Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
er when 192147 is divided by 4140. 1707 Calculate the remainder when 47202498 is divided by 5741. 5737 Calculate the remainder when 112586 is divided by 1735. 1546 What is the remainder when 30734 is divided by 2047? 29 Calculate the remainder when 47081 is divided by 23501. 79 Calculate the remainder when 12100354 is divided by 2642. 2636 What is the remainder when 382624 is divided by 99? 88 What is the remainder when 73330287 is divided by 1349? 1345 Calculate the remainder when 11620 is divided by 970. 950 Calculate the remainder when 363719 is divided by 9806. 897 What is the remainder when 639473 is divided by 213073? 254 Calculate the remainder when 4080115 is divided by 141. 139 What is the remainder when 4913200 is divided by 46792? 40 Calculate the remainder when 82014631 is divided by 11. 6 What is the remainder when 151563 is divided by 75238? 1087 What is the remainder when 4921498 is divided by 2570? 2518 Calculate the remainder when 7492030 is divided by 281. 8 Calculate the remainder when 934446 is divided by 77844. 318 What is the remainder when 177742 is divided by 1794? 136 Calculate the remainder when 7647195 is divided by 265. 90 What is the remainder when 4613873 is divided by 562? 415 What is the remainder when 14461 is divided by 6711? 1039 What is the remainder when 258751 is divided by 16? 15 What is the remainder when 894780 is divided by 223676? 76 What is the remainder when 3425752 is divided by 1080? 1072 Calculate the remainder when 819719 is divided by 3375. 2969 What is the remainder when 11684546 is divided by 13? 3 Calculate the remainder when 4211719 is divided by 1367. 1359 What is the remainder when 31248 is divided by 6122? 638 What is the remainder when 201983 is divided by 99757? 2469 Calculate the remainder when 48534 is divided by 1006. 246 Calculate the remainder when 35541334 is divided by 2530. 2424 Calculate the remainder when 1114996 is divided by 541. 536 Calculate the remainder when 1918092 is divided by 3413. 3399 What is the remainder when 292118 is divided by 251? 205 Calculate the remainder when 471390 is divided by 99. 51 What is the remainder when 192985321 is divided by 31? 29 Calculate the remainder when 2120731 is divided by 37. 2 Calculate the remainder when 364298 is divided by 2824. 2 What is the remainder when 933227 is divided by 12272? 555 Calculate the remainder when 5172744 is divided by 2654. 98 What is the remainder when 15166405 is divided by 38? 35 Calculate the remainder when 2217405 is divided by 3514. 71 Calculate the remainder when 1078243635 is divided by 282. 279 Calculate the remainder when 86681874 is divided by 1021. 1016 What is the remainder when 2551386 is divided by 3495? 36 Calculate the remainder when 15675030 is divided by 3387. 3381 What is the remainder when 147169 is divided by 145913? 1256 What is the remainder when 35541824 is divided by 2268? 2264 Calculate the remainder when 5599359 is divided by 2080. 2079 What is the remainder when 258366 is divided by 85? 51 What is the remainder when 1018886 is divided by 27534? 128 Calculate the remainder when 30679225 is divided by 2587. 2579 What is the remainder when 58475143 is divided by 42404? 27 Calculate the remainder when 63730023 is divided by 1388. 3 What is the remainder when 13167 is divided by 5905? 1357 What is the remainder when 680432 is divided by 680416? 16 What is the remainder when 107731 is divided by 107705? 26 Calculate the remainder when 1903156 is divided by 5766. 376 What is the remainder when 146881486 is divided by 1203? 1201 What is the remainder when 842719 is divided by 4321? 124 What is the remainder when 27046 is divided by 13435? 176 What is the remainder when 11754 is divided by 2276? 374 What is the remainder when 44951327 is divided by 1226? 37 Calculate the remainder when 335938 is divided by 579. 118 Calculate the remainder when 58006789 is divided by 98. 1 Calculate the remainder when 3329494 is divided by 34. 10 Calculate the remainder when 76944 is divided by 914. 168 Calculate the remainder when 5134463 is divided by 5134458. 5 What is the remainder when 40754 is divided by 40702? 52 What is the remainder when 72936 is divided by 63123? 9813 Calculate the remainder when 50487186 is divided by 439. 430 Calculate the remainder when 2548446 is divided by 2548269. 177 Calculate the remainder when 1159582 is divided by 193259. 28 Calculate the remainder when 47847 is divided by 15921. 84 What is the remainder when 26178647 is divided by 25? 22 What is the remainder when 3317341 is divided by 25518? 1 What is the remainder when 1262934 is divided by 1689? 1251 Calculate the remainder when 8756086 is divided by 23665. 36 Calculate the remainder when 12450435 is divided by 3869. 3862 What is the remainder when 662401 is divided by 331193? 15 What is the remainder when 374141994 is divided by 19? 17 What is the remainder when 78960671 is divided by 36? 35 Calculate the remainder when 22332 is divided by 3400. 1932 Calculate the remainder when 19398101 is divided by 7507. 13 What is the remainder when 202252 is divided by 5641? 4817 What is the remainder when 2011594 is divided by 1754? 1510 What is the remainder when 1034500 is divided by 172374? 256 What is the remainder when 16264966 is divided by 8132452? 62 Calculate the remainder when 29692742 is divided by 646. 644 What is the remainder when 283771 is divided by 35441? 243 What is the remainder when 84076519 is divided by 9113? 9094 Calculate the remainder when 76464 is divided by 1029. 318 What is the remainder when 1685326 is divided by 17197? 20 Calculate the remainder when 39554 is divided by 6575. 104 Calculate the remainder when 628359828 is divided by 190. 188 What is the remainder when 121224 is divided by 24059? 929 What is the remainder when 29467697 is divided by 88? 17 What is the remainder when 14033 is divided by 38? 11 Calculate the remainder when 128683 is divided by 31269. 3607 Calculate the remainder when 2363856 is divided by 590960. 16 What is the remainder when 1969726 is divided by 109423? 112 Calculate the remainder when 1340591 is divided by 446854. 29 Calculate the remainder when 226771055 is divided by 176. 159 What is the remainder when 879418 is divided by 109910? 138 Calculate the remainder when 42584919 is divided by 18. 15 Calculate the remainder when 966687 is divided by 107407. 24 Calculate the remainder when 714700 is divided by 24643. 53 Calculate the remainder when 16134869 is divided by 51. 50 Calculate the remainder when 8192499 is divided by 1250. 1249 What is the remainder when 11628916 is divided by 1823? 1822 Calculate the remainder when 3790735 is divided by 313. 305 Calculate the remainder when 424678 is divided by 1705. 133 Calculate the remainder when 2761596 is divided by 2455. 2176 Calculate the remainder when 170270 is divided by 28377. 8 Calculate the remainder when 817462 is divided by 27. 10 What is the remainder when 342005 is divided by 341922? 83 What is the remainder when 204949 is divided by 138? 19 Calculate the remainder when 89774987 is divided by 2671. 6 What is the remainder when 5957795 is divided by 5436? 5375 What is the remainder when 30596487 is divided by 438? 435 Calculate the remainder when 33314635 is divided by 5558. 5541 What is the remainder when 10718007 is divided by 2679488? 55 Calculate the remainder when 3690083 is divided by 109. 106 What is the remainder when 2685808 is divided by 177? 10 Calculate the remainder when 22040480 is divided by 2003677. 33 Calculate the remainder when 228710493 is divided by 13. 11 Calculate the remainder when 9582811 is divided by 49. 28 What is the remainder when 366637 is divided by 7331? 87 Calculate the remainder when 401710961 is divided by 138. 137 Calculate the remainder when 5484831 is divided by 4127. 48 What is the remainder when 48817998 is divided by 50? 48 What is the remainder when 170525 is divided by 6314? 47 Calculate the remainder when 8415209 is divided by 135728. 73 What is the remainder when 102363 is divided by 2707? 2204 Calculate the remainder when 35929747 is divided by 131. 115 What is the remainder when 239866 is divided by 2577? 205 What is the remainder when 40437878 is divided by	{ "pile_set_name": "DM Mathematics" }
4s + 2g + 2g + 12 = 0. Which is the smallest value? (a) 0 (b) -1 (c) s b Let t = -31/5 - -27/5. What is the second biggest value in 0.4, t, -1? t Let q = -0.6 - 3.4. Let d = 7 + q. Let s = -44 + 45. What is the smallest value in d, s, 1/5? 1/5 Let z = -1 + 0.4. Let a = -3.6 - z. What is the smallest value in 1/6, a, -1/2? a Let o be 6/2097(1 + -4). Let x = o - -484/2097. Suppose -4y + 35 = 2l - 9y, -4l - y = -15. What is the second biggest value in -1, x, l? x Let p = 8 - 7.88. Let s = -0.18 - p. What is the smallest value in -0.2, 4, s? s Suppose 5i = 18 - 3. Let t = 10 + -15. What is the second smallest value in 2, t, i? 2 Let d = 0.0007 - 0.5007. Let i = -21.91 - -22. Let x = i + -0.89. Which is the second smallest value? (a) d (b) x (c) -2/11 a Suppose 3d = 6d + 4k - 2, -2d + 3k = 10. Let p(u) = u + 2. Let n be p(-2). Let v be -4(-1)/(-7) + n. Which is the biggest value? (a) v (b) 1/2 (c) d b Let m = -0.7 + 3.7. Let a = 0.1 + 0.1. Let c = 0.1 + a. What is the third smallest value in m, c, 2/9? m Let w = -7 - -7.01. Let v = 5.01 - w. Let y(h) = h3 + 3h*2 + 3h + 1. Let i be y(-2). What is the third biggest value in i, v, 2? i Let x = 3 + -3. Let c = x - -2. Let s = c + -1.6. What is the third biggest value in -2/13, 0, s? -2/13 Let h = 188 + -182.96. Let f = h - 0.04. Which is the biggest value? (a) -0.1 (b) f (c) -0.2 b Let o = 9 + -6. Suppose -od = 2m - 3, -d - 4 = -5d + 2m. Let h be 22/70 + (-4)/(-14). Which is the second smallest value? (a) h (b) 2 (c) d c Let p = 0.01 - -1.99. Which is the biggest value? (a) 3 (b) 1/4 (c) -0.8 (d) p a Suppose 5g = 6g + 1. What is the biggest value in 2, -8, g? 2 Let k(i) = -i - 11. Let t be k(-15). Which is the third smallest value? (a) 0.3 (b) t (c) -1 b Let x = -1.16 + 0.16. What is the second biggest value in 0.6, -5, x? x Suppose r - 1 = -5. Let p = -327/5 + 65. Which is the second smallest value? (a) r (b) p (c) -3/7 c Let d = -0.05 - -0.25. What is the second biggest value in d, 0.5, -8? d Let u = 7 + -3. Let a be (852/(-30))/((-6)/10). Let d = -48 + a. What is the second smallest value in d, 5, u? u Let y = -0.069 - -4.069. Which is the second biggest value? (a) y (b) -0.4 (c) 3 c Let t(i) = -i - 1. Let n be t(-1). Let c = 43/2 + -22. What is the biggest value in 0.4, c, n? 0.4 Let j be (7/(7/(-4)))/(-6). Let i = j - 5/12. What is the second smallest value in -0.1, -2/5, i? -0.1 Let y = -0.28 + -13.72. Let t = -18 - y. Let f = 0.8 - 0.3. Which is the biggest value? (a) f (b) -2/7 (c) t a Let d = -10 + 8. Let k be 2((-5)/d - -1). Suppose -k = -2p - 1. What is the smallest value in 2, 1/9, p? 1/9 Let t = 41 + -29. Let q(a) = a*3 + 7a*2 + 8. Let m be q(-7). Let g = m - t. What is the third biggest value in g, 2/5, -1/7? g Let m(p) = -p + 4. Let j be m(-4). Which is the smallest value? (a) 1/5 (b) j (c) -2 c Suppose -5w - 36 = -5o - 6, -w - 16 = -3o. Let j = -0.395 - 0.005. Which is the biggest value? (a) o (b) j (c) -2/3 a Let j = -20 - -28. Which is the second biggest value? (a) 0.1 (b) 0 (c) j a Let s = -14 + 13.38. Let j = -0.12 - s. Let b = 0.5 - 0.3. What is the biggest value in j, -3, b? j Let r = 0.3 - -0.2. Let m = 64 - 69. What is the third smallest value in r, m, 3/5? 3/5 Let v = -0.43 + 0.46. Which is the second smallest value? (a) -3/4 (b) v (c) 3/4 b Suppose 3 = -0s - 3s. Which is the third smallest value? (a) s (b) 1/3 (c) -2/7 b Suppose 0 = 3n - 127 + 313. Let g = -188/3 - n. Which is the second biggest value? (a) 3 (b) g (c) 5 a Let k = 16 - 15.5. Which is the second smallest value? (a) -0.5 (b) 3/7 (c) k b Let v = -0.3 - -0.31. Let b = -2.99 - v. Let w = -4.4 - -4. What is the second smallest value in 4, b, w? w Let p = -0.39 - -0.99. Which is the third smallest value? (a) 3 (b) p (c) -2 (d) -5 b Let n = 18 + -17.5. Let k = 0 - 0. Let q = -3 - k. Which is the biggest value? (a) 0.2 (b) q (c) n c Suppose 0 = -q + 5q. Suppose q = -5w - 5d - 10, w = -w - 3d. Let j(p) = p3 + 5p*2 - 5p + 1. Let f be j(w). What is the smallest value in -2, -1/6, f? f Let n = 3.92 - -0.08. Let r = -3.8 + n. What is the second biggest value in r, -1/4, -1/7? -1/7 Let m = 0 + -6. Let t be (m/4)/(21/(-28)). What is the second biggest value in 0.4, t, -2/7? 0.4 Let r = 831/8 - 104. What is the second smallest value in -0.03, -5, r? r Let f = 13 + -18. Let x be 2/f + (-7)/35. Which is the second biggest value? (a) x (b) -1/3 (c) -5 a Let v = 0.1 - 1.1. Let i = 0.2 - 0.2. Let x = v - i. What is the third biggest value in 3/5, x, 4? x Let v = 0.07 - 0.07. Let y = -4 + v. Let o = y + 7. What is the second biggest value in 0.1, o, 0.3? 0.3 Let x(n) = -n*2 - 15n - 18. Let v be x(-13). Let b be (5/2)/(12/v). What is the biggest value in 1, 0.5, b? b Let h be (1 + -2)-4 - 1. Suppose -6 = hj + 9. What is the third smallest value in j, -1, -1/4? -1/4 Let f = -0.03 + 0.06. Let y = 0.33 - f. Let v be (-1)/((-2)/(-6))1. What is the third biggest value in v, y, 2? v Let j = 5 + -11. Let r = 7 + j. Let z be (r/(-7))/((-6)/21). Which is the second smallest value? (a) -3 (b) z (c) -0.3 c Let m be 12/(6/(-2)) + 3. Let n be m - ((-4)/10 - 1). Which is the second smallest value? (a) 2/17 (b) n (c) 1 b Let q(z) = -z2 - 3z + 29. Let p be q(4). Which is the biggest value? (a) -1/2 (b) p (c) -1/5 (d) -2/5 b Let v = -25.6 - -26. Let g = -0.9 + 1. Which is the second smallest value? (a) 0.3 (b) v (c) g a Let o be 17/(-21) - 4/(-6). Let r = 2/57 + 218/285. Let w = 13/10 - r. What is the second biggest value in -2, o, w? o Let o = -1.4 + -0.6. Let r = -2 + o. Let b = 7 - 5. What is the third smallest value in r, 0.4, b? b Let w = -7 + 6.7. Let z = -6 + 11. Which is the second smallest value? (a) 3/5 (b) z (c) w a Suppose 2j - 3j - 4d = -1, 2j = -4d + 6. What is the biggest value in j, -1/6, -5? j Let r = -12 - -8. Let x = -3 - -3.2. Which is the second smallest value? (a) -0.1 (b) x (c) r a Let f(o) = -o2 + 4o + 2. Let x be f(5). Let g = 59/2 + -653/22. Which is the second biggest value? (a) x (b) g (c) -2/9 c Let m = -2.9 + 3. Let x = 0.4 + m. Let p = -32/63 - -2/7. What is the second smallest value in x, -2, p? p Let d(j) = j*2 - 7j + 8. Let p be d(6). Let s be (-6)/(-2)(-12)/126. Which is the third biggest value? (a) -0.02 (b) p (c) s c Let o = 2.2 + -1.2. What is the biggest value in -4, 2/7, o? o Let y = -0.6 + 0.3. Let u = 0.25 + y. Let n = 2.05 + u. What is the biggest value in 5, n, -0.3? 5 Let u = 1.83 + 1.17. Let w be (3 + -1)/(4/(-6)). What is the second biggest value in u, w, 0.1? 0.1 Let v = 2 + 4. Let n = 6.4 - v. Let x = 7.3 + -7.8. What is the smallest value in x, 0.1, n? x Let z = -35 - -383/11. Let o be 5/(-30) - (-2)/4. Which is the third smallest value? (a) z (b) 0.3 (c) o c Let u be ((-2)/(-3))/(510/15). Which is the second biggest value? (a) -4 (b) 1 (c) 18 (d) u b Let g = 31 + -30. What is the third smallest value in 0, -2/7, g? g Let j = -0.9 + -1.1. Let o = j - -6. What is the smallest value in -2/11, o, 5? -2/11 Let k = -6 + 2. Let v = -3.9 - k. What is the biggest value in -3/7, v, 3? 3 Let o = -1/13 + -10/39. Let n = -68/279 - -2/93. What is the third biggest value in -0.1, n, o? o Let p = -1.8 - -1.69. Let g = 0.03 + p. What is the second smallest value in 3/2, g, 3? 3/2 Let k = 0.13 + 2.47. Let u = k + -3. Let z = 3.1 + -0.1. Which is the second biggest value? (a) 0.4 (b) z (c) u a Let u = -0.39 - -4.99. Let y = -5 + u. What is the biggest value in y, -1, 0.4? 0.4 Suppose 20v = 10v + 10. Which is the smallest value? (a) v (b) 2/15 (c) -11 (d) -1 c Let g be (-3)/5 - (-235)/225. Let m = -3 + 1. Let w = 2.5 + m. Which is the third biggest value? (a) w (b) g (c) -0.2 c Let k = -3 + 7. Let v = k + 1. Let a be (1/7)/((-11)/(-22)). What is the second smallest value in -5, v, a? a Let o(l) = 3l2 - 6l + 5. Let t be o(4). Let n = 175/6 - t. Let v be (0 - 1)/((-1)/4). Which is the second biggest value? (a) v (b) n (c) -3/2 b Suppose 0 = -0l + 4l + 12. Let o = -1 + 0.5. Which is the third biggest value? (a) o (b) -0.2 (c) l c Let k = 40 - 79/2. What is the biggest value in k, -0.1, -3? k Let y be 1 - (0 + 6)/(-2). Let z be (-2 - -2)	{ "pile_set_name": "DM Mathematics" }
9995 millimeters to centimeters. 3.749995 What is 2325221.1us in minutes? 0.038753685 How many grams are there in 33/5 of a kilogram? 6600 How many nanograms are there in nine tenths of a microgram? 900 Convert 881133.5 years to centuries. 8811.335 What is twenty-seven halves of a litre in millilitres? 13500 How many kilograms are there in 915.3078 grams? 0.9153078 How many millilitres are there in 3.606029 litres? 3606.029 How many centimeters are there in eighty-nine halves of a meter? 4450 How many nanograms are there in 1/16 of a milligram? 62500 How many nanoseconds are there in 47/4 of a microsecond? 11750 How many nanoseconds are there in 70317.48 weeks? 42528011904000000000 How many millilitres are there in seventy-six fifths of a litre? 15200 How many millilitres are there in 3/10 of a litre? 300 How many meters are there in 6/5 of a kilometer? 1200 What is 14112.88 nanograms in tonnes? 0.00000000001411288 What is three sevenths of a week in days? 3 Convert 0.5190088 centimeters to nanometers. 5190088 Convert 774387.4 litres to millilitres. 774387400 Convert 3.935985 millennia to decades. 393.5985 How many nanometers are there in 7986.05um? 7986050 How many months are there in 55432.81 centuries? 66519372 How many millimeters are there in one tenth of a meter? 100 Convert 90959.34kg to milligrams. 90959340000 What is 1/64 of a kilometer in millimeters? 15625 How many microseconds are there in 5402.156ms? 5402156 How many milligrams are there in twenty-one halves of a gram? 10500 How many millilitres are there in 38.60959 litres? 38609.59 What is 2832.676 hours in minutes? 169960.56 Convert 1728.271 decades to millennia. 17.28271 How many litres are there in 0.3593947 millilitres? 0.0003593947 What is 4.594866l in millilitres? 4594.866 Convert 13331.76nm to micrometers. 13.33176 What is 44/5 of a day in minutes? 12672 What is one tenth of a kilogram in milligrams? 100000 What is 6830.6787ms in days? 0.00007905878125 How many decades are there in 22083.23 millennia? 2208323 How many years are there in seven halves of a millennium? 3500 Convert 2340.621s to milliseconds. 2340621 How many millilitres are there in 5/4 of a litre? 1250 What is five eighths of a hour in seconds? 2250 How many milligrams are there in 1/10 of a gram? 100 How many millennia are there in 8242.33 years? 8.24233 Convert 671.7399 months to millennia. 0.055978325 How many decades are there in 81/2 of a millennium? 4050 What is 13/12 of a hour in seconds? 3900 Convert 405847.9 hours to microseconds. 1461052440000000 How many hours are there in 10/21 of a week? 80 How many years are there in 1/5 of a decade? 2 How many grams are there in 7.40588kg? 7405.88 How many months are there in 1.680548 decades? 201.66576 What is 0.9863061 weeks in nanoseconds? 596517929280000 Convert 69661.83 litres to millilitres. 69661830 Convert 0.928738 centuries to millennia. 0.0928738 How many kilograms are there in one quarter of a tonne? 250 How many seconds are there in 7/3 of a hour? 8400 Convert 0.5380615 nanograms to micrograms. 0.0005380615 What is 74804.28l in millilitres? 74804280 How many micrograms are there in 6/25 of a milligram? 240 What is 2.3341l in millilitres? 2334.1 How many millilitres are there in 0.3911724 litres? 391.1724 How many centimeters are there in 35.37922 millimeters? 3.537922 How many weeks are there in 1009.29864 hours? 6.00773 What is 1.154593 centimeters in nanometers? 11545930 What is 1647.668 years in decades? 164.7668 What is 5/4 of a litre in millilitres? 1250 How many months are there in one sixth of a decade? 20 How many centimeters are there in three tenths of a meter? 30 How many tonnes are there in 820.8506mg? 0.0000008208506 What is thirty-four fifths of a second in milliseconds? 6800 Convert 2.4107139 minutes to days. 0.001674106875 How many meters are there in 0.1792616 kilometers? 179.2616 What is five eighths of a micrometer in nanometers? 625 How many milliseconds are there in seventeen quarters of a second? 4250 How many seconds are there in 14/9 of a hour? 5600 What is 375.2092 micrograms in kilograms? 0.0000003752092 How many millimeters are there in 2.7122 kilometers? 2712200 How many months are there in 27/5 of a millennium? 64800 What is one quarter of a gram in milligrams? 250 How many micrometers are there in six fifths of a centimeter? 12000 What is five eighths of a kilogram in grams? 625 How many millilitres are there in fourty-five quarters of a litre? 11250 Convert 2.709409mg to grams. 0.002709409 How many months are there in 28/3 of a year? 112 How many grams are there in 7.009174 micrograms? 0.000007009174 What is 3/40 of a kilometer in millimeters? 75000 How many centimeters are there in twenty-one fifths of a meter? 420 Convert 0.3047485 days to microseconds. 26330270400 Convert 8.733841 years to centuries. 0.08733841 How many millimeters are there in twenty-six fifths of a centimeter? 52 How many millilitres are there in 21/2 of a litre? 10500 How many millilitres are there in 33/5 of a litre? 6600 What is 1.019075 micrometers in millimeters? 0.001019075 How many seconds are there in 10/3 of a minute? 200 What is 0.2980336 meters in nanometers? 298033600 How many meters are there in nineteen quarters of a kilometer? 4750 How many nanometers are there in one quarter of a micrometer? 250 What is sixty-one thirds of a hour in seconds? 73200 How many tonnes are there in 16932.81ug? 0.00000001693281 Convert 47.1514 nanograms to tonnes. 0.0000000000000471514 What is fourty-one halves of a tonne in kilograms? 20500 How many millimeters are there in one quarter of a meter? 250 Convert 0.242204ml to litres. 0.000242204 Convert 156993.417 minutes to weeks. 15.57474375 How many grams are there in 949389.9ug? 0.9493899 How many meters are there in 1/10 of a kilometer? 100 What is 82350.89 days in minutes? 118585281.6 How many milligrams are there in 3/50 of a kilogram? 60000 Convert 6308.204 days to weeks. 901.172 How many days are there in 1089.87741 milliseconds? 0.000012614321875 What is 806.9489ml in litres? 0.8069489 How many hours are there in eleven quarters of a day? 66 How many millilitres are there in three tenths of a litre? 300 What is three sevenths of a week in minutes? 4320 What is 54/5 of a microgram in nanograms? 10800 How many centuries are there in 6007.288 decades? 600.7288 What is 3/50 of a litre in millilitres? 60 What is 54265.05 minutes in days? 37.6840625 How many months are there in 6/5 of a decade? 144 What is 3/10 of a centimeter in micrometers? 3000 How many millilitres are there in twenty-six fifths of a litre? 5200 What is 25/4 of a millennium in months? 75000 How many tonnes are there in 282.3018g? 0.0002823018 How many micrograms are there in 32/5 of a milligram? 6400 What is seven sixths of a century in months? 1400 What is 95.10607 hours in microseconds? 342381852000 How many minutes are there in fourty-three thirds of a day? 20640 What is 3/8 of a kilometer in centimeters? 37500 How many millilitres are there in 6/5 of a litre? 1200 What is 27/5 of a millennium in centuries? 54 What is 72/5 of a day in minutes? 20736 What is 9205.573m in kilometers? 9.205573 What is 17.00643 nanoseconds in milliseconds? 0.00001700643 How many nanometers are there in 46/5 of a micrometer? 9200 How many months are there in 0.7595623 years? 9.1147476 How many years are there in 21/5 of a decade? 42 Convert 0.791681 kilometers to micrometers. 791681000 How many minutes are there in 3/5 of a day? 864 How many nanometers are there in one tenth of a millimeter? 100000 How many millilitres are there in three fifths of a litre? 600 How many nanograms are there in 0.677455 kilograms? 677455000000 What is 2.059908nm in meters? 0.000000002059908 What is 6/25 of a centimeter in micrometers? 2400 How many months are there in twenty-one quarters of a decade? 630 What is nine tenths of a micrometer in nanometers? 900 What is 636.5493 millennia in decades? 63654.93 What is seven quarters of a litre in millilitres? 1750 What is 6/25 of a second in milliseconds? 240 Convert 24.83845 centuries to millennia. 2.483845 What is 29/2 of a millennium in years? 14500 What is 55/2 of a kilogram in grams? 27500 How many millilitres are	{ "pile_set_name": "DM Mathematics" }
23al*3 + 4l*2 wrt a? -40a*3 - 264a*2l*3 What is the second derivative of 4252g*2m*3 + 434gm3 + 5m*3 wrt g? 8504m*3 Differentiate 99ai3 + 422i*3 wrt a. 99i3 What is the derivative of k4o3 + 57ko3 - 151o*3 wrt k? 4k*3o*3 + 57o*3 What is the third derivative of -7c*6 - 11c*4 - 4c*2? -840c*3 - 264c Find the third derivative of 3884n4 - n2 - 76n wrt n. 93216n What is the third derivative of 66rz3 - 358rz2 - 5rz - 27z*5 wrt z? 396r - 1620z2 Find the third derivative of -26h*4 - 5h*3n + 6h2n + 18n wrt h. -624h - 30n Find the second derivative of 2ko3 - 2ko2t*3 - 123ko2t - 6kot + 5kt - t3 wrt o. 12ko - 4kt3 - 246kt Find the third derivative of -26457p*3x - 2p2x - 3p2 - 73p + 4x wrt p. -158742x Find the second derivative of 1145r5 - 2r*4 + 514r + 3. 22900r3 - 24r*2 Find the second derivative of -6g*3y*3 + 903g*3y - 22y5 wrt y. -36g*3y - 440y3 What is the second derivative of 121a*2k*3z + a*2k*2z*3 - 2ak - 2k*3z*3 - 9k*3z + 4kz*3 wrt a? 242k*3z + 2k2z3 What is the second derivative of -l2o2 + 14l*2 + 2lo4 + 10lo2 + 9lo wrt o? -2l*2 + 24lo2 + 20l Find the third derivative of 319u4 + 60u*2 + 2u wrt u. 7656u Differentiate 269z*2 - 247. 538z What is the derivative of -f*2g - 20f2 - 187fg - 127 wrt g? -f2 - 187f Differentiate -71dwz + 20dw + 19wz - 338z wrt d. -71wz + 20w What is the derivative of 108t*2 - 308? 216t Differentiate -bqs + 40bq - 39bs - 2q2s + 3q2 + 1 wrt s. -bq - 39b - 2q*2 What is the second derivative of 1499n*3 - 108n + 8? 8994n What is the first derivative of -1274s4 + s2 + 3071? -5096s3 + 2s Find the third derivative of 2i2xz3 - 2i*2xz - 15i*2z*3 + 25i*2z + 2iz*2 + 7x - 6z3 wrt z. 12i*2x - 90i2 - 36 Find the third derivative of 2k*2o + k*2y*3 + 2k*2y*2 + 4k*2 + 2koy + 1534oy*3 + 4y*2 wrt y. 6k*2 + 9204o Find the third derivative of 200v5 - 2v*4 - 503v*2. 12000v*2 - 48v What is the first derivative of -4f3l*2 + 3f*3l + 3460f3 + 221l*2 wrt l? -8f*3l + 3f3 + 442l Find the third derivative of 64i3p*3 + 4i*3p*2z + 281i3p*2 - 134i*2p*3z + ip2 wrt p. 384i*3 - 804i*2z What is the third derivative of -2r3y*3 - 24r*3y*2 + 2r*3y - 54r2y*3 wrt y? -12r*3 - 324r*2 Find the second derivative of -58n*5 + 37n - 2. -1160n3 Find the second derivative of 2hl2 - 2hlv*3 + 63hl - 2l*2v*3 - 2l*2v + 4l2 + 14v*3 wrt v. -12hlv - 12l2v + 84v What is the third derivative of 54s4 + s3w3 + 3s*2w*3 + 42s wrt s? 1296s + 6w*3 Differentiate 4su3y + 850sy2 - u3 - 51uy*2 - 2y*2 with respect to s. 4u*3y + 850y2 Find the first derivative of -8c*3l - 3c3p + 7cl - 134cp*2 + 4lp2 wrt l. -8c*3 + 7c + 4p2 Find the third derivative of 6743w*4 - 18422w*2. 161832w Find the first derivative of -264g2 - 5gn3 + 1280n*3 wrt g. -528g - 5n3 What is the second derivative of 16296w*5 - 3782w wrt w? 325920w3 What is the third derivative of 54k*3s*3 + 3k*2s*3 - 2k*2s*2 wrt k? 324s*3 What is the first derivative of 16i*3 + 6i - 2069? 48i2 + 6 What is the third derivative of a2j*3 - 4a*2j*2 - 15a*2 - 157aj4 wrt j? 6a*2 - 3768aj What is the third derivative of 20kt3 - 10kt2 + 2kt - t4 - 3t*2 wrt t? 120k - 24t What is the second derivative of -15222i*3 + 6063i wrt i? -91332i Find the third derivative of -13kpt*3 - 30kpt*2 - 17kpt - kt4 + 2pt3 wrt t. -78kp - 24kt + 12p Find the second derivative of -4d5 + 28d*3 - 139d. -80d3 + 168d What is the derivative of -3c2k*2 - 30c*2 - 2ck + 4k*2 + 764k wrt c? -6ck*2 - 60c - 2k Find the second derivative of -943ks2 - 266ks + 2k wrt s. -1886k What is the second derivative of 3180g*2 + 1859g wrt g? 6360 What is the first derivative of -3a2d - 8a2 - 2adu - 13au + 228du wrt d? -3a2 - 2au + 228u Find the third derivative of -3f6h + 31f6 - 4f*3 - 8f*2 - f - 225h wrt f. -360f3h + 3720f3 - 24 Find the second derivative of 133g*5 - 3g + 17 wrt g. 2660g3 Differentiate -183n*2 - 5n + 1714 wrt n. -366n - 5 Differentiate 90o*2 + 119. 180o Find the third derivative of 6p4 + 44p*3 + 1830p*2. 144p + 264 What is the second derivative of -5072t2 - 305t + 9 wrt t? -10144 Find the third derivative of -75gn*6 + 15gn + n2 - 2 wrt n. -9000gn3 Find the second derivative of 12f*3h*2 - 366f*3 + 101fh2 + 2f - 9h2 wrt f. 72fh2 - 2196f What is the derivative of 45c2p*2 + 249c*2 + 2p wrt p? 90c2p + 2 What is the third derivative of -239hkn3 - hkn2 - hkn - hn*3 - 3hn2 + 2kn3 - kn + 8n2 wrt n? -1434hk - 6h + 12k Differentiate 40d*2p*3u + 134d2p*2w - dp3u + 8dpuw + p*3w - 12u wrt w. 134d*2p*2 + 8dpu + p*3 What is the first derivative of -6a*2q*3 - 27a*2q*2 + 29a*2 + a wrt q? -18a*2q*2 - 54a*2q Differentiate -2b4 + 15b*3y + 6by + 326y with respect to b. -8b*3 + 45b*2y + 6y What is the third derivative of -31n*6r*3 + 26n*3r*3 - 2n*2r - 2n2 - 54nr3 wrt n? -3720n*3r*3 + 156r*3 What is the third derivative of -425w*3y - 6w2 + wy wrt w? -2550y What is the third derivative of 278o*3 + 6o*2 - 8o wrt o? 1668 What is the first derivative of 2c3r + cr2 + c + 12r*2 - 8r wrt c? 6c2r + r*2 + 1 Find the second derivative of 759l*2y - 8l - 47y wrt l. 1518y Find the third derivative of -327y*6 - 46y*2 + 4 wrt y. -39240y*3 What is the third derivative of -117r*6 - 4r*2 - 18r wrt r? -14040r3 Differentiate -214b*3 - 76 wrt b. -642b2 What is the third derivative of m3w3 + 11m*3w - 2546w3 - 184w*2 wrt w? 6m*3 - 15276 What is the third derivative of 22s*4 + 3s*3 - 185s*2 - 1 wrt s? 528s + 18 Find the second derivative of y*5 - 123y*3 + 15y + 2 wrt y. 20y3 - 738y What is the third derivative of -2a4 + 217a*3 - 140a*2 wrt a? -48a + 1302 Find the first derivative of 348c2j3 - c2j + c2 + 518c wrt j. 1044c2j2 - c2 What is the first derivative of -1202r3 - 1645 wrt r? -3606r*2 What is the first derivative of 9992m*2 - 14545? 19984m Find the second derivative of -643f2i*3 + 2f*2i2 - f2i + 2fi3 + 2fi2 - 140f - 1 wrt f. -1286i3 + 4i*2 - 2i Find the first derivative of 10k3x*2 + 38kx2 + 91x*2 wrt k. 30k*2x*2 + 38x*2 Differentiate -dhox*2 + 736dhox + dhx + 6hx + 68ox2 - 6x*2 wrt d. -hox2 + 736hox + hx Differentiate -170wy3 + 7w + 8 with respect to y. -510wy*2 Find the third derivative of 2m*3y + 2625m3 - 563m*2y - 4m2 wrt m. 12y + 15750 Find the second derivative of -2187l2 + 694l. -4374 What is the second derivative of -h*2r*2 - 7h*2r - h*2 - hir2 - 111hi - 3426ir2 wrt r? -2h*2 - 2hi - 6852i What is the derivative of -2j3l*3vz + 573j*3 + 4jl3 - 2jv + 1942l*3vz wrt z? -2j*3l*3v + 1942l3v What is the third derivative of -41h5 + 5h*3 + 562h*2? -2460h*2 + 30 What is the derivative of -4207q*2s - 9q2 - 11q + 1 wrt s? -4207q2 What is the third derivative of -2cg3y*4 + 28cg2y*2 + c - 172g*3y4 + g3y2 wrt y? -48cg3y - 4128g3y What is the derivative of -4c2d3 - c2 - 66c + 4d*4 wrt d? -12c*2d*2 + 16d*3 Find the second derivative of 5208i*2 + 10i - 656 wrt i. 10416 What is the derivative of -5m3q*2 - 144m*3q - 1209q2 wrt m? -15m*2q*2 - 432m*2q Differentiate 6r2z*4 + 49r*2 - 5r - 56z4 with respect to z. 24r*2z*3 - 224z*3 Differentiate 127d*4 - 103 wrt d. 508d*3 What is the derivative of 286n*3 + 651 wrt n? 858n*2 What is the first derivative of -8510x + 5734? -8510 What is the derivative of 2u2v**2	{ "pile_set_name": "DM Mathematics" }
a be q(-1). Let n be -6(-2 - a/(-9)). Let m be n/22 + (-6)/33. Solve m + 16 = -4d for d. -5 Let b be (-25)/15(-7)/(70/6). Suppose 25 = 4x + 5z, -1 = -4x + 2z + 17. Solve 21 = -xj + b for j. -4 Suppose -o + 51 = 2o. Suppose -3n = 43 - 55. Suppose 0x - nx + 20 = 0, 5l = x + 5. Solve o = -lp + 7 for p. -5 Suppose -9d + 60 = d. Let n be (44/7 - 4)/(d/21). Solve 5p - n + 23 = 0 for p. -3 Let n = 17424 - 17132. Solve ng + 50 = 317g for g. 2 Let b(a) = -a + 21. Suppose -4z + 271 = 211. Let s be b(z). Solve -2g - g - s = 0 for g. -2 Let o be (-1)/(11/2) + (-6)/(-33). Suppose a + 2a - 7 = 5t, o = a + 5t - 9. Suppose 5u = -w - 1, aw - 3u + 3 - 22 = 0. Solve -h - 25 = wh for h. -5 Suppose 5s - 4f - 32 = 0, 4s + 2f - 7 = -f. Let v be (-1)/1 + 2/(-2) + 7. Let o(i) = 34i - 167. Let w be o(v). Solve sz = 15 - w for z. 3 Suppose -436f + 460f - 240 = 0. Solve -4i = -9i - f for i. -2 Suppose -59w - 101w + 4160 = 0. Solve 8y + w = -5y for y. -2 Let b = -28 - -32. Suppose -4 = -bo + 12. Suppose 39 = 5f + o. Solve f = 3u - 8 for u. 5 Let r(w) = -6w + 24. Let b be 5/(35/(-21)) + (1 - -6). Let s be r(b). Solve sc = 6c - 3c for c. 0 Let q(r) = -2r3 + 6r*2 + r - 3. Let v be q(3). Suppose 18p - 11p - 14 = v. Suppose -p - 5 = -d. Solve 5 = 3t - d for t. 4 Let t be -1 + (-6 + 19/3)/(1/3). Solve 24g + tg - 96 = 0 for g. 4 Let o = 70 + -118. Let h = o - -144. Let w = -93 + h. Solve -2r + w = 1 for r. 1 Let a = -134 - -130. Let s be -2((-35)/(-10) + a). Solve 2z - 3z - s = 0 for z. -1 Let p(u) = 7u2 - 120u + 446. Let f be p(4). Solve -68y + fy = 10 for y. 1 Let q(l) = -l*3 - 2l*2 + l + 2. Let v be q(-2). Let b = v + 15. Let d = b - 12. Solve 0 = -5c - d + 23 for c. 4 Let c(v) = 3v3 + 22v*2 + v - 23. Let b be c(-7). Solve -ba - 46 = -122 for a. 4 Suppose -2c = -5s - 15, c + 4c - 3s - 9 = 0. Suppose -d = -10d - cd. Solve -6o + 3 + 3 = d for o. 1 Let r be 24/6 + 334/6. Suppose 5q - r = 2n, -2n - 12 = 2n. Solve -7y + q = -3y for y. 1 Let s be -2 + 23 - (-1 + -2). Let w be ((10 - 0) + 1)-2. Let c = w + s. Solve 3g = c + 10 for g. 4 Suppose 3p + 155 - 146 = 0. Let x be (p/(-2))/(6/68). Solve 4o - x = -5 for o. 3 Let z(h) = 25h - 1426. Let x be z(58). Solve 45q - 84 = xq for q. 4 Suppose -2425 = -32u - 69u + 3938. Solve us = 19s + 264 for s. 6 Suppose 4j = 4x + 4, -2x - 15j + 25 = -41. Solve 2g - 2g + xg = 0 for g. 0 Suppose 5l - 20 = -4n, -3l - l - 2n = -16. Suppose 4j = -v + 128, 112 = lj - 2v - v. Suppose -29 = -5a + j. Solve -a = 6t - 2t for t. -3 Suppose 4v - 5r = 169, 2r - 32 + 42 = 0. Solve vs + 25 = -11 for s. -1 Let u(n) = 2n3 + n2 + 4n + 7. Let h be u(-2). Let t be (-9 - h)(-1)/(-2). Solve ts + 2 = 8 for s. 3 Let h(d) = -d*3 + 21d*2 + 22d + 22. Suppose 4s = -5m + 108, 4s + 4m - 39 = 65. Let a be h(s). Let p = 22 - a. Solve 0o - o = p for o. 0 Let r be ((80/6)/(-8))/((-110)/132). Solve -91j - r = -89j for j. -1 Suppose -44i - 62i + 3034 = -32i. Solve -48 = -ib + 17b for b. 2 Suppose 0 = 2i - 3110 + 3110. Solve iv + 6v = 2v for v. 0 Suppose -2p + 8 = 2p - 4r, 0 = 4r - 8. Suppose -7h + 68 = 27h. Let j be (h/7)/(71/994). Solve pw - j = -0w for w. 1 Let b = -221 + 223. Solve bq = 4q - 2 for q. 1 Suppose 85n = 2f + 81n - 228, 0 = -5f - n + 603. Solve -124w + f = -94w for w. 4 Let c = -115 + 149. Suppose -5q = 3h + c - 88, -q - h + 12 = 0. Solve 4y + q - 1 = 0 for y. -2 Let x be (-1)/(-8) - 2970/(-48). Let i = -57 + x. Let v(d) = -d + 10. Let a be v(i). Solve 0 = -ac + 4c for c. 0 Let l be -10((-9)/6 + 1). Let h(y) = y*3 - 4y*2 - 44y + 1. Let z be h(9). Solve 5i - l - z = 0 for i. 3 Suppose -t = 2z - 6, -3t + 3z + 4 = 13. Let q(c) = -c*2 - 5c + 9. Let n be q(-5). Solve t = -4m + 7m + n for m. -3 Suppose 393w = 266w + 254. Suppose b - 5a = 10, -2b - 2a + 42 = 10. Let l be ((-196)/(-12))/(-7)-3. Solve -lv + b = -wv for v. 3 Suppose 9331 = -3c + 34c. Let w = 304 - c. Solve -5o + wo - 4 = 0 for o. -2 Let g be (-33)/((-990)/600)(-2 + 4). Solve -7743m = -7735m - g for m. 5 Let q = 4 + -2. Let u = 98 - 146. Let s be (-9)/(-14u/(-256)). Solve 5p + s = qp for p. -4 Suppose 0 = -207q + 232q - 1000. Solve 0 = qc - 72 - 8 for c. 2 Suppose 7k - 56 = 4k + 4u, -9k + 4u = -176. Solve -kl + 155 = -51l for l. -5 Suppose 524 = 4z - 4s, -212 - 185 = -3z + 5s. Solve -z = -19w - 53 for w. 4 Let t(d) = 8d - 3. Let u be t(7). Let x be (-16)/(-8) + -21 - 51. Let s = x + u. Solve -sn = -7n - 15 for n. -3 Let q be 1701/49 - 72/(-252). Solve qu - 168 = 14u for u. 8 Let w(o) = -10o - 97. Let d be w(-10). Suppose 7i - 5i = -di. Solve -5r + r - 16 = i for r. -4 Let u(c) = c3 + 42c*2 - 73c - 1284. Let t be u(-43). Solve -25q = tq + 93 for q. -3 Let n(z) = -6z2 - 283z - 35. Let l be n(-47). Solve 0k = -6k - l for k. -2 Let h be 940/26 + (36/(-117))/2. Let k = -65 + 70. Solve -56 = -kc - h for c. 4 Let y = -1824 + 1824. Solve y = 962a - 965a + 9 for a. 3 Let w be 7/(28/(-36)) - -2. Let p(s) = -s2 - 6s + 15. Let h be p(w). Suppose -h = -y - y. Solve i - 3i = -y for i. 2 Let v(j) = 2j*2 + 29j + 92. Let q be v(-12). Suppose s = -19 + q. Solve -2f + 15 = s for f. 1 Let i(q) be the third derivative of q6/120 + q5/3 + 17q*4/24 - 17q*3/3 + 5q*2 + 15. Let v be i(-19). Solve 26 + v = -6n for n. -5 Let l = -246 + 248. Suppose -76 + 28 = -4u. Suppose -8y = -6y - u. Solve la - y = 5a for a. -2 Let s = -2673 + 2683. Suppose -76 - 36 = -4v. Solve 23h - vh = s for h. -2 Let v(s) = -3s2 - 21s - 13. Let t be v(-6). Suppose tw + 22 = 3u + w, -4u + 3w = -27. Solve u + 4 = -2j for j. -5 Suppose -2c = 2u, 3u + 2 = 5c - 14. Let n be (-1)/(c + 0 + -3)42. Solve nv - 37v - 15 = 0 for v. 3 Let q(o) = 9o + 68. Suppose 0 = -2s + 19 - 33. Let n be q(s). Solve -nj + 0j = -10 for j. 2 Suppose t - 1041 - 258 = 2r, -3242 = 5r + 3t. Let f be 3/(-4) + r/(-236). Solve -18 = -fm - 10 for m. 4 Let u be 4 + (7024/176 - 1/(-11)). Suppose 4f - u = -18f. Solve fz + 33 = 37 for z. 2 Suppose -16n = -7n - 2160. Suppose -158d + 161d = -n. Let r = d + 81. Solve r = -h + 6 for h. 5 Let l be 329/21 + (100/150 - (-1)/(-3)). Solve -758k = -754k + l for k. -4 Let x = 33 + -35. Let k be ((-66)/6)/(x/(-2)). Let y = k + 14. Solve y = -2z + 9 for z. 3 Suppose -l - 5 = 0, 0a + 10 = -a - 3l. Suppose -ax - 45 = -30. Let b be 5 - x/((-15)/10). Solve -bq = 2q + 25 for q. -5 Let i be (-2)/(3 + -1)4. Let x be (-1)/(i/(-24)) + 6. Solve x = 4t + 23 - 15 for t. -2 Let c(x) = -x3 - 101x*2 + 315x + 322. Let q be c(-104). Let h be -2 - (-3)/35. Solve q + 2 = hz for z. 4 Let m be (2 + -122)(-10)/20. Solve -8h - 12h = -m for h. 3 Let b(q) = q3 + 31q*2 + 28q - 58. Let n be -15(-1)/40 - (-729)/(-24). Let a be b(n). Solve ar = 5 - 1 for r. 2 Suppose 220m - 232m = -108. Solve -5 = mi + 40 for i. -5 Let p(o) be the third derivative of o6/60 - 17o*5/60 - 5o*4/12 + 3o*3/2 - 78o*2. Let n be p(9). Solve n = 4w + 4 + 8 for w. -3 Suppose -7h = 1913 - 2067. Solve hr + 46 = -42 for r. -4 Let a be (-2)/(-2) + 11 + -11 - -19. Let y be 195/a(80/(-6))/(-2). Suppose -19j - 8 = -y. Solve -r = jr for r. 0 Let o = 13 - 9. Suppose -3t = -5t + o. Suppose 0 = -2k + 2l + 6, 2l = -k + tk - 3. Solve -4i + 13 + k = 0 for i. 4 Let q = -5348 + 5389. Solve -ql = 66 + 16 for l. -2 Let u be ((-145628)/(-1848) - (-12)/33) + 5/6. Solve -u = -10y - 100 for y. -2 Let a = 3 + 0. Suppose 6 - 3 = s, 4t - 15 = as. Solve -c = -tc for c. 0 Let a = -2 + 4. Suppose 0 = 3c + 9, k - 6k + 27 = -4c. Suppose -4q = -2u + 68 - 24, k = -u - 3q. Solve ax = -x - u for x. -4 Let a(j) = 5j2 + 202j - 409. Let o be a(2). Solve 20y - oy - 10 = 0 for y. 2 Let r = 8385 - 8369. Solve x - r = -11 for x. 5 Let i = 36804 + -36804. Suppose -2y - 3y = -20. Solve i = 3d - 2d - y for d. 4 Let c(y) = -2y - 3. Let j be c(-5). Suppose -10s - 18 = -11s. Let w = s + j. Solve 6l = l - w for l. -5 Let i be 6/(-8)2 + (-10)/(700/(-2905)). Solve -6g = i - 16 for g. -4 Suppose 23t - 2257 = -233. Suppose 0 = -o + 12o - t. Solve 0 = -2d + od - 24 for d. 4 Suppose -3*w + 36	{ "pile_set_name": "DM Mathematics" }
eatest common divisor of 58 and u? 29 Let m(n) = n*2 + 4n - 8. Let u be m(6). Suppose 4r - v = 859, -5r + v + 1127 = u. What is the highest common divisor of 24 and r? 24 Suppose 3u = -2u - 20. Let l be (-114)/u - 1/2. Calculate the greatest common divisor of l and 14. 14 Let c(f) = 5f2 - 31f + 39. Let o be c(6). Calculate the greatest common divisor of o and 627. 33 Suppose 2w + 7844 = 6w. What is the greatest common factor of 53 and w? 53 Suppose -n - 2a = -88, -3a + 333 = 3n + 60. Let c = n + -54. Let p be 8 - (-9)/(27/6). What is the highest common factor of p and c? 10 Let r(p) = -40p - 261. Let s be r(-7). What is the highest common divisor of 247 and s? 19 Suppose 0 = 39j + 178 - 490. What is the highest common divisor of 348 and j? 4 Let g = 11 - 7. Suppose 146 = 2w + 4y, -w - gw - 5y = -340. What is the greatest common factor of 42 and w? 21 Let v(f) be the first derivative of 1/3f*3 - 12 - 5/2f*2 + 3f. Let x be v(7). What is the highest common factor of 51 and x? 17 Suppose 199 + 49 = r. Calculate the greatest common divisor of 31 and r. 31 Suppose 5m - 32m + 1728 = 0. What is the greatest common factor of 64 and m? 64 Let d(r) = r*2 - 2r - 15. Let k be d(5). Let a(f) = -2f2 - f + 40. Let v be a(k). Calculate the highest common factor of v and 60. 20 Suppose -23 = -0c - 4c + t, 4t + 2 = -2c. Let q = 8 + -6. Let s be (-1 - 0)(q + -7). What is the greatest common factor of c and s? 5 Let w be (0 + -7)30/(-7). Let d be (4 - -2) + 3 + 36. Calculate the highest common factor of w and d. 15 Let p(a) = 2a*3 - 6a*2 + 5a + 4. Let v = -27 - -31. Let d be p(v). What is the highest common factor of d and 7? 7 Let j(u) = u - 3. Let a be j(9). Let p = 13 + -7. Calculate the greatest common factor of a and p. 6 Let c = -272 - -310. Calculate the highest common divisor of 1026 and c. 38 Suppose 163 + 217 = 4w. Let j(h) = 3h*2 + 16h + 12. Let g be j(-10). Suppose g = 5y - y. What is the greatest common divisor of y and w? 19 Let n(k) = 2k - 7. Let v be n(6). Let o be (v/10)/((-1)/(-20)). Calculate the highest common divisor of o and 20. 10 Let o(i) = 2i3 + 20i*2 + 12i + 6. Let s be o(-9). What is the highest common divisor of 18 and s? 6 Let b = -12 - -18. Let t be (-6)/(-36)6 - 5 - -28. What is the greatest common divisor of b and t? 6 Suppose -10 = -5a, -2i = -i - 4a + 6. Suppose 3x + 7 = it + 2t, -5x - 7 = -2t. Let v be (1/x + -1)-6. What is the greatest common factor of v and 132? 12 Suppose 2d - 31 = 5p, 0 = d - 2p - 8 - 5. What is the greatest common factor of 6 and d? 3 Suppose 20s + 5452 = 4b + 24s, 5b + 4s - 6816 = 0. What is the greatest common divisor of 132 and b? 44 Let r be 1580/6 + 2/3. Suppose -5y - r = -y. Let b = y + 286. Calculate the greatest common factor of 20 and b. 20 Let s(c) = -c2 - 12c + 13. Let g be s(-12). Let y = 2 + g. Suppose 2t + 3n = y, 2t = -n - 8 + 25. What is the highest common divisor of 18 and t? 9 Suppose 6r + 780 = 10r. Suppose 2j + 2j = -5h + 156, 5j - 3h = r. Calculate the greatest common factor of j and 26. 13 Suppose 10t = -t + 154. Calculate the greatest common divisor of t and 140. 14 Let g = 29 - 27. Suppose 5q + 915 = 4c, 8c = 6c + gq + 456. What is the highest common factor of 90 and c? 45 Suppose -3r = -4y + 1634, 0 = 4y + 2r - 0r - 1644. What is the highest common divisor of y and 10? 10 Let l(j) = -j3 - 5j*2 - 4j + 581. Let a be l(0). Calculate the highest common divisor of a and 166. 83 Let a(s) = -s*3 + 15s*2 + 2s - 15. Let o(k) = k*3 - 10k*2 + 13k - 21. Let u be o(9). Let h be a(u). What is the highest common factor of h and 135? 15 Let x(m) = 22m - 143. Let y be x(13). What is the highest common divisor of 299 and y? 13 Let t(g) = -7g + 303. Let d be t(43). What is the greatest common divisor of 94 and d? 2 Let l be 48 - (0 + (2 - -1)). Let t = 4 - -14. Calculate the greatest common divisor of t and l. 9 Let b(s) = s*3 - 8s*2 + 8s - 7. Let n be b(7). Suppose -3i + 6i - 207 = n. Calculate the highest common factor of 23 and i. 23 Suppose -11z + 10z + 143 = 0. Let d be ((-9 - 2) + -2)-1. Calculate the highest common divisor of d and z. 13 Let u(l) = -l3 - 8l*2 + 7l - 8. Let x be u(-9). Let r be (-6)/(-4) + x/4. Let d be (r/4)/(2/30). Calculate the highest common factor of d and 60. 15 Suppose 86 = 3a - f, a = 2f + 25 + 12. Calculate the greatest common factor of a and 729. 27 Suppose -10w = 2w - 2280. Calculate the highest common divisor of 342 and w. 38 Let r = 573 - 551. What is the greatest common factor of r and 121? 11 Suppose 6j + 50 = 4f + j, -3f + 34 = -2j. Let r = 25 - 16. Suppose -3n - 3i + 189 = -r, -n + 5i = -90. Calculate the highest common divisor of f and n. 10 Let a(v) = 4v*2 - 6v. Let t be a(-5). Let y = 182 - t. Calculate the highest common divisor of y and 13. 13 Suppose j = 21 - 1. Let k(i) = i*2 - 3i + 4. Let s be k(3). Suppose sn = q + 79, 43 = 2n + 3q - 0q. What is the greatest common divisor of j and n? 20 Let u(g) = -g*3 + 28g*2 - 25g - 152. Let b be u(26). Calculate the highest common divisor of 22 and b. 22 Suppose 29 = 23p + 6. Calculate the highest common divisor of 8 and p. 1 Let c(u) be the third derivative of -u4/6 - 25u3/6 + u2. Let o = -1068 + 1058. Let k be c(o). Calculate the highest common factor of k and 6. 3 Let m(k) = k*2 + 10k + 4. Let o be m(-10). Let h be 16 + -4(-3)/o. Calculate the greatest common factor of h and 95. 19 Let o(w) = -w2 + 5w + 1. Let g be o(5). Suppose -16 + 12 = -u. Let s be (u + (-2 - -1))(3 - 0). What is the greatest common factor of s and g? 1 Suppose 4k - 189 = 11. Suppose 5i = -m - 16, -28 = 2i - 6m + m. Let j(o) = -o2 - 9o. Let h be j(i). What is the greatest common factor of k and h? 10 Let d(b) = -3b + 11. Let g(t) = -t + 6. Let f(j) = -2d(j) + 5g(j). Let m be 3/(-6)(-12 - 0). Let x be f(m). What is the greatest common factor of 98 and x? 14 Suppose -43 = 4w + 125. Let h = 29 - w. Let b = h - -49. What is the highest common divisor of 30 and b? 30 Suppose 5x + 2c - 820 = 0, -4x + 338 + 320 = 2c. Let z be (-2)/(-5)320. Let i = -6 + z. Calculate the highest common factor of x and i. 18 Let m = -10 - -24. Suppose -3r = -i + 15, 8i - 3i - 21 = -3r. Let l be (-21)/(-6)(i + -4). Calculate the greatest common divisor of l and m. 7 Let k(w) = -w*2 - 12w - 4. Let d be k(-4). What is the greatest common factor of 224 and d? 28 Suppose 2t - 132 = -96. Let r(o) = 49o*2 + 2. Let i be r(2). What is the greatest common factor of i and t? 18 Let q be (-56)/(-26) + (-26)/169. Suppose -s + g = -3s + 4, q = s - 5g. Calculate the greatest common factor of 10 and s. 2 Suppose -l = -3l + 80. Let x be 60 - (2 + -2)/(-7). Calculate the highest common factor of l and x. 20 Suppose 1025b - 490 = 1018b. What is the greatest common divisor of 14 and b? 14 Let b = 30 + -24. Let c(i) = i*2 - 5i + 1. Let z be c(7). Calculate the highest common factor of z and b. 3 Let t(o) = o*2 + 4o + 5. Let c be t(-4). Suppose -3w + ch = -131 - 184, -3h - 9 = 0. What is the greatest common factor of 25 and w? 25 Let l(p) = -9p - 2p2 + 4p + 2p + 70 + 4p. Let f be l(0). Calculate the highest common divisor of f and 14. 14 Let k = -110 + 155. Let v = k + -41. What is the greatest common factor of 36 and v? 4 Let v = 68 - -4. Let k(b) = -b*2 + 10b - 2. Let a be k(9). Let z = 15 - a. Calculate the greatest common factor of z and v. 8 Let t(l) = -l + 128. Let q be t(0). Let a(r) = -13r + 120. Let d be a(8). What is the highest common factor of d and q? 16 Suppose 0 = -3k + 3c + 219, c + 155 + 143 = 4k. Let p(o) = o*2 + 12o + 17. Let u be p(-13). What is the highest common divisor of u and k? 15 Let i = 134 + -92. What is the highest common factor of 168 and i? 42 Suppose -4f + 111 + 18 = 5q, 0 = 3f + q - 105. What is the greatest common factor of 12 and f? 12 Let y(d) = 2d - 10. Let m be y(7). Let o be (-2)/(-1)38/m. Let k = 310 - 291. Calculate the highest common factor of k and o. 19 Let n = 101 - 68. Let m = -75 - -54. Let i be 3/(-3 + 6) - m. What is the greatest common factor of n and i? 11 Suppose 0 = -24o - 6*o + 6960. Calculate the greatest co	{ "pile_set_name": "DM Mathematics" }
alculate fw(a) + gv(a). -a*2 Let q(k) = 2 + 1 - 1 - 2k + k2. Let l = 9 - 5. Let m(x) = x2 - 2x + 3. Suppose 0 = 4a - a + 15. Determine aq(g) + lm(g). -g*2 + 2g + 2 Let t(r) = r - 8. Let l(p) = -1. What is 5l(c) - t(c)? -c + 3 Suppose 0 = 3s - k + 3, -s - k = -4 + 1. Let r = 0 + s. Let f be r - ((-2 - -1) + 2). Let h(n) = -n - 1. Let t(l) = -2l2 - 5l - 3. What is ft(q) + 5h(q)? 2q2 - 2 Let o(d) = 17d - 8. Let s(z) = -8z + 4. Give 3o(i) + 7s(i). -5i + 4 Let v = -2 - -8. Let k(y) = -2y3 - 13y*2 + 2y - 15. Let r(g) = -16g2 - g3 + 4g + 10g2 - 7 - 3g. What is vk(j) - 13r(j)? j*3 - j + 1 Let l(c) = 7c*3 - 3c*2 - 5. Let t(u) = 53 + 2u*3 + 5u*2 - 5u*3 - 4u*2 - 51. Suppose 0w + 5 = -w. What is wt(f) - 2l(f)? f3 + f2 Let r(i) = 13i2 + 7i - 9. Let o(d) = -6d2 - 3d + 4. Suppose -4w + w = 0. Suppose -4g = -wg - 36. Give go(l) + 4r(l). -2l*2 + l Let l(h) = -4h*2 + 11h - 9. Let o(b) = -2b2 + 5b - 4. Suppose 4k = 69 + 175. Let q = 35 - k. Let f = q - -17. Determine fo(g) + 4l(g). 2g*2 - g Let y(g) = -4g + 6. Let w(c) = -c*2 - 14c - 3. Let z be w(-13). Let b(h) = h - 1. Determine zb(f) + 2y(f). 2f + 2 Let h(o) = -11o - 9. Let k be (20/(-6))/5-6. Let t = k + -8. Let s(v) = 2v - 3v - 5 - 5v. What is th(u) + 7s(u)? 2u + 1 Let y(c) = 2c*2 + 3c + 2. Let q = -90 - -86. Let d(m) = 5m - 5m - 4m - 3m*2 - 3. What is qd(i) - 5y(i)? 2i*2 + i + 2 Suppose -30 = b + 4b. Let c(g) = g*3 + 2g*2 + 3. Let t be (4 - 0) + -4 - 26. Let d(s) = -4s*3 - 9s*2 - 13. What is bd(w) + tc(w)? -2w*3 + 2w2 Let f(l) = -l3 - 2l2 + 3l + 4. Let k(p) = -p*3 - 4p*2 + 8p + 4. Let g(j) = -j + 1. Let d(s) = 3g(s) + k(s). Give -3d(m) + 5f(m). -2m*3 + 2m*2 - 1 Let c(b) = 5b*3 + 3b*2 + 3b - 1. Let j(i) = i3 + i2 + i. Suppose -q - 3o = -4o - 2, 5o = -25. Determine qj(g) + c(g). 2g3 - 1 Suppose -70 = -2g - 8g. Let j(f) = -7f*3 - 4f*2 + 4. Let i(a) = -13a*3 - 7a*2 + 7. What is gj(t) - 4i(t)? 3t*3 Let b(i) = -8i + 8. Let n be 5/(1(2 + -1)). Let f(a) = -3a + n + 1 - 3. Calculate -4b(p) + 11f(p). -p + 1 Let i(w) = -w - 4. Let s(a) = a - 1. Calculate -i(l) + 3s(l). 4l + 1 Suppose -5h = -4h + 4i + 14, -2h - i = 0. Let a(b) = 3b2 - 2b. Let k(t) = -4t2 + 3t. Let m = 7 + -4. Calculate hk(n) + ma(n). n*2 Let k(p) = 3p*3 - 2p*2 + 4p - 5. Let r(h) = 2h3 - 2h*2 + 3h - 4. Let a be 2/(-4) - (-27)/(-6). What is ar(f) + 4k(f)? 2f3 + 2f*2 + f Let s(y) = -3y*2 - 3. Let a = -74 + 78. Let r(g) = 2g*2 + 4. What is as(w) + 3r(w)? -6w*2 Let s be (4/10)/((-1)/10). Let t(j) = 11j*2 + 7j - 11. Let h(f) = -f - 1. Let y be h(-10). Let v(l) = 5l2 + 3l - 5. Calculate st(z) + yv(z). z*2 - z - 1 Let v(b) = 9. Let l(k) = k + 26. What is 3l(o) - 8v(o)? 3o + 6 Let b(q) = -17q + 15. Let m(w) = -8w + 7. Determine -4b(s) + 9m(s). -4s + 3 Let l(w) = -18w*2 + 2w - 4. Let r(v) = -18v2 + v - 3. Calculate -3l(y) + 4r(y). -18y*2 - 2y Let o(y) = -y*2 + 3y + 8. Let k(s) = s*2 - 2s - 5. Let g = 0 + -8. What is gk(j) - 5o(j)? -3j2 + j Let a(t) = t3 + 9t*2 - 9t - 9. Let l(w) = w3 + w2 - w - 1. Calculate -2a(d) + 18l(d). 16d3 Let i(z) = 21z*3 + 4z*2 - 4z. Let b(x) = -986x3 - 187x*2 + 187x. Calculate 4b(u) + 187i(u). -17u3 Let r(i) = -30i - 10. Let f(n) = n + 1. Calculate 8f(x) + r(x). -22x - 2 Let s(q) = -q*3 - 14q*2 - 14q - 12. Let z be s(-13). Let u(c) = -2c3 + 5c. Let x(d) = -d. What is zu(j) + 5x(j)? -2j3 Let y(c) = -c - 2. Suppose -8 = 6m - 2m. Let t(v) = 0 - 3v - 3 - 1. Calculate mt(h) + 5y(h). h - 2 Suppose -2j = -3x - 7j + 21, 3j = -5x + 19. Let r(d) = 4dx + d2 + 4d - d2 - 6d2 - d3 + 3. Let k(q) = q*2 - q - 1. What is 3k(y) + r(y)? -y3 + y2 + y Let m(z) = z*2 + 3z. Let b = 17 + -14. Let s(v) = 4v2 + 14v. What is bs(w) - 14m(w)? -2w2 Let c(w) = -10w*2 + 10w. Suppose -4x = n - 25, -2n - x = -4 - 46. Suppose 6h + n = h. Let d(m) = -3m*2 + 3m. Give hc(v) + 16d(v). 2v2 - 2v Let u(t) = -t*2 - 23t + 5. Let q(d) = -d*2 - 24d + 4. Give -3q(j) + 2u(j). j*2 + 26j - 2 Let s(y) = -2y + 3y + 4y. Let n(d) = -14d. Let o(i) = i + 7. Let x be o(0). Let z(u) = u*2 - 5u - 10. Let k be z(x). Determine kn(t) + 11s(t). -t Let d(u) = -u*3 + 2u*2 + u - 5. Let x be d(-2). Let w(z) = 3z - 3. Let f(n) = -n*2 - 13n + 13. Give xw(q) + 2f(q). -2q2 + q - 1 Let m(w) = 3w*2 - 15w*3 + 11w*3 + 3w - 3 - 4w2 - 2w2. Let j(v) = v3 + v*2 - v + 1. What is 3j(z) + m(z)? -z*3 Let i(x) = -2x. Let u be i(-4). Let o(r) = r*2 + 17r*2 - 7r*2 + u. Let a(y) = -7y*2 - 5. Give 8a(k) + 5o(k). -k2 Suppose -2 = l - 8. Let z = 11 - l. Let p(x) be the second derivative of x4/3 + 9x*2/2 - 16x. Let v(o) = 10o2 + 22. What is zv(i) - 12p(i)? 2i*2 + 2 Let r(u) be the first derivative of -3u2/2 + u + 15. Let s(l) = l2 + 1. Calculate -r(h) + s(h). h*2 + 3h Let t(o) be the third derivative of 0 + 1/3o3 - 1/20o*5 + 0o*4 + 3o*2 + 0o. Let f(w) = -10w2 + 7. Give -2f(a) + 7t(a). -a2 Let x(k) = -20k*3 - 3k*2 - 17k. Suppose o = -212 + 195. Let s(q) = -7q3 - q2 - 6q. Determine os(i) + 6x(i). -i3 - i2 Let v(q) = q3 - q2 + 3q. Suppose 5k + 18 = -3m, k + m + 0 + 4 = 0. Let f(t) = t3 + 2t. Determine kf(n) + 2v(n). -n*3 - 2n*2 Let y(g) = -11g. Let s = 4 + -1. Let a(k) = -s + 3 + 6k + 0. Calculate 5a(o) + 3y(o). -3o Let r(s) = s*3 - 4s*2 - 5s - 6. Let t be r(5). Let f(m) = -4 + 2 - 2. Let n(g) = -8. Let l(q) = tn(q) + 13f(q). Let z(a) = a - 5. Give 3l(w) - 2z(w). -2w - 2 Let k(u) = -3u*3 + 4u*2 + 4u - 4. Let t(f) = -2f3 + 5f*2 + 5f - 5. Calculate 5k(r) - 4t(r). -7r3 Let y(k) = -7k*2 - 2k - 4. Let u be -15 + (0 - 8)/4. Let m(c) = -20c2 - 6c - 11. Calculate uy(r) + 6m(r). -r*2 - 2r + 2 Let k(r) = 3 + 4r - 6r - 3. Let d(n) = 1 - 5 + 3. Let u = 3 - 2. Give uk(c) + 2d(c). -2c - 2 Let d(a) = 3 - 4a*2 - 2 + 4a - 8. Let k(v) = 2v2 - 2v + 3. Let c = 20 - 18. Suppose 5 = r + c. Give rd(z) + 7k(z). 2z2 - 2z Let d(l) = 6l3 - 24l2 + 24. Let v(y) = -y3 + 5y2 - 5. What is -5d(g) - 24v(g)? -6g*3 Suppose -2a - 2a = 0. Let p(g) = -3 + a + 2 + 6 - g. Let k(x) = -x2 - 4x. Let y be k(-3). Let r(c) = -c + 3. Calculate yp(h) - 5r(h). 2h Let h(q) = 5q3 - q2 - 4q - 4. Let y = 3 + -18. Let i = y - -22. Let s(b) = -9b*3 + 2b*2 + 7b + 7. Give ih(o) + 4s(o). -o3 + o2 Let r(n) = -2n3 + 3n*2 - 3n + 4. Let a(b) = 4b3 - 5b*2 + 7b - 8. Give 3a(k) + 5r(k). 2k3 + 6k - 4 Let p(f) = -3f3 + 7f + 7. Let r(l) = l + 2. Let d(b) = -5b - 11. Let a(s) = d(s) + 6r(s). Determine -14a(u) + 2p(u). -6u3 Let o(z) = -5z + 6. Let c = -36 - -91. Let k(r) = -45r + 55. Determine co(j) - 6k(j). -5j Let y(w) = -11w + 0w + 0 - 7. Let o(f) = 4f - 7. Let h be o(5). Suppose 7 = -2n + h. Let l(s) = -5s - 3. Calculate ny(u) - 7l(u). 2u Let b(c) = 3c + 4. Let a(m) = 1. What is -6a(z) + b(z)? 3z - 2 Let k(q) = q3 - q2. Let r(p) = -2p*2 + 51p - 51p - 1 + 3p*3. Calculate 5k(s) - 2r(s). -s3 - s2 + 2 Let f(a) = a2 - 5a. Let w(h) = -h*2 - 4h. Let s(y) = -3y2 - 8y. Let r(t) = 2s(t) - 5w(t). What is 3f(x) + 4r(x)? -x*2 + x Let a(o) = -21o*2 + 9o - 9. Let d(w) = 5w2 - 2w + 2. Let k = -43 - -34. Calculate kd(z) - 2a(z). -3z2 Suppose 9c + 33 - 15 = 0. Let g(r) = -3r2 + 2r - 1. Let u(a) = -a*2. What is cu(o) + g(o)? -o*2 + 2o - 1 Let n(t) = 6t3 - 3t*2 + 5t - 2. Let g(o) = -3o3 + 2o*2 - 2o + 1. Give 5g(p) + 2n(p). -3p3 + 4p*2 + 1 Let n(u) = -2u*2 + 3u + 2. Let g(z) = -4z2 + 1 - 11z + 3z2 + 12z. Determine -3g(w) + n(w). w2 - 1 Let o(l) = 15l*3 - 7l*2 - l - 7. Let n(j) = -7j*3 + 3j*2 + 3. What is -7n(b) - 3o(b)? 4b*3 + 3b Let m be (1/(-1))/((-1)/(-5)). Let d(h) = -h*2 + h. Let g(a) = -6a*2 + 6a - 2. What is md(y) + g(y)? -y2 + y - 2 Let l(q) = 91q*3 + 39q*2 + 39q + 39. Let n(i) = -9i3 - 4i*2 - 4i - 4. Give 4l(u) + 39n(u). 13u3 Let i(g) = -6g + 2. Let q(x) =	{ "pile_set_name": "DM Mathematics" }
22m - m4 - 17 - 8m*2 + 2 to nm + im3 + zm*4 + pm*2 + h and give n. 22 Express (-26 + 26 + 29l*3)(-5l - 17l - 23l)(2 - 2 - 3) in the form rl4 + j + ol + sl3 + yl*2 and give r. 3915 Rearrange 305u - 38u2 - 2096u - 41u2 + 78u*2 to iu + y + wu2 and give w. -1 Rearrange 2808b - 261b + 774b - 1 + 1 to ob + i and give o. 3321 Express 3s*2 + 98536s*3 - 98726s3 + s2 as vs2 + l + ds*3 + xs and give v. 4 Express -3p3 - 10 + 4 + 755p + 3418p + p3 + 7 in the form s + bp*3 + lp*2 + zp and give z. 4173 Rearrange 99h3 + 92h*3 + 94h*3 - 286h*3 + 3h*4 - 131 to dh*3 + z + nh*4 + oh + ch2 and give z. -131 Express 367946u + 28u3 + 2 - 4 - 367953u in the form tu3 + v + nu + bu2 and give n. -7 Rearrange (v + 2 - 2)(1 + 2 - 2)(28v - 40v - 20v)(-4 - 12 + 0) to zv + bv2 + c and give b. 512 Express -1830n - 4 + 0 - 167n + 6 - 5 in the form sn + z and give s. -1997 Rearrange -85 + 262 - 2r2 - 92 + 12051r - 85 to the form a + fr2 + vr and give v. 12051 Rearrange 973 + 1268 - 8c + 991 - 3519 - 7c to mc + a and give a. -287 Rearrange (-1655 + 1299 + 6494 + 6711 + 3068)(1 - 1 - 2v) to sv + f and give s. -31834 Rearrange -s + 274185s3 - 2 + s - 274099s*3 - 4s*2 to the form ys*3 + ls + x + zs2 and give z. -4 Rearrange (1394b*2 - 414b*2 + 1382b*2)(-b + 4b - 4b) to the form qb3 + wb + tb2 + d and give q. -2362 Express 1025 - 223w - 952w - 2024w - 1025 in the form i + nw and give n. -3199 Rearrange 111r + 199r + 2888r - 72r + 1295r to b + wr and give w. 4421 Express -365y*2 + 29908 - 11y*3 + 908y*2 - 29908 as g + my*2 + xy*3 + py and give m. 543 Rearrange (-1 - 3 + 1)(948 + 986 + 246 + 260)(-12j - 5j + 12j) to the form mj + w and give m. 36600 Rearrange -86b2 + 5b*3 + 33b*2 + 0b - 11b4 + 22b*2 + 2b - 1 + 28b2 to the form yb*3 + db + xb2 + o + sb*4 and give y. 5 Express 117z*2 + 40z*2 + 2z - 292z2 + 3z*3 - 10z*3 + 8z*3 in the form oz*3 + b + mz*2 + tz and give t. 2 Express 9876060 + 1608w2 - 9876060 in the form fw + h + cw2 and give f. 0 Express (41224 + 34400 - 39568 + 3351)(-2k2 + 3k*2 - 3k*2) - 2k*2 + 4k2 - k2 as y + tk2 + gk and give t. -78813 Rearrange -114d + 472 + 477 - 955 + 6d + 7d - 18d + 1 - 1 + 3d + (-2d + d + 3d)(0 + 0 + 1) + 3d - 3d + d to cd + k and give c. -113 Rearrange 61d - 34763783d2 + 34763783d2 - 130 + d3 to the form b + od + vd*2 + fd*3 and give b. -130 Rearrange 2148c + 2383c - 8831c to the form yc + j and give y. -4300 Rearrange (-4r*3 + 3r*3 - 7r*3)(628 + 893 + 1514 + 3036 + 502) to the form z + jr3 + ur + gr2 and give j. -52584 Express 3j*2 - 4j*3 + 24j*2 - 4 + 4j*4 - 3j*4 - 26j*2 + 2j + 0j in the form n + yj*4 + gj + uj3 + ij*2 and give n. -4 Rearrange 537k - 540k - k4 + 2k4 + 1 + k2 - 5 to the form jk4 + b + pk*3 + yk*2 + mk and give b. -4 Rearrange 4t2 + 13302t - 13306t - 49t*3 + 4t*3 to the form ut*3 + zt + ot2 + v and give z. -4 Express (26 - 26 - 5q)(-8 - 6 + 3)(-1 + 1 - q)(6 + 4 - 8) as jq + v + gq2 and give g. -110 Rearrange -715n - 707n + 2 + 2136n - 716n to the form jn + m and give j. -2 Rearrange 38048 - 3865u + 38046 - 76094 to the form hu + b and give b. 0 Rearrange (-21t + 12t*2 + 21t)((4t - 79 + 79)(-3t - 2t + 2t) - 2t2 - 3t + 3t) to the form ot*4 + xt*2 + yt + st3 + j and give o. -168 Express -4g + 257054 + 256843 - 518138 as ag + x and give a. -4 Rearrange 19h4 - h4 - 15h4 - h2 + 0h*4 - 537h*3 + h to the form th + oh3 + j + kh*2 + lh*4 and give k. -1 Rearrange m + 96m*2 + 3m + 61m3 - 97m*2 - m + 3m to w + xm2 + km*3 + im and give x. -1 Rearrange (302290 - 7471a - 302290)(2a + a - 4a) + 2a2 - 3a*2 + 0a*2 to the form wa + da2 + i and give d. 7470 Express 4 + 47h*2 - 40h*2 - 93 - 19 - 10h*2 in the form ph + ih2 + u and give u. -108 Express (4a + 6a - 6a)(61396 + 61401 + 1188a - 122799) in the form sa + y + ha*2 and give s. -8 Rearrange -123f*2 + 9326f + 3f2 - 4655f - 4652f to pf + h + lf2 and give l. -120 Rearrange (-o2 + o2 + o2)(-2 + 2o2 + 2) + (-5o + 18 - 6o + 10o)(64o*3 + 12o*3 - 14o*3) to co + no3 + xo*4 + po*2 + g and give x. -60 Rearrange (5v*2 + 3v*2 - 5v*2)(-13v2 - 327v + 327v + (6v + 2v - 6v)(1 - 1 - v)) to the form a + cv*2 + ov*3 + bv + lv4 and give c. 0 Rearrange 21 - 33z + 23z + 69 + 11z + 34 to q + bz and give q. 124 Rearrange -28u*3 + 2u*2 - 9u*3 - 3u + 29u3 + 7 to the form yu + gu3 + zu*2 + b and give z. 2 Rearrange -120 - k - 53 + 13k - 28 to tk + l and give t. 12 Rearrange -29 + 3b*3 + 29 - 18b*3 - 5b*3 + 8b*3 + (b - 4b + b)(-4 + 4 + b2) to the form gb + qb2 + hb*3 + u and give h. -14 Express 0m + 957 - 470m2 + m + 2m3 - m4 - 2m - 956 as xm + vm2 + lm*3 + k + dm*4 and give d. -1 Express -9 + 1 + 3z*2 + 5 + 1 + 2z*2 - 1 + (z + 3z - 2z)(0 + 2z + 0) - 3z*2 + 14z*2 + 6z*2 in the form u + bz*2 + pz and give u. -3 Express 10893c3 - 21436c*3 - 16c + 11081c3 as lc*2 + gc + t + nc3 and give l. 0 Rearrange 3158h*2 + 7h*3 + 21h - 3 - 3157h2 - h3 + 1 to qh*2 + mh + sh3 + b and give m. 21 Express 2 + 237p2 - 1 + p3 - p*4 - 233p*2 in the form mp*2 + xp + rp3 + l + jp*4 and give m. 4 Rearrange -119 + 7h - 10h + 438 + 15h - 22h to the form t + bh and give t. 319 Express 243a4 + 17a*4 - 215a4 - a2 + 12 in the form za4 + k + va*2 + oa + ta3 and give z. 45 Rearrange (8 + 17 + 61)(13t + 9t + 10t) + (1 - 1 + 2)(3t - 3t - 2t) - t + t + t to the form x + wt and give x. 0 Rearrange 25h + 69h + h - 19h + 45 - 25h to m + rh and give m. 45 Express (-1 - 2n + 1)(-3 + 2 + 4) + 146n + 3 - 1 - 9 + 110n + 7 in the form in + s and give i. 250 Rearrange 4311 - 4b2 + 5b - 11b3 - 4308 - b - 5b to s + gb + hb*3 + cb*2 and give c. -4 Express ((-7 - 15 + 8)(-1 + 6 - 4) + 164 - 77 + 185 + (-2 + 0 + 1)(3 - 1 + 0) - 2 - 3 + 4)(-5g + 2g + 2g) in the form pg + a and give p. -255 Rearrange 446r + 453r - 1231r - 1395r to the form v + xr and give x. -1727 Rearrange (-4k + 7k + k)(75181 - 75181 + 948k3) - 2k*4 + 0k*4 + 3k*4 to the form lk*2 + s + rk*3 + ak*4 + uk and give a. 3793 Rearrange -23152m - 26963m + 57289m + (-3 + 5 - 1)(2 + 2m - 2) to the form wm + g and give w. 7176 Express -i4 + i2 + 81i3 + 2759i - 2762i - 144 - 78i3 - i4 in the form q + ki + bi*2 + ni*3 + wi*4 and give w. -2 Express -674 - 2868o + 2866o + 230 in the form n + jo and give j. -2 Rearrange 2 + 13x3 + 4435x - 3x4 - 4432x + 2x2 + 9x*3 to wx*2 + h + dx*4 + kx*3 + tx and give w. 2 Express 11h - 54h*2 - 7h + 334h3 - 336h*3 - 2 - 10h as ph2 + jh*3 + i + dh and give d. -6 Express (-1347h + 2884h - 1081h)(0 + 0 + 3h + (-3h - h + 5h)(-1 + 3 - 1)) in the form jh + g + vh2 and give v. 1824 Rearrange -1061 + l2 - 13797l + 13797l to bl + ul*2 + d and give u. 1 Rearrange ((-3 - 2 + 1)(-5f + 0f + 4f) + 3f - 6f + 4f)(-33 + 26f*2 + 33) to v + nf*3 + rf + kf2 and give r. 0 Express -50 + 997z + 996z + 2z*3 + 9z*2 + 972z - 2963z as o + az*3 + kz + xz2 and give a. 2 Express (29y*3 - 90241y - 6 + 90241y)(7 - 11 - 13) as ay + iy*2 + jy*3 + b and give j. -493 Express (-7j - 13j + j)(-7 + 7 + 15) + 14j - 49 + 49 as t + aj and give a. -271 Rearrange (3 + 0 - 1)(568k + 34114 - 34114)(-2 + 1 + 6)(0k2 - k2 - k2) + 2k*3 - 1 + 1 to lk*3 + xk + j + mk2 and give l. -11358 Express 2v + v + 34v3 + 122v*3 - 1 + 21v*3 + 0v2 + v2 in the form m + wv3 + xv + av2 and give w. 177 Rearrange -13i*3 + 0i4 + i4 - 12i3 + 2i + 2i + 2i*2 - 6i to bi4 + vi*2 + di + ci3 + t and give v. 2 Rearrange -9d*2 - 1384483d - 401 + 1384483d to r + gd*2 + yd and give g. -9 Express 277k + 3k*2 + 214k - 129k - k2 + 179k in t	{ "pile_set_name": "DM Mathematics" }
22)/www)/ww)/(w23w) assuming w is positive. w(-6871/154) Simplify ((r(-8)/rr/(r((r/r*(-2/5))/r)/r)r)/(r(-1)/r)(-16))/((r/r*(1/2)r)*14/(rr(rr/(rr(-1/3)))/r)(-1)) assuming r is positive. r(-941/15) Simplify (y/(y(-2)y)y(-5/3)y)*(-50)((((y*(-3/7)/yy)/y)/y)/yy(-1))/(y0yyy*(-1/3)/yyy) assuming y is positive. y(-1549/21) Simplify (((aa/a*9a)/(((a/(a/a*(-5))a)/a)/a))/(a*(-6)aaa(a/(aa(-2/11)))/a))/((a(-4))(1/31))(-1/24) assuming a is positive. a(7801/2046) Simplify ((u(-1/3))(19/4))(-18/7)(u(-1/3)/u4)/(u(-1)uuu)39 assuming u is positive. u(-3287/42) Simplify ((c(-2))20)(-19)/((c(-1/2)/(c/(((cc(-2/11))/c)/c)))/((c(-7)/cc)/c(-1))) assuming c is positive. c(16647/22) Simplify ((ss0/s)36)(-20)/((s(-2))43s*(-1/7)/ss/s(-1)) assuming s is positive. s(596/7) Simplify (zz(z/z*(-2))/zzzz)/(z*(-2/7)/z)(z8/z)/((z/((z(-1/6)/z)/z))/z)(z/(z/(zz*(-5)z)))/zz(-3)(z(-1/2))(-29) assuming z is positive. z*(433/21) Simplify (ll/(l/l*(-15)))/(ll*(-12)/llll)((l/(ll(-23)/l))/l)/l23 assuming l is positive. l(-5) Simplify ((h/h(-7)h(-22/9))/(h(-38)/h(5/6)))(-2/75) assuming h is positive. h(-799/675) Simplify (((d3/(dd/(d/(d(-1/2)/d))))(-5/3))(-7))26 assuming d is positive. d*(3185/3) Simplify ((((q/(qq/(q(qq*(-13/3))/qq)qq))/q(-4))(-9/8))40)(-50) assuming q is positive. q*(-3000) Simplify ((uu*(-2/7)uu(-7))/((u/((uu/(u*(2/9)u)uu)/u)u)/u(2/3)))/((uu*5u1)/(u(-2/13)uu/(u/u*6)uuu)) assuming u is positive. u*(-1634/819) Simplify ((((www6)/(((w9w)/ww)/w))/((ww*(1/4))/((ww/(ww(-2/7)/w))/ww)))(23/5))(-3/41) assuming w is positive. w(-69/5740) Simplify ((a0)*38/(a(a*(3/4)aa)/aaa(-1/2)a))/((aa(1/3))(1/43)((aaa(-1)/a)/a)(-46)) assuming a is positive. a*(-25945/516) Simplify ((p/(p/(pp*(2/9)p)))/(p/(p*(1/8)/p))(p/(((pp(-1/2))/ppp)/p))(-8/7))(1/26) assuming p is positive. p(-113/13104) Simplify ((r5rr(-3/14)/r)/(r/(r(1/10)/r)rr11))(-25) assuming r is positive. r(1595/7) Simplify ((c(-1))15c(-10/9)/c(-9))(-34/3) assuming c is positive. c(2176/27) Simplify ((y/(y*(-6)/y))/((y(y*(-6)y)/y)/y))/(y1)(-1/46)(y((yy(-5))/y)/yyy/(y/((yy*(-1/2))/y)))/(yy(-1/3))(-24/7) assuming y is positive. y(1901/161) Simplify (f(1/2)/f*(-39))/(ff(f(-9/4)/f)/ff)(-50) assuming f is positive. f(-23) Simplify (g(-1)/g)(1/2)/((g/(g(gg*8g)/g))/((g/g*0)/g))(gg/(g/g(2/7))ggg)/gg/(g/(g(-6)/g)g)gg*(5/3)ggggg8 assuming g is positive. g(377/21) Simplify (m*3m(3/11))(-26)((mm(-1/3))(-8/3))(-45) assuming m is positive. m(-56/11) Simplify ((l(-4))(2/5)(l(-2/7))(-1/11))16 assuming l is positive. l(-9696/385) Simplify (w(1/2)/www/w(-2))(2/19)((ww/(w/w(1/2)ww)w)/(w/((w/(w*(2/9)/w)w)/w)))20 assuming w is positive. w(4433/171) Simplify ((xx(2/9)/x)(-14/11))(-33)(xxx/(x*(-1)xx)x)42/((x(-1/6)x)/((x/x(3/5))/x)) assuming x is positive. x(1339/10) Simplify (s(-5/4)s3)(-50)/((ss1ss)/(s(1/7)s))45 assuming s is positive. s(-3025/14) Simplify (i*23i)*(-43/5)i*26/(i(i/i(-2/25))/i) assuming i is positive. i(-4537/25) Simplify ((l*(1/4)l)(-24))(-2/45)((l/l4l)/(l/(l/l*(2/15))l))/(l(6/11)/l0) assuming l is positive. l*(-129/55) Simplify (xx/x*(2/19)x2)(-13)/(((x(x/(xx*(-2/5)))/xx)/(x/x(2/3)))/(x/(x(2/7)/x))(-3/26)) assuming x is positive. x(-1345924/25935) Simplify ((p*(-5)p)/(p(pp*(-18)p)/pp)(p/p*28)/pp/p*(-19)p)(-1/6) assuming p is positive. p(-2/3) Simplify (uu(1/8)u)28/(u(-6/19)u/(uu(-36))) assuming u is positive. u(905/38) Simplify (((m*(-4/3)m)/m*(-1/2))/(m/(m(mm(-2/7))/m)m)*22)/(m/(mm*(2/11))m/m*(-2/7)(mm1)(18/7)) assuming m is positive. m(-15877/462) Simplify ((kkk7k)*(20/11)((((k/k(-5))/k)/k)/k)(-34))(-48) assuming k is positive. k(44256/11) Simplify ((kk/(kk/(kk(2/3)k))k)/(k/(k/k(1/5)k))(k(-2/7))46)/((k/k0)14(k/((k/(kk(-2)k))/k))/k4) assuming k is positive. k(-2066/105) Simplify ((n(-26)/((n13/nn)/n))/(n(-17))(2/83))(2/9) assuming n is positive. n(-2080/249) Simplify ((z1)(1/77)/(z(-14)zz(6/7)))(2/45) assuming z is positive. z(208/385) Simplify ((ff*4f)*9((f*(-3/5)ff)/f)(-1))(-14/13) assuming f is positive. f(-3752/65) Simplify (uuu(2/3)/u)(9/8)/(u(8/7)/u(5/6))((u/(uu1))/u)47/(u4u/(u*(-6)/uu)) assuming u is positive. u(-17377/168) Simplify ((f(-2/7)/f)*(-1/16)(f(2/7))(-1/37))/(f/f*2(f/(ff(-2/3))f)/ff(3/7)f1) assuming f is positive. f(-12713/12432) Simplify (f*(1/26)/ff(20/7))/(f(2/5)/(((f*(-4)ff)/ff)/f)) assuming f is positive. f(-1369/910) Simplify c(-1/4)/(c*4/c)cc(-1/4)(c/c*(-4/5))/c(c/(c0/c))(6/7)/(c/c0)(2/15) assuming c is positive. c(-5/42) Simplify ((x(-2)x)(-36))(-2/3)/((x0)31(x/(x/((xx(-1))/x)))/x(x*(-3/2)x)/x) assuming x is positive. x*(-41/2) Simplify (((hhh(-1))(-2/17)(h/(h/h*(-5)))/(h/(h/(h/(hh*(-2/3)))h)))(-2/3))(-21) assuming h is positive. h(-3416/51) Simplify ((x0xx*(-7)(x/(x*(-1/2)x))/xx(-1))49)9 assuming x is positive. x(-6615/2) Simplify ((x(-4)x)/(x(x/(x(x*(1/4)/x)/xx))/x))*3(x/(xx(-2/15)/x)x(x/x(-2))/xx)/(x/(x*(1/2)xx))21 assuming x is positive. x(1523/60) Simplify ((i/((ii/(i/(ii/(i(-1/4)/i)))ii)/i))(-2/191)((ii(3/10)i)/i)/i0)/((i1i)/(i/i3)i(2/15)/(i(-2/15)/i)) assuming i is positive. i(-11237/2865) Simplify ((x(1/9)/(xx(-7/4))x*(6/5)/(x(x*7x)/xx))5)38 assuming x is positive. x(-23731/18) Simplify ((m(-2/5)mm)(5/3)(m*(-6)/m)/mmm(-3))/((m(m/(m/(mm/m(-2/9)m)))/m)30/((m/m(2/7))/mm)35) assuming m is positive. m(-79) Simplify ((m(8/7)m*(-3)(m(1/2))(7/11))(-7/5))(-7) assuming m is positive. m(-1659/110) Simplify (((g2g)/gg)*(-23)g*(-2)/(gg*1gggg))/((g0)(3/11)(gg(2/5)/g)(-11/4)) assuming g is positive. g(-759/10) Simplify ((g19/g)(-40)g/g*(6/17)((g*20g)/g)/gg)(2/17) assuming g is positive. g(-23778/289) Simplify (g(7/6)g(-1/18))6/((g/(g(4/5)/g))/(g(-4/3)/g))(-17) assuming g is positive. g(1001/15) Simplify (r(-4/3)/r)/r(-1/5)r0rr(-2)((r(rr(r(-3)/rr)/r)/r)/(r*(-1/5)rr))/(r(-1)r/(rr(-6)r)) assuming r is positive. r(-164/15) Simplify ((n41/(nn(-15)n))/((nn2)/n2))46 assuming n is positive. n2438 Simplify ((l/(((lll(-7/4)/l)/l)/l))(-34)l*30/((l(l10/l)/l)/l))(-24) assuming l is positive. l2532 Simplify u(-8/9)/((uu/u(-3/7)u)/u)u(-40)/(u(-41)/u) assuming u is positive. u(-83/63) Simplify ((z1)(-36/5)z(-3)/(z/(z3/z)zz))/((z(3/4))(-2/23))1 assuming z is positive. z(-2561/230) Simplify ((l/(l/(l/((ll29)/ll)l))ll(-21/4)ll)(-44))(-19) assuming l is positive. l(-25289) Simplify (g(-1/8)g*(1/3))/((gg*(-1/7)g)/(g*(-4)/g))((g/(gg(-9)g)g)/g7)/(g(-1/3)g/g(1/5)) assuming g is positive. g(-4297/840) Simplify ((h/(hh(2/17))hhhh(-4/9))/((h12/hh)/h)(8/11))43 assuming h is positive. h*(-36593/153) Simplify (pp(-1/2))(2/179)(p(pp0)/p)(-2/175)(p*(-3)p*2/pp)(3/10) assuming p is positive. p(-19161/62650) Simplify (r*(-2/11)(r/(rr1))/rrr(rr(-1))(-47))/((r(-1)r)(1/19)/(r6rrr/r(-1/4))) assuming r is positive. r(399/44) Simplify (w(-12)/(ww/w*(-5))(ww/(w(12/5)/w)w)/(ww(-1)w))22 assuming w is positive. w(-2024/5) Simplify (j/j3)/(j/j(-1/2))(j(1/4))(-1/4)(j(-2/9)/((j/j(1/3))/j))(-4/19) assuming j is positive. j(-9811/2736) Simplify ((((p/p*(-2/77))/pp(-1/22))27)(-2/11))(14/5) assuming p is positive. p(162/605) Simplify ((((v(-3/4)/v)/v)/v)/v3)(-9/4)/((vv/(v(-1/4)v))*(-37/2)(vv(-1))(-12/11)) assuming v is positive. v(613/16) Simplify (f(4/5)(f/	{ "pile_set_name": "DM Mathematics" }
k3 - 312/7k - 26k2 - mk5 = 0? -2, -1, -2/7, 3 Let f(q) be the first derivative of q8/9240 + 13q7/1155 + 169q*6/495 - 63q*3 + 2. Let k(i) be the third derivative of f(i). Factor k(x). 2x*2(x + 26)*2/11 Factor 2/13p*2 - 290/13p - 588/13. 2(p - 147)(p + 2)/13 Let m(c) be the second derivative of 2c6/75 - 29c*5/25 + 26c*4/5 + 29c - 4. Determine w so that m(w) = 0. 0, 3, 26 Let z(d) be the first derivative of d*6/3 - 28d*5/15 - 7d*4/3 + 8d*3 + 43d*2/3 + 20d/3 + 1736. Find q, given that z(q) = 0. -1, -1/3, 2, 5 Suppose -1462 + 5350 = 4o. What is t in 4860t + 42t3 + 1188t*2 + 4t*4 + 15t*3 + 4860 + 59t3 + o = 0? -9, -2 Let p(t) = -t3 + 20t2 - 21t + 42. Let i be p(19). Suppose 0 = -o - c - i, 13c = 10c - 12. Find q, given that -4/7q2 + 2/7q + o = 0. 0, 1/2 Let z(g) be the third derivative of -g*5/30 - 7g*4/12 - 4g*3 - 9g*2 + 14. Determine j so that z(j) = 0. -4, -3 Let c(o) be the first derivative of 2o*3/15 - 2362o*2/5 + 2789522o/5 - 4098. Factor c(a). 2(a - 1181)2/5 Let d = -52496/825 + 702/11. Let v(u) be the second derivative of -24u + 0u2 - 1/60u*4 + 0 + 1/15u*3 + du*6 - 29/100u*5. Let v(n) = 0. What is n? -1/4, 0, 2/7, 1 Let v(j) be the first derivative of 30 - 36j - 4/3j3 + 20j*2. Factor v(y). -4(y - 9)(y - 1) Let d(n) be the third derivative of 0n*7 - 1/1176n*8 + 1/420n*6 + 0n - 18n2 + 0n*5 + 0n*4 + 0 + 0n*3. Factor d(l). -2l*3(l - 1)(l + 1)/7 Let d(a) = a3 + 3a*2 + 4a + 7. Let c be d(-2). Factor -9u2 + 4u4 - u2 - 2u2 - 8u - 7uc - 14u*2 - 8u*2. u(u - 4)(u + 2)(4u + 1) Let t(u) be the first derivative of -u3 + 27u*2/2 + 108u + 1964. Factor t(g). -3(g - 12)(g + 3) Let o(n) = 4n2 + 3n - 4. Let p be o(-3). What is q in -p - 4q2 - 24 + 24q + 11 = 0? 3 Let k(z) be the first derivative of -37z4 + 272z*3/3 - 50z*2 - 24z - 6216. Factor k(j). -4(j - 1)2(37j + 6) Suppose 11 = -64j + 395. Let b(g) be the second derivative of 1/5g2 + 1/25g*5 + 0 + 0g*4 - 2/15g*3 - 1/75g*j + 9g. Factor b(d). -2(d - 1)3(d + 1)/5 Let n(o) be the second derivative of -13 + 1/5o5 - 20/11o*4 - 2/3o*3 - 1/165o*6 - 4o + 11o2. Determine g so that n(g) = 0. -1, 1, 11 Let b be 20/(-9) + 2 + 19765/45. Suppose -439 + 200f*2 + 140f + 2f3 + b - 17f*3 = 0. Calculate f. -2/3, 0, 14 Let i be -6 + 8 + (-1)/(-1). Suppose -iv + 5v - 6 = -4n, 4n = -4v. Let -8/5d + 6/5d*2 - 2/5d*4 - 8/5 + 4/5dn = 0. Calculate d. -1, 2 Let o(n) be the third derivative of n8/5040 - 2n7/315 + 8n*6/135 - 53n*3/6 + 49n2. Let r(s) be the first derivative of o(s). Solve r(g) = 0. 0, 8 Let y(x) be the first derivative of -x4/18 + 188x3/27 + 101x*2/9 - 380x/3 - 7079. Solve y(p) = 0 for p. -3, 2, 95 Let h = 24395/18 + -1355. Let g(f) be the first derivative of -hf4 + 2/45f*5 - 4/9f*2 + 16/27f*3 - 7 + 0f. Suppose g(l) = 0. Calculate l. 0, 1, 2 Let g = 3 + 1. Let i be -9128/(-63). What is b in -9b2 + 15b*4 - 16b*g - 5b*3 - 2 - 7b + 0bi = 0? -2, -1 Let j(r) be the first derivative of -3/4r + 1/4r3 - 80 - 3/16r*4 + 3/8r*2. Find t such that j(t) = 0. -1, 1 Let u = -1/242507 - -46561351/1697549. Solve 2304/7 + 4/7w*2 + uw = 0. -24 Let h = -281201/420 - -1943/60. Let y = 638 + h. Factor yo2 + 12/7 + 18/7o. 6(o + 1)(o + 2)/7 Suppose -1281c2 + 637c*2 - 862427 - 94057 + 3912c + 640c2 = 0. What is c? 489 Let j(q) be the second derivative of 51q*5/5 - 273q*4/4 + 2q*3 + q - 2354. Factor j(h). 3h(h - 4)(68h - 1) Solve -86/5j*2 + 6/5 - 58/5j - 22/5j3 = 0 for j. -3, -1, 1/11 Let f(c) be the first derivative of 0c - 12c2 + 58 - 28/3c*3 + 3c*4 - 2/3c*6 + 12/5c*5. Let f(n) = 0. What is n? -1, 0, 2, 3 Let w(j) be the third derivative of 1/330j*5 + 0j*3 - 1/1155j*7 - 1/165j*6 + 2j + 1/33j4 + 0 + 12j2. Find s such that w(s) = 0. -4, -1, 0, 1 Let t(z) be the third derivative of -z6/240 - z*5/20 + 247z*4/48 + 2856z*2. Factor t(g). -g(g - 13)(g + 19)/2 Let v = -2/21217 + 190961/84868. Let b(n) be the second derivative of 0 + 3/8n*4 + 11/8n*3 + vn*2 + 3/80n*5 + 25n. Find r such that b(r) = 0. -3, -2, -1 Let y(r) be the third derivative of -1/3r5 - 7/60r*6 + 0r*3 - 1/3r*4 - 1/70r*7 + 232r*2 + 0r + 0. Solve y(k) = 0. -2, -2/3, 0 Let s(i) be the third derivative of i*8/2688 - 3i7/280 + i6/8 - 23i5/30 + 11i*4/4 - 6i*3 - 20i*2 - 34. Solve s(b) = 0 for b. 2, 6 Suppose 10 - 22 = -4a. Let l be (17 - -4) + (-1)/(a/6). Suppose 39z + 3z*3 + 24z*2 + 28z - lz = 0. Calculate z. -4, 0 Suppose -260 = -3a + 7a - 70h, -4h = -16. Factor 1/2x*a + 0x2 - x3 + 1/2x + 0 + 0x*4. x(x - 1)*2(x + 1)*2/2 Let r(c) = -5c + 104. Let w be r(20). Find h such that -114h - 562h*2 + w + 444h*2 + 0 = 0. -1, 2/59 Factor 2/9i*2 + 494018/9 + 1988/9i. 2(i + 497)2/9 Suppose 0 = -6q - 5z + 2, 0 = -q + 98z - 101z - 4. Let a(x) be the first derivative of 10 - 20/3x + 25/6xq - 5/9x*3. Factor a(y). -5(y - 4)(y - 1)/3 Let 2/19n*2 + 5368/19 + 5370/19n = 0. What is n? -2684, -1 Let o be ((4 - 27)/23)/((6 - 2)/(-12)). Determine r, given that 2/3ro - 2/3r*2 - 2/3r + 2/3 = 0. -1, 1 Suppose 221g - 223g + 15 = -3y, 2g = -3y - 3. Let r(b) be the first derivative of 13 + 30b + 25/2b2 - 5/3b*g. Factor r(h). -5(h - 6)(h + 1) Let k(g) = -6g*3 - 5g*2 - 12g - 38. Let z be k(-7). Let f = z + -1856. Factor 0 - 5/3v2 - vf - 2/3v. -v(v + 1)(3v + 2)/3 Let i be (-6734)/(-7770)(-120)/(-117). Factor i + 76/3w - 841/9w*3 + 174w*2. -(w - 2)(29w + 2)2/9 Factor 2401/9w*5 + 50368/9w + 512/9 + 57722/9w4 + 463345/9w*3 + 1248152/9w2. (w + 8)3(49w + 1)*2/9 Let y(n) be the second derivative of -1 - 1/20n*4 + 21/10n*2 - 13n + 3/5n3. Suppose y(m) = 0. Calculate m. -1, 7 Let d(q) be the first derivative of -4q*3/15 - 246q*2/5 + 507. Factor d(a). -4a(a + 123)/5 Let h(z) be the third derivative of -z8/11760 + z6/2520 - 31z*3/6 + 145z2. Let f(l) be the first derivative of h(l). Factor f(p). -p2(p - 1)(p + 1)/7 Factor 1/3y5 + 0 - 232/3y*3 + 0y - 23/3y4 - 496/3y2. y2(y - 31)(y + 4)*2/3 Suppose 3 = -o + 597. Suppose -oh + 537h + 3380 - 5h*3 - 110h*2 - 268h = 0. Calculate h. -13, 4 Let y(f) be the third derivative of 0 - 78f2 - 1/240f6 - f4 + 0f + 13/120f*5 + 3f3. Solve y(k) = 0. 1, 6 Let g(i) be the second derivative of i9/7560 - i*8/224 - 4i*7/315 - 47i*4/6 + 35i. Let p(u) be the third derivative of g(u). Factor p(c). 2c2(c - 16)(c + 1) Let k be ((-6)/10)/(42728/(-125020)). Let c = k + -9/218. Factor -cs - 4/7s2 + 40/7. -4(s - 2)(s + 5)/7 Suppose 0 = -4i + 4q + 284, -i = i + q - 142. Let f = i + -69. Factor 100d*5 - 61d*3 - 23d*4 - 3d*3 + 31d*4 + 16d*f + 12d*4. 4d*2(d + 1)(5d - 2)*2 Let m be (16/(-12))/((-11)/33). Factor 222n*2 + 2n*5 - 10n*3 - 15n*4 + 17n*m + 0n - 216n2 + 0n. 2n2(n - 1)*2(n + 3) Let q*5 + 16/7q*4 - 3/7q*3 + 0 - 4/7q - 16/7q2 = 0. What is q? -2, -1, -2/7, 0, 1 Suppose -4x + 4z - 2628 = -2644, -5z - 20 = 4x. Factor 4/3s*3 + 0s + x + 0s2 - 4/3s*4. -4s*3(s - 1)/3 Let a(x) = -x*3 + 451x*2 - 17760x + 49280. Let s(q) = -2q3 + 1352q*2 - 53280q + 147838. Let u(o) = -7a(o) + 2s(o). Find m, given that u(m) = 0. 3, 74 Suppose 1/2u2 + 159201/2 - 399u = 0. What is u? 399 Let g(f) be the first derivative of 5f6/6 - 2f*5 - 15f*4/4 + 40f*3/3 - 10f*2 + 937. Find a such that g(a) = 0. -2, 0, 1, 2 Determine l, given that 7688/3 + 153016/9l - 1462/3l4 + 294878/9l*2 + 4l*5 + 128752/9l*3 = 0. -3/2, -1/3, 62 Solve 460r + 6313r3 + 6596r*3 - 13144r*3 - 177r*2 - 5r*4 - 43r*2 = 0 for r. -46, -2, 0, 1 Let s(u) be the third derivative of 0u + 93u2 + 5/48u*4 + 0 + 1/120u*5 + 0u*3. Factor s(v). v(v + 5)/2 Let q(p) be the third derivative of -p8/1848 + p7/105 - 395p2 - 2p. Factor q(d). -2d4(d - 11)/11 Let o be (-2)/(-4)(-1804 + 1805). Factor 0 + 6r*2 + 3r*4 - 2r - 13/2r3 - or*5. -r(r - 2)*2(r - 1)**2/2 Let d be 11	{ "pile_set_name": "DM Mathematics" }
(-2/5)))*(-2/29)(m/m*(4/9)mm/m(-2/7))/(m1m)7 assuming m is positive. m(-99793/9135) Simplify (y/(y((y/((yyyy(y(-3/2)/yy)/yy)/y))/y)/yy)y(-6))23(y*(-2/5)(y/y*4)/y)/(((yy*(-7))/y)/yy/y*8y) assuming y is positive. y*(-939/10) Simplify ((z(z/(z/z*(2/5)zz))/zzz)/zz)*3(zz/z6z)/(z/z*2z)(zz*0)/(z/(z(z/z*(-8))/z))z*(1/3)z/z*(2/5)z assuming z is positive. z(137/15) Simplify ((a(1/2)/a*(-1/8))/((aa*(4/7))/(aa(-7))))(-1/5) assuming a is positive. a(389/280) Simplify ((((z/z(-1/2)z)/z)/z)/(z(-4)z))*48((z(zz(z1/z)/zz)/z)(2/21))(-15) assuming z is positive. z(1156/7) Simplify ((x(-1)/(x*1x))/((x1/x)/x(-7)))/((x/(x*10x))/(xx(-5/4)))(-4) assuming x is positive. x(-49) Simplify ((oo*(3/5)o)(-10/11))(-1/11)/((o(2/9))14(o/(((oo(2/3))/o)/o))(9/2)) assuming o is positive. o(-9688/1089) Simplify (r0)22/(r(2/3))*17((r/r(-2/3))(-46))(-17) assuming r is positive. r1292 Simplify (((l(-2))(-12)/(ll(-4/5)l(-2/23)))(-37))(-49) assuming l is positive. l(4980311/115) Simplify (k/k*(2/9))/kkkkk2k(2/11)/k(6/7)k0/(k(-1/6)/k)((kk(-2/9))/k)(-13) assuming k is positive. k(3769/462) Simplify (((jj(1/26))/((j(1/18)/j)/j))/(j(-4/3))(-1/3))(-1/28) assuming j is positive. j(-33/364) Simplify ((l(-26))(-4/7)l/l(-2/31)(l/(l(-24)/l))/l)50 assuming l is positive. l(444000/217) Simplify ((k(-2/9)k)/kk/k(-1/5))41/(k*3k/k*1kk(k((k/k(-1/6))/kk)/k)/kkkkk(1/10)) assuming k is positive. k(1432/45) Simplify ((v*(2/11)v/v*6(v*(-2)v)/(v*(-2/11)/vv))9)(-25) assuming v is positive. v(13950/11) Simplify ((q7/q)*(2/19)(q(q/(q/q(-1/2))q)/q)(-34))(2/39) assuming q is positive. q*(-622/741) Simplify ((((t(t/t*5)/t)/t)/t)/tt6)16/((tt0t(-1))/(t/t(-6)tt6)) assuming t is positive. t(-2) Simplify ((v(-2/5))(2/57)(v/(v/v(2/7)))/v(-3/10))/((v/(v/(vv/v*4)))/v(v*3v)/v(vv(-1))31) assuming v is positive. v*(2281/3990) Simplify ((ii*1i)(-11))(-43)/(i*(-4)i/(i*(-3/7)ii))(3/8) assuming i is positive. i(9945/7) Simplify ((kkk(9/4))/(k22kk)kk5(kkk*11k)/k)(-2/99) assuming k is positive. k(1/66) Simplify ((z(-2/17)/z)/(z(-2/145)z))/(z(-18))(7/6) assuming z is positive. z(46579/2465) Simplify ((m/(m(-5/4)/m))/(m/m(-4/11)))(-35/6)/((m(-2))(-2/45))(-44) assuming m is positive. m(-28087/3960) Simplify ((((f/(ff*(-5)f))/f)/f(-5))/(f(-1/4)f(-1/11)))/((ff/(f(-1)/f))(2/9))(-19) assuming f is positive. f(9991/396) Simplify ((u(2/3))23(u4/uu)2)(7/5) assuming u is positive. u*(98/3) Simplify ((vv(2/5))(2/31)/(v*(-2)/(vv/(vv/(v/v(2/3)v))v)))/((v/(v/v(-2/5)))32/(v3/vvv/(vv(-1/2)))) assuming v is positive. v(19273/930) Simplify (p(pp*(2/13)p)/pp(2/3)p)(12/7)/(p2/(pp6)p*(3/7)((ppp6/p)/p)/p) assuming p is positive. p(557/91) Simplify (((j*2j/(j((jj*(-5/3)jj)/j)/jj))/((j*5j)/j(-1/12)))(-2))(-1/4) assuming j is positive. j(-53/24) Simplify (v*(-2/7)v)*(-8/11)(v/(vv(1/3)))/vvv7v(v(1/4)v/(v*1v))(1/6) assuming v is positive. v(12977/1848) Simplify (((s/((s/(s(1/2)/s))/s))(-3/11)/(((((s/(sss*(-8)sss))/s)/s)/s)/s(-2/3)))(-4/11))15 assuming s is positive. s(1190/121) Simplify (((ll0)(7/3)/(l/(((l/((ll(l/(l/l(-3/2)))/l)/l))/l)/l)l11))(2/3))(1/43) assuming l is positive. l(-55/387) Simplify (m*(-5/6)/((mm/(mmmm(-6)mm))/m))(-4/5)/(m(3/2)/mm(1/6)/m)(1/11) assuming m is positive. m*(379/165) Simplify ((h/(h/(hh/((hh(-1/5))/h))))(-22))(-49)(h*(1/3)/((hh/(h*(-1/4)/h))/hh))/(h*(1/4)/hh/h*(-3/8)h) assuming h is positive. h*(284047/120) Simplify ((ff/(f/(f/(f*6f))))/f3)(-37)((f(f/f(-2/5))/f)(1/35))(-33) assuming f is positive. f(7367/25) Simplify (((cc(1/26)/c)/c)(-2/55)(c(-22/9))1)(2/11) assuming c is positive. c(-6202/14157) Simplify (aa(-4)(a/a0)/a)/((a/(a/(a/a(-1/6)a))a)/a*(-2/17))a*(-1/4)/(aa*(2/3))(aa1/a)(-9) assuming a is positive. a(-3509/204) Simplify ((((h(-2/5)h)/h)*(-33)(h(4/7)/h)/h(-5/3))(3/2))(-22) assuming h is positive. h*(-16676/35) Simplify ((gg/(g((g/g1)/g)/g)g)25/(g(3/7)/g(1/17)))27 assuming g is positive. g(320112/119) Simplify (((h(4/15)h)(-39))15)20 assuming h is positive. h(-14820) Simplify ((h(-8)h/(hhh*(2/7)h)(hhh2)28)(-4))(-2/7) assuming h is positive. h(5696/49) Simplify ((b18bb(2/27))/((b/(bbb8b))/(bb(-20)/b)))(2/19) assuming b is positive. b(490/513) Simplify (g(-6)/gg/(g/(gg4)))49((g1)(5/3))(-9/2) assuming g is positive. g(-211/2) Simplify (p/(p*(-2/65)/p))/pp/(p/p*10p)(p(-2/15))43 assuming p is positive. p(838/195) Simplify ((b/(bbb/(bb/b*18)b))/b*39((b16/b)/b)/(b/b(3/2)))26 assuming b is positive. b(-1131) Simplify (w(-2/7)/w)(-22)/(w/(ww1))(-36)(((w/w*0)/w)/ww)(-6)/(w/(w/w(-2/3)w)w(2/11)) assuming w is positive. w(-1439/231) Simplify (m(-4)/m(2/7)m8mm(-1))/((m/m(-1))(2/65)m*7(mmm(-3/2))/m) assuming m is positive. m(-2591/910) Simplify (o/(o(o(-5/4)oo)/o)(o(3/7)/o)/o)(-7/6)/(o*(-2/9)(o/((oo(-6))/oo))/o)(2/9) assuming o is positive. o(311/648) Simplify ((gg(-2/19))/gg*(-4/9)/ggg20ggg*(3/2)g)39 assuming g is positive. g(106483/114) Simplify (((w*(-4/5)/w)/(ww6))/(w1)(1/14))/((w(-5)w(4/5)/w)/(((w/(w/(w(-1)w)))/w)/w)(-32)) assuming w is positive. w(4223/70) Simplify (((((w/w*(-4))/ww)/w)/(w/w(-3/23)))19)(6/25) assuming w is positive. w(7524/575) Simplify (u/((u*(-1/17)/u)/u)uu17u(u(17/2)/u)/(u/u(-9/5)))2 assuming u is positive. u(4549/85) Simplify (zz/(z/(z*(1/7)z)zz)(z/z(-2))/zz)*(-2/77)(zz5z(z(z*(-3)z)/zzz)/zz)/((z/(z/(z/(zz*(1/5))z)))/z(-2/3)) assuming z is positive. z(4007/735) Simplify (z/(zzzz(-26)zzzz))/z(2/17)(zz7)/z37 assuming z is positive. z(-155/17) Simplify ((c(1/4))(-28)/(c(-1))(-1/6))/((c(-1/2))(2/63)/(c5c(-3))) assuming c is positive. c(-649/126) Simplify ((www*(-1/7)w)/(w/(w(-2/17)/w)))(36/7)/((w/(ww/w1))(-2/63)/((w(-1/2)w)/((w/w(-4))/w))) assuming w is positive. w(505/1666) Simplify (f*(-1/5)f/(fff(-1/9)/f))(-19)(f12(f*(-6)/ff)/f)(-2/149) assuming f is positive. f(10874/6705) Simplify u*(12/11)uu/u32(u33)(-4) assuming u is positive. u(-1770/11) Simplify l(2/47)l/((l(18/5)ll)/l)(l*(12/5)/l)/(l(ll(-2))/l) assuming l is positive. l(-272/235) Simplify ((t(-16)t)*(-3/4)(tt(-2/21)/tt)/tt/(t(2/5)/t))(-49) assuming t is positive. t(-37499/60) Simplify (h/(hh*1)h/((h(h/(hhhh/(h/(h*15/h))hhh))/h)/h)hh/((hh(3/5)h)/h)hh/(h*(-1/27)/h)h)(-2/69) assuming h is positive. h(-6598/9315) Simplify (a*1a)15/(a0)*(6/5)(a*(-3)aa(-3/7))/((aa(-1/5))/(a(-2/3)/a)) assuming a is positive. a(2636/105) Simplify (n(3/4)nn(-4)/n)(-1/27)(n2/(nn0))/(n(-4)/n(-2/9)) assuming n is positive. n(529/108) Simplify (g/(g/(gg/g(1/8)g))(((g1/g)/g)/gg)/gg(1/10)g/g*(2/9))/((gg*(2/5)/gg)*42g*(3/2)gg6) assuming g is positive. g(-23597/360) Simplify ((((l/l(-9))/l)/lll(-8)l((lll/l2)/l)35)(-41))13 assuming l is positive. l(-1066) Simplify (h/((hh*16)/h)hh(31/4)(h/(hh25))/(hhh(2/15)h))(-4/11) assuming h is positive. h(2063/165) Simplify (g*(-13)g1)(1/15)((g(2/55)gg)/(gg(1/6)))(-5/7) assuming g is positive. g(-469/330) Simplify ((c/c(-1))(5/3))(-49)(c(-1)/(c/(c(c*8/c)/ccc)c))/(c1/c(-3)) assuming c is positive. c(-484/3) Simplify ((k(-22)/k)*(-24/7)(k/(k/k*(3/8))k)4)(-27) assuming k is positive. k*(-31887/14) Simplify ((h/(hh*(-2/3)hhh))/(hh7h))*(2/65)((h(1/3))(-16/3))(2/39) assuming h is positive. h(-772/1755) Simplify ((d16)(-2/33)/(d/(((d19/d)/d)/d))(-42	{ "pile_set_name": "DM Mathematics" }
ct the terms in -657 + 37g + 657 - 37g + 1249g2. 1249g*2 Collect the terms in -199815o - o*3 - 2 + 2 + 199808o. -o*3 - 7o Collect the terms in -286s2 + 155s*2 + 140s*2 + 10. 9s*2 + 10 Collect the terms in -108818f*2 + 108843f*2 + 0 + 1. 25f*2 + 1 Collect the terms in 985v*2 - 990v*2 + 177v - 172v. -5v*2 + 5v Collect the terms in -449 + 92o2 + 449. 92o*2 Collect the terms in -14958j - 424j + 15378j. -4j Collect the terms in 11j - 13119 - 7j + 3838. 4j - 9281 Collect the terms in -259a + 774a - 265a - 256a. -6a Collect the terms in -69c + 1 - 626c - 228c. -923c + 1 Collect the terms in 57m*2 - 26 + 26 - 441m*2 + 15m*2. -369m*2 Collect the terms in -238715y*3 - 238711y*3 - 238716y*3 + 716141y3. -y3 Collect the terms in 174 - 716 + 178 + 181 + 183 - 12l. -12l Collect the terms in -27 + 9j + 3 + 13 + 11. 9j Collect the terms in 29587 - 29587 - 205k. -205k Collect the terms in -907p3 + 901p*3 + 3p - 3p. -6p*3 Collect the terms in 226 + 267 + 246 + 2v*2 + 231 - 970. 2v*2 Collect the terms in 32248u*2 + 50 - 50. 32248u*2 Collect the terms in 0d + 337d3 + 0d + 471d3. 808d*3 Collect the terms in -32495735 + 4w*3 + 32495735. 4w*3 Collect the terms in -51v - 27v - 326 + 1 + 76v. -2v - 325 Collect the terms in 3y - 353 - 10y - y + 7y - y. -2y - 353 Collect the terms in 51 - 51312o*3 - 51 + 2o*2 + 51354o*3. 42o*3 + 2o*2 Collect the terms in 27v - 2v + 0v + 3v - 17v. 11v Collect the terms in 25s*2 + 2044 + 6s*2 - 2044. 31s*2 Collect the terms in 27r + 90362 - 90362. 27r Collect the terms in -182092r + 182079r + 2 - 2. -13r Collect the terms in 1023w + 166w*3 - 506w - 517w. 166w*3 Collect the terms in -90c + 24c + 5c. -61c Collect the terms in 141889h*3 + 141863h*3 - 283751h3. h3 Collect the terms in 3d3 + 6d + 93d2 - 5d - 2d - 93d*2. 3d*3 - d Collect the terms in 125y*3 - 82y*3 + 92y*3 - 58y + 31y + 27y. 135y3 Collect the terms in 62 + 86 - 28 + 18 - 105r. -105r + 138 Collect the terms in -235t + 1864t + 870t. 2499t Collect the terms in -8w - 9w + 7w - w - 6w. -17w Collect the terms in 191283f - 190910f + 0 + 0. 373f Collect the terms in -17v*3 - 18v*3 - 10v*3 + 46v3. v3 Collect the terms in 98p - 194p - 19p2 + 96p + 9p2 + 9p2. -p2 Collect the terms in 0 + 2533k2 + 0 - 3675k*2. -1142k*2 Collect the terms in 818r*3 - 932r*3 + 759r*3. 645r*3 Collect the terms in 55l + 2l2 + 13l + 2l - 70l. 2l2 Collect the terms in -25 + 62 - f - 20 - 17 - 721f*2. -721f*2 - f Collect the terms in -9k*3 + 2k*2 + 3k - 6k + 3k - 9. -9k3 + 2k*2 - 9 Collect the terms in -211r + 472r - 251r. 10r Collect the terms in 89699 - 2l - 44847 - 44852. -2l Collect the terms in -x + 2 + 2x + x - 9 - 5x. -3x - 7 Collect the terms in -2t2 + 57t - 23t - 57t. -2t2 - 23t Collect the terms in 5573m2 - 1 + 1 - 342m*2 + 1. 5231m*2 + 1 Collect the terms in -723s + 756s + 492s. 525s Collect the terms in 51 + 12y - 47 - 4 + 34y. 46y Collect the terms in -6062t + 12121t + 89t2 - 6059t - 2. 89t2 - 2 Collect the terms in 297f + 14f2 - 27f*2 + 12f2. -f2 + 297f Collect the terms in -2 + 864r*2 + 682r*2 - 1546r*2 + 2 - 3r*3. -3r*3 Collect the terms in 37 - 78 + 41 - 5243z*3. -5243z*3 Collect the terms in 16355z*2 + 507z*3 - 16355z*2 - 259z*3 - 252z*3. -4z*3 Collect the terms in -225z*3 + 463z*3 - 236z*3. 2z*3 Collect the terms in 152l*2 + 145l*2 + 2l*3 - 600l*2 + 149l*2 + 154l*2. 2l*3 Collect the terms in 4f - 5f - 10 - 43f*3 - 4f + 3f. -43f*3 - 2f - 10 Collect the terms in -17299a2 - 17299a*2 + 34602a*2. 4a*2 Collect the terms in 243 + 244 - 748 + 261 - 20x. -20x Collect the terms in f3 + 4f - 4f + 664f*2 - 704f2. f3 - 40f2 Collect the terms in 41361 - 41361 + 12p. 12p Collect the terms in -37c*2 - 61c*2 + 147c*2. 49c*2 Collect the terms in -31u*2 - 23u - 21u - 27u + 71u. -31u*2 Collect the terms in 18n + 28n + 28n + 8n. 82n Collect the terms in -5n - 32n*2 + 14n*2 - 24n*2 - 4n. -42n2 - 9n Collect the terms in 793g - 784g - 2794g. -2785g Collect the terms in -208c2 - 9c*2 + 77c*2. -140c*2 Collect the terms in -43w*2 + 86w + 25w2 + 11w*2 - 86w. -7w2 Collect the terms in -7k - 4k - 282k*3 + 12k - k. -282k3 Collect the terms in 2 + 122v*2 + 89v - 2 + 0 - 126v2. -4v*2 + 89v Collect the terms in 2i3 + 16i*2 + 15i*2 - 19i*2 - 12i*2 + 5i*3. 7i*3 Collect the terms in 305n*2 - 195n*2 + 135n*2 + 179n*2 + 5n. 424n2 + 5n Collect the terms in 5k + 991 - 990 + 6k. 11k + 1 Collect the terms in 125n + 211n + 5 - 6 + 24n. 360n - 1 Collect the terms in -3g + 16018 - 32527 + 16509. -3g Collect the terms in 91f*2 - 4198 + 4198. 91f*2 Collect the terms in 5 + 0 - 5 - 6734d. -6734d Collect the terms in -834g - 861g + 1805g. 110g Collect the terms in -o2 + 71o + 0o2 + 93o + 85o - 249o. -o*2 Collect the terms in 91856q*3 - 11942q*3 + 30222q*3. 110136q*3 Collect the terms in 0r - r - 30265r3 + r. -30265r*3 Collect the terms in -1284 + 1058 + 226 - 2g*3 + 3g3. g3 Collect the terms in -38 + 86 + 168s + 117s - 49. 285s - 1 Collect the terms in -1197s + 9 - 1151s + 2347s. -s + 9 Collect the terms in -4479 + 2240 + 2228 - 3y. -3y - 11 Collect the terms in -2y3 - 15y*2 - 191y - y*3 + 14y*2. -3y3 - y2 - 191y Collect the terms in -460 - 461 + 1379 + 4n - 468. 4n - 10 Collect the terms in -27z3 + z3 + 18z3 + 19z*3. 11z*3 Collect the terms in 19j - 5 + 15 + 0. 19j + 10 Collect the terms in -34u + 4u + 13u - 1 + 1. -17u Collect the terms in 0 - 15d - 492d2 - 101d*2 - 1 + 4d. -593d2 - 11d - 1 Collect the terms in -938g - 1101g + 1822g. -217g Collect the terms in 56a + 1 - 19a*2 - 56a - 201a2 - 4a*3. -4a*3 - 220a*2 + 1 Collect the terms in 41l*2 + 8l - 4l - 18l - 44l2 + 2l. -3l2 - 12l Collect the terms in 315m3 + 299m*3 - 644m*3. -30m*3 Collect the terms in -34w*2 + 12w*2 - 9w*2 + 66w*2. 35w*2 Collect the terms in -7 + 7 - 7 + 17u + 7. 17u Collect the terms in 402z*2 + 194z*2 + 491z*2. 1087z*2 Collect the terms in 44v - 210v + 45v + 53v + 69v. v Collect the terms in 2 - 36d + 64d + 52d + 12d. 92d + 2 Collect the terms in -1054k + 0 + 0. -1054k Collect the terms in 16p*2 - 24p + 2p2 + 24p + p2 + p2. 20p2 Collect the terms in 711f - 414f - 288f. 9f Collect the terms in -52x*2 - 55x*2 - 47x*2 + 205x*2 - 57x*2. -6x*2 Collect the terms in 15f + 0f - 8f - 17f2 - 7f. -17f2 Collect the terms in -24534370f + 8f3 + 24534370f. 8f3 Collect the terms in 331n*3 + 327n*3 + 330n*3 - 986n*3. 2n*3 Collect the terms in -9k + k + 24k + 26k. 42k Collect the terms in -3 - 1165f - 9 + 12 + 1100f. -65f Collect the terms in 3969j2 + 3970j*2 + 4 + 3964j*2 + 3963j*2 - 15870j*2. -4j*2 + 4 Collect the terms in 503d*2 - 130d*2 - 172d*2 - 117d*2. 84d*2 Collect the terms in 4g - 5g - 10g + 9g - 11g - 3. -13g - 3 Collect the terms in 90025 + 3d - 90025 + 0d - d. 2d Collect the terms in -2w - 4 - 21 + 3w + 18. w - 7 Collect the terms in -848c3 + 6274c*3 + 758c*3. 6184c*3 Collect the terms in 3 - 2d*3 - 130509d + 130509d. -2d*3 + 3 Collect the terms in 99744l*2 - 5025l + 5025l - 99746l*2. -2l*2 Collect the terms in 4f*2 - 1248f - 1149f + 2397f. 4f2 Collect the terms in -49k - 367k - 145k. -561k Collect the terms in 11h + 12h - 5573 - 11h. 12h - 5573 Collect the terms in -3y*2 - 98 + 4y + 65 - 4y. -3y*2 - 33 Collect the terms in 111m - 4m2 + 109m - 4m2 - 218m. -8m2 + 2m Collect the terms in 133 - 6g + 122 - 38. -6g + 217 Collect the terms in -68y + 3884y*3 + 68y. 3884y3 Collect the terms in 183 + 192z*2 - 183 - 124z*2. 68z*2 Collect the terms in 20g + 9 - 9 - 30g. -10g Collect the terms in 3003j3 - 6041j*3 - 3j*2 + 3040j*	{ "pile_set_name": "DM Mathematics" }
5 Suppose 61b - 1993 - 613 = 871. Solve 0 = 8t + 5u + b, -7 = -5u - 32 for t. -4 Let i = -4810 - -4838. Solve n - 4m - 8 = 3n, -3n + i = -4m for n. 4 Suppose -u - 5p = -38, 3u - 3p = p + 19. Suppose 9j + uj = 44. Solve d + v = -d - 5, -4v = jd + 2 for d. -3 Suppose 25 - 69 = -4u - 4p, -5p - 64 = -2u. Solve 14t = ut - 2d + 11, 0 = d + 2 for t. -5 Let n be (-66 + 67)/((-2)/(-8)). Suppose -2d = 2d + d. Solve 0 = -3i - na - 0a, -i + 5a = d for i. 0 Suppose 15z + 4a + 15 = 16z, -z + 15 = 4a. Solve -4q - z = -33h + 38h, -3h = -3q - 18 for h. 1 Let x = -34 + 70. Let u = -34 + x. Let s = -31 - -43. Solve -s = -3p - 0, 18 = -uk + 3p for k. -3 Suppose -2 = -2u, 5i = 9i + 5u - 41. Suppose -49 = -ik - 4. Solve -4o = 4c - 2 - 2, kc - 5o = -45 for c. -4 Let o(q) = q2 + 14q + 40. Let p = 266 - 276. Let r be o(p). Solve -2i - 26 = -4d, -i + 2d - 4d + 7 = r for i. -3 Let g be (-2)/4 + 2134/44. Let d = g - 46. Solve h - 2u - 5 = -2, -d = -2h + 3u for h. -5 Let r(b) = -6b - 53. Let d be r(-17). Let c = d - 14. Solve -t + 4t = 3m + 30, -2t = -5m - c for m. -5 Let x(z) = -9z2 - 2z + 9. Let r be 7/44 + (-3)/1. Let j be x(r). Let i = j + 145. Solve -2t + 7t - g = -10, 0 = -ig for t. -2 Let i(s) be the third derivative of 2s5/15 + 3s*4/8 - 17s*3/6 - 90s*2 + s. Let m be i(2). Solve p = -5l + 10 - m, 3 = 3l - 5p for l. -4 Let f(p) = 74p + 25 + 32p2 + p3 - 12p2 - 34. Let t be f(-15). Solve 0 = 3c + 5u + 10, -c = -tc - u - 24 for c. -5 Let m = -18406 - -18406. Let u be (-6)/(-8)40/15. Solve 0 = 2j + 3p - 8, m = -up + 4 for j. 1 Let j(d) = d*3 + 4d*2 + 22. Let x be j(-10). Let b = -575 - x. Solve -3a + 2o = -7, -a = ba + 4o - 16 for a. 3 Let b(r) = 2r*2 - 12. Let h be b(3). Suppose hp + 8 = 8p. Solve -5l = -20, pn = -2l - l + 24 for n. 3 Let c be ((-42)/(-77))/((-315)/1782 + 4/18). Solve 2p + c = -5q - 4, -2p = -3q - 16 for p. 2 Suppose -2i - 24 = 2k, 8i + 8940k - 2 = 8939k. Suppose 0 = 5p - 5r, -9 = p - 3r + 1. Solve 3t + q = 4q + 3, iq = pt - 2 for t. 0 Suppose 29s + 45s = -17s + 182. Solve 2t + 14 = -sq, 0 = 9t - 14t + 2q for t. -2 Let w(m) = -6m3 - 4m*2 - 12m + 34. Let o be w(3). Let l = -195 - o. Solve -3q = -2y - 15 + l, -4y = -2q + 4 for y. 1 Suppose -2l + 2f = -61 - 9, 2l - 49 = -5f. Suppose 6i - 10i - l = 0. Let w = i - -21. Solve 2j = g - 2j + 21, 5g + 3j = -w for g. -5 Let x(i) = -6i - 225. Let t be x(-38). Solve -3z + 7n = tn - 10, 18 = z - 5n for z. -2 Suppose -s = 4q + 10, 3q + 0 = -2s + 5. Let d = 6 - 3. Suppose s = 2j + dj, r = -3j + 10. Solve 5b = 3o + 3b, rb + 12 = 0 for o. -2 Let l(q) = -q3 - 110q*2 - 89q + 2183. Let f be l(-109). Solve -a = fz + 16 - 33, -2a - 6 = -2z for a. 2 Suppose -8 = 2d + 2a, -4d + a + 8 - 24 = 0. Let x be -62d/24-3. Let i be x/(-7) - (-57)/(-133). Solve g - 5g + 4z - 16 = 0, -ig = 3z - 5 for g. -1 Suppose -4q - 3w = -23, -q + 3w + 33 = 2q. Suppose -2c + 11 = 5. Suppose r = -c + 6. Solve ri - q = -t, 28 = -4t + 2i + i for t. -4 Let f(o) = -o*3 + 15o*2 - 6o + 91. Let i be f(15). Solve 0 = 5v + 4w - 11, -4v - i = 2w - 5 for v. -1 Let q(w) = 17w3 - 255w*2 + w - 2. Let b be q(15). Solve -8x + 5y - 25 = -bx, 0 = 5x + 2y - 22 for x. 4 Let w = -366 - -231. Let k be (-6)/8 + (0 - w/4). Suppose 5s - 48 = -k. Solve 5j = 3o + 11, 0 = -5o - sj + j - 8 for o. -2 Let r = -4510 + 4510. Solve -2b + 72p = 74p, r = -p + 4 for b. -4 Let z(v) = -v*3 + 8v*2 + 22v - 16. Let c be z(10). Suppose t = -ct. Suppose t = -4b - 0b. Solve 5r + 4i = -br + 21, -i = -4r + 21 for r. 5 Let p be (392/8 - 1)-2. Let g be 4 - p/216(-18)/4. Solve 0 = 5t + ga + 8, t - a = -3a for t. -2 Let u be 101042/700. Solve 3q - 16 = 5k, k + 12q - u = 8q for k. -2 Let y(r) = -r*3 + 3r2 - 3 + 3 + r2. Suppose -9 = v - h - 10, 2h = -3v + 18. Let b be y(v). Solve 0 = -4c + 5f + 2, b = -c - 0c + f for c. -2 Let b = -160 + 281. Let a = b + -121. Solve a = 4h - 2h + 4c - 2, -2h - 3c = -4 for h. 5 Let u(z) = -61z + 5075. Let h be u(83). Solve s - h = 3t + 3, 5t = -20 for s. 3 Let o be 71/15 + 8/30. Solve -5v + 2g + 2 + 3 = 0, 0 = 5v + 3g - o for v. 1 Let k(z) be the third derivative of -z5/20 - 21z4/8 + z3/2 + 33z2. Let x be k(-21). Solve -3j = xl, l = -j - j - 1 for l. 1 Let c be (-91)/2-2618/1638. Solve 23 = 2z + c, -2n + 4z = 18 for n. 1 Let n be 348/22/6. Let o = n + -58. Solve o = 2c, -3c = 3l - c + 15 for l. -5 Let w = -18 + 28. Let z be 25/28/w. Solve -4h - 12 = -2d, 0 = 5d - 0d + z for h. -4 Suppose 3v - 8v = 7v - 24. Solve 4r - 22 = vh, 3h = 4r - 29 + 2 for h. -5 Let t(q) = -2q + 56. Let s be t(24). Let w(l) = 26l - l*3 + 7 - 2l*2 - sl - 9l. Let f be w(-4). Solve 2o - 8 = -y, -2o = -2y + f + 1 for y. 4 Let y = -8 - -10. Suppose -yx + 11x - 90 = 0. Let s be 2/x - 4/(-5). Solve -1 = -d - 3m + s, 0 = m - 1 for d. -1 Suppose 5 = 5z, -4z - 23 = -3x + 24. Suppose -3y + x = -1. Suppose 0 = -yb + 4b + 10. Solve 17 = 4l + bi, -l - 3l = -3i - 9 for l. 3 Suppose 2n + 7 = -t + 19, -5t - 3n + 18 = 0. Solve -3h + 13j = 17j - 23, t = -5j + 10 for h. 5 Suppose 2l = 41 + 3. Suppose lp - 26p = -4. Let y be (0 - (-4 + 1))p + 2. Solve -yk + 2v + 20 = -5, 17 = -k - 4v for k. 3 Let o(g) = -g2 - 43g - 118. Let r be o(-51). Let a = r + 528. Solve ad - 2x = -4, 4x - 7 - 1 = d for d. 0 Suppose -43b + 107 + 22 = 0. Let p be (-1)/(30/(-12) + b) - -5. Solve q = 3z - 6 - 0, pz - 24 = -5q for z. 3 Let z = -13538 - -13540. Solve 7 = -g - zv, -11g = -9g - 3v + 7 for g. -5 Suppose 143 = 5y + 933. Let k = 162 + y. Suppose 5b = 8b - 84. Solve 3w + 3s = -w - 8, -kw + 2s = b for w. -5 Suppose 0 = -118b - 77b + 435 + 345. Solve -5v + 3z = -8, -5v + 4v - 26 = bz for v. -2 Let x = 179 + -215. Let t be ((-4)/9)/(8/x). Solve -l = 2r - 6, 4l = r - tr + 3 for l. 0 Let p = 5 - 3. Suppose 1056 = -f - 2f - 2c, 702 = -2f - 2c. Let a = -350 - f. Solve w - j = -a + p, -6 = 3j for w. -4 Let s(b) = -b + 10. Let a(w) = -1. Let r(g) = -3a(g) - s(g). Let m be (7/1 - -1) + -1. Let q be r(m). Solve i + 5n - 18 - 10 = q, 4i = -2n + 22 for i. 3 Suppose 5o + 165 = 5n, 2n + 2o = -17 + 71. Let h be 13 - 20/14063. Solve 2k - 5x = n, 5k - hx = -x + 37 for k. 5 Suppose -14h - 10h + 30 = -42. Solve -5x - 21 = hv - 4, 4x = 2v + 4 for v. -4 Let y be 15 - (8/2 - 4)/1. Suppose y - 6 = j. Solve 3w + 4b = 13, w - b + j = -4w for w. -1 Let q(c) = c2 + 7c + 10. Let l be q(-7). Suppose -52a - 44940 = -24a. Let b = 1608 + a. Solve 4 = 3v - 2v - bd, 5v - 5d - l = 0 for v. 1 Let q = 2 - 0. Let f be (5/(-4))/(19/(-76)). Suppose ql = fi, -i = l + l. Solve 2o - 3x + 21 = -io, -o = 2x - 7 for o. -3 Suppose 3k + 32 = 6k + a, -44 = -3k + 2a. Let q be k - (-2 + 6 + -8). Let v = q - 12. Solve -vf - 8 = 0, 3 = -6p + 3p - 3f for p. 1 Let y = 6425 - 6417. Solve 6 = m + 2n + 7, 4n = 4m - y for m. 1 Let s(y) = 6y2 + 5y + 6. Let k be s(-1). Suppose -16 = -kl + 12. Solve 3c - z = 2, c = -2c + lz + 17 for c. -1 Suppose 5w = -4c + 29, 4c = -5w + 10w - 21. Solve -o - 1 = 3x + c, -4x - 3 = o for x. -1 Let s(i) = i2 + 3i - 16. Let t be s(4). Let y be t1 - 6/3. Let r = 10 - 6. Solve 5z = p - y, -r = -2p + 5z - 3z for p. 0 Suppose -1232 = 237f - 5498. Solve -6z + 5z = -5s + f, 5s + 2z = 24 for s. 4 Suppose -11595a = -11621a + 156. Solve 4t + d - 17 = 0, t + d - a = -d for t. 4 Let r be (-9)/(-5) - (-132)/110. Solve -3l = 4d + 7 + 5, -d - r = l for d. -3 Let t(v) = -v*3 + 30v*2 + 93v + 203. Let p be t(33). Solve 51c = po + 50c + 38, 0 = 5c + 10 for o. -8 Suppose -21l + 16 = -236. Suppose -8q - 12 = -lq + c, c = -2q + 6. Suppose -2 = -3j + 2j. Solve -qo + 4 = -7o, 2i + 2o - j = 0 for i. 2 Let m(l) = 3l + 50. Let h be m(-15). Solve 0 = -d + 3b - 5, -10d + hb + 1 = -13d for d. -2 Let d = -6599 + 6599. Let m(h) = -2h - 3. Suppose -12 = 4p - 2u, 5p = -u + 4u - 14. Let x be m(p). Solve 4l = -a - 8, d = xl - l + 8 for a. 0 Let s(q) = q2 + q - 4. Let z = -16 - -11. Let o(b) = -b2 - 5*b - 3. Let a be o(	{ "pile_set_name": "DM Mathematics" }
