Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
iggest value? (a) -8/7927 (b) -1 (c) -29/5 (d) 2 a Which is the fourth biggest value? (a) -19/5 (b) -2 (c) -1/11 (d) 0.1 (e) -2046 (f) -3/8 (g) 4 f What is the second biggest value in -15260978, -2, 6/7, -1? -1 Which is the third smallest value? (a) 6 (b) 9/8 (c) -0.5 (d) 0 (e) -0.23 (f) 2 (g) -5 e What is the third biggest value in -118, 2/7, -1/2, 4, -3/5, -45.7, -20? -1/2 What is the fifth biggest value in -0.4, 2, -3/128, 1, 0.3, -3/35? -3/35 What is the second smallest value in 214, -17, -0.5, -1/9, -2/3, -3, -110? -17 What is the second smallest value in -5, 4/3, -2/13, 257, -0.5, 211, -3? -3 What is the third biggest value in -1/2, 0.6, 4787, 59? 0.6 Which is the biggest value? (a) 0.2 (b) -3/7 (c) 19 (d) 3 (e) 66292 e Which is the fourth biggest value? (a) 1 (b) 1/5 (c) -4 (d) -8.8 (e) -5 (f) 1.48 (g) 2/31 g What is the fifth biggest value in 3, 4, -0.15, 11, 1290? -0.15 What is the third biggest value in 16, 4, -2, -1/7, -740? -1/7 Which is the third smallest value? (a) -1/5 (b) -47.5 (c) -1.1 (d) -4 (e) 7 c What is the fourth biggest value in 25581, -4, -2, 4/7, 4? -2 What is the second biggest value in -1/7, 0.06, -147342/5? -1/7 Which is the sixth smallest value? (a) 1 (b) 0.1 (c) -1/3 (d) 2 (e) 4 (f) 1.56 e What is the second biggest value in 57/2, -364/3, 100, -0.1, 0? 57/2 Which is the fourth biggest value? (a) 94 (b) -5 (c) -3 (d) 0.4 (e) 4 (f) 29 d What is the smallest value in 0.3, 2, 2/5, -21, 2/349, 2/241? -21 Which is the sixth smallest value? (a) 2/173 (b) 5 (c) -71 (d) 0.12 (e) 2 (f) 0 (g) 2/13 e Which is the second biggest value? (a) 0.4 (b) 2/11 (c) -293190 (d) 796 a Which is the second biggest value? (a) -0.5 (b) 4/3 (c) 7/1821 (d) -24 (e) -45 c Which is the sixth smallest value? (a) 0.2 (b) 0.4 (c) -11/21 (d) 4.2 (e) 0 (f) 4 d Which is the second smallest value? (a) 0.2 (b) 4 (c) 644 (d) -1/3 (e) -1 (f) 159 d Which is the third smallest value? (a) -4 (b) -2/17 (c) -27/1198 (d) 10 c Which is the third biggest value? (a) -0.3 (b) -104.2 (c) -0.07942 (d) -0.4 (e) 1 a Which is the second biggest value? (a) -0.2423 (b) 1 (c) 4 (d) -4.2 b What is the second smallest value in 0, 7664347, 2? 2 What is the second biggest value in -3/5, -2/13, -2370, -4/5, -215? -3/5 What is the smallest value in 0.4, -1/5, 0.3, -0.1, 3/14, 3/32? -1/5 Which is the smallest value? (a) 0.4 (b) -0.14 (c) -426 (d) 75/32 c Which is the fourth biggest value? (a) 0.06 (b) 0 (c) 0.4 (d) -73070 (e) -4 e Which is the biggest value? (a) -2 (b) -1 (c) 39830 (d) -31 c Which is the biggest value? (a) 983 (b) -5 (c) -77 (d) -1 (e) -1/6 a Which is the fourth biggest value? (a) -5 (b) 2308 (c) -145 (d) -0.6 (e) -2 (f) -1/5 e What is the third biggest value in 1070965, 4, 2/13, -4, -2/3, -34/5? 2/13 Which is the second smallest value? (a) 1 (b) -0.36 (c) -47/6 (d) 2/3 (e) 0.02 b What is the smallest value in 1, 2, -17, -0.5, -4/7, 0.2, 0.0817? -17 What is the smallest value in -108, -4, 21, -3/2, 0.66, 0.4, 3/4? -108 What is the second smallest value in -2/2457, -3/7, -62491? -3/7 What is the third smallest value in 4, 0.3, 3, 189/116? 3 What is the fourth biggest value in -14, -0.3, 4, 65/48, -6, 0.5, 5? 0.5 What is the biggest value in -2/9, -2, 0.04, 37/3, 11, -4? 37/3 Which is the second smallest value? (a) -39/89 (b) 24 (c) -2 (d) 29 (e) 1/3 a What is the fifth biggest value in 3.8, 1/5, 0, -4/3, -154022? -154022 What is the third biggest value in -95, -1, -0.1, -47/7? -47/7 What is the second smallest value in 0, -19/5, 3, 5, 139543? 0 Which is the second biggest value? (a) 42 (b) 2198 (c) 2 (d) 0.0503 a What is the second smallest value in 10, -29/4, 4, 0.023, -3, 0.3, -2? -3 Which is the second smallest value? (a) -50/19 (b) -0.2 (c) -2 (d) -6 (e) 8 (f) 0.032 a Which is the third biggest value? (a) -1/237 (b) -1/2 (c) -0.3 (d) -194 (e) -0.06 c Which is the smallest value? (a) 2 (b) 13 (c) -124 (d) 3/133 (e) -1 (f) 4 c Which is the third smallest value? (a) -0.069 (b) -5 (c) -17/16 (d) 1 (e) 1.7 a What is the biggest value in -2, 60, -11417? 60 What is the smallest value in 0.1, 14, 3/541, -0.4, -6.6? -6.6 Which is the third smallest value? (a) 2/5 (b) -66 (c) 54 (d) 1/2 (e) 3 (f) -4 (g) -1.3 g Which is the smallest value? (a) -3 (b) 1/93726 (c) 3/5 a What is the smallest value in 249, 2, -4, -3/5, 930? -4 What is the fourth biggest value in 12, -2.58, -0.0856, 0.3? -2.58 Which is the second biggest value? (a) -12 (b) -3/4 (c) -2/145 (d) -4 (e) -20/99 e Which is the third smallest value? (a) 0.087 (b) -0.02594 (c) 1 (d) 8 c Which is the third biggest value? (a) 67133 (b) 22 (c) 2/3 (d) -2 (e) -0.2 c What is the fifth smallest value in 4, -1/34, -0.2, -1/46, 609? 609 Which is the smallest value? (a) -3/4 (b) 395/18 (c) 0.11562 a What is the fifth smallest value in 6/11, -0.1, 2/5, 111511, -9? 111511 Which is the second smallest value? (a) -2/11 (b) -16.8 (c) -5 (d) -19 (e) 5/4 (f) -1 b What is the second smallest value in -1, -9, -2, 1791, 0.3, 0? -2 Which is the fourth smallest value? (a) -0.9096 (b) 3.8 (c) 0.1 (d) -2 b What is the second biggest value in -2, -4, 1/78, 0.16, -2/5, -0.11, 4? 0.16 What is the fourth biggest value in -0.9, 5, -0.0807, 0.04, -71, -0.3, 3/2? -0.0807 What is the smallest value in -1, 3, 2.98, -1130/13, 2, 1/8? -1130/13 Which is the third smallest value? (a) -1 (b) -100 (c) -0.4 (d) 15/412 c What is the smallest value in -2, 10, -5, -1, 0, -30.5627? -30.5627 What is the fifth biggest value in -2/107, 5, 2, 16, -17, -0.08, 3? -2/107 Which is the second smallest value? (a) 3380 (b) 2 (c) 9/10 (d) 6/17 (e) 0.3 d Which is the sixth biggest value? (a) 7 (b) 3/4 (c) -42 (d) -0.2 (e) 0 (f) 74 c Which is the second smallest value? (a) -0.1 (b) -1.335795 (c) -23 b What is the third smallest value in -5, 3, -1/6, -0.2, -81162/17? -0.2 Which is the fourth biggest value? (a) -5 (b) -24 (c) -2 (d) 5 (e) 13.2 (f) -0.1 c Which is the fourth biggest value? (a) -0.5 (b) -0.102 (c) 41/5 (d) 1/3 (e) -1.17 a Which is the biggest value? (a) 0 (b) -1.7 (c) -0.21 (d) 4 (e) -3.6564 d What is the fifth biggest value in -0.07, 2, -1/3, 2/9, 6, 531, -5? -0.07 Which is the fifth smallest value? (a) -307/3 (b) -3 (c) -0.5 (d) -0.016 (e) 2 (f) -1.8 d Which is the second biggest value? (a) -2 (b) -2049 (c) 0 (d) -1/5 (e) 28/11 c What is the biggest value in 50, 91138, -0.2? 91138 Which is the third biggest value? (a) 3 (b) -2015 (c) 114 (d) -0.2 d What is the fourth smallest value in -8/67, -1/2, -2/5, -404, -2, 2, -0.1? -2/5 Which is the biggest value? (a) -1/4 (b) 1405 (c) 0.1 (d) 1/5 (e) -23.8 (f) 4 b Which is the second biggest value? (a) 3 (b) -101 (c) 0.09 (d) -2/15 (e) -2.7 c Which is the fourth smallest value? (a) -2 (b) 4 (c) -0.2 (d) 4/3 (e) 2/183 (f) 0.119 f Which is the third biggest value? (a) -19 (b) -2/37 (c) 51/2 (d) -1/4 (e) 0.002 b Which is the fifth biggest value? (a) 0.57 (b) 0.4 (c) -0.04 (d) 4 (e) -0.08 (f) -1742 e Which is the fourth biggest value? (a) -5 (b) 177 (c) -0.3 (d) 8 (e) 3 (f) -1/25 (g) -7 f Which is the seventh biggest value? (a) 0.5 (b) 0.16 (c) 61 (d) -0.2 (e) -6/13 (f) 5/2 (g) 0.06 e Which is the fifth smallest value? (a) 5/3 (b) 4 (c) -2 (d) 2/7 (e) 4/13 (f) 26523 b What is the second biggest value in -186, 0, -4, -14, 2/11, -0.14? 0 Which is the second biggest value? (a) 4 (b) -37/4 (c) -148560 b Which is the third smallest value? (a) -56 (b) -1241 (c) -1/7 c What is the third biggest value in -1.3, 2/67, 333? -1.3 What is the third biggest value in -25, -31, 0.09, 311? -25 Which is the fifth smallest value? (a) 6/5 (b) -1 (c) -5 (d) -0.2 (e) -0.03 (f) 1925.9 a What is the fifth smallest value in -1/74, -4/9, -12, -0.01, 3, 0.1, -4? -0.01 What is the biggest value in -1, -75124/3, 0? 0 Which is the second biggest value? (a) 5 (b) -161 (c) -2/1179 c Which is the second smallest value? (a) 11125.3 (b) -10 (c) 1/7 (d) -1/2 (e) -3 (f) -4 (g) -2 f Which is the second biggest value? (a) 2 (b) -9 (c) 842 (d) -0.045 a	{ "pile_set_name": "DM Mathematics" }
3}. 4/455 Calculate prob of sequence zaa when three letters picked without replacement from {t: 2, z: 4, a: 3}. 1/21 What is prob of sequence dee when three letters picked without replacement from {d: 10, e: 2, k: 3}? 2/273 Three letters picked without replacement from {p: 1, c: 4, r: 1, b: 4}. Give prob of sequence pcr. 1/180 What is prob of sequence rrt when three letters picked without replacement from {t: 7, r: 7}? 7/52 What is prob of sequence qkqk when four letters picked without replacement from {z: 1, q: 2, s: 1, k: 2}? 1/90 Three letters picked without replacement from vwvyvxmvvvhmwvxwwxwx. What is prob of sequence wmv? 7/684 What is prob of sequence xs when two letters picked without replacement from ssxkkskxskkkxssxk? 3/34 Four letters picked without replacement from {h: 1, u: 3, o: 2, k: 1, m: 1, z: 3}. What is prob of sequence oomu? 1/1320 What is prob of sequence gpum when four letters picked without replacement from mugopupommpmoo? 1/1001 Two letters picked without replacement from {u: 5, x: 1, r: 1, o: 1, q: 1}. What is prob of sequence qx? 1/72 Calculate prob of sequence uuu when three letters picked without replacement from {q: 3, a: 2, u: 3, k: 5}. 1/286 What is prob of sequence aadd when four letters picked without replacement from {d: 4, a: 16}? 8/323 What is prob of sequence hp when two letters picked without replacement from pzzyuhd? 1/42 What is prob of sequence am when two letters picked without replacement from {m: 6, a: 12}? 4/17 Two letters picked without replacement from vvvvvvvvvvvvvvqqvvv. What is prob of sequence vv? 136/171 Four letters picked without replacement from {e: 1, g: 1, z: 6, q: 4, o: 3}. What is prob of sequence qqeg? 1/2730 Two letters picked without replacement from aaddadaaajgdjjadd. Give prob of sequence dj. 9/136 Four letters picked without replacement from oooeokvooevvovoevov. Give prob of sequence voeo. 9/646 Four letters picked without replacement from {g: 2, t: 3}. What is prob of sequence tgtg? 1/10 Calculate prob of sequence jp when two letters picked without replacement from jglmjlmmjpglgljmgjt. 5/342 Calculate prob of sequence zy when two letters picked without replacement from {z: 2, y: 4, x: 8, w: 5}. 4/171 Four letters picked without replacement from {t: 3, a: 4, e: 7}. Give prob of sequence ttee. 3/286 What is prob of sequence vvl when three letters picked without replacement from vlvlvlvvll? 5/36 Three letters picked without replacement from {f: 2, l: 2, g: 8, p: 3}. Give prob of sequence gfp. 8/455 What is prob of sequence ruu when three letters picked without replacement from {x: 1, l: 5, a: 1, u: 6, r: 1, s: 3}? 1/136 Two letters picked without replacement from {d: 3, e: 1, u: 1}. Give prob of sequence ue. 1/20 Three letters picked without replacement from {c: 1, h: 4, t: 4, j: 4, o: 5, d: 2}. Give prob of sequence jjc. 1/570 Two letters picked without replacement from {n: 1, u: 2, l: 1, a: 1, j: 4}. Give prob of sequence ln. 1/72 Two letters picked without replacement from {d: 6, p: 2}. What is prob of sequence pd? 3/14 Four letters picked without replacement from {f: 11, q: 2, n: 1, a: 2}. Give prob of sequence naff. 11/2184 Calculate prob of sequence mww when three letters picked without replacement from {m: 4, w: 2}. 1/15 Three letters picked without replacement from fgyfyfygyyg. Give prob of sequence fgy. 1/22 What is prob of sequence icle when four letters picked without replacement from ncvniiinevneiilnnvnv? 1/11628 Calculate prob of sequence pv when two letters picked without replacement from zvpvv. 3/20 Three letters picked without replacement from {p: 17, o: 1}. Give prob of sequence pop. 1/18 Four letters picked without replacement from {i: 2, q: 11}. What is prob of sequence qqii? 1/78 Calculate prob of sequence ryyi when four letters picked without replacement from ninuurriirruruyry. 3/4760 Calculate prob of sequence xxc when three letters picked without replacement from waxxwcxfffwwwra. 1/455 What is prob of sequence fknl when four letters picked without replacement from {k: 8, f: 1, n: 5, l: 2}? 1/546 Calculate prob of sequence vvu when three letters picked without replacement from {u: 2, n: 2, v: 2, l: 5, j: 2, a: 1}. 1/546 Three letters picked without replacement from ssssssssssssussssss. Give prob of sequence ssu. 1/19 Calculate prob of sequence yooy when four letters picked without replacement from zyiyhoooyxxzyxy. 1/273 What is prob of sequence mx when two letters picked without replacement from cdjxncm? 1/42 Two letters picked without replacement from {m: 2, k: 5}. What is prob of sequence kk? 10/21 Calculate prob of sequence uzm when three letters picked without replacement from {u: 5, w: 1, z: 10, m: 1}. 5/408 Calculate prob of sequence cxjs when four letters picked without replacement from {c: 5, x: 1, n: 1, s: 1, j: 1}. 5/3024 Two letters picked without replacement from uvvruvcvvvcvvv. What is prob of sequence vu? 9/91 What is prob of sequence tu when two letters picked without replacement from {j: 2, k: 2, t: 2, u: 8}? 8/91 Calculate prob of sequence ozoz when four letters picked without replacement from zooooozooooozo. 5/182 Calculate prob of sequence cobo when four letters picked without replacement from bkbcebwkbowcoookcwko. 2/969 Three letters picked without replacement from {d: 8, s: 1, m: 6, y: 1}. Give prob of sequence sdy. 1/420 What is prob of sequence en when two letters picked without replacement from {n: 1, j: 1, e: 2, z: 4, g: 5, p: 2}? 1/105 Three letters picked without replacement from yyyqqqqqqxqqyxqg. What is prob of sequence yqy? 9/280 Three letters picked without replacement from {b: 1, d: 4, y: 4, k: 2}. Give prob of sequence kdd. 4/165 What is prob of sequence yyvj when four letters picked without replacement from {y: 3, v: 6, d: 1, j: 2}? 1/165 What is prob of sequence hhj when three letters picked without replacement from {x: 1, j: 2, y: 3, h: 2, f: 3, z: 1}? 1/330 What is prob of sequence yyf when three letters picked without replacement from {f: 5, y: 5}? 5/36 Four letters picked without replacement from iiriiihiiirihiiir. What is prob of sequence riii? 33/476 Calculate prob of sequence dbd when three letters picked without replacement from dokokbdokh. 1/360 Calculate prob of sequence ttr when three letters picked without replacement from {s: 4, t: 5, r: 2, j: 2}. 10/429 Four letters picked without replacement from nssnsnn. Give prob of sequence nsss. 1/35 What is prob of sequence tktk when four letters picked without replacement from {k: 5, t: 7}? 7/99 Three letters picked without replacement from hhzhhhzhhhz. What is prob of sequence zzz? 1/165 Calculate prob of sequence gg when two letters picked without replacement from lsrfrrrsggfrflllsffl. 1/190 What is prob of sequence ojoa when four letters picked without replacement from {j: 1, s: 1, i: 1, o: 2, a: 2}? 1/210 Four letters picked without replacement from {m: 5, h: 1, e: 1, t: 2}. What is prob of sequence memt? 5/378 Four letters picked without replacement from xpppppxppxxpppxpxpp. What is prob of sequence xppp? 143/1292 Four letters picked without replacement from ihchihchhhcciihc. Give prob of sequence hhcc. 1/52 What is prob of sequence fffo when four letters picked without replacement from {j: 6, a: 2, n: 2, o: 1, f: 7}? 7/2448 Three letters picked without replacement from llllllgsllslssgg. Give prob of sequence sgs. 3/280 What is prob of sequence llo when three letters picked without replacement from oolooloooooolooo? 13/560 Four letters picked without replacement from {g: 3, y: 17}. Give prob of sequence yggg. 1/1140 Three letters picked without replacement from kzzikpzzw. Give prob of sequence zzi. 1/42 Three letters picked without replacement from {d: 3, s: 4, m: 2, x: 2}. Give prob of sequence dss. 2/55 What is prob of sequence vvp when three letters picked without replacement from vovvpopp? 3/56 Four letters picked without replacement from aiaoabaaiboaaba. Give prob of sequence bbao. 4/1365 Two letters picked without replacement from qcqccqqqqqcccqcq. Give prob of sequence qq. 3/10 Calculate prob of sequence qgqg when four letters picked without replacement from qggqggggqqqqggqqgq. 6/85 Two letters picked without replacement from {x: 7, a: 6, d: 2}. What is	{ "pile_set_name": "DM Mathematics" }
((oo0)/o6)/(o(-5)/((oo/(o/o*(1/5)o))/o)))/(o*0/(oo/o*(-6)o)(o/(oo/(o/(ooo*(-3/7)))o)o)/o(-1/4)) assuming o is positive. o(1333/140) Simplify (((p/(p/(p/(pp*(4/9))))p(-1/50))(2/19))(-3/10))(-37) assuming p is positive. p(-407/750) Simplify ((f/f(-25))/f*(-6/17)f*(-19/3)((f/f*(5/8))/f)/fff)(-26) assuming f is positive. f(-108173/204) Simplify i(-33)(i/i*(-2/3))/ii(2/19)/((i/((i/(i(-34)/i))/i))/ii) assuming i is positive. i(101/57) Simplify b(bbb*(-1/2))/b(b/((b*(5/2)b)/b))/b((bb/(b*0/b)b)/b)*(4/9)((b(-1))22)(-35) assuming b is positive. b(2311/3) Simplify ((n/(nn/n(1/7)))/(nn*(-4)n))/(n43/(n(-32)/n)) assuming n is positive. n(-524/7) Simplify ((o/o(2/13))(4/13))(-6)o5((oo3)/o)/o(o/((o/(o*(-2/5)o))/o))(-2/21) assuming o is positive. o(93791/17745) Simplify ((uuu(2/5))(-5)/((uuu(2/15))/u(-6)))/(u/(uuuu(4/3)/uuuu)uu/(uu(u(1/5)/u)/u))(-2/9) assuming u is positive. u(-2824/135) Simplify ((c/(c/c0))38/(c/(c(-2)c)c(c/(c/((cc*(-1/10)/cc)/cc)))/c))/((c(-1))(-11/4)/((c/(c/(c/(c/c(-2/21)))))/c2)) assuming c is positive. c(-3253/420) Simplify (((kkk(-1))/k(-2))/(k(2/7)/k(-1/5)))/((k/k4)/kk*(2/7)(k(k(-2/9)k)/k)/((kk(2/7))/k)) assuming k is positive. k(1807/315) Simplify ((((x(2/17)/x)/xxx(5/4))(-16))(9/5))(-1/24) assuming x is positive. x(15/34) Simplify ((u(-3)/u)/uuuu)/(((uu(-1/15))/u)/u)((u/u(1/2))/u)(-21)((u(-1/3))(-9/5))(-46) assuming u is positive. u(-541/30) Simplify ((ppp/p(-2))(-5/4)(p/p(1/5))(7/3))/(((pp(-7/3)p)/pp(2/13))/((ppp(-6)p)/(pp(-2/21)))) assuming p is positive. p(-38813/5460) Simplify (h(-2)/h(-6))/(hh1)(5/7)(h1hh(1/4))/(hh*(-2/5)(h/h(-2))/h) assuming h is positive. h(311/140) Simplify (v/v*(-8)v*(-1/6)(vv/(vv(-2/19)))/v7)/((v/(vv/v7))/vv/(v/(v(v(-3/5)v)/v)))22 assuming v is positive. v(-66041/570) Simplify (w6/(w(-2)w)w*(-2/5)/(w/(wwww*(-4)ww)))/((w0)(8/5)(w1/w)(-31)) assuming w is positive. w(33/5) Simplify ((h1)(2/13))(-1/12)h/h4h*(-3/2)hh(2/17)(h(4/5)/h)/h assuming h is positive. h(-15233/3315) Simplify (n1)(-44)/((n*(-2)n)/(n/((n*4n)/n)))((n/(nn*(2/3)n))/n)(-2/11)/(n(-1)/(nn0/nn)) assuming n is positive. n(-1436/33) Simplify ((g(2/3)g17)/((g(1/5)/g)/(((g/((g(-3/2)g)/g))/ggg)/g)))(-5/3) assuming g is positive. g(-629/18) Simplify ((uu1/uu)/u)(-2/47)/(u0uu)*46(u/(u*(-2/7)u))/u*0(uu(3/2))/((u(u/(uu/(uuu(1/2)))u)/u)/uuu) assuming u is positive. u(-30517/329) Simplify ((r(-2/7))*(-5/6)(r(1/4))25)/(r*(1/2)((r*(-6)r)/r)/r(r(-1/4))(-1/29)) assuming r is positive. r(15809/1218) Simplify ((q/q(1/2))15(qq(30/7))/(q/q40))(-17) assuming q is positive. q(-12325/14) Simplify o(-2/17)/(o/(o(-6)/o))o(1/5)/(o/o1ooo)o*3oo1oo6o*(-1/3)o assuming o is positive. o(446/255) Simplify (g/g(-9))*(-35/2)(g(-2/51))(-29) assuming g is positive. g(-8867/51) Simplify (n(-2/7)/n*4nn20n(n/(n(n(n(-4/3)n)/n)/n)nn)/n)29 assuming n is positive. n(12209/21) Simplify (y/(y*3/yy)yy*3/y(y(2/11))(-1/9))11 assuming y is positive. y(97/9) Simplify (v*(-8/9)/((vv/v*11vvvv)/v))(-15/7)/((v(2/5)/v)(5/19)(v2/v)(-42)) assuming v is positive. v(12451/399) Simplify ((u/u(-20))/(u*(4/3)u)u/(u/(u/(u(1/7)u))u)(u/(u/(u*6/u))uu)/u)(-37) assuming u is positive. u(-18278/21) Simplify f(3/7)(f*(-1/9)f)/fff*(-1/3)fff*(-1)((f(2/7)/f)/f)(-49)(ff1)/(f(-7)/f) assuming f is positive. f*(6047/63) Simplify (ww*(-4)w/(w*(-1/3)w))/((w/(ww(-3/7)))/w3)(((w/((w/(ww(-1))w)/w))/w)(-50))(-27) assuming w is positive. w(-28352/21) Simplify u8/(((uu(-2/17)u)/uu)/u)((uu(2/19))/uuu)/(u/(uu*(-3/7)))((uu/(u/u(-5/4)))/(u(-10/7)u))11 assuming u is positive. u(97301/9044) Simplify (w(-31)/w)/(w(-2/13)/w)(w/(w(-35)/w)w)/(w*(6/11)w) assuming w is positive. w(802/143) Simplify ((u/(u(-2/5)/u)uu)(-10/7)/(u(2/7))*1)/(((((uu*(-1/3))/u)/u)/uu(2/3))/(u(-2/9)u(-8))) assuming u is positive. u(-827/63) Simplify (g/g4g(-2))(2/51)/((g2)(-1/22))(-5) assuming g is positive. g(-365/561) Simplify (z(-1/8)/((z(1/2)/z)/zz))(3/11)(((z(-5/4)/z)/z)/z1)/(z*(-2/5)/(z/(z/(zz(-1))))) assuming z is positive. z(-1649/440) Simplify (kk/k(4/17)k21)/(k(-2/11)/(kk34kk)) assuming k is positive. k(11210/187) Simplify w/w(-3)w/(w(w/((w/((w/w(-7)w)/w)w)/w))/ww)(www(-1)w)*(-37)(w*2/www(1/6))13 assuming w is positive. w(-299/6) Simplify ((((ff*(3/5)f)/(f*4/f))/(f/(f/(ff/(ff(-2/3)ff))))32)(-32))(-16) assuming f is positive. f(78848/15) Simplify (((w8/(ww/((w*7/ww)/w)))(-7/4))42)(-30) assuming w is positive. w26460 Simplify (((z*(3/7)z)/(zz/(z/z(-2/7))))/(z0)(1/34))/(z(-5)/(zz*(-1/7)z)(z/(zz*2/z))/(zzz(-2/7)/z)) assuming z is positive. z(65/7) Simplify ((w(-2/59)/w)/ww)*(3/4)w*(1/3)ww/(ww(-4/17)) assuming w is positive. w(9547/12036) Simplify ((k/(kk(-1/15)kk)k/(k*(1/5)/k)(k(-4))(-44))(-10))(-4/21) assuming k is positive. k(21104/63) Simplify ((j0j)/((j3j)/j))(-31/3)/((j(-2/3))(21/4)/(j0jj4)) assuming j is positive. j(175/6) Simplify s*(-1/2)/(ss*(-1)/s)(sss/(ss/s(1/2)))(-50)(s/(s*5s)(sss/(s/(ss(ss*(-1))/ss)))/s)(-7/3) assuming s is positive. s(-419/6) Simplify (qq(1/4)qq(-6)/qqqq*(-3)q(qq*(-3)q)/qq)/((qq(-1/2)/q)24(q/q(2/5))(3/4)) assuming q is positive. q(29/5) Simplify x/x2x*(-2/15)(x(-1/5)/x)/(x0/x)(x(3/11)(x/(x4/x))/x)(1/63) assuming x is positive. x(-106/77) Simplify ((m(-4))(1/25))(-41)m(-3/10)/(mm*1)mm(1/4)mm/(m(-1/2)/m) assuming m is positive. m(901/100) Simplify ((t9t(t(-4)/t)/t)/(t11t(-10/9)/t))(-36) assuming t is positive. t176 Simplify (d3/d*5)/(dd*(2/3)d)*(-3/2)(d7/d3)/(d(5/4)/d(-7)) assuming d is positive. d*(-9/4) Simplify (h/(hh7))(-35)/((hh/(h/(h(-6)/h))h)/(hh(-5/16))) assuming h is positive. h(4011/16) Simplify ((y(-8))25/(y/(((yy*9y)/y)/y)yy(3/16)))(-47) assuming y is positive. y*(145277/16) Simplify (((fff(-2/5)f)/(fff/f(-1/7)))/(f(-1/2)f(2/15)))/((f(1/2)f*(-5))/((ff*(-2/5)f)/f)50) assuming f is positive. f(3604/105) Simplify ((m*(-8)m(5/4)/m)/((m/(m(-1)m))/((m4m)/m)))/((mmmmm(-2))(-4/7)mm*(-1)mmm*8/mm) assuming m is positive. m(-381/28) Simplify (h(-5)/h*(2/5)(h/h(-5))/h(1/5))/((h/(h/(h*(2/3)h)h))(2/129)h*6/hh(-5)) assuming h is positive. h(754/1935) Simplify (p/(p/p*6p)p(-1/5)p*(-2/17)p*(-3))/(p(pp/p2)/pp5)(-3/11) assuming p is positive. p*(2848/935) Simplify (((hh/((hhh/h*(-2/7)h)/h))/h17)/(h(2/9))(-49))31 assuming h is positive. h(-14446/63) Simplify ((f(7/4)/(f/(ff(-11)ff)))/(f(-4/5))(10/3))(-3/22) assuming f is positive. f(5/8) Simplify (((qq/(q/(q(qq(-1/2))/q)))/q)/q)(2/117)/(qq/q7q/q*(-7))((q/q(2/9))/q(7/2))28 assuming q is positive. q(-1030/13) Simplify (((p/((p/(((p/((p/(p/(pp(-2)/p)))/p))/p)/p))/p)p)/p)*(-2/17)(p(-2/15))(-1/14))(-2/127) assuming p is positive. p(1226/226695) Simplify (x*(2/3)xxx(-3))6/((x*(-5/4)/((x/(xx(1/5)))/x))/(x(1/8)/(xxx3))) assuming x is positive. x(-273/40) Simplify (f16)(-1/48)/(f/f*49f(19/2)) assuming f is positive. f(229/6) Simplify (((s(-2)/s)/(s/s(-1/3))((s6s)/s)/(ss(4/7)))47)44 assuming s is positive. s(4136/21) Simplify w(3/4)ww(-3)/ww*(3/5)/www/w(-3)(w(-1/3))(3/25)w((ww(-1/5)/w)/w)/ww/(ww/w(-1))w assuming w is positive. w(11/100) Simplify (s(-2/5)s)(1/32)(s/(s(-1/2)/s))/s(2/7)(sss0)19/((ss(-2/9))/s(-6)) assuming s is positive. s(337229/10080) Simplify ((n0)**(-3	{ "pile_set_name": "DM Mathematics" }
nder when 0 + -1 - (-18)/2 is divided by b. 2 Calculate the remainder when (-7 + (6 - 0))-139 is divided by 44. 7 Let z(r) = r3 - 2r*2 - 9r + 17. Calculate the remainder when 110 is divided by z(5). 16 Calculate the remainder when 135 is divided by ((-2)/(-7))/((-15)/(-315)). 3 Suppose t - 3 = 1. Let y be (-1 + 20)/(t - 3). Suppose 84 = 5d + y. What is the remainder when d is divided by 8? 5 Let d(s) = 32s*2 - 8s*2 - 4s - 1 - 2 + s. Suppose u - 71 - 6 = -3m, 0 = -5u + 10. Calculate the remainder when d(-2) is divided by m. 24 Let y = 591 + -494. What is the remainder when 211 is divided by y? 17 Let x be -5(-2 - -1) - -5. Suppose -189 = -xu + 231. Calculate the remainder when u is divided by 26. 16 What is the remainder when 210 is divided by 1 + -62(10/4 + -3)? 18 Let r = -1 - -18. Let m(b) = b3 + 3b*2. Let x be m(-3). Suppose -3g = -2z - 191, -4g - z - z + 264 = x. What is the remainder when g is divided by r? 14 Let t(g) = 6g - 3. Let p be t(-4). Suppose -180 = -5k + 5q, 4k + 3q = 2q + 159. Let j = p + k. What is the remainder when 47 is divided by j? 11 Let z = 2528 - 2515. Suppose -x + 15 = -28. Calculate the remainder when x is divided by z. 4 Let z(g) = g*2 + 2g - 17. Let t be z(4). Suppose ts + 1000 = 17s. Calculate the remainder when s is divided by 26. 22 Suppose -5b + 7b + 150 = 0. Let z be 6/(-9)b/2. Suppose -za + 2 = -24a. Calculate the remainder when a is divided by 2. 0 Suppose 187 = 26v - 333. What is the remainder when v is divided by 7? 6 Suppose 0 = -b + 1, 5c + b + 0b = 101. Calculate the remainder when 117 is divided by c. 17 Let t = 15 + -4. Calculate the remainder when 174 is divided by t. 9 Suppose -2w = -6w + 324. Suppose 5x = 8x - w. What is the remainder when x is divided by 16? 11 Let l(g) = g + 12. Let j be l(-10). Suppose -ja = 3t + 4 - 19, a - t - 20 = 0. Calculate the remainder when a1(-6)/(-5) is divided by 5. 3 Let l = -291 + 311. Calculate the remainder when 139 is divided by l. 19 Suppose -z - n = -6, -3z + 5n + 2 = -0. Suppose 5o - 4f - 83 = -0f, 0 = -zo + 3f + 66. What is the remainder when o is divided by 6? 3 Let h(k) = k3 - 15k*2 + 25k + 13. Let z be h(13). Suppose z = -a - 3a + 5j + 51, -5a = 5j - 30. Calculate the remainder when a is divided by 4. 1 Calculate the remainder when 59 is divided by 1/(-9) - (-2 - 190/9). 13 Let j(a) = 6a - 24. What is the remainder when 86 is divided by j(12)? 38 Suppose -4t = -3h - 10 - 14, -3t - 3h - 3 = 0. Suppose -g = 4g, 21 = tj - 4g. What is the remainder when j is divided by 3 + (1 - (5 + -5))? 3 Calculate the remainder when (21/(945/(-288)))/(2/(-50)) is divided by 81. 79 Suppose m + 33 = 4u, -u + 2m + 19 = 16. Calculate the remainder when 70 is divided by u. 7 Let z(q) = 2q2 + 5q + 5. Let b be z(-5). Let j = -10 + b. Suppose w = -1207 + 1213. What is the remainder when j is divided by w? 2 Let p(c) = 292c2 + 15c - 20. What is the remainder when p(2) is divided by 20? 18 Let v(y) = y*2 - 10y + 30. Let q = 64 - 23. Calculate the remainder when q is divided by v(9). 20 Suppose 2q - 38 = g, -g - 9 - 12 = -q. What is the remainder when 80 is divided by q? 12 Let t(b) = -9b - 19. Let f(n) = 6n - 4. Let j be f(0). Calculate the remainder when 150 is divided by t(j). 14 Suppose 0 = -6o + 3o - 330. Let s = -1 - o. Calculate the remainder when s is divided by 57. 52 Suppose -67s = -77s + 770. What is the remainder when 215 is divided by s? 61 Suppose g + 5 = -4g. Let x be 5 + -5 + 13g. Calculate the remainder when 51 is divided by (-1 - (-1 + 1))x. 12 Let q(x) = -x*3 + 2x*2 + 5x - 6. Let n be q(3). What is the remainder when 187 is divided by 3/(-1) + n + 50? 46 Let a(w) = -w*3 + 10w*2 - 10w. What is the remainder when a(7) is divided by 14? 7 Let a be (-6)/(-2)45/27. Suppose 2x - 5 = 5k + 34, -ak - 15 = 0. Suppose 28s = 27s + 45. Calculate the remainder when s is divided by x. 9 Let y(z) be the second derivative of z*5/20 - 5z*4/6 - 4z*3 + 29z*2/2 - z. What is the remainder when 114 is divided by y(12)? 27 Suppose 0 = -5r + 3f + 38 + 5, 5f = -2r + 42. Let h = 8 + r. Calculate the remainder when h is divided by -1 + 1 - (-11 + 0). 8 Calculate the remainder when 2/155(-606)/(-4) is divided by 28. 17 Let h(n) = n3 - 23n*2 - 22n + 11. Let z(a) = -a*2 - a + 233. What is the remainder when z(0) is divided by h(24)? 56 Let o = -34 - -54. What is the remainder when 97 is divided by o? 17 Suppose -405 = 5f - 14f. What is the remainder when f is divided by 7? 3 Suppose 41 = n - 2s, n + 8s - 11s = 45. Calculate the remainder when n is divided by 7. 5 Let u(t) = 2t. Let p be (-1 - 3)(-3)/(-2). Let h be u(p). What is the remainder when 54 is divided by (-150)/h - (-6)/4? 12 Let y(k) = k*3 + 6k*2 - 11k - 8. Let c be y(-8). Let m = 11 - c. Calculate the remainder when m is divided by 12. 11 Let i(d) = -d + 2 + 5d2 + 3 - 5d + d*3. Let g = 9 + -7. What is the remainder when i(-6) is divided by g? 1 Let q be 2/(-3 - -4) + 1. Suppose 0n - n + 23 = 5c, n - 5c = q. What is the remainder when n is divided by 4? 1 Let r(l) = -17 + l - 22l + 3. Let w be r(-4). Let d = 102 - w. What is the remainder when d is divided by 11? 10 Suppose 0 = -0j + 5j. Let p(w) = -w3 - w2 + 22. Suppose -2t + 112 = 3u + 71, 77 = 4t + 5u. What is the remainder when p(j) is divided by t? 9 Suppose 850 = l - f, -5l = f + 3f - 4295. Calculate the remainder when l is divided by 66. 63 Let i = 181 - 148. What is the remainder when 83 is divided by i? 17 Let j(k) = -k2 - 7k + 2. Let c be j(-7). Suppose -cr = -u - 2u - 24, 3r = 2u + 31. What is the remainder when 52 is divided by r? 7 Calculate the remainder when 269 is divided by 256/(-7)4/(-4). 13 Suppose -2 = -2b, 2h - 4b + 1 = b. Suppose hy - 9 = 27. Suppose 16m = -198 + 358. What is the remainder when y is divided by m? 8 Suppose 64 - 142 = -2t. What is the remainder when 108 is divided by t? 30 Let a(x) = x*2 - 10x + 8. Calculate the remainder when -1 - -39 - (-4)/(-4) is divided by a(11). 18 Let i(q) = 6q - 2. Let s be i(1). Let c(x) = 5x - 2 - sx + 2x + 3x2. Calculate the remainder when c(-6) is divided by 23. 19 Let z be (9/(-15))/((-1)/(-5)). Calculate the remainder when 103 is divided by ((-7)/7)/(z/63). 19 Suppose 151 = o - 3y, -5o - 3y = y - 698. Calculate the remainder when o is divided by 9 + 1 - (-10)/5. 10 Suppose 4j + r = -0r + 269, -4r - 12 = 0. Calculate the remainder when 338 is divided by j. 66 Let t(g) = g2 + 9g + 9. Let r be t(-8). Let d = 5 - r. What is the remainder when 24 + (6 - d - 2) is divided by 13? 11 Suppose -v + 28 = -2. Let f = v + 0. What is the remainder when 119 is divided by f? 29 Let p = -30 + 40. What is the remainder when 6/(-9) - (-258)/9 is divided by p? 8 Let j(s) = 186s - 2208. Calculate the remainder when 186/2(-2)/(-2) is divided by j(12). 21 Let p = -10 - -2. Let a = 13 + p. Suppose -41 = -9c + 22. Calculate the remainder when c is divided by a. 2 Let x be (-1)/3945/(-9). Suppose 0 = 4u - 7u + 75. What is the remainder when u is divided by x/4 - (-4)/16? 7 Suppose -45 = 2t + t - 2r, 5t + 62 = -r. Let c = t + 19. What is the remainder when 10 is divided by c? 4 Suppose -331 = -13w + 228. What is the remainder when w is divided by 11? 10 What is the remainder when 20 is divided by ((-336)/(-108))/((-4)/(-18))? 6 What is the remainder when 341 is divided by 770/44(-2 - -4)? 26 Let m = -1121 - -1496. Calculate the remainder when m is divided by 19. 14 Suppose -4p = -16, 0t - 31 = -t - 3p. What is the remainder when 354/5 + 2/10 is divided by t? 14 Let t = -273 + 315. Calculate the remainder when t is divided by 16. 10 Let o(f) = -f*3 + 5f*2 - 3f - 2. Let u be o(3). Let z(p) = -13 - 3p + 4p - 9p - up. Calculate the remainder when z(-6) is divided by 20. 17 Let b(y) = 6y3 + y2 - y + 1. Let s be ((-2 - 0) + 0)/(2/(-47)). Let z = s - 1. What is the remainder when z is divided by b(1)? 4 Suppose 8 = -5y - 3n, y + 3n = -n - 5. Suppose -3u = -u - 48. Calculate the remainder when u is divided by (-1 - 19/y)/2. 6 Suppose 91s = 99*s - 88. Calculate the remainder when 219 is divided by s. 10 Let i be (18/24)/((-1)/	{ "pile_set_name": "DM Mathematics" }
35 a factor of 21746165? True Is 251283048 a multiple of 24? True Is 145 a factor of 173909375? True Is 20 a factor of 857094850? False Is 526732316 a multiple of 671? True Is 20302526 a multiple of 536? False Is 2851 a factor of 33185640? True Is 345455948 a multiple of 167? False Is 6813 a factor of 379456848? True Does 181 divide 49095888? True Is 932 a factor of 145754548? True Is 262720674 a multiple of 149? True Is 1768 a factor of 223620176? True Is 106303625 a multiple of 797? False Does 155 divide 13179960? True Does 3 divide 862475? False Is 819 a factor of 1499782465? False Does 4 divide 23100173? False Is 856 a factor of 200783047? False Is 86485930 a multiple of 67? False Is 12 a factor of 385977804? True Is 5 a factor of 2892180? True Is 857425146 a multiple of 12? False Is 251 a factor of 14205490? False Is 31914714 a multiple of 1078? False Does 75 divide 959866094? False Does 4 divide 12736441? False Is 424912851 a multiple of 33? True Does 245 divide 51414278? False Is 2719 a factor of 11814055? True Is 14 a factor of 824443? False Is 190 a factor of 1016086510? False Is 59667218 a multiple of 251? True Does 79 divide 109391570? False Is 237249 a multiple of 29? True Is 434 a factor of 2908841068? False Does 6 divide 54199530? True Is 767 a factor of 27047488? True Is 214377323 a multiple of 19? True Does 41 divide 324935742? True Is 231 a factor of 4406586492? True Is 127714960 a multiple of 365? True Does 3729 divide 6613639? False Does 131 divide 119121706? True Does 38 divide 1114692? True Is 176705188 a multiple of 44? True Is 16447903 even? False Is 1622450999 a multiple of 3474? False Is 137550775 a multiple of 6653? True Does 1147 divide 75174380? True Does 335 divide 3365572? False Is 1063 a factor of 58253463? True Does 149 divide 350330439? True Does 252 divide 69758892? True Does 602 divide 4556019343? False Is 412958473 a multiple of 42? False Does 11 divide 91545421? True Is 5 a factor of 758891055? True Does 13 divide 464852687? True Does 29 divide 1627814834? True Is 201 a factor of 19483533? True Does 2149 divide 423484089? True Is 573 a factor of 29926644? True Is 63 a factor of 138840219? True Is 752 a factor of 92153982? False Is 8344693 a multiple of 35? False Does 2 divide 13254364? True Is 11 a factor of 214205387? True Does 51 divide 37253391? False Is 429563910 a multiple of 1506? True Is 131 a factor of 83446083? True Does 17 divide 2546933? False Is 17 a factor of 212748100? False Is 27477529 a multiple of 8? False Is 46274186 a multiple of 75? False Is 9755 a factor of 1827241480? False Does 37 divide 355497776? True Is 109 a factor of 826153627? False Is 20 a factor of 755284483? False Does 8 divide 145101072? True Is 970444223 a multiple of 381? False Is 4880846 a multiple of 263? False Is 1972466050 a multiple of 9714? False Is 373997061 a multiple of 1613? False Does 3 divide 1275297282? True Is 38 a factor of 1245184? True Is 87336 a multiple of 6? True Is 293015073 a multiple of 169? True Does 24 divide 78038472? True Does 276 divide 60493128? True Is 232509802 a multiple of 38? True Is 245 a factor of 71344832? False Is 49 a factor of 106575931? True Is 14 a factor of 1155439982? False Is 23 a factor of 104925047? False Does 22 divide 54560704? True Is 3646069 a multiple of 2? False Is 5540689659 a multiple of 14? False Does 373 divide 122008300? True Is 223883363 a multiple of 98? False Does 73 divide 2443675? True Is 33897150 a multiple of 1575? True Is 329 a factor of 120409723? True Is 32945285 a multiple of 21? False Does 1725 divide 884689511? False Is 20 a factor of 120628600? True Is 513723056 a multiple of 98? True Does 299 divide 287850589? True Does 1495 divide 96248887? False Does 33 divide 8952180? False Is 20 a factor of 305215800? True Does 1181 divide 100358691? False Does 1158 divide 456926135? False Is 2657874277 a multiple of 3947? True Is 31405465 a multiple of 299? True Is 220 a factor of 1321453445? False Is 1924784160 a multiple of 312? True Is 278079002 a multiple of 1620? False Is 12 a factor of 139598945? False Does 1730 divide 1075807420? True Is 5991241 a multiple of 22? False Is 1523709942 a multiple of 339? False Does 90 divide 222404760? True Is 124 a factor of 24682200? True Is 68 a factor of 87302393? False Is 972 a factor of 152768268? True Does 116 divide 90221365? False Does 17 divide 340000221? True Does 1562 divide 156232802? True Does 30 divide 243984721? False Is 2180701259 a multiple of 1634? False Is 591621438 a multiple of 56? False Is 653997598 a multiple of 522? False Is 145 a factor of 219553635? True Does 1279 divide 102193379? True Does 2 divide 74325512? True Is 15 a factor of 68532532? False Does 12627 divide 1022654238? False Is 3865620 a multiple of 30? True Does 196 divide 67611180? True Does 9 divide 59670570? False Does 160 divide 28515360? True Is 1379193641 a multiple of 229? False Is 206 a factor of 3521776? True Does 30 divide 452798670? True Is 19 a factor of 881361949? True Is 67410507 a multiple of 26? False Is 250947602 a multiple of 603? False Is 1304802363 a multiple of 129? True Does 135 divide 3258957? False Does 76 divide 1625240240? True Does 737 divide 66933072? False Does 2 divide 2258755? False Does 280 divide 484172251? False Is 54944784 a multiple of 3088? True Does 28 divide 150878196? True Is 737701219 a multiple of 99? False Is 243176880 a multiple of 240? True Is 10239913 a multiple of 62? False Is 1046848198 a multiple of 11? True Is 670799415 a multiple of 15? True Is 360818630 a multiple of 590? True Is 2299717 a multiple of 32? False Does 26 divide 27761344? True Is 2605 a factor of 217887264? False Is 362 a factor of 1785959076? False Is 13 a factor of 604229170? False Is 194596831 a multiple of 11? True Is 46193608 a multiple of 72? False Is 155 a factor of 4576751? False Is 585461470 a multiple of 187? True Is 57 a factor of 130158? False Does 118 divide 31889169? False Is 43 a factor of 33238699? True Is 472 a factor of 50557138? False Is 612 a factor of 34802604? True Is 435337601 a multiple of 77? False Does 96 divide 23337413? False Does 9 divide 10053392? False Is 23 a factor of 1603883882? False Is 38 a factor of 25383406? False Is 26 a factor of 615769916? False Is 163 a factor of 20329197? True Is 41 a factor of 25347266? True Does 188 divide 76767168? True Does 14 divide 109908633? False Is 46 a factor of 1093462689? False Is 5 a factor of 944753509? False Is 3383190 a multiple of 5? True Is 109999112 a multiple of 152? False Is 8168 a factor of 1047125998? False Does 3 divide 39255115? False Is 2930200932 a multiple of 9854? False Is 264512575 a multiple of 113? False Is 8 a factor of 97280233? False Is 10 a factor of 15674670? True Is 232798906 a multiple of 38? True Does 359 divide 201248220? True Does 56 divide 44686320? True Does 534 divide 154225608? True Does 25 divide 2345450? True Is 8 a factor of 1465392? True Is 14311865 a multiple of 478? False Is 250139869 a multiple of 2210? False Does 9 divide 286938? True Does 13 divide 3744275696? False Is 90 a factor of 196468470? True Does 3315 divide 817589678? False Is 29311290 a multiple of 45? True Is 2229 a factor of 21983957? False Does 690 divide 963326561? False Is 53 a factor of 14341282? False Does 447 divide 36444103? False Is 189718530 a multiple of 20? False Is 46807880 a multiple of 1396? True Does 464 divide 24570192? True Does 536 divide 3204744? True Does 20 divide 1467372880? True Does 23 divide 173838123? False Is 10 a factor of 79204272? False Is 45901719 a multiple of 3? True Is 59649476 a multiple of 37? True Is 128408561 a multiple of 1190? False Is 570895667 a multiple of 796? False Is 237206585 a multiple of 395? True Is 484573157 a multiple of 15? False Is 5409266 a multiple of 11? False Is 259494984 a multiple of 62? False Is 24272280 a multiple of 382? True Does 25 divide 494940388? False Is 1227 a factor of 366873? True Does 15 divide 44798145? True Is 30258214 a multiple of 1040? False Is 9 a factor of 14486552? False Does 12 divide 91077128? False Is 6 a factor of 4491732? True Does 2800 divide 5938973? False Is 4 a factor of 282053256? True Does 1188 divide 588445853? False Is 1023900922 a multiple of 799? True	{ "pile_set_name": "DM Mathematics" }
e 3 + -9 + (1 - -2). What is y(u)? -3 Let i(p) = -6p - 1. Let s(r) = -15r - 6. Let c(d) = 10d + 4. Let w(h) = 8c(h) + 5s(h). Let a(j) = 3i(j) + 4w(j). Determine a(-5). -5 Suppose 3j + 3 + 9 = 0. Let n(x) = 5x + 5. Let w(a) = a - 1. Let h(s) = n(s) - 4w(s). Calculate h(j). 5 Let q(o) = o - 1. Suppose 5k = 4 + 1, -8 = f - 2k. Let y be (2/f)/(3/(-72)). Let u = y + -8. Determine q(u). -1 Let x(p) = -p3 + p2 + p. Let k(l) = -21l3 + 6l*2 + 8l - 1. Let z(u) = k(u) - 6x(u). What is z(1)? -14 Let m(b) = 2b*3 - 2b*2 - 4b + 5. Let p(h) = h3 + h2. Suppose -2t - o = 2, -5o + o + 2 = -2t. Let n(l) = tm(l) + 3p(l). Give n(-4). -5 Let d(o) = -o3 + 5o*2 + 0o*2 - 7 + 5o - o*2. Let b be 4/(-8) + 22/4. Give d(b). -7 Let c(q) = q - 6. Let g(u) = -6u + 31. Suppose 5t + 16 = -3s + 6, -s - 8 = 4t. Let l(i) = tg(i) - 11c(i). Let x be (-1)/2-2 - -3. Determine l(x). 8 Let f(l) = -8 + 11 + l*2 + 4 + l. Suppose 4p - 12 = -n, 5n + 2p = -0n + 6. Give f(n). 7 Let i(g) = -7g*2 + 2g - 1. Let q(k) = k2 - k - 1. Let c(d) = d2 + 6d + 2. Let m be c(-6). Let x be q(m). Let z be (-2)/x3/(-6). What is i(z)? -6 Let m(z) be the third derivative of -z8/10080 + z7/840 - z*6/720 - 2z*5/15 + 3z*2. Let l(w) be the third derivative of m(w). Give l(4). -9 Let r(i) = -5i - 9. Suppose -4p - 10 = -3p. Let c = 17 + p. Let w(u) = -6u - 10. Let d(b) = cr(b) - 6w(b). Give d(0). -3 Let n(c) = -c2 + 3c*2 - 42c*3 + 41c3. What is n(2)? 0 Let k(g) be the third derivative of -g4/24 - 4g3/3 + g2. Let u be 12/(-2) - (0 + 0). Calculate k(u). -2 Let k(j) = 2j*2 - 2j - 2. Let n = 0 - 2. Let a = 5 + n. Suppose -p - 4 = 3h, -a + 1 = -3p - 2h. Give k(p). 2 Let z = -3 + 3. Let b(n) be the second derivative of -1/2n*2 - 1/2n*3 - 1/20n*5 + n - 1/4n*4 + z. What is b(-3)? 8 Let t be 10/(-4)(-24)/20. Let a(n) = 5 + 2nt - n + 0n*3 + 3n*3 - 6n*3. What is a(0)? 5 Let w(r) = 7r + 12. Let p(v) = 3v + 6. Let m(x) = -5p(x) + 2w(x). Calculate m(-6). 0 Let p(i) = 3i*2 - i + 1. Let w be p(1). Let b(k) = -3k2 + k + 9 - kw - 9. Calculate b(-3). -3 Let j(d) = -6d3 + d2 + d - 1. Let c be j(1). Let a(i) be the third derivative of 1/12i4 + i2 + 0 + 0i + 7/6i*3. What is a(c)? -3 Let a(v) = -v - 1. Let n(h) = 2h + 1. Let d(x) = -4a(x) - 3n(x). Determine d(1). -1 Let u(y) = y + 1. Let n(q) = 4q + 7. Let l(a) = n(a) - 5u(a). Determine l(-4). 6 Let d(r) be the first derivative of -r3/3 + r2/2 - 10. Determine d(4). -12 Let o = 46 - 31. Let x be 2/5 + 39/o. Let r(c) = -c*2 + 2c + 1. Give r(x). -2 Let h(k) be the first derivative of -k5/120 - k4/24 + k3 + 3. Let p(i) be the third derivative of h(i). What is p(-3)? 2 Let r(j) be the second derivative of j7/2520 - j6/240 - j4/12 + 2j. Let m(x) be the third derivative of r(x). Let w be 0 + 3 - (-2)/(-2). Determine m(w). -2 Let w(j) = -j3 + 0j + 2j + 7j*3 - 2 + 0j - 8j2. Let t(p) = 4p - 4p - 2p + 9p2 + 2 - 7p*3. Let v(d) = 5t(d) + 6w(d). Give v(3). 4 Let q(t) = t3 + 3t2 + t - 2. Let u be q(-3). Let l = 7 + u. Let x(y) = 1 - yl + y - y3 + 2 + 2. Calculate x(0). 5 Let c(t) = -t2 + 1. Let z(o) = -6o2 - o + 2. Let g(i) = c(i) - z(i). What is g(1)? 5 Let t(p) = -14p + 10. Let k(s) = -6 + 7 + 6 - 9s. Let b(o) = -8k(o) + 5t(o). Determine b(5). 4 Suppose -4o = 3r + 5 - 3, 0 = -5r - o + 8. Let b(w) = w*3 - 2w*2 + 4w - 3. Give b(r). 5 Let k(j) be the third derivative of j6/120 - j5/20 - j*3/3 - 5j*2. What is k(3)? -2 Let p(w) = -18w. Suppose -3q + 5q = 2. What is p(q)? -18 Let b(i) = 1. Suppose -18 = -4j + 2. Let d(w) = w + 5. Let r(v) = jb(v) - d(v). Suppose -5k + 2 = 22. Calculate r(k). 4 Let n(x) = -3x3 - x2 + 14x + 14. Let v(p) = p3 - 5p - 5. Let u(y) = 3n(y) + 8v(y). Give u(-3). -4 Let p(b) = -4b - 2. Let v(l) = l. Let h = -1 - 1. Let x be v(h). What is p(x)? 6 Let v(c) = c + 8. Let j be ((-3)/6)/(3/30). Let g be j/10 - (-22)/(-4). What is v(g)? 2 Let o = -73 + 66. Let z(s) = -s2 - 4s + 5. Calculate z(o). -16 Suppose 124b = 127b - 24. Let d(h) = h*3 - 8h*2 - h + 6. Give d(b). -2 Let f(a) be the first derivative of 6a + 1/3a3 + 2 + 1/2a*2. Let j = -7 - -7. Give f(j). 6 Let q(p) be the first derivative of -p + 3/4p*4 + 2/3p*3 + 0p*2 + 1. Let h be 3/6-4 + 1. Determine q(h). -2 Let l(x) = x*2 + 14x + 18. Let w be l(-13). Let k be 4/(-6) - 195/(-9). Suppose -wc + 0c - 3b - 6 = 0, 5b - k = 2c. Let p(n) = -n + 1. What is p(c)? 4 Let k(h) = -h2 - 7h + 4. Let o(m) = -m*3 + 2m*2 - 1. Let a be o(1). Let l = -6 + a. Give k(l). 10 Let b(y) = 3y + 2 + 0 + 4 - 6y2 + y3. Let c = 185 + -180. Give b(c). -4 Let z = -20 - -22. Let t(i) = -i3 + 3i*2 - i + 1. What is t(z)? 3 Let h(c) = c - 2. Suppose -u - 3o - 12 = -3u, 3o = 0. Let j be h(u). Let i(q) = -q + 0q2 - 1 + q2 + jq. What is i(-5)? 9 Let n(f) = 2f3 - 2f + 2f2 - 4f*2 - 2f*2 + 4f. Suppose -5a + 3b = -1, a - 3b = 2b - 13. Determine n(a). 4 Let w(p) = p3 - p2 + p + 1. Let z(l) = 3l3 + 2l*2 - l + 2. Let x(c) = 4w(c) - z(c). What is x(4)? -10 Let q(v) = v - 7. Let y(r) = -r*3 + 10r*2 - 10r + 9. Let d be y(9). Suppose dj - 6 = -j. Determine q(j). -1 Let u(a) be the second derivative of a7/840 + a6/360 - a5/120 + a4/24 - a3 + a. Let c(z) be the second derivative of u(z). Determine c(1). 2 Let q(k) = -3k3 + k2. Let t(r) be the first derivative of r3/3 + r2 + r - 2. Let v be t(-3). Suppose g + 27 = 2u - vg, -2u + 2g = -12. Give q(u). -2 Let d = 193 - 196. Let u(g) = g*2 + 8g + 4. Give u(d). -11 Let b be ((-68)/51)/((-2)/(-6)). Let y(g) = -5g + 3. Calculate y(b). 23 Let d(f) = -2f*2 + 2f - 2. Let r = -67 - -70. Determine d(r). -14 Let t(h) be the second derivative of -h*3/2 - 2h*2 - 3h. Let u(b) = -b - 2. Let a(v) = 3t(v) - 7u(v). What is a(3)? -4 Let l(p) = -p*2 + 3p - 4. Let h be l(1). Let z(r) = -2r3 + r2 + 8r*3 + 2r - 7r3 + 2. Give z(h). 10 Let y = -2 - -4. Let s be 11/(-1) + -2 + y. Let x = s + 8. Let t(a) = -a3 - 3a*2 - 3a - 3. Determine t(x). 6 Suppose c - 6c = 0. Let k be (1/(-1))/(2/(-6)). Let i(d) = cd3 + d3 + 0d2 - kd*2 - 1. What is i(3)? -1 Let o(g) = -2g*2 + 7g - 5. Suppose 5l - 11 = 4. Suppose 4 = lb - 2. Let z be (-1 - b)/(-3) - -3. What is o(z)? -9 Suppose 7 = 5c + 2. Let u(m) = -c + 5 - m + 4 - 1. Give u(6). 1 Suppose 7 = 2f + 1. Suppose -i = -fi - 12. Let w(r) = r + 7. Determine w(i). 1 Let x(a) = a - 2. Suppose -n + 16 = -0n + 5i, -4n - 2i = -28. What is x(n)? 4 Suppose -4x - 28 = -4a, 4x = -x - 25. Let r be (18/(-12))/(a/(-4)). Let d(f) = 3f3 - f2 + 0f*2 - 4f*3 + 1 + 2f + 4f2. Determine d(r). 7 Let u(i) be the first derivative of 1 - 6i*2 + i - 2i*2 + 3. Calculate u(1). -15 Suppose -6 = 3d - d. Let r(o) = 1 + 5o2 + 6o - 4o2 - 2 - o. Calculate r(d). -7 Let k = -9 - -15. Let b(s) = -2s + 1 + ks + 0s. Let w be (-1 + 4)(-2)/(-6). Calculate b(w). 5 Let v(x) = -17x + 9. Let s(u) = -4u + 2. Let h be ((-18)/(-12))/((-3)/(-8)). Let m(g) = hv(g) - 18s(g). Give m(-1). -4 Let c(m) be the second derivative of -7m4/24 - m3/6 - m*2/2 + 2m. Let l(t) be the first derivative of c(t). Let v = 2 + -3. Give l(v). 6 Let h(k) be the first derivative of -k*3/3 + 7k*2/2 + k + 2. Calculate h(8). -7 Let f(n) = 4 + 5n*2 + 0 - 6n - n*3 + 0n*3. Suppose 36 = 2a + 28. What is f(a)? -4 Suppose 0 = -o + 3o - 3n - 5, 0 = -5o - 5n - 50. Let s(v) = -2v - 7. Determine s(o). 3 Let f be -3(-3)/186. Let o(b) be the third derivative of 1/60b*5 - 5/24b*4 + 1/6b*3 + 0b - 2b2 + 0. Calculate o(f). -5 Let h(g) = 24 + 0g3 - 26 - g3. Suppose t + 4t = 0. Give h(t). -2 Suppose -3c + 3m = 24, -4m + 20 = -5c + 3c. Let n(d) = d*3 + 7d*2 + 6d - 4. Give n(c). -4 Let m(h) = 0h + 3 - 9h2 - h3 + 3 - 4h + 2h*3. Let j be (-3)/2(-20)/6. Let x(k) = -k*3 + 8k*2 + 3k - 5. Let w(s) = jm(s) + 6x(s). Calculate w(2). 0 Let h(i) = i3 - i2 + i - 7. Suppose 26 = q - 4q - 5f, -5q + 5f + 10 = 0. Let z be q - (2 - (-2 + 6)). Calculate h(z). -7 Let h(y) be the third derivative of -y5/60 - y4/6 - y*3/2 - 10y**2. Suppose	{ "pile_set_name": "DM Mathematics" }
-10i + n = -9i. Let h = 148 - i. What is the units digit of h? 8 Suppose 67o - 13772 = 56o. What is the tens digit of o? 5 Let a(t) = t*3 + 6t*2 - 2t - 8. Let l be a(-6). Let f(z) = z - lz + 6z*2 + 8 - 10. What is the units digit of f(-2)? 8 Let j be -1(-72)/(-28)(-462)/9. Suppose -11v + 5v = -j. What is the units digit of v? 2 Suppose -4x + 654 - 212 = 2z, -z = -x + 103. What is the tens digit of x? 0 Suppose 4w + w - 4 = -2x, -8 = -5w - 4x. Suppose w = 2t + q - 129, 0t + q = -3t + 192. What is the units digit of t? 3 Let t(b) = b*3 + 4b*2 - b. Let o be t(-4). Suppose 11 = ow - 5. Suppose -wf + 227 - 19 = 0. What is the tens digit of f? 5 Suppose 2z - 21 = -7. Let f(j) be the first derivative of j*3/3 - 5j*2/2 + 5j + 14. What is the units digit of f(z)? 9 Let f(x) = -14x2 - 45x - 18. Let i(p) = 5p2 + 15p + 6. Let b(o) = 4f(o) + 11i(o). Let u be b(-11). Let z = u + -17. What is the units digit of z? 1 Let w(i) be the first derivative of i*4/4 - 4i*3/3 + 2i*2 + i - 2. Let n be w(3). Suppose -5p - 1 = -np, 0 = -4u - p + 67. What is the tens digit of u? 1 Suppose 140b + 11670 = 146b. What is the tens digit of b? 4 Let h(y) = y*3 - 5y*2 + y + 5. Let t be h(4). Let m = t - -10. Suppose -w - mr + 34 = 0, -2r - 33 = -3w + 14. What is the tens digit of w? 1 Suppose 5f - 7865 = -46d + 51d, -6252 = -4f - 4d. What is the hundreds digit of f? 5 Let s(t) = 6t3 - t2. Let o be s(1). What is the units digit of 424/o + ((-1)/5)/(-1)? 5 Let u = -79 + 185. Let m = u + 34. What is the hundreds digit of m? 1 Let a(s) = -100s - 3. Let c be a(-2). Suppose c = 4u - 107. Suppose -x + u = 3x. What is the tens digit of x? 1 Suppose -36i + 26577 = -13347. What is the tens digit of i? 0 Let i be 6/4 - 7/(-14). Suppose -il - 3l - 20 = 0. What is the units digit of (-6)/(-4 + 7)l? 8 Suppose -9l + 15l - 2232 = 0. What is the hundreds digit of l? 3 Let f = 67 - 47. Let w = f - -31. What is the tens digit of (-11 - -11) + (w - 1)? 5 Suppose -5a = 5q - 4840, -19q + 3860 = -15q - 2a. What is the hundreds digit of q? 9 What is the thousands digit of 1474 - ((-1088)/(-160) - 2/(-10))? 1 Let d(z) = 12z2 + 3z - 2. Let a be d(1). Suppose 0 = 3j - a - 5. What is the tens digit of (j/(-4))/((-10)/180)? 2 Let y(w) = 9w*2 + 15w - 6. What is the hundreds digit of y(6)? 4 Let y = 16 + -11. Suppose yv - 14 = 86. What is the units digit of v? 0 Let n = 20 + -31. Let l be (-145)/(-11) + 2/n. Let o = l - 9. What is the units digit of o? 4 Suppose 4r = 4h + 20, 5h = -r - 4 - 9. Suppose -4s - r - 18 = 0. What is the units digit of -4 + s(1 - 4)? 1 Let s(m) = 8m2 + m - 1. Let n be s(-3). Suppose -y = -n - 11. What is the tens digit of 3/15 - y/(-5)? 1 Let n(w) be the second derivative of -w3/2 + w2/2 - 9w. What is the tens digit of n(-3)? 1 Let r(q) = 16q2 + 11 - 5 - q3 - 19 - 21 + 19q. What is the units digit of r(16)? 0 Suppose 4v - 1904 = -3v. What is the tens digit of v? 7 Let o = -810 - -1417. What is the tens digit of o? 0 Let u be -1814/(-12). Suppose -uy = -5y - 70. What is the tens digit of y? 7 Let n(l) = 17l - 2. Let j be n(1). Let z = j - 11. What is the units digit of z/10 + 96/10? 0 Let v(o) = -99o - 56. What is the units digit of v(-30)? 4 Let g(y) = y*2 - 4y + 109. What is the thousands digit of g(-42)? 2 Let v(n) = -35n - 3. Let j = -16 + 21. Let f(p) = 71p + 6. Let w(b) = jv(b) + 3f(b). What is the units digit of w(1)? 1 Let i = -53 + 58. Suppose 0 = -ix + 10x - 470. What is the units digit of x? 4 Suppose 1290 = 4o - r, -3o - 4r = -5r - 967. What is the tens digit of o? 2 Let a(t) be the first derivative of 3t3 + 3t*2 - 18t - 18. What is the hundreds digit of a(-6)? 2 Let o(p) = p*2 - 7. Let t be (-18)/12 - 18/(-4). What is the units digit of o(t)? 2 Suppose 0 = -5f - 5, -2f - 2 - 10 = -2y. Let b be y1(-1)/(-1). Suppose 0 = -5m + 3l + 67, 3l + 66 = bm - l. What is the units digit of m? 4 What is the hundreds digit of 11003 + (-49 - -48)? 0 Suppose 0 = -8t + 3t - 20. What is the units digit of (-4)/t153? 3 Let f(p) be the second derivative of p3/3 - 5p. Let y be f(7). Let o = 11 + y. What is the units digit of o? 5 Let p be 60/16 + (-2)/(-8). Suppose 3h = 3y - 12 + 63, -py = h - 32. Suppose 0 = 5z - h, -4z + 0z = -4w - 12. What is the units digit of w? 1 Let b(m) = -m2 + 6m - 5. Let x be b(4). Suppose z + 5v + 7 + 12 = 0, -3z + 2v - 6 = 0. What is the tens digit of (-75)/z - x/(-12)? 1 Suppose 0 = -5n + 4d + 71, 3n = -2n + 2d + 73. Let m = n + -11. Let i(l) = l*2 - 2l + 4. What is the units digit of i(m)? 2 Suppose -1379 + 47 = -d. What is the thousands digit of d? 1 Let p = 0 - -5. Suppose 5 = pb - 5. Suppose bh = -3d + 49, 3d = -4h + 4d + 77. What is the tens digit of h? 2 Suppose 0s + 6 = 3s. Let i = 160 - 160. Suppose 4j + 75 = 5g, i = -g - 2g - sj + 67. What is the tens digit of g? 1 Let i = 26 - 21. Let z(v) = -10v3 + 10v + 11v3 + 0 + iv*2 + 2 + 3v*2. What is the units digit of z(-5)? 7 Suppose 0 = -2d + 3 + 5. Suppose 2z + 3c = -1, dz - 5c - 35 = -z. Suppose -11 - 37 = -4s - zi, 3s + 2i = 33. What is the units digit of s? 9 Suppose -13w = -21w + 2248. What is the units digit of w? 1 Let v = -305 - -348. What is the tens digit of v? 4 Let k = 37 + -43. Let a(d) = -2d3 - 9d*2 + d + 14. What is the units digit of a(k)? 6 Suppose 479 = 5t - 5x - 9091, 6t - 3x = 11481. What is the thousands digit of t? 1 Let o(i) = 15i*3 - 7i*2 - 3i - 11. Let c be o(7). What is the units digit of 2/(-7) - (c/(-35) - 5)? 1 Let i be (-118 - -137)-12/2. Let d(q) = -q*3 + 6q*2 + 6q + 3. Let b be d(5). Let x = i + b. What is the units digit of x? 9 Let s(y) = -y*2 + 23y - 51. Suppose 0 = -t - t + 20. What is the units digit of s(t)? 9 Suppose 462c - 24934 = 455c. What is the thousands digit of c? 3 Let t(f) = -f*2 - 5f + 6. Let l be t(-5). What is the units digit of (-1 + 13)26/l? 2 Let i = -9 + 11. Let v(g) = 27g3 - g2 + g - 4. What is the units digit of v(i)? 0 Suppose -2 + 0 = t. What is the units digit of t/((-1)/(445/10))? 9 Suppose -5c + 2c + 15 = 0. Suppose cr = -r + 198. What is the tens digit of r? 3 Let s(o) = -o3 + 3o + 470. What is the units digit of s(0)? 0 Let y(n) = 5n - 2. Suppose -1 = 22c - 23c. What is the units digit of y(c)? 3 Let t(o) = o3 + 4. Let i be t(0). What is the units digit of 27 + (-4)/(6 - i)? 5 Let m(s) = 5 + 6 - 8s + 2s. What is the units digit of m(-5)? 1 Suppose 4 = -2d - 6, 5s - 2d = 30. Let w(b) = -sb3 - 7b*2 + 4b*3 + 7b - b*3 - b. What is the units digit of w(-8)? 6 Let x(h) = 2h*2 + 2h - 3. Suppose n - 4 = 4. Suppose 2l - n = 4l. What is the tens digit of x(l)? 2 Suppose -18 = 7i - 13i. Suppose -w = -3b - iw + 451, -463 = -3b + w. What is the tens digit of b? 5 Suppose -l - 2c = -22 - 1, -2 = -2c. Let s = -33 + l. Let f(a) = -a - 6. What is the units digit of f(s)? 6 Suppose -5x - 2384 = -w, -x = 3w - 3632 - 3472. What is the thousands digit of w? 2 Let j be ((-3)/(-6))/((-4)/(-1760)). Let u = j + -115. What is the tens digit of u? 0 Let v(k) = 18k - 3. Let h be v(-6). Let u = h - -155. What is the units digit of u? 4 Suppose 0 = 2w + 41 - 49. Suppose -3i - 2c - 168 + 559 = 0, wi - 544 = 3c. What is the units digit of i? 3 Let r(z) = -16z + 71. What is the units digit of r(-19)? 5 Suppose -7m + 25 = -10. Suppose -mj + r = -1640, 6r = -2j + 2r + 634. What is the tens digit of j? 2 Let t(b) = -2b*2 - 6b. Let i be t(-4). What is the units digit of (52/6)/(i/(-12))? 3 Let u = -172 - -408. Let x = u - 49. Suppose -x = -5d + 133. What is the tens digit of d? 6 Suppose -3h - 7h + 12120 = 0. What is the units digit of h? 2 Let d be (-2)/(-4 + 102/26). Let u = d + -11. What is the units digit of u? 5 Let j(m) = -7m - 19. Let t be (-4 - (-9)/(-3)) + -2. What is the tens digit of j(t)? 4 Let p = 5 + -1. Suppose -3x + p = -8. Suppose -2t = -xt + 16. What is the units digit of t? 8 Suppose v + 411 = -2p + 1627, -3v = 3p - 1821. What is the hundreds digit of p? 6 Suppose 3h - 9 = 0, 0h + 2h = 2r - 88. Suppose 397 - r = 2*l. What is the hundreds digit of l? 1 Let	{ "pile_set_name": "DM Mathematics" }
) + 18s(g). Determine u(j(k)). -16k Let f(y) = -y. Let x(i) = -1049i + 8. Let z(n) = -2098n + 18. Let o(p) = 9x(p) - 4z(p). Calculate o(f(l)). 1049l Let z(w) = -13w. Let j(f) = 2f - 5 + 21 - 16 + 3f. Calculate z(j(p)). -65p Let n(b) = 2b. Let t(p) = p*2 + 19p. Let h(m) = -3m2 - 37m. Let g(o) = 2h(o) + 5t(o). Determine g(n(d)). -4d2 + 42d Let v(n) = 359n2 - 102n*2 - 91n*2 - 95n*2 - 104n*2. Let d(z) = -8z*2. Give v(d(l)). -2112l*4 Let m(u) = 166u + 10. Let j(b) = -33b2. Give j(m(i)). -909348i*2 - 109560i - 3300 Let g(b) be the first derivative of -b*3 - 75. Suppose 3m - 4m = 0. Let l(z) = -1 + mz - 2z + 1. Give l(g(i)). 6i*2 Let d(u) = -366u*2. Let c(w) = -155w. Determine c(d(y)). 56730y2 Let w(m) = -24m*2. Let i(o) = -2165o*2 + 1101o*2 + 1085o*2. Give i(w(g)). 12096g*4 Let d(y) = 2y + 558. Let c(a) = -a*2 - 57a. Determine d(c(q)). -2q2 - 114q + 558 Let j(d) = 26d + 70. Let g(t) = -144t. What is j(g(p))? -3744p + 70 Let b(t) = -2t*2. Let v(h) = -6h*2 + 1942h - 2. Give v(b(o)). -24o4 - 3884o*2 - 2 Let l(f) = 1041f. Let u(v) = 84v - 47v - 38v. Determine u(l(c)). -1041c Let z(o) = 4o2 - 5. Let y(l) = -27l*2 + 36. Let p(d) = -5y(d) - 36z(d). Let s(u) = -11u*2. What is p(s(r))? -1089r*4 Let d(c) = 3c + 6c + c - 2c*2 - 10c. Let j(h) = 20h. Give d(j(s)). -800s*2 Let h be (6 + (-1 - -2))1. Let u(q) = 3 - q + h - 10. Let y(r) = 34r. Determine u(y(f)). -34f Let i(f) = 5f. Let g(c) = -6c. Let w(b) = 6g(b) + 7i(b). Let m(y) = y*2 - 2y - 1. Let s be m(3). Let u(x) = 0x2 - sx*2 - 8x*2. What is w(u(h))? 10h2 Let a(p) = -p2. Let s(y) = -2004y2 - 4y + 2. Let v(j) = -384769j2 - 770j + 385. Let z(l) = -385s(l) + 2v(l). Give a(z(o)). -4008004o4 Let z(k) = 6k. Let n(o) = 13492o. Give n(z(l)). 80952l Let f(i) = 82i - 338i + 86i + 86i + 82i. Let p(x) = 31x. Calculate f(p(q)). -62q Let s(y) = 6y. Suppose 0 = 5t - 15, 5h + t - 7 = h. Let u(x) = -x. Let j(r) = hs(r) + 8u(r). Let m(w) = -5w. Calculate m(j(n)). 10n Let s(f) be the second derivative of f*4/4 - f. Let h(v) = 4080v*2 + 4063v*2 - 8192v*2. What is s(h(u))? 7203u*4 Let s(j) be the third derivative of -619j*4/24 - 257j*2. Let d(b) = b. Calculate d(s(c)). -619c Let h = -63 - -57. Let j(a) = -a*2 - 6. Let t(l) = 1. Let c(f) = ht(f) - j(f). Let i(z) = -11z2. Determine c(i(n)). 121n4 Let f(t) = -t2 - 4t - 1. Let d be f(-3). Let w(a) = -4a - da - 2a + 6a. Let m(q) = -15q*2. Determine m(w(l)). -60l*2 Let d(h) be the first derivative of -14h2 + 196. Let w(m) be the third derivative of -m4/12 - 2m2. Determine w(d(v)). 56v Let m(f) = 34f - 71f + 40f. Let r(z) = -3z + 4z - 3z + 5z. Calculate r(m(d)). 9d Let v(m) = -2 + 4 - 5m2 - 2. Suppose -75 = 3q - 8q. Let k(r) = -4r + qr - 9r. What is v(k(d))? -20d2 Let b(t) = -5t*2 - 2t - 543. Let f(k) = -21k. What is f(b(u))? 105u*2 + 42u + 11403 Let c(r) be the second derivative of -3r4/2 - 1898r - 2. Let d(x) be the third derivative of x5/60 + x2. Give d(c(j)). 324j4 Let o(d) = -555d*2. Let v(i) = 19i*2. Determine o(v(s)). -200355s*4 Let p(m) be the first derivative of -10m*3 - 428. Let u(n) = 5n. Calculate u(p(b)). -150b2 Let n(z) = -z2 - 4z - 4. Let y(h) = -h*2 - 5h - 5. Let u(g) = 5n(g) - 4y(g). Let i = 20 - 14. Let r(s) = -17s + 9s + is. Determine r(u(m)). 2m*2 Let j(g) = -2245g. Let u(i) = -181i2 - 2i. What is j(u(f))? 406345f2 + 4490f Let d(z) = 5z - 8z - 2z. Suppose -2c = 2c. Let f(q) = -7q + cq + 8q. What is f(d(l))? -5l Let l(i) = 3i + 12445. Let g(n) = n. What is l(g(r))? 3r + 12445 Let i(m) = 3 + 912m - 456m - 3 - 455m. Let o(b) = b. Let s(t) = -2 + 2 + 2t. Let j(g) = 13o(g) - 6s(g). Calculate i(j(w)). w Let v(h) = 9h - 18h - 10h + 21h. Let g(x) = 601x. What is g(v(o))? 1202o Let t(x) = -272x*2 - 659x. Let y(n) = -3n. What is y(t(m))? 816m*2 + 1977m Let j(b) = -714b. Let i(v) = 31v. Let h(p) = 3p3 - 3p*2 + 7p - 5. Let g be h(3). Let q(c) = gi(c) + 3j(c). Let a(u) = u. Determine q(a(t)). 28t Let l(n) = -20n. Let i(h) = 8418h. What is i(l(v))? -168360v Let o(z) be the third derivative of -z*4/24 - 79z*2. Let x(r) = 104r*2. Calculate x(o(m)). 104m*2 Let o(h) = -7h. Let u(m) = 7m. Let n be 50/8 - 5/20. Let p(y) = 0y - 5y - 2y + 8y. Let q(a) = np(a) - u(a). Determine o(q(x)). 7x Let f(q) = 121576q*2. Let l(z) = -3z*2. What is f(l(n))? 1094184n*4 Let x(k) = 8 + 82k*2 - 19 + 4 + 7. Let f(j) = 6j. Calculate f(x(r)). 492r2 Let w(f) = -14f*2 - 2. Let t(b) = 14b*2 + 3. Let h(i) = -2t(i) - 3w(i). Let a(x) be the first derivative of x3/3 - 129. Give h(a(q)). 14q*4 Let y(q) = 128261806 - 128261806 - q. Let r(x) = -10x. Let b(k) = -5k. Let c(g) = -5b(g) + 3r(g). Calculate y(c(i)). 5i Let c(a) = 36a2. Let u(y) = y2 + y + 1. Let k(p) = -4p*2 + p + 1. Let g(x) = k(x) - u(x). Calculate c(g(h)). 900h*4 Let g(p) = 10p2. Let k(z) be the second derivative of -z6/720 + 19z4/12 - 11z. Let m(b) be the third derivative of k(b). Determine g(m(s)). 10s2 Let a(k) = -3k2. Let i(g) be the second derivative of -g4/6 + 4g2 - 4g. Let w(d) be the first derivative of i(d). What is w(a(n))? 12n2 Let m(z) = 15z*2. Let i(y) be the second derivative of 0 + 0y*2 + 5/6y*3 - 54y. Determine i(m(k)). 75k2 Let w(b) = 6b - 26. Let s(o) = -103o. What is s(w(f))? -618f + 2678 Let p(d) be the second derivative of d*4/3 + 23d. Let q(o) = 5o2 + 7o - 7. Let b(t) = 2t2 + 3t - 3. Let u(v) = -7b(v) + 3q(v). Give p(u(n)). 4n4 Let r(u) = -15u*2 + 31u*2 + 10u*2. Let a(d) = 3d*2. Determine a(r(n)). 2028n*4 Let m(z) = -26z*2. Let n(k) = 4k + 2. Let o(v) = -26v - 12. Let j(w) = -12n(w) - 2o(w). What is j(m(t))? -104t*2 Let l(a) = a. Let k(s) be the first derivative of 57s*2 + 191. Calculate k(l(x)). 114x Let n(q) = -3q. Let u(f) be the third derivative of f5/15 + 16f*2 - 3. Give u(n(z)). 36z*2 Let z(n) = -n. Let v be (-65)/(-130) + 2/(-4). Let i(h) be the second derivative of v + 1/6h*3 + 0h*2 - h. What is i(z(d))? -d Suppose -v + 5y + 22 = y, -4v + y = -28. Let n(g) = -23g. Let k(s) = 4s. Let c(d) = vn(d) + 34k(d). Let z(p) = 3p. Calculate z(c(b)). -6b Let r(f) = -998f*2. Let x(b) = -2b + 70. Determine x(r(o)). 1996o2 + 70 Let n(q) be the third derivative of q7/1260 + q5/6 - 4q*2. Let v(x) be the third derivative of n(x). Let f(u) = -2u + 3u + 0u. Calculate v(f(d)). 4d Let s(w) = -w + 47385. Let q(a) = -2a. Determine s(q(n)). 2n + 47385 Let k(n) = -37n*2. Let q(z) = -95z. Let w(s) = -4s. Let i(a) = -2q(a) + 50w(a). Calculate i(k(g)). 370g2 Let h(q) = -q - q2 + q. Let n(p) = -66p - 82p + 153p. Calculate n(h(b)). -5b*2 Let z(r) = -3r + 77764. Let l(u) = -2u2. Give z(l(f)). 6f*2 + 77764 Let n(q) = -110q - 1. Let i(r) = r*2 + 4r + 4. Let m(s) = -2s2 - 10s - 10. Let x(h) = -15i(h) - 6m(h). What is n(x(o))? 330o2 - 1 Let h(m) = 2m. Let z(r) be the first derivative of -17 + 0r + 5/2r*2. Determine h(z(l)). 10l Let n be (4/(-12))/((-1)/9). Let y(k) = -nk2 + 1153 - 1153. Let i(x) = -4x*2. Give y(i(j)). -48j*4 Suppose 4r = 2u, u = -r - 1 + 4. Let s(t) = -4t2 + tu + 3t2 + t2. Let g(m) = -15m*2. Give s(g(x)). 225x*4 Let g(u) = 3u*2. Let t be (6 - 9)/((-1)/(-2) + -2). Let j(o) = -7o*2 + 3o*2 + to*2 + 0o*2. Calculate g(j(w)). 12w*4 Let x(y) = -y. Let u(h) be the first derivative of 0h + 11/2h2 + 3. Calculate x(u(q)). -11q Suppose 0k = k - 3o - 14, 5o = -2k - 16. Let p(t) = -2tk - 196t + 196t. Let w(v) = 10v*2. Calculate w(p(h)). 40h*4 Let j(s) = -41s - 31s - 42s + 101s. Let v(b) = 3b. Determine j(v(h)). -39h Let u(y) = -2y - 1 + 1. Suppose 0 = -11d - 2d + 780. Let o(l) = -47l2 + 90l*2 - dl*2. Calculate u(o(c)). 34c*2 Let v(b) = 656b - 4. Let l(z) = -2z2. Calculate v(l(g)). -1312g*2 - 4 Let f(c) = 189c*2 + 27. Let j(l) = -27l*2 - 4. Let k(u) = -4f(u) - 27j(u). Let b(q) = 2q. Calculate k(b(m)). -108m2 Let j(p) = p2. Let i = -3 - -5. Let y(q) = 20	{ "pile_set_name": "DM Mathematics" }
8 and 5883? 159 Calculate the greatest common divisor of 4090 and 164418. 818 What is the greatest common factor of 1785096 and 108? 36 What is the greatest common divisor of 97949 and 41? 41 Calculate the highest common factor of 441385 and 35. 35 What is the highest common divisor of 135114 and 126? 42 What is the greatest common factor of 3470 and 850? 10 Calculate the greatest common divisor of 5725 and 925. 25 Calculate the greatest common factor of 97893 and 53874. 657 Calculate the highest common factor of 136 and 34472. 8 Calculate the highest common factor of 230 and 1052342. 46 What is the highest common factor of 1220459 and 149? 149 Calculate the greatest common divisor of 7526 and 1562. 142 What is the highest common divisor of 9741 and 153? 51 Calculate the highest common divisor of 8618 and 4726. 278 Calculate the greatest common factor of 999 and 26196. 111 What is the greatest common divisor of 754 and 66469? 13 What is the highest common factor of 322 and 2346? 46 What is the greatest common factor of 2412 and 5490918? 1206 Calculate the greatest common factor of 40546 and 19. 19 Calculate the greatest common divisor of 12029 and 207. 23 Calculate the greatest common divisor of 45 and 4572. 9 Calculate the greatest common divisor of 1129774 and 226. 226 Calculate the highest common divisor of 544 and 11866. 34 Calculate the highest common divisor of 86853 and 114699. 663 Calculate the greatest common factor of 1751 and 4223. 103 Calculate the highest common factor of 5010 and 258. 6 What is the highest common factor of 1779294 and 198? 66 What is the highest common divisor of 44 and 22396? 44 Calculate the highest common factor of 185738 and 266. 14 Calculate the greatest common factor of 1233 and 14385. 411 What is the highest common factor of 267828 and 44? 44 What is the greatest common divisor of 72 and 90? 18 What is the greatest common divisor of 616637 and 3215? 643 Calculate the greatest common divisor of 2034 and 14577. 339 Calculate the highest common factor of 598 and 3201991. 299 What is the greatest common divisor of 3822 and 2814? 42 What is the highest common divisor of 92 and 290536? 92 Calculate the highest common factor of 316 and 7742. 158 What is the highest common factor of 550 and 2900? 50 Calculate the greatest common factor of 118449 and 13407. 123 What is the highest common divisor of 335 and 5830? 5 What is the greatest common divisor of 15147 and 396? 99 Calculate the highest common divisor of 1914 and 69861. 957 What is the highest common divisor of 57051 and 54? 27 What is the greatest common divisor of 28347 and 297? 33 Calculate the highest common factor of 201000 and 2760. 120 What is the highest common factor of 6743 and 913? 11 Calculate the greatest common factor of 1310 and 10. 10 Calculate the greatest common divisor of 1764 and 1860. 12 What is the greatest common factor of 173058 and 18? 6 Calculate the greatest common divisor of 396 and 496716. 132 Calculate the greatest common divisor of 104796 and 1491. 213 Calculate the greatest common factor of 11026 and 1924. 74 What is the highest common factor of 314785 and 5495? 785 Calculate the greatest common divisor of 108 and 138132. 108 What is the greatest common divisor of 49112 and 224? 56 What is the greatest common divisor of 3 and 2834706? 3 Calculate the greatest common divisor of 95292 and 27. 9 What is the highest common factor of 1444 and 764? 4 Calculate the highest common factor of 2833791 and 2734. 1367 What is the greatest common factor of 40942 and 1034? 22 What is the highest common divisor of 42823 and 1496? 187 What is the highest common divisor of 553845 and 15? 15 What is the greatest common divisor of 553833 and 21? 21 Calculate the greatest common factor of 7889 and 437. 23 What is the greatest common factor of 16 and 8881? 1 What is the greatest common divisor of 11346 and 162192? 186 What is the greatest common divisor of 8262 and 26154? 18 Calculate the highest common divisor of 760 and 3880. 40 What is the highest common factor of 102 and 215634? 6 What is the highest common divisor of 3 and 8856123? 3 What is the greatest common divisor of 799 and 44838? 47 What is the greatest common divisor of 37708 and 88? 44 Calculate the highest common divisor of 28 and 1923684. 28 What is the highest common divisor of 116 and 292? 4 What is the greatest common factor of 95700 and 1980? 660 What is the highest common divisor of 14110 and 59760? 830 Calculate the greatest common factor of 3888 and 1312. 16 Calculate the highest common divisor of 8 and 7124. 4 Calculate the greatest common factor of 13 and 511771. 13 What is the highest common divisor of 2625 and 4125? 375 What is the highest common factor of 256034 and 5726? 818 What is the greatest common factor of 133625 and 375? 125 What is the highest common divisor of 8 and 19288? 8 What is the greatest common divisor of 28116 and 1254? 66 Calculate the greatest common divisor of 133764 and 9420. 1884 Calculate the highest common factor of 121345 and 70. 35 Calculate the highest common factor of 3706143 and 651. 651 What is the highest common factor of 151 and 698224? 151 Calculate the highest common divisor of 1153450 and 345. 115 Calculate the greatest common factor of 147 and 68621. 7 Calculate the greatest common divisor of 221 and 18649. 17 What is the highest common divisor of 13804 and 7259? 119 What is the greatest common factor of 4437 and 81171? 261 What is the greatest common factor of 31827 and 6077? 103 What is the greatest common factor of 2336 and 55808? 32 What is the highest common divisor of 148 and 45547? 37 Calculate the greatest common divisor of 228 and 349372. 76 Calculate the highest common factor of 53030 and 160. 10 Calculate the highest common factor of 12 and 8508. 12 Calculate the greatest common divisor of 15867 and 559. 43 Calculate the highest common divisor of 18 and 5633739. 9 Calculate the highest common divisor of 19943 and 98. 49 Calculate the highest common divisor of 2916 and 180. 36 What is the highest common factor of 508 and 1215771? 127 What is the highest common divisor of 40 and 171032? 8 Calculate the highest common factor of 105 and 199170. 15 What is the greatest common divisor of 26978 and 11767? 287 What is the greatest common divisor of 106930 and 15606? 578 What is the highest common factor of 5798980 and 43? 43 Calculate the highest common factor of 6026 and 46. 46 Calculate the greatest common divisor of 21257 and 183983. 733 What is the greatest common factor of 34 and 1188827? 17 What is the greatest common divisor of 21 and 92666? 7 Calculate the highest common divisor of 54991 and 254. 127 Calculate the greatest common divisor of 150582 and 66. 6 What is the highest common divisor of 696019 and 1? 1 Calculate the greatest common factor of 83673 and 243. 81 Calculate the highest common factor of 224 and 98308. 28 Calculate the greatest common factor of 150348 and 510. 102 Calculate the greatest common divisor of 527 and 2001019. 527 What is the highest common factor of 1024 and 14752? 32 What is the highest common factor of 841100 and 800? 100 Calculate the greatest common divisor of 27 and 612954. 27 Calculate the highest common factor of 1434 and 2274. 6 What is the highest common factor of 76424 and 164? 164 What is the greatest common divisor of 6952 and 1573? 11 Calculate the greatest common factor of 28 and 209396. 4 Calculate the highest common factor of 726 and 48576. 66 What is the greatest common factor of 536 and 8192? 8 Calculate the highest common factor of 47718 and 30848. 482 Calculate the greatest common divisor of 12 and 213156. 12 Calculate the greatest common divisor of 45 and 11349. 9 Calculate the highest common factor of 3924 and 114612. 12 Calculate the highest common divisor of 592 and 123173. 37 What is the highest common divisor of 11760 and 199290? 210 Calculate the highest common divisor of 621 and 1087533. 27 Calculate the highest common divisor of 39392 and 112. 16 What is the highest common factor of 5301 and 29773? 19 Calculate the greatest common factor of 149041 and 103. 103 Calculate the greatest common factor of 1612 and 311428. 52 Calculate the highest common factor of 85 a	{ "pile_set_name": "DM Mathematics" }
uppose 3n + 6 = -5c - 0, 0 = 5n - 4c - 27. Suppose 2i + 2 = 4b + 4i, -nb + 4i = -29. What are the prime factors of b? 3 Let t = -7 - -12. Suppose 3h - t - 4 = 0, -f = -2h - 18. Suppose 0 = -m - m + f. What are the prime factors of m? 2, 3 List the prime factors of (-3 + (4 - 2))/(2/(-512)). 2 Let s be -4(-1 + 3/12). Let z be 56/s + 2/(-3). Suppose z = 4i - i. List the prime factors of i. 2, 3 Let h(v) = v2 + 13v - 2. Let k be h(-14). Suppose k = 2j - j. What are the prime factors of j? 2, 3 Suppose 5a - 70 = 70. Suppose w - 2b = a, -w - 4b - 32 = -2w. Suppose -u + w = 2u. What are the prime factors of u? 2 What are the prime factors of (3 - 4)1 + 47? 2, 23 Let g(t) be the second derivative of -t3/6 + t2 - 2t. List the prime factors of g(-7). 3 Let d be ((-1)/2)/((-6)/(-60)). Let l = d - 1. What are the prime factors of 2(3/l + 3)? 5 Let x(v) = -v2 + 7v - 6. Let w be x(7). List the prime factors of w6/(-20)5. 3 Let k(d) = -d*3 - 8d*2 + 6d + 7. What are the prime factors of k(-9)? 2, 17 Suppose 12 = 4n - 2m, 0 = -n + m + 3 + 1. Let b(x) = -4x2 + 3x*2 + 0x*n + 7 - 2. What are the prime factors of b(0)? 5 Let b be 7(-4)/(-4)4. Suppose -232 - b = -5u. What are the prime factors of u? 2, 13 Suppose 0 = 2r - 83 + 15. Suppose r = 5f - 11. List the prime factors of f. 3 Let c = 100 + 112. What are the prime factors of c? 2, 53 Let i be (30/(-1))/1 - 1. Let k = i + 19. Let c = k + 21. List the prime factors of c. 3 Suppose t + 18 = 7t. What are the prime factors of t? 3 Suppose 0 = d + 3d - 192. Suppose -p - d = -5p. List the prime factors of p. 2, 3 Suppose 3 + 19 = -2s. Let d be (-2)/(-6) - s/3. Suppose -3n + 6r = r - 41, -3n + 32 = dr. List the prime factors of n. 2, 3 Let a = 345 + -213. What are the prime factors of a? 2, 3, 11 Let j = -101 - -156. What are the prime factors of j? 5, 11 Let a(b) be the second derivative of b*4/12 - 2b*3/3 + 3b*2 - 23b. Let v = -1 + 5. What are the prime factors of a(v)? 2, 3 Suppose 8 = -2p, 4x = -p + 3p + 72. Suppose -2s - x = 2s. List the prime factors of (-147)/(-12) + 1/s. 2, 3 Let r = 12 + -8. Let m(z) = -z3 + 3z*2 + 2z + 5. Let p be m(r). Let j(v) = -3v + 3. List the prime factors of j(p). 2, 3 Suppose -2r + 3d = 0, 2r + 7d = 2d + 16. List the prime factors of r. 3 Let x(n) = n*2 + 1. Let a be -33/((-27)/6). Suppose -7q = -aq - 10. List the prime factors of x(q). 5 Let i be -6-3(-5)/(-18). Suppose -ib + 0f = -2f - 33, 2b + 2f - 16 = 0. List the prime factors of b. 7 Let q = 9 - 6. Suppose -4h = -0w + 2w - 150, -qh - 5w + 123 = 0. Suppose -4u + h = -u. List the prime factors of u. 2, 3 Suppose d = 2d - 4. Let o = 8 - d. Suppose 3 + 12 = 4f + 5v, -5f = ov - 30. What are the prime factors of f? 2, 5 Let d(k) = -5k3 + 6k*2 + 7k + 10. Let c(w) = w*3. Let p(y) = 4c(y) + d(y). What are the prime factors of p(7)? 2, 5 Let x = 0 - 1. Suppose -5h = -83 + 28. Let m = h - x. List the prime factors of m. 2, 3 Let y(f) = f2 + 3f - 7. Let z = -5 + -1. List the prime factors of y(z). 11 Suppose -3c + 2c = -5t + 33, 2t = c + 15. Suppose 12 = -4z + tz. Suppose -3n + 36 - z = 0. What are the prime factors of n? 2, 5 Suppose 5x - 46 = -291. List the prime factors of (-672)/x - (-2)/7. 2, 7 Let z be (-3 + 5 - -28)-9. What are the prime factors of (-4)/(-14) + z/(-35)? 2 Let q be (-9 + -387)2/(-4). What are the prime factors of q/30 - (-2)/5? 7 Let a = -28 - -69. List the prime factors of a. 41 Let k = 6 - 6. Suppose k = j + 5s - 29, 0s = 2j - 5s - 88. What are the prime factors of j? 3, 13 Suppose -2 = -2r - 0, -4p - 5r + 33 = 0. Let m be ((-14)/p)/(1/(-3)). Suppose 3b = -5w + 26, 8 = 3w + b - m. What are the prime factors of w? 2 Suppose -2z + 12 = -4v - 0v, 0 = 4v + 5z + 26. Let i(g) = g + 8. What are the prime factors of i(v)? 2 Let v(m) = m3 - 6m*2 - 6m + 9. What are the prime factors of v(7)? 2 Let c(w) = 5w2 - 4w - 4w2 + 0w*2 - 6 + w. Let a be ((-10)/(-6))/(2/6). List the prime factors of c(a). 2 Suppose 0 = g + 2g - 48. Suppose 4v + 3t = -15, 2v - 5t + 36 = 9. Let s = v + g. List the prime factors of s. 2, 5 Let h = -4 + 5. Let k be (1 - 0/1) + h. Suppose y = k - 0. What are the prime factors of y? 2 Let m be (-20)/(-6) + 6/9. Suppose 3i - mo = 5i - 10, 4o = 5i - 11. Suppose -q - 2 = l, il + 5 + 13 = q. What are the prime factors of q? 3 Let w be (-21)/(-4) - 8/32. Let x(z) be the first derivative of z*4/4 - 5z*3/3 + 3z - 1. List the prime factors of x(w). 3 Suppose 2m - 10 = -5q, 2m - 10 = 2q - 0q. What are the prime factors of q - (-4 - -2) - -1? 3 Suppose -2k - 3r - 12 = -4, -18 = -3k + 3r. Suppose -5j = ki - 4j - 79, 0 = -2i - 3j + 77. List the prime factors of (-2)/6 + i/3. 13 Suppose 3m - 2b - 110 = 0, 2b - 5b - 185 = -5m. What are the prime factors of m? 2, 5 Let p = 0 + 8. What are the prime factors of p? 2 Suppose -5f = -2f - 63. Suppose -fa = -25a + 96. What are the prime factors of a? 2, 3 Let v = 62 - -34. List the prime factors of v. 2, 3 Let s(v) = 3v - 6v2 + 8v*3 + v - 7v3. Let j be s(5). Let l(y) = y3 + 5y2 - y + 4. List the prime factors of l(j). 3 Suppose 6o = 3o. Let c(d) = d2 + 7d + 8. Let f be c(-6). Suppose -j + f + 5 = o. List the prime factors of j. 7 Let c(d) = -d*3 + 5d*2 + 3d + 5. Let n(y) = -y*3 + 4y*2 + 4y + 5. Let a(q) = 3c(q) - 2n(q). What are the prime factors of a(7)? 2, 3 Let u be 2/(-8) - 21/(-4). What are the prime factors of (u/(-5))/(2/(-10))? 5 Let z(d) = 7d2 + d - 1. Let t(h) = -8h*2 - 2h + 1. Let o(s) = 5t(s) + 6z(s). Suppose 0 = 2x - 2 - 4. List the prime factors of o(x). 5 Let l = -21 + 31. What are the prime factors of l? 2, 5 Suppose -3q - 6 = 39. Let f(s) = -3s - 4. What are the prime factors of f(q)? 41 Let r = -10 - -19. What are the prime factors of r? 3 Suppose 20 = 5h, 3h + 20 + 376 = 3t. What are the prime factors of t/(-12)(-6)/4? 17 Let o(w) = 2w2. What are the prime factors of o(-2)? 2 Let p(g) = g3 - 4g2 - 6g + 3. Suppose 2y = -0y + 10. Let k be p(y). Let o(d) = -2d3 - d2 + d + 1. What are the prime factors of o(k)? 11 Let a = -36 - -50. What are the prime factors of a/3108/24? 3, 7 Suppose -11c + 16c = -45. What are the prime factors of (-80)/(-15)c/(-6)? 2 Let i(y) = y3 - 3y*2 + 4y + 3. List the prime factors of i(4). 5, 7 Let o(i) = -i*2 - 5i - 4. Let c be o(-3). Suppose 2s = -0s + 144. Suppose 0 = 5k + cb - s, 4k + 4b = 28 + 20. What are the prime factors of k? 2 Suppose -2f + 8 = -88. What are the prime factors of f? 2, 3 Suppose 8x = 2i + 3x - 10, -4x - 10 = -2i. Let y(h) = h*3 - 6h*2 + 6h + 6. What are the prime factors of y(i)? 11 Suppose -2l + 1 = 5. List the prime factors of (-1 - (40 - -1))/l. 3, 7 Suppose -94 - 365 = -3a. List the prime factors of a. 3, 17 Let h(q) = q*2 + 2q + 2q3 + 12q*3 - 4 + 5. Let v be h(-1). Let r = v - -21. List the prime factors of r. 7 Let u(l) = 16l*2 - 3l + 1. Let c be u(2). Suppose -4p - 103 = 65. Let q = p + c. List the prime factors of q. 17 Suppose 4o = 2m + 14, -23 = -0m - 3m - 5o. Let y = m - 3. What are the prime factors of (4/(-8))/(y/28)? 7 Let c be 134/10 + (-8)/20. Let y = -1 + c. List the prime factors of y. 2, 3 Let n = -49 + -4. Let d = -3 - n. What are the prime factors of d? 2, 5 What are the prime factors of (2 - 2) + 37 + -4? 3, 11 Let m(k) = -8k2 - 35k + 26. Let f(q) = 3q2 + 12q - 9. Let v(b) = -11f(b) - 4m(b). What are the prime factors of v(6)? 7 Let s(f) = f3 - f2 - f + 4. Let i be s(0). Suppose 45 = 5o - y, -o + 16 = iy - 14. Suppose 2 = -4n + o. List the prime factors of n. 2 Suppose 0 = -2w + 5h + 6, w - h = h + 3. Let t = w + 0. What are the prime factors of t? 3 Suppose 3g = 9g - 126. Suppose 3s = j + 5, 5s - 4 = -2j + 4s. Suppose 0 = 2m - g + j. What are the prime factors of m? 2, 5 Suppose -2m - 10 = -4m, -4m = t - 69. List the prime factors of t. 7 Let l = -3 + -4. Let y = 25 + l. Suppose -n + 3n = y. What are the prime factors of n? 3 Let i(u) = 4u - 14. List the prime factors of i(11). 2, 3, 5 Suppose 5r = 5m + 25 - 5, -r = -5m - 8. Suppose rb = -2b + 155. List the	{ "pile_set_name": "DM Mathematics" }
