Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
ve of -g3/3 - g2/2 + 84g. Determine n(y). -3 Let l(q) = -2q + 111553 - 223115 + 111534. Calculate l(-17). 6 Suppose 4t - 9 = 11. Let h(y) = -9 + 2 + t - 3y + 6. Give h(6). -14 Let g(k) = 5k2 - k - 1. Let h(i) = -3i*3 - 41i*2 + 13i - 5. Let f be h(-14). Suppose -fz + 11z - 3w + 14 = 0, w = -3z + 1. What is g(z)? 5 Let v be (18 + 246)8/6. Let p be (-31)/(-9) - 3 - v/(-99). Let n(q) = 3q2 + 7. Let h(g) = -g2 + g - 1. Let w(u) = 4h(u) + n(u). Determine w(p). 3 Let c(t) be the second derivative of t4/12 - 23t*3/6 + 33t*2 - t + 302. Determine c(21). 24 Let h = -136 - -92. Let w = 52 + h. Suppose wi + 0i - 8 = 0. Let k(v) = 3v - 1. Give k(i). 2 Let q(f) be the first derivative of 2f2 - 1/3f*3 + 172 + 10f. Suppose -2m + 0 = -w + 3, -2w - 4m = -22. Determine q(w). -11 Let d(n) = -21n + 872. Let p be d(41). Let b(t) = -t*3 + 11t*2 - 5t + 8. What is b(p)? -47 Suppose 371b - 81 = 368b. Let m(j) = 10j3 - 11j*3 - b + 6j2 + 35. Calculate m(6). 8 Let r(q) be the second derivative of -q5/20 + 29q4/12 + 31q*3/6 - 27q*2/2 - q - 115. Determine r(30). 3 Let m(p) = -32 + 16459p*2 - 9p + 3p - 16460p2. Give m(0). -32 Let f = 248 + -517. Let k = 262 + f. Let x(s) = -s2 - 6s - 4. What is x(k)? -11 Let d(o) = o3 - 17o*2 + 5o + 39. Let n(x) = x*3 - 18x*2 - 3x + 41. Let j(i) = 2d(i) - 3n(i). Calculate j(21). -87 Let a(j) = 4j - 109. Let y be 544/(-80) - -7 - 268/(-10). Determine a(y). -1 Let w(t) be the third derivative of -t5/60 - t4/8 - 1029t*2 - 2. Determine w(6). -54 Suppose -4s = -o - 40, 5s - 2o - 50 = -3. Let v(u) = -2u2 + 3u*2 - 9 + s - 6. Let k be (2/1)/40. Give v(k). -4 Let c(j) be the first derivative of -5j2/2 - 121j + 426. Calculate c(-25). 4 Let n(f) be the first derivative of f*3/3 - 5f*2 - 19f - 911. Determine n(14). 37 Let j be 513/57 - 6/1. Let h(n) = -n + 10. What is h(j)? 7 Suppose 12 = -3y, -10y + 5y = 5f - 210. Let v(o) = -2o3 + 93o*2 - 46o. Determine v(f). 0 Let h(f) = -f*2 - 2f - 1. Suppose 21v - 1798 + 854 = -860. What is h(v)? -25 Let o(c) = -3 - 1 + 2c + 8. Let k = 189 + -172. Suppose -k = 20i + 43. Determine o(i). -2 Let n(f) = -2197f + 733f - f2 + 18 + 721f + 724f. Give n(-15). 78 Let j(o) be the first derivative of 3o*2/2 - 46o + 815. What is j(10)? -16 Suppose -5r + 0x = -4x - 10, 3r + 2x = 6. Let w(s) = s - sr + 2 - 3s2 + s2 + s. What is w(2)? -6 Let k(z) = 12z + 45. Suppose 14s + 64s - 9 + 321 = 0. What is k(s)? -3 Let x = -7 - 5. Let u be (-540)/80 - (1 + 21/x). Let b(q) = -2q*2 - 8q - 8. Calculate b(u). -32 Let b(q) be the first derivative of q*5/60 + 5q*4/24 + 7q*3/6 + 51q*2/2 - 86. Let i(d) be the second derivative of b(d). What is i(-6)? 13 Let h(z) be the first derivative of -1/6z*4 - 4z - 18 + 0z2 - 1/10z*5 + 0z*3. Let q(o) be the first derivative of h(o). Give q(-2). 8 Let j(u) = u + 1. Let b be j(6). Let h(n) = 5n + 33. Let s(f) = -2f - 4. Let i(m) = h(m) + 4s(m). What is i(b)? -4 Let m(q) = -22 - 4q + 31 - 14 + 3q. Let g = 98 - 98. Calculate m(g). -5 Let p = -170 - -184. Suppose pb = 38b + 192. Let t(k) = k*2 + 7k - 2. Determine t(b). 6 Let h(w) = -w + 16. Let c(y) = -104y - 954. Let g be c(-9). Calculate h(g). 34 Let r be 3/1 + 2/(-2). Suppose 30 = 31m + 185. Let k(u) = 7u2 + 5u + 3. Let l(x) = x*2 + x + 1. Let a(i) = ml(i) + k(i). What is a(r)? 6 Let t = -1978 + 1979. Let s(m) = -12m - 1. Let h(l) = 27l + 2. Let y(b) = 2h(b) + 5s(b). Calculate y(t). -7 Let o(m) be the second derivative of m*4/6 - 2m*3/3 - 7m*2/2 + 141m - 8. Give o(3). -1 Let v(b) = -558b2 + 57b + 14 + 3 + 567b2. Calculate v(-6). -1 Let v be (2 + (-2 - 3))(-184)/24. Suppose v + 67 = 15i. Let u(o) = -o2 + 8o + 2. What is u(i)? 14 Let m = 10 + -6. Let x = 16 + 212. Let s(v) = -v + 461v2 - 228v2 - v3 - xv2. Give s(m). 12 Let m(l) be the first derivative of l5/40 - 19l*4/24 - 34l*3/3 - 18. Let q(x) be the third derivative of m(x). Let u be q(9). Let i(n) = n + 8. Give i(u). 16 Suppose 0 = -25x + 15 + 60. Let k(b) = -22bx + 2b - 85 + 42 + 42. Give k(1). -21 Let c be (-23)/(-7) - (-2)/(-7). Let j(b) = b*3 + 0b - cb2 - 2b + 2 + 4b - 3b. Let p be -7(-9)/105 + (-12)/(-5). Determine j(p). -1 Let q(n) = 6n + 32. Let b be -9 + 14 + 2 - 18. Give q(b). -34 Let y(k) = -33k2 - 21k - 1. Let a(o) = 49o2 + 30o + 1. Let c(n) = 5a(n) + 7y(n). What is c(1)? 15 Let n(t) = t*2 + 15t + 31. Suppose -4b - 46 = -2z, -b - 10 = -3z - 6. Let g be n(b). Let m(x) = 3x - 7. What is m(g)? 8 Let x(w) = 3w + 1. Let a(j) = 9j - 10. Let u(m) = -10m + 13. Let p(y) = -5a(y) - 4u(y). Let l(q) = p(q) + 3x(q). Give l(1). 5 Let q(p) = -p*2 + 2p. Let x(k) = -k*2 + 19k - 2. Let s(j) = j*2 + 3j. Let o(f) = -4s(f) + x(f). Let d(n) = o(n) - 6q(n). Calculate d(-3). 22 Let p(g) = 216g + 133. Let y(d) = -124d - 66. Let b(s) = -4p(s) - 7y(s). Determine b(16). -6 Let s(g) = g*2 + 8g - 14. Let p be 196/(-98) + -4 + (-6)/3. What is s(p)? -14 Suppose -512u = 16u - 1056. Let j(v) be the first derivative of -v4/12 - v3/6 + v*2 + v + 1. Let o(c) be the first derivative of j(c). Calculate o(u). -4 Suppose -7f - 316 = -10f + 4m, 0 = -3m - 3. Let y(k) = fk*2 - 208k*2 + 102k2. What is y(-1)? -2 Let n(m) be the third derivative of -m6/720 - 7m5/120 - 119m*4/24 - 101m*2. Let k(v) be the second derivative of n(v). Give k(-11). 4 Let i(r) = -2r*2 + 15r + 9. Let u(q) = -q*2 + 14q + 10. Let m(p) = 2i(p) - 3u(p). Suppose 70v - 2835 = 197v - 1311. Determine m(v). -12 Suppose 0 = 7m + m - 2m. Let h(z) be the second derivative of 1/2z2 + 10z + 5/6z3 + m. Calculate h(1). 6 Let i be 344/(-40) + (-2)/5. Let c = 6 + i. Let n(f) = -f - 7. Let h(w) = 3w + 29. Let x(r) = h(r) + 4n(r). Give x(c). 4 Let d(j) = 3j - 19. Let v(n) = -n + 9. Let m be 2/11 - 230/55. Let p(g) = md(g) - 9v(g). Suppose 39 = 49l + 235. Give p(l). 7 Let i(s) = s2 + 68s + 1. Let a(o) = -o*2 - 100o + 1. Let m(h) = -2a(h) - 3i(h). Calculate m(0). -5 Suppose -4q - i + 2 = 0, -335q + 4i - 8 = -336q. Suppose 0 = n - 4n + 60. Let r(z) = -n - 2z + z + 0z. Give r(q). -20 Let p(f) = -6f + 455. Let g be p(72). Let o(x) be the third derivative of 2x3 + 0x + 1/120x6 + gx*2 + 0 - 5/12x*4 - 2/15x*5. Give o(9). 3 Let d(b) = -2b*2 + 4b - 4. Let n = 29 - -16. Let k be (3/9)/(5/n). What is d(k)? -10 Let q(i) = 5i + 221. Let z(g) = -6g - 311. Let v(y) = 3q(y) + 2z(y). Give v(-16). -7 Suppose -2k + 14 = 2t, -21 = 17k - 20k - t. Let z(x) = 6x - 41. Calculate z(k). 1 Let t be 8/(-10) - 21/(-15)7. Let c(a) = -5a3 - 7a*2 + 5a - 2. Let u(n) = -22n3 - 28n*2 + 20n - 10. Let w(y) = tc(y) - 2u(y). Give w(-8). 26 Suppose 5 = -14k + 75. Let z(s) = -s2 + 5s - 5. Calculate z(k). -5 Let b(q) = q*3 + 6q*2 + 6q - 3. Let r(x) = 4x3 - 2x*2 - 8x - 2. Let w be r(-2). Let g = w + 44. Suppose -go = -20o - 10. Give b(o). -8 Let l(x) = x - 6. Let j(r) = -r*2 - 3r + 9. Let n be j(-4). Let w(k) = -k + 4. Suppose 13c = 19c - 48. Let v(z) = cw(z) + nl(z). Determine v(2). -4 Suppose 0 = -11m - 22. Let d(k) = -25k*3 - 19k*2 - 17k + 54. Let n(c) = -7c3 - 6c*2 - 6c + 18. Let q(h) = md(h) + 7n(h). Give q(5). 3 Let i(c) = 27c + 2. Let a be ((-85)/119)/((-10)/70). Determine i(a). 137 Let i(z) = -2z*2 - 9977 + 4982 - z + 4988. Calculate i(-4). -35 Let n(j) = -13j - 12. Suppose -5a = -4s - 42, -5a = -64s + 68s - 18. Calculate n(s). 27 Let j be (-42)/(-8) - 6/24. Let y(v) = -j - 2 + 5v + 2 - 3. Let z be y(3). Let b(u) = -u*3 + 6u*2 + 6u + 8. Calculate b(z). 1 Let p(g) = 3g3 - 21 + 0g*3 - 5g + 21g + 22g*2 - 2g*3 + 6g. Calculate p(-21). -42 Let n(h) = -3h3 + 3h*2 - 3h + 1. Let r(g) = g*3 + 10g*2 + 0g*3 + 18g - 28g + 9g - 8. Let d be r(-10). Give n(d). -17 Let k(j) be the second derivative of -j*3/6 + 25j*2/2 - 365j + 2. Give k(7). 18 Let p(u) = 13 + 180u + 162u + 177u - 694u + 178u. Determine p(-10). -17 Let m(i) be the third derivative of -i4/6 - 9i*2 - i. Let p be (-3)/((-1)/(-2) - 1). Give m(p). -24 Let b(m) be the second derivative of -1/20m**5 + 0 + 11/1	{ "pile_set_name": "DM Mathematics" }
exxx. Give prob of sequence xxx. 1/4 Three letters picked without replacement from {t: 1, b: 1, n: 2, i: 3, x: 3}. What is prob of sequence bxi? 1/80 Calculate prob of sequence hhrh when four letters picked without replacement from {h: 3, r: 2}. 1/10 Four letters picked without replacement from {f: 3, j: 17}. What is prob of sequence fjjj? 2/19 Three letters picked without replacement from dxrdcjdvdddrcd. What is prob of sequence ccv? 1/1092 Four letters picked without replacement from {y: 2, z: 5}. Give prob of sequence zyzy. 1/21 Calculate prob of sequence bb when two letters picked without replacement from bvbvvbbbbbbbbbbvbbbv. 21/38 Calculate prob of sequence oww when three letters picked without replacement from {o: 1, w: 16, b: 3}. 2/57 Three letters picked without replacement from {r: 3, h: 11, a: 1, u: 3, w: 1}. What is prob of sequence uaw? 1/1938 Three letters picked without replacement from daaayyy. What is prob of sequence aya? 3/35 Four letters picked without replacement from ssuussuusuususuu. Give prob of sequence uusu. 21/260 What is prob of sequence ecq when three letters picked without replacement from {r: 4, i: 2, c: 2, q: 2, e: 3}? 1/143 Three letters picked without replacement from jwvjjjqjr. What is prob of sequence wvq? 1/504 What is prob of sequence hxss when four letters picked without replacement from {s: 2, h: 1, x: 1, v: 1}? 1/60 Three letters picked without replacement from bbjbjtjjjjbtttbjb. What is prob of sequence jbj? 21/340 What is prob of sequence qnp when three letters picked without replacement from bppbbpqqlbbnpdb? 4/1365 Four letters picked without replacement from {g: 4, y: 2, u: 6, q: 3}. What is prob of sequence yqgu? 2/455 Four letters picked without replacement from aaaa. What is prob of sequence aaaa? 1 Two letters picked without replacement from {w: 1, c: 3}. Give prob of sequence cc. 1/2 Four letters picked without replacement from {c: 1, u: 7}. Give prob of sequence uuuc. 1/8 Two letters picked without replacement from {i: 1, l: 4, z: 4, n: 2}. What is prob of sequence nn? 1/55 Calculate prob of sequence aaa when three letters picked without replacement from {z: 2, a: 6}. 5/14 Three letters picked without replacement from qiishozs. What is prob of sequence ioh? 1/168 What is prob of sequence iuiu when four letters picked without replacement from iluuuuil? 1/70 Two letters picked without replacement from {e: 2, g: 6, u: 10}. Give prob of sequence ge. 2/51 Four letters picked without replacement from acaccvacvcgaegvcccc. Give prob of sequence veae. 0 What is prob of sequence xm when two letters picked without replacement from mxxxmxxxxmm? 14/55 Calculate prob of sequence qqh when three letters picked without replacement from {q: 5, z: 7, h: 8}. 4/171 Calculate prob of sequence nn when two letters picked without replacement from {c: 2, x: 3, n: 3}. 3/28 Calculate prob of sequence bc when two letters picked without replacement from {b: 1, d: 2, c: 4, w: 2}. 1/18 Three letters picked without replacement from wvqvvywvwyq. What is prob of sequence vyy? 4/495 Two letters picked without replacement from vnvfvvmbvmmbvvftb. What is prob of sequence bn? 3/272 What is prob of sequence vv when two letters picked without replacement from {v: 3, u: 1}? 1/2 Four letters picked without replacement from {z: 8, d: 5, v: 5, t: 1}. What is prob of sequence ddzv? 25/2907 Three letters picked without replacement from {y: 1, q: 1, s: 1, h: 1, g: 1}. Give prob of sequence gyh. 1/60 Two letters picked without replacement from oqfoooforrrro. What is prob of sequence rr? 1/13 Calculate prob of sequence evve when four letters picked without replacement from vzrzmmeerrvmmvmmvmm. 1/3876 Two letters picked without replacement from ydddvaydd. Give prob of sequence va. 1/72 What is prob of sequence ii when two letters picked without replacement from eseiissisiei? 5/33 Calculate prob of sequence usu when three letters picked without replacement from {u: 2, s: 4}. 1/15 Calculate prob of sequence mf when two letters picked without replacement from nmrgfng. 1/42 What is prob of sequence xv when two letters picked without replacement from vrxxjdddxrdrddrj? 1/80 Calculate prob of sequence ubub when four letters picked without replacement from {e: 1, b: 4, i: 6, u: 2}. 1/715 Calculate prob of sequence qqzz when four letters picked without replacement from qqzqzz. 1/10 What is prob of sequence ooo when three letters picked without replacement from ooxoxo? 1/5 Calculate prob of sequence asaa when four letters picked without replacement from saaasaassasass. 35/572 Calculate prob of sequence hf when two letters picked without replacement from {f: 1, h: 2, v: 1}. 1/6 Two letters picked without replacement from {a: 1, j: 11, m: 1, o: 2}. Give prob of sequence ma. 1/210 Two letters picked without replacement from igtivgiizgii. What is prob of sequence it? 1/22 Three letters picked without replacement from mmvmmllmmmmvllllvmvm. What is prob of sequence lmm? 3/38 Four letters picked without replacement from tttqttutttttqttgt. What is prob of sequence ttqg? 13/2380 Four letters picked without replacement from kkkkkmmmmmmmmmmmmmm. Give prob of sequence mmmm. 1001/3876 What is prob of sequence emyt when four letters picked without replacement from esetemtjjemeemmetytm? 7/5814 Three letters picked without replacement from {w: 3, u: 1, j: 1, z: 1, i: 1}. Give prob of sequence www. 1/35 Two letters picked without replacement from eeeixiixixeie. Give prob of sequence xi. 5/52 Three letters picked without replacement from dxdcddddd. What is prob of sequence dxd? 1/12 Two letters picked without replacement from {v: 2, o: 4}. What is prob of sequence ov? 4/15 Calculate prob of sequence uru when three letters picked without replacement from ururrrruurruuuuu. 3/20 Two letters picked without replacement from {n: 4, c: 16}. Give prob of sequence nc. 16/95 Calculate prob of sequence aap when three letters picked without replacement from ptpmrmrrrbtttra. 0 What is prob of sequence epep when four letters picked without replacement from peepp? 1/10 Two letters picked without replacement from ptstkyfy. Give prob of sequence fy. 1/28 Calculate prob of sequence hel when three letters picked without replacement from {j: 1, e: 1, h: 2, l: 1, s: 2, p: 1}. 1/168 Four letters picked without replacement from nnnnnnnqhtntqntnv. Give prob of sequence vntq. 1/952 Calculate prob of sequence gqob when four letters picked without replacement from {o: 1, b: 1, g: 7, p: 4, q: 3}. 1/2080 Two letters picked without replacement from {u: 10, o: 1, j: 4, l: 3}. What is prob of sequence uo? 5/153 Calculate prob of sequence pwww when four letters picked without replacement from vvwvwwvpvvvvwppw. 3/728 What is prob of sequence www when three letters picked without replacement from wwww? 1 Two letters picked without replacement from {j: 4, p: 5, y: 2}. What is prob of sequence jp? 2/11 Three letters picked without replacement from {g: 1, a: 1, z: 1, y: 3, o: 1}. Give prob of sequence oay. 1/70 Four letters picked without replacement from fsxxzhzzvzshzxhfsssz. Give prob of sequence zxxz. 1/646 Four letters picked without replacement from tctdz. What is prob of sequence tdcz? 1/60 Two letters picked without replacement from {f: 7, p: 4, m: 3}. What is prob of sequence ff? 3/13 Calculate prob of sequence ndyy when four letters picked without replacement from {n: 1, y: 2, p: 3, d: 1, u: 3}. 1/2520 Three letters picked without replacement from nnmmnnmnt. What is prob of sequence mnt? 5/168 What is prob of sequence gwm when three letters picked without replacement from ggmcjwd? 1/105 Three letters picked without replacement from {e: 5, c: 3, a: 8}. Give prob of sequence eae. 1/21 Two letters picked without replacement from xyixixdxxxizgixxxxi. Give prob of sequence zg. 1/342 Two letters picked without replacement from bcbbabkk. Give prob of sequence ac. 1/56 Two letters picked without replacement from defefqqz. What is prob of sequence ze? 1/28 Calculate prob of sequence lk when two letters picked without replacement from {o: 1, l: 5, n: 4, k: 2, b: 3, p: 5}. 1/38 What is prob of sequence bbb when three letters picked without replacement from {n: 3, k: 1, b: 5, s: 3, q: 3}? 2/91 Calculate p	{ "pile_set_name": "DM Mathematics" }
2, 5864, 5914? 5998 What is the next term in 229, 1693, 5667, 13405, 26161, 45189, 71743, 107077? 152445 What is the next term in 7660, 15253, 22848, 30445, 38044? 45645 What is the next term in -50735, -101466, -152185, -202886, -253563, -304210? -354821 What comes next: 686, 1388, 2090, 2792? 3494 What is the next term in -1346, -5411, -12202, -21731, -34010, -49051, -66866, -87467? -110866 What comes next: 10639, 10657, 10673, 10687, 10699? 10709 What is next in -522, -150, 222, 594, 966? 1338 What comes next: 17250, 17236, 17200, 17130, 17014, 16840, 16596, 16270? 15850 What is the next term in -272, -525, -748, -941, -1104, -1237? -1340 What is next in 108704, 108695, 108680, 108659, 108632, 108599, 108560? 108515 What is the next term in -30028, -30156, -30364, -30658, -31044? -31528 What comes next: -24023, -24053, -24083, -24113, -24143, -24173? -24203 What is the next term in 58, -1, -124, -341, -682? -1177 What is the next term in 51, 76, 141, 264, 463, 756, 1161? 1696 What is next in 6166, 12353, 18538, 24721? 30902 What comes next: 11960, 23922, 35884, 47846? 59808 What comes next: 2954, 2945, 2936? 2927 What is the next term in -825, -3317, -7467, -13275? -20741 What comes next: 1, 77, 181, 307, 449, 601? 757 What comes next: 31490, 63064, 94638, 126212, 157786, 189360? 220934 What is next in -3787, -3749, -3707, -3661, -3611? -3557 What is the next term in -254, -365, -476, -587, -698? -809 What is next in -4198, -8398, -12600, -16804, -21010, -25218, -29428? -33640 What comes next: 436, 932, 1476, 2062, 2684, 3336, 4012? 4706 What is next in -2276, -2307, -2348, -2393, -2436, -2471, -2492? -2493 What comes next: 2786, 5397, 7824, 10055, 12078, 13881? 15452 What comes next: -91083, -182167, -273251, -364335, -455419, -546503? -637587 What is the next term in 806071, 806072, 806073, 806074, 806075? 806076 What is the next term in -102, -124, -82, 60, 338, 788, 1446, 2348? 3530 What is the next term in 166, -3, -172, -341? -510 What comes next: 559, 2244, 5055, 8992? 14055 What comes next: 19591, 19388, 19049, 18574? 17963 What comes next: 807, 1348, 1879, 2394, 2887, 3352, 3783? 4174 What comes next: 56026, 112049, 168068, 224083, 280094, 336101, 392104? 448103 What comes next: 11915, 11917, 11919? 11921 What comes next: 559, 2189, 4913, 8737, 13667, 19709, 26869, 35153? 44567 What comes next: 527, 428, 331, 236, 143, 52, -37? -124 What comes next: -159715, -159712, -159709, -159706, -159703, -159700? -159697 What is the next term in -201637, -403272, -604907, -806542, -1008177, -1209812? -1411447 What is the next term in 157, 321, 485, 649, 813? 977 What is next in 89416, 89420, 89426, 89434, 89444, 89456, 89470? 89486 What is the next term in -988, -1998, -3008, -4018, -5028, -6038? -7048 What is the next term in 38956, 38952, 38948, 38944? 38940 What is next in -32, -37, -38, -35? -28 What is the next term in -68, -169, -472, -1079, -2092, -3613, -5744, -8587? -12244 What is next in 30047, 30071, 30109, 30161, 30227? 30307 What comes next: 1017, 1087, 1277, 1647, 2257, 3167? 4437 What comes next: 272, 1095, 2464, 4379, 6840, 9847, 13400? 17499 What is next in -113, -856, -2099, -3842? -6085 What is next in -17030, -17024, -17018, -17012, -17006, -17000? -16994 What is next in 1354, 2678, 4002, 5326, 6650? 7974 What is next in -936, -1911, -2892, -3879, -4872, -5871, -6876? -7887 What is next in 264765, 529531, 794295, 1059057, 1323817? 1588575 What is next in 98810, 98814, 98820, 98828, 98838, 98850? 98864 What is the next term in -390, -580, -900, -1350? -1930 What is next in -129121, -129114, -129107, -129100, -129093, -129086? -129079 What comes next: -2139, -3079, -4031, -5001, -5995, -7019, -8079? -9181 What is next in -1273, -1565, -1859, -2155? -2453 What is next in 1512589, 1512581, 1512561, 1512523, 1512461, 1512369? 1512241 What is the next term in -3478, -13871, -31190, -55429, -86582, -124643, -169606? -221465 What is next in 19004, 37996, 56990, 75986, 94984, 113984? 132986 What comes next: -707, -1419, -2123, -2819, -3507, -4187? -4859 What comes next: -6415, -12807, -19199, -25603, -32031, -38495, -45007, -51579? -58223 What is the next term in -2047, -2014, -1959, -1882, -1783? -1662 What is next in -205, -149, -61, 59, 211, 395, 611? 859 What is next in 351, 821, 1287, 1749, 2207, 2661? 3111 What is the next term in -23, -174, -459, -878? -1431 What comes next: 1631, 6412, 14381, 25538, 39883? 57416 What is next in 790144, 790141, 790136, 790129? 790120 What is the next term in 3596, 6520, 9454, 12404, 15376, 18376, 21410? 24484 What is the next term in -11, -38, -65, -80, -71, -26, 67, 220? 445 What is next in 19401, 19396, 19389, 19380, 19369, 19356? 19341 What is the next term in 131977, 131976, 131975, 131974, 131973, 131972? 131971 What comes next: -73, -40, -7? 26 What is next in 33, 108, 255, 510, 909, 1488? 2283 What comes next: -29006, -232014, -783020, -1856024, -3625026? -6264026 What is the next term in -2520, -5345, -8170, -10995, -13820? -16645 What is next in 2820698, 2820699, 2820700? 2820701 What is the next term in 14910, 14905, 14902, 14901, 14902? 14905 What is next in 65, -10, -553, -1906, -4411, -8410, -14245? -22258 What comes next: -4475, -9500, -14525? -19550 What comes next: 1273, 2476, 3679, 4882, 6085? 7288 What is next in -1377, -1371, -1361, -1347, -1329, -1307, -1281? -1251 What is next in -732, -1159, -1590, -2025, -2464, -2907? -3354 What comes next: 6124, 6122, 6124, 6130, 6140, 6154? 6172 What is the next term in -23096, -23068, -23030, -22976, -22900, -22796? -22658 What comes next: 76, 335, 782, 1423, 2264, 3311, 4570? 6047 What comes next: 19622, 78510, 176656, 314060, 490722? 706642 What is next in 720, 1616, 2682, 3918? 5324 What is the next term in 5228, 5221, 5214, 5207? 5200 What is next in 4586528, 4586527, 4586528, 4586531, 4586536, 4586543? 4586552 What comes next: 316, 1059, 2298, 4033, 6264? 8991 What is next in -50, -60, -70, -80, -90? -100 What is next in 26145, 104557, 235245, 418209, 653449, 940965? 1280757 What is the next term in -147, 57, 259, 459, 657, 853? 1047 What is next in -118, -60, 40, 188, 390, 652, 980? 1380 What is the next term in 45803, 45802, 45801, 45800, 45799, 45798? 45797 What is the next term in -5454, -10925, -16396, -21867, -27338, -32809? -38280 What is next in -291101, -582204, -873307, -1164410, -1455513, -1746616? -2037719 What comes next: 427, 1653, 3697, 6559? 10239 What is next in -33774, -33773, -33772, -33771, -33770? -33769 What comes next: 7193, 7234, 7295, 7370, 7453, 7538, 7619? 7690 What comes next: 251876, 503751, 755626, 1007501? 1259376 What is next in 132929, 132912, 132881, 132830, 132753, 132644, 132497? 132306 What comes next: 1669, 3362, 5055, 6748, 8441, 10134? 11827 What comes next: 144, 371, 758, 1311, 2036, 2939, 4026? 5303 What is the next term in -23924, -23920, -23912, -23900? -23884 What is the next term in 2202, 2162, 2124, 2088, 2054, 2022, 1992? 1964 What is the next term in -429, -523, -617, -711, -805? -899 What is next in 147, 241, 501, 1011, 1855? 3117 What is the next term in 9, 20, 35, 60, 101, 164? 255 What is next in 304918, 304920, 304922? 304924 What comes next: 163035, 163034, 163033, 163032? 163031 What comes next: -9345, -18693, -28041, -37389? -46737 What is the next term in 830, 1709, 2654, 3671, 4766, 5945, 7214, 8579? 10046 What is next in 1403940, 2807878, 4211816, 5615754, 7019692? 8423630 What is next in -827, -865, -903, -941, -979, -1017? -1055 What is the next term in -40925, -81903, -122879, -163853, -204825, -245795, -286763? -327729 What is next in -1624, -1620, -1616, -1612, -1608? -1604 What is next in 17086, 17122, 17158, 17194? 17230 What is next in 589, 1138, 1663, 2152, 2593, 2974, 3283? 3508 What is the next term in 156021, 312040, 468059, 624078, 780097, 936116? 1092135 What comes next: 475, 476, 475, 466, 443, 400, 331? 230 What comes next: -93379, -186748, -280119, -373492, -466867, -560244? -653623 What is next in 44, 81, 140, 239, 396, 629? 956 What comes next: 511, 974, 1441, 1912, 2387, 2866? 3349 What is next in -36278, -145139, -326574, -580583? -907166 What comes next: 5442, 21889, 49300, 87675, 137014, 197317, 268584? 350815 What comes next: -1500, -6039,	{ "pile_set_name": "DM Mathematics" }
+ 14s2 - 14s + 17. Let g be a(-15). Is 2165807/116 - g/(-8) prime? True Let t(o) = 2o3 + o2 + o. Let h be t(0). Suppose h = -2w + 5 - 1. Suppose -1197 - 1525 = -wq. Is q prime? True Let r be (-3)/6-2283. Suppose 804 + r = 6f. Is f a composite number? False Suppose -2y + 2p + 2p = -10, 0 = 5p. Suppose l + yk - 8k - 1206 = 0, -l + 1200 = 3k. Is l a composite number? True Suppose -x + 19 - 25 = 0, -2m = x - 48032. Is m a composite number? False Let x(f) = f*2 + 345f - 1671. Is x(137) a composite number? True Let r(s) = 5s3 - 3s2 + s - 11. Let q(w) = -w3 + w + 1. Let o(c) = -2q(c) + r(c). Let m be o(6). Suppose x = 2x - m. Is x prime? False Let h(d) = 2d2 + 52d + 47. Let l be h(-18). Let a(m) = 872m. Let k be a(1). Let f = k + l. Is f prime? True Let s = 358 - 347. Suppose -sg + 894 = -5g. Is g composite? False Let q = 8858 + -6128. Suppose -3v - 5438 = -4w, 12w - 14w + q = 4v. Is w a prime number? True Let b(i) = 3770i2 - 2. Let l be b(-1). Suppose -4o = 3x - 3775, -4o = -3x - o + l. Is x a composite number? True Let v = -19686 - -64175. Is v prime? False Suppose 10a = 9a + 10. Is 134((-4)/10 + 14/a) a prime number? False Let h(y) = -y + 4. Let x(o) = 41o + 102. Let v(r) = -3h(r) + x(r). Is v(13) prime? False Let y(x) = 419x2 + 8x - 18. Let l be y(-6). Let d = 709 + l. Is d prime? True Let o = 129 + -84. Suppose -b + 6426 = 5b. Suppose 5u + 4r = o + 1008, -5u + 2r + b = 0. Is u prime? False Suppose 2135 = 3v + 4f, -v + 15f - 12f = -716. Suppose 1800 = 5h - 5g, -5h - 5g = -3h - v. Is h a prime number? True Suppose 13n = 18n - 4c - 561999, 224800 = 2n - 2c. Is n composite? True Let p be -1(-6 + 5)-1. Let g(z) = -6175z + 4. Is g(p) prime? False Suppose -6f + 16 = -32. Let g(m) = 10m*2 + m - 15. Let p be g(f). Is (7 + -8)/((-3)/p) composite? False Is (-2)/(-4)(-2270372)/(-26) a composite number? False Let h(n) = -n*3 + 14n*2 - 12n - 8. Let v be h(13). Suppose 6d - 17 + v = 0. Suppose -1088 - 302 = -dp. Is p prime? False Let b(t) = 250t + 140321. Is b(0) composite? False Let n = 71941 + 8602. Is n composite? True Is (-198)/(-24) - (-1 + 8) - (-1884375)/4 prime? False Let h(t) = -t3 - 12t*2 + 10t + 8. Let b be h(-12). Let k be 2/(-10) - b/35. Suppose j - 820 = -kj. Is j a composite number? True Let s(r) = 36r + 56. Let i(j) = -19j - 28. Let y(c) = -9i(c) - 4s(c). Let g(o) = o2 - 3o + 3. Let a be g(4). Is y(a) composite? True Let i be (3 - 248/88) + (-62)/(-22). Suppose -r - 9 = 5m, 0m - 16 = ir + 4m. Is (6/r)/((-1)/(-6 + 1148)) a prime number? False Suppose -12g + 1 + 11 = 0. Let r(n) = 6195n - 2. Is r(g) a prime number? False Let r = 42560 - 24909. Is r a composite number? True Let o(a) = -17112a - 1561. Is o(-12) a composite number? True Suppose -406q = -408q + 1434. Suppose -4j + 287 = -q. Is j prime? True Is ((-174798568)/(-98) - -44) + (2/14 - 0) prime? False Let p = 44 - 45. Let u be ((-702)/(-8) + p)4. Suppose 3s - 5264 = -u. Is s a composite number? True Suppose c - 20493 = -2f, 28c + 5f - 102425 = 23c. Is c prime? True Suppose 7o + 9 = 10o. Suppose -13 = 2u + 5t, 3u - ot = t + 15. Is 753 - (-8)/(-4 + 0)u a composite number? False Let x(p) = p2 + 19p*3 + 253 - p - 257 + 2p*2. Is x(3) composite? True Let g(z) be the first derivative of 23z4/4 - z3/3 - 3z2/2 - 7z + 48. Is g(4) composite? True Let p be (-70)/(-8) - (-60)/48 - 6. Let m(r) = -r*2. Let s(b) = 17b*3 - 7b*2 - 3b + 13. Let j(d) = -2m(d) + s(d). Is j(p) a composite number? False Suppose -5n + 0n = -10. Let j be (-1 - -2)/(n/(-258)). Let x = 240 + j. Is x prime? False Let m(l) = 1923l3 - l2 + 8l - 21. Let i be m(2). Is i + 2 + 1 + -7 a prime number? False Let o(m) = 313m + 2825. Is o(92) a composite number? True Suppose 6777843 = -46739c + 46742c. Is c prime? True Let d(n) = -39 - 33 + n + 74. Let y be d(-1). Is -1 + y - (-1660 - (-3 + 0)) composite? False Let a(u) = u*2 + 8u + 1. Let v be a(-8). Let y be -32/18-15v. Suppose 4m + 4o + 57 = ym, o = 4m - 213. Is m a composite number? False Let i be (-14)/4(-4)/(-7). Let q be i + (-5 + 1 - 4798). Is (3/(-6))/(2/q) prime? True Let d = -98339 - -284716. Is d prime? True Suppose 0p + 18p = 24948. Let i = p - -71. Is i a prime number? False Suppose 3054j - 3033j - 3619749 = 0. Is j prime? False Suppose -121i + 182 = -114i. Is (-4 - (-5)/(40/i))-2276 prime? False Let m be ((-126)/(-147))/((-2)/(-7)). Let l(n) = 64n*3 - 5n + 4. Is l(m) a prime number? False Let w(h) = h*3 + 20h*2 - 85h - 75. Is w(-19) a composite number? False Suppose 0 = -283x - 1254245 + 174539956. Is x a composite number? False Let o(g) = g2 + g + 47. Suppose -3r - 168 = -10r. Is o(r) composite? False Suppose -14a + 15 = -11a. Let o = -91 - -169. Suppose ay = -3 + o. Is y a prime number? False Let s(q) = 397q2 + 20q + 28. Let j be s(-6). Let c = j + -6383. Is c a composite number? False Let y(g) = g*3 + 6g*2 + 3g - 6. Let t be y(-5). Suppose 4w - z - 2 = 17, -tw + 4z = -28. Suppose -m + 4 = 2, -wm - 3258 = -2c. Is c prime? False Let y(h) = h3 + 156h*2 - 228h + 104. Is y(-57) prime? True Suppose -89r + 2050 = -99r. Let j(o) = -o + 6. Let m be j(6). Is -2 + r/(-1) + (m - 1) a prime number? False Let a(b) = b*2 + 18b + 38. Suppose 3q = 3o + 2o + 86, 12 = -o - 2q. Let p be a(o). Suppose -2016 = -3l + 3y, -5l = -pl - 2y + 663. Is l composite? True Let m(r) = 12r*3 - 3r*2 + 12r + 30. Let p(l) = -l3 - l2 - l. Let w(o) = m(o) + 4p(o). Is w(7) composite? True Let w be (160/(-15))/8 - (-41809)/3. Let r = w - 8198. Is r a composite number? False Suppose -3391 = -6t + 29. Suppose -t = -n - 2097. Let p = -706 - n. Is p a composite number? False Suppose 31m + 162 = -6f + 36m, -5f = m + 135. Is ((-192369)/f - 7) + (-4)/(-18) prime? False Let l(u) = 224u - 19. Let q be l(3). Let y be q - -3 - (3 + -2). Suppose -y = -6w + 1877. Is w prime? False Let x = -2466 + -1851. Let t = -1822 - x. Is t a composite number? True Suppose 3y + 4382 + 13889 = 2k, y = 3. Let l = 23382 - k. Is l a prime number? False Let f = -77317 - 17285. Let j = 137107 + f. Is j a prime number? False Let k(b) = -b*2 + 12b - 11. Let c be k(4). Is (-47390)/(-15)c/14 composite? True Suppose 4c = -4n + 24, c + 1 + 5 = 3n. Let t be (24/5)/(n/(-150)). Let v = 451 + t. Is v a composite number? False Let t be (-76)/(1 + -5) + (2 - 0). Let j be 10/3 - (3 - 56/t). Suppose 0 = 4r - jr - 3155. Is r a composite number? True Is (-28 - -18 - -13) + 67444 a composite number? False Suppose -24f = -3f - 231. Let r(j) = 5j - 2j*2 + 45j*3 - 44j*3 + 0 - 3. Is r(f) composite? True Let s(x) = 20x + 92. Let v be s(-5). Let h(n) = 25n2 + 14n + 29. Is h(v) prime? False Let l = 69 + -54. Suppose -7k + lk = -1536. Let n = k - -403. Is n a composite number? False Let o = 431 - 252. Let v = 246 - o. Is v prime? True Let l(n) = n*3 - 4n*2 - 5n + 2. Let d be l(5). Suppose -ds = -4004 + 1194. Is s prime? False Suppose -d = 4z + 21, -7d + 3z + 2 = -5d. Let j be -4614((-16)/(-40) + 7/d). Suppose -2o - h = -3083, -3o = -h + 6h - j. Is o a prime number? True Let f = 251747 + -148780. Is f composite? False Let z(w) = 2866w*2 + 10w + 2. Let c be z(-4). Suppose -10855 = -27s + c. Is s a prime number? True Let v = -5471 + 36948. Let n = v - 21446. Is n a prime number? False Suppose 0b + 5b + 4x = 654041, 5b - 654021 = x. Is b composite? True Let v(z) = -2z*2 - 10z - 3. Let p be v(-3). Suppose pr - 7681 = 3425. Is r a composite number? True Suppose -107q + 104q = -14466. Suppose 6a - q = 7016. Is a prime? True Is (7 - (-6)/(-1))/(5/59965) a composite number? True Suppose 0 = 2i - 0i + u + 5, -15 = -4i + 3u. Suppose 239q - 240q + 3251 = i. Is q a composite number? False Suppose 223z - 663529 = -256331. Let r(l) = 16l - 3. Let x be r(6). Let q = z - x. Is q a composite number? False Suppose -37 - 19 = -7h. Suppose 0 = 4n + h, z + 2n = 5z - 952. Suppose o + 4s - 211 = 0, 0 = 4o - 2s - 1045 + z. Is o composite? True Let n = -37 - -47. Suppose n = 9h - 17. Is 314 - (h + 3 + -6) composite? True Let t(c) = -37c - 74. Let p be t(-19). Suppose -3j + 364 = -p.	{ "pile_set_name": "DM Mathematics" }
+ 112.8. Let i = -2.9 - s. Let y = i - 7. What is the biggest value in -0.4, y, 0? y Let f = 38 + -43. Let z = -1.1 - -0.1. Let h = z + 5. What is the biggest value in f, h, -0.3? h Let m = 156 - 163.3. Let l = m - -7. Which is the third biggest value? (a) l (b) 4/5 (c) 1/3 a Suppose 0 = -3n + 15, 3n = -4c + 2c - 135. Let o be 1/(-2 - c/39). What is the third smallest value in -4, o, -1/2? -1/2 Let y = -0.05 + 0. Let v = y - 0.25. Let c = 1 - 1. What is the biggest value in c, v, -4? c Let c = 31 - 30. Let w = 0.07 - -0.43. What is the smallest value in c, -4/5, w? -4/5 Suppose -u - 8 = u. Let l = -41 + -147. Let o = l - -1313/7. Which is the third smallest value? (a) o (b) 4 (c) u b Let u = 66 + -67. Which is the third smallest value? (a) 3/4 (b) 2/23 (c) 0.5 (d) u c Let v = 0.55 + -0.65. Which is the second biggest value? (a) -3 (b) 0.5 (c) v (d) 5/4 b Suppose 6 = 4l - 2. Let k = -0.45 - -0.75. Which is the second smallest value? (a) 3/4 (b) l (c) k a Suppose 0 = -y - 2y. Let z = -2 + y. What is the second biggest value in -0.2, z, 2? -0.2 Let h = -80 + 83.3. Let g = h + -0.3. Let j = g - 4. Which is the third biggest value? (a) 3/7 (b) j (c) 0.1 b Let o = -0.25 + 0.05. Let z = 0.1 + 0.2. Let t(g) = 2g2 + 9g - 4. Let r be t(-5). Which is the biggest value? (a) z (b) r (c) o b Let p = -3.04 - -0.04. Let g = p + 1. Let o = -47/3 - -16. Which is the third smallest value? (a) g (b) 0 (c) o c Let u be 3 - (-1 - (-2 - -2)). Let i be (-1)/2 + u/12. What is the biggest value in 4, i, -1? 4 Let q = 4 + -3.9. Let f = 0.15 + -0.85. Which is the second smallest value? (a) f (b) q (c) 4 b Let t = 6.97 + -7. Let l = t - -1.03. What is the second smallest value in 1/4, -0.4, l? 1/4 Let h = -15 + 14.6. Let l = -5 - -4.7. What is the biggest value in h, 0.5, l? 0.5 Let d be 1/2 + 1554/(-1860). Let i = -2/31 + d. Which is the biggest value? (a) 3/2 (b) -4 (c) i a Let o be ((-3)/(-38))/(6/8). Let w = -22.3 + 22. Which is the smallest value? (a) 2 (b) o (c) w c Let x = 0.21 - 0.21. Let d = 0.4 - 0.5. What is the third biggest value in x, -0.04, d? d Let z = -0.499 - -0.399. Let f = -1527/11 - -139. Which is the biggest value? (a) f (b) z (c) 2/17 a Let x = 13/14 + -3/7. What is the third biggest value in x, -0.2, -0.4? -0.4 Let l(n) = -2n + 4. Let w be l(2). Let t = -1 - -5. Let q be (-6)/30 + t/(-5). Which is the biggest value? (a) q (b) w (c) -2/13 b Let d = 3 + 20. Let n be -2 + 4 + (-40)/d. Let s = n - -4/161. Which is the second smallest value? (a) -3/5 (b) 1 (c) s c Let f = 12 - 11.93. Which is the second smallest value? (a) 2 (b) -5/2 (c) f c Let v = -0.5 - -1.5. Let y be -3 + 0 - 0/(-3). What is the biggest value in 1/6, y, v? v Suppose -1 = x + 2m + 5, -3x - 4m = 16. What is the third smallest value in 1, -2/5, x? 1 Let v(p) = p*2 - 12p + 10. Let w be v(8). Let r be (-3 + (-74)/w)/(-2). What is the second biggest value in -1, 1, r? r Suppose 0s = -4s - i - 1, 3s - 4i - 4 = 0. Let d = s + 2. Which is the smallest value? (a) d (b) 1 (c) -8 c Let i = 15 + -10. Which is the third smallest value? (a) 0.5 (b) -1/10 (c) i (d) -5 a Let s = -0.26 - -0.06. Let i = 1 - -3. Suppose 5f - 2 = 2q, 0 = if + f + 2q + 2. Which is the smallest value? (a) 4 (b) s (c) f b Let j = 1.9 + -0.9. Which is the third smallest value? (a) -5 (b) j (c) -0.2 b Let q be 49/(-70) + (-2)/(-10). What is the second smallest value in q, 0.5, 0? 0 Let y = -5 + 23/5. What is the biggest value in -1, 2, y? 2 Suppose -2o + 3n - 13 = 0, -4n + 0 = 5o - 2. Let q = 404.07 + -401. Let t = -0.07 + q. What is the third biggest value in o, -0.1, t? o Let h = 7 + -7.3. Let j be (3/(-3) - -1)/(-2). What is the third biggest value in 3, j, h? h Let p = 9 + -8. Which is the third biggest value? (a) 2 (b) p (c) -4 c Let k be ((-20)/40)/((-1)/(-2)). Which is the biggest value? (a) 2 (b) k (c) 0 a Let l = -15 + 19. What is the second biggest value in 0.07, -0.2, l? 0.07 Let j = -90 + 89.6. Which is the third biggest value? (a) j (b) 4 (c) 5 a Let s = 28.5 + -28. What is the third smallest value in -5, s, -4? s Let p be 3/(-12) - 6/(-56). Let w(k) = k + 9. Let i be w(-9). What is the second biggest value in i, 3, p? i Let f = 5/27 - 79/135. Which is the smallest value? (a) -0.5 (b) -12 (c) -0.2 (d) f b Let x = -145.5 - -146. Let h = 10 - 15. Which is the second smallest value? (a) -0.5 (b) x (c) h a Let o = -0.862 + -0.138. Which is the smallest value? (a) 41 (b) -4 (c) o b Let n be 5/12 + 2/8. Let l(k) = k - 4. Let g be l(3). Let w be g/22 - -3. Which is the third smallest value? (a) n (b) -0.1 (c) w c Let s = 1 + -0.8. Let a(r) = -r2 - 11r + 9. Let g be a(-12). What is the second biggest value in s, -0.4, g? -0.4 Let n = 0.1 - -0.9. Let g = 2.6 + -6.6. Let f be (-2)/(-8) + (-2)/24. Which is the second biggest value? (a) n (b) f (c) g b Let u = -3 - -6. Suppose uw - 7w + 8 = 4m, -22 = -5w + m. Let d be 4/22 - 21/77. Which is the third biggest value? (a) d (b) 1 (c) w a Let b = 0.5 + -0.8. Let k = -1 + 1.4. Let x = k + b. What is the third biggest value in x, -1, 4? -1 Let k = 44 - 44. Let x(v) = -v*3 - 3v*2 - 2v + 2. Let z be x(-2). Suppose k = -0u - zu - 4. Which is the smallest value? (a) -2/13 (b) u (c) -0.3 b Let p = 0.3 + -0.2. Let k = -2.21 - -1.71. What is the biggest value in k, 3, p? 3 Let q = -15 - -15.05. What is the smallest value in q, -0.3, -4? -4 Suppose -2q - 3q + 17 = 4v, 2q - 3v - 16 = 0. Let j be (-1)/q - 17/(-35). Which is the third biggest value? (a) -0.2 (b) 1 (c) j a Suppose 3m + 0 = 4z - 1, -5z - 3m = -35. What is the third biggest value in -0.3, z, 0.3? -0.3 Let s = -137/189 - -17/27. Suppose -4l + 1 - 9 = 0, -5q + 16 = 2l. Let g be q/10 + 18/(-18). What is the third biggest value in -1, g, s? -1 Let n = 2.07 - 2.2. Let m = n + -0.37. Which is the second smallest value? (a) -4 (b) m (c) 1 b Let u = -5 - -5.4. Let h = 0.5 + 0.3. Let c = h + -0.5. What is the second biggest value in c, 0.1, u? c Let o be ((-11)/(-3))/(2/(-12)). Let z = o - -65/3. Let d be (-15)/(-10)2/6. What is the third smallest value in d, z, -0.2? d Let d = -2 - 1. Let q = d + 3.1. Suppose 14l + 2 = 16l. Which is the smallest value? (a) l (b) q (c) -1/4 c Let v be 6 - -310/(-15). What is the third smallest value in 5, -2, v, 0.2? v Let z = -1.313 + 0.313. Let q = -2 + 2. Let y = 129 + -391/3. Which is the second biggest value? (a) z (b) q (c) y a Let f = -3.3 + 3.3. Which is the biggest value? (a) f (b) -3 (c) 0.5 c Let q = 0.39 + -0.59. Let h = -1 - -1.1. What is the third biggest value in q, -5, h? -5 Let y = -10 + 5. Let h = -0.06 - 1.94. Let g = h + 3. What is the third biggest value in 1/2, y, g? y Let w = 23 - 17. Let i = w + -9. What is the second smallest value in 1, -0.5, i? -0.5 Let s be ((-84)/9)/(-4) - 3. What is the biggest value in -1/2, 0.1, s? 0.1 Let j = 37 - 23. Let r = j + -15. What is the third smallest value in -3, r, -0.3? -0.3 Let n = 11 - 11. What is the biggest value in n, -0.2, -2? n Let t be (-2)/(-4) + 5/10. What is the third biggest value in t, 2/9, -0.2, 2? 2/9 Suppose 0n + 4n - 2n = 0. Which is the third biggest value? (a) n (b) -0.09 (c) -0.4 c Let y = -100 + 99.8. Let v = 1.3 - 0.3. What is the third biggest value in y, 0.3, v? y Let j = -2/45 + 32/45. Let d = 109/24 + -14/3. Which is the third biggest value? (a) j (b) d (c) 3 b Let l = -1.96 + -0.04. Let d = -1 - l. Let x(j) = -j3 + 2j*2 - 3j + 15. Let w be x(3). What is the smallest value in w, -5, d? -5 Let v be 0 + (-3)/(18/(-4)). Let u = -0.18 + 0.29. Let h = -0.01 + u. What is the third biggest value in h, 5, v? h Let u = 6.3 - 7. Let o = u - -2.7. Which is the second smallest value? (a) o (b) -1/13 (c) -5 b Let z be (3/153)/((-6)/18). Which is the fourth biggest value? (a) z (b) 4 (c) 0 (d) -0.5 d Let x = 0.05 - 2.05. Let d = x - -1. What is the third biggest value in 0, -0.1, d? d Suppose 5k = -5u, -k - 2 = -2u + 10. Suppose -12 = -uc - 28. Let d = -174/77 - -28/11. What is the biggest value in 0.5, c, d? 0.5 Let r be (28/(-35))/(18/(-15)). Let w = -0.9 - -0.6. Which is the third smallest value? (a) r (b) 2/9 (c) w a Let u = -14.7	{ "pile_set_name": "DM Mathematics" }
olve 5h - 161 = -o, 3h - 3o - 267005 = -266894 for h. 33 Solve 0 = 5l + 311253w - 311250w + 117, 5l + 36w + 249 = 0 for l. -21 Solve 56w + 2t = 59w - 16, 2 + 1 = 3t for w. 6 Solve j - 3u = -j + 104, 5j - 4u - 25021 = -24880 for j. 1 Solve -2h - 4c + 3 = -7c - 2, -86 + 1 = 3h - 23c for h. 10 Solve 81r - 71r + 4q + 42 = 0, -3r + 40 = 4q + 89 for r. 1 Solve u - 62 - 95 = -3n, -37n - u + 1959 = 0 for n. 53 Solve 5i - 1152 = 128m, 20m - 40m = -5i - 17m + 27 for i. 0 Solve -10p + 6h = 23p + 4p + 358, p - 5p - 50 = -0p + 5h for p. -10 Solve 36r - o + 75 = 20r, 7r - 5o = -10 for r. -5 Solve -8p + 25p - 2n = 41, -2n + 13n - 93 = p - 41 for p. 3 Solve -25d + 3o = -17d + 377, 513d = 516d + 5o + 123 for d. -46 Solve 4u + 4 = 3g, -u + 3g + 6442 - 6434 = 0 for u. -4 Solve s = 3, 4a - 8a + 4s - 30 = -52 + 46 for a. -3 Solve -2w + 5 = 4x - 61, 3x = 4x + 3w - 9 for x. 18 Solve -3p - 23 = -2q, -3122 = -4p + 5q - 3162 for p. -5 Solve -28r + 2x + 150 = 0, r - 3x - 858 = -838 for r. 5 Solve 10m + j - 27 - 11 = 3j, -2j = 10j - 12 for m. 4 Solve -3k - 12n + 14 = 3k - 8n, 0 = -4k + 3n + 15 for k. 3 Solve -36 = -2x + 8c - c + 11c, -12 = -x + 3c for x. 9 Solve -18k - 19 + 39 = -17k - 2i, -2k = -5i - 45 for k. 10 Solve -4j = 2f - 24, 121 = 5j - 2785f + 2794f for j. -1 Solve 3c + 0n + 2n - 4n - 24 = 0, 141948c - 3n = 141951c - 2n - 33 for c. 10 Solve 1 = -b - 3f, -4f + 9 = 30 - 29 for b. -7 Solve -5k = -3g + 25, -46k + 28k = -19k + 2g + 2 - 0 for k. -8 Solve -2v - 2r = -21 - 5, 3r = 77v - 96v + 167 for v. 8 Solve 47 = 5k + 2n + 10, -124k = -127k + 38n - 801 for k. -1 Solve -5g = 92r + 353, -26r - 3r - 2g = -24r + 14 for r. -4 Solve 6u = -23c + 95, 0u - u - 37 = -0u - 3c - 46 for u. 12 Solve h = -0h - 16j - 25 - 17, -4j = -18h + 13h + 42 for h. 6 Solve -1242p + 1240p = 4w - 56, 5p = 4w + 140 for p. 28 Solve -9y - 41 = -4v, -433v - 433v + 1730v - 431v - 430v = 2y + 26 for v. 8 Solve 0 = -15w - 1529 + 1559, -10 = -3v - 2w for v. 2 Solve -p - 5f + 440 + 614 = 900, 5p - 4f = -129 for p. -1 Solve -4i + 3k + 251 = 23, 0 = -2i + 6k - 13k + 80 for i. 54 Solve 3n - 5l = -4, 2838l = -2n + 2843l - 6 for n. 2 Solve 4c + 92 = -7x + 11x + 32, -3c - 2x + 35 = 0 for c. 1 Solve 5y - 5t + 0t = 254266 - 254281, 3y - 3t + 4t - 11 = 0 for y. 2 Solve 19 = -3o + 3y - 7y - 28, 2o - 3y = 148110 - 148079 for o. -1 Solve -2d + 24 = -2a, 2d + 2a = -172a - 1208 for d. 5 Solve 3j - 3a = 2j - 57, 8a + 184 = j + 331 for j. -3 Solve s = -4v + 151, -102s - 97s + 194s + 89 = 2v for v. 37 Solve 0 = 4m + 5l + 204, -23437l = 30m - 23432l + 31 + 69 for m. 4 Solve -3p + 60 = -3s + 120 + 81, -3p - 1001 = -23s for p. -4 Solve 0 = 18z + 17q - 12q + 13, -4z + 0q - 4q = 0 for z. -1 Solve 13q + 52 = 16q + s - 6, 5s = 12q - 277 for q. 21 Solve 2g - g = 3p - 17, 313p - 154 = 288p - 4g for p. 6 Solve -2d + 2j - 1595 = -1641, 2d + 2j - 58 = 0 for d. 26 Solve -2o = h + 15, -h = 962o + 958o - 1921o for o. -5 Solve 510 = 4h - 18n + 109n + 1780 + 926, -5h - 3n = 87 for h. -3 Solve 0 = 5p - 95s + 97s + 22, 3 - 5 = 2s for p. -4 Solve 0 = -11x - 5h - 37, -h + 29 - 41 = -5x - 19 for x. -2 Solve 0 = -11j - 2c + 66, 5c - 50 = 2j + 56 for j. 2 Solve 452l - 5c - 195 = 450l, c + 27 = -2l for l. 5 Solve -111f = -116f + 5y - 40, -79f - 4y = 466 for f. -6 Solve 3b = m - 4m - 3, -14b + 13b = 2m - 653 + 652 for b. -3 Solve 35 = -5k - 5j, -2j + 6j - 49 - 43 = 26k - 0j for k. -4 Solve -7y - 96 = 2h, 195h = 198h + 102 for y. -4 Solve 3p = -3s - 10 - 2, 3s = 2p + 105 - 82 for s. 3 Solve 139i - 6 = l + 140i, -2l - 19 = 4i + 15 for l. 5 Solve 3l + 120 = -3x, 7528l - 7527l + 22 = 5x for l. -37 Solve 0 = -3d + 18078u - 18106u + 27, 3d = -12u - 21 for d. -19 Solve -5s = a + 30, -a - 142 = 29s - 208 for s. 4 Solve -j - 123 = 4y, -60107y + 60103y = -5j + 105 for j. -3 Solve d + 4s + 382 = 332, -5d + 51s + 673 = 0 for d. 2 Solve 2x + 5 = -5q, 2x = 2413q - 2416q - 7 for x. -5 Solve 21a = -3c + 51, 2494670a + 32 = -5c + 2494674a for c. -4 Solve 4x - 25 = -5h, 1669x + h - 5 = 1672x for x. 0 Solve 0 = -15c - 2t - 14, -189c - t + 43 = -194c for c. -4 Solve -2g = -16j + 37j - 30j + 83, 0 = -5j + 3g + 82 for j. 5 Solve 30m = -2a + 8m - 20m + 28, 4a - 2m - 11 = 45 for a. 14 Solve -4z - 3a = -24338 + 24221, z + 3a = 18 for z. 33 Solve 2o = -2a - 66, 4o - 700261 = 4a - 700361 for a. -4 Solve -24z - 3i + 2i + 18 = -11, i + 21 - 1 = 5i for z. 1 Solve r + 11 = 61a - 53a, -3a - 2r - 41 = 0 for a. -1 Solve -w - 119m = 124m - 244m - 3, 4w - 3 = 5m + 8 for w. 4 Solve i + 5k + 38 = -2i, -k - 662 = 3i - 640 for i. -6 Solve 5r + 20230k = 20232k - 38 - 102, -5k - 112 = 4r for r. -28 Solve -5z + o - 26 = 0, 4z - 17o + 269513 = 269476 for z. -5 Solve 120c = 77c + 3a + 34, -3c = -3c + 3a - 9 for c. 1 Solve -4a - 462 = 2c - 420, -c = 56a + 21 for c. -21 Solve 36p + 15f = 12f - 160 - 68, -103p = -106p - f - 22 for p. -6 Solve -4z - 48 = 4y, 2y + 9 = 7017z - 7016z for z. -5 Solve -4s = 3t + s - 65, t - 27594 = 9s - 27551 for t. 25 Solve 2g + 43r = 44r - 6, 0 = 5r for g. -3 Solve 3s - 5 = -c - 1, -c + 215 + 19 = -49s + 22 for c. 16 Solve 56l - 28 = 52l, 35j - 29j - 29 = -0l + l for j. 6 Solve -8o + 2n + 23 = -73, 2901o = 2896o + 4n + 60 for o. 12 Solve 953f + 2z - 20 = 954f, 10 + 14 = 3f + z for f. 4 Solve 37 = u - 5a, -8448 = -4u - 5a - 8325 for u. 32 Solve -3u - c + 2 = 0, -2c = -2u - 762641 + 762637 for u. 0 Solve 3x + 5 = -2h, -h = 165718x - 165722x - 14 for h. 2 Solve 1345t = 5g + 1353t - 133, -3g - 10 = -2t - 83 for g. 25 Solve 2w + 3p + 49 = 6w, 7p - 26 = -5w - 277 + 65 for w. -5 Solve -21 = -a + 2a + 2u, -6a + 6u - 28 = 4u - 42 for a. -1 Solve -2t - 26 = -122i + 120i, 27i = 4t - 2t - 49 for t. -16 Solve -4f - 55 = -s, -32f - 5s - 115 = 286 for f. -13 Solve 17c = 26c - 13c - u, 19u + 1 = -4u + 3 - 2 for c. 0 Solve -14577952d = -14577947d + 2k + 265, -5d + 4k = 265 for d. -53 Solve -818v + 3 = -815v, 3x + v + 5 = -6 for x. -4 Solve -20n - 20 = -2z, -749z + 5n + 2 = -751z - 28 for z. -10 Solve -3 = -3o + 4l, -157l + 160l = 4o + 3 for o. -3 Solve 28q = -3v - 32q + 64q - 7, -12v - 3q = -48 for v. 3 Solve -5v - 84 - 130 = 4c, -117c + 59c - 5v - 207 = -61c for c. -1 Solve 4r = 2w + 20, 7r - 4w - 100 = -281 + 115 + 102 for r. 4 Solve -4s = -9s - 10s + 825, 97f - 92f + 2s - 61 = 44 for f. -1 Solve -5k - 15 = -2t, t - 1027 = -1017 for k. 1 Solve -3r - 19i = -92, -2r + 19i + 4 + 0 - 1 = 20i for r. -1 Solve -20z = 4x - 4192 + 4260, -5x - z - 13 = 0 for x. -2 Solve 0 = 5t - 312c + 315c - 17, 75 - 38 = 2t - 188c - 159 for t. 4 Solve -b = -2821d + 2817d + 66, -5d - 4b - 8b + 109 = 0 for d. 17 Solve -7284f + 7283f = -0q + 5q, 0 = q - 6f - 31 for q. 1 Solve 3c - 42 = 18m, 8779c - 8778c + 6 = -0m + m for m. -4 Solve -101460x = -101456x - 4u - 44, 5x + 3u = 23 for x. 7 Solve 66 = 4p - 13p - 2r, 4r - 33 = 6p + 9r for p. -8 Solve u = 3u + 10n - 58, 4544 - 4593 = -5u - n for u. 9 Solve 0 = z + 3, 4k + 25z = -21z + 73z - 23z + 36 for k. 6 Solve -5g + 8k = 211, -3g + 206k = 204k + 135 for g. -47 Solve -930 + 469 + 481 = -s + 2z + z, -2z + 10 = 0 for s. -5 Solve -a + 61 - 58 = -3b, -2a - 13 + 16 = -9b for a. 6 Solve 0 = 2p - 5o - 67680 + 67673, 5o = 5p - 55 for p. 16 Solve 18689y - 9 = 18687y - 0n + n, -4y - 5n + 25 = 0 for y. 5 Solve 0 = 15t, t + 59 - 23 = -4y + 16 for y. -5 Solve 5b + 21102 - 21072 = 2u, 26 = -3b + 2u for b. -2 Solve -1 + 0 = v, 5v + 50 = -9484b + 9489b for b. 9 Solve -5p = 2a + 59, -9p + 12p + 71a + 32 = 140a - 70a for p. -5 Solve -9539o = -7m - 9536o + 12, 20m = -3o - 93 for m. -3 Solve -3g = -a + 6a + 39g + 225, 15a + 4g + 86 - 21 = 0 for a. -3 Solve -3t - 2265i + 2268i + 69 = 0, -i + 15 - 13 = 0 for t. 25 Solve 0j + 3j - 48 = -3l, -346l - 63j + 461 = -341l + 149 for l. 12 Solve -3*f + 11 + 63 = -	{ "pile_set_name": "DM Mathematics" }
econd derivative of 21858y5 - 11y*4 + 2y*3 - 6484459y - 2 wrt y? 437160y3 - 132y*2 + 12y What is the first derivative of 65457cj + 118c - 7274460j wrt c? 65457j + 118 Find the second derivative of -311369759p*2w - 4627251pw - p wrt p. -622739518w What is the second derivative of k3 + 2783832k*2 - 298075k - 3? 6k + 5567664 What is the second derivative of -15509630b*3 - 5b*2 - 20265376b? -93057780b - 10 What is the third derivative of 111018f*4 + 886f*3 + 2f*2 + f - 2281124 wrt f? 2664432f + 5316 Find the third derivative of 6jo*4 + 2jo3 + 2jo2 + j - 28o*4 - 13o*3 - 23490o*2 - 5 wrt o. 144jo + 12j - 672o - 78 What is the second derivative of -343163gm3t*2 - 225gm3t + gm3 + 240gmt*2 - 2gmt + 2g + 5m*3t - 2mt - 395t wrt t? -686326gm3 + 480gm What is the second derivative of -2cv3 + 293615cv - 4c + 10215568v3 wrt v? -12cv + 61293408v Find the second derivative of -217z3 - 24699z*2 - 10451763z. -1302z - 49398 Find the second derivative of 179985166q*3 + 293305489q. 1079910996q What is the first derivative of -1183717p*4 - 35p*3 + 17249811 wrt p? -4734868p*3 - 105p*2 Differentiate 6306g*3n*2 + 18631065g*3y + 6g3 - 8g*2n*2 - gn2 - n2y with respect to y. 18631065g3 - n2 Find the first derivative of -5468093x + 238195213. -5468093 Find the first derivative of -280143596x + 276722115 wrt x. -280143596 What is the first derivative of -123156012h + 193714807 wrt h? -123156012 Find the second derivative of -3f*3 + 8445370f*2 + 925276839f. -18f + 16890740 What is the third derivative of 2229602f*4 - 121698f*2 + 9f wrt f? 53510448f Differentiate -27614689n*3 - 3871031 with respect to n. -82844067n2 What is the first derivative of j2w + 179j*2 - 5010j - 34537861w wrt w? j2 - 34537861 Differentiate -2b*3 - 1122751b + 28422116. -6b2 - 1122751 What is the third derivative of -468195260w*4 - 17w*2 - 118712w + 3 wrt w? -11236686240w What is the first derivative of -v4 - 1120483v + 4162176? -4v3 - 1120483 What is the third derivative of -15207s*4 + 181s*3 + 30s*2 + 4s + 115? -364968s + 1086 What is the first derivative of 119ju2 + 8ju - 826j - 73u2 - 104418u wrt j? 119u2 + 8u - 826 Differentiate -9a3h*3p + 567862a3hp - 4418927a*3 + 10ah3 wrt p. -9a*3h*3 + 567862a*3h Find the third derivative of -223743r4 + 47r*3 - 5r*2 + 45r + 25807 wrt r. -5369832r + 282 Differentiate 5m*4n*3 + 34263806mn3 - 25735016n*3 with respect to m. 20m*3n*3 + 34263806n*3 What is the first derivative of -2699w*2 + 33w - 1917844 wrt w? -5398w + 33 What is the third derivative of -19531785p*4 - 8p*3 + 368918073p*2? -468762840p - 48 Find the third derivative of -245354401y4 - 217541936y*2 wrt y. -5888505624y What is the third derivative of 8308993u6 + 41469u*2 + 56u + 3? 997079160u3 What is the second derivative of 27154328i*2 - 1463i + 7345? 54308656 What is the second derivative of 120730340a2 + 141390045a wrt a? 241460680 What is the second derivative of -14284849j2m*2 + 3j*2m - 120j2 + jm*5 + 17jm + j - 9m - 2 wrt m? -28569698j2 + 20jm3 What is the derivative of -2726loy - 138407ly + 132l - 17292o + 7 wrt y? -2726lo - 138407l Find the second derivative of 86351466w*2 + 31497718w - 1 wrt w. 172702932 What is the third derivative of 66086810u3 - 2815u*2 + 31u + 64 wrt u? 396520860 Find the third derivative of 145149892l4 + l2 + 214317844l wrt l. 3483597408l Find the second derivative of 119m*3 + 32202m*2 - 73m + 263765. 714m + 64404 Find the second derivative of 7620458l*5 - 115958l + 16. 152409160l3 What is the third derivative of 6790697y*3 - 2y*2 - 2202800y? 40744182 What is the second derivative of -361578096h3 - 655990114h wrt h? -2169468576h What is the first derivative of -12661lu3 - lu*2 + 12380949l - u*3 wrt u? -37983lu2 - 2lu - 3u*2 Find the second derivative of 3o*5 + 374242o*3 + 3o*2 - o - 34650060. 60o*3 + 2245452o + 6 What is the second derivative of 3215073d2i*2s*2 - 39di2s - 328di*2 - 8dis*2 - di + i*2s*2 wrt d? 6430146i*2s*2 Find the second derivative of 1776723by2 + 67by - 2b + 39y3 - 63y - 491 wrt y. 3553446b + 234y What is the first derivative of 20001744j2 + 20645127? 40003488j Find the first derivative of 1544a3k*2 + 4794846a*3 - 6a - 3279k2 wrt k. 3088a*3k - 6558k What is the third derivative of -190496811fz3 - 2fz2 - 33382059fz wrt z? -1142980866f What is the derivative of 4dj + 4dv + d + 176jv + 210j + 4995v + 2014 wrt v? 4d + 176j + 4995 Find the second derivative of -439671v4 - 2941v + 1608 wrt v. -5276052v2 Find the second derivative of 2ag3 + 170832ag2 + 53ag + 57g*3 - 158878g wrt g. 12ag + 341664a + 342g What is the derivative of -22k2m*3 + 60007k - 9351677m3 wrt k? -44km3 + 60007 Differentiate 3569c*2r*2 - 2287c*2 - 237r*3 + 29r*2 - 4440 with respect to r. 7138c*2r - 711r2 + 58r What is the second derivative of 1517011930t3 + 363713659t? 9102071580t Find the first derivative of -12f*3 - 631f*2 + 1152f - 668656605. -36f2 - 1262f + 1152 What is the second derivative of -263891n5 + 82n*2 + 5892n - 4643? -5277820n3 + 164 Find the third derivative of 1479n*6r + 30369n6 - 10n*2r + 7719144n2 wrt n. 177480n*3r + 3644280n3 What is the second derivative of -62801362k*2 + 170603762k? -125602724 What is the third derivative of 2i4 - 4231008i*3 - 8i*2 + 139817i + 1? 48i - 25386048 Find the second derivative of -161jp2 + 13jps + 10js - 12p2s*2 - 480p*2s - 32s2 wrt p. -322j - 24s2 - 960s What is the second derivative of -bs2 - 713705bs - 2140100s*2 - 4s wrt s? -2b - 4280200 What is the first derivative of -14052t*2 + 143t + 58284542? -28104t + 143 What is the derivative of -880430k*2rz - 318k*2r - 25962kr wrt z? -880430k2r Find the third derivative of 12454y5 + 11y*4 - 2y*3 - 2y*2 + 219744y - 2. 747240y2 + 264y - 12 Differentiate 20346640r4 + 12114631 wrt r. 81386560r*3 Find the second derivative of 119303889r*5 + 2r*4 + 252316858r. 2386077780r3 + 24r*2 What is the second derivative of -3347h*4 + 7137h*2 - 10h + 1237187? -40164h2 + 14274 Find the third derivative of 23714j*4y*2 - 112j*3y*2 + 2710j*2y2 + j2y + 8j*2 + 4j - y*2 + 4 wrt j. 569136jy2 - 672y*2 What is the third derivative of -2s*3x + 37057031s3 - 4s*2x + 180sx - x - 7612 wrt s? -12x + 222342186 What is the second derivative of -66n*3v*2 - 204480n*3v - 4549nv*2 - 448nv + 7n wrt n? -396nv*2 - 1226880nv What is the third derivative of 64499990m*4 + 125948005m*2 wrt m? 1547999760m Find the first derivative of 2g2 + 120633312g + 267557464. 4g + 120633312 Differentiate 5lz - 930730l - 120140268z with respect to l. 5z - 930730 Find the first derivative of 632d3m - 48586487d3 + 4d*2m + 1740dm + m wrt m. 632d3 + 4d*2 + 1740d + 1 What is the second derivative of -28294838t2 + 14310066t wrt t? -56589676 Find the first derivative of -40v4 - 1776195v3 - v2 - 33452027. -160v3 - 5328585v*2 - 2v What is the first derivative of -10952557p3 - 9443666? -32857671p*2 Find the first derivative of -98285620t - 156294160 wrt t. -98285620 Find the first derivative of -23315359c3 - 15240511 wrt c. -69946077c*2 Differentiate 8800855a - 865068. 8800855 Find the third derivative of 73702925l3 + 5l*2 + 4803019l. 442217550 What is the second derivative of 8269493u2 - 2279530u wrt u? 16538986 What is the second derivative of -28173868y2 - 262818y + 3? -56347736 What is the second derivative of -3347464a2 - 12315464a wrt a? -6694928 What is the third derivative of 126u6 + 16316u*5 - 9u*2 + 13u - 1226 wrt u? 15120u3 + 978960u*2 What is the derivative of -4q*2t*3w - 2q2t*3 + 89q*2t*2 - 23985651q*2w - 14q + t*3 - 8	{ "pile_set_name": "DM Mathematics" }
Suppose w = yv - 0v - 6, -2w - 17 = v. Let j = 26 + w. Solve 2n = -2n - 16, t - 4n = j for t. 2 Let m(d) = -894d - 8043. Let q be m(-9). Let l = 19 - 5. Solve -qu = -5i - l, i + i + u = -10 for i. -4 Let j be 427/49 - 4/(-14). Let n be (j/(-6))/(18/(-60)). Solve -2v - 5k = 0, v - k + n = -6k for v. 5 Let p = -27 + 23. Let k be (-72)/(-6) - (6 + 2 + p). Let y be 124/(-64) + 19/k. Solve 4j + c + 21 = 0, yj = 3j + 4c + 24 for j. -4 Let y be (-54)/9 + (-3)/(5/((-250)/15)). Solve yt = -3n - 23, 3n - 4t + 0 = -7 for n. -5 Let d = -1 - -3. Suppose 3x - g = dg, 3x + 4g = 14. Suppose -193w + 17 = -369. Solve -4f + x = -wi, i + 5f - 6 - 7 = 0 for i. 3 Let y be -2 - -3 - -310/15. Suppose 55 - 19 = yc. Suppose 4h + 0 - c = 0. Solve u = -hd - 13, -5u = 2d - d - 5 for u. 2 Let x(z) = z3 + 43z*2 + 17z + 735. Let r be x(-43). Solve i + 2 = -g, -2g = g - ri - 22 for g. 2 Let i be (2254/147)/(1 - 1/3). Suppose -31m + i = -30m. Solve -r = -3v + r + 5, 5r + m = -3v for v. -1 Suppose f = -4d - 53, -4d - f - 33 = -4f. Let a be 77/21 + (-4)/d. Solve 0 = -t - ah - 7, 0 = -h + 2 - 4 for t. 1 Let q = -238 + 247. Suppose 0 = 4m - q - 47. Solve -14 = -5a + g, -2g + m = -a - 6g for a. 2 Let i(d) = -d2 - 4d. Let k be i(-2). Solve 1 = -4u - q, ku - 12q = -10q + 14 for u. 1 Let l = -131 - -134. Let s = 7 - 5. Solve -2t - s = -g, 3t - l = -g + 4 for g. 4 Let i(d) = -3d2 - 65d + 49. Let g(n) = 9n2 + 194n - 146. Let v(h) = 2g(h) + 7i(h). Let y be v(-23). Solve 0 = yl - 25, -5l = o - 0l - 30 for o. 5 Let c = 1 - 2. Let z(d) = -28d - 4d3 + 63d - d*2 + 2 + 0 + 1 - 33d. Let x be z(c). Solve 4s = xp, 0p = -p - 5s for p. 0 Let s(u) = -u*3 + 5u*2 - 2u - 2. Let y be s(3). Suppose ya + 29 = 139. Solve -2p + 19 = -3q, 2 = -2p + q + a for p. 2 Let d be (-140)/(-35) - (-117 - 1). Let f = d - 116. Solve 4p - 3g - f + 16 = 0, -3g = 6 for p. -4 Let x(j) = -j2 + 6j + 4. Let n be x(6). Let r(m) = 7m2 + 42m + 12. Let d be r(-8). Let h = d - 119. Solve -2c = nl + 10, -6c - 15 = -c + hl for c. -1 Suppose 86l + 26l = -56l + 47l. Solve l = 4g + 7s - 5s + 10, 5s + 25 = 0 for g. 0 Let q be (-22)/(-5) - 504/1260. Solve 2b = s + 12, qb - 28 = 4s + b for s. -4 Let f = -487 + 491. Solve -2g - 2t - 38 = -18, 2g - 16 = ft for g. -4 Let s = -86 + 88. Suppose -13x + 11x + 3o = -13, sx = o + 7. Solve -4l + 2l = -2q + 6, xl + 4q = -12 for l. -4 Suppose -u + 3 = 3s - 6, 0 = 2u + s - 43. Let i be 7 - (-12 - (-25 + 9)). Solve 6k - 3k + 3x + u = 0, 0 = ik + x + 16 for k. -4 Suppose 634t - 605t - 725 = 0. Solve -4m - 2o = t - 43, -o + 12 = 3m for m. 3 Let t = 7987 + -7983. Let u = 43 - 22. Let b be (70/u)/(3/(18/t)). Solve c + 0 = -3, -bj - 32 = 4c for j. -4 Let v(z) = z3 + 24z*2 - 20z + 129. Let p be v(-25). Solve d + 2 = 5u - 0, -p = -3u + 2d for u. 0 Suppose 5p = 5s - 135, -150s = -152s + 9p + 26. Solve 32h = sh + v - 1, 2v + 6 = 0 for h. -4 Suppose -8v + 6 + 26 = 0. Suppose 0 = -vo - 3i + 1, 5o - i = 3o + 13. Solve 2j - 30 = 4n - 2, o = j for n. -5 Let y = -34964 - -34964. Solve -3u - 12 = y, -30 = 4c + u - 46 for c. 5 Suppose -15a + 1632 = -3a. Suppose az = 154z - 144. Solve 0 = -b - 5j + 11, -5b - 3j = z + 3 for b. -4 Let o = -105131 + 105137. Let v = -2 + 4. Suppose 0 = 5h - 13 + 3. Solve 14 = -n - hn + vw, -n + o = 2w for n. -2 Let y(d) = -d2 + 15 + 4 - 5 + 10d. Let w be y(11). Solve -3z + l + 10 = 0, 4z + w = -l + 14 for z. 3 Suppose -l + 60 = 19l. Let o(a) = 2a*2 + 13a + 8. Let c be o(-6). Solve -cn - 4b - 22 = -0n, 2b = -ln - 21 for n. -5 Suppose -21p + 3d - 22 = -23p, -12 = -2d. Solve -5w - 3j + 2j = -14, -4j - 10 = -pw for w. 3 Suppose 5p + 3q + 10 = 0, 5q - 25 = p + 5. Let c be 4/(p + (-11)/(-2)). Suppose cj + 27 = 115. Solve -3v = 2u - 4u - j, -2u = -4v + 14 for u. -1 Suppose -4n - 2p = -26, 2n + p - 15 = 2p. Let g(t) = -t + 4. Let w be g(11). Let y = 10 + w. Solve 0 = 3d + 5b - 8 - n, 0 = 4d - yb + 9 for d. 0 Suppose -12 = -49a + 46a. Suppose -14 = b + 4y, -y + 6y = -2b - 13. Let f be (-3)/2(-370)/111. Solve -12 = -d - aj, -fj + 24 = 5d - b for d. 4 Let m = -3725 + 3767. Solve y = 4a + 17, -47y = -my - 5a - 10 for y. -3 Let y(x) = -x*2 + 5x. Suppose 0 = -t - 4b + 16, 2b = -4t + 3t + 10. Let w be y(t). Suppose -wu = -8u. Solve -15 = 4g + o, u = -6g + g + 5o for g. -3 Let z = 213 + 97. Let u = z - 308. Solve x = -uy - 7, 4y = -x - 2x - 17 for x. -3 Let y = 57 - 53. Suppose -yb = -8b + 40. Suppose s - 20 + b = 0. Solve 0 = 2m - 5t + 3 - s, 13 = -4m + t for m. -4 Suppose 0 = -7k + 6k - 3d - 16, 5k + 5d + 20 = 0. Solve -2y - 4v = ky - 4, 0 = -2y + 3v + 22 for y. 5 Let i(o) = -o3 - 36o*2 + 26o - 403. Let k be i(-37). Solve -11 = 3m + u, -4m - ku = 1 + 27 for m. -2 Suppose -32d + 34d - 254 = -2f, 248 = 2d - 4f. Suppose -16s + d = 5s. Solve -2p - 10 = 5x, 4p + s = -x - 14 for p. -5 Let k be (5 - 2)/(-3) + -2. Let b be ((-228)/(-15) - 12/60) + k. Solve 2w + b = -4d, -5d - 2w - 5 = 12 for d. -5 Let j be (-48)/(-408) + 2366/119. Solve -3l + 5q = -12, 4l - q - j = -l for l. 4 Suppose 9356 = 8b + 3276. Suppose b = -3h + 766. Suppose 10 + 5 = 3c. Solve -h = cl + 8, 4y + 10 = l for y. -3 Let d be 1 - (7 - (-6 - -8 - -1)) - -7. Solve -17 = j + 6x, dj - 17 = 3x - 31 for j. -5 Suppose 22i - 27i = -2y + 40, -3y + 85 = 5i. Solve l - 29 = 5x, -4x = -5l - 3x + y for l. 4 Let j(u) be the second derivative of 2u*3/3 + 3u*2/2 - 6u. Let k be j(-10). Let h = k + 42. Solve 0 = 4b - 2q - 16, 11 = -b - hq - 7 for b. 2 Let s(l) = l2 - l - 151. Let a(i) = i2 - 2i - 149. Let p(w) = -2a(w) + 3s(w). Let z be p(-13). Solve -h - z = -2r - 0, 3r + 5h = -5 for r. 0 Let m(l) = 10l - 8. Let d(b) = -29b + 23. Let u(q) = -3d(q) - 8m(q). Let a be u(1). Solve p - ap - g - 6 = 0, -3g + 6 = -5p for p. -3 Suppose 96j - 226j + 2080 = 0. Solve -2h = -5a + 17, -18a + 9 = -3h - ja for h. -1 Suppose -5q = 5v - 50, -10v + 23q + 16 = 21q. Solve vw = 3k + 24, 2 + 6 = 4w + 4k for w. 5 Let j(w) = 6w + 14. Let k be j(-2). Suppose ky - 5y = 0. Suppose 4g = 3o + 35, 4g + 2o - 8 - 2 = 0. Solve 2z = 2v - y + 4, -g = 5v for z. 1 Let i be -10(-5)/((-325)/(-52)). Solve -4q + 3 = x, ix + q = 3x + 15 for x. 3 Let i be 946/121 - 8 - (-2 - (-70)/(-22)). Solve q - 2 = -3d + 23, 37 = iq + 4d for q. 1 Suppose 2j + 6 = 0, 59o - 4j + 51 = 62o. Solve i = 5g + o, -g + 24 - 28 = 0 for i. 1 Let y(d) = -95d + 1600. Let s be y(16). Solve -v = -3b + 2, -sb + 30 = -70b for v. 7 Suppose -24x = -20x + 4. Let s be 14 + (-6 - x) - -23. Solve -5b + 4f = 41, -4f - 6 + s = -2b for b. -5 Let f be (57 - 44) + (-5 - -1 - 1). Let m = 6 - -3. Solve -2b = -p, -mb = -fb for p. 0 Let j(h) = -h3 - h2 + 21h + 6. Let u be j(-4). Let c be ((-32)/(-40))/((-4)/u). Solve -17 = 3q - 2n, -3n - 12 = cq - 3q for q. -5 Let i = 2367 - 2364. Solve 3v + 2s - 4s = 19, 0 = -3v + is + 24 for v. 3 Let p be (11 - 7)-1 - -6. Suppose 2c + 0 = -pg + 6, 5 = 5c. Solve 4u + gz - 6 = 6u, 1 = -z for u. -4 Let g = -8968 + 8968. Solve -10 = -h - k, -4h + 7h - 3k = g for h. 5 Suppose 4u = -4c - 28, -2u - 41 = -16c + 21c. Solve -2w = -5d + 19 + 16, 0 = -ud - 4w - 10 for d. 5 Let z(u) = -u3 + 3u*2 + 20u + 24. Let t be z(-2). Solve -2l + 32h = 37h - 8, -16 = -tl + 2h for l. 4 Suppose 0 = 2h + 2h, 4h + 12 = 19m - 17m. Solve 3u - ma = -3a + 33, -32 = -u + 4a for u. 4 Let d be (-22 + 38 + 656/(-40))/(2/(-10)). Solve -4x - 16 = -dq, -68x + 64x - 4 = -5q for q. -4 Let h be (35 - 26) + (-2)/3-33. Solve 5q - 3w + 11 = h, 0 = -w + 5 for q. 7 Suppose -76v = 145v. Solve v = -3t + 2b + 10, 24t - 25t - 4b - 6 = 0 for t. 2 Suppose 0 = v - 41 - 13. Let c = v + -51. Let g be (-4)/c24/(-8). Solve -2k - 13 = -gn + n, 4k - n + 1 = 0 for k. 1 Let l(i) = 2i - 19. Let x be l(11). Let j be (-250)/(-75)x/5. Solve -jr + 5q + 19 = 0, r - q - 11 = 2q for r. 2 Suppose 3t - 7t = 0, 3d - 4t - 12 = -t. Solve -y - v - d = 0, 5v = -2y - 5 - 6 for y. -3 Let c(u) = -u*3 - 157u*2 - 1048u + 305. Le	{ "pile_set_name": "DM Mathematics" }
/24 - 21t3 - 699t*2 - 5. Determine u(-24). -6 Let v be -23 - (-3 + 5)-43. Let c(n) = 67n + vn + 9 - 146n. What is c(-6)? 3 Let p(s) = 7s2 - 9s + 3. Let l(z) = 3z2 + 10z - 22. Let x be l(4). Let j = 65 - x. Let t(c) = -c*2 + c - 1. Let f(q) = jp(q) - 6t(q). Give f(7). -25 Let h be (-14 - -19)(-11)/(-5). Let m(k) = 7k2 + 7 + k3 + 15k + hk - 16k. Determine m(-6). -17 Let q(b) be the first derivative of b*4/4 - 5b*3/3 + 5b - 1. Suppose 5y = -4o + 9o - 45, 3y + 7 = -o. Calculate q(o). 5 Let z(t) be the second derivative of -t*4/12 + 4t*3/3 + 5t*2/2 + t. Let l be -1 + 4 + 7/21-21. Let b(x) = 2x + 14. Let q be b(l). Calculate z(q). 17 Let m(a) = -15a - 97. Suppose 17p + 35 = -5v + 21p, -2v - p - 14 = 0. Calculate m(v). 8 Suppose 32 + 36 = 4v. Suppose 32 = 7h - v. Let y(x) = x*2 - 3x + 5. What is y(h)? 33 Let u(q) = -2q + 3. Suppose 40a - 588 = 47a. Let k = a + 83. Calculate u(k). 5 Let x(l) = -58. Let v(j) = -10j + 65. Let z(m) = -v(m) - 4x(m). Give z(-16). 7 Let a(p) = -p - 3. Let j be a(7). Let f(b) = -43b*2 + 9b + 8. Let t(s) = 4s2 - 1. Let y(x) = f(x) + 11t(x). What is y(j)? 7 Let n(q) = 0 + 3q + 3 + 2. Let k(z) = z2 + 10z - 29. Let a be k(-12). Let v be (36/(-6))/(-6)a. Give n(v). -10 Let t(x) be the second derivative of x5/5 - x4/6 - x3/6 - 7x*2/2 - 3915x + 2. Give t(3). 80 Let j(u) = 2u + 3. Let s = 38 + -34. Let z be (-20)/(-150) - s/30. Suppose z = 2m - 5 - 1. Calculate j(m). 9 Let x(i) = -i*2 + 592i - 615i - 14 - 16. Determine x(-25). -80 Let r(v) = -v2 + 7v - 4. Let f = -5919 + 5926. Determine r(f). -4 Let k(o) = 2o + 1. Let b(u) = -9u*3 - 3u*2 + 3u - 2. Let n be b(2). Suppose 13a + 380 = 5i + 11a, 5i - 345 = -5a. Let x = i + n. Calculate k(x). -11 Let t(u) = 26u - 5 + u*2 - 2u*2 + 3u*2. Give t(-13). -5 Let z(l) be the first derivative of -2l*2 - 26l - 948. Determine z(-4). -10 Let z = 4 + -12. Let q(o) be the first derivative of 7/2o2 - 8o + 1/3o3 - 68. Determine q(z). 0 Let s(t) = -t3 - 24t*2 - 16t - 362. Let f(x) = -x*3 - 25x*2 - 15x - 428. Let n(a) = 5f(a) - 6s(a). Determine n(-18). -22 Let c(l) = 7l - 7. Let y(r) = 6r - 6. Let j(b) = -4c(b) + 5y(b). Suppose 6g + 3a = 18, -55a - 24 = -g - 52a. Give j(g). 10 Let d(c) = 2c - 1. Let y = -69 + 82. Suppose -5x + 11k = yk - 20, 0 = -k. Calculate d(x). 7 Let i(a) be the first derivative of a*4/2 + 20a*3/3 + 3a*2/2 + 26a - 2786. Calculate i(-10). -4 Let s be 26(754/104 - 6). Let v(m) = -m*2 + 13m + 31. Give v(s). 1 Let c(g) = 38g2 - 11858g + 623. Let t be c(312). Let k(j) = -j*3 - 2j - 1. Let r(z) = z + 1. Let u(f) = k(f) + 2r(f). Determine u(t). 2 Let z(y) be the second derivative of y4/2 + y2/2 + 25y. Suppose -5c = -20, -5u + 10c = 12c - 13. Determine z(u). 7 Suppose -3 + 3 = 21h. Suppose 2t - 3u + 0u - 19 = h, 2t = 5u + 25. Let j(q) = q + 10. Let r(x) = x + 11. Let l(i) = 4j(i) - 3r(i). Calculate l(t). 12 Let j(s) = -17s + 11 - 412s*2 + 206s*2 + 6 + 10s + 207s2. Give j(5). 7 Let m(t) = t3 - 7t*2 + 4t + 14. Let h be m(6). Let y(x) = 25x2 + 1 - 2x + 9xh - 38x2. Determine y(-2). -11 Let k(l) = -l2 + 3l + 10. Let m be k(5). Let h(z) be the first derivative of -13z - 21 + 3z2 - z2 + mz - 3z2. Give h(-9). 5 Let r be 3 + 9 + (3 - -1). Suppose -ry - 50 = -21y. Let j(x) = 2x - 18. Let s be j(y). Let w(c) = c*2 - c. Give w(s). 2 Let l be 3/(-10)10/12 - 456/608. Suppose f - 5x - 42 = -2f, x = -3f + 24. Let r(m) = -fm*3 - 1 + 0 - 12m*3. Calculate r(l). 20 Let g(y) be the first derivative of -3y*2/2 + 16y + 8. What is g(5)? 1 Let f(o) = o*3 - 10o*2 + 2o - 12. Let s be f(10). Let a(h) be the third derivative of 3/8h4 + 4h - h*2 + 0 - 1/60h*5 - 2/3h*3. Calculate a(s). 4 Let m(c) = 2c - 3. Let j = -3605 - -3597. Let n(g) = 3g2 + 24g + 17. Let d(b) = -2b2 - 16b - 11. Let q(z) = -7d(z) - 5n(z). Let s be q(j). Give m(s). -19 Let i = -38383 - -38389. Let f(q) = -6 - 2q2 + q2 - 6q2 + q3 + 7q. Calculate f(i). 0 Let n(h) = 5h*3 + 2h*2 + 6h - 8. Let d(w) = 14w3 + 6w*2 + 17w - 23. Let o(k) = 4d(k) - 11n(k). Let x be 1((-3)/10)/(97/(-970)). Calculate o(x). 47 Let d be 2/((-24)/6(-3)/(-54)). Let u(q) = 9q3 + 27q*2 + 13q + 5. Let w(x) = -4x3 - 13x*2 - 7x - 3. Let s(t) = -3u(t) - 7w(t). Determine s(d). -3 Let r(q) = 7q3 - q. Let p be r(-1). Let c(b) be the third derivative of b4/6 + 11b*3/6 + 2b*2 - 117. Give c(p). -13 Suppose b + 8 = 2h, -3b + 6h - 2h - 12 = 0. Let g(u) = 10u*2 - 9u - 2 - u*2 + 5u - 2u2 - u3. Give g(b). 30 Let o(d) be the third derivative of -d5/60 - 25d*4/24 - 29d*3/2 - 4098d2. Calculate o(-21). -3 Let g(s) = -s3 - 18s2 - 28s + 79. Let j be g(-16). Let r(b) = -jb2 + 37b*2 + 0 - 17b*2 - 1. Let d be 21(-1)/2. What is r(d)? 4 Suppose 5a + 0m = m + 22, a + 10 = 5m. Suppose -4 = -6y + ay. Let j(s) = s2 - s + 2. Determine j(y). 14 Let n = -3322 - -3350. Let g(m) = -m2 + 31m - 98. What is g(n)? -14 Let q be 6/9-23. Let v(h) = -2h*2 - 25h + 4. Let f(z) = -3z2 - 36z + 6. Let r(n) = -5f(n) + 7v(n). Give r(q). -6 Let c(u) be the first derivative of -u*4/2 - 5u*3/3 - 2u*2 + u - 42. Let x be 9/672/(-54). Give c(x). 5 Let h(m) = 2m + 14. Suppose 4f + 12 = 4g, -5g = -f - 35 + 32. What is h(f)? 8 Suppose 3j + 3p = 7j - 220, 136 = 3j + 5p. Let b = j - 50. Let a(d) = 138 + bd2 - d + d3 - 138. Calculate a(1). 2 Let h(j) = j*2 - 12j - 23. Suppose -110 = -1420y + 1409y. What is h(y)? -43 Let m be (-3)/(-2) + 1 + (-14)/(-28) + 3. Let l(p) = -15p + 82. Give l(m). -8 Let s(m) = -5m*3 + 2m*2 + 3m - 4. Let w(o) = -26o3 - o2 + o - 2o + 27o3 + 1. Let d(b) = s(b) + 4w(b). Determine d(2). -18 Let u(q) = -7q - 51. Let a = 7702 - 7708. Calculate u(a). -9 Let i be (-3)/(-27) + 7 - 2/18. Let p(h) = -h2 + 19h - 85. What is p(i)? -1 Let c(u) = 40 - 33 - 6 + 47u2. Let z(v) = 238v*2 - v + 6. Let n(s) = 11c(s) - 2z(s). Determine n(1). 42 Let g(u) = 3u*2 - 38u + 102. Let l(j) = -2j2 + 20j - 50. Let m(f) = -3g(f) - 5l(f). Give m(-17). -5 Let u(v) = v*3 - 5v*2 - 8v + 9. Let d = -32 + 36. Let k be d/(-10) + (-22)/(-5). Suppose -kg = -27 + 3. What is u(g)? -3 Let p(j) = 110j*2 + 268j + 61. Let h(o) = 67o2 + 135o + 30. Let v(b) = -5h(b) + 3p(b). Calculate v(26). 7 Suppose 955 = -664b + 855b. Suppose 2k - 15 = -3k, 3k - 1 = 4y. Let o(n) = 2n2 - 4n + 0 - ny + 2. Give o(b). 7 Let f(x) = -13 + x2 + 3x + 12 - 2x2. Let o = 9 + -19. Let z = o + 13. Give f(z). -1 Let i = -45 - -50. Let v be -50 - (-2 - (i - 3)). Let k = v - -48. Let r(j) = j3 - j*2 - 4j + 3. Calculate r(k). -1 Let k(s) = 109s + s2 - s3 + 31s + 2s3 + 20 - 140s. Let o = -36 - -36. Determine k(o). 20 Let v(p) = -p + 2. Let a(y) = -y - 17. Suppose -w - 12 = -1. Let n be a(w). Determine v(n). 8 Let k(n) = -11n + 123. Let h be k(-13). Let i = h + -263. Let f(y) = 2y - 7. Determine f(i). -1 Let c(y) = 13y - 5. Let u(g) = -14g + 9. Let w(a) = 5c(a) + 4u(a). What is w(-5)? -34 Let h(j) = j*3 + 3j*2 - 2j + 6. Let t be 3-2 + 84/14. Suppose -9a - 29 - 16 = t. What is h(a)? -34 Let o(n) be the first derivative of -n*3/3 + 9n*2/2 + 9n - 23. Suppose 31 = 3y + 4m, -3y + 4m = -28 + 5. Calculate o(y). 9 Let s(d) = 5d - 29. Suppose 4a = -18n + 27n - 48, a = n - 7. Determine s(n). -9 Let s(m) = 163m - 492. Let x be s(3). Let w(p) = 14p + 8. What is w(x)? -34 Suppose 3f + g = -12, -2g - 8 = 58f - 56f. Let c(o) = 6o + 1. Let w(b) = -6b - 2. Let n(r) = -6c(r) - 5w(r). Determine n(f). 28 Suppose -u - 261 + 139 = 0. Let k = u - -116. Let v(z) = z*3 + 6z*2 - 2z - 1. What is v(k)? 11 Let k(n) = 27n3 - 2n*2 + 7n + 10. Let u be k(-2). Let c = -222 - u. Let v(x) = x*2 - 6x - 10. Determine v(c). -10 Let z(f) be the first derivative of -f*3/3 - 3f*2 - 2f - 61. Let i = 19 + -26. Determine z(i). -9 Let x(f) = -2f + 12. Let m be (-83)/9 + (-12)/(-54). Let g be 1m/6(-32)/6. Calculate x(g). -4 Let p(x) = -2x + 7. Let o = 35 - 28. Let g(s) = -3s + 14. Let b(i) = op(i) - 4g(i). Suppose -5r = 2d + 44, -4d +	{ "pile_set_name": "DM Mathematics" }
lowest common multiple of 74746 and 126? 672714 Find the common denominator of -121/68796 and 41/1176. 137592 What is the lowest common multiple of 11541 and 61? 704001 What is the lowest common multiple of 2891112 and 27? 26020008 What is the common denominator of 25/1674 and 71/93? 1674 What is the common denominator of -51/64556 and 53/18? 581004 Calculate the smallest common multiple of 12960 and 900. 64800 What is the smallest common multiple of 774940 and 8? 1549880 Calculate the lowest common multiple of 301 and 22231. 155617 What is the common denominator of -63/5300 and 87/134620? 673100 Calculate the common denominator of 95/18244 and 87/40. 182440 Calculate the smallest common multiple of 5508 and 10692. 181764 Calculate the common denominator of -73/13560 and -127/180. 40680 What is the common denominator of 95/286 and 83/280? 40040 What is the lowest common multiple of 646 and 2584? 2584 What is the least common multiple of 80 and 7830? 62640 What is the least common multiple of 124488 and 6118? 2863224 Find the common denominator of -21/830104 and 137/679176. 7470936 Calculate the common denominator of 67/10 and 55/7534. 37670 Find the common denominator of 22/24939 and 67/12. 99756 What is the least common multiple of 505284 and 90692? 3536988 What is the smallest common multiple of 3137 and 159? 498783 Find the common denominator of 62/42975 and -82/197685. 988425 What is the common denominator of 65/174438 and 87/135674? 1221066 What is the smallest common multiple of 482125 and 35? 482125 Calculate the common denominator of 11/10770 and -119/58158. 290790 Calculate the lowest common multiple of 63 and 432. 3024 Calculate the smallest common multiple of 45236 and 3956. 1040428 What is the least common multiple of 14616 and 21? 14616 What is the smallest common multiple of 266 and 56? 1064 Calculate the least common multiple of 324 and 324. 324 Find the common denominator of -59/4440 and 55/411921. 16476840 Calculate the common denominator of -73/108642 and -45/36214. 108642 Calculate the common denominator of -59/12 and 37/44120. 132360 Calculate the common denominator of -43/71987 and 61/6. 431922 Calculate the lowest common multiple of 21721 and 31030. 217210 Calculate the common denominator of 3/10 and -103/910. 910 Calculate the common denominator of -133/1518096 and 119/30. 7590480 What is the smallest common multiple of 3 and 563? 1689 Find the common denominator of 42/5 and 169/4554. 22770 What is the least common multiple of 2392 and 38272? 38272 Calculate the common denominator of -65/46 and 32/833. 38318 Calculate the smallest common multiple of 215 and 134160. 134160 What is the least common multiple of 654 and 528? 57552 What is the smallest common multiple of 728 and 652? 118664 What is the lowest common multiple of 156 and 15188? 592332 What is the smallest common multiple of 48 and 104898? 839184 Find the common denominator of 67/77708 and 53/777080. 777080 Calculate the least common multiple of 29064 and 18165. 145320 What is the least common multiple of 100472 and 175826? 703304 Calculate the least common multiple of 17520 and 584. 17520 What is the lowest common multiple of 535 and 160? 17120 Calculate the common denominator of -107/1848315 and -29/3. 1848315 What is the lowest common multiple of 10330 and 4132? 20660 What is the lowest common multiple of 6360 and 189210? 756840 Find the common denominator of -59/84 and 97/79086. 158172 Find the common denominator of -35/209856 and 27/61208. 1468992 Calculate the common denominator of -31 and 42/122765. 122765 What is the least common multiple of 111 and 184737? 6835269 What is the least common multiple of 400 and 13796? 1379600 What is the lowest common multiple of 15548 and 7176? 93288 What is the smallest common multiple of 2508 and 16104? 305976 Find the common denominator of 97/9075 and -103/825. 9075 Find the common denominator of -49/204 and 19/9588. 9588 What is the common denominator of -25/529 and -29/16882? 388286 What is the lowest common multiple of 5670 and 770? 62370 Calculate the common denominator of 5/48711 and -5/14988. 194844 What is the lowest common multiple of 612 and 34816? 313344 Calculate the common denominator of 75/15182 and 91/30. 227730 Find the common denominator of 93/119152 and -3/834064. 834064 Find the common denominator of 77/28950 and -11/185280. 926400 Find the common denominator of -31/8 and -1/678328. 678328 What is the common denominator of 41/20 and -43/35974? 359740 Calculate the smallest common multiple of 4917 and 2607. 388443 Calculate the common denominator of -127/220 and 11/73520. 808720 Find the common denominator of 41/62881 and 63/17966. 125762 Calculate the smallest common multiple of 23160 and 72. 69480 Calculate the smallest common multiple of 425 and 475. 8075 Calculate the smallest common multiple of 115872 and 1278. 347616 What is the common denominator of -59/187 and 125/714? 7854 What is the common denominator of -23/316872 and -34/1215? 1584360 What is the common denominator of -71/30 and -34/105? 210 What is the least common multiple of 4 and 1258? 2516 What is the common denominator of -131/21306 and 71/220162? 660486 Calculate the smallest common multiple of 20 and 4982160. 4982160 What is the least common multiple of 297650 and 16? 2381200 Find the common denominator of -23/18 and 127/11454. 34362 What is the least common multiple of 124 and 131564? 131564 What is the common denominator of 97/18 and 13/10466? 94194 What is the lowest common multiple of 2277 and 440? 91080 Calculate the smallest common multiple of 1358 and 1785. 346290 Find the common denominator of -11/29085 and 37/693. 959805 What is the common denominator of 149/2580 and -131/112230? 224460 What is the smallest common multiple of 468 and 9594? 19188 Calculate the least common multiple of 153636 and 217. 153636 What is the common denominator of 44/1257 and 23/838? 2514 What is the common denominator of 29/6806 and -101/328? 27224 What is the smallest common multiple of 9690 and 24? 38760 Find the common denominator of -67/3903 and -47/23418. 23418 Calculate the lowest common multiple of 21219 and 3652. 7044708 Find the common denominator of -67/8793 and -34/294077. 2646693 Calculate the lowest common multiple of 5840 and 331712. 1658560 What is the common denominator of 11/68598 and 31/42? 480186 What is the least common multiple of 52 and 136396? 136396 What is the least common multiple of 43212 and 264? 950664 Find the common denominator of -123/50 and 23/11780. 58900 Calculate the lowest common multiple of 2 and 122. 122 What is the smallest common multiple of 224 and 5792? 40544 Calculate the lowest common multiple of 8658 and 1590. 2294370 Calculate the least common multiple of 77308 and 8. 154616 Calculate the common denominator of -181/180 and -83/11610. 23220 What is the common denominator of 77/1060 and 5/2052? 543780 Calculate the smallest common multiple of 297 and 4587. 41283 What is the common denominator of -15/32923 and -11/353174? 3884914 Find the common denominator of -105/466972 and 131/36. 4202748 What is the lowest common multiple of 22040 and 20? 22040 What is the least common multiple of 325028 and 32? 2600224 Calculate the lowest common multiple of 41208 and 40. 206040 Find the common denominator of -209/25620 and -9/59780. 179340 Find the common denominator of -6/5857 and -39/1399823. 1399823 Calculate the common denominator of -85/144 and 151/31014. 248112 Find the common denominator of -119/13512 and -7/2252. 13512 What is the common denominator of 104/38115 and -151/353430? 3887730 Calculate the smallest common multiple of 45648 and 40576. 365184 What is the least common multiple of 4036 and 473221? 1892884 What is the lowest common multiple of 51447 and 14031? 154341 Calculate the least common multiple of 156 and 79569. 4137588 What is the lowest common multiple of 18420 and 509620? 1528860 What is the common denominator of -11/1147 and -127/222? 6882 What is the common denominator of -11/2807 and 121/8020? 56140 Find the common denominator of 41 and 7/137183. 137183 Calculate the lowest common multiple of 105 and 471786. 2358930 What is the common denominator of 67/24 and -137/87456? 87456 Cal	{ "pile_set_name": "DM Mathematics" }
w be -1(-15 - -16 - 312). Suppose -l + w = -j + 31, l + 4j + 16 = 0. Which is bigger: l or 12/23? 12/23 Let z = -19160 + 19161. Which is smaller: z or -6522? -6522 Let s = 517 - 513. Suppose sk = -n - 5, k - n = -3n - 10. Let p be 2 + ((-4)/14 - 1). Which is smaller: p or k? k Let u(m) = -m2 - 11m + 68. Let t be u(-16). Let h(y) be the second derivative of y*3/3 - 2y*2 + 4y. Let i be h(3). Is t less than or equal to i? True Suppose 0 = 3k - 3u + 15, -5k + 4u - 19 - 5 = 0. Let j be ((-135)/225)/(k/50). Which is bigger: 9 or j? 9 Let p(q) = -q*2 + 22q - 89. Let f be p(16). Which is smaller: f or 114? f Let r(h) = h*2 - 3h - 5. Let d be r(-8). Suppose d + 52 = m - 4g, 489 = 4m + g. Let f = 373/3 - m. Which is bigger: 0 or f? f Suppose -12o + 258 = -13o. Let v = -259 - o. Which is bigger: 2/713 or v? 2/713 Let s(j) = -115j - 774. Let c be s(-6). Is -671/8 <= c? False Let m(j) = -j2 + 27j + 41. Let y be m(22). Let f = 150 - y. Which is smaller: f or 5/12? f Let q = -55 - -66. Suppose 17 + q = -2n. Let x = -35 - n. Which is bigger: x or -0.1? -0.1 Suppose 0 = 5y + 2j + 6832 + 18610, 3j - 25437 = 5y. Is -5089 >= y? False Let b be ((-15)/(-110))/(-3)(-12)/9. Is -2/3 less than b? True Suppose 0 = -4u + 5 - 9. Let d be (36/(-20))/(u - (-21)/30). Suppose -2s - 5n = 9, 0 = -dn + 2n + 4. Which is greater: -6 or s? -6 Let h = 3071/1155 - 106/231. Let r = -1 - -2. Which is greater: r or h? h Let v(l) = 5l - l*3 + 74l*2 - 5 - 39l*2 - 31l*2 + l. Let p be v(5). Which is bigger: -9/19 or p? p Suppose 2y - 5d + 19 = 0, -y - d = -6d + 22. Let n = -0.33 + -57.67. Let k = n + 64. Are k and y equal? False Suppose -86v - 232 = -94v. Let y(g) = -4g + 115. Let s be y(v). Which is smaller: -3/46 or s? s Suppose 0g + 32 = 4g - 3y, -2y - 8 = 0. Suppose gs = 5n - 165, -4n + 162 = n - 2s. Let d be (-187)/9 - n/144. Is d < -22? False Let z be 1788/252 + (-14)/2. Let u be (101/(-5))/(2 - 4). Let v = 21/2 - u. Is v greater than z? True Let o be (1/4)/((-144)/6451). Which is smaller: 1 or o? o Let i be ((-8)/66)/((-2)/(-36)). Let g(m) = -15m - 106. Let z(x) = -x3 - 6x*2 - 5x - 1. Let k be z(-2). Let h be g(k). Which is smaller: h or i? i Let w = -50 - -30. Let y(l) = l + 21. Let n be y(w). Let q be (-11)/20 + (49/28 - n). Which is smaller: 0 or q? 0 Suppose 4t = -3i - 441 - 87, 4i - 3t = -729. Let w be 1/(-10)i/(-4635). Which is smaller: w or 1? w Suppose -10q + 3193 + 527 = 0. Let z = 785/2 - q. Let l = z - 169/6. Is -7 >= l? True Let r be -1 + 4/(252/(-427)). Suppose 25 - 16 = 3v. Suppose 64 = vy - 11y. Which is bigger: y or r? r Let m = -38 - -38.044. Let y = m - -28.956. Let u = y + -24. Is 0 bigger than u? False Suppose 1066 = -29w - 326. Let s be (12/(-16))/((-296)/w). Which is bigger: s or 0? 0 Let v = 90.427 - -0.973. Is 2 != v? True Let i be (2 - 81) + (15964047/264)/69. Which is smaller: i or 870? 870 Let h = 25058 + -25065. Is h less than -379.7? False Suppose 5q - 4j = 1807, -5q + 3j = -6q + 350. Suppose 915 = -26m - q. Is m >= -99/2? True Let w be (72/(-20))/(3/60). Let t = w - -72. Suppose t = -5p - 2j - 4, -2 + 0 = -3p + j. Which is bigger: 5 or p? 5 Suppose 58 = -w + 56. Let j be (-1)/w + (-255)/30. Which is smaller: j or -52/7? j Suppose -3n - 3k - 3534 = 0, n - 5n - 4722 = 2k. Which is smaller: -1185 or n? -1185 Let p be 4/54 + (-246100)/2484. Is 1 greater than or equal to p? True Let v = -6954 + 6953.95221. Is -1 <= v? True Let m = 518.4 + -517.746. Does m = 6? False Let g = 2.3821 - 2.5821. Which is greater: g or 0.381? 0.381 Let j = 856 + -9388/11. Let k be (-3)/((-12)/8 - 0). Which is bigger: k or j? j Let x(q) = -q*2 + 56q - 407. Let b be x(12). Is 2296/19 at least as big as b? False Let l = 0.174 + 0.826. Suppose 125 = 2n + 3n. Let g = n - 101/4. Which is smaller: l or g? g Let p = -2393 - -1039. Is p bigger than -1354? False Let p = -9.529 + -0.171. Let a = p - -49.7. Let l = a + -3. Which is smaller: l or -0.1? -0.1 Let n = -29022/5 + 27669/5. Which is smaller: n or -272? -272 Suppose 0 = -40f + 1723 - 1683. Are 2/4245 and f unequal? True Suppose 5b + 5964 = 20d - 16d, -d + 3b + 1484 = 0. Is d at least as big as 1495? True Let l = 3 - 11. Let g(u) = -u3 - 9u*2 - 22u - 65. Suppose 2i - a = -14, 29i = 27i - 5a - 14. Let x be g(i). Is l < x? False Suppose 0 = -47m + 72m. Which is smaller: -2/6115 or m? -2/6115 Let q(t) = -t3 - t2 - t - 16. Let g be q(-8). Suppose -17r + g = -87. Which is bigger: -2 or r? r Suppose 5w - 29460 = 32u - 36u, -3u - 23599 = -4w. Is w at most as big as 5896? True Let x = -3872.12 + 3872. Which is greater: 73 or x? 73 Let z = -45.74 + -0.26. Let y = 7995 + -7994.9. Is y != z? True Let z(n) = -577n - 42. Let c be z(-6). Suppose c = -6j + 3j. Let s = -10214/9 - j. Which is smaller: s or 5? 5 Let i = -138 + 121. Suppose -6j + 9j - 12 = 0. Suppose -k - 8v - 38 = -3v, -jk = -2v + 64. Which is bigger: k or i? i Suppose -317o - 46o - 302o = 237o. Let u be (4/722)/(-1 + 2). Does u = o? False Let a = -2512 - -2815. Which is greater: a or -8? a Let w(m) = -m3 - 27m*2 - 2m - 58. Suppose -11d - 108 = -7d. Let a be w(d). Let n be 32(-1)/9 - a. Which is greater: -1 or n? n Let r = -3009 + 2952. Is r != -75? True Let v be -14 - (-1491)/(-63)45. Is -1089 less than or equal to v? True Let c = 21867/274 - -780/137. Let o = -160 - -246. Is o > c? True Let r be 11/(-2)(-59 + -7). Suppose -rj = -21j + 24. Is -31/19 bigger than j? True Let i = 126.92 + -176.4. Is i greater than or equal to 1? False Let b = -153815251/324114 - -1/46302. Which is bigger: -475 or b? b Let k be ((-53310440)/(-42))/4 - 0. Let c = k - 317200. Let w = c - 124. Are 0 and w unequal? True Let d(t) = -36t - 4. Let i be d(2). Let v be 2960/(-38) - (10 + (-2444)/247). Which is smaller: v or i? v Let j = -1 - -5. Let o(m) = -m. Let v be o(j). Let z = 3466478 + -3466479.1. Does z = v? False Let p = 429.55013 + -0.05013. Which is greater: p or 2/7? p Let d = 146.097 + -146. Let j = 0.197 - d. Is j greater than or equal to 130? False Let j = -3588 + 2081041/580. Is -3/4 less than j? True Let v = -19866 - -21801. Are 1934 and v unequal? True Let z be 0/(-14 + 10) - -264. Is 236 <= z? True Let w be 1 + (1347 + -2 - -2). Let a = 4007/3 - w. Suppose 5z + 38 = -3j, 16986j + 4z = 16987j + 7. Is a >= j? False Let d = -1762 + 835.23. Let g = 927 + d. Let b = 1 + 1. Is g <= b? True Let x(u) = 2u + 4. Let t be x(10). Let q = 37895 - 416569/11. Are q and t non-equal? True Let k = 65 + -32. Let s be 1/(-3) - (-143)/k. Suppose su + 31 = -65. Are u and -26 nonequal? True Let m = 43 + -93. Let t = m - -86. Suppose 2x = -3j - 24, 3j + x = 3x - t. Which is bigger: j or -11? j Suppose -5o + 0u = 4u - 2730, 0 = 4o + 5u - 2193. Let d = 527 - o. Let w = -36 - -22. Does w = d? False Suppose -3j + 3d - 6 = 0, -d = -1 - 3. Let z(q) = -3q*j - 5q + 6q - 10 - 18q. Let u be z(-5). Is -2/17 bigger than u? False Let o be (1513/2314)/((-5)/(-30)219). Which is bigger: -1 or o? o Suppose -4n - 827 = 933. Let z(v) = -v*3 + 10v*2 + 6v - 225. Let y be z(12). Which is greater: y or n? n Let a = -6 + 8. Let c = -689.56 - -675.5196. Let x = -0.0404 - c. Which is greater: x or a? x Let n(u) = -u*2 + 17u - 29. Let o be ((-10)/2 + 0)-3. Let q be n(o). Let g be 0/(q/(-1)4). Which is greater: -4/9 or g? g Let l(c) = -c*3 - 11c*2 - 12c - 22. Let f = -292 + 282. Let b be l(f). Is -8 > b? False Let j = -10258.5 + 10710. Which is smaller: 0.2 or j? 0.2 Let o be ((-13)/(45747/(-27)))/(6/4). Suppose 0 = -7h + 8h. Is h > o? False Let z be (-2992)/(12)(6/(-2) + 4). Which is smaller: z or -1493? z Let c be (0 + 3/5)/(16/80). Let z be 21/(-294)(10970/c + -2). Let f = 261 + z. Which is greater: f or 1/3? 1/3 Let v be 722/6 + (-1)/3. Let p = -15611 + 15731. Is v at least p? True Let v be (-1)/(((-3)/(-30))/((-4)/(-10))). Let u be (v/16)/(18306/(-4584) - -4). Is u >= -37? False Let c(b) = b2 + b + 5. Let w be c(-3). Suppose 262h - 7 = 261*h. Is w at least as big as h? True Let z = 946.3 - -2010.7. Which is smaller: z or 2/15? 2/15 Let l be (108/5)/(5/25). Let r be (((-8)/3)/2)/((-144)/l). Let o = 17265/476 + -254/7. Is r at most o? False Let w be	{ "pile_set_name": "DM Mathematics" }
/3, to the nearest integer? 1604 What is 5399746209 to the power of 1/2, to the nearest integer? 73483 What is the third root of 491211486 to the nearest integer? 789 What is 4807411074 to the power of 1/4, to the nearest integer? 263 What is 25633284 to the power of 1/8, to the nearest integer? 8 What is the square root of 1104614097 to the nearest integer? 33236 What is 29231852 to the power of 1/7, to the nearest integer? 12 What is 19750381 to the power of 1/7, to the nearest integer? 11 What is the third root of 554530657 to the nearest integer? 822 What is the third root of 1321827576 to the nearest integer? 1097 What is 3984160 to the power of 1/3, to the nearest integer? 159 What is the third root of 2463685989 to the nearest integer? 1351 What is the cube root of 4873428992 to the nearest integer? 1695 What is 70167467 to the power of 1/2, to the nearest integer? 8377 What is the seventh root of 226412054 to the nearest integer? 16 What is the fourth root of 2136959598 to the nearest integer? 215 What is 2754406931 to the power of 1/3, to the nearest integer? 1402 What is the cube root of 1339302149 to the nearest integer? 1102 What is 25324845 to the power of 1/2, to the nearest integer? 5032 What is the eighth root of 7629743200 to the nearest integer? 17 What is 69334723 to the power of 1/4, to the nearest integer? 91 What is the third root of 28143294 to the nearest integer? 304 What is the cube root of 268039378 to the nearest integer? 645 What is the cube root of 99574313 to the nearest integer? 463 What is the square root of 109526729 to the nearest integer? 10466 What is the third root of 1911431521 to the nearest integer? 1241 What is the tenth root of 101895729 to the nearest integer? 6 What is the eighth root of 926777658 to the nearest integer? 13 What is the square root of 473377738 to the nearest integer? 21757 What is the cube root of 31108213 to the nearest integer? 315 What is 130871429 to the power of 1/2, to the nearest integer? 11440 What is the square root of 1127496 to the nearest integer? 1062 What is the square root of 2438138292 to the nearest integer? 49378 What is 184219086 to the power of 1/2, to the nearest integer? 13573 What is the cube root of 1492736917 to the nearest integer? 1143 What is 1412546968 to the power of 1/3, to the nearest integer? 1122 What is 437317117 to the power of 1/2, to the nearest integer? 20912 What is 1266623598 to the power of 1/3, to the nearest integer? 1082 What is 9281871184 to the power of 1/3, to the nearest integer? 2102 What is the square root of 44149841 to the nearest integer? 6645 What is the cube root of 1745136587 to the nearest integer? 1204 What is the cube root of 106282297 to the nearest integer? 474 What is 108558871 to the power of 1/6, to the nearest integer? 22 What is the third root of 114468146 to the nearest integer? 486 What is the cube root of 588778382 to the nearest integer? 838 What is the ninth root of 1901277457 to the nearest integer? 11 What is the cube root of 1310593637 to the nearest integer? 1094 What is 1191141681 to the power of 1/2, to the nearest integer? 34513 What is the eighth root of 970641598 to the nearest integer? 13 What is the cube root of 1013217173 to the nearest integer? 1004 What is 68601735 to the power of 1/6, to the nearest integer? 20 What is the square root of 1288240862 to the nearest integer? 35892 What is the cube root of 6402186894 to the nearest integer? 1857 What is the third root of 20286258 to the nearest integer? 273 What is 89174851 to the power of 1/2, to the nearest integer? 9443 What is the seventh root of 126106094 to the nearest integer? 14 What is the third root of 91427555 to the nearest integer? 450 What is the third root of 347404027 to the nearest integer? 703 What is the seventh root of 47620390 to the nearest integer? 12 What is 31916866 to the power of 1/2, to the nearest integer? 5650 What is 676303779 to the power of 1/7, to the nearest integer? 18 What is the fourth root of 127528851 to the nearest integer? 106 What is 450154486 to the power of 1/7, to the nearest integer? 17 What is 72091967 to the power of 1/9, to the nearest integer? 7 What is 472528309 to the power of 1/2, to the nearest integer? 21738 What is 133982328 to the power of 1/10, to the nearest integer? 6 What is 570754599 to the power of 1/3, to the nearest integer? 830 What is 165726091 to the power of 1/8, to the nearest integer? 11 What is the eighth root of 36478933 to the nearest integer? 9 What is the cube root of 18044983 to the nearest integer? 262 What is the square root of 143795719 to the nearest integer? 11991 What is the square root of 532368233 to the nearest integer? 23073 What is the third root of 178158607 to the nearest integer? 563 What is the fourth root of 232646629 to the nearest integer? 124 What is the cube root of 4965888558 to the nearest integer? 1706 What is 91799799 to the power of 1/7, to the nearest integer? 14 What is 3466880518 to the power of 1/9, to the nearest integer? 11 What is 1073474855 to the power of 1/10, to the nearest integer? 8 What is the tenth root of 275835825 to the nearest integer? 7 What is the third root of 3454476003 to the nearest integer? 1512 What is 694304374 to the power of 1/2, to the nearest integer? 26350 What is the cube root of 2499282 to the nearest integer? 136 What is 34490125 to the power of 1/8, to the nearest integer? 9 What is the cube root of 108595464 to the nearest integer? 477 What is the ninth root of 254444695 to the nearest integer? 9 What is the square root of 78745982 to the nearest integer? 8874 What is 40380797 to the power of 1/4, to the nearest integer? 80 What is the square root of 6578643232 to the nearest integer? 81109 What is 26787950 to the power of 1/5, to the nearest integer? 31 What is 311067373 to the power of 1/3, to the nearest integer? 678 What is 4661951458 to the power of 1/2, to the nearest integer? 68278 What is the third root of 663347503 to the nearest integer? 872 What is the square root of 6439774 to the nearest integer? 2538 What is the eighth root of 2105987246 to the nearest integer? 15 What is the sixth root of 312610446 to the nearest integer? 26 What is 2775971642 to the power of 1/4, to the nearest integer? 230 What is the third root of 615937709 to the nearest integer? 851 What is the square root of 26940785 to the nearest integer? 5190 What is the square root of 2047878878 to the nearest integer? 45253 What is 37511228 to the power of 1/3, to the nearest integer? 335 What is 56475416 to the power of 1/2, to the nearest integer? 7515 What is the square root of 318454588 to the nearest integer? 17845 What is the cube root of 26755609 to the nearest integer? 299 What is 926873409 to the power of 1/7, to the nearest integer? 19 What is 927800510 to the power of 1/3, to the nearest integer? 975 What is the cube root of 3109135512 to the nearest integer? 1460 What is 78171129 to the power of 1/5, to the nearest integer? 38 What is the fourth root of 63178051 to the nearest integer? 89 What is the cube root of 53914640 to the nearest integer? 378 What is the ninth root of 5273742713 to the nearest integer? 12 What is 276331862 to the power of 1/3, to the nearest integer? 651 What is the square root of 2300009253 to the nearest integer? 47958 What is the eighth root of 47797481 to the nearest integer? 9 What is the square root of 632942809 to the nearest integer? 25158 What is 163820905 to the power of 1/9, to the nearest integer? 8 What is 279578118 to the power of 1/2, to the nearest integer? 16721 What is 31118285 to the power of 1/2, to the nearest integer? 5578 What is 589378988 to the power of 1/2, to the nearest integer? 24277 What is the third root of 506644259 to the nearest integer? 797 What is 25156493 to the power of 1/7, to the nearest integer? 11 What is 5366371692 to the power of 1/6, to the nearest integer? 42 What is the square root of 262345698 to the nearest integer? 16197 What is the tenth root of 17054812 to the nearest integer? 5 What is the cube root of 7194836679 to the nearest integer? 1931 What is 290411962 to the power of 1/3, to the nearest integer? 662 What is the third root of 3841308288 t	{ "pile_set_name": "DM Mathematics" }