4)2. -1824sqrt(13) + 675808 Simplify ((sqrt(306) - (sqrt(306) + -4sqrt(306)-2 - sqrt(306)))/(sqrt(6) - sqrt(726)-1))/(-1(sqrt(363)-1 + sqrt(363)) + 2sqrt(363)-4). 7sqrt(17)/1056 Simplify (5 + (1 + -3 + -1sqrt(1573) - (-1 + sqrt(1573) + -5 + 3)) + 0)2-2. -12656 + 528sqrt(13) Simplify 3 + (sqrt(70)/((sqrt(10) + sqrt(640))1)-2 - (sqrt(252)2 + (sqrt(7) - (-2 + sqrt(63)))))*2. 368sqrt(7)/9 + 59815/81 Simplify 2((sqrt(128) - (-52sqrt(128) + sqrt(128))2) + (-5(2 + sqrt(128)) - sqrt(128))*2)4-2. -15488sqrt(2) + 90560 Simplify (sqrt(77) + sqrt(77)-1-2 + -5sqrt(77)2)/(-2(sqrt(11) - sqrt(99)/(sqrt(9) - (sqrt(9) + 1sqrt(9))) - sqrt(110)/(sqrt(10)2 + sqrt(10)))). 21sqrt(7)/10 Simplify (3 + (sqrt(8)/sqrt(4))*2 - (-1 + sqrt(2) + 2)) + -3 - ((4sqrt(600))/sqrt(12) + -5). -21sqrt(2) + 6 Simplify ((3sqrt(539) + 0)6 - (-2 + (sqrt(11) - (-2 + sqrt(11))) + sqrt(11) - sqrt(22)/(1sqrt(2)))-6)2. 174636 Simplify (sqrt(175)/((sqrt(15) + sqrt(1215))/sqrt(3) - sqrt(5) - sqrt(5)))/(-3sqrt(180)6). -sqrt(7)/864 Simplify ((-2 + sqrt(704) + 3)1 + sqrt(704)-2 + 2 + sqrt(704)-2 + -5 + 2)*2 + -1. 6335 Simplify 5 + 6(sqrt(84)/(-1sqrt(567)))/(sqrt(8)/(sqrt(242) + sqrt(242)-1 + sqrt(242))). -22sqrt(3)/3 + 5 Simplify -3 + (-32sqrt(18) + sqrt(18) - (-2sqrt(2178) + sqrt(2178))) - ((sqrt(144) - (1sqrt(144) - sqrt(144)))3 - sqrt(144))/(-1sqrt(8)2). -3 + 21sqrt(2) Simplify (sqrt(18)/sqrt(3)-1 - sqrt(6))/((2sqrt(12))/sqrt(4)) + -2((sqrt(8))2 + 2 + (sqrt(2) + (-1 + sqrt(2) - sqrt(2))2)5). -30 - 11sqrt(2) Simplify (2 + 41(1sqrt(245) + 1 + (sqrt(245) - -1sqrt(245)-1 - sqrt(245)))2)*2. 100 Simplify 2 + (-3(sqrt(3500) - (sqrt(3500) + sqrt(3500)2)))/(sqrt(7)-23-2)-6. -30sqrt(5) + 2 Simplify ((2(sqrt(242)/sqrt(11)-4 - sqrt(22)))/(sqrt(54)/(sqrt(3) + sqrt(75)))1)2. 4400 Simplify (((1sqrt(108)3)/((sqrt(729) + 1sqrt(729) + sqrt(729) - sqrt(729)) + sqrt(729)))/(-6(sqrt(28)/(sqrt(28) - sqrt(7)) + sqrt(4))4))*2. 1/62208 Simplify ((-4(sqrt(156) - sqrt(156)1) + -4-1sqrt(156))/(sqrt(36)/sqrt(3)-2 + sqrt(12) - (sqrt(108)2 + sqrt(108))/sqrt(9)))25 + -2. 63 Simplify (6(sqrt(38) - sqrt(190)/sqrt(5)) + 4sqrt(190)/sqrt(5))/((-3sqrt(96)/sqrt(4))/(sqrt(12)2-2)). 16sqrt(19)/3 Simplify ((-2 + sqrt(1900) + -1)-6 - ((sqrt(19) - (sqrt(1539) - (-1 + sqrt(1539)))2) + (sqrt(342) + sqrt(38))/sqrt(2) + 2))5. -325sqrt(19) + 85 Simplify ((sqrt(19) + sqrt(76)-2 + 41sqrt(19) - (sqrt(2736)-1 + 4 + sqrt(2736) + 1 + 4)) + -3)2. -24sqrt(19) + 163 Simplify (2(2sqrt(162) + -4 - sqrt(162))4)2 + 6-2((-1 + 1sqrt(242))*2 - sqrt(242)). -4212sqrt(2) + 8476 Simplify ((2sqrt(250)-4 + 5((sqrt(250) - 1sqrt(250)) + sqrt(250)))/((sqrt(660)/(sqrt(44)/sqrt(4)))/sqrt(12)))*2. 450 Simplify 5(2sqrt(117)-24)/(-6(sqrt(9) + (sqrt(9) - -2sqrt(225)) - sqrt(9))). 40sqrt(13)/33 Simplify 2(2 + (sqrt(1377) - (sqrt(1377) - (sqrt(1377) - -3sqrt(1377))))*23) + (-4 + sqrt(1377)-1)-42. 72sqrt(17) + 132228 Simplify ((sqrt(176) - (sqrt(176) - (sqrt(176) - -1sqrt(176))) - sqrt(176))5 - sqrt(176) - sqrt(176))/(-1(4sqrt(64) + sqrt(4))) + 0. -6sqrt(11)/17 Simplify (1 + (sqrt(1100) - (-2 + sqrt(1100)3 - sqrt(1100))) - 65sqrt(1100)-3)2. 5340sqrt(11) + 8713109 Simplify (-2(3(1 + sqrt(1100) + sqrt(1100) + -3(sqrt(1100) + 0)) - (-1-2(sqrt(1100) + 1) + 2)))2. 400sqrt(11) + 110004 Simplify (3(3 + (sqrt(1200) - (1 + sqrt(1200) + (sqrt(1200)-1 - sqrt(1200)) + sqrt(1200)) - ((sqrt(1200) - sqrt(1200)2) + -4)))-3)*2. 38880sqrt(3) + 391716 Simplify 4 + (-2sqrt(3328)3-1)/(-2((sqrt(4) + sqrt(36))1 - (sqrt(4) - sqrt(8)/(sqrt(2)2)))). -48sqrt(13)/7 + 4 Simplify (sqrt(1800) + 5sqrt(1800)-4)/(-1(-3sqrt(384) + sqrt(384))). -95sqrt(3)/8 Simplify ((sqrt(120)-2-3)/(sqrt(10)/sqrt(20)))/((sqrt(24) + sqrt(48)/sqrt(2))/sqrt(2) - 2sqrt(768)) + -3. -3 - 6sqrt(5)/7 Simplify sqrt(12)/(-1sqrt(42)/sqrt(7)) + 5 + ((sqrt(2) + -3)-2 - (sqrt(176)/sqrt(8))/sqrt(11)). -4sqrt(2) + 11 Simplify (6sqrt(171)2 - -3(-1sqrt(171) + sqrt(171)))/(((sqrt(45)2)/sqrt(5) + sqrt(18)/sqrt(2)3)3) + 5. 4sqrt(19)/5 + 5 Simplify (sqrt(360)3)/(((sqrt(55)3 + sqrt(55))/sqrt(11) - sqrt(5))3). 2sqrt(2) Simplify (-2sqrt(300))*2 - ((-1 + sqrt(3))6 + sqrt(3)) - ((sqrt(432) + 1)3 - 2((sqrt(432) + sqrt(432)1)2 + sqrt(432))). -19sqrt(3) + 4659 Simplify ((4sqrt(880) + sqrt(55))/sqrt(11) + ((sqrt(245) + 2)2 - (sqrt(5)2 + -4)*2) + -2)6. 366sqrt(5) + 1266 Simplify (-5-5((sqrt(11) + sqrt(539) + -1)-6 + sqrt(396)/sqrt(4) + 5)-3)2. -5568750sqrt(11) + 125977500 Simplify -3(5-3(0 + (-1 + sqrt(1331) - sqrt(1331)) + sqrt(1331))6)*2-6. -3207600sqrt(11) + 194205600 Simplify 2(-6(sqrt(76) - -1-2sqrt(76))-4)/(1(sqrt(972)-2)/sqrt(3)). 8sqrt(19)/3 Simplify (sqrt(38) - (sqrt(38) - 5(sqrt(38) - (sqrt(38) + sqrt(950)))))/sqrt(72) + -3 + (sqrt(304) + -1)*2 + -5 + -1. -73sqrt(19)/6 + 296 Simplify 4((6-2sqrt(147) + 2(sqrt(147) + -1 - sqrt(147)) + 4)*2 + -5) + 5. -1344sqrt(3) + 84673 Simplify (sqrt(60)/(sqrt(6)/sqrt(2)) - (sqrt(20) + sqrt(20) + sqrt(140)/(sqrt(7)-4)))/(-6sqrt(8)/sqrt(2) - 1sqrt(4)2). 3sqrt(5)/32 Simplify -6(sqrt(60)-2)/sqrt(12)-1 + ((1sqrt(80))/sqrt(8))/(sqrt(20)/(-1sqrt(10))). -13sqrt(5) Simplify 2 + (sqrt(196) - -33sqrt(196))/((1sqrt(90) + sqrt(10))/sqrt(5)). 2 + 35sqrt(2)/2 Simplify ((sqrt(234)-25)/(-3sqrt(36)))/((5(sqrt(4) + (sqrt(4)2 - sqrt(4))))/(sqrt(200)/sqrt(4))). 5sqrt(13)/6 Simplify (3(sqrt(102)2 + sqrt(102) - sqrt(102)))/(sqrt(54)/(-1sqrt(9))) - (((sqrt(17) + 5)4 - sqrt(17)) + (sqrt(2057) + -3)2). -2086 + 57sqrt(17) Simplify 0 + ((-1-2sqrt(132))/(sqrt(3) - 3(sqrt(3) + -1sqrt(3))))/(((sqrt(324)-1)/sqrt(9))/(sqrt(144)1)). -8sqrt(11) Simplify 3(2 + (sqrt(162) + (sqrt(162) + sqrt(162)-2)1 + sqrt(162) - (-1 + sqrt(162))5))2-35. -118845 + 22680sqrt(2) Simplify (((sqrt(80)-1 - sqrt(5)) + sqrt(5) + 3)6 - (-4 + sqrt(5)-1 - (-3 + sqrt(5) + 3)))2 + -5. -968sqrt(5) + 2899 Simplify ((sqrt(70) + sqrt(70)-2)2 - (sqrt(70) + sqrt(70)1 + sqrt(70))6)/(sqrt(120)/(sqrt(12) + 3sqrt(12)) + sqrt(10) - sqrt(490)-1). -80sqrt(7)/33 Simplify (-5(sqrt(300) + -4 + sqrt(300) + 1))*2 + -2 + ((3 + sqrt(363) + sqrt(363)-5)*2 + sqrt(363) - sqrt(363)). -3264sqrt(3) + 36040 Simplify -2 + sqrt(98) + -1 + (4(sqrt(98) - (sqrt(98) - (3 + sqrt(98)))) + sqrt(98))2 + 3(-2 + -3 + sqrt(98))6. 973sqrt(2) + 2501 Simplify (-1 + sqrt(448) + 2 + sqrt(448) + (sqrt(448) + -3)5 + sqrt(448) + sqrt(448))2 - (sqrt(448)53 - (4 + sqrt(448)-6)*2). -2520sqrt(7) + 52628 Simplify (sqrt(28) - (sqrt(28) + 0)1 - ((sqrt(7) - sqrt(28)/(sqrt(4)1)) + sqrt(14)/sqrt(18))) + ((-5 + (2sqrt(567) - sqrt(567)) + -5)-2)*2. -2161sqrt(7)/3 + 2668 Simplify -2(-5 + sqrt(252)/sqrt(9)) + 4 + sqrt(7) + sqrt(7) + (sqrt(343)-1)2 + ((sqrt(49)/(sqrt(28)/sqrt(4)))2 - sqrt(7)). -3sqrt(7) + 364 Simplify (-5(2 + -45sqrt(1872))2-1)*2. -96000sqrt(13) + 74880400 Simplify 5(((6sqrt(66)1-2)/(-2sqrt(864) - sqrt(18)/sqrt(3)-6))*2 + -4). 40/9 Simplify (6((-6-1sqrt(152) - sqrt(152)) + sqrt(152) - -2(2sqrt(152) - sqrt(152))))/((-3(sqrt(96) + sqrt(96)-2) + sqrt(96))/(6(sqrt(12) + 1sqrt(12)))). 144sqrt(19) Simplify ((0 + sqrt(175) + -5)-2 + -1sqrt(175) + -5 + (sqrt(175) - -2(sqrt(175) + 2)))*2. 81 Simplify 62sqrt(539) + -3 + sqrt(11)-13 + (0 + sqrt(1331) + sqrt(1331) + -1 - (2sqrt(77)-2 + sqrt(77))/sqrt(7))2. 31sqrt(11) + 6873 Simplify -1 + 1sqrt(448)-2-2 + sqrt(448) + sqrt(448) + -5(sqrt(448) + 2) + -1. -12 + 8sqrt(7) Simplify (-1 + sqrt(140)/sqrt(5))1 - 3(sqrt(567) - 5(-2 + sqrt(567))). -31 + 110sqrt(7) Simplify -2 + (sqrt(84)/sqrt(48) - (sqrt(112) + 4sqrt(112)) - (sqrt(70)/(sqrt(10) - -2sqrt(10)) - (sqrt(7) - (sqrt(847) + -5)))). -179sqrt(7)/6 + 3 Simplify (sqrt(65)2-4 - 2sqrt(65)2)/(1(4sqrt(180) - sqrt(180))) + 1. -2sqrt(13)/3 + 1 Simplify (-3((-2sqrt(144) + sqrt(144))/sqrt(4) - sqrt(324)/sqrt(81)))/(-6(sqrt(12) - (sqrt(768) - sqrt(12))) - -3((sqrt(108) - sqrt(12)) + sqrt(12))). 4sqrt(3)/45 Simplify 3 + 2((sqrt(475)4 + -5 - sqrt(475) - (3-1sqrt(475) + sqrt(475))) + -2)*2. -700sqrt(19) + 23851 Simplify 0 + (3*(-2 + sqr	{ "pile_set_name": "DM Mathematics" }
l). 2l + 2 Let q(a) = a3 - 4a*2 + 4a - 6. Let m(c) = 9c2 - 4c*3 - 9c + 5 + 2c3 + 8. What is 4m(b) + 9q(b)? b3 - 2 Let n(i) be the third derivative of i4/24 - i3/6 + 2i*2. Let d(g) = g. What is -d(c) - n(c)? -2c + 1 Let i(l) be the first derivative of l*2/2 + l + 15. Let a(y) = 3y*2 - 4y - 4. Calculate -a(h) - 4i(h). -3h*2 Let a(w) = -w. Let c(d) = 1. What is a(x) + 3c(x)? -x + 3 Let k(h) = -4h + 1. Let u(w) = -4w + 2. What is 3k(n) - 2u(n)? -4n - 1 Let r = 28 + -19. Let y = r - 5. Let z(k) be the third derivative of k4/3 + 11k3/6 + k2. Let f(c) = 3c + 4. Determine yz(l) - 11f(l). -l Let v(y) = y. Let x(h) = 1 - 7h - 1 + h. Calculate -14v(g) - 2x(g). -2g Let w(x) = x2 + 1. Let q(l) = 6l*2 - 4l + 7. Calculate q(a) - 5w(a). a2 - 4a + 2 Let h = -31 + 21. Let q(t) = -7t3 - 3t*2 - 5. Let s(l) = 3l3 + l2 + 2. Give hs(n) - 4q(n). -2n3 + 2n*2 Let o(r) = -2r + 1. Let g(b) = -b. Let j be -7(8/7 + -2). Let a be j/(-3)3/(-2). Suppose 4f = aq + 14, 5f - q - q = 14. Determine fo(d) - 5g(d). d + 2 Let x(b) = 8b + 4. Let v(w) = -w + 1. Let m(p) = -3v(p) - x(p). Suppose -2 = -l - 13. Let k(r) = 9r + 13. What is lm(y) - 6k(y)? y - 1 Let v(r) = -14r + 1. Let m(l) = 71l - 6. Calculate -2m(k) - 11v(k). 12k + 1 Let p(q) = 19q + 1. Let g(r) = 58r + 3. Determine -2g(v) + 7p(v). 17v + 1 Let m(d) = -3d. Suppose 0 = 3i + f - 2f - 14, 2i - 8 = 2f. Suppose -5j = io + 30, -2o = 2o + j + 21. Let z(g) = -g2 - 5g. Give om(c) + 3z(c). -3c2 Let f(v) = -9v*2 + 3v - 3. Let h(b) = 23b2 - 11b + 11. Let k(o) = -116o2 + 54o - 54. Let m(x) = -14h(x) - 3k(x). Give -8f(c) - 3m(c). -6c2 Let n(l) = 4l*2 - 2. Let f(h) = 4h*2 + 0 - 4 + 1. Let o(v) = -2f(v) + 3n(v). Let q(w) = -9w*2. Determine -5o(d) - 2q(d). -2d*2 Let v(s) be the third derivative of 5s*4/24 + 5s*3/6 - 37s*2. Let i be (0 - 0) + -23. Let y(l) = l + 1. Determine iy(b) + v(b). -b - 1 Let x(d) = 2d*3 + 4d*2 + 7d + 1. Let c(u) = 2u3 + 4u*2 + 8u + 1. Determine 5c(h) - 6x(h). -2h3 - 4h*2 - 2h - 1 Let b(l) = 5l2 + l + 2. Let a(j) = 12j*2 + 3j + 11. Let t(p) = 4p2 + p + 4. Let v(c) = -3a(c) + 8t(c). Give 3b(k) + 4v(k). -k2 - k + 2 Let k(s) = -9s + 5. Let d(t) = 8t - 4. Calculate -4d(c) - 3k(c). -5c + 1 Let u be (4/6)/((-2)/3). Let l(f) = -f3 + f2 + 1. Let k(t) = -5t3 + 2t*2 - 2t + 3. Determine uk(g) + 3l(g). 2g3 + g2 + 2g Suppose 3s = 5s - t - 4, -3s + t + 5 = 0. Let j(k) = k3 + 1. Let u(y) = 3y*3 + 4. Give su(o) - 4j(o). -o3 Let n(p) = -7p*3 + 9p*2 - p + 5. Let h(g) = -4g + 4g3 + 3g + 2g - 5g*2 - 3. Determine 5h(s) + 3n(s). -s3 + 2s*2 + 2s Let x(w) = 4. Let r(v) be the second derivative of -v*3/6 + 9v*2/2 - 9v. Determine -2r(l) + 5x(l). 2l + 2 Let z(y) = 7y - 2. Let r(x) = -15x + 4. Let h be 6 - 5 - -313. Let o be h/(-16) + (-2)/16. What is or(l) - 13z(l)? -l + 2 Let j(g) = 3g3 + 5g*2 - 5g - 4. Let f(l) = 4l3 + 4l*2 - 4l - 3. Calculate 5f(c) - 4j(c). 8c3 + 1 Let x(d) = d3 - 3d*2 + 6d + 5. Let o(m) = 3m3 - 7m*2 + 13m + 11. Give 3o(i) - 7x(i). 2i3 - 3i - 2 Let l(t) = -4. Let o(k) = -3k + 14. Let c(r) = -4l(r) - o(r). Let j(y) = 2y + 1 - 3y - 2. Calculate -2c(z) - 4j(z). -2z Let m = 3 + -1. Let u be m - (-1 + (2 - 4)). Let f(t) = t2 + 3. Let c(g) = g2 + 5. What is uf(j) - 3c(j)? 2j*2 Let w(f) = -5f + 4. Let x(l) = 4l - 3. Let c(j) = 6j + 2j2 - 4j*2 - 6j2 + 7 + j3. Let h be c(7). Suppose 5 = -hr + r. Calculate rw(y) + 6x(y). -y + 2 Let k(c) = -c2 + 3c. Let i = 5 + -14. Let m(n) be the first derivative of 5n3/3 - 13n*2/2 - 50. Determine ik(h) - 2m(h). -h2 - h Let q(z) = 1. Let w(f) = -2f*2 - 2f - 6. Let g = -4 + 0. Determine gq(p) - w(p). 2p*2 + 2p + 2 Let g(x) = 8x2 + 14x - 10. Let v(a) = -a*2 - a + 1. Give -g(c) - 10v(c). 2c2 - 4c Let n(y) = -4y2 + 13y. Let f(w) = -w*2 + 4w. Let k be (-24)/(-84) + 47/7. Give kf(z) - 2n(z). z*2 + 2z Let r(u) = -2u + 4. Suppose -5v = f - 6 - 19, -4f + 8 = -3v. Let h(l) = -8. Let c(p) = -p + 23. Let a(t) = 3c(t) + 8h(t). Give fr(k) - 4a(k). 2k Let q(y) = y3 + 3y2 + 5. Let w(d) = d3 + 4d2 + 4. What is -4q(p) + 5w(p)? p3 + 8p*2 Let c(j) = -25j + 1. Let p(w) = -74w + 4. What is -7c(r) + 2p(r)? 27r + 1 Let x(v) = -17v - 14. Let l(u) = -11u - 9. Let a = -92 + 97. What is ax(g) - 8l(g)? 3g + 2 Let k(u) = 2u - 14. Let g(n) = 5n - 29. Calculate -3g(w) + 7k(w). -w - 11 Let o(i) = 74i*3 - 8i*2 - 8i - 8. Let x(w) = -25w3 + 3w*2 + 3w + 3. Determine 3o(u) + 8x(u). 22u3 Let h(x) = 5x + 4x - 4x - 4x. Let i(y) be the second derivative of y3/2 + 3y. Give 4h(j) - i(j). j Let k(h) = 1. Let p(y) = 51y + 153. Calculate 153k(d) - p(d). -51d Let r(p) = 16p2 + p2 - 14p*2. Let b(m) = -14m*2. Give -2b(s) - 11r(s). -5s*2 Let u(t) = 15t + 23. Let x(v) = -5v - 8. Determine -6u(d) - 17x(d). -5d - 2 Let k(n) = -n*2 + 1. Let y(d) = 5d*2 - 6d - 1. Determine -4k(q) - y(q). -q2 + 6q - 3 Let w(j) = 11j2 - 2j + 2. Let f(z) = 34z2 - 7z + 7. Determine -6f(v) + 21w(v). 27v2 Let s(z) = -z - 7. Let o(w) = -w - 8. Suppose 3f - 75 = 8f. Let d be 0 + (-1)/((-3)/f). Calculate do(n) + 6s(n). -n - 2 Let o(t) = -3t. Let m(k) be the first derivative of k*2 + 7. Give 5m(s) + 3o(s). s Let o(r) = -r2 + 3r. Let y(w) = -2w3 + 7w*2 - 8w + 1 + 2 + 3w3. Let u be y(-8). Let x(h) = h - uh + h. Determine o(j) + 3x(j). -j2 Let d(o) = 8153o. Let m(i) = -31i. Calculate 6d(z) + 1581m(z). -93z Let g(o) = -2o - 7. Let u(s) = 3s + 13. Let a(w) = -5g(w) - 3u(w). Let y(z) = 2z - 5. Calculate 5a(f) - 4y(f). -3f Let y(a) = a*2 + 5a - 2. Let k(x) be the second derivative of 0 + 7x + 7/3x*3 + 1/6x*4 - 3x*2. Determine 3k(p) - 8y(p). -2p*2 + 2p - 2 Let a be 12/1891. Suppose 0 = -2q - 2q - 32. Let h be (51/(-2))/(a/q). Let s(y) = y*2 - 3y. Let k(t) = 6t2 - 17t. Calculate hs(w) - 6k(w). -2w2 Let g(f) = 2f3 + f2 + 3f - 1. Suppose 2o + i = -3, -11 = -o + 8i - 6i. Let y(v) = v*3 + v. What is og(r) - 3y(r)? -r3 + r2 - 1 Let o(f) = -38f*3 - 4f*2 - 4f. Let r(c) = 1634c3 + 171c*2 + 171c. Determine 171o(a) + 4r(a). 38a3 Let l(v) = 8036v. Let y(k) = -47k. What is -2l(d) - 343y(d)? 49d Let l(t) = -6t2 + 4. Let g(i) be the second derivative of -7i*4/12 + 5i*2/2 - 16i. Determine 4g(v) - 5l(v). 2v2 Let m(n) = -n2 + 2n. Let z(l) = 4l2 - 7l. Let u(g) = -g - 6. Let v be u(-10). Calculate vz(s) + 14m(s). 2s2 Let t(r) = -r2 + r - 1. Let v(j) = j2 + 5. What is 3t(u) + v(u)? -2u2 + 3u + 2 Let z = -19 - -29. Let l = -5 + z. Let r(f) = -f*2 - 2 - 3 - f + l. Let w(b) = 2b*3 - 4b*2 - 4b - 1. What is 4r(k) - w(k)? -2k3 + 1 Let a(l) = l3 + l. Let c(j) = 2j3 - 3j*2 + 6j. Calculate 4a(h) - c(h). 2h*3 + 3h*2 - 2h Let k(f) = -f*2 + 4f + 2. Let p be k(5). Let s(u) = -2u. Let t(j) = j - 2j - j - 3j. Calculate pt(g) + 8s(g). -g Let b(r) = 2r*2 - 12r + 12. Let d(k) = k*2 + k - 1. What is b(o) + 12d(o)? 14o2 Let s(f) = 190f. Let h(i) = -5i - 27. Let z be h(-5). Let y(v) = 7v. What is zs(c) + 55y(c)? 5c Let n(t) = -3t*3 + 3t + 3. Let b(r) = 3r3 + r2 - 4r - 4. Give -3b(y) - 4n(y). 3y3 - 3y2 Let q(y) = y3 + 45y2 + 11. Let h(a) = 9a*2 + 2. Give -11h(f) + 2q(f). 2f*3 - 9f*2 Let t(c) = -3c*2 - 4c + 7. Let g(m) = -7m2 - 9m + 13. Determine -4g(p) + 9t(p). p2 + 11 Let m(r) = r3 - 4r2 + 3. Let l be m(2). Let u(j) = 1 + 0 + 1 - j. Let y(d) = -2d + 3. Give ly(o) + 8u(o). 2o + 1 Let q(v) = -2v - 7. Let j be q(-1). Let n(z) = -9z2 - 24z. Let t(f) = -2f2 - 5f. Give jn(b) + 24t(b). -3b2 Let s(t) = -t. Suppose 8o - 12 = 20o. Let h(f) = -6f - 2. What is oh(a) + 4s(a)? 2a + 2 Let u = -8 + 14. Let z(r) = -15r - 17. Let a be (-2)/3 + (-56)/(-12). Suppose 5w = -5y - 55, 3y + aw + 29 = -2. Let n(p) = -7p - 8. Give uz(g) + yn(g). g + 2 Let q(j) = j2 - j - 1. Let p = 8 - 9. Let w(u) = -5u*2 + 2u + 2. What is pw(a) - 4q	{ "pile_set_name": "DM Mathematics" }
+ 5a - 17, 9 = -3z + a. What is the nearest to -0.1 in 1, z, 5? 1 Let q be (-1 - 9/(-7))-1. Let y = 1.9 + -2. What is the closest to y in 5, 1, q? q Let x be 2444/32-2. What is the closest to -1 in -2, 2, x? -2 Let s = 3.5 - 0.5. Let c = 0.7 - 0.8. Let j be 1 + 10(-2)/14. What is the closest to c in j, s, -0.3? -0.3 Let i = -41597/2 - -436624/21. Let h = -43/6 - i. What is the closest to h in -0.3, 4, 1? -0.3 Let f = -0.9 + 1.1. Suppose 13o = 8o - 5. What is the closest to 3 in o, f, 2? 2 Suppose -s + 0s = -5l + 35, 5s + 3l + 147 = 0. Let p = -448/15 - s. Which is the nearest to 1? (a) -1 (b) p (c) -4 b Let t = -0.4 - 0.1. Let o = -0.19 - -0.19. What is the closest to o in t, -3, 5? t Let z(g) = -g*3 - 9g2 - g - 9. Let t be z(-9). Let n = -1 + 5. Which is the nearest to t? (a) n (b) 0 (c) -0.4 b Let z = -54.7 - -55. What is the nearest to z in 0.3, -1, 0.4? 0.3 Let g = -3823/17 - -225. Let f = 0.7 - 0.6. Let s = -2.98 - 0.02. What is the closest to 0.1 in s, g, f? f Let y = 3 - 3.5. Let s = 35 + -34.9. Which is the closest to s? (a) y (b) 0.4 (c) 2 b Let n = 25.9 + -26. What is the nearest to 0.1 in -3, n, 25? n Let z = -17024/381 - -134/3. Let v = z - 1135/508. Let r = v - -31/12. What is the closest to -1/4 in -4/5, r, 5? -4/5 Let h(o) = -o3 + o*2 - o + 5. Let r be h(0). What is the closest to 0.1 in 0.4, r, -2/17? -2/17 Let t = 4.3 + 0.7. Let u = t + 0. Let s = 4.7 - u. Which is the nearest to -1? (a) s (b) -1/3 (c) 1 b Let z = -0.1 + -0.9. Let c = 0.9 + z. Let l be (24/36)/((-8)/21) + 2. What is the nearest to 1 in c, -4, l? l Let q = 2.1 + -0.1. Let k = -1.75 + q. Let w = k + 0.05. Which is the nearest to w? (a) -1/5 (b) 1/4 (c) -1 b Let h = -11.2 - -9. Let m = 0.2 + h. What is the closest to -3/5 in 0, m, -5/3? 0 Let h = 4.05 + -0.05. Let x be 21(-6)/(-9). What is the closest to -1/4 in x, h, -4/7? -4/7 Let u(j) = j3 - 3j*2 + j + 1. Let i be u(2). What is the nearest to 2/7 in 0, i, 4/5? 0 Let t = 46 - 416/9. What is the closest to -1 in t, 2/7, 5? t Let v = 55.9 + -56. Which is the nearest to v? (a) -5 (b) 5 (c) -12 a Let j = 0.9 + -4.9. Let y = j - -5. Let u = 28 + -27.7. Which is the nearest to y? (a) 2/11 (b) 0.2 (c) u c Let w be (0 + -2)/(15 + (2 - 4)). Which is the closest to -0.1? (a) -0.5 (b) 0 (c) w c Let q = -1 - 2. Let h = -110 - -547/5. What is the nearest to 1 in 4, q, h? h Let y(h) = h + 1. Let w(r) = -3r + 12. Let f be w(5). Let j be y(f). Let a = -1613/9 - -179. What is the nearest to j in 3, a, 1/5? a Suppose -4y = -5a + a - 4, -3a - 2 = -4y. Let o = y - -2. Let j = 6 + -4. What is the nearest to 0 in j, o, 2/11? 2/11 Let r = -12 - -1. Let t = 7 + r. Let h = 10/3 - 43/12. What is the nearest to -1 in h, t, 0.4? h Let w be (-2)/(-7) - (-288)/(-420). What is the closest to w in -1/3, 2/5, 3/8? -1/3 Let x = 2.3 - -0.7. Let h = x - 2.7. Let q = h + -0.4. What is the nearest to -0.1 in -1, 2, q? q Let h = -137549/34 + 4046. Let c = 1/17 + h. What is the closest to -1/4 in c, 3/8, -2/5? -2/5 Let x = -33 - -229/7. What is the nearest to 2/7 in 1, x, 2/5? 2/5 Let g = -53.1 + 53. Let f be -1 + 3 + 9/(-2). Which is the closest to 1? (a) f (b) 2/15 (c) g b Let f be ((-1)/6)/(6/(-8)). Let i = 19.3 - 12. Let n = i - 7. Which is the nearest to -1/4? (a) -3 (b) n (c) f c Let g = 3 - 2. Let w = -3 + g. Let r = 1.8 + w. What is the closest to -1 in r, 2/13, 4? r Let f = 1.398 - -0.002. Which is the nearest to f? (a) 2 (b) -3 (c) 1 c Let u = 0 + -2. Let r = u - -1.5. Let f = 403 - 402. Which is the nearest to f? (a) -0.3 (b) 0.3 (c) r b Let w = 3 - 2.9. Let h = -1.7 + 2. Let r = -1418/7 - -202. What is the closest to w in h, -2, r? h Let h be (171/42 + -4)-4. Which is the closest to h? (a) -5 (b) -1/4 (c) 1 b Let l = -116/441 - -2/49. What is the nearest to 2 in l, 5, 0.5? 0.5 Let s = -10.9 - -9.9. Let d(g) = -g2 + 5g - 5. Let k be d(5). What is the closest to 0 in s, k, -0.5? -0.5 Let x = -4.3 - -4. What is the nearest to -3 in -1/3, x, -1/7? -1/3 Let s = -30.1 + 29.6. Let k = 0.1 + -0.1. Let p be (6/(-2))/((-6)/(-4)). What is the closest to p in k, -5, s? s Let w(j) = j - 9. Let v be w(9). What is the nearest to -1 in v, 1/7, -4/7? -4/7 Let v = 122 - 121.9. Which is the nearest to 3? (a) -4 (b) v (c) 4 c Let h = 13.32 + -13. Let v = h - 0.02. Let f be (-2)/(-6) + (-26)/42. What is the closest to f in 0.2, 1/11, v? 1/11 Let t = -0.07 + 3.07. What is the closest to 1 in -2/11, 5, t? -2/11 Let y = -2/29 - 52/87. Which is the closest to y? (a) -0.4 (b) 2/5 (c) -2/9 a Let l(s) be the third derivative of s5/60 - s4/4 - 5s3/6 - 2s*2. Let n be l(7). Which is the nearest to -1? (a) -0.3 (b) -3 (c) n a Let a = 124 + -128. Let y be (-2)/(-3 - -1) + 1. What is the nearest to 1 in y, 0.4, a? 0.4 Let n = -0.4 + 0. Let q = -1.64 + -1.36. Which is the closest to q? (a) -0.3 (b) n (c) -1 c Let w = 5 + -4. Let o be -3 + (1 - w)/(-2). Which is the closest to -1? (a) 5 (b) -5 (c) o c Let v = 1.6 - 1.2. What is the closest to -1/3 in -1, v, 2/3? -1 Let o = 0.2 - 0.2. Let f = 0.2 - o. Let x = -358 + 360. What is the closest to f in -5, x, 1? 1 Let l = -4.27 + 4.07. Let f = 3 + -11. Which is the closest to 1? (a) -2/3 (b) f (c) l c Let x be (4/5)/(4/(-2)). Let u = -50 + 50.2. What is the nearest to x in -2/11, u, 2? -2/11 Let r = -1.9 - -2. Let b = 2/123 + 113/615. What is the closest to -0.1 in 0, b, r? 0 Let i be 2/(-3)18/(-4). Which is the closest to -0.1? (a) -2/3 (b) i (c) 2 a Suppose -20 = -0o + 4o. Let v = -9 - o. Let u = -0.8 + 1.2. What is the nearest to 1 in u, 3/7, v? 3/7 Let i = 1 + -2. Let n = i + -2. Let p = -2 - -3. Which is the closest to p? (a) n (b) -1/6 (c) 0.1 c Let a(v) = -2v2 + v + 4. Let s be a(2). Let z = 1.3 - 6.3. What is the nearest to 2/7 in -0.1, s, z? -0.1 Let h be 6/(-18) + ((-98)/(-78))/7. Let v = -0.06 + -3.94. Which is the nearest to -0.3? (a) h (b) v (c) -5 a Let d(i) = -i2 + 5i + 8. Let f be d(6). Suppose -fh + 2 = -2r - 2r, 5h - r - 23 = 0. Suppose -x = x. Which is the nearest to -1/3? (a) x (b) h (c) 4 a Let p = -40/147 + -2/147. Let x be 0/(-1) + 0 + 1. Let m = 0 - 0. Which is the nearest to m? (a) 1/3 (b) p (c) x b Suppose -7x + 5x = 2. What is the closest to x in 1, 3/4, -2/3? -2/3 Suppose -29q + 24q - 25 = 0. What is the closest to 2/3 in 4, q, -2? -2 Suppose d - 6 = -d. Let m be 30(6/9)/(-1). Let j be m/12 + 2/d. Which is the nearest to -1? (a) -2/7 (b) j (c) 0 b Let p be (-2)/(-4) - 21/18. Let g = 0 - 0. Suppose 4l - f - 16 = g, 0l - 2f - 12 = -4l. What is the closest to p in 4/7, l, 0.4? 0.4 Let g = 104 + -518/5. Which is the closest to g? (a) -2/3 (b) -5 (c) 2/23 c Let u = -1 + -1. Let k(j) = j2 - 5j*2 - 1 + 0j2 + j3. Let x be k(4). What is the nearest to x in u, -3, -4? u Let v be ((-2)/3 - -1)-2. Let z be ((-220)/(-54) - 4)3. What is the nearest to v in 0.5, z, 5/4? z Let i = 0.4 - 1.5. Let d = i + 0.1. Let v be 4/7 + 2/(-7). Which is the closest to v? (a) d (b) 0.5 (c) -0.3 b Let q = 0.285 + 0.015. Let l = 0.2 + -0.1. Which is the closest to l? (a) q (b) -4 (c) 1 a Let h = 1 - 1. Let k = h - -0.2. Let x be (-11)/(-4) + (-20)/10. What is the nearest to k in 0.5, x, -4/5? 0.5 Let x = 1.6 - 2. Let r = -0.9 - x. Let i = -44/5 - -171/20. Which is the nearest to 1/2? (a) r (b) i (c) 1 c Let r = 61.9 + -62. Which is the closest to r? (a) -1/7 (b) 0.2 (c) 3/4 a Let s = -65 - -67. Which is the nearest to 0? (a) 4 (b) s (c) -3 b Let v be 3/15 + 18/(-40). Which is the nearest to v? (a) -0.1 (b) -0.3 (c) -0.7 b Let l = -2.1 - -2.5. What is the nearest to 0 in -0.5, 0.1, l? 0.1 Let j = 0.57 + 0.03. Let p = j + -0.2. Suppose 3v + 7 = -8. What is the nearest to 2/3 in p, -3, v? p Let c = -0.33 + 0.54. Let x = c - -0.09. Let y = 1.2 - 0.2. What is the closest to y in x, 3, -0.2? x Suppose 0 = -2p - 2p - 4, -4z - p = -7. Suppose 0g = -2g - z. Let q = g - 0. Which is the closest to q? (a) -2/5 (b) 4 (c) 0.4 a Let h = -0.2 + -0.3. Let j = -0.4 - -0.3. Which is the closest to j? (a) -2 (b) h (c) 2 b Suppose 0f = -3s - 2f + 8, -4s = 2*f - 10. Let u = -2/15 - 1/5. Let r = 0.4 + -0.3. Which is the closest to r? (a) -0.2 (b) s (c) u a Let h =	{ "pile_set_name": "DM Mathematics" }
3/(4 + (-44)/8). What is the hundreds digit of (((-7668)/63)/3)/(q/7)? 1 Let p = 5672 - 3285. Suppose 4n - 24758 = -24742. Suppose nv = -7v + p. What is the units digit of v? 7 Let z(r) = 512r + 1028. Let c be z(-2). Suppose 0 = -s + 10 - 2. Suppose -5p + cq = -195, s = -3q - 7. What is the units digit of p? 5 Suppose 0 = -248g + 807580 + 2060292. What is the ten thousands digit of g? 1 Let h(y) = y*3 + 4y*2 + 8y + 18. Let g(r) = -2r3 - 9r*2 - 17r - 36. Let o(f) = 3g(f) + 5h(f). What is the tens digit of o(-7)? 5 Suppose -5l - 5q + 42360 = 0, 13056 = 2l - 3q - 3893. What is the tens digit of l? 7 Let w(h) = -1 + 187h + 18 + 9 + 0 + 10. What is the units digit of w(5)? 1 Suppose 0 = -g + 5, 0g - g = k - 12. Suppose -12 = -o - k. Suppose -2l + 5r - 18 = -4l, -3l - or = -37. What is the tens digit of l? 1 Let u = 37 + -35. Suppose 3g = ug - 17. Let n(k) = k2 + 14k - 1. What is the tens digit of n(g)? 5 What is the tens digit of 1 + 18589/3 + 228/(-684)? 9 Let a = 60 + -51. Suppose 8b + 2 = ab. Suppose 354 = -bd + 5d. What is the tens digit of d? 1 Suppose 0 = -16a + 20a - v - 23751, -12 = 4v. What is the thousands digit of a? 5 Suppose -8t - 2338 = -22t. What is the units digit of (t/(-3))/(208/24 + -9)? 7 Suppose -5d + 8d - 3q - 29286 = 0, 19482 = 2d + 5q. What is the units digit of d? 6 What is the tens digit of 24/(-3) - (41587/(-13))/(2/22)? 8 Suppose -3n + 28450 = 5p, n + 330p - 9502 = 326p. What is the hundreds digit of n? 4 Let p(c) = -14c + 20. Suppose 7w - 8 + 8 = 0. Suppose g - 2u = 0, 21 = -3g - wu - u. What is the units digit of p(g)? 4 What is the thousands digit of 52/65 + 520945/25? 9 Let g(c) = 58c - 1 + 6 - 3 - 3. Let w(v) = -v3 + 6v*2 + 1. Let m be w(6). What is the units digit of g(m)? 7 What is the tens digit of (2/(-3))/(156/(-634374))? 1 Suppose 3l + 58608 = 3b, 32l - 78147 = -4b + 37l. What is the thousands digit of b? 9 Let y(x) = 968x - 1780. What is the thousands digit of y(7)? 4 Let i = -4406 - -9717. What is the hundreds digit of i? 3 Let x(g) = -1489g + 12 + 1535g - 8. What is the hundreds digit of x(5)? 2 What is the thousands digit of (0 + 100/(-35))/((-2)/3479)? 4 Let j = -7980 - -25293. What is the hundreds digit of j? 3 Let g = 292 + 10249. What is the tens digit of g? 4 Let s(w) be the second derivative of -1/20w*5 + 0 - 20w + 2/3w3 + 1/3w4 - w2. What is the tens digit of s(-4)? 1 Suppose 2p + 4c = -10 + 26, p - 17 = -5c. Let x be (-1)/(4p/1128). Let g = -70 - x. What is the units digit of g? 1 Let z = -43 - -45. Let j be (-3 + (z - -1))/2. What is the hundreds digit of (465/(-12) + j)-4? 1 Suppose -21k = -19k. Suppose l + 4a - 198 - 70 = k, -2l + 4a = -524. What is the units digit of l? 4 Let d = -73 + 40. Let i be d/11 - (55 - 1). Let g = -35 - i. What is the tens digit of g? 2 Let l = 65 + -61. Let o(z) = -2z2 + 9z + 1. Let n be o(l). Suppose 5g - 3y + 100 = 6g, -480 = -5g + ny. What is the tens digit of g? 9 Let n be (16/(-28))/(4/14). What is the thousands digit of (8 + (-18185)/10)n/3? 1 Let k be 242/16 + (-46)/368. Suppose 0 = -kf - f + 6672. What is the hundreds digit of f? 4 What is the thousands digit of -1 + (3 - (56/(-7) - 5154))? 5 Let q be ((-5)/5 + 2 + -1)/2. Suppose q = -4d + 11 + 5. What is the units digit of d(2/4)/(9/531)? 8 Let w(y) = -13y*2 + 2y - 3. Let c be w(2). Suppose 3n - 26n + 145 = -292. Let g = n - c. What is the units digit of g? 0 Let n be 6/9(-126)/(0 - 2). Suppose 10t - n = 3t. What is the units digit of 109 - 1t/6? 8 Let c(y) = 14y - 35. Let d be c(3). Suppose 4g + dp = 3p + 260, -263 = -4g - 3p. What is the units digit of g? 8 Let j = 8443 - 3024. What is the thousands digit of j? 5 Suppose -44z - 28z = -8z - 720576. What is the thousands digit of z? 1 Suppose -29 = b - 2m, 0 = -0b + 2b + 3m + 93. Let p be 113/b91. What is the hundreds digit of 6/p246/(-4)? 1 What is the units digit of (-1829520)/(-135) + (-1)/(-1)? 3 Suppose -400p + 644090 + 233910 = 0. What is the thousands digit of p? 2 What is the tens digit of (17 - 20)/((-1)/2497)? 9 Let w(a) = -45 - 9 + 60a + 11 - 84 + 5. What is the hundreds digit of w(20)? 0 Let g = 114749 - 66436. What is the ten thousands digit of g? 4 Suppose 0 = 388p - 11217746 - 3288798. What is the tens digit of p? 8 What is the hundreds digit of (1/(-16) + 2149787/(-1104))-3? 8 Let m(d) be the second derivative of 13/6d*3 + 6d + 0 + 9d2. What is the units digit of m(7)? 9 Let m = 66 - 63. What is the units digit of (-308)/(-6)(m + (-9 - -9))? 4 Let s = -10110 - -17130. What is the hundreds digit of s? 0 Let s(m) = -m*3 + 12m*2 + m - 16. Let r be s(12). Let z be 3(1 + 40) + r. Suppose z = 2l - 49. What is the tens digit of l? 8 Suppose -l + 3r + 8139 = 0, 117l + 2r = 115l + 16294. What is the hundreds digit of l? 1 Suppose 2x - 4d = 96602, -x + 6x = -3d + 241518. What is the ten thousands digit of x? 4 What is the tens digit of (-13)/((-208)/(-32))(-266607)/6? 6 Let x = 34800 - 662. What is the tens digit of x? 3 Let x(p) = -68 + 22p - 97 - 7p - 51p - 65p. What is the hundreds digit of x(-10)? 8 Let q = 70342 + -35322. What is the units digit of q? 0 Let j = -249 - -250. Let h(a) = -a. Let f(n) = -8n + 2. Let b(t) = -f(t) + 4h(t). What is the units digit of b(j)? 2 Suppose 2l = 3b, -4b + 3l - 2l = -5. Let w = 56 - b. What is the tens digit of w? 5 Let t(s) = 275s*2 + 30s + 302. What is the thousands digit of t(-7)? 3 Let a(t) = 10t2 + 10t - 70. Let z be a(11). Suppose 3909 = 4d - 3v, 5d + 5v + z = 6110. What is the tens digit of d? 7 Let u be ((-10)/4)/(-2 + 6/4). Suppose -4g = -5c - 653 - 747, ug - 1795 = -5c. What is the tens digit of g? 5 Let b(j) = -19660j + 1151. What is the ten thousands digit of b(-1)? 2 Suppose 39092 - 2716 = 8m. What is the hundreds digit of m? 5 Let y be (3 + 0)/(5 + -3 + -3). Let m = y - -6. Suppose -5a + 5l = 4l - 632, -136 = -a - ml. What is the units digit of a? 7 Suppose -5i = -u - 161, 0 = -3i + 5u - 9u + 92. Suppose -ig + 1800 = -29g. What is the units digit of g? 0 Let g be (2 + 12/9)(-3)/(-2). Let f be -3 - ((-221 - -2) + g + -8). Suppose f + 627 = 6z. What is the units digit of z? 1 Let n(s) = -2416s + 201. What is the hundreds digit of n(-21)? 9 Suppose -f + 3s - 450 = -4f, -2f + 288 = -4s. Suppose -f + 10 = -h - 2k, -4h - k + 566 = 0. Suppose b = -5 + h. What is the hundreds digit of b? 1 Let w(x) = 14x + 28. Let g be w(-2). What is the tens digit of (g - 1) + (-7060)/(-10)? 0 Suppose 3h + 4u = 3959, -5312 = -3h - h + 3u. Let y = h - 925. Suppose -56 - y = -4v. What is the units digit of v? 4 Let o(t) = 93t*3 + 4t*2 + 28t - 17. What is the hundreds digit of o(6)? 3 Let s(q) = -3q3 - 3q*2 + 10q - 6. Let y be s(-7). Let t = -194 + y. What is the units digit of t? 2 Let n = -354 - -354. Suppose -3o + 200 = -4i, 3 = 3i - n. What is the units digit of o? 8 Let v = 16 + -14. Let h = 232 + -131. Suppose vg = h + 73. What is the units digit of g? 7 Let n be -1 + (1 - -2) + -2. Let o(m) = -m*3 + 2m*2 + m + 148. Let h be o(n). Suppose -2l + h = 4b, -1 - 1 = 2b. What is the units digit of l? 6 Let y(v) = v*3 - 107v*2 - 562v + 242. What is the tens digit of y(112)? 1 Suppose 32c - 4g = 35c - 79530, 2c - 3g = 53020. What is the hundreds digit of c? 5 Suppose -26k + 35876 + 31490 = 0. What is the units digit of k? 1 Let a = 6101 + 690. What is the thousands digit of a? 6 Let y = -1223 - -13082. Suppose 4d + 3635 = y. What is the tens digit of d? 5 Suppose -11355 = -5f - 5z, 2267 = -2f + 3f - z. Let u = f - 987. What is the hundreds digit of u? 2 Let l be -1 + 96 - (4 - (-4 + 6)). What is the tens digit of 3 + (l - (-3 - 1))? 0 Suppose 5z + 31 = 51. Suppose 2372 = 4c - zb - 0b, -c + 575 = 5b. What is the tens digit of c? 9 Let n(h) = -6341h3 - 10h*2 - 3h + 6. What is the hundreds digit of n(-1)? 3 Suppose -3n + 5q - 12 = 9, -5q - 51 = 3n. Let l = 92 - 101. What is the units digit of 2692/16 + l/n? 9 What is the hundreds digit of (-10)/(-4) + 2140700/200? 7 Suppose 0 = 92v - 94v. Suppose v = 4x + 124 - 548. What is the units digit of x? 6 Let l(g) = -43g**	{ "pile_set_name": "DM Mathematics" }
rue Is 38628 a multiple of 116? True Does 44 divide 396? True Does 233 divide 18407? True Does 15 divide 5670? True Is 48678 a multiple of 38? True Is 247 a multiple of 5? False Does 27 divide 2727? True Does 32 divide 14786? False Does 12 divide 909? False Is 46 a factor of 3450? True Is 2380 a multiple of 14? True Is 671 a multiple of 13? False Is 5546 a multiple of 16? False Is 26699 a multiple of 9? False Is 9 a factor of 279? True Does 2 divide 287? False Is 6912 a multiple of 72? True Does 29 divide 2117? True Does 41 divide 246? True Is 94 a factor of 6295? False Is 47 a factor of 25383? False Is 5 a factor of 7412? False Is 16326 a multiple of 136? False Is 1326 a multiple of 12? False Does 14 divide 1249? False Is 21 a factor of 4473? True Does 27 divide 270? True Is 444 a multiple of 18? False Is 6911 a multiple of 31? False Is 13286 a multiple of 182? True Does 31 divide 814? False Is 52410 a multiple of 6? True Is 11 a factor of 18188? False Is 1485 a multiple of 9? True Does 92 divide 8924? True Is 9320 a multiple of 20? True Is 534 a multiple of 89? True Is 42 a factor of 7666? False Is 8582 even? True Does 29 divide 70099? False Does 13 divide 689? True Is 9 a factor of 450? True Is 16916 a multiple of 22? False Is 2992 a multiple of 22? True Is 5 a factor of 90? True Is 4 a factor of 231? False Is 28411 a multiple of 56? False Does 88 divide 10824? True Is 10 a factor of 1143? False Is 9 a factor of 435? False Does 57 divide 1026? True Does 10 divide 3561? False Is 1242 a multiple of 54? True Does 7 divide 1942? False Is 13870 a multiple of 73? True Is 4 a factor of 116? True Does 39 divide 10374? True Is 5395 a multiple of 65? True Is 222 a factor of 47064? True Is 24887 a multiple of 100? False Is 25 a factor of 1050? True Does 9 divide 94914? True Does 10 divide 680? True Does 116 divide 8236? True Is 43 a factor of 77056? True Does 20 divide 5918? False Is 3638 a multiple of 9? False Is 6 a factor of 729? False Is 37919 a multiple of 53? False Is 883 a multiple of 6? False Is 36014 a multiple of 11? True Is 3094 a multiple of 105? False Does 46 divide 763? False Is 12 a factor of 2508? True Is 2552 a multiple of 31? False Is 25 a factor of 1175? True Is 7 a factor of 2591? False Does 51 divide 12717? False Is 70 a factor of 350? True Does 14 divide 37755? False Is 68 a factor of 527? False Does 20 divide 835? False Is 13447 a multiple of 17? True Does 146 divide 23683? False Is 935 a multiple of 55? True Is 1800 a multiple of 5? True Is 15 a factor of 33585? True Is 20640 a multiple of 129? True Is 21 a factor of 344? False Does 58 divide 16240? True Does 24 divide 216? True Is 6 a factor of 475? False Does 38 divide 161? False Is 42 a factor of 2524? False Does 2 divide 5483? False Does 24 divide 10361? False Is 3626 a multiple of 61? False Is 23 a factor of 42757? True Does 75 divide 975? True Is 16 a factor of 5512? False Is 11 a factor of 20100? False Does 5 divide 1362? False Is 1283 a multiple of 26? False Is 28 a factor of 168? True Does 24 divide 15468? False Is 224 a multiple of 16? True Is 114 even? True Is 310 a multiple of 31? True Is 1083 a multiple of 57? True Is 12220 a multiple of 26? True Does 37 divide 33417? False Does 16 divide 432? True Does 8 divide 15323? False Is 1225 a multiple of 5? True Does 68 divide 17408? True Does 10 divide 990? True Is 9783 a multiple of 17? False Is 5 a factor of 490? True Is 130 a factor of 22032? False Does 84 divide 2950? False Is 554 even? True Does 37 divide 8598? False Does 3 divide 172? False Is 22 a factor of 5456? True Is 615 a multiple of 13? False Does 112 divide 2240? True Does 14 divide 340? False Does 145 divide 56753? False Does 6 divide 2644? False Is 3516 a multiple of 25? False Does 56 divide 2400? False Is 12582 a multiple of 54? True Is 3 a factor of 434? False Is 24 a factor of 1163? False Does 17 divide 34? True Is 88 a factor of 27368? True Is 2093 a multiple of 106? False Does 3 divide 679? False Is 15 a factor of 4945? False Is 782 a multiple of 97? False Does 3 divide 1005? True Does 45 divide 1745? False Does 6 divide 164? False Is 26 a factor of 25607? False Is 44 a factor of 21164? True Is 17 a factor of 289? True Is 9 a factor of 61? False Is 5 a factor of 302? False Is 3569 a multiple of 78? False Is 23 a factor of 7895? False Does 4 divide 1599? False Is 82 a factor of 1476? True Does 28 divide 476? True Does 12 divide 612? True Does 87 divide 466? False Is 1571 a multiple of 13? False Is 57 a multiple of 57? True Does 3 divide 216? True Is 11990 a multiple of 95? False Does 9 divide 28472? False Is 22 a factor of 2244? True Is 7 a factor of 153? False Is 7 a factor of 535? False Is 8556 a multiple of 124? True Is 42276 a multiple of 23? False Does 44 divide 24361? False Does 15 divide 612? False Does 7 divide 32? False Does 5 divide 995? True Is 13545 a multiple of 53? False Is 26 a factor of 76682? False Does 14 divide 595? False Is 30 a multiple of 3? True Is 90 a factor of 25470? True Is 41695 a multiple of 24? False Is 16164 a multiple of 99? False Does 20 divide 37020? True Is 17 a factor of 75789? False Is 41 a factor of 33210? True Is 99 a factor of 41628? False Is 1009 a multiple of 30? False Is 9 a factor of 2268? True Is 14782 a multiple of 8? False Is 14 a factor of 525? False Does 19 divide 176510? True Does 22 divide 2061? False Is 55173 a multiple of 347? True Is 9517 a multiple of 9? False Is 88 a factor of 1096? False Is 17024 a multiple of 28? True Does 4 divide 5027? False Is 570 a multiple of 10? True Is 49 a factor of 4366? False Is 6 a factor of 5904? True Does 23 divide 1219? True Is 7873 a multiple of 66? False Is 28 a factor of 122? False Does 21 divide 23197? False Is 239 a factor of 104447? False Is 1257 a multiple of 19? False Is 111 a factor of 2936? False Is 17 a factor of 7990? True Does 17 divide 119? True Does 3 divide 106? False Is 83 a factor of 25269? False Does 72 divide 12520? False Does 3 divide 180? True Is 9044 a multiple of 119? True Does 5 divide 294? False Does 84 divide 252? True Is 3192 a multiple of 8? True Is 7 a factor of 283? False Does 13 divide 1885? True Is 22 a factor of 1105? False Is 2224 a multiple of 27? False Is 110 a factor of 32735? False Does 95 divide 1722? False Is 478 a multiple of 18? False Is 13 a factor of 1430? True Does 41 divide 44854? True Is 2585 a multiple of 10? False Does 49 divide 1225? True Is 9701 a multiple of 22? False Is 3 a factor of 970? False Does 138 divide 7866? True Is 41 a factor of 519? False Is 3648 a multiple of 24? True Is 23 a multiple of 23? True Is 33 a factor of 17144? False Is 20296 a multiple of 118? True Does 21 divide 16570? False Is 688 a multiple of 8? True Does 10 divide 6563? False Is 36 a multiple of 12? True Is 24616 a multiple of 36? False Is 916 a multiple of 20? False Is 13 a factor of 23205? True Is 1651 a multiple of 5? False Does 24 divide 720? True Does 12 divide 336? True Is 3267 a multiple of 12? False Is 21 a factor of 2495? False Does 15 divide 337? False Is 14355 a multiple of 45? True Does 82 divide 5386? False Does 21 divide 10055? False Is 861 a multiple of 26? False Is 3 a factor of 78? True Does 134 divide 76391? False Is 7 a factor of 21945? True Does 5 divide 4671? False Is 18 a factor of 10368? True Is 1262 a multiple of 3? False Is 77 a factor of 1390? False Is 42 a factor of 918? False Is 4 a factor of 18788? True Does 108 divide 3421? False Does 16 divide 5363? False Is 2049 a multiple of 3? True Is 2 a factor of 318? True Is 25 a factor of 677? False Is 11424 a multiple of 34? True Is 12 a factor of 15936? True Is 24691 a multiple of 265? False Does 5 divide 95? True Is 12 a factor of 14160? True Does 57 divide 5529? True Is 15 a factor of 68175? True Is 408 a multiple of 3? True Is 1121 a multiple of 30? False Is 14 a factor of 29624? True Is 12 a factor of 661? False Is 1320 a multiple of 8? True Is 3057 a multiple of 53? False Does 24 divide 5496? True Is 1700 a multiple of 68? True Is 278 a factor of 5838? True Is 4176 a multiple of 13? False Is 2797 a multiple of 8? False Does 5 divide 667? False Is 21 a factor of 10479? True Is 9 a factor of 1512? True Is 2127 a multiple of 8? False Is 34 a factor of 190	{ "pile_set_name": "DM Mathematics" }
.1, -29 Put -617, -19, 5 in descending order. 5, -19, -617 Put -14, 0, 7, -5, -6 in decreasing order. 7, 0, -5, -6, -14 Sort 4, -1.2, -5, -2/37. -5, -1.2, -2/37, 4 Put -75, -3, 3, 5, 6 in descending order. 6, 5, 3, -3, -75 Sort -3, -1390, -4, 0, 4. -1390, -4, -3, 0, 4 Put 2388, -5, 5, -3 in ascending order. -5, -3, 5, 2388 Put 5505, 4, 1, 5 in increasing order. 1, 4, 5, 5505 Sort -1, -19, -9, 4 in ascending order. -19, -9, -1, 4 Put 423, 3, 8 in decreasing order. 423, 8, 3 Put -6, -2, 5, 2/3, 6022/3 in ascending order. -6, -2, 2/3, 5, 6022/3 Sort -0.1, 2/13, 2, 0.1, 2906/15, 3. -0.1, 0.1, 2/13, 2, 3, 2906/15 Put -1, 1/8, -1457, -1/4 in descending order. 1/8, -1/4, -1, -1457 Put -0.2, -0.038, -0.4, -6216 in increasing order. -6216, -0.4, -0.2, -0.038 Put -1328, -2, -1323 in descending order. -2, -1323, -1328 Sort -0.5, -557, -4/5, 3. -557, -4/5, -0.5, 3 Sort -0.1, -5/2, -2, 2/13, -4/55 in decreasing order. 2/13, -4/55, -0.1, -2, -5/2 Sort -0.13, -167, -24, 0.2 in descending order. 0.2, -0.13, -24, -167 Sort 23, 0, -107, -17, 3 in descending order. 23, 3, 0, -17, -107 Sort 0, -8, 46233 in descending order. 46233, 0, -8 Sort 5, 4, -2, 3943 in descending order. 3943, 5, 4, -2 Sort 1, 6, -4, -35, -1, 5. -35, -4, -1, 1, 5, 6 Sort -8, 5, -4, -188. -188, -8, -4, 5 Sort -1, 7, -57, 1, 0 in ascending order. -57, -1, 0, 1, 7 Sort 5, 25, 9, -295, -4. -295, -4, 5, 9, 25 Sort -5, 0, -2, 88, -35 in increasing order. -35, -5, -2, 0, 88 Put 75, -4, -47, 5 in descending order. 75, 5, -4, -47 Sort -5, 3, 0.8, -124. -124, -5, 0.8, 3 Put -3, 360, -4, -2 in descending order. 360, -2, -3, -4 Sort -115, 3, 4, -4, 58 in descending order. 58, 4, 3, -4, -115 Sort 0, 441, 5, 4. 0, 4, 5, 441 Put 0.2, -0.0589, -0.1824 in decreasing order. 0.2, -0.0589, -0.1824 Put 29, -2, -106, 5 in ascending order. -106, -2, 5, 29 Sort 13, 0, 3, -14, -8, 5 in descending order. 13, 5, 3, 0, -8, -14 Sort -2/11, -0.1, -0.16, -12 in decreasing order. -0.1, -0.16, -2/11, -12 Sort 0.2, 0.3, -3/7, 279/5 in ascending order. -3/7, 0.2, 0.3, 279/5 Put -4, -1/2, -2, -611, 0.3 in decreasing order. 0.3, -1/2, -2, -4, -611 Sort -1/4, 22, -23, -8. -23, -8, -1/4, 22 Put 32, 3, 2352, 5 in descending order. 2352, 32, 5, 3 Put -4, 6, 2, -34, -118 in increasing order. -118, -34, -4, 2, 6 Sort 5, -3/5, -3.164, -0.2 in descending order. 5, -0.2, -3/5, -3.164 Put 1/6, -2, 7/4, 0.0335 in increasing order. -2, 0.0335, 1/6, 7/4 Put 2/5, -4, 5, 2.8 in decreasing order. 5, 2.8, 2/5, -4 Sort -4/7, 0.3, -5/39, 2/15. -4/7, -5/39, 2/15, 0.3 Put -3/2, 4, -1/5, -2/3, -1/4 in ascending order. -3/2, -2/3, -1/4, -1/5, 4 Put -2, 104.7, -3, 0.4, 1 in increasing order. -3, -2, 0.4, 1, 104.7 Put -5.29, 0, 6/11, 0.9 in descending order. 0.9, 6/11, 0, -5.29 Sort -0.5, -2, 4/7, 5, -1947, 0.15 in decreasing order. 5, 4/7, 0.15, -0.5, -2, -1947 Sort 0, 9, 0.5, -107, -2 in descending order. 9, 0.5, 0, -2, -107 Put 126/29, -41/10, -0.5 in descending order. 126/29, -0.5, -41/10 Put 496.71, -0.2, 5 in ascending order. -0.2, 5, 496.71 Sort 10632, 3, -16 in increasing order. -16, 3, 10632 Put 0.051, -14/5, 5 in descending order. 5, 0.051, -14/5 Sort -5, 5, -28, 2075, 3, 2 in ascending order. -28, -5, 2, 3, 5, 2075 Sort -138, 0.5, -0.4, 18/11. -138, -0.4, 0.5, 18/11 Put 0, -2, -166, 4, -25 in ascending order. -166, -25, -2, 0, 4 Sort 2, 3, -105, -2, -8, 19 in descending order. 19, 3, 2, -2, -8, -105 Put -64, 6, 2, 0, -1, -5 in descending order. 6, 2, 0, -1, -5, -64 Put -1, 85, -374 in decreasing order. 85, -1, -374 Put 0.3, 3, -1, -2, -10/79 in descending order. 3, 0.3, -10/79, -1, -2 Sort -8, -2, -102/13, 0.28 in increasing order. -8, -102/13, -2, 0.28 Put 48, 95, 62 in decreasing order. 95, 62, 48 Sort -3851, -33, 3. -3851, -33, 3 Sort -1, 4, 5, -145, 9 in increasing order. -145, -1, 4, 5, 9 Put 1, 14, -4, -99, 0, -5 in increasing order. -99, -5, -4, 0, 1, 14 Sort 0, 7, 3, 5, -49, -3 in descending order. 7, 5, 3, 0, -3, -49 Put -391, -42, 4/9 in ascending order. -391, -42, 4/9 Sort 1, 29/24, 292 in increasing order. 1, 29/24, 292 Sort 4, 4389, 12, 5 in descending order. 4389, 12, 5, 4 Put 16, 15, 4, 63 in ascending order. 4, 15, 16, 63 Sort 7132, 2, 64 in descending order. 7132, 64, 2 Put 0.2, -0.5, 2/3 in ascending order. -0.5, 0.2, 2/3 Put -4, 362, -45, 0, -1, 5 in descending order. 362, 5, 0, -1, -4, -45 Put -2, 10, 20, -11, -5, 1 in descending order. 20, 10, 1, -2, -5, -11 Sort -1, 0.02, -0.013, -4 in increasing order. -4, -1, -0.013, 0.02 Put 84, 4, 3, 0, -4, -3 in decreasing order. 84, 4, 3, 0, -3, -4 Sort -9, 0, -20, 5, 2. -20, -9, 0, 2, 5 Sort -9, -27, -5, 2, -3 in increasing order. -27, -9, -5, -3, 2 Sort -3, 1138, 0.3, 14, 0.5. -3, 0.3, 0.5, 14, 1138 Put 5, -2, 9, -4, -5 in decreasing order. 9, 5, -2, -4, -5 Sort 3, 9, -19, 10, -3, -6 in decreasing order. 10, 9, 3, -3, -6, -19 Sort -1/23, -245, -4. -245, -4, -1/23 Sort 163599, -3, 3 in ascending order. -3, 3, 163599 Sort -4, 9149, -7 in descending order. 9149, -4, -7 Put -10, -5, -47, -4, 14 in descending order. 14, -4, -5, -10, -47 Sort -2, 155, 2, -4. -4, -2, 2, 155 Put 11, -37, 3/8, 3, 0.4 in ascending order. -37, 3/8, 0.4, 3, 11 Put 3, -4, -1/8, 21/106 in descending order. 3, 21/106, -1/8, -4 Sort 4, 5, 310, -239, -4, -1. -239, -4, -1, 4, 5, 310 Put -0.2, -252.9, -2/133 in descending order. -2/133, -0.2, -252.9 Sort 25, 632, -3, -0.3, -0.09, 0.4 in increasing order. -3, -0.3, -0.09, 0.4, 25, 632 Put -1, -104032, 0 in descending order. 0, -1, -104032 Sort 466, -1, 142 in descending order. 466, 142, -1 Put 6, -3, 4, -54 in descending order. 6, 4, -3, -54 Put -5, 33, -18, 214 in descending order. 214, 33, -5, -18 Put 12, 1, 3, -10, 2 in descending order. 12, 3, 2, 1, -10 Put 0, 7, 1/10, -0.43 in increasing order. -0.43, 0, 1/10, 7 Put 1, 7317, -2 in decreasing order. 7317, 1, -2 Put 16, 3, -64, 2 in increasing order. -64, 2, 3, 16 Put -4, -5, 0, 8, 111, 7 in increasing order. -5, -4, 0, 7, 8, 111 Sort 2, 99, 241, -3, -2. -3, -2, 2, 99, 241 Put -1/2, -3/10, 3, 1.7, 816 in decreasing order. 816, 3, 1.7, -3/10, -1/2 Sort 0.6, 0.5052, 2, 1, -3 in decreasing order. 2, 1, 0.6, 0.5052, -3 Sort 14, 25, -1, 1, 2. -1, 1, 2, 14, 25 Sort 1/7, -0.3, -2016 in descending order. 1/7, -0.3, -2016 Sort 0, 52/5, 22, 1/5. 0, 1/5, 52/5, 22 Sort -357, -11353, 4 in increasing order. -11353, -357, 4 Sort 45, 460, 0. 0, 45, 460 Sort -0.3, 5, 0.055872. -0.3, 0.055872, 5 Sort -5/4, -2165, 0.04, 5. -2165, -5/4, 0.04, 5 Put 0, -5, 7695, 1, 4 in ascending order. -5, 0, 1, 4, 7695 Sort -2/87, 1/4, -319.1 in decreasing order. 1/4, -2/87, -319.1 Sort -23, 2/901, 8/7 in ascending order. -23, 2/901, 8/7 Sort 0, 35, 4, 13, -12, -4. -12, -4, 0, 4, 13, 35 Sort 9, 5, 2, 0, -5. -5, 0, 2, 5, 9 Put -2, -1734, -6, 3, 5 in increasing order. -1734, -6, -2, 3, 5 Put -1/3, 2, 11, 3/89, -7 in descending order. 11, 2, 3/89, -1/3, -7 Put -1/4, -1, -5/26, -17, -0.2, -2 in descending order. -5/26, -0.2, -1/4, -1, -2, -17 Sort 0.6, 7/2, -64. -64, 0.6, 7/2 Put -1, 11, -59, 113, 5 in increasing order. -59, -1, 5, 11, 113 Sort 159, -0.4, -42 in descending order. 159, -0.4, -42 Put 1, 2, -2, 11, 9 in increasing order. -2, 1, 2, 9, 11 Put -124, 61/6, 2 in descending order. 61/6, 2, -124 Sort -15, -3.9, 17.1 in descending order. 17.1, -3.9, -15 Sort -4, 151, 31, 4. -4, 4, 31, 151 Sort -52019, -2, -3, 1 in descending order. 1, -2, -3, -52019 Put 2, -10, -1, -4, -5 in increasing order. -10, -5, -4, -1, 2 Put 1, 161, -13, 8, 0, -2 in decreasing order. 161, 8, 1, 0, -2, -13 Put 57, -2, 7, 38, 5, -1 in increasing order. -2, -1, 5, 7, 38, 57 Sort -2, -3, 4594. -3, -2, 4594 Put 609, 0.2, 0.06, -0.5 in descending order. 609, 0.2, 0.06, -0.5 Put 2, -11, -512, -32 in decreasing order. 2, -11, -32, -512 Put -118, 5, 191 in decreasing order. 191, 5, -118 Put -81, -4, 0.5, 2/325, -0.02 in increasing order. -81, -4, -0.02, 2/325, 0.5 Sort -3, 1, -0.26, -2/23. -3, -0.26, -2/23, 1 Sort 5, -2/155, -1/6, 8.7 in decreasing order. 8.7, 5, -2/155, -1/6 Sort 3, 26777, 5, -7, 0, -5 in decreasing order. 26777, 5, 3, 0, -5, -7 Sort 1, -1, -55, -2, 1/4, 4. -55, -2, -1, 1/4, 1, 4 Put -2, -1, 2, -4, -7, 29 in descending order. 29, 2, -1, -2, -4, -7 Put 2, -76, 4, 1, 21 in descending order. 21, 4, 2, 1, -76 Sort -1, 0.004, 0.2, 1/16, -0.04 in increasing order	{ "pile_set_name": "DM Mathematics" }
4h - 25h = 2h + 103938. What are the prime factors of h? 2, 3, 1019 Suppose -6b + 178 = 4. Let j(s) = 53s + 4. List the prime factors of j(b). 23, 67 Let d(v) = 366v*2 + 18v + 15. What are the prime factors of d(3)? 3, 19, 59 Suppose -4a = -29653 + 10857. List the prime factors of a. 37, 127 Let c = 18 + -14. Suppose -3r + c = -5, -2w + 17 = 3r. What are the prime factors of 51(52/12 - w)? 17 Suppose 482 = 2h - h. Suppose 0 = -5v + 4t + 454, -2t + h = 5v + t. Suppose -99g + vg = -415. What are the prime factors of g? 83 Suppose 71n - 162n + 3065880 = 141n. List the prime factors of n. 3, 5, 881 Suppose 0 = 5d + 2m - 119899, 39d + 3m + 47971 = 41d. What are the prime factors of d? 23981 Suppose 87p - 45955 = -14p. Let r = -1 - -3. List the prime factors of -4 + p/5 + r. 89 Let l(w) = w*2 + 2w2 + 1 - w2 - 10w + 7. Let s be l(11). Suppose -4d + 150 = 2k, s = -4d + 8d + 4k. What are the prime factors of d? 2, 5 Suppose 3l + 19 = 5z + 667, -3z - 220 = -l. Let u = -98 + l. List the prime factors of u. 113 Let i be 91/(-39) - 47/3. What are the prime factors of 36/i + 3198/(2 - -1)? 2, 7, 19 Suppose -1 - 4 = -5m, -n + 4m - 17 = 0. Let r(y) = y3 + 14y*2 + 6y + 1. List the prime factors of r(n). 2, 23 Let i = 2288 + -1086. List the prime factors of i. 2, 601 Suppose r - 6577 = -2l, -3l + 13045 = -5r + 3186. What are the prime factors of l? 2, 3, 137 Suppose -3t = -4a + 12, 0 = 17a - 16a + 2t + 8. Suppose -3w - w + 400 = a. List the prime factors of w. 2, 5 Let z(j) = -j3 - 4j*2 + 6j - 1. Let r = 20 - 25. Let f be z(r). What are the prime factors of 16/f - -4 - 22/(-6)? 5 Suppose -9i = 2i - 4j - 142755, 0 = j + 2. List the prime factors of i. 19, 683 Let o = 24 + -23. Let h be 3/972/(3 + o). List the prime factors of (15/(-6))/(h/(-132)). 5, 11 Suppose -5g = -27g - 2g + 47112. What are the prime factors of g? 13, 151 What are the prime factors of 1090230/(-9)(-12)/30? 2, 23, 79 Suppose 0 = 4k - 16k + 96. Suppose -3h = -13p + kp - 3571, -2h = -3p - 2380. What are the prime factors of h? 1187 Suppose -3077l + 3219l = 2602434. List the prime factors of l. 3, 41, 149 Suppose -4h + 54848 = -3y, -10y - 13711 = -h - 9y. What are the prime factors of h? 5, 13, 211 Let u be (4 + 2/(-1))(-34)/1. Let x = -47 - u. Let o = x - 9. List the prime factors of o. 2, 3 What are the prime factors of 1/(-13) + 184287656/11921? 3, 5153 Suppose -5071b = -5075b + 120188. What are the prime factors of b? 30047 Suppose -26t - 4648 = -34t. Suppose -h - t = -2h + 2f, 0 = 3h - 5f - 1747. What are the prime factors of h? 19, 31 Let x be (-31 + 1)(0 - 188/(-6)). Let o = x - -1504. What are the prime factors of o? 2, 3, 47 Suppose 0 = -8c + 34c - 126048. List the prime factors of c. 2, 3, 101 Let l(s) = -41s3 - 2s + 83s3 - 13s*2 - 7s*2 - 43s*3 - 38. List the prime factors of l(-20). 2 Let r(g) = -152g*3 + 2g*2 + 3g - 2. Let z be r(2). Let o = z + 1716. List the prime factors of o. 2 Let u(a) = a*2 + 2a - 29. Let r be u(13). Let m = 831 - r. Suppose 6x - 301 = m. List the prime factors of x. 7, 23 Suppose 15c - 21c = -3282. Suppose -a - c = -x - 36, 3a - 519 = -x. Suppose 35 = 2u + h - 307, -x = -3u + 2h. What are the prime factors of u? 3, 19 Let y = -60 - -104. Suppose 0 = 3b - 4t - 85, 44 = -5t + 24. Let x = y + b. List the prime factors of x. 67 Let n = 24798 + -16886. List the prime factors of n. 2, 23, 43 Let f be 21 + 265 + 1/(1 - 0). Let v = f - 47. What are the prime factors of v? 2, 3, 5 Suppose 0 = -3y + 3w + 21472 + 13253, 4w = -2y + 23162. What are the prime factors of y? 3, 17, 227 Let i = 2 - -2. Let p = 277 + -155. What are the prime factors of 1/(i/p)4? 2, 61 Suppose 5l = 3n - 1247, n - l + 5l = 427. Let h = n + -219. List the prime factors of h. 2, 5 Let v(i) = 53i - 304. Let d(c) = -35c + 202. Let a(b) = -8d(b) - 5v(b). What are the prime factors of a(14)? 2, 3, 19 Suppose -8 - 52 = j. Let y = j + 56. List the prime factors of -2y/(16/204). 2, 3, 17 Suppose 7v + v - 825281 = -258073. What are the prime factors of v? 70901 Let b(u) = 3u3 - 2u*2 + 5u - 22. Let j(g) = -g*3 + 2g*2 - 2g - 1. Let q(r) = -b(r) - 2j(r). List the prime factors of q(-11). 2, 281 Suppose 2t - 4u = -2t - 168, 4u = 2t + 78. Let o(w) = -68w + 551. Let q be o(7). Let i = q + t. List the prime factors of i. 2, 3, 5 Suppose 2l - 15 = -q, -4l + q = -q - 10. Let a = l - 3. Suppose 3z + a = 80. List the prime factors of z. 2, 13 Suppose 5k + 9 - 29 = 0. Suppose 50 = x - kq, 5x - 2q - 284 + 16 = 0. What are the prime factors of x/((2 - 2) + 10/25)? 3, 5 Let v be 2(-20)/(-6) - (-74)/(-111). Suppose 0 = 4p + 4t - 264, -vp + 2p = -5t - 282. What are the prime factors of p? 2, 17 Let c = -1609 - -2736. Let y = c - 563. List the prime factors of y. 2, 3, 47 Let m(u) be the third derivative of 0 + 0u - 2/3u*3 - 5/8u*4 + 5u*2. List the prime factors of m(-5). 71 Suppose -6l - 15 = -51. What are the prime factors of (-3087)/l16/(-24)? 7 Suppose -3x = -20x + 1615. Suppose -d = -4b - 803 - x, 4b = -d + 930. What are the prime factors of d? 2, 457 Let x = -157 - -472. Suppose 59 = 5d - 2b - x, -3d + 226 = -2b. Let q = d - -6. List the prime factors of q. 2, 5 Let l(k) = k2 - 4k + 3. Let o be l(3). Let m(d) be the third derivative of -d6/120 + d4/12 + 113d3/3 + 593d*2. What are the prime factors of m(o)? 2, 113 Let i = 485 - 480. List the prime factors of (-32224)/(-36) - i/45. 5, 179 Let y = 18 - 14. Suppose -a + y = 8. What are the prime factors of (a/(-4) - 4)-19? 3, 19 Let x be (0 + -1)/((-10)/200). Let n(k) = k + 3. Let j be n(-8). What are the prime factors of j/x-9112? 3, 7, 13 Suppose -3p - 12331 = -v + 6770, -5p - 38197 = -2v. What are the prime factors of v? 2, 3, 3181 Let v(o) = 6o + 137. Let s be v(-22). Suppose 6u - 3u - 395 = -4m, 5u = sm + 600. What are the prime factors of u? 5 Let a(f) = -276f*2 + 14f + 262f2 - 10 - 5f*3 + 4f*3. Let s be a(-15). List the prime factors of ((-220)/2)/(4 - s). 2, 5, 11 Let x be 1/(-4(-5)/40). Let f(k) = 174k2 - k + 1. Let q be f(x). Suppose -3p + 438 = 4r, -5p + r + 4r + q = 0. List the prime factors of p. 2, 71 Suppose -88d - 9d - 7d = -2595320. List the prime factors of d. 5, 7, 23, 31 Let v be (14 + -2)(9 - 8). Suppose -35 + 131 = vf. Suppose -4h + 824 = 4k, fh - 5k = 3h + 1050. List the prime factors of h. 2, 13 Let w(a) = 40a + 6. Let m(y) = 2y3 - 12y*2 + 6. Let r be m(6). Suppose 0 = -rz - z + 7. List the prime factors of w(z). 2, 23 Let w be 1 - (5 + (-27 + 3)6). List the prime factors of w/(1 - 7/14). 2, 5, 7 Let v(l) = 2l*3 + 19l*2 + 2l. Let t be v(-9). Let z = t + 297. What are the prime factors of z? 2, 3, 5 Let n(x) = -1. Let g(q) = 1. Let c(y) = 5g(y) + 4n(y). Let r(j) = j*3 - 22j*2 - 5j + 7. Let z(h) = -2c(h) - r(h). What are the prime factors of z(22)? 101 Let y(o) = -24o + 6. Let s be y(1). Let z = -3 - s. What are the prime factors of (z/12)/(-5)-836? 11, 19 Let k(q) = 9q + 8 - 10q + 2. Let d be k(12). Let o(z) = 12z*2 - 7z - 3. List the prime factors of o(d). 59 Let n(p) be the second derivative of p*3/3 + 39p*2/2 + 11p. Let j be n(-17). Suppose -6r = -jv - 8r + 703, -2r - 2 = 0. What are the prime factors of v? 3, 47 Let y be 9/(27/8484) - 1 - -4. Suppose 5a - 2519 = y. List the prime factors of a. 2, 5, 107 Let r(v) = -11 + 12 - 4v + v*2 - 6. List the prime factors of r(-18). 17, 23 Let h(q) = -50q + 79. Let w be 64/48 - (-56)/(-6). List the prime factors of h(w). 479 Let d(c) = 192 + 236 + 4c - 261 + 4c. List the prime factors of d(41). 3, 5, 11 Suppose 20s = 18s - d + 10, -5d - 10 = -5s. Suppose 2l + x = 38, 3l - 5 = 2l - sx. List the prime factors of l. 3, 7 Suppose -22079 = 20u - 72719. Suppose -2531v - 1427 = -uv. What are the prime factors of v? 1427 Let t(g) = 474g*2 - 84g - 392. What are the prime factors of t(-4)? 2, 941 Let c be -2 + (-3)/(-3) - -4. Suppose 1 = 2b - 3, 5f - cb - 579 = 0. List the prime factors of (6 + 0)f/6. 3, 13 Let s(w) = 587w2 - 101w - 1052. What are the prime factors of s(-9)? 2, 7, 1693 Let u(t) be the first der	{ "pile_set_name": "DM Mathematics" }
0, 1 Let h(v) = -v*2 - 16v + 9. Let y(t) = t*2 - 1. Let j(s) = 5h(s) + 30y(s). Suppose j(n) = 0. What is n? 1/5, 3 Let m(k) be the first derivative of -k5/5 - 5k*4/2 - 12k*3 - 27k*2 - 27k - 30. Factor m(x). -(x + 1)(x + 3)3 Suppose -5d - 21 = -l - 3l, -3 = -d - l. Let g be d/(-6) - 6/(-18). Factor 0 + 1/2x*3 + 0x*4 + 0x*2 - gx*5 + 0x. -x*3(x - 1)(x + 1)/2 Let z(g) be the third derivative of -g6/360 + g5/90 - g4/72 + 8g*2. Determine r so that z(r) = 0. 0, 1 Factor -8w*3 + 0w - 10w2 + 10w - 8w - 4w. -2w(w + 1)(4w + 1) Let f be 8/2 + 0 + (-14)/4. Factor -r*2 + 1 - 1/2r + fr3. (r - 2)(r - 1)(r + 1)/2 Let j(w) be the third derivative of 0w + 1/135w5 - 1/945w*7 - 1/54w*4 - 1/756w*8 - 1/27w3 - w2 + 0 + 1/135w6. Find y such that j(y) = 0. -1, -1/2, 1 Let t = 9 + -7. Let o(l) = -6l*3 - 5l*2 + l + 7. Let q(a) = 2a*3 + 2a*2 - 2. Let v(h) = to(h) + 7q(h). Suppose v(c) = 0. What is c? -1, 0 Let b(a) = -21a*3 - 15a - 15. Let g be (18/12)/((-2)/20). Let p(x) = 3x3 + 2x + 2. Let i(t) = gp(t) - 2b(t). Solve i(s) = 0 for s. 0 Let 749n - n2 + 5n*2 - 741n = 0. Calculate n. -2, 0 Suppose 2q = 6q - 8. Let n(v) be the third derivative of 0v + 2/9v*3 + 0 + 1/3v*4 + 5/72v*6 + 1/4v*5 + 2v*q. Factor n(s). (s + 1)(5s + 2)2/3 Let q(r) be the first derivative of 8 - 1/2r*3 + 1/8r*4 + 1/2r*2 + 0r. Find p such that q(p) = 0. 0, 1, 2 Suppose -6 = 4a - 14. Suppose 6x = ax + 8. Solve -2/5c*x - 1/5c*3 - 1/5c + 0 = 0 for c. -1, 0 Let j(w) = 3w3 - w + 2. Let f be j(1). Let 3/4p*5 + 9/4p*3 + 0 + 0p - 3/4p2 - 9/4p*f = 0. Calculate p. 0, 1 Let p(o) = 20o*2 + 14o - 6. Let j be 44/16 + 1/4. Let i(n) = -4n2 - 3n + 1. Let y(a) = jp(a) + 16i(a). Solve y(g) = 0 for g. -1, -1/2 What is n in -4n2 - n3 + 0n*3 - 4n*4 + 0n*3 + 9n*3 = 0? 0, 1 Let b(t) = 5t*5 - 8t*4 + 2t*3 + 4t*2 - 7t + 4. Let j(i) = i5 - i4 - i3 + i2. Let o(z) = b(z) - 6j(z). Suppose o(m) = 0. What is m? -4, -1, 1 Let d(o) be the first derivative of o4/24 - o3/18 - 5o*2/12 - o/2 + 20. Let d(u) = 0. What is u? -1, 3 Suppose -4r - 3 + 15 = 0. Factor c*2 + 3c3 + c4 - 2c3 + 0c*2 - rc3. c2(c - 1)2 Let 4/3a + 40/3a4 + 0 - 10/3a*2 - 34/3a3 = 0. What is a? -2/5, 0, 1/4, 1 Let a(n) be the second derivative of n7/3 - 53n6/25 + 253n*5/50 - 173n*4/30 + 16n*3/5 - 4n*2/5 + 7n - 1. What is r in a(r) = 0? 1/7, 2/5, 1, 2 Suppose -2m - 4k = 1 + 5, 4m = -3k + 13. Suppose z = -4 + m. Factor 2g2 - 1 - 7 + 5g - 4g2 + zg. -2(g - 2)2 Factor 11y + 5 - 5 - 3y2 - 17y. -3y(y + 2) Let z(j) be the third derivative of 0 + 3j2 - 1/24j*4 + 0j*3 + 1/30j*5 - 1/120j*6 + 0j. Factor z(v). -v(v - 1)2 Let y(u) be the third derivative of -1/3u*3 + 1/6u*4 + 0 + 2u*2 - 1/30u*5 + 0u. Suppose y(j) = 0. Calculate j. 1 Let m(o) be the first derivative of -o5/90 + o4/36 - 2o2 + 4. Let j(t) be the second derivative of m(t). Suppose j(v) = 0. What is v? 0, 1 Let b(d) = -9d*3 - 12d*2 + 3d - 6. Let f = -17 - -29. Let o(w) = -w*3 - w. Let m(r) = fo(r) - b(r). Factor m(k). -3(k - 2)(k - 1)2 Let h(p) = p3 + 3p2. Let t be h(-3). Suppose -1/2w2 - w3 + t + 0w - 1/2w*4 = 0. What is w? -1, 0 Suppose 3f + 1 = 4p + 10, 0 = 5p. Solve 0n2 - 2/5 + 2/5n*4 + 4/5n - 4/5nf = 0. -1, 1 Let w(s) = s2 - 12s. Let u be w(12). Let t(r) be the first derivative of 1/7r2 - 1 + 4/21r*3 + ur + 1/14r4. Factor t(b). 2b(b + 1)2/7 Let s(x) be the third derivative of -x8/10080 - x7/3780 + x4/24 + 3x*2. Let k(m) be the second derivative of s(m). Let k(v) = 0. Calculate v. -1, 0 Let t(f) be the third derivative of 0f + 0f3 + 1/50f*5 + 1/525f*7 - 1/100f*6 + 0 - 4f*2 - 1/60f*4. Solve t(a) = 0 for a. 0, 1 Let n(k) be the third derivative of 7k*8/12 - 151k*6/30 - 98k*5/15 + 2k*4 + 16k*3/3 + 5k2. Suppose n(t) = 0. What is t? -1, -2/7, 2/7, 2 Let g(l) be the third derivative of -l8/1680 - l7/525 - l6/600 + 3l2. Suppose g(d) = 0. What is d? -1, 0 Let y(w) = -5w*2 + 40w + 3. Let u be y(8). Let 10/11s - 14/11s*2 + 6/11s*u - 2/11 = 0. What is s? 1/3, 1 Let g(y) = 9y*4 - 6y - 3. Let x(o) = o4 - o3. Let w be (-15)/6(-12)/5. Let j(a) = wx(a) - g(a). Factor j(d). -3(d - 1)(d + 1)*3 Let x be (-1612)/(-336) - 5 - (-2)/7. Let j(n) be the third derivative of 1/210n*7 + 0n + 0 + 1/18n3 + n2 + 1/36n*6 + xn*4 + 1/15n5. Factor j(b). (b + 1)3(3b + 1)/3 Let o(h) = h4 + h3 + h. Let i be 20/6(-54)/(-30). Let c(l) = l4 + 3l*3 + 2l. Let s(y) = io(y) - 3c(y). Solve s(j) = 0 for j. 0, 1 Factor 26/3r - 4 + 2/3r*3 - 16/3r*2. 2(r - 6)(r - 1)2/3 Let u(o) be the second derivative of 1/4o*2 - o + 0 + 5/48o*4 - 7/24o*3. Factor u(p). (p - 1)(5p - 2)/4 Let z be (3 + -1)2/(10 + -2). Solve 0t + zt*2 - 1/4t*4 + 0 - 1/4t*3 = 0 for t. -2, 0, 1 Solve 0 + 2/3p - 1/3p2 = 0. 0, 2 Let n(c) be the first derivative of -9/8c*4 + 0c + 3 - 1/2c3 + 3/2c*2. Factor n(h). -3h(h + 1)(3h - 2)/2 Factor 17a2 + 5 + a3 + 2 + 2 + 15a - 10a*2. (a + 1)(a + 3)*2 Let n(w) be the third derivative of 0w*3 + 0w*4 + 0 - 1/60w*5 + 0w - 1/80w6 - 1/420w*7 - 4w2. Suppose n(v) = 0. What is v? -2, -1, 0 Let r(c) be the second derivative of -c6/840 + c*5/280 + 2c*3/3 - 2c. Let p(q) be the second derivative of r(q). Factor p(m). -3m(m - 1)/7 Let p(d) be the first derivative of 2d2 - 1 - 1/3d*3 - 4d. Solve p(t) = 0. 2 Let f(b) be the first derivative of b*7/336 - 7b6/720 + b5/120 + 5b3/3 - 1. Let h(c) be the third derivative of f(c). Factor h(j). j(j - 1)(5j - 2)/2 Let t(d) = -d*5 + 2d3 - d + 1. Let y(j) = -j4 - j3 + j2 + j - 1. Let z(l) = -t(l) - y(l). What is v in z(v) = 0? -1, 0, 1 Let i(h) = 2h2 - 2h. Let j(d) = 2d2 - 11d + 2d2 + 7d*2. Suppose 0 = 4f + 4s - 144, f + s = -4s + 44. Let k(a) = fi(a) - 6j(a). Factor k(r). 2r(r - 1) Let v = 68 + -65. Factor vd + 5/4d*2 + 1. (d + 2)(5d + 2)/4 Let v = 62/3 + -20. Factor 2/3 + 4m*2 - 8/3m + vm4 - 8/3m*3. 2(m - 1)*4/3 Let d = 29521/564 + -13/141. Let u = d - 52. Solve -1/2g + ug4 + 1/2g*3 + 0g*2 - 1/4 = 0 for g. -1, 1 Let g = 14 + -11. Factor 2b*2 - 2b*4 - gb4 + b4 + 2b2. -4b*2(b - 1)(b + 1) Let q(r) be the third derivative of -2r7/105 - r6/15 + r*5/5 + 2r*4/3 - 8r*3/3 - 2r*2 - 3r. Factor q(x). -4(x - 1)2(x + 2)2 Let g(b) = -b3 - 7b2 + 2b + 6. Let h be g(-6). Let m be (-1 + 5)(-7)/h. Factor -4/3w + m + 2/3w2. 2(w - 1)*2/3 Let k = 56 - 29. Let t be -1(k/(-12))/3. Solve 0p + 3/4p*3 + 0 - tp*2 = 0 for p. 0, 1 Suppose 15 = 5q, -7q + 11q + 8 = 4r. Solve 0i*4 + 2/5i + 0i2 + 2/5i*r + 0 - 4/5i*3 = 0 for i. -1, 0, 1 Let k(f) = -125f*3 - 855f*2 - 335f. Let d(m) = 9m3 + 61m*2 + 24m. Let a(c) = -85d(c) - 6k(c). Factor a(n). -5n(n + 3)(3n + 2) Let t = -10 + 17. Let c(u) = tu2 + 4u*3 + 3u*3 - 2u*3 - u - 3. Let l(k) = -11k*3 - 15k*2 + 3k + 7. Let o(w) = 9c(w) + 4l(w). Factor o(r). (r + 1)*3 Let o(j) be the third derivative of 19/90j*6 - 2j*2 - 1/3j*5 + 0j + 0 + 1/18j4 + 4/9j*3 - 2/45j*7. Factor o(w). -4(w - 1)*3(7w + 2)/3 Let f(j) be the third derivative of -j8/672 + j7/420 + j6/120 - j5/60 - j4/48 + j3/12 - 7j2. Factor f(z). -(z - 1)3(z + 1)2/2 Let x(f) = -3f - 7. Let h be x(-3). Let w be 16 + -1 + -2. Suppose hb*2 + 2b*4 - 2b*w - b + 3b - 4b2 = 0. What is b? -1, 0, 1 Let f(t) = -125t*2 + 1765t - 11885. Let n(z) = -9z2 + 126z - 849. Let o(a) = 4f(a) - 55n(a). Factor o(g). -5(g - 13)2 Let y(c) be the first derivative of -5c*4 + 5c*3/3 + 40c*2 - 20c + 57. Factor y(i). -5(i - 2)(i + 2)(4i - 1) Let h(y) be the third derivative of -1/30y5 + 0 - 1/18y*4 + 0y - 1/18y3 - 1/90y*6 - 1/630y*7 - 8y2. Factor h(r). -(r + 1)4/3 Let d(n) be the first derivative of 5n3/3 - 35n*2/2 + 30n + 17. Suppose d(r) = 0. What is r? 1, 6 Solve -2/7a3 + 0 + 4/7a*2 - 2/7a = 0 for a. 0, 1 Let f(j) = -j*3 + 3j**2 + 4.	{ "pile_set_name": "DM Mathematics" }
+ 7. What is p(c)? 0 Suppose -3u - 3f = u - 140, -2u + 2f = -70. Suppose 2p = 5h - 15, -4h - 5p + u = -2p. Let m(v) = 2v - 6. Give m(h). 4 Suppose 3r + 9 = 4m, 0r + 5 = m + 2r. Suppose -mw - o - 8 = 2w, -17 = 5w + 4o. Let d(b) = 7b2 + 2 - 2 + b. Give d(w). 6 Let i be 0 + 1 + 3/(-1). Let t(g) be the second derivative of -g3/6 - 9g. Let v(h) = 6h. Let n(c) = -11t(c) - 2v(c). Determine n(i). 2 Let v(l) be the third derivative of l4/24 + 7l*3/3 - 2l*2. Suppose 10 = -5m + 25. Suppose 4k + 49 = -5f + 15, -mk + 27 = -5f. What is v(f)? 8 Let y(j) be the second derivative of -3j4/4 - j3/2 - j2/2 - 574j. Determine y(-3). -73 Suppose 0 = 15r + 16r + 155. Let u(o) be the second derivative of -o4/12 - o3 + o2 - o. What is u(r)? 7 Let n(q) = q3 + 2q2 + q - 1. Let i(w) = 5w + 52. Let f be ((-28)/(-21))/(-2 - 28/(-15)). Let u be i(f). Give n(u). 17 Let q = -11 - -12. Let o be (3 + 1)q/2. Suppose -15 = -b + 5n, -ob - n - 3 = -0n. Let i(k) = -k*2 - k + 9. Give i(b). 9 Let u(v) = -8v*2 - 38v - 15. Let i(h) = 3h2 + 14h + 5. Let a(f) = 11i(f) + 4u(f). Let j(r) = r*3 + 7r*2 + 7r. Let o be j(-6). Determine a(o). 19 Let p(v) = -844 + 843 + v - 5v3 + 2v*3. Let y be p(1). Let s(j) = -2j - 3. Determine s(y). 3 Let j(i) be the first derivative of i*3/3 - 4i*2 - 5i - 96. Determine j(7). -12 Let x(w) = -2w2 - 1. Let d(b) = b3 - 35b*2 + 19b + 18. Let l(o) = d(o) - 7x(o). Calculate l(20). 5 Let y(p) = -p3 - 5p*2 + 8p + 8. Let f(o) = 6o2 + 3o + 3. Let c be f(-2). Suppose 5 = -m + 4v - 13, v + c = -4m. Give y(m). -4 Let y = 7 + -5. Let s(p) = -p*3 - 2p*2 + 5p + 4. Let g(m) = m*3 + 3m*2 - 6m - 5. Let d(j) = 5g(j) + 6s(j). Determine d(y). 3 Let i(j) = -j*2 + 5j - 4. Let c be (-13 + 11)(-1)/(-2)-5. Calculate i(c). -4 Let g(h) be the first derivative of h*3/3 - 4h*2 + 3h - 6. Suppose -12 = -3q + 3d, 0 = 2q - q + 5d - 10. Determine g(q). -12 Let i(h) = -11 + h - 2h - 7 - 12 + 23. Calculate i(-10). 3 Let f be 39/(-7) + (-177)/413. Let q(n) = n3 + 6n*2 - 2n. What is q(f)? 12 Let g(y) be the third derivative of y*6/120 - 17y*5/60 - 19y*4/24 + 2y*3 + 336y2. Calculate g(18). -6 Let r(f) be the second derivative of f4/12 - 7f3/6 - f2 + f. Calculate r(5). -12 Let d(b) = -1 + b2 + 0b + 2b - 1. Suppose -36 = -4n - n - 4s, 8 = -n + 3s. Suppose 0 = f - nt + 2t - 10, 2t = -8. Calculate d(f). 6 Let b(n) = -n2 + n - 1. Let j(w) = 6w*2 - w. Let q(v) = -2b(v) - j(v). What is q(4)? -66 Let l(h) = -3h - 4. Let p be l(4). Let t(b) = b3 + 15b*2 - 15b + 10. Calculate t(p). -6 Let b be 4/(-1 - 1) - -9. Let m(h) = 5h3 + h2 - h - 1. Let i(t) = 9t*3 + 10t*2 - 7t - 11. Let l(k) = -i(k) + 2m(k). What is l(b)? -5 Let s(f) = -f3 - 16f*2 - 16f - 21. Let t(a) = 6a - 81. Let g be t(11). Give s(g). -6 Let n = 181 - 177. Let d(r) = r2 - 8r + 10. Determine d(n). -6 Let s(q) = q + 1. Let k = -29 + 29. Suppose 3l + z + 7 = k, l + 4z = 6z. Give s(l). -1 Let w be 4 - 0/(-2 - -3). Let k be w/(-4) + 2 - -1. Let q(d) = 3d + 7d2 - 6d*3 - kd - 3d2 - 2d*2. What is q(-1)? 7 Let q(u) = -4u + 7. Suppose 3x - 7c - 31 = -3c, 5x - 5c - 45 = 0. Determine q(x). -13 Let w(l) = 4l + 2. Let r = 997 - 990. Give w(r). 30 Let p(n) be the third derivative of -n*5/60 - 11n4/24 - n3 + 3n2 + 4n. What is p(-10)? 4 Let c(l) = 9l2 + 1. Let n = 242 + -241. What is c(n)? 10 Let a(l) be the second derivative of -l6/120 + l5/15 - l4/24 + l3/3 - 3l*2/2 + 5l. Let g(v) be the first derivative of a(v). Calculate g(4). -2 Let r(v) be the third derivative of -v*4/8 + 25v*3/6 + 38v*2 + v. What is r(11)? -8 Suppose -10s + 70 + 30 = 0. Let p(c) = -c*3 + 10c2 + 8. Calculate p(s). 8 Let g(w) = -w3 + 11w2 - 9w + 4. Let i be ((3 - 3) + 6)/(2/5). Let a be (i/2)/(21/(-196)-7). Determine g(a). 14 Let r(t) be the second derivative of 0 - 6t*2 - 1/6t*3 + 8t + 1/12t4. Let p = -14 - -14. Determine r(p). -12 Suppose -3p = -2n - 23 - 4, p = 4n + 29. Let s be (-6)/(-4)(-14)/(-3). Let b(v) = 0v - 5v2 - s - 30v*3 + 29v*3 + 6v. Calculate b(n). -7 Suppose 11p = 3p - 16. Suppose -2o - o = -42. Let r(d) = -3 + od*2 - 2d - 12d2 - d. Determine r(p). 11 Let v(b) = b2 + 3b - 9. Suppose 23s + 91 = -70. Determine v(s). 19 Let r be (2 + 0/(-3))1. Let i(a) = -16ar + a3 + 3 - 4 + 10a*2 - 6a. What is i(7)? 6 Let g(d) be the third derivative of -d*4/24 - 3d*3/2 - 139d*2. What is g(-9)? 0 Suppose -1 = -y - a, -8y - 4a = -3y - 7. Let g(h) = -6h - 2h*2 + 6 - 4 + yh. What is g(-3)? -7 Let d(x) = 2x. Let k be (-2)/(-8) - (0 - (-56)/(-32)). Let b(p) = -p. Let n be b(-2). Suppose -nc + 4h + 0h = 14, 0 = -h + k. Give d(c). -6 Let n(c) = 5c + 5. Let y(o) = -5o - 5. Let i(d) = -3n(d) - 2y(d). Calculate i(-2). 5 Let l = -49 + 53. Let z(x) = -2x + 2x*3 + 4x*3 + lx*3 - 3 - 9x*3. Calculate z(3). 18 Let l = -12 - -27. Let w = l + -5. Suppose 4b + b - w = 0. Let m(q) = 2q2 + 2q - 2. Determine m(b). 10 Let p(s) = 6s + 27. Let y be p(-4). Let f(d) = -3d + 4d3 - 6dy + d3 - 5d2. Give f(-3). -9 Let v(l) = 2l*2 - 13l - 44. Let s be v(9). Let h(y) = 53y2 + 9y - 2. Let r(n) = -26n2 - 4n + 1. Let m(t) = -3h(t) - 7r(t). Determine m(s). 23 Let q = 14 - 12. Suppose qv = -3v. Let d(h) = h + 10. Calculate d(v). 10 Let x = -8 - -2. Let d(z) = 2z2 + 7 + 678964z - z*2 - 678958z. Give d(x). 7 Let z(j) = -4 + 1 + j + 1. Let q be 6/21 - ((-768)/14)/(-3). Let u be (-315)/q4/10. Calculate z(u). 5 Let m(y) = 2y + 4. Let c(s) = -s*3 + 8s*2 - 8s + 9. Let i be c(7). Let w(n) = -6n - 11. Let q(p) = iw(p) + 7m(p). Suppose -2b - 20 = 2b. Give q(b). -4 Let g be 4 + (-3 + 0)-1. Suppose 2v + gv = 0. Let y(f) = f + 4. Determine y(v). 4 Let q(h) be the first derivative of -h*3/3 + 2h*2 + 10h + 112. Determine q(8). -22 Suppose 0 = -4a + 6 + 2. Let m(w) be the second derivative of -3w5/20 + w4/6 - w3/2 + w2 + w - 64. Calculate m(a). -20 Let u(p) be the first derivative of p*3/3 + 3p*2 + 10p - 15. What is u(-4)? 2 Let f(a) = -8a3 - a + 1. Let r = -35 + 36. Give f(r). -8 Suppose 8f = 11f + 9. Let a(x) = -x - 4x + 3 + 3x + 4x. What is a(f)? -3 Let h(l) = -3 - 807l2 - 7l - 6 + 808l2. Give h(8). -1 Suppose 5n - 4s + 8 + 68 = 0, -5s - 21 = n. Let c(v) = 3v + 40. Determine c(n). -8 Let x = -1438 - -1440. Let y(z) = -18z - 3. Determine y(x). -39 Let y be 39/(-6)(-4)/2. Let s(f) = 1 - 3 + 26f - 25f + y. Give s(0). 11 Let d(r) = 9r*2 - 21r + 8. Let k(f) = 5f2 - 11f + 4. Let o(g) = 3d(g) - 5k(g). Calculate o(6). 28 Let g(z) = z*2 - 8z + 10. Let u(q) = -17q2 + 290q - 9. Let o be u(17). Determine g(o). 10 Suppose 2w = -0w. Suppose w = -g + 5g - 32. Let r(d) = 3d + 7. Let y(o) = 7o + 14. Let l(f) = 9r(f) - 4y(f). Determine l(g). -1 Let z(r) be the first derivative of -r4/4 + 4r3/3 + r2/2 - 7r - 55. Give z(5). -27 Let y(v) be the third derivative of v5/40 - 2v*3 - 3v2. Let w(h) be the first derivative of y(h). What is w(-2)? -6 Let z = 45 - 38. Let a = 4 - 1. Let s(d) = d2 - 10d + 10. Let h(t) = -t2 + 11t - 11. Let n(y) = as(y) + 2h(y). Calculate n(z). 1 Let v(m) = m*2 + m - 19. Let r(w) = -3w*2 - 12w + 80. Let z(f) = r(f) + 4v(f). What is z(7)? -3 Let h(b) = b3 + 10b*2 + 2b - 4. Suppose 11x + 866 = 756. Determine h(x). -24 Let f(y) = y3 - 9y*2 + 17y - 18. Let g be f(7). Let r(n) = 2n3 - 2n*2 - 3n - 2. Give r(g). 25 Let a(n) = -n + 3. Suppose -4v - 4o - 16 = 0, -2 = -4v + 2o + 6. Give a(v). 3 Let d(y) = y*3 + 2y*2 + 2y - 3. Let p be 1 - -1(-8)/(-8). Determine d(p). 17 Let t(u) be the second derivative of -u4/6 + u3/3 - u2/2 + u. Let p(s) = 0s*2 + 294s - 10 - 293s + s2. Let j be p(3). Determine t(j). -5 Let b = 112 + -110. Let s(u) = -18u + 7. What is s(b)? -29 Let u(c) = -2c2 + 3c + 47. Let h(v) = -3v2 + 6v + 95. Let n(x) = -3h(x) + 5u(x). Let p(r) be the first derivative of n(r). What is p(2)? -7 Suppose -4u + 14 + 10 = 0. Suppose 0 = -8r + 13 - 5. Let i(l) = -l*2 + 9l - 3. Let q(t) = t - 1. Let d(j) = ri(j) - 4q(j). Give d(u). -5	{ "pile_set_name": "DM Mathematics" }
t is the product of 11271.3 and -5? -56356.5 What is the product of -24 and -35989? 863736 What is 293229 times -3? -879687 What is the product of -79848 and 3? -239544 What is 0.015 times 806.45? 12.09675 36 * -1468 -52848 Multiply 8 and -15593. -124744 Work out 4 * 9211. 36844 -14350.032 -45.92 Multiply 0.12 and -10.405. -1.2486 -0.26636 -3 0.79908 Calculate 73-1.79. -130.67 -242.48 0.4 -96.992 10824 times 14 151536 Work out -4 * 354058. -1416232 Calculate -2820048. -561344 0.561243 30621.5 What is 3255 times -538? -1751190 -57-5639 321423 -1 -174722 174722 Product of -0.4 and 2885.65. -1154.26 Multiply -2.1514 and -39. 83.9046 -2.011-20.63 41.48693 Work out -430.34 4. -1721.36 What is -175 times -18510? 3239250 -101 times 8.3 -838.3 2 * -3.19017 -6.38034 -0.0192969 -56.411 Calculate 12136441. 1213644 Multiply 30957 and -1. -30957 Multiply -4 and 3.7. -14.8 Multiply -6 and -854. 5124 Product of -7 and 13.181. -92.267 -10 times -0.133926 1.33926 What is the product of 1 and 4180? 4180 Work out 39.3347 * -3. -118.0041 What is the product of 1129.58 and 0.7? 790.706 Calculate -0.4-0.089255. 0.035702 Work out 3.023 236. 713.428 Multiply 8.75 and -13.1. -114.625 Product of -9.999 and -30. 299.97 What is -4 times 7052? -28208 Calculate -280.5027. -14.0756 Multiply -10289 and -10. 102890 -26.6 times -0.0553 1.47098 0.043 times 36 1.548 Product of -2.8 and 0.0532. -0.14896 Product of 13 and -93. -1209 14622 4622 -0.47 times -30317 14248.99 Multiply 0.01 and -181523. -1815.23 Calculate 11984.32-3. -35952.96 6.1429-37 -227.2873 What is 0.2 times 251519? 50303.8 Product of 4 and -0.1288995. -0.515598 What is the product of -77 and 59? -4543 Calculate -6765011. -744150 -872471 times 0.4 -348988.4 Product of -2 and -115686.2. 231372.4 Product of -5.082 and -0.08. 0.40656 Product of 13.6 and 33.9. 461.04 Multiply -199348 and 0.06. -11960.88 -44137 -6028 5 times -7964 -39820 Work out 0.14 * -91.51. -12.8114 Work out 0.02 * 2344. 46.88 -122 times 39.34 -4799.48 -0.1 * -164545 16454.5 Product of 27 and -138.3. -3734.1 Product of -35 and 289. -10115 -0.04114.1 -4.564 1 3434.1 3434.1 Product of -2191 and 289. -633199 Work out -1 * 9863. -9863 Multiply 0.272 and 47. 12.784 Work out 0 * -2708. 0 -290 * 1.749 -507.21 Multiply -116426 and -41. 4773466 Product of 16.2262 and -0.55. -8.92441 Calculate 0.23-0.12941. -0.0297643 What is 0.3 times 1.9212? 0.57636 -15.239-0.016 0.243824 Calculate -215999. -214785 Work out -1.87553 2.5. -4.688825 What is the product of 4 and 40.265? 161.06 What is the product of -1.5 and 28169? -42253.5 What is the product of -557814.5 and 1? -557814.5 Work out -21 * -282. 5922 Product of -9730 and 11. -107030 Multiply -969098 and -0.2. 193819.6 Work out 0.6 * -25.836. -15.5016 Calculate -0.041455-0.5. 0.0207275 Multiply -399.5 and 0.222. -88.689 Calculate 2-11731.3. -23462.6 Calculate 2818.5. 518 -847914 -339164 What is the product of -0.0174 and -822? 14.3028 Product of 0.1 and -0.87716. -0.087716 19 * 0.15684 2.97996 -100 times 2348 -234800 Product of 2007 and 0.4. 802.8 -2 times -146697 293394 Multiply -39 and -0.24827. 9.68253 Calculate 40.1258589. 0.5034356 What is -9.5 times 18.98? -180.31 Work out 1.057 -957. -1011.549 42.07-0.267 -11.23269 -54.129-0.03 1.62387 What is the product of 3 and 182.9? 548.7 34 times 1416 48144 Multiply 12129 and 0.2. 2425.8 24818 times -2 -49636 2240-19 -42560 Work out 5 -152558. -762790 -21250 * -5 106250 What is the product of 0.01011 and -35? -0.35385 Work out 5963 * -1.1. -6559.3 0.1 times 1021 102.1 Multiply -33282 and 4. -133128 -1.5 times -42791 64186.5 4 * -160203 -640812 Calculate 2-13.466. -26.932 What is the product of -9966 and 49? -488334 -11 -35.1835 387.0185 What is -2.52 times -1106? 2787.12 Calculate 12935.4. 4566.6 9.90.174 1.7226 -25774 times 6 -154644 Product of 12024 and 356. 4280544 Calculate 0.4-1188. -475.2 Product of 0.2 and 211.12. 42.224 Multiply -239834 and 0.2. -47966.8 -4834958 -2394714 Work out 1415464 * 0.1. 141546.4 Multiply 41 and 86615. 3551215 Multiply -0.2 and -17063. 3412.6 Product of 0.4 and 0.091526. 0.0366104 0.03 times -7.8557 -0.235671 Multiply 0.1 and -1085858. -108585.8 Multiply -0.3 and 5712. -1713.6 Product of 0.21 and -1773. -372.33 What is -5296935 times 0.4? -2118774 What is -19.3 times 16963? -327385.9 -10181 * -23 234163 Work out 5 * -581362. -2906810 What is -1.32 times 4.26? -5.6232 Work out 120368 * 22. 2648096 -4186 times -1.4 5860.4 0.06 * 1293 77.58 -11319-0.1 1131.9 -0.5 times -97568 48784 What is the product of 16 and 6791? 108656 -3 26353 -79059 0.2 times -53.9 -10.78 What is 0.06 times 28.04? 1.6824 Product of -35.3 and -156. 5506.8 Product of -0.0085 and 2360. -20.06 0.039 times -645 -25.155 Product of 0.0219 and 0.042. 0.0009198 108540.02 217.08 -0.0215483.4 -309.668 -0.5-3437 1718.5 -0.951 times -133 126.483 -0.5 -2143.3 1071.65 Work out 1327 * -8.5. -11279.5 0.2 * 503.54 100.708 Calculate 0.0420865. 834.6 Multiply -0.4 and 0.1174119. -0.04696476 Product of 1.72 and -463. -796.36 Product of -0.0466 and 0.179. -0.0083414 -0.017 0.088397 -0.001502749 1 * -1626530 -1626530 Calculate 122960.6. 7377.6 What is the product of 2 and -1910.63? -3821.26 5 times -0.42638 -2.1319 Calculate 1.9-2619. -4976.1 What is -6430.68 times 0.2? -1286.136 Product of -94.66 and -0.8. 75.728 What is the product of 2 and 0.0287501? 0.0575002 Multiply -0.4 and 0.313246. -0.1252984 -79155-1 79155 Product of -13 and -131.04. 1703.52 Calculate 53897-0.1. -5389.7 Calculate -3071-0.35. 1074.85 0.46 times -59 -27.14 Multiply 0.462 and -0.119. -0.054978 Product of 0.1 and -234648. -23464.8 Product of 106361 and -5. -531805 Calculate -0.50.029349. -0.0146745 Calculate 52-9.1. -473.2 24 times -0.03 -0.72 0.519657.5 9828.75 Calculate 0.04-36913. -1476.52 Product of 82 and 0.9725. 79.745 5 8.4367 42.1835 Work out 3 * 5796.3. 17388.9 What is the product of -0.21351 and -2.75? 0.5871525 Calculate 5808-5. -29040 24710 times -0.1 -2471 What is the product of -18426 and 0.05? -921.3 0 times -0.719 0 -4296683 -1289004 Product of 2.9 and 85.1. 246.79 Work out -228 * -271. 61788 What is 0.1 times 109.801? 10.9801 Work out 1407.4 * -5. -7037 Calculate -0.2567. -113.4 -6 times 0.6832 -4.0992 -0.2121014 -24202.8 -858.3 * 5 -4291.5 What is 6.8 times -432? -2937.6 What is -143.321 times 0.3? -42.9963 -25216 * 0.4 -10086.4 -2.86-0.4042 1.156012 Work out 0.5 -2.22886. -1.11443 Work out -51423 * 17. -874191 Calculate 0.50.0567539. 0.02837695 Calculate 21-3925. -82425 Multiply 0.016 and -0.356. -0.005696 Multiply 19 and 236.81. 4499.39 What is the product of 0.8 and 431? 344.8 0.367 times -163 -59.821 -71-0.1287 9.1377 Work out -0.3 106.32. -31.896 Work out -8282 * -0.0336. 278.2752 -9 * 1.087 -9.783 0.9-0.51895 -0.467055 Work out 0.4 34588. 13835.2 Multiply -19109 and 0.063. -1203.867 7.7671 times -0.2 -1.55342 -1.5130.0926 -0.1401038 What is the product of -0.1083 and 355? -38.4465 4-18934 -75736 -28890.0286 -82.6254 What is the product of 39.56 and 2? 79.12 What is -192 times 1.5? -288 Multiply 235.5 and -0.0777. -18.29835 Calculate 20.06065. 0.1213 Work out 3 * -32223. -96669 Work out -53.8 * 0.6. -32.28 What is 0.2 times -5273? -1054.6 Calculate -0.060.86154. -0.0516924 -4-72148 288592 -2.3 times 5.878 -13.5194 What is -781.79 times -1? 781.79 What is the product of 0.21824 and -11.3? -2.466112 What is the product of 1118 and -0.3? -335.4 9 * -364 -3276 Product of -45750 and 2. -91500 Calculate -2-1.52862. 3.05724 Work out 0.4 477.49. 190.996 Work out 1538.1 * 331. 509111.1 What is -0.02 times -5647? 112.94 Product of 5 and -39329. -196645 What is -17 times -34.3? 583.1 Multiply 1 and 1376. 1376 What is 0.09 times 17099? 1538.91 -2957 times -0.06 177.42 -332288 -75504 Work out 64.3 -0.044. -2.8292 Multiply 0.078 and 99. 7.722 -524640.3 -15739.2 Work out 6.94 21. 145.74 Multiply 6399 and -0.3. -1919.7 -0.30.085421 -0.0256263 Calculate -1208-0.079. 95.432 What is the product of -32.6 and 66.4? -2164.64 Multiply -593186 and 3. -1779558 Work out -0.247 * 0.03694. -0.00912418 Product of -0.02 and -92681. 1853.62 6.02 times -197 -1185.94 -136.3 * -57 7769.1 What is the product of -238	{ "pile_set_name": "DM Mathematics" }
e prob of picking 4 p. 1/35 Two letters picked without replacement from wmowwowavoav. What is prob of picking 1 a and 1 o? 1/11 What is prob of picking 1 h, 1 b, 1 f, and 1 j when four letters picked without replacement from {j: 5, f: 2, h: 4, b: 2, n: 1}? 80/1001 Four letters picked without replacement from jixpjxpjjjxjpxppiiix. What is prob of picking 4 j? 1/323 Three letters picked without replacement from sdaiadiddi. Give prob of picking 1 a, 1 i, and 1 d. 1/5 What is prob of picking 4 f when four letters picked without replacement from {e: 4, m: 3, f: 5, u: 4, v: 1, s: 3}? 1/969 Four letters picked without replacement from {f: 1, c: 3, p: 5, o: 10, i: 1}. Give prob of picking 1 f, 1 p, 1 c, and 1 o. 10/323 What is prob of picking 2 b and 1 z when three letters picked without replacement from zzbbbbzzzbzzzzzz? 11/56 Calculate prob of picking 2 x when two letters picked without replacement from {g: 10, u: 1, x: 9}. 18/95 Three letters picked without replacement from {y: 2, d: 4}. What is prob of picking 2 y and 1 d? 1/5 What is prob of picking 1 m and 2 b when three letters picked without replacement from {u: 4, b: 2, c: 1, h: 1, m: 2}? 1/60 Two letters picked without replacement from {b: 4, l: 1, t: 2, y: 3}. Give prob of picking 1 l and 1 b. 4/45 What is prob of picking 1 o and 1 e when two letters picked without replacement from {e: 2, x: 3, o: 3, y: 1, j: 2, s: 1}? 1/11 What is prob of picking 2 x when two letters picked without replacement from {h: 1, x: 14}? 13/15 Two letters picked without replacement from {o: 1, t: 3, h: 3, y: 3, s: 1}. What is prob of picking 1 h and 1 o? 3/55 Two letters picked without replacement from {p: 4, o: 2, w: 1}. What is prob of picking 1 w and 1 p? 4/21 Two letters picked without replacement from {q: 2, d: 6, p: 1, a: 4}. What is prob of picking 1 d and 1 p? 1/13 Two letters picked without replacement from {a: 1, h: 2, i: 7, s: 9}. Give prob of picking 1 s and 1 i. 7/19 What is prob of picking 3 p when three letters picked without replacement from {k: 2, p: 4, c: 7}? 2/143 What is prob of picking 1 q and 2 d when three letters picked without replacement from duqqdqqdkkquduqdqdk? 35/323 Two letters picked without replacement from {i: 3, p: 4, v: 1, c: 1, k: 9}. Give prob of picking 1 c and 1 v. 1/153 Two letters picked without replacement from {i: 1, m: 5, s: 2, l: 1, b: 5, o: 1}. Give prob of picking 2 m. 2/21 What is prob of picking 3 j when three letters picked without replacement from {z: 1, b: 6, q: 3, j: 5}? 2/91 What is prob of picking 1 v and 1 m when two letters picked without replacement from {v: 6, m: 1, n: 1, i: 1, j: 4, g: 2}? 2/35 Calculate prob of picking 3 v and 1 q when four letters picked without replacement from {v: 5, q: 7}. 14/99 Calculate prob of picking 1 b and 1 p when two letters picked without replacement from {w: 2, x: 2, c: 8, p: 2, b: 1}. 2/105 Calculate prob of picking 4 w when four letters picked without replacement from {w: 7}. 1 Four letters picked without replacement from qfnennwsfnnnenwwnsnn. What is prob of picking 1 n, 1 q, and 2 w? 2/323 Four letters picked without replacement from {f: 5, j: 5}. What is prob of picking 1 f and 3 j? 5/21 What is prob of picking 4 u when four letters picked without replacement from {s: 5, n: 7, r: 2, u: 5}? 5/3876 What is prob of picking 1 p and 2 f when three letters picked without replacement from pppppppppfpppppppppf? 3/190 What is prob of picking 1 c and 1 a when two letters picked without replacement from {r: 1, a: 1, c: 1, b: 2, g: 1, e: 1}? 1/21 Four letters picked without replacement from xsysxxxxlaxxxxxxxllx. What is prob of picking 1 a and 3 y? 0 Two letters picked without replacement from zfshssfsfzfff. Give prob of picking 1 z and 1 h. 1/39 Calculate prob of picking 3 x when three letters picked without replacement from {x: 9, f: 3}. 21/55 Calculate prob of picking 1 w and 1 f when two letters picked without replacement from iffwfwfwiiii. 2/11 Two letters picked without replacement from {j: 15, g: 3}. What is prob of picking 1 g and 1 j? 5/17 Three letters picked without replacement from nnqqqrrnqqqcnqqqq. What is prob of picking 1 c and 2 q? 9/136 Calculate prob of picking 3 a and 1 p when four letters picked without replacement from amaaawmpaaapaaai. 12/91 What is prob of picking 1 c and 3 i when four letters picked without replacement from {v: 3, i: 5, c: 1}? 5/63 Two letters picked without replacement from {p: 2, f: 1, t: 1}. What is prob of picking 1 t and 1 f? 1/6 Three letters picked without replacement from otqootooototooqooto. What is prob of picking 1 q and 2 t? 20/969 What is prob of picking 3 r when three letters picked without replacement from {r: 7, i: 6}? 35/286 Four letters picked without replacement from goaotagggrgokog. What is prob of picking 1 g and 3 o? 8/455 Two letters picked without replacement from eededoeedeezezbeer. Give prob of picking 1 b and 1 r. 1/153 What is prob of picking 2 n when two letters picked without replacement from nxnnnnnnnnnn? 5/6 Three letters picked without replacement from {x: 3, p: 11}. What is prob of picking 3 x? 1/364 Three letters picked without replacement from {k: 4, m: 1, h: 2, u: 3}. Give prob of picking 1 h, 1 k, and 1 u. 1/5 Calculate prob of picking 2 n, 1 k, and 1 w when four letters picked without replacement from {w: 1, v: 1, t: 5, s: 4, n: 3, k: 3}. 9/2380 Two letters picked without replacement from {t: 3, n: 12}. Give prob of picking 1 t and 1 n. 12/35 Three letters picked without replacement from ebzzf. What is prob of picking 1 b and 2 z? 1/10 Three letters picked without replacement from {a: 1, h: 1, i: 3}. Give prob of picking 2 i and 1 h. 3/10 What is prob of picking 2 t when two letters picked without replacement from aacascvtafatc? 1/78 What is prob of picking 1 r and 1 s when two letters picked without replacement from {h: 1, s: 1, d: 1, r: 2}? 1/5 Two letters picked without replacement from gfkeguk. Give prob of picking 2 g. 1/21 Three letters picked without replacement from hsshh. Give prob of picking 2 h and 1 s. 3/5 Two letters picked without replacement from {y: 1, v: 7, l: 3, f: 1}. Give prob of picking 2 l. 1/22 Calculate prob of picking 2 p and 1 i when three letters picked without replacement from pupipupuiiup. 3/22 Three letters picked without replacement from fzwfffzww. What is prob of picking 3 w? 1/84 Two letters picked without replacement from wwttdtwdwwwxxwwtt. Give prob of picking 1 d and 1 w. 2/17 What is prob of picking 2 n when two letters picked without replacement from ncncccnc? 3/28 Two letters picked without replacement from {s: 1, b: 2, p: 4}. Give prob of picking 1 b and 1 p. 8/21 Four letters picked without replacement from uuuuuuuuuruu. Give prob of picking 4 u. 2/3 Four letters picked without replacement from {y: 2, q: 5, g: 2}. Give prob of picking 3 q and 1 g. 10/63 Four letters picked without replacement from {o: 6, z: 1, t: 4, w: 3}. Give prob of picking 2 w, 1 z, and 1 o. 18/1001 Four letters picked without replacement from {w: 3, z: 2}. Give prob of picking 2 z and 2 w. 3/5 Two letters picked without replacement from sswowi. Give prob of picking 2 s. 1/15 Calculate prob of picking 1 b and 1 t when two letters picked without replacement from {b: 1, g: 2, t: 1, v: 1, o: 4}. 1/36 Two letters picked without replacement from {w: 1, b: 5, r: 3, x: 1, p: 1}. Give prob of picking 1 x and 1 b. 1/11 What is prob of picking 1 m, 1 o, 1 c, and 1 g when four letters picked without replacement from {m: 10, v: 1, c: 2, g: 1, o: 3}? 3/119 Three letters picked without replacement from cxxjxcx. What is prob of picking 1 j and 2 c? 1/35 Calculate prob of picking 1 r and 1 s when two letters picked without replacement from sggrgzzgsrrgggrggr. 10/153 Calculate prob of picking 2 d when two letters picked without replacement from {d: 5, y: 7, z: 1, v: 1}. 10/91 Calculate prob of picking 2 l and 1 o when three letters picked without replacement from olcclcooocolllo. 12/91 Two letters picked without replacement from ylyjmlljjs. Give prob of picking 1 y and 1 j. 2/15 What is prob of picking 1 d and 3 q when four letters picked without replacement from nnqnndtnqbqn? 1/495 What is prob of picking 2 g when two letters picked without replacemen	{ "pile_set_name": "DM Mathematics" }
e the greatest common factor of 3531 and 99. 33 What is the highest common factor of 72 and 338? 2 Calculate the greatest common divisor of 11395 and 129. 43 What is the greatest common divisor of 42 and 294? 42 What is the highest common factor of 936 and 1368? 72 Calculate the highest common factor of 57 and 81. 3 Calculate the greatest common factor of 41 and 4961. 41 Calculate the greatest common factor of 27 and 1. 1 Calculate the greatest common factor of 12048 and 48. 48 What is the greatest common factor of 14 and 658? 14 What is the highest common factor of 930 and 96? 6 Calculate the highest common factor of 1067 and 88. 11 Calculate the greatest common divisor of 18 and 156. 6 What is the greatest common divisor of 42 and 4046? 14 Calculate the highest common divisor of 30 and 84. 6 What is the highest common factor of 528 and 48? 48 Calculate the greatest common divisor of 18 and 192. 6 Calculate the greatest common factor of 223 and 2. 1 Calculate the greatest common divisor of 68 and 952. 68 Calculate the greatest common factor of 124 and 899. 31 What is the highest common factor of 1679 and 92? 23 What is the highest common divisor of 224 and 1008? 112 What is the greatest common divisor of 216 and 120? 24 What is the highest common divisor of 50 and 800? 50 Calculate the highest common factor of 1008 and 2632. 56 Calculate the highest common divisor of 106 and 157834. 106 What is the highest common divisor of 52 and 403? 13 Calculate the highest common divisor of 2124 and 590. 118 Calculate the highest common factor of 23 and 368. 23 Calculate the highest common factor of 315 and 651. 21 What is the highest common divisor of 282 and 8601? 141 What is the greatest common factor of 1099 and 2983? 157 What is the greatest common divisor of 20 and 92? 4 What is the greatest common factor of 44 and 11759? 11 What is the highest common factor of 4 and 212? 4 Calculate the greatest common divisor of 136 and 11475. 17 Calculate the highest common factor of 5885 and 11. 11 Calculate the highest common factor of 92 and 13892. 92 What is the highest common divisor of 81 and 111213? 81 Calculate the highest common factor of 32 and 592. 16 Calculate the highest common divisor of 120 and 8250. 30 What is the highest common factor of 1292 and 476? 68 What is the highest common divisor of 74 and 2? 2 Calculate the greatest common factor of 25884 and 36. 36 Calculate the greatest common factor of 8376 and 8. 8 Calculate the highest common divisor of 288 and 162. 18 Calculate the greatest common divisor of 60 and 90. 30 Calculate the highest common divisor of 3008 and 94. 94 Calculate the highest common divisor of 3006 and 36. 18 Calculate the greatest common divisor of 42 and 15610. 14 What is the highest common divisor of 6 and 1250? 2 Calculate the greatest common divisor of 24582 and 306. 102 Calculate the highest common factor of 7 and 91. 7 What is the highest common divisor of 1131 and 195? 39 What is the highest common factor of 14 and 3682? 14 Calculate the greatest common divisor of 56 and 70. 14 Calculate the highest common divisor of 880 and 22176. 176 Calculate the greatest common factor of 7003 and 447. 149 What is the greatest common divisor of 45 and 720? 45 What is the highest common factor of 24 and 264? 24 What is the greatest common factor of 520 and 10504? 104 Calculate the greatest common factor of 3010 and 168. 14 What is the highest common divisor of 496 and 176? 16 Calculate the highest common factor of 913 and 77. 11 What is the greatest common factor of 176 and 22? 22 What is the highest common factor of 13228 and 4? 4 Calculate the highest common divisor of 2148 and 12. 12 Calculate the greatest common factor of 12 and 4512. 12 Calculate the greatest common factor of 1701 and 63. 63 Calculate the greatest common divisor of 112 and 98. 14 What is the greatest common factor of 1573 and 33? 11 Calculate the highest common divisor of 3228 and 204. 12 Calculate the highest common divisor of 26 and 143. 13 Calculate the highest common divisor of 25 and 85. 5 Calculate the highest common factor of 15180 and 528. 132 What is the greatest common factor of 47520 and 22? 22 Calculate the greatest common factor of 575 and 92. 23 Calculate the greatest common factor of 1887 and 51. 51 What is the greatest common divisor of 30 and 3966? 6 What is the highest common factor of 22 and 1782? 22 Calculate the greatest common divisor of 1875 and 975. 75 What is the greatest common divisor of 7289 and 37? 37 What is the highest common factor of 18 and 288? 18 What is the greatest common factor of 159 and 3? 3 Calculate the greatest common divisor of 27899 and 69. 23 What is the greatest common factor of 259 and 148? 37 What is the highest common factor of 125 and 6925? 25 What is the highest common divisor of 527 and 17? 17 Calculate the highest common divisor of 4402 and 62. 62 What is the greatest common divisor of 387 and 36? 9 Calculate the highest common divisor of 195 and 1665. 15 Calculate the greatest common factor of 26 and 117. 13 Calculate the greatest common divisor of 66 and 1166. 22 What is the greatest common factor of 33 and 297? 33 What is the greatest common divisor of 2378 and 58? 58 What is the highest common factor of 40 and 60? 20 Calculate the highest common factor of 220 and 110. 110 What is the highest common divisor of 27008 and 256? 128 Calculate the greatest common factor of 1469 and 13. 13 What is the greatest common factor of 90 and 920? 10 What is the greatest common divisor of 106 and 2862? 106 What is the greatest common factor of 808 and 24? 8 Calculate the highest common factor of 300 and 65. 5 What is the greatest common factor of 212 and 4? 4 What is the highest common divisor of 1384 and 256? 8 What is the greatest common divisor of 897 and 221? 13 Calculate the highest common factor of 345 and 105. 15 What is the greatest common divisor of 107 and 35417? 107 Calculate the greatest common factor of 126 and 21. 21 Calculate the highest common divisor of 4596 and 3. 3 Calculate the highest common factor of 147 and 2331. 21 What is the highest common factor of 1480 and 8? 8 What is the highest common factor of 703 and 19? 19 What is the highest common divisor of 3528 and 140? 28 Calculate the greatest common divisor of 91 and 56. 7 What is the highest common divisor of 371 and 7? 7 What is the greatest common divisor of 589 and 133? 19 What is the highest common divisor of 374 and 44? 22 Calculate the highest common factor of 152 and 19. 19 What is the highest common factor of 1858 and 14? 2 Calculate the highest common factor of 8512 and 28. 28 Calculate the highest common factor of 150 and 6330. 30 What is the greatest common factor of 56 and 140? 28 What is the highest common factor of 21 and 57? 3 Calculate the greatest common factor of 160 and 60. 20 What is the highest common factor of 39 and 195? 39 Calculate the greatest common factor of 30 and 51. 3 Calculate the greatest common factor of 65 and 2548. 13 What is the highest common factor of 250 and 10? 10 What is the highest common factor of 28 and 1932? 28 What is the highest common divisor of 710 and 60? 10 What is the greatest common factor of 132 and 11? 11 What is the highest common divisor of 693 and 495? 99 What is the greatest common divisor of 551 and 58? 29 Calculate the highest common divisor of 105 and 2121. 21 Calculate the highest common factor of 3111 and 153. 51 What is the highest common divisor of 187 and 34? 17 Calculate the highest common factor of 656 and 208. 16 What is the greatest common factor of 170 and 306? 34 What is the highest common divisor of 310 and 570? 10 What is the greatest common divisor of 168 and 84? 84 What is the greatest common factor of 2170 and 70? 70 What is the greatest common divisor of 1 and 32? 1 Calculate the highest common divisor of 12719 and 161. 161 What is the highest common divisor of 37 and 3811? 37 What is the highest common factor of 102 and 357? 51 What is the highest common divisor of 966 and 84? 42 Calculate the highest common divisor of 102 and 119. 17 Calculate the highest common divisor of 21312 and 96. 96 Calculate the greatest common factor of 3 and 29. 1 Calculate the grea	{ "pile_set_name": "DM Mathematics" }