1/5? 5/2 Which is the smallest value? (a) -3712/3 (b) -2 (c) 0.1 a Which is the third smallest value? (a) -11 (b) 4/3 (c) -3 (d) 3 b What is the second biggest value in -5, -1/2, -2, 0.31? -1/2 What is the second biggest value in 2, 3/7, -2/17, 0.1? 3/7 What is the biggest value in 0, -1/18, -8? 0 Which is the third smallest value? (a) -0.4 (b) 1 (c) 1/202 b Which is the fifth biggest value? (a) 4 (b) -0.17 (c) 3/2 (d) 2/3 (e) 1 b Which is the biggest value? (a) -4 (b) 2/3 (c) 1.3 (d) -2 c Which is the second smallest value? (a) 3/433 (b) 4 (c) 0.4 c Which is the second smallest value? (a) -0.1 (b) -2 (c) -210 (d) 0.4 b What is the fourth smallest value in 0.2, 4.93, -1, -4, 0? 0.2 Which is the third biggest value? (a) -2 (b) 15 (c) 6/5 (d) -5 a What is the biggest value in 2, -1/5, -0.5, 3, -14? 3 What is the biggest value in 2/11, -5, 0.04, -0.4? 2/11 Which is the second smallest value? (a) 2 (b) 0.03 (c) 246 a Which is the fourth biggest value? (a) -0.3 (b) 5 (c) -4 (d) 2/19 c What is the biggest value in -275, -1/4, 0, 0.2? 0.2 Which is the fourth biggest value? (a) -1 (b) -2 (c) 0.1 (d) 0.041 b Which is the fourth smallest value? (a) 1/2 (b) -0.5 (c) -101 (d) 4 (e) 0 a Which is the third smallest value? (a) 2/11 (b) -7/4 (c) -5 a Which is the fourth smallest value? (a) -0.4 (b) 2/9 (c) -1/5 (d) 13/8 (e) -1/8 b Which is the second smallest value? (a) -0.08 (b) -1 (c) 85 a Which is the fourth smallest value? (a) 9 (b) -0.6 (c) 4 (d) -2/5 a Which is the fourth smallest value? (a) 1 (b) 0.022 (c) 0 (d) -1 a What is the second biggest value in -62, 1/5, -1? -1 Which is the fourth biggest value? (a) -1/4 (b) -3/70 (c) -5 (d) -0.3 c Which is the fourth smallest value? (a) -0.5 (b) -9.4 (c) 2/3 (d) 0.2 c Which is the second biggest value? (a) 0 (b) 2 (c) 5 (d) 14 c What is the third smallest value in 0, 9/4, 2/7? 9/4 What is the third smallest value in 5, 0, -0.49? 5 Which is the biggest value? (a) -0.05 (b) -1 (c) -29 a Which is the second biggest value? (a) 47 (b) -103 (c) 0 c Which is the fourth smallest value? (a) -4 (b) 47 (c) -4/3 (d) 1/7 b Which is the fourth biggest value? (a) 0.3 (b) -1/44 (c) -4/7 (d) -2/7 (e) -3/10 e Which is the biggest value? (a) 0.4 (b) -26 (c) -0.3 (d) -0.02 a What is the third smallest value in -2/9, 189, -4? 189 What is the second smallest value in 4/13, 0.7, 4? 0.7 What is the third biggest value in 3, 5/3, 0.1, 351? 5/3 What is the biggest value in 297, -3, 0.4? 297 What is the smallest value in 1, 2/63, 11, 10? 2/63 Which is the third smallest value? (a) 35 (b) 3/2 (c) -0.4 a Which is the second biggest value? (a) 1/101 (b) 4/3 (c) 0.5 c What is the third biggest value in 0.1, 2/3, -0.02? -0.02 Which is the third biggest value? (a) -0.6 (b) -1/7 (c) 0 a Which is the fourth smallest value? (a) 2/3 (b) -2/11 (c) 19 (d) -2/3 c What is the biggest value in 0.4, 141, 0.3? 141 Which is the biggest value? (a) 4/13 (b) -5 (c) -0.05 a What is the smallest value in -3/2, 1/2, -2/7, -61? -61 What is the third biggest value in -1/4, 6.1, 0.02? -1/4 What is the second smallest value in 472, 3, 0.3? 3 What is the third smallest value in -5/3, -22, -15? -5/3 Which is the third smallest value? (a) 1 (b) -6 (c) -4 (d) -3 d Which is the fourth smallest value? (a) -2/5 (b) 5/7 (c) 5 (d) 1/5 (e) 0 b What is the second biggest value in -8/9, 154, -1? -8/9 What is the second biggest value in -5, 5, 1/8, 0.4? 0.4 Which is the fourth biggest value? (a) -2/5 (b) 0.2 (c) -0.5 (d) 1 c Which is the second smallest value? (a) -0.3 (b) 1/128 (c) -1/9 c What is the third biggest value in 3/7, -2, -1/135? -2 Which is the third smallest value? (a) -2.5 (b) 2/7 (c) 4 (d) 2 (e) 0.2 b Which is the fourth smallest value? (a) 2/3 (b) 0 (c) -1/6 (d) 0.2 a What is the biggest value in 1/9, 0, -2, 5, 0.1? 5 What is the third smallest value in -1/3, -4.9, -0.1? -0.1 Which is the second smallest value? (a) -9/19 (b) -3 (c) -1/2 c Which is the fourth smallest value? (a) -6 (b) -0.5 (c) 3/4 (d) 0.06 (e) 2 c What is the third smallest value in -158, 2/7, 1? 1 What is the second smallest value in 56, -4, -0.1, 4? -0.1 What is the third smallest value in 7.6, -26, 1, -2? 1 Which is the second smallest value? (a) 2 (b) 2/5 (c) -5 (d) -0.01 d Which is the fourth smallest value? (a) 0 (b) 4/3 (c) -3 (d) -2/203 (e) 2 b Which is the third smallest value? (a) -0.4 (b) 34 (c) 4/9 (d) -17 c Which is the fourth smallest value? (a) 4 (b) 1.5 (c) 1 (d) -0.1 (e) -10 b What is the third biggest value in -12, 6, 5? -12 Which is the third smallest value? (a) 35 (b) -0.3 (c) 3/2 (d) 0.5 c Which is the second smallest value? (a) 0.4 (b) -81 (c) 1 (d) 0 d What is the second biggest value in 270, 2/9, 1/6? 2/9 Which is the smallest value? (a) -9 (b) -2/31 (c) -8 a Which is the third smallest value? (a) 0.045 (b) 4 (c) 6 (d) -2/7 b Which is the second smallest value? (a) 5 (b) 0.3091 (c) -1 (d) -0.3 (e) -0.2 d What is the third biggest value in 4, 3/2, -4, -16, 0? 0 Which is the third smallest value? (a) 1/8 (b) -7 (c) 0.5 (d) 111 (e) -4/9 a Which is the biggest value? (a) 2 (b) -2/17 (c) 49 c What is the third smallest value in 1, 92, 3? 92 What is the smallest value in 41, -20, -0.3? -20 What is the biggest value in -27, 9, -2/7? 9 What is the smallest value in -0.4, 150, 2/13, 0.3, 4? -0.4 What is the second smallest value in 1.92, -3, 5? 1.92 What is the fourth smallest value in 2, 0.3, 0.5, -8? 2 What is the second biggest value in -1/6, 21/5, 2? 2 Which is the second smallest value? (a) 1.7 (b) -26 (c) 5 a Which is the fifth smallest value? (a) -18 (b) 4 (c) -2/15 (d) -0.5 (e) 0.2 b Which is the fourth smallest value? (a) 1 (b) 1/34 (c) 2/19 (d) 5 d Which is the smallest value? (a) 12 (b) 8 (c) -2/7 c What is the third biggest value in -0.13, -6/13, 3/5? -6/13 What is the third smallest value in -6, -0.9, -4? -0.9 What is the third biggest value in 5, 0.2, -267, -2/23? -2/23 Which is the biggest value? (a) -1/3 (b) -2/5 (c) 1/107 c Which is the biggest value? (a) -3 (b) 5 (c) -314/5 (d) 0.3 b Which is the third biggest value? (a) -1/4 (b) -0.1 (c) -5 (d) -26 (e) 0.11 a Which is the fourth biggest value? (a) 3/5 (b) -1/7 (c) -0.1 (d) -1.9 (e) -0.2 e Which is the biggest value? (a) -2 (b) -2/3 (c) 1.8 (d) 0.01 (e) -3 c Which is the second biggest value? (a) 0 (b) 1/10 (c) -558 a What is the smallest value in 0.4, -57, 3? -57 What is the second smallest value in 1/5, -0.4, 506? 1/5 Which is the third biggest value? (a) -0.03 (b) 71 (c) -0.2 c What is the fourth biggest value in 200, 16, 3, 0.3, -0.4? 0.3 What is the fourth smallest value in 11, -60, -2/7, -5? 11 Which is the fourth smallest value? (a) 5 (b) 1 (c) -4 (d) -5 (e) -0.03 b Which is the second biggest value? (a) 3 (b) 7/2 (c) -2 (d) -1/8 a What is the fourth smallest value in -0.44, -0.4, 2, -7, -0.1? -0.1 Which is the biggest value? (a) -4 (b) 58 (c) -0.4 b Which is the third biggest value? (a) -3 (b) -1 (c) -2 a What is the fifth smallest value in -2/15, -0.9, 1, -5, 5? 5 Which is the fifth biggest value? (a) -3 (b) 97 (c) 0.4 (d) 0.08 (e) 4 a What is the smallest value in 4, 3, 17, -2/11? -2/11 What is the third biggest value in 1/5, -2, -5, 2? -2 What is the smallest value in 0, -6/323, 0.4? -6/323 What is the second biggest value in 1540, 3, 5? 5 What is the second biggest value in 5, -0.32, 0? 0 What is the second smallest value in -0.19, -1/6, 4, 2? -1/6 Which is the fourth biggest value? (a) -2/9 (b) -1/64 (c) 0.4 (d) 0.5 (e) 2/3 b What is the third smallest value in 2, -0.21, 0.1? 2 Which is the smallest value? (a) 0.6 (b) 0.3 (c) 1/3 (d) -8 d Which is the fourth biggest value? (a) 2/7 (b) 1/6 (c) 87 (d) -0.5 d What is the biggest value in 1/6, -0.06, 8? 8 Which is the smallest value? (a) -2/3 (b) 0.3 (c) 3 (d) -0.028 a What is the third smallest value in -2/21, 102, 1/3? 102 What is the third biggest value in -0.16, 3, 4, 1? 1 What is the third biggest value in 0.5, -2/13, 2/7, -7.2? -2/13 Which is the smallest value? (a) -5 (b) -	{ "pile_set_name": "DM Mathematics" }
9s3 - 6s*2 + 2. Let g(k) = 9k*3 + 5k*2 - 2. Let n(u) = 6g(u) + 5m(u). Find the first derivative of n(i) wrt i. 27i2 Let i(p) = p2 - p - 4. Let x be i(3). Differentiate 6z + 3z*2 + x - 2z - 4z wrt z. 6z Suppose 0 = -5q - 5a - 15, -2q = 3q - a - 9. Find the first derivative of 0m - 2m + q + 2 - 2 wrt m. -2 Let s(n) = 32n4 + 37. Let w(z) = 1. Let m(d) = s(d) - 5w(d). Differentiate m(o) wrt o. 128o3 Let m(d) = 11d*2 - 4d + 19. Let t(y) = -10y2 + 3y - 18. Let j(q) = 3m(q) + 4t(q). What is the first derivative of j(h) wrt h? -14h Let d(f) be the first derivative of 7f*6/6 + 4f*3/3 + 2. Find the third derivative of d(o) wrt o. 420o*2 What is the second derivative of -10t + 2t + 11t*3 - 19t*3 wrt t? -48t Find the second derivative of -8n2 - 2n - 88 + 88 wrt n. -16 Let k be 2 - (2 - 1 - 3). Let o(c) = c*3 - 5c*2 + 4c + 3. Let d be o(k). What is the third derivative of -g*d - 2 + 2 - 2g2 wrt g? -6 Let t(x) = x5 + x3 + x2 + x. Let u(l) = -32l5 + 5l*3 + 9l*2 + 5l. Let f(w) = -5t(w) + u(w). What is the third derivative of f(q) wrt q? -2220q*2 Let j(q) be the third derivative of 1/336q*8 + 0q + 0 - 7q2 + 2/15q*5 + 0q*7 + 0q*3 + 0q*6 + 0q*4. Find the third derivative of j(h) wrt h. 60h*2 Let p(a) be the third derivative of -4a7/105 + a3/2 + 8a2. What is the first derivative of p(t) wrt t? -32t3 Let t(j) = -j2 - 5j - 2. Let h be t(-4). Let a(g) = 11g2 - g. Let u(l) = -l2 + l. Let n(c) = hu(c) + a(c). Find the second derivative of n(p) wrt p. 18 Let y(p) = 9p + 16. Let j(c) = 26c + 47. Let f(k) = 6j(k) - 17y(k). Differentiate f(x) wrt x. 3 Let u(c) = -c + 6. Let b be u(3). Suppose 6 + 6 = bp. Find the first derivative of 3vp - 3v4 + v4 - 2 wrt v. 4v3 Let d(r) be the second derivative of 3r*6/10 - 8r*3/3 - 11r. What is the second derivative of d(a) wrt a? 108a2 Let h(m) = m3 + 16m*2 - 2m - 3. Let l(w) = -w*3 - 17w*2 + w + 3. Let y(i) = -2h(i) - 3l(i). What is the second derivative of y(p) wrt p? 6p + 38 Let g(x) = 2x4 + 3x. Let s = -99 - -103. Let o(i) = 4i + i4 + 3 - 2 + 2i*4. Let v(p) = sg(p) - 3o(p). What is the derivative of v(t) wrt t? -4t*3 Suppose 3k - 94 = -k + 3x, 0 = 3x - 6. Find the third derivative of -kv2 + 6v*2 + 12v*2 - 7v*6 wrt v. -840v*3 Find the first derivative of 2 - 45f*4 + 19 + 16f*4 wrt f. -116f*3 Find the third derivative of -2d3 - d3 + 3d3 + 29d*5 - 4 + 13d*2 wrt d. 1740d*2 Let n(k) = 2k - 6. Let t be n(4). Find the third derivative of 3y5 - 3y*t + 4y*5 - 9y*5 wrt y. -120y*2 Let p(b) be the third derivative of 0b5 + b2 + 5/336b8 + 0 - 1/6b*4 + 0b*6 + 0b*7 + 0b*3 + 0b. What is the second derivative of p(m) wrt m? 100m3 Let a(o) be the first derivative of 0o*5 + 0o - 5 + 4/3o3 + 1/2o*6 + 0o*4 + 0o*2. Find the third derivative of a(q) wrt q. 180q*2 Find the third derivative of -9o*2 + 7o*5 + 21o*5 + 8o*5 - 19o*2 wrt o. 2160o*2 Let z(m) = 2m*2 + 4m + 3. Let l be z(-2). What is the second derivative of -2t + 14t*l - 11t*3 + t wrt t? 18t Suppose l + 2v = -0l - 4, 3v + 21 = l. Let s(k) = k2 - 7k + 9. Let m be s(l). What is the derivative of 1 + 2o2 - 4 - mo*2 - 4o*2 wrt o? -10o Let r = 89 - 89. Let z(n) be the third derivative of 1/40n6 + 0n + 1/3n3 + r + 2n*2 + 0n*4 + 0n*5. What is the derivative of z(m) wrt m? 9m*2 Let v(x) be the first derivative of 3x7/14 + x3 + 6x - 7. Let g(q) be the first derivative of v(q). What is the second derivative of g(p) wrt p? 180p*3 Find the third derivative of -90j*2 + 3j*3 + 93j*2 - 5j*3 wrt j. -12 Suppose 0 = 2g - 6g + 8. Find the third derivative of 4rg + r3 - 4r2 - 2r*2 wrt r. 6 Let t(m) be the second derivative of -16m*7/21 + 10m*3/3 + 22m. What is the second derivative of t(a) wrt a? -640a3 Let l(r) be the second derivative of 3r7/14 + r3 + 12r. Find the second derivative of l(j) wrt j. 180j*3 Let d(t) = -t + 1. Let f(x) = -3x*3 - 2. Let m(n) = -2d(n) - f(n). Find the second derivative of m(s) wrt s. 18s Let k(r) = -11r*4 + 7r*3 - 7r*2 + 9. Let a(h) = -11h*4 + 6h*3 - 6h*2 + 9. Let z(s) = -7a(s) + 6k(s). Differentiate z(v) wrt v. 44v*3 Let p(y) = 13y + 7. Let k(m) = -39m - 20. Let a(s) = 6k(s) + 21p(s). Differentiate a(w) with respect to w. 39 Suppose -c - 7 = -3v, -2c + 0v - 4 = -v. Let l be c/(-3 + 22/8). What is the second derivative of -10y5 + 4y - 5y4 + 5y*l + 6y*5 wrt y? -80y*3 Let j = 6 - 7. Let y = j - -5. Find the second derivative of h - 4h*y + h + 5h*4 wrt h. 12h*2 Let y(r) be the first derivative of 5r4/4 + r2/2 - 1. What is the second derivative of y(u) wrt u? 30u Let s be (-5)/(-1)(-24)/(-40). What is the derivative of 6w - w - sw + 3w - 6 wrt w? 5 Let i(a) be the second derivative of a8/14 + 31a*4/12 - 47a. What is the third derivative of i(z) wrt z? 480z3 Let b = -7 + 11. Find the second derivative of 2w*4 + 0w - w + 0w - bw*4 wrt w. -24w*2 Let c = -3 - -8. Suppose 0 = 2g + 3 - 9. Differentiate 0m - gm - c + 4 wrt m. -3 Let h be (-14)/39/(-3). Suppose -a + 5j + h = 2, -5a - 3j = -4. What is the second derivative of 3b + ab*4 + 4b - 5b wrt b? 24b*2 Let g(j) = j + 19. Let n be g(-14). Find the second derivative of nd*2 - 5 + 5 - 3d wrt d. 10 What is the second derivative of 0j - 13j - 26j4 + 53j*4 wrt j? 324j*2 What is the derivative of -15 - 7r*3 + 37r - 37r wrt r? -21r*2 Let y(f) be the second derivative of 2f*7/21 + 7f*3/2 + 24f. What is the second derivative of y(j) wrt j? 80j3 Let d(w) = 18w*2 + 4w + 3. Let h(v) = -37v2 - 9v - 6. Let u(n) = -9d(n) - 4h(n). Find the first derivative of u(o) wrt o. -28o Let g(z) be the first derivative of -z5/10 - 7z*2/2 - 3z + 4. Let n(u) be the first derivative of g(u). Find the first derivative of n(m) wrt m. -6m2 Let f(l) be the first derivative of 7 + 8/3l*3 - 9/2l*2 + 0l. What is the second derivative of f(h) wrt h? 16 Let h = -6 + 3. Let m be (-2)/h - (-8)/(-12). What is the second derivative of -g - g - g*3 + mg wrt g? -6g Let j = 7 + 13. Suppose 0 = -c - 3c + j. What is the third derivative of -4z5 + 2z*2 - 3z*c + 0z*2 + 5z*5 wrt z? -120z2 Let h(y) be the second derivative of -y2/2 - 12y. Let a(i) = i3 + 1. Let r = -2 - -1. Let q(s) = ra(s) - 2h(s). Find the first derivative of q(m) wrt m. -3m*2 Find the third derivative of -55b*6 + 3b*2 + 44b*6 - 14 - 29b*6 wrt b. -4800b*3 What is the first derivative of -8q*2 - 17 + 12 + 11 wrt q? -16q Let l(a) be the first derivative of -4a5/5 + 3a*4/4 - 14a*3 - 20. Find the third derivative of l(c) wrt c. -96c + 18 Let z be 2/(-4)(-7 + 5). What is the second derivative of -z - 4d + 2d + 1 - d4 wrt d? -12d*2 Let w(g) be the first derivative of 0g*2 + g + 5/3g*3 - 2. What is the first derivative of w(j) wrt j? 10j Suppose 0 = -4j - 4h + 20, -j = -h - 2h + 7. Let d(a) = a3 + 2a*2 - a. Let t be d(-2). Find the second derivative of 0vt - v + v2 + 2vj wrt v. 6 Let a(i) = 1. Let m(w) = 3w - 2w2 + 2 + 3w - 3w - 5w. Let g(p) = 2a(p) - m(p). Find the second derivative of g(b) wrt b. 4 What is the third derivative of -12x*4 + 17x*2 - 136x + 136x wrt x? -288x Let l(n) be the third derivative of -n6/24 + n5/20 + 3n2. What is the third derivative of l(s) wrt s? -30 Differentiate 0 + 26q*3 - 7q*3 - 7 with respect to q. 57q*2 Let g(c) = -23c*4 + 13c. Let n(m) = -69m4 + 38m. Let o(q) = 11g(q) - 4n(q). Find the second derivative of o(h) wrt h. 276h2 Suppose 0 = 5j - 4c - 18, 0 = -3c + 4c - 3. Suppose u - 3u + 6 = 0. What is the third derivative of -5dj + 6d*6 - ud - d*2 + 3d wrt d? 120d3 Let g(q) = -q. Let t(f) = f2 - 26f. Let r(v) = g(v) + t(v). What is the second derivative of r(a) wrt a? 2 Suppose -3q + 61 = 4t + 3, -4q = -3t - 44. What is the second derivative of 14 + r*2 + 2r*2 - r - q wrt r? 6 What is the third derivative of -22k*6 + 37k*2 - 11k*6 - 4k*6 wrt k? -4440k**3 Let x(h) be the second d	{ "pile_set_name": "DM Mathematics" }
of -6031p4 + p2 - 57789p - 1545982247? -24124p3 + 2p - 57789 What is the first derivative of 23498231d3 - 3d*2 - 178330161? 70494693d*2 - 6d What is the first derivative of 12498143x2 - 38794547? 24996286x Differentiate -184115655t3 - 97777980. -552346965t*2 Differentiate 82ny - 119372n - 2y + 7238384 with respect to n. 82y - 119372 Differentiate 8253802s - 8970683 with respect to s. 8253802 What is the third derivative of -130614111v*3 + 7899v*2 + 359 wrt v? -783684666 What is the first derivative of -534674i*3w*2 - 42699213i*3 - 38iw2 wrt w? -1069348i*3w - 76iw Differentiate 72289464o2 + 242036839 wrt o. 144578928o What is the first derivative of 238104890v2 - 126320042? 476209780v What is the third derivative of 4m5 - 49797646m*3 + 577m*2 - 11m + 1461 wrt m? 240m2 - 298785876 What is the derivative of -163551s*2 - 8sv + 29s - 64347750v wrt s? -327102s - 8v + 29 Find the first derivative of -11612717o*3r + 384o3 - o2 - 2o + 17 wrt r. -11612717o3 What is the second derivative of 12a*3w*2 + 2174a*3w + 2a3 + 2a*2w - 219757aw*4 - 87aw wrt w? 24a*3 - 2637084aw2 Differentiate -12485712c - 1348850 wrt c. -12485712 Differentiate 13606k2 - 562kq3x*2 - kq*3 + 5q*3x2 - q2x2 - 26q*2 - 855x*2 + 2 with respect to k. 27212k - 562q3x2 - q3 Differentiate 24fls + 2fs2 - ls*3 - 99558l + 528s3 - 79 with respect to l. 24fs - s3 - 99558 Find the first derivative of 57g*2x*4 + 38168g*2 + 66651gx - 7g + 4 wrt x. 228g2x*3 + 66651g Find the third derivative of 211072623n3 - 230737341n*2 wrt n. 1266435738 What is the second derivative of -10s*5 - 489764s*4 - 41318562s wrt s? -200s3 - 5877168s*2 What is the third derivative of 9933679p*2q*3 - 22p*2q*2 + pq*2 - 2p - 544q2 wrt q? 59602074p*2 Differentiate -2v*2z - 15v2 + 855vz + 75v + 203z - 29986 wrt v. -4vz - 30v + 855z + 75 What is the second derivative of s5 + 17870336s*3 - 853s - 10569 wrt s? 20s3 + 107222016s What is the second derivative of 27c3ku + 5c*3u*3 + 2c*2ku + 6c*2k + 2cku + 3cu - 22c + 12849012ku*2 - 2ku wrt u? 30c*3u + 25698024k What is the third derivative of 5k*5 - 3k*4 + 4200066k*3 + 16k*2 + 1320144 wrt k? 300k*2 - 72k + 25200396 What is the third derivative of -318181934a6 + 544652430a*2? -38181832080a*3 Find the second derivative of 271j*5 - 9j*4 + 193j*2 + 19743965j wrt j. 5420j3 - 108j*2 + 386 What is the second derivative of 137867d*3 + 5d*2 + 55238d - 84 wrt d? 827202d + 10 Find the second derivative of -369w*4 - 434w*3 + 9w*2 + 2179526w wrt w. -4428w2 - 2604w + 18 What is the third derivative of 1261369p5 - 72p*2 - 192p - 1? 75682140p2 Find the second derivative of -66496s*3 - 458s*2 + 50282446s wrt s. -398976s - 916 Find the third derivative of -28760967c*6 + 4279722c*2 wrt c. -3451316040c*3 Find the first derivative of 37029515l*2 + l + 1400835. 74059030l + 1 Find the first derivative of 2983g3 + 783g + 16957824 wrt g. 8949g2 + 783 What is the third derivative of -2505622x*3 + 62x*2 - 42279x? -15033732 What is the third derivative of -2287498m3 - 536703m*2 wrt m? -13724988 Find the third derivative of -22856q*6 + 19q*5y + 21098q2y + 11q2 + 2qy + 4 wrt q. -2742720q*3 + 1140q*2y What is the first derivative of -6070208r2 + 33174642? -12140416r Differentiate 6278405q2 + 60732431 wrt q. 12556810q Differentiate h*3 - 7h*2 + 10007h + 6656223 with respect to h. 3h2 - 14h + 10007 What is the derivative of 223w4 + 384w*3 + 1149w + 871720413 wrt w? 892w3 + 1152w*2 + 1149 Find the first derivative of 115017684bh3 - 205511302b wrt h. 345053052bh2 What is the derivative of -p3 + 53954033p2 - 77362193 wrt p? -3p*2 + 107908066p What is the derivative of -695u4 + 359u*2 + u + 6590385? -2780u*3 + 718u + 1 What is the third derivative of 2490346h5 + 3h4 + h2 + 353756h? 149420760h*2 + 72h What is the second derivative of 29412828m4 - 65790670m? 352953936m2 Differentiate 88860803r*2 - 154178720. 177721606r Find the third derivative of -k*3n*3y*3 + 6880572k*3ny3 - 28k*2n*3y*2 - 249k*2n*2y + 138ky*3 wrt k. -6n*3y*3 + 41283432ny3 Find the third derivative of -240rs6 + 159830rs4 + 145548rs2 - 526s*2 wrt s. -28800rs3 + 3835920rs Differentiate 3b*4 + 2b*3 + 8409b*2 - 5b - 1482149 with respect to b. 12b3 + 6b*2 + 16818b - 5 Find the second derivative of 56t4 + 297125t*2 - 426573099t. 672t2 + 594250 What is the first derivative of -4658706l*2 + 4307376 wrt l? -9317412l What is the first derivative of 62x2 + 52604x + 151613862 wrt x? 124x + 52604 Find the second derivative of -353366i*4 + 2i*3 + 2i*2 + 4426045i wrt i. -4240392i2 + 12i + 4 What is the first derivative of -301603538b - 223032846? -301603538 Differentiate -b3q + 3b3w + 359b2 - 2bq3 - 201970qw + 2w - 368 with respect to q. -b*3 - 6bq2 - 201970w Find the third derivative of 7211753c5 + c3 - 2c*2 + 1528c - 392 wrt c. 432705180c2 + 6 Find the second derivative of -75664849n*2 - 52n + 3180162 wrt n. -151329698 What is the third derivative of -974265t6 + 78777681t*2? -116911800t*3 Find the third derivative of 46b*4 - 1866b*3 + 2738034b*2. 1104b - 11196 Find the third derivative of -5303f4l - 3053f3l*3 + 2f*2l*3 + 29750514f*2l wrt f. -127272fl - 18318l3 Find the third derivative of -198il4 + il*2 - 4928il + 57i + 23387l5 - 2 wrt l. -4752il + 1403220l*2 What is the second derivative of -24666888w*3 + 3w - 211751? -148001328w Differentiate 56292361b*2t + 406759371t wrt b. 112584722bt What is the second derivative of 8gh3 + 28170gh2 + 9431gh - g + 128h*3 + 353h - 7 wrt h? 48gh + 56340g + 768h Differentiate -13198j3m*2 + 104782j*3 - 16j*2 - 156jm + 3m*2 wrt m. -26396j*3m - 156j + 6m Find the second derivative of 15781n5 - 21n*2 + 3528338n - 8 wrt n. 315620n3 - 42 What is the third derivative of -928648972ps3 - 6620ps2 - 24720p wrt s? -5571893832p What is the derivative of 18255285f*3 + 3496333? 54765855f*2 What is the third derivative of 4p*6 + 94647p*4 - 230p*2 + 90p + 6? 480p3 + 2271528p Find the second derivative of -a*2c*2 - 3a*2c + 6a2 + 25973529ac2 + 20ac - 1413c + 17 wrt c. -2a2 + 51947058a Find the second derivative of -27246620o3 + 27865580o wrt o. -163479720o Find the second derivative of 12898430j*3x*3 - 2jx2 - 3jx + 19x*3 - 12122x - 2 wrt j. 77390580jx*3 What is the first derivative of -451465w*4 + 86109497? -1805860w*3 Differentiate 12qx2 - 3q - 65353x2 - 2587276 with respect to x. 24qx - 130706x What is the second derivative of 36607386l2qu + 4l*2u - 76lqu + 7lq + 3lu + 4qu - 3q - 2u - 62 wrt l? 73214772qu + 8u What is the derivative of 10572038rs*3 + 16305975s*3 wrt r? 10572038s*3 Differentiate -13656826y + 12241740. -13656826 Differentiate -2i3 + 1458634i*2 + 2i + 29094759 wrt i. -6i2 + 2917268i + 2 Find the second derivative of -342056968v2 - 15v - 235294 wrt v. -684113936 Find the second derivative of -506068234w2y*2 + 2w*2y - 15w2 + 12727wy - w - 6y + 1 wrt y. -1012136468w2 Find the third derivative of -11379353b*4i*3 - 13b*2i3 + i3 + 5587i2 wrt b. -273104472bi3 Find the third derivative of -1414h*3m*2v*3 + 32h*3m*2v*2 - 5h*3m*2v - 8556h3m - 23746h3v*3 + 2hmv*2 + 2hv wrt v. -8484h*3m*2 - 142476h*3 What is the derivative of 19457773a - 822448? 19457773 Find the third derivative of 45q5 - 848612q*3 - 199793169q*2. 2700q2 - 5091672 Find the third derivative of i3k2p + 4428892i3kp + i2k*2p - i*2p + 3i2 + 3ik2 - 2ikp + 20795kp wrt i. 6k2p + 26573352kp Find the second derivative of 16261616ky*2 + 8519ky - 285k - y - 1 wrt y. 3252323	{ "pile_set_name": "DM Mathematics" }
nce ccdd. 1/36 Two letters picked without replacement from rcr. Give prob of sequence rc. 1/3 Four letters picked without replacement from xxxxdsssx. What is prob of sequence dxss? 5/504 Three letters picked without replacement from {g: 3, m: 3, a: 5, z: 5, c: 2}. What is prob of sequence maz? 25/1632 Calculate prob of sequence ol when two letters picked without replacement from {o: 1, u: 2, a: 1, k: 1, w: 1, l: 2}. 1/28 What is prob of sequence tl when two letters picked without replacement from {t: 3, l: 13}? 13/80 Two letters picked without replacement from {f: 4, w: 1, k: 2, v: 1, z: 1}. Give prob of sequence fz. 1/18 Three letters picked without replacement from {w: 3, v: 5, q: 1, b: 2, a: 1}. What is prob of sequence qwv? 1/88 Calculate prob of sequence ggzj when four letters picked without replacement from {u: 6, g: 2, j: 1, z: 7, w: 1}. 1/4080 Three letters picked without replacement from nlrnomr. What is prob of sequence ror? 1/105 Two letters picked without replacement from lnsslllnswwslngewn. What is prob of sequence wg? 1/102 Calculate prob of sequence wuu when three letters picked without replacement from vuwuqqwwuvwwwwuwu. 2/51 Four letters picked without replacement from grlrllgrlr. What is prob of sequence glrl? 2/105 Three letters picked without replacement from lnnnnlnplln. Give prob of sequence lll. 4/165 What is prob of sequence yyl when three letters picked without replacement from {y: 6, l: 6}? 3/22 Two letters picked without replacement from csckgcckkeskcfg. What is prob of sequence ek? 2/105 Calculate prob of sequence js when two letters picked without replacement from {s: 4, g: 2, j: 2, n: 11}. 4/171 Two letters picked without replacement from rrrrrroroor. What is prob of sequence or? 12/55 Two letters picked without replacement from {o: 9, z: 4, p: 1}. What is prob of sequence zo? 18/91 Calculate prob of sequence sme when three letters picked without replacement from mseemssmssesms. 1/26 Calculate prob of sequence kk when two letters picked without replacement from kykyk. 3/10 What is prob of sequence hzhd when four letters picked without replacement from {x: 7, h: 2, d: 4, z: 1, k: 2}? 1/5460 Three letters picked without replacement from cxcxxxxuucxx. What is prob of sequence ucc? 1/110 Calculate prob of sequence syy when three letters picked without replacement from {y: 2, s: 1, p: 1}. 1/12 Calculate prob of sequence jjdg when four letters picked without replacement from {g: 9, j: 5, h: 1, d: 3}. 1/136 What is prob of sequence zmof when four letters picked without replacement from {o: 1, z: 1, m: 1, g: 2, u: 1, f: 1}? 1/840 Four letters picked without replacement from ffffxxxfff. What is prob of sequence fffx? 1/8 Calculate prob of sequence uj when two letters picked without replacement from {v: 1, u: 3, b: 1, z: 1, j: 1}. 1/14 Calculate prob of sequence ffy when three letters picked without replacement from {y: 1, f: 2, x: 1}. 1/12 Calculate prob of sequence cldc when four letters picked without replacement from {l: 7, c: 7, d: 4}. 49/3060 What is prob of sequence cln when three letters picked without replacement from ccjnwcclc? 5/504 Calculate prob of sequence qqgg when four letters picked without replacement from {g: 3, b: 7, q: 2}. 1/990 Calculate prob of sequence uzbi when four letters picked without replacement from uwwwbzzzbbzbbibbbb. 1/2040 Four letters picked without replacement from aalfaxaalaaawwx. Give prob of sequence lxwa. 8/4095 Three letters picked without replacement from {l: 1, q: 2, k: 5, e: 1, i: 3}. Give prob of sequence iei. 1/220 Calculate prob of sequence ccnc when four letters picked without replacement from {n: 17, c: 3}. 1/1140 Four letters picked without replacement from iyijyyyjyiji. What is prob of sequence yyji? 2/99 Two letters picked without replacement from qqqqiid. What is prob of sequence di? 1/21 Three letters picked without replacement from {d: 2, v: 4}. What is prob of sequence vdd? 1/15 Two letters picked without replacement from {z: 1, f: 1, p: 1}. Give prob of sequence zf. 1/6 Calculate prob of sequence mwm when three letters picked without replacement from wmwmww. 1/15 Two letters picked without replacement from ggxg. What is prob of sequence gg? 1/2 Calculate prob of sequence zu when two letters picked without replacement from zelekuzkeklx. 1/66 Three letters picked without replacement from {l: 1, g: 3, y: 1, q: 5, r: 4, a: 1}. What is prob of sequence rla? 2/1365 Three letters picked without replacement from ovgiiviaiiiavaavaav. Give prob of sequence vav. 20/969 Calculate prob of sequence rc when two letters picked without replacement from rcrrcccvccvcr. 7/39 Two letters picked without replacement from {i: 4, e: 6, j: 1}. What is prob of sequence ii? 6/55 Calculate prob of sequence bb when two letters picked without replacement from qsqbb. 1/10 Four letters picked without replacement from zeggogezooog. What is prob of sequence oeoe? 1/495 Three letters picked without replacement from nxyxmfi. Give prob of sequence nmf. 1/210 Calculate prob of sequence ee when two letters picked without replacement from {e: 3, u: 6, c: 6}. 1/35 What is prob of sequence wz when two letters picked without replacement from {z: 1, a: 1, w: 2}? 1/6 Two letters picked without replacement from {t: 13, g: 2, w: 5}. What is prob of sequence gw? 1/38 Calculate prob of sequence hgih when four letters picked without replacement from hhhhhgphshihhgsihhgh. 11/1615 Three letters picked without replacement from {q: 2, k: 1, d: 2}. What is prob of sequence qkd? 1/15 What is prob of sequence yy when two letters picked without replacement from {x: 3, v: 1, y: 5}? 5/18 What is prob of sequence lbi when three letters picked without replacement from {b: 1, l: 1, t: 1, s: 1, i: 1}? 1/60 Calculate prob of sequence yee when three letters picked without replacement from {e: 2, y: 1}. 1/3 Four letters picked without replacement from azaziaazazzzaiazaz. What is prob of sequence zaii? 4/2295 Four letters picked without replacement from owmdvjjvo. What is prob of sequence ojmd? 1/756 Two letters picked without replacement from iifi. Give prob of sequence fi. 1/4 Two letters picked without replacement from ihssyyibiisys. What is prob of sequence si? 4/39 Calculate prob of sequence afsf when four letters picked without replacement from aaffaasaafaasssf. 4/455 Calculate prob of sequence hsx when three letters picked without replacement from {h: 1, s: 4, x: 5, o: 1, u: 4}. 2/273 Calculate prob of sequence pk when two letters picked without replacement from {u: 3, p: 2, k: 5}. 1/9 Calculate prob of sequence ozz when three letters picked without replacement from {z: 2, o: 2}. 1/6 What is prob of sequence xz when two letters picked without replacement from {x: 1, z: 1, c: 3}? 1/20 What is prob of sequence yt when two letters picked without replacement from ylylcto? 1/21 Three letters picked without replacement from yfyf. Give prob of sequence yfy. 1/6 Four letters picked without replacement from ttttttltttttttttut. Give prob of sequence ttlt. 7/153 Two letters picked without replacement from {q: 1, e: 5, x: 4, l: 6}. Give prob of sequence ql. 1/40 Calculate prob of sequence cc when two letters picked without replacement from iiciiiiic. 1/36 Three letters picked without replacement from {l: 1, h: 3, e: 2, k: 13}. Give prob of sequence khk. 26/323 Three letters picked without replacement from {n: 10, m: 2}. What is prob of sequence mnm? 1/66 What is prob of sequence isii when four letters picked without replacement from {o: 8, u: 1, s: 1, i: 6}? 1/364 Calculate prob of sequence sr when two letters picked without replacement from wrs. 1/6 What is prob of sequence qf when two letters picked without replacement from {p: 3, b: 2, q: 4, j: 3, n: 2, f: 1}? 2/105 Four letters picked without replacement from {v: 4, j: 5, u: 1}. What is prob of sequence jvuj? 1/63 Two letters picked without replacement from {z: 1, f: 2, n: 3, o: 5, i: 1}. Give prob of sequence if. 1/66 Calculate prob of sequence il when two letters picked without replacement from uuwwwuqulpliluwuppq. 1/114 Three letters picked without replacement from {k: 2, p: 2}. What is prob of sequence pkp? 1/6 Four letters picked without replacement from {g: 3, j: 3}. What is	{ "pile_set_name": "DM Mathematics" }
q + 2. What is p(-8)? -6 Let b(y) = -14y - 246. What is b(-6)? -162 Let t(q) = 2q2 + 274q + 1561. Determine t(-6). -11 Let w(g) = -387g - 364. Calculate w(-1). 23 Let s(d) = -8d*3 - 5d*2 + 9d - 27. Give s(3). -261 Let a(b) = 9335b - 121347. What is a(13)? 8 Let j(c) = -c2 + 8c + 50. Give j(12). 2 Let n(o) = -97o + 166. Give n(6). -416 Let g(o) = -576o + 27031. Calculate g(47). -41 Let o(u) = 4302u + 34431. Give o(-8). 15 Let a(m) = -m3 - 12m*2 - 23m - 4. What is a(-10)? 26 Let a(l) = 4683l + 28094. Calculate a(-6). -4 Let a(o) = o3 - 16o*2 + 24o + 12. What is a(2)? 4 Let i(d) = 6d2 - 30d - 30. Give i(-1). 6 Let b(w) = -657w - 4566. Calculate b(-7). 33 Let n(t) = -t2 + 93t - 901. Calculate n(11). 1 Let k(r) = -r + 75. Calculate k(10). 65 Let i(x) = x*3 + 12x*2 - 93x - 10. Calculate i(-17). 126 Let k(g) = -g*3 - 50g*2 + 10g + 419. Give k(-50). -81 Let q(i) = -233i - 1125. Determine q(-5). 40 Let m(w) = 20w - 459. What is m(23)? 1 Let z(h) = -h*3 - 21h*2 - 45h - 151. What is z(-19)? -18 Let k(u) = 49u2 + 72u + 319. What is k(-4)? 815 Let f(n) = -n*3 - 49n*2 + 27n - 1197. Give f(-50). -47 Let p(g) = 53g2 - 163g + 1. Calculate p(3). -11 Let g(w) = 29w - 51. Give g(3). 36 Let u(i) = 2i*3 + 33i*2 - 19i - 10. Determine u(-17). 24 Let s(b) = -b*3 + 19b*2 + 105b - 863. Give s(22). -5 Let g(t) = 220t - 12905. What is g(59)? 75 Let a(w) = -51w + 674. Calculate a(12). 62 Let z(s) = -189s - 742. Calculate z(-4). 14 Let x(s) = -24s*3 - 75s2 + 5. Calculate x(-3). -22 Let z(y) = y2 + 34y + 249. Determine z(-24). 9 Let i(f) = -f3 - 2f*2 + 11f - 30. Calculate i(-5). -10 Let b(q) = q*3 + 9q*2 - 13q - 60. Determine b(-10). -30 Let s(j) = -15j + 219. Calculate s(18). -51 Let s(x) = 214x - 9. Give s(2). 419 Let w(k) = k*3 - 44k*2 + 3k - 96. Calculate w(44). 36 Let w(m) = -240m + 26639. Give w(111). -1 Let i(q) = -8q + 61. What is i(12)? -35 Let s(v) = -3v3 + 92v*2 + 36v - 121. Determine s(31). 34 Let n(m) = 499m + 48397. What is n(-97)? -6 Let h(d) = 990d + 4949. Give h(-5). -1 Let f(m) = -117m + 1766. Give f(15). 11 Let f(s) = -s3 - 32s*2 - 87s + 25. What is f(-29)? 25 Let c(w) = w3 + w2 + 117w + 504. Calculate c(-4). -12 Let n(l) = l3 + 20l*2 + 29l + 54. Calculate n(-19). -136 Let c(n) = 50n2 + 7n + 1. What is c(1)? 58 Let f(o) = 2o2 - 31o - 20. Calculate f(15). -35 Let m(o) = 4o2 - 633o + 28. Determine m(0). 28 Let f(r) = -1212r + 10908. Calculate f(9). 0 Let f(a) = -132a + 128. What is f(1)? -4 Let c(a) = -69a + 3274. Determine c(47). 31 Let u(s) = -24s + 221. Determine u(10). -19 Let q(j) = -4j2 - 42j - 144. Calculate q(-9). -90 Let v(f) = f*2 - 36f - 970. What is v(-18)? 2 Let o(j) = 5j2 - 10j - 11. Give o(6). 109 Let m(w) = -w*3 - 14w*2 - 20w + 47. What is m(-12)? -1 Let c(k) = -16k + 967. Give c(44). 263 Let c(q) = -3q*2 - 73q + 317. Give c(-34). -669 Let a(n) = -n*3 + 2n*2 + 34n - 42. Determine a(7). -49 Let u(n) = -n*2 + 454n + 33. Give u(0). 33 Let g(x) = 83x + 508. Calculate g(-6). 10 Let n(b) = b3 + 6b*2 - 641b - 4440. Determine n(-7). -2 Let g(h) = 11h + 30. Calculate g(-7). -47 Let k(t) = -74t*2 + 12t - 26. Give k(2). -298 Let v(i) = i + 40. Give v(-41). -1 Let r(m) = -59m + 295. Give r(13). -472 Let p(q) = 7q - 11. What is p(16)? 101 Let z(w) = w*3 - 10w*2 - 68w + 99. Calculate z(14). -69 Let b(h) = -3h2 + 16h + 277. Determine b(-10). -183 Let o(s) = -s3 + s2 + 22s + 13. What is o(-6)? 133 Let y(p) = -168p - 1051. Give y(-6). -43 Let y(u) = 473u - 3780. Calculate y(8). 4 Let v(s) = 43s*2 + 505s - 120. Determine v(-12). 12 Let n(w) = 202w - 257. Determine n(2). 147 Let f(o) = 4o*2 - 932o + 5437. Give f(6). -11 Let l(d) = 388d + 10094. Determine l(-26). 6 Let z(u) = 4u + 94. Calculate z(-39). -62 Let w(t) = -4t + 142. Calculate w(26). 38 Let u(d) = d3 - 40d*2 - 25d + 965. What is u(40)? -35 Let d(j) = -j*3 + 23j*2 - 34j + 8. Give d(6). 416 Let a(y) = 4778y + 19112. What is a(-4)? 0 Let g(z) = -36z - 40. Calculate g(-5). 140 Let b(q) = -3q2 + 29q - 13. Give b(6). 53 Let m(j) = 20j - 216. Give m(12). 24 Let a(x) = 4x*2 - 1130x - 1697. Determine a(284). 7 Let i(a) = -a*2 + 631a + 13. Calculate i(0). 13 Let t(m) = -13m + 85. Give t(9). -32 Let d(z) = -3z*3 + 227z*2 + 103z - 1950. What is d(76)? 102 Let t(h) = 23h + 737. Give t(-35). -68 Let t(w) = 153w - 228. Determine t(2). 78 Let q(y) = y*3 - 93y*2 - 921y - 17. Determine q(-9). 10 Let h(w) = -w*3 + 11w*2 + 9. Determine h(6). 189 Let s(f) = -8f*2 + 58f + 104. Give s(8). 56 Let h(b) = -b*3 - 7b*2 - 13b - 74. What is h(-7)? 17 Let a(o) = -4o - 69. What is a(28)? -181 Let b(d) = 84d + 306. Give b(-4). -30 Let g(c) = 321c + 3374. Calculate g(-10). 164 Let i(g) = 16g*2 + 421g - 282. Give i(-27). 15 Let c(a) = -3a3 + 215a*2 - 144a + 69. Calculate c(71). -73 Let x(z) = -z3 + z2 + 36z + 44. What is x(-8)? 332 Let x(t) = t2 + 794t + 4733. What is x(-6)? 5 Let z(c) = 81c + 4684. Calculate z(-58). -14 Let y(f) = f3 - 8f*2 + 8f - 33. Determine y(6). -57 Let g(m) = -3m3 - 72m*2 + 25m - 96. Determine g(-24). -696 Let q(b) = 2b2 + 14b + 110. Give q(-13). 266 Let p(w) = -11w - 248. Determine p(-25). 27 Let x(y) = y2 - 61y + 927. Determine x(32). -1 Let j(t) = -t*3 + 10t*2 - 27t + 30. Calculate j(6). 12 Let u(z) = -2z2 + 81z - 525. Give u(8). -5 Let g(y) = y*3 + 41y*2 - 99. Calculate g(-41). -99 Let m(s) = 321s + 3896. What is m(-12)? 44 Let p(c) = -162c + 846. Determine p(5). 36 Let g(k) = k3 - 7k*2 - 9k + 67. What is g(5)? -28 Let r(b) = 18b2 + 132b + 243. What is r(-3)? 9 Let j(p) = 12p - 49. What is j(13)? 107 Let k(x) = -475x - 1438. Determine k(-3). -13 Let f(l) = l + 115. Calculate f(-26). 89 Let m(s) = -32s2 + 964s + 20. Calculate m(30). 140 Let z(y) = 200y3 + 1200y*2 - 4y - 4. Calculate z(-6). 20 Let x(a) = 174a + 8575. Determine x(-48). 223 Let f(j) = -67j + 31. Give f(3). -170 Let j(o) = -o*3 - 93o*2 - 91o + 119. Determine j(-92). 27 Let g(b) = 19b3 + b2 - 7b + 6. Determine g(1). 19 Let b(u) = -31u - 1879. Give b(-57). -112 Let t(m) = m3 - m2 - 112m - 5. What is t(-7)? 387 Let u(z) = -z*2 + 25z - 87. Calculate u(21). -3 Let z(d) = 112d - 4160. What is z(37)? -16 Let b(p) = 16p + 65. Give b(4). 129 Let v(a) = -188a - 598. What is v(-4)? 154 Let f(l) = l2 + 8l - 256. Calculate f(0). -256 Let t(a) = -7a2 + 123a - 2. What is t(18)? -56 Let g(x) = x*3 + 14x*2 - 40x - 389. What is g(-15)? -14 Let c(n) = -686n + 2746. Determine c(4). 2 Let d(l) = 463l + 53250. Calculate d(-115). 5 Let v(h) = h*2 + 2h + 25. Give v(-7). 60 Let w(z) = 12z + 821. Calculate w(-59). 113 Let x(p) = 3p*3 - 168p*2 - p + 54. Give x(56). -2 Let k(j) = -11014j - 88116. What is k(-8)? -4 Let r(i) = -i*3 - 6i*2 + 14i + 45. What is r(4)? -59 Let g(m) = m*3 + 7m*2 - 143m - 1098. What is g(-8)? -18 Let m(y) = -119y - 402. Determine m(3). -759 Let h(o) = 108o - 1818. Calculate h(17). 18 Let w(r) = 101r2 + 1832r + 257. Give w(-18). 5 Let m(l) = l*3 + 5l*2 + 20l - 8. What is m(-5)? -108 Let z(x) = -43x - 182. What is z(-6)? 76 Let q(l) = -l2 + 22l + 323. Determine q(33). -40 Let g(b) = -3b3 - 37b*2 - 5b + 97. What is g(-12)? 13 Let d(n) = 114n - 579. Give d(5). -9 Let h(x) = x2 - 415x - 6446. Determine h(-15). 4 Let m(a) = -a*2 - 20a - 91. Determine m(-10). 9 Let m(z) = z*3 - 49z*2 + 83z + 301. Give m(47). -216 Let q(c) = -39c2 + 439c + 345. What is q(12)? -3 Let o(a) = a*3 + 16a*2 - 134a - 53. What is o(-22)? -9 Let z(w) = -w + 40. What is z(-17)? 57 Let z(k) = k*2 - 47k + 131. Calculate z(44). -1 Let x(h) = 19h - 107. What is x(-20)? -487 Let c(w) = -8w + 829. What is c(104)? -3 Let c(q) = -13q2 + 343q + 95. Give c(25). 545 Let q(n) = 43n + 1232. Give q(-27). 71 Let u(g) = 147g + 5047. Give u(-34). 49 Let k(i) = -i*2 + 23i - 137. What is k(13)? -7 Let t(x) = -24x - 50. What is t(6)? -194 Let k(g) = g2 - 16g + 18. Determine k(15). 3 Let v(a) = 661a + 656. What is v(-1)? -5 Let u(t) = t2 + 20t - 50. Calculate u(-23). 19 Let h(t	{ "pile_set_name": "DM Mathematics" }
What is the remainder when 292914 is divided by 4437? 72 Calculate the remainder when 4513164 is divided by 1583. 31 Calculate the remainder when 3148090 is divided by 10. 0 What is the remainder when 234280 is divided by 605? 145 What is the remainder when 34572 is divided by 3257? 2002 What is the remainder when 286546 is divided by 31838? 4 Calculate the remainder when 281393 is divided by 1177. 90 Calculate the remainder when 43513 is divided by 5435. 33 What is the remainder when 209120 is divided by 41823? 5 Calculate the remainder when 910732 is divided by 940. 812 What is the remainder when 1257787 is divided by 207? 55 Calculate the remainder when 155073 is divided by 77436. 201 Calculate the remainder when 108586249 is divided by 266. 261 Calculate the remainder when 18166218 is divided by 1037. 52 What is the remainder when 160671 is divided by 1576? 1495 Calculate the remainder when 39025310 is divided by 1062. 1058 Calculate the remainder when 57600227 is divided by 14. 13 What is the remainder when 11415905 is divided by 183? 182 What is the remainder when 160175 is divided by 155? 60 What is the remainder when 30019 is divided by 4439? 3385 Calculate the remainder when 3674207 is divided by 1433. 1428 Calculate the remainder when 107969772 is divided by 15. 12 What is the remainder when 1306465 is divided by 24? 1 Calculate the remainder when 39949 is divided by 1020. 169 What is the remainder when 6057831 is divided by 902? 901 Calculate the remainder when 92095 is divided by 15045. 1825 What is the remainder when 198638937 is divided by 202? 15 What is the remainder when 2961208 is divided by 1480596? 16 What is the remainder when 73478 is divided by 8157? 65 What is the remainder when 906445 is divided by 10289? 1013 Calculate the remainder when 505077 is divided by 8138. 521 Calculate the remainder when 16990623 is divided by 16. 15 Calculate the remainder when 62637 is divided by 62480. 157 What is the remainder when 1576365 is divided by 24? 21 Calculate the remainder when 14252621 is divided by 233. 11 What is the remainder when 821299 is divided by 7019? 76 Calculate the remainder when 479993 is divided by 979. 283 Calculate the remainder when 942190 is divided by 431. 24 Calculate the remainder when 24616 is divided by 23468. 1148 Calculate the remainder when 2014571 is divided by 17518. 1 Calculate the remainder when 39296947 is divided by 2859. 2851 Calculate the remainder when 28848589 is divided by 121. 11 Calculate the remainder when 383195 is divided by 471. 272 Calculate the remainder when 36886378 is divided by 353. 349 What is the remainder when 17603052 is divided by 14880? 12 Calculate the remainder when 5795721 is divided by 5795691. 30 Calculate the remainder when 1805780 is divided by 69442. 288 What is the remainder when 3158822 is divided by 7557? 7553 What is the remainder when 292043 is divided by 7123? 0 What is the remainder when 7069420 is divided by 228? 52 Calculate the remainder when 2805995 is divided by 41. 37 Calculate the remainder when 150794 is divided by 2154. 14 What is the remainder when 645796202 is divided by 1268? 1266 Calculate the remainder when 277550 is divided by 92413. 311 What is the remainder when 639417 is divided by 331? 256 Calculate the remainder when 252862782 is divided by 35. 32 Calculate the remainder when 2872753 is divided by 1680. 1633 What is the remainder when 2066128 is divided by 344340? 88 Calculate the remainder when 208478 is divided by 2935. 93 Calculate the remainder when 145176 is divided by 10144. 3160 Calculate the remainder when 102315839 is divided by 371. 346 Calculate the remainder when 264865 is divided by 1506. 1315 Calculate the remainder when 2422044 is divided by 775. 169 What is the remainder when 30691 is divided by 1526? 171 Calculate the remainder when 157904 is divided by 12. 8 Calculate the remainder when 262893 is divided by 288. 237 What is the remainder when 107884 is divided by 100088? 7796 What is the remainder when 15151712 is divided by 108? 68 Calculate the remainder when 278610 is divided by 327. 6 What is the remainder when 1877416 is divided by 1877000? 416 What is the remainder when 1578783 is divided by 526247? 42 Calculate the remainder when 2123294 is divided by 212328. 14 What is the remainder when 368340193 is divided by 184170089? 15 Calculate the remainder when 969903 is divided by 18297. 162 Calculate the remainder when 1565120 is divided by 990. 920 What is the remainder when 62379393 is divided by 418? 417 Calculate the remainder when 8442538 is divided by 82. 64 What is the remainder when 15312844 is divided by 29? 3 Calculate the remainder when 2365873 is divided by 15668. 5 Calculate the remainder when 2392106 is divided by 9724. 2 Calculate the remainder when 9804842 is divided by 4902397. 48 Calculate the remainder when 1121277 is divided by 374. 25 What is the remainder when 2381502 is divided by 8240? 142 What is the remainder when 86996802 is divided by 826? 4 Calculate the remainder when 5168850 is divided by 90. 60 What is the remainder when 5100257 is divided by 34461? 29 Calculate the remainder when 34405 is divided by 6472. 2045 Calculate the remainder when 327815 is divided by 1047. 104 Calculate the remainder when 27753 is divided by 1704. 489 What is the remainder when 121979 is divided by 119659? 2320 What is the remainder when 16872264 is divided by 196? 192 What is the remainder when 37204509 is divided by 5126? 1 Calculate the remainder when 211413 is divided by 7899. 6039 What is the remainder when 8559 is divided by 1217? 40 Calculate the remainder when 1070338 is divided by 62957. 69 What is the remainder when 10392 is divided by 1693? 234 What is the remainder when 3300822 is divided by 308? 294 Calculate the remainder when 216941338 is divided by 210. 208 What is the remainder when 1217317 is divided by 608641? 35 Calculate the remainder when 353859 is divided by 12452. 5203 What is the remainder when 734806 is divided by 91824? 214 Calculate the remainder when 15937815 is divided by 52427. 7 Calculate the remainder when 636643 is divided by 24964. 12543 Calculate the remainder when 4755913 is divided by 3385. 3373 Calculate the remainder when 55817 is divided by 1428. 125 Calculate the remainder when 34279 is divided by 92. 55 Calculate the remainder when 125320 is divided by 20879. 46 Calculate the remainder when 537942587 is divided by 176. 171 Calculate the remainder when 858864 is divided by 144. 48 What is the remainder when 4211055 is divided by 12066? 21 What is the remainder when 56451174 is divided by 1441? 1440 What is the remainder when 152599536 is divided by 164? 160 Calculate the remainder when 8939981 is divided by 26. 11 Calculate the remainder when 2176091 is divided by 4. 3 Calculate the remainder when 1418743 is divided by 1418726. 17 Calculate the remainder when 17135372 is divided by 17135362. 10 What is the remainder when 987694 is divided by 3580? 3194 What is the remainder when 1708217 is divided by 6675? 6092 What is the remainder when 215704 is divided by 215666? 38 Calculate the remainder when 75959 is divided by 24927. 1178 What is the remainder when 1148745 is divided by 287180? 25 Calculate the remainder when 2557362 is divided by 122. 120 Calculate the remainder when 7079121 is divided by 52. 49 What is the remainder when 1670046 is divided by 5819? 5812 What is the remainder when 312346 is divided by 2603? 2589 What is the remainder when 14120069 is divided by 54? 41 What is the remainder when 1564488 is divided by 1210? 1168 What is the remainder when 7930301 is divided by 4152? 4133 Calculate the remainder when 2019945 is divided by 446. 11 What is the remainder when 8052050 is divided by 123? 101 What is the remainder when 17963127 is divided by 1995889? 126 What is the remainder when 16331502 is divided by 67765? 137 What is the remainder when 141284 is divided by 32897? 9696 Calculate the remainder when 663116 is divided by 20719. 108 Calculate the remainder when 8456 is divided by 4727. 3729 What is the remainder when 63609 is divided by 786? 729 What is the remainder when 21874267 is divided by 389? 19 What is the remainder when 8863461 is divided b	{ "pile_set_name": "DM Mathematics" }
value in 3, 13/35, -4/5? 13/35 Which is the second biggest value? (a) 0.5 (b) 2/7 (c) -6 (d) -47 (e) 2 a Which is the fourth biggest value? (a) -175 (b) 3 (c) -1 (d) -0.2 a Which is the second biggest value? (a) -2312 (b) -0.03 (c) -2/3 c What is the biggest value in 15, 46, -5, 3? 46 What is the biggest value in 2, 1/4, 1, 11/2? 11/2 Which is the biggest value? (a) 0 (b) 500 (c) 5 b Which is the third biggest value? (a) -4 (b) -27 (c) 4 (d) -2 (e) 4/7 d Which is the third smallest value? (a) 2 (b) -5 (c) 391 c Which is the third biggest value? (a) 3 (b) 20 (c) -1 c What is the third smallest value in -0.2, -0.02, 2/1141, 0.2, 1/6? 2/1141 What is the second smallest value in 2, 1/4, -0.187? 1/4 Which is the second biggest value? (a) 2 (b) -2 (c) -5 (d) 62 a What is the third smallest value in 0, 0.7, 3/5, -2, 18.3? 3/5 Which is the second smallest value? (a) -8 (b) 2/5 (c) -1/4 c Which is the second biggest value? (a) 3/10 (b) -23 (c) -0.3 (d) 2 (e) -8 a What is the third smallest value in -0.06, -3/4, -3? -0.06 Which is the third smallest value? (a) 1/3 (b) -1/18 (c) -2 (d) 0.1 d Which is the second smallest value? (a) -3 (b) -0.2 (c) -203 a What is the biggest value in 9, 2/11, -2? 9 Which is the second biggest value? (a) -2 (b) 0.4 (c) 11/3 (d) 3/13 b What is the second biggest value in -3, 34, -7.8, 1/8? 1/8 What is the second biggest value in -0.09, 12, -0.4? -0.09 What is the smallest value in -5, -3, 4, -8, 2/5? -8 Which is the third smallest value? (a) 10 (b) 1 (c) 2 (d) -3 c Which is the biggest value? (a) -1/3 (b) -3/2 (c) -3 (d) -62 a What is the biggest value in 0.5, 48/7, 0? 48/7 What is the third biggest value in -77, 1/6, -0.1, 2, 0.2? 1/6 Which is the third biggest value? (a) 1/3 (b) 97 (c) 0.5 a Which is the biggest value? (a) -4/13 (b) -0.1 (c) 4 (d) -1 c What is the second biggest value in -2, -0.23, 3/2? -0.23 What is the third biggest value in -1/7, 2.26, 1/2? -1/7 Which is the third smallest value? (a) -11 (b) 0.001 (c) -4 (d) -5 (e) 4 c Which is the fourth smallest value? (a) 1 (b) -3/5 (c) 2 (d) -2366 c Which is the second smallest value? (a) -3 (b) -7 (c) 6 (d) -0.3 (e) 0 a Which is the fifth biggest value? (a) 6 (b) 4/7 (c) 1/3 (d) -0.11 (e) 2 d What is the fourth biggest value in 1, -0.17, -4, 0.1, 0? -0.17 What is the biggest value in -118, -1/6, 5/4? 5/4 Which is the second smallest value? (a) -2/7 (b) -0.2 (c) -8 (d) -0.5 (e) 9 d Which is the smallest value? (a) -0.5 (b) 2 (c) 1 (d) 2/7 (e) 205 a Which is the third smallest value? (a) -0.02 (b) 3 (c) -13 b Which is the third biggest value? (a) 24 (b) 22 (c) 0 (d) -2 c Which is the fourth smallest value? (a) 11/9 (b) -2 (c) -3 (d) 1 a Which is the fourth biggest value? (a) -4/3 (b) 0.5 (c) 3 (d) 47 a Which is the second smallest value? (a) 5 (b) 1/3 (c) -4/7 (d) -3 (e) 1/81 c Which is the fourth biggest value? (a) -0.14 (b) -19 (c) 1/4 (d) 0.05 b What is the fourth biggest value in -101/3, -0.5, 0.4, 2/11? -101/3 Which is the third biggest value? (a) 0.01 (b) 2 (c) -0.2 c Which is the biggest value? (a) 27/5 (b) -54 (c) 2/9 (d) -1/4 a What is the second biggest value in 0.3, -8, 1/4, -4, 0.26? 0.26 What is the third biggest value in -25/8, -2, 1? -25/8 What is the second biggest value in -0.2, -25, -6, -0.3? -0.3 Which is the third smallest value? (a) -0.3 (b) 242 (c) 3 (d) -4 c Which is the second biggest value? (a) 1/5 (b) -2/9 (c) 1/21 (d) -2 (e) -1/10 c Which is the smallest value? (a) 1/6 (b) 0 (c) 2/45 b What is the second smallest value in 3, -40/9, 3/4, -1/3? -1/3 What is the second biggest value in -53, -12, -0.4? -12 What is the second biggest value in -2, -2/7, 2/13, -1? -2/7 Which is the third biggest value? (a) 0 (b) 219/2 (c) 1/2 (d) -2 a Which is the smallest value? (a) -1/7 (b) 1 (c) 10 a Which is the second smallest value? (a) 2/5 (b) 0.1 (c) -0.029 (d) 3 b What is the fifth biggest value in -2/3, 4, 0.4, 1/4, -0.1? -2/3 What is the third biggest value in 15, 37, -1/2? -1/2 What is the third smallest value in -1/4, -3, 0.15? 0.15 What is the fourth biggest value in -0.5, 5, 1/2, -4, -6? -4 What is the smallest value in 0.2, -2/5, 2/5, 3? -2/5 What is the biggest value in 2, -864, -5? 2 What is the smallest value in -0.1, -1/5, 1/5, 1, 17? -1/5 What is the smallest value in 0.2, 14/13, 2, -8? -8 Which is the biggest value? (a) 0.3 (b) -1/5 (c) -5 a Which is the fourth smallest value? (a) -0.4 (b) -1/4 (c) -3 (d) -40/21 (e) -2/3 a What is the smallest value in -19, 9, -6? -19 What is the smallest value in -2, 0, 3.8, 0.4? -2 What is the second smallest value in 1/2, 1/10, -5/6, -0.5? -0.5 What is the second smallest value in -18/7, 1/6, 6? 1/6 Which is the third smallest value? (a) 3 (b) 0.1 (c) -1/4 a What is the biggest value in 3/7, 1, 3, 6/25? 3 Which is the second smallest value? (a) 2/19 (b) 4 (c) -0.2 (d) 2 (e) 185 a What is the third biggest value in 2/9, 1/4, -0.2, 1/7? 1/7 What is the biggest value in -0.1, 2/3, 0.04, -3/7? 2/3 Which is the fourth smallest value? (a) 2.1 (b) 8 (c) 3 (d) 1/5 b What is the fourth smallest value in -1/21, -2, 3, 3/5? 3 What is the second smallest value in 27/67, -3, -0.3, 2/3? -0.3 Which is the second biggest value? (a) -1/729 (b) -5/4 (c) 4 a What is the third smallest value in -23, -5/2, -1/8? -1/8 Which is the third smallest value? (a) -2 (b) 0.5 (c) 0 (d) -1 c Which is the second smallest value? (a) -0.4 (b) -18 (c) -98/3 b Which is the second biggest value? (a) -21 (b) -0.002 (c) 3 b Which is the second biggest value? (a) -4/7 (b) -2/9 (c) 1/6 (d) -4 b Which is the biggest value? (a) 1/6 (b) -2 (c) 2 c What is the third smallest value in -6/11, -0.5, 1/2, -38? -0.5 Which is the biggest value? (a) 0.4 (b) 3 (c) -18/5 b Which is the smallest value? (a) 0.5 (b) -10 (c) -0.1 (d) 3/5 b What is the second smallest value in -4, -2/7, 129.8, 0, 3? -2/7 What is the fourth smallest value in 1/4, 2, 7, 1/2? 7 What is the fourth smallest value in 0.2, 1/10, -1/3, 2/33? 0.2 Which is the smallest value? (a) -4/3 (b) 0 (c) 133 (d) -1/11 a Which is the smallest value? (a) -0.3 (b) 2 (c) -90 c What is the second biggest value in -0.2, -10, -3, 3? -0.2 What is the third biggest value in 13/2, 0.3, 0? 0 What is the second smallest value in 3/8, -1, 1, -3, -2/9? -1 Which is the fourth smallest value? (a) -3 (b) 31 (c) 4/7 (d) -0.03 b What is the smallest value in -3/5, 9, 4/11? -3/5 What is the third biggest value in 3.4, 3/2, -1? -1 What is the second smallest value in 5, -13, -0.04? -0.04 Which is the second smallest value? (a) -2/11 (b) -5.7 (c) 2/9 (d) 5 (e) 0.01 a Which is the biggest value? (a) -5 (b) -3/5 (c) -0.1 c Which is the second biggest value? (a) -611 (b) -2/3 (c) -0.5 (d) 4 (e) 2 e Which is the smallest value? (a) 3 (b) 5 (c) 1 (d) -4/7 d Which is the fourth biggest value? (a) 5/3 (b) -70 (c) 29 (d) -3/2 (e) -0.1 d What is the second smallest value in -2/3, 0.121, -170? -2/3 Which is the fourth biggest value? (a) 11 (b) -3 (c) 1/4 (d) -4 d Which is the third biggest value? (a) 15 (b) -1/2 (c) 4 b What is the third biggest value in 0, -1/6, 1, 16? 0 What is the second biggest value in 7, 2/7, 4/3? 4/3 What is the second biggest value in -0.2, -0.086, 45? -0.086 Which is the smallest value? (a) 498 (b) 5 (c) -0.3 c What is the third smallest value in 18, -3/4, 12? 18 What is the third biggest value in 1/38, -2/5, 0.12? -2/5 What is the third smallest value in 2/7, 0.4, -0.4, -117? 2/7 Which is the smallest value? (a) -4.2 (b) 1 (c) 22 a What is the second smallest value in 0, 0.06, -2/13, -1.9? -2/13 What is the second biggest value in -0.9, -6, 2/13? -0.9 Which is the second biggest value? (a) -9 (b) -20 (c) -0.5 a What is the fourth smallest value in 3, 4, 2/9, -0.037? 4 What is the fourth biggest value in 100/3, 2, 0.1, -5? -5 What is the third smallest value in -0.1, -4, 393/5, -0.2? -0.1 What is the smallest value in 68, -1/2, -4? -4 What is the second biggest value in 2/13, -5, 0.4? 2/13 Which is the biggest value? (a) 0 (b) -1/3 (c) 2 (d) 16 d What is the s	{ "pile_set_name": "DM Mathematics" }
sqrt(162)) - (-1 + sqrt(153)-2))-1. -55sqrt(17)/9 - 1 Simplify (4 + (6(sqrt(1700) - sqrt(1700)2) - (5(sqrt(1700)2 - sqrt(1700)) - sqrt(1700))) + 2 + -2)2. -800sqrt(17) + 170016 Simplify (4 + 5-5(2 + sqrt(175) + sqrt(175))-5)2. 635000sqrt(7) + 11002016 Simplify (2(sqrt(175) - sqrt(175)-1 - sqrt(175)) + -5 + 2)*2. -60sqrt(7) + 709 Simplify 0 + -2 + (-4((1sqrt(98) - sqrt(98)) + sqrt(98) + sqrt(98)))*2. 6270 Simplify 3(6(3sqrt(95) + sqrt(95)) - sqrt(95))/(sqrt(20) - sqrt(60)/sqrt(3) - sqrt(20)). -69sqrt(19)/2 Simplify ((-5 + 2 + sqrt(1539) - sqrt(1539)) + sqrt(1539) - sqrt(1539))2 - (3 + (-5 + 1sqrt(19))*2). -38 + 10sqrt(19) Simplify (-3((sqrt(495) + sqrt(495)2)/sqrt(9) + sqrt(55)))/(sqrt(44)/(sqrt(40)/(3sqrt(10)) + sqrt(4) - sqrt(4))). -4sqrt(5) Simplify 4 + (sqrt(13) + sqrt(117))*2 + -3 + -2 - ((sqrt(13) + 4 + 3sqrt(13))*2 - (sqrt(65)/sqrt(5) + -1)). -31sqrt(13) - 18 Simplify (2 + 3 + sqrt(833) - (-2sqrt(833)-5)*2) + 0. -83295 + 7sqrt(17) Simplify ((sqrt(24) - sqrt(1176))2)/((sqrt(144)/sqrt(3))/sqrt(4)). -12sqrt(2) Simplify (5 + -2 + sqrt(13) + -2)*2 + 4(sqrt(13) + 0)*2 + sqrt(1053) + 1. 11sqrt(13) + 67 Simplify (5(-4 + -1 + sqrt(52) - sqrt(26)/((sqrt(16) + sqrt(64))/sqrt(8))))2. -1250sqrt(13)/3 + 13750/9 Simplify (-4(3 + sqrt(320)4))*2-5. -410320 - 15360sqrt(5) Simplify (sqrt(240)-55)/(1sqrt(363)2). -50sqrt(5)/11 Simplify -2 + (2sqrt(1900) + 0 - ((sqrt(1900) - 1sqrt(1900)) + -5)*2). -27 + 20sqrt(19) Simplify ((4 + (sqrt(1088) + 2 - sqrt(1088)))2 - (sqrt(204)/(sqrt(36)/sqrt(3)))2-6)4. 552 Simplify (2 + (sqrt(17)-3-1 - sqrt(17) - (sqrt(153) + -3)))*24. -40sqrt(17) + 168 Simplify (0 + -3sqrt(13))6 - (sqrt(1300) + sqrt(1300) + -1)4. -98sqrt(13) + 4 Simplify (-5 + ((1 + sqrt(432))6 - (2sqrt(432)6 + sqrt(432))) + -3)*2. 336sqrt(3) + 21172 Simplify ((sqrt(896)3)/(sqrt(242)2))*2. 1008/121 Simplify (5-2(sqrt(900) - sqrt(36)))/(sqrt(96)/((sqrt(2744) + sqrt(56))/sqrt(7))). -320sqrt(3) Simplify ((sqrt(91) + -3sqrt(91) + sqrt(91))/sqrt(7) - (1 + sqrt(325))) + 2. -6sqrt(13) + 1 Simplify -5((4(sqrt(5)-5 - sqrt(5) - sqrt(5)) + -5(sqrt(5) + -1 - sqrt(5)))4)2. -315600 + 22400sqrt(5) Simplify -6(4(sqrt(98) - -4sqrt(98)))2 + -1. -235201 Simplify -1 + sqrt(28)1 + (3 + 0 + sqrt(252))*2. 38sqrt(7) + 260 Simplify (-3 + -5sqrt(63) + sqrt(63))1-4. 12 + 48sqrt(7) Simplify 2sqrt(162)1 + -3 - (-2 + (sqrt(162) - (4 + sqrt(162)4)2)). 297sqrt(2) + 2607 Simplify ((2 + sqrt(200))4 - sqrt(200))2 - sqrt(72)-1-6. 444sqrt(2) + 1864 Simplify (sqrt(209)/(sqrt(891) + (sqrt(891)1 - sqrt(891))) + ((-2sqrt(171) + sqrt(171))-1)/sqrt(9))2. 1900/81 Simplify ((sqrt(51) - 2sqrt(102)/sqrt(2))1)/(3sqrt(48)-4). sqrt(17)/48 Simplify (-1-3(-1sqrt(14) + sqrt(14)))/(sqrt(126)/sqrt(2) - (sqrt(7) + sqrt(7)1)2). 0 Simplify ((sqrt(110) - (sqrt(110) + sqrt(110)-1))/sqrt(2))/(sqrt(405) + 2sqrt(405)). sqrt(11)/27 Simplify (0 + 4 + (sqrt(363) + (sqrt(363) - (3sqrt(363) + -5) - sqrt(363)))2)1. -220sqrt(3) + 1481 Simplify -4 + (1((sqrt(27) - (sqrt(27)3 - sqrt(27))) + (sqrt(3) + 5sqrt(3)3 + sqrt(3) - sqrt(3))))2. 503 Simplify (-1sqrt(119)-2 + sqrt(119) + -4(sqrt(119)-2 + sqrt(119) - sqrt(119)))/(3sqrt(448)-1). -11sqrt(17)/24 Simplify ((sqrt(160) - sqrt(40))/sqrt(2) - (sqrt(180) - (sqrt(180) - 1sqrt(180) - sqrt(180))))/((-4sqrt(100)1 + sqrt(100))/sqrt(10)). 5sqrt(2)/3 Simplify (-5((sqrt(2057) - (sqrt(2057) + 0 + -4) - sqrt(2057)) + sqrt(2057) + 2 + 5))2. 3025 Simplify (-2(sqrt(104) - (sqrt(104)-2 - sqrt(104))) - sqrt(104))/(sqrt(24)/(sqrt(9)/sqrt(3))) + (sqrt(1300) + 0 + -4 + (sqrt(1300) - -42sqrt(1300)))2. -809sqrt(13) + 130016 Simplify 5((-6sqrt(147)2 - (-4 + (sqrt(147) + -1 - sqrt(147)) + sqrt(147))) + 2)2. -6370sqrt(3) + 124460 Simplify -2 + 2-5(-1 + (sqrt(1900) - 3sqrt(1900))2-5). 380008 Simplify 1(-6sqrt(40)/sqrt(8)-5 - 2(sqrt(300)/sqrt(6))/sqrt(10)). 28sqrt(5) Simplify 4(-5sqrt(416)/(sqrt(96)/sqrt(3))5)*2. 32500 Simplify (-3sqrt(162) + (sqrt(16)/sqrt(8) + -5)*2)-2. -54 + 74sqrt(2) Simplify ((sqrt(50) + -4 - (-5 + sqrt(2)1 + sqrt(2))) + 1 + (sqrt(8) - (-1 + sqrt(8)-2)))2. 54sqrt(2) + 171 Simplify (4sqrt(147) + 4 + sqrt(12)/sqrt(4))2-6. -15234 - 1392sqrt(3) Simplify (((sqrt(176) + sqrt(44))-1)/((sqrt(4) + sqrt(100))-1) + 0 + 5)2. 5sqrt(11) + 111/4 Simplify ((sqrt(65) - (sqrt(65) - 1sqrt(65)) - sqrt(65))-6)/((sqrt(10)-2)/sqrt(2)). 0 Simplify 2((2sqrt(375)-5 - sqrt(375)) + sqrt(375))/(sqrt(605) - (sqrt(605) - 1sqrt(605))-3). -100sqrt(3)/11 Simplify (sqrt(1715) + (-2sqrt(1715) - sqrt(1715)) - (sqrt(35) + -3sqrt(105)/sqrt(3)))/((sqrt(189)/sqrt(48))/sqrt(9)). -48sqrt(5) Simplify -5 + ((sqrt(1053)3)2 - (2sqrt(1053) + sqrt(1053))*2)5. -5 Simplify (5sqrt(20)/sqrt(5))/sqrt(2) + (sqrt(10)/sqrt(5)-1 - -1sqrt(12)/sqrt(6))2. 5sqrt(2) Simplify (25sqrt(56)-1)/(-5(sqrt(200) - ((sqrt(200) - sqrt(200)3) + sqrt(200)))). sqrt(7)/5 Simplify ((sqrt(190) - (sqrt(190) + (sqrt(190) + (sqrt(190) - sqrt(190)3))2) - sqrt(190))/sqrt(5))/(sqrt(24)/(6(sqrt(12) + sqrt(768)))). 54sqrt(19) Simplify 4-2sqrt(720) + -1 - (sqrt(120)-2)/((sqrt(486) - -1sqrt(486)) + sqrt(6)). -1820sqrt(5)/19 - 1 Simplify -6(-6sqrt(39)/sqrt(48))*2 - 5sqrt(91)/(sqrt(567) + sqrt(567)1). -351/2 - 5sqrt(13)/18 Simplify (4 + ((sqrt(110)2)/sqrt(10) - (sqrt(275) + 2)) + -3 + 4 + sqrt(396))2. 18sqrt(11) + 108 Simplify ((-2sqrt(420))/sqrt(10) + -5sqrt(210)/sqrt(5))/((sqrt(294)-2 + sqrt(294) - sqrt(294)) + sqrt(150) + 1sqrt(150)). 7sqrt(7)/4 Simplify 1((sqrt(1300) + sqrt(1300) + 1)2 + (sqrt(78)/(sqrt(6) + sqrt(42)/sqrt(7)))2) + -3. 40sqrt(13) + 20805/4 Simplify (((1 + sqrt(80))4 - sqrt(80)) + -2sqrt(720)6)*2 + -4. -1056sqrt(5) + 87132 Simplify (-3(-2(2 + sqrt(320)) + sqrt(320) + sqrt(320)-1-4))*2. -1728sqrt(5) + 26064 Simplify -1(-5 + sqrt(36)/sqrt(3) + sqrt(72)/(sqrt(294) + sqrt(6)))-1. -5 + 9sqrt(3)/4 Simplify (-6sqrt(847)1 - sqrt(847) - (sqrt(847)1 + sqrt(847))-1)2 + (-4 + (sqrt(847) - (sqrt(847)-2 + 2)))*2. -396sqrt(7) + 28834 Simplify ((-2sqrt(350) + 1sqrt(1400) + sqrt(14))/(3(sqrt(128) - (sqrt(128)1 + sqrt(128) + sqrt(128) - sqrt(128))) + sqrt(128)))*2. 7/256 Simplify ((sqrt(156) - (-4(sqrt(156) + sqrt(156) + sqrt(156) + 1sqrt(156) + sqrt(156)) + sqrt(156) + sqrt(156)))-1)/(-2sqrt(1200)-6) + -1. -1 - 19sqrt(13)/120 Simplify -3 + ((sqrt(832)-2 + -2 - sqrt(832)) + (sqrt(1573) - (-1 + sqrt(1573))3))2 + 5. -92sqrt(13) + 27511 Simplify ((-42sqrt(2448))*2 - sqrt(2448))6 + 0. -72sqrt(17) + 940032 Simplify (51sqrt(27) + 2 - (sqrt(135) + (sqrt(135) - -1sqrt(135)-3))/sqrt(5))2. 72sqrt(3) + 976 Simplify (4 + -1 + sqrt(2057) - (-1(sqrt(17) + sqrt(17)-1) + 4))*2. -22sqrt(17) + 2058 Simplify (sqrt(1440)2-3)/(sqrt(55)/(sqrt(132)/(-2sqrt(12)))). 36sqrt(2) Simplify (sqrt(60) + sqrt(240)-4 + sqrt(60) + sqrt(60))/(1((sqrt(24)/sqrt(2) - sqrt(12)) + sqrt(12))). -5sqrt(5) Simplify (sqrt(3388)-1)/sqrt(4) + ((-2 + sqrt(700))-5)2 + -2. -1011sqrt(7) + 17598 Simplify (-4(3sqrt(19))*2 + -1 + 5)-3. 2040 Simplify ((sqrt(110) - (sqrt(110)2 - sqrt(110)))2 + ((sqrt(110) - -2sqrt(110)) + sqrt(110) + sqrt(110))5)/(sqrt(100)/(sqrt(110)/(sqrt(22)/sqrt(2)))). 25sqrt(11) Simplify (-3 + -4(1 + sqrt(51)/sqrt(3) + (0 + sqrt(1088) + sqrt(1088) + sqrt(1088) - sqrt(1088))))*2. 952sqrt(17) + 78657 Simplify (((sqrt(272) - 1sqrt(272))-6 - (sqrt(272) - (sqrt(272) + 3(2 + sqrt(272))))) + 2)2. 192sqrt(17) + 2512 Simplify (1(sqrt(475) + 2 + sqrt(475)))2-5-35. 3000sqrt(19) + 142800 Simplify (sqrt(7) - (sqrt(7) + (sqrt(252)/sqrt(4))/sqrt(9))) + (sqrt(56) - sqrt(224)/sqrt(4))/sqrt(8) - -1(sqrt(112) + 1). 1 + 3sqrt(7) Simplify (-6(sqrt(80) - -3(-2 + sqrt(80)) - (sqrt(320) + -1)6)3)2. 1658880 Simplify (sqrt(525) - sqrt(21))/sqrt(3) + sqrt(28)1 - (sqrt(231)/(sqrt(77)/sqrt(7)))/sqrt(3). 5sqrt(7) Simplify 5 + 0 + ((sqrt(102) + sqrt(102)-2)-1)/(sqrt(294) - (sqrt(294) - (sqrt(294) - (sqrt(294) + (sqrt(294) - sqrt(294)2))))). sqrt(17)/7 + 5 Simplify ((sqrt(11) - sqrt(539)1 - sqrt(11)) + 1 - (-2 + sqrt(1584) + 3))2. 3971 Simplify 3(sqrt(200) + sqrt	{ "pile_set_name": "DM Mathematics" }
h, -3h + 15 = 3k. What is the common denominator of k + 146/15 + (-14 - -9) and 67/(-12) - (-1)/(-1)? 60 Suppose r - 5y = -y + 288, -r - 5y = -342. Calculate the least common multiple of 24 and r. 312 Let o = -2678080 + 5913200521/2208. What is the common denominator of 137/96 and o? 2208 Suppose u - 8 = -4f - 19, -5f - 15 = u. Calculate the common denominator of 89/66 and 3 + f/52(-404)/(-24). 858 Let a = -1153691/360 - -16028/5. Find the common denominator of a and 119/162. 648 Let u(w) = -w3 - 9w*2 + 32w - 36. Calculate the least common multiple of 14 and u(-13). 224 Let u = -119118/7 + 17064. Let i = 47 - u. What is the common denominator of -107/176 and i? 1232 Let u(o) = 92o2 - 37o + 21. What is the lowest common multiple of u(2) and 225? 1575 Calculate the common denominator of 7/9654 and (-97)/6 - (-84 + 64). 9654 Let n = -15008 + 15104. What is the lowest common multiple of n and 768? 768 Suppose 7q - 12q = -35. Suppose r = -p + 6p - 3356, 2p - 9r = 1265. What is the smallest common multiple of p and q? 4711 Suppose -42v + 43v = m - 1242, -4m + 2v + 4960 = 0. What is the lowest common multiple of 10 and m? 6190 Suppose -4o + o - 3l - 264 = 0, 3o - 3l + 294 = 0. Let u = -44027/57187 + -4/1079. Find the common denominator of (o/30)/((-3)/(-6)) and u. 265 Suppose 5m = -5y + 560, -177y + 178y - 4 = 0. What is the smallest common multiple of 792 and m? 2376 Suppose -10w = 1 + 69. Let b be w((-10 - -4) + 1). Find the common denominator of -27/7 and -3 - (1 - (-65)/b). 7 Let d = 36 + -45. Let m(t) = 5t + 4. Calculate the smallest common multiple of m(7) and (6/d)/((-3)/108). 312 Let s = -947/4 - -240. Find the common denominator of (-14)/3(-3672)/5984 and s. 44 Suppose 210l = 820 + 1280. Let c(g) = -g3 - g2 - g + 20. What is the least common multiple of l and c(0)? 20 Let p be (-90534)/460410(-4 - -3)2. Let h = p - 76/745. Find the common denominator of (1 - (-22)/9) + -4 and h. 927 Let y = -6634087/171 + 38796. Calculate the common denominator of y and -59/3. 171 Find the common denominator of ((-48)/(-138))/(-4) - (-40599)/235980 and -23/2280. 2280 Suppose -253 = -8g + 83. Suppose 2j + 44 = 3x, 0 = -2x - 7j + 2j + g. Calculate the least common multiple of x and 4. 16 Let x(g) = g*3 + 9g*2 + 9g - 40. Let j be x(-7). Find the common denominator of j + (3173/420 - 8/14) and -3/20. 60 Calculate the common denominator of -17/22 and 2(-10214)/5056 - (-28)/7. 13904 Suppose 54 = -5t + 4v, -35t + 2v = -37t. What is the common denominator of t and 97/86? 86 Calculate the common denominator of -149/72 and 25/((-10500)/3765) + (1 - -5). 504 Suppose -j + 281 = 3y, -j - 20y + 329 = -23y. Let p(c) = c2 + 5c - 6. What is the lowest common multiple of j and p(-7)? 2440 Let q = 1698 - 1044. Let f = q + -511. Calculate the lowest common multiple of f and 52. 572 Find the common denominator of 131/12 and (1355/(-210))/(-9 - -70 - 8). 4452 What is the common denominator of 173(-4)/(-336) + -4 and -39/196? 588 Let b = 10470 + -136086/13. What is the common denominator of b and 20/(-22)7/(-2)? 143 Let w = -4951763/164 - -30192. Let v = w + -3/41. Let m = 4/3 + v. What is the common denominator of m and -141/70? 420 Suppose b = -s + 555, -31s - 565 = -b - 30s. What is the least common multiple of b and 168? 1680 Let g = -5375 - -4905. Let h be (30/(-4))/((-4)/(-251)). Let s = g - h. What is the common denominator of -9/14 and s? 56 Let c(r) = 18r + 52. Let v be c(-12). Let u = 110 + v. Calculate the common denominator of -4 - (1 + -2) - 318/u and -71/8. 72 Let a be 11/(-66) + 481/6. Let h = a + -71. Suppose z - 20 = -hz. What is the least common multiple of z and 13? 26 Let p = 2/28911010075 + 2452492073582917/1001159367887175. Let x = p + 9/3298. Find the common denominator of x and -3 + 51/(-8)1. 168 Suppose -9c + 34 = -38. Let f be 3/(-2) - 4/c. Find the common denominator of 53/2 and f/(-75)2350/(-120). 90 Let h(c) = -2c - 29. Let f be h(-12). What is the common denominator of -74/57 and f/1 + 595/60? 228 Suppose -2o + 4z = -7 - 23, 5o - 3z - 68 = 0. Suppose 4q = -oq + 748. What is the smallest common multiple of 28 and q? 308 Let g = 22/57 - -1327/57. What is the common denominator of (-4)/(-2) - 2007/858 and g? 858 Let l(u) = 2u*2 + 83u - 1189. Calculate the lowest common multiple of 146 and l(-53). 2190 Let r be (-8542562)/4614060 - 4/22. Let a = 2/20973 - r. Find the common denominator of a and -103/24. 120 Let i be (-1 + 5)796/(-5). Let m = i - -646. Let f = -99/7 - -682/21. What is the common denominator of m and f? 15 Let s = 30068 + -120359/4. Let g = -12729/5152 + -50/161. Calculate the common denominator of s and g. 32 Let x = -1172 + 172315/147. Find the common denominator of 65/56 and x. 1176 Let b = 3490 + -2542. Calculate the lowest common multiple of b and 24. 1896 Let m be (-108)/(-8)102/(-9). Calculate the common denominator of m/66 + (-3)/(-4) and 11/8 + 43/(-86). 88 Let m = 4038 + -3975. What is the smallest common multiple of m and 210? 630 Suppose 263 = 119i - 927. What is the smallest common multiple of i and 565? 1130 Calculate the lowest common multiple of 2314/65 + -17 + (-6)/10 and 75. 450 Suppose 2o - 11 = -4k + 37, 56 = 2o + 2k. Let l = -48678 - -778777/16. What is the common denominator of l and (-4)/4 + 22/o? 16 Let r be -2 + (-12)/(-30) + (-2)/5. Calculate the smallest common multiple of 1 and 630/77 + -2 + r/11. 6 Let u = 52345/6 - 8727. Calculate the common denominator of (6/195)/((-24)/(-305)) and u. 156 Let h be 2/6 + (-88)/66. Find the common denominator of 179/120 and 2152/576 - (h + 5). 360 Calculate the common denominator of 26923/(-120336) + (-2 - (-75)/36) and -53/352. 24288 Calculate the common denominator of -17 + 38780/5250 and (-158)/18 - (-13 + 10). 225 Suppose 0 = 45p - 41p - 12. Suppose -86 = -5h - 4x, 8h - 96 = ph + 6x. What is the lowest common multiple of h and 81? 162 Let o = 5102/3 - 1689. What is the common denominator of o and -4/57? 57 What is the common denominator of 4/1189 and (-9)/(-2)10336/4104? 3567 Calculate the smallest common multiple of 840 and 85 + 0 - 1118/86. 2520 Let h be 45300/96 - 5/(-40). Suppose -h = -4z - 3t, 660 = 5z - 3t + 70. Calculate the least common multiple of z and 10. 590 Calculate the common denominator of (16/(-88) - 2174/(-704))34/(-306) and -26/309. 9888 Suppose r - 81 = -24. Let k = r + -47. Suppose -53 = -5y + 47. What is the least common multiple of y and k? 20 Suppose -175j - 1000 = -180j. Let s = 232 - j. What is the least common multiple of s and 4? 32 Let s(q) = -3q + 6. Let j be s(-4). Let p = 3 - j. Calculate the common denominator of p/2462/(-5) and -29/4. 4 Suppose 0 = 2d - 10, -138 = -0c + c - d. Let n = c + 369. What is the least common multiple of n and 10? 1180 Let v = -1469 + 16172/11. Let i = -8975575092436/8415 - -1066616171. Let k = i + -4/765. Calculate the common denominator of v and k. 33 Suppose -53i - 158 - 160 = 0. What is the common denominator of -29/69 and 8 - i/(-648)1006? 1242 Suppose -85 = -5h - 5u, -u = 3h - 14 - 27. Calculate the least common multiple of h and 2/(-4) + 177/6 - -3. 96 Find the common denominator of 95/1318 and (-262)/8(-4)/(-12). 7908 What is the common denominator of -25/272 and ((-646)/(-57))/(1 - 19/(-3))? 2992 Let m = 4742 - 4382. What is the lowest common multiple of 480 and m? 1440 Let h be -1(26 - 0) + -2. Let r be (51580/h)/(16578/(-21)). Let n = r + 17/307. What is the common denominator of n and 109/22? 198 Suppose -9j - 259 + 61 = 0. Let t = j - -25. Calculate the smallest common multiple of t and 50. 150 Let t(d) = d*2 - 13d + 16. Let g(b) = 37b + 4. Calculate the smallest common multiple of t(12) and g(0). 4 Let j = 84443/105 + -10469/14. Let s = -363/5 + j. Find the common denominator of -133/18 and s. 18 Find the common denominator of 119/6 and 4/(-6)(-9 - 0) + 4923405/(-813630). 4398 What is the common denominator of 11/12 and (4/13984)/((-156)/(-104))? 5244 Let s = -2352 + 529199/225. Find the common denominator of -53/123 and s. 9225 Let z = 9713/15360 - -1/1024. Let u be (3 + (0 - -3))(-1)/3. Calculate the common denominator of (-11)/10u - 48/(-72) and z. 30 Let c = -175/11 -	{ "pile_set_name": "DM Mathematics" }
24. Let p(v) = 12v + 10. Let z(t) = 5g(t) + 12p(t). Let a(m) = -28m*2. What is a(z(u))? -1008u*2 Let a(d) be the first derivative of -5d*2/2 + 838. Let f(s) = -3s2. Let r(n) = n2. Let c(b) = -f(b) - 4r(b). Calculate a(c(g)). 5g*2 Let n(t) = -5t. Let m(q) = -17q - 18. Let k(i) = 168i + 189. Let a(v) = 6k(v) + 63m(v). Give n(a(p)). 315p Let o(q) = 20499 - 41q - 20499. Let j(a) = a + 4. Let h(u) = -3u - 11. Let d(w) = -4h(w) - 11j(w). Give d(o(c)). -41c Let u(x) = -5x2. Let t(s) = 6s + 2s + 10s - 19s. Give t(u(b)). 5b2 Let z(m) = -m2 - m - 1. Let h(d) = 2d2 + 3d + 3. Let v(k) = h(k) + 3z(k). Let s(a) = a2 - 331. Determine s(v(i)). i4 - 331 Let g(l) = -601l*2 - 2l - 2. Let t(z) = 8z2. Calculate g(t(p)). -38464p*4 - 16p*2 - 2 Let a(p) = -4p. Suppose -9 + 6 = h. Let y(g) = 4g + 3. Let s(n) = -4n - 4. Let q(v) = hs(v) - 4y(v). Give q(a(f)). 16f Let m(x) = -21x*2 + 4x. Let f(j) = 1. Let q(o) = -o - 5. Let y(i) = -5f(i) - q(i). Let n(r) = -m(r) + 4y(r). Let k(l) = 3l. Give n(k(a)). 189a2 Let k(n) be the first derivative of -n3 - 8. Suppose -m + 0m = 5s - 14, 3m = -2s + 29. Let o(r) = -17r + 7r + mr. What is o(k(u))? 3u*2 Let j(k) = 23k2. Let i(y) = -y3 - 18y2 + 19y + 2. Let o be i(-19). Let h(c) = -3c2 - c2 + 6c*o - 4c*2. Give h(j(m)). -1058m*4 Let j(y) = -4y. Suppose -16 = -z - 3a, 5a + 16 = 5z + 4a. Let c(b) = 2b2. Let w(v) = 4v*2. Let i(l) = zc(l) - 3w(l). Give i(j(p)). -64p*2 Let d(j) = 23j*2 - 1. Let t(g) be the first derivative of 10g*3/3 - 867. Calculate d(t(m)). 2300m*4 - 1 Let n(a) = 3a*2 - 793a + 793a - a2. Let x(q) = -q3 - 9q*2 - 8q + 6. Let t be x(-8). Let o(c) = t - 28c - 6 + 5c. Give o(n(u)). -46u2 Let t(s) = -2s + 3. Let l(y) = -3y + 5. Let r(m) = -6l(m) + 10t(m). Let h(o) = -18o*2 + 2 + 22o*2 - 45o*2. Calculate h(r(i)). -164i*2 + 2 Let f(t) = -430t. Let g(l) = 63l2 - 4l. What is g(f(n))? 11648700n2 + 1720n Let o(w) = w*2. Let n(a) = -56771a. Determine n(o(i)). -56771i2 Let b(t) = 10t*2. Let r(n) be the first derivative of -4n*3/3 + 124. What is b(r(i))? 160i*4 Let p(v) = -2844483v. Let j(r) = -r*2. Calculate j(p(d)). -8091083537289d*2 Let i(x) = 7x - 4307. Let l(z) = -z. Calculate i(l(f)). -7f - 4307 Let n(y) be the second derivative of 8y*3/3 - 2y - 584. Let j(m) = 19m. Calculate j(n(r)). 304r Suppose -5d + o - 3 = -0o, 0 = -2d + 3o + 4. Let w(k) = -k - 3. Let y(n) = n + 1. Let i(s) = dw(s) - 3y(s). Let p(m) = 14m2. Give p(i(v)). 56v*2 Let k(n) = -8n. Let c(t) = -409775t2. Calculate c(k(o)). -26225600o2 Let n(w) = w2. Let v(p) = 2399464p2. Calculate n(v(g)). 5757427487296g*4 Let i(g) = 5g + 312. Let w(p) = -p + 2. Let t(b) = -i(b) - 6w(b). Let q(c) = -2c. What is q(t(j))? -2j + 648 Let t(m) = -62m*2. Let l(g) = 14g*2 + 273g - 91. Let i(d) = -d*2 - 18d + 6. Let h(u) = 91i(u) + 6l(u). Determine h(t(a)). -26908a4 Let a(f) = 3f2. Let c(t) be the third derivative of -t7/1260 + 3t4/4 - 20t*2. Let x(p) be the second derivative of c(p). Give x(a(b)). -18b*4 Let i(l) = 10 + 3l + 13 - 23. Let m(z) = 4z + 1. Give i(m(r)). 12r + 3 Let l(w) = -122w2. Let j(c) = -49c. Determine j(l(d)). 5978d2 Let r(g) = -2g. Let t(v) = 6v2 + 4. Let s(l) = l2 + 1. Let i = -82 + 84. Let k(d) = is(d) - t(d). Calculate r(k(a)). 8a2 + 4 Let r(g) = 3g - 18 - g + 34 - 16. Let d(h) = -449h2. Calculate d(r(v)). -1796v*2 Let n(x) = x + 1. Let v(k) = -11k - 8. Let s(r) = 40n(r) + 5v(r). Let l(a) = -5a2. Determine l(s(u)). -1125u*2 Let a(m) = 2m2. Let n(z) be the third derivative of z8/5040 - z*7/630 + 11z*5/20 + 18z*2. Let l(u) be the third derivative of n(u). Calculate l(a(b)). 16b*4 - 16b2 Let q(b) = -b. Let p(k) = k2 - k - 1. Let z(y) = 6y2 - 2y - 2. Let t(s) = 4p(s) - 2z(s). Give q(t(v)). 8v2 Let x(c) = 23c2 - 4 + 4. Let m(n) be the first derivative of -n2/2 + 1413. Determine x(m(d)). 23d2 Let w(a) = -48a. Let f(r) = -121r. Let t(u) = -5u. Let n(m) = f(m) - 22t(m). What is n(w(b))? 528b Let v(l) = 221l - 446l + 228l + 3. Let z(n) = -n2. Give z(v(c)). -9c*2 - 18c - 9 Let k(t) = -2351 + 2351 - 338t2. Let f(w) = -w2. What is f(k(v))? -114244v*4 Let z(n) be the first derivative of -7n*6/360 + 26n*3/3 - 6. Let i(y) be the third derivative of z(y). Let q(p) = 4p. Determine q(i(k)). -28k2 Let y(a) = -44a*2 - 1. Let w(d) = 65d + 2. Give y(w(j)). -185900j2 - 11440j - 177 Suppose -10 = -2t + 24. Let q(k) = -23k + 34. Let w(u) = 8u - 12. Let v(c) = tw(c) + 6q(c). Let h(a) = 27a*2. What is v(h(z))? -54z*2 Let o(x) = -23x*2 + 10. Let h(r) = 3r*2. Determine h(o(g)). 1587g*4 - 1380g*2 + 300 Let m(h) = h - 1. Suppose 4b + 10 = -5z, -4z + 11 = -2b - 7. Let i(o) = 24o - 22. Let v(f) = zi(f) - 44m(f). Let r(x) = -3x. Determine r(v(n)). -12n Let u(o) = 3o. Let f(l) = -4639l*2. Calculate u(f(m)). -13917m*2 Let w(g) = -6g. Let m(v) = -21v2 + 9v*2 + 29v*2. Calculate w(m(q)). -102q*2 Let x = -4 - -16. Let s = x + -9. Let h(a) = -sa - 5a + 8a - a2. Let u(f) = f2. Calculate u(h(k)). k4 Let n(p) = -p2 + 9p - 16. Let c be n(6). Let i(v) = -5v*2 + 2v2 - v2 + 5vc. Let z(a) be the second derivative of 5a*4/12 + a. Give i(z(j)). 25j*4 Suppose -h - 2y = -1975, -5h + 2h + 3y + 5898 = 0. Let c(z) = -1969 + 15z + h. Let i(k) = k*2. Calculate i(c(w)). 225w*2 Let p(w) be the first derivative of 2w*3 - 52. Let y(g) = -16g*2. Calculate y(p(i)). -576i*4 Let r(h) = -4h. Let n(b) be the second derivative of -137b4/12 - 33b + 2. Give n(r(o)). -2192o2 Let f(y) = -48y*2. Let v(h) = -639h*2. What is f(v(o))? -19599408o*4 Let n(b) = 14b. Let u(f) = 23996f2. Determine u(n(l)). 4703216l*2 Let h(x) = x + 8. Let l be h(-6). Let n(s) = -4s + 6sl + 4s + 3s + 3s2. Let r(p) = -p2. What is n(r(q))? 9q4 - 3q*2 Let s be (-6)/12-25. Let r(c) = 5 - 6 + 9c*2 + 1 + 5 + 5c. Let x(b) = 5b2 + 2b + 2. Let t(u) = sx(u) - 2r(u). Let y(h) = -2h2. Calculate t(y(g)). 28g*4 Suppose -4n - 4 = -8n. Suppose g = n + 3, -4g + 20 = v. Let y(t) = 2t2 - t2 - vt*2. Let q(z) = 2z*2. What is q(y(r))? 18r4 Let x(q) = -q2. Let z(i) = 37122i. Calculate z(x(h)). -37122h*2 Let r(w) = 4w. Let x(v) = 3v3 - 2v*2 - v + 2. Let u be x(1). Let p(j) = -240j*u + 119j*2 + 106j*2. What is p(r(y))? -240y*2 Let b(a) = -201188a*2. Let l(p) = -2p. Give b(l(m)). -804752m2 Let q(c) = -8c2 - 9. Let d(b) = b2 + 1. Let t(n) = 6d(n) + q(n). Let s(y) = 34y + 9. Let g(k) = 30k + 8. Let m(r) = 9g(r) - 8s(r). What is t(m(z))? -8z*2 - 3 Let c(n) = 184n2. Let y(l) be the third derivative of -l5/30 - 3l2 + 2l. Calculate c(y(m)). 736m4 Let v(q) = -5q. Let w(z) = 6z. Suppose -s - 2k + 0k = -8, -s + 5k = -1. Let a(y) = sw(y) + 7v(y). Let h(l) = 3l + 1. Determine a(h(m)). 3m + 1 Let h(s) = -43s2. Let p(l) = -18l + 4. What is p(h(i))? 774i2 + 4 Let b(y) = -51y - 232y - 8y + 14y. Let c(a) = 4a*2. Calculate b(c(f)). -1108f*2 Let t(q) = -2q*2 - 6q - 190. Let j(l) = 3l. Determine t(j(r)). -18r*2 - 18r - 190 Let w(c) be the second derivative of -22c + 0c*2 + 0 - 2/3c*3. Let x(g) = -5g2 - 4. Let j(d) = -d2 - 1. Let y(i) = 4j(i) - x(i). Give y(w(p)). 16p*2 Let s be 12/(-15) + (-258)/(-10). Let h(f) = sf2 + 91 - 91. Let y(v) = v2. Determine y(h(q)). 625q4 Let h(d) = 3d. Let n(b) = 61816b. Give h(n(c)). 185448c Let h(p) = 6p. Let b(j) = -10j*2 + 3111. Give b(h(a)). -360a*2 + 3111 Let i(h) = 3h*2 - 2h. Let t(r) = -21r2 + 15r. Let y(j) = -j + 5. Let k be y(3). Let f(a) = kt(a) + 15i(a). Let z(u) = 3u2. Determine z(f(o)). 27o*4 Suppose -2r + 5s = r - 25, -25 = 5r + 5s. Let o(t) = -t2 + rt + t - t. Let i(g) = 16g. Calculate i(o(k)). -16k*2 Let x(y) = 76y. Let a(p) = -8p2 + 5. Let j(b) = -9b*2 + 6. Let u(s) = 6a(s) - 5j(s). Calculate u(x(c)). -17328c*2 Let d(l) = 30l*2 - 7. Let q(o) = 40o*2 - 9. Let x(g) = 9d(g) - 7q(g). Let f(j) = -101j. Give f(x(r)). 1010r*2 Let w(p) = 1	{ "pile_set_name": "DM Mathematics" }