e the prime factors of 933937172? 2, 7, 19, 23, 127, 601 List the prime factors of 799228085. 5, 159845617 List the prime factors of 313697400. 2, 3, 5, 522829 What are the prime factors of 132264506? 2, 11, 211, 28493 What are the prime factors of 407943467? 407943467 List the prime factors of 56577576. 2, 3, 11, 214309 What are the prime factors of 2685938975? 5, 241, 445799 List the prime factors of 45844564. 2, 11461141 What are the prime factors of 617416952? 2, 77177119 What are the prime factors of 80998937? 79, 1025303 What are the prime factors of 2193824998? 2, 43, 25509593 List the prime factors of 5358949. 971, 5519 List the prime factors of 493055867. 493055867 List the prime factors of 4695058. 2, 53, 44293 List the prime factors of 549341667. 3, 7, 859, 10151 List the prime factors of 46913317. 11, 4264847 What are the prime factors of 242801650? 2, 5, 7, 13, 17, 43, 73 List the prime factors of 37786130. 2, 5, 29, 4493 What are the prime factors of 219645968? 2, 13727873 What are the prime factors of 457281879? 3, 152427293 List the prime factors of 1755037824. 2, 3, 4570411 What are the prime factors of 3067136628? 2, 3, 29, 241, 36571 What are the prime factors of 68242335? 3, 5, 7, 17, 38231 List the prime factors of 1269595508. 2, 317398877 What are the prime factors of 35505636? 2, 3, 2958803 List the prime factors of 41521039. 7, 67, 223, 397 List the prime factors of 483299376. 2, 3, 7, 643, 2237 List the prime factors of 253866282. 2, 3, 283, 307, 487 List the prime factors of 197554786. 2, 11, 13, 29, 23819 What are the prime factors of 1441138494? 2, 3, 113, 409, 5197 List the prime factors of 168471793. 7, 24067399 List the prime factors of 1363841823. 3, 454613941 What are the prime factors of 28941470? 2, 5, 1117, 2591 What are the prime factors of 16510812? 2, 3, 1375901 What are the prime factors of 1348241832? 2, 3, 7, 31, 86293 List the prime factors of 891738647. 19, 46933613 List the prime factors of 1960294437. 3, 97, 883, 2543 List the prime factors of 95532109. 95532109 List the prime factors of 74609698. 2, 103, 373, 971 What are the prime factors of 35928447? 3, 211, 269 What are the prime factors of 380590411? 380590411 List the prime factors of 23185085. 5, 7, 11, 1229 What are the prime factors of 1607319907? 521, 3085067 List the prime factors of 1616104290. 2, 3, 5, 53870143 What are the prime factors of 5499995860? 2, 5, 929, 296017 List the prime factors of 65206569. 3, 21735523 What are the prime factors of 192933523? 103, 1873141 What are the prime factors of 25639087? 233, 110039 What are the prime factors of 87687766? 2, 41, 1069363 List the prime factors of 406958691. 3, 135652897 What are the prime factors of 626125401? 3, 11, 1997, 3167 What are the prime factors of 822174910? 2, 5, 17, 73, 97, 683 List the prime factors of 132475868. 2, 7, 4731281 List the prime factors of 1879395306. 2, 3, 79, 191, 20759 List the prime factors of 103925410. 2, 5, 43, 241687 What are the prime factors of 158344776? 2, 3, 31, 61, 1163 What are the prime factors of 541881594? 2, 3, 30104533 What are the prime factors of 349870286? 2, 174935143 List the prime factors of 1264899796. 2, 316224949 List the prime factors of 5265112284. 2, 3, 29, 37, 136303 What are the prime factors of 2202702093? 3, 37, 97, 7577 What are the prime factors of 399330553? 6779, 58907 What are the prime factors of 16741004? 2, 7, 29, 53, 389 List the prime factors of 55549198. 2, 19, 1461821 What are the prime factors of 3380520633? 3, 7, 29, 792991 List the prime factors of 2876472029. 17, 6337, 26701 What are the prime factors of 64010944? 2, 1000171 List the prime factors of 3847346. 2, 167, 11519 List the prime factors of 868213812. 2, 3, 439, 164809 What are the prime factors of 76265920? 2, 5, 238331 What are the prime factors of 85811949? 3, 71, 134291 What are the prime factors of 5053700? 2, 5, 97, 521 List the prime factors of 32583231. 3, 257, 14087 What are the prime factors of 51066418? 2, 13, 1964093 List the prime factors of 95446762. 2, 953, 50077 What are the prime factors of 115364142? 2, 3, 17, 125669 What are the prime factors of 86764308? 2, 3, 193, 37463 List the prime factors of 1812669219. 3, 373, 179989 What are the prime factors of 91690721? 29, 3161749 What are the prime factors of 157716954? 2, 3, 101, 86753 What are the prime factors of 257900735? 5, 51580147 What are the prime factors of 326038636? 2, 7, 11, 1058567 What are the prime factors of 14584887? 3, 540181 What are the prime factors of 120313539? 3, 17, 262121 List the prime factors of 2704194448. 2, 83, 1117, 1823 What are the prime factors of 303559051? 457, 664243 List the prime factors of 80175571. 7, 11453653 What are the prime factors of 5032395841? 11, 19, 24078449 List the prime factors of 376825912. 2, 103, 229, 1997 What are the prime factors of 62767804? 2, 11, 1426541 List the prime factors of 25263394. 2, 13, 17, 61, 937 List the prime factors of 23310142. 2, 29, 53, 7583 What are the prime factors of 3546943553? 101, 113, 310781 List the prime factors of 39121993. 337, 116089 List the prime factors of 3645974246. 2, 1822987123 What are the prime factors of 41388226? 2, 11, 73, 25771 List the prime factors of 629990043. 3, 197, 1065973 List the prime factors of 58659478. 2, 47, 624037 What are the prime factors of 2139506214? 2, 3, 1033, 345193 List the prime factors of 43355743. 4241, 10223 List the prime factors of 47420906. 2, 13, 137, 13313 What are the prime factors of 151383522? 2, 3, 47, 179, 2999 List the prime factors of 19076799. 3, 7, 908419 List the prime factors of 146978293. 7, 11, 29, 9403 What are the prime factors of 1457228149? 13, 131, 855683 List the prime factors of 4377649312. 2, 653, 209497 List the prime factors of 597750746. 2, 298875373 What are the prime factors of 506700254? 2, 137, 1849271 List the prime factors of 25270090. 2, 5, 2527009 What are the prime factors of 1748728776? 2, 3, 241, 463, 653 List the prime factors of 5841352591. 11909, 490499 What are the prime factors of 314591370? 2, 3, 5, 97, 108107 What are the prime factors of 83396551? 7, 23, 517991 What are the prime factors of 5470630032? 2, 3, 7, 883, 18439 List the prime factors of 161380181. 161380181 List the prime factors of 2092489516. 2, 13, 59, 682037 What are the prime factors of 90916806? 2, 3, 15152801 List the prime factors of 6682606457. 1499, 4458043 List the prime factors of 108188290. 2, 5, 7, 1545547 List the prime factors of 86680773. 3, 17, 20983 What are the prime factors of 230550644? 2, 73, 789557 List the prime factors of 61898476. 2, 1223, 12653 What are the prime factors of 51363385? 5, 251, 40927 What are the prime factors of 3513181970? 2, 5, 1123, 312839 List the prime factors of 94288569. 3, 23, 103, 13267 List the prime factors of 199384900. 2, 5, 11, 13, 73, 191 What are the prime factors of 322443960? 2, 3, 5, 2687033 What are the prime factors of 84143438? 2, 17, 19, 130253 What are the prime factors of 122997343? 7, 409, 42961 List the prime factors of 413459379. 3, 89, 516179 List the prime factors of 280144644. 2, 3, 13, 31, 53, 1093 List the prime factors of 836024011. 17, 49177883 List the prime factors of 63268174. 2, 157, 201491 List the prime factors of 47393261. 47393261 What are the prime factors of 76408508? 2, 11, 1736557 What are the prime factors of 1331878177? 7, 190268311 List the prime factors of 151339482. 2, 3, 7, 71, 5639 List the prime factors of 54861411. 3, 11, 1662467 List the prime factors of 49087027. 11, 4462457 What are the prime factors of 3864854358? 2, 3, 17, 23, 183047 What are the prime factors of 473759308? 2, 11, 10767257 List the prime factors of 547023287. 547023287 What are the prime factors of 830607932? 2, 7, 11, 2696779 What are the prime factors of 67765258? 2, 11, 47, 65537 List the prime factors of 624171848. 2, 3083, 25307 List the prime factors of 39801759. 3, 233, 56941 List the prime factors of 49932034. 2, 23, 709, 1531 List the prime factors of 7792540. 2, 5, 7, 55661 What are the prime factors of 2762648446? 2, 3229, 427787 What are the prime factors of 455707784? 2, 7, 41, 198479 What are the prime factors of 981700521? 3, 327233507 What are the pri	{ "pile_set_name": "DM Mathematics" }
arrange -2v2 + 2v*2 - 10v*4 + (-12v + 0v + 5v)(-5 + 5 + v3) to k + fv*4 + lv*2 + pv + zv3 and give k. 0 Rearrange -3b + 5b - 3b + (-2b + 3b + 3b)(-3 + 3 - 1) + b - 2 - 2b + 3b to mb + f and give m. -3 Rearrange 39z*2 - 86z*2 + 10z*2 - 47z*2 to rz*2 + uz + j and give r. -84 Rearrange w*2 + 6w - 4w - 2w*4 - 3w*3 + 6w + 2w3 to qw + vw4 + kw*2 + yw3 + p and give k. 1 Express (-l2 + l*2 + 2l*2)((-3 + 4 - 4)(3l - l - 4l) + 5 - 5 - 3l) as al + w + ml*3 + pl*2 and give m. 6 Express (-3q - 2q - q)(3 - 4 + 2) + (0 + 0 + q)(4 - 6 + 4) + 0q + 0q - 3q as y + xq and give x. -7 Rearrange z2 - 2z*4 + 2z + 5z - 3 - 5z to az + mz*4 + pz*3 + fz*2 + i and give a. 2 Express (28a*2 + 215a - 215a)(3 - a2 - 3) + a2 - a*4 - 3a*4 + 5a*4 in the form ra*3 + z + la*2 + oa + ha4 and give l. 1 Express (-3 + 5 - 4 + (0 + 4 - 5)(-2 + 2 + 1) - 4 + 0 + 2 + 3 - 1 + 0)(-10f + 10f + 12f*2) in the form j + bf*2 + gf and give b. -36 Rearrange -q - 19q3 + 17q3 - q2 - 3q + 5q to gq + vq*3 + j + kq*2 and give v. -2 Rearrange (3 + 0 - 4)(361 - 361 + 77o) to zo + f and give z. -77 Rearrange -2q + q2 - 7q*3 + q + 2q + 3q4 + 9q*3 to tq*3 + vq*2 + uq*4 + yq + g and give v. 1 Rearrange 7d2 + 2d*2 - 5 + 0 + 6 to the form pd*2 + t + nd and give t. 1 Rearrange -3j + 4j - 3j + (-1 - 3 + 5)(5j - 6j + 0j) + 2j + 2j - 5j + (1 - 2 + 2)(-2j + 5j - j) - j + 0 + 0 to the form m + aj and give a. -3 Rearrange -9g - 5g + g*2 - 18g*3 + 13g + 5g3 + 1 to ag + n + lg2 + og*3 and give l. 1 Express (-1 + 3w + 1)(0 + 2 - 1)(-2w + 0w + 3w) in the form vw*2 + iw + j and give v. 3 Express -b*4 + 0b*3 + 5b2 + 1 - b2 + 3b3 - 2b*3 as cb*4 + ib + fb3 + yb*2 + r and give y. 4 Rearrange -915o + 913o - 6o*2 - 12o*2 to s + fo + to2 and give f. -2 Express 1018 - 23q - 1018 in the form h + rq and give r. -23 Rearrange 0a2 - a3 + 6a + 2a*2 + 2a - 7a to the form va + ja2 + ua*3 + w and give j. 2 Express (4j4 + j3 - j*3)(-4 + 0 - 3) - 2j3 - j4 + 2j*3 as d + kj*3 + mj*4 + uj + pj2 and give m. -29 Rearrange 5n - 4n + n - 11 + 9 to the form j + in and give j. -2 Rearrange 19p2 + 35 - 35 + p to the form fp + qp2 + l and give q. 19 Express (-j + 0j - 5j)(-2 - 2 + 3)(3 - 2j - 3) in the form q + rj + hj*2 and give h. -12 Express -3i*2 - 2 + 4i - 2i + 0i in the form y + mi + ki*2 and give m. 2 Rearrange (-2r + r + 0r)(-3r - 3r + 4r) + (-97 - 6r + 97)(5r - 3r + 0r) to the form tr2 + jr + z and give t. -10 Express 614 - y*2 - 614 - 3y4 + y4 + 2y4 - 2y*4 + (-2y*3 + 0y*3 + 3y*3)(y + 5 - 5) as by4 + sy*3 + iy*2 + fy + w and give b. -1 Express (3 + 3 - 4)(23u + 20u - 33u)(1 - 3 - 1) as iu + m and give i. -60 Rearrange (-1 - 2 + 4)(-13 + 3q + 13) to lq + s and give l. 3 Rearrange (-2 + 2 - 2p)(-5 + 5 - 2p) - p*2 - 3p*2 + 2p2 + 2 - p2 - 2 + 2p + 21 + p2 + 19 - 2 to the form qp + kp2 + c and give q. 2 Express (-2 + 0 + 1)(-5 - 1 - 114k + 115k)(-2k + 2k + 3k) in the form z + jk2 + xk and give j. -3 Express (28d3 + 2d*3 + 10d*3)(-d + 3d - 3d) as j + xd2 + yd*3 + gd*4 + sd and give g. -40 Rearrange -s - 6s + 2s - 3s3 + 2s*3 + 0s*2 + 0s2 + (s2 - 2s + 2s)(-s - 2s + 0s) to ms + as3 + xs2 + q and give m. -5 Express h2 + 0h3 + 5h*3 - 4h*3 - h in the form lh*3 + yh*2 + p + xh and give l. 1 Express -4t2 + 40t - 808t3 + 807t*3 + 2t*2 as qt + st3 + rt*2 + z and give s. -1 Rearrange (-2f*3 - 2f + 2f)(-2f - 6f + 2f + (-3 - 3 + 4)(-2 - 2f + 2) - 3f - f + 2f) to gf*2 + jf*3 + u + pf + wf4 and give w. 8 Rearrange (68a + 1 + 37a - 7a)(2 - 4 + 3) to the form pa + g and give g. 1 Rearrange 2y + 4y + 4 - 1 - 2 to the form iy + l and give l. 1 Express (0r2 + r2 - 3r2)(-5527r + 10 - 7 + 5439r) in the form mr2 + l + cr + ur3 and give u. 176 Rearrange -r2 - 2r*3 - 5r*2 + 5r*2 + (0r + 0r - 2r)(23r*2 + 13r - 13r) to the form nr + hr3 + fr*2 + p and give f. -1 Express (-2p*3 - 2 + 2)(-4p + 4p + 5p) as jp + u + yp3 + np*4 + wp*2 and give n. -10 Express -4j*2 + 0j*2 + 2j*2 + 0j*2 + 2 as zj*2 + oj + r and give r. 2 Express -4y + 2y + 0y in the form i + sy and give s. -2 Express ((-2 - 2 + 3)(-1 + 4 - 2) + 3 + 3 - 4)(-6x + 2x + x - 1) - 10x - 14x + 3x in the form yx + f and give y. -24 Rearrange 0z2 - 9z + 2 - 4z2 + 9z to the form az2 + y + jz and give y. 2 Rearrange (46s + 52s - 72s)(-3s - 2s + s) - 3s2 + 3s*2 - s + 2s*2 to us*2 + h + ps and give p. -1 Rearrange 2w3 + 0w - w*3 - 2w4 + w4 + 2w + 2 to gw*4 + nw + zw2 + rw*3 + c and give r. 1 Express -2u + 0u - 2u + (-1 - 2 + 5)(0u - u + 5u) + (2 - 4 + 0)(-u - 2 + 2) in the form fu + j and give f. 6 Rearrange -14p - 9p - 20p to the form tp + l and give t. -43 Rearrange 62l*4 + 7l + 2 + 0 - 64l4 to gl*2 + yl*4 + ul*3 + q + rl and give q. 2 Rearrange 2g3 + 15g*2 - 2 + 0g - g - 16g2 + 0g to ng2 + og*3 + h + fg and give h. -2 Rearrange -2w2 + 7 + 4 + w3 - 8 + 3 to the form dw*2 + tw + k + zw3 and give k. 6 Rearrange 36 - 38 - 19v*2 + 0v*2 to the form p + jv + nv2 and give p. -2 Rearrange 10s*4 - 2 - 3s*3 - 11s + s*3 + 12s + 0s3 to the form ws + ys4 + i + ts*2 + ls*3 and give l. -2 Rearrange (8h*2 - 3h*2 - 9120 + 9135)((-3h + 5h - h)(-4h + h + 2h) + 2h - 2h - h2) to yh + k + ah3 + ih*4 + zh*2 and give z. -30 Express -4 - 14j4 + j2 - 2j3 + 2 + 12j*4 as pj + yj3 + dj*4 + f + hj*2 and give d. -2 Rearrange 13o*2 + 0o + o*2 + 0o to the form bo + x + no*2 and give n. 14 Rearrange 2 - 8t*2 + 23t*2 - 9t*2 to d + ut*2 + at and give u. 6 Rearrange -6d2 + d + 2d*3 - 3d*3 + 8d*2 + 0 + 1 to bd + nd2 + u + wd3 and give n. 2 Rearrange p2 + 4 + 2p3 + 9p + 18p - 2 to sp*3 + vp*2 + c + gp and give s. 2 Rearrange (2h + 2h - 7h + (0 + 3 - 1)(4 - 4 - 2h) + 0h - h + 3h)(-5h2 + 2h2 + h2) to bh + sh*3 + jh*2 + c and give s. 10 Rearrange (-5c + 0c - 2c)(-1 + 7c3 + 1) + c4 + 2c4 - 5c*4 + 2c*4 + 2c*2 - 2c*2 to the form mc*4 + n + wc*2 + xc*3 + zc and give m. -49 Express (3 - 5 + 3)(2 + 3 - 6)(3s - 4s - 7s) - 3 + 1 - 2s + 1 as r + os and give r. -1 Express 0o2 + 36 - 9 + o2 in the form no + po*2 + w and give w. 27 Express -16r*2 + 9r - 8r - 16 + 16 - r4 in the form pr + vr3 + c + zr*2 + lr*4 and give v. 0 Express 2s3 - s2 + 0s2 + 2s*3 in the form n + as*3 + is + us2 and give u. -1 Express (-8y + 1903 - 39y - 1904)(2y + 2y - 3y) in the form jy*2 + xy + d and give j. -47 Rearrange f - f*4 - f + (-7f3 + f3 + 11f3)(6f + 0f + 6f) + 2f*4 - 3f*3 + 3f*3 to the form pf*4 + r + uf*2 + xf*3 + tf and give p. 61 Rearrange (-2j - j + 2j)(8j*2 + 38j*2 - 2j*2)(-j + j + j) to the form aj4 + r + pj*3 + lj*2 + qj and give a. -44 Express -9h3 - 12 + 23h*3 - 11h*3 in the form fh*2 + ah + k + dh3 and give k. -12 Rearrange -6p + 16p - 4p - 7p to the form np + w and give n. -1 Express 4 - 2f3 - 2f*4 - 2f*3 + f - 2f*2 - 2 + 10f*3 as df*4 + o + mf*3 + jf + tf2 and give d. -2 Express -z4 + 3z4 - z3 + 2z3 - 7z*4 + 4 in the form vz*4 + tz + kz2 + bz*3 + h and give h. 4 Express -2 + 2 - 2i*2 + (-7 + 10 - 8)(-3 + i*2 + 3) - 5i2 - i2 + 5i2 as ji + l + oi2 and give o. -8 Express -1 + u3 + 1 + (-u + 0u - u)(u + 2u2 - u) - 3 - u3 + 3 - u - 12u + 7u*3 - 9u*3 as d + bu + xu3 + ru*2 and give b. -13 Express 49c - 40c + 63c as tc + m and give t. 72 Rearrange -2f + 9f - 5 - 3f - 9f + f2 to the form df*2 + a + uf and give d. 1 Rearrange 3 - 2o3 + o4 - 5 - 7o + 5o to the form do*4 + p + fo + wo3 + jo*2 and give p. -2 Express (-6 - 1 + 2)(-2j + 7j - 3j)(0 + 0 - j**2 +	{ "pile_set_name": "DM Mathematics" }
t z(y) = 2l(y) + 6t(y). What is the third derivative of z(m) wrt m? 60336m - 12 Let p(g) = 3459g*2 + 15g + 21. Let r(i) = i. Let k(o) = p(o) + r(o). Find the second derivative of k(q) wrt q. 6918 Suppose 0 = -3c + 3g - 10 + 4, -5c - g + 20 = 0. Find the third derivative of -t - 42t*2 - 84t*3 - 31t*c + 82t*2 wrt t. -690 Let g(d) be the second derivative of 6d*7/7 + 11d*6/30 + 40d*3 + 2d*2 - 8390d. Find the second derivative of g(x) wrt x. 720x3 + 132x*2 Let l(s) = -5247s*2 + 587s - 5. Let q(h) = 5245h2 - 586h + 4. Let i(f) = -4l(f) - 5q(f). What is the second derivative of i(w) wrt w? -10474 Let g(b) be the first derivative of 51b6 - b5/5 + 2b*3/3 - 608b*2 - 4083. What is the second derivative of g(n) wrt n? 6120n*3 - 12n*2 + 4 Let h(p) be the first derivative of -956p*6/3 + 47p*2/2 - 20p + 1971. Find the second derivative of h(r) wrt r. -38240r3 Find the third derivative of 216 + 76 - 65h*2 + 1277h*4 - 320h*4 + 64h*2 wrt h. 22968h Let y(m) be the third derivative of 125m7/42 + 24m*3 + 469m*2 + 2. Differentiate y(l) with respect to l. 2500l*3 Let j(c) = -4c + 6. Let f be j(-5). Find the third derivative of -fr2 - 5519r - 52r3 + 5519r + 1 wrt r. -312 Differentiate 1398r4 + 1287r*4 + 1104r*4 - 406r*4 - 929 with respect to r. 13532r*3 Let i = -1 + 3. Suppose z + 24 = 7z. Find the third derivative of -866g - zg*2 + 866g + ig3 wrt g. 12 Suppose -x = -5k - 0x + 352, -5x - 56 = -k. Suppose -k = -9a + 28. Find the second derivative of 0n - 14n + 5n + 3n2 - an wrt n. 6 Let b(g) = 5993g + 3908. Let a(t) = -29966t - 19596. Let p(u) = 3a(u) + 14b(u). What is the derivative of p(o) wrt o? -5996 Let j(n) = 2n2 - n + 1. Let x be j(1). Suppose 3r + xr - 17 = 2t, -5t = -2r - 10. Find the second derivative of 0gr - 3g - g + 5g - 2g*5 wrt g. -40g*3 Let x(b) = -1527b*2 + 750b - 4. Let c(r) = 5r2 - r + 1. Let v(l) = -4c(l) - x(l). Find the second derivative of v(y) wrt y. 3014 Let i(p) be the third derivative of -p*6/60 - 1567p5/30 + p4/12 - 10909p3/6 + 4p*2 + p - 36. What is the derivative of i(q) wrt q? -6q*2 - 6268q + 2 Let q be 1/(157/(-79) - -2). Let s = 84 - q. Find the third derivative of -4m2 + sm*3 + 0m*3 + 20m*6 - 5m*3 wrt m. 2400m*3 Find the second derivative of 61311j - 123025j + 58391j - 7024j2 wrt j. -14048 Let s(g) = -231g*4 - 4g*2 - 114. Let a(l) = -231l*4 - 4l*2 - 112. Let k(t) = 10a(t) - 9s(t). What is the third derivative of k(m) wrt m? -5544m What is the second derivative of 1 + 145t5 + 1214t + 552t3 + 26t*5 - 167t*5 wrt t? 80t*3 + 3312t Let i(g) be the second derivative of 35/6g3 + 0 - 1/15g*6 + 0g*5 - 73g - 47/2g2 + 0g*4. Differentiate i(a) with respect to a. -8a*3 + 35 Let s(l) = 6l4 + l2 + l + 2. Let p(d) = -269d4 + 2d*3 - 4d*2 - 27d - 7. Let y(w) = p(w) + 3s(w). What is the third derivative of y(v) wrt v? -6024v + 12 Let l(z) = 50z + 148. Let s(g) = -2g - 1. Let w(m) = 5m2 - 19m + 11. Let k be w(3). Let q(a) = kl(a) - 2s(a). What is the derivative of q(t) wrt t? -46 Let z(j) be the third derivative of 0j4 + 19/24j*6 - 2 + 0j*3 + 0j + 15j2 + 11/3j*5. Find the third derivative of z(f) wrt f. 570 Let p(v) be the second derivative of 149v*7/7 - 6v*3 + 9v*2 + 9v + 11. Find the second derivative of p(t) wrt t. 17880t3 Let q(y) be the third derivative of -631y*8/336 - 3y*5/20 - 23y*3/3 + 948y*2. Find the third derivative of q(h) wrt h. -37860h2 Let i(b) = b4 - 2b3 - b + 1. Let m(s) = -58s*4 + 10s*3 + 307 + 6s - 11s + 2s + 7s. Let z(c) = -4i(c) - m(c). Differentiate z(o) wrt o. 216o3 - 6o*2 Suppose -4r = -5g + 63 - 12, 3r - 2 = -2g. Suppose 3u - gu + 76 = 0. What is the second derivative of -8y + uy3 - 8y*3 - 4y*3 wrt y? 42y Let l(h) = 2189h3 - 10h*2 - 2h - 2. Let a(n) = 10946n3 - 52n*2 - 11n - 13. Let p(v) = 2a(v) - 11l(v). What is the third derivative of p(f) wrt f? -13122 Differentiate 1116o4 - 1566 + 1071o*4 - 1355 + 981o*4 wrt o. 12672o*3 Let a be 16-33/(-36). Suppose -av + 10 = 2. Differentiate 38q2 + q - 61q*v - q - 20 wrt q. -46q Let c(l) be the first derivative of 3029l4/2 + 3922l - 2431. Differentiate c(j) wrt j. 18174j2 Let d(n) be the first derivative of -1204n3/3 + n2 - 413n - 106. What is the second derivative of d(q) wrt q? -2408 Let q(m) = -9m*4 - 64m*3 - 4m*2 - 2009. Let n(g) = -10g*4 - 63g*3 - 5g*2 - 2006. Let p(z) = -4n(z) + 5q(z). What is the derivative of p(a) wrt a? -20a*3 - 204a*2 Let l be (17/102)/((-16)/(-192)). Let n(t) be the first derivative of 0t*4 + 0t + t*l - 9/5t*5 - 11 + 0t*3. What is the second derivative of n(j) wrt j? -108j*2 Let p(h) = -17h*3 - 6h*2 - 1957h + 7. Let l(k) = 9k3 + 3k*2 + 979k - 3. Let w(o) = 7l(o) + 3p(o). What is the second derivative of w(x) wrt x? 72x + 6 Let p(x) = 16x + 8. Let r be p(-5). Let l = r + 77. Differentiate -12u4 - lu*4 + 14 + 2u*4 with respect to u. -60u*3 Let y(l) be the first derivative of 2303l*5/5 + 151l3/3 - l2/2 + 1348. Find the third derivative of y(n) wrt n. 55272n Let h(s) be the first derivative of 125s*3/3 + 7s*2 - 7522s + 6069. What is the derivative of h(n) wrt n? 250n + 14 Suppose -5j - 30 = -10j. Suppose b + 2n = 4, -2b + jb - 16 = 2n. Find the third derivative of 18k*b + 0k*2 + 5k*2 - 14k*2 wrt k. 432k What is the second derivative of -143q3 + 262 - 1662q*3 - 8q + 10q wrt q? -10830q Let x(j) be the first derivative of -j*2 - 3j - 116/3j3 - 9. Find the second derivative of x(q) wrt q. -232 Differentiate -117a - 38 + 2a4 - 1204 + 4a*2 + 363a*3 - 4a*2 + 115a wrt a. 8a3 + 1089a*2 - 2 Let m(n) be the second derivative of 1429n5/20 + n4/6 + 1667n3/6 + 592n. What is the third derivative of m(g) wrt g? 8574 Let z(p) be the second derivative of 308p6/15 + 57p*2/2 + 15p + 46. What is the derivative of z(s) wrt s? 2464s3 Let g be 2/4 + 4211/132. Let t(l) be the second derivative of 7l + 0l*3 + 0 + 3/2l*2 + 19/12l*g. Differentiate t(j) with respect to j. 38j Let o(d) = 11d3 - d2 - 3d + 3. Let z be o(2). Differentiate 114t + zt - 75 - 61t wrt t. 134 Let g(l) be the second derivative of 11l7/21 + l5/20 + 55l4/12 + 13l*3 - 17l*2 + 4211l - 1. What is the second derivative of g(j) wrt j? 440j3 + 6j + 110 Let n be 272/112 + (-3)/7. Suppose 3k - b - nb = 18, -2 = k - 5b. What is the third derivative of -kt*6 + 23t*2 + 11t*6 + 19t*6 wrt t? 2640t*3 Let x = -1 + 5. Let b(f) be the first derivative of 13f + 17 - 38fx + 75f*4 - 41f*4. Differentiate b(d) with respect to d. -48d*2 Let q(f) be the third derivative of 151f*7/15 - 647f*3/2 + 25f*2 + 2f. What is the derivative of q(d) wrt d? 8456d3 Let n(i) = -6994i + 7033. Let r(t) = 3499t - 3518. Let u(z) = 3n(z) + 7r(z). Differentiate u(g) wrt g. 3511 Suppose 0 = 8r - 7 - 97. Find the second derivative of 7c + 34c*3 + r + 11c - 16c + c2 + 59 wrt c. 204c + 2 Let f(t) be the second derivative of 1195t4/12 - t3/3 + 8233t*2/2 + 169t + 21. Differentiate f(n) wrt n. 2390n - 2 Let b(m) = 218m + 197. Let n(a) be the second derivative of -5a3/6 + a2/2 - 95a. Let j(r) = b(r) - n(r). What is the first derivative of j(c) wrt c? 223 Suppose m = 3, 2m = z - 0m + 4. What is the third derivative of 61hz + 1 - 46h*3 + 66h*2 - 2 - 111h2 wrt h? -276 Let o(n) be the second derivative of n6/10 - 3n5/5 + 16n*4/3 - 2n*2 + 1129n. Find the third derivative of o(k) wrt k. 72k - 72 Let w(j) = 196j + 1. Let z be w(5). What is the first derivative of -36 + zn - 979n + 2n3 + 6n*3 wrt n? 24n2 + 2 Let b(g) = g3 - 4g2 + 3. Let w be b(4). Let u be (3 - 2)w + -4 + 4. Find the second derivative of 5j - 17j*u - 5j*5 + 17j*3 wrt j. -100j*3 Let w be (2 - 0/(-4)) + 18. Let h be (w + 1)-1(-1)/3. Find the first derivative of 1 - 693k + 693k + 9 - hk*3 wrt k. -21k*2 Suppose 77 = 13k + 38. Find the third derivative of 25q2 + 36q*3 - 19q*3 + 74q**	{ "pile_set_name": "DM Mathematics" }
s positive. q(301/40) Simplify (q(1/5)q((q/q*(-3))/q)/qq)/(qq(2/9))(-30) assuming q is positive. q(613/15) Simplify (((z/(z/(z(-26)/zz)))/z)/z15)(-8) assuming z is positive. z336 Simplify ((n/n(-20))/(nnn/n*(-10/3)n))/((n/(nn(2/71)n))/(n/(n/(n/(n*(-1)/n)))n)) assuming n is positive. n(3982/213) Simplify (m5/m)11/(m(-3)/m)(1/13) assuming m is positive. m(576/13) Simplify (i*10/(ii*18i))/(i/(i/(i/(ii(-1/3)i))))(-41) assuming i is positive. i(-112/3) Simplify j(-2/5)/(j5/j)j9/(j/(j/(jj*(-2/27)j))) assuming j is positive. j(361/135) Simplify (z(-1/10)/(zz(z/(z/z*(4/7)))/zz))/((zz11zz)/z8) assuming z is positive. z(-607/70) Simplify f(-7/6)f*(1/11)((f*(-8)/f)/f)/ff(1/3) assuming f is positive. f(-775/66) Simplify (o*13/o)/ooo/((oo/(ooo*(3/13)))/o)o(7/3)/((o/(o(-2/7)o))/oo) assuming o is positive. o*(4444/273) Simplify (((bb(3/7))/b7)/(b(-1/2))(-6/17))(-1/3) assuming b is positive. b(228/119) Simplify b*(1/4)bb(-11)(b(-4))(-6/17) assuming b is positive. b*(-567/68) Simplify (((z/((z/(zz/((zz(-2/37)z)/z))zz)/zz))/z)/zz/z*(2/5))/(z/(z/((z(z/z*(15/8)z)/zz)/z))z*(1/4)zz) assuming z is positive. z(-6987/1480) Simplify (a(6/23))(-6)((a/(a(2/7)/a))/a)(1/45) assuming a is positive. a(-2245/1449) Simplify ((w7w(1/15)w)0)(-2/17) assuming w is positive. 1 Simplify ((r*31/rrr)/((r(3/4)r)/r))/(r/(r/r*4)rr/r(3/7)) assuming r is positive. r(719/28) Simplify ((cc*(-19))/(c/(c(ccc*(3/14))/c)c))/((c/(cc(7/2))c)/c)(2/7) assuming c is positive. c(-235/14) Simplify (m*(-3/32)m)/(mm(-22))(m/(m(-2/19)/m))(1/44) assuming m is positive. m(146829/6688) Simplify j(-3/11)(jj/(jj(-5/7)))/jj*17/(jj/(j/j*9)jj) assuming j is positive. j(419/77) Simplify ((j12j)/j19)(-7/3) assuming j is positive. j*14 Simplify (tt*(-7/2)tt)/(tt*(-1/6))t*(2/5)ttt(6/13) assuming t is positive. t(298/195) Simplify (k(-18/7)/k26)/(k*(-18)kk(-3/10)) assuming k is positive. k(-789/70) Simplify (q(2/3)/q)(-28)/((q8q)/(qq(-2/9)/q)) assuming q is positive. q(1/9) Simplify ((v/v(-3/2))/(v(1/17)v))/(v/v(2/23))32 assuming v is positive. v(-21721/782) Simplify ((v/v(1/3))*(-1/9)/(((((vv*(-1/10)vv)/v)/v)/vv)/(v*(2/9)v)))5 assuming v is positive. v(67/54) Simplify (v9/v)(-15/4)/(v(-1/3))(1/60) assuming v is positive. v(-5399/180) Simplify ((o(-9)/o)/o(-9))(1/6) assuming o is positive. o*(-1/6) Simplify ((x/((xx*(1/20))/x))/(xx2))/(x(-3/5)x(x*(-12)/xxx)/x) assuming x is positive. x(191/20) Simplify ((oo(-2/25))/o)(28/3)oo/(((((oo(-3/14))/o)/o)/o)/oo)oo(-2/5)/o assuming o is positive. o(3221/1050) Simplify ((kkk/((k*(-2/13)/kk)/k)kk/k(-2/19))(-28/9))(-8/11) assuming k is positive. k(346304/24453) Simplify (q/(q(-4)/q))(-13/2)q/(q/q12)q*(2/9)q assuming q is positive. q(-232/9) Simplify (((x/x(-1/14))/(xx7))/(((x(-10)x)/xx)/xx(-9)))(-46) assuming x is positive. x(-3887/7) Simplify (r(-1/3)r)13/((r(1/5)r)/(r*(-2/7)r)) assuming r is positive. r(859/105) Simplify (((c(4/17)c)/c)/(c7c))/(ccc/c*(-2/93)cc(c(-1/10)/c)/c) assuming c is positive. c(-168949/15810) Simplify ((((y/(y/((y/y*(-6/11))/y)))/yy)/y)/y(y(3/4)/y)/y)/(yy*(-4)yyy(y/((y/(y/y(-2/3)))/yy))/y) assuming y is positive. y(-445/132) Simplify f7(ff*(7/5))/fff14f15 assuming f is positive. f(192/5) Simplify (((cc/(cc/c*(-3)))/cc)(-20))(-10/19) assuming c is positive. c(-600/19) Simplify a14a(-2/17)/aa*(-2/11)(a*2a)/a assuming a is positive. a(2749/187) Simplify (x(3/2)/(x*3xxx))/(x(-2))6 assuming x is positive. x(15/2) Simplify (n/n15n15nn)/((nn1)/n(5/6)) assuming n is positive. n*(11/6) Simplify (rr*13)/rr/(r/r*(-2/35))(r(-1/5))15 assuming r is positive. r(348/35) Simplify (k(-1)(k/(k/(k/k3)))/kkkkk6kk1)(-2) assuming k is positive. k(-14) Simplify (((w(-1/4)ww)/(w2/ww))/(w*5/(w/(ww/(ww1ww)))))24 assuming w is positive. w(-54) Simplify r/(r(-13)r)r(-1/14)/rr((rr/(rr11r))/r)/(r/(r/r(-4/9))) assuming r is positive. r(173/126) Simplify ((rr(-3))45(r/r*(-1)r)/rr(-5/6)r)(-49) assuming r is positive. r(25823/6) Simplify (((jj4/j)/j)/(jj/(j/j*(1/9)))((j(-5)/j)/j)/j1)(-3/19) assuming j is positive. j(55/57) Simplify (l*4/(l(ll(-6)ll)/l))/((ll*0)/ll15) assuming l is positive. l(-8) Simplify (u*19u)/u*(-11)u*35uu(-2/99) assuming u is positive. u(6631/99) Simplify ((g(3/7)g(2/13))/(g(-5)/((g/g(-3))/g)))(-40) assuming g is positive. g(-31240/91) Simplify ((g/(g/(g/g9gg)g))(8/15))(-44) assuming g is positive. g(2464/15) Simplify q/(qq*6)q*(-1/2)(q(-3))(-3/11) assuming q is positive. q*(-125/22) Simplify (n/(n(n/n*(1/12))/n)n)/n(n/(nn/(((((((nn(-5))/nn)/n)/n)/n)/nn)/n)))/n(n(-1/5))(1/14) assuming n is positive. n(-4171/420) Simplify ((g(-4)g)/gg)*(-25)(g*0g)(-17) assuming g is positive. g58 Simplify ((q6/((q/(q(-2)q))/q))/(q(-7)/q(-1/11)))(-2) assuming q is positive. q(-262/11) Simplify (n(2/11)/nn)/n*(-3)(n/(n((n/(n/n(1/13)))/nn)/n))22 assuming n is positive. n(3359/143) Simplify ((((b/(bb/(b/(b(-4)b)))b)/b)/(bbb/b0b))(-1))(-1/24) assuming b is positive. b*(-1/24) Simplify (vv(-10/11))/(v(-2/5)/v)v(-1/34)/(vv/(v*(2/3)v)) assuming v is positive. v*(6329/5610) Simplify yyy12yyy/(y/y*(-17))(y/y*(-5/7))/yyy(-10) assuming y is positive. y(-65/7) Simplify (((l/(ll(-2/7)))0)(-2/17))(-2/41) assuming l is positive. 1 Simplify ((bb(-2)b)/((bb/(b(13/4)b)b)/b))/((b(-4/3)/b)/b(-16)) assuming b is positive. b(-137/12) Simplify (x(xx/x(1/9)xx)/x)/(x/((xx*3)/x))(x12/x)/x(1/10) assuming x is positive. x(1511/90) Simplify (m/(m(-18)mm)mmm17m)/(m*(-3/4)mm(m/(mm(m/(mm(-9/2)m))/m)m)/m) assuming m is positive. m(157/4) Simplify (o(-4)/o(-16/9))/((ooo/(o/(((o(-2/5)/o)/o)/o)))/o(-25)) assuming o is positive. o(-1162/45) Simplify o3/o(3/7)(o(4/3))(-1/31) assuming o is positive. o(1646/651) Simplify ((y(-2/59)y)/y(1/12))/(y(-1/4)/((y/(y/(y(y(y(1/6)/y)/y)/y))y)/y)) assuming y is positive. y*(53/177) Simplify (j(j/j(1/2))/j)(5/14)/(j2/j(-11)) assuming j is positive. j(-359/28) Simplify ((n(-1/8)n(-2/21))(-40))(20/7) assuming n is positive. n(3700/147) Simplify (ww(w/(www9ww)ww)/ww)/w*(-9)(ww/(w/w(-23))www)/(w/(w/((((w/w(-15))/w)/w)/w))) assuming w is positive. w(-31) Simplify ll(1/7)l/l*(1/3)(l(-3/2))(-16) assuming l is positive. l(542/21) Simplify ((a(-2/11)a)/aa10)/(a(-1))(-16) assuming a is positive. a(-68/11) Simplify ((i*(-5)i5/i)(1/18))(-1/28) assuming i is positive. i(1/504) Simplify j(-1/12)/(j(2/29)j)((j/(j/j(2/19)))/j)0 assuming j is positive. j(-401/348) Simplify ((l/l(1/14)l12)(2/11))7 assuming l is positive. l(181/11) Simplify (((b(3/14))(4/15))(25/3))(16/3) assuming b is positive. b(160/63) Simplify ((k/k9kk)/(k/k(-2/3)))/((k(k/(k1/k))/k)/(k/((k13k)/k))) assuming k is positive. k(-62/3) Simplify ((x/x14xx)/(x((x/x*(-1/16))/x)/xx))31 assuming x is positive. x(-5983/16) Simplify (g4)50/(gg10g13) assuming g is positive. g176 Simplify (((w3/w)/(w6/w))(5/7))13 assuming w is positive. w(-195/7) Simplify (d/(d/d0))/((d*13/dd)/ddd)d(-1)/d1 assuming d is positive. d(-16) Simplify (x(-5/4))(2/3)/(xx*(-1/49)x*(-3/10)x) assuming x is positive. x(-1847/735) Simplify (f/f(-9))*25/((ff(-3/10))/f)(-4/5) assuming f is positive. f*(6244/25) Simplify (uu*(-2/27)/uu/(uu2)uu)19 assuming u is positive. u(-38/27) Simplify g(7/3)/(g/(ggg/(ggg(-5))))gg(11/4)g/(ggg*15gg) assuming g is positive. g(-83/12) Simplify (q(-2/3)qq)(-49)qqq*0qq/(q/(qq**(2/	{ "pile_set_name": "DM Mathematics" }
ide 15745950 by 6362. 2475 17 divided by -3885140 -17/3885140 What is -2261440 divided by 382? -5920 What is 403499 divided by -19? -403499/19 Divide 37339898 by -8. -18669949/4 Calculate 1206210641 divided by -4. -1206210641/4 Divide 25602200 by 6400550. 4 Calculate 557904 divided by -394. -1416 What is 5 divided by 1006111? 5/1006111 What is -7118076 divided by 1016868? -7 Calculate 3322324 divided by 4. 830581 Calculate 104318005 divided by -37565. -2777 What is -3 divided by -8470189? 3/8470189 Divide -49567856 by 3. -49567856/3 Divide -1825200 by -1350. 1352 What is 639318636 divided by 33? 19373292 What is -2391 divided by 96? -797/32 -10716940 divided by 52 -206095 Calculate 3808896 divided by -16. -238056 What is 88 divided by 143169? 88/143169 Calculate 6600 divided by -50226. -100/761 Divide 35 by 3671647. 5/524521 242657688 divided by 21 11555128 What is 306844447 divided by 377? 813911 Calculate 398956818 divided by 30688986. 13 What is -73025540 divided by -14605108? 5 What is 39116118 divided by 6519353? 6 Calculate 1453497 divided by 10. 1453497/10 Divide 103646920 by 40. 2591173 Divide -823123 by -20. 823123/20 What is -25 divided by -144946? 25/144946 5676 divided by -4001 -5676/4001 -9364754 divided by 10157 -922 Calculate -3013500 divided by -2870. 1050 Divide -5 by -3651680. 1/730336 Calculate -142785153 divided by -93141. 1533 45312164 divided by -3 -45312164/3 Calculate 259267 divided by 58. 259267/58 Calculate 34588 divided by -7014. -17294/3507 Calculate -332 divided by -110866. 166/55433 Calculate 1519440 divided by 131. 1519440/131 11756700 divided by -9 -1306300 What is -444 divided by -32047? 444/32047 1791 divided by -504 -199/56 Divide 180 by 20108. 45/5027 Calculate -87184160 divided by 2261. -38560 -611352 divided by -1 611352 Calculate 869494932 divided by -4. -217373733 -808979 divided by 4 -808979/4 Divide 3 by 3818900. 3/3818900 Divide -268435637 by 3. -268435637/3 Calculate 1846056 divided by -461514. -4 What is 99 divided by -4238277? -33/1412759 Divide -505900621 by -72991. 6931 Divide 23791548 by -4. -5947887 -2195203 divided by 589 -3727 Divide -224545680 by 10. -22454568 Divide -7692816 by -641068. 12 What is -3821073 divided by -5? 3821073/5 -9 divided by 1060939 -9/1060939 9661170 divided by 9661170 1 226 divided by 32602 113/16301 Divide 10091946 by -1681991. -6 Divide 1526346 by -251. -1526346/251 Divide -7026 by -90. 1171/15 -11167 divided by -2000 11167/2000 93527453 divided by 2 93527453/2 What is 108581364 divided by 159444? 681 Divide 9986782 by -5. -9986782/5 What is -1005224 divided by 1? -1005224 Calculate -1701632 divided by -54. 850816/27 Divide -16759314 by 8426. -1989 Calculate 55 divided by -1029246. -55/1029246 -9732915 divided by 279 -34885 Calculate -50287395 divided by -33193. 1515 Divide 2 by 14693192. 1/7346596 What is -1025 divided by 172713? -1025/172713 386696892 divided by -12 -32224741 Divide -67883792 by 2. -33941896 Divide 651842 by -5. -651842/5 Calculate -5 divided by -3702319. 5/3702319 793303 divided by -2 -793303/2 Divide -15771060 by 42740. -369 104421234 divided by 1 104421234 Divide 5 by 77107107. 5/77107107 What is 25 divided by -2486479? -25/2486479 What is 235804 divided by -73? -235804/73 Calculate -434529088 divided by -2. 217264544 Calculate -347 divided by -13757. 347/13757 What is 31515712 divided by -26618? -1184 Divide 1976133028 by 4. 494033257 What is -34 divided by 312753? -34/312753 What is 2137369 divided by -9? -2137369/9 What is -92666840 divided by -8? 11583355 -50028089 divided by -1 50028089 Divide -5 by 13121089. -5/13121089 Calculate 334827376 divided by -214084. -1564 Divide -5346392 by -7726. 692 Calculate -4237 divided by 72. -4237/72 -2691060 divided by -10 269106 Calculate 697 divided by 88725. 697/88725 Calculate 257 divided by 31662. 257/31662 What is 265442319 divided by 88480773? 3 Calculate -2482475 divided by 159. -2482475/159 What is 32315355 divided by 2154357? 15 Divide -35991329 by 297449. -121 1774502 divided by -19 -1774502/19 Divide -6742890 by -70. 96327 What is 82 divided by 1142322? 41/571161 Calculate 8046488 divided by 6661. 1208 Calculate -6238595 divided by -1247719. 5 What is -33797090 divided by -16898545? 2 Divide 12813840 by -346320. -37 What is 3329722 divided by -34? -97933 Calculate 189 divided by -2846. -189/2846 -28168048 divided by -14 14084024/7 Calculate 1763 divided by 1941. 1763/1941 0 divided by 15878265 0 Divide -52422500 by -1625. 32260 What is 668 divided by -76614? -334/38307 Calculate -830121 divided by -8. 830121/8 What is 478363525 divided by -4453? -107425 Divide -164898895 by -3. 164898895/3 What is -20 divided by 10575727? -20/10575727 95130 divided by 2427 31710/809 What is 83 divided by -4427723? -83/4427723 Calculate -2 divided by -923171. 2/923171 Calculate -8653788 divided by -480766. 18 -1545456 divided by -515152 3 Divide -13340 by -30939. 13340/30939 Divide -469 by 3211. -469/3211 -25988 divided by 1036 -6497/259 What is 39607972 divided by -39607972? -1 What is -1 divided by -12171437? 1/12171437 Calculate 0 divided by 23723009. 0 Calculate 668401711 divided by -47. -14221313 1 divided by 5800924 1/5800924 What is -13 divided by -6847972? 13/6847972 -736434 divided by -29 736434/29 What is -2783913 divided by -2? 2783913/2 -1520467 divided by 404 -1520467/404 What is 84107620 divided by -10? -8410762 What is 0 divided by -7142869? 0 -108221918 divided by 328942 -329 686898750 divided by 4579325 150 Calculate 184335 divided by -766. -184335/766 What is 15027 divided by 201? 5009/67 What is -8688720 divided by 17660? -492 Calculate -4 divided by 412220. -1/103055 What is 893202 divided by -21? -297734/7 What is 62328817 divided by -527? -118271 539 divided by 562802 539/562802 -150282 divided by 474 -25047/79 -131620240 divided by 32905060 -4 Calculate 389 divided by 296347. 389/296347 Divide 12969276 by -3. -4323092 196131 divided by -47 -4173 What is -5 divided by -406464597? 5/406464597 104152608 divided by -680736 -153 5167413 divided by 3 1722471 28801638 divided by -236079 -122 What is 9624717 divided by -5541? -1737 Calculate -188977740 divided by 2. -94488870 What is 245185550 divided by -49037110? -5 What is 1982479 divided by 5? 1982479/5 What is 68727 divided by 29? 68727/29 -851 divided by -28644 851/28644 What is -18110392 divided by 2? -9055196 What is -1236748 divided by -309187? 4 Divide -268 by -35590. 134/17795 4516080 divided by 930 4856 Divide 347 by 168056. 347/168056 -12390178 divided by -728834 17 177178173 divided by 19 9325167 Calculate 1 divided by -124336. -1/124336 Divide 157312112 by -4. -39328028 What is -36386736 divided by 12128912? -3 Divide 3861140 by 2. 1930570 849 divided by 344047 849/344047 What is -134 divided by 1029155? -134/1029155 Divide -49611931 by 81733. -607 Divide -1811044 by -4. 452761 Divide 8807279 by 2561. 3439 -452279 divided by 1 -452279 Divide -1596857 by 51. -1596857/51 -7713280 divided by -128 60260 Calculate -18437 divided by -230. 18437/230 -8 divided by 2063091 -8/2063091 Calculate -285171858 divided by -6. 47528643 54840240 divided by 756 72540 -510272 divided by -268 1904 -15719490 divided by -7859745 2 What is 416729478 divided by 3? 138909826 Calculate 56818071 divided by 6313119. 9 What is -197643440 divided by 2? -98821720 What is 415791 divided by 8? 415791/8 What is -9 divided by -72653169? 3/24217723 Divide -16612861 by -193. 86077 Divide 1001105 by 8. 1001105/8 12275611 divided by -89603 -137 What is -334 divided by -37555? 334/37555 Calculate -1011327 divided by 1011327. -1 What is -15407462 divided by 6? -7703731/3 Divide -419016 by -8058. 52 1 divided by 231106051 1/231106051 What is -1085354 divided by 1085354? -1 Calculate 277797442 divided by 14620918. 19 Divide 38807672 by 296. 131107 -7621 divided by -23339 7621/23339 What is -130704 divided by 6? -21784 Divide -7009331 by -7309. 959 Calculate -42259125 divided by 42259125. -1 Divide -1358668 by 2. -679334 Divide 8964400 by -3650. -2456 75 divided by -119098 -75/119098 Divide 0 by -187292. 0 What is 1 divided by 4083660? 1/4083660 What is -6687978 divided by -2? 3343989 What is 534487821 divided by -25451801? -21 Calculate 4687015 divided by 937403. 5 Divi	{ "pile_set_name": "DM Mathematics" }
- 2073961 What is the i'th term of -7809, -16102, -24395, -32688, -40981, -49274? -8293i + 484 What is the o'th term of -18366, -36497, -54580, -72591, -90506, -108301? 4o*3 - 18159o - 211 What is the g'th term of -1926, -7706, -17338, -30822? -1926g2 - 2g + 2 What is the t'th term of 6230560, 6230565, 6230574, 6230587, 6230604? 2t2 - t + 6230559 What is the h'th term of -37452, -37626, -37800, -37974, -38148? -174h - 37278 What is the z'th term of 84892, 169796, 254698, 339598, 424496? -z*2 + 84907z - 14 What is the o'th term of 60581, 121196, 181787, 242354, 302897, 363416? -12o2 + 60651o - 58 What is the r'th term of 195010, 390031, 585062, 780103, 975154, 1170215, 1365286? 5r2 + 195006r - 1 What is the n'th term of 66631, 266552, 599797, 1066402, 1666403, 2399836? 6n3 + 66626n2 + n - 2 What is the z'th term of 15313, 25335, 35355, 45373? -z2 + 10025z + 5289 What is the k'th term of -166, 157, 554, 1061, 1714? 6k3 + k2 + 278k - 451 What is the t'th term of -1547323, -1547314, -1547303, -1547290, -1547275, -1547258? t2 + 6t - 1547330 What is the j'th term of 4678534, 4678538, 4678540, 4678540? -j*2 + 7j + 4678528 What is the q'th term of -11742, -8833, -5924? 2909q - 14651 What is the o'th term of 143597, 143513, 143419, 143309, 143177, 143017, 142823? -o3 + o2 - 80o + 143677 What is the i'th term of -300, -2407, -8126, -19263, -37624, -65015? -301i3 + 1 What is the g'th term of -176443, -352951, -529461, -705973, -882487, -1059003? -g2 - 176505g + 63 What is the x'th term of -65791, -527158, -1779433, -4218070, -8238523, -14236246? -65909x3 - 4x + 122 What is the j'th term of -3010, -24681, -83624, -198475, -387870, -670445, -1064836? -3106j3 + 71j + 25 What is the b'th term of 627543, 627493, 627443, 627393, 627343, 627293? -50b + 627593 What is the p'th term of -79003, -78853, -78457, -77695, -76447, -74593, -72013, -68587? 20p*3 + 3p*2 + p - 79027 What is the m'th term of -140, -429, -762, -1025, -1104, -885, -254? 19m*3 - 136m*2 - 14m - 9 What is the u'th term of -738, -2061, -3990, -6555, -9786? -5u3 - 273u*2 - 469u + 9 What is the o'th term of -5605, -6202, -6789, -7360, -7909, -8430? o3 - o2 - 601o - 5004 What is the j'th term of 2510765, 2510907, 2511049? 142j + 2510623 What is the w'th term of -4159, -16576, -37269, -66238? -4138w2 - 3w - 18 What is the c'th term of 418372, 418359, 418346? -13c + 418385 What is the u'th term of -1530366, -3060680, -4590996, -6121314, -7651634? -u2 - 1530311u - 54 What is the n'th term of 436699, 437126, 437553, 437980, 438407? 427n + 436272 What is the l'th term of -1661, -6313, -14031, -24815, -38665, -55581, -75563? -1533l*2 - 53l - 75 What is the x'th term of -40443, -60320, -93441, -139800, -199391? x*3 - 6628x*2 - 33816 What is the i'th term of 2523460, 2523482, 2523504, 2523526? 22i + 2523438 What is the v'th term of -72058, -144114, -216186, -288280, -360402? -v*3 - 2v*2 - 72043v - 12 What is the u'th term of 99986, 200019, 300108, 400259, 500478, 600771, 701144, 801603? u*3 + 22u*2 + 99960u + 3 What is the q'th term of 5834, 46715, 157684, 373787, 730070, 1261579, 2003360? 5841q3 - 2q*2 - 5 What is the s'th term of 6179, 24758, 55735, 99122, 154931, 223174, 303863? 2s*3 + 6187s*2 + 4s - 14 What is the w'th term of -139430373, -278860746, -418291119, -557721492, -697151865, -836582238? -139430373w What is the s'th term of 159418, 637610, 1434596, 2550376? 159397s*2 + s + 20 What is the x'th term of -30729, -30988, -31403, -31956, -32629, -33404, -34263, -35188? 3x*3 - 96x*2 + 8x - 30644 What is the f'th term of -4984461, -4984456, -4984453, -4984452, -4984453, -4984456? -f*2 + 8f - 4984468 What is the i'th term of 2182278071, 2182278060, 2182278037, 2182277996, 2182277931, 2182277836, 2182277705, 2182277532? -i*3 - 4i + 2182278076 What is the q'th term of 11588, 10737, 9874, 8993, 8088? -q*3 - 844q + 12433 What is the s'th term of -442880, -1771511, -3985894, -7086029, -11071916? -442876s2 - 3s - 1 What is the m'th term of -26372, -26247, -26050, -25787, -25464, -25087? -m*3 + 42m*2 + 6m - 26419 What is the k'th term of 680, 536, 286, -118, -724, -1580, -2734, -4234? -8k3 - 5k*2 - 73k + 766 What is the b'th term of -2791, -28735, -101001, -242749, -477139, -827331? -3860b3 - b2 + 1079b - 9 What is the u'th term of 15063, 59466, 133213, 236304? 14672u2 + 387u + 4 What is the x'th term of -1404216, -5616882, -12637992, -22467546, -35105544, -50551986, -68806872? -1404222x2 + 6 What is the l'th term of 4119903, 8239806, 12359709, 16479612, 20599515, 24719418? 4119903l What is the y'th term of -2270, -17556, -58884, -139274, -271746? -2170y3 - y2 - 93y - 6 What is the w'th term of -168089, -336214, -504337, -672458, -840577, -1008694, -1176809? w*2 - 168128w + 38 What is the g'th term of 11062, 22206, 33286, 44302, 55254? -32g2 + 11240g - 146 What is the d'th term of 8095, 31953, 71697, 127333, 198867, 286305, 389653, 508917? d*3 + 7937d*2 + 40d + 117 What is the q'th term of -1203, -1682, -2115, -2502, -2843, -3138, -3387? 23q2 - 548q - 678 What is the n'th term of 47391, 95390, 143389, 191388, 239387? 47999n - 608 What is the g'th term of -85380, -85397, -85428, -85479, -85556? -g3 - g2 - 7g - 85371 What is the v'th term of 1843, 1273, 693, 103, -497, -1107? -5v2 - 555v + 2403 What is the y'th term of -55997, -53406, -50815, -48224, -45633? 2591y - 58588 What is the q'th term of 812963, 1625895, 2438825, 3251753, 4064679, 4877603, 5690525? -q2 + 812935q + 29 What is the a'th term of 1419, 2820, 4235, 5664, 7107, 8564, 10035? 7a2 + 1380a + 32 What is the y'th term of -144631, -578306, -1301089, -2312974, -3613955, -5204026, -7083181? y*3 - 144560y*2 - 2y - 70 What is the y'th term of -1385, -5519, -12459, -22199, -34733? y*3 - 1409y*2 + 86y - 63 What is the t'th term of -7698, -7749, -7854, -8037, -8322, -8733? -4t3 - 3t*2 - 14t - 7677 What is the k'th term of 317, 433, 643, 947, 1345, 1837, 2423? 47k2 - 25k + 295 What is the j'th term of -2459789, -2459785, -2459781, -2459777? 4j - 2459793 What is the z'th term of 134044, 132819, 131594, 130369, 129144, 127919? -1225z + 135269 What is the g'th term of 5524399, 11048802, 16573229, 22097692, 27622203, 33146774, 38671417, 44196144? 2g3 + 5524389g + 8 What is the y'th term of -9128, -1625, 5878, 13381? 7503y - 16631 What is the d'th term of 555769397, 555769395, 555769393, 555769391, 555769389? -2d + 555769399 What is the y'th term of 11253, 45673, 103029, 183315, 286525, 412653, 561693? -y*3 + 11474y*2 + 5y - 225 What is the l'th term of -9016, -8225, -7432, -6637, -5840, -5041? l*2 + 788l - 9805 What is the z'th term of -602109, -602030, -601951, -601872? 79z - 602188 What is the l'th term of 154737, 154739, 154745, 154755, 154769? 2l*2 - 4l + 154739 What is the p'th term of -4148, -17004, -38554, -68804, -107760, -155428? -p*3 - 4341p*2 + 174p + 20 What is the q'th term of -868960, -868958, -868960, -868966, -868976, -868990, -869008? -2q2 + 8q - 868966 What is the l'th term of 135530, 267909, 400288? 132379l + 3151 What is the f'th term of 18081933, 36163849, 54245765, 72327681? 18081916f + 17 What is the l'th term of 3995469, 3995475, 3995479, 3995481? -l*2 + 9l + 3995461 What is the i'th term of 281922, 564247, 846572, 1128897, 1411222, 1693547? 282325i - 403 What is the x'th term of -6899, -21571, -46061, -80399, -124615, -178739, -242801, -316831? -5x*3 - 4879x2 - 2015 What is the w'th term of 126147, 126220, 126271, 126294, 126283, 126232, 126135, 125986? -w3 - 5w2 + 95w + 126058 What is the y'th term of -1768609, -7074430, -15917467, -28297720? -1768608y2 + 3y - 4 What is the g'th term of -43732, -43896, -44058, -44218, -44376? g*2 - 167g - 43566 What is the d'th term of -4041234, -4041242, -4041248, -4041252, -4041254, -4041254? d*2 - 11d - 4041224 What is the o'th term of 5843, 12276, 19301, 26918, 35127? 296o2 + 5545o + 2 What is the c'th term of 2825555, 5650926, 8476297? 2825371c + 184 What is the w'th term of -334104, -334165, -334226? -61w - 334043 What is th	{ "pile_set_name": "DM Mathematics" }
+ 0t2. Let m be n(7). Let a = m + -16. What is the remainder when a is divided by 19? 17 Suppose r + 2r = 51. Let d = 23 - r. Calculate the remainder when 21 is divided by d. 3 Suppose -4y = -y - 30. Let a(m) = -m3 - 13m*2 + 13. Let l be a(-13). Suppose 16g - 114 = lg. Calculate the remainder when g is divided by y. 8 Let x be -2(-3)/(-12)-6. Let a(l) = -17l + 4 - 4 + x + 13l. Calculate the remainder when a(-7) is divided by 16. 15 Let y be 702/(-13) - 2/1-1. Calculate the remainder when (-2 + y)/(-2 - (-2)/4) is divided by 13. 10 Suppose -3r + 3k - 6k + 54 = 0, 8 = -4k. Let y = 75 - -62. What is the remainder when y is divided by r? 17 Let d(m) be the third derivative of -1/6m3 + 1/30m*5 + 1/8m*4 + 0 + 0m + 3m2. What is the remainder when d(-4) is divided by 5? 4 Let s = 152 - 116. What is the remainder when -6(-214)/412/s is divided by 22? 19 Let q(u) = -u3 + u2 - 2. Let n be q(2). Let m = n + 22. Suppose -m = -5p + 29. Calculate the remainder when 24 is divided by p. 6 Suppose -2c - 5a + 10 = -8, 12 = -3a. Let d(t) = -t3 - 3t*2 + 14t + 107. Calculate the remainder when d(-6) is divided by c. 17 Let k(r) = -6r3 - 11r*2 - 32r - 250. What is the remainder when k(-8) is divided by 8? 6 Let p = 55 + 484. What is the remainder when p is divided by 45? 44 Suppose 4l - 2 = 3d, 3l + 4 = -2d - 3. Calculate the remainder when 27 is divided by (-2)/((-8)/(-10) + l). 7 Let n = -132 + 176. Calculate the remainder when n is divided by 31. 13 Suppose -65n + 13719 = 2149. What is the remainder when n is divided by 3? 1 Suppose -3s = 5 - 122. Suppose 3h = y + 35 - 164, -347 = -3y + h. Calculate the remainder when y is divided by s. 36 Let b(t) = -t + 11. Let j be b(9). Let r be 1 + j + 0 + 1. Calculate the remainder when 54 is divided by r/342/4. 12 Let b be 1(-1 + 1)/(-4). Suppose b = 9x - 4x - 155. Calculate the remainder when 183 is divided by x. 28 Let b(t) = -23t - 1. Suppose 3z = -40 + 46. Suppose -h = -3d + 22, 4d = zh - 5h + 12. Calculate the remainder when b(-1) is divided by d. 4 Suppose -5a - 15 = 0, 7d - 3a = 10d + 288. Let l = d - -211. What is the remainder when l is divided by 10? 8 Let o(b) = 0b + 2262b2 - b3 - b - 2251b2 + 21. What is the remainder when 47 is divided by o(11)? 7 Suppose -1755 = 19d - 58d. What is the remainder when 131 is divided by d? 41 Let m = 0 + 5. Let b be (-13)/(-26)(-12)/(-2). Suppose -3t - ma + 58 = 0, -1 = -ba - 13. What is the remainder when 76 is divided by t? 24 Suppose -2t = t - 6. Let d(q) = q*3 + 3q - 1. What is the remainder when (-33)/22(-200)/6 is divided by d(t)? 11 Let h(d) = 14d - 140. What is the remainder when 25 is divided by h(11)? 11 Let u = 59 - 23. Let v = u - -2. Calculate the remainder when v is divided by 144/14 + (-8)/28. 8 Suppose 3a - a = 0. Suppose 5j - 89 - 6 = a. Calculate the remainder when j is divided by (-1)/(-3) + (-20)/(-3). 5 Let l be ((-162)/15)/(-2) + 4/(-10). Suppose -606 = -lk - 191. What is the remainder when k is divided by 21? 20 Let f = 40 - 21. Suppose 0s = s - k - 36, -3k = s - 32. What is the remainder when s is divided by f? 16 Suppose -5g = -92 + 27. Let x(q) = 53q + 279. What is the remainder when x(-5) is divided by g? 1 Suppose -h = -4g + 1431, 23h + 12 = 19h. Calculate the remainder when g is divided by 58. 9 Suppose 0 = 35u - 29u - 660. What is the remainder when u is divided by 14? 12 Let i(d) = -8d + 50. Calculate the remainder when i(-12) is divided by 30. 26 Let h(c) be the third derivative of c6/40 + c5/30 - c4/8 - c2. Let w(j) = 2j - 1. Calculate the remainder when h(2) is divided by w(5). 8 Suppose 2h + 3h = 50. Let a(s) = -44s - 6. Let p be a(-1). Suppose p = -5v + 128. Calculate the remainder when v is divided by h. 8 What is the remainder when 114 is divided by (-65)/20(2 - 18)? 10 Let j = 58 + -56. Suppose -x = -3q + x + 237, 2q - jx = 160. Calculate the remainder when q is divided by 10. 7 Let j = -1126 - -1223. What is the remainder when 872 is divided by j? 96 Let f be (-2)/(1/(3 + -5)). Suppose 0 = -fo - 58 + 10. Let n = 23 + o. What is the remainder when 19 is divided by n? 8 Let x = 43 - 54. Let a(r) = -r3 - 12r*2 - 13r - 12. Calculate the remainder when 108 is divided by a(x). 8 Let l(r) = -3r + 3. Let y be l(2). Calculate the remainder when 52 - (y + 4 + -3) is divided by (7/3)/(8/48). 12 Suppose -3u + 142 + 170 = 4d, -4u + d = -435. Calculate the remainder when u is divided by 59. 49 Let d(h) = 2h - 5. Let w be d(8). Let g(n) = -11 + 7n + w. What is the remainder when g(1) is divided by 5? 2 Let l(h) = 4h2 - 14h - 6. Let i be l(6). Suppose -i = -7o + o. Suppose 0 = 3x - 9 - 3. What is the remainder when o is divided by x? 1 Suppose 4o = 1410 - 442. Let t(a) = 4a - 1. What is the remainder when o is divided by t(7)? 26 Let x = -7452 + 7457. Suppose -g + 5r + 62 = 0, 24 = 2g - 3r - 72. Calculate the remainder when g is divided by x. 2 Suppose -w - 2w = -27. Suppose 4i + w = 5i. What is the remainder when 26 is divided by i + -6 + (3 - -1)? 5 Let o(m) = m*2 - 9m + 2m - 2 + 5m*2 + 10m. Suppose -3i + 0i + 33 = 0. Calculate the remainder when o(-3) is divided by i. 10 Suppose 3u = v - 6, 0 = -3v + u - 6u + 4. Suppose 15 + 3 = vw. Let d(p) = -p*3 - 2p*2 + 4p + 6. Calculate the remainder when d(-4) is divided by w. 4 Suppose 1032 = -0q + 2q. Suppose 7x = 4x - q. Let r = -122 - x. What is the remainder when r is divided by 17? 16 Suppose 40c = 351 + 729. Calculate the remainder when 36 is divided by c. 9 Suppose -14y + 365 - 99 = 0. Calculate the remainder when 63 is divided by y. 6 Let d(p) = -3p + 1. Let q be d(2). What is the remainder when 2 - (-11 + (q - 39)) is divided by 17? 13 Suppose -14s - 150 = -5i - 9s, -46 = -i + 5s. Let n(w) = -w + 1. What is the remainder when i is divided by n(-8)? 8 Let n = 7 + -1. Let b(l) = -3l + 6. Let s be b(n). Let w = -2 - s. Calculate the remainder when 37 is divided by w. 7 Let i be 16/(-2 - 2) + 4. Suppose c = -ic + 4. Suppose 0 = -3u + cu - 40. Calculate the remainder when u is divided by 14. 12 Suppose -4c - 8 = -8c. Suppose 29 = y - co, 3y + 2o = 4o + 75. Calculate the remainder when y is divided by 13. 10 Suppose 2g + 2g + 20 = 0, -4w + 35 = -3g. What is the remainder when 11 is divided by w? 1 Let a(d) = 2d + 22. Let f = 47 + -39. What is the remainder when a(4) is divided by f? 6 Let a(z) = 3z - 14. Let n be a(6). Let y(o) = -o + 2o + 4 - 5o + 7o. Calculate the remainder when 60 is divided by y(n). 12 Let p be (-64)/10 - (-18)/(-30). Suppose 4f - 7 = 1. What is the remainder when 41 is divided by 1 - (fp)/1? 11 Let c(n) be the first derivative of 3n*2/2 + 10n + 5. Let m(x) = -2x - 5. Let t(p) = -4c(p) - 7m(p). What is the remainder when 32 is divided by t(8)? 10 Suppose -26 = -2c - 12. Calculate the remainder when 83 is divided by c. 6 Let x = 21 - 14. Let r be (-29)/5 + x/(-35). What is the remainder when (r + 5)/(1/(-17)) is divided by 6? 5 Let z(w) = 8w2 + 34w - 60. Calculate the remainder when z(-15) is divided by 28. 26 Let p(r) = 2r + 27. Let f = 28 + -12. What is the remainder when f is divided by p(-9)? 7 Let p = -77 - -110. Let r(m) = -m3 + 8m*2 + 3m + 1. Let u be r(8). Let a = p + u. Calculate the remainder when a is divided by 20. 18 Suppose 4m - 82 = 5d - 7d, 5m - 3d = 97. Calculate the remainder when 439 is divided by m. 19 Suppose -3f - 2f + 20 = 0. Calculate the remainder when 6(7 - -4 - 8) is divided by f. 2 Suppose -3c - 15 + 39 = 0. Let p = -4 + c. Calculate the remainder when 21 is divided by p. 1 Let w(z) = -z3 - 12z*2 + 2z - 53. Calculate the remainder when w(-14) is divided by 26. 25 Let d = 9 - 9. Suppose d = -4n - n - 165. Calculate the remainder when n(4 - 2)/(-6) is divided by 7. 4 Let a be 4 - (2 - 140)/(-3). Let d = a - -72. What is the remainder when d is divided by 11? 8 Let p = 63 + -61. Suppose -pb + 12 = -0b. What is the remainder when b is divided by 2? 0 What is the remainder when 6364/20 + (-1)/5 is divided by 10? 8 Suppose 0 = -4m + 3y - 6, 3m - y = -4y - 15. What is the remainder when 100 is divided by (2/(-5))/(m/195)? 22 Suppo	{ "pile_set_name": "DM Mathematics" }
z is positive. z(13805/3888) Simplify (((k(-1/11)/k)/(kk(1/3)k))/(kk(-1/4))(-11))/((k(-2/5))(2/3)/(k2)(4/29)) assuming k is positive. k(102749/19140) Simplify ((t/t(-1/2))(-27)/(t(-26)t/t(5/13)))(-49) assuming t is positive. t*(19257/26) Simplify ccc(3/2)/ccc(-7)(cc/c(2/7))(-1/8)(ccc*(-1/6)c(c(3/14)/c)/c)9 assuming c is positive. c(40/7) Simplify (((((m/m(2/7))/m)/m)/m)5/((m/(m/(mm*(-1/11))m))/mm(1/6)))/(mmm7mm(-3/8)mm(2/9)/(m(-4)m)) assuming m is positive. m*(-135005/5544) Simplify ((yy*(5/6))/yy*3)/(y(y*(-2/5)/y)/yy*(-2/11))((y*0/yy)/y(-1))(-16) assuming y is positive. y(-3493/330) Simplify (((r/r(-4/11)rrr/(rrr(1/6)rr))/((rr/(r*8rr))/r13))(-2/67))(-15/4) assuming r is positive. r(6995/2948) Simplify ((((q/((qq*1)/q)q)/(qq(-1/7)))(1/5))(-18))8 assuming q is positive. q(-144/35) Simplify (h(1/4))(-2/27)(h/(h*(1/3)h))*2(h/(h*(4/7)h)h/(hh/(h/(h/(h*(-2)/hh)))))/(h/(hh4h)(h/h(-7)h)/h) assuming h is positive. h(-2743/378) Simplify m/(m(-1/2)/m)(m/((m/m(-3)m)/m)m)/mm*(1/7)/m((m*2/m)/m)/m(((m*(-3)m)/m)/(m(-6)/m))(-27/2) assuming m is positive. m(-789/14) Simplify (((r(-2)/r)/((rr(-3/7)r)/r))/(rr(2/7)rr/(r/(r(-2/7)r))))/(r*(2/5)/(rr*(-1)r)r(-3/8)/r(-2/5)) assuming r is positive. r(-1679/280) Simplify ((w/(wwww*7))/(ww/w(3/13)))(-35)/((w/(w/w(1/2)))/((w/(w/w(1/2)))/w)www(-4)ww(w/((ww(4/7))/w))/w) assuming w is positive. w(34261/91) Simplify (nn/(n/(n/(n*(-4/5)n)))(n/(n/n(-4)n))/n)*23((n/(n/(n/n(2/5))))19)(-42) assuming n is positive. n(-2877/5) Simplify w*(2/15)/(w/(ww*3)w)w(-4/7)/wwww*6(ww(-2)w)/(w*2/w)(ww(-1/6))/(w/w(-2/3)) assuming w is positive. w(471/70) Simplify ((b0/b)(2/5))(-34)(b(b/b(-1/4))/bbb)(-44)(b(-1)/b)(25/3) assuming b is positive. b(-2191/15) Simplify p(-2/5)/(p/p*(-5))p*(-4/5)/(pp*(-3)pp)(p(-2))37/(p(6/11)/p(-3)) assuming p is positive. p(-4661/55) Simplify (v(-46))*42v*47v43 assuming v is positive. v(-1842) Simplify (((ss12)/(s(-2/37)s))/(s*(-20/9)s/((s/((s*30s)/ss))/s)s))(-41) assuming s is positive. s(255635/333) Simplify (t*(2/5)t*(3/2)t*(-8)tt4/t)/((t/(t/(t4/tt)))1)(-1/13) assuming t is positive. t(-233/130) Simplify (s(-4/7)/(ss(-5)s))*(-49)(s/(ss/(s(-3)s)s))/(s6ss)s*1s*(-5)ss assuming s is positive. s(-133) Simplify (z0z)*(-40)/((z/(z(z/(z/(z*(-1/2)/z)zz))/z))/z(2/7))(z(-2/5))(2/19)z(-8)zz/(zz*4zzz) assuming z is positive. z*(-77481/1330) Simplify (m(((mm3)/m)/m)/mm(-7))17((m/(m/(m/m(1/6))))/(mm6))/(m/(m/((m6m)/m))mm/m(-2/7)) assuming m is positive. m(-4177/42) Simplify g8gg/(g(-1/8)/gg)(gg4)/(g/(g1g)g)(g10/gg4/g)(-20) assuming g is positive. g(-1799/8) Simplify ((x(-1/3))(-12/5))(-9/5)(x(-3/5)/x(-2/5))(-3/11) assuming x is positive. x(-381/275) Simplify (u/u(-1/4))(-9)/(u1)(-28)(u*(1/4)u)*24u*(-4)u(2/27) assuming u is positive. u(4625/108) Simplify ((a/a*(-1/5)a(3/2))/(a/a(-1))26)/(a/a(1/8)a(-6)(a/(aa(-1)))/(aaa/(aa*2)a)) assuming a is positive. a(-1767/40) Simplify (t(-7)(tt*6)/t)/((ttt3ttt)/(tt(5/4)t))(tt(-6/11)/t)/((t/t(-5))/t)(t(-2/5)/tt)/t(-1/8) assuming t is positive. t(-5091/440) Simplify ((tt(2/11))/tt*(-10)(t12)(-34))(15/2) assuming t is positive. t(-34470/11) Simplify (((w*(1/4)w)/w*(-3/11)(ww(-8))/(w/(w/(ww*(2/5)))w))(3/5))9 assuming w is positive. w(-46791/1100) Simplify (g(-1/4)gg)/ggg*(-1/5)g*6g*(1/2)/gg((g2/g)/g(-6))/(gg(g(-1)g)/gg)(-1/18) assuming g is positive. g(2729/180) Simplify y(6/11)/y(-2)(yy(-1)y)*5(y(-7/4)/(y/(y(-12)/y)))(-40) assuming y is positive. y(7013/11) Simplify ((p*0p5)/(p(-2/9)p)(-44))/(p(-3)p/p*(4/5)p(-3/2)/p(3/5)) assuming p is positive. p(3971/90) Simplify ((r/(r/r(-2/41)r)r)/r*(-4/7)(r/r(-16/3))/(r/(r(-2/7)/r)))(-6/7) assuming r is positive. r(-7870/2009) Simplify ((t*(2/17)/(t/(tt((tt/(tt/t(7/3))t)/t)/t)t))/(t(-24)/t(-3/11)))(22/5) assuming t is positive. t(5650/51) Simplify ((a(-1/11)a*(-6))/(a/(aa*(-3))a(-1/6)))/((a/a7)/(a*(11/5)a))(-23) assuming a is positive. a(-72773/330) Simplify (((a*(-1/3)a)/a)*(-3/4)(a(a(5/2)a)/a)/a*(-2/7))/((aa/(aa(1/4)))(2/15)(((a/(a*4/aaa))/a)/a)/(aa*(3/7)a)) assuming a is positive. a*(1731/140) Simplify (rr*(3/5)rrrr(1/5))(-1)/((r/r(-2/7))(22/3))45 assuming r is positive. r(-15018/35) Simplify ((d/d(-1))(-1/11)/(dd(-2/11))(1/10))(-41) assuming d is positive. d(1189/110) Simplify (((v/((v*(-11)/v)/vvv)vv/(v/(v(-4/3)v)v)v)/((vv(3/4))/(vv/v(-3))))27)(-8/5) assuming v is positive. v(-3438/5) Simplify ((((f(-13))42)40)(4/25))(-9) assuming f is positive. f(157248/5) Simplify ((d1)(2/67)/(d/((dd(-1)d)/d))*(-5/4))/(((((d((d*3d)/d)/d)/d)/d)/((d/d(-1/4))/d))/(d(-2/7)(d(-2/11)/d)/dd)) assuming d is positive. d*(-9675/10318) Simplify ((w/(ww(2/21)))/w7)*(-3/44)(w/(w*8w)w(-3/8))(-39) assuming w is positive. w(201499/616) Simplify (((pp*(2/13)p)/(p*17ppp))/(p*(-28)p/(p*28/pp)))(9/7) assuming p is positive. p(621/13) Simplify (((pp/(((p0p)/p)/p))/p)(1/4))(2/67)/((p(pp*(3/7))/p)/((p/(p/(pp*(-2/9)ppp)))/p))14 assuming p is positive. p(11399/603) Simplify (ll/l(-29)ll(-35)l)/(l/l(-3))(-45) assuming l is positive. l178 Simplify ((w(1/3)w)(-38)(w/(w/w(-1/3)))(7/8))/((w*(1/2)www/w*4)/(www/((w/(wwwww1ww))/w))(4/7)) assuming w is positive. w(-7517/168) Simplify (t/t(-3)t*(1/5))/(tt/(t/t(-2/3)))(-4/15)t/t(5/2)t(t(-5)t)/tt(3/5)/t0 assuming t is positive. t(-11/18) Simplify ((b/(b(4/9)b))/b(2/21))(-20)((b/(bbb1/bb))/(b/b5))16 assuming b is positive. b(2696/63) Simplify (b(2/55)/b)/(b/b*31)b(14/3)/(b(-35)/b) assuming b is positive. b*(11501/165) Simplify (t/((tt/(t/(tt(-5/9))))/t)t/(t*16t)t(-20)/(t(-1/12)t))(2/37) assuming t is positive. t(-1309/666) Simplify (f0)32/((f/f(-2))/(f/f(-2/13)))((ff*(-7))/fff/(f(ff/(f/((ff*(-6)f)/f))f)/f))/(f(-3/4)ff(2/25)) assuming f is positive. f(-5429/1300) Simplify ((x(2/21)/(((x/x29)/x)/xx))(2/7))(-33) assuming x is positive. x*(-13442/49) Simplify (((ss*(-4)/s)/sss/s(-2/5))/((s(-8)s)/(s((ss(-10))/s)/s)))6 assuming s is positive. s(-168/5) Simplify (i/((i/i(-10))/i))/ii(i/(ii(1/4)i))/ii(i*29i)(14/11) assuming i is positive. i(1229/44) Simplify (p*(1/5)/(pppp*(-14))(p(-1/7))(12/13))(-9) assuming p is positive. p(-45324/455) Simplify ((m(1/3))50((mm*0)/mmm)/mm/m(-3/7))(11/3) assuming m is positive. m(4411/63) Simplify x(2/3)xx*0(xx1/xxx)(1/34)((xx6/x)/((x(2/17)/x)/xx))/(x*(2/11)/(x(x/(x*(-6)/x)x)/x)) assuming x is positive. x(19585/1122) Simplify ((v(1/7)/v)35)(3/10)/((v*(-3/7)v(5/2))/((v(-5)/v)/(vv0))) assuming v is positive. v(-253/14) Simplify ((m(-18)m/m(-2/77))(-1/6))(20/9) assuming m is positive. m(13070/2079) Simplify (p/p3)/((p3/p)/p)(p(-2/5))(1/3)(p*(-2)p(-5)/p)/((p/(p/p(-3/2)))/(p/(pp/(p6/p))p)) assuming p is positive. p(-139/30) Simplify ((s/s1)*(2/41)(s(2/5))37)17 assuming s is positive. s(1258/5) Simplify (((b/(b/b*(-3/5))b)/b)/(b*(-3)b))*(2/15)(b*6bb4)/(bb1)40 assuming b is positive. b(-5161/75) Simplify (c(1/3)c(3/8)/c(c0/c)2)/(((c/c*(2/3)c)/(c/c3))/(c(-2)c/c4)) assuming c is positive. c(-85/8) Simplify ((b2/bbbb/(b*2bb))/((b/(b/(b(-7)/b)))/b(1/18)))/(b/b(-4)b*(-2/7)bbb*(-1)b4) assuming b is positive. b(-209/126) Simplify (((h/(h*(-2/3)/hh))/h)(-18))(-2/9)((h(-1/3))(1/14))(-38/3) assuming h is positive. h*(187/63) Simplif	{ "pile_set_name": "DM Mathematics" }
l + 4h - p for l. -5 Let b be (-5)/15(9 + -24). Solve 0 = 4g + 2o + 3 + 3, -2 = -3g + bo for g. -1 Let w(k) = 3k2 - 35k + 150. Let b be w(5). Solve 0a - 2f = -3a - 25, b = -5a + 5f for a. -5 Suppose -78 = -2k + 2h, 5h - h = -8. Solve 0 = 2v - 3v - 3q + 4, -4q = -5v - k for v. -5 Suppose 15 + 96 = 37r. Solve t + r = w + 4, t + 9 = -w for w. -5 Let m(r) = -2r2 + r2 + 8 - 9. Let b be m(-3). Let g = -4 - b. Solve 3j + j = 5y + 11, -2y = g for j. -1 Let d(h) = -h + 2. Suppose -3g + 5 = -5v, -10 = 3v - 8v. Let p be d(g). Let b be -4 - -1 - (p + -1). Solve -1 = -4i + 5t + 16, b = -3i + t for i. -2 Let c be 278/695 + 53/5. Solve 4w - 5l = 5, -7w = -cw + l + 17 for w. 5 Let t = -1 + 7. Suppose 4s - 3p - 6 = 0, -4s - 4p = -2p - 16. Let k be 116/s - 64/(-48). Solve 20 = -2q + 2w, -3q - w + tw - k = 0 for q. -5 Let f be 360/44 - 4/22. Let q be 135/f + 1/8. Let a = -13 + q. Solve w = -4r - 24, r + ar + 25 = 0 for w. -4 Let h(j) be the first derivative of -j*3/3 - 15j*2/2 - 10j + 4. Let l be h(-14). Solve 0 = -3i - 2p - 22, 4i + 3p + 27 + l = 0 for i. -4 Let t = -10 - -15. Let h(v) = 2v2 + 2v. Let j be h(-2). Solve 2w = -jp + 20, -w - tp + 16 = -p for w. 4 Suppose 141 = 4c - 3. Suppose 7t = 6 + c. Solve -w = 2h - 3, -4h + tw + 12 = 2w for h. 2 Let n(h) = -h3 - 5h*2 - 6h - 6. Let f be n(-4). Solve 5l - 3 = -5m - 23, 5m - 8 = fl for l. -4 Suppose 0 = -0k + 8k. Suppose z - 4 = -k. Solve zh + 6 = -y + 2, -4y - 3h = 16 for y. -4 Let r(x) = -33x - 4 - x*2 - 17 + 22x. Let o be r(-8). Solve 3t + 2t + 4 = -2n, ot - 3n = -15 for t. -2 Suppose -18 - 2 = -4f + 3t, 5t = 5f - 20. Solve 2h - f = 6h + 3k, -k - 21 = 5h for h. -5 Let m = -34 - -34. Let r(p) = mp + p*2 - 2p*2 + 4p + 2 - 1. Let l be r(2). Solve x = -3b - 4x + 29, b - 2x = -l for b. 3 Suppose -17q + 16q - 4z = 1, -5q = -3z - 18. Solve 3u + 15 + 0 = 0, ql + 13 = -5u for l. 4 Let s(y) = y - 9. Let k be s(13). Suppose -10a - k = -12a. Solve -4 = -2x - 2v, -v + 2v = ax - 4 for x. 2 Let n = -506 - -511. Solve nx = j + 12, 5x = -7j + 2j for j. -2 Let c = 166 + -162. Solve cb = -a + 16, a + 7 = 3b + 3a for b. 5 Let q(g) = 6g - 6. Let f(o) = 11 - 3o - 9o + 8 - 5o. Let i(p) = -4f(p) - 11q(p). Let d be i(6). Solve 2b = 4m - db + 16, 0 = 5b - 10 for m. -2 Suppose 0o - 11 = -5i - o, i - 5o = 23. Solve -5c = -it - 11, t - 3c + 5 = -0t for t. -2 Suppose z + r + 0r = -5, -5z = -2r + 4. Let f be ((-16)/(-1))/(0 - z). Solve 2l + f = 4n, 2l = -5n - 7 + 17 for n. 2 Suppose 0 = -3w + 33y - 29y - 4, 5w = 4y - 4. Solve w = 2f + 4h, h - 3 = 3f + 4h for f. -2 Suppose g - 4y = 6g + 3, 0 = -2g + 4y + 10. Solve 0 = 2a + 2, 5i = -3a + 2a - g for i. 0 Suppose -2q + x = -12, q + 4q + 2x - 12 = 0. Suppose 8 = 2f - 2. Suppose y - 7 = r, -4y + fy + 4r = -13. Solve ya = qt - 14, 4t + t - 5a = 20 for t. 2 Let k be ((0 - 23) + 4)/(-1). Let y = 19 - k. Solve -4 = -3q - 5v, 2q - v - 2v - 9 = y for q. 3 Let z = -6 + 11. Suppose 4w + 12 = 6w - 2y, 0 = 3w + 3y. Suppose -14 = -4j + c - 0c, -3j + 3 = wc. Solve -zf + 5 = 2x, -x + 4 = 4f - j for x. -5 Let h(m) = -105m - 522. Let a be h(-5). Suppose 19 = 2q + q + 2k, 3q - 14 = -k. Solve ar - 6r + 3o = -q, 4r = -5o - 14 for r. -1 Let m(n) = -4n3 + n2 - 1. Let i be m(-1). Suppose -i + 40 = 3a. Let o be (18/a)/(6/16). Solve 2l + 40 = 5w + 12, -ow = 4l for l. -4 Suppose -2z = -4z + i + 13, 4z = 5i + 29. Solve -2a - z = -g - 4a, 0 = 2a - 10 for g. -4 Let l(o) = -o*3 + 5o*2 + 7o - 31. Let c be l(5). Solve -2g + 3t - 5 = 0, 0t - 2t = cg + 18 for g. -4 Let f = -137 - -138. Solve n + n + 2 = -5b, -n + 4b - f = 0 for n. -1 Let y be 0/(1 + 3)1. Let z be ((y - -3) + -6)/((-6)/4). Solve 0 = -3w + w + zu - 6, 4u = 3w + 11 for w. -1 Let a(k) = -k*3 + 5k*2 + 15k + 4. Let u be a(7). Suppose d - u = -2m, 3d - 2 = m + d. Solve -w = -mw + 3j + 12, -w - 3j + 8 = 0 for w. 5 Suppose -5g = -v - 27, -6g + g - 4v + 17 = 0. Suppose 37 = q + 3u, 2q - gq + 81 = -u. Solve 6 = 4r + 5n, r - q = -4r + 4n for r. 4 Suppose 5g + 15 = -3n + 25, -8 = 3n - 4g. Solve -25 = h - nh - 5v, -10 = -5h - 2v for h. 0 Suppose s + 3s + 224 = 0. Let v be (12/(-14))/(12/s). Solve -n + g + 4 + 2 = 0, -n + vg + 9 = 0 for n. 5 Let n(s) = 161s + 7408. Let k be n(-46). Let p(o) = -o*2 + 5o + 3. Let z be p(5). Solve -zy - 4 = ka, 3a + 7y + 9 = 4y for a. -5 Let i be (0 - 1)/((-40)/360). Let m be 03/9 + 2. Solve 2t + i = -t + 3f, 0 = -t - mf for t. -2 Let y = 0 - -3. Suppose -5z + 10z - 25 = 0. Suppose 0 = -4l + z + 15. Solve -yq + 1 = -g, 3q = lq - g for q. 1 Let v = 115 - 97. Suppose -v - 93 = -4n + 3a, 72 = 2n + 4a. Suppose -5f + 15 = -p, 0p = 5f + 2p. Solve -5c + 5g = n, -c = -g + fg + 4 for c. -5 Let x(r) = 9r2 + 6r + 6. Let h be x(-3). Suppose -3l - 3c = -h, l + 4 - 15 = 3c. Solve 3g + 12 = 0, -3i - 5g = l + 12 for i. -4 Let p = -13 + 17. Suppose pk = 26 + 26. Let r = -8 + k. Solve 0o - 4 = 2o, 3l + 2o = r for l. 3 Suppose -74f + 96 = -66f. Solve -4t + 2o = 7o - f, 0 = -t - 2o + 3 for t. 3 Suppose 0 = 4i + 11 - 35. Suppose -2p + 24 = 2p + 4z, 48 = 4p - 2z. Let a = 14 - p. Solve x + 3 - a = 2d, 4d = -2x - i for x. -1 Let m(i) = i3 + i2 + 3. Let r be m(0). Suppose rl + 65 = 8l + 5d, 2l + 4d - 32 = 0. Let p = l + -5. Solve 5x - 9 = -q - 0, -px = 3q - 17 for q. 4 Suppose -9 = -5i + p, 25 = 81i - 76i - 5p. Solve h + 6 = k, 0 = -3h - k + i - 11 for h. -4 Let m(y) = -3y*2 + 3y + 12. Let v be m(3). Let g be (-1 + 2 + -2)/(2/v). Solve 0c + 4x - 10 = 2c, -4c - gx = -2 for c. -1 Suppose n = 4t - 12, -9t - 12 = -13t + 5n. Solve tz + 5l + 6 = 0, z + 3 = 3z + l for z. 3 Let s be (1 - -4) + (21 - 19) - 7. Solve 5x - 4l - 25 = 0, -5x + 6x + 2l - 5 = s for x. 5 Suppose 4j + 7 = 3w, 2j + 11 = 35w - 32w. Solve -1 = 2u + 2u + 3v, -wv + 9 = 4u for u. -4 Let s = 9 + -7. Suppose sd = 5j - 30, 3d = -4j + 8d + 41. Suppose -4h - 8 = -0o - 4o, o = 2. Solve 6 = 5b + 3v, v - 2 = jb - h for b. 0 Suppose 9d = -3q + 11d + 3, -3q - 2d = -15. Solve -5v = -5f + 5, -v - f = qf + 1 for v. -1 Let c(a) = 5 - 9a + 3a + a*3 + 1 + 5a2. Let o be c(-6). Let s(u) = -u2 - 6u - 4. Let n be s(-4). Solve 2p + o - 4 = -2y, 10 = -3p + ny for p. -2 Let o be (-3)/23/(99/(-110)). Solve om - 10 = -5s + 10, -m = -3s - 4 for s. 0 Let g be 8/80 - 716/(-40). Solve 2w - 3b + 3 = -11, -g = -2w - 5b for w. -1 Let w = 811 + -808. Solve -4 = 3d + wt - 1, -4t + 21 = -d for d. -5 Let z = -787 - -789. Solve 0 = 4v - zx + 2, 3v - 3 = -x - 2x for v. 0 Suppose 6s = 14s. Suppose -2z + z + 3o + 10 = 0, s = -3o - 6. Solve -2n = -5i - 2, -5i + zi + 4 = 4n for n. 1 Suppose 13 = -5j + 2u - 249, -4u = -3j - 146. Let c = 90 + j. Let q = c - 32. Solve 30 = -2p - qf, -3p + 3f - 10 = 2p for p. -5 Let p = 423 + -398. Solve 2d = 2m + 10, 0m + p = 5d + m for d. 5 Suppose 8g = -3s + 6g + 24, 0 = -3s - 5g + 24. Let l be ((-28)/s + 3)0/(-2). Solve 2k - m + 1 + 2 = l, 0 = k + 4m + 6 for k. -2 Let g be -5 + (-9)/(-3) - 77. Let s = -61 - g. Solve -6h + s = z - h, 0 = z + h - 2 for z. -2 Let d(a) = 2a - 16. Let l be d(0). Let s = l - -19. Suppose -19 + 3 = -3r - 2i, 0 = sr - 2i - 20. Solve 2q + rc + 10 = 2c, 2q + 2c + 8 = 0 for q. -3 Suppose -43l + 32 = -35l. Solve 5r + 35 = -lp, -r - 5p = 13 + 15 for r. -3 Suppose 4m - 6 = 10. Suppose 0 = -5c + 11 + m. Let h = c + -3. Solve hn = -2g + 2n - 2, -4n = g - 4 for g. 0 Suppose -5o + 2a = -10o - 190, -5o + 4a = 160. Let k = o + 16. Let s be k/(-9) - 12/54. Solve 4b - b + 4y - 32 = 0, -3b + sy + 2 = 0 for b. 4 Let j(z) = -2z - 1. Let c be j(-3). Suppose 5t = 2g - 16, ct + 20 = 4g + t. Solve 4n + 5v = -n + 20, -2 = -gn + 2v for n. 2 Suppose 2n - 1250b - 50 = -1252b, -5n + 119 = -b. Suppose 3o + i = 18, 3o - 10 = 3i - 4. Solve 0 = -2v - ol + n, 0v = -v + l - 2 for v. 2 Suppose -5x + 15 = -0s - 5s, -x + 3s + 3 = 0. Let k be (-1)/5 + x/15. Suppose -4n = -6n + 6. Solve d - 2o + 5 = k, 2o - 30 = -nd	{ "pile_set_name": "DM Mathematics" }
+ 1)(p + 2)2/5 Let w = -21 + 45/2. Let i be (-1)/(-3)(-3)/(-2). Factor -ic3 - 3/2c*2 - 1/2 - wc. -(c + 1)*3/2 Suppose -5v + 0v = -15. Let w(d) = -d2 + 6d + 31. Let z be w(9). Factor 1/3r + 0 - 1/3r*2 + 1/3r*z - 1/3r*v. r(r - 1)*2(r + 1)/3 Suppose 2q = -3 + 13. Solve -6n - 4n4 + 4n*2 - 2n*4 + 6n*q + 4n*3 - 4n*5 + 0 + 2 = 0. -1, 1 Let b be -1 - (5 + -2) - 7. Let t be (-10 - b) + 2/(-3). Factor -tl*4 + 0l + 0 + 4/3l3 - 4/3l2. -l2(l - 2)2/3 Let w(f) = 2f*4 + 0f*3 + 5f - f*4 - 6f - f*3. Let x(b) = 4b*4 + 2b*3 + 2b*2 - 2b. Let h(v) = -2w(v) + x(v). Suppose h(q) = 0. What is q? -1, 0 Let v(x) be the first derivative of -12x*5/5 + 2x*4 + 4x*3 - 4x*2 - 9. Find u such that v(u) = 0. -1, 0, 2/3, 1 Let v = 12 - 7. Let g(b) be the first derivative of 0b + 2/15bv - 2 + 0b*2 - 1/6b*4 + 0b*3. Factor g(d). 2d*3(d - 1)/3 Let u(q) be the first derivative of q7/6720 + q6/1440 + q*5/960 + 3q*3 + 6. Let i(b) be the third derivative of u(b). Factor i(g). g(g + 1)*2/8 Factor 0 + 0j - 5/3j2 + 5/3j*3. 5j*2(j - 1)/3 Let u(n) be the third derivative of n8/448 - n7/140 - n6/160 + n5/40 + 3n2. Determine m, given that u(m) = 0. -1, 0, 1, 2 Let 2/3f + 2f2 + 2f*3 + 2/3f4 + 0 = 0. What is f? -1, 0 Let t(n) be the second derivative of n10/30240 - n9/15120 - n4/4 - 2n. Let l(f) be the third derivative of t(f). Solve l(z) = 0 for z. 0, 1 Let o(b) be the third derivative of -1/2b*3 - 1/20b*5 + 0b + 1/4b4 + 0 - 10b*2. Factor o(t). -3(t - 1)2 Let p(t) be the second derivative of t6/360 + t5/40 + t4/12 - t*3/3 - 5t. Let x(s) be the second derivative of p(s). Factor x(i). (i + 1)(i + 2) Find b such that 16b*2 - 22b*2 + 2b*4 + 2b*3 + 7b2 - b4 = 0. -1, 0 Let u(l) = l*3 + 12l*2 - 30l - 28. Let p be u(-14). Suppose pm4 + 0m*3 + 0 + 1/3m*5 + 0m + 0m2 = 0. Calculate m. 0 Solve -4/5j*2 - 4/5j + 0 = 0. -1, 0 Let c(s) = -4s2 + 2s + 5. Suppose -5 = 2z + 29. Let r(m) = 12m*2 - 5m - 14. Let t(q) = zc(q) - 6r(q). Solve t(n) = 0 for n. -1/2 Let g(x) be the third derivative of -x*5/150 + 2x*4/15 - 16x*3/15 + 3x*2. Let g(z) = 0. Calculate z. 4 Let a(y) = -y + 14. Let x = 9 - -4. Let i be a(x). Solve 0o - 1/4o3 - 3/4o*2 + i = 0 for o. -2, 1 Solve -52q*4 + 467q*5 - 116q*2 - 118q*4 - 417q*5 + 212q*3 + 26q - 2 = 0 for q. 1/5, 1 Let g = -13 + 10. Let r = -3 - g. Determine p, given that 1/4p3 + 0 + 1/4p*4 + 0p + rp2 = 0. -1, 0 Suppose 9 = 12v - 9v. Let t(l) be the first derivative of 1 - l2 + l + 1/3l*v. Solve t(w) = 0. 1 Suppose w - 12 = -5r, 12 + 0 = 3r + 3w. Find c, given that -2 - rc - 1/2c*2 = 0. -2 Determine o so that -3/2o*5 + 0o*2 + 6o*4 + 0o + 0 - 9/2o3 = 0. 0, 1, 3 Let o(m) = -m2 + 17m - 9. Let v(l) = -4l + 2. Let s be (0 + 3)4/(-6). Let i(q) = so(q) - 9v(q). Factor i(k). 2k(k + 1) Let a = -16 - -41. Let i = a + -25. What is s in 16/11s3 + 2/11s + i + 12/11s2 = 0? -1/2, -1/4, 0 Factor 0 - 2s - 7/2s4 - 23/2s*3 - 10s*2. -s(s + 1)(s + 2)(7s + 2)/2 Let x(i) be the second derivative of -1/4i*4 - 1/28i*7 - 3/8i*5 + 0i*3 - 1/5i*6 - i + 0i*2 + 0. Factor x(k). -3k*2(k + 1)*2(k + 2)/2 Find n, given that -4n4 + 8n*3 - 3401 + 4n*2 + 3401 - 8n = 0. -1, 0, 1, 2 Solve 2v + 2v - 48v3 - 8v*2 + 8 + 44v*3 = 0. -2, -1, 1 Let n be (7/(-1050))/(12/(-10)). Let z(l) be the third derivative of 0 + nl*6 + 0l*3 + 0l*5 + 0l*4 - 2l*2 + 0l - 1/315l7. What is x in z(x) = 0? 0, 1 Let t(v) = -v2 + 10v + 13. Let z be t(11). What is r in -6r3 - 2r*3 - 2 - 4r4 + r2 + 5r + 0r*3 + 3r*5 + 5r*z = 0? -1, 1/3, 1, 2 Suppose 2x + 2 - 6 = 0. Suppose -5w + 9 = -xw. Determine u, given that 0u2 + 2u4 - u2 - u*2 - 4u*w + 4u*2 = 0. 0, 1 Let k be (-16)/(-156)(-6 + -1). Let f = 18/13 + k. What is r in 0r - 2/3r*3 - fr*2 + 0 + 2/3r*5 + 2/3r*4 = 0? -1, 0, 1 Let c be 155/10 + 1/4. Let k = c + -57/4. Factor 0 + 2q*2 - kq*3 - 1/2q. -q(q - 1)(3q - 1)/2 Let g(y) be the third derivative of -3y7/14 + y6 - 11y5/6 + 5y*4/3 - 5y*3/6 - 12y*2. Factor g(n). -5(n - 1)*2(3n - 1)2 Let g(b) be the second derivative of -2b + 0 - 7/9b3 - 4/9b*4 - 1/3b*2 + 8/15b*5. Factor g(l). 2(l - 1)(4l + 1)*2/3 Suppose 3m = 5b - 97, -b + 0b - 2m = -22. Factor 20q - bq - 8q*4 - 2q*2 - 10q*3. -2q*2(q + 1)(4q + 1) Let -36/5 - 1/5a2 - 12/5a = 0. What is a? -6 Let t(j) = j4 + j2 - j + 1. Let p(n) = 5n4 + n3 + 9n*2 - 7n + 4. Let k(w) = -p(w) + 6t(w). Factor k(y). (y - 2)(y - 1)(y + 1)2 Factor 0 - 8/5l*3 - 2l*2 - 2/5l*4 - 4/5l. -2l(l + 1)*2(l + 2)/5 Let q = 15/14 + -9/28. Factor 1/2 + 1/4k2 + qk. (k + 1)(k + 2)/4 Let u be ((-3)/(-6) + 1)/(-81). Let z = u + 113/270. Factor -1/5n*3 - zn*2 - 1/5n + 0. -n(n + 1)2/5 Let x(i) = -4i*2 - 4i - 3. Let j be -7 + 4 + -1 + 2. Let l = -4 - j. Let v(f) = 3f2 + 3f + 2. Let p(g) = lx(g) - 3v(g). Factor p(c). -c(c + 1) Suppose 3v - 107 + 29 = 0. Suppose -5t - 5s + 2 = -28, -5t - 4s + v = 0. Factor -2u - 3u*2 - 2u*2 + 3u*t. -2u(u + 1) Determine q, given that 3/5q - 1/5q3 - 2/5 + 0q2 = 0. -2, 1 Let s(g) be the second derivative of -g6/10 - 3g5/20 + g4/4 + g3/2 - 9g. Factor s(b). -3b(b - 1)(b + 1)2 Let f(z) = -45z*2 + 24z - 3. Let o(l) = l*2. Let b(m) = f(m) - 3o(m). Factor b(p). -3(4p - 1)*2 Let y be 1/(23/(-6) + 4). Let l be 18/y - 57/27. What is c in -8/9c + 2/9c2 + l = 0? 2 Let m(p) be the second derivative of 3/130p*5 + 2/39p*4 - 2/13p*2 - 1/39p*3 + 0 - 4p. Factor m(a). 2(a + 1)2(3a - 2)/13 Let n = -4613/9 - -513. Factor 2/9 - 2/9x*4 - nx*3 + 0x*2 + 4/9x. -2(x - 1)(x + 1)3/9 Let q(c) be the third derivative of c8/1848 - c6/330 + c4/132 - 4c2. Solve q(p) = 0 for p. -1, 0, 1 Let o be 2 - (3 - 527/525). Let c(b) be the third derivative of 0b*4 + 0 + 0b*3 + 0b5 + b2 - ob7 + 0b - 1/600b6. Suppose c(n) = 0. Calculate n. -1/4, 0 Let z be 35/20 + (-3)/2. Factor -f + zf*2 + 3/4. (f - 3)(f - 1)/4 Let h(y) = -3y4 - 9y*3 - 5y*2 + 4y - 2. Let u(c) = c*4 + 4c*3 + 2c*2 - 2c + 1. Let d(f) = 2h(f) + 5u(f). Factor d(p). -(p - 1)*3(p + 1) Suppose 4f = 16, -f = 6x - 2x - 12. Factor 0 - 2/3o*3 - 2/9o*5 + 0o - 2/3o4 - 2/9o*x. -2o*2(o + 1)*3/9 Factor 18/11x*4 - 4/11 - 50/11x*3 - 6/11x + 42/11x2. 2(x - 1)*3(9x + 2)/11 Suppose 3w + 5h = 4h - 126, 4w = -3h - 173. Let q = w + 125/3. Solve qx3 + 4/3x*2 + 2/3x + 0 = 0. -1, 0 Let h(v) be the first derivative of -243v4/4 - 36v*3 - 6v*2 - 4. Factor h(q). -3q(9q + 2)*2 Let y(z) = z. Let f(t) = 2. Let h(x) = f(x) + y(x). Let o be h(0). Suppose -10g - g*3 - 20g*2 - 10g*4 - og*5 - 19g*3 - 2 + 0 = 0. What is g? -1 Suppose -n - 2n = 2c - 12, -53 = -5c + 4n. Let g be 3/c + (-16)/(-6). Find q such that -3/4q + 3/2qg - 1/2 - 3/4q5 + q2 - 1/2q4 = 0. -1, -2/3, 1 Let l(p) be the second derivative of p6/900 - p5/150 + p4/60 - 2p*3/3 - 7p. Let t(x) be the second derivative of l(x). Factor t(c). 2(c - 1)2/5 Let m(a) be the second derivative of -3a - 1/42a4 - 4/21a*3 + 0 - 4/7a*2. Determine u, given that m(u) = 0. -2 Let h(a) = -51a*4 - 49a*3 + 91a*2 + 49a - 40. Let k(p) = 10p4 + 10p*3 - 18p*2 - 10p + 8. Let s(d) = -2h(d) - 11k(d). Let s(j) = 0. What is j? -2, -1, 1/2, 1 Let a(l) be the third derivative of -3l2 + 0l*3 - 2/525l*7 + 0l + 0l4 + 0 + 0l*5 + 1/300l*6 + 1/840l*8. Factor a(q). 2q*3(q - 1)*2/5 Let n be ((-234)/65)/(8/110). Let x = n - -54. Solve -6s*2 + 21/2s - x = 0 for s. 3/4, 1 Let v(p) = 2p2 - 4p + 2. Let h(w) = -3w2 + 4w - 3. Let u(o) = -7 - 1 + 3o - 4o. Let c be u(-4). Let x(d) = ch(d) - 5v(d). What is q in x(q) = 0? -1 Let g = 14 - 15. Let r = 1 - g. Factor 4/3zr - 4/3 - 2/3z*3 + 2/3z. -2(z - 2)(z - 1)(z + 1)/3 Let i(y) = 6y*3 - 17y*2 - 5y + 10. Let w be i(3). Factor 0x + 0x*2 + 2/7x*5 + 0x*w + 0 - 2/7x*3. 2x*3(x - 1)*(x + 1)/7 Let o(s) be the first derivati	{ "pile_set_name": "DM Mathematics" }
(f) = f2 + 1. Let j(r) be the second derivative of -r4/6 + r3/3 - r2 - 24r. Let v(u) = 3c(u) + j(u). Give v(-1). 0 Let m = -8 + 12. Let d(x) be the first derivative of 1/3x3 + 6 + 6x - 5/2x2. Determine d(m). 2 Let y(q) be the third derivative of q5/60 - q4/24 + q3/3 + q2 - 50q. Calculate y(1). 2 Let k be (-2)/6 - (336/(-18))/8. Let x(g) = -g*3 + 7g*k + 29 - 5g - 20 - 10. Suppose 4i + 0i + 18 = 5m, 0 = -3m + 2i + 12. Calculate x(m). 5 Let r(g) = -g2 - 3g - 5. Let k = -1254 + 1250. Determine r(k). -9 Let o(t) = -12t. Let v(q) = 25q - 21. Let m(b) = 2o(b) + v(b). Determine m(-13). -34 Let s(t) be the first derivative of -t4/4 + 8t*3/3 + 3t*2 + t + 144. Give s(9). -26 Suppose 5l - 3u = 93, -4u + 0 = 2l - 32. Let h = l + 1. Let d = 17 - h. Let i(w) = w3 + w2 - w - 1. Give i(d). -3 Let y(p) = -30p + 356. Let u be y(12). Suppose 2h = 5m - 2m + 6, -4h + 3m = -6. Let o(g) = -6 + g + 2 + g + hg. Calculate o(u). -12 Let j = -63 + 59. Let y be -2 - (-3 + 3 - j). Let c(a) = 6a + a2 + 4 - 2 + 4. Calculate c(y). 6 Suppose -5x + 2x + 456 = 0. Suppose 120 + x = 2f. Let p(r) = -r + 3r + 131 - f. Give p(6). 7 Let v(h) be the second derivative of h5/60 + h4/12 + h3/3 - 2h. Let f(n) be the second derivative of v(n). Let x be 4/3 + 154/(-21). Determine f(x). -10 Let x(u) = -2u2 - 5 - 993u*3 - 4u*2 - 2u*2 + 10u + 994u3. Calculate x(6). -17 Let b(j) = -j2 + 8j + 7. Let m(y) = -y*2 + 7y + 8. Let a(q) = 3b(q) - 4m(q). Give a(6). 1 Let w(x) = -x + 3. Let a(n) = 5n2 + 2n - 30. Let j(g) = -14g2 - 5g + 90. Let t(y) = 11a(y) + 4j(y). Let z be t(6). Calculate w(z). -3 Let d(i) be the third derivative of -5i4/24 - 3i*3/2 + 231i2 - 2. Give d(-5). 16 Let t(j) = -j2 + j + 12. Let r(z) = -z*2 + 5. Let l(s) = 5r(s) - 2t(s). What is l(-2)? -7 Let g(a) = a - 3. Let d be g(9). Let b(p) = -5p*3 + 4p*3 - 3p + 4p2 + 216 + 3p*2 - 223. Calculate b(d). 11 Let y be -2((-7)/2 - -6). Let u be (0 + -3)/(3/(-6)). Let v(i) = 20i + 26. Let j(s) = 7s + 9. Let m(g) = uv(g) - 17j(g). Give m(y). -2 Let s = 2700 + -2693. Let a(l) = 6l2 - l + 9. Let v(r) = -r2 - r - 1. Let t(h) = a(h) + 5v(h). What is t(s)? 11 Let n(w) be the third derivative of w5/20 - w4/12 - w*3/6 + 156w*2. Give n(3). 20 Let k(f) be the third derivative of 0f*3 - 5f*2 + 0 - 1/8f*4 + 0f - 7/720f6 + 0f5. Let a(v) be the second derivative of k(v). What is a(1)? -7 Let a(f) = f3 + 7f2 - 8f - 5. Suppose 30 = 3o - 3c, -4c + 2 = o - 8. Let z be 9/3 + 0 - 1 - o. Give a(z). -5 Let u(t) be the second derivative of -t7/840 + 7t*6/360 - 3t*5/40 + 3t*4/8 + 2t*3 - 20t. Let f(c) be the second derivative of u(c). Calculate f(6). -9 Let b be 326/(-30) + 28/(-210). Let l(t) = 2t + 15. What is l(b)? -7 Let u(a) = a + 2. Let s = -15 - -3. Let w = -9 - s. Suppose 0 = -wh - 2h. What is u(h)? 2 Let v(j) be the second derivative of -j5/20 + j4/4 + j3/6 - 92j. What is v(3)? 3 Let l(j) = -20j + 54. Let p(c) = 14c - 36. Let g(f) = -5l(f) - 7p(f). What is g(10)? 2 Suppose 3n = 9 + 30. Let r(g) = -3g + 4g + n + 0g. What is r(-6)? 7 Let a(j) be the third derivative of -j*6/120 + 3j*5/20 - 3j*4/8 + 5j*3/6 - 3j*2. Let c be (6/(-12))/((-15)/240). Calculate a(c). -3 Let f = -11 - -10. Let t(y) = -12y - 1. Let r be t(f). Let l(x) = -x*3 + 12x*2 - 11x. Let z be l(r). Let v(s) = s + 9. Calculate v(z). 9 Let x(g) = -1 - 5g2 - g3 + 3 + 9g + 2g - 13g. Let p be x(-4). Let d(m) be the third derivative of -m5/60 - m4/3 - 4m3/3 - 5m*2. Calculate d(p). 4 Let x(f) = -8f - 26. Let u(n) = 3n + 9. Let w(t) = -17u(t) - 6x(t). What is w(-6)? 21 Let r(u) = 12u + 206. Let i be r(-17). Let q(d) be the first derivative of -d*4/2 + 2d*2 - 3d + 9. Determine q(i). -11 Let w(g) = -379 - g*2 + 376 - 3g + 2g. Calculate w(5). -33 Let c(o) be the third derivative of -o6/360 - 3o*5/40 + 5o*4/24 - 7o*3/6 + 16o*2. Let w(u) be the first derivative of c(u). Calculate w(-10). -5 Suppose 10 = -2g - 3g. Let a = g - -7. Suppose -3n = -7n - 2y - 26, -an + y - 29 = 0. Let u(z) = z + 4. Give u(n). -2 Let u be (-9 - -8)/((-1)/3). Suppose ut - 7d - 45 = -2d, 12 = -4d. Suppose -8v - t = -10v. Let g(k) = k2 - 4k + 3. Give g(v). 8 Let r = 452 + -459. Let i(w) = 3w + 14. Calculate i(r). -7 Suppose 29p = 51p - 44. Let y(z) = -2z2. What is y(p)? -8 Let m(f) = -f3 - 7f2 - 3f + 24. Let x be m(-6). Let p(l) = -2l + 19. Let b(k) = k - 9. Let y(t) = 9b(t) + 4p(t). Give y(x). 1 Let w(q) = q2 - 2q - 8. Let y be w(0). Let r(k) = -k*2 - 12k - 4. Determine r(y). 28 Suppose 11 = 5m - 24. Suppose 3h - 19 = -m. Let a(f) = -hf - 2f + 5 + 7f. What is a(-4)? 1 Let q(u) be the second derivative of u5/5 - u2/2 - 4u. Let f(p) = 15p + 14. Let b be f(-1). What is q(b)? -5 Suppose -2j - j + 12 = 0. Let f(d) = -123 + 46 - d + 42 + 38. What is f(j)? -1 Let p(g) = -10g - 156. Let j be p(-16). Let n(t) = -t2 + 5t + 5. Calculate n(j). 9 Let n(l) be the second derivative of -l6/360 - l5/60 - l4/12 - l3 + 16l. Let d(s) be the second derivative of n(s). Calculate d(-2). -2 Let j(r) = r + 1. Let x be (-3)/2 + (-58)/(-4). Suppose 2c - x = 3c. Let g = c - -13. Give j(g). 1 Let a(s) = -12s*3 - 2s*2 - s. Suppose p - 23k = -24k + 1, 4k - 8 = 0. Give a(p). 11 Let d(r) = -r*3 + 6r*2 + 1. Let u be d(6). Suppose 25 = 5f, -3f + 19 = i + u. Let h(a) = -3a - 4ai + 1 + 8a*3 - 5a*3 + 4a2. Determine h(3). 1 Let z(a) = -a2 - 16a - 15. Let d = 21 - 35. Give z(d). 13 Let u(d) = -d2 - d - 1. Let c(k) = 2k*2 + 11k - 2. Let t(l) = -c(l) - 3u(l). Calculate t(6). -7 Let u(n) = 17n. Suppose 0 = -p - 2z + 9, 0 = 9p - 13p - 5z + 24. What is u(p)? 17 Let a be 2/4 + (-126)/(-4). Let z(m) = 2m - 33 + a - 4m + 3m2 - 2m*2. Determine z(3). 2 Let i(z) = 11z*2 - 59z - 5. Let h(c) = 9c2 - 48c - 4. Let b(n) = -5h(n) + 4i(n). Let s = -6 - -11. Calculate b(s). -5 Let f(s) = -s - 626 + 2s + 0s + 602. What is f(15)? -9 Let w(l) = l + 1. Let c(s) = -5s - 6. Let k(v) = c(v) + 6w(v). Let b be (132/(-110))/(2/5). Give k(b). -3 Let m = 26 - 20. Let x(z) = -2z2 - 5z*2 + mz + 3 + 8z2. Determine x(-7). 10 Let d(z) = -z2 + 8z - 6. Suppose 0 = 3q + 1 + 26. Let y be 188/36 + 2/q. Determine d(y). 9 Let x(a) = -3a*3 + 6a*2 - 6a. Let f(j) = 16j3 - 29j*2 + 29j + 1. Let z(m) = 2f(m) + 11x(m). Let n(w) = 2w - 3. Let y be n(5). Calculate z(y). -5 Let g be -14 + 9 + (-100)/(-10). Let i(r) = -r2 + 7r + 3. Give i(g). 13 Let o(y) = 2 - 6y2 + y3 - 2 - 2 + 103y - 99y + 2y*2. Calculate o(2). -2 Suppose 4a - 2 + 45 = -k, 2a = 4k - 44. Let y(l) = l + 6. Calculate y(a). -6 Let q(p) = p*3 - 8p*2 - 4p + 10. Suppose 0 = 5v + 4f - 32, 5v + 13f - 15f - 44 = 0. Give q(v). -22 Let l(o) = -10o + 15. Let t be l(2). Let b(r) = r*2 + 2r - 7. Determine b(t). 8 Let g(v) = -2 + 3v - 4v*3 + 6v*3 + v - 4v2. Let l(j) = -j3 + j*2 - 2j - 5. Let o be l(0). Let n(r) = r + 7. Let u be n(o). Determine g(u). 6 Suppose x + 13u = 9u + 5, -4x - 6 = 3u. Let n(y) = -y + 5. Determine n(x). 8 Suppose -2k = -54l + 50l + 16, -3l - k = -7. Let s(n) = 10n2 + 3n + 2. Let z(o) = 11o2 + 4o + 3. Let u(q) = 7s(q) - 6z(q). Calculate u(l). 23 Let j(k) = 506 + 2k - 283 + 2k2 - 222 + k3. Suppose -10 = -2q + 4i, 0 = -4q - 3i + 2i - 16. Determine j(q). -14 Let s(j) = -j2 + 14j + 3. Let g(l) = l*2 - 13l - 4. Let h(x) = 2g(x) + 3s(x). Let v be h(16). Let n(p) = 10p - 1. What is n(v)? 9 Let j(a) be the first derivative of 3a2/2 - 14. Let q(o) = o3 + 4o2 - 5o + 1. Let z be q(-5). Let w = 3 - z. Calculate j(w). 6 Let j(z) = 7z + 164. Let s be j(-23). Let d(k) = -k3 + 2k*2 + 2k - 3. Determine d(s). -6 Let n(c) = c*3 - 3 + 5 - 1 - 9c*2 + 5c + 8. Let g be n(9). Let t be 1/6 - (-45)/g. Let k(i) = 8i3 + i2 - i. What is k(t)? 8 Let t(p) = p3 - 11p*2 - 12p + 7. Suppose 3l + l = -l. Suppose 3h - 2v - 36 = -lv, 4v = 4h - 48. Give t(h). 7 Let d be -30 - -29 - (0 + -3). Let i(m) = -2m3 + m2 - m + 2. Determine i(d). -12 Let r(n) = -n3 - 3n*2 - 3n - 1. Let f(q)	{ "pile_set_name": "DM Mathematics" }
67071, 3334156, 5001253, 6668362? 6k2 + 1667067k - 2 What is the c'th term of -17108, -16712, -16158, -15368, -14264? 13c3 + c2 + 302c - 17424 What is the h'th term of 12836, 50626, 113364, 201044, 313660, 451206, 613676, 801064? -h*3 + 12480h*2 + 357h What is the r'th term of -3, 329, 1153, 2691, 5165? 37r3 + 24r*2 + r - 65 What is the m'th term of -58352273, -116704551, -175056829? -58352278m + 5 What is the w'th term of 3201, 6382, 9525, 12606, 15601, 18486? -4w3 + 5w*2 + 3194w + 6 What is the l'th term of 2793, 2680, 2361, 1728, 673? -18l3 + 5l*2 - 2l + 2808 What is the c'th term of -12063, -13313, -14565, -15819? -c*2 - 1247c - 10815 What is the g'th term of 6726, 6749, 6808, 6921, 7106, 7381, 7764? 3g3 + 2g + 6721 What is the g'th term of 25304, 25354, 25404, 25454, 25504? 50g + 25254 What is the c'th term of 1376, 1958, 2930, 4292, 6044, 8186? 195c*2 - 3c + 1184 What is the i'th term of 24110, 26878, 29648, 32420? i*2 + 2765i + 21344 What is the o'th term of 6957182, 27828607, 62614308, 111314279, 173928514, 250457007, 340899752, 445256743? -o*3 + 6957144o2 + 39 What is the s'th term of 181150, 362442, 543732, 725020, 906306, 1087590, 1268872? -s2 + 181295s - 144 What is the n'th term of 1904, 2536, 3154, 3758, 4348? -7n*2 + 653n + 1258 What is the z'th term of -4852932, -4853123, -4853300, -4853457, -4853588, -4853687, -4853748? z3 + z2 - 201z - 4852733 What is the h'th term of -187, -2279, -8237, -19993, -39479, -68627, -109369? -322h3 - h2 + 165h - 29 What is the g'th term of -266843, -1067335, -2401495, -4269329, -6670843? -g3 - 266828g*2 - g - 13 What is the n'th term of 718, 21403, 55868, 104113, 166138? 6890n*2 + 15n - 6187 What is the z'th term of -208597370, -417194742, -625792114? -208597372z + 2 What is the j'th term of -385899, -771726, -1157553, -1543380, -1929207, -2315034? -385827j - 72 What is the x'th term of 248061, 247845, 247629? -216x + 248277 What is the r'th term of -8942, -71617, -241702, -572891, -1118878, -1933357, -3070022, -4582567? -8949r*3 - 11r2 + r + 17 What is the z'th term of -45156, -181891, -409774, -728799, -1138960, -1640251, -2232666, -2916199? z3 - 45580z2 - 2z + 425 What is the x'th term of -8640, -8926, -9212? -286x - 8354 What is the m'th term of 505, 434, 257, -74, -607? -8m*3 - 5m2 + 518 What is the k'th term of 31615, 32357, 33083, 33787, 34463, 35105, 35707? -k3 - 2k2 + 755k + 30863 What is the p'th term of 33829, 135320, 304443, 541174, 845489, 1217364, 1656775, 2163698? -4p3 + 33840p*2 - p - 6 What is the s'th term of 16869, 67721, 152489, 271185, 423821, 610409, 830961, 1085489? 2s*3 + 16946s*2 - 79 What is the h'th term of -52632, -52656, -52686, -52722, -52764, -52812, -52866? -3h*2 - 15h - 52614 What is the y'th term of -235517, -471057, -706607, -942161, -1177713? y*3 - 11y*2 - 235514y + 7 What is the r'th term of -2874906, -2875382, -2876176, -2877288, -2878718, -2880466, -2882532? -159r2 + r - 2874748 What is the h'th term of 16197, 34286, 52375, 70464? 18089h - 1892 What is the r'th term of 6107543, 6107545, 6107549, 6107555? r*2 - r + 6107543 What is the i'th term of -9284747, -9284743, -9284739, -9284735, -9284731? 4i - 9284751 What is the n'th term of 4263603, 4263589, 4263575? -14n + 4263617 What is the c'th term of -1099723193, -1099723194, -1099723195, -1099723196? -c - 1099723192 What is the w'th term of -10959, -10996, -11101, -11310, -11659, -12184, -12921? -6w*3 + 2w*2 - w - 10954 What is the f'th term of -502672, -502682, -502692? -10f - 502662 What is the z'th term of -158444, -1267899, -4279388, -10143929, -19812540? -158503z3 + z2 + 63z - 5 What is the y'th term of -543097, -1086214, -1629331, -2172448, -2715565? -543117y + 20 What is the i'th term of 38282, 33465, 28648, 23831? -4817i + 43099 What is the n'th term of -3539115, -3539121, -3539127, -3539133, -3539139, -3539145? -6n - 3539109 What is the o'th term of 36, 547, 1742, 3903, 7312, 12251, 19002? 47o*3 + 60o*2 + 2o - 73 What is the v'th term of 30608, 30614, 30638, 30686, 30764, 30878, 31034? v*3 + 3v*2 - 10v + 30614 What is the s'th term of -51819801, -51819807, -51819815, -51819825, -51819837, -51819851, -51819867? -s*2 - 3s - 51819797 What is the d'th term of -8473, -16966, -25497, -34066, -42673, -51318? -19d2 - 8436d - 18 What is the q'th term of 120, 440, 968, 1704, 2648, 3800? 104q2 + 8q + 8 What is the h'th term of -1952, -8141, -18454, -32891? -2062h2 - 3h + 113 What is the c'th term of -604, -651, -730, -841, -984, -1159? -16c2 + c - 589 What is the t'th term of 1292, 10423, 35214, 83495, 163096, 281847, 447578, 668119? 1305t*3 - 4t - 9 What is the w'th term of -1357980, -2716050, -4074120, -5432190, -6790260, -8148330? -1358070w + 90 What is the r'th term of 223, 61, -483, -1409, -2717, -4407, -6479? -191r*2 + 411r + 3 What is the c'th term of -167758, -167787, -167816, -167845, -167874, -167903? -29c - 167729 What is the g'th term of 46415, 54080, 66861, 84764, 107795, 135960? g3 + 2552g*2 + 2g + 43860 What is the x'th term of 6073907, 12147837, 18221769, 24295703, 30369639, 36443577, 42517517? x*2 + 6073927x - 21 What is the x'th term of -1762, -6246, -13712, -24154, -37566, -53942, -73276? x*3 - 1497x*2 - 266 What is the x'th term of -5633, -6319, -8167, -11759, -17677? -97x3 + x2 - 10x - 5527 What is the t'th term of 18945540, 18945539, 18945538, 18945537, 18945536? -t + 18945541 What is the n'th term of 179143232, 358286463, 537429694? 179143231n + 1 What is the w'th term of 965, 2352, 4585, 8084, 13269, 20560, 30377? 70w3 + 3w*2 + 888w + 4 What is the n'th term of 28991, 54881, 80771? 25890n + 3101 What is the z'th term of -126902, -124100, -119428, -112886? 935z*2 - 3z - 127834 What is the z'th term of -24599, -49190, -73687, -98042, -122207? 8z3 - z2 - 24644z + 38 What is the v'th term of 219821, 220274, 220729, 221186, 221645, 222106, 222569? v*2 + 450v + 219370 What is the f'th term of 5571, 11197, 16779, 22317, 27811, 33261? -22f2 + 5692f - 99 What is the d'th term of 2609191, 2609180, 2609169, 2609158? -11d + 2609202 What is the g'th term of -1761, 5993, 18917, 37011? 2585g*2 - g - 4345 What is the i'th term of 62716507, 62716502, 62716497, 62716492, 62716487? -5i + 62716512 What is the a'th term of -1442, -1292, -1142, -992, -842? 150a - 1592 What is the s'th term of 15936239, 31872466, 47808691, 63744914? -s2 + 15936230s + 10 What is the v'th term of 130557, 524860, 1182037, 2102094, 3285037, 4730872, 6439605? v*3 + 131431v*2 + 3v - 878 What is the g'th term of 20796, 83297, 187508, 333429, 521060, 750401? 20855g2 - 64g + 5 What is the d'th term of 8153444, 8153443, 8153442, 8153441, 8153440? -d + 8153445 What is the x'th term of 28585, 57164, 85771, 114406? 14x2 + 28537x + 34 What is the d'th term of 24231, 33460, 42689? 9229d + 15002 What is the g'th term of 16879663, 16879659, 16879653, 16879645, 16879635? -g2 - g + 16879665 What is the n'th term of 154, 759, 1814, 3319? 225n*2 - 70n - 1 What is the k'th term of 48, 426, 1494, 3612, 7140, 12438? 60k3 - 15k*2 + 3k What is the n'th term of 186, 1290, 4306, 10188, 19890, 34366, 54570? 159n3 + 2n*2 - 15n + 40 What is the f'th term of 8891597, 17783195, 26674793? 8891598f - 1 What is the c'th term of 4460, 8983, 13552, 18167, 22828, 27535? 23c*2 + 4454c - 17 What is the f'th term of -906258, -906282, -906308, -906336? -f*2 - 21f - 906236 What is the h'th term of 476989, 476978, 476961, 476938, 476909, 476874, 476833? -3h2 - 2h + 476994 What is the r'th term of 509, 997, 1557, 2225, 3037, 4029, 5237, 6697? 6r3 + 446r + 57 What is the r'th term of 119670, 956602, 3228276, 7652064, 14945338, 25825470? 119562r3 - r2 + r + 108 What is the n'th term of -450993, -450977, -450951, -450915, -450869? 5n*2 + n - 450999 What is the f'th term of -2346, -5150, -8412, -12132, -16310? -229f*2 - 2117f What is the x'th term of -1037, -7811, -25783, -60419, -117185, -201547, -318971? -911x3 - 133x*2 + 2x + 5 What is the o'th term of -997, 9032, 36247, 89240, 176603, 306928, 4888	{ "pile_set_name": "DM Mathematics" }
6 What is 74/5 of a litre in millilitres? 14800 What is 11.75557ml in litres? 0.01175557 What is 7/4 of a litre in millilitres? 1750 What is seventy-five halves of a decade in years? 375 What is 1/4 of a century in months? 300 What is 4.464581 millilitres in litres? 0.004464581 How many micrograms are there in one quarter of a milligram? 250 How many kilograms are there in 41.6363t? 41636.3 What is 2/27 of a day in seconds? 6400 How many millennia are there in 27.606438 months? 0.0023005365 How many years are there in 27/4 of a millennium? 6750 What is 5/4 of a litre in millilitres? 1250 How many centuries are there in 6276.362 years? 62.76362 How many millilitres are there in 24.16194 litres? 24161.94 How many centimeters are there in 3/25 of a meter? 12 Convert 7.003665 millimeters to micrometers. 7003.665 How many millilitres are there in 12/25 of a litre? 480 How many decades are there in 497073.2 millennia? 49707320 What is eleven halves of a millennium in decades? 550 How many centuries are there in 2369785.5 months? 1974.82125 What is 4890.805 millilitres in litres? 4.890805 How many centimeters are there in 7/2 of a meter? 350 Convert 36203.63um to kilometers. 0.00003620363 What is eighty-one quarters of a litre in millilitres? 20250 How many hours are there in 11/2 of a week? 924 What is 876.3592 years in millennia? 0.8763592 How many centimeters are there in one tenth of a kilometer? 10000 What is six fifths of a decade in months? 144 What is 2.033618 millimeters in kilometers? 0.000002033618 What is 3718.715 kilometers in meters? 3718715 What is 1/6 of a millennium in months? 2000 Convert 51.04479 centimeters to kilometers. 0.0005104479 How many millilitres are there in sixty-seven quarters of a litre? 16750 What is twenty-one fifths of a micrometer in nanometers? 4200 What is 4666.226mm in kilometers? 0.004666226 What is 0.8497991m in centimeters? 84.97991 How many millilitres are there in 19857.1 litres? 19857100 How many millilitres are there in one quarter of a litre? 250 What is 11.50537 meters in micrometers? 11505370 What is 78472.69m in centimeters? 7847269 How many months are there in 3/5 of a century? 720 What is 0.933697nm in millimeters? 0.000000933697 What is 5/24 of a week in hours? 35 How many nanograms are there in 0.5394818mg? 539481.8 How many meters are there in 2.152457um? 0.000002152457 Convert 96.65774 meters to micrometers. 96657740 Convert 116191.5489 microseconds to weeks. 0.00000019211565625 What is fourty-four fifths of a microgram in nanograms? 8800 How many seconds are there in 8032.575ms? 8.032575 What is 0.8458118us in seconds? 0.0000008458118 How many centuries are there in 280352.4 months? 233.627 What is twenty-five eighths of a microgram in nanograms? 3125 What is 3/5 of a millennium in years? 600 What is 7/2 of a litre in millilitres? 3500 What is three eighths of a litre in millilitres? 375 What is 796.77l in millilitres? 796770 Convert 2.696428 milligrams to micrograms. 2696.428 What is 0.1985291 litres in millilitres? 198.5291 Convert 9824.13um to centimeters. 0.982413 What is seven eighths of a microgram in nanograms? 875 What is 14/9 of a day in minutes? 2240 What is 5.140768t in kilograms? 5140.768 How many minutes are there in 166.7028us? 0.00000277838 How many nanometers are there in 402754.6 kilometers? 402754600000000000 How many millilitres are there in seventeen quarters of a litre? 4250 How many litres are there in 8641.955ml? 8.641955 How many nanograms are there in 34/5 of a microgram? 6800 How many decades are there in 5819.648 centuries? 58196.48 What is thirty-eight sevenths of a week in days? 38 How many micrograms are there in nineteen quarters of a milligram? 4750 What is 118481491.8 microseconds in weeks? 0.0001959019375 Convert 361.8036 litres to millilitres. 361803.6 What is 1/4 of a millennium in decades? 25 What is 438512.7ml in litres? 438.5127 Convert 5980.743 weeks to minutes. 60285889.44 How many grams are there in three eighths of a kilogram? 375 How many millilitres are there in one quarter of a litre? 250 What is 3/8 of a microsecond in nanoseconds? 375 How many centuries are there in 9.036086 millennia? 90.36086 What is eleven quarters of a litre in millilitres? 2750 How many milliseconds are there in 3/40 of a second? 75 How many micrograms are there in three eighths of a milligram? 375 Convert 7.746414 milliseconds to nanoseconds. 7746414 Convert 23850.513 months to years. 1987.54275 What is 937800.7 days in milliseconds? 81025980480000 What is one tenth of a litre in millilitres? 100 What is three tenths of a millennium in months? 3600 How many centimeters are there in 3/16 of a kilometer? 18750 What is 3/5 of a microgram in nanograms? 600 Convert 9133.484 micrometers to meters. 0.009133484 Convert 3030.65 weeks to microseconds. 1832937120000000 What is seven halves of a centimeter in millimeters? 35 How many millennia are there in 79393.7 centuries? 7939.37 What is 0.553913l in millilitres? 553.913 How many litres are there in 131.116ml? 0.131116 Convert 1.197586 meters to millimeters. 1197.586 Convert 30960.18ml to litres. 30.96018 How many meters are there in 646.2535 micrometers? 0.0006462535 What is thirteen quarters of a micrometer in nanometers? 3250 What is 5.687282mg in micrograms? 5687.282 What is 1691.699 centimeters in millimeters? 16916.99 What is 68788.16 nanograms in kilograms? 0.00000006878816 What is 9.4929s in nanoseconds? 9492900000 How many microseconds are there in 3/5 of a millisecond? 600 How many nanograms are there in 45/4 of a microgram? 11250 How many seconds are there in 6/25 of a day? 20736 What is 1.409098 millilitres in litres? 0.001409098 How many hours are there in 182.71296ms? 0.0000507536 How many meters are there in 572.2463 micrometers? 0.0005722463 What is 3/25 of a tonne in kilograms? 120 What is 11/2 of a kilogram in grams? 5500 How many microseconds are there in 65006.38 days? 5616551232000000 What is three tenths of a century in years? 30 Convert 73.11249ms to microseconds. 73112.49 How many nanometers are there in fifty-two fifths of a micrometer? 10400 What is 121308.2 kilometers in micrometers? 121308200000000 How many micrograms are there in one fifth of a milligram? 200 How many millilitres are there in 8.398225 litres? 8398.225 What is 278031.24 nanoseconds in minutes? 0.000004633854 What is 2.452317 litres in millilitres? 2452.317 How many kilograms are there in three fifths of a tonne? 600 What is 3/7 of a week in minutes? 4320 How many litres are there in 6341.592 millilitres? 6.341592 Convert 21.97288 decades to millennia. 0.2197288 How many nanoseconds are there in 98.51336s? 98513360000 Convert 0.7803615 milligrams to nanograms. 780361.5 How many decades are there in 15.851256 months? 0.1320938 What is 4433.87kg in grams? 4433870 How many meters are there in 3/10 of a kilometer? 300 How many centuries are there in 13.757154 months? 0.011464295 What is 90590.39 centimeters in meters? 905.9039 How many minutes are there in one tenth of a week? 1008 Convert 0.0068059 weeks to minutes. 68.603472 What is 3.10646ug in tonnes? 0.00000000000310646 Convert 14.426343 months to millennia. 0.00120219525 How many millilitres are there in 0.2018083l? 201.8083 How many millimeters are there in 2950.981cm? 29509.81 What is 1/6 of a year in months? 2 Convert 2.3065551 months to millennia. 0.000192212925 What is 3.614644kg in nanograms? 3614644000000 What is 1/64 of a kilometer in millimeters? 15625 Convert 577.936t to kilograms. 577936 What is 78/7 of a week in days? 78 What is 7.028316 tonnes in grams? 7028316 How many milligrams are there in 32.18798g? 32187.98 How many meters are there in 0.26633 kilometers? 266.33 What is 638.26nm in kilometers? 0.00000000063826 How many nanometers are there in three tenths of a micrometer? 300 What is 44/5 of a millimeter in micrometers? 8800 What is 807565.8km in micrometers? 807565800000000 Convert 491414.6l to millilitres. 491414600 How many grams are there in 844123.2ng? 0.0008441232 What is thirteen quarters of a litre in millilitres? 3250 How many nanograms are there in 21408.83 tonnes? 21408830000000000000 How many centuries are there in 3.485436 months? 0.00290453 What is s	{ "pile_set_name": "DM Mathematics" }