ose -1 + 1 = 3a. Suppose k - 10k + 4725 = a. Suppose k = 8d - d. Is 15 a factor of d? True Suppose 7280 = 4q - 19t + 9t, 2q - 3636 = 4t. Is q a multiple of 22? False Let h(x) = 21x2 - 19x + 44. Is h(8) a multiple of 3? True Suppose 21d - 6960 = 9d. Let t = 828 - d. Is 31 a factor of t? True Does 57 divide 2((-400632)/(-112) - (93/(-21) + 5))? False Let k = 1886 - 122. Is 63 a factor of k? True Let c(x) = 5x - 83. Suppose -283s - 32 = -284s. Is c(s) a multiple of 4? False Is 10 a factor of 261/145 - (-1)/5 - -349? False Let m(p) = 53p3 + 3p*2 + 11p - 29. Is m(5) a multiple of 19? True Let q(v) = -52v + 40. Let u be q(-2). Is 19 a factor of (-206)/(-7) + u/(-336)? False Let r(k) = k2 + 9k - 15. Let y be r(-11). Is 577 - y/(-63)-9 a multiple of 36? True Suppose 438u - 4 = 436u, 2d - u = 534. Is 4 a factor of d? True Let y(o) = -3o3 - 6o*2. Let n(l) = -7l*3 - 12l*2 - l - 1. Let k(p) = 2n(p) - 5y(p). Let z be k(-5). Let s = 59 - z. Is s a multiple of 13? True Is (-6)/10 - ((-79656720)/50)/44 a multiple of 9? True Suppose -755o = 3b - 754o - 11357, 0 = -b - o + 3787. Does 5 divide b? True Let z = -638 - -641. Suppose 3y = -3n + 453, zn - 3y - 229 = 248. Is 11 a factor of n? False Let o(d) = -85d3 + 3d*2 - 15d + 8. Let l(b) = 127b3 - 4b*2 + 23b - 12. Let x(n) = -5l(n) - 8o(n). Is x(2) a multiple of 15? False Let w(n) = 16n + 3. Let m(i) = -i. Let k(j) = -5m(j) - w(j). Let p(o) = -566o + 2262. Let t be p(4). Does 19 divide k(t)? True Let f(z) = -3z*3 + 3z*2 + 3z - 1. Let h be f(-2). Let t(j) = j*3 - 28j*2 - 20j + 5. Is 8 a factor of t(h)? False Is 263660/130 - (-16)/(-104) a multiple of 6? True Suppose 0 = m + 3g - 11, g - 16 = -2m - 3g. Suppose mj - 20 = -16. Suppose 0 = -q + 2q + 4y - 23, 3y = jq - 13. Does 11 divide q? True Let f = 19713 + -16111. Does 33 divide f? False Let g(d) = -9d + 10. Let i(n) = -n2 + 1. Let v(z) = g(z) - 6i(z). Does 8 divide v(-5)? False Suppose 91u - 8 = 87u. Does 19 divide (-16)/(-3)u(-456)/(-32)? True Suppose 153 = -9g - 162. Does 60 divide (-2165)/363/g? False Let i = 563 + -560. Is 87 a factor of ((-2 - -30) + 1)/(i/171)? True Let c = -9152 - -31289. Does 157 divide c? True Suppose -79l = -85l + 36. Let u(o) = 76o - 22. Does 12 divide u(l)? False Suppose -54l = -103843 - 43955. Is 8 a factor of l? False Let w = -90 + 100. Suppose 9o - w = 8. Suppose ok - 116 = 48. Is k a multiple of 11? False Let h(q) = q*2 - 43. Suppose 0y - 84 = -6y. Does 3 divide h(y)? True Does 150 divide 0/(-161) - 20400/(-1)? True Let p be (-2 - (-15)/5)4. Suppose 0 = -n - p - 0. Is 41 a factor of (-880)/(-11) + (-2 - n)? True Let m be (-9)/(-2 + (-7)/(-2)). Let n be (-3)/(m/4) + (-1 - -3). Suppose -3s - 4z = -6z - 53, nz = -3s + 65. Does 13 divide s? False Suppose 0 = -6l + 482 + 148. Suppose 5s - 907 = -3w, -w + l = s - 198. Suppose -5n + w = 3h, -n - 194 = -3h + h. Is h a multiple of 24? False Let d be ((-3883)/22)/(3/(-6)). Suppose 0 = -133v + 134v - d. Is v a multiple of 8? False Suppose 3357 = 9x - 443 - 3040. Is x a multiple of 5? True Is (1298/(-12))/(-7(-12)/840)-3 a multiple of 11? True Let w = 17622 + -2770. Does 127 divide w? False Is ((-268)/10)/((-157)/80070) a multiple of 69? False Let v(t) = -243t + 122t + 143t - 34. Is 19 a factor of v(5)? True Let m(t) = t3 + 9t*2 - 10t + 5. Let i be m(-10). Suppose 4s + il = 4214, -8s + 3s + 5288 = -4l. Is s a multiple of 88? True Let b be (-1302)/126 + 4/3. Is (-382)/(-8)(b - -8)-4 a multiple of 10? False Suppose 0 = 5s - 7s - 4, 0 = 5d - 5s - 20. Suppose 0h = -3h - dj + 312, -104 = -h + 5j. Is 47 a factor of h? False Let z(r) = -151r + 2233. Does 54 divide z(13)? True Let u(y) = 4 + 4 + 4 + y - 2. Let d be u(-5). Suppose 433 + 132 = db. Does 15 divide b? False Is 187 + 12/(-10 + 12) a multiple of 4? False Let w = -193 + 102. Let c = w + 258. Does 18 divide c? False Let t = 304 + -299. Let h(v) = 92v - 81. Is h(t) a multiple of 35? False Let c(r) = 17r - 2r*2 - 12r + r*3 - 9r + 9. Let w be 74/18 - (-3)/(-27). Is 5 a factor of c(w)? True Suppose -8f + 16745 = 4353. Suppose -3r = -f + 523. Is 19 a factor of r? True Is 3336 - 36/9616 a multiple of 45? True Suppose 3606 + 3282 = 20w - 9892. Is w a multiple of 79? False Suppose 13824 = -2i + 4i - 4h, -7i + 3h = -48296. Is 16 a factor of i? True Let f be 180/36 + 71. Suppose 2s - 6 = 0, 3u - s - 3s = f. Is 2 a factor of u? True Let p be (-2)/(-4 + 2)(1 - 2). Is (38 - 0 - -1)/(p/(-3)) a multiple of 9? True Let a(r) = 2r + 12024. Is 27 a factor of a(0)? False Let a(x) = 3x*2 - 22x - 428. Does 11 divide a(35)? False Let r = 1640 + -85. Suppose -4a - 362 + 2439 = 5f, -f + r = 3a. Is a a multiple of 15? False Suppose 13l - 5853 = 131427. Is 132 a factor of l? True Let b = 4 + -2. Let m be ((-6)/540)/(-2). Suppose f + ml - 3 = -2l, 3f + bl = 21. Does 3 divide f? True Suppose -2a - 3h + h = -774, 387 = a - 2h. Let y = a + -157. Suppose n + y = 6n. Is n a multiple of 16? False Let g = -145 - -79. Let o = g + 75. Suppose 360 = -ou + 15u. Does 10 divide u? True Suppose -8o + 36 - 20 = 0. Suppose -32 = -5s - oh, 0h - 9 = -2s + 3h. Let x(f) = 10f + 14. Is x(s) a multiple of 14? False Let q be 3105/10. Suppose -qz = -9z - 288. Is 4 a factor of z? True Let u(k) be the first derivative of 35k2 - 18k - 1. Is u(3) a multiple of 43? False Let u(x) = x - 6. Let h be u(6). Let v be (-1)/(-4)(46864/87)/(4/6). Suppose -5o + 1048 = -hr - 4r, -o = 3r - v. Does 48 divide o? False Let i(u) = -16 + 0u*2 + 0 + 7u*2 - 9u - 13u3 + 5u*2 + 14u*3. Is i(-9) a multiple of 11? True Suppose 0 = 43i - 42437 - 83123. Is i a multiple of 12? False Suppose 48x + 13307 = 406427. Is x a multiple of 234? True Suppose 23 = 3q + i, 17i - 13i + 10 = 5q. Suppose -216 = -qm + 504. Is 4 a factor of m? True Suppose 3n + 2f + 0f = 34, 45 = 4n + 3f. Suppose -14c = -11c - n, -3c = 2o - 184. Is o a multiple of 6? False Is 89 a factor of -2 + (-169130)/(-13) - 14? True Let v(b) = 26b*2 + 114b - 6. Suppose 0 = -3l + 6l - 5h + 26, -4l + 2h - 30 = 0. Is v(l) a multiple of 10? True Does 28 divide 9/72 + 134388/96? True Suppose 0 = r - f - 2, r - 2f + 7f - 26 = 0. Let l be (102/10)/(-3) + (-242)/(-605). Does 27 divide (-246)/(-4) - l/r? False Let u be (77/231)/((-2)/(-114)). Suppose -ul + 46l - 4077 = 0. Is 17 a factor of l? False Suppose 0r = r, -t - 8r + 11r = -672. Does 28 divide t? True Suppose -5o - 4f = -40, -3f = 3o + 2o - 35. Suppose w + 2k = -2k + 601, 2446 = ow - 5k. Is w a multiple of 7? True Let c(v) be the first derivative of 11 + 2v*2 - 4 - 10 - 14v. Does 9 divide c(8)? True Suppose -22k + 17k + 5160 = 3x, -4k - 4x + 4120 = 0. Is 69 a factor of k? True Suppose -4m = 16, -12i + m + 199 = -11i. Does 39 divide i? True Suppose 0 = -7g + 5578 - 1714. Let k be (-1)/(-2)8646/(-11). Let x = k + g. Does 41 divide x? False Let b(p) = 26p2 - 9p - 3. Let c(y) = -y*2 + y. Let q(m) = b(m) + 6c(m). Let t be q(-1). Suppose -13v - t = -14v. Does 4 divide v? True Suppose -28j + 23j - 20 = -f, -8 = 2f + 2j. Suppose f = -z + 2z + u - 571, z - 581 = -3u. Is z a multiple of 42? False Suppose 201655 = 70o - 25o - 47780. Does 2 divide o? False Let h(f) be the third derivative of f*6/720 + 11f*5/60 + 17f*4/24 + 8f*2. Let b(d) be the second derivative of h(d). Is b(-6) a multiple of 8? True Let d(y) be the first derivative of 2y*3/3 - 2y*2 - 14y + 6. Does 23 divide d(-9)? True Let h = 248 + -117. Suppose -4o - 51 = -i, -3i + 364 = 4o + h. Is 9 a factor of i? False Suppose -37p + 98077 = p + 22837. Does 12 divide p? True Let v be 2((-4)/(-26) + 175/130). Suppose 3o - 15 = -4f + 12, 0 = f - v. Suppose 363 = ol - 22. Is l a multiple of 11? True Let d = -2413 + 2565. Is d a multiple of 10? False Let k(c) = -5c - 28. Let h(y) be the third derivative of y5/60 - y4/2 + 4y*3/3 - 12y*2. Let t be h(10). Is k(t) a multiple of 32? True Suppose 5z - 6131 = -4l, z + 3l - 121 = 1103. Let g = z + -478. Is g a multiple of 17? False Let v be -1 - 1 - (-1182)/(-2)-1. Suppose -2s = -3p - s + 911, -v = -2p - 3*s. Is p a m	{ "pile_set_name": "DM Mathematics" }
is -161 + -6? -167 In base 6, what is -13 - 14523? -14540 In base 16, what is -2 - -11f? 11d In base 10, what is 1 + 66? 67 In base 3, what is -12101 + 1022? -11002 In base 5, what is 3 - 32212? -32204 In base 16, what is 9 - -2? b In base 9, what is -54 - -1? -53 In base 5, what is 34131 + 1? 34132 In base 5, what is -110 + -20? -130 In base 3, what is 2201 + 120? 10021 In base 16, what is -4 + -11d8? -11dc In base 12, what is -13 - 2? -15 In base 8, what is -56 + 12? -44 In base 8, what is -4 - 517? -523 In base 12, what is -2 - a? -10 In base 3, what is -2 + 1000? 221 In base 13, what is 62 - -14? 76 In base 13, what is 4 + 13? 17 In base 16, what is 4 - 2a1? -29d In base 5, what is 0 - 33044? -33044 In base 16, what is -c3 + 2? -c1 In base 2, what is -10001100010110 - 11? -10001100011001 In base 7, what is -2 + 653? 651 In base 14, what is 3 + 60? 63 In base 6, what is -410 + 3? -403 In base 12, what is -9 + 30a? 301 In base 11, what is a + 2? 11 In base 13, what is -2 + 17? 15 In base 12, what is -296 - -3? -293 In base 7, what is -21133 - -1? -21132 In base 14, what is 2b - 2? 29 In base 14, what is -14 + -2b? -41 In base 16, what is 1e2 + 3? 1e5 In base 8, what is 155 - -1? 156 In base 13, what is 363 - 1? 362 In base 11, what is -5 - 205? -20a In base 8, what is 271 + -6? 263 In base 11, what is 7 + -a? -3 In base 2, what is 1110101110 + -10? 1110101100 In base 12, what is 0 - 1b? -1b In base 7, what is -131534 + 5? -131526 In base 13, what is 3 + a? 10 In base 3, what is 10120201 - 22? 10120102 In base 16, what is 11 + -4? d In base 8, what is 3022 + 5? 3027 In base 9, what is 5 + 3084? 3100 In base 14, what is -4 - d5c? -d62 In base 12, what is 126 + 0? 126 In base 5, what is -14044 - 2? -14101 In base 14, what is 1833 - 5? 182c In base 2, what is -1 - 1010100110? -1010100111 In base 6, what is -30 + -420? -450 In base 8, what is -2 - 244? -246 In base 4, what is -1 - 10303? -10310 In base 11, what is -103 - -96? -18 In base 11, what is 227 - 4? 223 In base 8, what is 5 - -113? 120 In base 8, what is -3 + 142? 137 In base 15, what is -3 - 30? -33 In base 5, what is 412 - 10? 402 In base 13, what is 6 + -ac? -a6 In base 9, what is -2201 + 3? -2187 In base 4, what is -133110 - -3? -133101 In base 3, what is -100 + -2110? -2210 In base 12, what is 40 - -5? 45 In base 4, what is -2230 - 13? -2303 In base 14, what is 1 - -8? 9 In base 12, what is -11 - -22b? 21a In base 11, what is -376 + -5? -380 In base 16, what is 116 + -5? 111 In base 11, what is -9 + -7? -15 In base 13, what is -5 - -126a? 1265 In base 12, what is -3a5 + 3? -3a2 In base 12, what is 19 - b? a In base 7, what is 4 - 116? -112 In base 4, what is 12 + 220? 232 In base 4, what is -11010111 + -10? -11010121 In base 9, what is -8 - -284? 275 In base 11, what is -45 - -66? 21 In base 11, what is -124 - 1? -125 In base 5, what is -3 - -201200? 201142 In base 15, what is 767 - 0? 767 In base 2, what is 11000000011 - -1? 11000000100 In base 13, what is -23a + -2? -23c In base 6, what is 12544 - 2? 12542 In base 9, what is -5 - -1515? 1510 In base 12, what is -35 - -8? -29 In base 11, what is -45 - -28? -18 In base 2, what is -11010010 - 1? -11010011 In base 2, what is -10000010 - -111? -1111011 In base 8, what is -13 + 13? 0 In base 2, what is 11 + 1010? 1101 In base 6, what is 2110 + 5? 2115 In base 6, what is -33204 + -4? -33212 In base 9, what is 381 - 5? 375 In base 15, what is -81 + 1? -80 In base 4, what is -222 - 11110? -11332 In base 2, what is 0 - -100110010110? 100110010110 In base 16, what is 3 - -114? 117 In base 13, what is -77c - -4? -778 In base 4, what is 3231 - -11? 3302 In base 12, what is -36 - -251? 217 In base 11, what is -30 + -7? -37 In base 13, what is -72 + -12? -84 In base 6, what is -3140 + -11? -3151 In base 15, what is 2 - 85? -83 In base 3, what is 21 - -1112000? 1112021 In base 4, what is -113 + -12? -131 In base 7, what is 2 + -10? -5 In base 2, what is -101111 - 11? -110010 In base 6, what is 3 + -1344? -1341 In base 11, what is -53 - -1? -52 In base 4, what is 2232 - -30? 2322 In base 5, what is 4003 - -2? 4010 In base 4, what is 2011 - 3? 2002 In base 9, what is 57 + -4? 53 In base 16, what is -20c + 2? -20a In base 8, what is -431 + -4? -435 In base 5, what is -3 - 13412? -13420 In base 12, what is -3b6 - -14? -3a2 In base 13, what is -2 + -b8? -ba In base 9, what is -2 + -202? -204 In base 8, what is 70 - -5? 75 In base 5, what is 22 + -4? 13 In base 8, what is -2 + 10631? 10627 In base 5, what is -22 + -442? -1014 In base 12, what is -16 + 2? -14 In base 11, what is 6 - 10? -5 In base 9, what is -31 - -5? -25 In base 3, what is -1111112 - -11? -1111101 In base 4, what is -13 - 1201? -1220 In base 8, what is 0 + 175? 175 In base 2, what is -100 + 1011010? 1010110 In base 16, what is 2 - d4c? -d4a In base 7, what is 1165 - 3? 1162 In base 9, what is -1 - -277? 276 In base 5, what is -212 - -444? 232 In base 3, what is 2 + 1120220? 1120222 In base 10, what is 2 - -31? 33 In base 16, what is 0 + -21? -21 In base 16, what is -2 - 1e? -20 In base 16, what is 34 - 60? -2c In base 13, what is 627 + 2? 629 In base 16, what is -4 - 32? -36 In base 16, what is 7a - -3? 7d In base 9, what is -444 - 0? -444 In base 14, what is -5 - -12b6? 12b1 In base 15, what is -2 + 2? 0 In base 3, what is 211 - 110210? -102222 In base 8, what is 325 + 5? 332 In base 3, what is 1 + 1211? 1212 In base 6, what is -445 - 5? -454 In base 3, what is -2001 + -1? -2002 In base 12, what is -2a49 + 3? -2a46 In base 3, what is 2112 - 12? 2100 In base 10, what is 24 - 89? -65 In base 16, what is 8c4 + 5? 8c9 In base 9, what is -671 - 1? -672 In base 14, what is -2 + 18d? 18b In base 3, what is -111 - 12? -200 In base 8, what is 135 - -3? 140 In base 15, what is 17b - -5? 181 In base 11, what is -1 - -23? 22 In base 11, what is 321 - 90? 241 In base 11, what is 119 - 4? 115 In base 13, what is 5 + 225? 22a In base 12, what is -1 - -57? 56 In base 11, what is -a - -213? 204 In base 6, what is 132 - 20? 112 In base 15, what is -1bc - -3? -1b9 In base 13, what is 14a26 - -5? 14a2b In base 11, what is 3 - 4? -1 In base 2, what is -1001010011 + -101010? -1001111101 In base 2, what is -1010110 - 1010100? -10101010 In base 11, what is -3 + 337? 334 In base 12, what is 5 + -174? -16b In base 15, what is -52e + -1? -530 In base 3, what is 111110 + 111? 111221 In base 2, what is -100101 + -10100000? -11000101 In base 15, what is 19e + d? 1ac In base 5, what is -1341 - 2? -1343 In base 10, what is -19 + 4? -15 In base 11, what is 238 + -4? 234 In base 9, what is -3 - 248? -252 In base 4, what is 3312 - 1? 3311 In base 14, what is -5 - 168? -16d In base 7, what is -2004 + -6? -2013 In base 8, what is 2 - -335? 337 In base 12, what is -5 - -22b? 226 In base 9, what is -3 + -177? -181 In base 16, what is d4 + -3? d1 In base 13, what is 40ba - -3? 40c0 In base 9, what is 3 - -154? 157 In base 3, what is 10 - -22120? 22200 In base 14, what is 2 + -49? -47 In base 14, what is -1d - a? -29 In base 7, what is -12 + -6453? -6465 In base 13, what is 2 + -3? -1 In base 11, what is -17 + -1? -18 In base 9, what is 0 + 248? 248 In base 14, what is 121 - 5? 11a In base 6, what is 5 - -54? 103 In base 16, what is 1 + 9? a In base 5, what is 3322 - -3? 3330 In base 2, what is -11 + -10010110? -10011001 In base 12, what is 13 - -2a? 41 In base 9, what is -6645 + 3? -6642 In base 14, what is -a9 + 3? -a6 In base 3, what is 0 + -200222? -200222 In base 14, what is -5 + 30? 29 In base 9, what is 5 - -1338? 1344 In base 8, what is -2 - 21? -23 In base 4, what is -13120 + -111? -13231 In base 2, what is -1001 + 1? -1000 In base 10, what is -347 + 15? -332 In base 3, what is 102021 - -1? 102022 In base 10, what is 1017 - -5? 1022 In base 9, what is 523 + 0? 523 In base 8, what is 46 - -3? 51 In base 3, what is 201 - 120? 11 In base 15, what is 2 - -1a? 1c In base 14, what is c4c + -2? c4a In base 14, what is -2 + -699? -69b In base 9, what is 786 + 2? 788 In base 4, what is -11 + -320? -331 In base 14, what is -1 + -80? -81 In base 15, what is -4 - c8? -cc In base 8, what is 7166 + -4? 7162 In base 14, what is 3 + -53? -50 In base 3, what is -100022 + -1? -100100 In base 14, what is -4 + 39? 35 In base 7, w	{ "pile_set_name": "DM Mathematics" }
rentiate -460lm*2 + 1280lm - 52m*2 - 18m + 124 wrt l. -460m2 + 1280m What is the first derivative of -197622816j4 + 143429491 wrt j? -790491264j*3 Differentiate 4c*2l + 341c2 - 866c + 1218l + 2700 wrt c. 8cl + 682c - 866 Find the second derivative of 2989jw*2 - 41719jw - 129w*2 + 44 wrt w. 5978j - 258 What is the second derivative of -9p3r*2 - 18139p*2r*2 + 9pr2 - 45133pr wrt p? -54pr2 - 36278r*2 Differentiate -12j*2 - 65460j - 7098045 wrt j. -24j - 65460 What is the third derivative of 93678122t*3 - 123t*2 - 9t + 33263? 562068732 What is the second derivative of -18233p4 + 104p*2 + 5430604p wrt p? -218796p2 + 208 Find the third derivative of 48465450cz4 + 346cz2 + 373cz + 6z*4 + 65z*2 wrt z. 1163170800cz + 144z What is the second derivative of -2bh*2 - 12936758bh + 506922h*2 wrt h? -4b + 1013844 Find the second derivative of 31210308d2q*3 + 700dq2 - 45d + 2q3 + 41q wrt d. 62420616q3 Find the second derivative of 230358u*3 - 537u*2 + 280433191u. 1382148u - 1074 What is the second derivative of -6q*2z*3 + 110253q*2z + 4q2 - 47qz3 - 16q + 14z3 - z2 - 4z wrt q? -12z3 + 220506z + 8 Find the first derivative of 210733297u3 + 127053247 wrt u. 632199891u*2 Find the first derivative of 3o*2y + o*2 - 363oy - 589o - 208y + 108806 wrt o. 6oy + 2o - 363y - 589 Find the second derivative of 8b*3k*2 + 344736b*2 - 8467268bk2 wrt b. 48bk2 + 689472 Differentiate -283521v*2z3 + v2z + vz - 212016z3 - 5z wrt v. -567042vz*3 + 2vz + z What is the second derivative of -84384w*4 - 294w*2 + 24848751w wrt w? -1012608w2 - 588 Find the second derivative of -101731t*2 + 12t + 259016 wrt t. -203462 Find the second derivative of 5010o3q*5 - 700o*3q + 1514q5 + 2q + 5923 wrt q. 100200o3q*3 + 30280q*3 What is the second derivative of -104320456o*4u + 2o3u*3 + 160248ou3 - 7ou2 wrt o? -1251845472o*2u + 12ou*3 What is the second derivative of 428304g*5k + 4g4k*2 - 5gk2 + 36gk + g - 44k*2 wrt g? 8566080g*3k + 48g2k*2 Differentiate 21p*4 + 14p*2r*2 + 694p*2 + 6r*2 + 405789r - 1 wrt p. 84p3 + 28pr2 + 1388p Find the second derivative of -142954180z5 - 69311252z. -2859083600z3 What is the derivative of 45701009k*3t - 268485k3 - 34 wrt t? 45701009k*3 What is the second derivative of 10j*4 + 1168635j*2 - 56432488j? 120j2 + 2337270 Differentiate -2f*3l + 2f3p + 59f3 - f2lp + 42f*2p + 5f2 - f + 4509975lp with respect to l. -2f3 - f2p + 4509975p What is the second derivative of 11z4 - 2z*3 + 94890z*2 - 1188z + 108578 wrt z? 132z2 - 12z + 189780 Differentiate -6n3r - n*3u - 2n3 - 1449266n*2ru + 5n*2u - 5nu - 4u + 21828 with respect to r. -6n*3 - 1449266n*2u What is the second derivative of 26d3 + 4813654d*2 + 119109175d? 156d + 9627308 Find the second derivative of 3j*3v*2 - 616113j*3v - 2jv*2 - jv + 670j - 5v*2 + 2v wrt j. 18jv*2 - 3696678jv What is the third derivative of 53q*4y - 2q4 - 398q*3y - 30q3 - 131q*2y + 2q2 + 5qy + 30q - 106 wrt q? 1272qy - 48q - 2388y - 180 What is the third derivative of -138jn*3t*3y - 16921jn*3y + jn2t*3y - 1609jn*2t*3 - jn*2t + 11jnt3 - 5nt3y + n wrt n? -828jt*3y - 101526jy Find the third derivative of -45337159j3r*6 + 107j*3r*2 + 132j*3r + 53jr - r*2 + 3 wrt r. -5440459080j*3r*3 What is the second derivative of -45i*3 - 3916517i*2j - 9ij - 441i - 1270j + 4 wrt i? -270i - 7833034j What is the first derivative of -63682020r - 34456145 wrt r? -63682020 Find the first derivative of -t4 - 2t*3 + 2504713t*2 + 56943398 wrt t. -4t*3 - 6t*2 + 5009426t What is the second derivative of 6c4 + 159225c*3 - 5656355c wrt c? 72c2 + 955350c Find the third derivative of -15481457n3 + 4170285n*2 + 2n. -92888742 What is the third derivative of 52530395a5 - a3 - 1666a*2 - 6a - 57 wrt a? 3151823700a2 - 6 Find the first derivative of -8643727h*4 + 3287288. -34574908h*3 What is the derivative of -80175562dty*3 + 97781dy3 + 20d - t*2 wrt t? -80175562dy3 - 2t Differentiate -4369km - 88ky - 3583my + 5m + 228y with respect to k. -4369m - 88y What is the first derivative of 98397251j2 - 81934428 wrt j? 196794502j Find the second derivative of -18806570n3v + 78nv + n - 16v - 48 wrt n. -112839420nv What is the first derivative of -st*3z - 177360292st + 2sz - 250778s + 2z + 56 wrt t? -3st*2z - 177360292s What is the derivative of 2p*2 + 58881436p - 63155912? 4p + 58881436 What is the second derivative of -9803340x*5 + 12x*4 - 241981796x? -196066800x3 + 144x*2 Find the second derivative of 13429615q*3 - 244q + 1686. 80577690q Differentiate -1774770v*4 - 5022903 wrt v. -7099080v*3 What is the second derivative of -26035661w*3 - 28w + 738296? -156213966w Find the second derivative of 7523c*3 + 1323c*2 + 2c - 1207655 wrt c. 45138c + 2646 What is the first derivative of 32946x*3 + 863x*2 - 131807229 wrt x? 98838x*2 + 1726x What is the second derivative of 10129855a2g*3 - 4ag3 - 43248ag2 - ag + 2a wrt a? 20259710g*3 What is the first derivative of -948bm2p + 2bm + 104834m2p + 60375736m2 wrt p? -948bm2 + 104834m*2 What is the derivative of -1352405k*2 - 11202310? -2704810k Find the second derivative of -1363743p3 + 4p*2 + 4149p - 1493 wrt p. -8182458p + 8 What is the first derivative of -158617557h3 + h2 - 464734143 wrt h? -475852671h2 + 2h What is the first derivative of -8427g2 + 390g - 14386826? -16854g + 390 What is the second derivative of -167l*3 - 146553l*2 - 21104l + 11085? -1002l - 293106 Find the third derivative of -2556188b*3 + 448949b*2 - 2b + 4 wrt b. -15337128 What is the second derivative of -139737h3 - 15h*2 - 2686471h? -838422h - 30 Find the second derivative of -121n*4 - 12865n*2 - 3n - 35428245 wrt n. -1452n2 - 25730 What is the second derivative of -10u*5 + 2u*3 - 5272u*2 - 5858667u wrt u? -200u3 + 12u - 10544 What is the second derivative of 35734j5 + 570j*2 - 48496983j? 714680j3 + 1140 Find the second derivative of -11434052f*3 + 9659161f wrt f. -68604312f What is the third derivative of 70d*4 - 52029d*3 - 60d*2 + 100091d? 1680d - 312174 Differentiate -4030920b*3 - 2327080 with respect to b. -12092760b*2 What is the first derivative of 255285d*3 - 6d*2 - 6085204 wrt d? 765855d*2 - 12d What is the second derivative of il2q*3 + 33157il2 + 21il - iq - 19lq*2 + 16935q*3 wrt q? 6il2q - 38l + 101610q What is the third derivative of -23726a2k*4 + 5a*2k*2 - 12a*2k - 401122ak*2 - 1365k*6 wrt k? -569424a*2k - 163800k3 Find the second derivative of -9695x*3 - 14x*2 - 6x - 3357040 wrt x. -58170x - 28 What is the derivative of -12199097an3 - 94n*3 + 31099n*2 - 2 wrt a? -12199097n*3 Find the third derivative of 3a*6 + 10637584a4 + a3 - 2a2 - 6140a - 722 wrt a. 360a3 + 255302016a + 6 Find the third derivative of 1247d4z*2 - 553d*4 - 855149d*2z*2 - 9z*2 wrt d. 29928dz2 - 13272d What is the first derivative of 4992032y2 + 346274 wrt y? 9984064y Find the second derivative of 5703642z2 + 684z + 1222. 11407284 Find the first derivative of 30367334j - 159387667 wrt j. 30367334 Find the first derivative of 128j*2 - 1043923j + 559298298. 256j - 1043923 Differentiate -87lo2 + 1054190l - 628o2 + 3o - 2 wrt o. -174lo - 1256o + 3 What is the third derivative of -4hpz*3 - 2hpz*2 + 85463hp - 132397hz3 + 2hz2 + pz*3 + 2pz2 + 12p + 11z3 + 2z*2 wrt z? -24hp - 794382h + 6p + 66 What is the second derivative of 36g*3t*2 + 1225g*3t + 58g3 - 4g*2t*2 + 4gt2 + 658t*2 - 2 wrt t? 72g*3 - 8g*2 + 8g + 1316 What is the derivative of 7881bc*3 + bc*2 - 811b + 2c3 + 2c**2 + 11	{ "pile_set_name": "DM Mathematics" }
16911 In base 10, what is 18262984 + -11? 18262973 In base 16, what is -1d - -5746ec? 5746cf In base 12, what is 1 - -10189636? 10189637 In base 10, what is 10043090 - 7? 10043083 In base 6, what is 3551203 - 4? 3551155 In base 11, what is 6a495453 - 2? 6a495451 In base 12, what is -11 + 3b9202a? 3b92019 In base 7, what is -120311 + 23? -120255 In base 2, what is 1000110111101111000111101110 + 1? 1000110111101111000111101111 In base 6, what is -40 + -411555025? -411555105 In base 13, what is -3b54 - -28b0? -1274 In base 12, what is -35 - -4767a1? 476768 In base 2, what is -1010110011000101000 + -101101? -1010110011001010101 In base 2, what is 101000111000010111 - 1101110? 101000110110101001 In base 7, what is 2623251 + 341? 2623622 In base 14, what is -c4d9 - 1c32? -1032b In base 6, what is 410 - 1301122? -1300312 In base 16, what is -18ab75a - 7? -18ab761 In base 16, what is -35c4982 + 2? -35c4980 In base 3, what is -2100102 + -2102210000? -2112010102 In base 16, what is 2 - 16247? -16245 In base 8, what is 134336264 + 65? 134336351 In base 10, what is -1540842244 - 5? -1540842249 In base 2, what is -11011111110 - -110010010010? 10110010100 In base 10, what is -352661 + 235? -352426 In base 8, what is -575467421 + 4? -575467415 In base 14, what is -114b4c3d - 3? -114b4c42 In base 7, what is -25401 + 54533? 26132 In base 15, what is b84d - 7? b846 In base 3, what is -1120221000 + -22010? -1121020010 In base 2, what is -10000100000101010010 + -1001010? -10000100000110011100 In base 3, what is 2 + 201002202221111100? 201002202221111102 In base 15, what is -b8 + 2a3acb? 2a3a13 In base 6, what is 353245 + -5312? 343533 In base 7, what is 16531 - -13646? 33510 In base 6, what is 155252201 - 3? 155252154 In base 9, what is -728728 - -4? -728724 In base 8, what is -3303170156 - -1? -3303170155 In base 12, what is -46835 - -1521? -45314 In base 16, what is 1 + 12e547? 12e548 In base 12, what is 161 + -b2078? -b1b17 In base 16, what is 75ec834 + -4? 75ec830 In base 12, what is -5 + -a55521? -a55526 In base 14, what is ca - 131? -45 In base 10, what is 33 - 1745948? -1745915 In base 8, what is -4704 + 2565? -2117 In base 16, what is 2 + 6b5d22? 6b5d24 In base 3, what is 12220111210221 + 121202? 12220112102200 In base 3, what is 1201 + -1200211122210? -1200211121002 In base 9, what is 4423151 + -275? 4422765 In base 2, what is -111000100010000111111 + -1? -111000100010001000000 In base 15, what is 10 - -2b3659b? 2b365ab In base 6, what is -2535310 - 141? -2535451 In base 5, what is 2331011301 + -1? 2331011300 In base 2, what is -100000101100010101001110 + -1? -100000101100010101001111 In base 7, what is -2622262 + -35? -2622330 In base 11, what is -28651 + 229? -28423 In base 6, what is 22524500152 - -5? 22524500201 In base 4, what is -22 + 220230031303? 220230031221 In base 6, what is -1412033424 + 5? -1412033415 In base 2, what is 11 + -1111110000100110011111? -1111110000100110011100 In base 9, what is 0 + -10361820? -10361820 In base 3, what is 20000001120202021 - -21? 20000001120202112 In base 13, what is 362a - -1671? 4c9b In base 16, what is 2 + 7866f4? 7866f6 In base 16, what is 1280 + -12f? 1151 In base 7, what is -5 - 3143550631? -3143550636 In base 9, what is 13 - 3423075? -3423062 In base 2, what is -100010011101101011010000110 + -11? -100010011101101011010001001 In base 6, what is -3121012120 + 1? -3121012115 In base 8, what is 3 - -66710361? 66710364 In base 13, what is -503647 - ba? -503734 In base 13, what is -42a4b - -1103? -41948 In base 11, what is -11 - 14a0538? -14a0549 In base 13, what is -3 + -16359749? -1635974c In base 14, what is 5 - 114b988? -114b983 In base 11, what is 3 + 2319677a? 23196782 In base 14, what is -60dc1 + -1b3? -61194 In base 16, what is 77 - -3877ec? 387863 In base 7, what is -5 - 10134442? -10134450 In base 7, what is -21 - -2440061? 2440040 In base 2, what is -11110101010 - 101100100101? -1001011001111 In base 14, what is -1251 + 3a43? 27d2 In base 6, what is 35434 + 12? 35450 In base 14, what is -56c719 - 125? -56c840 In base 16, what is 29072 + 80? 290f2 In base 9, what is -346436 + -107? -346544 In base 14, what is 3d9933 - 5? 3d992c In base 2, what is 10010011011011111001 - 100? 10010011011011110101 In base 10, what is 11204 - 189? 11015 In base 4, what is -110123031 - -33031? -110030000 In base 15, what is 20ee40 - -4? 20ee44 In base 7, what is -6601040603 - 2? -6601040605 In base 16, what is -4a + 3de79? 3de2f In base 5, what is 32 + 122013120? 122013202 In base 7, what is -30632 - -11? -30621 In base 5, what is 10 - -11441040142? 11441040202 In base 15, what is 0 + 1621e4? 1621e4 In base 14, what is 2a791 - -dab? 2b75c In base 12, what is -a2 - 82943? -82a25 In base 14, what is 317 - 18c3? -15aa In base 9, what is 31151 + -270? 30771 In base 15, what is 13b - -1ad9? 1c25 In base 5, what is -111322424 + 101? -111322323 In base 6, what is -10020445 - 100? -10020545 In base 5, what is 332132022 - -211? 332132233 In base 6, what is -5234230010 + 3? -5234230003 In base 2, what is 1010010000011111110 + -10001? 1010010000011101101 In base 3, what is 201122212022 - -12210? 201200002002 In base 16, what is 1861c5 - -28? 1861ed In base 3, what is 10222 - 22211120002? -22211102010 In base 11, what is -35774a + -433? -358082 In base 11, what is 8a79a9 - a2? 8a7907 In base 6, what is 50151 - 34122? 12025 In base 5, what is -10 + 233113112? 233113102 In base 4, what is -21 - -110232013? 110231332 In base 5, what is 1113444040 + -13? 1113444022 In base 9, what is -53 + -3783208? -3783262 In base 9, what is 43 + 6314622? 6314665 In base 4, what is 2112111 + 1032300? 3211011 In base 12, what is -2 - 69077aab? -69077ab1 In base 4, what is 330320210210 + -11? 330320210133 In base 13, what is b57c + -2a41? 883b In base 10, what is -2659 + 8584? 5925 In base 3, what is 2002011 + 2202111120? 2211120201 In base 4, what is 2 + 1312122321200? 1312122321202 In base 15, what is -1d9750d - 8? -1d97516 In base 6, what is 40 - 10442104555? -10442104515 In base 13, what is -47239 + 259? -46cb0 In base 6, what is -3523 - 1055435? -1103402 In base 11, what is -4512 - -90797? 87285 In base 2, what is -110000 - -11011000001101100? 11011000000111100 In base 9, what is -87062 + 128? -86833 In base 12, what is -3058 - -292? -2986 In base 6, what is -3121 + -10221? -13342 In base 15, what is 0 + -30b870? -30b870 In base 16, what is -16ae3c - 6? -16ae42 In base 8, what is -6116 + 1642? -4254 In base 12, what is 14 + 689b3? 68a07 In base 12, what is -71a4a - 89? -71b17 In base 13, what is -8 - -329273? 329268 In base 12, what is -a + -644ba14? -644ba22 In base 5, what is 201433042014 + -10? 201433042004 In base 12, what is 4 - -68108120? 68108124 In base 3, what is 22 + 1110200000212112? 1110200000212211 In base 14, what is 0 + 178db2? 178db2 In base 10, what is -1362768 + 53? -1362715 In base 11, what is -161408 + 1a5? -161213 In base 9, what is -2 - 62021377? -62021380 In base 12, what is -19424 + -3b9? -19821 In base 7, what is 4560365 + 114? 4560512 In base 5, what is -141110304 + 11? -141110243 In base 3, what is 220122 - 1112202212? -1111212020 In base 9, what is -112382 + -527? -113020 In base 3, what is 10 - -202012201102011222? 202012201102012002 In base 16, what is -1ad7c6d + -4? -1ad7c71 In base 3, what is 11122 + -20220101201010? -20220101112111 In base 2, what is -11000 - -10111010001100? 10111001110100 In base 11, what is 389348 - -13? 389360 In base 3, what is -102112 + 100212212? 100110100 In base 7, what is 1232 + -10454363? -10453131 In base 5, what is 23 + 2220311210? 2220311233 In base 14, what is -b + 24b7897? 24b788a In base 8, what is -133 + 1553107? 1552754 In base 13, what is -512a8 - -c75? -50333 In base 15, what is 9b47a3 + 5b? 9b480e In base 12, what is -36b6 + 403? -32b3 In base 3, what is 10022 + -11211212221? -11211202122 In base 4, what is -10103203313000 + -1? -10103203313001 In base 2, what is 1100 + -11011100100010101100? -11011100100010100000 In base 7, what is 3434240 + 131? 3434401 In base 7, what is 3 - 123363011? -123363005 In base 14, what is -7 + -c64762? -c64769 In base 7, what is -1141 + -6606? -11050 In base 9, what is 1 + 1125382? 1125383 In base 5, what is -1021210 + -1012122? -2033332 In bas	{ "pile_set_name": "DM Mathematics" }
4/35 Calculate prob of sequence ieeq when four letters picked without replacement from ieeiiiqqeeqiiq. 12/1001 What is prob of sequence kv when two letters picked without replacement from xkxhvvv? 1/14 What is prob of sequence rlri when four letters picked without replacement from lrrrllrlifrllllrrl? 7/1360 Calculate prob of sequence hlh when three letters picked without replacement from {l: 7, h: 4}. 14/165 Calculate prob of sequence up when two letters picked without replacement from {b: 2, e: 1, p: 2, c: 1, o: 1, u: 1}. 1/28 What is prob of sequence fjoo when four letters picked without replacement from bbfobjjojbbobjj? 1/1092 Calculate prob of sequence sl when two letters picked without replacement from {s: 2, l: 8, x: 2}. 4/33 Three letters picked without replacement from {n: 1, j: 5, q: 1, p: 1, d: 1, o: 3}. Give prob of sequence pjd. 1/264 Calculate prob of sequence skk when three letters picked without replacement from ssksssrskssskssrss. 13/816 Calculate prob of sequence jjep when four letters picked without replacement from jpjej. 1/20 What is prob of sequence sbkb when four letters picked without replacement from skspbnbbksb? 1/110 Two letters picked without replacement from {s: 1, o: 4, a: 1, w: 11}. What is prob of sequence oo? 3/68 What is prob of sequence qskq when four letters picked without replacement from {s: 5, q: 3, k: 3, b: 1}? 1/132 What is prob of sequence sul when three letters picked without replacement from ssmeuamasalesl? 1/273 Three letters picked without replacement from {j: 1, h: 4, g: 1, p: 1, q: 4, m: 3}. Give prob of sequence ghh. 1/182 Calculate prob of sequence thk when three letters picked without replacement from {f: 2, y: 4, k: 1, t: 4, h: 5}. 1/168 Calculate prob of sequence hr when two letters picked without replacement from {s: 1, h: 2, r: 3, j: 1, v: 3}. 1/15 What is prob of sequence ww when two letters picked without replacement from wrnrwwrnfv? 1/15 Three letters picked without replacement from tttthhtttttttttththt. Give prob of sequence tht. 8/57 Calculate prob of sequence zz when two letters picked without replacement from {z: 2, f: 4}. 1/15 Four letters picked without replacement from perqryereprrymqrpp. What is prob of sequence rmpe? 1/1020 Four letters picked without replacement from aullull. Give prob of sequence ulau. 1/105 Calculate prob of sequence gy when two letters picked without replacement from {g: 4, k: 3, b: 2, y: 1}. 2/45 What is prob of sequence mmmv when four letters picked without replacement from mvmvm? 1/10 Four letters picked without replacement from jthtfhztjjj. What is prob of sequence htzf? 1/1320 Two letters picked without replacement from {k: 2, b: 5, c: 1, j: 2, s: 1, g: 6}. Give prob of sequence gb. 15/136 Calculate prob of sequence yyyy when four letters picked without replacement from yyyyyy. 1 Two letters picked without replacement from ygmmkfyygkkmyyq. What is prob of sequence mg? 1/35 What is prob of sequence ymyy when four letters picked without replacement from {m: 5, y: 4, h: 1, x: 8}? 1/612 Two letters picked without replacement from bgvsnsbf. What is prob of sequence sg? 1/28 Two letters picked without replacement from {e: 3, c: 1, u: 2, q: 1}. Give prob of sequence qu. 1/21 Calculate prob of sequence zz when two letters picked without replacement from {z: 10}. 1 Four letters picked without replacement from {g: 3, o: 1, i: 7, n: 2, c: 3, e: 3}. What is prob of sequence eecc? 1/2584 Two letters picked without replacement from {e: 2, l: 5, p: 8}. Give prob of sequence ll. 2/21 What is prob of sequence ecc when three letters picked without replacement from ecceeceecccccc? 15/91 Calculate prob of sequence xx when two letters picked without replacement from {o: 16, x: 4}. 3/95 Calculate prob of sequence npg when three letters picked without replacement from mngnnpgnmppnmnnpn. 4/255 What is prob of sequence susm when four letters picked without replacement from smsusumtmum? 1/110 Calculate prob of sequence cqcd when four letters picked without replacement from cdcdqddddcdddjcdj. 1/476 What is prob of sequence cet when three letters picked without replacement from iiiaareetiaceiceii? 1/612 Three letters picked without replacement from {g: 1, t: 2, d: 2, i: 1, j: 1, v: 1}. Give prob of sequence dgt. 1/84 What is prob of sequence asss when four letters picked without replacement from aahshaasaaahhhsshhah? 8/4845 What is prob of sequence tttf when four letters picked without replacement from tftttttrt? 5/72 Four letters picked without replacement from moemooommemm. Give prob of sequence ooeo. 2/495 What is prob of sequence mm when two letters picked without replacement from {m: 5, y: 5}? 2/9 What is prob of sequence gy when two letters picked without replacement from {y: 5, g: 1, b: 5, r: 4, k: 1}? 1/48 What is prob of sequence wj when two letters picked without replacement from wwjwjw? 4/15 What is prob of sequence pipp when four letters picked without replacement from pipiipiiipiiiipiii? 13/1224 What is prob of sequence yo when two letters picked without replacement from moyny? 1/10 Calculate prob of sequence xq when two letters picked without replacement from {p: 2, r: 1, v: 2, x: 2, q: 1}. 1/28 Calculate prob of sequence jb when two letters picked without replacement from {l: 11, j: 2, w: 1, b: 2}. 1/60 Two letters picked without replacement from {n: 7, r: 10, j: 1}. What is prob of sequence nj? 7/306 Three letters picked without replacement from kkkkdkkk. Give prob of sequence dkk. 1/8 What is prob of sequence un when two letters picked without replacement from hhxxhhhhhxxuhxunhhh? 1/171 What is prob of sequence ffcf when four letters picked without replacement from {c: 9, f: 7}? 9/208 Two letters picked without replacement from mzmzzznozqjm. What is prob of sequence jz? 5/132 Four letters picked without replacement from vrzrz. What is prob of sequence rzvz? 1/30 Three letters picked without replacement from {i: 4, w: 3}. What is prob of sequence wwi? 4/35 Calculate prob of sequence uc when two letters picked without replacement from uubhcunubhuuuun. 4/105 Four letters picked without replacement from {h: 5, m: 1, k: 1, x: 3, c: 2}. Give prob of sequence hkmc. 1/1188 Calculate prob of sequence ttt when three letters picked without replacement from tttttattattt. 6/11 Three letters picked without replacement from {m: 1, q: 5, v: 14}. What is prob of sequence qqm? 1/342 What is prob of sequence zc when two letters picked without replacement from {c: 9, z: 3}? 9/44 What is prob of sequence qq when two letters picked without replacement from {i: 11, q: 2}? 1/78 Three letters picked without replacement from {r: 2, q: 4, b: 1, a: 4}. Give prob of sequence bra. 4/495 Calculate prob of sequence tqqq when four letters picked without replacement from {t: 5, u: 2, q: 3}. 1/168 What is prob of sequence weg when three letters picked without replacement from {s: 1, l: 5, e: 2, g: 2, q: 2, w: 5}? 1/204 Calculate prob of sequence xxxa when four letters picked without replacement from axxaxax. 3/35 Four letters picked without replacement from nnnmmmn. What is prob of sequence mnmn? 3/35 Calculate prob of sequence ppjr when four letters picked without replacement from pprjjjxjjp. 1/168 Two letters picked without replacement from nllsnnsss. Give prob of sequence ls. 1/9 Four letters picked without replacement from {r: 2, b: 10}. Give prob of sequence rbbb. 4/33 Four letters picked without replacement from elqblkqbqql. Give prob of sequence ebqq. 1/330 What is prob of sequence hvb when three letters picked without replacement from oeoeoohoeovhoboeoov? 2/2907 What is prob of sequence uzpz when four letters picked without replacement from {p: 1, z: 4, u: 3, t: 2, e: 2}? 1/330 Calculate prob of sequence dw when two letters picked without replacement from zgwzygzdzjwyzwgyzw. 2/153 Calculate prob of sequence yhy when three letters picked without replacement from zyyh. 1/12 Calculate prob of sequence too when three letters picked without replacement from ootoootoooooo. 5/39 Calculate prob of sequence kka when three letters picked without replacement from koooank. 1/105 Four letters picked without replacement from gaggauagggggugg. What is prob of sequence agua? 1/273 Calculate prob of se	{ "pile_set_name": "DM Mathematics" }
= 4j, 589 = 3h - 4j. What is the hundreds digit of h? 1 Suppose 2t - 13 = 3q, 4q + 2t = q - 29. Let s = q + 31. What is the tens digit of s - (-2 + 2)/(-4)? 2 Let t(v) = -11v + 23. What is the tens digit of t(-9)? 2 Let l be (4/6)/(2/(-18)). Let s = l - -11. Suppose 1 - s = -j. What is the units digit of j? 4 Let b = -206 + 328. What is the hundreds digit of b? 1 Suppose -26u = -25u - 1406. What is the tens digit of u? 0 Let f = 10732 + -7502. What is the hundreds digit of f? 2 Suppose -16p = -13p - 30. Suppose 0j - 640 = -pj. What is the units digit of j? 4 Suppose 3m = 4m. Suppose m = 2u - 13 - 13. What is the tens digit of u? 1 Let q(f) = 9f - 6. Suppose 4r + r = 40. Let h be q(r). Suppose 5p - 7p + h = 0. What is the tens digit of p? 3 Suppose -23o - 1633 + 10005 = 0. What is the units digit of o? 4 Let f(h) = h*3 - 4h*2 - 3h - 4. Suppose 5n - 4n = -19. Let v = -13 - n. What is the tens digit of f(v)? 5 Suppose 2v - 344 = 3q, -q + 617 = 5v - 260. What is the hundreds digit of v? 1 Suppose 6g = -30 - 18. Let l(f) = -15f + 3. What is the tens digit of l(g)? 2 Let b(y) = -399y - 3. What is the units digit of b(-5)? 2 Let b = 2 - -6. Let w be 454/b + 6/24. Let l = w - 32. What is the units digit of l? 5 What is the thousands digit of (57 + -54)(-3362)/(-6)? 1 What is the hundreds digit of (9 - 8) + -4 - 5-65? 3 Let u = -18 - -12. Let l(q) = 2q2 + 8q - 1. Let r be l(u). Suppose 0 = -2f + 15 + r. What is the units digit of f? 9 Suppose 3d = 6f - 4f - 400, -990 = -5f + 5d. Suppose f + 230 = 2s. What is the hundreds digit of s? 2 Let x(p) = 3p - 1. Let n(j) = -16j + 4. Let k(r) = -2n(r) - 11x(r). Let w(c) = -2c + 7. Let i(g) = -7k(g) + 3w(g). What is the units digit of i(8)? 8 Suppose 23 = -f + 474. What is the tens digit of f? 5 Suppose -2k + 19 = -3o, -2o + 3o - 34 = -3k. Let q(g) = -g2 + 18g + 27. Let z(c) = c + 1. Let b(u) = q(u) - 6z(u). What is the tens digit of b(k)? 3 Let h = 693 + -77. What is the units digit of h? 6 Let s(p) = -p3 - 5p*2 - p + 2. Let f be 104/(-8) - -31. Let j(b) = -b*3 - 11b*2 - 9b + 5. Let n be j(f). What is the units digit of s(n)? 7 Let x = -9337 + 14875. What is the hundreds digit of x? 5 Let f(d) = 2d3 - 12d*2 - 5d - 6. What is the tens digit of f(7)? 5 Suppose -6p - 3028 + 640 = 0. What is the hundreds digit of (-6)/(-12) + p/(-4) + 2? 1 Suppose 0 = 5i - 5u - 335, -i - 67 = -2i - 4u. Let m = i + -25. What is the tens digit of m? 4 Let r(i) = i2 + 11i - 9. Let w be r(-11). Let g = 14 + w. Let x = g + 2. What is the units digit of x? 7 Let a(c) = c*2 + 3c - 1. Let y be a(-4). Let t be (2 - 3)(-8 + y). What is the units digit of 25 + (t - (-4 - -5))? 9 Suppose -3h = 26 - 68. Let j = 22 + -18. Suppose -4b - 16 = -2z, 2z = -z - jb + h. What is the units digit of z? 6 Let v(p) = 5p - 20. Let d be v(5). Suppose -dz + 717 - 67 = 0. What is the tens digit of z? 3 Let l(c) = -c - 15. Let u be l(-13). What is the tens digit of 4/u - 75-1? 7 Let p = -2041 + 2860. What is the hundreds digit of p? 8 Let t(j) be the first derivative of 4j*2 + 31j + 26. What is the tens digit of t(6)? 7 Suppose -3y - 36 = 9y. Let i(h) = -20h + 2. Let f be i(-2). What is the tens digit of y/(-18) + 1841/f? 4 Let f = 240 - 78. What is the units digit of (1 - 10/6)/((-3)/f)? 6 Let v(s) = 3s*2 - 4s + 9. Suppose 0 = -5z - 16 - 9. What is the hundreds digit of v(z)? 1 Let l(k) = 95k + 6. Let i be l(-1). Let s = -71 - i. What is the tens digit of s? 1 Let r(p) be the second derivative of -p*4/12 - 4p*3/3 - 11p*2/2 + 2p - 8. Let t(f) = -f*2 - 3f - 1. Let x be t(-4). What is the units digit of r(x)? 4 Let r(x) = -x2 + 1. Let d(b) = b2 + 9b - 15. Let z(c) = -d(c) - 2r(c). What is the units digit of z(12)? 9 Let f = 6008 - 4080. What is the units digit of f? 8 Let b(v) = v*3 + 0v*2 + 0v + 3v - 4v*2 + 3 + 3v*2. What is the tens digit of b(4)? 6 Suppose -2d - 2 = -p, 2d - 3p + 8 = -2d. What is the units digit of (d - 71)/(16 - 17)? 0 Let l(t) = 190t - 59. What is the units digit of l(6)? 1 Let f(a) = -a3 - a2 + a + 3. Let i be f(0). Suppose -4h + r - 19 = -h, -h = 3r + i. Let s(k) = -k*3 - 4k*2 + 9k + 4. What is the units digit of s(h)? 2 Let y(u) = 187u3 - 5u*2 + 11u - 7. What is the units digit of y(2)? 1 Let z(g) = g + 3. Let h be z(0). Suppose 667 = 4v + hs, -4v - s + 167 = -3v. What is the units digit of v? 6 Let q be 25/(-10)(-64)/10. Let x(r) = r2 - 16r. Let h be x(q). Suppose h = g - 19 + 1. What is the tens digit of g? 1 Let i = 841 + -491. What is the hundreds digit of i? 3 Let q be 522 - ((1 - -1) + -5). Suppose 5t + q = 1350. What is the hundreds digit of t? 1 Let j = -14 + 48. Suppose 16 = -2y + y - 5a, -y = -5a - j. Let l = y + 0. What is the units digit of l? 9 Let h be -3(-12)/4510. Suppose -h = -3t + 4. Suppose -4r - t = 0, 18 = -n + 3r + 56. What is the tens digit of n? 3 Suppose s = -1 - 10. What is the hundreds digit of (3 - s)612/9? 1 Suppose 0 = j - 35 - 62. Let b = 76 + j. What is the hundreds digit of b? 1 Let k = 5 + 13. Let o be 92/k + 3/(-27). Let s(t) = 12t - 12. What is the tens digit of s(o)? 4 Let w(f) = -10f2 - 20f - 5. Let j(u) = -2u2 - 4u - 1. Let l(z) = -11j(z) + 2w(z). Let m = -118 - -114. What is the units digit of l(m)? 7 Let o = 15153 + -10594. What is the hundreds digit of o? 5 Let m be (-4575)/(-30)16/(-5). Let u = -345 - m. What is the hundreds digit of u? 1 Let o = 1233 - 504. What is the hundreds digit of o? 7 Let r(z) = -z3 + z - 1. Let l(g) = 3g*3 + 10g*2 + 12g + 16. Let d(f) = -l(f) - 2r(f). Let n = -21 + 12. What is the units digit of d(n)? 1 Let l be (-6)/2 - (-56 + 0). Let o be (l/6)/((-6)/(-36)). Let c = o + -12. What is the tens digit of c? 4 Let v be (-2)/(-17) - 700/(-119). Suppose -320 = 3a - va + r, 5a - 3r - 536 = 0. What is the tens digit of a? 0 Let v(u) be the first derivative of u4/4 + 5u3 + u2/2 + 21u + 1. What is the units digit of v(-15)? 6 Let w be (-2)/1 + 5 - 0. Let y = -11 + 18. Suppose y = wa - 4g, -16 = -5a - 2g + 13. What is the units digit of a? 5 Suppose m = -5v - 100 + 721, m - 3v - 629 = 0. Suppose m = 5j - h + 10, -4j + 5h + 497 = 0. What is the tens digit of j? 2 Let f = -132 - -281. What is the hundreds digit of f? 1 Let f(v) be the second derivative of 3v4 - v3/3 + v2/2 + 16v. What is the units digit of f(-1)? 9 What is the tens digit of ((-20)/8 + 2)233-50? 2 Let j = 12 + -7. Suppose f - v = -3v - 1, -3v + j = -5f. What is the units digit of (2/f)/(14/(-49))? 7 Let y = -71 + 37. Let l be (2 - -58)(-6)/(-5). Let r = l + y. What is the tens digit of r? 3 What is the tens digit of 320/(-15) - -250? 4 Suppose j + 15 = -4a, -3j - a + 30 = -4a. Suppose 2y - 11 = -d, 5y - jd + 0d = -10. Suppose -y = w - 6. What is the units digit of w? 3 Let c(d) = d*3 + 20d*2 + 46d + 19. What is the units digit of c(-17)? 4 Let b(i) = -13i3 + i2 + 3i - 2. What is the hundreds digit of b(-3)? 3 Suppose -3z + 26 = 2d + 1, 3z + 3d - 27 = 0. Suppose -12a = -za - 260. What is the tens digit of a? 5 Let a(y) = 2y2 + 2y - y*3 - 2y*2 + 4y + 1 + 2y2. What is the units digit of a(-4)? 3 Let q = 76 + -45. Let h = 18 - 10. Let d = q + h. What is the tens digit of d? 3 Suppose -52u + 6963 = -19u. What is the hundreds digit of u? 2 Let m = 601 - 50. What is the units digit of m? 1 Let k(p) = -p2 - 16p + 3. Suppose -8d = -7d - 5. Suppose dj + b = -69, 3b - 46 + 6 = 4j. What is the tens digit of k(j)? 4 Suppose 0z + 192 = 3z. Let y = -124 + z. Let k = -43 - y. What is the tens digit of k? 1 Suppose 3068 = 12k - 1636. What is the hundreds digit of k? 3 Let b(g) = -2g + 14. Let x be b(6). Suppose 10 = -0v + xv. Suppose -78 = vy - 298. What is the tens digit of y? 4 Let o(h) = -h + 12. Let f be o(4). Suppose -6n + f = -46. What is the units digit of n? 9 What is the hundreds digit of ((-1554)/(-15) - 3) + 6/15? 1 Suppose 14082 = 8o - 6838. What is the units digit of o? 5 Let n(l) = -4l + 14. Let u be (-4)/(-14) - (-329)/49. Let h be n(u). Let i(j) = -4j - 6. What is the tens digit of i(h)? 5 Let x = -57 - -50. Let r = 15 + x. What is the u	{ "pile_set_name": "DM Mathematics" }
9w - 8 + 7w wrt w. 16 What is the second derivative of 308k4 - 1110k*4 - 4 - 203k + 4 - 91k wrt k? -9624k*2 What is the second derivative of 2q*3 + 5 - 60299q*2 - 2 + 58300q*2 + 6 - 97q wrt q? 12q - 3998 Let j(w) be the first derivative of -1662w*3 - 89w*2/2 - w + 10648. Find the second derivative of j(l) wrt l. -9972 Let v = -10052 + 10054. Let z(a) be the second derivative of 2a*v + 8/3a*3 - 19a + 0. What is the first derivative of z(y) wrt y? 16 Let l(r) = 2285r2 - 6r - 2012. Let m(c) = -6855c2 + 17c + 6038. Let u(a) = 17l(a) + 6m(a). Find the first derivative of u(i) wrt i. -4570i Let q(i) = 3i*2 + 2i + 1. Let f be q(-1). Suppose j + 11 = 2j. Differentiate a - 20 + 37 - a - ja*f wrt a. -22a What is the first derivative of 1614 + 6429w - 1682 - 811 + 3618 + 3269 wrt w? 6429 Let x be 88078/94 + 0 + (1 - 1). What is the third derivative of 1588p*3 - 8 - 889p*3 - xp*3 + 7p*2 wrt p? -1428 Let n(h) = -1150h*3 - 1187h*2 + 6h - 3. Let v(b) = 4599b3 + 4749b*2 - 26b + 13. Let k(d) = 26n(d) + 6v(d). Find the third derivative of k(f) wrt f. -13836 Let r(m) = m*2 + 13m - 6. Let h be r(-12). Let x(l) = l*2 + 19l + 21. Let q be x(h). Find the second derivative of 7d3 - 23d*q - 6d + 13d3 wrt d. -18d What is the third derivative of 169m2 + 15m*6 - 4m*5 - 148m*2 - m + 264m*2 + 4m*5 + 37m*4 wrt m? 1800m*3 + 888m Let b(z) = 6z2 + 7z + 1. Let t be b(3). Find the first derivative of 12v4 + 11v*4 + 9v*4 + 0 + t wrt v. 128v*3 Let g be 122 + -1 + (-7 - -8). Find the second derivative of -gp + 2p2 + 32p*3 + 12p - 7p2 - 53p*3 + 31p*3 wrt p. 60p - 10 Suppose -30 = -m - 26. What is the third derivative of -37y4 + 7 - 13y*2 - 11 + 3 - 78y*m - 2y*2 wrt y? -2760y Find the first derivative of 510d4 + 220d - 391d4 - 215d + 1290 wrt d. 476d3 + 5 Let v(r) be the second derivative of 230r + 0 - 5r2 + 155/12r*4 + 5/3r3. What is the second derivative of v(d) wrt d? 310 Let o(h) = -h + 11. Let s be o(3). Let t(j) = -j3 + 9j2 - 7j - 6. Let w be t(s). Find the third derivative of 103v - 28v*3 - 103v + 12vw wrt v. -168 Let b = 164 - 150. Suppose 0 = 2y - 6y - 4m + 96, -75 = -5y + 4m. What is the second derivative of -yj - j5 - bj + 13j5 - 11j wrt j? 240j3 Suppose 0 = 3b - 0c + 3c - 15, -14 = -3b - 4c. Find the third derivative of 87qb - 2 - 934q*2 + 2 + 830q*2 wrt q. 10440q*3 Differentiate -1075y*2 + 20 - 2 - 1 + 0 + 0y*2 with respect to y. -2150y Let w = -93 + 97. What is the third derivative of 19524y4 + 171y*5 - 3y*2 - 19524y*w - 5y wrt y? 10260y2 Let c(w) be the third derivative of 303w*7/14 - 2633w*5/30 - 969w*2. What is the third derivative of c(g) wrt g? 109080g Let g(f) = 432f5 + 7f*4 + 6f*3 + 746f*2. Let w(s) = -2s5 - s4 - s*3. Let v(y) = g(y) + 6w(y). What is the third derivative of v(b) wrt b? 25200b2 + 24b Let a(h) be the first derivative of 3 - 21/2h2 + 0h - 3h3 - 1/4h*4. Let c(i) be the second derivative of a(i). Differentiate c(v) with respect to v. -6 Let x(k) = -k + 3. Let d be x(-2). Suppose 20 = 4h - dc, -7h + 52 = -3h + 3c. Differentiate -15 - 12 + 18m + 32 - h wrt m. 18 Let n = 181 + -179. What is the third derivative of 2v*4 + 8v*n + 57 - 13v*2 - 54 wrt v? 48v Let z(l) = -l4 + l3 - l*2. Let k(p) = 200p*4 + 2p*3 - 2p*2 - 314. Let u(m) = k(m) - 2z(m). What is the first derivative of u(i) wrt i? 808i3 Suppose 17 + 415 = 18o. Find the second derivative of -143n2 + 22n + 27n + 48n + on + 2n wrt n. -286 Find the third derivative of -1957j2 - 7j*6 + 4652j + 520j2 + 99j*4 - 2328j - 2322j - j6 wrt j. -960j*3 + 2376j Suppose 3d = -3r + 2 + 22, 4r = -d + 23. What is the third derivative of -a3 - 149a*2 + 6 + 4a*r + 138a*2 - 11a*5 wrt a? -420a*2 - 6 Let x(z) = -z + 47. Let j be x(-8). What is the third derivative of 14b*6 - 32b*6 - jb*2 + 17b*4 + 17b*6 wrt b? -120b*3 + 408b Let q be (-4 - 0/(8 + -3))-398. What is the derivative of 3 - 18 + qd*2 - 1484d*2 wrt d? 216d Let m(o) be the third derivative of o*7/210 - 23o*6/12 + 23o5/20 + o4/12 + 486o2. What is the third derivative of m(l) wrt l? 24l - 1380 Find the third derivative of 85p5 - 14p*5 + 29p*3 - 71p*3 - 41 + 15p*2 + 43p*3 wrt p. 4260p2 + 6 Let j(c) = -c3 - 9c2 - 9c - 4. Suppose 0 = 12o - 32 + 128. Let t be j(o). What is the third derivative of 9n*2 + 14n4 - n2 - 3nt wrt n? 264n Let v(f) = -390f3 - 3f*2 + 183f + 4. Let d(z) = 391z3 + 2z*2 - 177z - 3. Let l(r) = -6d(r) - 4v(r). Find the second derivative of l(s) wrt s. -4716s Let z(t) be the third derivative of -2t*7/21 + 19t*5/20 - 17t*4/8 + 5t*3/3 - 1575t*2. Find the second derivative of z(h) wrt h. -240h*2 + 114 Let k(p) = 21p + 28. Suppose 111 = 4w + 31. Let u(o) = -63o - 23 - 21 - w - 19. Let j(t) = 17k(t) + 6u(t). Differentiate j(x) wrt x. -21 Let h(k) be the second derivative of -389k6/10 + k3/6 + 457k*2 - 3308k. Find the second derivative of h(o) wrt o. -14004o2 What is the third derivative of 563g*2 + 231g*2 - 805g*2 + g + 21g*5 - 27g*4 - 229 wrt g? 1260g*2 - 648g Let s(f) be the second derivative of -f*7/3 + 9f*5/20 - 29f*3/6 - 1666f. Find the second derivative of s(l) wrt l. -280l3 + 54l Let h = 134 + -64. Let p = h - 24. What is the second derivative of -py + 40y + 3 - 2y4 - 3 wrt y? -24y2 What is the third derivative of -z2 + 3769z6 - 31672255z*5 - 908z + 31672255z5 wrt z? 452280z*3 Let g(k) be the first derivative of 19k*4/6 - 19k*3 - 5k*2/2 - 4k - 80. Let w(o) be the second derivative of g(o). What is the derivative of w(c) wrt c? 76 Let c(g) be the first derivative of 19g6/3 - 13g5/5 + g2/2 + 798g - 1604. What is the second derivative of c(m) wrt m? 760m*3 - 156m*2 Let q = -113 + 50. Let d = q - -68. Find the first derivative of -z + 2z + 6z2 - d - z wrt z. 12z Let w(h) = -10h3 + 8h*2 + 20h - 2. Let d be w(-6). What is the third derivative of -230x5 + 184x*2 + 1163x*3 + 1163x*3 - dx*3 wrt x? -13800x*2 Let v(i) be the first derivative of -29 - 7/3i*3 - 2i*2 + 40i. Differentiate v(q) with respect to q. -14q - 4 Let p = -1181 + 709. Let h = p - -906. Differentiate 9m*3 + h - 3m*3 - 417 wrt m. 18m*2 Differentiate 3557t*2 - 19t*2 + 139t*2 + 1032 - 1321t*2 + 2850t*2 wrt t. 10412t What is the second derivative of 43238042 - 1000b3 + 2015b - 43238042 wrt b? -6000b Let m(i) be the first derivative of -17/12i*4 + 2i*2 + 21i + 0i3 + 9. Let d(h) be the first derivative of m(h). Differentiate d(r) wrt r. -34r Differentiate -947q3 + 32 - 71 - 211 + 14q*3 - 19 wrt q. -2799q*2 Differentiate 2215 + 138m + 55m2 - 91m*2 - 91m*2 - 32m*2 - 133m wrt m. -318m + 5 What is the first derivative of 6w*3 - 1 - 1411 + 1429 - 104w*4 + 1292 + 747 wrt w? -416w*3 + 18w*2 Suppose 0 = t - 3, -4f + 2t + 241 = -1557. Find the third derivative of fl*3 - 230l*3 - 246l*3 + 36l*2 wrt l. -150 Let p = 55 - 27. Let i be p/12 - 4/12. What is the second derivative of -4l - 15l2 + 15l*i + 32l*3 wrt l? 192l Let q(z) = z3 - z2 - 8z + 1. Let n(r) = -6r*4 - 3r*3 + 174r*2 - 101r - 3. Let v(l) = -n(l) - 3q(l). Find the second derivative of v(t) wrt t. 72t*2 - 342 Find the first derivative of 14s + 149s - 606s - 350s - 549 - 372s wrt s. -1165 Find the second derivative of -747z3 - 723z*3 - 2286z - 667z3 + 754z*3 wrt z. -8298z Let b be 8415/143 - 6/(-39). Suppose 5y = 289 - b. What is the third derivative of -yt - 10t2 + 46t + 3t6 wrt t? 360t*3 Let b(r) = -2934r3 - r2 + 72. Let y(x) = -11733x3 - 5x*2 + 287. Let j(d) = -13b(d) + 3y(d). Find the third derivative of j(i) wrt i. 17658 Let q(j) = -2j5 + j2 - 2j - 1. Let z(b) = -4b*5 + 586b*2 + 1143b - 1. Let t(m) = q(m) - z(m). What is the second derivative of t(g) wrt g? 40g3 - 1170 Let r(l) be the first derivative of 0l*2 + 0l*5 + 104/7l*7 - 106 + 101/3l*3 + 0l*4 + 0l + 0l*6. What	{ "pile_set_name": "DM Mathematics" }
reasing order. u, 1, c Let s = -0.01 - -0.31. Let m = s - 0.4. Sort 1/4, 0, m. m, 0, 1/4 Let v be -11 + 15 - 0/(-1 - -2). Let l = -1.3 - -0.3. Sort l, 0.06, v in ascending order. l, 0.06, v Let b be 26/8 - 2/8. Suppose 0 = -12o + 8o + 76. Let u = o + -14. Sort -5, b, u in descending order. u, b, -5 Let l = -6 - -7. Let n be 5/((-4195)/2) - 0. Let j = n - -2531/5873. Put -1, j, l in ascending order. -1, j, l Let s(m) = m*2 - 5m + 1. Let j be s(6). Let y = 6 - j. Sort -4, 2, y. -4, y, 2 Suppose v = 6v. Let k(p) = 2p*2 - 5p + 4. Let b be k(3). Sort v, b, 1 in increasing order. v, 1, b Suppose 7k - 13k + 12 = 0. Sort -16, k, -4. -16, -4, k Let j(x) = x*3 - 2x*2 - 6x - 12. Let u be j(4). Suppose -3l - 12 = -3s - 0l, l - 20 = -5s. Put u, s, 5 in increasing order. u, s, 5 Let u be 2/40/(-1). Suppose -2g = -4a - 12, -a + ua - 3 = 2g. Let j = -0.1 + -0.3. Put j, 0, a in increasing order. a, j, 0 Let o = 0.2 + 0.1. Let q = 3/193 + -9671/1351. Let u = q - -264/35. Sort u, o, -1. -1, o, u Let i = 40 - 39.82. Sort 0.1, i, 0.3. 0.1, i, 0.3 Suppose -2q + 8 = -0. Let r = 15 - 6. Let l = r - q. Put 1, -5, l in descending order. l, 1, -5 Suppose 6 = -6k + 24. Sort -9, -3, k in descending order. k, -3, -9 Let y(f) = -5f3 + f2. Let l be y(1). Let p = 4 - 4. Put p, 5, l in decreasing order. 5, p, l Let k be -6 + ((-248)/(-20) - 6). Let z = 0.3 - 0.26. Let f = z - -1.96. Sort k, f, -0.4. -0.4, k, f Suppose -5g + 21 = l + l, 0 = -4l + 12. Let f be (-2)/g - (-2)/3. Suppose 0 = -fo - 3o - 3. Put -3, o, -2 in decreasing order. o, -2, -3 Suppose 13 = -5q - 17. Let j(d) = d3 + 6d*2 - 2. Let b be j(q). Suppose 4 = -t - 3t. Put 2, b, t in ascending order. b, t, 2 Suppose 0 = z - 31 + 29. Sort -5, -4, -11, z in decreasing order. z, -4, -5, -11 Let v = -39 - -36. Put 4, 5, v in decreasing order. 5, 4, v Let m = 0.5 - 0.45. Put m, -4, -5 in increasing order. -5, -4, m Let j(l) = l*2 + 8l + 8. Let v be j(-7). Let k be 679/1197 + (0 - v). Let p = 4/19 + k. Sort 1, -4, p in increasing order. -4, p, 1 Let c(f) = -f*3 + 16f*2 - 16f + 18. Let x be c(15). Sort -1, x, 2. -1, 2, x Let y = -12.5 + 12. Let k = -0.4 + 2.4. Put y, k, 5 in decreasing order. 5, k, y Suppose -5t - 22 = -7. Let i(a) = 0a2 + 3 + a2 + a + 4a. Let o be i(-5). Put t, 5, o in increasing order. t, o, 5 Let r = -527/4 + 131. Suppose 0 = -3w + 4a - 10 + 44, 0 = -a - 4. Sort -2/17, r, w. r, -2/17, w Let r be ((-4)/12)/(1/(-3)). Suppose 0 = -14k + 18k. Sort r, k, -3 in increasing order. -3, k, r Let p be ((-34)/8 - -3)/((-2)/16). Put 0, 3, p, -3 in descending order. p, 3, 0, -3 Suppose 5h = 2z - 3, -7z + h = -4z - 11. Sort z, -1, -2 in descending order. z, -1, -2 Suppose x + 2 = -2. Put 5, 2, x in increasing order. x, 2, 5 Let m = 3 + -2.5. Let w = -5/9 + 7/45. Sort 5, m, w. w, m, 5 Let b = -104/627 + 2/33. Suppose -5x + 79 - 9 = 0. Let t be (-52)/x - 4/14. Sort b, t, -1 in descending order. b, -1, t Let p = -11 + 13. Suppose -7s = 12 + 2. Put s, p, 4 in descending order. 4, p, s Suppose 2u - 4s + 0 = 6, -s + 21 = 4u. Sort -4, u, -1 in increasing order. -4, -1, u Let q = 1.9 - 2. Let v = 8/13 + -61/78. Sort -6, v, q in increasing order. -6, v, q Let u be (-3)/(-12) + (-73)/(-20). Let x = u - 17/5. Sort 1/3, 1, x in ascending order. 1/3, x, 1 Let z = 39 + -35. Suppose -2o - 16 = 2o. Sort -1, z, o in decreasing order. z, -1, o Let w = 35 + -35.1. Put w, 4, 1/2 in decreasing order. 4, 1/2, w Let t = 13 + -11. Suppose 3d + 8 = 2f + td, -16 = -2f + 3d. Put 0, f, -5 in decreasing order. f, 0, -5 Let k = 0.4 + -0.3. Sort k, 5, 0.2 in descending order. 5, 0.2, k Let f = -18 + 161/9. Let y = -72 + 72.31. Let s = 0.09 + y. Put f, s, 4 in ascending order. f, s, 4 Let z = -0.8 - 6.2. Sort z, -0.2, 1/6 in decreasing order. 1/6, -0.2, z Suppose 0d = 3d. Sort d, -4, -3. -4, -3, d Let w be 6/15(-1 + -4). Let h(a) = a + 8. Let b(q) = -2q - 16. Let m(x) = -3b(x) - 5h(x). Let f be m(-8). Put f, -4, w in ascending order. -4, w, f Suppose -u = 2 - 3. Let p = 7 + -4. Suppose 0 = -5n - 3q + 4 - 1, pn = q - 1. Sort n, u, -5. -5, n, u Suppose 4x = 3x - 4. Let w be (-3 - x)/(1 - 0). Let b be 2/(-4)61. Put w, -2, b in descending order. w, -2, b Let a be 12/5 + 10/(-25). Put a, 0, 8 in descending order. 8, a, 0 Let l be (-4 + 1)1 + 0. Let s = 3 + 1. Sort 6, s, l in ascending order. l, s, 6 Let g = 9 + -8.1. Let n = g + -0.4. Suppose -3 - 2 = -z. Sort z, -0.3, n. -0.3, n, z Suppose v + 4 = -v. Let y be (-234)/(-45) - v/(-10). Let q be (2 + 2)/1 - 0. Sort y, -4, q. -4, q, y Let s = -64 + 64.6. Sort s, -5, 1, 4. -5, s, 1, 4 Let o = 2 + -1.7. Let m = 0.1 + 0.4. Put m, o, -0.5 in decreasing order. m, o, -0.5 Let a = -13 + 8. Put a, 0.3, 3 in ascending order. a, 0.3, 3 Suppose -8 = 2l + 2l. Suppose 5k + 0k = 15. Let s be k/(-6(-2)/(-16)). Put s, 3, l in descending order. 3, l, s Let z = -15 + 19. Sort z, 0.3, 2/5 in decreasing order. z, 2/5, 0.3 Suppose 3s = 3d - 2 - 1, 15 = -3s. Put d, 3, 0.4 in increasing order. d, 0.4, 3 Let n be 2/(-1)(15/2 + -7). Put n, 2/9, -4, -0.14 in descending order. 2/9, -0.14, n, -4 Let g = -0.08 + 0.58. Put g, 0, 3 in increasing order. 0, g, 3 Let t = -1.5 - -1.57. Let a = -0.37 + t. Let q = 11 - 11.4. Put a, q, 2/7 in decreasing order. 2/7, a, q Suppose -2v = -y - 17, -3v + 5v - 19 = 3y. Let o = 3 - v. Let r(s) = s. Let h be r(2). Put h, -1, o in ascending order. o, -1, h Let c be (-4)/4-1 - -3. Let z be (-32)/(-180) - c/10. Put 1/6, z, 0.2 in ascending order. z, 1/6, 0.2 Let u = 0.49 + -0.19. Suppose w = r + 3, 2r - 20 + 2 = -2w. Suppose 0 = -2p + w, m + p + 0 + 2 = 0. Sort u, -2, m in increasing order. m, -2, u Let x(d) = -d*3 + 7d*2 - 7d + 3. Let g be x(6). Put -4, -2, g in ascending order. -4, g, -2 Let n = 69 + -69.2. Sort -4/3, n, 4. -4/3, n, 4 Let l = 0.32 + -0.02. Sort -2/9, l, 1/2 in decreasing order. 1/2, l, -2/9 Let h(u) = -9 - 10u - u + u + u - u2. Let a be h(-8). Let d(t) = -t + 2. Let w be d(-2). Sort a, w, 2. a, 2, w Suppose 0b + 28 = -7b. Let k = 15 + -13. Put b, k, 1 in ascending order. b, 1, k Suppose 5f - 3f - 24 = 0. Suppose 5q + f = -2j, -4 = -3j + 3q + 20. Suppose 0 = -3c - 5u + 10, -5c + 7u - 40 = 4u. Sort 3/8, j, c. c, 3/8, j Let w = 33 - 33.2. Put 1, -8, w, 4 in descending order. 4, 1, w, -8 Let i = -0.2 - -0.4. Let u = 0.5 - i. Let a = u + -0.4. Sort -2/11, 1, a in descending order. 1, a, -2/11 Let l(d) = -d*3 - 7d*2 - 4d + 12. Let z be l(-6). Put z, -0.3, 4 in increasing order. -0.3, z, 4 Let j = 219/7 + -31. Let b = 2 + -2. Let h = 27 - 26. Sort j, h, b in decreasing order. h, j, b Let m = 1.5 + -4.5. Sort m, 3/5, 1/2, -1/4 in increasing order. m, -1/4, 1/2, 3/5 Let u be 5/(-4 + 0 + 3). Let r = 11 - 15. Sort -1/3, u, r in descending order. -1/3, r, u Let v = -0.3 + -0.7. Let c be (-4 - -4) + (-8)/(-44). Sort v, -0.2, c in decreasing order. c, -0.2, v Suppose 2w - 4w - 4 = 0. Let x be (12/(-18))/((-2)/9). Suppose -9 + 0 = -xp, 2h + p = 3. Sort h, w, 1. w, h, 1 Let j(d) = 4d2. Let x be j(-1). Suppose -5t - 1 - 15 = 2f, -3f = -5t - 26. Sort t, x, 2 in decreasing order. x, 2, t Let b be 1/281. Let f = 0.065 + -1.065. Sort f, 0.4, b in decreasing order. b, 0.4, f Let a be (4 - 1) + (-2 - -3). Let h be ((-42)/126)/(2/(-6)). Sort h, a, -5. -5, h, a Suppose 2 = -j + l - 3l, 5l = -j - 11. Let x = j - -1. Sort x, -1, -2 in ascending order. -2, -1, x Let c = 1 + 4. Let w be 2/((1/(-6))/(-1)). Suppose -2z = 2z - w. Sort z, 2, c in ascending order. 2, z, c Let f = -1.02 - 3.98. Let d(k) = k3 + 5k*2 + 5k + 4. Let h be d(-4). Sort h, f, 4/3 in decreasing order. 4/3, h, f Let k be 45/(-30)((-16)/3 - 0). Let r be (1(-1)/1)/1. Sort 3, r, k in ascending order. r, 3, k Let n = 0.436 - 0.136. Put 5, -5, n, 7 in ascending order. -5, n, 5, 7 Let s = 6133/15 - 409. Sort 5, s, -3, 2. -3, s, 2, 5 Let j(z) = z*3 + 7z*2 + 7z + 1. Let b be j(-6). Let f be 544/476(-14)/4. Sort -3, f, b in descending order. -3, f, b Let a = -0.14 - -0.04. Let f = 1 - 6. Suppose b - 6b = -5. Put f, b, a in ascending order. f, a, b Let u(n) = -n - 26. Let t be u(-12). Put t, 5, 2 in descending order. 5, 2, t Let x = -13.39 - -13. Let i = -1.01 - -1. Let a = i + x. Put -5, -0.1, a in	{ "pile_set_name": "DM Mathematics" }
et x be ((-63)/18 + 4)126/(-4). Which is greater: -17 or x? x Let a be -7 + 13 - (0 - 4). Which is bigger: a or 8? a Suppose 3g + 0 = -5h + 6, 0 = 3h. Suppose 3z + 19 = -4u, 5z = u - gu - 9. Let d be (-6 - -6) + z/2. Is d bigger than 4? False Let m = 78548/437 - 3259/19. Is m at least 8? True Suppose 5b - 2r = -66 + 8, 2b + 5r = -29. Is -7 greater than b? True Let g = 0.06 - 0.06. Let c = -192.15 - -192. Is g <= c? False Let u(k) = k*3 - 18k*2 + 18k - 31. Let w be u(17). Let f be (21)/(w/(-7)). Is f less than or equal to 2/97? False Let p be (48/972)/(8/(-12)). Let w(r) = -2 - 3 + 3r - 2r. Let x be w(5). Which is bigger: x or p? x Let s = 0.49 - -0.11. Let d = s + -2.1. Let v = 0.5 + d. Which is smaller: 4 or v? v Let h = -20.018 - -0.018. Let t = h + 9. Let g = t + 12. Is 0 at most as big as g? True Let w(i) = i3 - 15i*2 + 25i + 10. Let l be w(13). Let b be -2 - -1 - 9 - -2. Let x be l/(-6)b/(-12). Are 20 and x nonequal? True Let w be -2 - (-1)/(-9) - (3 - 4). Is w > 2? False Let v(x) = 7x - 22. Let f be v(4). Suppose 3u = -2b + 13 + 8, b + 3u - 15 = 0. Suppose 36 = -fl - b. Which is smaller: 0.1 or l? l Let p be -4 - (5 + (-1990)/220). Which is smaller: 6 or p? p Suppose 7a - 12a = -5. Let b be (-9 - -6) + a + 2. Do -3/16 and b have the same value? False Suppose -q - 2 + 0 = 0, 3p + 7 = -5q. Which is greater: p or 12/43? p Let i(p) = p*3 - 9p*2 + 9p - 4. Let j be i(8). Suppose 0 + j = -4g. Let k = -113/21 - -17/3. Is g equal to k? False Let z = -1.953 - -640.953. Which is greater: z or -0.1? z Let l(z) = -z2 + 4z. Let x be l(3). Suppose -34i - 1 = -33i. Let q be (-5 - i) + -3 + (-356)/(-36). Which is smaller: x or q? q Let j be -7(1600/(-1484))/8. Does j = 0? False Suppose 50 = -124q + 174. Are q and 2/2059 equal? False Let n(c) = -248c + 126c - 2c3 - 11c*2 + 3c*3 - 4 + 120c. Let l be n(11). Is -26 at least l? True Suppose 7x - 30 = 26. Suppose -x = -5i + 17. Is 4 less than i? True Let l = 144 + -26. Which is smaller: -2/7 or l? -2/7 Let k = -5 + 7. Let t be 3 - ((-27)/36 + (-30)/(-8)). Let i = k - t. Is i bigger than -1? True Let q be (-1)/(-6)474/(-316). Which is smaller: q or -0.0907? q Let a = 814 + -2587/3. Let k = 47 + a. Suppose -3h - 18 = 3g, 0 = -4h + g - 2 + 3. Are k and h unequal? True Let i be ((-5)/10)/(4/(-32)). Let w be i/2(-4)/(-20). Is w > 1? False Suppose 0 = r - 0r + 2q, 2q - 8 = -5r. Suppose -k + 8 = 5x, -3k - 28x + 5 = -32x. Which is smaller: k or r? r Let n be (28/(-8) - 4)(5 - 3). Let m be n/(-50)2/3. Are m and -2/5 unequal? True Suppose -4s - 111 - 2153 = 0. Let d = s - -1107/2. Let r = -12 - d. Which is smaller: 0 or r? 0 Let y = 0.7 - -1.5. Let s = 5.4 - y. Let b = -3 + s. Which is smaller: b or 0.1? 0.1 Let x = 7.91 + -8. Let z = 1.22 - 2.31. Let a = x - z. Which is bigger: 2 or a? 2 Let j = -1145 - -1101.93. Let d = j + 43. Is -1 bigger than d? False Let o = 0.079 + -33.079. Let d = 34 + o. Is d != -0.09? True Let r = 80.57 - -0.43. Let w = -82.8 + r. Is w greater than 1? False Let t be (-1 + (-638)/(-6))(-78)/52. Is -160 greater than or equal to t? False Let h = -26.9 + 26.94. Which is greater: -3 or h? h Suppose 3n + 27f = 28f + 71, 0 = 2n - 4f - 34. Is 26 greater than n? True Let v = -7 + 11. Let i = 277.7 - 266. Let m = i - 12. Is v greater than or equal to m? True Let j be (-1 + -34)2/2. Let a be 10/j - (1 + -1). Is a >= 9/7? False Let h = -101 + 705/7. Let k = 7.5 + 82.5. Let b = k - 94. Are h and b nonequal? True Let y = 3 - 4. Let r = y + -2. Let p = -0.07 + -0.03. Is p less than r? False Let v = 3/5 - 31/85. Which is smaller: -0.1 or v? -0.1 Let a be (1/21)/(240/(-392)). Let z = a - -3/10. Suppose 0 = -4q - 4 - 0. Is z bigger than q? True Suppose 0 = -3h - h - 4p, -3h = -p - 12. Let k be ((-3)/(-6))/(1/(-2)). Which is greater: h or k? h Let v be 291/(-2)(-16)/(-12). Let t be 4/6 + v/(-15). Which is bigger: 15 or t? 15 Let f = 10678/15 - 712. Let q(n) = 2n - 9. Let x be q(6). Suppose -xd - 2d + 5 = 0. Are d and f equal? False Let o = 21.5 + 72.5. Let u = -93 + o. Which is smaller: u or 21? u Let j be (-1 + 6/9)6. Let p be (22/(-33))/(j/(-3)). Let t = 23/124 + 2/31. Is p greater than or equal to t? False Let k be (6/15)/(10/12 - 0). Suppose -2 = 2o + 3i, -5o + 2 - 7 = -4i. Is o < k? True Let z = 341 + -336. Which is smaller: z or 27? z Let d = -863/2040 + 22/51. Let v = 2/15 - d. Suppose -3 = 4m + 2i - 11, -4m - 3i = -12. Are v and m equal? False Let i be 2/(-4) - 2062/(-20). Let z = i - 103. Let m = 1528 - 1533. Is z != m? True Let q = -7.231 + 2.231. Which is smaller: 83 or q? q Let m be ((-6)/(-9))/(4/(-129)) + 4. Which is smaller: m or -19? -19 Suppose -3k + 2 = -v - 4v, -v - k + 6 = 0. Suppose -vs + 0 = -3i - 4, i - 5s = -10. Is -3/4 not equal to i? True Suppose -48x + 42x + 240 = 0. Let a be (-132)/x + 5/10. Which is greater: a or -2? -2 Let k(g) = -3g*3 - 179g*2 + 174g*2 + 2g*3 + 2g. Let q be k(-6). Which is bigger: 23 or q? q Let v(i) = i + 7. Let p be v(-3). Let w = 3 - p. Is w != 2/9? True Let h be 2/(-3) - (-7)/(84/92). Suppose -v = -6 - 10. Which is greater: v or h? v Let u = -31 - -31. Let b(g) = g2 + g3 - g2 - g2. Let h be b(u). Do h and 2/21 have different values? True Suppose -4t - 19 = d, -7t - 12 = -4t. Let v(h) = -h + 5. Let k be v(10). Which is smaller: d or k? k Let b = 82.2 + -82. Which is smaller: -88 or b? -88 Let l be 2(-2088)/384(-2)/3. Which is greater: 6 or l? l Suppose 7h = 4h - 12. Suppose 0 = -2s - 3i - 21, 18s = 17s + 4i + 6. Is h smaller than s? False Let x = 7547/25 + -302. Suppose 0 = 45u - 52u + 7. Which is greater: u or x? u Suppose 64 = 5i + 59. Is -2/185 less than i? True Let p be (-6)/(-8)1/3. Let z = 245.11 + -243. Let a = 0.11 - z. Is a greater than p? False Suppose -134 = -19a - 20. Is 37/5 greater than or equal to a? True Let z = 172 - 171.87. Let t = -8 - -8.03. Let o = t - z. Which is greater: 0 or o? 0 Suppose 51g - 57g - 234 = 0. Which is smaller: -37 or g? g Let z(t) = -2t - 2. Let w be z(-2). Suppose -wc = -4c + 4. Suppose cx = 3x + 2. Which is smaller: -3/4 or x? x Let g = 10383/2282 - -7/326. Which is smaller: 5 or g? g Suppose p = 4p + 5t + 990, -2p + 6t - 688 = 0. Do p and -334 have the same value? False Let l = 119 + 267. Which is greater: l or 387? 387 Let w = -27457/1287 + 1/1287. Is -2/5 less than or equal to w? False Let s = 0 - -5. Let f = 0 + 19. Suppose -8m + f = -21. Does m = s? True Let y = 543 + -405. Is y greater than or equal to 137? True Suppose -29g = -12g + 255. Which is smaller: -31/2 or g? -31/2 Suppose 4t - 5l = 162, 5t - 5l - 97 = 108. Which is bigger: 47 or t? 47 Let q be 1(-2 + (-2)/(-2)). Suppose -21p + 336 = -17p. Let k be -3 - (-1 + 4/p + -2). Which is bigger: k or q? k Suppose -3v = -4v + 91. Which is bigger: v or 92? 92 Suppose 0 = b - 5h - 30, -b - 3h + 46 = 0. Suppose 3c - 5r + b = c, 0 = 2c - r + 40. Is c less than -21? False Let n be (-5)/(-2) + 72/(-48). Which is smaller: 6/95 or n? 6/95 Let i be (-1 - 1) + (38 - 12/(-2)). Let r = i + -29. Is r bigger than 11? True Let d = -0.2 - 0. Let u be 3 - (3/371)/3. Let b = u + 21. Which is bigger: d or b? b Suppose -t = -4y + 16, 3y + 0 = -4t + 12. Which is bigger: 6/271 or t? 6/271 Let j = 276 + -275.938. Which is bigger: 0.1 or j? 0.1 Suppose -y + 8h - 184 = 6h, -4h - 190 = y. Is y not equal to -184? True Let u(g) = 5 + 2g - 2 - 2 + 1. Let f be u(6). Let p = f + -14. Which is smaller: p or 2? p Let d be (0 - 18/(-8))/(6/224). Let p = d - 60. Which is smaller: p or 45/2? 45/2 Let z = -152 + 8207/54. Suppose 5j + 2 = 3j. Is j >= z? False Let l = -1227143/322 + 3811. Which is greater: l or 0? 0 Let j = 3.738 - -0.262. Is -7/10 at least as big as j? False Let f = 15 - 26. Let b(l) = -l3 - 40l*2 - 113l - 86. Let a be b(-37). Which is smaller: a or f? a Let l = 5.1 + -5. Let z = 13.9 + l. Let h = z + -12. Which is smaller: h or 1/9? 1/9 Let x = -789 - -791. Suppose 0z = z + 4. Let v be (-26)/(-8) + 2/z. Is x at least as big as v? False Let h(x) = -6x*3 + 3x*2 + 3x + 16. Let o(v) = 7v3 - 4v*2 - 4v - 15. Let m(u) = -6h(u) - 5o(u). Let y be m(0). Which is greater: y or -20? -20 Suppose 3*o =	{ "pile_set_name": "DM Mathematics" }
l). Find the second derivative of v(k) wrt k. -2 Let y(b) be the second derivative of -11b5/20 - 5b*3/6 - 5b. What is the second derivative of y(z) wrt z? -66z Let k(j) be the second derivative of -4j + 0j4 + 1/14j*7 + 0j*6 + 0 + 5/6j*3 + 0j*2 + 0j*5. Find the second derivative of k(x) wrt x. 60x3 Let x be 2 - 1/((-1)/2). What is the derivative of x - h2 - 8h + 8h wrt h? -2h Let h be 25/10 + 2/(-4). Find the first derivative of 0b - 3b + h + 2b + 2b wrt b. 1 Let h = 17 - 10. Let w(z) = z - 2. Let s be w(h). Differentiate 2u*3 - su + 5u - 2 wrt u. 6u*2 Let a(f) = 16f*5 + 8f*4 + 6f*3 + 13f*2 + 5f - 6. Let p(u) = -u4 - u3 - u + 1. Let q(y) = a(y) + 6p(y). Find the third derivative of q(x) wrt x. 960x*2 + 48x Let o(a) = -4a - 1. Let f(t) = -20t + 3 - 8t + 39t. Let n(q) = 6f(q) + 17o(q). What is the first derivative of n(v) wrt v? -2 Suppose 2b = 4h - 13 - 3, 2b = -4. What is the third derivative of -3x*4 + hx*4 - 6x*4 - 6x*2 wrt x? -144x Find the second derivative of 126o - 4o*2 - 135o - 3o3 + 2o*3 wrt o. -6o - 8 Let b(c) = 2c + 5. Let l be b(-5). Let p = -1 - l. What is the first derivative of 0o*3 - p - 5o - 4o3 + 5o wrt o? -12o2 Let o(t) = -21t*4 - 4t*3 - 37t*2 - 4t. Let p(j) = 21j4 + 5j*3 + 38j*2 + 5j. Let s(g) = -5o(g) - 4p(g). Find the third derivative of s(m) wrt m. 504m Let l(v) be the second derivative of -13v*7/42 + 3v*3/2 + 10v. What is the second derivative of l(w) wrt w? -260w3 Let x(s) = -s2 + 3s + 2. Let h be x(2). Suppose -hy = -6y + 4. What is the third derivative of -yq2 - 2q*6 + 3q*2 + 3q*2 - 2q*2 wrt q? -240q*3 Suppose -3 = -4m + m. What is the first derivative of -2z3 - m + 0z + 0z wrt z? -6z*2 Let d(o) be the second derivative of 11o*3/6 + 33o*2/2 - 42o. Differentiate d(p) with respect to p. 11 Let b(o) be the third derivative of -5o9/504 - o5/60 + 3o*2. What is the third derivative of b(z) wrt z? -600z*3 Let m be 1/(-2)2 - -1. Suppose 4a - 1 - 7 = m. Differentiate 0r2 - r2 + 1 + 0ra with respect to r. -2r Suppose -5v = 4g + 19 + 10, g - 4 = v. Let w(s) = -s - 2. Let a(q) = 6q + 9. Let r(c) = va(c) - 24w(c). Differentiate r(o) wrt o. -6 Let m = 19 + -16. Let g be (-22)/(-6) - 2/(-6). Find the first derivative of -p4 - 2 + g + mp*4 - 4 wrt p. 8p*3 Let h(y) = -23y*2 - 6y - 15. Let w(a) = -a*2 - a - 1. Let m(q) = -h(q) + 6w(q). What is the derivative of m(z) wrt z? 34z Let a(u) = -u3 + u2 + u - 1. Let r(c) = -10c3 - c2 + 8c - 8. Let k(v) = -24a(v) + 3r(v). What is the third derivative of k(n) wrt n? -36 Let x(u) = 13u*3 + u. Let o be 3-3(-2)/6. Let p(q) = -2q*3 - 2qo + q3. Let i(v) = -9p(v) - 2x(v). What is the second derivative of i(m) wrt m? 6m What is the third derivative of -17n - 3n2 - 2n*2 - 19n*5 + 16n wrt n? -1140n2 Let y be (6 - 3) + (-1 - -1). Let b(k) be the second derivative of 0 + 3/20k*5 + yk + 1/2k2 + 0k*3 + 0k*4. Differentiate b(r) with respect to r. 9r2 Let x(n) be the second derivative of n6/10 - 25n3/6 + 11n. Find the second derivative of x(f) wrt f. 36f2 What is the third derivative of -7j*3 + 4j3 + 7 + j2 - 10j3 + 22 wrt j? -78 Differentiate 6f*2 - 7 - 119f + 119f with respect to f. 12f What is the second derivative of 12r + 13r - 12r + 9r + 7r2 wrt r? 14 Let y(m) = 46m*5 + 3m*4 - 27m*2 + 3m + 2. Let d(n) = n5 + n4 + n. Let w(k) = -3d(k) + y(k). What is the third derivative of w(f) wrt f? 2580f*2 Let t(s) be the first derivative of -19s6/3 - s4/4 - 3s2 + 53. Find the second derivative of t(n) wrt n. -760n*3 - 6n Let q(l) be the second derivative of -l8/3360 + l7/315 + l*4/12 - 3l. Let s(z) be the third derivative of q(z). Find the third derivative of s(j) wrt j. -12 Let x(u) be the first derivative of u4/6 + u3/3 + 3u2/2 - 3. Let o(b) be the second derivative of x(b). Differentiate o(k) with respect to k. 4 Suppose -4 = 3k - 10. Find the second derivative of 0d5 - kd + 3d5 + 0d*5 wrt d. 60d3 Let h(y) be the second derivative of -y9/7560 - 7y6/720 - y4/4 + 5y. Let s(u) be the third derivative of h(u). Find the second derivative of s(c) wrt c. -24c2 Let y(v) = 3v*2 + 14v + 6. Let z(q) = 7q2 + 28q + 13. Let i(a) = -13y(a) + 6z(a). What is the second derivative of i(s) wrt s? 6 Let m(c) = -2c - 2c + 0 + 6 - c*2. Let b be m(-5). What is the first derivative of 2 - b + 2g - g wrt g? 1 What is the third derivative of -1562y + 1562y + 33y2 + 13y*6 wrt y? 1560y*3 Let h(f) be the second derivative of 7f + 0f2 - 1/12f*4 + 0 + 3/10f*5 + 0f*3. What is the third derivative of h(w) wrt w? 36 Let v(l) be the first derivative of -9l*4 + 5l*3 + 56. What is the third derivative of v(o) wrt o? -216 Suppose 1 = 3m - 5. What is the derivative of m - 3f2 - 4f*2 + 8f*2 wrt f? 2f Let h(z) = z*3 + 7z*2 + 4z - 7. Let y be h(-6). What is the second derivative of k + 3k + 0k + 2ky wrt k? 40k3 Let i(a) be the third derivative of -a5/120 + a4/6 + a3/2 - 4a2. Let r(w) be the first derivative of i(w). What is the first derivative of r(p) wrt p? -1 Let z(v) be the first derivative of v3 - 7v2/2 + 8. Find the second derivative of z(a) wrt a. 6 Let g(w) = -w5 + w*3 - w. Let u(j) = 3j5 - j3 + 6j2 + j. Let y(s) = -g(s) - u(s). Find the third derivative of y(r) wrt r. -120r*2 Let x be 1 - (-6)/((-6)/(-3)). What is the derivative of 2 - 2j4 - jx + 1 wrt j? -12j3 Let x(i) be the third derivative of i9/504 - i7/105 - i5/30 + i4/3 - 12i*2. What is the third derivative of x(u) wrt u? 120u*3 - 48u Let i(z) be the third derivative of -z*7/15 + 25z*3/6 - 7z*2. Differentiate i(a) wrt a. -56a*3 Let x(j) be the second derivative of -11j*5/20 - 12j*2 - 26j. Differentiate x(b) with respect to b. -33b2 Let d = 14 + -9. Let w(x) = x2 + 2x + 2. Let m be w(-2). What is the second derivative of -mid + 3i*3 + i - 3i*3 wrt i? -40i*3 Let w(f) be the second derivative of -3f*8/56 + 5f*4/12 - 7f. What is the third derivative of w(a) wrt a? -360a3 Let d be (-1 + 3)(-3 + 4). What is the second derivative of 0k + 2k*3 - 2k*3 - dk + k*3 wrt k? 6k Let w(k) be the third derivative of -17k5/60 - k4/24 - 13k*3/6 - 36k2. Find the second derivative of w(x) wrt x. -34 Let k(s) be the third derivative of s6/180 - s4/12 - s3/3 + 2s2. Let a(n) be the first derivative of k(n). Find the first derivative of a(w) wrt w. 4w Let l(j) = -2j3 - 2j. Let w(o) = -10o3 - 10o. Let p(b) = 11l(b) - 2w(b). What is the second derivative of p(q) wrt q? -12q What is the first derivative of 12 + 27 + 25 - 26 - 7b wrt b? -7 Let j(g) be the second derivative of -23g6/30 + 3g*3/2 + 23g. What is the second derivative of j(v) wrt v? -276v2 Let l be 1/(-2 - 5/(-3)). Let q = l - -5. Find the third derivative of -qt*5 + 0t*5 + 0t2 + t2 - 2t2 wrt t. -120t*2 Let i(k) be the first derivative of -13k*5/5 - 14k - 4. What is the first derivative of i(n) wrt n? -52n3 Let g(y) = -13y*2 - 17y + 9. Let z(l) = 0l2 + 3l*2 + 2 + 4l - 4 + 0l2. Let s(h) = -2g(h) - 9z(h). Find the second derivative of s(i) wrt i. -2 Let n(o) = -45o*3 + 3. Let p(z) = -11z*3 + 1. Let x(r) = -2n(r) + 9p(r). What is the derivative of x(f) wrt f? -27f*2 Let x(i) be the first derivative of -10i*7/7 + 4i*3/3 + 12. Find the third derivative of x(r) wrt r. -1200r*3 Let z(u) be the first derivative of 49u4/4 - u3/3 + 38. What is the third derivative of z(g) wrt g? 294 Find the third derivative of 2l3 + 3l*3 + 2l*3 + 11l2 wrt l. 42 Let f(b) be the third derivative of -b5/20 - 2b3/3 + b2. Find the first derivative of f(t) wrt t. -6t Let j(x) be the third derivative of x7/1680 - x6/720 + x5/20 + x2. Let i(c) be the third derivative of j(c). Differentiate i(b) wrt b. 3 Let r = -17 + 24. What is the third derivative of -rp2 - p4 - p4 - p4 wrt p? -72p Let t(x) = -x - 1. Let l(m) = 4m + 1. Let f(v) = -2l(v) + 2*t(v). Differentiate f(n) with respect to	{ "pile_set_name": "DM Mathematics" }
, 0 = -n - 3j + 41. Suppose -2m + 3m = n. Suppose w = g - 8, -3g + m = 5w + 9. List the prime factors of g. 3 Let d(l) = 19l*2 - 46l - 246. What are the prime factors of d(-6)? 2, 3, 7, 17 Let l = -154 + 490. Suppose 4v = 3u + 336, 5v - 2u = v + l. What are the prime factors of v? 2, 3, 7 Let i(d) = d + 0d + 11 + 18. Suppose -3h + 11 = 47. What are the prime factors of i(h)? 17 Let u(x) = x*3 + 12x*2 - 13x - 1. Let n be u(-12). Let r be n/2 + (-2)/4. Let f = r + -24. List the prime factors of f. 53 Suppose 5w + 88 = 433. List the prime factors of w. 3, 23 Suppose -u + 3r + 326 = 49, 0 = 4u - r - 1064. Suppose 6g - 473 = u. What are the prime factors of g? 3, 41 Let d(y) = -y*3 + 25y*2 - 11y + 53. Let m be d(23). Suppose -20b = -17b - m. What are the prime factors of b? 2, 11, 13 Let l be ((-10)/(-8))/((-5)/(-20)). Suppose -ls - 380 = -9s. Suppose 0 = -u - 4f - f + 45, f + s = 5u. What are the prime factors of u? 2, 5 Let h = 32 + -34. List the prime factors of 48/18 + h/3. 2 What are the prime factors of (-77)/14 + 2/(-4) + 140? 2, 67 Let h be (-3)/3 + 296. Let y = -95 + h. What are the prime factors of y? 2, 3 Let u(d) be the second derivative of 43d3/6 - d2/2 - 2d. Let o be u(2). Suppose 3j = -7 - 8, t = 5j + o. What are the prime factors of t? 2, 3, 5 Let x = -31 - -36. Suppose 24 = xo - 3o. List the prime factors of o. 2, 3 Let t(q) = q3 - 9. Let k be t(0). Let g be ((-15 - -5)(3 - -2))/2. Let o = k - g. What are the prime factors of o? 2 Let y be -7(-3 + 5) + 0. Let b = y - -37. What are the prime factors of b? 23 Let s(c) be the first derivative of -c2 + 8c + 1. What are the prime factors of s(-11)? 2, 3, 5 Suppose -89j = -84j - 27210. List the prime factors of j. 2, 3, 907 Let l(k) = -k*3 + 3k*2 - 6k - 5. Let c be l(-4). Let z = c + -76. List the prime factors of z. 5, 11 Let y(t) = -t*3 + t + 3. Let d be y(0). Suppose -di - 36 = i - 5g, 8 = -2g. What are the prime factors of (-438)/i + 10/(-35)? 31 Suppose 3t + 4w = 16, 1 = -t + w + 4w. Suppose -4c = th - 0c - 8, -18 = -3h + c. Suppose h = k - 10. List the prime factors of k. 3, 5 Let u be (-1)/(-6) - (-1 - (-89)/(-6)). Suppose 17g - 157 = ug. What are the prime factors of g? 157 Suppose 3m = 5s - 5, 5m = 7m - s + 8. What are the prime factors of 4/8m/((-10)/116)? 29 List the prime factors of (-17997)/(-42) - (2 + 9/(-6)). 2, 107 Suppose 4b + 6772 = 4v, -2v + 3392 = -17b + 21b. What are the prime factors of v? 2, 7, 11 Let o = 340 + -189. Suppose 4j - 49 - o = 0. List the prime factors of j. 2, 5 Let a be 3/(-18)22-6. Let f(c) = 2c2 - 9c. Let w be f(6). Suppose w = v - 3i + 8i, -a = -v - 3i. What are the prime factors of v? 2, 7 Suppose 0 = d + 5k + 33, 6k = -d + 7k - 3. Let x be (-15 + 1)/(8/(-4)). List the prime factors of (0 - -42) + d + x. 41 Suppose -4h + 3v + 1684 = 7v, 0 = -h + 5v + 403. What are the prime factors of h? 2, 11, 19 Let i(n) = 7n - 3. Let t(y) = -y3 - 10y*2 - 13. Let u be t(-10). Let s = -10 - u. What are the prime factors of i(s)? 2, 3 List the prime factors of 17 - (-385)/(-22) - (-3270)/4. 19, 43 What are the prime factors of (-3)/3(5 + -36)6? 2, 3, 31 Suppose -2a - 13 = -21. Suppose 0 = -at + 4d - 132, -39 - 26 = 2t - 3d. Let m = t - -52. List the prime factors of m. 2, 3 Let n be 3 - ((-9)/3)/3. Suppose -nc = -5c + 4. List the prime factors of (-12)/(-32)4c. 2, 3 Let s(w) = w*3 - 2w*3 + 3 + 45w*2 - 41w*2. Let p be s(4). Suppose pv + 4y - 6 = 0, 5v = y - 3y + 10. List the prime factors of v. 2 Let a be 3424/7 + 24/(-168). Let m = -154 + a. What are the prime factors of m? 5, 67 Let u be (1208/(-4))/(1/((-1)/2)). Let g be 5 - (-2)/(-2 - 0). Suppose gb - u = -47. List the prime factors of b. 2, 13 Let y be 132-2(-9)/(-24). Let r = y - -166. List the prime factors of r. 67 Suppose 10 = -6u + 11u. Suppose 87 + 11 = ui. What are the prime factors of i? 7 Suppose -3w + 150 = -6w. Let a = -26 - w. What are the prime factors of a? 2, 3 Let s(m) = -m3 - 3m*2 + 5m + 9. Let c(v) = 2v - 9. Let f be c(6). Let t(i) = -2i + 2. Let r be t(f). What are the prime factors of s(r)? 5 Suppose -3k + 2200 = -3104. What are the prime factors of k? 2, 13, 17 Suppose -3z - 4 + 25 = 0. List the prime factors of z + 52 + (-2 - 1-3). 2, 3, 5 Let q(t) = -t3 + 10t*2 + 12t - 15. List the prime factors of q(8). 11, 19 Suppose 0 = s - 1 - 1. Suppose 2a - 3q - 74 = -sq, 0 = a + 5q - 37. List the prime factors of a. 37 Let h(f) = -f*3 + 4f*2 - 2f - 2. Let j be h(2). Suppose -v - jg + 1 = -17, v - 3g + 2 = 0. List the prime factors of ((-6)/v)/(2/(-30)). 3 Let r = -1950 + 1982. What are the prime factors of r? 2 Suppose p + 144 = 2z - 0z, -5z + 346 = p. Let x be (z/(-21))/((-2)/3). Suppose -xu + 190 = -0u. List the prime factors of u. 2, 19 Let b be (9/15)/(3/15). Suppose h - 64 = -3h. Let s = b + h. List the prime factors of s. 19 Suppose w - 3q = -q + 32, -4w = -3q - 128. Let c = -68 - -44. Let a = w + c. List the prime factors of a. 2 Suppose 9r - 8r = 2d + 769, r - 3d = 768. What are the prime factors of r? 3, 257 Suppose n - 22 = 33. Suppose a + 51 = 2o, -2o + a + n = -4a. What are the prime factors of o? 5 What are the prime factors of (5 + (-4539)/(-9))15/10? 2, 191 Suppose 160 = 5s + 3s. List the prime factors of s. 2, 5 Suppose -w - 2w + 6 = 0. List the prime factors of 0 + 35 + w + 10/5. 3, 13 Suppose -9o + 14o = 50. Suppose 7w = ow - 216. List the prime factors of w. 2, 3 Let r = -37 + 179. What are the prime factors of r? 2, 71 Suppose 0 = -44m + 111559 + 136777. What are the prime factors of m? 2, 17, 83 Let b(i) = -13i*2 - 20i - 25. Let s(c) = -3c2 - 5c - 6. Let t(w) = 2b(w) - 9s(w). Let l be t(-5). Suppose lr = 6 + 6. What are the prime factors of r? 3 Let w(t) = 2t*3 - 7t*2 + 3t + 5. Let n be w(4). Suppose -n - 10 = -k. List the prime factors of k. 43 Suppose -17f = -14f + 3r - 1797, 0 = 2f + 3r - 1197. List the prime factors of f. 2, 3, 5 Let d(t) = -t2 - 10t + 3. Let a be 92/(-10) - 64/80. Let r be d(a). Suppose rn + 1 = 3w + 4, w = -4n + 24. What are the prime factors of n? 5 Let d = 749 - 373. What are the prime factors of d? 2, 47 Let q(h) = h2 + 58h - 101. What are the prime factors of q(52)? 3, 1873 Let a be (-8)/666/(-4). Suppose -2f + a = -94. List the prime factors of f. 2, 29 Suppose 0 = -2r - 4l - 500 + 8346, -5r + 19647 = 2l. List the prime factors of r. 3931 Suppose -82g + 6235 = -77g. List the prime factors of g. 29, 43 Let l(t) = t*3 + 5t*2 - 7t + 3. Let f(g) be the third derivative of g*4/24 - 7g*3/3 - 2g*2. Let c be f(8). List the prime factors of l(c). 3 Let b(k) = -25k - 4. Let c = -99 + 93. List the prime factors of b(c). 2, 73 Suppose 3y + 2f - 6f - 2021 = 0, 687 = y + 2f. What are the prime factors of y? 7, 97 Let i = 64 + -106. Let h = i + 131. What are the prime factors of h? 89 Let m(q) = -q*3 + 4q*2 + 6q - 5. Let o be m(5). Suppose -4k - 12 = o, -13 = 2t - 0k - 3k. Let c = t - -17. List the prime factors of c. 2, 3 Let v = -95 + 95. Suppose 9a - 363 + 30 = v. List the prime factors of a. 37 Let d(x) = 5x + 3x3 - 34 + 16 + 12 - 5x*2 - 2x*3. Suppose 10 = -2q + 4q. List the prime factors of d(q). 19 Let v = 60 - 54. Suppose 2c - vc = -44. List the prime factors of c. 11 Suppose 0 = -0q - 2q - 4g + 212, 294 = 3q - 2g. Suppose q = 2a - 20. List the prime factors of a. 2, 3, 5 Suppose -24g + 5553 = -6327. List the prime factors of g. 3, 5, 11 Suppose l = -3k + 20, 2l = 2k - 4k + 20. Let w(s) = s + 7. Let i be w(7). Suppose 3z - 3r - 3 = 0, lz + i = 4z + 4r. List the prime factors of z. 2, 3 Suppose -5c + 3a = a + 73, -3a = -2c - 27. Let b = c + 15. What are the prime factors of (-2 + b)/(6/(-9))? 3 Suppose m - 3m + 30 = 0. Suppose 6 = 17o - mo. Suppose 0 = -on - 4a + 111, -96 = -4n - 2a + 52. List the prime factors of n. 37 Let v be (-320)/16(-3)/((-3)/(-34)). Suppose 10i - 2i - v = 0. What are the prime factors of i? 5, 17 Suppose -2k = -28 + 14. Suppose -k*s + 425 = 82. What are the prime factors of s? 7 Let d = 175 + -123. Let z = 18 - d. What are the prime factors of -1 - (	{ "pile_set_name": "DM Mathematics" }
-26 - -26. Suppose -3w = -0w - 36. Let n be w/(-78) + (-129)/(-1092). Is m > n? True Suppose -4v + 2o - 19 = -183, -4o = -2v + 76. Suppose -9i + 116 = 3r - 14i, -5r + 214 = 2i. Is v greater than or equal to r? True Let j = -1.7 + 1.6. Let u = -579.6 - -579. Which is smaller: j or u? u Let v be (2/18)/(218/12). Suppose -273 + 270 = 3s. Is v < s? False Let f = 2028.1 - 2280. Is f <= -1? True Let k be ((-24)/10)/(15/(-50)). Suppose 5y - 31 = 2t, 0 = 2t - 1 - 3. Let b = y - k. Which is greater: 1/37 or b? 1/37 Let a be 6/(-189)(-60954)/8. Let r = a + -242. Is 0 smaller than r? False Let q = 21701.4 + -21701. Which is smaller: -44 or q? -44 Let t = -549 + 548.9558. Let u = 0.0408 - t. Is 1 greater than or equal to u? True Let x be 48-1 - (-1776)/(-74). Which is smaller: x or -85? -85 Let r = 22.17 - 11.47. Let q = r - -62.3. Let h = 0 - 1. Which is smaller: h or q? h Let l(g) = g2 + 26g - 82. Let v be l(0). Which is smaller: v or 3/4? v Let q = -3341 - -3309. Which is bigger: -5 or q? -5 Suppose 0 = k - 4s - 521, -4k = 5s - 848 - 1320. Which is smaller: -5 or k? -5 Let q be 2/(-44)(163 - 165). Which is smaller: q or 3/461? 3/461 Let k(o) = -9o - 6. Let r be k(-2). Let n be 25/2 + r/24. Let v = 51/4 - n. Are v and -2 non-equal? True Suppose -2t + u + 3u = -14, 0 = 7t + u - 34. Let m be -4-2(-3)/(-12). Let g be (m - -2)/1 + -1. Is t not equal to g? True Suppose 3j - 5 = 100. Suppose -4q = 4, 2w + q + 0q = -j. Let d = 1477 + -1477.4. Is d < w? False Let r = 1 - -3. Let f = -3487.014 - -3484. Let x = 0.014 + f. Which is smaller: x or r? x Let d be 3/((55/160)/(-11)). Let c = d - -90. Which is bigger: -16/3 or c? -16/3 Let m = 35 + -33. Suppose 27 = mk + 9. Let a be (-30)/k(-6)/(-165). Which is smaller: -1 or a? -1 Let p be 0 - -4 - (1716/11 - -8 - 5). Is -150 greater than p? True Let q = 31377 + -8063865/257. Which is greater: q or -1? q Let n(q) = 25q3 - 327q*2 + 26q + 1. Let j be n(13). Is -9/28 < j? True Let k = -1.05 - -21.05. Let s = -20.4 + k. Let d be (2/28)/(3/(-12)). Which is bigger: s or d? d Let n = 28 - 15. Let h = 2.02 - -1.98. Which is smaller: h or n? h Let y = 262 - 146. Let r = y - 116.06. Is -12 smaller than r? True Suppose 0 = -2p + 3k - 958, 0 = -0p + 2p + 5k + 974. Let x be ((-576)/504)/(20/(-5)). Is p at least as big as x? False Let w be 5 - (-5 + (-648)/(-63) - -2). Which is greater: w or 0.01? 0.01 Let j be (16/(-4))/8 - (-2796)/(-8). Let i = 359 + j. Is 10 not equal to i? True Let p be 4 - (-161)/(21980/(-1850) - -12). Which is smaller: p or 140? p Suppose -63 = t + 2t. Suppose -3f - 48 = 5o + 38, 0 = -4f + 3o - 76. Which is greater: f or t? t Let g(k) be the third derivative of -k6/120 + 11k*5/60 + 31k*4/24 + 29k*2 + 3k. Let w be g(15). Is -434 smaller than w? False Let k(j) = -4j2 - 5j + 4. Let d be k(-4). Which is greater: d or -42? d Let j = -269/293 + 1483949/1172. Is j equal to 1266? False Suppose -178214 = -56k - 50926. Which is smaller: k or 2/5? 2/5 Let n = 25/388 - 16493/1552. Which is smaller: n or -12? -12 Let p(c) = -c3 + 12c*2 + 13c - 4. Let b be p(13). Let z be 1 + b - 24/9-3. Is 4 < z? True Suppose -3o = 2o. Let q be (-380)/(-1425) - 2/20. Is q smaller than o? False Suppose 0 = -4b + 5v - 12, 5b - 2v = -5v - 15. Let j(w) = w + 1. Let i be j(b). Which is bigger: -0.33 or i? -0.33 Let k be (-13805)/(-132) + 1 - (4 - -8). Which is bigger: -2/7 or k? k Let s be (-5856)/(-1220)(111 - 0). Which is bigger: 533 or s? 533 Let d be (4/(-12))/(2/6). Let p = 75037 + -5777854/77. Is p less than d? False Suppose -3m - 18 = -2b + 16, 2b - 18 = -m. Let h = -9 + b. Suppose -s + 3w + 7 = 0, 0 = -0s - 3s - hw + 54. Does s = 1? False Suppose -61x + 63x = -2. Let k be -4 - 3/(x/1). Which is bigger: k or 3/58? 3/58 Let f(v) = 12v - 198. Let x be f(29). Is x greater than 9? True Let q(z) = -5z*2 - 101z - 104. Let b be q(-19). Which is smaller: -29 or b? -29 Let m be (21/9)/(4704/(-504)). Let b = 45.91 - -1.09. Which is smaller: b or m? m Let v(q) = q*2 - 76q + 1643. Let i be v(51). Is i >= 368? True Let i be 111/(-21) - 10/(-35). Let h be 78/i - (-10)/(-25). Let j be (-5)/10h/(-18). Which is smaller: j or 0? j Let i = 99 - 89. Suppose -ig + 30 = -5g. Suppose -ga + 7a = 26. Is 24 greater than a? False Suppose 421 = 19y + 15y - 361. Which is smaller: -7 or y? -7 Let c = -523 - -1056. Let x = c - 561. Is x <= 8? True Suppose 0 = -4a + a + 6. Suppose 0 = an + 14. Suppose c - 3p = -c - 19, 0 = -3c - p - 34. Which is smaller: c or n? c Let j be ((10/3)/(-2))/(12/(-36)). Suppose -2c - jl = 7 + 22, -c - 5l - 27 = 0. Let m be (-3 - (-205)/(-5))/c. Is 22 > m? False Let q = 291 + -288. Let w be q5/(-240)5. Let h(l) = l2 - l. Let x be h(0). Is x >= w? True Let u(p) = p3 - 8p2 + 6p + 7. Let t be u(7). Let v = -671841/7 + 96663. Let m = -685 + v. Is m less than or equal to t? False Let h(j) = 2j2 + 2j + 3. Let u be h(-5). Let s = -46 + u. Let q be (-6)/s - ((-4)/(-1))/(-4). Which is smaller: -2 or q? -2 Let m = -2485 + 2461. Let u(p) = -p3 + p - 13. Let w be u(0). Which is greater: w or m? w Let h(c) = -c3 - 36c2 + 84c + 319. Let p be h(-38). Suppose -252 = -5r + r. Suppose -5b = -12 - r. Does b = p? True Let h = -159501/18444310 + 6/685. Which is smaller: h or 0? 0 Let f = -1837 + 1837. Let d(c) = 3c - 4. Let q be d(3). Suppose qy = -5l - 70, 2l = 1 + 1. Which is bigger: f or y? f Let b = -1793 + 57371/32. Let d = 81/416 + b. Which is smaller: -1 or d? -1 Let y be 110866/(-1232) - 42/112. Which is greater: y or -91? y Let v = 4057 - 4050. Is v smaller than -48.2? False Suppose -5h = -3c - 137, -5h + 136 = -0c - 4c. Let s be (7/h)/((-2)/8). Which is bigger: s or -2/1139? -2/1139 Let k = -2 - 0. Let c = -14741295/11 - -1338581. Let j = c - -1536. Does k = j? False Let m = -490 + 487.67. Let z = -123001 + 492003/4. Is z < m? False Let q be (-660)/(-144)36/(-90). Let s(m) = -m - 8. Let v be s(-5). Which is smaller: v or q? v Let j = 250 + -442. Let f = -299 - j. Are -0.2 and f equal? False Let m be (5/15)/(2/6). Let o be (m/2)/(14/84). Suppose ou + 16 = 22. Do -4 and u have different values? True Let o(w) = -w3 + 30w*2 + 118w + 597. Let a be o(34). Suppose -3f + 3l = -57, 3l = -3f + 2f + 23. Let d = 3 - f. Which is smaller: a or d? d Let z(f) = -3f*2 + 219f - 216. Let q be z(72). Which is greater: -4/3993 or q? q Suppose -244h = -238h - 6. Let v be 0 + (-16)/28 + h. Which is greater: v or 1.7? 1.7 Let j be -6((-15)/(-6))/(-5). Let s = j - 5. Let n be (-36)/216198/21. Which is greater: n or s? n Let w be 1-3 - (2 + -8). Let h be ((-4)/2)/(2/(-6)w). Let g be (0 + -1)/(h(-2)/52). Are g and 13 nonequal? False Let a = -2 + 2.0606. Let c = -0.4606 + a. Which is smaller: c or -0.23? c Let k be 40/16 + (-1)/2. Let u(z) = 7z - 10. Let g(x) = -3x + 5. Let n(q) = ku(q) + 5g(q). Let b be n(26). Which is smaller: b or 2? b Suppose 3p + 24 = -12. Let i be (-5)/(15/p) - (-4)/(-4). Suppose 5l - il + 8 = 0. Is -4 less than or equal to l? True Let i = -0.114 + -80.886. Let u = -0.02 - -49.02. Let j = i + u. Which is greater: -1 or j? -1 Let b = -32228 - -32220. Is -119.1 at most as big as b? True Let g(k) = 2k2 - 38k + 24. Let n be g(20). Let h be ((-3)/(-6))/(1/134). Let p = n - h. Which is greater: p or 2? 2 Suppose -5u = 3o - 20, -39 = -11u + 9u + 5o. Let a(y) = 15y*3 - 2y - 4y2 - 16y*3 + 2y*2 + 4 + 5y. Let j be a(-3). Which is bigger: u or j? u Let a = 11 + -3. Let j be 46/a + -2(-3)/(-8). Suppose 2n - 12 = 4o, -2n = -4n - jo + 48. Are n and 13 unequal? True Let s be (-12)/(-10)742/(-28) - -7. Is s greater than or equal to 9? False Let g = 32147 + -32076. Is g <= 19/5? False Suppose 16s + 3981 = 19s - 6o, 0 = 2s - 5o - 2656. Which is greater: s or 1322? s Let w = -58.35 + 58. Let o = 0.35 - w. Let p = -136.6 + 137. Which is smaller: p or o? p Suppose 69 = 2i - 1. Suppose -6139 = ib - 399. Which is bigger: b or -162? -162 Let f(h) = 6h2 - 6h. Let s(y) = -7y2 + 7y - 1. Let z(p) = 6f(p) + 5s(p). Let l be z(-2). Let r be 0 + (3/(-10) - 0). Which is smaller: r or l? r Let o be 1/((-551)/(-831) - 62/93). Is o less than or equal to -1389/5? False Let r(g)	{ "pile_set_name": "DM Mathematics" }