ue of 7/(-3)(-3120)/520? 14 Calculate ((494/(-38))/(-39))/((-28)/6). -1/14 ((-91)/(-21))/13-2 -2/3 What is the value of (52/(-18))/(-21(-11)/2079)? -26 What is the value of ((-2)/(-141))/((-24)/208829)? -2/47 What is ((-12)/(-105))/((-9)/(-45))98/28? 2 Calculate (2090/(-33))/19(-11)/((-22)/12). -20 Calculate (-340)/(-51)-8(-9)/48. 10 What is (1/(-5))/(487/4870)? -2 What is (5/8(-54)/(-45))/((-11)/(-176))? 12 What is ((-15)/910-4)/((-105)/490)? -4/13 What is ((-2)/21)/(((-435)/120)/29)? 8 What is the value of (7/63)/(18/864)-3? -16 What is the value of (1026/285)/(1(-2)/(-5))? 9 Evaluate (-4)/(-20)-10. 0 Calculate (-28)/(-22)-1308/((-1568)/56). 14 What is the value of (-1)/((2/(-25))/((-254)/635))? -5 Calculate 49/63(-756)/(-11466). 2/39 Calculate (6/(-8))/((-12)/(-144)). -9 Calculate (-50)/40(-20)/956/15. 2/19 Calculate ((-10)/(-4))/((-132)/30828/(-6)). 5/4 What is ((3/2)/1)/((7155/(-1800))/53)? -20 Evaluate (1/(-14))/(381/(-508)). 2/21 Evaluate 76/53270/12. 5/6 Evaluate ((-225)/50)/(((-10)/(-2))/10). -9 What is the value of ((-19)/228)/(12/24)? -1/6 What is the value of 10((-200)/10)/120? -5/3 Evaluate (6/(-8))/(((-8062)/(-2552))/139). -33 What is 29/116-125? -15 Calculate (-4)/26(-59319)/338. 27 What is the value of ((-18)/4)/(8/(-704)-33)? -12 508/(-381)9/114 -2/19 (((-12)/14)/(-3))/((-15)/(-35)-1) -2/3 Calculate ((-2)/(-2))/((-104)/52). -1/2 What is the value of (((-5698)/(-44))/37)/(-3(-3)/36)? 14 Calculate (18/104/(-6))/((-5592)/41940). 9 What is the value of 9/(-21)63/72(-96)/12? 3 (-10)/(-16)411/(-2055) -1/8 Evaluate ((-4)/(-3)(-23)/(-92))/((-26)/18). -3/13 What is the value of -17104/(-442)2/4? 2 What is (143/(-39))/(-11)(-4)/6? -2/9 Calculate (108/(-63))/(22/(-21)). 18/11 513/((-52)/4) -5 What is 5-1(-34)/1870? 1/11 Evaluate (-81)/(-18)988/(-234). -19 (87(18/36)/(3/2))/(-1) -29 -15(12/(-33))/(39/143) 20 (680/(-2550))/((-44)/10) 2/33 What is the value of (516/774)/(-4(-2)/264)? 22 What is the value of (((-49)/735)/((-15)/(-36)))/(12)? -2/25 (10/(-56))/((-44)/308) 5/4 4/2(((-20)/(-36))/5)/(-1) -2/9 (44225/(-4392))/1453/(-5) 1/24 What is the value of (-3(18/(-99))/2)/1? 3/11 Calculate ((12/7)/((-125)/35))/(24/(-60)). 6/5 Calculate ((-6)/(-15))/(((-324)/(-15))/9). 1/6 2370/1422(-42)/(-10) 7 Evaluate ((-2)/(-4))/(((-2)/25)/(4704/(-1960))). 15 (1/(-14))/(((-3864)/(-196))/23) -1/12 Evaluate ((-11)/(11/1))/((-4)/((-24)/(-237))). 2/79 Evaluate ((-5)/(550/(-88)))/(216/(-20)). -2/27 What is the value of ((-2)/(-30))/(((-6)/(-8))/(954/848))? 1/10 Calculate (4/8)/(((-9)/(-2))/9). 1 Evaluate ((-357)/340)/(12/10)-8. 7 Calculate (-18)/4((-12)/21)/(810/180). 4/7 Evaluate (1432/(-1568))/(2/91). -13 Evaluate ((-80)/24)/(18/(108/(-10))). 2 Calculate (-65)/(-572)(32/(-120))/2. -1/66 What is 8411/6? 14 What is (13(-33)/(-715))/((-6)/15)? -3/2 Calculate ((-2079)/(-1386))/(7/((-14)/(-72))). 1/24 What is the value of 40-3-1(-9)/(-1215)9? 8 What is the value of (9/(-12))/((22/880)/((-2)/6))? 10 What is the value of (-30)/4((-6)/12)/((-129)/344)? -10 (-154)/(-220)(-1254)/231 -19/5 Evaluate 8/7(-32151)/3062. -12 Evaluate -25(-16)/(-120)3. -10 Calculate ((-12)/30)/(2/40)(-106)/212. 4 What is the value of (51/306)/((-22)/40)? -5/3 Evaluate -9028/(-3528)14. 10 Calculate (48/224)/(((-111)/18)/(-37)). 9/7 Calculate (276/46)/((-30)/(-35)). 7 Evaluate (-7)/2(-408)/(-1428)(-2)/(-6). -1/3 What is (-10)/(-440)-41? -1/11 88/(-18)2/(-4)(-18)/(-12) 11/3 Evaluate (((-31)/(-4))/(-31))/(20/(-48)). 3/5 What is the value of 415/61/(80/(-12))? -3/2 What is (6(-4)/112)/((-36)/(-42))? -1/4 What is ((-2)/(-4))/((-5)/540-54)? 1 Calculate (25/30)/((-20)/(-120)). 5 What is (33/(-15)-5)/((-12)/((-72)/6))? 11 Evaluate (-2514)/(-3352)64/(-3). -16 Calculate 225/31563/(-105). -3/7 What is 5/(-7(-2)/(-14))? -5 What is (450/50)/((15/(-5))/(-3))? 9 What is the value of (-32/15)/((-198)/(-3960))? -8 What is (163/(-1630)2-2)/(1/(-55))? -22 Calculate (-5)/((-1860)/8)2529/1686. 1/31 Calculate ((-7)/56)/(27/(-4104)). 19 Calculate (-1856)/928(-2)/49. 9 Evaluate 3/(32/(-160)-15). 1 8(-18)/1224-17 2 What is 3234/(-1925)(-3)/95? 14/5 What is ((-20)/(-105)3)/(7/((-49)/(-2)))? 2 ((-33)/(-44))/((-504)/96) -1/7 What is -89/((-288)/56)? 14 Calculate (-459)/510-22/18. 1/5 What is the value of 28/(-28)196/(-14)? 14 Evaluate (-4)/317/(-50048)-48. -1/46 Calculate (((-3)/(-12))/((-385)/(-110)))/((-1)/(-2)). 1/7 What is ((-252)/240)/7(-4)/15? 1/25 Evaluate ((-2)/(-6))/(16/(-32)2/39). -13 Calculate (24/1)/((-156)/(-39)). 6 Calculate ((-1512)/(-2079))/(30/11). 4/15 Calculate -8(2/848)/((-20)/40). 2/53 -2(-1)/(-3)(-154467)/5721 18 Evaluate ((-2)/(-2))/(27/(-2)). -1/7 Evaluate (3/(-7))/((-1113)/(-106)). -2/49 What is ((-210)/105)/((-2)/(-92)-4)? 23 What is the value of ((-2040)/40)/(13(-2)/2)? 17 Calculate (13/(-208))/(23/(-184)). 1/2 43/(-10)(350/(-21))/(-5) -4 Calculate 0/((-6)/(-15)5)(-4)/4. 0 What is ((-2)/48)/(165/110(-4)/18)? 1/8 1(1140/20)/(-19) -3 What is (-2)/(-4)(0/2)/((-8)/(-4))? 0 Evaluate (-89)/(-890)1/(-1). -1/10 Evaluate 0-48/160. 0 What is 1411/(5082/891)? 27 17/(1122/(-11))(-30)/2 5/2 What is the value of ((-20)/80)/(3/8)(-3)/(-6)? -1/3 What is ((-1540)/275)/(7/(35/(-2)))? 14 What is the value of (-3)/(-5)(-5425)/1395? -7/3 What is the value of ((-150)/(-60))/(5/(-3))2/8? -3/8 Calculate 293/(-155)3. -18/5 What is the value of (828/368)/(6/(-16))? -6 -2(-7)/(-28)((-1296)/450)/18 2/25 31/(1860/(-200))(-4)/((-80)/36) -6 (285/120)/((-1)/(-8)) 19 What is (1/(-1))/(3435/26180)? -22 Calculate -16(-15)/1440(-12)/15. -2/15 Calculate (-423)/47(-2)/(-4)(-4)/(-30). -3/5 What is the value of (144/(-40))/(28/70)? -9 What is (((-1)/45)/(501/1670))/(2/6)? -2/9 What is the value of ((-2)/(-36))/(18/48(-2)/3)? -2/9 62/(-93)(-1)/266/8 11/4 What is the value of (4800/(-2100))/(4/(-28))? 16 9/1353((-3)/1)/6 -1/10 (1((-288)/(-12))/(-12))/((-72)/(-15)) -5/12 Calculate (24/8)/311/1. 11 (14/(-12)3)/(119/(-510)) 15 Evaluate (-1395)/((-9)/(-1))(-8)/40. 31 338(-21)/(-462) 12 Calculate 3(-10)/68((-1456)/195)/28. 2/17 What is the value of ((-8)/(-14)(-140)/(-140))/((-2)/7)? -2 What is ((78/(-5))/(-39))/(((-8)/(-130))/(-2))? -13 Calculate 12(-15)/16204/15. -20/9 Evaluate ((-140)/28)/(390/(-12)). 2/13 Calculate 5/(-15)393(-3)/(-9). -13 Calculate 15/42(480/25)/(-6). -8/7 Calculate 4/(-64)(-250)/(-750). -1/48 Evaluate ((-50)/(1000/(-6660)))/9. 37 What is (9/5)/((-1)/60-3-3)? -12 Evaluate -10(-1)/20((-420)/5)/(-7). 6 What is the value of (20/6)/(-2)1296/(-2160)? 1 What is 436/239812/(-8)? -1/22 ((-90)/(-85))/((-34)/(-578)) 18 What is (42/(-7))/((-54)/(-90))? -10 Evaluate 38192/(-12152)2/(-44). 1/7 Calculate (13/((-52)/6))/((-4)/(-8)). -3 What is the value of 13(-18)/(-2457)21? 2 Calculate (475/3760)/(2/40). 5/4 Calculate ((2/(-4))/((-345)/(-1725)))/((-5)/(-12)). -6 What is the value of (42/(-56))/((99/24)/11)? -2 Calculate 500/5001-9. -9 Calculate (-50)/15((-42588)/195)/(-26). -28 What is the value of ((-8)/44)/(30/(-2640))? 16 Evaluate (-519)/(-865)2/(-18)-5. 1/3 Evaluate 3/((-16)/51212). -8 What is (-24)/(-36)(-14)/18-3? 14/9 Calculate 396/4((-475)/190)/(45/(-4)). 22 10((-1512)/90)/12 -14 What is (-64)/32035/(-14)? 1/2 What is the value of 6/21321/(-428)? -3/14 825/(-330)(-18)/(-5) -9 What is the value of (9/36)/((-9)/144-92)? 1/23 What is the value of (-5)/12-2078/(-715)-11? 10 What is the value of -68(-16)/2176(42/1)/(-1)? -21 (((-21)/14)/(30/20))/((-2)/18) 9 Evaluate (-84)/9828/(-68). 6/17 Evaluate 170/136288/(-20). -18 Calculate 12/(-48)-13/18-4. -1/6 ((-48)/368)/(4/(-46)) 3/2 Calculate 32/(-24)(-27)/(-144). -1/4 Calculate ((-952)/(-16))/(14/4). 17 Calculate (-1)/(-1)-4(-8246)/(-1736). -19 Evaluate (-2)/(14/315)-1(-3)/(-5). 27 What is the value of ((2/(-20))/((-80)/2400))/(1/(-7))? -21 What is the value of ((-27)/(459/(-34))13)/2? 3 What is -2(-6)/(-4)13545/(-1161)? 35 2/(-2)(85/(-17))/(20/4) 1 Calculate ((-3)/224)/(38/(-418)-11). -6/11 Calculate ((140/(-24))/5)/((-26)/312). 14 Evaluate ((-360)/120)/(345/(-10)). 2/23 Calculate 175/(-25)(-143)/77. 13 Evaluate ((-42)/6098455)/(10/(-16)). 2/33 What is the value of -14((-93	{ "pile_set_name": "DM Mathematics" }
True Is 72 a factor of 470? False Is 2544 a multiple of 159? True Is 10380 a multiple of 3? True Does 60 divide 2760? True Is 50905 a multiple of 118? False Does 29 divide 5915? False Is 96 even? True Does 3 divide 1363? False Does 35 divide 9752? False Is 260 even? True Is 840 a multiple of 56? True Is 352 a multiple of 16? True Is 8 a factor of 830? False Does 10 divide 300? True Is 62 a factor of 304? False Is 113 a factor of 15031? False Does 128 divide 1536? True Is 86034 a multiple of 13? True Is 49196 a multiple of 28? True Is 13 a factor of 636? False Is 2 a factor of 1452? True Does 20 divide 1400? True Is 12 a factor of 211? False Is 3074 a multiple of 7? False Is 15 a factor of 208? False Does 16 divide 171? False Is 47 a factor of 2199? False Does 4 divide 268? True Does 50 divide 11683? False Does 8 divide 17681? False Does 66 divide 24937? False Is 209 a multiple of 21? False Is 10590 a multiple of 30? True Is 13 a factor of 2760? False Is 1260 a multiple of 60? True Is 64 a factor of 4992? True Is 6380 a multiple of 220? True Is 10 a factor of 90? True Is 10 a factor of 2859? False Is 275 a factor of 109042? False Is 3494 a multiple of 14? False Is 35365 a multiple of 240? False Does 77 divide 385? True Is 496 a multiple of 5? False Is 4017 a multiple of 13? True Is 252 a multiple of 30? False Does 22 divide 1584? True Is 10 a factor of 10169? False Is 16 a factor of 205? False Is 720 a multiple of 24? True Does 23 divide 5853? False Is 111 a multiple of 11? False Is 216 a multiple of 5? False Does 18 divide 1447? False Does 48 divide 1142? False Is 4 a factor of 12? True Does 29 divide 2794? False Is 29 a factor of 1150? False Does 22 divide 5280? True Does 14 divide 1876? True Does 48 divide 1613? False Is 1159 a multiple of 23? False Is 41 a factor of 14723? False Is 1677 a multiple of 61? False Does 140 divide 14279? False Is 2452 a multiple of 38? False Is 71 a factor of 779? False Does 26 divide 4082? True Is 11052 a multiple of 12? True Does 26 divide 884? True Does 5 divide 10126? False Is 7706 a multiple of 18? False Does 13 divide 14424? False Does 5 divide 5223? False Is 1476 a multiple of 17? False Is 528 a multiple of 6? True Does 29 divide 2053? False Is 20 a factor of 2399? False Is 10904 a multiple of 116? True Does 7 divide 581? True Is 14 a factor of 2447? False Is 15 a factor of 150? True Is 59 a factor of 12862? True Is 70 a factor of 5320? True Is 1015 a multiple of 16? False Is 2986 a multiple of 13? False Is 198068 a multiple of 13? True Is 94 a factor of 9588? True Does 159 divide 13197? True Is 38 a factor of 2546? True Is 27096 a multiple of 18? False Is 12320 a multiple of 22? True Is 2924 a multiple of 86? True Is 258 a multiple of 68? False Is 2628 a multiple of 24? False Is 74 a factor of 13320? True Does 45 divide 45585? True Is 18 a factor of 21960? True Is 58 a factor of 54172? True Is 19 a factor of 67495? False Is 812 a multiple of 29? True Is 3116 a multiple of 4? True Is 38 a multiple of 16? False Is 16900 a multiple of 86? False Is 16 a factor of 49388? False Is 6710 a multiple of 70? False Is 1326 a multiple of 102? True Is 1584 a multiple of 88? True Is 1392 a multiple of 29? True Does 24 divide 6919? False Is 1380 a multiple of 25? False Does 62 divide 2876? False Does 3 divide 321? True Does 76 divide 705? False Does 73 divide 21900? True Is 28652 a multiple of 38? True Is 400 a multiple of 22? False Is 62 a factor of 2271? False Is 63 a factor of 11918? False Does 18 divide 13302? True Does 27 divide 1058? False Does 103 divide 28287? False Is 21 a factor of 924? True Is 7 a factor of 3153? False Is 288 a multiple of 6? True Is 94 a factor of 2186? False Is 15 a factor of 180? True Is 2688 a multiple of 42? True Is 1612 a multiple of 31? True Is 22 a factor of 12496? True Is 82836 a multiple of 234? True Does 22 divide 17952? True Is 236 a multiple of 4? True Is 711 a multiple of 26? False Is 26 a factor of 754? True Does 68 divide 2913? False Does 7 divide 242? False Does 15 divide 305? False Does 65 divide 2023? False Is 385 a multiple of 34? False Is 228 a multiple of 3? True Is 27774 a multiple of 8? False Is 5282 a multiple of 38? True Does 5 divide 140? True Is 11 a factor of 924? True Is 500 a multiple of 50? True Is 5 a factor of 437? False Does 31 divide 9238? True Does 341 divide 106216? False Is 5772 a multiple of 17? False Does 10 divide 9153? False Does 16 divide 5553? False Is 663 a multiple of 22? False Is 19 a factor of 1254? True Does 20 divide 68114? False Is 4749 a multiple of 80? False Is 72 a factor of 10224? True Is 200 a factor of 25000? True Is 1566 a multiple of 18? True Is 156 a multiple of 26? True Does 7 divide 79? False Does 59 divide 885? True Is 5 a factor of 1069? False Is 9 a factor of 50247? True Does 32 divide 192? True Is 21 a factor of 819? True Is 37037 a multiple of 13? True Is 23 a factor of 52578? True Is 1452 a multiple of 6? True Is 2232 a multiple of 72? True Is 16 a factor of 15792? True Does 4 divide 1712? True Is 75 a factor of 11925? True Does 92 divide 99010? False Is 105 a factor of 5293? False Is 7821 a multiple of 9? True Is 16 a factor of 13236? False Does 66 divide 1122? True Is 67940 a multiple of 43? True Is 8766 a multiple of 41? False Does 20 divide 20? True Does 2 divide 2016? True Does 4 divide 27? False Is 248 a factor of 17499? False Does 18 divide 84996? True Is 81 a factor of 4147? False Does 93 divide 33294? True Is 4 a factor of 2355? False Does 15 divide 375? True Does 149 divide 3302? False Does 12 divide 132? True Is 2 a factor of 6773? False Is 200 a factor of 39960? False Does 21 divide 117? False Does 304 divide 50623? False Is 29304 a multiple of 8? True Is 298 a multiple of 4? False Is 46 a factor of 16655? False Is 57 a factor of 493? False Is 13 a factor of 4030? True Does 60 divide 1260? True Does 24 divide 3744? True Is 7859 a multiple of 12? False Is 70 a factor of 4061? False Is 48 a factor of 2256? True Is 557 a multiple of 25? False Does 7 divide 15036? True Is 11 a factor of 1583? False Does 60 divide 22100? False Is 72 a factor of 1899? False Does 4 divide 4228? True Is 19 a factor of 1878? False Does 54 divide 245? False Does 49 divide 4901? False Is 10 a factor of 5534? False Is 4 a factor of 176? True Does 30 divide 360? True Is 4768 a multiple of 14? False Is 112397 a multiple of 22? False Is 2355 a multiple of 6? False Does 8 divide 1532? False Is 3 a factor of 20417? False Is 14 a factor of 45542? True Does 4 divide 1180? True Is 14 a factor of 62692? True Is 820 a multiple of 20? True Is 24836 a multiple of 28? True Does 30 divide 86259? False Is 21 a factor of 2814? True Is 2244 a multiple of 5? False Does 42 divide 2814? True Is 780 a multiple of 13? True Does 87 divide 2871? True Is 23 a factor of 4453? False Does 2 divide 58? True Is 100 a factor of 3300? True Does 37 divide 771? False Does 20 divide 1020? True Does 27 divide 75? False Is 10 a factor of 30450? True Is 4104 a multiple of 18? True Is 376 a multiple of 4? True Is 27 a factor of 584? False Is 1384 a multiple of 6? False Does 129 divide 45461? False Is 14 a factor of 756? True Is 2737 a multiple of 11? False Is 3806 a multiple of 14? False Is 25 a factor of 2909? False Is 57 a factor of 38988? True Is 96 a factor of 34256? False Does 15 divide 55892? False Does 13 divide 2250? False Does 97 divide 388? True Is 72 a factor of 77472? True Is 64767 a multiple of 10? False Does 6 divide 3552? True Is 102080 a multiple of 58? True Is 29 a factor of 1162? False Is 6 a factor of 43296? True Is 8880 a multiple of 20? True Does 19 divide 399? True Does 48 divide 672? True Does 14 divide 11998? True Does 60 divide 5688? False Does 46 divide 438? False Does 40 divide 88799? False Is 2 a factor of 3819? False Is 660 a multiple of 22? True Is 11664 a multiple of 8? True Is 222 a factor of 21978? True Is 3287 a multiple of 61? False Is 3222 a multiple of 179? True Does 110 divide 3190? True Is 9 a factor of 18720? True Is 634 a multiple of 15? False Does 93 divide 2325? True Does 19 divide 6935? True Is 7493 a multiple of 17? False Does 9 divide 28309? False Does 75 divide 900? True Is 89 a factor of 42631? True Is 2808 a multiple of 26? T	{ "pile_set_name": "DM Mathematics" }
nt + at*4 + ft*3 and give a. -2 Express 3j - 2j3 - 2 - 5j + 0j + j4 as qj*3 + ij*4 + tj + k + cj2 and give c. 0 Express (-t + 0t + 2t)(-3t2 + 5t2 - t2) + 3t3 + t3 + t3 + t3 - 9t3 + t3 in the form yt2 + pt*3 + mt + n and give p. -1 Rearrange 13v + 41v - 9v to kv + u and give k. 45 Express 16 - 5 - 9 + f*2 in the form xf*2 + lf + a and give a. 2 Express -4 + 6z + 4 + 0 in the form v + qz and give q. 6 Rearrange (d - 2d - d)(0 + 6 + 2)(0d2 - d2 - 5d2) to the form ld*3 + nd + fd2 + u and give f. 0 Rearrange (3 - 2 + 0)(-3 - 2a + 3)(-3 - 1 - 3 - a) to the form ia2 + y + ha and give i. 2 Rearrange -2 + 4y2 + 19y - 15y - 4y to the form ny2 + j + uy and give n. 4 Express -13x - 14x - x + 5x in the form b + ix and give i. -23 Express -r - 2r + r - r + r - r + (r - 2r + 2r)(-2 + 3 - 3) - r - 2 + 2 + 3r - 2r + 4r as j + ur and give u. -1 Rearrange (-2 - 5 - u + 5)(-15 + 11u + 7 + 12) to q + xu2 + su and give q. -8 Rearrange 2f4 + 52 - 4f*2 + 4f*3 - 2f*3 - 56 to the form af*2 + q + bf + cf4 + df*3 and give b. 0 Rearrange -5n*3 - 3n2 + n4 + n - 2n + n3 to the form mn*2 + l + pn*4 + rn*3 + an and give p. 1 Rearrange (-2 + 2 + 2h2)(-21h + 3 + 43h - 20h) to the form mh*2 + fh + bh3 + c and give b. 4 Rearrange (b2 - 2b2 - b2)(b - b - 2b + (11 - 11 + 4b)(-2 - 2 + 2 + (0 + 0 + 2)(-2 - 3 + 4))) to ob*2 + c + zb + nb3 and give c. 0 Express -40u*2 - 41u*2 + 0u + 2u3 - 3u*4 + 86u*2 + u in the form c + qu*4 + ku*3 + fu*2 + yu and give y. 1 Rearrange 116 + 0j - 2j*2 - 109 - j to the form gj + y + cj2 and give y. 7 Express 3 - l + l3 - 1 - l4 - l + 0l as cl2 + yl + m + gl3 + tl*4 and give y. -2 Express 3f - 2f2 + 0f*3 - 2f + f*3 in the form rf + qf2 + hf*3 + x and give r. 1 Express 3t + 10 + 11 - 22 in the form g + ht and give g. -1 Express 12d - 7 - 1 + 8 as l + ud and give u. 12 Rearrange v - 5v*3 + 11 - 11 to sv + zv2 + lv*3 + h and give s. 1 Rearrange (2g + 2g - 2g)(30 + 89 - 15) to kg + h and give k. 208 Rearrange -8m3 + 7m*4 + 0m*2 + 6m3 + m2 - m to xm3 + ym + qm4 + im*2 + z and give i. 1 Express 2i - 3i4 + 1310i*3 - 1308i3 - i4 - 2 as gi + ri*4 + qi*3 + ti*2 + y and give y. -2 Rearrange -139c - 5 - c*2 - 1 + 135c to the form sc + mc*2 + r and give s. -4 Rearrange 0i*3 - 25i*2 - 4i*3 + 5i*3 - 16i*2 + 1 to p + bi*2 + di*3 + ui and give p. 1 Express 5w3 - 2w*3 - 4 - 3w*2 - 2w*3 as cw*2 + sw + zw3 + j and give c. -3 Express 26z + 31z + 2 - 18z + (5 - 2 - 2)(0z + 3z - 2z) in the form l + xz and give x. 40 Rearrange 0u*3 + 2u*3 + 1 - 26u + 53u - 2u*4 - 28u + u*2 to the form l + ou*4 + bu + ku2 + pu*3 and give k. 1 Rearrange 2 - 2b*2 - 112b*3 + 58b*3 + 4b + 56b3 to the form xb + rb2 + t + lb*3 and give x. 4 Rearrange (-3 + 0 + 4)(-4v + 5v - 2v) - v + 3v + 4v - v + 3 - 3 + (-v - 2 + 2)(-3 - 2 + 3) to the form dv + n and give d. 6 Rearrange 2 - 9o*2 - 6o + 12o2 + 6o to the form b + xo2 + lo and give x. 3 Express -1 + 2x2 + 8x*3 + 4x*2 - 5x2 + x2 in the form w + kx3 + lx + cx2 and give c. 2 Express (0f + 2f + 0f)(62f*2 + 1043f - 1043f) - f3 - 3f*3 + 3f*3 in the form kf*3 + jf*2 + y + bf and give k. 123 Rearrange -2w + 12w + 19w - 7w to the form a + zw and give z. 22 Express (0 + 3m*3 + 0)(3m - 7m + 2m) + (13 - 13 + 3m*2)(2m2 + 0m*2 - 3m*2) in the form pm + z + km2 + sm*4 + cm3 and give s. -9 Express (-u3 - u*4 + 2u*4 - 4u*4)(-5 - 14 - 9) as b + mu4 + qu*2 + du*3 + xu and give m. 84 Rearrange -2c2 - 3c + 3c + (-21 + 21 - 17c)(-3c - 2c + 4c) - 3c2 - c2 + 2c*2 to h + ic + oc2 and give o. 13 Express -11q + 4q + q - 24 + 2q in the form nq + b and give b. -24 Rearrange -3j + 2j - 6j + (5 - 3 - 1)(0j - 2j - j) to the form t + gj and give g. -10 Rearrange -3k4 - 12k*4 + 3k*4 + (2k2 - k2 + k*2)(4k2 + 2k*2 - 4k*2) to the form mk + bk4 + zk*2 + s + rk*3 and give b. -8 Express -2j*3 + 2j3 + j3 + (5 - 2 - 5)(-2j*3 + 2j*3 - 2j*3) + 4j*3 - 4j3 - j3 in the form yj3 + sj + u + gj2 and give y. 4 Rearrange -2k*3 + 4k3 - k3 + 0 + 0 + 2k3 + (3k - 4k - 4k)(2k - 2k + 3k*2) to vk + l + dk3 + nk*2 and give d. -12 Express 1 - 5h + 5h + 7h as th + u and give t. 7 Express -5 + 4 - t2 + 0t*2 + 0 in the form m + ut + st2 and give m. -1 Rearrange 1 - o3 - 5o + o - 3o2 + 3 - 3 to the form u + ro*3 + zo*2 + lo and give z. -3 Express -3n3 + 0n*3 + 2n*3 + (-2 + 1 - 1)(-2n3 - 3n*2 + 3n2 - n2) in the form hn3 + in + c + pn2 and give p. 2 Express (-4 - 3 + 3)(-7 + 7 - 8d) + (2d - 3d + 3d)(5 - 4 + 0) + 0d + 2d + 0d in the form y + id and give i. 36 Express 16v - 13v - 64v in the form m + yv and give y. -61 Rearrange -4i*3 - 3i*3 - 2i + 0i + 0i*3 to x + ki + ji3 + vi*2 and give j. -7 Rearrange 16i*2 - 8i*2 + 11i*2 to c + hi*2 + vi and give h. 19 Rearrange (0y - 2y + 0y)(0 - 5 + 28) to jy + z and give j. -46 Rearrange (-4d - 3d - 3d)(-2 + 2 - 2d*2) + 8d*3 - 2d*2 + 2d*2 to y + jd*3 + nd + ad2 and give j. 28 Rearrange (-j2 + 3j*2 - 4j*2 + (0 - 2 + 3)(j*2 - 4j + 4j))(0 - 14 - 2) to gj2 + w + lj and give g. 16 Rearrange (6y2 - 13y + 13y)(9 + 0y2 - 7 - y2) to ly*3 + wy*2 + cy + z + ry4 and give w. 12 Rearrange z2 - 8z + 26z - 3z*2 - 10z to the form az + rz*2 + f and give r. -2 Express (-1 + 1 + q + (-3 + 3 - 2q)(-1 + 0 - 1))(1 + 1 + 5)(-3q - 2q + 3q) as dq + wq*2 + o and give w. -70 Express 142 + 45d - 142 as ld + p and give l. 45 Express (-8t - t + t)(3 - 4 + 0)(5t - 5t + 2t2) in the form wt + zt2 + s + rt*3 and give r. 16 Rearrange (11 + 10 + 551a - 549a)(3 - 3a - 3)(0a - 4a + 2a) to the form da*2 + z + ua + sa3 and give d. 126 Express (-4n - n + 3n + (-3n + 2n - n)(2 - 2 + 3) - 4n + 3n - n + 5 - 2n - 5)(0n2 + 0n2 + n2) as pn + f + un*3 + bn*2 and give p. 0 Rearrange -2y - 2y - 2 - 4y - 2y2 - 2y*3 + 4y to the form iy2 + z + hy + oy3 and give o. -2 Rearrange (-m - 1 + 1)(5m - m + 0m) + (0m + 3m - m)(2m + 0m + 0m) - 3m2 + 4m2 + m2 to dm2 + wm + r and give d. 2 Rearrange -j*2 + 3j - 3j + (4j*2 + 3j*2 - 6j*2)(-2 + 8 + 10) to dj + bj*2 + l and give b. 15 Rearrange (4j*4 + 2j*4 - 2j*4)(-13 - 1 - 2 + (4 - 2 - 4)(4 - 1 - 2) + 0 + 6 - 4) to the form uj*4 + pj*2 + v + hj + wj3 and give u. -64 Rearrange 2n*3 + 4 - 5n*3 + 4n*3 - 2n*2 to the form kn*3 + qn*2 + t + in and give t. 4 Express -34q2 - 51q*2 - 8q*2 as nq + mq2 + l and give m. -93 Express 6 - 5c*2 + 6c*2 + 3 in the form r + ic + mc2 and give m. 1 Express (-1 + 1 + 2z*2)(2 + 2 - 2)(-z - 9z - 4z) in the form mz*2 + hz*3 + yz + a and give m. 0 Express -6n3 + n3 + 3n*3 + 13n*2 in the form vn + h + in3 + pn*2 and give p. 13 Rearrange 11l + 7l - 9l*2 - 18l - 2 to the form s + gl2 + jl and give g. -9 Express 68 + 2m2 - 9m - 7m - 68 in the form tm*2 + jm + p and give j. -16 Express -5o2 + 2o*3 + 0o + 11o2 - 2o - 7o4 - 7o*2 in the form vo*3 + w + to*4 + jo*2 + ro and give v. 2 Express 13l + 23l - 7l in the form zl + v and give z. 29 Express 4 - 3 - 84l - 1 as x + ul and give u. -84 Rearrange -25 - 1 + 2c + 22 - 73 to the form b + zc and give b. -77 Rearrange -t - 4t3 - 17t*2 + 18t2 + t3 + 6t3 to ut + st2 + dt*3 + z and give d. 3 Rearrange -v + 5v*3 + v + 7v3 - v3 - 4v3 - v3 - 4 + 4 + (-2 + 2 - v)(0v2 + 2v*2 + 0v*2) to the form jv*3 + yv + dv2 + t and give j. 4 Express -37j*2 - 2j - 9j2 - 6j*2 as gj*2 + l + aj and give g. -52 Rearrange -6z2 + 4z*2 + z + 17 - 3z*4 + 4z*2 to fz*2 + a + gz + qz3 + pz*4 and give p. -3 Express (-2233w + 2233w + 32w*2)(	{ "pile_set_name": "DM Mathematics" }
50x3 + 10513x*3 - x + 5x2 + x2 - 2x - 5264x*3. Calculate d(5). 10 Let q(a) = -3a3 + a2 + 9a - 1. Let k be q(-2). Let r(s) = -3s + 9. Give r(k). -18 Let q(c) = -73c + 22. Let f(v) = 231v - 65. Let k(d) = -6f(d) - 19q(d). Determine k(25). -3 Let z(k) = 6k + 5. Suppose -p + 9 - 47 = -2x, 2x - 5p = 46. Suppose -3q - 4s = -3, 3q - 3s + x = -0q. What is z(q)? -13 Let a(u) = 5u*2 - 3u - 7. Let p(o) = 6o2 - 4o - 7. Let z(g) = 5a(g) - 4p(g). Let q = 131 - 129. Suppose -qm + 2m = m. Give z(m). -7 Suppose -48o = -56o. Let d(w) = -7516 - w*3 + 7494 + 0w3. What is d(o)? -22 Let j = 4 - -119. Let d = j - 120. Let z(n) = n2 - n + 2. Calculate z(d). 8 Let a = 1 + 0. Let v(t) be the first derivative of -7/2t2 + 0t - 65. Calculate v(a). -7 Let a(b) = 3b. Let k be a(2). Suppose 0 = 3d - 7d + n + 27, 2d - 10 = 4n. Let u(g) = 3g - 13. Let w(c) = -5c + 20. Let v(f) = du(f) + 5w(f). Give v(k). -15 Let p(a) = -2a*2 + 11a + 25. Let u(r) = r*2 - 5r - 13. Let x(w) = 6p(w) + 13u(w). Let o(z) = z*3 + 6z*2 + 3z - 10. Let j be o(-5). Calculate x(j). -19 Let v be (5/(-2))/((-24)/48). Suppose 3r = -vr + 32. Let t(z) = -z*3 + 5z*2 - 6z + 2. Calculate t(r). -6 Let g(y) be the second derivative of -20y3/3 - 19y*2/2 + 10881y. What is g(-5)? 181 Let g(l) be the second derivative of l6/360 + l4/6 + l*3/3 + 45l*2/2 - 42l. Let u(w) be the second derivative of g(w). Calculate u(0). 4 Let t be (13 - 14)(1 + -4 + 1). Let j be (-49)/(-14)((-2)/t - 1). Let b(u) = u*2 + 6u + 2. Calculate b(j). 9 Let p(b) = 2b3 + 2b + 1. Let d = 483 + -481. Suppose -5x = -3o - 9, -5o + dx + 15 - 11 = 0. Calculate p(o). 21 Let z(c) = -2c2 + 20c + 34. Suppose -221 = 32061i - 32078i. What is z(i)? -44 Suppose 0 = -5w + 20, 0 = -2u + 6u - 2w - 36. Suppose m + 4m = -5d + 15, 5d = -m + u. Let g(t) = -3t*2 - 137t + dt2 + 141t. Give g(5). -5 Let a(v) be the third derivative of v6/60 - v5/60 - 11v4/24 - v3/3 - 847v2. Determine a(-3). -32 Let j(p) = -p2 + 11p - 19. Let o be 9 + -14 + (-1 - -3) + (16 - 4). Give j(o). -1 Suppose j - 3j = -2u + 392, u - 592 = 3j. Let i = -202 - j. Let k(h) be the third derivative of h5/60 - h3/3 + 7h2. Give k(i). 14 Let d(v) be the second derivative of -v4/3 + 11v*3/6 + 10v*2 + 1448v. Determine d(6). -58 Suppose 0 = -c + 4z + 14, 4z = 74c - 77c - 6. Let o(n) = 5n3 - 4n - 1. What is o(c)? 31 Let v(i) = 31i + 27i - i*2 - 60i + 0i2 + 1. Let g(l) = -2l + 23. Let u be g(10). Suppose 0 = uh - 4 + 10. Determine v(h). 1 Suppose 10x = -85 - 15. Let r be -2 + x - (-8 + 3). Let m(c) = -c - 5. Give m(r). 2 Let x be (6/(-9))/((-4)/(-4))-111. Let g = x + -72. Let d(y) = 4y - 1. Determine d(g). 7 Suppose 6l = 11l - 205. Suppose 0 = -6x + 53 - l. Let y(i) = 3i - 2. Let k(t) = 3t - 2. Let a(r) = -5k(r) + 4y(r). What is a(x)? -4 Let t(c) = -c2 - 2c + 1. Let f be t(-3). Let y(k) = k + 0k - 2k - 2k + 7. Let w(j) = 8j - 20. Let z(s) = -6w(s) - 17y(s). Calculate z(f). -5 Suppose -2i + 60 = 5u, 0u + 2i = -2u + 30. Let c(r) be the first derivative of -r4/4 + 11r*3/3 - 4r*2 - 10r + 964. Calculate c(u). 10 Let m(r) = -2r + r3 - 143351r*2 - 33 + 71663r*2 + 71665r*2. What is m(23)? -79 Let d be -4(6/3 + -3). Suppose 0 = dx + 15 - 39. Let n(i) = xi*2 - 2i + i + 0i + 0i. Calculate n(-1). 7 Let y(i) be the first derivative of -i*4/24 - 8i3/3 - i2 + 4i - 41. Let c(x) be the second derivative of y(x). Give c(-11). -5 Let k(d) be the second derivative of d4/3 - d3/6 + 101d. Determine k(1). 3 Let f(s) be the first derivative of 115 - 1/2s2 + s - 1/4s*4 + 2s*3. Calculate f(6). -5 Let n(d) = -20d + 4. Let g(x) = -3x. Let p(z) = -6g(z) + n(z). Suppose 4o + 20 = 9o. Suppose oi - 33 = -1. What is p(i)? -12 Let a(q) be the first derivative of -2q*2 - 22q + q + 17q - 41. What is a(-5)? 16 Suppose -69i - 2s - 7 = -70i, 0 = 4i - 3s - 8. Let d(f) = -3f3 + 2f*2 + 3f + 2. Give d(i). 4 Let b(i) be the second derivative of 7/120i5 + 0 + i2 + 12i + 7/6i3 + 1/24i4. Let f(t) be the second derivative of b(t). Give f(3). 22 Let j(h) = h2 + h - 3. Let s be j(0). Let r(l) = -l - 1. Let a be r(s). Let d(o) = -1. Let i(w) = w*2 - 4w - 4. Let z(u) = -5d(u) + i(u). Calculate z(a). -3 Let b(c) = -3c*2 - 13c + 4. Let w(j) = -16j2 - 186j + 66. Let s be w(-12). Give b(s). -26 Suppose -3z = 4s - 83, 0 = -2s - 3z - z + 44. Let h(g) = -21 + 20 + 19g - sg. Calculate h(3). -4 Let h(x) = -2x + 58. Suppose 10 = 5j, 2q - 113j = -118j + 62. Calculate h(q). 6 Let m(v) = -174v + 183. Let k be m(1). Let w(g) = g*2 - 5g - 31. What is w(k)? 5 Let z(c) = -4 - 10c2 + 31c - 2c2 + 15c*2 + 11c*3 - 33c. Determine z(-2). -76 Let u = 123 + -84. Suppose 4i - 25 - 50 = -3s, 2i - u = -s. Let h(v) = -19v - iv + 41v - 2. What is h(2)? 0 Let f = 5 - 3. Let t(n) = -3n3 - 7n*f + 4n*3 + 4 - 8. Suppose 52s - 385 = -5s + 2s. Determine t(s). -4 Let x = 55 - 24. Suppose -k + h - 4 = -1, 3k = -5h + x. Let b(t) be the third derivative of t5/20 + t3/3 + t*2. Give b(k). 14 Let g(y) = y - 6. Let l = 11 + -7. Suppose -720 = -198w + 18w. Suppose -3o + 11 = wp, lp = 3o + 4 - 23. What is g(o)? -1 Let l(n) = 4n*3 - n. Suppose 0 = o + d - 150 + 47, 3o - 302 = 4d. Suppose 2u = -0u + o. Suppose 0 = -48g + ug + 3. Determine l(g). -3 Let o(x) = -8 + 6x + 23 - 9x. Suppose 0 = -156d + 16d + 436 + 544. Give o(d). -6 Suppose 2t + 2t - 272 = 0. Suppose -2c + 4u - t = -5c, -3c + 58 = -u. Let s be 30/c(-8)/3. Let v(b) = b*3 + 4b*2 - b + 4. Calculate v(s). 8 Let k = 403441/120 - 3362. Let o(t) be the third derivative of 0t - 1/6t3 + 0 - 12t*2 + 0t*4 + kt*6 + 0t*5. Calculate o(-2). -9 Let v(q) = -4q*2 + 2q - 8. Let g be v(0). Let x(n) = 0 - 61n + 68n + 10. Give x(g). -46 Let k(u) = u*2 - 2u - 11. Let p be 3699/6852/3 + (-4)/(-10). Give k(p). -3 Let j(w) = -w - 1. Let f be (-424)/(-6) - ((-7)/3 - -3). Suppose -9a = -2a + f. Let v(c) = -c - 4. Let h be v(a). Determine j(h). -7 Let y be (-2 - 45/(-25)) + (-344)/(-20). Let z(r) = -yr*2 - 5 + 5r + 18r2 + r3 + 8r*2. Determine z(-8). 19 Suppose 42c - 12c = 4c - 0c. Let b(z) = 11z - 61. Let q(r) = 5r - 30. Let y(x) = 4b(x) - 9q(x). Calculate y(c). 26 Let m(x) be the third derivative of -x4/3 - 4x*3 - 19x*2 + 1. Give m(-3). 0 Let f(y) = -8y - 2. Let d(u) = -13u - 1. Let t(l) = -11l. Let q(g) = -5d(g) + 4t(g). Let c(x) = 8f(x) + 3q(x). Give c(-2). 1 Let d(c) = -44c - 28. Suppose 2p = 11 - 67. Let f(j) = -3j - 2. Let t(w) = pf(w) + 2d(w). Determine t(3). -12 Suppose 0x = 4x - 20. Let o(w) = 7w + w*3 + 9 - 4w + xw + 8w*2. Suppose -559y = -525y + 238. Calculate o(y). 2 Let j(m) = 8m*3 + 4m*2 - 7m - 4. Let z(u) = -13u3 - 6u*2 + 12u + 7. Let b(d) = 5j(d) + 3z(d). Calculate b(-3). -11 Let q(w) be the first derivative of w*2 + 53w + 608. What is q(-20)? 13 Let i(b) = -68b - 199. Let p(x) = -47x - 132. Let r(w) = 5i(w) - 7p(w). Calculate r(-6). -5 Let s(g) be the second derivative of -g5/20 + g4/4 + g*3 - 7g*2/2 + g. Let f be (-9)/(-36) - 6015/(-1604). What is s(f)? 1 Let b(i) = -8i*3 - 25i*2 - 10i - 15. Let c(u) = -9u3 - 26u*2 - 10u - 16. Let k(m) = -7b(m) + 6c(m). Give k(-9). 0 Let x(d) be the second derivative of 2d + 3 + 0d*2 + 1/12d*4 - 2/3d3. What is x(3)? -3 Let s(h) be the second derivative of -h3/6 - 7h2/2 - h - 10288. Let t = -6 - -2. Determine s(t). -3 Suppose -4c - 270 = 42. Let t be c/9(-12)/(-8). Let a = 19 + t. Let h(d) = -d + 3. What is h(a)? -3 Let i(r) be the third derivative of r4/8 - 31r*3/6 - 317r*2 - 2r. Give i(-19). -88 Let r = -194 - -209. Let v(w) = 10w3 - 1 + 2w + 0w - 8w - 11w3 - 8w - rw2. Determine v(-14). -1 Let f(s) = 12827s + 9 - 12816s + 19 - s2. Determine f(9). 46 Let a(w) = w2 - 11w + 22. Let j = 58 + -49. Let g be a(j). Let i(r) = -1159r + g + 1160r - 4 - 3. Determine i(-8). -11 Let g(z) = 6z2 - 72z + 15. Suppose -5q + 25 = 0, -3o - q = -6o + 31. What is g(o)? 15 Let w(s) = 23s + 2. Let c(x) = -42x + 1. Let o(f) = 6c(f)	{ "pile_set_name": "DM Mathematics" }
erivative of -w*3/6 - 2w*2 + 134w - 1. Let p(i) = -1. Calculate 2o(y) - 4p(y). -2y - 4 Let o(u) = 17 - 20 - 2u*2 + 0u - 3u + 9. Let j(k) be the first derivative of -k3/3 - k2/2 + 2k - 3. Determine -8j(q) + 3o(q). 2q2 - q + 2 Let t(r) = r2 - 2. Let x(i) = i2 - 3i + 4. Let f be x(3). Let v(a) = 2a2 - 5. Suppose 6b + 60 = -0b. Give bt(o) + fv(o). -2o*2 Suppose -2 = 4m - 2t, -4m - t + 0t - 11 = 0. Let x(u) = -1. Let c(s) = -2s*2 - 3s - 1. Determine mx(g) + c(g). -2g*2 - 3g + 1 Suppose -3q = j + 7, j + 0q = -q - 1. Let a(l) = 53 - 25 - 25. Let d(f) = f + 2. What is ja(h) - 3d(h)? -3h Let a(n) = -83n - 13. Let y(c) = -166c - 29. Give 9a(j) - 4y(j). -83j - 1 Suppose 4x + 0f - 24 = 2f, 4f = x - 6. Let w(z) = -z. Let v(i) = -2i - 5. Let d(s) = s + 4. Let b(o) = 4d(o) + 3v(o). Calculate xw(j) - 2b(j). -2j - 2 Let w(l) = 11l - 6. Let d(y) = 9y - 5. Let a(c) = 6d(c) - 5w(c). Let i(v) = -438 + 4v + 224 + 213. Give -6a(f) - i(f). 2f + 1 Let k(o) = -2o + 2. Let u be 9/6(1 + -2 - 1). Let w(d) = -d2 + 2d - 3. Calculate uk(q) - 2w(q). 2q2 + 2q Let j(q) = 18q3 - 2q*2 + 7. Let f(p) = -6p3 + p2 - 2. Suppose -189d + 185d - 8 = 0. What is dj(n) - 7f(n)? 6n3 - 3n*2 Let v(r) = 3r + 6. Let t(c) = -6c - 11. Let l(k) = 11 - 11 + k + 14. Let x be l(-8). Give xt(f) + 11v(f). -3f Let p(y) = y - 5. Suppose -5r = -t - 11, -2r - 3t + 24 = 2r. Let x(g) = 3. What is rp(z) + 5x(z)? 3z Let o(h) = -4h*3 + 3h - 14. Let p(v) = 4v3 - 3v + 13. Determine 5o(b) + 6p(b). 4b3 - 3b + 8 Let x(u) be the third derivative of 11u5/60 - u4/12 - u3/3 + 12u*2 + 12. Let v(m) = 780m*2 - 143m - 143. What is -2v(l) + 143x(l)? 13l2 Let o = 10 + -8. Let n(a) = -a2 - a + 1. Let j(c) be the first derivative of -c4/4 - 2c*3/3 + 3c + 5. What is on(u) - j(u)? u3 - 2u - 1 Let u(x) = -4x2 + 5x - 5. Let b(j) = j*2. Let i(w) = -25w*2 + 24w - 24. Suppose -6r - 13 = -7. Let a(m) = ri(m) - 5b(m). What is 5a(h) + 24u(h)? 4h*2 Suppose a = -1 + 4. Let r(m) = 1 - m + a + m + 7m. Let u be 16/(-12)9/3. Let p(c) = 36c + 21. What is up(x) + 21r(x)? 3x Let a(s) = s - 6 + 2 + s. Let l(b) = -3b + 3. Let r be (5/3)/((-15)/(-45)). Let o(v) = 7v - 6. Let w(c) = rl(c) + 2o(c). Calculate -3a(i) - 4w(i). -2i Let o(y) = -112y2 + 98. Let j(i) = i2 - 1. What is -490j(v) - 5o(v)? 70v*2 Let s(j) = 3j. Let v(q) = -4q. Suppose 2w + 19r - 23r - 20 = 0, -3w - r + 2 = 0. What is wv(o) + 3s(o)? o Let r(v) = -2v*3 - 3v*2 - 2 - 4v*2 - 5v*3 - 6v. Let j = 204 + -221. Let s(b) = -20b3 - 20b*2 - 17b - 6. Determine jr(l) + 6s(l). -l3 - l2 - 2 Let s(j) = -25j3 + 3j*2 + 3j*2 - 6j*2 + 17j - 17. Let f(r) be the first derivative of 3r4/4 - r2 + 2r + 80. Give 51f(v) + 6s(v). 3v3 Let s be (-1)/4 - 513/(-228). Let x(w) = -3w + 1. Let i(l) = 4l. Give sx(m) + 3i(m). 6m + 2 Let d(b) = 7b2 - 20b - 6. Let s(o) = -13o2 + 41o + 10. Determine 5d(m) + 3s(m). -4m2 + 23m Let r(i) = 3i3 - 4i*2 - 2i + 1. Let q(y) = 6y3 - 9y*2 - 5y + 2. Suppose -16g - 52 - 12 = 0. Calculate gq(v) + 9r(v). 3v*3 + 2v + 1 Let t(k) = 25k + 5. Let w(u) = -5u - 1. Let z(x) = -2t(x) - 11w(x). Let g(p) = 9p + 2. Give 3g(n) - 5z(n). 2n + 1 Let b(r) be the first derivative of 3r2/2 - 6r + 433. Suppose -3v = -25 + 7. Let m(x) = x + 2x - 6 - 1. Determine vm(j) - 7b(j). -3j Let c(k) = k2 - 42k - 185. Let l be c(-4). Let u(a) = -4a3 + 2a2 + a. Let y(v) = v3 - v*2. Calculate lu(n) - 3y(n). n3 + n2 - n Let i(h) = 2h + 2. Let q(r) = -7r + 112. Give -4i(g) - q(g). -g - 120 Let g(j) = -13j - 5. Let z(s) = 20s + 8. Let v be 1 - (-3 - -2) - 220/22. Determine vg(b) - 5z(b). 4b Let b(f) = -f + 6. Let q(m) = -1. Suppose -87x + 25 = -62x. Suppose 0 = 2i - 0i - 12. Determine iq(w) + xb(w). -w Let b(o) = 29o*3 - 10o2 - o - 5. Let g(m) = m3 - 2m2 - 1. Determine -b(h) + 5g(h). -24h3 + h Let c be ((-2)/(-5))/(-3 - 48/(-15)). Let v = 2 + 0. Let i(z) = 1 + 3z*3 + 0z*v + cz*2 - 4z3. Let f(t) = t3 - 3t2 - 1. Give -3f(b) - 5i(b). 2b3 - b2 - 2 Let q(k) = -11k3 + k2 - 3k - 6. Let h(n) = -12n3 - 4n - 7. Determine -3h(r) + 4q(r). -8r3 + 4r*2 - 3 Let k(g) = 58g + 56g - 108g + 21 + 5. Let v(j) be the second derivative of -j*3/6 - 5j*2/2 + 2j. Give -2k(b) - 11v(b). -b + 3 Let f(n) = -6n2 + 0n*3 - 6n*2 + 11n*3 + 20n - 5n2 - 4n*3. Let g(j) = -2j*3 + 6j*2 - 7j. What is -6f(c) - 17g(c)? -8c3 - c Let k(b) = -6b3 + b2 + b. Let z(m) = m*2. What is -k(s) - 6z(s)? 6s3 - 7s*2 - s Let a(c) = 2c*2 + 23c - 9. Let i(p) = 6p2 + 68p - 26. What is -17a(f) + 6i(f)? 2f2 + 17f - 3 Let a(f) = 5f3 + 8f*2 + 31f + 1. Let v(w) = 4w3 + 7w*2 + 31w + 2. Determine -5a(r) + 6v(r). -r*3 + 2r*2 + 31r + 7 Let u(d) = 4d + 5. Let v(w) = -19w - 3. Let r(g) = -12g - 2. Let h(j) = -8r(j) + 5v(j). What is -3h(o) + u(o)? o + 2 Let w(j) = j*3 - 3j3 + j3 - j*2 - 3. Let r = 14 - 11. Suppose 4x + 2 = rx. Let l(k) = -1. Give xw(y) + 6l(y). 2y*3 + 2y*2 Let p be 5 - ((0 + 4 - 8) + 4). Let f(j) = 41j*3 - 8j*2 + 8j + 8. Let b(z) = 27z3 - 5z*2 + 5z + 5. Calculate pf(n) - 8b(n). -11n3 Let h(x) = -x3 + 2x*2 + 6x - 7. Let k be h(3). Let o(l) = 2l + 2l + kl. Let a = 4 - 8. Let n(i) = -i. Give an(s) - o(s). -2s Let m(u) be the second derivative of -u4/12 - u3/6 + 73u. Let f(b) = b*3 + 4b*2 + 9b. Calculate -f(n) - 4m(n). -n3 - 5n Let y(r) = r3 + r2 + r - 6. Let p(u) = -3u3 - 3u*2 - 3u + 17. Let t(d) = 4d - 14. Let l be t(2). Give lp(j) - 17y(j). j3 + j2 + j Let m(g) be the second derivative of -g4/12 + 9g*2/2 + 2g + 21. Let f(z) = -2z2 + 22. Suppose 40 = -5b + 15. What is bf(q) + 12m(q)? -2q2 - 2 Let d = 8 + -41. Let l(w) = w2 - 3w - 60. Let c be l(-6). Let x be c/d + (-24)/11. Let i(q) = q - 3. Let r(k) = 4k - 13. Determine xr(f) + 9i(f). f - 1 Let s(z) = 4z2 - z2 - z + 2z2 - 4z*2 + 2. Suppose -n - 159 = -5y - 183, -2n + 8 = -2y. Let b(c) = -c*2 - c + 1. Give nb(k) + s(k). 2k2 + 1 Let k(r) = -3r - 7. Let f be (-1)/((-3)/(-31)). Let o be 2((-27)/6 - f). Let z(v) be the first derivative of -2v2 - 10v - 152. Give ok(h) + 5z(h). h - 1 Let o = 28 + -21. Suppose -ov = 42 - 0. Let t(h) = -h2 + h + 1. Let b(k) = 4k*2 - 3k - 4. Give vt(c) - 2b(c). -2c2 + 2 Suppose 0 = 2q - 11 + 29. Let t(h) = 4h - 3. Let j(r) be the third derivative of r4/24 - r3/6 - r2. Determine qj(b) + 2t(b). -b + 3 Let r(o) = 14o*2 - 10o + 7. Let b(f) = -16f2 + 11f - 7. Give -6b(n) - 7r(n). -2n2 + 4n - 7 Let p(m) = 2m2 + 2m + 1. Let h = 1 - 2. Let q(i) = 0 - 1 + 0. Suppose 26 = -15f + 11. Calculate fq(v) + hp(v). -2v*2 - 2v Suppose 5t - t - 12 = 0. Suppose 3q + 2f = -tf + 5, -5f = 4q - 10. Let b(h) = -11h. Let p(s) = -16s. Give qp(z) - 7b(z). -3z Let z(w) = -2w*2 + 3w + 3. Suppose 0 = 76n - 83n + 140. Let f(x) = 15x2 - 23x - n + 2x + x. Determine 3f(a) + 20z(a). 5a2 Let s be (6 + -3 + 1)/2. Let f(l) be the third derivative of l6/40 + 5l4/24 + 2l*3/3 - 15l2. Let y(b) = -b3 - 2b - 2. What is sf(z) + 5y(z)? z3 - 2 Let m(s) = -165s*2 + 2s - 10. Let w(j) = -165j2 + 2j - 12. Calculate -6m(x) + 5w(x). 165x2 - 2x Suppose 2 = -t - 5m, -t + 96 = -5t + 2m. Let i = t - -23. Let g(c) = -1. Let k(x) = -x + 3. Calculate ik(w) + 3g(w). -w Let b(v) = 3v*2 + 7396v*3 - 3693v*3 - 3702v*3 - 2v. Let k(w) = -w*3 - 2w*2 + 2w. Let f = 11 - 8. Determine fk(c) + 2b(c). -c*3 + 2c Let n(p) = p + 2. Let w(y) = -9y - 15. Let v(a) = -6a - 10. Let z(f) = -7v(f) + 5w(f). Let b = 1289 - 1291. Calculate bz(l) - 5n(l). l Let m(d) = -43d + 13. Let o(t) = -88t + 29. Give 7m(a) - 3o(a). -37a + 4 Let g(n) = -n - 1. Let i(q) = 8q + 7. Suppose 15 = -4c - 1. Let l(s) = -s3 - 4s*2 + s + 1. Let w be l(c). Determine wi(y) - 21g(y). -3y Let y(l) = -2l + 4. Let r(n) = n - 1. Let q(k) = -k3 + 4k*2 + k - 8. Suppose -5p + 4 = w, 5w - 1 = 3p + 19. Let	{ "pile_set_name": "DM Mathematics" }
e -4b + 20 = -mb. What is the units digit of b? 0 Let s(b) = -b*3 - 5b*2 - 5b + 2. Let h be s(-5). Suppose hf - 23f - 148 = 0. What is the units digit of f? 7 Suppose -f - 168 = -5f. What is the units digit of f? 2 Suppose 4s = 3s. Suppose 6 = 3g - s. What is the tens digit of 18/(3/(-6) + g)? 1 Let s be (-4)/5(-30)/4. Let j = s - 4. Suppose -4 = -p - j. What is the units digit of p? 2 Suppose 9 = -2l - 5h, -l + 3h = -0l - 23. Let d = l - 5. Suppose -5n + 2 = -d. What is the units digit of n? 1 Let z = 102 + -75. What is the tens digit of z? 2 Let k(n) = -n - 2 + 2. Let t = 13 + -14. What is the units digit of k(t)? 1 Let t(y) = 45y + 4. What is the units digit of t(6)? 4 What is the units digit of ((-212)/(-5) - -2)(-4 - -9)? 2 Let x be 3/2 + (-3)/2. Suppose 5f + 3b - 50 = x, f - 3 = 2f - 2b. Suppose -5 = -o - u, -o = -2o + 2u - f. What is the units digit of o? 1 Let w(s) be the second derivative of -s5/20 + s4/3 + s*3/3 - 2s*2 - 4s. What is the units digit of w(4)? 4 Let z(b) = -b*3 - 3b*2 + b - 2. Suppose -10 = 2s - 2. What is the units digit of z(s)? 0 Let a = -13 - -18. What is the units digit of a? 5 Let q(j) = -3j3 + 23j*2 + 9j - 14. Let i(s) = s*3 - 8s*2 - 3s + 5. Let a(n) = 17i(n) + 6q(n). What is the units digit of a(3)? 1 Let p be (8/6)/((-2)/(-6)). Suppose pq = -5b + 127, b + 31 = 2b - 2q. Let u = b + -18. What is the units digit of u? 9 Let w(m) = -m*2 - 7m. Let t be w(-6). Let s = 31 - t. What is the units digit of s? 5 Let y be (-3)/(-2)8/6. Let f be 2 + (-1)/(-11). Suppose f = yi - 1. What is the units digit of i? 2 Let x = -181 - -302. What is the units digit of x? 1 Let f = -43 + 83. Suppose 0y + y - f = 0. Suppose 4p - y = -5u - 0p, -u - p + 7 = 0. What is the units digit of u? 2 Suppose 3q = 8 - 2. Suppose -qi = 2d + 2d - 42, 25 = -5i. What is the units digit of d? 3 Suppose -39l + 36l + 699 = 0. What is the tens digit of l? 3 What is the units digit of 1206/8 - (-1)/4? 1 Let v be 2/(3(-3)/(-18)). Suppose f + 13 = -5j, -j - vj = 5f + 25. What is the units digit of (f/((-6)/(-52)))/(-2)? 3 Let g = 12 + 24. What is the tens digit of g? 3 Suppose -2g + 2b + 112 = 0, -3g + 3b - 5b = -193. What is the tens digit of g? 6 Suppose -3x - 2x + 20 = 0. Suppose q = -xq - 10. What is the tens digit of (36/6)/(q/(-4))? 1 Let h(t) be the second derivative of 17t3/6 - t2/2 + 9t. Let y be 2/(-2)3/(-3). What is the tens digit of h(y)? 1 Let s = -3 + 4. What is the units digit of s(-2)/(-1)3? 6 Suppose 2i - 4m = -9m + 7, -21 = -3i - 4m. What is the tens digit of i? 1 Suppose -k = -62 - 3. What is the units digit of k? 5 What is the tens digit of (-7)/(-14/12)? 2 Let q be -1 - (-16)/(0 - -1). Suppose 0 = -2h + q + 5. What is the tens digit of h? 1 Let w = -22 + 46. Let b = 18 + w. Let t = -30 + b. What is the units digit of t? 2 Let s be (-1)/3 - (-10)/(-6). Let z(b) be the first derivative of -2b2 - 3b - 3. What is the units digit of z(s)? 5 Let g be 2/((-8)/(-6))-6. Let z = -5 - g. Suppose 0 = -zm - 3b + 13, -b - b - 3 = m. What is the units digit of m? 7 Let j be 10/(-8)(-1 - 7). Suppose -s = -6s + j. What is the units digit of s? 2 Suppose j = 6j - 25, 2k + 4j - 190 = 0. What is the tens digit of k? 8 Suppose -2t = -5h + t + 1137, 0 = -h - 2t + 217. What is the tens digit of h? 2 Let z be 7/((-28)/8) - -22. What is the units digit of z/1581/6? 8 Let v be (-40 - 1)(0 + -1). Let a = -3 + v. What is the units digit of a? 8 Suppose 0 = 2a - 0a - 4, -2w + 3a = 0. Suppose -n = -h + 9, -32 = -4h - wn + 32. What is the tens digit of h? 1 Suppose 2v - 6 = -2c - 0v, -2v - 12 = -c. Suppose 8i - 6i = c. What is the units digit of i? 3 Let q = 6 - 3. Suppose 14 = -qv - 4. Let a = v - -10. What is the units digit of a? 4 Let r(m) = -15m - 6. What is the units digit of r(-2)? 4 What is the units digit of 18/(-10)(-14 + 4)? 8 What is the tens digit of 3/18 - 539/(-42)? 1 Let g = -132 + 222. What is the tens digit of g? 9 Let y(n) = n*2 - 11n - 15. Let t(s) = -13s3 - s2 + 1. Let p be t(-1). What is the units digit of y(p)? 1 Let g(q) = 8q - 1. Let h be g(-1). Let d = -3 - h. What is the units digit of d? 6 Let m(d) = -d + 6. Let y be m(4). Let v be y1/(-4)-10. Suppose -vh + 14 + 16 = 0. What is the units digit of h? 6 Let k(q) = -1 + 9q + 3 - q*2 - 11. Suppose -4l + 16 = -8. What is the units digit of k(l)? 9 Let g = 8 - 6. What is the units digit of 43-1g/(-2)? 3 Suppose -5j + 172 = -33. Suppose 4m - 19 - j = 0. What is the units digit of m? 5 Suppose -n - 6 - 19 = 0. Let c be (-45)/n + 2/10. What is the units digit of (-17)/(-3) - c/(-6)? 6 Let u(d) = -d*3 - 9d*2 - 9d - 9. Let s be u(-8). Let q(y) = 1. Let z(l) = 2l + 6. Let f(m) = sz(m) - 8q(m). What is the units digit of f(-10)? 6 Suppose 8t + 16 = 10t. What is the units digit of t? 8 Let r(x) = x - 12. Suppose -3z + 21 = 3y, 3y - 23 = -3z + 2y. Let m be r(z). Let v = m + 13. What is the units digit of v? 9 Let r(l) = -18l - 1 + 24l - 2 - 2. What is the units digit of r(2)? 7 Let q(m) = m2 - 6. Let v(a) = a2 - 7a - 5. Let r be v(7). Let i be q(r). Suppose p = -2p + 2d + 16, i = 3p + d. What is the units digit of p? 6 What is the hundreds digit of (-2)/(-6)(809 - 20)? 2 Suppose 5b = -3h + 47, -3b + 3h = -0b - 33. What is the units digit of b? 0 Let a(z) = z3 - z2 - z + 2. Suppose 5j = -r + 16, j + 3r = -0j + 6. What is the tens digit of a(j)? 1 Let n be ((-45)/4 + 4)-4. Suppose n = 2m - m. What is the tens digit of m? 2 Let k be (-6)/(-3)(4 - -6). What is the units digit of ((-15)/k)/((-1)/48)? 6 Let o be -2 - (-2 + 3 + 3). Let z = 7 + o. Suppose 2w - 7 = -z. What is the units digit of w? 3 Let f(m) = 17m*2 - 4m + 13. What is the tens digit of f(3)? 5 Let d(v) = v*2 - 2v - 3. Let s be d(-2). Suppose 9i - 4i = 3q + 39, sq = -15. What is the units digit of i? 6 Suppose 2n - y + 2y + 39 = 0, -3n = -3y + 36. Let a = -11 - n. What is the units digit of a? 6 Suppose -5i + 5y + 45 = 0, 3i - 27 = 5y + 10. Suppose -3f = 4l - 93, 3f - 3l = -il + 102. Suppose -s + 6s = f. What is the units digit of s? 7 Let n(z) = z*3 - 9z*2 - 2z + 9. Let w be n(9). Let i = w - -16. What is the units digit of i? 7 Let y = -67 - -128. Suppose 0 = 9t - 14t. Suppose -3x - 16 + y = t. What is the units digit of x? 5 Let q = 21 - 15. Let w be 184/q + (-2)/3. Suppose 5l + 4p - 14 - 1 = 0, -5l - p + w = 0. What is the units digit of l? 7 Let r(x) = -x*3 - 7x*2 - 6x + 6. Let z be r(-6). Suppose 3k + 7 = 6k + 2s, -z = -3s. What is the units digit of k? 1 Suppose -4d = -5d - 5t + 55, 0 = -5d - 2t + 344. What is the tens digit of d? 7 Let o = 99 - 58. Let j = -20 + o. What is the units digit of j? 1 Let c(f) be the second derivative of -f5/20 - f4/3 - f3/3 - 3f*2 - f. Suppose 2y - 3p = -y, -4p - 4 = -3y. What is the units digit of c(y)? 2 Let b(c) = 6c - 38. What is the units digit of b(7)? 4 Let g = 6 + -3. What is the units digit of 24/g + (0 - 2)? 6 Let b = -18 - -30. What is the tens digit of b? 1 Suppose 5u + 3 = 3l, -4l - 3u - 2 = -6. Let a(y) = -5 - l + 3y - 13y - y2. What is the units digit of a(-9)? 3 Let n(v) = -v3 + 11v2 - 4v + 3. What is the tens digit of n(7)? 7 Let i(o) = -o - 11. Let w be i(-4). Let u(l) = -3l + 5. What is the tens digit of u(w)? 2 Let t(p) = 5p*2 + 9p + 8. Let j(g) = g*2. Let x(l) = 4j(l) - t(l). Let z be x(-7). Suppose -4c = -c - z, -9 = -u - 2c. What is the units digit of u? 5 What is the tens digit of (3 - (-1200)/5) + 22? 4 Suppose 0 = 2s - 4s. Let k(l) = -l2 - l + 3. What is the units digit of k(s)? 3 Let a = -36 + 26. What is the units digit of (-2 + 3)/((-2)/a)? 5 Let t = 61 - 10. What is the tens digit of t? 5 Suppose -835 = -5g - 3q, 6q + 530 = 3g + 2q. What is the hundreds digit of g? 1 Let a(n) = -n*3 - 7n*2 + 9. Suppose 2z - 68 = -2z. Let v = 10 - z. What is the units digit of a(v)? 9 Suppose u = 6u. Let n(k) = k*2 - 5k + 6. Let m be n(4). Suppose g + mg - 18 = u. What is the units digit of g? 6 Suppose 22k = 26*k - 568. What is the units digit of k? 2 Let f = 40 - 10. What is the tens digit of f? 3 Suppose	{ "pile_set_name": "DM Mathematics" }
positive. r(-1318/37) Simplify ((((d/((d/d(1/17))/d))27)(-31/3))(1/25))(1/14) assuming d is positive. d*(-2511/2975) Simplify (cc/c(-1/3))/c(-2/5)c(2/11)ccc/(c(cc*6)/c)c(2/11)/c(1/10)(c1)48 assuming c is positive. c(15509/330) Simplify (w20/w)(1/24)w*17/((w((w*7w)/w)/w)/ww) assuming w is positive. w(259/24) Simplify ((c/c2)(2/123)(c*2c)23)/(c4/c(3/4))(-7/5) assuming c is positive. c(180893/2460) Simplify ((s3/((sss27)/s))/(s30ss*(-37)s))(-1/29) assuming s is positive. s(20/29) Simplify (i2/i(-1/4))*(-10/11)/(((ii(-6))/i1)/(i(-1/3))(1/30)) assuming i is positive. i(1952/495) Simplify ((b/(b/(b(-13)/b))bb(b/b(-3))/b)/(b(-5/2)/((b(-13)b)/b)))(-1/31) assuming b is positive. b(39/62) Simplify (d/(d/d*(-3)d))/(d*(-2/11)d)d(-6)dd3((d*(-2/5)d)/d)(-1/8)/(d(-1/5)d(-3/2)) assuming d is positive. d(-223/44) Simplify ((d/d9d/((ddd(-1))/d))/(d(-4)/d)(-6/13))(2/13) assuming d is positive. d*(-242/169) Simplify (((i(ii(ii4i)/i)/ii)/i)26/((i/(iii7i)i)/iiii*(-1/3)i))(1/40) assuming i is positive. i(113/24) Simplify ((((g(gg*(1/4)ggg)/g)/g)/gg3gg/(g6/g)g(-2/5))(-6/5))46 assuming g is positive. g(-2553/25) Simplify ((a*(-1/9)/(((a/(aa*7))/a)/aa))/(aa(2/9))(3/35))(-6/11) assuming a is positive. a(-4904/1155) Simplify (y4/yyy(-9)y)/((y*(-1)/yy)/(yy/(y/(y/(y/y(-2))))yyy))yy*(2/11)y*(-1/4)/y((y*(2/7)y)/y)(10/7) assuming y is positive. y(-1423/2156) Simplify ((g(gg0)/g)34)*42(g*(-2/17)g/(gg(g/(g*(-3)gg))/gg))/(g(g(-2/5)/g)/g)15 assuming g is positive. g(24580/17) Simplify (l/l(-1)llll7)(5/7)(l/((ll(1/6)l)/l)(l/l(-1/5))/l)(-34) assuming l is positive. l(781/105) Simplify ((a(-1/8)/a(-2/5)(aa/(a/(a0/a))a)(-7/3))(-6/11))(2/31) assuming a is positive. a(247/3410) Simplify ((y*5y)/y*(-1))/(y/(y/(yy/y(2/5))))(26/7)((y/(yyyy*(-1/4)y))/yyyy(-1/8))/(y(3/5)/(y(-3)y)) assuming y is positive. y*(-957/280) Simplify ((c(c*3c)/c)(1/71)/(c(-13)/(c/(((cc/c(1/7))/c)/c))))4 assuming c is positive. c(28228/497) Simplify (((h(-3)h)/hh)/(h/h(4/9)))50/((h(h*0h)/h)(-26))47 assuming h is positive. h(9848/9) Simplify ((w/(w/w1))/w)33/(w5/(www/((w/(ww(4/3))w)/ww)w))(w3w(1/3))(8/5) assuming w is positive. w(14/3) Simplify (n(1/2)/nn)(-35)(n1)(-4)(n(-1))(-5/7)((nn/n1)/n)15 assuming n is positive. n(-291/14) Simplify (l/l(-16/3)l)*(-32/5)(ll(6/19))/lll43 assuming l is positive. l(-746/285) Simplify ((pp(-3))/(p(2/9)/p))/(p*(-2/11)pp/(p(3/4)p))pp/p*2ppp*(3/2)/p(p*(2/3)pp)(-1/11) assuming p is positive. p(383/396) Simplify (a(-3/5)(a/(aa(2/9)))/a)/(a(1/5)a*(3/7))(a/a*(1/2))/aaa(1/4)a*3/aaa/(a(a*6aa)/a)a assuming a is positive. a(-5923/1260) Simplify (a(1/5)a)/a(-3)a/(a*(1/2)/a)a*(-5)(a*(4/3)a/a*(-1/8)a)(-2/179) assuming a is positive. a(7103/10740) Simplify ((((p(-5/3))15)(-7/11))6)(-16/5) assuming p is positive. p(-3360/11) Simplify (h*(-2)h*(-1/10))/(hh*1hh)(-21)h*(-7)(hhh*(-1/3))/hh*7/(hh(-4)) assuming h is positive. h(2567/30) Simplify (x*(-3)xx(1/3)x)*37((xx/(xx*(-2/13)))/(xx*(-3/2)))/(xx/(xx/(x2x)xx)xxx3) assuming x is positive. x(-2263/78) Simplify (j(j*(1/2)j)/jj(-6))/(j(-1)/(j(j((j/(jj/(jj(2/15)j)j))/j)/jj)/j))(jj(-2/7))(-2/17)/(j/j*(1/7)j/j1) assuming j is positive. j(-2197/510) Simplify ((q/(qq(-1/5))q)27)(1/31)/((q(-2/5))(-8/7)/((qq5)/(((qq0)/q)/q))) assuming q is positive. q(8233/1085) Simplify (t(-2/7))(41/2)/((t(t/(ttt(t/t*(2/13))/tt))/t)/t*4)(t*(-3/2)/(ttt(4/5)))(-38) assuming t is positive. t(74797/455) Simplify ((n(-2/5)/(n2/n))/(n(-2)n5))/(n(1/5)/(nn(2/7)nn)((n(2/7)/n)/n)43) assuming n is positive. n(362/5) Simplify (l(-2/3))29/((l(-3/7)/l)/(l/(lll*(-2/9)l)))((l/((ll/l*(2/13))/ll)l)/l(-5))/(l(1/3))10 assuming l is positive. l(-14629/819) Simplify (((s/(ss(-1/17)))/s)(-32)/(s*(3/2)s)(-13))42 assuming s is positive. s(44709/17) Simplify (w(-4))(-10/13)/((w(2/21)/w)/(w/((w/(w/(w/w*(-2/35))w))/w))) assuming w is positive. w(8087/1365) Simplify (k/(((k3/kk)/k)/k)k/k*(-3)(k/k(-1))(7/5))(-1/17) assuming k is positive. k(-2/5) Simplify ((qq/(qq*31)q)/q)*2(qq(-35/4)/q)/(q/(q(-8/13)/q)) assuming q is positive. q(-3711/52) Simplify ((r(-5/6)rr(-1/16))/(rr/(r((r(-9)r)/r)/rrr)(r(2/5)r)/r))(-4) assuming r is positive. r(2231/60) Simplify ((f/(f/(f/f*(-2/21))))/ff(f/((ff*(2/149)fff)/ff))/f)/(f(-10/7)/f)(-3) assuming f is positive. f(-31928/3129) Simplify (((tt(-2/59))/(t/t(2/13)))/(t(5/6))(-3))(-37) assuming t is positive. t(-148703/1534) Simplify (j38/(j/(j/j(2/7)))(j(-12/7)/j)(2/21))17 assuming j is positive. j(93602/147) Simplify (f(-2/5))1f0/(f/f(-6)f)(f*(1/2)f/(fff*(-1/11)ff))48 assuming f is positive. f(-6822/55) Simplify (n/(nn/(n/n*(-4))n)nnn/(n(-2)/nn))*(-7/2)((n*(2/19)n)/((n(n(-2)/n)/n)/n))(-42) assuming n is positive. n(-4606/19) Simplify (h(2/9)/((h/(h((h(h(-8)/hh)/h)/hh)/h))/h))(-44)(h*6h7/h)/((h/(((h/h6)/h)/h))/(h(-5)/h)) assuming h is positive. h(3062/9) Simplify (v/(vv(8/5))v*(-3)v(14/3)/v3)(27/2) assuming v is positive. v(-198/5) Simplify ((f(-2/5))(-1/25))*28(ff(-2)f2/f)(4/3) assuming f is positive. f(56/125) Simplify ((y(-15))(-13)/(y2)(-32))(-8/19) assuming y is positive. y(-2072/19) Simplify ((r/r(-1/6)r(4/9))/(r6/rr6))/((r1)*4rrr*2rrr/(r(-3/2)/r)) assuming r is positive. r(-206/9) Simplify ((((i/(i*2ii))/i)40/(i(2/7))(3/19))(1/52))21 assuming i is positive. i(-31929/494) Simplify ((w/(www(1/4)w))(-4/19))(12/7)(w/(w2w)w(-4))20 assuming w is positive. w(-15852/133) Simplify ((a(-2/7)/a)34(a/(a*5/a))/aa(3/5))(-49) assuming a is positive. a*(11543/5) Simplify (ll/(ll34)lll)/ll/(l/(l/l31))(lll22)/(l/((l/l(-31)ll)/ll)) assuming l is positive. l(-4) Simplify ((kk(kk(-2)/k)/k)40)41/(k/k(2/9)kk*(-2/3)(kk/k1)21) assuming k is positive. k(-14959/9) Simplify (q(-1/3)/q)(2/21)(q*2q)/qq/(q3q)q/(qqq1)q*6(q*(1/3)/qq)(-2/57) assuming q is positive. q(3425/1197) Simplify ((f1)(2/7)(f/((ff(2/13)/f)/f))/f5)/(((f/(ffff(2/7)f))/(fff*(-1/5)))/(fff(2/7)f)(1/3)) assuming f is positive. f(646/195) Simplify ((m(-4/25)/m(-11/2))/((m/m(-37))/m(7/3)))(-38) assuming m is positive. m(86431/75) Simplify (hhh1)/h(3/11)(h(1/4))(-32)h*(-1)h*(-1/5)h/(hh/h(2/9))h(-4/5) assuming h is positive. h(-797/99) Simplify v/(vv(3/10))vv6(v/((v*(-2/7)/vv)/v))*8((v(2/9))(3/4))(-3/29) assuming v is positive. v(25343/1015) Simplify (((v(1/3))(-2/39)/(v*(-2/7)vv(-2/5)v))(-16))(8/3) assuming v is positive. v(697856/12285) Simplify ((b/((b/b3)/b))/b*(-3)(bb1/b)/bb/b4)/(b0b(-2/11)bb/(b/((b(-1/4)/b)/bb))bbb5) assuming b is positive. b(-113/44) Simplify (((f(14/5)f)/(f/(f*(8/5)f)))/(f*(-12)/(f/((f(f/(ff(2/15))f)/f)/f))))(-7/5) assuming f is positive. f(-1946/75) Simplify ((q(-6/7))50/((qq(1/18)q)/((q/q(-11))/q)))(8/3) assuming q is positive. q*(-17092/189) Simplify ((gg/(g/g*(-2/27)g))/gg(2/3))/(g(1/3))(5/4)(gg(-5)ggg(gg/(g/g*4)g)/gg)/(((gg4)/g)/(g(-4)g)) assuming g is positive. g(-305/108) Simplify ((o(1/3)/oo)*(7/10)(oo(-10/7)oo)(-4/25))(2/37) assuming o is positive. o(-19/19425) Simplify (w6ww(2/17)w)*50(w/w*(-1)ww/(w/(w/(w(ww/(w/((ww*(-1)w)/w)))/w)))w)/((w/w0)/(w8/w)) assuming w is positive. w(7070/17) Simplify ((v/(vv*3)v)/vv/(vv/v*(-2/15))v)24/((v/(((v(-2)/v)/vv)/v))/(vv*(4/3)/v)	{ "pile_set_name": "DM Mathematics" }
+ 20. Let r(a) = -2a + 13. What is -5i(f) + 8r(f)? -f + 4 Let v(s) = -s. Let b(i) be the third derivative of 3i*4/8 - 4i*2. Determine b(r) + 6v(r). 3r Let a(h) be the second derivative of 0 + 0h*2 - 7/12h4 - h3 + h. Let y(v) = 0v + 5v*2 + 7v + 3v2. What is 7a(t) + 6y(t)? -t2 Let g be (-7)/((-35)/10) - 4. Let i(n) = n3 + 2n*2 - 4n + 3. Let r(k) = k3 + k2 - 3k + 2. Give gi(o) + 3r(o). o3 - o2 - o Let u(x) = x + 1. Let q(w) be the first derivative of w2/2 - w - 52. Calculate -q(y) + 2u(y). y + 3 Let m(b) = 6b2 - 3b - 2. Let a(y) = -13y2 + 7y + 4. Give 3a(z) + 7m(z). 3z2 - 2 Let l(u) = 9u*3 + 2u*2 + 2u - 3. Let p(y) = 36y3 + 9y*2 + 9y - 12. Calculate -9l(h) + 2p(h). -9h3 + 3 Let g(o) = o. Let i(q) = 3q. Let n be 1/(2(-3)/6 + 0). Calculate ni(b) + 6g(b). 3b Let r = -17 + 5. Let k be (-5)/((-15)/r) + 3. Let c(t) = 5t + 6. Let w(j) = j + 1. Determine kc(g) + 6w(g). g Let f(g) = 2g*3 - g - 6. Let n be (2 - (-3)/6)-2. Let d(q) = 2q3 - q - 7. Determine nd(m) + 6f(m). 2m*3 - m - 1 Suppose 0 = -2k - 1 + 3. Let t(a) = a3 - a2 - a. Let m(i) be the third derivative of -i6/24 + i5/15 + 5i4/24 + i2. What is km(u) + 4t(u)? -u3 + u Let s(w) = 1. Let k = -14 - -13. Suppose 3 - 8 = -5b. Let z(f) = f + 1. What is bs(x) + kz(x)? -x Let w(u) = u*2 - 1. Suppose -30 = -i + 6i. Let q be (-1 - -4)(-34)/i. Suppose 4r + 8 = 3h, r + 0r = -4h + q. Let k(d) = 2d*2 - 3. Give rk(n) - 3w(n). -n2 Let l(t) = -t - 1. Let o(j) = j2 - j + 4. Let g be o(-3). Let f(i) = -20i - 16. Calculate gl(r) - f(r). 4r Let q(s) = 8s. Let o(l) be the first derivative of l2/2 + 1. Suppose 3p + 4 = -a, -8 = 4a + 3p + p. What is aq(y) + 10o(y)? 2y Let f(j) be the third derivative of j5/120 + j3/2 + 2j*2. Let d(v) be the first derivative of f(v). Let b = -8 - -10. Let q(l) = -l. Give bq(k) + 3d(k). k Let z(t) = -16 + 0t + 4t - 17 + 36. Let o(g) = 2g + 1. Determine 5o(a) - 2z(a). 2a - 1 Let l(u) = 9u. Let p(c) = -5c + 6c + 13 - 13. Give l(j) - 4p(j). 5j Let z(o) = 9o3 + 7o + 5. Let r(a) = 13a3 + 10a + 7. Suppose -3j = 2j - 4q + 29, 0 = 2j - 5q + 15. What is jr(g) + 7z(g)? -2g*3 - g Suppose 0 = -5v + 6v - 2. Let j be ((29 - 4) + -3)/v. Let d(l) = 3l. Let r(y) = 16y. Calculate jd(z) - 2r(z). z Let k(o) = o2 + 3o. Let c = -7 - -3. Let j(d) = 4d. Calculate ck(f) + 3j(f). -4f*2 Let n(h) = 7h*2 + 6h. Suppose -4d - 6 = -5d. Let s(v) be the third derivative of 2v5/15 + 7v4/24 - v2. Determine ds(g) - 7n(g). -g*2 Let v = 3 - 5. Let t = 2 + v. Let q(f) = 0f + 4f + tf. Let x(b) = b. Determine -3q(w) + 10x(w). -2w Let a be -4 - -1 - (-2 - -2). Let x be 5/(-1 - 1 - a). Let u(y) = 5y*2 - 6 + 6 + y + xy + 6. Let z(n) = 11n2 + 13n + 13. Give -13u(s) + 6z(s). s*2 Let n(u) = 1 - 10u + 11u + 2 - 4. Let a(l) = -l + 4. Suppose -8 = -5k - i - 2i, 0 = -5k + 5i. What is ka(g) + 3n(g)? 2g + 1 Let z(q) = -2q2 - q - 1. Suppose 0i + i = 5l - 6, -i + 4 = 0. Let n = l + -2. Suppose -5u = -nu + 35. Let f(g) = 3g*2 + 2g + 2. Give uz(c) - 4f(c). 2c2 - c - 1 Let n(i) = i2 - 1. Let a(z) = -6z*2 - 3z - 4. What is a(u) + 4n(u)? -2u*2 - 3u - 8 Let u(y) = -4y3 + 3y*2 + 5y - 5. Let p = -4 + 3. Let f = -5 + p. Let x(z) = -4z2 + 6 + 2z*2 - 6z + 5z3 - 2z*2. Give fu(r) - 5x(r). -r3 + 2r*2 Let y(u) = -85u*3 - 10u*2 + 11u. Let q(p) = -17p3 - 2p*2 + 2p. Determine -11q(w) + 2y(w). 17w3 + 2w*2 Let s = 1 - 1. Suppose 5g = -sg + 10. Let v(k) = -k + g - 5 + 2 + 0k. Let i(z) = z*2 + 6z + 6. Calculate -i(q) - 6v(q). -q2 Let i(v) = -6v - 27. Let w(j) be the second derivative of j*3/6 + 2j*2 - 5j. Calculate 4i(m) + 27w(m). 3m Let s(v) = -3v*2 + 4v + 4. Let f be (-1 + 3 + -3)3. Let r(p) = 2p*2 - 3p - 3. What is fs(j) - 4r(j)? j*2 Let n(s) = -16s + 5. Let j(v) = 15v - 4. Calculate -6j(g) - 5n(g). -10g - 1 Let k(a) = 2a3 - 3a + 1. Let u(g) be the first derivative of 3g4/4 + g3/3 + 1. Let w be u(-1). Let d(s) = -2s*3 + 2s - 1. Give wk(c) - 3d(c). 2c3 + 1 Suppose 0 = -l - l + 6. Let u(s) = 9s2 + sl - 9s2 + 3s + 3. Let x(w) = 2w3 + 7w + 7. What is 14u(q) - 6x(q)? 2q3 Let v(g) be the third derivative of -g5/60 + g4/12 - g3/3 + 21g2. Let k(x) = -x2 + x - 1. What is 6k(h) - 3v(h)? -3h2 Let y(n) = n2 - n - 1. Let i(r) = 7r*2 - 4r - 12. Give i(d) - 4y(d). 3d*2 - 8 Let a(o) = -51o + 5. Let c(v) = -76v + 7. Determine -7a(w) + 5c(w). -23w Let g = -2 - -6. Let k(m) = 3m + 4. Let w(t) = -6t - 7. Give gw(x) + 7k(x). -3x Let u(o) = 5o2 + 25. Let i(n) = n2. What is 4i(b) - u(b)? -b2 - 25 Let m(w) = 1. Let c = 1 + 0. Let x(n) = n3 + 5n*2 + 3n - 2. Let k be x(-4). Let a(r) = 7 - kr + 4r - c. Give a(z) - 6m(z). 2z Let v(c) = -2975c3. Let o(y) = -31y*3. Determine -385o(t) + 4v(t). 35t*3 Let w(v) = 4v*2 - 5v - 7. Suppose t + 5 = -1. Let i(o) = 5o2 - 6o - 8. Determine ti(u) + 7w(u). -2u2 + u - 1 Let j(o) be the third derivative of o3/6 - o2 - 41o. Let i(x) = -x + 2. Let r = -9 - -13. Determine rj(b) - i(b). b + 2 Let c(p) = -p2 + p - 1. Let n(d) = 12d*2 - d + 1. What is 2c(o) + n(o)? 10o2 + o - 1 Let t(y) be the third derivative of -y4/12 + 2y*3/3 + 4y*2 - 5. Let n(g) = 2g - 3g + 4 - 2. Determine -7n(m) + 3t(m). m - 2 Suppose 3h - 4c - 16 = 0, -c = 3h + c - 10. Let n(b) = 4 - 2b2 + 4b*2 + 7b - h + 4. Let x(m) = -3m2 - 11m - 6. Give 8n(i) + 5x(i). i*2 + i + 2 Let d(j) = -8j + 14 - 10 + 10j. Let f(g) = 5g + 11. What is -11d(a) + 4f(a)? -2a Let n(w) = 3. Let l = 11 - 19. Let h(m) = -m - 8. Calculate ln(a) - 3h(a). 3a Let g(i) = 2i2 + 6i - 4. Suppose -5n = -0n - 20. Let f = -11 - -18. Let b(p) = -4p2 - 11p + 7. Give fg(o) + nb(o). -2o2 - 2o Let g(x) = -3x - 5 + 4 + 7 + 3. Let d(r) = -r + 4. What is -5d(z) + 2g(z)? -z - 2 Let i be -2-210/8. Let b(p) = 7p*2 + 5p. Suppose 0 = -4n + 4y + y + 18, -2y = 2n. Let j(k) = 15k2 - k + 4k - 11kn. Determine ij(o) - 3b(o). -o2 Let b be 5 - 2 - 0 - -9. Let q(p) = -p - 4. Let m(h) = -1. Determine bm(r) - 3q(r). 3r Let u(j) = 4j2 + 2j + j*2 + 5 + 0j*2. Let h(w) = -4w*2 - w - 4. Let c = -10 + 7. Let f be 3/(c/2) + -1. Determine fh(d) - 2u(d). 2d*2 - d + 2 Let y(r) = 19r*2 + 11r + 19r2 - 33r2. Let v(w) = -w2 - 2w. Calculate -22v(l) - 4y(l). 2l*2 Suppose 8 = 5t - 4y - 9, 3y = -2t - 7. Suppose -5l - 5 - 20 = 0. Let j(i) = -4 + 2i - 3i - i. Let q(r) = -1. Determine lq(a) + tj(a). -2a + 1 Let v(k) = -6k*3 - 3k + 4. Let h(t) = 18t3 + 8t - 11. What is -4h(l) - 11v(l)? -6l3 + l Let a(s) = -s + 1. Let v(n) = 3n - 2. Suppose 2d - 3m = -1 + 3, -11 = 3d - m. Give da(i) - 2v(i). -i - 1 Suppose -f - 9 = -5. Let o(x) = -x2 - 4x - 4. Let h(d) = -d*2 - 3d - 3. Determine fh(i) + 3o(i). i*2 Let k(l) = l. Let r(n) = -5n - 6. Calculate -6k(a) - r(a). -a + 6 Let r(w) = -25w + 5. Let v(q) = -51q + 9. Calculate 5r(p) - 3v(p). 28p - 2 Let u(b) = 12b3 - 4b*2 - 7b - 7. Let y(i) = 4i3 - i2 - 2i - 2. Let c(j) = j*2 + 11j + 17. Let x be c(-10). Calculate xy(z) - 2u(z). 4z3 + z2 Let i(x) = 3x - 9. Let k(o) = -4o + 4 + o + o + o. Suppose -1 - 3 = -u. Let r be u + -1 + 8/(-1). Determine rk(n) - 2i(n). -n - 2 Let v(x) = -3x*3 + 3x*2 + 3x - 3. Let k(s) = -9s3 + 8s*2 + 8s - 8. What is -3k(f) + 8v(f)? 3f3 Suppose -4x + 4f - 8 = 0, -x - 2f - 14 + 3 = 0. Let d(w) = -5w2 - 7w - 2. Let m(b) = 4b2 + 6b + 2. What is xd(a) - 6m(a)? a*2 - a - 2 Let y(c) = 2c + 1. Let v(k) = k - 1. Calculate 2v(q) + y(q). 4q - 1 Let k(l) = 2l2 - 4l - 6. Let o(f) = 3f2 - 8f - 12. Let z(a) = -5k(a) + 3o(a). Let b(r) = 3r2 + 9r + 13. Give 4b(c) + 9z(c). 3c2 - 2 Let b(o) = o + 1. Let u be b(5). Suppose 3d - 3 = -0d. Let h(j) = -5 + 3 + 2 - d. Let a(f) = -2f + 7. Give uh(l) + a(l). -2l + 1 Let q(j) = 2j2 + j + 2j - 4 - 8j. Let u(r) = -r2 + 3r + 2. What is -4q(w) - 7u(w)? -w*2 - w + 2 Let x(y) = 5y**2. Let h(q) be the first derivative of q	{ "pile_set_name": "DM Mathematics" }
kg + x and give k. 8 Rearrange -10y*3 - 2y*2 - 3y*3 - 11y*3 - 2 + 19y*3 to the form ay + uy3 + i + py*2 and give i. -2 Rearrange -1 + 4x*2 + 3 + x - 4 to the form kx*2 + jx + t and give t. -2 Rearrange -26k2 + 28k - 28k to dk + b + mk2 and give m. -26 Express -6o - 2 + 8o + 4o + 11o as ro + x and give x. -2 Rearrange (m*2 - 4m*2 + 2m*2)(-2m + 3 - 3)(14 + 5 + 14) to the form bm3 + r + am + um2 and give b. 66 Express -20i + 25i + 43i in the form ai + o and give a. 48 Rearrange -13q*2 + 2 + 31q*2 - 15q*2 - 4q to hq + o + dq*2 and give o. 2 Express -30k*3 + 12 - 8 - 2 in the form fk + uk3 + o + pk*2 and give o. 2 Express 5b*3 + 4b + 5b3 - b2 - 8b*3 in the form lb + wb3 + t + db*2 and give l. 4 Express (2h - 3h - 2h)(0h*2 - 5h*2 + 3h*2)(6 - 9 - 7)(-4 + 1 + 2) as j + oh*3 + zh*2 + ph and give o. 60 Rearrange (-1 + 1 + 1)(-5u*2 + 2u*2 + 2u2) - u2 - 4u2 - 5u*2 to pu*2 + au + z and give a. 0 Express -30s3 + 2 - 11s*3 - 12s*3 as js*2 + os*3 + p + zs and give o. -53 Express (-2 - 2r + 2)(1544r - 1544r - 3 + 73r2) as cr + yr2 + k + wr*3 and give c. 6 Rearrange 9 + 3 + 2 + 14 - 2y to the form ay + s and give a. -2 Rearrange -2s - 8s3 + 9s3 - s2 + 2s - s + 5 to the form os*3 + cs*2 + ns + p and give p. 5 Express -m + 38 - 19 - 16 + (2 - 4 + 0)(2m - 3m + 2m) in the form b + zm and give b. 3 Rearrange -24h - 20h - 38h to the form i + uh and give u. -82 Rearrange 7k*3 - 32k + 59k - 29k + k*2 to the form mk*2 + zk + s + rk3 and give z. -2 Rearrange (9 - 7 + 6)(-20h - 5h + 11h) to mh + b and give m. -112 Rearrange 6g - 4g + 1 - 6g4 - 4g3 + g3 + 2g3 to ng + v + cg3 + ig*4 + yg2 and give n. 2 Express -c + c2 + c + (3 - 2c - 3)(3 - 3 + 2c) + 3c*2 - 2c*2 + 0c*2 as lc*2 + zc + x and give l. -2 Rearrange (6v3 - 2v*3 - 2v*3)(-8v - 13v + 0v) to the form dv + gv4 + jv*2 + a + hv*3 and give g. -42 Rearrange -22c*4 + 23c*4 + 2c - 4c + 6 to the form p + wc + vc3 + dc*2 + hc*4 and give h. 1 Express (-8 - 3 + 3)(-3 + 3 - 1)(a - 3a + 3a) in the form la + y and give y. 0 Rearrange -2 + 6i2 - i3 + 2i*3 + 3i*2 to the form li*3 + hi*2 + ui + r and give h. 9 Express -41g - 26g + 38g in the form f + wg and give w. -29 Rearrange 1 + 2j4 + 65j + j*2 - 65j to the form cj4 + fj*3 + kj + gj2 + q and give g. 1 Rearrange (-j - j + 0j + (-2j + 4 - 4)(1 - 3 + 5))(-j + 3j - 4j)(-4 + 1 + 5) to the form z + pj2 + sj and give p. 32 Express -j + 2j4 + j + (2 - 2 - 2j)(j2 - 9j*2 - 38j*2)(2j - j - 4j) as yj2 + v + ij + gj4 + aj*3 and give g. -274 Express (-3v*2 + 2v*2 + 5v*2)(5 - 2 - 4v - 4) in the form hv + pv3 + nv*2 + a and give h. 0 Express (2j - j - 4j)(5 - 5 - 6j) + (j + 4j - 2j)(-1 + 1 - 2j) - 2j2 + j2 + 2j2 as w + oj*2 + dj and give o. 13 Rearrange -2z + 2z*4 - 953 + 6z*2 + 954 + 0z2 - z3 to fz + i + bz*2 + gz*3 + pz*4 and give f. -2 Express 3d + 10d - 3d + d + 4d - 4d + 2 - 2 - d + (-1 + 1 + 2d)(4 - 7 + 1) - 2d - 2 + 2 + d - 2d + 0d + 0 + 0 - d in the form nd + t and give n. 2 Rearrange -10 - 2f2 + 21 - f - 3f*3 - 11 to uf*2 + pf + a + hf3 and give u. -2 Express -3h*4 - 3h*2 + h - 7h*2 + 8h2 + h3 as nh4 + i + vh*3 + sh + jh2 and give n. -3 Express 20l*3 - 14l + 14l + 0l + l*3 + 0l + (7l - 3l - 2l)(-2l2 + 11l - 11l) in the form zl*2 + ql*3 + v + pl and give q. 17 Rearrange -790 + 3q2 + 800 - q2 - q to sq + dq2 + i and give d. 2 Rearrange (-n + 12 - 12)((0n3 + 2n*3 - 3n*3)(-4 - 2 + 4) + 13 - 29 + 15 - n*3) to gn*3 + fn*4 + in*2 + t + pn and give f. -1 Rearrange 25 - 25 + 13b to the form i + gb and give i. 0 Rearrange 2v3 - 3v*3 + 5v*3 + (8 - 8 + 4v)(-2v*2 + 2v*2 + 2v*2) to nv + p + mv3 + qv*2 and give m. 12 Express -16f*2 + 11f*2 + 11f - 13f2 - 9f in the form mf + c + vf*2 and give m. 2 Express 2g4 - g3 + 4g + 2g2 - g3 + g*3 in the form bg*4 + dg*3 + og*2 + zg + f and give z. 4 Express -255u - 61u - 137u + 209u + (-3 - 1 + 2)(u + 1 - 1) in the form z + gu and give g. -246 Express (34x - 90x + 154x)(-x + 3x - 3x) + x2 - x2 + 2x2 in the form ox + cx2 + z and give c. -96 Rearrange (-6 + 3 + 1)(2y3 - 3y*3 + 2y*3) to cy*2 + a + uy + ly3 and give l. -2 Rearrange -4g*3 + 1 + 5g*3 - 3g - 1 to the form kg2 + zg + ag3 + i and give a. 1 Rearrange 3d*2 - 7 - 18d*2 + 6d*2 + 7d*2 to qd + fd2 + u and give u. -7 Express -77 + 2k*3 - 4k*2 + 2k*4 + k + 77 as lk*2 + jk*3 + nk*4 + tk + p and give n. 2 Express 2x + 7 - 25x3 - x4 + 25x3 + 0 in the form qx*4 + nx*2 + yx*3 + w + bx and give b. 2 Express 2h2 - 3h*2 + 3h*2 + (-3h - 3h + 4h)(2h - 4h + h) + (4h + 1 - 1)(0h + 0h + h) in the form u + dh + wh2 and give d. 0 Express -2y*4 - 3y + 3 - 2y + 12y - 8y - 4y*3 in the form py*2 + wy*4 + h + sy + ay3 and give s. -1 Rearrange -58 + 16q*2 + 113 - 56 to l + tq*2 + iq and give l. -1 Express 9 - 9t3 - t4 + 3 + 10t*3 as s + bt*2 + zt + dt3 + ct*4 and give b. 0 Express (2c2 - c2 - 3c2)(4c + 0c - 3c) - 53c3 + 16 - c2 + 5 - 19 as p + wc + mc*2 + nc*3 and give p. 2 Express 5 + 6f*4 + 2f + 2f2 - 11f4 + f4 in the form sf3 + mf + bf4 + q + jf*2 and give b. -4 Rearrange -2k2 - 1 + k4 + 13k - k - 3k - 8k to the form gk*4 + qk + ck3 + ik*2 + f and give i. -2 Express (5 - 5 - 2u*3)(48 + 23u - 23 - 26) in the form pu + v + ku4 + ru*3 + qu*2 and give k. -46 Express 91j*3 - 8j - 45j3 - 42j*3 in the form qj*3 + mj*2 + z + sj and give q. 4 Rearrange -n4 - n4 + 0 - 1 - 2n2 + 0n*4 + 2n*3 to bn*4 + wn*2 + zn + kn3 + v and give w. -2 Rearrange -5c*2 + 32 - 32 - c to v + pc*2 + bc and give b. -1 Express -b*3 - 3b*3 + 6b*3 - 8b*2 as j + cb*3 + fb + yb2 and give y. -8 Rearrange 1 + 9 - 18 + 7 + 4b*3 to wb*2 + ub*3 + d + rb and give d. -1 Express (27 - 27 - 8h2)(-2h - 3 + 3 + (2h - h - 3h)(-1 - 1 + 0) + h + h + 0h)(-h - 3h + 2h) as jh + b + gh*3 + fh*4 + yh*2 and give f. 64 Rearrange -18k*2 - 5k*2 - 3327k + 3328k - 1 - 1 to qk*2 + bk + m and give q. -23 Express 2g3 - 3g*3 + 2g2 + g4 - 4g2 + 6 as kg + c + qg2 + bg*4 + xg*3 and give b. 1 Rearrange -16q - 2q - 12q + 3q + (1 + 2q - 1)(-1 - 2 + 1) to jq + p and give j. -31 Express 21o2 - 42o*2 - 4o*2 - 86o*2 in the form io*2 + po + q and give i. -111 Express -24r + 6r - 12r - 2r in the form c + ir and give i. -32 Express (w - 2w + 3w)((1 - 2 + 0)(-1 + 0 - 1) + 4 - 2 - 1 - 8 - 21 - 1)(2w2 + 5 - 5) in the form sw + yw3 + j + lw*2 and give y. -108 Rearrange -3 + 3 - x + 14x to u + mx and give m. 13 Rearrange 1 + 16m - 2 + 1 - 1 to l + jm and give l. -1 Rearrange 548 + 6m - 548 to the form nm + x and give n. 6 Rearrange (2i*2 - 3i*2 - 9i*2)(3i - 1 + 1)(-1 - 2i + 1) to the form zi*4 + ti + gi2 + bi*3 + p and give z. 60 Express -4j*3 + 2j - 4j2 - 5 + 4 + 3j*3 in the form sj*3 + mj*2 + kj + g and give g. -1 Rearrange k4 + k3 + 5 - 2k4 - 3 to sk*2 + i + xk*3 + fk + hk4 and give h. -1 Express -4r - 10r + 16r + 5r2 - 3r in the form f + kr + xr*2 and give x. 5 Express -3 + 10 - 3a + a4 + a2 - 11 as la + ja*4 + ba*3 + ua*2 + s and give j. 1 Rearrange (13z*2 - 13z*2 - 10z*4)(2 - 1 + 1) to the form cz2 + pz*4 + t + uz*3 + qz and give p. -20 Express (v - v + v)(15 + 9 + 3)(6v2 - 2v*2 - 3v*2) in the form rv*2 + m + wv + zv3 and give z. 27 Rearrange n2 + 26 + 31 + 5n*3 - 57 to ln*3 + gn*2 + vn + x and give v. 0 Express (0p2 + 0p2 + p2)(-8 - 9 + 0)(0p - 2p - 2p) as up*2 + jp*3 + k + np and give j. 68 Rearrange -2f - 17f*2 + 4f + 97f2 to lf*2 + cf + n and give c. 2 Express (-4 + 13v - 2v*2 + 18v - 35*	{ "pile_set_name": "DM Mathematics" }
684) + 1 - sqrt(684)) + 4(-2sqrt(684) + sqrt(684))))*2. -900sqrt(19) + 17325 Simplify (sqrt(208)2-6 + sqrt(208)-2-3 + sqrt(208) + 4)*2 + (0 + 1 + 2 + sqrt(208) + -11sqrt(208))2. -160sqrt(13) + 5225 Simplify -4 + 1sqrt(112)6 - ((sqrt(63) + 0)2 + ((sqrt(567) + -3 + sqrt(567))2 - sqrt(7))). -2344 + 133sqrt(7) Simplify 4 + (sqrt(45)2-5 - ((sqrt(4500) - -1sqrt(4500)) + sqrt(45)) - 1(sqrt(45)2 + -3))*2. -594sqrt(5) + 49018 Simplify 6(5(-2(sqrt(76) + sqrt(76) + 1 + sqrt(76)) - (1sqrt(76) + 0) - ((sqrt(76) - 6(sqrt(76) + 1)) + (-1 + sqrt(76))5)))*2. -37800sqrt(19) + 570750 Simplify 5 + ((5(sqrt(100)/sqrt(2) - sqrt(50)))/(sqrt(405) + -2sqrt(405)))/(4(-3sqrt(5) + sqrt(5)) + sqrt(720)). 5 Simplify ((sqrt(80)-1 + -2)2 + 1(sqrt(80) + sqrt(80)1)2 - (-2(1 + sqrt(80) - sqrt(80)) - sqrt(80) - 4(0 + sqrt(80))2))-6. -4356 - 120sqrt(5) Simplify (5(sqrt(144) - (sqrt(144) + -2sqrt(144)3))/(-2(sqrt(27) - sqrt(675))))2. 75 Simplify (sqrt(26) - (sqrt(26) - ((sqrt(208)-1)/sqrt(8) - sqrt(26))))/(sqrt(128)2) + -4 + 5(-4sqrt(1872) + sqrt(1872))2. -sqrt(13)/8 + 84236 Simplify 3 + 1(((sqrt(170) + -3sqrt(170) + sqrt(170))4)/(sqrt(1440) + (sqrt(1440)1 - sqrt(1440)) + sqrt(1440) + sqrt(1440)) + -1). -sqrt(17)/9 + 2 Simplify (((sqrt(114) - sqrt(114)-1)-2)/(sqrt(72)/(sqrt(24)/sqrt(2) + sqrt(12))) - 6sqrt(190)/(sqrt(10) - 2sqrt(10))6) + 4 + 1. 5 + 28sqrt(19) Simplify (-5(sqrt(28)/sqrt(4) + -1))*2 - (sqrt(847)-1 + 3) - ((3sqrt(77)-6 - sqrt(77)) + sqrt(77))/(-5(sqrt(11) + sqrt(44)/sqrt(4) + sqrt(11))). -201sqrt(7)/5 + 197 Simplify (3sqrt(2448)-2 - (-2 + sqrt(2448) + 5))*2 - ((sqrt(2448) + 5 + 3)2)*2. -264sqrt(17) + 109913 Simplify (2 + (4((sqrt(91)-1 - sqrt(91) - sqrt(91)) + sqrt(91))2)/(sqrt(84)/sqrt(3)-3))-5. -40sqrt(13)/3 - 10 Simplify (3((-3 + sqrt(117) + (4sqrt(117) - sqrt(117)) + -1 - -4(0 + sqrt(117) + sqrt(117))1) + 3))*2. -648sqrt(13) + 151641 Simplify ((sqrt(5040) - (3sqrt(5040) - sqrt(5040) - sqrt(5040))) + sqrt(1260)4)/((-22sqrt(84))/(-2sqrt(1200) - sqrt(1200))). 180sqrt(5) Simplify 4((sqrt(11) + sqrt(66)/sqrt(6))2 + 5 + 1) - (1sqrt(121)-5)/((sqrt(44) + sqrt(11))3). 5sqrt(11)/9 + 200 Simplify -4(-6sqrt(495)-3 - sqrt(495))/sqrt(11) - (-3((sqrt(2880) - (sqrt(2880) - (sqrt(2880) + 0)2)) + sqrt(2880)) + 0). -132sqrt(5) + 8640 Simplify 4((-51sqrt(204) + sqrt(204))/(-4sqrt(24)/sqrt(2)))*2 - 1(4 + -1 + sqrt(1377))*22. -2704 - 108sqrt(17) Simplify (3 + 1 + (sqrt(405)2 + sqrt(405))*2 + -4 + 4)-4-3. 43788 Simplify 6(sqrt(972)2-5 - -4sqrt(972)-1)/(4-1sqrt(324)-2). -21sqrt(3)/2 Simplify (((0 + sqrt(891)1)2 - (sqrt(891) - -1(sqrt(891) + sqrt(891)2 - sqrt(891)))) + (4(1sqrt(891))2 - -2(sqrt(891) - (sqrt(891) + 1)*2)))4. -180sqrt(11) + 10684 Simplify (-4(sqrt(77) - sqrt(77)-2))/(sqrt(22)/sqrt(2)-6) + 1 + (sqrt(112)1 + 2 - sqrt(112))2 + (-1 + sqrt(112) + 3)2. 18sqrt(7) + 121 Simplify -5((sqrt(3) + (sqrt(3) - sqrt(12)))2 + 0 + (4 + sqrt(3)1)*2) - (1 + (sqrt(147) - 6(-5sqrt(147) + sqrt(147)))2). -91971 - 40sqrt(3) Simplify ((-61sqrt(264))/(sqrt(6) + sqrt(18)/(sqrt(6)/sqrt(2))))*2 - (sqrt(44)-31 + sqrt(44) + -2 + sqrt(44)-2)*2. -312 - 32sqrt(11) Simplify ((-2(0 + sqrt(242)) - sqrt(242) - sqrt(242)) + 1 + sqrt(242) + 2 + (sqrt(160)/(sqrt(8)-2))/(-5sqrt(10)1))*2. -987sqrt(2)/5 + 108691/50 Simplify (-13(sqrt(99) + 3 + sqrt(99)-1 + sqrt(99)) + -1(11sqrt(99) + 3 + sqrt(99)-1))2 + -3. 216sqrt(11) + 1032 Simplify (2 + 2 + (-6(sqrt(176) + 2 + -3))2)1-2. -12752 + 576sqrt(11) Simplify (2 + -5 + -1 + (sqrt(245)-1 + sqrt(245) + 5 - (sqrt(245) + -2 + 5)))2 + -5. 28sqrt(5) + 244 Simplify (sqrt(14)/(-1sqrt(2)) - sqrt(252)-1) + (sqrt(448) + -1 + 2 + sqrt(448) + sqrt(448)1 + 0)2. 53sqrt(7) + 4033 Simplify 2(((62sqrt(405) - sqrt(405))-4 + -6(sqrt(405) + (sqrt(405) - (sqrt(405) + -4 + (sqrt(405) - (sqrt(405) + 1))))))3)*2. 486000sqrt(5) + 18241200 Simplify 4(0 + -1 + (5 + -1(1 + sqrt(72)) - -3(3 + sqrt(72)-1)))*2. -2304sqrt(2) + 5184 Simplify -2((-2 + sqrt(1216) + 4 - (sqrt(1216) + sqrt(1216)5 + -4)) + 4)*24. -244000 + 6400sqrt(19) Simplify (-4-1sqrt(77)5 + (sqrt(77) + sqrt(77)25 - (sqrt(77) - ((sqrt(77) + -2sqrt(77))-4 + sqrt(77)))))/((sqrt(84)1)/(-1sqrt(3)6)). -105sqrt(11) Simplify 4 + (2 + (-4 + (-6(sqrt(108) - (sqrt(108) + -1sqrt(108) + sqrt(108))) - (sqrt(108) - (sqrt(108) - (-2 + sqrt(108) + 1) - sqrt(108)))))5)2 + -2. 1560sqrt(3) + 10971 Simplify 6-2((sqrt(136) - sqrt(136)1)1 + sqrt(136) + -3-1sqrt(136))/((sqrt(16)-2)/sqrt(2) + -2sqrt(128)). 24sqrt(17)/5 Simplify (sqrt(51) + 1(sqrt(153)/sqrt(3) + sqrt(51)) + (sqrt(612)-2)/sqrt(12))/((sqrt(24) - (sqrt(1944) - (sqrt(1944)2 + sqrt(1944))))/sqrt(8)) + -3 + 0. -3 + sqrt(17)/19 Simplify (-5 + sqrt(325)2 + sqrt(325) + -4 + sqrt(325) + -1 + sqrt(325) - (-2 + (4 + (sqrt(325) - (sqrt(325) + 0) - sqrt(325)))-1))*2. -160sqrt(13) + 5216 Simplify (1sqrt(38)/(sqrt(8) + sqrt(8)1 + sqrt(2)))*2 - -2(sqrt(1216) + 1 + 3). 219/25 + 16sqrt(19) Simplify 5(6(sqrt(156) + -5sqrt(156)2 + 2sqrt(156)5))/(-41((sqrt(1200)-2 - sqrt(1200)) + sqrt(1200))). 3sqrt(13)/8 Simplify ((sqrt(1700)2 - sqrt(1700) - sqrt(1700)) + -1 + -4 - (-6-2sqrt(204))/(sqrt(12) - (-2sqrt(36))/sqrt(3))) + -1. -4sqrt(17) - 6 Simplify ((1(sqrt(30)-26 + sqrt(3000) + sqrt(3000) + sqrt(3000)-1))/(((1sqrt(18) + sqrt(18) + sqrt(18))-1 - sqrt(18))/(2sqrt(12)/sqrt(4))))2. 5 Simplify ((-1 + -4(sqrt(245) + 0 - sqrt(245)))6 + -6(6(sqrt(245) + -1) + sqrt(245) + (sqrt(245) - (-1 + sqrt(245))) + -1))2. -17640sqrt(5) + 433080 Simplify ((1(1 + sqrt(1100)) - (sqrt(1100) - (-5 + sqrt(1100)1)))*2 + (sqrt(22)/(-3sqrt(2)) + -4 + sqrt(11)-2)2)-4. -42908/9 + 736sqrt(11)/3 Simplify ((-22sqrt(104))/sqrt(8))21 - 5(-3 + sqrt(65)/sqrt(5))-3. 15sqrt(13) + 163 Simplify -6(((0 + sqrt(1377) + -3 - (-2 + (sqrt(1377) - -2sqrt(1377)))) + (5sqrt(1377)1 - (sqrt(1377) - (sqrt(1377)1 + -5 - sqrt(1377)))))*2 + 3). -33282 + 1296sqrt(17) Simplify (4 + (-2 + sqrt(567) + 5)1 - 5-15(-2 + sqrt(252) - sqrt(252)))*2. -774sqrt(7) + 2416 Simplify ((1 + sqrt(272))5 - (1 + -2sqrt(272)))*2 + (sqrt(272) + sqrt(272)4 + sqrt(272) + -4)*2 + 2sqrt(272)-2. 16sqrt(17) + 23152 Simplify 4 + (2 + sqrt(176) + -2 + ((-2 + sqrt(176) - sqrt(176)) + 5 - sqrt(176)) + sqrt(176))*2 + -5((sqrt(121) + 1sqrt(121)3)/sqrt(11))*2. -691 + 24sqrt(11) Simplify (-5-14((sqrt(847) + -3 + 0 - sqrt(847) - sqrt(847)) + -4 + -1 + sqrt(847))2)*2. 102400 Simplify 5-5(3 + sqrt(275) + sqrt(275) + -3 - ((sqrt(275) - -5-2sqrt(275)) + sqrt(275)))2-1 + -3. 687497 Simplify (sqrt(539) + -2)4 + sqrt(539)24 - ((-1 + sqrt(1331))2-3 + -4 + (sqrt(1100)1)2). 18sqrt(11) + 2892 Simplify 2 + (sqrt(39) - sqrt(234)/(-2sqrt(6)) - (sqrt(39) + 1sqrt(975) - sqrt(39)))/(sqrt(147)-1-6). -sqrt(13)/12 + 2 Simplify (((sqrt(513)2 - sqrt(513)) + sqrt(513) - sqrt(513))/sqrt(9))/sqrt(432) + 4(sqrt(133)/sqrt(28) + 0 + sqrt(95)/sqrt(5)). 73sqrt(19)/12 Simplify (-2sqrt(68)1 + -5sqrt(68)2 + sqrt(68))/(-4(sqrt(256)1 + (sqrt(4) - -2sqrt(484)))). 11sqrt(17)/124 Simplify 1(3 + 1 + sqrt(7))3 + (3(sqrt(7) + 0) - (sqrt(7) - (sqrt(7) + 0 + -5))) + 3. 10 + 6sqrt(7) Simplify (sqrt(40) + sqrt(40)-3-6 - sqrt(80)/sqrt(2)-1)/((sqrt(216)-3)/(2sqrt(243))). -40sqrt(5) Simplify -3 + (-3sqrt(192)1 - ((sqrt(192) - 3(2sqrt(192))2) + sqrt(192) - sqrt(192))) - (4 + (sqrt(192)-2 + 2 - sqrt(192)))*2-3. -896sqrt(3) + 7593 Simplify 4 + (66(0 + sqrt(288)) + 5)2 + -2 + -4. 4320sqrt(2) + 373271 Simplify (53sqrt(96)/sqrt(2))*2 - ((sqrt(300)14)2 - ((-2 + sqrt(300))2 + sqrt(300))3). -90sqrt(3) + 6912 Simplify (-3 + 2((1 + sqrt(245))-21 - -2(0 + (sqrt(245) - (sqrt(245) + sqrt(245) + -1)) - sqrt(245))))2. 504sqrt(5) + 35289 Simplify ((sqrt(143)/sqrt(275)1 - (sqrt(104)/(sqrt(40)/sqrt(5) + sqrt(8)) + sqrt(39)/(sqrt(3) - sqrt(12)))) + -5)2. -7sqrt(13) + 3137/100 Simplify 6(sqrt(2880) + (1 + 2 + sqrt(2880) - sqrt(2880)))2 - (sqrt(2880) + sqrt(2880)14 + 4 + sqrt(2880) + -1). 720sqrt(5) + 17331 Simplify -1(sqrt(3388)2)/sqrt(4) + sqrt(7)	{ "pile_set_name": "DM Mathematics" }