0hh)/h)/(h(1/2)h))/(h0)39 assuming h is positive. 1/sqrt(h) Simplify (m*(-2/9)m*(-6)/m)/(((mm*8m)/m)/mm(6/7)/mmm) assuming m is positive. m(-1076/63) Simplify (v1/v)(6/13)v/v*(-2/15)v(-2) assuming v is positive. v(-13/15) Simplify (d9/d(2/21))(-39) assuming d is positive. d(-2431/7) Simplify a*(-7)aa/(a(-7)a)(a(-1)a)(-26) assuming a is positive. a Simplify (n/n(-28)n)(-10) assuming n is positive. n(-300) Simplify ((q(-2/9))(-12))(28/5) assuming q is positive. q(224/15) Simplify p(1/3)/p(-2)(pp/(p(2/23)/pp)p)/(pp(-1/11)/p) assuming p is positive. p(4051/759) Simplify ss/(s(1/10)s)s/(s(1/30)/s)s assuming s is positive. s(58/15) Simplify (b0)(29/4)/(b(-2)/(((b*(-3/7)/bbbb)/b)/b)) assuming b is positive. b*(11/7) Simplify (z(zz/(((zz*2)/z)/z))/zzz)(-14) assuming z is positive. z(-42) Simplify ((ff(-2/3))(4/7))(-39) assuming f is positive. f(-52/7) Simplify ((m/(m/m*(-7)m))/(mm(-4)))(-12) assuming m is positive. m60 Simplify a(-19)a9 assuming a is positive. a(-10) Simplify (n7)(18/11) assuming n is positive. n(126/11) Simplify (i4/i(-4/9))(5/4) assuming i is positive. i(50/9) Simplify d0d17 assuming d is positive. d17 Simplify c(c*(-1/4)/ccc)/cccc/(c*(-14)c) assuming c is positive. c(67/4) Simplify (s(-2)s)/s(s*(3/4)/s)/s(ss/(s/(ss(1/2))))(-22) assuming s is positive. s*(-233/4) Simplify (cc*(1/2)cc)38/(c(1/9)/(ccc(6/11)c)) assuming c is positive. c(13507/99) Simplify (j(-14)j)(-26/5) assuming j is positive. j(338/5) Simplify m(-7)/(mm*(-2/33)m) assuming m is positive. m*(-295/33) Simplify (((xx/(x/(x(1/4)/x)))/x)(5/13))(34/3) assuming x is positive. x(-85/26) Simplify k*(-2/5)kk/k(-8)(kkk(kk*2)/kk)(-24) assuming k is positive. k(-672/5) Simplify n16/n29 assuming n is positive. n*(-13) Simplify hh*12h(19/5) assuming h is positive. h(84/5) Simplify (tt0)(-10/7)(t*(2/7)t)28 assuming t is positive. t(242/7) Simplify ((i/(ii(2/15)))/i(i/i*(-2))/ii)(-2/37) assuming i is positive. i(-56/555) Simplify ((w/w*(2/21))/(w(w(-10)/w)/w))(-1/5) assuming w is positive. w*(-50/21) Simplify ((ggg(-7/2))/((g(-1/4)/g)/g))(-16/7) assuming g is positive. g(-12/7) Simplify (d(-4/9)d(dd/d18)/d)24 assuming d is positive. d(-1184/3) Simplify (u(4/7)/u)/uu7uu(-1/7)/uu((u/((u(-4)/u)/uu))/u)/u assuming u is positive. u(73/7) Simplify z(-1/20)/(zzz*(2/7)zz) assuming z is positive. z(-607/140) Simplify p(-1/4)/p3p/((p/(pp(-6)pp))/p)p/((pp(-2/17))/p) assuming p is positive. p(-281/68) Simplify i27/i(6/17) assuming i is positive. i(453/17) Simplify ((qqq(-13))/qqq(1/8))20 assuming q is positive. q(-435/2) Simplify ((w/w6ww)/w6)/(((w/(w/w(-8)w))/w)/((ww/w(-3/8))/w)) assuming w is positive. w(19/8) Simplify (r(5/4)r(-3/4)/r)(-10) assuming r is positive. r5 Simplify (r(1/3))*(-16)r*5/(r/(rr*7/rrr)) assuming r is positive. r(23/3) Simplify ((g(-2/7)g)/g(-5/2))/((g(-2/9)g)/g)(-5/4) assuming g is positive. g(185/63) Simplify ((w(-1))16)(-9) assuming w is positive. w144 Simplify (n(3/2)n((n2n)/n)/n)/(nnn(-1/2))(-1/12) assuming n is positive. n*(29/8) Simplify (rr/((rr(-7/13))/r))/rrr(2/25) assuming r is positive. r(851/325) Simplify x6x*4/xx/((x/(xx(1/4)))/x)x(2/17) assuming x is positive. x(773/68) Simplify (d*(-2/55)d(11/2))(-15) assuming d is positive. d(-1803/22) Simplify (a(2/11)/a*(1/4))/((aa(2/7))/a)(-3/2) assuming a is positive. a(111/308) Simplify (o/(o(-2/7)/oo)o)*20/(o/(oo0))(-33) assuming o is positive. o*(320/7) Simplify ((hhhh(-3))/((h(-2/5)/h)/h))/(h0)(-47) assuming h is positive. h(12/5) Simplify x(-5)/xx(2/11)xx(x*(-3/4)/x)/xxxx*(-5)x assuming x is positive. x(-377/44) Simplify (i(1/3)ii(-1/4))/(i(-11)iii1) assuming i is positive. i(109/12) Simplify (oo17)/(o(3/26)o) assuming o is positive. o(439/26) Simplify (uu*(-10)u/(uu(-1/16)u))(2/3) assuming u is positive. u(-53/8) Simplify (i(5/3))(2/71) assuming i is positive. i*(10/213) Simplify (p(p/p*(2/15))/pppp(2/13))(-50) assuming p is positive. p(-5890/39) Simplify z/z(-3)z43/z assuming z is positive. z46 Simplify (r/r(1/8)rr(-3))(5/18) assuming r is positive. r(-5/16) Simplify (o(o(-3/10)/o)/o)/o(-1/15) assuming o is positive. o*(-37/30) Simplify (hh*2hh(1/11))/(((h(hh/h(-3/8))/h)/h)/(h(-5)/h)) assuming h is positive. h(-289/88) Simplify b28/(bb/(b15/b)) assuming b is positive. b40 Simplify (p*(1/4)p(1/4))(3/37) assuming p is positive. p(3/74) Simplify (u(-5/2)/u)/uu/u(2/17)u(uu*(2/7)/uu)45 assuming u is positive. u(13147/238) Simplify (((u/(u*(-5)u))/u)(10/7))(-4) assuming u is positive. u*(-160/7) Simplify (((w/(w/(ww/(w*2w))))/w)(-2/37))14 assuming w is positive. w(56/37) Simplify m(2/17)/(m/((m/(m*(-1/6)m))/m)mmm)(mmm/(mm11m))/(m((m/(m/(mm*(-2/17)m)m))/m)/m) assuming m is positive. m(-1489/102) Simplify (b(-3)/(bbb(6/5)))44 assuming b is positive. b(-1364/5) Simplify (r0(r*(-1/6)rr)/rr)/((((rr(-1))/r)/r)/rr(r(-4)r)/rr) assuming r is positive. r(41/6) Simplify (jj/(((jj/j2)/j)/jjj)jjj)*2/((j/(j/(jj/j*(-10))jj))/(jj*(-7/5)j)) assuming j is positive. j(3/5) Simplify (z(2/69)z)/z(2/17) assuming z is positive. z(1069/1173) Simplify (((y/(y4/y))/y)/(y(2/5)y))34 assuming y is positive. y(-748/5) Simplify (n(1/13))41 assuming n is positive. n(41/13) Simplify b/((b/b(-7/3))/b)bb(b/b(-10))/bb(-2/5)/(b(-2/9)b) assuming b is positive. b(427/45) Simplify ((x/((x(-1)x)/x))(-1/9))(2/57) assuming x is positive. x*(-4/513) Simplify (m((m/m(-1/5))/m)/m)(-38) assuming m is positive. m(-38/5) Simplify (n(1/6)/nnn/((nn/n6)/n))39 assuming n is positive. n(481/2) Simplify ((q/(q(-8)/q)q)/q(-6))(9/8) assuming q is positive. q(153/8) Simplify (b0b(b*1bbb)/bbb)/((bbb*2b)/(((bb1)/b)/b)) assuming b is positive. b Simplify (d4/ddddd(2/3))/((d1/dd)/dd)(3/2) assuming d is positive. d(31/6) Simplify (d(-1/7))(2/51) assuming d is positive. d(-2/357) Simplify x18/((x/x(1/2))/x) assuming x is positive. x(37/2) Simplify (v(-1/3))(21/5)/((v/v4)/(vv/(v3/v))) assuming v is positive. v(8/5) Simplify (zz(-21)z)/(zz29/z) assuming z is positive. z(-48) Simplify (x(2/23)/x)(2/61) assuming x is positive. x(-42/1403) Simplify f(1/2)/(f(7/3)/f)(f/f*(-4/7))/(ff*(1/6)f) assuming f is positive. f*(-10/7) Simplify ((mm(-1/4))/(m/(((m(5/8)/mmm)/m)/m)))31 assuming m is positive. m(-155/8) Simplify (a/a(1/5))44/((aa/(a8/a))/(aa*(-7)a)) assuming a is positive. a*(176/5) Simplify (bb/(bb(1/4))(bb/(b/b(-1/3)))/b)/(b/(b(b/b(-1))/b))19 assuming b is positive. b*(233/12) Simplify (zz/(z/((zz(2/9))/z)))(3/16) assuming z is positive. z(11/48) Simplify (b(5/8)b(-11))(2/13) assuming b is positive. b(-83/52) Simplify s(-4)/((ss(5/2))/s)(s(-1)/s)(-45) assuming s is positive. s(167/2) Simplify (u/u(-2/53))/(uu(-36)) assuming u is positive. u(1910/53) Simplify (ww/w3)(2/33) assuming w is positive. w*(-2/33) Simplify (r/((r/(rr/(rrrr/(((r18r)/r)/rr)rrrr)))/r))/(r/r(-14)r) assuming r is positive. r*(-3) Simplify ((ii/((i*(-5/4)/ii)/ii))/i)/(i/(i/(i/(i/(i/(iiii/((ii15)/i))))))) assuming i is positive. i(-39/4) Simplify (ww(-2/5)/w)(-21)w(-1/10)/(w/(www4)) assuming w is positive. w(133/10) Simplify (p/p2p)/(p*(-1)p)(p3)(-4/15) assuming p is positive. p(-4/5) Simplify (l(-5))(-14) assuming l is positive. l70 Simplify (((c/(c/(c/(cc0))))/c)/c)(-11)/(c/c(-2))(-1/8) assuming c is positive. c*(179/8) Simplify (ss(s(-4/3)/s)/sssss)5 assuming s is positive. s(40/3) Simplify x(-11)x*((x	{ "pile_set_name": "DM Mathematics" }
7m + 4153 - 4153). 117m*3 Expand (2 - 1 + 0)(3w - 4w + 2w) - 2w + w + 3w + 3w - 3w + 2w + (-2 - 1 + 5)(-4 + 2w + 4) - 10w + 8 - 8. -w Expand (-3 + 0 + 2)(4 - 5p + 4 - 2 + p2). -p2 + 5p - 6 Expand (-2 + 2 + 1)(9 - 5 - 6 - 10x). -10x - 2 Expand (7d - 3d - d)(-d + 3d + 0d + 2d - 2 + 2 + 0d - 2d + 0d + (2 + 1 - 4)(4d + 0d - 2d) - 5d + 2d + 2d). -3d2 Expand (v2 - v2 + v2)(-5v + 3v + 4v)(4v - v - v) + 4v - 4v + v*4. 5v*4 Expand h - 5h + 3h + 2h - 3h - h + (3 - 4 + 0)(-2 - h + 2) + (-3h + 4h - 2h)(-3 + 1 + 3 + (2 - 3 + 3)(1 - 4 + 4) - 3 + 5 - 3 - 1 - 2 + 4). -5h Expand (-1 + 6 + 7)(3 - 3 + k). 12k Expand (-2f + 0 + 0)(-3f2 + 0f2 + f2 + (-1 + 1 + 2f)(0 - f + 0) + 3f2 - 38 + 38). 2f*3 Expand -2f - 8f + f + 5f - 4f - 3f + (-f + f + f)(-2 + 4 - 3) + 0f - 3f + f. -14f Expand (-2l + 2l*5 + 2l)(-16 - 3 + 2) - 1 - 4l*5 + 6l*5 - 1. -32l*5 - 2 Expand (1 + 4 - 3)(-4o3 - 2o*4 + 4o*3) - 2o*4 + 2 - 2. -6o*4 Expand (-2 + 2 - 2n)(n4 - n4 + 2n*4) - 2n*5 + 2 - 2 + (-3n + 13 - 13)(-2 + 2 + 3n*4). -15n*5 Expand (0 + 0 - 2u*5)(2 - 6 + 2) + (-3u + u + 0u)(9u*4 - 85u*3 + 85u*3). -14u*5 Expand (-5u*2 + 3u*2 + 3u*2)(-u2 + u2 - u*2) + 0u + 0u + 2u4. u4 Expand (0b + 0b + b*2)(-3b3 + 3b*3 + 2b*3)(-1 + 0 + 0). -2b5 Expand y2 + 0y*2 + 0y2 + y2 - 2y2 + 2y*2 + (-3y + 0y + 2y)(y + 2y - 5y) + 2y*2 + 0y*2 - 16y + 19y. 6y*2 + 3y Expand 0o - 2o*4 + 0o + (-1 - o*2 + 1)(4o2 - 2o*2 - 3o*2) + 3o3 - o4 - 3o3 + 2o*4 - 14o*4 - 18o*4. -32o*4 Expand (3 - 1 - 1)(-16 + 16 + 4z)(z*2 + 0z*2 + 0z*2). 4z*3 Expand (-6 + 4 - 2)(-3c + 3c - c)(-5c + 2c2 + 5c). 8c3 Expand -5p*3 + 3p*3 + 3p3 + (p3 + 3p3 - 2p*3)(2 - 4 + 1) - 351 + 351 - 12p3. -13p*3 Expand -3u4 + u4 + 3u4 + (-3u*4 + 3u*4 - 2u*4)(-9 - 1 + 0) - 2u4 + u - u. 19u*4 Expand (-3b - 2b2 + 3b)(12 + 16 - 4) + 2b*2 - 2b*2 + 2b*2. -46b*2 Expand 0d - 3d + 0d - 2d - 2 + 2 + (1 + 4 - 4)(0d - 2d + 5d). -2d Expand (-14g - 12g - 13g)(-2 + 0 + 0 + (1 - 5 + 2)(-2 + 0 + 4) + 4 - 2 + 0 + 1 - 2 - 2). 273g Expand (f*2 + 2f*2 + 0f*2)(6 - 3 - 1)(-1 + f + 1). 6f*3 Expand 0a + a - 3a + (-2 - 2 + 2)(1 - 1 + 2a) + 2a + 2a - 3a. -5a Expand (-2 - 2 - 2)(-2h4 + h2 - h2) - 4h*4 + 0h*4 + 3h*4. 11h*4 Expand (23h*2 + 18h*2 - 8h*2)(-2h + 5h - 2h)(-2 + 5 - 2). 33h3 Expand (2 - 2 - 1)(3b2 + 2b*2 - 7b*2) + (b + 5b - 5b)(-b - 2b + 6b). 5b2 Expand (2h + 3h - 4h)(6h*2 - 4h*2 + 0h*2) + (2h*2 - 4h*2 + 3h*2)(-5h + 3h + 3h). 3h3 Expand (q3 - q3 - q3)(4 - 3 + 1) + q3 + 3q*2 - 3q2 + q3 + 3q3 - 2q*3 - 5 - 3q*3 - 2 + 6. -2q*3 - 1 Expand (-19 + 10 - 12)(-3 + 3 + 3v). -63v Expand (-1 + 0 + 0i - 3i)(2 + 1 - 2). -3i - 1 Expand (3l + 2l - 3l + (3 + 0 - 1)(l - 7l + 4l) - 1 + 1 + l + l - 4l + 2l + (l + l + 0l)(0 - 1 + 2) + 2l + 2 - 2)(-6l4 + 9l*4 + 14l*4). 34l*5 Expand ((-5a*5 + 3a*5 + 3a*5)(0 - 1 + 2) - 7a5 + 3a*5 + 2a*5 - 23 + 23 - 2a*5)(-3 - 3 - 1). 21a5 Expand (-13q + 4q + 4q)(-1 + 1 - q + (-1 + 1 + 2q)(-3 + 2 + 2)). -5q*2 Expand (q + 0q + 2q)(0 + 0 - 6q4) + 3q*5 + 4q*5 - 4q*5. -15q*5 Expand (2b*3 - 2b*3 - 3b*3)(5 + 0 - 7). 6b3 Expand (0h + 0h + 2h)(0 - 2 + 4) + 0h + 0h + 4h + (3h - 2h + 0h)(-2 + 0 + 0) - h + 0h + 2h. 7h Expand (2f*2 + 3f*2 - 6f*2)(-2f - f + 6f)(3 - 5 - 4 + (0 - 4 + 3)(2 + 2 - 2)). 24f3 Expand -2k*2 + 0 + 0 + 2k*2 - 4k*2 - 4k*2 + (3k + 2k - 3k)(-3k + 2k - k). -12k*2 Expand (-4r - 2r + 5r)(-4 + 3 + 2)(r - 3r + r). r2 Expand (-2 - b + 2)(3 + 3 - 4) + (5b + 6 - 6)(-2 + 2 - 3). -17b Expand (2y*3 + y - y)(2y + 1 - 2 - 1) + y4 + 3y*4 - 5y*4. 3y*4 - 4y*3 Expand (3 + 3 - 4)(b*3 - 76b*4 + 40b*4 + 7b*4). -58b*4 + 2b*3 Expand (-11q*2 + 5q*3 + 11q*2)(-3q2 - 2q*2 + 3q*2) + 2q*5 - 3q5 - q5. -12q5 Expand (2y*2 - 2y*2 + 2y*4 + (-2y*3 - 2 + 2)(2y - 2y - y))(0y + 0 + 2 + 3y). 12y*5 + 8y*4 Expand (u - 1 + 1)(-u - 3u + 2u) + 1 + u*2 - 1 + (u + 2u + 4u)(-2u - 2u + 3u) - 2u*2 - 2u*2 + 3u*2. -9u*2 Expand ((2 - 2 + 2z)(0z - 2z + 4z) + 0z + 24z*2 - 10z*2 - 3z)(-z2 + 3z2 - z2). 18z4 - 3z*3 Expand -31b*2 - 8b*2 + 15b*2 + (0 - 2b + 0)(4 - 4 - b). -22b*2 Expand (5b + b + 0b)(3 + 5b3 - 3). 30b*4 Expand (-4n4 - n4 + 3n4)(0n - 4n + 5n + (8 + 10 + 10)(n + 0 + 0)). -58n5 Expand (3w*4 - 2w*4 - 3w*4)((0 - 1 + 0)(3 - 4 + 2) + 1 - 4 + 1 + 0 + 5 + 0). -4w*4 Expand (0v*3 - 4v*3 + 2v*3)(0v - 4v - 6v). 20v*4 Expand (2 - 2 - 7l4 + (l - l - l3)(0l + l - 2l))(4 - 1 - 1). -12l4 Expand -4k*5 + 2k*5 + 4k*5 + (5k*2 - 5k2 - k2)(0k3 + k3 - 3k3) + (-k4 + k + 13k*4 - 9k*4)(1 - 1 - k). k5 - k2 Expand 3 - 3 - u + (2 - 3 - 1)(4u - 4u - u) + u - 4 + 4 + u + u - 3u - 2u + 4u + 0u + 0u - 3u + 0u + (-2 + 5 - 2)(-5u + 5u - u). -u Expand (-5f2 + f2 + 5f2)(2f2 + f2 - f2) - 4f + 30f3 + f4 - 30f*3. 3f*4 - 4f Expand -2y2 - 3y*2 + 6y*2 + (-y - y + 0y)(3y - 3y - 2y) - 5 + 20y - y2 - 20y. 4y2 - 5 Expand (-2s*2 + 7s*2 - 3s*2)(0s - 5s + 3s) + (s2 + 2s3 - s2)(2 - 2 - 1) + 17s*3 + 42s - 42s. 11s*3 Expand (-3q + 2q - q)(6 + 3 + 11)(1 + q - 1)(q*2 + 3 - 3). -40q*4 Expand -4z*3 + 5z*3 - 3z*3 + (0 + 0 + 1)(-z*3 + 4z*3 - 4z*3) + 0z3 + z3 + z*3 + 152z*3 - 82z*3 - 88z*3 - 2z*3 + 2z*3 - 2z*3. -21z*3 Expand ((-1 - 2r + 1)(0r + 2r + 0r) + 0 - 2r2 + 0 - 3r2 + r2 - 3r2)(r*3 + 0r + 0r). -11r*5 Expand (-4f + 2f + 9f)(-6f + f + 4f)(-4f2 + 3f2 - f2). 14f4 Expand (8 - 8 + 6b*3)(2b + 2b*2 - 2b). 12b5 Expand (-4q*3 + 3q*3 + 0q*3)(2q + 4q - 5q)((3q - 5q + 0q)(-2 + 0 + 3) - 5q + 2q - 3q). 8q5 Expand (l2 - 3l2 + l2)(l + 6 + 2l2 - 3 - 5). -2l4 - l3 + 2l2 Expand ((0 + 2g + 0)(-1 + 2 - 3) - 6 + 5g + 6)(-g + 3g - 3g). -g2 Expand -r4 + r2 - r2 + (-r + r - 2r*3)(-r - 2r + r) + (-4 + 1 + 2)(-43r4 - 26r*4 + 31r*4). 41r4 Expand -4 + q2 + 2q + 4 + 4q + 2q2 - 4q + (2 - 1 + 1)(-3q + 2q2 + 3q) + 0 + 0 - q*2. 6q*2 + 2q Expand (-4 - 1 + 3)(-2 + 58r - 26r - 28r). -8r + 4 Expand (8l*3 - 17l*2 + 17l*2)(2l + 3l - 3l)(-2l + 3 - 3). -32l*5 Expand (-4 + 4 - 5z*2)(3 - 4 - 2)(z + 2z*3 - z). 30z*5 Expand (-3s + 2s2 + 3s)(-67s*2 - 10s*2 - 20s*2). -194s*4 Expand (3m*5 - 6m*5 + 4m*5)(1 - 2 - 1)(1 + 2 - 2). -2m*5 Expand 3i + 3i - i + i2 + (0i - i + 4i)(-5i + 5i + 2i). 7i*2 + 5i Expand (5 + y - 3y - 4)(-1 - 8 - 6)(-y + 2y - 2y). -30y*2 + 15y Expand f*5 - 2f4 + f5 + 3f4 + f + f5 - f + (0f*4 - 4f*4 + 5f*4)(-1 + f + 1). 4f5 + f4 Expand (g5 + 2g*5 - 4g*5)(1 + 4 - 1) - 3g2 + 2g*5 + 3g*2. -2g*5 Expand (4p*2 - 3p*2 + 0p*2)(0p + 4p - 2p) - 198 - 4p*3 + 198 - 26p*3. -28p*3 Expand (0i*2 + 0i*2 + 5i*2)(-2 + 2 - i*2 + (2 + 1 - 1)(-2i + 2i - 3i2)). -35i*4 Expand 11h - 30h - 6h - h + 0h + 2h + (4 - 3 + 1)(2h - 2 + 2) - h + 2 - 2 - h - 2h + 2h. -22h Expand (-1 + 3 - 1 + (1 + 3 - 6)(0 + 1 + 0) + 1 - 4 + 1 + 3 - 3 - 1 + 0 + 3 - 1 - 1 + 3 - 3)(6 - 3 - 1)(-9o5 - 3o*5 + 3o*5). 54o*5 Expand ((1 - 1 + 1)(4h2 - 3h*2 + 0h*2) - 3h2 + h2 + 0h2 + 0 + 0 - 2h*2)(-6 + 6 - 6h2). 18h*4 Expand 4 + 2c*5 - 4 + 0c*3 - 2c*5 + 0c3 + c5 - c5 - c5 + (-2 + 2c + 2)(3 - 3 + 2c4) + 62 - 62 - 20c*5. -17c*5 Expand (3s*3 - 2s*3 - 2s*3)(37s2 - 7347s + 7347s). -37s5 Expand (-t2 + 2t2 - 4t*2)(-1 + t + 1) + 2t2 + 2t*3 - 2t*2 + 2 - 2 - 4t*3. -5t*3 Expand (-11p*2 + 297p*2 - 7p + 7p)(2p + 2 - 2). 572p*3 Expand (1 - 4y*4 - 1)(16 + 23 + 32). -284y4 Expand (0t	{ "pile_set_name": "DM Mathematics" }
11000022 Convert 11123 (base 4) to base 8. 533 10200200 (base 4) to base 3 221022212 What is 35443 (base 10) in base 12? 18617 What is 1e13 (base 15) in base 8? 14617 Convert -17923 (base 12) to base 16. -856b Convert -1e8c (base 15) to base 6. -50453 Convert -26111 (base 7) to base 5. -210132 10122 (base 3) to base 12 82 Convert -12 (base 6) to base 2. -1000 What is -10011 (base 3) in base 7? -151 What is 131 (base 8) in base 11? 81 Convert 470 (base 12) to base 10. 660 3102 (base 5) to base 10 402 423 (base 10) to base 16 1a7 What is 22aa6 (base 12) in base 11? 31a28 What is 1112 (base 6) in base 7? 521 What is -b2 (base 15) in base 7? -326 Convert 18a7 (base 12) to base 6. 21531 424322 (base 5) to base 11 a854 14277 (base 11) to base 14 7575 -23310 (base 7) to base 2 -1011101100001 What is -48e (base 16) in base 5? -14131 What is -2000011201 (base 3) in base 2? -1001101001000101 What is 10210002 (base 3) in base 10? 2756 Convert 1d5 (base 16) to base 5. 3334 What is -11065 (base 7) in base 10? -2791 Convert -121055 (base 6) to base 10. -10619 -14033 (base 5) to base 14 -5b9 What is 21980 (base 10) in base 4? 11113130 136 (base 11) to base 15 aa Convert 40331 (base 7) to base 13. 45aa What is 1df4 (base 16) in base 11? 5841 Convert a4a (base 12) to base 13. 8b3 Convert 2210100 (base 4) to base 7. 42435 -367 (base 9) to base 12 -214 What is 367 (base 12) in base 5? 4021 Convert -101082 (base 9) to base 12. -2a778 What is -110144 (base 5) in base 9? -5181 Convert 560 (base 12) to base 11. 660 What is -3144 (base 5) in base 14? -224 What is 432230 (base 5) in base 8? 34542 311101 (base 6) to base 13 b428 -265a (base 15) to base 8 -17771 -3135 (base 7) to base 3 -1111220 Convert bc40 (base 14) to base 9. 48633 Convert -10001 (base 2) to base 12. -15 10000220001 (base 3) to base 15 12a4d -3372 (base 10) to base 4 -310230 -128 (base 16) to base 8 -450 Convert b814 (base 14) to base 10. 31770 What is -310131 (base 4) in base 7? -12534 What is -150b (base 13) in base 14? -1181 Convert 448 (base 10) to base 7. 1210 What is 710a (base 13) in base 2? 11110011000110 Convert 206 (base 14) to base 2. 110001110 Convert -db7 (base 15) to base 3. -11020201 -1036 (base 11) to base 10 -1370 -c4 (base 15) to base 7 -352 Convert 636 (base 14) to base 4. 103020 7a03 (base 11) to base 6 120430 Convert 34ad (base 14) to base 2. 10001111010001 What is 727 (base 13) in base 9? 1601 What is -a43 (base 16) in base 15? -ba2 10111100101101 (base 2) to base 12 6ba5 Convert a639 (base 14) to base 12. 1470b What is -80e (base 16) in base 6? -13314 -11404 (base 8) to base 14 -1aba What is 2144 (base 11) in base 16? b0f Convert 6183 (base 11) to base 15. 2668 What is 48b0 (base 13) in base 6? 115335 -803 (base 12) to base 11 -960 -606 (base 7) to base 8 -454 -1112 (base 15) to base 6 -24425 Convert -126 (base 15) to base 11. -218 What is -1936 (base 11) in base 2? -100110011011 -240010 (base 5) to base 8 -21063 19f (base 16) to base 4 12133 342551 (base 6) to base 14 a8a7 Convert -19332 (base 10) to base 2. -100101110000100 What is 1313 (base 6) in base 15? 173 What is c8a (base 15) in base 8? 5416 -139 (base 12) to base 15 -c9 What is -1729 (base 13) in base 16? -d57 Convert -12773 (base 8) to base 15. -1a02 What is -1001000101111000 (base 2) in base 6? -444224 What is -3522 (base 14) in base 6? -110442 Convert 1993b (base 12) to base 9. 56552 What is 397 (base 16) in base 4? 32113 -2518 (base 9) to base 5 -30010 What is 30030012 (base 4) in base 13? 19956 Convert 1401 (base 10) to base 2. 10101111001 What is 1523 (base 7) in base 9? 742 Convert 169 (base 13) to base 2. 100000000 What is 2125 (base 9) in base 15? 6e2 What is -514 (base 10) in base 4? -20002 Convert -58 (base 15) to base 12. -6b Convert -21870 (base 10) to base 8. -52556 314e (base 15) to base 6 120132 -4355 (base 8) to base 4 -203231 What is 4100 (base 5) in base 10? 525 Convert 18890 (base 11) to base 5. 1320411 What is 8d41 (base 15) in base 10? 29986 Convert 260 (base 12) to base 6. 1400 -16429 (base 10) to base 11 -11386 What is -100012200 (base 3) in base 15? -1ec9 21554 (base 8) to base 13 4187 Convert -61546 (base 7) to base 5. -440103 What is -472 (base 9) in base 8? -605 -1546 (base 12) to base 14 -caa What is -332 (base 14) in base 13? -398 1020123 (base 4) to base 16 121b 12230 (base 6) to base 14 93c 211340 (base 5) to base 8 15667 184 (base 12) to base 11 202 Convert 414 (base 6) to base 4. 2122 Convert 10111002111 (base 3) to base 9. 114074 Convert -4ef (base 16) to base 5. -20023 -102333 (base 4) to base 11 -a05 179 (base 16) to base 10 377 What is -5ff (base 16) in base 11? -1176 211 (base 5) to base 4 320 What is -201 (base 7) in base 9? -120 What is -1021202 (base 3) in base 6? -4202 Convert -12200211 (base 3) to base 15. -136d Convert -616 (base 8) to base 3. -112202 What is -a84a (base 16) in base 5? -2334312 What is 422 (base 5) in base 14? 80 Convert 31653 (base 7) to base 12. 4686 1042 (base 9) to base 4 23333 20221 (base 3) to base 12 137 What is 619 (base 15) in base 6? 10210 Convert e5 (base 15) to base 6. 555 -1313302 (base 4) to base 6 -55254 Convert -681 (base 13) to base 5. -13434 Convert 1466 (base 11) to base 7. 5334 -202122 (base 3) to base 10 -557 -242452 (base 7) to base 15 -d127 30001 (base 4) to base 10 769 12106 (base 10) to base 7 50203 What is 203204 (base 6) in base 16? 3f94 -11101101110011 (base 2) to base 5 -441334 What is -52a (base 12) in base 2? -1011110010 2075 (base 11) to base 4 222320 -1312220 (base 4) to base 8 -16650 What is 25523 (base 8) in base 2? 10101101010011 Convert 1989 (base 16) to base 7. 25026 What is 145 (base 9) in base 4? 1322 Convert 2702 (base 13) to base 6. 41455 -12f7 (base 16) to base 5 -123410 2213 (base 9) to base 5 23012 What is 562 (base 16) in base 10? 1378 Convert 195 (base 11) to base 8. 341 14454 (base 6) to base 16 922 What is -5872 (base 9) in base 4? -1010012 What is -1218 (base 9) in base 2? -1110001100 -100122 (base 3) to base 9 -318 2b15 (base 13) to base 16 187f 174 (base 10) to base 3 20110 What is -4111 (base 6) in base 13? -54a Convert 203121 (base 4) to base 6. 14253 What is -31211 (base 7) in base 8? -16744 Convert -511 (base 14) to base 10. -995 Convert c344 (base 13) to base 2. 110100100101111 What is 14003 (base 5) in base 14? 5a8 9dc (base 16) to base 12 1564 -111100010111 (base 2) to base 3 -12022002 What is 65626 (base 7) in base 12? 9617 Convert 257a9 (base 11) to base 5. 2140103 -368 (base 14) to base 4 -22220 -1000110101100 (base 2) to base 6 -32540 2120 (base 7) to base 10 749 Convert f3c (base 16) to base 14. 15c8 What is -433c (base 14) in base 12? -6882 30231 (base 5) to base 12 1159 What is 269 (base 16) in base 7? 1541 Convert 2933 (base 11) to base 3. 12012021 11804 (base 12) to base 4 11301010 What is 2a4e (base 15) in base 10? 9074 Convert -3405 (base 12) to base 13. -2816 Convert -852 (base 11) to base 4. -100001 Convert -10615 (base 8) to base 2. -1000110001101 What is -135515 (base 6) in base 9? -18662 -3310101 (base 4) to base 7 -63402 Convert -25370 (base 12) to base 3. -2120110010 -13211 (base 4) to base 13 -2b4 Convert 10010210 (base 3) to base 7. 6450 What is 1323 (base 8) in base 4? 23103 6a71 (base 13) to base 15 4679 What is 24002 (base 5) in base 3? 2101220 -23572 (base 9) to base 2 -11110110100011 What is 100 (base 13) in base 11? 144 Convert -122011 (base 3) to base 2. -111001111 What is 1566 (base 12) in base 11? 1997 -9799 (base 10) to base 4 -2121013 312102 (base 4) to base 16 d92 -7164 (base 9) to base 11 -3a36 Convert -1000110001 (base 2) to base 3. -202210 Convert -3a2 (base 13) to base 14. -339 What is 3004043 (base 5) in base 10? 47398 What is -1106 (base 12) in base 6? -12410 What is 1210 (base 10) in base 2? 10010111010 What is -1ca (base 15) in base 6? -1531 -10000000101 (base 2) to base 13 -612 -100 (base 11) to base 4 -1321 Convert -503 (base 14) to base 2. -1111010111 Convert 110100100010 (base 2) to base 10. 3362 What is -113444 (base 5) in base 9? -5741 What is 1236 (base 13) in base 9? 3476 -8269 (base 10) to base 14 -3029 23423 (base 5) to base 16 6ca 1021 (base 9) to base 2 1011101100 6b10 (base 13) to base 5 440204 106 (base 16) to base 3 100201 What is -123505 (	{ "pile_set_name": "DM Mathematics" }
mallest value in j, 0.5, w? w Let s = 0.486 - 0.086. Which is the second smallest value? (a) s (b) -2 (c) -1/8 (d) -0.1 c Let h = -0.7 - 0.3. Let s = h + 0.6. Which is the biggest value? (a) 2 (b) -0.3 (c) s a Suppose 3m + 5k - 6 = 0, -3k = 3m - 9 + 3. Let d be (m/(-12) + 0)4. Which is the smallest value? (a) -1/8 (b) 5 (c) d c Let p = -70 - -70. What is the smallest value in p, -0.07, -3? -3 Let q = 182 + -181.6. Which is the second smallest value? (a) -1/8 (b) 2 (c) q c Let d = -4 - -3. Let f = 235.2 - 235. Let p = -9 + 5. Which is the second smallest value? (a) d (b) f (c) p a Let z be (1 + 2 - 2)/(-1). What is the biggest value in 0, 0.2, z? 0.2 Let p = -0.6 - -0.2. Which is the smallest value? (a) p (b) -1 (c) -0.8 b Let w = -9 - -7. What is the biggest value in -0.3, 0.3, w, 0.1? 0.3 Let a be 6/(-21)(-7)/(-3). Let g = -6 + -5. Let i = g - -16. What is the smallest value in a, i, 4? a Let f be (-8)/66/52. Which is the biggest value? (a) f (b) -2 (c) -2/5 a Suppose 5f - 2i - 2i = 12, -4f = 5i - 26. Let l be 4(-5)/(-2)-1. Let y = l - -6. Which is the third smallest value? (a) y (b) f (c) 3/7 b Let t = -491/6 + 82. Let l = 0.9 - 1. Let f = 4.9 - l. Which is the second biggest value? (a) f (b) t (c) -3/7 b Let j = -1 + 2. Let s = -4.3 + 1.3. Let u = s + j. Which is the biggest value? (a) -4 (b) 2 (c) u b Let z = 0.32 - -1.68. What is the third biggest value in -0.05, 5, z, -0.3? -0.05 Let i = 1.2 - 0.6. Let n = 0.66 - i. Let d = n + -5.06. Which is the second smallest value? (a) -0.5 (b) d (c) -1/11 a Let v = 6 + -1. Let u = -3.5 + 3. What is the smallest value in u, -2/11, v? u Suppose -y + 3 = 5. Let m = 39/4 - 269/28. What is the second smallest value in 1, y, m? m Let g = -0.11 - -0.21. Which is the second biggest value? (a) -0.1 (b) 0.2 (c) g c Suppose -4y = y - 5. Let v(r) = r2 + 4r + 6. Let g be v(-4). Suppose 0 = 3z - gz + 6. What is the third smallest value in z, y, 0? z Let n = 0 - 0.6. Let u = 0.9 - 0.5. Let h = u - n. What is the second smallest value in -4, -3, h? -3 Let z be 2(142/(-18) - -3). Let q = 86/9 + z. Let p be (2 - 1)/(3/(-6)). What is the third smallest value in -0.4, q, p? q Let t = -2.7 - -2.9. Let w be (6/4)/((-1)/2). Which is the third smallest value? (a) w (b) t (c) 1 c Let k = 9 + -13. Let z = 4 + k. What is the second smallest value in 3, -3, z? z Let u = 24 - 36. Let l = u + 11. What is the second smallest value in l, -3, 0? l Let i = -24 + 21. Which is the third smallest value? (a) 0.5 (b) i (c) 0 a Let l(a) = a3 + a2 + a + 2. Let i be l(0). Let j = -7.9 - 2.1. Let o = j - -14. What is the third biggest value in i, o, 0? 0 Let n be 1741/(-44) + 1/(-4). Let f = n + 40. Let d = 6 - 5.6. What is the smallest value in f, d, -3? -3 Let f = -0.3 - 0.1. Let k = 11 + -7. Let v = -1 + k. What is the third biggest value in v, f, 0.3? f Let v = 545/8 - 68. What is the third smallest value in 2, v, 0? 2 Let h = -0.2 - 0.1. Let d = 0 - -1. Let y = 0.9 - d. What is the third biggest value in y, -5, h? -5 Let l = -2.046 - -0.046. Which is the second biggest value? (a) l (b) 5 (c) -1/4 c Let g = -3.9 + -0.1. Let q = -1.4 - -11.4. Let r = q + -10.4. Which is the biggest value? (a) r (b) g (c) 1/5 c Suppose 5u = -h + 23, 0 = u + h + 2h + 1. What is the smallest value in 0.5, 0.4, u, -2? -2 Suppose 4o - 8 = -4v + 40, v = 0. Suppose 4s = s + o. Let l = 15 - 10. Which is the second smallest value? (a) l (b) -0.4 (c) s c Let y = -1.16 - -0.16. Which is the third biggest value? (a) -3 (b) -0.1 (c) y a Let g = 73/2 + -36. Which is the second biggest value? (a) 0 (b) g (c) 0.09 c Let d be 2/(-3) + 24/27. Let x = -51/5 - -199/20. Which is the third biggest value? (a) x (b) 0.5 (c) d a Let l = 1.9 - 2. Let y = -1.77 + 0.07. Let f = -0.3 + y. What is the second biggest value in -1/5, f, l? -1/5 Let r be (-23/9)/6. Which is the smallest value? (a) r (b) -4 (c) 1 b Let n be (-3)/(1(-9)/6). Let k be (n + 0)(-5)/(-2). Let r be k/(-15) - 14/(-15). Which is the smallest value? (a) -1/3 (b) r (c) 0.5 a Let z = 7 - 4. Suppose b + 1 = -z. What is the biggest value in b, 1/8, 0.5? 0.5 Suppose f - 522 = -3f + 2l, 2f + l = 267. Let s be (-8)/(-44) + (-57)/f. Which is the third biggest value? (a) s (b) 3 (c) 3/5 a Let o = 0.94 + -0.47. Let x = o - -3.53. Let t = 2.5 - 0.5. Which is the third biggest value? (a) -5 (b) t (c) x a Suppose -5f - 5v = -v - 30, 0 = f - 2v + 8. Let z be ((-6)/9)/f - -1. Let k = -0.1 + 0. What is the smallest value in z, 3, k? k Let s = -81 - -82. Which is the second biggest value? (a) s (b) -1/4 (c) 1/5 c Let i = 0.27 - -0.03. Suppose 3s - 8s + 5 = 5v, 5v - 9 = -3s. Let n be 91/(-21) - s/(-3). What is the smallest value in -4, n, i? n Let i = -0.3 + -0.2. Let w = 0.17 + -2.17. Which is the second biggest value? (a) -0.1 (b) w (c) i c Suppose -2l = 3l - g - 9, -20 = 5g. Which is the second biggest value? (a) 5 (b) 3 (c) l b Let z(v) = 0v2 + v2 + 1 + 0. Let r be z(1). Which is the second biggest value? (a) r (b) 4 (c) -2 a Suppose 0 = -m + 1, 0p + 17 = -5p + 2m. What is the third smallest value in -3/4, -0.6, p? -0.6 Suppose 470 - 74 = 4v + 5s, -5v + 4s = -454. Let p = 472/5 - v. Let f be (-1)/3 + (-14)/(-24). Which is the biggest value? (a) f (b) -1 (c) p c Let p(g) be the second derivative of -g3/6 + 8g*2 + g. Let r be p(0). Let h be (15/(-50))/((-6)/r). Which is the smallest value? (a) h (b) 3 (c) -2/17 c Let m = -16.56 - -17. Let p = -0.04 + m. What is the smallest value in p, -1/4, -2? -2 Suppose 0 = -r + 3r - 2. Which is the biggest value? (a) -7 (b) -4 (c) r c Let n be (-4)/26 - (-98)/468. Let z = n + 4/9. What is the third smallest value in z, 5, -3? 5 Let g = 0.5 - 0. Which is the smallest value? (a) g (b) 0.2 (c) 2/5 b Let n = 0.38 - 0.18. Which is the third smallest value? (a) 0.3 (b) n (c) 4/3 c Let z be 0/(((-4)/(-2))/1). Suppose -4n + z - 4 = 0. What is the third smallest value in -3, 3, n? 3 Let f = -0.032 - 0.968. Let h = 5/9 + -2/9. Which is the second smallest value? (a) f (b) h (c) 0.1 c Let i(s) = s2 - 1. Let d(n) = 3n*2 - 8n - 13. Let m(o) = -d(o) + 4i(o). Let h be m(-7). What is the second biggest value in 4, h, 1/2? h Let k be 6 - 5 - (-2)/1. Suppose 0 = q + 4y + 4, -3q + 4y + 0y + 4 = 0. Suppose 4d = -qd + 20. Which is the second smallest value? (a) k (b) -2/7 (c) d a Suppose -2v = -3v - 4. Let w = 1 + v. Let p = -62 + 66. What is the third biggest value in w, 2, p? w Let l = -19 + 18.9. Which is the second smallest value? (a) -3 (b) l (c) -3/4 c Let g = 8/59 + -241/472. Let q be ((-3)/8)/((-9)/6). What is the smallest value in q, 0.14, g? g Let t be (-18)/4 + (1 - -1). Let p = -510 + 512.07. Let w = 0.07 - p. What is the second biggest value in 2, t, w? w Let l = -0.2 + 0.2. Let q = -0.5 - l. Let h be (1 - -1)/(70/(-21) + 4). What is the second smallest value in h, q, 2? 2 Let n = -0.04 - 0.16. Let j = n - 0. Which is the third smallest value? (a) 0.1 (b) 5/3 (c) j b Let s = 1.95 - -0.05. Let z = s + -5. Let w = 3.5 + -3. Which is the second biggest value? (a) -5 (b) w (c) z c Let n = 0.114 + -0.014. Let s = -1 + 1. What is the smallest value in s, n, 0.2? s Let p be (-4)/16 + 15/28. Let i = -11 + 14. Which is the third biggest value? (a) -2 (b) i (c) p a Let r = 7.8 - 7.5. Let l = -1.8 + -0.1. Let k = 2 + l. Which is the third smallest value? (a) 2 (b) k (c) r a Let w be 1/(-5)-2 - (-340)/(-100). What is the third biggest value in w, -5, -0.2, 0.4? w Let q = 0 - -0.2. Let z = 0.1 + q. Let k = 0.1 - z. Which is the biggest value? (a) 1 (b) k (c) -0.3 a Let j = -10 - -10.4. Let g be -33/(-12)-4. Let w = 10 - 7. Which is the second biggest value? (a) w (b) g (c) j c Let c = -0.327 - -0.037. Let m = 1.01 + -1. Let b = m - c. What is the third smallest value in 3, b, -0.3? 3 Let i be -1 + -1 + 24/15. Let z = 45 + -42. Which is the third smallest value? (a) 2/13 (b) i (c) z c Let u = 0.385 - -0.015. Let v = -11 - -16. Which is the second biggest value? (a) u (b) v (c) -3 a Let z be 55((-11)/(-5) - 1). Let n = z + -200/3. Suppose -7h = -3*h - 16. What is the third biggest value in -5, h, n	{ "pile_set_name": "DM Mathematics" }
2/11 Let f = -0.495 - 0.005. Let u = 0.4 + -0.2. What is the closest to u in 5, 0.1, f? 0.1 Let t = 25 + -26. What is the closest to t in 0.1, 0.4, -0.3? -0.3 Let x = 0.84 + 0.16. Which is the closest to x? (a) -1 (b) 5 (c) 2/3 c Suppose 65 - 40 = -5p. Let u = -0.07 - -0.08. What is the nearest to -0.1 in -4, u, p? u Let c(b) = 2b*2 - 5b. Let t be c(6). Let u be -3(t/15 + -3). Let g = -30 - -121/4. What is the closest to g in -0.5, -4, u? u Let j = -127.5 + 128. Let v be (2 - -1)(-2)/15. Which is the closest to 2/3? (a) v (b) j (c) 3 b Let w = -16 + 20. Let t = 7 - 11. Let i = t - -3. Which is the nearest to -0.1? (a) -1/5 (b) i (c) w a Let i = -2/49 - -53/98. Which is the closest to i? (a) -0.3 (b) 2 (c) -1/7 c Let h(u) = -u*3 + 4u*2 - 4u + 1. Let v be h(4). Let d be 10/v - 8/(-30). Which is the nearest to d? (a) 3 (b) -0.3 (c) 1 b Let l = 50 - 50.74. Let t = -1 - l. Let a = 0.06 + t. What is the closest to a in -1, 2, 2/3? -1 Let t = -0.08 - -3.08. Let a(n) = -n*3 - 6n*2 + 14n - 21. Let b be a(-8). What is the nearest to t in b, 1/3, -1/6? 1/3 Let y = -4 - -3.6. Let s(l) = 3l - 7. Let z be s(5). Let q = -11 + z. Which is the nearest to 0.2? (a) -1 (b) q (c) y c Suppose 2o + 5x - 9 = 0, 2o + x = 3 + 2. Which is the closest to -1? (a) 0 (b) 3 (c) o a Let u = 0.24 + -0.04. What is the closest to -1 in 2/3, -2/17, u? -2/17 Let q(y) = -y. Let n be q(-4). Let s = 0 - n. Which is the closest to -1/2? (a) 0.5 (b) s (c) -0.4 c Suppose 4g - 3r + 2r - 133 = 0, 5g + 5r = 160. Let w = -97/3 + g. Let q = -4 - -2. Which is the nearest to -0.1? (a) q (b) -1 (c) w c Let d be ((-3)/(-12)2)/2. Let v = 0.2 + -0.2. Let h = -1 - v. What is the nearest to h in 5, 0.4, d? d Let h = -117/7 - -17. Let m = 0.2 - 0. What is the nearest to -0.1 in h, 5, m? m Let w = -0.4 + -4.6. Let x be (-2)/(-3) + 8/(-21). Let v = 0.13 + -0.43. What is the nearest to v in w, x, -0.4? -0.4 Let n(p) = p*3 + 7p*2 + 4p - 7. Let m be n(-6). Which is the closest to -2/5? (a) m (b) 2/3 (c) -5 b Let n be (-200)/243/1. Let g be (-15)/(-6)(-4)/n. Which is the closest to 1/4? (a) g (b) 2/7 (c) -1 b Let f = 85.3 - 85. Which is the nearest to f? (a) -1 (b) -2 (c) 0.5 c Suppose 0 = -0o - 2o + 4. Let h be (-12)/(-9) + o/(-6). Which is the nearest to 1? (a) h (b) -3 (c) -1 a Let l = -49/12 + 13/3. Which is the closest to -2/11? (a) 3 (b) l (c) 2/17 c Let f = -0.52 + 0.12. Which is the closest to 2/7? (a) f (b) -2/7 (c) -2 b Let a(b) = -b*2 + 5b - 3. Let h be a(3). Suppose -2 - h = m. Let w = -4 - -4. What is the nearest to -1/2 in w, m, 0.4? w Let l = -13 - -12.7. Let u = -0.1 + 0.1. Let q = -2 + 1. Which is the closest to 0? (a) q (b) u (c) l b Suppose -5p = 15, -q + 4p - 5 + 16 = 0. Which is the nearest to -3? (a) 3/5 (b) 5 (c) q c Suppose 0 = -3g - 2 - 1. Let q = g - -3. Which is the closest to -2? (a) -1/6 (b) q (c) -2 c Let y be 1/8 - (-147)/(-24). Which is the closest to -1? (a) 5 (b) y (c) 1 c Let g = 118 + -117.5. Let d = 1/2 + -7/6. What is the closest to d in 4, -5, g? g Let l = 0.2 - -0.8. Let r = -156/697 - -14/41. Which is the nearest to l? (a) r (b) -4 (c) -5 a Let p = -6 - -4. Let y = -0.12 + 5.12. Let i = 0 - -2. Which is the nearest to -1? (a) i (b) p (c) y b Let c = -0.04 + 0.04. Suppose 0 = -3a - a + 8. Let p = -5.7 + 6. What is the closest to c in a, -0.5, p? p Let n = 0.11 + 0.89. Which is the closest to n? (a) -0.4 (b) -2/3 (c) -4/5 a Let d = 1 - 9. What is the closest to 1 in -0.2, -2, d? -0.2 Suppose -4q - 8 = 5c + 2, 0 = q - c - 2. Let o = 0 - q. Let b = -32 + 29. What is the closest to o in -0.1, -0.3, b? -0.1 Let d = -0.89 - -0.09. Let g = -0.5 - d. What is the closest to 0 in -2, g, -1/9? -1/9 Let m = 2.97 + 0.03. Let x = m + -3.5. Let l = -70.2 + 70. Which is the nearest to -2/5? (a) -2 (b) l (c) x c Let t = 9/2 - 5. Let f = 20 + -19. Which is the nearest to 2/3? (a) t (b) f (c) -2/11 b Let f be 1 - 1 - 2/9. Let a = -691/11 + 63. What is the nearest to -2 in -3, f, a? -3 Let l = -5 + 7. Let h = -20/9 + 23/9. Which is the closest to h? (a) l (b) 0.3 (c) -4 b Let u = 57 + -30. Suppose 0g + 3g = 4d - u, 21 = -3g + 2d. Which is the nearest to 2? (a) 0.5 (b) g (c) 3 c Let x = 0.081 + 0.019. Let l be 21/(-52) + 1/4. What is the closest to x in 2/11, l, 0.1? 0.1 Let r = -11.9 - -12. Let g = -64/7 + 419/42. What is the nearest to r in g, 2, 1/6? 1/6 Let q = 0.12 - 0.12. Which is the nearest to 0.1? (a) q (b) 3 (c) -2 a Let j = 12 + -15. Let w be (-2)/(-8) - (-3)/(-4). What is the closest to -2/13 in 0, w, j? 0 Let l be ((-172)/(-15))/((-6)/(-12)). Let f = l - 70/3. What is the closest to f in -6, -1/5, 1/4? -1/5 Let d = 0.09 + 0.61. Let v = -0.6 + d. What is the closest to v in -0.5, 4, 0? 0 Let g = -0.18 + -19.82. Let v = 18 + g. Let w = 0.1 + -0.4. Which is the nearest to 2? (a) v (b) 2 (c) w b Let z = 4 + -3.8. What is the closest to 0 in -2/5, -1/7, z? -1/7 Let y = 118 + -122. What is the nearest to -0.3 in -0.02, y, -4/7? -4/7 Let f = 1.7 - -0.3. Let g = -1 - -2. Let o = f - g. Which is the nearest to o? (a) 0.3 (b) -3 (c) 1 c Let k = -33 - -38. Which is the nearest to 2? (a) k (b) 1/7 (c) -0.1 b Suppose -17 = -13j + 9j - v, -5j + 37 = -4v. What is the nearest to -6 in j, -1, -2/9? -1 Let w(x) = -x2 - 4x - 6. Let d be w(-4). Let f be (-12/d)/(-3). Let k = 0.22 - -4.78. Which is the nearest to 1? (a) f (b) k (c) 2/5 c Let s = 9 + -8. Let v = 2 + -1.8. Which is the closest to s? (a) v (b) 5 (c) -0.5 a Let p be (-14)/213/2. What is the nearest to p in -4, 0, 4? 0 Let i be 2/(-8) + (-56)/(-96). Let y be -1 - (54/(-21))/2. Let u be 10/(-18) - 2/(-6). Which is the nearest to 1/4? (a) y (b) u (c) i a Let m = 0.071 + -2.071. Which is the nearest to -1? (a) -1/3 (b) 3 (c) m a Let m = -33 - -37. Which is the nearest to 3? (a) -0.3 (b) m (c) -1/7 b Let z(q) = q*2 + 3q + 3. Let p be z(-2). Let g be 2/((-10)/(-613))1. Let t = -123 + g. Which is the closest to -2/5? (a) t (b) p (c) -0.3 a Let j = 8 - 8.2. What is the nearest to 0.04 in j, -2/7, -1/2? j Let q be (9/42)/((-1)/344). Let y = q + 74. Which is the nearest to 2? (a) 3/2 (b) y (c) 1/3 a Let i be ((-2)/4)/(2/(-8)). Let t = -45/2 + 22. Which is the nearest to -1/4? (a) t (b) i (c) -2 a Let d = -0.225 - -0.025. Let c = -0.2 + 0. What is the nearest to d in 5/4, 3/5, c? c Let n = -0.9 + 0.7. Which is the closest to 1? (a) 4/3 (b) 3 (c) n a Let z = -17 - -17. Which is the closest to -1? (a) -5 (b) z (c) 0.8 b Let m = -2.5 - -2.4. Which is the nearest to m? (a) 3/2 (b) -2/11 (c) 0.1 b Suppose -3y + 7 + 17 = 3m, -24 = -3m + 2y. Let o be 40/88m/(-10). Which is the nearest to o? (a) 2 (b) -2/7 (c) 1/5 b Suppose -3r - 2x + 3 = -8, r + x = 3. Let w = -0.8 + -0.2. Which is the closest to w? (a) r (b) -2 (c) -4 b Let r = 16.94 + -17. Which is the nearest to -0.2? (a) 0.2 (b) 0 (c) r c Let v = 3.7 + -8.7. What is the closest to -1/3 in -4, 0.5, v? 0.5 Let o = 14.9 + -15.1. What is the closest to o in 1, -0.1, 2? -0.1 Let r = 9/44 - -6/11. Let p = -0.4 - 0. Let u = -0.4 - p. What is the nearest to u in -5, 0, r? 0 Let y(c) = c*2 + 6c - 8. Let u be y(-6). Let n be (6/u)/(14/(-8)). Let r = -0.25 - -0.15. What is the closest to r in n, -5/4, -3? n Let j = 4.112 + -0.112. Let v = 5 - 3. Let f = -1.9 - -2. Which is the nearest to f? (a) 5 (b) v (c) j b Let j = 1 + -4. Let d be (2/(-1))/(1/(-2)). Which is the nearest to 0? (a) 2/9 (b) j (c) d a Let m = -17.5 - -13. Let j = m + 1.5. Let z = -0.01 - 3.99. What is the nearest to -1 in z, 0.2, j? 0.2 Let j = 1 + 1. Which is the closest to 2/5? (a) -0.5 (b) 3 (c) j a Let t be 786/4 + 5/10. Let v = -1377/7 + t. Which is the nearest to v? (a) -2 (b) 0.2 (c) 5/2 b Let i = 8 - 3. Let m = 0.45 - 4.75. Let n = 4 + m. What is the closest to 0 in 0, i, n? 0 Let h = 13/2 + -29/4. Which is the closest to -1? (a) h (b) -1/11 (c) 0 a Let u = -0.3 - -0.2. Let p = 18 - 22. Let n = 1 + p. What is the closest to u in -0.2, n, -4? -0.2 Let v = 9/2 + -19/4. Let x(g) = -g*2 - 2g + 9. Let q be x(-4). Let l be (-17)/3 + 2/3. Which is the nearest to 0? (a) q (b) l (c) v c Let l = -0.01 - -0.21. Let p(u) = -u	{ "pile_set_name": "DM Mathematics" }
6i2 Let k(r) = -18r + 18r + 3r2. Let o(w) be the third derivative of -w5/15 - 3w2. What is o(k(g))? -36g*4 Suppose -20 = -3p - 2p. Let o(z) = 1 + p - 5 - z. Let c(m) = -m2. Let i(a) = 2a*2. Let r(b) = -5c(b) - 3i(b). Determine o(r(x)). x2 Let x(m) = 2m2. Let a(o) be the third derivative of o5/30 - 5o2. What is x(a(j))? 8j*4 Let j(d) = 51d*2 - 3d. Let b(k) = 2k. Give b(j(n)). 102n*2 - 6n Let f(m) = -m. Let z = 99 + -97. Let x be -11(-1 + -1). Let k(v) = 6vx + 4v*2 - 11vz. Determine f(k(r)). r2 Let p(b) be the first derivative of b*3 - 2. Let m(g) = -4g*2 + 3g - 3. Let l(t) = -17t2 + 13t - 13. Let x(u) = -6l(u) + 26m(u). What is p(x(j))? 12j4 Let v(r) be the second derivative of -r6/72 - r3/2 + 3r. Let g(h) be the second derivative of v(h). Let i(n) = -n*2. Calculate i(g(d)). -25d4 Let u(h) be the second derivative of -h4/12 + 4h. Let a(r) be the second derivative of -r3/3 + r. Calculate a(u(t)). 2t*2 Let y(w) = 2w + 18 - 18 - 5w. Let g(m) = 11m*2. What is y(g(u))? -33u*2 Let q(h) = 11h - 8h - 3h - 16h2. Let y(a) = a2. What is q(y(g))? -16g*4 Let p(f) = -f. Let i = 2 + 0. Suppose -3c = i - 8. Let y(g) = 0g - cg + 2g + 4g. Determine y(p(j)). -4j Let s(a) = -47a + 2. Let t(x) = 67x + 1. What is t(s(u))? -3149u + 135 Let k(v) = 1. Let m(w) = w*2 - 6. Let d(p) = 6k(p) + m(p). Let y(i) = 0i - 3i + 2i. What is y(d(f))? -f2 Let a(n) be the first derivative of -7n3/3 - 8. Let p(w) = w2. Calculate p(a(s)). 49s4 Let y(c) = -c. Let h(s) = -127s - 2. What is y(h(r))? 127r + 2 Let q(h) = h. Let j(z) be the first derivative of -10z*3/3 + 11. Give j(q(l)). -10l*2 Let c(n) = 2n - 24. Let v(a) = -6a. Calculate c(v(p)). -12p - 24 Let q(s) = 3s. Let b(d) = -3d. What is b(q(p))? -9p Let r(w) = 10w + 7 + 5w - 7. Let z(b) = -b2 - 2b2 + b2. Give z(r(q)). -450q2 Let b(a) = 3a. Let p(s) be the second derivative of -s5/60 + s3/3 - s. Let r(j) be the second derivative of p(j). Determine r(b(c)). -6c Let f(d) = 31d. Let l(i) = 4i2. Calculate f(l(b)). 124b*2 Let l(o) = 2o. Let x(s) = 0s2 - 12 + 11s*2 + 12. What is x(l(d))? 44d*2 Let i(f) = 239f*2. Let x(y) = -2y. Calculate x(i(k)). -478k2 Let f = -16 - -18. Let d(u) = -u2 + uf + 7u*2. Let m(z) = z. Calculate d(m(t)). 7t*2 Let b(z) = -6z + 2. Let d(j) = -2j2. Determine b(d(y)). 12y*2 + 2 Let b(t) = -10t*2. Let c(p) = -p - 1. Let j(n) = 9n + 6. Let q(v) = -6c(v) - j(v). Determine q(b(h)). 30h*2 Let o(w) = 6w*2. Let z(g) = -3157g*2. What is z(o(d))? -113652d*4 Let d(h) = 5h*2. Let t(n) = -8n*2 + 7n - 7. Let q(i) = -3i + 18. Let p be q(8). Let y(a) = -7a*2 + 6a - 6. Let c(s) = pt(s) + 7y(s). What is c(d(w))? -25w4 Let b(h) = 3h. Let l(q) = -38q2 + 2q. Give l(b(n)). -342n2 + 6n Let n(t) = 15t + 3. Let u(i) = -5i + 2. Determine n(u(l)). -75l + 33 Let a(d) = d2. Let z(n) be the first derivative of 9n*3 - 2n + 12. Determine z(a(t)). 27t4 - 2 Let i(o) = -o2. Let j(k) = -163 + 8k + 163. What is i(j(b))? -64b2 Let j(t) be the third derivative of -1/24t*4 + 0t - t*2 + 0 + 0t*3. Let z(p) = -2p. Calculate z(j(o)). 2o Let l(w) = -2w*2. Let y(h) = -h + 20h*2 - 2h + 3h. Give l(y(z)). -800z4 Let w(o) = -o2 - 3o2 + 3o2. Let y(t) be the third derivative of t5/60 - 6t2. Calculate y(w(m)). m4 Let j(p) = -3p. Let s(x) = -59x - 12x + 21x + 11x. What is s(j(r))? 117r Let j(m) = -5m - 33. Let f(h) = -2h. Calculate j(f(w)). 10w - 33 Let a(j) = -j. Suppose 0 = s + s - 4. Let n(m) = -m*2 + 2m*s + 3m*2. What is n(a(z))? 4z2 Let z(p) be the first derivative of p3 + 17. Let k(s) be the second derivative of s*4/6 + 2s. Give k(z(b)). 18b4 Let q(v) = -2v*2. Let i be -4(9/6 + -2). Let j(g) = 4g + ig - 5g - 3g. Give q(j(k)). -8k2 Let s(p) be the first derivative of -2p*2 + 1. Let w(h) = -11h*2. Calculate w(s(g)). -176g*2 Let x(z) = 12z + 3. Let d(j) = 3j. Calculate x(d(s)). 36s + 3 Let c(q) = 7q. Let t(a) = -2a*2 + 22a. What is t(c(s))? -98s2 + 154s Let l(s) = 613s + 4. Let m(z) = -z2. Give l(m(h)). -613h2 + 4 Let p(a) = -a2. Let o(b) = -b*2 + 2b. Let s(n) = n*2 - n. Let q(g) = o(g) + 2s(g). Calculate p(q(f)). -f*4 Suppose 6w + 11 = 4a + 3w, 7 = 2a - 3w. Let i(h) = 2 - a + h. Let x(g) = 12g2 - 21. Let o(l) = 3l*2 - 5. Let j(f) = -21o(f) + 5x(f). Give i(j(r)). -3r*2 Let w = -4 + 6. Suppose -v = 2u - 11, 4v - 24 = -2u - 4. Let i(h) = -h*w + uh2 - h2. Let p(g) = -2g2. Calculate p(i(n)). -8n*4 Let s(g) be the third derivative of 0g - 1/24g4 + 0g3 + g2 + 0. Let q(c) be the third derivative of -c*4/8 + 2c*2. Calculate s(q(u)). 3u Let u(k) = -4k2 - 3k*2 + 6k*2. Suppose -4 + 2 = -c. Let l(d) = 4 + cd - 4 + 0d. Determine u(l(g)). -4g*2 Let a(v) = -3v*2. Let b(n) = 19n*2 + 5n + 5. Let t(d) = 9d2 + 2d + 2. Let f(j) = 2b(j) - 5t(j). Calculate a(f(y)). -147y4 Let v(k) = -5k. Suppose -5n = 3z - 13 - 12, 0 = -z + n + 3. Let l(h) = 2h - zh + 4h. Calculate v(l(i)). -5i Let w(j) = -j*2 + 6. Let i(u) = 32u. What is w(i(k))? -1024k2 + 6 Let j(d) = 2d*2. Suppose 0 = -a + 1, 0 = 4q + a + 1 - 14. Let h(f) = -3 - 16f + q + 12f. Give j(h(x)). 32x2 Let m(s) = -6s - 10. Let a(i) = i*2. Calculate a(m(t)). 36t*2 + 120t + 100 Let b(d) = 443d. Let i(g) = g2. Give b(i(v)). 443v*2 Let l(k) = -k. Let b(d) = 6d - 20. Calculate l(b(n)). -6n + 20 Let k(a) be the second derivative of 4a*3 - 9a. Let d(r) = -2r. Calculate d(k(n)). -48n Let l(d) = 42d2. Let w(x) = -2x + 22. Determine l(w(f)). 168f2 - 3696f + 20328 Let c(a) be the first derivative of -5a3/3 + 17. Let f(l) = -2l. Determine f(c(n)). 10n2 Let o(j) = -5j2. Let u(r) = r2 + 5r - 2. Let k be u(-6). Let p(x) = x - 8x + kx. Give p(o(a)). 15a*2 Let q(g) = 8145g*2. Let z(p) = p. What is z(q(c))? 8145c*2 Let d(a) = 4a*2. Let p(z) = -z - 11z*2 + 5z - 4z. Let o(b) = -2b*2. Let u(i) = -34o(i) + 6p(i). Calculate d(u(n)). 16n*4 Let w(m) = -10786m. Let f(b) = -b. Give f(w(q)). 10786q Let t(g) = g. Let s(l) = -15l*2 + 30l*2 - 12l*2. Calculate s(t(n)). 3n2 Let i(j) = -j2 - 7j2 + j2 + 8j*2. Let o(y) = 2y. Give o(i(q)). 2q2 Let j(w) = -6w. Let f(v) = 2v2 - v + 1. Let u be f(1). Let z(r) = 2r*2 + 0r*2 - 2r*2 + ur*2. Give z(j(b)). 72b*2 Let i(g) = -3g. Let f(r) = 86r + 6r*2 - 86r. Calculate i(f(t)). -18t2 Let s(k) be the first derivative of -7k*2/2 - 70. Let f(u) = 5u*2. Calculate f(s(t)). 245t*2 Let m(p) = 2p - 2p + p + p - 3. Let o(h) = 11h - 17. Let r(q) = -34m(q) + 6o(q). Let g(z) be the second derivative of -3z4/4 - z. Give g(r(b)). -36b*2 Let r(k) = -7k. Let a(o) = 39o2 - 1. Give a(r(n)). 1911n*2 - 1 Let l(k) = 7688k. Let i(u) = 3u2. Give i(l(y)). 177316032y*2 Let r(q) = -59q*2. Let x(l) = -l. Calculate r(x(a)). -59a2 Let g(l) be the first derivative of l2/2 - 18. Let o(p) = -2p2. Give o(g(j)). -2j*2 Let a(n) = 7n*2 + 7. Let r(g) = -7g*2 - 6. Let w(s) = 6a(s) + 7r(s). Let x(f) be the first derivative of -f3/3 - 2. What is x(w(c))? -49c*4 Let p(q) = -2q. Let o(k) = -46k2 - 4k - 4. Let y(a) = -a*2 + a + 1. Let l(b) = o(b) + 4y(b). Determine p(l(f)). 100f2 Let y(j) = -j2. Suppose 4t - 12 = 4. Let w(h) be the second derivative of 1/6ht + 0h*3 + 0h*2 + 0 + h. Calculate y(w(l)). -4l*4 Let m(a) = -9a + 7a - a - 17a. Let x(w) = -2w. What is x(m(p))? 40p Let v(z) = -5z2 + 3z. Let y(d) = -24d2 + 14d. Let f(t) = 14v(t) - 3y(t). Let q(g) = 9g2. Determine q(f(r)). 36r*4 Let d(u) = -4u*2. Let j = -2 - -6. Suppose ji - 23 = -i + 4q, 5 = i - q. Let v(b) = 3 + 2b*2 - i. Determine d(v(p)). -16p*4 Let g(s) = 27s. Let q(x) = 13x2 - 5x*2 - 6x*2. Determine q(g(d)). 1458d*2 Let p(a) = -5a*2 - 6a. Let z(r) = 4r2 + 5r. Let l(j) = 5p(j) + 6z(j). Let u(c) = -10c. Determine u(l(s)). 10s*2 Let b(s) = 127s*2. Let q(z) = 32z. Give b(q(u)). 130048u2 Let k(w) = -6w*2. Let a(x) = 14x*2 - 4. Calculate k(a(d)). -1176d*4 + 672d**2 - 96	{ "pile_set_name": "DM Mathematics" }
llest common multiple of 1010 and 808. 4040 Find the common denominator of -31/25 and -16/5. 25 Calculate the common denominator of 79/36 and 143/48. 144 What is the common denominator of -97/66 and 1/11? 66 What is the smallest common multiple of 10 and 6136? 30680 What is the least common multiple of 16 and 16? 16 Calculate the common denominator of 83/368 and 67/10. 1840 Find the common denominator of -69/1220 and 97/22. 13420 What is the common denominator of 7/100 and 3/20? 100 Calculate the common denominator of 71/102 and -89/2652. 2652 Calculate the smallest common multiple of 190 and 912. 4560 Find the common denominator of -49/30 and 139/120. 120 Calculate the common denominator of -7/114 and 47/21. 798 Calculate the least common multiple of 6 and 21. 42 Calculate the smallest common multiple of 108 and 198. 1188 What is the common denominator of -65/9 and -139/534? 1602 What is the smallest common multiple of 9 and 1044? 1044 Calculate the common denominator of -119/590 and 71/4366. 21830 What is the least common multiple of 1643 and 265? 8215 Calculate the common denominator of 59/108 and 82/441. 5292 What is the smallest common multiple of 30 and 2790? 2790 Calculate the common denominator of -79/10 and 79/656. 3280 What is the common denominator of 97/508 and 73/381? 1524 What is the least common multiple of 16 and 8948? 35792 Calculate the lowest common multiple of 158 and 10. 790 What is the smallest common multiple of 124 and 12? 372 Find the common denominator of -5/162 and -85/567. 1134 Calculate the least common multiple of 1 and 45. 45 What is the common denominator of -73/418 and -97/176? 3344 What is the smallest common multiple of 664 and 83? 664 What is the smallest common multiple of 4 and 467? 1868 Calculate the least common multiple of 92 and 112. 2576 Find the common denominator of 75/4 and 49/606. 1212 Calculate the lowest common multiple of 4543 and 413. 4543 Find the common denominator of 63/128 and 101/424. 6784 Find the common denominator of -89/96 and 93/1856. 5568 What is the lowest common multiple of 15 and 192? 960 What is the lowest common multiple of 104 and 13? 104 Calculate the common denominator of 49/3 and -67/26. 78 What is the smallest common multiple of 28 and 1768? 12376 Calculate the lowest common multiple of 285 and 225. 4275 Calculate the smallest common multiple of 3 and 57. 57 Calculate the common denominator of -75/68 and 33/34. 68 What is the least common multiple of 40 and 280? 280 What is the common denominator of 61/8 and -83/8853? 70824 Calculate the common denominator of -59/11550 and 46/147. 80850 What is the least common multiple of 57 and 152? 456 Find the common denominator of -61/338 and 23/68. 11492 Calculate the common denominator of -16/105 and -211/210. 210 Calculate the lowest common multiple of 1665 and 3996. 19980 Calculate the lowest common multiple of 176 and 308. 1232 Calculate the common denominator of -25/2 and 37/59. 118 Calculate the lowest common multiple of 2167 and 33. 6501 What is the lowest common multiple of 2 and 30? 30 What is the lowest common multiple of 3 and 115? 345 Calculate the common denominator of -53/4 and -11/2522. 5044 Find the common denominator of -74/2037 and 56/33. 22407 Calculate the smallest common multiple of 380 and 240. 4560 What is the common denominator of -85/16 and -87/10? 80 What is the common denominator of -88/15 and -41/25? 75 Calculate the common denominator of -139/102 and -67/6. 102 Calculate the least common multiple of 288 and 9. 288 What is the least common multiple of 48 and 111? 1776 Calculate the common denominator of 47/1595 and -15/11. 1595 What is the lowest common multiple of 264 and 28? 1848 What is the common denominator of 34/23 and -145/552? 552 What is the lowest common multiple of 77 and 1155? 1155 Calculate the lowest common multiple of 16 and 80. 80 Find the common denominator of -11/82 and 33/16. 656 What is the lowest common multiple of 5356 and 13390? 26780 Calculate the common denominator of 83/36 and -83/90. 180 Calculate the lowest common multiple of 460 and 13. 5980 Calculate the smallest common multiple of 66 and 6. 66 Find the common denominator of -121/6 and -50/9. 18 What is the smallest common multiple of 6 and 378? 378 What is the least common multiple of 527 and 255? 7905 Calculate the lowest common multiple of 295 and 10. 590 What is the common denominator of -4/17 and -113/170? 170 What is the common denominator of -11/200 and -131/600? 600 Calculate the smallest common multiple of 1655 and 160. 52960 Calculate the common denominator of 55/144 and 101/16. 144 What is the common denominator of -41/64 and 59/24? 192 Find the common denominator of 63/40 and 187/420. 840 Find the common denominator of -71/24 and 50/11. 264 Calculate the smallest common multiple of 1361 and 5. 6805 Find the common denominator of -69/20 and 73/822. 8220 Calculate the common denominator of -38/231 and -65/4557. 50127 Calculate the smallest common multiple of 102 and 20. 1020 Find the common denominator of 9/55 and 31/110. 110 Calculate the smallest common multiple of 495 and 159. 26235 What is the smallest common multiple of 167 and 3? 501 What is the least common multiple of 790 and 45? 7110 Find the common denominator of 101/8 and -65/216. 216 Calculate the common denominator of 41/174 and 23/261. 522 What is the common denominator of -2/3725 and 91/100? 14900 Calculate the lowest common multiple of 145 and 9. 1305 What is the common denominator of 25/164 and 65/5002? 10004 Calculate the common denominator of 19/54 and 76/261. 1566 What is the least common multiple of 184 and 92? 184 Calculate the least common multiple of 1750 and 7. 1750 Calculate the common denominator of -7/338 and 95/22. 3718 What is the lowest common multiple of 196 and 2940? 2940 Calculate the common denominator of 41/60 and 67/48. 240 Calculate the least common multiple of 15 and 18. 90 What is the smallest common multiple of 3546 and 2364? 7092 Calculate the smallest common multiple of 150 and 105. 1050 Calculate the smallest common multiple of 240 and 1704. 17040 Find the common denominator of -59/9 and 5/3. 9 Calculate the common denominator of 7/1242 and -27/22. 13662 Calculate the common denominator of 49/81 and 19/30. 810 What is the smallest common multiple of 429 and 9? 1287 What is the common denominator of 41/20 and 7/12? 60 What is the common denominator of -131/36 and -81/884? 7956 What is the least common multiple of 90 and 45? 90 Calculate the common denominator of -38/55 and 92/45. 495 Calculate the smallest common multiple of 294 and 42. 294 Calculate the smallest common multiple of 11 and 2292. 25212 What is the common denominator of 5/208 and -7/32? 416 What is the common denominator of 37/143 and -123/154? 2002 Find the common denominator of -47/231 and -29/105. 1155 Find the common denominator of 31/159 and -107/12. 636 Calculate the lowest common multiple of 10 and 10. 10 Calculate the common denominator of -32/135 and -103/460. 12420 Calculate the lowest common multiple of 84 and 651. 2604 What is the least common multiple of 15 and 144? 720 What is the common denominator of 1/96 and -95/832? 2496 What is the least common multiple of 6 and 18? 18 Find the common denominator of 65/332 and -47/8. 664 Find the common denominator of -63/32 and -23/18. 288 Calculate the smallest common multiple of 11 and 11. 11 Calculate the smallest common multiple of 74 and 8. 296 Calculate the lowest common multiple of 6 and 6. 6 Calculate the lowest common multiple of 2070 and 207. 2070 Find the common denominator of -3/422 and -15/22. 4642 Find the common denominator of -111/56 and -7/88. 616 Calculate the least common multiple of 4 and 5288. 5288 What is the smallest common multiple of 35 and 4890? 34230 Calculate the least common multiple of 84 and 27. 756 Find the common denominator of -57/14 and -107/374. 2618 Calculate the common denominator of -29/7014 and -57/98. 49098 Calculate the lowest common multiple of 25 and 10. 50 What is the lowest common multiple of 8 and 1167? 9336 What is the common denominator of 151/744 and 89/186? 744 Find the common denominator of 25/168 and 17/364. 2184 What is the common denominator of 71/1	{ "pile_set_name": "DM Mathematics" }
Let c(w) be the first derivative of 8/3w3 + 2w - w*2 + 9. What is the units digit of c(2)? 0 Suppose 88 = -4u + 1624. What is the units digit of u? 4 Suppose 5d = -i - 14, 4d + 3 = -4i - 5. Let a(q) = 23q*3 - q. What is the tens digit of a(i)? 2 Let a(v) = -2v - 1. Let x be a(-3). Suppose 0 = -2l + xl - 39. What is the tens digit of l? 1 Suppose 4x = -4y + 3y + 59, 61 = 5x - 3y. Suppose -xu + 774 = -1662. What is the tens digit of u? 7 Let m(s) be the third derivative of -s*5/60 + 13s*4/24 - 5s*3/3 + 2s*2. Suppose 0 = 4x + c - 41, -5c + 32 = 4x - c. What is the tens digit of m(x)? 1 Suppose -1684 = -20x + 3836. What is the tens digit of x? 7 What is the thousands digit of (-28342)/(-10) - ((-35)/25)/(-7)? 2 Suppose 3u + 3m - 15 = -2m, 5u - 25 = -m. Suppose 232 = -3q + uq. Let x = q - 80. What is the units digit of x? 6 Suppose -3z - 3j + 5 = -5z, -z + 2j = 4. Let f = 122 - z. Suppose 4b - f = b. What is the tens digit of b? 4 Suppose 4k + 59 - 7 = 0. Suppose -5r + 112 = -4u, r - 32 = 3u + u. Let h = r + k. What is the units digit of h? 7 Let u(i) = 2i2 - 23i - 9. Let c be u(17). Let l = c - 61. What is the hundreds digit of l? 1 Suppose -1048 = -2o - 0r - 4r, -4r = -2o + 1040. What is the hundreds digit of o? 5 Let h(a) = a3 + 8a2 + a - 6. Let v(f) = f2 + 1. Let d(p) = h(p) + v(p). Let n be d(-9). What is the tens digit of (-2 - -1)/(1/n)? 1 Let a = -49 + 364. What is the hundreds digit of a? 3 Suppose 5g = 0, 4s - 1 = 3s + 3g. What is the tens digit of -4(s + -1 - 8)? 3 Let o be ((-70)/21)/((-4)/162). Let p = o - -152. What is the units digit of p? 7 Let y = -1971 - -2971. What is the thousands digit of y? 1 Suppose 36u = 19u + 28543. What is the tens digit of u? 7 Let d = 25 - 48. Let y be (-2 + 0)/((-8)/(-28)). Let h = y - d. What is the tens digit of h? 1 What is the thousands digit of (-246)/(-8)8208/81 + 2? 3 Let q(r) = 251r3 - 15r*2 + 7r - 7. What is the hundreds digit of q(2)? 9 Suppose j + 3j + 72 = 0. Let a be (-48)/j(0 - -3). What is the units digit of a/((-4)/(-14) + 0)? 8 Let g(z) = 478z - 12. What is the hundreds digit of g(2)? 9 Let s = 1060 - 812. What is the hundreds digit of s? 2 Let h(r) = r2 + 8r + 20. Let x be h(-5). What is the hundreds digit of 99/1 - (4 + -12 + x)? 1 Let l be (1 + 7)/((3 - 9)/6). Let v(a) = 2a2 + 5a - 5. What is the units digit of v(l)? 3 Suppose j - 522 = 741. What is the units digit of j? 3 Suppose -27a = -28a + 448. What is the hundreds digit of a? 4 Let i be -12((-21)/(-9))/(-7). Suppose -44 = -2z + io, 2z + 5o = -0z + 35. What is the units digit of z? 0 Let l(y) be the first derivative of 2 - 8y - y2 + 1/3y*3. What is the tens digit of l(7)? 2 Suppose 6h - 157 = -j + 9h, -660 = -4j + 4h. Suppose 2g = 147 + j. What is the hundreds digit of g? 1 Let p(b) = b*2 - b + 1. Let t be p(2). Suppose 3 = tz - 2z. Suppose 0 = -zu + u + 34. What is the units digit of u? 7 Let w(j) be the first derivative of 2j3/3 + j2 + 4j + 1. Let h be 4/(-14) - 1/2178. What is the units digit of w(h)? 8 Suppose -8 = 4c + 8. Let i = 9 + c. What is the tens digit of (18/i)/(4/20)? 1 What is the tens digit of 1 + (-1177)/(-3) - (-4)/(-12)? 9 Let f = -24 + 25. Let v be -1 + 44 + -4 + f. What is the units digit of (42/(-24))/((-2)/v)? 5 Suppose -5 - 15 = -5c. Suppose -ca + 14 = -42. Let n(v) = -v*3 + 13v*2 + 14v + 16. What is the tens digit of n(a)? 1 Suppose -4j - 14 = -2p + j, 0 = -3p + 4j + 14. Suppose 124 = 2w + pw. What is the tens digit of w? 3 Suppose -63h = -68h + 10. Suppose hz + 163 = 457. What is the units digit of z? 7 Suppose -4q + 500 - 36 = 0. Suppose o - 29 = -q. Let l = o - -126. What is the tens digit of l? 3 Suppose 0a - 28 = -4a. What is the units digit of (-10)/35 - (-191)/a? 7 Let i(f) be the first derivative of f4/2 + f3 - 3f2 + 7f - 24. What is the units digit of i(4)? 9 Suppose 5v + 17 = 2z - 4z, 2z - 3v = 23. Suppose 0 = k - 3m - 2, m + m = 2k - z. Suppose 3l - k = 4. What is the units digit of l? 2 Suppose o + 300 = 3o. Let s = -34 + o. Suppose 0 = -0i - 5i + 3d + s, i - 31 = -2d. What is the tens digit of i? 2 Let l be (0 - 1)/((-9)/144). Suppose p + l = 5p. Suppose w - 2u - 154 = -3w, 3w - pu = 123. What is the units digit of w? 7 Let j be (-125)/(-3) + 4/(-6). Let s = 7 + j. Let r = s + -34. What is the tens digit of r? 1 Let a = 2270 + -336. What is the units digit of a? 4 Let k be 68/4 - 4 - -1. Let g be (-90)/(-7) + 2/k. Let r = g - 9. What is the units digit of r? 4 Let q = -545 - -1126. What is the tens digit of q? 8 Let r = -14 + 20. Suppose ru = u + 4j + 16, 11 = 4u - 5j. Suppose -ui - i + 75 = 0. What is the tens digit of i? 1 Let z(k) = 105k - 4. What is the tens digit of z(2)? 0 Let i(p) = -2p2 + 40p - 8. What is the tens digit of i(11)? 9 Let p = -457 - -997. What is the units digit of p? 0 Let l(d) = 3d2 - 41d - 8. Let h be l(14). Suppose -1281 = -hn - 69. What is the hundreds digit of n? 2 Let h = -4 - 88. What is the units digit of (-11)/(3 - (1 - 188/h))? 3 What is the units digit of (274-2)/(19/(-57))? 4 Let j(c) be the third derivative of -c4/2 - c3/6 - 6c2. Let y = -6 + 4. What is the units digit of j(y)? 3 Let a(x) = 34x. Let d be -2 + (4 - 10)/(-2). What is the units digit of a(d)? 4 Let v(h) = -h + 37. Let t be v(25). Suppose t + 4 = 2u. What is the units digit of u? 8 Let i(b) = b3 + 8b*2 - 13b + 14. Let c be i(-10). What is the tens digit of (-3 - c/20) + (-252)/(-10)? 2 Suppose -2h = -4n + 3730 - 76, 0 = 2n + 4h - 1852. What is the hundreds digit of n? 9 Let y = 2 + -2. Let r(u) = -2u + 80. What is the units digit of r(y)? 0 Let p(q) = q3 + 9q*2 - 10q. Let z be p(-10). What is the units digit of (z - (-82 - 3)) + (0 - -3)? 8 Suppose -u + 6118 = 22u. What is the units digit of u? 6 What is the hundreds digit of 76/(-5)(3 + -13)? 1 Let l(q) be the first derivative of q*2/2 - q + 5. Let f be l(0). Let x(d) = -7d*3 + 1. What is the units digit of x(f)? 8 Suppose -484d + 474d = -14650. What is the hundreds digit of d? 4 Suppose t + 3v - 79 = 528, 3t = -3v + 1851. What is the units digit of t? 2 Let v(k) = 102k - 31. What is the tens digit of v(11)? 9 Let d(t) be the third derivative of -t6/120 + 7t5/60 - t4/12 - t*2. Let a = 108 - 103. What is the tens digit of d(a)? 4 Suppose 4b - 12723 = -3d, 86b - 81b - 15890 = -d. What is the thousands digit of b? 3 Let p(a) = -2a*3 + 9a*2 + 24a + 71. What is the tens digit of p(-8)? 7 Let h = -306 - -754. Suppose 3n - h + 94 = 0. What is the units digit of n? 8 Let b(w) = w2 + 71. Let o = 36 - 36. What is the tens digit of b(o)? 7 Let w = 38 + -34. What is the tens digit of (-1416)/(-16) - 2/w? 8 Let a = -41 - -81. Suppose 529s + 405 = 534s. Let x = s - a. What is the tens digit of x? 4 What is the tens digit of 571 + -6 + 7 - -2? 7 Let m(y) = -y3 - 18y*2 - 13y + 90. What is the hundreds digit of m(-19)? 6 What is the hundreds digit of (-9)/((-30)/51204)? 3 Suppose 0 = o - 63 - 140. Suppose 0v + 5k = 5v - 325, 0 = -3v + 5k + o. What is the units digit of v? 1 What is the units digit of 20776/40 - (-9)/15? 0 Let g be (3-7)/(105/55 + -2). Let z = 342 - g. What is the hundreds digit of z? 1 Let p be (-24)/30(-30)/(-4). Let s = 6 + p. Suppose s = -c + 24 + 4. What is the tens digit of c? 2 Let m(n) = -2 - 6 + 2 - 3n - 5. Let k be -2 - 3 - (6 + -3). What is the units digit of m(k)? 3 Let d = 1030 + -540. What is the units digit of d? 0 Suppose 4m - 294 = 3678. What is the hundreds digit of m? 9 Let o = -10 - -10. Suppose os - 14 = s. Let w = 51 + s. What is the tens digit of w? 3 Suppose 2f = 4l + 8 - 2, -2f - 5l - 12 = 0. What is the tens digit of f/(-2)92 + 3? 4 Let z be (144/27)/(2/3). Let l(y) = -z - 6y2 + 4y*2 + 2y - 13y + y2. What is the tens digit of l(-8)? 1 Let u(f) = -2f*3 - 2f*2 + 3f + 3. Let b be u(-2). Suppose -k + 24 = -bd, 3d + 0 = -2k - 4. What is the units digit of (-63)/(-1) - (4 - k)? 3 Suppose 5n = -10 + 35. Suppose -5x = 3g - 8g - 350, 210 = 3x - ng. What is the tens digit of x? 7 Let t be ((-10)/7)/(29/203). Let j(l) = -20l - 35. What is the units d	{ "pile_set_name": "DM Mathematics" }
q + 3q - 7 = -v, 3v = -5q. Suppose 5m = qr - 17, r + m + 2m = 29. Solve 0 = -f + r - 11 for f. 3 Let a = 497 - 503. Let s be 4(2/(-6) - 5/a). Suppose f - 4 = 2. Solve -sj + f = j for j. 2 Suppose r = 3i + 49 - 48, i - 5r + 5 = 0. Solve i = -44d - 274 + 10 for d. -6 Let z(p) = -p2 - 14p. Let g be z(-12). Let i = g - 21. Let o(s) = s3 + s2 - 9s + 11. Let x be o(2). Solve it + 2 = x for t. 1 Let r be (3 - 10/4)10. Suppose 6z - 67 = 29. Let q be ((-12)/z - 0)/((-2)/40). Solve -5p - r = q for p. -4 Suppose 11b = 139 + 59. Suppose -5d = -b - 2, 22 = v + 4d. Solve 18 = -4h + v for h. -3 Let o be 1-2 + 1378/26. Let a = o + -48. Suppose 3c - 2l - 1 = 3, 5l = -c - 10. Solve c = -2m + m + a for m. 3 Let n be -7 + 0 + 0/(-2). Let p = 1094 - 1098. Let a be (p - n) + 0 + 0 + -3. Solve a = -4x + 8 for x. 2 Suppose -4q = -2o - 6, -1 = 3q + 4o - 11. Solve 1186 - 1172 = -qv for v. -7 Let n = -5287 + 5310. Solve 3c = 8 - n for c. -5 Let h = 3499 + -3499. Solve h = -42g + 45g for g. 0 Suppose 116y = 9534 + 10115 - 3641. Solve -49i = -26i - y for i. 6 Let d be (-4)/6 - 70/30 - -3. Suppose d = 3v - 5y + 4, 0v = -5v - 3y + 16. Let s be 5 + v/2 + 1. Solve 0 = -5w - 18 - s for w. -5 Let j = 8 - 26. Suppose 61 = 3w + 1. Let a = w + j. Solve 3i = ai - 2 for i. -2 Let f = -105 + 141. Let u(n) = 2n*2 + 4n - 5. Let a be u(-6). Let y = a - f. Solve 5g = -y - 8 for g. -3 Let u(f) = f3 - 7f*2 + 10f - 33. Let i be u(6). Let g = i + 12. Suppose 0 = 9n - 7n + 5h - 23, gh - 25 = -4n. Solve -8v - n = -4v for v. -1 Let g be (414/72)/(-23) + (-1)/(-8)394. Solve go = 48o - 3 for o. -3 Let m = 11606 - 11468. Solve 16x = -m + 26 for x. -7 Suppose -o + 52 = 38. Solve -8v = -ov - 24 for v. -4 Let h(x) = 603 + 643 - 1321 - x2 + 23x. Let b be h(19). Solve 9i + 35 = -b for i. -4 Let h(l) = l3 + 7l*2 + 6l - 4. Let j be h(-5). Solve jw - 17 = -1 for w. 1 Let v(x) = x2 + 4x - 5. Let u be v(-5). Let q(m) = -m*2 + 6m - 5. Let r be q(3). Suppose -3s + 2o = 0, -ro - 4 = -5s - 6. Solve u = sd + d for d. 0 Let n = -24221 + 24221. Solve 6a + 33a + 273 = n for a. -7 Let t = -15579 + 15582. Let d(y) = 2y3 + y2 + y. Let b be d(-1). Let k(m) = -2m - 2. Let i be k(b). Solve -tu + 1 = -iu for u. 1 Let p(i) = -40i - 55. Let f be p(3). Let k = 175 + f. Solve k = -u - 2 for u. -2 Let m(f) be the third derivative of f*4/24 + 5f3/6 - f2. Let l = 8182 - 8177. Let i be m(l). Solve -6z + z = i for z. -2 Suppose 15t = 5t. Let l(h) = h2 - 8h + 18. Let z be l(7). Suppose 0 = -5f + 9 + z. Solve t = -fw + 3 - 7 for w. -1 Suppose -4g + 12 = 2r, 2r - 12 = -3g - 5. Suppose 3v + 0 - g = 2d, 0 = 4v + 4. Let m be -2((-45)/10 - d). Solve -4c + 3 = -m for c. 1 Suppose 7i - 3i = 32. Let v be ((-12)/8 + 2)i. Suppose -2c = -2c - 12c. Solve c = -5z + vz + 5 for z. 5 Let l(b) = -b2 + 10b - 17. Let p(z) = 2z - 28. Let v be 34111/22. Let u be p(v). Let q be l(u). Solve 3r + q + 2 = 0 for r. -3 Suppose 3n - 5498 = z - 5697, 5z - 1028 = 4n. Solve v - 27v - z = 0 for v. -8 Let l(q) = 87q2 - 8q + 2. Let c be l(3). Suppose -cu = -769u + 88. Solve -k + 13 = u for k. 2 Let k be (9/(-27))/(-3 - 62/(-21)). Solve kd + 6 = 13d for d. 1 Let y(b) = -9b - 70. Suppose -3 = -3h, -34 = 4z - 2h + 12. Let f be y(z). Solve -28q + fq = -4 for q. -4 Let a(q) be the second derivative of q3/3 - q2 - 307q. Let p(z) = z + 7. Let s be p(-6). Let n be a(s). Solve -5 = l - n for l. -5 Let k(c) = -c2 + 7c - 2. Let h be k(5). Let s = h - 8. Let b be (1/(-3))/(84/(-1008)). Solve s = br - 2r for r. 0 Suppose 45s + 145s = -47s + 1659. Solve 15b + 32 = sb for b. -4 Suppose -5n = 5q - 540, 3n + 0n - 324 = -5q. Let z = n + -75. Let l(w) = w*3 + 16w*2 - 28w - 179. Let v be l(-17). Solve 0 = 5j + z - v for j. -5 Suppose 67 = -2c + i + 4i, c = -5i - 11. Let y = -24 - c. Suppose -o = -2m - 12, -4o = 2m + y - 0. Solve 5w - ow = -6 for w. -2 Let u(f) = -2f*2 + 3f - 2. Let w be u(8). Let s = 109 + w. Solve -sn = -11 - 4 for n. 5 Let x(z) = z2 + 32z - 317. Let d be x(-40). Solve 36 = df + 15 for f. 7 Suppose -4t - 4t + 6t + 40 = 0. Solve -l = 22 - t for l. -2 Let a(t) = t*3 + 19t*2 + 28t - 48. Let n be (136/48)/((-1)/6). Let l be a(n). Solve 59d + 10 = ld for d. -2 Suppose 5g - 2 = 4g. Suppose -j = 5d - 23, 3j - 7d + 2d = -11. Suppose 0 = -5i - 5v + 10, -5i + jv + 0v = -26. Solve -g - i = -2b for b. 3 Let s = -1 - -4. Let g be 184/18 - (-174)/(-783). Let z = 34 - 29. Solve zc - sc = -g for c. -5 Let r = 216 + -177. Let s = r + -37. Solve -sh - 6 = 4 for h. -5 Let j(q) be the second derivative of 1/6q*3 + 0 + 19q + 6q2. Let d be j(-10). Solve 7s = ds for s. 0 Let l(a) = -2a*3 + 10a*2 + 4a - 2. Let r be l(5). Suppose -12 = 3i - r. Suppose 0 = t - 6 - i. Solve 3s - ts = -15 for s. 3 Let d(t) = 635t + 7542. Let k be d(-11). Solve k - 613 = 8c for c. -7 Suppose a - 4g + 631 = 0, 3a - 126g + 122g + 1901 = 0. Let b = a - -635. Let z(o) = -o2 + 3o + 4. Let c be z(4). Solve c = -5n - bn + 15 for n. 3 Suppose 9w + 2134 = -8. Let a = -235 - w. Solve 3 = ac - 3 for c. 2 Let n = 15398 + -15398. Solve 46o + 115 - 437 = n for o. 7 Let r = -3220 - -3248. Solve -rq = -5q - 69 for q. 3 Let x(a) = -a2 - 14a + 1. Let q be x(-14). Let k be 3 + 14 - q/1. Let g = 197 + -193. Solve -4f = k - g for f. -3 Suppose 3h + 2 + 220 = 0. Let k = h + 79. Solve ko - 6o = 1 for o. -1 Let r(x) = -3x2 + 2x + 7. Let k be r(3). Let q = -3 - k. Suppose -5o = -2m + 42 - q, 8 = m - o. Solve 0 = mc - 4 - 2 for c. 2 Let g = 3697 - 3670. Solve gj - 15 = 39 for j. 2 Let m be ((-2 - -31) + -27)(-1)/((-4)/658). Solve -231 + m = -14k for k. -7 Let c(d) = d*3 - 7d*2 - 8d - 20. Let p be c(9). Let i be ((-8)/28)/(208/p - 3). Solve 4q + q + i = 0 for q. -2 Let m = -12322 + 12322. Solve -10c - 2869 + 2939 = m for c. 7 Let x = 64 - 197. Let a = x - -136. Let u be 2 - 2 - (-15)/a. Solve j = -3 + u for j. 2 Let t be (36/(-54))/((-2)/255). Let d = t + -67. Solve -6h + 12 = -d for h. 5 Let a(m) be the second derivative of -m4/12 + 6m*3 + 9m*2/2 + 25m. Let f be a(30). Suppose -19 = -13t + f. Solve -13c + 9c = t for c. -4 Let s = 4 + 8. Suppose 54233i = 54350i. Solve -2k + sk + 30 = i for k. -3 Let f(b) = b2 - 7b + 6. Let h be f(8). Let r(n) = -6 + 359n - 358n + 14n2 - 2 - n3. Let l be r(h). Solve -l = 6p - 3p for p. -2 Suppose 0p = 4k - 2p - 52, -4k = 2p - 36. Let u(i) = -64i + 128. Let l be u(2). Suppose l = -kn + 6n + 20. Solve -7 - 5 = -na for a. 3 Suppose -t = -2g + 26, -2g + 40 = -4t - 34. Let s(y) = -3y*2 - 50y - 22. Let u be s(t). Solve 22h = 20h + u for h. 5 Let n = -108 - -112. Suppose h = -4y + 5 + 8, y - nh + 18 = 0. Solve 0w - y = 2w for w. -1 Let f(n) = 50n + 970. Let r be f(-19). Solve 12 = -23k + rk for k. -4 Let z be (-2)/(-3)-591-1. Suppose -5t = -z - 26. Let l = t - 82. Solve -3s + ls = 0 for s. 0 Suppose 5 = 4k - 95. Let x = 28 - k. Solve 18 = xq + 12 for q. 2 Let l = 8 + -13. Suppose -3k - 2z - 24 + 1 = 0, -4k + 2z = 26. Let r = l - k. Solve b + 0 = r for b. 2 Suppose 0 = -699q + 434q + 30210. Solve q = -72m + 53m for m. -6 Let z(y) = -46y - 1403. Let p be z(-31). Solve pq = 133 - 18 for q. 5 Let b(l) = l*3 + 20l*2 - 46l - 11. Let v be b(-22). Suppose -5k = 5q - 50, q + 5k - v = -7. Solve 11 + 19 = qj for j. 5 Suppose -1092 = -55o - 36o. Solve o = 40i + 52 for i. -1 Let t be ((-96)/(-10))/(1/(-5)). Suppose 2f = -5y - 209, y = 2f + 3f - 31. Let b = y - t. Solve -bs - 25 = -2s for s. -5 Let b be -1 - (511)/1. Let j(c) = -c*3 + 22c*2 - 56c + 39. Let k be j(19). Let r = k + b. Solve 8 = -6u + ru for u. -2 Let r(k) = 53k2 + 129k + 8. Let z be r(-3). Solve -z + 243 = 29y for y. 5 Suppose -12 = 3y, -11 = -2n - 4y + 21. Solve -156u - n = -162u for u. 4 Let v(t) = -8t3 + 11t*2 + t - 2. Let s be v(1). Suppose -4c + r - 5 = 2r, -r - 5 = -4c. Suppose 0 = -2k - c + 2. Solve -3y - k = -sy for y. -1 Let c be (5 - 2)(-30)/(-18). Let i be (-8 + 2 - 1) + 11. Solve -cg = -ig for g. 0 Let t be 928 + (2 - 167)/15 + 11. Solve -17v = -59*v +	{ "pile_set_name": "DM Mathematics" }
1.00004126. Round i to six decimal places. -0.000041 Let p = 1.76 + -4.19. Let k = p + 135.43. Let d = 133.0000257 - k. Round d to 6 decimal places. 0.000026 Suppose -17457f - 28834000 = -17455f. Round f to the nearest one million. -14000000 Let c = 21701.979 + -21727. Round c to the nearest integer. -25 Let k = -133.06844 + 0.01844. Let b = 595 - 461. Let i = k + b. What is i rounded to 0 decimal places? 1 Suppose -y - b + 839036 + 341010 = 0, 2y = b + 2360080. Let u = -2780042 + y. What is u rounded to the nearest 1000000? -2000000 Let j = -2210.0005262 + 2210. Round j to four decimal places. -0.0005 Let c be -21((-42)/72 - (-3)/12). Let f be (-40)/5 + c + 71400001. What is f rounded to the nearest 1000000? 71000000 Let y = 198 - 410. Let u = 212.125 + y. Round u to 1 decimal place. 0.1 Let q = 66.068 - 0.468. Let g = -65.6000545 + q. Round g to six decimal places. -0.000055 Let o(v) = -5v - 22. Let i be o(-8). Suppose 16z = 14z + i. Suppose 4r - 1224 = -zd + 10d, 2d + 2435 = -5r. What is d rounded to the nearest 100? -1200 Let l = -0.3783 - -0.59882. Round l to two decimal places. 0.22 Let w = -1125.999995368 - -1126. What is w rounded to 7 decimal places? 0.0000046 Let c(k) = 1618341k - 414. Let w be c(54). What is w rounded to the nearest 1000000? 87000000 Let i = 35.24049 + -0.07049. Let h = 0.93 + i. What is h rounded to the nearest 10? 40 Let i be ((-884)/(-234))/(-34) + -280790(-1)/(-9). What is i rounded to the nearest one hundred? -31200 Let w = 0.276 + -0.035. Let j = 48241 + -48240.75779. Let l = w - j. Round l to 4 dps. -0.0012 Suppose -1580192519 - 1875629508 = -171t + 2123394973. What is t rounded to the nearest one hundred thousand? 32600000 Let t = 821.9 - 857. Let d = 41 + t. Let c = 5.89999925 - d. Round c to 7 dps. -0.0000008 Let f(q) = q2 + 9q - 17. Let r be f(-11). Suppose -4o + 7 = -r. Suppose 281997 = j - oj + 3c, -3j = 2c + 423002. What is j rounded to the nearest 10000? -140000 Suppose 11177057 - 23671535 = 85o + 12356122. Round o to the nearest ten thousand. -290000 Let c = -112595054 + 112593131.10429. Let x = c + 1923. Let g = -0.104 + x. What is g rounded to 4 decimal places? 0.0003 Let l = 32796215.1831957 + -32776980.8517. Let h = l - 19253.3315. Let c = -19 - h. What is c rounded to six dps? 0.000004 Suppose -149 = 2v - 61. Let o = v + 643. What is o rounded to the nearest 100? 600 Let f = -0.135 - -0.045. Let b = 0.144 + f. Let v = b + -0.053932. Round v to 5 decimal places. 0.00007 Let n(l) = l - 8. Let u be n(12). Suppose -m = um + 3p + 6669054, 2p = -2m - 2667620. Let q = -2135812 - m. Round q to the nearest 100000. -800000 Let s = -21596.022459 + 21596. What is s rounded to 3 decimal places? -0.022 Let d = -3483 - -3401.6. What is d rounded to the nearest 100? -100 Let r(l) be the first derivative of 2 + l2 + 9l - 4567/3l3. Let g be r(-3). Round g to the nearest one thousand. -41000 Let f = 1532.5 - 827.9. What is f rounded to the nearest 100? 700 Let x = 254405 + -254612.062. Let s = x + 0.062. Let u = s + 206.897. Round u to 2 decimal places. -0.1 Let f = 849154.9080567 + -849155. Let r = -0.092 - f. Round r to 4 decimal places. -0.0001 Let w = -272 - -163. Let v = w - -109.0000487. Round v to 6 dps. 0.000049 Let u = 53 - 44. Suppose 12r + 5481000 = ur. Round r to the nearest one hundred thousand. -1800000 Let i = 132 - 130.5204. What is i rounded to 1 decimal place? 1.5 Let p = -23 - 157. Let a be (15/6)/((-3)/p). Let t be (-1 - 163/(-3))/(4/a). Round t to the nearest 10000. 0 Let r be ((-14)/4 - (-1)/(-2))/((-20)/33426000). Round r to the nearest ten thousand. 6690000 Let z(f) = 2154243f - 241. Let y be z(-8). Let h be 1/(-2) - (-52668371)/2. Let a = h + y. Round a to the nearest 1000000. 9000000 Let z = -15208.00030214 - -15208. Round z to 5 dps. -0.0003 Let l = -62 - -62.21. Let h = l - 2.002. Round h to 1 decimal place. -1.8 Let b = -62.98085 + 62.97. Round b to three decimal places. -0.011 Let q = -5324554156 - -5324553872.0000149. Let g = 284 + q. Round g to five dps. 0.00001 Let y be (12 + 32)/(17/(-44710)). What is y rounded to the nearest one thousand? -116000 Let k be (19/(-57))/(1/(-9)). Suppose kg + 3 - 15 = 0. Suppose -3m = -3j - 801, m - gm + 5j = -803. What is m rounded to the nearest 10? 270 Let w = -23006482.5073 + 23003086. Let x = -3610.50591 - w. Let b = 214 + x. What is b rounded to four decimal places? 0.0014 Suppose -357 - 9423 = -3n. Suppose -2l - 2l = -n. Let x = -555 + l. What is x rounded to the nearest 100? 300 Suppose 10 + 0 = 5u. Let z(r) = 3650r - 26 - 15 + 41. Let c be z(u). What is c rounded to the nearest one thousand? 7000 Suppose -10l + 37188 + 262412 = 0. Suppose -8f - l = -f. What is f rounded to the nearest one thousand? -4000 Suppose 0 = 3j + l - 26882, 0 = 23j - 28j + 2l + 44818. Suppose -5t + 4o = 46520, j = 3t - 4o + 36882. What is t rounded to the nearest 1000? -9000 Suppose 5y - 117 + 12 = 0. Let v(j) = 28 + 135777j - 263460j - 238985j. Let h be v(y). Round h to the nearest 1000000. -8000000 Let p = 61 - 60.19. Let j = -2560 - -2562.01. Let k = j - p. What is k rounded to the nearest integer? 1 Let x = -13472.006482 + 13472. Round x to 3 decimal places. -0.006 Let m = -269.393498 + 269.4. Round m to 3 decimal places. 0.007 Suppose -11o + 440 = -3o. Let v = o + -55. Suppose v = 9g - 15562 - 4238. Round g to the nearest one thousand. 2000 Let g be ((-3)/12)/(2/(-48)). Let i(t) = -5776t*2 + 12t - 36. Let w be i(g). What is w rounded to the nearest 10000? -210000 Let t = 337300267.31 - 337300230.8252100833. Let r = -0.0847572167 + t. Let c = -36.4 + r. Round c to 6 dps. 0.000033 Let s = 5258.862448 + -10569300265.862448. Let i = -10569294896.99999853 - s. Let h = i + -110. What is h rounded to seven decimal places? 0.0000015 Let j = -0.0941 - -510.0941. Let w = 296 - j. Let v = w - -217.42. What is v rounded to one decimal place? 3.4 Let j = 0.2758588959 - 0.27586. Round j to 7 dps. -0.0000011 Let h = 2 + 1. Suppose hc - 5c - n + 71707 = 0, -71692 = -2c + 2n. Suppose -c = 4p + 252149. Round p to the nearest ten thousand. -70000 Let g = -4.4044 + 4.40398806. What is g rounded to six decimal places? -0.000412 Let i = -35269 + 35268.99997187. What is i rounded to 6 decimal places? -0.000028 Let c = -110770 + 245114. Let j = c - 134284.9953. Let i = j - 59. Round i to four decimal places. 0.0047 Let k = -137 + 151. Suppose -247 - 47 = -kt. Let g be (-76296)/(-7) - (-12)/t. Round g to the nearest one thousand. 11000 Let f = 42 - 38.32. Let x = -180 - -179.78. Let z = x - f. What is z rounded to 0 decimal places? -4 Let n = -126 + 135. Suppose 0 = -nh - 4365803 - 1682197. Round h to the nearest one hundred thousand. -700000 Suppose 2h - 52 = 2q, 0h = -4q - 4h - 144. Let y = 26 + q. Let f be 4/y + 312500030/(-25) + 2. Round f to the nearest 1000000. -13000000 Let g = -22.9 - -22. Let i = -30.1 - -44.8. Let x = i - g. Round x to the nearest integer. 16 Let g = -5360 - -5359.7389. Let v = 28.74 + -29. Let t = g - v. Round t to 3 decimal places. -0.001 Suppose -b + 5 = -0, -i + 5b = 86. Let z = -65 - i. Let j be 14242/8 + (-2 - 7/z). Round j to the nearest one hundred. 1800 Let m = -0.4726112 + 0.4715. Round m to 3 decimal places. -0.001 Let a = 1.09257 + -83.03157. Let h = 0.061 - a. Let u = 81.99967 - h. Round u to four dps. -0.0003 Let l = 0.33 + -2.53. Let p = 3.3 + l. Let n = p - 3.3. Round n to zero decimal places. -2 Let h = 5.16 + -5.16104789. What is h rounded to 5 dps? -0.00105 Suppose -528j - 648 = -520j. What is j rounded to the nearest one thousand? 0 Let p = -2038 + 1104.4. Let s = -861 - p. What is s rounded to the nearest 10? 70 Let a = -976911.3999689 - -976912. Let m = a + -0.6. What is m rounded to four dps? 0 Let m = 3.1615 + 2.2476. What is m rounded to one dp? 5.4 Let u = 28707 + -28706.999970854. What is u rounded to 7 decimal places? 0.0000291 Let u(f) = 13f*3 - 2953f*3 - 4f + f*2 - 419f3 + f2 - 32 + f*2. Let j be u(-8). Round j to the nearest 1000000. 2000000 Let k = -2434.5486 - -2434. What is k rounded to 2 dps? -0.55 Let x = -159084 + -8906. Round x to the nearest 1000. -168000 Let u = -195 - -193. Let n be 210((-256)/24)/(u/(-75)). What is n ro	{ "pile_set_name": "DM Mathematics" }
. 1/114 What is prob of sequence nto when three letters picked without replacement from {w: 2, n: 8, t: 2, o: 3, y: 2}? 1/85 What is prob of sequence pj when two letters picked without replacement from {j: 15, p: 4}? 10/57 Four letters picked without replacement from {u: 8, t: 2}. Give prob of sequence tuuu. 2/15 Calculate prob of sequence ss when two letters picked without replacement from hahtjajyasshay. 1/91 Calculate prob of sequence jv when two letters picked without replacement from {u: 1, j: 2, o: 4, f: 2, v: 2, r: 3}. 2/91 Two letters picked without replacement from dwrr. Give prob of sequence dr. 1/6 Three letters picked without replacement from tsst. What is prob of sequence ttt? 0 Calculate prob of sequence tqrq when four letters picked without replacement from rcqtqrcctrrrqqq. 5/819 What is prob of sequence pm when two letters picked without replacement from pppmppmpmmcpppmmpp? 11/51 Calculate prob of sequence yjy when three letters picked without replacement from {y: 4, j: 2}. 1/5 Calculate prob of sequence jr when two letters picked without replacement from {j: 3, y: 4, r: 4}. 6/55 Calculate prob of sequence yvvv when four letters picked without replacement from {y: 8, l: 5, v: 4}. 2/595 Three letters picked without replacement from ggbqgaqbvkgb. Give prob of sequence qqb. 1/220 Two letters picked without replacement from oloojllljollecolll. What is prob of sequence cl? 1/34 Two letters picked without replacement from {g: 7, u: 6}. What is prob of sequence uu? 5/26 Calculate prob of sequence ii when two letters picked without replacement from iiiririiriiiii. 55/91 What is prob of sequence eee when three letters picked without replacement from {e: 10, y: 9}? 40/323 Three letters picked without replacement from {y: 2, d: 10, n: 4}. What is prob of sequence dyy? 1/168 Four letters picked without replacement from odolyldqoyqyld. Give prob of sequence ooll. 3/2002 Three letters picked without replacement from nxnxxxxxxxxnxxxxnnn. Give prob of sequence nxx. 52/323 What is prob of sequence gz when two letters picked without replacement from {z: 1, m: 1, b: 5, g: 2}? 1/36 Calculate prob of sequence wwzw when four letters picked without replacement from {o: 3, p: 2, z: 4, w: 6}. 4/273 Three letters picked without replacement from iiiirzjziyjiiz. Give prob of sequence jyr. 1/1092 Calculate prob of sequence xbx when three letters picked without replacement from {d: 1, x: 2, k: 3, b: 6, r: 2, g: 1}. 2/455 Calculate prob of sequence cl when two letters picked without replacement from lccclccccclc. 9/44 What is prob of sequence awna when four letters picked without replacement from {n: 5, o: 1, w: 1, l: 1, a: 2}? 1/504 What is prob of sequence zwk when three letters picked without replacement from {z: 1, k: 13, h: 1, w: 5}? 13/1368 Three letters picked without replacement from ryrryrryyrrrrrrryrrr. What is prob of sequence yrr? 35/228 What is prob of sequence ioj when three letters picked without replacement from ijoidyq? 1/105 Four letters picked without replacement from kkkqkkkkkkq. Give prob of sequence qqkk. 1/55 Two letters picked without replacement from cspapppcpapp. What is prob of sequence ca? 1/33 What is prob of sequence gg when two letters picked without replacement from llgllxglllgiiiilil? 1/51 Calculate prob of sequence wwz when three letters picked without replacement from {z: 5, w: 3, g: 2, p: 2, s: 6}. 5/816 What is prob of sequence sa when two letters picked without replacement from saaaannaasaa? 4/33 Calculate prob of sequence bb when two letters picked without replacement from bhhhbbhbhhhbbhhhhhb. 7/57 What is prob of sequence ze when two letters picked without replacement from {z: 1, y: 1, e: 4, g: 1, b: 1}? 1/14 What is prob of sequence nnl when three letters picked without replacement from {n: 4, l: 10}? 5/91 Two letters picked without replacement from {k: 4, h: 6}. What is prob of sequence kh? 4/15 Three letters picked without replacement from {k: 1, z: 1, j: 1, q: 1, x: 1}. Give prob of sequence xqj. 1/60 Calculate prob of sequence vbvr when four letters picked without replacement from vvbvr. 1/20 Calculate prob of sequence je when two letters picked without replacement from {a: 1, e: 4, c: 1, j: 2}. 1/7 Four letters picked without replacement from {n: 1, w: 9, o: 1, j: 1, q: 4, m: 1}. What is prob of sequence wojq? 3/4760 Four letters picked without replacement from xqqqhihqqhhqhqqhqi. What is prob of sequence ixhh? 1/1224 Calculate prob of sequence ccc when three letters picked without replacement from {c: 4}. 1 Four letters picked without replacement from {b: 4, q: 3, c: 2, t: 10}. Give prob of sequence tctb. 5/646 What is prob of sequence kkk when three letters picked without replacement from xoxkxkovkxkkko? 5/91 Two letters picked without replacement from jajjjajjajjjjjjjaajj. Give prob of sequence ja. 15/76 Two letters picked without replacement from oroaeeeoeaoepeea. What is prob of sequence ar? 1/80 What is prob of sequence hg when two letters picked without replacement from qphhhhgqh? 5/72 Two letters picked without replacement from wfllwwwwwwwolof. Give prob of sequence ow. 8/105 What is prob of sequence uquc when four letters picked without replacement from uuuquzuuwuucuquunuuw? 13/4845 What is prob of sequence pp when two letters picked without replacement from {d: 1, v: 4, p: 5}? 2/9 Three letters picked without replacement from ysiossyss. Give prob of sequence yos. 5/252 Two letters picked without replacement from haja. What is prob of sequence ja? 1/6 Calculate prob of sequence ze when two letters picked without replacement from {e: 2, z: 2, v: 1, b: 1, h: 1, j: 2}. 1/18 Calculate prob of sequence dado when four letters picked without replacement from {a: 2, o: 5, e: 4, d: 2}. 1/858 Two letters picked without replacement from ihqehtff. What is prob of sequence hf? 1/14 Four letters picked without replacement from {e: 1, n: 14, h: 1}. Give prob of sequence ennh. 1/240 What is prob of sequence zzzt when four letters picked without replacement from {z: 5, t: 2}? 1/7 Calculate prob of sequence vz when two letters picked without replacement from {q: 1, l: 2, v: 1, r: 1, z: 1, i: 2}. 1/56 Two letters picked without replacement from {l: 1, h: 1, v: 1}. What is prob of sequence vh? 1/6 Calculate prob of sequence jqs when three letters picked without replacement from sqqhhsqqqjqnhjn. 4/455 Four letters picked without replacement from nxnxn. What is prob of sequence xnxn? 1/10 What is prob of sequence rtx when three letters picked without replacement from xbbmbxxxsxmstmrmmxbs? 1/1140 Two letters picked without replacement from {h: 3, m: 15}. What is prob of sequence mm? 35/51 What is prob of sequence jq when two letters picked without replacement from {w: 1, q: 2, h: 2, j: 1}? 1/15 Four letters picked without replacement from kskssskkkkksskkkkk. What is prob of sequence kssk? 11/204 Two letters picked without replacement from ulllmuulmumllmlmlllb. What is prob of sequence ll? 9/38 Two letters picked without replacement from {r: 2, u: 1, z: 2}. Give prob of sequence ru. 1/10 Two letters picked without replacement from iobbohmboobomoi. What is prob of sequence im? 2/105 What is prob of sequence gd when two letters picked without replacement from ldggkdkgggkghkkgk? 7/136 Calculate prob of sequence cmc when three letters picked without replacement from {c: 2, l: 3, m: 1, x: 4}. 1/360 What is prob of sequence jz when two letters picked without replacement from {j: 7, z: 2}? 7/36 Two letters picked without replacement from {a: 2, e: 4}. What is prob of sequence aa? 1/15 Three letters picked without replacement from ppkpkpkkpk. Give prob of sequence kkp. 5/36 Calculate prob of sequence yy when two letters picked without replacement from {h: 2, y: 4, t: 3}. 1/6 Three letters picked without replacement from {y: 1, v: 1, u: 2, d: 3}. Give prob of sequence udy. 1/35 Two letters picked without replacement from {l: 2, n: 8, k: 2, y: 7, m: 1}. Give prob of sequence yk. 7/190 What is prob of sequence ir when two letters picked without replacement from {i: 1, e: 8, b: 2, r: 1, d: 7}? 1/342 Three letters picked without replacement from feisssiwsiwimmieswi. What is prob of sequence fwm? 1/969 What is prob of sequence qq when t	{ "pile_set_name": "DM Mathematics" }
2 - 2) + 3b2 + 2b*2 - 7b*2. -3b*2 - 2b Expand (-3u + 5u + u)(-3u + u + 5u)(-147 + 112 - 179). -1926u2 Expand 3 - 2h - 3 + 0h + 2h + 0h + (-1 - 5 + 0)(3 - 3 - h). 6h Expand (n4 - 2n*4 + 0n*4)(-2917n + 1642n + 2176n + 1023n). -1924n5 Expand -191c - 154c - 7c - 2c + 1 - 1 + 3 + 2c - 3 - 1 - 2c + 1 + (-3 + 1 + 1)(-2c + 3c + c) + 0c - 2c + 0c. -358c Expand (4 - 4 + 1)(-3f*2 + 2f*2 + 2f*2)(4f3 + 0f*3 - 3f*3) + (-278f + 4f2 + 278f)(-f2 + f2 + 2f*3). 9f*5 Expand (6l + 3l - 4l)(8 + 19 + 26). 265l Expand 1224f + 1299f - 2600f + 1 + (-4 + 4 + 1)(5f - f - 5f). -78f + 1 Expand (0c*2 + 0c2 - c2)(0 + 2c + 0) + (-c*2 - c + c)((3c + 37c + 17c)(-3 - 2 + 4) + 0c + 4c - 2c). 53c3 Expand (-8 + 8 + z2)((-2 - 2 + 0)(5 - 2 - 4) + 2 + 1 - 4) + (z - z - z)(-3z + 0z + 5z). z2 Expand o4 - 2o4 + 2o*4 - 3o + 3o + o4 + (-5o*3 + 0o*3 + 4o*3)(-3 + 3 - 2o) + 52o*4 + 208o*4 - 31o*4 + (-3 + 0 + 2)(o*4 + 2o - 2o). 232o*4 Expand (-6o + 2o + 0o)(8o + 32 - 32) + o - o - o*2. -33o*2 Expand (2l - l - 1 - 3l)(31494 - 31494 - 134l). 268l*2 + 134l Expand (-1 - 3 + 2)(-x4 + 7x*5 - 2x*4 + 3x*4). -14x*5 Expand (-1 + 4 - 2)(-3u + 3u - 2u) + (3u + 0u + u)(-3 + 0 + 2) + 233u - 183u - 111u. -67u Expand -1 - 2u3 + 2u3 - u3 + (-7u - 2u - 4u)(9u2 - 2u2 - u2). -79u3 - 1 Expand (-2i*3 + 6i*3 + 27i*2 - 22i*2)(-4i - i + 3i). -8i4 - 10i*3 Expand (-2y - 2 + 2)(-3 + 0 + 2) - 15y - 109 + 109 + 3y - 6y + 2y - 3y + 3y + 3y + (-3 + y + 3)(0 - 3 + 2). -12y Expand (0 + 1 - 2)(0o - 3o + 4o)(-17 + 7 + 3)(2o3 + 4o*3 - 4o*3). 14o*4 Expand (-4 + 4 + 2)(-174 + 174 - 36q2 - 2q*2 + q - q - q + q + 2q*2 + (0 + 0 - q)(q + q - q)). -74q2 Expand 1 + 2i*3 - 1 - 69i + 69i - 277i*3 + 0i + 0i - i3 + (-1 - 1 + 4)(-6i3 + 2i*3 + 3i*3). -278i*3 Expand (-6 + 11 - 3)(4 - 4 - 3)(0k + 0k + 2k). -12k Expand (-2 + 1 + 2)(-2c2 + c2 + 3c*2) + 47 - 47 + 103c*2. 105c*2 Expand (2k*4 + 2k*2 - 2k*2)(-3 + 1 + 1) + 0k4 - k4 + 2k*4 - 5k4 + k4 + 3k4 + (62k + 100k + 69k)(k3 - 4k*3 + 0k*3). -695k*4 Expand (-414 + 414 - 14a)(2a + 0a - a)(2 - 2 - a)((2 - 5 + 5)(2 - 4 + 0) + 1 + 0 - 2). -70a3 Expand 2 + v - 2v + 1 + (-v + v + 5v)(-7 + 4 + 1). -11v + 3 Expand (-f + f + 2f*3)(-4 + 6 - 27)(4f - 2f + 0f). -100f4 Expand (1 - 1 - f2 + (1 - 1 + 1)(-f2 - f2 + 0f2))(-179f - 159f + 66f). 816f*3 Expand 2i5 + i5 - 5i5 + i5 - i5 + i5 + (-4i + 4i - 5i*4)(0 + 0 + i). -6i5 Expand (0n - 2 + 2n + 9)(18 + 6 - 3)(2 - 5 + 1). -84n - 294 Expand (0 + v + 0)(-6v + 3v + 4v) + 2v2 + 5 - 5 - 4v*2 + 0v2 - v2 - 2v2 + 2v2 - v2 + (-3v2 + v2 + 0v*2)(2 + 1 - 1). -7v2 Expand 3o - 2o + o + (3o + 0o - o)(-2 + 2 + 1) - o + 1 - 1 - 3616 + 1806 - 1356o + 1810. -1353o Expand (3y2 + 6 - 6)(-y2 + y2 + y3 - 3 - y3 + 3 + (-3 + 3 + y*3)(1 - 2 + 0) + 2y3 - y3 + 2y*3). 6y*5 Expand (-2g - 4 + 4)(2g - 2g + 2g*2) + 0g3 + g3 - 3g3 + (5g - 2g - 2g)(6g - 5g - 4g)(-19 - 6g + 19). 12g3 Expand (-2146 + 4296 - 14c*2 - 2159)(0c + c2 + 0c). -14c4 - 9c*2 Expand 6y - 29y - 30y + (4 + 0 - 5)(-2y + 2y - y) - 2 + y + 2. -51y Expand 3c - 3c - c*3 + (-2c - 3 + 3)(126c*2 - 135c*2 - 139c*2). 295c3 Expand -k2 - 4k2 + k2 + (0k - 3k + 2k)(2k + 1 - 1) + (-2k - 6k - k)(1 - 1 - 2k)(0 - 3 + 5). 30k2 Expand (5 + d3 - 5)(d + 4d + d) + (5d3 - 6d*3 + 24d*3)(5d - 2d - 2d). 29d*4 Expand (52 - 52 + 9z*3)(4z2 - 28 - 2z*2 + 2). 18z*5 - 234z*3 Expand ((-z + 0 + 0)(-2z + 0z + 0z) - 3z*2 + 4z*2 - 2z*2)(-136z3 - 10z*3 - 124z*3). -270z*5 Expand (-13k*2 + 260k - 275k - 6k*2)(-2k + 2k + 2k). -38k*3 - 30k*2 Expand (3781p - 86p3 - 3781p)(10 + 49p*2 - 50p*2 - 2 + p). 86p*5 - 86p*4 - 688p*3 Expand (2q + 9q - 3q)(-q - 4q + 4q) - 5q*2 - 4q*2 + 24q*2. 7q*2 Expand -123r*4 + 122r*4 + 1 - 3r*3 - 2r - 2r3 + (-5 + 6 + 0)(4r4 + r4 + 0r*4). 4r*4 - 5r*3 - 2r + 1 Expand -3k4 + 1 - k4 + 0k*4 + (308 + 16k - 308)(4k*3 - 4k3 - k3). -20k4 + 1 Expand (k4 + 0k*4 + 3k*4)(-5k + k + k) + (k4 - k4 - k4)(0 - k + 0) + 6k5 - k5 + k5. -5k*5 Expand (1 - 4 + 0)(-3 + 0 + 1)(-1 - 197d + 81d - 82d). -1188d - 6 Expand -2m*4 + 3m*4 - 4m*4 + (-2m + 5m - 2m)(-2m3 + m3 + 11m3) + 0m*4 + 0m*4 + 3m*4. 10m*4 Expand (3 - 2 - 2)(-2f + f - 2f)(5 - 3 - 3)(2f2 - f2 + f2). -6f*3 Expand (83 - 2u - 83 - 2u + 0u + u + u - 4u + 2u + (1 + 1 + 0)(4 - 4 + u) + u + 2 - 2)(-3u + u - 3u). 5u2 Expand (3q*3 + 5q*3 - 3q*3)(-1 + 6q + 1)(2 + 6 - 4). 120q4 Expand (22p*2 - 6p*2 + 12p*2)(-4p + 4p + 3p2) + 0p*4 - 2p4 + p4. 83p4 Expand (-4 + 3 + 3)(-2 + 2a + 2)((1 + 1 + 0)(-3a + a + 5a) + 9 - 5a - 9). 4a2 Expand -2n*3 + 2n*3 + 4n*5 + (0n2 - n2 + 302 - 293 + 5n3)(-n2 + 0 + 0). -n5 + n*4 - 9n2 Expand (-c2 + 0 + 0)(4c*3 + 70c - 5c3 + 120c). c*5 - 190c*3 Expand (-5j*5 + 3j*2 + 0j*2 + 3j*5)(149 - 177 + 131). -206j5 + 309j*2 Expand -3k*5 + 3k*5 - 3k*5 + 7k*5 - 4k5 - k5 - k*5 + 13k*5 + 0k*5 + (-2k - 2k + 2k)(-4k*4 + 0k*4 + 6k*4). 7k*5 Expand (-42v - 18v - 138 + 137)(-6v + 5v - v). 120v2 + 2v Expand (2a2 + 1 - 1)(8 + 591 - 150 + 587 - 38). 1996a2 Expand 7a*3 - 2a*3 - 3a*3 + (-90a - 19a2 + 90a)(8a + 0a - 4a). -74a3 Expand (224 + 71r - 78r - 87)(2r + 2r - 2r). -14r*2 + 274r Expand (-34k4 + 138 - 138)(-1 + 1 + 2). -68k4 Expand (2 + 0 - 5)(-9j2 + 41j2 - j2). -93j2 Expand (14h - 14h - 5h*3)(-2h2 - 2h2 + h2) - 2h5 + 8h*5 - 3h*5. 18h*5 Expand (4 - 4 - y)(52 - 19y2 - 52 - 4 - 2y*2 + 4 + (2y + y*2 - 2y)(3 - 1 + 0) - 2y*2 + 2y2 - y2). 20y3 Expand (-248 + x2 + 509 - 252 - 2x)(1 - 1 - 1). -x2 + 2x - 9 Expand (18r - 353 + 353)(-r2 - r4 + r2 + r4 + 0r4 + 2r*4 + (-5r + r + 5r)(0r3 + 4r*3 - 5r*3)). 18r*5 Expand (0 + 1 - 3)(33t + 20t - 38t). -30t Expand -38t3 + 2t - 520t2 + 79t*3 - 43t*3 + (-9t*2 + 0t*2 + 3t*2)(-2t + 0t + 0t). 10t*3 - 520t*2 + 2t Expand (0c2 + 2c*2 + 0c*2)(-2 - 2c + 2) + 3c*3 - 6c*3 + 4c*3 + (3 - 3 - 4c*2)(0c + 0c + c) - 2c2 + 3 + 3c*3 + 8c*3 - 6c*3. -2c*3 - 2c*2 + 3 Expand (1 - 3 + 1 + (2 - 2 + 3)(-5 + 1 + 3))(8u*5 + 123u*3 - 123u*3). -32u*5 Expand -3b*2 - 3b2 + b2 + (2b + 0b - b)(-2b + 4b - b) + (2b - 3b - b)(53 + 2b - 53) - 3b*2 - 2b*2 + 4b*2. -9b*2 Expand (3 + 3 - 4 + 0 - 3 + 1 + (3 - 2 - 3)(2 - 1 - 3))(-3a + 6a - 4a)(34a - 48a - 69a). 332a2 Expand (5 - 2 - 2)(-102x2 + 299x*2 + 223x*2). 420x2 Expand -z4 - 3z2 + 3z*2 + (2z*2 - 2z + 2z)(2z - 2z*2 - 2z) - 34z4 + 3z + 2z + 16z*4. -23z*4 + 5z Expand (307d3 + 19 - 19 - 947d*3)(-2d + 0d + d). 640d4 Expand -70 + 26s + 70 + (11 - 11 + 19s)(-2 - 2 + 3). 7s Expand (-5 + 3 + 0)(23g + 17 - 17) - 2g - g + 2g + 0g + 2g + 0g - 6g + 0g + 4g + (5 - 2g - 5)(-1 + 0 - 1) - 2 + 2 + 2g. -41g Expand -258p*5 - 3p*2 + 261p5 + p2 + 22p3 - 2 + (3p*5 + 0p*5 - 4p*5)(-4 + 0 + 0). 7p5 + 22p*3 - 2p*2 - 2 Expand 29 + 32 + 33 - 94 + 2137u3 + (0 - u2 + 0)(3 - 3 - 2u). 2139u3 Expand (k - 6k + 3k)(14 + 8 + 3 + (3 + 2 - 6)(-3 + 0 - 1)). -58k Expand (88d2 + 28d*2 - 30d*2)(-d + 0 + 0)(-2 - 2 + 3). 86d*3 Expand (492g*3 - 468g*3 + 237g*3 + 230g*3)(-2 + g + 2) - g*4 + 2g*3 - 2g*3. 490g*4 Expand (-159 - 110 + 86)(5 + 1 - 4)(2 - 1 - 3)(2z3 - 4z3 + z3). -732z3 Expand -43h - 350h - 151h + (-4 + 2 + 1)(-2h + h + 0h) + 2h + 2 - 2. -541h Expand (-2r - 2r + 3r)(-62r - 129 + 33r + 27r). 2r2 + 129r Expand (0 + 0 + 2v)(0v4 + 3	{ "pile_set_name": "DM Mathematics" }