What is the fourth smallest value in 0.3, -1/4, -3, -0.1282? 0.3 Which is the biggest value? (a) 2.7 (b) 5 (c) 458 c What is the third biggest value in -1/12, 157, 5, -5, 9, 13? 9 Which is the second biggest value? (a) -2/17 (b) -13 (c) 3 (d) 9 (e) 1/2 c Which is the biggest value? (a) -0.06 (b) 90/11 (c) 0.11 (d) 14 (e) 4 d Which is the second smallest value? (a) -0.4 (b) 1830 (c) -56.8 (d) 5 (e) 3 a Which is the biggest value? (a) -6/7 (b) -1 (c) -1.22 a Which is the smallest value? (a) 3/5 (b) 94 (c) 48 (d) -2 (e) -5 (f) -0.2 e What is the second biggest value in 61/4, -1/4, 31, 22/7? 61/4 What is the smallest value in 5, 5211, 2/13? 2/13 Which is the fourth smallest value? (a) 4/5 (b) 0.1 (c) -2/7 (d) 5396 (e) -4 a What is the fourth smallest value in -5/4, 0, 566, -0.5? 566 Which is the biggest value? (a) -323/4 (b) 0.5 (c) -5 b What is the sixth biggest value in 1, -1/6, 1/7, -15, 13, -0.3? -15 What is the fifth smallest value in 0, 5, 69, 1/9, 1/4? 69 What is the second biggest value in 2, -153, -0.007, 0.07? 0.07 What is the second biggest value in -25, -2, 1786? -2 What is the third biggest value in 0, 1/3, 3, -1/5, -0.014? 0 Which is the sixth biggest value? (a) 0.1 (b) 2/3 (c) -2/7 (d) -20/9 (e) -0.4 (f) 52 d What is the smallest value in 3, -3, -89, -1/2? -89 Which is the third smallest value? (a) -47 (b) -0.1 (c) -2 (d) -154 c What is the fourth biggest value in 31, 3, -0.2, 25, -2? -0.2 Which is the biggest value? (a) 4 (b) 25671 (c) 2 b Which is the second smallest value? (a) -39 (b) -0.4 (c) 8 (d) 0.1 (e) -1/4 b What is the third smallest value in -177, 343, 4? 343 Which is the smallest value? (a) 3/2 (b) -0.3 (c) 3/685 (d) 2 b Which is the fourth biggest value? (a) 1/7 (b) -2/9 (c) -94 (d) -0.5 c Which is the third smallest value? (a) -0.0969 (b) 33 (c) 0.5 b What is the fifth smallest value in -5, 5, -0.7, 2, 1, 14? 5 Which is the biggest value? (a) 5 (b) 1 (c) -10 (d) -3 (e) 4 (f) 19 f Which is the third smallest value? (a) 7 (b) -67 (c) 1044 c Which is the fifth biggest value? (a) 3 (b) -1 (c) 14 (d) 4 (e) -5/328 b Which is the second smallest value? (a) 2 (b) 0.5 (c) 73 (d) -0.054 b What is the third smallest value in -1, 3, -0.05, 0.4, -5.9? -0.05 What is the smallest value in -12, -4/5, 2/425? -12 What is the third smallest value in -1/5, -0.6, -4/83? -4/83 Which is the biggest value? (a) -0.54 (b) 2/65 (c) -4/7 (d) 2/3 d Which is the biggest value? (a) 3.24 (b) -5 (c) 5 (d) -2/59 c Which is the fifth smallest value? (a) -2 (b) 3 (c) -6 (d) -0.3 (e) 1.2 (f) 0.044 e What is the third smallest value in -3, 0.165, -1/4? 0.165 What is the second smallest value in 75, -0.3, -9, 2, -1/5, -0.5? -0.5 Which is the smallest value? (a) 0 (b) 45395 (c) -1 c What is the second biggest value in -52, -49, 5.7? -49 What is the fourth biggest value in -0.3, -0.0127, 2/15, -2, -135? -2 Which is the smallest value? (a) 0.03 (b) -1/2 (c) 4/7 (d) -169 (e) 0.2 d Which is the second biggest value? (a) 0.62 (b) 1/4 (c) 0.4 (d) -24 c Which is the second smallest value? (a) 24 (b) -7/9 (c) -27 b What is the fifth biggest value in 28, 4, 2/9, -8, -0.1? -8 Which is the smallest value? (a) 4 (b) 0.5 (c) -4 (d) 48 (e) 1/10 c What is the second biggest value in -2070, 17, 0.03? 0.03 What is the biggest value in 0.08, 1172, 1? 1172 What is the biggest value in 5, -3697, 0.32, -0.5? 5 What is the smallest value in -1333, -8, 2? -1333 What is the fifth smallest value in -0.3, 0.9, -88, -2, 3? 3 What is the smallest value in 2/29, -2/9, 5, -0.46? -0.46 What is the fourth smallest value in 3/26, 0.4, -0.9, 804? 804 Which is the second biggest value? (a) 2 (b) -75 (c) -0.046 c Which is the fourth biggest value? (a) -0.1 (b) -6670 (c) -5 (d) 4 b Which is the third smallest value? (a) -2604 (b) 9 (c) -7 b What is the fourth biggest value in 0.22, -1, -0.202, -2, -0.3? -1 What is the third smallest value in -2, -51/200, 3, 5, 2? 2 What is the second biggest value in -0.66, -5, 0.6, 2/13, 1? 0.6 Which is the fourth biggest value? (a) 4/7 (b) 2 (c) 32.12 (d) -1/4 d Which is the fourth biggest value? (a) -1 (b) -1/10 (c) -0.87 (d) 4 (e) 1 c What is the second smallest value in -0.2, -273117, 5? -0.2 Which is the third smallest value? (a) 0.4 (b) -775 (c) -2 (d) -2/5 (e) -0.2 (f) -2/9 d Which is the smallest value? (a) 49/423 (b) -4 (c) -0.2 (d) -1 b What is the second biggest value in 5, -3/8, -3, -16? -3/8 Which is the fourth biggest value? (a) -6 (b) -1/400 (c) 1/4 (d) -4 a What is the biggest value in 14, 3, -1, -0.14, -0.4, -0.7? 14 Which is the third biggest value? (a) -585 (b) 0.11 (c) 3/26 a Which is the fourth biggest value? (a) 4 (b) -1/23 (c) 6 (d) -0.2 (e) 0.05 b Which is the fourth smallest value? (a) -0.05 (b) -120 (c) 1/3 (d) 4 d Which is the second biggest value? (a) -36 (b) 1/7 (c) 1/6 (d) -9/5 (e) -0.3 (f) -1 b Which is the fourth smallest value? (a) -2/139 (b) 0.4 (c) -0.3 (d) -0.23 b Which is the smallest value? (a) 0.2 (b) -33 (c) 87 (d) -2 (e) -5 (f) -0.1 b What is the second smallest value in 0.29, 0, -48, 0.5? 0 Which is the second biggest value? (a) 669 (b) 5 (c) 0.103 (d) -0.04 b Which is the biggest value? (a) 0.31 (b) 0.151 (c) 3 (d) 116 (e) 2/9 d Which is the fifth biggest value? (a) -0.75 (b) 4/3 (c) -1 (d) -70/13 (e) 2/17 d Which is the third biggest value? (a) 1 (b) -1432 (c) 8/7 b Which is the biggest value? (a) 13215 (b) -4 (c) -0.1 (d) 1/8 a Which is the smallest value? (a) 0.1 (b) -1650 (c) -157 b What is the biggest value in 0.2, -267/73, 0? 0.2 Which is the fifth biggest value? (a) -3 (b) 5 (c) -0.9581 (d) -0.5 (e) 4 (f) -1 f Which is the second smallest value? (a) 0 (b) 74/7 (c) 49 b What is the smallest value in 89, 306, -0.1, -0.4? -0.4 Which is the second smallest value? (a) -0.021 (b) 0.04 (c) 2/47 b What is the fourth biggest value in -135, -36, -6.7, -3? -135 What is the second biggest value in -3, 0.2, 1/6, 135773? 0.2 Which is the second biggest value? (a) -2/13 (b) -308 (c) -1 c Which is the fifth biggest value? (a) -93 (b) -0.1 (c) 0.6 (d) 1/3 (e) -1/6 (f) 1/6 e Which is the biggest value? (a) -525 (b) 31/5 (c) 0.03 b What is the third smallest value in -44, -5, 53, -2, 2/5? -2 Which is the second smallest value? (a) -2/15 (b) -3 (c) -4 (d) -5/8 (e) -0.3 b What is the second biggest value in -2/5, -2, 0.1, -0.5, -0.289? -0.289 What is the second smallest value in 1/3, -48/37, 4, 0.1, -19? -48/37 What is the fifth biggest value in -0.3, -3/5, 0.09, 1/8, 0, -1? -3/5 Which is the fourth biggest value? (a) 2.4 (b) 5 (c) -36/61 (d) -1 d What is the third smallest value in 0.24, 6, -2/4251? 6 Which is the fourth biggest value? (a) -5 (b) 0.14 (c) -48 (d) 1/21 c What is the fifth biggest value in -177, -1/9, -0.2, 0.1, 8/7? -177 Which is the smallest value? (a) -0.07 (b) 25 (c) -0.5 (d) -8/7 d What is the fifth smallest value in 11/3, 0, 0.175, -0.02, 0.2? 11/3 What is the second biggest value in 0, -0.06, -2, -174/11, 0.144? 0 Which is the third biggest value? (a) 0.2225 (b) 0 (c) 27 (d) -1 b Which is the third smallest value? (a) 0.2437 (b) 3 (c) 2 b Which is the third biggest value? (a) -1 (b) -2/13 (c) -61 (d) -2/3 (e) 2/11 d What is the second biggest value in -3967, 39, -5? -5 What is the third biggest value in 1/4, -0.1, 1/6, -1/4, -5/2? -0.1 Which is the second smallest value? (a) 4611 (b) -5 (c) 1/9 (d) 0.06 d Which is the fifth smallest value? (a) 3/4 (b) 0.1 (c) 427 (d) 8/11 (e) 0.4 c Which is the fifth smallest value? (a) 3.01 (b) -3 (c) 14 (d) 2/7 (e) -18 c What is the fifth smallest value in 2/37, -16, 0, 5, -1/3? 5 Which is the third smallest value? (a) -0.04473 (b) 0.2 (c) -0.4 (d) -0.3 a What is the third smallest value in 3/2, 2/3, 187, -0.1? 3/2 Which is the second biggest value? (a) -0.5 (b) 2963/3 (c) 0 c Which is the second smallest value? (a) 3 (b) -2/15 (c) -22 (d) 1 (e) 1/72 b What is the fourth smallest value in 5/6, 1, -6.59, 3? 3 What is the second biggest value in 0.9, 0.1745, 0, -1/3, 1/3, -3? 1/3 What is the fift	{ "pile_set_name": "DM Mathematics" }
/5 of a gram in milligrams? 9600 What is 305.9571 litres in millilitres? 305957.1 How many millilitres are there in 422.2148l? 422214.8 Convert 43.30984um to centimeters. 0.004330984 How many decades are there in 0.2585033 millennia? 25.85033 What is one sixth of a week in minutes? 1680 How many seconds are there in 0.2998398ns? 0.0000000002998398 What is 3/8 of a meter in millimeters? 375 What is 79/2 of a kilogram in grams? 39500 What is 48.71105t in kilograms? 48711.05 Convert 47245.4 millennia to months. 566944800 What is 538.7223kg in tonnes? 0.5387223 How many meters are there in 19/4 of a kilometer? 4750 How many micrograms are there in 3/10 of a milligram? 300 How many millilitres are there in 3/8 of a litre? 375 How many kilometers are there in 746524.8nm? 0.0000007465248 What is 242271.48 months in millennia? 20.18929 What is 7/2 of a litre in millilitres? 3500 What is 13/5 of a litre in millilitres? 2600 Convert 7594.64 centuries to months. 9113568 What is one quarter of a millennium in months? 3000 Convert 1.4092719 months to millennia. 0.000117439325 Convert 896.5195 millilitres to litres. 0.8965195 What is 972.04 tonnes in milligrams? 972040000000 Convert 5.37626 litres to millilitres. 5376.26 How many minutes are there in fourteeen ninths of a week? 15680 How many millilitres are there in five quarters of a litre? 1250 What is 332282.3 millilitres in litres? 332.2823 What is 61/4 of a microgram in nanograms? 15250 What is 6/5 of a meter in millimeters? 1200 Convert 355.5815 millilitres to litres. 0.3555815 How many grams are there in six fifths of a kilogram? 1200 What is fifty-three fifths of a decade in years? 106 What is 13/5 of a microgram in nanograms? 2600 What is three eighths of a centimeter in micrometers? 3750 How many micrograms are there in 19/4 of a milligram? 4750 What is 27/5 of a kilometer in meters? 5400 How many millilitres are there in five quarters of a litre? 1250 How many months are there in 4/3 of a millennium? 16000 How many minutes are there in 19/7 of a week? 27360 How many days are there in 2204832.96s? 25.5189 What is 783.68265 nanoseconds in hours? 0.000000000217689625 Convert 256.5297 milligrams to grams. 0.2565297 How many meters are there in 2001.628km? 2001628 How many months are there in 10/3 of a century? 4000 What is 3/25 of a kilogram in grams? 120 How many minutes are there in 23949.333us? 0.00039915555 How many decades are there in twenty-one halves of a millennium? 1050 What is 39617.73 years in millennia? 39.61773 How many millilitres are there in 25/4 of a litre? 6250 What is fourty-five quarters of a microgram in nanograms? 11250 Convert 9.759953l to millilitres. 9759.953 How many millilitres are there in thirty-one fifths of a litre? 6200 What is 7/4 of a millennium in years? 1750 What is 60.23668um in nanometers? 60236.68 What is 5/8 of a gram in milligrams? 625 What is 2676.976ug in grams? 0.002676976 How many kilometers are there in 4528.6mm? 0.0045286 How many meters are there in 44/5 of a kilometer? 8800 What is 3.763913 milliseconds in seconds? 0.003763913 Convert 0.973916ml to litres. 0.000973916 Convert 5351.212ml to litres. 5.351212 How many grams are there in 776.9983mg? 0.7769983 What is 45/2 of a litre in millilitres? 22500 How many months are there in 3540.071 decades? 424808.52 How many millennia are there in 1517071.5 months? 126.422625 What is one tenth of a kilometer in centimeters? 10000 How many meters are there in 7/4 of a kilometer? 1750 What is 21/5 of a century in years? 420 How many millennia are there in 20319.71 decades? 203.1971 What is 3149.905km in micrometers? 3149905000000 How many grams are there in 45/4 of a kilogram? 11250 What is 51/5 of a litre in millilitres? 10200 What is 878.44311 seconds in hours? 0.244011975 What is twenty-six fifths of a milligram in micrograms? 5200 What is 41.02858 millennia in months? 492342.96 What is thirty-one fifths of a milligram in micrograms? 6200 What is fourty-four fifths of a tonne in kilograms? 8800 What is one tenth of a micrometer in nanometers? 100 What is 1580.854023ns in weeks? 0.0000000000026138459375 How many minutes are there in three eighths of a day? 540 What is 17/2 of a litre in millilitres? 8500 How many micrometers are there in 1/20 of a meter? 50000 How many centimeters are there in 730.176um? 0.0730176 How many grams are there in 21/4 of a kilogram? 5250 What is 9/10 of a century in years? 90 Convert 792.0197 millilitres to litres. 0.7920197 How many kilograms are there in 11/10 of a tonne? 1100 Convert 839.6815t to nanograms. 839681500000000000 Convert 68363.82t to nanograms. 68363820000000000000 What is 7.077866 decades in years? 70.77866 What is 17/4 of a litre in millilitres? 4250 Convert 11213.7s to minutes. 186.895 Convert 1.793133 decades to centuries. 0.1793133 How many grams are there in 1/10 of a kilogram? 100 What is seventeen quarters of a meter in millimeters? 4250 Convert 5.76002l to millilitres. 5760.02 What is 2/105 of a week in seconds? 11520 Convert 77.702724ns to hours. 0.00000000002158409 Convert 5.7305mg to tonnes. 0.0000000057305 What is 3/25 of a milligram in micrograms? 120 How many millilitres are there in five eighths of a litre? 625 How many micrometers are there in fifty-one halves of a millimeter? 25500 What is 8815.98249ns in weeks? 0.000000000014576690625 What is 0.0513552kg in tonnes? 0.0000513552 How many nanograms are there in 3/8 of a microgram? 375 Convert 55672.7 centimeters to meters. 556.727 How many millilitres are there in twenty-one fifths of a litre? 4200 What is 7/8 of a microgram in nanograms? 875 What is 1/20 of a second in microseconds? 50000 How many millilitres are there in 3/8 of a litre? 375 Convert 0.9188624cm to meters. 0.009188624 How many kilograms are there in 54555.22ug? 0.00005455522 How many decades are there in seventeen halves of a millennium? 850 How many meters are there in seven halves of a kilometer? 3500 How many nanometers are there in nine tenths of a micrometer? 900 What is twenty-nine halves of a litre in millilitres? 14500 What is 1/4 of a century in years? 25 What is 7/25 of a meter in centimeters? 28 Convert 403.543 milligrams to tonnes. 0.000000403543 Convert 0.9811997 centuries to millennia. 0.09811997 What is 3/50 of a microgram in nanograms? 60 What is 6.483476 years in decades? 0.6483476 How many nanoseconds are there in 3.14457 weeks? 1901835936000000 How many millilitres are there in thirty-one fifths of a litre? 6200 How many micrometers are there in 1/20 of a meter? 50000 How many decades are there in 6731.29 centuries? 67312.9 How many months are there in 44/5 of a decade? 1056 How many nanoseconds are there in 60.839 minutes? 3650340000000 How many millilitres are there in 711179.5l? 711179500 How many millimeters are there in 31/5 of a meter? 6200 What is 980.4016 litres in millilitres? 980401.6 What is 5173202.7 microseconds in hours? 0.00143700075 What is 0.54636ml in litres? 0.00054636 Convert 83843.92 micrometers to nanometers. 83843920 How many kilograms are there in eleven eighths of a tonne? 1375 How many milligrams are there in 25/4 of a gram? 6250 What is 3/32 of a kilogram in milligrams? 93750 How many meters are there in twenty-one halves of a kilometer? 10500 Convert 710115.3 nanometers to meters. 0.0007101153 How many microseconds are there in 9/10 of a millisecond? 900 What is 3/25 of a meter in centimeters? 12 How many milligrams are there in 31/2 of a gram? 15500 How many months are there in 3/5 of a millennium? 7200 How many nanometers are there in 553.206km? 553206000000000 What is 4/3 of a day in hours? 32 How many micrometers are there in seven quarters of a millimeter? 1750 How many milliseconds are there in 2.371674 microseconds? 0.002371674 Convert 2878.567 decades to millennia. 28.78567 Convert 9.088892 centuries to years. 908.8892 Convert 53333.36 litres to millilitres. 53333360 Convert 869.3853 meters to millimeters. 869385.3 What is 45.86891km in millimeters? 45868910 What is 1039992.3 nanoseconds in hours? 0.00000028888675 How many minutes are there in 17/2 of a hour? 510 What is one fifth of a litre in millilitres? 200 How many months are there in 7/4 of a millennium? 21000 How man	{ "pile_set_name": "DM Mathematics" }
8 What is the least common multiple of 66 and 99? 198 What is the least common multiple of 9 and 145? 1305 Calculate the common denominator of 85/112 and 85/112. 112 Find the common denominator of 83/2223 and -29/104. 17784 Calculate the lowest common multiple of 2472 and 11. 27192 What is the lowest common multiple of 148 and 44? 1628 What is the lowest common multiple of 2233 and 13? 29029 What is the common denominator of -107/2576 and -109/552? 7728 Find the common denominator of 139/180 and -79/900. 900 Calculate the common denominator of -47/21 and 109/28. 84 What is the common denominator of 31/615 and -46/15? 615 What is the lowest common multiple of 11 and 6? 66 What is the smallest common multiple of 96 and 8? 96 Find the common denominator of 41/6 and 1/4462. 13386 What is the lowest common multiple of 5088 and 60? 25440 What is the common denominator of -101/218 and -85/18? 1962 Find the common denominator of 3/1343 and 57/869. 14773 What is the common denominator of -73/154 and 97/176? 1232 Calculate the common denominator of -19/4975 and -2/75. 14925 Calculate the common denominator of 9/14 and -151/15618. 109326 Calculate the smallest common multiple of 165 and 55. 165 Calculate the common denominator of 77/80 and 31/160. 160 Calculate the smallest common multiple of 2 and 7. 14 What is the common denominator of -43/245 and 33/875? 6125 Calculate the least common multiple of 500 and 320. 8000 What is the common denominator of 91/66 and -79/30? 330 Calculate the least common multiple of 51 and 10. 510 Calculate the common denominator of 107/2268 and -89/462. 24948 What is the lowest common multiple of 108 and 3888? 3888 What is the common denominator of 25/56 and 31/56? 56 Calculate the common denominator of -7/144 and -17/1083. 51984 Find the common denominator of -55/7 and -89/154. 154 What is the lowest common multiple of 50 and 370? 1850 What is the common denominator of -19/2 and -139/39738? 39738 What is the common denominator of 4/39 and -40/117? 117 What is the common denominator of 127/12 and 83/76? 228 Calculate the least common multiple of 2200 and 3300. 6600 What is the common denominator of -4/63 and 125/168? 504 What is the lowest common multiple of 160 and 440? 1760 What is the common denominator of 89/60 and 33/5? 60 What is the smallest common multiple of 10 and 4371? 43710 What is the lowest common multiple of 70 and 12? 420 What is the lowest common multiple of 50 and 12? 300 What is the lowest common multiple of 96 and 9? 288 Calculate the common denominator of 71/224 and -11/400. 5600 What is the least common multiple of 143 and 33? 429 What is the common denominator of -107/36 and -1/44? 396 What is the smallest common multiple of 39 and 9? 117 Find the common denominator of -119/36 and -103/30. 180 What is the common denominator of 103/3336 and 89/16? 6672 What is the common denominator of -137/276 and 133/216? 4968 What is the common denominator of 93/1390 and 151/18? 12510 Calculate the least common multiple of 27 and 1155. 10395 Calculate the smallest common multiple of 1085 and 2170. 2170 Find the common denominator of -83/36 and -71/78. 468 Calculate the common denominator of -53/2 and 7/446. 446 Find the common denominator of -113/12 and 85/11064. 11064 What is the lowest common multiple of 156 and 40? 1560 Calculate the smallest common multiple of 287 and 9. 2583 Find the common denominator of 79/36 and 41/18. 36 Calculate the common denominator of -101/30 and 7/5412. 27060 Calculate the least common multiple of 45 and 168. 2520 Calculate the lowest common multiple of 1065 and 5. 1065 What is the lowest common multiple of 27 and 396? 1188 What is the common denominator of 161/270 and -13/270? 270 Find the common denominator of 55/3484 and -62/5. 17420 Calculate the lowest common multiple of 78 and 48. 624 Find the common denominator of -89/20 and 79/284. 1420 Calculate the lowest common multiple of 63 and 2030. 18270 What is the least common multiple of 99 and 45? 495 What is the common denominator of -103/96 and -35/48? 96 What is the common denominator of 31/13124 and -24? 13124 Calculate the least common multiple of 76 and 16. 304 What is the common denominator of 119/20 and 26/315? 1260 What is the least common multiple of 75 and 9? 225 Find the common denominator of -34/5 and 145/13578. 67890 What is the common denominator of 5/6796 and -21/2? 6796 Calculate the least common multiple of 1476 and 7380. 7380 Calculate the common denominator of -139/18 and -23/2892. 8676 What is the lowest common multiple of 418 and 342? 3762 Calculate the common denominator of -6/403 and -17/78. 2418 Calculate the least common multiple of 140 and 140. 140 Calculate the lowest common multiple of 24 and 60. 120 Calculate the common denominator of -119/60 and -59/12. 60 Calculate the least common multiple of 845 and 555. 93795 Find the common denominator of -37/145 and 64/87. 435 What is the common denominator of -47/297 and 169/42? 4158 What is the smallest common multiple of 8340 and 1112? 16680 What is the common denominator of -3 and 97/110? 110 Calculate the common denominator of -52/77 and -55/7. 77 What is the least common multiple of 229 and 1? 229 Find the common denominator of -87/188 and -143/36. 1692 Calculate the common denominator of -47/54 and -139/18. 54 What is the common denominator of -31/50 and -71/15? 150 What is the smallest common multiple of 456 and 2964? 5928 What is the common denominator of 117/14860 and -51/8? 29720 Calculate the common denominator of 3/6637 and 29/8. 53096 What is the smallest common multiple of 2058 and 686? 2058 Calculate the common denominator of 4/99 and 48/121. 1089 Calculate the common denominator of 51/2 and -19/186. 186 Calculate the common denominator of -7/90 and -71/120. 360 What is the common denominator of 36/7 and -37/533? 3731 What is the smallest common multiple of 135 and 66? 2970 Find the common denominator of 119/30 and -70/27. 270 Find the common denominator of -55/98 and 83/168. 1176 What is the least common multiple of 24 and 33? 264 What is the smallest common multiple of 6150 and 450? 18450 What is the least common multiple of 2130 and 3? 2130 What is the common denominator of 39 and 45/11? 11 Calculate the least common multiple of 3270 and 1635. 3270 Calculate the smallest common multiple of 9 and 17. 153 Calculate the least common multiple of 104 and 13. 104 Find the common denominator of -95/42 and 125/102. 714 What is the common denominator of -46/369 and -119/410? 3690 Find the common denominator of -51/8 and -7/32. 32 What is the least common multiple of 50 and 55? 550 What is the least common multiple of 63 and 21? 63 Calculate the least common multiple of 30 and 60. 60 Calculate the common denominator of -23/95 and -45. 95 Find the common denominator of 145/72 and 23/132. 792 What is the common denominator of 21/5 and -83/21? 105 Calculate the smallest common multiple of 512 and 1. 512 Calculate the least common multiple of 30 and 7. 210 What is the smallest common multiple of 392 and 1134? 31752 What is the smallest common multiple of 410 and 164? 820 What is the least common multiple of 84 and 1612? 33852 What is the common denominator of -13/33 and 137/192? 2112 Calculate the common denominator of 3/11 and 40/3893. 42823 Calculate the least common multiple of 2230 and 1561. 15610 Calculate the lowest common multiple of 65 and 15. 195 What is the smallest common multiple of 4 and 2420? 2420 Find the common denominator of 1/87 and 32/63. 1827 What is the common denominator of 29/686 and 31/84? 4116 Calculate the smallest common multiple of 83 and 664. 664 Find the common denominator of 15/394 and -91/44. 8668 What is the smallest common multiple of 9 and 270? 270 Find the common denominator of 119/930 and 73/620. 1860 Find the common denominator of 55/1198 and 13/12. 7188 Calculate the lowest common multiple of 50 and 30. 150 Calculate the common denominator of 89/114 and 61/660. 12540 Calculate the lowest common multiple of 77 and 11. 77 What is the smallest common multiple of 4 and 3? 12 What is the common denominator of -109/162 and 139/72? 648 Calculate the lowest common multiple of 16 and 320. 320 Calculate the least common multi	{ "pile_set_name": "DM Mathematics" }
z) wrt z. 4 What is the second derivative of -1 + 1 - 2962u5 + 19u + 1471u5 + u3 + 1485u*5 wrt u? -120u*3 + 6u Let s(f) be the third derivative of 0f4 + 0f*5 + 0 + 2f + 32/105f7 + 0f*6 - 67/6f3 - f2. Find the first derivative of s(j) wrt j. 256j3 Let i(q) be the first derivative of 5/3q*3 - q + 13/2q2 + 92. What is the second derivative of i(b) wrt b? 10 Let p = -191 - -198. Let d(r) = r2 + 5r - 1. Let o(c) = -3c*2 - 10c + 3. Let u(f) = pd(f) + 3o(f). What is the first derivative of u(a) wrt a? -4a + 5 Let l(d) = d2 - 4d + 3. Let p be l(3). Let k be ((-1)/2p)/(13 - 11). Find the first derivative of k + 5w3 - w3 - 1 + 2 wrt w. 12w2 Let g(f) be the second derivative of 507f*7/7 + 111f*3/2 + 3123f. What is the second derivative of g(w) wrt w? 60840w3 Suppose r - 63 = 7v - 9v, 4v + 4r = 128. What is the first derivative of 0d*3 + d + 2 + 95 - vd*3 + 41 wrt d? -93d*2 + 1 Find the first derivative of 820 + 3933t*4 + 132 + 826 + 770 wrt t. 15732t*3 Let o(v) be the third derivative of 34 - 3/2v5 - v2 + 0v4 + 0v + 2/5v6 + 0v*3. Find the third derivative of o(j) wrt j. 288 Let g(l) be the second derivative of -565l*3/2 + 15l*2 - 674l. Differentiate g(b) with respect to b. -1695 Let z = 70 + -72. Let d be (-5 + (-114)/(-24))/(z/24). What is the third derivative of -5s2 + 11s*3 - 6s*2 - 31s*d wrt s? -120 Let p = 61 + -59. What is the first derivative of -14 - 26s*p - 25 - 15s*2 + 27 wrt s? -82s Let l(y) = -y3 - y2. Let m(w) = -5w3 - 4w*2 + 630w + 1525. Let c(r) = 4l(r) - m(r). Differentiate c(u) wrt u. 3u*2 - 630 Let x(u) = -465u*3 + 243u*2. Let l(h) = 467h*3 - 243h*2. Let p(v) = 6l(v) + 4x(v). What is the third derivative of p(s) wrt s? 5652 Let n(f) = -888f*2 + 5885f + 30. Let z(v) = -888v2 + 5886v + 24. Let k(c) = 4n(c) - 5z(c). What is the second derivative of k(h) wrt h? 1776 Let o(v) be the first derivative of 0v4 + 166 + 0v*3 + 0v*2 + 211v + 32/5v5. Find the first derivative of o(s) wrt s. 128s*3 Let d(h) be the second derivative of 2 + 1/3h*3 + 0h*4 + 2h - 61/2h2 + 0h*5 + 14/5h*6. What is the derivative of d(p) wrt p? 336p*3 + 2 Find the third derivative of -71d + 230d - 91d + 2711d2 - 68d - 2775d6 wrt d. -333000d*3 Let q = -93 + 95. Let x be 96/44 - q - (-60)/33. Differentiate -33d*2 - 4 + 99d*x - 53d*2 with respect to d. 26d Let x be ((-1)/(-3))/((-11)/(-66)). Suppose 4m = -s + 70, -2s = 2m - m - 21. Find the second derivative of -6d*2 + 11dx - d2 + md2 + 16d wrt d. 42 Let y = -31 - -33. Find the second derivative of 46r2 + 6r*y - 2r*2 - 21r wrt r. 100 Let h(y) = -938y + 5660. Let c be h(6). Let g(v) be the first derivative of -43v - 1/2v2 - c. Differentiate g(z) wrt z. -1 Suppose 5u - 5r = 3u + 7, -5u + 5r + 10 = 0. What is the third derivative of 2t2 - 11t4 - t5 + 10t4 - 8t*4 - u wrt t? -60t*2 - 216t Let s be (-16)/7 - 16/(-56). Let u be (-8)/4 - -4 - s. What is the third derivative of 4j2 + uj*2 - 6j*5 - 10j*5 + 0j*5 wrt j? -960j*2 Let g(h) be the second derivative of 65h*4/12 + 7h*3/6 + 5058h*2 + 20h - 152. What is the derivative of g(i) wrt i? 130i + 7 Let p(u) = -53u*2 - 260u + 9542. Let h(r) = -73r2 - 346r + 12722. Let n(y) = -8h(y) + 11p(y). What is the first derivative of n(a) wrt a? 2a - 92 Find the second derivative of 602l2 + l3 + 11254l - 1708l + 1085 + 3027l - 1085 wrt l. 6l + 1204 What is the second derivative of 13028s3 - 6146s*3 - 5362s*3 - 672s wrt s? 9120s Let u(w) be the third derivative of 23/60w*6 + 0w*4 + 0w + 3/10w5 + 0 + 121w*2 + 5/6w*3. What is the third derivative of u(z) wrt z? 276 Let o = -86 - -101. What is the second derivative of -15r5 - r2 - 68r - 11r*5 + or*5 wrt r? -220r*3 - 2 Let i(s) = 23s*2 - 20s - 1953. Let g(f) = 24f2 - 20f - 1952. Let p(d) = 3g(d) - 4i(d). What is the first derivative of p(y) wrt y? -40y + 20 Let l(s) = -9161s + 24786. Let k(c) = 3054c - 8268. Let x(b) = 7k(b) + 2l(b). Find the first derivative of x(p) wrt p. 3056 Let i(m) be the first derivative of 4/5m*5 - 99m - 15/4m4 + 0m*2 + 0m*3 - 120. Differentiate i(b) with respect to b. 16b*3 - 45b*2 Let w(a) = 109a*3 - 18a - 648. Let b(v) = 219v3 - 29v - 1296. Let o(t) = -4b(t) + 7w(t). Differentiate o(c) with respect to c. -339c2 - 10 Suppose 3016 = 32x - 3x. What is the first derivative of -30 + n + 0n + 4n - xn*4 - 125 - 3n wrt n? -416n3 + 2 Let q be (406/(-84))/(1/(-6)). What is the derivative of 20j - j*4 - 4j - 16j - 1 - qj*3 wrt j? -4j*3 - 87j*2 Let p(y) be the second derivative of -144y*3 + 41y*3 - 14 + 3y*2 - 3y + 46y3 + 46y*3. What is the first derivative of p(j) wrt j? -66 Suppose -569 - 7 = -3k. Find the first derivative of -43q3 - q - 89q*3 - 83q*3 + 41q*3 - k wrt q. -522q*2 - 1 Let p(n) = 5393n*2 - 1609n + 2. Let t(g) = -26965g2 + 8086g - 11. Let r(i) = 11p(i) + 2t(i). Find the second derivative of r(u) wrt u. 10786 Let o(f) be the second derivative of -837f5/10 + 481f*4/4 + 1305f. Find the third derivative of o(x) wrt x. -10044 Suppose 3i = -3w + 30, -22 = -5w + 5i - 3i. Suppose -9m + 7m = -w. Find the third derivative of 9b*2 + 739 - mb*3 - 739 wrt b. -18 Find the third derivative of -86x*2 - 58x*2 - 120x*2 + 82x*2 - 70x*2 - 2471x*5 wrt x. -148260x*2 Suppose 6c + 10 - 46 = 0. Suppose 133 + 53 = cs. What is the third derivative of 335w - 335w + sw*3 + 21w*2 wrt w? 186 Let i(z) be the first derivative of 825z*4/2 + 608z*3 + 1595. Find the third derivative of i(v) wrt v. 9900 Find the first derivative of -543 - 340 + 105m + 613m wrt m. 718 What is the third derivative of 2747h*3 - 1830h2 - h6 - 81808h4 + 81808h*4 wrt h? -120h*3 + 16482 Suppose -4m - 23x = -25x - 18, -12 = -3m + 3x. Find the third derivative of 107h2 - 160h*2 - 57h*2 + 60h*m - 55h*2 + 3h*5 wrt h. 3780h2 Let d(g) = -g2 + 13g - 8. Let c be d(11). Suppose 15o - co = 2. What is the second derivative of 11w*o + 1986 - 1986 - 6w wrt w? 22 Let r(w) = w*3 - 479w*2 + 22w + 8. Let q(f) = f*3 - 2f*2 + f. Let t(y) = -q(y) - r(y). Find the second derivative of t(b) wrt b. -12b + 962 Find the third derivative of -244q2 + 0q*5 + 0q*5 - 17359q*6 + 20530q*6 wrt q. 380520q*3 Let b(j) be the second derivative of 0j*5 - 76j*2 + 1/6j*6 + 0j*3 - 13 + 5/12j*4 + 4j. Differentiate b(v) with respect to v. 20v3 + 10v Let u(s) be the third derivative of 121s7/21 - 313s5/30 - s3/3 + 233s2 + 11. Find the third derivative of u(y) wrt y. 29040y Let m(v) = -15v + 2. Let x be m(-2). Let h be (-54)/(-15)(-190)/(-228). Find the second derivative of 3u + xu - 27uh - 10u wrt u. -162u Let k(p) = 96p + 1271. Let i(x) = -478x - 6343. Let q(d) = 4i(d) + 22k(d). Differentiate q(m) wrt m. 200 Let n = -156 - -159. What is the third derivative of 36s*2 + 0s*n - 14s*2 - 3s*3 + 10s*2 wrt s? -18 Let t(x) be the second derivative of 13/2x*2 + 13/24x*4 - 19 + 2x - 8x3. Let y(a) be the first derivative of t(a). Differentiate y(h) with respect to h. 13 Find the third derivative of -o + 1483o*2 - 100518o*3 - 337o*4 + 100518o*3 wrt o. -8088o Let a(f) be the first derivative of 81/4f4 + 2/5f*5 + 0f*2 - f + 72 - 1/3f*3. Find the third derivative of a(w) wrt w. 48w + 486 Let c(n) be the second derivative of 2 + 0n2 + 0n*4 + 0n*6 + 34/3n*3 - 1/4n*5 + 10n + 1/42n7. Find the second derivative of c(g) wrt g. 20g*3 - 30g Find the second derivative of -3752p - 3p*3 - 516p + 2628p2 + 1718p wrt p. -18p + 5256 Let d = -188 + 192. Find the first derivative of 1 + 20 + 22 - 38q*d wrt q. -152q*3 What is the derivative of -298 - 3221n - 158 - 193 - 284 wrt n? -3221 Let m(t) = t4 - t2 - t + 3. Let f(y) = -5y4 + 420y*3 + 6y*2 + 6y - 1408. Let l(u) = f(u) + 6m(u). Find the first derivative of l(z) wrt z. 4z*3 + 1260z*2 Let a(v) be the third derivative of -108v*4 - 2989v*3/6 + 1173v**2. What is the fir	{ "pile_set_name": "DM Mathematics" }
- 3p2 - 430p*2 + 3 + 244p*2 - 3. -190p*2 Expand -2z*3 + 7z*4 + 2z*3 + 15z4 - z4 + 10z4 + (-2z2 + z2 + 2z2)(-2z2 - 1 + 1). 29z4 Expand h5 + 2h5 - 4h*5 + (h - 7h - 2h)(0 + 0 - 7)(h4 + h4 - 5h*4). -169h*5 Expand ((5 - 4 + 0)(-y + y - 2y) + 4y + 3 - 3)(82 - 194 - 182). -588y Expand -o + 60o2 - 7090 + 7090 + (0o + 4o - 5o)(o + 0 + 0). 59o*2 - o Expand (-2a + 1 - 1)(a - 2a + 2a) - 26 + 5a*2 + 26 + (-3 + 0 + 1)(0a2 + a2 - 2a*2) - 2a*2 + 5a*2 + 2a*2. 10a*2 Expand (4 - 25 + n - 14)(3 - 3 + 3). 3n - 105 Expand ((3v - 2v + 0v)(-1 - 2 + 2) + 3v - 10v + 6v + 3 - 3 + v - 2)(-5 - 3v*2 - 3v*2 + 4v*2). 2v*3 + 4v*2 + 5v + 10 Expand -3 + m + 1 + 4 + (4 - 2m - 4)(-1 + 0 - 1) + (0 - 1 + 5)(-5m + 3m - m). -7m + 2 Expand (-o - 2o + o)(1 - 1 + 2o)(1154o - 2835o + 1034o). 2588o*3 Expand (1 + 1 - 4)(-2 + 2 - 1)(52 - 52 + 36t). 72t Expand (-2d - 1 + 1)(-d + d - d)(-d2 + d2 - 2d3) + (d2 - d2 + 2d*4)(19d - 35d - 17d). -70d*5 Expand ((-3 + 4 + 1)(-4n + 2n + 3n) + 29 - 21 - 10 - 14n)(4n - 6n + 3n). -12n2 - 2n Expand (-3 - 1 + 2)(-3 + 2 + 3)(-29j2 + 29j*2 + 8j*4) - 4j*4 + 460 - 460. -36j*4 Expand (46p - 21p - 8p)(-2 + p + 1 - 3p). -34p2 - 17p Expand (4 - 1 - 1)(0r*2 + 3r*2 - 2r*2) + 70r*2 + 17r*2 - 7r*2. 82r*2 Expand -7q*4 + 7q*4 + 6q*5 + (4q - q*2 - 4q)(-2q3 - q2 + q*2) - 3q*5 + 5q*5 - 3q*5 - 10q*3 - 14q*5 + 10q*3. -7q*5 Expand (6x*3 - 183x*2 + 183x*2)(2 - 1 + 1)(2x + x - x). 24x4 Expand -4n*3 + 2n3 + n3 + (5 - 5 + 2)(26n*3 + 0n*3 + 0n*3). 51n*3 Expand (3n*2 + 0n*2 + 0n*2)(22n2 + 13n*2 + 55n*2 + 0n*2) + 2n*4 - 3n*4 + 0n*4. 269n*4 Expand (138c + 165 - 165)(-c3 - c2 + c2) + (-3 + 3 + 3c)(2c*3 - 3c*3 + 3c*3). -132c*4 Expand (0 - 17l + 0)(-l + 3l - 3l) - l2 + 0 - 1 - 2. 16l*2 - 3 Expand (-119 + 119 - 11o)(-4 + 0 - 4)(2 + 3 - 6). -88o Expand (6 + 3 - 2)(4l - 5l + 3l) + l - l + 3l + (-3 - 2 + 6)(-3l + 5l - 3l) - 1 + 1 + 2l. 18l Expand (0 + 6 - 5)(-t + t - t3) - 104t*3 + 71t*3 + 171t*3 + (0 + 0 + 2t)(-4t*2 + 0t*2 + 2t*2). 133t*3 Expand (0 + 0 + 1)(2g5 + 0g + 0g) + 2g*4 - 2g4 - g5 - 18g5 + 100g*2 - 100g*2 - 2g*5 - 51g*4 + 51g*4. -19g*5 Expand (-92 - 323 + 33)(1 - 4 + 4)(-2j + 1 - 1). 764j Expand ((-2 + 2 - 4)(4 - 4 + 1) - 2 + 2 - 1)(-2u + 1 - 1)(-58 + 11u + 58) - u*2 - 2u*2 + 5u*2. 112u*2 Expand (4m*2 + 2 - 6m2 + m2)(29 + 3 + 2). -34m*2 + 68 Expand -40p*2 + 40p*2 - 16p*3 - 2p*3 - 3 + 3 + (-4p*2 + 4 - 4)(1 + 2p + p - 4p). -14p3 - 4p2 Expand (l3 + l*3 + 5l*3)(-9l - l - 3l + 32l - 7l). 84l4 Expand -11m + 96m2 - m + 10m + 5m + 3m*2 - 5m + (-m*2 + 2 - 2)(3 - 3 - 1) + 2m2 + 3 - 3. 102m*2 - 2m Expand -16v - 9v + 23v + (-3 + 2 - 2)(-v + 0v + 0v) - 2 + 2 - 15v. -14v Expand (-2 - z + 2)(4z*2 + 7z*2 + 4z*2)(2 + 3 + 6). -165z3 Expand (-5h + h + 3h)(227 + 256 - 531)(h + h - h). 48h*2 Expand (19 + 32h - 21 - 2h3 - 36h)(-1 + 3 + 2)(0 - 1 - 1). 16h3 + 32h + 16 Expand -4 + 4 + n + (-4 - 3 + 6)(3n + 0n - n) - 2n + 4n - 4 - 1. n - 5 Expand (-o - 2o + 2o)(-23 - 48 - 223). 294o Expand -2v*5 - 3v*5 + 3v*5 + (4 - 4 - 2v*3)(2v2 + 2v*2 - 3v*2) - 1 + 1 - 2v*5 - 21v*3 - 10v*5 + 6v*5 + 3v*5. -7v*5 - 21v3 Expand -p3 + 69 + 2p3 - 76 + 76 + 13p*3 - 76 + (-2p*2 + 0 + 0)(1 - 1 - p). 16p3 - 7 Expand (-o - 4o + 4o)(6 - 3 - 1 + (4 - 1 - 1)(-1 + 2 - 3) + 4 - 7 + 14)(-3 + 7 - 2)(1 - 3 + 3). -18o Expand (-1 - 2 + 1)(-1 + 0 + 3)(0w - 3w + 2w + (-7w + 7w - 11w)(3 - 10 + 3)). -172w Expand (-5u + 0u + 3u + (8 + 3 - 1)(u + 3u - 2u))(u2 - u2 - 4u*4). -72u*5 Expand (4t - t - 2t)(0 + 0 + t) + 2t2 - 3t*2 + 2t*2 + 168 - 168 + 508t2 + (t2 + t*2 + 0t*2)(-2 + 0 + 1). 508t2 Expand (-131 + 65 + 21w*2 + 65)(2 - 2 + 1). 21w2 - 1 Expand (-2t - 2 + 2)(-1 - 2 + 1)(2 - 17 + 10)(4 - 2 + 0). -40t Expand (-j*2 + 2 - 2)(-j - 4 + 4) + 0j3 - 3j*3 + 4j*3 + (0j*2 + 0j*2 + 2j*2)(-16j + 20j + 9j) - j3 + 2j - 2j. 27j*3 Expand (10x - 1 + 1)(-2x + 5x - 2x + 6x + 0x - 3x + 2x + 2 - 2 + (1 - 2 + 3)(x + x + 0x))(0x + 0x + x3). 100x*5 Expand (3z - 4 + 4 - 2)(-180z*2 + 343z*2 - 189z*2). -78z*3 + 52z*2 Expand (-109 + 47 - 62)(2 - 2 - 2h). 248h Expand (-4b2 + 2b2 + b2)(-2 + 1 - 1)(-3b + 3b - b) + 7b3 - 8b*3 - 3b*3. -6b*3 Expand (2p*3 + 4p - 4p)(2p + 0p - p + (0 - 3 + 2)(2p - 1 + 1) - 24 + 8p + 24) + (0p4 + p4 + 0p4)(7 - 4 - 4). 13p4 Expand (1 - 1 - 2h + (11 - 6 + 5)(2h - 2h + h))(-1 - 3h2 + 1)(3 - 3 - 3h2) + 2h*5 + 6h*5 + 2h*5. 82h*5 Expand (5t2 - t2 - 3t2 + (-t2 + 1 - 1)(-24 - 28 + 35) + (2t + 3t - 3t)(4t - t - 2t))(1 + 1 - 1). 20t*2 Expand (-1769 + 1769 - 170c)(-2c - 3 + 3). 340c2 Expand (v - 18 - 6v + 7v)(-5 - 5 + 5). -10v + 90 Expand (-72 + 519 + 495 + 26)(2k + 3k - 3k). 1936k Expand 8 - 7h2 - 8 + (0 - 4 + 5)(-h*2 + 0h*2 + 2h*2 + (0 + 2h + 0)(5h - h + 5h) - 3h*2 + 4h*2 + 0h*2 - 3h*2 + 0h*2 + 2h*2). 12h*2 Expand (47t*2 - 30 + 7 + 24)(-t2 - t2 - t*2). -141t*4 - 3t*2 Expand (-4b + 3b + 0b)(-187b + 68b + 88b) - 6b2 + 2b2 + b2 + 0b2 + 0b2 - b2. 27b2 Expand 0f*2 - 3f*2 + 5f*2 + (0f - f + 2f)(-f - f + f) + (-4f2 + f2 + 7f*2)(25 + 62 - 55). 129f2 Expand (0 + 1 + 1)(-4g4 + 2g*4 + 0g4) + 0 - g4 + 0 + (0g2 + 3g*2 + 0g*2)(-g - 3g + 3g)(3 - 5 + 3)(0 + g + 0). -8g4 Expand (6 - 6 - 13w2 - w2 + w*2 + 2w*2 + 4w*2 - 6w*2 + 0w*2 + (-2w + w - w)(1 - 1 + 2w))(-1 + 2 - 2). 17w*2 Expand (-3v2 - v2 + 5v2)(-3v + 0v + v) + 6v3 - 3v*3 - 2v*3 - 7v*3 - 4v*3 + 2v*3 + 5v*3 - 4v*3 + 0v*3. -9v3 Expand r3 - 157r5 - 2r*2 - 159r*5 + 309r*5 + (-2r*4 + 0r4 - r4)(-r - r + 5r). -16r5 + r3 - 2r*2 Expand (25r*3 + 20r*3 + 21r*3)(r*2 - 3r2 + r2). -66r5 Expand (m4 - m4 + 2m*4 + (4m2 - m2 - 2m2)(0m2 + 2m2 - m2) + 2m4 + m2 - m2 + 15m*4 - 5m*4 + 2m*4)(9 - 3m - 9). -51m*5 Expand (-4 + 3 + 3)(-2s + 4 - 4) + 0s - 2s - 2s. -8s Expand -2 + 2 - w2 + (3 + w - 3)(w - w + 2w) - 41w*2 - 51w2 - w2. -92w2 Expand (-l4 + 2l - 2l)(4 - 7 - 8) - 634l + 634l + 30l4. 41l*4 Expand (106 - 214 + 218t + 108)(-t - 1 + 1). -218t*2 Expand 0p + 4p - 6p + (8p - 5p - 7p + (-3p + 0p + 2p)(-4 - 3 + 5) + 6p - 3p - 4p)(0 + 4 - 1) - 2 + 2 + p. -10p Expand (-2 - 5 - 1)((-2a + a + 0a)(2 - 2 + 1) - 4 + 4 - a). 16a Expand (-3771s - 61 - 59 + 120)(0s + 0s - s). 3771s*2 Expand (-1 + 1 + 2h)((0 - 3 + 4)(0 + 3 - 2) + (8 - 4 - 5)(2 + 0 + 0))(4 - 4 - 4). 8h Expand (-10 - 14 + 19 - 2r)(19r*3 + 19 - 19). -38r*4 - 95r*3 Expand (-2 + 10 + 17)(4f4 + 5f*4 + 3f*4). 300f*4 Expand 17x*4 - 69x + 69x + (2 - 2 - x)(0x3 + x3 + x3) - 74x*2 + 74x*2 - 17x*4. -2x*4 Expand (1 - 1 - 2m)(704m*3 - 386m*4 - 704m*3). 772m*5 Expand (-4 - 5 + 1)(0k - k + 2k) + (6 + 1 - 3)(-3k + 4k - 2k)(4 - 2 - 1) + 3k - 8 + 8. -9k Expand 4q2 + q2 - 3q2 - 2q*2 + 2q*2 - 4q*2 + (-2q + q + 0q)(-5 + 5 + 4q). -6q*2 Expand 1 - 1 - 3s*5 + (-86s + 203s + 105s - 1)(3s3 + s4 - 3s3). 219s5 - s4 Expand (-4 + 2 - 4)(r - r - r4 + 0r + r*4 + 0r + (-r - r + 4r)(-4r + 4r - r*3) - 107r*2 + 107r*2 - 26r*4). 168r*4 Expand (2u*2 - 4u*2 + 4u*2)(-5u2 + 114u*2 - 3u*2) + (3u - 2 + 2)(0 + 0 - u3). 209u*4 Expand ((0g - 4g + 2g)(-3g + 0g + 5g) - g2 - g2 + 0g2)(-9g3 - 106g*3 - 23g*3). 828g*5 Expand (3 - 4 + 3)(-2 + 6 + 10)(2 + 2j - 2)(-j2 + 0j2 - j2). -112j3 Expand 2h + 3h - 3h - 17h + 15h - 10h + (5 - 5 - 3h)(-1 - 2 + 5) - 2 + 2 - 2h. -18h Expand (3 + 1 + 0)(0 + n**3 + 0 + n	{ "pile_set_name": "DM Mathematics" }
+ 12f2 + vf + 109 - 140f = 0. Calculate f. -2/3, 11 Let q(r) be the first derivative of 3/20r*5 + 0r*4 + 0r + 30 + 3/4r2 - 3/4r*3. Let q(n) = 0. Calculate n. -2, 0, 1 Let b(q) be the second derivative of 27q*4 + 48q*3 + 32q*2 - 2q + 7. What is l in b(l) = 0? -4/9 Let l be 10/45-5(-132)/5. Let o = -29 + l. Determine b, given that 0b - 1/3b2 + o = 0. -1, 1 Let b(z) = z2 - 21z - 18. Let q be b(22). Let g(j) be the second derivative of -2j - 1/6j3 + 1/24j*q + 0 + 0j*2. Suppose g(w) = 0. What is w? 0, 2 Let c(b) be the first derivative of 4b*3/15 - 46b*2/5 - 40b - 553. Find o such that c(o) = 0. -2, 25 Let t(c) be the second derivative of c7/945 - c6/108 + 4c5/135 - c4/27 - 21c*2/2 + 13c. Let a(r) be the first derivative of t(r). Factor a(d). 2d(d - 2)*2(d - 1)/9 Suppose 78y = 574 - 574. Suppose -1/5c*4 - 1/5 + 0c + 2/5c2 + yc*3 = 0. What is c? -1, 1 Suppose -7 = -3r + 5. Solve 10h2 - 9h2 - h5 + h*3 + 11h*r + 0h*3 - 12h4 = 0. -1, 0, 1 Let j(c) = c4 - c*3 + 4c2 + c - 5. Let u = -60 + 55. Let p(z) = -z4 - 3z2 - 2z + 6. Let n(s) = up(s) - 6j(s). Let n(y) = 0. Calculate y. 0, 1, 4 Let a(n) be the first derivative of -n*3/2 + 189n*2/4 + 533. Determine c, given that a(c) = 0. 0, 63 Let i(y) = -10y*3 - 95y + 5. Let m(x) = 3x3 + 47x - 2. Let r(t) = -2i(t) - 5m(t). Factor r(s). 5s(s - 3)(s + 3) Let f = -161 - -147. Let g be (15/f)/(6/(-8)). Factor -8/7 + 16/7s - gs2 + 2/7s*3. 2(s - 2)*2(s - 1)/7 Let v = 1586 + -1586. Let b(d) be the second derivative of -1/130d5 + 1/39d*3 + v + 0d*4 - 3d + 0d2. Factor b(k). -2k(k - 1)(k + 1)/13 Let m(f) = -f3 - f2 + 3. Let n(w) = 2w4 + 4w*3 - 2w*2 - 6. Let b(z) = -2m(z) - n(z). Factor b(t). -2t2(t - 1)(t + 2) Factor 0c + 20/3c3 - 58/3c*2 + 0. 2c*2(10c - 29)/3 Let a = -1001 + 1003. Suppose 2/5 - 1/5v*3 + 3/5v + 0va = 0. What is v? -1, 2 Suppose 0 = -4p - 5u - 9, 5p - 15u + 16u = 15. Let y(c) be the first derivative of -pc2 + 2 + 8c + 2/3c3. Factor y(l). 2(l - 2)*2 Determine c, given that -2/7c*3 - 2/7c*2 + 2/7c*5 + 0c + 2/7c4 + 0 = 0. -1, 0, 1 Let d = -10 - -15. Suppose 0 = -dc + 2x - 4, -6c + 5x - 10 = -3c. Find y, given that 2y - 31 + 27 + cy*2 + 2y*2 = 0. -2, 1 Suppose -5g = -4h - 6, -5g = 4h - 6g - 2. Suppose h = -o - c, 2o - 2c - 10 = -0o. Factor 4f*3 + 2f - 11f2 - fo + 6f. 4f(f - 2)(f - 1) Let l(f) be the third derivative of 2f7/525 + f6/10 - f5/75 - f4/2 - 80f2 + 2. Determine a, given that l(a) = 0. -15, -1, 0, 1 Let k(q) be the third derivative of q8/112 - 9q*7/70 + 3q*6/8 - 7q*5/20 - 69q*2. Factor k(j). 3j*2(j - 7)(j - 1)2 Let b(y) be the first derivative of -y6/9 - 4y*5/5 - 3y*4/2 + 8y*3/9 + 4y*2 - 2. Suppose b(z) = 0. What is z? -3, -2, 0, 1 Let d(k) be the third derivative of 1/15k*5 + 0k*3 + 1/60k*6 + 0k + 4k2 + 0 + 1/12k*4. Factor d(s). 2s(s + 1)2 Let g(n) = -n4 + 6n*3 - 20n*2 + 24n - 5. Let l(d) = 6d4 - 31d*3 + 101d*2 - 122d + 24. Let z(s) = -33g(s) - 6l(s). Factor z(m). -3(m - 1)3(m + 7) Let p(j) = -14j4 - 6j*3 - 14j*2 - 11j. Let m(z) = -5z4 - 2z*3 - 5z*2 - 4z. Let w(s) = -11m(s) + 4p(s). Let w(t) = 0. What is t? -1, 0 Let -75g + 185/2g*2 - 50g*3 + 10g4 + 45/2 = 0. Calculate g. 1, 3/2 Let d(q) be the third derivative of q7/5040 + q6/720 - q4/36 - 6q3 - 16q*2. Let n(u) be the first derivative of d(u). Suppose n(l) = 0. Calculate l. -2, 1 Suppose -108c*2 - 47c*2 - 500c + 33c3 - 45c*2 + 207c*3 + 4c*5 - 56c*4 = 0. What is c? -1, 0, 5 Let w(q) be the first derivative of -15/2q*2 + 17/3q*3 - 14 - 2q. Factor w(p). (p - 1)(17p + 2) Let u = 753/5173 + -2/739. Factor 2/7q3 + uq*2 - 2/7q - 1/7q4 + 0. -q(q - 2)(q - 1)(q + 1)/7 Let l be (-66)/(-15) - 91/65. Let d(n) be the first derivative of 2/3nl + 0n - 6 - 1/2n4 + 0n*2. Factor d(c). -2c*2(c - 1) Let w be (-6080)/880 + (2 - -5). Let y(b) be the first derivative of 0b + wb*2 - 7 + 1/11b*3 + 1/44b*4. Factor y(a). a(a + 1)(a + 2)/11 Let j(y) = 19y*3 + 17y*2 - 43y + 7. Let g(l) = -20l3 + 29l + 7l3 - 26 - 11l*2 + 15 + 6. Let q(s) = -7g(s) - 5j(s). Factor q(h). -4h(h - 1)(h + 3) Let t(d) = d*2 + 2d - 1. Let v be t(-2). Let o(p) = -4p - 2. Let c be o(v). Factor -n3 + n5 + 3 + 1 - 8n*2 + 3n*4 + 0nc + n2. (n - 1)*2(n + 1)(n + 2)2 Suppose 17 = -o + g, 7g = -2o + 2g + 1. Let s = o - -17. Factor sb2 + b + b5 + 6b*4 - 11b*2 + 2b - 4b5. -3b(b - 1)3(b + 1) Let x(z) = 2z + 163. Let b be x(0). Let c = b - 163. Factor -7/4n*4 + 19/4n*3 - 2n*2 + c - n. -n(n - 2)(n - 1)(7n + 2)/4 Let j(g) be the first derivative of g6/450 - g5/50 + g4/15 + 26g3/3 - 11. Let c(k) be the third derivative of j(k). Determine l, given that c(l) = 0. 1, 2 Let d(m) be the second derivative of m7/1470 - m6/420 + m4/84 - m*3/42 + 33m*2/2 + 15m. Let j(h) be the first derivative of d(h). Factor j(w). (w - 1)*3(w + 1)/7 Let r(x) be the third derivative of -x9/3024 + x7/210 - 19x3/6 + 3x2. Let i(a) be the first derivative of r(a). Factor i(l). -l3(l - 2)(l + 2) Let c(q) be the first derivative of 2q5/15 + q4/3 + 2q3/9 - 37. Solve c(r) = 0 for r. -1, 0 Let n(c) be the second derivative of c7/315 - c6/180 - c5/90 + c*4/36 + 29c*2/2 - 3c. Let h(m) be the first derivative of n(m). What is y in h(y) = 0? -1, 0, 1 Let w(i) be the second derivative of 2/33i4 - 4/33i*3 + 0 + 0i*2 - 25i - 1/110i5. Factor w(c). -2c(c - 2)2/11 Let r(n) = n + 1. Let x(d) = -d2 - d - 25. Suppose -4w - 6u + u = 33, -3w = -5u - 19. Let y(l) = wx(l) - 18r(l). Factor y(m). 2(m - 4)*2 Let l = 1832 - 5494/3. Suppose l + 2/3o*4 + 0o*3 - 4/3o*2 + 0o = 0. Calculate o. -1, 1 Let s be ((-1031)/2 - 1)6/3. Let r be -5 - s7/35. Factor -32/5 - ro2 + 686/5o*4 - 64o - 784/5o3. 2(o - 2)(7o + 2)*3/5 Let c be 6 + -10 + (-2)/2-19. Factor 31g - 9g*2 - c - 15 - 82g. -3(g + 5)(3g + 2) Let q(n) be the second derivative of 1/160n*5 + 1/24n*4 + 0n*3 + 0n*2 + 7n + 0. Factor q(r). r*2(r + 4)/8 Let b be ((-3)/6 + 0)(-9 - -3). Let x(l) be the second derivative of l + 1/3l*4 - 2l*2 + 0 + 0l*b. Determine f so that x(f) = 0. -1, 1 Let d(n) be the second derivative of 3/2n*2 + 3/20n*5 - 6n - 1/2n3 - 1/4n*4 + 0. Suppose d(w) = 0. Calculate w. -1, 1 Let u be 395/135 + (-6)/2. Let n = u + 20/27. Factor 1/3i*2 + ni*3 - 2/3i - 1/3i4 + 0. -i(i - 2)(i - 1)(i + 1)/3 Let u(p) be the third derivative of -p*5/300 + 2p*3/15 + 8p*2. Find j, given that u(j) = 0. -2, 2 Factor -20/3k*2 + 0 + 1/3k*4 - 1/3k*3 + 0k. k*2(k - 5)(k + 4)/3 Let g(v) = -8v*2 + 169v - 2498. Let u(i) = 9i2 - 168i + 2493. Let h(k) = -6g(k) - 5u(k). Factor h(r). 3(r - 29)2 Let f(k) be the third derivative of 9k*6/8 + 47k*5/10 + 53k*4/8 + 2k*3 - 67k*2. Factor f(g). 3(g + 1)*2(45g + 4) Let k = -163 - -1469/9. Suppose -17c = -8c - 3c. Let -kf2 + c - 2/3f = 0. What is f? -3, 0 Let y(n) = -n*2 + 2n + 1. Let r be y(-4). Let o = r + 25. Factor 0l3 - 4/5l*o + 0l + 2/5 + 2/5l4. 2(l - 1)*2(l + 1)*2/5 Suppose -1 + 2 = -5o - 2k, 3o + 2k = -3. Let t be (-18)/(-45) + (26/10)/o. Factor -2g*2 + 1/2g*5 + 3g*t - 2g*4 + 0 + 1/2g. g(g - 1)4/2 Let r be ((-2850)/12)/25 - -11. Let -2t - 1/2t4 + t3 + rt*2 - 2 = 0. Calculate t. -1, 2 Let o(w) = -145w + 147. Let s be o(1). Factor -2z3 - 3/2 + 1/2z*4 + sz + z*2. (z - 3)(z - 1)*2(z + 1)/2 Let n(x) be the first derivative of -3x6/35 - 12x*5/35 + 3x*4/14 + 11x + 14. Let p(k) be the first derivative of n(k). Solve p(b) = 0 for b. -3, 0, 1/3 Let n(z) be the second derivative of -29z + 0z*3 + 0z*2 - 5/36z*4 - 7/24z*5 - 5/36z*6 + 0. Factor n(s). -5s*2(s + 1)(5s + 2)/6 Let h(s) = -3s + 51. Let a be h(16). Solve -8r*3 - 4 - 24r*2 - 2r*3 - 18r + 0ra = 0 for r. -1, -2/5 Let y(l) = 2l*5 - 2l3 + l2 - l - 1. Let b(j) = 6j5 - 12j*4 - 24j*3 + 8j*2 + 14j + 4. Let h(q) =	{ "pile_set_name": "DM Mathematics" }
when p(3) is divided by l? 10 Let b be (-24)/(-6) - (-26)/1. Let w = 38 - b. Calculate the remainder when 45 is divided by w. 5 Let q(o) = -3o - 6. Let a be q(-4). Let w(d) = d - 2. Let h be w(a). Suppose b - 22 = hc, -2b - 2c - 6 = -0b. What is the remainder when 6 is divided by b? 0 Let l(a) = -a2 - 16a - 8. Let y = 20 - 36. Let t be l(y). Calculate the remainder when 40/(-16)(t + 2) is divided by 9. 6 Let k(v) = -2v*3 - 19v*2 + 30v - 5. What is the remainder when k(-11) is divided by 9? 1 Let s(k) = -36k + 2310. Calculate the remainder when (-4)/1055/(-1) is divided by s(64). 4 Let o = 1818 - 1781. What is the remainder when 219 is divided by o? 34 Let o(q) = q*3 + 8q*2 + 6q - 3. Let d be o(-5). Let r = d + -24. Let w = r - 9. Calculate the remainder when 25 is divided by w. 7 Let a(u) = 2u2 + 15u. Let c be a(-10). Suppose -o = -1 - c. Suppose 0 = m - 3m - b + o, -b = -m + 24. Calculate the remainder when m is divided by 7. 4 Let m(l) = l + 4. Let g be m(-13). Let y(d) = -d3 - 8d*2 + 6d - 7. What is the remainder when y(g) is divided by 11? 9 Suppose 4n - 80 = k - 3k, -5n - 5k + 105 = 0. Suppose c - 2v = -v - 42, -5c = 2v + 217. Let s = c - -53. What is the remainder when n is divided by s? 9 Let g be ((-78)/(-12))/(1/2). Let y = -13 + g. Suppose -z - 2z + 48 = y. What is the remainder when 77 is divided by z? 13 Let b(q) = 9q - 24. Let o(l) = 9l - 1. Let a be 14/42 + (-2)/(-3). Calculate the remainder when b(6) is divided by o(a). 6 Suppose -79 - 17 = -8f. Suppose 3w - 80 = -2p, 5p = 3w + 222 - 64. Calculate the remainder when p is divided by f. 10 Let c be 131 + 5/(-3 - 2). Let q = c + -92. Calculate the remainder when q is divided by 11. 5 Let v(i) = 6i. Let g(h) = -h*2 + h - 1. Let o be g(0). Let y be v(o). What is the remainder when 65 is divided by (y/(-3) - 36)/(-2)? 14 Let o be (-55)/2(5 + -7). Suppose 0 = q - o - 14. Calculate the remainder when q is divided by 14. 13 Let v = 244 + -207. Calculate the remainder when 132 is divided by v. 21 Let m(f) = f + 13. Let y be m(-11). Suppose yo - 7 - 7 = 0. Let i = -182 - -184. Calculate the remainder when o is divided by i. 1 Let f = 41 - 93. Let b be 3/3 + 0 - f. Let g = 100 - b. What is the remainder when g is divided by 16? 15 Suppose 2p = 4d + 14 + 4, -4p - d + 36 = 0. Suppose 8k - 18 = pk. What is the remainder when k(4 + (-14)/3) is divided by 4? 0 What is the remainder when 52 is divided by 6/(-57) + 2321/209? 8 Let s(t) = -6t + 1. Calculate the remainder when 188 is divided by s(-4). 13 Let l = 183 + -143. What is the remainder when 238 is divided by l? 38 Suppose 2l + 0 = 8. Suppose -5q + lq + 24 = 0. What is the remainder when 138((-7)/(126/(-96)) - 5) is divided by q? 22 Suppose 109c - 83 = 26c. What is the remainder when 1 is divided by c? 0 Suppose 1599 = 56z - 15z. Suppose 19 = 3i - 4p, 2i + 4p - 17 = i. What is the remainder when z is divided by i? 3 Calculate the remainder when 942-98/(-108) is divided by 105. 103 Suppose 0 = -5r + 3m + 163, 4r + 2m = -2m + 156. Suppose -b + r = 5z, -b + 6z - 1 = 2z. Let c = -4 + 61. What is the remainder when c is divided by b? 12 Let b = -959 - -1201. What is the remainder when b is divided by 74? 20 Suppose -6q + 365 = -223. What is the remainder when q is divided by 11? 10 Let b = 1811 + -1785. What is the remainder when 544 is divided by b? 24 Suppose 10t + 78 = 4t. Let q = 4 - 6. What is the remainder when 51 is divided by (-236)/t + q/13? 15 Suppose 6r + 20 = 98. Let y(i) = 3i - 32. Let q be y(r). Suppose 8s - 20 = qs. Calculate the remainder when 59 is divided by s. 19 Suppose -3w + 54 = w - 2s, 0 = 4s + 4. Let b(k) = k*3 - 13k*2 + 3k - 10. Calculate the remainder when 84 is divided by b(w). 26 Calculate the remainder when 4956/(-8)20/(-35) is divided by 21. 18 Let t(j) = j2 + 5j + 54j3 - 4 + 6j - 7j. Calculate the remainder when t(1) is divided by 8. 7 Suppose -2l = 3u - 25, 0 = -3l + 3u + 13 + 17. Let g(v) = -35v + 30. Calculate the remainder when g(0) is divided by l. 8 Suppose 0 = 4j - 4, -j - 80 = -2y - 3j. Let d = -6 - -27. What is the remainder when y is divided by d? 18 Let c(t) = 5t*2 + 2t. Let v(q) = q. Let j(u) = 2c(u) - 4v(u). What is the remainder when 59 is divided by j(-1)? 9 Let z(n) = -2n2 + 6n + 41. Calculate the remainder when (1 - 7)/(4/(-50)) is divided by z(0). 34 Suppose 4s - 4l = 71 + 37, 2l = -3s + 71. Suppose 8q - s = 63. Calculate the remainder when 21 is divided by q. 10 Suppose 1 = -4p + 13. Suppose 0 = -5b + pb - 48. Let f = b - -34. Calculate the remainder when 19 is divided by f. 9 Let c be (-2)/(-3)(-75)/10. Let y be 10 + -1 + 10/c. Let u(z) = 2z - 8. What is the remainder when 10 is divided by u(y)? 4 Let k = -27 + 91. Let d = k + -41. Calculate the remainder when 68 is divided by d. 22 Let d = 10 + -10. Let n be (2/(-1))/(-1 - d). Let f(c) = 4c2 - c - 2. Calculate the remainder when 33 is divided by f(n). 9 Suppose -g + 180 = -3g. What is the remainder when 20/g + (-922)/(-18) is divided by (13)/(704/(-104) + 7)? 12 Let m = 24 + -10. Suppose 35 + 85 = 3h. Calculate the remainder when h is divided by m. 12 Let y = -176 - -177. What is the remainder when 1 is divided by y? 0 Suppose 3l = 2l. Suppose x + x - 3r - 47 = 0, l = 4r + 20. Suppose 0 = xd - 11d - 255. Calculate the remainder when d is divided by 13. 12 Let a = -19 - -32. Let t = 580 - 220. Suppose 0 = -42m + 32m + t. Calculate the remainder when m is divided by a. 10 Let c be (-342)/(-30) - 3(-2)/(-15). Suppose 3z = 28 + c. Suppose 0q - 8 = -2q. What is the remainder when z is divided by q? 1 Let m(d) = -2d - 6. Let c be m(0). What is the remainder when 48 is divided by 2 - (2 + -1) - c? 6 Suppose -5o = -2z + 19, -5o + 29 + 0 = 2z. Calculate the remainder when 43 is divided by z. 7 Let t(f) = 15f*2 + 44f + 109. What is the remainder when 1005 is divided by t(-3)? 109 Let n = -45 + 15. What is the remainder when 21 is divided by (-4)/5n/4? 3 Suppose 748 = 5f + 538. Calculate the remainder when 67 is divided by f. 25 Suppose 3b - 30 = -3z - 0b, z = 3b + 26. Let f = -29 + 17. What is the remainder when 0 - 7/(z/f) is divided by 4? 2 Let z(d) = d*3 + 5d*2 - 5d - 2. Let y be z(-5). Let r = 334 + -305. Suppose 2w = r + y. What is the remainder when 50 is divided by w? 24 Suppose -12g = -13g + 37. Suppose 4j - 601 = -5v, 2v = 5j + v - 715. What is the remainder when j is divided by g? 33 Let b = -403 - -466. What is the remainder when 376 is divided by b? 61 Let s(x) = -6x + 1. Calculate the remainder when 103 is divided by s(-6). 29 Let u(n) = -n*2 - 19n - 81. What is the remainder when 43 is divided by u(-9)? 7 Suppose 4o - 20 = -u + 233, 3o + 5u - 211 = 0. What is the remainder when o is divided by 23? 16 Suppose 0 = 5o + r - 98 - 5, -5r = -4o + 65. Let p = o + 5. What is the remainder when 99 is divided by p? 24 Suppose -4p = 3m + 36, -5p + 4m + 10 = -4p. Let g(o) = -2o + 5. Let h(s) = 1. Let i(z) = g(z) - h(z). Calculate the remainder when 29 is divided by i(p). 13 Let d be -5 - (0 - -2)-1 - -1011. Suppose 12x = -6x + d. What is the remainder when x is divided by 29? 27 Suppose -11c = 246 - 1951. Calculate the remainder when c is divided by 16. 11 Let t = -98 + 125. What is the remainder when t is divided by 3/((-3)/4) - -9? 2 Suppose -4f - 28 = 116. Let c = 67 + f. Calculate the remainder when c is divided by 16. 15 Let q be (13 + -1)(-4)/6. Let y = 18 + q. What is the remainder when 17 is divided by y? 7 Let c be 10/(-20) + (-10)/(-4). Let o be (-3)/c(-10)/3. Suppose og = -i + 34, -5i + 116 = -2g + 27. What is the remainder when 54 is divided by i? 16 Let v(a) = 32a + 76. Calculate the remainder when v(4) is divided by 69. 66 Let g(y) be the first derivative of 2y3/3 - y2 - 15y + 20. Calculate the remainder when g(4) is divided by 3. 0 Let r(l) = 4l*3 - 28l*2 + 3l + 7. Let f = -3 - -6. Suppose fz + z - 44 = 0. What is the remainder when r(7) is divided by z? 6 Let d(m) = m2 - 2m - 3. Let t be d(-2). Suppose -3u + 283 = -0u - 2p, -tu + 5p + 470 = 0. What is the remainder when u is divided by 32? 31 Let x(y) = -2y - 2. Let n	{ "pile_set_name": "DM Mathematics" }
12, -2/11, 1, 5, 33? 33 What is the biggest value in -1.19, -0.3, 1/3? 1/3 Which is the second biggest value? (a) 2/5 (b) 1 (c) -3/5 (d) 12 (e) -27 b Which is the second smallest value? (a) -3 (b) 0.2 (c) 1046 b Which is the second smallest value? (a) 184 (b) 1/3 (c) -0.3 b Which is the third smallest value? (a) 0.2 (b) 4 (c) -25 b What is the biggest value in 1, 2, -2/27? 2 What is the second smallest value in -2/13, -49, 4, -3? -3 Which is the second smallest value? (a) -0.08 (b) 2/11 (c) 3.1 b Which is the fourth smallest value? (a) 2 (b) -246 (c) 3/2 (d) -0.3 (e) -2/17 c What is the biggest value in -2, -0.02, 3, 0? 3 Which is the fifth smallest value? (a) -0.4 (b) -1/6 (c) 7 (d) 0.6 (e) -5 c What is the second biggest value in 1, -4/9, -10, 0.2? 0.2 Which is the biggest value? (a) -2.2 (b) 5 (c) 2 (d) -0.1 (e) -1/2 b What is the third smallest value in -6.4, -0.3, -0.5, -0.2? -0.3 What is the second biggest value in -1/2, 1/2, 455? 1/2 Which is the smallest value? (a) -4 (b) -1/6 (c) 1526 a Which is the fourth biggest value? (a) -5 (b) -8 (c) 4 (d) 0 b What is the biggest value in 2/7, 1/1754, 1/7? 2/7 What is the third biggest value in -0.5, -5, -75/7? -75/7 Which is the biggest value? (a) 3/5 (b) 3.3 (c) 0.5 b What is the third smallest value in 1.5, 3, -1, 0.3? 1.5 Which is the third biggest value? (a) -84 (b) -2/13 (c) 4 (d) 2 b Which is the third biggest value? (a) -0.5 (b) 31 (c) 16 (d) 0 d Which is the fourth biggest value? (a) 50/7 (b) -0.5 (c) -4 (d) 1/5 (e) 0 b Which is the second smallest value? (a) -7 (b) -5 (c) -3 (d) 0.02 (e) 1 b What is the third biggest value in -4, -0.4, -2, -0.5, -63/17? -2 What is the biggest value in -4, 2.4, 2/9, 17? 17 What is the fourth biggest value in 5, 3, 0.2, 2/11? 2/11 What is the second biggest value in 5, -2, -0.5, -1? -0.5 Which is the second smallest value? (a) 0.4 (b) 0.08 (c) 0 (d) 2/21 (e) 0.3 b Which is the smallest value? (a) -12 (b) 4 (c) -1/2 (d) 1 a What is the third biggest value in 0.1, -0.3, 2? -0.3 Which is the third biggest value? (a) -94 (b) 2 (c) -32 a Which is the biggest value? (a) -4/11 (b) -4 (c) 4 c What is the biggest value in -566, 0.4, 2/11? 0.4 What is the second biggest value in -3, -0.146, 2? -0.146 Which is the second smallest value? (a) -167 (b) 7/5 (c) 4 (d) 1 d What is the fifth smallest value in 5, 1/17, -1/8, -0.2, -2/13? 5 Which is the fifth smallest value? (a) 7 (b) -1 (c) 3 (d) 2/9 (e) -3 a What is the second biggest value in -1/5, 2/3, -480? -1/5 What is the fifth biggest value in -4, 5/6, -3, 14, 2? -4 Which is the third biggest value? (a) -1 (b) 1/4 (c) -2262 c What is the second biggest value in 22/7, -0.3, -2, 0.2? 0.2 Which is the fourth biggest value? (a) 0 (b) 4 (c) -0.4 (d) -8 d What is the smallest value in 4/3, -2, -3/7, -5? -5 What is the fourth smallest value in -0.02, 4, -2, -1/6? 4 Which is the fourth biggest value? (a) 18 (b) -2/47 (c) -2/5 (d) -2/15 c What is the second biggest value in -0.01, 2/11, -0.1? -0.01 Which is the third biggest value? (a) 1 (b) 0 (c) 4 (d) -0.01269 b Which is the second smallest value? (a) -2 (b) -3951 (c) 3 a What is the second biggest value in -6/11, -35/187, -0.4, 0.3? -35/187 Which is the third biggest value? (a) -3 (b) 2/5 (c) -0.04 a What is the third biggest value in 0.1, 0.6, -0.4, -1? -0.4 What is the third smallest value in -0.1, 11, 5, 4? 5 Which is the second smallest value? (a) 2.7 (b) 2 (c) -10 b Which is the third smallest value? (a) 17 (b) 3 (c) 0.3 a What is the second biggest value in -3, -1/4, 0.1, -0.1? -0.1 Which is the smallest value? (a) 43/2 (b) -3 (c) 0 b What is the fifth smallest value in 2/29, -2/7, 2/7, -1/3, 0.2? 2/7 What is the biggest value in -3, -0.3, 2/9, 1/4, 5? 5 Which is the third smallest value? (a) 0.2 (b) -2/9 (c) 1573 c Which is the third smallest value? (a) -546 (b) -3/10 (c) 1 c Which is the smallest value? (a) 15 (b) 1 (c) -9 (d) 5 c What is the third smallest value in -2/9, -0.5, 1/5? 1/5 What is the biggest value in 5, -5, -3/7, 331? 331 What is the second biggest value in 0.028, -0.16, -4? -0.16 What is the third biggest value in 6, -9, -0.04, -0.3? -0.3 What is the third biggest value in -4, 9, -0.3, 2/17? -0.3 Which is the fourth biggest value? (a) 2/17 (b) -54 (c) 3 (d) -5 (e) 0 d Which is the third smallest value? (a) 29 (b) 2 (c) -0.3 (d) 3/4 b Which is the third smallest value? (a) 1 (b) 10.9 (c) -1/3 b Which is the biggest value? (a) 110 (b) -2/13 (c) 46 a What is the third biggest value in -0.1, 5, 2/75? -0.1 Which is the fourth biggest value? (a) 1 (b) -24 (c) -2 (d) -0.01 b What is the third biggest value in -0.1, 5, -134? -134 What is the smallest value in 3/5, 0.4, -0.8? -0.8 Which is the second smallest value? (a) -5 (b) -1 (c) -150 (d) -1/8 a What is the third biggest value in 3, -4, 2, 3/5, 1/3? 3/5 What is the second smallest value in 0.05, 0.264, -0.4? 0.05 Which is the second biggest value? (a) -2/19 (b) 1/10 (c) -36 a What is the fourth biggest value in 2/35, 5, 0.4, 29, -1? 2/35 Which is the biggest value? (a) 2/397 (b) -0.2 (c) 2/5 (d) -1 (e) -2/11 c What is the third smallest value in 0, 1/4, 0.342? 0.342 What is the fifth biggest value in 2/9, -2/3, -1/5, 2.9, 3/2? -2/3 Which is the second biggest value? (a) 3/4 (b) -4 (c) 721 (d) -1/2 a Which is the second smallest value? (a) 1 (b) -0.5 (c) 2/5 (d) -2 (e) -0.1 b What is the third biggest value in 1/11, 4/7, 0? 0 What is the second smallest value in 2/11, -0.2, -0.19, 2/5, 2/7? -0.19 Which is the third biggest value? (a) 1/3 (b) -5 (c) 0.02 (d) 0.03 c Which is the biggest value? (a) 6/679 (b) -0.4 (c) 0.1 c Which is the third smallest value? (a) -4 (b) 1 (c) 1/24 (d) 0.5 (e) -5/3 c What is the biggest value in 474, 0, 2/13? 474 Which is the smallest value? (a) 0.5 (b) 2 (c) -46 c Which is the fourth smallest value? (a) 5 (b) 0.2 (c) -17 (d) -1/3 a Which is the third smallest value? (a) -5 (b) 1/4 (c) 403 c Which is the smallest value? (a) 9 (b) -5/3 (c) -4 (d) -0.06 c What is the smallest value in 4, 0.5, -174, 0? -174 Which is the second smallest value? (a) -0.4 (b) -1503 (c) 4/7 (d) 0.3 a What is the fourth biggest value in -2/9, 3, 18, -4? -4 Which is the second biggest value? (a) 0.1 (b) 6.3 (c) -3 a Which is the second smallest value? (a) 72 (b) 4 (c) -0.3 b What is the smallest value in -37, 1/2, 4, -3? -37 Which is the third biggest value? (a) 0 (b) 1/7 (c) -2 (d) -3 (e) 0.4 a Which is the third biggest value? (a) 1/6 (b) 0.04 (c) -2 (d) -0.23 d What is the second smallest value in -0.5, -3/2, 3, -44? -3/2 Which is the third biggest value? (a) -0.13 (b) 5 (c) 2 (d) -37 (e) 0.5 e What is the fourth biggest value in 4, 306, 3, 1? 1 What is the third biggest value in -1, 5/2, 16? -1 Which is the second smallest value? (a) 5 (b) -17000 (c) 1 c Which is the second smallest value? (a) 5 (b) 0.48 (c) 1/5 (d) 2 b Which is the smallest value? (a) 5 (b) 3 (c) 3/5 (d) -1/6 d What is the third biggest value in -1/7, -23, -3/2, -4? -4 Which is the second smallest value? (a) -1/2 (b) 2302 (c) 4 c What is the biggest value in 2/7, -3, -1? 2/7 What is the third biggest value in 294, 2/7, 1, 0.3? 0.3 What is the third smallest value in 7, 0.1, -2, 5? 5 What is the fourth smallest value in -3/7, -3/4, -4, -3, -5? -3/4 What is the third smallest value in -1, 1, -8.2? 1 Which is the biggest value? (a) -3/10 (b) -2/79 (c) 4 c Which is the third biggest value? (a) 0.4 (b) -4/149 (c) -0.5 (d) -0.3 d What is the biggest value in -2/3, 364, 2/9, 1/5? 364 Which is the third smallest value? (a) 1/3 (b) -282 (c) -2/3 a What is the second smallest value in 1/3, 0, 0.8? 1/3 Which is the smallest value? (a) -61/5 (b) -1/9 (c) 2/11 a Which is the third smallest value? (a) -2/37 (b) -4 (c) 4/9 c Which is the second smallest value? (a) -3 (b) 3 (c) -2/5 (d) 48 (e) -0.5 e What is the smallest value in 121, 46, -0.2? -0.2 Which is the third biggest value? (a) -5 (b) 1 (c) 0.1 (d) -0.25 d Which is the third smallest value? (a) 2/11 (b) -1/2 (c) -81.5 (d) -0.3 (e)	{ "pile_set_name": "DM Mathematics" }
3, 5? 2/9 Let q = -19 - -22. Which is the biggest value? (a) -2/5 (b) q (c) 0 (d) -4 b Let x be -1 + (33/10 - 3). Let v = x + 19/20. What is the third biggest value in v, -5, -4? -5 Let c = -0.24 + 0.44. What is the smallest value in -0.3, c, -5? -5 Let d = 30449/75 + -406. Let l = d - -377/150. Which is the smallest value? (a) 1/7 (b) -1/3 (c) l b Suppose -143 = 4u + k - 2k, 0 = 5k + 5. Let l be u/(-40) - 2/5. Which is the third biggest value? (a) 4 (b) l (c) 2 b Let z = 25/36 - 4/9. What is the third biggest value in -5/4, z, 0.3, -0.01? -0.01 Let h(m) be the first derivative of m2/2 + 5m + 3. Let a be h(-7). What is the third biggest value in -5, a, 3/4? -5 Let o = -8 - -5. What is the second smallest value in -3/2, 0.1, o? -3/2 Let m = 97/126 - -4/63. Which is the second biggest value? (a) m (b) 2 (c) 2/9 (d) 1/6 a Suppose 3x + x - 22 = -2u, -5x + 3u + 11 = 0. What is the second smallest value in x, -0.1, 3? 3 Suppose -1 + 7 = z. Suppose 0 = 5k + z - 16. Which is the smallest value? (a) 4/5 (b) k (c) 0.1 c Let g be (-15)/(-50)(-2)/(-6). Let h = g + 3/20. Which is the second biggest value? (a) -5 (b) 0.3 (c) h c Let v = 10 - 9.9. Let m = 4.1 - v. Which is the second smallest value? (a) 8 (b) 5 (c) m b Let b = 0.37 - 0.67. What is the third biggest value in b, -2, 1/3? -2 Let n = 0.1 + -0.6. Suppose -2 = -r + 2. Let f = -29 + 119/4. Which is the second smallest value? (a) n (b) f (c) r b Suppose -2x + 3 = -3. Let g = -5.1 + 5.3. What is the second biggest value in 4, x, g? x Let o = 7 - 10. Let c be 12/(-4) + 10 - 3. What is the second smallest value in o, c, -1? -1 Let w = -12 - -7. Let t = 5.4 + w. What is the smallest value in 0.3, -4, t? -4 Let k = 99/4 + -685/28. Which is the second smallest value? (a) 0.4 (b) k (c) 4/9 a Suppose -2p = 5r - 31, -3p - 4r + 32 = p. Let a be 1p2/12. What is the second smallest value in -0.5, a, -1? -0.5 Let f = -0.059 - -4.059. Suppose 0m - 5m = -3d + 3, 17 = -3m - 2d. What is the second biggest value in 2, m, f? 2 Let m be (3 - 5917)(-1)/22. Let k = m + -269. Let z = 200/11 + -18. What is the second biggest value in z, -2/3, k? k Let o = 4/49 + 29/245. Let f = 15 - 10. What is the third smallest value in 6, f, o? 6 Let y = -86.9 + 87. Which is the fourth biggest value? (a) 0.05 (b) 2/17 (c) y (d) -3 d Let m = 5551/12 - 463. Let w = m + -1/12. Which is the second smallest value? (a) -1/5 (b) w (c) 2 a Let p = -65 + 63. Which is the fourth biggest value? (a) 0 (b) 2 (c) -4 (d) p c Let o be ((-2)/3)/(6/3). Which is the biggest value? (a) 3 (b) 5 (c) o b Let a = -147/5 + 30. Let w = 5.031 - 0.031. What is the second smallest value in -3, a, w? a Let s be 2(32/28 - 1). Let m = -1 + 0. What is the smallest value in -2, m, s? -2 Let p = -4/107 - 170/1177. Which is the third biggest value? (a) 3/4 (b) p (c) 0.4 b Let m = -6.7 - -1.8. Let p = 0.1 - m. Let f = 1 - p. Which is the biggest value? (a) f (b) -3/5 (c) -5 b Let w be (-2)/((-1 - -6)1). Let m(i) = -i3 + 2i*2 + 4. Let y be m(3). Which is the third biggest value? (a) y (b) w (c) 1 a Let f = 0.6 - -2.4. Which is the smallest value? (a) 0.1 (b) -1/6 (c) f b Let v = 101 + -100.1. Which is the third biggest value? (a) v (b) -1 (c) 3 b Let w(v) be the second derivative of 3v5/20 + v3/3 - v*2/2 + 4v. Let l be w(1). Which is the smallest value? (a) 3 (b) -1/5 (c) l b Let y = 14 - 9. Let q = -5.4 + 5. Let x = -0.02 - 0.48. Which is the third biggest value? (a) q (b) y (c) x c Let z = 6.6 - -0.4. Let k = 6.17 + -0.17. Let q = z - k. Which is the third biggest value? (a) -1/2 (b) -0.3 (c) q a Let k = -10094041/16318 - -25423/41. Let n = 2/199 + k. Let f be 10/16 - (-1)/(-4). Which is the second smallest value? (a) f (b) n (c) 1 c Let k = 38/5 + -109/15. Which is the third smallest value? (a) k (b) 0.3 (c) 0.5 c Let d be -2 - (-5 - 3) - 4. Which is the biggest value? (a) 1/2 (b) d (c) 2/5 b Let z = 5.23 - 5. Let l = z + 0.67. Let q = 1.2 - l. What is the second biggest value in -5, q, -2/9? -2/9 Let t = -3.37 - -0.37. What is the biggest value in t, -0.4, 0.5? 0.5 Let p = 8.22 - 8. Let l = p + 0.08. Let k be 2 - (2 + 4/6). What is the second biggest value in l, 0.1, k? 0.1 Let u(w) = -w*2 + 5. Let z be u(0). Let x be z/12 + 2/(-3). Let p = 115 + -350/3. Which is the second smallest value? (a) p (b) x (c) 0.4 b Let i = -3.04 + 0.04. Let o = 0.97 - -0.13. Let s = 0.1 - o. Which is the third biggest value? (a) s (b) -2/7 (c) i c Let t = -0.48 + 0.18. Which is the second smallest value? (a) 2/5 (b) t (c) 4/7 (d) -0.5 b Let y = -5 + -6. Let i = y + 16. Which is the second biggest value? (a) i (b) 2/3 (c) -4 b Suppose 5f = 3w - 46, -3w - 12 = 2f - 2. Let a = -11 - f. Let p = 2 + -1.7. What is the second biggest value in p, 0.5, a? p Let y = -2.5 - -2.9. Let u = -0.1 - -3.1. Which is the biggest value? (a) -2/11 (b) u (c) y b Let h(b) = b2 - b - 2. Let d be h(-2). Suppose -o - o = -d. Let u be -2(42/20 - o). What is the biggest value in 3, 1/4, u? 3 Let u = -6 + 5.8. Let f = -1 - -0.9. Let s be 0 - (3/2 + 0). Which is the second biggest value? (a) s (b) u (c) f b Let z = -1.6 + 1. What is the third biggest value in -4, 0.6, z? -4 Let g be (6/(-8))/(((-135)/24)/(-5)). Which is the third smallest value? (a) 0 (b) 0.1 (c) 4 (d) g b Let r = 3/61 - -223/427. Which is the second smallest value? (a) r (b) -0.1 (c) 6 (d) 3 a Let k = -0.74 - -0.18. Let u = k + 0.06. What is the third smallest value in 2/9, u, 0.4? 0.4 Let f = -0.03 + 2.03. Let m = f - 1.98. Let t = -1.98 - m. What is the biggest value in 2, t, 3? 3 Let z = -27 - -25. Let m = 2.6 - 3. Which is the biggest value? (a) m (b) 1/5 (c) z b Let i be (-1)/(-3)(1 - 0). Let h = -13 - -17. Let d = 4.3 - h. What is the smallest value in i, d, 0? 0 Let t = -18 - -12. Suppose 0 = 3z - 0z - 15. Which is the smallest value? (a) z (b) -2 (c) t c Let h = 3.68 - 0.68. Let g = -5.3 + 5. What is the third biggest value in 0.5, h, g? g Suppose 6s - 24 = 4s. Let n be 0-2(-3)/s. Let r be 2 + n/1 - 1. What is the third smallest value in 3, r, -1/3? 3 Let i = 32 + -25. What is the third biggest value in -0.2, i, 0? -0.2 Let h = 0.33 - -3.67. Which is the second smallest value? (a) -0.5 (b) h (c) -1/4 (d) 1/7 c Let q = -18 + 10. Let v = 14 + q. Which is the second biggest value? (a) v (b) 5 (c) 0.5 b Let l = -16 + 31/2. Let t = 4 - 3. Let v = t + -1.2. Which is the biggest value? (a) v (b) -2/11 (c) l b Let n = 3.3 + -0.3. Let j = -1.1 - -0.1. Which is the third smallest value? (a) j (b) -4 (c) n c Let h = 0 + 2. Let z(s) = s2 - 6s + 4. Let y be z(6). Let f = 3 - y. What is the smallest value in h, 0.3, f? f Let y = -0.064 - 4.956. Let w = 0.02 + y. Which is the smallest value? (a) w (b) 0 (c) 0.2 a Suppose c - 10 = -c. Suppose cj + 28 = j. What is the biggest value in 1/3, j, 1/7? 1/3 Suppose 4u = 8u - 3g + 13, u + 5g - 14 = 0. Let b(z) = z + 9. Let d be b(-4). What is the second smallest value in 0.04, d, u? 0.04 Let b = 9.8 - 10. What is the second smallest value in 11, -3/4, b? b Let v = -14.9 + 15. Let f = v - -0.4. Which is the third smallest value? (a) -0.2 (b) f (c) -5 b Let f = -5.5 + 2.5. What is the third smallest value in f, -27, -3/7? -3/7 Let w = 0.3 - 3.3. Which is the third smallest value? (a) -5 (b) 6/7 (c) w b Let y = 8 - 13. Let j = 8 + y. Which is the smallest value? (a) -3 (b) -0.3 (c) j a Let y = -1.94 - -1.44. Which is the second smallest value? (a) y (b) 4 (c) -2/5 c Let v = 9.5 + -10. Which is the second biggest value? (a) -10 (b) 3 (c) v c Let w = 0.2 + 0.8. Let n = 0 + 0.2. Let z = -97 - -101. What is the third biggest value in n, z, w? n Suppose 0 = -6f + 2f - 32. Let o be ((-6)/9)/(f/6). What is the third biggest value in 5, 3, o? o Let n = -1137042 - -303590576/267. Let c = n + -2/89. What is the second smallest value in 0.4, -8, c? 0.4 Let i be (32/(-40))/(9/(-5)). What is the smallest value in -3, i, 0? -3 Let p = -20 + 81/4. Let f = -2.02 - -0.02. Let d = -3 + 2.9. Which is the smallest value? (a) d (b) p (c) f c Suppose s - 67 = -m, -3s + 207 = 4m + 11. Let h be (-6)/s(-3)/2. What is the third smallest	{ "pile_set_name": "DM Mathematics" }
cc(-2/19)c11 assuming c is positive. c(-4039/285) Simplify ((d/(dd(-15))dd(dd(-9)d)/d)(-12/17))(2/85) assuming d is positive. d(-216/1445) Simplify (l(1/3)l/l(-1/24))/(l/(ll(-2/5)/l))(3/2) assuming l is positive. l*(-29/40) Simplify (iii/(ii*(21/2)i)ii/(((i*17/i)/i)/i)i)/(i4/(i/i(-13))) assuming i is positive. i*(-21/2) Simplify (ddd/(d/(d/d(2/7))dd))(-3/11)d*(1/3)dd/(d1/d) assuming d is positive. d(494/231) Simplify ((ss(((sss(2/5)/s)/ss)/s)/s)*37((ss0s)/s)(-1/52))(-9) assuming s is positive. s(-121167/260) Simplify y(2/25)/(y*5/y)((yy/y13)/y)/yy(7/2) assuming y is positive. y(-671/50) Simplify (y/(y/y9))(-14)/(y(-5/2))(-8/3) assuming y is positive. y(-398/3) Simplify (j(-21)/(j/(j27/j)))/((j(1/2)j)/((j/j(-21))/j)) assuming j is positive. j(47/2) Simplify (k/(kk(-2/5)))(-24)/(k*(2/3)k/k*(-2/5)kkk) assuming k is positive. k(-44/3) Simplify ((l(-29/5))23)(-8) assuming l is positive. l(5336/5) Simplify (u(1/6)/((u/(uu/(uu*(-2/7)u)u))/u))/((u14/u)/u(-1/3)) assuming u is positive. u(-499/42) Simplify (o(ooo/(o*2/oo))/o)*(-43)/((ooo(1/7)/o)/(o/(oooo*(15/4)o))) assuming o is positive. o(-1425/28) Simplify (w/(w/((w/(w/w(2/7)))/w))w(w/(w/(w/((w/(w/(w/(www/w*(-6)))))/w))w))/w)(-2/55) assuming w is positive. w(-116/385) Simplify (i(-12))(-3)i(-17)i*(5/4)ii assuming i is positive. i(89/4) Simplify (((d/((d/d1)/d))/d)/d8)/(d0)(-38/3) assuming d is positive. d(-7) Simplify (((g(-5)g)/g)/g)/g*(2/9)(g(1/4))(-1/23) assuming g is positive. g*(-5161/828) Simplify (i/(ii(ii*(-8/11))/i)i(2/43))/((i/i(1/8))/((((i*20/i)/i)/ii)/i)) assuming i is positive. i(60161/3784) Simplify (c(2/21)c(1/26))/(c(-10/7)/(c(-30)/c)) assuming c is positive. c(-16073/546) Simplify (j(-2/51)/jj/(j(j(-1/7)/j)/j))/(j(-2/5)/jj/(j/(jj/(j(1/9)/j)))) assuming j is positive. j(-2063/5355) Simplify (((hh/h*(-19))/h)/hh/((hh/(hhh(-2/5)))/h))/((h(-1/12)/h)/(hh(-23))) assuming h is positive. h(-19/60) Simplify ((kk(-29)kk)/k)/(k/(k/(k/k(-11))))(kk(-29))/(k/(k/(kkkk*(-3/10)k))) assuming k is positive. k*(-707/10) Simplify ((h(hh(7/6))/h)/(h/h(8/7)))/(h/(hh*9hh)h3) assuming h is positive. h(433/42) Simplify j/j*11jj(-3/8)(j/(j*(1/6)/j)j)1 assuming j is positive. j(-157/24) Simplify (((q(q(-2/13)qq)/qq)/qq5q)(4/7))(3/14) assuming q is positive. q(612/637) Simplify t/t(1/3)t(ttt*(-8/9)t)/t(t(-12))41 assuming t is positive. t(-4403/9) Simplify (f/f(-4/35))/((f/(f/(f(3/7)f)))/f)f(-21)f(-1/46) assuming f is positive. f(-32741/1610) Simplify (((tt/(t(tt(2/19))/tttt))/t*(-12))/(tt/t(-1/2))22)(-1/4) assuming t is positive. t(857/76) Simplify a*(-3/17)a*(-2/37)/a(a*(8/7)a)/a(3/2) assuming a is positive. a(-5175/8806) Simplify d*(1/5)/((dd*(-5/4))/dd)(d/d(-2))(2/23) assuming d is positive. d(327/460) Simplify z3/z(-11)(z(1/3))(-3/4) assuming z is positive. z(55/4) Simplify (i(-9)/i(2/25))/(i2/i(-2)) assuming i is positive. i(-327/25) Simplify ((v/(v*(-1)v))*(23/3)(((v(2/15)/v)/v)/v)/(v(-4)/v))(-27) assuming v is positive. v(-1323/5) Simplify (uu/(((u10u)/u)/uu)u4)/(u3)0 assuming u is positive. u(-4) Simplify (t12/(t10t))/(t(-1/8))29 assuming t is positive. t(37/8) Simplify ((r/r29)/r(-3/14))(-34) assuming r is positive. r(6613/7) Simplify ((m(-14)m)42)(-2/3) assuming m is positive. m*364 Simplify (((qq/q1)(-1/74))(-2/3))38 assuming q is positive. q(38/111) Simplify ((k0)*31kk3(k/(k/((k*(1/5)/kk)/k)))/k)(-1) assuming k is positive. k(-11/5) Simplify ((gg/((g/g1)/g))/gg*7g)/((((((((g*18/g)/g)/g)/g)/gg)/g)/ggg)/(g/(g/g13))) assuming g is positive. g9 Simplify (d/d(2/5))(-9/4)((dd*0d)/d)(1/2) assuming d is positive. d(-17/20) Simplify (p((p15/pp)/p)/pp)/pp(p/p(-11))/p(p*(1/8)p)(2/37) assuming p is positive. p(3857/148) Simplify (qq/q15q)*(-18)(qqq*(-15/2)qq)/(qq((q/(q(-12/13)q))/q)/q) assuming q is positive. q*(5501/26) Simplify ((vv(6/5)/v)/(v(-28)v))/(v(2/31)v(-1/2)) assuming v is positive. v(8877/310) Simplify (((t*(1/2)t)/tt(-1))(-4/5))(-3/26) assuming t is positive. t(-3/65) Simplify (h(2/57)/(h14/hh))/((((h(h/h10)/h)/h)/hhh)/h(hh(1/8)hh)/h) assuming h is positive. h(-2777/456) Simplify h4/h(-1/14)h*(-13)h((h(-2/3)/h)/h)/h assuming h is positive. h(-487/42) Simplify (b/b(8/5))/(b8bbb)b1bb(4/3) assuming b is positive. b(-124/15) Simplify (y8)(-21/8)/(yyy18/y)(8/9) assuming y is positive. y(-341/9) Simplify ((zz/z*(3/11)zz)/z)/(zzz(-7)zzz)z(z/(z(z/z11)/z))/zzz(-15/2) assuming z is positive. z(203/22) Simplify (t(tt1t)/tt)47((t/t(5/4))/t)/(t/(t(3/13)t)) assuming t is positive. t(9723/52) Simplify (v(-1/2)v)*(2/15)(v/(v*(3/8)v))/(v/v(-3/5)) assuming v is positive. v(-229/120) Simplify ((m/(mmm/((m/(mm(-15)m))/m)m)m)/m)(-3)/(m(-9)mmm11/m) assuming m is positive. m(-33) Simplify (n(1/7)nn6n*7nn(-3))(2/17) assuming n is positive. n(10/7) Simplify ((w(-5/4)ww/w(2/5))/((www(-1/2)/w)/w(1/4)))(2/67) assuming w is positive. w(1/335) Simplify (((k1/k)/k)/k(-6))/((k/(((k/k(-1/2))/kk)/k))/(k(k/(k(k*(3/10)/k)/kkk))/k)) assuming k is positive. k(21/5) Simplify ((oo*(-21)oo)/o(-3))(-1/8) assuming o is positive. o(15/8) Simplify m(-2)/mm*(1/6)(mm3)/m(-5) assuming m is positive. m(37/6) Simplify aa/(a*12aa)a*19aa/a15a(-10/7) assuming a is positive. a(-52/7) Simplify (w(-1/6))(-1/52)(ww*6w)/(w/(w/w9)) assuming w is positive. w(-311/312) Simplify (s*(-10)ss5)/(ss(-14/9))42 assuming s is positive. s(58/3) Simplify f(-31)/(f/(ff(2/3)f))(f/(ff(-22)))/(f27/f) assuming f is positive. f(-100/3) Simplify (((n(3/10)/nn)/(n(6/17)/nn))(1/4))(-22) assuming n is positive. n(99/340) Simplify (x15)*28(x/(xxx*(-15)xx))/x(-22) assuming x is positive. x454 Simplify (a/a(-3/2))(-1)/(a/a(-15)aa23) assuming a is positive. a(-85/2) Simplify (k(-7))(-46)/((k/k(-1/11)kk)/(k/(kk*(1/6)k))) assuming k is positive. k(20971/66) Simplify (x/x(-18))*(-13)x*(2/9)xx(-2/9) assuming x is positive. x(-246) Simplify (l(-5)lllll((ll((l(-4/3)l)/l)/l)/l)/l)/(l7)(-15) assuming l is positive. l(308/3) Simplify (h7/h0)/(h(-6/7)/(h/h*(-14)h)) assuming h is positive. h*(167/7) Simplify (g/(ggg(-1))g)*(16/3)/(gg/(gg2)gg(-7)g) assuming g is positive. g(34/3) Simplify (v(-6)v)(3/44)vv23v(-3/11) assuming v is positive. v(1029/44) Simplify (k/(k*(-5)/kk))*34(k/(kk(-2/11)k))15 assuming k is positive. k(2109/11) Simplify ((w/w(-1/5))19/((w/(w(4/7)/w))/w(2/5)))(-30) assuming w is positive. w(-4572/7) Simplify ccc/(c*(-2)c)ccc(-13)(c*(-3/8)/c)/(cc3/c) assuming c is positive. c(-91/8) Simplify ((s/(s/((s/s*(1/2))/s))s)*39(s2)(-2/39))(2/39) assuming s is positive. s(1513/1521) Simplify xx/(x/x4)x/(xx19x)(x/(xx(1/6)))/(x(-7)/xx) assuming x is positive. x(-49/6) Simplify (z(5/2))(-3/22)z/(zz/(z/(z/z(3/2))))(z/z0)/z assuming z is positive. z(7/44) Simplify ((ffff(-1))/f20)/(f(-9)f)12 assuming f is positive. f78 Simplify (a/(a/(a/a7)))(3/26)/(a/(a*(2/29)a)aa/(a*(-4)a)) assuming a is positive. a(-2120/377) Simplify ((y/y(-9))/(yy12))/(y8y/((yy(-1/11))/yyyy)) assuming y is positive. y*(-100/11) Simplify (rr(((r(2/15)/r)/r)/r)/rrr)/(r(-3/2)/rr)r(-1)rrr(-14) assuming r is positive. r(-341/30) Simplify (y(-3/17)/y25)/(y6)(17/4) assuming y is positive. y*(-1723/34) Simplify (z(z/(z/(zz(-2))))/z)6(z*8z)15 assuming z is positive. z129 Simplify (((v*(2/17)/vv)/v)/vv/v7v)/(v*9v**11) assuming v is p	{ "pile_set_name": "DM Mathematics" }
tens digit of (-1 + z/(-12))-4? 1 Suppose y - 51 = -0. Suppose 33 + y = 4k. What is the units digit of k? 1 Let a = -72 + 102. Let t = -14 - -14. Suppose tj - a = -3j. What is the tens digit of j? 1 Let m(t) = -t*3 + 4t*2 + 7t - 5. Let b be m(5). Suppose -p = -bz + 62, 2z - 3z = -5p - 22. What is the tens digit of z? 1 Suppose 3k - 4 = 8, 0 = -5t + 5k. Suppose 32 = 3l + tb - 99, 3b = -3l + 126. What is the tens digit of l? 3 Let r(i) = -5i + 6. Let c be r(4). Let g = c - -25. What is the units digit of g? 1 Let g be 16/7 + 4/(-14). Suppose u = go - 116, 5o - 5u - 246 - 39 = 0. What is the tens digit of o? 5 Suppose 0 = 98j - 100j + 234. What is the units digit of j? 7 Let q be 1 - (-2 + -125 + 2). Suppose 0b - q = -3b. What is the units digit of b? 2 Let z = 18 - 11. Suppose m + p - 14 = -2m, -4m + 23 = -3p. Suppose 0 = -2f - 2f - 12, f - z = -mo. What is the units digit of o? 2 Let f = -221 - -310. What is the units digit of f? 9 What is the tens digit of 351 - 25/10(-18)/(-15)? 4 Let v(k) = -36k - 12k + 7k - 5. Let z be v(5). What is the units digit of z/(-27) + (-6)/(-27)? 8 Let h(m) = -m3 + m2 + 6m + 32. Let a(z) = 2z3 - 2z*2 - 11z - 63. Let w(l) = -6a(l) - 11h(l). What is the tens digit of w(0)? 2 Let j(m) = m*3 - 3m*2 + 4m - 2. Let f be j(2). Let l(k) = 7k - 7kf + 6 + k3 - 1 - 4. What is the units digit of l(6)? 7 Suppose 5v = 3v + 6. Suppose -d = -vd - z + 115, -3z = 5d - 290. What is the tens digit of d? 5 What is the tens digit of (-570)/(-40) - ((-5)/(-4) - 1)? 1 Let g(i) = -15i + 3. What is the tens digit of g(-2)? 3 Let b be (2/(-6))/((-5)/15). Let v be b/2(1 - -3). Suppose 0d - 20 = -vd. What is the tens digit of d? 1 Let j(w) = -3w + 4 - 2 - 4 - w*3 + 6w*2. What is the units digit of j(5)? 8 Let r(d) = d - 13. Let i be r(9). What is the tens digit of 119/11 + i/(-22)? 1 Suppose 5q - 16 + 1 = 0. Suppose -x - 3i - q = 2x, -3i = 6. What is the units digit of x? 1 Let v = 1 + 2. Suppose 3j - 3s = -2j + 115, -4j = vs - 92. What is the tens digit of j? 2 Let a(z) = -z*2 - 6z + 3. Let i be (6 + -4)(-10)/(-4). Let u = i + -11. What is the units digit of a(u)? 3 Suppose -a + 5j + 7 = 0, -4j = 5a - 10 + 4. Suppose -11 = -m + au, -3m - u + 0u + 19 = 0. What is the units digit of m? 7 Let k be (5 - 4)192. Let n = -19 + k. Let b = n + -11. What is the units digit of b? 8 Let h(i) be the third derivative of i5/30 + i4/24 + i2. What is the units digit of h(-1)? 1 Let m be (-18 - 2)/4-1. Suppose -5j + 63 = 4s - 13, -5s + mj = -140. What is the tens digit of s? 2 Suppose -5z - 2t - 2 = -37, -3z = 3t - 21. Let g = z + -8. What is the units digit of -3 - g - 8/(-2)? 2 Let b(f) = 68f2 + f - 1. What is the hundreds digit of b(2)? 2 Suppose -45 = -4p + p. Let g = p - -3. What is the tens digit of g? 1 Suppose z - x = 3, -2z - x - x = 6. Suppose 4p + 4 - 13 = t, t + 3p - 12 = z. Suppose 2d + 29 = 3s, -ts + 4d = d - 33. What is the units digit of s? 7 Suppose 0s - 4c = 4s - 40, 4s - 70 = 2c. What is the tens digit of s? 1 Let y be 1 - (-1 - 2/1). Suppose 2f = 5r - 74, 0 = -3r - yf + 43 + 17. What is the tens digit of r? 1 Suppose 7 = -5y + 27. Suppose -ys + 3g + 16 = 0, 2s - g = -2g + 8. Suppose 0 = -9i + 4i + sz + 60, 0 = -5i + 3z + 55. What is the units digit of i? 8 Suppose -4u + 2 = -18. Suppose uc - 30 = 85. What is the units digit of c? 3 Let c(b) = -b*3 + 10b*2 - 4b. What is the units digit of c(6)? 0 Let l(n) = -n*2 - 18n - 20. What is the units digit of l(-11)? 7 Let u(o) = -o*3 - 4o*2 - 6o - 2. What is the units digit of u(-4)? 2 Let v = -94 - -151. What is the tens digit of v? 5 Let o(r) = -4r + r + 1 + 3r - 9r2. Let f(c) = -9c*2 + 1. Let n(j) = -5f(j) + 4o(j). What is the units digit of n(1)? 8 Let h = 30 - 13. Suppose -8f = -4f - 5i + 9, 3f + i = h. Let d = 13 - f. What is the units digit of d? 9 Let y(q) = 2q*2 - q - 2. Let w be y(-2). Let u = -1 + w. What is the units digit of u? 7 What is the units digit of (4 + (122/4)/(-1))-10? 5 Suppose 3b + 0o - 26 = -4o, 3o - 15 = 0. Suppose 4l + 3a - 29 = 0, 2l = -0l + ba + 32. What is the tens digit of l? 1 Let a = -6 + 10. Suppose 5m - x - 101 = -2x, 5m - ax - 96 = 0. What is the units digit of m? 0 Let n(g) = g + 0 - 1 - 3. Let a be n(0). What is the units digit of (-153)/(-21) + a/14? 7 Let n = 18 + -10. What is the units digit of n? 8 Let h be 54/10 - 2/5. What is the units digit of (-2 - -1)/(h/(-155))? 1 Let x(c) = -30c + 5. Let n be x(-4). Suppose -4o - 5j + n = 0, -o = -j + 3j - 35. What is the units digit of o? 5 Let w(x) = -x + 6. Let j be w(0). What is the tens digit of (-117)/6(-8)/j? 2 Let y(u) = u + 9. Let i be y(-7). Suppose im - 36 = -2m. What is the units digit of m? 9 Let l be 3/(-4)8/(-2). Suppose 6d - ld = 15. Suppose r + 35 = dc, -4c + 2r = -r - 17. What is the units digit of c? 8 Let r be 1 + (0 - 1/1). Suppose -41 = -2g - 5t + 40, r = -3t + 9. What is the tens digit of g? 3 Let j be -1 - (1 + 0) - -2. Let k = 3 + j. Suppose -9 = -ki - 0i. What is the units digit of i? 3 Let m(p) = 20p*3 + 2p - 1. Let v be m(1). Suppose -3c + 2w + v = w, -4w - 20 = -4c. Suppose -2r = -0r - c. What is the units digit of r? 4 Suppose m + 4y - 329 = 0, -2m + 0y = y - 658. What is the tens digit of m? 2 Let m = -6 + 50. Suppose -d + m = 3d. What is the tens digit of d? 1 Let o = 2 - -1. Suppose -3a + op = -93, -a - 3a - 4p = -108. What is the tens digit of a? 2 Suppose -24 = -0z + 3z. Let x(q) = -3q + 6 + 4q + 9. What is the units digit of x(z)? 7 Let r(t) = 8t2 + t. Let y be r(-2). Suppose -4n = -y - 14. What is the tens digit of n? 1 Let m = 5 - -2. Suppose ma = 4a + 42. What is the units digit of a? 4 Let w(c) = 7c3 + c2 - c + 1. What is the units digit of w(2)? 9 Let q = 5 + -1. Let c = 8 - -2. What is the units digit of q/c - (-26)/10? 3 Let q(k) = 4k - 4. Let t(a) = a*3 + 9a*2 + 8a + 2. Let m be t(-8). Let d be 1/(-2) - (-7)/m. What is the units digit of q(d)? 8 Let s(w) = 3w. Let x be s(6). Suppose -4j = -x + 6. What is the units digit of j? 3 Suppose 2 = -m - 1. Let u(w) = -w*2 - 4w + 4. What is the units digit of u(m)? 7 Let k be (0 - 4)/2 + 2. Let y be -1 + 1 - (-1 - k). Let v = y + 4. What is the units digit of v? 5 Let i = 4 - 8. Let d = i + 6. Suppose 7y = -b + dy - 7, 2b - y = 8. What is the units digit of b? 3 Let u(o) = -2 - 4 + o - o + 2o. Let v = 13 - 8. What is the units digit of u(v)? 4 Let c(n) = 3n - 4. Let h(w) = w2 + 5w - 3. Let i be h(-4). Let m be c(i). What is the units digit of 6/(-10) + (-290)/m? 1 Let r(z) = -9z - 26. What is the tens digit of r(-13)? 9 Let g(z) = -z + 4. Let f be g(2). Suppose 11 = 3l + f. Suppose 2k - l - 7 = 0. What is the units digit of k? 5 Suppose -4b = 3c - 60, c - 3 = 4b + 1. Suppose -u - 4f + c = 0, -2 = 3u - 2u - 5f. What is the units digit of u? 8 Suppose -5i + 383 = 3b, -4b - 2i + 4i = -502. What is the hundreds digit of b? 1 Suppose -5f = 2s - s - 147, 2f = 0. Suppose -5m = 37 - s. Suppose 3d - m = d. What is the units digit of d? 1 What is the units digit of (-4)/(-18) + 612/162? 4 Let m = -4 + 3. Let j(i) = -9i + 1. Let f be j(m). Let n = f + -1. What is the units digit of n? 9 What is the tens digit of 2 + (-16)/6(-9)/2? 1 What is the tens digit of (-111 + 0)5/(-15)? 3 Suppose u = 6u - 15. Suppose -8 = -up - 2. What is the units digit of p? 2 Let h(x) = x3 + 14. Let s be h(0). Let t be -3 + (2 - 0)s. Suppose 0 = 4p - 11 - t. What is the units digit of p? 9 Suppose 2s + 3s = 45. Suppose 5n = 8n + 6. What is the units digit of 60/s + n/(-6)? 7 Let l(q) = q3 - 5q2 + q + 1. Let r be l(5). Let d = r - 1. What is the units digit of d? 5 Let v(m) be the third derivative of -m6/120 + m*5/15 + 5m*4/24 + 5m3/6 + m2. Let h = -10 - -15. What is the units digit of v(h)? 5 Suppose 0 = 2t - 2m + 6m - 52, t - 5 = 5m. Suppose 4p - t = -4c, 1 = -c - 3. What is the units digit of p? 9 What is the units digit of 78/(-15)20/(-8)? 3 Let l be (-1)/(3/6) + 38. Suppose 6o - l = 3o. What is the tens digit of o? 1 Suppose 2n + 2u = 28, -u + 47 = n + 3n. Su	{ "pile_set_name": "DM Mathematics" }
e of 16? False Suppose 0 = 4i - 2u - 62, -3i + 8i = u + 76. Let c = i + -27. Does 16 divide c/1636-1? False Let k be -2 + (2 - 0) - (-943 - 1). Suppose -12l - k = -28l. Is l a multiple of 30? False Suppose 0 = 4c - 4o - 116, 2o - 4 = 6o. Suppose 3d - 70 = 2t, 2d = -4t + 80 - c. Is 6/16 + (663/d)/1 a multiple of 4? True Let d(x) = x*2 + 3x - 3. Let l be d(2). Let w(z) = 7z + 101. Let t be w(-14). Suppose -4k - l = 9, -tk + 2 = o. Is 7 a factor of o? True Let s(t) = -t3 + 10t*2 - 2t + 2. Let l be s(4). Suppose 0 = -7n + 12n - l. Let r(f) = 2f + 16. Does 23 divide r(n)? False Let x(c) = 3c*3 - 3c*2 - c - 2. Let n be x(2). Suppose -1694 = k - nk. Does 22 divide k? True Let t = -6 - -10. Suppose 0 = -to - 4x + 176, -2o + 3o - 3x = 44. Is o a multiple of 3? False Suppose 0m + 35 = 5m. Let t = m - 2. Suppose -b + 380 = 3v, 2v + 0v + tb - 236 = 0. Is v a multiple of 16? True Let a = 1051 - 2245. Let g = -567 - a. Does 33 divide g? True Let k = -346 - -342. Is 2105/(k - 145/(-30)) a multiple of 42? True Let h(w) = 18w + 101. Let n be h(-6). Does 15 divide 2/(-70)n - (-14908)/10? False Let u = -4218 + 4564. Does 9 divide u? False Is 10 a factor of (23 - 876/36)(-2 - 2651/2)? True Let p be (170/(-1020))/((-1)/102). Suppose -2g - 3g + 220 = 0. Suppose j + 2b - 5 = p, -2j = -2b - g. Does 11 divide j? True Let m be -6 + (9 - -2) + -3 + -1 - -19. Let f(v) = 12 + 17v - v2 - 11v + 14v. Is f(m) a multiple of 6? True Let f = 267 - 262. Suppose -fx + 32760 = 30x. Does 62 divide x? False Let h be (-225)/(-54) + (-2)/12. Suppose 2a - d - 47 + 39 = 0, -13 = -5a - d. Is (150/h)/((-15)/6 + a) a multiple of 8? False Let n be (0/(-30))/(0 - -3). Let c = 49 + -28. Suppose x - 34 - c = n. Is x a multiple of 20? False Suppose -p = -3k - 2k + 404, 0 = -5k + 5p + 420. Suppose 0 = -kc + 83c - 156. Is 10 a factor of (0 - c)(-130)/40? False Let x(l) = -19 + 0l - 3l + l. Let v be x(-10). Is 18 a factor of 55 - (2 - 1/v)? True Let a(n) = 2n2 + 60n + 6. Is 6 a factor of a(23)? False Suppose -q + 9515 = b, -q = -5b + 1324 - 10869. Is 69 a factor of q? False Let y(g) = 8245g*3 - 86g*2 - g - 1. Is y(1) a multiple of 26? False Suppose -5c + 25 = -205. Is (c/8)/((-7)/(-308)) + -1 a multiple of 36? True Let u(j) = 8j + 2j*2 - 7128j*3 + 0j*2 + 0j*2 + 7127j3 + 12. Is u(-5) a multiple of 7? True Let m be (-549)/27 + 1/3. Let d(f) = -f3 + 11f2 + 8f - 13. Let r be d(11). Let h = r + m. Is h a multiple of 13? False Let y(o) = o*2 + 9o + 13. Let u be y(-7). Let j be -6 + 3 + u - 2/2. Does 13 divide (892/(-12) - j)/(2/(-6))? True Suppose 28 = 4o + 3o. Suppose 7x + ox = 6x. Suppose -5m - 1090 = -5p, 2p + m - 433 = -xp. Does 31 divide p? True Let x be ((-376)/32 + 8)/(6/(-16)). Let o(y) = -y3 + 9y*2 + 11y + 6. Does 2 divide o(x)? True Is ((-629)/74)/(-1 - (-413)/414) a multiple of 25? False Let x = -4 + 12. Let b be 24(-10)/4(-112)/24. Suppose -xt + 15t = b. Does 8 divide t? True Let q(h) = 2h + 36. Let l(r) = r3 + 7r*2 + 8r + 6. Suppose -4c + 5c = -6. Let z be l(c). Is 4 a factor of q(z)? True Let x(j) = 92j2 - 19j + 6. Is x(9) a multiple of 168? False Let q(x) = 10x - 59. Let m be 3/(-6) + (-23)/(-2). Let o be q(m). Suppose 110 = i - o. Is i a multiple of 23? True Suppose -3v - 2h + 28 = 0, -7v + h = -2v - 64. Let b be 119/3 - (2 - 28/v). Suppose 3x - 5x = -b. Does 5 divide x? True Suppose -6o + 47 + 7 = 0. Suppose -od + 5d = -20. Suppose 0 = -2g - 0w - w + 331, dg - w - 845 = 0. Does 13 divide g? False Suppose 0 = 9g - 16422 - 1047. Is g a multiple of 4? False Suppose -2f = 2n - 1630, 0 = -3n + 452f - 451f + 2437. Is n a multiple of 22? False Let d be ((-18)/(-54))/(1/204). Suppose -do + 50o + 1404 = 0. Does 26 divide o? True Suppose w = 4, -401 = 4b + 2w - 121. Let i = -65 - b. Suppose -9h + 26 = -ih. Is 13 a factor of h? True Suppose -6q + 122279 = 46q - 38245. Is 10 a factor of q? False Let v(n) = 871n + 6595. Is 169 a factor of v(5)? False Let u be 4(-16 + -1)/(-8 + 4). Suppose -7a = ua - 5256. Is a a multiple of 3? True Suppose -2t = 5o - 9 - 7, -3o = 3t - 6. Let z be 92(-150)/12t/20. Is 23 a factor of -1z/15-6? True Suppose -2q + 2 = -2. Let v be (94/(-470))/(3/(150/(-1))). Suppose qz - v = 4. Is 5 a factor of z? False Let n(k) = -k3 + 5k*2 - 4k + 14. Suppose 0 = 3o + 5c - 25, -3o + 2c + 8 + 3 = 0. Let g be n(o). Does 27 divide (3 - 2 - 2)1458/g? True Let a(j) = 36j*2 + 67j + 142. Is 12 a factor of a(-10)? True Suppose -17760 = -4983i + 4971i. Does 20 divide i? True Let n = -195 - -195. Suppose -288 = -no - 4o - 4c, -16 = 4c. Is 38 a factor of o? True Suppose -83o + 107o = 56544. Let z = -1384 + o. Is z a multiple of 81? True Let b = 30172 + -14002. Suppose 14d = -0d + b. Is d a multiple of 77? True Suppose -5z - 3i + 3653 = 0, 0 = 2z - 6i + 3i - 1457. Is z a multiple of 46? False Let l(d) = 47d*2 + 50d + 134. Does 11 divide l(-21)? True Let d = 17 + 5. Let o = 594 + -294. Suppose -db + o = -17b. Is 13 a factor of b? False Is (-5)/(-10)14030 + (-4 - -11) a multiple of 68? False Let o = -12 + 52. Suppose 16 = -4v, -v = -4m + 4v + o. Suppose -y = x - 5x + 170, -116 = -3x - my. Is x a multiple of 11? False Suppose 5g = w - 16, -4g = -3w + 7w + 8. Let f be 15/(-5) - (-2)/w. Does 3 divide (-2)/2(-10 + f)5? False Suppose -26y + 76y = 12y + 1077528. Is 14 a factor of y? False Let g = -1659 + 2461. Is 2 a factor of g? True Let f be (-1 + 3)(-9)/(-9) - -362. Suppose 592x - 585x = f. Does 3 divide x? False Suppose -c + 1520 + 1178 = -4o, -5o - 13460 = -5c. Suppose 5p = -3x + 4438, -4x = -3p + x + c. Suppose 11z - p = 6z. Does 12 divide z? False Is 28 a factor of (-1)/(303245/(-12635) + 24)? False Suppose -k = 8 - 12. Let d(c) = c - 1. Let r be d(k). Suppose rm = 2 + 31. Does 3 divide m? False Suppose -f + 5l - 9 = 0, -l + 5 = 2. Suppose -f = -d - 2d. Suppose -dx = -167 - 187. Does 16 divide x? False Suppose 10w - 5w + 48780 = 20w. Is w a multiple of 4? True Let u(d) = 251d*2 + 139d + 984. Is u(-7) a multiple of 10? True Suppose 6a = -0a + 24. Suppose -5b - 6q + 2q - 662 = 0, aq = b + 118. Let k = -16 - b. Is k a multiple of 20? False Suppose 336 = -4z + 2440. Suppose -10h = 11 - 31. Suppose -4o - hf + z = 0, -260 = -2o - 0f - 2f. Is o a multiple of 45? False Let u = 197 + -192. Suppose -uk = -1234 - 1571. Does 11 divide k? True Let h = -166 - -187. Is 22 a factor of ((-955)/(-2) + -2)/(h/14)? False Is (-2)/(856/280 + -3)(-119)/1 a multiple of 7? True Let x(a) = -6a2 + a3 + 2a - 4 + 11 + a2. Let v be x(6). Suppose 5y = -0 + v. Does 2 divide y? False Suppose 2450a = 2447a - 111. Suppose 2x + 128 = -0x - 5r, -238 = 4x + r. Let b = a - x. Is 11 a factor of b? True Let m(j) = 58j + 79. Let h be (30 - 31)/(2/(-6)). Is m(h) a multiple of 23? True Suppose -4m + 5u + 11 = -3m, -m - 2u + 4 = 0. Suppose -3h - p = -mh + 42, 5h + 5p = 70. Suppose -8i - h = -54. Is i even? False Let a = -6172 - -8318. Is a a multiple of 58? True Suppose 0 = -w - 4t + 8450, 159t = 2w + 157t - 16880. Is 126 a factor of w? True Let t(r) = -r*3 + 19r*2 - 40r - 19. Let c be t(17). Let o = c + 130. Suppose 0v + 774 = ov. Is 43 a factor of v? True Let v(k) = -4k + 5. Let w be v(2). Let c(i) = i3 + 5i*2 + 3i + 1. Let n be c(w). Let b(j) = j*3 - 10j*2 + 7j - 13. Does 9 divide b(n)? False Suppose 0 = -11f + 3f - 48. Let a be 3/f6 + -57. Let m = 115 + a. Is m a multiple of 5? True Does 13 divide 6680/(-90)-315/10? False Let u be (-6)/(-24) - ((-3755)/4)/1. Suppose 4d + g - u = 0, -3d - 2g + 468 = -d. Does 14 divide d? False Let c(m) = 54m + 259. Let i(w) = 13w + 65. Let v(j) = 6c(j) - 26i(j). Does 44 divide v(-16)? True Suppose 11c = 7c - 176. Let z = 48 + c. Suppose 4r - 27 = -3y - 2y, zy = -4r + 28. Does 2 divide r? True Suppose 41x - 218x + 4743391 + 4777439 = 0. Does 33 divide x? True Let c(w) = 5379w - 380. Is c(3) a multiple of 10? False Suppose 25m = 5m - 160. Does 29 divide (-1906)/(-8) + (-6)/m? False Does 17 divide (101 + 0)/((36/2376)/(4/6))? False Let n = 90 - 74. Suppose -h - 2s - 3 = -5, -2h + 2*	{ "pile_set_name": "DM Mathematics" }
nth root of 17914 to the nearest integer? 4 What is the square root of 3579 to the nearest integer? 60 What is 2140 to the power of 1/2, to the nearest integer? 46 What is the square root of 158 to the nearest integer? 13 What is 9227 to the power of 1/3, to the nearest integer? 21 What is 21198 to the power of 1/6, to the nearest integer? 5 What is the square root of 14813 to the nearest integer? 122 What is 11892 to the power of 1/2, to the nearest integer? 109 What is the square root of 421 to the nearest integer? 21 What is the ninth root of 5275 to the nearest integer? 3 What is 471 to the power of 1/2, to the nearest integer? 22 What is 5683 to the power of 1/7, to the nearest integer? 3 What is the cube root of 254 to the nearest integer? 6 What is 65945 to the power of 1/9, to the nearest integer? 3 What is the square root of 13515 to the nearest integer? 116 What is 151 to the power of 1/3, to the nearest integer? 5 What is the square root of 32474 to the nearest integer? 180 What is the square root of 546 to the nearest integer? 23 What is the sixth root of 704 to the nearest integer? 3 What is the third root of 4946 to the nearest integer? 17 What is 11003 to the power of 1/3, to the nearest integer? 22 What is the cube root of 33673 to the nearest integer? 32 What is 118388 to the power of 1/9, to the nearest integer? 4 What is the sixth root of 6769 to the nearest integer? 4 What is 62598 to the power of 1/2, to the nearest integer? 250 What is the fourth root of 453 to the nearest integer? 5 What is the cube root of 9662 to the nearest integer? 21 What is 808 to the power of 1/2, to the nearest integer? 28 What is the cube root of 3581 to the nearest integer? 15 What is the tenth root of 5983 to the nearest integer? 2 What is the fourth root of 1763 to the nearest integer? 6 What is the square root of 98226 to the nearest integer? 313 What is the cube root of 27288 to the nearest integer? 30 What is the square root of 13080 to the nearest integer? 114 What is 5499 to the power of 1/2, to the nearest integer? 74 What is the cube root of 21553 to the nearest integer? 28 What is 53814 to the power of 1/3, to the nearest integer? 38 What is 3631 to the power of 1/7, to the nearest integer? 3 What is the cube root of 62322 to the nearest integer? 40 What is the seventh root of 429 to the nearest integer? 2 What is 3497 to the power of 1/4, to the nearest integer? 8 What is the third root of 2213 to the nearest integer? 13 What is the square root of 2291 to the nearest integer? 48 What is 4698 to the power of 1/3, to the nearest integer? 17 What is 162328 to the power of 1/3, to the nearest integer? 55 What is the eighth root of 201 to the nearest integer? 2 What is the sixth root of 1812 to the nearest integer? 3 What is 2460 to the power of 1/2, to the nearest integer? 50 What is the cube root of 170684 to the nearest integer? 55 What is the cube root of 427 to the nearest integer? 8 What is the square root of 658 to the nearest integer? 26 What is the third root of 50963 to the nearest integer? 37 What is the square root of 73958 to the nearest integer? 272 What is the sixth root of 8083 to the nearest integer? 4 What is 19770 to the power of 1/2, to the nearest integer? 141 What is 329 to the power of 1/9, to the nearest integer? 2 What is 5635 to the power of 1/2, to the nearest integer? 75 What is 40778 to the power of 1/3, to the nearest integer? 34 What is 15164 to the power of 1/8, to the nearest integer? 3 What is the cube root of 743 to the nearest integer? 9 What is 35632 to the power of 1/2, to the nearest integer? 189 What is the cube root of 1739 to the nearest integer? 12 What is 103 to the power of 1/2, to the nearest integer? 10 What is the cube root of 917 to the nearest integer? 10 What is the square root of 5917 to the nearest integer? 77 What is the square root of 119622 to the nearest integer? 346 What is 4026 to the power of 1/7, to the nearest integer? 3 What is the third root of 27432 to the nearest integer? 30 What is 1799 to the power of 1/10, to the nearest integer? 2 What is 1453 to the power of 1/2, to the nearest integer? 38 What is the square root of 38758 to the nearest integer? 197 What is the cube root of 41815 to the nearest integer? 35 What is 37737 to the power of 1/7, to the nearest integer? 5 What is the square root of 9759 to the nearest integer? 99 What is 98328 to the power of 1/6, to the nearest integer? 7 What is 1130 to the power of 1/3, to the nearest integer? 10 What is 3489 to the power of 1/2, to the nearest integer? 59 What is the cube root of 4524 to the nearest integer? 17 What is the cube root of 161914 to the nearest integer? 55 What is the eighth root of 151 to the nearest integer? 2 What is 1490 to the power of 1/3, to the nearest integer? 11 What is the tenth root of 1326 to the nearest integer? 2 What is the fifth root of 3708 to the nearest integer? 5 What is 1205 to the power of 1/2, to the nearest integer? 35 What is 26172 to the power of 1/10, to the nearest integer? 3 What is the square root of 3336 to the nearest integer? 58 What is 7569 to the power of 1/6, to the nearest integer? 4 What is the third root of 13 to the nearest integer? 2 What is the fifth root of 796 to the nearest integer? 4 What is 1564 to the power of 1/8, to the nearest integer? 3 What is 7691 to the power of 1/3, to the nearest integer? 20 What is the cube root of 376 to the nearest integer? 7 What is the sixth root of 95 to the nearest integer? 2 What is 16050 to the power of 1/2, to the nearest integer? 127 What is the cube root of 46876 to the nearest integer? 36 What is the square root of 145 to the nearest integer? 12 What is the third root of 2431 to the nearest integer? 13 What is the cube root of 24949 to the nearest integer? 29 What is the cube root of 69656 to the nearest integer? 41 What is the square root of 28832 to the nearest integer? 170 What is 50150 to the power of 1/10, to the nearest integer? 3 What is the square root of 1630 to the nearest integer? 40 What is the cube root of 98273 to the nearest integer? 46 What is the seventh root of 67977 to the nearest integer? 5 What is 371 to the power of 1/2, to the nearest integer? 19 What is 1816 to the power of 1/2, to the nearest integer? 43 What is the eighth root of 37479 to the nearest integer? 4 What is the fourth root of 59112 to the nearest integer? 16 What is the square root of 5509 to the nearest integer? 74 What is 1730 to the power of 1/2, to the nearest integer? 42 What is 1590 to the power of 1/10, to the nearest integer? 2 What is 54133 to the power of 1/7, to the nearest integer? 5 What is 912 to the power of 1/9, to the nearest integer? 2 What is the cube root of 3475 to the nearest integer? 15 What is the third root of 5735 to the nearest integer? 18 What is the third root of 7166 to the nearest integer? 19 What is the cube root of 7248 to the nearest integer? 19 What is the seventh root of 645 to the nearest integer? 3 What is the square root of 239 to the nearest integer? 15 What is the eighth root of 4913 to the nearest integer? 3 What is the square root of 12721 to the nearest integer? 113 What is 142910 to the power of 1/3, to the nearest integer? 52 What is the sixth root of 33702 to the nearest integer? 6 What is 32617 to the power of 1/7, to the nearest integer? 4 What is 2482 to the power of 1/7, to the nearest integer? 3 What is the cube root of 4360 to the nearest integer? 16 What is 2807 to the power of 1/7, to the nearest integer? 3 What is the cube root of 434 to the nearest integer? 8 What is 27518 to the power of 1/9, to the nearest integer? 3 What is 5273 to the power of 1/3, to the nearest integer? 17 What is 1585 to the power of 1/2, to the nearest integer? 40 What is 99676 to the power of 1/2, to the nearest integer? 316 What is 365 to the power of 1/10, to the nearest integer? 2 What is 47581 to the power of 1/2, to the nearest integer? 218 What is the square root of 3400 to the nearest integer? 58 What is 20126 to the power of 1/2, to the nearest integer? 142 What is the seventh root of 5199 to the nearest integer? 3 What is the square root of 1290 to the nearest integer? 36 What is 4153 to t	{ "pile_set_name": "DM Mathematics" }