7 Let j(r) = 2r + 4. Suppose -2h - 9 = h. Let t(d) = -6d - 11. Let q(u) = ht(u) - 8j(u). List the prime factors of q(2). 5 Suppose 40h - 42h + 588 = 0. List the prime factors of h. 2, 3, 7 Let a be 492/(-20) - 4/10. What are the prime factors of 2/(-3)-3 - a? 3 Let p be (-208)/36 + (-2)/9. Let b be ((-14)/5)/(p/30). Let k = b - 0. List the prime factors of k. 2, 7 Let k(c) = c*3 + 6c*2 + c - 5. Let t be k(-5). Suppose 4s - 9s = -t. Suppose -sw = 2w - 20. What are the prime factors of w? 2 List the prime factors of (21 + 0)/(-1 + 2). 3, 7 Suppose -5c + 7s = 2s - 60, -5s - 51 = -4c. Let f be 8/(-3)c/6. List the prime factors of 6/f66/(-9). 11 Suppose -2s - 2 + 6 = 0. Suppose -3c - 1 = -m, 3 = 5c - sm + 5m. Suppose c = -j - j + 10. What are the prime factors of j? 5 Suppose -x - 9 = a, -2a - 28 = 3x + x. Let g(o) = -5o - 2. List the prime factors of g(a). 2, 3 Let p(m) = m*3 - 2m - 2. List the prime factors of p(3). 19 Let y(w) = -w*3 - 1 + 156w*2 - 1 - 155w*2. List the prime factors of y(-3). 2, 17 Suppose -3z + 33 + 84 = 4q, -5q + z + 151 = 0. Let g = 17 + q. What are the prime factors of g? 47 Let s(z) be the third derivative of -5z4/24 - 11z*3/3 - 8z*2. List the prime factors of s(-12). 2, 19 Suppose 1 = 5x + 2t + t, 0 = -4x - 2t + 2. Let c be ((2 - x) + -4)/(-2). Suppose -ck + 3k = 4m + 24, -4k + 5m + 41 = 0. List the prime factors of k. 2 Let v = -7 - -10. Let h = 5 + v. Suppose -i + 3c = 4i - 87, -2c - h = 0. What are the prime factors of i? 3, 5 Let i(w) = w2 - 4. Let n be i(5). Let x be 4/18 + 133/9. Let o = n - x. What are the prime factors of o? 2, 3 Suppose -4z = i - 3i - 140, -4z = -4i - 136. List the prime factors of z. 2, 3 Suppose y - 44 = -3y. Let p = y + 3. List the prime factors of p. 2, 7 Let d(a) be the third derivative of -a6/120 + a5/6 + a*4/2 + 4a*3/3 - 2a*2. Let i be d(11). Suppose -3p = 4 - i. List the prime factors of p. 5 What are the prime factors of (-3)/(12/(-584))1/2? 73 Let p(o) = 8o*2 - 4. List the prime factors of p(-5). 2, 7 Suppose 3 = -2t + 7. Suppose o - 68 = -tg, -3g + 2o + 120 = g. What are the prime factors of g? 2 Suppose -2z + 3z = 0. Suppose -r + zr - 26 = 0. Let o = 38 + r. What are the prime factors of o? 2, 3 Suppose 0 = -0w + 5w - 10. Let y(b) = 2b2 + 1. Let p be y(w). Let v = 20 - p. What are the prime factors of v? 11 Let w be ((-13)/(-26))/(2/48). Let i = w + -5. What are the prime factors of i? 7 Let q be 20((-64)/(-20))/2. Suppose 3o + 32 = m, -3o = 2m - m - q. List the prime factors of m. 2 Let d(s) = -s2 - 8s - 7. Let r be d(-7). Let a be ((-2)/(-1) - 1)r. List the prime factors of 2 + (2 - 0) + a. 2 Suppose 6u - 2u = 148. What are the prime factors of u? 37 Suppose 0 = 4s - 685 - 59. List the prime factors of s. 2, 3, 31 List the prime factors of ((-8)/(-10))/(7/35). 2 Suppose 3x + 2o = -3o + 257, 0 = 3o - 3. What are the prime factors of x? 2, 3, 7 Let v be (-1)/2(-12)/(-2). Let z = 5 + v. Suppose 0 = zs + s - 36. What are the prime factors of s? 2, 3 Let y = 97 - 52. Suppose -a + 5 + 8 = 0. Suppose a = -4b + y. What are the prime factors of b? 2 Let s be 24/(-9)9/(-6). Suppose -2k + t + 5 = 0, -k + st = -7 + 1. Suppose -2b - 2b = -3m + 19, -m - kb + 3 = 0. List the prime factors of m. 5 Let r be (1/(-2))/(2/384). What are the prime factors of r/(-4)9/12? 2, 3 List the prime factors of (-51)/(-85) + 1(-797)/(-5). 2, 5 Suppose 2x + 4r = -22, -27 = 2x + r + 4r. What are the prime factors of x/2 - (-119)/14? 2 Suppose 0l - 40 = -4m + 4l, -3m = 5l - 38. What are the prime factors of m? 11 Let k(n) = -n + 5. List the prime factors of k(-15). 2, 5 What are the prime factors of 500/18 - 4/(-18)? 2, 7 Let w = 213 - 140. What are the prime factors of w? 73 Suppose 0 = -2o - 3o. Suppose 0v - 3v + 19 = 2k, 5k + 2v - 20 = o. What are the prime factors of k? 2 What are the prime factors of (-2 + 1)/(7/(-721))? 103 Let w be 94(-1)/(-2) + 3. Suppose 4j = -4q + 44, -4j - 2q + w = -q. What are the prime factors of j? 13 Let z(d) = 4d*2 + 4d. List the prime factors of z(-3). 2, 3 Suppose -90 = -0f - 5f + 5a, -2f - a = -21. What are the prime factors of f? 13 List the prime factors of ((-18)/(-45))/((-1)/(-120)). 2, 3 Suppose -27 = -3a - 5x, 0 = -a - a + 2x + 18. Let f = a + -6. List the prime factors of f. 3 Let v be 1(1 - 0) + 0. Suppose 12 - v = z - 2k, 2k = -z + 11. List the prime factors of z. 11 Let i(f) = -f*3 - 6f*2 - f. What are the prime factors of i(-6)? 2, 3 Let s = 28 + -21. Suppose -sd + 156 = -3d. List the prime factors of d. 3, 13 Let m(i) = -11i*3 + 2i*2 - 1. Suppose 3u - 5y + 3 = 5u, -2y = -4u - 6. List the prime factors of m(u). 2, 3 Let n = 8 + -13. Let j(i) = -4i2 - 8i - 1. Let z(y) = -7y2 - 15y - 3. Let d(h) = 5j(h) - 3z(h). What are the prime factors of d(n)? 2 Let c(k) = -6k + 10. List the prime factors of c(-5). 2, 5 Suppose -2w + 83 = -0w + 3t, t + 71 = 2w. List the prime factors of w. 37 Suppose 0v - 4n = v + 10, -5v + 4n + 22 = 0. Suppose 0 = -4w + v + 14. Suppose 40 = 2m + 4z, -wm - z = -3z - 30. List the prime factors of m. 2, 5 Suppose 3k + 233 = 3h - k, -h + 91 = -4k. What are the prime factors of h? 71 Let a = 160 + -67. List the prime factors of a. 3, 31 Let y(r) = -2r - 4. Let h = 10 - 7. Let b be y(h). Let z = b + 20. What are the prime factors of z? 2, 5 Let i(b) be the first derivative of -b5/120 - b3/3 - 2. Let s(a) be the third derivative of i(a). List the prime factors of s(-4). 2 Suppose 3b = -2s + 32, 4b - 2b + 3s - 28 = 0. List the prime factors of b/3 + 3/9. 3 Let m(g) = -g3 - 2g*2 + g + 49. List the prime factors of m(0). 7 Let m(l) = 29l + 12. Let p be m(6). Suppose 12 = -3f + p. What are the prime factors of f? 2, 29 Suppose -2x - 3x = -4z - 314, 5 = -5z. List the prime factors of x. 2, 31 Let k = -2 - -2. Suppose k = -2f - 6 + 40. List the prime factors of f. 17 Suppose -5i + 25 = 70. Let w = i - -15. List the prime factors of w. 2, 3 Suppose 2x = -0x + 4. Suppose -3t - t = xg, -g = t. Suppose -m + 2m - 12 = t. What are the prime factors of m? 2, 3 Let x(v) = -v. Let n be x(-4). Let f be 0/2 - (3 - n). What are the prime factors of (-1)/f1-6? 2, 3 Suppose -3u = -4a - 59, -8a + 3a - 73 = -3u. What are the prime factors of (1 + a)/(12/(-12))? 13 Let g(q) = -q3 - 5q*2 + 6q + 5. Let l be g(-6). Let v = 8 - l. List the prime factors of v. 3 List the prime factors of (21/3)/((-6)/(-30)). 5, 7 Let s = -7 - -20. What are the prime factors of s? 13 Let i be (-5)/1012. What are the prime factors of ((-3)/(-1))/(i/(-5))? 3, 5 Let q(y) be the first derivative of y4/24 + y3/2 + y2 + 2. Let c(m) be the second derivative of q(m). List the prime factors of c(7). 2, 5 What are the prime factors of (-7)/(9/12 + 17/(-20))? 2, 5, 7 Let c(p) be the third derivative of -p5/60 + p4/8 + p3/2 - 2p2. Let h be c(3). Let w = -1 + h. What are the prime factors of w? 2 Let d be (1 + -3 - 2) + 6. List the prime factors of (-1356)/(-30) + d/(-10). 3, 5 Suppose 5x + 20 = 0, 2x = -2t + 4x + 52. List the prime factors of t. 2, 11 Suppose -4w - 8 = 2l, 3w + 3 + 6 = 0. Let c be (0 - -1)(0 + 3). Suppose -ch = lh - 50. What are the prime factors of h? 2, 5 Let w = 6 + -3. Suppose -wg + 5 = -2g. Suppose -gs + 2z = -2z - 50, 0 = -3z. What are the prime factors of s? 2, 5 Suppose 1 = -2c - 5h - 6, h = -4c + 13. Let q = 9 - c. Suppose -11 + 76 = qy. What are the prime factors of y? 13 Let b(u) be the first derivative of 4u3/3 - 2. List the prime factors of b(1). 2 Let n(v) be the first derivative of -v4/4 - 4v3/3 + 3v*2/2 + v + 1. What are the prime factors of n(-5)? 11 Suppose 17 = n + 4w, 4n - 5w = 6n - 19. Let p(v) = 3v*2 - 3v + 1. List the prime factors of p(n). 37 Let f be (-1 + -4)(-2)/5. Suppose -fy + 9 = -3i, y - i = 2i + 6. Let s = 9 - y. What are the prime factors of s? 2, 3 Suppose -4n + 126 = 18. Let k be (-4)/((-12)/n) - 2. Suppose -3z + k = -26. List the prime factors of z. 11 Let h(n) = n*2 - 19n + 22. What are the prime factors of h(22)? 2, 11 Let b(c) = c*3 - 8c*2 - 26c + 3. List the pri	{ "pile_set_name": "DM Mathematics" }
t is seven quarters of a year in months? 21 How many hours are there in 7.659989 days? 183.839736 How many grams are there in 15/4 of a kilogram? 3750 What is 8.110674um in kilometers? 0.000000008110674 How many hours are there in 28.842774 minutes? 0.4807129 Convert 56793.29 millennia to decades. 5679329 How many tonnes are there in 19.49345ng? 0.00000000000001949345 What is 1/20 of a litre in millilitres? 50 What is fourty-four fifths of a microgram in nanograms? 8800 How many nanoseconds are there in 952.7908 seconds? 952790800000 Convert 81477.06l to millilitres. 81477060 What is 847467.3l in millilitres? 847467300 How many minutes are there in 27/4 of a hour? 405 What is 3/50 of a litre in millilitres? 60 What is 3/25 of a litre in millilitres? 120 What is 8/25 of a millennium in decades? 32 How many millilitres are there in 9851.954l? 9851954 How many milliseconds are there in 19/4 of a second? 4750 How many millilitres are there in thirty-seven fifths of a litre? 7400 How many millilitres are there in fifty-five quarters of a litre? 13750 How many nanometers are there in one quarter of a micrometer? 250 How many years are there in 93.73287 months? 7.8110725 Convert 55.10736 centimeters to kilometers. 0.0005510736 How many millilitres are there in 53/5 of a litre? 10600 What is eighteen sevenths of a week in hours? 432 How many centuries are there in 7547.55 millennia? 75475.5 How many nanograms are there in 387939.9 tonnes? 387939900000000000000 How many milliseconds are there in 0.5722172 hours? 2059981.92 How many months are there in 657.8445 millennia? 7894134 What is 1/20 of a gram in micrograms? 50000 What is fifty-five quarters of a litre in millilitres? 13750 What is fourty-four fifths of a centimeter in micrometers? 88000 What is 11/2 of a millisecond in microseconds? 5500 What is five eighths of a millimeter in micrometers? 625 How many minutes are there in one fifteenth of a hour? 4 Convert 1.2912ug to milligrams. 0.0012912 How many millennia are there in 5658.007 years? 5.658007 How many hours are there in 11207.43ms? 0.003113175 How many nanometers are there in 47/4 of a micrometer? 11750 What is 3/5 of a micrometer in nanometers? 600 How many days are there in 0.3182623 weeks? 2.2278361 How many meters are there in 50.34605nm? 0.00000005034605 How many meters are there in 25.64049 nanometers? 0.00000002564049 What is 6/25 of a millennium in months? 2880 How many milligrams are there in 46/5 of a gram? 9200 What is five eighths of a tonne in kilograms? 625 How many millilitres are there in seventy-four fifths of a litre? 14800 What is 44/5 of a litre in millilitres? 8800 What is six fifths of a gram in milligrams? 1200 What is 7/2 of a milligram in micrograms? 3500 What is 406.6358 millilitres in litres? 0.4066358 What is nine tenths of a millimeter in micrometers? 900 What is one fifth of a decade in months? 24 How many micrograms are there in 8/25 of a milligram? 320 What is 1070.758 weeks in nanoseconds? 647594438400000000 What is 13/5 of a litre in millilitres? 2600 Convert 7315.8138 minutes to days. 5.08042625 How many tonnes are there in 4.295381ng? 0.000000000000004295381 What is 235.6512ns in minutes? 0.00000000392752 How many millilitres are there in fourty-five quarters of a litre? 11250 Convert 0.0306402 millennia to years. 30.6402 How many kilograms are there in three fifths of a tonne? 600 Convert 982.5133g to milligrams. 982513.3 How many hours are there in 88716.39 days? 2129193.36 What is 3/5 of a minute in seconds? 36 What is 3/25 of a micrometer in nanometers? 120 How many millilitres are there in eleven eighths of a litre? 1375 How many litres are there in 61.79787ml? 0.06179787 How many minutes are there in 7.742023 days? 11148.51312 How many micrograms are there in 6305.014 grams? 6305014000 How many minutes are there in twenty-three thirds of a week? 77280 Convert 9.867324m to centimeters. 986.7324 How many millimeters are there in sixty-seven fifths of a meter? 13400 Convert 9.7994 millennia to years. 9799.4 What is 918.4806mg in micrograms? 918480.6 What is seven quarters of a decade in months? 210 What is 634.3384ng in milligrams? 0.0006343384 Convert 33.58183 decades to centuries. 3.358183 How many minutes are there in 1/10 of a week? 1008 How many months are there in four fifteenths of a decade? 32 What is 7.146689km in micrometers? 7146689000 What is twenty-one halves of a litre in millilitres? 10500 What is 3/10 of a millennium in years? 300 What is 73663.22 millilitres in litres? 73.66322 How many litres are there in 8093.12ml? 8.09312 What is thirty-one fifths of a gram in milligrams? 6200 What is 5/4 of a century in months? 1500 How many micrograms are there in 6.405523 grams? 6405523 What is 836724.8um in millimeters? 836.7248 What is 26845.93 kilometers in millimeters? 26845930000 Convert 866103.1 micrometers to kilometers. 0.0008661031 What is 258419.7ml in litres? 258.4197 Convert 5.2086645 minutes to days. 0.003617128125 How many months are there in 6.791986 years? 81.503832 What is 0.9456472g in nanograms? 945647200 What is five quarters of a hour in minutes? 75 Convert 8354.413ml to litres. 8.354413 What is seventeen quarters of a millennium in years? 4250 How many milligrams are there in 6/25 of a gram? 240 How many years are there in 11/10 of a decade? 11 What is 7.207255t in milligrams? 7207255000 How many months are there in 0.9823928 centuries? 1178.87136 How many millimeters are there in 3/5 of a meter? 600 Convert 730.2519 decades to months. 87630.228 How many litres are there in 19.11015 millilitres? 0.01911015 What is 8599.509 millilitres in litres? 8.599509 What is eleven halves of a century in decades? 55 Convert 0.3595291t to grams. 359529.1 What is 194960.85 days in weeks? 27851.55 How many milligrams are there in seven quarters of a gram? 1750 What is 354104.4 litres in millilitres? 354104400 How many meters are there in 25/4 of a kilometer? 6250 Convert 11683.12 kilograms to tonnes. 11.68312 How many years are there in fourty-six fifths of a decade? 92 What is 3/32 of a second in microseconds? 93750 How many milliseconds are there in one sixteenth of a minute? 3750 How many years are there in twenty-one quarters of a century? 525 What is 271136.7 years in decades? 27113.67 What is 26/5 of a millimeter in micrometers? 5200 What is 59/3 of a minute in seconds? 1180 How many seconds are there in 5/6 of a hour? 3000 What is thirty-one fifths of a day in minutes? 8928 How many decades are there in one fifth of a millennium? 20 How many litres are there in 9.068887 millilitres? 0.009068887 What is 4275.01 micrometers in centimeters? 0.427501 How many months are there in 21/5 of a decade? 504 What is 96674.55 litres in millilitres? 96674550 What is seven thirds of a decade in months? 280 What is eleven halves of a millimeter in micrometers? 5500 How many years are there in 409660.9 decades? 4096609 What is three fifths of a tonne in kilograms? 600 What is one tenth of a second in milliseconds? 100 How many decades are there in 37.90754 years? 3.790754 How many months are there in ten thirds of a decade? 400 What is three eighths of a microgram in nanograms? 375 How many micrograms are there in 312535.8t? 312535800000000000 How many microseconds are there in 211.4689 hours? 761288040000 How many seconds are there in 7/16 of a day? 37800 What is 1/4 of a millennium in months? 3000 How many hours are there in eleven halves of a week? 924 How many millilitres are there in 1/4 of a litre? 250 Convert 139012.6kg to grams. 139012600 How many milliseconds are there in 37.60509 minutes? 2256305.4 Convert 1.843659 months to centuries. 0.0015363825 How many nanometers are there in 247.4983cm? 2474983000 Convert 48.91915 years to months. 587.0298 Convert 803317.6 years to decades. 80331.76 Convert 9500.276l to millilitres. 9500276 How many minutes are there in 0.129984us? 0.0000000021664 How many years are there in 13/5 of a decade? 26 Convert 27139.08 minutes to hours. 452.318 How many months are there in seven halves of a millennium? 42000 What is 230.8771 kilograms in nanograms? 230877100000000 What is 107418.69 months in decades? 895.15575 How many seconds are there in one ninth of	{ "pile_set_name": "DM Mathematics" }
hen o is divided by 11? 8 Let a = 98 - 83. Let m(p) = 9p - 118. What is the remainder when 166 is divided by m(a)? 13 Suppose 0 = 55l + 9276 - 39141. What is the remainder when l is divided by 184? 175 Suppose 853 = -38h - 796 + 2181. Suppose -2y = -138 + 2. Suppose -124 = -3q + y. What is the remainder when q is divided by h? 8 Suppose -36m = 18m - 6750. Calculate the remainder when m is divided by 3. 2 Let p = -12666 - -12682. Suppose -9 - 5 = -2m. Calculate the remainder when p is divided by m. 2 Let p(w) be the third derivative of 5w4/24 - 5w*3/3 - 19w*2. Let r(z) = -55z3 - z2 - z + 1. Calculate the remainder when r(-1) is divided by p(6). 16 Let y = -638 + 1243. What is the remainder when y is divided by -23 + (15 - (14 + -30))? 5 Suppose 428 = -123j + 1781. What is the remainder when 212/63/2 is divided by j? 9 Let f be 633(-3)/(-12) + (-42)/(-56). Let d = f - 125. What is the remainder when d is divided by 9? 7 Suppose -2m = h + h - 22, -2h = -m + 14. Let t = 126 - 281. Let w = 223 + t. Calculate the remainder when w is divided by m. 8 Let d = 3115 - 3106. What is the remainder when 638 is divided by d? 8 Let v = 52 - 44. Let y(m) = -m + 22. Let g be y(v). Suppose 3s - g = -3n + 10, 3n - 3s = 12. Calculate the remainder when 17 is divided by n. 5 Let b = -36560 - -36588. What is the remainder when 842 is divided by b? 2 Let d = 1 - 1. Suppose 57 = -do + 3o. Let y = 1429 + -1393. Calculate the remainder when y is divided by o. 17 Suppose -136f = 67f + 51f - 230632. Calculate the remainder when f is divided by 14. 12 Let s(p) = -754p + 2368. Suppose h - 57 = -2g, -6g + 3g = 5h - 96. Calculate the remainder when s(3) is divided by g. 25 Suppose 0 = -6b - 9b + 1520 + 490. What is the remainder when b is divided by 15? 14 Suppose -26h = -1753 + 557. Let k(l) be the third derivative of l5/15 + l4/24 - 2l3/3 - 9l*2. What is the remainder when k(-5) is divided by h? 45 Let m = -15537 - -22609. What is the remainder when m/38 - (-7 - (-540)/76) is divided by 21? 18 What is the remainder when 7/(8 - -6)1342 is divided by 107? 29 Suppose -2s + 6960 = 10b, 4b + 3s + 2070 = 7b. What is the remainder when 707 is divided by b? 12 Suppose -3z = -12, -u + 21 + 5 = -2z. Let n = 115 - -7. What is the remainder when n is divided by u? 20 Suppose 121f - 41744 = 14642. Calculate the remainder when f is divided by 39. 37 Suppose 3c - 512 = 133. Suppose -2b = 2v - 78, 2v + 108 = -156b + 160b. What is the remainder when c is divided by b? 29 Suppose -15k + 59k = 4224. What is the remainder when 3550 is divided by k? 94 Suppose -71746 = -112v - 7122. What is the remainder when v is divided by 53? 47 Suppose -2v + 964 = 2v + 2u - 1376, 0 = -u. Calculate the remainder when v is divided by 29. 5 Suppose 16h = 7414 - 5798. Calculate the remainder when 7472 is divided by h. 99 Let x = -4505 + 4620. What is the remainder when 219 is divided by x? 104 Let j be ((-40)/(-4 + 0))/(4/(-44)). Let z = -102 - j. What is the remainder when 143 is divided by z? 7 Suppose -2011 + 1516 = -5q. What is the remainder when 191 is divided by q? 92 Let p = -142 - -237. Let w = 20649 - 20607. Calculate the remainder when p is divided by w. 11 Suppose -2q + 32 = 5w, 24 = 557w - 561w. Suppose 2h + 14 = p, 6 - 2 = -4h. Calculate the remainder when q is divided by p. 7 Let v = 6172 - 6170. Calculate the remainder when 507 is divided by v. 1 Let l be 1683/(-68)(-16)/3. Let d be 360/(-54)l/(-10). Let s = -74 + d. Calculate the remainder when s is divided by 6. 2 Let l(v) = -2v2 - 4v - 2. Let a be l(-2). What is the remainder when 17/51(-2 - -50) is divided by (-22)/(-4)2(a + 3)? 5 What is the remainder when 399 is divided by (-10824)/770 + 14 - 8264/(-70)? 45 Let h(o) = -11o - 14. Let r(g) be the first derivative of g*2/2 + 6g + 12. What is the remainder when h(-3) is divided by r(-2)? 3 Suppose -870 - 1943 = -12n - 809. Calculate the remainder when 594 is divided by n. 93 Suppose -168r - 32306 = -148394. Calculate the remainder when r is divided by 208. 67 Let g(i) = -7i - 9. Let r be g(-2). Let x be (87 + -2)/r - 2. Suppose -x + 9 = -3b. Calculate the remainder when 2 is divided by b. 0 Suppose -53m + 21m + 7501 = 589. Calculate the remainder when 760 is divided by m. 112 Let z(i) = 91i + 8038. What is the remainder when 390 is divided by z(-88)? 0 Suppose -20f - 7f = -0f - 6561. Calculate the remainder when f is divided by 61. 60 Let f(j) = 26j2 + 71j + 1836. What is the remainder when f(-27) is divided by 44? 41 Calculate the remainder when 1291950/3828 - 31/(-2) is divided by 42. 3 Let r = -4689 + 4926. What is the remainder when 7107 is divided by r? 234 Let u(o) = 5o + 59. Let w(p) = -2p - 1. Let j(m) = -u(m) + 5w(m). What is the remainder when j(-11) is divided by 52? 49 Let h(q) = 18q2 + 19q - 101. What is the remainder when h(4) is divided by 14? 11 Suppose -278h + 430218 = 181h + 55h. What is the remainder when h is divided by 14? 11 Suppose 8o = -21 + 21. Suppose -10u + 15u - 2855 = o. What is the remainder when u is divided by 41? 38 Suppose 0 = -6r + 4r - 5x + 20, 3r + 3x = 30. Suppose 9j = rj + 4. Calculate the remainder when 166 is divided by (-625)/(-15) + j/(-12). 40 Let y(l) = -8l - 186. Let p be y(-31). Suppose -53b + pb = 99. Calculate the remainder when 62 is divided by b. 7 Let l(s) = 4s - 7. Let o be l(3). Suppose ou + 6x - 114 = 8x, -x - 24 = -u. What is the remainder when 62 is divided by u? 18 Let w = -33 + 48. Let t = w + -7. Let j(o) = -12o2 - 101o - 113. Calculate the remainder when j(-6) is divided by t. 5 Let n = 1598 - 989. Let y = -586 + n. Calculate the remainder when 250 is divided by y. 20 Let i = -13094 - -16529. What is the remainder when i is divided by 1716? 3 Suppose 8z = 6z + 338. Let g = 288 - z. Let p = g - 66. What is the remainder when p is divided by 19? 15 Suppose 3t = -0t + 2s + 8, 0 = t + s - 1. Suppose ti - 6 = 4y, 0y + i = -2y - 1. Calculate the remainder when 0 + 2 + y - (-19 - -6) is divided by 11. 3 Let t(v) = -15v*2 + 159v + 59. What is the remainder when t(9) is divided by 83? 26 Let b = -412 + 600. Let q be -4 - (0 - (b - 3)). Suppose -4j = -5n + q - 27, -2n = 3j - 57. What is the remainder when 55 is divided by n? 25 Suppose 4y + 2r - 2050 = 0, 56y - 51y = 4r + 2608. What is the remainder when y is divided by 23? 10 Suppose -2q + 110 = 5v - 4q, 5v = -q + 110. Suppose -11p - 60 = -577. Suppose -p - 32 = -w - 4u, -u = 0. What is the remainder when w is divided by v? 13 Let m be -2619/(-2) - -3. Suppose 6j = j + m. Suppose 3o + 65 = -3k + 350, -2k + 3o + 210 = 0. Calculate the remainder when k is divided by j. 49 Suppose -40 = -5a - 5g, 5a + 14 = 2g + 40. Suppose 0 = ah - 307 - 101. Calculate the remainder when 474 is divided by h. 66 Let d(u) = -5u2 + 252u + 26. What is the remainder when 5668 is divided by d(9)? 1 Let o(l) = -2l + 79. Let n(t) = t3 - 10t*2 + 4t + 47. Calculate the remainder when o(28) is divided by n(9). 1 Let h = 226 - 215. Suppose 6l = hl - 115. What is the remainder when 110 is divided by l? 18 Let f = 133 - 125. Let x(l) = -3l2 + 38l - 6. What is the remainder when x(f) is divided by 9? 7 Let y be (-41)/246 - (-2)/12. Suppose 51 = z + 5u, yz - 4z + 109 = u. What is the remainder when z is divided by 16? 10 Let a(f) = -f3 - 22f*2 + 80f + 143. Calculate the remainder when 1091 is divided by a(-25). 11 Suppose -760 = -8b - 30b. Let v = b + -6. Calculate the remainder when 362 is divided by v. 12 Suppose 0 = 2z - n - 17, z - n - 4n + 5 = 0. What is the remainder when 42 is divided by 24/(-1020)-17 - (-266)/z? 15 Suppose 9753 - 649 = 2t - b, -2b = -t + 4555. Calculate the remainder when t is divided by 99. 96 Suppose -6 = -6p + 24. Suppose -a + 16 = r, -pa + 84 = 2r + 19. Suppose -7x - a = -8x. What is the remainder when 40 is divided by x? 7 Let k(a) = 126a + 46. Let p(m) = -2m*3 - 10m*2 + m - 8. What is the remainder when p(-7) is divided by k(0)? 43 Suppose 0 = -47j + 44 + 285. Suppose -98 = jg - 308. Let s = -21 - -78. Calculate the remainder when s is divided by g. 27 Let w(m) = -3m - 10. What	{ "pile_set_name": "DM Mathematics" }
. Let c = -106 - -188. Suppose -u = -2r + 37, -4r + 4 + c = 2u. Calculate the lowest common multiple of r and p. 20 Let p = 0 - -3. Calculate the least common multiple of (12 + -15 + 10)(1 + 0) and p. 21 Suppose 5i - 58 - 27 = 0. What is the common denominator of -5/2 and (-2)/i + 2058/(-136)? 4 Let z = -24269/3 - -8070. Calculate the common denominator of z and 211/90 + 2/(-5). 18 Calculate the least common multiple of (-42)/63(-2 - 28)/2 and 14/3(-12)/(-4). 70 Let p be (-312/(-42))/(4/3325). Suppose -m = 4b - 736, 3m - b - 2193 = 2b. Let c = p - m. What is the common denominator of 11/4 and c? 4 Let y be 300/(-40)(21)/3670. Let p = 15963/367 - y. Find the common denominator of p and -21/11. 22 Let q = -83 - -83. Suppose m = -r + 19, m = -qm + 3r + 23. What is the lowest common multiple of (-84)/(-9)(-3)/(-2) and m? 140 Suppose -5s + 9s = -332. Let b = s + 101. Calculate the lowest common multiple of 9 and b. 18 Let j = -93 - -65. Let v(r) = r*3 - 13r*2 + 10r + 13. Let p be v(12). What is the common denominator of j and (-2)/p - (-692)/(-176)? 4 Let x = 94156569447/1185032 - 635639/8. Let w = 8147537/32736509 - x. Let j = w - -20003/2210. Find the common denominator of -93/14 and j. 70 What is the common denominator of -9/112 and (-4)/(-18) - ((-3829)/(-504) + 0)? 112 Let o = 1739 + -19090/11. Find the common denominator of -20/49 and o. 539 Let r(y) = -3y2 - 21y - 1. What is the common denominator of r(-8) and (-58)/12 + -1 + 2? 6 Let i = -213532219289/1578 - -135318256. Let j = i - -2/263. Calculate the common denominator of j and 2/(-6) + (-229)/42. 42 Let v = -60010 - -3240433/54. What is the common denominator of v and (-1 + 218/30)/1? 270 Let f be ((-12)/(-3))/(-4) + -22. Let h = f - -38. Suppose -2o + h = -3u, 4o - 3u - 8 = 19. Calculate the lowest common multiple of 2 and o. 6 Let l = -1 + 0. Let s be l((-1000)/21 - -2). Let w = 47/42 - s. Find the common denominator of w and 49/16. 16 Suppose 2d + 3h - 21 = 16, 5d = -h + 86. What is the least common multiple of d and 187? 187 Calculate the common denominator of 49/36 and 157/(-12) + -9 + 10 + 3. 36 Let c be (-5306)/(-4)57/15. Let x = 5031 - c. Let z = 59854/11 + -5437. Find the common denominator of z and x. 110 Let i be ((-36)/(-32)14)/((-9)/(-48)). Suppose i = 13p - 202. Calculate the smallest common multiple of p and 6. 66 Let z = -5531/280 - -372/35. Find the common denominator of z and 7/139. 1112 Let a = 602 + -600. Suppose 4q = -2s + 6, -3s + 2q + 3q + 9 = 0. Suppose 20 = j + 4r, -aj - sr = -r - 40. What is the least common multiple of j and 8? 40 Let o = 15 + -19. Let y = o - -6. Calculate the common denominator of -1 + y + (-124)/(-48) and -89/8. 24 Let w = -9/1409 - 68933/16908. Find the common denominator of w and 133/36. 36 Let s(q) = 4q*2 - 5q - 8. Let f(c) = 9c2 - 11c - 16. Let k(l) = -3f(l) + 7s(l). Calculate the lowest common multiple of k(6) and 84. 336 Let u be 1080 + (-1)/(-1) + -2. Find the common denominator of 93/22 and u/1561/4. 528 Let l(q) = 5q*2 + q + 2. Let f = 4 - 3. Calculate the least common multiple of l(-1) and f. 6 Let x = 27/27782 + -178082917/305602. Let j = -582 - x. Calculate the common denominator of j and 30/11. 11 Let i = 20395 - 2039543/100. Find the common denominator of i and -101/80. 400 Let l = -7 - -10. Suppose -4w = -2h - 4, -lh + 3w - 7 - 2 = 0. Calculate the common denominator of -69/14 and (h + 142/36)-133. 126 Suppose 5a = 3k + 29, -1 + 9 = 5a + 4k. Let l = 10 - 6. Let m = l + -2. Calculate the smallest common multiple of a and m. 4 Suppose 5z - 452 = 3r + 263, r - 143 = -z. What is the least common multiple of 65 and z? 715 Let i(t) = t*2 - 6t - 7. Let s(h) = -h + 2. Let d be s(0). Suppose 0 = -b + d. Calculate the least common multiple of i(8) and b. 18 Let z = -2 + 4. Find the common denominator of (-73)/(-20) + -1z and (-127)/40 - (-6)/(-16). 20 Let y = -14033 + 22975/2. Let n = 637 - 3133. Let a = n - y. Find the common denominator of a and 37/4. 4 Let d be 22/((-5)/20 - 0). Find the common denominator of (-36)/d + (1 - 2) and -43/20. 220 What is the common denominator of 6/(-120)(-2 + 230/(-140)) and -99/14? 280 Let w(u) = -u*2 - 3u + 33. Let v be w(-7). Suppose 5h - 4g - v - 43 = 0, -5h - 5g + 30 = 0. What is the least common multiple of h and 5/112/10? 24 Suppose -4u - 90 = 166. Suppose 0 = -2f - c + 113 + 87, 4f - 402 = -3c. Calculate the common denominator of 91/8 and 2/u(f - 5). 16 Let n = 178163041542729986327/3064998 + -58128273343974. Let d = n + -2/30049. Let l = 40/17 + d. Calculate the common denominator of l and -41/4. 12 Let h = -187 + 287. What is the lowest common multiple of 100 and h? 100 Let d = -2967 + 14882/5. Find the common denominator of -214/(-4) + 6/9 and d. 15 Let p = 4281/8990 - 25/58. Let v = p + 115/62. What is the common denominator of -23/6 and v? 30 Let r(u) = -3u*3 - 2u*2 - 2u. Let m(d) = -96d + 8170. Calculate the smallest common multiple of m(85) and r(-2). 20 Let x be -16 + 8 + 0/1. Let h = -3 - x. Suppose -2r + 13 - h = 0. Calculate the lowest common multiple of 20 and r. 20 Let a = -18 + 75/4. Let o = 212/3 + -193/6. What is the common denominator of o and a? 4 Let j = 26 - 12. Let w(v) = -v*2 + 2v - 1. Let m(y) = 5y2 - 9y + 3. Let t(z) = 2m(z) + 9w(z). What is the least common multiple of j and t(-5)? 154 Let h = -23 - -13. Let g be 12(-1)/(4/h). Suppose -g = -2u - u. What is the least common multiple of 1 and u? 10 Suppose a - 10 = -p, 0p - 3a - 74 = -5p. Let y(j) = j3 - 14j*2 + 14j - 5. Calculate the least common multiple of 4 and y(p). 8 Let p(y) = -y*3 - 8y*2 + 4y + 11. Let o be p(-8). Let a be (12/o)/((-4)/14). Suppose -56 = -0g - ag. Calculate the common denominator of g and -34/11. 11 Suppose -d - 381 = -4b, -5b + 12d = 7d - 465. Calculate the smallest common multiple of 96 and b. 96 Calculate the common denominator of (30/(-520))/(4 + -3) and -73/14. 364 Let h = 36 - 26. Let b(m) = m*3 - 11m*2 + 10m + 2. Let o be b(h). Suppose ol - 13 - 27 = 0. Calculate the least common multiple of l and 8. 40 Suppose -10u + 8u = -6. What is the smallest common multiple of 28 and (4 - u) + 30 - -1? 224 Let j = 6155/6 + -1021. What is the common denominator of 56/189(6 + 27)21/(-182) and j? 78 Suppose 0w + w - 36 = 0. Let k = w + -35. Calculate the lowest common multiple of k and 1. 1 Suppose -4s + 41 = 5y, -y + 14 = y + s. Suppose yq + 0p - 3 = 4p, -3q = 5p - 24. What is the least common multiple of 2 and q? 6 Calculate the lowest common multiple of 11 and ((-29)/29)/(3/(-90)). 330 Let n(j) = j + 6. Let p be n(0). Let u = -36391/7 + 5207. Calculate the common denominator of p/9(-73)/(-2) and u. 21 Let w(k) = 11k2 - 2k - 3. Let q be w(-1). Suppose 22 = qy + 2. Calculate the lowest common multiple of y and 19. 38 Let u = -278 + 820. Find the common denominator of 67/60 and u/528 - (-34)/187. 120 Let g(r) = -r3 - 7r*2 + 21r + 184. Let j = 0 - -46. Calculate the lowest common multiple of g(-6) and j. 506 Let l = -2346293 + 32889477/14. Let c = 2950 - l. Calculate the common denominator of -19/90 and c. 630 Let q be (10 - 3 - 47)(-4)/(-10). Let i = 40 + q. What is the least common multiple of 15 and i? 120 Find the common denominator of 95/26 and 7 + (-72)/9 + (-855)/(-460). 1196 Suppose 4r = 12 + 28. Suppose -2 = x + r. Let i = x + 16. What is the lowest common multiple of i and 9? 36 Suppose -5l = -4l - 2. What is the common denominator of -291/8 + l and 3/(-1) - (-129)/6? 8 Let i be 1 + 4/(-2) - 962. What is the common denominator of i/66(-1)/(-3) and 65/12? 132 Let c be (17661/36)/(-7) - (-2)/3. Let y = c + 505/6. Calculate the common denominator of -1/6 and y. 12 Calculate the common denominator of -101/4 and (-1)/(-2)(1 + 36/272). 136 Suppose 11 + 9 = -2n. Let t be (n/6)/((-3)/(-18)). What is the common denominator of ((-4)/t)/(28/(-265)) and 53/8? 56 Let c = -2927/3689767 + 1743653892667/157073381190. Let k = -2/21285 + c. Let y = -2072 + 4239/2. Calculate the common denominator of k and y. 10 Let f be (-1)/((-1)/15) - 1. Let w = -422/7 - -6037/84. What is the common denominator of (-275)/(-56) + (-4)/f and w? 24 Let u = -3193/10 + 1567/	{ "pile_set_name": "DM Mathematics" }
3/6 - 27m + 2. Calculate a(l(o)). 6241o2 Let n(d) = -1862d. Let x(a) = a - 36. What is n(x(q))? -1862q + 67032 Let j(p) = 19p + 2. Let m(z) be the first derivative of -z*3 - 75. Determine j(m(y)). -57y*2 + 2 Let l(s) be the third derivative of 1/24s*4 + 0 + 0s + 2s2 + 0s*3. Let n(g) be the first derivative of -7g*2/2 + 343. Give l(n(k)). -7k Let v(w) = -w*2. Let r(d) = -688d - 9. Give r(v(u)). 688u2 - 9 Let m(t) = -16t. Let l(h) be the first derivative of 4/3h3 + 7 + 0h*2 + 0h. Determine l(m(o)). 1024o2 Let d(b) be the third derivative of -13b*4/24 - 62b*2. Let v(f) = 9f*2. Give v(d(a)). 1521a*2 Let b(l) = 2l. Let n(t) = -97t - 8. Let j(k) = 17170k + 1414. Let i(d) = 4j(d) + 707n(d). Give i(b(r)). 202r Let b(o) = 8o*2 - 20o - 40. Let f(d) = -d*2 + 3d + 6. Let k(w) = 3b(w) + 20f(w). Let p(g) = -100g. What is p(k(r))? -400r*2 Let q(i) = -i. Let n = -23 - -28. Suppose 3t = 3p - 45, -3p - nt - 3 = -2p. Let h(x) = -5x2 + px*2 - 12x*2. Give q(h(b)). 5b*2 Let i(t) be the third derivative of -23t5/120 - t3/6 - t*2. Let j(g) be the first derivative of i(g). Let o(h) = 316h - 643h + 325h. Give o(j(l)). 46l Let d(y) = -108y*2. Let p(r) = 3r + 5r - 14r + 8r. Give p(d(o)). -216o*2 Let c(r) = -27399r*2. Let v(z) = -z. Calculate c(v(a)). -27399a*2 Suppose -11q = -19q + 40. Let c(z) = -3z*2 - 2z - 2. Let l(p) = -7p2 - 5p - 5. Let a(m) = qc(m) - 2l(m). Let b(j) = -7j2. Calculate b(a(t)). -7t*4 Let t(y) = -2y*2 - 105. Let i(h) = 8h*2 + 4h*2 - 14h*2 + 7h*2. Determine t(i(p)). -50p*4 - 105 Let j be 66/15 - 15/(-25). Let l(u) = 4u - j + 9 - 4. Let v(m) = 3m. Give v(l(k)). 12k Let x(w) = 28w + 5758 - 5758 + 13w. Let v(u) = 12u. Calculate v(x(s)). 492s Let o(p) = -p + 4. Let y(b) = -2b + 12. Let d(i) = 3o(i) - y(i). Let z(f) = 4f2. What is z(d(w))? 4w*2 Let c(m) = 3m. Let i(z) = 10 - z - 18 - 2. Determine c(i(w)). -3w - 30 Let d(a) = -a. Let n(s) = -14437s*2. What is d(n(k))? 14437k*2 Let u(k) = -k - 7958. Let x(l) = 2l. Calculate x(u(r)). -2r - 15916 Let x(c) = -35c + 32c + 16c. Let n(h) be the second derivative of -h5/120 - h3/6 + 2h. Let r(t) be the second derivative of n(t). Give x(r(b)). -13b Let g(b) be the second derivative of -5b3/6 + 3b. Let t(w) = -5w2 + 3w. Let v(o) = -o*2 + o. Let s(h) = -t(h) + 3v(h). Calculate g(s(c)). -10c2 Let q(m) be the first derivative of -m2/2 + 1. Let u(o) = -o. Let y(s) = 4s. Let b = 2 + -1. Let i(j) = by(j) + 6u(j). What is i(q(f))? 2f Let a(m) = m2. Let o(q) = 74857q*2. Determine o(a(f)). 74857f*4 Let z(c) = -3c2. Let k(i) be the third derivative of -i5/30 - 4i3/3 + 29i*2 + 3i. Determine k(z(v)). -18v4 - 8 Let a(l) = -2207l*2. Let c(z) = -2z + 4. Calculate c(a(b)). 4414b2 + 4 Let n(g) = -3g*2. Let q(m) be the first derivative of -22m*3/3 - 39. Determine q(n(f)). -198f*4 Let w(y) = 7y - 1. Let r(f) = f*2 + 91f. What is r(w(j))? 49j2 + 623j - 90 Let j(r) = 8r + r2 - 8r. Let y(x) = -x. Let f(d) = 3d. Let b be 4 - 2 - (1 + 2). Let h(m) = bf(m) + 6y(m). What is h(j(t))? -9t*2 Let i(r) = -6r*2. Let l(w) = -2w*2 - 67w*2 - 35w*2 - 50w*2 + 12w*2. Give l(i(d)). -5112d*4 Let j(q) = -14459q. Let w(c) = -58c. Calculate w(j(i)). 838622i Let s(z) = 82z2 - 35 + 35 - 81z2. Let u(l) be the third derivative of -l2 + 0l + 0 + 0l*3 + 1/6l*4. Determine s(u(o)). 16o*2 Let n(l) = -74l2 - 2. Let a(d) be the third derivative of d5/60 - 78d2. Give a(n(i)). 5476i*4 + 296i*2 + 4 Let z(o) = -14o*2 + 6o*2 + 4o2. Let n(w) be the second derivative of w3/3 + 50w. Determine n(z(g)). -8g*2 Let z(d) = -2d*2. Let y(t) = -39t*2 + 363t + 6. Give y(z(c)). -156c4 - 726c*2 + 6 Let h(p) be the first derivative of 8p3/3 + 3. Let i(n) = n2 + 59n - 59n. What is i(h(m))? 64m4 Let n(t) = 2t*2. Let d(j) = -3119367j. What is n(d(h))? 19460900961378h2 Let x(c) = -2c. Let w(h) = -44018h. Determine w(x(v)). 88036v Let w(y) be the second derivative of y*4/12 - 13y*2/2 + 13y. Let c(k) be the first derivative of w(k). Let j(q) = 2q2 + q - q. Determine c(j(t)). 4t*2 Let q(k) = k + 10. Let b be q(-5). Let l(h) = 3h + 3h - bh - 3h. Let o(t) = -7t. Let i(g) = 20g. Let u(d) = -6i(d) - 17o(d). What is l(u(v))? 2v Let q(z) = -z. Let b(t) = -t*2 - 154t - 1 + 95t + 77t + 1. What is q(b(u))? u*2 - 18u Let j(w) = 2w2 + 23w. Let c(o) be the second derivative of o*4/12 - 459o. Determine j(c(u)). 2u4 + 23u*2 Let g(p) = -3p2. Let c(r) be the third derivative of r5/20 - 118r2. Calculate g(c(d)). -27d*4 Let u(h) = -2h. Let d(k) = 11k - 3. Let o(j) = -9j. Let m(c) = 5d(c) + 6o(c). Give u(m(z)). -2z + 30 Let w(x) = x2 - 1. Let y(t) = 3t*2 - 4. Let g(z) = -4w(z) + y(z). Let h(q) = -7q2 + 2. Determine h(g(u)). -7u4 + 2 Let b(i) = -i2. Let c(y) = -1471 - 207y + 1471. Calculate b(c(h)). -42849h*2 Suppose 6h - 366 - 36 = 0. Let f(v) = -67v + hv - 2v2. Let r(z) = -15z. Calculate f(r(l)). -450l2 Let c(k) = 3k. Suppose 5y + 2n - 5n - 15 = 0, 5n - 3 = -y. Let z be (-2 + 2)(-1)/y. Let p(r) = -4r + 3r + zr. Give c(p(l)). -3l Let s(u) = 3u*2. Let f(q) = 2q*2 - 39928. What is f(s(g))? 18g*4 - 39928 Let f(o) = 51o*2 - 170. Let h(m) = 13m*2 - 40. Let l(z) = -4f(z) + 17h(z). Let i(t) = -29t. Determine i(l(k)). -493k2 Let z(t) = -3t*2. Let s(b) be the first derivative of 12b*3 + 35. What is z(s(w))? -3888w4 Let y(o) be the second derivative of -o4/12 - 51o2 + 32o + 4. Let f(s) = -4s2. Calculate y(f(t)). -16t*4 - 102 Let s(k) = 38k + 5. Let h(r) = -548r2. Calculate s(h(m)). -20824m*2 + 5 Let b(y) = -6y*2. Let j(x) = -399068x. Determine j(b(o)). 2394408o2 Let w(z) be the first derivative of -4 + 0z - 1/3z3 + 0z*2. Let x(c) = -7c - 5. Let m(s) = -6s - 4. Let p(i) = 5m(i) - 4x(i). Give p(w(a)). 2a*2 Let o(d) = 2d + 1. Let h(l) = -l*2 - 2l - 1. Let x(j) = -9h(j) - 9o(j). Let w(p) = -79p. Give w(x(m)). -711m2 Let k(s) be the second derivative of s4/12 + 3s + 1. Let h(v) be the second derivative of v3/6 - 3v*2/2 - 11v. What is k(h(j))? j*2 - 6j + 9 Let s(w) be the second derivative of 0w3 - 5/6w*4 + 0 + 0w*2 + 9w. Let a(o) = -o*2. What is a(s(f))? -100f*4 Let p(x) = 2x*2. Let j(k) be the first derivative of 106k*2 + 257. Calculate j(p(l)). 424l*2 Let a(j) be the second derivative of 11j*3/6 - 7j - 83. Let i(f) = 2f + 5. Give i(a(c)). 22c + 5 Let r(p) = 2p2. Let b(q) = 5q*2 - 2q - 5. Let t(z) = 11z2 - 5z - 9. Let f = -46 - -48. Let k(i) = ft(i) - 5b(i). Determine r(k(l)). 18l4 - 84l*2 + 98 Let n(c) = -31c*2. Suppose k = -m + 6, 4k = -2m - k + 24. Let f(z) = 9z*2 + 7z*2 - 15z*m. Calculate f(n(u)). 961u*4 Let m(b) be the first derivative of 6b*2 + 4b + 53. Let f(i) = 2i2. What is f(m(y))? 288y*2 + 192y + 32 Let m(b) = 2b - 176. Let z(c) = 2c + 87. Determine m(z(v)). 4v - 2 Let b(h) = 501 - 501 + 5h. Let u(t) = -8t2. Calculate b(u(p)). -40p*2 Let q(k) = 3k*2. Let i be (-37)/481 + (-3)/(-39). Let u(g) be the third derivative of -10g*2 + 0 + 1/60g*5 + 0g + ig4 + 0g*3. Determine q(u(h)). 3h*4 Let f(w) = 3627w*2. Let a(g) = -8g. Determine a(f(p)). -29016p2 Let b(k) = 5k - 35k - 174k - 45k - 143k. Let l(o) = -o. Give l(b(g)). 392g Let k(q) = q2 - 182. Let h(x) = -81x. Determine h(k(s)). -81s2 + 14742 Let l(p) = -p - 121. Let w(o) = 5122o. Give w(l(d)). -5122d - 619762 Let c(v) = -v - 1. Let t(x) = 41x*2 - 6x - 4. Let u(d) = 4c(d) - t(d). Let l(n) = 2n. Give u(l(i)). -164i2 + 4i Suppose -3i = -3y + 6y - 45, -3i + 31 = 2y. Let o(a) = -a - 7a - ya. Let z(r) = -r. Calculate o(z(k)). 22k Let t(l) = 13l + 31l + 31l + 20l - 119l. Let b(a) = 6a*2 - 4a - 4. Let r(j) = -j*2 + j + 1. Let o(g) = b(g) + 4r(g). Give o(t(p)). 1152p2 Let m(l) = -9l - 3. Let q(h) = 17h + 5. Let n(j) = -5m(j) - 3q(j). Let u(k) = k + 15. Let r be u(-10). Let t(g) = 2 + 3 + 2g - r. Calculate n(t(o)). -12o Let d(h) = -4h. Let c(f) = f*2 - 3f - 1595. What is d(c(l	{ "pile_set_name": "DM Mathematics" }
8 Convert -2 (base 13) to base 9. -2 Convert 251 (base 7) to base 13. a4 1 (base 7) to base 16 1 What is -2 (base 14) in base 2? -10 What is -213 (base 5) in base 10? -58 Convert -1 (base 4) to base 5. -1 -3122 (base 4) to base 7 -431 88 (base 13) to base 11 a2 What is 28 (base 10) in base 5? 103 Convert -2 (base 12) to base 4. -2 What is -39 (base 10) in base 3? -1110 What is -7 (base 16) in base 4? -13 Convert 13 (base 6) to base 11. 9 What is 50 (base 7) in base 8? 43 What is b (base 14) in base 12? b Convert -2 (base 9) to base 12. -2 Convert 22 (base 9) to base 16. 14 What is -433 (base 6) in base 11? -140 Convert 5 (base 15) to base 14. 5 Convert -65 (base 7) to base 9. -52 What is 11c (base 14) in base 10? 222 -14 (base 11) to base 14 -11 What is -10 (base 7) in base 13? -7 8a (base 16) to base 6 350 Convert 4 (base 14) to base 10. 4 Convert 3 (base 4) to base 16. 3 10 (base 4) to base 12 4 What is -341 (base 6) in base 15? -8d What is -65 (base 9) in base 7? -113 1034 (base 5) to base 14 a4 What is 75 (base 12) in base 11? 81 What is -2201 (base 4) in base 15? -ab What is 3d (base 16) in base 3? 2021 5a (base 15) to base 13 67 -6 (base 13) to base 12 -6 Convert 4 (base 5) to base 13. 4 Convert 6 (base 12) to base 13. 6 What is 34 (base 10) in base 2? 100010 Convert dd (base 16) to base 13. 140 What is -52 (base 7) in base 10? -37 Convert -12 (base 5) to base 7. -10 Convert 3 (base 16) to base 8. 3 Convert b (base 15) to base 7. 14 Convert -10001 (base 2) to base 15. -12 What is -105 (base 8) in base 11? -63 -5 (base 7) to base 11 -5 -1 (base 11) to base 5 -1 What is 22 (base 3) in base 15? 8 -20 (base 4) to base 8 -10 Convert 29 (base 10) to base 16. 1d What is 110 (base 2) in base 10? 6 Convert 32 (base 4) to base 8. 16 Convert 221 (base 4) to base 10. 41 What is -8 (base 15) in base 7? -11 What is 54 (base 6) in base 3? 1021 What is -221 (base 3) in base 2? -11001 Convert 10100 (base 2) to base 13. 17 Convert -113 (base 11) to base 9. -160 100 (base 6) to base 5 121 -11 (base 4) to base 9 -5 Convert -11 (base 7) to base 3. -22 Convert 8 (base 11) to base 5. 13 What is 4 (base 10) in base 11? 4 100 (base 2) to base 14 4 Convert -32 (base 12) to base 9. -42 Convert 2 (base 12) to base 6. 2 Convert 424 (base 9) to base 3. 110211 Convert 0 (base 12) to base 3. 0 -12 (base 3) to base 16 -5 -1222 (base 3) to base 16 -35 Convert 3 (base 16) to base 14. 3 Convert -2 (base 8) to base 3. -2 Convert 2 (base 8) to base 9. 2 87 (base 9) to base 3 2221 Convert -222 (base 4) to base 3. -1120 What is a (base 13) in base 11? a Convert -12 (base 4) to base 2. -110 Convert -3 (base 5) to base 16. -3 -52 (base 7) to base 8 -45 What is 72 (base 15) in base 9? 128 2020 (base 3) to base 2 111100 What is 10 (base 11) in base 14? b 2122 (base 3) to base 8 107 -2 (base 5) to base 7 -2 What is -5 (base 10) in base 5? -10 What is 243 (base 10) in base 4? 3303 -43 (base 10) to base 5 -133 What is 1 (base 15) in base 3? 1 Convert 33 (base 7) to base 6. 40 What is -7 (base 13) in base 16? -7 Convert -12 (base 5) to base 14. -7 Convert -317 (base 8) to base 4. -3033 What is b (base 15) in base 14? b 1001 (base 4) to base 6 145 What is -d (base 14) in base 10? -13 What is -223 (base 4) in base 5? -133 -e7 (base 16) to base 9 -276 What is 95 (base 14) in base 12? ab What is -46 (base 8) in base 11? -35 Convert 24 (base 16) to base 3. 1100 What is -11 (base 2) in base 14? -3 What is -31 (base 5) in base 3? -121 Convert -4 (base 9) to base 2. -100 What is -24 (base 8) in base 7? -26 Convert -11 (base 9) to base 3. -101 What is -2 (base 11) in base 13? -2 -110 (base 6) to base 8 -52 Convert 46 (base 9) to base 12. 36 What is -1001011 (base 2) in base 13? -5a What is e (base 15) in base 16? e -1 (base 9) to base 14 -1 Convert 10 (base 2) to base 12. 2 -40 (base 16) to base 15 -44 Convert -54 (base 9) to base 7. -100 Convert -21 (base 3) to base 8. -7 Convert 0 (base 4) to base 9. 0 What is -331 (base 6) in base 15? -87 Convert -11100111 (base 2) to base 14. -127 Convert -3 (base 5) to base 15. -3 Convert 23 (base 5) to base 15. d What is 0 (base 3) in base 14? 0 What is -5 (base 13) in base 15? -5 Convert 0 (base 4) to base 8. 0 Convert 15 (base 7) to base 4. 30 Convert -1 (base 8) to base 6. -1 110 (base 3) to base 6 20 What is 200 (base 6) in base 2? 1001000 Convert -212 (base 4) to base 12. -32 What is -7 (base 14) in base 16? -7 What is 2 (base 8) in base 3? 2 What is -40 (base 13) in base 9? -57 -234 (base 5) to base 9 -76 What is -3200 (base 4) in base 13? -143 Convert -3 (base 14) to base 10. -3 What is -12 (base 5) in base 10? -7 -158 (base 9) to base 12 -b2 1 (base 10) to base 7 1 What is 10 (base 4) in base 9? 4 1c (base 13) to base 5 100 What is -22 (base 4) in base 5? -20 -57 (base 10) to base 8 -71 Convert 5a (base 15) to base 4. 1111 1 (base 6) to base 3 1 2 (base 10) to base 8 2 Convert -30 (base 6) to base 11. -17 What is 6 (base 9) in base 16? 6 Convert 3 (base 4) to base 5. 3 What is 324 (base 6) in base 14? 8c 0 (base 11) to base 14 0 -4f (base 16) to base 4 -1033 Convert -3 (base 12) to base 7. -3 What is -25 (base 7) in base 16? -13 -36 (base 10) to base 15 -26 Convert -2 (base 14) to base 13. -2 Convert -6 (base 16) to base 10. -6 What is 17 (base 9) in base 7? 22 What is -1 (base 2) in base 15? -1 What is 5 (base 13) in base 2? 101 Convert -a (base 11) to base 16. -a Convert 1b (base 14) to base 7. 34 47 (base 10) to base 5 142 Convert 0 (base 10) to base 14. 0 -d (base 16) to base 15 -d What is 2 (base 5) in base 9? 2 Convert -a9 (base 13) to base 15. -94 3 (base 7) to base 16 3 Convert 0 (base 10) to base 9. 0 0 (base 8) to base 6 0 2 (base 11) to base 16 2 Convert -21 (base 7) to base 11. -14 What is -3 (base 14) in base 2? -11 Convert 0 (base 11) to base 13. 0 What is 3 (base 8) in base 3? 10 What is -103 (base 11) in base 13? -97 Convert 1000111 (base 2) to base 6. 155 -1 (base 2) to base 16 -1 What is 137 (base 12) in base 5? 1222 What is -30 (base 7) in base 12? -19 Convert -1 (base 12) to base 16. -1 7 (base 13) to base 9 7 What is 123 (base 4) in base 8? 33 What is -27 (base 10) in base 7? -36 Convert 2 (base 12) to base 16. 2 -6 (base 13) to base 11 -6 Convert -250 (base 6) to base 2. -1100110 What is -2012 (base 4) in base 8? -206 2 (base 6) to base 3 2 -3 (base 11) to base 14 -3 Convert 30 (base 10) to base 14. 22 Convert 221 (base 3) to base 11. 23 What is -b (base 13) in base 3? -102 103 (base 8) to base 9 74 Convert 90 (base 10) to base 2. 1011010 -40 (base 13) to base 4 -310 What is 2 (base 11) in base 14? 2 Convert -9 (base 14) to base 4. -21 What is -2 (base 10) in base 7? -2 1 (base 13) to base 16 1 What is 0 (base 8) in base 11? 0 What is 0 (base 7) in base 10? 0 What is -2 (base 8) in base 16? -2 What is -52 (base 14) in base 6? -200 What is -3 (base 10) in base 9? -3 What is 12 (base 7) in base 2? 1001 Convert 3 (base 9) to base 8. 3 What is 26 (base 10) in base 11? 24 130 (base 4) to base 5 103 What is -14 (base 7) in base 13? -b Convert 46 (base 8) to base 9. 42 What is d2 (base 15) in base 12? 145 What is 343 (base 5) in base 4? 1202 Convert -1b (base 12) to base 9. -25 Convert -10a (base 11) to base 14. -95 -45 (base 11) to base 16 -31 5 (base 8) to base 3 12 100100001 (base 2) to base 14 169 What is -43 (base 5) in base 12? -1b Convert 8 (base 13) to base 16. 8 What is 11 (base 5) in base 4? 12 Convert -48 (base 11) to base 8. -64 What is -2 (base 11) in base 12? -2 Convert 121 (base 6) to base 4. 301 Convert 19 (base 15) to base 7. 33 Convert 7 (base 12) to base 2. 111 -1 (base 15) to base 2 -1 -3 (base 15) to base 13 -3 -1 (base 2) to base 13 -1 Convert -2 (base 3) to base 10. -2 2 (base 11) to base 13 2 What is 9 (base 16) in base 13? 9 What is 4 (base 16) in base 15? 4 What is -420 (base 5) in base 2? -1101110 What is 1 (base 10) in base 6? 1 What is -1 (base 3) in base 12? -1 1 (base 6) to base 9 1 Convert 1 (base 12) to base 8. 1 Convert -10 (base 4) to base 5. -4 What is -2 (base 8) in base 9? -2 -2 (base 8) to base 10 -2 What is 11 (base 5) in base 13? 6 What is -195 (base 10) in base 11? -168 Convert 123 (base 4) to base 10. 27 Convert -3a (base 12) to base 15. -31 2 (base 13) to base 9 2 -21 (base 9) to bas	{ "pile_set_name": "DM Mathematics" }
00001 Let t be (-14)/(-18) + 60/27 + -2. Let p(d) = 279d - 5. Let y be p(t). What is y rounded to the nearest 10? 270 Let l(t) = -2t*2 + 9t - 14. Let z(i) = -3i - 6. Let k be z(-8). Let v be l(k). Round v to the nearest 1000. -1000 Let r = -2.53625 - -2.56. Round r to three decimal places. 0.024 Suppose l + 3 + 12 = -5j, -l + 5 = 0. Let h(y) = -737498y2 + 7y - 4. Let u be h(j). Round u to the nearest one million. -12000000 Let d = -0.1343 - -0.18088. Let v = d + -0.046. What is v rounded to four decimal places? 0.0006 Let i = -0.0238 + 0.02379523. Round i to seven decimal places. -0.0000048 Let q = -6.9356 + 0.1056. Round q to one decimal place. -6.8 Let t = -16165576 + -22234424. What is t rounded to the nearest one million? -38000000 Let h = 1.63 + -1.5. Let u = h - 0.12991. What is u rounded to four decimal places? 0.0001 Let a be (-40)/(-5) + -12 + -23249996. What is a rounded to the nearest 1000000? -23000000 Let a(q) = -1685q2 - 4q - 3. Let m be a(4). Let i = -19413 - 68566. Let d = m - i. What is d rounded to the nearest 10000? 60000 Let u = 34315 - -17985. What is u rounded to the nearest one thousand? 52000 Suppose 3f - 2q = -2064894, f + 2q + 403676 = -284630. What is f rounded to the nearest 10000? -690000 Let t(r) = 21r*2 - 22r - 29. Let y be t(-8). Round y to the nearest 100. 1500 Let v = -0.74 + 0.08. Let u = v + 0.15. Round u to one decimal place. -0.5 Suppose 26r = -2r + 50008. What is r rounded to the nearest 10? 1790 Suppose 2f - 6f + 16 = 0. Let w be -9 - (f + 1/(-1)). Let c be (-20760006)/w - 2/4. Round c to the nearest 100000. 1700000 Suppose -h = -3b + 5892, 0 = 2h - 0b + 2b + 11776. Let c = 7811 - h. What is c rounded to the nearest 1000? 14000 Suppose -20612 = -3d - 5729. Suppose 10s + 3939 = -d. Round s to the nearest one hundred. -900 Let q(u) = -8736u3 + 3u*2 + 12u + 24. Let p(k) = -k*3 - k + 1. Let s(z) = 3p(z) + q(z). Let i be s(-13). Round i to the nearest one million. 19000000 Suppose -5b + 122170 = -4n, 10418 + 14027 = b - 3n. What is b rounded to the nearest one hundred? 24400 Let r = -0.03 + -0.07. Let h = r + 5.1. Let q = 4.999906 - h. Round q to five dps. -0.00009 Suppose 158350012 = -5b - 4r, -5b + 0b = 5r + 158350015. What is b rounded to the nearest 1000000? -32000000 Let l(p) = 25p + 5 - 14 + 0. Let g be l(3). Round g to the nearest ten. 70 Let j = 710.300011334 + -710.3. Round j to 6 decimal places. 0.000011 Let f = -5.148 + 5.3. Let r = f - -4.298. Round r to one dp. 4.5 Let g(x) = -x2 - 10x + 24. Let y be g(-12). Suppose 4r - 6063 + 63 = y. Round r to the nearest one thousand. 2000 Suppose 10a + 15946875 = 40590235. Suppose 0 = 2y + 475664 + a. What is y rounded to the nearest one hundred thousand? -1500000 Let a = -77.8081 + 0.0881. What is a rounded to the nearest integer? -78 Let j(n) = -n3 + 16n*2 + 2n - 30. Let k be j(16). Suppose -x - 365 = -2w - 3w, -766 = 2x + kw. What is x rounded to the nearest one thousand? 0 Let i = 32 - 29. Suppose -iv - 15 = 102. Round v to the nearest ten. -40 Let m(z) = 3z - 25. Let v be m(10). Suppose -t = -vc - 4772356 - 32577644, -37350000 = 5c - 2t. What is c rounded to the nearest 1000000? -7000000 Let l = -0.800599 + 0.8. Round l to five dps. -0.0006 Let u = 76 + -39. Let r = 121 - u. What is r rounded to the nearest 10? 80 Let f = 0.0002 - 0.00156. What is f rounded to 4 decimal places? -0.0014 Let h be (78 + 0)20/6. Let a = 36 - -55. Suppose x - h = -a. What is x rounded to the nearest ten? 170 Let u(z) = z*3 + 13z*2 + z - 2. Let h be u(-13). What is h rounded to the nearest ten? -20 Let v = -124 + 96.8. Let u = -27 - v. What is u rounded to 1 dp? 0.2 Let w = -274497 + 274613.0763. Let c = w + -116. Round c to two decimal places. 0.08 Let l = 3159 + -7046. Let u = -3883.997 - l. Let f = u - 3. Round f to 2 dps. 0 Let o = 689.388 + -2.888. What is o rounded to the nearest 10? 690 Let b = 8931 - 8930.34928. Let q = b - 0.65. Round q to 4 dps. 0.0007 Let a = 269 - 269.000000269. Round a to 7 decimal places. -0.0000003 Let d be (18/(-3))/((-6)/8). Let t(f) = 5f*3 + 4f - 11. Let a be t(d). Suppose a = -o - 497419. What is o rounded to the nearest 1000000? -1000000 Let p = 0.1042 + -0.11568. Round p to 3 decimal places. -0.011 Let h = -7 - -204. Let s = -197.00356 + h. Round s to three decimal places. -0.004 Let r be (1 + (-14)/(-2))/((-2)/(-19)). Round r to the nearest ten. 80 Suppose 0 = -4v - j + 7, 4v = 5j - 0 + 13. Suppose -1881 = w - 5o + 284, -o + 4339 = -vw. What is w rounded to the nearest one thousand? -2000 Let r = -1.023 - -19.363. Let k = r + 0.16. Let i = k - 31.2. What is i rounded to 0 decimal places? -13 Let g = 0.1 - 0. Let f = 7.15935 - 7.05934988. Let t = f - g. What is t rounded to 7 dps? 0.0000001 Let o = -473.1 + 578. What is o rounded to the nearest 100? 100 Let c = -3.3 - 13. Let p = -14.4 - c. Round p to the nearest integer. 2 Let p = -6 + 15. Suppose 15 = 3u, f - u = -f - p. Let q(m) = 54999m - 2. Let n be q(f). Round n to the nearest 100000. -100000 Let x be 750/(-15)7/((-7)/2560). What is x rounded to the nearest ten thousand? 130000 Let m = 43710.299788 - 43710. Let f = -0.3 + m. Round f to five dps. -0.00021 Suppose -18b = -14b + 16109720. Let p be 0 - 3/(-3) - 827431. Let o = p - b. What is o rounded to the nearest one million? 3000000 Let t = -0.18 + -30.82. Let u = 30.9948 + t. What is u rounded to 3 dps? -0.005 Let u = -2.72 + 2.366. Let q = 2.424 + u. Round q to 1 dp. 2.1 Let g = -22 - -22. Suppose 4m + gm - 119999980 = 0. Suppose -4w + h = m, 0 = -5w + 3w + 5h - 14999975. What is w rounded to the nearest 1000000? -8000000 Let n = 1930 + -1929.8044. What is n rounded to 2 dps? 0.2 Let i = 122416.27325 - 94594.2718. Let l = i + -27823. Let q = l - -1. What is q rounded to four decimal places? 0.0015 Suppose 6l - 80999976 = -0l. Suppose -w + 0w = 4q + l, 0 = 3w - 2q + 40500002. What is w rounded to the nearest one million? -14000000 Suppose 97s - 2545 = 92s. What is s rounded to the nearest 10? 510 Let l = 0.214786 - 0.2175. Round l to four decimal places. -0.0027 Suppose -3w + 386 = 1340. Let u = -48 - w. Let r = 440 - u. Round r to the nearest 100. 200 Let q = 781.001131 - 781. What is q rounded to 5 dps? 0.00113 Let x(s) = 161s - 5. Let w be x(1). Round w to the nearest one hundred. 200 Let s = -146 - 16. Let l = s - -161.99893. What is l rounded to 4 dps? -0.0011 Suppose 4j = -3j - 2j. Let i be 20-1(j - 8000). What is i rounded to the nearest 1000000? 0 Let j = 50.08 + -51. Let o = j + 0.9274. Round o to 3 decimal places. 0.007 Let x = -787999 + 787965.0043. Let b = -34 - x. What is b rounded to 4 decimal places? -0.0043 Let k = -7309.023 - -7304. Let a = -17 - -12. Let v = k - a. Round v to 3 decimal places. -0.023 Let t = 16 + -15.71. Let z = t - -30.71. Let n = 30.927 - z. What is n rounded to two dps? -0.07 Let c = -511 + 209. Round c to the nearest ten. -300 Let i = -15 - -1. Let p = 13.9995 + i. What is p rounded to 3 decimal places? -0.001 Let x = 70 + -822. Let f be (5310/20)/((-6)/x). Suppose 5z + 1533251 = -5c + f, -5z + c - 1500005 = 0. Round z to the nearest one million. 0 Let y = 641 + -641.333. Let k = y + 0.3329839. Round k to 6 dps. -0.000016 Let u(s) = -17s3 + 9s*2 - 58s - 14. Let m be u(-19). What is m rounded to the nearest one thousand? 121000 Let u = 2388.4457236 + 0.0582764. Let p = u + -2289.50453. Let t = -99 + p. Round t to four dps. -0.0005 Let d = 1923.2294532 - 2011.22945273. Let b = d - -88. Round b to seven dps. 0.0000005 Suppose -1257000 = 10y + 5y. Round y to the nearest 10000. -80000 Let a(s) = 1566s*3 - s - 1. Let m be a(-1). What is m rounded to the nearest 100? -1600 Let y = -5.5 - 28.5. Let z = -36.05 - y. Round z to one decimal place. -2.1 Let i = 0.043 - 118.043. Let a = 125 - i. Let f = 242.999869 - a. What is f rounded to 5 decimal places? -0.00013 Let q = 8 + 3. Let w = -25 + q. Let f = w + 13.832. What is f rounded to 2 decimal places? -0.17 Let m = -3332189.79233 - -3332205. Let d = m + 154.77373. Let a = d - 170. What is a rounded to 3 dps? -0.019 Let z = 1.455 + 141.845. What is z rounded to the nearest 10? 140 Let r = -240272473 + 230202804.7. Let l = -10069668.8	{ "pile_set_name": "DM Mathematics" }
5/25 + 9l4/5 - 12l*3/5 - 2l*2/5 + 12l/5 + 6. Determine n, given that f(n) = 0. -1/2, 1, 3 Let c(p) be the first derivative of -3/4p2 - 1/2p*3 + 0p - 3. Factor c(s). -3s(s + 1)/2 Let q(y) be the second derivative of y7/1680 - y6/360 + 3y3/2 + 8y. Let p(z) be the second derivative of q(z). Factor p(w). w*2(w - 2)/2 Let b(r) be the first derivative of -5/18r4 - 2/3r*3 - 4/9r - 2/45r5 + 1 - 7/9r*2. Factor b(i). -2(i + 1)*3(i + 2)/9 Let k(o) = 4o5 - 10o*4 + 8o*3 - 4o*2 - 2o - 2. Let t(u) = -9u5 + 21u*4 - 15u*3 + 8u*2 + 5u + 5. Let y(n) = 5k(n) + 2t(n). Factor y(d). 2d2(d - 2)(d - 1)2 Let -7/4w - 3/4w3 + 2w2 + 1/2 = 0. Calculate w. 2/3, 1 Factor -t2 + t*2 - 5t*2 + 7t*2 - 2. 2(t - 1)(t + 1) Let r = 133 + -131. Suppose 0v*r + 0v + 2/7v3 + 0 = 0. Calculate v. 0 Suppose -3k + 11 = -6k - 2q, k + q + 4 = 0. Let f be (-7)/(-2) + k + 0. Factor -3/2c2 + 1/2c*5 + 3/2c*4 + fc*3 + 0 - c. c(c - 1)(c + 1)2(c + 2)/2 Factor 0 + 2/11q + 2/11q*2. 2q(q + 1)/11 Factor 0 + 4/3n*3 - 4/3n*2 - 8/3n. 4n(n - 2)(n + 1)/3 Factor 3d*4 - 3d*3 + 3d + 9d2 + 4d*3 + 8d*3. 3d(d + 1)3 Solve b3 - b3 + 0b5 - b5 + b3 = 0. -1, 0, 1 Let n(s) be the third derivative of s8/420 + s7/42 + s6/10 + 7s5/30 + s4/3 - 4s3/3 - s2. Let i(o) be the first derivative of n(o). Factor i(z). 4(z + 1)3(z + 2) Let p(v) be the third derivative of -v5/60 + v4/12 - v*3/6 - 11v2. Find h such that p(h) = 0. 1 Let o(v) be the third derivative of -v6/360 - v5/45 - v4/18 + 9v2. Factor o(k). -k(k + 2)*2/3 Solve -10/9p - 2/9p4 + 2/3 + 4/3p*3 - 4/9p*2 - 2/9p5 = 0. -3, -1, 1 Let s(i) be the third derivative of i5/100 - i*4/8 + 2i3/5 + i2. Factor s(o). 3(o - 4)(o - 1)/5 Let y(r) be the first derivative of r5/25 + r4/15 - 4r3/15 - 3r + 7. Let u(o) be the first derivative of y(o). Factor u(f). 4f(f - 1)(f + 2)/5 Suppose 2/9o*2 - 8/9 + 0o = 0. What is o? -2, 2 Let g(l) = -4l - 1. Let w be g(-3). Let o = -9 + w. Factor 0u - 6/7u5 - 2/7u*2 - 10/7u*3 + 0 - ou*4. -2u*2(u + 1)*2(3u + 1)/7 Let x(a) = -4a*3 + 6a2 - 35. Let o(z) = z3 + 1. Let c(s) = 6o(s) + 2x(s). Solve c(j) = 0 for j. -2, 4 Let t(v) = -6v5 - 6v*4 + 9v*3 + 18v*2 + 3v + 3. Let l(x) = 7x5 + 7x*4 - 9x*3 - 19x*2 - 2x - 4. Let k(n) = 3l(n) + 4t(n). Factor k(d). -3d(d - 2)(d + 1)3 Let 14/11m*3 - 4/11m*2 + 0 - 2/11m - 8/11m4 = 0. Calculate m. -1/4, 0, 1 Let k(q) be the second derivative of q8/6720 - q7/630 + q6/180 - q4/6 + 4q. Let m(c) be the third derivative of k(c). Let m(o) = 0. Calculate o. 0, 2 Let h(l) be the second derivative of -1/48l4 + 1/168l*7 - 1/80l*5 + 1/120l*6 + 0 + 0l*3 + 5l + 0l2. Let h(c) = 0. What is c? -1, 0, 1 Let z(b) = -b3 + 7b*2 - 11b + 32. Let g be z(6). Factor -1/2k3 - 1 + 3/2k*g + 1/2k - 1/2k4. -(k - 1)2(k + 1)(k + 2)/2 Let 0p + 5/2p3 - 7/6p*2 + 1/6p*5 + 0 - 3/2p*4 = 0. Calculate p. 0, 1, 7 Let c(r) be the first derivative of 2r*5/65 + 5r*4/13 + 2r*3/3 - 60r*2/13 + 72r/13 + 23. Factor c(u). 2(u - 1)2(u + 6)*2/13 Let y = -17 + 21. Factor 4k*3 - 3k*y - 8k - 3k2 - k3 + 5k + 6k4. 3k(k - 1)(k + 1)*2 Let y(o) = -4o*5 - 32o*4 + 24o*3 + 8o*2 + 4o - 24. Let s(n) = n4 - n3 + 1. Let h(d) = 24s(d) + y(d). Factor h(i). -4i(i - 1)(i + 1)*3 Suppose -5 = 5r + 5. Let w = 4 + r. Factor -wz2 + 2z2 - z4. -z*4 Let k(l) = -2l*3 - 44l*2 - 3l - 64. Let b be k(-22). Find h, given that -1/4hb - 1/4 - 1/2h = 0. -1 Let c(f) be the second derivative of -2f7/105 + 4f*6/75 - 2f*4/15 + 2f*3/15 + 2f. What is n in c(n) = 0? -1, 0, 1 Let s(i) be the first derivative of -i*5/5 - 3i*4/2 - 13i*3/3 - 6i*2 - 4i + 4. Factor s(o). -(o + 1)*2(o + 2)*2 Factor 4v*5 - 2v*2 + 7v*4 + 3v*2 + 2v*3 - 5v*2 + 3v2. v2(v + 1)2(4v - 1) Let w(i) = -i + 6. Let q be w(6). Let j(k) be the second derivative of 0k*4 + 0 + qk*3 - 1/30k*6 + 0k*2 + 2k - 1/20k5. Solve j(p) = 0. -1, 0 Suppose -4i - i = -10. Find q, given that -2qi + 3q + 0q + 0q - 2q + q3 = 0. 0, 1 Suppose -2p - 20 = -6p - 4h, -7 = -2p + h. Factor -2/9u*p + 4/9u*2 - 2/9 + 0u*3 + 0u. -2(u - 1)2(u + 1)*2/9 Factor 2/3 + 0w - 1/6w2. -(w - 2)(w + 2)/6 Let q = 13/5 + -12/5. Factor -3/5j + 2/5j*2 + 1/5j*5 - 3/5j*4 + q + 2/5j3. (j - 1)4(j + 1)/5 Let k(h) be the third derivative of 1/40h*6 - 1/24h*4 + 1/24h*3 - 1/120h*5 + 3/280h*7 + 0h + 0 + 2h2. Factor k(u). (u + 1)2(3u - 1)2/4 Suppose 5/4z*3 - 5/4z + 5/4z2 - 5/4 = 0. What is z? -1, 1 Factor -3/4o*5 + 0 + 0o*2 + 0o - 7/4o3 + 11/2o4. -o3(o - 7)(3o - 1)/4 Factor 1 + 1 + 8r*2 - 11r*3 - 17r*2 - 15r + 33r2. -(r - 1)2(11r - 2) Let s(u) be the third derivative of -2u*7/35 - 11u*6/30 - 8u*5/15 + 2u*4/3 - 23u*2. Factor s(n). -4n(n + 2)2(3n - 1) Let g(o) = -2o3 + o. Let z(q) = -q3 + q*2 - 1. Let d(c) = 5g(c) - 5z(c). Determine k so that d(k) = 0. -1, 1 Find k, given that -k2 + 3k*2 + k + 0k*2 - 4k3 + k2 = 0. -1/4, 0, 1 Let t(q) be the second derivative of -1/24q3 + 1/16q*4 - 1/120q*6 - 1/4q*2 + 1/80q*5 + 5q + 0. Solve t(h) = 0 for h. -1, 1, 2 Suppose 3y = 5r - 19, 0y - 16 = -3y - 2r. Factor ly - 3l*2 - 3l*3 + 5l*2. -3l*2(l - 1) Let n = -3 + 5. Factor -9m5 - 11m*2 + 11m*n + 2m4. -m4(9m - 2) Let k(y) = y*4 - 49y*3 + 124y*2 - 84y. Let i(g) = 15g4 - 685g*3 + 1735g*2 - 1175g. Let x(s) = -4i(s) + 55k(s). Find a, given that x(a) = 0. 0, 1, 4 Let z(f) be the first derivative of -f4/24 + f3/18 + 1. Factor z(v). -v*2(v - 1)/6 Let p(t) be the second derivative of -t*6/240 - 3t5/80 - t4/8 + 3t3/2 - 6t. Let d(n) be the second derivative of p(n). Factor d(g). -3(g + 1)(g + 2)/2 Let g(m) be the second derivative of 4m2 - 5/6m*4 + 8/3m*3 - 6m + 0. Solve g(r) = 0 for r. -2/5, 2 Let l = -1 + 5. Let -z + 2zl - z3 + 7z*3 + 2z*2 + 2z4 + z3 = 0. What is z? -1, 0, 1/4 Solve 214 + 2o5 + 28o*3 + 32o*2 + 12o*4 + 9o - 210 + 9o = 0 for o. -2, -1 Let s(i) = 4i*3 - 16i*2 + 12i - 4. Let k(w) = w*4 - 4w*3 + 15w*2 - 12w + 5. Let m(h) = 4k(h) + 5s(h). Let m(z) = 0. What is z? -3, 0, 1 Let b(l) be the third derivative of -l5/240 + l4/24 - l*3/6 + 36l2. Factor b(m). -(m - 2)2/4 Let o be ((-8)/(-252)-3)/((-9)/42). Solve o + 2/3j + 2/9j2 = 0. -2, -1 Let p(s) = 9s*2 + 14s - 3. Let q(o) = o*2 + o. Let t(w) = -p(w) + 6q(w). Determine h so that t(h) = 0. -3, 1/3 Let m(x) be the third derivative of -x6/120 - x5/20 - x4/8 + x3/6 - x*2. Let o(j) be the first derivative of m(j). Solve o(p) = 0. -1 Let l = 2773 - 665519/240. Let j(h) be the third derivative of -lh*6 + 0 - 1/6h*3 - 2h*2 + 1/80h*5 - 1/840h*7 + 0h + 1/24h4. Solve j(i) = 0 for i. -2, 1 Let h be -6(128/66 + -2). Suppose 2q - 1 = 3. Factor 0o + 2/11o5 + 0 + 2/11o*3 - ho*4 + 0o*q. 2o*3(o - 1)*2/11 Factor -10/7r*2 + 1/7r*5 + 10/7r*3 + 5/7r - 1/7 - 5/7r4. (r - 1)5/7 Let b = -25 + 27. Factor 1/5v*3 + 1/5v - 2/5vb + 0. v(v - 1)*2/5 Let f = -66 + 68. Let s(w) be the first derivative of 1/6w*4 - 2/15w*5 + 2/3w*3 - 5/3w*f - 2 + 4/3w. Suppose s(t) = 0. What is t? -2, 1 Let w = 184 - 184. Let b(o) = o. Let s be b(4). Let wl + 0 + 0l*3 - 2/3l*s + 0l*2 = 0. Calculate l. 0 Let o(d) be the first derivative of 2d*5/65 - 2d*3/39 - 9. Factor o(f). 2f*2(f - 1)(f + 1)/13 Let x(q) be the first derivative of 2 + 1/5q*2 + 0q + 0q3 - 1/10q*4. Factor x(i). -2i(i - 1)(i + 1)/5 Let u(w) be the second derivative of w8/1680 - w6/120 + w5/60 + w3/2 - 3w. Let h(z) be the second derivative of u(z). Let h(b) = 0. Calculate b. -2, 0, 1 Let k be ((-5)/(-2))/(5/30). Suppose 2w = -g + w + 1, -g - k = 5w. What is i in -7/2i + 13/2i2 - 1/2i*3 - 7i*4 + 1/2 + 4i*g = 0? -1, 1/4, 1/2, 1 Let s be (-4 + 5)/(7/14). Find d such that 11/6d + 1/3 + 13/3d3 + 4d*s + 7/3d*4 + 1/2d**5 = 0. -1, -2/3 S	{ "pile_set_name": "DM Mathematics" }
b - 6 = -g + 5. What is the units digit of g? 1 Let o(n) = 7n3 - n2 + 11n + 11. Let t(g) = g3 + g2 + g + 1. Let z(i) = -o(i) + 6t(i). What is the units digit of z(6)? 1 Let o(s) = s3 + 3s*2 + 1. Let t be o(-2). Suppose 3w - k - 17 = 0, -tw = 3k + 8 - 41. What is the units digit of w? 6 Let f(w) = -w*2 - 8w - 7. Let b be f(-6). Suppose 2x - 1 = bz, 0 = -3x + 2x - 4z + 33. Let l = 21 - x. What is the units digit of l? 8 Let d be 42/10 + (-2)/10. Suppose 0g - 145 = -dt - 5g, 0 = -t + g + 43. Suppose -2a + 4m = 0, -a + 2m = -4a + t. What is the units digit of a? 0 Let u(q) = -2q3 + q2. What is the tens digit of u(-2)? 2 Let z be (0/(-5))/(-11). Suppose zg - g = -13. What is the units digit of g? 3 Suppose 3y = 5s - 2y - 305, -s = -3y - 65. Suppose -s + 11 = -3p. What is the tens digit of p? 1 Let y = -10 + 10. Suppose -c + 4b - 5 = y, 4c - 59 = -3b - 3. What is the units digit of c? 1 What is the units digit of (-5)/(-1(0 + 1))? 5 Let o(b) = b*2 - 9b - 12. Let p be o(9). Let j be (-90)/(-27)p/5. What is the units digit of (-1 + -5)12/j? 9 Let p be (-2)/((-4)/10) + 1. Suppose -4w = -3a - 18, 3w = 2a + pw - 5. What is the units digit of (a/(-2))/(2/12)? 6 Let i(b) = b2 + 7b + 3. Let u be i(-6). Let l = u - -9. What is the units digit of l? 6 Let p(j) = -j*3 - 7j2 - j. Let f(s) = s3 + 8s2 + 2s. Let b be (-1 + 10)8/(-12). Let h(d) = bp(d) - 5f(d). What is the units digit of h(-3)? 3 Let s(f) = -5f*3 + 2f*2 + 3f. Let a be s(-3). Suppose -2x - 5i + 60 = 0, -i - a = -4x + i. What is the tens digit of x? 3 Let m be (1 - 2)(-2)/(-2). Let q be 2m/2 - 1. What is the tens digit of 93/9 - q/(-6)? 1 Suppose m = -5f + 851, -f - 3f - 3m + 683 = 0. What is the hundreds digit of f? 1 Let x(i) = -12i. What is the tens digit of x(-1)? 1 Suppose -w + 74 = -5w - 3a, -5w - 2a = 96. Let k = 29 + w. What is the units digit of k? 9 Let c be (-2)/(-2 - (-36)/15). Suppose 5b - 3j - 59 = -2j, 5j = 3b - 31. Let x = b + c. What is the units digit of x? 7 Suppose -5x = -2x - 3. Let i(s) = 2 - 4s2 - x + 5s*2 - 4s. What is the units digit of i(5)? 6 Let v = -11 + 10. Let x = v + 17. What is the tens digit of x? 1 Suppose -5c + 12 = -n, -n - 3c + 52 = 4n. Let i be n/(-10)30/(-12). Suppose 5g = 2y - 3y + 58, iy = 2g - 16. What is the tens digit of g? 1 Suppose -3d + 97 = 4i - 150, -3i = 5d - 419. What is the tens digit of d? 8 Let d = -6 + 8. Suppose h - q = -d, -4h + q = -0q - 1. What is the units digit of h? 1 Let f = -5 - -6. What is the units digit of 9(f/3 + 0)? 3 Let w = 81 - 40. What is the tens digit of w? 4 Let n be (-1 - 6/(-4))6. Let y be n + 17 + 4/(-2). Suppose 4g = g + y. What is the units digit of g? 6 Let v(k) = 7k2 - 3k + 10. Let z(t) = -t*2 - 1. Let a(h) = v(h) + 6z(h). What is the units digit of a(3)? 4 Suppose 30 = x + n, 4n + 149 = 4x + 5. What is the tens digit of x? 3 Let q be 5/((-15)/8)-9. Let r be 6/(-4)160/q. Let p(l) = -l - 9. What is the units digit of p(r)? 1 Let a(v) = 5v. Let o = -13 - -18. Let x(f) = -f2 + 11f + 1. Let k(z) = oa(z) - 2x(z). What is the units digit of k(-3)? 7 Let m(r) = 3r - 2. Let q be m(6). Let c = -11 + q. Suppose k - 3w = 0, -ck - w + 30 = -6w. What is the units digit of k? 9 Let d(h) = -h*3 - 7h*2 - h - 10. Let q be d(-7). What is the tens digit of q(-11)/3 + 1? 1 What is the tens digit of 12/60 - 218/(-10)? 2 Let i(o) = -o*2 + 7o - 7. Let z = 0 - -6. Let t be i(z). What is the units digit of ((-1 - 2) + 2)t? 1 Suppose 22 = 2f - 5f + i, 4f + 16 = 4i. Let h(n) = n3 + 10n*2 + 6n - 11. Let r be h(f). What is the units digit of r/1 - (-2 + 4)? 4 Let f = -2 + 3. Suppose s - f = 2t - 0, 5t - s = 5. What is the units digit of t? 2 Let l be 1 + 6(-4)/(-8). Suppose lf + 23 = 5f. What is the units digit of f? 3 What is the tens digit of 40 - -9 - (-1 - 1)? 5 Let d = -1 + -1. Let n(x) be the first derivative of -2x*2 - 3x + 1. What is the units digit of n(d)? 5 Let y = 4 - 7. Let g = y + 9. What is the units digit of g? 6 Suppose -2q + 4 = 2q - 2z, 13 = -5q - 2z. Let j be 0 + (q - 1) - -3. Let u = 2 - j. What is the units digit of u? 1 What is the tens digit of (0 - -40)21/2? 4 Let k(a) = -12a - 1. Let j be k(1). Let f = -6 - j. What is the units digit of f? 7 Let y(s) = -8s3 - s2 - s - 1. Let r be y(-1). Let n = 24 + -22. Suppose nz = 9 + r. What is the units digit of z? 8 Let m(x) = -x*2 + 10x + 12. What is the units digit of m(11)? 1 Let o(q) = -q*3 - 3q*2 - 2q + 1. Let p be o(-3). Suppose -3 - p = -i. What is the units digit of i? 0 Let f(z) = -z*2 - 3z. Let t(b) = -3b. Let i be t(2). Let g be f(i). Let d = -11 - g. What is the units digit of d? 7 Suppose -13x + 9x = 3s - 506, 4s + 2x - 678 = 0. What is the hundreds digit of s? 1 Let t be 5/(-2)(-8)/10. What is the units digit of 6/(-2 + t + 2)? 3 Let t = -4 - -6. Suppose -10 - 11 = 4g - 5a, 3a - 13 = tg. What is the units digit of ((-7)/3)/(g/(-3))? 7 Suppose 3g - 26 = k, 2g - 11 - 10 = -3k. What is the units digit of 4/3g + 2? 4 Let t(s) = -10s + 14. What is the units digit of t(-5)? 4 Let d be (15 - 0)/1 + 0. Suppose -2x + 15 = 5b - 7x, -b - 5x = d. Suppose -3h + 39 - 12 = b. What is the units digit of h? 9 Suppose -2h - 37 + 7 = 0. What is the units digit of -2 - 0 - h/3? 3 Suppose 5g + 98 + 272 = 0. What is the tens digit of (0 + g)6/(-12)? 3 Suppose -b + 8 = 14. Let p = b - -7. Let c = 2 - p. What is the units digit of c? 1 Let p(i) = 3i3 - 4i*2 + 9i - 10. What is the units digit of p(3)? 2 Suppose -5u + u = -16. Suppose -5v + f = -4v - u, 8 = -v + 4f. What is the units digit of v/10(-50)/(-4)? 0 Suppose -4l + 128 = 2c + 2c, 0 = 5l. Suppose -c = -4j - 0j. Suppose -3p - j + 20 = 0. What is the units digit of p? 4 Suppose -3c - 4j = -4, 5j + 0 = -4c + 6. What is the units digit of (-6)/(-8) - (-33)/c? 9 Let j = 6 - 2. What is the units digit of (-12 + 1)/((-4)/j)? 1 Let l(k) = -k*2 - 14k + 4. Let f(h) = h*3 - 6h*2 - 8h - 6. Let t be f(7). What is the tens digit of l(t)? 1 What is the units digit of (-8)/31701/(-84)? 4 What is the units digit of ((-7)/7)/((-2)/74)? 7 Let p be 50/(-20)(-4)/5. Suppose pk + 2k - 20 = 0. What is the units digit of k? 5 Let c(r) = -r*3 + 14r*2 - 3r - 27. What is the units digit of c(12)? 5 Suppose -2 = 2y - 10. Suppose -2r + y = -0. Suppose -2 = b + rf, -44 = -4b + 5f + 13. What is the units digit of b? 8 Let t be (252/(-35))/((-3)/20). Suppose 0 = -4u + u + t. What is the units digit of u? 6 Let h = 135 + -56. What is the tens digit of h? 7 Let g(k) = -k + 14. Let x(o) = o*2 - o - 3. Let s be x(-3). Let w be g(s). Suppose -4r = -wr + 6. What is the units digit of r? 6 Let q = 4 + -7. Let m = -5 - -5. What is the tens digit of 10 - q/(m - -3)? 1 Let s(x) = -x3 - 13x*2 - 4x - 19. What is the units digit of s(-13)? 3 Suppose -2m - 4t = -59 - 111, t = 2m - 170. What is the units digit of m? 5 Suppose -2s + 4 + 2 = 0. Suppose o + s = 0, -4g + 119 = 5o + 42. What is the units digit of g? 3 What is the hundreds digit of -2(-3)/6 - -156? 1 Suppose -2l + 5 = 4t - 11, 0 = 5t + 4l - 20. Suppose -t = 2s - 3s. Suppose sg - 21 = g. What is the units digit of g? 7 Suppose -5r = -15, 4r - 4 = -4t + 36. Suppose 3v + 1 = t. Suppose 0 = -2a + 6 + v. What is the units digit of a? 4 Let o(f) = f3 - 2f*2 - f + 3. Suppose -2t + 18 + 3 = 3a, 0 = 5t + 2a - 25. What is the units digit of o(t)? 9 Let w(b) be the second derivative of b3/6 + b2/2 + 3b. What is the units digit of w(3)? 4 Suppose -20j + 24j - 40 = 0. Suppose 6 = -c + j. What is the units digit of c? 4 Let u(h) = h + 7. Let f be u(6). Suppose 5n - 17 = 28. Let c = f - n. What is the units digit of c? 4 Suppose y - 4y + 18 = 0. What is the units digit of ((-4)/2)/((-2)/y)? 6 What is the units digit of 103/2 + (-4 - (-22)/4)? 3 Let f be (-3)/(9/(-6) - 0). Suppose fs - 10 = -3s. What is the units digit of 3 + (-1)/1 + s? 4 What is the units digit of 4 - 28(-4)/2? 0 Suppose -2x + 48 = -4y, -y - 3y - 8 = 0. Suppose -3z + 45 = 4n, n - 4z + x = 3n. What is the units digit of n? 2 Let o(m) = m - 31. Let p(z) = 6. Let l	{ "pile_set_name": "DM Mathematics" }
7/5 of a hour in minutes? 804 How many millimeters are there in 789.8664nm? 0.0007898664 What is seventeen sixths of a year in months? 34 What is 7/2 of a day in hours? 84 What is 1773.591 kilograms in tonnes? 1.773591 What is 6703.779mg in grams? 6.703779 How many millilitres are there in thirty-two fifths of a litre? 6400 What is 57518.793 nanoseconds in hours? 0.0000000159774425 How many milliseconds are there in 29/2 of a second? 14500 Convert 0.2749458 millilitres to litres. 0.0002749458 What is 25/8 of a litre in millilitres? 3125 How many minutes are there in 31/2 of a hour? 930 What is 226.1076 nanograms in kilograms? 0.0000000002261076 What is eleven halves of a litre in millilitres? 5500 How many meters are there in three eighths of a kilometer? 375 How many centuries are there in 946883.5 years? 9468.835 Convert 96791.1mg to nanograms. 96791100000 How many seconds are there in three tenths of a minute? 18 What is 0.4335874 centimeters in meters? 0.004335874 What is 0.8524916ng in milligrams? 0.0000008524916 How many millimeters are there in five quarters of a meter? 1250 How many millilitres are there in 13/5 of a litre? 2600 What is seven quarters of a decade in months? 210 How many years are there in 501.3958 decades? 5013.958 How many centimeters are there in 42/5 of a meter? 840 What is 3/40 of a tonne in kilograms? 75 What is 6/25 of a kilometer in centimeters? 24000 How many grams are there in 43.12434 nanograms? 0.00000004312434 What is 4211.344nm in centimeters? 0.0004211344 What is 72249.4ns in milliseconds? 0.0722494 Convert 62.9855l to millilitres. 62985.5 How many grams are there in 25.55043ng? 0.00000002555043 How many millilitres are there in 0.5203723l? 520.3723 How many micrometers are there in 3/50 of a meter? 60000 How many meters are there in 3/10 of a kilometer? 300 How many weeks are there in 3.3552274 days? 0.4793182 How many centuries are there in 809050.2 months? 674.2085 How many seconds are there in 9028.955 minutes? 541737.3 What is fourty-nine fifths of a microsecond in nanoseconds? 9800 How many weeks are there in 2144747.43 microseconds? 0.000003546209375 How many months are there in 6/25 of a millennium? 2880 Convert 85492.97 kilometers to centimeters. 8549297000 How many seconds are there in one quarter of a minute? 15 How many nanograms are there in 3/5 of a microgram? 600 What is one fifth of a microgram in nanograms? 200 How many centuries are there in 4341.632 millennia? 43416.32 Convert 25658.85 millennia to years. 25658850 How many hours are there in 11/2 of a day? 132 What is 1496.991 litres in millilitres? 1496991 What is fifty-one halves of a kilogram in grams? 25500 What is 995.373 years in months? 11944.476 How many micrograms are there in three eighths of a milligram? 375 Convert 71542.57 decades to months. 8585108.4 What is eleven halves of a litre in millilitres? 5500 What is 0.8841905 years in decades? 0.08841905 What is eleven quarters of a tonne in kilograms? 2750 How many milligrams are there in 283.6109kg? 283610900 How many hours are there in ten sevenths of a week? 240 How many months are there in 0.7316682 years? 8.7800184 What is three fifths of a millennium in decades? 60 Convert 408.944 years to millennia. 0.408944 How many weeks are there in 9.620856 nanoseconds? 0.0000000000000159075 What is one quarter of a second in milliseconds? 250 Convert 16.73452 grams to nanograms. 16734520000 How many milligrams are there in 0.8924292g? 892.4292 What is fifty-three quarters of a millennium in decades? 1325 What is 1/5 of a decade in years? 2 Convert 59162.45 millilitres to litres. 59.16245 What is seventeen quarters of a milligram in micrograms? 4250 How many centimeters are there in 3292.28 nanometers? 0.000329228 How many millimeters are there in 21/8 of a meter? 2625 How many nanograms are there in 45/2 of a microgram? 22500 What is 949143.8 micrograms in tonnes? 0.0000009491438 What is twenty-nine halves of a year in months? 174 Convert 0.8614695l to millilitres. 861.4695 What is five sixths of a day in seconds? 72000 What is 2.187192 months in years? 0.182266 How many years are there in 32/5 of a millennium? 6400 Convert 97.2108mm to micrometers. 97210.8 Convert 339.7268 years to months. 4076.7216 How many seconds are there in 26/5 of a hour? 18720 What is 26/5 of a meter in centimeters? 520 Convert 63.6941ng to grams. 0.0000000636941 Convert 712738.8 decades to months. 85528656 How many millilitres are there in fifteen quarters of a litre? 3750 How many milligrams are there in 6.031426 grams? 6031.426 What is 27945.2 millennia in centuries? 279452 How many millilitres are there in one quarter of a litre? 250 Convert 2.31103 weeks to milliseconds. 1397710944 What is 0.8998422 kilometers in millimeters? 899842.2 What is five fourteenths of a week in hours? 60 Convert 3.515622 centuries to decades. 35.15622 How many seconds are there in 4/3 of a hour? 4800 How many grams are there in thirty-two fifths of a kilogram? 6400 What is 42658.95l in millilitres? 42658950 What is 45/4 of a millennium in years? 11250 How many millilitres are there in 0.4866922l? 486.6922 What is 4/3 of a minute in milliseconds? 80000 What is 1/5 of a litre in millilitres? 200 How many millimeters are there in 0.0400388 kilometers? 40038.8 Convert 0.2845944 millennia to decades. 28.45944 What is twenty-one quarters of a litre in millilitres? 5250 Convert 0.1801726 nanoseconds to seconds. 0.0000000001801726 What is 77.32893 kilometers in millimeters? 77328930 What is thirty-seven halves of a milligram in micrograms? 18500 How many grams are there in 65.98031 milligrams? 0.06598031 How many decades are there in 350.1006 millennia? 35010.06 What is four sevenths of a week in hours? 96 How many millimeters are there in 26.21775 meters? 26217.75 How many millilitres are there in fourty-five eighths of a litre? 5625 Convert 647881.7 grams to tonnes. 0.6478817 How many micrograms are there in 5/4 of a milligram? 1250 What is eleven quarters of a microgram in nanograms? 2750 What is one quarter of a microgram in nanograms? 250 How many hours are there in 23/3 of a day? 184 What is 2.811172ml in litres? 0.002811172 How many meters are there in 4.188477 micrometers? 0.000004188477 What is twenty-nine halves of a century in years? 1450 How many months are there in twenty-nine thirds of a century? 11600 How many millimeters are there in thirty-seven halves of a meter? 18500 Convert 811726.9 litres to millilitres. 811726900 How many weeks are there in 49.708974 days? 7.101282 What is 0.9974605nm in kilometers? 0.0000000000009974605 How many millimeters are there in 1/5 of a centimeter? 2 Convert 42483.55 kilograms to milligrams. 42483550000 Convert 6048.2um to nanometers. 6048200 Convert 5267.926cm to nanometers. 52679260000 What is 13/5 of a meter in millimeters? 2600 Convert 775.7673 litres to millilitres. 775767.3 How many years are there in 15/4 of a century? 375 How many millennia are there in 8662.268 decades? 86.62268 How many millilitres are there in 55.54246l? 55542.46 How many months are there in 3/5 of a millennium? 7200 How many weeks are there in 3.006612 days? 0.429516 What is 77.09249 millilitres in litres? 0.07709249 How many milligrams are there in thirty-seven fifths of a gram? 7400 What is 19/4 of a gram in milligrams? 4750 How many millimeters are there in 46337.73 kilometers? 46337730000 How many kilograms are there in 3/40 of a tonne? 75 What is 2056.45 years in millennia? 2.05645 What is 12/25 of a millennium in months? 5760 What is 0.1397753ml in litres? 0.0001397753 What is six fifths of a millimeter in micrometers? 1200 What is 8/7 of a week in days? 8 How many litres are there in 951082.5ml? 951.0825 How many nanoseconds are there in 60.4913 seconds? 60491300000 Convert 415121.8g to milligrams. 415121800 How many seconds are there in 74652.12 minutes? 4479127.2 What is 28.61849 microseconds in milliseconds? 0.02861849 Convert 32.05912 years to millennia. 0.03205912 How many kilograms are there in three eighths of a tonne? 375 How many millilitres are there in 4.760555 litres? 4760.555 How many centuries are there in 0.6670743 months? 0.00055589525 What is thirty-one halves of a century in	{ "pile_set_name": "DM Mathematics" }