91, 5351 List the prime factors of 3193575452. 2, 3461, 230683 List the prime factors of 2962536578. 2, 673, 2200993 List the prime factors of 113377687. 73, 1553119 What are the prime factors of 91544764? 2, 29, 43, 18353 List the prime factors of 521101457. 521101457 List the prime factors of 113096570. 2, 5, 47, 240631 List the prime factors of 70639080. 2, 3, 5, 17, 31, 1117 List the prime factors of 41552960. 2, 5, 129853 List the prime factors of 98411258. 2, 11, 281, 15919 List the prime factors of 463798263. 3, 2879, 53699 What are the prime factors of 22798823? 22798823 List the prime factors of 249710707. 359, 695573 What are the prime factors of 263515004? 2, 31, 59, 181, 199 What are the prime factors of 166276825? 5, 11, 13, 46511 List the prime factors of 3684807876. 2, 3, 337, 911179 What are the prime factors of 1660427026? 2, 17, 43, 557, 2039 What are the prime factors of 623522501? 7, 12724949 What are the prime factors of 26522778? 2, 3, 4420463 What are the prime factors of 455037197? 3989, 114073 What are the prime factors of 39703567? 113, 351359 What are the prime factors of 48437686? 2, 11, 31, 71023 What are the prime factors of 65346635? 5, 179, 73013 List the prime factors of 5475291002. 2, 29, 101, 934669 What are the prime factors of 63718124? 2, 293, 54367 What are the prime factors of 37001136? 2, 3, 61, 12637 What are the prime factors of 3567118041? 3, 17, 26891 List the prime factors of 193913832. 2, 3, 7, 17, 43, 1579 List the prime factors of 838579870. 2, 5, 281, 298427 What are the prime factors of 67352511? 3, 19, 241, 4903 List the prime factors of 164532292. 2, 2683, 15331 List the prime factors of 1699673076. 2, 3, 293, 161137 List the prime factors of 2378330159. 61, 1811, 21529 List the prime factors of 52896842. 2, 2113, 12517 What are the prime factors of 171107628? 2, 3, 14258969 What are the prime factors of 110645891? 1723, 64217 List the prime factors of 2126598017. 17, 125094001 List the prime factors of 20906989. 31, 674419 What are the prime factors of 15466373? 13, 23, 173 List the prime factors of 4659970555. 5, 17, 54823183 List the prime factors of 32344417. 7, 23, 79, 2543 List the prime factors of 23490046. 2, 11745023 List the prime factors of 8725661. 7, 41, 30403 List the prime factors of 1323729177. 3, 441243059 What are the prime factors of 65781576? 2, 3, 7, 47, 2777 List the prime factors of 59839648. 2, 11, 47, 3617 List the prime factors of 1002244028. 2, 2281, 109847 What are the prime factors of 28824015? 3, 5, 11, 15881 List the prime factors of 300836145. 3, 5, 20055743 What are the prime factors of 438972271? 438972271 List the prime factors of 974250067. 7, 59, 1237, 1907 What are the prime factors of 47683591? 47683591 List the prime factors of 1617554845. 5, 17, 107, 293, 607 List the prime factors of 405679285. 5, 11, 37, 311, 641 List the prime factors of 643463645. 5, 11, 67, 174617 List the prime factors of 225451134. 2, 3, 197, 21193 List the prime factors of 30594090. 2, 3, 5, 103, 9901 What are the prime factors of 64793136? 2, 3, 53, 25469 What are the prime factors of 2019596705? 5, 7, 103, 560221 What are the prime factors of 5905392345? 3, 5, 43743647 List the prime factors of 4677944034. 2, 3, 4673, 166843 List the prime factors of 180129474. 2, 3, 7, 47, 10139 What are the prime factors of 117098379? 3, 67, 21577 What are the prime factors of 544939790? 2, 5, 54493979 What are the prime factors of 589317316? 2, 7, 23, 31, 4217 List the prime factors of 833281312. 2, 26040041 List the prime factors of 63470209. 11, 929, 6211 What are the prime factors of 172977507? 3, 593, 32411 List the prime factors of 4079563700. 2, 5, 53, 769729 List the prime factors of 404681812. 2, 31, 151, 21613 List the prime factors of 1530901888. 2, 11960171 List the prime factors of 10479202. 2, 67, 78203 What are the prime factors of 15438724? 2, 7, 227, 347 List the prime factors of 135447302. 2, 151, 241, 1861 List the prime factors of 61146694. 2, 7, 31, 140891 What are the prime factors of 768713474? 2, 127, 3026431 List the prime factors of 615938998. 2, 19, 421, 38501 What are the prime factors of 921945972? 2, 3, 17, 43, 227, 463 List the prime factors of 3603162188. 2, 29, 31061743 What are the prime factors of 337077253? 919, 366787 List the prime factors of 985115972. 2, 37, 179897 What are the prime factors of 4413939078? 2, 3, 43, 857, 19963 What are the prime factors of 122548372? 2, 89, 344237 What are the prime factors of 1586975240? 2, 5, 1601, 24781 List the prime factors of 316940521. 71, 1423, 3137 List the prime factors of 2128694203. 19, 523, 214219 List the prime factors of 5206372466. 2, 2603186233 List the prime factors of 665143340. 2, 5, 33257167 What are the prime factors of 12307740? 2, 3, 5, 205129 List the prime factors of 28565780. 2, 5, 17, 84017 List the prime factors of 36992204. 2, 17, 661, 823 List the prime factors of 206417013. 3, 11, 6255061 What are the prime factors of 59967773? 811, 73943 What are the prime factors of 234375723? 3, 37, 157, 4483 List the prime factors of 16812707. 16812707 What are the prime factors of 129416425? 5, 337, 15361 What are the prime factors of 223668015? 3, 5, 14911201 List the prime factors of 8957571. 3, 7, 426551 What are the prime factors of 17969662? 2, 191, 47041 List the prime factors of 1958116582. 2, 2953, 331547 List the prime factors of 248694927. 3, 13, 31, 205703 What are the prime factors of 47251004? 2, 1439, 8209 List the prime factors of 2612377060. 2, 5, 2551, 51203 What are the prime factors of 3571799414? 2, 71, 643, 39119 What are the prime factors of 197952504? 2, 3, 8248021 List the prime factors of 628503664. 2, 4933, 7963 What are the prime factors of 658526? 2, 11, 37, 809 What are the prime factors of 2864710016? 2, 7, 29, 41, 2689 List the prime factors of 511845044. 2, 17, 311, 24203 What are the prime factors of 2087635168? 2, 3571, 18269 What are the prime factors of 46428393? 3, 11, 359, 3919 List the prime factors of 122626200. 2, 3, 5, 204377 List the prime factors of 856219232. 2, 11, 251, 881 What are the prime factors of 278235553? 41, 181, 37493 List the prime factors of 267935329. 127, 2109727 List the prime factors of 152352625. 5, 1218821 What are the prime factors of 3462908345? 5, 13, 53275513 What are the prime factors of 461250849? 3, 59, 487, 5351 List the prime factors of 182171149. 182171149 What are the prime factors of 764643486? 2, 3, 19, 353021 List the prime factors of 13128957. 3, 241, 6053 What are the prime factors of 46462257? 3, 5162473 List the prime factors of 36070723. 13, 67, 41413 List the prime factors of 243450027. 3, 1523, 17761 What are the prime factors of 1874709376? 2, 31, 472457 List the prime factors of 332075937. 3, 31, 383, 9323 What are the prime factors of 338982792? 2, 3, 607, 23269 What are the prime factors of 69252586? 2, 13, 23, 115807 What are the prime factors of 53218235? 5, 7, 139, 10939 List the prime factors of 6023974326. 2, 3, 3793, 264697 List the prime factors of 537702277. 7, 7951, 9661 What are the prime factors of 575737611? 3, 31, 6190727 What are the prime factors of 427980906? 2, 3, 23776717 List the prime factors of 27108509. 4597, 5897 List the prime factors of 235933235. 5, 47186647 List the prime factors of 1002680944. 2, 17, 3686327 What are the prime factors of 73743835? 5, 11, 1340797 What are the prime factors of 239577040? 2, 5, 2994713 List the prime factors of 125322525. 3, 5, 401, 463 What are the prime factors of 1413509958? 2, 3, 7, 647, 2477 What are the prime factors of 29272124? 2, 7, 73, 14321 List the prime factors of 17855998. 2, 163, 54773 What are the prime factors of 9079879? 97, 93607 What are the prime factors of 48657565? 5, 11, 61, 14503 What are the prime factors of 67936118? 2, 163, 208393 What are the prime factors of 8676101? 7, 1239443 What are the prime factors of 1280540735? 5, 71, 3607157 What are the prime factors of 53315958? 2, 3, 43, 206651 What are the prime factors of 1218304312? 2, 152288039 What are the prime factors of 934012945? 5, 186802589 What are the prime factors of 1685868079? 7, 34405471 What are the prime factors of 39240816? 2, 3, 257, 3181 What are the	{ "pile_set_name": "DM Mathematics" }
-1 a Let q be (1/5)/(2/(-15)). Let n be 0 - 7 - 2-1. Which is the second smallest value? (a) n (b) q (c) -8 a Let i(z) = -33z - 329. Let g be i(-10). What is the biggest value in g, 3.4, 0? 3.4 Let i(m) = m*3 - 9m*2 + 17m - 19. Let v be i(7). Let r = 5/4 - v. Which is the third biggest value? (a) -5 (b) -2 (c) r a Let w = 1.1 - 5. Let o = -3.5 - w. Which is the third smallest value? (a) o (b) -0.08 (c) -4/5 a Let j be 2/(-10)-51. Let v be ((-11)/(-2) - 3) + (-3 - -1). Which is the third smallest value? (a) j (b) -4 (c) v a Let v = 4063 - 4058. Let s = 5 - 1. Which is the second smallest value? (a) 5/3 (b) v (c) s c Let m = -1665 + 1667. Let v = -4.6 + 5. What is the second smallest value in 4, v, m? m Let a = -7.5 + 7. Let q = 32 - 29. Let l = -2/187 + -179/748. What is the smallest value in q, l, a? a Let l be 12 + (14 - 5) - (3 + 1). Which is the second biggest value? (a) -3 (b) 2/5 (c) l b Let m = 5.72 - 6.22. What is the third biggest value in -2/3, m, 5, -2/63? m Let z = -0.4 - -31.4. Let r = z + -26. Suppose 5w + 4 = -3l, -l = -4w + 5w. What is the third smallest value in w, -2/13, r? r Let y = 3397/3 - 1131. What is the smallest value in 19, 2/3, y, -1/2? -1/2 Suppose 0 = -29i + 26i + 9. Let p = 2 + -4. Which is the biggest value? (a) i (b) p (c) 0.2 a Let q = -35 - -3. Let p = q + 23. Let f = 81.7 + -81.6. Which is the biggest value? (a) f (b) p (c) 1/5 c Let o = -178 + 154. What is the third biggest value in 1, 1/10, o, -4? -4 Let h = 0.17 - -1.23. Let i = -1.9 - h. Let m = -3.7 + i. Which is the third smallest value? (a) 3 (b) 5 (c) m b Let c = 0.3 + -0.26. Suppose -150 = 3z + 5u - 117, -5u - 31 = z. What is the smallest value in c, 2, z? z Suppose -10j + 5j = 5. Let d be -2 + 0/j + 6. What is the third smallest value in -3/2, d, -3/5? d Let t = 9.98 + -9.58. What is the second smallest value in -92, -1/2, t? -1/2 Let o(h) = -3h - 5. Let d(z) = 5z + 10. Let g(a) = -4d(a) - 7o(a). Let y be g(4). Let b = -1.25 + 1.05. What is the second biggest value in y, b, -2/7? -2/7 Let k = -7 - -6.945. Let p = k + -3.945. Which is the second biggest value? (a) p (b) 2/3 (c) 0 c Let k = 766 + -764. Which is the smallest value? (a) 0.03 (b) -2/9 (c) k b Let i = 996/5 + -199. Let v be (3/36)/(9/24). What is the second smallest value in i, 5, v? v Let r = 1347 - 1343. Which is the third biggest value? (a) -11 (b) r (c) 6/5 (d) -1 d Let w = -214 + 213.5. What is the biggest value in 0.1, w, -0.3, 0.4? 0.4 Suppose 2m = -3l - 4, 3l = 7l + 5m + 3. Let x = 52 - 48.01. Let z = 0.01 + x. What is the third smallest value in l, z, 3? z Suppose z + 4 = -5i - 18, 4z + i = -12. What is the second smallest value in 3/5, 0.27, z? 0.27 Let x = -122 - -118.95. Let i = x + 0.05. Let v = -5373/8 - -672. Which is the biggest value? (a) -2/5 (b) v (c) i b Let g = -136 - -137. What is the second smallest value in g, -1/6, 0, -1/11? -1/11 Suppose 0u - 20 = 10u. Suppose x - o - 6 = 0, 2x + 3o - 1 = -4. Which is the third biggest value? (a) 1 (b) 0.5 (c) u (d) x b Let v be 2((-10)/4 - 4). Let h = 38/3 + v. Which is the smallest value? (a) h (b) -6 (c) -2 b Let n = -2/931 + -1852/4655. What is the second biggest value in 1/17, -4, n, 0.5? 1/17 Let l(r) = -5r*2 + 48r + 699. Let t be l(-8). Suppose w - 13 = -4o, -3w + 33 = 4o + 2w. Which is the second biggest value? (a) o (b) t (c) 2/11 c Let w = 0.00055 + 4.99945. Let n = -7751 + 434089/56. Let m = 7/8 - n. Which is the second biggest value? (a) -2 (b) m (c) w b Let x = 342.7 + -343. What is the biggest value in x, -2, 0.4, -0.5? 0.4 Let j = 14.6 - 14.86. What is the second biggest value in j, 5, -1? j Let h = 4.9 - -0.1. Let y = 8 - h. Suppose -78m = -79m - 5. Which is the third smallest value? (a) y (b) m (c) -2 a Let t be 0 + 2(-1)/(-7). Let g be (9 - 1)/((-2)/4). Let c = g + 65/4. What is the biggest value in 5, t, c? 5 Let d be 255/34(1 - 55/50). What is the biggest value in d, -1.7, 4/5, -0.3? 4/5 Let z = 1685/4 + -418. Which is the second biggest value? (a) z (b) 1 (c) 0.1 b Let q = -37 + 483/13. Let r = -6.9 + 10.9. What is the second biggest value in 2/5, r, q? 2/5 Let h be ((-6)/(72/(-15)))/(1/1). Let w be (-12)/3010/12. Which is the smallest value? (a) -1 (b) h (c) w a Let z be -1 + (-2)/(-12) + 24/24. Which is the third smallest value? (a) 1 (b) z (c) -10 a Let z = 0.1145 + -0.1145. What is the second smallest value in z, -0.16, 3/5, 3/8? z Let g = -0.2 + 0.3. Suppose 0 = -0m + 5m - 2y + 154, 3y = -3m - 105. Let r = m + 33. Which is the biggest value? (a) r (b) 5 (c) g b Let c = 4 + -2. Let a = -10688 + 10692. What is the biggest value in a, c, -2, -5? a Let n = -949 - -949. Let v = -0.8 - 3.2. Which is the biggest value? (a) n (b) v (c) 2 (d) -10 c Let p = 0.12 - 0.53. Let l = 4.41 + p. What is the second biggest value in -8, -0.5, -1/4, l? -1/4 Let l = -134 - -130. Which is the third smallest value? (a) -41 (b) 1 (c) l (d) 2 b Let n = 8 + -9. Let b = 0.76 - 1.06. What is the third biggest value in b, 2, n? n Let t = 6 - 4. Let u be (3/(-9))/((-4)/48). Which is the second biggest value? (a) 3 (b) t (c) u a Let h = 0.2146 - 0.1346. Let m = 2/41 - 47/123. Which is the biggest value? (a) -3 (b) h (c) m b Let z = -474 + 477. Let l = 1.9 - 1.5. Which is the second smallest value? (a) 4 (b) z (c) l b Let v = -1.04 - -0.9. Let c = v - 0.06. Let s = -7 - -6.7. What is the third smallest value in s, c, 2/11? 2/11 Let z(w) be the second derivative of w5/20 + w4/6 - 2w3/3 - 14w. Let i be z(-3). What is the biggest value in i, 0.5, 1/7? i Let u = 66 - 59. Let h = 2.4 + -0.4. Let z = u - h. What is the third smallest value in 4/9, -1/8, z? z Let l = 208 + -207. What is the second biggest value in 5, -4, l, -1/3? l Let d = -0.07 - 3.33. Let u = -3 - d. Which is the third smallest value? (a) u (b) -2 (c) -2/9 a Let f be 4/36153. What is the third biggest value in f, -5/21, -0.5? -0.5 Let w(t) = -t*3 - 14t*2 + 14t - 13. Let a be w(-15). Let x = -95 + 99. What is the smallest value in x, a, 2/5? 2/5 Let m = 5.84 - 2.84. Which is the second biggest value? (a) -0.29 (b) -2/5 (c) m (d) 2/5 d Let r = 5.6 - 0.6. Let u = -6 + 3. Let s be (4 - 3 - u)-1. What is the third biggest value in r, s, 1? s Suppose -k + 3q + 3 = 4q, q - 3 = 2k. Suppose 4o - 9 - 3 = k. Which is the third smallest value? (a) -0.2 (b) -0.03 (c) -4 (d) o b Suppose -3v + 7 = -4q - q, -5q + 4v = 11. Suppose -5c = -3u - 28, 3c - u - 14 = -2u. What is the biggest value in -0.07, q, c? c Let s = 249 + -254. What is the fourth smallest value in 0.5, s, -4, -28? 0.5 Let y = 113/28 + -23/7. Let s = -2.44 - -4.44. What is the third biggest value in y, 5, s? y Let i = 56.9 + -59. Let p = i + 2. Suppose 6y - y = 20. Which is the second smallest value? (a) y (b) p (c) -5 b Let q = 0.3 - 0.1. Let f = 9.8 + -12.8. What is the third smallest value in q, -1, f? q Let s = 669.1 - 669. Let k = -1.8 - -2. What is the smallest value in 5, s, k? s Let z be 123*(2 - (-2)/((-6)/5)). Let g = 37 - z. Which is the biggest value? (a) g (b) 4 (c) 3 (d) -1 b Let o = 1094 - 1082.74. Let l = -11 + o. Let w = l - -0.04. Which is the smallest value? (a) -5 (b) -1/2 (c) w a Let n = 85 - 83. Let q be -2 - -3 - (-27)/(-21). Which is the second biggest value? (a) -14 (b) q (c) n b Let g = -2.831 - -0.031. Let l = g - -1.8. What is the third biggest value in -2, l, -2/11? -2 Let q = -0.096 - 0.104. What is the third smallest value in -3, 0.4, 3/4, q? 0.4 Let j = -2935/6 + 489. Which is the biggest value? (a) 2/5 (b) -0.32 (c) j a Let n be (4/(-100))/((-11)/(165/2)). What is the second biggest value in 4, -2/9, n? n Let f = -0.01 + -0.69. Let w = -19 + 18.86. Let x = -0.06 + w. Which is the second smallest value? (a) x (b) f (c) 4 a Let v(y) = -y + 2. Let k be v(-3). Let p = 0.26 + -0.37. Which is the third smallest value? (a) 4 (b) 2 (c) k (d) p a Let i = -20.2 - -20. What is the third smallest value in -50, i, -2/11? -2/11 Let x = 49.2 + -49. Which is the fourth biggest value? (a) x (b) 3 (c) -2/7 (d) -1 d Let z be (-8)/76 - (186/38 - -2). Which is the biggest value? (a) -4 (b) -1 (c) z (d) 0 d	{ "pile_set_name": "DM Mathematics" }
alue? (a) -3 (b) u (c) g (d) -2 b Suppose -786 = -53t - 786. Which is the biggest value? (a) -1.02 (b) 1 (c) t b Let b = 0.104 + 3.746. Let c = 29436 + -29437.15. Let h = c - b. What is the second biggest value in -3/7, h, 0.04? -3/7 Let l = -106.1 - -104.1. Which is the third smallest value? (a) l (b) 3/4 (c) -191 (d) 0.8 b Let r be (15/60)/((-1)/(-152)). What is the biggest value in 5, -0.5, r, 1? r Let s = 4262/5 - 858. What is the third biggest value in -0.4, s, 3/5? s Let j be (-244)/(-44) + 1860/(-3410). Let r be (-63)/128/(-26). Let h = r - 79/65. What is the second biggest value in -60, j, h? h Suppose -9 = -3b + 5f, -5f = -6f - 3. Let s be (-60)/510 - b/98692. What is the smallest value in s, 5, 4/7? s Let y = 86.42 - 86. Let k = y + 0.08. Which is the second smallest value? (a) 2/31 (b) k (c) -3 a Let r = -14/489 + 451/66993. Which is the smallest value? (a) r (b) -0.4 (c) 3 b Let r be (-1)/34-2-6. Let u = -1.2405 + 0.0795. Let s = u - -0.161. Which is the fourth biggest value? (a) -0.3 (b) -0.2 (c) s (d) r c Let u = 117439 - 117439.4. Let l = 7 + -7.3. Let z = -16/21 + 10/7. Which is the smallest value? (a) -0.2 (b) l (c) u (d) z c Let z = -2 + 2. Let q = z + 0.12. Let f = 74095 + -74095.5. What is the second smallest value in f, -4, q? f Let i(d) = -2d*3 + 35d*2 + 16d - 22. Let a be i(18). Let j = 56 + a. What is the smallest value in j, 2, 0.4, -1/5? j Let g = -651 - -647. What is the third biggest value in 1, 2/9, -0.3, g? -0.3 Let t be -6 + (-72)/(-16) - (-1 - (-35)/(-126)). Which is the smallest value? (a) 1/4 (b) 0.03 (c) t (d) 2/15 (e) 1.8 c Let y = 0.256 - -2.144. Let k = -4.22 + 0.22. Which is the biggest value? (a) 5/6 (b) y (c) k b Let r be (-3)/(((-315)/(-28))/15). Let n be (-4 - 84)/r5/(-65). What is the third biggest value in n, 1, 2/17? n Let k = 0.276391 + -0.506391. Let p = -1 - 2. What is the biggest value in -2, k, p? k Let n = -502.53 + 242.53. What is the biggest value in 0, -0.4, 3/2, n? 3/2 Let y = -0.04 + -1.96. Let h = 4.24 + -4.24. Let k = -26 + 22. Which is the second smallest value? (a) k (b) -0.08 (c) h (d) y d Let w be (6 - (-152)/(-28))3/6. Let u = -0.113 - -0.613. Let j = -0.2 + -0.8. Which is the third biggest value? (a) j (b) -2 (c) u (d) w a Let t be 4(1/10 - (-4)/10). Suppose -9 = -3l, y - 3l + 11 = ty. Suppose 0 = -6h - y + 8. What is the fourth smallest value in h, -0.4, -1.4, 4? 4 Let z = -968 + 15483/16. Let x be (-2)/(-18)((-24)/20)/((-10)/(-25)). Which is the second smallest value? (a) -0.2 (b) z (c) x b Let p = -0.053 - -12.053. Let j = -6 - -8. Which is the second biggest value? (a) -4/3 (b) p (c) j c Let r = -33.92 + 37.92. What is the third biggest value in 1, r, -5, -2? -2 Let x be 3/(-2) - (-4)/16-18. Let l = -1858 - -1854. Which is the third smallest value? (a) -1/3 (b) x (c) 1 (d) l a Let c = -3253.7 - -3251.8. What is the second biggest value in -4, 113, c? c Let x(z) = z + 2. Let l be x(-8). Let g be 2 + 0 + l - -3. Let d be 8(g/(-2))/1. What is the smallest value in 6, d, -0.2? -0.2 Let l = -2727 - -2616. What is the third biggest value in 1/4, -0.5, l? l Let k = 643 - 637.17. Let j = 6.23 - k. Which is the second smallest value? (a) -1 (b) j (c) 73 b Let z = 436 + -91. Let x = z - 347. What is the smallest value in -3/4, x, 70? x Let q = 5.77 + -1.77. Let m be (2/3)/(-2 + 438/216). Which is the third smallest value? (a) q (b) m (c) -5 b Let y = 205.02 + 0.98. Let f = 206.37 - y. What is the second smallest value in f, -5, -0.5? -0.5 Let s = -0.1 + -1.9. Let q = s - -2.3. Let n = -122772 + 122771.7. What is the second smallest value in 3, q, n? q Let h = 741 - 387. Suppose 319 = -7t + h. Which is the third biggest value? (a) -2 (b) t (c) 16 (d) 2/11 d Let v = -163/5 - -32. Let f = 293 - 292.7. Which is the smallest value? (a) v (b) f (c) 5 (d) 0 a Let i = 5549 - 5549.068. What is the smallest value in i, -0.5, -5, 1? -5 Let i be 10(2 + (-24)/15). Suppose -22n + 23n = iz - 9, 4z - 18 = -2n. Let u = -281/5 + 56. Which is the second smallest value? (a) z (b) 6 (c) u a Let s = 7968 + -7965. Which is the fourth biggest value? (a) -4 (b) -2 (c) -0.5 (d) -3 (e) s d Let x = 55084/5 + -10983. Let t = x + -34. Let s = 4168 + -4167. What is the third biggest value in t, 2, s? t Let g = -6448 + 6443. Let u = -0.1 + 0.1. What is the second biggest value in g, -4, u? -4 Let i be (1 - 1)3(-2)/(-18). Suppose w = 4g - 5, -2w + 3 + 3 = 0. Suppose gv - 4c - 27 = -7c, 2v - 3c = 9. What is the biggest value in i, 1/2, v? v Let i = 1921 - 1921.4. Let t be (1/2)/((-90)/(-74)). Let y = -1/90 + t. What is the smallest value in i, 3, y? i Let n = 0.06769 - -2.93231. Which is the second smallest value? (a) 5 (b) 82 (c) n (d) 15 a Let q be 12(12/(-16) - -4). Let s be (0 - -3)/(q/(-26)). Let l be 3 + (s - 5/(-5)). Which is the biggest value? (a) l (b) 6 (c) 3 b Suppose n + 247 = 2l, -4l + 374 + 110 = -4n. Let a = 123 - l. What is the third smallest value in -1/2, 0, a? 0 Suppose -2i = -4b - 24, -i + 7b - 6b = -17. Suppose iw - 12w - 40 = 0. Let s be (-1)/(-28)w-2. What is the fourth smallest value in s, 0.1, 1, -1/6? 1 Let i = -815 - -1623/2. What is the fourth smallest value in 0, i, 2, -1/7? 2 Let y be 18/(-7) + 28/496/(-8). What is the fourth biggest value in -13/2, 2, y, 9? -13/2 Let x be (148/(-444))/((-2)/(-12)). Let i = -41 - -32. Which is the biggest value? (a) -5 (b) x (c) i b Let h = -190508/7 - -27208. What is the smallest value in h, 18/5, 2/15? h Let f = -2.065 + 2.465. Let y = -8 + 8.1. Let n = -4 - -2.5. Which is the biggest value? (a) y (b) f (c) n (d) -1/2 b Let t = -34 - -32. Let h be t/(-9)(7 + -1). Suppose 3 - 4 = d. What is the second smallest value in d, h, -18? d Suppose 60w = 65w + 80. Let u be w/(-200) + 39/450. Let v = 3 + 2. What is the smallest value in 1/10, v, 4, u? 1/10 Suppose -2i - 14 = -3b - 4i, 4i = -3b + 16. Let w = -8 + b. Let m be ((-2)/(-16))/(w/24). What is the third smallest value in 0.01, m, 1? 1 Let n be 147/(-245)(-314)/(-9). Let v = n - -104/5. Which is the smallest value? (a) -0.04 (b) -5 (c) -5/2 (d) v b Let s = -13/19 - 11/95. Which is the fourth biggest value? (a) -6 (b) -0.5 (c) -0.4 (d) s a Suppose 165 - 168 = 3c. Let j be 1/8 + (-1904)/(-128) + -13. What is the second biggest value in 0.8, c, j, -5? 0.8 Let a(o) = -o3 - o2 - 2. Let c be a(-2). Let h = 21.04 + -25.04. What is the third biggest value in c, 8, h? h Let y(v) = v + 10. Suppose 3g + 4w = g, 5w = 15. Let d be y(g). Let t be d/(-14) + (-192)/112. Which is the third smallest value? (a) 3/7 (b) -0.5 (c) t a Let q = -451.6 - -451.8. Which is the fourth biggest value? (a) 0.5 (b) 0 (c) -0.033 (d) q (e) -2 c Let m be (33/(-44))/((-5)/(-4) + 0). Let f = -17.7 + 16. Let u = f + -1.3. Which is the biggest value? (a) 5 (b) m (c) u a Let j = -84.4 + 83. Let n = 11.6 - j. Let f = -17 + n. What is the third biggest value in f, 2, -11? -11 Let v = 14 + -16. Let n be (v/3)/((-22)/(-6)). Let y = -0.18 + 0.08. Which is the second smallest value? (a) 5 (b) n (c) y c Let i = 653.6 - 660.6. What is the third smallest value in 0.09, 0, i, 0.02? 0.02 Let n be 10/(-45) + (-188)/(-36). Let d be (9/(567/91))/(4/(-3)). Let u = d + 4/3. Which is the third biggest value? (a) n (b) -0.4 (c) u b Let g = 0 - 0. Let u = -0.023014 + -0.476986. Which is the second biggest value? (a) 51 (b) g (c) u b Let v = 448 + -426. Suppose x - 25 = -4x, 4s = -2x + v. Let z = 0.33 + -0.03. Which is the fourth biggest value? (a) z (b) 5 (c) s (d) -0.4 d Let g be 18/27 - 8/6. Let v = 12998 - 12997.5. Which is the smallest value? (a) -12 (b) g (c) -4 (d) v a Let z = -73 + 67. Let s be (-12)/(-18)1/z-3. What is the biggest value in s, -3, -0.7? s Let s = 4871 - 4871. Which is the fourth smallest value? (a) s (b) 16 (c) -1 (d) -0.3 b Let x = -306/41 + 407/82. Which is the second biggest value? (a) 16 (b) x (c) 1 (d) 0 (e) 0.2 c Let r = -0.2 - -1.2. Let z(p) = -21p - 126. Let d be z(-19). Let a be d/(-245) + 2 - 4/14. What is the second biggest value in r, a, 5? r Let q = -0.3299 - -0.0299. Let p = 9 - 8.98. What is the second smallest value	{ "pile_set_name": "DM Mathematics" }
). What is the units digit of t(-1)/(-4) - -301? 6 Suppose 2b - 4w - 37 = b, -3w = 5b - 116. Suppose -4t + 29o + 4692 = bo, -4o + 4716 = 4t. What is the tens digit of t? 7 Let t(f) = -f*2 - 7f + 25. Suppose 0 = -o + 3x - 20, -3o = 2x - x + 30. Let m be t(o). Let j = 32 - m. What is the units digit of j? 1 Suppose 4r + 52730 = 3w, 62w - 61w + 5r - 17545 = 0. What is the units digit of w? 0 Let j(q) = 10q + 28. Let y(u) = 3u + 9. Let r(g) = -2j(g) + 7y(g). Let v be r(-4). Let h(x) = 4x2 + 5x - 2. What is the units digit of h(v)? 9 What is the tens digit of (-6 + 6 - -3)/(-1)-1787? 6 Let i = 9411 - 4659. What is the units digit of i? 2 Suppose 168k - 800 = 164k. Suppose a = k + 168. What is the hundreds digit of a? 3 Let v = -20512 - -34111. What is the ten thousands digit of v? 1 Let t(p) = 23035p + 2415. What is the ten thousands digit of t(1)? 2 Suppose -l = 2p - 29350, -73414 = -5p - 4l + 8l. What is the units digit of p? 8 Let m be 0 + -1 + 132. Let x = -16649 + 16669. Suppose -my + 15 = -xy. What is the units digit of y? 3 Suppose 0 = 11c - 391 + 1403. Let p be c(-3 - (-5)/2). Suppose 5o - 3l = 384, 2l - 98 = -2o + p. What is the units digit of o? 5 Let o = -205 - -193. What is the units digit of (-1)/3 + ((-208)/o - 1)? 6 Suppose -341 = 2v + 65. Let f = 130 + v. Let j = f - -167. What is the units digit of j? 4 Suppose y = -k + 21, -5y + 8y - 33 = 3k. Suppose yh + 1343 = 6991. What is the hundreds digit of h? 3 Suppose 3d - 7b - 1 = -5b, -5d - 5b = -35. Suppose -dl + 316 = -806. What is the tens digit of l? 7 Suppose -4f - 2792 = 4q, -5f + 585 - 4079 = 3q. Let c = f + 1000. What is the tens digit of c? 0 Suppose 2t = 6t - 16. Suppose -tw - 74 = -3h, -76 = 2h - 4h - 4w. What is the tens digit of (14 - h)-21? 3 Suppose 4i = 5t - 12 - 451, 5t = 3i + 466. Let k = -7 + t. What is the units digit of (k/(-32))/(1 + (-17)/16)? 4 Let m(c) = 42c*3 + 29c*2 - 73c - 4. What is the tens digit of m(9)? 0 Suppose -9p + 1 = -11p + 5m, 3p - m = 5. What is the units digit of 1594/2 + p/(-2)? 6 Suppose 4a - 6260 = 5472. What is the hundreds digit of a? 9 Let n be 1/3 - (-374)/66. Suppose -j = 5k + 8 - 0, -k = -2j + n. Suppose 2b = -2c + 74, -jc - 4b + 9 + 59 = 0. What is the units digit of c? 0 Suppose 122o - 105o = 60860. What is the thousands digit of o? 3 Let h be 43/635/(-5). What is the tens digit of h/98 - (701/(-7) - 2)? 0 Suppose 18998g - 38256 = 18990g. What is the units digit of g? 2 Let b be (-1)/(-4) - 89/4. Let w = -6118 + 6120. What is the units digit of (w - 4)/4 - b/4? 5 Suppose -605 = 3h + 4o, 0h = -3h + 5o - 641. What is the hundreds digit of 2/((-12)/h)4? 1 Let x be (97710/27)/5 - (-2)/9. Let z = -153 + x. What is the tens digit of z? 7 Suppose 2d - 5g - 291 - 17060 = 0, 5d = -3g + 43300. What is the tens digit of d? 6 What is the ten thousands digit of (-3 - 12/(-8))(-2 + 110684/(-6))? 2 Let g(s) = -3s + 10s*2 + 6s*2 + 6s*2 + 4s - 21s2 - 8. Suppose -c - 32 = -5c. What is the tens digit of g(c)? 6 Let o(u) be the first derivative of u*4/4 - 2u*3/3 - 3u*2 + 262u - 65. What is the units digit of o(0)? 2 Let j = 754 - 706. Suppose 0 = -ja + 51a - 2673. What is the units digit of a? 1 Suppose -2g - 7 = -u + 2, -5u - 11 = 4g. Let p(w) = -8w - 75w + 252w + 1. What is the hundreds digit of p(u)? 1 Let z = 18 - 8. Let v(o) = 121o - 10o - zo + 40o - 4. What is the tens digit of v(1)? 3 What is the tens digit of 0 - 0 - (-187)/(-22)-1422? 8 Let d be (30/(-75))/(0 + (-1)/505). Suppose 246 + d = 3z - 2r, 458 = 3z - 4r. What is the hundreds digit of z? 1 Let b(w) = -w3 - 34w*2 + 25w + 44. Suppose 2u + 70 = -2j + 10, -5u = -3j - 130. What is the tens digit of b(j)? 9 Suppose -23 = -5m + 2q + 167, 4q = m - 20. Suppose 650 = -35k + mk. What is the tens digit of k? 3 Let z(h) = -25h + 11 - 21 + 99h + 8. What is the tens digit of z(1)? 7 Let r(l) = l2 + 10l - 17. Let v be r(-12). Suppose -2x + 61 = -u, x - vu = -2u + 26. Let m = x + 16. What is the tens digit of m? 4 Suppose 0 = -9v + 4v. Suppose 7d - 3d = -4, v = 2p + d - 527. Suppose -2x + 6x - 4m - p = 0, 196 = 3x - 4m. What is the tens digit of x? 6 What is the thousands digit of 7(-1)/21425676/(-2891)? 1 Let d = 36 + -36. Suppose -5 = -3k + 2p - 4p, d = 2k + p - 5. Suppose r + 16 = kr. What is the units digit of r? 4 Let m(p) be the second derivative of -2p3 + 39p*2/2 + 2p. Let r be 3 - ((-10)/15)/(2/(-51)). What is the units digit of m(r)? 7 Let l(r) = 5r3 - 33 - 4r*3 - 2r*3 + 145 - 6r*2 - 110 + 10r. Suppose -3w - 17 = 5f, -3w + 2f - 4f - 23 = 0. What is the tens digit of l(w)? 5 Let g(t) = -35 + 15 + 120t*2 + 17 + 18t*2. What is the hundreds digit of g(2)? 5 Let y = -316 - 142. Let p = y + 1454. What is the hundreds digit of p? 9 Suppose 14s - 39020 = 78841 + 9721. What is the thousands digit of s? 9 Let v be (-1 + 2)(-232)/(-29). What is the hundreds digit of ((-19056)/(-42) - v) + (-4)/(-14)? 4 Suppose 45k = 35k + 40. Suppose -3y + 6036 = kf, -6y = 5f - 3y - 7545. What is the units digit of f? 9 Suppose 0 = 5v + l - 7, 2v + 1 = -2l - 1. What is the units digit of v/(-14) + 29690/70? 4 Let r(v) = 461v*2 + 45v - 163. What is the thousands digit of r(4)? 7 Let z(u) = 32u2 - 823u + 230. What is the tens digit of z(50)? 8 Let y(x) = 57x3 + 11x*2 - 34x + 49. What is the units digit of y(5)? 9 Let m = 1010 + 600. What is the tens digit of m? 1 What is the units digit of -410/(-12)(82468/20 - -25)? 8 Let a be (544/28)/4 - (-2)/14. Suppose -560 = -al - 5i, -6l = -10l + 5i + 430. What is the units digit of l? 0 Let r(t) = -177t + 120. Let d be r(-10). Suppose -634 = 8o - d. What is the tens digit of o? 5 Suppose -2s - 2z - 774 = 0, -5z = 5s - z + 1932. Let u = -328 - s. What is the units digit of u? 6 Let z(q) = 21q*2 + 7q*2 + 15q - 5 - 3 - 8q2. What is the units digit of z(6)? 2 Suppose 0 = -4j + 4s - 36, 15 + 6 = -4j - s. Suppose 0 = -12q - 42 - 18. What is the units digit of (-10 + 2)/(-1 + q/j)? 8 Suppose -3y + o + 7 = -4, 14 = 4y - 2o. Let k be 3/4-5y. Let s(d) = -2d + 27. What is the tens digit of s(k)? 5 Suppose -3d - 3c + 21 = 2c, -15 = -3d - 3c. Let l be (-11 + 8)(1 - d). Let h = 40 + l. What is the units digit of h? 3 Let k = 156 + -152. Let b be (-9)/6 + (-2)/k - 583. Let i = b - -861. What is the units digit of i? 6 What is the ten thousands digit of 10(22 - (-222696)/40)? 5 Let n = -1023 - -708. Let f = 3 - n. What is the units digit of f? 8 Let l(b) = 17b2 - 1124b + 254. What is the thousands digit of l(76)? 3 Suppose 0 = 4m - 2i - 10, 4m = -5i + 37 + 8. Suppose -mj - 2g = -1076, -3g - 666 = -5j + 420. Let n = 367 - j. What is the units digit of n? 1 Let p = 2548 + 939. What is the thousands digit of p? 3 Let y be (2(-6)/36)/((-3)/189). Let h = y - -337. What is the hundreds digit of h? 3 Suppose 18j + 23j = 50j - 257004. What is the units digit of j? 6 Let z be 212/6 + 12/18. Let w be z/45 + 302/10. Suppose 163 - w = 4b. What is the tens digit of b? 3 Let t be (-7 - (-6 - 3)) + (-1 - -41). Suppose 4b - 74 - t = -3z, 0 = 2z + 3b - 78. What is the units digit of (-1 - 3)102/z-3? 4 Let o(r) = -79r*2 + 11r + 10. Let f(m) = -41m2 + 6m + 5. Let w(j) = -13f(j) + 6o(j). What is the units digit of w(3)? 0 Let v(w) = 488w + 76. Let l be v(7). Let y = l - 1478. What is the thousands digit of y? 2 Let b be 0 - (99/15 - (-10)/25). Let h(z) = -25z - 23. Let m be h(b). Suppose -4a - 17 = -5n + 141, -a - m = -5n. What is the tens digit of n? 3 Suppose -5y + 5g = 0, 4y + 6 - 24 = -5g. Suppose -2v + 484 + 20 = yw, -w = -4v - 257. What is the hundreds digit of w? 2 Suppose -v + 4 = 0, -3l = -3v - 2v + 14. Let w be 6/(-5)((-15)/l)/3. What is the tens digit of (-33)/(-9)(w + 0)? 1 Let y(q) = -q3 + 19q*2 + 2q - 19. Let n be y(16). Suppose 8d - 3013 = -n. Let z = d + -182. What is the tens digit of z? 9 Let h(g) = -g3 + 12g*2 + 7g + 12. Let k be h(9). Suppose 2w + o + 229 = 5w, -5o + k = 4w. Suppose w = 5*b - 208. What is the tens digit of b? 5 Let l be (-8)/52 - (-1264)/104. Suppose -1	{ "pile_set_name": "DM Mathematics" }
biggest value? (a) -2/9 (b) q (c) 1/6 (d) 1 a Let z = 0.15 + 5.85. Let g = 1 + 6. Let c = z - g. What is the second biggest value in -0.5, -9, c? c Let g = -0.05 - -0.15. Let o = g - -3.9. Let p = -44/135 - 2/27. Which is the third biggest value? (a) o (b) p (c) 2/11 b Let g be ((-62)/2046)/(((-50)/(-12))/5). What is the third smallest value in -4, g, 4/5? 4/5 Let k = -0.3 - -1.8. Let r = -0.16 + -1.44. Let m = r + k. Which is the biggest value? (a) -2/5 (b) m (c) -3 b Let v = -1043 - -1044. Which is the fourth smallest value? (a) -0.3 (b) v (c) -3 (d) -4 b Let m = -4 - -4.3. Let j = -87 + 88. Which is the third biggest value? (a) 1/6 (b) m (c) j a Let x = -7120 + 28641/4. Let g = 2085/52 - x. Let j be 3/(-60)-42. What is the third smallest value in g, j, -5? j Let z = 3.6 - 0.6. Suppose 2k + 66 = 5f, -f + 3k = 3f - 57. Let s be 40/f(3 + 27/(-5)). What is the third smallest value in -0.2, z, s? z Let h = -13/33 - -877/132. Which is the third biggest value? (a) -1 (b) 3 (c) 1/6 (d) h c Let y be (-1(-6)/(-10))/((-17)/85). Let f be (-1)/4 + 10/8. Which is the smallest value? (a) y (b) f (c) -1 c Let i be (15/(-40))/(15/(-20) + 3). Which is the fourth smallest value? (a) 4/5 (b) -1/5 (c) -4/3 (d) i a Let d be ((-80)/60)/((-20)/(-3) + -2). What is the second biggest value in -3, 0.2, 4, d? 0.2 Let s = 32 - 34.1. Let m = 1.7 + s. Suppose 0b + 15 = 5b. What is the smallest value in m, b, 1? m Let a = 45947/45 - 1021. Let h = 1/15 + a. What is the second smallest value in -3, -2, h? -2 Let j = -572 + 571.9. What is the fourth smallest value in j, -1/4, 5, -7? 5 Let q = 326 - 325.976. What is the smallest value in q, 1/2, -1? -1 Let c = 0.558 - 0.006. Let p = c + -0.112. What is the biggest value in -0.5, p, 0.2? p Let x = 53 - 83. Let u = x + 34. Let y = -2082/2615 - 2/523. What is the smallest value in y, u, 1/4? y Let y be (-2)/8 + 22/(-8). Let m be (-7 + 16)/(-18)8. What is the third smallest value in 0.7, y, m? 0.7 Let v = -79151/45 + 1759. Let z = v + 29/180. Let g = -17/76 - 1/38. Which is the biggest value? (a) z (b) 0.2 (c) g a Let i = 4.56 + -3.8. Let q = i - 0.26. Let u = 2 - -1. Which is the third smallest value? (a) u (b) 1/7 (c) q a Let o = 16.95 - -0.05. Let m = -31 + o. Let h = m + 14.2. Which is the second smallest value? (a) h (b) 1 (c) -4 a Suppose 9d = 5d + 20. Let r = 32 - 35.2. Let i = r + 3. Which is the smallest value? (a) i (b) d (c) 2 a Let i = 8843/3 - 2989. Let n = i + 41. What is the third smallest value in 2, 0.2, n, -1/4? 0.2 Let i = 741.3 - 741. What is the smallest value in 0.6, i, -14? -14 Let l = 21.9 - 29.1. What is the second biggest value in l, 1/3, -3/4? -3/4 Let y = 8 - 4. Let i = -5098/5 + 1020. Which is the biggest value? (a) i (b) 0.3 (c) y c Let i = 88.4 - 93. Let f = -4.7 - i. Which is the third smallest value? (a) -24 (b) -0.4 (c) f c Let k = 0.3 + -2.3. Let p = -299.2 + 299. Which is the second biggest value? (a) -7 (b) p (c) k (d) 3 b Let s = -39.4 - -35.4. Which is the smallest value? (a) -3 (b) s (c) -39 (d) 0.4 c Let n be 62/(-84) - 5/14. Let t = 2 + -2.2. Which is the third smallest value? (a) t (b) n (c) 0.5 c Let o be -4215/24. Let f be 2/o(-50)/12. Which is the third biggest value? (a) 5 (b) -1 (c) f b Let h = -92.07 + 93. Let q = h + 1.07. What is the second biggest value in q, -2, 2/13, -0.1? 2/13 Let h = 57 + -50. Suppose 0y - 35 = hy. Which is the second biggest value? (a) y (b) 5 (c) -4 (d) 2 d Let f be 4/(-120)4621-5104. Let j = f - 785858. Let t = 328 - j. What is the second smallest value in t, -6, 0.1? t Let l = -683 + 687. Let n = 3 + -2. What is the third smallest value in l, 0.1, n? l Let d = 5 + -5.3. Let u = 0.2 + d. Let a be (4 + 5 - (-2403)/(-270))(-6 + 2). What is the biggest value in u, 2/7, a? 2/7 Let r = 73.06 + -0.06. Let s = 74 - r. Which is the second smallest value? (a) -4 (b) s (c) 0.07 c Let r = -196 - -196.5. Which is the third smallest value? (a) r (b) 1 (c) -1/5 (d) -23 a Let d be (-6)/(-8) + 6446/(-1320) - -4. Let a = 3.5 + -4. Let h = a + 0. What is the second smallest value in -0.4, h, d? -0.4 Let y(n) be the first derivative of n*2/2 - 3n - 1. Let u be y(5). Let o = -7 + 6. Which is the smallest value? (a) o (b) -0.3 (c) u a Suppose a = -6a - 294. Let v = a + 49. What is the third smallest value in -2/11, 2/3, v? v Let p = 0.233 - 2.613. Let o = p + -0.62. Let j = 1 + 1. What is the biggest value in j, o, -1? j Let o be (-4)/(-6)18/15. Let y = -2.5 - -3. Which is the third biggest value? (a) y (b) 3/4 (c) o a Let l be 3 - (-4 + (-36)/(-8))4. What is the second smallest value in -44, 0.2, l? 0.2 Let q = 1.9431 - -0.0569. Let j = 0.6 + -0.9. What is the third biggest value in j, -4, q, 1/4? j Suppose 0 = 4u + p - 20, 20 = 5u - u - p. What is the smallest value in 2, 0.11, u, 2/13? 0.11 Let t be (-12)/(1 + 3) + 59. Let q(m) = -57m + tm - 1 - 1. Let k be q(-2). What is the second smallest value in k, 1/3, -5? k Let f = 53 + -52. Which is the third smallest value? (a) -0.1 (b) -1 (c) -0.2 (d) f a Let r(y) = -y2 + 5y + 2. Let b be r(5). Let i = -8.31 - -8.91. What is the second smallest value in i, b, 2/3? 2/3 Suppose 4d = 4y + 4, 2y + 4 = -5d - 26. Let u = -160.7 + 161. Which is the second biggest value? (a) d (b) u (c) 1 b Suppose -10f + 40 = -5f. Let z be (8/(-18))/(f/12). Let s = -8 + 6. Which is the second biggest value? (a) z (b) 2 (c) s a Let h = 2614 - 2614.5. What is the biggest value in h, 3, 7? 7 Let z = -2460 - -597778/243. Which is the smallest value? (a) 1 (b) -0.5 (c) 0 (d) z b Let f = 233.95 + 2.05. Let u = f + -233. Let s = 2 - 1.7. What is the second biggest value in s, -3/17, u? s Suppose -54 = 2u - 108. Let r be 8/(-126) + 0 + (-6)/u. What is the third biggest value in -5, 1/4, r, -3? -3 Suppose -3v - 100 = -6v + y, -5v - 2y + 163 = 0. Let p = v + -30. Which is the third smallest value? (a) p (b) -1/2 (c) 0.3 a Let x = 7406.909 + -7398. Let z = -0.091 - x. Which is the second biggest value? (a) 0.1 (b) z (c) 0.4 a Suppose 5o + 8 = -3r, 2o = -5r - 8 + 20. Suppose 122 = -rz - 58. Let m be 10/z - (-56)/90. Which is the third biggest value? (a) -1 (b) m (c) -1/5 a Let y = -2044/5 - -409. Which is the second smallest value? (a) 4 (b) y (c) -1 (d) 3/5 b Let j = 83 + -82.41. Let k = 0.79 - j. What is the second biggest value in 1/6, -5, -4, k? 1/6 Let i = -2278 - -2281. Which is the third biggest value? (a) i (b) 11 (c) 2/11 (d) 0.4 d Let l = -0.7 + 0.2. Let z = 0.25 + 0.05. Let j = -450 + 449.6. What is the biggest value in z, j, l? z Suppose -2g = 2g - 20. Let h be ((-4)/10)/((-8)/g). Suppose f + 4c = -0c + 12, -4f = -2c - 30. What is the second smallest value in -1, f, h? h Let g = -5.6 - 0.9. Let c = -6 - g. Let b = -78 - -78. What is the smallest value in c, 0.02, b? b Let r = 1256 + -1256. What is the third biggest value in 5, -1/5, r, 17? r Let d = 291 + -170. Let k = 124 - d. Let v = 11 - 7. Which is the third smallest value? (a) k (b) v (c) -2/5 b Let c = -102.2 + 102. Let o = 3.7 + -4. What is the smallest value in c, -2, o? -2 Let y be (-4)/(-6)30/4. Suppose -7 = -2r + y. Let q be 3/((-5)/(15/r)). What is the third biggest value in q, -3, -4? -4 Let t = -91.4 + 91. Which is the smallest value? (a) t (b) -0.61 (c) -2/3 c Let o = 3213 + -3212. Let v = -27 + 44. Let k = -17.9 + v. Which is the smallest value? (a) k (b) 4 (c) o a Let u be (0/2 - 2) + 0. Let d be -1 + u + 25/7. Let k = 7 + -2. What is the third biggest value in k, -4/5, d? -4/5 Let l = 1335 - 20027/15. Let h = 0.3 - 7.3. Which is the second smallest value? (a) h (b) 5 (c) l c Let o = -20.2 + 15.2. Which is the third biggest value? (a) 3 (b) -3 (c) o c Let o be -2 - (15/(-6))/((-5)/(-20)). Let r be (-6)/24 + ((-30)/o - 0). What is the second smallest value in r, -1, -0.5, -0.14? -1 Let l = -225.3 - -225. What is the third smallest value in l, -8/7, -0.5? l Let s = 613 + -636. Let z be -1(2 - 1)0. Which is the smallest value? (a) -0.4 (b) s (c) z b Let h = -4 - -65. Let o = h - 56. Which is the third smallest value? (a) o (b) 0.5 (c) -3/17 a Let s = -22.4 + 22.9. Which is the smallest value? (a) -	{ "pile_set_name": "DM Mathematics" }
8l4 - 39209 wrt l? 146232l*3 Find the second derivative of -478391b*2t*2 + 13bt2 + 114bt - 5b - 2 wrt b. -956782t2 Find the first derivative of -7785u - 645574 wrt u. -7785 Differentiate 7d3 + 654d*2 - 3d + 354328. 21d2 + 1308d - 3 What is the second derivative of 1348983y2 - 669483y wrt y? 2697966 Find the third derivative of -76jm*3n + jm2n - 2jmn - 3j - m*3n - 935m3 - 33m*2n + 173m wrt m. -456jn - 6n - 5610 What is the second derivative of -97k2q*3u*2 - 2k*2q*2u - kq3u + 870kq*2u - 523q3u*2 wrt u? -194k*2q*3 - 1046q*3 What is the first derivative of 2103493n + 1667664? 2103493 What is the second derivative of -369z5 - 52z*4 + 47733z? -7380z3 - 624z*2 Find the third derivative of 638147h*4 - 65691h*2 - 3h wrt h. 15315528h Find the third derivative of -g6 + 4211g*5 + 2g3 + g2 - 183g - 11 wrt g. -120g*3 + 252660g*2 + 12 What is the third derivative of 26353u*3 - 24679u*2? 158118 Differentiate 2i*2r*2u - 926610i2r - 2ir2 - r2u + ru - 47485u wrt u. 2i*2r2 - r2 + r - 47485 What is the derivative of -58266jn - 6077j + 5n*4 + 49 wrt n? -58266j + 20n3 Find the second derivative of 38721n*4 - 2n*3 - 14775n - 1. 464652n2 - 12n What is the third derivative of 78071s3z*2 - 4s*2 + 46735sz2 wrt s? 468426z*2 Find the second derivative of 3m*3z*2 - 158m*3z - 1821mz*2 + 63mz wrt z. 6m*3 - 3642m Find the second derivative of 7928a5 - 25a*4 + a - 277100. 158560a*3 - 300a*2 Find the third derivative of -1215s*3w*3 - 401s*3w2 - s3 + 6s2w*2 - 13sw4 - 2sw3 + s wrt w. -7290s*3 - 312sw - 12s Find the second derivative of 9o2y*2 + 1151o*2y - 4o2 - 4oy2 + 10o - 3y2 + 2y - 55 wrt o. 18y2 + 2302y - 8 Find the third derivative of 1200605t3u*2 - 3t*2u*2 + 2t*2 + 32tu - 156u*2 wrt t. 7203630u*2 What is the third derivative of 10hn3 - 2hn2 - 3hn - 15903h - 6459n4 + 2n*2 wrt n? 60h - 155016n Find the third derivative of -4i*2uw3 + 3i*2u + 340iuw3 - 4016iuw*2 + uw*2 - 12w*4 - 4 wrt w. -24i*2u + 2040iu - 288w Differentiate 1668071b*2 + 592122 wrt b. 3336142b Find the second derivative of -1911gs*2w + gs2 - 7432gsw + gs - s2w - 2sw - 2w wrt s. -3822gw + 2g - 2w Find the second derivative of -5607k*5 - 4k*2 - 1651k. -112140k3 - 8 What is the first derivative of -5000n*3 + 5n + 901846 wrt n? -15000n2 + 5 Find the third derivative of ah*3q - ah3 - 3654ah2 - 19799h*3q + 2h3 + 102hq wrt h. 6aq - 6a - 118794q + 12 What is the second derivative of -4n*4p*3 - 1336n*4 - 43421np3 + 2 wrt n? -48n*2p*3 - 16032n*2 What is the second derivative of 5fx2 + 393fx - 3f - 9692x4 - 2x*3 - 3x - 2 wrt x? 10f - 116304x*2 - 12x Find the third derivative of -12b2p*3 + 26b*2p*2 + 17b*2p - 2bp*4 - 491p*3 - 15p wrt p. -72b2 - 48bp - 2946 Find the second derivative of -24i*2j*2 - 36i*2jky + 2i2k - i*2y - 399j2ky + jy + ky + 3 wrt j. -48i*2 - 798ky What is the second derivative of -151966q*5 - 69880q wrt q? -3039320q3 What is the second derivative of -2111865h*3 - 597636h? -12671190h Find the second derivative of 127z*3 - 7239z*2 - 5557488z wrt z. 762z - 14478 What is the second derivative of 527106l*3 - 619128l? 3162636l Differentiate 234739rs2 + 171s*2 - 11 with respect to r. 234739s*2 Find the first derivative of -15588y*3 - 55012. -46764y*2 What is the second derivative of 58f*5 + 2f*4 - 97f*3 + 106625f? 1160f3 + 24f*2 - 582f What is the second derivative of -841i4 + 5i*3 - 3i*2 + 30i - 328 wrt i? -10092i2 + 30i - 6 What is the third derivative of -313n5 + 241n4 + n2 + 48972n + 1 wrt n? -18780n*2 + 5784n What is the second derivative of -5o5 + 81o*4 + 435o*3 + 486481o wrt o? -100o3 + 972o*2 + 2610o Differentiate -87311p3 - 188666 wrt p. -261933p*2 What is the third derivative of -4100n*5 - 2992n*2 + 3n - 3 wrt n? -246000n2 Find the third derivative of 38272uw3y*3 - 2uw3 + 5uw2 + w3y + 463w2y + y*3 wrt w. 229632uy3 - 12u + 6y Differentiate -ghu - gh + gu - 1713hu - h - 7420u wrt h. -gu - g - 1713u - 1 Differentiate 48g3 - 215g + 23506 with respect to g. 144g2 - 215 Find the third derivative of -3v*6 + 242v*5 + 3v*3 + 382v*2 + 48 wrt v. -360v*3 + 14520v*2 + 18 What is the second derivative of 25w4 - w3 - 134w2 - 214w + 357 wrt w? 300w2 - 6w - 268 What is the third derivative of -1369c3k*3l*3 - 10c*3kl2 - 5c*3kl - 79c*2k*3l*2 - 3ck - 2k*2l*2 + 4kl3 - 25l*3 wrt l? -8214c*3k*3 + 24k - 150 Find the second derivative of -1449529t2 + 54768t wrt t. -2899058 What is the derivative of 3a4 + 3357a + 10024? 12a3 + 3357 Find the first derivative of 2ai4 - 695ai2 - 5ait*3 - 2at3 + 2at - 9911 wrt i. 8ai3 - 1390ai - 5at3 Find the second derivative of -c3x + 1177c2x + 2cx - 9c + 2x + 3 wrt c. -6cx + 2354x What is the second derivative of -1753c*2w*2 - 411c*2 - 59cw2 + 2cw + 7c - 3w + 15 wrt c? -3506w*2 - 822 What is the second derivative of -29761d*4 + 41931d wrt d? -357132d2 Differentiate -5380c*3wz3 - 2c*3w - 1013c3 + 4c*2z*3 with respect to w. -5380c*3z*3 - 2c*3 Find the second derivative of 5012t*3 - 8t*2 + 559159t wrt t. 30072t - 16 What is the second derivative of 8g*4 - 10802g*3 + 6g*2 + 3959g - 26 wrt g? 96g2 - 64812g + 12 What is the second derivative of -o*2r*3 - 115o*2r + 25799or*3 + 15o + 1 wrt r? -6o2r + 154794or Find the second derivative of 5j5 + 2449j*3 + 39j - 380 wrt j. 100j3 + 14694j What is the third derivative of 683z5 - 65z*3 + 674133z*2 wrt z? 40980z*2 - 390 What is the second derivative of -3p*4 - 7572p*3 - 5p - 1635 wrt p? -36p2 - 45432p Find the second derivative of 22043u2 - 29666u. 44086 What is the second derivative of -95918kq*2 - 88678kq wrt q? -191836k Find the third derivative of 4q5 + 81283q*4 - 2q*3 - 1120831q*2. 240q*2 + 1950792q - 12 What is the third derivative of 1609g2h*3 + 2g*2h*2 + 255g*2h - g*2 + 20gh3 - 135g - 6h3 wrt h? 9654g*2 + 120g - 36 What is the second derivative of 3m3 + 20648m*2 + 8m + 2542 wrt m? 18m + 41296 Find the second derivative of -22y4 + y3 + 182y2 - 1335y - 3 wrt y. -264y2 + 6y + 364 Find the second derivative of 14r2w*2 - 180r*2wx + r2 - 4722rw2x + rwx - 4rx + 3r + w2 wrt w. 28r*2 - 9444rx + 2 Find the second derivative of -28094k*2 - 13k + 535. -56188 Differentiate -2i2 + 7627i - 162184 wrt i. -4i + 7627 What is the second derivative of -2291521l*3u*2 + 3l*3 + 311401l*2u wrt u? -4583042l3 What is the second derivative of -26243b*2 + 28090b - 2 wrt b? -52486 What is the second derivative of -105a3x*3 + 1664a*3x*2 + 57a*3x + 11a2x + 62ax wrt x? -630a3x + 3328a3 Differentiate -10ab2 + 2ab - 230112a - 652b2 wrt b. -20ab + 2a - 1304b What is the first derivative of -575d*2l + 135dl + 4l - 2085 wrt d? -1150dl + 135l Differentiate -149696m3 + 446932. -449088m*2 What is the third derivative of 7m*5 - 18060m*3 + 126m*2 + 2m - 79? 420m2 - 108360 Find the second derivative of 88866z*2 + 51419z wrt z. 177732 What is the third derivative of 944272d6 - 2d5 - d2 + 400683d wrt d? 113312640d*3 - 120d*2 What is the first derivative of 28998v*4 - 16v*3 + 2505339 wrt v? 115992v*3 - 48v*2 Find the second derivative of -324366d*5g*2 + 2dg2 - dg - 35073d - g2 wrt d. -6487320d*3g*2 What is the third derivative of -2cd6 - 4cd2 + 4cd + d6 + 2922d*3 - 4d*2 + 2d wrt d? -240cd*3 + 120d*3 + 17532 What is the third derivative of -338428i*3 - 280330i*2 - i wrt i? -2030568 Find the first derivative of -3j*2 - 10397jr + 2r - 5848	{ "pile_set_name": "DM Mathematics" }
= 2t, -4t + m = 15 for t. -4 Solve 53q - 56q = -2u + 22, -3q + 3 = 3u for u. 5 Solve -a = 14u - 15u, -5a + 2u = -12 for a. 4 Solve 2i = 4r - 8r - 4, 0 = 4i + 3r - 7 for i. 4 Solve 25 = -5c, -3i - 23c = -28c - 16 for i. -3 Solve -o + 8 = 3g, -6g + 4g = -4 for o. 2 Solve n + 0n + 2y = 0, -y - 22 = -5n for n. 4 Solve 20 = 5h - 2v - 0v, 0 = -3h + 4v + 26 for h. 2 Solve -2c + 6c + 4 = p, -2p - 4c + 8 = 0 for p. 4 Solve -5o - m = 20, 2o + 10 = m - 5 for o. -5 Solve 0 = -2i - 8, 8l - 3l + 2i + 33 = 0 for l. -5 Solve -11x - 40 = -3x, 3x + 35 = -4p for p. -5 Solve 0 = -5w + 3p + 19, 2w - w + 19 = -7p for w. 2 Solve 5f = -u + 5, -4f + 2 = -6 for u. -5 Solve 4o = 2x + 20, 3x + 19 - 5 = 2o for o. 4 Solve -2z + 6 = -2n, 0n - n = 3z - 9 for n. 0 Solve 3y + 5 - 20 = 0, 2y - 15 = 5f for f. -1 Solve -3t - 7 = v, 3v = -6t + 11t - 7 for v. -4 Solve 4f - a + 2 = -3, -5a = -5f - 10 for f. -1 Solve -s + 3i = 14, 3s = i - 3 - 15 for s. -5 Solve c + 4v - 4 = 12, 0 = -c + 5v - 20 for c. 0 Solve 0 = -5f + 4j - 15 - 16, 4j - 16 = 0 for f. -3 Solve -5u - 10 = 0, 0y - 2y + 4u = -8 for y. 0 Solve -2p + 2z + 14 = 0, -308z + 304z = 16 for p. 3 Solve -5x = -6p + 7p + 7, x - 5p = -17 for x. -2 Solve 3v + 0 = c + 1, -5c - 22 = 2v for c. -4 Solve 5r + 5p - 40 = 0, -5r + 7r = -p + 12 for r. 4 Solve 0 = 22g - 27g - 2m - 8, -4m = 4g + 16 for g. 0 Solve 61t - 62t = 5m + 4, 5m - t = 4 for m. 0 Solve -w = 2q + 3, 12 = -4q + 130w - 134w for q. 0 Solve -5 = -5v + 3l, 5l + 31 = 5v + 36 for v. 4 Solve r - 4c + 17 = 0, 7r - 5c = 3r - 35 for r. -5 Solve 25 = -4v - 6q + 5q, 0 = v - 3q - 10 for v. -5 Solve -5z - 2f = -9 + 1, -3z - 8 = -2f for z. 0 Solve 25x - 18x + 1 = -5o, 4x + 3o = 0 for x. -3 Solve 0 = -5r + 4q + 3, -3r - 7q = -3q + 11 for r. -1 Solve -3y = -2k + 13, 2y + 8 = 4k - 3k for k. 2 Solve -8z = -10z - d - 11, 4d = -3z - 29 for z. -3 Solve -u = -3r - 1, 0 = 5r + 3 + 7 for u. -5 Solve 0 = -2d - 3s + 1, -d - 7 + 6 = 3s for d. 2 Solve -4q - 3x - 3 = 0, 5q - 28x = -29x - 12 for q. -3 Solve i + 3i = -2t - 10, 2t + 5i = -11 for t. -3 Solve -3p + 0 = -3, 3u + 4p - 1 = 0 for u. -1 Solve 2d - 4k = 6 - 26, 3d - 3k + 21 = 0 for d. -4 Solve -5c - 5r = 30, -2c + r = c + 14 for c. -5 Solve 3m = l - 18, -m - 2l - l = -4 for m. -5 Solve 21b - 1 = 20b, 3b - 1 = u for u. 2 Solve 10k - 9k + 2 = g, -5k = 5g + 20 for k. -3 Solve 0 = 2c, 0 = -y + 20c - 23c - 3 for y. -3 Solve 0 = -2z - 2n + 18, 3z = -5n + 28 + 9 for z. 4 Solve c = -3u - 10, 0 = 21c - 25c - u + 4 for c. 2 Solve -4 = 3k + k, 4i = -5k - 17 for i. -3 Solve 4m + 19 = 10o - 11o, 5o = 4m + 1 for m. -4 Solve -2j + 9 = k, -3k = -j - 13 - 0 for j. 2 Solve 0 - 1 = -4u + 3m, 2u - 2m = 0 for u. 1 Solve -2i - 4 = 2o, 4i + 12 = -i - 4o for i. -4 Solve -5p + 4p + 20 = -5y, 5p - y + 20 = 0 for p. -5 Solve 29 = -5j - 4n - 11, -10 = 2n for j. -4 Solve -151 + 139 = -2n, -5u - 3n + 8 = 0 for u. -2 Solve 0 = 5g, -13 = 2n + 5g - 7 for n. -3 Solve -4l + 2p + 6 = 0, -6 = 2l - 0l + 2p for l. 0 Solve 5n = 4m + 10n + 18, 5n - 10 = 0 for m. -7 Solve o = x, 20 = 5o - 5x + 4x for o. 5 Solve 0 = 3z + 6, 0 = 2m - 11z + 10z + 8 for m. -5 Solve -1 = 5g - 2w, 0 = 4g - 3w - w - 4 for g. -1 Solve -l + 12 = 4m, 2m = 6l - 2l + 24 for m. 4 Solve 5n = 5i - 0i - 10, 3i - 4n = 3 for i. 5 Solve -4r - 2 = q, -13q = -9q + 8 for r. 0 Solve -1 - 18 = -3j + 4r, 3r + 11 = -j for j. 1 Solve -119z - 2k + 12 = -123z, 4z - k + 16 = 0 for z. -5 Solve -4z + 16 = -n, -2z - 15n + 8 = -20n for z. 4 Solve -2 = 2d - m, -3d + 36 = 2m + 3m for d. 2 Solve -3s - 15 = -5r, -4r + 7r + 2s = -10 for r. 0 Solve 4k = -2n + 12, 5n + 0n = 4k - 26 for k. 4 Solve -32 = 5n + 3o, -5o = 3n + 58 - 26 for n. -4 Solve -26u - 3l - 20 = -22u, 3u - 3l = -15 for u. -5 Solve -9 = 3n - j, -2j = -4n - j - 11 for n. -2 Solve 2m = -1 - 1, -n + 3 = -2m for n. 1 Solve 0 = -3t + 3b, 4t - 7 = 2t - 5b for t. 1 Solve -4w - 2v = v + 18, -4v = -w + 5 for w. -3 Solve 3i - 15 = -2f, 0 = -5i - f + 3f + 25 for i. 5 Solve 5k - j = -28, -2k - j = -4k - 13 for k. -5 Solve -3h = k, 0k + 3k = -5h - 4 for k. -3 Solve -6i = -10i - 2p + 4, 4i = 3p + 34 for i. 4 Solve -5u + 2o - 4o = 10, 4u + 4o + 8 = 0 for u. -2 Solve 2y + 19 = 13, 0 = -4q + y - 17 for q. -5 Solve -4q = -4m + 8, -m + 2q = -4m + 1 for m. 1 Solve 5l - 5a - 5 = 0, 3l = 122a - 117a + 1 for l. 2 Solve 3z + 32 = -4w, 14z - 9z + 3w + 35 = 0 for z. -4 Solve -3b - 7 = -4t, -7b - 2 = -9b - 4t for b. -1 Solve 5a + d + d = 28, 0 = -2a - d + 12 for a. 4 Solve -4m + 5x - 6 = 7x, 4x = -4m - 8 for m. -1 Solve 14 = -4g + 3q - 8q, 4g = -3q - 10 for g. -1 Solve m + 3c + 4 = 1, 0 = -m - c - 3 for m. -3 Solve -30l + 15 = -j - 35l, 12 = -3l for j. 5 Solve 0 = o - 3z + 7, 480z - 485z = -2o - 9 for o. 8 Solve -8s + 5 = 2o - 7s, -4o + 35 = -3s for o. 5 Solve r = 3z - 10, -3z = -25r + 28r - 6 for r. -1 Solve -4v - 5c = -27, v + 5c = 16 + 2 for v. 3 Solve -2z + 6 = 0, 5y + z + 3 = 3y for y. -3 Solve -f - f + 14 = -2u, f = 2u + 11 for u. -4 Solve 0 = 3f - 3, 5w + 40 = -f + 56 for w. 3 Solve 0 = 5t - 2p - 5, 6t - 5 = t - 4p for t. 1 Solve 2 = g - 0g + 2a, g - 3a = -13 for g. -4 Solve 3m + 20 = 22p - 27p, 0 = 2m for p. -4 Solve -2y = -l - 2, 5y = 4l + 21 - 10 for l. -4 Solve -12 = -4g - 2f, 0 = -4g - 0g - f + 10 for g. 2 Solve 2p = 4z - 14, -219z + 220z - 5 = 2p for z. 3 Solve u = -2m - 1, -28u - 4 = -27u + 3m for u. 5 Solve 3 = 3p - 3l, -4l = -3p + 22 - 16 for p. -2 Solve -4c - 4n - 2 = -3n, -c = 2n + 4 for c. 0 Solve 3q = -3l + 6, -15q + 3l - 6 = -11q for q. 0 Solve -2v - 6 = 4, 0 = g - 5v - 27 for g. 2 Solve 3o - 8 = -3i - i, -4o - 4i + 8 = 0 for o. 0 Solve 2g - 20 = -32s + 30s, 4s + 5g = 45 for s. 5 Solve 4g = -3v + 4, 5g - 5 = v - 3v for g. 1 Solve a - 35h = -31h - 18, -a + 3h = 14 for a. -2 Solve 0d + 5y - 11 = d, -27 = -3d - 5y for d. 4 Solve 6u = 3g + 3u - 15, g + 4u = -15 for g. 1 Solve 0w + 8 = -w + 2u, 8 = 2w + 4u for w. -2 Solve 2v + 3v + 5t = 5, -4t = 3v for v. 4 Solve 7 + 2 = 3u + 3f, -3u = 5f - 5 for u. 5 Solve -4y + 2v + 3 + 1 = 0, 0 = -4y + v + 4 for y. 1 Solve 0 - 5 = o + 2p, -16 = 4o + 4p for o. -3 Solve 0 = 2q + 2q + 16, 5l = -5q - 45 for l. -5 Solve 17c = -2z + 16c + 14, 2z + 2c - 18 = 0 for z. 5 Solve 0 = -2n - 3t + 8, -227t = -2n - 229t + 4 for n. -2 Solve 3 = 3n + 3j, 0 = -2n - 5j + 8 - 9 for n. 2 Solve 2i = n + 4n - 10, 4n = 8 for i. 0 Solve 0 = v - h, 0 = -3v + v - 2h - 8 for v. -2 Solve -5p = 5u - 4 - 21, u - 5p + 19 = 0 for u. 1 Solve -3a + 9d = 4d - 8, -a - 2 = 3d for a. 1 Solve -2y - 4n + 10 = 0, -2y + 0y = n - 4 for y. 1 Solve n + i = -0n + 2, -2n - 26 = -4i for n. -3 Solve -17d = -13d + 5t + 11, -3d = 4t + 9 for d. 1 Solve 0 = -2v - 13 + 5, 4p - 3v - 28 = 0 for p. 4 Solve 0l - 2l = 5y, 3y = 6 for l. -5 Solve 0 = -g - 2c - 13, -2c = 2g + 6 + 10 for g. -3 Solve 3x - 4 = 5j, -2j = -5x - 9 + 3 for x. -2 Solve x - 11 = -5t, 19x - t + 7 = 24x for x. 1 Solve 2r + 0l = l + 2, 2r = -4l + 2 for r. 1 Solve t + 3a = 10, -a = -0a - 4 for t. -2 Solve 2a + 2a = 4z + 28, 5z - 3a + 25 = 0 for z. -2 Solve 0 = -11d + 13d + 2n - 12, 3d - 2n + 7 = 0 for d. 1 Solve w - 25 = p - 22, w = -2p - 12 for p. -5 Solve 0 = 4i - 3w + 17, w + 21 = 54i - 58i for i. -5 Solve 14 = 3w + 5g, 4w - 3g = 2g - 28 for w. -2 Solve 0c - k = 2c - 8, -5c - 4k = -26 for c. 2 Solve 0 = -5g - 26q + 30q + 21, -3g + 4q = -19 for g. 1 Solve 0 = 2n + 2l - 4, 24 = -5l + 19 for n. 3 Solve -5k - 33 = 4m - 14, -11 = 5k - 4m for k. -3 Solve -3z = -1167r + 1163r - 19, 5z - r = 26 for z. 5 Solve 2j - 4g = -0j, 3g = -5j + 13 for j. 2 Solve 3s = -5t - 8 + 31, 0 = -2s + 3t - 10 for s. 1 Solve 2d = 5m - 2 + 20, 5m + 2 = -2d for d. 4 Solve 2o - 4d - 18 = 0, -2o - 2d + 0d = 0 for o. 3 Solve 2c = 0, 2g = 7g - 4c + 20 for g. -4 Solve -5x + 5p + 5 = 0, 14x -	{ "pile_set_name": "DM Mathematics" }
s? q Let w = -0.12 - -0.05. Let n = w + -0.33. What is the second biggest value in 1, -1, n? n Let m = -36 - -34. Which is the third biggest value? (a) 0.4 (b) m (c) 2 b Let m = 61 - 108. Let n = -48.96 - m. Let i = -0.04 + n. Which is the smallest value? (a) i (b) -2/17 (c) 0.1 a Let f(r) = -r2 + r - 2. Let u be f(0). Let g = 308 - 313. Which is the second biggest value? (a) 4 (b) u (c) g b Let w = -0.507 - -0.107. What is the smallest value in -5/4, 1, w, 3/7? -5/4 Let o(m) = -m3 + m*2 + 2m - 2. Let u be o(2). Let h be 1 + 2 + 0 + u. Let v = 9 - 13. What is the biggest value in -1/6, v, h? h Let n = 0.5 + 14.5. Let o = n + -10. Which is the biggest value? (a) -5 (b) o (c) 7 c Let q be ((-285)/(-18))/(-5) + 3. Let t = -16 + 15.7. Which is the smallest value? (a) t (b) 0.4 (c) q a Let k = 31.05 - 31. Which is the third biggest value? (a) -0.5 (b) k (c) 0.3 a Suppose -27s + 8 = -31s. Which is the third smallest value? (a) -11 (b) s (c) 2 c Suppose 1 - 6 = -5p. Let s be (-4)/3(-2)/(-4). Let y = 0 - 0. Which is the smallest value? (a) y (b) p (c) s c Suppose 2j - 10 = -3j. Let f = -42 - -39. Which is the smallest value? (a) -5/2 (b) j (c) f c Suppose -4 = -3v + 5. Suppose -vm + m + 8 = 0. Let i be 0/2 + 2 - m. Which is the smallest value? (a) 2/5 (b) i (c) 2/3 b Let h = -61 + 56. Which is the biggest value? (a) 1 (b) -0.2 (c) h a Let q = 87 + -83. Which is the smallest value? (a) -1 (b) -4 (c) -0.1 (d) q b Let r be -2 - (48/20 - (-2 - -6)). Let x = 0.9 + 3.1. Which is the third smallest value? (a) 1 (b) r (c) x c Let v = 6 + -5. Let k be (-2)/10(-3 + v). What is the third smallest value in k, -1/3, 1/6? k Let r = -34.4 + 34. What is the second smallest value in 1, r, 4, -4? r Let d = -4.4 + 0.4. Let r(j) = -j2 + 8j - 2. Let o be r(7). Suppose -2 - 3 = -ou. Which is the second smallest value? (a) 2/5 (b) d (c) u a Let d = 12.9 + -12.9. What is the second smallest value in -0.01, d, -1? -0.01 Let k = 0.13 + -5.13. Let g be 0/(0 + 2 + -3). Which is the smallest value? (a) g (b) -1 (c) k c Let p = 346 + -1726/5. Let f be 0 + (1 - 0) + -2. Let j be ((-5)/1 - 0)/f. What is the second smallest value in -4, j, p? p Let x be -3 - (-2 + (-2)/(-6)-1). Which is the biggest value? (a) -2 (b) x (c) 2 c Let v = 15 - 15. Let h = 18 - 8. Let k = h + -5. Which is the smallest value? (a) -3 (b) v (c) k a Let k = -147.07 - -152. Let m = k + 0.07. Let q = 5.3 - m. Which is the third biggest value? (a) 1 (b) q (c) -4 c Let c = -5 + 1. What is the third smallest value in 2/7, 5, c? 5 Let z = 0.84 + -0.04. Let r = z - 0.5. Which is the smallest value? (a) 3/7 (b) r (c) -3 c Suppose -9 = 3c, 0 = 2n - 2c + 4 - 18. What is the smallest value in 1, 26, 4/3, n? 1 Let j(m) = -m2 - 4m - 5. Let v be j(-4). Let u = -9 - -9.4. Which is the third smallest value? (a) u (b) v (c) 4 c Suppose 5d - 2w = 43, -5w = -3d + 4d + 13. Let l be d/5 - (4 - 2). Which is the second biggest value? (a) 0.3 (b) l (c) 5 a Let k = 133 + -63. Let o = k - 206/3. What is the second smallest value in o, 0, 2/5? 2/5 Let i be (0 - 4/(-20)) + 0. Let f = -6 + 4. Which is the third smallest value? (a) i (b) -4 (c) f a Suppose 0x + 15 = 5x - w, x - 9 = -w. Suppose xg - i = 2i - 9, -3i = 2g + 9. Which is the biggest value? (a) -4/5 (b) 2 (c) g b Suppose 3r = y - 2, 4r + y + 5 = 14. Let d = -78 - -80.06. Let f = d + -0.06. What is the second biggest value in f, -0.3, r? r Let z = 0.26 - -0.04. Let n(i) = i3 - 5i*2 - 7i + 4. Let m be n(6). What is the third biggest value in -0.2, z, m? m Let t be (7/(-70))/(4/(-50)). Which is the smallest value? (a) t (b) 0.4 (c) 4 (d) -0.4 d Let z = 0.105 - 21.505. Let t = z + 21. What is the second biggest value in t, 1, -5? t Let d = -2 - -1.8. Let s = -10 - -4. Let f be ((-3)/(9/s))/(-15). What is the biggest value in -1/8, d, f? -1/8 Let r = -0.13 - 0.27. Let d = -16/21 + 3/7. Which is the third smallest value? (a) r (b) 2/9 (c) d b Let h = 29 + -33. What is the smallest value in 2, 0.1, h? h Let p = 7 - 9. What is the third smallest value in p, 3, 0? 3 Let s = 149 + -59. Suppose 0 = -f - 3f - 12, -n + s = -2f. Let t be (-15)/n - (-1)/(-4). What is the second smallest value in -4, t, -5? -4 Let s = -2269/28675 - 1/1147. What is the third biggest value in 0.2, -0.4, s? -0.4 Let j = 7 - 12. Which is the smallest value? (a) j (b) 0.1 (c) 3 a Let m(p) = -2p + 4. Let u be m(-4). Let o be (1/(-7))/(u/(-14)). Which is the third smallest value? (a) o (b) 1/2 (c) -2 b Let c = 16/17 - 114/85. What is the smallest value in -4/3, c, 2, 3/5? -4/3 Let z = 53/2 + -25. Let v = 1 + -2. Which is the second smallest value? (a) v (b) 0.5 (c) z b Let j(s) = s + 1. Let y be j(-1). Let r be y/(-62/(-4)). Which is the third biggest value? (a) -0.3 (b) -3 (c) r b Let d = -2 - -2.1. What is the second biggest value in 1, d, -3? d Let s = -163.4 + 163. What is the biggest value in s, -0.1, -2/93? -2/93 Let u = 0.08 - 3.08. Let w = -3.54 - -0.34. Let r = w - u. Which is the third biggest value? (a) r (b) -2/3 (c) 0.2 b Let w = 7.5 + -8. Let f be ((-9)/(-12))/((-2)/8). Which is the second biggest value? (a) w (b) 1 (c) f a Let d = -209 + 208.5. Suppose -4g - 3 = 2c + 27, -5c = 25. What is the third smallest value in d, -1, g? d Let v = -28 - -28.31. Let f = -0.09 - v. What is the second smallest value in -0.3, -1, f? f Let z = 4 + -4.06. Let k = z + 0.06. What is the third smallest value in k, 0.4, -2/7? 0.4 Let y = -0.948 - 0.052. What is the smallest value in 2, y, 5? y Let y = -0.15 - -0.15. Let k = -0.4 + 0.7. What is the third biggest value in y, -0.3, k? -0.3 Let m = -8.5 - -8.2. What is the third biggest value in 4, m, -1? -1 Let z = 11.92 - 12. Let w = z - 0.22. What is the third smallest value in 1, -1/7, w? 1 Suppose -k - 11 = -5o + 10, -o - 1 = 5k. Let j(v) = 6v2 + 5 - 1 - v3 + 5v + 5. Let w be j(7). Which is the second smallest value? (a) w (b) o (c) 0.1 c Let w = 3 + 0. Suppose -7 = -3n + x + 6, 4n = 3x + 24. Suppose j = nj + 4. What is the biggest value in w, j, 1/6? w Let s = 2.6 - 3.1. What is the second smallest value in -2/3, 3/4, s? s Let d = -80618 - -11689663/145. Let r = -1/29 - d. Let t = -0.07 + -0.03. What is the biggest value in r, -3/5, t? t Let b = -2.8 + 3. Let z = 13/6 + -11/6. What is the third biggest value in b, -2, z? -2 Let r = 0 + 0. Let p(f) = 5f - 18. Let b be p(4). What is the biggest value in b, -2, r? b Let d = -110 - -548/5. Let z = -1 - 1. Let s be -1 + 2 - (-1)/z. Which is the biggest value? (a) s (b) 0.2 (c) d a Let u = -3.91 - -0.91. What is the third biggest value in -1, -2/21, u, -4? u Let q = 0.04 - -1.96. Let f = -2.2 - -2.5. Which is the third biggest value? (a) -0.5 (b) f (c) q a Let k(s) = s*2 + 5s - 8. Let c be k(-6). Let m(g) = g + 2. Let z be m(c). What is the third biggest value in -2, -0.3, z? -2 Let x = -0.1 + -0.4. Suppose 3h - 41 = 1. Let q = -59/4 + h. What is the third smallest value in -2, q, x? x Let u be 1 + -3 + 28/12. Let r be 3/(-4)(-1 - -5). Which is the second biggest value? (a) -5 (b) u (c) r c Let f = -0.068 + 0.268. Which is the third smallest value? (a) f (b) -19 (c) -2/9 a Let k = 1179/11 + -107. Which is the third smallest value? (a) 1 (b) -2/15 (c) k a Let k = 3 + -3.2. Let x = k - -0.4. Let d be (3(-1)/7)/1. What is the third biggest value in x, d, 1? d Let i = 2742 + -63055/23. Let z = 262/115 - i. Let g = z + -17/15. Which is the second smallest value? (a) 5 (b) g (c) -0.2 b Let p = 0.4 - 0.49. What is the biggest value in -0.3, -0.1, p? p Let a = 0.026 - 3.726. Let k = 4 + a. What is the biggest value in -2/15, 0, k? k Let y = 0.14 + -0.64. Let n(f) = f2 + 5f - 10. Let q be n(-7). Which is the biggest value? (a) q (b) 0.5 (c) y a Let d = 9 + -7. Suppose 7x - 2x = 55. Let n = x - 43/4. What is the third smallest value in n, -0.4, d? d Let q = -30.2 + 26. Let o = q - 0.8. Which is the smallest value? (a) -0.3 (b) -2/5 (c) o c Let u = 1.4 - -0.6. Which is the second biggest value? (a) 0.2 (b) u (c) -1 a Let q = 18 + -18.2. What is the second smallest value in 0.2, -5, 0.4, q? q Let f(s) = -s*3 + 8s*2 + 10s + 3. Let v be	{ "pile_set_name": "DM Mathematics" }
et b(s) = -2s3 + 2s*2 + s + 1. Let l be b(k). Calculate x(l). -7 Let h(x) = x - 4. Let m(g) = -2g + 7. Let p(j) = -7h(j) - 4m(j). Give p(-6). -6 Let b(f) = -5f2 + f - 5. Let r(c) = -3c*2 - 3. Let v(d) = 4b(d) - 7r(d). Calculate v(-3). -2 Let d = -6 - -8. Let j(s) = -4s*d + 2 - 1 + s - s. What is j(1)? -3 Suppose 0 = -3y - 2w, -4y + 1 - 24 = -5w. Let v(m) = -3m - m + 1 + 8m - 2m. What is v(y)? -3 Let u(g) = g*3 - g - 4. Let c be (1/3)/(1/9). Suppose 0 = -d + cd. What is u(d)? -4 Let g(c) = -2 + 2c - 1 - 3c - 4. Let r = 13 - 19. Give g(r). -1 Let j be 1(-1)/((-1 - 3) + 3). Let k(b) = 11b + 1. What is k(j)? 12 Let z be (6/(-8))/((-27)/6). Let c(l) be the second derivative of -l - 1/12l4 + 0 + zl*3 + 2l*2. Give c(-3). -8 Let k be 2 + -6 + (-1 - -3). Let c(o) = -2o - 3. Let i(h) = -2h - 4. Let s(t) = 3c(t) - 2i(t). Calculate s(k). 3 Let i(r) = 0r + r - 304 - 3r + 307 + r2. Give i(3). 6 Let q(n) be the third derivative of -n6/360 + n5/24 - n4/24 + 2n*3/3 - 3n*2. Let r(o) be the first derivative of q(o). Calculate r(5). -1 Suppose 8 = -11l + 13l. Let h(t) = -t2 + 3t - 6. Calculate h(l). -10 Suppose -2n = 2n - 108. Let q(v) = -4v2 + 6v + 3v2 + n - 30. Give q(4). 5 Let h = 12 + -11. Let p(r) = -14r*3 + 2r2 - 1. Calculate p(h). -13 Let m(b) = -b2 + 7b - 7. Let x be -4(-2 + (-15)/(-20)). Calculate m(x). 3 Let j(c) = c*3 + c - 3. Suppose -2s = 3s. Calculate j(s). -3 Let g be 2/8 + 34/(-8). Suppose -5h = -5u + 20, -3u + 0u - 2h + 17 = 0. Let y(b) = -3b - ub2 + b3 + 0b2 + 5 - 2b*3. Give y(g). 1 Let c(x) = -2x + 3. Let k(d) = d. Let i(m) = 4m - 9. Let l(z) = i(z) - 3k(z). Let n be l(11). Calculate c(n). -1 Let b(d) = -d*3 + 11d*2 - 10d - 5. Let i(k) = k*2 + 3k. Let g be i(-5). Let q be b(g). Let s(f) = -f*2 - 5f - 1. Give s(q). -1 Let u(o) be the first derivative of o*4/4 + 4o*3/3 - 3o*2 - 3o + 1. Let i(y) = y*3 - 4y*2 + y - 4. Let h be i(3). Let n = 5 + h. Give u(n). 2 Let v be 15((-36)/(-15))/2. Suppose 0 = 3j + 3 - v. Let i(w) = -1 + 4w + 2w - jw + w*2. Give i(1). 1 Let m(l) = -5 + 3l + 8 + 5l + 7 + l2. Give m(-7). 3 Let f(l) = -l - 6l*2 - 2l*2 - 2 - 5l + 9l2. Calculate f(6). -2 Let r(q) = -1 + 2q - 3q - 5. Let b(g) = g3 + g2 + 3g + 4. Let o be b(-2). What is r(o)? 0 Let y(q) = 2q + 2q + 5 + 7q. Let r(l) = -34l - 21. Let z(f) = 51f + 31. Let c(d) = -7r(d) - 5z(d). Let t(p) = -5c(p) - 8y(p). Calculate t(1). -3 Suppose 0 = 92q - 91q. Let x(r) be the second derivative of r3/6 + 5r*2/2 - 2r. Calculate x(q). 5 Let x be ((-9)/5)/(2/((-40)/6)). Let u(j) = -j*3 + 5j*2 + 5j + 8. Calculate u(x). 2 Suppose -v - 25 = -5x - 8, -5v = 5x - 35. Let p(s) = -s + 1. Determine p(x). -3 Let m(p) be the first derivative of -p4/4 - 7p*3/3 - 3p*2 - 2p - 1. Suppose -4v + 6 = 30. What is m(v)? -2 Let k(m) be the first derivative of -1/4m*4 + 1/3m*3 - m + 0m*2 - 7. Give k(-2). 11 Let b be (14/(-8))/((-2)/8). Let u = b - 3. Suppose uq = 5q. Let o(p) = -p3 + p2 - 5. Give o(q). -5 Let g(v) be the third derivative of 5v4/12 + v3/2 + 3v2 - 7v. Determine g(3). 33 Let x = 170 + -181. Let r(l) = l*3 + 12l*2 + 11l + 2. What is r(x)? 2 Let a(j) = j*3 - 5j*2 + 3j + 2. Let w be 12/54 - (-34)/9. Give a(w). -2 Let x(g) be the first derivative of -g4/4 + g3/3 + 8. Calculate x(0). 0 Let q(h) = 3h + 3. Let i be (-3)/6-6 - 1. Let k(v) = -2v3 + 3v*2 - 1. Let g be k(2). Let a = g + i. What is q(a)? -6 Let l(h) = h + 3. Let s(g) = -g - 3. Let y(m) = -6l(m) - 5s(m). Determine y(-6). 3 Let s(f) = -f. Let c be s(-1). Let z(a) = 1 + c - 1 + a. Let b(t) = -t2 - t + 1. Let p be b(-2). What is z(p)? 0 Let r be (-1)/(-2)-2 - -1. Let b(o) = -1 + 5o - 1 - 2 + r. Give b(3). 11 Let s be (-3 - -2) + -3 - 1. Let p be 4/2(-2 - -3). Let n(t) = 0 + t3 - t3 - t*3 - 6t*p - 5t - 4. Give n(s). -4 Suppose 3t = 5t - 6. Let n(s) = 7s2 + 2s - 6. Let y(m) = 6m2 + m - 5. Let j(r) = 5n(r) - 6y(r). Calculate j(t). 3 Let c(n) = -n3 - 3n*2 + 3n + 6. Let u(w) = -3w + 38. Let t be u(14). Determine c(t). 10 Suppose -3b = -b + 10. Let o = 8 + b. Let c(x) = x*2 - 5x + 2. Give c(o). -4 Let k(w) = 0 - 6w2 - 5w - 5 - w - w3 - w. Calculate k(-4). -9 Let v(n) = n2 + 7n + 5. Let x = -166 - -162. What is v(x)? -7 Let k = -10 + 10. Let p(j) = -6j + 6j + 9 - 8 - j3. Calculate p(k). 1 Suppose 16r + 5 = 15r. Let b(i) = -2i + 1. What is b(r)? 11 Suppose 12 = h + 3h. Let r(t) = -t3 + t2 - t + 1. Let y(d) = d3 + 2d*2 - d - 5. Let g(l) = 2r(l) + y(l). Determine g(h). -3 Let c(z) be the first derivative of 7/2z2 - 7z + 5/3z3 - 1/4z*4 - 2. What is c(6)? -1 Let p(j) = -2j*2 - 3j - 3. Let y(d) = d*2. Suppose 0r = r + a - 3, 0 = -r - 3a + 11. Let b(s) = rp(s) - y(s). Give b(-3). 3 Let i(m) = -m + 2. Let s(l) = -3l + 5. Let q(u) = 8i(u) - 3s(u). Let f(n) = -n3 + 6n*2 - 7n + 6. Let c be f(4). Suppose -4a - c = 2. Determine q(a). -2 Suppose -3y + 4o = 1 - 12, 0 = 3o + 15. Let u(c) = c*3 + 4c*2 + 3c + 4. Give u(y). 4 Let k(c) = -2c + 6. Suppose -i + 20 = -5i. Calculate k(i). 16 Let v(o) = -2o - 2 + o3 - 5 + o2 + 6. What is v(-3)? -13 Let s = 8 - 8. Let v(t) = -2t*2 + 1 + 0t + 1 + st + 2t. Calculate v(3). -10 Suppose 5a = -47 - 3. Let x = 12 + a. Let r(m) = -m3 + 2m*2 - 2m - 1. What is r(x)? -5 Let k(x) = -x*2 + 5x + 7. Let l be (4 + -2)-1 + 16. Let g be 9/6l/3. Give k(g). -7 Let k = 32 - 7. Suppose 0x = -5x - k. Let a(g) = -2g - 7. Give a(x). 3 Let m(j) = j3 - 4j*2 + 2. Let b = -2 - -17. Suppose 16h - 11h = b. Calculate m(h). -7 Let p(l) = -3l + 1. Let d(m) = -5m3 - m2 + 1. Let b be d(-1). Determine p(b). -14 Let q(r) = -r3 - 7r*2 + 8r + 2. Let k be q(-8). Let p be -2 + -1k + 2. Let c be ((-5)/p)/(1/2). Let a(y) = y3 - 5y*2 + y - 1. What is a(c)? 4 Let n(p) = 2p - 3. Let g(y) = y + 1. Let z(i) = 3g(i) - n(i). What is z(-11)? -5 Let d(r) = 5r*2 + 4r - 2. Let x(a) = 11a2 + 8a - 4. Let i(m) = -13d(m) + 6x(m). Calculate i(5). 7 Let m(q) = -13q + 1. Let l(p) = 7p - 1. Let z(o) = -11l(o) - 6m(o). Let t(w) = w + 10. Let b(c) = -3t(c) + 5z(c). Let i = -6 - -11. Determine b(i). 5 Let n(f) = 9 - 3 + 26f - 23f. Determine n(-6). -12 Suppose 2p + 0p - 2 = 0. Suppose 5 = 3u - p. Suppose b = ub. Let i(r) = r*2 + r + 7. Give i(b). 7 Let n(g) = -5g - 7. Let f(i) = 28i + 42. Let b(l) = 6f(l) + 34n(l). Determine b(11). -8 Suppose 4y + d - 44 = 0, 2y + 5d - 55 = -3y. Let a(g) = 10g*2 - g - yg*2 + 3 + 3g. Let n be 0 - 0 - (-1 - 3). Give a(n). -5 Let p = -16 - -9. Let q(l) = l*3 + 8l*2 + 9l + 1. Determine q(p). -13 Suppose 0 = -2m - 3t + 4, 0m + 12 = -2m + t. Let z(x) = -x3 - x2 + x + 1. Let n(l) = -2l3 - 4l*2 + 4l + 7. Let q(v) = n(v) - z(v). What is q(m)? 10 Let m(c) be the second derivative of c*3/6 + 2c*2 - c. Determine m(3). 7 Suppose 0 = -5h + 4o - 19 - 11, -3h = -2o + 18. Let g(a) be the first derivative of a2/2 + 8a + 14. What is g(h)? 2 Suppose -4n = -0n - 4. Let k be n - (-5 + (-1 - -3)). Let t(r) = -r*3 + 3r*2 + 4r + 4. Give t(k). 4 Suppose 4p + p = 5t - 10, 4p + t - 17 = 0. Let z(d) = d3 - 2d*2 - 4d + 1. Calculate z(p). -2 Let m(n) = -n*3 + 8n*2 - 8n + 7. Let r = -4 - -11. What is m(r)? 0 Let g(d) be the first derivative of d*4/12 - 3d*3/2 + 7d*2/2 + 4d - 2. Let h(u) be the first derivative of g(u). Determine h(6). -11 Let q(p) = 4p + 2. Let g(h) = -h - 1. Let b(d) = -5g(d) - q(d). Determine b(-3). 0 Let s be 12/(-1)(-5)/15. Suppose sh = 4c - 16, -3c + 6 = -4h - 8. Let t(q) = 5q - 1. What is t(h)? -11 Suppose 4z - 3 = -3f, 3z + 5 + 9 = f. Suppose n = 0, -4q + 3n = -0q. Let c(o) = -5o - o2 + 0o*2 + qo*2 - 2. What is c(z)? 4 Let j(f) be the first derivative of 1 - 1/3f*3 + 2f*2 + 0f. Give j(4). 0 Suppose 3 + 6 = -3b. Let r = 3 - b. Let j(o) = -o2 - o - 3o - r + 0o. Determine j(-4). -6 Let u(h) = 3h*3 - 3h*2 + 2h - 2. Let q(c) = 10c3 - 10c*2 + 6c - 6. Let d(j) = -2q(j) + 7u(j). Give d(2). 6 Let q(x) = 3x2 + x + 2. Let h be q(-1). Let k(d) = -d3 + 3d*2 + 4d + 2. Give k(h). 2 Suppose 0	{ "pile_set_name": "DM Mathematics" }
(-15)/(-24)48/36? 5 What is (-38)/(-114)3/(-4)? -1/4 What is the value of (-1)/(-2)(-99)/(-66)? 3/4 What is the value of ((-21)/14)/((-6)/4)3? 3 What is ((-140)/(-42))/(-10)(-3)/7? 1/7 Evaluate 222/4-2. -4 Calculate 130/312-62/(-1). 5 (-28/96)/(2/20) -5/3 Calculate (-11)/((-6)/(-4)). -2/3 What is the value of -410/(-760)2? 2/19 (-18)/(-90)10/4-10 -5 Evaluate (-2)/1(-9)/(-6). -3 Calculate 2/((-10)/15-3). 1 Calculate (28/4)/(-84)(-4)/1. 1/3 What is -2(-5)/((-50)/(-15))? 3 ((-72)/60)/(((-84)/(-40))/7) -4 8(11/(-6))/(-11) 4/3 Evaluate (20/(-24))/((-25)/20). 2/3 What is the value of ((-4)/10)/(-1013/(-1950))? -6 What is the value of (6/(-28))/(10/((-1600)/30))? 8/7 Calculate (-4)/(16/(-4))8. 8 Calculate (-10)/(-5)5/(-10). -1 8/(96/(-252))1/3 -7 Calculate ((-8)/(64/12))/(36/(-16)). 2/3 What is ((-15)/3)/((-25)/30)? 6 Calculate (4/(-6))/(8/(-6)). 1/2 Evaluate (-110)/993/(-5). 2/3 Calculate (((-16)/(-3))/(-8))/((-2)/(-3)). -1 Evaluate (-240)/(-180)(-18)/44. -6/11 Calculate (8/(-36))/((-8)/6). 1/6 ((-2)/(-28))/(44/(-96)) -3/7 ((-24)/(-20))/((-15)/100) -8 ((-1)/3)/(2668/696) -2/23 Calculate 9/(126/35)16/100. 2/5 What is 2/((-189)/(-105)60/9)? 1/6 Evaluate (-4)/(-5)(14/8)/7. 1/5 What is (-34/(-18))/(2/(-12))? -4 What is (11/(-66))/((-7)/7)? 1/6 -2(-75)/259/6 9 What is -12(25/5)/(-15)? 4 What is (2/15)/(6/(-9))? -1/5 What is the value of 1/(((-14)/(-6))/(-7))? -3 (15/(-5))/(331) -1/11 Evaluate ((-9)/(-10))/(-29/(-15)). 3/4 9/15/751 3/5 (-816/1536)/(9/24) -2/9 Calculate 1/(-5)57/191. -3/5 What is (-6(-9)/27)/(22)? 1/2 (10/6)/((-10)/(-30)) 5 (-62/8)/((-36)/(-12)) -1/2 Evaluate (-6)/(-25)3/((-99)/(-55)). 2/5 Evaluate (-3)/2-72/(-35). -3/5 Evaluate 3(10/6)/5-3. -3 Evaluate -105/(-20)2. 5 What is the value of (21/(-98))/(3/(-6))? 3/7 What is (0/3)/(2/1)? 0 What is the value of 1/(32/24)? 4 What is (34/(-12))/(-17)8-1? -4/3 Evaluate (((-4)/(-5))/(5/(-25)))/2. -2 (1/(-38))/(14/(1456/26)) -2/19 What is the value of (-610/150)/(-5)? 2/25 What is the value of (52/(-78))/(4/6)? -1 What is the value of ((170/17)/10)/(2/10)? 5 Evaluate (4/(-5))/((-154)/55). 2/7 Evaluate 4(5/(-12))/(1/3). -5 Calculate (-1)/(63/6)(-3)/1. 2/7 What is the value of 36/(-108)-3? 1/2 Evaluate (-1)/(168/(-16))3/(-2). -1/7 Evaluate ((-2)/14)/(30/105). -1/2 What is the value of 3/1510/6? 1/3 Calculate (-4)/((-3)/(18/(-12))). -2 What is 4/345/(-2550)-17? 2/5 ((-2)/8-6)/((-8)/48) -9 Calculate -2(-4)/24-1. -1/3 What is the value of 4/(-7)(-168)/(-48)? -2 Evaluate 8((-3)/(-10))/(6/10). 4 What is (4/(-10))/(232/290)? -1/2 Evaluate (4/(-27))/(4/6). -2/9 Calculate (2/(-2))/93510/(-260). 3/2 What is the value of (-14)/43/21-8? 4 Calculate (-36)/412/6. -3 (5/45)/(32/36) 1/8 What is the value of 1/2(-36)/6? -3 1/4(-176)/(-66) 2/3 ((9/4)/(-9))/1 -1/4 What is the value of (6/16)/(((-108)/(-40))/9)? 5/4 Evaluate 14/(-4)10/7. -5 Evaluate ((-15)/(675/(-60)))/((-4)/(-6)). 2 (2/(-4))/(-5(-42)/240) -4/7 What is the value of -45/5604? -1/7 3/(-2)((-16)/3)/(-4) -2 Calculate ((-6)/8)/((-5)/(-20)). -3 11/(44/8)1/(-3) -2/3 (288/(-189))/83/(-2) 2/7 What is the value of (-4)/(-6(-3)/(-315)7)? 10 Calculate ((40/5)/8)/2. 1/2 Calculate 1/(-3)(-24)/(-100)-5. 2/5 (1/(-11))/((-1)/(-2)) -2/11 Evaluate (24/(-798))/(44/(-56)). 2/19 Calculate ((-4)/((-168)/(-7)))/(2/2). -1/6 Evaluate (-1)/4(-16)/3-3. -4 What is 60/36-3(-24)/(-270)? -4/9 Calculate (6/14)/((-5)/((-15)/3)). 3/7 (396/(-128))/(-11)(-40)/(-30) 3/8 What is the value of 8((-4)/(-2))/(-4)? -4 What is 1/((-6)/((-180)/(-50)))? -3/5 What is the value of (2/4)/(7/((-336)/12))? -2 Calculate ((-1)/3)/((-2)/24). 4 Calculate (6/(-30))/((-5)/(-20)). -4/5 What is the value of ((-15)/5)/(-3)0? 0 What is (10(-2)/(-88))/((-90)/(-216))? 6/11 4720/118(-1)/(-5) 8 Calculate 3/1((-1)/(-1))/1. 3 (483/1610)/((-5)/((-50)/(-12))) -1/4 What is the value of (6/(-32))/((-3)/(-36)-3)? 3/4 ((-3)/8)/((-33)/(-44))-12 6 Evaluate ((-1)/((-5)/(-15)-3))/(-1). -1 ((-25)/15)/(5(-1)/6) 2 What is 9/(-24)-12/3? 1/4 Evaluate (2/(-6))/(((-140)/15)/(-7)). -1/4 Evaluate (-1)/10(-5025)/(-402). -5/4 What is the value of (-1)/9(-168)/28? 2/3 What is the value of (-5(-44)/(-165))/(2/6)? -4 What is the value of (10/2)/((-3)/1)? 0 Evaluate ((6/(-1))/18)/(8/(-4)). 1/6 Calculate ((-11)/14)/(-11)-2. -1/7 Evaluate ((20/6)/5)/((-8)/6). -1/2 Calculate ((-30)/(-36))/(6/36). 5 Calculate ((84/(-132))/7)/(2/2). -1/11 Evaluate (3/4)/(3/(-24)12). -1/2 (-60)/104/(-12) 2 (87/116)/((-4)/((-160)/6)) 5 Calculate ((-7)/28)/(5/5). -1/4 Calculate (-1)/((31)/(63/7)). -3 Calculate 3/41212/72. 3/2 Evaluate ((-4)/24)/(-510/(-75)). -1/4 What is the value of 154/66(-4)/(-14)? 2/3 What is (12/(-5))/(76/190)? -6 What is 152/(-342)3/(-8)? 1/6 (10/(-10))/((-1)/(-5)) -5 Calculate (36/210)/(6/(-10)). -2/7 Evaluate 27/12(-13)/39-1. 3/4 What is (6/4)/((-7)/(-14))? 3 Evaluate ((-11)/((-33)/(-18)))/((-4)/2). 3 Evaluate (21/6)/728/(-14). -1 What is (-6)/((1/6)/(10/(-90)))? 4 What is (-54)/36(-2)/1? 3 What is the value of ((0/(-15))/(-14))/(6/(-3))? 0 (-8)/(-12)(-15)/70 -1/7 ((-24)/(-42))/((-10)/(-35)) 2 What is the value of (310/(-15))/((-4)/(-20))? -10 Evaluate -3(6/3)/542. -2/9 Calculate ((-24)/(-8))/(4/2). 3/2 ((2/6)/(1/3))/(-9) -1/9 ((-48)/(-240))/(6/(-20)) -2/3 0(-5)/(-5)-1 0 (-2)/(2/(-18)-6) -3 80/(-4)(-55)/220 5 What is (-50)/(-50)((-2)/(-3))/2? 1/3 What is the value of ((-2)/40)/(20/(-150))? 3/8 What is the value of 12/6398/84? 2/9 What is (-5)/136/(-45)? 4 Evaluate (1/5)/(-1(-8)/(-5)). -1/8 What is (-7)/5(-2)/((-30)/(-75))? 7 What is (0/3)/(3/((-12)/(-8)))? 0 Calculate (5/(-2))/((-7)/(-14)). -5 What is 2/3(-27)/18? -1 Evaluate (-5)/(-10)-25. -5 What is 0/(2/(-5)(-90)/(-36))? 0 Calculate (-12)/(-24)-21. -1 Evaluate (-1)/(((-2)/(-8))/(51/51)). -4 (-12)/(-3)(-2)/((-4)/1) 2 ((-144)/(-36))/(4/4) 4 What is (-42)/(-28)6/15? 3/5 What is the value of -3(-1)/310/(-15)? -2/3 What is the value of (-1)/(-1)15/(-5)? -3 What is (-260)/(-1365)(9/(-2))/(-3)? 2/7 What is 8/(-4)(-2)/(4/(-1))? -1 1/((6/(-9))/(5/30)) -1/4 What is the value of (-1)/16(-260)/(-65)? -1/4 9/(-6)(-7)/((-42)/(-16)) 4 Evaluate (-146)/(-219)(-3)/17. -2/17 Calculate 4/(-8)11/11-2. 1 Calculate (13/(260/16))/(8/20). 2 Calculate ((-31)/(-93))/((-1)/(35)). -5 (-6(-4)/32)/(2/(-8)) -3 What is the value of 37/213? 3 What is the value of 6/(-10)132/(-396)? 1/5 What is 314/214/(-144)? -1/18 What is the value of (-100)/(-20)(-8)/10? -4 What is (4/(-22)1)/((-2926)/1694)? 2/19 Evaluate ((-20)/16)/(11/44). -5 Evaluate (30/35)/(255/35). 2/17 What is the value of 2((-11)/2)/1? -11 2/3(-27)/(-6) 3 (14/5)/(22/(-935)-17) 7 (2/(-10)-2)/(1200/1000) 1/3 Calculate (10/15)/(2/(-1))-15. 5 Evaluate (51)/((-10)/(-10)). 5 Calculate -5-33/15. 3 ((-2)/21-12)/((-44)/154) -4 What is the value of 80/(-30)((-81)/12)/(-3)? -6 Calculate (3/2)/(87/29). 1/2 84/244/(-8) -2/3 8/7209-8 -4/5 What is (24/6)/110/4? 10 What is (30/1)/(-5)2/(-4)? 3 Evaluate 981/1091/(-3). -3 (-7(-6)/42)/(-5) -1/5 Evaluate (-1)/((-2)/8(-60)/15). -1 (90/(-81))/((-8)/(-12)) -5/3 0/57/(-14) 0 2((-2)/6)/(8/12) -1 Calculate (19/(-152))/(6/16). -1/3 What is the value of 5/(2/(-2)3/3)? -5 Evaluate (3/(3/(-2)))/(10/(-15)). 3 What is the value of (-23)/(-23)((-5)/(-3))/(-1)? -5/3 Calculate (-234)/546((-2)/(-2))/3. -1/7 What is the value of (-1)/(-5)((-14)/(-2))/(-7)? -1/5 Calculate ((-3)/(-5))/((-54)/(-150))-3. -5 6((-245)/42)/(-7) 5 (-3)/(-1)2/(-18) -1/3 What is the value of (-75)/(-60)(-7)/35? -1/4 Calculate (2(-3)/8)/(-3). 1/4 Calculate 1/4(-144)/(-63). 4/7 What is the value of (66/9)/(4/(-2))? -2 Calculate ((28/(-4))/(-42))/(1/(-2)). -1/3 What is the value of 15/30-6(-3)/(-12)? -3/4 Calculate ((-3)/(90/6))/(2/2). -1/5 What is the value of ((5/(-1))/(-30))/(3/(-9))? -1/2 What is the value of (1/3)/(11/(-165))? -5 What is the value of ((-6)/(-18))/((-3)/(-216)4)? 6 What is the value of ((-3)/10)/(210/175)? -1/4 What is (22/(-55))/(2/(-4))? 4/5 What is the value of (-16)/40(-10)/2? 2 Calculate -1(20/(-5))/40. 0 1/(-6)(-171)/(-76) -3/8 What is the value of 7-26/42? -2 ((-2)/(-14))/(603/(-1407)) -1/3 Calculate (-2)/(-2-1(-1)/(-5)). -5 What is ((-29)/145)/(4/	{ "pile_set_name": "DM Mathematics" }
. Solve 3j - 12 = -t for j. 3 Suppose d + 3h = -2d + 21, -h = -2. Let r = 1 + -4. Let l be r/(-6) - 7/(-2). Solve l = -db + 14 for b. 2 Suppose 3s + 2g + 2 = 0, -2s + 5 = -g - 3. Solve c + 4 = sc for c. 4 Suppose 5p = 4n + 25, 5p - 12 - 13 = -n. Let l(b) = 0 + 4 - b - 2b - pb - b2. Let m be l(-8). Solve 2 = x + m for x. -2 Suppose -3g = 2r + 3r - 9, 0 = -5r + 15. Let m = 0 - g. Solve 0 = mw - 2 - 2 for w. 2 Let z be ((-2)/(-2) + -14)-1. Solve 0 = 4i - z + 1 for i. 3 Let y = -7 + 12. Suppose -s - 55 = -yh, 0 = 3h - s - 12 - 19. Suppose 5c + 42 = 3j + 2, -4j - 3c = -5. Solve jz + h = 2 for z. -2 Let h be 4 + (1 + 0)-1. Suppose 4 + 2 = hs. Solve sv - 4 = v for v. 4 Suppose -1 = -r - 0. Solve 4 = 5x - r for x. 1 Let r(g) = -g2 - 8g + 7. Let q be r(-8). Solve qy + 15 = 2y for y. -3 Let k = 47 - 44. Solve 1 = -kv + 16 for v. 5 Let m = -21 - -27. Solve 4q - q = -m for q. -2 Suppose -7 + 3 = -4f. Let s(z) = z3 + 7z*2 + 7z + 6. Let q be s(-6). Solve -f + q = w for w. -1 Let v be (3 + -4)1-4. Suppose 0g = -vg. Solve 4p + p - 15 = g for p. 3 Suppose 5p - 23 = 2. Suppose -r - 3i + p = -2i, 0 = -3r - i + 5. Solve 4 = x - rx for x. 4 Let w be (-2 - -7) + -1 + 3 + -4. Solve 16 = wj + j for j. 4 Suppose 2u + 13 = 3r, -u + 5r - 21 - 3 = 0. Let f be (-102)/(-12) - u/(-2). Solve 5b + f = -11 for b. -4 Let g(p) be the third derivative of -p4/24 + 5p*3/6 + 2p*2. Let b be g(-4). Suppose -4s - 24 = -v, 4v + 4s = 3v - 16. Solve bj = vj for j. 0 Let z be 3(-2)/3 + 2. Let u be (-3 - 85/(-30)) + 37/6. Solve z = 4d - d - u for d. 2 Suppose 0 = -5i + 3w + 2w + 35, -3i + w + 15 = 0. Suppose 0 = -v - 3f - i - 3, 2f = 2v - 26. Suppose 3d - v = -d. Solve 3z = -dz + 25 for z. 5 Let v(m) = 20m*3 - 2m*2 - 2m. Let p be v(-1). Let l = 20 + p. Solve 0 = -lo + o + 4 for o. -4 Let m(a) = -2a*2 - 7a. Let y be m(-3). Solve 0 = yz + 9 + 3 for z. -4 Let k = -52 + 31. Let r = -46 - -31. Let j = r - k. Solve 0 = 2b - 0b - j for b. 3 Let x(g) = 0g*2 - g + 2g*2 - 4g*2 + 7g*2. Let t be x(1). Solve 2 = i + t for i. -2 Suppose -1 = -i - 0i. Solve -m + 0 = -i for m. 1 Suppose -2p - 2d + 15 = -3d, -2p + 3d = -21. Solve -3j + p = -6 for j. 4 Let o = 49 - 45. Solve od = -0d + 4 for d. 1 Suppose 0 = -z + 2z - 3. Solve 6 = zv - 6 for v. 4 Suppose -4o + s = -11, -4o + 0s - 7 = 5s. Suppose -l - o = -6. Suppose 2f - l = f. Solve 0 = fz - 16 for z. 4 Let d(z) = 11z + 2. Let g be d(1). Solve g + 7 = 5a for a. 4 Let r(q) = -q*3 - 3q*2 - q - 1. Let i be r(-3). Solve -i - 4 = -2z for z. 3 Let s = 3 + -2. Let q be 4/(s-2) + 4. Let i(o) = o + 1. Let k be i(q). Solve y + 8 = ky for y. 4 Let c = 10 + -23. Let n = c - -18. Solve nf - 2f = -6 for f. -2 Let k(y) = y + 2. Let v be k(2). Suppose vt = 2t + 2. Solve j - 3 = -t for j. 2 Let k be 0/(2/(-12)). Let x = 34 - 32. Solve k = -0w - xw for w. 0 Suppose 0y - 4 = -2y. Suppose 2u - 5j = -y, 4u + j = 2 + 16. Solve -24 = uo - 8 for o. -4 Suppose 2c + 2a = 6c - 10, -2c + 3a = 5. Suppose 42 = cz + 2. Solve -4j - z = -0j for j. -2 Let o(f) = 8f. Let m be o(-1). Let g = -6 - m. Solve 4 = -0h + gh for h. 2 Suppose -l + 21 = 2p, 6p + 5l = 2p + 45. Suppose 0 = 3u + 5m - p, 5u - m = 4u - 2. Solve u = 6q - q + 10 for q. -2 Suppose -13t + 15 = -10t. Solve -tr + 3 = -2 for r. 1 Suppose -2 = -2w + 2. Let f = -3 + 7. Solve -2x + w = -f for x. 3 Let p be ((-2)/5)/(1/(-5)). Let z be (-7)/((-84)/(-54))(-2)/3. Let v(f) = 26f - 1. Let s be v(1). Solve pu = -zu - s for u. -5 Let n(p) = 2p2 - p - 2. Let f be n(-2). Suppose 4d - 3c - 3 = 0, 7d - 4d = 2c + 2. Solve -4q + fq + 8 = d for q. -2 Suppose 9 + 3 = 3s - 2i, s - i = 3. Solve -sg + 2g = -12 for g. 3 Let g = 4 + -1. Suppose -4s = 4p - 32, -6 = -p - 2p + gs. Solve -pj + 1 - 16 = 0 for j. -3 Let v = 49 + -37. Solve 5s - 13 = v for s. 5 Suppose -b + 2 = -0. Suppose -4r + 18 = -y, -4r = by - 3 - 9. Solve i + r = -0i for i. -4 Let v(q) = q*3 - 4q*2 - 7q + 4. Let n be v(5). Let g be n/33 + 4/22. Solve w = -gw + 2 for w. 2 Let n = 10 + -8. Let t be 2 - 2n/(-4). Solve o + t = -0o for o. -3 Let m(c) = c - 5. Let h be m(6). Suppose -j + 63 = 6t - t, 0 = 3t + 4j - 48. Let d = t - 12. Solve 3n + h + 2 = d for n. -1 Let r be -4(60/48 - (1 - -1)). Solve 0 = -2o + 7 - r for o. 2 Let i = -11 + 15. Solve -w - 12 = -iw for w. 4 Let y(j) = -j*3 + 11j*2 - 11j + 3. Let c(i) = 3i3 - 33i*2 + 33i - 8. Let b(w) = -2c(w) - 7y(w). Let h be b(10). Solve -hn - 6 = -2n for n. -2 Let p(k) be the second derivative of -3k3/2 - k. Let l be p(-1). Suppose 6 = 2x + 3i, 3x = -i - 4i + l. Solve -x = -4g + 9 for g. 3 Let t(s) = -10s3 - 34s*2 - 7. Let g(k) = 7k*3 + 23k*2 + 5. Let o(f) = -7g(f) - 5t(f). Let a be o(-9). Suppose -q = -aq. Solve d + 2 = -q for d. -2 Let q(h) = h + 5. Let j be q(-7). Let r be (-1 - (4 + j)) + 7. Solve 18 = rw + 2 for w. 4 Let b = 0 + 1. Let z = -1 + b. Suppose -t = 2o - 0o, z = o - t. Solve on = 2n - 10 for n. 5 Let h = -20 - -19. Let t be -2(-5 - h) + -3. Solve -td + 18 = 3 for d. 3 Let z(g) = 2g*3 - 3g*2 - 4g + 1. Let b be z(3). Suppose -3h = -h - 16. Suppose -5n - 4a = -b, -n = -3a - h + 1. Solve -2 = -i - n for i. -2 Suppose -20 = -4z - 0. Solve -zi - 36 = -11 for i. -5 Let j = -2 + 6. Let s = -1 + j. Solve 8 = b + sb for b. 2 Let p be -5(4/10 - 1). Suppose -t + 8 = -px + 2x, 0 = -5t - 5x. Let g be 0 + t + 0/1. Solve 5 = -gy + 5y for y. 5 Suppose 0 = -32w + 36w - 4. Solve 4v - 3 = w for v. 1 Let f be (-3)/5 + 1(-92)/(-20). Solve -fu = 5 + 11 for u. -4 Suppose 5n + 45 = -5t, -2n = -n - 4t + 19. Let r = n - -29. Solve -5v - 3 = -r for v. 3 Suppose -o - 4x = -20, -5o - 2x + 4x + 34 = 0. Suppose 6 = -5l + ol. Solve 0 = lg + 3g for g. 0 Suppose -5 = -2d + 9. Suppose -4g = -1 - d. Solve -g = -m - 3 for m. -1 Let g(c) = c*2 + 5c + 7. Let s be g(-3). Solve 0 = x + s - 5 for x. 4 Let u be (-32)/6 + (-8)/12. Let x be ((-4)/12)/(2/u). Let y be 2 - x - (-2)/(-2). Solve -2m - m = y for m. 0 Let f be (-150)/(-20) + (1/(-2) - 0). Solve 13 + f = 4q for q. 5 Let a be (-4)/(-6) + (-1)/(-3). Suppose -2v = -5i + 32, 5i = v - 1 + 37. Suppose 0 = 2t + 2 - i. Solve -7 = -tg - a for g. 2 Let t be 4/(-10) + 112/80. Solve 3j + t = 4j for j. 1 Let b(o) = o3 + 2o*2 - 3o - 3. Let h be b(-2). Solve hw + 0w + 15 = 0 for w. -5 Let t(r) = -r*3 + 3r*2 - r + 1. Let q be t(2). Suppose 2d + 2d = 0. Solve d = -3j + 3 + q for j. 2 Suppose -2w = -2v - 0 + 2, 4v - 24 = -w. Let z = v + -3. Suppose 5j = -2a - 9, 3a + za + 4j - 3 = 0. Solve 6 = an - 6 for n. 4 Suppose 5v + 3h = 13, -h + 4h = -3v + 3. Solve vs - 2s = 0 for s. 0 Suppose -2s + 2v - 7 = -3, 0 = -2s + v. Solve 2i = s + 8 for i. 5 Suppose b = -2 - 9. Let v = 27 + b. Solve 5o + v + 4 = 0 for o. -4 Suppose -3 = 4n + 9, -g = -n - 19. Solve -3a = a - g for a. 4 Let l be 6/36 - 2/12. Let u be (-1 - l)/1-12. Solve 3f - 3 = -u for f. -3 Let q be (-8)/60 + 152/15. Let d(h) = -3h - 7. Let k be d(-3). Solve 3f - q = -kf for f. 2 Let a = -21 - -24. Let z(i) = i + 2i - i. Let l be z(a). Solve -lq + 3 = -3q for q. 1 Let p(j) = -j*2 - 10j + 2. Let g be p(-10). Suppose -5r = 24 - 9. Let d be -4 - r - (1 - 2). Solve 0 = -gv - dv - 6 for v. -3 Suppose 19 = 4x - 61. Let j(h) = h*2 - 10h - 18. Let p(y) = 2y2 - 10y - 18. Let m(d) = -3j(d) + 2p(d). Let b be m(-8). Solve 6v = bv - x for v. -5 Let x be ((-16)/(-24))/((-2)/(-27)). Solve 2r - x = -r for r. 3 Suppose -2d - r - 1 = -3d, -r = -5d + 17. Suppose -do = -32 - 28. Suppose 7q - 5h = 2q + 15, -5h + 33 = q. Solve -3t + o = -qt for t. -3 Let y(n) = -3n - 2. Let u be y(-2). Suppose -m = um. Solve mi = -2i - 10 for i. -5 Suppose 0 = -2x + 125 - 35. Suppose -u - 5o - 4 = 2u, 5u - x = 2o. Solve -2s + us + 15 = 0 for s. -3 Let o(p) = 6p + 6. Let x be o(1). Solve 0 = 3l - 0l - x for l. 4 Let b be -5 - -3 - (0 - 17). Solve -2i - b = i for i. -5 Let b(l) = -l. Let x be b(-2). Suppose -2w + 3v + 2 = 0, xw + 5v - 5 = 7w. Let q = 8 + w. Solve qp - 2p = -5 for p. -5 Let q = -11 + 13. Suppose qs - 10 = 4*s, 23 =	{ "pile_set_name": "DM Mathematics" }
618? False Does 23 divide 5916779? False Is 212360832 a multiple of 1429? True Is 18 a factor of 1068180403? False Is 13 a factor of 57667012? True Is 80 a factor of 280288560? True Does 1510 divide 104897135? False Does 223 divide 3011766194? True Does 2746 divide 41343776? True Is 32 a factor of 4786112? True Does 608 divide 12609920? True Does 3587 divide 94255599? True Is 14 a factor of 67565456? True Is 94 a factor of 403915915? False Is 39 a factor of 47931? True Is 136 a factor of 146743048? True Is 148 a factor of 36957442? False Is 102200808 a multiple of 2627? True Is 133547277 a multiple of 104? False Is 817 a factor of 71682763? True Does 260 divide 13790293? False Is 10 a factor of 22172120? True Is 134 a factor of 521180217? False Is 474 a factor of 9598500? True Is 62 a factor of 57867328? True Does 117 divide 66306367? False Does 264 divide 2928288? True Is 13 a factor of 234647618? False Is 118 a factor of 231206258? False Is 343 a factor of 47505555? False Is 2314040787 a multiple of 713? True Is 136258005 a multiple of 3547? True Does 2 divide 16220537? False Does 14 divide 132584677? False Is 326369264 a multiple of 3536? True Is 14 a factor of 3402015? False Is 6 a factor of 226949226? True Does 3 divide 595039573? False Is 484378077 a multiple of 124? False Is 6995 a factor of 1042823340? False Does 276 divide 260388888? True Is 1911 a factor of 128367603? True Does 234 divide 26904897? False Is 2006673 a multiple of 21? False Does 580 divide 20292175? False Is 1891931462 a multiple of 21? False Is 1817831169 a multiple of 104? False Is 11 a factor of 159987322? True Is 51791157 a multiple of 64? False Is 157 a factor of 2196887? False Is 2907 a factor of 150646554? True Is 4660202544 a multiple of 5739? False Is 30 a factor of 12120164? False Does 471 divide 225892542? True Is 17841722 a multiple of 19? True Does 17 divide 44108538? False Does 758 divide 2099900286? True Does 13 divide 114162688? False Does 2096 divide 130725424? True Is 46482242 a multiple of 8? False Does 2 divide 38340900? True Does 80 divide 679818855? False Is 45 a factor of 448847460? True Is 18682377 a multiple of 4? False Does 42 divide 2253857844? True Does 37 divide 14116384? False Is 127093389 a multiple of 6? False Is 1058470745 a multiple of 166? False Does 15 divide 21988145? False Is 67331901 a multiple of 273? True Is 5 a factor of 104510142? False Is 4416192 a multiple of 36? True Is 957454618 a multiple of 214? True Is 34 a factor of 60495523? False Is 110 a factor of 1770560? True Is 86 a factor of 23979036? True Is 674945926 a multiple of 1089? False Does 13 divide 442118035? False Does 105 divide 92283450? True Is 407446 a multiple of 13? True Is 51 a factor of 1950526263? True Is 791622266 a multiple of 4647? False Is 785743772 a multiple of 44? True Is 109 a factor of 46251922? False Is 1063165045 a multiple of 67? True Is 2531 a factor of 1804518343? False Does 3004 divide 814855332? False Is 113119040 even? True Is 27 a factor of 3229795701? True Does 75 divide 71910375? True Does 671 divide 2338435? True Does 2291 divide 75814230? False Is 34100982 a multiple of 6? True Is 11 a factor of 2341757? True Is 8 a factor of 592873478? False Is 4 a factor of 12428545? False Does 10 divide 24718520? True Is 70 a factor of 137894610? True Does 84 divide 19837206? False Is 122623100 a multiple of 215? True Is 179300700 a multiple of 450? True Is 74151789 a multiple of 1775? False Is 264757304 a multiple of 7? True Does 11 divide 2593815075? False Is 220 a factor of 7640380? True Is 585159898 a multiple of 463? False Is 90141336 a multiple of 521? True Is 911 a factor of 25517015? False Does 212 divide 94302264? True Is 288 a factor of 13130040? False Is 2134 a factor of 74339171? False Is 15 a factor of 265918092? False Does 428 divide 13133868? False Is 51819500 a multiple of 10? True Does 51 divide 17490356? False Is 4 a factor of 1347373? False Is 2296 a factor of 40675936? True Does 671 divide 364021418? False Is 20084526 a multiple of 66? True Does 96 divide 4631240? False Does 9 divide 661877163? True Is 23635260 a multiple of 20? True Is 330 a factor of 4464417336? False Is 9366183 a multiple of 171? True Does 17 divide 131032430? True Does 4 divide 1751046316? True Is 9230903 a multiple of 319? True Does 11 divide 17639000? False Is 1826981373 a multiple of 327? True Does 19 divide 109220002? False Is 7 a factor of 663320196? True Is 7564944 a multiple of 14? False Is 1047 a factor of 281336442? False Is 10123666 a multiple of 297? False Is 820488733 a multiple of 27? False Is 15018760 a multiple of 10? True Is 12 a factor of 51987393? False Is 165429624 a multiple of 996? True Is 1474084728 a multiple of 24? True Is 14086260 a multiple of 36? True Is 19 a factor of 33821228? False Is 466 a factor of 1765444262? True Is 64749253 a multiple of 1233? False Is 1580 a factor of 240967894? False Is 2711 a factor of 3051543057? False Is 44950482 a multiple of 578? True Is 136 a factor of 240992? True Does 1874 divide 440641116? True Is 33 a factor of 3050981463? False Is 436515256 a multiple of 1016? True Is 3078280 a multiple of 342? False Is 13480390 a multiple of 6314? True Does 615 divide 20459554? False Is 60 a factor of 213494340? True Is 137 a factor of 7252780? True Does 45 divide 110089983? False Does 23 divide 3372223269? True Does 228 divide 585498300? True Is 6 a factor of 1352004912? True Is 11 a factor of 4126120? False Is 13460249 a multiple of 5? False Does 4950 divide 649543950? True Does 38 divide 1322446? False Is 73637769 a multiple of 226? False Does 22 divide 61377512? False Is 6404034243 a multiple of 203? False Is 69510235 a multiple of 33? False Does 86 divide 33408411? False Does 28 divide 238466200? True Does 300 divide 1810322100? True Is 27023566 a multiple of 554? True Is 232965815 a multiple of 131? True Does 13 divide 432916276? True Is 29658770 a multiple of 8? False Is 13 a factor of 207601000? False Does 604 divide 1082192840? True Is 419 a factor of 169024214? False Does 7 divide 1722067? False Is 17 a factor of 396109656? True Does 16 divide 1455065872? True Is 1752 a factor of 42076032? True Is 4230148938 a multiple of 138? False Is 239870322 a multiple of 6? True Is 27803153 a multiple of 348? False Is 261847980 a multiple of 325? False Is 3843 a factor of 943199019? True Is 145905270 a multiple of 10? True Does 761 divide 10103036? True Does 606 divide 103492046? False Does 1313 divide 40450904? True Is 174 a factor of 40152762? True Does 42 divide 339364301? False Is 58020 a multiple of 2? True Is 110 a factor of 46439800? True Is 45 a factor of 4814023? False Does 12 divide 527304? True Does 2283 divide 581723391? False Does 22 divide 159795328? True Is 308 a factor of 91022008? True Is 8 a factor of 22068248? True Does 12 divide 9076716? True Is 75 a factor of 342713972? False Does 266 divide 1282909222? True Does 159 divide 99795873? True Is 343823758 a multiple of 298? True Is 1806553480 a multiple of 14? False Is 20388368 a multiple of 286? True Does 62 divide 13298318? True Is 6 a factor of 45076698? True Does 988 divide 97907836? True Is 2200932189 a multiple of 843? False Is 28253739 even? False Is 11 a factor of 11963512? True Does 8 divide 265696320? True Is 31968347 a multiple of 13? False Does 206 divide 232986? True Is 1516142430 a multiple of 990? True Is 14114607 a multiple of 663? True Is 1334 a factor of 91948975? False Is 831008244 a multiple of 127? True Is 23 a factor of 58332462? True Does 588 divide 1947139068? True Is 5333 a factor of 182916567? True Does 271 divide 2635198309? True Is 30 a factor of 13904303? False Does 50 divide 11697547? False Does 21 divide 55799360? False Does 106 divide 5271168? True Does 51 divide 38100825? True Is 231409661 a multiple of 1134? False Is 567 a factor of 53347394? False Is 248136909 a multiple of 643? False Is 1242043738 a multiple of 8? False Is 312794702 a multiple of 19? False Is 1118722056 a multiple of 13029? True Does 261 divide 10836461? False Is 820 a factor of 28390860? True Is 42956824 a multiple of 443? True Is 2641508 a multiple of 161? False Is 804395007 a multiple of 170? False Is 30 a factor of 110014800? True Is 13	{ "pile_set_name": "DM Mathematics" }
prime? True Let p = 2474 + -1063. Is p composite? True Let o(k) = 468k3 + k2 + k + 5. Is o(2) composite? True Let m(q) = -2q - 8. Let l be m(-6). Let u = 4 - -15. Suppose -lh + u + 201 = 0. Is h a prime number? False Let i(n) = 10n + 41. Is i(17) prime? True Suppose 8g = 2g + 1266. Is g prime? True Is (-2 - -2) + (2745 - -4) composite? False Let h = 3852 - 2622. Suppose f - h = -f. Suppose -5l + 4m = -f, 4m - 40 + 528 = 4l. Is l prime? True Let a(j) = 14j3 - 8j - 6. Let r(g) = -7g3 + 4g + 3. Let x(q) = 2a(q) + 5r(q). Suppose 6 = -5h - y - 9, -4y - 30 = 5h. Is x(h) prime? False Let s be 2 + (2 - 3) + 6. Let l(x) = x2 + 0x*2 + sx + 3 - 5. Is l(-8) a composite number? True Let p be 3/(-9) + 30/9. Suppose 23 = po + 2g - 4, 0 = 4g. Is o a prime number? False Let x = 3187 + -1678. Is x a composite number? True Suppose -8892 = -3y + n, 2948 = y + 8n - 3n. Is y composite? False Is 49 + (-61)/(-3) composite? True Let o be 0 + 0 + 31 + 1. Let q be 7/14 - (-21)/2. Let p = o - q. Is p a composite number? True Let o be (-21)/(-3) - (-2)/(-1). Let t = 3 + -3. Suppose -4a + 63 + 7 = oy, -5a - y + 77 = t. Is a prime? False Let i(m) = -15m - 11. Let y(u) = 31u + 23. Let s(z) = 13i(z) + 6y(z). Is s(-4) a composite number? False Let f(u) = 2u3 - 21u*2 + 7u + 29. Is f(14) prime? True Let f(x) = 18x - 17. Is f(8) a composite number? False Suppose -2d = 2d + 1240. Is 12/10d/(-4) a prime number? False Let k(w) = 10w + 7. Let h be k(6). Suppose 0b + b = h. Is b prime? True Let i(z) = -z*3 - 2z*2 - 12z - 11. Is i(-8) prime? False Let r(z) = 2z2. Let a be r(-1). Let k be a(-4 + 1)/6. Is -1 + k + 297/3 prime? True Let o(u) = u - 10. Let s be o(12). Is (7/(-28))/(s/(-536)) a prime number? True Suppose 0 = 3z + z - 16. Suppose -3l - 53 = -zw, w = -w - 4l + 10. Is w composite? False Is (-7 - (3 - 7)) + (586 - 0) composite? True Let i(g) = 78g2 - 2g - 1. Is i(-1) a composite number? False Suppose -5i + 10 = -3i. Let r(h) = 2h3 - 4h*2 - 2h - 1. Let s be r(4). Suppose -2j - s = -3u, 2j = -iu + 3j + 80. Is u a composite number? True Let s be 37/4 - (-2)/(-8). Suppose x - 6 + 3 = 0. Suppose -xq + 27 = -f - s, -5f = -15. Is q a prime number? True Suppose 320 = m - 6m. Let l = m + 117. Is l a composite number? False Is ((-3)/4)/(8/(-4768)) prime? False Suppose 0 = 23z - 25z + 538. Is z a composite number? False Let t(p) be the first derivative of -p*3/3 + 7p*2/2 - 5p + 1. Let f(g) = 3g3 + g. Let j be f(1). Is t(j) composite? False Suppose o + 5u - 13 = 0, 4o - u - 17 = -7. Suppose -ov - a + 54 = 0, -3v + v = -5a - 53. Is v prime? True Let u be 22/6 + (-3)/(-9). Suppose -92 = -uf + 56. Is f prime? True Let v = -698 + 2097. Is v composite? False Is 0 + 642 + (-1)/1 a prime number? True Let g be (2/6)/((-2)/(-48)). Suppose 4w = gw - 8. Suppose wn - 193 = 65. Is n a prime number? False Let c be ((-1)/3)/((-3)/45). Suppose 20 = -cm, 3h + 0h + 54 = -3m. Is ((-6)/(-4) - 2)h prime? True Let h = 24 - 8. Suppose -3y + 73 = h. Is y prime? True Let s = -10 + 12. Is (141/(-6))/((-1)/s) a prime number? True Let o(g) = -6g + 0g - 8 + g. Suppose s - 2s = 2p + 21, 2p = s - 15. Is o(p) a prime number? True Suppose k + 1119 = 4k. Is k prime? True Let k(p) = -p*2 - 3p + 1. Let j be k(-3). Is j21/1 + 1 a composite number? True Let b be (-6)/18 - (-4438)/(-6). Let z = 17 - b. Is z a prime number? True Let n be (4 - 0) + 4 + -6. Suppose -4s - 2m - nm + 4 = 0, 0 = s - 3m - 17. Is (-2)/s + (-1641)/(-15) a composite number? False Suppose -2h + 176 = -2p, 2h - 2p = p + 174. Let q = h + -57. Is q a prime number? False Suppose a = 54 + 221. Suppose w = 6w - a. Is w a prime number? False Let h(o) be the third derivative of -o7/280 - o6/72 - o5/30 - o4/12 - o3/6 - o2. Let p(r) be the first derivative of h(r). Is p(-3) composite? True Let f = -57 + -116. Let j = 104 + f. Let r = 126 + j. Is r composite? True Let j(s) = s*3 + 11s*2 - 11s + 17. Let a be j(-12). Let b = a - 2. Suppose 5c = -m + 43, -bc - 23 = -m + 2c. Is m a prime number? False Is -1 + 5382 + 2 + -2 composite? False Suppose 0 = -3p + 6p + 138. Is p/(-42/4) a composite number? False Let p be (-1)/2 - 1715/(-10). Let j = p + -82. Is j a prime number? True Let l(j) = j - 6j - 1 + 5j*3 - 3j*3 - 5j*3. Is l(-6) a composite number? False Is 8/20 + (-793)/(-5) a composite number? True Let s be 0/5 + 51. Let y = -3 - -18. Suppose -y = -2r + s. Is r prime? False Let l(s) = -2s*2 + 15 + 6s*2 + 15s - 3s2. Let m(u) = -u - 1. Let y(a) = -l(a) - 4m(a). Is y(-9) a composite number? False Is (-314)/(-4)(-5 + 19) prime? False Suppose 30 = 4b - 2n, -3b - b + 5n + 45 = 0. Suppose 0 = -4l + bp + 24, 4l + p = 2l + 12. Let k = l + 1. Is k a composite number? False Suppose 0 = 3d - 3f - 21, -d = d - 3f - 11. Is d a composite number? True Suppose 5x - 16 = -6. Let k = -8 + 11. Suppose -3c - 46 = -2b - xc, 0 = -kb - c + 59. Is b prime? False Suppose -19 = 3c + 2. Suppose 3d = 4d + 10. Let i = c - d. Is i a composite number? False Suppose 9 - 7 = 2q. Is -2(-122 + 3) + q prime? True Let n(i) = -i*2 - 7i. Let y be n(-7). Suppose -v - d = 106, yd = -3v - 2d - 319. Let t = v - -160. Is t a prime number? True Suppose 0 = 3g + a - 2394, 4g + 2a = -a + 3197. Is g a composite number? False Let j(i) = 7i2 + 5i - 65. Is j(24) a prime number? False Let d(q) = -q*3 + 8q*2 + 6q - 13. Is d(8) a composite number? True Suppose 5l - 835 = -2z, -2l + 334 = 2z + z. Is l composite? False Suppose 5f - 4222 = -m, 2m - f - 4f = 8399. Is m a composite number? True Suppose 2u - 137 - 33 = 0. Is u a composite number? True Let r(w) = 34w3 - 2w2 + 1. Let q(n) = n2 + 7n + 1. Let b be q(-7). Is r(b) composite? True Is (-252)/(-35) + (-2)/10 a prime number? True Let f = 11 - 2. Let u be 523 + f/3 + -6. Suppose -5j - u = 2y - 7y, 525 = 5y - 4j. Is y a composite number? False Suppose 4m = 4n + 1496, 8n - 1143 = -3m + 4n. Suppose 4z - 4s - 203 = m, 4z = 2s + 588. Is z a composite number? False Let c(f) = -40f - 5. Suppose -q - 4p = 2q + 29, 26 = -2q - 4p. Is c(q) a composite number? True Is (-127)/((-9)/(-15) + (-16)/10) prime? True Let g(s) = -2s3 - 10s*2 - 7s - 1. Let q be g(-6). Let c = -60 + q. Is c a prime number? True Is (-21)/((-20)/4870) a composite number? False Suppose -101 = -4y - a + 114, 0 = 5y + 3a - 260. Is y a composite number? True Suppose h - 4p + 8 - 2 = 0, -2h + 5p = 0. Suppose l + 154 = 5r, -2r = -3r - 5l + h. Suppose r = 3t - t. Is t prime? False Let y(s) = 128s - 1. Let d(m) = -m3 + 4m*2 - 4m + 4. Let i be (-5)/(15/(-18)) + -3. Let p be d(i). Is y(p) composite? False Let x = -13 - -74. Let u = 154 - x. Is u prime? False Suppose 20 = -2n - 3n, -z - 4n + 360 = 0. Suppose 3w - 6947 = g, -5g + z = 3w - 6595. Is w a prime number? False Suppose -5s + 46 = -24. Suppose -4 + 28 = 3u. Is u/28 - (-178)/s composite? False Suppose 4u + 3o = -18 + 6, 20 = 2u - 5o. Suppose ut = t, 3t = -2h + 150. Suppose -5y = 0, -2f + h = 3y - 83. Is f prime? True Let t(u) = 0 + 3 + 44u - 1. Is t(1) a prime number? False Is (-6)/(-2) + 2504 composite? True Suppose -229 + 33 = -4c. Is c a prime number? False Let a = -2 + 4. Suppose -5n - l + 382 = -an, 0 = 4l + 20. Is n prime? False Suppose x + 5 = 10. Let v be 964/10 - 2/x. Suppose -3c = 5l - 583, 4c - 318 = -2l - v. Is l composite? True Let v be (-362)/(-3) - (-4)/(-6). Suppose -2g + v + 50 = 0. Is g a composite number? True Let b(h) = 66h*2 - 4 + 8h - 6h + 0h*2 + 3. Is b(-3) a prime number? True Suppose -2d - 244 = -2x - 56, -3x = d - 270. Suppose 3u = -2v + x, 4v - 189 = u - 0u. Is v a prime number? True Let w(r) = 11r - 3. Let o be 4/11/2. Is w(o) a composite number? False Let f be (1 + -1)/(2 + -1). Suppose f = 4l - 5l. Suppose 0 = 2w - lw - 158. Is w composite? False Let v = 7 - 3. Suppose v = -5k + k. Is 1/(-3)345/k composite? True Let o(r) = r*2 - r + 3. Let q be o(0). Suppose -4f - 32 = -m, 0 = 2m + qf - 2f - 37. Let h = m + -13. Is h a composite number? False Let w(l) = -2l - 6. Let b be w(-4). Suppose -3r + 4o = -0*r - 58, -3	{ "pile_set_name": "DM Mathematics" }