+ 9. Let r be h(7). What is the second derivative of -d - 2dr - 16d*k + 2d*2 - 6d wrt d? -192d2 Let v(j) be the first derivative of 8j*5 - 56j*3/3 + 6322j - 4263. Find the first derivative of v(b) wrt b. 160b3 - 112b Let n(t) be the third derivative of t*4/24 + 2t*3/3 + 9t*2. Let b be n(7). Differentiate -27 + 11 + bv*2 + 4v*2 wrt v. 30v Let i = 2865 - 1526. What is the derivative of 45 + r*4 - 6 - ir + 1354r wrt r? 4r*3 + 15 Let t be (-1)/((-8)/(-4))-12. Find the third derivative of -2nt + n2 - 19 - 10n*2 + 24n*5 + 7n*2 wrt n. -240n*3 + 1440n*2 Find the second derivative of -7230r*5 - 499r - 1885r + 2159r*5 - 376r wrt r. -101420r3 Find the third derivative of 57t*2 + 122t*4 - 474t*4 - 169t*4 - 911t*2 + 98t*2 wrt t. -12504t Let n be (69/6)/1 - (-2)/4. Let z be (1 - -33) + 12/n. What is the first derivative of -zv2 + 4 - 1 + 4v*2 wrt v? -62v Let a(u) = 38601u2 + 32u - 24528. Let p(r) = 12867r2 + 10r - 8179. Let y(d) = 5a(d) - 16p(d). What is the derivative of y(b) wrt b? -25734b Suppose 3g - o = 7, -1 = -3g + 2o + 1. What is the third derivative of -10yg - 10y*4 + 17y*4 - 2y*3 - 79y*2 wrt y? -72y - 12 Suppose 10 = -15b + 12b - 4w, 3b - 2w = 14. Differentiate -598c*3 - 7c*4 + 8 + 598c*3 - bc with respect to c. -28c3 - 2 Let t = 25 - 28. Let z be 67 + (t + -2 - -4). Differentiate -72 + z - 10k*3 - 2k*3 with respect to k. -36k*2 Suppose 0 = 2c + 8, t - 120 = -2t + 3c. Find the third derivative of -5u2 + 67u*5 + 254u*3 - tu*2 + 2 - 254u*3 wrt u. 4020u*2 Let a(s) be the first derivative of 251s*7/42 - 35s*3/2 - 75s + 118. Let d(o) be the first derivative of a(o). What is the second derivative of d(q) wrt q? 5020q3 Let y(k) = 313k*3 - 5k*2 + 164k. Let p(r) = -1252r3 + 19r*2 - 656r + 2. Let h(o) = -3p(o) - 11y(o). What is the second derivative of h(m) wrt m? 1878m - 4 Let g(a) be the first derivative of 401a*4 - 2468a*3/3 - 1908. What is the third derivative of g(v) wrt v? 9624 Let q be -10(-10)/(-8)(-8)/(-20). Let j be (-7 - q)/(-2(-2)/(-14)). What is the third derivative of jv2 + 5v*3 - 10v*2 - 15v*3 wrt v? -60 Suppose 4n + 18 = 3m, -4m - 2 = -5n - 25. Find the third derivative of -2 - 20v*3 + 67v*m - 27v*3 - 13v*3 - 77v*2 wrt v. -360 Let x(q) be the third derivative of -371q*5/20 + 637q*3/6 + 641q*2. Find the first derivative of x(t) wrt t. -2226t Let j(f) be the second derivative of -4499f3/3 + 739f*2 - 16f + 159. Differentiate j(o) with respect to o. -8998 Let d(b) be the third derivative of -b*7/210 + 125b*5/6 + 979b*3/3 - 14b*2 + 17b - 1. Find the first derivative of d(r) wrt r. -4r3 + 2500r Let z(p) = 33p2 - 159. Let r(n) = n2 - 2. Let u be -2 - (3/(-6) - (-12)/(-24)). Let t(m) = uz(m) - r(m). Find the first derivative of t(d) wrt d. -68d Let h be 7 - (1 - (-12)/(-3)). Let y(f) = -f2 + 13f - 6. Let t be y(h). Differentiate -9v - t + 12 + 10 wrt v. -9 Suppose 84b = 190b. Let i(g) be the first derivative of -21 + 9/4g*4 - 7/3g*3 + bg + 0g2. Find the third derivative of i(f) wrt f. 54 Let i(k) = -3809k - 14399. Let v(q) = -635q - 2400. Let j(r) = -4i(r) + 23v(r). What is the derivative of j(s) wrt s? 631 Let o(l) = -l2 + 13l - 24. Let s be o(8). What is the second derivative of 39a2 - s + 22a*2 - 39a + 16 wrt a? 122 Let x(h) = 4h2 + 1159h - 1940. Let r(b) = 7b2 + 2317b - 3880. Let i(g) = -6r(g) + 11x(g). What is the first derivative of i(y) wrt y? 4y - 1153 Let k(z) be the second derivative of -7z*6/30 + 32z4/3 + z3/3 - 183z2 - 31z - 12. Find the second derivative of k(f) wrt f. -84f2 + 256 Let k be 3((0 - 1) + (-200)/(-120)). Find the third derivative of 39y3 + 22y*3 + 814y*2 - 723y*k + y wrt y. 366 Let j(q) = 1784q*3 - 16q*2 - 21q. Let u(x) = 891x3 - 7x*2 - 8x. Let a(o) = -3j(o) + 7u(o). Find the third derivative of a(n) wrt n. 5310 Let c(l) be the second derivative of 669l5/10 + 71l3/2 - l2 + 2l + 564. What is the second derivative of c(n) wrt n? 8028n Let k = 10 - -49. Find the first derivative of k + 2 - 2 + 53q - 5 wrt q. 53 Let z(s) be the third derivative of 0 - 1/120s*6 + 5/3s*3 + 0s*4 - 28s + 1/105s7 + 1/30s*5 - 2s*2. Find the third derivative of z(b) wrt b. 48b - 6 Let x(l) = -5l3 + 92l*2 - 2l + 2189. Let f(g) = -16g3 + 278g*2 - 7g + 6559. Let v(a) = -2f(a) + 7x(a). What is the first derivative of v(d) wrt d? -9d2 + 176d Suppose -10j + 655 = -595. What is the first derivative of jc - 10 - 26 - 26 + 17 wrt c? 125 Let y(x) be the first derivative of -134x + 0x*4 - 18/5x*5 + 0x*2 + 50 + 0x*3. What is the first derivative of y(w) wrt w? -72w*3 Let m(p) = -13p*2 - p - 1. Let y(x) = 89x*2 - 1121x + 4. Let c(f) = -4m(f) - y(f). What is the second derivative of c(s) wrt s? -74 Let z(m) be the second derivative of m5/10 + 301m*3/6 - 720m*2 + 302m + 8. What is the derivative of z(q) wrt q? 6q2 + 301 Let j(m) be the third derivative of -93m8/56 - m4/6 - 23m3/6 + 88m*2 + 7. Find the second derivative of j(g) wrt g. -11160g*3 Let q(h) = 320h*2 - 44h + 3739. Let y(x) = 23042x2 - 3157x + 269206. Let b(r) = -287q(r) + 4y(r). Differentiate b(k) with respect to k. 656k Let o(a) be the first derivative of 0a*2 - 9a*3 - 71/5a*5 + 0a + 0a4 - 112. Find the third derivative of o(d) wrt d. -1704d Let l(x) be the first derivative of -85x3 - 1074x*2 + 2660. What is the second derivative of l(t) wrt t? -510 Let a(c) = 1539c*4 + 1663. Let b(p) = -3079p*4 - 3325. Let u(z) = 7a(z) + 4b(z). What is the first derivative of u(t) wrt t? -6172t*3 Let w(x) = 23x*3 - 5x*2 - 35x + 402. Let v(p) = 29p3 - 6p*2 - 35p + 403. Let z(y) = 5v(y) - 6w(y). Differentiate z(t) with respect to t. 21t2 + 35 Suppose 4y = -1 + 9. Find the third derivative of 71w3 - 32w*2 + 18w*2 - 106w*2 - 51wy wrt w. 426 Find the third derivative of -13 - 10 + v3 + 33v2 + 6 + v5 - 4 + 18 wrt v. 60v2 + 6 Let o(k) = -k4 + 3k3 - 5k2 - 1754. Let h(m) = m4 - 6m3 + 9m*2 + 3510. Let c(s) = 5h(s) + 9o(s). Differentiate c(x) wrt x. -16x*3 - 9x*2 Let k(j) = 636j*3 + 3j*2 + 3j - 408. Let r(h) = 636h3 + 2h*2 + 2h - 407. Let y(o) = 2k(o) - 3r(o). What is the first derivative of y(f) wrt f? -1908f2 Let b(m) be the third derivative of m5/30 + 287m*4/6 - 369m*3/2 - 2012m*2 + 2m. What is the first derivative of b(d) wrt d? 4d + 1148 Let a(l) = -l - 12. Suppose w - 49 = 3f, 0 = 6f - 4f - 2w + 30. Let v be a(f). Find the second derivative of vm + 8m - 4m*3 - 3m*3 + 25m*3 wrt m. 108m Let r be 69/2168. Let l be (0 - (1 - 3))2. What is the second derivative of 5i*5 + li*2 - i + 9i*2 - 13i*r wrt i? 100i3 Let t(j) = j2 + 2j + 1. Let l be 84/636/(-4). Let v be t(l). What is the second derivative of 52d - 31d - v - 11d5 + 1 wrt d? -220d*3 Let f(z) = -53z + 14. Let i = -1235 - -1243. Let h(n) = 3 - 4n + 39n - 12. Let d(o) = ih(o) + 5f(o). Differentiate d(k) wrt k. 15 Let t be 3(4 - (-12)/(-4)). Suppose 0 = -v + s - 2s - 1, -tv + 21 = -5s. What is the derivative of -4w + 2 + 2w + w - vw wrt w? -3 Let l(h) = 1177h*3 + 3h*2 - 11h - 7. Let y(p) = -2353p3 - 7p*2 + 20p + 15. Let b(a) = 7l(a) + 3y(a). What is the second derivative of b(v) wrt v? 7080v Let q(d) be the second derivative of 1553d*4/12 + 5244d*2 + 6080d. Differentiate q(k) wrt k. 3106k Let o(r) = 116r - 8. Let l be o(4). Suppose -9z = -z - l. Find the first derivative of -98p + 62p + 26 + zp wrt p. 21 Suppose -3p - 3y = -63, -p + 34y - 30y = -21. What is the third derivative of -18h2 + 41h*5 - ph*2 - 24h*2 + 16h*2 wrt h? 2460h*2 Let a(s) = -14s3 + s2 + 15s3 + 0s*2 + 8s + 6s2 - 5. Let d be a(-5). Find the first derivative of -11 - 3 - dx - 3 - 15x wrt x. -20 Suppose -1 = 3w + 4i - 26, -2i = 3w - 23. What is the derivative of -14 - 2g*4 - 6 + 37g*2 + 102 + wg*2 wrt g? -8g*3 + 88g Find the second derivative of 0w + w - 9 + 1545w*3 + 7w - 4*w - 14 wrt w	{ "pile_set_name": "DM Mathematics" }
*2 - 47923y - 72 What is the g'th term of -1580, -1938, -2308, -2696, -3108, -3550, -4028? -g*3 - 351g - 1228 What is the m'th term of 238126, 476372, 714622, 952876, 1191134, 1429396? 2m2 + 238240m - 116 What is the z'th term of 574775, 1149539, 1724303, 2299067? 574764z + 11 What is the o'th term of -148932, -149242, -149554, -149868, -150184? -o2 - 307o - 148624 What is the g'th term of 3158708, 6317418, 9476128, 12634838, 15793548? 3158710g - 2 What is the n'th term of 46477, 97081, 147697, 198331, 248989, 299677, 350401? n3 + 50597n - 4121 What is the s'th term of -467, -643, -811, -971, -1123, -1267? 4s2 - 188s - 283 What is the k'th term of 88920885, 88920883, 88920879, 88920873, 88920865, 88920855, 88920843? -k*2 + k + 88920885 What is the y'th term of -1513, -5762, -12873, -22870, -35777, -51618, -70417? -4y*3 - 1407y*2 - 102 What is the l'th term of -111915, -111940, -111981, -112038, -112111, -112200, -112305? -8l*2 - l - 111906 What is the p'th term of 81487974, 81487979, 81487984, 81487989, 81487994, 81487999? 5p + 81487969 What is the t'th term of 35671808, 35671803, 35671796, 35671787? -t*2 - 2t + 35671811 What is the n'th term of -17851, -34873, -51905, -68953, -86023, -103121? -n3 + n2 - 17018n - 833 What is the j'th term of 724, 2033, 4184, 7153, 10916? -4j*3 + 445j*2 + 2j + 281 What is the j'th term of 466, 5354, 19910, 49378, 99002, 174026, 279694, 421250? 874j3 - 410j*2 + 2 What is the z'th term of 2382, 9842, 22296, 39744, 62186? 2497z*2 - 31z - 84 What is the g'th term of -3224659, -6449313, -9673967, -12898621? -3224654g - 5 What is the a'th term of -70777, -71071, -71363, -71653? a2 - 297a - 70481 What is the p'th term of -81852, -327410, -736672, -1309638? -81852p2 - 2p + 2 What is the n'th term of -153, 155, 431, 675, 887, 1067? -16n2 + 356n - 493 What is the g'th term of 3957, 5476, 6995, 8514, 10033? 1519g + 2438 What is the o'th term of -3932, -31735, -107620, -255761, -500332? -4029o*3 + 133o*2 + o - 37 What is the k'th term of -85703430, -171406860, -257110290, -342813720? -85703430k What is the r'th term of 266074, 1063835, 2393436, 4254877, 6648158? 265920r2 + r + 153 What is the p'th term of 12820166, 51280634, 115381412, 205122500, 320503898? 12820155p*2 + 3p + 8 What is the a'th term of 3428787, 6857574, 10286361, 13715148? 3428787a What is the r'th term of 44982, 44276, 43100, 41454? -235r*2 - r + 45218 What is the g'th term of -320770, -641497, -962224? -320727g - 43 What is the i'th term of -1171661, -4687623, -10547559, -18751469? -1171987i2 - i + 327 What is the p'th term of 1410, -856, -7000, -18960, -38674, -68080, -109116? -323p3 - p2 - 2p + 1736 What is the r'th term of 1347250, 1347435, 1347620, 1347805, 1347990? 185r + 1347065 What is the y'th term of 92087, 92007, 91883, 91715, 91503? -22y2 - 14y + 92123 What is the v'th term of 60896, 60918, 60940? 22v + 60874 What is the j'th term of -185332, -185768, -186202, -186634, -187064, -187492, -187918? j2 - 439j - 184894 What is the j'th term of 30329, 30673, 31017, 31361, 31705? 344j + 29985 What is the t'th term of -1483, -2876, -4137, -5212, -6047? 9t*3 + 12t*2 - 1492t - 12 What is the u'th term of 48300, 48365, 48474, 48627? 22u2 - u + 48279 What is the b'th term of -2322, -9357, -21096, -37539? -2352b*2 + 21b + 9 What is the h'th term of -2206268, -2206144, -2206020? 124h - 2206392 What is the g'th term of -902, -439, 332, 1417, 2822? g3 + 148g*2 + 12g - 1063 What is the q'th term of 2555045, 2555050, 2555055? 5q + 2555040 What is the q'th term of 5539800, 5539777, 5539754, 5539731, 5539708? -23q + 5539823 What is the p'th term of -157038, -156104, -155170, -154236, -153302, -152368? 934p - 157972 What is the n'th term of -1114, -3722, -8078, -14182, -22034, -31634? -874n*2 + 14n - 254 What is the f'th term of -203814161, -203814159, -203814157, -203814155? 2f - 203814163 What is the i'th term of -1021189, -2042394, -3063599? -1021205i + 16 What is the b'th term of 3642, 4275, 4934, 5631, 6378, 7187, 8070, 9039? 2b3 + b2 + 616b + 3023 What is the h'th term of -2124, -8393, -18768, -33249, -51836, -74529? -2053h2 - 110h + 39 What is the x'th term of 3917705, 3917719, 3917733? 14x + 3917691 What is the q'th term of 10653, 21366, 32039, 42666, 53241? -q3 - 14q*2 + 10762q - 94 What is the r'th term of -1406, -371, 3102, 9013, 17362, 28149? 1219r2 - 2622r - 3 What is the g'th term of -56, 832, 2280, 4288, 6856, 9984? 280g2 + 48g - 384 What is the n'th term of 5441, 10949, 16483, 22055, 27677? 2n3 + n2 + 5491n - 53 What is the w'th term of -97, -749, -1837, -3361, -5321? -218w2 + 2w + 119 What is the s'th term of 14456237, 28912472, 43368707, 57824942, 72281177? 14456235s + 2 What is the b'th term of 2246, 1112, -22, -1156? -1134b + 3380 What is the p'th term of 727529, 727610, 727743, 727928, 728165, 728454? 26p2 + 3p + 727500 What is the v'th term of -6572434, -6572438, -6572452, -6572482, -6572534, -6572614, -6572728? -v3 + v2 - 6572434 What is the u'th term of 6496, 18928, 31364, 43804, 56248, 68696? 2u2 + 12426u - 5932 What is the y'th term of 41422, 82236, 123048, 163858? -y*2 + 40817y + 606 What is the h'th term of 2771, 5593, 8413, 11231, 14047? -h*2 + 2825h - 53 What is the b'th term of -300958, -301009, -301060, -301111? -51b - 300907 What is the k'th term of -1865365, -3730715, -5596019, -7461253, -9326393, -11191415, -13056295? 4k3 - k2 - 1865375k + 7 What is the r'th term of -56789, -56678, -56567, -56456? 111r - 56900 What is the s'th term of 269106, 542853, 816600, 1090347, 1364094? 273747s - 4641 What is the k'th term of -13950, -27817, -41650, -55449? 17k*2 - 13918k - 49 What is the d'th term of 1242537, 4970153, 11182843, 19880607? 1242537d2 + 5d - 5 What is the i'th term of -13148, -105268, -355308, -842228, -1644988, -2842548? -13160i3 + 12 What is the w'th term of -8542, -7772, -6480, -4666, -2330, 528? 261w*2 - 13w - 8790 What is the a'th term of -624, -5220, -17524, -41334, -80448? -633a3 - 56a*2 + 3a + 62 What is the x'th term of -236982, -473418, -709856, -946296, -1182738? -x*2 - 236433x - 548 What is the v'th term of -10762, -20723, -37318, -60541, -90386? v*3 - 3323v*2 + v - 7441 What is the l'th term of -25900, -53393, -84066, -119509, -161312, -211065, -270358? -265l*3 - 25638l + 3 What is the j'th term of 182, 1064, 3268, 7418, 14138, 24052, 37784? 104j3 + 37j*2 + 43j - 2 What is the y'th term of 14171, 28546, 43119, 57890, 72859? 99y2 + 14078y - 6 What is the v'th term of 220564, 441123, 661674, 882217, 1102752, 1323279? -4v2 + 220571v - 3 What is the w'th term of 44208039, 88416075, 132624111, 176832147, 221040183, 265248219? 44208036w + 3 What is the n'th term of 2016, -1698, -5422, -9156, -12900? -5n*2 - 3699n + 5720 What is the c'th term of 192937, 387147, 581357? 194210c - 1273 What is the x'th term of -277890, -273496, -266172, -255918, -242734, -226620, -207576? 1465x*2 - x - 279354 What is the y'th term of 222008, 444140, 666394, 888770, 1111268, 1333888? 61y*2 + 221949y - 2 What is the q'th term of -34874840, -34874836, -34874832? 4q - 34874844 What is the s'th term of -8231, -7686, -7141, -6596, -6051? 545s - 8776 What is the u'th term of -12304, -14894, -17518, -20194, -22940, -25774, -28714? -3u3 + u2 - 2572u - 9730 What is the x'th term of 2414, 5117, 8136, 11471, 15122? 158x2 + 2229x + 27 What is the p'th term of -53802, -53828, -53852, -53874, -53894, -53912, -53928? p*2 - 29p - 53774 What is the q'th term of 753, 2995, 6709, 11883, 18505, 26563, 36045, 46939? -2q3 + 748q*2 + 12q - 5 What is the l'th term of 208, 1233, 2788, 4873, 7488, 10633? 265l2 + 230l - 287 What is the q'th term of 32563, 65117, 97651, 130159, 162635, 195073? -q*3 - 4q*2 + 32573q - 5 What is the t'th term of -430872, -1723424, -3877554, -6893160, -10770140? 17t3 - 430891t*2 + 2t What is the w'th term of -27537, -25328, -23119, -20910, -18701? 2209w - 29746 What is the t'th term of -220766, -214950, -209134, -203318, -197502? 5816t - 226582 What is the u'th term of -	{ "pile_set_name": "DM Mathematics" }
+ 8k2 - 47k + 37. Let z(u) = h(u) + p(u). Factor z(o). 3(o - 2)(o - 1)(o + 6) Let x = -1155/194 - -626/97. Determine q so that -9/2q + 0 - xq4 - 3/2q*2 + 5/2q*3 = 0. -1, 0, 3 Suppose 2k + 56 = 6k. Suppose 6v - k = -v. Factor -18w - 12 + 0 + 0 - vw + 8w2. 4(w - 3)(2w + 1) Solve -5489b + 24 - 5b*4 + 10b*2 + 23b*2 + 2b*4 + 5435b = 0. -4, 1, 2 Let q(b) be the second derivative of -b5/100 - b4/6 - 2b3/5 + 36b*2/5 - 65b. Factor q(l). -(l - 2)(l + 6)2/5 Let b = 245 + -242. Let d(x) be the third derivative of -3x*2 + 0 + 0x*4 + 0x - 4/27xb + 1/270x*5. Determine i, given that d(i) = 0. -2, 2 Let i = 5 + -8. Let d = 9 - i. Factor -5 + 4l*3 + dl - 18l2 + l3 + 13 + 0l3. (l - 2)2(5l + 2) Let z(s) be the first derivative of 5s8/336 - s7/21 + s5/6 - 5s*4/24 + 12s*2 - 2. Let h(o) be the second derivative of z(o). Factor h(g). 5g(g - 1)3(g + 1) Let n = -1613848/435 + 3710. Let i = 1154/1305 + n. Factor 8/9g + 2/9g*2 + i. 2(g + 2)*2/9 Let j(r) = 5r - 98. Let b be j(20). Let t(d) be the first derivative of 4 - bd + 4/3d3 - d2. Factor t(m). 2(m - 1)(2m + 1) Let i(k) be the second derivative of -k7/168 - k6/12 - 11k*5/80 + 41k4/24 + k3/2 - 9k2 + 34k. What is v in i(v) = 0? -6, -1, 1, 2 Determine z, given that -11z5 + 34z*5 - 18z*5 + 60z*2 + 45z*4 + 100z*3 = 0. -6, -2, -1, 0 Let q be (-11900)/(-39375) - (46/(-50) + 1). Factor -8/9i*4 + qi*5 + 4/9 + 8/9i*3 + 4/9i*2 - 10/9i. 2(i - 2)(i - 1)*3(i + 1)/9 Let f = 1635 + -11427/7. Find p such that -3/7p + 0 - fp*3 + 12/7p*4 + 12/7p*2 - 3/7p*5 = 0. 0, 1 Let d(o) = 14o*2 + 44o + 38. Let k(f) = 9f2 + 29f + 25. Let j = 22 - 27. Let l(y) = jd(y) + 8k(y). Factor l(n). 2(n + 1)(n + 5) Let b(g) be the first derivative of 7 - 7/24g4 - 11/12g*3 - g - 1/2g*2 + 1/2g*5. Let w(p) be the first derivative of b(p). Factor w(x). (x - 1)(4x + 1)(5x + 2)/2 Let n(o) be the second derivative of o4/24 + 7o*3/12 + 3o*2 - 120o. Find r such that n(r) = 0. -4, -3 Suppose -6p + 2p = -16. Suppose pw + w = 0. Factor wi + 0i2 - 12i*3 - i - 3i - 16i2. -4i(i + 1)(3i + 1) Let r(n) be the first derivative of -7 + 3/14n*4 + 0n - 1/7n3 - 3/35n*5 + 0n*2. Factor r(c). -3c*2(c - 1)*2/7 Suppose z - 7 + 2 = 0. Let g be (20/8)/((-15)/(-6)) - -3. Suppose 1/8j*3 - 1/8j*z + 0j + 0 + 1/4j2 - 1/4j*g = 0. What is j? -2, -1, 0, 1 Factor 2/5y*2 - 22/5y + 0. 2y(y - 11)/5 Let k(q) be the third derivative of q8/168 - q7/35 - 2q6/15 + 4q*5/5 + 4q*4/3 - 16q*3 - 496q*2. Solve k(v) = 0. -2, 2, 3 Suppose 62d = 64d - 14. Let t(g) be the second derivative of -2g*3 + 1/10g*6 + 0g*4 + dg + 0 + 9/20g5 + 0g*2. Factor t(w). 3w(w - 1)(w + 2)*2 Let x = 295 + -291. Let i(s) be the second derivative of 1/72s*x - 1/180s*6 - 1/36s*3 + 3s + 1/120s5 + 0 + 0s*2. Factor i(u). -u(u - 1)*2(u + 1)/6 Determine m so that 3/8m5 - 3/2m*4 - 9/8m + 0 + 3/4m3 + 3/2m2 = 0. -1, 0, 1, 3 Let b(o) be the first derivative of o4/16 - 3o3/2 - 39o*2/8 - 5o + 103. Find l such that b(l) = 0. -1, 20 Suppose 1661 = 5a + 16. Solve 165w*2 - 4w*3 - 2w*5 - aw*2 + 164w*2 - 6w4 = 0 for w. -2, -1, 0 Let s(v) be the second derivative of -v6/72 + v*5/4 - 15v*4/8 + 2v*3 + 6v. Let g(k) be the second derivative of s(k). Factor g(b). -5(b - 3)2 Let b(f) be the first derivative of -3f*2 + 0f + f*3 - 3 + 9/4f*4. Let v(m) = 17m*3 + 5m*2 - 11m. Let w(r) = 11b(r) - 6v(r). Factor w(z). -3z2(z - 1) Let c(s) be the second derivative of -s*4/36 - 23s*3/18 - 7s*2 - 625s. What is w in c(w) = 0? -21, -2 Solve 0p3 + 9p*3 + 15p*4 - 13p4 - p3 + 6p3 = 0 for p. -7, 0 Let a(g) be the first derivative of 2g*5/3 + 59g*4/24 + 19g*3/6 + 17g*2/12 - g/6 - 97. Let a(d) = 0. Calculate d. -1, 1/20 Let c = 32 - 30. Suppose 4s - 6 = c. Factor 4g + 4g*3 + 0 + 6g*s + 0 - 2g*3. 2g(g + 1)(g + 2) Let o(r) = -r*3 + 8r*2 - 6r - 4. Let z be o(7). What is y in -2y4 - 2y*3 - 3y*4 + 2y*2 + 2y*5 + zy*4 = 0? -1, 0, 1 Let p = -43233/5 - -8647. Factor -2/5c*2 + pc*3 + 0c + 0. 2c2(c - 1)/5 Let g(v) be the first derivative of -v6/45 - v5/30 + v*4/9 - 5v - 10. Let h(x) be the first derivative of g(x). Determine u, given that h(u) = 0. -2, 0, 1 Factor 0 + 20/7q2 - 12/7q - 4/7q4 - 4/7q*3. -4q(q - 1)2(q + 3)/7 Let a(k) = -k*3 + 8k*2 - 22k - 4. Let f(n) = -n*2 + n - 2. Let h(i) = a(i) - 2f(i). Suppose h(c) = 0. What is c? 0, 4, 6 Let v = -24572 - -24577. Factor -3/7r4 - 1/7r*v + 0r + 0 - 2/7r3 + 0r2. -r3(r + 1)(r + 2)/7 Suppose -5q + 10 = 30. Let c(o) = 6o*2 + 6o. Let b(r) = -3r - 7r*2 + 3r - 7r. Let d(k) = qb(k) - 5c(k). Factor d(l). -2l(l + 1) Factor 0n - 1/6n4 + 0 - 7/6n*3 - 5/3n2. -n2(n + 2)(n + 5)/6 Factor -3/2h2 + 0 - 6h. -3h(h + 4)/2 Let m(s) be the third derivative of -s8/70560 - s7/17640 + s*5/4 - 16s*2. Let i(n) be the third derivative of m(n). Factor i(g). -2g(g + 1)/7 Factor 2/9c*2 + 2/9c*4 + 0 + 0c + 4/9c3. 2c*2(c + 1)*2/9 Let l be 1(-13 - (0 - 8) - 150/(-26)). Factor 4/13 - 2/13n4 - ln + 2/13n3 + 6/13n*2. -2(n - 1)*3(n + 2)/13 Let f = 283 - 286. Let k be f/(-8)34/9. Determine x so that -1/2x2 + x - k = 0. 1 Let t = 14 - 4. Suppose -5g = t, -g = v + 4g + 8. Factor 3u*2 + 1 - 2u*2 + vu + 0u2. (u + 1)2 Let l = 2/5083 + 20326/15249. Let v(y) be the second derivative of -6y + 0 + ly3 + 1/20y*5 + 5/12y*4 + 2y*2. What is p in v(p) = 0? -2, -1 Suppose 52w = 7182 - 2190. Determine s, given that 3/2s2 + w + 24s = 0. -8 Let d(l) = -15l4 + 55l*3 + 235l*2 + 255l + 90. Let r(q) = 23q4 - 82q*3 - 352q*2 - 382q - 135. Let j(t) = 8d(t) + 5r(t). Factor j(u). -5(u - 9)(u + 1)*3 Suppose 5y + m = 16, -4y - 49m + 14 = -47m. Factor 4/5z*2 + 0 + 0z - 2/5zy. -2z*2(z - 2)/5 Let b(v) be the first derivative of -v5/30 + v3/6 + v*2/6 + 8. Determine w, given that b(w) = 0. -1, 0, 2 Let j be 48/(-120)(-2 + 16/(-2)). Let v(o) be the first derivative of 0o + 0o2 - oj + 8/3o3 + 8. Factor v(d). -4d*2(d - 2) Suppose 3b = 5u - 9, -3u - 5b - 49 = -34. Factor -4/13t3 - 2/13t*2 + 4/13t + u + 2/13t4. 2t(t - 2)(t - 1)(t + 1)/13 Suppose -272q + 4 = -270q. Let g(y) be the first derivative of 9y*2 - 21/8y*4 + 6y - q - 9/2y3. Let g(a) = 0. What is a? -2, -2/7, 1 Let u(m) be the third derivative of m7/1260 - m6/135 + m5/45 - 7m3/6 - m2. Let s(x) be the first derivative of u(x). Solve s(d) = 0 for d. 0, 2 Let c(a) be the first derivative of 7/5a5 + 8a*2 - 13 + 1/6a*6 + 19/4a*4 + 25/3a*3 + 4a. Determine d so that c(d) = 0. -2, -1 Let u be ((-272)/184)/17-23. Factor 2/9g*3 - 2/9g*u + 1/9g*4 - 1/9g - 1/9g5 + 1/9. -(g - 1)3(g + 1)*2/9 Let c(n) = 21n*2 - 9n - 4. Let x = 69 + -43. Let s = 52 - x. Let p(h) = 5h2 - 2h - 1. Let y(l) = sp(l) - 6c(l). Determine i, given that y(i) = 0. -1, 1/2 Let r be ((-39)/9 - 1)(-9)/6. Solve -4i*5 - ri*4 - 28i*3 + 16i*4 + 16i*2 + 8i*5 = 0. -4, 0, 1 Let u(i) = 327i - 19618. Let y be u(60). Determine o so that 1/3oy - o - 4/3 = 0. -1, 4 Suppose 0 = -5p + 5v + 15, v = -0v. Determine l so that 3 + 0l3 + 0l3 - lp - 7l - 3l*2 + 8l*2 = 0. 1, 3 Suppose -9q + 94 - 31 = 0. Let o(t) be the second derivative of t*4 - 4/15t*6 + 1/7t*q + 7t + 1/3t3 - 2t*2 - 2/5t*5 + 0. Let o(i) = 0. What is i? -1, -2/3, 1 Let c = -6773 + 27137/4. Factor -3/2p*3 - 69/8p*2 - cp + 27/8. -3(p + 3)2(4p - 1)/8 Factor 60w*3 - 440w + 4w4 - 72w*3 + 488w - 16w2. 4w(w - 3)(w - 2)(w + 2) Let h be 85/21 - (5 + -2 + 1). Let v(t) be the first derivative of 2/7t*2 + 1 - 3/7t - ht3. Suppose v(u) = 0. What is u? 1, 3 Solve 200/3z + 5000/3 + 2/3z2 = 0 for z. -50 Let n(t) = -5t*2 + 117t - 100. Let u(m) = -15m2 + 352m - 295. Let r(p) = 7n(p) - 2u(p). Factor r(x). -5(x - 22)(x - 1) Let o(l) = l*3 + 5l - 9. Let v be o(0). Let n be (-33)/v + (-11 - -8). Factor 0 - 8/3w + nw*2. 2w*	{ "pile_set_name": "DM Mathematics" }
1)/w))(7/2))22)(-2/17) assuming w is positive. w(-48/17) Simplify (((m*3mm)/m)(-14/11))(-36)(m/((m/m(6/5))/m))/(m(-8)/m)(m(-1/4))45 assuming m is positive. m(40309/220) Simplify ((vv/v*(-10)vv(1/15)vv(-8)/(vvv(2/3)/vvv))(4/25))(3/2) assuming v is positive. v(72/125) Simplify (j(-1/9)j/(j/((j*(2/3)j)/j))j)/(j/(j/(j/(jj/j*(2/9))))j*(2/17))((j(-1/2))(-11/3))(-29) assuming j is positive. j(-5197/102) Simplify (j(1/4))(-3/2)/(j/(jj(1/2))j*(2/11))((j/(j/(j/(j*2/jj)))j)/(j(j/j(-5))/j))(-4/19) assuming j is positive. j(2017/1672) Simplify (g41g23(g((g/g36g)/g)/g)/(g/g(-43)))48 assuming g is positive. g(-720) Simplify (v(-1/2))40/(v/v(2/5))*(-1/4)(v*(-7)v/(v*(1/14)vv)v)(-5) assuming v is positive. v(2171/140) Simplify (((b2/b)/b(-1/2)bb*(1/3)bb(-2/3)b)(-1/29))36 assuming b is positive. b*(-150/29) Simplify rrrr/(r/(rr/(r/(rr*(1/5)/r))))rrr*5r/r*(-4/3)rr(1/2)/r((r/r0)/r)/(r/r(-4))r/(r/(r(1/6)/r))rr/r(-9) assuming r is positive. r(96/5) Simplify ((o29o(-6/13))/(o/o6o)(-1/22))(2/3) assuming o is positive. o(8110/429) Simplify ((i(-2)ii9i)/(i*(6/7)ii25))(-1/53) assuming i is positive. i(125/371) Simplify (((x(-2)/x(-11))(3/50))(12/11))(2/9) assuming x is positive. x(36/275) Simplify ((r/r(1/4))30)(-1/22)/((r/r0)(-1/2)(r*(-1/3)r)(-1/8)) assuming r is positive. r(-29/66) Simplify ((q/((q/q(19/2))/q))/(q(4/27)q))/(q/(q/q34))(-36) assuming q is positive. q(66601/54) Simplify d(1/6)/(d/(d(-1/5)d)d)(d(-1/4))27((d(1/2)d)(-1/5))(-6/17) assuming d is positive. d*(-7831/1020) Simplify ((i/((ii*(-2)ii)/i))(-2/33)ii(-3/2)i/((i*2/ii)/i)i)/((i4(ii/i(1/4))/i)/((ii(2/13))/i1)) assuming i is positive. i(-7133/1716) Simplify (l/(((l/(((l(-12)l)/ll)/l))/l)/l)l47/l)/(l/(ll/l(-42)))(1/25) assuming l is positive. l(943/25) Simplify ((c(2/7))3/(c/c(-1))*(-2/3))/((c/(cc*1c))(-3/26))43 assuming c is positive. c(-2111/273) Simplify (v(-2/7))(-8)/(v(1/5)(vv*(-4))/v)v*(-1/7)/vvv(-1)v*(-3)/vv(2/7) assuming v is positive. v(43/35) Simplify ((j(24/11))(4/3)/(j*21j)19)(-4) assuming j is positive. j(18264/11) Simplify ((f(-2/3)/f)(-2/17))(-2/121)/((ff(-1/2))10)(1/10) assuming f is positive. f(-6211/12342) Simplify ((w/w(-2/3)w)36/((w(-2/11)www)/(w/w(1/4))))/((w(-1/4)/((w/w(-1/2))/w))/(w(2/3)/(w(-5/4)/w))) assuming w is positive. w(12883/132) Simplify ((x(-2/11))(-15)/(x(-6)x)(-2))31 assuming x is positive. x(-2480/11) Simplify (((l(-3)/(l/((l*(2/5)l)/ll)))/(((((l4l)/l)/l)/l)/l(-3/2)))(-9/4))22 assuming l is positive. l(6039/20) Simplify (k*(-1/4)k*(-4)k)*(-19)((k*2k)(-19))(-29) assuming k is positive. k*(6859/4) Simplify (((cc/(c/c*(5/6))c)/c)/cc/(c(1/5)c)cc(-8)/c10)(3/2) assuming c is positive. c(-491/20) Simplify (i4/(i(-2)ii))*(-11/4)(i/i*8i/i*9i)(-1/5) assuming i is positive. i(-41/5) Simplify ((i(ii/(i/i*(1/8)))/iii)/((((i/i21)/i)/i)/ii)i(2/11)i(-4))(2/9) assuming i is positive. i(625/132) Simplify ((((j/((j13j)/j)j)/j)/j)/(j/j(-1/38)))/(j34/j35) assuming j is positive. j(-495/38) Simplify ((ii/((i(-9)/i)/i)i)*(23/6)/(i(i(i7/i)/i)/ii(8/3)))46 assuming i is positive. i2070 Simplify ((g(-2/3))6/(((g3g)/g)/(g3g)))/(g*3/(gg/(g*0gggg))(g(2/19)/g)/(g(-5)g)) assuming g is positive. g(-211/19) Simplify ((u/((uu(-1))/u))(-1/3))14/(u(4/5)((uu/u*(-8))/u)/u((uuu*(1/3))/uu)/(u/(u(-6)/u))) assuming u is positive. u(-187/15) Simplify (k/(k*(5/3)kk)k/(k/(k(k/((k(1/13)/kk)/kk))/kkk))k*10k/k(-1/7))(2/85) assuming k is positive. k(6224/23205) Simplify (((z/z0)/zzz/(z/z*(2/5)))/(zz(-1))(-1/14))/(z*(-1/5)z*(-1/8)(zz(-1)zz)45) assuming z is positive. z(-3531/40) Simplify (k(2/11)kkk*6kkk*3/k(k*(-1/11)k)/k)/((kk(-3)k/(k/(k*(-2/3)kk)))/(k(-4)((k/(kk(-4)))/k)/k)) assuming k is positive. k(355/33) Simplify (q/(q/(q(-37)/qqq)q)q(-36)q/q*16q*39q)(-26) assuming q is positive. q1248 Simplify (((tt(1/2)tt)/t)(2/63)(t(-1/5))(-17))(-22) assuming t is positive. t(-24112/315) Simplify (b*0b(1/2))(-19)/(((b/(b/(bb/(b2b))))/(b(b/(b(b/b*1)/bb))/b))/(b*0b4)) assuming b is positive. b(-9/2) Simplify ((t(t(-6)t)/t)(3/13)/(t(-19)/(t/(t(t(-8/5)/t)/t))))(-3/7) assuming t is positive. t(-4182/455) Simplify ((z(1/8))(-46)(zz(-5)z)(-3/20))(-38) assuming z is positive. z(1007/5) Simplify (((f(-2)f)/(ff/f*(1/8)ff))/((f(ff(14/5))/f)/(f/f(5/3))))(-2) assuming f is positive. f(1121/60) Simplify y/(y/y(1/4))y*(-6)(y/((y/(y/y*(-3)))/y))/y(yy(-2/7))/y((yy(y*(-2)y)/y)(-11))(-16) assuming y is positive. y(-57/28) Simplify ((n(2/3))*(-36)/((nn(-7))/(n/((n9/n)/n))))/(((n2/n)/n)(2/15)/(((n/n*(2/7))/n)/nn)(-4/15)) assuming n is positive. n(-2512/105) Simplify (o*(-1/6)/oo*(1/12)(o(-1))(-39))/((o/(o/(o/o*(-4/5)oo)))/(o/(o(7/2)/o)))(-30) assuming o is positive. o(2363/12) Simplify (dd(d/(d/(d(ddd(dd/(d/(d(d39d)/d))d)/dd)/d)d)d)/d)*(-2/3)(dd/d(-1/68))(-14/3) assuming d is positive. d(-4087/102) Simplify (l(4/3)ll/(l/(l/(ll*(-27))))(l*(-12)l)17)(1/4) assuming l is positive. l*(-473/12) Simplify ((d(d/d(1/3))/d)/(d/d(-4))d/(d(-4)dd)d*(-1/2))/(d/(d(d*(-3)/d)/dd)d(-1)(ddd/(dd(1/4)))/(d(-2)/ddd)) assuming d is positive. d(-91/12) Simplify (o(-2/43)oo11oo(-1/4)oo(-11)o)37 assuming o is positive. o(23569/172) Simplify ((n/n*(-6)nn)/n(-11)(nn(-16))/n2)2 assuming n is positive. n6 Simplify (((n/(nn*(-2/23)nn)n(-4))/((n(-1/8)n)/n(1/5)))(-4/11))45 assuming n is positive. n(4959/46) Simplify ((hh*(-1/3))/((h/(hh(-24)/h))/h))/((h(-11/5)/h)/hh)(-3/19) assuming h is positive. h(-6794/285) Simplify (o(5/4)/ooo)/(oo*(-2/53))oo(-1)oo(o*(-15/2)o)/o assuming o is positive. o*(-893/212) Simplify ((ww0/w)19)(-2)/(w(-3)/ww(-7/2))(-2/53) assuming w is positive. w(-15/53) Simplify g(2/15)/(gg*1)(g1/g)(-2/19)((g1)(-3/4))(2/5) assuming g is positive. g(-13/6) Simplify ((p4pp/(p/((p/p9)/p)))/((pp*5)/ppp(-1/6)/p))/(p4p/(pp/p11)p)34 assuming p is positive. p(-3113/6) Simplify ((v1)0)*(2/67)(vv2v/(v/(vvv*7/vvvv))vv)(2/29) assuming v is positive. v(32/29) Simplify ((l(-3))(-9)/((l*(-4/15)l)/l(-2/3)))(-29) assuming l is positive. l(-3712/5) Simplify (t/t(1/9))/tttt(t/((t*30/t)/t))/ttt(-13)tt/t(-16)t assuming t is positive. t(-163/9) Simplify ((l/l(-2))*(-28)l*3l6)/((l0)*(-14)((ll(ll(1/4))/ll)/l)(-48)) assuming l is positive. l33 Simplify (q*(-13)q*26)/((qqq43)/q)31 assuming q is positive. q(-1351) Simplify (g1)(-1/12)((g/(g*(-1)/g)g)/g)*4((gg10)/ggg(-5))(-1) assuming g is positive. g(71/12) Simplify ((k4k(-1)/k)/(k(-1/4))(-27))/((k/((k(2/5)k)/k)kk)(-8)/(k(-4/7)/k(-4))) assuming k is positive. k(2727/140) Simplify (p2/p(-3))/((p/((p/((pp/(p/(pppp/(pp*(2/7)p))p))/p))/p))/p(-4))(p(-2))38(p/p(2/15)ppp)/pp(-9/5) assuming p is positive. p(-7943/105) Simplify ((h(2/7))(-21)/((h(h/h*(2/5)hh)/hh)/((hh(-6)hh)/h)))/(h/(hh/(h/(h*(-5)/h))h)h7h)(32/5) assuming h is positive. h(-484/5) Simplify (p(2/21)/(p(-4/17)p)(p((p(-6)/p)/p)/p)28)(5/7) assuming p is positive. p(-401035/2499) Simplify ((u(4/9)u)(-23/5)/((u(-4)/u)/u)(1/21))(-9) assuming u is positive. u*(2003/35) Simplify ((g(gg(-1/5)g)/g)/(g/(g6/g)))(-44)/(g*(-2)/(gg*5g)(gg*(1/2))/(gg(-1/12))) assuming g is positive. g(-14807/60) Simplify (q(1/4))3(q(1/2)/q)/q(-6)((q/(q*8q))/(qq/q(1/6)))33 assuming q is positive. q*(-1273/4)	{ "pile_set_name": "DM Mathematics" }
+ 3 = -5j - u for j. -1 Suppose -49 = 5w + c - 163, w = c + 24. Solve -w = -5h + k, -h = h - 3k - 4 for h. 5 Let w(n) = n*3 + 8n*2 + 12n + 7. Suppose -5b - 45 = -3s, 3s - 9 = 6. Let q be w(b). Solve -2y = 5l - 27, -l - qy = -2y - 10 for l. 5 Let b be -2 + (-1 - -9 - 2). Suppose -10 + 131 = 11s. Suppose -j + s = 2j + 5q, 3j = -3q + 9. Solve 0 = z, -bz = jc - 5 - 3 for c. 4 Suppose -2a + 5 + 11 = 0. Suppose 4v + 7 = -1, 4p + a = -4v. Let n be (-28 - (-53 + 31))/((-4)/10). Solve p = -w + 6w - n, -5i - 3w = -14 for i. 1 Let d(s) = -2 - s + 1 + 0s. Let h be d(-6). Suppose -37k + 41k = -l + 25, 0 = 4l + 12. Solve j = 5t + 6, -2t - 17 = hj + k for t. -2 Let h = -29 - -29. Suppose -7j + 14 = -hj. Solve -js + 5y + 9 = -5s, -19 = -5s + 3y for s. 2 Suppose -2 = -2c - 0b - 2b, -3c - 2b + 2 = 0. Suppose s + cs - 4 = 0. Let w be 1/(-1) - (-48)/4. Solve 6x - 2x + 12 = 0, x = -sh - w for h. -2 Suppose 0 = 3k + 10k - 39. Solve -t + 2i + 8 = -5t, t = ki - 16 for t. -4 Suppose -2n - 3n = -20. Let h be 21/n - 1/4. Solve -z = -0v + 2v + 10, -5v + hz = 10 for v. -4 Let a(q) = 138q - 1081. Let s be a(8). Solve -2n - v = -3 + 1, -5v + s = -3n for n. -1 Suppose 8k = -8k + 144. Let m(g) = -g3 + 5g*2 + 3g - 5. Let c be m(4). Solve -3p = k, -b = 3b - 5p - c for b. 2 Suppose 0 = d - 3o - 3, -5d = -2o + 6o - 34. Solve -3m = -5v - d + 2, -4m - 2v = -14 for m. 3 Suppose 4j - 4m + 15 = 5j, -5j + m = -12. Suppose -10 = -2d - c, -jc + c = 2d - 10. Let y = 4 - -1. Solve 0h - 5w = -2h - 33, -d = yh + 3w for h. -4 Let w be (4 - 40)/(6/(-4)) - 4. Suppose -16 = -4m + w. Solve 3s - 23 = 2s + 5a, 0 = s + 3a + m for s. 3 Let t be 35/21 - (-84)/9. Let m(j) = j - 7. Let k be m(t). Solve ko = 3z + 16, 0 = 4o - 9o - 2z - 3 for o. 1 Let g = 23 + -19. Suppose 0 = 3d + 4i - 6i + 2, -2i = -2d - 4. Let c be 8/(-16) + 41/d. Solve 0 = -4w - gl + c, 4w - 5l - 8 + 33 = 0 for w. 0 Let m be (1 - 0) + 74/2. Let g = m - 34. Solve -8 + 1 = -ga + h, 3h = -3a + 9 for a. 2 Suppose -4m - 43 = -15. Let p = m - -11. Suppose 22d = -21d + 215. Solve -df + 26 = px - 10, -5x = 3f - 32 for f. 4 Let i(l) = l*2 + 18l + 4. Let s be i(-18). Solve -3m + 7m + 3p = 15, 5m = sp + 11 for m. 3 Let z = -68 - -73. Suppose -5i + 14 + 11 = 4h, 25 = zi. Solve -f + 4p - 17 = h, 5f - 6p + 37 = -2p for f. -5 Let j = -282 + 284. Solve 0 = ju - n - 3 + 7, 0 = 2u + n for u. -1 Let g(u) = -u2 + 4. Let a = 0 - 0. Let k be g(a). Let s(l) = -l3 + 37l + 3. Let w be s(0). Solve v + 10 = -5c, 22 = -kv - v + wc for v. -5 Let n be (3 - 5) + 1 + (-30 - 0). Let v = -29 - n. Solve -y - 5j = 1, vy + 2 = -0y - 2j for y. -1 Let w = 17 + -16. Suppose -2g + 11 = -w. Let u be (8/g)/(2/3). Solve 0 = -3y + 4r - 8, -5r = -ur + 3 for y. -4 Suppose 3i - 14t - 22 = -12t, -2i = 5t - 2. Solve -s - i - 4 = 4x, -2s = -4x - 4 for x. -2 Let v be 1 + (-14)/216. Let d(o) = -3o - 1. Let z(j) = 2j + 1. Let i(u) = -2d(u) - 5z(u). Let f be i(v). Solve 0b + 3b + f = 0, 21 = -5c - 2b for c. -3 Suppose -5h + 3l + 4 + 5 = 0, 4l - 20 = -4h. Suppose hg + 4 - 1 = 0, -5g = -4f + 45. Solve -5j + 5k = f, -2j = k - 4k + 3 for j. -3 Suppose -4c - 3y = 48, 2c - 7c + 4y - 29 = 0. Let p = c + 13. Solve -d - 5f = 8, pd + f = 2d - 7 for d. -3 Suppose 102i - 224 = 70i. Solve -if - 8 = -4a - 6f, -5a + 4f = -21 for a. 1 Let d(l) = -l*3 + 6l*2 - 4l + 1. Let t = -11 + 16. Let w be d(t). Suppose 0 = -5q + 7q - w. Solve -qu - 8 = 2p, -p + 8 = 3u - 3p for u. 0 Suppose -123x + 131x = 40. Solve -5v + 40 = -4q, -xq + 0q = -v + 29 for q. -5 Suppose 5b + 3u = 27, 5b - 2u - 34 = 2u. Suppose -5l = -3l - b. Let p = -3783 + 3785. Solve -2w = lh - 15, -ph = -2w + 3w - 10 for w. 0 Suppose -5d = 2v - 3 - 26, -4d + 18 = -v. Suppose b = dk + 4b + 12, 2b = 2. Let p be 9/k + (6 - -2). Solve -3m + 0 + p = 4i, -m - 3i = -5 for m. -1 Let u = -166 + 186. Solve -k + 3 = -4h + 5h, -u = -4k for h. -2 Suppose -19 = 3d - 25. Solve -dt - 2h = 16, -3h = -2t - 0h - 1 for t. -5 Suppose 27q = 20 + 34. Let z = 1 + -1. Solve 5f - n - 10 = z, qn - 19 = -4f + 5n for f. 1 Suppose 0 = 211q - 207q - 12. Solve qj + 11 = -4a + 2j, -a = -2j + 5 for a. -3 Let k be 1/(2/(-24)-1). Suppose -9z + 39 = k. Solve -za + 2g - 23 = 0, 6a - 5g = 3a - 35 for a. -5 Suppose 3n + 28n = -21n. Solve -5t - 29 + 9 = n, -w - t - 6 = 0 for w. -2 Let i be 36/(-252) + (-1 - 128/(-14)). Solve -3p = 3v - 4p + i, -36 = 5v + 4p for v. -4 Suppose -24l + 95 = -193. Solve j = 5d - 10, 4j + 4d = -l - 4 for j. -5 Let o = -1 + 3. Suppose -4p = 2b - 20, p + 11 + 2 = 4b. Suppose om = -2q + m + 35, 75 = 3q - pm. Solve 3h + q = 4t, -5h = 2t + 4 + 12 for t. 2 Let c(p) = -p*2 + 4p - 3. Let f be c(3). Let n be 7 - 5 - (0 - -2). Suppose 2 + n = o. Solve 2g + 6 = f, g + o = 5d - 6 for d. 1 Suppose -14 = -4h - 2i, -3h - i = 3i - 18. Solve 3n - 4 = -2v + 3v, h = 3n - 2v for n. 2 Let x be 4-1 - (-8 - 7). Suppose j - x = -3r, -13 = 5r - 5j - 38. Solve 5b - 5p + r - 34 = 0, 3b = -5p - 6 for b. 3 Let s = -45 - -47. Let v be 324/33 - (-10)/55. Suppose 4c + 2 - v = 0. Solve 0 = 2z + sp, 4z = -3p - 0 - c for z. -2 Let x = 404 + -400. Solve -3l - 2f + f = -11, -xl - 4f = -28 for l. 2 Let u be (6/(-9))/((-4)/114). Let k be (18 - -3)(15 + -14). Let a = k - u. Solve -2h + 20 = -2y + ah, -3y - 4h = 0 for y. -4 Let d(l) = -2l + 21. Let n be d(9). Suppose -4u = 2r + 4, -nr = -2u - 2 + 16. Let v be (-171)/(-38) - u/2. Solve -3j + j - 4 = 0, 2f + 3j = -v for f. 1 Suppose 38 + 62 = -5w. Let o = 23 + w. Solve 5k = 3r + 26, -r = -4r + ok - 18 for r. -2 Suppose -2o + 1 + 9 = 0. Suppose -7b - 12 = -ob. Let f be (1 - 1)/(b + 10). Solve 0 = -r - 3r + 4c + 28, -4r + c + 13 = f for r. 2 Suppose 0 = -5h + 3n + 34, -h - 1 = -0h + 2n. Suppose 4b = hb - 14. Suppose 8 = -2p + b. Solve v = 2z - 1, -5v - 4z + 14 = -pv for v. 3 Let n = -56 - -56. Let w(b) = b*2 - 7b + 9. Let j be w(6). Suppose -14 = -u + 2h, 0u + h - 3 = -2u. Solve -2c = q + u, -13 = jc - 2q - nq for c. -3 Suppose -2o + 9 = o. Suppose -ot + 13 = k, -4k + 39 = k + 2t. Let u = k - 4. Solve 0 = a - 2p - u, 3p = -5a + 3a + 6 for a. 3 Suppose 4c - 3c + 2f = 7, 4c - 2f = 18. Solve -q - 2 = -0p - cp, p + q - 4 = 0 for p. 1 Let k be 67 + -70 + -5(-1)/1. Solve -2r + 3c = 5c + 4, r = -kc - 6 for r. 2 Let i = -4141 - -4141. Let k(a) = -a + 1. Let c be k(-1). Solve i = -cd + 2b - 1 + 11, -5b = -3d + 23 for d. 1 Let i(f) = -8f - 134. Let k be i(-17). Solve -kp + s = 3p - 2, 2s = -4p + 10 for p. 1 Suppose 3x + z - 71 = 0, 21 = x + z - 2z. Let g(h) = h*3 - 25h*2 + 47h - 19. Let i be g(x). Solve c - 3 = -0p + 2p, 0 = ip - 3c + 3 for p. -3 Let j = -12 + 13. Let w = j - -3. Let o be (5 + (-50)/(-15))3. Solve c + 4c = 3p + 15, -wc = 5p + o for c. 0 Let h(p) = 2p2 - 2. Let g be h(2). Let r(q) = q2 - 5q + 10. Let l be r(3). Solve -4x = -8x - 5z + 26, -5z = -lx + g for x. 4 Let s(k) = 17k - 63. Let j be s(4). Solve -3y = 2a - 10, -jy + 15 = -5a - 10 for a. -1 Let l(i) = i3 + 13i*2 + i + 17. Let d be l(-13). Suppose u + c = -u + 3, 0 = -4c + d. Suppose 5r = -u + 21. Solve -rz - 4 = 4f, 0 = -z + 2 for f. -3 Suppose -52c + 15 = g - 57c, 2c + 6 = -3g. Let o(h) = -h2 + 8h - 9. Let n be o(6). Solve -nl = -6, g = k - 3l + 4 - 0 for k. 2 Suppose -7c + 7 = -3c - z, 0 = -5c + 4z + 6. Solve 3 = 3y, 0 = -ci + 2y + 1 - 5 for i. -1 Suppose 3x + q + 2q = -54, 4x + 5q + 72 = 0. Let h = -10 - x. Suppose -2m = -h - 0. Solve -y - 15 = -4c + 1, -5y - mc = -16 for y. 0 Let w = 11 + 11. Let y = 74 + -69. Suppose -3z - 2b + w = y, 2z + 4b = 22. Solve -6 = -zj - 0j + i, -5j - 5i = 10 for j. 1 Let c be 6 + (7 - (5 - 3)). Suppose -c = -2x - 5. Solve 0m = f - 5m + x, 4f = 2m - 12 for f. -3 Suppose -l = 5b - 27, -3l + 2b = 6b - 26. Solve -2 = lr, 0d + 5r = -3d - 5 for d. 0 Suppose 5u - 1 = 3z, 10 = 2z - 0z + 2u. Suppose -6 = -4t + 2. Let j(p) = 2p. Let o be j(2). Solve -2 = -3w - tf + f, ow + z*f = 6 for w.	{ "pile_set_name": "DM Mathematics" }
(-4))) prime? True Let c(r) = 621r + 8. Is c(1) a prime number? False Let z = 2158 + 135. Is z prime? True Is (-5 - 24/(-6))/5-15545 prime? True Suppose 2x = -j + 1639, -2x = -5j + 7097 + 1062. Is j prime? False Suppose -d + 779 = -2v, -2v - 3v = 3d - 2326. Suppose -11c + d = -8c. Is c prime? False Let y(b) = 13b*2 + b + 3. Let v = -4 - -9. Let a be y(v). Let n = -30 + a. Is n prime? False Let b be -27(-21 + (-182)/(-6)). Let q = 1452 + b. Is q composite? True Let t(w) = 47w + 1. Let r(q) = -q3 - q2 + 2. Let h be r(0). Let s be t(h). Let j = s - -174. Is j prime? True Let c(a) be the third derivative of a*4/24 + 3a*3/2 + 5a*2. Let i be c(-7). Suppose -5n = -4k + 43, i = -k - 3n - 0. Is k a prime number? True Suppose -3l + 0l = 4y + 102, 0 = 5l + y + 187. Let k(r) = r3 + r2 - r - 1. Let x be k(4). Let a = l + x. Is a a composite number? False Let h(q) = 3739q2 + 2q + 2. Is h(-1) composite? False Let b(z) = 3z + 12. Let j be b(-6). Let x(m) = -3m - 7 + 4m + 2m + 4m2. Is x(j) prime? False Suppose 6 + 9 = 3g. Suppose -3o - 12 = -v, -go + 2v = -8o - 3. Is 3 + o + 32 - -1 prime? False Let h be (-1)/7 - 4296/(-84). Is (-2694)/4(-34)/h a prime number? True Let s = -368 + 930. Suppose -6u + 104 + s = 0. Is u composite? True Suppose 5n + 122630 = 5w, 0 = 22w - 17w - 3n - 122632. Is w a prime number? True Let f = -81 + 35. Let w be (28/(-8) - -1)f. Let t = -82 + w. Is t a composite number? True Suppose 2h = 5h. Let a(y) = y3 + y2 - 138. Let i be a(h). Let t = 8 - i. Is t a prime number? False Suppose 80 = 5v - v. Suppose 0 = -3g - 2g - v. Is 1559/(1 - 0) - g a prime number? False Let l = 122 - 16. Is l prime? False Let w(a) = -a3 + 6a*2 - 14. Let l be w(6). Let h = l - -91. Is h a composite number? True Let p = 16 - 28. Let h(v) = 15v - 7. Let w(q) = -15q + 5. Let g(k) = 3h(k) + 4w(k). Is g(p) a prime number? True Let y(f) = 136f + 39f - 22 - 35 + 18. Is y(8) prime? True Let g = -238 + 149. Let x = 219 + g. Suppose -3b + 35 = -x. Is b composite? True Let l be 2881/603 + ((-4)/(-18) - 0). Let j(v) = -v*2 + 6v - 4. Let s be j(4). Suppose f - 13 = -sr + 2r, -lr = -5f - 25. Is r prime? False Let b(h) = 4h + 15. Let o be b(-3). Suppose om - 3800 = -161. Is m prime? True Let x = 84 - 68. Let u(d) = 45d - 49. Is u(x) a composite number? True Let f(b) be the second derivative of -b4/6 - b3/6 + 1343b*2/2 - 13b. Is f(0) a prime number? False Let z be ((-9)/(-18))/(2/60). Suppose 17s - zs = 2078. Is s composite? False Let u = -3 + 6. Suppose -6o = -uo. Suppose 2h = 4q + 78, 4q - 70 = -2h - oh. Is h composite? False Suppose -32209 = -10p + u, 4u + 2030 = 3p - 7629. Is p composite? False Is (2255/(-22))/5(-45 + -1) a prime number? False Let u(j) = j + 2. Let g be u(2). Suppose -3s + 135 = -3o, -2s = go - 80 - 16. Suppose -2w = 2w - 12, 3w = -f + s. Is f composite? False Let a(v) = -1322v + 13. Is a(-2) composite? False Let a = 11 + -45. Let q = a - -38. Suppose -2l + 2b = l - 1567, ql - 2090 = 3b. Is l a composite number? False Let l = 16 - 13. Suppose 0 = -5m + 2 - 7, 2m = lf - 11. Suppose 4r = -fs + 41, 5 = -r + 2r. Is s a composite number? False Suppose 4j + 24 = 24. Suppose j = 9b - 3514 - 5108. Is b a composite number? True Suppose b = -5q + q + 33926, -2q + 4b = -16972. Is q a prime number? False Let i = 17484 + -9261. Is i a prime number? False Let b be (-1)/((12/(-21))/4). Is (-8 - -1)(b - 10) a composite number? True Let h be 4/14 + 48150/35. Suppose -h = -2l - 0l. Suppose -3v + l = 79. Is v prime? False Let k be (-12 - -11)/(2/6). Is (-3)/k + (-612)/(-2) prime? True Suppose 7 = -2l - v, 2v + 3v = -4l - 29. Is (11/33)/(l/(-7893)) a composite number? True Suppose x + 2f + 2f + 2 = 0, 4f + 4 = 0. Let t be (3 - -396) + (-3 - -1). Suppose n - x = 0, 2n + t = 2i + 103. Is i a prime number? True Let v(q) = 782q*2 + q - 116. Is v(-11) a composite number? True Let b = 60 + -30. Let s = -25 + b. Suppose 4g = sz - 12 - 114, -2z + 5g + 47 = 0. Is z prime? False Is ((-2)/10)/((-47)/4427165) composite? False Is (-34670)/((-1)/(-2)-4) prime? False Let q(u) = u*3 - 7u*2 + 4u + 17. Let j be q(6). Is j2/20(1115 - 1) a prime number? True Suppose 2o - 3f - 57031 = 16542, -5o + 4f = -183915. Is o a prime number? True Let j be 5 + 1(-2 + 3 + -3). Suppose 4r + jt - 1831 - 3019 = 0, 4r = 3t + 4838. Is r a prime number? False Let l(j) = -69j - 51. Let k be l(-17). Let x = k - -1331. Is x a composite number? True Let c = -32 - -36. Suppose g + 5244 = 4y + 1612, -2g = -cy + 3636. Is y composite? False Suppose -7i + 24719 + 3792 = 0. Is i a prime number? True Suppose -4c = -5t - 10 + 32, -2t + c + 7 = 0. Suppose 0 = -tr + 463 + 731. Is r composite? True Suppose -15t + 14t + 2g = -1065, 0 = t - g - 1067. Is t prime? True Suppose -6 = -t - 4k - 26, -k = t + 5. Is (88 - -1) + (-1 - (t - -3)) composite? True Let x(t) be the third derivative of t5/12 + t4/24 - 5t3/2 - 6t*2. Let p be x(14). Suppose 11a = 12a - p. Is a a composite number? True Let j be 8/20 - 18/(-5). Let b(r) = -r2 + 4r - 3. Let f be b(j). Let i(u) = -4u3 + 2u*2 - 2u - 3. Is i(f) composite? True Suppose 3z = 3u - 172439 + 34604, 183784 = 4u - 2z. Is u a prime number? False Let s be -1 + 2 + 2 + 111. Suppose -4j + 3z = -418, 0z + s = j + 4z. Is j composite? True Suppose -3g - 1776 = -5958. Is g/10 + (-4)/10 composite? False Let m(r) = 7r*3 - 3r*2 + 6r - 13. Is m(4) a prime number? False Let y be 15/204 - 3. Suppose 0 = -yi + 5i - 3j - 2786, i = -j + 562. Is i a prime number? False Let q(a) = 10a3 - 7a*2 + 11a - 10. Let k be q(4). Let t = k + -255. Is t composite? False Let w be 438 - (6/9)/(6/27). Suppose 5s - 3j - 2j = w, 348 = 4s - 5j. Is s a prime number? False Suppose -309i = -305i - 2648. Is i composite? True Is (-604310)/(-12) + (-64)/384 composite? False Let n(f) be the second derivative of f5/20 - 7f4/12 - f3/2 - f*2/2 - 4f. Is n(12) composite? False Suppose 4k = 1 + 3, -211699 = -2j - 5k. Is j composite? True Let o = -1254 + 5221. Is o composite? False Let x = -3 + 1. Let p = x + -3. Let f(d) = d2 + d - 10. Is f(p) a prime number? False Suppose 379l - 53914 = 377l. Is l a prime number? False Suppose -2k = k - 4227. Is k composite? False Let s(k) be the third derivative of k8/20160 - k7/630 + 11k6/720 - 7k*5/60 - 2k*2. Let n(m) be the third derivative of s(m). Is n(-12) prime? True Suppose -6x + 1 = -11. Suppose 2a + j + 0j = 417, xj = 2a - 432. Is a a composite number? False Is (72989/21)/(43/21 + -2) a composite number? True Suppose -5k - k + 4k = 0. Suppose -2f = 4g - 11494, k = 5g - 3g. Is f composite? True Let b = 6 + -2. Suppose j - q - 3 = 0, j + 0q - bq = -3. Suppose -4t - jw = -0w - 1053, 2t + 5w = 539. Is t composite? False Let a = -298 + 593. Let x(v) = -v3 - 2v*2 + 9. Let c be x(0). Is a - (-9)/(c/(-2)) a prime number? True Suppose 3m + 5y = 1462, 5m - 4m - 2y = 469. Is m composite? False Is 18812(-6)/(-24) a composite number? False Let x(a) = 21a3 + a2 - 6a - 2. Let g be 1/(-1 - 12/(-9)). Let o be x(g). Let h = o + -263. Is h prime? True Suppose -2w - 7w + 264699 = 0. Is w a prime number? True Is 5388 - -155/(-15) a composite number? True Let o(c) be the third derivative of c4/12 + 7c*3/2 + 11c*2. Let r be o(-8). Suppose -rl + 896 + 389 = 0. Is l a composite number? False Let z(o) be the second derivative of o*4/4 + 4o*3/3 + 3o*2/2 + 19o. Is z(-14) a composite number? False Is 265/(-159) + (-7448)/(-3) a prime number? False Suppose -6o + 10065 + 5289 = 0. Suppose -44n + 41n + o = 0. Is n composite? False Suppose 4v - 2734 = -2w, 4476 - 373 = 3w + 4v. Is w composite? True Let g(z) = z2 + 12z + 7. Let v be g(-11). Is 3/(-1) - (-9 + v) a prime number? False Suppose 50 = 9f - 85. Is 0 - ((-2)/5 - 73599/f) prime? False Let r = 29600 - 19384. Suppose 5m + r - 36081 = 0. Is m composite? True Let r(j) = j*3 + 5j*2 - j + 7807. Is r(0) prime? False Suppose -p = 4u + 124, -2p = -5p - 12. Let a be (-4)/6u/4. Suppose af = -f + 870. Is f composite? True Let s = 220 - -413. Suppose 4*f - f	{ "pile_set_name": "DM Mathematics" }
losest to 0 in 5, 3, w? 3 Let g be ((-536)/(-20))/(2/5). Suppose -69w + 2 = -gw. Let v be 8 + ((-40)/50)/(w/5). What is the closest to -1 in v, -2/13, 3? -2/13 Let f(z) = 5z2 - 126z + 760. Let n be f(11). Let s = -12/11 - -38/55. What is the closest to 1/2 in s, 2, n? s Let s = -152.708 - -152.7. Let k = -4 - -4.052. Let q = k - s. What is the closest to 2/9 in q, 1, -4? q Let i = 46 + -40.2. Let f = 5.873 + -0.073. Let r = i - f. Which is the closest to r? (a) 1 (b) -0.4 (c) 0 c Let h = 157.7 + -158. Let q = h - -5.3. Let y = -3.4 + 0.4. Which is the nearest to -1? (a) 0.1 (b) q (c) y a Suppose z = -3n + 2z + 21, 5n + 6z - 35 = 0. Which is the closest to -2/15? (a) 3 (b) -3 (c) n b Let l = 0.491 + 0.009. Let f = 846 + -847. Which is the nearest to -8/5? (a) -0.5 (b) f (c) l b Let h = 3741 + -3739. Let i = -2 + 2. What is the nearest to i in 5, 3, h? h Let v = -329.6 + 330.2. What is the closest to 6 in 0.2, v, -3, 0? v Let u = 0.34 - 0.04. Let w = -334.71 - -336. Let x = w + 1.71. Which is the closest to x? (a) u (b) -4 (c) 2 c Let f(c) = 18c - 1985. Let d be f(110). What is the nearest to -103/3 in d, 2/7, 0.8? d Let z = 0.17 - 4.07. Let d = z + 3.8. Let y be ((-2)/(-5))/(96/30). Which is the nearest to d? (a) y (b) -3 (c) -0.5 a Let t = -0.1966 + -0.0034. What is the nearest to -1/4 in -2, 4, t, 2/9? t Let m = 160 - 153. Let v = 157.5 - 157. Which is the nearest to -1? (a) m (b) -3/5 (c) v b Let r = 3 - -1. Suppose -2 = -3y + r. Let o = 6.08723 + -0.08723. Which is the closest to o? (a) y (b) 0.4 (c) -5 a Suppose 31f - 55f - 63f = 0. What is the closest to f in 0.5, -2/11, -3, 5? -2/11 Let r be (38/912)/(1/24). What is the closest to r in -2, 0.2, -1, 2/11? 0.2 Let q be 0 + -1 + (-25)/(-20) + 0. Let i = 17.45 + -17.25. Which is the nearest to i? (a) 4 (b) -7/2 (c) -2/5 (d) q d Let t = 10145.8 - 9341. Let i = t - 804. Which is the nearest to -1? (a) -2/9 (b) 0 (c) i (d) 0.2 a Let p = -0.328 - 0.072. Let x = 7666.8 - 7670. Which is the closest to 0? (a) -1 (b) -1/3 (c) x (d) p b Let l be ((-4)/(-35))/(((-336)/(-2100))/(6/15)). Which is the nearest to -594? (a) -1/2 (b) 4 (c) l (d) 0 a Let f = -1.6102 - 0.3898. Which is the nearest to f? (a) -5 (b) 0 (c) 0.05 b Let j = 1186 + -1186. What is the closest to -101 in 4/3, j, -1? -1 Let y = 0.12 + -12.12. Let w = -784.4 + 581. Let q = -203 - w. Which is the nearest to -2/5? (a) y (b) -3/4 (c) q b Let u = 5777/65 - 1158/13. What is the nearest to u in 1/4, 0.8, -1/8, 3? -1/8 Let w = 38 - 38.01. Let d = 0.09 - w. Let g be (-14)/315(-5 + 0). Which is the closest to d? (a) 4 (b) g (c) 1 b Let s be (-2)/9 + (319/9)/11. Let f = 211 + -215. What is the closest to f in s, -4, 0.1? -4 Let k be (-176 + 182)(-2)/(-9). Which is the closest to k? (a) -1/7 (b) -2.1 (c) 1/4 (d) 0.1 c Let p be 100/(-175) + 8/(-84). Let s = 2.9 - 2.7. Which is the nearest to 2? (a) 1 (b) p (c) s a Let w be (-7)/9 + (-6 - -7). Let i = 83323/2 - 41662. What is the closest to i in 4/3, 5, w? w Let j = 14923 - 14918. Which is the nearest to -1? (a) 8/5 (b) j (c) -11 a Let o = 59.758 + -60.758. Let u = 0.4 + 0.1. What is the closest to -0.05 in o, u, -0.3? -0.3 Let a be (-4)/(100/(-375)35). What is the nearest to -1 in 11/3, a, -0.24? -0.24 Let t = -1167/7 + 167. Let q be 4961 + 2/(-2). Let a = 294 - q. What is the nearest to 1/5 in -0.4, t, a? t Let o be 0 - (10/14 - 1). Let f = -46.556 - 0.444. Let n = f - -44. Which is the nearest to 1? (a) n (b) -1 (c) o c Let h = 0.023 + -0.083. Suppose 3n = 4i - n - 68, -4i - 5n + 23 = 0. Let s be (10/i)/(10/(-20)). Which is the closest to 1/2? (a) h (b) s (c) 3 a Let w = -1743 - -1744. What is the nearest to 0.1 in w, -5.3, -2, -1? w Let h = -80.36 + 80.36. Which is the closest to h? (a) -1.39 (b) 0 (c) 0.05 (d) 5 b Let r = 233/5 - 47. Let d = 503.9 - 504. What is the closest to r in -2, d, 5? d Let m = 0.1141 - 0.3141. Which is the closest to -1/3? (a) -2/5 (b) m (c) 64/3 a Let y = 869 - 826.3. Let d = y - 42.7. Let a(n) = -n*2 + 4n + 7. Let l be a(5). What is the nearest to -2/5 in d, -2, l? d Suppose 5z + 50 = -5u, 0 = 3u + 11 + 1. Let n be 4/(-18) - (-4)/(216/z). Suppose -8q + 1 = -7q. Which is the nearest to n? (a) -3/4 (b) q (c) -4 a Let r = -7 + 3. Let l be 4/((-20)/35) + (2 - -1) + 3. Which is the closest to l? (a) 4 (b) r (c) -1 (d) -0.17 c Let j be 0 + (2 - 2) + 1. Let s = 0.9268 - 0.9268. What is the nearest to j in -5, -2/11, s? s Let h(k) = -k2 + 317k + 5. Let g be h(0). What is the closest to -4 in 0.5, -0.5, g, -113? -0.5 Let o be (45/(-10) - -3) + (-435)/(-348). Let m = 1264/9 - 140. What is the closest to m in o, -7, 0.4? 0.4 Let m = -34872 - -278979/8. Let t = -5 - -8. What is the nearest to -1 in m, t, -6? m Let g = -5.9 + 4.9. Let x(l) = -l*3 + 8l*2 - 35l + 65. Let w be x(3). Which is the closest to g? (a) -0.07 (b) w (c) 2/5 a Let b = -4.35 - -4.3671. Let a = 0.1171 - b. What is the closest to a in 14, 4, -3, -2? -2 Let y(s) = -s*3 + 13s*2 - 26s + 318. Let m be y(13). What is the closest to 1 in -5, -1, m? -1 Let r = -34 - 4. Let h = 50 + r. Let q be 33/h + -7 + 5. Which is the closest to -4/7? (a) 3 (b) q (c) -3 b Let z be (2/(-5))/(6/5). Let y = -27.98 + 27.48. What is the nearest to -2/5 in -3, z, y? z Let f be -2 - (46/(-11) - -2). Let j = -1.02411 - -3.02411. Which is the closest to 7? (a) f (b) 0.4 (c) j c Let h = -3244.76 - -3245. Which is the nearest to 1/3? (a) h (b) -2 (c) 46 a Let m be -6(-5 - (5 - 7)). Suppose -o + m = 4p, 2o = 3p - 14 - 5. What is the closest to -0.2 in o, 1, -3? 1 Let p = 1673 + -8366/5. Which is the nearest to 0.1? (a) 6 (b) 1 (c) p (d) 2/9 d Suppose 76f - 11 = -28 - 59. Let h = -78 - -392/5. Let v(q) = -q2 + 5q - 3. Let x be v(3). Which is the nearest to f? (a) x (b) h (c) 3/8 c Let g be 20/(-105)3/(-2). Suppose 11 + 308 = 15v + 4. What is the nearest to g in 1/9, -4, v, 5? 1/9 Let w be 221/119-7 + 15. Let h be -2 + (-3 + 1)/2. What is the nearest to w in h, 1, 0.4? 1 Suppose 27c - 22c - 7 = 9a, -2a - 5c = -29. What is the nearest to 5 in -10, -3, 2/19, a? a Let q be ((-13 - -6)/21)/(5/18). Let t = 4424778/139 - 114712798326/3603575. Let k = t - -2/1525. What is the closest to -1 in 1/3, k, q? q Suppose 2f + 16 = -2f. Let i = -18779 - -18779.6. Which is the nearest to -1? (a) f (b) 0.09 (c) i b Let s be (-17)/(-36) + 4/(-16). Let j be -1 + 4 - (-261 + -5 + -4). Let v = 283 - j. Which is the nearest to v? (a) 2 (b) s (c) -1 a Let j(p) = -10p2 + 60p - 88. Let o be j(4). What is the nearest to 86 in -5, o, 0.2? 0.2 Let s = 4.7 - 34.7. Let j = -30.6 - s. Let w = 0.7 + j. What is the nearest to -1 in -1/3, 3, w? -1/3 Let w = 352 + -232. Let t = 120 - w. Let r be 1 - ((-2 - 1) + 3). Which is the nearest to 0? (a) -5 (b) r (c) t c Let k = 63423 + -7991359/126. Let j = 1/63 - k. Let l = 8 - 8. Which is the closest to j? (a) -3 (b) 0.1 (c) l b Let r = -4 - -1. Suppose -4d + 13 = -3g + 38, 3d = -3g - 3. Let m be (-4)/(32/(-12)) + 2 + d. Which is the closest to m? (a) 0 (b) r (c) 1 a Suppose 0 = 3k + 4k - 14. Let h = -21.3 + 22.29. Let r = h + 1.01. Which is the nearest to k? (a) -0.4 (b) r (c) 0 b Let r = -4053 + 4052. Which is the nearest to r? (a) -8/3 (b) -0.7 (c) 0.1 (d) -4 b Let x = 149 + -275. Let z = x - -124. What is the closest to 1 in -4, z, 1? 1 Suppose 0 = -3h + 4f - 16, -2f - 53 = -3h - 61. Which is the closest to h? (a) -0.2 (b) -0.3 (c) 2 (d) 1.3 a Let m = -0.2 - -0.4. Suppose 0 = 2f - 10, 4f - 1 - 9 = -2l. Let i be ((-3)/5)/(8/(-10)). What is the closest to m in i, l, -0.7? i Let d = 0.1 + -0.3. Let x(r) = -r3 + 4r*2 + 24r + 8. Let p be x(-3). What is the nearest to p in d, 0.11, 4? d Let y = 19566 - 19675. Let n = -63 - -176. Let v = y + n. Which is the nearest to -0.1? (a) v (b) -2/13 (c) -4/3 b Let f = 2044/6141 - -1/2047. What is the nearest to -9 in -0.14, f, -0.5, -1? -1 Let v = 122.9 - 129. Let t = -5.8 - v. Let j = -8.5 - -8.3. Which is the nearest to -3/7? (a) 1 (b) j (c) t b Let w be 2/(-4)2/(-5). Let q = -606 - -605.661. Let c = 0.239 + q. What is the nearest to c in w, 3, 0? 0 Let c be 128/(-12)((-17)/4 - -2).	{ "pile_set_name": "DM Mathematics" }
{p: 1, e: 2, t: 7, y: 1, s: 3}. What is prob of sequence spt? 1/104 Three letters picked without replacement from {s: 2, z: 7}. Give prob of sequence szs. 1/36 Four letters picked without replacement from {q: 13, j: 5}. Give prob of sequence qjjj. 13/1224 Two letters picked without replacement from xxxxxxxxxxxxxaxxxxxx. What is prob of sequence ax? 1/20 Calculate prob of sequence ttwl when four letters picked without replacement from uwuutuutttlttutlttu. 1/646 Two letters picked without replacement from rrdrrd. What is prob of sequence rd? 4/15 Two letters picked without replacement from {m: 8, c: 1, j: 1, b: 6}. What is prob of sequence cj? 1/240 Three letters picked without replacement from {b: 2, o: 4, e: 7}. Give prob of sequence bee. 7/143 Calculate prob of sequence aq when two letters picked without replacement from qqqaqqqqqqi. 9/110 What is prob of sequence ljl when three letters picked without replacement from {l: 16, j: 4}? 8/57 Calculate prob of sequence tf when two letters picked without replacement from {s: 2, p: 1, x: 2, t: 1, f: 1}. 1/42 Calculate prob of sequence oo when two letters picked without replacement from {o: 3}. 1 Four letters picked without replacement from sgagsagsaaag. What is prob of sequence sagg? 1/66 Three letters picked without replacement from zbwwzlrwztb. What is prob of sequence wzl? 1/110 Calculate prob of sequence iiii when four letters picked without replacement from iidddii. 1/35 Calculate prob of sequence gju when three letters picked without replacement from {t: 1, g: 5, o: 11, j: 1, s: 1, u: 1}. 1/1368 Two letters picked without replacement from {k: 1, z: 2, m: 6, t: 1, g: 3}. What is prob of sequence tk? 1/156 What is prob of sequence jyyj when four letters picked without replacement from jyjyjyyyjj? 5/63 Two letters picked without replacement from eyymeyyqzy. Give prob of sequence ze. 1/45 Calculate prob of sequence snni when four letters picked without replacement from {s: 5, n: 2, i: 4, z: 4, r: 2}. 1/1428 Calculate prob of sequence sllq when four letters picked without replacement from {l: 4, s: 1, j: 7, q: 1}. 1/1430 Four letters picked without replacement from {a: 4, t: 15}. What is prob of sequence taat? 35/1292 What is prob of sequence eoo when three letters picked without replacement from kookkooosooeooos? 3/112 Calculate prob of sequence ynny when four letters picked without replacement from {n: 7, y: 2}. 1/36 Two letters picked without replacement from hnvnzzavm. Give prob of sequence vm. 1/36 Four letters picked without replacement from {q: 5, c: 2}. What is prob of sequence cqcq? 1/21 What is prob of sequence nn when two letters picked without replacement from nnbnkans? 3/14 What is prob of sequence ms when two letters picked without replacement from {s: 3, h: 2, q: 1, p: 1, m: 2, o: 3}? 1/22 Four letters picked without replacement from ebrrgrregrarrtagag. What is prob of sequence gagt? 1/2040 What is prob of sequence ci when two letters picked without replacement from cccccccccccccccciccc? 1/20 Four letters picked without replacement from deeddydydydyddee. What is prob of sequence ydde? 4/195 What is prob of sequence qqw when three letters picked without replacement from ibiwbibwiibqzbiqzii? 2/2907 What is prob of sequence hu when two letters picked without replacement from uuggghhg? 1/14 What is prob of sequence ool when three letters picked without replacement from {l: 4, f: 4, o: 2}? 1/90 What is prob of sequence wtw when three letters picked without replacement from ttttwww? 4/35 Four letters picked without replacement from cdrydzz. What is prob of sequence dzzc? 1/210 What is prob of sequence qf when two letters picked without replacement from {t: 1, f: 2, q: 2, d: 8}? 1/39 What is prob of sequence cz when two letters picked without replacement from {z: 5, p: 4, c: 1, t: 1}? 1/22 Four letters picked without replacement from {j: 11, n: 1, w: 6}. Give prob of sequence wjjj. 11/136 What is prob of sequence ccnn when four letters picked without replacement from cnccccccn? 1/36 What is prob of sequence efc when three letters picked without replacement from {f: 2, h: 2, c: 2, e: 2}? 1/42 Calculate prob of sequence qb when two letters picked without replacement from pqgiqbi. 1/21 Four letters picked without replacement from zzypzzzpxpqypx. Give prob of sequence zyxq. 5/6006 What is prob of sequence qhh when three letters picked without replacement from hhhhhhhqhhhqqhhhhhhh? 34/285 Two letters picked without replacement from {w: 4, a: 1, i: 3, n: 10}. Give prob of sequence na. 5/153 What is prob of sequence rt when two letters picked without replacement from pjpttppptrptpffr? 1/30 Calculate prob of sequence pp when two letters picked without replacement from upuppuuuuppuu. 5/39 Three letters picked without replacement from buvubgvvvbbg. Give prob of sequence buu. 1/165 Four letters picked without replacement from {m: 2, d: 3, v: 7, t: 7}. Give prob of sequence tmdt. 7/2584 Three letters picked without replacement from lclcccmlccgku. What is prob of sequence klm? 1/572 Two letters picked without replacement from {u: 2, r: 2, w: 4}. Give prob of sequence wr. 1/7 What is prob of sequence dp when two letters picked without replacement from {v: 2, p: 1, d: 4}? 2/21 Calculate prob of sequence vvi when three letters picked without replacement from vvvvivivivv. 28/165 What is prob of sequence lo when two letters picked without replacement from {a: 1, o: 2, c: 1, l: 2, k: 2}? 1/14 Calculate prob of sequence ssss when four letters picked without replacement from {z: 5, s: 5}. 1/42 Two letters picked without replacement from {p: 4, q: 2, u: 2, a: 12}. Give prob of sequence uu. 1/190 Calculate prob of sequence gqg when three letters picked without replacement from ggeggeeqeegeeegqgeq. 7/323 Four letters picked without replacement from ggxxx. Give prob of sequence gxxx. 1/10 Two letters picked without replacement from yyyii. What is prob of sequence ii? 1/10 Three letters picked without replacement from {p: 7, e: 2, c: 9}. Give prob of sequence pcp. 21/272 Four letters picked without replacement from toto. What is prob of sequence toto? 1/6 What is prob of sequence wv when two letters picked without replacement from {h: 3, v: 2, w: 1, i: 1}? 1/21 Three letters picked without replacement from ffi. Give prob of sequence iff. 1/3 What is prob of sequence uxg when three letters picked without replacement from {h: 3, g: 4, x: 2, u: 1}? 1/90 Four letters picked without replacement from {a: 1, u: 2, n: 1, x: 4, t: 2}. Give prob of sequence nuxx. 1/210 What is prob of sequence cccc when four letters picked without replacement from {c: 5}? 1 Three letters picked without replacement from {f: 13, z: 5}. Give prob of sequence zzz. 5/408 What is prob of sequence bxss when four letters picked without replacement from ssssxssbxbxx? 2/99 Four letters picked without replacement from {m: 6, z: 12}. Give prob of sequence mzmz. 11/204 Two letters picked without replacement from {n: 11, s: 2, j: 1, h: 2}. Give prob of sequence hs. 1/60 What is prob of sequence defd when four letters picked without replacement from {d: 5, e: 4, w: 1, i: 3, f: 1, m: 3}? 1/714 What is prob of sequence ki when two letters picked without replacement from {n: 4, a: 6, i: 1, k: 5}? 1/48 Two letters picked without replacement from ziulu. Give prob of sequence lu. 1/10 Two letters picked without replacement from {k: 1, z: 4, e: 1, o: 2, v: 1}. Give prob of sequence eo. 1/36 Four letters picked without replacement from cbjjkbbbcbbbibbcbbi. Give prob of sequence ibib. 55/23256 Two letters picked without replacement from {m: 4, h: 1, f: 1, c: 8, z: 1, q: 1}. What is prob of sequence zf? 1/240 Four letters picked without replacement from kkkkkkkikikkkkkiklkl. What is prob of sequence iili? 1/9690 Two letters picked without replacement from hccheehhhchhhhce. Give prob of sequence hc. 3/20 Two letters picked without replacement from {v: 2, w: 2, b: 4, i: 5}. Give prob of sequence ib. 5/39 What is prob of sequence pm when two letters picked without replacement from bmmpddmmdddmmhmdmmdd? 9/380 Calculate prob of sequence nunu when four letters picked without replacement from {d: 1, u: 8, n: 10}. 35/646 Three letters picked without replacement from bpb	{ "pile_set_name": "DM Mathematics" }
Suppose 4d3/9 - 4588d*2/9 + 428576d/3 + 287760 = 0. What is d? -2, 495, 654 What is d in -5d2 - 5885180d - 11770340 = 0? -1177034, -2 What is x in -5x5 + 14825x*4 + 59410x*3 - 89050x*2 - 59405x + 74225 = 0? -5, -1, 1, 2969 Let -2f3/11 - 132f*2 - 196138f/11 - 575400/11 = 0. What is f? -548, -175, -3 Factor -5d2 - 17380d + 7094025. -5(d - 369)(d + 3845) Find x, given that 1828x3/3 - 5334110x*2/3 + 3891246376x/3 - 4257362 = 0. 3/914, 1459 Determine y so that 21y3/8 - 127848753y*2/2 + 389173878013392y + 222385094023776 = 0. -4/7, 12176072 Determine z so that -2z3/9 - 133744z*2/9 - 3740128z/3 = 0. -66788, -84, 0 What is z in z*4 - 221z*3 - 42346z*2 + 172004z - 172872 = 0? -126, 2, 343 Factor r*2/2 + 412559r/2 - 6188835. (r - 30)(r + 412589)/2 What is u in 2u*2/7 - 427170u/7 - 854348/7 = 0? -2, 213587 Suppose g*3 + 32059g*2 + 103822595g + 88874254025 = 0. What is g? -28529, -1765 Solve -h*2/3 + 5532944h/3 - 7653367326784/3 = 0 for h. 2766472 Determine y so that y*5/2 - 425y*4 + 12708y*3 + 1541592y*2 + 32968296y + 213626160 = 0. -18, 90, 814 Find z, given that 5z3 - 4780z*2 - 5977405z + 5982180 = 0. -716, 1, 1671 Factor a*2 + 1457a - 50694. (a - 34)(a + 1491) Factor -4y*2 + 4593008y + 13779060. -4(y - 1148255)(y + 3) Factor -4w2 + 5147068w - 51470280. -4(w - 1286757)(w - 10) Suppose -o*3 + 33237437o*2 - 276181787963523o - 276181821200961 = 0. Calculate o. -1, 16618719 What is p in -p*3 - 17360p*2 + 8216512p - 959358976 = 0? -17824, 232 Let -d*3/3 + 12929d*2 - 852782d/3 - 620240 = 0. What is d? -2, 24, 38765 Find q, given that -2q4 + 5398q*3 + 4349370q*2 + 776176434q = 0. -339, 0, 3377 Factor -4i2 + 508912i - 8650348. -4(i - 127211)(i - 17) Suppose 3i2/4 - 22659687i + 171153804979323 = 0. What is i? 15106458 Find k, given that -3k5 + 2823k*4 + 19875k*3 + 31269k*2 + 14220k = 0. -5, -1, 0, 948 Factor 2g2 - 817470212g + 83532193438415618. 2(g - 204367553)2 Solve -b5/6 + 375b*4 - 22393b*3/6 - 2634b*2 + 138790b/3 + 67200 = 0 for b. -2, 5, 9, 2240 Solve -r*4 - 17r*3 + 3359r*2 + 153r - 30150 = 0. -67, -3, 3, 50 Let -4a3 - 651704a*2 + 2606864a - 2606880 = 0. Calculate a. -162930, 2 Let -4g2 - 593560g + 11279084 = 0. What is g? -148409, 19 Determine y, given that -3y5/4 + 20895y*4/2 + 1264500y3 = 0. -120, 0, 14050 Determine n, given that -n4 + 466836n3 - 54477426628n*2 - 1525642456128n - 10680137730304 = 0. -14, 233432 Find l, given that -1067089l3 + 373946l*2 - 32761l = 0. 0, 181/1033 Suppose -3k2 + 100818k - 19744719 = 0. Calculate k. 197, 33409 Solve -3f2/7 - 385600416f/7 - 12390640068281088/7 = 0 for f. -64266736 Solve r*4 + 32343r*3 + 1292073r*2 - 1518487r - 7946538 = 0. -32303, -41, -2, 3 Let -l*3 - 54903l*2 - 839075931l - 2275937712293 = 0. Calculate l. -25733, -3437 Determine u so that -4u3/3 - 1192u*2/3 + 9716u/3 + 119560 = 0. -305, -14, 21 Factor -2d2/9 + 1695524d - 3234151838898. -2(d - 3814929)2/9 Solve -t4/2 - 6341t*3/2 + 6407t*2/2 + 412293t/2 + 199773 = 0 for t. -6342, -7, -1, 9 Solve -2o4/5 - 27362o*3/5 + 575214o*2/5 - 3699054o/5 + 6659172/5 = 0 for o. -13702, 3, 9 Find s such that 338s4 + 6754s*3 - 47102s*2 - 117466s + 2100 = 0. -25, -2, 3/169, 7 Find t such that t*4 - 4631t*3 + 537391t*2 - 2089401t + 1556640 = 0. 1, 3, 115, 4512 Suppose k*2 - 18718748k - 18718749 = 0. What is k? -1, 18718749 Solve -c*3/2 - 53873c*2 - 1939185c/2 - 4362984 = 0. -107728, -9 Suppose -3u3 - 72630u*2 - 525284100u - 980239029000 = 0. Calculate u. -10670, -2870 What is p in -p*5 - 910p*4 - 41048p*3 + 282928p*2 + 164208p - 1117152 = 0? -862, -54, -2, 2, 6 What is b in 2b3/9 - 19864b*2/9 + 238054b/9 + 257920/9 = 0? -1, 13, 9920 Solve 5t4 + 91695t*3 + 421451370t*2 + 9648777220t + 17612482440 = 0 for t. -9158, -21, -2 Suppose 132627975682084s2 + 46065688s + 4 = 0. What is s? -1/5758211 Determine w, given that 2w5 - 66w*4/5 - 5948w*3/5 + 45792w*2/5 - 76736w/5 - 7680 = 0. -25, -2/5, 4, 24 Solve 2x3/3 + 279964x*2/3 - 7840168x/3 + 18294640 = 0 for x. -140010, 14 Find u such that 22180932u4 + 990622980u*3 + 15062830272u*2 + 82469424128u + 68375035904 = 0. -2576/177, -1 Find t, given that 10t4 + 14205t*3 - 1343250t*2 + 12362125t - 30011250 = 0. -1510, 5, 159/2 Suppose -2l4/3 + 320l*3/3 - 290l*2/3 - 1500l + 2544 = 0. What is l? -4, 2, 3, 159 Solve 6o5/11 - 1750o*4/11 - 98796o*3/11 + 66640o*2/11 = 0. -49, 0, 2/3, 340 Factor -2a*3 + 270a*2 + 59244a + 117392. -2(a - 253)(a + 2)(a + 116) Find f such that -3f*2 - 121632f - 243252 = 0. -40542, -2 Solve -h*2/2 + 1342591h/2 - 3356465 = 0. 5, 1342586 Solve -3x3/5 - 52431x*2/5 - 44208912x + 70859899968/5 = 0 for x. -8888, 299 Let 6724y3 - 23819852y*2 - 682667968y - 4871643904 = 0. What is y? -584/41, 3571 What is s in -2s3/11 - 2274s*2/11 + 109826s/11 + 106470 = 0? -1183, -9, 55 Find m, given that 6815m4 - 552005m*3 - 7625m*2 + 552005m + 810 = 0. -1, -2/1363, 1, 81 Factor 3o3/2 - 97311o*2/2 + 42505584o - 9412207830. 3(o - 31545)(o - 446)*2/2 What is n in -4n*5 - 4864n*4 + 9760n*3 + 19480n*2 - 9756n - 14616 = 0? -1218, -1, 1, 3 What is m in 4m4/5 + 10391364m*3/5 + 62348088m*2/5 + 124696112m/5 + 16626144 = 0? -2597835, -2 Factor 5g3 + 26705g*2 - 4984525g + 228679815. 5(g - 91)2(g + 5523) Find x such that -2x4/5 + 4226x*3/5 - 50424x*2/5 - 512x/5 + 1075712/5 = 0. -4, 8, 2101 Factor d*2 + 1378d - 4792304. (d - 1606)(d + 2984) Determine j so that j3/4 - 58279j*2/4 - 174855j/2 = 0. -6, 0, 58285 Solve 2c2 + 499424c = 0 for c. -249712, 0 Let 3g3/4 + 2208159g*2/2 + 8832627g/4 + 1104078 = 0. Calculate g. -1472104, -1 Solve 5k2 - 1533265k + 22997850 = 0 for k. 15, 306638 Let 23787s2 - 119127s + 960 = 0. Calculate s. 64/7929, 5 Factor -f*2 + 75826f - 303288. -(f - 75822)(f - 4) Suppose -5r*3 + 1262180r*2 - 15145620r + 45436320 = 0. Calculate r. 6, 252424 Let -4i5/19 + 450i*4/19 + 16016i*3/19 + 105480i*2/19 - 56800i/19 = 0. Calculate i. -20, -10, 0, 1/2, 142 Factor -10y2/17 - 13806508y/17 + 2761302/17. -2(y + 1380651)(5y - 1)/17 Determine c so that -2c*4 - 11772c*3 - 23144522c*2 - 17134216632c - 4236995432072 = 0. -2314, -629 Let -3q4 + 18738390q*3 + 74953596q*2 + 74953608q = 0. Calculate q. -2, 0, 6246134 Factor 3d2 - 16612032d - 299017548. 3(d - 5537362)(d + 18) Factor 2j2/9 + 2978j/3 - 360560/9. 2(j - 40)(j + 4507)/9 Factor 1160l2 - 65332l - 44916. 4(l - 57)(290l + 197) What is h in 2h*3/13 + 1670652h*2/13 - 6682632h/13 + 6682640/13 = 0? -835330, 2 Let 4w3 + 107062892w*2 - 4w - 107062892 = 0. What is w? -26765723, -1, 1 Determine x, given that -x*5/4 - 245x*4/4 - 9921x*3/4 + 700733x*2/4 + 2226641x/2 + 1507038 = 0. -139, -4, -2, 39 Factor p*3 - 4227p*2 + 813842p - 3187800. (p - 4025)(p - 198)(p - 4) Determine o, given that o*4/3 + 89612o*3/3 - 1733601o*2 + 1703730o = 0. -89670, 0, 1, 57 Factor -3p2/4 - 159237p/4 + 39810. -3(p - 1)(p + 53080)/4 Suppose 4m2 + 97297836m + 97297832 = 0. What is m? -24324458, -1 Let -4i5 + 6332i*4 - 1309224i*3 + 63676640i*2 - 1175420800i + 7511232000 = 0. Calculate i. 20, 174, 1349 Let -13491369366s5/5 - 897831346s*4 + 2654288s*3/5 - 392s*2/5 = 0. What is s? -1/3, 0, 14/47419 Let 10m*5/17 + 8424m*4/17 - 205278m*3/17 - 781588m*2/17 - 394248m/17 + 561168/17 = 0. What is m? -866, -2, 3/5, 27 What is o in -o*3/7 - 105902o*2/7 - 2009611o = 0? -105769, -133, 0 Factor 5y2 - 965289430y + 46589184183486245. 5(y - 96528943)2 Suppose -3f*2 - 44412f + 18104391 = 0. Calculate f. -15201, 397 Factor 4410b2 + 2707656b + 2078061512/5. 2(105b + 32234)*2/5 Determine g, given that 15g*2/4 + 422485g/2 - 422500 = 0. -169000/3, 2 Factor 5o3 + 11380o*2 + 636375o + 8787240. 5(o + 24)(o + 33)(o + 2219) Determine w, given that -w3 - 709w*2 - 20339w + 21049 = 0. -679, -31, 1 Solve 2v5 + 32078v*4 + 160334v*3 - 96230v*2 - 416864v + 320	{ "pile_set_name": "DM Mathematics" }
88440925+5.1 -5888440919.9 What is 33090 + 557807.21? 590897.21 What is 48561584 plus 0.077977? 48561584.077977 What is 3347843571.6 + -3? 3347843568.6 Add together -12 and 429659793.8. 429659781.8 What is -0.086 less than -23713297907? -23713297906.914 What is 18210912852 + 12044? 18210924896 Work out -276661.91848801 + 5. -276656.91848801 Add 8.05424684630365 and -0.4. 7.65424684630365 What is 2478.992090518 plus -0.3? 2478.692090518 What is the distance between 8.5449 and 7338797207? 7338797198.4551 What is -0.25 plus -8848329171.56? -8848329171.81 Add -0.05 and -12.6200142054. -12.6700142054 Total of -81.33043227171 and 1.7. -79.63043227171 2561210.113 - -129.313 2561339.426 -848.513929746 + 1003 154.486070254 Add together 0.11 and 131008251630. 131008251630.11 Calculate -12.323 - 1404417685. -1404417697.323 What is 1283244815218 take away 16? 1283244815202 Total of -0.01 and -224096653532. -224096653532.01 What is -0.115 + 7191.046786? 7190.931786 Sum 0.5 and 1958531962606. 1958531962606.5 What is the distance between 1966221935690 and -6.5? 1966221935696.5 What is the difference between 2188 and -351991805128? 351991807316 Put together -0.0436 and -0.0481048606. -0.0917048606 Total of -19223983436 and 35.51. -19223983400.49 Calculate 0.0518 - 48182694.341. -48182694.2892 What is 326 plus -5016810.31? -5016484.31 Work out -0.104 - 25123097852. -25123097852.104 What is -0.1 minus 649.75374588? -649.85374588 Put together 0.69889 and 920255. 920255.69889 50834594668 - 14 50834594654 Calculate -7948.39108 + 28.15. -7920.24108 Put together -0.080187078 and -1073. -1073.080187078 What is -630 plus -24981.73872? -25611.73872 What is the distance between 2774.8 and -2451.33542? 5226.13542 Add together -456666.5393 and 0. -456666.5393 Put together -51474162439400 and 1.2. -51474162439398.8 Subtract 2.2267 from 172061150. 172061147.7733 Calculate -2279605 - -102812. -2176793 What is the difference between 775982125557 and -0.05? 775982125557.05 Work out -2165.5536 + 3.359385. -2162.194215 What is -31132.81726 take away 2.73? -31135.54726 What is 56337162252 less than 2873? -56337159379 Work out -70049826288 - -6. -70049826282 -31800.57286 + 7.4494 -31793.12346 Work out -3 - -215897039801. 215897039798 -45458.016257+-2.5 -45460.516257 What is -0.057236513 + -289.4? -289.457236513 What is 0.33 plus 23535295207? 23535295207.33 What is 21013.0277 + -19256? 1757.0277 What is -60624518392604 + -2? -60624518392606 Calculate -1451420863795 + 19. -1451420863776 Sum 14755746409 and 883.7. 14755747292.7 What is the difference between -5 and 1900384624246? 1900384624251 Add -176810850930 and 9. -176810850921 What is 16.814 take away 12775653? -12775636.186 -10011989.295797 - -4 -10011985.295797 Sum 2626182064 and -6.32. 2626182057.68 Sum 1127233975 and 788. 1127234763 Subtract 1769 from -259801.38036. -261570.38036 1896+6283278.18 6285174.18 Add -82436 and -33503173. -33585609 What is the difference between -574895074644 and -0.4? 574895074643.6 Total of 35.47 and -29594192209. -29594192173.53 What is 34586.8 minus -716895? 751481.8 What is the difference between -0.3448934899 and 140.98? 141.3248934899 Calculate -44.6603 + 611.063. 566.4027 Calculate -72 + -192771070860. -192771070932 Add 42.0909098 and 2208460. 2208502.0909098 Calculate 480.6302119 + 4565. 5045.6302119 What is -0.138517816 minus -16233? 16232.861482184 Work out 47259 + 219.510458. 47478.510458 What is 0.03967 less than -0.1828185008? -0.2224885008 Add together -0.00046755728278 and 1. 0.99953244271722 Calculate 56516 + -46876824. -46820308 What is the distance between 510.69 and -59308518? 59309028.69 Calculate -8.6484 + 1162049770. 1162049761.3516 What is -224170470835 - 0? -224170470835 Add 2.44123 and -0.4481675. 1.9930625 What is 0.05283441647 - -1932? 1932.05283441647 What is 428 plus 601144453? 601144881 Total of -1.000028928 and 98190. 98188.999971072 Work out 1526 - -3513520990. 3513522516 Subtract 18688330410 from -437. -18688330847 Total of 0.22 and -106347086.4913. -106347086.2713 What is -39.80263 - -2035876? 2035836.19737 What is 1 - -2620236355.16? 2620236356.16 Calculate -0.1 + 14.231914299335. 14.131914299335 Add together -506949819 and -1.93. -506949820.93 What is 89 minus -15714124640? 15714124729 What is 2 less than -58807542.77423? -58807544.77423 What is the distance between 45917 and 6086506? 6040589 0.02084+-9869527512 -9869527511.97916 12387889.2+-17.87 12387871.33 5158662 + 5020 5163682 What is 181310.4 - -0.059124641? 181310.459124641 What is 1334.374793 take away -12? 1346.374793 Work out -1405 - 23456144.01. -23457549.01 Calculate -641791.0028738 - 0.06. -641791.0628738 What is the difference between 2692999 and 0.048674? 2692998.951326 -0.647834641176 - 0.2 -0.847834641176 Calculate 4.6162 + -33553142. -33553137.3838 What is -15255281410 - 2? -15255281412 -12 + -10.8724298582 -22.8724298582 What is 0.093069 plus -13559464? -13559463.906931 What is 876985.3234616 minus -1? 876986.3234616 Work out 140 + 1649992532. 1649992672 Put together 2195.811 and 783312. 785507.811 1.59801320281+0.1 1.69801320281 Calculate -4670.15301 - 0.01087. -4670.16388 Total of 12827.07 and -0.033197. 12827.036803 Work out -13965.669129 - 0.11. -13965.779129 -385730834780.968+-0.2 -385730834781.168 What is -0.095412 plus 65455? 65454.904588 Add -1212495360 and 339638. -1212155722 Add together 360.655724326 and 0.1. 360.755724326 Add -91253739.401 and -4. -91253743.401 Add together -21622 and -0.05369339. -21622.05369339 Sum 61 and -13832823.76834. -13832762.76834 What is -4746.84 + 1780862? 1776115.16 Work out -132536 - -553285839. 553153303 Add together 29812502 and -5216. 29807286 Work out -17 + 125545207.6369. 125545190.6369 What is the difference between 2068102258522 and 0.04? 2068102258521.96 Work out 0.3 + 27957812208524. 27957812208524.3 Add together 62.1521950205 and 131. 193.1521950205 678 - 0.1022534 677.8977466 What is -7431978735716 take away 0.01? -7431978735716.01 What is 2.6 - 131.3276163? -128.7276163 Work out 144300431590 - 242. 144300431348 Calculate 840825656602 + -4.2. 840825656597.8 What is -1030783052 plus -0.2? -1030783052.2 Total of -32 and 30157938005. 30157937973 Work out 0.1 + -9167459805629. -9167459805628.9 What is -4094558 minus 5139891? -9234449 Subtract 20410054440 from -1492.1. -20410055932.1 What is the difference between -10503717 and -87.793? 10503629.207 Calculate -0.150379 - -28871.743. 28871.592621 What is 26164474.47 less than -2.2? -26164476.67 8992635640 + -2.056 8992635637.944 What is -0.002956 - 215802? -215802.002956 What is 11504 take away 4665169064? -4665157560 Add 1561716 and 858930. 2420646 Work out 4006.69505 + -15777. -11770.30495 What is -29.060983213 - 1.1? -30.160983213 What is -64562 plus -0.01524418? -64562.01524418 Calculate 24187336352.2 + 489. 24187336841.2 Subtract 1848.7212037 from 466.2. -1382.5212037 Calculate 0.06535 + -20080909. -20080908.93465 Subtract -54.03275478025 from 0.2. 54.23275478025 What is 579.8 take away -24641917? 24642496.8 What is 1383747095457 - 0.4? 1383747095456.6 Put together 3.37391030705 and -0.5. 2.87391030705 Total of -24830.783965133 and 0.2. -24830.583965133 What is -895602 + -63614? -959216 What is 2585.352035 take away 3088? -502.647965 Sum -9 and 139.5770397418. 130.5770397418 Sum -9 and 1668521846111. 1668521846102 Add -37279.5297 and -0.47. -37279.9997 Calculate 2132411073 - 120.7. 2132410952.3 What is 0.371 minus -822005109? 822005109.371 Add -1.3 and -467461732646. -467461732647.3 Work out -700 - -177817146463. 177817145763 What is 0.1 - -22493446916? 22493446916.1 Calculate -0.3937 - 632025.7778. -632026.1715 Calculate 54 - 1133443826414. -1133443826360 Work out -2.691 - 1370.771779. -1373.462779 0.176781802 - 13.76 -13.583218198 Work out -277 - 369.518527471. -646.518527471 Put together -550.3391959 and -643. -1193.3391959 What is the difference between -0.5 and -194.0476903438? 193.5476903438 What is 46216 + 7.824076696? 46223.824076696 What is 212518509655 - -2.5? 212518509657.5 Total of 7222880782 and -24301. 7222856481 Add together 32297356576.97 and -35. 32297356541.97 -2.76293727 - 393 -395.76293727 What is -1360430074 plus -1.509? -1360430075.509 What is 0.009032 + 79309327.5?	{ "pile_set_name": "DM Mathematics" }
r = z for r. 1 Let x(q) = q*3 + 5q*2 - q - 1. Suppose 16 + 9 = -2f + 5y, 3 = y. Let n be x(f). Suppose -5c + 2u + 75 = 7u, -nc = -4u - 20. Solve -5i - c = 5 for i. -3 Suppose -103o + 445 + 1542 + 176 = 0. Let k be (-1)/(-1(-1)/(-17)). Let b = o - k. Solve h + b = 2 for h. -2 Let z(o) = -o3 - 7o*2 - 4o + 15. Suppose 15k = 18k - 6. Suppose w + 8 - k = 0. Let f be z(w). Solve l + f = 4 for l. 1 Let m be ((-3420)/1330)/((-3)/7). Solve -15k - 105 = mk for k. -5 Let r(l) = l + 19. Let j be r(-9). Let n = j + 2. Suppose -ng = -8g. Solve -d - 2d - 3 = g for d. -1 Let a be ((-9)/5)/(7 + 102/(-15)). Let b be (30/(-9))/(6/a). Solve -3 = -bl - 13 for l. -2 Suppose 493 - 489 = 4i. Suppose 2l + 0 - i = p, -4p = -2l - 26. Solve -28 + 1 = pf for f. -3 Let k(j) = -35j - 2. Let f be k(5). Let y = -177 - f. Solve -7h + 10h + 15 = y for h. -5 Suppose -3a + 4a = -8. Let h be (-4 - -1 - 3)4/a. Solve -t = ht for t. 0 Suppose -5f - 4j + 489 = 0, 0 = -4f + j - 5j + 388. Let v be 1010/f14/10. Solve 16 = 10s - v for s. 3 Suppose r + 15 = -5s, 5 = -5r - 2s - 1. Let x(v) = v2 - 8v + 15. Let p be x(2). Suppose -pb - 4 = -1, -4j - 4b + 4 = 0. Solve r = -ju - u for u. 0 Let z(x) = 45x - 79. Let l be z(2). Solve p + 15 - l = 0 for p. -4 Let w(j) = -j3 + 21j*2 - 10. Let b be w(21). Let f be (-77 + 74)/(6/b + 0). Solve -f = -4u + 5u for u. -5 Suppose 53d - r - 23 = 51d, 5r + 25 = 0. Suppose 0 = l - 3l + 6. Solve 6 = -lv + d for v. 1 Suppose 2x = 5s + 25, 2x - 31 = 190s - 191s. Solve xi = 16i - 3 for i. 3 Let z = 1079 - 540. Suppose -z + 554 = 5r. Solve 0 = -4l + 7 - r for l. 1 Suppose 5k = -30, w + 5k - 8 = -22. Solve -23 = wj - 103 for j. 5 Suppose -x - 3 + 16 = 0. Let b = -172 - -409. Let y = b - 235. Solve y = 5h - x for h. 3 Let b be 32 - (110 - 96)/(0 + 2 - 0). Solve 0 = bg + 29 - 104 for g. 3 Let h(d) = d*3 - 5d*2 - 12. Let v be h(6). Let x = v - 20. Let f = x - -8. Solve -3r + f = r for r. 3 Let b(q) = -q*3 + 5q*2 - 5q. Let i be b(2). Suppose -3t - id + 6 = 0, 7d - 8d + 9 = 3t. Solve c = tc + 3 for c. -1 Let q be (-2)/(-14)01. Solve -619s + 626s + 21 = q for s. -3 Suppose 0 = -21v + 14v + 161. Suppose 2a = -9 + v. Solve a = -4d - 1 for d. -2 Let r(v) = 4v + 78. Let x be r(-16). Suppose 3z = x - 2. Solve 0 = 8t - 10t + z for t. 2 Let v(y) = 2y2 + 167y - 16 - 159y + 6y2 + y3. Let h be v(-4). Solve -5z = -z + h for z. -4 Let z(n) = n3 - 2n*2 - 51n + 39. Let j be z(8). Suppose 0 = -6b + 2b + 16. Solve ba = -a + j for a. 3 Let q(l) = -7l + 2. Let r be q(-1). Let z = -1340 - -1351. Solve 4a = -z - r for a. -5 Let q(n) = -7n*2 - 126n + 31. Let t be q(-18). Solve -44 + 13 = tk for k. -1 Suppose 0 = 26v - 23v - 12, 0 = -j - 2v + 27. Solve j = -2m + 23 for m. 2 Suppose -3g - 2q = -3q - 24, -g + 8 = q. Let f = -187333 - -187335. Let v(u) = u*3 + 2u*2 + 2. Let r be v(-2). Solve -g = rx + f for x. -5 Let f(m) = -m*2 + 7m + 1. Let o be f(5). Let i be 2/(-4) - (-4)/(8/o). Suppose t = -5x - i, 0x + 26 = 4t - 3x. Solve 0h = 5h + t for h. -1 Suppose 3l + 5u = 2l + 23, 0 = 3u - 12. Suppose 6v = 61 - 19. Suppose 0o + vo = 2o. Solve o = -g + 2g - l for g. 3 Suppose -4p = 2z - 10, 6z - 8z + 3 = -3p. Let a(w) = 37w2 - 3w - 2. Let l be a(1). Solve -26 = -zd - l for d. -2 Suppose 3y - 66 = 4n, -25y = -20y - 4n - 94. Solve 13v = -v - y for v. -1 Suppose 0 = -5c + 4l + 136, -5c + 559 = -5l + 424. Solve c = -12m - 8 for m. -3 Let n(h) = -2h2 - 2h + 8. Let f be n(0). Let q = 1 + 2. Suppose -3j = -3c - 3, -4j + 6 = -qc + 2. Solve c = fs - 3s for s. 0 Suppose -214 = 9r - 8r. Let i = r - -230. Solve -x = 3x - i for x. 4 Let a be 6 + 17 + -23 - (2 + (-1 - 16)). Solve 39 = -aj - 36 for j. -5 Suppose 2q = 4l + 60, 0 = -3q + l - 5l + 90. Solve -qp + 29p = -5 for p. 5 Let m be 4 + (-49)/(-5) + (-96)/(-80). Solve 48 = -mt - 12 for t. -4 Let g(b) = 83b + 86b + 2 - 168b. Let t be g(-2). Solve to = 5o + 20 for o. -4 Suppose 222 + 618 = 4i. Suppose -510 + i = -30m. Solve -45 = -r + mr for r. -5 Suppose 5p + 5w - 1085 = 0, 0 = -9w + 7w - 6. Solve pz - 226z - 36 = 0 for z. -6 Let v be 135/(-30)(7 + (-3)/3). Let h be -3 + (-63)/v3. Solve 11 - 27 = hw for w. -4 Let h(m) = -m*3 + 36m*2 - 204m + 7. Let f be h(7). Solve f = 236c - 230c + 24 for c. -4 Let f = -3943 + 3944. Let q(o) = 7o + 7. Let k(m) = -6m - 6. Let v(w) = -6k(w) - 5q(w). Let h be v(-1). Solve hj - f = j for j. -1 Let h(n) = n3 + 6n*2 - 87n + 318. Let s be h(4). Solve -s = 7q - 95 for q. -5 Let f be (-690)/(-90)(45/20 + 6/8). Solve -fy + 36y + 39 = 0 for y. -3 Let i(t) = 6t + 12. Let s be i(-32). Let u be (6/(-15))/(9/s). Let x(a) = 6a*3 - a. Let h be x(1). Solve z = hz + u for z. -2 Let f(p) = -p*2 + 11p - 23. Let k be (-40)/(-16)(-36)/(-15). Let h be f(k). Suppose hw - 15 = 27. Solve -3n = -wn + 9 for n. 3 Let h = 472 - 456. Suppose -4b - 18k + hk = -124, k + 58 = 2b. Solve bi = 35i - 5 for i. 1 Let m = 318 + 122. Solve -67f - m = 21f for f. -5 Suppose -1553v + 1554v - 4 = 0. Let n = -5 - -13. Solve -m = -v + n for m. -4 Let f be -2 + 0 + (2 - -3). Let d(c) = -fc3 - 3c*3 + 7c*3 - 2c*3 + 7. Let p be d(0). Solve -2v + 25 = -pv for v. -5 Suppose -52x + 46x = -43x + 2072. Solve 3w = xw for w. 0 Let r = 27 + -28. Let z be (754/65)/(r2/20). Let x = 121 + z. Solve -4f = -xf + 1 for f. 1 Let d be (-44)/(-2) - (-66 + 61). Suppose 6 = -2o - 0, 4k - d = o. Solve -9 = -kt - 3 for t. 1 Let q be (-1 + -1 - -2)(2 - 1). Solve 55s - 188 + 23 = q for s. 3 Let g(n) = -2n3 + 236n*2 + 487n - 308. Let j be g(120). Solve 0 = -543h + jh - 66 for h. -6 Let y(u) = 50u - 12 - 3 - 17u*3 + 36u*3 - 7 - 20u*3 - 9u*2. Let v be y(-13). Let f = 1 + -1. Solve -4 = vx - f for x. -1 Suppose 6l = 3l + 6. Let p be (l - 6/(-5)) + 8/(-40). Suppose -s + n + n = 0, -ps - 2n + 16 = 0. Solve s = m - 0m for m. 4 Suppose 0 = -62s + 105 + 143. Solve 5w = 2w + sw for w. 0 Let j be -10 + 264/21 - (-8)/(-14). Suppose 4p - 4 = jd, -4d + 2d + 2p = 0. Solve 5l + dl - 35 = 0 for l. 5 Let t(d) be the first derivative of -d6/360 - d5/30 + 17d3/3 + 1. Let q(k) be the third derivative of t(k). Let o be q(-3). Solve -8 = -b - o for b. 5 Let m = -178 + -135. Let g = 317 + m. Solve -2p = 2 + g for p. -3 Suppose -z + 5f - 18 = 0, -3z + 2z - 9 = -2f. Let p be (z/(-6))/(1/(-6)) - -34. Let s = -25 + p. Solve -5 = g - sg for g. 1 Let x = 110 - 110. Suppose 8d - 6d - 16 = x. Solve -10g - 8 = -dg for g. -4 Let f be 3/((-24)/(-238)) + 237/(-316). Solve -fz = -19z + 40 for z. -4 Let s(u) = u3 - 103u*2 + 104u - 197. Let j be s(102). Solve 28q = jq - 126 for q. -6 Let c be (-4)/14 - (-88)/14. Let m(w) = -w*2 - 23w - 49. Let h be m(-17). Let i = -49 + h. Solve -c - 6 = ib for b. -3 Let y(f) = 10f + 290. Let q be y(-3). Solve 0 = 255n - qn - 10 for n. -2 Let w = 198 + -162. Suppose -4i - 8 = -w. Solve 0 = 4b - 1 - i for b. 2 Let o(f) = 2f2 + 2f - 18. Let x be o(3). Suppose -xw + 4y + 4 = -w, -3w - 5 = 5y. Solve w = -3j + 8j + 25 for j. -5 Let j(c) = c*2 + 3c + 3. Let g be j(-2). Suppose 0 = -6z - 14z. Suppose z = -18m + m. Solve m = o + g - 0 for o. -1 Suppose 3q = -x + 8957, -5q - 7x + 14917 = -11x. Solve 0 = 2979z - qz + 30 for z. 5 Let c(m) = 10m*2 - 10m - 3. Let l be c(-5). Let q be ((-15)/(-4))/((l/36)/11). Solve 0x + 15 = -qx for x. -3 Suppose 4h = 5b, -2h + 6h + 5b = 0. Suppose -12w + 114 = 66. Suppose h = -6a + wa + 12. Solve 3d + 0d - a = 0 for d. 2 Let s(a) = 7a3 + 443a*2 + 132a + 383. Let x be s(-63). Solve -y - 18 = xy for y. -3 Let d = -6194 + 6198. Solve l - 3 = dl for l. -1 Suppose s + 4u - 3 + 2 = 0, -21 = -5s - 4u. Let n = 2421 - 2416. Solve si + n + 0 = 0 for i. -1 Let a be ((-94)/6)/(-1) + (-2)/3. Let k be (4 + 20/(-8))2. Suppose -10d + 29 = -5d + kr, -2d = 5r - 23. Solve dw = 7w - a for w. 5 Let u(w) = -2w3 + 16 + 3w2 - w3 + 9 - 14w - 11w*2 + 2w*3. Let d be u(-5). Solve ds - 25s + 20 = 0 for s. 4 Suppose -5l = -3j - 40, -2l = -4l + j + 15. Suppose 3 = li - 12. Suppose ic + 15 = 8c.	{ "pile_set_name": "DM Mathematics" }
ppose -5s - 5f = -250, 3s - if + 2f - 130 = 0. Is s a multiple of 10? False Let z(o) = -2o3 - o2 + 3o - 8. Let r(u) = -3u*3 - 2u*2 + 5u - 15. Let x(f) = -3r(f) + 5z(f). Does 2 divide x(0)? False Suppose -2w = -2b + b - 141, -351 = -5w + b. Let g = -23 + w. Does 17 divide g? False Suppose 365 + 127 = 12g. Suppose -26 = j - g. Is 6 a factor of j? False Suppose -2j - 3d = -441, 2d - 485 - 634 = -5j. Does 9 divide j? True Let o(r) = 229r2 - 57r - 8 - 6 - 233r2. Is 47 a factor of o(-12)? True Suppose 8 = 4w - a, -2w + 5a - 12 - 2 = 0. Suppose 3y - 89 = -2j, -wj - y + 0y + 123 = 0. Does 13 divide j? False Let j = -10 - -13. Suppose 103 = ja - 170. Is 34 a factor of a? False Let a(r) = -30r + 204. Is 17 a factor of a(-17)? True Let j(k) = 219k2 + 2k - 3. Suppose 4q - 6 + 2 = 0. Does 24 divide j(q)? False Suppose b - 8 = -2h, h + b = -b + 7. Suppose -z = hz. Suppose -2s + 16 = 2q - zq, -q = 1. Is s a multiple of 9? True Suppose -8a + 486 = a. Suppose a + 66 = 2g. Is 5 a factor of g? True Let j = 450 + 210. Is 12 a factor of j? True Let y = 5 - 3. Suppose 10g - 384 = yg. Is 24 a factor of g? True Let d = 862 + -614. Does 4 divide d? True Suppose -3c + 1189 = 8r - 3r, r = c + 241. Does 3 divide r? False Let g(b) = -12b + 2b - 5b - 3b - 2. Does 28 divide g(-6)? False Let t(u) = 2u + 0 + u + 2u - 2. Let a be t(4). Is 9 a factor of (-3)/a - 1055/(-30)? False Let v be -3 - (49 + 5)/(-1). Let l = 285 - v. Is l a multiple of 15? False Suppose 8b = 4b + 20. Suppose -5a + 4g + 445 = -0a, -ba - 4g = -445. Let n = -20 + a. Is 18 a factor of n? False Let j = 179 - -445. Is j a multiple of 26? True Let p be (1/3)/(14/2856). Suppose -5w + 2o + p = 0, 3w - o + 5o = 46. Does 11 divide w? False Suppose 424 + 186 = 5i. Suppose 5y = -i + 427. Is 4 a factor of y? False Let a be (0/(-1))/((-2)/2). Suppose a = 4s - 0n - n - 185, -2s - 5n + 87 = 0. Is 7 a factor of s? False Let m be (-2)/5(-14 + 4). Suppose q - 2q = -m. Suppose 4b + q = -j + 44, 2b = -2j + 74. Does 18 divide j? True Let r = -1163 - -1762. Does 7 divide r? False Let j = 75 - 75. Suppose jl + v - 58 = -l, 177 = 3l + 2v. Is 13 a factor of l? False Let v = 48 - 35. Let c be ((-2)/4)/((-1)/(-2)). Does 8 divide v - (c + -1 + 1)? False Suppose -3a + 244 - 700 = 0. Let c = a + 317. Does 15 divide c? True Let s(n) = -n3 + 20n*2 + 72n - 33. Is s(23) a multiple of 4? True Suppose 5h - 2h - 336 = 0. Let i be 2 + 2-13-1. Suppose 0 = -2j + h + i. Does 15 divide j? False Let p(s) = 2s - 13. Let c be (-2)/4 + 37/2. Is p(c) a multiple of 4? False Suppose 0 = -0x - x + t + 181, -950 = -5x - 4t. Is x a multiple of 30? False Let i = 3 + -8. Let q(h) = h3 + 4h*2 + 2h - 1. Let r be q(i). Let v = -21 - r. Is v a multiple of 5? True Let h(d) be the second derivative of -4d5 + d3/6 - d. Let n be h(-1). Suppose 2l - 82 = -4b + 30, 3b = -4l + n. Is b a multiple of 7? False Let f = -18 - -25. Let c = 157 - 158. Let x = c + f. Is x a multiple of 3? True Let l(r) = 2r*2 - 15r + 7. Let w = 8 + -2. Let i be l(w). Let j = i - -26. Is 15 a factor of j? True Let c = -2055 + -483. Does 9 divide c/364/(-6)? False Let t(p) be the third derivative of p6/120 + p5/12 - p4/4 - p3/2 - 4p*2. Let j be t(-5). Let m = j + 2. Is 10 a factor of m? False Let z = 50 + -46. Suppose 0 = 2h - 2o - 3o - 77, o + 163 = zh. Does 5 divide h? False Is (456/(-10))/((-24)/240) a multiple of 24? True Let r(j) = -452j + 324. Is r(-4) a multiple of 17? False Let k(f) = -4f - 2. Let o be k(13). Let h = -25 - o. Is 5 a factor of h? False Suppose 4s = 3t + 992, 4t = -4s + 3t + 992. Let f = s + -160. Does 22 divide f? True Suppose -320 = 3g - 11g. Does 8 divide g? True Let w(g) = -3g + 26. Let z be w(9). Let t(f) = -71f - 4. Is 18 a factor of t(z)? False Let i be (4 - (2 - 2))/2. Does 46 divide ((-3)/9)/(i/(-276))? True Suppose 3h + 3b - 695 = h, 4h = -2b + 1370. Is h a multiple of 5? True Suppose 608 = -6p + 14p. Is p a multiple of 2? True Let a(t) = 4t + 9t + 14t - 21t - 63. Does 11 divide a(16)? True Let k(w) = 4w - 8. Is 4 a factor of k(25)? True Suppose -2k - 7t + 1674 = -9t, -2529 = -3k - 3t. Is 20 a factor of k? True Is (-1)/(-1) + 189 + 16/16 a multiple of 42? False Let q = 32 - 29. Suppose -44 = -i - i - 2x, 0 = -qi - 5x + 62. Let l = 59 - i. Is l a multiple of 5? True Suppose s = 5j - 545, 0 = 3j + 2s - 5s - 327. Suppose j = 9w - 350. Is 18 a factor of w? False Let g be 24/3010/4. Suppose gj - 11 = -j - n, 2n = -j - 3. Suppose ja + 2b = 261, 2a - 2b - 93 = b. Does 17 divide a? True Let z(i) = -7i + 4. Let k = -28 + 45. Let w = 11 - k. Does 11 divide z(w)? False Let o(i) be the third derivative of i5/20 - i4/12 - i*3/3 - 20i*2. Is o(-1) a multiple of 3? True Suppose -7x + 2578 = -3008. Suppose 30p - 33p = -x. Is p a multiple of 40? False Suppose 944 + 1576 = 4r. Is 10 a factor of r? True Is (-6)/(1/1)-4 a multiple of 8? True Let u = 85 - 49. Suppose -3k - 7 = -5j - u, 0 = -j + 2. Does 4 divide k? False Suppose 66 = 296g - 302g. Let s(d) = -2d2 + 12 + 4 - 6d - 18d. Is 19 a factor of s(g)? True Let d(x) = -x2 - 3x. Let t be d(-4). Let w be ((-126)/t)/(-3)2. Let q = 9 - w. Is q a multiple of 17? False Suppose 84n = 12934 + 7310. Does 15 divide n? False Let k(d) = -d*3 + 7d*2 - 7d + 6. Let p = -25 + 30. Does 7 divide k(p)? True Let q be 4/(-1)5/(-5). Suppose qr = -26 + 114. Is 22 a factor of r? True Let p(c) = -8c2 + 7c - 16. Let z(s) = s*2 - s + 1. Let y(x) = -p(x) - 2z(x). Is 21 a factor of y(5)? False Suppose -5n + v + 50 = -10, 4n = 4v + 48. Suppose -8f + n = -4f. Suppose -3z - f + 33 = 0. Is z a multiple of 7? False Let g(m) = 1481m + 21. Is g(1) a multiple of 105? False Let l(s) be the second derivative of s5/20 + 3s*4/2 + 7s*3/3 - 11s*2/2 + 21s. Does 10 divide l(-17)? True Let f(u) be the third derivative of -u*6/120 + 2u*5/15 - 7u*4/24 + 4u*3/3 - 18u*2. Is f(7) a multiple of 6? False Suppose 23g - 21g = 0. Is 4 - (g + -4 + 4) a multiple of 4? True Suppose 2q + 88 = -94. Let p = q + 175. Is 8 a factor of p? False Let h(c) = -17c + 0c + 3 - 2. Is 7 a factor of h(-2)? True Let c(p) be the second derivative of -p4/12 - p3/3 - 3p2/2 - 12p. Let u(s) be the first derivative of c(s). Does 8 divide u(-7)? False Let o(v) = -316v + 3. Let j be o(-2). Suppose 5b = 26 - 1, -b - j = -5f. Is f a multiple of 28? False Let v(j) be the first derivative of 19j*2/2 + 17j - 28. Does 18 divide v(8)? False Let s = -1345 - -3642. Is 8 a factor of s? False Let j be 4/((-3)/4 + 1). Is (-2)/8 + 612/j + -4 a multiple of 34? True Let i(w) = -16w + 4. Suppose 14 = -3f + 8. Does 12 divide i(f)? True Let i = 741 + -480. Is 7 a factor of i? False Let z(o) = 0o + 40o*2 + 32o*2 - 6o + 1 + 5o. Let m be z(1). Let x = 112 - m. Is x a multiple of 10? True Suppose 9o = 12o - 1413. Is 34 a factor of o? False Let m(o) = 5o + 3. Let c be m(-2). Let n be ((-33)/55)/(2/10). Is 2 - c - (-6)/n a multiple of 3? False Suppose -4b + 229 = -71. Suppose 2h = -0a - a + b, -3a - 3h = -234. Is 28 a factor of a? False Let d = -150 + 235. Suppose -3n + 5t = -0t - d, -5t = 4n - 90. Suppose o - 6o = -n. Does 5 divide o? True Let l(b) = b - 9 - 10 + 0b + 24. Let a be l(0). Suppose 7o - 26 = ao. Does 6 divide o? False Suppose -102o + 42o = -22260. Is o a multiple of 53? True Let o be ((-1)/5 + 1)5. Let s(l) = -l3 - ol*2 + 16l + 0l2 - 22l - 4. Does 4 divide s(-4)? True Let i(a) = a*2 + 26a - 47. Does 46 divide i(-39)? True Is -2(638/(-4))/1 a multiple of 29? True Suppose -67o - 5436 = -76o. Is o a multiple of 16? False Let n(m) = -15 + 10 + m2 - 7m + 11. Let g be n(8). Suppose -g + 5 = -r. Does 2 divide r? False Let q = -8 + 11. Let i be 3/(6/(-2)) + q. Suppose b - 72 = 2s - 6s, -is = -3b - 50. Is 6 a factor of s? False Let k = 668 + -547. Is k a multiple of 2? False Suppose -10d - 5d = 255. Let m(z) = -z*2 - 17z + 32. Is 8 a factor of m(d)? True Suppose v + 4v - 350 = 0. Suppose -q = -4q - 129. Let k = v + q. Does 19 divide k? False Let w(b) = -33b*2 + b - 1. Let d be w(-2). Let k = 193 + d. Let f = -24	{ "pile_set_name": "DM Mathematics" }