-22 + (11 - (-16 + 9))? -4 What is the value of -8 + -1 + 18 + -2 - 18? -11 3 - (-3 + (-4 - (-2 - 1)) - -4) 3 20 + -31 - ((3 - 4) + -3) -7 8 + -5 + -3 + (8 - (25 + 8)) -25 Evaluate (2 - -2 - -6) + 11 + -27 + -13. -19 0 + -2 + 5 + (48 - (13 + 60)) -22 -12 - (-2 - -7 - (8 + 5 - 8)) -12 Evaluate 10 + -9 + -4 + 2 - (6 - -2). -9 Evaluate (2 - (0 - -10)) + 88 + 3 + -46. 37 Calculate -201 + 223 - (1 + 15). 6 What is the value of 0 - -4 - 6 - (-9 - -19)? -12 -3 - (-12 - -5) - 18 - -42 28 Evaluate (-1 - 0) + -19 + (-1 - -13). -8 What is 19 + (-120 + 127 - (-2 - -15))? 13 -24 + -2 + (-6 - -13) - -8 -11 Evaluate 468 + -454 + -13 + -2. -1 What is 26 + 1 - (28 - (1 + (18 - 1)))? 17 What is (-9 - 2) + (49 - 63) + 5 + 1? -19 8 + (-1 - 13) + (-141 - -134) -13 Calculate 52 + -39 - (-11 + (10 - -47)). -33 What is the value of -202 + 198 + (12 - 1) - -2? 9 What is 4 + -2 - -3 - (12 + -4 - -2)? -5 Evaluate -13 + 1 + 2 - -8. -2 (5 - 0) + (805 - 796) 14 Calculate (-15 + 2 - (16 - 28)) + -22. -23 What is the value of 3 + (-6 - -4) - (30 + (8 - 14))? -23 Evaluate (-16 - -24 - (1 - -15)) + 5. -3 -7 - -8 - 7 - (8 + 4) - -6 -12 Evaluate -1 + (-3 + (-2 - 1) - -3) + 6. 2 What is (-15 - -32) + 11 + -32? -4 1 + -8 + 4 + 10 7 Evaluate 33 - (18 - (-18 + 17)). 14 What is -6 - (76 + -79 - (-2 + 4))? -1 What is 4 - (12 + 10 + 3 - 13)? -8 Calculate (-30 + 31 - (0 + -4)) + (-1 - 17). -13 What is (-3 - (-15 - -15)) + 21? 18 8 + (5 + 0 + -15 - (7 - 7)) -2 What is the value of 18 + (33 + -32 + 7 + 0 - 13)? 13 Calculate -14 + 1 + 8 - (-3 + -3). 1 Evaluate 962 - 964 - (1 + -5). 2 What is -3 - 1 - (-2 - 20 - (-8 - -3))? 13 What is 4 - (-2 - -5 - (-11 - -14)) - -1? 5 What is -14 - (4 + (0 - (2 + -1)) - 7)? -10 What is 17 + (-11 - (-12 + 2)) - (1 - 6)? 21 Calculate -3 + 3 + (2 - -9 - 1) - 0. 10 Evaluate 5 - (-8 + (0 + 0 - -7)). 6 22 + -7 + 15 - 30 0 What is (4 + 4 - (0 + -5)) + -5? 8 (22 - 18) + (0 - -6) 10 Evaluate -5 + (-22 - -29) - (12 - 0). -10 What is the value of 56 + -50 + (-2 - -2 - (3 - -3))? 0 What is (0 - 8) + 497 + -511? -22 What is -4 - 16 - (11 - 28)? -3 Evaluate 1 + -5 - (7 - (19 + -1)). 7 What is (17 - 2) + (-167 - -149)? -3 Calculate -49 + 28 - (-54 + -1). 34 -34 - (-64 + 37) - -22 15 Evaluate (-24 - -8) + -76 + 75. -17 What is the value of -8 + 2 + 23 + (9 - 18)? 8 What is the value of 4 - -9 - (84 + -71)? 0 Calculate -4 + (-85 - -76) + (0 - (2 - -4)). -19 Calculate (36 - (22 + -1)) + 1. 16 Calculate 22 - 1 - (377 + -368). 12 Evaluate (5 + (4 - 13) - 1) + (11 - -7). 13 Evaluate 0 - 0 - -8 - (1277 - 1269). 0 What is the value of 14 - (-2 + 7 + (-2 + 1 - 0))? 10 (4 - 1) + -6 + (-29 - -27) -5 Calculate 12 + -19 + (2 - -2) - (4 + 0). -7 What is 6 + (7 - 8) + -10 + 15? 10 What is the value of 9 + (0 - (22 + -6)) - (-2 + 2)? -7 What is 2 + -7 + 16 - (27 - -1)? -17 Calculate (-7 + -20 - 13 - -17) + -2. -25 What is the value of (-8 - -15) + 6 - (-3 - 3)? 19 1 - (-13 - (-9 + -8)) - (1 - -1) -5 What is the value of (2 - -1) + (22 - 26)? -1 4 - (2 + -18 + 12 + (2 - 6)) 12 What is the value of 6 + (-4 - (1 + -1)) + 2 + -5? -1 What is the value of (10 - 2) + -50 + 64 + 9? 31 What is (-6 - (0 + -7)) + -1 - (-2 + -5)? 7 What is the value of 1 - 3 - (14 - (21 - 11)) - -12? 6 Evaluate (1 - 6) + 0 + -17 + 1 - 9. -30 Calculate 53 + -18 - (-3 - -19). 19 Evaluate -3 + 16 + (-10 - 8 - -6). 1 (-1 - (-32 + 20)) + 1 12 18 + ((-17 - -8) + -5 - -7) 11 (0 - -2) + -6 + (-40 - -53) + -20 -11 What is the value of (-16 + 9 - -10) + -4 + (-2 - -6)? 3 -14 + 30 + (-18 - -10) 8 What is the value of 10 - 2 - (20 - (-6 + 20))? 2 What is the value of 1 + (0 - 3) + 344 + -349? -7 What is the value of -19 - (-41 + (-41 - -50))? 13 Evaluate 1 - 12 - (57 + -131 + 73). -10 Calculate (15 - (16 + -1)) + -17. -17 What is the value of -20 + 2 + 137 + -108? 11 8 - (5 + 9 + -9 + 8) -5 Evaluate -39 + 0 - (-783 - -770). -26 What is the value of (4 - 7 - 5) + 1 + 3 + 1? -3 42 + -44 + (3 - -4) + 2 7 Evaluate (64 - (-8 - -43)) + -21. 8 14 + -1 + -4 + -17 + 1 -7 (-5 - -1 - -11) + (-3 + 4 - -3) 11 What is 16 - 5 - (-11 + 11 + 15 - 19)? 15 Evaluate -8 + 4 + (8 - 7) + 0 + -5. -8 Evaluate 95 + -89 + 2 + -18. -10 What is 0 + 3 + 1 + -2 + 38 + -53? -13 Calculate (-20 - -9) + -10 - (-8 + 4). -17 Evaluate (-3 - -37) + -3 + 7 + 8 + -18. 28 What is the value of 3 - ((99 - 112) + 2 + (5 - -1))? 8 Calculate 20 - (2 - (17 - 17)). 18 8 + -36 - -7 - -35 14 (17 - (-58 + 29)) + -26 20 Calculate 14 + -15 - 7 - 3. -11 What is 14 + -24 + 7 + (-16 - 3)? -22 Calculate 30 - (0 - (-7 - (6 + 7 + -10))). 20 -2 + (31 - (5 - -13)) 11 Calculate -2 - (11 + (-17 - (18 + -10))). 12 28 + (-12 + (-1 - -18) - 12) 21 What is 7 + -6 + (15 - 12 - (-1 + 2))? 3 Calculate -8 - ((10 - -6) + -10). -14 Calculate 8 - (-1 - (-6 + -9 + 4 + 6)). 4 Evaluate 12 + -1 - (-3 + 4) - -10. 20 (-4 + -5 - -6) + 9 + (-7 - -1) 0 -4 + 9 + (-1 - -6) + 2 + 4 16 What is -2 + 17 + 3 - (-61 + 61)? 18 What is -11 - (13 + -7 + (2 - 12))? -7 -8 + -12 - -11 - (2 - 12) 1 What is the value of -12 + (30 - -11 - 29)? 0 Evaluate 3 + 27 - (2 + (4 - 5) + 7). 22 What is the value of 8 - (-12 + 11 + -2)? 11 What is (21 + -15 - (-3 + 7)) + -15? -13 What is -36 - -40 - (2 + 1 + -3 + 3)? 1 Evaluate 78 + -71 + (-10 - 2) - (-12 + 0). 7 -30 + 21 + 34 + -29 -4 Calculate -10 + -1 - (-6 + 46 + -64). 13 Evaluate (-18 - (-3 - 17)) + -4. -2 What is the value of -1 + (0 - -8) - (-1258 + 1258)? 7 What is the value of -40 + -3 + 77 - 32? 2 Evaluate (1 + -22 - (20 + -18)) + -92 + 99. -16 Calculate -31 + (-2 + 2 + 11 - 0). -20 What is the value of 4 - (6 + (3 - 16))? 11 What is -19 + 0 + (30 + -18 - -16)? 9 (-8 + 7 - -15) + -1 + -14 -1 What is 0 + 19 - (3 - (-43 + 44))? 17 Calculate 12 + 34 + -57 - (29 - 0). -40 What is -98 + 103 - (19 - -2)? -16 (-8 - -40) + -9 - 4 - (-2 + 3) 18 What is (3 + -1 - (244 - 248)) + -33? -27 What is the value of 14 - (16 + 5 + -11)? 4 (28 - (2 - -35)) + 2 -7 What is 23 - 8 - (-8 + 29)? -6 Calculate -2 + (1 - (0 + 0)) + -245 + 251. 5 What is the value of (60 - 53) + (-9 - 0) + -4? -6 Calculate 87 - 104 - (3 - 3). -17 Calculate (-31 - -64) + (-5 - 9 - 3). 16 Evaluate 42 + 20 + -49 + -22. -9 What is 12 + (-11 - -4) + -12 - -23? 16 What is -10 - (-5 - -6 - (-2 + 7 + -10))? -16 -18 + -7 + -16 + (31 - 8) -18 Evaluate (12 - (-14 - -23) - 3) + -10. -10 Calculate -1 - 14 - (-3 + 1 - (35 + -34)). -12 Evaluate (-47 - -33 - 0) + (28 - 6). 8 Evaluate -23 + -1 + 1082 + -1035. 23 Calculate -629 + 654 + -38 + 0. -13 Evaluate 7 + (25 + -24 - 23). -15 What is the value of (-21 - -13) + 30 - 35? -13 Evaluate (4 - (12 - 10)) + (-1 - -7). 8 What is the value of (11 - (-14 + 9 - -9)) + 10? 17 Evaluate 7 - 1 - ((-15 - -36) + -19). 4 9 + -13 + -3 + (-2 - 2) -11 Evaluate 12 + (8 - 3) + -24. -7 0 + -1 + -12 + 5 + -4 -12 What is the value of 0 + 4 + (-34 - -20)? -10 Calculate -2 + -9 - (87 - 90). -8 Evaluate -8 + 20 - ((14 - (8 - 1)) + 3). 2 -2 + 14 - 8 - (2 - 24) 26 ((-9 - -1) + (38 - 47) - 1) + 8 -10 6 + 1 + (14 - 11 - 9) + 3 4 Calculate -7 + (11 + -2 - 4) + 0 + -4. -6 -6 + 1 + (-1 - ((5 - 7) + -10)) 6 Evaluate -8 + 12 + 1 + -10 - (15 - 0). -20 What is the value of 5 + (-22 + 23 - (0 + 1))? 5 32 + -11 + -10 + -2 9 What is 1 - (-11 + (11 + -3 - -1))? 3 What is the value of (4 - 6) + -7 + (4 - 0)? -5 Calculate 0 + 6 - (2 + 2 - (-7 + 7)). 2 What is the value of 7 + 0 + (-204 - -184)? -13 -705 + 650 + -2 + 32 -25 What is 2 - (8 + -6 - 11 - (-4 - 0))? 7 Evaluate (8 + -5 - (56 + -45)) + (-2 - 0). -10 What is the value of -42 + (16 - 1 - -8)? -19 What is -23 + (-16 + (16 - 6) - (-3 + -13))? -13 Evaluate -176 - -178 - (-3 - 1). 6 What is the value of -7 - 3 - -17 - (15 + -3)? -5 -2057 + 2086 - ((0 - 0) + 2 - 0) 27 What is the value of (14 + (4 - 10) - (-10 + 2)) + 0? 16 What is the value of 15 + (-17 + -10 - 5) + 7? -10 Calculate 6 + 10 + -9 - (2 + (1 - 1)). 5 Calculate 0 + -10 + 0 + -10 + (-17 - -26). -11 What is (-55 - -52) + 3 + -2 - (1 - 18)? 15 Evaluate 14 - (1 - -31 - (11 - -2)). -5 Calculate (17 - 25) + 31 + -19. 4 Calculate 28 - ((-1 - -2) + -1 - (119 + -129)). 18 What is the value of -6 + (-3 - (-21 + 13))? -1 What is 2 + (-10 + -10 - -12) - -7? 1 What is the value of 6 + 4 + -13 + 1 + -6 + 35? 27 (-149 - -167) + (-35 - 5) -22 What is the value of (-4 - (-20 - -16)) + -13 + 0? -13 Calculate -20 - (-7 + (-7 -	{ "pile_set_name": "DM Mathematics" }
1)/(((sqrt(66) - (sqrt(66) - (sqrt(66) - sqrt(66)-1))) + sqrt(66) + sqrt(66))/sqrt(6)) + (-1sqrt(847) - (0 + sqrt(175)))2. sqrt(7)/4 + 1792 Simplify ((sqrt(133) + -1sqrt(133)-1 + 2sqrt(133)2)-6)/((-2sqrt(21)2)/(sqrt(3)1-5 + sqrt(3))). -36sqrt(19) Simplify 5(((sqrt(297)1 - sqrt(297))-1)/sqrt(11) + (2sqrt(162))/sqrt(6) + 2). 10 + 30sqrt(3) Simplify 3(2(sqrt(1188) + sqrt(1188)2 + sqrt(1188)))/((sqrt(99) - 2sqrt(99))/sqrt(9) - sqrt(66)/sqrt(54)). -108sqrt(3) Simplify -1 + (-3 + (sqrt(50)/(3sqrt(10) + sqrt(10)) - (sqrt(210)/sqrt(6))/sqrt(7)))-53 + 1. 45sqrt(5)/4 + 45 Simplify (-5(2 + -2 + sqrt(125) + 1 + sqrt(125))1 + 4 + 3)2. -200sqrt(5) + 12504 Simplify ((-3(sqrt(65) - 2sqrt(65)))/(sqrt(5) - -4sqrt(5)1) + sqrt(364)/sqrt(7) + (3 + (sqrt(13) - sqrt(13)4))2)-4. -504 + 308sqrt(13)/5 Simplify -4 + ((sqrt(468) - (sqrt(468) - (sqrt(468) - -2sqrt(468)-2)))/(-1sqrt(1296) + sqrt(9)))/((sqrt(40)/sqrt(5))/sqrt(2) + sqrt(24)/(sqrt(30)/sqrt(5))). -4 + 3sqrt(13)/22 Simplify -3((sqrt(99)2 + 0 - (sqrt(99) + 0 + sqrt(99) + 3))3 + sqrt(99) + -2(2sqrt(99) + sqrt(99)) + sqrt(99) + 0 + -5 + sqrt(99))*2. -3261 - 756sqrt(11) Simplify -5 + 5 + -3 + ((sqrt(242) + sqrt(242) + 0)*22 + sqrt(242) + ((sqrt(242) + -1 - sqrt(242))4)2 - (-2 + sqrt(242) + 0)3). -22sqrt(2) + 1955 Simplify (1 + -5 + sqrt(2736)4 + -3 + (-4 + sqrt(2736) + 1 + sqrt(2736) + sqrt(2736) - 2((sqrt(2736) - (sqrt(2736) - 1sqrt(2736))) + sqrt(2736)))4)2. 361 Simplify -2((-2(3 + sqrt(117) + (1 + sqrt(117) - sqrt(117)) + 1 + sqrt(117))1 + 0)-6)2. -141984 - 17280sqrt(13) Simplify (sqrt(231)/(sqrt(7)-1) - (sqrt(33) + 1sqrt(1188)))/(4(sqrt(300)2 - sqrt(300))) + -4. -4 - sqrt(11)/5 Simplify (1(-5(sqrt(396) + -2 + sqrt(396) + 4sqrt(396)) - ((-6(0 + sqrt(396) + sqrt(396)) - sqrt(396)) + sqrt(396) - (-4 + sqrt(396) + -1))))*2. -1020sqrt(11) + 114469 Simplify 1(((sqrt(300) + -1)-1)*2 - (-5(sqrt(3) + 2) + sqrt(3) + 4))-6. -1842 + 96sqrt(3) Simplify (-3(sqrt(80)/(sqrt(15)/sqrt(3)) - (sqrt(1024) + (sqrt(1024) - (sqrt(1024) - (sqrt(1024)-1 - sqrt(1024)))))))/(-5(6sqrt(96)/sqrt(3))/sqrt(4)). 9sqrt(2)/10 Simplify (-3 + (sqrt(624)1 - sqrt(624))/sqrt(12) + (3sqrt(130))/sqrt(10) + sqrt(78)/sqrt(6)3)5. -15 + 30sqrt(13) Simplify (sqrt(13) + ((sqrt(416)/sqrt(8))/sqrt(4))*2 - 1(-2 + sqrt(13))) + (-5(sqrt(91)1 + sqrt(91)))/(sqrt(28)/sqrt(4)6). -5sqrt(13)/3 + 15 Simplify 6((-2sqrt(720) - (sqrt(20) + sqrt(20) + (sqrt(500) - 2sqrt(500) - sqrt(500)) - sqrt(20) - sqrt(20)))/(2sqrt(144)-6) + -5). -30 + sqrt(5)/6 Simplify 3(5(sqrt(1872)2 - sqrt(1872)))2 - (((2 + sqrt(1053))2 - sqrt(1053))3 + sqrt(1053))2. -180sqrt(13) + 134058 Simplify (1sqrt(171)-2-2 - 5(sqrt(19) + sqrt(209)/sqrt(44) + (sqrt(76)-2 + sqrt(76))/sqrt(4)))*2. 6859/4 Simplify (5sqrt(2432)-26)/(((sqrt(100) - (sqrt(100)-2 + sqrt(100) - sqrt(100) - sqrt(100) - sqrt(100)))/sqrt(5))/(sqrt(160)2)). -768sqrt(19) Simplify ((sqrt(190) + -6-1sqrt(190))/(-6sqrt(10)-1))2 + (sqrt(1900) + 0 + sqrt(1900) - sqrt(1900) - 3sqrt(171)) + 0. sqrt(19) + 931/36 Simplify (-4(sqrt(99) + (sqrt(99) - (sqrt(99) - (sqrt(99) - (sqrt(99) + -1sqrt(99)))-3))) + 4sqrt(99)-5-3)*23. 1373328 Simplify (-5 + (sqrt(1008)-1 + sqrt(7))2-5)2 + (sqrt(49) - sqrt(588)/(4sqrt(12)))/(sqrt(7) + (sqrt(7) - 5sqrt(448))). -8480 - 3sqrt(7)/152 Simplify (((sqrt(75) + 0 - sqrt(75)) + 3)-1 + -52(sqrt(75) + -1) + -5)2 + 2. -200sqrt(3) + 7506 Simplify -5(-3((3 + sqrt(200))5 + -1(sqrt(200) + -3 + sqrt(200))) + 0)*2. -95580 - 48600sqrt(2) Simplify -1 + -2((1 + sqrt(288) - sqrt(288)) + 5) + (-4 + sqrt(98) - (-3 + sqrt(18))). -14 + 4sqrt(2) Simplify ((((sqrt(252)-2 - sqrt(252)) + 1)-23-4)*2 + -2)-3. -3920826 + 62208sqrt(7) Simplify ((2 + 5-1(5 + -4(-1 + sqrt(425) - sqrt(425)) + 0))-5)2. 46225 Simplify (-1(4sqrt(153)-1)/(2sqrt(9)-1 + sqrt(9)))*24 + 3. 1091 Simplify (-63(-2(sqrt(75) + 1sqrt(75)) + sqrt(75)))*2 + (1-2-1sqrt(75)3)2 + 5. 221405 Simplify (sqrt(1100)1 - sqrt(1100) - sqrt(99)5 - (-5 + (sqrt(11) - 2sqrt(11)) + -4))*2 + -2. -252sqrt(11) + 2235 Simplify (sqrt(1573) + sqrt(1573) + -4 + sqrt(1573) + sqrt(78)/(sqrt(6)-5) + (sqrt(325)-4 - 1sqrt(39)/sqrt(3)))2. -472sqrt(13)/5 + 45653/25 Simplify ((sqrt(270)/sqrt(5))/sqrt(2) + sqrt(27) - (sqrt(27) - (sqrt(27) + 1)-6)) + (2 + (sqrt(2187)1)*2 - sqrt(2187))6. -177sqrt(3) + 13128 Simplify 3(sqrt(495)/(sqrt(9) + (sqrt(9) - sqrt(225)))1)/(sqrt(275)34). -sqrt(5)/60 Simplify ((-4(sqrt(300) + 0) - (0 + sqrt(300) + 1sqrt(300) + sqrt(300))) + -1((-3 + 1 + sqrt(3) + sqrt(3) - sqrt(3)) + (sqrt(36)/sqrt(4))/sqrt(3)))*2. -288sqrt(3) + 15556 Simplify 6(-2-3sqrt(4032) + 3 + (sqrt(1372)2 + -5 - (sqrt(1372) - -4(sqrt(1372)-2)*2))). -131724 + 948sqrt(7) Simplify -5 + ((sqrt(125) + -1)-3 - sqrt(125) - -3(sqrt(125) + (sqrt(125) - sqrt(125)1) + sqrt(125))) + -4(-3 + (sqrt(125)2)2)-3. 10sqrt(5) + 5962 Simplify 3(-6(((sqrt(125)2 + -4)*2 - sqrt(125)) + (-1sqrt(125) + 4)*2 - (5 + (sqrt(125) - -2sqrt(125)) - (5 + (0 + sqrt(125) - sqrt(125))))) + 5). -11811 + 2520sqrt(5) Simplify (sqrt(8)/sqrt(64) - sqrt(8)/sqrt(4)-5 - (2sqrt(180))/sqrt(10))2 - (1sqrt(512))/((sqrt(24)4)/sqrt(6)). -2sqrt(2) + 9/8 Simplify (-1 + (5(3 + (sqrt(272) - (sqrt(272) + 0))) + (sqrt(272) - (sqrt(272)1 + sqrt(272))6 - (5 + sqrt(272) + -1)))2)-2. -78576 + 2112sqrt(17) Simplify 0 + -1 + (2 + 6(-5 + 1sqrt(242) + -3))2. -6072sqrt(2) + 10827 Simplify (sqrt(484)-2)/(sqrt(12)/(sqrt(6) + sqrt(12)/sqrt(2))) - ((sqrt(8)2)*2 - (sqrt(128)-3)*2). -44sqrt(2) + 1120 Simplify (sqrt(60)/(sqrt(54) + sqrt(6)) - (sqrt(110) + 2sqrt(110))/sqrt(11))/(-1sqrt(98)-4 + sqrt(98))5. -11sqrt(5)/28 Simplify (5 + (642sqrt(1377) + 4 - (sqrt(1377) + (sqrt(1377) + -1)-4 - ((sqrt(1377) - (sqrt(1377) + -1 + sqrt(1377) + sqrt(1377)) - sqrt(1377)) + -2))))2. 3456sqrt(17) + 3172624 Simplify (-1 + 2 + (4(sqrt(242) + 0 + sqrt(242)) - 4(sqrt(242) + 4)))*2. -1320sqrt(2) + 4097 Simplify -3((sqrt(81)/sqrt(36))/(sqrt(21)/(sqrt(7) - (sqrt(7) - sqrt(21)/sqrt(3)))) + ((-5(0 + sqrt(108) + sqrt(108)))*2 - ((sqrt(108) + -1)5)*2)). -24225 - 1803sqrt(3)/2 Simplify (((sqrt(84) - (2sqrt(84)2 - sqrt(84))) + sqrt(84) + sqrt(84))/(sqrt(36)/sqrt(150)))/((-2sqrt(28)/sqrt(2))/(sqrt(6)/(-2sqrt(3) - sqrt(3)))). 0 Simplify ((5sqrt(81)-2 - sqrt(81))/(sqrt(75)2))/(sqrt(9) + (sqrt(9) - sqrt(27)/sqrt(3))4 + -2sqrt(441)). 11sqrt(3)/130 Simplify 0 + (43sqrt(833) + -2 + 2 + sqrt(833) + sqrt(833) + 2 + sqrt(833)2 + 3 + -4)2. 224sqrt(17) + 213249 Simplify 4 + (((-3sqrt(2299) + sqrt(2299))2 + sqrt(2299))-5)2 - (sqrt(2299) - -3(1 + sqrt(2299)))*235. -34616 - 3960sqrt(19) Simplify -4 + (-2 + 1sqrt(1053) - (((sqrt(1053) + 1)-2)*2 - sqrt(1053)) - (2 + 0 + (1sqrt(1053) + sqrt(1053))*2 + 0)). -8436 - 54sqrt(13) Simplify ((2sqrt(144))/sqrt(12)3)/(-1sqrt(64) - (sqrt(4) + sqrt(64)1)) + 3. -2sqrt(3)/3 + 3 Simplify -4 + (-5(6(sqrt(833) + (sqrt(833) - (0 + sqrt(833))) - sqrt(833) - sqrt(833) - sqrt(833))1 + -1sqrt(833) + -4 + sqrt(833)-2 + 2))*2. 10500sqrt(17) + 4685721 Simplify ((sqrt(117)/(sqrt(6)/sqrt(2)))/(sqrt(60)/sqrt(5)))*2 - -1(4sqrt(1053)1)2. 67405/4 Simplify 2 + (-1 + sqrt(425) + sqrt(425))2 + -1 + sqrt(833)1 + (2(sqrt(153)4 - sqrt(102)/sqrt(6)-6))*2. -13sqrt(17) + 23734 Simplify ((4(sqrt(1200) + -2) - (sqrt(1200) + -21sqrt(1200))) + (3 + 3 + sqrt(1200))-2)*2. -2400sqrt(3) + 11200 Simplify (0 + sqrt(208))-4 + 2 + (-3((-2 + sqrt(208) + sqrt(208))*2 - sqrt(208)) - (sqrt(208) + 2 + 3)) + 3. -2508 + 88sqrt(13) Simplify -2(2 + sqrt(168)/((sqrt(84)/sqrt(2))/sqrt(7)) + 5(sqrt(28) + 1 + -1sqrt(112)))2. -994 + 224sqrt(7) Simplify -3 + ((-1-3-1sqrt(170)-5)/(16(sqrt(160) - (sqrt(160) + sqrt(160)2))))2. -343/256 Simplify (sqrt(76) + 0 - sqrt(76)) + -5 + (-3 + (sqrt(76) - (sqrt(76) - (sqrt(76) - (sqrt(76) + 2)))))2 + (2-5sqrt(76)-1 + -2)*2. -80sqrt(19) + 7624 Simplify (5((sqrt(99) - -5sqrt(99)1) + sqrt(99) + -3(sqrt(99) - (sqrt(99)1 + sqrt(99)))))/(6-1sqrt(81)-2). 25sqrt(11)/18 Simplify 3((sqrt(1584) + -1 + 4 + sqrt(1584) + -2 + sqrt(1584	{ "pile_set_name": "DM Mathematics" }
late the highest common divisor of v and 7. 7 Let v(n) be the first derivative of 2n2 + 4n - 9. Let x be v(4). What is the greatest common divisor of x and 180? 20 Suppose 23 = 4d - t, 4d - 8 - 21 = -5t. Suppose 3k - 5k = -d. Let b(h) = h2 - 11h + 3. Let l be b(12). What is the highest common factor of k and l? 3 Let a(f) = 2f2 + 50f + 83. Let q be a(-24). Calculate the greatest common factor of q and 147. 7 Suppose 0l + 2l = 3u - 436, 0 = 3u - 3l - 438. Let m = u - 74. What is the highest common divisor of 10 and m? 10 Suppose 2 = s - 2. Suppose sd + i + 27 = 92, 66 = 3d - 5i. What is the greatest common factor of 136 and d? 17 Let w be 14(-11)/(77/(-4)). Calculate the highest common divisor of w and 56. 8 Let z = 604 + -541. What is the greatest common factor of 27 and z? 9 Let l(p) = -4p + 1. Let i(f) = f + 1. Let x(q) = 6i(q) - 6l(q). Let v be x(3). Let b = v - 50. Calculate the greatest common divisor of b and 20. 20 Let f(d) = d*3 + 9d*2 + 11d + 5. Let x be f(-4). Suppose -4y + x = 3w, -3w + 8 = 5y - 44. What is the highest common factor of 55 and y? 11 Let n(q) = -12 + 3q + 360q*2 - 15q - 358q2. Let o be n(9). Calculate the greatest common divisor of o and 14. 14 Let u be -8 - 12/(-3) - -33. Suppose -m + 89 - u = 0. Suppose 5i - m - 25 = 0. Calculate the greatest common factor of 17 and i. 17 Let l(s) = -38s - 458. Let x be l(-13). Let m(z) = -2z*3 - 2z*2 + 2z. Let n be m(-2). Calculate the highest common divisor of n and x. 4 Let m(v) = 2v2 + 6v - 3. Let s be m(4). Suppose -3k + b + s = 0, 4b - 40 = -0k - 2k. What is the highest common factor of k and 6? 6 Let h(y) = -14y - 4. Suppose -3 - 8 = i + 2c, 5i - 4c = -27. Let n be h(i). Let m be 1n + (-4 - -6). Calculate the highest common divisor of m and 12. 12 Suppose -3k - 127 = -2527. What is the greatest common factor of k and 32? 32 Let m = 1118 + -1029. What is the greatest common factor of m and 178? 89 Let w(g) = -12g2 + g - 1. Let m be w(1). Let y be ((-124)/m - -3)3. Suppose 3d = -12, 5d = 3z + 2z - y. What is the greatest common factor of 32 and z? 4 Let i(v) = 79v3 - v2. Let p = 0 + 1. Let l be i(p). Let k = l + -33. Calculate the greatest common factor of 15 and k. 15 Suppose -2c = 11 + 21. Let h = 29 + c. Suppose 109 = m + s, 0 = 2m - m + 3s - 119. What is the greatest common divisor of m and h? 13 Let q(r) = r + 5. Let i be q(-13). Let k be (-7 - i)/(2/4). Suppose ky = 4y + c - 257, 516 = 4y + 4c. What is the greatest common factor of 16 and y? 16 Let c = 3 - 1. Suppose -2l + 2d - 2 = 0, -4l - 1 + 5 = -cd. Suppose -m + 3u = -30, lu - 22 = -7. Calculate the greatest common divisor of 5 and m. 5 Let y be (405/(-3))/((-7)/7). What is the highest common factor of 378 and y? 27 Suppose -3c + 4 = -c. Suppose -g - 89 = -2t - cg, -t + 47 = -2g. Calculate the greatest common factor of t and 27. 9 Let c be ((-632)/(-14))/1 + 20/(-140). Suppose 2k = 3l + 33, -k + 3l = -33 + 9. Calculate the greatest common divisor of k and c. 9 Let a(r) = -r2 + 4r + 13. Let g be a(6). Let w(q) = -2q + 3. Let p be w(-4). What is the highest common factor of p and g? 1 Let y be (-2)/9 - (-160)/72. Suppose z = -yz + 93. Let b = z - 25. Calculate the greatest common divisor of 66 and b. 6 Suppose 0 = 9t - 4t - 60. Calculate the highest common divisor of 78 and t. 6 Let d = -131 + 236. Suppose d = 2g + 5m, -2g + 135 = -m - 0m. What is the highest common divisor of g and 5? 5 Suppose 295w = 155w + 8820. Suppose 3r + 4q - 74 = 0, -5q + 21 = -4. What is the highest common factor of r and w? 9 Suppose -28 = 9t - 226. Suppose -66 = -0i - 2i. Calculate the highest common divisor of t and i. 11 Suppose 10r = 12 + 168. What is the highest common divisor of 42 and r? 6 Suppose -41l + 27832 = 30l. What is the highest common divisor of 490 and l? 98 Let p(r) = -r2 - 33r - 8. Let m be p(-9). Calculate the greatest common divisor of m and 16. 16 Let v(o) be the third derivative of 3o2 + 1/10o*5 + 0o - 1/6o4 + 0o*3 + 0. Let c be v(3). Calculate the highest common divisor of 6 and c. 6 Let h = 19 - -25. Suppose 0 = -8t + 12t - 416. Let g = -38 + t. What is the highest common factor of g and h? 22 Suppose -3b - 64 + 7 = 0. Let p = 35 + b. What is the greatest common factor of p and 4? 4 Let d = -299 + 331. Suppose -5h = -w - 244, 2h + 3w + 0w = 84. Calculate the greatest common divisor of h and d. 16 Suppose -2v - 25v + 2592 = 0. Suppose 5k - 56 = 24. Calculate the greatest common divisor of k and v. 16 Suppose 48 = -c + 4c. Suppose 2i - 4o = -i + 9, 3o = 2i - 7. Let k be (-9)/ic/12. Calculate the greatest common factor of 132 and k. 12 Let u be 26/13((-399)/(-6))/7. What is the greatest common divisor of u and 3914? 19 Let n be -3 - 5/(5/(-3)). Let w be 9 - 5 - n/1. Suppose 0q = -wq + 572. Calculate the greatest common factor of 13 and q. 13 Suppose -3o + 2y = -30 - 19, -3y = 3o - 69. Let h(n) = -35n - 1. Let v be h(-6). Calculate the greatest common factor of o and v. 19 Let j(l) = 4l + 5. Let w(z) = 4z + 5. Let r(t) = 5j(t) - 6w(t). Let v = -531 - -527. Let p be r(v). Calculate the highest common factor of p and 1. 1 Suppose s = 3n - 4s + 7, 0 = 2n - s. Let i = n + 10. Calculate the greatest common factor of i and 11. 11 Let z be ((-2)/3)/(10/(-1170)). Let b(c) = 8c3 - 4c*2 + 2c. Let x be b(2). Calculate the highest common factor of z and x. 26 Let b = -5 - -49. Let u = -35 + b. What is the highest common factor of u and 54? 9 Let i = 650 + -460. What is the greatest common divisor of i and 30? 10 Let a = -1192 + 2207. What is the highest common factor of 35 and a? 35 Suppose -1590 = -8v - 534. Calculate the greatest common factor of 308 and v. 44 Suppose -5o + 3n = -127 + 29, -20 = -5n. What is the greatest common factor of o and 11? 11 Let l = 30 + -9. Let c be 2/(-9) + (-130)/(-18). Calculate the greatest common divisor of l and c. 7 Let r(b) = -2b2 - 2b*3 + 9b*2 - b + 7b + 3b3 + 15. Let z be r(-6). Let h be (-3)/(z/24 + -1). What is the highest common factor of 88 and h? 8 Suppose i + 9i = 20. What is the highest common divisor of 4 and i? 2 Let k be (-223)/(-5) - (-2)/5. Suppose 8a - 30 = 3a - 5g, 0 = -5a + 4g - 6. Let b = a + 16. Calculate the greatest common factor of k and b. 9 Suppose -y + 2h - 11 = -31, 3y = -3h + 69. Suppose -685 = -8r + 723. Calculate the greatest common divisor of r and y. 22 Let i(l) = -l3 - 2l. Let u be -1 - (-4 - 9/(-3)). Let k be i(u). Suppose 0 = 3z - kz - 9. Calculate the highest common divisor of z and 3. 3 Suppose -7f = -533 - 195. Let m be (4-1)/((-16)/f). What is the greatest common divisor of m and 2? 2 Let m = 520 - 288. Let z = 1105 + -1076. What is the greatest common divisor of z and m? 29 Suppose -4d = -2p - 3p + 5, 0 = 5d + p - 30. Suppose 3w = 3o - 42, -w = do - 5w - 66. Calculate the highest common factor of o and 40. 10 Suppose -51i + 56 = -44i. Let z(n) = n*2 + n - 2. Let w be z(2). Calculate the highest common factor of w and i. 4 Suppose 4q = p + 516, -16 = -2q + p + 240. Calculate the highest common divisor of 10 and q. 10 Let p be ((-602)/(-215))/((-1)/(-15)1). What is the greatest common divisor of p and 140? 14 Let z(u) = -2u3 - 38u*2 - 3u - 26. Let h be z(-19). Calculate the highest common divisor of h and 1984. 31 Suppose 10 = 5f, -4q + f + 174 = 2f. Calculate the greatest common divisor of q and 1591. 43 Let d(k) = -k2 - 3k + 2. Let v be d(-5). Let b = 5 + v. Let h be 1/(b/6) + 44. What is the highest common factor of 6 and h? 6 Let b(m) = -7m + 197. Let k be b(27). Calculate the highest common divisor of 488 and k. 8 Let t be -43/(-12)7. Let m = 4 - t. Let p(i) = 6i*2 + 4i + 3. Let x be p(m). Calculate the highest common factor of 9 and x. 9 Suppose 220q - 616 = 192q. Calculate the greatest common divisor of q and 1298. 22 Let w = 102 + -100. Suppose -wn - 9n = -22. Calculate the greatest common divisor of n and 6. 2 Let o = 2 + 13. Suppose -q - q = -20. Let z be 154/q + 4/(-10). What is the highest common divisor of z and o? 15 Let w = 25 - 19. What is the highest common divisor of w and 54? 6 Let p = 33 + -34. Let a be	{ "pile_set_name": "DM Mathematics" }
i? 7 Suppose -43o + 48o = 3p - 472, -5o = 3p - 482. What are the prime factors of p? 3, 53 Let x(s) = 5s*2 + 6. Let g be x(-3). What are the prime factors of (-3)/(-1 + g/54)? 2, 3 Suppose 2i = 123 - 33. Let l = i + -10. Let u = l - 20. List the prime factors of u. 3, 5 Let u = -18 + -10. Let t(p) = -p - 1491. Let n be t(0). What are the prime factors of n/u - 6/(-8)? 2, 3 Let m(l) = l*3 - 5l*2 - 6l. Let u be m(6). Suppose -5p + 542 = -up - 2f, 2p - 218 = 2f. What are the prime factors of p? 2, 3 Let d(l) = l2 + 11l - 9. Let k be d(-12). Suppose -kv = 2g + 55 - 181, 179 = 3g + 2v. What are the prime factors of g? 3, 19 Let l = 114 + -80. What are the prime factors of l/8 - (-30)/40? 5 Let f(i) = -i*3 + 5i*2 - 2i - 23. Let v be f(5). Let p = 91 + v. What are the prime factors of p? 2, 29 Suppose -4r + 5u = -56 - 1, -2 = r + 2u. Suppose 6c - 239 = 3c - w, 4w - r = 0. What are the prime factors of c? 79 Suppose 0 = 4a - 6a + 14. Let b(q) = -q*2 + 14q - 7. Let x be b(14). What are the prime factors of 1 + 2 + a + x? 3 Suppose 3u = 2q - 25, 3q + 5u + 9 = -1. Suppose 2d - 1125 = -5h, -94 = -h - qd + 131. What are the prime factors of h? 3, 5 What are the prime factors of 17/((-170)/(-13120)) - -1? 13, 101 Let s(i) = -i2 - 7i - 8. Let r be s(-5). What are the prime factors of 201/r60/45? 2, 67 Let i(p) be the second derivative of 4p + 13/2p2 - 1/12p*4 + 0 - 1/3p*3. List the prime factors of i(-4). 5 Suppose 129m + 40900 = 139m. What are the prime factors of m? 2, 5, 409 Suppose 0 = -5i + 10 - 0. Suppose 4n + 0n = ip - 22, -34 = -4p + 3n. Suppose 0 = -4d + 67 - p. List the prime factors of d. 3, 5 Let z = 258 - 142. Let k = z - 98. List the prime factors of k. 2, 3 Let g(s) = -16s - 217. What are the prime factors of g(-35)? 7 Let o be (-12)/(1 + 3) + 3 + 4. Let b = o - -98. List the prime factors of b. 2, 3, 17 Let c = 21 + 129. List the prime factors of c. 2, 3, 5 Suppose 0 = -r - 3, o + 24r - 27r = 952. What are the prime factors of o? 23, 41 Suppose 5w - 24 = -x + 5x, 11 = 4w + 5x. Suppose 3m + 2k = -2k + 95, -126 = -wm - 5k. List the prime factors of m. 29 Let x = 109 + -107. What are the prime factors of ((-1750)/5)/((-2 - x) + 2)? 5, 7 Suppose 0 = 11q - 12q + 9. Suppose 39 = -3s + q. Let o = s - -14. What are the prime factors of o? 2 Suppose -320w + 328w - 5000 = 0. List the prime factors of w. 5 Suppose -7w + 690 = 3w. Let x = w + -29. List the prime factors of x. 2, 5 Let b(a) = -a - 1. Let w be b(-3). Let n(r) = -r2 - 7r - 2. Let l be n(-6). Suppose u + lz - 28 = 0, wu + 5z - 44 = z. What are the prime factors of u? 2 Let c(m) = 21m + 9. List the prime factors of c(11). 2, 3, 5 Suppose 5t - 3 = 7. Suppose 4c = 2m + 3m + 55, tc + 85 = -5m. Let q = m - -49. What are the prime factors of q? 2, 17 Suppose 18s - 7920 = -0s. List the prime factors of s. 2, 5, 11 Suppose -7j = -4j + 9. Let a be ((-5)/(-3) - 2)j. Let s(v) = 74v2 - v + 2. What are the prime factors of s(a)? 3, 5 Let c(b) = b3 + 51b2 + 93b - 34. What are the prime factors of c(-48)? 2, 17, 71 Suppose 0 = 113f - 120f + 476. What are the prime factors of f? 2, 17 Let t = -5 + -51. Let q = -22 - 57. Let g = t - q. What are the prime factors of g? 23 Let x(a) be the second derivative of -a5/20 - a4/4 + a*3/6 + 3a*2 - 7a. Let o be x(-6). Suppose k + o = 4k. List the prime factors of k. 2, 3 Let b = -8 + 12. Suppose bm = -8, 0 = c + 4c + 5m. Suppose 0 = -cu + 3u - 10. What are the prime factors of u? 2, 5 Let f be (-5)/(-2) + 2/(-4). Suppose -2s = 6, -f - 7 = 3c - 2s. What are the prime factors of (4 + c)/(1/(-5))? 5 Suppose -3k + 13 + 11 = 0. Let f(a) = -a*3 + 8a2 + a + 3. Let w be f(k). Suppose 0 = v - w + 4. What are the prime factors of v? 7 What are the prime factors of (-94)/329 - 45434/(-14)? 5, 11, 59 Let f(p) = -p3 - 10p2 + 7p + 18. Suppose -3a + z - 30 = -0z, -z = 3. List the prime factors of f(a). 2, 31 Let l(m) = -66m - 553. List the prime factors of l(-10). 107 Let b(c) = c3 - 12c*2 - 10c - 31. Let w be b(13). What are the prime factors of 10/((18/w)/9)? 2, 5 Let f = -163 + 776. List the prime factors of f. 613 List the prime factors of (-8 - -15)/(-7)(-755 + -2). 757 Let m(s) = 3s*2 - 3 + 7 - 98s + 93s. Let z be ((-12)/(-10))/(3/10). What are the prime factors of m(z)? 2 Let v be 1 + 21/(-2). Suppose -l - 3z - 38 = v, -4l - 45 - 55 = -z. List the prime factors of 3/((-6)/l) + -2. 11 Suppose -y + 20 = 8. Suppose -5m + y - 2 = 0. List the prime factors of (m/(-2))/((-2)/34). 17 Suppose 0d + 6 = -6d. Let l be d + (-4)/(2 + -3). List the prime factors of (320/(-30))/((-1)/l). 2 Suppose -229 = 10k - 3079. What are the prime factors of k? 3, 5, 19 Suppose 4o - 12 = -k + 50, -3o - 4k = -53. Let i = o - 9. List the prime factors of 10/15 - (-122)/i. 3, 7 Let o(k) = 5k*2 + 8k - 5. List the prime factors of o(4). 107 Suppose 0 = 4f - 236 - 200. Suppose -2o = -4w + 274, -4w + 5o + f + 150 = 0. What are the prime factors of w? 71 Suppose -13p + 5o = -14p + 344, 2p - 4o - 660 = 0. List the prime factors of p. 2, 167 Suppose 8 + 2 = -4q - 2l, q + 4 = -l. List the prime factors of (-22 - 14)/(2q). 2, 3 Suppose 3l + 2v - 2999 = -0l, 4v = 5l - 5035. List the prime factors of l. 17, 59 Let v(y) = 2y + 480. What are the prime factors of v(29)? 2, 269 What are the prime factors of (-416)/(-8) + -2 + 7 - 1? 2, 7 Suppose -19 = -4l - 3. Suppose 3w - l - 20 = 0. List the prime factors of 220/w + 3/6. 2, 7 List the prime factors of (3860/(-80))/((3/20)/(-3)). 5, 193 Let p(c) = -14c*2 - 15c - 20. Let g(k) = -9k2 - 10k - 13. Let l(b) = -8g(b) + 5p(b). What are the prime factors of l(4)? 2, 7 Let q = 7336 - 4278. List the prime factors of q. 2, 11, 139 Suppose -5u + 4u + 38 = 0. Let p be 2 + -2 + -1 + u. Suppose -11 - p = -3w. What are the prime factors of w? 2 Let w be 2375/10 - ((-2)/(-4))/1. Let a = w - 119. List the prime factors of a. 2, 59 Let s = -16 - -20. Suppose 3l + s = 1, 111 = c - 3l. What are the prime factors of c? 2, 3 Let g be 96/(-5) + (-5)/(-25). Let w = 16 - g. List the prime factors of w. 5, 7 Let v(a) = 11a + 1. Let x be (-22)/428/(-14). Suppose 0c - 5c = -2w + 31, 3w + 4c = -x. What are the prime factors of v(w)? 2, 17 What are the prime factors of (0 + 16/(-40))/((-4)/16060)? 2, 11, 73 Let k(x) = -116x - 88. List the prime factors of k(-11). 2, 3, 11 Let c = 46 - -1. Let i = -14 + c. What are the prime factors of i? 3, 11 Let t(l) = 269l + 1. Let a be t(1). Let c = -276 - -278. Suppose 4b - a = -cb. What are the prime factors of b? 3, 5 Suppose -1122 = -312x + 306x. What are the prime factors of x? 11, 17 Let r(v) = -212v + 154. What are the prime factors of r(-12)? 2, 19, 71 Let d be 2/8 + (-7)/(-4). Let v be d/3 + (-352)/24. Let w = v - -33. List the prime factors of w. 19 Let q be ((-6)/4)/(3/18). Let s = 14 + q. Suppose -sk - 120 = -405. List the prime factors of k. 3, 19 List the prime factors of (-1649)/(-153) + -11 + (-28163)/(-9). 3, 7, 149 Suppose -3n - 5x + 7 = 0, -n = 4n - 2x + 9. Let y be (n + 14/(-4))-14. Suppose -f - 4v - 3 = v, 4f + 5v = y. List the prime factors of f. 2, 11 Let w(u) = -u*3 + 18u*2 - 17u - 5. Let x be w(17). Let z = x + 27. What are the prime factors of z? 2, 11 Let u = 75 + -415. List the prime factors of 2/(-8) - u/16. 3, 7 List the prime factors of 1-5 - (9 - 284). 2, 3, 5 List the prime factors of (-5)/1(-14 - 86). 2, 5 Let q(t) = -t + 58. Let v be q(0). Let s = v - 37. List the prime factors of s. 3, 7 List the prime factors of (-13 - -6 - -5) + 44 + 1. 43 Let y = -44 - -43. List the prime factors of (-2)/2(-1)/(y/(-71)). 71 Suppose -2x - 2n = 0, -5x + 2n + 22 - 1 = 0. Suppose -xi + 43 + 89 = 0. What are the prime factors of i? 2, 11 Let h(z) = z*3 + 10z*2 - 4z - 8. Suppose -3m - 15 = 15. Let x be h(m). Let q = 71 - x. List the prime factors of q. 3, 13 Let t(v) be the second derivative of v3/2 - 2v*2 + 3v. Let s be t(2). Suppose -sn + 7n + w - 229 = 0, 74 = 2n - 4w. What are the prime factors of n? 3, 5 Let p = 3357 - 2327. List the prime factors of p. 2, 5, 103 Let s(g) = -4g - 8g**3 +	{ "pile_set_name": "DM Mathematics" }
= 2b. Let g(s) = um(s) + h(s). Give g(0). 7 Let o(d) = 8d2 + 10d*2 - 29d*2 + 18d2 + d3 - 37. Calculate o(-6). -1 Let f(n) be the third derivative of 1/24n4 - 1/15n*5 + 5n*2 + 5/6n*3 - 1/120n*6 + 0 + 0n. Let o be 36/(-10) + (-2)/5. Determine f(o). 1 Suppose -g - 3h = -486, 0h + 5h - 1462 = -3g. Let t = -493 + g. Let y(c) = 3c2 + 5c + 3. Give y(t). 31 Suppose 4f + 9 = -8q + 5, -3f = 3q - 3. Let u(t) = t*2 + 7t + 9. What is u(q)? -1 Suppose -2k + 3q + 1 = 0, -5q + 7 + 4 = 3k. Let d be (132/(-24))/((-1)/k). Suppose 3h = -d - 1. Let p(n) = -n2 - 5n + 1. Calculate p(h). 5 Let x(q) = -35q3 + 16q*2 + 11q + 8. Let u(a) = 9a3 - 2a*2 - a + 1. Let w(c) = -4u(c) - x(c). What is w(-5)? -52 Let w(y) = 4y + 11. Let u(j) = -j. Let p(a) = 3u(a) + w(a). Let f be (-24)/20(-40)/6. Suppose 2h - 4c = -f, -c - 3 = -1. What is p(h)? 3 Let x(r) be the second derivative of r4/12 + r2/2 - 26r. Let z be (-7 - (2 + -5)) + 56/(-7) + 6. Determine x(z). 37 Let y be ((-16)/(-40))/((-4 - -2)(-3)/30). Let r(u) be the second derivative of -7/2u*y + 0 - 7/12u*4 - 1/20u*5 + 5u - u*3. Determine r(-6). -7 Let w(o) = 102o - 12. Let v(n) = 28n - 4. Let b(q) = 7v(q) - 2w(q). Give b(2). -20 Let b(r) be the third derivative of 53r*2 + 1/2r*3 + 0r + 0 + 1/24r4. Determine b(1). 4 Let b(q) = -q - 9. Let n(a) = 5 + 7 - 11 + 0. Let t(i) = -b(i) - 2n(i). Let l be -7 + -1 + 10 + -5. Give t(l). 4 Let a(h) = 61h - 24. Let v(q) = -14q + 6. Let c(d) = 2a(d) + 9v(d). Determine c(6). -18 Let d(m) = 3m3 + 722m*2 - 382m*2 - 2m*3 + 35 + 47m - 366m2. What is d(24)? 11 Let v(j) = j3 + 8j*2 + 13j + 29. Suppose 248b - 142b = 133b + 189. Give v(b). -13 Let l(b) = b2 - 2b - 19. Let v be l(7). Let r be 27/6v/3. Suppose -5o + 5c + 25 = -5, -r = -4o - 3c. Let g(i) = -i + 3. Determine g(o). -3 Let b(z) = z3 - z2 + 1. Let w(q) = -3q*3 + 50q*2 + 98q + 106. Let m(p) = 2b(p) + w(p). Give m(50). 8 Suppose -2l = 3n - 4n - 11, 0 = 5l + 2n - 5. Let b(k) = 4k2 + 1 + 2k - lk2 + 10k*2 - 3k*2. Let u be -4 - 1 - (14 - 18). What is b(u)? 7 Let n be 25/3 + -6(-26)/(-468). Let i(h) = -h*3 + 6h*2 + 14h - 7. Determine i(n). -23 Let u(c) be the third derivative of 0 + 1/8c4 - 1/60c*5 - 1/2c*3 + 0c - 128c2. Determine u(2). -1 Let c(n) = -n2 - 3 + 18n + 5 + 6. Let f = 139543 - 139525. Determine c(f). 8 Suppose -5z - 9 + 39 = 0. Let d(v) be the third derivative of v4/24 - 11v*3/6 + 2v*2 - 126. Determine d(z). -5 Let h(c) = -13c + 78. Let v be (14/12 + -1 - 1)(15 - 21). Determine h(v). 13 Suppose -26 = 4u - 378. Let w(b) = -ub + 2 + 87b + 0 + 9. Determine w(10). 1 Let f(d) = -d*2 + 21d + 32. Suppose -25a + 8l = -24a - 70, 4l + 90 = 3a. What is f(a)? 10 Let r(h) = 2h*2 + 2h - 16. Let w be (-6)/(-14) + 24/336-76. Determine r(w). 24 Let p(i) = -10i - i2 + i3 - 5 + 8i + 0i*2 + 10 + 0. Give p(0). 5 Let j = 205 + -211. Let w be ((-15)/9 - -1)j. Let x(v) be the second derivative of -v*4/12 + 5v*3/6 + 3v*2/2 - 5v. Calculate x(w). 7 Let v = 30 + -23. Let a(u) = vu2 + 3u*2 + 1 + 3 - 11u2. Let z(s) = s2 + 4s - 4. Let i be z(-4). Determine a(i). -12 Let c(x) be the second derivative of 2x4/3 - x3/6 - 5x2 - 3x - 431. Calculate c(-2). 24 Let p(n) = n*2 - 13n - 27. Let a be p(15). Suppose s - ah = -2s + 18, -4h - 8 = 4s. Let u(r) = 5r3 - r2 + 2r - 1. Give u(s). 39 Let l(j) = j. Let t = 35 - 36. Let f be l(t). Let k(p) be the second derivative of 5p4/6 + p3/6 + p2/2 - 10p. Give k(f). 10 Suppose -73k + 117 = 44k. Let j(v) = -v2 + v - 3. Give j(k). -3 Let t(c) = -c3 - 4c2 + 7c + 3. Suppose 5w + 238 = -d + 212, -4w - 10 = -d. What is t(d)? 33 Let u(z) = 3z2 + 24z + 25. Let j be u(-7). Let b(x) = -j - 27x - 4 + 4 + 3. Give b(-1). 26 Suppose 184w - 284w = -138w + 114. Let d(n) = n*2 - 54n + 147. Determine d(w). -6 Let b(g) = -2g - 6. Let f = -3 + 8. Let v = 600 - 595. Suppose fo = 25, -p - vo + 17 = -3. What is b(p)? 4 Suppose -46c = 230 - 46. Let k be c + 2 + 5 + -4. Let s(h) = 56h + 1. Give s(k). -55 Let p(s) = -4s*2 + 7s - 9. Let i be (-2)/(-12)-4(15 + -18). Give p(i). -11 Let u(c) be the third derivative of -c6/30 + c5/60 - c4/6 + c3/2 - 45c2 - 3c. Let b = 35 + -33. Calculate u(b). -33 Let g(h) = -h - 2. Let n(u) = -u*2 - 27u - 8. Let c be n(-26). Suppose o + c = 7o. Let q(i) = -3i - 5. Let d(l) = oq(l) - 8g(l). Give d(1). 0 Let w = -26 - 41. Let o = 59 + w. Let f(z) = -z*3 - 7z*2 + 7z + 8. What is f(o)? 16 Suppose -53x + 16 = -49x. Let t(c) = -22c2 + 0c - c + 20c2 - x + c3 - 2c. Give t(3). -4 Let z(y) = -y - 1. Let v(s) = 24s + 20. Let h(o) = 2v(o) + 44z(o). Let m be (12/(-9))/((-24)/(-54)). Give h(m). -16 Let s(x) be the third derivative of -5x4/24 + x3/2 + 49x2. Let h(v) = v - 1. Let o(m) = h(m) - s(m). What is o(-3)? -22 Let f(g) = g + 26. Let h(s) = 2s + 37. Let m(b) = -4f(b) + 3h(b). Determine m(-7). -7 Let q = -128 - -667. Let r(t) = -1 + qt - 5 + 541t - 1081t. What is r(-2)? -4 Let h(p) = p2 + 5p + 2. Let a = 43 - 38. Let f(v) be the second derivative of -v4/12 + v3/2 + 7v2/2 - 2v. Let c be f(a). What is h(c)? -4 Let l(v) = 12 - 409v + 774v + 83 - 356v. What is l(-11)? -4 Let w(d) = -d3 + 4d*2 - 10d + 1. Suppose -23m + 34 = -12. Let n(c) = 2c*3 - 3c*2 + 11c - 2. Let o(s) = mn(s) + 3w(s). What is o(-7)? 6 Let m(u) = 2u3 - 5u*2 + 5u - 3. Suppose -2x - 488 = -42. Let i = x + 226. Calculate m(i). 21 Let l(k) be the third derivative of -k4/6 + k3/3 - k2 - 929k. Give l(9). -34 Let b(f) = -f*3 - 3f*2 + 4f + 4. Let x(a) = 2a2 + 4a - 28. Let i be x(-5). Suppose -3m + 32 = -5r - 0, 4 = r + im. Calculate b(r). 4 Let z(r) = -r3 + 2r*2 + 27. Let x be z(0). Suppose -9 = 2j - x. Suppose -jf = -5f - 8. Let i(g) = 2g2 + g - 1. Give i(f). 9 Let t(p) = p3 + 3p*2 + 4p + 5. Let f(l) = -l*2 - 3l. Let x be f(0). Suppose x = 23n - 3n + 80. Give t(n). -27 Suppose -3o = -2u - 46, -52 = -9o + 7o - 4u. Let q(z) = oz + 15 + z*2 - 5 - 2z*2 - 5z. What is q(14)? -4 Suppose 0 = 3s + 3w + w - 5, 14 = 4s - 2w. Suppose -2b + 15 = 4d - sd, -b + 3d - 3 = 0. Let o(z) = -28 - 4 + b - z. Determine o(0). -26 Let n(a) be the first derivative of 21a2/2 + 121a + 112. Calculate n(-6). -5 Let d be (58/(-290))/(2/(-2650)). Let s = d + -263. Let m(n) = 4n + 1. Let v(b) = -13b - 4. Let w(x) = 7m(x) + 2v(x). What is w(s)? 3 Let x be 0 + 183/99 - (4030/143 - 28). Let b(o) be the first derivative of xo3 - 1/4o*4 - 5 + 4o - 2o2. Calculate b(4). 4 Let k(a) = -17a*2 - a + 12. Let n(u) = -30u*2 - 3u + 20. Let t(f) = -7k(f) + 4n(f). What is t(-8)? -28 Let v(y) = 3y2 - 11y. Let n be v(4). Let o(t) = t*3 - 5t*2 + 7t - 6. Let q be o(n). Let j(i) = -i + 7. Give j(q). 1 Suppose -111c = -125c + 182. Let q(r) = -2r - 1. Calculate q(c). -27 Let l = 848 - 854. Let u(a) = a - a - 5 - 3a + 0a. Let v(r) = -3r - 4. Let g(y) = -4u(y) + 3v(y). Calculate g(l). -10 Let d(x) = x*3 + 14x*2 + 13x - 9. Let f be d(-13). Let v = f + 12. Let s(o) = -o*3 + 3o*v + 3o*3 - 2 + 6o + 5o2 - 6o*3. Give s(6). -2 Let y(d) = -5d*3 - 4d*2 - 3d. Let k(h) = -16h3 - 13h*2 - 8h + 7. Let z(x) = 2k(x) - 7y(x). Calculate z(-2). -12 Let i = -218 - -114. Let u = i + 109. Suppose 4t + 0t - 8 = h, -2t + uh = 14. Let y(z) = 2z + 3. Determine y(t). 9 Let j(y) = -y3 + 4y*2 + 15y - 11. Let k be 667/(-29) + 29 - (0/1)/2. Determine j(k). 7 Let b(n) = -n*3 - 6n*2 + 7n + 3. Let j = -416 - -698. Let x = j - 289. Determine b(x). 3 Let o(f) = 60f3 + 110f*2 + 98f + 44. Let l(k) = -19k3 - 36k*2 - 32k - 15. Let c(i) = -19l(i) - 6o(i). Give c(-23). 90 Let n(r) = -r*3 - 43r*2 + r + 46. Let w be n(-43). Let q(s) = -10 - 149s*w - 32s*2 + 6s + 150s3 + 24s*2. Let g be (-2)/342/(-4). Calculate q(g). -17 Let u(h) = -24h - 441. Let l(j) = 11j + 203. Let z(t) = -13l(t) - 6u(t). Let n be (4/8)/(1/10). Suppose 13 = -nv - 12. What is z(v)? 2 Let n(h) be the second derivative of -h5/20 + 5h*4/12 + 2h3/3 + h2/2 - 12738*h. Determine n(6).	{ "pile_set_name": "DM Mathematics" }
om {x: 1, f: 1, w: 2, y: 1, o: 1, d: 1}. What is prob of sequence yx? 1/42 Four letters picked without replacement from ssqvq. What is prob of sequence svqq? 1/30 Calculate prob of sequence hz when two letters picked without replacement from {z: 1, h: 11}. 1/12 Four letters picked without replacement from vvivvpip. Give prob of sequence vvvp. 1/35 Two letters picked without replacement from {f: 10, i: 4}. Give prob of sequence fi. 20/91 What is prob of sequence ajaj when four letters picked without replacement from ajjjajjaaajaa? 21/286 What is prob of sequence ruru when four letters picked without replacement from ururruxxru? 1/35 Three letters picked without replacement from {w: 6, v: 12}. Give prob of sequence vwv. 11/68 Two letters picked without replacement from pxxkxbbxkbbvxkxvbbxk. Give prob of sequence px. 7/380 Four letters picked without replacement from {e: 3, g: 4, j: 1, d: 10}. Give prob of sequence ejed. 1/1224 What is prob of sequence icc when three letters picked without replacement from cccccicccccccccccc? 1/18 What is prob of sequence ap when two letters picked without replacement from apappaaaaapp? 35/132 Four letters picked without replacement from {d: 4, q: 2, i: 3, c: 2}. Give prob of sequence iqqi. 1/660 Calculate prob of sequence jg when two letters picked without replacement from gagjgvjggpaia. 5/78 Calculate prob of sequence fncz when four letters picked without replacement from {a: 1, m: 2, n: 1, c: 3, z: 2, f: 6}. 1/910 What is prob of sequence jpp when three letters picked without replacement from {f: 1, j: 4, p: 2}? 4/105 Four letters picked without replacement from {l: 7, k: 4, t: 1, i: 2, f: 2}. What is prob of sequence tfli? 1/1560 Two letters picked without replacement from {w: 4, e: 1, i: 3, x: 2, b: 2}. What is prob of sequence bx? 1/33 Calculate prob of sequence bbvb when four letters picked without replacement from bbvbbbvvbvvbb. 14/143 What is prob of sequence mjj when three letters picked without replacement from {j: 3, m: 2}? 1/5 Two letters picked without replacement from {p: 5, l: 2, a: 9}. What is prob of sequence aa? 3/10 What is prob of sequence arar when four letters picked without replacement from {w: 3, r: 5, a: 3}? 1/66 Calculate prob of sequence lixi when four letters picked without replacement from {c: 2, i: 3, l: 13, x: 2}. 13/9690 Calculate prob of sequence ggxx when four letters picked without replacement from xmfggxgg. 1/70 Two letters picked without replacement from gbggbggbgg. What is prob of sequence gb? 7/30 What is prob of sequence kzsm when four letters picked without replacement from sssmmzszbzsmkbzmk? 1/357 Calculate prob of sequence ne when two letters picked without replacement from lnnnoeenoeneeetnt. 9/68 Two letters picked without replacement from {e: 7, y: 1, g: 1, k: 3, t: 2}. Give prob of sequence tk. 3/91 Calculate prob of sequence vt when two letters picked without replacement from vbbbttptbvtttbvtb. 21/272 Three letters picked without replacement from {o: 1, n: 1, y: 5, e: 6, p: 1}. What is prob of sequence nep? 1/364 What is prob of sequence mp when two letters picked without replacement from ddpmtpddd? 1/36 What is prob of sequence fzd when three letters picked without replacement from {d: 4, j: 4, f: 1, z: 4, b: 1, p: 1}? 8/1365 Three letters picked without replacement from rrhhrvrvirhvrrrvvh. Give prob of sequence rhv. 5/153 Three letters picked without replacement from umkjujdggjgmkkgjuujj. What is prob of sequence jmg? 2/285 Calculate prob of sequence ww when two letters picked without replacement from {p: 3, a: 1, w: 5, g: 3, c: 7}. 10/171 Calculate prob of sequence rsp when three letters picked without replacement from rrssbrprpsbwbs. 4/273 What is prob of sequence af when two letters picked without replacement from ddafdddsdsdsdsddd? 1/272 Four letters picked without replacement from csbsbbbc. What is prob of sequence sbsc? 1/105 Calculate prob of sequence aa when two letters picked without replacement from maaaaamamaaaamam. 11/24 Four letters picked without replacement from {w: 1, z: 6, b: 3, r: 3}. Give prob of sequence wrzz. 3/572 Three letters picked without replacement from dqqakqqqzaqdqzaqqdqz. What is prob of sequence dkq? 1/228 Three letters picked without replacement from {a: 1, e: 3, l: 3, x: 7}. Give prob of sequence lal. 1/364 Four letters picked without replacement from {j: 2, s: 2, e: 9, y: 5}. What is prob of sequence sjje? 1/2040 Three letters picked without replacement from {d: 2, s: 9, x: 2, y: 1}. What is prob of sequence yds? 3/364 Calculate prob of sequence yyoo when four letters picked without replacement from {y: 3, o: 1}. 0 What is prob of sequence kw when two letters picked without replacement from {x: 2, w: 6, n: 3, u: 1, k: 1}? 1/26 Three letters picked without replacement from {t: 4, n: 2, i: 8}. What is prob of sequence nit? 8/273 Two letters picked without replacement from {t: 7, j: 2, o: 7}. Give prob of sequence jj. 1/120 Calculate prob of sequence izf when three letters picked without replacement from fcizffi. 1/35 Calculate prob of sequence btbt when four letters picked without replacement from bttqtqbb. 3/140 Three letters picked without replacement from kwbwgwdw. What is prob of sequence gdb? 1/336 Four letters picked without replacement from qhqnqnn. What is prob of sequence nnnh? 1/140 Two letters picked without replacement from pzpzppzzzpzzzzozppz. What is prob of sequence zz? 55/171 Four letters picked without replacement from vayylayayalyvaavayya. Give prob of sequence lvva. 4/4845 Calculate prob of sequence vm when two letters picked without replacement from {v: 3, r: 1, m: 6, s: 2, u: 4, p: 3}. 1/19 Calculate prob of sequence dc when two letters picked without replacement from dddcdddc. 3/14 Four letters picked without replacement from {t: 14, u: 5}. Give prob of sequence uutt. 455/11628 Three letters picked without replacement from leegejleeelgjllele. Give prob of sequence gll. 5/408 What is prob of sequence tz when two letters picked without replacement from {z: 4, t: 4, a: 1, k: 1, v: 1, s: 1}? 4/33 Four letters picked without replacement from lddlllllll. What is prob of sequence lddl? 1/45 Four letters picked without replacement from {i: 4, k: 7}. Give prob of sequence iiii. 1/330 Three letters picked without replacement from {x: 3, z: 5, w: 1, j: 1, n: 2, l: 1}. Give prob of sequence xxx. 1/286 Four letters picked without replacement from {i: 15, u: 5}. What is prob of sequence uiiu? 35/969 What is prob of sequence mm when two letters picked without replacement from pmmxzmmukmxxm? 5/26 Calculate prob of sequence fff when three letters picked without replacement from {f: 3, b: 17}. 1/1140 Three letters picked without replacement from {y: 1, w: 5, i: 10, r: 4}. Give prob of sequence wiw. 5/171 Three letters picked without replacement from ayyaaqzssyayyqbay. What is prob of sequence qqa? 1/408 Two letters picked without replacement from {a: 3, b: 7, x: 8}. What is prob of sequence aa? 1/51 Two letters picked without replacement from snas. What is prob of sequence sa? 1/6 What is prob of sequence bjzw when four letters picked without replacement from jxqwzxb? 1/840 Three letters picked without replacement from {c: 5, u: 3, i: 3}. Give prob of sequence uui. 1/55 Four letters picked without replacement from lbljllmbjzbmlmbmbmmj. What is prob of sequence jmjm? 1/646 What is prob of sequence xe when two letters picked without replacement from xxexeee? 2/7 Three letters picked without replacement from zxhlxunh. Give prob of sequence hul. 1/168 What is prob of sequence iicc when four letters picked without replacement from {e: 1, c: 2, u: 1, i: 5}? 5/378 Two letters picked without replacement from {j: 2, i: 1, e: 1, b: 2, k: 6, z: 3}. Give prob of sequence jz. 1/35 Calculate prob of sequence rruu when four letters picked without replacement from {u: 2, r: 5}. 1/21 Three letters picked without replacement from {h: 2, a: 7, g: 1, p: 2}. What is prob of sequence hgh? 1/660 Calculate prob of sequence faet when four letters picked without replacement from faeaaeeecettee. 1/572 Calculate prob of sequence kk when two letters picked without replacement from {m: 1, k: 3, i: 3}. 1/7 What is prob of sequence urbo when four letters	{ "pile_set_name": "DM Mathematics" }
ose -k + 5k = -2f + 5530, k = 5f - 13781. Is f a composite number? True Suppose 5h + 3 = 8. Suppose 21 = b - 2s, -s + h + 21 = 2b. Is b composite? False Let j(a) = a*3 + 27a*2 + 11a - 40. Is j(-22) prime? False Let l(w) = -4w2 + 3. Let b be l(-3). Suppose -11 = -t - 34. Let y = t - b. Is y composite? True Let s(t) = -t2 - 6t - 6. Suppose -5a = -2k - 10, 4k - 2a + 0a - 12 = 0. Let w be s(k). Let y = -40 - w. Is y a composite number? True Is (-3882)/(-4)(-10)/(-15) a composite number? False Suppose -2x + 3v = 45, -2v + 10 = x + 3v. Let d(l) = -l*3 - 5l*2 + 36l - 17. Is d(x) a composite number? False Suppose -2c - c = 0. Suppose c = j + 15 - 184. Suppose u - j = 30. Is u prime? True Let y(z) = 4z - 2z - 5z*2 - 3 - z + 3z*3. Let u(a) = 3a - 2. Let s be u(2). Is y(s) prime? True Let d be 4304/32 + 2/4. Suppose -d = -5j - 10. Let y = j + 9. Is y a composite number? True Suppose 9k - 5083 = 7850. Suppose -3x + 9924 = -k. Is x composite? True Let h(k) be the second derivative of 13k5/2 + k4/12 - k3/3 + k2 + 29k. Is h(1) a composite number? False Is (-96936)/(-72) + (-4)/3 a prime number? False Let z be (2749/(-3))/(1/(-3)). Suppose -3k + m = 5m - 2765, z = 3k - 4m. Is k prime? True Is -4 + (-8)/(48/(-20214)) composite? True Is (21/6 - 3)8098 prime? True Let k = 47 + -75. Let m = k - -65. Is m composite? False Suppose 28b - 11b = 216563. Is b a prime number? True Let q be 10/40 + (138/8)/3. Suppose 2j - qj - 1224 = -4p, 5p = -5j + 1540. Is p a composite number? False Let b(h) = -h3 + 10h*2 - 5h + 3. Let s be b(9). Let w be 4 + s + -3 + 1. Let z = w + 42. Is z a prime number? True Suppose -1664 = -4i + 4v, -2i + 4i + v - 835 = 0. Let x = -194 + i. Is x composite? False Suppose 0 = -7g + 3g + 484. Let d = -24 + g. Is d prime? True Let v = 11914 + -7003. Suppose 0 = -0z + 3z - v. Is z prime? True Let u = -878 - -2800. Let i = u + -395. Is i a composite number? True Suppose 1373 = -4o - 4887. Let j = o - -2444. Is j composite? True Let y = -8 - -19. Suppose 4n + 2 = 3f, 0f + 4f - y = -3n. Is (4/(-12))/(n/(-921)) a prime number? True Let a = 618 - -225. Is a composite? True Let p(z) = -z*2 + 7z. Let c be p(7). Suppose c = h + 138 - 8. Let t = h - -236. Is t a composite number? True Let i(a) = -1998a3 + 5a*2 + 8a - 8. Is i(-3) prime? True Let p(r) = 554r + 81. Is p(13) a composite number? False Let o = -70 - -72. Suppose -oa - 779 = -7a + 2b, -2a + 320 = -5b. Is a a composite number? True Let o(f) = -221f + 9. Is o(-2) a prime number? False Let r(p) = p3 + 4p*2 + 5p + 2. Let n be r(-3). Let t(g) = g*2 + 2g - 1. Let d be t(n). Suppose -b - d + 386 = 0. Is b a prime number? True Suppose -751 - 2092 = -4u - 5c, 0 = -2u - 2c + 1422. Let q = u - -411. Is q composite? False Let k = 64 + -42. Let r be k + 1(1 - 4). Let y = 98 - r. Is y a composite number? False Is 42/126 - 4610/(-3) composite? True Let d(p) be the second derivative of p4/12 - 4p3/3 - p2/2 - 16p. Is d(22) composite? False Suppose f + 2j = -0f - 10, -2f - 5j - 20 = 0. Let s be (-1)/(-2) - 45/f. Suppose -2v - 760 = -7v - 5m, sv = 3m + 736. Is v composite? False Suppose -99a + 1756 = -103a. Let y = a + 1002. Is y a composite number? False Let q(o) be the second derivative of 9o4/2 - 2o*3/3 + 3o*2/2 + 16o. Is q(2) a prime number? True Let s be 2 + (5 - -11532) - (-6)/(-2). Suppose -x + s = 4m - 0m, -4m + 5x = -11560. Is m a prime number? False Suppose 0 = -9l + 10975 + 5162. Is l prime? False Suppose 17 - 27 = -5o. Suppose of + 2218 = 3f. Is f prime? False Suppose -52u - 3339 = -55u. Suppose -4l = -5l + 5v + u, 0 = 2l + 4v - 2296. Is l composite? True Is (-2)/(6/(-30729)) - (-7 - -3) prime? True Suppose 4a + t + 1083 = 5962, -6110 = -5a + t. Let o = 1150 + a. Is o composite? False Let x(n) be the first derivative of 11n*3/3 - 19n*2/2 + 4n - 3. Let t(p) = 7p2 - 13p + 3. Let c(u) = -7t(u) + 5x(u). Is c(9) prime? True Is ((-1)/3 - -1)/((-102)/(-102969)) composite? False Suppose -4x + 78 = j, -5j + 6j = 2. Is x prime? True Is 16/(-56) + (-4208016)/(-28) + 1 a prime number? True Suppose -3a + 4260 + 16621 = m, -3m + 2a + 62599 = 0. Is m a prime number? False Suppose 135914 = 38q - 896888. Is q composite? False Let j(u) = -u2 - 2u + 2. Let w be j(0). Suppose wx + 3 = 9. Let f(v) = 2v3 + v2 + v + 1. Is f(x) prime? True Let r = -211614 + 296773. Is r a composite number? False Suppose 3f = 4y - 31, 3f = 5y - 48 + 13. Suppose -u = 3t - 655, u + yu = 3t + 3347. Is u composite? True Let l(g) = 3034g - 143. Is l(15) a prime number? False Suppose 12y - 7y = 0. Suppose y = -0p - 2p, 0 = -c - 3p + 653. Is c composite? False Let l(k) = -19k*3 - 2k + 1. Let o be l(1). Let d be ((-52)/o + -3)5. Let i(f) = -7f*3 - 2f - 1. Is i(d) prime? True Let w = -17603 + 31222. Is w a prime number? True Let f(m) = -m*2 + 13m + 7. Let b be f(13). Let r be 6 - (-2 + (-4)/(-1)). Suppose -4h = -3w + bw - 2244, 0 = rw - h - 2254. Is w prime? True Suppose -3o = 4k - 7640, -7k + 2k - 2o + 9543 = 0. Is k prime? True Let u(v) = -58v3 - v2 - 4v + 1. Let m(f) = -57f3 - f2 - 3f + 1. Let r(j) = 3m(j) - 2u(j). Is r(-2) a prime number? True Let z(y) = 15y*3 + 4y*2 + 46y - 80. Is z(7) prime? False Let n = -716 + 19. Let r = n + 3402. Is r prime? False Suppose -41227 = -4t + 5j + 31119, 18095 = t + 3j. Is t a prime number? True Let v = 21756 + -15518. Is v composite? True Let z(c) = -c - 1. Let q(f) = 8f - 14. Let a(p) = -q(p) + 4z(p). Let r be a(-5). Suppose s = 3s - r. Is s prime? False Let y = -7 + 11. Suppose 4c + 8 = 0, -2m = -3m + yc + 129. Is m a composite number? True Let c = 21 - 20. Let v be c + 2 + (-1 - -1). Is v/2 + 3/2 a prime number? True Let z = -34 + 19. Is 51/z + 3 + 5414/10 composite? False Suppose 4c - 8 = -8. Suppose 2j - 87 - 143 = c. Is j prime? False Let g(a) = a*3 + 8a*2 - 4a + 8. Let c be g(-6). Suppose n = -3n + 2796. Suppose -5u - c = -n. Is u composite? True Let y be (-30)/(-45)(-1 + -2). Is (-17 - -1375)/((-4)/y) a prime number? False Let a(p) = 84p3 - p2 - 5p + 9. Is a(2) a composite number? True Let c(j) = j3 - 6j*2 - 3j + 2. Let u be c(6). Is 3/(-12) + (-15476)/u a composite number? False Is 12(-204378)/(-12) prime? False Let o(v) = v + 1. Let m be o(3). Suppose m = 2d + 3w, 0 = -0d - d + 4w + 2. Suppose 3r = l + 57, dr + 3l - 38 = -0r. Is r a prime number? True Is (-6)/(24/34)(1 - 587) a prime number? False Suppose -3j = -4l + j - 1168, -l - 300 = 3j. Let b = l - -1072. Is b prime? False Let w(c) = 6c2 - 15c + 17. Suppose -3x + 4 = 40. Is w(x) a composite number? False Let n = 143 + -139. Suppose 2b + 5q = 4106, -10481 + 2269 = -nb - 3q. Is b prime? True Let p = -9 - -11. Let v(x) = -7x*2 + 3 - x + 21x*p - 4. Is v(2) a composite number? False Let u = 17 - 15. Suppose -3n = un + 5. Is 91/(-14)(n - 13) prime? False Let s be (1500/16 - 3)(-24)/(-9). Let f = 409 - s. Is f a prime number? True Suppose -4r + 5 + 8 = 5p, 2r - 3p = 1. Let w be 256 + 1(r + -1). Suppose w = k - 74. Is k prime? True Let l(u) = u*2 - 8u - 9. Let k be l(9). Suppose -5h - 216 = -2a - 720, k = 5a + h + 1287. Let n = 516 + a. Is n a composite number? True Let t = 5501 - 468. Is t composite? True Let k(g) = -g3 + 9g*2 - 3g + 5. Let u be k(8). Suppose 5s = 165 - u. Let x = 13 + s. Is x a prime number? True Let a = 56 - 57. Is -2 - (a + (1 - -2)-414) a prime number? False Is 12300 + 2/(-2) + (18 - 16) prime? True Suppose -13397 = 139q - 140q. Is q a composite number? False Let o(l) = -395l + 16. Is o(-15) composite? True Suppose -2v + 212 = 2678. Let y = 233 - v. Is y composite? True Suppose 3j + 3o - 21201 = 0, -5j + 3o + 11362 = -23973. Is j a composite number? True Suppose 3c - 215 = -74. Suppose 2m - 6m + 24 = 0. Suppose -ma - 23 = -f - 2a, a + c = 3f. Is f composite? True Let t(q) be the third derivative of -1/24q4 + 3/20q*5 + 0 + 0q + q*2 + 1/6q3. Is t(6) a prime number? False Let t = 240 - -3251. Is t prime? True Let k(m) = m2 + 48m - 189. Is k(-58) prime? False Let p be (-8)/(-4)(-10)/(-4). Suppose -39 = p*n + 3	{ "pile_set_name": "DM Mathematics" }
t(204)/(sqrt(96)/sqrt(72)))*2 + 0. 153 Simplify 0 + sqrt(17) + 1 + -5sqrt(68)/sqrt(4). -4sqrt(17) + 1 Simplify ((-2 + 0 + sqrt(5))2 + sqrt(5) + sqrt(5)-1 + -2)-6. -42 + 24sqrt(5) Simplify -5(-5 + (sqrt(432)-2 - sqrt(432)) + -4). 45 + 180sqrt(3) Simplify (-1 + sqrt(567) + -3 + sqrt(567))2. -144sqrt(7) + 2284 Simplify ((3 + sqrt(76)/sqrt(4) - sqrt(19)) + -1 + sqrt(1539))*2 + sqrt(57)/(sqrt(363)2). 793sqrt(19)/22 + 1543 Simplify (1 + sqrt(153) + -1 + sqrt(153) - sqrt(153))2. 153 Simplify -3(sqrt(7) - ((sqrt(7) - sqrt(448)) + 0)). -24sqrt(7) Simplify (0 + sqrt(18))2 + sqrt(22)/(sqrt(33)/sqrt(3)). sqrt(2) + 18 Simplify 2 + (sqrt(126)/(sqrt(24)/sqrt(4)))/(sqrt(343)2 - sqrt(343)). sqrt(3)/7 + 2 Simplify (sqrt(120)/sqrt(4))/sqrt(10) + (0 + sqrt(3) + 1 + sqrt(3))*2. 5sqrt(3) + 13 Simplify (sqrt(432) - (sqrt(432) + (-1 + sqrt(432) - sqrt(432)))*2)3 + (-3sqrt(432)2)*2. 108sqrt(3) + 14253 Simplify (sqrt(165)/(sqrt(3)1))/(sqrt(44)/sqrt(4)4). sqrt(5)/4 Simplify ((sqrt(120)/sqrt(3)3)/sqrt(8))2. 45 Simplify (sqrt(12)/(-1sqrt(6)) - (-4 + (sqrt(2) + sqrt(8)/sqrt(4) - sqrt(2))))*2. -16sqrt(2) + 24 Simplify 0 + (sqrt(19) + sqrt(38)/sqrt(2))5-6. -60sqrt(19) Simplify 6((sqrt(153) + (sqrt(153) + -1sqrt(153) - sqrt(153))-5)/sqrt(9) + -3). -18 + 36sqrt(17) Simplify (sqrt(90)/(sqrt(6) - (sqrt(54) - sqrt(6)) - sqrt(6)) - sqrt(15) - sqrt(15))/(61sqrt(3)). -5sqrt(5)/12 Simplify (sqrt(75) - 2sqrt(75) - sqrt(75))2 - (0 + 2sqrt(3)). -2sqrt(3) + 300 Simplify (sqrt(7) - sqrt(28)/sqrt(4) - sqrt(7)) + 0 - (sqrt(175) + -1). -6sqrt(7) + 1 Simplify (sqrt(187)25)/sqrt(11). 10sqrt(17) Simplify (sqrt(1216) + 1 + sqrt(1216) + -5 + -2)2. -192sqrt(19) + 4900 Simplify (-1sqrt(77)2 - sqrt(77))/(sqrt(33)/sqrt(3)-1 - sqrt(11)). 3sqrt(7)/2 Simplify -5 + (sqrt(152)/(sqrt(72) + sqrt(72) + 2sqrt(72)))2. -701/144 Simplify (-3(sqrt(405) - (-1 + sqrt(405))))*2. 9 Simplify ((sqrt(600)5)/sqrt(8))*2. 1875 Simplify (3 + (sqrt(891) - -2sqrt(891))-5)2. -810sqrt(11) + 200484 Simplify (-1 + sqrt(162) + sqrt(54)/(sqrt(3)2))2 + -5. -21sqrt(2) + 433/2 Simplify (-2 + sqrt(28) + sqrt(7))*2 + 4sqrt(112). 4sqrt(7) + 67 Simplify -3 + sqrt(34)/sqrt(2) + 4. 1 + sqrt(17) Simplify sqrt(13) + (-1 + sqrt(13))2 + -4 + sqrt(13) + 4. 14 Simplify (2(sqrt(25) - 2sqrt(25)))/(sqrt(405) + sqrt(405)-1 - sqrt(405) - sqrt(5)). sqrt(5)/5 Simplify (3sqrt(3993) + sqrt(33))/(sqrt(147)3). 34sqrt(11)/21 Simplify (-5 + (sqrt(5) - sqrt(25)/((-2sqrt(5) - sqrt(5)) + sqrt(5))) + 5)*2. 45/4 Simplify -3 + sqrt(120)/sqrt(6). -3 + 2sqrt(5) Simplify (sqrt(117) + 4)*2 + sqrt(13) + -3 + 0. 25sqrt(13) + 130 Simplify -1(sqrt(475)2 + 1)*2. -1901 - 20sqrt(19) Simplify ((2 + sqrt(500) + -2)2)2. 2000 Simplify ((3 + sqrt(17))4)*2 - ((sqrt(17)-5 + -4)*2 + sqrt(17)). -25 + 55sqrt(17) Simplify (((sqrt(153) - ((0 + sqrt(153))3 + sqrt(153)) - sqrt(153)) + 0)1)*2. 2448 Simplify sqrt(5)35 - sqrt(25)/(-2sqrt(5)). 31sqrt(5)/2 Simplify (sqrt(143)-15)/sqrt(11) + -2. -5sqrt(13) - 2 Simplify ((sqrt(10)/(sqrt(12)/sqrt(6)))*2 + (sqrt(5) - (sqrt(5) - sqrt(5)2)-1) + sqrt(5))-4. -20 - 4sqrt(5) Simplify sqrt(5) - (sqrt(80)/sqrt(4))2 - -5sqrt(45). -20 + 16sqrt(5) Simplify ((sqrt(13) - -5sqrt(208)) + sqrt(39)/sqrt(3) + 4)*2. 176sqrt(13) + 6308 Simplify (-4(sqrt(931) + sqrt(931)-2) - (sqrt(931) + -1 - sqrt(931) - sqrt(931))4)2. 448sqrt(19) + 59600 Simplify (0 + sqrt(931))*2-6. -5586 Simplify (sqrt(405)-2)2 + (sqrt(90)/sqrt(3))/sqrt(6). sqrt(5) + 1620 Simplify 5 + sqrt(1584) + (sqrt(1584) - (0 + sqrt(1584)) - sqrt(1584)) - sqrt(1584) - (-3 + (sqrt(1584) + 1 - sqrt(1584))). -12sqrt(11) + 7 Simplify sqrt(99)/((sqrt(9) - -3sqrt(9))-4). -sqrt(11)/16 Simplify -3(3sqrt(3) + sqrt(3))-6. 72sqrt(3) Simplify (sqrt(55) - (sqrt(110)1)/sqrt(2) - sqrt(55))/((sqrt(121) + sqrt(121)-2)/sqrt(11) - sqrt(11)). sqrt(5)/2 Simplify 15(sqrt(38)/sqrt(2) - sqrt(19)). 0 Simplify -3 + (-1sqrt(88))/(sqrt(33)/(sqrt(9)/sqrt(3))). -3 - 2sqrt(2) Simplify (sqrt(33) + sqrt(132)3)/(sqrt(11)-36). -7sqrt(3)/18 Simplify (sqrt(156) - (sqrt(156) + (sqrt(156)1 - sqrt(156))))/sqrt(12) + -4. -4 Simplify sqrt(30)/(sqrt(6) - -4(sqrt(6) + sqrt(600))). sqrt(5)/45 Simplify sqrt(486)/sqrt(3)-22. -36sqrt(2) Simplify (-2(sqrt(130)-1 - sqrt(130)))/(sqrt(40)4). sqrt(13)/2 Simplify 4(2 + sqrt(20)/sqrt(4))-1. -4sqrt(5) - 8 Simplify (sqrt(220)/sqrt(16))/(2sqrt(99)). sqrt(5)/12 Simplify (sqrt(7) - (1 + (sqrt(28) - sqrt(7)))*2)-1. sqrt(7) + 8 Simplify (-3sqrt(6)/sqrt(3))2 - (sqrt(2) - sqrt(22)/(sqrt(11) + sqrt(11)-1 + sqrt(11))). 18 Simplify (sqrt(8)/sqrt(4)5 + sqrt(6)/sqrt(3)-2)2. 6sqrt(2) Simplify ((sqrt(35)/sqrt(7) + -5)*2 - sqrt(5)) + sqrt(5) + -1 + 0. -10sqrt(5) + 29 Simplify (sqrt(792)-1)/sqrt(2). -6sqrt(11) Simplify 4sqrt(8) + 3. 3 + 8sqrt(2) Simplify (sqrt(44)/sqrt(4) + -4)2 + (4 + sqrt(44))2. 8sqrt(11) + 87 Simplify sqrt(4)/(sqrt(2)-2-6) + -3. -3 + sqrt(2)/12 Simplify (sqrt(76) + -3-1sqrt(76))/((sqrt(108)/sqrt(3))/sqrt(9)). 4sqrt(19) Simplify (sqrt(896)-3)/(sqrt(14)/(sqrt(12)/sqrt(6))). -24sqrt(2) Simplify ((sqrt(15) - sqrt(60))/sqrt(3) - -5sqrt(5)1)*2. 80 Simplify 0 + (1 + sqrt(252) + sqrt(252)-2 - sqrt(252)). -12sqrt(7) + 1 Simplify ((sqrt(85) - -1sqrt(85))/sqrt(5) + sqrt(17))*2 + (1 + sqrt(17))-2. -2sqrt(17) + 151 Simplify sqrt(784)/sqrt(7) + sqrt(7) + 0. 5sqrt(7) Simplify -2 + sqrt(180) + -1 + -1 + sqrt(180)-1 + 2. -2 Simplify -2 + -3sqrt(832). -24sqrt(13) - 2 Simplify (-6(sqrt(1900) + 4 + sqrt(1900)))*2. 5760sqrt(19) + 274176 Simplify (sqrt(15)/sqrt(3) + -3 + sqrt(5))-5. -10sqrt(5) + 15 Simplify (-1sqrt(325))2 + 1 + sqrt(117). 3sqrt(13) + 326 Simplify (-31sqrt(117))*25 + 4. 5269 Simplify (4 + (sqrt(160) - sqrt(160)-1)/sqrt(8))2. 32sqrt(5) + 96 Simplify (sqrt(108)/sqrt(3) - sqrt(9))/(sqrt(3) + (sqrt(192) - -3sqrt(192) - sqrt(192))). sqrt(3)/25 Simplify -5 + -3 + (sqrt(17) + 1 + 4)2. 34 + 10sqrt(17) Simplify (6(sqrt(7) + sqrt(7)-3) - (sqrt(28)2 + sqrt(7)))2-3. -6069 Simplify (sqrt(2200) + -1sqrt(2200) + sqrt(2200) + sqrt(2200))/(sqrt(11) + sqrt(99)5). 5sqrt(2)/4 Simplify sqrt(96)/sqrt(3) - (4 + 1 + sqrt(2))2. -27 - 6sqrt(2) Simplify (sqrt(288)-2)2. 1152 Simplify (3sqrt(85)-1)/(sqrt(15)/(sqrt(3)2 + sqrt(3) + sqrt(3))). -12sqrt(17) Simplify (-4sqrt(36)/sqrt(2))/sqrt(6) + (sqrt(6)/(-1sqrt(2)) - sqrt(243)-2). 13sqrt(3) Simplify 1((sqrt(243) - (1 + -2sqrt(243)))2 + -5). -54sqrt(3) + 2183 Simplify (sqrt(363) + 2)*2 + 3. 44sqrt(3) + 370 Simplify -1 + -1 + (sqrt(3630) + sqrt(30))/sqrt(6). -2 + 12sqrt(5) Simplify 0 + sqrt(28) - sqrt(896)/sqrt(8). -2sqrt(7) Simplify (sqrt(343)-4)2 + -4-1sqrt(7). 4sqrt(7) + 5488 Simplify (sqrt(119) - 12sqrt(119))/(-4(-1sqrt(7) - sqrt(7))). -sqrt(17)/8 Simplify 2(sqrt(5472)-1)/(-2sqrt(128)). 3sqrt(19)/2 Simplify (3 + sqrt(34)/sqrt(2) - (sqrt(17) + (3 + sqrt(17) + -2 + sqrt(17))*2))-4. 16sqrt(17) + 264 Simplify 2 + -1(sqrt(425)-3)2. -3823 Simplify (-4 + (-5(sqrt(147) + -1) - (sqrt(147) - ((0 + sqrt(147))-6 - sqrt(147)))))2. -182sqrt(3) + 24844 Simplify ((sqrt(416) - 2sqrt(416)) + sqrt(416) + sqrt(416))/sqrt(2) + 4. 4 + 4sqrt(13) Simplify 0 + sqrt(99)/sqrt(729). sqrt(11)/9 Simplify sqrt(5) + (sqrt(80) - sqrt(5))-1 - sqrt(45)/(sqrt(36)/sqrt(4)). -3sqrt(5) Simplify (6(sqrt(12)/sqrt(4) + sqrt(3)) + sqrt(3) + sqrt(36)/(sqrt(12) + -1sqrt(12) + sqrt(12)))*2. 588 Simplify (sqrt(76) + sqrt(76) + (-4(sqrt(76) + -2sqrt(76)) - sqrt(76)) + sqrt(76))/(sqrt(4) + -1sqrt(256) + sqrt(256)). 6sqrt(19) Simplify (1(sqrt(19) + -2 + sqrt(19)) - (sqrt(19) + 2)-5)2. 112sqrt(19) + 995 Simplify (2sqrt(108))/(sqrt(16)/(sqrt(16)/sqrt(4))). 6sqrt(3) Simplify (sqrt(400)/sqrt(5))*2 - 2sqrt(25)/sqrt(5). -2sqrt(5) + 80 Simplify (sqrt(30)/(sqrt(8) - sqrt(2)) + sqrt(15))/(-2sqrt(5)-2 + sqrt(5)). 2sqrt(3)/5 Simplify ((sqrt(95)3 - sqrt(95))-3 + sqrt(95))/sqrt(5). -5sqrt(19) Simplify (-3(4(sqrt(1216) + -3) + sqrt(1216)))2. -8640sqrt(19) + 274896 Simplify ((sqrt(539) + -2)5)2. -700sqrt(11) + 13575 Simplify -4(4 + -1 + sqrt(17) + -1). -4sqrt(17) - 8 Simplify (sqrt(266)/sqrt(7))/sqrt(2) - (5 + sqrt(19)3). -2sqrt(1	{ "pile_set_name": "DM Mathematics" }
ber? True Let m(o) = o*2 + 4o + 2. Let p be m(-3). Let v be p2 + 0 + 5. Suppose 4u - 3a = a + 144, 3u = -va + 114. Is u a composite number? False Let s be 43/(-5) - (-8)/(-20). Suppose -4x + 0x = -80. Let h = x + s. Is h a prime number? True Let a(l) be the first derivative of l2 - 3. Let q be a(-2). Is 14/16-82q a prime number? False Let p(j) = -5 - 4j - j + 3j2 + 2j. Is p(-8) composite? False Is 3333/21 - 4/(-14) composite? True Suppose -t + 437 = -g - 2g, 4g + 1740 = 4t. Is (t/(-28))/(1/(-10)) a prime number? False Suppose -2i + 11 = -69. Suppose q - 91 = -2b, 4q + 5b - 211 - 156 = 0. Suppose p - q = -i. Is p a prime number? True Let i(z) = -6z*3 + 5z + 6. Let o be i(-4). Is (4/8)/(1/o) a prime number? False Suppose -20 = -3g - 5. Suppose -5o - 65 = -gx, -3o = -5x + 30 + 39. Is x composite? True Suppose 0 = -0t + 5t - 25. Suppose -3z + 2z + tn = -97, -4z = -2n - 316. Is z prime? False Suppose 4s - 12 = -0. Suppose -276 = -sr - r. Is r a prime number? False Suppose 5c + 0c - 345 = 0. Is c a prime number? False Let z(u) = u*3 - 6u*2 - 7u + 7. Let k be 8/28 - (-19)/7. Suppose 6i - ki - 21 = 0. Is z(i) a composite number? False Let g(h) = 125h + 2. Let x be (2 - -2) + 1 + -4. Is g(x) a composite number? False Suppose p - 26 = 61. Is p a composite number? True Let k(p) = p - 1. Let y be k(3). Let i be 1y/12. Is ((-6)/i)/(15/(-100)) prime? False Let d = 2 + -2. Let j(s) be the second derivative of s5/20 - s4/12 + s3/6 + 21s*2/2 + 3s. Is j(d) a prime number? False Let p = 263 + -100. Is p prime? True Let u = -571 + 2520. Is u composite? False Let k(n) = -13n + 1. Let f = -3 + 6. Suppose 3 = fu + 3a, -u + 5 = -0u + 3a. Is k(u) a prime number? False Let o be (-2 - 1) + 2 - 1. Let g = -1 - o. Is (47 - g)(-6)/(-12) a composite number? False Suppose 3c = 4q - 2415, -132 = -2q + 2c + 1076. Let f = -418 + q. Is f prime? False Suppose -7h + 36 = -3h. Let i(y) = -y*3 + 10y*2 - 7y - 5. Is i(h) a prime number? True Suppose -5z = -z - 12, 391 = 2g + 3z. Is g a prime number? True Let j(r) = r + 7. Let t be j(-7). Let u = 7 + t. Suppose 4w - uw = -195. Is w a prime number? False Let c = 18 + -10. Is 34 - (2 - c - -3) a composite number? False Suppose 0 = -x + 4a + 74, 0 = 2x + 2a - 8 - 140. Is x a composite number? True Suppose 5j - 1192 - 328 = 0. Suppose p = -2, 4y = -0p + 2p - j. Let t = y - -172. Is t composite? True Let x = -20 + 13. Let c be -1(-2 - 15/(-3)). Is x/((3/1)/c) prime? True Let x(n) = -7n - 5. Let z be x(-5). Is z/(-12)236/(-10) a composite number? False Let n be (0/(3/(-3)))/(-1). Suppose -5p + 2 + 18 = n. Is p/(-8)(-356)/2 a prime number? True Let g = -54 + 137. Is g a prime number? True Let h(y) = y2 - 6y + 80. Let w(m) = -m*2 + 5m - 81. Let r(j) = -4h(j) - 5w(j). Let k be (-2 - (-1 - -2)) + 3. Is r(k) a composite number? True Let s be (24/2)/((-8)/(-4)). Suppose 0 = 2u - su + 24. Is u prime? False Suppose -z + 2 + 3 = 0. Suppose 5u - 213 + 38 = -zm, 140 = 4u - m. Is u a composite number? True Let l be (68/(-5))/(3/(-15)). Suppose 0b - l = 2b. Let a = b - -53. Is a composite? False Let p(w) = -2 + 2w*2 - 1 + w + w. Suppose 5j + 50 = -5d, 0j = -d - 4j - 25. Is p(d) prime? True Suppose 4 = -4j - 20. Let o(a) be the second derivative of -a3/2 + a2/2 + 5a. Is o(j) composite? False Let p(q) be the third derivative of q4/4 - q3/6 - 3q*2. Let k be p(6). Let o = k - -110. Is o a prime number? False Suppose -8o + 933 = 2p - 3o, -4p = 3o - 1873. Is p a composite number? True Suppose d = 3w - 2, -8 = -5w + 5d + 2. Let x be (-2 + w)(-6)/(-12). Is (-2)/(x + (-105)/(-111)) composite? False Suppose 0 = 2w + q + 321, 0w - 3w - 5q = 492. Is (-8)/(-12)w/(-2) prime? True Let o = -13 - -8. Let d(v) = v3 + 4v*2 - 6v + 1. Is d(o) prime? False Let v(s) = 52s3 + 2s*2 - 1. Suppose -2t = -4u - 2, t + 2u + 0 = 1. Is v(t) composite? False Let t(f) = 2f3 + 3f*2 - 6f - 2. Is t(5) composite? False Suppose -5s + 312 = -0z - 3z, s - 2z = 68. Suppose -s = -d - 14. Suppose 5x + 3q - d = 0, -3q = 3x - 38 + 14. Is x composite? False Is 8352 + (-4)/6(-24)/16 composite? False Let c(r) = 67r*2 - 3r - 7. Let b(u) = -33u2 + u + 3. Let m(s) = 7b(s) + 4c(s). Is m(-3) composite? True Let x = 5265 - 2806. Is x a composite number? False Let a(c) = -c3 - c2 + 10. Let h be a(0). Let l = -19 + h. Let t = -6 - l. Is t a prime number? True Let q(s) = -s2 - 14s - 8. Let r be q(-14). Let d = r + 15. Is d a prime number? True Is 4/7 + 195507/91 composite? True Suppose -j = -4k + 5, -3j + 4k - 2k = -5. Suppose jl + 7c = 3c + 26, -c + 9 = l. Suppose 0 = -3b + l + 11. Is b prime? True Let p be 3/(-2)(-6)/9. Let y(c) = 61c + 1. Is y(p) composite? True Suppose 4j + b - 1639 = -j, 3b = 12. Is j composite? True Suppose 2z = 2u - 26, -2u = -z + 3u - 17. Let r be 2 - 4/(z/39). Let a = r - 9. Is a a composite number? True Is 1-719((-2)/1 + 1) prime? True Let x = 1036 - 1664. Is (x/6)/((-12)/18) composite? False Let o(z) be the third derivative of 37z6/120 + z5/60 - z3/6 + z2. Suppose 2u = 3 - 1. Is o(u) prime? True Let x = 155 - 96. Is x composite? False Suppose -3b + 5b + 5q = 26, -2b + 18 = 3q. Is b/9 - 1108/(-6) a prime number? False Let p = -1 + -3. Let o(u) = -145u + 7. Is o(p) a prime number? True Is (232)/((-8)/(-20)) a prime number? False Let z = -10 + 14. Suppose 177 = 5q - zh, 4q + 0h = 2h + 144. Is q prime? True Let m(c) = -27c - 3. Let o be m(-3). Suppose -566 = -4h + o. Is h prime? False Suppose 2g + 106 = 3g - 5b, g + b = 100. Let m = 154 - g. Is m prime? True Suppose 0 = -4j - 2j + 114. Is j prime? True Suppose -2n - 16 + 184 = 0. Suppose a = -3a + n. Is a a prime number? False Let v(f) = 7f*2 - 5f - 5. Let t be v(-6). Suppose -4 = 4g, 2g + t = 5z - 0g. Is z composite? True Suppose -c + 3m + 25 = 0, -2c + 4m + 33 + 7 = 0. Is 4905/c - (-2)/4 prime? True Suppose -2u + 3 - 1 = 0. Let v be u/(-1(-3)/225). Is v/12 - 12/(-16) prime? True Suppose 5n + g = -2, -g = -0n + n - 2. Is 2177/14 - n/(-2) a prime number? False Let v = 7 + -3. Let w(b) = 5 - 2b + 5b2 - 2b - b. Is w(v) prime? False Let l(i) be the third derivative of -i4/12 + i3 - 2i2. Let h be l(-6). Suppose 4a - 44 = 3n + 35, -a - n = -h. Is a a prime number? True Let o = -15 - -31. Let g(d) = 41d - 12. Let y be g(10). Is y/8 - 12/o a composite number? True Let t(d) = d*2 + 10. Is t(-7) a composite number? False Let j be -35/31. Let i = -5 - j. Suppose i = -b + 13. Is b a composite number? False Let y(m) = m2 + m - 10. Let b be y(7). Suppose 4k = b - 10. Is k a prime number? False Let s(n) = -2n - 3. Let a be s(-3). Suppose 0c - ac + 363 = 0. Is c composite? True Suppose -c = 3t - t - 3, -t = -5c + 15. Is (-7 + 96)/(t - -1) a composite number? False Suppose 0o + 56 = -4o. Let f(l) = l3 + 15l*2 + 5l + 1. Is f(o) prime? True Let d be 288/56 - 2/14. Suppose s - 2s + 135 = 2t, 3t - ds = 196. Is t a prime number? True Let h(i) be the first derivative of -i*5/60 + 5i*4/8 - 7i*3/6 + 2i*2 + 1. Let v(x) be the second derivative of h(x). Is v(6) composite? False Let j(c) = 2c + 2c2 + 2c + 3 - 1 - 7c3. Is j(-2) a composite number? True Let a = 77 - 55. Let t = -10 - 3. Let r = a - t. Is r a composite number? True Let d(l) be the second derivative of 1/2l2 - l3 + 2l + 0. Is d(-2) composite? False Suppose 2c + 3 - 7 = 0. Suppose -cq + 0q + 254 = 0. Is q a composite number? False Let d(z) be the third derivative of 3/8z4 + 0z + 0 + 2z2 + 1/3z*3 + 1/30z*5. Is d(-7) prime? True Suppose -2p + 276 = 2p. Is p/24/6 prime? True Suppose -3328 + 572 = -4v. Is v a prime number? False Suppose 6u - 3653 + 455 = 0. Is u composite? True Suppose 2s + 32 = 4s. Suppose 0 = -0g - 4g + 12. Suppose -5 = -gl + s. Is l a prime number? True Let z(j) = -75j + 3 + 6 - 37j. Is z(-8) composite? True Let n be -1(2 - 15/3). Let s(f) = 10f2 + 3. Is s(n) composite? True Suppose 4l + 8 = 0, 289 - 926 = -3y + 5l. Is y a composite number? True Suppose 56 = -3f + 296. Suppose 0 = v + 2z - 45, -2v + 5z = -v - f. Is v a prime number? False Suppose	{ "pile_set_name": "DM Mathematics" }
s the thousands digit of 23879? 3 What is the tens digit of 4226? 2 What is the hundreds digit of 2422? 4 What is the tens digit of 1416? 1 What is the units digit of 3694? 4 What is the units digit of 736? 6 What is the hundred thousands digit of 126207? 1 What is the thousands digit of 2208? 2 What is the thousands digit of 6304? 6 What is the hundreds digit of 303? 3 What is the thousands digit of 135409? 5 What is the tens digit of 714? 1 What is the hundreds digit of 7039? 0 What is the hundreds digit of 2555? 5 What is the thousands digit of 1064? 1 What is the hundreds digit of 141235? 2 What is the hundreds digit of 463? 4 What is the thousands digit of 12942? 2 What is the units digit of 214? 4 What is the thousands digit of 30296? 0 What is the tens digit of 156368? 6 What is the thousands digit of 12318? 2 What is the thousands digit of 1636? 1 What is the hundreds digit of 2649? 6 What is the tens digit of 2763? 6 What is the units digit of 122582? 2 What is the tens digit of 1498? 9 What is the hundreds digit of 56776? 7 What is the ten thousands digit of 26953? 2 What is the ten thousands digit of 13536? 1 What is the units digit of 406? 6 What is the hundreds digit of 12460? 4 What is the hundreds digit of 8070? 0 What is the units digit of 93634? 4 What is the thousands digit of 17335? 7 What is the units digit of 291? 1 What is the tens digit of 10156? 5 What is the thousands digit of 22961? 2 What is the tens digit of 18464? 6 What is the tens digit of 1189? 8 What is the units digit of 2891? 1 What is the thousands digit of 1224? 1 What is the tens digit of 5522? 2 What is the tens digit of 47063? 6 What is the units digit of 9721? 1 What is the ten thousands digit of 97823? 9 What is the thousands digit of 1107? 1 What is the units digit of 10936? 6 What is the thousands digit of 1847? 1 What is the ten thousands digit of 34750? 3 What is the thousands digit of 14109? 4 What is the thousands digit of 15252? 5 What is the ten thousands digit of 30991? 3 What is the hundreds digit of 3597? 5 What is the hundreds digit of 1867? 8 What is the hundreds digit of 63302? 3 What is the hundreds digit of 347? 3 What is the tens digit of 48559? 5 What is the hundreds digit of 14788? 7 What is the tens digit of 6079? 7 What is the thousands digit of 3777? 3 What is the hundreds digit of 1805? 8 What is the units digit of 502? 2 What is the units digit of 7349? 9 What is the units digit of 780? 0 What is the tens digit of 977? 7 What is the units digit of 39859? 9 What is the tens digit of 1549? 4 What is the hundreds digit of 2921? 9 What is the tens digit of 4022? 2 What is the ten thousands digit of 109884? 0 What is the ten thousands digit of 17380? 1 What is the units digit of 5345? 5 What is the hundreds digit of 951? 9 What is the hundreds digit of 46820? 8 What is the units digit of 2338? 8 What is the thousands digit of 14574? 4 What is the hundreds digit of 22907? 9 What is the units digit of 3810? 0 What is the units digit of 24229? 9 What is the ten thousands digit of 88276? 8 What is the ten thousands digit of 147493? 4 What is the units digit of 4211? 1 What is the tens digit of 514? 1 What is the tens digit of 3668? 6 What is the tens digit of 19851? 5 What is the ten thousands digit of 74452? 7 What is the hundreds digit of 2207? 2 What is the tens digit of 71? 7 What is the units digit of 533? 3 What is the units digit of 3245? 5 What is the hundreds digit of 879? 8 What is the hundreds digit of 9446? 4 What is the thousands digit of 1928? 1 What is the thousands digit of 5488? 5 What is the units digit of 80325? 5 What is the units digit of 19658? 8 What is the units digit of 848? 8 What is the tens digit of 1071? 7 What is the units digit of 4006? 6 What is the hundreds digit of 5076? 0 What is the hundreds digit of 7216? 2 What is the hundreds digit of 632? 6 What is the units digit of 47? 7 What is the hundreds digit of 2291? 2 What is the tens digit of 215? 1 What is the tens digit of 186? 8 What is the thousands digit of 16752? 6 What is the tens digit of 78250? 5 What is the tens digit of 3888? 8 What is the thousands digit of 140232? 0 What is the units digit of 2553? 3 What is the tens digit of 1593? 9 What is the units digit of 1186? 6 What is the hundreds digit of 11973? 9 What is the hundreds digit of 12845? 8 What is the tens digit of 1542? 4 What is the tens digit of 2480? 8 What is the hundreds digit of 31738? 7 What is the ten thousands digit of 15547? 1 What is the thousands digit of 36865? 6 What is the hundreds digit of 1028? 0 What is the hundreds digit of 6079? 0 What is the tens digit of 742? 4 What is the hundred thousands digit of 103639? 1 What is the tens digit of 998? 9 What is the units digit of 97? 7 What is the thousands digit of 1296? 1 What is the tens digit of 17940? 4 What is the hundreds digit of 138186? 1 What is the hundreds digit of 42465? 4 What is the units digit of 880? 0 What is the tens digit of 85? 8 What is the thousands digit of 1831? 1 What is the units digit of 69099? 9 What is the units digit of 6816? 6 What is the tens digit of 1188? 8 What is the hundreds digit of 9044? 0 What is the tens digit of 62682? 8 What is the hundreds digit of 915? 9 What is the hundreds digit of 38525? 5 What is the ten thousands digit of 67150? 6 What is the hundreds digit of 11156? 1 What is the hundreds digit of 1779? 7 What is the hundreds digit of 1620? 6 What is the tens digit of 1689? 8 What is the tens digit of 4906? 0 What is the thousands digit of 1496? 1 What is the units digit of 437? 7 What is the hundreds digit of 31514? 5 What is the units digit of 296? 6 What is the tens digit of 15044? 4 What is the hundreds digit of 5617? 6 What is the hundreds digit of 21168? 1 What is the thousands digit of 9740? 9 What is the hundreds digit of 159? 1 What is the thousands digit of 91164? 1 What is the tens digit of 41077? 7 What is the tens digit of 7734? 3 What is the thousands digit of 5725? 5 What is the hundreds digit of 3764? 7 What is the units digit of 947? 7 What is the thousands digit of 22992? 2 What is the units digit of 30410? 0 What is the thousands digit of 4074? 4 What is the thousands digit of 22934? 2 What is the units digit of 5847? 7 What is the tens digit of 451? 5 What is the units digit of 997? 7 What is the hundreds digit of 129? 1 What is the hundreds digit of 703? 7 What is the units digit of 16619? 9 What is the thousands digit of 9007? 9 What is the tens digit of 4181? 8 What is the tens digit of 1306? 0 What is the units digit of 2057? 7 What is the tens digit of 213? 1 What is the tens digit of 202? 0 What is the thousands digit of 31087? 1 What is the tens digit of 4530? 3 What is the thousands digit of 6658? 6 What is the hundreds digit of 5462? 4 What is the hundreds digit of 41611? 6 What is the hundreds digit of 43297? 2 What is the units digit of 1692? 2 What is the hundreds digit of 699? 6 What is the hundreds digit of 16417? 4 What is the units digit of 7651? 1 What is the thousands digit of 22449? 2 What is the units digit of 2800? 0 What is the hundreds digit of 28578? 5 What is the tens digit of 477? 7 What is the hundreds digit of 4692? 6 What is the units digit of 37313? 3 What is the thousands digit of 49710? 9 What is the units digit of 72521? 1 What is the tens digit of 7344? 4 What is the units digit of 3126? 6 What is the units digit of 33133? 3 What is the ten thousands digit of 59612? 5 What is the tens digit of 24832? 3 What is the hundreds digit of 3308? 3 What is the tens digit of 1966? 6 What is the thousands digit of 1265? 1 What is the units digit of 5426? 6 What is the hundreds digit of 54842? 8 What is the tens digit of 3058? 5 What is the hundreds digit of 776? 7 What is the tens digit of 106? 0 What is the hundreds digit of 400? 4 What is the tens digit of 2146? 4 What is the units digit of 40363? 3 What is the tens digit of 624? 2 What is the ten thousands digit of 18009? 1 What is the thousands digit of 31110? 1 What is the hundreds digit of 482? 4 What is the hundreds digit of 54340? 3 What is the hundreds digit of 71291? 2 What is the ten thousands digit of 12547? 1 What is the tens digit of 35966? 6 What is the thousands	{ "pile_set_name": "DM Mathematics" }