divided by 3471892? -2 Calculate -4619391 divided by 4619391. -1 What is 10046758 divided by 1982? 5069 What is -5 divided by -51027199? 5/51027199 Calculate -16128424 divided by 1. -16128424 205 divided by 1237516 205/1237516 What is -1681100 divided by -25? 67244 Divide -3447168 by 764. -4512 Calculate 896604881 divided by 3572131. 251 4700376 divided by -16668 -282 Divide 8 by 532889. 8/532889 Divide -378743168 by 2958931. -128 Calculate 12773345 divided by 4. 12773345/4 What is -4 divided by -1264617? 4/1264617 Divide -121841187 by 6539. -18633 -368 divided by 62930 -184/31465 Calculate -1689310 divided by 120665. -14 Divide -954269 by -48. 954269/48 -389538 divided by -201 1938 Divide -5391100 by 130. -41470 Calculate 547105338 divided by -65553. -8346 What is -24653328 divided by 921? -26768 0 divided by 3360204 0 -3737191 divided by 1 -3737191 -783728 divided by 438 -5368/3 Calculate 3149188 divided by 4786. 658 Divide 224472711 by 3. 74824237 40522773 divided by -29 -1397337 Calculate 34862952 divided by -8715738. -4 Calculate -2704668 divided by -877. 3084 Calculate -5939163 divided by 17. -5939163/17 Calculate 1321 divided by -33998. -1321/33998 Calculate -7746776 divided by -1936694. 4 -30 divided by -258347 30/258347 Calculate -12860736 divided by -401898. 32 What is -72293920 divided by 14458784? -5 Divide -569503 by -11. 51773 Calculate 2639884 divided by -659971. -4 Calculate 14718033 divided by -22. -1338003/2 Divide -13752 by 9553. -13752/9553 Calculate -131549916 divided by 6197. -21228 What is -1982191940 divided by 4? -495547985 29 divided by 1366669 29/1366669 Calculate -190318576 divided by 56. -3398546 -902 divided by 562098 -451/281049 Calculate 3 divided by 3732799. 3/3732799 Divide -2 by -836522. 1/418261 What is 9380021 divided by 7889? 1189 What is 762949215 divided by -3255? -234393 Divide -1 by -523713. 1/523713 Calculate 36 divided by 712307. 36/712307 Divide -2762 by -8399. 2762/8399 85403 divided by 1 85403 What is 169 divided by 787057? 169/787057 -3094383 divided by 3 -1031461 Calculate -5438 divided by -91811. 5438/91811 Divide -12807058 by -2. 6403529 Divide -16669686 by -363. 45922 Divide 37571988 by 5. 37571988/5 Divide -37752678 by 18876339. -2 Calculate -302843295 divided by -5. 60568659 -395347905 divided by 131782635 -3 Divide 181064823 by 60354941. 3 Calculate 0 divided by 13848022. 0 What is 4880889 divided by -9627? -507 What is 16399 divided by 73? 16399/73 Calculate -23062384 divided by 11531192. -2 Divide 4889174 by -4889174. -1 Calculate 1783914 divided by 453. 3938 141 divided by 725996 141/725996 What is 2280040 divided by -680? -3353 What is -73 divided by -6111794? 73/6111794 -15225 divided by 722 -15225/722 0 divided by -27284969 0 What is -270322632 divided by 113868? -2374 Calculate -19457 divided by 123. -19457/123 7714856 divided by 1928714 4 What is -59326345 divided by 5? -11865269 What is -7 divided by 9961008? -7/9961008 Divide -24755054 by -5. 24755054/5 Divide 9 by -980228. -9/980228 Divide -6 by 1628024. -3/814012 Divide 9678 by -3645. -3226/1215 Calculate 13423830 divided by -447461. -30 Calculate 536 divided by 18150. 268/9075 Divide -1572 by -64344. 131/5362 Calculate 8593615 divided by -1. -8593615 Calculate 475 divided by -671653. -475/671653 Divide -104752968 by 372. -281594 What is -14540978 divided by 7270489? -2 What is -100548 divided by 935? -100548/935 -79985706 divided by 79985706 -1 Divide -113425 by 325. -349 Calculate 380 divided by -1257760. -19/62888 -7655004 divided by 5747 -1332 Calculate -52348320 divided by -145412. 360 Calculate 11213244 divided by -5. -11213244/5 What is 118363458 divided by 37374? 3167 Calculate 4 divided by -219092. -1/54773 -5416748 divided by -2 2708374 -2451157 divided by -1 2451157 What is -8909320 divided by 7? -1272760 Calculate 4550406 divided by 108343. 42 Divide -541328823 by -63. 8592521 Calculate 1916728 divided by -2. -958364 What is -53495842 divided by 1? -53495842 -1 divided by -29400854 1/29400854 What is 2 divided by -1737486? -1/868743 Divide 5698052 by -27. -5698052/27 Calculate 358632570 divided by 71726514. 5 -46854695 divided by -1 46854695 Calculate 242827396 divided by -121413698. -2 Calculate 2083591102 divided by 4. 1041795551/2 What is -91846728 divided by -2482344? 37 Divide 89713575 by -7. -12816225 Divide 0 by 2169282. 0 Calculate 243723 divided by -33. -81241/11 Divide 48939 by -105. -16313/35 What is 40845222 divided by -11? -3713202 Divide -24320125 by -5. 4864025 Divide -5736528 by -26558. 216 4264938 divided by 313 13626 Calculate -1560168 divided by 5592. -279 What is -31419 divided by -5? 31419/5 Divide -250320 by 84. -2980 What is 829385458 divided by 11? 75398678 -119707760 divided by 2 -59853880 -28813068 divided by 7203267 -4 What is 8835 divided by -32579? -8835/32579 What is -960 divided by 34229? -960/34229 107333466 divided by -89 -1205994 Calculate -165 divided by 251970. -11/16798 Divide 240739876 by 4629613. 52 Calculate -40 divided by -223690. 4/22369 Calculate -208918890 divided by 6. -34819815 1250 divided by 7665 250/1533 What is 0 divided by -7027933? 0 Calculate -19588336 divided by 9794168. -2 Divide -338275 by 7. -48325 -23162493 divided by 126571 -183 4884200 divided by 6 2442100/3 What is -167747769 divided by 86961? -1929 What is 0 divided by 7071639? 0 -17 divided by -21551929 17/21551929 5381040 divided by -96090 -56 Calculate -6 divided by 2713624. -3/1356812 Calculate 917713862 divided by 197. 4658446 955049 divided by 2 955049/2 Calculate 1081 divided by 17307. 1081/17307 What is -1745142 divided by -249306? 7 Calculate -1591426455 divided by -3. 530475485 4966936 divided by -1172 -4238 Calculate -1 divided by 11544955. -1/11544955 What is -4 divided by 8349144? -1/2087286 What is 12059420 divided by -2411884? -5 What is -5744620 divided by -41033? 140 -4212010 divided by 842402 -5 Divide -2 by 155133004. -1/77566502 What is 215430920 divided by -5? -43086184 Divide -9 by 21020315. -9/21020315 Divide -16 by 14892286. -8/7446143 What is 5 divided by 296525? 1/59305 Calculate -6 divided by -12196262. 3/6098131 Calculate 6836615 divided by 1367323. 5 Divide 203113320 by 50778330. 4 Calculate -3198 divided by -41. 78 Divide -10 by 1315043. -10/1315043 Divide -62704 by 8557. -62704/8557 What is -20851200 divided by -1440? 14480 What is -348 divided by 13460? -87/3365 Calculate -1442995 divided by -5. 288599 Divide 13 by -11635741. -1/895057 Calculate -2929108 divided by 732277. -4 Divide -105 by 817446. -5/38926 What is 100569756 divided by 513111? 196 Calculate -89465256 divided by 12. -7455438 -3928965 divided by 5573 -705 117760 divided by 20 5888 Divide -45516977 by 4137907. -11 Divide 122577676 by -4714526. -26 What is 32681600 divided by -116720? -280 Calculate -29 divided by 1757858. -29/1757858 Calculate 32649 divided by 2215. 32649/2215 Divide 876944 by -38128. -23 What is 2439675 divided by -4647? -525 1546192 divided by -16 -96637 Divide -4012666 by -573238. 7 Divide -4200 by -7271. 4200/7271 Calculate -120327048 divided by 40109016. -3 Calculate -6048726 divided by 3. -2016242 What is 81094 divided by 26? 3119 What is -516258296 divided by -346? 1492076 Calculate 140 divided by 29416. 35/7354 -290779 divided by 2812 -290779/2812 Calculate -19910 divided by -441. 19910/441 Divide 594462144 by -12. -49538512 Divide 0 by -1217569. 0 Divide 38820 by 1819. 38820/1819 Divide 0 by -6069149. 0 Divide 2170723 by 2. 2170723/2 36 divided by 5919039 4/657671 What is -11865798 divided by 847557? -14 Divide 246109800 by -200. -1230549 -346191 divided by -18 115397/6 -16242089 divided by 3 -16242089/3 What is -39369 divided by -449? 39369/449 What is 1 divided by 1532200? 1/1532200 -21299076 divided by 1 -21299076 Calculate 193447 divided by -282. -193447/282 Calculate 7131504 divided by -1782876. -4 What is 0 divided by -3117424? 0 2146720 divided by 5 429344 12663 divided by 110 12663/110 Calculate 7014448 divided by -784. -8947 Calculate -87 divided by -14625. 29/4875 What is 608173618 divided by 46782586? 13 Divide -182600565 by 345. -529277 -389276664 divided by 27805476 -14 Divide 108345 by 142. 108345/142 Calculate 96810875 divided by 8. 96810875/8 -5 divided by 6351736	{ "pile_set_name": "DM Mathematics" }
. -5 Solve -n - 6 = 5k, 4 = n - 0n - 5k for n. -1 Solve -7 = u + 2u + l, 0 = 3l + 3 for u. -2 Solve -65c = -5u - 69c + 36, -2u - 4c = -24 for u. 4 Solve n - 26 = 5q, 24n + 5q + 24 = 23n for n. 1 Solve -5o - 20 = 2i, 4i + 4o - 8 + 24 = 0 for i. 0 Solve 5x - 2k = 2k, 4x = -2k for x. 0 Solve -4g + 7 = -u, -4u - 11 = g - 0u for g. 1 Solve -10 = -v - 3k - 14, 3k = 4v + 16 for v. -4 Solve -2h + 9 = -5r + 3, 3r = -5h + 15 for r. 0 Solve -12 = 11x - 12x + 5r, -3x + r = 6 for x. -3 Solve -5z = -11h + 8h + 2, 0 = -3z - 3h - 30 for z. -4 Solve 3o + 10i + 8 = 5i, -8i = 5o + 12 for o. 4 Solve -4o + l + 21 = 16, -l = -3o + 5 for o. 0 Solve -12 = 4k - 4y + 4, 0 = -5k - 2y + 15 for k. 1 Solve -3q - 2 = -2w, 4q - q + 3w = -12 for q. -2 Solve m = -f - 1, 4f + 5 = m + 1 for m. 0 Solve 10y - 7y - 2g = 3, 3y + 2g = 3 for y. 1 Solve 2d + 4w - 22 = 0, -3 = -d - 3w + 13 for d. 1 Solve -5z - 3y = 19, 3z - 4y = 4z + 14 for z. -2 Solve -3k + 1 = -3y - 8, 3y + 23 = -4k for k. -2 Solve 6 = -t + a, 6a + 8 = -2t + 7a for t. -2 Solve -12 = 42u - 45u + 2c, 2c = -5u + 20 for u. 4 Solve 0 = -o, 5o - 8o - 2 = -v for v. 2 Solve 0 = p - 3p - 4f + 12, -p - 5f + 12 = 0 for p. 2 Solve -32h + 27h = 3a - 20, -3h = 3a - 18 for a. 5 Solve 3q + 35z = 30z - 13, 5q + 1 = 2z for q. -1 Solve -3m - 4s = -12, -3s + 7 = 3m - 2 for m. 0 Solve -3d = 3g + 9, -3d - 2g + 7g + 15 = 0 for d. 0 Solve 0 = -3j + 4j + z + 4, -2j - 12 = 4z for j. -2 Solve -2b - 12 = 4a, -5b + 47a - 42a = 0 for b. -2 Solve 5k - 2u + 2 = -u, -4 = 4k - 2u for k. 0 Solve -5q - 5o = 10, 3q + 26o = 24o - 5 for q. -1 Solve -5a - 45l + 46l + 16 = 0, 5a - 2l = 17 for a. 3 Solve 2y + 33 = -5i + 5, -3i - 12 = 0 for y. -4 Solve q + 52 = -3i + 58, 2i - 17 = -5q for q. 3 Solve -5p = 0, 6p + 15 = 3z - 8z + 7p for z. -3 Solve 5t - 6 = -2v - 3, -v = 5t - 4 for t. 1 Solve -5x = -3g + 7, -4 + 2 = -g + 2x for g. 4 Solve -2h + 0 = -2g + 2, -4g = -5h - 5 for g. 0 Solve 5 = 4w + 4k + 1, -4k - 1 = 3w for w. 5 Solve -17a + 18a = -5c + 21, 17 = 3c + 5a for c. 4 Solve 4m - 18 = z - 24, -m - 10 = 4z for z. -2 Solve -4h = 0, -3z - 3h + 25 = 2z for z. 5 Solve 5m = 5n + 5, 3n = 4m + m + 3 for m. -3 Solve -3l + 5l - 4 = 0, -5w + 2l - 9 = 0 for w. -1 Solve 0 = 3b + 2r + 9, -3r - 11 = b - 1 for b. -1 Solve 0 = -334l + 335l + 2d + 6, d = -2l for l. 2 Solve 166r - 170r + g = -15, r - 18 = 5g for r. 3 Solve 4z - 2c = -12, 3c + 9 = -z + 5c for z. -1 Solve 8o = 5o - 6, 0 = 4d - 4o - 20 for d. 3 Solve 5p = -5l - 10, 4p + 4 + 2 = -2l for l. -1 Solve -5 = -5h - 2x, -5h + x - 30 = -4x for h. -1 Solve 0 = 3j + 3i, 2i = -5j - 2i + 1 for j. 1 Solve 0 = 3d - 3y + 6 + 18, 2d - y + 12 = 0 for d. -4 Solve -2q - 3o + 5 - 3 = 0, 2q = -o - 2 for q. -2 Solve -2z - 3 = y, -3z + 4y - 24 = -2z for z. -4 Solve -g + 11 = -0z - 3z, -2z - 26 = 4g for g. -4 Solve n - 6 = -5c, 0 = 4n + 2c - 4c + 20 for n. -4 Solve 4c - 3p = 15, 6c - 12 + 2 = 2p for c. 0 Solve 0 = 5m - 5f - 30, 3m = 5f + 1 + 25 for m. 2 Solve -2f + z - 29 + 24 = 0, -15 = 3f - 4z for f. -1 Solve 0 = 5c + 2y + 1, 25c - 30c - 3y + 1 = 0 for c. -1 Solve 0 = -7b + 2b + w, -4 = b - w for b. 1 Solve 2y = 2t - 8, 0 = 2t + 13y - 14y - 8 for t. 4 Solve -3q + 4g - 35 = 0, g + 15 = 4g for q. -5 Solve -8h = -5h + 3f, -h = -4f for h. 0 Solve -3j + 10 = -4m - 2, 5m + 15 = -j for j. 0 Solve -25 = 5g + 2q - 7q, 0 = 3g - 2q + 13 for g. -3 Solve 5l + 4q + 4 = 0, 0q - q - 4 = 2l for l. -4 Solve 4a - f + 39 = 61, -3f - 6 = 0 for a. 5 Solve t - 2l - 7 = 0, -17t + 19t = -5l - 31 for t. -3 Solve 3 = n + 2h, 4h - 6 = 2h for n. -3 Solve -4f + 3 = -3a, -16f + 5 = -5a - 17f for a. -1 Solve -5t - 11 = 2b, -5t = -0t + 15 for b. 2 Solve 2d + 2t - 10 = 0, -9d + 7d = 3t - 15 for d. 0 Solve -2d - 7 = -c, 0d = -4d - 4 for c. 5 Solve 0 = 4j + 4g + 8, 0 = -j + g + 4 for j. 1 Solve 3g - y - 33 = -44, 0 = -4g + 2y - 16 for g. -3 Solve 2h + 2w + 21 = 19, 5w + 11 = -3h for h. 3 Solve 2g - 6 = 2q, 3g + 11 = 2q + 16 for g. -1 Solve -4t + 14g + 3 = 15g, 2 = 3t + g for t. 1 Solve 0d - 5t - 20 = -d, 0 = d + t + 4 for d. 0 Solve -2n = -2t + 10, -16 = 3n + 39t - 43t for n. -4 Solve 2k + 36 = 3y + 51, -3k + 6 = y for k. 3 Solve l + 4g + 27 - 9 = 0, 5l + g - 5 = 0 for l. 2 Solve -3o = 4g + 35 - 0, 5o + 2g + 35 = 0 for o. -5 Solve 3p = a + 7 + 2, -2a + 4 = 5p for a. -3 Solve 0 = -0g + 2g, 4q - 5g + 8 = 0 for q. -2 Solve -2v + 2 = 0, 5j + 4v + 1 = 5 for j. 0 Solve i = -4w + 2w + 3, 0 = 2w + 2 for i. 5 Solve 3c + x = -1, -6 = -x - 2x for c. -1 Solve 3b + 0l = 4l + 3, -l + 5 = 5b for b. 1 Solve -3g = r + 13, 1 = 3r - 5 for g. -5 Solve 5 = y - 2j, 0y + 2y = 5j + 11 for y. 3 Solve 2t = 5d + 17, 2 = d + 5t - 0t for d. -3 Solve -2n = -4b - 12, -16n = -21n + 4b + 24 for n. 4 Solve -4k - 5v = 30, -6v = k - v + 15 for k. -5 Solve 2w - 5w - 2i - 5 = 0, -5i = 20 for w. 1 Solve 7 = 3a - 4t - 24, -a = t - 1 for a. 5 Solve -12 = -3f, 3 + 47 = -5i + 5f for i. -6 Solve -4b - a = -17, 5b + a - 5 = 4b for b. 4 Solve 4z - 25 = 2z + 5j, 0 = -z + 5j + 25 for z. 0 Solve 0r + 13 = -4r - y, -4r + 5y = -17 for r. -2 Solve 0 = 5p - 5d - 30, 14p + 11 = 17p + 4d for p. 5 Solve -a - 57w - 25 = -52w, 5w = -25 for a. 0 Solve -p = -2l - 0 - 3, -p + 11 = -4l for l. -4 Solve -k + 6 = k, -2s - 5 = -k for s. -1 Solve -3z = f - 16, 4z = 3f + 16 + 1 for z. 5 Solve x = 5t + 5x + 11, 0 = 5t - x + 16 for t. -3 Solve 5b = -2n - 7, 4b - 5n = 8 - 7 for b. -1 Solve 2y = 2z - 4, 0y + 3z = y + 8 for y. 1 Solve 15 = 5q - 5, g + q - 7 = 0 for g. 3 Solve -3z + 8 = 7i - 6i, -5z = 3i - 12 for i. -1 Solve -5p + 5 = -5k, 0 = -2k + k - 4 for p. -3 Solve 6 = -5h - 5m + 21, -3h = -4m + 26 for h. -2 Solve 2w - 3c + 3 = 3w, -2w - 4c + 2 = 0 for w. -3 Solve -5w = 4i - 31, -5w + 6i - i - 5 = 0 for w. 3 Solve -8y - 15 = -9y - 3g, -y + 19 = 4g for y. 3 Solve -1 = -3n - 2i, 58i = -5n + 56i - 1 for n. -1 Solve 3 + 0 = -4s - 5d, s + 5d + 12 = 0 for s. 3 Solve 5i - 2 + 0 = 3x, 3i + 4x = 7 for i. 1 Solve 2l = -5q + 4, -3q - 5l + 10 + 0 = 0 for q. 0 Solve 5k = 3h - 5h - 20, -3k = 3h + 12 for k. -4 Solve u + 5 = m - 0m, 0 = -5m + 3u + 25 for m. 5 Solve -5 = g, 5g + 25 = 9k - 13k for k. 0 Solve -k + 24 = -5p, 0 = -p - 3p - 5k - 25 for p. -5 Solve -k = -4w + 3, 0 = 5k - 2w - 0w - 21 for k. 5 Solve -b = -3x, 9x + b + 5 = 7x for x. -1 Solve -4u = -5u + z, -2u + z = 5 for u. -5 Solve 5w - 15 = 0, 3n - w + 24 = 30 for n. 3 Solve 19 = -4r + 3i + 15, -2r = -4i - 8 for r. -4 Solve -5f - x - 4x + 5 = 0, f - 4x = 11 for f. 3 Solve 3d = -u + 11 - 8, -d + 17 = -5u for u. -3 Solve x + 2a + 5 - 1 = 0, -4x + 2a + 14 = 0 for x. 2 Solve 2q = -5t, -5t + 15q + 15 = 14q for t. 2 Solve 4u + 4w = 32, u + 28 = 6u + 2w for u. 4 Solve -5x = -x + 4t - 8, -2x - 4t + 4 = 0 for x. 2 Solve -5j - 33 = c, -4j - 4 = 20 for c. -3 Solve 5s + 24 = 3c + 13s, 5c - 9 = -3s for c. 0 Solve -5k + 24 = 4y, 2y - 10 - 2 = 3k for y. 6 Solve -2x + 9 = 2a - 5, -x + 17 = 3a for a. 5 Solve 0 = 2l + 4b + 14, 4l + l - 3b - 30 = 0 for l. 3 Solve -1 + 13 = -5j + 2g, 3j + 4g + 2 = 0 for j. -2 Solve -10x + 3 = -13x - 3p, 4x + 3p = -7 for x. -4 Solve -2v + 11 = u + 16, 2v + 3 = u for v. -2 Solve 0 = 5b + 5t + 24 - 14, -3b + 2t = -14 for b. 2 Solve 5j = -20, f - 20j + 24j = -16 for f. 0 Solve 3l + 1 = 5d - 2, l = d + 1 for d. 3 Solve -4i + 16 = -4x, 6 = -239x + 241x + 5i for x. -2 Solve -t = 3n + 14, 2n = t + 1 - 7 for n. -4 Solve 7k = d - 0d + 30, -k + d = -6 for k. 4 Solve 4x + t + 34 = 57, 3x - 24 = -3t for x. 5 Solve 13 = -4u - c, -3c - 7 = 4u - 0c for u. -4 Solve -14j + 1 = -l - 16j, 4l = 5j + 22 for l. 3 Solve -5d + 1 = -10d - 4z, -13 = -3d + z for d. 3 Solve -2m + q - 4 = 0, 3m - 5m = -2q for m. -4 Solve l = 5l + 5d - 10, 0 = -3l + 4d + 23 for l. 5 Solve 12 = -5l + 4v - 21, 0 = 2l + 4v + 2 for l. -5 Solve 3v + m = -m - 3,	{ "pile_set_name": "DM Mathematics" }
- 5o, o + 12 = 3p. Calculate the greatest common factor of p and 48. 3 Let s(h) = -18h - 11. Let j be s(-2). Suppose -22l = -jl + 255. Calculate the highest common divisor of l and 34. 17 Let i = 315 + -291. What is the highest common divisor of i and 88? 8 Let b(s) = s3 + 21s*2 + 39s + 25. Let c be b(-19). Let m = 314 + -218. What is the highest common divisor of m and c? 6 Suppose -3c + 4c = 7. Let u(g) = -g*2 - 11g + 5. Let s be u(-11). Let o = 9 + s. Calculate the highest common factor of o and c. 7 Let r(o) = o + 125. Let a be r(22). Calculate the highest common factor of 105 and a. 21 Let w be (-5 + 0)/(3 + 174/(-57)). Calculate the highest common factor of w and 19. 19 Suppose -4f = -4h - h + 34, -9 = -h + 3f. Let u be (-2)/(-1) + (-1 - -5)16. Calculate the greatest common divisor of u and h. 6 Let x(n) = -n*2 - 36n - 170. Let c be x(-29). What is the highest common divisor of 429 and c? 33 Let t = 255 + -448. Let c be 2 + 2/1 + t. Let y = -89 - c. What is the highest common divisor of 40 and y? 20 Let z = 699 - 400. Calculate the greatest common factor of z and 39. 13 Let k be (-63)/15(-6390)/54. Calculate the highest common divisor of k and 213. 71 Let i be (-14 + 66/3)22/4. Calculate the greatest common factor of 880 and i. 44 Let m = -782 - -840. What is the highest common divisor of m and 551? 29 Suppose 7y + 106 = 5y. Let t = y - -22. Let h = -11 - t. Calculate the greatest common divisor of 4 and h. 4 Let s = 322 - 190. Suppose 2g - s = 4i - i, 5i + 80 = g. Calculate the highest common divisor of 36 and g. 12 Let m = -160 - -178. Calculate the greatest common divisor of 99 and m. 9 Let v = 12 - -38. Let a be (0 - -28)/(-4 - -3). Let o = a + v. What is the greatest common factor of 198 and o? 22 Suppose -3o = -6, -3o + 6 = 5m + 70. Let d(n) = -14n - 20. Let x be d(m). Let t = 16 - 0. What is the greatest common factor of x and t? 16 Suppose 13v - 8 = 17v. Let h be (43 - v)4/6. Calculate the highest common divisor of 15 and h. 15 Let z(f) be the third derivative of f*6/120 + 3f5/20 + f4/8 + 3f3/2 - 12f*2. Let t be z(-8). What is the greatest common divisor of t and 7? 7 Suppose -6i + 273 = -3i. Calculate the greatest common factor of i and 13. 13 Let h(u) = -96u - 165. Let d be h(-5). Calculate the greatest common factor of 35 and d. 35 Suppose -10w = -410 - 970. Calculate the greatest common divisor of 92 and w. 46 Suppose -q + 5q + 1 = n, 0 = 5n - 5q - 5. Suppose 3s - s = 14. Calculate the highest common factor of n and s. 1 Let k be (1139/51)/((-2)/(-6)). Suppose -k = -2j + f + 18, 4j = -5f + 191. What is the greatest common divisor of 11 and j? 11 Suppose -120 - 636 = -54q. What is the highest common factor of 854 and q? 14 Let s = -857 - -1501. What is the highest common divisor of s and 28? 28 Suppose 0 = -2s + 84 + 276. Calculate the greatest common factor of s and 108. 36 Let f(g) = 32g + g2 - 69g - 51 + 34g. Let o be f(12). Suppose 3r - 57 = -0r. What is the greatest common factor of r and o? 19 Let v(g) = -6g + 10. Let y(n) = 7n - 9. Let d(t) = 6v(t) + 7y(t). Let i be d(2). Calculate the greatest common factor of 23 and i. 23 Let a(o) = -o2 + 11o - 5. Let s be a(10). Suppose -k = sk. Suppose 0 = 4u - ku - 36. What is the greatest common factor of 45 and u? 9 Suppose -406 + 2266 = 4r + 3m, -2r - 2m + 932 = 0. Let g = -327 + r. Calculate the greatest common divisor of 54 and g. 27 Let w = -41 + 39. Let v(x) = -10x*3 - 3x*2 - 3x - 2. Let k be v(w). What is the highest common divisor of k and 18? 18 Suppose 2m - 8m = -30. Suppose 24 = ma + 5j - 6, 5a - 24 = -2j. Suppose 2l + 20 = al. What is the highest common factor of l and 10? 10 Let t = 1798 + -1792. Calculate the highest common factor of t and 1080. 6 Let q(f) = -f*3 + 6f*2 + 11f - 4. Let i be q(7). Let k be (0 + 8)(-3)/(-12). Suppose kd - 4d = -72. What is the highest common divisor of d and i? 12 Let i be (-6 + -1)(0 + -1). Let g = 98 + -103. Let a = g + i. What is the highest common factor of 3 and a? 1 Let o be (-37)/2 + 12/8. Let x(j) = -3j - 15. Let i be x(o). What is the highest common factor of 252 and i? 36 Let l = 559 - 479. Calculate the greatest common factor of l and 10. 10 Let r(o) = o3 - 17o*2 + 18o + 4. Let t be r(16). Suppose 10h - 12h = -t. What is the greatest common factor of 45 and h? 9 Let p = -7 - -17. Suppose 0 = -6h + 9h - 642. Suppose 0k - h = -3k - o, 2o = -5k + 358. Calculate the highest common divisor of p and k. 10 Let i(m) = 452m3 - 3m*2 + 2m. Let n be i(1). Calculate the highest common factor of n and 82. 41 Let q = -16 + 32. Let g(j) = -j + 4j2 - 4j - 5j - 5j*2 + 16. Let b be g(-8). Calculate the highest common divisor of b and q. 16 Let f = 7 - 8. Let p be -3((-4 - f) + 6). Let d be ((-104)/6)/(3/p). Calculate the greatest common factor of 13 and d. 13 Suppose -f - 2h - 1 = 0, -2f + 25 = -8h + 3h. Let v(n) = -n*3 - 10n*2 + 20n - 43. Let p be v(-12). What is the greatest common factor of f and p? 5 Let a = 20 + -15. Suppose -as + 114 - 39 = 0. Calculate the highest common divisor of 10 and s. 5 Let g(l) = 3l*2 + 3l + 42. Let o be g(-10). What is the highest common divisor of 24 and o? 24 Suppose 0 = y - 3. Suppose yb + 2b = -10. Let c be (-108)/(-60) + b/(-10). What is the highest common factor of c and 18? 2 Suppose -2r + 0r + 115 = -q, 0 = 2r + 2q - 118. Let p = r + -28. Calculate the greatest common factor of p and 75. 15 Let j(i) = 40i + 40. Let l be j(3). Calculate the greatest common factor of l and 5. 5 Suppose -299 = -2l + 3z, 0 = 5l + 3z - 2z - 756. Let s be (-2)/(-1 + -1) + -68. Let d = s + l. Calculate the highest common divisor of 12 and d. 12 Suppose -5c - 2r + 123 = -3r, -2c + 2r + 54 = 0. Let s = 140 + -104. What is the greatest common divisor of s and c? 12 Suppose 0 = -b - 2u + 8 + 2, -2b = 5u - 17. Suppose -2g - 3 = -19. Calculate the highest common factor of g and b. 8 Let z = 2 - -10. Suppose -3h - 33 = -357. What is the greatest common factor of z and h? 12 Let m be 8 + 114/(-14) + (-478)/(-14). Calculate the greatest common factor of 986 and m. 34 Suppose -q = 2j - 24, -5q - 4j = -3j - 156. Suppose -2n + q = t, 3t - 76 = n + 20. Calculate the greatest common divisor of t and 160. 32 Let q = 31 - 22. Let b = 17 - q. What is the greatest common divisor of b and 88? 8 Suppose 3z - 4s - 176 = 0, -228 - 44 = -4z - 4s. Calculate the greatest common factor of 168 and z. 8 Let g(n) = -11n - 77. Let v be g(-8). Calculate the highest common divisor of v and 1397. 11 Let f = -431 - -575. What is the greatest common factor of 90 and f? 18 Let l = 7 - 4. Let r = 285 - 284. What is the highest common divisor of r and l? 1 Suppose -6 = m - 12. Let y(f) = f - 6. Let q be y(m). Suppose 0 = 3i - 3k - 750, -3k = -qi + 3i - 768. What is the greatest common divisor of i and 23? 23 Let s(j) = -4j + 9. Let f be s(-10). Calculate the greatest common divisor of 392 and f. 49 Let f = 122 + -122. Suppose f = -2m + 178 - 66. What is the highest common factor of 14 and m? 14 Let u(z) = -8z + 107. Let f be u(-5). What is the greatest common divisor of f and 196? 49 Suppose -2z = 2u - 674, 3z + 5u - 411 - 590 = 0. What is the highest common factor of z and 38? 38 Let k be (2/6)/(2/30). Suppose -26q + 12 = -24q. Let f(j) = j2 - 3j - 3. Let s be f(q). What is the greatest common divisor of k and s? 5 Suppose -3i + 9 = -3l, -3l + 2i - 6 = -0i. Suppose 5d = 2d + 69. Suppose l = p - 2p + d. Calculate the highest common factor of p and 138. 23 Suppose -4q + 12 = -3a - 12, -3a = 4q. Suppose 6u + 111 = 27. Let i = a - u. Calculate the greatest common divisor of i and 90. 10 Suppose 2a - 2s - 92 = 0, 0 = -5a + 2s + 45 + 179. Suppose -2v + 0v = -a. Calculate the highest common factor of v and 154. 22 Let j = -705 + 1314. Calculate the highest common factor of 174 and j. 87 Let p be ((-5)/((-10)/(-8)))/(-1). Let d be 30/40 - (-58)/8. Calculate the highest common divisor of p and d. 4 Let x be (5/(-3) - -3)39. Suppose -j + 3m + 0m = -23, 0 = -3j + m + 77. What is the greatest common divisor of x and j? 26 Let y(t) = -2t*2 + 8t + 20. Let m be	{ "pile_set_name": "DM Mathematics" }
- r. Solve -5u - 34 + x = 0 for u. -5 Let f be (-28)/(-49) + 4/((-84)/(-639)). Solve -11 = 5l - f for l. 4 Let y(c) be the first derivative of -c*3/3 - 5c*2/2 - 4c + 6. Let l be y(-3). Solve -lf + 5 - 1 = 0 for f. 2 Let r(d) = -d2 - d + 2. Let o be r(-3). Let w(i) = i2 + i - 3. Let j be w(o). Let x be (-6)/j - (-34)/6. Solve 3k - 10 = xk for k. -5 Let m(j) = j2 - 5j + 5. Let r be m(5). Suppose 0 = rq - 10. Solve -y = q + 1 for y. -3 Suppose 2z - 24 = -4z. Solve y = z - 2 for y. 2 Suppose 5s = 4 + 6. Solve sh + h = -15 for h. -5 Let l(y) = -y + 0y*2 - 1 + 3y*3 - 2y3 + y2 + 0y2. Let t be l(-1). Solve 0v - 3v = t for v. 0 Suppose 3v = -2v + 5. Solve -7 = -2w - v for w. 3 Let m = 49 - 46. Solve -mc + 2 = 5 for c. -1 Let r be (-256)/10 - 4/10. Let m = -37 - r. Let z(i) = i3 + 12i*2 + 11i + 2. Let p be z(m). Solve -v - p = -5 for v. 3 Let d(x) = -x*3. Let a(l) = -7l*3 + l - 1. Let z(n) = -a(n) + 2d(n). Let f be z(1). Let v = 1 + 15. Solve fj + v = j for j. -4 Suppose 29 = 3x - 37. Solve -6 = -4b - x for b. -4 Suppose -5q = -5 - 0, -3q = 5y - 3. Let o be y/(-1 - 0/2). Solve ov - v = 5 for v. -5 Let p(h) = 3h - 12. Let s be p(4). Solve 2 = 2j - sj for j. 1 Let z = -11 - -4. Let j = 12 + z. Solve 10 = -jp - 10 for p. -4 Let v be 1/(1/3) + -1. Solve vt = t - 3 for t. -3 Let y(c) = -c*2 + 6c + 5. Let d be y(6). Let z be d/((1 - 0)/1). Let l = -10 + 12. Solve zn = -l + 27 for n. 5 Let s(t) = -t2 + 6t + 6. Let j be s(6). Solve -4v + 6 = -j for v. 3 Suppose 4o - 4v - v - 18 = 0, 3v + 4 = -o. Solve -2t = o + 2 for t. -2 Let f = -7 + 9. Solve 0 = -fg - 0g + 10 for g. 5 Let k = 0 - 0. Let g(v) = 2v*2 - 2v + 2. Let s be ((-76)/(-28) + -3)-7. Let n be g(s). Solve 4z - 2z - n = k for z. 3 Let j(o) = 2o - 1. Let s be j(2). Let l be 2-1 - (-3 - 1). Let w(i) = i2 - 3i + 3. Let a be w(l). Solve y + a = -s for y. -4 Let c(p) = 5p - 6. Let o be c(3). Solve -2s - o = -1 for s. -4 Let o(w) = w3 + w2 + 4. Let x be o(0). Let g = -29 + 17. Let v = g - -16. Solve -va - x = -2a for a. -2 Suppose -3h - 460 = -5n, -n - 4n = 2h - 435. Suppose 0 = 2g - 4g + 10, 4u + n = -3g. Let d = u + 37. Solve -3l - 5 = -d for l. 2 Suppose -5u - 54 + 19 = 0. Let t = 24 + u. Solve -1 = -4l - t for l. -4 Let c = 5 - 5. Suppose -3b - b + 3p + 1 = c, 5p = -3b + 37. Solve bf = 6f for f. 0 Suppose 4r - 6 = 3l + r, 5l = -r + 14. Solve 2z = -lz - 8 for z. -2 Let x = 5 + -8. Let z = 6 + x. Solve -zj + 2 = -j for j. 1 Suppose o = 5r + 2o - 140, r - 28 = 5o. Let s = r - 14. Suppose 2m + m + h - s = 0, -3m - 3h = -24. Solve 4b + m = -13 for b. -4 Let p(i) = i*3 - i + 2. Let a be p(0). Solve r - 6 = -ar for r. 2 Suppose -2z = -c - 0 + 28, 8 = c + 2z. Suppose -3 = s, 48 = l - 5s + c. Solve 2m + l = -m for m. -5 Let d(j) = j2 - j - 2. Let f(i) = i2 - i + 3. Let g be f(0). Let u be d(g). Let h = -6 - -6. Solve -q - u = -hq for q. -4 Let t = -20 + 22. Solve -w = -tw - 3 for w. -3 Let y(j) = j - 7. Let p be y(8). Let k = -2 + p. Let q = k + 9. Solve m + m = q for m. 4 Suppose -3b + 32 = 4j, j + 4b - 25 = -b. Suppose q = -7u + 2u + j, 3u = q - 5. Solve q + 4 = -3z for z. -3 Let w = -12 + 19. Let i(c) = -c3 + 6c*2 + 10c - 10. Let m be i(w). Solve 0 = 4u + m - 3 for u. -2 Suppose 0 = 5t + 7v - 3v - 14, t - 6 = -4v. Solve -tc = 2c - 12 for c. 3 Suppose 0 = 2l - 5y + 15, 3y = -4l + 9 - 0. Suppose 7 = w + b, lw + 60 = 4w - 4b. Suppose 0z = -5z. Solve 3v + 4 + w = z for v. -5 Let t = -21 + 26. Solve -28 + 8 = tv for v. -4 Suppose -4u = -4x + 8, -u - 5x + 28 = -0u. Let n be 1/(-1)-2 - -14. Solve n = f + uf for f. 4 Let n be (-2 - (-2 - -3)) + 8. Let i be 4((-7)/(-4) - -2). Solve 0k = -nk + i for k. 3 Suppose 0 = 2y - 3m, -4m = 4y - 0m - 40. Solve ya = 3a + 9 for a. 3 Suppose -2n - 2w + 3w = -3, 4n - 27 = -5w. Solve -n + 4 = -l for l. -1 Suppose c + 86 - 91 = 0. Solve 2a + c = -5 for a. -5 Let a(x) = -x*2 - 8x - 7. Let g(t) = t - 13. Let h be g(10). Let j be 1 - (0/h - -7). Let d be a(j). Solve 0 = -3q + dq for q. 0 Let j = 52 - 50. Solve 0 = jc + c for c. 0 Suppose -3 = 3v, 5t - v + 6 = -8. Let a = -8 - t. Let c(w) = -3w - 5. Let l be c(a). Solve k + 4k = l for k. 2 Let a be (-82)/4 + 5/10. Let p be (-1 + 6)(-8)/a. Solve 3j = pj - 2 for j. -2 Let y = -21 - -46. Solve 0o + y = -5o for o. -5 Let a(m) = m*3 + 4m*2 + 2. Let q be a(-4). Solve -qr + 5r + 12 = 0 for r. -4 Suppose -3g + 5 = -0n + n, -4 = -4n - 4g. Let w = 1 + n. Solve v + w = -2 for v. -2 Let c be 2-34/(-8). Suppose cv = 7v - 12. Solve -v = -b - 8 for b. -5 Let l = -43 + 48. Solve -l = -5w + 10 for w. 3 Let w = 5 - 3. Suppose -4 = -4b + wb. Solve 0 = x + 3 + b for x. -5 Suppose -4d - x + 13 = 0, 2d + 2x = -2x - 4. Let g = -1 + 3. Let b = g + 0. Solve df + 14 = -b for f. -4 Suppose 5t = t + 8. Solve -tl - 3l = 5 for l. -1 Let b = 1 + 2. Let z = 37 + -21. Suppose 3x + 7 = 4h, -5x - 5 = -h - z. Solve -x = -bw + 6 for w. 3 Let u be (-4)/(-2) - (-14 + 0). Suppose -5p + 49 = 4w + 4, 0 = -4p + 5w - 5. Suppose 0 = pl - 3n - 25 - 12, 25 = l - 5n. Solve lf + u + 9 = 0 for f. -5 Let q(y) = -2y3 - 2y*2 + 2y + 3. Let u be q(-2). Let p be 5/7 - (-2)/u. Solve -v + 3 = -p for v. 4 Suppose 4l - 36 = -2w, -2w - 2w + 40 = 4l. Let m = l - -18. Suppose -2r + r = 2, 3r + m = 5d. Solve 0 = dt + t for t. 0 Suppose -9v = -4v - 25, -j - 5v + 28 = 0. Solve -1 = -ju + 2 for u. 1 Let r(v) = v3 - 10v*2 + 9v + 2. Let s(k) = -4k + 1. Let c(a) = a3 - 2. Let l be c(0). Let h be s(l). Let u be r(h). Solve up + 5 = -1 for p. -3 Let x(d) = d*3 + 5d2 - d - 4. Let v(j) = -j3 - 5j2 - 3j + 4. Let q be v(-3). Let f be x(q). Solve -2u + f = -1 for u. 1 Let j be 9/(-1(-3)/2). Let m = j - 3. Solve q + 2 = m for q. 1 Let k(o) = 2o2 + 11o + 19. Let p(u) = u*2 + 5u + 9. Let y(f) = -6k(f) + 13p(f). Let j be y(0). Solve -m = -jm for m. 0 Let n = -1 + 9. Let y = n + -8. Solve y = 2r + r + 15 for r. -5 Suppose 5l - 9 = s, 0 = 2l + 2s - 4 - 2. Suppose 4z - 22 = -l. Suppose y - 6y + 60 = 0. Solve -zh + y = 2 for h. 2 Suppose 8l = 5l. Solve r + 1 + 0 = l for r. -1 Let k be ((-2)/(1 - 0))/(-2). Let j be 3/(1/(2/3)). Let t = j + k. Solve th - 5 = -2 for h. 1 Let n be (-14)/(-10) + 6/(-15). Let m = n - 1. Solve 3a - a + 10 = m for a. -5 Suppose -5b = -5q - 40, -4q - 2 = 2b - 6. Let j be (50/b)/(1/3). Solve -i + j = 4i for i. 5 Let l(y) = -y - 2. Let z be l(-1). Let v be 2/(-4)(z + 1). Solve -2a + 8 = -va for a. 4 Let u(m) = -m*2 + 5m + 8. Let q be u(6). Solve -12 = p + qp for p. -4 Let f be (-3)/((-30)/4)10. Let y = 0 + 0. Solve y = n + fn for n. 0 Let c(p) = 2p*2 + 2p - 2. Let h be c(1). Solve -hk - 4 = -3k for k. 4 Suppose 0 = -f - 2f - j - 1, -2f - j - 1 = 0. Let i be 2/5 + (-7)/5. Let a be (3 + -3)/(f + i). Solve a = 2x - 5x - 3 for x. -1 Suppose 0g - 9 = -2h + g, 5h = -3g + 17. Solve 2 = ho + 14 for o. -3 Let i be (4/6)/((-8)/(-36)). Suppose 2c = -m + 9, 36 = im - 5c + 2c. Solve 5r + m = -9 for r. -4 Let v = -7 + 11. Suppose -5i + vi + 2 = 0. Let r = 0 + 3. Solve ra = -ia + 10 for a. 2 Suppose -m - w = -2w + 2, -2w + 18 = 5m. Let u = 3 - m. Solve -6 = 5z - u for z. -1 Suppose 2s - 4 = s. Suppose 2h - 6h = 0. Suppose t - 3g - 12 = h, 5g = -st + 11 + 3. Solve p + t = -p for p. -3 Let j be ((-84)/105)/((-2)/5). Solve -jt + 5 = 13 for t. -4 Let m = 37 + -31. Solve m = -5b + 1 for b. -1 Let j = 2 + 0. Suppose jt + 2 = 0, -6v + 5t = -v - 30. Suppose -2q + 5 = -d, 4q = -vd - 7 + 52. Solve qr + 13 = -7 for r. -4 Suppose q + 21 = 5w, 5w - 9 = 3q + q. Solve wf + 20 = f for f. -5 Let w(u) = u3 - 6u*2 + 2u - 3. Let c be w(6). Solve 16 + c = 5q for q. 5 Suppose 3t + 2t = 0. Suppose -s - s + 44 = t. Solve 5q - 7 = -s for q. -3 Let o = -17 + 12. Let u be (o/2)/(4/(-8)). Solve -uc - 7 = -2 for c. -1 Let u(k) be the first derivative of k3/3 - 5k*2/2 + 7k - 2. Let s be u(4). Solve 0 = 4m + 5 + s for m. -2 Suppose -19 + 7 = -2w. Suppose -f = -5l - 19, -8 - 12 = -2f + 4l. Solve 2r - fr = w for r. -3 Let g be (2 - 1)(5 + (-8)/4). Solve 18 = -g*v + 3 for v.	{ "pile_set_name": "DM Mathematics" }
0 divided by -23? 11500 What is 20 divided by 1152? 5/288 Calculate -147400 divided by -11. 13400 What is -227 divided by -156? 227/156 What is -41340 divided by -18? 6890/3 Divide 129069 by 3. 43023 Divide -72 by 138. -12/23 What is 1436736 divided by 22449? 64 -4950 divided by 9 -550 130 divided by 10 13 Calculate 36 divided by 4924. 9/1231 3 divided by 278757 1/92919 Divide 4005575 by 7. 572225 What is 33108 divided by 1068? 31 Divide -7008417 by -4383. 1599 68646 divided by -34 -2019 What is 1 divided by -7062? -1/7062 What is 5524 divided by -9? -5524/9 What is -2018 divided by 237? -2018/237 Divide 792 by 331. 792/331 -40244 divided by -10 20122/5 Calculate -217512 divided by -2052. 106 What is 517005 divided by -103401? -5 Calculate -45559 divided by -6. 45559/6 Divide -106 by 383. -106/383 Calculate -369397 divided by 52771. -7 What is -48187 divided by -8? 48187/8 7964 divided by 362 22 Calculate -19867 divided by -37. 19867/37 -3 divided by 31440 -1/10480 Divide 8547 by -4. -8547/4 What is -118424 divided by -4? 29606 Divide 854743 by -1. -854743 Calculate 4 divided by -385200. -1/96300 What is -27690 divided by -1065? 26 Calculate -8 divided by -288850. 4/144425 What is 2501 divided by -48? -2501/48 5934124 divided by 2 2967062 Calculate -198524 divided by -62. 3202 What is 13680 divided by -6840? -2 What is 65712 divided by -3? -21904 Divide -42529 by 71. -599 Calculate 1952115 divided by -5. -390423 What is -126084 divided by 3318? -38 Calculate -14326 divided by -377. 38 Divide 45168 by -15056. -3 Divide 3464322 by 3. 1154774 Divide 12600 by 20. 630 1 divided by -9917 -1/9917 Divide 1093 by 190. 1093/190 What is -9 divided by -69385? 9/69385 Calculate -203 divided by 94. -203/94 -7340 divided by 2 -3670 What is 143307 divided by 2? 143307/2 Calculate 309870 divided by -51645. -6 What is 318375 divided by 3? 106125 Divide 53100 by -19. -53100/19 Divide -231984 by 162. -1432 Calculate 5 divided by 6368. 5/6368 What is 12720 divided by -53? -240 Calculate 21 divided by -760. -21/760 Calculate -356848 divided by 16. -22303 Calculate -45 divided by -9061. 45/9061 Divide -4767 by -3. 1589 Divide 440130 by 2. 220065 Calculate 17907 divided by -381. -47 -1429934 divided by 11 -129994 155394 divided by 97 1602 Divide 1572 by 131. 12 88 divided by 7340 22/1835 Calculate -3223400 divided by 11350. -284 What is -422088 divided by 4? -105522 What is -147147 divided by 7? -21021 What is -47 divided by -9148? 47/9148 437936 divided by -4 -109484 Divide 0 by -12602. 0 What is 1640 divided by -932? -410/233 52 divided by 56157 52/56157 What is -116275 divided by 4651? -25 Calculate -16414 divided by -29. 566 Divide 1939767 by -3. -646589 Divide 797 by -139. -797/139 What is 856715 divided by -5? -171343 1147086 divided by -3 -382362 Divide 28110 by 5622. 5 Calculate 38472 divided by -3. -12824 What is 49831 divided by 6? 49831/6 64080 divided by -6 -10680 Divide -655204 by 29782. -22 What is -54729 divided by -7? 54729/7 Divide 2 by -25135. -2/25135 What is 563035 divided by 112607? 5 Calculate -4389 divided by -21. 209 Divide -7970 by 5. -1594 What is 167850 divided by 2? 83925 What is 388 divided by -734? -194/367 Calculate 642640 divided by 4. 160660 Divide -224846 by -224846. 1 Divide 405337 by 1. 405337 -29 divided by 14186 -29/14186 What is 2291436 divided by -1299? -1764 -2 divided by 1055292 -1/527646 Divide 5 by 20712. 5/20712 Calculate 295536 divided by -524. -564 -7074 divided by -1179 6 Divide -819570 by 1607. -510 Calculate -59 divided by -14113. 59/14113 Calculate 67 divided by 3626. 67/3626 Divide -941 by -59. 941/59 Divide -285443 by 8. -285443/8 Divide -9387 by -131. 9387/131 What is 4 divided by 96970? 2/48485 Calculate -492268 divided by -28. 17581 What is 3922 divided by 323? 3922/323 Calculate -124236 divided by 102. -1218 Divide -76475 by -4025. 19 What is -1378 divided by -1378? 1 What is -57074 divided by 6? -28537/3 Calculate -15 divided by -388. 15/388 -2734251 divided by -13 210327 Calculate -4 divided by 75888. -1/18972 What is 918950 divided by -183790? -5 Divide -4 by -22345. 4/22345 Calculate -350265 divided by 5. -70053 Divide 5200125 by -849. -6125 Divide 3075 by 625. 123/25 5233 divided by -6 -5233/6 Calculate -839300 divided by -119900. 7 Calculate -30471 divided by -21. 1451 What is 533588 divided by -724? -737 Calculate 3648216 divided by -13. -280632 Calculate -98214 divided by 2. -49107 Calculate -69615 divided by 819. -85 Calculate -139 divided by -817. 139/817 -5 divided by 29694 -5/29694 What is 25308 divided by -36? -703 Divide -1706748 by -4. 426687 Calculate 147992 divided by 18499. 8 Calculate -4585 divided by 6. -4585/6 3 divided by 265778 3/265778 -16984 divided by 1544 -11 52640 divided by 10528 5 What is -2419 divided by 22? -2419/22 -3 divided by -20416 3/20416 What is -890028 divided by -10988? 81 What is 32662 divided by 7? 4666 Divide 4354 by 715. 4354/715 -4288788 divided by 34038 -126 Divide 3 by 4958. 3/4958 8339 divided by 52 8339/52 Divide 1 by -90835. -1/90835 -14399 divided by -119 121 Calculate 0 divided by -45146. 0 10664 divided by 5 10664/5 Calculate 230004 divided by -2. -115002 What is -3 divided by -6121? 3/6121 Divide -22 by 4492. -11/2246 What is -8036 divided by 7? -1148 What is -3 divided by -15125? 3/15125 31 divided by 1370 31/1370 What is -3948906 divided by -6? 658151 Calculate -8 divided by 266347. -8/266347 What is -5928 divided by 6? -988 Divide -4 by 7952. -1/1988 What is -33 divided by 13263? -11/4421 What is 3 divided by -133? -3/133 Calculate 0 divided by -90526. 0 -4 divided by -480 1/120 What is 2 divided by 12064? 1/6032 122184 divided by -9 -13576 Divide 1310622 by 436874. 3 Calculate 46240 divided by 11560. 4 Calculate -3096 divided by -64. 387/8 232452 divided by -25828 -9 Divide 603986 by -1. -603986 -48 divided by -12579 16/4193 Divide -35197 by 9. -35197/9 What is -44320 divided by -11080? 4 Divide 27470 by 2. 13735 -11190 divided by -15 746 Divide -74490 by 2. -37245 Divide 41452 by 4. 10363 Divide 120820 by 10. 12082 Calculate 78428 divided by -1. -78428 Divide -1 by -103122. 1/103122 Divide -6747 by 4. -6747/4 What is -7651288 divided by 956411? -8 6 divided by 4933 6/4933 Divide -12041 by 85. -12041/85 Calculate 11359 divided by -5. -11359/5 What is 9 divided by -65431? -9/65431 Calculate -168300 divided by 90. -1870 -28545 divided by 15 -1903 Calculate 69 divided by -6882. -23/2294 Divide -847720 by -40. 21193 What is 130735 divided by -2? -130735/2 What is -3 divided by 7293? -1/2431 0 divided by 1184222 0 What is -2596 divided by 108? -649/27 -149 divided by -500 149/500 Divide 132984 by -24. -5541 What is -8927 divided by -25? 8927/25 Divide -11 by 9233. -11/9233 Calculate -846 divided by 586. -423/293 73689 divided by -3 -24563 Calculate 155436 divided by -6. -25906 What is 211620 divided by 17635? 12 Divide 2829 by 50. 2829/50 Divide 40834 by -6. -20417/3 What is -88769630 divided by 5? -17753926 251160 divided by -5460 -46 2438 divided by 980 1219/490 -1640 divided by 162 -820/81 What is 6412488 divided by 2? 3206244 3180 divided by -10 -318 Divide 44 by -43775. -44/43775 2153 divided by 10 2153/10 Calculate -1 divided by -540048. 1/540048 1 divided by 6047 1/6047 Calculate -8 divided by 303110. -4/151555 Divide -164732 by 6. -82366/3 60656140 divided by 5 12131228 5 divided by 54481 5/54481 Divide 2 by -170030. -1/85015 2834 divided by 559 218/43 What is -571938 divided by 5017? -114 -381620 divided by -12 95405/3 What is -64432 divided by -16? 4027 What is 168 divided by 1? 168 Calculate -43839 divided by -3. 14613 Divide 11 by -277092. -11/277092 -287 divided by -786 287/786 1970814 divided by -1 -1970814 Calculate -166878 divided by 73. -2286 Divide 242847 by -7359. -33 What is 35 divided by 47? 35/47 Calculate -27711 divided by 9237. -3 Divide 2108568 by 7. 301224 Calculate 8320 divided by -10. -832 Calculate 59740 divided by -290. -206 Calculate 21 divided by -1241. -21/1241 Calculate -6 divided by -38. 3/19 Divide 1151649 by 369. 3121 Calculate 131859 divided by 2691. 49 What is 54688 divided by -54688? -1 What is 199895 divided by -2? -199895/2 What is 2 divided by 51496? 1/25748 What is 3 divided by 20450? 3/20450 What is -45236 di	{ "pile_set_name": "DM Mathematics" }
in -1, 3, p? -1 Let w(j) = 2j - 2 - 3 - 2. Let f(o) = -o2 - 8o - 1. Let t be f(-7). Let q be w(t). Which is the biggest value? (a) 4 (b) 0.1 (c) q c Let x = -11.3 + 13.3. Let i = 0.04 + 0.01. Let h = i + 0.95. What is the second smallest value in x, h, 5? x Let m = -10667 - -64001/6. Let i = -1 - 1. What is the fourth smallest value in 0.3, m, i, -4? 0.3 Let r = 0.19 + 0.21. Let k = -23/18 + 62/45. Which is the third smallest value? (a) r (b) 4/3 (c) 5 (d) k b Let d = -23 + 1086/47. What is the smallest value in d, -2/3, 0.3? -2/3 Let q = 448 - 456. Which is the second smallest value? (a) -0.1 (b) -2 (c) q b Let m = -186 - -186.3. Which is the fourth smallest value? (a) -0.5 (b) -0.2 (c) m (d) 24 d Let x = -6.31 - -10.31. What is the smallest value in -5/3, -1/3, 2/27, x? -5/3 Let m = -13 + 9. Let h = -946 - -947. Which is the smallest value? (a) h (b) m (c) 1/4 b Let s = 7.673 + -0.673. Let b = -9.6 - -1.6. Let v = -8 - b. What is the second biggest value in s, 5, v? 5 Let w be -4 - (-32 - (-4 - -7)). Let m = w - 61/2. Which is the second smallest value? (a) -4 (b) 6 (c) m (d) 2/7 d Let r = 0.2 + 0.3. Let t be (1 - -1)/(23/3). Let g = t - 1/92. What is the third smallest value in 2, r, g? 2 Let p(x) be the second derivative of x3/6 - x2/2 + 3x - 7. Let s be p(0). Which is the second biggest value? (a) -1.6 (b) s (c) 0.5 b Let f = -30.848 + 0.048. Let p = 31 + f. What is the third smallest value in 5, 2/9, p, -2/7? 2/9 Let u = 25 + -30. Which is the third smallest value? (a) -2 (b) u (c) 1/2 (d) 3/11 d Let f = 878.84 - 879. Which is the smallest value? (a) f (b) -1 (c) -0.2 (d) -3/4 b Let t be 24934/(-102) - 3/(-9). Let d = t + 244. Let g = 147 - 150. Which is the biggest value? (a) 5 (b) d (c) g a Suppose 0 = -b - 0 - 1. Let t(n) = -n3 - 3n*2 + 3n - 5. Let k be t(-4). Let m be 2/k(-27)/18. What is the third biggest value in m, -5, b? -5 Suppose 3b + 1 - 7 = 3d, 5b + 4 = -2d. Let k = -20/9 + 31/18. What is the second smallest value in 3, -3, k, b? k Let l = -2409 - -2413. Which is the second biggest value? (a) l (b) -3/2 (c) 68 (d) 0.2 a Let g = -37/129 - 2/43. Which is the fourth biggest value? (a) -2/161 (b) 3 (c) g (d) 1 c Let u = -21.9 + 21.8. What is the smallest value in -6, u, -0.4? -6 Let j = 0.8 + -1.3. Let h = -45 + 44.961. Let r = h - -0.439. Which is the second smallest value? (a) j (b) r (c) -0.02 c Let c be 0/(((-2)/4)/((-2)/12)). Let b be c + 2/5 - (-11 + 11). What is the smallest value in 1, 16, b? b Let s(x) = -x3 + 5x*2 - 5x - 1. Let y be s(4). Let z = -0.027 - 7.973. Let f = z + 11. What is the smallest value in 0.1, f, y? y Let j be 68/(-306) + -1 + (-5)/(-63). What is the smallest value in j, 0.1, -2/7? j Let y(m) = 2m2 - m - 10. Let v be y(-5). Let z be 12/15v/(-2). Let s be 13/(-5) - z/(-45). Which is the second smallest value? (a) s (b) -2 (c) -1/3 b Let p = 2119/133 + -585/19. Which is the third biggest value? (a) p (b) -2/3 (c) 4 a Suppose 4t - 21 = -25. Let f be 1t/(-4)(-32)/24. What is the biggest value in 5, -4, f? 5 Let z = -2206.367 + 2207. Which is the second smallest value? (a) z (b) 0.2 (c) 0 b Let d be (-4)/5(-10)/(-2). Let x be (-481)/(-37) - (0 + 11). Which is the biggest value? (a) d (b) x (c) -6 b Let g be (11 + -2)11/(-33). What is the smallest value in g, 1, 0.07? g Let j = -0.185 - -135.185. Let x = -134.9 + j. What is the second smallest value in x, -0.1, -5, 4? -0.1 Suppose -g = -5z + 81, 0g - 3g = 3. Suppose -10 = zq - 21q. What is the third smallest value in q, -1/5, -2/5? q Let m = -2789.1 - -2789. Suppose 0k = -5k + 20. Which is the second biggest value? (a) m (b) k (c) -0.08 c Suppose 3h = -0s - 2s - 250, -5h + 5s - 400 = 0. Let r = 137 + h. Let v = -223/4 + r. Which is the third biggest value? (a) -0.4 (b) v (c) -2/17 b Let w = -0.4 - -0.3. Let u = 19.41 + -0.41. Let n = u - 19.3. Which is the third biggest value? (a) w (b) 0.1 (c) n c Let g be 9 - (-6 + 16) - (-5)/4. What is the second smallest value in -2/25, g, -2, 4? -2/25 Let j = -0.01689 - -0.51689. Suppose 2l - 5c = -3l - 60, -4l + 5c = 47. What is the biggest value in j, l, -1/2? j Let r = -45.0112 + -0.0888. Let y = r - -45. Let l = 4 + -7. Which is the second biggest value? (a) -1 (b) y (c) l a Let i = -0.111 - 150.889. Let y = i - -146. Which is the third smallest value? (a) -3 (b) y (c) 5 c Let x = -3.1 - -3. Let h = -0.037 + -6.763. Let v = h + 6.6. What is the biggest value in x, -3/4, v? x Let t = 0.2179 + -2.0179. Which is the second smallest value? (a) -2/3 (b) t (c) 3/4 a Let h be 2/6118. Suppose -3p = -5p + h. Suppose 4 = -2f + pr - 6, 5f + 3r - 17 = 0. Which is the third biggest value? (a) 4/3 (b) -2 (c) f b Let m = 605 + -610. What is the third smallest value in m, 1/58, 1/8? 1/8 Suppose 4t = 2q + 84, 0 = q + 4. Let w = t + -25. Let s = -0.8 + 1.3. What is the second biggest value in -0.3, w, s? -0.3 Suppose 4l + 28 = 6h - 2h, 0 = -h - 4l + 7. Suppose 4b = hb. Let s = -0.991 - 4.009. What is the third smallest value in s, -3, b? b Let t = -306 - -306.2. Let z = -9/20 - -1/5. What is the biggest value in t, -0.5, z, -3? t Let g = 1205/88 - 111/8. Which is the third smallest value? (a) g (b) 17 (c) -4 b Let n = -16 - 0. Let t = n + 16. Let r be (-12)/(-28) - (-66)/(-56). Which is the third smallest value? (a) -6 (b) r (c) t c Let s = 0.14 - -0.06. Let z be (-4 - -3)(-7)/77. Which is the smallest value? (a) s (b) 4 (c) z c Let i(o) = -o3 - 30o*2 + 28o - 94. Let c be i(-31). What is the third biggest value in c, -2/3, -0.36? c Let r = 35 + -34.46. Let u = 0.04 - r. What is the smallest value in 3, 5, u, -2? -2 Let k = -50 - -92. Let r = 40 - k. What is the fourth biggest value in 1/6, r, 4, -1? r Let v(k) = -k*3 - 9k*2 + 7k - 14. Let m be v(-10). Let g be 0 - 1 - (m + 5). Let d = g + 20. Which is the second biggest value? (a) -1/6 (b) d (c) -0.2 c Suppose -165 = 3z + 57. Let f = z + 82. Which is the second smallest value? (a) f (b) -0.3 (c) 0 (d) 3 c Let v(l) = 6l - 15. Let f be v(3). What is the smallest value in 4, f, -36? -36 Let d = -1.5 + 1. Let m be (-5 + 4)(-2)/(-6)(-6)/(-6). What is the third smallest value in d, -5, m? m Suppose -2h = s - 0 + 3, -h + s = 3. Let l be h/(-10)(-75)/10. Which is the second smallest value? (a) 3 (b) -2/3 (c) l b Let f = -95 + 92. Which is the second biggest value? (a) 1.2 (b) f (c) -0.09 c Let z = -111 - -110. Let h be (-2)/(-4) - (-27)/6. Let l be 2/6 + h/(-15). Which is the second biggest value? (a) l (b) 2/19 (c) z a Suppose 8v + 44 = -100. What is the second biggest value in v, 2, 2/13? 2/13 Suppose 2l + u + 16 = -3u, 12 = -4u. Let j be 2 - (-16 - 2) - 2. Which is the second smallest value? (a) j (b) 5 (c) l b Let k = 0.481 + -0.081. What is the third smallest value in 2, 5, k? 5 Let n = 40.9 - 35.9. Let m = 19/184 + 1/46. Which is the smallest value? (a) 2 (b) n (c) m c Let u = -28.933 + -0.067. Let h = u - -26. Which is the second biggest value? (a) h (b) -3/5 (c) 2 b Let p = -8526 - -8525.99. Let y = 0.25 - -0.85. Let x = y + -1. Which is the second smallest value? (a) -1 (b) p (c) x b Let u = -13954/3 - -4732. Suppose 4f = 46 - 366. Let x = f + u. Which is the third smallest value? (a) x (b) -0.1 (c) 0.5 a Let y = 956 + -955. Which is the biggest value? (a) 1/6 (b) 2/155 (c) y c Let w = 53/152 - 9/19. Let f = 0 + -0.1. Let t = -0.456 - -0.056. What is the second smallest value in t, w, f? w Let n(i) = -3i + 3i + 1 + 2i. Let o = -44 + 46. Let r be n(o). What is the third biggest value in r, 0.1, -1? -1 Let v = 326 - 1628/5. Which is the smallest value? (a) 8.1 (b) -0.3 (c) v b Let p = 5.5 - 0.5. Let x = -14 - -15. Let r = x - -2. What is the biggest value in r, p, 0.5? p Suppose 2r - 8 = -0r, 4r - 41 = -5a. Suppose ab = 2b + 3. What is the second biggest value in 3, -6, b? b Let f be 5/4 - (803/44 - 18). Which is the biggest value? (a) -1 (b) 5 (c) 1/9 (d) f b Let v = -1 - 4. Which is the second smallest value? (a) -0.4 (b) -1/14 (c) v (d) 0.3 a Let s = -172.19 + -1.81. Which is the second biggest value? (a) -2/3 (b) 0.2 (c) -4 (d) s a Let g = -276 -	{ "pile_set_name": "DM Mathematics" }
Multiply 95.4 and -0.145. -13.833 760.6 * -5.34 -4061.604 Product of 4129 and 32013. 132181677 Product of -670378 and -50. 33518900 What is 3.042 times 206.19? 627.22998 What is the product of -5 and -38.4699? 192.3495 Work out -0.1 * 36499326. -3649932.6 -1228 times 12.2 -14981.6 Calculate 46266.45234. 185065.8092 15.320208 33 505.566864 Work out -0.2 * 1.12820559. -0.225641118 What is the product of -0.54 and -10133? 5471.82 What is -855176 times 9? -7696584 0.08-220650.5 -17652.04 Calculate 61415380. 49132240 What is the product of 73 and -1719.4? -125516.2 Product of 0.5 and -2037450.2. -1018725.1 -0.395093 times 0.0456 -0.0180162408 Product of -789 and -0.04646. 36.65694 Multiply -3250 and -824. 2678000 Product of 137 and -6141335. -841362895 What is -0.5 times -130.4859? 65.24295 380 times 334123 126966740 Work out -8459689 * 0.3. -2537906.7 What is -24.2 times 218654? -5291426.8 Multiply 1839262 and -0.1. -183926.2 What is the product of 1496 and -0.39509? -591.05464 Product of -6 and 0.463821. -2.782926 What is -8405066 times 12? -100860792 -7793783 * 0.4 -3117513.2 -355.1141 times -4 1420.4564 Calculate -1.50.07175985. -0.107639775 0.111 times -0.068262 -0.007577082 What is -199204 times 0.22? -43824.88 Product of 23.2 and -1471804. -34145852.8 What is -301 times 1821391? -548238691 Work out 12 -58.275771. -699.309252 -1421277 times 0.7 -994893.9 Product of -0.04918 and -24.88. 1.2235984 -27976045.4 -21216666.6 -45 times 61544 -2769480 -212875886 -0.2 42575177.2 What is -0.077 times 365404? -28136.108 -0.249692555 * -4 0.99877022 Multiply -1337104 and -43. 57495472 Calculate -6741301.3. -4447807.8 Multiply -0.04 and 202.0909. -8.083636 Work out -2866.24 -0.1139. 326.464736 Product of -31.2517 and 106. -3312.6802 Multiply 0.10011 and -417.59. -41.8049349 -77 times 902717 -69509209 6-938353 -5630118 Work out 359 -4.002. -1436.718 What is 2.54503575 times -2? -5.0900715 What is the product of 0.063228558 and 1? 0.063228558 Calculate -9989.50.009. -89.9055 Product of 0.1 and -154.74099. -15.474099 Multiply -3718 and 57318. -213108324 Multiply 4425171 and 0. 0 Product of -0.519313 and -8. 4.154504 What is -0.101 times -10.0203? 1.0120503 What is the product of 851503 and -6? -5109018 What is the product of 29.9522 and -0.62? -18.570364 Multiply -12881425 and -4. 51525700 0.09-490068 -44106.12 -0.1 * -1295203 129520.3 -0.066000780.054 -0.00356404212 What is -635334 times -7? 4447338 Product of -5861 and 0.01414. -82.87454 What is -59260.7 times -0.48? 28445.136 Product of -340.7 and -4.965. 1691.5755 -0.05 times -21998.1 1099.905 Work out -39519551 5. -197597755 Work out -0.01776244 * 2. -0.03552488 Multiply 13 and -718974. -9346662 Work out -0.1401241 * -0.4. 0.05604964 Multiply 5153.1 and -108.9. -561172.59 Calculate -200.4107-21. 4208.6247 1661813.2 times -0.08 -132945.056 What is 9 times -46729800? -420568200 Multiply 0.2357 and 1167. 275.0619 -9056 times -0.09893 895.91008 11 times -9.931172 -109.242892 5274.57 1372.85 Multiply 1832.0203 and 0.5. 916.01015 Calculate -96.351817-5. 481.759085 Work out 12.2 946.87. 11551.814 Multiply 0.03251 and 15500. 503.905 Multiply 0.04 and 2.2093277. 0.088373108 What is 975 times 19594.3? 19104442.5 Multiply 8789 and -0.008283. -72.799287 Product of -1 and 1.17348909. -1.17348909 -0.18 times -308.859 55.59462 What is the product of -48.9 and 1.84974? -90.452286 -4546 times -8804 40022984 Multiply -261 and -25.3266. 6610.2426 6262 times -3.66 -22918.92 Work out 368.413 * 0.1422. 52.3883286 What is 2038030 times 0.2? 407606 What is -22 times 18409865? -405017030 279 times 1.45 404.55 -0.8 times -373.9812 299.18496 Product of 5513 and 0.9501. 5237.9013 -22706 * -80 1816480 Multiply -2397.0875 and -5. 11985.4375 What is -0.09524 times 564? -53.71536 2178 * 2.045 4454.01 What is the product of -14323 and -1106? 15841238 0.03 times 0.2069499 0.006208497 0.5-105210156 -52605078 Product of -11690.86 and 0.14. -1636.7204 3.5128419 449466.5 What is the product of -4 and -0.04973934? 0.19895736 -0.4 * 230.9165 -92.3666 Multiply -13 and 92671.7. -1204732.1 -13793313.24 -4320519.32 What is -45870 times -22? 1009140 Product of -5696 and -24390. 138925440 Work out 0.46 -840628. -386688.88 1.8552345 times 4 7.420938 Product of 212571.917 and 0.4. 85028.7668 Work out -1889 * 10768. -20340752 448013 * -173 -77506249 What is the product of -2307 and -1945.51? 4488291.57 16.34522 * 1 16.34522 What is the product of 0.0088 and -48835? -429.748 Multiply 0.0232 and -408.3. -9.47256 What is 46 times -0.0766257? -3.5247822 11751513-9 -105763617 What is 4.9 times 2.069309? 10.1396141 What is 1418231 times -0.5? -709115.5 -22569.9-0.5 11284.95 What is -282952 times -4? 1131808 -5041848 -4033472 -0.2 times -122784971 24556994.2 What is the product of -841.7 and -10.155? 8547.4635 Calculate -8.1201-0.58. 4.709658 Calculate 1.03712107. 12554.959 Product of 1068 and -58879. -62882772 Work out 0.29541 -1239. -366.01299 What is the product of 5.14112 and 920? 4729.8304 Product of 2.65 and 655197. 1736272.05 -1086 times 432 -469152 Calculate 2-326.972205. -653.94441 What is the product of 102681625 and 0.4? 41072650 What is 137483 times 12.93? 1777655.19 -14652168 0 0 What is the product of 10230 and 15912? 162779760 Calculate -75937182. -15187436 5805602-0.23 -1335288.46 8-18596827.5 -148774620 Multiply -776614.178 and -2. 1553228.356 -1.34176.76 -5429.788 What is -0.19908424 times 4? -0.79633696 What is the product of 148146980 and -5? -740734900 What is 191072.53 times 0? 0 Multiply -0.03875 and -0.409. 0.01584875 Product of -7 and -6.67883. 46.75181 Product of -4 and -2086738.5. 8346954 Multiply -8 and -5920201. 47361608 -0.21 times -371561 78027.81 Calculate -0.06-1659154. 99549.24 3923190 times -10 -39231900 Work out 2 -70.99395. -141.9879 -33.161 * 5.564 -184.507804 What is the product of 0.74381177 and 1? 0.74381177 What is the product of 0.57 and 6647296? 3788958.72 -5 * 16309792 -81548960 Work out 34738 * 1.1825. 41077.685 Product of 5 and -17332728. -86663640 Calculate -140-6237.8. 873292 25639443 -4 -102557772 -0.1 times 11.13535 -1.113535 3 times 101349130 304047390 Work out -0.04 * -20424.93. 816.9972 What is the product of -64.86 and 8231? -533862.66 What is the product of -762.3 and -24221? 18463668.3 Work out 1644635 * -0.05. -82231.75 -40.26893692 -1.07574768 What is 17192064 times 0.17? 2922650.88 Multiply -0.04 and 2338899. -93555.96 What is 1866.86 times -26? -48538.36 Calculate -38-312393. 11870934 What is 0.5 times -40699399? -20349699.5 -24.46517 * -0.03 0.7339551 Calculate -5079.369216. -81269.9072 Product of -956 and 1008. -963648 Multiply -2.619924 and 0.6. -1.5719544 -299821.17 -0.1 29982.117 6.17 times -387.05 -2388.0985 What is -5 times -102395.5? 511977.5 Calculate 573-0.2079. -119.1267 1.64392 times 0.09 0.1479528 What is the product of -0.8 and -18504028? 14803222.4 Calculate 443590-89.4. -39656946 -14615 * 0.0757 -1106.3555 Product of -750946279 and -0.2. 150189255.8 -83.16 times -0.061287 5.09662692 Work out 209.3987 * -17. -3559.7779 Work out -3 * 320477.4. -961432.2 Work out -0.11 * -938541. 103239.51 14522.8599 3314.6855 What is the product of 2 and 1752229? 3504458 Product of -7 and -87445.2. 612116.4 Work out -10 502866. -5028660 01405793 0 What is the product of 109 and -7.371? -803.439 What is -1 times 851462? -851462 What is the product of 0.0387 and -12.03? -0.465561 Calculate 0.1733861.5. 10.66287 Work out 6974659 * 0.03. 209239.77 Multiply -766575 and 425. -325794375 -0.5-2498290.3 1249145.15 Calculate 10011621.6. 2162505.6 Multiply -3832644 and -0.29. 1111466.76 What is the product of 0.1 and 604.9119? 60.49119 -24.1021322 * -0.3 7.23063966 Multiply -45231347 and -6. 271388082 What is -1482738 times 0.083? -123067.254 Calculate 20.3658285. 0.731657 4263332-3 -12789996 Multiply 0.9096086 and 0.1. 0.09096086 Work out 4 * 30321998. 121287992 What is 35 times 3356471? 117476485 Calculate -13718*-16904. 231889072 Product of -1 and 1464435. -1464435 Multiply 157628 and -965. -152111020 What is -1545 times 696847? -1076628615 What is the product of -7003 and 15.2281? -106642.3843 What is 68 times 4644? 315792 Calculate 23	{ "pile_set_name": "DM Mathematics" }
ere in one twentieth of a litre? 50 What is 3/5 of a kilometer in meters? 600 What is 3/5 of a kilometer in meters? 600 How many micrograms are there in 101.2588 milligrams? 101258.8 How many meters are there in fifty-two fifths of a kilometer? 10400 How many millilitres are there in 9500.543 litres? 9500543 How many milligrams are there in 2042.613 tonnes? 2042613000000 How many millimeters are there in 3/50 of a kilometer? 60000 What is five quarters of a meter in millimeters? 1250 How many millennia are there in 22331.73 years? 22.33173 Convert 741.5018 milligrams to grams. 0.7415018 What is seven sixteenths of a kilometer in centimeters? 43750 How many centuries are there in 0.6941882 years? 0.006941882 How many micrometers are there in thirty-one fifths of a millimeter? 6200 Convert 168.4248 millennia to months. 2021097.6 Convert 756.1992 millimeters to kilometers. 0.0007561992 What is 1/6 of a day in hours? 4 How many weeks are there in 537.076512 minutes? 0.0532814 Convert 0.0139497km to meters. 13.9497 What is 0.3242456 microseconds in seconds? 0.0000003242456 Convert 736.971m to millimeters. 736971 What is 65810.44 meters in kilometers? 65.81044 Convert 70669.47 meters to kilometers. 70.66947 What is 0.508364ml in litres? 0.000508364 Convert 0.9997328 micrometers to nanometers. 999.7328 What is 52/5 of a meter in millimeters? 10400 How many millilitres are there in thirteen quarters of a litre? 3250 What is seven quarters of a week in hours? 294 What is seven quarters of a milligram in micrograms? 1750 What is 838.6517 years in millennia? 0.8386517 How many micrometers are there in 482.3436km? 482343600000 How many seconds are there in 1743.447 milliseconds? 1.743447 How many millilitres are there in 27/2 of a litre? 13500 Convert 50.61831t to nanograms. 50618310000000000 Convert 47.54475ms to microseconds. 47544.75 How many kilograms are there in 45.23082g? 0.04523082 How many hours are there in 8/3 of a day? 64 What is three tenths of a century in years? 30 How many milliseconds are there in 1/4 of a minute? 15000 What is 3/50 of a milligram in nanograms? 60000 How many millimeters are there in 3/50 of a meter? 60 How many millilitres are there in 60.0951 litres? 60095.1 Convert 211.7402 nanograms to kilograms. 0.0000000002117402 What is four thirds of a hour in seconds? 4800 What is 2035.686 centuries in millennia? 203.5686 What is 3/16 of a day in minutes? 270 How many seconds are there in 19849.38 weeks? 12004905024 What is 633.8724 millennia in years? 633872.4 What is 1/10 of a century in decades? 1 What is seventy-five halves of a decade in years? 375 What is 366751.3 tonnes in milligrams? 366751300000000 How many micrometers are there in 306127.6 meters? 306127600000 How many decades are there in 198567.93 months? 1654.73275 How many hours are there in 1/4 of a day? 6 What is 4/3 of a hour in minutes? 80 What is 0.9506931 centuries in months? 1140.83172 What is 29/5 of a centimeter in millimeters? 58 How many nanograms are there in seven quarters of a microgram? 1750 What is 2.803515ng in kilograms? 0.000000000002803515 How many meters are there in eleven halves of a kilometer? 5500 Convert 4181.473 millimeters to micrometers. 4181473 What is seven quarters of a litre in millilitres? 1750 Convert 6.89613 nanograms to grams. 0.00000000689613 What is 1/27 of a week in seconds? 22400 What is 3.968242ms in microseconds? 3968.242 How many years are there in fourty-three halves of a decade? 215 Convert 312.69906us to hours. 0.00000008686085 Convert 1401.216 years to months. 16814.592 How many years are there in 550936.3 centuries? 55093630 Convert 914.1815 kilometers to nanometers. 914181500000000 How many centimeters are there in one twentieth of a kilometer? 5000 How many minutes are there in 29/2 of a day? 20880 How many nanograms are there in 43532.71 milligrams? 43532710000 How many millennia are there in 750.98 decades? 7.5098 How many minutes are there in 2665579.2ns? 0.00004442632 What is eighty-seven halves of a day in minutes? 62640 What is 21/2 of a tonne in kilograms? 10500 What is fourty-nine fifths of a millimeter in micrometers? 9800 What is 1.2048 millilitres in litres? 0.0012048 How many millilitres are there in three fifths of a litre? 600 How many minutes are there in 2502140.7us? 0.041702345 Convert 32.43253mm to centimeters. 3.243253 How many centuries are there in 4881.606 millennia? 48816.06 Convert 52.1696ml to litres. 0.0521696 What is 0.87111m in kilometers? 0.00087111 What is seven quarters of a millennium in months? 21000 Convert 0.268642 years to months. 3.223704 What is 6/5 of a centimeter in millimeters? 12 How many minutes are there in 6/5 of a day? 1728 How many years are there in thirty-four fifths of a decade? 68 What is eight thirds of a week in hours? 448 What is eleven quarters of a century in months? 3300 How many decades are there in 25/2 of a century? 125 Convert 0.775815 minutes to nanoseconds. 46548900000 What is 196.63065 milliseconds in minutes? 0.0032771775 What is five eighths of a litre in millilitres? 625 How many millilitres are there in 5/8 of a litre? 625 Convert 6941.997 millilitres to litres. 6.941997 What is three fifths of a hour in seconds? 2160 What is 7.532065mg in nanograms? 7532065 What is 0.0848785 micrograms in tonnes? 0.0000000000000848785 What is twenty-one halves of a millisecond in microseconds? 10500 What is 27/5 of a microgram in nanograms? 5400 How many grams are there in 687238.9 milligrams? 687.2389 How many milliseconds are there in one quarter of a second? 250 How many nanograms are there in one twentieth of a microgram? 50 How many millilitres are there in 42/5 of a litre? 8400 Convert 516.0332 weeks to nanoseconds. 312096879360000000 How many months are there in 5/6 of a millennium? 10000 Convert 7.601628 hours to microseconds. 27365860800 What is 1022.205ms in seconds? 1.022205 What is three tenths of a millimeter in micrometers? 300 How many tonnes are there in 18.4624mg? 0.0000000184624 Convert 911.9778 years to decades. 91.19778 Convert 76.85994l to millilitres. 76859.94 How many nanoseconds are there in 6/5 of a microsecond? 1200 What is 863.4569 litres in millilitres? 863456.9 How many centimeters are there in 2642.922 nanometers? 0.0002642922 How many minutes are there in 38.59968 seconds? 0.643328 How many hours are there in 13/8 of a week? 273 What is 587675.9 litres in millilitres? 587675900 How many minutes are there in 14035.773 microseconds? 0.00023392955 What is one fifth of a centimeter in micrometers? 2000 How many milliseconds are there in 939.04ns? 0.00093904 What is one fifth of a litre in millilitres? 200 How many seconds are there in twenty ninths of a hour? 8000 How many micrometers are there in 83.9854m? 83985400 What is 8609.968ml in litres? 8.609968 What is 6/5 of a kilometer in meters? 1200 Convert 79.57123l to millilitres. 79571.23 Convert 11.291607ns to hours. 0.0000000000031365575 How many centimeters are there in 1/4 of a kilometer? 25000 What is 419544.4 years in millennia? 419.5444 How many litres are there in 49.10763ml? 0.04910763 How many milligrams are there in 630.8909ng? 0.0006308909 How many kilograms are there in 7/8 of a tonne? 875 How many millilitres are there in 31/2 of a litre? 15500 What is five sixths of a minute in seconds? 50 How many years are there in 7/2 of a decade? 35 How many meters are there in 1/10 of a kilometer? 100 What is 96.66385 centuries in years? 9666.385 How many minutes are there in twenty-eight ninths of a day? 4480 How many nanoseconds are there in 29758.84 days? 2571163776000000000 How many milligrams are there in 489.0782 nanograms? 0.0004890782 How many millilitres are there in three fifths of a litre? 600 Convert 124.2432 meters to nanometers. 124243200000 What is 666039.8 meters in millimeters? 666039800 How many micrometers are there in fourty-five eighths of a centimeter? 56250 Convert 83206.11 milliseconds to nanoseconds. 83206110000 What is 91151.45mg in nanograms? 91151450000 What is twenty-seven fifths of a century in months? 6480 What is 0.8758801 millilitres in litres? 0.0008758801 Convert 95.00085mg to kilograms. 0.00009500085 Convert 386.945mg to tonnes. 0.000000386945 W	{ "pile_set_name": "DM Mathematics" }
h be -8 - (-249)/18 - (-2)/(-6). Put w, h, -0.1 in ascending order. -0.1, w, h Let a = -715 - -730. Sort -0.4, -1, -4, a in increasing order. -4, -1, -0.4, a Suppose -2b - 9 = d, -5d - 4b - 33 = -0. Let g = 0.2 - 0.1. Put d, g, -2, -0.3 in ascending order. d, -2, -0.3, g Let o = 150 + -235. Let q = o - -337/4. Sort q, -2, 1/12. -2, q, 1/12 Let z(x) = -8x + 3. Let a be z(3). Let i = -19 - a. Suppose 5k = 4p + 6, -4p = -5k - 2p - i. Sort -5, k, 0.4 in decreasing order. 0.4, k, -5 Suppose -5r - 2 = 13. Let f be ((-4)/r + -1)9. Sort -1, f, 0 in decreasing order. f, 0, -1 Let s = -137 + 141. Put -46/5, -5, 3, s in descending order. s, 3, -5, -46/5 Suppose -3v + 6 + 30 = 0. Suppose 0 = -3l - l - v. Sort -4, l, 1. -4, l, 1 Let d = -1 + 6. Suppose -r = -4s + 10, 3r + 12 = ds + 3. Let c = -265 + 260. Put c, r, 0 in descending order. r, 0, c Let r = -9 + 15. Suppose -b + 2b = -y - 7, -y - 2b - 9 = 0. Suppose 12z + 44 + 4 = 0. Sort y, z, r. y, z, r Let i be 4-83/(-24). Put -4, -149, -3, i in descending order. i, -3, -4, -149 Let k = 78 - 77. Put k, -2, -4 in decreasing order. k, -2, -4 Let c = 588/5 + -118. Let q(w) = w + 3. Let f be q(2). Put -1/3, f, c in ascending order. c, -1/3, f Let y = -181 + 182. Let u = 31.2 + -31. Sort u, y, 5, -4 in descending order. 5, y, u, -4 Let f be (0/(40/5))/(-1). Sort f, 9, -1, 2 in decreasing order. 9, 2, f, -1 Let s = -2.7 + 10.2. Let v = 8 - s. Let q be (276/(-150) + 2)/((-12)/(-10)). Put q, v, -3 in decreasing order. v, q, -3 Suppose -42b + 28b - 42 = 0. Let f = -41 - -40. Put f, 0, b, 8 in decreasing order. 8, 0, f, b Suppose -104 = -4l + 16. Suppose -3k = 2k - l. Let c = k + -9. Sort c, -4, -2. -4, c, -2 Let k = 18 - 19. Let x = -8 - 4.8. Let w = -13 - x. Put 4, w, k in increasing order. k, w, 4 Let l(g) = -g*2 - 15g + 67. Let j be l(-19). Put 0, j, 4 in descending order. 4, 0, j Let q = 219 - 211. Suppose 0 = -z + 4x + q, -12z + 3x = -7z + 11. Let r = -0.3 + 0.1. Sort z, r, 0.4 in descending order. 0.4, r, z Let h be (-98)/39/(-6). Let l = 45 - h. Put l, -3, 0, 3 in descending order. 3, 0, -3, l Let f be 62/(-14) + (-11 - -11) + 5. Put f, -1.3, -4 in decreasing order. f, -1.3, -4 Suppose 0 = -84q + 36q - 240. Sort q, -65, 0, -3 in ascending order. -65, q, -3, 0 Suppose -22l + 45 = 1. Put -8, -25, 5, l in descending order. 5, l, -8, -25 Suppose -2c = g - 1, -4g - 5 = -9g. Suppose c = -2j - x - 2x + 3, 4j + 27 = 5x. Let l = 2 - -3. Sort j, l, 4 in increasing order. j, 4, l Let m(r) = -r - 1. Let c be ((-4)/12)/(2/18). Let s be m(c). Let l be (-33)/(-22)(0 + 12/(-9)). Sort 1, s, l in descending order. s, 1, l Suppose 3p + 15 = 4p. Let f be (-4 + 7)p/9. Put 3, f, -1/2, 1 in increasing order. -1/2, 1, 3, f Let i(p) = -39 + p2 - 7p + 3p + 39. Let a be i(5). Let b = 7 - 10. Put 2, a, b in decreasing order. a, 2, b Let u be (108/351)/((-2)/(-9)). Sort 5, -0.4, -1, u in decreasing order. 5, u, -0.4, -1 Let f = 7/153 + 3/17. Suppose -3w - 25 = 4v, -2v - 4w = -v + 16. Let m be (-10)/(-104) - (-1)/v. Sort 3, f, m in increasing order. m, f, 3 Let d = 593 - 592.5. Put -0.1, -0.12, d in increasing order. -0.12, -0.1, d Let o = 3559 + -3564. Let t be (-1 - (-14)/10)/(-2). Put 6, t, o in decreasing order. 6, t, o Let a = 998 + -990. Sort 3, a, -10 in decreasing order. a, 3, -10 Let g = 232 + -236. Sort -5, g, 7. -5, g, 7 Suppose -2j - 80 = -3l + 87, 5l - 3j = 279. Sort 1, l, -4, 0. -4, 0, 1, l Let g be 3/60 - -10. Let i be g(1 - 15/25). Put -4, -0.4, i in decreasing order. i, -0.4, -4 Let v = 1 + -5. Let u be -3 - 4086/88 - (-2)/11. Let g = 48 + u. Sort -0.2, g, v in increasing order. v, g, -0.2 Let k = -15 - -10. Let m = k - -8. Let i = m - 0. Sort 2, i, -5 in decreasing order. i, 2, -5 Suppose -n + 6 = f - 0n, -5f - 4n + 25 = 0. Sort -5, f, 5, -2 in descending order. 5, f, -2, -5 Let i = -95 + 92. Sort i, -4, -83. -83, -4, i Suppose 0 = -5n - 729 + 764. Sort 2, n, 1, 5 in descending order. n, 5, 2, 1 Suppose -22w - 144 + 34 = 0. Sort -0.3, 1/9, w, 7 in decreasing order. 7, 1/9, -0.3, w Suppose -4p + 8p = 48. Let d be p/21 + (-76)/(-14). Suppose -g - dg = 0. Sort g, -1, 4 in decreasing order. 4, g, -1 Let j = 1160 + -1161. Sort -14, -1/2, j. -14, j, -1/2 Let z be ((-1)/(-2))/(14/(-8)). Let n = 14 + -9. Let u = 1.038 + -1.538. Put n, z, u in decreasing order. n, z, u Suppose 3d + 2l - 4l - 19 = 0, -3d + l = -14. Suppose 0 = -dq, -12 = 3j + 2q - 0q. Sort 14, 2, j in descending order. 14, 2, j Suppose -4s + 6s + 2u - 6 = 0, -3s + u - 3 = 0. Suppose -4c + 10 = -2w, 3c - 5w = 9 + 9. Put -3, 4, c, s in decreasing order. 4, c, s, -3 Let z(h) = -h2 - 16h - 44. Let p be z(-12). Let w be 2/(-8) - (-38)/(-8). Sort p, w, 5, -4 in decreasing order. 5, p, -4, w Let n be (-3)/(-2) - (-25)/10. Let x = n - 0. Suppose -4l = -0l + 12. Sort -2, l, x in descending order. x, -2, l Let h = -795 + 843. Put -1, -0.2, h in decreasing order. h, -0.2, -1 Let q = 18 - 29. Let j = -72 + 70. Put 2, j, q in decreasing order. 2, j, q Let g = 7.9 - 3.9. Let m = -167.9 + 157. Let y = m - -11. Sort -0.4, y, g in ascending order. -0.4, y, g Suppose 1 = h - 9. Let q = 6 - h. Let o = -3/79 - -243/158. Put 3, o, q in descending order. 3, o, q Let h be (56/315)/8 - (-1)/5. Sort 3, 5, 22, h in descending order. 22, 5, 3, h Let y = -9 + 29/3. Sort -0.2, y, 0 in descending order. y, 0, -0.2 Let i = 471/3146 + 1/242. Let c be 4/10 - (-182)/70. Put i, -0.1, c in increasing order. -0.1, i, c Let v be (144/108)/((-3)/(-126)2). Put 5, v, 2 in ascending order. 2, 5, v Let c be 1/(-2 + (-10)/(-4)). Let z(s) = -s3 - 40s*2 + 42s + 47. Let f be z(-41). Sort f, 0, c in ascending order. 0, c, f Let r = -0.204 - -57.204. Sort r, 1, -3 in descending order. r, 1, -3 Suppose 0 = v - 3v + 32. Suppose -o = 3x - 0 - v, 2o - 16 = -2x. Sort -5, 2, -1, o in decreasing order. o, 2, -1, -5 Let f = -0.02 - -0.02. Let g = f + 4. Let h = 4.3 - g. Sort -0.2, -3, h in ascending order. -3, -0.2, h Let t = 4043/2 - 2022. Sort 2, 1/43, t. t, 1/43, 2 Let d = 37 + -27. Let x be 2/d + 280/100. Sort x, -1, -4, 0 in descending order. x, 0, -1, -4 Let g be (-75)/50(1 + 1). Sort 14, -2, 5, g in decreasing order. 14, 5, -2, g Suppose 5j = -0 + 10. Suppose -4d + 0 + 1 = -5r, 0 = jr + 2. Sort 0, -0.1, -0.04, d in ascending order. d, -0.1, -0.04, 0 Suppose 3u + 7 = -5n, 4u + 11 = u - n. Sort u, -2, -42. -42, u, -2 Let o = -7 + 4. Let i be (1 + o/9)(-9 + 6). Put i, 5, -3 in ascending order. -3, i, 5 Suppose -2560t + 2543t = 68. Let v(l) = -l3 - 5l*2 - 4l + 3. Let p be v(-4). Sort p, -1, 2, t. t, -1, 2, p Let n(l) = 29l + 112. Let w be n(-4). Put -6, 0, 2, w in decreasing order. 2, 0, w, -6 Let m = -7 + 4. Put -0.5, m, 3/4 in increasing order. m, -0.5, 3/4 Let u = 0.79 - 0.89. Sort 8, -4/7, -5/4, u. -5/4, -4/7, u, 8 Let p(y) = 2y + 24. Let a(u) = -u - 1. Let r(d) = a(d) - p(d). Let l be r(-8). Put -2, 3, l in ascending order. -2, l, 3 Let j be ((-2)/(-9))/((-2)/6). Let f be (11 - (1 + -3)) + -12. Put j, 0.3, f, -2 in decreasing order. f, 0.3, j, -2 Suppose 0 = t + 4r - 3, -t = 4t + 5r + 15. Let c(s) = -s3 + 9s*2 - 7s - 11. Let z be c(8). Sort z, -2/5, t in decreasing order. -2/5, z, t Let z(f) = f*3 + 6f*2 - 7f + 5. Let n be z(-7). Let j(a) = a*2 - 4a - 7. Let u be j(n). Put 2, 5, u in increasing order. u, 2, 5 Let z = -0.9 - -12.3. Let x = z + -11. Sort -5, -0.3, x. -5, -0.3, x Let o = -3918 - -7837/2. Suppose 0 = -4k - 32 + 12. Sort 3, k, o in ascending order. k, o, 3 Let y = -642 + 640. Sort -3, y, -1, 4 in ascending order. -3, y, -1, 4 Let c = 11 - 6. Let l be (10/160)/(2/(-12)). Sort c, l, 2. l, 2, c Let c(q) = 2q*2 + q + 1. Let h = -21 + 20. Let j be c(h). Let p = j + 2. Sort p, -5, 2 in ascending order. -5, 2, p Let c = -3 + 2. Let l = -31 - -74. Let j = l + -42.9. Sort -3/2, j, c in decreasing order. j, c, -3/2 Let s be 34/153(-3)/(-31). Sort s, -1/5, 5 in descending order. 5, s, -1/5 Let y = 151 - 151.2. Sort y, -4, -0.8. -4, -0.8, y Let b = 0.3 + 0.2. Let h = -0.0151 - 0.4849. Let c = -6 + 6.4. Put c, b, h in ascending order. h, c, b Let k = 785 + -2356/3. Put 2/29, k, 0.09 in descending order. 0.09, 2/29, k Suppose -r - 5c = 30, 33c - 25 = 38*c. Let w be 4/(-14)	{ "pile_set_name": "DM Mathematics" }
. Is m prime? True Is 39140925/(-45)(-3)/5 composite? False Is (-899)/(-62)(2593 + 1) prime? False Suppose 35r + 3 = -3d + 30r, 2r = -6. Is (-6914)/(-3)(18/d)/3 composite? False Let h(k) be the first derivative of 20k*2 + 17 + 4 - 7k*2 - 31k + 14. Is h(13) prime? True Let m = 74 - 74. Suppose 4g + 3z - 879 = 0, -10z + 5z + 25 = m. Let n = g + 1567. Is n composite? False Let j = 805356 + -396757. Is j a composite number? True Suppose 5s - b - 1678107 = 426142, -5s - 5b + 2104285 = 0. Is s prime? True Suppose -5r + 4f = -43334, -8671 = -12r + 11r + 5f. Suppose -2l + 576 = -r. Is l a prime number? True Let g(l) = 51l*2 - 27l - 9. Let x be g(-18). Suppose x = 35b - 26b. Is b a composite number? False Suppose -3t - 6 = -18. Is 5 + 714948/91 - t/7 composite? True Let s be (-1)/(16/24)(-16)/(-6). Is 12381((-15)/(-18)-2 - s) prime? False Is (11 - -1767347) + -4 + (-1 - -2) composite? True Suppose -2y = -3x - 98720, 74y - 3x = 73y + 49357. Is y composite? False Suppose -5s + 5k + 273 = 23, 2k - 4 = 0. Suppose sl - 49l - 30717 = 0. Is l a prime number? False Let q(n) = 109n2 + 9. Suppose 0 = -0l + 4l - 16. Is q(l) a composite number? False Let y(f) = f3 - 6f*2 - 15f - 10. Let w be y(8). Let a be ((-6)/2 - w)/((-1)/60293). Suppose -5z - 4q + 36171 = -2z, 0 = -5z - 4q + a. Is z prime? False Suppose -4v - 868 = -4a - 60, -5a + 1016 = v. Let t(c) = -282c + 4 - 6 + ac. Is t(-16) a prime number? False Let b(p) be the first derivative of -16p + 8/3p3 + p2 - 1/4p4 - 10. Is b(7) composite? False Let n(h) = -31 + 316h - 75 - 445h - 606h. Is n(-7) a composite number? False Let o(k) = k*3 + 2521. Let v be 8/(-24) - 2(-2)/12. Is o(v) prime? True Suppose -77 = 6u + 7. Let h = u - 0. Let m(j) = -59j + 27. Is m(h) a prime number? True Is ((-4)/(-2) - (-61 + 70))/(5/(-121685)) composite? True Let z(h) = 394h - 15. Let j be z(3). Let p = 542 + j. Is p a prime number? True Suppose 0 = 3w - 5b - 297 + 2903, -b = -3w - 2614. Let y = 1714 + w. Is y prime? False Suppose 8s - 17592 = -0s. Suppose 4r - 5y + 608 = s, -r - 2y = -388. Is r composite? True Let v(m) = 18m + 7. Let q(i) = i*3 + 8i*2 - 3i - 10. Let l be q(-8). Let w = -10 + l. Is v(w) a composite number? False Suppose 30h + 361431 = 93h. Is h prime? True Let f(c) = 1688c2 - 109c - 139. Is f(8) prime? True Let p be (2 - 2)/(4 + -3). Suppose pb = 2b - 13548. Suppose 0 = 5i - b - 1341. Is i a composite number? True Suppose 0 = -18y + 19y + 13. Let o(k) = k + 17. Let m be o(y). Suppose -2j + mz = -2218, -2j + z - 1020 = -3223. Is j a prime number? False Let a = 82 + -84. Is -2 - -3 - (a + 614)/(-2) prime? True Let f(i) = -4i + 18. Let n be f(4). Let d be (n + 2)(25/(-10))/(-5). Suppose -2c - 2b + 15 = -1241, 0 = -5c + db + 3161. Is c composite? False Suppose -7276 = -6g - 352. Let z = 600 + g. Is z prime? False Let b = 727 + -440. Let h(o) = -2o*2 + 6o - 10. Let u be h(8). Let m = b - u. Is m composite? True Let h = -1565985 + 2758274. Is h prime? False Let o be 90/3648/10. Let c(u) = u2 - 11u - 10. Let g be c(o). Suppose -4d + 32 = t - 2d, 0 = t - gd - 20. Is t composite? True Suppose 3u = -3s + 541440, 2s = -u + 417774 - 56809. Is s composite? True Let b(h) be the third derivative of 5h5/6 + 13h4/24 + h3 - 39h2. Let v be b(5). Let t = 448 + v. Is t prime? False Let j(f) = -f3 + 6f*2 - 6f + 8. Let m be j(-6). Suppose -4q = 4d - 584 - m, -779 = -3q + d. Let l = q + -62. Is l a composite number? False Let f be ((-6)/7)/(110/(-28) + 4). Let x be 556/6 - 4/f. Let p = x + 286. Is p a composite number? False Let h = -13 - -17. Let w be (-23)/(-7) - h/14. Is 4/(-12) + 3 + 2383/w a composite number? False Let i = 1200 + -378. Suppose -22x + 19x + i = 0. Is x prime? False Suppose -2d = 5n - 56953, -4n + 27333 = -5d - 18269. Is n composite? False Let x be (1 - (-167068)/(-8))(9 + -15). Suppose 0n + 5c - 83530 = -2n, -3n + 5c = -x. Is n composite? True Suppose 949 = 4p + 9. Let o(h) = -2h3 + h2 - 2h + 6. Let j be o(4). Let b = j + p. Is b composite? True Let w(m) = -558498m - 12745. Is w(-10) prime? False Let l be 6/2 - (10 - -489580). Let g = 250215 + l. Is (-8)/10 - g/140 a composite number? False Suppose 0 = -4h - 2l - 6, -3h - l = -5h + 3. Suppose h = 5y + 3 - 13. Suppose 0 = -ym - 2m + 4876. Is m a composite number? True Suppose 0 = g - 2n - 1, 34n = 3g + 33n - 13. Is 0 - g/((-35)/88571) a composite number? False Let k = -16812 + 35146. Suppose 5w - 18322 = -7p + 3p, w + k = 4p. Is p prime? True Let c be ((-3342)/(-9))/((-2)/(-12)). Suppose 5s + 0s = -4i + 2231, -4s + c = 4i. Let k = i + -73. Is k a prime number? False Let p(s) = -3s*3 - 12s*2 - 12s - 11. Let f be p(-8). Let v = 5533 + -3901. Let q = v - f. Is q composite? True Suppose -k + 2r + 49015 = 0, 28k + 2r + 147033 = 31k. Is k prime? True Suppose -294070 = 17b - 52b. Is b(-15)/(-20)(-4)/(-6) composite? False Let d(k) be the second derivative of 11k6/40 - k4/4 + k3/3 + k2/2 + 18k. Let l(i) be the first derivative of d(i). Is l(2) a composite number? True Let b(k) = 5k3 - 3k*2 + 2k + 7. Let f be b(-5). Let i = f + 500. Let s = -129 - i. Is s a prime number? False Let h(i) = -i*3 - 7i*2 - 2i + 11. Let n be h(-6). Let a = 17 + n. Is (2/a)/(((-18)/(-3))/5316) a prime number? True Let v(h) be the third derivative of -h*6/120 + 29h*5/60 + 3h*3/2 - 27h*2. Let x be v(29). Suppose xr - 11r = -290. Is r a prime number? False Is (263733/(-9))/(((-272)/168)/34) a composite number? True Suppose 5x = 3v + 174534 + 68086, 4x - 3v - 194096 = 0. Suppose -5q = -3i - 6q + 29106, 5i = 3q + x. Is i composite? True Let j(n) = -n*3 + 2n*2 - 3n - 9. Let g be j(-2). Let d(k) = 40k + 31. Is d(g) a composite number? True Let a = 0 + -23. Let o = -23 - a. Is o + 9074/10 - (-4)/(-10) a prime number? True Suppose -27663288 = -149f + 32881223. Is f a prime number? True Suppose 17q - 19q + 1592 = 0. Is (-8)/(-16)(0 + q) a prime number? False Let b(y) = 1504y*3 + 20y*2 - 65y - 41. Is b(6) composite? False Let i(z) = 75z - 7. Let c be 1 + (-6 - -2) + -2. Let y be i(c). Is (-2 - 3)y/2 composite? True Let p(h) = -274h + 1187. Is p(-93) prime? True Let g = 620 - 636. Let b(m) be the second derivative of -13m*3/6 - 17m*2/2 + 2m. Is b(g) composite? False Let o be 1-7-1 + 3150/(-450). Suppose -50 = -5q - 3m, 5q + 0m + m - 40 = 0. Suppose qu - 6671 = -ou. Is u a composite number? False Let n(f) = 3f - 45. Suppose -x + 47 = 3c, 0 = 2c - 4x - 36. Let r be n(c). Suppose 2y + 6 = 0, ri - 1293 - 585 = -5y. Is i composite? False Let c(r) = -562r*2 - 13r + 59. Let n(p) = -1124p2 - 27p + 118. Let l(s) = 5c(s) - 3n(s). Is l(4) composite? True Suppose -10w + 6 = 6. Suppose w = 8y - 45967 - 19209. Is y a composite number? False Suppose -120l + 5013 = -121l. Let d = l + 8120. Is d composite? True Let z(p) = -13 - 9 + 68p + 1. Suppose -u + 1 = k, -4k + 5k - 5u - 19 = 0. Is z(k) composite? False Suppose 2y = 5k + 4590, -2y + 4634 = -9k + 15k. Is y prime? False Let j = 3854 - 2753. Suppose -f + 3606 = -5z, 6 = -2f - 2. Let i = j + z. Is i prime? True Suppose 633l - 574l = 13215941. Is l a composite number? False Let c = 4 - -5. Let k(o) = -26o - co - 34 + 32. Is k(-21) composite? False Let o = 3 - 1. Let p be (-31565)/(-7) + 62/(-217). Suppose -y - 4y = 4w - p, 1803 = oy + w. Is y prime? False Let u(t) = -t*2 + 23t - 26. Let j be u(21). Suppose jr + 41653 = 134117. Is r a composite number? False Suppose -9 = -y + 2n, -4y + 4 + 5 = n. Suppose 2b = -3q + yb + 35, -5q = b - 61. Is ((-1)/(-3))/(q/7164) a composite number? False Suppose 0 = 4p - m - 27 - 7, -3p = 3m - 33. Suppose -556 = 5l - pl. Suppose -3w + l = 37. Is w composite? True Let m = 408684 + -228703. Is m a prime number? True Let o(t) = -4t3 + t2 - t - 1. Let a be o(-1). Suppose au - u = -2z - 2, 0 = 4u + 4z - 4. Is 1 - (1 + u) - (-243 + 6) a prime number? True Let x(a) = 21504a + 221. Is x(7) composite? True Suppose 3j - 4199200 = 19j. Is (-13)/(910/j) + 2/(-7) composite? True Let d = -12 - -6. Let u(q) = -127 - 659q + 180 - 50. Is	{ "pile_set_name": "DM Mathematics" }
rivative of -11946457w3 + 27900292w*2? -71678742 Find the second derivative of -19l*3 - 57869l*2 - 40568210l. -114l - 115738 Find the second derivative of 4s*4 + 834s*3 + 36s*2 - 7510453s. 48s2 + 5004s + 72 What is the third derivative of -677512d2q*3 + 17970d*2q*2 - 3d*2q + 2dq*3 - 15q*3 - 54q*2 + q - 2 wrt q? -4065072d*2 + 12d - 90 What is the third derivative of -260174k3t*3x*3 + 2k*3t*2x - 3k3tx3 + 12k*3tx2 + 6k*2x - 15kt*3x*2 + 16kt3 + t3 wrt x? -1561044k*3t*3 - 18k*3t Find the second derivative of 97322h2lz + 54h*2l - hlz + 6hl - 33hz - 211lz - z - 8 wrt h. 194644lz + 108l What is the derivative of -2g*3w*4 - 489217g*3w*2 - 675g*3 - 4548g*2 - 1 wrt w? -8g*3w*3 - 978434g*3w Find the first derivative of 248777372fw + 28371276w wrt f. 248777372w What is the second derivative of -11165291i2w*2 - 1348465i*2 - 5w*4 - 37w wrt w? -22330582i2 - 60w*2 Differentiate -369c*2n*3 - 889569c*2n*2 + 87n*3 - 198n*2 + 29n + 21 with respect to c. -738cn*3 - 1779138cn2 What is the derivative of 27334016l - 20183068 wrt l? 27334016 What is the first derivative of 135p3 - 15711p*2 + 3p - 4600869? 405p2 - 31422p + 3 Differentiate -w*3 + 253w*2 - 229w - 4453124 with respect to w. -3w2 + 506w - 229 Find the first derivative of 122n4 + 418036n*2 - 458355174. 488n*3 + 836072n Differentiate 29580q2 - 915q + 304155411 wrt q. 59160q - 915 What is the second derivative of -10564781l*4 - 3349l - 181 wrt l? -126777372l2 Find the second derivative of -866w*4 - 1879w*3 - 2w*2 - 36029388w wrt w. -10392w2 - 11274w - 4 Find the first derivative of 174724i2ux - 7718i*2x + 38iu*2x + 5361ix wrt u. 174724i2x + 76iux What is the third derivative of 53f*4t + 661159f4 + f3t*3 - 21f*2t*3 - 35f*2t*2 + ft*3 + 16t*3 - 11t - 2 wrt f? 1272ft + 15867816f + 6t*3 Differentiate 29h*3 + 567049h*2 + 2h - 78042360 wrt h. 87h2 + 1134098h + 2 Find the third derivative of 266948543a3 - 27095293a*2 wrt a. 1601691258 What is the second derivative of 672556s*3 - 247s*2 - 22377893s + 3? 4035336s - 494 Differentiate -61112n*3s - 15ns*2 + 1027s*2 + s + 41 wrt n. -183336n*2s - 15s2 Find the second derivative of -9542027l*2 - 90313010l wrt l. -19084054 What is the third derivative of -g*4z + 2886316g3 - 2g*2z + 77gz - 6121z wrt g? -24gz + 17317896 What is the third derivative of -16124976o*3t + o*3 - 2311o*2t - 1539o2 wrt o? -96749856t + 6 What is the third derivative of 2170g2r*4 + 3g*2r3 + g2r2 + 13g*2 - 35gr3 - 10727364r*2 wrt r? 52080g*2r + 18g2 - 210g Find the second derivative of 19612269i2o*2 - 12io2 + io - 1607o2 - o - 3 wrt i. 39224538o*2 Find the second derivative of -1615230l*4 + 13145623l. -19382760l2 Find the third derivative of -237262294u*4 - 2430879u*2 - 15u - 1 wrt u. -5694295056u What is the first derivative of -12917933p*2 - 16170392 wrt p? -25835866p Differentiate -13252l2 + 1080l - 22631067 with respect to l. -26504l + 1080 Find the third derivative of 42868843w*4 - 8747494w*2 - 2w wrt w. 1028852232w What is the first derivative of 9488508co + 13767607c wrt o? 9488508c Find the second derivative of 66930123u3 + u2 + 3u - 17462544. 401580738u + 2 Find the first derivative of -94773033di + 4660dl*3 - 4356il2 + 2i wrt l. 13980dl*2 - 8712il Find the first derivative of -17288729p*4 - 6038393 wrt p. -69154916p*3 Find the second derivative of -338912076f*2y*2 + 3f*2y + 2f2 - 17fy - 2797f + 2y + 1 wrt y. -677824152f*2 Find the third derivative of 4982258l*6 - 8485079l*2 wrt l. 597870960l*3 Find the third derivative of 99027937z*3 + 130z*2 - 24110z wrt z. 594167622 Find the third derivative of -27225503u3 - 29274635u*2 wrt u. -163353018 What is the third derivative of 27897001d3 + d2 - 2d + 2245552 wrt d? 167382006 What is the second derivative of -348f*2gz + 362f*2g - 9f2z + 8fgz - 21fg - 3f + 4gz + 225g wrt f? -696gz + 724g - 18z Find the third derivative of 33255339a*2f*2g*2t*3 - 3a*2g*2 - 4a*2t*2 + 10afg*2t*2 + 20f*2 + 63f - 3gt*2 wrt t. 199532034a*2f*2g*2 What is the first derivative of 6878389u*2 - 2u - 14637195 wrt u? 13756778u - 2 Find the third derivative of 19110893h*3n*3 + 97643h*3 - 418hn2 wrt n. 114665358h*3 Differentiate -426533167ir + 700218445i wrt r. -426533167i Find the second derivative of 21338ad3 + 6ad - a - 101d*3 - 184d + 115 wrt d. 128028ad - 606d What is the second derivative of -385321009q*2 - 174181381q? -770642018 What is the third derivative of -15643p6 + 9p*5 - 32p*3 + 574p*2 - 14295? -1877160p*3 + 540p*2 - 192 What is the third derivative of -4115n*5 - 1638n*4 + 34837489n*2? -246900n*2 - 39312n What is the second derivative of -6ty*3 - 6882474ty2 + 2468ty + 72t - 2y3 - y + 1 wrt y? -36ty - 13764948t - 12y Find the second derivative of 20959531c*2i + 5ci - 3c - 8i - 1714 wrt c. 41919062i Find the second derivative of 22452249j*3 - 2j - 2317843. 134713494j Find the third derivative of -2754058c*2j3 + c2j2 + 58cj3 - 235cj - 27159c + 2j3 + 3 wrt j. -16524348c*2 + 348c + 12 What is the second derivative of o*3 + 14960080o*2 + 14249o - 66? 6o + 29920160 Differentiate -68426d*4s - 25ds*2 - 12904446s*2 with respect to d. -273704d*3s - 25s2 What is the third derivative of -82h*4 - 1768h*3 + 7883090h*2 wrt h? -1968h - 10608 Find the third derivative of -342132696y4 - 21y*2 - 935y - 2288. -8211184704y What is the third derivative of -t2u*3 + 50t*2u + 12464t2 - 4tu2 + 7069448u*3 wrt u? -6t*2 + 42416688 What is the derivative of -46441v*4 - 3v*2 + 6v - 8595121? -185764v3 - 6v + 6 What is the second derivative of 6o5 + 9359o*4 - 17o*2 - 4094333o wrt o? 120o3 + 112308o*2 - 34 Find the first derivative of -4845372bn + 351bs + 14b - 2gns - 2gn + 12gs - s + 2 wrt n. -4845372b - 2gs - 2g Find the third derivative of 688659069n*3 - 7118n*2 - 29n + 520 wrt n. 4131954414 What is the third derivative of 17000850q3w3 + q2w3 + q2 - qw*3 - 4834w*3 wrt q? 102005100w*3 What is the third derivative of 14n*5 - 244384n*4 - 4n*3 + 8346827n*2? 840n*2 - 5865216n - 24 Find the third derivative of -1747286b5 + 8b*2 - 144b - 66. -104837160b2 Find the third derivative of 10093746l*3 + 68322830l*2 wrt l. 60562476 Find the third derivative of 7k*3qz3 - 6718k*3z*5 + 11k*3z*2 + 10k*2z*2 + 11k*2 + 20kqz wrt z. 42k3q - 403080k3z*2 Find the third derivative of -5g*3t*4 + 4887g*3t*2 - 1205g*3t + 57720g2t*4 wrt t. -120g*3t + 1385280g2t Differentiate -45ci*3 + 3ci2n + 2cn - 3cs - 7c - i3ns + i2 - 133in - 12762084ns - n wrt s. -3c - i*3n - 12762084n What is the second derivative of -236287q*4 + 229q*3 - 3066q - 46543? -2835444q2 + 1374q What is the first derivative of -2o2q*2 + 93230941o*2q + q*2 + 71548q - 71 wrt o? -4oq*2 + 186461882oq Find the first derivative of -86939927hn2 - 3182n*2 + 5n + 9023 wrt h. -86939927n2 What is the third derivative of -2j*5 + 23764724j*4 + 584226890j*2 wrt j? -120j*2 + 570353376j Differentiate -121722c2 + 137c - 38752975. -243444c + 137 Find the second derivative of 152911493z*5 - 504105165z. 3058229860z3 Differentiate -8183085u*3 - 31075849 wrt u. -24549255u*2 Find the first derivative of -298023w*2 + 18w - 9617862 wrt w. -596046w + 18 What is the derivative of -2n*2p + 7827927n2 + 4601926np3 + 1 wrt p? -2n*2 + 13805778np2 Find the second derivative of 32f*2k*2m - 4510f2m*2 + 29fkm - k*2m*2 + 4k*2 - km*2 - 9km + 46m*2 wrt m. -9020f*2 - 2k*2 - 2k + 92 Differentiate -10g3 - g2 - 109616g - 31864998 wrt g. -30g2 - 2g - 109616 W	{ "pile_set_name": "DM Mathematics" }
f*3 + 159f*2 + 246f + 96. -3(f - 2)(f + 1)*3(f + 16) Factor 4f5/7 + 16f*4/7 + 24f*3/7 + 16f*2/7 + 4f/7. 4f(f + 1)*4/7 Factor -289o*5/9 - 799o*4/9 - 667o*3/9 - 97o*2/9 + 56o/9 - 4/9. -(o + 1)*3(17o - 2)2/9 Solve 3n*2 + 27n - 408 = 0 for n. -17, 8 Let -3f5 + 3f*4 + 27f*3 - 27f2 = 0. Calculate f. -3, 0, 1, 3 Solve o4/3 - 2o3/3 - 4o*2/3 + 8o/3 = 0 for o. -2, 0, 2 Let -2a4 - 1107a*3/2 - 77003a*2/2 - 28428a + 9522 = 0. Calculate a. -138, -1, 1/4 Factor 2u3/7 + 158u*2/7. 2u*2(u + 79)/7 Determine f so that 3f3 - 822f*2 - 3f + 822 = 0. -1, 1, 274 Factor 2x5 + 40x*4 - 550x*3 + 1500x*2. 2x*2(x - 5)*2(x + 30) Determine l, given that 3l2/7 - 1770l/7 + 261075/7 = 0. 295 Factor 2s3 - 28s*2. 2s*2(s - 14) Suppose -2a2/7 + 160a - 22400 = 0. What is a? 280 Find s, given that -9s5/2 + 89s*4 - 689s*3/2 + 324s*2 + 90s = 0. -2/9, 0, 2, 3, 15 Determine p so that 3p2 + 34116p + 96991788 = 0. -5686 Factor -28o3 - 144o*2 + 372o + 56. -4(o - 2)(o + 7)(7o + 1) Factor 12b4 - 2616b*3 + 213858b*2 - 7770174b + 423474483/4. 3(2b - 109)*4/4 Let -9g*5 - 39g*4 + 119g*3/4 - 3g*2/2 - 5g/4 = 0. What is g? -5, -1/6, 0, 1/3, 1/2 Find b, given that 5b3 + 9745b2 = 0. -1949, 0 Find v, given that v4/3 - 8v3/3 - 7v*2 + 8v/3 + 20/3 = 0. -2, -1, 1, 10 Factor -5o5 - 155o*4 - 290o*3 + 10o*2 + 295o + 145. -5(o - 1)(o + 1)*3(o + 29) Find i, given that -2i2 + 900i - 1792 = 0. 2, 448 Factor -5z4 - 6140z*3 - 1872660z*2 + 7564480z - 7589120. -5(z - 2)2(z + 616)*2 Determine m so that -5m*2 - 165m = 0. -33, 0 Factor 4v4/5 - 4v*3 + 36v*2/5 - 28v/5 + 8/5. 4(v - 2)(v - 1)*3/5 Factor 3i*3 - 1842i*2 - 3705i + 5544. 3(i - 616)(i - 1)(i + 3) Let j3/4 - 8j*2 = 0. Calculate j. 0, 32 Find l, given that 2l*2/13 + 1472l/13 + 270848/13 = 0. -368 Let 4n2 + 48n + 128 = 0. What is n? -8, -4 Determine w so that -2w4/11 - 620w*3/11 + 622w2/11 = 0. -311, 0, 1 Factor -v4/7 + 15v3/7 - 78v*2/7 + 164v/7 - 120/7. -(v - 6)(v - 5)(v - 2)*2/7 Solve 24i*5 - 381i*4 + 2208i*3 - 5478i*2 + 4680i + 675 = 0 for i. -1/8, 3, 5 Suppose -21x2/2 - 507x - 144 = 0. What is x? -48, -2/7 Let -w*2/4 - 4w + 33 = 0. What is w? -22, 6 Determine x, given that 9x3 - 12x*2 + 4x = 0. 0, 2/3 Let -5l4 + 95l*3 + 35l*2 - 635l - 570 = 0. Calculate l. -2, -1, 3, 19 Factor y*3/8 + 779y*2/8 - 195y/2. y(y - 1)(y + 780)/8 Determine g, given that g*3/5 - 377g*2/5 - 378g/5 = 0. -1, 0, 378 Factor -2n2/7 + 32n - 896. -2(n - 56)2/7 Solve -7r*4 - 37r*3 + 46r*2 + 100r + 24 = 0. -6, -1, -2/7, 2 Factor -l*3/3 + 55l*2/3 - 728l/3 - 784/3. -(l - 28)*2(l + 1)/3 Factor -n*4 + 360n*3 - 30919n*2 - 268272n - 236992. -(n - 184)*2(n + 1)(n + 7) Find f, given that 6f*5 + 2f*4 - 26f*3 - 18f*2 + 20f + 16 = 0. -4/3, -1, 1, 2 Factor -6r4 - 14181r*3 - 11169900r*2 - 2930234736r + 1467911616. -3(r + 788)3(2r - 1) Factor -2q*2/11 + 202q/11 + 1744/11. -2(q - 109)(q + 8)/11 Factor 5l2 - 355l - 2310. 5(l - 77)(l + 6) What is i in -2i2/7 - 12i/7 + 54/7 = 0? -9, 3 Find b such that -4b3 + 28b*2 - 24b = 0. 0, 1, 6 Let f*4 + 32f*3 - 229f*2 - 32f + 228 = 0. Calculate f. -38, -1, 1, 6 Factor 4m3 - 64m*2. 4m*2(m - 16) Factor -3o4 + 720o*3 - 57600o*2 + 1536000o. -3o(o - 80)*3 Determine j, given that -1109205j*2 - 4710j - 5 = 0. -1/471 Let 2p3/5 + 1742p*2/15 - 388p/5 = 0. What is p? -291, 0, 2/3 Factor -3z3/4 + 15z*2/4 + 6z - 36. -3(z - 4)2(z + 3)/4 Let 2g4/21 + 326g*3/21 + 4478g*2/7 + 3726g/7 - 26244/7 = 0. Calculate g. -81, -3, 2 Solve 3n5/4 + 32n*4 + 462n*3 + 2352n*2 + 1372n = 0 for n. -14, -2/3, 0 Find g such that -3g5/5 - 24g*4/5 - 63g*3/5 - 54g*2/5 = 0. -3, -2, 0 Find k such that 2k*3/7 + 20k*2/7 - 104k/7 + 16 = 0. -14, 2 Factor 2s3/7 - 2s*2/7. 2s*2(s - 1)/7 Find o such that o*2/2 + 6065o + 36784225/2 = 0. -6065 Factor 4m4 + 336m*3 - 1392m*2 + 1408m. 4m(m - 2)*2(m + 88) Factor -3z2/5 - 6618z - 18249135. -3(z + 5515)2/5 Determine v, given that -5v*2 + 475v - 470 = 0. 1, 94 Factor 2a4 - 12a*3 - 30a*2 - 16a. 2a(a - 8)(a + 1)2 Factor -5w*2 - 20w - 15. -5(w + 1)(w + 3) Find r, given that -3r4 - 12r*3 - 6r*2 + 12r + 9 = 0. -3, -1, 1 Solve q*2/7 + q = 0. -7, 0 Determine b, given that -35b*3 + 13710b*2 - 1340640b - 384160 = 0. -2/7, 196 Suppose -l*3/3 - 10l*2/3 - l/3 + 40 = 0. What is l? -8, -5, 3 Factor -3z*2 + 3100z + 2068. -(z - 1034)(3z + 2) Factor v*5/5 + 2v*4/5 - 3v*3/5 - 4v*2/5 + 4v/5. v(v - 1)2(v + 2)2/5 Suppose f2/4 - 1192f - 4769/4 = 0. Calculate f. -1, 4769 Find l, given that -2l*3/13 - 336l*2/13 - 666l/13 - 332/13 = 0. -166, -1 Factor 2n3/11 - 8n/11. 2n(n - 2)(n + 2)/11 Factor f3/4 - 3f*2/4 - 4f + 12. (f - 4)(f - 3)(f + 4)/4 Determine q, given that -q*5 - 33q*4 - 408q*3 - 2404q*2 - 6816q - 7488 = 0. -13, -6, -4 Solve 2k5 + 10k*4/7 - 18k*3/7 - 10k*2/7 + 4k/7 = 0 for k. -1, 0, 2/7, 1 Factor -3m2/2 - 84m - 1152. -3(m + 24)(m + 32)/2 Suppose -2y3 - 72y*2 + 312y - 320 = 0. Calculate y. -40, 2 Suppose -3i3 + 225i*2 - 2958i = 0. What is i? 0, 17, 58 Factor 77q2 - 233q + 6. (q - 3)(77q - 2) Factor -4x2 + 32x - 48. -4(x - 6)(x - 2) Let -w*4/7 + 31w*3/7 + 99w*2/7 + 101w/7 + 34/7 = 0. What is w? -1, 34 Determine b so that 2b2/7 + 248b/7 + 2486/7 = 0. -113, -11 Factor -2m3 - 60m*2 + 8m + 240. -2(m - 2)(m + 2)(m + 30) What is y in 4y5/5 + y4 - 11y3/5 - 7y*2/5 + 7y/5 + 2/5 = 0? -2, -1, -1/4, 1 Factor 2t3 + 12534t*2 + 26183526t + 18232461938. 2(t + 2089)3 Factor 3v*4 - 129v*3 + 249v*2 - 123v. 3v(v - 41)(v - 1)2 Factor 2h*2 - 232h + 6728. 2(h - 58)2 Factor 3u*5 + 17u*4 - 8u*3 - 12u2. u2(u - 1)(u + 6)(3u + 2) Factor -2p4 - p3 + 1007p*2/8 + 3249p/8. -p(p - 9)(4p + 19)2/8 Factor -f2/4 - 83f/4. -f(f + 83)/4 Factor -v5 + 8v*4 - 19v*3 + 12v2. -v2(v - 4)(v - 3)(v - 1) Factor 3q*4 - 36q*3 - 177q*2 - 234q - 96. 3(q - 16)(q + 1)*2(q + 2) Suppose -4h5 + 68h*4 + 200h*3 - 4552h*2 - 9412h - 4732 = 0. Calculate h. -7, -1, 13 Factor 6s2 + 75s. 3s(2s + 25) Suppose -5c*4/2 + 65c*3 + 425c*2/2 + 145c = 0. Calculate c. -2, -1, 0, 29 Find n such that -n*3/3 + 211n*2/3 + 640n/3 + 428/3 = 0. -2, -1, 214 Factor -4k5 - 156k*4 - 1272k*3 + 4792k*2 - 5124k + 1764. -4(k - 1)3(k + 21)2 Factor -j3 - 35j2 + 237j - 369. -(j - 3)*2(j + 41) Factor 5t3 - 1010t*2 - 3065t - 2050. 5(t - 205)(t + 1)(t + 2) Factor -p4/5 + 54p*3/5 - 829p*2/5 + 540p - 500. -(p - 25)*2(p - 2)*2/5 Factor 3m4/4 + m3/2 - 19m2/4 + 3m/2. m(m - 2)(m + 3)(3m - 1)/4 What is s in 3s2 + 9s - 30 = 0? -5, 2 Suppose -3t4 + 1512t*3 - 190512t2 = 0. Calculate t. 0, 252 Find b such that b3 - 1082b2/3 - 361b/3 = 0. -1/3, 0, 361 Find y such that 4y2/3 - 28y/3 - 32/3 = 0. -1, 8 Factor n*2 + 11086n + 30724849. (n + 5543)*2 Suppose -4c*5 - 16c*4 - 4c*3 + 24c*2 = 0. Calculate c. -3, -2, 0, 1 Factor -5r*2 + 35r + 150. -5(r - 10)(r + 3) Factor 4m4 + 28m*3 + 44m*2 + 20m. 4m(m + 1)*2(m + 5) Find j, given that 3j5 + 51j*4 + 234j*3 - 150j*2 - 2541j - 2205 = 0. -7, -5, -1, 3 Let -l*4/4 - 5l*3/2 - 29l*2/4 - 2l + 12 = 0. Calculate l. -4, -3, 1 Suppose 8c2 + 6c - 2 = 0. Calculate c. -1, 1/4 Factor -3y2/4 + 291y/2 - 579/4. -3(y - 193)(y - 1)/4 Factor 2s4/7 + 100s*3/7 - 1392s*2/7 + 832s - 7936/7. 2(s - 4)3(s + 62)/7 Solve 8m4/5 - 2598m*3/5 + 209294m*2/5 + 265038m/5 + 53138/5 = 0. -1, -1/4, 163 Factor 3g3 + 57g*2 - 135g - 189. 3(g - 3)(g + 1)(g + 21) Factor -2c*5/7 - 52c*4/7 - 482c*3/7 - 1840c*2/7 - 2432c/7 - 1024/7. -2(c + 1)2(c + 8)*3/7 Factor 6n*3 + 134n*2 + 40n - 88. 2(n + 1)(n + 22)(3n - 2) Solve -d*3/4 + 27d*2/2 + 427d/4 = 0. -7, 0, 61 Solve 2n3/5 - 104n*2 - 2n/5 + 104 = 0 for n. -1	{ "pile_set_name": "DM Mathematics" }