)4/(-34). -2/17 What is the value of ((34639/(-2115))/67)/(33/(-18))? 2/15 Calculate 5/325/(-250)(-4)/1. 2/3 What is the value of 6/20(-104)/(-78)50/4? 5 Evaluate ((-7)/(-6))/(-77(-2)/88)39. 26 Calculate (((-84)/147)/((-48)/(-56)))/((-2)/(-15)). -5 Calculate 71540/210027/(-2). -27 (-84)/(-48)((-4)/42)/(-2) 1/12 What is ((19720/(-4165))/(-116))/((-3)/((-42)/8))? 1/14 Calculate (6/(-16))/(2370/3792). -3/5 Evaluate ((-441)/66155/2)/((-12)/80). 10/9 Evaluate (5/5)/((-1)/((-35)/(-7))). -5 (-1)/(1/(-6))(-11431)/(-24495) 14/5 What is ((-36)/1629)/1? -2 Calculate -7(268/(-603))/(6/27). 14 Evaluate (135/27)/(-5(-1)/(-2)). -2 What is (-159)/533(-13)/(-9)? -13 What is (10/(-40)(-4)/(-1))/19? -1/19 Evaluate ((-72)/(-84))/(231/1962). 4/11 What is 9/((-135)/20)(-20)/(28320/36)? 2/59 Calculate ((-8)/70)/(1046/(-2615)). 2/7 (-980)/(-343)210/(-20) -30 Calculate -1(2880/(-20))/(-9). -16 -6((-26)/(-4))/((-357)/238) 26 What is ((-3)/(-5)-9)/(6/(-10))? 9 What is the value of ((-2)/(-2))/(19722/3114)? 3/19 (164/410)/((-4)/4) -2/5 6(-3)/(-10)14/798-19 -3/5 Calculate (((-2)/(-36))/((-1)/8))/(16/(-504)). 14 Calculate (2/((-16)/6))/(5280/704). -1/10 What is the value of ((-13)/(-104)-12)/(6/(-24)102)? 1/17 What is the value of (-10)/6(-1194)/995? 2 ((-3)/(-6)2)/(147/(-1617)) -11 What is the value of 4/7896/64? 1/13 Calculate (-1)/24-390/(-36). -15 Evaluate 3036/138(-2)/(-4). 11 What is (-23)/31395215? -1/13 (1-3)/((-25)/((-2500)/(-850))) 6/17 Calculate 15/10(2/(-18))/((-28)/1344). 8 Evaluate (((-180752)/237)/52)/(3/((-18)/8)). 11 Evaluate 11/11(-5)/((-25)/4). 4/5 Evaluate (370/(-1628)22)/(-2(-2)/(-4)). 5 What is the value of ((29-1)/((-3)/(-1)))/((-1358)/(-4074))? -29 What is the value of (-9)/42/(-6)-16? -12 Calculate ((-203)/232)/((-16)/128). 7 12/26(-32175)/675 -22 ((232/(-87))/((-2)/(-6)))/(8/8) -8 (-205)/3280(-9)/(-6)12/9 -1/8 ((-18)/144)/(15/40) -1/3 Calculate (-27)/2798/(-1197). 9 Evaluate ((-2)/12)/((-195)/520). 4/9 ((-26)/390)/((-50)/3750) 5 What is (((-18)/240)/((-4)/(-10)))/(-3)? 1/16 What is ((-14)/(-6))/(119/(-9282)65/(-10))? 28 Calculate 312/(-130)(-20)/(-12)2. -8 Evaluate (-4)/(-44)(-6)/681/27. -3/11 154/924(-54)/(-5) 9/5 26/26050 0 ((-1)/((-9)/((-3)/1)))/((-977)/(-20517)) -7 What is the value of ((-380)/(-304))/(10/96)? 12 (-5)/(-3)53/1060408 34 Calculate (-45)/(-2)27/(-1701)-14. 5 Evaluate (4/6)/((-24)/128(-28)/(-63)). -8 What is ((340/20)/(-34)2)/((-31)/2)? 2/31 What is the value of 5/2(-177)/(-3540)(-36)/(-3)? 3/2 Evaluate -8-2(-7)/(13832/(-19)). 2/13 Evaluate (27(-25)/14175)/((-3)/7). 1/9 What is the value of (-20)/(-15)(-7)/(-42)? 2/9 Evaluate 7/(-35)(-1)/(-1)10. -2 Evaluate (784/1344)/(14/(-6)). -1/4 What is ((-168)/(-420))/((-19)/(-5)1/(-1))? -2/19 Calculate ((-702)/36)/(512/(-80)). 26 What is the value of ((-9)/4)/((-303)/1616)? 12 Evaluate ((-1275)/2295)/((-5)/6). 2/3 Evaluate 25695/571(-2)/(-30). 3 (2/(-2))/((-2)/(17/(153/72))) 4 Evaluate (((-170)/35)/(-17))/(-245/(-42)). 2/15 Calculate -1((-3276)/8)/(-13)26/39. -21 What is (((-264)/20)/11)/((-33)/(-25))? -10/11 Evaluate 6/(3/3)(-5)/(-6). 5 Evaluate 58/(15544/201)(-8)/(-15). 2/5 9(-94)/(-423)12/(-20) -6/5 What is (((-8)/(-4))/((-20)/(-30)))/((-45)/2)? -2/15 ((-202)/303)/((-136)/(-36)) -3/17 Evaluate ((-68)/(-170))/((-8)/180(-12)/(-16)). -12 What is (-35)/(-966)-3-7(-6)/105? -1/23 Calculate ((-1584)/132)/(((-18)/15)/2). 20 ((-68)/153)/((-22)/9) 2/11 What is the value of -72/(-42)-2(-12)/(-8)? -1 What is the value of (12/(-1))/(-24)(-144)/(-9)? 8 Evaluate -563/13512. -28 Calculate (24/70)/((-13)/(-5))791/226. 6/13 Evaluate ((-2)/(-54))/(-1(-7)/(-84)4). -1/9 Evaluate 2/4-5(-54)/(-27). -5 Calculate ((-83)/25896-52)/(-11/4). -2/3 What is (2/(-10))/(900/1125)? -1/4 (9(-80)/(-168))/((-5)/(-210)15) 12 Calculate (4/8)/(39/(-858)). -11 What is the value of -24782/(-184)(-2)/17? -12 Evaluate (-63)/61040/728. -15 (((-196)/(-21))/(-1))/(4/36-6) 14 (152/(-19))/(968/(-66)(-3)/2) -4/11 What is (-220)/(-20)(-1)/1? -11 ((-56)/(-30))/(284/2130) 14 What is the value of (16/(-28))/((-48)/12)? 1/7 Calculate 62/(-6)(-6)/(12/(-17)). -17 Calculate 4(-2)/(-2)17(-3267)/6732. -33 ((-9108)/15939)/(2/(-70)) 20 Calculate (-9)/(-1)(612/27)/(-17). -12 What is the value of 17/(357/(-21))7? -7 What is the value of (-8)/(-64)(-480)/6? -10 -19((-323)/19)/17 19 208/(-676)4/(-24) 2/39 Calculate 22/11015(-3)/(-27). 1/3 Evaluate (-5)/(9(-5)/45). 5 Evaluate 2((-4)/14)/(((-8)/56)/1). 4 What is the value of ((-2)/7)/(20714/882)? -2/23 Evaluate (-4)/(3/(195/52)). -5 Evaluate (5/25)/((-2)/((-200)/(-4))). -5 What is (60/8)/(1023/(-124))? -10/11 What is ((-10)/3)/((-32)/(-64)(-12)/9)? 5 Calculate (15442/98)/(2/((-1)/1)). -33 Calculate ((63/14)/9)/(54/40). 1 What is (-16)/7107/(-856)? 2/7 (2/(-16)1)/((-52)/((-9568)/69)) -1/3 Calculate 1771/(-69)(-3)/7. 11 (((-396)/30)/22)/(3/5-21) 1/21 Evaluate (((-1122)/27)/(-17))/(4/91). 11/2 What is 3/(-29(-9)/783)? 9 What is the value of (105/(1925/(-42)))/(-3)? 4/11 What is 63/304/640/64? 7/8 Evaluate (125/(-4))/((-5)/4). 25 What is the value of (-5)/650(-312)/48? 1/20 What is the value of (3(-10)/675)/(-1(-8)/400)? -20/9 Evaluate ((-36)/162)/((-6)/648-3). -8 What is the value of (18/(-22))/((-51)/1122)? 18 (-45)/(-10)(-268)/134 -9 (34364/1547)/(-112/1) -4/11 13/((-13)/1)(-14)/(-2) -7 What is the value of ((80/(-25))/((-2)/(-15)))/(4/(-2))? 12 Calculate ((-5000)/(-750))/((-5)/(-12)). 16 ((-32730)/(-7637))/(10/(-84)) -36 What is (-80)/15-3(-4)/81? -8 What is the value of 1440/1260(-14)/4? -4 ((-221)/(-51))/((-546)/(-42)) 1/3 Evaluate 13/8(-174)/(-87). 13/4 Calculate (40/2)/(7/(-28)8). -10 Evaluate -1112/(-110)-5. -6 6/(60/35)-2 -7 Calculate (4/8)/(835/(-334)). -1/5 What is the value of (-48)/(-140)(100/(-35))/(12/14)? -8/7 Calculate ((-135)/(-10))/38(-35)/(-84). 15 Evaluate (-3)/(((-12)/(-14))/((-32)/1456-338)). -26 What is (19/(874/69))/((-3)/10)? -5 ((-1520)/900)/38-10 4/9 (94/((-8272)/(-132)))/((-1)/(32/(-6))) 8 -2617/238-7 13 What is the value of 3/39(-31)/(-62)16? 3/13 What is ((-2)/(-11))/(1150/120175)? 19 Calculate 3/(4(-57)/988). -13 What is (-315)/7981235/(-195)? 5/2 What is the value of 4384/5206(-19)/(-2)2/1? 16 What is (((-15)/70)/((-12)/(-14)))/((-11)/4)? 1/11 (10/(-570))/((-36)/(-54)) -1/38 Calculate 7/(15/((-630)/(-14)))(-1)/(-18). 7/6 What is the value of (29/((-928)/24))/((-63)/(-616))? -22/3 Evaluate (-250)/4250-1(-3)/(-3). 1/17 ((-4)/(-5))/(((-1560)/25)/24) -4/13 Calculate (-48)/22(-924)/(-168). -12 Calculate 9/271((-21)/(-245))/(-1). -1/35 What is 1/(-1)-2615(-24)/(-720)? 13 Evaluate (100/(-10))/10(-1)/1. 1 What is the value of ((-12)/9)/((-14)/(798/(-323)))? -4/17 What is the value of (4/(-11))/(188/(-1034))? 2 What is the value of (2/(-48)2)/(25/225)? -3/4 Calculate (-12)/(-18)12(-19)/(-8). 19 Calculate ((-2032)/(-1524))/(4/(-33)). -11 Evaluate (-1120/(-385))/(1/(105/(-10))). -6 Evaluate ((-60)/(-45)(-3)/(-36))/((-6)/(-4)). 2/27 Evaluate ((-225)/(-750))/(6/40)(-3)/(-3). 2 What is the value of ((105/(14/2))/(-1))/(30/(-36))? 18 What is the value of (6/(-12))/((-2035)/110)? 1/37 What is the value of 510/(-120)20/5? -17 Calculate ((45/20)/3)/(18/(-672)-7). 4 (-2)/1305/(-61) 10 2/((342/90)/19) 10 Evaluate 15(-12)/(-72)-2. -5 (-135)/(-240)20/180 1/16 (3/(-171))/(((-3)/54)/(2/4)) 3/19 What is the value of (-5(-48)/(-180))/(33/27-3)? 4/11 What is the value of ((-254)/(-635))/(((-3)/20)/3)? -8 What is (-333)/370(-10)/36? 1/4 (1020/(-221))/((-240)/(-2080)) -40 What is the value of (248/1860)/((-6)/20)? -4/9 What is -24((-5565)/(-126))/(-53)? 20 What is ((-16)/20)/((112/315)/8)? -18 Calculate 7/(-70)-2-5-1. 1 What is the value of ((1100/(-7381))/(-25))/((-6)/(-33))? 2/61 What is (((-1)/8)/1)/(4236/16944)? -1/2 What is the value of ((1575/(-5))/35)/9? -1 What is the value of (2/63)/(((-170)/(-1530))/((-1)/3))? -2/21 What is the value of ((-2)/(-6)54/20)/((-342)/(-684))? 9/5 Evaluate (15/25)/(2/(-3)(-252)/60). 3/14 Calculate 63/(-9)(-10)/213348/(-465). -24 Calculate 224/(-196)(9/(-6))/((-9)/(-12)). 16/7 (-17)/((-952)/70)(-2)/5 -1/2 What is ((-45)/30)/((330/48)/11)? -12/5 What is 32/14(-1890)	{ "pile_set_name": "DM Mathematics" }
ulate b(-2). -7 Let g(n) = 4n2 + 75n - 106. Determine g(-20). -6 Let a(p) = -2p2 + 20p - 8. Give a(0). -8 Let c(r) = 3r2 + 10r - 6. What is c(-4)? 2 Let p(g) = -g - 33. Calculate p(0). -33 Let i(h) = -h*2 + 15h + 53. What is i(-3)? -1 Let q(l) = l*3 + 3l*2 - 29l + 2. What is q(4)? -2 Let j(q) = 3q + 41. Determine j(-14). -1 Let v(z) = -z3 - 7z*2 - 7z. What is v(-8)? 120 Let v(p) = p*3 - 16p*2 + 6p - 35. Give v(16). 61 Let x(k) = 2k3 + 9k*2 + 10k + 2. What is x(-2)? 2 Let v(d) = -2d + 3. Calculate v(0). 3 Let g(n) = -n2 - 2n + 1. Calculate g(2). -7 Let o(z) = -4z2 - z - 8. Give o(4). -76 Let c(r) = -r + 10. What is c(-13)? 23 Let c(a) = a3 - a2 - 5a + 5. What is c(3)? 8 Let k(y) = 6y. Determine k(-6). -36 Let l(w) = w3 - 28w*2 - 25w - 111. Determine l(29). 5 Let b(o) = 5o2 - 11o - 37. Calculate b(-3). 41 Let n(c) = -c*3 - 17c*2 - 30c - 31. What is n(-15)? -31 Let c(v) = -v*3 - 38v*2 - 36v + 72. Determine c(-37). 35 Let q(t) = 7t + 2. Determine q(0). 2 Let z(o) = o2 + 13o - 10. Calculate z(-14). 4 Let y(u) = -u*2 - 9u + 7. Give y(-9). 7 Let b(y) = y*3 + 15y*2 - 50y + 74. Determine b(-18). 2 Let g(v) = -45v2 - v - 2. What is g(-1)? -46 Let c(v) = 2v*2 - 18v - 73. Give c(12). -1 Let g(o) = o*3 - 4o*2 + 3o - 7. What is g(3)? -7 Let d(n) = -n*2 + 6n - 3. Calculate d(7). -10 Let q(r) = r*3 + 19r*2 - 42r + 3. Calculate q(-21). 3 Let c(u) = u*3 - 7u*2 - 6u - 3. Calculate c(8). 13 Let t(s) = s3 - s2 - 10s + 10. What is t(-3)? 4 Let l(n) = n2 - 6n + 15. Give l(6). 15 Let x(b) = b*3 + 14b2 + b - 27. Give x(-14). -41 Let b(h) = h3 + h*2 + 3h - 3. What is b(1)? 2 Let c(u) = -u*3 + 8u*2 + 11u + 3. Determine c(9). 21 Let c(z) = z*3 - 3z2 + z + 3. What is c(2)? 1 Let z(o) = o2 - 10o. Calculate z(7). -21 Let j(f) = 2f*2 - 7f - 48. What is j(-4)? 12 Let k(m) = m - 34. Give k(13). -21 Let g(l) = 312l + 1880. Determine g(-6). 8 Let z(b) = -b3 + 5b - 6. Calculate z(2). -4 Let c(t) = t*3 - 6t*2 + 2t - 17. Calculate c(6). -5 Let c(d) = 250d + 253. Give c(-1). 3 Let l(h) = h3 - 7h*2 + h + 3. Give l(7). 10 Let d(b) = -9b + 24. What is d(11)? -75 Let b(v) = -9v + 164. Determine b(18). 2 Let m(r) = -r - 2. Give m(2). -4 Let f(y) = y2 + 17y + 48. Calculate f(-9). -24 Let c(t) = 3t3 - 1. Give c(1). 2 Let f(x) = x2 - 3x - 193. Give f(0). -193 Let p(b) = b*3 + 8b*2 + 5b - 13. Give p(-7). 1 Let w(q) = 4q - 191. Determine w(45). -11 Let h(x) = -4x. Determine h(2). -8 Let y(f) = f*3 - 3f*2 - 7f + 2. What is y(5)? 17 Let a(v) = v*3 - 3v*2 - 5v + 14. Determine a(3). -1 Let y(x) = -x*3 - 3x*2 - 5x - 7. Give y(-5). 68 Let o(y) = 32y - 124. What is o(4)? 4 Let t(d) = d3 - 50d*2 + d - 55. Give t(50). -5 Let w(r) = -3r - 7. What is w(-6)? 11 Let j(n) = n*2 + 12n - 4. Calculate j(-8). -36 Let v(z) = -z + 1. Give v(0). 1 Let q(v) = -v*2 + 6v + 13. Calculate q(6). 13 Let k(p) = 3p + 2. Determine k(21). 65 Let x(j) = -j3 - 6j*2 + 9j + 7. Calculate x(-7). -7 Let z(j) = j*2 - 5j + 4. Determine z(3). -2 Let v(p) = -p*3 + 30p*2 - 29p - 45. Calculate v(29). -45 Let l(p) = 4p - 2. Calculate l(2). 6 Let c(w) = -24w*2 - 10w + 7. What is c(1)? -27 Let m(u) = -3u - 4. Calculate m(-7). 17 Let b(f) = -f2 - 10f - 21. What is b(-6)? 3 Let d(c) = 4c - 1. What is d(2)? 7 Let j(x) = x2 + 55x - 972. Give j(14). -6 Let a(f) = -10f - 52. Give a(-4). -12 Let v(i) = 14i + 632. What is v(-45)? 2 Let f(m) = m*3 - 8m*2 - m + 4. Give f(0). 4 Let a(g) = -5g - 8. Give a(5). -33 Let u(i) = i*2 - 63i - 3. What is u(0)? -3 Let f(z) = -2z + 5. What is f(-7)? 19 Let f(k) = -31k + 2. Determine f(2). -60 Let c(q) = 45q + 79. Give c(-2). -11 Let s(t) = t2 - 4t - 4. Give s(-2). 8 Let r(h) = 3h2 + h + 4. Determine r(0). 4 Let s(m) = -m3 - 7m*2 + 7m - 7. Determine s(-8). 1 Let w(l) = l*2 - l + 5. What is w(4)? 17 Let a(c) = -5c + 119. Calculate a(26). -11 Let v(y) = 10y3 + 2y*2 - y - 2. Give v(-1). -9 Let m(r) = 4r*2 + 8r - 6. What is m(3)? 54 Let f(d) = -d*2 - 5d - 6. Calculate f(-5). -6 Let q(l) = -9l + 12. Calculate q(6). -42 Let o(a) = 4a + 73. What is o(-13)? 21 Let s(x) = 9x - 5. Give s(-4). -41 Let o(m) = -m2 + 2m + 3. Give o(-4). -21 Let n(l) = l*3 - 5l*2 - 7l + 40. Determine n(5). 5 Let r(w) = -3w - 22. Give r(-9). 5 Let t(z) = z2 - 68z + 1032. Determine t(23). -3 Let y(n) = n*3 + 7n*2 - 9n + 6. Give y(-8). 14 Let p(m) = 7m - 107. Calculate p(13). -16 Let l(i) = -16i*2 + 2i + 1. Give l(2). -59 Let b(q) = -2q3 - 4q*2 - 2q + 1. Calculate b(-1). 1 Let w(u) = 2u - 67. Determine w(22). -23 Let f(n) = 29n - 112. Give f(4). 4 Let c(w) = w*2 + 2w - 2. What is c(-9)? 61 Let h(v) = -v*2 + 14v + 114. Determine h(-6). -6 Let m(i) = i2 + i + 47. What is m(0)? 47 Let t(j) = j2 + 10j - 22. Calculate t(-12). 2 Let w(r) = 3r*2 - 2r. Give w(-2). 16 Let f(g) = -5g + 9. Calculate f(4). -11 Let k(g) = -43g - 379. Calculate k(-9). 8 Let z(o) = o + 12. Give z(15). 27 Let m(r) = -r*2 - 26r + 47. What is m(-25)? 72 Let n(s) = 2s3 - 4s*2 + 5s - 2. Give n(3). 31 Let j(y) = 15y + 189. Calculate j(-14). -21 Let c(d) = 21d + 15. Give c(8). 183 Let f(r) = -3r2 - 2. Calculate f(0). -2 Let l(p) = 2p. Give l(-5). -10 Let t(b) = -8b - 28. What is t(-3)? -4 Let t(v) = -4v + 3. Calculate t(0). 3 Let w(y) = -y*2 - 22y - 1. Give w(-22). -1 Let y(g) = g + 4. What is y(6)? 10 Let l(y) = -9y + 66. What is l(15)? -69 Let q(s) = -4s*2 + s + 1. Determine q(-1). -4 Let w(i) = -i - 69. What is w(0)? -69 Let q(a) = 2a*2 - 44a + 34. Give q(21). -8 Let n(u) = -29u + 9. Calculate n(2). -49 Let q(k) = k2 + k - 6. What is q(-5)? 14 Let q(g) = -g2 + 11g + 1. Determine q(7). 29 Let m(y) = y*2 - 11y + 2. Determine m(10). -8 Let d(w) = -23w - 5. What is d(3)? -74 Let q(y) = -y2 - 14y + 1. Determine q(-11). 34 Let d(x) = x + 3. Determine d(-4). -1 Let q(t) = -10t2 - t. Give q(-1). -9 Let w(t) = t - 3. Calculate w(-4). -7 Let o(i) = -i2 + 7i + 14. Determine o(-6). -64 Let i(f) = 2f - 27. Give i(14). 1 Let g(w) = w2 - 4. Determine g(2). 0 Let q(s) = 9s + 12. What is q(-5)? -33 Let x(k) = 13k + 4. Determine x(3). 43 Let r(p) = p2 - 9p + 6. Give r(6). -12 Let i(w) = 7w2 - 5w. What is i(3)? 48 Let x(r) = -r*3 - 9r*2 + 20r - 18. Calculate x(-11). 4 Let d(t) = t*3 + 2t*2 - 6t - 10. Give d(-3). -1 Let t(j) = -j*3 - 15j*2 + 3j + 28. Calculate t(-15). -17 Let a(d) = 4d3 + 2d*2 - d + 1. Calculate a(1). 6 Let d(m) = 31m - 956. Give d(31). 5 Let b(s) = s*3 - 16s*2 + 11s - 16. Calculate b(15). -76 Let f(a) = -a3 + a2 + 2a + 3. What is f(0)? 3 Let v(c) = c3 - 12c*2 + 15c - 15. What is v(11)? 29 Let d(w) = 5w + 22. What is d(-9)? -23 Let b(f) = -19f. Give b(2). -38 Let z(f) = f*2 + 14f - 1. What is z(-12)? -25 Let s(w) = -3w + 18. What is s(-13)? 57 Let i(j) = -15j - 335. What is i(-22)? -5 Let h(y) = 2y2 + 48y + 280. What is h(-13)? -6 Let l(x) = 2x3 + 6x*2 - 5x + 7. Give l(-5). -68 Let f(d) = -50d - 1. Give f(-1). 49 Let m(j) = -j + 6. Calculate m(6). 0 Let f(g) = -27g + 7. Determine f(2). -47 Let u(k) = 2k2 - k + 1. What is u(2)? 7 Let v(k) = 2k*3 - 9k*2 - 4k - 3. Give v(5). 2 Let c(b) = b + 9. Give c(-9). 0 Let u(p) = 3p2 + p + 5. Determine u(-2). 15 Let r(l) = -2l. Determine r(11). -22 Let i(s) = 2s2 + 28s - 71. Give i(-16). -7 Let f(r) = 6r + 84. What is f(-10)? 24 Let x(a) = a3 + 14a*2 - 3a - 18. Determine x(-14). 24 Let v(l) = -2l + 4. Calculate v(9). -14 Let c(z) = -16z - 2. What is c(-2)? 30 Let w(d) = d*3 + 5d*2 + 8d + 4. Give w(-4). -12 Let w(u) = 3u2 + 5u. Give w(-4). 28 Let z(s) = -s*3 + 21s*2 - 22s + 35. Calculate z(20). -5 Let i(d) = -d*2 + 6d + 283. Calculate i(20). 3 Let q(o) = o*3 + 19o*2 + 19o + 22. What is q(-18)? 4 Let r(l) = 7l + 27. What is r(0)? 27 Let i(g) = -4g*2 + 8g + 2. Calculate i(4). -30 Let p(h) = -h*2 + 18h - 31. Calculate p(17). -14 Let k(q) = -q*3 - 7q*2 - 4q + 10. Calculate k(-6). -2 Let l(g) = 2g3 + 13g*2 + 2g - 7. What is l(-6)? 17 Let g(k) = -k*3 + 3k*2 + k - 2. What is g(2)? 4 Let p(w) = -2w*2 + 4w - 5. Dete	{ "pile_set_name": "DM Mathematics" }
48 for z. 0 Solve 3z - 81 = 5o, 15z + 37752 = -13o + 37473 for o. -18 Solve -4j - 3b = -2, 3b + 10021 - 5013 = -10j + 5022 for j. 2 Solve -3r - 48 + 8 = 25679a - 25681a, 0 = 3a + 12 for r. -16 Solve -4 = -2q - a, -4q - 4177a + 4180a + 8 = 0 for q. 2 Solve 3c - 4c - 61 = -11m - 5c + c, 0 = 2m - 48c + 620 for m. 2 Solve -105f + 53f = -2g - 53f - 8, g - 6f - 35 = 0 for g. -1 Solve -3g - 68 = -0x - 4x, -6g + 161 - 123 = -2x - 9g for x. 5 Solve -2q - 32 = 2d, 2q = 106d - 106d - 3 + 1 for d. -15 Solve -3 - 36 = -q, 15q = -21d + 16d + 590 for d. 1 Solve -124 = 2n + c - 3c, -4n + 8c - 5c + 37 = 4c for n. -5 Solve n - 27 = -11j - 42 - 15, -2n + 40 = -3j for j. -4 Solve -5j - 1254 + 1214 = -3y, -4j - 24 = -4y for y. -5 Solve -36 = 5n - 3w + 93 - 40, -3n + w = 27 for n. 2 Solve -2c - 2 = -4x, c = 5x + 463 - 449 for x. -5 Solve -11b = -11, 6b - 2b - 19 = 5t + 69 + 81 for t. -33 Solve -r - 5c + 26 = -r - r, 7c - 6801 + 6727 = -6r - 2r for r. 4 Solve 31184v - 31187v - 105 = 5a, 0 = -5a - v - 105 for a. -21 Solve 142w + 212 = 8g + 146w, -2g + 4w = 202 for g. 1 Solve 38 = -8c - 2p, -379c + 384c = 8p - 33 for c. -5 Solve 10s - 5i = 70, 5s + 3i - 17 = 6i + 23 for s. 2 Solve u + 21u + 147 - 75 = 4b, -36 = 5b + 4u for b. -4 Solve -171z + 131z = 2b - 1318, -3z + 31 = -2z + 2b for z. 33 Solve 2o + 6393s = 6395s + 58, -5o = 6s + 119 for o. 5 Solve 4u - 1 + 21 = -4i, -80i + 52i + 6 = -16i + u for i. 1 Solve -4d - 5x - 93 = 0, -2x - 24 = 43d - 96d + 59d for d. 3 Solve -27h = -6207v + 6205v - 99, 2v = -4h - 6 for h. 3 Solve -450 = 5h + 8n, 45n - 81n + 289 = -7h - 41n for h. -2 Solve 0 = 5o, 7o = -4x + o - 0o - o + 200 - 208 for x. -2 Solve 0 = -3068t + 3064t - 3m - 33, -5m + 3 = -3t for t. -6 Solve -948u - 13 = 5x - 946u + 25, -2 = -x - 10u for x. -8 Solve 2j + 1 = -3w, 2j = 2947283w - 2947287w + 4 for j. -8 Solve -8v + 4v - 146 = -5c, -84v = 2c + 2c + 232 for c. 26 Solve -4l - 3u + 47 = 0, -22 = -u - 10 + 3 - 10 for l. 8 Solve 9i + 19t - 46 = 14i - 3i + 13t, 2i - 3t = -25 for i. -2 Solve 19k - 13k + m = 5 - 3, k - 14 = 3k + 4m for k. 1 Solve u = 2u + 3u + c, 21u - 12u + 13u + 2c = 4u - 41u for u. 0 Solve -12 = -2j - 0 - 4, -43l - 4j + 40 = -40l for l. 8 Solve 0 = 99f - 96f - 12, -2a - 46f - 90 = -48f for a. -41 Solve -w + 4g - 1814674 = -1814521, 4g = -4w + 168 for w. 3 Solve 23w + 4m + 6 = 0, w - 86m + 83m = -17 + 58 for w. 2 Solve -2y + 28 - 15 = 48b - 105 - 304, 0 = 3y - 3b + 42 for y. -5 Solve -7c + 381 = k, -17107k + 17112k = -4c + 231 for c. 54 Solve g - 29m + 27m = 37, -3m - 27 = 8g for g. 3 Solve -3q - 2g = 36, 2975q - 198 = 5940q - 2980q + 8g for q. 2 Solve -2x - 110 = -2m, 4986675x - 4986674x + 39 = -3m for m. 4 Solve 0u + 5u - 4n - 44 = 0, 5u - 72n - 33 = -69n for u. 0 Solve -4p - 34q - 228 = 0, -16698q = 2p - 16707q - 42 for p. -6 Solve 7z - 4k = 26, 5z - 362k + 364k + 3 = 7 for z. 2 Solve -4k - 5w - 20 = 3w - 0, -5w = -5k - 10 for k. -3 Solve 25w - 23w + 12 = 3o + 12, 3w = -3o for w. 0 Solve 2a + 2w = 52, 6a + 4w - 19 - 93 + 62 = 98 for a. 22 Solve 72 = 3h - 12p, 89h + 5p = 25h + 56h - 104 for h. -8 Solve 0 = -g + 5g - 12t - 5t - 6t + 200, -g - 2t + 28 = -4g for g. -4 Solve 40 = -5s, -2k - 30983 + 31025 = -4s for k. 5 Solve n = 78u + 63, 5n - 315 = -0u + 9u - 10u for u. 0 Solve 28w = 7l - 77, -4l + 2 - 2 - 5 = -w + 11 for l. -5 Solve 0 = -5z + 83a + 145a - 1343, -5 = 5z + 5a - 30 - 30 for z. 5 Solve 2t - 50i = -51i - 33, t + 19i + 590 = 0 for t. -1 Solve 61d - 63d = 11y - 6, -3y - 140 = 8d for y. 4 Solve c = -49u + 194, 3u + 67596 - 67598 = -5c for c. -2 Solve 3q - 7q = 24h + 84, 8h + 8 + 19 = -0h - q for h. -3 Solve 651j - p - 10p = 650j - 4p - 5p + 12, 3j - 76 = -34p for j. 14 Solve 7y = 5a - 66, 5y + 151a + 87 = 159a for y. -3 Solve -48w + 23 = -45w - i, -4w - 236 = -2i + 14i for w. 1 Solve 2o - 40z = -252, 12033z + 122 = -3o + 12029z for o. -46 Solve 0 = 4143n - 4141n - 3p + 2p - 75, 5n - p = 186 for n. 37 Solve 2i - 48m + 45 = 713, 0 = 3i - m - 8 for i. -2 Solve -1385430i - 12 = -5l - 1385436i, -4l - 3i + 6 = 0 for l. 0 Solve -4j - 3w - 36 = 0, 304 = -j - 4w - 301 + 596 for j. -9 Solve -129450q - 3v = -129447q - 27, -3q - 8 = -4v for q. 4 Solve -q = 4f - 7, 67 = 3f - 90597q + 90601q for f. -3 Solve -5g = 4802k - 4802k + 50, 0 = 3k - 4g - 55 for k. 5 Solve -13d = -2j + 63, 274j + 274j - 11 - 58 = 3d + 543j for d. -3 Solve b = -10q - 58, -604q + 599q = -4b - 97 for q. -3 Solve -3n + 45 - 20 = 75u + 37, 0 = -5n - u - 20 for n. -4 Solve -4v - 45 - 2 + 14 = 2q + 39, 11v = 3q - 232 for q. 4 Solve 2j + 0t + 3t - 29 = 0, 0 = 34850j - 34848j - 4t - 22 for j. 13 Solve z - 110h + 62h = -2686, -z = 5h - 282 for z. 2 Solve 4z - 28 + 1 = 3s, -10s = 93z - 96z - 3 for s. 3 Solve 321u - 6 = 322u - c, -139u = -4c + 564 for u. -4 Solve -7x + 46 = 5q + 61, 5q - 19 - 21 = 4x for q. 4 Solve 3z - 8z + 2i - i = -25 + 4, 14 = -2z + 6i for z. 5 Solve -989i + s - 283 = -984i, -3i = -18s + 135 for i. -57 Solve -17k + 7 - 25 = 7k + 266p - 267p, -2k - 166 = -4p for k. 1 Solve 14t - 5u + 10 = -49, 3t + 39 = 3u + u for t. -1 Solve -3v - 36w = -189, -776439 = 5v + 5w - 776809 for v. 75 Solve 2243o + m - 917 = 2474o, 0 = 2o + 5m + 43 for o. -4 Solve 6p - 4o - 5 = p + 196, 3p = -2o - 117 for p. -3 Solve v - i = -22, -32239v + 91 = -32244v + 4i for v. -3 Solve 27y = -3l - 2l + 31y + 13, -4l - 35y - 260 = -0l + l for l. -3 Solve -4h = 3l - 89, -4h - 4l + 721 = 597 for h. -4 Solve 0 = -241z - 239z + 475z - 4y - y + 15, 0 = 7z - 5y + 51 for z. -3 Solve 162j - 4v + 580 = 0, 3v + 43 = 3v - 3v - 8 for j. -4 Solve 9i + i - 4r + 0 + 6 + 4 = 4i + 2i - 2, 0 = -5r for i. -3 Solve 98 = 5t + 3n, 23t - 24t - 5n + 0 = -24 for t. 19 Solve -3y - 16 = n, 6n - 4n + 1525 - 1529 = 0 for y. -6 Solve 0 = -l - z - 1, -6z = 2l - 40 + 46 for l. 0 Solve 0 = 2x + p - 47, -5x + 3p = 1332 - 1224 for x. 3 Solve -4a - z + 13 = -52, -7 + 50 = 3z + 52 for a. 17 Solve 2x - 5w - 15 = 0, x - 10w + 28w = 15w + 10w + 30 for x. -5 Solve 6096x = -v + 4v + 6097x - 5, -3v = 12x + 12x - 120 for v. 0 Solve 0 = -14m + 12m + 2f + 1 + 1, -36m - 99f + 101f - 202 = 0 for m. -6 Solve 808w + 572 = 75w - 894, w - 2w + 2w = 4a - 22 for a. 5 Solve -4a = 3z - 148, -233449a - 476 = -233463a for z. 4 Solve 2 = 4s + 7n, -69n = -16s + 13s - 31n - 85 for s. -3 Solve -1753s - 1759s + 6 = -q - 3511s, 3s = -4q + 11 for q. -1 Solve 0 = -3b - 4s + 147 - 9 - 81, b - 255 = -21s for b. 3 Solve 3b = 2o - 19922 + 19864, 3o = -5b - 0b - 103 for o. -1 Solve -23 = 5k + 2y, -k = -55y + 50y + 12 - 2 for k. -5 Solve 106 = d - a + 97, -4d - d - 170a - 1180 = 0 for d. 2 Solve 8d + 386 = -f + 293, 0 = -4f - 4d - 36 for f. 3 Solve 8y + h + 14 = 6y + 3y, -8h - 29h - 557 = 2y for y. -1 Solve 6a - 18 = 2a + 6a + 19816x - 19815x, -2x = a + 15 for a. -7 Solve 24c = -5m + 10c + 13c + 6, -186 = -2m + 20c for m. 3 Solve -2u + 17x - 59x + 46x = 6, 5x = -5u + 30 for u. 3 Solve -3m + 160a - 7 = 159a, -3m = -232a + 931 for m. -1 Solve 0 = 2z - 7g + 229, 155z + g = 152z + 5g - 129 for z. 1 Solve -2y = 11i - 43, -4y - 2309i - 39 = -2312i for y. -6 Solve -5p - 4 = -w, -3p = -4w + 58964 - 58999 for w. -11 Solve 2t - 5h - 16 = 0, 2t - 2h + 4 - 8 = 9 + 3 for t. 8 Solve 2w - 33 = c, -164c + 169c + 145 = 5w for c. -25 Solve -5y + 40 = -5g, 3g - 89y + 598 + 928 = 68y - 500 for g. 5 Solve 0m + 3m - 24p + 12 = 0, 11p - 1 = 4m - 7 + 22 for m. -4 Solve -26813g + 26814g - y = y - 8 - 2, 18g = 4y - 52 for g. -2 Solve -30 = 3r - 5c, -8r - 16c + 323 - 103 = -13r + 147 for r. -5 Solve -1963w + 1961w - 22 = 12l, -3w - l - 4 + 4 = 16 for w. -5 Solve -496q = -5v - 4v - 237q - 262q - 60, 5q + 61 = -2v for v. -3 Solve -4n = 2x + 12, -599x + n = 3977 - 383 for x. -6 Solve b - 26 = -0b + 12s - 11s + 21s, -4s = 2b	{ "pile_set_name": "DM Mathematics" }
is the smallest value? (a) 0.07 (b) 5/19 (c) 4 (d) 2 (e) -28 e Which is the fifth smallest value? (a) 0.05 (b) 12 (c) -0.3 (d) -5 (e) -2/15 (f) -7/2 a Which is the biggest value? (a) 5 (b) 0.05 (c) 8/107 a Which is the biggest value? (a) 0.5 (b) 3 (c) -5 (d) -0.3 (e) 0 (f) -447 b Which is the third biggest value? (a) 3 (b) 4 (c) 11576 (d) 0.3 a What is the second biggest value in 29/72, 3, 1/5, -0.01, -1, -0.5? 29/72 Which is the fifth biggest value? (a) 2/5 (b) 44 (c) -5 (d) -0.4 (e) 4 c Which is the second smallest value? (a) 0.5 (b) -1/5 (c) -5 (d) 3 (e) -1/10 (f) 1/4 b Which is the smallest value? (a) -3/4 (b) 14.8 (c) -2/21 a What is the third biggest value in -4/21, -11/7, 7? -11/7 Which is the second smallest value? (a) 180 (b) 0.3 (c) -14 (d) 0.2 d What is the third smallest value in 3/8, 0, 39/4, -3/14, -4? 0 Which is the fourth smallest value? (a) 10 (b) -770 (c) 0.3 (d) 4 a Which is the third biggest value? (a) 10/7 (b) -58 (c) 48 b What is the fourth smallest value in -2, 5, -1/6, 0, -2/5? 0 What is the second smallest value in 5, 2/11, -4/5, 0.6? 2/11 Which is the biggest value? (a) 1/15 (b) -2/5 (c) 2/5 (d) 0.19 (e) -1 (f) 39 f Which is the fourth biggest value? (a) -1251/7 (b) -2/37 (c) 2/5 (d) 6/7 (e) 5/3 b What is the fourth biggest value in -0.1, 0, -516/143, -1/8? -516/143 What is the second biggest value in 0.01, 0, 178, 4/7? 4/7 What is the second biggest value in -4, -1/4, -0.11, 0, 2/11, 0.2? 2/11 What is the biggest value in 2351, 1, 0.2? 2351 What is the smallest value in 1/5, 0.07, 18, -0.5, 0.4? -0.5 Which is the fourth smallest value? (a) 2/41 (b) -34174 (c) 2 (d) 1 c Which is the biggest value? (a) -1/10 (b) -2/10875 (c) -8 (d) -2 (e) 0.4 e What is the smallest value in -3/5, 3/4, -19, -2? -19 Which is the second smallest value? (a) 5 (b) -2 (c) -5 (d) 218 (e) 0.6 b Which is the biggest value? (a) 37 (b) 1/15 (c) 20 a Which is the fifth biggest value? (a) 48/17 (b) -2 (c) -5 (d) -2/11 (e) -1/2 c Which is the second smallest value? (a) -5 (b) -3/2 (c) -2/33 (d) -757 a Which is the third smallest value? (a) -0.04 (b) 2/9 (c) -0.1 (d) 1.5 (e) 5 (f) 0 f Which is the third smallest value? (a) 2 (b) -2/7 (c) -0.021 (d) -207/5 c What is the third smallest value in -3/5, -2/9, -0.03, -685, 2/7, 0? -2/9 Which is the biggest value? (a) 2/9 (b) 5.02 (c) 1/6 b Which is the second biggest value? (a) 4 (b) 309/5 (c) 0.3 (d) -0.4 (e) -5 (f) -1/4 a What is the smallest value in 1916, -3, 0.7? -3 Which is the fifth biggest value? (a) 0.5 (b) -5 (c) -0.5 (d) -0.6 (e) 645 b What is the smallest value in -1/4, 431, -5? -5 What is the smallest value in -4, -2, -2/519249? -4 Which is the fourth biggest value? (a) -0.219 (b) -4/5 (c) 2/7 (d) -3 (e) 2 b Which is the biggest value? (a) -1.1 (b) -0.4 (c) -30 (d) -3/5 (e) -0.3 e Which is the biggest value? (a) -1 (b) -1910 (c) -2/11 c What is the third smallest value in 4, -1, -459, 29? 4 Which is the fourth biggest value? (a) 3 (b) 1.14 (c) -0.2 (d) 2.6 c Which is the third biggest value? (a) 8 (b) 0.4 (c) -5 (d) 53 (e) -2 b Which is the fourth biggest value? (a) 7 (b) -4/9 (c) -857 (d) 4 c What is the biggest value in -3, 61, -0.3, 0.1377? 61 Which is the smallest value? (a) 1.0603 (b) -4 (c) 0.5 (d) -0.1 b Which is the fourth smallest value? (a) 7 (b) 4 (c) 2 (d) 857 d Which is the second smallest value? (a) 2/5 (b) -6 (c) -0.5355 c What is the second smallest value in -344, -2/67, 2? -2/67 What is the smallest value in 5, -2, 7830? -2 What is the fourth smallest value in -3, 2/11, 0.4, 7/6, 0.1, -2/5? 2/11 Which is the fourth smallest value? (a) -1.6 (b) -0.7 (c) -2 (d) -26 (e) 2 b What is the fourth smallest value in 4/11, 2, 3, -1/4367? 3 What is the second smallest value in -3/5, 3, -57.514, 0? -3/5 Which is the fifth smallest value? (a) 3 (b) 5 (c) -0.1 (d) -194 (e) -3 b What is the third smallest value in 6, 4/7, 0.015, -6? 4/7 What is the fourth biggest value in -3, -1/3, 3, 41, -0.045, 5? -0.045 Which is the third biggest value? (a) 4 (b) 2589 (c) -2/5 (d) -2 (e) 0.1 e What is the fifth biggest value in 19, -3, 0.111, -1, 1/12? -3 What is the smallest value in 18, 0.3838, 5? 0.3838 Which is the third biggest value? (a) -0.4 (b) 1385 (c) 0 (d) -1/6 (e) 1 (f) 1/3 f What is the fourth smallest value in -5.7, -1/9, 615, 3? 615 What is the second biggest value in -2/71, 1.3, -3/7? -2/71 Which is the second biggest value? (a) -0.5 (b) -5 (c) 1/2 (d) 1 (e) 135 d What is the smallest value in 6, 0.74, 13.6, 4, 5? 0.74 What is the third smallest value in -20/13, -15/4, 1? 1 Which is the third smallest value? (a) 0 (b) -5 (c) 2 (d) 1/400 d What is the smallest value in -23.9, -7, 2, 368, -3? -23.9 What is the fourth biggest value in 0.1, 0.5, -1.1938, 5? -1.1938 What is the biggest value in -2.2, -19/7, 0.1, 4/3? 4/3 Which is the third smallest value? (a) -1532 (b) 3 (c) -0.0581 b Which is the fifth biggest value? (a) -9 (b) -3 (c) 2 (d) -2/7 (e) 0 (f) -4/9 b What is the fourth smallest value in -1/10, 38573, 0.5, 11? 38573 Which is the fourth smallest value? (a) -0.046 (b) 3 (c) -2/3 (d) 8/9 b Which is the second biggest value? (a) -1/9 (b) 0.085 (c) -149 a Which is the second smallest value? (a) -5/2 (b) 5 (c) -16 (d) 66 a What is the fifth biggest value in -4/3, -2/9, -12.1, -0.15, -8? -12.1 Which is the second biggest value? (a) 4 (b) 2 (c) 1619 (d) 0.7 a What is the fourth biggest value in 370, -7, 0, -1? -7 What is the fifth smallest value in -2/3, 36, 5, 0.1, 2, 0.5? 5 What is the biggest value in -2, -1/4, -20, -0.41, -3, 5/3? 5/3 Which is the fourth smallest value? (a) -4/7 (b) -2 (c) -0.2 (d) 0.3 (e) -0.04 (f) 2/47 e Which is the third smallest value? (a) -0.105 (b) 2 (c) 0 (d) -35 c Which is the third smallest value? (a) -0.07 (b) -95 (c) -1 (d) -3.2 c Which is the biggest value? (a) 1 (b) -8 (c) 1/7 (d) 0.2 (e) -2/17 a What is the sixth biggest value in 0.06, 5, -0.1, 3, 0, -24? -24 What is the smallest value in -4, 2, 21/4, 0.1, -2.88? -4 What is the third biggest value in -63, 3, -1, -3, 4? -1 What is the third smallest value in -1009/3, 0.6, -76? 0.6 Which is the second biggest value? (a) 1/4 (b) 0 (c) 1/3 (d) 2 (e) 1/6 (f) 4/3 f Which is the third biggest value? (a) -4 (b) 16426 (c) 2/7 a What is the fourth biggest value in -8, -5, 2252, -0.1? -8 What is the second biggest value in 3/4, 2/17, 3/7, -3/28? 3/7 Which is the fourth biggest value? (a) -1/2 (b) 566 (c) 0.31 (d) -5 d Which is the fourth biggest value? (a) 26 (b) -28 (c) 5/4 (d) -0.5 b Which is the second smallest value? (a) 3 (b) 6 (c) -1/1000 a Which is the second biggest value? (a) -0.4 (b) 0.4 (c) 2 (d) 158 (e) 0.5 c What is the second biggest value in 0.2671, -241, 0.3? 0.2671 What is the third smallest value in -1, 2822, -9/5? 2822 What is the third biggest value in -67, 2, -28, -37, -12? -28 What is the third biggest value in 1/783, -0.06, -2? -2 Which is the fifth biggest value? (a) 1 (b) 11 (c) 4 (d) -6/11 (e) 22/3 d What is the smallest value in -3, -1/6, 0.2, -5.125? -5.125 Which is the third biggest value? (a) -1 (b) -300 (c) -13 (d) 0.2 (e) -3 e What is the smallest value in 5, -1, 3, -81, 15? -81 Which is the third biggest value? (a) 5 (b) 0.06 (c) 1 (d) 4.2 c Which is the fourth smallest value? (a) -3.5 (b) 0.02 (c) -2 (d) -2/9 (e) 0 e Which is the smallest value? (a) 4/9 (b) -11 (c) 20 (d) 3 b Which is the fourth smallest value? (a) -1 (b) 0.5 (c) -1475 (d) -4 (e) -2 a Which is the second biggest value? (a) 1/7 (b) 0.4 (c) 87276 b Which is the fifth smallest value? (a) 2/17 (b) -3 (c) -141 (d) 2 (e) -1/27 (f) 4 d What is the third smallest value in 0.03, -0.2, 126/19? 126/19 What is the second biggest value in 2/9, -0.17, -5, 0.3, 6? 0.3 Which is the third smallest value? (a) -277 (b) -144 (c) 0.5 (d) -1/13 d What is the second smallest value in -5, -57, -1.4, -1.43? -5 Which is the biggest value? (a) 0.2 (b) 8 (c) -1/8 (d) -0.5 b What is the smallest value in -14, -0.1, 2/7, 12? -14 What is the fourth smallest	{ "pile_set_name": "DM Mathematics" }
denominator of 99/4 and t. 4 Let o = 220595505/622 + -354655. Find the common denominator of o and -101/2. 622 What is the common denominator of (-3)/(-6) + ((-4669)/312)/23 and 61/16? 624 Suppose 0 = l - 2 - 1. Let u(o) = -o*2 + 14o - 11. Let i be u(11). Calculate the common denominator of l/4(-92)/i and 121/40. 440 Suppose 3n = 13 - 4. Let f be ((-4)/(-6))/(16/(-456)). Let p = f - -21. What is the smallest common multiple of n and p? 6 Let p = 7683 - 138205/18. What is the common denominator of 109/168 and p? 504 Let v be (-32)/20 + (-2)/5. Let a be ((-5)/10)/(v/12). Suppose 0 = i + ai - 16. Calculate the least common multiple of 22 and i. 44 Let j(m) = 4m - 4. Let a be 3(8/6)/(12/(-66)). Let t = 29 + a. Calculate the lowest common multiple of j(3) and t. 56 Suppose 0 = 5h - 5z - 100, -3h + 40 = -3z + 5z. Calculate the lowest common multiple of h and 176. 176 Suppose 5o - 9 + 59 = 0. Let b = 19 + -11. What is the smallest common multiple of b and ((-36)/(-10))/((-2)/o)? 72 Let r = 351 - 343. What is the least common multiple of 70 and r? 280 Suppose 0 = 4i - 2q + 14, 7 + 7 = -3i + 5q. What is the smallest common multiple of (2 - (-32)/10)/(i/(-15)) and 10? 130 Let f = 11721/8 + -1462. Calculate the common denominator of f and 33/4. 8 Suppose -142 + 52 = -3x. Let v = -32 + x. What is the lowest common multiple of ((-45)/v)/94 and 22? 110 Let f = 2191/792 - 63/22. What is the common denominator of f and -62/117? 936 Suppose 2g - 10g + 16 = 0. Let t = 17 + -8. Calculate the lowest common multiple of ((-20)/(-8) + -2)/(g/12) and t. 9 Suppose g + 3b - 63 = 0, 0 = 2g - 4b + 13 - 149. Calculate the common denominator of -5/9 and g/(-18) - (-2)/(-5). 45 Let y(n) = n*3 + 34n*2 - 73n + 52. What is the least common multiple of y(-36) and 88? 88 Suppose -x + 81 = -3z + 229, 3x + 4z + 392 = 0. Calculate the common denominator of -17/25 and ((-3)/12)/((-15)/x-2). 75 Let o be 3 - 0/3 - 1. Suppose 0 = oy - 34 + 8. Find the common denominator of 555/(-26) + (-2)/y and -4/11. 22 Suppose -58o + 65o = 1036. Calculate the common denominator of -151/6 and o/(-40) - (0 - 3). 30 Let c(a) = a2 - 10a - 5. Let v be c(11). Suppose -2d + 208 = vd. Calculate the lowest common multiple of 8 and d. 104 Suppose 5d = 5k - 10, 3k - 4d - 3 = 2. Suppose 10v = kv + 35. Suppose -11 = t + vb, t + 3b + 1 = -t. What is the least common multiple of 16 and t? 16 Let p be -15/((-20)/(-24)). Let x = -1057 - -11650/11. Calculate the common denominator of 445/22016/p and x. 11 Let k = 19709/48 - 821/2. Calculate the common denominator of k and 29/12. 48 Let i(k) = -30 + 14 + 13 + k + 11. Calculate the lowest common multiple of i(-5) and 30. 30 Let h = 2279 + -18201/8. Find the common denominator of 3/391 and h. 3128 Let d be ((-3)/6)/((-3)/24). Suppose 0 = 4y + y. Suppose g + 2j = y, 20 = dg - j + 4j. Calculate the lowest common multiple of 8 and g. 8 Let w = 1/4495 + -76439/107880. Find the common denominator of w and (2/48)/((-4)/1016). 24 Find the common denominator of 0/3 - (-34)/11 and (-6)/4 + (-10)/(220/(-3)). 11 Let v be ((-3)/(-3))/((-1)/2598). Let y = -28608/11 - v. What is the common denominator of y and ((-2)/(-3))/((-28)/(-318))? 77 Let i(x) = -4x. Let s be i(-7). Suppose -13q = -209 - 129. Let y = s - q. Calculate the least common multiple of y and 10. 10 Let t = 38 + -38. Calculate the least common multiple of 100/5(1 + t) and 16. 80 What is the smallest common multiple of 63 and (-13)/(156/560)(-6)/4? 630 Suppose -3x - 546 = -606. Calculate the lowest common multiple of x and 362. 3620 Let v = 22 + -10. Suppose 2p + v = -p. Calculate the common denominator of 6p/884 and 123/10. 110 Suppose -4u + 57 = 5z, 4z = 5z - 2u - 3. Calculate the least common multiple of 9 and z. 9 Let b = 15 - 8. Suppose 2o - 55 = 5. What is the smallest common multiple of b and (-1)/(o/(-9) + 3)? 21 Suppose 0 = -0g + g - 32. Suppose -5c - 48 = -5w + 3w, 2c - 20 = -2w. What is the least common multiple of g and w? 224 Let q(i) = i3 + 2i*2 + 20i - 4. Let u be q(-8). What is the common denominator of -97/6 and (2/(-36)u)/(24/9)? 12 Let l = 25 - 23. Let g be 14242/18(-3)/l. Let n = 1191 + g. What is the common denominator of -119/6 and n? 6 Let u be (-2043)/(-1008) + 2/7. Let j = 1123/112 - u. Find the common denominator of 87/4 and j. 28 Suppose -2s = p - 29, -3s + 6s = -2p + 53. Suppose 2u = 282 - 288. Let d = u + p. What is the least common multiple of 6 and d? 48 Let b = 26 - 22. What is the common denominator of ((-435)/(-700) - b) + (-9)/(-21) and -145/54? 540 Let x be (120/140)/((-1)/(-511)). What is the common denominator of (x/40)/((-9)/(-6)) and -21/10? 10 Let t = -13742 - -32664736/2377. Let b = t - 87971/26147. Let z = 42268/9 - 4689. Find the common denominator of b and z. 99 Calculate the least common multiple of (-15)/(-10)(-100)/(-15) and 662. 3310 What is the common denominator of (151/(-4) + 0)(-6)/45 and 49/2? 30 Let z = 875888603 + -5541747209441/6327. Let v = -2/703 + z. Let c = -18235/6 + 3046. Calculate the common denominator of c and v. 18 Let s(h) = 0 - 2h*2 - 2 - 2h*3 - 7h*3 + h + 6h*3. What is the least common multiple of s(-2) and 8? 24 Let t = 48 - 48. Suppose 4a - 16 = -t. What is the lowest common multiple of a and 36? 36 Suppose -3i = -3o + o - 1, -2i + o + 2 = 0. Let p(u) = -7u*2 + 9 - 5u*3 + 5u*3 - 2u3 + u3. Calculate the smallest common multiple of p(-7) and i. 9 Calculate the common denominator of (132/(-176))/((-10)/(-108)) and 62/237. 2370 Let k(t) = t + 13. Let q be k(-8). Suppose 0 = qn - 84 - 6. Find the common denominator of -139/18 and (-88 + -1)/(n + -20). 18 Let a(y) = -y3 + 16y*2 - 15y + 7. Let z(s) = s. Let m be z(-12). Calculate the least common multiple of a(15) and (-9)/m - 100/(-16). 7 Let p = 12 - 3. Suppose 62 + p = x. Calculate the common denominator of -107/14 and 0/4 - x/10. 70 Let r(f) = -f*2 + 11f - 6. What is the least common multiple of (-17748)/(-442) + 2 + (33/39 - 3) and r(6)? 120 Let d = -204503/20 - -10228. Let p = 6895/4 - 1749. Find the common denominator of p and d. 20 Let r(v) = v*2 + 2v - 29. Let u be r(8). Calculate the common denominator of (-5)/((-50)/u) - 3 and 27/7. 70 Suppose 2j = 5u - 1042, 2j - 203 = -u - 3j. Suppose 0 = -2q + k + k + 96, -5q + u = 3k. What is the smallest common multiple of q and 32? 352 Let j be (-7)/(-7) - 10/2. What is the common denominator of (-11)/(-2) + (-2)/(-6) and 20/j - 95/70? 42 Let b = 17 + 7. Let d = -89 - -92. Suppose -dj + 18 = -24. Calculate the least common multiple of b and j. 168 What is the common denominator of (-146)/306/(-4) and ((-12)/(-42))/1 - (-1354)/308? 110 Suppose 0p - 5p = 5. What is the common denominator of ((-15)/14)/(5/15) and (-2 + 50 + p)/(-6)? 42 Suppose 5t - 3h + 59 = 0, -28 = 6t - 2t + 4h. What is the common denominator of 20/(-16) + 21/35 and (-3)/5t/28? 140 Let f = 56 - 36. Calculate the lowest common multiple of (75/f - 4)-4 and ((-8)/(-10))/((-3)/(-15)). 4 Let n(j) = 6j + 15. Suppose 5s = 3s + 72. What is the smallest common multiple of s and n(-1)? 36 Let r = 3181 - 57377/18. Calculate the common denominator of r and (-82)/32 - 1/1. 144 Suppose 39m - 65m = -3536. What is the least common multiple of m and 1? 136 Let f(g) = -2g - 10. Let t be f(-10). Let y = 15 - t. Suppose 4x - 8 = 0, 0 = yz - 6z + 2x + 14. What is the least common multiple of 18 and z? 18 Calculate the common denominator of ((-95)/105)/((-100)/70) and 103/18. 90 Let k = 23 + -401. Let u = k - -4577/12. Calculate the common denominator of 77/10 and u. 60 Let h = -16918 + 812101/48. Calculate the common denominator of -17/36 and h. 144 Let a(r) = r*2 + 5r - 18. Let c(b) = -2b2 - 9b + 36. Let p(l) = 11a(l) + 6c(l). What is the least common multiple of 2 and p(0)? 18 Let w(u) = -5u + 5. Let g(b) = b3 + 6b*2 + 7b + 9. Let a be g(-5). What is the lowest common multiple of 27 and w(a)? 270 Let y(v) = 2v + 10. Let f be y(-7). Let n(x) = 2x + 2. Let h be n(f). Let p = h + 20. Calculate the least common multiple of 2 and p. 14 What is the common denominator of ((-33)/(-660))/(0 + 4/730) and 67/2? 8 Let g be (-24186)/(-40) + 20/(-50). Let	{ "pile_set_name": "DM Mathematics" }
1, b: 2}. 3/14 Calculate prob of picking 1 w and 1 p when two letters picked without replacement from {w: 4, p: 14}. 56/153 Four letters picked without replacement from {w: 10, l: 1, p: 4, t: 4}. Give prob of picking 2 w, 1 p, and 1 t. 60/323 Calculate prob of picking 3 a and 1 h when four letters picked without replacement from {m: 2, h: 3, a: 10}. 24/91 Calculate prob of picking 1 s and 1 z when two letters picked without replacement from ozoszoss. 3/14 What is prob of picking 1 p and 1 u when two letters picked without replacement from {j: 1, p: 2, u: 1}? 1/3 Four letters picked without replacement from ooeyaon. Give prob of picking 2 o, 1 n, and 1 e. 3/35 Calculate prob of picking 1 j and 1 p when two letters picked without replacement from {m: 1, j: 5, p: 1, y: 2}. 5/36 Calculate prob of picking 3 u and 1 y when four letters picked without replacement from {u: 4, y: 1, i: 1, x: 5}. 2/165 Calculate prob of picking 2 y when two letters picked without replacement from {p: 4, y: 5, s: 7}. 1/12 Two letters picked without replacement from upeep. What is prob of picking 2 e? 1/10 What is prob of picking 1 j and 1 k when two letters picked without replacement from jjjrjpjjbpkbjrjtp? 1/17 Three letters picked without replacement from aigkbaaa. Give prob of picking 1 g, 1 k, and 1 i. 1/56 Two letters picked without replacement from tttz. What is prob of picking 2 t? 1/2 Four letters picked without replacement from pezzezepzz. Give prob of picking 2 z and 2 p. 1/21 Three letters picked without replacement from sidkdskkdiksdkdwss. Give prob of picking 3 s. 5/408 Three letters picked without replacement from aal. What is prob of picking 3 l? 0 Four letters picked without replacement from {n: 5}. What is prob of picking 4 n? 1 What is prob of picking 1 p and 1 f when two letters picked without replacement from {p: 4, f: 8, j: 5}? 4/17 Two letters picked without replacement from {e: 7, z: 3}. Give prob of picking 2 z. 1/15 Two letters picked without replacement from njnaajaatajjaaajja. Give prob of picking 2 n. 1/153 What is prob of picking 1 x and 3 f when four letters picked without replacement from {x: 2, f: 8}? 8/15 Calculate prob of picking 2 p when two letters picked without replacement from npp. 1/3 Two letters picked without replacement from emooqmeee. Give prob of picking 2 e. 1/6 Four letters picked without replacement from {v: 5, n: 2, j: 1, t: 2, g: 1, q: 2}. What is prob of picking 2 q and 2 n? 1/715 Calculate prob of picking 2 n when two letters picked without replacement from {n: 2, v: 1}. 1/3 Three letters picked without replacement from iiii. Give prob of picking 3 i. 1 What is prob of picking 1 k, 2 i, and 1 z when four letters picked without replacement from {i: 2, z: 4, k: 1}? 4/35 What is prob of picking 2 z when two letters picked without replacement from zyvvyzyzvvbvbyyyyyyy? 3/190 Three letters picked without replacement from frrfffff. What is prob of picking 2 r and 1 f? 3/28 Two letters picked without replacement from kkkktkkktt. What is prob of picking 2 k? 7/15 Calculate prob of picking 4 x when four letters picked without replacement from {x: 6, o: 4, b: 10}. 1/323 Two letters picked without replacement from lwposwpopoo. Give prob of picking 2 p. 3/55 What is prob of picking 1 a, 1 q, and 2 o when four letters picked without replacement from {o: 2, q: 9, a: 5}? 9/364 What is prob of picking 1 p and 2 w when three letters picked without replacement from ppwpwwpwpppw? 7/22 Calculate prob of picking 1 b and 1 f when two letters picked without replacement from fubccbccccccbbv. 4/105 What is prob of picking 2 h when two letters picked without replacement from rhhhlrrhrhrhrrrrrrr? 5/57 Two letters picked without replacement from {d: 6, t: 3, i: 6}. Give prob of picking 2 d. 1/7 What is prob of picking 2 y, 1 m, and 1 i when four letters picked without replacement from bykbbbkmybmyybyiyb? 1/102 Four letters picked without replacement from {w: 6, q: 11, a: 1}. Give prob of picking 3 a and 1 q. 0 Calculate prob of picking 1 h, 1 m, and 2 e when four letters picked without replacement from hkhhhkekhhkmhhhhheh. 1/323 Two letters picked without replacement from {a: 2, j: 1, s: 1, z: 1, r: 1, p: 1}. What is prob of picking 1 j and 1 z? 1/21 What is prob of picking 2 c and 1 t when three letters picked without replacement from {t: 5, j: 6, c: 3, f: 1}? 3/91 Three letters picked without replacement from ckcc. Give prob of picking 1 k and 2 c. 3/4 Calculate prob of picking 1 u, 1 c, and 1 j when three letters picked without replacement from {d: 1, l: 8, e: 1, j: 7, u: 2, c: 1}. 7/570 Four letters picked without replacement from {c: 5, b: 7}. Give prob of picking 1 b and 3 c. 14/99 What is prob of picking 1 c and 1 b when two letters picked without replacement from {a: 1, c: 2, h: 3, b: 1}? 2/21 Two letters picked without replacement from kzxkkkpkh. Give prob of picking 1 h and 1 z. 1/36 Two letters picked without replacement from vssv. Give prob of picking 2 v. 1/6 What is prob of picking 2 y when two letters picked without replacement from yyyyyyyyyyyqq? 55/78 Calculate prob of picking 2 r when two letters picked without replacement from {m: 6, r: 7}. 7/26 Three letters picked without replacement from {f: 3, w: 3, b: 1}. What is prob of picking 3 f? 1/35 Two letters picked without replacement from jxxejeejjexexxxx. Give prob of picking 2 e. 1/12 Four letters picked without replacement from {w: 4, z: 1, v: 3, i: 3, k: 2, y: 3}. What is prob of picking 1 z, 2 v, and 1 y? 9/1820 Three letters picked without replacement from {t: 3, k: 1, u: 5, p: 4}. What is prob of picking 1 t, 1 u, and 1 k? 15/286 Two letters picked without replacement from ukkkhkuhukhh. Give prob of picking 2 h. 1/11 What is prob of picking 3 w when three letters picked without replacement from wyyeynyenyrwywe? 1/455 What is prob of picking 1 y, 1 u, 1 e, and 1 d when four letters picked without replacement from {d: 1, y: 1, u: 3, e: 10, m: 2}? 3/238 Two letters picked without replacement from vvvvvvsvvvvsv. What is prob of picking 2 s? 1/78 Two letters picked without replacement from {w: 5, k: 1, h: 3, d: 3, p: 1}. Give prob of picking 1 d and 1 p. 1/26 Four letters picked without replacement from {r: 7}. Give prob of picking 4 r. 1 Four letters picked without replacement from {b: 7, a: 1, j: 4, i: 1}. What is prob of picking 1 j and 3 b? 28/143 Calculate prob of picking 3 w and 1 p when four letters picked without replacement from {p: 12, w: 1}. 0 Calculate prob of picking 2 q, 1 b, and 1 k when four letters picked without replacement from bbvkvvbqbvkkqkbqbb. 7/255 What is prob of picking 1 p and 2 o when three letters picked without replacement from opppppppoppoggop? 3/28 Two letters picked without replacement from {x: 3, w: 2, y: 4}. Give prob of picking 2 y. 1/6 Two letters picked without replacement from {g: 3, c: 2}. What is prob of picking 1 c and 1 g? 3/5 Two letters picked without replacement from vmgxgmdxgmgxxs. What is prob of picking 1 v and 1 m? 3/91 What is prob of picking 3 z when three letters picked without replacement from {z: 5}? 1 Calculate prob of picking 4 e when four letters picked without replacement from {z: 5, e: 5}. 1/42 Calculate prob of picking 2 f when two letters picked without replacement from {f: 4, z: 4, h: 2, p: 4}. 6/91 What is prob of picking 1 q and 1 b when two letters picked without replacement from bbqqqbb? 4/7 Four letters picked without replacement from {o: 2, f: 13, s: 3, y: 2}. Give prob of picking 1 s, 1 o, and 2 f. 156/1615 Three letters picked without replacement from swwvaee. Give prob of picking 1 e and 2 w. 2/35 Three letters picked without replacement from {u: 1, v: 2, x: 1, c: 1, g: 1, q: 1}. What is prob of picking 1 x, 1 v, and 1 c? 2/35 What is prob of picking 1 o and 1 j when two letters picked without replacement from ojvjovjjjjjovjvjjjo? 44/171 Two letters picked without replacement from {m: 3, a: 11, o: 1}. What is prob of picking 1 o and 1 a? 11/105 What is prob of picking 2 t when two letters picked without replacement from {t: 2, l: 5, k: 5}? 1/66 What is prob of picking 2 e when two letters picked without replacement from lelwlewewel? 6/55 Four letters picked without replacement from {j: 1, d: 2, t: 2, w:	{ "pile_set_name": "DM Mathematics" }
30 + 3 - -25. 66 Let q(v) = -v - 1. Let o be q(-5). Suppose -60 = -4k - 0i + 5i, -i - 54 = -5k. What is the smallest common multiple of k and ((-15)/o)/((-3)/16)? 20 Let y(f) = f*2 + 14f + 21. Let w be y(-15). Suppose 0 = 3p + 3u - u - w, 2u = 4p - 48. What is the least common multiple of p and 14? 84 Suppose 0 = 3b - 5l + 37, -3l = 4b + 16 + 72. Let h(g) = -g*3 - 19g*2 + 2g + 40. Calculate the lowest common multiple of h(b) and 10. 10 Let y(a) = -3a3 - 5a*2 + 15a + 25. Calculate the lowest common multiple of y(-3) and 416. 416 Let m = -7921/3 - -52769/20. What is the common denominator of 101/10 and m? 60 What is the common denominator of 146/(-280) + 5/(40/6) and 28/3? 105 Let d be (-1)/(-6) - (-177)/18. Suppose 15 = 5c + d. Suppose 2o - 11 = 7. What is the lowest common multiple of c and o? 9 Suppose -4m + 21 = 5. Suppose 14q - 23q = -90. What is the lowest common multiple of q and m? 20 Calculate the common denominator of (-1095)/(-300) + 2/(-5) and -53/188. 188 Let p(y) be the first derivative of y2 - 23y - 6. Suppose -4k + 55 = 4h - 3k, -k - 49 = -4h. What is the least common multiple of p(h) and 2? 6 Suppose 110 = 2v - n - 4, 3v - 162 = -3n. Calculate the smallest common multiple of 42 and v. 168 Suppose -244 = 22l - 18l. Let r = l - -82. Calculate the lowest common multiple of r and 30. 210 Suppose 0 = -12j + 167 + 313. What is the smallest common multiple of 25 and j? 200 Let d = 393860/59 - 6676. Find the common denominator of d and 73/6. 354 Let w be -7 + 10 - ((-16 - 2) + 1). Calculate the common denominator of (-79)/39 + w/(-30) and ((-1)/5)/((-6)/(-27)). 130 Let f(g) = 11g2 - 10 + g3 - 1 - 5 - 2g - 2. Suppose -5h = -3h - 18. What is the least common multiple of h and f(-11)? 36 Calculate the common denominator of ((-2)/(-8))/(5/(-34)) and (-12216)/(-720) - (-2)/(-15). 30 Let l = 119 + -111. Calculate the least common multiple of l and 8. 8 Find the common denominator of 11(-58)/(-585) + (-36)/(-234) and 52/35. 315 Suppose y = 2y - 3. Calculate the least common multiple of y and (-3 + 5)/(-1) + 17 + 3. 18 Let z(d) = -d*2 + 2d - 24. Let j be z(8). What is the common denominator of 137/18 and 8/j(-363)/(-2)? 18 Suppose -4n + 247 = -5t - 0n, -104 = 2t + n. Let q = -39 - t. What is the least common multiple of q and 26? 156 Calculate the common denominator of (2/(-5 + -59))/(7/133) and -41/6. 96 Suppose 2s = 4l + 12, -10 = -s + l - 2. Suppose -2b + j = -4, 5b - 2j + 5j - s = 0. Calculate the least common multiple of b and 2. 2 Suppose -3n + 28 = -n - 4b, 0 = -5n + b + 34. Let r be ((-1)/(-3))/((-1)/(-9)). What is the common denominator of r/(-5)(-28)/n and 37/7? 35 Let a = 601/459 + -21/17. Find the common denominator of 12/(-30) + (-284)/(-135) and a. 27 Let m be 14/10 + -1 - 69/(-15). Suppose -7w = -mw + 82. Calculate the common denominator of w and -125/6. 6 Suppose 120h = 125h + 5. Find the common denominator of 55/8 and (2/881)/(h/(-13)). 88 Suppose 14h - 30 = 9h. What is the lowest common multiple of h and 8? 24 Find the common denominator of ((-2)/36)/(2/((-4736)/272)) and 67/36. 612 Let m = -1335 - -1439. What is the least common multiple of 13 and m? 104 Let a(z) = -6z - 3. Let p be a(4). Let m = -39 - p. What is the common denominator of (10/(-27))/(m/234) and 36/7? 63 Suppose -r + 2r = 7. Let i = 15 + -12. Suppose -2g + 10 = ig. What is the smallest common multiple of g and r? 14 Let p(a) = a*2 + a - 1. Let x(l) = -4l*2 + 11l + 17. Let k(v) = -6p(v) - x(v). Let s = 5 - 12. What is the least common multiple of k(s) and 6? 30 Suppose -4 = -4b + 20. Find the common denominator of (-28)/10b/24 and ((-2)/48)/((-726)/(-364) - 2). 60 Let b(y) = -y3 - y2 + 4. Let o be (-5 + -1)/(-6 - -4). Suppose 6n = on - 9. What is the smallest common multiple of 16 and b(n)? 176 Let x(l) = -2l*3 - 21l*2 - 10l + 12. Calculate the smallest common multiple of x(-10) and 32. 96 Suppose 2l = -4x - 24750, 3x = 8x + 2l + 30937. Let v = x + 86561/14. Calculate the common denominator of v and (-1)/6(-237)/5. 70 Let m(r) = -r*3 - 5r*2 + 3. Let s be m(-5). Suppose 5v - sv - 18 = 0. Calculate the least common multiple of v and 24. 72 Let q = 9954 - 99421/10. Find the common denominator of -89/4 and q. 20 Let w be 3/(-2)16/(-6). Let x be 1(w - 22/1). Let l = x - -23. Calculate the lowest common multiple of 4 and l. 20 Let q = 17257 + -2640302/153. Calculate the common denominator of 4/11 and q. 1683 Let q(j) = 4295j. Let d be q(1). Let g = 17263/4 - d. What is the common denominator of (1 - -1) + 77/(-10) and g? 20 Let t = -72 - -12. Let j = t - -27. Find the common denominator of 3 - ((-54)/j - 1) and 49/4. 44 Let s be (-7364)/11050 + (-14)/(-21). Let p = s + 723703/298350. What is the common denominator of p and (-20)/(-12)(-66)/28? 378 Suppose p + 3 = -0. Let k = 7 + p. Let s = 982 - 981. What is the lowest common multiple of s and k? 4 Suppose 10 = -2f, 12f - 88 = -3z + 8f. Calculate the smallest common multiple of 180 and z. 180 Let d = -4/945 - -2339/1890. Let m = 24042 + -528829/22. What is the common denominator of d and m? 330 Suppose 0 = -0b - b. Calculate the least common multiple of (b - -2)(-4 - (-13 + -3)) and 44. 264 Calculate the common denominator of (870/50 - 17) + 1/(-240) and -103/36. 144 Let b = -20737 - -456319/22. Let f = -555 + 5531/10. Find the common denominator of b and f. 110 Let g(j) = -2592j + 1291j + 1299j + 16. Suppose 0 = 4r + 2 + 6, -4n = -4r - 32. Calculate the lowest common multiple of g(n) and 30. 60 Suppose -5t + t = 4u - 348, 3u + 95 = t. Calculate the lowest common multiple of t and 4. 356 Let s = -1616141/96 + 16835. Let u = -1501/96 - s. What is the common denominator of u and -65/42? 42 Let v be (-1)/(4/68/48). Let c = 14 + -6. What is the smallest common multiple of (-3)/v + 68/12 and c? 24 Let d = -48989/10 + 4904. Let z = -55 - -31. What is the common denominator of d and z/192 + (-790)/(-176)? 110 What is the smallest common multiple of 4 and (-220)/(-26) - (-102)/(-221)? 8 Calculate the smallest common multiple of 6 and 5792/88 - 4/(-22). 66 Let k be (-4 - 5)/((-12)/8). Suppose -q + k + 2 = 0. Calculate the lowest common multiple of 2 and (-3)/9 - q/(-6). 2 Let y be (-699)/(-3620) + 2/(-10). Let h = y + 26441/2172. Let i = -1/2430 + 7493/1215. What is the common denominator of h and i? 6 Let m = -10 + 14. Suppose mi - 6 = 5i - 4p, -4i + 36 = -4p. What is the smallest common multiple of i and 2? 14 Suppose -53a + 164 = -12a. Let u be (-26/(-3))/(-1). Let s = u - -5. Calculate the lowest common multiple of a and s. 4 Let c = 1/6184 + 117379/723528. Calculate the common denominator of 26/9 and c. 117 Let r = -74253 + 12177585/164. Calculate the common denominator of 69/2 and r. 164 Suppose -35 = -5i + 55. What is the least common multiple of 36 and i? 36 Suppose f = 2i - 6 - 4, 5f - 10 = -2i. Suppose 9 = -3r, 2h - 5r + f = 191. What is the smallest common multiple of h and 22? 88 Let q be (-1330)/12 - 2/(-4). Let d = q - -106. Let y = d - 49/24. Calculate the common denominator of y and -23/18. 72 Let j(y) = -y*2 + 7y + 90. What is the lowest common multiple of 8 and j(9)? 72 Let c = -45 + 57. Let l = -10 + c. Calculate the lowest common multiple of l and ((-6)/(-8))/(2/24). 18 Let q(r) = r*3 + 12r*2 + r - 43. Let h be q(-13). Find the common denominator of -107/6 and (-10)/h((-650)/(-8))/5. 18 Let b be 6/(-4)16/8. Find the common denominator of (189/192)/((3/(-4))/b) and -45/28. 112 Let u be -2 + 422/24-541. Let k = u - -9520. Find the common denominator of 101/6 and k. 12 Let k = -82 - -127. What is the smallest common multiple of k and 132? 1980 What is the common denominator of -47/32 and (956/(-320) + 3)(-2130)/36? 96 Let f = -46 - -53. Suppose -5u - 2h = -40, 0u + 3u = -h + 24. Calculate the least common multiple of u and f. 56 Let x(p) = 6p*2 - 31p - 36. Let h(s) = 7s2 - 32s - 37. Let v(z) = 5h(z) - 6x(z). Calculate the least common multiple of v(27) and 20. 20 Let y(c) = 2c - 1. Let z be y(4). Suppose -4t + 41 = -z. Calculate the lowest common multiple of t and 0 + 38/10 - 7/(-35). 12 Let o be ((-1)/(-2))/((-77)/(-490017)). Let t = -317	{ "pile_set_name": "DM Mathematics" }
et n = 21 - 26. Which is the nearest to 1/3? (a) -1 (b) -3 (c) n a Let a(t) = -t + 1. Suppose 0 = h - 2h + 4. Let k be a(h). Let b = -145/453 + -2/151. What is the nearest to 1 in b, -5, k? b Let w(t) = -t2 - 8t - 3. Let m be w(-7). Let z = 0.2 + -0.1. Let u(q) = 2q2 - 5q + 5. Let h be u(2). Which is the closest to z? (a) m (b) h (c) 2 c Let z = 11 - 11. What is the closest to 2 in 1/8, 3/7, z? 3/7 Let k = -0.276 - 0.024. Which is the closest to 0.6? (a) 0.5 (b) k (c) -5 a Let p be (-1)/(-4)(4 - 6). Which is the closest to 0.3? (a) p (b) 5 (c) 0 c Let y(g) = 2g + 8. Let n be y(-2). What is the nearest to -0.2 in 1/7, 5, n? 1/7 Let s be (-2)/(-3) - 77/129. Let z = s + -52/129. Which is the closest to -1? (a) -3 (b) 0 (c) z c Suppose 4v - 16 = 4j, -3v + 12 = -5j - 0j. Let n = -13 - -16. Let m be n/420/30. What is the closest to m in j, 1/9, -0.5? 1/9 Let w = 0.7 + 2.3. Let y = -30/7 - -127/28. Let n = 1 + -5. What is the nearest to y in n, w, 1? 1 Let i(x) = x*2 + 5x - 3. Let h be i(-6). Let o be 14/((-32)/(-3)). Which is the nearest to 0? (a) o (b) -5 (c) h a Let h = -2 + 1. Let r = -1/137 + 419/1096. What is the nearest to -1 in h, 1, r? h Let g = -374945/42 + 8928. Let p = -4/7 + g. What is the closest to p in -0.1, -0.5, -2/15? -0.1 Suppose 4n = -4 - 16. What is the nearest to 1 in -4, n, -1/7? -1/7 Let w = 4/577 + -46172/1731. Let h = -27 - w. Let z = 2 - 1. Which is the nearest to z? (a) -0.2 (b) h (c) 0.3 c Let b = 137 + -136.8. What is the nearest to -4 in 2/5, b, 5? b Let y = -3 - -6. Suppose -2w - yw = -5. Which is the closest to w? (a) -4 (b) -2/13 (c) 0.5 c Let s be (-4 - -8) + (-26)/7. Which is the nearest to s? (a) -0.1 (b) 5 (c) 3/7 c Let u = 2.128 - 0.028. Let w = u + -2. Let j be ((-3)/24)/((-3)/4). What is the nearest to 0.3 in j, w, 2/3? j Let f = 0.026 - 0.026. Which is the nearest to -4? (a) -3/2 (b) -0.5 (c) f a Let x = -3.8 + -1.2. Suppose 0y - 2y + 4 = 0. Which is the closest to -1/4? (a) x (b) -0.3 (c) y b Let l = 701/470 + 2/235. What is the closest to l in -3, 0.12, -0.5? 0.12 Let r = -2/55 + -157/220. Which is the nearest to -2/7? (a) r (b) 2 (c) 0 c Let f be (((-2)/(-2))/(-5))/(-1). Let j = -4.1 + 4. Let k(i) = -3i - 4. Let g be k(-3). What is the nearest to j in 0.3, f, g? f Let a = 17 + -12. Let f = -0.07 + 0.01. Let v = -1.94 + f. What is the nearest to v in a, 0.4, -0.3? -0.3 Let r be -4(-2)/4 + 2. Let f = 36 - 35.8. Let h = -0.04 + 2.04. Which is the closest to 0? (a) r (b) f (c) h b Let v = -0.0615 + 4.1715. Let l = v + -0.11. Let a(t) = -t*3 + 5t*2 - t + 7. Let s be a(5). What is the closest to -2/5 in l, -1/3, s? -1/3 Let i = 46.1 - 46. Suppose 0 = 2j - 0j - 4. Which is the nearest to 3? (a) j (b) -1/5 (c) i a Let p be (-3)/3 + (1 + -4 - 0). What is the nearest to 0.1 in -1, 0.5, p? 0.5 Let y = 4372/3819 + -72/67. Let p = 182/969 - y. Let c = 1.5 + -2. What is the closest to -2 in p, c, 5? c Let q = -4.9 + 5. Let w = 0 - 2. Which is the closest to q? (a) 3 (b) w (c) -3/4 c Let r(z) = -z2 + 10z + 3. Let w be r(9). Suppose -l + w = -2s - 5l, 0 = -4s - 3l - 9. Let q be (5 - 3) + 0/(-1). What is the closest to q in -2/5, -1, s? s Let v be (-3)/(-4 - -7) + (-1)/2. Which is the nearest to -3? (a) -0.4 (b) 5 (c) v c Let k = -0.1 - -0.6. Let j = 0.8 + -4.8. Let x = 0.3 - 0.2. What is the closest to x in -0.2, j, k? -0.2 Suppose 0 = 4k - 4 + 8. Which is the closest to 2? (a) k (b) -0.2 (c) 3 c Let x be (-2)/6 - (-3)/27. Let m = 1 - -3. Let n = -2.6 - -2.5. Which is the nearest to n? (a) 0.1 (b) x (c) m b Let k = 0.06 - 0.26. Let p = 1.5 + -1.6. Which is the nearest to p? (a) k (b) -1 (c) 1 a Let k = -18 - -20. What is the closest to -2 in k, -3, 0? -3 Suppose -2 = -5b - i + 7, 2i = 5b + 3. Let d be 3(-1 + 12/15). What is the nearest to b in 2/5, d, 0.1? 2/5 Let w = 4.2 + -3.5. Let d = 746/11 - 68. What is the closest to -0.1 in 0.3, w, d? d Let z = 0.47 + -21.47. Let p = z - -21. What is the nearest to p in 1/3, 0.5, 0.1? 0.1 Let n = 29/48 - -1/16. Suppose 8 - 4 = -p. What is the nearest to n in 0.2, 0.8, p? 0.8 Let r be 2/44/(-19). Let g = 29 - 26. Let f be ((-6)/(-15))/((-1)/5). Which is the closest to f? (a) 2 (b) r (c) g b Let p = 13 + -11. What is the closest to 1 in 2/5, 3/5, p? 3/5 Let y = 15.1 + -14.1. Which is the nearest to y? (a) -37 (b) 0.3 (c) 1/5 b Let r(q) = -3q + 4. Let m be r(7). Let b = 3 + m. Let u be 4/(-14) + 10/b. What is the closest to -3 in -0.5, -4, u? -4 Let s = 31 - 67. Let d be (-1)/(-3)s/(-48). Which is the nearest to -2? (a) d (b) -5 (c) 0.1 c Let q = 0.1 - 0.2. Suppose 3w - 5 = 5t - 22, -5t - 4w = -24. Suppose j = 3j + 2, 0 = -4z + tj + 4. Which is the closest to q? (a) 3 (b) z (c) -1 b Let o(m) = -m + 3. Let u be o(5). Let k be (u - -3) + 22/(-18). Let n = 0.06 + 2.94. Which is the closest to 0? (a) n (b) k (c) -1 b Let o = -3 + 2.9. Suppose -1 - 7 = 4l - 4y, 16 = 4y. Suppose -ls + 2 = 2k, -4s + 5k = -0s + 41. Which is the nearest to o? (a) 5 (b) s (c) 0.1 c Let r = 2.6 + -4.6. Let h = -2.9 - 11.1. Let p = h + 9. Which is the closest to r? (a) 2 (b) -2 (c) p b Let v(l) = -2l + 3. Let d be v(2). Let z be 2/(-2) + (-4)/(-3). Which is the closest to -1/2? (a) z (b) d (c) 2/3 b Let z = 45/2 + -23. Let o be (-1)/(2 - (-5)/10). Which is the nearest to o? (a) -3/2 (b) z (c) 0.3 b Let j = 2.4 - 2.4. Which is the closest to -0.1? (a) j (b) 0.08 (c) 3 a Let p = -0.103 + -1.897. Let i = -9 - -4. What is the nearest to 1 in p, i, 0? 0 Let i = 4 + -5. Which is the closest to -2/3? (a) 0.3 (b) i (c) -5 b Let q = -15.3 + -3.7. Let k = 18.7 + q. Which is the nearest to 0.03? (a) -4 (b) k (c) -1/3 b Let m be (6/(-56))/(1/4). Let b = -0.4 + -0.1. What is the nearest to 1 in -4, b, m? m Let t = 1/10 - -2/5. Let m = -0.4 + 0.2. What is the nearest to t in -4, m, 1? 1 Let m = 1.9 - 1.1. Let k = -0.9 + m. Let o be 0/(-1) + 4/14. Which is the closest to o? (a) k (b) 3/2 (c) 1/4 c Let l = 38 - 23. Suppose -x + 6x = 5c - l, 5c + 2x = -13. What is the nearest to c in -1, 1/8, 3/2? -1 Let t = -1.2 + -3.6. Let q = t + 5. Let z = 1.9 + -2. What is the closest to z in 3, 1/3, q? q Let h = 0.448 - -4.642. Let f = h + -0.09. Suppose 4m - 5y = 7, 0 = -m + 6y - 3y. Which is the nearest to -0.1? (a) f (b) m (c) -0.3 c Let s = -0.7 - 0.3. Let z = -5 - -1. Let u = z + s. Which is the closest to 0? (a) u (b) 3 (c) -1 c Suppose -z = -0z - 5. Let q = -4 + z. Which is the nearest to q? (a) 0.5 (b) -2/3 (c) 2/3 c Let q = -0.1 - -0.5. Let u = -0.8 - -0.6. Which is the closest to -1? (a) 0 (b) u (c) q b Let p = -8 - -7. Which is the nearest to 0.1? (a) 4 (b) 3/2 (c) p c Let q be 48/(-8)(-2)/(-8). What is the closest to q in -1, 0.5, 1? -1 Let k = -0.01 - -1.01. What is the closest to k in -0.2, 0.3, -0.3? 0.3 Let d(g) = -g*2 + 10g - 16. Let s be d(8). Suppose 0 = 6v - 3v - 3. What is the closest to s in v, -2/3, 1/4? 1/4 Let o = -48 - -32. Let h = o + 233. Let u = h + -2389/11. What is the nearest to -1 in -0.2, -2/9, u? -2/9 Let o = 0.16 + 0.04. Which is the closest to 0.2? (a) -1/9 (b) o (c) 0.6 b Let h = 1 - 3. Suppose 10 = 2f + 4. Suppose fq = q + 10. Which is the closest to h? (a) -0.1 (b) q (c) 2 a Let t = 0 - -5. Let d = 343.9 + -344. Which is the closest to 0.1? (a) d (b) t (c) -0.3 a Let k = -7 - -8. Let s = k + -1.3. What is the closest to -1 in 2, -0.1, s? s Suppose -3x + 1 = -8. Let w be (((-1)/(-6))/((-2)/(-6)))/(-1). Which is the nearest to -1? (a) w (b) -1 (c) x b Let k = -8.7 - -5.7. Suppose 2s - 4l + 10 = 0, -2s = 4*l - 13 - 1. Which is the closest to 0.1? (a) 2/11 (b) k (c) s a Let r = -59 + 16. What is the closest to -0.2 in -1, -5/6, r? -5/6 Let g = 39 + -34. What is the nearest to 1/4 in 2/17, g, -1/3? 2/17 Let z = 3/23 + -32/69. Let q = 3.6 + -4. Let l = 10 - 5. What is the nearest to z in 1/5, l, q? q Let p = -15 + 59/4. Let g be -1 + (1 - 15/(-27)). Let u = 1/18 - g. Which is the closest to 0? (a) p (b) u (c) -4 a Let k = -5.11 - -0.11. Let d = 9 + k. What is the closest to -0.2 in 5, -0.2, d? -0.2 Let j = 0.6 + 0.4. Let h = 0 - -6. Let x = h + -3. Which is the closest to j? (a) -2/7 (b) 2 (	{ "pile_set_name": "DM Mathematics" }
89n2 + 1)(3n - 2n + 0n). -3n*3 - 5n*2 - n Expand (7 - p - 7)(41 - 38 + 22). -25p Expand 2f - f - 2f + (3 - 2 - 3)(2 - 2f - 2) - 5f + 3f + f - 3f + 18f + 17f. 34f Expand -6i + i*4 + 58i + i*3 + 13i + (-2i2 - 1 + 1)(i*2 + 0i2 + i2) + 0i4 + 6i*4 - 5i*4. -2i4 + i3 + 65i Expand (1 - 1 + 2h)(15h*4 - 9h*4 - 17h4) - 2 + h5 + 2 + h. -21h5 + h Expand (-33q - 38q - 9q - 9q)(-q3 - q3 + 4q3). -178q*4 Expand (-52 - 151 - 56 + (4 + 1 - 4)(2 - 4 + 1))((-2 + 3 - 2)(2l + l - 4l) + 2l + 3l - 3l + 2l - 2l - l). -520l Expand (n*2 + 0n*2 + 0n*2)(-3n2 + 0n*2 + 0n*2 + (-2 + 2 - 8n)(-2n + 2n + n)). -11n4 Expand (-g2 - 2g2 + g2)(-5 + 2 + 2)(-3 + 5 + 0) + 2g*2 + 1 - 1 + (-7g + g + g)(0g + 5g - 3g). -4g2 Expand (-2j + 6j - 3j)(-j2 - 2j*2 + 5j*2) + 5j*3 - 5j*3 + 2j*3 + (j - 2j - j)(3j*2 - 37 + 37) - 7j*3 + 3j*3 + 3j*3. -3j*3 Expand (2h*3 + 0 + 0)(2h + 0h - 3h) - 587h*4 + 1147h*4 - 577h*4 + 7h*2. -19h*4 + 7h*2 Expand (0c + 2c2 + 0c)(6 - 3 - 2) + (47 + 15c*2 - 47)(23 - 16 + 21). 422c2 Expand (-r + r - r2)(4r - 12 - 14 + 7). -4r*3 + 19r*2 Expand (q - 4q + q)(-20 + 56 - 26 - 6q). 12q2 - 20q Expand 418h - 1220h + 40h + (-h + 3h - h)(0 + 4 - 6). -764h Expand (0l2 - l2 + 0l*2)(-1395 + 208l + 1395). -208l*3 Expand (-238 - 176 + 39)(0y2 + y2 + y2) + (2 - y - 2)(y + 0y - 2y). -749y2 Expand 2736 - 8p - 2736 + (2 - 2 + 1)(-2 - p + 2) + 1 - 2p - 1 + 0p + p + p. -9p Expand (7z - 2z + z)(3z*2 - 6z*2 - 2z2) + z3 + 0z3 - 2z*3. -31z*3 Expand (-6 - 16 + 0)(r + r + 0r)(-1 + 2 + 0)(-4 + 8r + 4). -352r2 Expand 3y*2 + 2y*2 - 37y*2 + (0 + 7 + 0)(0y + 0y + 2y2). -18y*2 Expand (-3n3 + n3 + 4n3)(-n - 3n + 2n) + (0n + n - 5n)(92n - 26n3 - 92n). 100n4 Expand (-3g - 5251 + 5198 - 3g)(4 - 4 - g). 6g2 + 53g Expand (0h2 + h3 - 5h3 + h2)(-12 - 21 + 63). -120h*3 + 30h*2 Expand -109y + 174y - y3 - y3 + 4y*2 + (0y*2 + 5y*2 - 3y*2)(3y - 5y + y). -4y3 + 4y*2 + 65y Expand (-3 + 2 - 1)(-15 - 15 + 15)(-r + 5r + 0r). 120r Expand (21g*2 + 17g*2 - 19g*2)(-2 + 2 - 2g)(4 - 3 - 2). 38g3 Expand (-5 + 5 + h2)(-6h + 2h + 2h)(2h2 + h2 - 4h*2) - 46h - 15h5 + 46h. -13h5 Expand (2t + t - 4t)(5 - 6t - 5) + 3 - 3 + 2t*2. 8t*2 Expand (-2o + 4o + 17o)(8o - 23 + 0o - 9o). -19o2 - 437o Expand (-56l + 175l - 69l)(-3l3 + 0l*3 + 0l*3). -150l*4 Expand (-1793 + 3571 - 1790)(-8q2 + q2 - 2q*2). 108q*2 Expand (-p - 2 + 2)(-30 - 5 - 4)(3p - 4 + 4). 117p2 Expand ((5v*2 - 6v*2 + 4v*2)(7v - 6v + 2v) + v - v3 - v)(v*2 + 2v2 + v2). 32v5 Expand (-4 + 2t + 4)(1 + 0 + 0)(-2t + 0 + 0 + (-2t + 0t + t)(-745 + 1545 - 990)). 376t2 Expand (-2 + 3 + 1)(7 - 3 - 2)(57x - 1084 + 1084). 228x Expand (-2f*3 + 2f*3 + 2f*3)(-2 + f*2 + 2) + (-4 + 4 + 2f*4)(-67 + 157f + 67). 316f5 Expand (-w2 + w - w)(-3 + 36w*3 - 20w*3 - 12w*3). -4w*5 + 3w*2 Expand (-6 + 2 + 3)(3v + 7v - 2v) - 13v - 4 + 4. -21v Expand (3t*2 + 3t*2 - 4t*2)(t + 5t3 + 4t*2 - 26t*2 + 26t*2). 10t*5 + 8t*4 + 2t*3 Expand (-2n - 3 + 3)(-20n + 5 - 8 + 11n) + 11n*2 + 27n*2 - 8n*2. 48n*2 + 6n Expand -2p2 + 3p - 3p + (-4 - 1 + 3)(-3p + 2p*2 + 3p) + p*2 - 2p*2 + 3p*2 - 4p2 + p2 - p*2. -8p*2 Expand (-47w*2 + 42w*2 + 83w*2)(3 - 2 + 1) - 2w2 - w + w. 154w*2 Expand (0n - 2n - 2n)(-13n - 5n + 2n)(0n2 + n2 + n*2). 128n*4 Expand (-w - 4w + 3w)(-w*2 + 2w - 2w) + (-4 - 3w + 6w + w)(w*2 + 1 - 1). 6w*3 - 4w*2 Expand (-3 + 6 + 4 + (0 - 2 - 8)(1 - 3 + 0))(-d + 5d + 0d). 108d Expand 9x - 9x + 12x2 + (7x - 16x + 22x)(5 - 5 - 2x). -14x2 Expand (-1 - 4 + 2)(4f + 5f - 4f). -15f Expand (o - 1 + 1)(-4o + o + o) + (o*2 - 1 + 1)(4 - 2 - 4) - 142o2 + 21 - 62o*2 - 21. -208o*2 Expand 0u + u*4 + 0u + (-5u2 - 6u*2 + 9u*2)(-4u2 + 4u2 + u2) + 0u4 + 5u*4 - 3u*4 + (u - 3u + 7u)(1 - 1 - 2u3). -9u*4 Expand (-2x*3 + 3 - 5 + 4)(-274x + 615x - 258x). -166x*4 + 166x Expand (3u2 - u2 + u2 + (-u2 + u2 + u2)(-2 + 2 - 2))(76 - 10u - 76) - 2 + 2 + 2u3. -8u3 Expand (-t + t - t2)(-t2 + 0t*2 + 3t*2) + 51t*4 - 7t*4 + 44t*3 - 44t*3. 42t*4 Expand (4 + 2v*2 - 4)(25 + 60 + 14)(0 + 3 - 2)(1 + 2 - 1)(4 - 2 - 4). -792v2 Expand s3 - 3 + 3 - s + s + s3 + s3 + s3 - s3 + (-1 + 1 - 2s)(-s*2 + 2s2 + s2) + 1 - 1 - s*3 + 57s*3 - 140s*2 + 140s*2. 55s*3 Expand 6d*5 - 21d*5 - 10d*5 + (3d*2 - 4d + 4d)(2d2 - 4d2 + d2)(-3d + 4d - 4d) + 2d5 + 0d*4 + 0d*4. -14d*5 Expand 2i*5 - 4 + 4 + (-5i*2 + 0i*2 + 3i*2)(i*3 - 3i3 + i3) + 3i5 + 3i*5 - 4i*5 - 96167i*4 + 96167i*4 + 146i*5. 152i*5 Expand (-6428 - 165u + 6428)(-5 + 2 - u + 2). 165u*2 + 165u Expand (15 + 4r2 - 15)(6r - 3r - 4r + (-r + 5r - 3r)(1 + 0 + 1) + 4r - 2r - r - 10r + 9r + 2r). 12r*3 Expand (2 + 2 + 5)(-2i - 3i + 7i)(-1 - 3i + 1). -54i*2 Expand (-5k*2 - 4k*2 - 10 + 2k*2)(-1 - 3 + 2). 14k2 + 20 Expand (-17s*2 + 3s*2 + 2s*2)(-3 + 4 + 0)(4s - 4s - s)(4s - 6s + s). -12s4 Expand (-3g*2 + 4g*2 + 4g*2)(g*2 - 5g + 5g) + 5 - 5 - 3g*4 + (2g*3 + 2g*3 - 5g*3)(-g - 2g + g). 4g*4 Expand 2x*4 - 3x4 - x4 + (-5x3 + 3x*3 + 3x*3)(-3x + 0x + 4x) + 8x*4 - 29x*4 - 2x*4. -24x4 Expand -i5 - i*5 + 3i*5 + (-2i*3 - 3i + 3i)(224i2 - 123i*2 - 249i*2). 297i*5 Expand (2 - 2v - 2)(-295v + 178v + 209v). -184v2 Expand (-1 - 1 - 1)(-5m + 11 - 11) + 2m - 10m - 2m + (-2 + 4 + 0)(1 - m - 1). 3m Expand -6 - 2k5 + 2 + 3 + 2k*5 + 2k*5 - 5k*5 + (4k*2 - 5k*2 - 6k*2)(-9k - 6k*3 + 9k). 39k5 - 1 Expand (-38 - 57 + 17)(m + 4 - 4) + 13 - 13 - m + (-m + 2m - 3m)(1 + 2 - 5). -75m Expand (0r + r + r)(-2r + 3 - 3 - r + r - r + (3 - 1 + 0)(2r + 4r - 3r) + r + 2r - 2r + 14 - 14 + 9r). 26r2 Expand (0n + 3n - n)(-5 + 9 + 5) - 2n - 2n + 6n. 20n Expand (-50b + 24b - 36b)((3 - 3 + 2b)(3 + 4 - 5) - 2 + 2b + 2 - 2 + b + 2 - 1 + 1 - b). -372b*2 Expand (-4c*3 - 3c*3 + 6c*3)(-2c2 + 0c*2 + 3c*2) - 3c*5 + 5c*3 - 5c*3 - 2c*5 + 2c*5 - 7c*5 + 4c5 - c2 + c*2. -7c*5 Expand (-4p + 4p - 8p*2)(-p + p - 3p)((-p + 0p + 0p)(p + 3p - 5p) + (5 + 0 + 1)(-2p2 + 0p + 0p)). -264p*5 Expand ((0 + 0 + 4)(3 - o2 - 3) - 2 + 2 - o2 + (3o + 0o - o)(-o + 3o - 5o))(-6 - 3o + 7o + 2). -44o3 + 44o2 Expand -o5 - o*5 - 2o*5 + (2o - 2o + 2o)(-2o*4 + 0o4 + o4) - 4o5 - 8o*2 + 8o2 + o5 + o*5 + 2o*5. -6o5 Expand (b2 - 2b + 2b + (-1 + 4 + 0)(0b*2 - 4b*2 + 5b*2))(-1 + 1 + 1)(-12b*2 - 16b*2 + 30b*2 - 4b). 8b4 - 16b*3 Expand (2 + 0 - 3)(-2u4 - 2u*4 + 3u*4) - 19u*4 + 19u*4 - 21u*4. -20u*4 Expand (-3z*4 - 2z*2 + 2z*2)(371 - 211 - 251). 273z4 Expand (54z + 67z + 6z + (3z - 4z - 2z)(4 + 0 - 3))(-1 + 3 - 1). 124z Expand 28v - 4 + 4 - v - v + v + 2v + 3v - v - 3v + (2 - 2v - 2)(2 - 4 + 0) + 3v - 7v + 2v. 30v Expand (-g + g + g*3)(-36g2 + 30g*2 + 9g*2 + 56). 3g*5 + 56g*3 Expand (h + 2h + 0h)(0 - 1 + 0 + (2 - 4 + 0)(0 - 3 - 4)). 39h Expand (g + 3g - 2g + (2 - 3 - 5)(6 - 6 + 2g))(-1 - 5 - 1). 70g Expand 3 - 7s + 6s - 2 + (s + 2s - 5s)(2 - 2 + 2) - 3s - s + s - 4s - 5s + 6s. -11s + 1 Expand ((-2a + 2a - 2a)(-3 + 0 + 1) + (-3 + 2 + 0 + (-3 + 3 - 1)(0 + 2 - 1))(8a + 0a - 3a))(-2a3 - 2a*3 + 6a*3). -12a*4 Expand (11 - q - 11)(6q4 - 6q*4 + 7q4) - q5 + 2q5 + q5. -5q*5 Expand (-5 - 1 - 2)(-2 + 2 + 2)(-4p + 4p + p)(-4 - 2 - 9). 240p Expand g + g - 3g + 7g - 2g - 4g + (3 + 3 - 4)(2g - 2g + 2g) + 0 + 0 + g + (3g - g + 3 - 3g)(-2 - 2 - 7). 16g - 33 Expand -p2 - 2p2 + p2 + (4 - 3 -	{ "pile_set_name": "DM Mathematics" }
+ 9 = 3h - 29. Find the second derivative of sb*2 - 3b*2 + b + 8b*3 - hb wrt b. 48b Let p(g) be the second derivative of 0 + 1/6g*3 + 0g*2 - 1/4g*4 - 9g. What is the second derivative of p(s) wrt s? -6 What is the derivative of 59i + 136 - 35i*2 - 59i - 114i2 wrt i? -298i Suppose 0 = -4f - 5b - 13, 2f - 3b = -0b + 21. Let g be -65/(-135) - (-32)/18. What is the third derivative of -4l4 - 9l*g - 23l*f + 23l*3 wrt l? -96l Let i = 8 + -5. Suppose y - 8 = -5. What is the second derivative of -m*i - m + 5m*y - 3m + m wrt m? 24m Let a(t) be the first derivative of 0t + 21 + 27/2t2 - t3. What is the second derivative of a(y) wrt y? -6 Let b(n) be the second derivative of 77n*5/4 + 441n*2/2 - 363n + 1. Differentiate b(h) wrt h. 1155h2 Let s(n) be the first derivative of -34n*3 - 3n*2/2 - 2n - 79. Find the second derivative of s(m) wrt m. -204 Let n be (2/2)/(67/11 + -6). Find the second derivative of 3g3 - ng*3 + 10g - 15g3 - 31g wrt g. -138g What is the third derivative of 21492s*2 + 96 - 21493s*2 - 40s*6 + 12s*6 wrt s? -3360s3 What is the third derivative of -h6 + 187h2 - 224h*4 + 937h - 468h - 471h wrt h? -120h3 - 5376h Suppose 11 = -h - 5b - 2, -1 = 4h + 3b. Suppose -6 + 0 = -2g. Find the third derivative of 0r6 + r6 - rh + r6 + gr*2 wrt r. 240r3 Let h(p) be the first derivative of p5/5 - 196p3/3 + 7p*2/2 - 2p + 29. Find the second derivative of h(j) wrt j. 12j2 - 392 Let o(b) be the second derivative of -74b*6/15 + 13b*4/2 - b - 15. Find the third derivative of o(h) wrt h. -3552h Let l = -9 - -11. What is the third derivative of 14 + 10sl - 35 + 21 - 7s*5 wrt s? -420s*2 Let g(s) be the second derivative of 35s*4/4 + 32s*3/3 + s - 49. Find the second derivative of g(q) wrt q. 210 Find the second derivative of 434 - 136 - 151 - 24x4 - x - 138 + x5 wrt x. 20x3 - 288x2 Let n(l) be the first derivative of -l3/3 + 8l2 + l + 3. Let h be n(11). Find the second derivative of hx*2 + 7x + 8x3 - 56x*2 wrt x. 48x Let n(l) = -196l2 - 12l + 593. Let v(r) = -392r2 - 27r + 1186. Let g(x) = -9n(x) + 4v(x). Find the first derivative of g(c) wrt c. 392c Let s = 91 + -89. Find the second derivative of 2l*2 + 1628l - 2 + s - 1593l wrt l. 4 Let l be ((-21)/(-30))/136/63. Let a(o) be the first derivative of 0o2 + 2o + 0o3 + 4 + 0o*4 - lo*5. Find the first derivative of a(t) wrt t. -8t*3 Let b be (45/(-4) - -3)-4. Let m = b + -20. Find the second derivative of 8k3 - 11k - mk + 19k wrt k. 48k Let y(v) be the first derivative of -61v*3/3 - 49v*2 - 34. What is the second derivative of y(f) wrt f? -122 What is the first derivative of -15072a - 15070a + 68 + 16a*2 + 30144a wrt a? 32a + 2 Let n(c) = c3 - 4c*2 - 11c - 65. Let w be n(7). Let k = 9 - 6. Find the second derivative of -wt + kt + 11t + 10t*5 + 0t wrt t. 200t3 Let p(v) be the second derivative of -11v4 + v3/3 - 87v2/2 + v + 69. Find the first derivative of p(y) wrt y. -264y + 2 Let t(r) = -520r2 - 168r. Let a(k) = -40k2 - 13k. Let w(j) = 80a(j) - 6t(j). What is the second derivative of w(u) wrt u? -160 Let j(r) be the third derivative of 13/6r3 + 0 + 0r - 2r2 + 7/24r*4. What is the derivative of j(y) wrt y? 7 Find the second derivative of 0c - 1 - 5c - 111c*2 - 3 - 4 - 2c wrt c. -222 Let i be (-1)/(-9) - ((-391)/153)/(-23). Suppose -4t + 5r - 10 = -3t, -2t = -4r + 8. Find the second derivative of -6b*3 + i + 5b + 15b3 + t wrt b. 54b Let c(h) be the first derivative of 0h3 - 8/3h*6 + 5/2h*2 + 0h*5 - 7 + 0h*4 - h. What is the second derivative of c(f) wrt f? -320f3 Let r(k) be the third derivative of -k9/504 - 3k6/40 - k5/20 - k3/3 - 63k*2. Find the third derivative of r(p) wrt p. -120p3 - 54 Let q(o) be the first derivative of o8/168 - o*5/40 + 8o*3/3 - 3. Let n(b) be the third derivative of q(b). What is the second derivative of n(x) wrt x? 120x*2 Let c(m) be the first derivative of -19/3m*3 + 0m*4 + 0m - 29 + 0m5 - 2/3m*6 + 0m*2. What is the third derivative of c(v) wrt v? -240v*2 Find the second derivative of -25s + 61s + 52s*4 - 7 + 8 wrt s. 624s*2 What is the second derivative of 7u5 + u3 + 13u5 - 7u*5 + 24u + 35u wrt u? 260u*3 + 6u Suppose 3s = -4g - 1, g - 11 = -2s + 5s. Suppose -gu + u = -2. What is the third derivative of -4l*5 + 3l*5 - 15l*2 + 13l*u wrt l? -60l*2 What is the derivative of -9r*3 - 28r*3 + 105 - 6r*3 + 122 wrt r? -129r2 Let y(g) be the third derivative of g6/30 + g*5/20 + 13g*4/4 - 12g*2 - 2. Find the second derivative of y(c) wrt c. 24c + 6 Let v(d) = -d*3 - 1. Let h be ((-3)/2)/(3/4) - -1. Let g(z) = 3z*4 + 4z*3 + 5z + 4. Let l(x) = hg(x) - 4v(x). Find the second derivative of l(i) wrt i. -36i2 Let d(x) be the third derivative of x5/30 + 17x*4/6 - 31x*3/3 - 62x*2. Find the first derivative of d(r) wrt r. 4r + 68 Let v(y) = -8y3 + 4y*2 + 3. Let g be v(-3). What is the derivative of -264 - 2w*4 + g - 22w*4 wrt w? -96w*3 Find the first derivative of 385 + 383w + 75w - 68 + 199 - 40 wrt w. 458 Let o(f) = 35f*2 - 11f. Let v(t) be the third derivative of -t*5/60 + 5t*2. Let m(z) = o(z) + 2v(z). Find the second derivative of m(c) wrt c. 66 Let q(v) be the first derivative of 0v3 + 3/4v*4 + 0v - 10 - 3v2. What is the second derivative of q(d) wrt d? 18d Let l(t) = -2t3 - 8t - 786. Let h(k) = -k*3 - 4k - 394. Let q(c) = 5h(c) - 3l(c). What is the first derivative of q(u) wrt u? 3u2 + 4 Let g(d) be the third derivative of d6/120 + d5/60 + 5d*3/6 + 4d*2. Let k be g(0). What is the second derivative of -4x + x*5 + 0x*k + x wrt x? 20x3 Let s = -389/3 + 130. Let f(q) be the second derivative of 0 + q2 + 0q3 + 4q - sq4. Differentiate f(n) wrt n. -8n Let h be -2 - (-1 - (-8 + 3)). Let g = 10 + h. What is the third derivative of 3w2 + 0w*2 - 8w*4 - 5w2 + wg wrt w? -168w Let y(a) be the first derivative of -a6/40 - 7a*4/12 + 12a*2 - 18. Let m(x) be the second derivative of y(x). Find the second derivative of m(s) wrt s. -18s Let v = 13 + -11. Suppose 3s - 15 = -vs. Find the second derivative of 3x - 7x + 11x2 - sx wrt x. 22 Let s(g) = -4g4 + 4g - 12. Let j(o) = -2o + o4 + 2o*4 - 6o + 3o + 13. Let p(x) = 4j(x) + 5s(x). Differentiate p(b) wrt b. -32b*3 Let f be ((-35)/21)/((-2)/6). What is the third derivative of -fo*3 - 4o*3 + 9o*3 - 4o*2 + 9o*3 wrt o? 54 Find the second derivative of 163h + 53h4 - h3 - 2h*5 + 233h + 99h4 + h3 wrt h. -40h*3 + 1824h*2 Let v(j) = -42j*3 + 4j*2 - 4j - 15. Let q(s) = 2s3 - s2 + s. Let y(n) = -4q(n) - v(n). Differentiate y(w) with respect to w. 102w2 Let x(f) be the first derivative of 4 + 0f*2 - 35f - 13/3f3. Differentiate x(s) wrt s. -26s Let a(j) = 86j5 - 16j*2 - j + 3. Let w(f) = -87f*5 + 16f*2 + f - 4. Let c(k) = -4a(k) - 3w(k). What is the third derivative of c(b) wrt b? -4980b*2 Let b(f) be the first derivative of -5f8/112 - f5/60 + 8f2 - 21. Let z(t) be the second derivative of b(t). What is the third derivative of z(d) wrt d? -900d*2 Let w(t) = 0t*2 - 11t*2 - 7t + 8 - 2t + 4 - t3. Let o be w(-10). What is the third derivative of 2r*4 - 5r*o - 17r*6 - 2r*4 + 8r*6 wrt r? -1080r*3 Suppose 18 = 17j - 14j. Find the first derivative of 8 + j + 5w - 34 wrt w. 5 Let x be 6(-3)/(-6) - 3. Find the third derivative of -h3 + xh*2 + 2h*2 - 7h*2 wrt h. -6 Find the third derivative of -2g - 84g6 - 79 + 154 - 75 - 8g*2 wrt g. -10080g*3 Let k = 176/5 + -167/5. Let v(n) be the first derivative of 0n*4 + 0n*3 + kn*5 - 9n + 0n2 - 9. What is the first derivative of v(i) wrt i? 36i*3 Suppose -3p = 3p - 12. Let g = p - -3. What is the third derivative of 5k*2 + 0k*4 - 2k*2 - 7k*g + 0k*4 wrt k? -420k*2 Let d(f) be the third derivative of -9f*5/10 + 45f*4/4 - 56f**2 - 2. What is the second derivative of d(v) wrt v? -108 Let g = -46 - -80. Let s = -29 + g.	{ "pile_set_name": "DM Mathematics" }
. Let d(q) = -7c(q) - 6f(q). What is d(i)? -1 Let k(a) = -a + 4. Suppose -5b + 19b - 2688 = 0. Let v = b + -189. Determine k(v). 1 Suppose 126r - 134r = -24. Let n(k) = -k*2 - 6k. Let p(q) = 2q2 + 13q + 1. Let i(j) = -5n(j) - 2p(j). Calculate i(r). 19 Let t = -6 + 8. Suppose -g - 4x = -tx - 11, 3x = 4g + 11. Let y(u) = 7u - u2 + g - 9u - 12u2. Calculate y(1). -14 Let q(a) = -1 + a - 1 + 1. Let w(k) = -k3 + 2k*2 + 21k. Let z be w(-4). Suppose 3f + 2p + 14 = 0, 3p + p = -2f - z. Calculate q(f). -5 Suppose 0 = 17u - 14u + 3i, 0 = -4u + 2i + 12. Let g(s) = -2s*3 + 5s*2 - 4s + 2. What is g(u)? -2 Suppose 1152d + m = 1148d + 20, 11 = 5d + 3m. Let g(p) = 2p2 - 12p - 14. Determine g(d). 0 Let n = -186 - -188. Suppose 0 = 2u + 4, na + 2u = 3a - 5. Let b(p) = -5p - 2. Give b(a). -7 Suppose 3s - 426 + 159 = -3q, 3s + 485 = 5q. Let x = -101 + q. Let p(w) = 2w + 10. What is p(x)? -4 Let i(h) be the second derivative of h*3/6 - 11h*2/2 - 4h. Let z be (-609)/(-28)(-8)/(-6). Suppose 9u - 25 = z. Determine i(u). -5 Let u(l) be the third derivative of -l6/120 + l5/20 + 5l4/24 - l3/6 + 2l*2 + 2l - 1336. Give u(5). -26 Let v(j) be the first derivative of 3j2/2 + 20j - 1750. Calculate v(-8). -4 Let r(a) be the third derivative of -5a4/12 + 52a*3/3 + 441a*2 + 2a. Calculate r(11). -6 Let l(q) be the first derivative of 33q4/4 - q3/3 + 3. Let z = -42437 + 42438. Give l(z). 32 Let i = -350 + 355. Let c(z) = -7z + 35. What is c(i)? 0 Suppose -10t + 64 = -6. Suppose -60 = tr - 46. Let b(x) be the first derivative of -6x2 - 2x - 4. Give b(r). 22 Let v(c) = 9c - 2. Suppose -16k - 17 = -81. Suppose -40a + 37a = -ki - 3, -3i + 3 = -4a. Determine v(i). -29 Let a(l) = -82 - 89 + 0l - l*2 + 4l + 168 - 13l. Let r = -2 - 6. Give a(r). 5 Suppose -14k + 36 = -10k + 2p, k - 3p - 9 = 0. Let t(c) = -228c - c*2 - k + 233c + 15. Give t(5). 6 Let m(j) = -9j2 + 3j - 27. Let f(t) = 10t2 - 5t + 32. Let v(z) = 4f(z) + 5m(z). Calculate v(-4). -67 Let z(n) be the second derivative of -n*4/6 - 13n*3/3 - 23n*2/2 + 3304n. What is z(-11)? 21 Let d be 2/(-2)(23 - 24). Let b(t) = 9 - 3t - 8 - 2t2 - t + d + t2. Give b(-6). -10 Let o = 9 - 5. Let d(v) = 7 + 23 - 4v + 2v2 - v2 - 60 + 23 + 4. Determine d(o). -3 Let a(g) = -2g*2 + g + 2. Let l(u) = -3u*2 + 4. Let i be 2/(-4)(7 + 3). Let p(w) = il(w) + 7a(w). Let s be (1 + (-1)/2)-14. Give p(s). -6 Let y(z) = -5z + 72. Let j be y(14). Let l(f) = f3 - f. Let t(o) = -o3 - 6o2 + 3o + 8. Let b(h) = jl(h) + t(h). Let i = 13 + -7. Calculate b(i). 14 Let c be 14/(-21)(2 - 14). Let g(n) = 3n + n2 - n - n3 + c + 0n - n. Let p be 0/(-2 - (3 - 7)). What is g(p)? 8 Let m be -9 - -6 - (-10)/(2 + 0). Let l(b) = -2b + 20 + 5b + b - 2b - 18. Calculate l(m). 6 Let y(q) be the second derivative of -17q*3/6 + 93q*2/2 + 52q + 7. Calculate y(5). 8 Let y(d) = 2d + 7. Let i(j) = -3j - 8. Suppose -3q - 1 - 1 = x, -5x - 2q - 23 = 0. Let n(h) = xy(h) - 4i(h). Calculate n(6). 9 Let n(s) = 3s*2 - 5s - 46. Let i be n(5). Suppose -3v = -6, 3v = -0u - 5u + 21. Let a(w) = -1 + 2 - 23w2 + 19w2 - w3 - iw + uw. Give a(-3). -5 Suppose -110 = -2u - 3r, -5r + 283 = 5u + 18. Let a be (-10)/(-35) - 63/u. Let l(x) = -2x2 + x + 1. What is l(a)? -2 Let z(u) = -11 + 2 + 8u - 7u + u + 5u2. Let q(i) = -i2 - i + 2. Let v(h) = 4q(h) + z(h). Give v(3). 2 Let s(u) = u - 2u*3 + 9u*2 + 3u + 1768608 - 1768603. Calculate s(5). 0 Let t = 17/137 + 69/548. Let q(p) be the first derivative of -7 - 1/2p2 + 5/3p*3 - 3p + tp4. What is q(-5)? 2 Suppose 44v - 52v = -128. Let f be 2/(v/(-13 - -5)). Let n(x) = 2x - 2. Give n(f). -4 Let z(c) = 2c2 - 14c + 31. Suppose -4081 = -29r - 565r + 11r. Calculate z(r). 31 Let n be 8 + -3 + (0 - 0/(-7)). Let m(k) = k2 - 12k + 5. Determine m(n). -30 Let a(t) be the third derivative of -t*6/120 - 3t*5/5 + 59t*4/12 + 5t3 + t2 + 200t. Determine a(-39). -9 Let j = 110 - 25. Let q(y) = -y2 + j - 15y*2 - 85. Calculate q(1). -16 Suppose -6a - 15 = -27. Suppose av = -692 + 702. Let p(d) = -2d*2 + 7d - 5. Give p(v). -20 Suppose -2k - 236 = -4k. Let n = 67 - k. Let b be (3-2)/(n/68). Let i(y) = -y2 + 7y + 3. Calculate i(b). -5 Let n(i) be the first derivative of i2/2 + i + 7001. Let l(y) = y - 4. Let v be l(2). What is n(v)? -1 Let t(w) = -w - 10. Let u(h) = h2 - h - 27. Let n be u(9). Let y be (1/3)/(-2 - (-85)/n). Let x be y + (-5)/10 + 3/(-2). What is t(x)? -5 Let j(n) = -68n - 7. Let q(c) = -54c - 9. Let g(s) = -4j(s) + 5q(s). Determine g(6). -5 Let f(u) = u + 11. Let j be f(-7). Let a(s) be the first derivative of -1/2s2 - j + 7s. Calculate a(6). 1 Let n(f) = -2f3 + f2 + 3f + 2. Let s be n(0). Let r(t) = st - 22 + 14 + 1 - t. Determine r(-8). -15 Let d(r) = -10r*2 + 13r + 36. Let m(h) = -3h2 + 4h + 11. Let v(g) = 2d(g) - 7m(g). Give v(4). 3 Let m(w) = 20 + w - 11 - 16 - 5. Suppose 3p - b - 28 = 0, 5p + 87b = 88b + 44. Calculate m(p). -4 Let z be (-5)/30 + (2/12 - -3). Suppose 3a - 11 = -2n, -zn - 2a - 2a = -16. Let g(d) = -d2 + 2d - 3. Determine g(n). -11 Let y(z) = -5z3 - 4z*2 + 8z - 5. Let g be y(1). Let j be (-15)/g + -2 + (-24)/(-16). Let c(b) = 2b2 - 2b. Calculate c(j). 4 Let v(c) = 0 - 24c3 - 6234c*2 + 3116c*2 + 3120c*2 + 1 - 3c. Calculate v(1). -24 Let f(k) = k*2 - k. Let a(y) = 2y*2 - 8y + 3. Let u = -124 + 127. Let n be a(u). Determine f(n). 12 Let s(k) = k + 8. Let d = 4226 + -4237. Determine s(d). -3 Let f(y) be the third derivative of 2/3y3 - 1/120y*6 + 0y + 0 + 1/15y5 - 13y*2 + 5/24y4. Let b = 4 + 1. Calculate f(b). 4 Let x(n) = -n2 + 17n + 24. Let m be 1/2 + 10 + (-2515)/(-10). Let c = m + -244. Give x(c). 6 Let h(t) = t3 + 3. Let r(d) = 2 - 4d + 138d2 - 139d*2 + 58. Let q be r(-10). Determine h(q). 3 Let v(k) = 9k*3 + 58k*2 + 14k + 6. Let m(z) = -10z3 - 64z*2 - 13z - 6. Let o(x) = 10m(x) + 11v(x). Give o(-6). 6 Let o(d) = 2d + 3. Let t be (1 + 14/(-4))152/(-20). Let p be 1 + t - (-19 + 18). Let a = p + -26. What is o(a)? -7 Let c(y) = y + 19. Let x be c(-13). Let p(t) = -4t3 - 30t*2 - 2t - 3. Let d(k) = 5k3 + 42k*2 + 3k + 3. Let v(u) = 3d(u) + 4p(u). Calculate v(x). 3 Let h = 10470 - 10476. Let d(c) = -c. Let w(t) = 3t - 3. Let m(f) = 4d(f) + w(f). Give m(h). 3 Let v(i) = 30319 + 30374 - 60657 - 24i2 + 2i*3 + 36i. Give v(10). -4 Let a be 3 - (2/10 - 344/20). Suppose -4w - 8 = -3q, w - 16 = -4q + 20. Suppose 18y = qy + a. Let c(j) = -j2 + j + 1. What is c(y)? -1 Let c(g) = -14g + 45. Let n(d) = 15d - 52. Let h(q) = 7c(q) + 6n(q). What is h(2)? -13 Suppose 527 = -9l + 554. Let u(a) = -4 - 8a2 + 9a*2 - 34a + 34a. Give u(l). 5 Let z(j) = -7j*2 + 1 + 8j + j2 + j3 + 6 - 2j3. Let u(k) = k3 - 2k*2 + 4. Let s be u(0). Suppose sg - 10 + 38 = 0. What is z(g)? 0 Let h be (20 - -8)1/2. Suppose -hf + 10f + 44 = 0. Suppose -2m = f + 7. Let d(j) = j*3 + 9j*2 - j - 13. Give d(m). -4 Suppose 6b = 7b - 70. Let o(v) = 7v + b - 36 - 35. Let w = -4 - -5. Determine o(w). 6 Let n(i) = i - 5. Let u(t) = 3t2 + 2t - 2. Let z be u(2). Suppose -277l = -513l + 1180. Let y = l - z. Calculate n(y). -14 Let i(w) be the first derivative of -2w2 + 81w + 3217. What is i(24)? -15 Let t(s) = s + 2. Let y(b) = -b3 + b2 - b - 9. Let u = 8 - 8. Let v be y(u). Calculate t(v). -7 Let a(u) be the first derivative of 5u4/2 - u3/3 + u2 - 2u + 4912. Give a(2). 78 Let x(b) = b*3 - 13b*2 - 30b. Suppose 4s - 70 = 5a, -3s - 2a + 155 - 114 = 0. Give x(s). 0 Let t(c) be the second derivative of c5/20 - c4/3 + 3c2/2 - 142c. Suppose -x + 4 = 0, 2h = -20x + 24x - 10. Determine t(h). -6 Let n(t) = t3 + 9t*2 + 3t + 44. Let h be n(-9). Suppose -16k - 65 + h = 0. Let p(a) = -a3 - 4a*2 + a. Give p(k). -12 Suppose 341 = 3a - 5i, -5a - i + 447 = -a. Let h be 55/((-21)/6 + 2 + 1). Let j = h + a. Let g(n) = -5n + 2. Give g(j). -8 Let i(d) be the second derivative of -d4/12 + d3/2 + d2/2 + d. Let x = 804 - 802. Let q(v) = 31v - 59.	{ "pile_set_name": "DM Mathematics" }
+ 32. Let k = -99066.9894 - -99035. Let z = k - w. What is z rounded to three dps? 0.011 Let r(p) = 4p2 - 8p*2 - 1630 + 5p*2 + 57630 + 2p. Let k(z) = z - 9. Let w be k(9). Let v be r(w). What is v rounded to the nearest ten thousand? 60000 Let o = -5052 + 4946.55. Let b = o - 392.44. Let f = b + 494. What is f rounded to one dp? -3.9 Let w = 136 + -16. Let k = w + -119.82. Let n = -0.2079 + k. What is n rounded to 3 dps? -0.028 Let d = 570 - 569.82. Let h = d - 8.76. Round h to 1 decimal place. -8.6 Let l = -2.39 - -151.39. Let w = -29925073.1600171 + 29925222.16. Let z = w - l. What is z rounded to six decimal places? -0.000017 Let w = -801561079.0000595 - -801560798. Let l = -232 - 49. Let v = w - l. What is v rounded to 5 decimal places? -0.00006 Let b = -4.27 - -14.98. Let o = b - 11.4739. What is o rounded to 2 decimal places? -0.76 Suppose 723 - 85 = -22h. Let n be (-232)/h(-1 + -3612499). What is n rounded to the nearest one million? -29000000 Let s(c) = -2c2 + c + 26536178. Let x be s(0). Suppose -5o - 47563837 = -3w + x, 0 = -5w + 25. Round o to the nearest one million. -15000000 Let z be -1 + (-3)/(-9) - 28/(-6). Suppose 3o - 8100 = zq, -637 - 4763 = -2o + 3q. Round o to the nearest one hundred. 2700 Let x = -2159 - -2159.007578. Round x to 4 dps. 0.0076 Let v = 28677 + -28677.000017196. What is v rounded to five decimal places? -0.00002 Let b = -2377 + 1046. Let f = b - -1214.3. What is f rounded to the nearest ten? -120 Suppose -13i + 16i + b + 42155 = 0, 5i - b + 70245 = 0. Let l = i - 15650. What is l rounded to the nearest one thousand? -30000 Let k = -817.3 + 813.953. Let f = -3.31923 - k. Round f to three dps. 0.028 Let k(m) = m + 24. Let z be k(-18). Let p(u) = -43u*3 - 8u*2 + u + 10. Let y be p(z). What is y rounded to the nearest one thousand? -10000 Let m = 11.69869 + -11.821. Round m to 3 decimal places. -0.122 Suppose 16x + 16179211 + 9031428 = -2067761. Round x to the nearest one hundred thousand. -1700000 Let z = 91 + -89. Suppose 5s + 793 = 4p - 3035, -zs = 4p - 3800. Round p to the nearest ten. 950 Suppose 0 = -4p + 24 - 4, -k - 5p + 7329 = 0. Let g = k - -5089. Suppose g = -2w + 2193. What is w rounded to the nearest one thousand? -5000 Let z be ((-2)/(-6))/(-1010/(-2700)). Let n(h) = h*3 - 7h*2 - 17h + 31. Let t be n(z). What is t rounded to the nearest 100? 0 Let n = 162 + -227. Let m = n - -60.7. Let s = -4.29932 - m. Round s to four dps. 0.0007 Let i = 1.63 - 0.03. Let p = -0.6 + i. Let c = -0.899 + p. Round c to two dps. 0.1 Let i = 3039.2 - 7982.8. What is i rounded to the nearest one thousand? -5000 Let d = -177 - -180.68. Let f = 0.58 - d. Let t = f - -3.1000544. What is t rounded to 6 decimal places? 0.000054 Let o = -2048 - -2049.4907. Round o to one decimal place. 1.5 Let a = 8009 - 7603.3. What is a rounded to the nearest 10? 410 Let u = 208120 - 207942.497. Let q = u + -0.303. What is q rounded to zero decimal places? 177 Let r be 706(-2 - (-15)/6). Let z = -604 + r. Let u = z + 168. What is u rounded to the nearest 10? -80 Let n = -0.0906986 + 0.0898. Round n to four dps. -0.0009 Let g = 2 - -2.7. Let m = -6.6 + g. Let d = m - -1.900045. Round d to five dps. 0.00005 Let j = 889573 + -889572.98400012. Let k = -409.016 - -409. Let p = j + k. Round p to seven dps. -0.0000001 Let z = 547541240 - 547542120.001222. Let i = -880 - z. Round i to four dps. 0.0012 Let v = -571 - -972. Let m = 400.9518 - v. What is m rounded to three decimal places? -0.048 Let y = 53398 + -53398.054349. What is y rounded to 2 dps? -0.05 Suppose -476412 = -u + 3v, -65v - 16 = -61v. Round u to the nearest 100000. 500000 Let j = 94531.1471163294 - 1.7661263294. Let u = j + -94529. Let n = u + -0.379. What is n rounded to four dps? 0.002 Let k = 1787 + -2505. Let b = -717.999999913 - k. What is b rounded to 7 decimal places? 0.0000001 Let x = -0.90982 + 0.77. Round x to 3 dps. -0.14 Let x(o) = 10o2 - 6. Let a be x(3). Let j = 346 + a. Round j to the nearest one hundred. 400 Let x = 187 + -163. Let q be 15-1848(-20)/x. Round q to the nearest one thousand. 11000 Let n = 16.84618 + -16.807. What is n rounded to two dps? 0.04 Let a = -28001696 + 12949596. Round a to the nearest one hundred thousand. -15100000 Let j = 7.7 - 8.23. Let o = -22832874.46999942 + 22832875. Let t = o + j. What is t rounded to 7 dps? 0.0000006 Let b be ((-10)/6)/(-103/36). Suppose -2k - 6 = b, 3p - 5k = 17. Let i be 11100((1 - p) + -5 + 2). Round i to the nearest one thousand. -11000 Suppose -v = v - 4. Let w(j) = 18 - 21 - 331j*2 + 4j - 670jv. Let g be w(3). Round g to the nearest one thousand. -9000 Let m = 55 - 54.7025. Let f = m - 0.29. Round f to three decimal places. 0.008 Let w be (-99834497)/(-21) - (-2 + (-20)/(-12)). Suppose -7u + w = -6725976. Round u to the nearest 100000. 1600000 Let w(p) = -2 - 6p + 64669p*2 + 15 + 5 - 4. Let u be w(4). Suppose 5h + 17500000 = j, u = -5h + 3j - 16465306. Round h to the nearest 1000000. -4000000 Let h be (-5)/(3/((-12)/10)). Suppose 0v - 2v = 4r - 52, -v - 18 = -hr. Suppose rm - 14m = -219. Round m to the nearest 10. 70 Let j be (-2)/5 - (-550933380)/(-50). Suppose -14474674 = -4o - y, 0 = -2o - 2o - 5y + 14474682. Let t = j + o. What is t rounded to the nearest 1000000? -7000000 Let a(p) = 771110p2 - p + 13. Let c be 1571/13 + (-6)/(-39). Let g = c - 118. Let q be a(g). What is q rounded to the nearest one million? 7000000 Let i = -1095 + 1124. Let q = 25.97 - -3.33. Let k = i - q. Round k to the nearest integer. 0 Let z = 0.09028 - 419.39028. Let q = 402.756 + z. Let s = q - -16.1. What is s rounded to two decimal places? -0.44 Let x = -19.4828081924 - 237.5171916096. Let y = 257 + x. Round y to seven dps. 0.0000002 Let p = 17.427 + -17.35673. What is p rounded to three dps? 0.07 Let q(u) = 1643u - 10. Let a be q(-3). Let j = -2199 - a. What is j rounded to the nearest 1000? 3000 Let a = 0.52 + 0.25. Let r = -0.75 + a. Let i = 0.0132 - r. Round i to three decimal places. -0.007 Let c = 593196471 + -908782870. Let n = -315586656.999506 - c. Let f = -258 - n. What is f rounded to four decimal places? -0.0005 Let k = 3402 + -3498.88. What is k rounded to the nearest integer? -97 Let s = -0.1237 + 0.137547. Round s to 3 decimal places. 0.014 Let r(v) = -5000v2 - 3v - 9. Suppose -13 = -h - 16. Let b be r(h). Round b to the nearest ten thousand. -50000 Let c(h) = -325h2 + 7h + 344. Let f be c(83). What is f rounded to the nearest 1000000? -2000000 Let s be 126/(-3)18/(-21). Let i be 73176/s + (-8)/12. What is i rounded to the nearest 100? 2000 Let i = 505 - 490.95. Let z = i - 19.74. What is z rounded to one decimal place? -5.7 Let u = -10472.990712 + 10473. What is u rounded to three dps? 0.009 Let r be 20 + 6805542 - (-2 - 1). Suppose 0 = g + 4t + 505581 - r, -5g - 3t + 31499988 = 0. Round g to the nearest one million. 6000000 Let p = -2264123355.9999255 + 2264123936. Let w = 580 - p. Round w to 5 dps. -0.00007 Let c = 4643.9999985048 - 4644. Round c to seven decimal places. -0.0000015 Let c = 3533300 - 2047038. Let u(y) = 2118y3 - 5y*2 + 4y + 5. Let o be u(7). Let z = o - c. Round z to the nearest one hundred thousand. -800000 Let p = 3595.9996022 + -3596. What is p rounded to four decimal places? -0.0004 Let j(n) = -767n2 - 6n + 15. Let b be j(-6). Let y = b + 59311. Round y to the nearest 1000. 32000 Let x = -0.05689 + 3074.05689. Let r = 3073.99993665 - x. What is r rounded to five decimal places? -0.00006 Let n = -0.4116001 - -102.4102501. Let t = 102 - n. Round t to three decimal places. 0.001 Let n = -67.022597 - -67. What is n rounded to three dps? -0.023 Let s(z) = 881891z + 3. Let t be s(3). Suppose -4j + 0j + t = 0. Let f = -381419 + j. Round f to the nearest one hundred thousand. 300000 Let t = 770.97 - -6.03. Let o = 563659074 - 563658296.999481. Let r = t - o. What is r rounded to 4 decimal places? -0.0005 Let i = 1273 + -1143.2. Let q = -176.775 + i. Let u = q - -47. What is u rounded to 2 dps? 0.03 Let g = -376.9758 + 377. Let x = g + -0.0599. What is x rounded to 2 dps? -0.04 Let j = -37507.81 - -37817. Round j to the nearest one hundred. 300 Let i be (-2172)/(-54) - 2/9. Let u(z) = -z*2 -	{ "pile_set_name": "DM Mathematics" }
+ 7/2b2 + 0 + 1/6b*3. Determine u(r). -3 Let b = -125 + 179. Suppose -14s + 232 = -594. Let w = s - b. Let a(m) = m*2 - 5m + 3. Determine a(w). 3 Suppose -3r = -2r - 4, -6 = -3d + 3r. Let m(i) = -di2 + 3i*2 + 5i*2 + 4i + 1. Let l(s) = -1. Let k(f) = 2l(f) + m(f). Give k(-3). 5 Let l(o) = -o2 + 10o + 1. Let u(i) = -7. Let q(p) = l(p) - u(p). What is q(12)? -16 Let a be -11 + (10/(-50) - (-22)/10). Let g(h) be the third derivative of -h*6/120 - 2h*5/15 + 3h*4/8 - 2h*3/3 + 19h*2. Determine g(a). -4 Let d(b) = 31b - 39. Let g(v) = 17v - 21. Let l(x) = 6d(x) - 11g(x). Determine l(11). -14 Let n be (1 - 17)/(-2 - 0). Let p = 40 - 18. Let w(l) = -4l - 4 - 21 - l*3 + p + 9l2. What is w(n)? 29 Let i(a) be the first derivative of -a4/4 + 10a3 - 29a*2 + 51a + 1969. Give i(28). -5 Let l = 25 - 17. Suppose -6 = -n - 2n, -t - l = 5n. Let k be ((-12)/t)/(1/(-3)). Let c(j) = -6j2 - 2j - 2. Calculate c(k). -22 Let x(d) = 4d + 2. Let b = -136 + 296. Let k be b/25 + (-4)/10. Suppose -ka = -9a - 12. What is x(a)? -14 Let i(c) = 132c - 4753. Let j be i(36). Let u(r) = -54r2 + 2. What is u(j)? -52 Let d = -2535 - -2539. Let h(g) = g - 6. What is h(d)? -2 Let k be ((1280/100 - 13)(-1 - -1))/(-1). Let b(g) = -2g - g3 + 5g - 4g - 3. Give b(k). -3 Let g(w) = 7w*3 + 22w*2 + 38w - 60. Let n(f) = f3 + f2 + f - 17. Let d(y) = g(y) - 6n(y). What is d(-14)? -14 Let o(h) be the third derivative of h4/24 - h3/3 - 790h*2 + 2h. Let l(s) = 8s - 18. Let x(r) = 4l(r) - 36o(r). Let v be 8/3(-6)/(-4). Determine x(v). -16 Suppose -8 = -18p + 14p. Suppose 3w - 2n = 13 - 1, -3w = pn - 12. Let d(h) = 2h + 3. Determine d(w). 11 Let m be 165/(-33) - (-32)/2. Suppose -133 = -mo - 122. Let c(k) = -2k3 - k2 + 2k - 2. Determine c(o). -3 Let f(q) = -q*2 - q - 1. Let c be 24/(-80) + (-17)/10. Let h(g) = 3g*2 - 2g. Let o(y) = cf(y) - h(y). What is o(6)? -10 Suppose -1255 = -18n + 4631. Let q(w) = 335w2 - w3 + 6 - w + nw*2 - 662w2. Calculate q(0). 6 Let t(u) = u2 + 6u + 9. Let s = -289 - -291. Let j(x) = -3x*2 - 15x - 19. Let b(i) = sj(i) + 5t(i). Determine b(-6). -29 Let k(m) = -2m - 152. Let j(q) = 69q + 5635. Let a(t) = 5j(t) + 184k(t). Give a(9). 0 Let t(g) = -46g + 180. Suppose 41 - 25 = -2a + 4n, 0 = -3a - 2n + 24. Give t(a). -4 Let z(i) = 4i - i - 2i. Let m be 1 - -1(-228)/4. Let f be (-50)/125 + m/10. What is z(f)? -6 Let c(h) = h - 3. Let f(x) = 6x - 15. Let u(r) = -11c(r) + 2f(r). Suppose -1 + 7 = 2m - 5g, 5m = -g + 15. What is u(m)? 6 Let h = 15756 - 15760. Let g(p) = -7p2 - p + 6. Calculate g(h). -102 Suppose -2n + 0n - 6 = 2r, 18r = 3n - 117. Let x(p) be the third derivative of 0 + 0p4 + 0p + 1/30p5 - 15p*2 + 0pn. Give x(1). 2 Let k be (-1)/(-15) + (-298072)/555. Let c = k + 546. Let j(o) = o - 9. What is j(c)? 0 Let w be (-4)/((-240)/75) - (-3)/4. Let u(x) = -x3 - x*2 - x + 4. Calculate u(w). -10 Let l = -114 + 127. Let p = 19 - l. Let h(v) = -2v + 1 - 3 + 0 + 3v. Determine h(p). 4 Let j(k) = -k - 4. Let c(g) = 1. Let r(q) = 6c(q) + j(q). Let h(f) = 4f - 7. Let t be 62/3 + 1 + 17/51. Let n(p) = tr(p) + 6h(p). Give n(-4). -6 Let c(o) = 2o*2 + 6o - 9. Suppose -3f - 41 = 4x, -5x - 4f - 43 = -2x. Calculate c(x). 11 Let v(m) be the third derivative of m7/840 + m6/120 + m5/30 + m4/12 - 22m*3 + 312m2. Let l(y) be the first derivative of v(y). Calculate l(-2). -2 Let v(t) be the second derivative of t5/20 + 7t4/6 + 13t*3/3 - 17t*2/2 - 1792t. Determine v(-12). -41 Let u(a) = 187a + 94. Let j(c) = 154c + 92. Let k(l) = -6j(l) + 5u(l). Determine k(5). -27 Let s(g) be the second derivative of g*3/2 - 4g*2 + 19493g. Suppose -4i = 4d - 6i - 10, 5d - 2i - 15 = 0. What is s(d)? 7 Let z(r) = r2 + 5r - 8. Let i be (-12)/(-48) - (-939)/(-12). Let u be 16/(-6) - i/(-18). Give z(u). 6 Let i(y) be the first derivative of -y*4/2 - 4y3/3 - y2/2 + 1. Let h(t) = -t*2 + 4t + 14. Let o be h(-3). Let b be -6o/((-98)/7). Give i(b). 21 Let x(o) = -o2 + 12o + 35. Let v = 615 + -603. Determine x(v). 35 Let y(q) = 13q - 2. Let k(l) = 35l*3 + 2939l*2 - 84l - 5. Let j be k(-84). What is y(j)? -67 Let s(r) = -r*2 - 2r - 4. Suppose 0 = 8w - 7w - 5. Suppose wb - 14 = 6. Let a(t) = -1. Let f(v) = ba(v) - s(v). Determine f(-4). 8 Let j(m) = 4 + 0 - 2 - m. Let z be 32384/(-6578) + (-1)/13. Calculate j(z). 7 Suppose 0 = 459b - 177b + 1109 + 3403. Let t(m) = -m*2 - 8m + 135. Give t(b). 7 Suppose 0 = -0b + 4b + 16. Let h = b - -1. Let k(r) be the second derivative of -r4/12 - r3/6 + r*2 + 856r. Give k(h). -4 Let a = 4568 + -4557. Let r(z) = z*3 - 13z*2 + 20z - 5. What is r(a)? -27 Let s(d) be the first derivative of -7d2 + 23d + 758. What is s(8)? -89 Let x(h) be the third derivative of -h*4/24 - 8h*3/3 + 32h*2 + 1. Suppose 351 = -17u - 10u. What is x(u)? -3 Let k(y) = y + 13. Let p(g) = 4g*2. Let v be p(-2). Suppose vz - 11z = 0. Suppose u + 4r + 0r = z, u - 3r = 0. Give k(u). 13 Let x(a) = -a*2 - 7a - 4. Let w(d) be the third derivative of d*5/60 + 11d*4/24 + 2d*3 + 23d*2. Let u be w(-8). Let m be (-1)/(1/u-2). Give x(m). 2 Let q(f) be the first derivative of f*4/4 + 2f*3 + 7f*2/2 + f - 1. Suppose -3c + 12 = -3y, 0 = 3c - 696y + 699y + 42. Calculate q(c). -9 Let q(u) be the third derivative of u*5/60 + 3u*4/8 - 14u*3/3 - 3u*2 - 1. Give q(-12). 8 Let b(i) = -i - 6. Suppose 4t + 49 - 53 = 0. Let f be (5t/15)/((-2)/36). What is b(f)? 0 Let o(b) = 11b. Suppose -4v + 8v = 8v. Determine o(v). 0 Let n(f) = -8f - 24f + 2 - 17f - 9f + 74f + 3f2. Give n(-7). 37 Let l be -3 - (22/8 - (-2)/8). Let i(j) = 4j*3 - 15j*2 + 8j - 1. Let x(q) = q*3 - 5q*2 + 3q. Let h(a) = 2i(a) - 7x(a). Calculate h(l). -8 Let v(w) be the first derivative of w*4/24 - 2w*3/3 + 151w2/2 + 218. Let p(n) be the second derivative of v(n). Determine p(-4). -8 Let u(t) = t2 - 10t - 29. Let y be u(-11). Let j = -196 + y. Let i(b) = b - 10. Let z(m) = m - 10. Let r(a) = -2i(a) + 3z(a). Calculate r(j). -4 Let l(p) = -p2 + 13p + 17. Suppose 0 = 5j + 5s - 55, -5s = 3j - 7j + 71. Let q be l(j). Let v(n) = -nq - n - 5n*2 - 3n + 5n. Determine v(-5). -5 Suppose -c + 4c = -4h + 167, 0 = 3h + 4c - 120. Suppose -38n - 36 = -hn. Let u(q) = -q2 + 8q - 20. What is u(n)? -8 Let t(d) = -8d2 - 20d - 4. Let a be t(3). Let y = -125 - a. Let g(i) = -i*3 + 11i*2 - 3i - 13. Determine g(y). -46 Let x be (23 + 1)(14 + (-752)/24). Let w = 403 + x. Let h(s) = s2 + 14s + 13. What is h(w)? 0 Let k(x) be the second derivative of 7x5/10 + x4/12 + x3 + 2x*2 - 4465x. What is k(-1)? -15 Let v = 60 - 61. Let w(b) = -51b - 12. Let q(k) = -4k - 1. Let p(s) = -27q(s) + 2w(s). Let c be p(v). Let i(y) = y*2 + 3y - 1. Give i(c). -1 Let o(r) = -r - 109. Let j = 5094 - 5094. Determine o(j). -109 Let b(w) = -w + 5. Suppose -4l - 16 = -5x, -4l = 4x + 24 - 8. Let k = x - -10. Give b(k). -5 Let a(g) = -288 + 103 + 6g2 - 4g*2 - 289 - 232 + 61g. Calculate a(9). 5 Let b be 1/(-4) + (-34)/(-8). Suppose x = -4f - 2, -bx + 12 + 0 = -4f. Let d(o) = 1 + 12o*2 + 2268o - 753o - 758o - 756o. Calculate d(f). 12 Let g(v) = 4v*2 + 67v - 1521. Let p(i) = -i*2 - 16i + 379. Let w(u) = -2g(u) - 9p(u). What is w(-25)? 6 Let d(f) be the third derivative of -f6/60 + f5/12 - f*4/8 + 2f3/3 - f2. Let i = -220293 - -220296. Calculate d(i). -14 Let g(p) = 20p2 - 5p - 1. Let z(s) = -9s2 + 2s + 1. Let f = -374 - -383. Let i(h) = fz(h) + 4g(h). Let t(n) = n - 2. Let r be t(-3). Determine i(r). -10 Suppose 1 = 5w - 29. Let j be -244/(-56) - (-15)/35. Let f(k) = -3k + 9k*2 + w - k - 8k*j. Determine f(4). 6 Let f = 9848 + -9850. Let h(q) = -11q*3 + 1. Determine h(f). 89 Suppose -5u - 5m - 4450 + 670 = 0, 5u - 4m = -3735. Let n = u - -752. Let t(o) = -13o*2 - 3o + 3. What is t(n)? -13 Let m(q) = -q*3 + 4q*2 - 3q. Let j(h) = h*2 - 7h + 14. Let w be j(4). Let n be m(w). Let t(u) = -7u2 + u2 - 8u - 2 - 3un + 8u2. What is t(-8)? -2 Let y(z) be the second derivative of z5/10 - z**4	{ "pile_set_name": "DM Mathematics" }