- f, 2f - 339 = -v. Let n = -326 + v. Solve -12k = -nk + 12 for k. -4 Let g(c) = -2c + 3c + c2 + 0c + 66 - 61. Suppose 2a + 0a = 0. Let y be g(a). Solve yq = 3q - 10 for q. -5 Let x(y) = y*2 + 10y - 15. Let b be x(-12). Suppose 0 = 12p + 28 - 52. Solve -pr + 15 = b for r. 3 Let f be (12/66)/(168/33 - 5). Suppose -14 = -t + 3n, 4t - 2n = 3n + 28. Solve fz = -tz - 4 for z. -1 Let i = 159 - 461. Let k = 302 + i. Solve k = 5t - 4t + 11t for t. 0 Let c(u) = -87u + 7744. Let g be c(89). Suppose f - 2f = t, 2f = t - 6. Let q(b) = -b*2 + 2b. Let r be q(t). Solve r = o + g for o. -1 Suppose 0 = 2r - 10, -26r = -3p - 21r - 10. Suppose -4g + 37 = -12k + 15k, 0 = pk - 3g - 23. Solve kb + 0b = -35 for b. -5 Let s(l) = -l3 + 8l*2 + 56l - 95. Let y be s(12). Solve 76o - 77o = -y for o. 1 Let o be (-3 - 7) + (-2)/2. Suppose 0 = -5g + 31 - 111. Let t = o - g. Solve -t = -3m - 17 for m. -4 Let h(w) = w*2 - 139. Let c be h(-13). Let n = c - 29. Solve -3 = 2u - n for u. -1 Let m = 681 - 665. Suppose 0 = 3y - 6, 3x + y + 0y = 8. Solve 0 = -xz + 6 - m for z. -5 Suppose 313q - 315q = 5n - 46, 0 = 3q + 4n - 76. Solve -120 = qf - 4f for f. -5 Suppose 0 = 5f + 2u - 63, -4u = 111f - 115f. Solve -64 = fs - 28 for s. -4 Let o = -39125 + 39135. Solve -46h - 144 = -oh for h. -4 Let p(s) = -s - 8. Let q be p(-10). Suppose -qk - 3k + 8k = 0. Solve -1 = -o - k for o. 1 Let s(z) = 8z2 - 30z - 27. Let i be s(6). Solve -12f + i = 15f for f. 3 Let f = -722 + 726. Let p be (-5 - -10) + -1 - f/(-2). Solve 0 = -7k + pk - 3 for k. -3 Let t(g) = 9g2 + 19. Let x be t(-5). Let y = -239 + x. Solve -2l - y = 1 for l. -3 Let v = -106 + -61. Let o = 173 + v. Solve 4p - 8 = op for p. -4 Let u be 710/28(-684)/(-15). Let k = u + -107. Solve -kr - 6 = 1 for r. -1 Suppose 0 = 4l - 12, -4i + i - 4l + 444 = 0. Let k = 152 - i. Solve 0 = -kb + 4b + 16 for b. 4 Let g be 66/4(36/27)/2. Let m be (-3)/2(-112)/6. Suppose m = gf - 5. Solve 2p - f = -1 for p. 1 Let s be ((-3)/(-3))/((-3)/(-228)) - -1. Let b = 86 - s. Solve -7l + bl = 10 for l. 5 Let f be (20 - (25 - 2)) + 7. Solve 50 = -fd + 38 for d. -3 Let z = -10825 + 10875. Solve 0 = -6k - z + 68 for k. 3 Let r be 110/2406 - (-6)/(-8). Suppose 51 - 74 = -5h + 4x, 12 = rh - 3x. Solve 0t = -2t + ht for t. 0 Suppose 25c + 9c - 1263 + 141 = 0. Solve 0 = 55b - cb for b. 0 Let h(y) = -y*2 - 30y + 678. Let q be h(15). Let o = -15 + 21. Solve -qv + 12 = o for v. 2 Suppose -8t + 126 = -42. Suppose 4c - 15 = t. Solve -cy = -5y for y. 0 Suppose -5c + 8c - 12 = 0. Let z be -4 + (0 - (-32)/c). Suppose -2t = -4v + 38, -2t - 4 = -v + z. Solve i = -i + v for i. 5 Let y(x) = 17x2 + 2x. Let o be 4/26 + (15/(-13))/1. Let c be y(o). Let g be (-2)/c - 6(-76)/45. Solve -a - a = g for a. -5 Let h = 4 - 8. Let s be 57h/72-6. Solve -20t + st - 3 = 0 for t. -3 Let o be (((-60)/(-4) - 7) + -8)/(36/6). Let l(w) = w3 + 6w*2 + 3w. Let y be l(-5). Suppose 4v - 8 = k + y, -5k = 3v - 25. Solve oj = vj for j. 0 Let x(y) = -y3 - 20y*2 - 21y - 33. Let r = -588 - -569. Let d be x(r). Solve -dc - 4 = 1 for c. -1 Suppose -99x = -71x - 28. Let g(j) = 4j - 4. Let i be g(x). Solve -4q - 26 + 6 = i for q. -5 Let r(s) = -4s*2 + 4. Let l be r(-4). Suppose -2b - b = 165. Let g = b - l. Solve -gd + 0d = -15 for d. 3 Let d be ((-123)/(-82))/((-3)/(-56)). Let k(l) = l*3 - 26l*2 - 57l + 31. Let f be k(d). Solve fw = -17 + 2 for w. -5 Suppose 117 = -5j - 5i - 2828, i - 589 = j. Let p = j + 591. Solve -5 + 9 = -pl for l. -2 Suppose -q + 9 = -7. Suppose qd = 20 + 60. Let f = 0 + 0. Solve f - 10 = -du for u. 2 Let g = -3083 - -3087. Suppose -15 + 8 = -k. Solve -g + k = -i for i. -3 Let f(b) = 6b - 163 + 163. Let c be f(2). Suppose -c - 3 = -5j + 3x, -2j = -3x - 6. Solve -j = 2t - 1 for t. -1 Suppose 0 = 2m + a + 7, 5a + 397 - 318 = m. Let o = 0 + 3. Solve -3y = -my - o for y. -3 Let w(g) = g*2 + 23g + 14. Let c be w(20). Let v = c - 866. Solve -2d - v + 2 = 0 for d. -3 Let j = -20 - -20. Suppose j = 5r - 6r + 33. Let c be r/7 + (-10)/(-35). Solve 0u - c = u for u. -5 Let w(o) = 27o. Let c be w(-1). Let h = 2296 + -2266. Let j = c + h. Solve -g - jg = 0 for g. 0 Let l(m) = -m*3 + 4m*2 + 15m - 60. Let v be l(4). Suppose r = 3r - 10. Suppose rs - 18 = -2a, 5s - s + a = 12. Solve sp + 3p = v for p. 0 Let s(u) = -2u2 - 113u - 816. Let d be s(-38). Solve -dt = -598t + 16 for t. 2 Let b(i) = 2i2 - 276i + 2596. Let r be b(128). Solve -60 = -26m + rm for m. -6 Suppose 3u - 78 = -3u. Suppose -ur + 35 = -8r. Solve 5q - 8 = r for q. 3 Let a be 21904/68 - 8/68. Let h = 330 - a. Solve 6i - 8i - h = 0 for i. -4 Let r = 158 + -159. Let a be (8/(-32))/(r/20). Solve 1 - a = k for k. -4 Suppose 49 - 35 = 14p. Solve 7 = 8r - p for r. 1 Let x be 28/(2 + 0) + 0. Suppose -3246 = -164d - 356 - 266. Solve -d = xc - 6c for c. -2 Let i be ((-4)/(-5))/((-4)/(-50)). Suppose in - 23 = 117. Let d = -14 + n. Solve s + d = -4 for s. -4 Let w(t) = -8t3 + t2 + 11t + 14. Let u be w(-3). Let q = u + -197. Solve 3i - 3 = -q for i. -2 Let y = 2026 - 2013. Solve -17v = -4v + y for v. -1 Let r = 572 + -564. Solve 470 = -rz + 422 for z. -6 Suppose 17x + 118 - 156 = 591. Solve -1 + x = -12y for y. -3 Let m be 6 - (0 + (-2)/(-1)). Let d be (2 + -2)/(m/(-2)). Suppose 6k - 2200 = -104k. Solve -3z - 2z - k = d for z. -4 Suppose -2p + 434 - 394 = 4y, 0 = 4y - 8. Solve -p + 16 = -7z for z. 0 Let p be 11/((-132)/832) + (-4)/6. Let r = p + 73. Let m = -4 + 10. Solve rl = -0l + m for l. 2 Let y be (-1 - 28/(-20))/((-1)/40). Let n = y - -25. Suppose 0k = nk. Solve c = -kc for c. 0 Suppose -y = 16y - 2805 + 442. Solve -11w + y = 205 for w. -6 Let b(z) be the first derivative of z*2 - 10z - 502. Let y(g) = g*3 + 5g*2 + 4g. Let o be y(-3). Let x be b(o). Solve 0 = -xn + n for n. 0 Let y(d) = d3 + 15d*2 + 14d + 39. Let r be y(-14). Solve -rv + 49v = -20 for v. -2 Let u = 196 + -187. Suppose ug - 23g = -42. Solve -2h = -gh - 1 for h. -1 Let i = -251 - -236. Let p be (-22)/(-2) + i + 16. Solve 6v - p - 18 = 0 for v. 5 Suppose 2l = -5l - 735. Let a be ((-20)/3)/((-28)/462). Let g = a + l. Solve p + 1 = g for p. 4 Suppose -3n = 18, h + 5n + 0 = -18. Solve -ha - 37 = -25 for a. -1 Let l(u) = -u3 - u2 + 10u - 4. Let n be l(-4). Suppose k - nx = 3, -k - 4k + x = -15. Solve -4j + j = -k for j. 1 Let s(k) = -2k + 38. Let d = -573 - -585. Let r be s(d). Solve -r = 5p - 4 for p. -2 Let m(o) = -24o2 - 15o + 12. Let k(l) = 9l2 + 5l - 4. Let t(g) = 17k(g) + 6m(g). Let q be t(1). Solve qv = 13v for v. 0 Suppose 0 = -3g - m + 54, 6g + 3m - 139 = -37. Solve -2z = gz + 44 for z. -2 Suppose 220 = -5t + 375. Suppose -36 = -y - t. Solve -yx = -1 + 16 for x. -3 Suppose 5n = 5w + 15, -5n - 25 = w + 4w. Let y be (-2 - n)(-11 + -1). Suppose 17 + 7 = yr. Solve rg + 4 + 4 = 0 for g. -4 Let x(o) = o*2 - 73 + 22o + 60 - 7o. Let j be x(-16). Suppose y - 4t = 19, 0y - jt = -2y + 28. Solve 0 = c - y + 6 for c. 5 Suppose 16p - 18p = 0. Suppose -2z + b + 59 = -0z, 3b = 4z - 119. Solve p = -26j + zj - 6 for j. 2 Suppose 2b + 28b - 5b - 6050 = 0. Solve 22 = 55o + b for o. -4 Let p(k) = k3 + 47k*2 + 242k + 5. Let s be p(-6). Solve -20 = -9n + sn for n. -1 Let o(n) = n*3 + 9n*2 + 41n + 271. Let l be o(-8). Solve lh = 19h for h. 0 Let l be (-3 - 28/(-8))/(4/728). Let o be (-4)/7 - (-52)/l. Solve o = 4d - 0 - 8 for d. 2 Let v(o) = -o + 8. Let b be v(4). Suppose 5 = a - 2t, 0a + 5a = bt + 19. Suppose aw - 16 = -7. Solve 3i = -0i + w for i. 1 Let n be (-875)/(-21)12/20. Let y be 1(21/1 - -2). Solve 0 = yj - nj for j. 0 Let g = -27519 - -27542. Solve -150 = -gm - 7m for m. 5 Let v = 1080 - 613. Let u = -463 + v. Solve 7 = un - 9 for n. 4 Suppose 0 = 890l - 830l. Solve -101m - 113 - 190 = l for m. -3 Suppose 0 = -2c + x + 184, 3x = 12c - 17c + 449. Solve -c - 221 = 52f for f. -6 Let s(m) = -m3 - 10m*2 - 2m - 15. Let z(o) = o*2 + 8o - 14. Let n be z(3). Let g be n/(-2) - 16/32. Let t be s(g). Solve -tl + 4l - 1 = 0 for l. -1 Suppos	{ "pile_set_name": "DM Mathematics" }
/(-20125))/6410). 115 Calculate ((144/16)/36)/(11/(-1672)). -38 What is the value of ((-339328)/3856)/(77/(-2))? 16/7 What is -42128/(-2016)2-91? -48 Calculate (15/(-2))/((-1410)/188). 1 Calculate 14/(-6)(43560/(-2002))/66. 10/13 What is the value of ((-608)/38090/24)/(-6(-20)/16)? -4/5 Calculate ((-12)/(-22))/((-825)/55(-20)/(-20)). -2/55 What is (-205)/(-27306)(-228)/95? -2/111 What is (88/10)/((-12)/20(-92)/(-276))? -44 Evaluate (((-14175)/(-135))/(-210))/(((-154)/20)/11). 5/7 Evaluate ((-49)/(-84))/((-6)/56(-525)/(-150)). -14/9 Calculate (-52)/6((-11)/(-4))/((-19)/(2850/(-275))). -13 Evaluate (1836/(-15912))/(((-81)/(-30))/(-9)). 5/13 Evaluate 2/(-2)(-726)/712818. 11/6 Calculate (2-2)/(50/45). -18/5 Calculate (1980/(-360))/((-6)/672-8). -77 (4((-6)/28)/(132/154))/((-13)/286) 22 Calculate 644930/319806/44. 11/4 What is the value of (((-2)/(-6))/(9/(-657)))/(21/(-882)-14)? -73 What is the value of (32/5)/((-678)/565)(30/88)/1? -20/11 What is the value of ((-5016)/1386)/(-213/273)? 38 Evaluate (-39)/(39975/164)9/18. -2/25 What is the value of ((-232)/1566(-30)/(-8))/((-5)/(-34))? -34/9 Calculate 720/(-132)(-80)/(-10)(-3)/(-48). -30/11 Calculate (-36)/(-600)234600/612. 23 Calculate (-3)/72(1/(64/(-48)))/(-1). -1/32 (-176)/((-3272192)/2800)(-8)/(-50) 2/83 What is the value of 55/(651/13630/54)? 44 Calculate 2/90675852/(-1176). -43/5 What is (-166)/1411(-8)/24? 2/51 What is 100/(-45)9/(-195)16/89614? 1/39 ((-15)/6)/((366/(-21))/((-720)/3150)) -2/61 What is the value of ((50112/29)/24)/(-1)? -72 What is the value of (-16)/1046936/(-289)? 48/13 Evaluate 80/32(-348)/2755. -6/19 Calculate ((-31)/(-465))/(7/126)(-12)/(-18)-100. -80 Calculate ((-34)/((-3740)/(-66)))/(((-4185)/(-105))/((-10)/(-7))). -2/93 What is the value of (21/(-42))/(41/(-3198))? 39 Evaluate (3572/(-57))/((1080/81)/20). -94 What is the value of (143/20449)/(6/(-26))? -1/33 Calculate (24/16)/((-3(-116)/(-360))/((-46)/207)). 10/29 What is ((-5160)/80)/(81/54)? -43 Evaluate 20/64084(-5)/(-15). 7/8 -90(-77)/((-13090)/85) -45 What is the value of (((-70)/4)/(-7))/(371(-40)/(-224))? 2/53 What is the value of ((-78)/9)/((-12235)/7341)? 26/5 Evaluate ((-58320)/(-45))/(-81)4/(-152). 8/19 What is ((-48)/160)/(-3)-36? -18/5 Evaluate (-19)/57323/23. -1 What is the value of ((-2)/6)/((-10285)/5610(-5)/(-4785)-3)? -58 What is the value of (((-700)/(-2610))/35)/((-2)/9(-24)/4)? 1/174 Evaluate 272/(-4)32788/10539. -42 Calculate ((4/(-3))/(-4))/(((-1292)/16932)/(-19)). 83 What is -636/157951310? -16/9 -176(6/9)/(648/(-243)) 44 53568/10646643/20 2/265 What is the value of 75/1125-84(-160)/(-28)? -32 (-2)/(-2)2/(-2)150236/(-2644) 19 What is the value of ((-495)/(-135))/(8(-7)/(-672))? 44 Evaluate 8612/544(-1)/33. -3/11 Evaluate (2/8)/(1152/384). 1/12 What is the value of -4(429/169)/((-1512)/(-18018))? -121 What is the value of (273/682555/(-22))/((-2)/(-284))? -71/5 Evaluate ((25/225)/((-39)/36))/(2/6). -4/13 What is ((-177)/(-16048)-17)/(((-64)/(-8))/96)? -9/4 What is ((-35916)/(-15330))/((-4)/(-70))? 41 ((-15300)/(-20655))/((-3)/(-54)) 40/3 What is the value of (15/7)/(598(-110)/(-14168))? 6/13 What is 34/2(-5)/((-90)/(-16))(-283)/(-1132)? -34/9 (-4)/(-10)(-15)/(-12)2698/(-93081) -1/69 What is the value of (270/(-1836))/((-130)/(-52))? -1/17 Calculate 146188/(-407238)36/14. -12/13 What is the value of (2/(-16))/((((-1989)/(-156))/(-51))/4)? 2 Calculate ((-4954)/(-4954))/((-2)/86). -43 What is 11/112/(46/1)202/202? 1/23 What is (2827/214852)/(1/(-2))? -1/38 What is the value of (810/400)/(3/105014)? 5 What is ((-4)/(-6))/(1790/(-2685))62? -62 Calculate ((13/13)/(1/((-1)/1)))/((-9579)/1854). 6/31 (-5)/((-160)/576(-120)/(-20)) 3 What is (-158)/(-3713)141(-19)/(-1)? 114 What is the value of 46/977525(-697)/(-2993)? 2/73 What is (30/12)/(((-18)/(-24))/(12/20))? 2 What is the value of (-162)/150(-29450)/4712? 27/4 (-35)/1050/(-35) 5 Calculate 456/15964/1220-35. -2/61 Evaluate (((-72)/28)/9)/((-162)/3528-7). -8/9 Evaluate (-34)/(-5)(14/2840)/(-4). -34 Calculate 4/568464/(-1058). -4/7 What is ((-415)/(-4731)57)/((-1)/(-4)-5)? -4 What is (264/120)/((-616)/105)? -3/8 What is the value of (120/10((-85)/(-50))/(-17))/((-147)/14)? 4/35 What is the value of ((2/(-3))/(72/(-54)))/(12/(-48))? -2 What is the value of (-176)/559(-110)/396? 8 What is ((-358)/1969)/((-9)/(-66))? -4/3 What is -63(-82)/36911/((-77)/(-18))? 36 Calculate ((2/18)/((-135)/(-6075)))/((-25)/330). -66 Evaluate ((-210)/(-9))/51475/(-590)24/20. -14 What is the value of (-5)/(-55)66/12(60/1705)/(-3)? -2/341 Evaluate 3/6-2063/23111. -30 Calculate 392/(-686)(-14)/(4/(-140)-5). 16 What is (((-32)/(-210))/((264/24)/154))/((-6)/(-9))? 16/5 Calculate 0(5893/(-142))/(-83). 0 What is 16/(-25)390/4683? -8/5 Calculate 110/(-11)41/(7380/(-24)). 4/3 Calculate ((-192)/(-54))/(-8)(-31)/124. 1/9 What is the value of (1/(276/15))/(((-195615)/(-648))/161)? 2/69 What is ((-112)/(14784/(-297)))/(2/(-16))? -18 Calculate 6(-7)/420-5-2. -1 Evaluate ((-13)/(65/2))/(56/196). -7/5 Calculate -94/(-30)((-2950)/(-944))/((-35)/(-308)). 33 Evaluate (44455/9937)/((-2)/38). -85 Evaluate (((4/(-14))/((-1338)/(-1561)))/3)/((-2)/112). 56/9 What is the value of 23112/(-11235)251/((-3)/615)? 48/7 Evaluate ((-124)/(-279))/((-41)/(-369)). 4 Evaluate (((-28500)/(-1375))/(-57))/(((-48)/(-22))/4). -2/3 What is the value of -46/(-40)((-950)/(-418))/(24/11)? 5/8 Calculate (6/8)/(36/(-1056))2. -44 Evaluate ((-748)/(-110))/(160/100)-8. -34 (-8)/(-12)((-14400)/140)/30 -16/7 (-7(50/(15/(-3)))/(-1))/(2/1) -35 779/(-123)(-18)/6 19 What is (-990)/(-30)(-29)/(-638)123? 54 Calculate 6/4615906/(-7953). -6/23 ((-68)/(-10))/((-716635)/16862) -4/25 Calculate (-92)/((-1416984)/(-153))8/(-6). 2/151 Calculate ((-71)/((-426)/(-30)))/(90/(-4)). 2/9 What is the value of ((-9)/100)/(1935/(-6450))? 3/10 Calculate ((-156)/(-12))/(1953/(-11718)(2/1)/1). -39 What is the value of ((20/(-15))/(-2))/((-7755)/(-12690))? 12/11 Evaluate ((234/(-840))/13)/(648/864). -1/35 Evaluate (-2)/(-8)-2106/5973149. -1/23 What is the value of -29-13(-3886)/(-21866)? 67 What is (72/(-14))/(1444/12635)? -45 What is the value of ((-3)/44)/(30168/18436)-9? 3/8 Evaluate 108/21((-22540)/23)/70. -72 What is (-30)/162(-1614)/(-25555)? -2/171 What is the value of (23-14(-6)/1932)/7? 1/7 Calculate (1/(-1))/((-1524)/(-508)(-2)/(-78)). -13 (1/((-10)/(-4)))/(5643/(-855)) -2/33 What is the value of (614/(-126)(-30)/(-10))/((-82)/(-3))? -3/41 What is the value of (-102)/(-357)14/72(-378)/18? -7/6 5/1-372/24(-36)/486 10/3 Calculate (-134/3644)/(8/(-644)). 46 What is the value of ((-884)/3)/((-59194)/10446)? 52 What is the value of 135/(-10)(-17)/136-16(-10)/15? 18 What is ((-8)/805)/(1/(-14(-6)/2373))? -2/113 (20/(-48))/(360/(-62496)-62) -7/6 2/(40/(-1008)324/30) -21 What is (-11309/26059)/3? -1/23 What is the value of ((-457)/10511)/(2/4-1)? 2/23 What is the value of ((-6)/31)/((61/((-8723)/66))/((-2)/13))? -2/31 What is -7((-240)/140)/(33/(-55))? -20 What is 525(-76)/(-45600)-40? -35 Evaluate (4/(-36)1395/62)/(1/14). -35 Calculate (4/8)/(((-4)/(-5))/(4928/280)). 11 What is (147/6)/(3052/2616)? 21 (400/240)/(60/(-864)) -24 Evaluate 2/121((-255)/(-5))/(-153)1. -1/18 What is -15/(-198)(-2288)/28606? -4/33 ((-1)/4)/(119/102) -3/14 What is (54/4)/(((-12)/(-408))/((-36)/22950-25))? 18 What is (-22)/((-2)/(-619/456))? -11/4 645/(-70)(-3766)/(-807) -43 What is the value of (-4(-15)/80)/((-4)/((-4928)/21))? 44 What is the value of (-7)/(-40)468/(-1638)-1? 1/20 Calculate 13632/(-1917)18/4. -32 ((-30)/(-45))/((-2)/(-1))2436/(-28) -29 -53(-130)/(-6890)(-3)/11 3/11 What is (190/6840)/(1/252)? 7 Calculate (1696/(-530))/((-24)/20). 8/3 Calculate (-4)/(-22)2533905/10238. 45 Calculate (8/50)/((-117)/10530040). -18/5 ((-2835)/672)/15(114/76)/(6/(-16)) 9/8 Evaluate 18/((11(-18)/(-693))/((-3)/((-210)/(-40)))). -36 Calculate (-3)/(11(-1)/3256-24). -37 Calculate (-1)/(-15)(68/85)/(44/(-165)). -1/5 Calculate (12/(-208)(-10)/(-5))/((-21)/(-112)). -8/13 (-27)/6(-46)/(-483)-84 36 What is ((4085/(-76))/(-43))/((-25)/(-5))(-36)/(-21)? 3/7 What is the value of 15(-19)/190	{ "pile_set_name": "DM Mathematics" }
. Let y(w) = -w + 2. Let g be y(c). Solve -4z + 10 - 32 = 5x, x + gz = -14 for x. -2 Let x = 73 + -38. Solve 2l + 18 = 4t, -3t + 5l + x = 11 for t. 3 Let n(s) = 2s - 3. Let z be n(8). Solve 2b - 5a = 16 + z, -4b = 3a + 7 for b. 2 Let z(g) = -2g + 10. Let u be z(5). Solve -4 = i - u, 5h + 4i = -16 for h. 0 Let f(w) = w3 - 10w*2 - 37w - 23. Let i be f(13). Solve 4d - 2 = 2g + 2, -g = id - 8 for d. 2 Let u be 5 - ((-7 - -1) + 7). Let p(f) = -3f3 + f2 + 2f + 1. Let s be p(-1). Solve sy + 5n = -y + 8, un = 0 for y. 2 Let u(d) = -d*2 - 7d - 6. Let n be u(-6). Let f = -4 - 0. Let t = n - f. Solve -4q + 2q + 16 = 2m, -3q + 27 = tm for q. 5 Suppose 4h = 2h - 2c + 14, 5c = -2h + 29. Solve 6 = k + 3d, 3d = h + 1 for k. 3 Let h(r) = -r3 - r2 + 3. Let k be h(0). Let x be 2/k99/3. Solve 4m - 5m = -5v + x, 5m - 15 = 0 for v. 5 Let r be 3/(24/28 - 1). Let v = 23 + r. Solve 3u - 21 = 2z, vz + 23 = 4u + z for u. 5 Suppose -2b = -11 + 3. Let s(d) = 10d2 + 2d - bd + d. Let j be s(-1). Solve -3y + r - j = -r, -4y + 4r = 16 for y. -3 Suppose 14 = 8y - 34. Solve y = 3s - 0, -18 = -3n - 3s for n. 4 Let l be ((-3)/(-2))/((-1)/(-2)). Let q(v) = -2v - 25. Let c be q(-15). Solve -cs = x + 7, -5x - 6 = -s - ls for x. -2 Suppose 4f + 20 = 4. Let a be 2/(-8) - 9/f. Solve 0 = au + 2l, -3 = -u + 5u + 5l for u. 3 Suppose -4d - 1 = -21. Let p be (-32)/(-12) - 4/6. Suppose -pk - 2k + 40 = 0. Solve -z - 2r + 11 - 1 = 0, -dz + 2r - k = 0 for z. 0 Suppose 0 = 2d + 4, 2f - 2d + 7d = 0. Solve 0 = fz - 4c - 3 - 5, -2z - c = -11 for z. 4 Suppose -4n - 5w = n - 115, 0 = 4n + w - 98. Let x(v) = -5v - 1. Let t be x(-1). Solve tu = l + 5, 3u - n = 5l - 2u for l. -5 Let d be (-6 - -1)12/(-15). Solve -dp + 5 - 2 = -5o, -2o - 8 = -5p for o. 1 Let u = -8 + 12. Solve -r - 3r - uf = 0, f + 9 = 2r for r. 3 Let r = -8 + 16. Suppose -3k = 3p + 6, -3k + 3p = 16 + 14. Let m = r + k. Solve -5s - 4 = n, 5s + 5n + 12 = mn for s. 0 Suppose -6y + 7y + 45 = 0. Let k be 4/18 + (-215)/y. Solve -d = 3r - 0 + 2, -kd + 2r - 10 = 0 for d. -2 Let y(p) = 3 - 2p - 4p3 + 0 + 5p*3 - 2p*2. Let b be y(3). Solve 2s + 2s - 2c = b, 2s - 28 = -4c for s. 4 Let h = 22 - 12. Suppose -h = g - 3g. Let x be (3/2)/((-3)/(-40)). Solve gy + 3l + 24 = 6, x = -5y - 5l for y. -3 Suppose -4h + 61 = 5t, 33 = h + h + 3t. Let f(n) = 11n - 6 - n2 - 3 - 4. Let j be f(h). Solve -4l = 4y + 16, 3y - 14 = jy - 4l for y. -5 Let j = 6 - 6. Suppose -2u + u - 13 = 3z, -2 = -u. Let o be (-4)/10 + (-12)/z. Solve -2 = -oq + 2f, 2q = -jq - f - 10 for q. -3 Suppose -2h - 15 = -7h. Let z be (0 - 1)-3 + -1. Suppose 0 = g + zg. Solve 3v + 2r + r + 12 = g, 2r = hv - 3 for v. -1 Let m be (-2)/(-2(-3)/(-12)). Suppose -x = -m + 2. Solve -4k + 5v - x - 1 = 0, -v = 3k - 12 for k. 3 Suppose -4w + 0a + 4a + 24 = 0, 5a + 21 = -4w. Let n = w - 2. Let o be (-2 - n)(-10 + -6). Solve -2m = -4c - o, 0 - 14 = -c - 4m for c. -2 Suppose 4y - 27 = 5w, -3w + 4 = -2y + 15. Solve 0 = 2l - 3d - 16, l + y = 2l - 4d for l. 5 Let g = 39 - 77. Let m = g - -68. Solve -4u + 2v = 4v - m, 2u - 5v = -15 for u. 5 Let t(q) = q*2 + 7q - 9. Let m be t(-9). Let x = m + -5. Suppose -xp + 20 = -4y, -5y - 2 = -p + 3. Solve -2 = -i + b, 5b + 28 = -yi - i for i. -3 Let y be 1032/40 + 2/10. Solve 0d + 6 = -r - d, -3r = 5d + y for r. -2 Suppose -44 = 4z - 72. Solve -5m - 2i + z = -12, m - 9 = -3i for m. 3 Suppose -5x + 9 = -3m, -5x + 32 - 7 = 5m. Solve -2p - 11 = -md + p, -p = 3 for d. 1 Let n(x) be the third derivative of x4/24 - x3/6 + 5x2. Let b be n(6). Solve -8 = 4r + p, 3p + 0 + 7 = br for r. -1 Suppose 15 = a - 6a. Let v(o) = o2 - 3o. Let q be v(a). Solve g + q = 2h - g, -g = -5h + 25 for h. 4 Let r be (-10)/(-45) + 980/45. Solve 0 = -a - 5p + r, 18 = 3a + 4p - p for a. 2 Let x be -1(-2 - -2 - -3). Let o(i) = -i*3 - 2i*2 + 3i + 4. Let d be o(x). Solve -2l - 5u = -dl + 3, -5l = -5u for l. -1 Let x = -8 + 11. Solve -3w = 5n - n, 0 = xw - 4n for w. 0 Let u(w) = w + 4. Let h be u(0). Suppose 0 = hk + 10 - 2. Let t be k/(-3) + (-16)/(-12). Solve n + 6 = -3b, -n - tn = -5b - 10 for b. -2 Let a(g) = -6g - 4. Let h be a(-3). Solve -4n + h = -l, -2n + 2 = l - 2 for n. 3 Suppose 5h - y - 25 = 2y, 3y + 15 = 3h. Let d(j) = j - 18. Let a be d(18). Solve a = 5p - ho + 10, 3o = -2p + 1 + 10 for p. 1 Suppose 0 = 4p + p - 25. Suppose y - 8 - 11 = -pj, 3j + 3y = 21. Solve 3b = -3u - 6, -4 = -4b - ju - 15 for b. -5 Let j = 14 - 14. Let k be (1 - (-29)/3)(-3)/(-2). Solve 0 = -5c + 9 + 11, -4s + 2c - k = j for s. -2 Suppose 3p = 8 - 5. Let h(q) = -q3 + 10q*2 - 11q + 22. Let m be h(9). Solve -3k - 2v = -23, 3k - mv + 0v + p = 0 for k. 5 Let n(t) = t2 - 2t - 1. Let c be n(-1). Suppose 0 = cy - 2 - 22. Solve -m - 16 = -5b, -4b + 2b - y = -5m for m. 4 Let l be ((4 - 1) + 0)1. Solve 2o + lo + 10 = -5m, -5o + 26 = -4m for m. -4 Suppose 0d + 18 = -3d. Let n(u) = u3 + 5u*2 - 7u - 1. Let p be n(d). Solve -pw - 5y = -5, 3w + 5y - 6y - 7 = 0 for w. 2 Suppose -f - 6 = -4f. Let o(n) = -n*2 - 5n + 8. Let l be o(-6). Solve -4r + fr = -2w + 12, 5r + lw = 5 for r. -1 Let c(g) = 2g + 12. Let n be c(-5). Solve 2o + 16 = m - o, 0 = no + 8 for m. 4 Let s = 2 + 2. Solve 0 = -5h - 4d - s, 6d - 20 = d for h. -4 Suppose -d = 5t - 85, 5d + 7 = 3t - 4t. Solve -4z = z + 5c + 25, 3z + t = -4c for z. -2 Suppose 2z = z. Let y = 15 - 12. Solve -ym + zs + s - 5 = 0, 5s = -5m - 35 for m. -3 Suppose -3w = -2b - b + 9, 0 = -5w - b + 3. Solve -2x + 31 = -wx - 5d, 0 = -x - 3d - 12 for x. 3 Let g = -28 - -34. Solve -5d - 3 = -gn + 2n, -2 = -n for d. 1 Let o(m) = m3 - m2 - m + 5. Let w be 01(-1)/2. Let l be o(w). Let k = 8 - l. Solve -5y - 21 = ks, 3s + 11 = -3y - 4 for s. -2 Suppose 0 = 2d - 3d - 5p - 17, -d + p = -7. Suppose 2k + 6 = 0, -3k - 4 - 5 = q. Suppose ql - 3l = -9. Solve 3j + ly = 24, 2j - 5y + 20 = dj for j. 5 Let g(d) = -d3 + 5 - 5 - d2 + 4 - d. Let h be g(0). Solve hq + 5o = -37, 2q = q - 2o - 13 for q. -3 Let z(j) = -6j - 5. Suppose 4 = 5s + 34. Let a be z(s). Suppose -67 = -4k + 3d, -d - a = -2k + 4. Solve -4o - 30 = 6w - w, 0 = 3o + 2w + k for o. -5 Suppose 0 = 25g - 24g - 2. Suppose 4v - 11 = -4a + 3a, 5a = -4v + 23. Let l = 5 - a. Solve -3 = 3q - f - 1, -f = lq - g for q. 0 Let c(s) = -s*3 + 4s*2 - 5s + 4. Let j be c(2). Solve 3o = jh + 3h - 6, -o - 2 = 0 for h. 0 Let v(d) = -3d + 9. Let g be v(2). Solve -gs - w + 27 = -8s, -3s + 5w = 25 for s. -5 Let u be 2/(-1) + (14 - 10). Solve 9m = -uf + 4m + 21, 2f - 1 = -m for f. -2 Suppose -2y + 2 = 4o, -6 = -y - 2y - 3o. Solve -yz - 3u + 0u = 0, -5u = 3z - 6 for z. -3 Let g(t) = t2 + 2t - 36. Let i be g(7). Solve -3y = -9, 3u + i = 6y - y for u. -4 Let r be (1 - 0)(1 - -1). Suppose -4 = 2t - rc, 5c + 4 - 30 = -3t. Solve -ts = 0, -g - 1 = 5s + 2 for g. -3 Let g be (-3)/(18/4)-3. Suppose gh = -3r + 22, r - 4h = -9h + 29. Solve -j + 10 = -5i, -r = -3j + i - 2 for j. 0 Let f = -8 - -6. Let u = 6 + f. Solve -2h - 2h - uv - 24 = 0, 2h + 5v = -27 for h. -1 Let k(f) = -f - 2. Let o be k(-2). Solve og + 3p = -g - 8, -2p - 2 = -g for g. -2 Let l be (6/(-9))/(2/(-72)). Let g = 48 - 15. Let t be 15/(-25) + g/5. Solve o - to + n + l = 0, -3o - 4 = 4n for o. 4 Let o be 2/8 - (-69)/12. Let q be (-14)/(-2)4/14. Let u = o - q. Solve -5d + j = -2, uj = 5d - 2d + 9 for d. 1 Let t be (4/(-5))/(5/25). Let c be t((1 - -1) + -3). Solve -2r + 3w = -14, cw = 6 - 22 for r. 1 Let x(g) = 2g*2 - 6g - 5. Let u be x(-1). Solve -4p - 14 = z, uz = 3p - 2 + 5 for p. -3 Let d be ((-1)/(-2))/(2/8). Let o be (-1 + 0 + 1)/2. Suppose -dh - 2h = o. Solve -3s - 6 - 6 = 0, h = -2i + 3s + 18 for i. 3 Suppose 8x - 137 = 95. Solve -z = -0z - m + 8, 0 = -3z + 4m - x for z. -3 Let a = -28 + 31. Let v be 1/(a1/36). Solve 4h - v = 0, -2m + 12 = 4h - 4 for m. 2 Suppose -4g = -5 + 1. Let m(v) = -v3 + 3v*2 - v + 5. Let r be m(3). Solve 0 = 2q - 4*f - r, -q + g	{ "pile_set_name": "DM Mathematics" }
3 and 9675656. -2902696.8 Multiply -59 and -3221491. 190067969 Calculate -6350516. -2103096 -352.3 times -2009 707770.7 -9592350.044 -42206.34 Multiply 13802 and -13030. -179840060 82032-2.92 -239533.44 Work out 4368 -1967. -8591856 Work out -3.9 * 0.614207. -2.3954073 -0.291110313 -3.7844339 -15 -1607434 24111510 What is the product of 0.5 and -37550928? -18775464 Product of 87745 and 2110. 185141950 Work out 0.1349 * 61936. 8355.1664 Calculate -1.028426564-0.4. 0.4113706256 9483.1 times 0.75 7112.325 -1184.7-3.736 4426.0392 Product of -0.53101 and -7. 3.71707 2 times 77796757 155593514 Multiply 9.287 and -0.6035. -5.6047045 Multiply 2.2 and 1743.7237. 3836.19214 Work out 87 * 6412.1. 557852.7 -22.7272 * -0.24 5.454528 470.381 times 2.1 987.8001 21.74-0.104931 -2.28119994 What is -471 times -360218? 169662678 -29914835 times -11 329063185 What is 20025149 times -9? -180226341 37438.739 -0.4 -14975.4956 What is -206.0513 times -14? 2884.7182 Work out 24.42805526 * 3. 73.28416578 What is the product of 0.115387184 and -5? -0.57693592 -6657.0573 times -1.9 12648.40887 Calculate -0.5477797. -238898.5 What is the product of 209.56 and 5913.8? 1239295.928 Product of 1319.9 and -0.0123. -16.23477 What is the product of -0.39 and -646448? 252114.72 Product of 9.931 and 109.7. 1089.4307 What is 25.54326 times 476? 12158.59176 What is the product of 0.0285 and 17169? 489.3165 -0.032 times -1373.025 43.9368 Calculate -117600910.2. -2352018.2 What is the product of -109222 and 82.6? -9021737.2 Multiply 1181 and 23904. 28230624 What is 2655806 times -1? -2655806 Calculate 6870168. 4771424 What is 0.172 times 2225.184? 382.731648 What is the product of 125479 and 0.09? 11293.11 Work out -6.26 11301. -70744.26 Calculate -0.4-868798. 347519.2 Work out -13.532675 -3. 40.598025 What is the product of 0.6 and 17555.532? 10533.3192 What is the product of -15786.3 and -0.1? 1578.63 Multiply -109002 and 0.9. -98101.8 Calculate 2036-2.6781. -5452.6116 What is -5046.5 times -1710? 8629515 Multiply 15.1 and -48259. -728710.9 94454 times -236 -22291144 1351559.8 351559.8 Work out -454 * -1726.74. 783939.96 3.4669885 34261.41 Multiply 329984.9 and -0.4. -131993.96 -25223752 -5593800 Product of 416910 and 146. 60868860 -357140 times 0.22 -78570.8 -2511847-21 52748787 Multiply 2106193 and 0.26. 547610.18 What is 0.28491523 times -1? -0.28491523 -85592415 -79014825 What is the product of -1 and 92608658? -92608658 Multiply 3.75 and 942. 3532.5 10.976721 836258.9 Work out -10093603 -5. 50468015 What is the product of -18979 and 22712? -431051048 1138611 * 0.158 179900.538 Work out -0.0189 * -305.22. 5.768658 Multiply 142.65703 and -0.3. -42.797109 -0.5 times -3235.902 1617.951 Product of -2 and 1392.87014. -2785.74028 What is the product of -0.032 and -907976? 29055.232 -0.4821 * 550 -265.155 -0.02562326 -0.666198 Work out 0 -1.28705851. 0 Product of -1259.7 and 4.46. -5618.262 Product of -2.35 and -116.282. 273.2627 What is the product of 32.12095 and -0.1? -3.212095 -42 * -6411382 269278044 Calculate -225057.294. -164151.47 Multiply 216534 and 59. 12775506 Product of -0.18 and -113.7291. 20.471238 Work out 1293940 -0.1. -129394 Multiply -8.3 and 150. -1245 14694 times 55.5 815517 0.0904464 times 4 0.3617856 Work out 8.8032774 * -0.2. -1.76065548 -112 * -528277 59167024 What is -6 times -69986907? 419921442 Product of -0.08 and 1.233667. -0.09869336 What is the product of 1 and 3173.039? 3173.039 -0.20013-1062 212.53806 Product of 5 and -3411366. -17056830 -751 119780 -89954780 1.5 * 1924.0184 2886.0276 Work out 4 * 794871. 3179484 What is the product of -0.12 and 1355443? -162653.16 -0.513413022 -6706511 Calculate -1.1665680.058. -0.067660944 -6773.07-0.0386 261.440502 61206 32 1958592 What is 2152648393 times -0.2? -430529678.6 What is the product of -44 and 0.26848? -11.81312 Product of 574 and 100862. 57894788 What is -220631.36 times -1? 220631.36 Product of -90 and -2085. 187650 0 times -1805222 0 0.183 * -110495 -20220.585 Product of -70661 and -467. 32998687 8203911 902429 Product of -7178812 and -8. 57430496 Calculate -23-0.02835426. 0.65214798 -0.5141919528 -70959764 -515.6305-8 4125.044 Product of 93045 and 1527. 142079715 What is the product of 2314638 and -71? -164339298 -0.21 times 296.03 -62.1663 -0.62074486 times -2 1.24148972 -0.10.180359 -0.0180359 Multiply -807922 and -0.053. 42819.866 What is the product of -20.2244 and 0.8? -16.17952 -0.16 -3.716 0.59456 Work out 1 * 9621318. 9621318 Calculate 13293610-42. -558331620 -26188 times -25842 676750296 What is the product of -564 and -1.04128? 587.28192 What is 0.08 times 1220102? 97608.16 What is -2279629 times -0.4? 911851.6 What is the product of -259028 and -0.114? 29529.192 What is the product of -2.34 and -407.44? 953.4096 Product of 3079.2 and 2.9. 8929.68 Work out -22.7 108.03. -2452.281 Multiply -14660 and -2594. 38028040 0.2-285.188 -57.0376 -1109.6189 times -14 15534.6646 Calculate -32704-0.4662. 15246.6048 Multiply 1645 and -1.27859. -2103.28055 What is -3714 times -0.14344? 532.73616 Calculate -686-0.22235. 152.5321 Multiply -7.53 and 0.02542. -0.1914126 Multiply -12.6975 and 618. -7847.055 Calculate 2-29439.982. -58879.964 5469863 times -0.5 -2734931.5 126108744 55487828 1611517 9 14503653 What is -29 times 3977326? -115342454 Product of 5 and 260400258. 1302001290 Multiply -1082369106 and 2. -2164738212 Multiply 893269 and -4. -3573076 What is the product of 430.645 and -87? -37466.115 What is 64365717 times 0.2? 12873143.4 Multiply 174.716 and -1.4. -244.6024 -0.1-808363.7 80836.37 Product of -0.04252 and 0.1101. -0.004681452 Work out -913.6156 5. -4568.078 Work out -2652986.2 * -0.1. 265298.62 -1.43 * -0.033973 0.04858139 Calculate 28359-8.2. -232543.8 Work out 104692 8. 837536 Work out 12831747 * 54. 692914338 Product of 2568.4 and -2059. -5288335.6 2.19-2522.04 -5523.2676 Calculate -22.196650.015. -0.33294975 253.23126.74 32094.3702 -48 106054 -5090592 What is the product of -90361 and 41? -3704801 Multiply -127 and 997579. -126692533 -5220 times 526 -2745720 Work out -134.87 * 3.397. -458.15339 Calculate -2.07995.84. -12.146616 Work out -25 31568. -789200 Product of 23.689715 and 0. 0 What is the product of 1.9 and -137462? -261177.8 -6381288 * 0.6 -3828772.8 -1318157 times -0.21 276812.97 2241735-33 -73977255 6 times 5.59212 33.55272 Work out 517 -160.07. -82756.19 896331121 563469769 Calculate 237.7-0.012277. -2.9182429 47 * 29302 1377194 Multiply -4 and -10664998. 42659992 What is the product of -2 and 0.0221286? -0.0442572 Calculate 1.3-34.174629. -44.4270177 Calculate -0.0677559-0.1. 0.00677559 -3 * 0.1041831 -0.3125493 What is the product of -130 and -45.372? 5898.36 Calculate -261470-131. 34252570 Multiply 8670284 and -3. -26010852 1 0.04504378 0.04504378 What is -1226 times 0.0675? -82.755 169131798 69131798 0.016 times -3343208 -53491.328 -707-502306 355130342 Calculate -1183626591. -314731076 Calculate 240507-17. -4088619 -86194 * 77 -6636938 Work out 1295.7426 * 4. 5182.9704 -10 * -3355651 33556510 0.106853293 351.85705 300 0.010542 3.1626 What is the product of 5 and -14663716? -73318580 What is the product of -9384799 and -1.5? 14077198.5 Calculate 6925123860.4. 277004954.4 -1556764 times -0.33 513732.12 What is the product of 0.813349 and -11? -8.946839 Multiply 0.3 and -16167965.3. -4850389.59 1930.4445 86869.8 -25.6429926 * 0.3 -7.69289778 -8484128 -7066752 3156.368-22 -69440.096 Multiply -509223 and -132. 67217436 0.15.652993 0.5652993 Product of 4 and -800117.5. -3200470 Calculate -239-14425.9. 3447790.1 -3-1568842.8 4706528.4 Work out -87213 -1228. 107097564 Calculate 0.8-0.14856955. -0.11885564 Multiply 0.7335 and 173. 126.8955 Calculate -200063061. -20006306 What is the product of -2 and -42378776? 84757552 Product of -948 and -23.52. 22296.96 -7261667.2 -4844539.2 What is -905.18 times -1575? 1425658.5 What is -3572975 times 8.3? -29655692.5 Calculate -62997854. -61866948 Multiply -314 and 34.14. -10719.96 Product of 3.1713 and 0.1087. 0.34472031 -353.74 times -1668 590038.32 What is the product of 4 and 11197077? 44788308 What is 58602 times 210? 12306420 7	{ "pile_set_name": "DM Mathematics" }
(-12)12/6. -1/3 Calculate (9/(-6)-12)/3. 1 What is the value of 5(-10)/(-25)-2? -4 What is ((-8)/12)/((-2)/3)? 1 What is (2/1)/(96/(-12))? -1/4 What is the value of (-6)/(-8)(-16)/(-20)5? 3 What is the value of (7/(-14))/(6/4)? -1/3 29/(2030/336)5/4 6 What is the value of 12((-2)/5)/((-104)/130)? 6 Calculate 1-13/3. -1 What is the value of ((-45)/27)/((-10)/4)? 2/3 What is the value of (8/(-14))/(30/105)? -2 Evaluate (9/13512)/(2/(-15)). -6 (-6)/((-4)/(47/7)) 6 Evaluate ((-6)/(-4))/((-186)/(-62)). 1/2 ((-60)/(-30))/(2(-4)/32) -8 ((-8)/(-3))/(24/(-36)) -4 Calculate (-245)/(-1127)(-4)/(-10). 2/23 What is the value of -33-41/12? 11 Calculate ((-2)/(-4)-1)/(1/(-6)). 3 10/1536/((-8)/(-2)) 6 -1(14/2)/(15/(-15)) 7 What is the value of -44(-1)/84/(-8)? -11/4 (-176)/96(-3)/11 1/2 What is the value of ((-18)/(-21)7/4)/6? 1/4 Evaluate 37/(-294)4. -2/7 What is (93/279)/(2/16)? 8/3 What is (-5)/2510/(-4)-6? -3 Calculate (30/25)/((-9)/30). -4 Calculate 0/((-2)/25). 0 (-6)/(-3)2/6-3 -2 What is the value of ((-3)/(-12))/((-30)/60)14? -7 What is (1/1)/((-9)/36)? -4 2/14(-3)/32 -2/7 Evaluate 1/((-32)/962/2). -3 What is the value of ((-2)/(-5))/(35/(-25))? -2/7 ((-6)/(-9))/(3(-8)/(-108)) 3 (10/105)/((-5)/(-15)) 2/7 -51(96/(-10))/(-8) -6 What is the value of ((-21)/(-3))/140/2? 0 Evaluate ((0/2)/((-28)/(-28)))/(-1). 0 Evaluate (2(-1)/(-10))/((-412)/1545). -3/4 Evaluate 72/((-18)/(-2))2/4. 4 3/(-1(12/8)/1) -2 What is the value of (12/22)/(24/33)? 3/4 What is the value of (-14)/(-4)(-142)/71? -7 ((-42)/(-56))/(-21/(-8)) 3 What is the value of (-3)/(-72)8-4? -4/3 Evaluate 4/2060/(-54). -2/9 ((-390)/20)/13(-8)/(-42) -2/7 Calculate (-12)/2527/(14/12). -2/7 Evaluate (36/3)/24-4. -2 Calculate 24/(-60)15/4. -3/2 Evaluate (279/(-62))/(3/4). -6 What is the value of (-12)/(-60)0(-2)/(-8)? 0 What is the value of (-2)/(-30)12/2? 2/5 Evaluate (62/93)/(2/(-3)5). -1/5 What is the value of (-2)/(-2)(-24)/(-132)? 2/11 What is the value of ((-2)/(-5))/((-137)/2740)? -8 What is the value of 34/(-18)-6? 4 Calculate 364/783/(-2). -7 What is the value of 170/(-204)(-4)/(-10)? -1/3 Evaluate 76/(-285)110/4. -2/3 What is (-3)/((-75)/(-5))(-25)/(-30)? -1/6 Evaluate (-4)/(-4)(-1)/(-2)-2. -1 What is the value of ((0/(-4))/3)/(3/(-3))? 0 Calculate (30/(-8))/(486/(-108)). 5/6 Evaluate ((-2)/(-4))/(1/205). 2 What is the value of ((-33)/(-33))/(2/6)? 3 Evaluate (1(-4)/(-48)6)/(-2). -1/4 What is 117/(-156)24/27? -2/3 Calculate 147/493(-1)/1. -9 What is the value of -312/15(-110)/66? 4 Calculate 26/(-39)(-12)/2-1. -4 Calculate (5/((-15)/(-2)))/((-22)/(-99)). 3 Evaluate 3-31/9. -1 What is (9/((-810)/6))/((-2)/6)? 1/5 (50/75)/(4/(-2)) -1/3 (-9)/(-18)(-6)/(-4)4 3 What is 340/3421/(-5)? -4 What is ((-11)/(-22))/((-3)/(-4))? 2/3 Evaluate ((-40)/5)/163-1. 3/2 What is the value of 8/101/45? 1 0/(1/((-4)/(-4))) 0 (((-144)/27)/8)/2 -1/3 (-1)/(((-33)/6)/11) 2 Evaluate (154/(-385))/(((-18)/10)/(-1)). -2/9 (-10)/(-35)73/(-2) -3 (7/28)/(21/36) 3/7 What is the value of (72/(-600))/((-18)/(-15))? -1/10 What is ((-2)/(-16))/(1/(-6))? -3/4 What is the value of -3(16/(-6))/(-8)? -1 What is the value of 1162/332(-4)/72? -4 What is the value of (10/(-4))/((-1)/2)? 5 What is the value of 74/148(-8)/(-6)? 2/3 Calculate ((-30)/(-15))/(((-6)/(-3))/(-2)). -2 What is -110/(-5)(-4)/4? -2 Evaluate ((0/4)/5)/2. 0 What is the value of 428/9624/(-154)? -6/11 (30/27)/(18/(-81)) -5 (26/((-156)/27))/(3/(-4)) 6 Evaluate (-2)/((-2)/15)4/12. 5 What is 0/382/6? 0 Calculate (2/1)/(64/(-16))-10. 5 What is (5/10-1)/((-5)/(-6))? -3/5 What is (((-2)/4)/(1/8))/(-10)? 2/5 Calculate (-2)/((-2)/(-50)10). -5 Calculate (-33)/(-275)5/1. 3/5 Evaluate (196/343)/(34/7). 2/17 What is 16/(-160)8/(-2)10? 4 Calculate (2/31)/(2/(-1)). -1/3 What is the value of (-4)/((50/(-2))/5-2)? -2/5 Calculate (-330)/(-132)(-1)/20. -1/8 Evaluate (1/2)/((-2)/(-16)). 4 What is 2/(-5)(-20)/(-8)? -1 What is the value of (-402)/(-268)(-4)/(-6)? 1 (10/4)/(24/48) 5 (-10)/(-2)3(-1)/(-5) 3 What is the value of -34/24-61? 3 What is the value of 5/((-10)/1)-2? 1 ((-99)/165)/((-18)/10) 1/3 Evaluate (3/2)/((-23)/46). -3 Calculate ((-161)/483)/(2/(-6)). 1 Evaluate 1/(((-8)/80)/((-2)/4)). 5 Calculate ((-12)/48)/((-14)/(-280)). -5 Evaluate (1/1)/8-3. -3/8 Evaluate (-2)/810. 0 What is ((-10)/(-105))/((64/(-12))/8)? -1/7 Evaluate (-36)/(-28)(-7)/(-21). 3/7 Calculate (-34)/51(-3)/(-8). -1/4 What is (-14)/351/(-2)? 1/5 Calculate (360/35)/(-9)(-1)/2. 4/7 Evaluate (-6)/(-8)20/(-5). -3 Calculate 4/49/(-3). -3 (-18)/(-3)(-2)/6 -2 What is 3/12/2? 3 Evaluate ((-6)/54)/((-21)/27). 1/7 What is the value of (-6)/(-1)(-5)/(-45)-6? -4 What is the value of 12/44/2? 6 12/((-576)/(-12))4/(-1) -1 Evaluate (27/(-27))/((-1)/(2/2)). 1 (2/((-50)/45))/(18/(-60)) 6 Calculate (21/(-7))/((-2)/(-6)-3). 3 What is the value of ((-75)/(-50))/(6/20)? 5 What is the value of (17/4488-8)/((-1)/(-6))? -2/11 50/(-75)16/(-14) 2/7 Evaluate ((-7)/(-63))/((-7)/14). -2/9 Evaluate (5(-4)/(-20))/(-1)3. -3 What is (-5)/(-13)(60/50)/(-3)? -2/13 What is -168/(112/7)? -8 Evaluate (74/(-185))/((-1)/1). 2/5 What is the value of (7/(420/8))/(16/40)? 1/3 What is the value of ((-7)/(28/20))/4? -5/4 Calculate (4/36)/((-9)/81-1). 1 Calculate (-9)/(-6)(672/18)/8. 7 Evaluate (-2)/(((-12)/(-15))/(-2)). 5 Evaluate 31/(-6)140/10. -7 What is the value of (-2)/(-6)(-7)/(21/6)? -2/3 What is -21(-25)/(-15)(-3)/(-15)? -7 What is the value of (8/(-10))/((-90)/(-675))? -6 Calculate 6/(33/(-44)2). -4 Evaluate (2/5)/(16/(-30)). -3/4 Calculate -5(72/84)/(15/21). -6 What is (-14/16)/(1/1)? -1/4 What is the value of ((3/54)/1)/((-3)/24)? -4/9 What is the value of (-1)/(-1)0/1? 0 (-6)/((-6)/2)-11 -2 What is (87/(-116))/(-3(-3)/(-60))? 5 What is (3/(1/1))/((-18)/(-12))? 2 (-3)/(-2)(-10)/3 -5 Evaluate (-5)/(250/15)(-8)/6. 2/5 Evaluate 6/(-2)(28/(-12))/(-7). -1 What is ((-2)/14)/((-1)/21)? 3 What is the value of (6/(-68))/((-360)/1020)? 1/4 What is (-1)/(-1)(-184)/(-460)? 2/5 Evaluate (-1)/((15/(-60))/(1/4)). 1 What is the value of ((-10)/(-12))/(-42/48)? -5 What is (108/(-144))/(9/(-8))? 2/3 Evaluate (12/2)/6-3. -3 Evaluate (-5)/6(-9)/(270/(-16)). -4/9 What is ((-4)/84/14)/1? -1/7 Evaluate 1(62)/((-12)/6). -6 What is 7((-16)/(-8))/((-2)/(-1))? 7 What is 20/10(-6)/4? -3 (5/(150/(-2)))/(8/(-10)) 1/12 Evaluate (-1)/((-2)/9)(-10)/75. -3/5 ((-20)/(-15))/(-4)(-18)/14 3/7 Evaluate (2/(-3))/(1/6). -4 Calculate ((-5)/1)/(192/(-192)). 5 Evaluate ((-3)/4)/((-10)/40). 3 -551/340(-1)/(-3) -1/4 Evaluate (4/2)/(60/(15/3)). 1/6 What is the value of (-15)/(-70)-2(-5)/(-5)? -3/7 (-22)/33(-18)/(-30) -2/5 Calculate (-6)/(-3)-1(-4)/(-4). -2 What is the value of 5/360-86/(-4)? 1/6 Calculate (-1)/((54/30)/9). -5 Calculate (297/396)/((-3)/(-28)). 7 2/7(-4)/(16/7) -1/2 What is the value of 2((-3)/(-4))/((-36)/(-168))? 7 (-2)/(-8)216/(-270)2 -2/5 What is (-1)/((7/42)/1)? -6 2/(140/(-42)12/10) -1/2 Evaluate 16/(-48)(-4)/(8/(-6)). -1 What is 6/(1/(2/3))? 4 ((-9)/6)/(450/40) -2/15 Calculate (-10)/(-2(-1)/4-4). 5 What is the value of ((-2)/3)/((-21)/(84/(-16)))? -1/6 Calculate ((-6)/(-7))/((-76)/(-266)). 3 (242/(-99))/((-26)/117) 11 Evaluate (-3)/(-3)-35/45. -1/3 Calculate (((-8)/9)/4)/((-7)/189). 6 (7/(63/3))/((-5)/15) -1 Calculate ((-9)/2)/((624/(-64))/(-13)). -6 What is the value of 30/104(-3)/18? -2 (-9)/((-1296)/(-128))3/(-2) 4/3 Calculate ((-4)/(16/(-3)))/((-3)/(-24)). 6 What is the value of (-720)/(-60)((-3)/(-10))/3? 6/5 Evaluate (-8)/(-6)(-144)/64. -3 Evaluate ((-2)/(-24))/(-12/20). -5/6 What is the value of (-4)/(-14)-1(-7)/3? 2/3 What is the value of ((-37)/(-74))/((-2)/(-24))? 6 What is the value of (10/(-6))/((-25)/135)-1? -9 -45116/(-80) 9 What is the value of ((-10)/3)/((-20)/15)? 5/2 What is 9(6/(-21))/((-21)/49)? 6 Calculate 6/((-6)/(-3))(-12)/9. -4 Calculate 7/(-10)(-2)/(-14). -1/10 Evaluate (828/(-69))/((-2)/(-1)). -6 Calculate (-3)/42(-5)/15. 1/2 Calculate ((-2)/(-7))/(250/(-350)). -2/5 ((-46)/(-322))/(6/7) 1/6 (-1)/(((-15)/25)/(30/(-325))) -2/13 What is the value of ((-3)/((-63)/(-7)))/((-1)/(-6))? -2 What is 1/((-30)/(-12))(-150)/(-12)? 5 Evaluate (714/51)/(1-2)	{ "pile_set_name": "DM Mathematics" }
x(-2/5)/x assuming x is positive. x(-343/110) Simplify (w/((((((wwwww*(-4/3)ww)/w)/w)/w)/w)/w)ww(-6))/((ww/(w/(www(w/((www(-1/8))/w))/ww)))/((w/w*(-2)ww)/w)) assuming w is positive. w(-91/24) Simplify (w/(w(1/5)w)(w/(w/(w3/w)))/w)/(w8w((w/w10w)/w)/w) assuming w is positive. w*(9/5) Simplify (v/(vv/v*(-6/7))v(-6))(-4/5) assuming v is positive. v(44/7) Simplify (n/(((n/(n(-6)n))/n)/n)nn)/(n/((n/n(-1/6))/n)) assuming n is positive. n(-11/6) Simplify (t(-4))(4/3) assuming t is positive. t(-16/3) Simplify o(1/20)o44/o assuming o is positive. o(861/20) Simplify j/(j*(1/7)/j)j/(j/(jj0))(j/(j(-1)/j))(-15/7) assuming j is positive. j*(-25/7) Simplify ((v/(vv*(5/2)v)v)/v)(-3/34) assuming v is positive. v(21/68) Simplify m(-2/35)/(m(-3)m) assuming m is positive. m(68/35) Simplify ((z(-1))(-4/37))21 assuming z is positive. z(84/37) Simplify (o(6/7))0 assuming o is positive. 1 Simplify (b(-3)b(1/4))/(b(1/2))(-22/5) assuming b is positive. b(-11/20) Simplify (s1)(7/6)/((s4sss)/ss/s(2/9)) assuming s is positive. s(-101/18) Simplify (h5(h*(-3/5)/h)/h)/((hh*(-3/7))/(h(h*4/h)/hh)) assuming h is positive. h*(204/35) Simplify (xx/(x/(x*(1/7)x))x)/(x(xx(-7/5))/xx) assuming x is positive. x(89/35) Simplify ((p/(p/p(-18)))/p)/p(-1/5) assuming p is positive. p(-94/5) Simplify (v/v10)/(v/(v(1/7)v)) assuming v is positive. v(-62/7) Simplify g(5/6)gg/g(21/2) assuming g is positive. g(-23/3) Simplify aa*(-16)a(a(a/((a/a*(-2/5)a)/a))/a)/a assuming a is positive. a(-77/5) Simplify u/(((u/u(2/9))/u)/u)u4u*6u(-2/9) assuming u is positive. u12 Simplify (u/(u/(uuu*(-7)uu)))(11/5) assuming u is positive. u(-33/5) Simplify (vv/v(-17/5))(1/6) assuming v is positive. v(9/10) Simplify d(-20)/(d/d*13d) assuming d is positive. d*(-9) Simplify ll/(l/(l/(ll(4/5))))l*(-4)l(3/8)/l2 assuming l is positive. l(-217/40) Simplify ((u0u)(-21))(-2) assuming u is positive. u42 Simplify n(-2/17)/(nn*25n) assuming n is positive. n(-461/17) Simplify r(2/5)rr*(-5)r*(-2/7)/rrr/r(-5) assuming r is positive. r(74/35) Simplify g(13/5)g(2/9) assuming g is positive. g(127/45) Simplify ((z(-1/8))(-26/7))(6/19) assuming z is positive. z(39/266) Simplify ((v/(v*(-1/14)v))/v)/(vvv(3/20)) assuming v is positive. v(-431/140) Simplify ((o*(3/2)o)/o)/(o/((oo(-9)oo)/o))o*(-1/2)/oo(-4)/o assuming o is positive. o(-13) Simplify ((t/(t/(tt(-3/8)))tt)(-3))33 assuming t is positive. t(-2079/8) Simplify (((jj*(-2/5))/j)/(j/(((jj4)/j)/j)))/((j(3/10)j)/j(1/14)) assuming j is positive. j(13/35) Simplify (o(-15)(oo(-2/5))/o)(-48) assuming o is positive. o(3696/5) Simplify (i(-1/3)i)9 assuming i is positive. i6 Simplify (w*28w)/((w(-4)/w)/w) assuming w is positive. w35 Simplify (a/(((a/a(-45))/a)/a))(-2/5) assuming a is positive. a(86/5) Simplify (f(2/15))(11/5) assuming f is positive. f(22/75) Simplify (u/(((u/u*2)/u)/uu)uu(u(u/(u*(2/7)uu))/uu)/uu)(1/30) assuming u is positive. u(11/70) Simplify (h/(h(-6)/h)(h(h/(h(h/(h(-10)/h))/h))/h)/h)/(h(-1)h)(-1/4) assuming h is positive. h(-4) Simplify (b/((bb/b*2)/b)(bb/b5)/bbb)/(b(-2/5)b)(-1/30) assuming b is positive. b(1/50) Simplify ((y*(-2/71)y)/yy)/y(2/73) assuming y is positive. y(4895/5183) Simplify (r(-8)rr/(rr*8)r)*0 assuming r is positive. 1 Simplify ((w/(www(-2)w))/(ww(-1)w))/((w/w(2/9))/(w/w(5/4))) assuming w is positive. w*(-73/36) Simplify (ss*(-4/7)/s(s*(-5)/s)/s)/(sss/(ss*(-1)s)s)(-10) assuming s is positive. s(157/7) Simplify i(3/7)/(i(-5)/i)i(i/(i(2/33)/i))/iii(-3)/ii assuming i is positive. i(1471/231) Simplify z(-19)zz(-9) assuming z is positive. z(-27) Simplify (ww(-1))2/(w(-8)ww/(w/(w/w8)ww)) assuming w is positive. w16 Simplify ((b3)(2/15))(-13) assuming b is positive. b(-26/5) Simplify (f2)28(ff/f(3/2))/(f/(f(-7)/f)) assuming f is positive. f(95/2) Simplify (oo(-3/5))(-13/4)/((o/(o(2/5)/o))/o)(-36) assuming o is positive. o(203/10) Simplify (t/t(-1))(-27) assuming t is positive. t(-54) Simplify ((d/d(1/7))/((d(4/11)/d)/dd))/((d(-1/4)/d)/(d/((d/(dd((d(-2/7)/dd)/d)/ddd))/d))) assuming d is positive. d(1681/308) Simplify (m(1/14)(m/m(-1/4))/m)(-33) assuming m is positive. m(-297/28) Simplify (g/(g21/g))/g(8/3) assuming g is positive. g(-65/3) Simplify t/t(-7)tt/t(-2)tt(-1/13)t*2tt assuming t is positive. t(220/13) Simplify (gg/(g/g*(-1/4)))/gg(g(-2/3)/g)/ggg(-5)g6 assuming g is positive. g(1/12) Simplify (y/(y(-3)/y))35 assuming y is positive. y*175 Simplify ((nn*1nn)/n(1/2))/((nn(-1))/n)(7/4) assuming n is positive. n*(21/4) Simplify y/(yy/(((y*(-4)y)/yy)/y)y)y/(y/(yy(y/y(1/3))/yy))y(-1/3)(yyy/(y(-2/9)/y))/y assuming y is positive. y(-4/9) Simplify rr(2/13)r/((rr/r3r)/r)(r/r(-2/3)r)(3/11) assuming r is positive. r(555/143) Simplify m(-21/8)/(m/m(-6/7)) assuming m is positive. m(-251/56) Simplify c/c1ccc/c(-3/7) assuming c is positive. c(24/7) Simplify ((z2)(-4/31))(12/11) assuming z is positive. z(-96/341) Simplify c/(c/(c/c(-22)))c(3/10) assuming c is positive. c(233/10) Simplify ((r*(-13)/r)/rrr(r(r(-17/4)/r)/rr)/rrr)(-26) assuming r is positive. r(845/2) Simplify m*(-14)mm(mm(4/7))/m assuming m is positive. m(-80/7) Simplify ((jj*(1/6)jj)/(j(-7)/jj))/((jj9j)/j(-3)) assuming j is positive. j(-23/6) Simplify (a16)(-11) assuming a is positive. a*(-176) Simplify ((qq/(q*(-1/4)q))(-41))(2/41) assuming q is positive. q(-5/2) Simplify (j0j)(-18)j(-1/11)/(j/(j(-1/17)/j)) assuming j is positive. j(-3768/187) Simplify ((s6/s)/ss8s)/(s*(-1/7)(s/(s(s/s2s)/s))/s) assuming s is positive. s*(92/7) Simplify (yyy(-1))(-5/4)yy/y2y(-2/7) assuming y is positive. y(-43/28) Simplify (r(-1/2))(-39) assuming r is positive. r(39/2) Simplify u(-1)/u*(-2/11)(u/u0)(-13) assuming u is positive. u(-152/11) Simplify (o16(o/(o/(oo(2/39)/o)))/o)46 assuming o is positive. o(27002/39) Simplify ((t(-4))(2/29))10 assuming t is positive. t(-80/29) Simplify (((n/n(2/3))/n)44)25 assuming n is positive. n*(-2200/3) Simplify (g/(gg(-12)/g))(-3) assuming g is positive. g*(-39) Simplify (nn0/n)(-33)/(n*(-1/4)nn0) assuming n is positive. n(-3/4) Simplify c(-2)cc(1/10)(c1)(1/8) assuming c is positive. c*(-31/40) Simplify ((uu(u/((u/(uu*(-2/15)u))/u))/uuu)/uu)/(uuu5) assuming u is positive. u(-17/15) Simplify (((k/(k(-2/25)k))/kk)(-2/75))(-1/3) assuming k is positive. k(4/5625) Simplify (q1)(2/107)((q*(-1/7)qq)/qq)/(((q*(-5)q)/q)/q) assuming q is positive. q(5899/749) Simplify (m/(m/(m/m(-6)))mm)/m*(-2/17)m*(-6)/mmm(-2/5) assuming m is positive. m(231/85) Simplify t7t(-2/131) assuming t is positive. t(915/131) Simplify (f(2/3))(-21)((f(1/5)f)/f)(-1/18) assuming f is positive. f(-1261/90) Simplify (l/(l/l*35l))/(l/(ll45)l) assuming l is positive. l78 Simplify (((l/(l(1/2)l))/l)/(l/(ll(-1/5))))/(l(-2)/(l/l(2/5))) assuming l is positive. l(9/10) Simplify (f/((((ff3)/f)/f)/f))/fff(3/8) assuming f is positive. f(3/8) Simplify l/l(-1/30)ll(8/11)/ll assuming l is positive. l*(911/330) Simplify (v/(vvv6))(-24) assuming v is positive. v168 Simplify ((gg36)/g)(11/5) assuming g is positive. g(396/5) Simplify i/i(2/5)(i/(ii*(3/7)))/ii assuming i is positive. i(6/35) Simplify (r(-1))*(-33)((rr/r0)/r)(-10) assuming r is positive. r23 Simplify ((k/k4k)/k*(2/5))/((kk*7)/((((k(k/k(-3/7))/k)/k)/k)/k)) assuming k is positive. k(-419/35) Simplify k*12/(kk/k6) assuming k is positive. k16 Simplify t/t*(3/4)t*4t(-2)/(t/(t(-5)/t)) assuming t is pos	{ "pile_set_name": "DM Mathematics" }
5g - 41. Suppose 3p + 2o - 90 = 0, p = -2o + 17 + w. Suppose -p = -3a + 1. What is the tens digit of a? 1 Let u(o) be the first derivative of -4o*2 + 6 - 1/3o*3 + 10o. What is the units digit of u(-7)? 7 Let f = -38 + 19. Let t = 11 + f. Let g = -4 - t. What is the units digit of g? 4 Suppose 16r = 20r. Suppose i - 592 = -5k, -4k + ri - 4i = -480. What is the units digit of k? 8 Let h(d) = -3d - 5. Let p(i) = -9i - 16. Let k(z) = -17h(z) + 6p(z). Let t(a) = -a - 4. Let x(j) = 2k(j) - 7t(j). What is the units digit of x(6)? 2 Let o(p) = -7p + 27p*2 - 28p*2 + 0p. Let g be o(-7). Suppose g = -2s - 2s + 8. What is the units digit of s? 2 Let y(w) = w*3 + 10w*2 + 11w + 11. Suppose -5c + 90 - 25 = 0. Suppose -2r + 44 = -5f, -2f - c - 1 = r. What is the tens digit of y(f)? 5 Let z(h) = 3h2 - 18h + 4. Let b(a) = -10a2 + 55a - 12. Let r(o) = -2b(o) - 7z(o). What is the tens digit of r(15)? 1 Let o(z) = -z + 3. Let i be o(-1). Let l be 48/(i/2 - 1). What is the units digit of l + 2 + -8 + 2? 4 Let g(z) = -2z + 10. Let a be g(-8). Suppose 0 = 2u - 4x - 22, 2u - 5x + 1 = a. Suppose c + 0i = -ui - 21, -15 = 3i. What is the units digit of c? 4 Suppose 5b = 2b - 69. Let o(d) = -d*3 - 12d*2 + 8d - 14. Let y be o(-13). Let t = y - b. What is the units digit of t? 4 Suppose 40y + 5r = 45y - 14110, -y = -2r - 2818. What is the hundreds digit of y? 8 What is the units digit of 290/75123 - (-4)/10? 6 Suppose -21 = -k - 1. Suppose -10 = -25n + kn. Suppose 12 = nh - 6. What is the units digit of h? 9 Suppose -85 - 35 = 3p. Let y = -10 - -66. Let g = y + p. What is the units digit of g? 6 Let w = -44 - -48. Suppose -4s + u = 0, wu = 3s + 8 + 5. What is the units digit of s? 1 Suppose 9r = 6r + 21. Suppose rq = 11 + 17. Suppose -2t - h + 43 = 0, -t - 75 = -6t + qh. What is the tens digit of t? 1 Let u = 61 + -58. Suppose us = -7 + 61. What is the units digit of s? 8 Let x(j) = 15j*2 + 7j*3 - 8j*3 - 6j + 14 - 9j. Let g be x(14). Suppose -5n - 2p + 90 = g, 5n - 60 - 30 = 5p. What is the units digit of n? 8 Let o(w) = -w2 + 13w - 15. Let t be 94/10 - (-3)/5. What is the tens digit of o(t)? 1 Let r = 13 + -8. Suppose rd - 3 - 22 = 0. Suppose 2 = dw - 3. What is the units digit of w? 1 Suppose 0 = -5i + 6 + 19. What is the tens digit of (-1)/(i/(-510))2? 0 Suppose -37f + 31f = -2472. What is the units digit of f? 2 Let v = -49 - -45. What is the tens digit of 93 - (2/(-4) - (-6)/v)? 9 Let y be 21/(-56)(2 - 10). What is the tens digit of 218-4y/(-24)? 0 Suppose -4o + 42 + 242 = 0. Suppose -4y + 3r = -3y - 89, 3r = -y + o. What is the units digit of y? 0 Suppose 0y - 4y - 4u + 932 = 0, 4y = 3u + 946. What is the hundreds digit of y? 2 Let z be (3 - 54/21) + 2192/14. Let r = z + -97. What is the units digit of r? 0 Let l = -20 - -19. Let q(c) = 3c*2 - 1. Let h be q(l). What is the tens digit of h/(156/51 + -3)? 3 What is the thousands digit of (2152/(-10))/(191/(-3820))? 4 Let w(h) = 3h + 48. Let m be w(-14). What is the units digit of 227 - m - (2 + 0 + 1)? 8 What is the units digit of -15 + 671/44 + 2831/4? 8 Suppose 4w = w. Let c = 31 - w. Let x = c + -14. What is the units digit of x? 7 Let x be -6 + -312/(-9). What is the units digit of 1/x + (-91)/(-14)? 6 Let l be (-4)/6 + 39/(-9). Let b = 5 + l. Suppose b = 2s - 5w - 60, 5s = s - w + 76. What is the tens digit of s? 2 Let n(o) = -5o + 514. What is the tens digit of n(31)? 5 Let f = 659 + -51. Let s be (-4)/(-3) - f/(-12). What is the tens digit of (-4)/(-2) + -2 + s? 5 What is the hundreds digit of (63/6)/(-3)(-8508)/42? 7 Let c be (-6)/3 - (0 + -2). Let f = c + 3. What is the units digit of 1/(-2)(-42)/f? 7 Suppose -13i + 15 = -8i. Suppose ip = h + 3h - 124, -2h - 3p + 80 = 0. What is the units digit of h? 4 Let h = 11 - 11. Suppose 0 = -ht - 3t + 9. Let l = 13 + t. What is the units digit of l? 6 Suppose 5 = -w - 2p + 4p, w - 5p + 14 = 0. Let g be (61)/(w/(-5)). What is the tens digit of g/4(-8)/6? 1 Suppose 2c - 1100 = 4n - 4938, 2872 = 3n + 5c. What is the tens digit of n? 5 Let o(j) = j3 + 6j*2 + j + 6. Suppose 0 = -0u - u + 6. Suppose -5 = -5f + uf. What is the tens digit of o(f)? 2 Suppose -4j = h - 15, 0 = -4j - 5h + 8 + 3. Suppose 0g + jg + 71 = 5v, 70 = 5v - 5g. Let m = v - 4. What is the tens digit of m? 1 Let t(c) = 2c3 - 6c*2 + 4c + 11. Let a be t(5). Suppose -j - 33 = -a. What is the units digit of j? 8 Let r(i) = -i*2 - 8i + 12. Let m be r(-8). Suppose 3z - 2z = 3w + 8, 0 = -z - w + m. What is the tens digit of z? 1 Let z(s) = -46s*2 + 5s - 41s2 + 89s*2 + 54. What is the tens digit of z(-10)? 0 Let h be 2/(-13) - 6265/91. Let q = h + 99. What is the units digit of q? 0 Let i(g) = -2g*2 + 4g + 4g + g2 + 13 - g3 - 7g. What is the tens digit of i(-4)? 5 Suppose -9 = -4f - o, 5f + 0o - 21 = 2o. Suppose 0 = ft - t. Suppose th - 4h = -88. What is the tens digit of h? 2 Let w = 315 - 195. What is the units digit of (2/(-5))/((-8)/w)? 6 Suppose -2m = m - 654. Let q = m + -131. Suppose -5k + 2k = -q. What is the units digit of k? 9 Let m = -1951 - -3315. What is the units digit of m? 4 Let a(f) = -f*3 - 58f*2 - 103f + 54. What is the hundreds digit of a(-57)? 6 What is the units digit of 3 + -3 + 7 + 845? 2 Suppose -4q = -3g + 783, -4 = -q - 7. What is the tens digit of g? 5 Suppose 0 = 24z + 9z - 55011. What is the units digit of z? 7 Suppose -j - 3i - 9 = 0, -5i - 4 = 21. Let k(m) = 6m - 2. Let n(d) = -d2 - d + 1. Let c(s) = -k(s) - 2n(s). What is the units digit of c(j)? 8 Let i = 778 + -755. What is the units digit of i? 3 Let a = 1171 + -777. What is the tens digit of a? 9 Let y = 44 + -27. Suppose -y = -4h - 9. Suppose -2n = -3w - 105, hw - 30 - 100 = -2n. What is the units digit of n? 0 Suppose 0 = -664q + 671q - 7042. What is the units digit of q? 6 Let w = -886 + 1793. What is the hundreds digit of w? 9 Let l be -3(0 + -5)(-1)/(-3). Suppose u - 389 = -3o + 3u, 4u - 663 = -lo. What is the units digit of o? 1 Let x be 89 - (25/(-5) + 0). What is the tens digit of 1x - 6/(-9)-3? 9 Suppose 2n = 6n - 5v - 163, 2v = -3n + 105. What is the units digit of n? 7 Let k(p) = -302p3 + p2 - 7p - 7. What is the hundreds digit of k(-1)? 3 Suppose -29760 = 24i - 36i. What is the tens digit of i? 8 Let p = -43 - -46. What is the units digit of (p/(-6))/(2/(-312))? 8 Let t = -3 + 11. Let c = t - 14. Let x = c - -15. What is the units digit of x? 9 Suppose 5v - 18 = -l - 2, 3v + 4l = -4. Let w(t) be the third derivative of 3t4/8 - t3/6 - 36t2. What is the tens digit of w(v)? 3 Let l(v) = -19v*3 + 5v*2 - 9v - 45. What is the thousands digit of l(-4)? 1 Let w(f) = 20f - 25. What is the units digit of w(4)? 5 Let h be (1 - 3 - -4) + (239 - 5). Suppose -349 = -5g + 2c + 255, -2g + h = 2c. What is the units digit of g? 0 Let o(n) = n3 + 16n*2 - 19n - 16. Let a be o(-17). Let l = 37 - a. Let f = l + -13. What is the units digit of f? 6 Suppose -m + 1407 = v, -1389 = -11m + 10m + 5v. What is the hundreds digit of m? 4 Let z = 6 - 9. Let r be z + 2 + 0 - -143. Suppose r = 3u + 46. What is the tens digit of u? 3 Suppose 0p = -p + 24. Let x = p + -83. Let q = x - -101. What is the tens digit of q? 4 Let n be -6((-15)/(-9) - 3). Suppose -223 + 1079 = nc. What is the hundreds digit of c? 1 Let z(a) = -a3 + 11a*2 - 8a + 8. Let s be z(10). Suppose -33k = -sk - 25. Suppose -f + 107 = 2r, 2r + kf + 16 = 103. What is the tens digit of r? 5 Let f = 56 - 54. What is the units digit of (-1)/((-15)/20 + 1/f)? 4 Let q(l) = l3 - 18l*2 + l - 2. Let r be q(18). What is the hundreds digit of (-293)/(-2) - (-8)/r? 1 Let v = -93 - -95. Let j(t) = 43t - 1. What is the tens digit of j(v)? 8 Let g be 16/24 - 4/(-3). Suppose gt = -0 + 6. Suppose -t = -w + 12. What is the units digit of w? 5 Suppose 3q + 7 = 5n - 9, -2q - 19 = -5n. Suppose -2m + 5g = -152, 3g = qm - g - 235. What is the units digit of m? 1 What is the tens digit of 4 - -4(-952)/64-4? 4 Let x = 20 + -14. Let b be -4 + 3 + x - 0. Suppose -3h - 2c = c - 150, bh = -4*c + 246. What is the unit	{ "pile_set_name": "DM Mathematics" }
(2/6)/(28/168)? 2 Evaluate ((-2)/10)/(-2(-10)/(-60)). 3/5 What is (3/16)/(318/(-424))? -1/4 (-5)/(-2)(-23)/(460/16) -2 Calculate (-2)/2(-4)/(-8)-8. 4 What is 5/30(-21)/286? -3/4 4/2(42/12)/(-7) -1 Calculate (1(-12)/(-30))/(4/(-15)). -3/2 What is 11/(-22)0(-1)/(-2)? 0 What is the value of ((-9)/12)/(((-240)/(-4))/10)? -1/8 (-7)/7245/18 -5 What is the value of (10/(-5))/(2/(-35)-5)? -7 What is (3/(54/(-3)))/((-15)/(-60))? -2/3 What is the value of ((-70)/(-75))/14-3? -1/5 What is 6/9(-8)/16? -1/3 What is (8/(-224))/((-2)/7)? 1/8 What is ((-56)/(-42)(-6)/4)/(-1)? 2 Evaluate (-8)/1218/(-4). 3 Evaluate (-4)/(-12)2/(-8)3. -1/4 What is the value of 3/((-90)/121)? -2/5 What is the value of 0/(-3)-11/(-2)? 0 (88/(-44))/(1/(-2)5) 4/5 7/26(-5)/15 -7 What is (((-24)/42)/(-4))/((-4)/(-12))? 3/7 (1/(12))/(160/(-1600)) -5 What is the value of 7/((-21)/(-6))-2? -4 What is the value of (15/(-15))/((-44)/((-12)/3))? -1/11 What is the value of 54/18(-2)/(-39)? 2/13 (2/(-3))/((-830)/(-249)) -1/5 (2/(-4))/(30/(-12)) 1/5 What is the value of (472/(-413))/(2/7)? -4 What is 6/4-8(-4)/(-168)? -2/7 Calculate 225/(-675)(-12)/(-2). -2 What is ((-3)/14)/(12/16)? -2/7 What is ((-41)/(-123))/((-3)/722)? -4 Evaluate 11/(154/56)(-1)/5. -4/5 Evaluate ((-1)/4)/(4/(-24))2. 3 6/9-2(-12)/56 2/7 What is (-4)/(4(-4)/6)? 3/2 Evaluate (4/(-6))/(4/(-3))10. 5 Evaluate (2/(8/6))/(837/124). 2/9 Evaluate ((-63)/(-12))/(-7)(-9)/(-27). -1/4 3/((-9)/(72/8)) -3 Evaluate 30/(-12)(-6)/3-1. -5 What is (-15)/(-3)25/((-1375)/(-66))? 6 What is (6/1)/((308/14)/(-11))? -3 (1/(-1))/(1/(-5)) 5 Calculate -15-62/(-36)1. -5 What is 4/9(-16)/(288/(-27))? 2/3 What is (-6)/24360/18? -5 Evaluate (-10)/(60/27)(-4)/(-9). -2 What is the value of (-32)/(-10)655/(-262)? -8 Evaluate (2/(61))/(8/(-72)). -3 Evaluate ((-1)/4)/((-66)/(-264)). -1 What is the value of (-12)/204(-35)/(-28)? -3 2/(-1)4/(-16)-2 -1 Calculate (108/48)/((-6)/8). -3 Calculate (2/18)/((-2)/(-2))-1. -1/9 Evaluate ((-35)/10)/(-7)0. 0 (16/24)/(4/3) 1/2 6/(-8)5/(75/(-20)) 1 What is (6/(-10))/(37/(-105))? 3 What is the value of ((-4)/232)/(13/(-572)-11)? -2/29 Calculate 14/(10920/(-10))-12. 2/13 Evaluate (48/54)/((-4)/(-6)). 4/3 What is 322/(-207)(-45)/10? 7 Evaluate ((-4)/(-4))/(198/36). 2/11 10/(-46)(-10)/2259 2/23 2/696/(-176) -2/11 (2(-3)/6)/(220/88) -2/5 What is the value of 439/104(-4)/(-18)? 1/3 Evaluate (-125)/(-375)(-6)/(-26). 1/13 (9(-3)/18)/(-5) 3/10 (((-3)/(-2))/((-6)/(-16)))/2 2 What is (-4)/(-3)24/176? 2/11 What is the value of 1(-6)/((-18)/3)? 1 What is ((-4)/(-1))/(-1)10/(-8)? 5 What is the value of (((-8)/110)/2)/((-41)/615)? 6/11 What is the value of ((-8)/14)/(38/133)? -2 Evaluate (4/(-88))/(-1)6/(-3). -1/11 Calculate 215/(525/(-10)). -4/7 (2/2)/((12/(-2))/(-18)) 3 Calculate (2/(-2))/(27/(-54)). 2 Calculate (11/(-44))/((-1)/(-4)). -1 Evaluate ((-3)/(-21))/((-3)/(-21)). 1 What is (1/(-2))/(8/48)? -3 Calculate (-15)/10(-6)/99. 1/11 Calculate ((6/30)/(-1))/1. -1/5 What is ((-3)/(-9))/((16/36)/4)? 3 (((-15)/10)/(-3))/1 1/2 What is the value of (420/(-45))/(-28)0/1? 0 What is 6/16(-21)/((-63)/(-2))? -1/4 (7/(-21))/((-1)/(-15)) -5 Calculate (12/(-30))/(24/(-10)). 1/6 Calculate 5/(-2)(-5)/(275/66). 3 Evaluate 26/520/2. 0 Calculate (-1)/(3/4)45/15. -4 What is the value of ((-8)/(-7))/(24/2529)? 4/3 What is the value of 42/7015/3? 3 What is 33(-2)/18? -1 What is -910/(-180)-6? -3 Evaluate (0/5)/((-3)/((-9)/(-3))). 0 9/(-108)-12(-8)/14 -4/7 What is the value of 2/(7/21-3)? -2 What is the value of 4/((-8)/2421)? -4/7 (12/15)/(49/35) 4/7 Calculate ((-6)/3)/((-52)/41). 2/13 Evaluate (-2)/(18/(-3)(-1)/(-3)). 1 ((-3)/9)/(2(-7)/126) 3 Calculate (-39)/63/(-39). 1/2 What is the value of (-14)/(-8)(-2)/(-7)? 1/2 Calculate (21)/((-1)/((-5)/(-2))). -5 What is the value of (-2)/8-2(-356)/(-178)? 1 (-36)/27165/176 -5/4 What is ((-2)/1)/((-8)/(-12))? -3 Evaluate 120/(-6)((-4)/1)/16. 5 Evaluate (282/235)/((-4)/5). -3/2 Evaluate 11/((-6)/6). -1 What is the value of ((-159)/265)/(6/20)? -2 What is 9/(-24)(-4)/(-6)? -1/4 What is the value of 24/16-4(-3)/126? 1/7 Evaluate (78/84)/2. 1/3 Evaluate (1/(4/4))/((-33)/11). -1/3 What is (5/(-45)3)/((-33)/22)? 2/9 What is -2(2/12)/(9/(-81))? 3 (1/3)/(-2(-17)/612) 6 Calculate (6/10)/(6/30). 3 What is ((-285)/171)/((-10)/6)? 1 ((15/(-4))/(-5))/(2340/(-416)) -2/15 10/(-2)(-5)/(-15)-3 5 Evaluate (10/(-4))/(11/((-132)/6)). 5 (-3)/(-4)-2(-48)/(-18) -4 Calculate (5/(-3))/(((-105)/(-18))/(-7)). 2 What is -10(155/50)/(-31)? 1 What is ((-4)/1)/((-2)/(-4)2)? -4 Evaluate 2/(((-1)/(-1))/(-1)). -2 What is ((-5)/25)/((-3)/(-5))? -1/3 What is the value of (39/(-27))/((-6)/4)? 2/3 Calculate (-2)/((-11)/(165/50)). 3/5 Calculate (2/(-40))/((-12)/(-24)). -1/10 What is the value of (80/64)/(35/8)? 2/7 Calculate 18/(-2)(-8)/(576/24). 3 What is the value of (8/(-50))/(234/(-195))? 2/15 What is (-31(-18)/279)/(-18)? -1/4 Evaluate -126/1310/(-4). 5 What is -14/((-36)/3)? 1/3 Evaluate (2/3)/(34/(-72)). -4 Calculate (3/(-2)336/(-63))/(-2). -4 What is the value of (-3(-2)/(-6)4)/3? -4/3 7/2-21 -7 What is ((-3)/8)/((-9)/((-108)/12))? -3/8 ((-8)/4)/((-2)/5) 5 Calculate (-48)/6030/(-3). 8 Calculate (129/172)/((-6)/4). -1/2 What is (3(-3)/(-9))/(61/61)? 1 What is 2/4(-218)/327? -1/3 What is the value of ((-3)/15)/((-27)/(-60)-2)? 2/9 Calculate -16/28(-52)/(-39). -2/7 Evaluate 21/(-6)-69/27. 7 (8/14)/(12/28) 4/3 What is (-10)/(-2)(6/2)/3? 5 What is the value of (55/44)/(6/(-8))? -5/3 Evaluate ((-8)/1083)/(4/(-3)). 1/6 ((-693)/2156)/(3/(-4)) 3/7 What is the value of -15(1/(-24))/((-5)/(-10))? 5/4 What is 4/(-6)-3(-4)/(-10)? 4/5 Evaluate 1/914/(-14). -1/9 -48/42/(-16) 1 What is ((-14)/(-252)6)/(2/(-30))? -5 Evaluate ((-3)/4)/(-163/(-384)). -6 Calculate (36/10)/(-3)10/3. -4 What is 8(-100)/(-256)4/(-10)? -5/4 What is the value of (1/(-2))/((-5)/10)? 1 What is (18/32)/(-1)(-40)/(-60)? -3/8 What is (-15)/(-2)7(-6)/63? -5 Calculate 1(-2)/(2/3). -3 Evaluate (23/115)/((-2)/(-10)). 1 What is (2/(-4))/(((-93)/18)/(-31))? -3 Calculate (-72)/2527-1. 2 Calculate ((-15)/(-6))/((-40)/(-384)-4). -6 Calculate 3((-4)/39)/(-2). 2/13 What is the value of 2/60554/12? 3/4 What is the value of 2/(-4)((-56)/(-77))/2? -2/11 What is the value of ((6/69)/(-2))/(7/14)? -2/23 Evaluate (245/980)/(2/321). 4 What is ((-20)/(-36))/(5/(-6))? -2/3 What is the value of (144/14)/(14/1)? 2/7 What is the value of (184/(-92))/((4-1)/(-2))? -1 What is ((-2)/(-14))/((-4)/8)? -2/7 Calculate (-39)/(1287/44)9/28. -3/7 What is ((-10)/(-175))/((-2)/20)? -4/7 What is (1/3)/((21/(-27))/(-7))? 3 (-1)/10(-14)/14 1/10 What is the value of ((-370)/(-111))/(16/6)? 5/4 Calculate (-5)/(9/(270/25)). -6 Evaluate 0/24-11. 0 Calculate (-58)/(-145)((-20)/(-2))/(-2). -2 Calculate ((-605)/(-242))/(5/7). 7/2 (-1)/3-12(-2)/112 -1/14 Calculate 6/(-5)(-55)/(-22). -3 10/8(-224)/(-140) 2 Evaluate (9/3)/((-3)/2). -2 What is (6/72)/(3/8)? 2/9 What is the value of ((-6)/27)/((-9)/9)? 2/9 Evaluate (-4)/3205-2. 1/8 Calculate ((35/7)/90)/(2/(-3)). -1/12 What is the value of ((-51)/(-714))/((-2)/(-7))? 1/4 Evaluate (-8)/(-6)36/24. 2 33(-5)/(-15) 3 1/(4/(-24))(-3)/(-3) -6 Calculate (3/45)/((-7)/(-21)). 1/5 Calculate -51/(-3)15/(-5). -5 What is (((-4)/3)/(-2))/4? 1/6 Calculate ((-1793)/652)/((-22)/4). 1/2 What is the value of (92/(-207))/(70/(-45))? 2/7 15/97/((-1400)/(-72)) 3/5 (6/(-60))/(3/45) -3/2 What is the value of (15/(-50))/(8/(-32))? 6/5 Evaluate (2/7)/((-13)/(-7)). 2/13 What is the value of 0/(-4)9/36? 0 What is ((-12)/(-28))/((-9)/6)? -2/7 What is (-36)/(-45)10/(-4)2? -4 Evaluate (2/2)/(-3)(-27)/9. 1 What is the value of (((-455)/7)/13)/1? -5 Calculate ((-12)/36)/(2/(-18)). 3 What is the value of 11/(-2)4/(-11)? 2 What is 612/(-504)-5? 5/7 Calculate 4/(-6)14/((-168)/(-54)). -3 ((-17)/17)/((-1)/(-4)) -4 Calculate 1/1131/31. 1 What is 1100/(-660)3/25? -1/5 What is 32/10812/(-16)? -2/9 What is (-55)/2221? -5 (4/10)/(55/55) 2/5 Calculate (6/(-75))/((-2)/10). 2/5 18/3020/16 3/4 Evaluate ((-2)/4)/1(-8)/(-4). -1 What is the value of ((238/42)/17)/(1/(-12))? -4 (-8)/(-3)(-177)/(-236) 2 (-5)/15(-3)/(-12) -1/12 Calculate (-16)/	{ "pile_set_name": "DM Mathematics" }
ainder when q is divided by 17. 10 Let a be (-12514)/(-30) - (-8 - (-732)/90). Let z = a - 304. What is the remainder when z is divided by 46? 21 Let a = 13819 + -13752. Calculate the remainder when 384 is divided by a. 49 Let l = 8 - 1. Let z(q) = 60q - 66. Let x be z(8). Calculate the remainder when (-2)/(-3) - x/(-27) is divided by l. 2 Let f be (-4)/30 + (-7 - 308/(-60)). Let b = -100 - -154. Calculate the remainder when b is divided by (19/f)/(2/(-4)). 16 Let q = 1419 + -1376. Let o = -50 + 62. Calculate the remainder when q is divided by o. 7 Suppose 1374g + 246984 = 1497g. What is the remainder when g is divided by 666? 10 Suppose 3z - 2u = 2995 + 389, 2z + 5u - 2237 = 0. What is the remainder when z is divided by 27? 19 Suppose 5d - 4y = 362 + 324, 279 = 2d + 3y. What is the remainder when d is divided by 69? 0 Let a = -32129 - -32249. Calculate the remainder when 1560 is divided by a. 0 What is the remainder when 1475 is divided by (-13 - -7)/((-16)/136)? 47 Suppose -q + 50 + 13 = 0. Suppose 102n + 579 - 2823 = 0. Calculate the remainder when q is divided by n. 19 Let a(b) = 2b2 + 7b + 4. Let c be a(4). Let x = -8 + c. Let r(d) = -d*3 + 6d + 6. What is the remainder when x is divided by r(-3)? 11 Let p(m) = 4m + 10. Let j be p(-4). Let f(w) = -8w + 14. What is the remainder when f(j) is divided by 15? 2 What is the remainder when 245 is divided by 142/8 - (22/(-165) + (-56)/480)? 11 Let n = -199 - -335. Let t(p) = -12p2 + 11p + 18p2 - 7p2 + 5. Calculate the remainder when n is divided by t(9). 21 Let w(x) = -x3 - 9x2 - 17x - 17. Let h be w(-7). Let m = 22 - h. Suppose 0 = -3c - 0c + m. What is the remainder when 9 is divided by c? 3 Calculate the remainder when (5312/(-14) + (-25)/350)-8 is divided by 169. 163 Let g(k) = 4k - 51. Suppose 112 + 168 = 2l. What is the remainder when l is divided by g(16)? 10 Let m = -147 + 149. Calculate the remainder when (-8)/(-16) - (-55)/2 is divided by m - (1 + -14)/(-3 - -4). 13 Let o = 29 - -86. Let x = -31 - -35. Suppose 4z + 4u - 97 - 55 = 0, xz - 5u - 161 = 0. Calculate the remainder when o is divided by z. 37 Calculate the remainder when 4666/8 + (-73)/292 is divided by 83. 2 Let c = -17411 - -17530. Calculate the remainder when c is divided by 56. 7 Suppose n - 244 = -5l + 287, -3l = 5n - 301. What is the remainder when 208 is divided by l? 101 Suppose 0 = -m + 5b + 174, -2m + 3m - b - 170 = 0. What is the remainder when m is divided by 130/(-182) + 2604/147? 16 Let k(a) = 41 + 5a*2 - 7a + 15a2 - 27a + 14a - a3. What is the remainder when k(19) is divided by 20? 2 Let f = 38 - 27. Let j(s) = 42s*3 - 4s*2 - s. Let w be j(-1). Calculate the remainder when (-213)/w9 - 2/(-5) is divided by f. 10 Let w = -27208 - -48375. Calculate the remainder when w is divided by 14. 13 Let s(o) = 30 + o*3 - 15o*2 + 12o + 5o2 - 3 - 2o*3. Let l be s(-11). Let k = 21 + l. Calculate the remainder when k is divided by 20. 17 Suppose 0 = -89b + 86b + 36. Let d(o) = -5o*3 - b + 4o*3 - o + 5o*2 - 8o*2. Calculate the remainder when 23 is divided by d(-4). 7 Suppose 0 = 4x + 4o - 6736, 0 = -x - 3x + 3o + 6701. What is the remainder when x is divided by 112? 111 Suppose -z = 3z - 44. Suppose 5a - 67 = -2w, -3w = -34a + 29a + 62. What is the remainder when z + -3 + (-18)/(-3) is divided by a? 1 Suppose 19m - 22m - 4s + 232 = 0, -227 = -3m - 5s. Calculate the remainder when 86/6 + (-4)/(-6) is divided by ((m/10)/(-7))/(4/(-30)). 6 Suppose 0 = j - 18 + 3. Suppose 0 = -49y + 15y - 209y + 17010. Calculate the remainder when y is divided by j. 10 Suppose 4a - 4127 = 3d, -2d - 596 = -a + 432. Suppose 0 = 8w - 934 - a. What is the remainder when w is divided by 13? 12 Let m be (2/6)/(28/336). Suppose -f - mb + 6b + 34 = 0, 3f - 66 = -3b. What is the remainder when 90 is divided by f? 12 Calculate the remainder when 324 is divided by (-8 - (-7 + (-3)/6))-230. 94 Let w be ((-21)/14)/(9/(-84)). Suppose -wl - 31 = -1109. What is the remainder when 226 is divided by l? 72 Let y be (-2)/10 - (7/(-35) + 0). Suppose y = v + a - 12, -4a - 36 = -3v - 8a. Let w = 173 + -90. What is the remainder when w is divided by v? 11 Let y(d) = d*3 - 2d*2 + 3d - 30. Calculate the remainder when y(5) is divided by 5. 0 Suppose -2708d + 2560d + 13172 = 0. Calculate the remainder when 316 is divided by d. 49 What is the remainder when 1900 is divided by (23/(-23) - 11/(-3))33? 52 What is the remainder when 288 is divided by (-774)/(-4) - 30/1407? 96 Let a(t) = 1435t. Let c be a(-9). Calculate the remainder when c/(-60) + 0 + (-3)/12 is divided by 31. 29 Suppose -i + 2i = 5j - 797, 2i + 154 = j. Let q = -46 + -27. Let s = q + j. Calculate the remainder when s is divided by 15. 12 Suppose 0 = 35g - 5763 + 1633. Calculate the remainder when 300 is divided by g. 64 Let g(o) = 2o*2 - 56o + 299. What is the remainder when g(29) is divided by 33? 27 Suppose 112j = 114j - 3y - 25, -3j = -4y - 35. Calculate the remainder when 486 is divided by j. 1 Suppose -q - 4q = 4k - 22, -k = -3. Let n = -480 - -444. Calculate the remainder when 50 is divided by (-3)/(n/(-52))(q + -5). 11 Let b(v) = 10 - 16 + 54 - 16v + 5. Calculate the remainder when b(-7) is divided by 28. 25 Suppose 3h + 5 = -4i - i, 0 = -i - 3h - 13. Suppose 18 = ic - 0. Calculate the remainder when c is divided by (5/(-2))/(8/(-16)). 4 Let u be (-9890)/23(1 + 6/(-4)). Let m = u - 198. Calculate the remainder when 48 is divided by m. 14 Suppose 3g = -323 + 2996. What is the remainder when g is divided by 149? 146 Let b = -6409 + 7748. Calculate the remainder when b is divided by 10. 9 Suppose 6 - 10 = -2g. Let x(a) = -a*3 - ga - 10a - 2a - 8 + 11a2. Calculate the remainder when x(6) is divided by 13. 10 Let m(h) = -h3 + 4h*2 + 11h - 18. Let b be m(6). Calculate the remainder when 70 is divided by 18/(-8)(20 + b). 7 Suppose -5m - 4f + 2f + 931 = 0, -5m + 3f = -941. Let d = m - 53. Suppose -126 = -3p - 24. Calculate the remainder when d is divided by p. 32 Suppose 8c - 61 - 35 = 0. Let l be (9 + 1)/(0 - -1). Calculate the remainder when (c/l)/((-33)/(-220)) is divided by 3. 2 Let t be (-1)/(1(-1)/84). Let s = 128 - 113. Suppose -sz + t = -13z. What is the remainder when 80 is divided by z? 38 Let y(t) = -21t + 3807. Calculate the remainder when 7152 is divided by y(68). 15 Let a(f) = 2f3 - 12f*2 + 28f - 55. Calculate the remainder when a(7) is divided by 9. 5 Suppose 6 - 5 = -2n - 5r, -5n + 4r = -14. Let k be 12/(4 + -1) - n. Suppose 13a - 495 = -ka. What is the remainder when a is divided by 13? 7 Calculate the remainder when 18/117 - 57/(-52) - 1694/(-8) is divided by 124. 89 Let f = 39116 - 39102. What is the remainder when 2/(-6) - (-1254)/9 is divided by f? 13 Suppose 616 + 96 = 9d + 46. What is the remainder when 118 is divided by d? 44 Suppose -2u + 30 = 4u. Suppose -3n - 20 + 151 = 5x, -205 = -un - 5x. What is the remainder when 119 is divided by n - (-3)/66? 39 Suppose 5l = 4i, -i + 13 = 4l - 8. Suppose 365 = ix + 5o - 8o, 5x + 4o = 365. Let p = 7 - -18. What is the remainder when x is divided by p? 23 Let x = 28610 - 21771. Calculate the remainder when x is divided by 236. 231 Suppose 3a = -5b - 135, 5b - a - 2a + 135 = 0. Let u = -10 - b. What is the remainder when 103 - 7/((-21)/(-12)) is divided by u? 14 Let g be (-13 - -1)(1 - 0). Let r = -2 - g. Let n(f) = 71f + 17. What is the remainder when n(0) is divided by r? 7 Suppose -5d = -9 - 1, 0 = q + 2d + 496. Let h = -485 - q. Calculate the remainder when 163 is divided by h. 13 Suppose 8d - 9d + 462 = -4y, 0 = 4d - y - 1878. Calculate the remainder when d is divided by 69. 56 Let v(z) = -2z3 + 26z*2 + 67z + 65. Calculate the remainder when v(-14) is divided by 6. 3 Let t(a) = 7a2 - 39a - 373. What is the remainder when 5987 is divided by t(-6)? 111 Let s be (-59 - -58)-21. Suppose -sp - 61 = 4n - 203, 0 = -4n + 20. What is the remainder when 422 is divided by p? 56 Let l be 575/161 + 4/(-7). Suppose 0 = -4c + 2v + 156 + 258, -3v = lc - 324. Calculate the remainder when 415 is divided by c. 100 Suppose -5h = -3*i -	{ "pile_set_name": "DM Mathematics" }
93 Sort 2, -1, -2, 5397, 1 in descending order. 5397, 2, 1, -1, -2 Put 2/7, -0.3, 6, -1.3, 0.4 in descending order. 6, 0.4, 2/7, -0.3, -1.3 Sort 1/4, 874.9, 3 in decreasing order. 874.9, 3, 1/4 Sort -2, -14195, 3/7 in ascending order. -14195, -2, 3/7 Put -2, -17, 2, -3/7, 3, 401 in ascending order. -17, -2, -3/7, 2, 3, 401 Sort -6, 5382, 11, -2, 5. -6, -2, 5, 11, 5382 Sort -110.8, -108, 1/3, 3 in ascending order. -110.8, -108, 1/3, 3 Sort 0.0726, 2/15, 8. 0.0726, 2/15, 8 Put -0.3, 10.39, 3, -3, 4, -7 in increasing order. -7, -3, -0.3, 3, 4, 10.39 Sort 5, -1/6, 12, 1084/7 in increasing order. -1/6, 5, 12, 1084/7 Sort -1003, 17, -6 in descending order. 17, -6, -1003 Sort -105, 3, 1332 in descending order. 1332, 3, -105 Sort 0.3265, 0, -0.145 in decreasing order. 0.3265, 0, -0.145 Put -3, -340, 109, 5 in descending order. 109, 5, -3, -340 Put -26, -13/4, -10 in ascending order. -26, -10, -13/4 Sort -0.2, -0.3, -1/2069 in increasing order. -0.3, -0.2, -1/2069 Sort 2, 6, -9731. -9731, 2, 6 Put -14, -4, -2, 1017/22 in increasing order. -14, -4, -2, 1017/22 Put 40, -1484, 3 in descending order. 40, 3, -1484 Sort -40, -5, -23, 12 in decreasing order. 12, -5, -23, -40 Sort -4, -29, 559 in ascending order. -29, -4, 559 Sort 1436, 289, 4 in descending order. 1436, 289, 4 Sort 4, 303, 0.5, -59. -59, 0.5, 4, 303 Put -2, -241, 0.0123 in increasing order. -241, -2, 0.0123 Sort -0.96, -4/7, 3, 67, -0.1 in ascending order. -0.96, -4/7, -0.1, 3, 67 Sort -6.3, -1, 273.9 in increasing order. -6.3, -1, 273.9 Sort 3, 0.27, -3, -95 in descending order. 3, 0.27, -3, -95 Sort -5, -367, 7, -4 in decreasing order. 7, -4, -5, -367 Sort 0, -3, 2, 3/2, 242, 10/9. -3, 0, 10/9, 3/2, 2, 242 Sort -5, -3, 63, 0, -1, 4 in ascending order. -5, -3, -1, 0, 4, 63 Sort 1, -23, 191 in decreasing order. 191, 1, -23 Sort 1, -3, 1797, 5, -1, 0 in decreasing order. 1797, 5, 1, 0, -1, -3 Put -2, 1, 19, -103, 18 in ascending order. -103, -2, 1, 18, 19 Sort -12, -83, -5, 3, -3. -83, -12, -5, -3, 3 Sort -55, 4/23, 3, 0, -0.4. -55, -0.4, 0, 4/23, 3 Sort -2, -1, 98, 154. -2, -1, 98, 154 Sort 6.56, -4, 0.3, -1, 4.2 in descending order. 6.56, 4.2, 0.3, -1, -4 Sort 5, 3, -3, -75, -23, 1 in ascending order. -75, -23, -3, 1, 3, 5 Sort 1, -0.1, -2834.4 in descending order. 1, -0.1, -2834.4 Sort 5, -1083, 0. -1083, 0, 5 Put 24, 4, -30, -5, 1 in ascending order. -30, -5, 1, 4, 24 Sort -0.05, 0.4, -1, -1904. -1904, -1, -0.05, 0.4 Sort -1, 117130/11, 3. -1, 3, 117130/11 Sort -8, 3, -5, 0 in ascending order. -8, -5, 0, 3 Sort 7, -18, 84, 3. -18, 3, 7, 84 Put 2, -2, -4935.2 in decreasing order. 2, -2, -4935.2 Sort 30, -5, -1, -4, 574 in increasing order. -5, -4, -1, 30, 574 Put 4, 3, -1, 361, -5 in ascending order. -5, -1, 3, 4, 361 Sort -0.03, -30, 16 in descending order. 16, -0.03, -30 Sort -106, 417, -3, 3 in descending order. 417, 3, -3, -106 Sort 1, 0.37, -4/33 in decreasing order. 1, 0.37, -4/33 Sort -3, -18, 3, 375, 0 in decreasing order. 375, 3, 0, -3, -18 Put 1/5, -0.1, -24, -4/2811 in decreasing order. 1/5, -4/2811, -0.1, -24 Put 3/2, -2/611, 15 in decreasing order. 15, 3/2, -2/611 Sort -17, -33, 3, 16. -33, -17, 3, 16 Sort 29.1, 6/5, 2, 0.3 in ascending order. 0.3, 6/5, 2, 29.1 Sort 0.5, 4/7, -327 in descending order. 4/7, 0.5, -327 Put -1, -979, -14, 5, 4 in ascending order. -979, -14, -1, 4, 5 Put 2/67, -11, 0, -0.1 in decreasing order. 2/67, 0, -0.1, -11 Sort -4, -9, -1385 in decreasing order. -4, -9, -1385 Put 1.5, 3, -6, -75 in ascending order. -75, -6, 1.5, 3 Put 3/7, -18, -2/11, 5, 0, 48 in ascending order. -18, -2/11, 0, 3/7, 5, 48 Sort 1/2, 0.4, 1212. 0.4, 1/2, 1212 Put 1/5, -0.559, -3, -0.3, -0.2, 7 in descending order. 7, 1/5, -0.2, -0.3, -0.559, -3 Put -3, 3/8, 4/25 in ascending order. -3, 4/25, 3/8 Sort -0.07, -3, 3, 1/14, -2/21. -3, -2/21, -0.07, 1/14, 3 Sort 3, -7, -4, 3618, 1. -7, -4, 1, 3, 3618 Sort 1, 8552, 4, 3 in ascending order. 1, 3, 4, 8552 Put -7.21, 0.2, 0.3, -6 in decreasing order. 0.3, 0.2, -6, -7.21 Sort 2/11, 161.6, -3/4 in ascending order. -3/4, 2/11, 161.6 Sort 7, -2, 397 in ascending order. -2, 7, 397 Sort -11, 9611, 0. -11, 0, 9611 Sort 237, 9, -2, 4, -1, 7 in increasing order. -2, -1, 4, 7, 9, 237 Put -13, 3, 2, 4, -4, -315 in descending order. 4, 3, 2, -4, -13, -315 Sort -5, 17, 2763, -4, -2 in decreasing order. 2763, 17, -2, -4, -5 Put 23, 2, -4, 5, -0.3, -20 in descending order. 23, 5, 2, -0.3, -4, -20 Sort 40621, 3/2, -2 in ascending order. -2, 3/2, 40621 Sort -2, 15, -1, -3, 2, 4. -3, -2, -1, 2, 4, 15 Sort -3, 4, 0, 102, 5. -3, 0, 4, 5, 102 Put -6810, -5, 2/3, 0 in ascending order. -6810, -5, 0, 2/3 Put 5, -3, 41935, 3 in increasing order. -3, 3, 5, 41935 Sort -0.2, -3, 1, -6900 in descending order. 1, -0.2, -3, -6900 Put 31, 3768, 1 in increasing order. 1, 31, 3768 Sort 2, -3088, 0. -3088, 0, 2 Sort 0, -10, 5, -18, 11, 3 in descending order. 11, 5, 3, 0, -10, -18 Sort -1083, 4/7, -0.33, -2. -1083, -2, -0.33, 4/7 Sort 12, 0.03, -13, -1/2, 1/3 in descending order. 12, 1/3, 0.03, -1/2, -13 Put 6, 1, 3, 23, 4 in increasing order. 1, 3, 4, 6, 23 Put -5, 6, -1495 in descending order. 6, -5, -1495 Sort -3, 2463, -9. -9, -3, 2463 Sort -2/11, -5, 13, -2/3, -2.22. -5, -2.22, -2/3, -2/11, 13 Sort 24609, -4, -3, -6 in descending order. 24609, -3, -4, -6 Put 0.5, -0.9, 17/307, -3 in descending order. 0.5, 17/307, -0.9, -3 Sort 2, -5, 19, 4, -1318 in descending order. 19, 4, 2, -5, -1318 Sort 112, 0, 60 in decreasing order. 112, 60, 0 Put 1, 6, 4, -2229, -2 in increasing order. -2229, -2, 1, 4, 6 Sort -1228978, 5, 4 in increasing order. -1228978, 4, 5 Put -1, 1, -0.1, -1.7, 1/5 in descending order. 1, 1/5, -0.1, -1, -1.7 Sort -23.1, 4/3, 0, 240, -3 in descending order. 240, 4/3, 0, -3, -23.1 Sort 7, 6306, 3 in descending order. 6306, 7, 3 Sort -9, 0, -6, 11 in ascending order. -9, -6, 0, 11 Put 357, 4, 2 in descending order. 357, 4, 2 Sort 6437, -3, 0 in decreasing order. 6437, 0, -3 Sort 1, -49, -1, -14, 4 in decreasing order. 4, 1, -1, -14, -49 Put -179, 5, 117 in decreasing order. 117, 5, -179 Put 36, 1/32, -0.2, 0 in increasing order. -0.2, 0, 1/32, 36 Sort 6, 1, -12, -1, -5 in descending order. 6, 1, -1, -5, -12 Put -14, 5, 65, -9 in decreasing order. 65, 5, -9, -14 Put -2.6, -0.16, -21 in increasing order. -21, -2.6, -0.16 Put 1, -24, -5, -3, 8 in increasing order. -24, -5, -3, 1, 8 Put 19033, 4, 2 in ascending order. 2, 4, 19033 Put -543.1, 2, -5 in ascending order. -543.1, -5, 2 Put -3, -0.2, 31, -0.037 in increasing order. -3, -0.2, -0.037, 31 Put -29, -106, -4, 3 in decreasing order. 3, -4, -29, -106 Put -0.5, 5, -79.63 in descending order. 5, -0.5, -79.63 Put -6, -5, -2, 7, -18 in decreasing order. 7, -2, -5, -6, -18 Put 2, 167, -4, -3 in increasing order. -4, -3, 2, 167 Sort 2/5, 5, -2, 0.2, -12.6. -12.6, -2, 0.2, 2/5, 5 Put -3, -4137, 1 in decreasing order. 1, -3, -4137 Sort 3/8, 105810, -1/3 in descending order. 105810, 3/8, -1/3 Put 0, -5, 22, -66 in ascending order. -66, -5, 0, 22 Put 5, 0.3, -0.515, 0.06 in descending order. 5, 0.3, 0.06, -0.515 Put 3, 0, 6192, 5, 4 in decreasing order. 6192, 5, 4, 3, 0 Put 39, 37, 2, -4 in decreasing order. 39, 37, 2, -4 Put 10/3, -5, 0.31, -28 in ascending order. -28, -5, 0.31, 10/3 Put 12, -1, 94, 9, 5, -8 in decreasing order. 94, 12, 9, 5, -1, -8 Sort 0, 972, -26 in decreasing order. 972, 0, -26 Sort -1, 20.74, 0.08. -1, 0.08, 20.74 Sort -4, -12, 4, -111 in increasing order. -111, -12, -4, 4 Put 24, -8, -2, -14, 3 in ascending order. -14, -8, -2, 3, 24 Sort 1/9, 0.02, -11, -141, 4 in decreasing order. 4, 1/9, 0.02, -11, -141 Put -2, -10/3, 508 in decreasing order. 508, -2, -10/3 Put -5, -7/2, 2, -2/9, -19, -32 in increasing order. -32, -19, -5, -7/2, -2/9, 2 Put -7, -5, -1, 2064 in descending order. 2064, -1, -5, -7 Sort -1, -4349, 2. -4349, -1, 2 Sort -4, -1, 3, -42, 11 in decreasing order. 11, 3, -1, -4, -42 Put -149, 38, -4, -1 in descending order. 38, -1, -4, -149 Put -219.9, 5, -3, -0.5, 0.5 in descending order. 5, 0.5, -0.5, -3, -219.9 Sort 7, -1.48, -0.4, 1/2, 0.2 in increasing order. -1.48, -0.4, 0.2, 1/2, 7 Sort 5, 0.9, -3, 2274, 4/5 in descending order. 2274, 5, 0.9, 4/5, -3 Sort -2/3, -4, 0.5, 6.2, 5. -4, -2/3, 0.5, 5, 6.2 Sort 0, 172, 6 in increasing order. 0, 6, 172 Sort -1456, -398, 2 in descendin	{ "pile_set_name": "DM Mathematics" }