s b Suppose 10y - 1068 = 1412. Let p = y + -244. Which is the nearest to -1/4? (a) p (b) 2 (c) 8 b Let h = -3.4 + 3. Let b = -0.5047 - -1.0047. What is the nearest to b in -1/9, -3, h? -1/9 Let p = 0.112 - 3.312. Let m = p + 8.2. Which is the closest to 0.1? (a) 2/9 (b) m (c) 0.5 a Let i = -6.648 + 6.748. What is the closest to i in -0.09, 4, -7? -0.09 Let u = -98 + 98. What is the nearest to -2/7 in -5, u, -0.2, -4.4? -0.2 Let c = 4.2 - 0.2. Let i = -126.2 + 106. Let p = i - -20. What is the closest to 0 in p, c, -1/4? p Let i = -6.528 - -3.528. Which is the closest to 0.04? (a) 13 (b) i (c) 2/9 c Let t be ((-14)/(-68))/((-2)/4). Let y = t + 117/119. Let g(i) = i3 - 28i*2 - 57i - 89. Let n be g(30). Which is the nearest to 0.2? (a) y (b) n (c) 2 a Let v = 0.0012 + -346.0012. Let s = 346.5 + v. What is the closest to 2 in 37, s, -3? s Let s = 27.18 + -34.18. Which is the closest to -1? (a) 1/3 (b) -3 (c) s (d) -3.9 a Let g be (11 - 20)/(39/(-6) - 1). Let p = 1942/9 + -216. What is the closest to 1 in p, 0, g? g Let d = -6.22 - 0.78. Let z = -65.4 + 66. Which is the closest to -1? (a) 1 (b) d (c) z c Let l be (-14)/6 + (0 - -3). Let a = 2.2 - -12.8. Let w = a - 17. What is the closest to 2/3 in -1/3, w, l? l Let d be (9/(-3))/(-15)(3 - 187/44). What is the nearest to d in -2, -133, -4/9? -4/9 Let k = -14693 - -14689. Which is the nearest to -0.3? (a) 2/7 (b) 0.3 (c) 0 (d) k c Let f = 12482 - 12481.9. What is the closest to f in 25, 6, -1/2? -1/2 Suppose 6v + 3v - 44 = 2y, 5v = -5y. Let l = -92/17 + 711/34. Let h = 15 - l. Which is the closest to -0.03? (a) h (b) -2/3 (c) v a Let h = 0.13 + -0.83. Let p = -171 - -166.54. Let k = 1.46 + p. What is the nearest to h in k, 1/5, -1/5? -1/5 Let h be -446(5 + 0 + -3). Let u be h/(-304)(-32)/(-18). Let g = 78/19 - u. What is the nearest to -2/5 in g, 0.1, -1/4? -1/4 Let l = 9 + -4. Let o be 249/210 - 1 - (-8)/(-1036)37. Which is the nearest to 0.3? (a) l (b) o (c) -1 b Let s = 76.09 - 76.49. Which is the closest to -4? (a) 1/7 (b) -4 (c) 4.9 (d) s b Let l = 15778.58 - 15779. Which is the closest to 1? (a) l (b) 2 (c) -0.5 (d) -0.3 b Let d be (-3)/21 + 337085/420. Let l = -265 + d. Which is the closest to l? (a) -4 (b) 0.8 (c) 1/12 c Suppose -3g + 57 = -66. Let i = 45 - g. Suppose 4v = -3h, h = -5v - ih. Which is the closest to v? (a) 1/6 (b) 3/2 (c) -0.3 a Let u = 0.86 - 0.8. Let i = -25.2 - -28.6. Let s = -7.4 + i. What is the nearest to -1/4 in s, u, 0.5? u Let l be 15/(-18)1/5. Let u be -3 + 0 + 6/5. Let n = 1723/5349 - -20/1783. Which is the closest to n? (a) -0.1 (b) u (c) l a Let h = -312 + 282. Let w = 30 + h. Which is the closest to 2/5? (a) w (b) 0.2 (c) 0.5 c Let g be (-2)/(-6 - 14 - -18). Which is the nearest to -3? (a) -3 (b) -0.06 (c) 11 (d) g a Let o = 6757 + -6756. Let w = 0.15 - 0.05. Which is the closest to -18? (a) w (b) o (c) 3 a Let n = 30.572 + -293.572. Which is the closest to 4? (a) 0.1 (b) -2/3 (c) n a Let j = 3 - 1. Let n = 4600 + -4600. What is the closest to 0.1 in n, j, -0.2? n Let v = 0.04887 - -0.21113. Which is the nearest to 0.1? (a) 0 (b) v (c) -0.02 (d) -4 a Let u = -30.9 + 31. Let y = -0.4 - 0.1. Let h = 2795 + -2790. Which is the closest to u? (a) h (b) y (c) 2/5 c Let p = 1091 + -1091.2. Which is the nearest to -2? (a) p (b) 14 (c) 3 a Let x = -8.86 + 9.86. Let l = -23 - -25. Which is the closest to l? (a) 2 (b) x (c) -2/11 (d) 0.08 a Let z = -0.279 - 0.011. Let h = -1.29 - z. Let k = 2.5 + -2.4. Which is the nearest to h? (a) -0.6 (b) k (c) 5/3 a Let x = 2 + -2.1. Let v = 55 + -17.4. Let g = v + -37.7. Which is the nearest to x? (a) 2 (b) g (c) 3/5 b Suppose 726f - 707f - 19 = 0. Which is the closest to f? (a) -12 (b) 5 (c) -5 (d) 2/7 d Let p = -833 + 588. Let k = p + 241. Which is the nearest to -0.3? (a) 1/6 (b) k (c) -3 a Let y = -4360 - -4360. Let j = -983/9 - -109. What is the closest to y in j, 4, -6? j Let k = -34 + 43. Let n(b) = -3b + 28. Let v be n(k). Let z = 0.1 + 0. What is the closest to v in z, 5, -5? z Let x = -8 - -11. Let y = -4 + 2. Suppose -46u + 139u = -372. What is the nearest to -1/4 in y, u, x? y Let r = 216 + -211.46. Let h = -0.552 - -1.092. Let g = h - r. What is the closest to -0.3 in 1/2, g, -1/3? -1/3 Let h = 0.63 + -0.77. Let j = -97 + 150. Let d = j - 52.6. Which is the nearest to h? (a) d (b) -1/5 (c) -1/4 b Let y = -197 + 186.9. Let j = y - -10. Let l = 5.3 + 4.7. Which is the closest to l? (a) j (b) 3 (c) 5 c Let s = -4571 - -4576. Which is the nearest to -1? (a) -6 (b) s (c) -0.39 c Suppose -5k + 4n + 12 = 0, -2n + 6 = 3k - 10. Suppose -ks + o = -19, -o - 2 - 5 = -s. Which is the closest to 4? (a) s (b) -2/7 (c) 5 a Let s = -2 + 7. Let p = 0.1693 - 0.1693. What is the nearest to -14 in s, 0.3, p? p Let m be 1/42 - (-56)/112. Which is the closest to m? (a) -19 (b) 4/7 (c) -2 (d) -1.1 b Let h = 24.1471 + 0.8529. Which is the nearest to 0.4? (a) 1/4 (b) 1/2 (c) h b Let g(b) = b3 + 39b*2 + 123b + 536. Let r be g(-36). What is the closest to r in -1, -3, -4? -4 Let y be (-21)/3 - (-5 + (-8 - 4 - -13)). Which is the nearest to -0.12? (a) y (b) 2/5 (c) -27/4 b Let u be 10(-8336)/(-41720) + -2. Let n = 2092/3129 + u. Which is the closest to n? (a) 0 (b) 4 (c) 1 (d) 25 c Let w = 0 - 0. Let g(k) = -k3 - 9k*2 + 26k + 48. Let t = -268 - -257. Let n be g(t). What is the nearest to w in -2, n, -0.4? -0.4 Let f = 1.46 + 27.54. Let i = f + -24. What is the closest to 0.1 in i, 2, 1/3? 1/3 Let n = -1/68699 + 68701/137398. What is the closest to -2/7 in -13.25, 5, n? n Let v = -6422 + 6833. What is the nearest to 1 in -2, v, 0.5? 0.5 Let q be ((-6264)/12)/29 - (-7 + 1). Let u = 0.3 - 0.2. Which is the nearest to -2/5? (a) 1/2 (b) u (c) q b Let p = 4 - 1. Let z = -10.7 + 1.1. Let v = -9.6 - z. What is the nearest to v in 0.5, 4, p? 0.5 Let w be ((-3)/9 + 1)/((-10)/3 + 0). What is the nearest to -3 in 0.1, 5, 3, w? w Let a = 58.39 + -42.89. What is the closest to 1/4 in a, -1/10, 1/2? 1/2 Let x be (-231)/2541 + (-2)/((-308)/(-382)). Which is the nearest to -5? (a) 3 (b) x (c) -2/3 b Let h = 6 + -6.3. Let k = -181.3 + 63.4. Let l = -118 - k. Which is the closest to l? (a) 0.3 (b) h (c) 1 b Let h = -148/5 + 30. Let w = 6924.7 - 6541. Let t = w + -384. Which is the nearest to 0.1? (a) t (b) 2/9 (c) h b Suppose 0 = -30y + 20y - 40. Let v = -2.34 + 1.34. Which is the closest to v? (a) 0.1 (b) y (c) -2 c Let m = -1111.1 - -1110.26. Which is the nearest to m? (a) 0 (b) 3/2 (c) -0.5 c Suppose 27l + 109l = -680. What is the nearest to 2/3 in 1/2, 3, 0.012, l? 1/2 Let z = -162 + 109. Let c = z + 67. Let g be (-87)/1015 - (0 + (-4)/c). What is the closest to -3 in -6, g, 1/8? -6 Let x(g) = 2g2 - 46g + 256. Let s be x(13). Let k = 0.38 - -0.62. Which is the closest to -1? (a) s (b) k (c) -2/9 c Let v = 5900 + -23601/4. Which is the nearest to 54/11? (a) 0.1 (b) 3/7 (c) v (d) -1 b Let u = 13099 + -13248. Which is the nearest to 0.2? (a) -1/10 (b) -5 (c) u (d) 2 a Let f = -1865/13 - 2621/39. Let g = f - -209. What is the closest to g in 0, 4, 3, -0.3? -0.3 Let x = 6567 - 6562. Which is the closest to -2? (a) 3/5 (b) x (c) 4 a Let q = 0.5257 - 0.2257. Which is the closest to 1? (a) -5 (b) 1/4 (c) -42 (d) q d Let p = -47.306 - -24.332. Let h = p + -0.026. Let y = 18 + h. What is the nearest to -0.1 in y, 5, -1/5? -1/5 Let x = 347/1602 + 1/178. Let q = 2.4 - 0.4. Let d = -17/541 - 456/2705. What is the nearest to x in d, -3, q? d Let d(f) = -2f2 - 8f - 10. Let n be d(-4). Let r be ((0 + 1)*(-25)/n)/5. Let p = -80 - -80.3. Which is the nearest to -0.1? (a) 0.04 (b) p (c) r a Let d = 322 + -304. Let u be 0 + (-6)/d + (-3)/9. What is the closest to 1 in 3, u, -0.061? -0.061 Let i = 2.03 + -18.63. Let g = 16.1 + i. Which is the closest to -1? (a) -6 (b) 0.3 (c) g c Let s = -211.6 + 211.2. Let n = 0.3 - 0.3. Let o = n - -0.1. Which is the closest to o? (a) 5 (b) -1 (c) s c Let m = -2.268 - -4.268. Which is the closest to 4? (a) -5 (b) -11 (c) m c Let l = 8038 + -8040. Which is the nearest to 0.1? (a) 0.07 (b) l (c) 3 a Let j = 190.52 + -187. Let v = j	{ "pile_set_name": "DM Mathematics" }
(b) 192 (c) -5 b What is the third smallest value in 0.2, -2/7, -1.35113? 0.2 What is the third biggest value in 543, 189, 0.3? 0.3 What is the fifth smallest value in -71, -2, 0.4, 3/2, -3/4, -4? 0.4 Which is the biggest value? (a) -2 (b) 0.7 (c) 4 (d) 0.5 (e) -3364 c What is the fifth smallest value in -1, 1, 3/5, -13/79, 2? 2 Which is the smallest value? (a) -5 (b) 16.13 (c) -3 a Which is the biggest value? (a) -20.6 (b) -0.19 (c) 1/27 c Which is the biggest value? (a) -2 (b) 3.38 (c) 1 b What is the smallest value in 113, -2, -17? -17 What is the third smallest value in -42/17, 1.95, -7? 1.95 What is the biggest value in 6, -2/11, -5, 317, 0? 317 What is the second biggest value in -1, 4, -4, -2/41, 1.87, 2? 2 Which is the second biggest value? (a) 3 (b) 471/5 (c) 0.1 (d) -1/3 (e) -0.28 a What is the second smallest value in -1/83, -0.1, 0.02, 2, -7? -0.1 What is the third biggest value in 1/6, 1.129, 5, 19/2? 1.129 What is the second biggest value in 35, -13.92, -41? -13.92 Which is the second biggest value? (a) -2 (b) 1 (c) -5 (d) 38065 (e) 3 e Which is the third biggest value? (a) -1/5 (b) 0.1635 (c) 1 (d) -2 (e) -5 a Which is the fifth smallest value? (a) -1/8 (b) -2 (c) 95 (d) -4 (e) -48 c What is the sixth smallest value in -4, 0.2, 23, -1/2, 0.3, -21/4? 23 What is the second biggest value in 2/3, 1/28, -43.55? 1/28 Which is the second smallest value? (a) -1/351 (b) -0.5 (c) 0.3 (d) 1/7 a What is the fourth biggest value in -3/8, 1, 291, -0.5, 2/3? -3/8 Which is the fifth smallest value? (a) -113 (b) 0 (c) -164 (d) 0.1 (e) 5/4 e Which is the third biggest value? (a) -0.2163 (b) 2 (c) 5 (d) 12 b What is the biggest value in -15, -0.03, 0.061, -3? 0.061 What is the third smallest value in 1/3, -27048, 4, -1/3? 1/3 What is the fourth smallest value in 1/60, -0.1, -1/5, 536? 536 Which is the second biggest value? (a) 6 (b) -23 (c) -5 (d) 9 (e) -1/2 a Which is the smallest value? (a) 1/144 (b) 1/67 (c) -5 (d) 3 c Which is the biggest value? (a) -2.1377 (b) -4/7 (c) -0.2 (d) -5 (e) 0.04 (f) 0.4 f Which is the fourth biggest value? (a) -1/3 (b) -26 (c) 0.03 (d) 9 (e) 8 (f) -1/2 a What is the fourth smallest value in -15/2, 0.07, 0.4, -0.66? 0.4 Which is the biggest value? (a) 2 (b) -28903 (c) -5 a Which is the second smallest value? (a) 3 (b) 4 (c) 13 (d) -0.02 (e) -41 d Which is the fourth smallest value? (a) -7/5 (b) -25 (c) -0.198 (d) 4 d What is the fourth smallest value in -97, -5, -0.06, 5/3, -21? -0.06 Which is the fourth smallest value? (a) -0.2 (b) -13 (c) 5 (d) -1 (e) 6.54 c Which is the fourth smallest value? (a) 3 (b) 5 (c) 21 (d) -2/5 (e) 6 (f) 0.1 b What is the second smallest value in -1/22, 5/133, -1/2? -1/22 What is the second smallest value in 0.2, 0.4, -0.16655? 0.2 What is the third biggest value in -0.5, 5, -2/57, 5/4? -2/57 What is the third smallest value in -20, -8/717, -0.1? -8/717 Which is the biggest value? (a) -603226 (b) 2/5 (c) -2 b What is the fourth biggest value in 6, -198, 5, 0.1, 2? 0.1 Which is the biggest value? (a) 2/13 (b) -1/2 (c) -3 (d) 1/2 (e) -0.1 (f) -251 d Which is the second smallest value? (a) -0.15 (b) 1 (c) 0.04873 c Which is the biggest value? (a) 178 (b) -11 (c) -2/3 (d) 4 a Which is the third biggest value? (a) -5 (b) -0.5 (c) 1/25957 a Which is the biggest value? (a) -1 (b) -0.048 (c) 30 (d) 5/4 c Which is the smallest value? (a) -131 (b) -31 (c) 5 (d) 1 a Which is the third smallest value? (a) 0 (b) 27.89 (c) 4/11 b What is the fifth biggest value in 3, 21, 7, 0, -0.1? -0.1 What is the third smallest value in -4, 6, -107/3, 1/4? 1/4 Which is the biggest value? (a) -0.2 (b) 0.2 (c) 17 (d) 4.9 (e) -19 c What is the fourth biggest value in 8, 0.5, 0.032, -1, 0.1? 0.032 What is the third smallest value in -4114, 0, 4? 4 Which is the second smallest value? (a) -0.4 (b) 146 (c) 4/5 c What is the third biggest value in -1, -99/8, 0.0673? -99/8 What is the fourth smallest value in 13, 3, -4/9, 1, 0.1? 3 What is the smallest value in 3, -136/5, -3, -1/5? -136/5 Which is the smallest value? (a) 0.1 (b) -32 (c) -1/620 b Which is the third smallest value? (a) -0.03 (b) -0.07 (c) 0 (d) 1/4 c What is the second smallest value in 3, -2.09, -5, -2, -1/5? -2.09 What is the second biggest value in -2/24731, 0, -168? -2/24731 What is the biggest value in -4, -1/11, 7, -789, 0.2, -0.3? 7 Which is the second biggest value? (a) 2/25 (b) -18 (c) -2/63 c Which is the smallest value? (a) -10 (b) 2/27 (c) 0.063 a What is the smallest value in -5, 101, 6/17? -5 Which is the biggest value? (a) -6 (b) 2/7 (c) -0.07 (d) -0.2 (e) -30 b What is the third biggest value in 0.4, -2, 131.141? -2 What is the third smallest value in -0.2, -1/4, -7, -0.0307, -3, 0? -1/4 What is the third biggest value in 753, -3/52, 0.1? -3/52 Which is the second smallest value? (a) 4 (b) -5 (c) -13901 (d) -51 d What is the second smallest value in -8/11, -4/9, -0.1, -29, 1? -8/11 Which is the sixth smallest value? (a) -3 (b) 0 (c) 20 (d) -1 (e) 1 (f) -5 c Which is the third smallest value? (a) -1/263 (b) 1244 (c) -2/5 b What is the sixth biggest value in 2/7, -4, -1/4, -102, 5, 0.2? -102 What is the fourth smallest value in -4/9, -99, 0, 9? 9 Which is the biggest value? (a) -1 (b) 11198/5 (c) 5 (d) -0.2 b What is the second smallest value in -0.57, -1, 2/1095? -0.57 Which is the smallest value? (a) -0.2 (b) -1 (c) 0 (d) 3 (e) -175 (f) -107 e What is the third smallest value in 0.2, -187.8, 3? 3 Which is the fifth smallest value? (a) 3 (b) -2/3 (c) -2 (d) 238 (e) -0.19 d What is the second smallest value in -2171, -11, -1/4? -11 Which is the second biggest value? (a) -4.5 (b) 0.4 (c) -0.3 (d) 5 b Which is the third smallest value? (a) 1/2 (b) 2 (c) -2/11 (d) 4 (e) 0.445 (f) 5 a What is the third biggest value in -20, 5/4, 10? -20 Which is the second biggest value? (a) -2.2 (b) -2/11 (c) 0.3 (d) -0.2 (e) 50 c What is the fifth biggest value in 12, 2/13, 5, 2, -0.5, -0.46? -0.46 Which is the third biggest value? (a) 0.1 (b) 5 (c) 11501 (d) -0.013 a Which is the third biggest value? (a) -25 (b) -17 (c) 1/38 a What is the second biggest value in 2, 5.757, 3? 3 What is the fifth smallest value in 0.35, 7, -4, 0, -0.3, 9? 7 Which is the sixth biggest value? (a) 5 (b) 0 (c) -1/7 (d) -1 (e) 1/4 (f) 1291 d What is the second biggest value in 4, 0, -48.05? 0 Which is the third biggest value? (a) 7039 (b) -3 (c) 309 b Which is the fourth smallest value? (a) -31 (b) -1/302 (c) -1/5 (d) 5 d Which is the second smallest value? (a) -6/7 (b) 0.12 (c) 0 (d) 8/9 (e) 0.1 (f) -0.4 f What is the second smallest value in 221, 0.5, -4, 4, -21? -4 Which is the fourth biggest value? (a) -229 (b) -666 (c) -2 (d) 4 b What is the biggest value in -8743, -0.2, -2/7? -0.2 Which is the fourth biggest value? (a) -0.13 (b) 0.3 (c) -27 (d) 0 c Which is the second smallest value? (a) -19306/9 (b) 4 (c) 0.3 c Which is the fourth biggest value? (a) -0.1 (b) 476 (c) 7 (d) 2/21 (e) 1 (f) -3 d What is the biggest value in -3, 1, 0.5, -26, -15, -7/16? 1 Which is the smallest value? (a) -8/11 (b) -34/19 (c) 2/3 b Which is the second biggest value? (a) 52/3 (b) 3/34 (c) 2 c Which is the third smallest value? (a) -866 (b) 3 (c) -4/9 (d) 1 d Which is the fourth smallest value? (a) -3/7 (b) 2/7 (c) -0.1 (d) -786.77 b What is the second biggest value in -11, -2/9, -1229, -2/15? -2/9 Which is the third biggest value? (a) 6 (b) -2/11 (c) 5 (d) -1/4 (e) -5 (f) -0.4 b Which is the fourth smallest value? (a) -4 (b) -44 (c) -27 (d) 3 (e) -6 (f) 4 a Which is the biggest value? (a) -12 (b) -43 (c) -2/11 (d) 24 d Which is the fourth biggest value? (a) -2.5 (b) 50 (c) 1 (d) -52 (e) 3 a Which is the third biggest value? (a) 1/27 (b) 1/10 (c) 1/3 (d) 20 (e) -3/22 b What is the third biggest value in 29, 0.11, -4, -1/5? -1/5 Which is the third smallest value? (a) 1/3 (b) -0.01 (c) -30/13 (d) -0.3 (e) -2 d What is the biggest value in 372/7, 0.48, 0, 2? 372/7 Which is the biggest value? (a) -218 (b) -5 (c) -189 (d) -4	{ "pile_set_name": "DM Mathematics" }
930 plus -626.9? 9531303.1 17+-156.96228525 -139.96228525 Calculate 0.04 - 615221928.2388. -615221928.1988 Subtract 2.1166325673 from 0.4. -1.7166325673 Total of 0.5 and 70069195733446. 70069195733446.5 347739261+-127 347739134 Work out 163729.021 + 1220473. 1384202.021 What is -678608072 take away -44368? -678563704 Add -2216.0296854 and -5167. -7383.0296854 Put together 0.0328 and 0.349783116. 0.382583116 What is the difference between 698708272 and -0.1279? 698708272.1279 Calculate 0.5 + 276576224915975. 276576224915975.5 What is -0.141 minus -320620.92242? 320620.78142 Total of -9862595002.3 and -0.6. -9862595002.9 Calculate 14 - -220683242587.2. 220683242601.2 Total of 76829682.1 and -6.8. 76829675.3 Calculate -268098 - 60430105. -60698203 Total of -212535 and -63475. -276010 Work out 0 + -25147595489870. -25147595489870 Calculate -17.71242 + 49.06973. 31.35731 20.8 + 8753.19234 8773.99234 Work out 0.031839 - 0.1653058827. -0.1334668827 Put together 2222591.177 and -23269. 2199322.177 Calculate -1443285 - 2861.79. -1446146.79 What is -0.144 minus -35844463210? 35844463209.856 Put together -6 and 556812930990. 556812930984 What is 910 plus -49577136.9? -49576226.9 Sum 9547562 and -3.454695. 9547558.545305 Subtract -0.1 from 98960635262846. 98960635262846.1 Calculate -4622 + -612851484. -612856106 What is the difference between -26 and -185457.244439? 185431.244439 Total of -0.1 and 12468477277447. 12468477277446.9 What is -0.1 take away -769801518562? 769801518561.9 Subtract 1224649746579 from 0.64. -1224649746578.36 Work out -119480 + -1544711455. -1544830935 What is -1648046 take away -1144.52? -1646901.48 What is 278 take away 173606529297? -173606529019 What is 1.4905 take away 316558732? -316558730.5095 What is the distance between -0.05 and 24400864330628? 24400864330628.05 Sum 2 and 192372978825. 192372978827 What is 0.5 take away 14.1738471931? -13.6738471931 Calculate 0.0278 + 26201502328. 26201502328.0278 What is 12858.940182 less than -0.24? -12859.180182 Calculate -3 + 184746795052. 184746795049 Total of -69.2469 and 185600.33. 185531.0831 What is -7349 plus -435096459? -435103808 Work out -0.2 - 1481814887607. -1481814887607.2 Calculate 3.74494 + 343352. 343355.74494 What is -197131662904 minus 0.015? -197131662904.015 Work out -1530066 - 86.11801. -1530152.11801 Put together 0.09736 and 1294.256059. 1294.353419 Calculate -2.8 - 8353932251305. -8353932251307.8 Add together -728331 and 105634. -622697 Add together -13744.889 and -81113. -94857.889 Work out -97432823940 - 156. -97432824096 Put together 0.0926148 and -808393. -808392.9073852 Add together -6.77 and -8892.2914. -8899.0614 What is 1474.5 minus -14989871? 14991345.5 Sum 52.4 and -7526634715. -7526634662.6 What is the distance between -8075 and -982.8119? 7092.1881 What is -16 minus -28371997581762? 28371997581746 Subtract 0.06394 from -0.01615478657. -0.08009478657 Work out 897639722572 - 2. 897639722570 Work out -335 - 69983804. -69984139 Put together 4 and -320365926944. -320365926940 Work out -104.86385 + 14.138. -90.72585 What is -198.49 + -34520470487? -34520470685.49 What is -189213229 take away -72890? -189140339 What is -489.9744 less than 11092? 11581.9744 What is 48319491 + 8124.668? 48327615.668 Calculate 181082263338 - 0. 181082263338 Calculate 1624337.7 + -67487. 1556850.7 4 - -0.0836439733461 4.0836439733461 Total of 36.0357 and 205.278. 241.3137 Total of 17107038035 and -3. 17107038032 Total of -44 and 9504037430227. 9504037430183 Work out 0.3705 - -712799134. 712799134.3705 Work out 56.3 + 41928947.8. 41929004.1 Total of 7421595216184 and 0.007. 7421595216184.007 4694.216241047 + -0.5 4693.716241047 What is 5834 + -0.156857479? 5833.843142521 Sum -0.48364 and -58456.003. -58456.48664 What is 136197579616 plus 19.9? 136197579635.9 Add 52.239 and -31.166353. 21.072647 Calculate 0.30941829 + 1.252. 1.56141829 Calculate -36.941619992914 - -0.06. -36.881619992914 What is the distance between -0.38005562 and 40746? 40746.38005562 What is -227.24 - -35710267? 35710039.76 What is 4423711 take away -177.45812? 4423888.45812 Subtract 0.2 from -5776589897998. -5776589897998.2 Calculate 91888177.43 - -0.1. 91888177.53 Subtract -662 from -246219586. -246218924 What is the difference between 29465.7 and 14.845602? 29450.854398 Subtract 104391934399 from 2.2. -104391934396.8 Add 312 and -701350611. -701350299 Work out -12400613891590 + 0.2. -12400613891589.8 What is -33.91 minus 322092.71? -322126.62 What is 10 - 22445391475326? -22445391475316 What is 284566 - -0.3238994? 284566.3238994 Work out 698.84 + 69.15166. 767.99166 What is -13 less than -21618884525.9? -21618884512.9 What is -81891613280259 plus 2? -81891613280257 Add together -0.5 and 4991.19475821. 4990.69475821 What is -3786.5 - 126567314? -126571100.5 Calculate -155815619388 + -13. -155815619401 Sum 0.05 and 789722735165. 789722735165.05 What is -178276.11 + -1162416? -1340692.11 What is -838594380143 take away -327? -838594379816 Calculate 2843351298 + -9.99. 2843351288.01 What is -0.014 + -2369777102367? -2369777102367.014 What is 0.12651138 plus -99427.8? -99427.67348862 Total of 26900821 and -4917. 26895904 What is -2053791.0299 + 69? -2053722.0299 What is 73642384 less than -145358? -73787742 5261.85224 - 10.4 5251.45224 Calculate 117901649 - 0.492. 117901648.508 -0.0517818202 - -0.32 0.2682181798 3.588 + 0.077404330121 3.665404330121 Put together 122.7 and -6.0340819. 116.6659181 Subtract 1696272 from -198.474. -1696470.474 Calculate 0.386292 + 40836043. 40836043.386292 What is -3 + 1.094306607028? -1.905693392972 -0.0174650033+0.07 0.0525349967 What is the difference between 3.18 and 16078144717? 16078144713.82 -26.78+1772626 1772599.22 What is 35466 - 0.2092436? 35465.7907564 -3.4 + 12.49034356 9.09034356 Sum 9.4 and -2902.039. -2892.639 Subtract 0.3 from 91300810571890. 91300810571889.7 What is 86.716852 less than 3732263? 3732176.283148 Put together 0.081460383 and -0.39561. -0.314149617 190+-1587586332413 -1587586332223 Calculate -0.052 + -492295339689. -492295339689.052 Add together -3 and 51109131375.015. 51109131372.015 What is the difference between -1 and 2.4985088615? 3.4985088615 Work out 1189510111284 - 0.02. 1189510111283.98 Work out -3576663910 + -171. -3576664081 Total of -1 and -2243359.907279. -2243360.907279 What is -7 take away 8847282582? -8847282589 What is the distance between -263099 and -9630400? 9367301 What is -1927 less than -13792713476? -13792711549 Total of 0.7 and 9794.3901492. 9795.0901492 -64048.2 - -200594795 200530746.8 Add -13659800593659 and -5. -13659800593664 What is -1221.3039436 minus 4482? -5703.3039436 What is 0.170339 plus -1432422839? -1432422838.829661 What is 172797659477 take away -0.13? 172797659477.13 What is -89278 plus 9.343192? -89268.656808 14 - 15730031738 -15730031724 Put together -127484 and -117721. -245205 Total of -36 and 3455200880. 3455200844 Add -83900040.2724 and -16.1. -83900056.3724 -4702758619168 - -0.9 -4702758619167.1 Calculate -8691262437329 + 22. -8691262437307 Total of -4.22 and 480045512286. 480045512281.78 What is -4535052 take away -15.8341? -4535036.1659 Work out -5173663.46414 - -0.5. -5173662.96414 Calculate -0.0765 - 96959281.24. -96959281.3165 What is the distance between -81139 and -155210.563? 74071.563 What is the distance between 7 and -3571678140869? 3571678140876 Total of -27.8 and -255027.622. -255055.422 Sum 1516584.174 and 34692. 1551276.174 Work out 2018 + 38905636.3. 38907654.3 Put together -18501291638 and 13079. -18501278559 16107011 - -0.82336 16107011.82336 What is -36504.702906 - -0.3536? -36504.349306 569436256364+-0.3 569436256363.7 What is 3020334.4 - -126490.4? 3146824.8 What is 1190.685 + -867569.7? -866379.015 Calculate -37513984 + -0.14695. -37513984.14695 -10366.44 + -95.0765 -10461.5165 0.014 - 3456346163354 -3456346163353.986 80.012+-4256274.8 -4256194.788 What is the distance between 0.19 and 1738141240.9? 1738141240.71 -4278274+-3493525 -7771799 Sum 7452766.3 and 71.4. 7452837.7 Add 1.006896 and 169241. 169242.006896 What is -8.48 + 3286480.3782? 3286471.8982 What is -9546 less than -0.23542096? 9545.76457904 What is the distance between -528949863 and 60? 528949923 1511709+189333985	{ "pile_set_name": "DM Mathematics" }
r when 26 is divided by z(-1). 2 Calculate the remainder when 296/20 - (-1)/5 is divided by 9. 6 Let h = 80 - 29. Suppose 5k = 18 + 27. What is the remainder when h is divided by k? 6 Let y = 53 + -31. Calculate the remainder when y is divided by 12. 10 Let b(y) = y2 + y - 1. Let k(f) = 2f*2 - 19. Let n(d) = b(d) - k(d). Let a be n(0). Calculate the remainder when 29 is divided by a(-6)/(-9) - 2. 9 Let y(i) = i + 77. Calculate the remainder when y(-23) is divided by 7. 5 Let q(j) = -j*2 + 12j - 14. What is the remainder when (8/(-20))/(2/(-50)) is divided by q(10)? 4 Suppose -2b + 26 + 2 = 0. Calculate the remainder when b is divided by 6. 2 Suppose -2i = 2 - 18. Let a = 28 - 20. What is the remainder when i + -8 - 3-7 is divided by a? 5 Let p(g) = -2g3 + g2 + g + 30. Suppose -5j = -t + 2t + 4, 5j + 15 = 0. What is the remainder when p(0) is divided by t? 8 Let g(j) = -66j*3 + 3j*2 + 4j + 2. Calculate the remainder when g(-1) is divided by 23. 21 Let q = -1 + 2. Let g be 14 - (3 + q/(-1)). Suppose 2x = -0m - 5m + 39, 0 = -2m - 2x + g. Calculate the remainder when m is divided by 5. 4 Let m(v) = 3v3 + v2 - 4v - 4. Let b(i) = -i - 1. Let r(n) = 4b(n) - m(n). Let c be r(-1). Calculate the remainder when 18 is divided by 12 - -4(-1)/c. 8 Calculate the remainder when 47 is divided by (-38)/57 - (-64)/6. 7 Let w = -101 + 154. Calculate the remainder when w is divided by 18. 17 Let h(i) = 2i*2 + 2i + 2. Let b be h(-1). Suppose bc + 130 = 7c. What is the remainder when c is divided by 9? 8 Suppose -4c - 3g = -329, 9c - 4c - 440 = 2g. Calculate the remainder when c is divided by (4 - 37)/(2/((-16)/12)). 20 Let q(u) = u2 - 2u - 3. Let r be q(-2). Suppose -g + 3t + 6 = 2g, rt = -5g + 50. Let s = -1 - -11. What is the remainder when s is divided by g? 4 Let o(a) = 4a2 - a + 1. Let y be o(2). Suppose w + i = 6, 4i = -w + y - 3. What is the remainder when 6 is divided by w? 2 Let l(o) = o*3 - o. Let u be l(0). Suppose 5w + z - 105 = 0, -5w = -z - uz - 105. Calculate the remainder when 41 is divided by w. 20 Let f = -2 - -5. Suppose 0 = 3h - 7h + 20. What is the remainder when h is divided by f? 2 Let k(o) = o - 5. Let a be k(11). Calculate the remainder when ((-2)/a)/(3/(-207)) is divided by 13 - (2 + -3 + 2). 11 Let j = 23 + -32. Let h = 0 + j. Let r(w) = -w - 5. What is the remainder when 10 is divided by r(h)? 2 Suppose 5y = y - 36. Let a = 23 + y. Calculate the remainder when 53 is divided by a. 11 Let v = 20 + -13. Suppose 2y + 75 = vy. Calculate the remainder when 57 is divided by y. 12 Suppose 10 = 2x - 8. What is the remainder when 42 is divided by x? 6 Suppose -v + 505 = 2v + 2j, 3j = 5v - 810. Calculate the remainder when v is divided by 28. 25 Calculate the remainder when 93 is divided by -6(224/(-6))/7. 29 Suppose -q - x - 4 = -8, -4q = 5x - 16. Suppose qn + 197 = 5m, -m = -4n - n - 52. Calculate the remainder when m is divided by 19. 18 Let h be 42/10 + (-2)/10. Let g = h + -2. Suppose -3p = -4v - 88, -g = 3v - 8. Calculate the remainder when p is divided by 11. 10 Let i be 5 + 1(2 - 3). Suppose 0 = 4f - w - 31, if + 5w - 18 = -5. Suppose -x + 6 + f = 0. Calculate the remainder when 25 is divided by x. 12 Suppose -b - 3b = -432. Suppose -b + 18 = -5f. Calculate the remainder when f is divided by 10. 8 Let d = -9 + 15. Let w be (-9)/(-15)(4 + 1). What is the remainder when w(7 + 2 - 2) is divided by d? 3 Suppose 3x = -2x + 15. Suppose -11 = -7f + 17. Calculate the remainder when f is divided by x. 1 Let a = -126 - -143. Suppose -2y - y - g = -2, -y + 2g + 10 = 0. What is the remainder when y7/(-4)-14 is divided by a? 15 Calculate the remainder when -1(-2)/(-3)10506/(-68) is divided by 26. 25 Let n(s) = 0 + 1 - s + 2. Let o be n(-5). Suppose -2p - o = -4p. What is the remainder when p is divided by 2? 0 Suppose -5p + 0p = -255. Suppose 0 = -4y + p + 5. What is the remainder when 39 is divided by y? 11 Let u(k) = k3 + 13k*2 + 2k + 5. Let a(n) = n*2 + 1. Let t(g) = -6a(g) + u(g). Let v = -3 + 13. Calculate the remainder when t(-3) is divided by v. 9 Calculate the remainder when ((-4)/4)/(1/(-60)) is divided by 26. 8 Suppose 3a - 51 = -a - q, q + 61 = 4a. What is the remainder when 54 is divided by a? 12 Let r(j) = j*2 + 6j + 3. Let u be r(-6). Let x(b) = 2b2 - 3. Calculate the remainder when x(u) is divided by 4. 3 Let q(m) = m + 10. Let j be q(0). Calculate the remainder when (-8)/j + (-2290)/(-50) is divided by 12. 9 Let q = 326 + -199. Calculate the remainder when q is divided by 32. 31 Suppose 2t + 4y = 30, 3 = 5t - 3t - 5y. What is the remainder when (5/2)/(2/12) is divided by t? 6 Let o be (-4 + 4)/(-1 + 3). Suppose -b = -3c - 4 + 13, 0 = -b - 5c + 31. What is the remainder when o/(-3) + -3 - -14 is divided by b? 5 Suppose 87 - 9 = 3c. What is the remainder when 50 is divided by c? 24 Let z(y) = -6y + 1. Calculate the remainder when 73 is divided by z(-3). 16 Let j(o) = -o2 - o - 5. Let u(p) = p2 + p + 1. Let k(v) = j(v) + 5u(v). Calculate the remainder when k(-4) is divided by 17. 14 Let j be (1 + 0)(-1 - 2). Let p(o) = -2o3 - 4o*2 - 3o - 4. Calculate the remainder when p(j) is divided by 8. 7 Suppose o = u - 3u + 15, -4u = -4. What is the remainder when 49 is divided by o? 10 Let h(g) = g*3 - 4g*2 + 6g. Let d be h(4). Suppose w = j + j + 12, w + 2j = d. Let x = -5 + 39. What is the remainder when x is divided by w? 16 Suppose 0 = -2b - 0b, -24 = -4x - 3b. Calculate the remainder when 17 is divided by x. 5 Suppose -l = 4j - 6l - 118, -3l = -j + 26. Calculate the remainder when 125 is divided by j. 29 Let y(n) = n*3 - 21n*2 + 21n - 12. What is the remainder when y(20) is divided by (-8)/(-3) + (-2)/(-6)? 2 What is the remainder when 56 is divided by (15/(-21) - -1) + 164/14? 8 Let c(q) = 31q3 - q2 + 1. Let k(m) = m + 7. Let x be k(-6). Calculate the remainder when c(x) is divided by 11. 9 Let z = 6 - -27. Suppose 27r + 48 = 31r. What is the remainder when z is divided by r? 9 What is the remainder when -1222/(-4) - 1 is divided by 21? 18 Suppose -3z = 4o - 53, -56 = -4z - 2o - 2. Let q be ((-1)/(-1))/24. Suppose -qw + 8 = -0w. What is the remainder when z is divided by w? 3 Let c = 3 + -2. Let p be -11 + (0 - -2)1. Let z = p + 12. Calculate the remainder when z is divided by c. 0 Calculate the remainder when (30 + 0)(3 + (-63)/35) is divided by 20. 16 Let w be 16/20(-1 - 4). Calculate the remainder when 43 is divided by (-86)/w + 3/6. 21 Let t(q) = q - 2. Let c be t(2). Calculate the remainder when c + 4/(4/23) is divided by 6. 5 Let z = 0 - -1. What is the remainder when 34 is divided by 1/2z12? 4 Suppose -4z - 3w + 19 = 0, -4w + 21 = 5z - 3w. What is the remainder when z is divided by 2? 0 Let z(o) = 28o*2 + 2o + 1. What is the remainder when z(-1) is divided by 7? 6 Let m = -6 - -22. Let j(i) = 19i2 + 4i - 9. Let o(p) = -9p2 - 2p + 4. Let z(u) = -2j(u) - 5o(u). What is the remainder when z(2) is divided by m? 14 Let v(a) = 3a2 + 2. Calculate the remainder when 27 is divided by v(2). 13 Suppose -y + 3t = -2y + 25, 4y = 3t + 70. Let m = 56 - y. What is the remainder when m is divided by 19? 18 What is the remainder when 6/(-4)(-22)/3 is divided by 7? 4 Let t(y) = -y*2 + y + 18. What is the remainder when t(0) is divided by 7? 4 What is the remainder when 116 + 1 - 4 is divided by 22? 19 Suppose 5i + 16 = -q, -4i + 20 = 2q - 7i. Suppose -30 = -5a + 2h, qa = -3h + 77 - 30. What is the remainder when 30 is divided by a? 6 Let g be (76/(-6))/(2/6). Let j = 27 + g. What is the remainder when 20 is divided by j((-3)/(-3) - 2)? 9 Let n(i) = 49i*2 - 2i + 1. Calculate the remainder when n(1) is divided by (2 + -1)/((15/(-3))/(-50)). 8 Let n be 21/(-2) - -3. Suppose -5p = 5x - 105, 4p = nx + 3p - 42. What is the remainder when x is divided by 6? 3 Suppose 0 = -3a + g + 2g - 3, a + 5g = 11. Suppose -a = v + m, 0 = 3v + m - 5m - 25. What is the remainder when v is divided by 3? 0 Calculate the remainder when (2 + 0)57/1 is divided by 29. 27 Suppose z - 27 = -5b, -z - 5b = 2z - 31. Suppose -zv + 5v + 4w = 16, -4*v - w +	{ "pile_set_name": "DM Mathematics" }
5 -31138 divided by -1 31138 Calculate 746624 divided by -2432. -307 Calculate 2190390 divided by -3. -730130 What is -395 divided by -639? 395/639 What is 12 divided by -504? -1/42 Divide 377 by -51. -377/51 What is -279 divided by 4087? -279/4087 Calculate -13342 divided by -3. 13342/3 -119712 divided by 172 -696 What is 1486529 divided by -737? -2017 -1036216 divided by -129527 8 What is 842 divided by -27? -842/27 Calculate 275572 divided by 68893. 4 Calculate 14 divided by -794. -7/397 Calculate -189 divided by -129. 63/43 Divide -153840 by -10. 15384 Calculate -2702 divided by -12. 1351/6 Divide -10057 by -113. 89 348000 divided by -150 -2320 -2 divided by 387 -2/387 78635 divided by 2 78635/2 -15973480 divided by 4 -3993370 Divide 165 by -33. -5 5722622 divided by -106 -53987 Divide -711015 by 1. -711015 Calculate 5032610 divided by 10. 503261 79239 divided by 1299 61 What is -8571 divided by -27? 2857/9 Calculate 59422 divided by -3. -59422/3 -111005 divided by 111005 -1 Calculate 170 divided by -111. -170/111 Calculate 3 divided by 56380. 3/56380 Calculate -3 divided by 188202. -1/62734 Calculate 146968 divided by 146968. 1 Divide 0 by 707721. 0 Calculate -93168 divided by -48. 1941 What is -3879 divided by -4? 3879/4 142090 divided by 2186 65 Calculate -64735 divided by -11. 5885 Divide 106489 by 18. 106489/18 Divide -4159 by -9. 4159/9 -4 divided by -271827 4/271827 186 divided by 82 93/41 What is 484 divided by -432? -121/108 14553 divided by 21 693 What is 209880 divided by 120? 1749 What is -984528 divided by 4? -246132 657768 divided by 6 109628 Calculate 372669 divided by 11293. 33 Calculate 2 divided by -49037. -2/49037 Calculate -69101 divided by 6. -69101/6 Calculate 5955 divided by -28. -5955/28 Calculate -692406 divided by -18. 38467 0 divided by 66822 0 96075 divided by -15 -6405 What is 831288 divided by -4? -207822 Calculate -511173 divided by 13. -39321 -57485 divided by 5 -11497 What is -307883 divided by 499? -617 Divide 42 by 97. 42/97 Calculate -15515 divided by -5. 3103 Calculate -268660 divided by 20. -13433 -760115 divided by -5 152023 What is -112910 divided by 14? -8065 What is -258517 divided by 7? -36931 What is -8169 divided by 1? -8169 What is -40437 divided by -2? 40437/2 Calculate 49288 divided by 12322. 4 What is -26250 divided by 4375? -6 What is -2540 divided by 685? -508/137 -1095143 divided by -101 10843 Calculate -594 divided by 374. -27/17 -5 divided by -1960 1/392 26928 divided by -3 -8976 2427 divided by -9 -809/3 Divide 8851 by 167. 53 Divide -2341000 by -8. 292625 Divide 22424 by 198. 11212/99 -2811 divided by -1 2811 Divide -470840 by 316. -1490 Divide 6 by 4972. 3/2486 Calculate -2552 divided by 324. -638/81 What is -10752 divided by -5? 10752/5 1753404 divided by -4 -438351 -145 divided by 39 -145/39 Calculate -57016575 divided by -3. 19005525 Calculate 2 divided by -211276. -1/105638 What is 1092312 divided by -60684? -18 What is -23618 divided by -14? 1687 521250 divided by -5 -104250 Calculate 44813 divided by 44813. 1 What is 4 divided by 639388? 1/159847 What is 206270 divided by -5? -41254 Calculate 25 divided by -267115. -5/53423 Divide 3 by 290838. 1/96946 Calculate -5 divided by -148773. 5/148773 Divide 27634 by 16. 13817/8 Calculate -8921012 divided by -2. 4460506 8140002 divided by -6 -1356667 Divide 4400 by -44. -100 -5667 divided by 2 -5667/2 Divide -1 by 6401. -1/6401 What is 39986 divided by -5? -39986/5 Calculate -69 divided by 12672. -23/4224 Calculate 617772 divided by -3. -205924 Calculate 1784 divided by 389. 1784/389 Calculate -460 divided by -460. 1 Calculate -62 divided by 1774. -31/887 815080 divided by 29110 28 Calculate 2 divided by -6771. -2/6771 What is -48184 divided by -6? 24092/3 What is -5701 divided by 5? -5701/5 Calculate 139910 divided by 27982. 5 Divide 308774 by 2. 154387 79156 divided by -6 -39578/3 Calculate 2 divided by 73726. 1/36863 152807 divided by 41 3727 Divide 2 by 1165495. 2/1165495 3 divided by -1522 -3/1522 Divide 86 by -16983. -86/16983 -5 divided by -3042 5/3042 -222513 divided by 74171 -3 Divide 696882 by 6. 116147 Calculate -362499 divided by 6. -120833/2 -2766 divided by -3 922 Divide 14022 by 2. 7011 Divide -71693 by 3. -71693/3 What is -13329 divided by 19? -13329/19 Calculate 20860 divided by 70. 298 5993 divided by 3 5993/3 82 divided by -546 -41/273 What is -597351 divided by -7197? 83 -1067 divided by 82 -1067/82 3 divided by 220072 3/220072 Divide 164501 by 1. 164501 Divide 44 by -5952. -11/1488 Calculate 167264 divided by 41816. 4 Calculate 3027 divided by -93. -1009/31 31 divided by -12264 -31/12264 What is 99131 divided by 99131? 1 What is 1551956 divided by 221708? 7 Divide 474405 by 5. 94881 Calculate 251 divided by 855. 251/855 -11706 divided by 212 -5853/106 What is 11222 divided by -10? -5611/5 What is 17 divided by 95226? 17/95226 -13 divided by -4881 13/4881 Divide 42208 by -11. -42208/11 What is -588 divided by 21? -28 What is -39 divided by 2407? -39/2407 Calculate 57 divided by 306. 19/102 -242916 divided by 121458 -2 Divide 622900 by 2. 311450 Calculate -2 divided by 7823. -2/7823 162 divided by -5738 -81/2869 Calculate 12 divided by 72965. 12/72965 Calculate 408 divided by 2. 204 Calculate -877 divided by -129. 877/129 43704 divided by -2428 -18 -265899 divided by -5 265899/5 What is 128 divided by -103? -128/103 Divide 16266 by 6. 2711 Divide -31998 by -1. 31998 Divide -10439 by -8. 10439/8 What is 143 divided by 988? 11/76 Calculate -3 divided by 33195. -1/11065 Calculate 146990 divided by -73495. -2 What is 258 divided by 2157? 86/719 Calculate 776800 divided by 10. 77680 Divide -1744 by 94. -872/47 Divide 1 by 66825. 1/66825 -6969 divided by -23 303 Divide -118 by 16910. -59/8455 1991 divided by 3 1991/3 Calculate 1042932 divided by -2. -521466 What is 81600 divided by -60? -1360 Calculate -173 divided by -86. 173/86 Calculate 5322275 divided by -313075. -17 What is 59850 divided by 350? 171 What is -13540 divided by -6770? 2 Divide -1247 by -27. 1247/27 -2993824 divided by -1 2993824 Divide 1218060 by -27068. -45 -193 divided by -44 193/44 Divide -1 by -21233. 1/21233 Divide 408000 by 17. 24000 Calculate -572226 divided by 286113. -2 What is -6 divided by -5810? 3/2905 Calculate -10 divided by 24928. -5/12464 Divide 77824 by -16. -4864 25 divided by -21401 -25/21401 Divide -50555 by -1. 50555 What is -3 divided by 1373870? -3/1373870 Divide -23640 by 2955. -8 -1055919 divided by 53 -19923 Calculate 4313 divided by -1. -4313 -214 divided by 1944 -107/972 Divide 477823 by -4. -477823/4 Calculate -3 divided by 1867. -3/1867 Divide 54442 by -2. -27221 Divide 6992 by -38. -184 What is -134693 divided by 797? -169 What is 46 divided by 283? 46/283 Divide -19720 by 3944. -5 77712 divided by -77712 -1 Calculate -2063206 divided by -21949. 94 Calculate 1546 divided by 121. 1546/121 Calculate 71811 divided by -303. -237 Calculate -78408 divided by 22. -3564 Divide -4 by -67308. 1/16827 What is 167348 divided by 4922? 34 Divide 963833 by 491. 1963 Calculate -4 divided by 99681. -4/99681 Calculate -472072 divided by 59009. -8 Calculate -1814895 divided by -604965. 3 Calculate -17590 divided by 8795. -2 Divide 1641984 by 6. 273664 -137180 divided by 4 -34295 What is 2209 divided by -981? -2209/981 What is 28914 divided by -14457? -2 What is 1629 divided by 140? 1629/140 -25644 divided by -12822 2 Divide -6051 by 255. -2017/85 Divide -44423 by -1433. 31 -24624 divided by -24624 1 16 divided by 7341 16/7341 Divide -93153 by -3. 31051 Divide 1205 by -354. -1205/354 What is 178707 divided by -178707? -1 What is -4032156 divided by 3? -1344052 Divide -28 by 2769. -28/2769 What is -31 divided by 400? -31/400 Divide 69597 by -11. -6327 Divide 947562 by -98. -9669 Calculate 663586 divided by -4774. -139 What is 136 divided by 467? 136/467 -46629 divided by 297 -157 Divide -631134 by -3. 210378 -110960 divided by -4 27740 What is -206192 divided by -1? 206192 What is 2455 divided by -9? -2455/9 Divide -39758 by 2. -19879 -5 divided by -64204 5/64204 What is -1128 divided by -2764? 282/691 Calculate -3496290 divided by -1748145. 2 What is -43846 divided by 22? -1993 -8663 divided by -2 8663/2 -20 divided by -60807 20/60807 Calc	{ "pile_set_name": "DM Mathematics" }
/35)/(4 - (-95)/(-25)). Suppose -x = -5t - 3k, t - 31 = -k + 2005. What is the hundreds digit of t? 0 Suppose 0 = 20x + x - 198009. Suppose 14s + 833 = x. What is the tens digit of s? 1 What is the ten thousands digit of ((-25158)/(-15))/(634/23775)? 6 Suppose 0 = u + 1, 3q - 3230 - 9320 = -5u. What is the hundreds digit of q? 1 Suppose 426s - 401s - 118750 = 0. What is the tens digit of s? 5 Let q be (-224)/(-35) + (-2)/5. Suppose p + 5w = -p - 11, -3p = -3w + q. What is the tens digit of 3/(-2)116/p? 5 Let h be 4/((-2)/(-4)2). Let i(n) = 6n*3 - 5n - hn2 + 4n*3 - 12n*3 - 4. What is the tens digit of i(-5)? 7 Suppose 3t + 44t = -325t + 30204540. What is the tens digit of t? 9 Let t be 2742/(-54) - (-3)/((-81)/6). Let d = t - -85. What is the tens digit of d? 3 Suppose -5n - 15 = 0, -4 = -4r - 5n - 11. Let l be (-6)/(-4)(1 - -59 - r). Suppose 3t + 50 = m, 5t - l = -4m + 28. What is the tens digit of m? 3 Suppose 24m - 2289 = -7593. Let l = 276 - m. What is the hundreds digit of l? 4 What is the tens digit of 1 - -1 - 1 - (-25064 - -177)? 8 Let t(v) = v*2 - 2v - 21. Suppose 14b = 11b + 48. Suppose 39 = -5z - b. What is the units digit of t(z)? 2 Let m(w) = -w3 - 32w*2 - 58w + 64. Let p be m(-30). Suppose -3d + 4h + 766 = -0d, 2h + 1008 = pd. What is the hundreds digit of d? 2 Suppose 339s = 3t + 343s - 64038, 4s + 12 = 0. What is the units digit of t? 0 Let y be 1(-537)/6-4. Let f(d) = d3 + 20d*2 - 11d - 7. Let c be f(-21). Let q = c + y. What is the units digit of q? 1 What is the hundreds digit of (-303348)/(459/(-27)) + -17? 8 Let w be (-234)/1080/(-24). Let m = -110 + w. What is the units digit of 381/4 - (-8)/m? 5 Let n(q) = 9q + 273. Let d be n(25). Suppose -7w + 2w + 3m = -32, 4w + 2m = 8. Suppose 0 = 2y + wy - d. What is the units digit of y? 3 Let u(p) = -2p*3 + 39p*2 - 18. What is the thousands digit of u(-12)? 9 Suppose 85o - 684456 = -73o. What is the thousands digit of o? 4 Suppose -114j = 46912 - 472816. What is the hundreds digit of j? 7 Let t(g) = g*3 - 3g*2 + 5g - 2. Let q be (-3)/(4/(-6) - (-34)/24). Let c(o) = 3o + 15. Let s be c(q). What is the units digit of t(s)? 3 Suppose 0 = 18n + 22n - 1244720. What is the ten thousands digit of n? 3 Suppose 2h - 5u + u = -8, -4h = -2u - 14. Suppose -hq = -16q + 3680. What is the hundreds digit of q? 3 Suppose -6 = -i - 2. Let g = 391 - -196. Suppose 0 = -6s + 4s - m + 233, -5s - im = -g. What is the tens digit of s? 1 Let u be (-14)/(-8) + 65/52. Suppose 7t - 2t - um - 2646 = 0, 2t + 3m - 1071 = 0. What is the units digit of t? 1 Let v = 2 + 10. Suppose 4h = v, 4m + 0h - 26 = -2h. Suppose 6d = d + mi + 780, d = -i + 156. What is the tens digit of d? 5 Suppose d = -m + 8868, 4d - 14767 - 29573 = -5m. What is the hundreds digit of m? 8 Let d = -98 + 60. Let y = d + 44. What is the tens digit of 18 - (y/21 + 6/(-21))? 1 Let y(q) = -127q + 31. Let j be y(-2). Suppose -n + j = w - 59, w - 2n = 353. What is the hundreds digit of w? 3 Let j(c) = 4c + 23. Let q be j(-19). Let x = q - -56. Suppose -22 = -xk + 41. What is the units digit of k? 1 Suppose 15475 = 2u + 3d, -4d + 23214 = -0u + 3u. What is the hundreds digit of u? 7 Let i = 113 - 109. Let p be -2 + -59 - (i/(-1) - -1). Let f = p + 79. What is the tens digit of f? 2 Let n be (-3)/(-5) - ((-6768)/(-45))/4. Let m = 241 - 124. Let o = n + m. What is the units digit of o? 0 Let j(z) = 51z*2 + 6z - 3. Let b(i) = -i + 1. Let w(l) = 5b(l) + j(l). Let o be w(-1). Let p = 152 - o. What is the units digit of p? 0 Suppose 2m + 2c = 35430, 69976 = 5m - 4c - 18536. What is the ten thousands digit of m? 1 Let m = 42 - 15. Suppose 0 = -4h - 23 + m. What is the units digit of 82 + (h - 5) + 1? 3 Let n = -724 + 755. Suppose 15m = nm - 29728. What is the thousands digit of m? 1 Suppose 265p + 22671 = 5o + 264p, -4o - 5p + 18160 = 0. What is the tens digit of o? 3 Suppose 0 = -40q - 645 - 115. Let p(z) = -z3 - 17z*2 - 61z - 4. What is the units digit of p(q)? 7 Suppose 24 = 63h - 62h. Let g = h - -131. What is the units digit of g? 5 Suppose 0 = 186p + 1909847 - 8553023. What is the units digit of p? 6 Let h be -123(-181539)/81. What is the units digit of h/322 - (-6)/14? 1 Let n(k) = 5k*3 - 11k*2 + 5k - 7517. Let y(q) = q*3 - 2q*2 + q - 1503. Let b(s) = 2n(s) - 11y(s). What is the thousands digit of b(0)? 1 Suppose 3n + 1900 - 11293 = 0. What is the units digit of n? 1 Suppose -4u + 305m + 216596 = 301m, 108316 = 2u + m. What is the thousands digit of u? 4 Let p(g) = 9358g + 321. What is the hundreds digit of p(2)? 0 Let b be (3 - 34/10) + (-81)/(-15). Let p(g) = -6g*2 + 2g + 4. Let f be p(b). Let w = f + 238. What is the hundreds digit of w? 1 What is the tens digit of 2561/(-23(-23)/2116)? 4 Let o be (-4)/9 + (-68)/9 - -3. What is the hundreds digit of 568/((2 - o) + -5)? 2 Let g = 19722 + -11938. Suppose -4o - g = -18o. What is the tens digit of o? 5 Let w be -3 + (0 - ((-3 - -5) + 21)). What is the tens digit of ((-117)/w)/((-6)/(-176)) - -4? 3 Suppose -5z + 26 = -4a - 25, 3a + 15 = -4z. What is the units digit of (-2118)/a(-3)/6-6? 6 Suppose 2 = -2g - 5n, 6g = g - 2n - 26. Let k(a) = -6a*3 - 8a*2 - 6a + 14. What is the tens digit of k(g)? 5 Suppose -3d = -2 - 34. Suppose 2i = -3i + 75. Suppose 111 = dw + i. What is the units digit of w? 8 Let g = 13737 - 5393. What is the hundreds digit of g? 3 Let a(k) = k + 9. Let m be a(0). Let z(j) = 24j2 - 78j + 150. Let s(p) = -5p2 + 16p - 31. Let f(w) = 19s(w) + 4z(w). What is the tens digit of f(m)? 2 Suppose -4t + 188 = 2u - 134, -2t = 5u - 797. Suppose ui = 158i + 383. What is the units digit of i? 3 Suppose -2h + 4u - 134 = 0, h + 38 = 4u - 39. Let c = -45 - h. Suppose 0 = -4b + 4q + c, b + 0b - 3q - 7 = 0. What is the units digit of b? 1 Let z(j) = j2 - 6j - 1. Let n be z(7). Suppose -13t - 12t = 0. Suppose t = -5b + nb - 12. What is the tens digit of b? 1 Let b(q) = q*2 + 9q. Let s = -12 - -3. Let w be b(s). Suppose w = -v + 6v - 195. What is the tens digit of v? 3 Let w(i) = 17i*2 + i + 3. Let r be w(6). Suppose 0 = 2l - 5l - p + r, 5l - p = 1043. What is the tens digit of l? 0 Suppose -2b - 3b = 25. Let f be (b/((-20)/8))/(-6)-12. Suppose -fu + 75 = k, 3k - 6 = k. What is the units digit of u? 8 Suppose -35 = -4v + 29. Suppose -2 = 2b - 5z - v, -8 = 4b - z. What is the hundreds digit of -6 - 160/(-24) - 478/b? 1 Let d(n) = -20n - 72. Let o be d(-6). Suppose -3565 = ob - 53b. What is the units digit of b? 3 What is the units digit of (-11397)/(64/512 + 9/(-8))? 7 Let c(a) = -a. Let g(s) = 3s. Let b(t) = -6c(t) - g(t). Let p be b(1). Suppose -404 = -4y + 4k, pk - 179 = -4y + 197. What is the tens digit of y? 9 Let u(j) = 266j - 1. Let w be u(3). Let y = -434 + w. What is the tens digit of y? 6 Suppose 9j + 1450 = 7j. Let g = -487 - j. What is the units digit of g? 8 Let y be -10 + 6 + (2 - -3). Let o(x) = -3x*2 + x + 1. Let c be o(-4). What is the tens digit of (7/3 - 4)/(y/c)? 8 Suppose 79q - 107q + 1347248 = 0. What is the tens digit of q? 1 Suppose -4w + 17539 = -5l - 6344, -2l + 5961 = w. What is the tens digit of w? 6 Let k = -248 - -149. Let u = 70 + k. Let w = u - -53. What is the units digit of w? 4 Suppose -405s = -407s + 22606. What is the ten thousands digit of s? 1 Let v(g) = 2g3 + 4g*2 - 2g - 7. Let s be v(-4). Let w = 10 + s. What is the units digit of 10/(w/(-17) + -8 + 5)? 5 Suppose -4k + 1 + 6 = -w, 0 = k + 4w + 11. Let m be (-4 + k)/((-4)/4). Suppose h + 0l = l + 17, 0 = 5h - ml - 79. What is the tens digit of h? 1 Let p(v) = v + 1. Let f(o) = 9o*2 + 5o + 16. Let i(x) = f(x) - 2p(x). Let w be i(-6). Suppose w = 19l - 15l. What is the units digit of l? 0 Let g(u) = 25u*3 + 17u*2 - 81u + 9. What is the units digit of g(5)? 4 Let y be (-28)/(-16) - 2 - 17/(-4). Suppose 456 + 197 = h + 4z, 5h - yz - 3289 = 0. What is the units digit of h? 7 Let x(s) = -2s*3 + 7s*2 - 5. Let r be x(3). Suppose 0 = rj - 3j - 5. Suppose 826 - 266 = jc. What is the units digit of c? 2 What is the hundreds digit of (-15)/(360/(	{ "pile_set_name": "DM Mathematics" }
2y + (-6 - 1 + 3)(-2y + 0y + y) - 10y - 13y - 4y)(2 - 2 + 2) as j + zy and give z. -48 Rearrange 2u*2 - 5 + 7u - 3 - 5u2 + 11 + 2u*4 to the form c + fu + su2 + iu*3 + ku*4 and give k. 2 Rearrange -17n*2 + 13n*2 - 10n*2 + 860n + 11n2 to the form yn*2 + l + zn and give y. -3 Rearrange (0 - 1 - 1)(14 + 2 - 1 + (-1 + 0 - 1)(3 + 0 - 4) + 0 + 3 - 1)(1 + 1 + 1)(2 - 2l - 2) to ql + n and give q. 228 Rearrange -61624q + 23386q + 26027q to w + iq and give i. -12211 Express -3 - 386h4 + 4h*4 + 201h*4 - 4h + h in the form qh3 + yh*4 + rh + xh2 + w and give y. -181 Express (-4 + 0 - 1)(0n + 4n - 5n) + 9 - 5892n - 5896n + 11722n + 0 in the form pn + c and give c. 9 Rearrange 223d*2 + 3d + 2129d3 - 1 + 2 - 2127d*3 to t + jd*2 + vd + bd3 and give t. 1 Rearrange 3v*2 - 5v*2 + 0v*2 + (3 - 2 + 7v + 2v)(742v - 363v - 366v) to u + fv*2 + av and give a. 13 Rearrange (-56c2 + 16c*2 + 9c*2)(41c - 1 - 10c + 53c) to the form jc*3 + sc*2 + mc + o and give o. 0 Express -52 + 12 - 43 - 40r in the form s + zr and give s. -83 Express -14 + 180n2 + 3999n - 7999n + 4000n + 1029n2 as in + h + fn2 and give h. -14 Express -3370g - 5413637 + 5413637 - 9171g - 1758g as t + sg and give s. -14299 Express -1433g*2 - 8871g*2 - 9617g*2 + 486g*2 in the form pg + z + wg2 and give w. -19435 Express (18q + 562 - 560 + 6q)(54q - 2q*3 - 54q) in the form jq2 + uq*3 + m + oq + hq4 and give u. -4 Express 48g - 4 + 2g3 - 83g + 48g - 9 as xg + j + og3 + ag*2 and give j. -13 Rearrange -706h + 2299 - 1154 - 1146 to o + ih and give o. -1 Express (-m3 + 12m*3 + 0m*3)(1 - 3 + 1) + (12m - 13m*2 - 12m)(4m - 2m + 2m) as dm2 + pm + om3 + j and give j. 0 Rearrange (c + 5c - 2c)(-5086 + 2035 - 4451)(4 - 3 + 1) to fc + u and give f. -60016 Rearrange -340k2 + 12 + 101k*2 + 217k*2 to the form n + lk*2 + uk and give n. 12 Rearrange -25h2 - 20 + 37h*2 + 2h + 88h2 to the form q + yh*2 + rh and give r. 2 Rearrange (-17x - 40x + 4x)(3 - 15 - 51)(3x2 - x2 - 4x2) to l + px*2 + dx*3 + zx and give d. -6678 Express (-5 + 7 - 6)(-1 - 1 + 4706312w - 4705603w) in the form dw + p and give d. -2836 Rearrange 230u2 - 62664 + 62662 + 612u*2 to iu + gu2 + t and give t. -2 Rearrange 469z + 1064z + 6294z + 3143z to the form p + yz and give y. 10970 Rearrange -2d + 3d + 2d - 2000 - 5d - 2d to cd + m and give m. -2000 Express -1 + 0t - 2t + 4 + 0t + t + t + (t + t + 0t)(-1 - 3 - 8) + 78t + 68t + 34t in the form dt + n and give d. 156 Rearrange 141105c + 4c3 - 140996c - 7 + 8 to gc3 + ic*2 + dc + k and give g. 4 Express 145 + 3b2 - 425 - b2 + 143 - 7b + 152 in the form m + vb2 + ub and give m. 15 Express 419 - 640k4 + 2k*3 - 421 + 101k*2 - 101k*2 in the form pk + ok3 + n + zk*4 + lk*2 and give n. -2 Rearrange (-2790l + 4706l - 2918l)(-4l - 2l - 2l) to the form wl + g + ml*2 and give m. 8016 Express 3r*4 - 5r*4 + 630 - 628 + 1765r*3 + 3882r*3 in the form sr*3 + i + gr + dr2 + hr*4 and give h. -2 Express -1621m*2 + 810m*2 + 814m*2 - 68 + (4 - 1 + 2)(3m - 3m - 2m2) as a + dm*2 + hm and give a. -68 Express (-3t4 + 6t4 - t4)(-1 + 1 + 2) - 6540t*4 + 4275t*4 + 3119t*4 as qt*2 + rt + l + it4 + st*3 and give i. 858 Rearrange (6c*2 - 7c*2 + 14c*2)(-12c + 126c + 135c) to pc*2 + y + mc + hc3 and give h. 3237 Rearrange (-u - 2u + 2u)(0u - 3u + u) + (-3 - 15 - 16)(-3u*2 + u - u)(10 + 12 - 25) to n + hu2 + iu and give h. -304 Express (-2 - 2 - 2)(-4124p + 2924p - 3600p) in the form m + tp and give t. 28800 Express (3 - 1 - 3)(2t + t - 2t) - 232 + 26579t - 26580t - 14 in the form yt + f and give y. -2 Rearrange (-4 - 4 - 1)(-2c - 2c*3 + 2c) - 2c3 + 3c*3 - 2c*3 - 338c + 170c + 167c - 86c3 to the form pc*2 + o + qc*3 + ac and give a. -1 Rearrange 22855 + 3852h - 22855 + (3 - 3 + 2h)(-1 + 5 - 1) to the form uh + f and give u. 3858 Express (-675x + 595 - 595)(5 - 10 + 35) as tx + s and give t. -20250 Rearrange -7b - 1147 + 58 - 7b + 24b - 8b to pb + h and give h. -1089 Express -4768u3 + 121u*2 + 855u*3 + 122u*2 + 118u*2 - 360u*2 in the form y + tu*2 + fu*3 + cu and give f. -3913 Express (-1 - 1 + 5)(0g + 3g + 0g) - 3323g + 6744g - 1675g as rg + h and give h. 0 Express 4q4 + 2q - 3q3 + 8q*2 - 10q*2 + 55q*4 + 1 - 26q*4 as tq*4 + gq + wq2 + vq*3 + r and give w. -2 Rearrange -30h3 - h2 + 51h3 + 16h*3 - 29h*3 + 1 - 57h to ah2 + w + jh*3 + ch and give j. 8 Rearrange (0 - 2 + 1)(p + 0 + 0) - 2p + 2p + 3p - 6p + 4p + 6p - 6p + 0p + 4p + 176p - 781p + 250p to the form b + mp and give m. -351 Rearrange 233b2 - 5 - 701b*2 + 2b*3 - 176b*2 - 627b*2 to sb + xb3 + a + mb*2 and give x. 2 Rearrange (495 + 1497 + 9303)(0l2 + 3l*2 - 2l*2) to the form jl + p + tl2 and give t. 11295 Rearrange (-3o + o + o)(-39o*2 - 54o*2 - 21o*2) + 6o + 2o3 - 4o - 4o to the form vo + bo2 + r + fo3 and give b. 0 Express (-2 + 2 - h2)(2h - 3h + 4h)(9 - 40 - 19)(-4 + 0 + 0) in the form gh + wh*3 + t + lh2 and give w. -600 Express -24 - j2 + 2762j3 + 4 - 2795j*3 in the form g + uj*2 + lj + pj3 and give g. -20 Rearrange (2 + 2t - 2)(-4 - t + 4) + (-4 + 4 + 2)(-2319t2 - 753t*2 - 4133t*2) to v + it*2 + ct and give i. -14412 Express 459n + 369200 - 369200 + (2 + 1 - 2)(0n - 2n - n) as zn + x and give z. 456 Rearrange (43f*2 + 9f*2 - 14f*2)(7f + 569 - 554 - 18f) to yf + z + gf*3 + rf*2 and give r. 570 Express -47v*2 - 36v*2 - 31v*2 + 105v*2 + 584 as gv*2 + s + yv and give g. -9 Rearrange 72 - 4w2 + 81 + 5w*2 - 8255w - 153 - 3w3 to bw*2 + m + qw*3 + tw and give b. 1 Express (-2 - 4 + 4)(2z - 3z + 3z) + 3535 - 2439 - 2z - 1891 as jz + h and give h. -795 Rearrange 867z - 58 + 1854z - 47 + 105 to the form x + dz and give d. 2721 Express (-1641 + 1201 + 2220 + 890)(-8f - 2f*2 + 8f) in the form pf + jf*2 + u and give j. -5340 Rearrange 213n + 11n2 + 2n*3 - 130n - 83n + 8 to m + rn + hn3 + pn*2 and give m. 8 Express (2848d + 2020d - 4363d - 2)(-1 - 5 + 4) as kd + o and give k. -1010 Rearrange -43 - 5 - 7m2 + 13m*3 - 36m*3 + 9 + 16 to pm + sm2 + im3 + d and give d. -23 Express d3 + 15d4 - 41d*2 - d + 8d*3 - 3d*3 + 42d*2 + 0d*3 as qd*4 + id*3 + bd + t + gd2 and give i. 6 Rearrange (-r + 2 - 2)(-105r - 58r - 2 - 56r + 4r + 7) to the form gr + jr2 + a and give g. -5 Express -a2 - 2 - 91a3 - 2112a + 1059a - 1 + 1055a in the form fa2 + i + qa + ba3 and give i. -3 Rearrange 56 - 31 - 30o2 - o2 - 2o - 35 to zo + b + so2 and give z. -2 Express -5k*2 + 6k*2 + 251 - 18 - 5k*2 as a + qk + xk2 and give a. 233 Rearrange (-4o + 5o + 0o)(4o*2 - 3o*2 - 2o*2) + (-681o*2 + 4300o*2 - 983o*2)(-o + 0o + 3o) to io3 + so + lo2 + k and give i. 5271 Rearrange -349 - 2z*3 + 366 - 445z + 181z + z4 to the form dz*4 + i + nz*3 + yz*2 + az and give n. -2 Rearrange (376t + 1487t + 241t)(0 + 3 - 1)(-3 + 4 + 1 - 4) to the form i + ot and give o. -8416 Express (-37 + 66 - 224 - 61)(-9l + 0l + 12l) as a + il and give i. -768 Rearrange 8 + 25 - 2 + 523x - 506x to j + vx and give j. 31 Express -20 - 683760n2 + 683760n*2 - 4n*4 + 22n*3 in the form an*3 + on*2 + pn*4 + k + gn and give p. -4 Express -11686 - 11679 + 23365 - 8284n as z + fn and give f. -8284 Express (-1475 - 184 + 647)(5 - 5 + 4o)(-1 - 2 + 1) in the form co + s and give s. 0 Express 722q2 + 1075q*2 + 4558q*2 - 213q*2 + 3693q*2 - q + 2 as g + mq*2 + dq and give g. 2 Express ((-571 + 308 + 301)(4 - 6 + 15) + 3 - 3 + 1)(-2z - 5z*2 + 11z*2 - 7z*2) as cz*2 + tz + m and give t. -990 Express 0b - 35649b*2 - 311 + 35643b*2 - 2b in the form cb + hb*2 + f and give f. -311 Rearrange m + 12m*2 - 18m**2	{ "pile_set_name": "DM Mathematics" }
o (b) -1/5 (c) 0.4 b Let v = 31 - 405/13. Suppose -2t - 2o = -6t, 2o = -2t - 6. Which is the closest to -2/3? (a) v (b) t (c) 2/9 b Let w = 75/4 - 18. What is the closest to 1 in w, -0.2, -2? w Let o = 3 - 4. Let h = -0.6 + -3.4. Which is the closest to o? (a) h (b) 1 (c) 0 c Let u = -1.5 + 1.1. Which is the nearest to 2/11? (a) u (b) 2 (c) 4/7 c Suppose 10 = -5g - 5. What is the closest to 0 in g, 0.1, -4? 0.1 Let k = 3.5 - 1.5. Which is the closest to -0.2? (a) 3 (b) k (c) 1 c Let x be (-18)/(-52) - (-1)/(-2). Let h(q) = -q*2 + 1. Let t be h(0). Let z be ((-1)/t)/((-6)/12). Which is the nearest to -1? (a) x (b) z (c) 0 a Let p = 0.07 - 0.27. Let u = 198 - 1784/9. Which is the closest to 1? (a) p (b) u (c) -0.6 a Suppose -21 = -3r + 5g - 9, -5g = -r + 4. Which is the closest to 0.1? (a) r (b) 0.5 (c) 2 b Let p = -12.2 + 12. Let b = p - -1.2. Let j = 0.8 - -0.2. What is the nearest to b in j, 1/2, 2/9? j Let i(t) = t*3 + 5t*2 + 4t - 1. Let z be i(-3). Let n = z + -7. What is the nearest to -2 in n, -0.1, -0.3? n Let x be (1 + (-16)/12)2. Which is the closest to 1? (a) x (b) -3/4 (c) 2/7 c Let z = -0.967 + -0.033. Which is the nearest to 2? (a) -0.1 (b) 2 (c) z b Let q = 0 + -1. Let w = -11/90 + -1/10. Suppose 0o + o = 2. Which is the closest to q? (a) w (b) o (c) 0.5 a Suppose 4p = 7p - 3o + 3, 0 = 5p + 3o - 11. Let a = -1 - -3. What is the closest to -2/3 in a, 0.3, p? 0.3 Let u = 23 + -28. Let k = -0.6 + 2.6. What is the closest to k in -3, u, -0.2? -0.2 Let j = -4.07 - -0.07. Let g be 2/(-3) + 44/57. Let s = -16 + 14. Which is the nearest to s? (a) j (b) 3/2 (c) g a Let g = 203/6 - 34. Let n = -97 - -487/5. Let k = 3/29 + -38/87. What is the nearest to k in g, n, -3? g Let y = -2 - -3. Let z = 4.8 + -3.77. Let u = z + -0.03. What is the closest to y in -4, u, -4/5? u Let u = -25 + 26. Which is the nearest to u? (a) -2 (b) -2/5 (c) -3/5 b Let d = -222 - -1106/5. Let m = -4.018 + 0.018. What is the nearest to 0 in m, 0.5, d? 0.5 Let o = -1.4 + 1.7. Which is the closest to -3? (a) -2/3 (b) o (c) 0.5 a Let f = 0.1 - -0.2. Which is the closest to 0? (a) -0.2 (b) f (c) -4 a Let d(l) be the second derivative of l5/20 + l4/2 - 7l*3/6 + l. Let w be d(-7). Which is the closest to 1/4? (a) -0.3 (b) -4 (c) w c Let f be (2/(-4)0)/2. Suppose -m - v + 8 = -fm, 0 = -4v + 20. Let i = 23 + -23.2. What is the nearest to -1 in 3/4, i, m? i Let v = -7 - -7.1. What is the nearest to v in 1, 5, 0.02? 0.02 Let r = -1 + 1. Let n = 9.91 - 10. Let u = -0.01 + n. Which is the nearest to u? (a) r (b) 0.5 (c) 5 a Let u = -7.4 + 7. What is the closest to 0 in -0.2, u, 1? -0.2 Suppose -4t + 9t = 0. Which is the closest to 2/21? (a) 2/7 (b) t (c) 2 b Let o = 0.08 - 0.33. Let i = o - -0.65. Which is the nearest to 2? (a) 5 (b) i (c) 0.2 b Let j = -0.2 + 0.7. Let w be (-6)/2(-4)/(-10). Let y = -0.06 - -0.16. What is the nearest to y in w, 2/9, j? 2/9 Let j be (3/(-2))/((-63)/12). What is the closest to j in 0.5, 0, 0.4? 0.4 Let r = 0.3 + 0.2. Let s = 8.2 - 8. Which is the closest to s? (a) -1/9 (b) 5 (c) r c Let h = -3 + 2. Let w be (1 - h) + (-8)/5. Suppose -2f = -3f + 2o + 2, 5f + 2o = -14. Which is the closest to f? (a) -5 (b) 3 (c) w c Let j be 5/(-3) + (-1 - -3). Which is the nearest to j? (a) 4/9 (b) -2 (c) -2/17 a Let b = 10 + -17. Let l = -11 - b. What is the closest to 0.1 in l, 2, -1/6? -1/6 Let x = 76903/225 + -3077/9. Let l = 8/25 + x. Which is the nearest to -0.1? (a) -1 (b) l (c) -0.04 c Let s = 3 - 8. Let m be 8 - (-8)/((-200)/215). What is the nearest to -1 in s, -5/4, m? -5/4 Let l = 11.9 + -12. What is the closest to l in 4, -1, -1/3? -1/3 Let k be 1 - (5 - 3/3). Let r = -1643/6 - -273. Which is the closest to 0.1? (a) k (b) 3 (c) r c Let m = -2.6 + 4.6. What is the closest to m in -2/3, 0, 3? 3 Let o = 0.24 + -0.04. Which is the closest to 0.3? (a) o (b) -0.5 (c) 2 a Let b be 6/52/(-6). Let v = -7 + 12. What is the nearest to 2 in b, v, 1/9? 1/9 Let n = -1 + 4. Let f = 2 - n. Let k be (6 - 4) + (-8)/5. What is the closest to k in f, 0, -5? 0 Let u be 2/(-4)48/(-30). Which is the closest to -2/5? (a) -0.6 (b) 4 (c) u a Let f = 1 + 1. Let g = 727 - 729. Let o = -25 - -49/2. What is the nearest to o in -0.2, g, f? -0.2 Let x = 95 - 93.1. Let g = 8 - 7.1. Let r = g - x. What is the closest to -2 in 0.1, 5, r? r Let i(r) = -r*2 - 9r - 9. Let u be i(-8). Let f be 3u/(-27)2. Let m be (1 + 5)/((-12)/8). Which is the nearest to 1? (a) m (b) 2/13 (c) f c Suppose 16 = -z + 2d + 2d, 2d + 6 = -3z. Let n be 117/126 - (-2)/z. Which is the closest to -1? (a) 0.5 (b) -4 (c) n c Let w = 1.2 - -1.8. Suppose 3z = -2z + 10. What is the nearest to -0.1 in z, -4, w? z Let d = 2 - 4. Let g be ((-3)/(-12))/(1/d). Let t = 0.02 - 0.22. Which is the nearest to 1? (a) t (b) -1/4 (c) g a Let o = -0.2 + 0.3. What is the closest to o in 0.5, 2, -5? 0.5 Let c be 1/(2 + 3/(-3)). Let f = -0.03 - 0.47. Let o be 3(0 + 3/(-12)). What is the nearest to c in o, 2, f? 2 Let g be (1 - (2 + -1))1. Let n(q) = q*2 + 2q - 4. Let s be n(-4). Suppose g = -3y - s - 8. Which is the closest to 1? (a) 1 (b) 1/3 (c) y a Let h be (4 + 45/(-10))/1. Which is the closest to h? (a) 5/2 (b) 2 (c) 1/3 c Let n = 81.9 + -63. Let o = 16 - n. Let k = o - -3. Which is the closest to -1? (a) -2 (b) k (c) 2/15 a Let j = 0.2 + -0.1. Suppose n + 4n = 55. Let o(i) = i*3 - 10i*2 - 10i - 8. Let s be o(n). Which is the closest to j? (a) -5 (b) s (c) -2/9 c Let a = 119 + -119. What is the closest to -2/3 in a, -0.2, 0.3? -0.2 Let i = 13.9 + 0.1. Let q = 11 - i. What is the closest to -0.2 in -2, q, -0.4? -0.4 Let t = 0.111 + -0.611. What is the closest to 2/5 in -5, 1/65, t? 1/65 Let q = -3.2 - 0.8. Let s = q - -3.6. Which is the closest to 1? (a) s (b) -3 (c) 3 a Let t = -136 + 133. What is the closest to -1 in 8, -1, t? -1 Let q = -182.7 + 183. What is the nearest to -2/7 in -0.5, q, -2? -0.5 Let d = 6 + -8. Which is the closest to 9? (a) -1/2 (b) 0.3 (c) d b Let h be 17/(-6) - (0 - -1). Let w = h - -95/24. Let n = 2 - 2. Which is the closest to 1/2? (a) w (b) 0.2 (c) n b Let i = 2 + -1.9. Let x = 0.396 + -5.396. What is the closest to i in 0.1, -0.2, x? 0.1 Let m = -3.7 + 4. Let t = -11 - -11.7. Let l = m + t. Which is the closest to l? (a) -1/4 (b) 1 (c) -2 b Suppose -y = -m + 3y - 14, -m - 5y + 31 = 0. Let d = m + -1. What is the nearest to 2/5 in -0.2, -1, d? -0.2 Suppose -4n + 10 + 8 = -2d, 3n = -d + 21. Let y be ((-3)/7)/(n/4). Which is the closest to 0? (a) y (b) -5 (c) 0.1 c Let n be ((-2)/12)/(7/(-406)). Let l = 9 - n. What is the nearest to l in 0.5, 2/7, 2? 2/7 Let i = -19 - -13. Let j = i - -4. Let w be 2 + -2 - 1/4. Which is the closest to w? (a) j (b) 1/10 (c) 0.3 b Let d = -14 - -8. Let c = 28.5 + -29. What is the closest to -2 in c, d, -4? c Let j = 4 + -4. Let g = -0.54 - 2.46. Let q = 7 + -11. What is the nearest to j in q, g, -0.4? -0.4 Let r be (-4)/(-6) - (-32)/(-66). Let y = -3 + 2. Let x = -2.13 + 0.13. Which is the closest to 1? (a) x (b) r (c) y b Let i = 0.3 + -0.2. Let c = 0.45 + -0.05. Let q = i + c. What is the nearest to -0.1 in 4/9, q, 5? 4/9 Let v = -20.5 + 21. Let n = -2 + 2.2. Which is the nearest to n? (a) 0.4 (b) -3/7 (c) v a Let o = 4 - 3.5. Let c = -192 + 1726/9. What is the closest to c in 4, o, -1/9? -1/9 Let x be 217/21 - 2/6. Let c be 1/2 - (-15)/x. Let g = -2 + c. What is the closest to g in -2, -2/23, -1? -2/23 Let y = 0 + -0.2. Let v = -20 - -20. Which is the nearest to v? (a) -1/10 (b) y (c) -0.4 a Let b = 0 - -1. Let a be (-20)/(-16)(-8)/20. What is the nearest to b in a, -0.4, -0.2? -0.2 Let o be (-20)/(-40) + (-7)/6. What is the nearest to o in -0.01, -5, -1? -1 Let p = -0.6 - -0.2. Let t = p + 0.3. Which is the closest to t? (a) -1 (b) 0 (c) 2/7 b Let t = -2/21 - 17/42. Let d = 32 + -30. Which is the nearest to 2? (a) t (b) 5 (c) d c Let z be ((3 - -1) + -3)/7. What is the closest to -1 in z, -4, 1/2? z Let t = -8 + 7.5. Let h = -3 + 6. What is the closest to 2/9 in 3/4, t, h? 3/4 Let b be 0/(-1) - (-7 - -9). Let g be ((-6)/3)/(5/b). What is the nearest to 0.3 in g, 2, -5? g Let	{ "pile_set_name": "DM Mathematics" }
e factors of i(-1). 2, 5, 31 Suppose 18225 = 9d + 36d. What are the prime factors of d? 3, 5 Let x(m) = m*3 + 13m*2 - 7m + 82. List the prime factors of x(10). 2, 17 Suppose 22m - 23m - 15 = 0. Let h be (-55)/m + 2/(-3). Suppose -n + 6 = h. List the prime factors of n. 3 Let p(r) = -r*3 - 36r*2 + 31r - 50. List the prime factors of p(-37). 2, 43 Let f(l) = -l*3 + 23l*2 + 33l + 135. List the prime factors of f(17). 2, 3, 5 Let r be -32(-4)/24. Suppose 4f - 227 - r = 0. List the prime factors of f. 3, 19 Let i be 15(-3 - (-51)/15). Suppose 8r + i = 86. List the prime factors of r. 2, 5 Suppose -j + 3z + 8 = -12, 5j - z - 100 = 0. Suppose 0 = -5s - j, -v - 5s = -s + 11. Suppose -11 = -2b + v. List the prime factors of b. 2 Let x(t) = 678t2 + 20t - 23. What are the prime factors of x(2)? 2729 Suppose 0 = -3q - 16 + 571. Suppose -16 = -4y, 4 = -3m + 5y - 4. Suppose mt - q = -t. What are the prime factors of t? 37 Suppose 15q - 14 = 8q. Suppose 0 = f - 0 + 6. List the prime factors of 26/3 - q/f. 3 Suppose -w - 3r = -27, 0 = -2w + 5w - 5r - 11. Let z be (-3)/2 - (-2538)/w. Suppose 7y = y + z. List the prime factors of y. 5, 7 Let d be 4/3(-1362)/4. Let r = d - -649. List the prime factors of r. 3, 5, 13 Suppose -5y + 0r + 3r - 310 = 0, 2y + 98 = -4r. Suppose 4i = -4 - 92. Let z = i - y. List the prime factors of z. 5, 7 Let b = -292 + 436. What are the prime factors of b? 2, 3 Let s(k) = -k3 + 11k*2 - 9k + 13. Let f be s(10). Suppose i = f - 11. What are the prime factors of i? 2, 3 Let y = -8 + 14. Suppose y = 2s - 0. Suppose -5t + 92 = 4a - t, -sa - 2t + 73 = 0. What are the prime factors of a? 3 Let b = 73 - 25. Let p = b - 31. What are the prime factors of p? 17 Let n be 1/14 + 122. Suppose -6m + n = -3m. List the prime factors of m. 2, 3, 7 Suppose 4s + 3g - 32 = 0, 2 - 3 = -s + g. Let i = s + 14. What are the prime factors of i? 19 Suppose -2j + 23 = -7. Let m be (-32)/(-10) + (-3)/j. List the prime factors of 2/m - (-406)/21. 2, 5 Let d(h) = h2 - 14h + 1. Let o be d(15). Let f be (-1 + -1)(-40)/o. Suppose -4 = -2m + 4, fm + 70 = 5l. What are the prime factors of l? 2, 3 List the prime factors of (-1 - 2631)(-69)/138. 2, 7, 47 Let p be 38(5/2 - 2). Let q(r) = r*3 - 5r*2 - 7r + 8. Let l be q(6). Suppose -t - p = -lt. List the prime factors of t. 19 Let b(m) = 39m*2 + 2m + 6. What are the prime factors of b(3)? 3, 11 Suppose -17 = -4u + 43. Suppose -3t = -3b - 5t + 243, -243 = -3b + 4t. Let g = b - u. List the prime factors of g. 2, 3, 11 Let j be 6/(-2)2324/(-42). Suppose 48 - j = -a. What are the prime factors of a? 2, 59 Let t(u) = -u3 - 6u*2 + 4u - 8. Let k(v) = -v*2 + 5. Let a be k(3). Let s be 7(1 + a + 2). What are the prime factors of t(s)? 13 Suppose 5b = 3o - 13, -3o = 2o + 20. List the prime factors of (-632)/b + (-2)/5. 2, 3, 7 Suppose -142y + 134y + 25512 = 0. List the prime factors of y. 3, 1063 Let t(c) = c - 9. Let h be t(12). Suppose -hz - 14 = -3m - 2z, -z = 2m - 11. Suppose mi - q = -3q + 102, 3i - 58 = 2q. What are the prime factors of i? 2, 5 Let m = -154 + -29. Let s = 127 - 254. Let g = s - m. List the prime factors of g. 2, 7 Let u(g) be the first derivative of -3g2/2 + 8g - 6. List the prime factors of u(-10). 2, 19 Suppose -2u = -3n + 19, 0 = -u + 2u + 2. Let d(w) = 3w - 10. What are the prime factors of d(n)? 5 Let r(b) be the third derivative of b6/120 - b5/15 + b*4/3 + 5b*3/6 - 12b*2. What are the prime factors of r(7)? 2, 13 Let j = 16 + -12. Let b = 6 - j. List the prime factors of (-81)/b8/(-12). 3 Suppose -2q - a = -0a - 2217, 0 = -6q + 3a + 6669. What are the prime factors of q? 2, 3, 5, 37 Let n be ((-1)/2)/((-13)/(-156)). What are the prime factors of n/(-30) - 468/(-10)? 47 Let z(k) be the second derivative of k*7/315 + 3k*4/4 + 2k. Let y(b) be the third derivative of z(b). What are the prime factors of y(-1)? 2 Let l(t) = -4t + 4. Let k(y) = -1. Let b(j) = -3k(j) + l(j). Let u = -162 + 159. What are the prime factors of b(u)? 19 Suppose 0 = 10f + 630 - 1880. What are the prime factors of (f + -4 - -5)/(3/4)? 2, 3, 7 List the prime factors of (-5 + -4 - -1937) + 1. 3, 643 Let v(r) = r3 - 12r*2 + 11r - 17. Let q be v(11). Let u(c) = -c - 6. What are the prime factors of u(q)? 11 Let n(u) = 2u3 + 6u*2 + 3u - 8. Let v(a) = -3a3 - 7a*2 - 4a + 9. Let m(c) = -4n(c) - 3v(c). What are the prime factors of m(4)? 3, 7 Let o(k) = k*3 + 28k*2 + 26k + 18. List the prime factors of o(-22). 2, 5, 47 Suppose -v + 3 = -t, -11 = t - v + 4v. List the prime factors of 5 + ((-48)/30)/(2/t). 3 List the prime factors of (-12467)/39(-7 + 2 + -1). 2, 7, 137 List the prime factors of ((-15)/(-3) - 2) + 403. 2, 7, 29 Suppose -3y + 350 - 913 = 5k, 5y = -k - 95. Let l = k + 163. Suppose 2u - l = -4u. What are the prime factors of u? 2 Suppose 2x = -5u + 4 + 6, -2x = 4u - 8. What are the prime factors of 4 - (u + -11 + -1)? 2, 7 Let f(i) = 55i*2 + 27i + 289. List the prime factors of f(-7). 5, 13, 43 Let a be (-236)/(-2)(-3 + 28/8). Suppose 3s + a - 266 = 0. What are the prime factors of s? 3, 23 Suppose -5r - 3t = -0r - 14458, -5t + 2874 = r. List the prime factors of r. 2, 1447 Let h be (-48)/(-20) + (-2)/5. Suppose 405 = 3l + hl. Suppose -l - 39 = -3p. List the prime factors of p. 2, 5 Let h be 0 + 249-1 + 4. Let u be (12/10)/((-14)/h). List the prime factors of -1(u-1 - 4). 5 Suppose 2a - 4u = 1002, 9u - 6u - 501 = -a. What are the prime factors of a? 3, 167 Suppose -47w + 269463 - 69478 = 0. List the prime factors of w. 5, 23, 37 Let q(w) = w2 + 8w + 11. Let f be q(-7). Suppose d + 27 = 3a - d, fa - 53 = -3d. Let b(y) = y + 3. List the prime factors of b(a). 2, 7 Let i(v) = v - 2. Let n be (-6)/428/(-6). What are the prime factors of i(n)? 5 Suppose -5o - 2i + 34 = 26, i + 3 = o. What are the prime factors of o? 2 Let g = 1091 + -645. What are the prime factors of g? 2, 223 Let s = 570 - -2884. What are the prime factors of s? 2, 11, 157 Let a be (-6)/(-1) + (-8)/4. Suppose j + 4 = -4c, c - 4j + 16 = -8j. Suppose 3w + a = -2v, -2w + cw + 5v = -29. What are the prime factors of w? 2 Let l be 1/3 - ((-8320)/15 + 2). Let w = -370 + l. List the prime factors of w. 3, 61 Let t(z) = z*2 + 6z + 8. Let a be t(-6). Suppose 0 = 5b - 5p - 4 - 1, -a = -2p. List the prime factors of (17 + -7)/(1/b). 2, 5 Let h = 5 + -1. Suppose 0c - 2c = -h. Suppose -c + 40 = 2s. What are the prime factors of s? 19 Let l(k) = 37k3 + 6k*2 - 8k - 2. Let f be l(2). Suppose -5i + 228 + f = 0. List the prime factors of i. 2, 53 Let w = -2 + -6. Let m be (-2)/w - 33/(-44). Let s(g) = 19g*2 - 2g + 1. What are the prime factors of s(m)? 2, 3 Suppose -2k = 4 - 2. What are the prime factors of 1(-25 - -2)/k? 23 Let y(g) = -44g - 140. What are the prime factors of y(-5)? 2, 5 Let w(i) = -i3 + 10i*2 - 13i - 17. Let d be w(7). List the prime factors of d/26(-148)/(-3). 2, 37 What are the prime factors of (-225)/(-18)(-28)/(-2)? 5, 7 Let w = 9 + -5. Suppose wr + 5f - 4f + 3200 = 0, f - 2400 = 3r. What are the prime factors of (-2)/13 + r/(-130)? 2, 3 Let g(k) = k*2 - 7k + 12. Let i be g(5). Let p(v) = -6v - i - 13 - v2 - 10v. List the prime factors of p(-14). 13 Let r(s) = -4s2 - 13. Let n(c) = -9c*2 - 26. Let y(i) = 3n(i) - 7r(i). List the prime factors of y(-13). 2, 7, 13 Let a(r) = 302r*2 - 8r + 1. What are the prime factors of a(1)? 5, 59 Suppose r + 634 - 1935 = -2w, 0 = 2w + 2r - 1306. List the prime factors of w. 2, 3 Let x = -1892 + 2710. What are the prime factors of x? 2, 409 Let d = 1998 - -103. List the prime factors of d. 11, 191 List the prime factors of ((-351)/(-36))/((-6)/(-632)). 13, 79 Suppose -4 = -9y + 8y. Suppose -yn + 370 = 2b, 0 = n - 0b - 2b - 80. What are the prime factors of n? 2, 3, 5 Let r = -903 - -1597. Suppose -4j + 190 = -r. What are the prime factors of j? 13, 17 Suppose -2y + 71 = -227. Let p = -75 + y. List the prime factors of p. 2, 37 Suppose 5c = -2g - 3g - 515, -5c + 394 = -4g. Let v = g + 181. List the prime factors of (v/6)/(6/18). 2, 5 Let x = 15 - 17. What are	{ "pile_set_name": "DM Mathematics" }
ate the highest common factor of 9 and t. 9 Let b(c) = 3c2 + 3c + 9. Let f be b(-4). What is the greatest common divisor of f and 135? 45 Suppose -3l = -2l, 572 = 2v - 2l. Calculate the greatest common factor of 78 and v. 26 Let n be ((-3)/5)/(8/(-720)). Suppose 4r - 48 - 24 = 0. Calculate the highest common factor of r and n. 18 Let h(k) be the third derivative of k5/15 + 5k*4/8 + 2k*3 + 21k2. Let n be h(-6). Calculate the highest common divisor of 22 and n. 22 Let q = -95 - -133. Calculate the highest common divisor of q and 209. 19 Let q(a) = -a3 - 5a2 - 5a. Let o = -4 - 0. Let h be q(o). Suppose 0 = -hs + i + 46, 0 = -4i - 1 + 9. Calculate the highest common factor of s and 96. 12 Let m = -29 - -20. Suppose 2z - 7z = c + 60, z = c - 6. Let l = m - z. Calculate the highest common factor of l and 2. 2 Let f = -5 - -3. Let d be 0 + (2 - -2) + f. Suppose -2g = 4m - 188, -dm + 5g + 93 = 23. What is the highest common factor of 5 and m? 5 Let m = 490 + -194. Calculate the highest common divisor of 8 and m. 8 Let p be -803/(-6) + -1 + 0. What is the greatest common factor of 624 and p? 39 Let j(a) be the first derivative of 1/3a*3 + 3/2a*2 + 2 - 5a. Let t be j(4). Calculate the greatest common divisor of 161 and t. 23 Let j(d) = 4d2 + 3d - 42. Let q be j(6). Calculate the highest common factor of 80 and q. 40 Suppose -d = -2q - 2, -5d - 1 = -4q + 1. Let m be (-1)/q - 730/(-20). Calculate the greatest common divisor of 333 and m. 37 Let y(n) = 42n + 14. Let d be y(4). Calculate the highest common factor of d and 28. 14 Suppose -f - 16 = -3f + 4u, -4u = -5f + 34. Calculate the greatest common factor of 282 and f. 6 Suppose -5x + 15x - 770 = 0. Let f = x + -76. Calculate the greatest common factor of 4 and f. 1 Suppose 44 + 46 = -3z. Let g = -24 - z. Let r be 1 + (-1 - (-24)/2). Calculate the greatest common factor of g and r. 6 Let k(h) = -h2 - 7h + 30. Let t be k(-11). Let n = t - -37. Calculate the greatest common divisor of n and 92. 23 Let r = 90 + 6. What is the greatest common divisor of r and 6? 6 Let s(u) = 4u2 + 6u + 1. Let x be s(2). Suppose -51 = xa - 32a. Calculate the highest common divisor of a and 221. 17 Let q(y) = y*3 + 16y*2 - 27y - 32. Let f be q(-17). Let d = f - 72. Calculate the greatest common factor of d and 33. 33 Suppose 0 = -21r + 17r + 64. What is the highest common divisor of 184 and r? 8 Suppose 2m = 5t + 19, -m - 3 + 2 = t. Let d = 8 + m. Calculate the highest common divisor of 25 and d. 5 Suppose -4t + 113 + 123 = 0. What is the highest common factor of 236 and t? 59 Suppose 5n = 27 - 7. Suppose nv + 0v - 24 = 0. Let m = v - -2. What is the greatest common divisor of 20 and m? 4 Let x be (-48)/(-9) - 8/(-12). Suppose 11b = 9b + x. Let m be -1 + (26/2 - 0). What is the greatest common factor of m and b? 3 Suppose -14 + 6 = -4s. Suppose s = 2q - 2. Let g be 46-4(q + -3). What is the greatest common divisor of g and 23? 23 Let w(j) = 4j2 - 3j - 4. Let x be w(3). Let y = 21 - x. Let h be 211(-1 - y). What is the highest common factor of 21 and h? 21 Let m = 0 - 2. Let i be (-7554)/(-21) - m/7. Suppose j - i = -3j. Calculate the greatest common divisor of j and 18. 18 Suppose -n = 2n - 72. Suppose -3l = -5z + 183 + 111, -4z = -4l - 232. What is the highest common divisor of n and z? 12 Let v be 6/(-14) + (-454)/(-14). Calculate the highest common factor of v and 2. 2 Let g(a) = -a*3 + 4a*2 + 14a - 7. Let u be g(6). Suppose 0 = -5s, 5c + us - 80 = s. What is the greatest common factor of c and 24? 8 Suppose -j + 6 = 2l, -4l = -j - 0l. Suppose j = 3q - 2. Calculate the greatest common factor of q and 18. 2 Let z = -23 - -14. Let q be 2/z + 6/27. Let l be 16 + -4 + q + 4. Calculate the highest common factor of l and 16. 16 Let x(n) = 20n + 352. Let p be x(-14). What is the highest common divisor of p and 36? 36 Suppose -2l - 3i + 116 = 0, 2i + 2i + 58 = l. Let o = 106 - l. What is the highest common factor of 6 and o? 6 Let n(v) = -13v - 5. Let j be n(-2). What is the greatest common factor of j and 315? 21 Let i(j) = j2 + 2j. Let n be i(-2). Suppose nm - 3x - 448 = -4m, 0 = m + x - 105. Suppose 35 = 4o - m. What is the greatest common divisor of o and 9? 9 Let t(z) = 15z3 - 8z*2 + 3z + 12. Let s be t(3). What is the greatest common factor of s and 6? 6 Let r(k) = k*2 - 4k - 136. Let s be r(18). What is the highest common divisor of 1856 and s? 116 Let q(x) = 3x + 25. Let p be q(-10). Let y(o) = o3 + 4o*2 - 6o - 4. Let u be y(p). Calculate the highest common divisor of u and 9. 1 Suppose 6f - 295 + 91 = 0. Calculate the greatest common factor of 1887 and f. 17 Let n = -252 + 268. Calculate the greatest common divisor of 128 and n. 16 Suppose 0c + c = 30. Suppose 13 - 77 = 4j. Let v = j - -28. Calculate the highest common divisor of c and v. 6 Suppose g - 431 = -w, -2w + 1720 = -0g + 4g. Calculate the greatest common divisor of g and 78. 39 Suppose y - 37 + 27 = 0. Suppose y = -5r, -2r - 1338 = -4l + r. Calculate the greatest common divisor of l and 37. 37 Let p = 1024 + -940. What is the highest common factor of 8 and p? 4 Let d(b) = b2 + 5b + 99. Let x be d(0). Calculate the highest common factor of x and 66. 33 Suppose -5r + 4g + 498 = 0, r - g + 390 = 5r. Let q = r + 67. What is the highest common divisor of q and 15? 15 Suppose -2p + 2 + 2 = 4o, -o = 4p + 6. Let x = 2 - p. Calculate the highest common factor of x and 6. 2 Suppose -5m - 8 = -9m. Suppose d - 72 = -md. Suppose 114 = 3i + d. Calculate the highest common factor of i and 12. 6 Let d = -14 - -18. Calculate the highest common divisor of d and 74. 2 Let l(a) = -a*2 - 9a + 3. Let q be l(-8). Let t be 3/7 + q/7. Suppose -12 = j - 2p - 5, p = -tj + 11. What is the highest common divisor of j and 2? 1 Let g(z) = z + 7. Let y(s) = -s - 3. Let j(h) = 4g(h) + 10y(h). Let n be j(-2). Suppose f - 33 = -n. What is the greatest common divisor of 253 and f? 23 Let f = 122 + 41. Let k = f - 64. What is the greatest common divisor of 11 and k? 11 Let r = 186 + -128. Let b = r + -44. What is the highest common factor of b and 98? 14 Suppose -3b - 5u = -83, -2b - 2u + 82 = -4u. Calculate the greatest common divisor of b and 36. 36 Suppose -3m + 31 = -53. Let b(q) = -q*3 + 12q*2 - 5q + 74. Let z be b(12). What is the highest common divisor of z and m? 14 Let v = -7 - -15. Suppose -19t + 88 = -18t. Calculate the highest common factor of t and v. 8 Let x(v) = v*3 + 11v*2 - 48v - 24. Let n be x(-14). Suppose 0 = -0a - 2a + 12. What is the greatest common divisor of n and a? 6 Suppose -2q - 8550 = -20q. What is the greatest common divisor of q and 5? 5 Suppose 15j = 42j - 3618. What is the greatest common factor of 603 and j? 67 Let m = -66 + 75. Suppose 168 = -p + mp. Calculate the greatest common factor of p and 84. 21 Let j = -670 - -1598. What is the highest common factor of j and 64? 32 Suppose 2b + 8 = 6b. Suppose bg = -g + 42. Suppose 190 = 5s + 4d, -14 = -4s - 3d + 139. Calculate the highest common factor of s and g. 14 Suppose 3h + 10 = 8h. Suppose -b - 5f - 139 = 0, 2f + h = 4. Let c = 214 + b. What is the highest common divisor of 10 and c? 10 Suppose 5i - i - 4c - 712 = 0, 2c - 340 = -2i. Calculate the greatest common divisor of i and 1334. 58 Suppose 6l + 422 = 3092. Calculate the highest common factor of l and 10. 5 Let n(f) = -2f*3 - 121f*2 - 63f - 81. Let d be n(-60). What is the highest common factor of 66 and d? 33 Let v(a) = -3a + 8. Let q(u) = u. Let g(r) = -6q(r) - v(r). Let d(f) = 2f. Let o be d(-4). Let h be g(o). Calculate the greatest common divisor of h and 64. 16 Let k be 3 - (28 + 1)6/(-6). Let j = -58 + 74. What is the highest common factor of k and j? 16 Let t(v) = v*2 - 2v + 3. Let c be t(2). Let j(a) = 4a2 + 68a + 195. Let h be j(-3). Calculate the highest common factor of c and h. 3 Suppose -m = 4t - 3, -2t + 2m + 3 = m. Let c be 37 + 5 - (-3)/t. Let x be (-15)/(1 + -5 + 3). Calculate the highest common factor of c and x. 15 Let m(a) = 6a*2 + 45a - 51. Let d(b) = b*2 + 9b - 10. Let n(t) = -11d(t) + 2m(t). Let f be n(9). Calculat	{ "pile_set_name": "DM Mathematics" }
j/(jj(12/5)) assuming j is positive. j(-72/5) Simplify (q/(q*16q))/((q/q(2/33))/q) assuming q is positive. q(-526/33) Simplify (p/(((((pp1)/p)/p)/p)/p))(-2/3)((pp/(p/(p/((p0p)/p)p))p)/p)/p(3/8) assuming p is positive. p(5/8) Simplify (q(q/q2q)/q)/((q*6/q)/q)(q*(-4)q)/q(-6) assuming q is positive. 1/q Simplify (s(4/5))5 assuming s is positive. s4 Simplify rr(-32)rr(11/4) assuming r is positive. r(-109/4) Simplify q11/q9 assuming q is positive. q2 Simplify (r(rr(-1/3)r)/r)*10r*(-2/9)/rr9 assuming r is positive. r(220/9) Simplify (m*(-24)/m)/((m/(m/(mm*(-23))m))/mm) assuming m is positive. m(-2) Simplify (k(2/23)k(-3))/((k/k(2/19))/(k*(-5)k)) assuming k is positive. k*(-3412/437) Simplify (zz/z*(-31)zzz)/zz42 assuming z is positive. z77 Simplify (y(1/6)/y(2/9))(-34) assuming y is positive. y(17/9) Simplify ((l/(ll(-4/5)))/l(-1/2))(1/56) assuming l is positive. l(13/560) Simplify ((t/t(7/6))/t)(-9/2) assuming t is positive. t(21/4) Simplify (i/i(1/2))20 assuming i is positive. i10 Simplify r*(-3/8)r/(r/(r/(r/(rr/(r/(r/(r/r(-3)))))rr)))(r/(rr1r))/r(2/5) assuming r is positive. r(-271/40) Simplify z*(-4/5)/(((zz/z*(-26)z)/z)/z) assuming z is positive. z*(-139/5) Simplify ((dd*(-1/25)/dd)/dd)14 assuming d is positive. d(336/25) Simplify (hh*(-4/7)((h/h*(-6/7)h)/h)/h)/(h0)(1/20) assuming h is positive. h*(9/7) Simplify v(v*(-19)/v)/vvvv*(2/29)v assuming v is positive. v*(-491/29) Simplify ((uu/((u/u*(6/23))/u)u)/u)/(uuu/u24) assuming u is positive. u(535/23) Simplify (m*(-6)/(m/(mmm/(mm*(-5/4)/m))))/((m/(mm*7))/(m(m*(-4)m)/m)) assuming m is positive. m*(5/4) Simplify (d/(ddd(1/4)))32/(d/(d/d0))(-8) assuming d is positive. d(-40) Simplify ((jjjj0)/j)(-5/11)/(j(-2))(1/21) assuming j is positive. j(-188/231) Simplify i(5/2)i(-1/14) assuming i is positive. i(17/7) Simplify r(-2/5)r*(1/6)r*(-2)rrrrr/(r/((r/(r/(r/(r/r(-1/4)))))/r)) assuming r is positive. r(31/60) Simplify (a*3a)(-2/31) assuming a is positive. a(-8/31) Simplify f(-5)/(f/(f5/ff)) assuming f is positive. 1/f Simplify (f/f1)36 assuming f is positive. 1 Simplify (y7y*0)/((y/(y/(yy*(2/9))y))/(y*(-5)y)) assuming y is positive. y(25/9) Simplify (q(-9)q(-4/3))/((q/q(-5))/q(2/15)) assuming q is positive. q(-81/5) Simplify ((mmm(-2/11)m)(-2/27))18 assuming m is positive. m*(-124/33) Simplify ((a/((aaaa*2)/aa))/a)*7/((a/(aa*(-2/11))a)/(a/a(2/15))) assuming a is positive. a(-5827/165) Simplify (k(-1))12kk*8/kkkk(-6) assuming k is positive. k(-8) Simplify (f/f*(4/5)f)(2/107) assuming f is positive. f(12/535) Simplify (k(-1/5)/k)/k28 assuming k is positive. k(-146/5) Simplify ((v(-3))31)(7/9) assuming v is positive. v(-217/3) Simplify d/(d/d(-1/5))dddd*7/d(d*2/d)/(d/(d/(dd*(-4/5)dd))) assuming d is positive. d(38/5) Simplify (b(1/4))(-1/32)/(b/b1)(2/139) assuming b is positive. b(-1/128) Simplify v/((vv*(1/5))/vvv)v*(1/6)(v(1/3))(-46/5) assuming v is positive. v(-41/10) Simplify ((r(-2/43)rr)/r)(4/17) assuming r is positive. r(164/731) Simplify p/p*(11/5)p*(-2/93)p assuming p is positive. p(-103/465) Simplify ((i/(i/((((i/i1iii)/i)/i)/i))i)/i)*(-1/14)(i*(-1/4)i)(-5) assuming i is positive. i(-15/4) Simplify i/((i*(-5)ii)/i)i/(i/(i*(2/17)i)) assuming i is positive. i(104/17) Simplify (j(13/4)/j)/(((j/j*(2/5))/jj)/j) assuming j is positive. j*(53/20) Simplify v/(vv*(-13/2))v/v11 assuming v is positive. v(-7/2) Simplify mm/(mm*(-3/20))m(m0/m)/m assuming m is positive. m(3/20) Simplify i11i15/i assuming i is positive. i25 Simplify ((h(2/7))21)(-6/7) assuming h is positive. h(-36/7) Simplify (z*6z*(-1))/(((zz*3)/zz)/z(-1/5)) assuming z is positive. z(4/5) Simplify x*7x/(xx/(x/x(3/10))x)x(-1)x6 assuming x is positive. x(107/10) Simplify (s22)(7/13) assuming s is positive. s(154/13) Simplify (p5p)/(p/((ppp/p19)/p)) assuming p is positive. p(-12) Simplify (d(6/11)/d(1/2))(-20) assuming d is positive. d(-10/11) Simplify (y/y(-4))/y(-21) assuming y is positive. y26 Simplify (ww*22)/(ww/(w/w(16/5))) assuming w is positive. w(94/5) Simplify (vv(-4)vvv/(vvv5))/(v2)14 assuming v is positive. v(-35) Simplify (p/(pp/(p/(p/p(1/3))p)))(1/17)/(p(-2/7)ppp/(p(pp/(p/(pp*(-5))))/p)pppp) assuming p is positive. p(-3461/357) Simplify p(1/5)p/(p/((p*(-2)/pp)/p))(p/p0)40 assuming p is positive. p(186/5) Simplify (l(-8/5))(1/14) assuming l is positive. l(-4/35) Simplify ((f/((f(-2/15)/f)/f))/ff)/ff(-7)(f/f(-10))/(f/f9) assuming f is positive. f*(212/15) Simplify (rr(6/17))(1/3) assuming r is positive. r(23/51) Simplify (q(-34))40 assuming q is positive. q(-1360) Simplify (((r/r*2r)/r)/rr(5/4))/(r/(r(r/(r/r(2/3)))/r))41 assuming r is positive. r(-173/12) Simplify (s(-6/7)ss)(-2/11) assuming s is positive. s(-16/77) Simplify j/j*11jjjj(j/(j*16j))/jjj assuming j is positive. j*(-21) Simplify yy/(y(yy*(9/5)/y)/yy)yy/((y/((yy(1/4))/y))/y)(y(1/2))(-17) assuming y is positive. y*(-141/20) Simplify (rr*(-1)r)*(-26)/(rrr/((r/((r/(r(-1/3)r))/r))/rrr)rrr)(3/8) assuming r is positive. r(-109/4) Simplify nn*(-3/4)/n(n/n13)/n assuming n is positive. n(-55/4) Simplify m*(3/20)m(-12) assuming m is positive. m(-237/20) Simplify (r(2/9)/r)/(r/r(-5/4))r/(rrr1)r/((r*(-2)r)/r) assuming r is positive. r(-73/36) Simplify p17/p(-6) assuming p is positive. p23 Simplify ((o/(o(-2/11)/o))46)(3/31) assuming o is positive. o(3312/341) Simplify f*25/fff43 assuming f is positive. f68 Simplify (p(-1)pp)28/((p/(pp3))/(p/p3)) assuming p is positive. p29 Simplify j/j(-3)j/((jj*(-2))/j)jjj(jjj(1/2))0 assuming j is positive. j10 Simplify d(-1/24)/(dd/(d*(-12)/d)d) assuming d is positive. d(-385/24) Simplify ((n(-1))(-33))(-3/4) assuming n is positive. n(-99/4) Simplify (v(4/5)v/(v(4/7)vv))/(v(-2/3)vv/v(-6)v) assuming v is positive. v(-956/105) Simplify (q(2/11)/q(-1/3))/(q(2/5)/qq)(33/5) assuming q is positive. q(-1753/825) Simplify ((x/x7)/x(-1/17))/(xx*(1/10)/x(xx(-3))/x) assuming x is positive. x(-517/170) Simplify (g28/g)/(ggg(-1/32)) assuming g is positive. g(801/32) Simplify l27l(ll/l*(-29)l)/l assuming l is positive. l59 Simplify (r(-3/4))*(3/4)(r/r(2/11))/r(2/7) assuming r is positive. r(-37/1232) Simplify m(1/5)mm*(-8)(mm/m(-2)m)16 assuming m is positive. m(366/5) Simplify ((hh(3/4))/hhhh(-2/15)/h)/(h(-4/7)/h5) assuming h is positive. h(3019/420) Simplify v(-6)/(v(1/2)v) assuming v is positive. v(-15/2) Simplify ((b6/b)/bb*4b)/((bb2b)/b(-8)) assuming b is positive. b(-3) Simplify (cc22c)/(c*(-14)c) assuming c is positive. c37 Simplify (((j/j10)/j)/jjjj(-10/9)j)(-25) assuming j is positive. j(2050/9) Simplify j(2/27)/j0 assuming j is positive. j(2/27) Simplify ((w5)(40/7))(-41) assuming w is positive. w(-8200/7) Simplify h(-8)/(h/h*8)h(-1/5)/h(-8) assuming h is positive. h(34/5) Simplify (t(-5/4)/(tt(tt/(t(t/t*(-7))/t))/t))/((tt/(t/(tt(1/3))))/t(1/2)) assuming t is positive. t(23/12) Simplify (a/a(-1)aa)(-50)/((aa*(1/2)aa)/a(6/5)) assuming a is positive. a(-2023/10) Simplify (n/n(-2/5))(1/16)/(n/n7n/(n(n/(nn(-4)))/n)) assuming n is positive. n(727/80) Simplify (a(4/39))(4/17) assuming a is positive. a(16/663) Simplify l(-1)/l*(-1/6)l/(l/l*0)l2 assuming l is positive. l(7/6) Simplify (d*(3/2)dd/(d/d(2/11)))/(d/(d/d(-3/5))dd(-1)/dd) assuming d is positive. d*(361/110) Simplify (tt*(2/7)t)*(-45)/(ttt/(t/t(-1))t)(-31) assuming t is positive. t(-286/7) Simplify ((tt(2/23))/(t/(t*(1/10)/t))	{ "pile_set_name": "DM Mathematics" }
= 17682567b - 2. Let y(t) = -5t*2. What is a(y(h))? -88412835h*2 - 2 Let g(x) = -43x*2. Let s(v) = 84 - 255 + 3v + 75 - v + 83. What is s(g(d))? -86d2 - 13 Let c(s) = 2s*2. Let z(v) = -7 + 3v - 2 + 9. Let w(h) = -7h - 1. Let j(x) = -2w(x) - 10z(x). What is j(c(k))? -32k*2 + 2 Let u(f) = -29f. Let s(o) be the third derivative of 0 + 3/20o5 + 24o + 0o4 + 2o*2 + 0o*3. Determine s(u(n)). 7569n*2 Let t(u) = -6u*2. Suppose -5g = -2g + 12, 0 = 2m + g - 222. Let y(q) = -34q - 44q - 45q + mq. Calculate y(t(b)). 60b2 Let o(g) = g2 - 41g. Let h(p) = 3247p. Determine h(o(x)). 3247x*2 - 133127x Let q = -156 - -158. Let u(l) = -27l2 + 24l*q - 1 + 21l*2. Let d(i) = 3i. Determine u(d(k)). 162k2 - 1 Let c(p) = -23p + 8. Let f(b) = -15b + 5. Suppose 5j + 9 + 16 = 0. Let n(t) = jc(t) + 8f(t). Let r(x) = -5x + 0x + x + 0x + 7x. What is r(n(y))? -15y Let x(z) = -4z2 - 1. Let f(l) be the second derivative of -l4/6 - 36l + 5. Determine x(f(s)). -16s*4 - 1 Let t(d) = 4d*2. Let p(v) = 5844242v. Give t(p(l)). 136620658218256l2 Let h(y) = 21481y - 26. Let o(g) = 27g - 2. Give h(o(a)). 579987a - 42988 Let f(c) = -12c2 - 66. Let m(i) = -i2 + 281i. What is m(f(b))? -144b4 - 4956b*2 - 22902 Let r(z) = -2588z - 2. Let b(l) = 203 - 10l2 + 194 + 12l*2 - 397. Calculate b(r(f)). 13395488f*2 + 20704f + 8 Let h(u) = 3u. Let y(r) = -2r - 1432589. Give h(y(p)). -6p - 4297767 Let p(w) = -w3 - 16w*2 - 3w - 46. Let a be p(-16). Let l(t) = 98t2 - 23t*2 - 12t*2 + 8t*a + 126t*2. Let v(d) = -2d. Give l(v(k)). 788k2 Let s(u) = -263u. Let q(h) = -19 + 7 + 33h + 12 - 56h. Determine q(s(k)). 6049k Let c(o) = 2 - 3o - 2. Let m(i) = -7i. Let p(q) = 5c(q) - 2m(q). Let k(w) be the second derivative of w4/2 + 3466w. Give k(p(f)). 6f2 Let d(o) = 6o + o + 3o - 9o. Let s(v) = -11v2 + 5887v - 5891v + 7v*2. What is s(d(k))? -4k*2 - 4k Let x(z) be the third derivative of -3221z5/60 - 774z*2 + 2z. Let o(w) = 2w. Determine x(o(v)). -12884v2 Let c(b) be the third derivative of -b4/24 - 16b2. Let t(u) = 279u - 720 + 720 - 55u. Determine t(c(n)). -224n Let y(d) = 6d - 8d*2 - 6d. Let r(s) = 6s - 26. Let i be r(8). Let t(k) = 12 + 10 - i - k2. Give t(y(p)). -64p*4 Let n(d) = 9d*2 + 26. Let q(o) = 68970o. What is n(q(y))? 42811748100y2 + 26 Let p(c) be the third derivative of c7/2520 + 13c*5/20 + 21c*2 + 1. Let a(n) be the third derivative of p(n). Let w(m) = 81m*2. Give a(w(b)). 162b2 Let c(n) = -n2 - n + 7. Let b(z) = -6z2 - 8z + 56. Let v(d) = -b(d) + 8c(d). Let m = -7 - -15. Let h(a) = -m - 8 + 16 - 12a. What is h(v(q))? 24q2 Suppose 4z - 3 - 7 = -2u, 2u = -5z + 10. Let s(w) be the first derivative of 0w + zw2 + 34 + 14/3w*3. Let o(j) = 4j. Calculate o(s(v)). 56v2 Let w = 31627 + -31625. Let x(r) be the first derivative of -24 + 1/2r*w + 0r. Let s(y) = 13y - 2. Calculate x(s(p)). 13p - 2 Let n(q) = -7381q2. Let v(b) = b2 + 42688b + 42690b - 85378b. Determine v(n(x)). 54479161x4 Let c(j) be the first derivative of j2/2 - 4. Let r(p) = -1475 + 1475 - 3p - 35p. Determine c(r(m)). -38m Let o(c) = -31c2 - 8c - 4. Let s(y) = 4y2 - 7y - 31y2 - 21 + 18. Let n(z) = 3o(z) - 4s(z). Let u(k) = -4k. Determine n(u(h)). 240h2 - 16h Let d(n) = -55n - 11. Let b be d(-2). Let u(z) = -36 - bz*2 + 36 - 108z*2. Let p(h) = -2h. Give u(p(t)). -828t2 Let z(r) = 9r*2. Let a(x) = 7912362x. Calculate a(z(o)). 71211258o2 Let g(w) = 3w. Let o(l) = 13105669l2. What is o(g(y))? 117951021y*2 Let t(a) = 180a*2 + 66. Let s(m) = 45m*2 + 18. Let z(o) = 11s(o) - 3t(o). Let q(r) be the third derivative of r4/24 + 2r*2. What is z(q(j))? -45j*2 Let s(h) = -28h*2 - 23171136. Let q(o) = 2o. What is q(s(a))? -56a2 - 46342272 Let y(l) = l - 1387. Let o(c) = 231c - 1 + 226c + 1 - 456c. Give o(y(u)). u - 1387 Let a(q) = 20q - 4q*2 + 5q - 58q + 33q. Let l(p) = 11p2 + 33. Calculate l(a(h)). 176h*4 + 33 Let d(s) = -38s. Let n(m) be the first derivative of m*5/120 + 17m*3/3 + 2m*2 + 138. Let v(l) be the third derivative of n(l). What is d(v(g))? -38g Let z(i) = 314i. Let r(y) = -67891y*2. Calculate z(r(j)). -21317774j*2 Let t(u) = 1710u - 3675u + 1964u. Let y(a) = 91a + 69a + 14a. Calculate t(y(w)). -174w Let d = -31 + 35. Let j(y) = d - 315y - 4 + 336y. Let b(o) be the third derivative of o*5/20 - 5o*2 + 15. Give j(b(w)). 63w*2 Let j(v) = -2v. Let i(w) = -10w2 - 32. Let q(z) = -3z*2 - 10. Let o be 3 + (96/120)/((-4)/(-10)). Let t(x) = oi(x) - 16q(x). What is j(t(s))? 4s*2 Let c(y) = 28y - 4981 + 2451 + 2529. Let o(i) = -1. Let z(n) = 3n - 6. Let b(v) = 6o(v) - z(v). What is c(b(p))? -84p - 1 Let j(m) = -m2 + 5m - 6. Let a(c) = -2c2 + 6c - 7. Let k(d) = -6a(d) + 7j(d). Let g(h) = 0h - 15h - 2h2 + 0h*2 + 15h. Determine k(g(z)). 20z4 + 2z*2 Let i(j) = -2j. Let l(u) = 19833262u. What is l(i(z))? -39666524z Let o(t) = 131t. Let i(v) = -30139v*2 - 5. Calculate i(o(a)). -517215379a*2 - 5 Let v(n) = 4 - 14n + 2 - 69n - 74n - 5. Let p(x) = x*2. Calculate v(p(b)). -157b*2 + 1 Let w(t) = -2t*2. Let f(v) = -2933v - 176. Calculate f(w(s)). 5866s2 - 176 Let p(i) = 0 - 2i*2 + 0. Let c(q) = 894q - 35. Let k(b) = -225b + 9. Let t(y) = -9c(y) - 35k(y). Determine t(p(f)). 342f*2 Let q(t) = 2t*2 - 67. Let d(a) = -71 + 68 + 3 + 17a. Give q(d(m)). 578m2 - 67 Let b(j) = -6j. Let s(x) = -19778923x. Calculate s(b(w)). 118673538w Let y(z) be the second derivative of 7z4/12 + 2z. Let u(a) be the first derivative of 0a + 0a*2 - 13 + 5/3a*3. Determine y(u(o)). 175o*4 Let r be 2/(-4) - (-69)/46. Let s be ((-6)/(-3))/r - 0. Let m(v) = 20 - 33 + 19 - sv2. Let n(u) = u2. Determine m(n(a)). -2a4 + 6 Let c(a) = -21a. Let p(d) be the first derivative of -d*4/6 - 109d*2 - d - 43. Let i(h) be the second derivative of p(h). Calculate c(i(v)). 84v Let i(o) = 3o. Suppose -5x - 1 = -61. Let c be -2((-3)/2 + 2). Let s(u) = -u. Let z(h) = -9h. Let n(b) = cz(b) + xs(b). Give n(i(w)). -9w Let m(k) = 3k*2 - k - 2. Let g(z) = 2z*2 - 2z - 3. Let h(p) = -g(p) + 2m(p). Let v(x) be the first derivative of -2x*3/3 - 1. Calculate v(h(w)). -32w*4 + 16w*2 - 2 Let l(i) = 17i + 3. Let t(q) = -273q - 49. Let s(g) = -98l(g) - 6t(g). Suppose 0 = 9p - 81404 - 158977. Let d(j) = -p - j*2 + 26709. What is d(s(w))? -784w*2 Let r(i) be the first derivative of 0i - 1/3i3 - 5 + 0i*2. Let s(b) be the third derivative of -7b4/24 - b2. Determine r(s(m)). -49m2 Let a(s) = -7s*2. Let g(i) = -307662 + 307662 - 139i. Calculate g(a(c)). 973c2 Let i(w) = 13870w*2. Let k(c) = 22463c. Determine k(i(n)). 311561810n2 Let x(f) = -2f - 4. Let k(d) = -193d2 + 14. What is x(k(b))? 386b*2 - 32 Let f(k) be the second derivative of -5/6k*3 + 0k*2 + 0 - 96k. Let s(v) = 5v2. Determine s(f(h)). 125h*2 Let k(c) = 3c - c + 0c. Let o(z) = z + 3840 - 3803 - 2z + 0z + 2z. Give k(o(r)). 2r + 74 Let t(b) be the third derivative of -34b*2 + 1/12b*4 + 0 + 0b + 0b3. Let v(d) = -35d - 3. Determine t(v(f)). -70f - 6 Let t(v) = -228v*2 + 105v*2 + 121v*2. Let y(o) = 99o. Calculate t(y(k)). -19602k2 Let p(s) = 24s + 54. Let c(x) = x + 3. Let w(h) = 18c(h) - p(h). Let a(i) be the first derivative of -19i*3/3 + 56. What is w(a(t))? 114t*2 Let k(y) = -94y*2. Let z(q) = 5167q. Determine k(z(n)). -2509601566n2 Let n(q) be the first derivative of -8q*2 - 2. Let y(b) be the second derivative of -13b*4/12 - 333b + 5. What is y(n(g))? -3328g2 Let b(l) = 2l*2. Let v(h) = -9h*2. Let j(r) = 6r - 19. Let x be j(-12). Let f(s) = -403s2. Let w(c) = xv(c) + 2f(c). What is w(b(m))? 52m*4 Let x(c) = -10c. Let l(n) = -n*2 - 668n - 35. Give x(l(f)). 10f2 + 6680f + 350 Let g(n) = -4376410n2. Let b(d) = 48d*2. What is g(b(l))? -10083248640l4 Let y(n) be the first derivative of 1 - 29 + n2 - 6. Let v(t) = 10t2 - 18t*2 - 13t*2. Determine v(y(j)). -84j*2 Let b(i) = 670i*2. Let g(j) = 16594j	{ "pile_set_name": "DM Mathematics" }
588449805956. 4(u + 804433)2 Solve o5 - 81o*4 + 903o*3 + 2393o*2 - 3216o = 0 for o. -3, 0, 1, 16, 67 Find w, given that 4w3 + 42476w*2 + 932444w - 974924 = 0. -10597, -23, 1 Factor h*3/4 - 1479h*2 + 129645h/4 + 67781/2. (h - 5894)(h - 23)(h + 1)/4 Factor j*3/3 - 150j*2 - 13879j - 81466/3. (j - 529)(j + 2)(j + 77)/3 Find y such that 1458y4 - 1890y*3 + 464y*2 - 32y = 0. 0, 4/27, 1 Solve -10b4/9 - 9826b*3/9 + 29578b*2/9 + 9826b/9 - 9856/3 = 0 for b. -4928/5, -1, 1, 3 Determine d so that -2d4/9 + 4078d*3/9 + 16342d*2/9 + 1366d/3 - 2724 = 0. -3, -2, 1, 2043 Factor -4k2 + 170908k/9 + 88648/3. -4(k - 4749)(9k + 14)/9 Determine y, given that -10y*5 - 1985y*4 + 7155y*3 + 17135y*2 - 7145y - 15150 = 0. -202, -3/2, -1, 1, 5 Factor -4t2 - 459736t. -4t(t + 114934) Suppose 2y3/7 + 6474y*2/7 + 12942y/7 + 6470/7 = 0. Calculate y. -3235, -1 Factor -388131591125w2 - 11144600w - 80. -5(278615w + 4)*2 Let -2r*4/5 - 150r*3 + 4566r*2/5 - 2306r/5 - 1524 = 0. Calculate r. -381, -1, 2, 5 Factor 5h3 + 85h*2 - 1890h + 1800. 5(h - 12)(h - 1)(h + 30) Find v, given that -6v*4/5 + 942v*3/5 + 2934v*2/5 - 8478v/5 - 5184 = 0. -3, 3, 160 Factor -2m2/5 + 674284m - 284161820410. -2(m - 842855)2/5 Determine v so that -2v*4/17 + 200v*3/17 - 5770v*2/17 + 2420v - 35568/17 = 0. 1, 9, 38, 52 Determine r so that r*3 - 106r*2 + 511r - 606 = 0. 2, 3, 101 Suppose -4c3/5 + 1036c*2/5 + 632c - 4192/5 = 0. What is c? -4, 1, 262 Factor j*3 + 1525j*2 + 427047j - 124698573. (j - 173)(j + 849)2 Suppose -2h*3/7 + 338272h*2/7 - 2043404502h + 4086615708 = 0. Calculate h. 2, 84567 Factor l*3 - 117l*2/7 + 158l/7 + 2952/7. (l - 9)(l + 4)(7l - 82)/7 Suppose 3b*5/5 + 3972b*4/5 + 1294698b*3/5 - 2655732b*2 + 22657323b/5 - 10677336/5 = 0. Calculate b. -667, 1, 8 Determine v, given that -3v5 + 4002v*4 + 28107v*3 + 72354v*2 + 80436v + 32184 = 0. -2, -1, 1341 Determine r, given that -51r3 - 206799r*2/5 + 211926r/5 - 4872/5 = 0. -812, 2/85, 1 Solve -2s3/9 + 298s*2/9 + 4516s/9 + 2608/3 = 0. -12, -2, 163 Factor k*4 - 499k*3 + 82775k*2 - 4563125k. k(k - 175)2(k - 149) Factor -2t4 - 30430t*3 + 60866t*2 - 30434t. -2t(t - 1)*2(t + 15217) Determine n, given that 2n3/7 - 3504n*2/7 + 59022n/7 - 55520/7 = 0. 1, 16, 1735 Factor 2m2/11 - 4754140m/11 + 2825230892450/11. 2(m - 1188535)2/11 Solve v4 - 125v*3 + 602v*2 - 232v - 960 = 0. -1, 2, 4, 120 Suppose -2g5/9 - 34g*4/9 + 2390g*3/9 + 226g*2/9 - 5612g/3 + 1584 = 0. What is g? -44, -3, 1, 2, 27 Determine i so that -i*3 - 14i*2 + 1081i - 1066 = 0. -41, 1, 26 What is y in 3y5 - 117549y*4/2 + 288149190y*3 - 2733289791y*2 + 5751086535y + 7189776075/2 = 0? -1/2, 5, 9791 Solve r*5/3 - 239r*4/6 - 941r*3/3 - 2945r*2/6 + 1516r/3 + 1016/3 = 0. -4, -1/2, 1, 127 Solve s*2/7 + 8s/7 - 180/7 = 0. -18, 10 Factor -7p3/9 + 415p*2/9 + 1168p/9 + 620/9. -(p - 62)(p + 2)(7p + 5)/9 Let -4i*5/3 - 280i*4/3 - 5116i*3/3 - 21016i*2/3 - 31312i/3 - 15136/3 = 0. What is i? -43, -22, -2, -1 Solve 16j5 + 216j*4 + 273j*3 - 178j*2 + 24j = 0 for j. -12, -2, 0, 1/4 Find u, given that u*4/3 - 20u*3/3 - 1405u*2/3 - 13240u/3 - 3952 = 0. -19, -12, -1, 52 Find a, given that 5a3/3 - 3605a*2/3 + 28595a/3 - 17825 = 0. 3, 5, 713 Suppose -m*3/2 + 331m*2/2 - 643m/2 - 4935/2 = 0. Calculate m. -3, 5, 329 Factor 2u2/17 - 2634u/17 - 64368/17. 2(u - 1341)(u + 24)/17 Find r, given that 2r3/7 - 802r*2 + 11220r/7 = 0. 0, 2, 2805 Suppose -2z2/11 - 3844z/11 - 19170/11 = 0. Calculate z. -1917, -5 Factor 3k3/5 + 198k*2 + 4857k/5 - 1170. 3(k - 1)(k + 6)(k + 325)/5 Factor -3h*5 - 5364h*4 - 2413719h*3 - 14289858h*2. -3h*2(h + 6)(h + 891)2 Find f, given that -12f*2/7 + 4257f/7 + 1065/7 = 0. -1/4, 355 What is z in z*2/5 - 175466z/5 + 7697079289/5 = 0? 87733 Let -2w3/11 - 3108w*2/11 - 18562w/11 + 21672/11 = 0. Calculate w. -1548, -7, 1 Factor a*3/4 - 391503a*2/4 + 587251a/2 - 195750. (a - 391500)(a - 2)(a - 1)/4 Suppose -r*2/6 + 55r/3 - 875/2 = 0. Calculate r. 35, 75 Factor 4p2 + 7122440p + 3170571972100. 4(p + 890305)2 Solve -4w*5/5 - 623w*4/5 + 12069w*3/10 - 4681w*2/2 - 4625w/2 - 825/2 = 0 for w. -165, -1/2, -1/4, 5 Factor 2f2/15 + 1504f/15 - 40456/15. 2(f - 26)(f + 778)/15 Suppose 4q4 - 52q*3 - 736q*2 + 14320q - 57600 = 0. Calculate q. -16, 9, 10 What is h in -h*2 - 2153h - 15022 = 0? -2146, -7 Solve -3i2/4 + 120i = 0. 0, 160 Let -4p5 + 180p*4 - 1612p*3 - 8532p*2 - 11488p - 4752 = 0. What is p? -2, -1, 22, 27 Let -5k4 + 140k*3 - 265k*2 + 130k = 0. Calculate k. 0, 1, 26 Suppose 2l3 - 4456l*2 + 31094l = 0. Calculate l. 0, 7, 2221 Factor 3c2/2 - 849c/2 + 28815. 3(c - 170)(c - 113)/2 Factor 2r2 + 20424r + 163264. 2(r + 8)(r + 10204) Factor -2c2 + 528c + 3240. -2(c - 270)(c + 6) Factor 2d4 - 74d*3 + 242d*2 + 714d + 396. 2(d - 33)(d - 6)(d + 1)2 Factor -j2/2 - 3839j - 14737921/2. -(j + 3839)*2/2 Suppose -3h*5/7 + 105h*4 - 56568h*3/7 + 1059864h*2/7 + 23341776h/7 + 41979696/7 = 0. Calculate h. -11, -2, 86 Determine v so that v*2 - 46v - 840 = 0. -14, 60 Suppose h*3 - 21181h*2 + 42359h - 21179 = 0. Calculate h. 1, 21179 Factor 4b2 - 6191400b + 2395839622500. 4(b - 773925)2 Factor -3c*4/5 - 4383c*3 + 43842c*2/5. -3c*2(c - 2)(c + 7307)/5 Find m such that -123m*2/4 - 117m + 960 = 0. -320/41, 4 Find o such that 3072o4 - 337152o*3 + 9334512o*2 - 4604232o + 572907 = 0. 1/4, 437/8 Suppose 3k4 + 243k*3 - 8985k*2 + 65025k + 74250 = 0. Calculate k. -110, -1, 15 Suppose -276v2 + 270200v + 3916 = 0. Calculate v. -1/69, 979 Factor -2w3 - 174w*2 - 828w - 656. -2(w + 1)(w + 4)(w + 82) Factor -4c*4/7 - 24c*3 - 1364c*2/7. -4c*2(c + 11)(c + 31)/7 Solve -2k*5/3 - 42k*4 + 1008k*3 + 55224k*2 - 964224k - 3359232 = 0. -54, -3, 24 Factor -2s3/11 - 1420s*2/11 - 335650s/11 - 2401000. -2(s + 220)(s + 245)2/11 Find z such that -z4 + 186z3 - 8480z*2 - 31434z + 1461681 = 0. -13, 13, 93 Factor -t*4 - 200t*3 - 4422t*2 - 8248t - 4025. -(t + 1)*2(t + 23)(t + 175) Factor 50a*3 - 10895a*2 + 20565a - 9720. 5(a - 216)(a - 1)(10a - 9) Factor 3u2/2 - 768u - 266739/2. 3(u - 649)(u + 137)/2 Let r*4 + 381r*3 - 23812r*2 + 292020r + 1573200 = 0. Calculate r. -437, -4, 30 Suppose 2s5 + 3514s*4 + 1462388s*3 - 71320300s*2 + 786106282s + 858885458 = 0. What is s? -901, -1, 23 Factor 4v2 - 748v + 29344. 4(v - 131)(v - 56) Determine h, given that -h*2/8 - 2758h - 15213128 = 0. -11032 Let 6x5 + 363x*4 + 1218x*3 + 1203x*2 + 342x = 0. What is x? -57, -2, -1, -1/2, 0 Solve -4u4 - 244u*3 + 6248u*2 + 13440u = 0. -80, -2, 0, 21 Solve -5c3 + 180225c*2 - 1624322835c + 4871346615 = 0 for c. 3, 18021 Suppose -2b3/3 - 5596b*2 - 268174b/3 - 217828 = 0. What is b? -8378, -13, -3 Suppose -5h3/2 + 258595h*2 - 13374274805h/2 = 0. Calculate h. 0, 51719 Solve r*3/4 - 33647r*2/4 - 50475r/2 = 0. -3, 0, 33650 Solve 33n3 + 6165n*2 - 19932n + 3420 = 0 for n. -190, 2/11, 3 Find n such that 3n4 + 1167n*3 - 1170n*2 = 0. -390, 0, 1 Factor 3n*4 + 107781n*3 + 1289957967n*2 + 5133567924039n - 113563982339742. 3(n - 22)(n + 11983)*3 Factor 3l*4 - 63l*3 - 2745l*2 - 21225l - 47250. 3(l - 45)(l + 5)*2(l + 14) Find g, given that 6g2 + 271083g + 135540 = 0. -45180, -1/2 Factor c*3 - 106417c*2 + 2831410496c - 14154392180. (c - 53206)*2(c - 5) Factor 2a2 - 3734a + 135420. 2(a - 1830)(a - 37) Find j, given that -3j2/7 - 85200j/7 - 604920000/7 = 0. -14200 Factor -j*2/5 + 39268j/5 + 15708. -(j - 39270)(j + 2)/5 Factor -9y*3 - 700y*2 - 10932y + 2464. -(y + 22)(y + 56)(9y - 2) Let -3m*5 + 27m*4 + 27m*3 - 363m*2 - 360m = 0. What is m? -3, -1, 0, 5, 8 Determine n so that 2n2/5 - 2954244n/5 + 1090944701442/5 = 0. 738561 Suppose -2i2 + 409596i - 20971110402 = 0. What is i? 102399 Factor b*3/9 + 14b*2/9 - 97b/9 - 1430/9.	{ "pile_set_name": "DM Mathematics" }