8:02 PM and 11:25 PM? 203 What is 121 minutes before 6:25 AM? 4:24 AM How many minutes are there between 7:52 AM and 8:32 AM? 40 How many minutes are there between 5:38 AM and 11:52 AM? 374 What is 142 minutes before 3:39 AM? 1:17 AM How many minutes are there between 3:14 AM and 5:33 AM? 139 What is 240 minutes after 12:14 PM? 4:14 PM What is 317 minutes before 4:02 PM? 10:45 AM What is 488 minutes before 3:25 PM? 7:17 AM How many minutes are there between 5:15 PM and 5:59 PM? 44 What is 706 minutes before 11:03 AM? 11:17 PM What is 520 minutes after 12:50 AM? 9:30 AM How many minutes are there between 3:03 AM and 11:27 AM? 504 What is 289 minutes before 3:54 PM? 11:05 AM What is 96 minutes after 10:24 PM? 12:00 AM How many minutes are there between 8:09 PM and 7:11 AM? 662 What is 634 minutes before 7:29 AM? 8:55 PM How many minutes are there between 2:03 AM and 8:34 AM? 391 What is 298 minutes after 3:43 PM? 8:41 PM What is 430 minutes after 8:35 AM? 3:45 PM What is 681 minutes before 11:53 PM? 12:32 PM How many minutes are there between 10:05 AM and 5:06 PM? 421 What is 291 minutes before 2:59 AM? 10:08 PM How many minutes are there between 3:23 AM and 10:51 AM? 448 What is 243 minutes after 4:10 PM? 8:13 PM What is 171 minutes after 1:43 PM? 4:34 PM What is 386 minutes after 5:11 PM? 11:37 PM How many minutes are there between 8:41 PM and 10:25 PM? 104 How many minutes are there between 7:49 PM and 2:16 AM? 387 What is 610 minutes after 10:47 AM? 8:57 PM How many minutes are there between 8:45 PM and 9:26 PM? 41 How many minutes are there between 7:28 AM and 9:23 AM? 115 What is 665 minutes before 1:06 AM? 2:01 PM How many minutes are there between 10:15 PM and 3:18 AM? 303 What is 42 minutes after 4:28 AM? 5:10 AM How many minutes are there between 3:03 PM and 6:09 PM? 186 What is 71 minutes after 8:37 AM? 9:48 AM How many minutes are there between 5:54 AM and 1:59 PM? 485 What is 90 minutes before 12:35 AM? 11:05 PM How many minutes are there between 11:38 AM and 10:01 PM? 623 What is 44 minutes before 3:02 AM? 2:18 AM How many minutes are there between 1:11 PM and 10:39 PM? 568 What is 473 minutes after 4:03 AM? 11:56 AM What is 623 minutes after 1:17 AM? 11:40 AM How many minutes are there between 10:23 PM and 6:06 AM? 463 How many minutes are there between 5:13 PM and 2:01 AM? 528 What is 300 minutes before 5:41 PM? 12:41 PM How many minutes are there between 6:48 PM and 3:34 AM? 526 How many minutes are there between 7:29 AM and 9:44 AM? 135 How many minutes are there between 8:08 PM and 8:14 PM? 6 How many minutes are there between 2:52 AM and 4:21 AM? 89 How many minutes are there between 4:58 PM and 12:21 AM? 443 How many minutes are there between 6:10 AM and 6:29 AM? 19 How many minutes are there between 7:56 AM and 12:47 PM? 291 What is 12 minutes before 9:41 PM? 9:29 PM How many minutes are there between 12:30 AM and 12:10 PM? 700 How many minutes are there between 7:39 AM and 1:10 PM? 331 What is 91 minutes after 6:07 AM? 7:38 AM What is 20 minutes before 4:37 PM? 4:17 PM How many minutes are there between 10:57 AM and 11:08 AM? 11 How many minutes are there between 8:00 PM and 10:50 PM? 170 How many minutes are there between 12:26 AM and 10:54 AM? 628 How many minutes are there between 1:44 AM and 6:57 AM? 313 How many minutes are there between 9:23 PM and 12:13 AM? 170 How many minutes are there between 10:16 AM and 12:51 PM? 155 What is 303 minutes before 9:46 AM? 4:43 AM What is 444 minutes before 1:13 AM? 5:49 PM How many minutes are there between 12:27 AM and 6:04 AM? 337 How many minutes are there between 8:19 PM and 1:08 AM? 289 What is 399 minutes after 9:42 AM? 4:21 PM What is 249 minutes before 2:31 PM? 10:22 AM What is 185 minutes after 11:22 AM? 2:27 PM What is 419 minutes before 8:20 AM? 1:21 AM What is 687 minutes before 12:18 PM? 12:51 AM What is 418 minutes after 5:45 AM? 12:43 PM What is 235 minutes before 10:03 AM? 6:08 AM How many minutes are there between 9:34 AM and 8:20 PM? 646 What is 252 minutes after 4:11 AM? 8:23 AM What is 10 minutes before 2:46 AM? 2:36 AM How many minutes are there between 3:05 AM and 1:35 PM? 630 What is 467 minutes before 1:09 AM? 5:22 PM How many minutes are there between 2:38 AM and 4:21 AM? 103 What is 54 minutes after 3:47 AM? 4:41 AM What is 20 minutes after 10:16 PM? 10:36 PM What is 448 minutes before 3:21 AM? 7:53 PM What is 646 minutes after 6:37 PM? 5:23 AM How many minutes are there between 12:35 AM and 5:44 AM? 309 How many minutes are there between 1:25 AM and 1:31 AM? 6 How many minutes are there between 4:50 PM and 7:40 PM? 170 How many minutes are there between 10:41 PM and 11:40 PM? 59 How many minutes are there between 8:37 PM and 9:37 PM? 60 What is 439 minutes before 3:07 PM? 7:48 AM How many minutes are there between 9:54 AM and 8:58 PM? 664 What is 96 minutes after 8:40 PM? 10:16 PM How many minutes are there between 6:45 AM and 6:49 AM? 4 How many minutes are there between 8:04 PM and 3:58 AM? 474 What is 644 minutes before 3:21 PM? 4:37 AM What is 309 minutes before 4:13 AM? 11:04 PM How many minutes are there between 1:59 AM and 1:24 PM? 685 How many minutes are there between 6:58 PM and 4:39 AM? 581 How many minutes are there between 6:18 PM and 5:37 AM? 679 How many minutes are there between 9:35 AM and 10:10 AM? 35 What is 715 minutes after 12:06 PM? 12:01 AM How many minutes are there between 4:05 PM and 4:15 PM? 10 What is 277 minutes after 8:46 PM? 1:23 AM How many minutes are there between 6:26 PM and 11:48 PM? 322 What is 59 minutes after 5:17 PM? 6:16 PM What is 325 minutes after 12:58 PM? 6:23 PM How many minutes are there between 4:40 AM and 4:51 AM? 11 How many minutes are there between 10:42 AM and 3:28 PM? 286 What is 507 minutes after 3:49 PM? 12:16 AM How many minutes are there between 1:05 AM and 2:04 AM? 59 What is 265 minutes before 10:03 AM? 5:38 AM How many minutes are there between 5:21 PM and 1:04 AM? 463 How many minutes are there between 6:02 PM and 11:12 PM? 310 How many minutes are there between 11:52 AM and 9:09 PM? 557 How many minutes are there between 12:14 PM and 8:08 PM? 474 What is 67 minutes before 10:51 PM? 9:44 PM How many minutes are there between 5:38 PM and 9:33 PM? 235 How many minutes are there between 7:34 PM and 12:00 AM? 266 What is 170 minutes before 5:09 PM? 2:19 PM How many minutes are there between 2:35 PM and 1:06 AM? 631 What is 687 minutes after 7:36 AM? 7:03 PM How many minutes are there between 8:30 AM and 4:23 PM? 473 How many minutes are there between 9:07 AM and 4:07 PM? 420 How many minutes are there between 1:19 AM and 7:35 AM? 376 What is 501 minutes after 7:00 PM? 3:21 AM How many minutes are there between 6:04 AM and 6:53 AM? 49 How many minutes are there between 12:36 PM and 8:10 PM? 454 How many minutes are there between 8:54 AM and 9:38 AM? 44 What is 165 minutes before 5:47 PM? 3:02 PM What is 689 minutes before 9:47 PM? 10:18 AM How many minutes are there between 10:49 AM and 10:18 PM? 689 How many minutes are there between 8:47 PM and 11:15 PM? 148 What is 507 minutes before 8:16 PM? 11:49 AM What is 82 minutes after 8:11 PM? 9:33 PM How many minutes are there between 10:10 PM and 5:58 AM? 468 How many minutes are there between 12:10 PM and 5:28 PM? 318 What is 298 minutes before 10:12 AM? 5:14 AM How many minutes are there between 12:43 PM and 9:08 PM? 505 How many minutes are there between 8:22 AM and 6:49 PM? 627 How many minutes are there between 7:28 PM and 8:17 PM? 49 How many minutes are there between 2:37 PM and 10:42 PM? 485 How many minutes are there between 3:36 AM and 10:36 AM? 420 What is 404 minutes before 12:47 AM? 6:03 PM What is 36 minutes after 10:03 PM? 10:39 PM How many minutes are there between 3:08 AM and 2:52 PM? 704 What is 643 minutes after 11:53 PM? 10:36 AM How many minutes are there between 1:45 AM and 12:40 PM? 655 What is 39 minutes after 12:29 AM? 1:08 AM What is 111 minutes before 10:00 AM? 8:09 AM What is 410 minutes after 5:12 AM? 12:02 PM What is 388 minutes before 10:22 PM? 3:54 PM How many minutes are there between 9:52 PM and 10:52 PM? 60 How many minutes are there between 11:55 AM and 5:39 PM? 344 What is 677 minutes after 2:24 AM? 1:41 PM Ho	{ "pile_set_name": "DM Mathematics" }
assuming v is positive. v(-515/4) Simplify ((w(-16)w)/w)(-33)/(w(-15)/(w(w(w31w)/ww)/ww)) assuming w is positive. w*577 Simplify (((t/(t/(t/((t/(tt*(-1/5)/t))/t))t))/t)(19/3))(-2/29) assuming t is positive. t*(76/145) Simplify (o(oooo(2/7)/oo)/o)(2/11)/(o/o7o(-3/4)/o) assuming o is positive. o(2571/308) Simplify (c7c)/((cc(5/6)c)/c)(cc2)/c11 assuming c is positive. c(-11/6) Simplify ((k(-2/5))*(-1/40)(k(-3/5))(3/2))(37/2) assuming k is positive. k(-3293/200) Simplify k*1/((kk*(2/7)/k)/k)(kk(-6/11))/(k/(k/k(3/4))) assuming k is positive. k(437/308) Simplify (((hh5)/(h(-1/4)h))/((h(-3/7)h)/h(-1/2)))(-34) assuming h is positive. h(-1989/14) Simplify (f/f11)*33(f/(fff*14/ff))/((f/(ff/(f(-18/7)/f)))/f) assuming f is positive. f(-2376/7) Simplify (((m(mm/(m/m(-1/13)))/m)/m)/m)(-42)m*38m(-3/4) assuming m is positive. m(4289/52) Simplify ((u/(u/((u(uu*(-10/3))/uuuu)/u)))/uu)(-30)/(u(u*11u)/u)(25/2) assuming u is positive. u(-140) Simplify (g19/g(-1/4))/(gg4g)(2/11) assuming g is positive. g(799/44) Simplify ((mmm/m(-9/4))/m)(-1/20)(m(-1/6)mmm)(-23/3) assuming m is positive. m(-15793/720) Simplify (dd(6/7)/d)/d(2/31)(((dd(-2/11)d)/d)/dd)/d(-7/6) assuming d is positive. d(39779/14322) Simplify ((ggg(-2))(-10/13)((g(gg/((ggggg*0g)/g)g)/g)/g)43)27 assuming g is positive. g(-2322) Simplify (qq(-1/4))(-47)/(q11)(-36) assuming q is positive. q(1443/4) Simplify ((a5)(-11))(-47) assuming a is positive. a2585 Simplify h3/((h/h*(-8))/h)h(-12)/(h/h(-1/4)) assuming h is positive. h(-73/4) Simplify p10/(p/(p*(-13)/pp))(p(-2/5)/p)(1/28) assuming p is positive. p(-81/20) Simplify (f(-1)/f)(-2/45)/(ffff*1f)(-13/5) assuming f is positive. f(589/45) Simplify ((((m/(m*(-2/5)m))/m)/m*(-1/2))/(mm*3/mm)(-1))(-49) assuming m is positive. m*(-1911/10) Simplify ((tt/(t/(tt(3/8)/t)))/t(-11))/(t/(tt/(t(tttt/t*(-1/7)tt)/tt)))(-34) assuming t is positive. t(12389/56) Simplify ((u/(u/u(-1/5)))/(u17/u))/(u*(-2/19)/(uuuuu9uuuu)) assuming u is positive. u(86/95) Simplify ((b(b*(-3/5)b)/bb)/(b(bb/(b(-10)/bbb)b)/b))/((b/b*(-3))/bb)(2/71) assuming b is positive. b(-3803/355) Simplify d21/(d/d(-12))dd/(d/(d*(5/3)d))d(3/16) assuming d is positive. d(569/48) Simplify ttt(2/5)tt(4/3)(tt27)/t(-2/87) assuming t is positive. t(14249/435) Simplify n6/(n7/nn)(n0)(-19/3) assuming n is positive. 1/n Simplify (tt0)(-2/113)(tt(1/20))(-6/11) assuming t is positive. t(-7339/12430) Simplify ((m/((m/(m1/m)mm)/m)mm)(-19/6))(-1/13) assuming m is positive. m*(19/78) Simplify ((a/((a/(aa*(-25)a))/a)aa13)(-1/24))(4/9) assuming a is positive. a(4/27) Simplify (c*(3/5)c)*(-2/45)(cc(-1))(-28) assuming c is positive. c(-16/225) Simplify j(-6/11)/j(-4/29)(j34)(2/51) assuming j is positive. j(886/957) Simplify ((k/(k(-2/3)/k))(1/29)/(k0)(-2/21))44 assuming k is positive. k(352/87) Simplify q(-29)/(qq(-12/7))(q*(-18)q)/q(4/11) assuming q is positive. q(-3515/77) Simplify ((d/d*(-1/5)d10)(1/13))*0 assuming d is positive. 1 Simplify c/(cc/c*2)(c/c*(4/17))/cc*(-1/19)cccc5 assuming c is positive. c(2814/323) Simplify (v23v*(9/7)v)/(v(-10))(1/27) assuming v is positive. v(4849/189) Simplify (c/c10)(-2/21)/(c(-34)/c(1/12)) assuming c is positive. c(2935/84) Simplify (mm(m/(m/m*(-13))m)/m)*31/((m/(m/(m/(mmm(-3/34)))))/(m/(mm/(m(mm/m*20)/m)m))) assuming m is positive. m(-12243/34) Simplify (c(2/17)/(c/(c(17/6)/c)))(2/3) assuming c is positive. c(97/153) Simplify (g(-2/13))*(-3)g/g*(-29)g/g(-30) assuming g is positive. g(799/13) Simplify (h/((h*(7/2)/h)/h))/hhh/h(-6)hh37/h(-3/11) assuming h is positive. h(985/22) Simplify (x(1/4)x(5/2))/(x/x(4/9)x(x/(xx(5/3)))/x) assuming x is positive. x(139/36) Simplify (s/(s(-7)s))*(-35)s(-1/19)/(s/s(-19)) assuming s is positive. s(-5036/19) Simplify (i/(i4i))/(ii*(1/4))(i/((i*(-8)i)/i))/((i/(i*(-2)/ii))/ii) assuming i is positive. i(3/4) Simplify (x(-6)/(x3xx)(x/x*8x)/((x/x*(-2/7))/xxx))(-8) assuming x is positive. x(1080/7) Simplify (ff*(-2/9)(f*(-12)ff)/fff)/(f(-1/14)f*(-11)/fff) assuming f is positive. f(233/126) Simplify ((a0/(aa(-4)))35)(-11) assuming a is positive. a(-1155) Simplify (q/q*(-5)qq7qq)/(q9qqq/(q*(-12)q)) assuming q is positive. q(-7) Simplify (y(-17)y/(y/y(-1/27)))(16/5) assuming y is positive. y(-1472/27) Simplify ((r(-4)/r(-2/7))/(r5/r(5/4)))24 assuming r is positive. r(-1254/7) Simplify ((q/q(1/3))(-10))(-5/6) assuming q is positive. q(50/9) Simplify ((j/j(-6/11))/(j/j(2/13)))/(j(1/5))(16/3) assuming j is positive. j(-788/2145) Simplify (((o(-5/3)o)/o(-4))(-3/22))(-11/4) assuming o is positive. o(5/4) Simplify ((kk17kk)/k(1/12))/(k(1/8))(2/13) assuming k is positive. k(776/39) Simplify (b(1/12))(22/9)/((bb*(2/85)b)/bbb6) assuming b is positive. b(-35893/4590) Simplify (u9/(u(-9/4)/u))/(u*(-3/14)/uuu(6/13)) assuming u is positive. u(4369/364) Simplify (s/(ss*(-4/9)s))/s*32s/(s/(s/((ss(s*9/ss)/s)/s)))s(-2/13) assuming s is positive. s(-4763/117) Simplify i2iii/(i(i(i/((i*(-1/17)/ii)/i))/ii)/i)i/i*(1/5)i(4/3) assuming i is positive. i(1039/255) Simplify ((x*3x)/(x*(-14)x))/((x(-12/11)/x)/((x(-1/3)/x)/x)) assuming x is positive. x*(553/33) Simplify (vv*(-4)vv/v(8/3))/(v/(vv7/v))(-33) assuming v is positive. v(-605/3) Simplify (q16q/((q/(q/(qq/(qq(1/15))qq)))/qq))/(qq(1/3)q)(-9) assuming q is positive. q(526/15) Simplify o26/o(9/4)(oo12)/(o/o21) assuming o is positive. o(227/4) Simplify (b/((b/(b7bbb))/b))(-2)(b/(((b/b22)/b)/b))/(b8bb) assuming b is positive. b(-8) Simplify (q(-16)/q19)(-24) assuming q is positive. q840 Simplify (h(2/5)h(-3)h(hh/h*0hh)/h(2/17))(-15/7) assuming h is positive. h(-582/119) Simplify (a(1/13)aaa*(-3/7)a(-2/19)/(a(11/5)/a))17 assuming a is positive. a(50422/8645) Simplify j*(-9)jjj*11jj(j/(j*7j))(-11/5) assuming j is positive. j(107/5) Simplify (p/p1)(-5/6)/((p/p*(-1/11))/pp(-10/3)/p) assuming p is positive. p(140/33) Simplify (p*(-38)p(-11/5))/(p35/(p/(p/p*(-1/35))p)) assuming p is positive. p(-2598/35) Simplify (h/h(1/2))*(19/3)/((h/(hhh5)h)/(hh/(hh(-3/2)))) assuming h is positive. h(32/3) Simplify l/l*(6/5)ll(1/2)((l/(l*(-8)/l)l)/l)/(l/l*(-3/2)l) assuming l is positive. l*(39/5) Simplify ((hh0)(14/9)/(h/(hh/(hh/h(-1/2))))34)(-1/29) assuming h is positive. h(445/261) Simplify (y/(y(-2/7)/y))6(y(-3)/y)/y(-4/7) assuming y is positive. y(72/7) Simplify (a(-7))30/((((aa(-18))/a)/a)/(a(-15)a)) assuming a is positive. a(-205) Simplify ((l/l(7/2)l(-2))36)(-3/17) assuming l is positive. l(486/17) Simplify (x(3/4))(-14)/((x(-2/9)/x)/(x(-9/2)/x)) assuming x is positive. x(-133/9) Simplify k/(k(-4)/kk)k/(k/k*6)k(2/9)/k(-5/4) assuming k is positive. k*(449/36) Simplify (((yy/(y/(y(-1/7)/y)))/y2)/(y/(y*(2/7)/yy)y(-2/25)y))17 assuming y is positive. y(-11237/175) Simplify (((y/y(2/7))(-10))18)(-26) assuming y is positive. y(23400/7) Simplify (c4)*(25/2)(c/(c/c*(-4)c))(-1/4) assuming c is positive. c(205/4) Simplify ((f*(-1/34)/ff)/f)/(f/(f*(-1/28)/f))ff(-8)f*(-6)/ffff assuming f is positive. f(-6695/476) Simplify (a21/a2)/(a(-9/4)/((a/(aaa/a*(-3/7)a))/a)) assuming a is positive. a*(471/28) Simplify ((x/(x/(xx/x(4/7))))/(x/x(-12)))/((x/(x/((x/x(-2/11))/x)))/x(3/5)) assuming x is positive. x(-4294/385) Simplify w9w(11/2)w*(-24)w(-1/17) assuming w is positive. w(-325/34) Simplify (d*(2/83)/((d/(dd**18))/d))/	{ "pile_set_name": "DM Mathematics" }
8:05 PM and 5:24 AM? 559 What is 704 minutes after 2:17 AM? 2:01 PM What is 244 minutes before 1:53 AM? 9:49 PM What is 155 minutes before 4:40 PM? 2:05 PM What is 149 minutes after 9:30 AM? 11:59 AM What is 709 minutes after 6:30 AM? 6:19 PM What is 63 minutes after 1:05 AM? 2:08 AM How many minutes are there between 10:16 PM and 9:41 AM? 685 How many minutes are there between 11:06 AM and 12:08 PM? 62 How many minutes are there between 8:05 PM and 5:50 AM? 585 What is 605 minutes after 8:49 PM? 6:54 AM How many minutes are there between 2:06 PM and 7:38 PM? 332 How many minutes are there between 9:55 PM and 12:10 AM? 135 How many minutes are there between 4:35 AM and 12:47 PM? 492 What is 36 minutes after 7:17 AM? 7:53 AM What is 549 minutes after 2:31 PM? 11:40 PM What is 641 minutes after 4:18 PM? 2:59 AM How many minutes are there between 4:12 AM and 8:15 AM? 243 What is 444 minutes after 6:56 AM? 2:20 PM What is 692 minutes after 6:38 AM? 6:10 PM How many minutes are there between 4:03 AM and 5:19 AM? 76 How many minutes are there between 4:10 PM and 2:57 AM? 647 What is 158 minutes before 5:46 PM? 3:08 PM What is 111 minutes before 4:22 PM? 2:31 PM How many minutes are there between 12:28 AM and 1:19 AM? 51 How many minutes are there between 10:10 PM and 9:53 AM? 703 What is 69 minutes after 8:05 AM? 9:14 AM How many minutes are there between 9:02 AM and 4:38 PM? 456 What is 253 minutes after 2:30 PM? 6:43 PM What is 342 minutes before 7:49 PM? 2:07 PM What is 470 minutes after 12:51 PM? 8:41 PM How many minutes are there between 3:07 PM and 5:54 PM? 167 What is 715 minutes after 11:05 PM? 11:00 AM What is 719 minutes after 5:59 AM? 5:58 PM What is 149 minutes after 7:55 PM? 10:24 PM How many minutes are there between 4:33 AM and 9:10 AM? 277 How many minutes are there between 11:14 AM and 3:10 PM? 236 How many minutes are there between 9:03 AM and 7:42 PM? 639 What is 255 minutes before 6:00 AM? 1:45 AM What is 419 minutes after 11:01 AM? 6:00 PM What is 291 minutes before 10:16 PM? 5:25 PM How many minutes are there between 9:24 PM and 10:04 PM? 40 How many minutes are there between 11:26 PM and 12:06 AM? 40 How many minutes are there between 2:14 PM and 11:21 PM? 547 How many minutes are there between 4:23 PM and 6:30 PM? 127 What is 155 minutes after 9:23 PM? 11:58 PM What is 715 minutes after 3:06 PM? 3:01 AM How many minutes are there between 7:49 AM and 1:26 PM? 337 What is 482 minutes before 6:44 AM? 10:42 PM What is 472 minutes after 9:34 AM? 5:26 PM How many minutes are there between 9:18 AM and 2:45 PM? 327 How many minutes are there between 8:52 PM and 12:55 AM? 243 How many minutes are there between 2:25 AM and 5:18 AM? 173 How many minutes are there between 12:25 PM and 6:02 PM? 337 What is 424 minutes after 5:43 AM? 12:47 PM What is 302 minutes after 5:33 AM? 10:35 AM How many minutes are there between 7:58 AM and 6:44 PM? 646 What is 292 minutes after 9:54 PM? 2:46 AM What is 605 minutes after 6:38 AM? 4:43 PM What is 491 minutes after 11:56 AM? 8:07 PM What is 331 minutes after 11:25 PM? 4:56 AM What is 605 minutes before 9:32 AM? 11:27 PM How many minutes are there between 4:42 PM and 2:29 AM? 587 What is 524 minutes before 6:48 AM? 10:04 PM How many minutes are there between 8:45 AM and 4:04 PM? 439 How many minutes are there between 10:58 PM and 3:12 AM? 254 What is 553 minutes after 7:42 AM? 4:55 PM What is 388 minutes after 2:39 PM? 9:07 PM What is 655 minutes after 9:24 AM? 8:19 PM What is 394 minutes before 3:57 PM? 9:23 AM How many minutes are there between 1:33 AM and 12:38 PM? 665 How many minutes are there between 4:33 AM and 2:32 PM? 599 How many minutes are there between 5:40 PM and 7:08 PM? 88 What is 564 minutes before 3:04 PM? 5:40 AM What is 296 minutes before 8:43 AM? 3:47 AM What is 115 minutes after 3:46 PM? 5:41 PM How many minutes are there between 1:51 AM and 2:44 AM? 53 How many minutes are there between 7:19 PM and 7:58 PM? 39 What is 610 minutes after 11:19 AM? 9:29 PM What is 310 minutes before 1:52 PM? 8:42 AM What is 503 minutes before 6:11 PM? 9:48 AM What is 191 minutes after 9:31 AM? 12:42 PM How many minutes are there between 12:56 AM and 7:50 AM? 414 How many minutes are there between 4:47 PM and 9:11 PM? 264 What is 401 minutes before 11:10 PM? 4:29 PM What is 63 minutes before 4:45 AM? 3:42 AM How many minutes are there between 1:56 AM and 7:17 AM? 321 What is 56 minutes before 11:09 PM? 10:13 PM How many minutes are there between 4:04 AM and 2:35 PM? 631 What is 539 minutes before 10:11 PM? 1:12 PM What is 160 minutes before 5:56 PM? 3:16 PM What is 204 minutes after 1:43 PM? 5:07 PM What is 560 minutes after 8:57 AM? 6:17 PM What is 173 minutes after 11:07 AM? 2:00 PM What is 406 minutes before 2:48 PM? 8:02 AM How many minutes are there between 2:07 PM and 8:45 PM? 398 How many minutes are there between 8:45 AM and 2:02 PM? 317 What is 546 minutes after 1:07 AM? 10:13 AM What is 388 minutes before 1:17 AM? 6:49 PM What is 253 minutes after 7:33 PM? 11:46 PM What is 391 minutes before 4:42 AM? 10:11 PM How many minutes are there between 3:46 AM and 9:06 AM? 320 How many minutes are there between 7:29 PM and 6:49 AM? 680 What is 448 minutes after 10:10 PM? 5:38 AM What is 255 minutes after 11:05 PM? 3:20 AM How many minutes are there between 8:29 PM and 3:11 AM? 402 What is 481 minutes after 9:43 PM? 5:44 AM How many minutes are there between 11:36 PM and 1:31 AM? 115 What is 538 minutes after 7:42 AM? 4:40 PM What is 547 minutes before 4:58 PM? 7:51 AM What is 457 minutes after 10:02 PM? 5:39 AM What is 705 minutes after 3:39 PM? 3:24 AM What is 576 minutes after 6:19 AM? 3:55 PM What is 4 minutes after 10:45 PM? 10:49 PM How many minutes are there between 8:04 AM and 9:07 AM? 63 How many minutes are there between 7:19 PM and 11:29 PM? 250 How many minutes are there between 10:07 PM and 11:10 PM? 63 How many minutes are there between 11:47 PM and 10:31 AM? 644 What is 423 minutes after 3:44 PM? 10:47 PM What is 176 minutes before 4:19 AM? 1:23 AM What is 620 minutes before 6:14 PM? 7:54 AM How many minutes are there between 8:18 PM and 6:41 AM? 623 How many minutes are there between 8:15 AM and 3:40 PM? 445 How many minutes are there between 4:32 AM and 12:15 PM? 463 How many minutes are there between 1:14 AM and 9:01 AM? 467 What is 707 minutes after 7:25 PM? 7:12 AM How many minutes are there between 8:19 AM and 10:27 AM? 128 What is 291 minutes after 1:56 AM? 6:47 AM What is 387 minutes after 6:49 AM? 1:16 PM What is 39 minutes after 8:00 AM? 8:39 AM What is 296 minutes after 12:41 PM? 5:37 PM What is 2 minutes after 5:05 AM? 5:07 AM What is 687 minutes before 6:15 AM? 6:48 PM What is 446 minutes after 12:07 PM? 7:33 PM What is 88 minutes before 7:48 PM? 6:20 PM How many minutes are there between 6:41 PM and 7:17 PM? 36 How many minutes are there between 7:01 PM and 11:59 PM? 298 What is 564 minutes after 3:14 AM? 12:38 PM How many minutes are there between 10:47 AM and 5:46 PM? 419 How many minutes are there between 12:10 PM and 8:02 PM? 472 How many minutes are there between 10:24 PM and 2:35 AM? 251 What is 36 minutes before 10:29 AM? 9:53 AM How many minutes are there between 4:05 PM and 10:05 PM? 360 What is 160 minutes before 8:48 AM? 6:08 AM What is 679 minutes before 11:28 AM? 12:09 AM How many minutes are there between 1:21 AM and 4:52 AM? 211 How many minutes are there between 6:41 AM and 4:24 PM? 583 How many minutes are there between 5:37 AM and 4:23 PM? 646 How many minutes are there between 6:37 PM and 1:46 AM? 429 How many minutes are there between 6:15 AM and 4:14 PM? 599 How many minutes are there between 3:40 AM and 3:12 PM? 692 How many minutes are there between 3:06 PM and 3:20 PM? 14 How many minutes are there between 12:28 PM and 3:32 PM? 184 What is 634 minutes after 9:54 AM? 8:28 PM What is 588 minutes after 3:18 AM? 1:06 PM How many minutes are there between 11:46 AM and 1:03 PM? 77 How many minutes are there between 11:21 PM and 12:59 AM? 98 How many minutes are there between 7:08 PM and 5:25 AM? 617 What is 107 minutes before 5:31 PM? 3:44 PM What is 525 minutes after 5:33 PM? 2:18 AM How many minutes are there between 6:11 AM and 3:24 PM? 553 Wha	{ "pile_set_name": "DM Mathematics" }
nteger? 3 What is the cube root of 186763 to the nearest integer? 57 What is the third root of 5885225 to the nearest integer? 181 What is 3990144 to the power of 1/9, to the nearest integer? 5 What is the third root of 100772 to the nearest integer? 47 What is 699799 to the power of 1/9, to the nearest integer? 4 What is 24585393 to the power of 1/4, to the nearest integer? 70 What is the square root of 637235 to the nearest integer? 798 What is the fifth root of 1235024 to the nearest integer? 17 What is the square root of 6725172 to the nearest integer? 2593 What is 39021 to the power of 1/2, to the nearest integer? 198 What is 5748236 to the power of 1/7, to the nearest integer? 9 What is the cube root of 1581177 to the nearest integer? 117 What is the third root of 1899965 to the nearest integer? 124 What is 6880883 to the power of 1/8, to the nearest integer? 7 What is the square root of 281676 to the nearest integer? 531 What is the square root of 20898397 to the nearest integer? 4571 What is the cube root of 561123 to the nearest integer? 82 What is 1650372 to the power of 1/10, to the nearest integer? 4 What is the eighth root of 23422990 to the nearest integer? 8 What is 14527178 to the power of 1/7, to the nearest integer? 11 What is the third root of 248761 to the nearest integer? 63 What is 6122 to the power of 1/9, to the nearest integer? 3 What is 1971357 to the power of 1/2, to the nearest integer? 1404 What is the square root of 4586009 to the nearest integer? 2141 What is 164941 to the power of 1/10, to the nearest integer? 3 What is the sixth root of 11942955 to the nearest integer? 15 What is 3152857 to the power of 1/2, to the nearest integer? 1776 What is the fourth root of 290747 to the nearest integer? 23 What is 2944735 to the power of 1/9, to the nearest integer? 5 What is the seventh root of 9212390 to the nearest integer? 10 What is 8875660 to the power of 1/4, to the nearest integer? 55 What is the tenth root of 10412015 to the nearest integer? 5 What is 418899 to the power of 1/2, to the nearest integer? 647 What is 3212224 to the power of 1/8, to the nearest integer? 7 What is 217366 to the power of 1/10, to the nearest integer? 3 What is the fifth root of 23731140 to the nearest integer? 30 What is the fourth root of 3681941 to the nearest integer? 44 What is 854642 to the power of 1/2, to the nearest integer? 924 What is 2884156 to the power of 1/3, to the nearest integer? 142 What is 586220 to the power of 1/7, to the nearest integer? 7 What is the third root of 7486723 to the nearest integer? 196 What is the cube root of 61740 to the nearest integer? 40 What is the fifth root of 3676802 to the nearest integer? 21 What is the cube root of 2397155 to the nearest integer? 134 What is 169988 to the power of 1/2, to the nearest integer? 412 What is the cube root of 9554827 to the nearest integer? 212 What is 17769718 to the power of 1/10, to the nearest integer? 5 What is the third root of 180321 to the nearest integer? 56 What is the square root of 1044858 to the nearest integer? 1022 What is the square root of 27981631 to the nearest integer? 5290 What is 1266095 to the power of 1/4, to the nearest integer? 34 What is 7513592 to the power of 1/10, to the nearest integer? 5 What is the sixth root of 19281 to the nearest integer? 5 What is the square root of 2771894 to the nearest integer? 1665 What is 108477 to the power of 1/7, to the nearest integer? 5 What is 300885 to the power of 1/5, to the nearest integer? 12 What is the ninth root of 710452 to the nearest integer? 4 What is 19420799 to the power of 1/8, to the nearest integer? 8 What is the cube root of 276535 to the nearest integer? 65 What is 2129045 to the power of 1/2, to the nearest integer? 1459 What is the square root of 15466 to the nearest integer? 124 What is 50107 to the power of 1/2, to the nearest integer? 224 What is 1654549 to the power of 1/3, to the nearest integer? 118 What is 4797561 to the power of 1/8, to the nearest integer? 7 What is the cube root of 358943 to the nearest integer? 71 What is the square root of 74125 to the nearest integer? 272 What is 3798308 to the power of 1/3, to the nearest integer? 156 What is 52619 to the power of 1/2, to the nearest integer? 229 What is 519680 to the power of 1/2, to the nearest integer? 721 What is 247741 to the power of 1/5, to the nearest integer? 12 What is 3778720 to the power of 1/3, to the nearest integer? 156 What is 1429882 to the power of 1/2, to the nearest integer? 1196 What is 40672 to the power of 1/3, to the nearest integer? 34 What is the ninth root of 1157995 to the nearest integer? 5 What is 3796336 to the power of 1/2, to the nearest integer? 1948 What is 10280625 to the power of 1/5, to the nearest integer? 25 What is 1705432 to the power of 1/5, to the nearest integer? 18 What is the cube root of 7951324 to the nearest integer? 200 What is the fifth root of 477082 to the nearest integer? 14 What is 1425450 to the power of 1/3, to the nearest integer? 113 What is 529997 to the power of 1/8, to the nearest integer? 5 What is the square root of 2161468 to the nearest integer? 1470 What is the third root of 65277 to the nearest integer? 40 What is the fourth root of 15232748 to the nearest integer? 62 What is 416692 to the power of 1/3, to the nearest integer? 75 What is the fourth root of 300534 to the nearest integer? 23 What is the square root of 174342 to the nearest integer? 418 What is the cube root of 2468280 to the nearest integer? 135 What is the cube root of 199569 to the nearest integer? 58 What is the square root of 955959 to the nearest integer? 978 What is the cube root of 371561 to the nearest integer? 72 What is 107191 to the power of 1/2, to the nearest integer? 327 What is 8587257 to the power of 1/2, to the nearest integer? 2930 What is the fifth root of 157005 to the nearest integer? 11 What is 13832 to the power of 1/3, to the nearest integer? 24 What is the tenth root of 86786 to the nearest integer? 3 What is the third root of 5358610 to the nearest integer? 175 What is the tenth root of 160323 to the nearest integer? 3 What is the fourth root of 85166 to the nearest integer? 17 What is 12013583 to the power of 1/2, to the nearest integer? 3466 What is 487076 to the power of 1/3, to the nearest integer? 79 What is the cube root of 141738 to the nearest integer? 52 What is 2380453 to the power of 1/10, to the nearest integer? 4 What is 212859 to the power of 1/5, to the nearest integer? 12 What is 7796719 to the power of 1/2, to the nearest integer? 2792 What is the tenth root of 5556070 to the nearest integer? 5 What is the third root of 129088 to the nearest integer? 51 What is 32092250 to the power of 1/3, to the nearest integer? 318 What is the cube root of 174897 to the nearest integer? 56 What is the eighth root of 3538774 to the nearest integer? 7 What is 3981679 to the power of 1/7, to the nearest integer? 9 What is the cube root of 24276885 to the nearest integer? 290 What is 174790 to the power of 1/8, to the nearest integer? 5 What is 810773 to the power of 1/8, to the nearest integer? 5 What is 4606471 to the power of 1/7, to the nearest integer? 9 What is the square root of 40698 to the nearest integer? 202 What is the square root of 8275711 to the nearest integer? 2877 What is 499762 to the power of 1/7, to the nearest integer? 7 What is the square root of 10320 to the nearest integer? 102 What is the ninth root of 1748355 to the nearest integer? 5 What is 271501 to the power of 1/2, to the nearest integer? 521 What is the eighth root of 388875 to the nearest integer? 5 What is 282366 to the power of 1/2, to the nearest integer? 531 What is 410160 to the power of 1/4, to the nearest integer? 25 What is 32740170 to the power of 1/2, to the nearest integer? 5722 What is 1279627 to the power of 1/6, to the nearest integer? 10 What is 596134 to the power of 1/6, to the nearest integer? 9 What is the third root of 102684 to the nearest integer? 47 What is 2807832 to the power of 1/3, to the nearest integer? 141 What is the cube root of 4196073 to the nearest integer? 161 What is the cube root of 8586728 to the nearest integer? 205 What is 1	{ "pile_set_name": "DM Mathematics" }
2 + 4i. Let r be o(-7). Calculate the greatest common divisor of 36 and r. 4 Let o(u) = -u*3 + 20u*2 + 28u - 48. Let l be o(21). Let q be 2/(-10) + (-92)/(-10). What is the greatest common divisor of l and q? 9 Let g = -10 - -19. Let n(s) = -17s - 8. Let y be n(6). Let j = -47 - y. What is the greatest common divisor of j and g? 9 Suppose 0 = 3t - 5b - 985, b = -0 + 1. What is the greatest common factor of t and 30? 30 Let f = -20 + 24. Calculate the highest common factor of 48 and f. 4 Let a be (-50)/(-4) - ((-135)/(-6))/(-15). Let y = 42 - 14. Calculate the highest common divisor of y and a. 14 Suppose -r + 2l = -30, -5r = 4l - 305 + 113. Calculate the greatest common divisor of 54 and r. 18 Let t be (12 + -1)(-22)/(-2). Suppose -t = -2j + 39. Suppose j = -4f + 320. Calculate the highest common factor of 24 and f. 12 Suppose 0 = 2p + 5 + 3, -5q + 4p + 296 = 0. Let c = 12 - 10. Let u be (6 - -1)/(2/c). Calculate the greatest common factor of q and u. 7 Suppose 0 = 3q + 64 - 10. Let c = -13 - q. What is the greatest common factor of c and 2? 1 Let c(l) = -3l*3. Let i be c(-1). Suppose 0 = ia + 5r - 22, 0a - 4r = -5a + 49. What is the greatest common factor of a and 45? 9 Let y be (-6)/((-1)/2-2). Let c be (y/(-9))/((-2)/(-45)). Calculate the highest common divisor of c and 15. 15 Suppose -5m - 1 = -2r, 7r - 6r = 3m. Calculate the highest common factor of 4 and r. 1 Let n = -97 - -177. What is the highest common divisor of n and 10? 10 Suppose 0 = -2j + 5 + 11. Suppose 0 = -8u + 4u + j. Suppose -304 = -3r + 4n, -83 - 21 = -r + un. What is the highest common divisor of r and 12? 12 Suppose 69 = 182g - 179g. What is the greatest common factor of g and 69? 23 Let q be ((-15)/(-9) + -2)-9. Suppose 11 - 53 = -qr. Suppose 4p = -l + 447, 227 = 3p - p - 3l. What is the greatest common divisor of p and r? 14 Let z(t) = 5t3 + t2 + 2t - 3. Let d be z(2). What is the highest common divisor of d and 30? 15 Let k(l) = 14l - 2. Let i = -17 + 12. Let n = 12 + i. Let t be k(n). Calculate the highest common factor of t and 12. 12 Let g be 4((6 - 3) + 0). Let w = -26 + 62. What is the highest common factor of w and g? 12 Suppose -2x + 100 = 2x. What is the greatest common factor of x and 100? 25 Let o(d) = d2 - 6d - 12. Let l be o(9). Let w = l + -14. Calculate the highest common factor of 8 and w. 1 Let c be 1025/20 + (-2)/4. What is the highest common factor of c and 60? 12 Let a = 44 + -35. What is the highest common factor of 12 and a? 3 Suppose i + 3i - 280 = 0. Suppose 50 = x + 3k, -x - k + 2k + i = 0. Calculate the highest common divisor of x and 13. 13 Let k = -1 - 5. Let a(q) = q*2 - 2q - 3. Let u be a(5). Let r = u + k. Calculate the highest common factor of r and 4. 2 Let f be (-2)/(-8) - (-790)/8. Suppose m + 12 = 5m, 2m = 5l - f. What is the highest common divisor of 63 and l? 21 Suppose 3n - 5c = 60, n + 3c + 16 = 2n. Let b = 8 + -3. Calculate the greatest common factor of b and n. 5 Suppose 2f = -5i + 43, 12 = 3f - 3i - 0i. Let k(p) = 7p3 + p2 + p + 1. Let m be k(-1). Let d = m + f. What is the greatest common divisor of 3 and d? 3 Let y(n) = n3 - 15n*2 + n - 6. Let r be y(15). What is the greatest common divisor of r and 63? 9 Suppose -74 = -2y - 4v, v - 3v + 10 = 0. Calculate the greatest common divisor of 189 and y. 27 Suppose -5y = -2q + 34, -2y = -5q + 107 + 20. Let d(s) = s*2 + 10s - 15. Let r be d(-12). Calculate the greatest common divisor of q and r. 9 Let n(t) = -t - 1. Let b be n(-1). Suppose 2z - 5z - 5a = -21, b = z - a + 1. Suppose -21 - 11 = -zw. Calculate the greatest common factor of w and 80. 16 Let t be 4 + -2 + 2 + 1. Let o be (-9)/(-6)(4 + -2). Let b = o + 2. What is the greatest common divisor of b and t? 5 Suppose 336 = 4k + 3k. What is the highest common factor of 240 and k? 48 Let l(j) = 16j*2 - j - 6. Let r be l(-2). Calculate the highest common divisor of 36 and r. 12 Let y be (-1)/2 + 1324/8. Let u = 167 - 95. Suppose -10 = -4q - r + 51, 0 = -5q + 3r + u. What is the greatest common factor of q and y? 15 Let w = 19 - 8. Suppose 3c = -c - 8696. Let z be (-8)/(-44) - c/22. Calculate the greatest common divisor of w and z. 11 Let p be (-2)/(3/(1101/(-2))). Let k = -246 + p. Suppose 5g = -4z + k, 0g + g + 91 = 4z. What is the greatest common factor of 36 and z? 12 Let l be (63/27)/(2/96). What is the greatest common factor of l and 14? 14 Let g be 10 - (1 + 2/(-2)). What is the greatest common divisor of 2 and g? 2 Let n = -28 + 119. Suppose -5l + 32 + 33 = 0. What is the highest common factor of n and l? 13 Let m(t) = t*2 + 7t + 22. Let r be m(-17). What is the greatest common factor of 12 and r? 12 Let p(m) = -m*3 + 5m*2 - m - 3. Let u be p(5). Let g = u + 11. What is the highest common factor of g and 9? 3 Let n = 299 + -134. Calculate the greatest common divisor of n and 15. 15 Let i = -65 - -103. Suppose 8 = 3x - 10. Suppose -2t + xd = d - 34, -4t + i = 5d. Calculate the highest common divisor of t and 84. 12 Let o(i) = 28i. Let v be o(1). Suppose 0 = m - 5 + v. Let c = -2 - m. Calculate the greatest common factor of 63 and c. 21 Let b = 17 - 0. What is the greatest common divisor of 17 and b? 17 Suppose 11v + 252 = 15v. Calculate the highest common factor of 9 and v. 9 Let b(k) = k3 + 7k*2 + 2k + 2. Let j be b(-6). Let z be 26((0 - -2) + -1). What is the highest common divisor of j and z? 26 Suppose 6w - 2w = 1212. Let p = 439 - w. What is the greatest common divisor of p and 17? 17 Suppose 18a = 14a + 112. Calculate the greatest common factor of 112 and a. 28 Let l = 386 + -270. What is the greatest common divisor of l and 29? 29 Let l(w) = w2 - 3w - 1. Let f(o) = -4o2 + 8o + 4. Let g(z) = -2f(z) - 7l(z). Let b be g(-7). What is the highest common factor of b and 104? 13 Let w be 2 + (1 - 0 - -42). Suppose -3x = 2t - 2x - 14, -4t = 5x - 40. Let f = w - t. What is the highest common divisor of 5 and f? 5 Suppose 4w + 4o - 13 + 1 = 0, 2w - 5o = -1. Let q(d) = 5d*2 + d - 2. Let z be q(w). Calculate the greatest common factor of z and 60. 20 Suppose -2 = y, 4h - 26 = -0h - 3y. Let p(a) = a + 9. Let u be p(-5). Calculate the highest common divisor of h and u. 4 Let y = 8 + -6. Suppose -yx - 153 - 8 = -3w, 0 = 2w + 2x - 124. Calculate the greatest common factor of 19 and w. 19 Suppose 3u - 2p = 168, 0 = -2u + 4p - 3p + 111. Calculate the greatest common divisor of 27 and u. 27 Let y = 18 - 14. Suppose -yo + 5q - 2 = 0, -q - 2q = -6. Suppose 0 = 2g - a - 13, g + 3a - 4a = 9. What is the greatest common divisor of o and g? 2 Suppose 66 = -6t + 7t. What is the highest common divisor of 6 and t? 6 Let w(s) = s. Let g be w(3). Suppose -9 = gt - 27. Suppose -3v + 57 = -t. What is the greatest common divisor of 3 and v? 3 Suppose 3a = -2f - 10 - 1, 4a = -3f - 18. Let o = -7 - f. Suppose 2g - 14 - 7 = -3z, 0 = 2g - oz - 51. Calculate the highest common factor of 2 and g. 2 Let b(x) = -x + 6. Let c be b(0). Let m(y) = y + 9. Let q(p) = -p - 1. Let d(g) = m(g) + 2q(g). Let w be d(-5). Calculate the highest common factor of w and c. 6 Let k = -8 + 17. Calculate the greatest common factor of k and 9. 9 Let d(l) = l*2 + 70. Suppose -3h - 10 = -5a, -3h - a - 4a + 10 = 0. Let u be d(h). Let g = 20 - 10. Calculate the greatest common factor of g and u. 10 Suppose h - 2h = 2y - 2, y - 4h - 10 = 0. Suppose -7a + s = -ya - 88, 0 = 2a - 2s - 32. What is the highest common factor of 9 and a? 9 Suppose 3n - 1 = 4w, 2n - 4 = 2. Suppose 5u - 4 = -wd + 2, 3d - 3u = 9. What is the greatest common factor of d and 3? 3 Suppose -3i = 4v - 64, -3i + 7i - 52 = 3v. Calculate the greatest common factor of 16 and i. 16 Let d = 11 + -7. Suppose -2y - 3p + 7 = -y, -73 = -3y + dp. What is the greatest common divisor of 19 and y? 19 Suppose -1 = -c + 2q - 0, 12 = 4q. What is the greatest common factor of 49 and c? 7 Suppose 5n - 43 = 27. Suppose -3o = -0y - y - 16, 0 = -3o - y + n. Suppose 3*m + m - 40 = 0. What is the greatest common factor of m and o? 5 Let q = 21 + -16. Let a = 4 + q. Calculate the highest common factor of a and 36. 9 Le	{ "pile_set_name": "DM Mathematics" }
e power of 1/3, to the nearest integer? 59 What is the eighth root of 167129 to the nearest integer? 4 What is 2830144 to the power of 1/2, to the nearest integer? 1682 What is the cube root of 570211 to the nearest integer? 83 What is the third root of 122350 to the nearest integer? 50 What is the cube root of 960034 to the nearest integer? 99 What is 18122953 to the power of 1/4, to the nearest integer? 65 What is the fourth root of 21972885 to the nearest integer? 68 What is 2074726 to the power of 1/2, to the nearest integer? 1440 What is 871412 to the power of 1/3, to the nearest integer? 96 What is the third root of 19083863 to the nearest integer? 267 What is 113309 to the power of 1/6, to the nearest integer? 7 What is 3027870 to the power of 1/2, to the nearest integer? 1740 What is 12826523 to the power of 1/2, to the nearest integer? 3581 What is the fifth root of 174408 to the nearest integer? 11 What is 3481915 to the power of 1/4, to the nearest integer? 43 What is 88966 to the power of 1/10, to the nearest integer? 3 What is 10496957 to the power of 1/3, to the nearest integer? 219 What is the seventh root of 7842682 to the nearest integer? 10 What is 391945 to the power of 1/2, to the nearest integer? 626 What is 95179 to the power of 1/4, to the nearest integer? 18 What is the cube root of 3610269 to the nearest integer? 153 What is the third root of 95121 to the nearest integer? 46 What is 270129 to the power of 1/3, to the nearest integer? 65 What is 13127100 to the power of 1/5, to the nearest integer? 27 What is the fourth root of 4222928 to the nearest integer? 45 What is 26862428 to the power of 1/3, to the nearest integer? 299 What is 1790491 to the power of 1/9, to the nearest integer? 5 What is the third root of 17001441 to the nearest integer? 257 What is the ninth root of 354642 to the nearest integer? 4 What is the fifth root of 22388051 to the nearest integer? 30 What is the tenth root of 4576743 to the nearest integer? 5 What is the third root of 847858 to the nearest integer? 95 What is 18875833 to the power of 1/5, to the nearest integer? 29 What is the third root of 745638 to the nearest integer? 91 What is the square root of 332096 to the nearest integer? 576 What is the tenth root of 5581894 to the nearest integer? 5 What is the third root of 7139704 to the nearest integer? 193 What is the third root of 871661 to the nearest integer? 96 What is the third root of 3417628 to the nearest integer? 151 What is the cube root of 11068492 to the nearest integer? 223 What is the square root of 3274046 to the nearest integer? 1809 What is the third root of 21364015 to the nearest integer? 277 What is the eighth root of 32341718 to the nearest integer? 9 What is the third root of 587805 to the nearest integer? 84 What is 195346 to the power of 1/10, to the nearest integer? 3 What is the cube root of 1414673 to the nearest integer? 112 What is 781503 to the power of 1/9, to the nearest integer? 5 What is the cube root of 7196167 to the nearest integer? 193 What is 789691 to the power of 1/3, to the nearest integer? 92 What is 860338 to the power of 1/3, to the nearest integer? 95 What is 36122367 to the power of 1/9, to the nearest integer? 7 What is the cube root of 20927602 to the nearest integer? 276 What is 189813 to the power of 1/2, to the nearest integer? 436 What is 2807030 to the power of 1/2, to the nearest integer? 1675 What is 337731 to the power of 1/3, to the nearest integer? 70 What is the third root of 4325363 to the nearest integer? 163 What is 2528161 to the power of 1/8, to the nearest integer? 6 What is the square root of 72595 to the nearest integer? 269 What is 17286581 to the power of 1/3, to the nearest integer? 259 What is 12986065 to the power of 1/9, to the nearest integer? 6 What is the third root of 1522806 to the nearest integer? 115 What is the tenth root of 577 to the nearest integer? 2 What is 2651 to the power of 1/3, to the nearest integer? 14 What is the cube root of 887823 to the nearest integer? 96 What is 1003577 to the power of 1/9, to the nearest integer? 5 What is 16909512 to the power of 1/9, to the nearest integer? 6 What is 578959 to the power of 1/6, to the nearest integer? 9 What is 1906093 to the power of 1/2, to the nearest integer? 1381 What is the cube root of 6791250 to the nearest integer? 189 What is the square root of 442934 to the nearest integer? 666 What is the sixth root of 219205 to the nearest integer? 8 What is the cube root of 871727 to the nearest integer? 96 What is the third root of 217367 to the nearest integer? 60 What is the third root of 1477465 to the nearest integer? 114 What is the tenth root of 590863 to the nearest integer? 4 What is the square root of 5295365 to the nearest integer? 2301 What is the third root of 1490394 to the nearest integer? 114 What is 21303519 to the power of 1/2, to the nearest integer? 4616 What is the third root of 2312467 to the nearest integer? 132 What is 6620484 to the power of 1/2, to the nearest integer? 2573 What is the fifth root of 17484606 to the nearest integer? 28 What is the square root of 538886 to the nearest integer? 734 What is the square root of 15404165 to the nearest integer? 3925 What is 179622 to the power of 1/9, to the nearest integer? 4 What is 3514552 to the power of 1/5, to the nearest integer? 20 What is 107997 to the power of 1/2, to the nearest integer? 329 What is the third root of 683578 to the nearest integer? 88 What is the third root of 23143310 to the nearest integer? 285 What is the square root of 338322 to the nearest integer? 582 What is the cube root of 1878908 to the nearest integer? 123 What is the third root of 6638854 to the nearest integer? 188 What is the seventh root of 912224 to the nearest integer? 7 What is the sixth root of 2745797 to the nearest integer? 12 What is the cube root of 3220759 to the nearest integer? 148 What is the fifth root of 26725953 to the nearest integer? 31 What is the square root of 1060781 to the nearest integer? 1030 What is 2600695 to the power of 1/7, to the nearest integer? 8 What is the fifth root of 1392110 to the nearest integer? 17 What is the tenth root of 1298725 to the nearest integer? 4 What is 519136 to the power of 1/2, to the nearest integer? 721 What is the sixth root of 6842482 to the nearest integer? 14 What is the square root of 1325878 to the nearest integer? 1151 What is 471619 to the power of 1/7, to the nearest integer? 6 What is 4135622 to the power of 1/2, to the nearest integer? 2034 What is the fourth root of 3429873 to the nearest integer? 43 What is 584213 to the power of 1/2, to the nearest integer? 764 What is 1979975 to the power of 1/7, to the nearest integer? 8 What is 1513681 to the power of 1/5, to the nearest integer? 17 What is the ninth root of 37720 to the nearest integer? 3 What is 1355417 to the power of 1/6, to the nearest integer? 11 What is the third root of 636903 to the nearest integer? 86 What is the fifth root of 6202301 to the nearest integer? 23 What is the cube root of 3988621 to the nearest integer? 159 What is the seventh root of 205779 to the nearest integer? 6 What is the third root of 401735 to the nearest integer? 74 What is 519756 to the power of 1/3, to the nearest integer? 80 What is the seventh root of 19177422 to the nearest integer? 11 What is the square root of 18724 to the nearest integer? 137 What is 2233126 to the power of 1/8, to the nearest integer? 6 What is the fourth root of 165406 to the nearest integer? 20 What is 1249487 to the power of 1/7, to the nearest integer? 7 What is 376875 to the power of 1/10, to the nearest integer? 4 What is 4258553 to the power of 1/9, to the nearest integer? 5 What is 5523518 to the power of 1/2, to the nearest integer? 2350 What is 298042 to the power of 1/3, to the nearest integer? 67 What is 32383481 to the power of 1/10, to the nearest integer? 6 What is the cube root of 5178137 to the nearest integer? 173 What is 1688117 to the power of 1/7, to the nearest integer? 8 What is 23769 to the power of 1/2, to the nearest integer? 154 What is 2014388 to the power of 1/2, to the nearest integer? 1419 What is the fourth root of 2025597 to t	{ "pile_set_name": "DM Mathematics" }
/3)z)z*(1/6)/z(z/(z(z(-1/3)z)/z))/z(z(-4/5)/z(1/6))/(((zzzz*4z)/z)/zz(2/13)/z) assuming z is positive. z(-1037/65) Simplify ((fff(-1/2)f)/((f/(ff5/f))/f)(f1/f)6)/((f/(f/(f/(ff/f(2/7))ff)))(-15))(-9/11) assuming f is positive. f(-1275/154) Simplify (((bbb(4/15)bbbb)/bb(-1/21)/b)(-1/23))(-2/77) assuming b is positive. b(886/185955) Simplify (j*(-1)j(1/7))(1/3)((j(-1))(-6/5))(10/3) assuming j is positive. j(26/7) Simplify ((c(-2/3))13/((c/(c/c(-2/5))c)/(cc(-4))))/((c(-1/3)/c)5(cccc(2/7))38) assuming c is positive. c(-4566/35) Simplify (w(-2)/(w(2/9)w))*(-30/7)((w(-2/9))(-1/28))(-47) assuming w is positive. w(1693/126) Simplify ((o(-1)/o)/(o(2/11)/oo)(o*(-1/4)oo)(-48))(-46) assuming o is positive. o(43608/11) Simplify (w(-29)w*(-18)(w*(2/21)w)/(w/(w/(ww(-17)/w))))40 assuming w is positive. w(-24280/21) Simplify ((x(-6)x/(x/x(-2/5)))/(x(-6)/x(-2/5)))/((x/x2)/((x/x(-3))/x))10 assuming x is positive. x(196/5) Simplify (y(-12)/y*(1/5)yy(3/20)yyy(-5)/y)(-17) assuming y is positive. y*(5117/20) Simplify (((ll/(ll(3/2))l)/lll*(-12)l)/(l(1/11)/l)(2/5))(-41) assuming l is positive. l(9143/22) Simplify ((q/(qq(-4)/q))/(q(((q*(-32)/q)/q)/q)/qq))/(((qqqq4)/q)/q(-9)) assuming q is positive. q24 Simplify ((((ii*14)/i(iii*(-1/14))/ii)6)(-22/7))(2/63) assuming i is positive. i(-9812/1029) Simplify q1/q(1/4)qq*(2/7)qqq*(-3)qq((q/q*6)/(q/(qq(qq*6)/qqq)))(-38/7) assuming q is positive. q(-523/28) Simplify j(-33)/(jj*34)(jjj*(-6/7)/jj)(-5) assuming j is positive. j(-516/7) Simplify ((m/((m*(8/9)/mm)/m))/mm)17/((mm*(2/5)m)/m(-3/13)) assuming m is positive. m(9511/585) Simplify (kk0)(-1/19)/((k(-4)k)/k*(2/9))(kk(-2)(kk(-3)k)/k)(-3) assuming k is positive. k(2081/171) Simplify (((t*1/(t/((tt*(-3/10))/t)t))/(t/t(-3))(-16/3))(15/2))(-9/10) assuming t is positive. t(-5409/40) Simplify (((r(-4/3)r)/(r/(r(-1)r)))/(r1)8)/(r*(-9/4)(r/((r/r*(-2)r)/rr))/r)31 assuming r is positive. r(2213/12) Simplify (((u/u(-1))/u(1/6))/(uu(-1))(-11/3))/((u*(-1)uu/(uu(-2)/u))/(u(2/9)/uu(-1/3))) assuming u is positive. u(-41/18) Simplify (m5/m)/mm*(5/4)/m(m/(m*(1/9)m))/(mm(4/9)/m)(m(-2)/m10)17 assuming m is positive. m(-7247/36) Simplify ((j/(j/((j(3/5)/j)/j)))3)*9(j/(j/(j/(j/(j/((jjj*(-4)/j)/j)j))jjj))j/(j/j*(-5)jj))(1/2) assuming j is positive. j(-184/5) Simplify ((j(-11/6))(-3)(j/((j*2/j)/j)j)/(j*(-3/11)j))(-10/11) assuming j is positive. j(-745/121) Simplify ((k(-3)/(k(-1/4)k))/(kk*(-3)k/((k*(-2/15)/k)/kk)))/((k*(1/4)k)*42(((k(k/k(-1))/k)/k)/kk)20) assuming k is positive. k(-4583/60) Simplify (t*(-6)/(tt/(t/(t/((tt(2/15))/t)))t))/(tt2/ttt/(t/(t/t(2/7)t)))t(-2/11)/t(2/7)t*(-2/3)t(-3/8) assuming t is positive. t(-19919/1320) Simplify ((p*(2/7)p)(-43))(16/5)((((pp(-1/4))/p)/p)/p(-2/19))(-21) assuming p is positive. p(-406647/2660) Simplify ((n(-1))(-9/8)/((n/n*(3/4))/nnn/((nnn(-4)/n)/n)))/(n/n(-2/21)n*(-2)n)(-3/22) assuming n is positive. n(-2533/616) Simplify (((i2/i)/(i(3/7)/i))/(i/(i/((i*(-4/3)/i)/i))i(-2/11)))/((i(-3)/iii/i(-1/7))/(i1/(i/(i/(iii7/i))))) assuming i is positive. i(-13/231) Simplify (a/(a(2/43)/a))(-49)((a/a(-1))/a)/(a/a37a) assuming a is positive. a*(-2568/43) Simplify ((q/(((qq*(-4/3)qq)/q)/qqq))(-49)((q/((q/(q/q*(-1)q))/q))/q)(2/41))(-24) assuming q is positive. q(-32288/41) Simplify ((z(1/3)zzz(1/18)/z(z*(2/5)z)(2/111))(2/15))(-3/4) assuming z is positive. z(-4709/33300) Simplify (v/v*3)/((vvv(-6)vv)/vv)vvvv*(2/9)vvv*(-4)(v*1v)/(v*(1/5)v)(v/(vvv5)v)/(((vv2)/v)/v) assuming v is positive. v(-179/45) Simplify (t(t/(tt(-2)/tt))/ttt/(tt(5/2)ttt)t)3(t(2/9)/((t/t(-2/17))/tt))(-23) assuming t is positive. t(4925/306) Simplify (((c(-43)c)/c)/c(8/9))/(c8/(c/(cc(c*45c)/cc))) assuming c is positive. c(-890/9) Simplify (w5ww)/(w/w(-2/5))w/(w/w*0)(w/((w/(w/w*(4/7)))/w))/w((w(1/5))(-10))(-35) assuming w is positive. w(2661/35) Simplify ((t*(-3/8)tt/(t/(t(3/8)/ttt)))/(t(-2/3))1)/((t1)16/(t(1/11)/tt(2/5))) assuming t is positive. t(-2284/165) Simplify (j/(j/j*(2/95))j)*(-1/9)(j/(j/(((j/j(-1/8))/j)/j)))(-4/21) assuming j is positive. j*(91/1710) Simplify (((cc1)/(c(1/2)/c))/(cc/(c1/c)c)(2/9))/((c/(c/c(-2)))19)(2/133) assuming c is positive. c(101/42) Simplify (w(4/3)w/(w/(w0/w)w)w)(-7)(w(-2)/(w(1/2)w))/(((ww(-2/15))/w)/(w(-1/4)w)) assuming w is positive. w(-99/20) Simplify (((((g/(gg*(-2/3)g)g)/g)/g)/(ggg22))/((g/(g/g(-28)g)gg)/(gggg(40/9))))(-26) assuming g is positive. g(-2132/9) Simplify ((z(4/7)z)/zzz/(z/(z*15zz)z)(z(-2/19)z)(2/127))(-1/24) assuming z is positive. z(-297037/405384) Simplify g(-7)g(-2/3)((g(g/(g0/g)g)/g)/g)*(-9)g*(-2)g/(g/(g*(-5/4)ggg))gg/g*(1/2)g5/g assuming g is positive. g(-245/12) Simplify ((t(-1/4)/t)(6/5))*6((t/t(-1/3))/t(-6))(3/20) assuming t is positive. t(-79/10) Simplify (v1)(1/4)/(v*(-2)vv(-2/7)v)(v0)49(vv6/v)/((vvv(v*(-7)/vvv)/v)/v) assuming v is positive. v(323/28) Simplify k4k*6((k/(kk(-4))kk)/kk)/(kkk*4)((k(1/3))(-1/88))(4/5) assuming k is positive. k(3299/330) Simplify (((f(-1/12)/f)/((f/((f(-13)f)/f))/f))/((f/f8)/(ff(-10/7))))(-8) assuming f is positive. f(1262/21) Simplify j14/jj/(((j(19/3)jj)/j)/j)(jj(-32))/j(-43) assuming j is positive. j(59/3) Simplify (((h/h(-31))/h)/hhhhh14)/(h21/h(1/64)) assuming h is positive. h(1665/64) Simplify ((f/((ff*5)/ff)f12/f)/(f/f(-2/9)f(2/17)))4 assuming f is positive. f*(2852/153) Simplify (bb/b*(-3/4)b*(-20)b(-17)/b(-25))(-4/11) assuming b is positive. b(37/11) Simplify (z*(-38)z*(-1/2)(zz3)/z(2/5))(-41) assuming z is positive. z(14309/10) Simplify ((o(-1/2)/(o(4/17)/oo))/((oooo/o(2/13)oo)/((o(o*(-4/7)/o)/o)/oo)))7 assuming o is positive. o(-25225/442) Simplify (ss9s)/(s*3ss)(s6/s)/(s(5/7)/s)((s/s5s)(-24))(-1/56) assuming s is positive. s*10 Simplify ((uu(uuu(-2/3)uuu)/u)18/(u(1/4)/((u*2u)/u)))/((u/(u(u/(uu*(-1/2)u))/u))*(-32)/(uu/u(-1/3))(-1/4)) assuming u is positive. u*(871/6) Simplify ((qq(2/3))24/((q/q2)/(q/q(-6))))/(((qqq(-1))/(q(-3)/q))/(((q/(q/q(1/2)))/q)/q(-2/13))) assuming q is positive. q(1109/26) Simplify ((g(-5/7)/g)/((g*29gg)/g))/(((g/(g/(g(-43)gg)))/g)/ggg40) assuming g is positive. g(-208/7) Simplify (y(-1/4))(2/39)((y*(-1/6)y)/y)/y*(-2/3)(yy3(y*4/yy)/yy)/((y/y(-2/17))/y0) assuming y is positive. y(4886/663) Simplify (((y(-2/9)/y)/(yyy(-9/4))(yyy(1/2))/y(-3))36)26 assuming y is positive. y*4238 Simplify (((zz*(-5/4)z)/(z/((z/(((z*1z)/z)/zz))/z)z))/(zz0z/(z*(3/11)zzz)))(3/11) assuming z is positive. z(-129/484) Simplify ((rr5r)/r*(-10/7)(rr(2/29))/(r(3/5)rrrr))(-33) assuming r is positive. r(-164043/1015) Simplify ((x(-3/5))(-34)x/(xxx*(-17)x)x3/x)23 assuming x is positive. x(4301/5) Simplify ((xx/(x17/x))/(x/(x/x(-1/2)))x23xxxx/(x/x12)xxxx)(2/155) assuming x is positive. x(57/155) Simplify ((f0/(f/f(5/6)))/(f/f5)(2/3))(-2/41) assuming f is positive. f(-5/41) Simplify ((l/(l6l))/(ll/l0l))/(l0/l)37((ll/l(-5))/l(1/4))(-15/2) assuming l is positive. l(-181/8) Simplify ((((b(b/b(4/7))/bb)/(bb/(bb/(bb(-6/5)))))/((b/(b/(b/b10)))/(b(5/7)/b)))(3/16))(2/39) assuming b is positive. b(181/1820) Simplify (j(-3/7)j)/j*(-1/5)((j/j5)/j)/j(-1/5)(j1/(j/(j/j(1/2))))/(j(-3)j(-1/4)) assuming j is positive. j(-39/1	{ "pile_set_name": "DM Mathematics" }
y ((pp(-2/7))/pp)*5((pp(1/3))/p)40 assuming p is positive. p(355/21) Simplify (t(-3)/t)/ttt(-2)t*(1/3)ttt(-4) assuming t is positive. t(-23/3) Simplify (n(n(n(n/n6)/n)/n)/n)(-1/3) assuming n is positive. n(5/3) Simplify (((hh*(-2/15))/h)/h)/hh(-2/7) assuming h is positive. h(-254/105) Simplify (y(-4)/(y(-2/9)y))16 assuming y is positive. y(-688/9) Simplify h/h(-14)(h/(h(-1)/h))/h assuming h is positive. h17 Simplify (q*(-2)/q(((q/(q(-3)/q))/q)/q)/q)(7/10) assuming q is positive. q*(-7/10) Simplify ((m/(mm/(mmm/m(-1/5))))/(m(2/5)/m))(-8/17) assuming m is positive. m(-112/85) Simplify p*(-2)p*(-1)/pppp*(-5)pp/p3 assuming p is positive. p(-8) Simplify ((o/(oo*1o))/(o/(o6/o)))(-16) assuming o is positive. o(-32) Simplify d1d(-23) assuming d is positive. d(-22) Simplify ((m(-2/5)mm)(-49))(47/5) assuming m is positive. m(-18424/25) Simplify (l/l5)/l1 assuming l is positive. l(-5) Simplify s(-4/5)s/((s/(ss(3/10)))/s)(s(-2))(-32) assuming s is positive. s(131/2) Simplify (p/p(1/8))/(((p/(pp12/p))/p)/p) assuming p is positive. p(111/8) Simplify (i(-3)i/(i*(-1/5)i))/(i*(-4/3)/(ii2)) assuming i is positive. i(23/15) Simplify ((j*(1/11)j)/j)38 assuming j is positive. j(38/11) Simplify (i/((i*(-2/13)i)/i))(-7) assuming i is positive. i(-105/13) Simplify (t/(t/(t/(ttt/(((t*(-1)/t)/t)/tt))))t)/((t(1/24)t)/t) assuming t is positive. t(-97/24) Simplify j(2/15)j(-1/2)j*(-4)j(1/6) assuming j is positive. j(-21/5) Simplify (uuu(1/3))(-4)u(1/3)u(-1)/u assuming u is positive. u(-11) Simplify w/(www*11w)w/w(-1/7) assuming w is positive. w(-83/7) Simplify (b/(b/b(-4/5))bb(-1))/(b4/(bb(-1/7))) assuming b is positive. b(-138/35) Simplify (o*(-9/5)o(-1/5))(-2/15) assuming o is positive. o(4/15) Simplify w/w(-38)wwww(-13) assuming w is positive. w29 Simplify h*(2/9)/hh*(-6)hhh(h1)(3/8) assuming h is positive. h(-245/72) Simplify ((w/(w/w(-4)))/((w2ww)/ww))(-8/13) assuming w is positive. w(64/13) Simplify (xx(-2)/x)/x1 assuming x is positive. x(-3) Simplify (y(yy(3/2))/y)(9/2) assuming y is positive. y(45/4) Simplify s/(s(-10/9)s)sss/((s/s1)/s) assuming s is positive. s(46/9) Simplify pppp*0pp10 assuming p is positive. p14 Simplify q(1/13)/q(q(11/3)/q)/q assuming q is positive. q(29/39) Simplify q*8(qqq(-4)/q)/q assuming q is positive. q4 Simplify y/(yy/y6)yy7y*(6/11)y/(y/(y*(-1)y)) assuming y is positive. y(149/11) Simplify u(-3)uu*(1/7)/uu(u1)(-4/13) assuming u is positive. u(-197/91) Simplify (r(r*(25/2)r)/r)/(r/r(-7/3)) assuming r is positive. r(61/6) Simplify (vv(-3)v(2/19))1 assuming v is positive. v(-36/19) Simplify (u/u(-6/7))/(uu(1/15)) assuming u is positive. u(83/105) Simplify (w11/w)/((w/(w/(w/w(4/5))))/w) assuming w is positive. w(54/5) Simplify (s(1/9)/s)/ss(1/5) assuming s is positive. s(-76/45) Simplify (a*(-3)a)*(2/9)(a/a*7)/(aaa(-5)) assuming a is positive. a(-31/9) Simplify ((x(1/5)/x)/x)(1/62)(xx2)(1/31) assuming x is positive. x(21/310) Simplify (b4/(bbb(-2/7)b))(-1/5) assuming b is positive. b(-9/35) Simplify (l(-13)/l)/(l17/l) assuming l is positive. l(-30) Simplify (o/o1)*(-29)/((oo*5o)/(o/(o*(3/7)o))) assuming o is positive. o(-52/7) Simplify v(2/11)/(vv(v*6/v)/vvv)(v(-1)/v)35 assuming v is positive. v*(-856/11) Simplify (fff(-11/2))/fff27 assuming f is positive. f(47/2) Simplify (q/(qq(-1)))(-6/17)(q(-2/7)/q)(-2/45) assuming q is positive. q(-176/595) Simplify ((s/(ss/((s/(s(-3/7)/s))/s)))/(s/s(1/8)s))/(ss/s*5(s/s2)/s) assuming s is positive. s(199/56) Simplify (f/(ff/(f(ff/(ffff/f*16ff))/f))f15)(9/4) assuming f is positive. f(117/2) Simplify ((u2u)/u(-1))/(u/(u1/u)uuu(u(1/5)/uu)/uu) assuming u is positive. u(-1/5) Simplify t(5/3)/(t/(t(-1)tt)t)(t/t(-1))(-3/10) assuming t is positive. t(1/15) Simplify (i(-11/2)/ii8/i)(-2) assuming i is positive. 1/i Simplify (b/(bb/b(-1/12)b)(b(2/19)b)/b)(-40) assuming b is positive. b(4510/57) Simplify b*(-4)bbb*(-1)b*(-5)(b(-1/3)/b)/b assuming b is positive. b(-31/3) Simplify (r*(-7/3)r7)(-8/7) assuming r is positive. r*(-16/3) Simplify ((ooo/(oooo8))/o(5/4))20 assuming o is positive. o(-185) Simplify f/f*(-31)f/f7 assuming f is positive. f26 Simplify (l*(3/2)ll/(lll(1/9)))/((l(5/2)/l)/l(2/7)) assuming l is positive. l(11/63) Simplify v(7/4)vv/(v(-7/8)vvv) assuming v is positive. v(13/8) Simplify ((a4a)/(aa*(5/3)a))44 assuming a is positive. a(176/3) Simplify z/(z/z*2z)z7/z assuming z is positive. z7 Simplify (v(-1)v)(-1/22)/((v(-6/5)/v)/v(5/7)) assuming v is positive. v(102/35) Simplify b4/(b/b(1/6)b)(b(-1/4))9 assuming b is positive. b(-1/12) Simplify ((m(-1)m)(-50))4 assuming m is positive. 1 Simplify (w(-3)/w2)/(w4w2) assuming w is positive. w(-11) Simplify ((rr/(r/((((rr*1)/rr)/r)/r)))/r)(-2/75) assuming r is positive. 1 Simplify (n(2/3))*(-21)(n*(1/3)n)(-1/16) assuming n is positive. n(-169/12) Simplify (s/(ss(-17)ss))/(s/s(2/23)) assuming s is positive. s(324/23) Simplify ((o/(o(-1)oo))/o)(-20)/(((o(-3/7)/o)/o)/o(oo(((oooo8/o)/o)/o)/ooo)/o) assuming o is positive. o(94/7) Simplify (g/g(-1/14))(-4/15) assuming g is positive. g(-2/7) Simplify p(1/4)pp(-2/7)(p(2/7))36 assuming p is positive. p(45/4) Simplify (v(1/2)(v/(v/v(-8)v))/v)/((v/((v*(-6)/vvv)/v))/(v/(v/(v5v)))) assuming v is positive. v(-21/2) Simplify (a(-10)a)/a(2/51) assuming a is positive. a(-461/51) Simplify ((yy(-3))42)23 assuming y is positive. y(-1932) Simplify (n/(nn(-2/3)))(-19/3)/(n1)(1/70) assuming n is positive. n(-2669/630) Simplify (l(-3)l(2/11))/(l(1/2)l(-3/4)/l) assuming l is positive. l(-69/44) Simplify p22/p(-1/18) assuming p is positive. p(397/18) Simplify ((yy1/y)(1/2))(-3/20) assuming y is positive. y(-3/40) Simplify u(-2)/u1(u4uu)/(u(-2/5)u) assuming u is positive. u(12/5) Simplify ((y(-1)/y)/y(1/5))(-2/181) assuming y is positive. y(22/905) Simplify (h(-3/4)(h7/h)/h)/(h(-6)/(h0/h)) assuming h is positive. h(37/4) Simplify l(-4)/((lll6l)/l)(l(-1))(-44) assuming l is positive. l32 Simplify ((((yy*(-2))/y)/y)/yy(yy*(2/15))/y)/(((yy*(-2/5)y)/y)/y(-4)) assuming y is positive. y(-112/15) Simplify (yyyyy/(y/y(1/8)))(-10/7) assuming y is positive. y*(-165/28) Simplify (vvv/(v(-4/3)/v)vv2)44 assuming v is positive. v(1100/3) Simplify (c6/c(6/7))48 assuming c is positive. c(1728/7) Simplify ((jjjjj0j)(-1/6))(-2/61) assuming j is positive. j(5/183) Simplify (r7r(2/5))50 assuming r is positive. r370 Simplify (m/(m(m*(2/45)m)/m)m)/m(-1/5) assuming m is positive. m(52/45) Simplify (v/(vv*(-3)vvv))(-24) assuming v is positive. 1 Simplify (b(-1/26)b)/(b/(bb/(bb/b(7/6)b))b) assuming b is positive. b(-34/39) Simplify (t(-2/5)/tt)(-29)/(t/(t(-2/7)/t)t)(-10/3) assuming t is positive. t(2368/105) Simplify ((n/n(-2))4)(-3/7) assuming n is positive. n(-36/7) Simplify ((x(2/5))(-9))30 assuming x is positive. x(-108) Simplify (jj(1/6))35 assuming j is positive. j(245/6) Simplify (w(-1/3))41/(w0)(-9) assuming w is positive. w(-41/3) Simplify k*0/kkk29 assuming k is positive. k29 Simplify (c(1/4)cc(-3/7))/(c(-2)/c(1/3)) assuming c is positive. c(265/84) Simplify ((qq*(-3/2))/((q/((q/(qqq/q(2/17)q))/qq))/q))/(q(-6)/(q(1/3)/q)) assuming q is positive. q(199/102) Simplify (c/((((c/(cc/(c(-5)/c)))/c)/c)/c))/(c/(c/c(-1/5))c)(cc/c(-3/5))(-1/40) assuming c is positive. c(2027/200) Simplify ((o/(o/o2o))/o)*19/((ooo(-2/13)o)/o**(-4)) assuming	{ "pile_set_name": "DM Mathematics" }
13). What is v rounded to the nearest 10000? -60000 Suppose -86 - 114 = -3f + 2h, 2f - 5h - 115 = 0. Round f to the nearest one hundred. 100 Let b = -177.00109 - -177. Round b to four dps. -0.0011 Suppose -5z + 0z = 2w - 7849992, 5w = -2z + 3139980. Round z to the nearest 100000. 1600000 Suppose -3o + 12 = 0, -2q + 0o + 3o + 78 = 0. Suppose -3i + 285 + q = -3u, 5i = 25. What is u rounded to the nearest 10? -110 Suppose 0 = -4h - 2v + 45279998, -3h + 56599996 = 2h + 4v. What is h rounded to the nearest one million? 11000000 Suppose -s = 2a - 7, -s = -3a - 2s + 11. Suppose ap = -9976 - 230024. Round p to the nearest 100000. -100000 Let o(u) be the second derivative of 57929u*4/12 - 5u*3/6 - 3u*2 - 2u. Let a be o(-4). Let z = 4626878 - a. What is z rounded to the nearest 1000000? 4000000 Let t = 2.381 - -69.139. Let a = 70 - t. What is a rounded to 1 decimal place? -1.5 Let s = -18368 + 18360.9992. Let y = s - -7. What is y rounded to 3 dps? -0.001 Let j = 44 - 44.00000302. What is j rounded to seven dps? -0.000003 Let k = 2.7104 - 2.7. What is k rounded to three dps? 0.01 Let u = -66.98 - -67. What is u rounded to 2 decimal places? 0.02 Let g = 5 + -5.000083. What is g rounded to 5 decimal places? -0.00008 Let i = -5 - 0. Let c = 3 + i. Let j = c - -2.04. What is j rounded to 2 decimal places? 0.04 Let i = 5.613 + -0.013. Let l = -39.6 + i. Let r = l + 33.99882. What is r rounded to 4 dps? -0.0012 Let w(j) = 1500000j2 - j - 1. Let i be (-1)/(2/(2/1)). Let u be w(i). Round u to the nearest one million. 2000000 Let l = 770798.60017 + -770795. Let u = -3.14 - 0.46. Let s = u + l. What is s rounded to four decimal places? 0.0002 Let u = 0.8 - 0.2. Let t = -0.8 + u. Let i = 0.19999928 + t. Round i to seven dps. -0.0000007 Let x = -80504231.30000022 + 80504229. Let v = 4.3 + -2. Let c = v + x. What is c rounded to 7 dps? -0.0000002 Let v = 0.3 + -0.300052. Let j = 0 - v. What is j rounded to 5 dps? 0.00005 Let s = -432.357 + 29.57. Let a = s + 403. What is a rounded to two decimal places? 0.21 Let z = -7.475 - 21.566. Let t = -29 - z. What is t rounded to 2 dps? 0.04 Suppose 0d = -d + 7. Let w(u) = -76956u3 - 4u*2 - 9u - 1. Let k be w(d). Let g = 15196168 + k. Round g to the nearest 1000000. -11000000 Let l(h) = 447h3 - 9h*2 + 11h + 18. Let i be l(-18). What is i rounded to the nearest 100000? -2600000 Let t = -0.09944 + 0.1. Round t to four decimal places. 0.0006 Suppose 5q = 5f - 4370, -3f - 4q = -0f - 2594. Round f to the nearest one hundred. 900 Let k = -0.66 - -3.56. Let r = 2 - k. Let n = -0.89999988 - r. Round n to 7 dps. 0.0000001 Let l = 6.0999949 - 6.1. Round l to 6 dps. -0.000005 Let a = -1.25 + 1.3. Let t = a + -0.049985. Round t to five decimal places. 0.00002 Let h be (12 - -1988)/(1/3750). What is h rounded to the nearest one million? 8000000 Let m be ((-458)/3 + 0)-393. Let y = 4 - 5. Let o be 4/2 - my. What is o rounded to the nearest 100000? 100000 Let c = -5.3 - -1.6. Let o = c - -4.756. Let a = 1.1 - o. What is a rounded to 2 decimal places? 0.04 Let v = 0.280032 + -0.28. Round v to 5 dps. 0.00003 Let z = 328510.44021 - 2.44021. Let o = 328507.099965 - z. Let q = o - -0.9. What is q rounded to five dps? -0.00004 Suppose 2o - 4u - 1195200 = 0, -3o + 1792800 = -0o + 2u. Let k be (-30)/(-4)o/27. What is k rounded to the nearest 10000? 170000 Let o = 286 - 285.881. What is o rounded to two decimal places? 0.12 Let x = 21 - 39. Let c = -26 - x. Let p = c - -8.00056. What is p rounded to 4 decimal places? 0.0006 Let c = 105.6 + -115.43. Let a = 7.7 + 2.8. Let w = a + c. Round w to one decimal place. 0.7 Let w = 388643 - 127643. Let f = 23 - 23. Suppose -3j - w = -fj. What is j rounded to the nearest 10000? -90000 Suppose -3u + 10 + 19 = 4o, -16 = 3u - 5o. Suppose -4f + 3d + 24391 = 0, -2f - 4d + ud + 12203 = 0. Round f to the nearest one thousand. 6000 Let d = -11 + 10.9896. What is d rounded to 3 dps? -0.01 Let w = 104 + 150. Let k = -618 + w. Let p = 254 + k. Round p to the nearest one hundred. -100 Let a = -37.78190959 - 0.21807341. Let v = a - -38. What is v rounded to five dps? 0.00002 Let d(o) = 3o - 2. Let y be d(2). Let a be (-54)/(-15) + y/10. Suppose 0 = -af - 44 - 12. Round f to the nearest ten. -10 Let f = -9 - 10. Let t = f + 19.00054. What is t rounded to 4 decimal places? 0.0005 Let c = 4.49 - 4.137. What is c rounded to two dps? 0.35 Let r = -0.09 + 0.13. Let j = -0.005 + r. Round j to 2 decimal places. 0.04 Let j be (-3 + 1)/((-8)/28). Let a(i) = 50437i3 + i2 + 10i - 10. Let y be a(j). Round y to the nearest 1000000. 17000000 Let g = 893 + 410. Suppose 2k - k + g = -3a, 4a = -2k - 1740. Let y = a + 63. What is y rounded to the nearest 100? -400 Let s = -2.70000124 - -2.7. Round s to seven dps. -0.0000012 Let b = 63053361762 + -63053384197.3448859. Let f = b - -22413.8449. Let m = f + 21.5. Round m to 6 dps. 0.000014 Let i = 18 + -13. Suppose 0 = ip - 10p + 2m + 26, -27 = -3p + 5m. Suppose k = -pk - 60500000. What is k rounded to the nearest one million? -12000000 Let g = 8.2 + -8.1999828. Round g to six decimal places. 0.000017 Let a = -5 - -18. Let z = 12.999896 - a. Round z to five dps. -0.0001 Let h = -1901101 + 1926128.53. Let k = -25005.52963 + h. Let g = k + -22. What is g rounded to 4 decimal places? 0.0004 Suppose 0h + h - 2w = -58, 5h = -5w - 305. What is h rounded to the nearest one hundred? -100 Suppose -3952 = -4s - 0s - 2f, 2f = 0. Let w = s - -152. Round w to the nearest one hundred. 1100 Let j = -702.314 + 690.3. Let p = -9.4 + -2.6. Let h = j - p. Round h to 2 decimal places. -0.01 Let c = 1.21 - -33.45. Let f = -35.0334 + c. Let m = -0.37 - f. What is m rounded to three dps? 0.003 Let u(q) = q - 5q + 5q - 6. Let r be u(10). Suppose 5c = rd + 160025, -d - 80015 = d - 3c. Round d to the nearest 10000. -40000 Let v be (240001 - 1)10/6. What is v rounded to the nearest one hundred thousand? 400000 Let p(o) = -219o3 - o2 + o - 1. Suppose 5 = -4a + 3t, t - 8 = a - 2t. Let m be p(a). What is m rounded to the nearest one hundred? -200 Let n = -0.05 + -0.55. Round n to one dp. -0.6 Let v = 4 - 3.976. Let g = v - -0.606. Round g to 1 dp. 0.6 Let z = -1 + -5. Let p(n) = 104n + 14. Let m be p(z). What is m rounded to the nearest 100? -600 Let b = 20 - 5. Round b to zero dps. 15 Let o = 0.99999816 - 1. Round o to 7 decimal places. -0.0000018 Let p(o) = 2607o*3 - 5o*2 - 11o + 1. Let y be p(9). Round y to the nearest one million. 2000000 Let n = -16 - -16.094. Round n to 2 decimal places. 0.09 Let l = 5 - 10. Let h = l - -5.00024. Round h to four dps. 0.0002 Let t(h) be the second derivative of 98h3/3 + h. Let x be t(-2). Let v be 150/7x/(-1). What is v rounded to the nearest one thousand? 8000 Let u = 99 - 93.8. Round u to the nearest integer. 5 Let z(y) = -91y2 + 22y + 5. Let s be z(-15). Round s to the nearest 1000. -21000 Let v(m) = 3m2 + 11m - 6. Let u be v(4). What is u rounded to the nearest ten? 90 Let w = 56 + -56.039. Round w to 2 dps. -0.04 Let u = -1.12 - -59.52. Let t = u - 51. What is t rounded to the nearest integer? 7 Let n(t) = -18t3 - 2t*2 - t + 1. Let f be n(-2). Suppose 4k - 394 = i - f, -4k = i + 271. Round i to the nearest 10. -260 Let c = -2 - -1.9967. Round c to 3 decimal places. -0.003 Let s = -444.586 - -441. Let x = s - -1.979. Let f = x - 0.013. Round f to 1 decimal place. -1.6 Suppose 4u - 11 = 5. Suppose 0 = h - 4j - 5399980, uh + 3j + 0j - 21600015 = 0. What is h rounded to the nearest one million? 5000000 Let y = -0.03 - -0.02977. What is y rounded to four dps? -0.0002 Suppose -q + 5c - 113 = 0, 211 + 64 = -3q - c. Round q to the nearest 10. -90 Let h = 4 - 3. Let z = 5.502 - 4.5136. Let q = z - h. Round q to 3 decimal places. -0.012 Let t(r) = -r2 + 3. Let x be t(-3). Let j(s) = -s3 - 4s2 - 2s - 6. Let l be j(x). What is l rounded to the nearest ten? 80 Let k = 3963 - 3991.71. Let a = -53 + 82. Let c = k + a. Round c to 1 dp. 0.3 Let x = 11 - 10.9999932. What is x rounded to 6 dps? 0.000007 Let s be 13(-6)/9. Let c be s/(-4) - (-76000005)/(-10). Round c to the nearest 1000000. -8000000 Let c = -9 - 11. Let p = -2 + 20.7. Let m = c	{ "pile_set_name": "DM Mathematics" }
(-26)/k2. Solve -5p + 2 = -y for p. 3 Let b = 20 - 14. Let p be 2/4 + (-30)/(-12). Let l = 3 - 3. Solve b = -pm - lm for m. -2 Let r = 32 + -30. Solve 20 = rq + 2q for q. 5 Let x = 178 + -173. Solve -5s = -20 + x for s. 3 Suppose -3r = -0r - 3, 2r = o - 2. Solve g - 6 = -o for g. 2 Let p be 1/(1(-2)/(-4)). Solve t = -pt for t. 0 Suppose 4t + 3 = 27. Solve 12 = 2i - ti for i. -3 Let o(h) = -h*2 + 7h - 3. Let j be o(6). Solve jf - f + 10 = 0 for f. -5 Suppose -5l - 4 = -4v - 4l, -2 = -2v + 2l. Solve -3 = 2u - v for u. -1 Suppose 0 = 6m - 4m. Solve 0p - p = m for p. 0 Let u = 302 - 296. Let w be (-1)/((1 - -1)/(-2)). Solve -5b = -ub - w for b. -1 Suppose -3v = v - 3x + 1, -2v - 3x = -13. Solve -2l = vl - 12 for l. 3 Suppose 3h + 0h - 15 = 0. Suppose -hg + 7 = -3. Suppose 0 = 3n - 8n + 4t + 19, 2n = -2t + 4. Solve -gr = -1 + n for r. -1 Suppose -6d = -4d - 18. Solve -7m + d = -10m for m. -3 Suppose s + 0s = 4m - 18, s + 5m = 27. Solve l - s = 3l for l. -1 Suppose -2h = -4z + z, 4 = -2z. Let a = h + 1. Let u be a/(6/(-27)) - 3. Solve 0 = -0g + 3g + u for g. -2 Let k = 17 + -4. Solve -4j + k = 33 for j. -5 Let f(y) = y3 + 4y*2 - 5. Let x be f(-2). Solve x - 1 = -b for b. -2 Let c be 4/(-14) - (-216)/21. Suppose 8 = -j - 3i, 4j - 5 - 27 = 4i. Let d = c - j. Solve dk + 6 = 3k for k. -2 Suppose -2k + 5 = 1. Let d be k/(0 + -2) - -3. Let h be (2/3)/(4/18). Solve 1 = dx + h for x. -1 Let w(g) = -g*2 + 9g - 6. Let c be w(8). Solve cy - 3 = 5 for y. 4 Suppose 0 = 9t - 12t + 12. Solve -3p - t = -1 for p. -1 Let w be (6/10 + 0)5. Solve 15 = -4l + w for l. -3 Suppose -d - 2t = -4, -d - t = -5d + 25. Solve -5f - 9 = d for f. -3 Let k = -10 - -16. Suppose l - 12 - k = 4n, 4n = -16. Solve lz + 0z = 4 for z. 2 Suppose 0 = 5d - 125 - 15. Suppose 5m - v = d - 7, 4m - 2v = 18. Let q be (-12)/9(-6)/m. Solve -q = -3c + 13 for c. 5 Let p = 9 + 2. Solve -5n - 9 = p for n. -4 Suppose 4v - r = -12, -3r - 4 - 28 = 5v. Let u(a) = 3a*3 + 5a*2 + a. Let l be u(-2). Let x = v - l. Solve -m + 4 = x for m. 2 Let t be 1 - (-2 - 0 - 1). Suppose 0r - tn + 64 = r, 3n + 297 = 5r. Suppose 2o + 6 = 4j - r, 5j - 4o - 90 = 0. Solve 3z - 2 + j = 0 for z. -4 Let u(a) = a - 6. Let b be u(13). Suppose -b = 2i - 3i. Let o = -2 + i. Solve o = -0l + 5l for l. 1 Let j(a) = -a*3 - 14a*2 + 3. Let h be j(-14). Solve 17 - 5 = -ho for o. -4 Suppose 0u = -5u + 40. Solve 0 = -5r - 33 + u for r. -5 Suppose m + 3t = -0t + 16, 2m - 5t = -23. Let p(d) = 4d3 - d2 + d - 1. Let s be p(1). Let z be 0/(-5) + (1 - -6). Solve si = -m + z for i. 2 Let o be (-12 - -13)/((-1)/(-5)). Solve -oa = -4 - 6 for a. 2 Suppose -7g + 2g - 5u + 95 = 0, 4g - 79 = -5u. Suppose -3a - 9 = 21. Let f = g + a. Solve 0 = -ft + t + 10 for t. 2 Let s(l) = l3 + 10l*2 + 9l + 2. Let r be s(-9). Solve rj + 6 = -0j for j. -3 Suppose -6q + 4q = -10. Suppose -3i = -4i + q. Let b = i + -2. Solve -bz = 3 + 12 for z. -5 Let v(q) = -9q*2 + 7q + 5. Let h(z) = 5z2 - 4z - 3. Let o(a) = -7h(a) - 4v(a). Let d be o(1). Let l be 9 + (-1)/(d/(-2)). Solve -6y + l = -y for y. 2 Let t = 10 + -8. Solve -1 = -k - t for k. -1 Let b = 40 - 24. Suppose -3u = 13 - b. Solve -9 = 2q - u for q. -4 Let g = 1 - 4. Let c = g + 4. Let s = c + -1. Solve 3y + sy = -3 for y. -1 Let w(s) = 2s + 9. Let a be w(11). Suppose -3i + k = 2k - a, -10 = 2k. Solve -3n + 6n = -i for n. -4 Let w(k) = k3 + 2k2 - k. Let h(b) = b2 - 4b - 7. Let o be h(5). Let y be w(o). Solve 15 = m + ym for m. 5 Let x be ((-154)/42 - -13)-3. Solve 0 = v + x + 2 for v. -4 Let n(a) = -2a - 2. Let w be n(-4). Solve 20 = wp - p for p. 4 Suppose -2 = -3t - z - 0, -5t - z = -6. Solve -3u = tu - 15 for u. 3 Let w be -3 + (3 - (-2 + 2)). Suppose w = 5h - 32 - 3. Solve -h = -4i - 3 for i. 1 Suppose -v + 10 = 3y, -7y = -3y + 5v - 28. Let o be 1/y-2 + 8. Suppose 8 = 5s - o. Solve -6 = sp + 6 for p. -4 Let t be (-1 - 0/6)/(2/(-8)). Solve -ti = i + 25 for i. -5 Let v = -11 + 9. Let a be 2 - (-1)/((-1)/v). Solve a = 3g - g for g. 2 Suppose 0 = i + 3 - 7. Suppose 0 = 4n + 3f - 18, 0f - 14 = -n + if. Solve -2j + 2 = -n for j. 4 Suppose 3j = 13 + 8. Let u(s) = 3 + 3s*2 - 4s*2 + 3s*2 + js - s*2. Let h be u(-7). Solve -4k = -23 + h for k. 5 Let f = -410 - -412. Let c(u) = -u*2 - 6u + 9. Let l be c(-7). Suppose -4 = p - lp. Solve -ph - f = 2 for h. -1 Let h(l) = -14l3 + 2l*2 - 1. Let z be h(-1). Solve z = -5j - 0j for j. -3 Let b(k) = k3 + 9k*2 - 10k + 7. Let h be b(-10). Solve 4o - h + 27 = 0 for o. -5 Let n be (-11)/3 + (-68)/51. Let v(x) = x3 + 5x*2 - 5x. Let y be v(n). Solve -2t = 3t + y for t. -5 Let c be 0/(26/(-4)). Suppose -5x + c = -5. Solve -3 = b - x for b. -2 Suppose -9 = -q - 3h, h + 1 = -q - 0. Let d be (-2)/4 - 9/q. Let f be 2 - (2 + (d - 4)). Solve -fa - 4 = a for a. -1 Let b(f) = 4f3. Let h be b(1). Let m be 42 - h/2. Solve a = -a - m for a. -3 Suppose -g = 6g - 56. Solve -g = 5p + 7 for p. -3 Let u(m) = -m - 4. Let n be u(-8). Solve 0 = -nw + 1 + 19 for w. 5 Suppose 4s = 4w - 20, 6w - s - 41 = w. Suppose 0 = v - w - 8. Solve v = 5t - 3 for t. 4 Let l(m) = -5m + 4. Let k be l(-3). Let w = k + -10. Suppose w + 3 = 4q. Solve qd = 6d for d. 0 Suppose -3y + 9 = -4f, 2y = -2y + 12. Let o be (-16)/24 - 34/(-6). Solve oa + f = 5 for a. 1 Suppose 4m = -5y - 10, m + 0m + y = -2. Solve 3u + 12 = -mu for u. -4 Let r be (0 + 4)(-21)/28. Let o be 0/r(-1)/2. Solve o = -v + 6v for v. 0 Let w(x) be the third derivative of x6/360 + x5/40 + x4/12 + x2. Let g(d) be the second derivative of w(d). Let n be g(3). Solve -2j - n = j for j. -3 Let a(s) be the second derivative of -s3/6 - 2s*2 - s. Let j be a(-4). Suppose 0f - 5f = j. Solve 5b - 20 + 0 = f for b. 4 Suppose -153 = -5s - 38. Let r = 23 - s. Solve 3k - 9 - 6 = r for k. 5 Suppose -4k - 28 = -28. Solve -2b + 6b + 16 = k for b. -4 Let z be -1 + 4 + (3 - 6). Solve zp - 2 = -p for p. 2 Let b be 12/(-42) + 69/21. Suppose 4z = -0z. Solve -y + z - b = 0 for y. -3 Suppose n - p = -5p + 1, -2n - 2p + 2 = 0. Let y = 6 - -6. Let b be (-3)/y + (-17)/(-4). Solve 0 = -3l - n + b for l. 1 Let v(z) = 0z3 - 9z + z + 5z2 + z3 + 0 - 7. Let o be v(-6). Suppose 0 = -5n - 4r - 20, 2n - r + o = -2r. Solve -s - 4 = -ns for s. -4 Suppose 7q + 17 - 38 = 0. Solve 7 = -qh - 5 for h. -4 Let l = 3 - 0. Suppose -5t - a + 48 = 0, 8a = 5t + la - 60. Suppose -3q - q + t = -2s, q - s - 2 = 0. Solve 2g + 7 = q for g. -2 Suppose 4l - 12 = 8. Solve -5r = -0r - l for r. 1 Let u(v) = v - 4. Let q be u(6). Suppose 5f - 20 = -2t, -qt = -4t - 2f + 14. Suppose -3g - 2 = -tg. Solve b - g = -0b for b. 1 Let o be ((-1)/2 - -1) + 2/(-4). Solve o = 5a + 3 + 7 for a. -2 Suppose 4p - 7 = u, -4 - 6 = -3p - 4u. Let k(q) = 2q - 1. Let v be k(p). Solve vf + 10 = -2 for f. -4 Let f(d) = -5d - 9. Let j be f(-4). Suppose -2i = j - 15. Let k be 19 + -2 + 1. Solve im = -2m + k for m. 2 Let d be (1 - 23)/(7/(14/(-4))). Solve 0 = -3x + d + 4 for x. 5 Let d = -4 - 0. Let v be 1 - (d + 4 + -4). Solve vs = 4s - 4 for s. -4 Let o = -1 + -2. Let w be 26 - (0 + o - -5). Suppose -4d = 2y - 18, -4d + 0y + w = -4y. Solve -3 = -di + 2 for i. 1 Suppose -4q = -11z + 6z - 10, 4z = 2q - 2. Suppose 3b - 4b = -zj - 1, -j = 5b - 27. Let d = -5 + 5. Solve j = 2t - d for t. 1 Suppose a = 5g - 3, 2a = -3a + 5g + 5. Let r(s) = -s*2 + 12s + 15. Let u be r(12). Suppose 9 = o + 4d - u, ao + d - 13 = 0. Solve o = 4l - 0l for l. 1 Let n(j) be the third derivative of j*4/24 - 2j*3/3 + 2j*2. Let u be n(4). Solve 2k + k = u for k. 0 Let d be ((-10)/35 + (-4)/(-14))/2. Solve q + d = -2 for q. -2 Let c be 27/(-2)(-16)/12. Let k be c/8 - (-3)/(-12). Solve 2p - k = -10 for p. -4 Let g(a) = -a3 - a2 + a - 1. Let v be g(1). Let c = v - -1. Let k(u) = 3u2 - 1. Let h be k(c). Solve 0 = ht - 2 for t. 1 Suppose -5p + 40 = 2w - 5w, -5 = -p. Let c = w + 8. Suppose -4s = 4l - 104, -5l + 122 = -0s - cs. Solve 4a - l = -9 for a. 4 Suppose 9a - 39 - 33 = 0. Let n = 10 - 5. Suppose 2*	{ "pile_set_name": "DM Mathematics" }
+ c*2 + c - 1. Let p be (-42)/712/(-4). Let h(x) = 30x - 12x + 4x*2 - 4 - 13x - 5xp. What is h(q) - 4w(q)? -q*3 + q Let t(u) = -3u + 1. Let s(d) = -8d + 3. Let m be (-1)/4 + 45/4. Let g(z) = -4z. Let q = -17 + 18. Let x be g(q). Give mt(n) + xs(n). -n - 1 Suppose p - 3 = 1. Suppose -pa = 4 + 4. Let b(w) = -w3 - w - 1. Suppose 4j - 144 = -4j. Let i(c) = -8c*3 - 9c - 8. What is ai(k) + jb(k)? -2k3 - 2 Let n(l) = -16l*2 + 18l + 10. Let r(m) = 14m2 - 19m - 8. Determine 4n(c) + 5r(c). 6c2 - 23c Let u(d) = 2d3 - 7d*2 + 3d + 1. Let h(k) = 5k3 - 20k*2 + 8k + 2. Suppose 14j - 14 + 56 = 0. Determine jh(v) + 8u(v). v3 + 4v*2 + 2 Let o(x) = -3x - 3. Suppose -3a - 3f = -111, -3a = -4a + 5f + 19. Suppose -14u - 6 = -a. Let s(c) = -4c - 3. Determine us(r) - 3o(r). r + 3 Let v(t) = -2t*2 + 15t - 1. Let g(i) = 3i2 - 16i + 2. Determine 3g(f) + 4v(f). f*2 + 12f + 2 Let k = 232 - 226. Let v(q) = -9q + 1. Let b(g) = g + 10. Let d be b(-5). Let o(p) = 8p - 1. Determine dv(w) + ko(w). 3w - 1 Let d(p) = 2p - 1. Let z = 13 + 53. Let c be 1/5 - z/30. Let b(k) = 1. Let h(j) = -j*2 - j + 5. Let i(a) = 5b(a) - h(a). Determine ci(v) + 2d(v). -2v2 + 2v - 2 Let n(g) = g*2 + g - 5. Let k(l) = 0l + 0l2 + 6l + l*2 - 6 - 4l. What is -5k(b) + 6n(b)? b*2 - 4b Let g(w) = -w - 1. Suppose 40 = 6q + 22. Let u(m) = m3 - m. Let a be u(1). Let k(y) = -1 + y3 - 6y + ayq + 3y. Calculate -g(h) + k(h). h*3 - 2h Let v(s) = 7s2 + 2s + 16. Let a(g) = -g*2 + g. Give -a(k) + v(k). 8k*2 + k + 16 Let o(i) = 37i + 7. Let u(x) = 21x + 4. Let n(j) = -6o(j) + 11u(j). Let d(a) = -4a - 1. Suppose -7 = -0r + r. Give rd(y) - 3n(y). y + 1 Let b(u) = 9u - 394. Let x(g) = 4g - 197. Calculate -3b(c) + 7x(c). c - 197 Let l(q) = -14q + 10. Let n(v) = -3v - 5. Let p(z) = 4z + 6. Let w(h) = -5n(h) - 4p(h). Suppose -24t = -190 - 98. Determine tw(y) - l(y). 2y + 2 Let k(l) = 13l*2 + 32l - 4. Let x(a) = -3a2 + a + 1. Determine k(p) + 6x(p). -5p2 + 38p + 2 Let t(v) = 75v + 5. Let z(i) = 2i. What is -t(l) + 15z(l)? -45l - 5 Let i(x) = 1. Let m(n) = 265n - 159. What is -159i(f) - m(f)? -265f Let r(x) = -3 + 229x*3 - 76x*3 - 78x*3 - 66x*3. Let a(k) = -2 - 1 + 1 + 8k*3. Determine 5a(q) - 4r(q). 4q*3 + 2 Let d(x) = 696x + 1624. Let t(y) = y + 2. What is -4d(u) + 3248t(u)? 464u Let d = -8 + 18. Let r(f) = -4f + 3. Let p(w) = -7w + 5. Calculate dr(t) - 6p(t). 2t Let y(z) = -4z2 - z + 10. Let a(v) = 5v*2 - v - 11. Give 6a(t) + 7y(t). 2t*2 - 13t + 4 Let p(m) = 11m - 9. Let c = -579 + 588. Let o(j) = -5j + 5. Determine co(u) + 4p(u). -u + 9 Let s(b) = b*3 + 4b*2 - 4. Let t = -82 + 87. Let f be 1(-1)/((-1)/t). Let m(k) = 2k3 + 5k*2 - 5. What is fs(g) - 4m(g)? -3g*3 Let a(i) = i. Suppose 3c = 2c - l + 2, -4l - 17 = -c. Let s(n) = -2n2 + 6n - 2. Determine ca(v) - s(v). 2v*2 - v + 2 Let b(a) = -a - 1. Let r(g) be the second derivative of 2g3/3 + g2 + 6g. Let f = 26 + -23. Give fb(t) + r(t). t - 1 Suppose 172g - 148g + 144 = 0. Let c(w) = -3w + 3. Let m(n) = -4n + 4. Give gc(f) + 5m(f). -2f + 2 Let i(n) = -2n3 - n2 + n - 1. Let h(p) = 13p3 + 2p*2 - p + 5. Calculate -h(o) - 2i(o). -9o3 - o - 3 Let a(q) = 13q*2 + 424q + 27. Let i(w) = 3w2 + 106w + 6. What is 2a(d) - 9i(d)? -d*2 - 106d Let x(h) = -2h - 13. Let d = -26 + 23. Suppose -2z - 14 = 2r, 2z + 16 = -2z. Let l = r + d. Let j(t) = -t - 6. Give lx(v) + 13j(v). -v Let l(y) be the second derivative of y5/4 - y4/12 + y3/2 - 4y*2 + 13y + 11. Let g(m) = -6m3 + m2 - 4m + 9. Determine -3g(s) - 4l(s). -2s3 + s2 + 5 Let k(c) = -c2 - 4c + 2. Let y be -2(-1 + 0) + -76 + 75. Let w(b) = b2 + b - 1. What is yk(v) + 2w(v)? v2 - 2v Let h(v) = 4v + 51. Let c(u) = -1. Determine -6c(l) + h(l). 4l + 57 Let z(g) = -12g + 188. Let f(o) = 29o - 378. What is -2f(k) - 5z(k)? 2k - 184 Let c(u) = u*2 - u - 1. Let b(v) = 13v*3 + 4v*2 - 4v - 4. Suppose -15d + 78 = 18. Calculate dc(p) - b(p). -13p3 Let v be (1/(-1))/(116/(-28) - -4). Let n(h) = 10h + 5. Let b(u) = 3u + 2. What is vb(o) - 2n(o)? o + 4 Let b(n) = 6n - 149. Let q(i) = 4i - 149. Give 3b(a) - 4q(a). 2a + 149 Let k(b) = -b3 - b2 + 6b - 5. Let n(u) = -u2 + 5u - 4. Suppose 2o = -3h - 27, -2h + 1 + 7 = -3o. What is on(a) + 5k(a)? -5a3 + a2 - 1 Let c(u) = 8u*2 + 5. Suppose -d - 6 = 2d + 3b, 5d = b - 28. Let s(m) = -11706m2 - 1 + 0 - 6m + 11705m2 + 6m. What is ds(r) - c(r)? -3r*2 Let m = -81 - -85. Let s(h) = -5h*2 + h + 3. Let k(c) = 6c*2 - c - 4. Determine ms(z) + 3k(z). -2z*2 + z Let x(v) = 1865v. Let r(d) = -4d. Determine -373r(l) - x(l). -373l Let v(f) = 7f*3 - 3f*2 + 9f. Let u(j) = j*2 - j. Calculate 6u(m) + 2v(m). 14m*3 + 12m Suppose 0 = 56a + 24a - 240. Let k(r) be the first derivative of -2r - 2 - 1/2r*2 - 1/3ra. Let u(x) = -x2. Give -k(w) - u(w). 2w2 + w + 2 Let d(b) = -3. Let a(r) = -r2 - 207. What is -a(c) + 2d(c)? c*2 + 201 Let x(b) = 10b*3 - 6b*2 + 108b + 1. Let d(m) = 18m3 - 11m*2 + 217m + 2. What is 6d(l) - 11x(l)? -2l3 + 114l + 1 Let z(y) = -112y - 17. Let c(j) = -111j - 15. Calculate -7c(x) + 6z(x). 105x + 3 Let b(o) = -324o + 567. Let t(n) = -n + 1. Determine 3b(w) - 1701t(w). 729w Let s(p) be the second derivative of -3p5/20 - p4/6 - p*3 + 332p. Let w(v) = -v. Calculate s(r) - 3w(r). -3r*3 - 2r*2 - 3r Let m(p) = -17p3 + 3p*2 + 9p - 2. Let t(x) = 49x3 - 8x*2 - 26x + 5. Give -8m(y) - 3t(y). -11y3 + 6y + 1 Let z(v) = v*2 - 20v - 1. Let m(r) = 3r2 - 39r - 2. What is 4m(b) - 10z(b)? 2b2 + 44b + 2 Let i(y) = 496y3 + 4y*2 + 4y - 12. Let k(l) = 21825l3 + 175l*2 + 175l - 525. Determine -175i(p) + 4k(p). 500p3 Let v(r) = -r + 1. Let y(p) = -3p - 17. Let j = 5 - 9. Let t be y(j). Let f(k) = 8k - 4. Determine tv(a) - f(a). -3a - 1 Suppose 3b - 39 = 3h + 8b, -4b + 20 = -4h. Let n(x) = 13x2 - 8x - 8. Let f(l) = 4l2 - 3l - 3. Determine hf(m) + 3n(m). 7m2 Let g(w) = -8w + 5. Let h(l) = -7l + 5. Let a(d) = -5g(d) + 6h(d). Let p(s) = s - 4. Calculate -4a(q) - 5p(q). 3q Suppose 0m - m = -5u + 6, 0 = -3m + u + 52. Let t(g) = 11 - mg*2 + 34g*2 - 6g*3 + 0. Let q(w) = 3w*3 - 8w*2 - 6. Give 11q(c) + 6t(c). -3c*3 + 2c2 Let q(n) be the first derivative of n2/2 - n + 113. Let s(l) = -l + 2. What is -10q(r) - 5s(r)? -5r Let l(n) = -3n*2 - 5n - 3. Let v(o) = -8o2 - 14o - 8. Let x(p) = 14l(p) - 5v(p). Let z(m) = 10m2 + 11. Give -11x(f) - 2z(f). 2f*2 Let j(a) = 3a*3 - 7a*2 - 6. Let x(q) = -5 + 209q*3 + 10 - 212q*3 + 6q*2. Give -5j(p) - 6x(p). 3p3 - p2 Let c(g) = g*2 - g + 1. Let r(l) = 4l*2 - 6l - 29. Determine 10c(o) - 2r(o). 2o2 + 2o + 68 Let y(q) = -q + 1. Let b(r) = 146r + 5. Determine -b(f) + 5y(f). -151f Let r(o) = 12 + 4o + 2o - 3 - 4o*3 - 7o*2. Let f be (18/30)/(-41/(-60)). Let j(q) = -2q3 - 3q*2 + 3q + 4. Give fj(p) - 4r(p). -2p3 + p2 + 3p Let y(t) = 16t - 7. Let h = -325 + 318. Let m(i) = 11i - 5. Determine hm(g) + 5y(g). 3g Let s(t) = 33t - 2. Let p(h) = -24h + 2. Let w(d) = 4p(d) + 3s(d). Let j(n) = -3n - 2. Calculate 4j(m) + 5w(m). 3m + 2 Let z(r) = -20r*2 - 11r. Let u(h) = -21h2 - 12h. Determine 3u(x) - 4z(x). 17x2 + 8x Let f(w) be the first derivative of 3w2/2 + 6w + 124. Let x(t) = -4t - 7. What is -6f(q) - 5x(q)? 2q - 1 Let j(k) = 16k2 - 209k + 12. Let f be j(13). Let h(t) = -t*3 - 3t - 3. Let l(v) = v + 1. Calculate fh(i) - 3l(i). i*3 Let t(s) = s - 4. Let a(k) = k + 1. Let o = 507 - 508. Determine oa(j) - t(j). -2j + 3 Let x(z) = 5z*2 - 6z - 10. Let b(n) = -6n2 + 7n + 9. Determine 4b(c) + 5x(c). c*2 - 2c - 14 Suppose 0 = 2706b - 2709b + 45. Let k(g) = -7g3 + 9g*2 + 5g. Let i(j) = 3j3 - 4j*2 - 2j. What is bi(f) + 6k(f)? 3f3 - 6f*2 Let k(q) = 10q*2 + 5q - 5. Let i be (-1)/(-1) - (-2 + 6). Let r(z) = 5z2 + 382z - 385z - z2 - 9z*2 + 3. What is ik(y) - 5	{ "pile_set_name": "DM Mathematics" }
is positive. f(-109/1120) Simplify ((j(-1/4))*34/((jjjj*(-2/15)j)/j5))(1/41) assuming j is positive. j(-221/1230) Simplify ((((z2/z)/zz)/z)/z(-2/7))/(z(-15))(-23) assuming z is positive. z(-2413/7) Simplify (g(-14)g9)36 assuming g is positive. g*(-180) Simplify (y/(yy/y*(-1/5))y*14)/((yyyy*14)/((yyyy/y(21/2))/y)) assuming y is positive. y(-117/10) Simplify ((k/((k/(kk/k(-13)k))/k)(k1k)/k)/(k*(2/7)k)(-16))27 assuming k is positive. k(7290/7) Simplify (((g(-1/3)/g)/g)/gg)(-1/11)(g*2/gg)/g0 assuming g is positive. g(73/33) Simplify (x/((x*(-1/7)/x)/x)x*0x)/(x*(-22)/(xxx/(x(1/25)x)xx)) assuming x is positive. x(5268/175) Simplify ((((b(-1/8)b)/b)/(b4/b))/(b(1/3)/b)(-3))(-6/23) assuming b is positive. b(123/92) Simplify (((jj*5j)/(j/(jj(-2/9))))/(j/j3)(-23))(-4/15) assuming j is positive. j(1412/135) Simplify (x(-3/2)x/x*(3/2)(x(2/3)/x)30)(-2/19) assuming x is positive. x(24/19) Simplify ((((d/(d/d*(-1/9)))/dd)/d)/d)/d*(-3/10)dd/d(-11)dd(2/7)dd assuming d is positive. d(9119/630) Simplify (z(1/45)zz/(zz/z*(2/13))z)(2/23) assuming z is positive. z(1376/13455) Simplify (((o/o*(-1/4))/(oo*(-11/5)oo))12)(2/17) assuming o is positive. o(54/85) Simplify ((((v/(v/(v/v(-10)v))v)/v)/v)/((v((v/(v*(-3/16)v))/v)/v)/vv))/(v23/v(5/2)) assuming v is positive. v(-139/16) Simplify ((i/i(-7/4))/i(-10))/(i/(i(4/3)iii)(iiii(-1/3)/i)/i) assuming i is positive. i(185/12) Simplify (q2)(-48)/(q*1q(q7q)/q) assuming q is positive. q(-105) Simplify ((p/p(-16)pp)/((p*10/p)/pp))/(p/(p/((p/p1)/p)))(-25) assuming p is positive. p(-15) Simplify (z(3/2)/zz(-11))/(zz*5z((zz(-12/5))/z)/z) assuming z is positive. z(-141/10) Simplify (m(-12)/m(-29))/(m(4/15)/(m/m(-12)m)) assuming m is positive. m(461/15) Simplify (sss(2/7)ss)/(s/(s(-10/7)/s))(s/s*(-16)s)/(s/s(2/11)) assuming s is positive. s(1389/77) Simplify (gg(-2/9)(g/(g*(-16)g))/g)/(g/g(2/9))22 assuming g is positive. g*(-4/3) Simplify ((dd/d*5dd(-2/29))(5/11))(-1/50) assuming d is positive. d(6/319) Simplify (((k/((k(kkk/k*27)/kkkkk)/k))/k)/kk(kkkk/(k/k*(-1/46))kkk)/k)/(k*(-9/5)kk/k(-10/3)) assuming k is positive. k(15487/690) Simplify (s(-6)s)*(-21)/((ss(s(-20)s)/ssss)/s(-17/3)) assuming s is positive. s(343/3) Simplify ((k(2/7)k3)(15/7))34 assuming k is positive. k(11730/49) Simplify (h*(3/16)hh)/(hh/h*31)h*(-34/7)h/(h/((h/h(-5/3))/h)) assuming h is positive. h(9407/336) Simplify (b8)1(b11/b)(-45) assuming b is positive. b(-442) Simplify ((x30x)/((x(x/(x(x*3x)/x))/x)/x))/(xxxx/x(18/7)xxx(-21)/x) assuming x is positive. x(375/7) Simplify (b(7/6))(-35)/(b/b*(1/14)((b/(((b/(bb(9/4)/b))/b)/bb))/bb)/b) assuming b is positive. b(-3697/84) Simplify nn/n*16n*(-7/6)n*(-1/2)n/n9 assuming n is positive. n(-71/3) Simplify (t((t/((t/(t/t6))/tt)t)/t)/t((t(t/(tt*(-5)))/t)/t)/t(t/(t/(tt/t(4/7))))/tt(-12))48 assuming t is positive. t(-4560/7) Simplify ((h(-2/3))(-45))(-24/11) assuming h is positive. h(-720/11) Simplify (((x(-6)/x)(-21))(-1/30))(-25) assuming x is positive. x(245/2) Simplify (gg/(g(-2/5)/g)g)*(2/27)g*(2/31)g/g(-7/4) assuming g is positive. g(52571/16740) Simplify ((y/(y/(y/((yy/((y6/y)/y)y)/y))))/(yy(1/12)))/((yy/(yy(-11)y))/y(y/(yy/(((yy/(y(-2/43)y)yy)/y)/y))y)/y) assuming y is positive. y(-4195/516) Simplify ((mm/m*(3/2)(mmmm/(mm/m*(-10)m))/m)(-4/13))(2/9) assuming m is positive. m(76/117) Simplify (y(-1/9)/(yy32y))(5/13) assuming y is positive. y(-1535/117) Simplify (i/(iii*(-14)i)i)/(i(-3)/ii)(i/(i/(i(6/11)/i)))(-17) assuming i is positive. i(261/11) Simplify (l1/(ll*(13/2)))/(l/(llll/l*(-9/2)l)l)(-18) assuming l is positive. l(-283/2) Simplify (b8/b)/(b/((b/(bb/(b/b*(-18))))/b))(bbbb(-1/19))/(b(8/3)b) assuming b is positive. b(1270/57) Simplify (k(3/4)k)/kk*(3/14)(k*(-1)/kk)/(k/(k(-7/4)/k)) assuming k is positive. k(-53/14) Simplify (p(-3/2))(-2/11)/(pp(-2/27)/pp16) assuming p is positive. p(-4649/297) Simplify (l(2/21))(-34)/(ll24lll28) assuming l is positive. l(-1223/21) Simplify ((((r/(r/r*(1/2)r))/r)38)50)(-15/7) assuming r is positive. r(42750/7) Simplify (nn/n(1/5)nnn*(16/5))/(n/(n/(nn*(1/2)))n(3/8)/n) assuming n is positive. n(49/8) Simplify t(-13)/(t(-13)/t)(t(-2/17))(2/5) assuming t is positive. t(81/85) Simplify (ttt(-2)/tt)37/((t(5/2)t)/t6) assuming t is positive. t(5/2) Simplify ((nnn2)/nn)*33(n/(n(n/(n/(nn*(1/3))))/n)n)(5/9) assuming n is positive. n(3574/27) Simplify (rr7)/(rr*(-2))r13/r0 assuming r is positive. r*22 Simplify jjj(1/9)j*(-11)(j8)(5/2) assuming j is positive. j(100/9) Simplify (p(6/11)p)/(p/p(8/11)p)p9p(3/2) assuming p is positive. p(237/22) Simplify (q*5/(q(q/(q/(q/((q/(q/q*(-4/5)))/qq)qq))q)/q)(q*(2/3)qq)(38/7))(-35) assuming q is positive. q(-1541/3) Simplify (((jjj/j33j)/j)/((j/j*(4/19))/j))/(jjj(-7)j(-21)) assuming j is positive. j(-72/19) Simplify (g*(1/9)gg((g*(4/15)g)/gg)/gg)/(g/(gg/((((g(-5/3)/g)/g)/g)/g)g))(3/10) assuming g is positive. g(511/90) Simplify (j(-2/5))(-42)(jj0)/j(1/6) assuming j is positive. j(529/30) Simplify (((b(1/4)/b)(1/22))(-10/7))(-31) assuming b is positive. b(-465/308) Simplify ((j((j(-8)/jj)/jj)/jj)(-9/4))(-1/3) assuming j is positive. j(-21/4) Simplify (((d12/d)/(d/(d/d*(6/5))d))(5/2))(-34) assuming d is positive. d(-748) Simplify (r9rr)*0(r(-8))37 assuming r is positive. r(-296) Simplify ((o8/o)/(oo(o*37o)/o))(7/3) assuming o is positive. o(-224/3) Simplify (z/((zz/((zz/(z/(zz/(z9/zz)z)z)zz)/z))/zzz))/zz5(zz(-4/3)z)/z(3/13) assuming z is positive. z(-100/39) Simplify ((d(dd/d7)/d)(-1/30))(-2/13) assuming d is positive. d(-1/39) Simplify (ww(-7)wwwww*(-7/2)w)/((ww(-1/7))/w(-2/49)) assuming w is positive. w(-529/98) Simplify (((w34/w)/www)/w(1/16))10 assuming w is positive. w(2715/8) Simplify ((c(-1)c/(c((cc*(-13))/c)/cc))(-45))(2/19) assuming c is positive. c(-1080/19) Simplify (((s(1/3)/s)/s(-1/6))(-2/193))40 assuming s is positive. s(40/193) Simplify n*(-2)nnn*8(n*13nn)/(n(3/7)nn) assuming n is positive. n(144/7) Simplify (t(-20)/(((tt(-8/3))/t)/t))47 assuming t is positive. t(-2303/3) Simplify (n(2/7)nn)*(3/31)(nn11)(2/17) assuming n is positive. n(6024/3689) Simplify (v(-19))(-40)v/v*(-5/7)v23 assuming v is positive. v(5493/7) Simplify h(h(-7/3)h)/hh/(hhh/(h(-2/13)/h))h(h/(h/(h(h/(h/(h/(hhh*(-15/2)hh))))/hh)))(-19/4) assuming h is positive. h(-9239/312) Simplify (y/(y/(y*5y))y)39(y/(y/y(-18)))/(y(-18)/y) assuming y is positive. y*274 Simplify ((nn*2n)/n(7/6))/((n/n(-1))/nn)(19/3) assuming n is positive. n(-59/6) Simplify (t/(t(4/11)/t))/ttt12(ttt*(2/3)/tt)48 assuming t is positive. t(1558/11) Simplify (r(-22))(1/4)/(r*7r23) assuming r is positive. r(-71/2) Simplify (((s*(-6)s)/s)/s6)/(s(6/19)sss/s(-3/11)s) assuming s is positive. s*(-3467/209) Simplify (ss(2/13))(-43)(s(s*(-4)/s)/ss)(-5/12) assuming s is positive. s(-1870/39) Simplify (s*(-3/19)s/(s/s*(-6)s)ss)/((s14/s)/(s/s(-33))) assuming s is positive. s*(301/19) Simplify ((u/(u/(u(u/(u*4u))/u)))/(u*(-15/4)u))(1/3) assuming u is positive. u(-5/12) Simplify (g*4ggg/(gg0)(((gg(-2/21))/g)/gg)/(g/((g/g(-3/8))/g)))31 assuming g is positive. g(27497/168) Simplify ((b(-20)b)(-9/8))(1/39) assuming b is positive. b(57/104) Simplify i(6/11)i(i/i(-14))/ii*(-2/3)i/((i/(((i*(8/3)i)/i)/ii))/i) assuming i is positive. i(204/11) Simplify ((n*(-2	{ "pile_set_name": "DM Mathematics" }