6 Calculate the greatest common factor of 40 and 3. 1 Calculate the highest common divisor of 90 and 2376. 18 Calculate the highest common factor of 49 and 31. 1 Calculate the highest common factor of 78 and 1378. 26 What is the greatest common divisor of 516 and 756? 12 What is the greatest common factor of 494 and 754? 26 What is the greatest common factor of 8832 and 72? 24 What is the greatest common divisor of 387 and 215? 43 What is the highest common divisor of 4901 and 7917? 377 Calculate the highest common divisor of 494 and 190. 38 Calculate the greatest common divisor of 2490 and 90. 30 What is the greatest common divisor of 1243 and 11? 11 What is the greatest common divisor of 172 and 2623? 43 What is the highest common divisor of 836 and 76? 76 What is the greatest common divisor of 124 and 186? 62 Calculate the highest common divisor of 2596 and 132. 44 What is the greatest common factor of 30 and 10935? 15 Calculate the highest common factor of 10 and 4710. 10 Calculate the highest common factor of 81 and 11. 1 Calculate the highest common factor of 40 and 85240. 40 Calculate the greatest common factor of 18 and 1656. 18 What is the greatest common factor of 2464 and 154? 154 Calculate the highest common factor of 2 and 6098. 2 Calculate the highest common factor of 210 and 54. 6 What is the greatest common factor of 6 and 729? 3 Calculate the greatest common divisor of 200 and 10. 10 Calculate the greatest common divisor of 66 and 506. 22 What is the greatest common divisor of 1059 and 3? 3 Calculate the greatest common divisor of 378 and 486. 54 What is the greatest common divisor of 40 and 36? 4 Calculate the highest common divisor of 12 and 104. 4 Calculate the greatest common divisor of 2 and 29. 1 What is the greatest common factor of 165 and 6699? 33 What is the greatest common divisor of 427 and 3904? 61 What is the greatest common factor of 2668 and 184? 92 Calculate the highest common divisor of 99 and 693. 99 What is the highest common factor of 2 and 256? 2 Calculate the greatest common factor of 85 and 1751. 17 Calculate the highest common divisor of 1909 and 1. 1 Calculate the greatest common factor of 4042 and 86. 86 Calculate the greatest common divisor of 14180 and 40. 20 Calculate the highest common divisor of 9165 and 390. 195 What is the highest common divisor of 44 and 550? 22 What is the greatest common divisor of 455 and 4004? 91 Calculate the highest common factor of 3 and 1131. 3 What is the greatest common factor of 380 and 20? 20 What is the greatest common factor of 243 and 27? 27 Calculate the highest common divisor of 27547 and 326. 163 What is the highest common factor of 1134 and 2754? 162 What is the greatest common factor of 15 and 37? 1 What is the highest common factor of 13 and 16627? 13 Calculate the greatest common factor of 25 and 205. 5 Calculate the highest common divisor of 13 and 299. 13 What is the greatest common factor of 5565 and 105? 105 What is the greatest common factor of 28 and 1757? 7 What is the highest common divisor of 8 and 15608? 8 Calculate the highest common factor of 640 and 880. 80 What is the greatest common divisor of 209 and 220? 11 What is the greatest common factor of 3 and 51? 3 What is the greatest common divisor of 726 and 5929? 121 What is the greatest common divisor of 846 and 9? 9 Calculate the greatest common factor of 325 and 65. 65 What is the greatest common factor of 327 and 8938? 109 What is the highest common factor of 456 and 24? 24 Calculate the highest common factor of 55 and 20. 5 Calculate the highest common divisor of 10 and 120. 10 What is the highest common divisor of 1952 and 96? 32 Calculate the greatest common divisor of 5832 and 72. 72 What is the highest common factor of 917 and 7? 7 What is the highest common factor of 16383 and 129? 129 What is the highest common divisor of 32 and 2984? 8 What is the greatest common divisor of 12 and 27? 3 What is the highest common divisor of 69 and 2139? 69 What is the greatest common divisor of 765 and 17? 17 Calculate the greatest common divisor of 60 and 108. 12 What is the greatest common divisor of 9665 and 5? 5 What is the highest common factor of 174 and 78? 6 What is the highest common factor of 142 and 6887? 71 What is the greatest common divisor of 12519 and 117? 117 Calculate the highest common factor of 11 and 7183. 11 Calculate the greatest common divisor of 210 and 1344. 42 Calculate the highest common factor of 285 and 255. 15 What is the greatest common factor of 13 and 2561? 13 Calculate the highest common factor of 3 and 7. 1 Calculate the highest common divisor of 364 and 308. 28 What is the greatest common divisor of 81 and 54? 27 What is the greatest common divisor of 2263 and 155? 31 Calculate the greatest common divisor of 111 and 592. 37 What is the highest common divisor of 72 and 99? 9 What is the highest common factor of 42 and 42? 42 What is the greatest common factor of 1207 and 17? 17 Calculate the highest common factor of 855 and 180. 45 What is the highest common factor of 10 and 5515? 5 What is the greatest common factor of 2907 and 102? 51 What is the highest common factor of 72 and 10980? 36 What is the highest common factor of 42 and 162? 6 Calculate the highest common factor of 506 and 1738. 22 Calculate the highest common divisor of 21 and 357. 21 What is the greatest common factor of 154 and 14? 14 Calculate the highest common factor of 340 and 860. 20 What is the highest common divisor of 832 and 16? 16 What is the greatest common factor of 532 and 448? 28 What is the greatest common divisor of 156 and 2106? 78 What is the highest common factor of 9345 and 4895? 445 Calculate the greatest common factor of 966 and 92. 46 Calculate the greatest common divisor of 1352 and 16. 8 Calculate the greatest common divisor of 168 and 192. 24 Calculate the highest common divisor of 266 and 14. 14 Calculate the highest common factor of 85 and 15. 5 What is the greatest common factor of 1369 and 296? 37 What is the greatest common divisor of 250 and 75? 25 Calculate the greatest common factor of 7 and 7. 7 What is the highest common factor of 3260 and 20? 20 Calculate the highest common divisor of 23 and 2461. 23 Calculate the greatest common factor of 469 and 67. 67 What is the greatest common divisor of 22 and 1210? 22 What is the greatest common factor of 37011 and 219? 219 What is the greatest common factor of 378 and 448? 14 Calculate the highest common divisor of 70 and 170. 10 Calculate the greatest common factor of 66 and 18. 6 Calculate the greatest common divisor of 140 and 665. 35 What is the highest common factor of 140 and 12530? 70 What is the highest common divisor of 3111 and 61? 61 What is the highest common factor of 49 and 14357? 49 Calculate the greatest common divisor of 405 and 90. 45 Calculate the highest common divisor of 33 and 5302. 11 What is the highest common factor of 1188 and 378? 54 Calculate the highest common divisor of 2 and 18. 2 Calculate the highest common factor of 4275 and 135. 45 Calculate the highest common divisor of 40 and 15. 5 What is the highest common factor of 143 and 187? 11 What is the highest common factor of 21 and 1? 1 Calculate the greatest common factor of 848 and 16. 16 What is the greatest common divisor of 51 and 9809? 17 What is the greatest common divisor of 30 and 276? 6 Calculate the highest common divisor of 4 and 1174. 2 What is the greatest common factor of 32 and 32? 32 What is the highest common factor of 810 and 738? 18 Calculate the greatest common divisor of 84079 and 83. 83 What is the greatest common divisor of 441 and 9? 9 Calculate the highest common factor of 115 and 368. 23 What is the highest common factor of 13752 and 72? 72 Calculate the highest common divisor of 3780 and 810. 270 What is the greatest common factor of 25 and 295? 5 What is the highest common divisor of 470 and 30? 10 Calculate the greatest common divisor of 104 and 299. 13 Calculate the greatest common divisor of 279 and 27. 9 Calculate the highest common factor of 399 and 651. 21 Calculate the highest common divisor of 3752 and 1232. 56 What is the highest common factor of 403 and 130? 13 Calculate the highest common fact	{ "pile_set_name": "DM Mathematics" }
be 12/92q/(-3). Are 1 and v nonequal? True Let k = -0.88 + -0.12. Which is smaller: k or 2? k Let g = -32 - -24. Which is smaller: g or -7? g Suppose 2u = 5u + 3. Let z be (-1 - (-13)/9)/2. Which is smaller: u or z? u Suppose -2n + 6 = -5n. Which is bigger: -3/5 or n? -3/5 Suppose -1 = -3u - 4. Let i = -2 - u. Does i = -2? False Let m = -1.3 - -0.3. Let i = -13 - -9. Let s = -2 - i. Is m at least as big as s? False Let q be (-4)/(-26) + (-280)/3510. Do -0.1 and q have different values? True Suppose 2c - 3l - 11 = -50, l + 7 = -c. Let g = -9 + 16. Let o be (1/g)/(c/14). Does -1 = o? False Let z(x) = -5x - 5. Let f(k) = -k. Let i(v) = -4f(v) + z(v). Let c be i(-4). Is c < -4/7? True Let v(f) = f*2 + 2f - 2. Let q be v(-3). Let x be q-21/(-2). Let w = -759.7 + 759. Are x and w equal? False Let d be (-9)/(-18) + (-138)/4. Let n = -25 - d. Which is greater: n or 11? 11 Let x be 12/(-9)9/6. Suppose 3f - 3 = -6. Let r = 1 - f. Which is smaller: x or r? x Let h be 6/27 - (-275)/(-630). Are 1 and h unequal? True Let b(n) = -n*2 - n. Let v be b(-1). Let c be ((-2)/(-33) + 0)1. Which is smaller: c or v? v Let n = 2129/1212 + -2/303. Which is bigger: n or 2? 2 Let z = 3 + -2.9. Let x = 368 - 370.98. Let q = x - 0.02. Is q not equal to z? True Let s(i) = i*2 + 12i + 4. Let g = 15 + -27. Let b be s(g). Suppose -n = -bv - 12, 0 = -6v + v + 3n - 22. Which is greater: v or -2/3? -2/3 Let q = -0.9 - -1. Let k = 1.11 - 1.11. Which is smaller: k or q? k Let z = -9 + 9. Let k be z/(1 + -1 + 2). Is k equal to -1/2? False Let m be -72/(-6)3. Let z be (-5)/m(-6)/(-15). Which is bigger: z or 1? 1 Suppose -4w = w - 20. Suppose -w = 4x - 0. Let v be (-2 + (-14)/(-4))/6. Which is greater: v or x? v Let i = -7 + 13. Suppose u = iu - 40. Is u at least 9? False Let d be (4/(-5))/((-4)/10). Suppose 3x = -dx + 30. Let p be (420/300)/((-2)/(-10)). Which is smaller: p or x? x Let x = -9 + 5. Let o = 0.1 - 1.1. Let i = o + x. Are 0 and i nonequal? True Let l be (-2)/(-7) + (-1040)/2464. Is l greater than -1? True Let u = 1.84 - -0.16. Do -0.01 and u have the same value? False Let q(u) = u3 + 2u*2 - 3u + 2. Let o be q(-3). Suppose -2i = -4i - b - 4, -4i + 2b = 8. Let m be (o + -1 + -1)/i. Which is smaller: m or 1/2? m Suppose 2f = f - 1. Suppose -2g + n = 2, -4g + 1 = -n + 3. Let p = f + g. Which is smaller: -1/3 or p? p Let i = -3 - -2.8. Let q = -0.8 + i. Let x = 2.1 + -2. Which is smaller: q or x? q Let u(i) = -5i - 3. Let j be u(-3). Suppose 7 = -4w - 5v, 0 = 4v + j - 0. Which is smaller: -2 or w? -2 Let v be (1/(-9))/(1 + -8). Which is greater: v or 0? v Let m be 4/(-6)3/(-1). Suppose 0 = 2a + mx - 4, a - 2x - 1 = 2a. Suppose -2b = -3v - 4b + a, 1 = 3v + 4b. Which is smaller: v or 2? 2 Let a be (-2 + 2)/(-2) - -3. Let y = 5 - a. Let c be (96/15)/(-4) + y. Which is greater: c or 1? 1 Let s be (-9)/(-2)28/105. Let c = 8 - 6. Is c at most s? False Let c(f) = -8f - 36. Let j be c(-5). Which is smaller: -4 or j? -4 Let k be 8/(-9)54/36. Which is smaller: 0 or k? k Let o = 3.2 - 3. Let q = 110 - 110.2. Which is bigger: o or q? o Let n be 225/30(-40)/42. Does -7 = n? False Suppose -2z - 65 = -7z. Suppose -5 = -2l + z. Let u be (-3)/l + (-2)/(-3). Is u bigger than -1? True Let u be (9/(-5))/((-1)/5). Let p be 222/24 - (12/(-16) - -1). Is u greater than or equal to p? True Let o = -3 + 4. Let c be 6 + -3 - (3 - 0). Is o > c? True Let b = -43 + 30. Let n = 25 + b. Suppose n = 5i + 2. Is i less than or equal to -0.1? False Suppose -3c - 15 = 3m, -3c = -4m - 14 + 1. Is c >= -4/9? False Let w = 3.7 - -1.3. Let j = w + -2. Let f = -27/52 - -10/13. Is f less than j? True Suppose -6b + 86 = -16. Is 18 less than or equal to b? False Let l = 5 + -3. Let q be (-374)/4l/4. Let y = 47 + q. Is y equal to 1? False Let w be (-8)/(-7) + (-6)/6. Let f = w - 23/14. Do f and -2 have different values? True Let q = 3 + -3.09. Let y = -0.01 + q. Is 8 smaller than y? False Let l = 62 + -62. Let d(x) = 2x2 - 1. Let u be d(1). Which is smaller: l or u? l Let v(m) = m3 + 4m2 - 7m - 7. Let w be v(-5). Suppose 5h - w = 17. Suppose 3x - 1 = -h. Is -2 smaller than x? True Suppose 15 = 3b - 8b. Suppose -2 = -2s - 8. Is s > b? False Let m(x) = x3 - 2x*2 + 2x - 2. Let v be 13/(-6)-4. Let w be m(v). Which is smaller: 5/2 or w? w Let y = -43 - -36. Is y at most as big as -4? True Let q = 0.82 + 0.18. Let p be 2/(-27)(-9 + 3). Which is smaller: q or p? p Let d be (-3 + 1)/(2/(-1)). Let l(v) = -4v - 2. Let f be l(-1). Which is smaller: d or f? d Let x(h) be the second derivative of 3h5/10 - 5h4/12 + h3/3 + h*2/2 - 3h. Let r be x(3). Let v = -1365/11 + r. Do v and 1/4 have the same value? False Let s be (0/(-3))/(-3) + 3. Suppose 0 = -sm - 2m. Is 1/13 smaller than m? False Let r = 69/26 - 5/2. Let q be -4 - (-9 - (2 - 8)). Are r and q non-equal? True Let y be 132/18 - (-2)/(-6). Suppose 3 + y = -2h. Is h < -3? True Suppose b + 3w = -2b + 132, -32 = -b - 4w. Let d = b - 527/11. Does d = -1? False Let l be (1285/(-25))/(4/(-3)). Let o be ((-151)/5)/((-4)/(-5)). Let u = l + o. Which is smaller: 0 or u? 0 Suppose 4v - 15 = 3g, -3g = v - 0v. Is 1 less than v? True Let t = 43 - 43.1. Is t > 56? False Let b = 0.077 + -12.677. Let o = -4.7 - b. Let q = o + -8. Which is smaller: q or -5? -5 Let j(y) = y*2 + y + 12. Let f be j(8). Is f greater than or equal to 83? True Suppose 3h - 4y = -28, -4y + 40 = -5h - 4. Let d be 12/h(-8)/6. Which is greater: 2/5 or d? d Let b be 1 - (-2 - (-363)/108). Let y = 1/9 + b. Let j(r) = -r*3 + 4r*2 - r + 5. Let i be j(4). Are i and y non-equal? True Suppose v - 2u + 7u = -6, v - 3u - 2 = 0. Let p be -4 + 2v/2. Which is greater: p or -4? -4 Let t be 540/1701 - 1/(-9). Is -2/7 < t? True Let y = -225133 - -52230721/232. Let p = y + 6/29. Is p smaller than 1? True Suppose -3w + b + 4 = 14, w - 1 = -4b. Which is smaller: -13 or w? -13 Let h be ((-3)/54)/(6/(-9)). Which is greater: 0 or h? h Let p = -0.15 + 0.35. Which is smaller: p or 21? p Let n = -17 - -18. Let f be (9/(-45))/(n - -2). Is 0 at most as big as f? False Let v = -20 - -35. Suppose 0 = -5n - 6p + p - v, -7 = 5n - 3p. Suppose 0y - 4 = 4y. Is n greater than y? False Let u = 10.89 + 0.11. Let q = -10 + u. Is q < 5? True Let d(f) = 4f*3 + 3f*2 + 5f - 3. Let g be d(-4). Let m be (-220)/g + 2/(-7). Which is bigger: m or 11? 11 Let h = 82.4 + -74. Let w = -9 + h. Is -1 >= w? False Let l be -1 - -4 - (-8)/(-4). Which is smaller: 1/40 or l? 1/40 Let p be 26/(-22) - (-3 - -2). Let l(m) = -5m2 + 5m + 1. Let x(s) = -s*2 + s. Let j(h) = l(h) - 4x(h). Let d be j(2). Which is bigger: p or d? p Suppose 7t + 69 = 6. Are t and -9 non-equal? False Suppose -3t = -4z, -6t - 2z + 14 = -4t. Let h = -4 + t. Let g = -2/67 - -164/1005. Do g and h have the same value? False Let i be (-50)/42 - 3/(-13 - -4). Which is smaller: i or 0? i Let x = -0.4 - -0.9. Let f = -0.6 + x. Is 0.7 at most as big as f? False Let j be 4/3 + (-1 - 1). Suppose -4p = 4m + 12, -m - 1 = -3m + 5p. Is j < m? False Let x = -42 - -63. Let v be 4/(-14) - (-4)/14. Suppose v = -5w + 2w - x. Which is greater: -6 or w? -6 Let g(k) = -k*2 + 11k - 6. Let y be g(10). Let h be (y/(-6))/(42/27). Is h greater than or equal to 1? False Let n = -5 - -4. Let u(z) = -z*3 - 6z*2 + 8z - 3. Let k be u(-7). Let c be n/k + 5/(-10). Is 2 > c? True Let h = 2065308971/12302 + -167884. Let w = h + 215219/270644. Let n = 6/11 - w. Is n smaller than 0? True Let k be 1/(-2)0(-7)/28. Which is greater: k or -5/11? k Let r(x) = -x*3 - 4x*2 + 4x - 3. Let q be r(-5). Suppose 3z + q = f, -f = 3f + z - 8. Is f bigger than -3? True Let w be (3 - (-18)/(-5))1. Suppose -5f + 2f = 0. Suppose 0g + 3g = f. Is g less than w? False Suppose u - 3u - 6 = 0. Let a = 5 + u. Let o be -1(2 + 24/(-14)). Is a greater than o? True Let u be (-4)/4 - (0 - 2). Which is smaller: -4 or u? -4 Let a = 11 + -7. Let t = 4 - a. Which is smaller: -0.1 or t? -0.1 Let q(v) = v2 - 17. Let j be q(-7). Is j at most as big as 30? False Let w = 2/29 + 25/58. Which is greater: -1.9 or w? w Let f = 1.43 + -0.69. Let d = 0.51 - f. Let v = 0.07 - d. Does v = 1? False Suppose 1 = 3	{ "pile_set_name": "DM Mathematics" }
ithout replacement from ccllwxrq. What is prob of picking 1 r and 2 c? 1/56 Four letters picked without replacement from hhvvvhhhvhvhhvhhvvvh. Give prob of picking 3 h and 1 v. 99/323 What is prob of picking 1 l and 1 m when two letters picked without replacement from {p: 2, m: 2, x: 3, l: 2}? 1/9 What is prob of picking 2 d and 2 y when four letters picked without replacement from {a: 3, t: 3, d: 9, y: 2}? 9/595 Calculate prob of picking 2 o, 1 a, and 1 r when four letters picked without replacement from {o: 3, r: 1, a: 3, f: 2, j: 5, i: 1}. 3/455 Three letters picked without replacement from nqgg. Give prob of picking 1 n and 2 q. 0 What is prob of picking 1 g and 3 s when four letters picked without replacement from gssggsgsgggggsssggss? 308/1615 Two letters picked without replacement from feefpfpfpfpfp. What is prob of picking 2 e? 1/78 What is prob of picking 1 s and 1 z when two letters picked without replacement from zssszssssssssssz? 13/40 Two letters picked without replacement from {p: 6, x: 4}. Give prob of picking 2 x. 2/15 Four letters picked without replacement from {k: 8, v: 2}. What is prob of picking 2 v and 2 k? 2/15 Four letters picked without replacement from {l: 5, u: 1, d: 4}. Give prob of picking 2 l and 2 d. 2/7 Three letters picked without replacement from {m: 3, c: 1, d: 3, u: 3}. Give prob of picking 3 u. 1/120 Three letters picked without replacement from rjrjjrjj. Give prob of picking 2 r and 1 j. 15/56 Four letters picked without replacement from kvuhphkdd. What is prob of picking 1 u, 1 d, and 2 h? 1/63 Four letters picked without replacement from {y: 14, p: 5}. What is prob of picking 3 y and 1 p? 455/969 Three letters picked without replacement from {s: 11, v: 4, z: 3}. What is prob of picking 1 s and 2 z? 11/272 Calculate prob of picking 1 n and 2 s when three letters picked without replacement from ssvntvgntvvsfstftvtn. 3/190 Three letters picked without replacement from yyofhhkhykhhzkhk. Give prob of picking 1 k, 1 y, and 1 h. 9/70 What is prob of picking 1 i and 1 c when two letters picked without replacement from {h: 1, f: 1, i: 1, y: 1, c: 1}? 1/10 Four letters picked without replacement from {z: 5, i: 2}. What is prob of picking 4 z? 1/7 Calculate prob of picking 3 z when three letters picked without replacement from {z: 6, g: 6}. 1/11 Three letters picked without replacement from svssvssssssvssss. What is prob of picking 3 v? 1/560 Calculate prob of picking 1 w and 2 k when three letters picked without replacement from {w: 1, k: 5, x: 12}. 5/408 Calculate prob of picking 3 l when three letters picked without replacement from {l: 3, r: 1, y: 1}. 1/10 Calculate prob of picking 2 m and 1 e when three letters picked without replacement from oeemr. 0 Three letters picked without replacement from {g: 4, x: 3, f: 2}. What is prob of picking 2 f and 1 x? 1/28 Three letters picked without replacement from {u: 3, k: 7, a: 1, h: 1}. Give prob of picking 1 k, 1 a, and 1 u. 21/220 Four letters picked without replacement from ddddfdfdfd. What is prob of picking 1 f and 3 d? 1/2 Calculate prob of picking 2 v when two letters picked without replacement from {j: 1, b: 3, x: 6, z: 2, r: 4, v: 4}. 3/95 What is prob of picking 2 s when two letters picked without replacement from sysysyysyyy? 6/55 Three letters picked without replacement from {s: 1, u: 1, r: 1, m: 2, c: 2}. Give prob of picking 1 s and 2 c. 1/35 Calculate prob of picking 1 a and 3 s when four letters picked without replacement from ssssssaszasnaaz. 32/195 What is prob of picking 1 p and 3 o when four letters picked without replacement from {p: 3, o: 10, v: 3, i: 4}? 24/323 Two letters picked without replacement from {e: 1, q: 2, w: 1, g: 2}. Give prob of picking 1 q and 1 w. 2/15 What is prob of picking 2 u when two letters picked without replacement from {u: 5}? 1 Two letters picked without replacement from {w: 5, v: 4, i: 3}. What is prob of picking 2 v? 1/11 Three letters picked without replacement from {s: 6, g: 2}. Give prob of picking 3 s. 5/14 Two letters picked without replacement from wwllrt. Give prob of picking 1 t and 1 w. 2/15 Two letters picked without replacement from eyieeiiyiyeeeiylyey. What is prob of picking 1 l and 1 i? 5/171 Three letters picked without replacement from qtqvkovvckvqv. Give prob of picking 1 o, 1 t, and 1 q. 3/286 Four letters picked without replacement from {l: 1, s: 8, q: 4}. What is prob of picking 2 s, 1 q, and 1 l? 112/715 Calculate prob of picking 1 f, 1 v, and 1 m when three letters picked without replacement from fmmfffffmmfmmfmvvm. 8/51 What is prob of picking 2 b and 1 g when three letters picked without replacement from {i: 6, b: 9, g: 4}? 48/323 Two letters picked without replacement from bxbxxrkxn. Give prob of picking 1 x and 1 r. 1/9 Calculate prob of picking 3 n and 1 q when four letters picked without replacement from {q: 5, n: 3}. 1/14 Calculate prob of picking 2 e, 1 q, and 1 d when four letters picked without replacement from {d: 1, q: 1, x: 1, e: 2}. 1/5 What is prob of picking 1 j and 1 s when two letters picked without replacement from {s: 3, z: 5, j: 9, y: 1}? 3/17 Three letters picked without replacement from ebxvubuuux. What is prob of picking 3 u? 1/30 What is prob of picking 2 c, 1 q, and 1 n when four letters picked without replacement from {c: 7, n: 2, o: 7, q: 2}? 7/255 Calculate prob of picking 1 c and 1 h when two letters picked without replacement from chhhccuccccuch. 32/91 What is prob of picking 1 r and 3 v when four letters picked without replacement from rrrvrvrrrvvrrrrrvr? 13/306 What is prob of picking 3 d when three letters picked without replacement from {d: 6, p: 7}? 10/143 Calculate prob of picking 3 j when three letters picked without replacement from {i: 4, j: 6}. 1/6 Calculate prob of picking 2 f when two letters picked without replacement from {x: 1, u: 4, j: 11, f: 3}. 1/57 What is prob of picking 1 q and 1 h when two letters picked without replacement from {r: 7, q: 4, h: 4}? 16/105 Calculate prob of picking 1 t and 2 x when three letters picked without replacement from {e: 1, t: 3, r: 8, v: 1, x: 2, a: 1}. 3/560 Calculate prob of picking 2 l, 1 x, and 1 i when four letters picked without replacement from {l: 2, e: 2, x: 1, i: 1}. 1/15 What is prob of picking 2 h and 1 i when three letters picked without replacement from hllillhi? 1/28 Three letters picked without replacement from ppuekee. Give prob of picking 1 k, 1 e, and 1 u. 3/35 Three letters picked without replacement from {h: 8, q: 5}. Give prob of picking 1 q and 2 h. 70/143 Two letters picked without replacement from swsrfnsffpfn. Give prob of picking 1 f and 1 p. 2/33 Two letters picked without replacement from zsscsszz. Give prob of picking 2 s. 3/14 Calculate prob of picking 1 b and 1 u when two letters picked without replacement from {o: 1, b: 3, u: 2, t: 13}. 2/57 Three letters picked without replacement from {c: 1, d: 1, s: 1, h: 1, y: 2, g: 1}. Give prob of picking 1 g, 1 s, and 1 h. 1/35 What is prob of picking 2 w and 2 y when four letters picked without replacement from ywyyyywyyy? 2/15 What is prob of picking 1 z and 2 j when three letters picked without replacement from iimjjzzijiijmzijjii? 15/323 Three letters picked without replacement from {g: 3, u: 3, i: 5, z: 2}. Give prob of picking 2 g and 1 i. 15/286 Two letters picked without replacement from gwrwzhrgoworgrg. What is prob of picking 1 h and 1 z? 1/105 Three letters picked without replacement from kvvkcvvcccvvv. What is prob of picking 3 v? 35/286 Three letters picked without replacement from nnnnnfnnnnnn. Give prob of picking 1 f and 2 n. 1/4 Calculate prob of picking 1 h and 3 w when four letters picked without replacement from {d: 1, h: 1, x: 1, r: 1, w: 2, z: 1}. 0 Four letters picked without replacement from {r: 6, f: 6}. What is prob of picking 1 r and 3 f? 8/33 What is prob of picking 1 r and 2 h when three letters picked without replacement from gtrkrhptthpk? 1/110 Calculate prob of picking 1 u and 1 r when two letters picked without replacement from wmbmwmnuwrwmnmrw. 1/60 What is prob of picking 2 i, 1 d, and 1 p when four letters picked without replacement from {j: 1, p: 1, i: 2, d: 1}? 1/5 Three letters picked without replacemen	{ "pile_set_name": "DM Mathematics" }
arest to 1/3? (a) -1 (b) o (c) i a Let x = -30 + 61/2. Let j = 0 - 0.2. Which is the nearest to x? (a) -3 (b) j (c) -1 b Let c = -65 + 71. What is the nearest to 1 in c, 1, -1/4? 1 Let f = 37 + -42.7. Let g = 0.04 - -0.66. Let q = g + f. Which is the closest to -0.1? (a) 4 (b) q (c) -2 c Let b be ((-2)/(-14))/(1/(-3)). What is the nearest to -0.1 in -0.5, b, 1? b Let g = -3.2 + 0.2. Which is the closest to g? (a) 3/7 (b) -0.5 (c) -1/3 b Let g = -2 - -1.9. Let t = 0.23 - 0.67. Let p = -0.04 - t. Which is the closest to g? (a) -4 (b) 0.3 (c) p b Let l = -0.1 - -0.2. Let k = -0.2 + l. Let d be (0 - 2) + 2 + 0. What is the nearest to -0.1 in d, k, 3/4? k Let v = 5 - 7. Let o = 22 + 0. Let j = o - 108/5. Which is the nearest to v? (a) 0.1 (b) -2 (c) j b Let o = 3 - 2. Let d = 0.6 - 0.6. Let u = 0 - d. Which is the nearest to u? (a) o (b) -4 (c) -5 a Let h = 6.4 - 2.4. Which is the nearest to 1/4? (a) 1/4 (b) 0.1 (c) h a Let y be 2/4 - 3/14. Let c be ((-6)/(-4))/((-20)/8). Let j be ((-4)/(-6))/(8/6). What is the closest to y in -5, j, c? j Let u = -1 + -3. Which is the closest to 1? (a) 5 (b) 0 (c) u b Let l = -20 + 20. Let s = 235 + -2117/9. Let o = 0.2 + -0.1. Which is the closest to o? (a) 2 (b) l (c) s b Let d = 0.071 + 0.329. Which is the closest to -0.4? (a) 0 (b) d (c) -3 a Let v = 3 - -10.9. Let w = 14 - v. What is the nearest to w in 5/2, -2, 3? -2 Let g = 16 - 16.4. Let y = 9 - 14. Let q = 2 - 2.1. What is the nearest to q in g, y, 5/2? g Suppose 4v + 10 = 4l + l, -2l = 5v + 29. Let o be 0 - l - (25 + -2). Let p be (-2)/(1/((-6)/o)). What is the closest to -2 in 0.5, -3, p? -3 Suppose 5l + 23 = -2j, -j - 1 + 12 = -5l. Let n = -36 - -36. What is the closest to -1/3 in -0.1, l, n? -0.1 Let m be 15/(-8) - 1/(-8). Which is the closest to 1/2? (a) 0.5 (b) m (c) -4 a Let g = -43/6 + 17/3. What is the nearest to 1 in 4/3, -1/3, g? 4/3 Suppose -5o + 6 = -2o. Let x be o + (-2)/((-10)/(-9)). Let j = -2 + 3. Which is the closest to j? (a) x (b) -1 (c) 1/4 c Let m be -4 + 7 - (3 + -4). Which is the closest to 1? (a) 1/5 (b) 0.3 (c) m b Let p = 8.7 - -0.3. Let d = p + -5. Which is the nearest to -0.1? (a) d (b) -1/2 (c) -0.3 c Let n = -35 + 141/4. Which is the nearest to n? (a) 0.2 (b) -4 (c) 3 a Let y be (-2)/(-5) - 11990456/(-1260). Let d = -9516 + y. Let k = -2/63 - d. Which is the closest to -1? (a) -0.3 (b) -5 (c) k c Let k = -10.74 + -1.26. Which is the closest to 2/9? (a) 2 (b) 0.2 (c) k b Let h(d) = -d2 + 12d - 20. Let g be h(10). Which is the nearest to 2/13? (a) -0.2 (b) -2/15 (c) g c Let a = 3.04 - 3. Let v = -0.09 + 0.35. Let x = v + a. What is the nearest to -1 in x, 0, -2/9? -2/9 Let w = 2 + -5. Let t = 2.1 - 0.1. Let x = 3 - t. What is the closest to x in w, -0.1, -2? -0.1 Suppose 48 - 52 = 4t. Which is the nearest to 1/2? (a) -1/2 (b) -0.3 (c) t b Suppose 5z - 11 = -31. What is the closest to 0.1 in 1, -7, z? 1 Let y = 31.2 + -27. Let s = -0.8 - y. Let h = 34/95 - 3/19. What is the closest to -0.1 in 1/3, s, h? h Let r be -2 - (-2 - 0)/(-1). Which is the closest to 1? (a) r (b) -1 (c) 0.3 c Let z = -105/8 - -13. Let p = 2 - 4. Let r = -521 - -520. What is the nearest to r in p, z, 1/2? z Let j = -5 + 5.2. Let d = j - -0.8. Which is the closest to 1? (a) -0.4 (b) -2/21 (c) d c Suppose p + 1 = -2o - 10, 7 = 2o - 5p. Which is the nearest to -1? (a) -1/4 (b) o (c) 0.5 a Let q be (18/(-16))/((-7 - -8)3). Which is the closest to 0? (a) 2 (b) 1 (c) q c Let k = 68 + -67. What is the closest to k in -1, -6, -3? -1 Let l = 12 + -12.8. Let h = 0.2 - l. Which is the closest to h? (a) -5 (b) -2 (c) -1/3 c Let y = 55/222 + -3/37. Let w be 2 - (-2 - -23). Which is the nearest to 0? (a) y (b) w (c) 1 a Let u = 24.7 + -26. Let j = 3.3 + u. What is the closest to j in -4, 4, 3? 3 Let v = -3.9 + 3.9. Which is the nearest to -1? (a) -5/3 (b) 4/7 (c) v a Let i = 0.5 - 0.2. Let j = 4.6 + -8.7. Let k = j - -4. Which is the nearest to k? (a) 0.5 (b) i (c) 4 b Suppose 0f - 5f + 3g = 24, -2g + 18 = -4f. Which is the nearest to f? (a) 1/5 (b) 3 (c) 2/3 a Let j = 3.02 + -0.02. Let p = 2 - 5/3. Which is the nearest to -0.1? (a) 0 (b) j (c) p a Let x = -7 + 7.3. What is the closest to 0 in 0, 4, x? 0 Suppose -5m = -m + 24. Let i(g) = g + 5. Let z be i(m). Which is the nearest to 1? (a) z (b) -5/3 (c) 0.2 c Let d = 0.06 + -0.16. Let k = 78.5 + -79. What is the nearest to -2/7 in d, k, 1/4? d Let r be 1/((6/3)/(-2)). What is the nearest to r in -4, -2/11, 0.3? -2/11 Let x(b) be the third derivative of b6/120 + b4/24 - 2b3/3 + b2. Let i = 48 + -48. Let k be x(i). What is the nearest to 0 in 2, k, -1? -1 Let c = -0.05 - -0.15. Let y = 0.6 - 1. What is the closest to -1 in 0.2, y, c? y Let x = 282 + -187. Suppose -4s + 3z = -5s - 13, -5z = -3s - x. Let p = 251/10 + s. Which is the nearest to 1? (a) -4/3 (b) 2 (c) p c Let m = 5.8 - 6. Let o = 0.8 - m. Which is the nearest to o? (a) 3/7 (b) -1/4 (c) 0.4 a Let r = 0.2 - -0.2. Let n = -20 - -19.7. Which is the closest to -2/3? (a) r (b) n (c) -2 b Let q = -4.9 + -0.1. What is the closest to -3 in 4, q, -1/4? q Let o = -58/5 - -11. Let m = 10 - 9. Let z be 22/(-28) - (-14)/49. Which is the closest to z? (a) m (b) o (c) 1/3 b Let f = 0.165 + 0.035. Which is the nearest to 0? (a) -5 (b) f (c) -1 b Let u = 1/6 + -2/3. Which is the closest to u? (a) -5 (b) -1 (c) 0.3 b Let c(a) = -a3 + 14a*2 - 13a - 3. Let b be c(13). What is the closest to 1 in b, -0.1, 1? 1 Let i = -9 + 5. Let r = 4.1 + i. Which is the nearest to -2/3? (a) 2/3 (b) r (c) -5 b Let a = 8 + -8.05. Let m = 0.95 - a. Suppose -2g - g - 15 = 0. What is the nearest to m in 3, g, 0.4? 0.4 Let v = 26 - 1. Let y be v/(-20) - 1/(-2). Which is the closest to 1/3? (a) y (b) 1/9 (c) 0.3 c Let v(k) = k + 5. Let t be v(-6). Let d be 1/2(-1 - t). Which is the closest to d? (a) 0.3 (b) -0.2 (c) 2 b Let w = 0.3 - 0.4. What is the closest to w in -4, -1/5, 0.2? -1/5 Let u = 0.475 - 0.075. Let h(m) = 2m + 3. Let d be h(-3). Which is the nearest to 2? (a) -1/3 (b) d (c) u c Let k = 1.6 - 4.6. Let l = -3/128 - 223/1408. Which is the closest to k? (a) l (b) -1 (c) -0.4 b Let k = 1 - 0. Let h = 61/5 + -437/35. What is the nearest to k in h, -2/11, 0.5? 0.5 Let z = 7.5 - 7. Let f(q) = -q2 - 8q + 10. Let r be f(-9). What is the nearest to r in z, -0.5, -0.4? z Suppose -5b = -20, -4l + 3b - 7b = 4. Let u(s) = s + 1. Let z be u(4). What is the closest to -1 in l, z, -1? -1 Suppose 1 - 2 = -i. Which is the nearest to 0.1? (a) 2/7 (b) 0 (c) i b Let d = -15 - -15. What is the closest to 2 in -2/7, 2, d? 2 Let x be 6/(-21) - (-3)/(-14). Let k = 35.7 + -34. Let n = 2 - k. Which is the nearest to -1/4? (a) 2 (b) n (c) x c Let f = 5.17 + -0.17. Which is the nearest to 0? (a) f (b) -2 (c) -3/8 c Let u = -0.01 - 4.99. Let q = -2 + 2. What is the nearest to q in u, 4, 2/19? 2/19 Let o be 3/((-21)/21). Let x = 1 + 0. Let y(b) = -b - 10. Let m be y(-7). What is the nearest to x in 0.1, o, m? 0.1 Let r = 139/3 - 47. Let d(q) = -3q*3 + 2q*2 - 1. Let l be d(-1). What is the closest to 2/7 in l, -3, r? r Let r = 8.1 + -8. Let c = 6 + -9. What is the closest to 0 in c, r, 1/2? r Let p = 138 + -137. What is the nearest to 1 in p, 0.3, -15? p Let u = 1.9 + 8.1. Let r = 8 - u. Which is the closest to -0.1? (a) 0.1 (b) 5 (c) r a Let t(r) = -2r*2 - 19r - 23. Let y be t(-7). Which is the closest to -1? (a) 0.3 (b) -2 (c) y b Let w = 62 - 66.3. Let u = w + 0.3. Which is the closest to -0.4? (a) u (b) -5 (c) 1/3 c Let o be (-2)/(-24)(-94)/(-2). Let n = 17/4 - o. What is the closest to 0 in -2/5, 0.5, n? n Let x = 51 + -49. What is the closest to x in -2/17, 2, -5? 2 Let n = -69/4 - -17. Which is the closest to n? (a) -1 (b) -3/2 (c) -0.2 c Let o(w) = -w - 3w + w*3 + w - 9w*2 + 4w. Let s be o(9). Let m = s + -13. Which is the nearest to -1? (a) m (b) 4 (c) -0.2 c Let v be (-50)/125 - (-6)/10. Let p = -0.6 - 1.4. What is the closest to -0.1 in v, 1, p? v Let i = 2.06 + -0.06. Let j = 27 + -22. What is the nearest to -2 in i, -0.2, j? -0.2 Let x = -2 + 3. Which is the nearest to -1/7? (a) x (b) 2/9	{ "pile_set_name": "DM Mathematics" }
6. 1774278 Calculate the lowest common multiple of 44 and 150194. 300388 What is the common denominator of 11/166660 and -123/100? 833300 Calculate the common denominator of 92/1365 and -19/207. 94185 What is the least common multiple of 68 and 503420? 8558140 What is the common denominator of 55/16 and -49/438? 3504 What is the common denominator of -53/509004 and -83/509004? 509004 Calculate the least common multiple of 60 and 211260. 211260 Find the common denominator of -53/630 and 10/2619. 183330 What is the common denominator of 61/6580 and 44/985? 1296260 What is the common denominator of 37/407456 and 19/272? 407456 What is the least common multiple of 10 and 12300? 12300 Calculate the common denominator of 79/80145 and -66/3965. 4888845 Calculate the common denominator of -29/90410 and 97/759444. 3797220 Calculate the lowest common multiple of 6430 and 15432. 77160 What is the common denominator of 91/95616 and -51/16? 95616 Find the common denominator of 13/34590 and -91/20. 69180 Calculate the lowest common multiple of 73890 and 570. 1403910 Calculate the common denominator of -39/896 and 53/1176. 18816 Calculate the common denominator of -101/66 and -149/7260. 7260 What is the lowest common multiple of 154700 and 2240? 2475200 Find the common denominator of 27/62176 and -1/124. 1927456 Find the common denominator of 52/9 and 40/36011. 324099 Find the common denominator of 80/183393 and 53/812169. 5685183 Find the common denominator of 99/232 and 131/246. 28536 Calculate the common denominator of -49/2643680 and 51/8. 2643680 What is the least common multiple of 397614 and 18? 1192842 Calculate the smallest common multiple of 4075 and 8965. 44825 Calculate the common denominator of 89/180 and 91/16700. 150300 What is the lowest common multiple of 18326 and 94248? 659736 Find the common denominator of -151/648 and 77/120. 3240 Calculate the common denominator of 83/85956 and -127/12. 85956 Find the common denominator of -67/68822 and 1/65. 344110 Find the common denominator of -58/711 and 27/64. 45504 Calculate the common denominator of 43/2 and 79/2253630. 2253630 What is the smallest common multiple of 21186 and 51788? 466092 What is the lowest common multiple of 18734 and 560? 5245520 Calculate the common denominator of -85/400624 and -37/18. 3605616 Calculate the lowest common multiple of 9 and 26144. 235296 Calculate the smallest common multiple of 1440 and 1220. 87840 What is the lowest common multiple of 550 and 209770? 1048850 Calculate the common denominator of -25/256472 and 37/160295. 1282360 Calculate the lowest common multiple of 66 and 1663. 109758 What is the lowest common multiple of 195 and 28230? 366990 Calculate the smallest common multiple of 1164 and 7857. 31428 Calculate the smallest common multiple of 176360 and 18. 1587240 What is the common denominator of -63/3368 and -93/13472? 13472 Calculate the common denominator of -145/936 and -115/15912. 15912 Find the common denominator of -76/15 and 151/215208. 1076040 Find the common denominator of -131/6384 and -17/140784. 2674896 Calculate the smallest common multiple of 53 and 11819. 11819 What is the smallest common multiple of 279 and 287? 80073 Find the common denominator of 121/293944 and -21/446165. 24985240 What is the smallest common multiple of 9614 and 195624? 4499352 Calculate the least common multiple of 411 and 1359. 186183 What is the common denominator of 101/10428 and -37/13904? 41712 Calculate the common denominator of 113/8120 and -66/455. 105560 What is the common denominator of 61/14814 and 34/9? 14814 Find the common denominator of -8/11 and -57/155525. 1710775 Calculate the common denominator of -47/125472 and 39/460064. 1380192 Calculate the smallest common multiple of 411646 and 411646. 411646 Calculate the smallest common multiple of 416 and 184. 9568 What is the common denominator of 47/2304 and 19/43584? 523008 Calculate the common denominator of -19/13425 and 7/26895. 24071025 What is the common denominator of -38/45 and 47/3903? 58545 What is the common denominator of -29/210 and 61/2268? 11340 Calculate the least common multiple of 14364 and 1596. 14364 What is the common denominator of -67/244881 and -63/8? 1959048 What is the common denominator of -21/22910 and -68/45? 206190 What is the lowest common multiple of 174240 and 27588? 3310560 Find the common denominator of 17/12714 and 16/5379. 139854 Calculate the common denominator of 151/24 and -77/4144464. 4144464 Calculate the smallest common multiple of 122 and 1268. 77348 What is the lowest common multiple of 127983 and 4612? 511932 Calculate the common denominator of -113/2165205 and 58/309315. 2165205 Calculate the common denominator of -85/210754 and 71/14. 1475278 Calculate the common denominator of -44/10719 and 23/45. 53595 Calculate the common denominator of -31/2940 and -51/460040. 9660840 Calculate the common denominator of 76/64227 and -97/35772. 2825988 What is the least common multiple of 11578 and 5789? 11578 What is the smallest common multiple of 15 and 67866? 339330 Calculate the smallest common multiple of 315 and 137439. 4810365 Calculate the lowest common multiple of 2 and 365220. 365220 Find the common denominator of 3/415 and 8/544563. 2722815 What is the smallest common multiple of 1015 and 14007? 70035 Find the common denominator of -64/231 and 50/22041. 1697157 What is the common denominator of 17/907124 and -83/7528? 1814248 What is the least common multiple of 50416 and 1104? 151248 What is the lowest common multiple of 65586 and 408? 262344 Calculate the common denominator of -50/13477 and 17/5. 67385 Calculate the common denominator of 163/106386 and -17/24. 425544 Calculate the least common multiple of 5243 and 1421. 152047 Calculate the least common multiple of 72553 and 143. 798083 Calculate the least common multiple of 130400 and 5. 130400 Calculate the lowest common multiple of 5034 and 36. 30204 What is the common denominator of 87/1184 and -1/3219? 103008 Calculate the smallest common multiple of 3478 and 116. 201724 What is the common denominator of -83/1364 and 17/27533? 3414092 Find the common denominator of 39/154805 and 88/315. 1393245 Calculate the smallest common multiple of 120 and 27846. 556920 Calculate the lowest common multiple of 833085 and 19965. 9163935 What is the lowest common multiple of 368 and 1856? 42688 Find the common denominator of -93/19108 and 63/277066. 554132 Find the common denominator of -34/21 and -10/22967. 68901 Calculate the lowest common multiple of 912 and 19470. 2959440 Find the common denominator of 149/9390 and 23/38. 178410 Find the common denominator of 97/64 and 25/1149584. 4598336 What is the least common multiple of 1549 and 3? 4647 Calculate the common denominator of -85/443352 and -89/234. 1330056 What is the common denominator of 81/10 and -49/194111? 1941110 Calculate the lowest common multiple of 297 and 87. 8613 What is the least common multiple of 43 and 41045? 1764935 What is the lowest common multiple of 8236 and 290? 41180 Calculate the lowest common multiple of 40 and 5720. 5720 Find the common denominator of -61/752 and 15/2726. 21808 Calculate the lowest common multiple of 1818 and 21. 12726 What is the lowest common multiple of 5916 and 1251? 2466972 Calculate the smallest common multiple of 6690 and 432. 481680 Calculate the common denominator of 17/24 and 227/68250. 273000 What is the lowest common multiple of 88 and 255464? 255464 Calculate the common denominator of -139/553104 and -39/42752. 8849664 Calculate the common denominator of 99/35836 and -25/6. 107508 What is the common denominator of 101/8694 and 137/2070? 43470 Calculate the smallest common multiple of 3364 and 18734. 1086572 Find the common denominator of 97/234 and 121/1686. 65754 What is the common denominator of 59/11145 and 17/100? 222900 What is the common denominator of 37/50 and -99/274220? 1371100 What is the smallest common multiple of 4563 and 663? 77571 Calculate the least common multiple of 1962 and 73248. 219744 What is the smallest common multiple of 9260 and 9260? 9260 Find the common denominator of 25/83103 and 71/21. 581721 What is the common denominator of -79/211545 and -5/507708? 2538540 Find the	{ "pile_set_name": "DM Mathematics" }
2r - 45, 3s - 66 + 76 = -5r for s. 5 Solve -4l = -3f - 25, -4l = -298f + 303f - 1 for f. -3 Solve -42 = 4y - 2j, 27 = -y + 32j - 30j for y. -5 Solve -2364k - i + 186 = -2373k, 4k - 2i = -78 for k. -21 Solve -2j - r - 24 = 0, 3r + 63 = -80j + 77j for j. -3 Solve 3d = -k - 16, -132k - 32 = 4d - 128k for d. -4 Solve -8t - 27 - 9 = 4a, -3a + 4t = -3 for a. -3 Solve 21 = 27y - 29y - 7z, -3z - 9 = -y for y. 0 Solve -60 = 9945s - 9942s + f, 0 = 5s + 5f + 100 for s. -20 Solve -8 = -4l + 2u, 11l - 26 = 8l + 4u for l. -2 Solve 27q - 26q = -f + 5, -2f - 3q + 15 = 0 for f. 0 Solve -135g = -i - 139g + 11, 0 = i - 3g + 3 for i. 3 Solve -4g + 5o + 27 = 51, 2g + 2o - 6 = 0 for g. -1 Solve -40 = 4o + 4w, o + 237w = 242w - 10 for o. -10 Solve 7s + 20 = 153q - 152q, -4q + 4s + 80 = 0 for q. 20 Solve -6o + 9 = -3f, -2o + 1684f + 17 = 1685f for o. 5 Solve -247m + 4i = -251m, -4m + 3i + 21 = 0 for m. 3 Solve -2057b + 4k - 20 = -2053b, b + k = 3 for b. -1 Solve 0 = -145c + 162c - 5g - 64, 2c - g = 10 for c. 2 Solve 0 = -2m + 45k - 41k - 20, -3m - 2k + 18 = 0 for m. 2 Solve -7h + 29 = 4i, -4i + 14 = 8h - 6h for h. 3 Solve 0 = 4a + 24, -q + 100 = 3a + 114 for q. 4 Solve -5p = 2r + 27, -22p - 4r - 30 = -20p for p. -3 Solve -71 = p - 261s + 266s, 0 = -2p - 5s - 67 for p. 4 Solve -d - 2 = -5r, -2 = -4r + 90d - 89d for r. 0 Solve 0 = -2i + 4, -460 + 465 = 3m + i for m. 1 Solve -12j - 20 = -17j, -4i + 28 = j for i. 6 Solve 5c + 20 = -5k, -2c + 18 - 14 = -k for c. 0 Solve -3 = 3a, 6o - 15a = -11a - 14 for o. -3 Solve 11f + 2p + 11 = 6f, 5f - 4p = 7 for f. -1 Solve -2y = -4u + 18, 3u - 25 = -2y - 29 for u. 2 Solve 497l - 495l = 5n - 13, l - 7 = -2n for n. 3 Solve -1097x + 1094x - 3b - 30 = 0, -3b = -4x + 2 for x. -4 Solve c + 5u - 274 = -277, 13c + 5u = 21 for c. 2 Solve w = 3a - 5, 82w = 78w - 8a + 40 for w. 4 Solve 841p + 5a = 844p - 51, 138 = 6p + 2a for p. 22 Solve 0 = -4r - 16, -3f + 3977r - 3978r + 5 = 0 for f. 3 Solve 3h + 4 = -2u, 731u + 36 = -5h + 735u for h. -4 Solve -81 = 3o - 4p, 1660o - 1661o - 27 = -5p for o. -27 Solve 90g = 87g + 2y + 20, 4 = 2g + y for g. 4 Solve -5a = -3u - 6, -u - 773 = a - 763 for a. -3 Solve 4x + 1523 = -3q + 1467, 0 = -4q - 4x - 72 for q. -16 Solve 103r - m = 108r + 7, 5r + 4m = 2 for r. -2 Solve -157b + 155b = 20, 11c + 43 = -0b - b for c. -3 Solve -4p = h - 15, -24p - 3h = 37p - 57p - 21 for p. 3 Solve -28675w - 4v = -28673w - 10, -5w + 5v = -10 for w. 3 Solve 0 = -13g + 9g - 4u + 12, 0 = g + 4u + 9 for g. 7 Solve 4c - 27 = -3t, 17c - 8c + 2t = 12c + 1 for c. 3 Solve c - 147 + 137 = -4i, 0 = 5i - 5c - 25 for i. 3 Solve 0 = -5w + 20, -218b - 24 = -214b - 3w for b. -3 Solve -3v + 5z + 6 = 0, 4z - 2 = 51v - 52v for v. 2 Solve -104p = 10f - 102p + 22, -4f - 5p + 8 = 0 for f. -3 Solve -5q - 55 = 5y, 2q + 1529y = 1526y - 18 for q. -15 Solve 11j = -5w + 7j + 7, -4w = 4j - 8 for w. -1 Solve 3m - 3u + 24 = 0, 12u - 10u - 25 = 5m for m. -3 Solve 159j - 158j + 2 = -4s, 2j - 3s + 48 = 0 for j. -18 Solve 3v + 3s - 62 = -53, 0 = -s + 1 for v. 2 Solve 44 = 4b + 5h, 37 = -4h + 53 for b. 6 Solve -4f - 1975r + 80 = -1973r, 2f = 3r + 24 for f. 18 Solve 0 = 4w + 5b + 34, -346w = -343w + 10b + 63 for w. -1 Solve -2i - v = 1, -3v + v - 79 = 33i + 2v for i. -3 Solve -16 = 2h - 2b, -20494h + 20499h = b - 12 for h. -1 Solve -4k + 27 = 3j, 583k - 582k - 10 = -4j for k. 6 Solve 201s + 3c - 22 = 205s, -2c = -2s - 12 for s. -4 Solve 320d + 4l + 8 = 324d, -d - 4 = 2l for d. 0 Solve -9b = 2l + 23, -5b - 73 = 2l - 70 for l. 11 Solve -3l = -3h - 3, 2h - 6l + 50 = 8l for h. 3 Solve -12 = -2i - 22, 2h - 3i - 11 = 0 for h. -2 Solve 3k - g = 28, 348 = 4k + 2g + 304 for k. 10 Solve -z - 82i = -79i + 9, 3z + 1 = 4i for z. -3 Solve 2d - 3 = -7f, 0 = 3d - 5d - 4f - 6 for d. -9 Solve 4f - 64 = 8l, 27f - 24f - 4l - 42 = 0 for f. 10 Solve 436 = 3o - 4u + 447, 3u = -2o + 4 for o. -1 Solve 2j - 7399b + 7403b = -26, 4j - 3b - 3 = 0 for j. -3 Solve -4d = -3k - 28, -3d + 91k + 32 = 86k for d. 4 Solve 12 = 5s + 6m, 2s - 7355 + 7345 = 3s - 5m for s. 0 Solve 29 = j, 2z - 116 = -2z + 3j - 7j for z. 0 Solve -24888z + 5f + 11 = -24889z, 3f - 87 = 3z for z. -26 Solve -372 = -3g - 15b, -3b = -g - 495 + 419 for g. -1 Solve -4a + 3k - 42 = -47, 15 = 3k for a. 5 Solve 0 = -g - 4r - 521 + 503, -g - 2r - 12 = 0 for g. -6 Solve -29 = -3y + 2g - 24, -2y + 30 = 2g + 2g for y. 5 Solve -3a = 2y - 4, -19a + 437y - 434y = 6 for a. 0 Solve -d - 9 = -5j + 8, 2d = -5j + 26 for d. 3 Solve -5v - 4i + 23 = 0, 895v - 9 = 895v + 3i for v. 7 Solve 0 = -4t - 4g - 8, 0 = t - 7001g + 7006g + 14 for t. 1 Solve -3z + 3n + 95 = -2n, z - n = 19 for z. 0 Solve 5g - 2s = -4, 5g + 165s = -10g + 12g + 330 for g. 0 Solve 0 = -729t + 731t + 2, 0t + 15 = -2b + t for b. -8 Solve -3w - 8 = 4x, -2x + 74w - 81w = 4 for x. -2 Solve 3g + 112 - 112 = u, 3u = -5g for u. 0 Solve 0 = 3y - 5a + 11, 3989 = -5y + 3a + 3944 for y. -12 Solve -4c - 4g - 28 = 0, -272g = -c - 274g - 11 for c. -3 Solve 4m = 3c + 16, 0 = 2m + 2c + 32205 - 32199 for m. 1 Solve 5 = -3z - v, 5z + 2884v = 2881v - 7 for z. -2 Solve -5t - 4b = 3, t + 4b + 11 = 20 for t. -3 Solve -5o + 554 = 4b + 546, -2b - 10o + 34 = 0 for b. -3 Solve -2c - 5376 + 5400 = 0, 5t + c = 37 for t. 5 Solve -4p = -c - 16, -7c - 8 = -12c - 2p for c. 0 Solve 3q = 4g + 39, 2675g - q + 13 = 2679g for g. 0 Solve 2v - 3r + 4 = 0, 0 = -v + 19r - 23 + 56 for v. -5 Solve -9 = 3t, -136j + 145j - 2t + 30 = 0 for j. -4 Solve -29449 = -w + h - 29462, -h + 31 = -3w for w. -9 Solve 55 = 5o + 5x, -276 = -o - 4x - 250 for o. 6 Solve 0 = -4m - 3s + 2, 142s = 141s - 2 for m. 2 Solve 4a + 3n = 0, -4a - n + 7n - 11n = 0 for a. 0 Solve -5l + 4n = 39, -4128 + 4119 = 2l + 5n for l. -7 Solve -2t + p = 2, 0 = t - 522p + 524p - 14 for t. 2 Solve -466o + 2y - 9 = -471o, -5y + 12 = 2o for o. 1 Solve 3z + 4l = 26, 4l = -50z + 46z + 28 for z. 2 Solve -2a - 5 = -4y - a, 3a - 18 = y for y. 3 Solve 3i + 36 = -o, 3i - 4o = 5818 - 5839 for i. -11 Solve 6t - 46 = -4h, 35t - 32t - 8h = 73 for t. 11 Solve 3m = -5o + 259 - 267, -4m + 36 = -5o for o. -4 Solve 5j + 321 - 361 = 5b, -5b = -3j + 30 for b. -3 Solve -15 = 3c, -10 = 2i - 9c - 41 - 22 for i. 4 Solve p + 0 = -3j - 14, -4p + j + 9 = 0 for p. 1 Solve -108r + 12 = 4a - 105r, 75r = 2a + 300 for a. 0 Solve 96l - 94l = 5c + 86, 0 = -4c + 4l - 76 for c. -16 Solve -4x + f - 12 = -33, -6f + 30 = 2x for x. 6 Solve 201v - 200v + c - 5 = 0, -5v - 25 = -5c for v. 0 Solve b = 3z + 3, 2z + 306b + 19 = 301b for z. -2 Solve 0 = 5m - 2c + 34, -m - 5c + 738 - 707 = 0 for m. -4 Solve -78g + 75g = -3q - 3, 3g - 3 = -24q for g. 1 Solve 5j = -2n + 81, -72 = n - 43j + 38j for n. 3 Solve -3j = 5w + 2, -18w - 69j = -70j - 40 for w. 2 Solve -i = 19h - 96, 2h + 23i = 27i - 72 for h. 4 Solve -2q + q = 0, 41m - 44m = -3q - 39 for m. 13 Solve -3c - 6k = 60, -3c - 14k + 12 = -6k - 10k for c. -2 Solve 4q - 48 = -15c + 11c, 0 = -5q - 14c + 33 for q. 15 Solve j = -4l - 170 + 156, 3l = -j - 10 for j. 2 Solve 5n - 509c - 26 = -505c, 70n = c - 131 for n. -2 Solve -834g + 838g = c + 25, -15c - 50 = 5g for c. -5 Solve -2v - 8 = 3i, 3i + 6509v = 6514v - 1 for i. -2 Solve 7f = 2m - 3, -356565f - 3m = -356560f - 20 for f. 1 Solve -2203x + 2205x = 3j - 4, 3j - 4x - 8 = 0 for j. 0 Solve 18 = i - 2r, 3i + 103 = -3r + 85 for i. 2 Solve 22 = -30f + 28f + 18u, -u = -2f - 5 for f. -2 Solve -3n = -51l + 59l + 47, -1 = -l + n for l. -4 Solve s - g = 9, -19g - 27 = -2s - 16g for s. 0 Solve 10c - l = -53 + 14, -3 = 3l for c. -4 Solve 4v = l - 252 + 262, 0 = -4l - 4v + 40 for l. 6 Solve 0 = -22k + 153 - 219, m = 4k + 13 for m. 1 Solve 20 = 5q, -4 = 6g + 4q - 44 for g. 4 Solve -v - 17 = 4m - 6, -4m = -v + 5 for v. -3 Solve 0 = 3u - 2g + 22, 29 = -2*g +	{ "pile_set_name": "DM Mathematics" }
= -10b - 81b + 91 for b. 1 Solve -5r + 67 = 52 for r. 3 Solve 61w = 24w - 333 for w. -9 Solve 36 = -61d + 52d for d. -4 Solve 280 - 275 = -q for q. -5 Solve 7q + 36 = 19q for q. 3 Solve 2l = -8l - 10 for l. -1 Solve 0 = -18g - 8 - 28 for g. -2 Solve 101w - 27 = 74 for w. 1 Solve 4p - 1 = 7 for p. 2 Solve -33 = 5t - 13 for t. -4 Solve 0 = -46d + 14 - 14 for d. 0 Solve 18b - 15b = 15 for b. 5 Solve 9l - 21 + 39 = 0 for l. -2 Solve -22j - 17 - 5 = 0 for j. -1 Solve -256s + 7 = -263s for s. -1 Solve -16u + 75 = -31u for u. -5 Solve -5m + 8 = -m for m. 2 Solve -70h - 36 = -58h for h. -3 Solve -17l = -16l + 5 for l. -5 Solve -18 = -0u + 6u for u. -3 Solve 23n = -27n - 350 for n. -7 Solve -55k - 2k + 513 = 0 for k. 9 Solve 0 = -14j + 133 - 119 for j. 1 Solve 9u - 42 + 60 = 0 for u. -2 Solve -44 = 366c - 370c for c. 11 Solve 0 = -8a - 3a - 22 for a. -2 Solve 8r + 2 = 7r for r. -2 Solve 0 = 42c - 38c + 12 for c. -3 Solve -14s + 12 + 30 = 0 for s. 3 Solve -5924m + 5934m = 0 for m. 0 Solve -h = 70 - 69 for h. -1 Solve 224 = -6m + 194 for m. -5 Solve -9r + 8 = -28 for r. 4 Solve -15n + 9n = 6 for n. -1 Solve -7h + 3h + 4 = 0 for h. 1 Solve 0 = -93m + 94m + 2 for m. -2 Solve 7d - 16 = 15d for d. -2 Solve 44g - 37g + 28 = 0 for g. -4 Solve 0 = -10s - 27 - 23 for s. -5 Solve -o + 3o = 6 for o. 3 Solve -6b - 71 = -29 for b. -7 Solve 39i = 48i for i. 0 Solve 4w - 11w = 28 for w. -4 Solve -6o - 49 = -19 for o. -5 Solve 5d - 82 = -57 for d. 5 Solve 3h + 6 = -0h for h. -2 Solve 23 = -a + 25 for a. 2 Solve 48 = -42o + 30o for o. -4 Solve 60m - 98m + 152 = 0 for m. 4 Solve -20j + 9 = -17j for j. 3 Solve 0 = 3p - 48 + 51 for p. -1 Solve 3b + 40 = -7b for b. -4 Solve -6i - 13 = -7 for i. -1 Solve 15s = -38 + 8 for s. -2 Solve 8i = 51 - 83 for i. -4 Solve -454 + 486 = 8f for f. 4 Solve 0 = l + 37 - 45 for l. 8 Solve 286a - 287a = -1 for a. 1 Solve 18u + 242 - 314 = 0 for u. 4 Solve -5j = -168 + 163 for j. 1 Solve 1246d - 24 = 1238d for d. 3 Solve -49b + 108 = -186 for b. 6 Solve 10z + 9 = -11 for z. -2 Solve -4c = 2c - 12 for c. 2 Solve 0 = 14z + 42z + 49z for z. 0 Solve -9 + 30 = -7s for s. -3 Solve 0 = -53i + 21i + 64 for i. 2 Solve -139b - 927 = 463 for b. -10 Solve -27u + 22u - 30 = 0 for u. -6 Solve -32 = 21f - 95 for f. 3 Solve 47p - 81p + 238 = 0 for p. 7 Solve 47z = 48z - 7 for z. 7 Solve 2j - 9 = -5 for j. 2 Solve -5t - 29 = -14 for t. -3 Solve 21u + 9 = 114 for u. 5 Solve -26i = -9i for i. 0 Solve 3 - 33 = -6u for u. 5 Solve -23m = -33m - 60 for m. -6 Solve 55 = -15d + 160 for d. 7 Solve -10c = 169 - 269 for c. 10 Solve -46 = -3m - 34 for m. 4 Solve 2l = 11 - 5 for l. 3 Solve -16q = -12q - 12 for q. 3 Solve -4q = -298 + 290 for q. 2 Solve -22 = 7x - 22 for x. 0 Solve -1147 = -2w - 1169 for w. -11 Solve -57d = -96d + 156 for d. 4 Solve 7 - 18 = 11b for b. -1 Solve -n + 8 = 9 for n. -1 Solve 47 + 147 = -97u for u. -2 Solve -5 = 14q + 23 for q. -2 Solve 64o + 363 = -21 for o. -6 Solve 6b + 10b = 19b for b. 0 Solve 39 + 25 = -8o for o. -8 Solve -30f = 10f for f. 0 Solve 13t - 14t = -4 for t. 4 Solve 539 = 13y + 448 for y. 7 Solve 114c - 108c - 6 = 0 for c. 1 Solve 36 + 51 = 29k for k. 3 Solve 1290z = 1288z + 2 for z. 1 Solve -2n + 33n = 186 for n. 6 Solve 41o = 48o + 35 for o. -5 Solve 3b = 947 - 971 for b. -8 Solve 3x = -37 + 25 for x. -4 Solve -4p + 7p + 12 = 0 for p. -4 Solve 152b = 166b + 84 for b. -6 Solve -505r = -483r + 154 for r. -7 Solve 3o + 13 = 4 for o. -3 Solve 0 = 4w - 0w - 5w for w. 0 Solve -6u - 11 + 35 = 0 for u. 4 Solve -4m - 7 = -27 for m. 5 Solve 0 = z - 3 for z. 3 Solve 18 = -7h - 10 for h. -4 Solve 20q + 14q - 136 = 0 for q. 4 Solve -19j - 12 = -16j for j. -4 Solve 0 = -27f - 3f + 150 for f. 5 Solve -15o = -7o for o. 0 Solve 0 = -15h - 2807 + 2762 for h. -3 Solve 84 = -19p + 40p for p. 4 Solve -26 = 6n - 2 for n. -4 Solve 6g = -0g + 24 for g. 4 Solve -21g = 30g - 153 for g. 3 Solve 5b = 5 - 30 for b. -5 Solve 0 = 10w - 6w - 20 for w. 5 Solve 10n = 9n - 5 for n. -5 Solve 0 = 61w - 78w + 153 for w. 9 Solve -8y + 12y - 12 = 0 for y. 3 Solve 9f - 11 - 25 = 0 for f. 4 Solve -18 = -12w + 30 for w. 4 Solve -13d + 7d = -18 for d. 3 Solve 25 = -8g + 1 for g. -3 Solve -26g + 2 + 50 = 0 for g. 2 Solve -4q = -7q + q for q. 0 Solve 4 = -q + 5q for q. 1 Solve 5x - 1151 + 1136 = 0 for x. 3 Solve 52 = -17c - 33 for c. -5 Solve 18 = 3y - 12 for y. 10 Solve -4q = -16q + 72 for q. 6 Solve 5971g - 5981g = 70 for g. -7 Solve -855b + 864b + 36 = 0 for b. -4 Solve 0 = 5w + 71 - 56 for w. -3 Solve 6d = 5d - 5 for d. -5 Solve 59 = 16s - 21 for s. 5 Solve -6l - 26 = -38 for l. 2 Solve -f + 57f + 392 = 0 for f. -7 Solve -4w + 13w = 0 for w. 0 Solve -47 = -3l - 44 for l. 1 Solve -17k = -31k + 28 for k. 2 Solve 0 = -2j - 24 + 22 for j. -1 Solve -8v + 9v = 3 for v. 3 Solve 35m - 40m + 30 = 0 for m. 6 Solve -1804k = -1800k - 20 for k. 5 Solve 5y - 8 = -3y for y. 1 Solve 33 = 21y + 54 for y. -1 Solve -2p = 3 + 3 for p. -3 Solve 5u + 20 = 15u for u. 2 Solve 7 = -244x + 251x for x. 1 Solve 57 = 20d - 43 for d. 5 Solve -29s + 53s = 0 for s. 0 Solve 11v - 8 = -63 for v. -5 Solve -156z + 124z = 0 for z. 0 Solve 8m - 198 = -230 for m. -4 Solve 47 = 6q + 71 for q. -4 Solve 12 = 4t - 7t for t. -4 Solve -489q - 22 = -500q for q. 2 Solve 0 - 5 = o for o. -5 Solve -806a + 801a = -25 for a. 5 Solve 13u - 22 - 17 = 0 for u. 3 Solve 28u = 29u - 19u for u. 0 Solve 15 = -61f - 229 for f. -4 Solve 15v + 1 = -74 for v. -5 Solve 314 = -109z - 449 for z. -7 Solve 7w = -0 + 21 for w. 3 Solve 30 = -5o + 20 for o. -2 Solve 25l + 14 = 89 for l. 3 Solve 2 = -t + 2t for t. 2 Solve -178 = 62o - 54 for o. -2 Solve 5 - 15 = -2g for g. 5 Solve -12i + 343 = -61i for i. -7 Solve 49j - 44j + 5 = 0 for j. -1 Solve 12o - 8o + 4 = 0 for o. -1 Solve 25c = -5 + 55 for c. 2 Solve -30f + 5f - 50 = 0 for f. -2 Solve -26 = -28j + 114 for j. 5 Solve 7v = -37 + 2 for v. -5 Solve -12 = -18d + 21d for d. -4 Solve -27 = 996s - 987s for s. -3 Solve 5 = 14h + 33 for h. -2 Solve -16 = 14b + 26 for b. -3 Solve -11 = 2j - 3 for j. -4 Solve 14r + 2r = 80 for r. 5 Solve 0 = 10w + 5w - 60 for w. 4 Solve 80o - 84o - 12 = 0 for o. -3 Solve 133 = 397y - 378y for y. 7 Solve -144k + 192 = -112k for k. 6 Solve -110 = -6b - 16b for b. 5 Solve 12k = -20 - 28 for k. -4 Solve 25 = 5x + 35 for x. -2 Solve -k - 23 = -21 for k. -2 Solve 0 = 5f - 4f - 4 for f. 4 Solve 8 + 2 = -2d for d. -5 Solve 948 = -3z + 948 for z. 0 Solve -4q - 159 = 49q for q. -3 Solve -5r - 8r = 39 for r. -3 Solve 9t = -27t - 108 for t. -3 Solve 21n - 100 = n for n. 5 Solve -56 = 33z - 5z for z. -2 Solve 17b - 4 = 18b for b. -4 Solve 0 = -83i + 18 + 231 for i. 3 Solve -32l = -30l for l. 0 Solve -6z = -14z + 24 for z. 3 Solve 32 = -13a - 59 for a. -7 Solve -197 = 40h + 43 for h. -6 Solve -31r - 130 = 25 for r. -5 Solve -75s = -71s + 8 for s. -2 Solve 8n + 64 - 56 = 0 for n. -1 Solve 0 = -v - 11 + 6 for v. -5 Solve 7l - 10 = 2l for l. 2 Solve 95l = 86l - 27 for l. -3 Solve 0 = 65p - 56p - 18 for p. 2 Solve 5i - 6 = 14 for i. 4 Solve 0 = -w - 140 + 143 for w. 3 Solve -235i + 44 = -257i for i. -2 Solve -5 = -10q + 9q for q. 5 Solve 2t - 10 - 10 = 0 for t. 10 Solve 46z + 10 = 36z for z. -1 Solve 10r - 35r + 100 = 0 for r. 4 Solve -32 = 19c + 6 for c. -2 Solve -522f - 36 = -518f for f. -9 Solve 2z + 16 = 6 for z. -5 Solve 6g - 63 = -15g for g. 3 Solve 0 = 10w + 65 - 25 for w. -4 Solve -668j = -670j + 4 for j. 2 Solve 28q + 9 - 121 = 0 for q. 4 Solve 7l = l - 24 for l. -4 Solve 41w = 42w for w. 0 Solve 0 = -14y + 3y - 77 for y. -7 Solve 0 = 5k + 1035 - 1040 for k. 1 Solve -29 = 3s - 17 for s. -4 Solve 3a + 52 = 16a for a. 4 Solve 118 + 449 = -81v for v. -7 Solve 158t - 165t - 21 = 0 for t. -3 Solve 5 = 2d + 11 for d. -3 Solve 3c - 60 = 15c for c. -5 Solve 0 = -3i + 4423 - 4399 for i. 8 Solve 23 = 4q + 11 for q. 3 Solve -1 = -2a - 5 for a. -2 Solve 8 = l + 7 for l. 1 Solve 3a - 6 + 3 = 0 for a. 1 Solve -6x - 5 =	{ "pile_set_name": "DM Mathematics" }
4/30 + 4i*3/15 - 4i*2/5 + 4i. Find u such that r(u) = 0. 2 Let k(n) be the third derivative of n7/840 + n6/360 - n*5/60 - 5n*3/3 + 6n*2. Let d(o) be the first derivative of k(o). Solve d(s) = 0 for s. -2, 0, 1 Let q(s) = 8s*2 - 22s - 6. Let l(t) = -4t2 + 11t + 3. Let z be 3/(-2)(-104)/12. Let j(h) = zl(h) + 6q(h). Suppose j(m) = 0. Calculate m. -1/4, 3 Let l be (-360)/(-35) + 2/(-7). What is j in 12j*3 + 7j*2 + 6j - 3j4 - 12j*2 - lj*2 = 0? 0, 1, 2 Let w(o) be the first derivative of 0o*2 - 3 + 1/15o*4 + 0o - 2/75o5 - 2/45o*3. Factor w(c). -2c*2(c - 1)*2/15 Solve 1/4g*5 + 1/2g*3 - 3/4g - 1/2g2 - 1/4 + 3/4g*4 = 0 for g. -1, 1 Let a(z) be the first derivative of -3 - 21/5z*5 - 2z*3 - 27/4z*4 + 0z + 0z2. What is x in a(x) = 0? -1, -2/7, 0 Suppose -2g = 5d - 212, -2g + 172 = 4d + 2g. Let o = -122/3 + d. Factor 10/3c2 + oc + 0 - 14/3c3. -2c(c - 1)(7c + 2)/3 Let s(m) be the second derivative of 4m*5/25 + 11m*4/15 + 2m*3/3 - 4m*2/5 - 21m. Factor s(d). 4(d + 1)(d + 2)(4d - 1)/5 Let t be ((-2)/2)/((-2)/8). Factor 2ot + 0 - 25o*2 + 28o*3 + 2o*5 - 4 - 7o*2 - 14o*4 + 18o. 2(o - 2)(o - 1)*4 Let o be 235/1412/209. Factor 9/4q*2 + o - 15/4q. 3(q - 1)(3q - 2)/4 Let -2p*3 - 4 + 6p + 0p3 + 3p*3 - 3p3 = 0. Calculate p. -2, 1 Let v(t) be the third derivative of -t8/20160 + t7/7560 + t4/24 + t*2. Let j(d) be the second derivative of v(d). Let j(i) = 0. What is i? 0, 1 Find h, given that 0h + 0h2 - 1/2h*3 + 0h*4 + 0 + 1/2h*5 = 0. -1, 0, 1 Find u, given that -1/4 + 1/4u*2 - 1/4u + 1/4u3 = 0. -1, 1 Let c(t) be the second derivative of -10t4/21 - t3/21 + t*2/7 + 22t. Solve c(f) = 0. -1/4, 1/5 Let b(f) be the third derivative of -f7/735 + f5/210 + 2f2. Determine z, given that b(z) = 0. -1, 0, 1 Let f be 2-3(-2)/12. Let p be f - (3/(-3) - 0). Factor 0t*p - 5t3 + t2 - 3t2. -t2(5t + 2) Suppose 20 = -2h + 7h - 2j, 2h + 4j = -16. Let a be (-9)/(-3)h/3. Find l such that -la - 2l*2 + 0 + 6l - 3 + 0 = 0. 1 Let -2/7q5 + 4/7q*3 - 2/7 - 2/7q - 2/7q4 + 4/7q*2 = 0. Calculate q. -1, 1 Let t(v) = -v - 5. Let z be t(-9). Let l = 2/7 + 3/14. Factor 1/4 - 1/2a*3 - la*2 + 1/4a*5 + 1/4a*z + 1/4a. (a - 1)*2(a + 1)3/4 Let o(q) be the second derivative of q7/70 - q*6/40 - 3q5/20 + q4/8 + q3 - q2 + 2q. Let t(n) be the first derivative of o(n). Factor t(z). 3(z - 2)(z - 1)(z + 1)*2 Suppose -k = -4k - 3. Let x be 0 + 0 + (-2)/k. Solve 4p5 + 4p*4 - 2p*5 - 2p*2 - xp + 0p4 - 2p2 = 0. -1, 0, 1 Let v(w) be the third derivative of w8/840 + w7/105 + w6/30 + w5/15 + w4/12 + w*3/2 - 4w*2. Let z(p) be the first derivative of v(p). Factor z(k). 2(k + 1)*4 Let h(v) be the second derivative of 3v5/20 + v4 + 3v3/2 - 4v. Factor h(x). 3x(x + 1)(x + 3) Let f = -558 - -561. Factor o + 1/3of - 1/3 - o2. (o - 1)*3/3 Let s(v) = -v + 10. Let m be s(7). Suppose 0 = 2q, -l = -2l - mq + 2. Factor 1/2p4 - 1/2p*l + 0p + 0 + 0p3. p2(p - 1)(p + 1)/2 Let 9/2c*3 + 0 - 3c*2 + 0c + 9/2c4 - 3c*5 = 0. What is c? -1, 0, 1/2, 2 Find y such that 2/9y*3 + 0 - 2/3y*2 + 4/9y = 0. 0, 1, 2 Let z = 359/18 + -39/2. Let d(w) be the first derivative of 1 + 1/12w4 + 2/3w*2 + 0w + zw3. Let d(g) = 0. Calculate g. -2, 0 Let q be 1 + 1-4(-4)/48. Suppose -4f + 25 = f, -2 = 4b - 2f. Let -8/3v2 - 10/3v + bv3 + q = 0. Calculate v. -1, 1/3, 2 Factor 9s*4 - 39/2s*3 - 6s + 18s2 - 3/2s*5 + 0. -3s(s - 2)2(s - 1)2/2 Let t(l) be the third derivative of l6/420 - l5/105 + l4/84 - 7l2. Factor t(k). 2k(k - 1)2/7 Let v(l) = -l3 + 2l*2 - 3l. Let r be v(2). Let q be (-2)/r - (1 + -1). Find g, given that 1/3g4 + 1/3g*5 - 1/3g*3 + 0 - qg*2 + 0g = 0. -1, 0, 1 Let o(t) = 2t3 - 8t*2 + 2t. Let b(h) be the second derivative of h*5/5 - 4h*4/3 + 5h*3/6 + 5h. Let v(n) = -6b(n) + 11o(n). Factor v(d). -2d(d - 2)*2 Suppose -12s - 10s2 + 17s + 30s + 20 = 0. Calculate s. -1/2, 4 Let x(u) be the third derivative of -u5/30 + u4/6 + u3/2 - u2. Let q(h) = -1. Let j(p) = 3q(p) - x(p). Factor j(s). 2(s - 3)(s + 1) Let r(u) be the second derivative of u5/80 + u4/12 + 5u3/24 + u2/4 - u. Determine a, given that r(a) = 0. -2, -1 Let v = 0 + 4. What is q in vq*4 - 2q + 3q2 - q + 3q*3 - 7q4 = 0? -1, 0, 1 Let t(b) = b4 + b + 1. Let p(w) = -10w4 + 8w3 - w2 + 5w + 5. Let n(h) = 2p(h) - 10t(h). Find k, given that n(k) = 0. 0, 1/5, 1/3 Find v such that -3v*2 - 12/7v + 3/7v4 + 0 - 6/7v3 = 0. -1, 0, 4 Let x(l) be the first derivative of l4/4 + 5l3/3 + 4l + 5. Let u be x(-5). Let 2/3c3 + 0 - 2/3c*u + 0c*2 + 0c = 0. What is c? 0, 1 Factor -5d - 5d*3 + 5d*2 + 0d*3 + 5d*2. -5d(d - 1)2 Suppose 3q = -5q + 32. Let v(g) be the first derivative of 4/3g*3 + 0g + g*2 + 1/2g*q + 3. Find l such that v(l) = 0. -1, 0 Suppose -5 - 3 = -4p. Solve f*p + 11f*2 + 2f*3 + 16 + 20f + 4f = 0. -2 Let v(o) = o3. Let j(h) = -h5 + 2h*4 + 5h*3 - 2h*2 + h. Let w(z) = -j(z) + 5v(z). Factor w(t). t(t - 1)3(t + 1) Let c be (1 + 17)4/8. Suppose -2w + 3o = o - 6, -2o = 3w - c. Factor -4x*2 - 2x*3 + 0x3 - xw - x. -x(x + 1)(3x + 1) Let r(o) be the second derivative of 3/80o*5 - 3o - 1/120o6 + 1/24o*3 - 1/16o*4 + 0 + 0o*2. What is d in r(d) = 0? 0, 1 Let k(q) be the first derivative of 4q*5/5 + 2q*4 - 4q*2 - 4q + 6. Factor k(g). 4(g - 1)(g + 1)3 Let t(f) be the third derivative of f6/720 - f5/60 + f4/16 + 4f2. Solve t(k) = 0 for k. 0, 3 Let l(q) be the first derivative of -q4/16 - q3/4 + q2/2 - 5. Factor l(g). -g(g - 1)(g + 4)/4 Let b = 1195/4 - 297. Factor -1/2 - bv*2 + 9/4v. -(v - 1)(7v - 2)/4 Let c(x) = -7x5 + 9x*4 - 2x*3 + 5x*2 + 5. Let n(a) = 3a*5 - 4a4 + a3 - 2a2 - 2. Let o(y) = -2c(y) - 5n(y). Factor o(d). -d3(d - 1)*2 Factor w + 2w + w - 5w3 + w3 + 40w*2 - 40. -4(w - 10)(w - 1)(w + 1) Find o, given that 1/4o2 + 1/2o + 0 = 0. -2, 0 Let q = -102 - -409/4. Solve -qu2 + 1/4u + 0 = 0 for u. 0, 1 Suppose -2 = -4l + 2b + 8, 6 = 2l - 2b. Find t, given that -2t - t - 2t + 2t - 3t*l = 0. -1, 0 Let r = 20 - 19. Let x(t) = -9t*3 + 3t*2 - 6t. Let n(s) = s*3 + s. Let u(z) = rx(z) + 6n(z). Find b such that u(b) = 0. 0, 1 Let i = 890/3 - 296. Factor 2/3a*4 + 0 + 0a + 0a3 - ia*2. 2a*2(a - 1)(a + 1)/3 Let f(b) = b3 + b2 - 2b + 2. Let k be f(2). Suppose 3w = 2g + k, -5g - 2 = -4g. Factor 2/5j3 + 0j + 0 - 1/5jw. j2(2j - 1)/5 Let m(y) = -8y3 - y2 + 37y + 25. Let x(p) = 20p*3 + 2p*2 - 92p - 62. Let i(b) = -12m(b) - 5x(b). Let i(t) = 0. Calculate t. -1, 5/2 Let j(y) be the first derivative of -y*5/20 + 3y4/16 - y3/4 + y*2/8 - 6. Factor j(u). -u(u - 1)*3/4 Let f = 54/5 - 643/60. Let r(b) be the first derivative of 1/8b*2 - fb*3 + 2 + 1/2b. Let r(n) = 0. What is n? -1, 2 Let g(b) be the first derivative of b*4 - 4b*3 + 6b*2 - 4b - 2. Solve g(y) = 0. 1 Let b(r) = -2r2 - 10r + 3. Let t be b(-5). Let -3/2s4 + 0s*t + 3/2s*2 + 0s + 0 = 0. Calculate s. -1, 0, 1 Let w(g) = g + 1. Let k(x) = 6x + 17. Let n(r) = -k(r) + 4w(r). Let p be n(-9). Suppose -q*3 + 5q - pq - q2 = 0. Calculate q. -1, 0 Let l(a) be the third derivative of 11a7/5880 - a6/1260 - 2a3/3 - 6a*2. Let d(s) be the first derivative of l(s). Solve d(c) = 0 for c. 0, 2/11 Let g(s) = -4s*2 + 7s - 5. Suppose 5n - 8 = 17. Let u(z) = 3z*2 - 6z + 4. Let f(l) = nu(l) + 4g(l). Factor f(i). -i(i + 2) Let j(v) = -3v*4 - 18v*3 - 39v*2 - 24v. Let s(m) = 6m4 + 36m*3 + 79m*2 + 49m. Let b(l) = 13j(l) + 6s(l). Find d such that b(d) = 0. -3, -2, -1, 0 Let n(r) be the first derivative of -r8/420 - r7/70 - r6/90 + r5/10 + r*4/3 + 8r*3/3 + 7. Let q(i) be the third derivative of n(i). Factor q(j). -4(j - 1)(j + 1)2(j + 2) Let n(c) be the second derivative of c5/50 + c4/3 + 3c3/5 + 12c. Factor n(r). 2r(r + 1)*(r + 9)/5 Let f(v) be the t	{ "pile_set_name": "DM Mathematics" }
u3/6 + 21u*2. Is r(-2) a composite number? False Let z = 740 + -504. Suppose -2u + 5y = z, 3u - y + 354 = y. Let r = u - -197. Is r a prime number? True Is 609609/88 - 15/40 prime? False Let c(l) = -l*3 + 14l*2 + 13l + 3. Let r be c(11). Suppose -r = -5f + 546. Is f composite? False Is 5522/4 - 18/(-36) prime? True Suppose -4x - 2v = -20, 5v = 2x + 4 + 10. Suppose a - 15 = -4a - 5f, -5a - f = -x. Let c = a - -21. Is c composite? True Let p(v) = 9v - 1. Let q be p(2). Let g(a) = -5a*2 - 7a - 1. Let t(x) = -14x2 - 22x - 3. Let o(c) = qg(c) - 6t(c). Is o(11) prime? True Suppose v + 20 = -v. Let u = v + -45. Is 2652/10 + 11/u prime? False Let w(f) = 196f2 - f - 4. Let d(h) = -h2 + 21h + 25. Let k be d(22). Is w(k) a prime number? False Suppose 2v = 5s - v - 34, 5s = -2v + 19. Let u(b) = -b + 11. Let a be u(11). Suppose -sr + 3y + 1714 = a, 0r = 4r + 3y - 1355. Is r a prime number? False Let l(h) = 26648h - 9. Is l(1) a composite number? True Let m = -8 + 13. Suppose 3q = mq - 826. Is q prime? False Let t(s) be the third derivative of s5/20 + s4/3 - 5s3/6 + s2. Let j be (-1)/(((-2)/(-1))/14). Is t(j) composite? True Let j(h) = 127h*2 + 37h - 243. Is j(16) a prime number? False Let w = -94 + 160. Let o be (-6)/4w/(-11). Is 421/o + (-12)/(-54) a prime number? True Let d = -2148 - -1099. Let p = d + 2008. Is p composite? True Suppose -6w + 20802 = -19812. Is w a prime number? False Suppose -29o + 2r = -26o - 8, 2o = -2r + 12. Let c be (5402/4)/(1/2). Suppose c = 3z - 4s, oz - 4s - 4061 + 465 = 0. Is z prime? False Let l(u) be the second derivative of -u4/12 + 5u*3/6 + 4u*2 + 2u. Let b be l(6). Suppose 72 + 62 = bv + 5f, 2v - 2f = 162. Is v composite? True Let a = -71 + 75. Suppose -879 = i - ai. Is i a composite number? False Is 2/((-3)/(-3761)2)3 a composite number? False Let r = 35772 + -9775. Is r composite? False Is 3833/(((-4)/(-1))/4) a composite number? False Let x(p) = -209p + 23. Is x(-6) a prime number? True Suppose -24 = -o + 17. Let i = o - 23. Let k = 44 - i. Is k a prime number? False Let i(j) = 97j - 7. Let p(u) = -49u + 3. Let z(f) = 4i(f) + 9p(f). Let b be z(8). Let y = b - -624. Is y a prime number? True Suppose -2o = v + 4, -o - v - 2v + 8 = 0. Is (274/o)/((-5)/50) prime? False Let r be (-4)/(-2) + 2608/2. Let g be (3/(-9))/((-1)/3). Is 0/g + r/2 a prime number? True Is 1182/78 + -15 + (-388997)/(-13) composite? True Suppose -270w + 257w - 7228 = 0. Let o(y) = -16y2 + 5y - 3. Let p be o(5). Let n = p - w. Is n a prime number? False Let u be (-1 + 1649)/((-10)/(-10)). Suppose -u = -8v + 2344. Is v a composite number? False Let d = 35535 + -20924. Is d a prime number? False Suppose 6j - 2j + 2067 = s, 0 = 2s + 2j - 4104. Suppose 5b - s = 2q - 0q, 0 = -4q. Is b prime? False Let a be (-1050)/(-8) - (-1)/(-4). Let j = 28 - -306. Let w = j - a. Is w composite? True Suppose -5v - v = -5472. Suppose -v = -j + 569. Is j composite? False Let m(a) = -2a3 - 4a*2 + 16a - 23. Is m(-19) a prime number? False Suppose 149 + 1 = -5v. Let a be 15/(-2)20/v. Suppose -n - i = 3i - 317, -3n = -ai - 951. Is n a prime number? True Let i(g) be the first derivative of -27g*2/2 - 40g - 11. Is i(-17) a prime number? True Let n = -21 + 24. Suppose 133 = nu + 4. Is u a prime number? True Suppose g + g + 4u - 22 = 0, -16 = -2g + 2u. Is (-23)/(-2)(13 + g) a prime number? False Let d be 35 + ((-2)/(-1) - 0). Suppose -218 = 35s - ds. Is s composite? False Suppose -20o + 447402 = 53942. Is o prime? False Suppose 66263 = 48x - 269209. Is x composite? True Let r be -91(184/28 + -4). Let c = r - -1399. Is c composite? True Suppose f = 3n - 234, 3n - 4n - 2f + 71 = 0. Let o be (-4)/(-6) - 2/3. Suppose -d + od + n = 0. Is d a prime number? False Suppose 27 = 4x + t + 4t, 5x = 5t. Let p(g) = -14g - 2 + x + 51g. Is p(4) prime? True Let j be -3 + (-6)/(-2) + 4 + -4. Suppose 3a = -d - ja + 197, 2d = -4a + 400. Is d prime? False Let t(l) = -2l*2 - 8l - 3. Let z be t(-2). Suppose 5p + 7f = 3f + 3331, zp = 5f + 3340. Is p a composite number? True Suppose -83u = -66u - 150433. Is u prime? True Suppose 86457 = 5s - a, 5s + 0s - 86461 = 3a. Is s a composite number? False Let k(v) = v + 18. Let q be k(-10). Let b = 11 - q. Suppose 4d - 3f = 139, -2f + bf = -3d + 88. Is d a composite number? False Suppose 64 = 7b - 48. Is (-8)/b + 5386/4 a prime number? False Suppose -2k + 31798 - 5236 = 0. Suppose -5h - 6i = -4i - k, -7973 = -3h + i. Is h a prime number? True Let v(o) = 1476o + 1. Let d(t) = 3t + 22. Let f be d(-7). Is v(f) a prime number? False Let j(f) = 4f3 - 11f*2 + 3f*3 + 9f - 6f3 + 3 + 9. Let g be j(10). Is (g/(-1))/((-4)/116) a composite number? True Let p = -4928 - -7627. Is p prime? True Let z(c) be the second derivative of 303c3/2 - c2/2 - 2c + 35. Is z(2) a composite number? True Let f(q) be the first derivative of q7/840 + q6/40 + q5/20 - 3q*4/8 - 5q3/3 + 2. Let j(l) be the third derivative of f(l). Is j(-7) composite? False Let t(r) = r3 + 7r2 + 7r + 7. Let y be t(-6). Let w be (18 - 19)y-4. Suppose -2g - 6 = 0, 3h = wh - 3g - 340. Is h composite? False Let b be 2/8 + 42/24. Suppose bz = 75 + 507. Is z a prime number? False Suppose -x = -2x + 4y + 111, -x + 76 = 3y. Is x composite? True Let q(u) = -u*3 + u + 187. Suppose -m + 13 = 5w, 2w + 2 = 3m - 3. Suppose -5x + 2 = -3h + 14, -wh = x - 8. Is q(x) prime? False Let t(c) be the first derivative of 10c*3/3 - 11c*2/2 + 12c + 6. Is t(9) a composite number? True Let j(i) = 14i2 - 7i + 5. Is j(-9) prime? False Suppose 76 = 3x - 4v - 22, 0 = -3x - 2v + 86. Let i = 25 - x. Is 3 + (-1975)/i + -3 a composite number? True Let t(a) = 3a3 + a2 - 1. Let p be t(1). Suppose 0 = ph - 152 - 313. Let g = h + -104. Is g composite? True Let o(t) = 80t + 7. Let s be (0 - 5)14/(-10). Let l be o(s). Suppose 4c - 797 = l. Is c composite? True Let z = 7948 - 2075. Is z a composite number? True Let u(n) = 4n*2 + 22n*2 - 7n*2 + 27n*2 + 9. Is u(-4) prime? False Let k = 2762 + -961. Is k prime? True Let y(k) = -11k*3 - 11k*2 - 19k - 10. Let j be y(-6). Is (j/6)/((-14)/(-21)) prime? True Let v(g) = -g*2 - 8g - 12. Let r be v(-3). Suppose 1443 + 3240 = ry. Is y composite? True Let o = 73 - 92. Let t(q) = -9q - 44. Is t(o) a composite number? False Suppose l + 30 + 151 = 0. Let n = l + 255. Is n composite? True Let g(j) = 3j2 - 5j*2 + 0j*2 + j + 5j*2 + 31j3 + 10. Is g(3) prime? True Let j(p) = p3 + 8p2 + 4. Let b be j(-8). Suppose -bc - 768 = -2d - 2c, -756 = -2d - 2c. Is d prime? False Suppose -5z - 48670 = -5t, t - 19471 = -t + 5z. Is t prime? True Suppose -391 - 1107 = -2w. Is w a prime number? False Suppose -21o - 4b + 18077 = -16o, 3o - 10824 = 5b. Is o composite? False Suppose -3f + 5f + 40 = 2d, -38 = 2f - d. Let m = f + 115. Is m prime? True Let i = 18802 + -7451. Is i composite? False Suppose 3o - 32022 = -3c + 70524, c - 34188 = 5o. Is c prime? True Let a = -35 + 37. Suppose -2 = ah, -550 + 4597 = 4g - 3h. Is g composite? True Suppose 0y = -8y + 458776. Is y a composite number? False Let y = 2 - -1. Let c(a) = a3 - 3a*2 + a + 3. Let v be c(y). Suppose -vj = -4j - 42. Is j a prime number? False Let n(x) = -x + 4. Let m be n(4). Suppose -2s + 7s - 15 = m. Suppose 5p - 461 = sf + 293, 0 = f + 3. Is p a prime number? True Let f = -3485 + 5044. Is f a prime number? True Let j(g) = -40g + 17. Let k be j(10). Let f = k + 645. Is -2 + f + -1 + 4 prime? True Suppose 0 = -13o + 15o - 4066. Suppose -5837 = 5d + o. Is 6/(-15) - d/10 a composite number? False Suppose -5p = -3 - 12. Let j = -264 + 651. Suppose 24 = -pa + j. Is a a composite number? True Let j be 1/((-1)/4 - 0). Let b be (1048/(-1))/j - 2. Suppose x + g = b, 2g - 3 = -g. Is x a composite number? True Let q = 232 - 11. Let i = -158 + q. Suppose -i = -2o + 31. Is o composite? False Suppose 15 - 51 = -6k. Let a(s) be the second derivative of s*5/10 - 3s*4/4 + 7s*3/6 - 7s*2/2 + s. Is a(k) prime? False Let g be (-28)/42(-3)/(-2). Is ((-8)/12 - g)/(2/23394) a prim	{ "pile_set_name": "DM Mathematics" }
ve of 1/20r5 + 0r - 2rt - 2r*2 + 0 + 0r*4. Factor i(v). 3(v - 2)(v + 2) Suppose 6/5 - 4/5x*2 + 1/5x + 1/5x3 = 0. What is x? -1, 2, 3 Let x = -67 + 15. Let i = x - -55. Determine t, given that -2/9t*5 - 8/9t*2 - 16/9t*i + 0t + 0 - 10/9t4 = 0. -2, -1, 0 Suppose 95a - 112a = 0. Let m(i) be the third derivative of 9i*2 + 2/3i*3 + a + 0i + 5/12i5 - 5/6i*4. Factor m(s). (5s - 2)*2 Let i = -16347/28 - -2349/4. Let -512/7m + 1/7m4 + 192/7m*2 - im3 + 0 = 0. What is m? 0, 8 Let c(l) = -l2 + 82l - 1645. Let j be c(47). Find h such that 1/2 - 1/2h*2 + jh = 0. -1, 1 Let v(l) be the second derivative of -l*5/40 + 11l*4/12 + 47l*3/12 + 6l*2 + 148l. Solve v(n) = 0. -1, 24 Suppose 23z + 22 = 19z + 5o, 5z = 20o - 110. Factor -1/2k*z + 0k + 1/4k3 + 0. k2(k - 2)/4 Factor 0 + 78/11d2 + 0d - 2/11d3. -2d*2(d - 39)/11 Suppose 13 = -6d + 19. Let l be d/6-3 + (-69)/(-10). What is n in -128/5n - 4/5n*4 - 96/5n*2 - 64/5 - ln*3 = 0? -2 Factor 2/9p*3 - 4/9p - 1/3p2 + 1/9p4 + 4/9. (p - 1)2(p + 2)2/9 Let j be (4/(-8))/(3/((-3)/2)). Let k(w) be the second derivative of 0 + 7w + 3/2w3 - jw*4 - 3w*2. Let k(t) = 0. Calculate t. 1, 2 Let f = 13 + -46. Let a = f + 35. Suppose 1/4u*3 + 0u*a - 3/4u - 1/2 = 0. What is u? -1, 2 Suppose -5l = 2 - 32. Let x(b) = 4b - 20. Let c be x(l). Find d such that 3d2 - d4 - 2d*c - 2 + 2 = 0. -1, 0, 1 Solve 17/4b*2 + 1/4b*3 + 147/4 + 91/4b = 0 for b. -7, -3 Let u = -58 - -39. Let o = u + 19. Suppose o + 1/2d - 1/4d2 = 0. Calculate d. 0, 2 Let b(i) be the first derivative of -i5/40 + 19i4/8 - 683i*3/12 - 741i*2/4 - 1521i/8 - 452. Factor b(v). -(v - 39)*2(v + 1)*2/8 Let y be ((-1140)/760)/((-3 + 1)/4). Factor -8/3i*y - 8/3i - 4i2 - 2/3i*4 - 2/3. -2(i + 1)*4/3 Let n(l) be the first derivative of 3l*4/8 - 11l*3/2 + 18l*2 + 54l + 300. Find u such that n(u) = 0. -1, 6 Let g(n) be the third derivative of n5/90 - n4/3 - 64n3/9 - 452n*2. Factor g(q). 2(q - 16)(q + 4)/3 Let a(q) be the second derivative of 1/12q*5 + 0 + 5/36q*4 + 0q*2 + 0q*3 - 18q. Find g such that a(g) = 0. -1, 0 Let c be 1/(-5) + 92/(-40) + 2. Let q = 11/6 + c. Factor -4/3 - 1/3l2 + ql. -(l - 2)*2/3 Let h = 101 - 98. Suppose 3g = hj - 9, -2g + 3 = 2j + 9. Factor -27/4s*3 + 0 + js - 3/2s2 - 21/4s*4. -3s*2(s + 1)(7s + 2)/4 Let i(y) = y*3 + 2y*2 - 2y + 6. Let k be i(-3). Suppose 2c4 + 6c - 6ck - 4c*4 - 17c*2 + 15c*2 + 4 = 0. Calculate c. -2, -1, 1 Let a(y) be the first derivative of -1 + 1/180y*5 + 1/36y*4 + 0y*3 + 3y*2 + 0y. Let w(m) be the second derivative of a(m). Factor w(l). l(l + 2)/3 Suppose -30/7z*3 + 18/7 + 0z*2 + 33/7z - 3/7z5 - 18/7z*4 = 0. Calculate z. -3, -2, -1, 1 Factor 0 - 1/5c*2 + 10c. -c(c - 50)/5 Let s = 1003/288 + 7/96. Factor 208/9f + 184/9f2 + s + 44/9f*3. 4(f + 2)*2(11f + 2)/9 Let q = 32 + -28. Let s(r) be the first derivative of 0r*2 + 2 - 2/55r*5 + 0r*q + 0r + 2/33r3. Factor s(n). -2n*2(n - 1)(n + 1)/11 Let j = -402 + 404. Let o(z) be the first derivative of j + 1/15z*3 - 2/5z + 1/10z2. Find y such that o(y) = 0. -2, 1 Let q be 1/((-27)/6) - 94/(-18). Determine y so that 69y - 10y4 - 2y*3 - 69y - 3y3 - qy*5 = 0. -1, 0 Let f(l) = 5l*4 - 199l*3 + 960l*2 - 1321l + 566. Let h(b) = -b*4 + 40b*3 - 192b*2 + 264b - 113. Let y(r) = 2f(r) + 11h(r). Solve y(n) = 0. 1, 3, 37 Let j(c) be the second derivative of c*4/4 - 114c*3 + 19494c*2 - 919c. Find o such that j(o) = 0. 114 Let -15a + 36a - 4a2 - 5a*3 - 37a*2 - 96a + 135 - 14a2 = 0. What is a? -9, -3, 1 Factor 8/3d*2 + 2d - 12 - 2/3d3. -2(d - 3)*2(d + 2)/3 Let b(v) be the third derivative of -2v7/525 - v6/150 + v5/75 + v4/30 + 67v*2. Find p, given that b(p) = 0. -1, 0, 1 Let h(s) be the third derivative of 0 - 1/15s*5 + 1/6s*4 + 4/3s*3 + 0s + 16s2. Suppose h(d) = 0. What is d? -1, 2 Let k(q) be the second derivative of q5/90 - q4/54 - 26q*3/27 - 8q*2/3 - 3q + 45. Find a, given that k(a) = 0. -4, -1, 6 Let j(t) be the second derivative of t*4/60 + 163t*3/15 + 26569t*2/10 + 103t. Solve j(k) = 0. -163 Let o(b) be the second derivative of 0b4 + 0 + 1/6b*6 + 0b*2 + 0b*3 + 1/4b*5 - 48b. Solve o(c) = 0 for c. -1, 0 Suppose 3 + 18 = 3k. Let n be (6 + 2)k/28. Factor 0 - 1/2q3 + 1/2q*n + 1/2q - 1/2q4. -q(q - 1)(q + 1)2/2 Let s be (-110)/(-11)1(-2)/(-4). Factor -6n*3 + 2n + sn3 - 2n*4 + 2n2 - n3. -2n(n - 1)(n + 1)2 Let n(d) = 2 - 2 + 9d*2 + 6d*3. Let i(r) = -3r - 2r + 0r + 17r3 + 6r + 26r2. Let c(o) = -3i(o) + 8n(o). Find s, given that c(s) = 0. -1, 0 Let x(r) be the third derivative of -4/45r*5 - 5/18r*4 + 0r + 1/30r6 + 4/9r3 + r2 - 9. Factor x(d). 4(d - 2)(d + 1)(3d - 1)/3 Let h(i) = 12i2 - 549i + 37002. Let w(u) = -5u2 + 274u - 18500. Let s(a) = -6h(a) - 15w(a). Determine j so that s(j) = 0. 136 Let y(b) = -4b2 - 142b - 298. Let g(x) = 11x2 + 283x + 597. Let d(u) = -2g(u) - 5y(u). Factor d(a). -2(a - 74)(a + 2) Let u(d) = 3 - 2 - 3d3 + 14 - 21d*2 + 0d*3 - 18d. Let r(n) = n*2 + n - 1. Let x(i) = -15r(i) - u(i). Determine q so that x(q) = 0. -1, 0 Factor 3/2d4 - 7/6 + 1/6d*5 - 5/2d - 1/3d2 + 7/3d*3. (d - 1)(d + 1)*3(d + 7)/6 Factor 575 - 602 - 17g3 - 72g*2 - 78g + 3g4 - g3. 3(g - 9)(g + 1)3 Let i(q) be the first derivative of -27 - 3/4q*4 + 0q2 - q3 + 0q. Factor i(d). -3d*2(d + 1) Let n(f) be the second derivative of 0f2 - 10/3f*3 - 10/3f*4 - 26f + 1/4f5 + 0 + 1/3f*6. Factor n(g). 5g(g - 2)(g + 2)(2g + 1) Suppose -27p + y = -29p + 3, 3p + 3y = 0. Let j(z) be the second derivative of 0 + 1/2zp + 1/3z*4 - 6z - 1/2z2. Factor j(k). (k + 1)(4k - 1) Let s(g) = -3g*2 + 8g - 11. Let j(r) = 3r2 - 8r + 10. Let y(p) = 5j(p) + 4s(p). Let w(z) = 3z2 - 7z + 5. Let c(o) = -6w(o) + 5y(o). Factor c(k). -k(3k - 2) Let f be 6 + -12 + 10/1. Let u(l) be the third derivative of 3l2 + 1/240l*5 - 1/840l*7 + 0l*3 + 0l*f + 0l*6 + 0 + 0l. Factor u(m). -m*2(m - 1)(m + 1)/4 Let z(k) be the third derivative of k8/6720 + k7/840 + 7k4/8 - k2. Let x(d) be the second derivative of z(d). Factor x(h). h*2(h + 3) Let d(i) be the second derivative of -i*4/60 + 2i*3/15 - 2i*2/5 + 75i. Factor d(l). -(l - 2)*2/5 Let u(d) be the third derivative of 1/42d*7 + 0d + 0d3 + 1/24d*6 - 1/12d*5 - 5/336d*8 + 10d*2 + 0 + 0d*4. Solve u(p) = 0 for p. -1, 0, 1 Let h = -48/25 + 58/25. Let y(j) be the first derivative of -2/25j*5 + 3 + 0j + 1/5j2 - hj*3 + 3/10j4. Determine a, given that y(a) = 0. 0, 1 Let c(h) be the third derivative of -h8/784 - h*7/490 + 9h6/280 + h5/28 - 2h4/7 - 6h*3/7 - 216h*2. Let c(f) = 0. What is f? -3, -1, 2 Suppose 2h - 71 = h - 4c, 0 = -3h - 5c + 199. Let g be (-3(-8)/(-36))/((-70)/h). Factor 2/5 - 1/5d4 + d - 1/5d*3 + gd*2. -(d - 2)(d + 1)*3/5 Find q such that -3688q - 13438q2 - 22862q*2 - 3q*5 - 8641q - 19615q - 4554q*3 - 201q*4 = 0. -22, -1, 0 Suppose 2s + 14 = 22. Let h(n) = -7n3 + 4n*2 - n. Let l(o) = 6o*3 - 3o*2. Let v(j) = sl(j) + 3h(j). Let v(r) = 0. What is r? -1, 0, 1 Let i = 7624 + -7622. What is a in -i - 63/2a*2 - 49/4a*3 - 15a = 0? -2, -2/7 Determine q, given that 12/7q2 - 4/7q + 0 - 8/7q3 = 0. 0, 1/2, 1 Let g(w) be the first derivative of 0w + 1/20w6 - 7/2w*2 + 0w*3 + 1/4w*5 - 4 + 1/4w*4. Let k(j) be the second derivative of g(j). Factor k(b). 3b(b + 2)(2b + 1) Let b = 1 - -3. Suppose bj = -0j + 24. Factor -p + 4p - jp - 9p*2 - 3 - 6p - 3p3. -3(p + 1)*3 Let z be (-48)/(-14) + 1 + 1354 + -1357. Factor 2/7h*3 + 12/7 - zh - 4/7h2. 2(h - 3)(h - 1)(h + 2)/7 Let p(c) = -c4 - c3 + c - 1. Let m(v) = -4v4 + 6v*3 - v + 1. Let s = -90 + 91. Let u(y) = sp(y) + m(y). Suppose u(o) = 0. What is o? 0, 1 Suppose -7/5a2 + 1/5a*3 - 8/5 + 14/5a = 0. What is a? 1, 2, 4 Suppose -4u + 12 = 32t - 34t, 12 = 4u + 2*t. Let	{ "pile_set_name": "DM Mathematics" }