r + 40. Let h(l) = -l - 8. Let t(u) = -11h(u) - 2k(u). Determine t(q(f)). 2f*2 + 8 Let x(b) = -5b. Let o(a) = 11a2 - 4a - 2. Let y be o(4). Let m(g) = 302g - 157g - yg. What is x(m(u))? 65u Let n(g) be the third derivative of -g*4/24 + 619g*2 - 1. Let r(c) = -27c*2 - 26. What is r(n(j))? -27j*2 - 26 Let p(x) = -296834x - 2x2 + 296834x. Let q(o) = 118o2. Calculate q(p(v)). 472v*4 Let u be 06/12 + 2. Let a(i) = -771i2 + 384i*2 + 388i*u. Let h(l) = -3l + 0l - 3l. Determine h(a(m)). -6m2 Let s(u) = 656 - 1974 + 19u*2 + 657 + 660. Let n(z) = 3z*2. Give n(s(h)). 1083h*4 - 114h*2 + 3 Let b(l) be the third derivative of 51l5/20 - l4/24 + 12l2. Let y(w) = 2w + 302. Let g(a) = 8a + 1359. Let q(h) = 2g(h) - 9y(h). Calculate q(b(s)). -306s*2 + 2s Let s(h) = -5h. Let o(y) be the first derivative of y4/12 + 55y + 2. Let t(r) be the first derivative of o(r). Give s(t(l)). -5l2 Let n(b) = -12b - 4. Let u(z) = -109z - 36. Let q(i) = 18n(i) - 2u(i). Let x(w) = w2 - 3. Determine q(x(g)). 2g*2 - 6 Let b(s) be the third derivative of -31s4/6 - s3/6 + 62s2 + 10s. Let m(k) = 41k2. Calculate b(m(a)). -5084a*2 - 1 Let c(n) = 586095n2. Let q(y) = y2. What is q(c(o))? 343507349025o4 Let x(u) = -23u*2 + 11u. Let c(y) = -622y. Calculate x(c(n)). -8898332n*2 - 6842n Let y(a) = -a*3 - 8a*2 - 12a + 3. Suppose -118j + 123j = -30. Let r be y(j). Let x(w) = 5w - 5w - rw. Let u(z) = 9z*2. What is u(x(i))? 81i*2 Let i(o) be the third derivative of 0o + 0o4 - 1/20o*5 + 0o*3 + 3o*2 + 8. Let s(p) = 13p*2. What is i(s(d))? -507d*4 Let q(j) = 44j*2. Suppose -16 = 3m - 2a, 12m + 11 = 11m - 5a. Let y(t) = t*2. Let g(o) = my(o) + q(o). Let r(b) = 3b2. Calculate g(r(k)). 342k*4 Let m(j) = -16j*2 + 56. Let s(n) = -25470n. Calculate m(s(u)). -10379534400u2 + 56 Let n(h) = -1004h - 22. Let x(t) = 137t + 3. Let l(a) = 6n(a) + 44x(a). Let i(s) = -2s*2 - 102s. Determine l(i(z)). -8z2 - 408z Let q(y) = -2y2 + 0y*2 + 3y2. Let u(i) be the third derivative of i5/3 - i*3/2 + 38i*2. Let o(k) be the first derivative of u(k). Give o(q(t)). 40t*2 Let f(j) = 5024608j. Let o(h) = -3h. What is f(o(y))? -15073824y Let z be 567 - ((-2)/13 + 378/91). Let a(c) = -283c + zc + 7c2 - 280c. Let p(v) = 2v2. Give a(p(f)). 28f*4 Let s(j) = 20j + 38j - 49j*2 - 478j*2 + 10j. Let u(b) = -39b2 + 5b. Let d(r) = -5s(r) + 68u(r). Let p(y) = y - y - 2y + 3y. Calculate p(d(a)). -17a2 Let v(p) = -5p + 214. Let t(r) = -2r + 93. Let c(s) = -19t(s) + 8v(s). Let d(z) = 12z. Calculate d(c(n)). -24n - 660 Let b(s) = 11577s*2 - 5800s*2 - 5775s*2. Let h(q) = 734q*2 - 2. Determine h(b(p)). 2936p*4 - 2 Let j(p) be the second derivative of 31p*3/6 + 1461p. Let d(x) = -6x + 7x + 4x. Give d(j(u)). 155u Let y(d) = -d*2. Suppose -9f = -28 + 1. Let r(j) = fj2 - 18 + 2 - 14 + 0. What is y(r(l))? -9l*4 + 180l*2 - 900 Let n(h) = 26h - 3. Let q(c) = -1035c + 120. Let x(a) = -200n(a) - 5q(a). Let r(j) = -j2 - 2j2 - j2. Calculate r(x(d)). -2500d2 Let i(o) = -2o - 16. Suppose 5d + 5 = 4s, -s = -3d + 4d + 10. Let q be (-4)/s + (-30)/(-25). Let r(j) = 4j2 + 2j*2 - 4j*q - 4j*2. What is i(r(p))? 4p*2 - 16 Let d(s) = 28s*2. Let z(f) = 1603f - 49. Determine z(d(y)). 44884y2 - 49 Let u(d) = 7778d*2 + d - 16. Let j(m) = 3m. Give u(j(z)). 70002z2 + 3z - 16 Let j(h) = -588315h2. Let g(s) = -47s*2. Determine j(g(f)). -1299587835f*4 Let l(m) be the third derivative of -1271m*4/6 + 11m*2 + m - 21. Let b(v) = -2v. What is b(l(w))? 10168w Let k(h) = -176h. Let g(q) = -10q - 36. Let v(d) = -77d - 264. Let j(w) = -22g(w) + 3v(w). Give j(k(l)). 1936l Suppose 4x + 10 + 14 = -5s, -3s = -4x + 40. Let l(p) be the second derivative of 1/6p*3 - 34p + 0 + 0p2 - 25/12p*x. Let h(u) = 2u*2. Give l(h(f)). -100f*4 + 2f2 Let g(w) be the third derivative of -w4/24 - 127w2. Let t(d) = 140d*2 - 5d + 5d + 94d*2. Give g(t(c)). -234c*2 Let o(r) = 2r*2. Let l(g) = 30g + 7. Let w(a) = 44a + 6. Let z(s) = 3l(s) - 2w(s). Determine z(o(h)). 4h*2 + 9 Let h(w) = -54889w. Let x(i) = -111i. What is h(x(r))? 6092679r Let c(a) = 46268512a - 31a*2 - 46268512a. Let d(f) = -55f2. What is c(d(q))? -93775q*4 Let w(q) be the first derivative of 5q*3/3 - 221. Let s(r) = 5r2. Let c(l) = l2. Let d(y) = 10c(y) - s(y). Calculate d(w(t)). 125t*4 Let d(y) = -17013y. Let x(m) = -2m2 - 1242m. What is d(x(t))? 34026t2 + 21130146t Let b(z) = 0z + 0z + 2z2 + 4z*2 - 13. Let s(k) = -25k*2 + 6k - 24. Let f(a) = -104a2 + 25a - 100. Let u(t) = 6f(t) - 25s(t). Calculate u(b(x)). 36x4 - 156x*2 + 169 Let h(q) = 55949 - 55949 + 131q. Let d(a) = 3a2. Calculate d(h(l)). 51483l*2 Let z = 10 + -6. Suppose zy - 4 = 4. Let f(v) = 420v - 420v + v*2 + 0v*y. Let x(g) = -39g. Calculate f(x(q)). 1521q2 Let j(y) be the second derivative of 7y*3/6 - 570y. Let d(r) = -2r - 83. Determine j(d(z)). -14z - 581 Let c(q) = 360q2 + 2q. Let v(a) = 5a. Let x(n) = -7n. Let s(w) = -5v(w) - 4x(w). Calculate s(c(f)). 1080f2 + 6f Let s(o) be the first derivative of -111 + 0o - 1/2o*2. Let c(i) = 139i*2. Calculate c(s(v)). 139v*2 Let b(d) = -7d*2 - 30d. Let r(o) = 4o2 + 12o. Let q(z) = 2b(z) + 5r(z). Let f(c) = 42c + 2. What is f(q(i))? 252i*2 + 2 Let v(w) be the second derivative of 53w*5/20 + 48w*2 - w + 142. Let t(c) be the first derivative of v(c). Let f(n) = -2n*2. Calculate f(t(j)). -50562j*4 Let z(i) = -3i*2. Let x(a) be the first derivative of -4a*3/3 + 9a*2 + 965. Calculate x(z(v)). -36v*4 - 54v*2 Let a(s) = 67s + 1. Let q(l) = -8866l. Give q(a(p)). -594022p - 8866 Let j(a) = 2a2 + 6. Let i(c) = -7027c*2. Determine j(i(q)). 98757458q*4 + 6 Suppose -4p = -10p + 6. Let x be (-2)/(-2 + p/((-14)/(-24))). Let k(m) = 3m*2 + x - 17 + 10. Let r(j) = -2j*2. Give k(r(n)). 12n4 Let s(w) = -w2. Suppose 4d + d - 150 = 0. Suppose -6k + d = -0. Let v(q) = 6q + 0q - kq - 3q. Give s(v(f)). -4f2 Let m(v) = 27934903v*2. Let l(c) = -2c. Calculate m(l(y)). 111739612y2 Let o(j) be the first derivative of 0j*2 + 0j - 1/3j3 - 25. Let u(k) = -15k + 452 - 452. Determine o(u(y)). -225y2 Let m(o) = -38o*2. Let i be (15 + -22 - -8)0. Let v(x) be the second derivative of ix2 + 0 - 22x - 1/3x3. What is m(v(n))? -152n*2 Let z(a) = 209a. Let t(w) = 1229758w. Give z(t(l)). 257019422l Let c(q) be the first derivative of -2q3/3 + 5q*2/2 + 10q - 2309. Let a(j) = -2j2. Calculate c(a(k)). -8k*4 - 10k*2 + 10 Let g(d) = 3d - d - 7 + 3d. Let z(h) = -7882h*2 + 3940h*2 + 118 + 3941h*2 - 118. Give z(g(r)). -25r*2 + 70r - 49 Suppose -4a - 3o = -1, -21 + 1 = 4o. Suppose an = -2q + 5q + 36, q + 8 = n. Let m(l) = -15l2 - nl + 12l. Let u(i) = -3i*2. Give m(u(j)). -135j*4 Let w(f) = 17 - 2f - 172 + 155. Let x(g) = 10g2 - 303g. Calculate w(x(l)). -20l2 + 606l Let l(a) = 3a + 1. Let c(g) be the second derivative of -g3/2 + 3g + 23. What is c(l(w))? -9w - 3 Let o(k) = 40k. Let i(c) = 105c + 742. Let l(w) = 7w + 49. Let j(s) = 6i(s) - 91l(s). Give o(j(b)). -280b - 280 Suppose 5s = -5u + 90, 60 = 3s - 0s + 5u. Suppose 10p - s = 5. Let o(f) = 591f*p + 0f - 595f2 + 0f. Let v(y) = -2y2. Determine o(v(g)). -16g*4 Let b(x) = -104x - 156x + 227x. Let w(i) = -2i - 1. What is w(b(r))? 66r - 1 Let y(p) be the first derivative of -3p2/2 - 5. Let m(n) = 19n - 8. Let d(f) = -76f + 36. Let t(w) = -2d(w) - 9m(w). What is y(t(c))? 57c Let i(p) = -p. Let g(h) = -15211h2 - 1547h + 1. Give i(g(q)). 15211q2 + 1547q - 1 Let z(a) = -39446535a2. Let n(j) = j. Calculate z(n(q)). -39446535q*2 Let h = 98 - 96. Let x(m) = 30m*2 - 95m*2 + 31m*2 + 33mh. Let y(g) = -g2 + 17. Determine y(x(w)). -w*4 + 17 Let y(g) = 27g*2. Let m be -1((-3)/(-3) - 19). Let b(s) = 14s - 31. Let f be b(3). Let j(d) = f + 7 - d - m. Determine y(j(o)). 27o*2 Let h(g) be the third derivative of -3g**4/	{ "pile_set_name": "DM Mathematics" }
109q + 353. Let u(a) = -7i(a) + 12l(a). Factor u(n). -2(n - 20)(n + 3) Let v = 34 - 19. Let t = -11 + v. Let -14p*3 - tp*2 - 22p*4 - 2p*5 + 0p*5 - 4p*5 + 6p*4 = 0. What is p? -1, -2/3, 0 Determine a so that 21/5a*2 + 27/5a*4 - 69/5a*3 - 48/5 + 72/5a - 3/5a5 = 0. -1, 1, 4 Let w = -178 - -182. Let a(c) be the first derivative of -c2 - 2c + 3 + 2/3c3 + 1/2cw. Let a(s) = 0. Calculate s. -1, 1 Let i(m) be the third derivative of -m5/6 + m*4 + 3m*3 + 40m*2 - 5m. Factor i(c). -2(c - 3)(5c + 3) Let j = -318/37 - -1028/111. Determine v so that -1/3v + 1/3v2 - j = 0. -1, 2 Let o be (5 + -6)/(528/(-420) - (-1)/(-7)). Let -4/7n + 1/7n2 - o = 0. What is n? -1, 5 Let v = 4903/1090 + 1/545. What is h in -33/2h + vh2 + 9 = 0? 2/3, 3 Let c(a) be the second derivative of -a7/462 + a6/330 + 3a5/220 - a4/132 - a*3/33 + 5a + 3. Suppose c(l) = 0. What is l? -1, 0, 1, 2 Suppose -3p + 3l + 0 = -3, 0 = -3p + 5l - 3. Let n(u) be the first derivative of 1/2up + 7 + 1/3u*3 + 0u*2 + 0u. Factor n(b). b*2(2b + 1) Let b = 19/31 + -287/620. Let c(r) be the first derivative of -5 + br*4 + 3/5r*3 + 0r*2 + 0r. What is n in c(n) = 0? -3, 0 Let m(k) = -2k2 - 2. Let w(z) = -z2 - z - 3. Let b be -5 - -4 - 4/(-2). Suppose -l - 5 = b. Let s(u) = lm(u) + 4w(u). Factor s(j). 4j(2j - 1) Let q(p) be the second derivative of -p5/160 - p4/24 + p3/12 + p2 - 147p - 1. Let q(s) = 0. Calculate s. -4, -2, 2 Let b(i) be the first derivative of i4/28 + 10i3/21 + i2/2 - 18i/7 + 238. Solve b(k) = 0. -9, -2, 1 Let i be 8/(-1) - (-9 - (-9 + 4)). Let d be 6/i(-2 + 0). Factor -4/13 - 32/13v2 - 14/13v*d - 22/13v. -2(v + 1)2(7v + 2)/13 Suppose 5h = -l + 11, -19 = -4l - 2h + 7. Determine d, given that 8d2 + 2d*3 - 37d + 50d - d3 + l = 0. -6, -1 Suppose 8t = 23t + 269 - 359. Factor -2/3m*3 - tm + 8/3 + 4m2. -2(m - 4)(m - 1)2/3 Find t, given that -16/17t*3 + 10/17t*4 - 2/17t*5 + 0t + 8/17t2 + 0 = 0. 0, 1, 2 Let k(f) be the first derivative of -15 + 1/10f5 - f2 + 1/12f4 - 2/3f - 1/2f3. Solve k(a) = 0 for a. -1, -2/3, 2 Let r be ((-22)/(-165))/(40/90). Let 0b - rb3 - 1/10b*4 + 0 + 0b*2 = 0. What is b? -3, 0 Determine b, given that 3b - 25b3 + 22b + 19b2 + 5b*4 - 46 - 4b*2 + 26 = 0. -1, 1, 4 Let a(i) be the first derivative of -2i*5/25 - 3i*4/10 + 16i*3/5 - 28i2/5 - 860. Let a(u) = 0. Calculate u. -7, 0, 2 Let v(j) be the first derivative of j5/5 - 7j4/4 + 5j*3/3 + 7j*2/2 - 6j - 17. Solve v(p) = 0 for p. -1, 1, 6 Let c = -1425 - -9977/7. Determine w so that -cw2 + 2/7w*3 - 2/7w*5 + 2/7w*4 + 0 + 0w = 0. -1, 0, 1 Let i(j) be the first derivative of j*6/6 - 31j*4/4 - 10j3 - 163. Factor i(l). l2(l - 6)(l + 1)(l + 5) Let d(k) = -39k*2 - 35k + 4. Let x(w) = 20w2 + 18w - 2. Let a be (-9)/(315/(-10)) - (-37)/(-7). Let q(u) = ax(u) - 3d(u). Factor q(c). (c + 1)(17c - 2) Let s(p) be the second derivative of p*4/9 + 44p*3/27 - 32p*2/9 + 36p + 2. Let s(t) = 0. What is t? -8, 2/3 What is q in 1/2q2 - 3/2q - 5 = 0? -2, 5 Suppose -2o + 21 = -5v, -6o + 2o + v = -15. Let k = o + 1. Let 574hk - 145h + 968h3 + 4 - 262h*2 + 6h*2 - 490h*5 + 28 + 17h = 0. Calculate h. -1, -2/5, 2/7, 2 Let l be (-1)/(7/14(-1 + 3)). Let d be 26/40 - ((-10)/25)/l. Let -9/4w - 2w2 - d = 0. What is w? -1, -1/8 Suppose -20o + 4i - 330 = -21o, 0 = 3o - 5i - 990. Let l be -5 - (-212)/44 - (-104)/o. Factor lf2 - 2/15 - 2/15f + 2/15f3. 2(f - 1)(f + 1)2/15 Suppose -68u + 735 = 16u + 63u. Factor 0 + 1/6tu - 2/3t*4 + 1/6t - 2/3t2 + t3. t(t - 1)*4/6 Let s(k) = k. Let j(b) = 65025b*2 + 1015b + 4. Let o(y) = 2j(y) + 10s(y). Factor o(x). 2(255x + 2)*2 Find w such that -12w*2 + 4w*2 + 0w*3 - 24w + 4w2 - 2w*4 - 2w*4 + 16w*3 = 0. -1, 0, 2, 3 Suppose -4i - 6 = -14. Find o such that 1006o + 8 + 0o*i - 1002o - o*2 - 3o*2 = 0. -1, 2 Find m such that 62/7m - 20/7 - 30/7m2 = 0. 2/5, 5/3 Let j be (0/(-4))/(23/23). Let d(g) be the second derivative of -1/15g*6 + 5/6g4 - g3 - 1/10g5 + 0 + 6g + jg2. Factor d(h). -2h(h - 1)2(h + 3) Suppose 117w3 - 61w*3 - 89w*2 + 94w + 12 - 2w2 - 44w*2 - 27w2 = 0. What is w? -3/28, 1, 2 Let h(k) be the second derivative of -k6/180 - 67k5/120 - 385k*4/24 - 121k*3/4 + k + 70. Factor h(c). -c(c + 1)(c + 33)2/6 Suppose 3v + 3u - 3 = 0, -4v + v + 17 = -4u. Suppose 3q - 12 = 4y, q = 6q + y + v. Factor -1/2h4 + qh + 0h3 + 0 + 1/2h2. -h2(h - 1)(h + 1)/2 Let 2/15v4 - 22/15v*3 - 48/5 + 8v + 44/15v2 = 0. Calculate v. -2, 1, 6 Let i(o) be the second derivative of -6o*6/35 - 6o*5/7 - 16o*4/21 + 20o*3/7 + 50o*2/7 - 68o. Determine g, given that i(g) = 0. -5/3, -1, 1 Let i = 248 + -172. Let l be i/16 - 3/(-6). Factor 15/4m2 - 3/4m*3 - lm + 9/4. -3(m - 3)(m - 1)*2/4 Let b(c) be the third derivative of -1/2c*4 - 1/20c*6 - 1/210c*7 + 0c + 0 - 2c2 - 13/60c*5 - 2/3c3. Factor b(y). -(y + 1)2(y + 2)2 Let t(x) = 8x*2 - 48x - 194. Let f(d) = -3d2 - 2d - 1. Let w(j) = f(j) + t(j). Find i, given that w(i) = 0. -3, 13 Suppose 7q - 11q + 8 = 0. Suppose -q = 2x - 2. Suppose 0y - 2/5y2 + 1/5y*5 - 3/5y*3 + 0 + xy4 = 0. Calculate y. -1, 0, 2 Let h(k) be the first derivative of -k6/18 - 13k5/30 + k4 - 19k*3/3 + 7. Let n(v) be the third derivative of h(v). Find s such that n(s) = 0. -3, 2/5 Let r(g) = g + 2 - 4g - 1 + 2g. Suppose 2c - 4 = 6c. Let u(w) = -w2 - 4w + 3. Let x(t) = cu(t) + 3r(t). Determine a, given that x(a) = 0. -1, 0 Let d(w) be the first derivative of 5w3/2 - 51w*2/4 - 81w - 408. Factor d(x). 3(x + 2)(5x - 27)/2 Let x(j) = -550j - 11547. Let q be x(-21). What is y in -9/4y2 + 0y + 0 - 3/4y4 - 3yq = 0? -3, -1, 0 Let i(r) = -r3 - 166r2 - 127r - 14. Let h(f) = f*3 + 81f*2 + 63f + 7. Let v(x) = 13h(x) + 6i(x). Factor v(d). (d + 1)(d + 7)(7d + 1) Suppose 2s = -3h + 25, 5h + 2 + 3 = 0. Let u be 32/s + (-2)/7. Let -10k4 - 40k + 8k + 6k*4 + 8 + 6k*u - 10k*4 + 32k3 = 0. What is k? -1, 2/7, 1, 2 Let r(t) be the third derivative of -t10/453600 - t*9/181440 + 13t*5/60 - 11t2. Let x(q) be the third derivative of r(q). Solve x(j) = 0 for j. -1, 0 Let k(t) = -t4 + t3 - t2. Let d(b) = b*5 + 2b*4 - 3b*3 + 2b*2. Let w(y) = d(y) + 2k(y). Determine u, given that w(u) = 0. -1, 0, 1 Let f(t) be the second derivative of 1/294t7 + 8/7t*2 - 1/12t*4 + 23/140t*5 - 3/70t*6 - 4/7t*3 + 2t + 0. Suppose f(k) = 0. Calculate k. -1, 1, 4 Factor 119p2 + 4p*3 - 16p + 16 - 243p2 + 120p*2. 4(p - 2)(p - 1)(p + 2) Let w(c) = -3c - c - 3c*2 + 10 - 9c*2 - c. Let i(x) = 11x*2 + 5x - 10. Let k(u) = 7i(u) + 6w(u). Factor k(r). 5(r - 1)(r + 2) Let r(m) be the second derivative of 45/2m2 - 2 + 1/4m*5 - 6m + 5/2m3 - 25/12m*4. Solve r(b) = 0 for b. -1, 3 Let r = 22/19 + -116/133. Solve -rq*4 + 2/7q*3 + 0q + 0q2 + 0 = 0 for q. 0, 1 Factor 190/11c + 92/11c2 + 96/11 - 2/11c*3. -2(c - 48)(c + 1)2/11 Suppose 0n - 2r = -5n + 18, -2n - 3r = -11. Factor 2s5 + 3s3 - s5 - ns3. s3(s - 1)(s + 1) Let f = -14734 + 14734. Factor -1/2q - 5/4q2 - 1/4q4 - q3 + f. -q(q + 1)2(q + 2)/4 Let h be ((96/(-9))/8)/(2/6). Let t = 9/2 + h. Factor 0 + 1/2w + tw*2. w(w + 1)/2 Let b(u) = 4u2 - 5u - 6. Let c be (4/2)/(16/(-3)). Let p be b(c). Factor 2/5f*2 - 2/5f*p + 0f + 0. -2f2(f - 1)/5 Let b(z) = -z*2 + z - 1. Let g(a) = -4a + 37. Let x be g(8). Let i(y) = 2y2 + 9y + 26. Let v(p) = xi(p) + 5b(p). Determine n so that v(n) = 0. -5 Let v(n) = 7n + 135. Let k be v(-19). Determine g, given that 0 - 1/8g + 1/8g4 - 3/8g*3 + 3/8gk = 0. 0, 1 Let w(c) be the second derivative of -c6/120 + 13c4/48 + c3/2 - c + 9. Find v, given that w(v) = 0. -3, -1, 0, 4 Let c(i) be the second derivative of -1/294i*7 + 0 + 6i - 2/7i2 + 1/12i*4 + 0i*3 - 1/70i*6 + 1/140i*5. Let c(m) = 0. What is m? -2, -1, 1 Suppose 5g*4 + 4g*4 + 127g*	{ "pile_set_name": "DM Mathematics" }
+ 1 Let m(n) = 1. Let q(l) = 0l - 1 - 1 + l + 1. Determine 3m(d) + 3q(d). 3d Let h = -2 - -7. Let s(j) be the first derivative of -j*4/2 - 4j*3/3 - 5j*2/2 + 2j - 10. Let d(n) = -3n3 - 5n*2 - 6n + 2. What is hs(o) - 4d(o)? 2o3 - o + 2 Let a(i) = 2i*3 + 4i*2 - 1. Let l(k) = -5k*3 - 11k*2 + 2. Calculate 8a(v) + 3l(v). v3 - v2 - 2 Let z = 212 + -213. Let w(i) = -i2 - 1. Let m(d) = d3 - 3d*2 - 3. Suppose -5t - c + 19 = 1, -3 = -4t + 3c. Determine tw(x) + zm(x). -x*3 Let y(m) = 6m*2 - 6m - 1. Let j(w) = -5w2 + 6w + 1. Give 5j(i) + 4y(i). -i*2 + 6i + 1 Let z be (-50)/(-6) - (-4)/6. Let t(s) = 4s2 - zs - 9 + 1 + 1. Let x(n) = -2n2 + 4n + 3. Suppose 2g = 4g + 6. What is gt(c) - 7x(c)? 2c2 - c Let p(h) = 2h - 5 + 6h - 3h. Let w = 3 - 0. Let v(y) = -21 + 9 - y + 3y + 10. Give wp(a) - 8v(a). -a + 1 Let q(r) = -21r*3 - 5r. Let z(d) = 442d3 + 104d. Determine 104q(u) + 5z(u). 26u3 Suppose -t - 1 = 4. Let z be (((-42)/(-14))/(5 - 2))/1. Let o(l) = -l2 + l + 1. Let m(y) = -3y*3 - 5y*2 + 5y + 5. Calculate to(n) + zm(n). -3n3 Let y(d) = d2 + 9d - 2. Let l(t) = 1 - 5t + 0t + t. Determine -5l(i) - 2y(i). -2i2 + 2i - 1 Let i(w) = -16w - 15. Let s(q) = 9q - 33. Let b(k) = 2k - 8. Let l(g) = 21b(g) - 5s(g). Give -2i(h) + 11l(h). -h - 3 Let c(i) = 12i + 5i2 + i + 2i - 3 - 11i. Let q(u) = -14u*2 - 11u + 9. Give 11c(j) + 4q(j). -j2 + 3 Let m(s) = s3 + 5. Let a(t) = 4. Determine 5a(n) - 4m(n). -4n3 Let w(n) = n2 - n - 1. Let v(s) = 4s*2 - 6s - 5. Suppose -31t = -34t - 9. Calculate tw(f) + v(f). f2 - 3f - 2 Let s be (2 + 0)11/2. Let b(n) = -10n*2 - 6n. Let q(z) = 2z2 + z. Suppose -5 = -4r + 3. Calculate rb(p) + sq(p). 2p2 - p Let h(z) = 2z*2 + 4. Let s(x) = -5x*2 - 7. What is 13h(i) + 6s(i)? -4i*2 + 10 Let r(a) = -2a*3 - 12a*2 - 8a - 11. Let m(s) = s*3 + 8s*2 + 5s + 7. What is 8m(l) + 5r(l)? -2l3 + 4l*2 + 1 Let i(m) = -m + 1. Let v(f) = 16f*2 + 12f - 12. Determine 12i(p) + v(p). 16p2 Let c(q) be the third derivative of q6/120 - q5/60 - q4/24 + 15q2. Let n(t) = -4t*3 + 3t*2 + 3t + 2. Give 3c(a) + n(a). -a3 + 2 Let m(s) be the third derivative of -s5/30 - s4/6 + 2s*3/3 + 3s*2 + 2. Let c(g) = -5g*2 - 7g + 7. Calculate -4c(w) + 7m(w). 6w2 Let t(s) = s - 1. Let l(o) be the second derivative of o4/4 - 7o*3/6 + 2o*2 - 41o. What is -l(p) - 5t(p)? -3p*2 + 2p + 1 Let h(o) = 1. Let n(p) = -p + 8. Let a(f) = -3f + 7. Let v(t) = 2t - 5. Let k(r) = -5a(r) - 7v(r). Let s(j) = -2k(j) - n(j). What is -6h(g) - s(g)? g + 2 Let w(i) = 7i - 9. Let h(g) = 4g - 1. Let q(d) = 4d - 2. Let r(b) = -3h(b) + 4q(b). Give 5r(m) - 3w(m). -m + 2 Let s(v) = -2v*3 + 4v*2 + 2v - 3. Let z(f) = 3f3 - 5f*2 - 2f + 4. Let h(y) = 3y - 10. Let o be h(5). Determine os(x) + 4z(x). 2x*3 + 2x + 1 Let t = -7 + 2. Let j(w) = -5w2 - 6w. Let o(d) = 4d2 + 5d. Give tj(r) - 6o(r). r*2 Let i(t) = 6t. Suppose 0 = q - 3q. Suppose 3r - 6 + q = 0. Let l(m) = rm - 3m + 2m. What is i(d) - 4l(d)? 2d Let n(d) be the third derivative of d6/30 + d5/15 + d4/6 - 5d*3/6 + 5d*2. Let v(l) = 4l*3 + 3l*2 + 3l - 4. Give -3n(x) + 4v(x). 4x3 - 1 Let f(i) = 7i*2 + 6i. Let s(t) = -8t2 - 7t. Let g be (((-6)/(-5))/(-1)-5)/(-1). Let p = 10 + -21. Let a = 4 + p. Calculate af(h) + gs(h). -h2 Let s(r) = 4r*2 - 4r + 1. Let u(t) = 7t2 - 7t + 2. Let m(c) = -7c - 1. Let p be m(1). Let x = p - 2. Calculate xs(h) + 6u(h). 2h*2 - 2h + 2 Let z(b) = 8b3 - b - 1. Let x be z(-1). Let f(n) = 1. Let p(s) = -2s - 10. What is xf(i) - p(i)? 2i + 2 Let r(t) = -3t - 8. Let i(k) = 1. Let h(f) = -4i(f) - r(f). Let b(n) = -9n - 11. Determine 3b(x) + 8h(x). -3x - 1 Let v(c) = 3c2 + 2c - 2. Suppose 4q = 5q + 4b + 25, -4b - 34 = 2q. Let t(h) = -13h*2 - 9h + 9. Give qv(l) - 2t(l). -l*2 Let o(x) = 7x - 3. Let k(h) be the second derivative of 13h3/6 - 5h*2/2 - 3h + 9. What is 3k(n) - 5o(n)? 4n Let q(v) = -9v*3 - 11v - 5. Let w(c) = -4c3 - 6c - 2. Determine -2q(k) + 5w(k). -2k3 - 8k Let r(w) = 7w - 15. Suppose -2j - j - 3a + 9 = 0, -3j = -2a + 6. Suppose 5m - m - 24 = j. Let g(d) = 2d + 6d - 4d - 8. Calculate mr(u) - 11g(u). -2u - 2 Let t(g) = 4g3 - 9g*2 + 9g + 5. Let w(f) = -2f3 + 4f*2 - 4f - 2. Suppose -p + 1 = -1. Let y(s) = s*2 - s - 1. Let l be y(-2). Give lw(d) + pt(d). -2d*3 + 2d*2 - 2d Let q(j) = -4 + j*3 - 4j*2 + j - 3j*3 + 1 - 2j. Let b(w) = 0w + 4 + 56w*2 + 2w*3 - 51w*2 + w. What is -3b(i) - 4q(i)? 2i3 + i2 + i Let f(v) = 5v3 + 2v*2 + 2v + 7. Let w(p) = 3p3 + p2 + p + 3. What is -3f(d) + 7w(d)? 6d3 + d2 + d Suppose -4y = -2y + 2. Let i(j) = 3 + 0j + 6j - j - 4j. Let o(d) = 1. What is yi(l) + 3o(l)? -l Let u(n) = n - 6. Let c(s) = -s + 3. Calculate -7c(z) - 3u(z). 4z - 3 Let t(g) = g*2 + 0 - 5 - 8g + g + 5g. Let w(o) = 2o + 4. Determine 2t(h) + 3w(h). 2h2 + 2h + 2 Let z(g) = 45g3 - 2g*2 - 2g + 5. Let t(m) = 22m3 - m2 - m + 2. Determine -5t(l) + 2z(l). -20l3 + l2 + l Let o(z) = 7z2 - 11z - 6. Let a(c) = -c*2 + 1. Calculate 6a(x) + o(x). x*2 - 11x Let t(v) = 3v2 - 4v + 10. Let r(m) = m*2 - 2m + 5. Determine -7r(s) + 3t(s). 2s2 + 2s - 5 Let a(w) = w*2 - w - 1. Let j(n) = -10n*2 + 6n + 6. Let s(g) = 2g + 3. Let x be s(-2). What is xj(b) - 6a(b)? 4b*2 Let q(g) = 7g*2 - 6g + 6. Let a(i) = -6i2 + 5i - 5. What is 6a(n) + 5q(n)? -n*2 Let q(o) = 2 - 6 - 6o*2 + 3o*3 - 2o*2 + 4o*2. Let w(n) = -3n*3 + 5n*2 + 5. What is 5q(t) + 4w(t)? 3t*3 Let x(l) = 1 - 4 + 0l + l. Let n(t) = t - 2. What is 3n(a) - 2x(a)? a Let c(o) = 6o + 7. Let p(v) = 9v + 10. Give -7c(r) + 5p(r). 3r + 1 Let v(h) = 2 + 2 - 5. Let k(a) be the third derivative of -1/3a*3 + 0a + 0 - 8a2 + 1/24a*4. What is k(j) - 3v(j)? j + 1 Let b(l) = 4l - 1. Let u(n) = 8n - 3. Give -9b(t) + 4u(t). -4t - 3 Let r(h) = h3 + 2h*2 - 5h. Let a(j) = j3 + j2 - 4j. Calculate -4a(y) + 3r(y). -y3 + 2y*2 + y Let f(n) = 10n - 5. Let t(m) = -9m + 4. What is -4f(h) - 5t(h)? 5h Let c(g) be the second derivative of g4/12 - g2/2 + 13g. Let m(a) = -8a*2 + a + 4. Give 6c(y) + m(y). -2y2 + y - 2 Let u(t) = t3 - 3t + 2. Let f = -13 - -6. Let x(b) = 4b3 - 14b + 7. Let p(r) = -r. Let z(y) = -4p(y) + x(y). What is fu(i) + 2z(i)? i3 + i Let a(d) be the third derivative of -d5/10 + 2d*3/3 - 34d*2. Let p(y) = 5y*2 - 3. Give -4a(n) - 5p(n). -n2 - 1 Let d(b) = -5b - 4. Let v(y) be the second derivative of -5/2y2 - y3 + 0 + 2y. Calculate -5d(m) + 4v(m). m Let u(z) = -3z - 8 + 3z - z. Let q(n) = n + 9. Let o(g) = 8g + 3. Let t be o(5). Suppose 3r - t = 4k, -k + 0r - r = 2. What is ku(w) - 6q(w)? w + 2 Let z(c) = c + 2. Let i(y) = -y - 2 - y + y. Suppose -2m + 6 = 0, 6 + 14 = 4b + 4m. Determine bi(k) + 3z(k). k + 2 Suppose 2c = -2c + 2b + 34, 0 = 3c - 2b - 28. Let v(s) = -s*3 + 2s*2 - 2. Let l(x) = -7x*3 + 13x*2 - 13. Calculate cl(f) - 39v(f). -3f*3 Let p(m) = -6m*3 - 5m*2 - 5m. Let d(f) = 7f3 + 6f*2 + 6f. What is -5d(t) - 6p(t)? t*3 Let n(j) = -9j*3 - 15j*2 - 17j - 6. Let h(w) = -4w3 - 7w*2 - 8w - 3. Calculate -13h(u) + 6n(u). -2u3 + u2 + 2u + 3 Let n(m) = -m*2 - m + 1. Let h(q) = 5q*2 + 7q - 7. What is 5h(y) + 35n(y)? -10y2 Let j be (-1)/(15/84) - (-18)/30. Let h(l) = -3l*3 - 7l*2 + 5l - 5. Let x(d) = -d*3 - 3d*2 + 2d - 2. Give jx(a) + 2h(a). -a3 + a2 Let r(q) = q3 + q2 - 1. Let d = -8 + 3. Let z(g) = -6g3 - 4g*2 + 5. Calculate dr(l) - z(l). l3 - l2 Let f(z) = 4z2 + 1. Let y(w) = 21w*2 + 6. Let s = 3 - 5. Let o(x) = -x + 3. Let p be o(-8). What is pf(n) + sy(n)? 2n*2 - 1 Let i = -40 - -60. Let m = -9 + i. Let h(l) = l + 4. Let q(d) = 3d + 21. Let j(k) = -2k - 21. Let s(a) = 2j(a) + 3q(a). Determine mh(g) - 2s(g). g + 2 Let g(q) = -q3 - q2. Let j(f) be the second derivative of -f3/6 + 7f*2/2 - 6f. Let y be j(8). Le	{ "pile_set_name": "DM Mathematics" }
a factor of l? True Let f(v) = v*3 - 4v*2 + 4v + 2. Let o be (-1 + 1)1/(-2). Let n be 0 + (-3 + o - -7). Is f(n) a multiple of 5? False Suppose k = 4j - 11, -12 = k + k - 3j. Let i be ((-2)/3 + 1)k. Is 15 a factor of -3(-4 - (i - -18))? False Suppose -z + 1 = 0, 4c = 2z - z - 1. Suppose -5t + 7u - 4u = -11, c = -3t + 4u. Does 4 divide t? True Let o(f) = -f*3 + 4f*2 + 12f + 2. Let h be o(6). Suppose -5r = 5l - 130, -5l = -hr - r + 70. Is r a multiple of 5? True Is 10 a factor of 27900/126 - (-5)/(35/4)? False Suppose 3u + u - 4 = 0, -3i + 145 = u. Suppose 42q - iq = -204. Does 5 divide q? False Let b = -12 + 20. Let t(o) = 7 - 2 + bo - 9o. Is t(-5) a multiple of 10? True Let j(z) = -z*3 + 14z*2 - 19z - 27. Is j(12) a multiple of 3? True Suppose -t = -3t + 1094. Suppose 127 - t = -5j. Is 12 a factor of j? True Suppose m - 867 = -4k, -4k + 0m + 858 = -2m. Does 9 divide k? True Suppose -c = -4c - 945. Is (-8)/(-3)(c/(-4) + 6) a multiple of 13? False Let i be ((-2)/2)/(4/(-16)). Suppose 0 = -3s + ih + 22, -16 = -4s - 0h + 2h. Suppose 87 = 2g - u, -2g + 0g - su + 90 = 0. Is g a multiple of 11? True Suppose -6310 = -18u + 5192. Is u a multiple of 67? False Suppose 6l - 4l - 24 = 0. Suppose lb - 900 = 96. Is b a multiple of 23? False Let k = 1164 + -644. Does 20 divide k? True Let k(c) = 62c - 42. Let r = 147 - 140. Is k(r) a multiple of 56? True Let b = 5 - -1. Let a be (-42)/(-30) - b/(-10). Suppose 0 = -5l - k + 182, -k + 2k + 77 = al. Is 15 a factor of l? False Let y = 58 + -96. Let u(b) = 6b3 + b2 + 5b - 3. Let m be u(2). Let g = m + y. Does 7 divide g? True Let v(q) be the second derivative of q7/2520 + 11q6/720 + q4/3 - 9q. Let z(w) be the third derivative of v(w). Is 29 a factor of z(-14)? False Let x = -33 + 95. Is x even? True Is (2 - 12/5) + 9060/25 a multiple of 11? False Suppose 10t - 18414 = -52t. Is t a multiple of 28? False Let b(l) = -3l*3 + 5l*2 + 6l + 13. Is 11 a factor of b(-3)? True Let f be (-354)/(-30) - (-2)/10. Let z = -10 + f. Suppose 2h = 3y - 142, -zy - 3h - 45 = -3y. Does 16 divide y? True Let y(x) be the second derivative of 7x*5/120 - 5x*4/12 + 5x*3/6 + 2x. Let i(a) be the second derivative of y(a). Is i(3) a multiple of 3? False Let z = -4 + 5. Let o be -26 - z - (-18)/9. Let k = o - -69. Is 14 a factor of k? False Let x(b) be the first derivative of 20b3/3 - 2b*2 - 10b - 13. Let y be x(-5). Suppose -26 = -n + 3h + 84, 2h - y = -4n. Is n a multiple of 28? False Let v(s) = -2s*2 + 3s - 2. Let b be v(1). Let j be b/1151. Is 3 a factor of (j/(-2))/(2/4)? True Let q(u) = -21u + 5. Let j = 15 - 8. Let o(w) = -10w + 3. Let k(p) = jo(p) - 4q(p). Is k(2) a multiple of 21? False Let s(f) be the first derivative of 43f2/2 - 12f + 48. Is 16 a factor of s(4)? True Let j = -12 - -15. Suppose -4i + j = -29. Let t = 15 - i. Is t a multiple of 3? False Let n = -12 - 5. Let d = n - -80. Is 6 a factor of d? False Let k(c) = c3 + 7c*2 - 2c - 6. Let h be k(-7). Let y(f) = -3 + hf - 16 + 4 - 3f. Is y(15) a multiple of 8? False Let u(m) = m*3 + 13m*2 + 10m + 3. Let b be u(-11). Suppose 55 = 2r - 2x - x, 5x = 5r - b. Does 26 divide r? True Let t be 39/(-2)12/(-4 - 2). Let x = t - 22. Does 4 divide x? False Let r be (2/4)/1(6 - 2). Let s(x) = -x*2 - 2 + 0 + 3x + 9x2. Is 9 a factor of s(r)? True Let r = 121 + -114. Suppose 5h = rh - 504. Is h a multiple of 36? True Suppose 1838y + 672 = 1844y. Does 15 divide y? False Let i = -69 - -39. Let b = i + 74. Is b a multiple of 4? True Let o(p) = 14p*2 - p + 3. Let t(h) = 14h*2 - h + 4. Let l(v) = -6o(v) + 7t(v). Does 32 divide l(2)? True Does 96 divide 5/(30/2879) - 4/(-24)? True Suppose 0 = 13h + 3h - 6272. Is 28 a factor of h? True Let j be (6/8)/((-10)/(-360)). Let a be 140/(-50)(6 + -1). Let o = a + j. Does 5 divide o? False Suppose 82a + 328 = 84a - 5q, 0 = -3a + 5q + 487. Is a a multiple of 6? False Let n be (-60)/212/8. Is (240/n)/((-4)/42) a multiple of 37? False Suppose 4d - 2d - 105 = -a, -5d = 20. Suppose w + 2p - 132 = -9, 0 = -w - 4p + a. Is w a multiple of 19? True Suppose -f + 0f + 221 = 0. Suppose -3a + f = -103. Is 9 a factor of a? True Let f(p) = -p3 + 25p*2 - 17p - 43. Is 25 a factor of f(24)? True Let s(x) be the first derivative of -x*3/3 + 5x*2/2 + 9x - 29. Does 3 divide s(5)? True Let m = -253 + 418. Is m a multiple of 33? True Suppose -3v + 519 = j - 571, -4393 = -4j - v. Is j a multiple of 5? False Does 47 divide (5 - 11) + 9 + 91? True Let h = 2 - -3. Suppose 19p - 20p = -244. Suppose -hf = -p + 69. Does 7 divide f? True Let x = -418 - -796. Is x a multiple of 27? True Is 12 a factor of (28/(-35))/4 + (-1831)/(-5)? False Suppose 2t = -3t - 20, 0 = -4j - 2t + 8328. Is 53 a factor of j? False Suppose 5n - 28 + 6 = -2q, q + 5n = 11. Let h(z) = z*3 - 10z*2 - 13z - 2. Let u be h(q). Is ((-23)/3)/(8/u) a multiple of 11? False Let r = 15 + -15. Suppose -2c + 5c - 42 = r. Does 14 divide c? True Let y(g) be the second derivative of -5g3/6 + 6g*2 - 5g. Is y(-6) a multiple of 14? True Let k(y) = 5 - 6y3 + 1 + 7y*3 + 1 - 13y - 10y2. Let r be k(11). Is 16 a factor of 96/r45/(-6)? True Let j = 11 - 7. Suppose -2p + j = -0p. Is 8 + -7 - (-68)/p a multiple of 11? False Suppose 0n + 4n - 12 = 3v, -3n - 5v - 20 = 0. Suppose -6 = -2m - nm. Suppose -4y - md = -63, 0d = -4y + 2d + 58. Is 4 a factor of y? False Is 53 a factor of ((-4276440)/132)/(-6) - (-18)/(-33)? False Let i = -888 + 1225. Does 9 divide i? False Let b be 428/12(10 - 12/3). Suppose 0 = -3o + 2o - 5h + 61, b = 4o + 5h. Is o a multiple of 12? False Suppose -11m = 2i - 6m - 746, 3i + 5m - 1109 = 0. Is i a multiple of 5? False Let q be (2 + -2)(0 + -1). Let r = 12 + q. Is 426/r + (-2)/(-4) a multiple of 18? True Let l = 38 + 13. Is l a multiple of 15? False Let l = -167 - -33. Let x = l - -218. Is 10 a factor of x? False Suppose 4o - 4f = 931 + 229, -4f = 2o - 604. Is 7 a factor of o? True Let l be -18 - 4 - 1 - -3. Let a(b) = -b*3 + 8b*2 + 10b - 11. Let i be a(9). Is 13 a factor of ((-510)/l)/(i/(-4))? False Suppose 155 = -2x + v - 4v, -5x + 3v - 440 = 0. Let f = 61 + x. Is 19 a factor of (f/5)/(5/(-75))? False Suppose 203 - 1316 = -q + 4s, 5s = -10. Does 13 divide q? True Suppose -g = x - 27, 0 = 2g - 4g - x + 59. Suppose -h = h - g. Does 4 divide 236/h + 6/(-8)? False Let g = 49 - 32. Suppose b - 129 = -g. Suppose -70 = -3a - 2s + 11, 4s - b = -4a. Is a a multiple of 9? False Let o = 45 - 40. Suppose 0 = v + 4f - 43, -ov + 115 = -2v - 2f. Is 13 a factor of v? True Let m = 36 - 16. Suppose 0 = 3g + l - 236, -5g - m + 390 = -3l. Does 25 divide g? False Suppose -i + 353 = r - 1, -2r - 4i = -706. Does 9 divide r? False Let w(m) = -201m + 15. Let t(r) = -50r + 4. Let u(b) = 22t(b) - 6w(b). Is 24 a factor of u(1)? False Let y(o) = -o2 - 8o. Let w be y(-8). Suppose -a + 3a - 58 = w. Suppose -4s - a = -v, -3v - 5s - 7 = -v. Is 3 a factor of v? True Let k be -12(8/(-6) + 1). Suppose ki - 10 = 54. Is i a multiple of 8? True Let d(u) = 16u3 - u2 + 2u - 2. Let g be d(2). Suppose 9p - g = 2p. Suppose pr - 208 = 14r. Is r a multiple of 7? False Let w(c) be the first derivative of -1 + 15c - 1/2c*2. Is 3 a factor of w(0)? True Let c be (360/(-64))/(-15) + 10/16. Let y be (-2)/5 + (-932)/(-5). Is ((y/3)/1)/c a multiple of 8? False Suppose 0t - 2t + 4q = -12, 5q - 20 = 0. Let z = t - 12. Suppose -zh + h = -23. Is 10 a factor of h? False Suppose -2f + 3712 = 4o, -5o + 5564 = -6f + 9f. Is 44 a factor of f? True Let b = 238 + -83. Is b a multiple of 12? False Let a = 112 + -88. Does 3 divide a? True Let h be (2 + 0/(-2))1. Suppose -hk + 78 = -k. Is 38 a factor of k? False Let k(c) = -5 + 8c - 3c2 + 2c2 - c3 + 0c2 + 7c*2. Let z be (2 + -1)/((-2)/(-10)). Is k(z) a multiple of 33? False Is ((-132)/(-55))/((-40)/(-44350)) a multiple of 25? False Let s(q) be the first derivative of 15q*2 - 4q - 18. Is 33 a factor of s(4)? False Suppose 7a + 104 = 363. Is a even? False Let d(q) = -3q - 3. Let y be d(0). Let t be (0 - (4 + y))*33. Let v = -	{ "pile_set_name": "DM Mathematics" }
- u - 5 for o. 1 Let f be (-1)/4 - 17/(-4). Suppose 7a = fa. Solve y + ay + 5z + 15 = 0, -9 = 3y + 3z for y. 0 Suppose 3l - 8 = -s, 5s + 5 = l + 3s. Suppose 3g + 2p - 5 = -0, lp - 5 = -4g. Solve -2x - 19 = -gx - 4t, 3x = 4t + 11 for x. 5 Suppose -3s - 10 + 19 = 0. Suppose -4q = -4b + 140, -2b - 2b + 140 = -sq. Solve -b = 4p - 5l, -l - 15 = -6l for p. -5 Let m = 54 + -41. Solve -l - m = s + 2s, l = -s - 5 for l. -1 Let l = 13 - 9. Suppose -lo + b = -o - 4, -12 = -4o - 2b. Let m be (-32)/12(-3)/o. Solve 6 = mk - 2k - c, 3k - 3c = 6 for k. 4 Suppose 5d = -22 + 127. Solve 0 = 5b - 0h + h + d, -3h - 15 = 3b for b. -4 Suppose 0 = -5a - 42 + 192. Suppose 0h - a = -5h. Solve -17 = 3o + 2t, 0 = o + 2t + 17 - h for o. -3 Suppose 3a + 0a = -9. Let p be 3 - (0 + -2 + a). Let y = 6 + -3. Solve 3t = h - p, 3t = t + yh - 17 for t. -1 Let o(d) = -d*3 - d - 1. Let f(j) = -2j*3 + 9j*2 - 7j - 3. Let p(n) = f(n) - o(n). Let v be p(8). Solve -3b = 5l - v, 4b + 0l - 14 = -2l for b. 3 Suppose -3g - 12 = 0, -4k + 4 = -5g - 16. Solve -3w - 2 = 2h - 2w, -h - 2w + 2 = k for h. -2 Let y(q) = 5q2 + 7q - 2. Let r(p) = -9p2 - 14p + 4. Let m(h) = 4r(h) + 7y(h). Let z be m(-7). Solve 0o + 4o + 16 = 0, 4o + 14 = zd for d. -1 Let q = -7 - -12. Suppose -qj + 14 = -1. Solve 0 = -h - 3v + 9, -4v + 4 = jh + h for h. -3 Let g be 9/2(1 + -3). Let a = 14 + g. Suppose 1 = 2q - 5, 0 = -2r - aq + 15. Solve 4w - i - 14 = r, -3i + 3 - 9 = -3w for w. 4 Suppose -2b = 4a - 96, 4b - 2a - 2a - 180 = 0. Let p = b - 28. Let o = p - 13. Solve 3h + 8 = -h - 5i, -10 = oh + 5i for h. -2 Let u be 29/6 + -1. Suppose -x + 9 = u. Solve -2n = 4i - 4n, x = -5i - n for i. -1 Suppose -7 = -2n + 15. Let m(d) = 4d + d2 - 4 + 5 - 1. Let t be m(-4). Solve t = 4p + 3j + 3 - n, -3p + 3 = 3j for p. 5 Let b(g) = -g3 + 5g*2 + 9g - 7. Let y be b(6). Let i = -17 + y. Let t = -4 - i. Solve 22 = 5a - 3j, -ta = -3a + j + 4 for a. 5 Let r(t) = 2t + 24. Let b be r(-5). Solve -5i - b = d, -3i - 13 = 2i + 2d for i. -3 Let a(d) = d3 - 7d*2 - d + 6. Let r be a(7). Let s = r + 1. Solve -t - 2k + 8 = 0, -5t = -st - 4k + 16 for t. 0 Let f(r) = r + 10. Suppose 0 = -0h + 2h + 16. Let a be f(h). Solve 0 = -4v + w - 7, -1 = -4v - w - a for v. -1 Let q be 7(4/14)/1. Let y = -1 + -2. Let x be 16/(-12)y/q. Solve xb - 10 = -4f - 0f, 5 = b + 5f for b. 5 Let h be (-41)/((-1)/(-2)). Let l be (-18)/h - 1/4. Suppose -4m + 4 = 2x, 0m + 8 = m - 3x. Solve -p - 1 = -2p - lg, -mg - 4 = 0 for p. 5 Let r(h) = -h + 11. Let v be -15 + 13 - 4-2. Let q be r(v). Solve qz = 4n + 16, -n + z + 17 = 5z for n. 1 Suppose 3t - 15 = -0t. Let o = 6 - t. Let s = 2 + 0. Solve 3r - 3 = -g + o, -sg - 4r = -4 for g. -2 Let g = 13 + -9. Suppose -gr + 14 + 12 = -z, -3 = -r + 2z. Solve -3k - 3x + 3 = 0, -r = -4k - x - 2x for k. 4 Suppose -o = -2u - 10, -2u + 98 = 3o + 2o. Solve 2t - 5g - o = 0, 5t + g + 7 = 2t for t. -1 Suppose 3t - 3v = 9, 2t + 3v = 7t - 9. Suppose t = 3x - x. Suppose -k + 4b + 2 = 5b, x = -2b. Solve 5o = -5m + 25, 7o - ko = 3m - 15 for m. 5 Let t be 3 + ((-29)/(-1) - -2). Let k be 9/12 - t/(-8). Let f(w) = 2w2 - 7w - 2. Let g be f(k). Solve 5q - g = 2s - s, 1 = -s + q for s. 2 Suppose 0q + 15 = 5q. Suppose 0k = -k. Suppose k = -g + q + 2. Solve -15 = -3b - t, 2b + b = -gt + 15 for b. 5 Let c = 1 + -1. Let k be (-2 - -1) + 0 + 6. Suppose 4r + r = 75. Solve 0p + 3x = 4p + r, c = -4p + x - k for p. 0 Suppose -f - 10 = -3f - 4s, 13 = 4f + s. Solve k + i = 2k - 9, -fk + 5i + 35 = 0 for k. 5 Suppose 0 = 6g - 3g - 9. Suppose s - 20 = -gs. Suppose 3r - 12 = 2r - 2w, -3r = sw - 33. Solve r = 2v - o, 0o = 4v + o - 12 for v. 3 Let b = -23 - -25. Solve -4u - 1 = -4f + 3, 0 = bf - 5u - 2 for f. 1 Let h(q) = 3q2. Let s = 9 - 8. Let f be h(s). Solve 3w = -fk - 0w + 6, 0 = 4k - 4w + 32 for k. -3 Let z(d) = -d*2 + 2d + 6. Let v be z(6). Let x = 25 + v. Let o = -4 - -11. Solve -2t + 2l - xl - 11 = 0, 2t + l = -o for t. -3 Suppose -2w = -s - 3s + 4, -5w - 4s + 4 = 0. Solve -5h = w, -h - 4 = -0c - 4c for c. 1 Let h = -11 + 14. Suppose -4p = -hp. Solve c + r = 6c + 20, -3c - 5r - 12 = p for c. -4 Let h = 9 - 1. Let p be 2/((h/(-5))/(-4)). Solve -pz - 21 = r - 2r, 5z = -4r - 16 for z. -4 Let k(o) = -o*2 - 6. Let r be k(0). Let z = r - -9. Solve -2 - 2 = -4u + a, zu - 5a - 20 = 0 for u. 0 Let q be (0 + 1)(19 - -2). Suppose -m + 3 = -2. Let v = -3 + m. Solve 5i + 20 = -4n + 2n, vi - 5n = q for i. -2 Let s = 11 - 8. Suppose -t + 52 = st. Suppose t = 2b - 7. Solve 5k + 2l = -2l + b, 2l + 4 = 2k for k. 2 Let q = 50 + -34. Solve -2v = -2a + q, 3v + 27 = -v + 3a for v. -3 Let d(k) = k2 + 8k - 7. Let j be d(-9). Suppose 3z + 5s = 6, 2s = -z + 7s + j. Solve 3q + p - 1 = 0, -q - 2q + 2 = zp for q. 0 Suppose -a + 5z - 4 = 0, -3a - 2z - 3z = -28. Let k(t) = 2t*2 - 6t + 9. Let j be k(a). Suppose 0 = -c - 2c + j. Solve q = 4y + c, q + y + 11 = 1 for q. -5 Let g be 2/40/2. Solve 0 = -2w + 8, 3w = -gl - l + 10 for l. -2 Suppose 4d = -p - 445, 142 = -2d - 5p - 67. Let x be (-210)/d + 2/16. Solve 3v = -0v + 2l + 14, 3l + 8 = -xv for v. 2 Let d be (-6)/515/(-2). Let t = -7 + d. Solve -5c + z - 13 - 16 = 0, 0 = -3c + tz - 23 for c. -5 Let u(s) = s*3 - 8s*2 + 7s + 1. Let y be u(7). Let w be y - -1 - (5 - 3). Solve 0 = -3t + 5k + 17, w = t + 5k + 28 - 7 for t. -1 Let l(c) = c + 11. Suppose -3 - 9 = 3s + 3a, -5s - 2a - 32 = 0. Let n be l(s). Solve nr = t, -4t = -0r + 3r + 15 for t. -3 Let n be 11 + 12/(-4) - -4. Let s = n - 4. Solve 4l = 3u - su, 4l - 5u = 0 for l. 0 Let r = 12 - 6. Suppose 4n - 11 = 13. Let c = n - 2. Solve -r = 2a - 0a - 4x, -4x - c = 0 for a. -5 Let l = 8 - 4. Solve -2w + lq + 16 = 0, -q = 2w - 0q + 4 for w. 0 Let s(m) = -4 - 1 - 3m*3 + 2m - 8m2 - 4m + 2m3. Let n be s(-8). Solve -3a - 7v = -3v + 23, -a - n = 2v for a. -1 Let x be 1 + 1 + (-9 - -7). Solve -3n + 13 = -f, -2n = 2f - xf + 2 for f. -4 Suppose 0 = q + 4r + 22, 3 - 8 = r. Suppose 3g - 3 = 0, -2p + g = -3g - 4. Let d be (q + p/5)-10. Solve -4a - 3n - 21 = 0, -d = 3a + 2a - n for a. -3 Suppose w + 2w = 12. Solve -c = wc - 2z - 31, -3c - 3z = -6 for c. 5 Suppose -2g = -14 - 22. Solve -3r = -3f - g, -2 = -2f - 3r + 1 for f. -3 Let h(b) = -b*2 + 7b - 2. Let n be h(6). Suppose 3p + n = 4m - 3m, 4m + 3p = 46. Solve 5s - c + 2c + 25 = 0, -2c - m = 0 for s. -4 Let w be (-9)/2(3 + -5). Let b = 21 - 30. Let k be 8 + 1/((-3)/b). Solve 0o - 2o - 3t = k, 0 = o + 5t + w for o. -4 Let d be -2 + (-5)/(25/(-20)). Solve w + 12 = df, 2w - 23 = -5f + w for f. 5 Suppose -a + 12 = 2a, 0 = y - 5a + 8. Solve 5v = 5h - 10, -5v + 4h - y = -0v for v. -4 Suppose -w - 3z = 2w - 36, 5w - 57 = -2z. Solve -9 = -4v + w, 0 = -3f - v + 20 for f. 5 Let r = 7 - 7. Let f be (-36 - r)4/(-6). Solve -4g = 4j, -3g + g = -4j - f for j. -4 Let i(m) = 2m + 5m - 6m - 2. Let n be i(2). Suppose ny = -y. Solve -3j + 4l + 20 = -yl, 4j + 25 = -5l for j. 0 Suppose -4i - 4t + 10 = -18, 4i + 3t - 31 = 0. Let c = i - 5. Solve cm + 1 + 9 = p, 0 = 4p + 3m + 6 for p. 0 Let u = 8 - 7. Suppose -26 = 3y - 122. Let s be (1/(-2))/((-4)/y). Solve st - f + 5 = 4f, 2t + u = f for t. 0 Let j be ((-5)/(-2))/(((-2)/12)/(-1)). Solve t - 2b = -0t + j, 4t + 2b - 10 = 0 for t. 5 Let r(a) = a*2 + 6a + 3. Let w be r(-6). Let y = -7 + 13. Solve -m + wk = -3, 0 = ym - m + k - 15 for m. 3 Let a(x) = -x + 9. Let g be a(-8). Solve 3b + 2b - 3q + 30 = 0, -q = -4b - g for b. -3 Suppose -2u + 0u - 4b - 4 = 0, 2u - 4b = 4. Suppose t = -4s + 19, u = s - t - 1. Let x = s + 3. Solve 2k = -2f + 8, -x = -3k + 3f - f for k. 3 Let n(z) = -z*2 - 5z + 5. Suppose -j = -5 + 3. Suppose -4 = jk + 4. Let u be n(k). Solve -2m + 7m + u = 4q, 0 = q + 4m + 24 for q. -4 Suppose 0 = 3t + 4u - 18, 2t + 4u = -2t + 20. Solve -7 = 3q - 5w, 8q - 3q + 22 = -tw for q. -4 Let k be -3(8/(-6) - 4). Solve -h = -5p + k, -p + 3p - 11 = 5*h for p. 3 Let r	{ "pile_set_name": "DM Mathematics" }
ate r(y). 2 Let j(a) = a - 6. Suppose -15x - 5x = 17440. Let i = x - -877. What is j(i)? -1 Let h(r) = 7r3 - 16r*2 - 2r + 11. Let d(t) = 8t3 - 15t*2 + 10. Let a(c) = 5d(c) - 6h(c). Give a(11). -5 Let k(p) = -p3 + 18p*2 + 20p - 9. Let o be (157)/((-15)/6 - 220/(-40)). Calculate k(o). 10 Let w(r) = 2r - 8 + 4r - 3r - 2r. Let c(j) be the third derivative of j6/60 + 7j*5/20 - 5j*4/12 + 17j*3/6 - 75j*2. Let a be c(-11). Give w(a). -2 Let k be (3 - (-55)/(-20))(-8)/(-2). Let q(r) = 13r2 - 18r + 18. Determine q(k). 13 Let y be 2/13 + 873/2522 - (-2)/(-4). Let w(n) = 2n2 - 6n + 5. Determine w(y). 5 Suppose 1 = u, -5u = -4w - 211 + 254. Let p(n) = n*3 - 12n*2 + n - 9. Calculate p(w). 3 Let u(t) = 31t - 251. Let i be u(8). Let o(q) = -q*3 - 2q*2 + 4q - 7. Determine o(i). -10 Let j(b) = -10552199b3 - 4 + 10552200b*3 - 5b - b*2 + 4b*2. Let s be (-3 - -1)2/1. What is j(s)? 0 Let f(c) = -c*3 - 31c*2 - 85c - 42. Let s be f(-28). Let r(p) = -p*2 - 23p - 121. What is r(s)? 5 Let s(k) = k*3 + 14k*2 + 10k - 11. Let x be s(-13). Let a(b) = 7 + xb + b2 - 12b - 12b. Calculate a(-4). 7 Let a be 47 - 46 - 82/1. Let u(x) = x*3 + 15x*2 - 4x - 46. Determine u(a). 14 Let n be -318 + 1/(4/(-16)). Let o = -63 - n. Let d(i) = 6 - 51i*3 - 4i - 6i2 + 26i*3 + 24i3. Give d(o). 1 Let f(l) be the second derivative of l5/20 + l4/3 - l3/2 - 2l2 - 828l. Let n(a) = -a - 4. Let h be n(-2). Let m be 3/6 - (-9)/h. What is f(m)? 8 Let w = 829 + -825. Suppose 0 = wz - 4k + 28, 0 = -z + k - 2k - 3. Let t(a) = a2 + 2a - 3. Calculate t(z). 12 Let z = 4 + -4. Suppose 3x = -2a - 2 + 16, 4a - 16 = 0. Let j(p) = 5 + 11p - 1 - 7p - 5p - px. What is j(z)? 4 Let n(v) = v2 - 4v - 4. Let q = -544 + 278. Let d = 271 + q. What is n(d)? 1 Let p(r) = r3 - 5r*2 + 4r - 3. Let s(g) = -g - 33. Suppose 3a + 28 + 83 = 0. Let w be s(a). Give p(w). -3 Let c = 3/1343 - -3969/26860. Let u(w) be the second derivative of cw*5 + 0w*3 + 0w*2 + 0w*4 + 12w + 0. Determine u(1). 3 Let p be 4/(((-42)/10 - -4)-10). Let n(g) = 4g*p - 118g*3 + 2g*2 + g - 3g*2 + 59g*3 + 60g*3. Let b be (-6 - -3)(1 + 0). Determine n(b). -3 Let f(l) be the first derivative of -2l3/3 + 17l*2 + 6l - 59. Let g be f(17). Let r(k) = -k - k*3 + 2 + k + 6k*2. Give r(g). 2 Let x(q) = -51 - 22 + 32 + 1 - 12q - q. Calculate x(0). -40 Let k(i) = 45i + 218. Let j(o) = 10o + 165. Let a be j(-17). Determine k(a). -7 Suppose 4y = 4k + 9y - 15, -k + 5y - 15 = 0. Let w(s) = -3 - 4s3 + 3s*3 - 36s*2 + k + 44s*2. Let f = -13 - -21. Determine w(f). -3 Let c(r) = -23r + 296. Let z be c(33). Let d = -468 - z. Let a(s) = -3s + 2s*2 - 3s*2 - 3s. Give a(d). 5 Let v(p) = 13p - 28. Let n be (-20 - 150/(-12)) + (-1)/2. Determine v(n). -132 Let i(b) = 8b + 2b + 833644 - 833642. What is i(-13)? -128 Let u(f) = 22f - 13. Let j be u(2). Let l be 4/(-3)186/j. Let y(m) = -m - 9. What is y(l)? -1 Let d(c) = 0c3 - c3 - 43c - 11 - 3c*2 - 14c + 54c. Calculate d(-3). -2 Suppose 4y - 3g = 254, 11g = 5y + 14g - 331. Suppose yh - 81 = 56h. Let k(f) = f - 3. What is k(h)? 6 Let p(y) = -5y2 - y + 4. Let q(a) = 2. Let t(b) = 6b*2 + b - 16. Let c(d) = 6q(d) + t(d). Let z(w) = -4c(w) - 5p(w). What is z(0)? -4 Let c(u) = 13u2 - 10u + 245. Let p(s) = 15s2 - 11s + 287. Let a(l) = 7c(l) - 6p(l). Calculate a(3). -10 Let c = -286 - -351. Let y(g) = 1 - 1 - cg + 72g. What is y(-2)? -14 Let p(k) = -k3 - k2 + k. Suppose -3714m = -3713m - 1. Determine p(m). -1 Let k(w) = 4955w2 + 4943w*2 - 9904w*2 - 1 + 9w. Determine k(2). -7 Let c(v) = -23v - 163. Let p(q) = -8q - 56. Let u(i) = 4c(i) - 11p(i). Give u(-18). 36 Let j(f) = 11f + 141. Let r(b) = -78b - 976. Let k(s) = -15j(s) - 2r(s). What is k(-19)? 8 Let x be 26 - (46 + (-442)/26). Let j(v) be the second derivative of 7v3/6 + v2/2 + 2v. Determine j(x). -20 Let k(a) = a + 19. Let p be (10 - 1)/((-18)/12)-1. Suppose -98 = py - 20. What is k(y)? 6 Let o(f) = -f*2 - 12f - 10. Let s(a) = 2a2 + 23a + 20. Let z(x) = -5o(x) - 3s(x). Suppose -5n + k + 36 = -8n, -5k = 4n + 81. Determine z(n). -10 Let c be (1 - 2)5 - 0. Let r(g) be the third derivative of 0 + 0g - 5/24g4 + 0g*3 - 74g*2 - 1/60g5. Give r(c). 0 Let c(a) = a - 3. Let p(h) = -h2 - 14h + 38. Let f be p(-18). Let k = f + 38. Determine c(k). 1 Let w(q) be the first derivative of q4/4 - 8q*3/3 - 9q*2/2 + 5q - 721. Calculate w(9). 5 Let j(g) = -g - 1. Let a(y) = -y*2 + 9y - 9. Let s be a(3). Suppose s = -349p + 352p. Calculate j(p). -4 Let y = -37 + 39. Let i(k) = -6 + 1 - yk - 6 + 0k. Let o be i(-8). Let g(t) = t*2 - 7t - 4. What is g(o)? -14 Let m(t) = -3t2 + 8t + 4. Let v be ((-840)/20 - -54)/((-2)/((-4)/6)). Calculate m(v). -12 Let b(k) = 3k2 + 15k*3 - 36k*3 + 20k*3 + 4k*2 - 6. Give b(9). -168 Let b(j) = -18j - 20. Let x be b(-6). Let t = x + -86. Let f(u) = -2 + 9ut - 10 + u3 + 11 - u. Give f(-9). 8 Suppose -42v - 2178 = -2430. Let y(z) = -z*3 + 7z*2 - 7z. Let m(n) = 1. Let q(g) = 1. Let c(s) = 5m(s) - 4q(s). Let j(a) = -6c(a) - y(a). Give j(v). 0 Let s(o) = -3162 + 1582 + 1587. Let b(k) = 2k*2 + k + 23. Let m(y) = -b(y) + 3s(y). Determine m(3). -23 Let j(d) = -20d3 - d2 - 2d. Let q be (-81)/54 - (-4)/8. Determine j(q). 21 Let l(q) = 12q2 + 2q - 7. Let c(m) = -17m2 - 3m + 11. Let i(z) = -5c(z) - 7l(z). Determine i(-3). 0 Let y(u) be the second derivative of u*5/20 - 17u*4/12 - 17u*3/6 - 33u*2/2 + 598u. Give y(18). -15 Let x = 2087 - 2084. Let f(g) be the first derivative of -g*2/2 + 2g + 22. Give f(x). -1 Let f(i) = -i*3 - 7i*2 - 9i + 1. Suppose 0 = -4t + 6w - w - 1, 0 = 2t - 4w + 8. Suppose tp + 83 - 53 = 0. What is f(p)? -4 Suppose -39n + 6443 = -22n. Let r = 382 - n. Let a(j) = j2 - 4. Give a(r). 5 Let w(l) = 15l - 63. Let g(u) = -2u + 9. Let c(m) = -42g(m) - 6w(m). Suppose -5 = -x - 4. Determine c(x). -6 Let m(y) = 45y*2. Let w be m(1). Suppose -p + 5o + 29 = 0, 9p - 5o = 4p + w. Let f(z) = -2z + 1. Determine f(p). -7 Suppose 71x + 31x - 171 = 33. Let r(a) = 9a3 + 2a*2 - 2a + 3. Calculate r(x). 79 Let k be (-6 + (-402)/(-30) + -7)/((-1)/(-5)). Let y(v) be the first derivative of 31 - kv - v2 - 1/3v*3. Give y(-3). -5 Let q(i) = 2i*3 + 14i*2 - i - 5. Let d be q(-7). Suppose 5o = do + 6. Let c(f) = 565 - 573 + of - 3f. Calculate c(-5). -3 Let g(n) = -36n*2 - 25n - 103. Let i(z) = -43z2 - 26z - 105. Let k(u) = -6g(u) + 5i(u). Determine k(-8). -3 Let k(f) = 4f3 - 9f*2 + 5f - 5. Suppose 0 = -3q + 3, 4q + 16 = -a - 3a. Let b(z) = 3z*3 - 8z*2 + 4z - 4. Let w(j) = ab(j) + 4k(j). Give w(-4). 0 Let w(b) = -b*2 + 2b - 6. Let h(l) = l*2 - l + 4. Let s(v) = -8h(v) - 5w(v). Let y(x) = 2x*2 - 33x + 134. Let t be y(8). Determine s(t). -10 Let y = 353 - 353. Let r(f) = -4f - 30 - 5f2 + f3 + 3f + 29 + yf. Determine r(3). -22 Let c be (-1)/2 - (-3)/(-2). Let u = 5 - c. Let d(m) = -78m - 16 - 32m + 50m + 3 + 61m. Calculate d(u). -6 Let a(z) be the first derivative of -17z2/2 - 19z + 366. What is a(4)? -87 Let r(d) = -5d2 - 10d - 16. Let a(i) = 37i - 1186. Let o be a(32). Calculate r(o). -16 Let o(u) be the third derivative of -u4/12 - 5u*3/3 + 231u*2. Let q = 4 - -1. Suppose qm - p + 41 = 0, -5m + 2p + 3p - 45 = 0. Determine o(m). 6 Let f(m) = 3m*2 - 21m - 7. Let l(q) = 16q2 - 106q - 48. Let j(t) = -11f(t) + 2l(t). Give j(15). 41 Let k(s) be the first derivative of s*4/4 - 2s*3/3 - 2s*2 + 2s + 27. Let p be 2 - (2 + 16/(-4)). Let d be 0 + p - (-14 + 15). Determine k(d). -1 Let f(v) = 40v + 53. Let b(c) = 241c + 340. Let o(g) = 2b(g) - 13f(g). Determine o(-2). 67 Let p = -34 - -27. Let z = 20 + p. Suppose -9m + z + 14 = 0. Let d(q) = -q2 + q + 4. Give d(m). -2 Let q(g) = 13g - 96. Let k = -2281 - -2289. What is q(k)? 8 Let z = 1909 - 1342. Let t = z + -569. Let p(l) = 3l2 + 4l + 3. Calculate p(t). 7 Let i = -35252 - -35269. Let y(a) = a*2 - 13a - 24. Give y(i). 44 Let o(i) = i3 + i2 - 6i - 10. Suppose -156g = 4c - 158g + 4	{ "pile_set_name": "DM Mathematics" }
3n + 1. Let k(m) = -9m*3 - 9m*2 + 5m + 1. Give xr(i) + 3k(i). -2i3 - 2i*2 - 2 Let t(j) = 10j - 91. Let y(v) = 2v + 3. Give t(o) - 4y(o). 2o - 103 Let k(j) = 9j - 10. Let i(p) = -p*2 - 6p + 12. Let c be i(-7). Suppose -s - 2h + 4 = 0, 2h + 21 = cs - 11. Let w(m) = 4m - 5. Calculate sk(y) - 13w(y). 2y + 5 Let i(k) = -4k*2 - 3k + 2. Let y(q) = 2q2 + 3q - 3. Give 3i(g) + 2y(g). -8g2 - 3g Let l(g) be the first derivative of 14g3/3 + 17g*2/2 + 4g + 78. Let u(c) = -5c2 - 6c - 1. Calculate -4l(a) - 11u(a). -a*2 - 2a - 5 Let g(a) = 30a3 + 22a*2 + 74a - 8. Let c(w) = 20w3 + 14w*2 + 49w - 5. Calculate -8c(q) + 5g(q). -10q3 - 2q*2 - 22q Let c(p) = -p*2 - 2p + 3. Let b(k) = k*3 + 18k*2 - 2k - 34. Let o be b(-18). Let u(q) = -315q2 + 16 + 310q*o + 0q - 11q. Give 11c(t) - 2u(t). -t2 + 1 Suppose 5i - i + 7 = 5s, -12 = 3i + 3s. Let h(o) = -3. Let g(a) be the first derivative of a2/2 + 2a - 7. Give ig(c) - 2h(c). -3c Let i(w) = -11w - 69. Let f(x) = -5x - 35. Determine -13f(d) + 6i(d). -d + 41 Let s(h) = 8h*3 - 9h*2 + 9h - 10. Suppose -87 = -9r + 75. Let k(l) = l3 - l2 + l - 1. Determine rk(j) - 2s(j). 2j*3 + 2 Let x(g) = -4g + 2. Let m(h) = -21h + 11. Let v = -305 + 303. Let k(z) = -11z. Let f be k(-1). Determine fx(l) + vm(l). -2l Let o(y) = 159y*2 - 26y. Let q(f) = 32f2 - 5f. Calculate 2o(d) - 11q(d). -34d2 + 3d Let k(f) = -f*2 - 2f + 2. Let o(b) = 896b2 + 1344b - 1344. What is -672k(s) - o(s)? -224s*2 Let q(v) = -2v*3 + 6v*2 - 11v. Let h(p) = -2p3 + 5p*2 - 11p. What is -5h(n) + 4q(n)? 2n3 - n2 + 11n Let i(v) = 8v3 - 4v*2 + 6v - 6. Let t(y) = y + 4y2 - 3y - 3y + 0 - 5y*3 + 5 - 2y*3. Calculate 5i(u) + 6t(u). -2u*3 + 4u*2 Let s(t) = -4t + 9. Suppose -15 = -b - 3q, q = b + 4b - 11. Let o(j) be the first derivative of -b - 2j + 4j + 4j - j2 - 2j. What is -5o(v) + 2s(v)? 2v - 2 Let d(a) = 413a + 3. Let h(s) = s + 1. Determine -2d(m) + 6h(m). -820m Let f(n) = -n. Let a(x) be the second derivative of x4/12 - 7x*3/6 - 5x*2/2 + 18x. Let u(g) = 1. Let o(h) = a(h) + 5u(h). What is -6f(c) + o(c)? c*2 - c Let d(b) = -14b - 23. Let g(v) = 42v + 69. Let x(s) = -11d(s) - 4g(s). Let k = 48 - 42. Let j(h) = 5h + 8. Calculate kx(r) + 17j(r). r - 2 Let i be 31/(-5) - 4/5. Let u = 12 + i. Suppose 4t + 21 - u = 0. Let k(b) = -2b*3 - 4b*2. Let g(f) = 4f*3 + 9f*2. What is tg(v) - 9k(v)? 2v*3 Let c(x) = 2x - 3. Let t(k) = -48k + 9. Let u(o) = 89o - 18. Let l(d) = -11t(d) - 6u(d). Calculate 8c(v) + 3l(v). -2v + 3 Let t(a) = -2a*2 - 3a - 3. Let s(j) be the first derivative of -6j3 - 13j*2 - 26j - 48. What is 6s(h) - 52t(h)? -4h2 Let j(o) = -331o*2 + 2o + 2. Let x(l) = 489881l2 - 2961l - 2961. Calculate -2961j(t) - 2x(t). 329t2 Let k(z) = 1. Let h(l) be the second derivative of l4/24 - 9l*2/2 - 20l. Let x(p) be the first derivative of h(p). Calculate -2k(a) + x(a). a - 2 Let t(c) = -474c - 21. Let l(p) = -711p - 29. What is 5l(y) - 7t(y)? -237y + 2 Let n(q) = 3q3 + 4q + 6. Let x = -711 + 700. Let g be ((-2)/(-4))/((-2)/(-32)). Let y(b) = b*2 - gb3 - b2 - 17 - 11b. Determine xn(w) - 4y(w). -w3 + 2 Let l(z) = -13z + 6. Suppose 0 = -4j - 2 - 22. Let m(p) = -p + 1. Give jm(y) + l(y). -7y Let a(i) = 39i*3 - 7i*2 - 12. Let v(p) = 13p*3 - 2p*2 - 4. Give 2a(r) - 7v(r). -13r*3 + 4 Let h(k) = 6k*2 + 2k + 3. Let q(b) = 2. What is h(n) - 3q(n)? 6n*2 + 2n - 3 Let t(u) = 0u + 6u + 1 - 8u. Let a(k) = 1. Suppose -4c = -0 - 8, -5o = -c - 8. Give oa(y) - t(y). 2y + 1 Let d(k) = -k3 - 431k*2 - k. Let u(s) = -2s*3 - 863s*2 - 2s. Determine -13d(m) + 6u(m). m*3 + 425m*2 + m Let u(p) = -p + 1. Let k be (-148)/(-16) + 18/24. Suppose 5z + 25 = kz. Let c(m) = -7m + 4. Give zu(n) - c(n). 2n + 1 Let x(m) = -2m3 - m2 + 1. Let n(w) = 3w*3 + 3w*2 - 340. Calculate -n(p) - 3x(p). 3p3 + 337 Suppose 0 = -31n + 74n - 32n - 22. Let t(r) = -3r + 2. Let w(u) be the second derivative of -7u*3/6 + 5u*2/2 + u. What is nw(j) - 5t(j)? j Let n(g) = 4g*3 + 5g - 15. Let h(z) = z*3 + z - 3. Let a(k) = -5h(k) + n(k). Let b(m) = -m. Calculate 2a(c) - b(c). -2c3 + c Let w(u) be the first derivative of -u4/12 - u*3/3 - 20u - 2. Let i(z) be the first derivative of w(z). Let k(c) = -c*2 - 5c. Determine -5i(b) + 2k(b). 3b2 Let w(g) = -2g*2 - g - 4. Let a = -2 - -7. Let m(r) be the second derivative of 1/6r*4 + 0 + 12r + 5/2r2 + 1/6r*3. Determine aw(t) + 4m(t). -2t2 - t Let w(c) = c3 + 2c2 + c. Let m(v) = -5v*3 - 12v*2 - 6v + 111. Calculate -m(o) - 6w(o). -o3 - 111 Suppose s - 5m = 4 - 26, -s + 2m - 19 = 0. Let f(y) = -41y + 17. Let u(h) = 14h - 6. Determine su(r) - 6f(r). 8r Let r(z) = 3z - 21. Let b(j) be the second derivative of -j3/6 + 5j*2/2 - 5j - 7. What is 9b(d) + 2r(d)? -3d + 3 Let i(p) = 11p + 107. Let v(s) = 19s + 215. Give 7i(f) - 4v(f). f - 111 Let i(t) = 287t*3 - 56t2 - 28. Let z(f) = -f3 + 2f2 + 1. Calculate i(g) + 28z(g). 259g3 Let w(u) = -606u + 1. Let v(p) = -1820p + 3. Determine 3v(l) - 8w(l). -612l + 1 Let f(w) = -22w - 257. Let u(z) = 10z + 129. Calculate -4f(r) - 9u(r). -2r - 133 Let k(u) = -u3 + 11u*2 - 3u - 1. Let h(q) = -2q2 + q - 3. What is -4h(i) - k(i)? i*3 - 3i*2 - i + 13 Let j(h) = 703h + 4. Let z(u) = -712u - 5. Determine -3j(r) - 2z(r). -685r - 2 Let q(b) = 9b - 4. Let g(d) = 19d + 33d - 9d + 70d - 14d - 45. Determine -4g(u) + 45q(u). 9u Let j(l) = 1159l - 7. Let c(b) = -586b + 4. Determine 10c(o) + 6j(o). 1094o - 2 Let u(v) be the first derivative of v4/4 + v3/6 - 5v2 - 20. Let g(a) be the second derivative of u(a). Let n(c) = 2c. Determine 4g(j) - 11n(j). 2j + 4 Let m(u) = 47u + 1. Let z(i) = 234i + 5. What is -11m(n) + 2z(n)? -49n - 1 Let v(o) = -2o2. Let z(p) = 5p*2 + 3. Let c(r) = -9r*2 - 5. Let f(x) = 3c(x) + 5z(x). What is -3f(l) + 2v(l)? 2l*2 Let p(d) = -3d*2 - 6d + 6. Let t(w) = 2w2 + 5w - 5. Let z be 6/((-9)/(-30)5). Let a = z + -1. Determine ap(s) + 4t(s). -s2 + 2s - 2 Suppose -3w + 4q - 10 = -5w, -3w - 2q = -19. Let x(g) = 9g - 9. Let a(n) = -8n + 8. Let z(k) = 0 - k - 1 - 1 + 5k. Let b be z(2). Give bx(d) + wa(d). -2d + 2 Let n(f) be the third derivative of -f4/24 - f3/2 - 76f*2. Let u(v) = -v + 1. Determine n(g) + 3u(g). -4g Suppose 0 = -f, -5v = -3v + f - 4. Let d = -13 - -2. Let j(o) be the first derivative of 5o*2 + 11o - 6. Let g(b) = 2b + 2. Determine dg(x) + vj(x). -2x Let p(s) = 9s3 - 10s*2 - s - 12. Let t(o) = -8o*3 + 8o*2 + 11. Give -4p(r) - 5t(r). 4r*3 + 4r - 7 Let k(b) = -26b + 614. Let s(i) = 31i - 614. Calculate 6k(a) + 5s(a). -a + 614 Let f(j) = 16j3 + 11j*2 - 6. Let q(a) = 2 + 124a*2 + 3a*3 - 15 + 6 - 122a*2 + 6. Let s be (-5)/15 - 67/(-3). What is sq(b) - 4f(b)? 2b*3 + 2 Suppose -12j + 33 = -11j. Let r = -38 + j. Let k(h) = -10h - 5. Let q(c) = -7c - 3. What is rk(o) + 7q(o)? o + 4 Let g(v) = 16v*2 - 13v - 8. Let s(b) = 12b2 - 11b - 7. Calculate 4g(h) - 5s(h). 4h2 + 3h + 3 Let h(o) = -463o3 - 6o*2 - 6o. Let g(u) = -4170u3 - 55u*2 - 55u. Give -6g(v) + 55h(v). -445v3 Let s(v) = 85v*3 + 25v*2 + 25v - 25. Let t = 144 + -142. Let n(i) = 2i2 + ti + 1 + 0 + 7i3 - 3. Calculate -25n(j) + 2s(j). -5j*3 Let l(i) = -6i + 256. Let q(n) = 11n - 510. Give -5l(j) - 3q(j). -3j + 250 Let b(s) = 711s3 - 11s*2 + 33s. Let q(j) = 178j3 - 3j*2 + 9j. Calculate 6b(u) - 22q(u). 350u3 Let b(y) = -2y*2 - 5y - 35. Let n(s) = 2s2 + 4s + 35. What is 2b(z) + 3n(z)? 2z2 + 2z + 35 Let s(q) = -1. Let w(l) = 4 + 10l - 9l - 7l + l. Let m be ((-5)/10)/(1/2). Determine mw(u) - 3s(u). 5u - 1 Suppose 0 = -0n + 3n - 6. Let j(l) = -5l + 0 - 3 - nl*2 + 5. Let o(p) = 2p*2 + 6p - 2. What is -5j(r) - 4o(r)? 2r2 + r - 2 Let f(n) = 117n*3 - 6n*2 + n - 4. Let k(h) = 233h*3 - 11h*2 + 2h - 7. What is 7f(c) - 4k(c)? -113c3 + 2c*	{ "pile_set_name": "DM Mathematics" }
(a) s (b) 3/4 (c) -0.5 c Let v = 15 + -11. Which is the closest to 1? (a) v (b) 0.2 (c) -6/7 b Let x = 6/49 - 13/49. Which is the closest to x? (a) 0.1 (b) -0.5 (c) 5 a Suppose -6q - 12 = -2q. Let h be 0/8 + q/5. What is the closest to -0.1 in 2/13, h, -0.1? -0.1 Let n be (0/1)/((-39)/13). What is the closest to 0 in -40, n, 0.4? n Let r = 0 + -2. Let v = 0.8 - 0.9. What is the closest to -1/2 in r, v, 4? v Let i = 19 + -18. Which is the nearest to i? (a) -0.1 (b) 8 (c) 0.1 c Let w = -18 + 8. Let t = w - -7. Let f be ((-1)/3)/((-10)/(-12)). What is the nearest to -0.2 in t, -5, f? f Let d = -8 + 6. Let z = -0.5 + -0.5. Which is the closest to 2/5? (a) d (b) z (c) 0.1 c Let u be (6/20)/(54/45). What is the nearest to u in 2, -2, 1/10? 1/10 Let s = -48 + 143/3. Which is the closest to 0.1? (a) -2/19 (b) s (c) -1 a Let j = -2.1 + 0.4. Let v = j - -1.8. Which is the closest to v? (a) 5 (b) -1 (c) 1 c Let x = -0.2 + 4.2. Which is the nearest to 2/3? (a) x (b) -5 (c) -2/5 c Let u = 36 - 35.9. What is the nearest to -0.1 in 4/3, u, 2? u Let r(o) = 5o2 - 44o + 50o + 1 - 4o*2 + 0o*2. Let s be r(-6). Suppose -5q + q + 16 = 0. What is the nearest to s in -5, 2/17, q? 2/17 Let f = 0.61 - 0.11. Let m = -0.1 + 0.1. Let k = 0.8 + -1. What is the closest to 0.1 in m, f, k? m Let v = 17.7 + -2.7. Let g = v + -12. Which is the nearest to 1? (a) 2/11 (b) g (c) 5 a Suppose -2p + 4m - 14 = 0, 3p + 2 = 2m + 1. Suppose 0 = -2h - ph. Which is the nearest to -1? (a) -4 (b) h (c) 1 b Let z = -0.113 - -0.013. Let g be (-32)/130 + 2/5. Let h = g - 19/39. What is the closest to z in -0.4, 2, h? h Let h(l) = -l*2 - 6l + 11. Let w be h(-8). Let n = -0.4 + 0.6. Which is the nearest to n? (a) 2/13 (b) w (c) 1 a Let v = 0.1 - 0.06. Let i be ((-11)/99)/(2/(-12)). Which is the nearest to i? (a) v (b) -1 (c) -1/5 a Let s = -9 - -9.2. What is the closest to -0.1 in -3, s, 5? s Suppose 4j - 16 = -l, 2j + 0 - 6 = -l. Let o(g) = -g*2 - 3g + 3. Let x be o(-5). Let w = x + 5. Which is the nearest to -0.1? (a) w (b) j (c) 0 c Let f be (-728)/(-3 + 3/6). Let n = f - 290. Which is the closest to -2? (a) n (b) -2 (c) -1 b Let k = 552/5 + -111. Which is the closest to -5? (a) k (b) 2 (c) -0.5 a Let q = 1 - -9. Let u = q + -7. What is the closest to -1 in u, 0.3, 0.5? 0.3 Let x = -49/4 - -12. Let g = -0.92 + -0.08. What is the nearest to g in x, -3, -5? x Let n be (-6)/(-26)(-4)/6. Let l = -5 - -2.4. Let c = 0.6 + l. What is the closest to 1/3 in -2/5, c, n? n Let f = 16 - 22. Let d = -6 - f. Let s = 0.5 - d. Which is the nearest to 1? (a) s (b) -3 (c) -0.2 a Let h = -254/5 - -51. Let z = 0.2 + -0.3. Which is the nearest to -1? (a) -1 (b) z (c) h a Let w be (615/(-20))/6. Let i = 1.7 + 0.7. Let g = i + 0.6. What is the closest to -2/3 in g, -2/21, w? w Let d = 29 + -30. What is the closest to d in -5, 17, 1/3? 1/3 Let s be 22/(-3 - (-204)/52). Let n = s - 433/18. Which is the closest to 2/5? (a) -2 (b) 4 (c) n c Let v = -3.1 - -3. Let c = 0.03 - 0.33. Let x = v - c. What is the nearest to 1/2 in -0.3, x, 2/3? 2/3 Let j = -1.6 + 0.6. Which is the closest to j? (a) 3 (b) -3/7 (c) 0.1 b Let n = 93 - 94. Which is the nearest to -0.1? (a) 5 (b) n (c) 2/11 c Suppose 31 = 5w - 14. Suppose 0 = -d + 4g + w + 9, 4d - g = 12. What is the closest to d in -1, -4, -0.2? -0.2 Let l = -0.62 - -0.7. Let h = 0.02 + l. Which is the nearest to -1? (a) h (b) -0.1 (c) 1 b Let y = 1825/2 + -935. Let z = 22 + y. What is the nearest to -0.1 in 5, -2/17, z? -2/17 Let u = 1 - -1. Let p = -2 + u. Let m = 2/3 + -1. Which is the nearest to p? (a) -2 (b) 3 (c) m c Let o be -3(1 - (-17)/(-15)). Let w = -20 - -17. Which is the closest to -2/3? (a) 1/4 (b) o (c) w a Let k = 6 - 10. Suppose -5g + 11 = -3h + 4, -2g = 2. Let o be (-24)/(-56) - h/7. What is the nearest to o in -2, -5, k? -2 Let v be 2/62/(-4). Let w be 0 + 0 + (-8)/36. Let q be (4/6)/((-40)/15). Which is the nearest to 1/4? (a) w (b) v (c) q b Let q = 5.116 + -0.116. Which is the closest to -15? (a) 3 (b) -0.2 (c) q b Suppose -r - 20 = 3r. Let q be (-4)/20 - 31/r. Suppose 2 = 4d + q. What is the nearest to -1 in 0.4, d, 0.3? d Let l = 5.07 + 0.73. Let h = -6 + l. What is the nearest to -1 in 0, h, 0.5? h Suppose -p = -8 + 3. Let s = 3.9 - 4. What is the nearest to -1/3 in -1/5, s, p? -1/5 Let g = 0.2 + 0.2. Let z = 5.3 - 5. Let t = -4 + 3.8. What is the nearest to -1 in g, z, t? t Let r = 0.3 + 0.2. Suppose 0 = 2t - 15 + 9. Which is the closest to -1/2? (a) t (b) -3 (c) r c Let g be 1(-2)/5 + 1. Suppose 0 = -5b + 2b - 12. What is the nearest to g in -3, b, -1/2? -1/2 Let w = -6 + 4. Which is the closest to 2? (a) -5 (b) -3 (c) w c Let m = 12 + -8. What is the closest to -8 in -1, m, -0.5? -1 Let d = -0.25 - -0.3. Let y = -2.05 + d. Let g = 7 - 8. Which is the closest to y? (a) -5 (b) g (c) 0.3 b Let v = 1.975 - -0.025. Which is the closest to -33? (a) -0.5 (b) v (c) -1 c Let d be 26/(-16) - (-4 - -2). Let y = -34 + 308/9. Which is the closest to -0.1? (a) d (b) y (c) -0.5 b Suppose 0d = d - i + 2, -3d - 9 = -4i. Let j = 5 + -4. Let n = -1 - j. Which is the nearest to 0.2? (a) n (b) d (c) -1/4 c Suppose -3l = l - 40. Let y = 7 - l. Let f be y + -3 + 25/4. Which is the closest to f? (a) 0.1 (b) -0.3 (c) -1/4 a Let z = 7.1 + -7. Let k = -7 + 2. Let x = 30 - 29. Which is the nearest to x? (a) 3 (b) k (c) z c Let j = 1.03 + -0.73. Which is the nearest to 0? (a) 1 (b) j (c) -3 b Let r be (-2)/2-2 + -2. Let k be (1 + -1 + r)/2. What is the closest to -0.2 in -2, 2/3, k? k Let b = -0.18 + -0.32. Let k = 1.2 - 0.2. What is the nearest to k in b, -5/4, 1/2? 1/2 Let i = 23/6 + -43/12. What is the nearest to i in 0, 8, 5/3? 0 Let n = -0.057 + -1.023. Let h = n + 0.08. Let g = -5 - -3. Which is the nearest to h? (a) g (b) -4 (c) -1 c Let q = 136.17 - 137. Let m = 0.17 - q. Which is the closest to 0.1? (a) 1/9 (b) -3 (c) m a Let o = 1 + -1. Let g = 3.2 + -5.2. Which is the closest to o? (a) 0.05 (b) 5 (c) g a Let o(m) = 13m - 1. Let t be o(1). Let l be ((-90)/t)/(2/(-4)). Suppose 0 = -5r - l, -15 = -w + 3r + 2r. Which is the nearest to 0? (a) 1/3 (b) 1 (c) w c Let n be 6((-4)/30 - 0). Let a = -27 + 25. Let j be ((-3)/(-2))/(6/12). What is the closest to 0 in n, j, a? n Let q = 173356/21 - 8253. Let l = q - 12/7. Let s be (3 - 43/15)3. Which is the nearest to l? (a) 0 (b) s (c) -5 b Let t = -1.13 - -0.93. Which is the closest to 15? (a) 5 (b) 3 (c) t a Let g = -189 + 189.5. Let x = 7 + -13. What is the closest to -2/7 in -1, x, g? -1 Suppose 0 = 23y - 28y. Which is the closest to -4/7? (a) -0.3 (b) 0.2 (c) y a Let k = 0.76 + -0.96. Which is the nearest to 0.2? (a) -2/11 (b) 2/11 (c) k b Let l be (-14 - -4 - 2)(-1)/4. Which is the nearest to 1/3? (a) l (b) -3/8 (c) -4 b Let f = -0.1 - -1.1. What is the nearest to f in -0.3, -5/2, 2/7? 2/7 Let f = -1 + 1. Let r be (22/(-10))/(14/(-35)). What is the nearest to 0.1 in r, f, 4? f Let k = 2/3 + -1/15. Let t = 0.2 - 0.4. Which is the closest to -9? (a) k (b) -1/2 (c) t b Let t = 2.8 + -3. Suppose -m = -2s - 3m - 10, s - 2m = 10. Which is the closest to s? (a) 2/13 (b) -4 (c) t a Let g = 8 - 4. What is the nearest to -1 in g, 3, 0.1? 0.1 Let v be ((32/(-5))/4)/2. Let m = -0.11 + 5.11. Which is the closest to -2? (a) -3 (b) m (c) v a Let c(l) = 3 - 8 + l - 2. Let w be c(5). What is the nearest to -2 in 1/3, w, -1/3? w Let f be 9/(-7) - 2/(-2). Suppose 3m + 1 = -23. Let d be (-36)/10 + m/(-2). Which is the nearest to f? (a) -5/3 (b) -1/2 (c) d b Suppose 4t - 2n + 20 = 0, 3t + 4n + 15 = -n. Let v = 160 - 1117/7. Which is the closest to 0? (a) t (b) v (c) 0.5 b Let n = -28 + 23. Which is the nearest to 1? (a) n (b) -1 (c) -0.2 c Let q = 7.06 + -7. Let l = -0.04 - q. Which is the nearest to l? (a) -3/2 (b) -1 (c) -2 b Let g be 2/(-3)1/2. Which is the nearest to g? (a) -1 (b) 5 (c) 0.1 c Let x = 32/11 - 3. Suppose 0 = -z - 0z. Let k be (0 - (-2 + 1))z. What is the nearest to 1 in k, x, -5? k Suppose 2m - 2f - 12 = 0, 4f + 10 = m - 8. Let x = -5 + 7. Suppose 0 = -mo - 4l - 4, xo = l + 1. Which is the closest to 0.1?	{ "pile_set_name": "DM Mathematics" }
et i(s) = 11s3 - 36s*2 + 77s - 43. Let k(j) = -18i(j) + 5l(j). Factor k(w). -3(w - 2)3 Let f = 145 + -144. What is h in -3/2h + f + 1/2h3 + 0h*2 = 0? -2, 1 Suppose -8 - 1 = x - 2g, 5g = -3x + 17. Let a = 3/2 + x. Solve -ab + 0b*2 - 1/2b5 + b3 + 0b4 + 0 = 0 for b. -1, 0, 1 Let k(f) = f4 - f3 - 2f2 + f. Let t(y) = y4 + y*3 - y. Let g(j) = k(j) + t(j). Factor g(c). 2c*2(c - 1)(c + 1) Let x(a) = a2 + 4a - 3. Let d be x(-5). Factor 0u + 3u + u2 - u2 - 3ud. -3u(u - 1) Let z(w) = -w - 2. Let d be z(-6). Factor -dg*2 - g + 5g - 1 + 3g2 - 3. -(g - 2)2 Let t(w) = 4w*2 + 9w - 9. Let u(m) = -5m2 - 10m + 10. Let i = -3 + 6. Let s be (-1)/((i/18)/(-1)). Let a(x) = st(x) + 5u(x). Factor a(d). -(d - 2)*2 Let a(o) = 3o - 30. Let l be a(11). Let q(z) be the third derivative of 0z + 0 - 4/15zl + z2 - 1/300z6 + 1/50z*5 + 0z*4. Factor q(s). -2(s - 2)*2(s + 1)/5 Let w = 3 - 4. Let d be (-4 + (1 - -1))w. Factor 2b + 2 - 2b - 2b*d. -2(b - 1)(b + 1) Let c(q) be the second derivative of 1/36q*4 - 3q + 1/9q3 + 1/6q*2 + 0. Determine l so that c(l) = 0. -1 Let x be (-4)/10 - (-66)/15. Factor 8q*3 + 0q3 - q3 + xq4 - q + 2q*2. q(q + 1)*2(4q - 1) Let w(z) be the second derivative of 1/9z*4 + z + 0 + 4/9z*3 + 8/9z*2 + 1/90z*5. Let w(k) = 0. Calculate k. -2 Let c(d) = -d - 11. Suppose w = g - 2w - 2, 6 = -2g + 4w. Let z be c(g). Determine k so that 1/3k3 + 0 + 0k*z + 0k + 0k4 - 1/3k5 = 0. -1, 0, 1 Let o(u) be the first derivative of u7/210 - u6/40 + u5/20 - u4/24 + u2 + 8. Let p(n) be the second derivative of o(n). Let p(r) = 0. What is r? 0, 1 Let b(x) be the first derivative of 4x3/3 + 2x*2 - 8x - 5. Find t such that b(t) = 0. -2, 1 Let b(p) be the third derivative of 8p7/21 + 5p*6/3 - 29p*5/4 + 175p*4/24 - 10p*3/3 + 31p*2. Determine t so that b(t) = 0. -4, 1/4, 1 Let f = 9 - 3. Let q(x) be the second derivative of 1/135x*f + 0x*2 + 1/54x*4 + 1/45x*5 + 0x*3 + 0 - 2x. Let q(g) = 0. What is g? -1, 0 Let m(u) be the first derivative of 5u3/4 - 55u*2/8 - 5u + 14. Factor m(n). 5(n - 4)(3n + 1)/4 Let u(n) be the first derivative of -2n*6/3 - 8n5/5 - n4 - 6. Factor u(l). -4l3(l + 1)*2 Let k be 0 + -3 - (1 + -4). Let p(q) be the third derivative of kq*3 + 0q*5 + 2q*2 + 1/180q*6 + 0q + 0 + 0q4. Suppose p(m) = 0. What is m? 0 Let p be -2 + (-32)/(-18) + 8/36. Factor 0 + 2/5a*5 + 0a + pa4 - 2/5a*3 + 0a*2. 2a*3(a - 1)(a + 1)/5 Suppose 32 = 8m + 8m. Let h(v) be the second derivative of 2v + 1/20v4 + 0 - 3/10v*m + 0v*3. Factor h(u). 3(u - 1)(u + 1)/5 Let r(c) = -4c2 - 8. Let j(g) = g2 - g. Let n(z) = -6j(z) - r(z). Solve n(l) = 0. -1, 4 Suppose o + 7c - 4c + 21 = 0, 0 = -3c. Let m = -19 - o. Let 0 + 1/5zm + 1/5z = 0. Calculate z. -1, 0 Let l(j) be the third derivative of j8/16800 + j7/12600 - j6/900 + j5/20 - j2. Let p(r) be the third derivative of l(r). Let p(g) = 0. What is g? -1, 2/3 Let u(r) be the third derivative of r7/11340 + r6/810 + r5/135 + r*4/3 - 4r*2. Let d(i) be the second derivative of u(i). Solve d(h) = 0. -2 Suppose -5a - 2q - 6 = -6a, -3a - 2q = -2. Factor -o - 1/3o3 - oa - 1/3. -(o + 1)3/3 Let j(w) be the third derivative of 0w - 5w2 - 1/180w*5 - 1/18w*3 + 1/36w*4 + 0. Suppose j(m) = 0. What is m? 1 Let p(v) be the first derivative of 1/360v*6 + 1/24v*4 + 1/60v*5 + 0v*2 - 1/3v*3 + 2 + 0v. Let s(y) be the third derivative of p(y). Factor s(l). (l + 1)*2 Suppose -4j = -2u - 78, -8 = 5u - 3. Factor -2h3 - 24h + h*2 + 16 + jh*2 - 8h*2. -2(h - 2)*3 Factor 1 + x - 3/4x*2. -(x - 2)(3x + 2)/4 Let r(z) = -36z*3 - 39z*2 + 12z - 15. Let f(m) = 9m3 + 10m*2 - 3m + 4. Let h(v) = 15f(v) + 4r(v). Factor h(s). -3s(s + 1)(3s - 1) Let t(u) be the second derivative of -u*6/10 + 9u5/20 + u4/4 - 3u3/2 + 6u. Factor t(i). -3i(i - 3)(i - 1)(i + 1) Suppose -24 = -b - b. Find h such that -5h2 + 13h + 2h3 - bh*3 - 2h4 - h2 + 5h = 0. -3, 0, 1 Let i be 1 - 0 - (-2 - 0). Suppose -iv + t = -3t + 8, -8 = v - 4t. Factor v + 4/9j2 - 2/9j - 2/9j3. -2j(j - 1)2/9 Let t(h) be the third derivative of 2/1155h*7 + 0h*6 + 0h - 1/165h5 - 1/132h*4 + 0 + 1/1848h*8 + 0h*3 + 5h*2. Suppose t(s) = 0. What is s? -1, 0, 1 Let t = -61 - -17. Let p be 3/(-12) + (-11)/t. Determine b, given that 9/4b*3 + 5/4b*5 - 1/2b*2 - 3b*4 + p + 0b = 0. 0, 2/5, 1 Let x = -20 - -26. Let u = x + -4. Factor 4/7y3 + 0y - 2/7y4 - 2/7y*u + 0. -2y*2(y - 1)*2/7 Suppose -f - 4f + c = -2, -2c = 4. Factor -1/4g + f - 1/4g2. -g(g + 1)/4 Let y = -69 - -211/3. Factor 0 - yj - 4/3j*2. -4j(j + 1)/3 Let 3/2q*2 + 0q + 0 + 1/2q3 = 0. What is q? -3, 0 Let x(f) be the first derivative of -3f*5/20 + 3f4/16 + f3/8 - f + 4. Let u(m) be the first derivative of x(m). Solve u(w) = 0. -1/4, 0, 1 Let x(d) be the third derivative of d7/70 + d6/10 + d*5/5 + 5d*2. Factor x(v). 3v*2(v + 2)*2 Let o = -1 - -7. Suppose 3b - 2k - o = 0, -2b + 3b + 6 = -2k. Factor 2/3t2 + 1/3t*3 + 1/3t + b. t(t + 1)2/3 Let f = 2/131 - -248/917. Factor -fy*2 + 1/7y + 0. -y(2y - 1)/7 Let q = 29/8 - 601/168. Let k(t) be the first derivative of 16/7t + qt*6 + 4t*2 + 25/14t*4 + 16/35t*5 + 2 + 76/21t3. Find n such that k(n) = 0. -2, -1 Let k(x) be the third derivative of x7/735 - x6/420 - x5/210 + x*4/84 - 12x*2. Find w such that k(w) = 0. -1, 0, 1 Let p(c) be the first derivative of -2/21c*3 - 2/7c - 2/7c2 - 1. Suppose p(f) = 0. What is f? -1 Suppose -2y - 40 = 3y. Let l be y/20(-30)/3. Solve -5/3k3 + 3k*2 + 2/3 - 7/3k + 1/3kl = 0. 1, 2 Let 15/4 + 3/4j*2 - 9/2j = 0. Calculate j. 1, 5 Let z(t) be the third derivative of t*6/300 + 2t5/75 + t4/20 - 11t2. Factor z(m). 2m(m + 1)(m + 3)/5 Suppose 4m = m + 9. Suppose mv = 2v. Solve 1/2z - 1/2z2 + v = 0. 0, 1 Let -19o*2 + 2 + 5o*3 - 11o*2 - 2 + 25o = 0. Calculate o. 0, 1, 5 Let w = -5256/17 + 1261559/4080. Let c(t) be the third derivative of 0t3 + 0 - wt*5 - 1/48t4 + t2 + 0t. Find g such that c(g) = 0. -2/7, 0 Let m(o) = -3o - 5 + 1 + 2o - 2. Let j be m(-8). Suppose 2p - 4p2 + 3p*2 + 1 - jp = 0. What is p? -1, 1 Suppose -2s - k = -6, 4s - 3k - 2k = 12. Factor -4n3 - ns + 0n*3 + 3n*3 + 2n*2 + 4n. -2n(n - 2)(n + 1) What is d in -1/4d*3 + 0d + 1 - 3/4d2 = 0? -2, 1 Factor 1/6t + 0 + 8/3t4 + 4/3t*3 - 7/6t*2. t(t + 1)(4t - 1)*2/6 Suppose 4k - 34 = -3y + 41, 0 = 3k - 5y - 49. Suppose 4p - 3q - 13 - k = 0, 3p - 2q - 23 = 0. Solve -7n + 2n4 + pn - 2n3 = 0. 0, 1 Let q be 122/240 + ((-9)/(-6))/(-3). Let j(t) be the third derivative of 0t + 0 - qt5 + 3t*2 + 1/12t*3 + 1/240t*6 - 1/48t4. Factor j(p). (p - 1)2(p + 1)/2 Let n(s) be the second derivative of s5/20 + s4/6 - s3/6 - s2 - 7s. Factor n(y). (y - 1)(y + 1)(y + 2) Let h(u) be the first derivative of -2u3/15 + 5u*2/3 - 16u/15 + 66. Solve h(d) = 0. 1/3, 8 Let u(t) be the third derivative of -5t8/336 + 5t7/42 - t6/3 + t*5/3 - 11t*2. Factor u(m). -5m*2(m - 2)*2(m - 1) Factor 10w4 - 15w*4 - 29w + 5w3 + 20w*2 + 9w. -5w(w - 2)(w - 1)(w + 2) Let 0 + 2/7d2 - 2/7d = 0. What is d? 0, 1 Let m be 10/15 + 4/(-6). Suppose -r + 4 + 0 = m. Suppose -2/7j3 + 0 - 2/7j*r + 0j + 0j2 = 0. Calculate j. -1, 0 Let k(x) = 2x. Let r be k(1). Let i(g) be the first derivative of -2 - 4/7g - 2/21g*3 + 3/7gr. Determine q so that i(q) = 0. 1, 2 Let f(s) be the second derivative of -s5/170 + 2s4/51 - 5s*3/51 + 2s*2/17 + 8s. Determine b so that f(b) = 0. 1, 2 Let w(p) be the first derivative of -4p5/5 - 2p*4 - 4p*3/3 - 10. Factor w(j). -4j*2(j + 1)*2 Suppose 2v + 7v = 198. Let w = v + -22. Factor 0 - 2/9d*4 + wd*3 + 2/9d*2 + 0d. -2d2(d - 1)(d + 1)/9 Suppose -6 = -4o + 2. Let i = -18 + 22. Factor -9zi - 3z*2 + oz5 + z5 + 0z5 + 9z*3. 3z*2(z - 1)*3 Let k(j) be the second derivative of 0 + 1/35j	{ "pile_set_name": "DM Mathematics" }
t + ln + qn*2 and give t. -1 Express 1458a*2 - 2961a2 + a3 - 3a3 - 5 + 1480a*2 as sa*3 + ba*2 + ta + y and give s. -2 Express (54n2 - 47n*2 + 79n*2)(-11 + 5 - 7) in the form y + tn + zn*2 and give z. -1118 Rearrange 4l*4 - 107 + 55 - 5l2 - l2 + 8l2 + 54 + l - 10l*3 to hl*3 + ul + fl2 + cl*4 + v and give h. -10 Express 5 - 5 + v - v - 3v - v + (-4v + v + 0v)(4 - 5 + 2) - v + 11v + 5v - 2 as gv + w and give g. 8 Express 1346439i3 + 2i*4 - 2i*2 - 1346439i*3 + 2i + 569 as di + t + hi*2 + ji*4 + ui*3 and give t. 569 Rearrange 2f - 6f + 139956 - 37f*3 - 139918 to the form bf + vf3 + r + af*2 and give v. -37 Express 470o - 1425o - 88o - 793o as mo + x and give m. -1836 Express -1885x - 6x*3 + 1883x + 122x4 - 126x*4 + 12x3 - x2 + 130x3 + 2 as nx*2 + wx + rx3 + gx*4 + s and give g. -4 Rearrange (-6g - 31 + 31)(1253 - 3195 + 1567) to w + kg and give w. 0 Rearrange 1566p2 - 19p*2 + 1045p*2 to the form hp + wp2 + g and give w. 2592 Rearrange -102p*3 + 13p + 3p - 12p + 555p3 to the form tp*3 + wp + ap2 + j and give t. 453 Rearrange -3622u*4 + 3595u*4 + 6 + 11 + 25 + 2u*3 to the form qu + bu3 + n + du*4 + tu*2 and give n. 42 Express (31q*2 - 186 + 186)(-202q + 326q + 693q) in the form jq*3 + u + zq + gq2 and give j. 25327 Express 30b + 27 - 52b - 2b4 + b2 + 19b + 4 in the form pb*4 + zb*2 + vb + r + xb3 and give p. -2 Rearrange (6 - 3 - 9)(-1052 + 958x + 2104 - 1052)(-2 + 4 - 4) to v + yx and give y. 11496 Express -2x + 2x + x - 4 - x + 4 + (x + x - 4x)(-1 + 0 + 3) + 2x - 2 + 2 + (5x - 2x + 4x)(597 + 66 - 1168) in the form mx + g and give m. -3537 Express 46 + t2 - 151 - 48 - 220 as wt + jt2 + i and give i. -373 Rearrange -725g - 4418g - 1140g + 525g to n + ag and give a. -5758 Express 44a2 + 132a + 9a - 166a in the form c + ma + da*2 and give m. -25 Rearrange -4 + 101555g + 101564g + 3 - 3g*4 + 5g4 + g2 - 203166g to the form f + ng + dg3 + jg*2 + ug*4 and give j. 1 Express -3968c + 13629c + 13561c as d + pc and give p. 23222 Express 67820i*4 - 1 + 67822i*4 - 135640i*4 + 1049i*3 as w + gi*3 + li*4 + yi + xi2 and give w. -1 Express 55 + 6u - 183 + 71 + 72 in the form du + f and give f. 15 Rearrange 4i*2 + i - 5i*4 + 73i*3 - 11 - 74i*3 + 2i*4 + 11 to the form xi + oi2 + y + si*3 + mi*4 and give x. 1 Express -3 - 17 + 13 - 107c + 12 + 22 in the form k + jc and give j. -107 Rearrange 4r - 1047r4 - 1047r*4 - 73 - 63 + 2091r*4 - 44 to the form ur*2 + vr*3 + br*4 + a + lr and give l. 4 Rearrange -74m + 15m*3 - 15m*3 + 23 + 16m*3 + 72m + m*2 to the form l + rm + sm2 + wm*3 and give w. 16 Express -7c + 591c2 + 5c*3 - 591c*2 - 41 + (-c - 3 + 3)(0c2 - 4c*2 + 3c*2) in the form jc + i + tc2 + kc*3 and give j. -7 Express (-18x + x - x)(-13x*2 + 39x*2 + 43x*2) in the form ux*2 + zx + r + sx3 and give s. -1242 Express 903s - 2 - 9206s - 4028s + 4185s - 4105s in the form u + vs and give v. -12251 Express (265 - 3v - 604 + 255)(0v2 - v2 - 4v2) as uv*2 + r + lv*3 + wv and give u. 420 Rearrange (103 - 739 + 6s - 828 - 9s)(-4s - 3s + 0 + 1) to the form h + gs*2 + is and give g. 21 Express (3p2 + 3p*2 - 4p*2)(2p + 1 - 1) + 808p + 815p + 115p*3 - 1616p in the form sp2 + i + mp + yp3 and give y. 119 Rearrange (82d + 53d - 30d)(83 - 21d*2 - 83) + (0d + d - 2d)(-d*2 + 0d*2 + 0d*2) to f + rd*3 + hd + id2 and give r. -2204 Rearrange 6r4 - r4 - 2r4 + (0 + 1 + 1)(69207r - 69207r + 3167r4) to the form u + pr*4 + zr*2 + sr + ar3 and give p. 6337 Rearrange 195c*3 + 7 - 55c - 12c + 4c*2 + 35c + 30c to sc*2 + qc*3 + k + mc and give k. 7 Rearrange -133f + 6f*3 - 14f*3 + 3f*3 + 3f*3 - 2f3 - f4 + 3 to of + sf*2 + y + mf*3 + if*4 and give o. -133 Rearrange 1630h - 4891h + 1632h + 1631h - 2h*4 + 2 + 69h2 + h3 to the form rh + wh*4 + th*3 + uh*2 + o and give r. 2 Express (-81y*2 + 44y*2 + 173y*2)(15y - 2y + 8y) in the form z + dy*2 + ay*3 + hy and give d. 0 Express (-v + v + 2v)(v - 3v + v) + (-3v + v + 4v)(2v + 4v - 4v)(-6172 - 4473 - 1401) as av2 + jv + d and give a. -48186 Rearrange (2y - 4y + 0y + 6)(-23y3 - 17y*3 + 26y*2 + 39y*3) to py + vy2 + qy*4 + m + hy*3 and give q. 2 Express -2g*2 + 0g*2 - 1315 - g + 1693 in the form l + ug*2 + ig and give l. 378 Rearrange (-1 + 0 + 0)(-8 + 8 + 3f)(268f + 216f + 519f) to qf2 + x + df and give q. -3009 Rearrange -269 + 88 + 89 + 96 + 200w to the form c + xw and give x. 200 Rearrange -10b + 6b - 1803b3 - 1371b*3 to ib*3 + rb*2 + q + yb and give y. -4 Express -l - 72 - 99 - 75 - 87 in the form wl + c and give w. -1 Rearrange (9x - 10x + 8x)(206x*3 - 4407x*3 + 261x*3) to yx + sx4 + f + ax*2 + qx*3 and give s. -27580 Express -41x*2 + 14x + 69x2 - 59x + 17x + 16x as bx2 + sx + p and give b. 28 Rearrange c + 1 - 19c3 - 41c*2 + 27c*3 - 8c*3 + 9c*3 to tc*3 + f + vc*2 + ac and give f. 1 Rearrange (4 - 1 - 4)(2 - 2 + 1)(-113 - 203 - 18)(4h - 5h + 53h) to rh + s and give r. 17368 Express 144 + 985d*3 - 85 - 1026d*3 as vd*2 + id + sd3 + l and give s. -41 Express -22t + 2 - 6t - 3 + 124t*2 + 40t in the form q + ct2 + yt and give q. -1 Express 1 - 3 + 271d - 102d + 1 + 344d in the form i + ud and give i. -1 Express -18j2 - j - 2409812j*3 + 1 + 0j + 2409810j3 in the form wj*3 + lj + f + kj2 and give k. -18 Express (-3 + 3 - 2)(-127h + 14h - 618h) + (1 - 5 + 2)(2h - 4h + h) as yh + r and give y. 1464 Rearrange -609 - 225h - 229h - 350 + 686h - 231h to ah + q and give a. 1 Rearrange (3r - 3r - 2r + (3 - 5 + 0)(204 - 204 + 90r) + (-5r + 5r + 2r)(0 + 0 - 1) + 3r + 7 + r - 9)(-2 - 2r + 2) to j + dr + br*2 and give b. 360 Rearrange -525118p*3 + 5 + 10p*2 + 4p*2 + 525125p*3 - 3p*2 to the form hp*3 + op*2 + r + mp and give o. 11 Rearrange (-3 + 3 + 2x)((4 + 0 - 6)(-32 - 54 + 101) + (-3 + 4 + 0)(0 + 1 - 3)) - 1711 + 79x + 1711 to the form q + px and give p. 15 Rearrange -297 - 2n - 1343 + 4582n*2 - 4581n*2 to the form tn*2 + g + fn and give t. 1 Express -g*3 - g + 2g*2 + 65 - 20 + 22 + 31 as b + fg*3 + tg*2 + ig and give t. 2 Rearrange 7c2 + 2c*2 - 8c*3 - 71 - 88 + 3c*3 to mc + ic2 + rc*3 + y and give y. -159 Express 1164m + 602m - 1003480 + 1003480 as h + wm and give w. 1766 Rearrange -379d + 3499d + 5421d + 1473d to the form jd + p and give j. 10014 Rearrange -3b*2 + 4b*2 - 536663 - 41b*4 + 536697 to o + zb*4 + kb + yb3 + hb*2 and give o. 34 Express (209d - 26d + 241d)(-2 + 2 - 2d*3) + (3d*2 - 2d*2 + 2d*2)(d*2 - 2 + 2) as t + rd*3 + fd*2 + kd*4 + cd and give k. -845 Rearrange 3158s2 + 12s*3 + 5 - 3157s*2 - 3 to the form as*3 + cs + r + ws2 and give r. 2 Express 8 - 602k*2 + 174k*2 + 112k*2 + 199k*2 - 3 in the form jk + d + ck2 and give c. -117 Rearrange 23m*2 + 7m*3 + 54m*4 - 9m*3 - 55m*4 - 3 + 21m*2 to ym + qm4 + vm*3 + xm*2 + r and give x. 44 Rearrange -13q*2 + 6q*2 - 55q*3 + 11q*2 - 53q*3 - 13 + 89q*3 to c + vq + jq2 + hq*3 and give h. -19 Rearrange (-3y + 0y + 4y)(-87y*2 - 19749y*3 - 4 + 9925y*3 - y + 9821y*3)(0 + 4 - 3) to the form x + jy + wy*2 + gy*4 + by*3 and give w. -1 Express 1964l - 27 + 114 - 42 - 45 as n + sl and give s. 1964 Rearrange 4u - 17u2 + 102u*2 + 9u*2 + 4u*3 - 10u*3 - u to the form su*2 + m + qu*3 + iu and give q. -6 Express 539r2 - 3r - 1628r2 + 544r*2 + 545r*2 - 635r*3 in the form v + yr + br3 + jr*2 and give j. 0 Rearrange (-1 - 20c*2 + 1)(-12667 + 24960 - 12494) to kc + h + dc2 and give d. 4020 Express (-k2 + 1 - 1)(-2k2 - k2 + 5k2) + k4 + k4 - k4 + 21 + 811k*4 + 11 - 34 + 3135k*4 as sk + pk4 + tk*2 + i + ck**3 and giv	{ "pile_set_name": "DM Mathematics" }
1? 1 Let a(k) = 3k + 5. Let y be a(-5). Let q = y + 20. Suppose 0 = -b - 2g + q, 2g + 2 = 2b + 6. Which is bigger: b or 1? b Let x = -26573/876 + 365/12. Which is bigger: x or -1? x Suppose 9c = -205 - 326. Are c and -69 unequal? True Suppose -4y = 5r + 47, -4r - 31 = -0r + y. Let u be (4/r)/((-18)/105). Which is smaller: u or 4? u Let s = -13.1 - -17.1. Is 10 != s? True Let c = -13.44 - -13.4. Is -1 at most as big as c? True Suppose 0 = -3p - 48 + 6. Let r = -8 - p. Suppose 2q = -4m - 0m - r, 0 = 3q + 9. Which is smaller: m or 4? m Let q = 5 - 1. Let i be (-2)/(-3) - 132/(-18). Suppose 0 = -5y + y + i. Which is bigger: q or y? q Let l be ((-9)/4)/((-135)/(-18))2. Let v = l - -47/95. Are v and 1 nonequal? True Let t = 31 - 27. Let n = 1 - t. Which is greater: 2 or n? 2 Let h(g) = -106g + 44. Let s be h(-1). Which is greater: 148 or s? s Let i = -19 + 23. Suppose i = 2f - 0. Suppose 5n = 4b + 32, 3b - fn = 3n - 29. Is 4 at most as big as b? False Suppose -5u = 3q + 3, -8 = q - 3q. Let n(h) = h*2 + 4h - 4. Let f = -15 + 11. Let d be n(f). Which is bigger: u or d? u Let i be (1/(-2))/(-7 + (-4422)/(-627)). Let c = 10 - 21. Which is smaller: i or c? c Let v = 4.833 - -0.287. Let g = -0.12 + v. Let l = g - 2. Is l at least as big as 2? True Let w = 0.1 + -0.4. Let u = 66.5 - 66.4. Which is greater: u or w? u Suppose -2668 = -61y - 9378. Which is bigger: y or -106? -106 Suppose 42 = 7j - 0j. Let r(z) = -33z3 - z2 + z + 1. Let x be r(-1). Suppose -5p + x = -2a, 4p + a - 23 = -0a. Are j and p nonequal? False Let t = 2.09 - 0.09. Let s(l) = -l*3 - 10l*2 - 17l - 12. Let c be s(-8). Do t and c have the same value? False Let j = 17 - 15. Suppose jd = 3d + 1. Is d > 3/16? False Suppose -h + 15 = -7. Suppose 0 = -f - 5, 0b - 5f + 63 = 4b. Is h bigger than b? False Suppose 5v + 132 - 7 = 0. Let b = v - -30. Is b at most 5? True Let d be 12/(-4)(-4 - -3). Suppose 3u = 15 - d. Suppose -us = 3w - 2s + 1, 0 = -2s - 4. Which is bigger: 1/19 or w? w Suppose -5b + 113 = -9b - m, -5b - 135 = -5m. Is -22 equal to b? False Let f be (0 + 2 - 3)0. Suppose 45 = t + 4t + 5a, -2a - 4 = f. Let p(d) = -d*3 + 3d*2 + 2d + 4. Let z be p(3). Which is bigger: z or t? t Let k = 126 + -139.1. Is 5 less than or equal to k? False Let a(g) = -g - 15. Let z be a(-18). Suppose -3x = 3p + 6, 2p + x - 1 = -z. Which is bigger: p or 2? 2 Let d = 73 - 36. Is d smaller than -2/3? False Suppose 2b = -2q - q + 3, -5b = 4q - 11. Which is smaller: q or -56/31? -56/31 Let r = 17.39 - 0.29. Let p = 1.1 - r. Let l = p - -17. Which is greater: l or -6? l Suppose -m = -5v + 5, 0m + 4m = 3v - 3. Suppose -j - 2a - 6 = m, 5j - 4a + 38 = 2j. Is j at least -4? False Let y = -1 + -18. Let v = y - -21. Let q be 1 - -1 - (v + -1). Do q and 24/11 have different values? True Let s be (-2(-1)/(-3))/((-1)/(-3)). Let q be 3 - (22/8 + s + 2). Is -17/2 > q? False Let y = -26 + 18. Let r = y - -11. Suppose 0m - 2o = -rm - 19, o = -5m - 23. Which is smaller: m or -26/7? m Let v = 8 + 3. Suppose 4i - 13 = 3i + 5s, 0 = -4i - s - v. Is 0 greater than i? True Let z = -1 + 41. Suppose 3x - z = 3f + f, 2x = f + 15. Suppose n + 3 = -3. Which is bigger: n or f? n Let u = -31.9479 - -0.0479. Let g = -32 - u. Is g equal to -15? False Suppose 3j - 34h - 703 = -32h, 3h = 4j - 939. Is j smaller than 229? False Let r be ((-2)/6)/((-6)/(-36)). Suppose u + 4u + 4b + 4689 = 0, 0 = -4u - b - 3760. Let f = 6569/7 + u. Are f and r non-equal? True Let h = -142028/19 - -7472. Let x = -1099/342 - h. Which is smaller: x or 0? x Let x = -822 - -7393/9. Which is smaller: -0.1 or x? x Suppose -p = -1 - 0. Let s(y) = -7y*2 + y - 4. Let u be s(6). Let g = 5999/24 + u. Which is smaller: p or g? g Suppose -4s = t + 59, 2t = 2s + 46 - 4. Let r(h) = -h*2 - 8h - 3. Let a be r(-6). Let b be (s/3)/((-6)/a). Is 9 < b? False Suppose 2i - 5g - 21 = 0, -8 - 16 = -5i + 3g. Let q = 2 - i. Let d be q(-3 + 17/6). Which is bigger: d or -1? d Let g = -19.52 + 20. Is 0.1 less than g? True Suppose -4 = -3o + 86. Suppose o = 5l + 2s, 2l + 0 = 2s + 12. Which is greater: l or 4? l Let w = -537 - -539. Is -264 > w? False Let s(y) = y*2 - 2y - 2. Let c be s(-2). Let h = 36285 + -36269. Which is greater: h or c? h Suppose -15 = -46d + 41d. Let w be ((-5)/10)/(d/16). Which is greater: -3 or w? w Let m = -1025/15141 + 2/309. Which is smaller: m or 0? m Let b be (1 + 0)(15 + -9). Suppose 0 = -15c + 9c + b. Which is smaller: -1/10 or c? -1/10 Let i(h) be the second derivative of 1/20h*5 - h + 0 - 1/2h*2 + 1/2h*4 + 1/6h3. Let j be i(-6). Are -6 and j unequal? True Let n be ((-50)/15)/((-1)/3). Let q(l) = -l3 + 11l2 - 9l - 2. Let c be q(n). Let a = c - 9. Is a less than or equal to -1? True Let d = -122.9 + 96.9. Is d > 6? False Let c be (580/(-289) + 2)(-9)/(-99). Which is smaller: 1 or c? c Let q(u) = 3u + 20. Let b be q(8). Suppose -5z + 3n = -b, -39 = 4z + 5n - 89. Is 13 <= z? False Let n = 481/11 - 42941/979. Let m = 2/1335 + n. Are 1.5 and m equal? False Let u = -226 - -226. Which is bigger: -7/5 or u? u Suppose 0q = 40q. Which is bigger: q or -3/329? q Let j(d) = d*3 + 6d*2 + 7d - 1. Let i be j(-4). Let c be -1i(-2)/6. Which is bigger: c or 2/81? c Let g = 2772/13 + -795577/3731. Which is greater: 0 or g? 0 Let k be (-8)/(56/315) - 5. Is k bigger than -47? False Suppose 7 + 9 = -4y. Let u = 4 + y. Suppose u = 2p - p + 4. Is p at most -2? True Suppose -z + 22 = -3d + 3z, 0 = -3z + 12. Suppose 4h = -3w - 1, 0 = w - 3h - 3 + 12. Is d > w? True Let o be (-7)/((1 + 0)/(-3)). Let v = o + -35. Let f = 14 + v. Is 0 at least as big as f? True Let f = 430 - 1000. Suppose 6t + k - 2 = t, -5k - 20 = -5t. Let z be (-215)/f - t/6. Are z and -1 nonequal? True Let g = 22 - 19. Suppose -gd = d - 16. Is 0.2 greater than d? False Let j(t) = -7t2 + 9t + 37. Let x be j(3). Which is smaller: x or 1/692? 1/692 Let n = -2677/9735 + 2/885. Let u be 0/(((-32)/(-4))/(-4)). Which is smaller: n or u? n Let c = -16 + 308/19. Let p = 87/38 + c. Let u be (-414)/230 + (-8)/(-10). Is p at most as big as u? False Let i be 6/(-20) - 6030/(-100). Is i at least as big as 63? False Let i = 203 + -74. Is i not equal to 1? True Suppose -8 + 0 = 4a. Let n be 32/(-20) - a - (-21)/(-15). Which is smaller: -1/4 or n? n Let s(i) = -1 - 2 - 5i + i. Let z(l) = -11l - 10. Let c(r) = -8s(r) + 3z(r). Let q be c(4). Which is smaller: -1 or q? q Let t = -86/11 - -1787/33. Is t >= 46? True Let r be 6/12(5 + 1). Let i be r + 1 + -13 + 12. Which is greater: -3 or i? i Suppose 0 = 4393l - 4401l. Let t = 36328/31 + -1172. Are t and l unequal? True Let i = 17 - 12. Suppose 3l + i - 2 = 0. Let k = -29185/3 - -9727. Does l = k? False Let n be 3 + 0 - 12/(18/6). Let v be ((-18)/(-3) + -5)(0 - n). Which is smaller: -19 or v? -19 Suppose 2c - 9 - 95 = -3y, 3y - 3c = 129. Which is smaller: 36 or y? 36 Let x = -1 - -3. Let i = -70 - -69. Is i > x? False Suppose -20g = -8g + 12g. Let z be (6/7)/(18). Is z at most as big as g? False Suppose -o = -0o - 5. Suppose -om = -0m. Suppose -3i + h = -4, -3i + i + 2h + 4 = m. Which is smaller: -1/5 or i? -1/5 Suppose 6d + 150 = 3d. Let q be 1/(1 + d/45). Are q and -7 unequal? True Let n = 1751751/149336 - -747/1697. Let d = n + -93/8. Is 0 bigger than d? False Let w = -3595 - -176137/49. Is -1 at least as big as w? False Suppose -6w = -457 + 337. Which is smaller: w or 19? 19 Let d = 238233/8 - 29867. Suppose 0 = 15o - 10o - 440. Let s = d + o. Is 1 at most s? False Let w be 3 + ((-455188)/119140 - -1). Let l = 4/2553 + w. Let y = l + -7/15. Which is smaller: 0 or y? y Suppose 0a + 9 = 3a. Let m(j) = -5j*3 + 14j*2 + 3j. Let w be m(a). Which is bigger: 1 or w? 1 Suppose 12 = 3p - 5b, -3b = 3p - 0b - 12. Let y be 1 + p/1 + -3. Suppose -5c + 14 = yc. Is c at most as big as 8/13? False Let c(q) = 19q*2 - 7q + 15. Let y be c(6). Let z be -3 - ((-5254)/y + 5). Which is smaller: z or 1? z Suppose -310 = -3o - 295. Suppose 8 = 3u + 2. Let d be 1(-1)/u-7. Which is smaller: o or d? d Let h(i) = -i*3 + 2i*2 + 2i + 1. Let m be h(-1). Let r be (-102)/(-153)*(-5)/(-2). Do r and m ha	{ "pile_set_name": "DM Mathematics" }
m = 4f + 16, -13 = f - 5m. Let k be (0/3)/(-2) + 2. Suppose -2x = 3u + 2x + 11, x = -u - k. What is the closest to -1/2 in -1, f, u? -1 Let t = 944 + -1015. What is the nearest to t in -2, -0.4, 1/5? -2 Let t = 32 + -98/3. Let i be (-152)/(-28) - 9/21. Let a be (i/70)/((-2)/(-8)). What is the nearest to t in -3, a, 2? a Let w = -369 - -2955/8. Let z = 18 - 23. Which is the closest to -1? (a) z (b) 0.5 (c) w c Let x be (-51)/(2(-12)/16). Suppose -5b = 21 + x. Let m be (0/1)/(-9 - b). What is the nearest to -0.1 in 0.5, 1/4, m? m Let h = -17.899 + 20. Let i = -0.001 + h. Let k = i + -1.7. Which is the closest to 0.1? (a) 4 (b) k (c) 5 b Let k = 30.9 + -31. Suppose -2a + 4 + 2 = 0. What is the closest to 1/4 in a, k, -2? k Let g = 70 + -70.2. What is the nearest to -2 in 0.2, -2/9, g? -2/9 Let x be (-3)/(-20) - 1/(-4). Let k(s) = s*3 + 11s*2 - 14s - 21. Let g be k(-12). Let p be g/24(2 + -3)2. What is the nearest to p in 2/17, -1, x? 2/17 Let z(s) = s*3 + 6s*2 - 2s - 7. Suppose 2t + 36 = -5x - 0t, 5x + 4t + 42 = 0. Let f be z(x). Which is the nearest to -1? (a) 2 (b) -5 (c) f a Let c = 57.6 - 58. Let p be (-1)/(-30)-22 - 4/(-12). What is the nearest to p in c, -0.5, -2/21? c Let p = -48 + 48.1. Let f = 22 + -21.9. What is the closest to p in -3, f, -5? f Let w = -5 - -4. Let g = 125 + -125.87. Let y = g + 0.57. Which is the closest to w? (a) -5 (b) y (c) 2/9 b Let x = -19 - -11. Let t = x + 8.1. What is the closest to 3 in 0.4, -1/11, t? 0.4 Let x = 6 + -4. Let t be (-112)/(-616) - 51/99. What is the closest to 0 in 0, x, t? 0 Let p = 246 - 263. Which is the closest to 1/13? (a) p (b) -0.1 (c) -3 b Suppose -3s + 15 = -27. Suppose -13r + sr - 23 = 0. Let b = r - 25. What is the closest to 1/4 in 4, -1, b? -1 Let h = 18 - 16.6. Let k = h - 1. Which is the nearest to -1? (a) -1 (b) -3 (c) k a Suppose -i - 2i = 0. Let z be -510/15 + 3. Which is the closest to i? (a) z (b) -5 (c) 4/5 a Let z = 1731 + -1727. Let v = 87/176 - 5/16. Which is the closest to z? (a) v (b) 3 (c) 1 b Let h = 30 + -27.2. Let p = -3 + h. Let z = 3.732 + -3.732. What is the closest to 1/4 in 2/11, p, z? 2/11 Let o(t) = 28t + 169. Let j be o(-6). What is the closest to 0.2 in -2, j, 1.2? j Let j = -1/58 + 121/290. Let m = -1/12 - 1/4. What is the nearest to j in m, 4, 0.2? 0.2 Let o be ((2 + 0)-1)/(4 + 3). What is the nearest to -2/5 in -2, 0.3, o? o Let d = 0.4679 + 0.0321. What is the closest to 2/7 in d, -1/8, -4, -3? d Let t be (4/(-9))/(68/(-6)). Let x = 17106.5 + -17107. What is the nearest to 1 in x, t, 2/9? 2/9 Let m be 2/6 + (-12)/27. Let u = m + -2/9. Let l = 3.11 - 3.11. Which is the closest to l? (a) -2 (b) u (c) 2/11 c Let u = -354 + 6020/17. Which is the nearest to -0.1? (a) 0.1 (b) 1 (c) u a Let l = -49 + 197/4. Let m be (-22)/333/(-7). Let n = 1.1 + -1.3. What is the closest to l in 2/3, n, m? m Let x = -1/7 - 3/28. Let z be ((-14068)/(-22) - 1) + 0. Let u = z - 639. What is the closest to x in -2, 0.2, u? u Let u = 7952.7 - 7953. Let d = 0.8 + 0.2. Let h = 2 + d. What is the nearest to 0.1 in 2/3, h, u? u Let w = 640 - 640.5. Which is the nearest to 2/173? (a) -3 (b) w (c) 0.4 c Let s = -0.535 - 0.465. What is the closest to -1/44 in -4, s, 0.4? 0.4 Let u = -0.2376 - -0.0876. Which is the closest to -1/6? (a) u (b) -5 (c) -2/5 (d) 5 a Let x = -28.7 + 29. Let l = 0.6 + -0.9. Let w = 0.2 + l. What is the nearest to w in 0, x, 0.4? 0 Let h = -62/55 - -8/11. Suppose 0 = 3k - 7k - 2p, -2p = 3k + 1. Let y be (49/343)/((-1)/(-7)). Which is the nearest to y? (a) h (b) k (c) 0.3 b Let t(c) = -c3 + 2c2 + 13. Let i = 84 - 81. Let k be t(i). What is the nearest to -0.2 in k, 0, 1/6? 0 Let j(v) = v3 - 9v2 - 8v - 12. Let s be j(10). Let t be (-3)/9 + s/6. Which is the closest to t? (a) 2/3 (b) -0.1 (c) 5 a Suppose 2o - s = -0s - 16, 8 = 2s. Let k = -40 + 31. Let n be (-3)/o6/k. Which is the closest to -0.1? (a) -2/5 (b) n (c) -0.5 b Let k = -0.6 + 0.9. Let x be ((-64)/3)/(2/(-4)). Let d = x - 44. Which is the nearest to -0.1? (a) 1/4 (b) d (c) k a Let j = 1.088 - 0.688. What is the closest to -16 in 4, 3, j? j Let w = -3.864 + -0.136. What is the nearest to -12 in w, 1, -1? w Let v = -1973 - -1969. What is the nearest to 0.036 in -3, 5, v? -3 Let l = -0.6 - -0.3. Let g = -14.9 + 13.9. What is the closest to 3 in g, 4, l? 4 Suppose 2o = -10, z - 2o = 7 + 6. Let u be z/(-6) + 8/64. Which is the nearest to -2/5? (a) -0.2 (b) -0.4 (c) u b Let k = 2152.3 + -2152. Which is the nearest to -1/4? (a) 0 (b) 185 (c) -4 (d) k a Let f = -5.17 - 0.83. Which is the nearest to -10? (a) 3 (b) f (c) -0.5 b Let r = -2 + 5. Suppose 5x = p - 4p - 9, p + r = 2x. Let o be (p/54)/((-2)/(-8)). What is the closest to -2 in 2/7, -0.2, o? o Let h = -553.4 - -553. Which is the nearest to 8? (a) 2 (b) h (c) 3/4 a Let m = 6447 + -6452.013. Let h = m - -0.013. Which is the closest to 0? (a) h (b) 4 (c) -0.3 c Let t = -1855 + 1854.8. What is the nearest to -2 in t, 0.2, -5, 3/4? t Let u = 588 + -591. Which is the nearest to u? (a) 0 (b) -2/31 (c) -0.1 (d) 0.3 c Let s be 2/(-4)(-278)/3. Let u = s + -47. Let t be (-9)/12 - (108/(-16) - -4). Which is the nearest to u? (a) 5 (b) 4 (c) t c Let a be 6/5(-20)/6. Let s = -1 - -1.1. Let y = 514 - 511. What is the closest to s in y, a, -0.2? -0.2 Let z be 424/728 + (-4)/26. What is the closest to -2 in -0.1, -1, z? -1 Let p = -2 + 2. Suppose z - 9z = -32. Suppose -2k - k = -zk. Which is the nearest to p? (a) 4 (b) k (c) -5 b Let x = -0.117 + 0.017. Which is the closest to -1? (a) -2/5 (b) -1 (c) 0.3 (d) x b Suppose h - 6h = 50. Let f be 34/(-14) - (0 + -4 - -2). What is the nearest to 1 in f, h, -5? f Suppose -15 = -p - 4r, -43p + 39p - 2r - 10 = 0. What is the nearest to -1 in 2/11, -0.4, 1/19, p? -0.4 Let b be ((-99)/(-63))/(3/16). Let n = -26/3 + b. Let i be 8/70 - 4/10. What is the nearest to i in n, -0.4, -1/6? n Suppose 0 = 3l - 14 - 1. Let v be -18l/35 - -3. Which is the closest to 1? (a) -4 (b) 0.4 (c) v c Let t = -59 + 59. Let x = 70 - 130. Let r be 34/x + 2/12. Which is the closest to t? (a) -2/7 (b) -2 (c) r a Let k = -24.8 - -26.8. Which is the nearest to 12? (a) -2 (b) -2/3 (c) k c Let u(w) = w2 - 5. Let m be u(2). Let q = 1/144 - -427/720. Suppose -6l + 2l = -16. What is the closest to m in l, -1/2, q? -1/2 Let f = -0.0816 - 1.9184. Let r = 0.85 - 1.2. Let p = r - 0.05. Which is the nearest to 1? (a) p (b) f (c) -0.5 a Let b be ((-5)/4)/(2/8). Let r = 0.2686 + 0.2314. What is the nearest to -2/3 in b, -6/7, r? -6/7 Suppose -3s - 80 = x, -2x = -6x - 8. Let v = s + 29. Which is the nearest to -0.1? (a) 2 (b) -3/5 (c) v b Let h = -330 + 335. Which is the closest to -156? (a) h (b) 2 (c) -0.3 c Let z = -839 - -840. Which is the nearest to z? (a) -2 (b) 67 (c) -1 c Let z = -0.018 - 0.782. Let l = 19 - 15. What is the closest to z in l, -1, 3? -1 Let c = 0.4 - -0.1. Let q = 1.76 + -1.76. Let m = 0.02 - -1.98. What is the closest to m in q, c, -3? c Let j = 3.07 - 0.07. Let h = j + -4. Let p = -3.536 + 2.536. What is the nearest to p in h, 1/2, -5? h Let s be 1/(-12)(-14 + 11). Let z = -152/279 + 10/31. Let i be ((-16)/6 - -2)/2. Which is the closest to i? (a) -1 (b) z (c) s b Let q = 0.74 - -22.26. Let d = q - 24. Which is the closest to 2/7? (a) -0.06 (b) d (c) -0.5 a Let i = 1.8 + -3.8. Let b = -12 + 11. What is the nearest to -40 in b, 4, i? i Let t(s) = -s2 + 22s + 44. Let i be t(24). Let m = -0.19 - -2.19. Which is the closest to m? (a) 4 (b) i (c) -3/4 a Let z = 955 - 956. Let t = -15139/43 - -352. Let m = t - -113/387. What is the closest to z in -0.5, -0.3, m? -0.5 Suppose 4k = -2k + 18. Let h = k + -5/2. What is the closest to h in -0.2, 5, -0.1? -0.1 Let g be 3 + (-9)/12 + (-51)/68. Let m = 6.5 - 4.6. Let w = m + -2. Which is the nearest to -2/3? (a) g (b) w (c) 3 b Let m = 58.08 + -58. Let u = m - -0.92. Which is the nearest to -0.6? (a) -2/3 (b) -0.3 (c) u a Let h = 8 + -4. Let f = 308.9 + -308.5. What is the closest to 0 in f, 0, h? 0 Let g = 1 + -1.5. Let u = 3.95 + -3.9. Let q = u + 4.95. Which is the nearest to -0.1? (a) g (b) 4 (c) q a Let v =	{ "pile_set_name": "DM Mathematics" }