a) -6 (b) -5 (c) 3 c Let d = -2.055 + 0.055. What is the nearest to 2/3 in -1, d, -5? -1 Let w(o) = -o. Let z be w(2). Let g = z - 2. Let q = -39/2 - -19. What is the closest to q in g, 1/5, 2/5? 1/5 Let i = 9.06 - 0.06. Let t = 4 - i. Let s = 3/20 + -73/220. What is the nearest to -1/4 in s, t, 1/2? s Let t = 189 - 194. Which is the closest to 2? (a) 43 (b) 2 (c) t b Let b(d) = 13d - 49. Let l be b(4). Let c = -0.1 - -0.1. What is the closest to -0.1 in 4, l, c? c Let d = 0.2359 - 0.0359. What is the closest to 1 in 3/2, -1/5, -1/3, d? 3/2 Suppose 2g = -5 - 5, -5k + 3g = 0. Let x be 1 + (-5 - (2 + k)). Let z be (011/121)/(-1 - 1). Which is the nearest to z? (a) 2/9 (b) 0.3 (c) x a Let c = -237 - -237.5. What is the nearest to 1 in -2, -4, c? c Let m(n) = -n3 + 20n*2 + 20n + 21. Let j be m(21). Which is the nearest to 11? (a) -1 (b) -0.4 (c) j c Let s = 3.6798 + 0.3202. Let j = 89/3 - 30. Which is the closest to j? (a) -5 (b) 5 (c) s c Let l = -49 + 51. Let b = -46 + 45.99. What is the nearest to l in 4/7, b, -0.4? 4/7 Let x = -44.68 - 0.32. Let o = x - -48. Which is the nearest to -1/5? (a) 0.5 (b) -3/4 (c) o b Let z = -1.38 + 88.38. Let w = z - 89. Which is the closest to -2/9? (a) 2 (b) 1/5 (c) w b Let k = 706.01 - 706. Which is the nearest to -3? (a) -3/4 (b) 3/5 (c) k (d) 5 a Let f = -518/9 + 2081/36. Let m = -2 + 3. Which is the nearest to m? (a) 2/7 (b) f (c) 0.3 c Let g = 4.519 - -0.511. Let p = g - 0.03. Which is the nearest to 3? (a) -1/6 (b) p (c) -3 b Let u = 208/3 - 206/3. What is the closest to -0.2 in -0.2, 2, u, -2/11? -0.2 Let n be (14/6)/((-3)/9). Let c = -3 - n. Let f = -1.0054 + 0.0054. What is the closest to -2/5 in 2/5, f, c? f Let o be (-2 - -3)/((-2)/16). Let s = o - -8. Let g = 0 - -0.1. What is the nearest to g in 5, -2/11, s? s Let w = -355 + 354. Let n = 2202 - 6532/3. Let v = 25 - n. Which is the closest to w? (a) -3/4 (b) v (c) 3 a Let g be ((-126)/360)/((-4)/(-42)). Let r = -19/5 - g. Let s = -1 + 0.9. Which is the nearest to r? (a) 0.4 (b) s (c) -2 b Suppose 0 = 2w - 4w + 198. Let f = 98 - w. What is the closest to 0.2 in -0.5, -2/9, f? -2/9 Let m be 17/((-17)/2) + 48/21. What is the nearest to 0 in 50, m, 1? m Let o = -477 + 473. Which is the nearest to -1? (a) -1/4 (b) 1/3 (c) 0.2 (d) o a Let u = 40 - 43. Suppose 4y + 4k - 3k = 8, 5k = -4y + 24. Which is the closest to y? (a) 3 (b) u (c) -1.9 a Suppose -1 = -v - y, 4 = 2v + 4y - 0y. Suppose v = 4f - 2 + 2. Let j = 31/10 + -13/5. What is the nearest to 0 in j, -1/4, f? f Let i = -0.054 - 42.946. Let g = -45 - i. What is the nearest to 0 in g, 0.07, 4/3? 0.07 Let k = -2 + 3. Let q = 0.4 - 0.6. Let u = -1.29 - -1.19. What is the nearest to k in q, u, 1? 1 Let k = 90.795 + 0.205. Let v = k + -91. What is the closest to 0.1 in v, 2, -0.2? v Let x = 8233 - 8233. Let o = -4.95 + -0.05. What is the closest to -2/3 in o, x, 2/5? x Let z = 158 - 208. Let k = z + 49.8. Which is the nearest to -1? (a) k (b) 1 (c) -2/5 c Let o be (-27)/(-18) - 2/(-4). Let k = 11 + -16. Let z = k - -3. What is the closest to 0.1 in -5/3, o, z? -5/3 Let g be 1 + (5/(-2) - -1). Let f be 0/2 - (56/(-546))/(4/(-6)). Which is the nearest to -11? (a) 0.4 (b) g (c) f b Let w = -0.057 - -0.457. Let y = 0.4 + 1.6. What is the closest to 1/4 in y, w, 0.2? 0.2 Let p(c) = 3c*2 + 103c + 129. Let n be p(-33). What is the nearest to 5 in 3, n, 5, -0.1? 5 Let n = 530 + -535. Let v = -3 - -8. Let x = -32 - -35. Which is the closest to n? (a) 2/9 (b) x (c) v a Let f(d) = -45d - 176. Let t be f(-4). What is the closest to -9/4 in 0, t, 0.5, 2/11? 0 Let r = 220.7 + -221. What is the closest to 0.1 in -2, r, -2/7, -1/6? -1/6 Let f be ((-1)/4)/(30/(-48)). Let d = 0.066 - -7.634. Let w = d - 8. Which is the closest to f? (a) w (b) -5 (c) 0 c Let l be (-11)/(-30) - 2/10. Suppose 3f - 21 = 5d, 6f - 4d = 4f + 16. Which is the nearest to 1? (a) -2 (b) l (c) f b Let g = 415.5 + -415. Which is the nearest to -1/4? (a) 1 (b) -2/41 (c) g b Let d = 0.4 + -0.2. Let q = 0.0541 - -0.9459. Which is the nearest to q? (a) -2/5 (b) -6 (c) d c Let x(d) = -d*3 + 7d*2 + 2d - 6. Let s be x(7). Let m be 4/6 + 42/18. Suppose -mi + s = -i. Which is the nearest to -2? (a) i (b) -1/4 (c) -0.4 c Let j = 344 - 343.8. What is the nearest to j in -2, -5, 2/7, 2/3? 2/7 Let o = -3.9 + 1.7. Let m = -2 - o. Let h(v) = 5v + 50. Let d be h(-9). Which is the closest to -0.3? (a) 1/2 (b) m (c) d b Let j = 1117 + -5584/5. Let a = 1.2 + -0.2. Let t = -0.24 - 0.06. What is the nearest to a in j, -2, t? j Let g = -55 + 217/4. Which is the nearest to 0.1? (a) 2/5 (b) -5 (c) 3 (d) g a Suppose -3 = 2t - 11. Let u = -392 - -388. Let v = -0.45 - -0.55. Which is the nearest to v? (a) u (b) t (c) 2/5 c Suppose 0 = 2k + 3k + 135. Let l be 4/(-6)k/(-3). Let q = -2831 - -2833. What is the nearest to l in -0.2, -1, q? -1 Let q = 266 + -264. Which is the closest to 11? (a) -5 (b) q (c) 0 b Let p = 360 + -361. Suppose -4x - 19 - 13 = 0. Which is the nearest to x? (a) 5 (b) p (c) 0 b Let j = -1 - -1. Let p = -10 + j. Let r(g) = g3 - g2. Let t be r(1). What is the nearest to t in p, 2/9, -2/5? 2/9 Let j = -2 + 3. Let y = -1.1 + j. Let i = 169 + -172. What is the nearest to -2/7 in y, i, 0.3? y Let m = 412 - 426. What is the nearest to 0 in m, 3, 2? 2 Let n = -966 + 966.11. What is the closest to n in -5, 3/5, -3/4? 3/5 Let j = -38 - -38.11. Let c = -0.01 + j. What is the closest to -0.8 in -2/3, c, 3? -2/3 Let h = -0.1 + 0.08. Let n = 0.42 + h. Let j = 193 + -195. Which is the closest to -0.2? (a) n (b) j (c) -4 a Let u = 37/203 - -3/29. Let y = -6 + 4. Which is the nearest to 0.1? (a) y (b) -0.1 (c) u c Let i = -0.3 - -0.5. Suppose 0 = 24s - 46s + 110. Which is the closest to 2/7? (a) i (b) s (c) 4 a Let h = 0.8 + -0.4. Suppose -2r - 13 = -q + 70, -2q = -5r - 206. Let y be (-6)/r - 9/(-36). Which is the nearest to y? (a) -3 (b) -1/4 (c) h c Let r = -151.9 - -159. Let f = 2.1 - r. Which is the closest to -1? (a) f (b) -6 (c) -3/4 c Let q be (-40)/12(4/(-8) - 1). Which is the closest to 3? (a) q (b) 2/5 (c) 7 (d) 0 a Let f = 24.03 + -22.5. Let r = -0.13 + f. Let v = r - 1.5. Which is the closest to v? (a) 5 (b) -3 (c) 0.2 c Let b = 532 + -537. Let m be -1(0 + 1/(-3)). What is the closest to 1 in -0.5, m, b? m Let r = 19/5 + -4. Let q = -1.9916 + -0.0084. What is the closest to 0.2 in 0.1, q, r? 0.1 Let x = -101/301 - 4/43. Let y = 0 - 5. Let o be ((-1)/y)/(12/15). What is the nearest to o in x, 0, 4? 0 Let r = 1.9 + -2. Let a = 923/5 + -184. Let q = 0.04 + 0.16. What is the closest to r in 1/7, q, a? 1/7 Let k be (-2 + 100/56)/(72/(-84)). Which is the nearest to k? (a) 0.2 (b) 4 (c) -3/2 a Let v = -1.84 - 0.16. Let s = -2 - -4. Which is the nearest to s? (a) 3/2 (b) 0 (c) v a Suppose 5i + 6 = 16. Let s = 31/54 + 5/54. What is the nearest to -2 in -4, s, i? -4 Let z = -2.98 + 3.48. What is the closest to 0.7 in -1/9, z, -4? z Let s = 8 - 5. Let o be (3/(-4))/(-3) - 1. What is the nearest to 1 in s, -5, o? o Let t = 149 + -161. Which is the closest to -1/2? (a) t (b) -4 (c) 1/4 c Let o(t) = t2 - 10t + 21. Let g be o(6). Let l be (-39)/(-12) + (-1)/4. Let y be (-1)/g + 2/l. Which is the closest to -0.1? (a) 0.1 (b) y (c) 0.2 a Let b = -139 + -12. Let j = 155 + b. What is the nearest to 1 in 1, -5, j? 1 Let t = -2/157 - 292/1727. Let i = 661 - 16523/25. What is the closest to 0.1 in t, 0.05, i? i Let s = -1.328 - -1.628. Let k = -9 - -16. Which is the closest to 0.1? (a) -4 (b) k (c) s c Let d = -0.49 + 0.59. Let n = -161/52 + 13/4. What is the closest to -1 in n, -5, d? d Let o be (-58)/(-208) + 22/(-143). Which is the nearest to -37? (a) o (b) 5 (c) -0.2 c Let f = -179 + 181. Which is the closest to -5? (a) f (b) -2 (c) -0.2 b Let g = -28 - -39. Let y = g + -14. Which is the closest to 1? (a) y (b) -0.2 (c) 4 b Let r = 2.8 - 3. Let a be ((-2)/(-10) - 180/(-75)) + -3. What is the closest to a in r, -3, -2? r Let z = 0.18 + 0.02. Let d = -0.3 - -0.2. Let f = 115.95 - 116. Which is the nearest to d? (a) -1 (b) f (c) z b Let s = 0.3 + -0.3. Suppose 14d - 9d = 0. Let v = -13.2 - -13.3	{ "pile_set_name": "DM Mathematics" }
nutes are there between 11:02 PM and 9:19 AM? 617 What is 466 minutes after 4:55 AM? 12:41 PM How many minutes are there between 3:34 AM and 2:21 PM? 647 How many minutes are there between 8:10 AM and 5:51 PM? 581 What is 672 minutes after 9:15 AM? 8:27 PM What is 111 minutes before 11:03 AM? 9:12 AM What is 628 minutes before 5:46 PM? 7:18 AM How many minutes are there between 9:28 PM and 10:07 PM? 39 What is 371 minutes before 9:45 AM? 3:34 AM What is 142 minutes after 11:47 AM? 2:09 PM What is 576 minutes before 11:40 PM? 2:04 PM How many minutes are there between 6:04 PM and 8:25 PM? 141 How many minutes are there between 2:31 AM and 2:19 PM? 708 What is 149 minutes before 5:20 AM? 2:51 AM How many minutes are there between 1:53 PM and 6:57 PM? 304 How many minutes are there between 5:51 PM and 9:49 PM? 238 What is 20 minutes before 11:27 AM? 11:07 AM How many minutes are there between 4:37 PM and 12:30 AM? 473 What is 253 minutes before 3:26 PM? 11:13 AM How many minutes are there between 12:07 PM and 10:23 PM? 616 How many minutes are there between 10:22 AM and 10:10 PM? 708 How many minutes are there between 10:13 PM and 4:58 AM? 405 What is 148 minutes after 10:29 PM? 12:57 AM What is 265 minutes after 1:26 PM? 5:51 PM What is 289 minutes before 8:47 AM? 3:58 AM What is 481 minutes after 7:58 AM? 3:59 PM What is 137 minutes after 10:27 PM? 12:44 AM How many minutes are there between 12:08 PM and 4:21 PM? 253 What is 406 minutes after 12:33 AM? 7:19 AM How many minutes are there between 11:24 AM and 10:36 PM? 672 What is 453 minutes after 12:12 PM? 7:45 PM What is 56 minutes before 1:10 PM? 12:14 PM How many minutes are there between 8:56 PM and 3:56 AM? 420 How many minutes are there between 3:06 AM and 5:07 AM? 121 How many minutes are there between 6:18 AM and 10:13 AM? 235 What is 148 minutes after 9:12 PM? 11:40 PM What is 166 minutes before 2:01 PM? 11:15 AM What is 530 minutes before 2:41 PM? 5:51 AM How many minutes are there between 12:31 PM and 12:20 AM? 709 What is 549 minutes before 8:46 AM? 11:37 PM What is 444 minutes before 6:14 PM? 10:50 AM What is 145 minutes before 7:38 PM? 5:13 PM What is 191 minutes before 3:29 PM? 12:18 PM How many minutes are there between 4:18 AM and 3:49 PM? 691 What is 697 minutes before 8:16 PM? 8:39 AM How many minutes are there between 12:44 AM and 9:51 AM? 547 How many minutes are there between 10:42 PM and 6:55 AM? 493 How many minutes are there between 1:02 AM and 3:58 AM? 176 What is 423 minutes after 11:28 AM? 6:31 PM How many minutes are there between 11:36 AM and 1:36 PM? 120 What is 532 minutes before 6:15 AM? 9:23 PM How many minutes are there between 10:25 AM and 5:10 PM? 405 How many minutes are there between 12:08 AM and 2:54 AM? 166 How many minutes are there between 1:21 AM and 4:32 AM? 191 What is 38 minutes after 7:16 PM? 7:54 PM How many minutes are there between 1:43 AM and 11:32 AM? 589 What is 360 minutes after 11:34 PM? 5:34 AM How many minutes are there between 10:47 AM and 12:30 PM? 103 How many minutes are there between 3:00 PM and 3:59 PM? 59 What is 708 minutes after 6:54 AM? 6:42 PM What is 528 minutes after 5:50 PM? 2:38 AM How many minutes are there between 9:38 PM and 11:29 PM? 111 What is 130 minutes after 6:01 PM? 8:11 PM How many minutes are there between 5:05 AM and 11:39 AM? 394 What is 530 minutes before 2:57 PM? 6:07 AM What is 636 minutes before 10:35 AM? 11:59 PM How many minutes are there between 5:40 AM and 6:49 AM? 69 What is 355 minutes before 3:11 AM? 9:16 PM How many minutes are there between 3:11 PM and 6:38 PM? 207 What is 491 minutes before 10:30 AM? 2:19 AM How many minutes are there between 4:17 PM and 8:42 PM? 265 How many minutes are there between 12:00 PM and 2:00 PM? 120 What is 292 minutes after 4:21 AM? 9:13 AM How many minutes are there between 12:09 AM and 10:05 AM? 596 How many minutes are there between 5:49 PM and 7:52 PM? 123 What is 669 minutes before 5:49 AM? 6:40 PM What is 423 minutes before 11:19 PM? 4:16 PM What is 628 minutes after 9:07 AM? 7:35 PM What is 482 minutes before 2:42 PM? 6:40 AM What is 503 minutes before 9:34 AM? 1:11 AM What is 166 minutes before 6:58 PM? 4:12 PM What is 588 minutes after 5:36 PM? 3:24 AM What is 524 minutes after 10:44 AM? 7:28 PM How many minutes are there between 3:37 PM and 4:19 PM? 42 How many minutes are there between 3:23 PM and 9:08 PM? 345 How many minutes are there between 5:22 PM and 7:05 PM? 103 How many minutes are there between 4:31 PM and 6:50 PM? 139 What is 367 minutes before 1:27 AM? 7:20 PM What is 255 minutes after 6:19 PM? 10:34 PM What is 249 minutes before 1:30 PM? 9:21 AM What is 11 minutes after 5:45 PM? 5:56 PM How many minutes are there between 2:41 PM and 4:57 PM? 136 What is 675 minutes before 3:58 AM? 4:43 PM What is 253 minutes after 10:46 PM? 2:59 AM What is 679 minutes after 4:48 PM? 4:07 AM What is 584 minutes after 1:26 AM? 11:10 AM What is 89 minutes before 5:33 AM? 4:04 AM How many minutes are there between 10:59 AM and 11:10 AM? 11 What is 502 minutes before 6:13 PM? 9:51 AM How many minutes are there between 7:02 AM and 6:49 PM? 707 What is 289 minutes before 4:10 PM? 11:21 AM How many minutes are there between 11:37 PM and 6:33 AM? 416 What is 588 minutes before 5:10 AM? 7:22 PM How many minutes are there between 7:33 PM and 1:27 AM? 354 What is 195 minutes before 6:38 AM? 3:23 AM What is 250 minutes before 10:27 PM? 6:17 PM How many minutes are there between 3:23 AM and 4:19 AM? 56 How many minutes are there between 12:49 PM and 3:25 PM? 156 How many minutes are there between 6:28 PM and 9:14 PM? 166 What is 11 minutes after 1:11 AM? 1:22 AM What is 144 minutes after 6:00 AM? 8:24 AM How many minutes are there between 6:01 PM and 11:22 PM? 321 How many minutes are there between 1:28 AM and 11:51 AM? 623 How many minutes are there between 1:22 AM and 10:12 AM? 530 What is 60 minutes before 6:51 PM? 5:51 PM What is 399 minutes before 3:30 PM? 8:51 AM How many minutes are there between 3:55 AM and 6:17 AM? 142 What is 670 minutes after 4:29 PM? 3:39 AM What is 117 minutes before 4:57 AM? 3:00 AM How many minutes are there between 11:40 PM and 7:56 AM? 496 How many minutes are there between 3:46 AM and 5:36 AM? 110 How many minutes are there between 12:52 PM and 7:53 PM? 421 How many minutes are there between 8:09 AM and 4:36 PM? 507 How many minutes are there between 1:51 PM and 4:43 PM? 172 How many minutes are there between 9:03 AM and 1:42 PM? 279 What is 707 minutes after 12:46 PM? 12:33 AM How many minutes are there between 7:03 PM and 11:42 PM? 279 How many minutes are there between 11:28 PM and 3:41 AM? 253 What is 679 minutes before 4:17 PM? 4:58 AM What is 59 minutes after 9:30 PM? 10:29 PM What is 501 minutes before 4:07 AM? 7:46 PM How many minutes are there between 7:17 AM and 8:09 AM? 52 What is 82 minutes before 10:10 PM? 8:48 PM How many minutes are there between 8:32 AM and 12:58 PM? 266 What is 680 minutes before 9:09 PM? 9:49 AM How many minutes are there between 7:22 AM and 4:46 PM? 564 What is 324 minutes before 8:59 AM? 3:35 AM What is 156 minutes before 5:07 PM? 2:31 PM How many minutes are there between 3:01 PM and 10:44 PM? 463 What is 44 minutes before 12:11 PM? 11:27 AM How many minutes are there between 2:51 AM and 5:42 AM? 171 How many minutes are there between 10:11 PM and 3:48 AM? 337 What is 473 minutes after 9:31 PM? 5:24 AM What is 481 minutes before 10:26 PM? 2:25 PM How many minutes are there between 1:46 AM and 7:57 AM? 371 What is 91 minutes before 7:52 PM? 6:21 PM What is 374 minutes before 10:13 AM? 3:59 AM How many minutes are there between 11:41 AM and 5:53 PM? 372 What is 572 minutes after 7:19 AM? 4:51 PM How many minutes are there between 12:48 AM and 7:32 AM? 404 What is 27 minutes after 12:09 AM? 12:36 AM How many minutes are there between 8:00 PM and 9:09 PM? 69 How many minutes are there between 9:38 AM and 10:29 AM? 51 What is 137 minutes after 7:46 PM? 10:03 PM How many minutes are there between 4:58 PM and 10:02 PM? 304 What is 277 minutes before 8:10 PM? 3:33 PM How many minutes are there between 8:59 PM and 2:53 AM? 354 How many minutes are there between 12:32 AM and 8:54 AM? 502 What is 564 minutes	{ "pile_set_name": "DM Mathematics" }
4238 + 4233 - 12705 - 10k + 4220. Calculate o(-18). 166 Let g be (-6)/(-24)(-81 + 10) - 3/(-4). Let t(d) = -2d3 - 37d*2 - 49d + 30. Determine t(g). -4 Let u(n) be the second derivative of -n6/120 + n5/20 + n*4/4 + 2n*3/3 - 67n*2/2 - 22n. Let l(d) be the first derivative of u(d). What is l(5)? -16 Let l(v) = 3v - 1. Suppose -6y = -139 + 25. Suppose -y = -3q + 5n + 15, -5n - 25 = 0. Suppose 12p - 9p - q = 0. What is l(p)? 2 Let x(n) = n3 - n2 + n + 1. Let b be 3/((-1)/(8 - -63)). Let s = b + 213. Calculate x(s). 1 Let n(r) = 115r + 6. Let a be n(0). Let l(p) = p*2 + 8p - 5. Let x(o) = 6o2 + 39o - 26. Let t(f) = -11l(f) + 2x(f). Give t(a). -21 Let f(m) be the third derivative of m4/24 - m3/6 - 3m2. Suppose 86 + 19 = 7o. Suppose 147 = 6b + ob. Determine f(b). 6 Suppose -46 = 6h + 51h - 958. Let v(b) = b*2 - 16b + 13. Calculate v(h). 13 Let i(h) = -8h + 45. Let x be (0 + -3)17/((-85)/10). Calculate i(x). -3 Let p(i) be the third derivative of 2i4/3 + 2i*3/3 - 34i*2 - 10. Give p(2). 36 Let i(u) = -1991u + 684. Let a(q) = 706q - 228. Let m(b) = -17a(b) - 6i(b). Calculate m(-4). -4 Let r(v) = -v3 - 11v*2 + v + 3. Let l(j) = 6j*3 + 55j*2 - 6j - 14. Let a(s) = 2l(s) + 11r(s). Let t = -78 - -89. Give a(t). -6 Suppose -4x + 3o = 15, 0 = 69x - 65x + 3o + 9. Let a(s) = 7s*2 - 7s - 29. What is a(x)? 55 Let c(a) = -a*2 + 4. Let r be c(0). Suppose 2 + r = d. Let g(b) = 4 - 3b + b + 2 + 4 - 4. What is g(d)? -6 Let c = 2423 + -2424. Let b(k) = 2k - 1. What is b(c)? -3 Let y(k) = k3 - k2 + 4k. Let f = 2937 + -2934. What is y(f)? 30 Let k(y) be the third derivative of 0 + 0y + 5/12y*4 + 1/60y*5 - 3/2y*3 - 70y*2. Calculate k(-11). 2 Let z(t) = -2t + 13. Suppose -3l + 23 = -1. Let f(s) = 5s - 37. Let v(h) = lz(h) + 3f(h). Calculate v(-4). -3 Let a = 0 - 4. Let p be 309/21 - 4 - 2/(-7). Let z(s) = -ps + 2s + 2 + 5s. What is z(a)? 18 Let c(t) be the third derivative of t5/60 - 3t*4/8 + 5t*3/3 + 6t*2. Let y(p) = 3p*2 - p - 3. Let u be y(2). Suppose -45 = -ul + 4. Give c(l). -4 Let j(h) = h*3 + 15h*2 + 55h - 4. Let u(g) = g*3 - 47g*2 - 375g + 12. Let n be u(-7). Calculate j(n). -13 Let i(z) = z*3 - 9z*2 - 25z + 274. Let x be i(7). Let a(n) = -17n + 19. Calculate a(x). 2 Let l(a) = 3a*2 - 2a - 118480 + 118478 - 2a2. Give l(-3). 13 Let c(s) be the second derivative of s4/12 + s3/3 - 7s*2/2 - 936s. Determine c(-7). 28 Let m(y) = y + 11. Let k = -10181 - -10173. What is m(k)? 3 Let y(m) = -11m + 692. Let j be y(62). Let o(z) = -z2 + 9z + 3. Give o(j). -7 Let w(v) be the third derivative of v*5/60 - 19v*4/24 + 7v*3/3 - 2136v*2. What is w(19)? 14 Let w(v) = v + 4. Let t be w(-3). Let k = -113 + 137. Let o(m) = 25m - 7 - km + 6. Give o(t). 0 Let m(f) = 67f*3 + 3f*2 + f - 1. Let w be 5/(-20)200/50. Give m(w). -66 Let i be (-3)/90-3 + (-1617)/770. Let w(k) be the first derivative of -4k3/3 + k2/2 + k - 4. Determine w(i). -17 Let f(c) be the first derivative of 54c2 - 8c - 6987. What is f(0)? -8 Suppose 0 = j - 49 + 51. Let o(n) = 3225n + 0 + 3 - 3216n. Determine o(j). -15 Let x(j) = -5j2 + 2j. Let v(b) = 51b2 - 21b. Let z(d) = -2v(d) - 21x(d). Let h(l) = 2l + 24. Let a be h(-13). Give z(a). 12 Let k(f) = 3f*2 + 9f - 17. Let i(w) = -w*2 - 3w + 6. Let q(x) = -2x2 + 4x - 7. Let r be q(2). Let n(l) = ri(l) - 2k(l). Calculate n(-6). 10 Let d(a) = 2006 - 5a2 - a3 + 4a2 - a2 - 2008 + 2a. Let r = -78 - -75. Give d(r). 1 Let m be ((-32)/6)/(64/(-12) + 6). Let g(p) = 2p - 12. What is g(m)? -28 Suppose -160 - 106 = 19w. Let y(c) = -4 - c - 1 - 2 - 3. Determine y(w). 4 Let s(x) = -5x - 3. Let m = -2896 + 2899. Give s(m). -18 Suppose -2j + 14i - 40 = 10i, -5j - 4i = -26. Let u(c) = c3 + 1 + 3c*2 + 3c + 1 + 1. Calculate u(j). 1 Let z(p) = -2 + 5p2 - 4p*2 + 4 - 10p. Suppose 21i = 213 + 18. Determine z(i). 13 Let l(g) = -37g + 8g - 26 + 23g + 3g. What is l(4)? -38 Suppose 0 = 2s + s - 15. Suppose -5d + 4y + 3540 = 0, -2d + 0d + sy = -1433. Let x(w) = -7w - 704 + d. What is x(2)? -14 Let r = -13 + 17. Suppose -4v + rv = -2v. Let c(p) = p - 4p + 5p - 5 - p. Determine c(v). -5 Let a(x) be the first derivative of -3x*2/2 - 6x + 539. Determine a(-4). 6 Suppose 3q - 4 - 20 = 0. Let p(h) be the second derivative of h3/6 - h2 - 27h - 3. Give p(q). 6 Let a(g) = -g - 1. Let v(f) = -2. Let k(n) = 2a(n) - 3v(n). Suppose 85 = 2s + 3s - 5r, 2r = -4s + 56. Suppose 4z = 1 + s. Determine k(z). -4 Let h(g) = g*3 + 3g*2 - 12g + 1. Let b(m) = 2m3 - 44m*2 - 43m - 75. Let k be b(23). Give h(k). -35 Let c be (-2)/((-8)/(-22))2. Let u = 13 + c. Let o(w) = 5w3 - w2 - 1211w - w2 - 4w*3 + 1210w + 2 - 4. Give o(u). -4 Let v be 14/(-4)112/(-5 - 2). Let m be v/4215/2. Let x(g) = g*2 - 14g + 7. What is x(m)? -33 Suppose -4d + 5x - 1 + 6 = 0, 2x = -5d + 31. Let q(z) = -7z2 - 10z + 23z3 - d + 12z*3 - 34z*3. Give q(8). -21 Suppose 3d - 2 = -2m + d, 4d + 41 = 5m. Let c(q) = 4q - 6. Let l(t) = 5t - 6. Let h = -31 + 29. Let k(g) = hl(g) + 3c(g). What is k(m)? 4 Let z(f) = f3 + 11f*2 - 29f - 12. Suppose 66y - 24y - 35y + 91 = 0. Give z(y). 27 Let s(g) = g3 + 7g*2 - 7g + 3. Let i(y) = -3y2 - 65y + 42. Let v be i(-22). Suppose c + vc + 168 = 0. What is s(c)? -5 Let r be 20/4 - 21/7. Let z(l) = 6l*2 - 10l*2 - 4l + 3lr. Give z(-2). 4 Suppose n + 2r = 8040, -17856 - 6272 = -3n - 4r. Let x(h) = -3h - 8058 + 2h + n. Determine x(-5). -5 Let i(a) = -139a2 + 59a + 112. Let c(r) = -56r2 + 29r + 56. Let p(x) = 5c(x) - 2i(x). Calculate p(15). 11 Let p(a) = -a*2 - a - 1. Let u(f) = -4f*2 + 3f - 4. Let h(q) = -3p(q) + u(q). Let n(t) = -t3 - 50t*2 + 340t + 231. Let s be n(-56). Give h(s). -8 Let q(p) = p*2 - p - 11. Suppose -13x - 18 - 14 = 7. What is q(x)? 1 Let u be 1 + -1 - (-3 - -3). Let s(l) = -l*3 - 7l*2 + 4l + 4. Let h(f) = -f*3 - 9f*2 + 5f + 3. Let x(r) = 3h(r) - 4s(r). Calculate x(u). -7 Let t(i) = i + 5. Let m be t(-2). Suppose 0 = 11n - 2n. Suppose 7 = -mg + 2x - 6x, -5x - 5 = n. Let y(p) = 3p2 + 2p + 1. Give y(g). 2 Suppose 42 = -23o + 30o. Suppose -27g - o = -28g. Let a(m) be the second derivative of m*4/12 - 7m*3/6 + 9m2/2 + m. Calculate a(g). 3 Let w(a) = -a3 - 7a2 - 5a. Suppose 13 = -2y - 9g, 2g - 13 = 5y + 5g. Give w(y). -10 Let h(a) = a3 + a2 + a + 67. Suppose -11w = 13w - w. Give h(w). 67 Let v(i) be the second derivative of -i3 + i2/2 + 3i - 20. Suppose -478 + 370 = -12r. Give v(r). -53 Suppose 0 = -t - t - 4t. Let j(f) be the first derivative of f*2/2 + 31f + 749. Calculate j(t). 31 Let g(y) = 2y2 - 4y - 22. Let b(p) = 11p2 - 26p - 109. Let a(l) = 3b(l) - 16g(l). Calculate a(12). 1 Suppose 6r + 1547 = 13r. Let z = r + -226. Let s(x) = -x - 8. Determine s(z). -3 Let o(w) = 54w + 55. Let y(d) = -31. Let i(t) = o(t) + 2y(t). What is i(0)? -7 Let c(a) = -a*2 + 3a. Suppose -w + 0w + 2f = 36, 2w - 5f + 73 = 0. Let g = w + 36. Let i(p) = p*2 - 3p + 5. Let b be i(g). Determine c(b). 0 Suppose 42 - 116 = -q. Let m = q + -56. Let d(j) = -mj - 15j + 32j. Calculate d(-4). 4 Suppose -10 = 8c - 58. Let i(d) = -9 - 11d2 + c + d - 10d + 6 - d*3. What is i(-10)? -7 Suppose 2v - 50 + 7 = 3i, 4i + 50 = -v. Let y(d) = -17d - 41. Let c(t) = -8t - 19. Let f(w) = ic(w) + 6y(w). Calculate f(-4). -7 Let l(c) be the second derivative of c*4/12 - 3c*3 - 9c*2/2 - 36c - 3. Calculate l(13). -74 Let o(b) = -3b2 + 3b - 2. Let j be ((-156)/16)/3 - 31/(-124). What is o(j)? -38 Suppose 4v - 14 = -0q + 3q, 20 = 4v. Let l(g) = 3554g - 1717g - 1842g + 2. What is l(q)? -8 Suppose -7y - 5y = -24. Let f(v) = yv + 0v3 + 5 + 0v - v + 3v2 - v3 + v2. Calculate f(5). -15 Let z = -28611 + 28615. Let x(o) = -2o*2 + 4o + 5. What is x(z)? -11 Let m = 2 - 1. Let r(d) = d*2 - 44d + 160. Let s be r(40). Let v(g) = 3g - 5g + sg + g - 1. Give v(m). -2 Let d(m) = -m3 - 15m*2 + 33m - 19. Let q be -20 + ((-3)/(-6))/(5/30). Give d(q). -2 Let a(x) be the third derivative of 5x4/12 + 3	{ "pile_set_name": "DM Mathematics" }
4r = -n - x for n. 1 Suppose 2m - 4 = -2x + 5m, -2m + 8 = 0. Suppose 4w + 5c = -0c - x, 2w = -c + 2. Solve -3d + 12 = 0, 10 + 8 = -2t + wd for t. -3 Let s(i) = 7i + 5i - 14i - 19. Let j be s(-11). Solve 3l - 2h = 2l + j, 0 = -5h + 5 for l. 5 Let s be 22 + (2 - 3)2. Let o(t) = -t*2 - 3t + 1. Let j be o(-5). Let d = -4 - j. Solve 0c = 5c + 20, -dc - s = -f for f. 0 Let z = 34 - 25. Suppose 3l - 6 = z. Suppose -l = -2g + 3. Solve 5k - gb + 8b = -31, 3k + 3b + 21 = 0 for k. -3 Suppose 0 = 13p - 8p - 90. Suppose -14x + px - 52 = 0. Solve 0 = 3o + 2v - v + x, 3o - 3v - 3 = 0 for o. -3 Suppose 0 = 3s - 5y - 22, -2y + 28 = 5s - 6y. Let v be s/(-4) - (-1)/1. Suppose 3n - 15 + 0 = v. Solve na = -15, 0a - 5a = 5p + 10 for p. 1 Let o be ((1 - 0) + 2)/1. Let y(h) = 11h + 16. Let l(k) = -5k - 7. Let s(x) = -7l(x) - 3y(x). Let u be s(7). Solve u = 3j + og, 0j + 3 = 2j - 5g for j. 4 Let r(j) = -j3 - 2j*2 - 2j - 1. Let z be r(-2). Suppose zk + 15 = -24. Let x be (-63)/k + (-4)/(-26). Solve 2t - 19 = 2y + 3y, y - x = -4t for t. 2 Let a(r) = 2r*2 + 17r - 7. Let i be a(-9). Suppose 2g = -5m + 7 + 2, -5g + 4m + 6 = 0. Solve c = ic + 4k - 2, -gc - k = 3 for c. -2 Suppose -5y = -9y. Solve 3n = l - 11, yl + l - 7 = 2n for n. -4 Suppose -7 = -4d - 3s, -6s + 9s - 6 = -3d. Solve -n = 5m, -4n + 5m + 26 = d for n. 5 Suppose 0 = -4a - 5g + 41, -3a + 2a + 29 = 5g. Let y(o) = -81o + 731. Let r be y(9). Solve au = rd + 14, 0 = -d + 4d - 9 for u. 5 Suppose -3v + 5 = -2u, -v - 2u - u = -9. Let c be 2/6(38 + 1/1). Suppose 3w - w = 8. Solve -h + c = wb, 2b = -h + vh + 4 for h. 1 Let h be (2 - 2)/(-4) - (-6 + 2). Let d(y) = 2y*2 + 5y - 42. Let z be d(h). Solve -3m = 2m - z, -u = -m - 2 for u. 4 Let c(n) = n*2 + 21n + 3. Let f be c(-21). Let m be (-4)/5(-20)/8. Solve -2d + fd = mt - 13, -2d = 10 for t. 4 Let w be (50/60)/(1/6). Let k = -30 + 21. Let c = 12 + k. Solve 3g = -wf - 5, f - 4f - g = c for f. -1 Suppose 16 = 4u - 2u. Suppose -um = -12m. Suppose -4z + 3z + 16 = 3p, 0 = 2p - 4z - 6. Solve -pi - 11 = 3l - ml, l - 7 = i for l. 3 Suppose -r = 3t + 6, 2r - t = -3t - 4. Solve -2l + 2i = -l - 6, r = -2i - 8 for l. -2 Suppose 0p + 154 = 22p. Solve -p = -2n + 3, -5n = -5z for z. 5 Suppose v - 2o = -v + 8, 0 = 5v + 4o - 29. Let k = 27 + -27. Solve -3j + vh + 20 + 0 = k, j + 2h + 8 = 0 for j. 0 Suppose t + 5 = 2t. Suppose tu = 8u. Suppose 4q - 25 + 1 = u. Solve -5w - 5j = 30, -qw + 5j = -w - 20 for w. -1 Suppose -2b - 10 = 10. Let k be (-1 - 0)/3 + b/(-3). Suppose j - 2v + 7 = 3v, 0 = -2j + 3v + 7. Solve 2q = -3s + 17, -kq - 2q + j = -4s for s. 3 Suppose -4g + 5 = g, -5g + 9 = i. Suppose 3n - 2x = 2x + 35, 2n = -ix - 10. Solve 3v - 4o + 24 = -0o, nv + 5o + 5 = 0 for v. -4 Suppose 5g - 23 = -2r, 5r - 15 = -3g + 14. Solve rq - 2q + 5v + 9 = 0, 4v = -4 for q. -2 Let w be 70/30 + (-18)/(-27). Solve 3u - 12 = -wb - 0b, 2b - 10 = 0 for u. -1 Let t be 2(162/4)/9. Solve -4r + y = 2y + 1, -4r + y + t = 0 for r. 1 Let h(v) = 3v*2 - 99v + 112. Let p be h(32). Solve 0 = -2j + 2a - p, a + 1 + 1 = -j for j. -5 Let q(b) = 3b2 - 52b + 17. Let w be q(17). Solve -2u - 2u = -3j + 2, u + 2j - 5 = w for u. 1 Suppose -4p = -t - t + 54, -5t - 4p + 163 = 0. Suppose -13q + 21 = -t. Solve 0w = -qd + 2w + 4, -3d = 5w - 3 for d. 1 Suppose -21 = -2j + 4v - 83, -5j = 5v + 185. Let w = j + 45. Solve -5d + 3s = 2s + w, -2d + 3s - 4 = 0 for d. -2 Suppose 0 = -3l + 12, -4v + 0v = -2l - 24. Solve n = 3a - 7, 2a = 6a - v for n. -1 Let c = 0 - -2. Let h(y) = 6y + 13. Let w be h(-7). Let m be (-6)/15(w + -1). Solve -3b - 4o = -m, 0 = -2o - co for b. 4 Let o = 372 + -367. Solve 21 - 6 = -om - 5a, -3m + 3a - 15 = 0 for m. -4 Let d(p) = 16p - 1. Suppose o = 4a - 11, 5o + 2a + a = 14. Let x be d(o). Suppose -2k = -57 + x. Solve 5u + 0i - 22 = 2i, -5i - k = -4u for u. 4 Let m(f) = f3 + 7f*2 - 5f + 32. Let g be m(-8). Solve -h + 10 = -2y, 3y + 9h + g = 7h for y. -4 Suppose 6i - 382 = 44. Let u = i + -69. Solve 0 = -ud - 2y + 6y + 2, -25 = 2d + 5y for d. -5 Let u be (-2 - -2) + 11 + -7. Let g(i) = 2i2 - 2i. Let k be g(u). Solve q + 0s = 2s - 12, -3s + k = -3q for q. -4 Let h be 60/50(-1 - 4). Let f be ((-12)/(-15))/(h/(-75)). Suppose 5i = 3l, 0 = 4l + 5i - fi. Solve 0 = -2m - 3j - 16, -3m - 5j - 26 = -lj for m. -2 Let x be ((-145)/(-40) - (-3)/8)1. Solve -2s - xc = -4s + 4, -4s = -2c + 4 for s. -2 Let l(k) = -k3 + 9k*2 - 13k + 20. Let a be l(8). Let j be (a/(-8))/(15/36). Solve 3d - 2 = jd + 2n, 5d + 5n + 5 = 0 for d. 0 Suppose -6i + 10 = -i. Solve 0k = h + 4k + 2, ik - 6 = 3h for h. -2 Let l = -21 + 5. Let b = -13 - l. Solve -v - 10 = -4a, -3a - bv - 14 = -7a for a. 2 Let f = 116 - 164. Let w = f - -53. Solve -3n + wo = -0 + 10, -4n + 4o = 0 for n. 5 Let h be (-2)/(-6) + (-15)/(-9). Suppose hu + 16 = 4u. Let b = 20 - u. Solve b = -7j + 2j - g, -5j - 4g = 3 for j. -3 Let p be (1/2 - 1)-2 - -3. Suppose 0 = 3q - pu - 52, q + 0u = -4u + 28. Solve -4j + 0j = -q, 3n - 4 = j for n. 3 Let p be (42/(-12))/((-1)/(-2 - -4)). Solve 2m + 9 = -3j, j - 2 = 8m - pm for j. -1 Let h = -205 - -300. Suppose -5k + h = -i, -2k + 7 + 31 = -5i. Solve -3d = 5u - 1, k = -4d - d + 2u for d. -3 Suppose 2m - 5u = -m + 62, 0 = m + 2u - 17. Suppose 4 - m = -b - 3k, 2k - 23 = -5b. Suppose 6p - bp = 0. Solve 3f - 6 = 2y - py, 0 = -5f for y. -3 Let g(r) = r3 - r2 - r + 2. Let d be g(2). Suppose 1 = da - 7. Suppose -3k - 7 = -3q - ak, 2q = k + 3. Solve 20 = qv, -2 = -5y + v + 8 for y. 3 Let s(c) = -2c3 - 34c*2 + 37c + 21. Let y be s(-18). Solve 5b = a + b + 9, -12 = -a - yb for a. 3 Let g(v) = -v + 15. Let b be g(-7). Let i = 25 - b. Solve 0 = ia - 2a + 5r, 5r = -5a for a. 0 Let d(l) = -l2 + 12l - 9. Let t be d(11). Let o = 23 + -13. Let j = o - t. Solve -4s = -4w + j, -w + 28 = -5w - 5s for w. -2 Suppose -2l + 0l + 12 = 0. Suppose -4m = -7m + l. Solve -j = -4w + 7, m - 9 = -3j - 2w for j. 1 Suppose -127h + 2 = -125h. Solve 0 = -2d + d + 1, -v = -3d - h for v. 4 Let n = 16 - 14. Suppose 5z = 3x - n - 8, 3x = -4z + 19. Solve -5m - 7 = 2i, -z + 2 = -4i + 3m for i. -1 Let j(l) be the first derivative of -l4/4 - l3 + l2 - 5l - 3. Suppose -12f + 12 = 60. Let d be j(f). Solve -dz - 2z + 50 = 5g, -2g = -10 for z. 5 Suppose 27t = 24t + 24. Solve -3v - h - t = 0, -5h = -2v - 0v + 6 for v. -2 Let v be -4 + 335/50 + 3/10. Solve -5u + 16 = -40g + 41g, -vg - 8 = u for u. 4 Suppose 25 = -5f + 5g, -5g + 1 = -3f - 24. Solve 5p + 4z + 7 = 0, p + f = -4z + 5 for p. -3 Let f = 7 + -19. Let l(c) be the second derivative of c*3/6 + 7c*2 + c. Let h be l(f). Solve -5i - 2 - 2 = -4u, 0 = -hu + 2i for u. -4 Let o(l) = l3 + 8l*2 + 6l - 4. Let a be o(-7). Let f = a + 29. Let b = -18 + f. Solve 0 = -3y + 2j - 12, -j - 3j = -y - b for y. -2 Let s(v) = 3v - 23. Let f(x) = -x + 6. Let o be f(-3). Let l be s(o). Solve -2d + 15 - 5 = 5c, -lc = -d + 5 for d. 5 Let m = -26 + 25. Let k be 1/(m/12-3). Solve kv - 9 = -3j + 14, 4v - 21 = -j for j. 1 Let z(y) = -y2 + 10y - 7. Let l be z(9). Let b be (-80)/(-3) + (-1)/(-3). Solve 5k = -ld - b, 4k - 2d + 8 = -10 for k. -5 Let l be -2 - (1 - 3)(1 - 0). Solve -s - 3g = -ls - 15, 5s = -2g + 23 for s. 3 Let i be 74/14 + (-15)/((-840)/(-16)). Solve -4g + 8 = -4r, 0r - i = -4g + r for g. 1 Suppose 40z - 140 = 30z. Solve -d = y + 3 - 5, 0 = -3y + d + z for y. 4 Let z be ((-4)/(-38))/((-20)/(-380)). Solve -j + 4r + 17 = 0, -3j + 2r = -zj - 9 for j. 1 Let y = -61 - -52. Let n be (-16)/((-3)/y - 1). Solve 5c + n = -x, -4c + c = x + 14 for x. 1 Suppose -2l + 22 = j, j + 55 = 5l - 2j. Solve 2v - 3o - l - 4 = 0, -2v - 2o - 10 = 0 for v. 0 Suppose 0 = -19t + 17t. Solve q + 6 = 2n, 5 = n - tn for q. 4 Let c = -32 - -12. Let j = -20 - c. Suppose 8 = -jb + b - 3p, b = -4p - 6. Solve -2m + 2 = l + bl, 0 = 2l + 4m + 12 for l. 4 Let x be (-2)/(-6) + (-1)/3. Solve -3p - 5q	{ "pile_set_name": "DM Mathematics" }
r*2 - 105r - 63 What is the w'th term of -427, -593, -861, -1225, -1679? w*3 - 57w*2 - 2w - 369 What is the i'th term of 69, 151, 245, 351, 469, 599, 741? 6i2 + 64i - 1 What is the x'th term of 111039, 222078, 333117? 111039x What is the a'th term of 571, 1169, 1767? 598a - 27 What is the c'th term of 86, -19, -506, -1567, -3394, -6179? -32c3 + c2 + 116c + 1 What is the o'th term of -1676, -6929, -15756, -28157, -44132, -63681, -86804? -1787o2 + 108o + 3 What is the n'th term of -57670, -57686, -57702, -57718, -57734, -57750? -16n - 57654 What is the n'th term of -302455, -604909, -907363, -1209817? -302454n - 1 What is the k'th term of 12544, 25104, 37666, 50230? k*2 + 12557k - 14 What is the h'th term of -312, -453, -696, -1047, -1512? -h*3 - 45h*2 + h - 267 What is the z'th term of -70190, -140371, -210552, -280733, -350914, -421095? -70181z - 9 What is the z'th term of 80, 276, 616, 1100, 1728, 2500, 3416? 72z2 - 20z + 28 What is the g'th term of 63, 308, 913, 2058, 3923, 6688, 10533? 30g3 + 35g - 2 What is the k'th term of 1515, 3076, 4637, 6198? 1561k - 46 What is the o'th term of -1434, -2900, -4366, -5832, -7298, -8764? -1466o + 32 What is the z'th term of 198, 1016, 2380, 4290, 6746? 273z2 - z - 74 What is the o'th term of 19, 45, 93, 157, 231, 309, 385? -o3 + 17o*2 - 18o + 21 What is the o'th term of -41, -196, -567, -1262, -2389, -4056, -6371? -18o3 - 29o + 6 What is the w'th term of 66, 150, 222, 282, 330, 366? -6w2 + 102w - 30 What is the u'th term of -576, -703, -830, -957? -127u - 449 What is the x'th term of -11046, -22065, -33072, -44067, -55050, -66021, -76980? 6x*2 - 11037x - 15 What is the m'th term of -120, -425, -730, -1035? -305m + 185 What is the a'th term of 278, 1029, 2082, 3275, 4446, 5433, 6074? -27a*3 + 313a*2 + a - 9 What is the f'th term of 9110, 9114, 9118, 9122? 4f + 9106 What is the v'th term of -4783, -4781, -4779, -4777, -4775, -4773? 2v - 4785 What is the v'th term of -21, -122, -377, -864, -1661, -2846? -13v3 + v2 - 13v + 4 What is the k'th term of 412, 804, 1854, 3886, 7224, 12192? 54k*3 + 5k2 - k + 354 What is the n'th term of -2264, -2148, -2034, -1922, -1812, -1704? -n2 + 119n - 2382 What is the g'th term of 15, 205, 697, 1641, 3187, 5485? 25g3 + g2 + 12g - 23 What is the z'th term of 818, 3987, 9260, 16631, 26094? -z3 + 1058z*2 + 2z - 241 What is the g'th term of 596, 614, 644, 686, 740, 806, 884? 6g2 + 590 What is the z'th term of 7593, 15186, 22779? 7593z What is the v'th term of 7291, 29286, 65987, 117394? 7353v2 - 64v + 2 What is the c'th term of 169254, 338361, 507478, 676611, 845766, 1014949, 1184166? c3 - c2 + 169103c + 151 What is the i'th term of -3851, -3943, -4105, -4343, -4663, -5071, -5573? -i3 - 29i*2 + 2i - 3823 What is the m'th term of -763, -1509, -2257, -3007, -3759, -4513, -5269? -m*2 - 743m - 19 What is the n'th term of 3658, 3690, 3780, 3958, 4254, 4698? 5n3 - n2 + 3654 What is the z'th term of 9, 66, 139, 234, 357, 514? z3 + 2z*2 + 44z - 38 What is the x'th term of 5126, 5121, 5102, 5063, 4998, 4901, 4766, 4587? -x3 - x2 + 5x + 5123 What is the h'th term of -8548555, -8548553, -8548551, -8548549, -8548547? 2h - 8548557 What is the j'th term of -1364875, -1364874, -1364873? j - 1364876 What is the y'th term of 42, 6, -136, -438, -954, -1738, -2844? -9y3 + y2 + 24y + 26 What is the n'th term of 3288, 2926, 2564? -362n + 3650 What is the f'th term of 181, 790, 1909, 3622, 6013? 14f*3 + 171f*2 - 2f - 2 What is the j'th term of 44, 391, 1350, 3227, 6328, 10959, 17426, 26035? 51j3 - 10j + 3 What is the d'th term of 31206, 124826, 280856, 499296, 780146, 1123406? 31205d2 + 5d - 4 What is the c'th term of 83067, 83082, 83095, 83106, 83115, 83122, 83127? -c*2 + 18c + 83050 What is the a'th term of -158965, -158963, -158961, -158959? 2a - 158967 What is the r'th term of -31, -96, -211, -376, -591, -856, -1171? -25r*2 + 10r - 16 What is the m'th term of 15017, 30030, 45043, 60056? 15013m + 4 What is the j'th term of -119, -690, -2125, -4820, -9171, -15574, -24425? -66j*3 - 36j*2 - j - 16 What is the x'th term of -162, -1456, -4976, -11838, -23158, -40052? -186x*3 + 3x*2 - x + 22 What is the m'th term of -112887, -112889, -112891, -112893, -112895? -2m - 112885 What is the i'th term of -3594, -3593, -3592? i - 3595 What is the h'th term of 861, 808, 755? -53h + 914 What is the c'th term of 22289, 44529, 66769, 89009, 111249? 22240c + 49 What is the s'th term of -213932, -213931, -213930, -213929, -213928? s - 213933 What is the s'th term of 17489, 17473, 17461, 17453, 17449? 2s2 - 22s + 17509 What is the d'th term of -745216, -745208, -745200, -745192, -745184? 8d - 745224 What is the w'th term of 1439277, 1439276, 1439275, 1439274, 1439273, 1439272? -w + 1439278 What is the v'th term of -64485, -64473, -64461, -64449? 12v - 64497 What is the r'th term of -1193, -1477, -1761, -2045? -284r - 909 What is the m'th term of -216, -5, 342, 825, 1444, 2199, 3090? 68m*2 + 7m - 291 What is the c'th term of 287671, 287664, 287655, 287644, 287631, 287616, 287599? -c*2 - 4c + 287676 What is the z'th term of -433, -854, -1275, -1696, -2117? -421z - 12 What is the i'th term of -4877, -39148, -132209, -313454, -612277, -1058072? -4899i3 - i2 + 25i - 2 What is the h'th term of -178, -47, 74, 179, 262, 317? -h3 + h2 + 135h - 313 What is the s'th term of -659, -587, -515, -443, -371, -299? 72s - 731 What is the m'th term of 94, 491, 1242, 2419, 4094, 6339? 12m*3 + 105m*2 - 2m - 21 What is the a'th term of 56516, 113042, 169568? 56526a - 10 What is the q'th term of 497, 1024, 1563, 2120, 2701, 3312, 3959? q3 + 520q - 24 What is the d'th term of 629, 846, 1063, 1280, 1497? 217d + 412 What is the f'th term of -211547, -211556, -211565? -9f - 211538 What is the a'th term of 328, 396, 554, 844, 1308, 1988, 2926? 7a3 + 3a*2 + 10a + 308 What is the p'th term of 6945, 13882, 20815, 27744, 34669, 41590? -2p2 + 6943p + 4 What is the m'th term of 1106, 1097, 1080, 1055? -4m2 + 3m + 1107 What is the f'th term of 576, 517, 374, 105, -332, -979, -1878, -3071? -7f3 - 10f + 593 What is the n'th term of 5097, 8920, 12745, 16572, 20401, 24232, 28065? n*2 + 3820n + 1276 What is the x'th term of -944, -929, -898, -851, -788, -709? 8x2 - 9x - 943 What is the y'th term of -25442, -25424, -25406, -25388, -25370, -25352? 18y - 25460 What is the j'th term of -1457634, -1457639, -1457646, -1457655, -1457666, -1457679, -1457694? -j2 - 2j - 1457631 What is the y'th term of 120, 205, 286, 363? -2y2 + 91y + 31 What is the r'th term of -110422, -110400, -110370, -110338, -110310, -110292, -110290? -r*3 + 10r*2 - r - 110430 What is the f'th term of 445, 3513, 11825, 27997, 54645, 94385, 149833? 436f*3 + 6f*2 - 2f + 5 What is the u'th term of -49126, -49121, -49116, -49111, -49106, -49101? 5u - 49131 What is the k'th term of -22632749, -22632748, -22632747? k - 22632750 What is the b'th term of 47, 140, 323, 602, 983? b3 + 39b*2 - 31b + 38 What is the u'th term of -92, -178, -302, -482, -736, -1082, -1538, -2122? -3u3 - u2 - 62u - 26 What is the y'th term of 164361, 328717, 493069, 657417, 821761, 986101? -2y2 + 164362y + 1 What is the o'th term of -163641, -163640, -163639? o - 163642 What is the d'th term of -120, -236, -344, -444, -536? 4d2 - 128d + 4 What is the c'th term of 221, 345, 373, 305, 141, -119, -475? -48c2 + 268c + 1 What is the w'th term of 3580, 7118, 10630, 14116, 17576? -13w2 + 3577w + 16 What is the v'th term of -124, -11, 86, 173, 256, 341, 434, 541? v*3 - 14v*2 + 148v - 259 What is the u'th term of 107, 156, 227, 320, 435, 572? 11u2 + 16u + 80 What is the x'th term of 67749, 67718, 67667, 67596, 67505, 67394? -10x2 - x + 67760 What is the s'th term of -371, -712, -1025, -1310, -1567, -1796? 14s*2 - 383s - 2 What is the y'th term of -6270, -50117, -169132, -400899, -783002, -1353025, -2148552, -3207167? -6264y3 + y - 7 What is the l'th term of 1503213, 1503209, 1503203, 1503195? -l*2 - l + 1503215 What is the a'th term of -126, -81,	{ "pile_set_name": "DM Mathematics" }
t) = -8t3 + 12t*2 + 149t - 748. Give g(5). -703 Let s(p) = 21p3 - 4p*2 + 4p - 9. What is s(-3)? -624 Let o(r) = -r*2 - 86r + 899. Calculate o(-94). 147 Let o(l) = -158l - 47. Calculate o(-4). 585 Let s(j) = 34j*2 - 374j + 17. What is s(11)? 17 Let h(v) = -9v3 + 146v*2 + 15v + 11. Calculate h(16). 763 Let y(w) = -27w3 + w2 - 4w - 6. What is y(-2)? 222 Let x(f) = 4f2 - 7f - 106. Calculate x(9). 155 Let g(z) = 3z3 - 268z*2 + 88z + 76. What is g(89)? -13 Let j(l) = -10l2 - 718l - 560. Determine j(-71). 8 Let f(z) = -10z2 + 25z - 61. Give f(3). -76 Let h(f) = 224f + 5812. Give h(-26). -12 Let l(p) = p3 + 30p*2 - 92p + 295. Determine l(-33). 64 Let v(d) = 2d3 + 11d*2 + 32d + 23. What is v(-2)? -13 Let m(h) = -5h2 - 10h - 41. Give m(-5). -116 Let s(i) = 36i2 + 1295i + 14. Give s(-36). 50 Let t(d) = -d*3 - 53d*2 - 48d + 216. Calculate t(-52). 8 Let a(d) = d*2 + 28d + 141. Determine a(-6). 9 Let p(n) = 410n + 14356. What is p(-35)? 6 Let k(g) = 5g*2 - 689g + 555. Calculate k(137). 7 Let u(w) = -2w3 - 17w*2 - 50w - 345. What is u(-8)? -9 Let l(z) = -z*2 - 501z + 13709. Give l(26). 7 Let a(d) = 85d - 4879. Give a(50). -629 Let k(g) = -g3 - 92g*2 - 2098g - 362. What is k(-51)? -5 Let w(p) = -p*2 + 899p + 10015. Give w(-11). 5 Let k(d) = 2d3 - 28d*2 - 31d + 38. What is k(15)? 23 Let x(y) = 24y2 + 232y - 89. Give x(-10). -9 Let o(x) = -417x - 34. What is o(0)? -34 Let l(k) = 81k*2 + 565k - 2. Calculate l(-7). 12 Let c(m) = -51m - 3537. Calculate c(-83). 696 Let y(w) = w2 + 86w + 1819. Give y(-49). 6 Let p(i) = -i*2 - 12i. Give p(-14). -28 Let v(p) = -364p - 1818. Calculate v(-5). 2 Let x(m) = -m3 - 48m*2 - 410m - 104. What is x(-37)? 7 Let x(n) = -102n + 432. What is x(1)? 330 Let b(q) = q3 - 142q*2 - 582q - 279. Calculate b(146). 13 Let s(a) = 860a - 19756. What is s(23)? 24 Let f(w) = 221w - 6151. Calculate f(28). 37 Let o(b) = 8b2 - 10b - 3. What is o(0)? -3 Let o(w) = -7424w - 96514. What is o(-13)? -2 Let v(g) = g2 - 2g - 459. Calculate v(0). -459 Let w(v) = -v*3 + 45v*2 - 88v - 20. Calculate w(43). -106 Let a(u) = 3u2 + 14u - 142. Calculate a(6). 50 Let w(t) = t*3 - 56t*2 - 309t + 247. Determine w(61). 3 Let n(k) = 18k2 + 874k + 482. Determine n(-48). 2 Let l(j) = -j*3 - 7j*2 + 48j + 46. Calculate l(-12). 190 Let p(k) = -2k2 - 859k + 14261. Determine p(16). 5 Let d(o) = o*3 - 2o*2 - 16o + 49. Determine d(-7). -280 Let p(j) = -j*2 + 52j - 348. Determine p(42). 72 Let b(x) = x3 - x2 - 22x + 3. What is b(5)? -7 Let g(h) = h2 + 6h - 220. Calculate g(-20). 60 Let h(a) = -119a - 318. Calculate h(-3). 39 Let i(j) = 2j*2 - 754j + 50057. Calculate i(291). 5 Let j(a) = -12a3 + 96a*2 + 5a - 4. Calculate j(8). 36 Let z(x) = 107x - 116. Calculate z(3). 205 Let y(v) = -v3 + 77v*2 - 360v - 29. Determine y(72). -29 Let l(f) = -191f + 4969. What is l(26)? 3 Let u(n) = 2n*2 + 65n - 83. Calculate u(-37). 250 Let z(o) = 4o2 + 22o - 30. What is z(-7)? 12 Let v(q) = 1117q - 11172. Calculate v(10). -2 Let o(q) = 684q - 23940. Determine o(35). 0 Let o(v) = 76v - 125. Determine o(3). 103 Let p(a) = a3 + 64a*2 + 252a - 2527. What is p(-59)? 10 Let b(x) = -8x2 - 65x - 54. Give b(-7). 9 Let n(f) = -4538f - 54455. Determine n(-12). 1 Let m(u) = -u2 + 7u - 139. Determine m(12). -199 Let g(t) = t*2 - 95t + 1320. Give g(81). 186 Let d(y) = 60y + 1804. What is d(-30)? 4 Let g(v) = v2 + 22v + 169. Give g(-7). 64 Let f(g) = g*2 + 119g - 359. Determine f(3). 7 Let o(r) = -272r + 672. Determine o(4). -416 Let h(f) = -10f*2 + 2428f + 9871. Calculate h(-4). -1 Let d(k) = 3k2 - 77k + 287. Give d(21). -7 Let x(q) = 1213q - 351. What is x(1)? 862 Let l(k) = -k3 - 21k*2 + 9k + 602. What is l(-19)? -291 Let g(u) = u*3 - 4u*2 - 5u - 8. What is g(5)? -8 Let u(k) = -5k2 - 63k + 867. Calculate u(8). 43 Let u(o) = 650o + 14928. Give u(-23). -22 Let t(u) = 29u - 4351. Calculate t(150). -1 Let j(c) = 2360c + 19. Give j(0). 19 Let p(i) = 110i + 2293. Give p(-21). -17 Let b(z) = z*2 + 30z + 18. Determine b(-14). -206 Let x(l) = -l*2 + 120l - 826. Give x(113). -35 Let q(l) = 6l2 + 184l - 10. What is q(-32)? 246 Let v(a) = -3a2 - 39a + 169. Calculate v(-20). -251 Let f(h) = 2h3 - 7h*2 + 63h - 97. Give f(2). 17 Let i(p) = 2p3 + 134p*2 - 4p - 269. Determine i(-67). -1 Let m(r) = -r*3 + 127r*2 - 170r - 10000. Give m(125). 0 Let y(m) = 96m3 + m2 - 3m - 1. Give y(-2). -759 Let p(a) = 5a2 - 286a - 533. What is p(59)? -2 Let w(d) = -25d - 2940. Determine w(-118). 10 Let d(y) = -y3 + 44y*2 - 86y - 68. Determine d(42). -152 Let s(b) = b*3 + 59b*2 - 4b - 261. What is s(-59)? -25 Let d(y) = -9y + 843. What is d(98)? -39 Let b(u) = -u3 - 65u*2 - 181u + 312. Give b(-62). 2 Let y(c) = -34c2 - 303c + 20. What is y(-9)? -7 Let k(d) = 1014d + 11157. What is k(-11)? 3 Let r(f) = 4f*2 + 169f - 171. Give r(1). 2 Let y(f) = 2f3 - 83f*2 - 46f + 176. Calculate y(42). 8 Let u(q) = -4q3 + 97q*2 + 80q - 41. Give u(25). 84 Let m(d) = -4d2 - 59d - 20. Give m(-18). -254 Let b(k) = 154k + 3694. Calculate b(-24). -2 Let j(m) = -m2 + 10m + 612. Give j(30). 12 Let z(d) = -d*2 - 709d + 3571. Calculate z(5). 1 Let w(d) = 3d3 - 20d*2 + 5d + 8. What is w(8)? 304 Let q(m) = -250m - 1995. Calculate q(-8). 5 Let x(u) = u2 + 33u - 559. What is x(-45)? -19 Let k(y) = -32y - 566. Calculate k(-19). 42 Let g(r) = -1078r - 15084. What is g(-14)? 8 Let b(p) = 297p - 3081. Determine b(10). -111 Let k(x) = -6x3 - x2 + 5x - 2. What is k(2)? -44 Let o(x) = -3x*3 - 68x*2 - 58x - 87. What is o(-22)? 221 Let h(y) = 6y2 - 261y - 35. Determine h(42). -413 Let k(q) = 907q - 20862. Determine k(23). -1 Let s(u) = u3 - 31u*2 + 442u - 13711. Give s(31). -9 Let d(x) = -4x2 + 32x - 12. Calculate d(7). 16 Let u(m) = -m*2 - 89m - 1378. What is u(-19)? -48 Let a(w) = 48w + 2395. Determine a(-50). -5 Let m(d) = -94d*2 - 1499d - 24. Determine m(-16). -104 Let x(i) = -22i3 - 126i*2 - 127i - 2. Determine x(-1). 21 Let a(r) = -105r - 1145. Give a(-12). 115 Let r(h) = 132h - 3033. What is r(23)? 3 Let q(l) = 138l - 1259. Determine q(10). 121 Let x(o) = -o2 - 5o + 526. Give x(-26). -20 Let u(x) = 31x + 319. Determine u(-11). -22 Let b(o) = -72o*2 + 1432o - 1. Determine b(20). -161 Let l(h) = h*3 + 15h*2 + 104h + 325. Determine l(-8). -59 Let g(b) = -479b - 10484. What is g(-22)? 54 Let g(d) = -d2 + 21d - 66. What is g(9)? 42 Let y(h) = -26h + 505. Determine y(21). -41 Let l(g) = -8g - 37. Determine l(-9). 35 Let v(g) = g*3 + 55g*2 + 223g + 974. Calculate v(-51). 5 Let r(t) = -t*3 + 30t*2 + 798t - 24. What is r(-17)? -7 Let o(j) = 15j2 + 75j - 149. Give o(2). 61 Let q(i) = 2i3 + 78i*2 - i - 46. What is q(-39)? -7 Let z(h) = -7h*2 + 8h + 304. Calculate z(-13). -983 Let c(u) = 9u + 198. Determine c(-20). 18 Let r(c) = -5c3 - c2 + 5c + 11. Calculate r(-3). 122 Let z(n) = -27n*2 + 136n - 276. What is z(2)? -112 Let f(r) = r*3 + 16r*2 + r + 49. Calculate f(-15). 259 Let p(o) = -1590o - 9539. Give p(-6). 1 Let r(q) = 54q + 636. Give r(-14). -120 Let l(j) = 107j - 860. Determine l(8). -4 Let r(j) = -j*2 - 29j - 202. What is r(-18)? -4 Let g(q) = -q*3 + 46q*2 - 521q + 306. What is g(18)? 0 Let h(m) = -1485m + 7423. Determine h(5). -2 Let i(n) = -n3 + 7n*2 + 16n + 28. Calculate i(-4). 140 Let b(f) = -f*3 + 3f*2 + 110f + 32. Calculate b(-9). 14 Let m(d) = d*3 + 18d*2 + 17d - 235. Give m(-5). 5 Let o(p) = -2p3 + p2 + 8p + 8. What is o(-5)? 243 Let r(p) = -4362p - 174488. What is r(-40)? -8 Let v(p) = 4p*3 + 100p*2 - 3p - 43. Give v(-25). 32 Let o(t) = 249t - 495. Give o(2). 3 Let m(r) = 17r + 1322. Determine m(-78). -4 Let o(x) = -69x + 3354. Calculate o(47). 111 Let c(y) = -22y*3 - 2y*2 + 4y - 6. Determine c(2). -182 Let f(j) = 5j3 + 406j*2 + 78j - 225. Calculate f(-81). 18 Let f(c) = -c*2 - 5c + 4. What is f(-4)? 8 Let u(t) = 275t - 11246. Give u(41). 29 Let h(c) = c2 - 19c - 98. Calculate h(-7). 84 L	{ "pile_set_name": "DM Mathematics" }
1 - 1 + 3)(z + 0 + 0) + 1 - 1 - 3z) in the form p + lz and give l. 252 Rearrange (79s - 150s - 112s)(-s - s - s) to the form vs + n + us2 and give u. 549 Express (-1 + 4 - 1)(3w3 + w3 - w3)(33w + 30 - 30) in the form gw*4 + hw + zw3 + bw*2 + s and give g. 198 Express 118b*4 + 0b*2 + 14b*3 - 14b*3 - 119b4 - b2 + 4b + 6 as x + fb*3 + yb*2 + kb + lb4 and give l. -1 Express (-43u - 51u + 23u)(u - u + 3u) - 3u2 + 5 - 5 as nu*2 + o + mu and give n. -216 Rearrange (p + 163p - 15p + 107p)(-p*3 - 3p*3 + 0p*3) to yp*3 + rp*2 + gp*4 + jp + i and give g. -1024 Express 7n + 12989n*2 - 12981n*2 + 2n in the form v + an + un*2 and give u. 8 Rearrange -3r - 2r3 - 13r*4 + 13r*4 - 5r*4 - 3 + 4r to f + xr + ur*3 + or*4 + gr*2 and give u. -2 Rearrange -361q + 48q + 104q + 75q to pq + h and give h. 0 Rearrange 63q2 - 38q*2 - 498q2 + q2 - 2q2 + 2q*2 + (-2 + 2 + 2q)(-2 + 2 + 2q) to the form i + vq2 + tq and give v. -468 Express -10q + 58 - 16 - 22 as o + aq and give o. 20 Rearrange 1716n - 724n - 540n to ln + c and give l. 452 Rearrange (g + 2g - 15 + 3)(-8 + 0 - 1 + 1 + 4 - 4 + (-6 + 3 + 1)(-1 - 1 + 0) - 1 + 1 + 1 + 1 + 1 + 0) to c + tg and give c. 12 Rearrange -f4 - f3 + 2f + 289 + 0f*3 - 287 - 4f + 25f2 to qf*4 + of + mf3 + y + if*2 and give y. 2 Rearrange 10 - a - 3a*2 + 5a*2 - a - 8a*4 + 11a*4 + 12 to the form ca*2 + ma*4 + d + sa + xa3 and give d. 22 Rearrange -174867f*2 - f + 6f*3 + 87 + 174867f*2 to rf*3 + df*2 + u + of and give o. -1 Express (-671 + 262 + 880)(0i - i - 4i) in the form a + fi and give f. -2355 Express -1892t - 5 - 9 - 6 + 20 in the form ot + c and give o. -1892 Rearrange 2v + 4 - 4 + (5 - 5 - 2v)(-1 - 3 + 2) - 1 + 1 + 2v - 5v + 2v - v + (-2 + 2 + 1)(-v + 3v - 4v) to the form u + sv and give s. 2 Rearrange -174r2 + 7415r - 253r2 - 7415r to br2 + k + jr and give b. -427 Express 3z3 - 2z*3 - 3z*3 + (2 - 2 - 1)(2z2 + 2z*3 - 2z*2) + 2z*3 - 29 + 57 - 29z - 26 as xz + t + dz*3 + sz*2 and give s. 0 Express (80 + 202 - 170)(-l + 3l - l)(-1 - 1 + 1)(4 + 0 - 2) as ul + b and give u. -224 Express u*3 + 83 - 4u - 3u3 + 83 + 0u*2 - 2u*2 - 157 in the form k + hu*3 + su*2 + mu and give m. -4 Express -3 + 27244t4 - 27243t*4 - 2t + 2t2 - 1 + t3 as wt*3 + it*4 + kt + vt2 + p and give p. -4 Rearrange (6 - 3 - 4)(-i + 4i + 2i + 0 + 0 + i + 0i + 5i - 4i + (1 - 1 + 2)(0i - 4i + 2i) + 3 - i - 3 - i - 7i + 3i) to d + li and give l. 3 Express 2m - 704 + 378 + 400 as cm + l and give c. 2 Rearrange 297r - 263 + 263 + 1206r to pr + g and give p. 1503 Rearrange (15205u*2 + 180 - 15207u*2 + 474)(-2 + 4 + 3) to i + ou + bu*2 and give o. 0 Express 0p*2 - 10p*3 - 2p*2 - 3p*2 - 2 + p + 11p*4 - 19p*4 + 3p*2 in the form yp*4 + rp*2 + lp*3 + u + bp and give y. -8 Express 0l3 - l3 - l3 + (-78 - 467 - 851)(-1 - 2l3 + 1) in the form zl*2 + tl*3 + q + hl and give t. 2790 Rearrange -4x - 4x - 260 - 20x + 27x to the form m + zx and give m. -260 Rearrange -457g*3 + 460g*3 - 13 - 27 + 2g*2 to bg*2 + fg*3 + tg + i and give i. -40 Rearrange -5p2 - 617697p - 33p3 + 617699p + 4p2 to ip*3 + up + dp2 + v and give v. 0 Rearrange -19o*3 + 30o + 3o3 - 2o*2 - 51o*3 - 32o to wo3 + go + ao2 + j and give g. -2 Express -k + 0 + 0 + (4 - 4 - 2)(-32636 - 265k + 32636) + 2k + 0 + 0 in the form qk + d and give q. 531 Express (1 - 2 - 1)(-3 + 0 + 4 + (2 - 5 + 4)(-2 - 2 + 6))(-123o2 - 36o*2 - 80o*2) as k + yo*2 + io and give y. 1434 Rearrange (-a - 2a - 5a)(2 + 1 - 4) + (a - a + 2a)(0 + 2 - 1) + (2a - 5a + 2a)(10 + 0 - 2) to ya + v and give y. 2 Express (-22 + 22 + 4o)(2 - 3 + 5)(-7o + 11o + 17o) in the form f + to2 + ko and give f. 0 Express -1035z - 3z*3 + 1039z + 3 + z*2 + 1 in the form gz*2 + yz*3 + rz + u and give g. 1 Rearrange 1 + 115q4 - 108q*4 + 3q*2 + 74q - 4 - 76q to the form jq*3 + aq*2 + fq*4 + c + bq and give a. 3 Rearrange (-2 - 4 + 7)(12 + 3 - 4)(-7 + 19 + 21)(-j + 4j - 10j) to m + sj and give s. -2541 Express (-119 - 5k + 119)(2k + 0k - 3k)(-4 + 2k + 4) - 32k*3 - 15k*3 + 75k*3 as zk + hk2 + c + nk*3 and give z. 0 Express (0n*2 + 14n + n*2 - 3n*2)(-215 + 41 + 105) as t + hn + vn*2 and give h. -966 Rearrange -2 + 47u*2 - 28u*3 - 22u*2 - 6u + 6u - 26u*2 to cu + i + ju3 + hu*2 and give i. -2 Rearrange (33 + 1 + 6)(0n + n4 + 0n) to the form tn2 + ln*3 + vn + p + gn4 and give t. 0 Rearrange -1 - 13c*2 + 4154c*4 - 2079c*4 - 2c*3 - 2078c*4 to the form hc*4 + oc*3 + n + fc + dc2 and give n. -1 Express (3b3 - b3 + 5b3)(-13 + 29 + 15b - 19) as gb*3 + ab*2 + j + wb + sb4 and give w. 0 Rearrange (-v - 3v + 2v)(-v + 4v - v)(-13 - 9 + 9)(-v - v + 0v) to the form w + lv + cv*3 + yv*2 and give c. -104 Rearrange -3r + 18r3 - 5r*3 - 20r + 10r to lr + hr2 + zr*3 + b and give z. 13 Express -723i + 155 - 13 + 722i in the form hi + w and give h. -1 Express -1159h2 - 11h + 5h + 394h*2 + 6h in the form d + jh2 + ih and give i. 0 Rearrange -5 + 3s3 + 7 - 2 - s - 13s*3 - 2 to the form zs*3 + qs*2 + bs + k and give b. -1 Express (-87p2 + 18p*2 - 169p*2)(10p + 7p - 9p) as op*3 + c + mp + sp2 and give o. -1904 Rearrange 845w*2 - 421w*2 + 12w - 420w2 - 3 + 1 to xw + hw2 + t and give x. 12 Express 8m - 39m - 49m in the form tm + q and give t. -80 Express 6m - 3m + 4151 - 3141 in the form a + xm and give a. 1010 Rearrange 2 - 30i3 - 30i*3 + 17i + i*2 - 26i*3 - 17i*4 + 85i*3 to the form ki*3 + xi + l + gi4 + ui*2 and give l. 2 Express -3b - 6 + b + b + (-4b + 4b + 2b)(0 + 0 - 1) - 3b + 5b - b + 36b + 67b - 36b as f + cb and give f. -6 Express -4d + 2d*4 + 997d*3 - 1997d*3 + 997d*3 in the form t + pd*3 + od + qd2 + yd*4 and give y. 2 Rearrange 2g*2 - 147 + 3g*2 - 11g*2 + 5g*2 to w + ug + qg2 and give w. -147 Rearrange (45 - 45 - 52o)(-o2 + 0o*2 + 0o*2 + (-4o + 5o - 3o)(16o - 6o + 28o)) to the form u + mo2 + do + bo3 and give u. 0 Rearrange 302g + 41007 - 41007 to b + og and give b. 0 Rearrange (2y*2 + 3y*2 - 2y*2)(-33y2 - 1521 + 760 + 760 - 2y) to by2 + vy*3 + qy + xy4 + a and give x. -99 Rearrange 4s + 191s3 + 1 + 37s*2 - 114s*2 + 38s*2 - 3s + 37s2 to g + as*2 + js + ys3 and give y. 191 Express 2 - 2 - 6 - 3u*3 - 1 in the form v + qu*2 + su + xu3 and give x. -3 Express (2 + 2 - 5)(22p2 - 39 + 39 - 22p*2 - 2891p*4) in the form lp + vp2 + sp*4 + n + bp*3 and give s. 2891 Rearrange (2g + 2g - 2g)((-4 + 3 + 2)(-1 + 1 + 2) + (-2 + 3 + 2)(-23 + 1 - 31)) to the form v + bg and give b. -314 Express -98f2 - 675f*2 - 649f*2 as lf + xf2 + a and give x. -1422 Express 0o*2 + 0o*2 + 2o*2 + (3 + 0 + 0)(-2 - 11 - 2)(5o*2 - 3o2 + o2) - o*2 + 2o - 2o as xo + l + uo2 and give u. -134 Express -42i*2 + 2i + 5i3 + 19i*3 - 21i*3 + 1 as p + ni + li2 + hi*3 and give h. 3 Rearrange -389s*2 - 387s*2 + 295 + 775s*2 to ys*2 + ps + f and give f. 295 Rearrange -32c + 313 - 29c + 60c to the form x + bc and give b. -1 Rearrange 2 - 364n - 133n - n*2 + 107n to gn2 + in + o and give i. -390 Rearrange (-4 + 4 - 2)(9u - 4u + 117u) to the form du + n and give d. -244 Rearrange 191n + 746 - 746 to i + an and give a. 191 Rearrange 6j*2 - 29j + 2j - 7j*2 + 4 - 14 + 6 to the form aj + o + lj2 and give o. -4 Rearrange (871m*3 + 2m*4 + 0m - 841m3 - 5m)(5 - 1 - 2) to the form dm + j + wm3 + cm*2 + om*4 and give o. 4 Rearrange 10c + 0 - 16c2 + 5 - 8c*2 + 27c*2 to sc + bc2 + v and give v. 5 Rearrange 41s*2 - 7s*2 + 84s*2 + (-7s + 2s - 9s)(6s - 2s - 2s) to os2 + q + ys and give o. 90 Rearrange 55z3 + 230 - 4z - 695 + 238 + 139z*3 + 229 to the for	{ "pile_set_name": "DM Mathematics" }
52 - 110 for x. 2 Solve -236o + 229o + 217 + 12 = -4t, 2t + 3t + 15 = 0 for o. 31 Solve -15p = 2s + 3p - 56, 0p - 2 + 3 = p - 1 for s. 10 Solve -2t + 2581p + 2 = 4t - 5t + 2579p - 14, -4p = -12t + 92 for t. 6 Solve -3t + 15 = 5s, -2t = -s - 7t + 47 for s. -3 Solve 5f - 4547w + 155 = -4549w, -3w = 2f + 51 for f. -33 Solve 0 = 3m + 9r + 24, -1697865m = -1697867m - r + 4 for m. 4 Solve -39m - 353m - 1955 = -5g, -4m + 3g - 17 + 5 = -m for m. -5 Solve 8p + 14c - 118 = 3p, 11c + 11 = -p + 19c - 41 for p. 4 Solve -4h - 185 = 5k, 3h - 2k + 3k + 251 = 104 for h. -50 Solve -50 = 2l, 26l - 23l + 61 = 14u for u. -1 Solve -8a = -0k + 5k - 316, -11k - 6 = -9k + a - 51 for k. 4 Solve l - 7v = -10, 2l - 31v + 28v - 2 = 0 for l. 4 Solve -366n = -h - 353n - 273, -n = -21 for h. 0 Solve -4d - 4l = 292, 6d + 3d - 116l + 637 = -115l for d. -71 Solve 0 = -7t - 5w + 13, -t - 3437w + 7 = -3438w for t. 4 Solve 5r - 53 = -2t - t, r + 247 = -3t + 296 for r. 1 Solve -4h - 26 = -3q - 67 + 102, 322 = -q - 25h for q. 3 Solve -9c - 51 = -5v, 2v - 3v + 10 - 2 = -5c - 5v for c. -4 Solve -7 = -w - w - 410f + 413f, -5f - 23 = 8w for w. -1 Solve -4u - 31g + 15 = 40 + 159, -9 + 1 + 0 = 2g for u. -15 Solve -859v + 858v = 5k - 4, -89k + 190 = -2v for k. 2 Solve 2n - n = 2p + 12, 803n - 807n = -3p - 13 for n. -2 Solve 40t + 32t + 38t + 24 = 98t + 2q, -10 = 5t + 3q for t. -2 Solve 140430z - 5f + 48 = 140434z, -5z = 11f - 98 for z. 2 Solve -12q - 4s + 219 + 97 = -6q, -10q = -12q - s + 107 for q. 56 Solve -h + 51 - 75 = 4o, -4h + 3h - 3h - 24 = 5o - 5 for o. -7 Solve 0 = f + 4o - 127, 13f + 7o + 110 + 87 = -3o + 14o for f. -5 Solve 12i - 4i - 19 = 183s - 178s, 0 = -2i + 5s + 1 for i. 3 Solve -q + 4z + 2 = 0, 3q + 516z - 19 = 3q - 4q + 521z for q. 6 Solve -198 = 3p - 12q, -6213p + 6212p - 3q = -53 for p. 2 Solve 3p + 2506 - 2518 = -3q, -40 = 5p - 5q for p. -2 Solve 4u + 5650 = x + 5649, -2x = -5u + 7 for x. -11 Solve -u - 62 = -5j + 27, -949u + 952u = -3j + 39 for u. -4 Solve -v - 9i - 2659 = -2725, 0 = -v - 3i + 24 for v. 3 Solve -13 = -5u + 10u - 6u - 2r, 2r = 6r - 28 for u. -1 Solve -50l - 191 = -j - 62l, 3j + l - 13 = 0 for j. -1 Solve 205r = 2t + 197, -946 + 1895 - 970 = -5r - 4t for r. 1 Solve 147w - 151w = -3j + 80, 2j = -51w - 1181 for w. -23 Solve -63 = 3s + 4b, -53b = 162s - 161s + 951 for s. 3 Solve 3z - 22 = -2t, 1321t - 32 = 1317t - 3z for t. 5 Solve 24 = -3a - 4k, -97a + 93a = 5k + 25 + 5 for a. 0 Solve -2m + 0m = -5m - 5w, -10m + 7m = 10m - 10w for m. 0 Solve -4g - 2o + 10 = 0, -4o = -8g - 251 + 215 for g. -1 Solve -11d - 434 + 447 = -z, d + 5 + 10 = -8z for d. 1 Solve 3o = -32y - 108, -5o + 0y + y = -8 + 3 + 22 for o. -4 Solve -11 = -7b - 3g - 30, -2b + 2g + 3 = 3b for b. -1 Solve -5a + 38 = 2s, -31a = -9s + 9s - 30a - 8 for s. -1 Solve -j + 2j + 212f + 122 + 604 = 65f, -2j - 2f = 2j - 26 for j. 9 Solve -75708y = -75713y - 5b - 5, y + 2b + 4 = 0 for y. 2 Solve 0 = 2p + 3h + 37 + 16 + 10, -129 = 7p + 8h + 39 for p. 0 Solve 1746t = 3u + 876t + 868t - 19, 34u + 67 = -3t for u. -1 Solve 68 = 5b + 4a, -37b - 4a = 107 - 559 for b. 12 Solve 4z + 26513d = 26516d + 281, 8z - 572 = -4d for z. 71 Solve 0 = -n - 3x + 18, 69538n = 69535n + 4x + 2 for n. 6 Solve 779c + 72 = 782c - 5j, -24c - 4j - 84 = 0 for c. -1 Solve 5l + 509z = 508z + 10, 4l + 4z = 24 for l. 1 Solve 5f + 32 = -2l, -37f + 443 = 6l + 583 for l. -11 Solve -d - 3x = -29, -3d + 9x - 14x = -7d + 99 for d. 26 Solve 0 = 3r + 4i - 3i + 11, -8r + 14r + 17i = -52 for r. -3 Solve -v + 6k + 17 = 3k - 5, 2v + 4v - 62 = 4k for v. 7 Solve 3p + 17868 - 17901 = -i, 0 = 8p - i - 22 for p. 5 Solve v - 65 + 71 = -5y - 0v, 4y = 3v - 1 for y. -1 Solve -3x = -m - 54, 28m - 4622 = 2x - 4576 for m. 3 Solve 2s = 5a - 6, 3s + 13a + 2054 - 988 - 975 = 0 for s. -13 Solve -8r - 106c + 11 = -107c + 1, -8 = 5r - 3c for r. 2 Solve 0 = -3a - 12h - 30, -58a + 7h - 40 = -54a + 3h for a. -10 Solve -5h = -3627u + 3630u + 58, 5u - u + 5h = -79 for u. -21 Solve -4y + 83 = z, -8z + y - 3y = 2z - 70 for z. 3 Solve 0 = -2f + 18, 5j = -3f - 8 + 2 + 43 for j. 2 Solve 7i - 134411 = -2q + 3i - 134479, 0 = 3q - i + 137 for q. -44 Solve -5y = -3s + 20, 3s - s - 2972 + 2980 = -2y for s. 0 Solve -2k = 124, 2y = 4y + 13k - 4k + 550 for y. 4 Solve s = -5l + 14 + 29, 19s = 34l - 36l + 73 for l. 8 Solve 1526u - 1527u - c = 37, 136 = -3u + 2c - 0c for u. -42 Solve -4q + 2z + 3z = -4q - 25, -8z = -3q - 53 for q. -31 Solve -v = -17l + 37, 2187v = 2190v + 5l - 1 for v. -3 Solve -5u + 4w + 44 = 0, 102323u - 3 = 102321u - 4w + 37 for u. 12 Solve 10j + 42 + 6 - 47 = 51, 0 = 5x - j + 35 for x. -6 Solve -1442g + 485g = 5f - 491g - 484g + 34, 2f - 9g + 19 = 0 for f. 4 Solve -3v + 26g - 35 = 25g - 58, 3g + 24 = 0 for v. 5 Solve 3j + 6a = -3a + 13a - 89, -5j + 13a - 313 = 0 for j. 5 Solve 52w - 2k = -155w - 160 + 783, -5k = -5w + 20 for w. 3 Solve 5j = -2h - 31, -7193 = -2j - 13h - 7303 for j. -3 Solve -4r + 4 = 6b, 0 = r - 3r - 5b + 6b + 3 - 17 for r. -5 Solve 0 = -5c - 3i - 3, -70i + 357 - 77 = 0 for c. -3 Solve v - 5s = 92, -v - 4s - 74124 + 74054 = 0 for v. 2 Solve 98f = 6l + 101f + 1 + 5, -2l - 8f + 40 = 0 for l. -4 Solve -237217p + 237221p + 90 = 3n, p - 11n + 2 = 0 for p. -24 Solve 0 = -979v + 981v - 3h + 6 - 0, 0 = -3v + 5h - 7 for v. -9 Solve 17m + 8u + 1 = 0, 2m - 60774 = 2u - 60780 for m. -1 Solve -4u - 20 = -12m, -3m + 9u - 78 + 219 = 0 for m. -4 Solve 12s - 10s + 7 = 3o, -5o = 22s - 20s - 33 for s. 4 Solve -123 = 1248v - 1247v + 3f, -3v - 205 = 5f for v. 0 Solve -4n + 337f - 351 = -521 + 6256, -3n = 4f - 57 for n. -5 Solve 2f + 151 = -5s, 2080 - 2190 = 4s - 2f for s. -29 Solve 26s + 10 = -4k, 3692k = 9s + 3696k - 7 for s. -1 Solve 10p + 75 = 5p - 2k - 0k - 225 - 15, 0 = 19k for p. -63 Solve -3j + 342 - 384 = 0, 0 = -5o + j + 19 for o. 1 Solve 31m + 146 = -5o + 33m, 9 + 31 = 5o + 60m for o. -28 Solve 0 = k - 3f - 11, 4k = -5f - 251 + 261 for k. 5 Solve 52l + 47l - 94l = -t - 188, 0 = -2l - l + t - 108 for l. -37 Solve -116 + 131 = 5d + 5z, -z - 39 = 15d for d. -3 Solve -4p + 2 = -2s, -20 - 11 - 57 = 39p + 2s for p. -2 Solve -11v + 2y + 92 = -3y - 170 + 56, -9y - 156 = -5y for v. 1 Solve 2825 = 3m - 2m + 67o + 282, 5m - o = -53 for m. -3 Solve -580 = 21k + 315p - 307p, -4p = -2k - k - 88 for k. -28 Solve 105g = -4h + 4305, 4g - 164 = -11h - 12h - 6h + 32h for g. 41 Solve -2c - 2r = -26, -13c + 16c + 60r - 59r = 15 for c. 1 Solve -o + 24 = 4r, 0 = -1317o + 1322o - 4r + 124 - 172 for o. 12 Solve 328681o - 2a = 328683o, -2a + 15 = -3o for o. -3 Solve 0 = -5n - 662061m + 662057m - 25, 3n = -5m - 28 for n. -1 Solve -161p - 211v = -210v + 667, -4v = -3p + 80 for p. -4 Solve -27016i = 3h - 27019i + 135, -3h = 11i - 439 for h. -4 Solve -12m + 133 = 5n, -386n + 383n = 2m - 59 for m. 4 Solve -3l - 73 = 5y + 57, 4y - 589 = -174579l + 174592l for y. 1 Solve 8r - 9001 = -5c - 9034, -73 = -2r + 5c for r. 4 Solve -3804c - 44 = 4w - 3811c, 7w + 2c = -3w - 0c - 110 for w. -11 Solve 4a - 683 + 526 = -13p, 0 = 3p + 3a - 84 for p. 5 Solve 7u - 2o = -71, -9u + 10o = -4u + 89 + 25 - 29 for u. -9 Solve 0g + 2g = 4n - 30n - 484, -23 = 3g + 2n for g. 5 Solve 80v - 1924 = -2q, -28 = -70630q + 70628q - v for q. 2 Solve -22c = 4l + 49 - 135, -29l - 10 - 14 = -3c - 32l for c. 3 Solve 0 = -3d + 11297n - 11296n - 1, -3n = 8d - 71 for d. 4 Solve -2l = 2g - 2, 6g = 6g - 7l - 28 + 70 for g. -5 Solve -133j + 128j + 193 = -3i, 6i - 105j - 32 = -106j for i. -1 Solve -6190 = -16n + 17n + 2h - 6196, 5h = -5n + 20 for n. 2 Solve 372f = 422f - 7b + 878, f - 4b + 33 = 0 for f. -17 Solve -2f + 2s = 18, -22s = -6774f + 6769f - 113 for f. -5 Solve -381 = 10x - 6k + 2k - 126 + 15, -11k + 55 = 0 for x. -25 Solve 305v - 308v = -2	{ "pile_set_name": "DM Mathematics" }
69. Let z(r) = -r*3 + 3r + 3. Let w(n) = 4n3 - 11n - 11. Determine bz(f) - 6w(f). -2f3 Let n(v) be the third derivative of -v4/3 + 2v*3/3 - 26v*2. Let g(x) = -7x + 3. Determine -7g(j) + 6n(j). j + 3 Let m(a) = -a + 4. Let w(d) = -2d + 9. Let v = -115 + 108. What is vm(x) + 3w(x)? x - 1 Let f(k) = -3k*3 - 11k - 29. Let m(x) = -2x3 - 7x - 19. Determine 5f(j) - 8m(j). j3 + j + 7 Let i(t) = -t3 - t2 + t + 1. Let u(d) = -d3 - 2d2 - 4d - 2. Let c(r) = 2i(r) + u(r). Let n(f) = -f3 - 2f*2 - f. Calculate 2c(y) - 5n(y). -y3 + 2y*2 + y Let t(l) = -10l3 - l2 - 7l - 4. Let m(s) = 9s3 + s2 + 6s + 5. Determine -7m(d) - 6t(d). -3d3 - d2 - 11 Suppose -3g + 3o - 18 = 0, -4o - 1 = g - 15. Let u(l) = 4l - 2. Let j(a) = -17a + 9. Let v be 4/(8/18)-1. Calculate gj(d) + vu(d). -2d Let j(g) = -2g - 1. Let s(l) = l + 4. Let y(h) = 3j(h) - s(h). Let p = 16 - 8. Let x(w) = 11w + 11. Calculate py(o) + 5x(o). -o - 1 Let j(z) = 3z. Let f be (9/(-18))/(2/(-4)). Let a(m) = 8m - 5m + f + 4m + 6m. Calculate -2a(b) + 9j(b). b - 2 Suppose -5u = u + 18. Let r(c) = -c + 4. Let h(n) = 3. Give ur(a) + 4h(a). 3a Let j(t) = 6t - 17. Let b(h) = 2h - 6. Let y = 16 - -1. Give yb(u) - 6j(u). -2u Let o(m) = 4m2 - 4. Let d(u) = -4u*2 + 3. Determine -4d(p) - 3o(p). 4p*2 Let u be -1 + 1 + 3/1. Suppose -2p - 9 + u = 2m, -16 = 2p + 4m. Let n(a) = -a2 + 3a - 2. Let j(s) = -s*2 + 4s - 3. Give pj(x) - 3n(x). x*2 - x Suppose k + 12 = -3k. Let g(w) = 9w2 - 11w*2 + 3 + 5w - 3. Let b(a) = -a*2 + 3a. Determine kg(p) + 5b(p). p*2 Let x(m) = 11m + 4. Let d(c) = -10c - 5. Determine -2d(u) - 3x(u). -13u - 2 Let i(t) = 6t2 + 6 + 7t*3 - 2t - 4t + 0t*3. Let b = -13 + 19. Let o be 31/b + (-18)/108. Let x(v) = 6v*3 + 5v*2 - 5v + 5. What is oi(u) - 6x(u)? -u*3 Let q(u) = 3u*3 - 5u*2 - 6u - 4. Let k(g) = g3 + g2 + g. Let f(c) = 8c3 - 9c*2 - 11c - 9. Let x(y) = -f(y) + 2k(y). What is -9q(a) - 4x(a)? -3a3 + a2 + 2a Let c(t) = -t. Let l(u) = 7u*2 + 5u - 2. Give 5c(n) + l(n). 7n2 - 2 Let z be (7/(-28))/(3/(-24)). Let t(v) = -v3 + 9v + 4. Let r(c) = 4c + 2. Give zt(i) - 5r(i). -2i3 - 2i - 2 Let v(b) = -4b. Let n(o) = -11o - 3. Let f(t) = 21t + 5. Let l(a) = 4f(a) + 7n(a). Give -3l(k) - 5v(k). -k + 3 Let j(c) = c3 + 8c*2 + 2c. Let z(d) = 2d3 + 17d*2 + 5d. What is -5j(n) + 2z(n)? -n*3 - 6n*2 Let v(w) = -5w*3 - 4w + 3. Let j(b) be the third derivative of -b*4/24 + 2b*2. Let z be j(-3). Let x(y) = -11y*3 - 9y + 7. Give zx(s) - 7v(s). 2s3 + s Let j(k) = k2 - 3k - 4. Suppose 2m + 51 = -f + m, -3m + 15 = 0. Let n be f/(-24) - 4/(-6). Let b(v) = -v*2 + 2v + 2. What is nj(i) + 5b(i)? -2i2 + i - 2 Let s(k) = -5k*3 - 6k*2 - 4k. Suppose 0 = 2c - 4c - 6, a = c - 3. Let h(g) = 4g3 + 5g*2 + 3g. Determine ah(z) - 5s(z). z*3 + 2z Let t = -20 + 13. Let z = 6 + t. Let u(r) = -8r2 - 6r - 7. Let h(f) = f*2 + f + 1. Calculate zu(y) - 6h(y). 2y*2 + 1 Let d(q) = -2 + 1 + q + 1. Let r(j) = 1. Determine -d(c) - 2r(c). -c - 2 Let l(m) be the second derivative of -m5/10 - m4/4 + m*2 - 6m + 4. Let y(h) = 2h3 + 4h*2 - 3. Calculate 3l(q) + 2y(q). -2q3 - q2 Let o(g) = 13g - 5g - 7g. Let a(i) be the second derivative of -i4/6 - i2/2 - 2i. Let k(u) be the first derivative of a(u). What is -k(d) - 3o(d)? d Let i(o) = -15o*3 + 3o*2 - 7o. Let a(u) = 14u3 - 3u*2 + 6u. What is -6a(b) - 5i(b)? -9b3 + 3b*2 - b Let b(p) = p. Let u be 24/162. Let i be u(3 + 1 - 2). Let m(h) = -3h. Calculate im(c) + 3b(c). -3c Let z(n) = -4n3 - 5n*2 - 5. Let y(t) be the third derivative of -3t*6/40 - 11t*5/60 - 11t*3/6 - 3t*2. Calculate -6y(j) + 13z(j). 2j3 + j2 + 1 Suppose o + 2o + 24 = 5s, -4o = -2s + 18. Let z(v) = v*2 + 3v - 2. Let r(m) = 2m2 + 4m - 3. Give oz(k) + 2r(k). k2 - k Let t(r) be the first derivative of -r3/3 - 5r2/2 + 2. Let p(f) = f2 + 3f. Determine 5p(d) + 3t(d). 2d2 Let n(s) = -7s + 6. Let q be 8/20 - 66/(-10). Let p(v) = -5 + v - 2v + qv. Let r = -46 + 51. Give rn(g) + 6p(g). g Let i(g) = -4g + 4. Let w(s) = -s + 1. Suppose 12 = -3n + n. Calculate nw(o) + i(o). 2o - 2 Let z(j) = -2925j2. Let f(c) = 43c*2. Give -273f(q) - 4z(q). -39q*2 Let i(c) = -6c + 6. Let s(r) = 11r - 7. Let d(q) = 88q - 55. Let m(a) = 4d(a) - 33s(a). Give -7i(z) + 4m(z). -2z + 2 Let m(d) = -17d*2 - 4d + 6. Let w(b) = 18b2 + 5b - 7. Give 7m(y) + 6w(y). -11y2 + 2y Let h(c) = -8c - 2. Let w be h(3). Let j be 4/((-8)/w) - 3. Let k(m) = -m. Let p(b) = -4b - 1. What is jk(n) - 2p(n)? -2n + 2 Let v(u) = u - 2. Let b be (-20)/10(-19)/2. Let f(y) = 34 - b - 16. Let h(z) = -z + 1. Let j be h(-1). Determine jf(c) - 2v(c). -2c + 2 Let o(n) = -31n - 7 + 17n + 17n. Let w(y) = -y + 2. Suppose -4t = -b + 4b - 54, 4b - 53 = t. Suppose -1 = -m + 3. Calculate bw(s) + mo(s). -2s Let s(u) = -2u2 - 4u - 4. Suppose 20 = -v - 3v. Let p(y) be the second derivative of y4/4 + 7y*3/6 + 7y*2/2 - 4y. Calculate vs(i) - 3p(i). i*2 - i - 1 Let r(i) = 60i - 12. Let c(t) = 15t - 3. Give -9c(a) + 2r(a). -15a + 3 Let y(i) = i - 1. Suppose 73 = 5j + 8. Let f(w) = 2w - 2. Give jy(o) - 6f(o). o - 1 Let w(c) = -2c2 - 4c - c*2 - 4 + 0c*2. Suppose x - 4 = 1. Let j(d) = -4d*2 - 5d - 5. What is xw(n) - 4j(n)? n*2 Let g(p) = 12p + 10. Let j(x) = -11x - 9. What is -6g(l) - 7j(l)? 5l + 3 Let o(n) = -n2 - n - 1. Let q(w) = 1. Determine -o(g) - q(g). g2 + g Let h(x) = x. Let k be h(-4). Let w(z) = -z + 1. Let f = -9 - -11. Let u(r) = 3 + 3r + 4 - 10 + fr. Calculate kw(v) - u(v). -v - 1 Suppose 3t - 5 - 22 = 0. Let n(c) = 13c2 - 9c + 11. Let h(o) = 6o2 - 4o + 5. Determine th(z) - 4n(z). 2z2 + 1 Let i(g) = 2g*2. Let x(j) = 2j*2 - 4j. Let h be x(3). Let n(o) = -2o2. Calculate hi(u) + 5n(u). 2u*2 Suppose 18a = 17a + 8. Let b(v) = 2v + 1. Let n(g) = -6g - 3. Calculate ab(x) + 3n(x). -2x - 1 Let g(t) = -21t3 - 5t*2 - 7t + 5. Let u(c) = 10c3 + 2c*2 + 3c - 2. Give 2g(n) + 5u(n). 8n3 + n Let l(d) = -11d2 + 7. Let p(w) be the third derivative of w5/10 - 2w3/3 + 7w*2. What is -3l(f) - 5p(f)? 3f*2 - 1 Let g(c) = 21c*3 - 8c*2 + 8c - 2. Let d(l) = -14l3 + 5l*2 - 5l + 1. Determine 8d(s) + 5g(s). -7s3 - 2 Let v(k) = -5k - 4. Let b(f) = 4f + 3. What is 3b(x) + 2v(x)? 2x + 1 Let b(x) = 6x2 - 7. Let i = 21 - 0. Suppose 4q = q + i. Let g(p) be the second derivative of -p4/6 + p2 - 6p. Give qg(t) + 2b(t). -2t*2 Let p(m) = 14m*2 - 9m + 1. Let s(l) = 15l2 - 8l + 1. Calculate -6p(r) + 7s(r). 21r2 - 2r + 1 Let q(t) = -1 + 3 - 3. Let n(l) be the third derivative of l*4/12 + 4l*3/3 + 5l2. Let o(a) = a2 + 7a - 9. Let w be o(-8). Determine wn(r) - 6q(r). -2r - 2 Let k(f) = -f2 - 1. Let w(c) = -c3 - 7c2 - 3c - 9. Let i(o) = 2o3 + 13o*2 + 5o + 17. Let g(y) = 3i(y) + 5w(y). Give -g(z) - 6k(z). -z3 + 2z2 Let z(h) = -h3 - 2h2 + 2h + 2. Let t(n) be the second derivative of -n4/12 + n3/6 + n*2/2 + 7n. Suppose -3 = 5q + 7. Give qt(u) + z(u). -u*3 Let b(y) = 2y*2 + 5y + 4. Let l(q) = 4q2 + 11q + 9. Give 13b(a) - 6l(a). 2a2 - a - 2 Let s(w) = 15w*2 - 4w - 1. Let p(z) = -7z2 + 2z. Determine -9p(m) - 4s(m). 3m2 - 2m + 4 Let o(x) = 2x - 4x*3 - 7x*2 - 8x + x*3 - 5. Suppose -8f + f + 42 = 0. Let r(k) = 4k3 + 8k*2 + 7k + 6. Calculate fo(i) + 5r(i). 2i3 - 2i*2 - i Let o(i) = 14i*3 + 23i*2 - 6i + 17. Let u(s) = 5s3 + 8s*2 - 2s + 6. Calculate -6o(g) + 17u(g). g*3 - 2g*2 + 2g Let h be (-2)/2 - (-2 - -1). Suppose -p + 4 = -hp. Let g(q) = 0q - p + q + 3. Let a(v) = -v*2 - 2v + 3. Give -a(r) - 3g(r). r2 - r Let u(y) = 5y - 3y - 6y - 12 + 2y. Suppose -3p + 0p - 36 = 0. Let t(x) = 1. Calculate pt(n) - u(n). 2n Let l(g) = -1. Let r(h) = 6. Let n(y) = 5l(y) + r(y). Let w(u) be the third derivative of 0 - 5/6u3 - 1/24u*4 + 0u - 2u2. Give -4n(t) - w(t). t + 1 Let i(q) = -1	{ "pile_set_name": "DM Mathematics" }
3/2 + 2590p2 + 154425p/2. -5p(p - 1065)(p + 29)/2 Let 11z*5 - 101z*4/3 + 24z*3 - 4z*2/3 = 0. What is z? 0, 2/33, 1, 2 Factor -3q*3 - 252q*2 - 3948q + 8928. -3(q - 2)(q + 24)(q + 62) Solve 2p*2 - 46132p - 46134 = 0. -1, 23067 Find y, given that -2y3 - 11312y*2 + 295126y - 1920516 = 0. -5682, 13 Let -3u4/7 - 27u*3/7 + 417u*2/7 - 171u + 810/7 = 0. Calculate u. -18, 1, 3, 5 Find x, given that -3x4/8 - 441x*3/8 - 4743x*2/4 + 130161x/2 - 183051 = 0. -86, 3, 22 What is h in 5h5/3 + 680h*4/3 - 31255h*3/3 + 104690h*2 = 0? -174, 0, 19 Factor -2v*2 - 494844v - 30608823042. -2(v + 123711)2 Determine d so that -5d*5 + 230d*4 - 2265d*3 - 8480d*2 - 5980d = 0. -2, -1, 0, 23, 26 Suppose -21z4/5 - 198z*3/5 + 6147z*2/5 - 1848z + 3312/5 = 0. Calculate z. -23, 4/7, 1, 12 Factor q*3/6 - 9551q*2 + 273664803q/2. q(q - 28653)2/6 Factor l2/5 + 3793l/5 + 9828. (l + 13)(l + 3780)/5 Determine v, given that -v3/5 + 42v*2/5 - 117v/5 = 0. 0, 3, 39 Factor u*3/2 + 11267u*2 + 22533u/2. u(u + 1)(u + 22533)/2 Let 484u2 - 4862880u + 12214670400 = 0. Calculate u. 55260/11 Factor -4a2/3 + 106016a - 2107386048. -4(a - 39756)2/3 Determine t so that 2t*4 - 38272t*3 - 114834t*2 = 0. -3, 0, 19139 Factor 5c*3 - 247070c*2 - 494155c - 247080. 5(c - 49416)(c + 1)2 Factor o3/4 - 243o2/4 + 3402o + 35721. (o - 126)*2(o + 9)/4 Let -4k4 - 548k*3 + 16312k*2 - 103168k + 187776 = 0. What is k? -163, 4, 18 Let -158x2 + 85788x + 3258 = 0. Calculate x. -3/79, 543 Solve 4l5 + 3296l*4 - 174412l*3 + 338920l*2 - 167808l = 0 for l. -874, 0, 1, 48 Suppose -k*4 + 28k*3 - 217k*2 + 510k = 0. What is k? 0, 5, 6, 17 Determine l so that -l*5/2 + 54l*3 - 335l*2 + 1509l/2 - 585 = 0. -13, 2, 3, 5 Factor 108z4 - 48816z*3 + 4195944z*2 - 133021040z + 1446542604. 4(z - 351)(3z - 101)3 Solve -z3 - 33641z*2/4 + 46273z/2 + 25239/4 = 0 for z. -8413, -1/4, 3 Let 252p4 + 14356p*3 + 27264p*2 - 880p = 0. Calculate p. -55, -2, 0, 2/63 Factor -4u2 + 47868u + 47872. -4(u - 11968)(u + 1) Factor -5h2 + 2289170h - 262014964445. -5(h - 228917)2 Find n, given that 2n*3 - 5070n*2 - 2n + 5070 = 0. -1, 1, 2535 What is r in 400r4 + 7720r*3 + 37249r*2 = 0? -193/20, 0 Factor -2g*4/25 + 366g*3/25 + 30996g*2/25. -2g*2(g - 246)(g + 63)/25 Suppose -22x*5/15 - 1246x*4/5 - 154738x*3/15 + 116958x*2/5 + 91504x/3 - 14792/5 = 0. What is x? -86, -1, 1/11, 3 Solve -6z4/11 + 8450z*3/11 + 73610z*2/11 + 9530z + 39676/11 = 0. -7, -1, -2/3, 1417 Find r such that -3255r2/4 + 8125r/2 + 125/4 = 0. -5/651, 5 Factor 2g2/3 + 582g - 3516. 2(g - 6)(g + 879)/3 Factor 5j2 + 59310j + 175883805. 5(j + 5931)2 Factor -7u*3/4 + 38u*2 - 355u/4 - 57/2. -(u - 19)(u - 3)(7u + 2)/4 Factor 4x*3 + 72104x*2 + 324792420x - 1300323600. 4(x - 4)(x + 9015)*2 Solve -3p*3 + 1983p*2 + 16008p + 32112 = 0 for p. -4, 669 Suppose -2t2/5 + 2796t/5 + 16848/5 = 0. Calculate t. -6, 1404 Let 2r4/11 + 504r*3/11 - 150796r*2/11 + 8146440r/11 - 7996150/11 = 0. What is r? -443, 1, 95 Factor 3w3 - 81w*2 + 396w + 1140. 3(w - 19)(w - 10)(w + 2) Determine j, given that -2j*4 - 464j*3 - 9102j*2 - 50840j - 42200 = 0. -211, -10, -1 Factor -2x2/3 + 135412x - 6876153654. -2(x - 101559)2/3 Determine c so that c3 + 49c*2 - 284c - 756 = 0. -54, -2, 7 Determine i so that 3i3 + 633084i*2 + 1899231i + 1266150 = 0. -211025, -2, -1 Factor 3h3 - 16526h*2 - 22039h - 5510. (h - 5510)(h + 1)(3h + 1) Solve -4q*5/19 + 6q*4/19 + 176q*3/19 + 294q*2/19 - 280q/19 - 192/19 = 0 for q. -4, -3, -1/2, 1, 8 Factor -4q3/5 + 1131316q*2/5 - 79992808896q/5 + 79991677584/5. -4(q - 141414)2(q - 1)/5 Solve -14s5 - 4077s*4 - 352581s*3 - 4007966s*2 + 449361348s + 96472296 = 0. -106, -3/14, 27 Let 10u4/3 + 98u*3/9 - 172u*2/3 - 16u = 0. Calculate u. -6, -4/15, 0, 3 Factor p*2/2 - 2593p + 6723649/2. (p - 2593)*2/2 Solve -4c*5 + 984c*4 - 6728c*3 + 8576c*2 + 6732c - 9560 = 0 for c. -1, 1, 2, 5, 239 Factor -28z2 - 2850324z - 814376. -4(z + 101797)(7z + 2) Let -m2/7 - 163m/7 + 330/7 = 0. What is m? -165, 2 Suppose a*5/2 + 11a*4/2 - 46a*2 + 40a = 0. Calculate a. -10, -4, 0, 1, 2 Find s such that -s*2 - 8890s - 19758025 = 0. -4445 Find m such that m*4/5 - 248m*3/5 + 981m*2/5 - 1222m/5 + 488/5 = 0. 1, 2, 244 Factor -5d3 + 820d*2 - 39220d + 438080. -5(d - 74)2(d - 16) Factor 3o2/5 + 95652o/5 + 669417/5. 3(o + 7)(o + 31877)/5 Determine m, given that 30258m3/19 - 995070m*2/19 - 113554m/19 - 3234/19 = 0. -7/123, 33 Suppose x*4/3 + 29x*3/3 - 1921x*2/3 + 1891x/3 = 0. Calculate x. -61, 0, 1, 31 What is w in 4w5/11 + 386w*4/11 - 2236w*3/11 + 874w*2/11 + 540w + 2448/11 = 0? -102, -1, -1/2, 3, 4 Let 4v3 - 14372v*2 + 314732v - 1728364 = 0. What is v? 11, 3571 Factor -r*2 + 57021r. -r(r - 57021) Suppose -2m*4/7 - 502m*3/7 + 5708m*2/7 - 2096m = 0. What is m? -262, 0, 4, 7 Factor 5t4 - 35325t*3 + 83155020t*2 - 65137886960t - 196163010240. 5(t - 2356)3(t + 3) Factor -o*4 + 55o*3 - 158o*2 + 104o. -o(o - 52)(o - 2)(o - 1) What is i in 3i*2/4 - 32133i/4 - 32139/2 = 0? -2, 10713 Determine d so that 2d3 - 228d*2 + 6022d - 31668 = 0. 7, 29, 78 Factor -55f2 - 2380f + 6900. -5(f + 46)(11f - 30) What is z in 3z*5 - 378z*4 - 80904z*3 - 3970512z*2 - 64075536z - 112910112 = 0? -42, -2, 254 Let u*5/5 - 59u*4/5 - 846u*3/5 - 478u*2/5 + 745u - 2343/5 = 0. What is u? -11, -3, 1, 71 Factor y*4/2 - 49y*3/2 - 3y*2/2 + 149y/2 - 49. (y - 49)(y - 1)2(y + 2)/2 Solve -4w2 + 105740w + 2116400 = 0. -20, 26455 Factor -8f2/5 - 46f - 300. -2(f + 10)(4f + 75)/5 Factor 3z*2/4 + 60507z/2 + 1220365683/4. 3(z + 20169)2/4 What is z in z5 + 228z*4 + 17085z*3 + 421966z*2 = 0? -94, -67, 0 Solve 2x*4 + 53078x*3 - 106164x*2 = 0. -26541, 0, 2 Solve 3a*4 + 651a*3 + 5064a*2 + 10032a = 0. -209, -4, 0 Suppose -b*3/2 + 49342b*2 - 1217415160b + 4868871200 = 0. Calculate b. 4, 49340 Factor 4h3 + 976h*2 + 13040h + 36800. 4(h + 4)(h + 10)(h + 230) Suppose 104v*4/5 + 9348v*3/5 + 199548v*2/5 - 490912v/5 - 584016/5 = 0. Calculate v. -46, -23/26, 3 Factor -5w3 + 430w*2 - 2725w - 3160. -5(w - 79)(w - 8)(w + 1) Find b such that -14b*3/17 + 556b*2/17 - 5762b/17 + 5220/17 = 0. 1, 18, 145/7 What is a in a*2/2 - 241a - 45603/2 = 0? -81, 563 Find c such that 2c5/3 + 316c*4/3 + 17710c*3/3 + 398300c*2/3 + 835000c - 2250000 = 0. -50, -45, -15, 2 Determine t, given that 3t5 + 106t*4 - 577t*3 - 680t*2 = 0. -40, -1, 0, 17/3 Factor -2x*2/7 - 2888x/7 - 17256/7. -2(x + 6)(x + 1438)/7 Find p such that p*4/2 - 50p*3 - 13509p*2/2 - 154602p + 161406 = 0. -42, 1, 183 Factor -4s3 + 6428s*2 + 12872s. -4s(s - 1609)(s + 2) Determine p so that p4/5 + 8393p*3/5 - 1679p*2 - 8393p/5 + 8394/5 = 0. -8394, -1, 1 Determine z, given that z*2 - 23906z + 47808 = 0. 2, 23904 Let 10c2/7 - 2022c/7 + 4400/7 = 0. Calculate c. 11/5, 200 Solve p*4/7 + 67p*3/7 + 1402p*2/7 + 7332p/7 - 36504/7 = 0 for p. -26, -18, 3 Solve 2s4 + 16s*3 + 8s*2 - 96s = 0 for s. -6, -4, 0, 2 Suppose 35w5/2 + 4255w*4/2 + 126165w*3/2 - 187155w*2/2 + 28350w = 0. Calculate w. -63, -60, 0, 3/7, 1 Determine b so that -b*2 + 106587b + 106588 = 0. -1, 106588 Suppose -t*5/3 - 132t*4 - 13707t*3 - 377050t*2/3 - 139732t + 893976 = 0. Calculate t. -193, -6, 2 Find u such that -24u5 + 212412u*4 - 4032459u*3/2 + 8513313u*2/2 + 5039295u/2 + 663075/2 = 0. -1/4, 5, 8841 Factor 11z2 + 6025z/4 - 411/4. (z + 137)(44z - 3)/4 Determine z, given that -z*3/3 - 1891z*2/3 - 26033z - 271803 = 0. -1849, -21 Suppose -605i3 - 143275i*2 - 2910000i - 15480000 = 0. Calculate i. -215, -120/11 Suppose -490o3 + 1961o*2 + 2446o - 5 = 0. What is o? -1, 1/490, 5 Let 2c5/7 + 66c*4/7 - 302c*3/7 - 194c*2/7 + 1020c/7 - 592/7 = 0. What is c? -37, -2, 1, 4 Suppose c*4 + 314c*3/7 + 3496c*2/7 - 2166c - 30	{ "pile_set_name": "DM Mathematics" }
positive. a(4/5) Simplify ((c(-2/9)/c)(7/10))(3/4) assuming c is positive. c(-77/120) Simplify w(6/11)w/(ww*11/ww) assuming w is positive. w(-115/11) Simplify ((p(-2/5))(-22))41 assuming p is positive. p(1804/5) Simplify b(-9/5)b/b(2/99) assuming b is positive. b(-406/495) Simplify qqqq/((q/(q*(9/4)/q))/qq)qq8 assuming q is positive. q(53/4) Simplify ((nn(-5/3)nnn)/(n/(n*(3/7)n)))/((n*0n)/n)(-2) assuming n is positive. n(58/21) Simplify ((xxx(2/35))/x)/(x(2/59)/xx) assuming x is positive. x(2113/2065) Simplify ((zz(z(-4)/z)/zz)(-38))(-6/5) assuming z is positive. z(-684/5) Simplify l9/(ll(2/15)l)(l(-2/5))(37/5) assuming l is positive. l(293/75) Simplify (l/l(-3))/(l/(l(1/27)l)l) assuming l is positive. l(82/27) Simplify (l/l(2/5))/(ll*(-2/5)l)l(1/4)/(((l(4/9)l)/l)/l) assuming l is positive. l*(-7/36) Simplify (w(w/w*(-1/6))/ww*(-2)/www)(-1/12) assuming w is positive. w(-1/72) Simplify (v/v(-2/31))(-1) assuming v is positive. v(-33/31) Simplify (u/(u/(u/(u/u(-1/3))u))uuu(-1)u)/(u/((u/(uu(-7)/uuu))/u)uu/(uu/u(-2))) assuming u is positive. u(26/3) Simplify (rr(-1/9))/(rr*(-1/14)r) assuming r is positive. r*(-131/126) Simplify ((gg(-2/15))/g)(-20) assuming g is positive. g*(8/3) Simplify ((vvv/(v(-3/7)/v)vv)/v)(3/10) assuming v is positive. v(57/35) Simplify (y/(yyy/(yyyy(-2/9))))/y(-1/5)y(6/5)/(y(-6)/y) assuming y is positive. y(413/45) Simplify x(-2)/((x(-23)/xx)/x) assuming x is positive. x*22 Simplify (z/(z/((zz(z(-2/89)zz)/zz)/z)))(-4) assuming z is positive. z(-1060/89) Simplify (cc(c/c*(-17/2))/cc)(3/4) assuming c is positive. c(69/8) Simplify (h(2/9))(-1/7) assuming h is positive. h(-2/63) Simplify o(-3/4)(o3o)/oo/(oo*(-2))o(5/6) assuming o is positive. o(61/12) Simplify (ww/(w/w5w))/(w*(-3/2)w)w5/w(-6) assuming w is positive. w(33/2) Simplify v(-1/16)/((v(-5)v)/v) assuming v is positive. v(79/16) Simplify j(-1/13)/jjjj/j20jjj assuming j is positive. j(-196/13) Simplify s/(s17sssssss)s(ss/s*(-13)s)/sss assuming s is positive. s*(-5) Simplify (bbb/((bbb(-4/5))/b)bb)43 assuming b is positive. b(1032/5) Simplify (g(g/g(-1))/g)(-2/21) assuming g is positive. g(-4/21) Simplify (k/k5)12 assuming k is positive. k(-48) Simplify ((mm/(m/m(-12)))/m)/(m/(mmm/(m(1/13)m)mm)) assuming m is positive. m(-118/13) Simplify (v(-1))*6v*(-1/6)v/(v/v(-7)) assuming v is positive. v(-79/6) Simplify (z/(z(zzz(-1/2))/z))(-45)/(z/z(2/3)z)(-3/11) assuming z is positive. z(503/22) Simplify nnn/(((nn(-2))/n)/n)n*(-5)(nn(-1))(-19/4) assuming n is positive. n Simplify (s/s33)(-6) assuming s is positive. s192 Simplify (gg/g(2/7))14(g(-2/5))(-24) assuming g is positive. g(168/5) Simplify c(-12)/c10 assuming c is positive. c(-22) Simplify ((b2)5)(-1/4) assuming b is positive. b(-5/2) Simplify ((a/((a/a(-3))/a))(-26))(9/4) assuming a is positive. a117 Simplify (w(2/21))(-36) assuming w is positive. w(-24/7) Simplify (m1/m(-1))(-22) assuming m is positive. m(-44) Simplify (((x(x*(2/19)/x)/xx)/x)/x)/(xx/x(-4/11)) assuming x is positive. x(-890/209) Simplify ((q/(qqq5/qq))/q(-1/8))/((q/(q(-9)/qq))/(q(qq(2/5))/q)) assuming q is positive. q(-579/40) Simplify y(2/29)/((y(1/16)y)/y) assuming y is positive. y*(3/464) Simplify (r(r/(r/r*(-24)))/r)/rr/((r/((rr/(r/((r/(rr/r*12rr))/r)))/rr))/r) assuming r is positive. r(-15) Simplify (r(1/2)r(-2/7))(-6) assuming r is positive. r(-9/7) Simplify nn*(3/8)nnn(-16) assuming n is positive. n(-101/8) Simplify (mmmm(-2/11))/(mm(m(11/3)mm)/m) assuming m is positive. m(-127/33) Simplify (kk*(-8/7))/kk*(2/11)k assuming k is positive. k(3/77) Simplify n(-6)n(-1/4)n(nn/n*0nn)(2/47) assuming n is positive. n(-955/188) Simplify ((((vv*(-1)v)/v)/v)/vv)/vv(-11/3) assuming v is positive. v(-17/3) Simplify (p(-8)/p(1/4))/(pp(-2/7))(8/11) assuming p is positive. p(-2701/308) Simplify u31/(uu(-1/36)) assuming u is positive. u(1081/36) Simplify (h(-8))(-32) assuming h is positive. h256 Simplify w(-3/32)w(((w/w(-2/21))/w)/w)/w assuming w is positive. w(-671/672) Simplify (((x*(-7/3)x)/x)/x)/(x(x(x(10/3)/x)/x)/x) assuming x is positive. x(-17/3) Simplify hh(-11/3)/hhh(-9/7)/hhhh assuming h is positive. h*(-41/21) Simplify gg/g*3g/((g*3g)/gg)(g/(g/(g/((g/((g/(g/(g/(g/(g*(-3/8)/g)g))))/ggg)g)/g)g)))/(g*1g) assuming g is positive. g*(-51/8) Simplify ((ss*(2/15))/sss(-7))8 assuming s is positive. s(-704/15) Simplify dd*(-3/14)dd16 assuming d is positive. d(249/14) Simplify (((bb*(2/11)b)/b)/bb(-2))/(((b(((bb(1/4))/bb)/b)/bb)/b)/((bb*0)/bb)) assuming b is positive. b(-47/44) Simplify (p/(p/p(-4))p)(-5) assuming p is positive. p15 Simplify a(2/33)/(a/a(-4)) assuming a is positive. a(-163/33) Simplify (yy/(y/y*(-2)y))/y*(-4/3)(yy(2/25))/((yy/y*(4/3)y)/yyy) assuming y is positive. y(-169/75) Simplify (n(-2/11)nn*(-1/7))/((nn*(-2/7)n)/n)13 assuming n is positive. n(-663/77) Simplify ((y*(-13)y)/yy/(yy(1/8)))(31/4) assuming y is positive. y*(-3255/32) Simplify nn*(-3)n*(1/11)nnnn/n3n/n(1/5) assuming n is positive. n(-6/55) Simplify (c/c*(-5)((c/(c(-7)/c))/c)/c)/(((c/(c/(((c1c)/cccc)/c)))/cc)/c)(13/2) assuming c is positive. 1 Simplify r(9/5)/rrr(-8) assuming r is positive. r(-31/5) Simplify t5/(tt*(-10)t) assuming t is positive. t13 Simplify (v/v(-9/7))/((v/(v/v*(-2)vv))/v) assuming v is positive. v(51/7) Simplify ((f/(f1f))/f)*(-2)/((fff(-3)/ff)/f)44 assuming f is positive. f92 Simplify ((l/(l*8ll))/((l(2/3)l)/l))/(ll/(l1l)l)(2/17) assuming l is positive. l(-499/51) Simplify (j/(j/(jj*28))j)/jjj/((jj26/jj)/j)jj assuming j is positive. j7 Simplify n/n9n(2/7) assuming n is positive. n(-54/7) Simplify (o(1/3)ooo/(o/(o*8/o)))/(o/(oo(1/2)))9 assuming o is positive. o(83/6) Simplify (u(-2/5)u(1/4))/(u(-3/5)/(u/(uuu/u(-2/11)))) assuming u is positive. u(-381/220) Simplify (y(2/7)y(yyy3)/y)(5/3) assuming y is positive. y(185/21) Simplify (z3zzzz(-7))(8/13) assuming z is positive. z(-8/13) Simplify (w(4/5)ww(3/4))(-47) assuming w is positive. w(-2397/20) Simplify i28/i(-7) assuming i is positive. i35 Simplify ((z/(z/((z34z)/z)))/zz)/zzz28 assuming z is positive. z62 Simplify (x38x)/(x/(x(4/7)/x)) assuming x is positive. x(263/7) Simplify ((f*2f)/((f/f*(3/7))/f))/((ff/(f/(f/(ff(1/8)/ff)f)))/(f/(ff/f(2/7)))) assuming f is positive. f(47/56) Simplify (((s*(-2/9)/s)/s)/s(s/s*3)/sss)39 assuming s is positive. s(-494/3) Simplify (kk*3((k/(k/(kk/((k/(kkkk*1kk)k)/k))))/k)/k)(4/13) assuming k is positive. k(36/13) Simplify (q/q(-1/2))(-2/11)(q/(q(-7)q)q)/(q(-2)q) assuming q is positive. q*(96/11) Simplify (nn(n(nn(-6))/nn)/nnn*7nn)(2/75) assuming n is positive. n(14/75) Simplify (d(-9)/d)/(dd/(d/d*(-9)))(d(2/3)/d)(-2/3) assuming d is positive. d(-16/9) Simplify ((a/((a/(a/a(-5/3)))/aa)a)/(a/(a3/a)))19 assuming a is positive. a*(266/3) Simplify (r((r*(-6/7)/r)/r)/rrr/(rrrrr(1/4)r))5 assuming r is positive. r(-855/28) Simplify bbb*(-2/9)b(2/35) assuming b is positive. b(578/315) Simplify ((b*(-1/3)b)/b0)(-7) assuming b is positive. b(-14/3) Simplify (v(-1))18 assuming v is positive. v(-18) Simplify ((c/c*5c)5)(-1/45) assuming c is positive. c(1/3) Simplify (f0)(19/2)/(f(1/4)/f(2/3)) assuming f is positive. f(5/12) Simplify (((f*3f)/f)/(f*8f))/(f(f(fff/(ff/(ff*7)))/f)/ff*0/ff) assuming f is positive. f(-15) Simplify w(-1/16)(w/w(2/19)w)/w assuming w is positive. w(253/304) Simplify y(2/89)/(y	{ "pile_set_name": "DM Mathematics" }
positive. x(217/9) Simplify (d(-38)((d(-22)/d)/d)/d)(-2/7) assuming d is positive. d18 Simplify ((x/(x(-13)xx))/(x(-14)/x))/((x(-18)x)/(xx(-2/3)/x)) assuming x is positive. x(130/3) Simplify (((gg(-3/5))/(g/g(-12/11)))/(gg(-2/19)ggg*(2/23)g))(-27/4) assuming g is positive. g(3681207/96140) Simplify f/f*(-16)f*6(f(f(-3/2)/fff)/f)/((f/(ff*(-5)/ff))/fff) assuming f is positive. f(33/2) Simplify (v(-7))*(3/26)v/v*27v(1/4) assuming v is positive. v(-1381/52) Simplify (qqq*13q)/qq/q17q(2/21)/q7 assuming q is positive. q*(-166/21) Simplify (qq(-18))/(q6q)(qq(-23))/q7 assuming q is positive. q(-53) Simplify (q/(qq(6/19)))/((q(-17)/q)/qq)(qq/q(-10))(-14) assuming q is positive. q(-2856/19) Simplify ((gg*(-3/10)g)/(g/(g*(-1)g)))/(g*(2/3)/(g(g*(-6/11)/ggg)/g)) assuming g is positive. g(161/330) Simplify (((g(-1/4)g)/(gg(-1/7)g))(-28))(-1) assuming g is positive. g(-31) Simplify ((z/((z/z(4/7))/z))/z)15/(z(-1/19)z5) assuming z is positive. z(482/133) Simplify (uu/u*4u(4/7))/(u(3/7))(1/7) assuming u is positive. u(-73/49) Simplify ((v(v(1/7)v)/vvv(1/6))(1/4))(-25) assuming v is positive. v(-2425/168) Simplify ((m/m(-48))/(m/m21))(-43) assuming m is positive. m(-2967) Simplify (((dd/((dd/((dd(6/13))/d)d)/d)d)/d)/d)(-13)/(dd(d(d*(-2/7)d)/ddd)/d)(-3/4) assuming d is positive. d(137/14) Simplify y*(-2/35)/((y(yy(y*(1/13)/y)/y)/yy)/y)(y(y/(y/(y(2/5)/y)))/y)(6/5) assuming y is positive. y(-1943/2275) Simplify (w(-2/5))(-1/2)/((w12/w)/(w*(3/7)w)) assuming w is positive. w(-328/35) Simplify ((((j(-1)/jj)/j)/j)(-32)/((j(-8/5)j)/(j/(j*(-9)j)j)))(-3/32) assuming j is positive. j(-1599/160) Simplify (n(-1/9)/n(2/5))(-14/5) assuming n is positive. n(322/225) Simplify ((o(1/2)/o)27(((o*(-1/4)/o)/o)/oo)50)(6/23) assuming o is positive. o*(-756/23) Simplify (kk11)/k(8/5)k(-4/5)/(k(1/10)k) assuming k is positive. k(17/2) Simplify z(-12)/(z*(-11)/z)z*1(zz/(z/(z(-1/5)/z)))/z assuming z is positive. z(-1/5) Simplify (b/b(6/7)b/b*7(b*1/bbb)44)23 assuming b is positive. b(13225/7) Simplify (p(-2/19)/(pp(1/16)))/(p(-3/17)/(p/p(-20))) assuming p is positive. p(103405/5168) Simplify ((z(z(-4/5)/z)/z)/z(2/13)z*4/(zz/(z/(zz(z/z(-6))/z))))(-26) assuming z is positive. z*(904/5) Simplify ((yy(1/36))27)(2/53) assuming y is positive. y(111/106) Simplify (kk/((k/k0k)/k)k(-3))/((kk(2/23))/k(2/3)) assuming k is positive. k(-167/69) Simplify (((w(2/5)ww)/w)*(-2/13)/((ww(-5))/w(-3/2)))5 assuming w is positive. w(297/26) Simplify ((p/p*(-1/4)p/(p*(2/5)p)p)/(p0)35)2 assuming p is positive. p(37/10) Simplify (g(-14))(-43)g*(1/7)gg10g assuming g is positive. g(4299/7) Simplify (k(-17))(1/78)/(((k/(k(-6)/k))/k)/(k/(k*(-2/59)k))) assuming k is positive. k(-33061/4602) Simplify m(10/3)m(-10/7)((m/(m(-3)/m))/m)36 assuming m is positive. m*(3064/21) Simplify (w/(www(-6)/w))/ww*(-10)/ww*(-3)w/((w/(w/(w/w(-2/17))))/w) assuming w is positive. w(-138/17) Simplify ii/i(-3/7)iii(iii/((i(-2/27)i)/ii))/ii(i/((i(-4/7)/i)/i)i)/iiii10 assuming i is positive. i(623/27) Simplify (n(-1))(-21/5)/(n2/((n/(((nn*(-16)n)/n)/n))/n)) assuming n is positive. n(91/5) Simplify (h1)*(-8)/(hhh11(h/h*2)/hh) assuming h is positive. h*(-20) Simplify (((((oo/(oo(1/3))o)/o)/o)22)(1/33))(5/9) assuming o is positive. o(-10/81) Simplify (s(-1/2))(-2/161)ss(s/s(-12/11))/sss(ss13)/s assuming s is positive. s(32050/1771) Simplify ((j/j7)/j(-1/2)j*(6/5)jj(-5))(2/131) assuming j is positive. j(-83/655) Simplify (oo(-15))(-4)/(o/(oo/(o/(o/(o(2/15)/o))o))o(-2/21)) assuming o is positive. o(5981/105) Simplify z(-4)zz(-11/5)z(z(-5)z)(34/5) assuming z is positive. z(-157/5) Simplify (s(-9)/s)(-28)/(s*(1/6)s/(s/(ss/((ss/(s/(((ss(-13))/s)/s)))/s)))) assuming s is positive. s(1583/6) Simplify i15i*(-25/4)(i(-13))(22/3) assuming i is positive. i(-1039/12) Simplify (w(-3/7))*10(www/(w/w*(-27)))/(ww(-1/4)) assuming w is positive. w(-841/28) Simplify ((b(-2/13))(-22))(-4/13) assuming b is positive. b(-176/169) Simplify (x(-1/9))(37/4)/(xx/(x/x(-29))x(-3/7)/x) assuming x is positive. x(7157/252) Simplify a*(-8)(aa1/aa)/a(a(a*(-2)a)/a)(-20/7) assuming a is positive. a(-29/7) Simplify (x/(xx/x(-2/5)))(-49)x*(1/46)/xx(15/7) assuming x is positive. x(112321/1610) Simplify w(1/5)/w(-7/5)(w/((w/(w(1/4)w)w)/w))/w7 assuming w is positive. w(-83/20) Simplify ((o/o(-2/3))(-15/2)/((oo/(oo(-2/11)o))/(oo(2/3)/o)))2 assuming o is positive. o(-793/33) Simplify (h(5/2)hh19/hh)(-26) assuming h is positive. h(-585) Simplify ((h(h(-20)/h)/h)/h)/((h/h(-17/4))/h)(h(1/2))(-50) assuming h is positive. h(-205/4) Simplify (v/v(-1/10))/(vv/(v/v(-5/8)))(v(-3/2))(-37) assuming v is positive. v(2249/40) Simplify ((b/(b(-1/5)/b))*(1/3)b/b*(-6)b(-2/17))(-2) assuming b is positive. b(-3884/255) Simplify ((b(-3/11)bb*(-2/5)bb)(-20/7))30 assuming b is positive. b(-15360/77) Simplify (d/((ddd/(d/(d(-2/25)d))d)/d))/(d(-2/3)/dd)(dd(dddd/d*(-7/2))/dd)/(d/(d/(d/(d/d*22)d))) assuming d is positive. d(-2213/150) Simplify (f(-1))*(-11/4)(f(2/9))(-40) assuming f is positive. f(-221/36) Simplify (w10/w)(-41/5)/(w/w(2/7)w)(18/13) assuming w is positive. w(-34659/455) Simplify ((u(-15))(5/3))(-28) assuming u is positive. u700 Simplify (qq*(-7)qq5/q)/(qqq/(qq*(2/15)q)q(-2/11)q) assuming q is positive. q(-443/165) Simplify i8ii*(2/31)i*(-5)i*(-3/5)i assuming i is positive. i*(692/155) Simplify oo*3o*(-5/6)/o(oo/o(1/13)oo)/(oo*(1/23)oo) assuming o is positive. o(5465/1794) Simplify ((s/(s/(s/(ss*(5/6)))))/(s(s*(8/3)/sss)/sss))(-1/15) assuming s is positive. s(13/30) Simplify (u(-12)/(u/u19))/(u(-20)/(u(3/2)u)) assuming u is positive. u(57/2) Simplify (((a(-1/3))(-23))(1/34))(10/11) assuming a is positive. a(115/561) Simplify (u/(uu10u)u/(uu*(2/13)/u))/((uu/(u/(u(uu/((uu(-4/5)u)/u))/uu)))/u(7/4)) assuming u is positive. u(-3173/260) Simplify (((j/((j(-4/5)/j)/jjj))/((j/j(4/3)j)/j))/(j*6j*(6/11)j))(-1/30) assuming j is positive. j(893/4950) Simplify ((w(1/3)/w)/(w/w8)((w/w(-1))/w)(-39))28 assuming w is positive. w(-2744/3) Simplify (ww/w(3/2))/(w/(w(-17)w)w)(w(w/(w/((w/w*(-5/8))/w)))/ww)/w10 assuming w is positive. w(-207/8) Simplify (a*(-22)a/a(1/27))/(a(-19)/((aaa*(-16/3)aa)/a)) assuming a is positive. a(-118/27) Simplify (z/z(-27)z/((zz/z(-16))/z))/((z/(zzz14)z)/z)(-4/13) assuming z is positive. z(96/13) Simplify (l/l(-2/27))(-13)/((ll(-6/11))/lll16) assuming l is positive. l(-9034/297) Simplify (s4/s)(4/17)/(s(4/17)/ss5) assuming s is positive. s(-60/17) Simplify (((gg(1/5)gg)(-8))(-8))(-27/7) assuming g is positive. g(-27648/35) Simplify f11/(f(2/23)f)(((ff/(f*(1/3)/f)f)/ff)/f)/f7 assuming f is positive. f(385/69) Simplify ((m1(m(-2/15)/m)/m)0)(-27) assuming m is positive. 1 Simplify ((l(3/5)ll/(l/(l/(l*(-5)l)l)))/((ll*(-7/5)ll)/(lll(-1/3))))(28/9) assuming l is positive. l(644/27) Simplify ((g(-3)/g)/g(g/(g/g*(-4/11))g)/g)/((g/(((g*(-2/3)g)/gg)/g))/g(3/2)) assuming g is positive. g(-365/66) Simplify ((g/(gg*(1/10)))/gg*(5/3)ggg)/(g0)(-45) assuming g is positive. g*(107/30) Simplify (pp/(p/(p/p*(-8)))p*(-1)pp)/(p(-1/3)pp(((p*(-2/19)p)/p)/p)/p) assuming p is positive. p(652/57) Simplify ((m(3/4)/m)/mm10)12 assuming m is positive. m105 Simplify ((b/(bb(-3/5)))/b11)/(b*(-33)/(b(bb(((((b/b*(-22/9))/b)/b)/bb)/b)/bb)/b)) assuming b is positive. b*(1127	{ "pile_set_name": "DM Mathematics" }
401 What are the prime factors of 103993605? 3, 5, 83, 9281 List the prime factors of 6587956. 2, 1646989 What are the prime factors of 5865839730? 2, 3, 5, 23, 2833739 List the prime factors of 286236102. 2, 3, 19, 2510843 List the prime factors of 5480562660. 2, 3, 5, 41, 2227871 What are the prime factors of 346104826? 2, 73, 2370581 What are the prime factors of 86795302? 2, 11, 17, 232073 List the prime factors of 45335645. 5, 23, 394223 List the prime factors of 482890033. 821, 588173 What are the prime factors of 207784815? 3, 5, 7, 43, 46021 List the prime factors of 35273503. 211, 167173 What are the prime factors of 15759041? 15759041 What are the prime factors of 3368587428? 2, 3, 93571873 List the prime factors of 170673754. 2, 23, 3710299 What are the prime factors of 45441455? 5, 257, 35363 What are the prime factors of 253351069? 107, 2367767 List the prime factors of 101085659. 6997, 14447 What are the prime factors of 1616000? 2, 5, 101 List the prime factors of 143772147. 3, 15974683 List the prime factors of 186120282. 2, 3, 47, 660001 What are the prime factors of 26493081? 3, 8831027 List the prime factors of 23482124. 2, 37, 158663 What are the prime factors of 193917626? 2, 7, 3677, 3767 List the prime factors of 47992788. 2, 3, 1333133 What are the prime factors of 2820985311? 3, 1217, 772661 What are the prime factors of 118251652? 2, 29562913 List the prime factors of 79850214. 2, 3, 4436123 What are the prime factors of 2658118690? 2, 5, 109, 389, 6269 List the prime factors of 53919518. 2, 701, 38459 What are the prime factors of 913657929? 3, 547, 556769 List the prime factors of 61141954. 2, 199, 153623 List the prime factors of 228949815. 3, 5, 2389, 6389 What are the prime factors of 122895099? 3, 593, 23027 List the prime factors of 164858587. 139, 1186033 What are the prime factors of 905006472? 2, 3, 443, 85121 What are the prime factors of 1555764123? 3, 37, 43, 325951 What are the prime factors of 543889280? 2, 5, 11, 23, 3359 What are the prime factors of 1076294788? 2, 269073697 List the prime factors of 1769622179. 13, 136124783 List the prime factors of 1693940586. 2, 3, 13, 37, 586951 List the prime factors of 170592454. 2, 107, 797161 List the prime factors of 4521870796. 2, 257, 4398707 List the prime factors of 113655788. 2, 23, 1235389 List the prime factors of 653639792. 2, 13, 3142499 What are the prime factors of 115460738? 2, 57730369 List the prime factors of 261251828. 2, 65312957 What are the prime factors of 232394222? 2, 116197111 What are the prime factors of 90999377? 7, 41, 317071 What are the prime factors of 89205517? 6733, 13249 What are the prime factors of 1046248456? 2, 11, 103, 115429 What are the prime factors of 77477997? 3, 53, 487283 What are the prime factors of 1448321346? 2, 3, 80462297 What are the prime factors of 123202766? 2, 23, 2678321 List the prime factors of 594575967. 3, 23, 61, 141263 What are the prime factors of 479435870? 2, 5, 17, 2820211 What are the prime factors of 42356616? 2, 3, 23, 76733 What are the prime factors of 3126291419? 61, 823, 62273 What are the prime factors of 3235380270? 2, 3, 5, 37, 659, 4423 List the prime factors of 4038421057. 11, 31, 127, 93251 List the prime factors of 957896817. 3, 41, 7787779 What are the prime factors of 1670627646? 2, 3, 1117, 27697 What are the prime factors of 3576756633? 3, 17, 70132483 List the prime factors of 2413061102. 2, 1206530551 List the prime factors of 439734852. 2, 3, 17, 53, 4519 What are the prime factors of 90445367? 90445367 List the prime factors of 32660910. 2, 3, 5, 17, 21347 What are the prime factors of 2187099? 3, 243011 List the prime factors of 38064384. 2, 3, 5507 List the prime factors of 32377556. 2, 191, 42379 What are the prime factors of 17477886? 2, 3, 167, 17443 List the prime factors of 4961318117. 7, 907, 781433 What are the prime factors of 28246855? 5, 7, 13, 62081 List the prime factors of 483882604. 2, 120970651 List the prime factors of 1522956130. 2, 5, 6247, 24379 List the prime factors of 361433023. 7, 53, 974213 List the prime factors of 42896011. 157, 433, 631 What are the prime factors of 2033559298? 2, 1016779649 What are the prime factors of 2360838470? 2, 5, 61, 3870227 What are the prime factors of 302251973? 302251973 What are the prime factors of 426393308? 2, 11, 1427, 6791 List the prime factors of 42237580. 2, 5, 7, 11, 27427 List the prime factors of 326222178. 2, 3, 54370363 What are the prime factors of 589093178? 2, 877, 335857 What are the prime factors of 3596429315? 5, 73, 1511, 6521 What are the prime factors of 148360913? 1993, 74441 List the prime factors of 444122631. 3, 1297, 38047 List the prime factors of 17098572. 2, 3, 1424881 What are the prime factors of 4564207350? 2, 3, 5, 83, 122201 What are the prime factors of 61946392? 2, 1831, 4229 List the prime factors of 67593648. 2, 3, 1408201 List the prime factors of 107819245. 5, 29, 397, 1873 List the prime factors of 2074772138. 2, 61, 3121, 5449 List the prime factors of 244831703. 244831703 List the prime factors of 41051168. 2, 41, 67, 467 What are the prime factors of 708758262? 2, 3, 4375051 List the prime factors of 49755553. 49755553 List the prime factors of 81566604. 2, 3, 7, 67, 4831 List the prime factors of 96725104. 2, 7, 17, 37, 1373 List the prime factors of 268625055. 3, 5, 17908337 What are the prime factors of 594592751? 594592751 What are the prime factors of 388133931? 3, 197, 656741 List the prime factors of 62477411. 163, 383297 List the prime factors of 628397301. 3, 7, 3407, 8783 What are the prime factors of 74453618? 2, 179, 207971 What are the prime factors of 941654566? 2, 227, 2074129 List the prime factors of 19431101. 19431101 What are the prime factors of 1972616871? 3, 657538957 What are the prime factors of 448179177? 3, 17, 516931 What are the prime factors of 41652435? 3, 5, 11, 53, 433 List the prime factors of 710354437. 13, 2633, 20753 What are the prime factors of 382619199? 3, 79, 1181, 1367 What are the prime factors of 806156486? 2, 23, 103, 229, 743 What are the prime factors of 294251886? 2, 3, 811, 6719 List the prime factors of 556087314. 2, 3, 92681219 List the prime factors of 552142156. 2, 138035539 List the prime factors of 230402036. 2, 1259, 45751 What are the prime factors of 258352230? 2, 3, 5, 17, 506573 List the prime factors of 5144394697. 13, 83, 647, 7369 List the prime factors of 1410012954. 2, 3, 7, 53, 70381 List the prime factors of 73427786. 2, 2617, 14029 List the prime factors of 267141267. 3, 9894121 What are the prime factors of 99140580? 2, 3, 5, 7, 11, 23, 311 List the prime factors of 10962241. 10962241 What are the prime factors of 567212967? 3, 47, 1340929 List the prime factors of 4311518. 2, 19, 83, 1367 List the prime factors of 35563975. 5, 31, 109, 421 List the prime factors of 435887968. 2, 19, 137, 5233 List the prime factors of 1409945106. 2, 3, 1213, 193727 What are the prime factors of 26561714? 2, 2053, 6469 List the prime factors of 346305782. 2, 173152891 List the prime factors of 31691875. 5, 50707 What are the prime factors of 226459391? 1597, 141803 What are the prime factors of 1441696668? 2, 3, 19, 1163, 5437 What are the prime factors of 1947619102? 2, 11, 13, 61, 111637 What are the prime factors of 49973716? 2, 13, 961033 What are the prime factors of 1822074664? 2, 6449, 35317 What are the prime factors of 90719002? 2, 11, 4123591 What are the prime factors of 387571473? 3, 4784833 What are the prime factors of 69146838? 2, 3, 43, 97, 307 List the prime factors of 1235241304. 2, 11, 14036833 List the prime factors of 1074515053. 1759, 610867 What are the prime factors of 46482336? 2, 3, 79, 227 What are the prime factors of 7497675809? 13, 59, 787, 12421 List the prime factors of 164531410. 2, 5, 2729, 6029 What are the prime factors of 5844787008? 2, 3, 173, 175963 What are the prime factors of 680027917? 19, 35790943 List the prime factors of 391462408. 2, 227, 215563 What are the prime factors of 2089136? 2, 7, 23, 811 What are the prime factors of 550325131? 11321, 48611 List the prime factors of 118575322. 2, 97, 611213 List the prime factors of 17231282. 2, 103, 233, 359 List the prim	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.