Let i be v(-8). Let m = 9 - 15. Let l(p) = p*3 + 7p*2 + 6p + 1. Let x be l(m). Solve o = -5u + 16, io + x = 6o - u for o. 1 Suppose 0 = 3u, 4p - u + 0u - 20 = 0. Solve -2x - x - 2t - 10 = 0, -px = 5t + 15 for x. -4 Suppose 0 = 2g - 3g. Let p be 5 + g4/8. Solve k - f - 2 = 6k, -3k + 10 = -pf for k. 0 Let q = -6 + 8. Suppose m = 2m - 6. Let r be m/(-14) + (-217)/(-49). Solve -5z + qt + 12 = -1, -rt + 19 = 5z for z. 3 Let n(k) = k - 2. Let j be n(6). Solve -4y - 1 + 5 = jh, 0 = -5h + 3y + 37 for h. 5 Let l(n) = -n2 - 9n + 5. Let u be l(-9). Let j be (0 + 2)(-12)/(-8). Solve -4g - uq = 17, -6g + 3g + 21 = -jq for g. 2 Suppose 0 = -4x + 1 + 7. Let s be x/(-2 - (-15)/6). Solve -3m - 5k = -17, 3m - 4 - s = 4k for m. 4 Let w = 17 + -11. Suppose 3h = 3d + 3 + 3, -3d = -h + w. Solve h = -4b - 4n + 16, 0n + 4n = -b + 4 for b. 4 Suppose b + 8 + 0 = 2c, -2c + 4 = -3b. Solve 2a + 11 = -5q, -5a + 2 + 2 = bq for a. 2 Let d(t) = -t2 + 1. Let s be d(1). Let f = 31 + -31. Solve f = 5a, -4x + 3a + 1 - 5 = s for x. -1 Suppose 4z + 5g - 41 = 0, 0z + z - 4g - 5 = 0. Suppose 3v + 0v + 5w = 35, -v - w + z = 0. Solve vu + 4q = -10, u + 10 = -4u - 5q for u. -2 Let l = -7 + 21. Let x be 10/6((-28)/(-4) + -4). Solve -5p + l = -2c + 39, -p - xc - 5 = 0 for p. -5 Let n(x) = 2x - 6. Let o be n(7). Suppose -2w = o, 2w + 18 = c - 2w. Solve 0 = cm - 3y - y + 22, y = -2m - 7 for m. -5 Let z(v) = -2v - 3. Let g be z(-7). Suppose -26 + g = -5r. Let p(m) = -m*2 + 3m + 2. Let y be p(3). Solve -t + 5 = -n, -3t = -n - y - r for n. -5 Suppose r = -2b - 5, 2b + 0 - 7 = -5r. Let y be (-3)/((-42)/b)-14. Solve 4m + y = -4c, 3c - m = 4 + 13 for c. 4 Let q be (-2)/9 - (-376)/72. Solve 2k = -3w + q, -k + 4w - 1 - 2 = 0 for k. 1 Let m = 16 - 14. Let b(o) = -2o + 4. Let l be (-25)/4 - 1/(-4). Let n be b(l). Solve -2p = v + 2v - 1, -n = mv - 2p for v. -3 Let r = -2 - -18. Let v = r - 12. Solve -5k + 3 = -2i, vk - 14 = 3i - 6 for i. -4 Let k(n) = -2n + 23. Let v be k(10). Solve -vx = -8x + 2z + 23, 2z = -x - 5 for x. 3 Suppose 3m - 5 + 5 = 0. Solve -5a - 5b + 50 + 0 = m, -5 = -b for a. 5 Let o be 28/(-10)(-45)/18. Suppose o - 2 = k. Solve 5d - 2w + 9 = w, -5d - kw = -15 for d. 0 Let i = 0 + 2. Let p be 15/(-2)(-6)/9. Suppose -pd + 7 = -3. Solve m - 8 = -m - ir, -dm = -4r + 4 for m. 2 Suppose 4h = y - 3, 13 + 30 = 3y + 5h. Solve 2f + 3j + 1 - 2 = 0, -f + 2j = -y for f. 5 Let s(w) be the third derivative of -w6/120 - w5/15 - w*4/6 - 8w*2. Let m be s(-4). Solve z + 14 = 5r - 2, 0 = 3z + r - m for z. 4 Suppose -4z + 2f + 12 = 0, -14 + 5 = -3z + 3f. Let j be (1/(-2))/(z/(-6)). Suppose 0 = -5a + 9 + j. Solve -5q - 3o - 4 = a, q = -5o - 10 for q. 0 Suppose -2h - 8 = -4h. Let p be h/12 + (-1)/3. Solve 0 = -f - pf + 3c + 7, 0 = f - 5c - 15 for f. -5 Let d(o) = -o*3 + 6o*2 + 5o + 16. Let y be d(7). Solve w + 20 = -yx - 3x, 2x - 4w + 30 = 0 for x. -5 Let w = -15 - -17. Solve v + 2j = 2, 0 = -5v - wj + j + 1 for v. 0 Suppose 0 = -o - 4o. Let n be (0/2)/(o - 2). Let u = n + 9. Solve 5y + 62 = -4z + 21, 5y - 4z + u = 0 for y. -5 Let r be (4/6)/(-1)-3. Let u = 14 - 10. Suppose 0v + uv = 16. Solve -2x - g = -7 - 0, vg = -rx + 10 for x. 3 Suppose -2l = 3w - 16, 3w - 4 = 2l + w. Let f be (29 - (l - 2))1. Solve -5s + f = 2m, -5s - 3m + 4m = -23 for s. 5 Suppose q = 5q - 12. Suppose 2a - qa = 0. Solve -v - 8 = -4p - 20, -3v - 5p + 2 = a for v. 4 Suppose 2c = -4z + 30, -6c - 40 = -2z - 2c. Solve 14 = -4b - 4r - 10, -z = 2r for b. -1 Suppose 0 = -0g + 4g - 5l + 9, -g + 2l = 3. Let w(f) = -19f + 1. Let u be w(g). Solve u = 4s, 10 = 3t + 3s - s for t. 0 Let q be 2/(-3)(-54)/4. Suppose -5r + 5 = -4r. Solve -ru + 4 = 2o + 25, 0 = -3o - q for u. -3 Suppose 3 = -d + 17. Suppose 2t = 5g - d, 3g - g = t + 6. Solve -j = -5s - 16, -j + s + 6 = gj for j. 1 Let z(j) = 2j + 4. Let n be z(-2). Solve -4x = 2i, i - 12 = -nx + 4x for i. 4 Suppose 8o = 3o. Solve -2h + 13 = -3x, h - x = 4 - o for h. -1 Suppose -14 = -5z + 1, k + 4z = 15. Let l(v) = v*2 + v - 2. Let j be l(k). Solve -3o - 2n = j, 2o = -2n + 3n - 2 for o. -2 Suppose 0 = -4a - j - 4j + 72, -2a + 2j = -18. Let o = 23 - a. Solve -3x = i - o, x - 2x + 3i = -10 for x. 4 Let b be 26/7 - 4/(-14). Let n be (-780)/(-55) + (-4)/22. Solve -2l - 3 = a, -l + ba - 38 = -n for l. -4 Suppose a + 2 = 0, -2a + 2 = 2i - 0i. Solve -3j + i = 5s - 5, 0 = -s + 4j + 20 for s. 4 Let m = -7 + 12. Suppose -o + 27 = 2g, 3g + mo = g + 7. Let s(l) = l*3 - 7l*2 + 4l - 24. Let f be s(7). Solve 0 + g = k - fh, -4k + 12 = -3h for k. 0 Suppose -5r = 4u - 2, -2r - 3u - 6 = 2u. Solve 3 + 5 = -o + 4l, -r = -2l for o. -4 Let m be 4/618 - 3. Let a = 14 - m. Solve 0 = 5f - 2f - 4c - 16, f - 20 = ac for f. 0 Let p = 17 + -19. Let y be 4/p - (-8 + 6). Solve -j = -yj - 3g + 4, 4 = -3j + 5g for j. 2 Suppose 0 = 2l - 4q - 38, 3l - 2q = -2l + 63. Let g(f) = -f - 7. Let y be g(0). Let k = l + y. Solve 0b + 20 = -4b - 4o, 0 = -kb + 3o - 6 for b. -3 Let z be 0 + (4 + -6)-1. Solve -5l - 5x - 5 = 0, -1 = 2l + zl + 3x for l. 2 Let h be 119 + (-2 - 0). Let f be 0 + 2 + 12/4. Suppose 0 = fd - d - 12. Solve 0 = -5n + r + h + 1, -r = d for n. 3 Let w(b) = 7b. Let v = 2 - 1. Let a be w(v). Suppose 0 = -0d - 5d. Solve -i + di = -1, 4i = -p + a for p. 3 Let n be 1 - 4(1 + -2). Suppose -h + 2 = -b, 3b - nh = 2b - 10. Let a be ((-10)/2)/(0 - 1). Solve f - 2c = 7, bf + f + a = -c for f. -1 Let a be ((-22)/6 - -3)-15. Suppose -t = t - a. Solve -c = g - tc + 15, 45 = 4g + 5c for g. 5 Let g(a) = 2a + 46. Let w be g(-16). Let k = 13 + -8. Suppose kr - w = -4n, n + 2n - 7 = -2r. Solve rm - 3u + 28 = -2m, 2m - u = -12 for m. -4 Suppose 5k + 35 = 4s, 5s - 3k - 55 = k. Solve -4u - 4i - 13 = s, -2u - i - 9 = 0 for u. -2 Let q = -50 + 53. Solve u + 9 = qx, 3u + 1 + 2 = -3x for u. -3 Let w(u) = -u*3 + 4u*2 + 2u - 4. Let j be w(4). Solve 3p + 13 = l, jp + 23 - 2 = 5l for p. -4 Suppose -i = 2b + 3, -3i = -5i - 10. Let s be 3 - ((-6)/2 + b). Solve -g = so + 4 - 10, -3 = -5g + 2o for g. 1 Let s be ((-8)/3)/((-2)/3). Solve 2p = v + 4, p = -2v + 4v - s for v. 4 Let f(w) = -w - 3. Let z be f(-7). Solve -3v - 1 = -2t + 3, 4t + 32 = -zv for v. -4 Let h = 0 - 2. Let u be (-164)/(-12) + h/(-6). Suppose 0w = -w + u. Solve 0 = 5g - g - 2t + w, 2g - 4t = -22 for g. -1 Let c = -4 + 6. Suppose -16 = -4q + 2y, -cy - 14 = 4q - 7q. Let s(u) = 2u2 - 5u + 5. Let g be s(2). Solve 0 = gt - 15, -qb - 3t + 10 = -3b for b. 5 Suppose 0 = 3i + u - 78, 3u = -0 + 9. Suppose 11k + 5k - 96 = 0. Solve 5v = 4h - 2, -5h + v = kv - i for h. 3 Let g(t) = -t + 15. Let u be g(12). Solve -uh - 18 = v, -2h - 2v + 3v = 7 for h. -5 Suppose 2c = -3c + 30. Suppose -cz + 4z = -4. Solve 0 = 3v + zj + 25, 2v + 3j + 9 = -16 for v. -5 Suppose -3o + 2 = -2o. Solve -6 - 2 = 4s - 4w, -ow = 2s - 4 for s. 0 Let l(i) = i*2 - 7i - 5. Let f be l(10). Solve -2a + o + 0o + 8 = 0, 0 = -5a + 5o + f for a. 3 Let h(a) = a*3 + 8a*2 - 3a + 2. Let t be h(-8). Solve -t = 2i - 6i + 5g, 3i - 14 = g for i. 4 Suppose -k = 2k - 3m - 39, -2m = 6. Let q(v) = -v3 - 4v*2 + v. Let s be q(-4). Let u = s - -6. Solve 3a - a = -4g - k, 0 = -ua + 3g + 4 for a. -1 Let n = 13 - -2. Let q(r) = -2r - 7. Let y be q(-9). Suppose 4p = -5c + 12 - 5, -2c = -3p + y. Solve n = m + 3m - k, -5m = 4k - p for m. 3 Let l(z) = z3 + 6z*2 - 8z + 5. Let m be l(-7). Solve -3o - m = -3h, -5h + 21 = -3o - 1 for h. 5 Let m be 96/52 - 2/(-13). Solve 0 = -5j, 1 = -md + d + j for d. -1 Let g be -2 + 5 + (-2 - (0 + -1)). Suppose -l = y - 6, -2y + 57 = 3y - 4l. Solve c + 2 = gj - 1, 3c = -y for j. 0 Suppose 5o + s - 39 = -s, -5o - s + 37 = 0. Solve -5a + 17 = o, f = a - 2 for f. 0 Let o = -14 - -9. Let j = o + 10. Suppose 3q = -jz - 9, 1 = -2z - q - 2. Solve 4f - a - 12 = 0, 4f - 3a - 4 = -zf for f. 4 Let t = 14 + -23. Let h be (84/t)/(1/(-3)). Solve -6 = -2b, -4g + 1 = -5b + h for g. -3 Suppose 3*q =	{ "pile_set_name": "DM Mathematics" }
/sqrt(2)) + 2). -2 + 49sqrt(13)/15 Simplify (5 + (-5 + sqrt(75))1 + -1 - (2 + (sqrt(75) + sqrt(75) + 2 - sqrt(75)) + -5(sqrt(75) + -1 + sqrt(75)) + -1))2. -900sqrt(3) + 7581 Simplify 1 + (5(-1sqrt(30) - sqrt(30)))/sqrt(10) - (sqrt(6) + sqrt(6) + (sqrt(96)/sqrt(2))/sqrt(8))/((sqrt(2) - (sqrt(2) - sqrt(32)))-3). -39sqrt(3)/4 + 1 Simplify ((5 + sqrt(153) - (sqrt(17) + (3sqrt(17) + sqrt(17) - sqrt(17))1) - (4 + sqrt(1700)1-4))-2)2. 312sqrt(17) + 103432 Simplify 1(6(5 + 5(-2 + sqrt(192))))2-1. -173700 + 14400sqrt(3) Simplify (-3 + -1(1 + sqrt(405)) + 0 + sqrt(405) + 4 + -4 + -4(sqrt(5) - sqrt(5)-1) + -2)*2. 96sqrt(5) + 356 Simplify (62sqrt(104)35)/(2sqrt(800)12). 9sqrt(13)/2 Simplify (1-5(((sqrt(27) - sqrt(3)) + 0)1 - -5(sqrt(27) + 0))-1)2. 21675 Simplify (sqrt(6336) + 1)2 + (sqrt(5324)-3 - sqrt(44)) - ((1sqrt(44)2)*2 - (sqrt(44) + sqrt(176) + 1 - sqrt(44)))-3. -32sqrt(11) + 6862 Simplify ((sqrt(102) + 4((sqrt(102) - sqrt(102)-1) + sqrt(102) + sqrt(102) + sqrt(102)))41)/((sqrt(2646)2 + sqrt(2646) + sqrt(2646) + sqrt(2646))-3)6. -8sqrt(17)/5 Simplify (2(sqrt(882) - -61sqrt(882)))/(((sqrt(108)1 - sqrt(108))/sqrt(2) + sqrt(54))/(sqrt(96)5)). 1960sqrt(2) Simplify (3 + -4 + 1(sqrt(704) + -3) + sqrt(704)-2-5 + 1 + -4)*2. -1232sqrt(11) + 85233 Simplify (-3-6((sqrt(567)-25 - sqrt(567)) + -4 + (sqrt(700) - (sqrt(700) - 2sqrt(700)) - ((sqrt(84)-2 - sqrt(84)) + sqrt(84))/sqrt(12)) + 5))*2. -49896sqrt(7) + 13447296 Simplify (sqrt(108)/(sqrt(144)/sqrt(4)) - (sqrt(432) + -1sqrt(432)3))/((sqrt(128)1 + sqrt(8))/(sqrt(128) + sqrt(2))). 45sqrt(3)/2 Simplify 4((sqrt(275) + -1 + 1)25 - ((-6(sqrt(275) + 2 + sqrt(275)) - sqrt(275)) + 3)2). -180724 - 4680sqrt(11) Simplify ((3((2sqrt(110)-2 - sqrt(110)) + -5-2sqrt(110)))/(((sqrt(100)-2)/sqrt(10) - (sqrt(360) + sqrt(360)2 + sqrt(10)))4)-5)2. 6875/784 Simplify (-1(4(sqrt(1500)1 - sqrt(1500))/sqrt(12) + (sqrt(875)-1 - sqrt(875))/((sqrt(252) - (sqrt(252) + -1sqrt(252))) + sqrt(7))))*2. 500/49 Simplify 5 + ((((-1sqrt(231))/sqrt(7))/(sqrt(11) - 2sqrt(44)/sqrt(4)))2 - -1(sqrt(75) - (-2 + sqrt(75)-2))). 10 + 15sqrt(3) Simplify -2(-1 + sqrt(1100))2 + 2(1 + sqrt(1100))*2 + ((2 + (1 + sqrt(1100))4)-2)2. 2000sqrt(11) + 70544 Simplify -1 + -1(5 + 5(-3 + (sqrt(1900) + -2)6)-5). -381 + 1500sqrt(19) Simplify (3sqrt(378) - -3sqrt(3402))/((sqrt(384) - (-2sqrt(384) - sqrt(384))) + sqrt(864)3). 9sqrt(7)/17 Simplify ((sqrt(6)/(sqrt(8)/sqrt(4)) - sqrt(3))6 + 5(sqrt(75) + sqrt(75)-2) - (5(sqrt(216) - (-2sqrt(216) - sqrt(216))))/(sqrt(24)/(sqrt(12)/sqrt(4))))2. 21675 Simplify (-41((1sqrt(2000))*2 + -1 - sqrt(2000)) + 5)6 + 5. -47941 + 480sqrt(5) Simplify (((sqrt(126)/sqrt(3)6)/(sqrt(2)-14))/(6sqrt(84)/(sqrt(108)6 + sqrt(12))))*2. 1083/16 Simplify 2 + (sqrt(175)-1-5 + 6(-1 + sqrt(175)) - (-3(-2 + sqrt(175) - sqrt(175) - sqrt(175)) + (sqrt(175) + 0)-3))*2. -1320sqrt(7) + 21321 Simplify -1-3(1 + ((1 + sqrt(637))*2 + sqrt(637) + 4)2) + -3. 126sqrt(13) + 3852 Simplify 6(-1-2sqrt(176) - 6(sqrt(11)1 + sqrt(11) + -3)*2)-1. -480sqrt(11) + 1908 Simplify 1(0 + sqrt(272) + sqrt(272) + sqrt(272) + 0) - ((sqrt(272) - 4((sqrt(272) + 2)2 - sqrt(272))) + 1). 56sqrt(17) + 1103 Simplify 1 + (sqrt(2057)3-5 + sqrt(2057))2 - ((sqrt(34) + sqrt(34) + sqrt(272)/sqrt(8))/sqrt(2) + (1 + sqrt(17) + -1)2). -3sqrt(17) + 403156 Simplify (4(5 + 6(sqrt(325) + 1) + 1) + 3)2. 12240sqrt(13) + 189801 Simplify (5 + 2-1sqrt(99))4 - 6-2sqrt(396)2-6. -888sqrt(11) + 20 Simplify (-5 + (1sqrt(1331)-1 + -2 + 0 + sqrt(1331) - (1 + (sqrt(1331) + 3)5)))2. 2530sqrt(11) + 33804 Simplify (11(sqrt(2200) - -3sqrt(2200)))/(31(-3sqrt(4))/sqrt(2)). -40sqrt(11)/9 Simplify -3 + 2 + (5(sqrt(605)1-4 + (sqrt(605) - (sqrt(605) - (sqrt(605) - (-1 + sqrt(605) + -1 - sqrt(605)))))))*2 + 5. -3300sqrt(5) + 136229 Simplify (((1sqrt(108))/sqrt(9))/((-1sqrt(33))/sqrt(11)))/((sqrt(88)/(sqrt(22)/sqrt(2)) + sqrt(8))/(6sqrt(4)1)). -3sqrt(2) Simplify ((4sqrt(119)3 + sqrt(119))/(sqrt(70)/(3sqrt(10))) - 5(1sqrt(153)-4 + sqrt(153))-4)*2. 337977 Simplify sqrt(2)-2 + -5 - -2(1 + sqrt(2))2 - -12(sqrt(200) + 0)2. 2sqrt(2) + 401 Simplify -1 + (sqrt(891) + (sqrt(891) - (-1sqrt(891) + -2)))2-2 + 2 + (-5(sqrt(891)1 - sqrt(891)))*2 + 3. -16042 - 216sqrt(11) Simplify (sqrt(77) + 25sqrt(77) + 5(sqrt(77) + 5sqrt(77)))/(-14((sqrt(1100)-4 - sqrt(11)) + sqrt(11))). 41sqrt(7)/160 Simplify (2 + (((sqrt(108) + 2)4 + -1)-3 - (-4 + 52-2sqrt(108))))2. -1440sqrt(3) + 7137 Simplify -5 + (2sqrt(275))2 - (sqrt(66)/(sqrt(18)/sqrt(3)) + -4) - ((sqrt(1584) + 1)-5 - (sqrt(33)/(1sqrt(75)))2). 59sqrt(11) + 27611/25 Simplify (sqrt(1331)2)2 + -2 + sqrt(55)/(1sqrt(320) + sqrt(320)) - ((-5 + sqrt(539)-2-4)6)2. -1237434 + 322561sqrt(11)/16 Simplify (sqrt(1584) + 2)6 + -5 - 5(5 + sqrt(1584)-1). -18 + 132sqrt(11) Simplify (1 + ((sqrt(132)2 - sqrt(132))1 + ((sqrt(132) + (sqrt(132)-1 - sqrt(132)) - sqrt(132)) + sqrt(132))-1)/((-1sqrt(144))/sqrt(3)))2. -2sqrt(11) + 12 Simplify ((1sqrt(48)/sqrt(4))/(sqrt(96) + sqrt(96)1 - sqrt(96)))*2-3 - (-31sqrt(24))/(sqrt(24)/sqrt(2)3). -3/8 + sqrt(2) Simplify -1((sqrt(162) - ((sqrt(162) + 0)2 + sqrt(162)) - (0 + sqrt(162) + -3))4 + -1). -11 + 108sqrt(2) Simplify (((sqrt(153) + 1 + 2 - (0 + sqrt(153))5)-6 + (sqrt(153) + 0 + sqrt(153) + sqrt(153) + 4 + sqrt(153) + 1)3)-2)2. -2592sqrt(17) + 793188 Simplify (-4 + (0 + sqrt(2448))2 + 3 + 0 + (sqrt(2448)2 + 2 - (-5 + sqrt(2448)1)) + 4)2. 720sqrt(17) + 22132 Simplify ((6sqrt(192)/sqrt(4) - sqrt(48) - (0 + sqrt(48) + 3 - sqrt(48)))2 + 6-1sqrt(108)1)5. -780sqrt(3) + 6045 Simplify 1sqrt(847)-5 + -1(sqrt(847) + (sqrt(847)2)*2) + sqrt(847)-2-5 + -2((sqrt(847)2)2 - sqrt(847) - sqrt(847)) + 4. -10160 + 88sqrt(7) Simplify -2(1(5 + (1 + sqrt(1331))*2) - (5 + sqrt(99)/(sqrt(729) + sqrt(729)3 + sqrt(9)))). -2664 - 1626sqrt(11)/37 Simplify -5(sqrt(11) + (sqrt(11) - sqrt(33)/sqrt(3))*2 + 5 + sqrt(77)/(sqrt(7)2))6 + 1(sqrt(891) + ((0 + sqrt(891))-1)2)4. -9sqrt(11) + 3414 Simplify ((0 + -1(sqrt(19) + (sqrt(684) - sqrt(19))))-6 + -5 + (-4sqrt(684) + sqrt(684) - sqrt(684)) + 4)-3. -36sqrt(19) + 3 Simplify 2 + (4((sqrt(7) + 3)-2 + -4))*2 + (((sqrt(343) + 1)-2)*2 - sqrt(343))-6. -6206 + 346sqrt(7) Simplify (-5(2 + 2 + sqrt(243) + -2 + 3 + 0) + 3)*2. 1980sqrt(3) + 6559 Simplify ((4 + -4 + (6(sqrt(170) + sqrt(170)1))/(-1sqrt(50)/sqrt(5)))-4)*2 + -2. 39166 Simplify ((1sqrt(1331) + sqrt(1331) - sqrt(1331)) + sqrt(99)/(sqrt(18)/sqrt(2)) - ((sqrt(99)-2)/sqrt(9) - (2 + 2sqrt(11))))*2 + -1 + -1. 64sqrt(11) + 2818 Simplify (6((sqrt(88) + sqrt(88)3)2 + -2(sqrt(88) + (sqrt(88) - 3sqrt(88))))/(-5-4(sqrt(392) + (sqrt(392) - (-2sqrt(392) - sqrt(392))))))*2. 99/1225 Simplify (3(2sqrt(95) + sqrt(95)) + sqrt(95)-5-5)/((sqrt(180)/(sqrt(12)2))/((sqrt(18) + sqrt(108)/sqrt(6))/sqrt(6))). 136sqrt(19) Simplify (((-1 + sqrt(2299))-5 + (sqrt(2299) - (sqrt(2299) + -1)2))2-4 - (2sqrt(2299)6 + (sqrt(2299) - (2 + sqrt(2299) + -3)))*2)4. -2649236 + 13728sqrt(19) Simplify ((sqrt(135)-2 + sqrt(135) + (sqrt(60)-1 + sqrt(60) - sqrt(60))/sqrt(4))/((-5(sqrt(6) + sqrt(24)))/((sqrt(50) + sqrt(2))4)))2. 1024/5 Simplify ((((-1sqrt(896))/((sqrt(84) - sqrt(84)-3)/sqrt(12)) + -5)-3)*2 + -5)2. 360sqrt(2) + 584 Simplify 1((sqrt(891)-1 + 1)2)*2 + (4 + (sqrt(891) - 1sqrt(891) - sqrt(891) - sqrt(891))3)2-1. -28524 + 360sqrt(11) Simplify -3 + -1sqrt(13)4 + 5 - (4 + (0 + sqrt(13) + sqrt(39)/sqrt(3) - sqrt(26)/sqrt(2)5)). -sqrt(13) - 2 Simplify 1 + (sqrt(1700) + 3sqrt(1700)-5 - sqrt(1700)) + sqrt(68) + (sqrt(68) - (3 + sqrt(68) + -1)*2) + 3. -154sqrt(17) - 68 Simplify ((sqrt(76) + 1sqrt(76))-1)/sqrt(4)-3 + (4 + sqrt(19) + -4)2 + (sqrt(171)/sqrt(324))2. 703/36 + 6sqrt(19) Simplify (3sqrt(133)-5-2-3)/(-652sqrt(112)). 3sqrt(19)/8 Simplify (-3 + 4((sqrt(425) + 3 + sqrt(425)2 - sqrt(425)) + -1) + (2 + sqrt(425))3 + -2 + sqrt(425) + -2)2. 840sqrt(17) + 61249 Simplify (-4-3(sqrt(1225)2 + sqrt(1225)))/(-6	{ "pile_set_name": "DM Mathematics" }
))(8/7) assuming m is positive. m(183/20) Simplify (((oo(2/23))/oo)(8/7))(-2/67) assuming o is positive. o(-400/10787) Simplify ((f(6/23)/f)/(f/(f/(f/(ff(-29))f)f)))(-34) assuming f is positive. f(23256/23) Simplify (u20/(((u(u/(u/(u/(u*19u))))/uu)/u)/u))/(u(-13)/u)(-41) assuming u is positive. u(-534) Simplify (o/(oo/o*(1/13)))/(oo/o*(-6/13)oo)o/(o/o*8)(o*(-2/3)oo)/o assuming o is positive. o(115/39) Simplify (k/((k/(k/(k5/k)))/k))(9/4)/((k18k)/((((kk(-22)k)/k)/k)/k)) assuming k is positive. k*(-93/2) Simplify ((ii*(-9))/ii)/(ii/(i(-2/63)ii)i)(i0i)(1/12) assuming i is positive. i(-2255/252) Simplify f*(-20)/ff(f(-3/7)ff)/f((fff*10)/f)/(ff*(-13)ff) assuming f is positive. f(11/7) Simplify (((l6ll)/(l/(ll/l(-21))))(1/27))(1/2) assuming l is positive. l(5/9) Simplify ((b/(b*(-14)/b))/(b/(bb(-8))))/((b/(b(-6)b))/(b/(bbb/(((b(bbb*(2/9))/b)/b)/bbb)b)b)) assuming b is positive. b(20/9) Simplify (ii*(-19)i/(i0/i))/(i(-3)ii/i(4/3)) assuming i is positive. i(-41/3) Simplify (u*(1/36)/(uu32))8 assuming u is positive. u(-2374/9) Simplify (r(-3/7)r)(-1/9)r(7/4)/(r/r(-8/5)) assuming r is positive. r*(-1151/1260) Simplify ((pp(2/9)/p)/(p/p(-2/9)))/(((p/(p*(-7)/ppp))/p)/(pp/p(4/5))) assuming p is positive. p(-29/5) Simplify m*(24/5)mmm*(-7/3)mm(m*(-6)/mm)(1/2) assuming m is positive. m(52/15) Simplify ((b*(-14/5)/b)/b(b/b*(-23)b)/b)/(((bb12/b)/bbb)/(b(-34)bbbb)) assuming b is positive. b(-119/5) Simplify (j5/(j/(j/j(-3/19))))/(j(-20)jj)44 assuming j is positive. j(15146/19) Simplify (n3)(-2/99)n*(-12)/(nnn(-8)) assuming n is positive. n(-200/33) Simplify (((y/((yy*(2/89)/y)/y))/y)/(yy*(2/75)y))(-3/13) assuming y is positive. y(7003/28925) Simplify (iii*(2/11)/ii*(-2)((i/(i(1/11)/i))/i)/(i9/i))(-4) assuming i is positive. i(348/11) Simplify ((oo(-3/5))/(o/(o/(((o(o*2/o)/o)/o)/oo))))/(((o/(o/(o/(o/((oo7o)/o)o))oo))/oo)/((ooo(2/19)/o)/o)) assuming o is positive. o(-427/95) Simplify (x(-3/2))(4/5)/(((x/(x*(-3/11)x))/x)/(xx(-15)x)) assuming x is positive. x(-741/55) Simplify ((n/(n/n(2/17)))/n7)/(n/(n/(n/(n/((n(3/4)/n)/n)))))(1/17) assuming n is positive. n(-463/68) Simplify k(2/9)/k(-1/2)(k0)(-14/5) assuming k is positive. k(13/18) Simplify (r(-2/3)/r)(2/7)r*(-11)r3 assuming r is positive. r(-178/21) Simplify (l*(-27)ll(l/(l*(3/5)ll))/ll)(-50) assuming l is positive. l1330 Simplify (m13)(1/42)m22m(2/73)/m assuming m is positive. m(65419/3066) Simplify ((i(-1/4)/i)/i)/(i(-1/11)/i)ii*(2/25)i/i(-1/5) assuming i is positive. i(1233/1100) Simplify ((z*(1/5)z)/z*(2/3))/((z/(zzz(-2/15)/z))/z)(1/21) assuming z is positive. z(181/315) Simplify (((o/o(12/13))/o)/(oo/(o/((oo(-1))/o))))/(o(-3/29)o39) assuming o is positive. o(-15012/377) Simplify (((b2/b)50)(-19))(-1/53) assuming b is positive. b(950/53) Simplify (((r12r)/r)/r6)16 assuming r is positive. r96 Simplify (((m1m)(-2/33))(-45))(-16) assuming m is positive. m(-960/11) Simplify (r/(r*(-2/17)r))*(1/5)/(rrr/((r(-3/7)/rr)/rr))11 assuming r is positive. r(-22426/595) Simplify ((g/g(-13)g/(g/g*13)g)(-24))(-1/36) assuming g is positive. g*(56/3) Simplify (ss/(ss(-1/2)))(3/5)s/s*(-3/4)ss/(s/(s/(ss*(2/107))s)) assuming s is positive. s(9911/2140) Simplify ((x(1/10)/x)3)(-22/7) assuming x is positive. x(297/35) Simplify ((w/(w/w31))/w)/(w/(ww(17/2))ww)w*(-12)/((ww(3/8))/w) assuming w is positive. w(193/8) Simplify (gg/(g(-2/9)/g))(-1/30)(gg/g(-2/11)g)9 assuming g is positive. g(84731/2970) Simplify (((h/(hh(2/13)h))(-12/5))(-41))(-2/11) assuming h is positive. h(2952/143) Simplify (o(-1/7))(2/5)/(o(2/3))(-11) assuming o is positive. o(764/105) Simplify (b(-9)b1)(2/37) assuming b is positive. b(-16/37) Simplify l(-12)/(l(2/11)/l)l((ll*(-27))/l)/llll/((l(2/7)/l)/l) assuming l is positive. l(-2577/77) Simplify x*12xxx((x(2/5)/x)/x)/xx1/(x(-10)x) assuming x is positive. x(112/5) Simplify i/(ii/((i*(-9/7)/i)/i)i)iii(-1/26)(i7)(5/13) assuming i is positive. i(-115/182) Simplify (x(-3))18/(x4xx(-1/15)) assuming x is positive. x(-884/15) Simplify (b*(-5)bb)48/(b(bb20)/bbb(-2/55)b) assuming b is positive. b*(-9183/55) Simplify (qq/q*(-2/7)qq/q(5/3))/(q/q12qqq14) assuming q is positive. q(-50/21) Simplify (q(-3/4))(-5)/(qqq/(q*3/q)qqq(-2/45)) assuming q is positive. q(143/180) Simplify ((hh(1/11)/h)(2/5))10 assuming h is positive. h(4/11) Simplify (vv/v(-11))/(v/v(3/13)v)(v/(vv11)v)/(v*(-18)v) assuming v is positive. v*(237/13) Simplify (c(c*(-2)/c)/cc)(-28/9)/(c(-7)/c(-9)) assuming c is positive. c(38/9) Simplify (aa/a17)/(a((((a*(1/22)/a)/a)/a)/a)/a)a*12aa6 assuming a is positive. a(175/22) Simplify ((b2)(-42)b*(-8)b(-1/13))(3/31) assuming b is positive. b(-3591/403) Simplify ((c/c8c)/c)(-18/7)/(c(-17)/c(-15/8)) assuming c is positive. c(265/8) Simplify (r7)5(rr(r/(rrr/(r(((rr/(r/(r/(r/(r/r*(-2/15)))))rr)/r)/r)/rrr)))/rr)(1/17) assuming r is positive. r(8987/255) Simplify ((o0/(o(4/3)o))24)(-3) assuming o is positive. o168 Simplify (x20/(x/(x/(xx*(-13)))))/(xx*(-6)x)17 assuming x is positive. x100 Simplify ((c/c*12cc)/(cc(4/5)))/(c(-2/11)ccc(-4)c) assuming c is positive. c(-529/55) Simplify ((j(2/7))(-33)/(j1/jjj(-3/11)))(-1/18) assuming j is positive. j(391/693) Simplify ((a(-8/7)a)/a)7/((a(-9)aaa)/a)(2/31) assuming a is positive. a(-234/31) Simplify (bb(1/4))/(bb*(1/13))(bb2)/b18 assuming b is positive. b(-771/52) Simplify (s(1/29)/s(-7))14 assuming s is positive. s(2856/29) Simplify ((w/(w/(w/w(1/6)w))w(-2))(-6/7))(-30) assuming w is positive. w(-30/7) Simplify (((x(-2/9))(-1/2))(-1/38))(6/11) assuming x is positive. x(-1/627) Simplify v(-10/9)v/(vvv*(-17/3)vv)v(-5/8)/v(-30/7) assuming v is positive. v*(2629/504) Simplify (((mm/m*4mmm)/(m*(-1/3)m))/((m*3m)/m5))(5/6) assuming m is positive. m*(10/9) Simplify (cc(2/21))(-4/19)((cc/(cc/(cc*(1/6)c)ccc))/c)47 assuming c is positive. c(-68945/798) Simplify (i14)(1/31)/((i/(i/i(3/19))i)/(iii*2iiii)) assuming i is positive. i(4296/589) Simplify (((j/j(18/7))/j)/(j/j(-5)))/((j(1/4)j)/((j*11jj)/j)) assuming j is positive. j(61/28) Simplify (((zzzz*(2/21))/zz)/((z/(z/z14))/z))/(z(-1)(z/(z/(zz/z*(-7/5)))z)/z) assuming z is positive. z(-1292/105) Simplify (d(-20)/dd30d)(-5/6) assuming d is positive. d(-25/3) Simplify (nn/n25nn22)/((n((n/n*25)/n)/nn)/(nn/(n8/n)nn)) assuming n is positive. n21 Simplify x(-1/3)(x(((x((x/(x/x*(-2/25)))/xx)/x)/x)/x)/xx)/x(xx/x(5/6))/x(x(4/13)/x)/x assuming x is positive. x(-7681/1950) Simplify ((k*(-2/3)k)(-16)/(k(-2/11))(-36))(-25) assuming k is positive. k(9800/33) Simplify ((a/a(-1/5))/aaaa7)/(a/a6aa6) assuming a is positive. a(36/5) Simplify (tt*(2/23)t)/(t/(t*(-3)/t))(t(t/t(1/20)tt)/t)/t(-1/8) assuming t is positive. t(149/920) Simplify (t(-2/21))19/(t17/((t/(t(t/(t*(-3/7)/t)t)/t)t)/tt)) assuming t is positive. t(-425/21) Simplify (i/(i(-1/6)i))(1/8)(i*12i)/(i(-10)/i) assuming i is positive. i(1153/48) Simplify ((((((xx1)/x)/x)/x)/(x(3/4)x))(-36))(-1/10) assuming x is positive. x(-99/10) Simplify ((s18s)/((ss(-1/21))/s))(-9/5) assuming s is positive. s*(-240/7) Simplify ((ii*(2/5)(i/(i/i*(-2)))/i)/(ii*(-2/11)ii(-1/2)))(5/7) assuming i is positive. i(-321/154) Simplify (m(-11))(-2/115)m20/m13 assuming m is positive. m*(827/115) Simplify pppppppp*(1/10)p*10(p*(-2)p)/pp10 assuming p is positive. p*(251/	{ "pile_set_name": "DM Mathematics" }
9? 2 What is the units digit of 911785? 5 What is the thousands digit of 166779? 6 What is the hundred thousands digit of 1495695? 4 What is the tens digit of 405577? 7 What is the hundred thousands digit of 917629? 9 What is the hundreds digit of 45080? 0 What is the millions digit of 5916030? 5 What is the units digit of 30192958? 8 What is the ten thousands digit of 3484065? 8 What is the millions digit of 2698360? 2 What is the millions digit of 2775434? 2 What is the thousands digit of 4937805? 7 What is the thousands digit of 1142254? 2 What is the tens digit of 700316? 1 What is the millions digit of 4847937? 4 What is the units digit of 1031979? 9 What is the ten thousands digit of 41630? 4 What is the ten thousands digit of 515843? 1 What is the units digit of 351864? 4 What is the units digit of 8080133? 3 What is the ten thousands digit of 5272123? 7 What is the hundreds digit of 918012? 0 What is the hundreds digit of 466127? 1 What is the ten thousands digit of 15966? 1 What is the hundred thousands digit of 21858684? 8 What is the millions digit of 1414579? 1 What is the hundred thousands digit of 247114? 2 What is the tens digit of 99429? 2 What is the tens digit of 2709643? 4 What is the units digit of 2304381? 1 What is the hundred thousands digit of 308298? 3 What is the hundreds digit of 44368? 3 What is the units digit of 409810? 0 What is the tens digit of 387399? 9 What is the hundreds digit of 830831? 8 What is the thousands digit of 533991? 3 What is the hundreds digit of 25889715? 7 What is the millions digit of 3396282? 3 What is the tens digit of 479635? 3 What is the hundred thousands digit of 342363? 3 What is the units digit of 2861543? 3 What is the units digit of 3797002? 2 What is the millions digit of 10253031? 0 What is the units digit of 17128262? 2 What is the hundred thousands digit of 1999198? 9 What is the ten thousands digit of 687686? 8 What is the thousands digit of 6514493? 4 What is the ten millions digit of 11347971? 1 What is the thousands digit of 6510217? 0 What is the units digit of 5974980? 0 What is the thousands digit of 477582? 7 What is the hundred thousands digit of 21059490? 0 What is the ten thousands digit of 20232? 2 What is the units digit of 4218? 8 What is the units digit of 1463364? 4 What is the thousands digit of 250817? 0 What is the hundred thousands digit of 392521? 3 What is the hundreds digit of 10410950? 9 What is the units digit of 38414? 4 What is the tens digit of 583707? 0 What is the tens digit of 1723162? 6 What is the thousands digit of 842711? 2 What is the units digit of 7427079? 9 What is the millions digit of 5153977? 5 What is the hundreds digit of 26626656? 6 What is the tens digit of 443476? 7 What is the thousands digit of 2054788? 4 What is the ten thousands digit of 427281? 2 What is the millions digit of 1405671? 1 What is the ten thousands digit of 2520912? 2 What is the hundreds digit of 114245? 2 What is the millions digit of 10680949? 0 What is the thousands digit of 515043? 5 What is the units digit of 125286? 6 What is the hundreds digit of 16469? 4 What is the ten thousands digit of 4814397? 1 What is the hundreds digit of 13732200? 2 What is the hundreds digit of 195967? 9 What is the thousands digit of 3323888? 3 What is the ten thousands digit of 6185095? 8 What is the units digit of 6995748? 8 What is the hundreds digit of 441369? 3 What is the ten millions digit of 21407858? 2 What is the tens digit of 2633350? 5 What is the hundred thousands digit of 1083883? 0 What is the millions digit of 2185825? 2 What is the hundreds digit of 277623? 6 What is the ten millions digit of 12397907? 1 What is the millions digit of 6729120? 6 What is the thousands digit of 864035? 4 What is the thousands digit of 257849? 7 What is the tens digit of 5388027? 2 What is the hundreds digit of 2034821? 8 What is the units digit of 3113636? 6 What is the ten thousands digit of 833934? 3 What is the hundreds digit of 1230983? 9 What is the ten thousands digit of 6208182? 0 What is the hundred thousands digit of 140219? 1 What is the thousands digit of 5504592? 4 What is the thousands digit of 665602? 5 What is the ten thousands digit of 3170697? 7 What is the hundred thousands digit of 489621? 4 What is the hundreds digit of 47551? 5 What is the millions digit of 1292163? 1 What is the hundreds digit of 2162727? 7 What is the ten thousands digit of 100448? 0 What is the hundreds digit of 495994? 9 What is the hundred thousands digit of 899244? 8 What is the millions digit of 2440886? 2 What is the ten thousands digit of 445643? 4 What is the ten thousands digit of 7411408? 1 What is the hundred thousands digit of 1373501? 3 What is the units digit of 4592600? 0 What is the ten millions digit of 10010006? 1 What is the ten thousands digit of 6524984? 2 What is the tens digit of 231949? 4 What is the hundreds digit of 41732? 7 What is the hundred thousands digit of 2502369? 5 What is the tens digit of 8097083? 8 What is the hundred thousands digit of 2482901? 4 What is the millions digit of 3453067? 3 What is the hundreds digit of 599834? 8 What is the tens digit of 211225? 2 What is the hundred thousands digit of 524271? 5 What is the thousands digit of 143542? 3 What is the units digit of 6885098? 8 What is the hundreds digit of 5567830? 8 What is the tens digit of 489640? 4 What is the thousands digit of 661942? 1 What is the ten thousands digit of 19443? 1 What is the ten thousands digit of 940966? 4 What is the hundred thousands digit of 417568? 4 What is the ten thousands digit of 844243? 4 What is the thousands digit of 488213? 8 What is the hundred thousands digit of 242406? 2 What is the hundred thousands digit of 3025377? 0 What is the units digit of 170599? 9 What is the thousands digit of 242220? 2 What is the thousands digit of 552171? 2 What is the hundreds digit of 55464? 4 What is the ten thousands digit of 219078? 1 What is the millions digit of 14520381? 4 What is the thousands digit of 12717223? 7 What is the hundreds digit of 1563170? 1 What is the tens digit of 122854? 5 What is the millions digit of 3290198? 3 What is the ten thousands digit of 13202628? 0 What is the hundred thousands digit of 3453902? 4 What is the units digit of 17980? 0 What is the thousands digit of 3342842? 2 What is the ten thousands digit of 21868049? 6 What is the ten thousands digit of 630010? 3 What is the hundred thousands digit of 197624? 1 What is the hundreds digit of 9950803? 8 What is the ten millions digit of 36789619? 3 What is the thousands digit of 769834? 9 What is the hundreds digit of 497692? 6 What is the hundred thousands digit of 780775? 7 What is the hundreds digit of 28914? 9 What is the hundred thousands digit of 768427? 7 What is the ten thousands digit of 420466? 2 What is the hundred thousands digit of 1301840? 3 What is the units digit of 96313? 3 What is the tens digit of 10096533? 3 What is the units digit of 17986954? 4 What is the ten thousands digit of 10202147? 0 What is the hundred thousands digit of 123386? 1 What is the hundreds digit of 198535? 5 What is the tens digit of 3572790? 9 What is the units digit of 710845? 5 What is the hundreds digit of 75792? 7 What is the thousands digit of 139542? 9 What is the ten thousands digit of 2277090? 7 What is the ten thousands digit of 8705819? 0 What is the thousands digit of 20984507? 4 What is the tens digit of 242487? 8 What is the thousands digit of 586021? 6 What is the units digit of 2242504? 4 What is the tens digit of 1865550? 5 What is the thousands digit of 3191394? 1 What is the hundred thousands digit of 18953155? 9 What is the hundreds digit of 653604? 6 What is the ten thousands digit of 35406? 3 What is the hundred thousands digit of 8443548? 4 What is the hundreds digit of 21012382? 3 What is the millions digit of 2043673? 2 What is the hundred thousands digit of 1423702? 4 What is the tens digit of 5023062? 6 What is the hundred thousands digit of 2586733? 5 What is the units digit of 1316474? 4 What is the ten thousands digit of 842562? 4 What is the units digit of 369367? 7 What is the hundreds digit of 32119738? 7 What is the hundred thousands digit of 11650246? 6 What	{ "pile_set_name": "DM Mathematics" }
n g, -0.07, r? r Let i = 13 - 97. Let u be (-10)/45 + i/(-135). Let x = -127.6 + 127.8. Which is the second smallest value? (a) u (b) -1/5 (c) 3/4 (d) x d Let o = -0.39 - -114.39. Let n = o - 113. What is the third biggest value in -3, n, -1/5, 59? -1/5 Let q be 50/(-10) + 21/2. Let o be (3/(-5))/((-1)/(-5)). Which is the third smallest value? (a) o (b) 2 (c) -0.4 (d) q c Let h = -12902 + 90317/7. Which is the fifth smallest value? (a) -4 (b) 12 (c) -0.1 (d) h (e) 3 b Let j = -776 - -777. Let a = -3.11 + -1.89. What is the third biggest value in a, j, 6? a Suppose -3d + 4n = -163, 3d - 139 = -7n + 5n. Let p be (-1476)/(-28) + 2/7. Let u = d - p. Which is the third smallest value? (a) 1 (b) u (c) -0.5 a Let y = 0 + 0.2. Let q = y - 0.05. Let a = q + 1.85. What is the biggest value in a, 0.5, 3? 3 Let f = -0.071 + -30.229. Let i = f + 33.3. What is the third biggest value in i, 30, -2/3? -2/3 Let j = -0.37348 - -873.37348. Which is the second biggest value? (a) -2/5 (b) 0.2 (c) j b Let i = -347 - -625. Let o = 277.6 - i. Let k = 8 + -8.15. Which is the third biggest value? (a) -0.5 (b) o (c) 4 (d) k b Let n be (1/(20/(-8)))/((-35)/(-25)). Let p = 791 + -786. Which is the biggest value? (a) p (b) n (c) -1/11 (d) 2/5 a Let k be -1 + (8/44)/(10/(-110)). Let f = 5.11 - 0.11. Which is the smallest value? (a) -2 (b) 21 (c) f (d) k d Let p = -434.2 + 84.2. Let r = p - -346. What is the second biggest value in r, 0.1, 42/11? 0.1 Suppose -11g = -897 + 292. Let r = -51 + g. Suppose 10 = -w + 2t, rw - w = -2t + 2. Which is the smallest value? (a) -1/5 (b) 3/7 (c) w (d) -5 d Suppose 0 = 4k - 1774 + 466. Let x = 2284/7 - k. Which is the third smallest value? (a) 0.4 (b) -13 (c) 1 (d) x a Let u be 18 + -17 - 62/38. Let z = u - -43/38. Which is the third biggest value? (a) -15 (b) z (c) 6 a Let i(u) = 26u + 22 - 18 - 22u. Let x be i(0). What is the fourth biggest value in 0.1, -1, -2/7, x? -1 Let l = -0.0577 - -2.8277. Let p = l - 3.77. Which is the biggest value? (a) 3 (b) p (c) 2/9 (d) 1/7 a Let x = 511 - 424. Let t = 87 - x. Let v = -9/10 - -2/5. Which is the fourth smallest value? (a) t (b) -6 (c) v (d) 0.4 d Let r = 462.383 - 0.383. Let u = -458 + r. What is the fourth smallest value in 5, -4, -0.04, u? 5 Let j = 383 - 406.96. Let z = 2.8 + 21.2. Let v = j + z. What is the biggest value in -1/3, 3, v? 3 Let n = 0.4 - 0.7. Let w = -7019/17 + 413. Let h = -31 - -31. Which is the second smallest value? (a) h (b) w (c) n (d) 1/2 a Let z = 330.5 + -336. Let i = 10.5 + z. What is the second smallest value in -2/13, -4, 1/52, i? -2/13 Let o be (-380)/(-19) + 994/(-49). Which is the second smallest value? (a) 0.034 (b) o (c) -33 b Let i(y) = -y2 - 41y - 318. Let n be i(-11). Which is the smallest value? (a) 10 (b) n (c) 0 (d) 5 (e) 4 c Let y = -4370 - -4544. What is the fourth biggest value in y, 2, -5, 3? -5 Let g = 4 + -3. Let w = -73601/6 + 12209. Let f = -58 - w. What is the second smallest value in 4/7, 3, f, g? 4/7 Let m = -262 - -263. Let c be 110/153/2. Suppose ca = 8a. What is the fourth biggest value in m, a, -3, -2/5? -3 Let q be 354/11 + ((-36)/22)/9. Let b be -2 + (q/(-10) - -5). What is the second smallest value in -16, -0.4, b? -0.4 Let x = 0.15215 - 2.15215. Which is the third smallest value? (a) x (b) -486 (c) 2 c Let x = -6275 - -6276. What is the third biggest value in 9, x, 0, -5? 0 Let p = -6430 + 6429. Which is the second biggest value? (a) -5 (b) 4/11 (c) p c Let x be (15/(-8))/(920/(-32) - -31). What is the biggest value in -1/5, x, 74? 74 Let j = 65.9385 + 0.0615. Let d = j + -61. What is the second biggest value in d, 1, -24, 3/2? 3/2 Suppose 2y + 6 + 2 = 0. Let r be (-2 + (-4)/y)3. Let c = -811 - -807. What is the fourth smallest value in -2/7, c, -0.06, r? -0.06 Let b be ((-110)/77)/(-3(-3 - 917/(-294))). Let a = 3.1 + -0.1. What is the biggest value in a, -16/5, b? b Let y = 105.8 + -82. Let q = -24 + y. Let l = 178 + -180. Which is the third biggest value? (a) l (b) 0.05 (c) q a Let x = 0.454 + 0.046. Suppose -57m = -77m - 240. Which is the smallest value? (a) m (b) x (c) 1 a Let s be -2(-12)/10 + -2. Let m = 427/2517 + -5/1678. Which is the third biggest value? (a) s (b) -2/11 (c) 0 (d) m c Let i = -87 - -141. Let x = -49 + 103. Let g = i - x. Which is the smallest value? (a) -5 (b) g (c) 2 a Suppose -17149 = 20u - 6089. Let h = u + 2768/5. Which is the third smallest value? (a) h (b) 5 (c) -0.5 b Let h = 0.5 + -0.3. Let t = 850 + -619. Let n = t - 230.6. What is the second biggest value in h, 9, n? n Let q = 9.07063 + -0.07063. What is the third biggest value in -2, 5, 0.055, q? 0.055 Let x = -41746 + 459226/11. Which is the smallest value? (a) 5 (b) -0.12 (c) 0.1 (d) x b Let f = -8/216625 + -1928612191/4982375. Let r be 386 - (-3 - 8/(-4)). Let g = r + f. Which is the third biggest value? (a) g (b) -1/2 (c) -0.1 b Let y = -0.5 + -3.5. Let b = -0.71605 - -45.71605. What is the fourth smallest value in 2/7, b, -1, y? b Let d = 39 - 47. Let c = d - -51. Let i = c - 43.2. What is the smallest value in i, 3, 2? i Suppose 4k - 3d - 139 = 0, -4k - 2d + 100 = -14. Let o = 29 - k. What is the biggest value in o, 6/7, -2/23? 6/7 Suppose 0 = -3p - 12 + 18, 14 = -4i - p. What is the third biggest value in 0.001, i, 0, 4? 0 Let u = -63.3 + 67.3. Which is the fifth smallest value? (a) 3 (b) 0.5 (c) u (d) 1/3 (e) -0.3 c Let n = -8 + 7.7. Let o = -180/679 - 2/97. Let r = 419 - 418. Which is the third biggest value? (a) r (b) o (c) -3 (d) n d Let x = -10.9669 - 0.0331. Which is the third smallest value? (a) -2 (b) 0.22 (c) 2 (d) x b Let c = 4 - 10/3. Let f = 9263 - 9262.9. What is the fourth biggest value in c, -26, f, 0? -26 Let l = 0 + 0.2. Let q = -8108.6 + 8135.6. What is the second biggest value in q, -0.5, l? l Let m = 0.045229 + -0.025229. Let o = 0.35 + -0.05. Which is the third smallest value? (a) m (b) o (c) -6 b Let q = -47741 + 47738. What is the biggest value in q, -1/2, 5, -39? 5 Let u = 510.497 - 510.5. What is the fourth biggest value in -2, -5, -6, 2, u? -5 Let u = 1.892 + -1.972. Which is the third smallest value? (a) -2/7 (b) u (c) 6/11 c Suppose -5k + 25 = 0, -19u + 15u + 5k - 721 = 0. Let l be (u/725)/(3/(-10)). Which is the third biggest value? (a) l (b) -12 (c) -1 b Let k = 1717.453 - 1719. Let m = k + -0.453. What is the fourth biggest value in -1/22, -1/4, 0.5, m? m Let r = -6052 + 6054.3. Which is the third smallest value? (a) r (b) -21 (c) 3 c Let y(p) = -4p - 80. Let f be y(-21). Let h = -39 - -123. Let l = h + -84.5. Which is the smallest value? (a) l (b) 1 (c) 13 (d) f a Let o = -1020.1 + 1020. What is the biggest value in o, -4, -3, -0.06? -0.06 Suppose 28r = 6r. Let f be (5/(-25) - r)3. What is the second smallest value in -3, 1/3, f? f Let x = 3178 - 34964/11. What is the fourth smallest value in -0.3, -31/6, 5, x? 5 Let y = -68 - -201. Let i = 133.1 - y. What is the second smallest value in i, 3, -1.1, -3? -1.1 Let g = 0.0711 + -1.0711. Which is the third biggest value? (a) -9 (b) -2/81 (c) g a Let p = 7090.47 + -7124. Let v = p - -34. Let r = 0.61 - v. Which is the third biggest value? (a) -1 (b) 0.3 (c) r a Let j = 749.7 + -791. Let b = -40.3 - j. What is the third biggest value in 5, b, -33, -0.1? -0.1 Let d = 1.5 - 2.39. Let s = 85.11 - d. Let n = s - 86.5. Which is the biggest value? (a) n (b) -7 (c) 4 c Let v = 0.08 - 0.08. Let m = -1.184 + 1.484. Which is the biggest value? (a) 0.5 (b) m (c) -2 (d) v a Let z = -850 - -798.3. Let k = 0.3 - z. Let v = k - 52.5. Which is the second biggest value? (a) 7 (b) 0.5 (c) v b Let o be ((-52)/12 - -5)/(-2 + 0 + 0). What is the biggest value in 1.04, o, -1/6, 0.5, 1/4? 1.04 Suppose 5n - 34 = 66. Let f be (-11 - (-280)/25) + 1478/10. Let u = 149 - f. Which is the second smallest value? (a) u (b) 4 (c) n (d) 3 d Let r = 1270.321 + 0.679. Which is the biggest value? (a) -0.1 (b) -1/2 (c) r c Let x = 4206 + -4196. Which is the second smallest value? (a) 1 (b) -1/5 (c) 0 (d) 4 (e) x c Let p(b) be the third derivative of -b4/12 + 7b3/6 + b2. Let r be p(6). Let n = -1130607/5 - -	{ "pile_set_name": "DM Mathematics" }
-3/7 (d) -1 b Let v = 218 + -217.6. What is the smallest value in v, 0.1, -2/9, 22, 14? -2/9 Let n = -0.7 + 0.2. Let m = -39525.9 - -39527. Which is the third smallest value? (a) 0 (b) n (c) m c Let q = 0.06 + 0.34. Let j = 3.961007 - -0.038993. What is the biggest value in j, q, -1/4? j Let r = 41 + -41.2. Let z = 11.004 - 10.004. Which is the fourth smallest value? (a) -0.11 (b) z (c) 2 (d) r c Let r = 8.8 - -42.2. Let z = 26 - r. Let j = z + 24. Which is the biggest value? (a) 6 (b) j (c) -5 a Let i = -2042 - -2042.3. Let a = 0.1 - 0.1. Let c = -0.1 - a. What is the second smallest value in i, c, -6? c Let v be 6/((-48)/40) + (75/9 - 4). What is the second smallest value in -3.9, 0.2, v? v Let h = -116.7 + 114. Let y = 32 - 28.8. Let o = y + h. Which is the biggest value? (a) 5 (b) -3 (c) o a Let j(z) = -z*3 + 4z*2 + 2z - 3. Let u be j(4). Let t = -0.0116 + 16.5516. Let h = 12.54 - t. Which is the smallest value? (a) u (b) h (c) 0 b Let n be 10/6 + 8/(-12). Suppose 7o + 37 = 8o. Suppose 5z = 2h + o, 0z - 9 = 3z. Which is the fourth smallest value? (a) -5 (b) n (c) h (d) 2 d Let j = -4.341 - -6.341. What is the fifth biggest value in j, -3, -2, 5, 0.2? -3 Let g = 3.3 - 0.3. Let q be 15/(-18) - ((-15)/60 + 424/96). What is the biggest value in q, 2, g, -0.3? g Let f = -8.01 - -8. Let g = -3760.4 + 3760. Let y = -7.3 - -7. Which is the third biggest value? (a) f (b) y (c) g (d) -0.5 c Let x(z) = -6z3 - 16z*2 - 4z - 9. Let h be x(-6). Let r be (-140)/h14/(-12). Which is the biggest value? (a) 3/8 (b) -2 (c) -1/2 (d) r a Let k = -879 + 2612/3. Let p = k - -419/51. Suppose 0 = r + 5, 3o - r - 7 = o. Which is the third biggest value? (a) o (b) 8 (c) p c Let x = -0.1 + -0.9. Let m = -68771/3 - -22923. Let q = -2 + 2.4. Which is the biggest value? (a) q (b) 1/2 (c) x (d) m b Let j = 1.98 + -1.9584. Let i = 0.4784 + j. Let t = -0.1 + -0.3. Which is the third smallest value? (a) 0.3 (b) t (c) -4 (d) i a Let l = -29.64 - 3.96. Let t = -39.6 - l. Which is the biggest value? (a) t (b) 1 (c) -2 b Suppose 1 + 15 = 4w. Suppose -wx = -r - 137, -4x = 2r - r - 135. Suppose 33q = xq - 5. Which is the third biggest value? (a) 4 (b) q (c) -3/4 (d) 0.2 d Suppose -2w = -2i + 4, 370w = 2i + 375w + 24. Let f = 0.4 + -2.4. Let v = f - -6. Which is the fourth smallest value? (a) v (b) -3 (c) -4 (d) i a Let v be 14 + 0 - (5 - 9). Suppose -15w + 6w + v = 0. Which is the second biggest value? (a) 1/3 (b) w (c) -1/11 a Let y = 2.151 + -2.2. Let q = -1.12 + 1.171. Let v = y - q. Which is the third smallest value? (a) 0.5 (b) 2/11 (c) v a Let c = 1.5 + -1. Let j = 6302.45 + -6302.4. What is the smallest value in 5, -1, c, j? -1 Let a = -1 + 0.6. Let x = -3.2196 - -1.2196. What is the third smallest value in a, -11, x? a Let i = -5 - -10. Let o = 2921 - 2889. What is the third biggest value in 0.4, i, o? 0.4 Suppose 99h - 83 - 16 = 0. What is the second biggest value in -46/11, h, 0? 0 Suppose 6155 = 5n - 15i, -3n - 5i + i = -3589. Which is the second smallest value? (a) n (b) -5/4 (c) 3 c Let w = 4548 - 4547. Let i = -15 + 16.8. Let t = i + -2. Which is the third biggest value? (a) 0.3 (b) w (c) t (d) -13 c Let m = -62 - -62. Let d = -26.9 - -27.3. What is the biggest value in m, -3, -1/4, d? d Let v = -0.0243 - 198.9757. Let j = 194 + v. What is the third biggest value in -2, j, -1? j Let z = 691 + -312. Let k = z + -388. What is the smallest value in -1, -2, k, 1? k Let w = -28.5 + 31.5. Let n be 2/(-7) + 2904/(-77). Let o = n + 44. Which is the fourth smallest value? (a) w (b) o (c) 2/7 (d) -5 b Let m be 2/33 - 12095/38940. Which is the biggest value? (a) 0.03 (b) -4.2 (c) m a Let l = -1.35 + -18.75. Let x = l - 10.9. Which is the second smallest value? (a) x (b) 1/2 (c) -2/5 (d) -3 d Let u = 3 + -3.5. Let n be (6552/198 - 36) + (3 - 0). Which is the smallest value? (a) u (b) -2 (c) n b Suppose -3p + 2 = -3u - 1, 0 = -p + 3u - 1. Suppose 5t - 8 - p = 0. Let w = 3.2 - 2.9. Which is the second biggest value? (a) -9 (b) t (c) w c Let w = 577 - 576.759. Let h = w + -0.041. Let c = -0.892 + 0.192. What is the third smallest value in -4, c, h? h Let v = 42.95 + -40.05. Let g = -0.29 - 2.51. Let u = v + g. What is the third biggest value in u, -4, -0.5? -4 Let g = 35803/78 - 2755/6. What is the third biggest value in g, -0.2, -128, 2/25? -0.2 Let x be ((-3)/5)/(42/(-210)). Let j = -0.1 + 0. Let l = 1539.2 + -1539. Which is the third biggest value? (a) j (b) l (c) -5/3 (d) x a Let l = 1570/3 - 524. What is the third smallest value in -0.3, 5, -1/4, l, -1/2? -0.3 Suppose 10v - 1953 + 1913 = 0. Let q be -3(7/3 + 3 + -4). What is the second smallest value in v, -6, q? q Let s(t) = 29 - 39 - 8 - 5t - 65. Let y be s(-16). Which is the second smallest value? (a) -4/7 (b) 3 (c) y (d) 22 a Let x = -32301 - -226111/7. What is the second smallest value in x, -24, -25? -24 Let s = 68901/2 + -34449. What is the fourth biggest value in -2, -1.6, -1/25, s? -2 Let q = -10166 - -10155. What is the third biggest value in 1/5, q, 4, -4? -4 Let m = -0.04603 - 8.95397. Which is the smallest value? (a) 0 (b) -1/26 (c) m c Let x(r) = 4r*3 + 2r*2 + 4r - 6. Let s be x(1). Which is the third biggest value? (a) -234 (b) -1 (c) s (d) 1 b Let f = -599.299 + 599. Let i = f - 0.001. Let z = -25 - -49/2. Which is the second smallest value? (a) -2 (b) i (c) z c Let w be (-2)/5 + 8/15. Let i = 19694 + -19689. What is the fourth biggest value in -15, 0, i, w? -15 Let s = -0.133 + 57.133. Let g = 54 - s. Let v be ((-37)/222)/(-1 - 18/(-8)). Which is the second biggest value? (a) v (b) 0.1 (c) g (d) 0 d Let r = -5 - -5.1. Let g = -222655/2 + 111330. What is the second biggest value in r, g, 0.3, 3? g Let y be (-4)/(-5) - (-4)/(-10). Let x = -36 - -41. Let u = -2.726 - -2.636. What is the smallest value in y, u, x, -5? -5 Let h = 19573 - 19576. Which is the fourth biggest value? (a) -2/11 (b) 7/2 (c) h (d) 5 (e) -39 c Let v = 70732/5 - 14147. Let o = -0.24 + -0.06. Let k = 3.7 - o. Which is the biggest value? (a) v (b) -1/8 (c) -0.3 (d) k d Let q = -4661.41 + 4661.3. Let h = 0.3 + -1.3. What is the third smallest value in h, -4, q? q Let h = -0.99171 + -0.00829. What is the third smallest value in -2/349, h, -2/7? -2/349 Let h = 8 - 10. Let k be (-1)/((-36)/8 - -2). Let z = -41 + 40.5. Which is the smallest value? (a) z (b) k (c) h c Let c = 192.2 - -48.8. Let f = c - 240.9. What is the third biggest value in -7/3, -8, f? -8 Let f = 13.103 + -0.003. Let l = -12.9 + f. Which is the second smallest value? (a) 2/9 (b) l (c) 0.6 (d) -0.3 b Let p = -8.9 + 9. Let x = -85.93 - -87. Let a = x + 0.93. What is the third biggest value in p, -2, a? -2 Let y = 185 - 234. Let p = -19 + y. Which is the smallest value? (a) 3/5 (b) 0.2 (c) p c Let o = 13/33 - -3/11. Let a = -287 - -69. Let i = -216 - a. What is the smallest value in o, i, -0.1? -0.1 Suppose -3a - 5q = -22, -2a - 3q = -0a - 14. Let f be 180/42 + a/(-14). Let z be 238/(-504) - (-1)/f. What is the second biggest value in 8, z, -0.1? -0.1 Suppose x = -z - 3, -3x - 30z + 25z - 7 = 0. What is the biggest value in 2051, 0.4, x? 2051 Suppose -5j - 4b - 35 = 0, 0 = -2j + 2b - 6b - 26. Let c = -55 + 53. Let r = 2.5 + c. What is the biggest value in -9, r, j, 0? r Let u = -6.712 + 1.478. Let n = -0.234 - u. Which is the third biggest value? (a) n (b) 3 (c) 1/5 c Let i = -2.98 + -0.02. Let w = -0.1467 - -500.6467. Let g = -500 + w. Which is the third smallest value? (a) 0 (b) g (c) 3 (d) i b Let v = 17.95 - -0.05. Let p = -1154 - -3464/3. What is the second biggest value in p, v, -1/10? p Let m = -5534 - -5491. What is the biggest value in 0, 3, m, -1? 3 Let u = 12 + -14. Let s = 45/554 + 1811/4986. Which is the third smallest value? (a) 8/11 (b) 2 (c) u (d) s a Let u(o) = 2o - 4. Let m be u(4). Let c be (4/(-66) + (-534616)/(-8976))(8 - 4)/56. What is the biggest value in -1, c, m, 2/13? c Let r be -8 - (64/(-7) + 15 + -14). Which is the second smallest value? (a) -4 (b) r (c) -2/5 (d) 3/2 (e) 191 c Let q be -14(2 + (-98)/48). Let k = 17/36 - q. Let v be (-8)/(-76) - 52/133	{ "pile_set_name": "DM Mathematics" }
231, -44340? -133h3 + h2 - 5h - 27715 What is the l'th term of 38076, 37936, 37712, 37410, 37036? l*3 - 48l*2 - 3l + 38126 What is the a'th term of 924675, 924844, 925011, 925176, 925339, 925500? -a*2 + 172a + 924504 What is the i'th term of 665697948, 1331395895, 1997093842, 2662791789, 3328489736, 3994187683? 665697947i + 1 What is the h'th term of -243691, -487402, -731115, -974830, -1218547, -1462266, -1705987? -h2 - 243708h + 18 What is the a'th term of -308369, -616768, -925167? -308399a + 30 What is the d'th term of 1423, 1349, 1373, 1615, 2195, 3233, 4849, 7163? 20d*3 - 71d*2 - d + 1475 What is the a'th term of 7971095, 15942219, 23913343, 31884467? 7971124a - 29 What is the z'th term of -5293603, -5293664, -5293767, -5293912? -21z2 + 2z - 5293584 What is the k'th term of 470, 1922, 4366, 7808, 12254, 17710, 24182, 31676? k*3 + 490k*2 - 25k + 4 What is the y'th term of 4296, 17299, 38996, 69381, 108448? -y*3 + 4353y*2 - 49y - 7 What is the t'th term of 48667, 194701, 438091, 778837, 1216939, 1752397? 48678t2 - 11 What is the l'th term of -1198643, -4794588, -10787831, -19178372, -29966211, -43151348? -1198649l*2 + 2l + 4 What is the x'th term of 34773, 139117, 313017, 556473, 869485, 1252053? 34778x2 + 10x - 15 What is the d'th term of -14759, -14527, -14271, -13979, -13639, -13239? 2d3 + 218d - 14979 What is the q'th term of 98555507, 197111008, 295666507, 394222004, 492777499? -q*2 + 98555504q + 4 What is the v'th term of 1083, 481, -831, -3105, -6593, -11547, -18219, -26861? -42v3 - 103v*2 + v + 1227 What is the h'th term of -18242, -36119, -53682, -70931, -87866, -104487, -120794? 157h*2 - 18348h - 51 What is the c'th term of 14714, 59009, 132898, 236381, 369458, 532129? 14797c2 - 96c + 13 What is the j'th term of 678349, 678330, 678337, 678382, 678477, 678634, 678865, 679182? 2j3 + j2 - 36j + 678382 What is the f'th term of -41113, -41047, -40981, -40915, -40849, -40783? 66f - 41179 What is the f'th term of -56765, -451322, -1522267, -3607796, -7046105, -12175390, -19333847? -56366f*3 + 2f2 - f - 400 What is the m'th term of 2777251, 11109066, 24995433, 44436358, 69431847, 99981906, 136086541, 177745758? m3 + 2777270m2 - 2m - 18 What is the k'th term of -953731, -1907334, -2860811, -3814168, -4767411, -5720546, -6673579? -k*3 + 69k*2 - 953803k + 4 What is the u'th term of -45849037, -45849032, -45849027, -45849022, -45849017, -45849012? 5u - 45849042 What is the t'th term of 1252, 3214, 6520, 11170, 17164, 24502, 33184? 672t*2 - 54t + 634 What is the m'th term of -5966640, -5966703, -5966766? -63m - 5966577 What is the w'th term of -15378082, -15378081, -15378080, -15378079, -15378078? w - 15378083 What is the h'th term of -113558, -224734, -335898, -447044, -558166, -669258, -780314, -891328? h3 - 111183h - 2376 What is the w'th term of -180366, -180363, -180352, -180327, -180282? w*3 - 2w*2 + 2w - 180367 What is the o'th term of 119, 287, 411, 473, 455, 339? -3o3 - 4o*2 + 201o - 75 What is the t'th term of 1617, 1342, 741, -348, -2087, -4638? -27t3 - t2 - 83t + 1728 What is the n'th term of -825, -4343, -10207, -18417? -1173n2 + n + 347 What is the g'th term of -11284, -22743, -34176, -45583, -56964, -68319, -79648? 13g*2 - 11498g + 201 What is the q'th term of 1444, 3924, 6404, 8884? 2480q - 1036 What is the q'th term of -107067, -106784, -106505, -106230, -105959, -105692? -2q*2 + 289q - 107354 What is the f'th term of -6633, -6695, -6801, -6951, -7145? -22f2 + 4f - 6615 What is the f'th term of -1212277, -1212162, -1212047, -1211932, -1211817? 115f - 1212392 What is the h'th term of -20857963, -20857947, -20857931, -20857915? 16h - 20857979 What is the r'th term of 3690, 7456, 11256, 15108, 19030, 23040? 3r3 - r2 + 3748r - 60 What is the r'th term of -20756, -83372, -187732, -333836, -521684, -751276, -1022612? -20872r2 + 116 What is the h'th term of -104504, -105900, -107296? -1396h - 103108 What is the h'th term of -13021688, -13021687, -13021686, -13021685? h - 13021689 What is the m'th term of -521, -106, 623, 1666, 3023, 4694, 6679? 157m2 - 56m - 622 What is the x'th term of 113464519, 113464524, 113464533, 113464546? 2x2 - x + 113464518 What is the d'th term of -2092794, -4185595, -6278406, -8371233, -10464082? -d3 + d2 - 2092797d + 3 What is the r'th term of -493684, -493749, -493816, -493885, -493956? -r*2 - 62r - 493621 What is the u'th term of -607967, -1215938, -1823913, -2431892? -2u2 - 607965u What is the g'th term of 924857, 924719, 924493, 924185, 923801, 923347, 922829, 922253? g*3 - 50g*2 + 5g + 924901 What is the q'th term of -32363662, -32363666, -32363670, -32363674, -32363678? -4q - 32363658 What is the h'th term of -135881, -542960, -1221419, -2171252, -3392453, -4885016, -6648935? h3 - 135696h*2 + 2h - 188 What is the r'th term of -465051, -930098, -1395145, -1860192, -2325239, -2790286? -465047r - 4 What is the l'th term of 380701, 761536, 1142371, 1523206, 1904041, 2284876? 380835l - 134 What is the q'th term of 3956, 12446, 20936, 29426, 37916, 46406? 8490q - 4534 What is the p'th term of 4354, 8764, 13238, 17776, 22378, 27044, 31774? 32p*2 + 4314p + 8 What is the k'th term of -353015, -352087, -351159? 928k - 353943 What is the w'th term of 1806, -751, -4990, -10917, -18538? -w3 - 835w*2 - 45w + 2687 What is the g'th term of -22973547, -45947105, -68920663, -91894221, -114867779, -137841337? -22973558g + 11 What is the g'th term of -15409, -30719, -45983, -61201, -76373? 23g*2 - 15379g - 53 What is the q'th term of 3735, 3721, 3697, 3669, 3643? q*3 - 11q*2 + 12q + 3733 What is the o'th term of 63798272, 63798275, 63798280, 63798287? o*2 + 63798271 What is the j'th term of -331252, -1325008, -2981268, -5300032, -8281300? -331252j2 What is the k'th term of -3805546, -3805657, -3805758, -3805843, -3805906, -3805941, -3805942? k3 - k*2 - 115k - 3805431 What is the g'th term of 1182775, 1182767, 1182753, 1182733? -3g2 + g + 1182777 What is the y'th term of 480, 983, 1586, 2289, 3092? 50y*2 + 353y + 77 What is the y'th term of 242938, 242082, 241226, 240370? -856y + 243794 What is the x'th term of -29567, -58794, -88021, -117248, -146475, -175702? -29227x - 340 What is the z'th term of -43514, -44619, -45724, -46829, -47934, -49039? -1105z - 42409 What is the m'th term of 1512, 9067, 16628, 24195, 31768? 3m*2 + 7546m - 6037 What is the f'th term of 925, 3244, 6971, 12130, 18745, 26840? 4f3 + 680f*2 + 251f - 10 What is the p'th term of 519339, 1038603, 1557867, 2077131? 519264p + 75 What is the c'th term of -2867, -5531, -7981, -10223, -12263? -c3 + 113c*2 - 2996c + 17 What is the x'th term of -828432, -1656852, -2485272, -3313692, -4142112, -4970532? -828420x - 12 What is the p'th term of -34158, -58210, -82262, -106314? -24052p - 10106 What is the k'th term of 684, 6318, 21624, 51438, 100596, 173934, 276288, 412494? 806k3 - 8k - 114 What is the k'th term of -211, -778, -2295, -5236, -10075? -79k3 - k2 - 11k - 120 What is the h'th term of -4511, -36284, -122583, -290666, -567791, -981216, -1558199, -2325998? -4543h3 - 5h*2 + 43h - 6 What is the t'th term of -580041, -1160030, -1739969, -2319858, -2899697, -3479486, -4059225? 25t2 - 580064t - 2 What is the d'th term of 2613, 11508, 26337, 47100? 2967d2 - 6d - 348 What is the f'th term of -6068, -24197, -54398, -96671? -6036f2 - 21f - 11 What is the s'th term of 212236, 212238, 212242, 212248? s2 - s + 212236 What is the m'th term of 14222, 57810, 130756, 233054, 364698? -m3 + 14685m2 - 460m - 2 What is the f'th term of 3341, 3356, 3695, 4520, 5993, 8276? 27f3 - 174f + 3488 What is the l'th term of 8296, 8011, 7540, 6883, 6040, 5011? -93l2 - 6l + 8395 What is the n'th term of -1488074, -1488108, -1488140, -1488170? n*2 - 37n - 1488038 What is the x'th term of 7056, 6954, 6852, 6750, 6648? -102x + 7158 What is the x'th term of 1907, 7504, 16573, 28898, 44263, 62452, 83249, 106438? -36x*3 + 1952x*2 - 7x - 2 What is the b'th term of 1441414042, 1441414041, 1441414040, 1441414039? -b + 1441414	{ "pile_set_name": "DM Mathematics" }
2, o: 5, b: 1}. 1/910 Three letters picked without replacement from pnekejjejep. Give prob of sequence njk. 1/330 Two letters picked without replacement from ubjbrbjjbrvjvr. What is prob of sequence ru? 3/182 Calculate prob of sequence mqmt when four letters picked without replacement from mqmqmqmmqqmmtqmtbqm. 7/646 Four letters picked without replacement from {f: 5, x: 1, u: 8, r: 2}. What is prob of sequence fxfu? 1/273 Two letters picked without replacement from rxrreperprrrrperee. Give prob of sequence ee. 10/153 What is prob of sequence iii when three letters picked without replacement from {i: 9}? 1 Two letters picked without replacement from {z: 8, x: 7, n: 4, q: 1}. What is prob of sequence zn? 8/95 Calculate prob of sequence by when two letters picked without replacement from bbqyqbbqqyy. 6/55 Calculate prob of sequence gzgz when four letters picked without replacement from {g: 4, z: 16}. 8/323 What is prob of sequence uu when two letters picked without replacement from {u: 6, m: 13}? 5/57 Three letters picked without replacement from {l: 1, i: 9, f: 1, c: 1}. What is prob of sequence ilc? 3/440 What is prob of sequence uqlg when four letters picked without replacement from {u: 1, q: 5, g: 5, l: 1}? 5/2376 Calculate prob of sequence yjuu when four letters picked without replacement from {u: 8, j: 7, y: 5}. 49/2907 Three letters picked without replacement from {v: 2, k: 6}. Give prob of sequence vkv. 1/28 Calculate prob of sequence an when two letters picked without replacement from {n: 7, a: 3, p: 9}. 7/114 What is prob of sequence xj when two letters picked without replacement from axaaaaajbbab? 1/132 Calculate prob of sequence gz when two letters picked without replacement from nzzznzggcgnznz. 9/91 Calculate prob of sequence eu when two letters picked without replacement from {g: 2, u: 2, j: 1, e: 1, h: 1}. 1/21 Three letters picked without replacement from {d: 7, n: 4, k: 1, f: 1}. What is prob of sequence dfk? 7/1716 Four letters picked without replacement from {o: 4, f: 15}. Give prob of sequence ooff. 35/1292 Three letters picked without replacement from pnyfrly. Give prob of sequence nyp. 1/105 Calculate prob of sequence pgg when three letters picked without replacement from vtztgztvtpv. 0 Calculate prob of sequence ux when two letters picked without replacement from {u: 2, x: 2}. 1/3 What is prob of sequence ccc when three letters picked without replacement from {e: 15, c: 5}? 1/114 Four letters picked without replacement from wxwffdfwwiwbwbxdf. What is prob of sequence didb? 1/14280 Two letters picked without replacement from {l: 2, x: 1, y: 11, d: 1}. What is prob of sequence yl? 11/105 Calculate prob of sequence zrer when four letters picked without replacement from {r: 2, e: 5, z: 8}. 2/819 What is prob of sequence gw when two letters picked without replacement from oldhlwwg? 1/28 Four letters picked without replacement from iiititittiiiitiiiii. Give prob of sequence itii. 455/3876 Calculate prob of sequence vev when three letters picked without replacement from {l: 2, e: 2, u: 6, v: 2, r: 4, w: 1}. 1/1020 What is prob of sequence ss when two letters picked without replacement from {s: 2, l: 9}? 1/55 Calculate prob of sequence wcfc when four letters picked without replacement from wwwwcpwfcwcw. 7/1980 Four letters picked without replacement from {z: 13, i: 3, y: 1, f: 3}. What is prob of sequence zzzf? 143/3230 What is prob of sequence euu when three letters picked without replacement from {e: 5, u: 5}? 5/36 What is prob of sequence ie when two letters picked without replacement from {e: 2, w: 2, i: 2}? 2/15 What is prob of sequence sst when three letters picked without replacement from {l: 5, t: 1, s: 4, y: 3}? 1/143 Calculate prob of sequence wx when two letters picked without replacement from bcxxcocccbcowwxwxq. 2/51 Two letters picked without replacement from {v: 2, b: 2, m: 1}. What is prob of sequence vb? 1/5 Calculate prob of sequence mjrr when four letters picked without replacement from jrwjrjmzjrzzz. 1/715 Calculate prob of sequence aasa when four letters picked without replacement from ssasasssasaassasaaa. 35/646 Two letters picked without replacement from {x: 4, e: 4, s: 12}. What is prob of sequence ss? 33/95 Four letters picked without replacement from qqhqhqqqqqhqqhqqhqqq. What is prob of sequence qqqh? 455/3876 What is prob of sequence nn when two letters picked without replacement from snuoujjojjss? 0 Calculate prob of sequence ooi when three letters picked without replacement from {o: 8, i: 2}. 7/45 Calculate prob of sequence ewg when three letters picked without replacement from {m: 1, e: 4, g: 3, f: 2, w: 2}. 1/55 Four letters picked without replacement from {j: 7, d: 1}. What is prob of sequence jdjj? 1/8 Three letters picked without replacement from {r: 5, u: 7, i: 7}. What is prob of sequence iuu? 49/969 Calculate prob of sequence wwww when four letters picked without replacement from {w: 6}. 1 Calculate prob of sequence kk when two letters picked without replacement from kykkkkykkyk. 28/55 Calculate prob of sequence qqn when three letters picked without replacement from {p: 3, q: 5, l: 6, n: 1}. 2/273 What is prob of sequence ucc when three letters picked without replacement from uuucucs? 4/105 Calculate prob of sequence desi when four letters picked without replacement from sxdeiewxexxxiexe. 1/4368 What is prob of sequence kk when two letters picked without replacement from {k: 3, d: 3, h: 4, e: 7, c: 1}? 1/51 Three letters picked without replacement from {k: 2, x: 8}. Give prob of sequence kkx. 1/45 Calculate prob of sequence zi when two letters picked without replacement from {z: 10, i: 1, h: 1, k: 2, r: 2}. 1/24 Three letters picked without replacement from vmslllmll. What is prob of sequence lmm? 5/252 Calculate prob of sequence pppi when four letters picked without replacement from ippipippppppppp. 11/91 What is prob of sequence ffcf when four letters picked without replacement from fccffccjcjcsffjjfcj? 35/3876 Two letters picked without replacement from {m: 2, d: 1, g: 12, f: 4}. What is prob of sequence dg? 2/57 Two letters picked without replacement from {c: 1, j: 1, v: 4, r: 2, y: 7}. Give prob of sequence cr. 1/105 Three letters picked without replacement from {f: 1, d: 7, m: 1, l: 3}. Give prob of sequence ddf. 7/220 Three letters picked without replacement from tsmmesmsamotetsttsmm. What is prob of sequence mmo? 1/228 What is prob of sequence xeo when three letters picked without replacement from {e: 1, o: 1, x: 5, f: 3, v: 1}? 1/198 Two letters picked without replacement from {o: 5, z: 5, u: 1, y: 4}. Give prob of sequence zo. 5/42 Calculate prob of sequence uawh when four letters picked without replacement from {h: 6, u: 1, a: 1, w: 3, r: 1}. 1/660 Two letters picked without replacement from {s: 1, p: 2, f: 1}. What is prob of sequence sp? 1/6 What is prob of sequence vvb when three letters picked without replacement from {g: 1, b: 1, v: 1}? 0 Two letters picked without replacement from {c: 7, m: 5, r: 7}. What is prob of sequence mr? 35/342 What is prob of sequence dee when three letters picked without replacement from {d: 5, e: 4, r: 7, s: 2}? 5/408 Calculate prob of sequence ee when two letters picked without replacement from {e: 3, z: 4, a: 1}. 3/28 Four letters picked without replacement from vuddnnd. What is prob of sequence udnn? 1/140 What is prob of sequence vtvv when four letters picked without replacement from {a: 3, t: 2, u: 5, j: 3, v: 5}? 1/612 Calculate prob of sequence sepe when four letters picked without replacement from ixiexeixezsxipzizz. 1/12240 What is prob of sequence df when two letters picked without replacement from {d: 2, f: 7}? 7/36 What is prob of sequence fql when three letters picked without replacement from {f: 4, q: 5, l: 7}? 1/24 Three letters picked without replacement from kttzjkzkkoojzb. What is prob of sequence boj? 1/546 Four letters picked without replacement from yiizpyu. Give prob of sequence ypiu. 1/210 What is prob of sequence fz when two letters picked without replacement from {f: 12, z: 6}? 4/17 Calculate prob of sequence gbbb when four letters picked without replacement from {p: 3, t: 5, b: 3, o: 3, g: 4}. 1/3060 Calculate prob of se	{ "pile_set_name": "DM Mathematics" }
w + 4 - 4)(5 - 4 + 1) - 2w + 7w - 3w + (1 + 7 + 1)(-4w - 2 + 2). -30w Expand i2 - i2 + 2i*5 + (0i2 - i2 - i*2)(0 + 0 - 3i3 - 2i). 8i5 + 4i*3 Expand (-2 + 2 - 2p)(10p*2 - p + p)(-3p + 0p + 2p). 20p4 Expand (-q2 + q*2 + 2q*2)(-48q2 + q + q + 50q*2). 4q*4 + 4q*3 Expand 0x*3 + 2x*3 + 2x*3 + (2x*2 - 16x*2 + 2x*2)(3x - 3x + 2x). -20x3 Expand (-21 + 21 - n3)(3n - n - 4n)(-3 + 4 + 0). 2n4 Expand -9k + 12k + 23k - 2k + 4k - 3k - 5 + 5 + 2k + 3k - 4k + 2k + (-2 + 0 + 0)(-4k + 0k + 2k) - 1 - k + 1 + 0 + k + 0. 32k Expand 2u3 + u2 - u2 + (2u - 3u + 0u)(4u*2 - 4u2 - u2) + 23u3 - 2u*3 - 2u3 - u3 + 3 - 3. 21u3 Expand (2 + 4 - 3)(2 + 0 - 6u - 3). -18u - 3 Expand (-5i + 3i + 3i)(0 - 1 - 1 + 5 - 2 - 1 + (-3 - 1 + 2)(1 + 2 - 2) + 2 - 5 + 2)(-4i2 + 5i*2 - 3i*2). 6i*3 Expand (s - s + 2s)((2s*2 + 2 - 2)(2s2 + 0 + 0) - 8s + 8s - 3s*4). 2s*5 Expand 7t - t + 0t + (-3t + 3t + t)(-3 + 0 + 1). 4t Expand (-82 + 82 + 21n - 10n)(-2 + 0 + 1). -11n Expand -v3 + 3v3 - v3 + (2v2 - 3v2 - v2)(5v + 7v - 4v). -15v3 Expand -3j*5 + 2j*5 + 4j*5 + (0j + 0j + 3j*4)(-3j + j - 2j) + j*5 + 4j*5 - 4j*5. -8j*5 Expand 2z - 2z + 2z*3 + (-z + 0 + 0)(4 - 4 - 2z2) + 0z3 + z3 + z*3 + 0z*3 + 0z3 - z3 - z3 + z3 + 2z3 - 4z*3 + 2z*3 + 3z*3. 8z*3 Expand (-3j + 2j2 + 2 + 3j)(-5 - 1 + 2 + 2j*2). 4j*4 - 4j2 - 8 Expand (i2 + 1 - 1)(-39 + i + 39). i3 Expand (4c - 2 - 3c - 1)(10c2 - 101c + 101c + (5 - 5 - 2c)(-5c + c + 3c) + c2 - 3c*2 + 4c*2). 14c*3 - 42c*2 Expand (0n*4 - 7n*4 + 14n*4 + (0n*3 - 2n3 + n3)(-4n + 4n - 2n) + 2n4 - 2n*4 + 2n4 + n4 - 2n3 + 2n*3)(-3n + 7n - 3n). 12n*5 Expand -18m*3 + 15m*3 - 6m*3 + (-2m + 0m + 4m)(0 + m2 + 0) - 2m*3 - 2m*3 + 6m*3 + 0m*2 + 0m2 + m3 + 3m - 2m*3 - 3m. -6m3 Expand (t3 - 4t3 + t3)(4 - 8 - 4t + 3). 8t4 + 2t*3 Expand w - 4 + 4 + (2w + 1 - 1)(-1 - 1 + 1) - 1 + 1 - 3w + (-1 + 0 + 0)(4w - w - 5w) + 8 - 18w - 8. -20w Expand 0w + 0w2 - 5w*2 + w + (-4w*2 - 3w*2 + 3w*2)(1 - 5 + 5) - 2w2 - w2 + 2w*2. -10w*2 + w Expand (5g - 17g - 6g + (5 - 2 - 4)(2g - 3g + 3g) + 1 - 2g - 1)(-4 + 2g + 4)(3g2 - g2 - g2). -44g*4 Expand 4i - 4i + 4i*4 + (-3i + i*2 + 3i)(-2i*2 - 2i + 3 - 3). 2i4 - 2i*3 Expand (-4 - 3 + 5)(-2s4 - 2s*4 + 3s*4) + 18s*4 + 31 - 7s*4 - 12s4. s4 + 31 Expand -4j2 - j2 + 3j*2 + (-3j + 0j + 0j)(3j - 3j + 2j - 2j + 5j - 2j + (-3j + 5j + 0j)(-1 + 1 + 1) + 0j - 2j + 4j). -23j2 Expand (-2y*4 + 0y*4 + 3y*4)(809 - 407 - 404 - 90y). -90y*5 - 2y*4 Expand (-5z*3 + 0z*3 + 4z*3)(8 + 10 - 30). 12z3 Expand (0v*2 - 10v*2 - 4v*2)(-5v2 + 5v*2 + 4v*3). -56v*5 Expand (-2g - 3g + 3g)(1 - 5 + 0)(2 - 2g2 - 2). -16g*3 Expand ((3 + 1 - 2)(-2r - 2 + 2) + r - 1 + 1 - 4 + 4 + r)(19 - 19 + 3r). -6r*2 Expand ((-25p + 25p + 29p*2)(1 - 4 + 1) + p*2 - 4p2 + p2)(3p + 2p - 4p)(1 - 2 - 1). 120p*3 Expand (1 + 1 + 0)(-4 + 1 + 0)(-y3 - y3 + y3). 6y3 Expand -2 + 2 + x2 - 1 + (-x - 2x + 5x)(x + x - 3x). -x*2 - 1 Expand (2q + 2q - 1 - 3q)(6 - 2 + 0). 4q - 4 Expand (10 - 3i - 7 - 2i)(-1 - 3 + 5). -5i + 3 Expand (-2 + 4 + 0)((-4y + 3y - y)(3 - 1 - 1) + 0 + 0 + y). -2y Expand (3z - 2z - 3z)(z - 2z + 3z + (2z + 0z + 0z)(0 + 1 + 0) + 42 + 2z - 42). -12z2 Expand (l + 0l + 0l)(-2 + 0 + 3) - l + 3l + l + 3 - 4l + 3l - 2l. l + 3 Expand (0u - 2u + u + (3 - 3 - 2u)(-5 + 3 + 0) + 3u - u + u)(-u - 2 - u + 4). -12u2 + 12u Expand (2g2 - 4g*2 + 14g*2 + (-2g + 6g - 2g)(0g + 0g - 2g) + 2g2 - 2g*2 + 2g*2)(-3g3 + 2 + 2 - 5). -30g*5 - 10g*2 Expand (-y + 4y - y*2 + 2y*2)(-y + 4y + 3y). 6y3 + 18y*2 Expand (3v*3 - 2v*3 - 3v*3)(-1 + 1 - 2v) + 10v*2 + 65v*4 - 126v*4 + 62v*4. 5v*4 + 10v*2 Expand (2w + 7w + 4w)(2w3 - w3 + w*3) + 0w*4 - 4w*4 + 2w*4. 24w*4 Expand 0x*3 - 2x*3 + 4x*3 + (-3x - 2x2 + 3x)(-6x + 4x + 0x) + (-2 + 2 + 2x)(0 + 0 + 3x2). 12x*3 Expand (6s*3 + 9s*3 - 5s*3)(6 + 2 - 4). 40s3 Expand (-5x + 5x - 2x*2)(-15 + 45 + 31). -122x2 Expand (3 - 3p + p - 6)(2 - 2 - p). 2p*2 + 3p Expand (2h2 - h2 + h2)(3 - 4 + 2) + h*2 - 2h*2 + 2h2 + 2 - 2 - h2 + (0h + 0h - h)(17h - 3h - 9h). -3h2 Expand (4n - n - 2n)(-4 + 2 + 0). -2n Expand (3z + 0z2 + 13z*2 - 9z*2)(-3z - 4z + z). -24z3 - 18z*2 Expand (0w - w + 0w)(7w + 6w + 6w)(-1 - 2w + 1). 38w*3 Expand (0 - 4 + 0c*2 - 2c - 2c2)(-33c2 + 14c*3 + 33c*2). -28c*5 - 28c*4 - 56c*3 Expand 0i + 2i - 3i + (2 - 4 + 0)(-9i - 3i + 34i). -45i Expand b4 - b4 + b4 + (0b + 3b3 + 0b)(-1 + b + 1). 4b*4 Expand -6b*3 + 3b3 - b3 + (b*2 + 3b*2 - 5b*2)(-b - 2b + b) + (1 - 1 - 2b)(-4b*2 + 0b*2 + 2b*2). 2b*3 Expand (4 - 3 + 1)(-b3 - b3 + 4b3) - 129 + 129 + 7b2 + b3. 5b3 + 7b*2 Expand -2b - 5 + 5 - 4b + b + b + (0b + 2b + 0b)(3 - 3 - 2) + (-5 - 2 + 5)(-8 + 8 - 7b). 6b Expand (-3i + 6 - 6 + (i + 4i - 3i)(-2 + 0 + 3) + (2i + 0 + 0)(-1 + 2 + 0))(2i - 3i4 - 2i). -3i5 Expand (2b - 2b + 2b*2)(-7b + 5 - 5)(b*2 - 1 + 1). -14b*5 Expand -1 + 2v + 1 + (0 - 5 + 2)(2v - 1 + 1) - 2v - 2v + 0v. -8v Expand (-4 + 9 + 2)(2 - 2 - 2t). -14t Expand (-3 + 3 + 1)(1 - m - 1) - 8m + 4m + 2m + (4 - 4 - m)(-3 + 3 + 2). -5m Expand (3s + 5s + s)(-3s4 + s4 + 4s*4). 18s*5 Expand (3b*2 + 2b*2 - 2b*2)(-7 - 14b + 7). -42b*3 Expand (-1 - 3 + 1 + (4 - 4 + 5)(0 - 3 + 2))(0g*3 + 0g*3 - 2g*4). 16g*4 Expand -2c + 2c - c + (0 + 6 - 4)(2c - 3c + 4c) + 4c + 0c - 6c + 6c + 9 - 9 + (0c - 2c + 0c)(4 + 2 - 4). 5c Expand (1 - w - 1)(2w*2 + 5w*2 - 3w*2) - 5w + 0w3 - 2w*3 + 0w*3. -6w*3 - 5w Expand (2l + 0l + 0l)(l*4 + 4l*4 - 6l*4) + (0l*3 - 3l*3 + 0l*3)(2l2 - 2l + 2l). -8l*5 Expand (3 - 3 - d)(-7 - 2d - d + 5d). -2d2 + 7d Expand (r - 3 + 3)(1 - 1 - 2)(r*2 + 2 - 2 + (r - 5r + 3r)(-r + 3r - 4r) - r2 - r2 + 3r2). -8r*3 Expand (0p + 0p + p3 + (2p + 2 - 2)(-3 - 2p2 + 3) - p3 + 6p3 - 4p3 - p2 + p2 + p3)(-p + 4p - 2p). -p4 Expand (3b3 - b3 + 2b3)(b*2 + 0b - b - b). 4b5 - 8b*4 Expand (0i - 5i + 3i)(0 + 0 + 3i + (1 - i - 1)(-2 + 2 - 1)). -8i*2 Expand 3a*2 - 4a*2 + 0a*2 + a - 2a*2 - a + (-1 - 1 + 0)(4a2 - 2a2 - a2). -5a2 Expand (d - 2d + 2d)(3 - 3 - 2d2) - 54d + 54d + 6d*3. 4d*3 Expand (-4 - 8 + 1)(-3 + 3 + 1)(2o - o + 0o). -11o Expand -8l5 + 4l*2 - 4l*2 + (4l + 3l - 5l)(-3l*4 - 2l*4 + 3l*4) + 4l - 2l5 - 4l + l*5 + 0l*4 + 0l*4. -13l*5 Expand (-2p*3 + 4p3 - p3)(-353p - 32p2 + 353p). -32p5 Expand (x + x + 0x + (-2 + 2 + 2)(2x + 0 + 0) + 1 - 1 - 2x)(-6x3 + x3 - 2x*3). -28x*4 Expand (7c + c + 4c + (1 - 1 - 1)(-2c - 2c + 3c))(-c - 2c + 4c). 13c2 Expand (-34q*4 + 57q*4 - 2q + 2q)(2q + 3q - 3q). 46q*5 Expand -2 - 2t - 6t - 2t - 5t + 2t + 5t + 2t - 2t - 2t + (2t + 0t + 0t)(-4 + 2 + 1). -12t - 2 Expand (0t*2 + 0t2 - t2)(-18t*3 - 318t*2 + 318t*2). 18t*5 Expand 2z + z*5 - 2z + 2z4 + z5 - 2z*4 + (0z2 - z3 + 0z2)(-2z2 + 0z + 0z) + (4z*2 + 2z*2 - 4z*2)(-z*3 + 9z*3 + 2z*3). 24z*5 Expand (2j - 2j - 3j)(2j - j*2 - 2j) + 5j3 + 16j*2 - 16j*2. 8j*3 Expand -t - 2t*3 + t - 4t*3 + 0t*3 + 2t*3 + (-3t - 2t + 3t)(t2 + 3t*2 - 3t2) + t + t3 - t. -5t3 Expand (-2 - 3u + 11u + 17u)(4u - 2u - 4u). -50u2 + 4u Expand (2y + y2 - 2y)(4 - 4 - y) + (y3 - 4y3 + y3)(-2 + 5 - 4). y3 Expand ((-4 + 1 + 5)(3 - 1 + 0) - 1 + 3 - 1 + 6 - 4 - 4 - 1 + 5 - 2)(-4m*2 - 2m*2 + 5m*2). -5m*2 Expand 5h -	{ "pile_set_name": "DM Mathematics" }
0.4 * -1429.62268 -571.849072 Multiply -300.23063 and 5. -1501.15315 Work out 58 * -146110. -8474380 0.1861 times 555 103.2855 What is the product of -0.0855 and 496038? -42411.249 Calculate 0.3-4168661. -1250598.3 1-2426092 -2426092 Multiply 80.82 and -0.986. -79.68852 Work out -0.78 * 12766. -9957.48 Product of 0 and 2629582. 0 Calculate -13768-161.6. 2224908.8 Product of 0.5 and 874.6907. 437.34535 Product of 0.5 and -1136.9617. -568.48085 0.03109.917 3.29751 Multiply -30 and 0.2083616. -6.250848 Work out -36100831 * 0.5. -18050415.5 -0.5-290371.2 145185.6 Product of 3 and 246999.1. 740997.3 What is the product of 0 and -3348705? 0 What is 3.809 times -2.407? -9.168263 7815.3-584 -4564135.2 -1976452 * 0.105 -207527.46 0.8767 times 0.491 0.4304597 Work out 11.8259 * -15.2. -179.75368 Product of 8.456 and -2538. -21461.328 Calculate 1495085.46. 757733.54 What is the product of -10103806 and 0.33? -3334255.98 32.7 times 6883.6 225093.72 Multiply -0.07435 and -0.10096. 0.007506376 What is 0.6 times 1004830? 602898 -386539329 -112096397 Work out -0.0106 * 54451. -577.1806 -3 * 54018291 -162054873 8 times 123576.473 988611.784 Multiply 0 and -32548690. 0 13514.2-1716 -23190367.2 Work out 0.1 0.35637164. 0.035637164 What is -8.3 times -1.818563? 15.0940729 Calculate -32235-29.9. 963826.5 Multiply 0.1531925978 and 0.2. 0.03063851956 -158.103686 -108458.658 Calculate -4507-77. 347039 -0.34009111.8 -38.022062 14439.84.6 66423.08 What is 0.1 times -3375044? -337504.4 What is 26553.63 times 6? 159321.78 Multiply -6.16011 and -369. 2273.08059 Calculate -147921-0.472. 69818.712 -0.75642316-1 0.75642316 What is the product of -0.585 and 0.56802? -0.3322917 Work out 3 0.0744404. 0.2233212 What is the product of 40.372333 and -1.4? -56.5212662 Calculate -0.83-212600. 176458 What is 17.61 times 1758? 30958.38 0.1 times -27878056 -2787805.6 18.145 times -0.011186 -0.20296997 Calculate -229-0.041109. 9.413961 -1499 * 840413 -1259779087 Calculate 19.53428-0.1. -1.953428 What is the product of -4 and 5131478? -20525912 Multiply 38.50585 and 0.98. 37.735733 Multiply 0.4 and -1965339. -786135.6 Multiply 0.157994 and 249. 39.340506 -5.9217950 -106264 Multiply -12855671 and 0.03. -385670.13 Multiply 503738801 and -0.4. -201495520.4 4-139958237 -559832948 Work out 0.0613 -46022. -2821.1486 2 * 4023127 8046254 Product of 0.29 and -589348. -170910.92 What is 0.44 times -17081588? -7515898.72 Calculate 2972-33332. -99062704 What is -2 times 300.9421? -601.8842 Product of 1240583 and 0. 0 50.164 times 1.81 90.79684 0.1 times -22.339011 -2.2339011 Calculate 0.3-508653. -152595.9 What is -261.91 times -11550? 3025060.5 What is the product of -1825 and 15.87? -28962.75 Product of 0.043 and -1353008. -58179.344 0.8 * -1.503873 -1.2030984 Calculate 3918-31755. -124416090 -2537-355 900635 What is -9 times -338776? 3048984 What is the product of 939778 and 84? 78941352 What is 264 times -156258? -41252112 Calculate 573.7083-9. -5163.3747 Multiply -1368.307 and -6. 8209.842 563245 times -1.67 -940619.15 Calculate 11160.5092. 568.2672 What is -0.3 times 2.919015? -0.8757045 What is -2421.75879 times 0.4? -968.703516 Product of 284.91082 and -7. -1994.37574 What is -5 times 1449954? -7249770 What is the product of -1315 and 6538? -8597470 What is the product of -0.205 and -1187811? 243501.255 Product of -4 and 3593818. -14375272 -142193258 -113754600 -1015 0.00516 -5.2374 Calculate -3.0849.1515. -151.38662 Product of 178 and -60599. -10786622 Product of 4.146 and 593. 2458.578 -0.143855.6 -539.784 Multiply -99273760 and -0.3. 29782128 Multiply 28.9 and 147936. 4275350.4 -3590.98 * 1.9 -6822.862 -10904962 * 31 -338053822 Calculate -10-329316. 3293160 -18.6747990.29 -5.41569171 -0.010.0903599 -0.000903599 Product of -12 and 710136. -8521632 Product of 0.1 and -2246363. -224636.3 What is the product of -0.04 and -165772361? 6630894.44 What is 0.04 times -2.16834609? -0.0867338436 Product of 23564.9808 and 2. 47129.9616 What is the product of -0.15 and -657137? 98570.55 Calculate -11882-6.12. 72717.84 Multiply -4 and -1241.573. 4966.292 -5.15772 times -0.1363 0.702997236 Product of -1.55394 and -0.2. 0.310788 What is the product of 15890 and -4.9? -77861 Calculate -80255-79. 6340145 Work out 0.077 -4.0011. -0.3080847 -185369931 * 0 0 Work out 17.29079 * 0.087. 1.50429873 Calculate 194-46719. -9063486 960 times -144796 -139004160 What is the product of 2761708.6 and 4? 11046834.4 Product of -2435.92 and -529. 1288601.68 Product of -211191384 and 0. 0 Product of -22039906.4 and 0.1. -2203990.64 What is the product of -1.3 and -1072416? 1394140.8 Product of -0.3 and 129678719. -38903615.7 Work out 35149253 10. 351492530 -489861.2 -473337.6 4292.5 times -247 -1060247.5 0.64 times 207605 132867.2 What is the product of 279084 and -379? -105772836 0.09 times 112074.55 10086.7095 -157.57 times 9.76 -1537.8832 Multiply -31512 and -0.334. 10525.008 Work out -1416962 -225. 318816450 8.0629-0.42 -3.386418 Work out 27 -0.03434911. -0.92742597 -203903941-0.2 40780788.2 0.008 times -5.777 -0.046216 Calculate -1738-790. 1373020 Multiply 117771690 and 0.4. 47108676 Multiply 0.205 and -0.1055783. -0.0216435515 Work out 6066.14 * -947. -5744634.58 Product of -9 and -380090.42. 3420813.78 -1.42477081 times 0.3 -0.427431243 What is 4986014 times 29? 144594406 What is -110.3959 times -38? 4195.0442 -0.452 * 1.0894 -0.4924088 Multiply -0.0213 and 8971. -191.0823 Multiply 312152 and -2.15. -671126.8 6.965776 times 1 6.965776 What is -13 times -1118355? 14538615 What is 154.7397 times 3.6? 557.06292 0.07051 * -0.044 -0.00310244 What is -731 times -1442? 1054102 What is -0.2 times 205.967? -41.1934 -28 times -1288649 36082172 Work out 13 * -26581830. -345563790 What is 328567.666 times -0.2? -65713.5332 Work out -0.047 * -209749. 9858.203 -43.75076 times 3 -131.25228 What is -8044358 times 4? -32177432 Calculate 13892033.70.3. 4167610.11 What is 2114.6 times -272.1? -575382.66 Multiply -0.14 and -3594311. 503203.54 Work out 2 -18548085. -37096170 -11602 times 203.3 -2358686.6 25683053 times -0.9 -23114747.7 What is -8 times -11.08986? 88.71888 What is the product of 0.233 and 31064? 7237.912 Product of 0.718 and 11.8854. 8.5337172 What is 51505942 times -5? -257529710 What is -45868 times -1.17? 53665.56 9.421636 times 1 9.421636 -22.63911867 -42267.1997 Work out 5 -37217129. -186085645 -0.5 * 35450849 -17725424.5 Calculate 248361310.16. 3973780.96 Product of -0.1 and 81248166. -8124816.6 369910 times -0.034 -12576.94 Multiply -5.0985 and 35.87. -182.883195 Multiply -0.2 and -725.7421. 145.14842 Work out -3629273 -1.7. 6169764.1 1252 * 1366.3 1710607.6 -1549 * 439190 -680305310 What is 505.44134 times -0.1? -50.544134 What is -18.21 times -1470.9? 26785.089 What is -0.53 times -0.3924867? 0.208017951 -66833014 -40998084 Calculate 0.8222-2.4. -1.97328 Multiply 239 and -2524.9. -603451.1 What is 0.46 times 1434385? 659817.1 0.0533099905 times -3 -0.1599299715 -0.149 times -183767.9 27381.4171 What is -162 times -601092? 97376904 What is 0.1 times 1034.941? 103.4941 Work out -6 * -328.7317. 1972.3902 -447.6 * -27057 12110713.2 What is 7854.277 times -0.2? -1570.8554 -0.1621553 * 3 -0.4864659 Calculate 69.43095035. 347.1547515 Multiply 7304 and -42791. -312545464 What is the product of -8704312 and 12? -104451744 10-39291117 -392911170 Work out 0.8 * 13757648.7. 11006118.96 What is 0.5 times 4250657? 2125328.5 -4 times -3.8835966 15.5343864 What is the product of -81274.6 and -11? 894020.6 Multiply 0.13 and 43.134679. 5.60750827 542.553 * -62 -33638.286 What is 41220 times -1748? -72052560 1438 * -17213 -24752294 Work out 3 * 37239.45. 111718.35 Calculate 1247551-0.21. -261985.71 Multiply 2 and 0.021204. 0.042408 -1655 times 35138 -58153390 Multiply -1.42994 and 0.04. -0.0571976 Multiply 28 and 804.33. 22521.24 -18892.988 0.69 -13036.16172 -0.038 * -1285677 48855.726 What is the product of -10.18 and 2032.64? -20692.2752 What is 5178686 times 3.57? 18487909.02 What is the product of -28.9876 and 546? -15827.2296 What is the product of -0.2 and 30.321? -6.0642 Work out -1601 * 4268. -6833068 -7136465.09 -3632458.14 Work out -0.75 -418	{ "pile_set_name": "DM Mathematics" }
in the form kd + f and give f. 0 Express -20404 - 2s*4 - 10s - 20s3 + 20406 - 15s*3 + 2s*3 + 4s*4 as hs*4 + ns*2 + k + is*3 + ms and give h. 2 Rearrange 13 + 5i2 - 2i*3 + 27i*2 - 35i*2 + 4i to the form ri + q + xi*3 + di*2 and give x. -2 Rearrange 22 + 21 + 16 + 13 - 1811p - 70 to k + zp and give k. 2 Express 66 + 3a - 200 + 68 - 2a2 + 179a*3 + 66 in the form oa*2 + ka + p + da3 and give k. 3 Express -23v + 23v - 2v*2 + v - 10 - 41v2 + v3 in the form nv3 + mv + t + av2 and give m. 1 Express -30f*2 + 15f*2 + 74 + 17f2 + f - 75 - f3 + 80f4 in the form gf*4 + yf*2 + wf + of3 + h and give o. -1 Express -13 - 32 + 91d - 24 + 61 in the form q + yd and give y. 91 Rearrange 28u2 + u3 + 12u - 3u - u - 6u - 1 + 3 to the form hu + qu2 + au*3 + y and give a. 1 Express -m + 585 - 19m*3 - 12m + 6m3 + 14m as am + tm*3 + nm*2 + f and give f. 585 Rearrange -7895n + 5 + 10 - 23 + 0 + 10 to the form gn + h and give h. 2 Rearrange 152u*2 - 4u - 66u2 - 11 - 48u*3 - 71u*2 - 4u*3 - 14u*2 to the form mu*2 + lu*3 + iu + p and give m. 1 Express (3495d2 - 117d + 117d - 4954d*2 - 10264d*2 - 18043d*2)(-1 + 1 - 1) in the form n + ld2 + td and give l. 29766 Rearrange (-17b2 - 6b*2 - 12b*2)(5b2 - 6b*2 - 15b*2) to ab + nb4 + db*3 + xb*2 + p and give n. 560 Rearrange 1893o + 5339o + 1451o - 614o to the form so + j and give s. 8069 Rearrange -6 + 6 - 11u2 + (1 - 2u - 1)(0 + u + 0) + 62u + 2u2 - u2 - 3u*2 to the form gu*2 + mu + j and give g. -15 Express k*2 - 68 + 260k + 2k3 - 7k*2 - 143k - 116k as q + ck + hk3 + ik2 and give q. -68 Express -a2 - 2a2 + 3680 + 2a*2 - 3292 + 10611 in the form n + za*2 + xa and give n. 10999 Rearrange -260p2 + 475p*2 - 2p*3 + 27p - 1 - 217p2 + 49p to the form gp + qp*2 + xp*3 + o and give o. -1 Express (606 + 1328 + 704 - 160)(-2w + 3 - 3 + (-3w + 5w - 4w)(0 + 4 - 2) + 0w + 2w + 0w - 2w + 3 - 3 + 2w + 1 - 1) as p + ow and give o. -9912 Express -1031f*2 - 1578f*2 - 5 + 3 + 2 as kf*2 + tf + b and give k. -2609 Express ((95 - 51 + 38)(p - 3p + 0p) - 5p + 3p - 2p)(p - p - 3p*3) + 0p*4 + 2p4 - p4 in the form b + ip4 + jp*2 + lp*3 + wp and give i. 505 Rearrange -203 - 12s2 - 272 + 9s*3 - 88 - 14s*3 + 6s*3 to rs + js3 + zs*2 + m and give m. -563 Express -21a - 473a3 + 921a*3 + 10 - 461a3 + a2 - 8a4 + 20a in the form g + va2 + ya + ca3 + ja*4 and give v. 1 Rearrange 4 - 62s + 0 + 136s - 2 + 599s to the form vs + q and give v. 673 Express -91d*2 + 5d*2 + 53d*3 + 43d*2 + 44d*2 + 8 in the form vd*3 + cd + td2 + j and give t. 1 Rearrange (2 - 2 + 2w)(-w2 - 5 + 5) + (3882 - 83w + 180w - 96w + 1053)(7w - 7w + 5w*2) to sw + m + tw2 + hw*3 and give m. 0 Rearrange (-95 - 345 + 10)(4i - 2i + 6i3 - i) to the form vi*2 + ni + l + wi3 and give n. -430 Express 482 - 821o - 200 - 468o - 282 in the form y + mo and give m. -1289 Express -2u3 - 2u*2 - 171u + 85u + 26 + 73u in the form fu3 + iu*2 + cu + z and give c. -13 Express -1017p2 + 44 + 82 - 125 - 2p*3 in the form np*3 + rp*2 + m + lp and give m. 1 Express -572y - 562y - 2352y2 + 1135y + (2 + 1 - 1)(-y + y - 2y)(-2 - 2y - 1 + 2) in the form gy + ny*2 + h and give g. 5 Rearrange 1257c - 4621c - 4499c to the form l + kc and give k. -7863 Rearrange -1390g*3 - 44056 + 44056 + (-5g + 9 - 9)(-4g*2 + 2g*2 + 0g*2) to the form wg*2 + dg + l + og3 and give o. -1380 Rearrange 333i - 57i - 4 + 284i + 865i + 374i to si + p and give p. -4 Express -3p2 + p4 + 11685 - 2p4 - 2p*3 - 23361 + 0p*4 + 14p + 11677 in the form h + bp2 + lp*4 + xp*3 + vp and give v. 14 Express -1 + 48z2 + 5z*4 + 18 - z + 2z*3 - 50z*2 - 29z*4 as lz*4 + oz*2 + gz*3 + k + rz and give l. -24 Rearrange 104757i2 - 51802i*2 + 5 - 51242i*2 to the form ui + v + si2 and give s. 1713 Rearrange 87699q*4 - 175404q*4 + 1128q*3 + 87701q*4 + 0q - 3q2 - 2q + 4q2 to hq*2 + d + gq + tq4 + cq*3 and give h. 1 Rearrange 180357f*2 - 90178f*2 - 90185f*2 - 1042 to zf*2 + q + pf and give q. -1042 Rearrange (9 - 21 + 27)(-2 + 3 + 10)(51m + 34m - 18m) to vm + s and give v. 11055 Rearrange (-84774i4 + 170084i*4 - 84670i*4 + 5i*2)(3 - 4 + 2) to p + si4 + xi*3 + mi + ji2 and give j. 5 Express 2g*4 - 5g*4 + 2g*4 + (5g*2 - 2g*2 - 2g*2)(20522g2 - 12197g*2 + 18594g*2) as n + dg*3 + vg + ig2 + lg*4 and give l. 26918 Express -t + 3t - t + (2905t - 264t + 3701t)(-4 + 2 + 3) in the form gt + d and give g. 6343 Rearrange -9h3 - h3 + 7h3 - 1629 + 5h*2 + 1611 - 2h to b + mh + nh*2 + sh*3 and give b. -18 Rearrange 6l*2 + 4l*2 - 2l - 199 - 12l2 + 0l*2 to tl*2 + w + xl and give w. -199 Rearrange -4 - 26 + 9 - 8r2 + 8r*2 - r - 25r*3 to the form qr*3 + fr + o + tr2 and give q. -25 Express b3 + 499 + 0b*3 - 322 - 160b + 4b4 + 159b as h + mb3 + lb*4 + rb*2 + fb and give h. 177 Express (2312 - 41g + 154g - 2298)(-2 - 2 + 1) as u + sg and give s. -339 Rearrange -350y + 352y + 23 + 1241y3 + 30y*4 - 1240y*3 to ly*2 + ay*3 + g + py*4 + ty and give a. 1 Rearrange 52y2 + 5y*3 + 2438 - 28y*2 - 21y*2 + y - 2337 to the form x + jy*2 + oy*3 + uy and give u. 1 Rearrange (7 + 19s - 51s - 9)(-1715 + 1715 - 65s) to the form w + is + xs*2 and give w. 0 Rearrange (1 + 1 + 0)(-2 + 2i + 2) + 1 + i - 1 - 1407i - 1444i - 8064i to the form x + mi and give m. -10910 Express -31 - 7045a*2 + 31 - 8711a + 8711a as o + la + da2 and give d. -7045 Express (-9 - 9 + 6)(-78683w + 78687w - 170 - 111) as nw + v and give v. 3372 Express (4 - 1 - 1)(-414n2 + 618n*2 - 1222n*2)(3n2 - 2n*2 - 5n*2) in the form hn*4 + fn + wn2 + p + ln*3 and give h. 8144 Rearrange (1122 - 1095 + 1439)(3 - m - 3) to the form c + ym and give y. -1466 Rearrange 9r*2 - 230 - 24r*3 - 229 + 458 - 9r*3 to the form sr*3 + t + nr*2 + fr and give s. -33 Express -4478s - 2 + 4479s + 22s3 - 14s*3 + 4s*4 + 15s*3 + 12s*3 + 3s*2 as ps*3 + hs*2 + qs*4 + cs + a and give p. 35 Rearrange 10c + 7 - 2c*2 - 26 - 35c + 12 - 2c2 to the form bc + z + lc2 and give z. -7 Rearrange -i3 + 325 + 300 - 43i - 627 + 5i3 to zi*2 + b + qi + yi3 and give b. -2 Rearrange -r - 1367 + 4r + 600 + 657 to the form n + tr and give t. 3 Rearrange -121j*2 + 4j*3 + 3j*4 + 196j*2 + j + 46 - 76j*2 to oj + x + lj2 + cj*3 + fj*4 and give l. -1 Rearrange 15g + 3g4 + 3g*4 + 2g2 - g4 - 40g - 2g*4 - 10 to the form s + yg*2 + dg*3 + pg + fg4 and give f. 3 Rearrange 325k + 2244k + 906k to i + zk and give z. 3475 Express 188j*3 + 129954 + j - 64977 - 64979 in the form ij*3 + k + aj*2 + lj and give l. 1 Rearrange -29g2 - 688g + 66g2 + 1839g - 36g2 + 2422g to bg2 + s + qg and give q. 3573 Rearrange -3k3 + k2 + 2 - k - k - 4228k*4 + 8434k*4 - 4215k*4 to the form nk*3 + vk*2 + ik + sk4 + h and give i. -2 Rearrange 25p*3 + 0p*3 - 11p*3 + (-3p + 2p - p)(0 + 2p2 + 0) to the form wp + np3 + kp*2 + d and give n. 10 Rearrange -36s - 33s - 36s + 452 + 136s - 33s to the form ms + b and give m. -2 Rearrange (-2640 + 10946 - 2798 - 2451 - 2563)(4t - 4t - 7t2) to the form wt + ct2 + y and give c. -3458 Rearrange (3i + 3i - 4i)(223 - 726 + 2892)(6i3 - 3i3 - i3) to the form f + ri + qi*3 + oi*4 + ci*2 and give o. 9556 Rearrange 269u - 77u - 91u - 101u + 23690u*2 to the form t + qu + mu2 and give m. 23690 Rearrange ((39 - 3 + 3)(-2 + 0 + 0)(6w - 4w - 3w) + (-4w + 3w + 2w)(1 + 1 - 4))(154 + 22 - 8) to the form pw + n and give p. 12768 Rearrange 7h3 - 95h - 2h2 - 8h*3 + 4h2 - h2 - 2 - 22h to zh*3 + vh + y + bh2 and give y. -2 Express 451c - 115c2 - 451c - 12 + 6c2 + 12 + (-c + 3c -	{ "pile_set_name": "DM Mathematics" }
he o'th term of -54, -260, -612, -1116, -1778, -2604? -o*3 - 67o*2 + 2o + 12 What is the z'th term of -58, -55, -52, -49, -46? 3z - 61 What is the k'th term of -167, -699, -1593, -2855, -4491, -6507, -8909? -k3 - 175k*2 + 9 What is the m'th term of -4341, -8682, -13023, -17364? -4341m What is the m'th term of -3, 7, 41, 111, 229, 407? 2m3 - 4m - 1 What is the k'th term of 2, 77, 282, 683, 1346, 2337, 3722, 5567? 11k3 - k2 + k - 9 What is the y'th term of 23, 34, 49, 68, 91, 118, 149? 2y*2 + 5y + 16 What is the g'th term of 53, 67, 107, 185, 313, 503, 767, 1117? 2g3 + g2 - 3g + 53 What is the y'th term of 553, 1104, 1657, 2212, 2769? y*2 + 548y + 4 What is the s'th term of -79, -85, -95, -109, -127? -2s2 - 77 What is the t'th term of 1, -20, -91, -236, -479, -844, -1355? -4t3 - t2 + 10t - 4 What is the o'th term of 51, 107, 163? 56o - 5 What is the m'th term of -182, -178, -172, -164, -154, -142? m2 + m - 184 What is the z'th term of 1513, 1509, 1503, 1495, 1485, 1473, 1459? -z2 - z + 1515 What is the v'th term of -23269, -46540, -69811, -93082, -116353? -23271v + 2 What is the f'th term of -590, -594, -598? -4f - 586 What is the k'th term of 28, 60, 110, 184, 288, 428, 610? k*3 + 3k*2 + 16k + 8 What is the t'th term of -4, 11, 36, 71? 5t2 - 9 What is the s'th term of 13970, 27938, 41906, 55874, 69842, 83810? 13968s + 2 What is the u'th term of -1975, -7899, -17771, -31591? -1974u2 - 2u + 1 What is the l'th term of -7388, -7392, -7396, -7400, -7404, -7408? -4l - 7384 What is the u'th term of 11, 32, 65, 116, 191, 296, 437, 620? u3 + 14u - 4 What is the f'th term of 37088, 37087, 37086, 37085, 37084, 37083? -f + 37089 What is the i'th term of -8380, -8381, -8382, -8383? -i - 8379 What is the f'th term of -117, -105, -85, -57, -21, 23? 4f2 - 121 What is the o'th term of 3, 4, 7, 12, 19, 28, 39? o2 - 2o + 4 What is the i'th term of -56, -74, -114, -188, -308, -486, -734? -2i3 + i2 - 7i - 48 What is the m'th term of 1025, 1028, 1031, 1034? 3m + 1022 What is the t'th term of -3, 56, 257, 672, 1373, 2432? 12t3 - t2 - 22t + 8 What is the h'th term of 11, 12, 9, 2, -9, -24? -2h*2 + 7h + 6 What is the t'th term of 118, 244, 370? 126t - 8 What is the s'th term of 10, 14, 4, -26, -82, -170, -296? -s3 - s2 + 14s - 2 What is the l'th term of -55, -110, -165, -220, -275? -55l What is the g'th term of 30, 44, 56, 66, 74, 80, 84? -g2 + 17g + 14 What is the f'th term of -62, -126, -190? -64f + 2 What is the k'th term of -60, -111, -162, -213, -264? -51k - 9 What is the i'th term of 60, 106, 152, 198, 244, 290? 46i + 14 What is the g'th term of 174, 214, 256, 300, 346, 394, 444? g2 + 37g + 136 What is the q'th term of -1, -22, -65, -136, -241? -q*3 - 5q*2 + q + 4 What is the k'th term of -1743, -1746, -1749, -1752, -1755? -3k - 1740 What is the r'th term of 78, 87, 98, 111? r*2 + 6r + 71 What is the l'th term of 100, 72, 56, 58, 84? l*3 - 35l + 134 What is the m'th term of -9, -15, -19, -21? m*2 - 9m - 1 What is the k'th term of 8, 8, 20, 50, 104, 188? k*3 - 7k + 14 What is the c'th term of 3, 46, 147, 336, 643? 5c3 - c2 + 11c - 12 What is the m'th term of 19065, 19069, 19075, 19083, 19093? m*2 + m + 19063 What is the i'th term of -136, -275, -414, -553, -692? -139i + 3 What is the l'th term of -45, -46, -47? -l - 44 What is the g'th term of 99, 158, 221, 288, 359? 2g2 + 53g + 44 What is the c'th term of 142, 136, 128, 118, 106, 92, 76? -c*2 - 3c + 146 What is the l'th term of 731, 1464, 2197, 2930? 733l - 2 What is the n'th term of 2061, 2059, 2057, 2055? -2n + 2063 What is the d'th term of -265, -535, -807, -1081, -1357, -1635? -d*2 - 267d + 3 What is the j'th term of 42, 152, 332, 582? 35j2 + 5j + 2 What is the h'th term of -97, -87, -71, -49, -21? 3h2 + h - 101 What is the m'th term of -10, -25, -56, -109, -190? -m3 - 2m*2 - 2m - 5 What is the f'th term of -1784, -3562, -5340, -7118? -1778f - 6 What is the i'th term of -49, -85, -169, -325, -577, -949, -1465, -2149? -4i*3 - 8i - 37 What is the r'th term of -3, -15, -35, -63, -99, -143? -4r2 + 1 What is the v'th term of -1, -20, -53, -106, -185, -296? -v3 - v2 - 9v + 10 What is the c'th term of -17, -34, -53, -74, -97, -122? -c*2 - 14c - 2 What is the d'th term of 93, 92, 91? -d + 94 What is the r'th term of 369, 737, 1107, 1479, 1853? r*2 + 365r + 3 What is the t'th term of -13, -17, 1, 53, 151, 307, 533? 2t3 - t2 - 15t + 1 What is the n'th term of -124, -267, -422, -589, -768, -959? -6n2 - 125n + 7 What is the h'th term of -5504, -5505, -5506, -5507, -5508, -5509? -h - 5503 What is the c'th term of -122, -119, -100, -59, 10, 113, 256, 445? c*3 + 2c*2 - 10c - 115 What is the m'th term of -1344, -1356, -1382, -1428, -1500, -1604? -m3 - m2 - 2m - 1340 What is the y'th term of -27, -74, -141, -234, -359, -522, -729, -986? -y3 - 4y*2 - 28y + 6 What is the c'th term of -179, -357, -533, -707, -879, -1049? c*2 - 181c + 1 What is the p'th term of -90, -182, -274, -366? -92p + 2 What is the x'th term of 4648, 4646, 4644, 4642, 4640, 4638? -2x + 4650 What is the i'th term of 1626, 1617, 1594, 1551, 1482? -i3 - i2 + i + 1627 What is the x'th term of -50, -44, -36, -26, -14? x*2 + 3x - 54 What is the f'th term of -13891, -13890, -13889, -13888? f - 13892 What is the v'th term of 230, 228, 226? -2v + 232 What is the c'th term of -5, 2, -9, -44, -109? -c3 - 3c*2 + 23c - 24 What is the g'th term of 29, 40, 33, 8? -9g2 + 38g What is the q'th term of -21, -53, -107, -183, -281? -11q2 + q - 11 What is the q'th term of 345, 362, 405, 486, 617, 810? 2q3 + q2 + 342 What is the k'th term of 2, -6, -26, -64, -126, -218? -k*3 - k + 4 What is the l'th term of 311, 603, 895? 292l + 19 What is the n'th term of 38, 44, 50, 56? 6n + 32 What is the r'th term of -13, -72, -229, -532, -1029, -1768? -8r3 - r2 - 4 What is the z'th term of 185, 194, 215, 254, 317, 410? z*3 + 2z + 182 What is the i'th term of 48, 98, 150, 204, 260, 318? i*2 + 47i What is the l'th term of 10, 29, 46, 61? -l*2 + 22l - 11 What is the m'th term of -246, -495, -740, -981, -1218, -1451, -1680? 2m2 - 255m + 7 What is the p'th term of -6861, -6853, -6841, -6825? 2p2 + 2p - 6865 What is the z'th term of 0, -107, -286, -537, -860? -36z2 + z + 35 What is the g'th term of -82, -90, -110, -148, -210, -302, -430, -600? -g3 - g - 80 What is the r'th term of -9, -39, -91, -165, -261? -11r*2 + 3r - 1 What is the f'th term of -22, -37, -52, -67, -82, -97? -15f - 7 What is the v'th term of 285, 568, 849, 1128? -v2 + 286v What is the n'th term of -1655, -1653, -1651, -1649? 2n - 1657 What is the b'th term of -83, -201, -331, -479, -651, -853, -1091? -b3 - 111b + 29 What is the m'th term of -76, -68, -46, -4, 64, 164, 302, 484? m3 + m2 - 2m - 76 What is the r'th term of 7, 31, 65, 103, 139? -r3 + 11r*2 - 2r - 1 What is the j'th term of -12, -10, -6, 0, 8? j2 - j - 12 What is the l'th term of -36, -23, 6, 57, 136, 249, 402? l3 + 2l2 - 39 What is the f'th term of -63, -67, -71, -75? -4f - 59 What is the k'th term of -63, -244, -545, -966, -1507, -2168? -60k2 - k - 2 What is the b'th term of 2, 1, -2, -7, -14, -23, -34? -b2 + 2b + 1 What is the p'th term of 5, -57, -239, -601, -1203? -10p3 + 8p + 7 What is the z'th term of 46, 94, 142, 190? 48z - 2 What is the a'th term of 8156, 16310, 24464, 32618, 40772, 48926? 8154a + 2 What is the k'th term of -206, -740, -1636, -2900, -4538, -6556? -k*3 - 175k*2 - 2k - 28 What is the o'th term of -89, -168, -247, -326, -405? -79o - 10 What is the r'th term of -44, -49, -54, -59? -5r - 39 What is the n'th term of -120, -238, -360, -486? -2n2 - 112n - 6 What is the q'th term of -2233, -2230, -2217, -2188, -2137, -2058, -1945? q3 - q2 - q - 2232 What is the v'th term of 35, 117, 253, 443, 687, 985, 1337? 27v2 + v + 7 What is the i'th term of 2159, 4318, 6477, 8636, 10795? 2159i What is the l'th term of -534, -1059, -1576, -2085? 4l2 - 537l - 1 What is the c'th term of 13, -1, -29, -77, -151, -257, -401, -589? -c3 - c2 - 4*c + 19 What is the w't	{ "pile_set_name": "DM Mathematics" }
l + l + 0l)(-2l3 + 6l*4 + 2l*3). -23l*5 Expand (-4r + 2r + 4r)(0 + 3 - 2) - 4r - r + 2r + (33 - 85 - 1)(-3r + 5r + r). -160r Expand -7h + 7h + 6h*2 - 3h + h*2 + 3h + (2 + 2h - 2)(11h - 10h - 14h). -19h*2 Expand (2j*2 + 0j2 + j2)(-4j + 2j - j - 1) - 18j*3 - 373j + 373j. -27j*3 - 3j*2 Expand -148a*4 + 621a*4 + 214a*4 + (-3a3 + a3 + 0a3)(0a - 4a + 6a). 683a*4 Expand (1 - 15 + 56)(9v + 0v - 7v). 84v Expand (2 + 14 - 2)(11 + 14 - 15)(2 - 2c - 2)((-c + c + 2c2)(-2c + 1 - 1) + 0c*3 + 2c*3 + 0c*3 - 5c3 + c3 + 3c3). 840c*4 Expand (w - 1 + 1)(-3 + 1 + 4) + (4w - 3w + 0w)(-209 + 1 + 6). -200w Expand (-2 + 2 - 9l*4)(2 + 2 + 0) + 3l4 - 4l*4 + 0l*4 + (2 - 1 - 3)(-3 + 2l4 + 3) + 3l*4 - 4l*3 + 4l*3 + 4l*4 - 2l*4 + 2l*4. -34l*4 Expand 2 + 21r*4 - 20r*4 + 2r5 - r5 + (-2r5 + 2r*5 - 2r*5)(1 - 1 + 2) + 2r5 - r5 + r5. -r5 + r4 + 2 Expand (-8d + 9d + 15d)(24 + 9 + 257 + 25). 5040d Expand (6w + 0w - w)(-6w + 6w + 33w*2). 165w*3 Expand (-3u2 - u4 + 3u2)(0 + u + 0) + (-u + u + 2u)(9u - 9u - u*4). -3u*5 Expand (-1 - f + 1)((3f - 2f - 2f)(3f + 5f - 2f) + 2f*2 - 3f*2 + 3f*2 + (-2f - f + 7f)(-5f + f + 3f) - f*2 - 4f + 4f). 9f*3 Expand 74b*4 + 328b*2 - 328b2 + (b2 - 2b2 - b2)(0 - 2b2 + 0) - b4 - 4b*4 + 3b4 + b4 - 2 + 2. 77b4 Expand (7z*2 - 2z - z*2 - 4z*2)(-5z - 2z + 3z)(4 - 3 - 3). 16z3 - 16z*2 Expand 6v - 2v - 4v*4 + 6v - 2v4 + 2v*4 - 2v*4 + 5v*4 - 5v*4 - 2v*4 - 3v4 + v4 + 3v4 + (3 - 3 + 1)(-3v4 + 3v*4 + 2v*4). -5v*4 + 10v Expand -c + 0c + 3c + (-2c - c + 2c)(4 - 3 - 3) - 190 + 264c + 190. 268c Expand (2 - 1 - 3)(-3z + 0z - z) + 16z + 0z - 5z - z + z + 2z - 1. 21z - 1 Expand (u2 - 4u2 + u2 - 23u + 23u - 2u2 + (-2 - 4 + 4)(-3u2 + 0u*2 + 5u*2))(0u3 + 18u*3 + 14u*3). -256u*5 Expand (-j + 3j + 2j)(-2 + 0 + 4 + (0 + 0 + 2)(0 + 1 + 1)) + 21 - 2j + 37 - 8. 22j + 50 Expand (5 - 2v - 5)(-3v + 5v + 0v) + (-35v - 60 + 60)(4 + 2 - 5)(-2v + 0v - v). 101v*2 Expand (8s + 0s - 4s + (2s - 1 + 1)(64 - 195 + 26))(-3 - 1 + 2). 412s Expand (535v - 23v + 32v)(5v2 + 0v*2 - 3v*2). 1088v*3 Expand (4q*2 - 1 - 2 - 3q*2)(13q - 14q + 51q3 + 40q*3). 91q*5 - 274q*3 + 3q Expand (3n4 - 3n*4 + 2n*4)(3 - 4 - 1) - n*4 + n - n + (-2 - 1 + 1)(-38n3 + 38n*3 + 25n*4). -55n*4 Expand (2864 + 0f - 2862 - 2f2 - 21f)(-2f*3 + 0f + 0f) + 4f*5 - 2f*5 + 0f*5. 6f*5 + 42f*4 - 4f*3 Expand (2 - 2 + x)(-3x - x + 0x) - 4x2 + 7x*2 + 2x*2 + 2x*2 + 2x*2 - 3x*2. 2x*2 Expand (4z - z + 4z)(88z - 26z + 33z). 665z*2 Expand ((-2p*2 - 1 + 1)(2 + p - 2) + 0 - 2p3 + 0 - 6p + 6p - 10p*3)(26p2 - 4p*2 - 15p*2). -98p*5 Expand (-3f*3 + 2f*3 + 3f*3)(2f - 4f + f) + f*4 + 0f + 0f - 8f + 8f - 8f*4 + 0f4 + f4 + f*4 + (4f + 3f2 - 4f)(-f2 - f2 - f2). -16f*4 Expand (9g - 3g - 7g - 11g2)(0g + 2g + 2g). -44g*3 - 4g*2 Expand 0n*3 + 0n*3 + 2n*3 + (-n + 0n - 6n)(0 - 1 - 1)(2n*2 + 2n*2 + 2 - 7n*2). -40n*3 + 28n Expand (-3h + 5h - 3h)(-2h2 + 1 - 1) + 0h3 - h3 + 9h3 + (-4 + 1 + 5)(-5h3 + 2h*3 + 5h*3) + (0h*2 + 3h2 - h2)(36 - 25h - 36). -36h3 Expand (-119 + 119 - 17f)(-3f*3 - 6f*3 + 3f*3). 102f*4 Expand (-2 - 2 + 3)(2 - 3 + 3)(5 + 2 - 5)(-127p - 1219 + 1219). 508p Expand (3g3 + 0g + 0g)(2g + 3g - 2g - 4g + 0g + 3g + (0g + g - 2g)(0 - 1 - 1))(2 - g - 2g - g). -48g*5 + 24g*4 Expand (-2m*2 + 6m*2 - 2m*2)(0m3 - 3m*3 + 2m*3 + (-4m*2 + 0m*2 + 2m*2)(0 + 0 - m) + (2 + 6 - 5)(-5m3 + m2 - m*2)). -28m*5 Expand (-12s*4 + 8s*4 + 7s*4)(-s + 16s + 14s - 3s). 78s5 Expand (-h2 + 2h - 2h)(h - 3 + 3) - 57h*3 + 47h*2 - 47h*2 - 2. -58h*3 - 2 Expand 0s + s*5 + 0s - 3s5 + 5s5 - s5 + (-2s5 + 2 - 2)(3 - 1 - 3) - 6s5 + s5 + 4s*5 - 79s*5 - 1090s*3 + 1090s*3. -76s*5 Expand (-3o*2 + 0o*2 + 2o*2)(2 - 1 + 0) - 26o2 - 67o*2 + 26o*2. -68o*2 Expand (-4j - 4j - 55j)(j2 - 2j3 - j2)(-3 - 2j + 3 + (j + j - 3j)(-1 - 1 + 3) - 3j + 2j - j + 2j - 3j - j + 4j + j - 4j). -756j5 Expand (133f*3 - 133f*3 + 18f*4)((4 - 2 - 3)(-1 + 2 + 1) + 1 - 2 + 2 + (-4 + 2 + 3)(-1 + 0 - 1) - 5 + 3 + 1). -72f4 Expand (-266u*2 - 194u*2 + 587u*2)(4u - u - 2u)(-1 - 2u + 1). -254u4 Expand (5g - g - 3g)((-2 - 2 + 5)(-g2 + 4g - 4g) + (-2g - 4g + 5g)(2g - g + 4g)). -6g*3 Expand (-3b - 2 + 2)(233 - 84 - 99)(2 + 2 - 2). -300b Expand (1207 + 423h - 834h + 412h)(h + 0 + 0). h2 + 1207h Expand (-1 - 4 + 3)(2 + 2 - 2)(-3 + 3 - i - 2i2). 8i*2 + 4i Expand (0w2 + 0w*2 - 2w*2 + (-2w + 3 - 3)(2w - 3w + 3w) + w*2 + 0w2 + w2)((-3 + 0 + 2)(-1 + 4 + 7) + 4 - 3 + 1). 32w2 Expand (4r + 4r - 3r)(-16 + 3 - 1). -70r Expand (3 + 4h - 2 - 2)(11h2 - 13h*2 + 15h*2) + (0h*2 + 2h*2 + 0h*2)(-h + 5h - 2h) - 3 - 2h3 + 3 + h3 + h3 + 0h*3. 56h*3 - 13h*2 Expand (4 + 5g - 4)(1 - 4 + 0)(-1 - 1 + 6)(2 + 3 + 0). -300g Expand (-1 - 4 + 4)(207d*3 - 133d*2 + 133d*2). -207d*3 Expand (2a + 4a - 7a)(-19 + 222 + 15). -218a Expand -17b5 - 11b*5 + 21b*5 + ((1 - 1 - 2b)(6 - 2 - 2) + 3 - 3 + 2b)(0b + 0b + 2b*4). -11b*5 Expand (23 - 3 + 41 + 24)(2v - 71 + 35 + 38). 170v + 170 Expand 3w3 + 2 - 2 + (3w*2 + 11w*2 + 0w*2)(0 + 1 - 4)(-w - 1 + 1). 45w*3 Expand (-6p*4 + 14p*4 - 7p*4 + 2p + 2p4 - 2p - 3p4 - p2 + p2 + (-1 + 2p*3 + 1)(-1 - 2p + 1))(0 + 0 - p). 4p5 Expand (-11 + 7 + 13)(-8x - 6x + 21x)(-2x + 2x + 2x3). 126x*4 Expand (-2 + 7 + 2)(h + 6h + h)(-5h + 3h + 5h). 168h2 Expand -l4 + 0l4 + 5l*4 + 13l*5 + (-2l*4 + 4l*4 + 0l*4)(-2 + 2 - l). 11l5 + 4l*4 Expand (-12j + 6j - 3j)(-2j - 2j + 7j)(-j - j + 0j)(2 - j - 2)(-2 + 1 - 2). 162j4 Expand (-5v + 4v - v)(22 - 58 + 20). 32v Expand (-4237l*2 + 9l*4 - 13l*4 + 4064l*2)(1 - 1 + 2l). -8l*5 - 346l*3 Expand (0w*2 + 0w2 + w2)(w + 2w - 2w + (4 + 2w - 4)(-8 + 18 + 8)). 37w*3 Expand (-1 + 28 + 7)(-7i2 - 8i + 8i). -238i*2 Expand (-2z - 7z - 2z)(19 + z - 19)(5z - 3z + 0z). -22z*3 Expand (-2 + 7 + 2)(14 + 3 - 10 - 3q). -21q + 49 Expand (5p + 95p*3 - 101p*3 - 3p)(p - 14p + 8p) + (5 - 4 - 3)(4 + p - 4)(p3 - p3 - p3). 32p*4 - 10p*2 Expand (-2 + 0 + 0)(-77x5 + x4 + 148x*5 + 5 - 72x*5). 2x*5 - 2x*4 - 10 Expand (5l*4 + 0l*4 - 3l*4 + 0l + 0l - l4 + (-l4 + 3l*4 - 3l*4)(1 - 2 + 3) + 2l4 + l4 + 0l*4)(-798 - 24l + 798). -48l5 Expand 6 + 3 + z2 - 15 + (4 - 4 - 2)(2z2 - z2 + z*2). -3z2 - 6 Expand -l2 + 2l2 - 5l*2 + (2l - 6l + 0l)(22l + 8l - 9l). -88l2 Expand (-1 + 14 - 2)(2d4 - d4 - 2d*4). -11d*4 Expand (2f*2 - 5f2 + f2)(-2f - 1 + 1) + 5f3 - 2f3 - f3 - 2f + 2f - f*3 - 63f*3 + 32f*3 - 51f*3. -77f*3 Expand -39z*4 - 56z*4 - 561z*5 + 95z*4 + (2 + 0 - 1)(3z5 - z5 - 3z*5). -562z*5 Expand ((1 - 2 + 2)(4m + 3m - 5m) + 4 - 4 + 2m + 5m - m - 3m - 79 + 79 + 16m)(3m + 0m - m) + m*2 - 10m2 + m2 + (2 - 2 - m)(4 - 4 + m). 33m*2 Expand (-2t + 4t + 0t)(178t + 17t2 - 178t + 15t3). 30t*4 + 34t*3 Expand (2i*2 - 5i2 + i2)(4i*2 - 4i2 - i2) + (-i*3 + 3i*3 - 5i*3)(-2i + 6i - i) + 0i4 + 0i*4 + 2i*4. -5i*4 Expand (-n + 0n + 3n)(-9n4 - 239n*2 + 239n*2 + (2n - 2n - 2n*4)(1 - 1 + 1)). -22n5 Expand (-164 + 342 + 519)(-2 - 2o + 2). -1394o Expand -8w5 + 41w*5 + 0w*5 + (-5w*4 - 4w*4 + 6w*4)(-4w - 2w + 3w). 42w*5 Expand (-3r*3 + 3r*3 + 2r*3)(1 - 1 - r) + 0r4 - 2r4 + r4 + r*4 + r - r - 3r2 - r4 + 3r2 + (-5 - 3 + 3)(-4r3 + 4r3 + r4). -8r*4 Expand (-2 + j + 2 +	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.