37y2 - 45y + 36. Let d(r) = -34r2 + 11r - 9. Let o(x) = -9d(x) - 2q(x). Let v = 12 - 16. Is o(v) a prime number? True Let f = -7427 - -3959. Let k = f + 6509. Is k composite? False Suppose -240r + 73697 = -227r. Let c = r - -9942. Is c composite? True Let l = 2583 - -8656. Is l composite? False Suppose -s = -2w + 50147, -31w + 4s = -30w - 25077. Is w a composite number? False Suppose c + 7250 - 2716 = 0. Let a = c - -10005. Is a prime? True Suppose 6k = 8k - 54. Let c = k + -29. Is 1/2 - 0 - 147/c a prime number? False Let b(u) = -855u + 1. Let h be b(-2). Let y = h + -1026. Is y a composite number? True Let q(t) = 2262t*2 - 121t - 1028. Is q(-9) prime? True Let t be (-12)/(-66) + (-1)/((-33)/390). Suppose th = h + 45166. Is h a prime number? False Let j = 205 - 328. Is (574/j)/((-4)/1506) a composite number? True Let q = -1004 - -31827. Is q prime? False Let z = 164707 - 67814. Is z composite? False Suppose -5k + 357493 = -2u, -u = -25k + 23k + 142996. Is k a prime number? False Let n(w) = -3w + 5w2 + 3w + 4w - w3 + 2 - w2. Let b be n(4). Suppose b = -4r + 142. Is r a prime number? True Is ((-6)/(-18))/(((-14)/(-3499503))/2) composite? False Let g(i) = i + 16. Let h be g(-3). Let o(v) = 0 + 11v + 2v*3 - 3v*2 - 5 - 2v*2 - hv. Is o(6) a prime number? False Suppose -1751 - 3014 = -c. Let z = 8174 - c. Is z prime? False Suppose -7i + 312215 = -257592. Is i a composite number? False Let g(z) = -z2 - z + 28. Let b be g(0). Suppose 2n + 0n = 5f + 42, 0 = 2n + 2f - b. Is -1942((-56)/n + (3 - 1)) a composite number? True Suppose i - 3 = 4g - g, -i = -3. Is (1/(-3) - g) + 199326/9 a composite number? False Let d(s) = 3s2 - 2s + 23. Let x be d(7). Suppose 3u = 183 + x. Is u composite? False Suppose 19m = -16m - 234675. Let l = 3106 - m. Is l composite? False Let b(p) = 27p*3 - 4p*2 + 2p - 6. Let n(l) = -l*2 + 10l - 20. Let s be n(8). Let a be b(s). Let z = a - -3385. Is z a prime number? True Let b be 46612 + (-20)/5 + 0. Suppose -b = -9i - 13i. Is i prime? False Let m(t) = -12227t - 557. Is m(-20) prime? False Suppose 28k - 641484 - 1132232 = 0. Is k prime? True Let r(z) = -z + 15. Let i be r(13). Let a(m) = 25m*i + 47m*3 + 8m - 19 - m - 29m2. Is a(4) a composite number? False Let h(t) = t3 + 50t*2 - 10t + 49. Is h(-36) a composite number? False Suppose -21l + 62l = 11l + 2301630. Is l a composite number? True Suppose 16 = -4s, 2y - 2s - 40 = -2y. Suppose -11i + 7011 = -yi. Suppose -2609 = -2g + i. Is g a composite number? False Let p(f) = 82346f2 - 7f - 3. Is p(2) prime? False Suppose 3p - 105827 = -22427 + 83661. Is p composite? True Let a(w) = 83w + 4. Let v(y) = -5y + 31. Let z = -56 + 62. Let j be v(z). Is a(j) composite? True Let x(w) = 296w - 4575. Is x(22) a composite number? True Suppose 0 = 2a - 5b + 50, 4a + 134 = -5b + 64. Is -8a/32 - (-7783 - 1) a composite number? False Is (-4)/6 - (-273229)/177 a composite number? False Let s = 38 - -73. Suppose 5m + 36 = 2x + 9, -x - 6 = 4m. Suppose 4k - 148 = q - xq, 3k - 2q = s. Is k prime? True Let p = 7610 - 7610. Let h(u) be the third derivative of u*4/4 + 701u*3/6 - 2u*2. Is h(p) a composite number? False Suppose 25f - 70f + 1978546 = -6432989. Is f a prime number? False Let l(k) = 87k*3 - 2k*2 - 3k - 1. Let c be -2 + 24/16 + 2/(-4). Let a be l(c). Let v = 244 + a. Is v a prime number? True Suppose 0 = -f - 7f + 13544. Suppose 17764 = 11o + f. Is o prime? False Is (27/(-63))/(21/(-7520863)) a composite number? False Suppose 54j = 34293474 + 8171964. Is j a composite number? True Suppose 2z + 1298 = f - 818, -4f + 3164 = -3z. Let s = 717 - z. Is s composite? False Let g be ((0 - 0)/(27 + -29))/1. Let d(h) = -3h2 - 2h + 953. Is d(g) composite? False Let c(p) = -2p2 + 29p + 20. Suppose -45 = -2f - f - 3l, 0 = 4l + 4. Let r be c(f). Let y = r + 107. Is y a prime number? True Let p be (27/(-18))/((-1)/2) - -9. Let b be (40/p)/(4/(-6)). Is ((-978)/10 - 10/5)b a prime number? True Is 89348/(-8)(4 + 1)/(10/(-4)) a composite number? True Let h(b) = 55b + 8. Let p(s) = s2. Let q be p(-2). Let c be h(q). Let v = c - -1573. Is v a composite number? False Let b(l) = -l3 - 2l2 - 4l + 18589. Is b(0) prime? False Suppose -3q = -4q + 5. Suppose qd = 5o, 5d = 2o - 6 - 3. Is (149/d)/(2/(-18)3) composite? False Suppose 2d - 254879 = -21k + 26k, -5k + 1274485 = 10d. Is d a composite number? False Let n(p) be the third derivative of -365p4/24 - 2p*3/3 + 22p*2. Let j be n(1). Let c = 880 + j. Is c a prime number? False Let s = 4265814 - 2783745. Is s a composite number? True Let z be 4/(-16)-4(-891 + 0). Let o = z + 1778. Is o prime? True Suppose 6i + 54458 - 2396 = 0. Let d = i + 21258. Is d composite? True Let v(q) = 7q2 - 12q - 49. Let o be v(30). Let w = o - 1344. Is w a prime number? True Let m(g) = g2 - 2. Let v be m(7). Let z = v - 66. Let h(j) = j3 + 20j2 + 16j - 11. Is h(z) a composite number? True Suppose -12956 = w + 4j - 1223, -2j - 10 = 0. Let k = -7386 - w. Is k a composite number? False Suppose 0 = -92h + 87h + 42855. Is h composite? True Let a = -15 - -11. Let g(u) = -7u3 - 31729u + 63463u - 31729u - 3u2 - 1. Is g(a) a composite number? False Suppose -40d + 16481212 = -567948. Is d composite? False Let t be 2 + (-9)/((-9)/2). Let n be 1 + -4 + t - -1. Suppose -2k = 4d - 206 - 598, 0 = nk + 4. Is d a composite number? True Suppose -132y - 8545221 + 20992526 = -11259763. Is y a prime number? False Suppose 0 = v - 232676 - 111131. Is v a prime number? False Let z(w) = w*3 + 8w*2 + 7. Let v be z(-8). Suppose 8x - 221 = vx. Suppose 6l - 253 = x. Is l a composite number? False Suppose -2 = -o + 4w, 2w + 11 = o + 5. Suppose 2d + 3r - 10021 - 40807 = 0, -5r - o = 0. Is d a prime number? False Let t = 74 - 67. Is 2/7 - (-5871)/t a prime number? True Is -1723029(15 + -32 - -16) prime? True Suppose -10a + 18a - 120 = 0. Suppose -aj = -13j - 72. Suppose -y - 1 = -j. Is y a prime number? False Let q be 12/3 - 214-1. Let k(r) = r3 - 7r*2 - 12r + 11. Let c be k(10). Suppose q = 3s - 4t - 459, s = -3t + c. Is s prime? False Let q(n) = -n3 - 22n*2 - 31n - 23. Let i be 1((-69)/(-9))/((-4)/12). Is q(i) a composite number? True Let b(l) = -8l*3 + 15l*2 + 22l - 10. Let h be b(-9). Let x = 12310 - h. Is x a prime number? True Let k(j) = -223j - 53. Let y(d) = -112d - 27. Let g(o) = 2k(o) - 5y(o). Let l(s) = s - 1. Let t(f) = g(f) + 2l(f). Is t(13) composite? True Suppose -3d + 43451 + 177498 = -78412. Is d a composite number? False Let o(g) = 8g3 + 3g*2 + 7g - 12. Let s be o(6). Suppose -3045 = -3b + s. Is b prime? True Suppose -47340 = -256f + 255f. Suppose -24h + 336444 = -f. Is h composite? False Let a be 39/78(0 - -1)4. Suppose 5c - 510 = -af + 1462, 5f - 4965 = 5c. Is f a prime number? True Let b = -8397 - -2730. Let o(n) = n*3 + 5n*2 - 20n + 2. Let r be o(20). Let l = r + b. Is l prime? False Let s(m) = -418m - 7. Let n be s(-2). Suppose -1851 = -4j + n. Let h = 1083 - j. Is h prime? False Let f be 888 + 1/((-2)/4 - -1). Let m = f - 385. Is m prime? False Let n = -4360 + 2109. Let b = n + 4664. Is b a composite number? True Suppose 2m - 118615 = 5g, 49m - 51m = -4g - 118618. Is m composite? True Suppose 0 = 55d - 56d + 120140. Suppose -k = -3q - 24040, 0 = -5k - 3q - 2q + d. Is k a prime number? False Let i(m) = m3 - 17m*2 - 40m + 38. Let x be i(19). Let y(c) = -c*2 + 2c + 2927. Is y(x) composite? False Suppose -25o + 155743 = -91032. Is o a composite number? False Suppose -6w = -9w. Suppose -2407 = -x - g - 723, w = 2x + 4g - 3358. Suppose 0 = 2d + d + q - 1009, -5d = -2q - x. Is d a composite number? False Suppose -255r = -208r - 222263. Is r a composite number? False Suppose -r = 5q - 10, -q - 26 + 28 = 5r. Let l(n) = 928n - 39. Is l(q) composite? True Suppose -16758 = -3d - 3u, -4d - 4u = d - 27932. Suppose 0l - d = -4l. Is l composite? True Let n(g) = 12g*2 + 10g - 7. Let x(t) = -t3 + t2 - t + 1. Let z(k) = n(k) - x(k). Let r be z(-10). Is (-10)/45 + (-4558)/r a composite number? True Let m = -19	{ "pile_set_name": "DM Mathematics" }
before 2:00 PM? 4:36 AM How many minutes are there between 5:00 PM and 7:25 PM? 145 What is 82 minutes after 5:14 AM? 6:36 AM What is 491 minutes before 6:10 PM? 9:59 AM What is 170 minutes after 4:11 AM? 7:01 AM How many minutes are there between 12:59 AM and 12:28 PM? 689 What is 142 minutes after 8:27 AM? 10:49 AM How many minutes are there between 1:40 AM and 9:45 AM? 485 What is 49 minutes before 7:00 AM? 6:11 AM What is 667 minutes after 2:16 AM? 1:23 PM How many minutes are there between 9:39 PM and 11:56 PM? 137 What is 53 minutes after 8:05 AM? 8:58 AM What is 628 minutes after 3:57 AM? 2:25 PM How many minutes are there between 5:37 PM and 12:05 AM? 388 What is 260 minutes before 1:26 PM? 9:06 AM What is 402 minutes before 8:42 PM? 2:00 PM What is 405 minutes before 2:57 AM? 8:12 PM How many minutes are there between 1:31 AM and 7:02 AM? 331 What is 443 minutes before 5:59 PM? 10:36 AM What is 639 minutes after 6:02 PM? 4:41 AM How many minutes are there between 12:32 PM and 1:43 PM? 71 What is 120 minutes after 7:43 AM? 9:43 AM How many minutes are there between 5:54 PM and 2:16 AM? 502 What is 677 minutes after 7:01 PM? 6:18 AM How many minutes are there between 3:07 AM and 4:16 AM? 69 How many minutes are there between 9:29 PM and 7:56 AM? 627 How many minutes are there between 12:03 PM and 7:06 PM? 423 How many minutes are there between 7:31 AM and 6:38 PM? 667 What is 207 minutes before 6:02 PM? 2:35 PM How many minutes are there between 12:07 PM and 1:38 PM? 91 What is 270 minutes before 3:11 AM? 10:41 PM How many minutes are there between 4:50 PM and 10:13 PM? 323 What is 111 minutes after 8:16 PM? 10:07 PM How many minutes are there between 5:30 AM and 8:03 AM? 153 What is 502 minutes before 4:51 PM? 8:29 AM What is 50 minutes before 12:06 AM? 11:16 PM What is 371 minutes before 5:49 PM? 11:38 AM How many minutes are there between 3:46 PM and 8:59 PM? 313 How many minutes are there between 8:13 PM and 4:26 AM? 493 What is 480 minutes after 7:04 PM? 3:04 AM How many minutes are there between 9:23 PM and 4:22 AM? 419 How many minutes are there between 2:53 AM and 10:01 AM? 428 What is 386 minutes after 2:59 PM? 9:25 PM How many minutes are there between 8:30 PM and 1:19 AM? 289 How many minutes are there between 7:48 AM and 2:44 PM? 416 How many minutes are there between 9:09 PM and 10:05 PM? 56 How many minutes are there between 8:36 AM and 4:59 PM? 503 What is 453 minutes before 7:15 AM? 11:42 PM How many minutes are there between 1:16 AM and 3:17 AM? 121 How many minutes are there between 12:01 PM and 2:47 PM? 166 What is 292 minutes before 5:39 AM? 12:47 AM What is 39 minutes before 9:20 AM? 8:41 AM How many minutes are there between 10:31 PM and 9:05 AM? 634 What is 265 minutes after 5:39 PM? 10:04 PM How many minutes are there between 6:15 PM and 4:54 AM? 639 How many minutes are there between 1:20 AM and 3:03 AM? 103 What is 345 minutes before 6:55 PM? 1:10 PM What is 391 minutes after 4:40 AM? 11:11 AM How many minutes are there between 5:48 AM and 11:55 AM? 367 How many minutes are there between 9:37 AM and 6:04 PM? 507 What is 341 minutes before 9:38 AM? 3:57 AM What is 699 minutes before 10:26 AM? 10:47 PM How many minutes are there between 7:40 PM and 9:48 PM? 128 What is 672 minutes after 11:03 PM? 10:15 AM How many minutes are there between 5:29 PM and 3:17 AM? 588 What is 623 minutes after 4:18 PM? 2:41 AM What is 591 minutes before 7:33 PM? 9:42 AM What is 238 minutes after 11:10 PM? 3:08 AM How many minutes are there between 2:45 PM and 4:48 PM? 123 What is 35 minutes after 11:10 AM? 11:45 AM How many minutes are there between 9:38 AM and 10:17 AM? 39 What is 77 minutes after 3:00 PM? 4:17 PM How many minutes are there between 4:20 AM and 2:05 PM? 585 How many minutes are there between 6:06 PM and 5:22 AM? 676 What is 82 minutes after 6:28 AM? 7:50 AM What is 493 minutes before 5:45 AM? 9:32 PM What is 48 minutes after 5:40 AM? 6:28 AM How many minutes are there between 1:17 AM and 6:32 AM? 315 What is 693 minutes before 11:08 PM? 11:35 AM How many minutes are there between 10:26 PM and 10:32 PM? 6 How many minutes are there between 12:10 AM and 6:17 AM? 367 What is 244 minutes after 5:12 AM? 9:16 AM How many minutes are there between 12:17 AM and 10:47 AM? 630 What is 295 minutes before 6:07 PM? 1:12 PM How many minutes are there between 6:10 AM and 3:29 PM? 559 How many minutes are there between 5:10 PM and 4:59 AM? 709 What is 514 minutes after 9:57 PM? 6:31 AM What is 678 minutes before 12:55 PM? 1:37 AM How many minutes are there between 4:40 PM and 10:04 PM? 324 What is 617 minutes after 4:06 AM? 2:23 PM How many minutes are there between 9:36 PM and 8:54 AM? 678 What is 223 minutes before 7:01 PM? 3:18 PM How many minutes are there between 9:44 PM and 12:35 AM? 171 What is 583 minutes after 8:07 AM? 5:50 PM How many minutes are there between 10:38 AM and 8:29 PM? 591 How many minutes are there between 5:08 PM and 2:44 AM? 576 What is 337 minutes before 12:54 AM? 7:17 PM How many minutes are there between 2:39 AM and 9:27 AM? 408 What is 293 minutes after 6:21 PM? 11:14 PM How many minutes are there between 7:28 AM and 1:00 PM? 332 What is 12 minutes after 11:24 PM? 11:36 PM What is 317 minutes before 9:35 AM? 4:18 AM What is 482 minutes after 1:28 PM? 9:30 PM How many minutes are there between 11:54 PM and 4:59 AM? 305 How many minutes are there between 6:02 PM and 10:17 PM? 255 How many minutes are there between 6:54 PM and 5:46 AM? 652 How many minutes are there between 10:58 AM and 6:51 PM? 473 What is 185 minutes before 2:08 PM? 11:03 AM What is 714 minutes before 8:40 AM? 8:46 PM What is 6 minutes after 1:16 PM? 1:22 PM How many minutes are there between 4:03 AM and 9:23 AM? 320 What is 27 minutes after 4:46 PM? 5:13 PM What is 543 minutes after 4:03 PM? 1:06 AM How many minutes are there between 9:21 AM and 4:33 PM? 432 What is 482 minutes before 5:05 PM? 9:03 AM What is 353 minutes after 5:52 AM? 11:45 AM What is 456 minutes after 8:24 AM? 4:00 PM What is 502 minutes before 3:54 AM? 7:32 PM How many minutes are there between 6:22 AM and 8:13 AM? 111 What is 597 minutes before 12:24 AM? 2:27 PM What is 173 minutes before 11:25 PM? 8:32 PM How many minutes are there between 11:15 PM and 7:01 AM? 466 What is 634 minutes after 11:21 AM? 9:55 PM How many minutes are there between 7:04 PM and 7:10 PM? 6 What is 374 minutes after 8:12 AM? 2:26 PM What is 605 minutes before 11:04 PM? 12:59 PM What is 573 minutes after 3:55 AM? 1:28 PM What is 448 minutes before 12:24 PM? 4:56 AM What is 373 minutes after 7:26 PM? 1:39 AM How many minutes are there between 2:58 AM and 4:15 AM? 77 What is 457 minutes before 12:54 PM? 5:17 AM How many minutes are there between 10:14 AM and 11:14 AM? 60 What is 589 minutes before 12:28 AM? 2:39 PM How many minutes are there between 9:14 PM and 1:38 AM? 264 How many minutes are there between 11:18 AM and 5:46 PM? 388 How many minutes are there between 8:55 PM and 9:06 PM? 11 What is 235 minutes before 1:29 AM? 9:34 PM What is 20 minutes before 2:55 PM? 2:35 PM How many minutes are there between 9:24 PM and 11:02 PM? 98 How many minutes are there between 9:03 AM and 12:46 PM? 223 What is 264 minutes before 10:36 AM? 6:12 AM How many minutes are there between 1:53 PM and 7:21 PM? 328 What is 592 minutes before 7:00 AM? 9:08 PM What is 255 minutes after 3:39 AM? 7:54 AM How many minutes are there between 12:24 AM and 2:34 AM? 130 What is 305 minutes before 1:26 PM? 8:21 AM What is 148 minutes after 3:08 PM? 5:36 PM How many minutes are there between 8:38 AM and 6:10 PM? 572 What is 708 minutes after 7:03 AM? 6:51 PM What is 520 minutes before 3:12 AM? 6:32 PM How many minutes are there between 11:02 AM and 12:19 PM? 77 How many minutes are there between 2:24 AM and 1:16 PM? 652 How many minutes are there between 1:36 AM and 1:16 PM? 700 How many minutes are there between 10:14 PM and 6:35 AM? 501 How many minutes are there between 2:40 PM and 1:03 AM? 623 How many minutes are there between 6:38 PM and 6:49 PM? 11 What is 591 minutes before 2:33 PM? 4:42 AM How many minutes are there between 5:08 AM and 5:33 AM? 25 What is 532 minutes after 12:35 PM? 9:27 PM What is 692 minut	{ "pile_set_name": "DM Mathematics" }
46644u + 1 Find the second derivative of 1023571i*3x*2 - 508i*3x - 13i2x - 11 wrt x. 2047142i3 Differentiate 583o*4 - 4o - 469516 with respect to o. 2332o3 - 4 What is the second derivative of 10a*2j*2n + a*2jn - 2a*2n*2 + 1415aj3n*2 - 14aj3n - 3aj*2n - j*3 + 2jn2 wrt n? -4a*2 + 2830aj3 + 4j What is the derivative of 39127k4 + 24644 wrt k? 156508k*3 Find the third derivative of -23395a*2d*2t3 - a2dt*3 + 3a*2dt + 15d*2t - 5t2 wrt t. -140370a*2d*2 - 6a*2d Find the third derivative of 5303r3 + 40069r*2 wrt r. 31818 What is the derivative of 1059557i*3 + 1749515 wrt i? 3178671i*2 Find the first derivative of -2wx4 + 314w - 3561x4 + 4 wrt x. -8wx3 - 14244x*3 Find the third derivative of 1268268g*3l - 3g2l + 12162g2 + gl + 1 wrt g. 7609608l Differentiate -380du - 29775d + 17u wrt u. -380d + 17 Differentiate 194957n - 236580. 194957 Find the first derivative of 2222246u*4 + 2038691 wrt u. 8888984u*3 Find the first derivative of -3c*2 - 54769c - 129702 wrt c. -6c - 54769 Differentiate 2043632m*3t + 2m2t*2 + 24t*2 - 4345t - 6 with respect to m. 6130896m2t + 4mt*2 Find the first derivative of -5co2 + 105cov - co - cv + 73c + 4983o*2v + 218ov wrt c. -5o2 + 105ov - o - v + 73 What is the second derivative of -30168rv2 - 13rv + 2r - 131v wrt v? -60336r Find the first derivative of -c*3n*2 + 5560c*2n*3 - 125n*3 - 15n*2 wrt c. -3c*2n*2 + 11120cn3 What is the second derivative of -232b*2q*2 - 3b*2q - 108b2 + 65bq2 - 69bq + q wrt b? -464q*2 - 6q - 216 What is the derivative of -5i2v - 16i2 + 19iv + 13i - 13v3 - 2 wrt v? -5i*2 + 19i - 39v2 What is the second derivative of -1958no2s + nosw + now - 2no + 2ns2w + 8ns*2 + 14o*2s*2w + 2s wrt s? 4nw + 16n + 28o2w What is the third derivative of 3a2n*3 + 71a*2n - 19an*3 - 15an2 + 121n*3 - 32 wrt n? 18a*2 - 114a + 726 Find the third derivative of -50694p2v*3 - 107242p*2v*2 wrt v. -304164p*2 What is the first derivative of -82426o*4 - 45349? -329704o*3 Differentiate -3a*4q + a*4 - 332a*2q + 143961q wrt a. -12a*3q + 4a3 - 664aq Differentiate -251747d3 + d2 - 670681 with respect to d. -755241d2 + 2d Find the third derivative of -2264n3ry2 + n3r - 106n3y*2 + 3n*2ry - 118n*2y - nry*2 + 2nr + 23ny - 2ry2 wrt n. -13584ry2 + 6r - 636y2 Find the third derivative of -226152a*3 + 24387a*2. -1356912 Find the third derivative of 4737672v*3 + 833489v*2. 28426032 What is the third derivative of 8790f*3y*4 + 2f*3y - 4f3 + 53f*2y*6 + 170f*2y*2 + 2fy2 + 38 wrt y? 210960f*3y + 6360f2y*3 Find the third derivative of -38868n*3 - 3886n*2 - 2. -233208 What is the derivative of 361g*2 + 802g + 243917 wrt g? 722g + 802 What is the derivative of 2066b*2y - 84b2 - 4bst*2y - bst*2 - st*2 - sy + 5t2 - 3t + 1 wrt y? 2066b2 - 4bst*2 - s Differentiate -16431f*2 - 50f - 2019451 with respect to f. -32862f - 50 Differentiate 2080gx3 - 4gx + 460283g - 15x3 wrt x. 6240gx2 - 4g - 45x2 What is the second derivative of -q5 - 85829q*2 + 14846q - 8 wrt q? -20q3 - 171658 What is the third derivative of -627a*6 - 124a*5y - 79a2y - 213a + 2 wrt a? -75240a*3 - 7440a*2y Find the second derivative of -f*3n*3 + 45619f*3n + 825fn*3 - 2fn + n3 - n2 wrt n. -6f*3n + 4950fn + 6n - 2 Find the first derivative of -63398o + 14244 wrt o. -63398 What is the second derivative of 1031997m2 - 144m - 2801? 2063994 What is the second derivative of 2b2i*3o - 89b2i*3 - 1966b*2o + 3bi*3 - bi*2o - 2bi*2 - 18bo + 3i*3 - 3 wrt b? 4i*3o - 178i3 - 3932o What is the third derivative of 877388m4 + m2 + 802825m? 21057312m What is the second derivative of 131356g*5w + g*2w*3 - 2gw3 - 3gw + 23g - 292w3 wrt g? 2627120g*3w + 2w3 What is the first derivative of -707o*3 - 61o*2 + 313382 wrt o? -2121o*2 - 122o What is the second derivative of b*5 - 54b*3 + 263b*2 - 15b - 293 wrt b? 20b3 - 324b + 526 What is the second derivative of 50678x2 + 6x + 226 wrt x? 101356 Find the second derivative of -8228f3r*3 - 3f*3r - 3f3 + f2r + 3fr*5 + 171fr wrt r. -49368f*3r + 60fr*3 Find the first derivative of 2a*2ky + 609a*2k - 3ay + 23ky + 142k - y wrt a. 4aky + 1218ak - 3y Find the first derivative of -12s*2w*2 + 7sw2 + 3sw + 41806w*2 wrt s. -24sw2 + 7w*2 + 3w What is the second derivative of -53104b3g - b*2g*3 - 4127bg3 - 20g*3 wrt b? -318624bg - 2g*3 What is the derivative of -2f*3i - 32f2i*2 - 71fi - 26260i*2 - i wrt f? -6f*2i - 64fi*2 - 71i What is the third derivative of 526988o4 - 19o*2 + 4519o? 12647712o Find the third derivative of -1753l*6 + 2l*4 - 6l*3 - 135341l*2. -210360l*3 + 48l - 36 What is the derivative of hk2q*2 + 1677hk2q + 21hq - 9k2q*2 + 20kq + 221k wrt h? k*2q*2 + 1677k*2q + 21q Find the third derivative of -d3hj + d3hv2 + 2234d*3j*3 + 3d*2hj3 + 50d*2hv2 - 5dhj*3v + 5hj*2v + j*2v*2 wrt d. -6hj + 6hv2 + 13404j*3 Find the second derivative of 9t*5 + 4t*4 + 19100t*2 + 5t + 126594 wrt t. 180t3 + 48t*2 + 38200 Find the second derivative of 158899v*3 + 3v + 2987 wrt v. 953394v Differentiate -99121h*2 + 2h + 541170. -198242h + 2 Differentiate -2lv2y + 32689ly + 30v2y - 2v2 - 3vy - 308v with respect to l. -2v2y + 32689y What is the second derivative of 13g*2v*4 + 2g*2v*2 - 13g*2v + 156v3 + v + 105 wrt v? 156g*2v*2 + 4g*2 + 936v Find the third derivative of 32258v4 - 13173v*2. 774192v What is the second derivative of -56h2s*3 - 50h*2s + 748h2 + 39s*4 wrt s? -336h*2s + 468s2 What is the first derivative of -dm*2w*2 - 489435dw3 + 2m*2w*3 + 143m*2w + 650m2 + w wrt d? -m2w*2 - 489435w*3 Find the second derivative of -4a*2v4 + a2v + 61av5 - 2499av wrt v. -48a*2v*2 + 1220av3 Differentiate 13d*3 + 201d*2 + 91162 wrt d. 39d*2 + 402d Differentiate 20gi + 2gr - g - 3ir*2 - 284i + 145r2 + 12 wrt i. 20g - 3r2 - 284 What is the first derivative of 4c*3k*2 + 3879ck2 - 23961k*2 wrt c? 12c*2k*2 + 3879k*2 Find the second derivative of 4b*3z*3 + 73b*3z*2 + 16b*3 + 39bz3 - 1027bz - z wrt z. 24b*3z + 146b3 + 234bz What is the third derivative of -4iu5 - 7092iu3 + 4iu2 + 2i - 7u2 + 121u wrt u? -240iu*2 - 42552i Differentiate -7212il + 4i + 30208l + 1 with respect to i. -7212l + 4 What is the third derivative of -106y*5 - 17417y*4 - 351016y*2 wrt y? -6360y*2 - 418008y What is the first derivative of 5197b2lv - 23b*2l - 247b2v - bv + 153b wrt l? 5197b2v - 23b2 Find the second derivative of -58536l*5x - 20lx + 496l + 2x wrt l. -1170720l3x Find the third derivative of 1760x5 + 550x*4 - 111x*2 + 37x + 6 wrt x. 105600x2 + 13200x What is the second derivative of 525852s2 + 1065826s wrt s? 1051704 What is the second derivative of -73597b2 - 6b + 25863 wrt b? -147194 Find the third derivative of -58233x6 - 175x*2 + 10x + 1 wrt x. -6987960x3 Find the third derivative of 31f*3h*4 + 2f*3h2 - f3h + 5f*2h + 209fh*3 - 7h*4 + 7975h*2 wrt h. 744f*3h + 1254f - 168h What is the third derivative of 3a2bd3 + 184a*2d*2 + 35033ad3 + 13b + d + 2 wrt d? 18a2b + 210198a Find the second derivative of -8952hj2lp + 6hjl*2 - 4hjp - 3h + 2j*2l*2p + 5j2p - 3jl*2 - 3l*2p wrt j. -17904hlp + 4l*2p + 10p Differentiate -3q*2t*2 - 3q*2t - 32239qt*2 + 6716068t*2 with respect to q. -6qt2 - 6qt - 32239t*2 Find the first derivative of -41477r - 2657. -41477 Find the second derivative	{ "pile_set_name": "DM Mathematics" }
-2))/(0 + -1). Sort 2/9, -2, k, 74/7. -2, k, 2/9, 74/7 Let a = 0.44 + -0.6. Let g = 444 - 444. Sort a, 0.2, g. a, g, 0.2 Let d = -32 + 38. Suppose 0j = m - 3j - d, -4m + 2j = -14. Suppose 16g - 5 = 11g. Sort -1, 5, g, m. -1, g, m, 5 Let n(w) = -w*2 + 14w - 20. Let r be n(12). Let d = -615 - -626. Put r, -8/5, d in decreasing order. d, r, -8/5 Let t = 63/4 - 575/36. Let l(s) = -2s2 + 46s + 151. Let i be l(26). Sort t, i, -0.24, 9 in ascending order. i, -0.24, t, 9 Let x be (-53)/318 + (-2741)/6. Let g = -453 - x. Put g, -5, 7 in decreasing order. 7, g, -5 Suppose 4231 + 605 = -3w. Let r be w/(-6) - (-88)/66. Let d be 4 - (r/14)/5. Sort d, 0.2, -1/3 in decreasing order. 0.2, d, -1/3 Let z = -0.45475 - 0.04525. Put 24, z, 3, -2 in decreasing order. 24, 3, z, -2 Let j = -3403 + 3408. Let t = -0.5 + 0.61. Let i = t - 5.11. Sort j, i, 1. i, 1, j Let n(g) = g3 - 5g*2 + g - 3. Let w be n(5). Suppose 0 = -5s - 5x + 4765, 8x - 9x = -5s + 4735. Let o = -944 + s. Sort w, o, 0. 0, w, o Let d(r) = r - 17. Let u be d(19). Let s(w) = w - 1. Let z be s(-6). Let k be (21)/(6 + z). Put k, 4, u, -5 in ascending order. -5, k, u, 4 Let s = 5112.15 + -5112. Sort s, 5, 6/5, 2 in ascending order. s, 6/5, 2, 5 Let o = 0.34 + -1.14. Let q = 1.2 - o. Let m be (10/30)/(4 + -5). Sort -0.5, m, q, -1.2 in increasing order. -1.2, -0.5, m, q Suppose -5m + 37 = -q + 25, m + 3q + 20 = 0. Sort -1, m, 172, 5 in decreasing order. 172, 5, m, -1 Let r(z) = 5z + 29. Let k(t) = -6t - 29. Let v(s) = -3k(s) - 4r(s). Let m be v(-16). Let x = m - 4. Put -0.1, x, -0.3, -3 in increasing order. -3, x, -0.3, -0.1 Let w(t) = -26t*2 - t - 1. Let n be w(-1). Let q = 31 + n. Suppose 15p + 3p = 0. Sort q, 2, p in decreasing order. q, 2, p Suppose -1056 = 3o + 3i, o - 123i + 334 = -118i. Put 5, 4, 2, o in increasing order. o, 2, 4, 5 Let n = -92.292 + 0.292. Let i = n + 102. Sort i, 2, -2 in descending order. i, 2, -2 Let x be 1/(-2) - (-549)/(-11102)-7. Let f = 1/6 + -2/3. Sort x, 20, f, 3 in decreasing order. 20, 3, x, f Let t = 8682 - 8684. Put t, -8, -9, 0, 1 in increasing order. -9, -8, t, 0, 1 Let s = -12214.4 - -12214. Put -138, 0.4, 6, s in decreasing order. 6, 0.4, s, -138 Let p = 0.3 - 40.3. Let x = 35 + p. Let u = 156 + -158. Put 0, u, 0.1, x in descending order. 0.1, 0, u, x Suppose -2065 - 20 = 207j - 222. Sort 3, 0, j, 2, 4. j, 0, 2, 3, 4 Let v(w) = -w3 + 11w*2 + 68w - 125. Let d be v(15). Sort 4, 3782, d in increasing order. d, 4, 3782 Let t = -2.1839 + 2.3839. Put t, 0.052, 0.3, 9 in decreasing order. 9, 0.3, t, 0.052 Suppose 4t = -4p - 8, t = 5p - 2 + 6. Put 4, 1, p, -5, -155 in ascending order. -155, -5, p, 1, 4 Let t be (-1 + 2)/((-68)/(-102)(-3)/8). Put 0, 46, -2, t, 5 in descending order. 46, 5, 0, -2, t Let z be 48/(-42)3 - -4. Sort z, 14, 1 in descending order. 14, 1, z Suppose -5r + 4q - 5 = 0, -q + 4q = -4r + 27. Suppose -7t - 12t - 76 = 0. Let n be (5/(-10))/(1/(-10)). Put 1, t, n, r in increasing order. t, 1, r, n Suppose -c - 11 = -9. Let x be 47c/(-56) - 6/14. Put 2.5, x, -0.4 in descending order. 2.5, x, -0.4 Let z(t) = t*2 + 30t - 32. Let g = -582 - -551. Let q be z(g). Put 0, 1, -25, q in decreasing order. 1, 0, q, -25 Let m(q) = -2q2 + 173q + 700. Let s be m(-4). Put 0.5, s, -8, -4, 1/3 in ascending order. s, -8, -4, 1/3, 0.5 Let k = 0 + 2. Suppose 3 = i - k. Let s(b) = -10328b + 51635. Let l be s(5). Sort i, l, -2, 9 in descending order. 9, i, -2, l Let r = -2.57 + 1.31. Let x = r - -1.33. Sort 2/11, 3, x in decreasing order. 3, 2/11, x Let c = -1270 + 1268. Let u be (24/(-9))/(2/(-6)). Suppose 0 = -10m + um - 8. Sort m, 4, c in ascending order. m, c, 4 Let m = -659/2358 + 15/262. Put 0.05, m, -121 in decreasing order. 0.05, m, -121 Let o(r) = -166r - 829. Let p be o(-5). Sort p, 46, 2 in decreasing order. 46, 2, p Let r = 10940.2 - 10940. Sort 1/6, -8/11, 0.5, r in decreasing order. 0.5, r, 1/6, -8/11 Let y = 0.0545 + -1.0545. Sort -0.5, 0.2, y, 0.4, -0.3. y, -0.5, -0.3, 0.2, 0.4 Let a be 6/24/6. Suppose ak + 3 = -k. Let f(g) = g*2 + 284g + 5035. Let i be f(-19). Sort -4, i, -5, k. -5, -4, k, i Let h(y) = -y*3 + 16y*2 - 69y + 254. Let c be h(12). Let k be ((-10)/(-6))/(1/3). Sort c, k, -10, 3. -10, c, 3, k Suppose m = 3 - 5. Sort -27, 0.1, m in descending order. 0.1, m, -27 Let b(t) = -84t - 758. Let h be b(-9). Let y = 6 + -9. Sort 4, h, y. y, h, 4 Let y = 1.08 + -1.097. Let f = y + 0.317. Let g = -5 + 3. Sort 2, -3/8, g, f in increasing order. g, -3/8, f, 2 Let w be 3 + 2 + 3 + (0 - (-77)/(-11)). Sort 3, 294, w, -8. -8, w, 3, 294 Let s = -1.8 + 2. Let n = 6534 + -6534.2. Put n, s, 4, -0.1 in decreasing order. 4, s, -0.1, n Let p = 148 + -144. Suppose -597 = 4i + 7x - px, -5x + 305 = -2i. Put -4, i, 3 in descending order. 3, -4, i Let d = -1.96 - 0.04. Let r = -233/91 - -37/13. Sort -0.3, r, 2/9, d. d, -0.3, 2/9, r Let t = -246 + 245.95. Let m = t + -0.95. Put -3, m, -4, -0.2 in decreasing order. -0.2, m, -3, -4 Let m be 70/(-15) - -5 - (-1)/(-3). Suppose -3h = -mw + 4w + 57, -w = -4h. Sort -2, w, 0 in increasing order. w, -2, 0 Suppose 3q + 4l = -0q - 2, 5q = -2l + 6. Suppose 5y - 3x = -9, -qy - 2y = -2x + 6. Suppose y = -w - w + 6. Put -4, w, 0 in increasing order. -4, 0, w Let w = 0.0978 - -166.9022. Let p = -168 + w. Let x = -0.1 + 1.1. Sort 0.5, x, p in descending order. x, 0.5, p Let v(o) = -574o + 43624. Let u be v(76). Let s be 5 + (-1)/(-1)-2. Suppose -2n + 1 = s. Put n, -5, 3, u in descending order. 3, u, n, -5 Let o = -1187 + 1186.7. Let x = 340 - 9182/27. Sort o, x, -2/3. -2/3, o, x Let n be (14 + -9)2/2. Suppose -5w + 6 = 4a - 28, 0 = a - w - 4. Let k(h) = h - 18. Let l be k(19). Sort l, a, n in ascending order. l, n, a Suppose 69585y = 69615y + 30. Sort y, -3, 2, 4, -6. -6, -3, y, 2, 4 Let t = 9.4 - -624.6. Let f = 634 - t. Sort -4, f, 2/7 in decreasing order. 2/7, f, -4 Let z = -1.06 + -7.94. Let r = -26 + 11. Let k = z - r. Sort -4, 2/19, k. -4, 2/19, k Let y(c) = -104c - 4056. Let g be y(-39). Let w(v) = -v3 - 5v*2 - 3v + 5. Let j be w(-4). Let u be -2 - (-2 + j)0. Sort g, u, -4 in decreasing order. g, u, -4 Let v = -322.835 + 331.7. Let g = v - -0.135. Put g, -0.1, 1/4 in decreasing order. g, 1/4, -0.1 Let h = 0.16203 - 0.00203. Sort 4, 5, 4/3, h, -3 in descending order. 5, 4, 4/3, h, -3 Let t = 0.3 + -0.8. Let f = -178 + 187. Let i be 33/f + (-45)/27. Sort t, i, -1/4 in descending order. i, -1/4, t Let o = 46 + -92. Let m = -14185 + 14181. Sort 2, m, 2/9, o in ascending order. o, m, 2/9, 2 Let h be (2 - -4)(-5)/(-15). Suppose -2o - ho + 141 = -5a, 2o - a = 75. Put 4, o, -1 in descending order. o, 4, -1 Let t = 91.97 + 209.03. Sort t, -2/3, -1/2 in decreasing order. t, -1/2, -2/3 Let m be 5-1 - (-39 + (-3460)/(-100)). Let j = -1 + 4. Sort 0.5, j, m in descending order. j, 0.5, m Let h(k) = k2 - 57k + 452. Let b be h(10). Put b, -7, -2, -10 in descending order. -2, -7, -10, b Let y be (12/21/9)/((-2)/(-489)). Sort 5, y, 2, -4, -2 in ascending order. -4, -2, 2, 5, y Let z = 211.84 + -208.49. Sort z, 0.4, -0.1, -2, 4 in ascending order. -2, -0.1, 0.4, z, 4 Let j = -257.52 - -259.52. Let v = 0.9 + -0.4. Let c = 6 + -6.8. Sort j, -3/5, v, c in ascending order. c, -3/5, v, j Let t(d) = -d2 + 11d - 13. Let i be t(10). Let q = -12/7 + -11/14. Let v = -0.076 + 0.076. Put v, i, q in ascending order. i, q, v Let o(h) = -2h2 - 12h - 4. Let s be o(-6). Suppose 4 = -7i + 3i. Sort -2, 4, i, s. s, -2, i, 4 Let z be (-380)/90 + 2 + 2. Let j = -134 - -159. Let k = -26 + j. Sort 5, -0.02, k, z in increasing order. k, z, -0.02, 5 Let n = -5 - -4.821. Let z = -0.279 - n. Suppose 2c + 2t - 2 = 0, -2t = c - 2c - 11. Put z, -2/11, 0.1, c in increasing order. c, -2/11, z, 0.1 Suppose 0 = 10w - 8w - 6. Suppose 3p + p + 16 = 4k, -4k = -wp - 8. Suppose 0 = 17j - 8j - 18. Sort j, 5, p in decreasing order. 5, j, p Let u = 25592 + -25507.048. Let z = 83 - u. Let h = z + -0.048. Sort -1/3, h, 0.2. h, -1/3, 0.2 Suppose v + 116 = -29*v + v. Sort -2, 6, -22, v in decreasing order. 6, -2, v, -22 Let c = -47.5 - -47.9. Let w = 92 - 737/8. Put 0.3, w, 1/5, c in ascending order. w, 1/5, 0.3, c Let v(t) = -t - 1. Let z be v(-4). Let j be ((-6)	{ "pile_set_name": "DM Mathematics" }
-1/58, -2/7, -5? -1/58 Let v = 35 - 34.5. Let q = 0 - -2. Let d be 0/q - 8/(-28). What is the nearest to -1 in v, -5, d? d Let s = -80/3 - -157/6. Let r be ((-3)/2)/(-13). Which is the nearest to s? (a) -0.3 (b) 5 (c) r a Let z = -0.5 + 2.5. Let f = 3 + -2.5. Let u be (99/48 - 2)-2. Which is the closest to f? (a) z (b) 3/4 (c) u b Let d = -257.9 - -258. Which is the closest to -2/19? (a) -4 (b) -1 (c) d c Let z = -150 - -63. Let o = 88 + z. Let d = 0.7 + -0.2. Which is the closest to o? (a) d (b) 5 (c) 1 c Let i(w) = -w + 1. Let t be i(6). Let l = -5966 - -5969. What is the closest to 0.1 in t, l, -1? -1 Let q = -10 - -9.5. Let n = -2.2 - -0.2. Which is the closest to 1/4? (a) q (b) n (c) 2/3 c Let z = 0.885 + -0.685. Let g = -4 - -4.1. Let l = g + -0.5. Which is the closest to z? (a) l (b) 0.2 (c) -0.2 b Let y = 4700.07 + -4680. Let s = y - 20. Let v = -0.93 - s. What is the closest to -0.1 in v, 5, -5? v Let h = 1228 + -25784/21. What is the closest to 0 in h, -3.1, -0.5? h Let h = 34 - 39. Let x(n) = -n*2 - 5n + 5. Let k be x(-6). Let v = k - -5/7. Which is the nearest to 2/5? (a) v (b) h (c) 3 a Let g(j) = 4j + 66. Let q be g(-23). Which is the closest to 1/2? (a) -3 (b) 0.5 (c) q b Let p be -3 - -4 - 4/6. Let n = 85 + -88.7. Let d = 3.4 + n. Which is the nearest to -4? (a) d (b) 0.4 (c) p a Let r = 908 + -907.8. What is the closest to r in -2, 7, 0.1? 0.1 Let s = -878 - -3509/4. Let d = 2906/11 + -264. Which is the nearest to 1? (a) s (b) d (c) -3 b Let l = -5/24 - -1/24. What is the nearest to 0.2 in -0.6, l, -0.1? -0.1 Let n = 825 + -9901/12. Suppose -2d = -5 - 5. Which is the nearest to 2/23? (a) d (b) -5 (c) n c Let g = 6/1703 - 318491/8515. Let b = 37 + g. What is the closest to 0 in b, -1/18, 1/3? -1/18 Let f be (-26)/52 - (-1)/6. Suppose -4c = -11 - 5. What is the nearest to f in 1/2, 0.1, c? 0.1 Let m = -256/3 + 86. Let s = 38/1643 + 1693553/16430. Let v = s + -103. Which is the nearest to 0.1? (a) v (b) m (c) -0.2 a Let z be 157/3 - 1 - -2. Let o = -53 + z. Which is the nearest to o? (a) -3 (b) 22 (c) 0 c Let m = 359.96 - 360. What is the closest to -6 in m, 3, 0.4, 2/13? m Let x = -120 - -130. What is the closest to x in -2/3, 2, 0? 2 Let j = 2307 - 16145/7. What is the closest to -1/15 in 7, j, -2/21, 2/13? -2/21 Let h = -2.5 + 0.5. Let z = 112578/7 - 16083. Which is the nearest to 2? (a) h (b) -5 (c) z c Let j = -0.002 + -0.098. Which is the nearest to 6? (a) 5 (b) j (c) 2 a Let p = 45 - -23. Let k = 64 - p. Which is the nearest to -1? (a) 0 (b) 0.5 (c) k a Let q = 23 - 32. Let l = q + 6. Let u = -18 + 18. Which is the nearest to u? (a) 7 (b) -0.4 (c) l b Let h = -4.35 + 3.35. What is the nearest to -0.3 in h, 2/3, 55/2, 1? h Let p be 6/(-10)-1 - 0. Let s = 25 + -25.1. Which is the closest to s? (a) 0.3 (b) p (c) 0 c Let n be ((-836)/6)/(10/(-18)). Let q = -252 + n. Let k = 4 + -3. Which is the closest to k? (a) q (b) -3 (c) 2/3 c Let u = 127 + -507/4. Which is the closest to 1? (a) 5 (b) u (c) 1/2 c Let u = -49.079 + 0.079. Which is the nearest to 0? (a) -2 (b) 4 (c) u a Suppose 3t - 6t = -3. Let g(j) = -j - 2. Let o be g(-4). Suppose 4n = -4v - 8, ov + 2v = 4n. What is the nearest to t in 2, 0.03, n? 0.03 Let u = -101.67 - -101.67. Let z = -126 + 2648/21. Which is the nearest to 0? (a) z (b) u (c) 5 b Suppose -6n - 2 = -4n. Let t be -104/(-8)(-1)/n. What is the closest to 1 in 3/5, t, -1/5? 3/5 Let k = 15.3 + -25.4. Let r = k + 10. Let i = 14.3 - 14.7. Which is the nearest to -0.2? (a) i (b) -3 (c) r c Let d = -215 - -215. Let l = 2 + -1.7. Which is the closest to d? (a) l (b) 3/2 (c) -1/2 a Let k = 12 + -134/11. Let z(g) = g + 5. Let a be z(-3). Let s = 0.385 - 0.285. What is the closest to s in a, k, -0.3? k Let f = -3.925 - 0.075. Let d be (-18)/10 - -2 - (-49)/5. Which is the nearest to d? (a) -0.5 (b) f (c) 2 c Let j = 492 + -490. Which is the nearest to j? (a) 0 (b) 0.1 (c) -1/5 (d) 1 d Let g = -3.08 + 3.18. What is the closest to -0.1 in 0.05, g, -1/8, 1? -1/8 Let h = -318 - -318.3. Let u = 0.08 + -3.08. Which is the nearest to -9? (a) -0.2 (b) h (c) u c Let f = -2054 - -2053. Which is the nearest to -1? (a) -3.2 (b) -4 (c) f c Suppose -44n - 160 + 292 = 0. Let o(f) = f*2 - 1. Let s be o(-1). What is the closest to -1/8 in s, n, -1? s Let n = -5.77 + 5.37. Which is the nearest to 0? (a) 3/4 (b) n (c) 7 b Let j = -0.4 - -0.2. Suppose 8n - 4n = 5m - 3, -4m + 8 = -6n. What is the closest to 0 in n, j, -3? j Let p be (6/(-20))/(15/(-50)). Which is the closest to p? (a) 18 (b) -0.1 (c) 1 c Let d = -1.378 - -1.478. Which is the closest to d? (a) 3/5 (b) -1 (c) -0.5 a Let o = 4 - 6. Let p(n) = -n*3 + 9n*2 - 12n + 11. Let r be p(7). Let u = 24 - r. Which is the nearest to o? (a) u (b) -2/11 (c) 1/7 a Let u = -1561/2 - -919. Let g = 136 - u. Let d be (57/(-42) - -1)16/(-40). Which is the nearest to 0.4? (a) d (b) 3 (c) g a Let q = -1 + 0. Suppose -5u = -0u + 90. Let a be 20/u - (-2)/3. What is the nearest to q in 2/5, 2, a? a Let r = -9 + 12. Let t = -64/39 + 30/13. Which is the nearest to t? (a) r (b) 1/3 (c) -4 b Let t = -118 - -117. Let p be 35/10 + -2 + -1. What is the nearest to p in t, -0.4, 1/2? 1/2 Let u = 260 - 1298/5. What is the nearest to -0.1 in -2, u, -12? u Let p = -0.5753 - -0.0753. Which is the closest to 0.3? (a) p (b) 4 (c) -0.4 c Let t = -0.03 - 3.47. Let p = -409 + 412. Let s = p + t. Which is the closest to -0.1? (a) -1 (b) 3 (c) s c Let q = -4 - -4. Let v be (-6)/(-6) + -2 - -2. Which is the nearest to v? (a) -2/9 (b) q (c) -2 b Let t be 4/20 - 122/10. Let z be (-1)/(2 + 4/t). Let p = -1 + 1.5. Which is the closest to -0.1? (a) p (b) -2/9 (c) z b Let m = 19.9 - 24.9. Which is the nearest to 3? (a) 2 (b) 0.4 (c) m a Let y = 5.79 - -19.21. Which is the nearest to -0.1? (a) 0.1 (b) y (c) 1 (d) -2 a Let j = -5035/168 - -239/8. Which is the nearest to 1? (a) -3 (b) 4 (c) j c Let k(s) = -2s*2 - s. Let m be k(-1). Let b be 3/(42/22) - (-6 + 8). What is the closest to m in 5, 3, b? b Let f = 62 + -61.6. Let t be 3/(-45)3-2. What is the closest to t in -3, 0.5, f? f Let c = 215223/14 - 15350. Let q = c + -45/2. Let k = -0.15 - -0.2. What is the closest to 0.1 in 0, k, q? k Let f = -109/812 - 1/116. What is the nearest to 13/4 in -2/5, f, -7? f Let c = -569 + 568.5. Let q = 3.93 - -0.07. What is the closest to q in -1/6, 1, c? 1 Let z = -12.95 + 9.95. Which is the nearest to z? (a) 1 (b) 0.4 (c) -2/7 (d) -0.07 c Let d = -0.17 - 0.13. Let h = -4.11 + 0.11. Let r = h + 5. What is the closest to -1/2 in d, r, 3? d Let z = -0.18 + -1.72. Let h = 3.9 + z. Let x = -9 - -19/2. What is the closest to h in 2, x, 0.4? 2 Let l(f) = -f - 38. Let w be l(-40). What is the nearest to 0 in 2/5, 9, w, -2/15? -2/15 Let o be (-16)/(-12)(-3)/(-106). Which is the nearest to 0.1? (a) o (b) -1/6 (c) 0.2 a Let n = -9 - -5. Let r = -234 + 233.7. Which is the closest to r? (a) -0.5 (b) n (c) 1 a Let q = 9.4 + -52. Let p = q + 43. What is the closest to 0.1 in p, -0.5, -9? p Suppose 3249 = -8f + 3241. Which is the closest to 2/7? (a) 6 (b) f (c) -3/4 (d) 1 d Let f = 257 - 261. Let c = -0.5 + 1.5. What is the nearest to c in -2/3, f, 0? 0 Let g = -35.1 - -35.5. Which is the closest to 4/5? (a) 4 (b) g (c) -0.5 (d) -0.1 b Suppose 2m = -m. Let u = 17.48 - 17.48. What is the nearest to u in 0.1, m, -5? m Let l(n) = -n*2 - 34n - 140. Let b be l(-29). What is the nearest to -0.1 in -0.5, 0.04, b? 0.04 Let n = 19/10 + -2/5. Let p = 14 - 13. Let h = 0.9 - p. What is the nearest to -0.1 in 0.1, n, h? h Let z = -72 + 649/9. Suppose -2d + 8 = w, -5d + 4w - 12 + 6 = 0. Let u = 4 - 4. Which is the closest to -2? (a) d (b) z (c) u c Let n be ((-4)/20)/(5 - (-34)/(-10)). What is the closest to -3 in -2/15, n, 0? -2/15 Let t = -64 + 59.925. Let z = -0.075 - t. Which is the nearest to 0.2? (a) z (b) -2/7 (c) -4 b Let y be (15/35)/((-6)/4). Let f(i) = -i3 + 24i*2 + 26i - 25. Let x be f(25). Let m = 0.26 - 0.56. Which is the closest to y? (a) m (b) -3/4 (c) x a Let o = -0.6 + -1.2. Let t = o + -0.2. Let s = -41/2 + 21. What is the nearest to -1 in s, -3/8	{ "pile_set_name": "DM Mathematics" }
d the second derivative of u(x) wrt x. 2560 Let o be (2 - 4)1 - (-119)/17. Let x(c) be the third derivative of -23/60c*o + 0c*3 + 17c*2 + 0 + 0c + c*4. Find the second derivative of x(z) wrt z. -46 Suppose 487k - 491k = -48. What is the third derivative of 12 - 10 + km*2 + 61m*2 - 4m*4 + 3m*4 - 10m*5 wrt m? -600m*2 - 24m Let b(p) = 378p3 - 37p*2 - 6p - 2. Let y(f) = 1135f3 - 115f*2 - 21f - 6. Let s(t) = -7b(t) + 2y(t). What is the third derivative of s(a) wrt a? -2256 Let z(u) = 4892u2 - 40u + 828. Let r(j) = j*2 + 2j - 28. Let f(o) = 56r(o) + 2z(o). What is the second derivative of f(k) wrt k? 19680 Suppose 0h - 5h = -105. What is the second derivative of -13q + 11q - 2q2 + hq*4 + 14q wrt q? 252q2 - 4 Let s(m) be the first derivative of m6/2 - 15m*4/4 - 8m3/3 - m2 + 124m + 6776. Find the second derivative of s(x) wrt x. 60x*3 - 90x - 16 Let i(x) = 2004x + 552. Let a(m) = -1967m - 551. Let z(y) = -6a(y) - 5i(y). Find the first derivative of z(v) wrt v. 1782 Suppose -2g - 4m = -84, -3g + 2m + 81 = -m. Suppose 4 = 2w, -w + 0w = 2p - g. Differentiate 3 + p + 15f*3 - 5 with respect to f. 45f*2 Let n(m) = -20m - 11. Let v be n(-1). What is the third derivative of -15g - g3 - vg*4 + 3g*4 - 25g*2 + 15g wrt g? -144g - 6 Let t(z) be the third derivative of 775z*8/168 + 947z*4/24 - 1570z*2. Find the second derivative of t(d) wrt d. 31000d*3 Suppose -t = -6t. Let l be 8 + (-1)/(1/6). What is the third derivative of tr - 9r*5 - 28r*l + 0r + 35r2 wrt r? -540r*2 Suppose 7f = -756 - 1631. Let u = 499 + f. Differentiate -u + d + 3d + 160 with respect to d. 4 Let w(h) be the first derivative of 0h*4 + 80/3h*3 + 0h + 0h5 + 58/7h*7 + 219 + 0h*2 + 0h*6. What is the third derivative of w(s) wrt s? 6960s3 Let q(z) be the third derivative of -z5/15 + 7z4/12 - 703z*3/3 - 463z*2. Differentiate q(b) wrt b. -8b + 14 Let p be -60(-4 + (-28)/(-6)). Let w be p/(-24)(4 - 1). Find the second derivative of r*w - 2r*5 - 5r*5 - 18r wrt r. -120r3 Let y(i) = 4 + 5 - 4 - 192i*2 + 0 + 120i + 7. Let j(g) = -191g2 + 119g + 8. Let r(c) = -3j(c) + 2y(c). What is the second derivative of r(x) wrt x? 378 Let g(w) be the third derivative of -5w8/168 + 8w*7/21 + 1027w*5/30 + 394w*2. Find the third derivative of g(j) wrt j. -600j*2 + 1920j Suppose -2d + 0 + 6 = 0. Suppose -df = 2f - u - 1509, -2f = -3u - 614. Find the second derivative of -fb*3 + 301b*3 + 8b + 6b4 wrt b. 72b*2 Let l(f) be the second derivative of -3f*7/7 - 19f*6/30 - 369f3/2 + f2/2 - 1735f. What is the second derivative of l(q) wrt q? -360q*3 - 228q*2 Let p be 15 + 3 + -2 + -3. What is the third derivative of -12k3 + p - k4 + 11k3 - 3k*2 + 0k*2 wrt k? -24k - 6 Find the second derivative of 2d3 + 144d*5 + 68d*5 + 21d - 21 + 0d + 2d wrt d. 4240d3 + 12d Suppose -3d - 2d = -5l + 10, -3l = 4d - 13. Let c = d - -19. Differentiate 0t*3 + ct*4 - 33t*4 - 11 + 0t*3 with respect to t. -52t*3 Let z be 16048/208 - (-2)/(-13). Find the first derivative of -38j - z - 152 + 3j - 52 wrt j. -35 Suppose 10w = 7 + 23. Find the second derivative of 85sw + 21s + 13970 - s*2 - 13970 wrt s. 510s - 2 Let f(d) be the first derivative of -2559d3 - 4344d - 8921. What is the first derivative of f(u) wrt u? -15354u Let p(f) = -553f*4 + 9f*3 - 1369f + 14. Let d(r) = -553r4 + 8r*3 - 1371r + 12. Let j(i) = -7d(i) + 6p(i). Find the second derivative of j(g) wrt g. 6636g2 - 12g Differentiate -150d - 387 - 542 + 333 - 289 with respect to d. -150 Let a(g) be the second derivative of -2747g*4/6 + 696g*2 - g - 414. Differentiate a(b) wrt b. -10988b Suppose 12u = 2177 - 581. What is the third derivative of 12r*5 + 90r*5 + ur*5 + 62r*2 + 101r*2 + 24r*2 wrt r? 14100r*2 Let q(s) = -6233s*2 - 30s + 7792. Let k(i) = 8i - 1. Let o(v) = -4k(v) - q(v). Find the first derivative of o(p) wrt p. 12466p - 2 Differentiate 1491 - 544t3 - t4 + 1083t3 - 592t*3 with respect to t. -4t*3 - 159t*2 Let l(d) be the third derivative of -25d*9/72 - 77d*5/30 + 551d*2 + d. What is the third derivative of l(y) wrt y? -21000y*3 Let c(p) be the first derivative of 346p5 + p2/2 - 1603p + 837. Find the second derivative of c(h) wrt h. 20760h*2 Let i(b) be the third derivative of 23b*7/105 - 7b*6/120 - 370b*3/3 + 11b*2 - 25b. Differentiate i(x) wrt x. 184x3 - 21x*2 Let o(l) be the second derivative of 5/2l*2 - 5l*3 + 1 + 3l. Differentiate o(b) wrt b. -30 Suppose -6t = -10t + 196. Let k = 4 - 2. Find the second derivative of -6wk + tw - w*2 - 41w wrt w. -14 Let i(q) = -3q2 - 40q + 34. Let d be i(-14). What is the second derivative of 3y - 3y*4 + dy*4 - 41 + 8y4 + y3 - y - 19 wrt y? 132y2 + 6y Let v(h) = h*4 - 5h3 - h2 + h. Let m(l) = -7l4 - 158l*3 + 1146l*2 - 5l. Let p(y) = m(y) + 5v(y). Find the third derivative of p(q) wrt q. -48q - 1098 What is the third derivative of 350a - 350a + 8136a5 - 5357a*2 - 301a*5 - 791a*2 wrt a? 470100a*2 Let v(t) = 2t*4 + t. Let x(z) = -7z*4 + 3z*3 - 455z*2 - 2z + 1. Let r(g) = -2v(g) - x(g). Find the third derivative of r(l) wrt l. 72l - 18 Let o(f) = 5051f5 + 249f*2 + 49f + 9. Let z(a) = 2527a5 + 124a*2 + 24a + 4. Let k(t) = -4o(t) + 9z(t). What is the third derivative of k(i) wrt i? 152340i2 Let t(h) = 14h*2 - 2h + 2. Let c(g) = -12779g3 + 85g*2 - 12g + 343. Let p(a) = -c(a) + 6t(a). What is the third derivative of p(o) wrt o? 76674 Let d = 25 + -25. Find the third derivative of -2091p*6 + dp2 - p2 + 2137p6 + 18p wrt p. 5520p3 Let l = 6443/1487 + 2/4461. Let y(k) be the first derivative of 11/4k*4 - 8 + lk*3 + 0k + 0k2. Find the third derivative of y(f) wrt f. 66 Let i(a) = 10a3 - a2 - a + 1. Let v(c) = -12c4 - 9c*3 + 2c*2 + 9c + 2575. Let r(g) = 2i(g) + v(g). Differentiate r(q) with respect to q. -48q*3 + 33q*2 + 7 Suppose -4a = -4o - o - 10, a - 9 = -2o. Find the second derivative of -24b2 + 82b - 57b2 + 18b*o - 9b wrt b. -126 Let v(j) = 4j + 9. Let o(p) = -20p - 44. Let k(z) = -5o(z) - 24v(z). Let w be k(0). What is the third derivative of -a*w + 4a*2 + 6a*4 - 4a*4 wrt a? 24a Let y be (2 + -1)/((-14)/(-55398)). What is the second derivative of -3957 + 16p - 40p*5 + y wrt p? -800p*3 Find the second derivative of -281m - 230m3 + 12495254m*2 - 763m*3 - 12495257m*2 wrt m. -5958m - 6 Differentiate -286 - 121 - 2645 - 2484t - 749t with respect to t. -3233 Suppose 0 = 25b - 21b + 132. Let o = b - -35. What is the derivative of -6y4 - 2 - oy*3 + 2y*4 + 2y*3 wrt y? -16y*3 Let y = 103 - 97. What is the third derivative of 388x*y - 41x*2 - 186x*6 + 1 - 168x*6 wrt x? 4080x3 Let w(u) be the second derivative of -u6/15 - 69u5/5 + 7u4 + u3 + u*2 + 95u + 1. Find the third derivative of w(k) wrt k. -48k - 1656 Let p(d) be the first derivative of 6d*7/35 + 77d*5/30 + 53d*2 + 26. Let k(f) be the second derivative of p(f). Find the third derivative of k(s) wrt s. 864s Let j(y) be the second derivative of -6y + 2 + 0y5 + y3 + 1/6y4 - 3y*2 + 2/15y*6. What is the second derivative of j(t) wrt t? 48t*2 + 4 Suppose 0o - 2o = -5s - 3490, -10 = -2o. Let f be s/(-72) - 1/(-3)-2. What is the first derivative of -8 - fk - 4 - 1 wrt k? -9 Let s(b) be the third derivative of 3 + 1/24b*4 + 29/60b*5 + 11b*2 - 43/6b*3 + 0b. Find the second derivative of s(h) wrt h. 58 Let r(f) = -4986f3 - 2356f*2 + 60. Let k(w) = 9972w*3 + 4711w*2 - 140. Let x(y) = 3k(y) + 7r(y). Find the third derivative of x(c) wrt c. -29916 Let b(h) = 33h + 2228. Let z(s) = -67s - 4470. Let m(x) = 5b(x) + 3z(x). What is the derivative of m(g) wrt g? -36 What is the first derivative of -700c*3 + 1433 + 946c*3 - 659c*3 wrt c? -1239c*2 Let j(i) be the first derivative of 34i*7/7 - 13i6/6 + i3/3 + 64i2 - 611. Find the third derivative of j(s) wrt s. 4080s*3 - 780s**2 Let r(i) be the third d	{ "pile_set_name": "DM Mathematics" }
2. What is the second derivative of c(a) wrt a? -28 Let z(v) = 21v3 + v2. Let k(s) be the second derivative of -11s*5/10 - 4s. Let o(y) = 4k(y) + 5z(y). What is the third derivative of o(t) wrt t? 102 Let n = 1175/2 + -587. Let u(l) be the second derivative of 7/20l5 + l + 0l*3 + 0l*4 - nl*2 + 0. What is the first derivative of u(c) wrt c? 21c*2 Find the third derivative of -10226f + 10228f + 81f*5 + 7f*2 + 43f*2 wrt f. 4860f*2 Let s = -1 + 4. Differentiate 9 + 0u*3 - 15u*s + 35u*3 with respect to u. 60u*2 Let l(k) be the first derivative of 11k*5/20 + 11k*4/4 - 31k - 16. Let c(q) be the first derivative of l(q). Find the third derivative of c(v) wrt v. 66 Let x(o) = -2o - 3. Let m be x(-3). Find the second derivative of -qm + 4q*5 + 14q*5 - 15q + q*3 wrt q. 360q*3 Let r(m) = 1539m*2 - 1537m + 16. Let q(x) = -513x2 + 512x - 6. Let l(s) = 8q(s) + 3r(s). What is the second derivative of l(f) wrt f? 1026 Let h(o) be the third derivative of o6/30 - o5/60 - 2o3/3 + 43o*2. Find the first derivative of h(k) wrt k. 12k*2 - 2k Let l be (6/15)/(2/10). Suppose -9 + 13 = lz. What is the second derivative of 2x*2 - 5x + 7x5 + 0x*z - 2x*2 wrt x? 140x*3 Let p(h) = -5h + 4. Let r(s) = -s*2 + 6s - 4. Let c be ((-6)/7)/(24/(-84)). Let z = 3 + c. Let i(v) = zp(v) + 5r(v). What is the derivative of i(x) wrt x? -10x Let d = 858 + -103. Find the third derivative of 9s*4 + 755 - d + 16s*2 wrt s. 216s Suppose 0 = 2t + 3 - 59. Let y be t/8(-10)/(-7). Find the third derivative of a*2 - ya*2 - 12a*4 - 8a*2 wrt a. -288a Let z(q) be the third derivative of -68q5/15 - q4/4 - 11q*3/6 - 2q*2 + 93q. What is the second derivative of z(h) wrt h? -544 Let x(w) be the first derivative of -w10/1260 + w6/360 - 7w3 - 2. Let q(b) be the third derivative of x(b). Find the third derivative of q(i) wrt i. -480i*3 Suppose d - 2m = 2, 7 = 5d - 4m - 3. Find the third derivative of 19u6 - 18u*6 + 0ud + u2 wrt u. 120u3 Let x(z) be the first derivative of 61z*4/2 + 112z3/3 - 63. Find the third derivative of x(c) wrt c. 732 Let h(b) = b3 - b*2. Let c be h(1). Suppose 3v = -cv + 6. Find the third derivative of 0z*5 + 4z5 - z5 + vz2 wrt z. 180z*2 Let s(p) = 46p - 51. Let x(t) = -2t + 3. Let i be x(5). Let b(z) = -23z + 25. Let n(o) = ib(o) - 4s(o). Differentiate n(k) with respect to k. -23 Let s(f) = -10f - 5. Let a(v) be the third derivative of -11v4/24 - v3 - 2v2. Let n(u) = -6a(u) + 7s(u). Differentiate n(d) with respect to d. -4 What is the third derivative of 70t*3 + 2t*3 + 36t*3 - 61t*2 - 9t*3 wrt t? 594 Let u(x) be the first derivative of 7x*4/12 + 37x*3/6 + 23x - 4. Let t(p) be the first derivative of u(p). What is the second derivative of t(b) wrt b? 14 Let m = -117 - -122. Find the third derivative of -l*5 - 4l*5 - 53l*2 - 232l + 234l + ml*4 wrt l. -300l*2 + 120l Let j(f) = -331f3 + 124f*2 - 9f. Let k(r) = 83r3 - 31r*2 + 2r. Let m(o) = 2j(o) + 9k(o). What is the third derivative of m(i) wrt i? 510 Let t be (-5)/(-15)13. Let m be (3/6)/(t/6). What is the third derivative of -4u4 - mu*4 + 3u*2 - 8u*2 + 2u*4 wrt u? -120u Let w(g) be the third derivative of 553g5/60 - 238g*3/3 + 475g*2. Differentiate w(j) with respect to j. 1106j Let x(j) be the second derivative of -557j6/30 - 295j*3/6 - 173j. Find the second derivative of x(p) wrt p. -6684p2 Let i(w) be the first derivative of 0w + 5 - 1/4w4 + 7/3w*3 + 0w*2. What is the third derivative of i(x) wrt x? -6 Let s(p) be the first derivative of -17/2p*2 + 11/3p*3 + 0p - 7. What is the second derivative of s(f) wrt f? 22 Differentiate -7 - 10j3 - j2 + 1 + 1 + 3 wrt j. -30j*2 - 2j What is the third derivative of 12u2 - 245u*2 + 21 - 36 + 137u*4 + 15 wrt u? 3288u Let s(f) = -f*2 - 1 - 6f + 2 + 4. Let h be s(-6). What is the third derivative of t*4 + 2t*2 - 8t*4 + ht*2 - 2t*2 wrt t? -168t Let q(t) = t*3 - 2t*2 - 5t + 2. Let a be q(4). Let y = -12 + a. Find the second derivative of -4dy + 2d + 3d - 6d wrt d. -8 Let c(y) = -49y3 - 5y*2 - 6y - 4. Let x(m) = 393m3 + 39m*2 + 48m + 33. Let l(o) = 33c(o) + 4x(o). What is the third derivative of l(d) wrt d? -270 Let t(h) be the first derivative of 3h8/28 - h4/4 + 8h + 9. Let q(o) be the first derivative of t(o). What is the third derivative of q(j) wrt j? 720j3 What is the third derivative of -58b*2 - 81b5 - b3 + 161b5 - b3 wrt b? 4800b*2 - 12 Suppose -4q + 3m + 473 = 0, 0 = -q + 4m + 168 - 53. Let p be q/21 - (-4)/(-6). What is the second derivative of -26 + 26 - 6y5 + py wrt y? -120y3 What is the second derivative of 59u*3 - 189u + 56u3 - 146u*3 + 57u*3 wrt u? 156u Let c(n) be the first derivative of n*6/3 + 11n*4/4 + 111n*2/2 - 44. What is the second derivative of c(w) wrt w? 40w*3 + 66w Let t(b) = b*2 + 1. Suppose 0 - 6 = -3i. Let z be t(i). Find the third derivative of 6g5 + 2g2 - 2 + 2 - gz wrt g. 300g2 Let u(m) be the third derivative of 0 + 4m*2 + 11/120m*6 + 0m*4 + 0m*3 + 3/10m*5 + 0m. Find the third derivative of u(y) wrt y. 66 Let o(d) = d - 7. Let w be o(12). Suppose -u = u + h, -2 = wu + 3h. What is the second derivative of up3 - 33p + 29p - 3p*3 wrt p? -6p Suppose -10i + 120 = -6i. Differentiate -6w2 - 2w*2 - 3w*2 + i with respect to w. -22w Let u be (-3 - -2) + -21 + 25. Let w(f) be the first derivative of 0fu + 0f + 9 + 3/2f2 + 7/4f*4. Find the second derivative of w(g) wrt g. 42g Let f(t) be the second derivative of 9t5/5 + 33t*2 + 85t. What is the first derivative of f(y) wrt y? 108y2 Let a(z) be the second derivative of z6/30 - 11z5/10 - z4/3 - 4z2 + z - 59. Find the third derivative of a(x) wrt x. 24x - 132 Let r be (21/9)/((-6)/(-36)). What is the second derivative of 9y + ry*2 + 15y*2 - 38y*2 wrt y? -18 Suppose -23l + 95 = 72. Let s(o) be the first derivative of 9/2o2 - 4o + l. Differentiate s(v) wrt v. 9 Let m = -18 + 23. Let q(i) be the first derivative of -mi + 0i*4 + 2/5i*5 + 2 + 0i*2 + 0i*3. Differentiate q(l) with respect to l. 8l3 Let n(x) = -x3 - 2x2 + 5x. Let m be n(-4). Let u be (m/2)/(15/10). What is the third derivative of -6i2 - 5i*4 + 6i*4 + 3i*u wrt i? 96i Let x = -77 + 79. Differentiate 3yx + 5y*2 - 13y*2 + 4 wrt y. -10y Let c(l) be the second derivative of l6/5 + l4/12 + 41l3/6 + l2 + 2l - 52. What is the second derivative of c(y) wrt y? 72y2 + 2 Suppose 0 = -5n + 4j - 2j + 52, -8 = -n - 2j. Differentiate nd*4 - 15d*4 + 12d*4 + 14 with respect to d. 28d3 Let k(p) be the second derivative of p5/20 - p*4/4 - 10p*3 + 71p. What is the second derivative of k(v) wrt v? 6v - 6 Let z(r) be the third derivative of -r8/56 + 8r7/35 + r4/3 + 16r3/3 - 161r*2. What is the second derivative of z(q) wrt q? -120q*3 + 576q*2 Suppose 3r = -2r + 140. Find the third derivative of 14p*5 - 2 - 22p*2 + 2 + rp*2 wrt p. 840p2 Let r(w) = -w3 + 5w2 - w - 8. Let v be r(4). Differentiate 27m*4 - 31m*v - 22m*4 - 38 wrt m. -104m3 Let d(m) be the first derivative of m6/3 + 43m4/4 - m2 - 13m + 31. What is the second derivative of d(p) wrt p? 40p3 + 258p Let s(c) be the first derivative of 0c3 + 6c*2 + 11 + 9/4c*4 + 0c. Find the second derivative of s(j) wrt j. 54j Let y(o) be the third derivative of 7o*6/120 + 77o*5/60 - 4o2 - 4. What is the third derivative of y(j) wrt j? 42 Let p(h) = h3 - 3h2 - 6h + 1. Let c be p(5). Let s be -3 - -2c/6. What is the first derivative of 3d*s - 3 - 7d*4 + 1 + 5 wrt d? -16d*3 Let t(c) = 17c + 46. Let w(p) = 6p + 15. Let r(g) = 3t(g) - 8w(g). Let i(q) = 6q + 35. Let a(u) = 4i(u) - 9r(u). Differentiate a(z) wrt z. -3 What is the third derivative of -62d4 + 8 - 4d*5 - 1 + 0d*5 + 1 + 5d*4 + 17d*2 wrt d? -240d*2 - 1368d Suppose 28 = -0q + 4q. Let f = -2 - -5. Differentiate qk3 - 1 - f - 3k*3 - 3k*3 with respect to k. 3k**2 Suppose -18 = 1	{ "pile_set_name": "DM Mathematics" }
n. 2 Express (1 - 1 + f)(f - f - 2f) - 327f2 - 1125f*2 + 99f*2 in the form xf*2 + c + zf and give c. 0 Express -25k + 90k*2 + k + 5k + 4k + 3k as j + sk + ok*2 and give s. -12 Express (3 + 2 - 2)(-79559 - 11632j + 79559) as gj + v and give g. -34896 Rearrange -q + 3 - 67q3 + 0 + 1207q*4 - 592q*4 - 613q*4 to the form dq*2 + kq + jq4 + xq*3 + p and give p. 3 Rearrange -8 + 2u + u - u*3 - 2u + 0u + (-25u - 9u2 + 25u)(5u - u - 2u) to xu*3 + tu + lu2 + y and give t. 1 Express 2109l*2 + 811l*2 + 444l*2 - 211l*2 - 119l*2 as bl*2 + q + zl and give b. 3034 Rearrange 3i + 6i*2 + 431 + 108 - 7i*2 + 58 to the form li*2 + q + bi and give l. -1 Rearrange 4b3 + 1 - 2b*3 + 8637b*4 + 3b*2 - 8633b*4 to the form mb*4 + pb*3 + ub + yb2 + i and give p. 2 Express 15510r*2 - 7751r*2 - 7747r*2 + 977r in the form z + hr + sr*2 and give h. 977 Rearrange -51t*4 - 2t*4 + 35t*4 - 4t*2 + 19t*4 - t + 2t*3 to rt*3 + st*4 + nt + y + ut2 and give u. -4 Rearrange 28064n + 641406951 - 641406951 + (n - 3n + n)(4 - 3 + 1) to the form u + an and give a. 28062 Express -203l - 2947l + 1238 + 1232 - 2470 in the form al + n and give a. -3150 Express -74m3 - 890m + 2m4 + 80m*3 + 887m - 9 as qm3 + sm*2 + gm*4 + k + nm and give q. 6 Rearrange -1260979p + 2924p*2 + 1260979p to cp2 + gp + q and give c. 2924 Express (10a + 16a - 5a + (41a - 20a + 29a)(1 + 2 - 5))(-5 + a + 4 + 3) as za2 + ca + t and give z. -79 Express -9l2 + 7l*2 + 10l*2 - 7l*2 + 1231l in the form ol + kl*2 + y and give o. 1231 Rearrange (2 - 3 + 3)(0c - 4c - 4c) + (-2 - 2 + 5 + (-10 + 4 + 7)(-2 - 2 + 1))(5c - 2c - c) to hc + j and give j. 0 Rearrange -610p + 924p - 773p to o + jp and give j. -459 Express (-48t - 19 + 12 + 7)(19 - 4 - 7)(82 - 6 + 64) as u + kt and give k. -53760 Express -23f2 - 3 - 2f*3 - 106f + 3f3 + 108f - 46f in the form jf*3 + t + af*2 + hf and give a. -23 Rearrange -903v2 + 73v*3 - 40v*3 - v - 29v*3 - 619v*2 to the form uv*3 + pv*2 + r + wv and give p. -1522 Express (2x - 2 - 4x + x + (-3x - x + 2x)(0 + 0 - 1) - x + 0 + 0 + 2x - x + x)(-22 - 366x + 21 + 419x) as vx + ux2 + b and give u. 106 Express (-2 + 5 + 8)(-113 + 46 - 57 - 132)(11 - 11 - 4v) in the form nv + x and give n. 11264 Rearrange 6h - 2h + 4h + (-1 + 6 - 2)(20h + 27h - 63h) to the form g + fh and give f. -40 Express 15k*2 + 11 - 9k*2 - 4k*2 + (-2k + 2k - 4k)(10 - 20 - 13k + 12) in the form u + wk2 + sk and give w. 54 Rearrange -4835z - 4818z + 9647z - 42 to rz + a and give a. -42 Rearrange 945 + 277a2 - 472 - 471 to the form u + ca*2 + ma and give m. 0 Rearrange (-w + 2w + w)(1 - 1 + w)(0w - 1010w2 + 9w - 1130w2 + 2459w*2) to the form hw*3 + sw*4 + a + tw + gw2 and give h. 18 Express -112w*3 + 4 - 194w*2 + 107w*3 + 114w*2 as vw*3 + s + aw*2 + lw and give a. -80 Rearrange 2615y - 5092y - 3965y to the form ny + q and give n. -6442 Rearrange u - 2u + 5u + (6426 - 6426 + 367u)(8 - 5 - 7) to the form tu + p and give t. -1464 Express -55p + 33 + 39p + 13p + (4 - 2 + 1)(3 - 3 + 2)(4p - 4p - 3p) as d + vp and give v. -21 Rearrange -11t + 2371 - 781 - 785 - 789 to the form pt + w and give w. 16 Rearrange -p*3 - 3103p + 35 - 40 + 3103p + 246p*2 to ip + ap2 + m + qp*3 and give q. -1 Express (2i*2 + 0i*2 + 2i*2)(0 + 1 + 0 + (-3 + 5 + 2)(-4 + 6 + 0) + (-2 + 2 + 2)(-1 + 1 + 1)) in the form vi + ti2 + g and give t. 44 Express 7 + 1 - a - a2 - 3 - a*3 + 6a + 9a as ia*2 + ta + y + oa3 and give t. 14 Rearrange (-5745i*3 - 1042i*3 - 23 + 23)(-4 + 4 - 4) to the form o + ri + pi*3 + hi*2 and give o. 0 Express 2080m*3 - 1556m*3 + 29m*2 - 36m*2 as u + zm*2 + wm + km3 and give z. -7 Rearrange -490t - 514t - 2t*3 - 1 - 190t*4 + 1016t to the form wt2 + pt*4 + v + bt*3 + ut and give v. -1 Rearrange (3 + 68r - 79r - 1)(-329 - 70 - 256) to the form u + vr and give u. -1310 Rearrange -938y2 + 141y + 159y2 - 143y to the form ay + k + wy*2 and give w. -779 Express 204g + 223g - 2 + 2g*4 - 353g + 4g3 - 2g*2 in the form ag*4 + ig + ug3 + f + wg*2 and give w. -2 Rearrange -1 - 1413l - 3 + 4 - 3397l to the form n + wl and give w. -4810 Rearrange -1492y - 5 - 20 + 25 to v + ky and give k. -1492 Rearrange -6261d + d4 + 0d2 - 2 + d2 + 5172d to the form ud*2 + pd + w + nd3 + id*4 and give p. -1089 Express -1348h*2 - 109h*2 - 3089h*2 - 1071h*2 - 604h*2 in the form ch*2 + bh + n and give c. -6221 Express (-184 + 184 + p*2)(-173 + 173 - 213p) + 5p*3 + 0p*3 - 4p*3 in the form cp + sp3 + jp*2 + d and give s. -212 Rearrange 7n - 2n - 2n + (-3 - 3 + 5)(-n + 0n + 2n) - 1134n - 1136n + 2341n + 24 - 3n - 24 to the form dn + x and give d. 70 Rearrange (330 - 244 - 185)(-3g - 2g2 + 3g) - g*2 + 2g*2 - 2g*2 to the form ng*2 + m + zg and give n. 197 Rearrange -29085w + 8070946 - 8070946 to k + fw and give f. -29085 Rearrange -115 + 6839o + 115 + 6642o to the form v + ro and give r. 13481 Rearrange 360z*2 - 144z*2 + 2z - 9851 - z*3 + 9848 to the form hz*3 + o + rz + lz2 and give l. 216 Rearrange -7d*4 + 282d - 139d - 93 - d3 + 178 - 142d - 18d2 - 91 to z + ld*4 + md*2 + od + ud3 and give m. -18 Rearrange -238a - 155812 + 155812 + (0a + 3a - 5a)(1 + 2 - 1) - 5a - 5a + 3a to the form n + ma and give m. -249 Express -659 + 691 - r + r*2 + r in the form br + z + yr2 and give z. 32 Express (4 - 1 - 1)(30l - 10271l*2 + 108l - 137l) + 2l*2 + 0l + l + l in the form cl + bl*2 + h and give h. 0 Express -1 - 907h + 1769h + 4h*2 + 21h*3 + 2 - 888h in the form m + ch + wh*2 + bh*3 and give b. 21 Rearrange -15s*2 - 5s + 5s2 + 73 + 3s*4 - 231 + 81 + 15s*3 + 76 to cs*2 + gs + bs3 + j + ds*4 and give b. 15 Rearrange (27a*2 + 29a*2 + 60a*2)(0a2 - 2a*2 + 4a*2) + (8 - 19 - 4)(-2a3 + a4 + 2a*3) to ra*3 + va*4 + x + za + qa2 and give v. 217 Rearrange -1562g + 7148g + 3516 - 3516 to a + qg and give q. 5586 Express -1925 + 3s + s3 + 3814 - 5s4 - s3 - 1955 in the form vs4 + rs*2 + ws + as3 + u and give v. -5 Rearrange -174b*2 - 1952b + 1959b + 10b*2 to the form i + nb + fb2 and give n. 7 Rearrange 0 - 174t - 1514t + 0 to the form o + ft and give f. -1688 Express -81423866 - 10620u + 81423866 as hu + z and give h. -10620 Express -1636x3 - 219x*3 + 8762x3 + (-x3 + 2x3 - 2x*3)(2 + 0 - 3) in the form rx3 + cx + ux2 + b and give r. 6908 Express 20 - 4w + 362 - 52 + 5w + 2w in the form r + hw and give h. 3 Rearrange -7340j + 7340j - 9 - 63j*2 to lj*2 + f + kj and give l. -63 Express 56n - 29n*3 - 13n + 1 - n*2 + 6 - 33n*3 - 46n as pn + d + jn*2 + an*3 and give a. -62 Rearrange 12 - 3b*4 - 1 - b + 0b*2 - 3b*2 - 10 - 16b*3 to tb*4 + w + hb*3 + ob*2 + qb and give h. -16 Express -v*2 - v + 3v*2 + 0v*2 + (-3v - v + 6v)(-1 + 1 + 2v) - 81 + 81 - 77v*2 + 11v*2 + 12v*2 - 14v*2 as ov*2 + iv + p and give i. -1 Rearrange 460z3 + 23z*4 + 11z - 3z + 3z - 463z3 - 26z*4 to the form jz*3 + tz*4 + iz*2 + pz + a and give a. 0 Rearrange (347j - 58155 + 1746j + 58153)(j + 5j - 2j) to dj*2 + vj + l and give v. -8 Rearrange 228p4 + p3 + 6 - 399p*4 + 172p*4 + 270p to the form s + yp2 + jp*3 + op*4 + rp and give j. 1 Express 44124z - 4 + 3 - 89079z + 44594z in the form y + iz and give y. -1 Express 2u4 - 37u - 104u3 - 15u + 2u2 + 11u + 102u3 in the form ou*3 + ku*4 + gu + c + mu2 and give k. 2 Rearrange -122g*3 + 944 + 125g*3 - 17 to hg*2 + ng*3 + fg + o and give n. 3 Express 33b4 - 3b*3 + 5b*3 - 4b*2 - 4b*3 - b + 8b*2 in the form ab*4 + fb + db2 + jb*3 + r and give j. -2 Rearrange (25511 + 5008 + 16134)(1 + m*2 - 1) to d + jm + gm2 and give g. 46653 Rearrange (-6 - 12 + 37)(-3 - 2 + 3)*(-55	{ "pile_set_name": "DM Mathematics" }
er 4:44 PM? 7:18 PM How many minutes are there between 6:34 AM and 4:21 PM? 587 How many minutes are there between 3:07 AM and 2:32 PM? 685 What is 406 minutes before 4:47 AM? 10:01 PM What is 699 minutes before 5:31 PM? 5:52 AM What is 152 minutes after 4:33 AM? 7:05 AM What is 236 minutes after 2:33 PM? 6:29 PM How many minutes are there between 3:33 PM and 8:54 PM? 321 How many minutes are there between 10:35 PM and 9:54 AM? 679 What is 485 minutes after 11:59 AM? 8:04 PM What is 274 minutes after 5:03 AM? 9:37 AM What is 354 minutes before 8:35 PM? 2:41 PM What is 687 minutes after 2:32 AM? 1:59 PM What is 691 minutes before 4:04 PM? 4:33 AM What is 292 minutes before 7:30 PM? 2:38 PM What is 444 minutes after 4:53 AM? 12:17 PM What is 719 minutes after 7:08 PM? 7:07 AM What is 423 minutes after 12:04 PM? 7:07 PM What is 342 minutes after 11:57 AM? 5:39 PM What is 573 minutes before 6:12 PM? 8:39 AM What is 103 minutes before 8:10 PM? 6:27 PM How many minutes are there between 11:15 AM and 10:10 PM? 655 What is 376 minutes after 5:24 PM? 11:40 PM What is 685 minutes before 8:47 PM? 9:22 AM What is 588 minutes before 4:55 AM? 7:07 PM What is 543 minutes after 5:11 AM? 2:14 PM What is 121 minutes before 1:36 AM? 11:35 PM How many minutes are there between 3:54 PM and 11:06 PM? 432 How many minutes are there between 11:35 AM and 6:36 PM? 421 What is 439 minutes after 8:21 AM? 3:40 PM What is 535 minutes before 12:23 PM? 3:28 AM How many minutes are there between 6:31 PM and 9:07 PM? 156 How many minutes are there between 9:46 PM and 3:40 AM? 354 How many minutes are there between 2:37 PM and 1:20 AM? 643 How many minutes are there between 11:20 AM and 5:36 PM? 376 How many minutes are there between 6:04 PM and 9:59 PM? 235 How many minutes are there between 11:18 PM and 9:15 AM? 597 What is 448 minutes after 11:50 PM? 7:18 AM How many minutes are there between 5:55 PM and 5:00 AM? 665 How many minutes are there between 7:14 PM and 11:25 PM? 251 How many minutes are there between 12:23 AM and 7:32 AM? 429 How many minutes are there between 11:59 AM and 9:11 PM? 552 What is 657 minutes before 1:04 AM? 2:07 PM What is 331 minutes after 5:22 AM? 10:53 AM How many minutes are there between 10:48 PM and 1:00 AM? 132 What is 679 minutes after 3:57 PM? 3:16 AM What is 120 minutes after 6:32 PM? 8:32 PM What is 643 minutes before 9:14 AM? 10:31 PM How many minutes are there between 8:42 AM and 4:42 PM? 480 What is 292 minutes after 6:41 AM? 11:33 AM What is 145 minutes before 9:01 PM? 6:36 PM How many minutes are there between 10:40 PM and 12:43 AM? 123 How many minutes are there between 6:01 PM and 7:32 PM? 91 How many minutes are there between 3:02 PM and 8:27 PM? 325 How many minutes are there between 7:54 AM and 1:14 PM? 320 What is 418 minutes before 6:15 AM? 11:17 PM How many minutes are there between 8:18 AM and 5:54 PM? 576 How many minutes are there between 12:24 PM and 10:34 PM? 610 How many minutes are there between 2:32 AM and 5:00 AM? 148 How many minutes are there between 11:48 PM and 1:24 AM? 96 What is 186 minutes before 5:53 PM? 2:47 PM How many minutes are there between 1:51 PM and 3:02 PM? 71 What is 719 minutes before 2:41 AM? 2:42 PM How many minutes are there between 1:35 AM and 10:02 AM? 507 How many minutes are there between 11:42 AM and 4:21 PM? 279 How many minutes are there between 7:14 AM and 5:39 PM? 625 How many minutes are there between 7:07 AM and 9:08 AM? 121 How many minutes are there between 5:28 PM and 6:28 PM? 60 How many minutes are there between 5:59 AM and 5:27 PM? 688 What is 446 minutes after 12:02 AM? 7:28 AM What is 255 minutes before 4:30 AM? 12:15 AM What is 428 minutes after 6:24 PM? 1:32 AM What is 4 minutes after 4:44 AM? 4:48 AM How many minutes are there between 4:38 AM and 6:09 AM? 91 How many minutes are there between 1:25 AM and 5:28 AM? 243 What is 20 minutes before 11:11 PM? 10:51 PM What is 173 minutes before 1:56 PM? 11:03 AM How many minutes are there between 1:00 AM and 12:43 PM? 703 What is 62 minutes before 11:51 AM? 10:49 AM What is 102 minutes before 6:05 AM? 4:23 AM What is 453 minutes after 5:10 PM? 12:43 AM What is 175 minutes before 11:52 PM? 8:57 PM How many minutes are there between 7:29 PM and 12:32 AM? 303 How many minutes are there between 12:18 AM and 10:38 AM? 620 How many minutes are there between 3:51 AM and 2:34 PM? 643 How many minutes are there between 5:30 AM and 8:04 AM? 154 How many minutes are there between 3:39 AM and 11:33 AM? 474 How many minutes are there between 7:43 PM and 7:03 AM? 680 How many minutes are there between 12:32 AM and 2:56 AM? 144 What is 130 minutes before 9:59 PM? 7:49 PM What is 388 minutes before 12:16 PM? 5:48 AM How many minutes are there between 8:21 AM and 6:44 PM? 623 What is 398 minutes before 8:57 AM? 2:19 AM How many minutes are there between 4:12 PM and 1:55 AM? 583 What is 394 minutes after 12:48 AM? 7:22 AM What is 374 minutes after 4:08 AM? 10:22 AM How many minutes are there between 12:12 AM and 9:29 AM? 557 What is 289 minutes after 6:32 PM? 11:21 PM How many minutes are there between 3:50 PM and 1:28 AM? 578 What is 552 minutes before 2:52 AM? 5:40 PM What is 583 minutes before 12:53 AM? 3:10 PM How many minutes are there between 4:26 PM and 6:29 PM? 123 What is 89 minutes before 11:04 AM? 9:35 AM What is 557 minutes before 4:54 AM? 7:37 PM How many minutes are there between 3:10 AM and 11:22 AM? 492 What is 419 minutes before 1:17 PM? 6:18 AM What is 532 minutes after 9:24 PM? 6:16 AM How many minutes are there between 3:19 AM and 10:27 AM? 428 What is 19 minutes after 7:50 AM? 8:09 AM How many minutes are there between 9:55 PM and 11:02 PM? 67 What is 707 minutes before 11:14 AM? 11:27 PM What is 597 minutes before 12:40 PM? 2:43 AM How many minutes are there between 3:56 AM and 11:20 AM? 444 How many minutes are there between 3:04 AM and 8:29 AM? 325 What is 82 minutes after 11:57 PM? 1:19 AM How many minutes are there between 11:53 PM and 1:54 AM? 121 What is 457 minutes before 1:28 PM? 5:51 AM What is 107 minutes after 9:01 AM? 10:48 AM How many minutes are there between 12:58 PM and 1:04 PM? 6 How many minutes are there between 4:17 AM and 12:22 PM? 485 How many minutes are there between 11:43 AM and 3:06 PM? 203 How many minutes are there between 8:57 PM and 9:41 PM? 44 How many minutes are there between 7:15 AM and 5:07 PM? 592 What is 490 minutes after 5:19 AM? 1:29 PM What is 568 minutes after 6:01 PM? 3:29 AM How many minutes are there between 7:37 AM and 11:08 AM? 211 How many minutes are there between 1:20 PM and 2:00 PM? 40 How many minutes are there between 11:54 PM and 7:03 AM? 429 How many minutes are there between 7:01 AM and 1:32 PM? 391 What is 670 minutes after 10:19 AM? 9:29 PM What is 391 minutes after 7:29 AM? 2:00 PM How many minutes are there between 6:25 PM and 10:23 PM? 238 How many minutes are there between 8:21 AM and 10:03 AM? 102 How many minutes are there between 9:18 PM and 5:31 AM? 493 What is 416 minutes before 5:11 PM? 10:15 AM What is 337 minutes after 1:19 AM? 6:56 AM How many minutes are there between 3:46 AM and 1:27 PM? 581 How many minutes are there between 10:45 PM and 2:07 AM? 202 How many minutes are there between 7:17 PM and 4:30 AM? 553 What is 332 minutes before 1:52 AM? 8:20 PM How many minutes are there between 4:21 PM and 9:24 PM? 303 How many minutes are there between 1:59 AM and 6:33 AM? 274 How many minutes are there between 7:46 PM and 5:06 AM? 560 What is 173 minutes before 7:37 PM? 4:44 PM How many minutes are there between 9:34 PM and 5:12 AM? 458 What is 145 minutes before 1:27 PM? 11:02 AM What is 507 minutes after 7:46 PM? 4:13 AM What is 152 minutes before 4:15 PM? 1:43 PM What is 243 minutes after 4:09 AM? 8:12 AM How many minutes are there between 12:22 PM and 12:55 PM? 33 What is 687 minutes after 7:58 PM? 7:25 AM How many minutes are there between 6:33 AM and 10:58 AM? 265 What is 704 minutes after 7:22 AM? 7:06 PM How many minutes are there between 12:35 AM and 10:07 AM? 572 What is 332 minutes before 11:02 PM? 5:30 PM What is 244 minutes after 4:32 AM? 8:36 AM How many minutes are there between 3:56 PM and 8:26 PM? 270 How many minutes are there between 2:1	{ "pile_set_name": "DM Mathematics" }
(5 + 0 + sqrt(539))) + sqrt(539))-3)2)-2. 2688sqrt(11) + 165734 Simplify -6(2sqrt(192)-1 + -5(2 + sqrt(192)))2 + 5. -57043 - 6720sqrt(3) Simplify (5sqrt(1764)-4)/(5sqrt(192)2 + sqrt(192)) + 1. -35sqrt(3)/11 + 1 Simplify ((sqrt(500) + 0 + sqrt(500) + 1)-2)*2 + -1 + (-5 + (sqrt(500) - (0 + sqrt(500) + 2))6)*2. 160sqrt(5) + 8292 Simplify ((2-1-1sqrt(65)2)/(3(sqrt(5) - sqrt(10)/sqrt(2)) - (sqrt(125)1 + sqrt(5))))*2. 52/9 Simplify (6-2(-3(5 + 0 + (1 + sqrt(432))4) + -4)3)*2. 11570688sqrt(3) + 81867024 Simplify (1 + -6(sqrt(432) + -1) - (4 + (sqrt(432) - (-4 + sqrt(432) + -2))2))24. -576sqrt(3) - 264 Simplify ((((sqrt(72) - (2sqrt(72)-4 - sqrt(72)))/sqrt(6))/(sqrt(294) - 4(sqrt(294) + (sqrt(294)-2 - sqrt(294)))) + 1)2)2. 80sqrt(2)/63 + 16676/3969 Simplify ((sqrt(16) + sqrt(16)2)/sqrt(2))2 + (-1 + sqrt(648) - sqrt(648)) + 5 + (-1sqrt(4050))*2. 4126 Simplify -4(3 + (1 + sqrt(1216))5 + (sqrt(1216) - (sqrt(1216) + 1 + sqrt(1216) + -2)) + 2 + (sqrt(1216) - (sqrt(1216) + 0)) + sqrt(1216) + -5)2. -121744 - 1920sqrt(19) Simplify 4(-4 + sqrt(272) + -2)-6 - ((-4-1sqrt(204))/sqrt(12) + (5(-2 + sqrt(51)/sqrt(3)))2). -381 Simplify (sqrt(18) - (sqrt(2592) + sqrt(2592)1 + sqrt(2592)))/((sqrt(72)1)/sqrt(8)) - (sqrt(18) + -2sqrt(72) + 0)*2. -162 - 35sqrt(2) Simplify (((sqrt(700)-2 + 0 - sqrt(700)) + -4 + (sqrt(700)-2 - sqrt(700)))2 + (0 + sqrt(700))1 + sqrt(700)-3 + 3)2. 1400sqrt(7) + 137225 Simplify (-22sqrt(684) + (sqrt(304) - (sqrt(304) + 0)) + (sqrt(19) - sqrt(133)/(sqrt(7)-2)))2 + 1(0 + 1 + sqrt(304)) + -4. 4sqrt(19) + 38463/4 Simplify (4-4-2sqrt(512))/((sqrt(400)2)/(sqrt(8)/(sqrt(2)2))). 64sqrt(2)/5 Simplify -1 + sqrt(34)/(sqrt(2)-2) + 2 + (-21sqrt(34))/(6(sqrt(2) + sqrt(6)/sqrt(3))). -2sqrt(17)/3 + 1 Simplify ((-3 + -4 + (-4(0 + sqrt(450) + sqrt(450)) - sqrt(450)) + (-1 + sqrt(450))2 + sqrt(450))*2 + 0)-6. -97686 - 9720sqrt(2) Simplify (-5 + sqrt(2)1 - (1sqrt(12))/sqrt(6) - sqrt(8)/sqrt(4)-32 - -1(3 + -2sqrt(162) + -5))2. 168sqrt(2) + 337 Simplify ((-5(-2 + sqrt(1700)))2 + 2 + ((1sqrt(68) - sqrt(68))*2 - sqrt(68)) + 4)-2. -85212 + 2004sqrt(17) Simplify -6-1(sqrt(275) + 3 + -1 + 3)4. 120 + 120sqrt(11) Simplify ((sqrt(112)-16)/sqrt(4)4)/(-3sqrt(100) - sqrt(484)3). sqrt(7)/2 Simplify (-1sqrt(133)-1 - -3sqrt(133)-2)/(6(2sqrt(700) - sqrt(700)) - -6(2sqrt(700) + sqrt(700)))-2. sqrt(19)/24 Simplify 2-2sqrt(1300) + 5 + (2 + -6(1sqrt(1300) - sqrt(1300)))2 + -3. -40sqrt(13) + 6 Simplify -5 + (sqrt(128) + -1 + 5)*2 + (0 + sqrt(128) + sqrt(128))-3 + (-2 + sqrt(128) - sqrt(128))*2 + 3. 16sqrt(2) + 146 Simplify ((-3 + 6(sqrt(363) - (sqrt(363) - (5 + 1 + sqrt(363)))) - (0 + sqrt(363) + -4)41)-1)*2. 2156sqrt(3) + 3853 Simplify -4 + (5(5 + -1sqrt(700)) + (sqrt(700) + 2)6 + -5-2sqrt(700) + -4)2. 7260sqrt(7) + 85785 Simplify (-5(sqrt(684) + (sqrt(684) + 0 + sqrt(684))3 - (sqrt(684) - (-2 + -1sqrt(684)))) + 2 + -4)2. -2400sqrt(19) + 427564 Simplify ((sqrt(832) - (sqrt(832) + sqrt(832)1)1)-4)2 + (sqrt(832) - (-3 + sqrt(832)1))*2 + 3 + 1. 13325 Simplify (sqrt(450) - 2sqrt(450))/(sqrt(80)/sqrt(200)) + 1 + (sqrt(35)/sqrt(175))*2 + sqrt(45)/(sqrt(36) + sqrt(9)). -44sqrt(5)/3 + 6/5 Simplify (((sqrt(65) - -61sqrt(65)) + -4-2sqrt(65))2)/(3sqrt(40)/(sqrt(200)-1)). -50sqrt(13) Simplify 5sqrt(57)/(sqrt(192)2) - -5(sqrt(57) - sqrt(456)/(sqrt(24)/sqrt(3)))/sqrt(3). 5sqrt(19)/16 Simplify (-2((sqrt(110) + 1sqrt(110) - sqrt(110)) + sqrt(110))-14)/(-5sqrt(40)/sqrt(4) - (sqrt(90)1)/sqrt(9)) + 1. -8sqrt(11)/3 + 1 Simplify ((-3sqrt(84)-2 - 2sqrt(84)1)/(2(1sqrt(48) + (-2sqrt(84) + sqrt(84))/sqrt(7) + sqrt(12))))*2. 7 Simplify (4sqrt(2688) - (sqrt(378) + 3sqrt(378)))/(((sqrt(216) + -4sqrt(216))-4)/sqrt(4)). 5sqrt(7)/9 Simplify ((-21sqrt(384) - sqrt(384) - -1sqrt(384)2)/(sqrt(40)/(sqrt(45)4)))2 + 1. 6913 Simplify (((-2-2sqrt(204) - (sqrt(204) + (sqrt(204) - sqrt(204)1))4)2)/(13-4sqrt(300)))2 + 4. 4 Simplify -4(sqrt(52)/sqrt(4) + 1 + 4)*2 + (1-1sqrt(130))/(sqrt(40)1) + 4. -148 - 81sqrt(13)/2 Simplify 0 + ((-2sqrt(847) - sqrt(847))-2 + 4 - (-5 + -1 + sqrt(7) + (sqrt(7) + -1)-3)). 7 + 68sqrt(7) Simplify (5sqrt(816) - sqrt(102)/(1sqrt(2)))/((sqrt(432) - (sqrt(432) + (sqrt(432) - (sqrt(432) + -2sqrt(432)) - sqrt(432)) + sqrt(432) + sqrt(432)))3). -19sqrt(17)/108 Simplify 1((0 + sqrt(75) + 6(sqrt(75) + 0) - (-2 + sqrt(75) + sqrt(75)-1 + 3))2 + 4). -70sqrt(3) + 3680 Simplify (1 + 4 + ((sqrt(130) + 2sqrt(130))-6 + sqrt(130))/sqrt(10) + -6(-3 + sqrt(325)-1 + sqrt(325))-4)2. 2278sqrt(13) + 8246 Simplify (3(sqrt(18) + ((sqrt(72) - -1sqrt(72))/sqrt(4))2) - ((sqrt(18) + 4 + sqrt(2))2 + 6sqrt(8)/sqrt(4)))2. -58sqrt(2) + 336 Simplify ((sqrt(1944)23)/((sqrt(200) - sqrt(200)1) + sqrt(200) - (sqrt(8) - sqrt(1152)2)) + 5)2 + 2. 135sqrt(3)/7 + 7479/196 Simplify (4 + -6((-2 + sqrt(1331)2 + -3)-1 + 2) + 5)2. -8712sqrt(11) + 192753 Simplify ((4 + sqrt(200) + 2)*2 - (sqrt(16)/sqrt(2)6 + (-2sqrt(40))/sqrt(5)))-5. -1180 - 560sqrt(2) Simplify 14((-3sqrt(539))*2-2 + sqrt(1584) + (1 + sqrt(1584) - sqrt(1584))3 + sqrt(1584) + sqrt(1584) + sqrt(1584)). -38796 + 192sqrt(11) Simplify (((sqrt(693) - -3sqrt(693))-1 - 1(sqrt(693)-3 + sqrt(693)))/(4-42sqrt(539)))2. 9/1792 Simplify (sqrt(176)/((sqrt(8)/sqrt(2) - sqrt(4) - sqrt(4))4) - (sqrt(396) + sqrt(396) + (sqrt(396)14 - sqrt(396))))/((4(sqrt(44) + sqrt(704)))/sqrt(176)). -61sqrt(11)/20 Simplify (((sqrt(136) - (sqrt(136) + -3sqrt(136)2)) + -3sqrt(136)-6)/(2(sqrt(128) + sqrt(128) + 2sqrt(128)2)))2. 17/4 Simplify 4((sqrt(33)/(6sqrt(12)/sqrt(4)))2 + 5 + 3 + sqrt(220)/sqrt(5) + 5). 8sqrt(11) + 479/9 Simplify ((sqrt(175) - 4sqrt(175)-1)/(sqrt(25)/sqrt(45)))/(sqrt(847)-1 + (sqrt(7) - (sqrt(175)-2 - sqrt(175)))) + 2. 2 + 3sqrt(5) Simplify (sqrt(153) + 1)2 + -3 - ((2 + sqrt(153))2 - -1sqrt(153)) - (1(0 + sqrt(2057)) + 1)2. -31sqrt(17) - 8 Simplify (6(sqrt(192) + (sqrt(192) - 1sqrt(192))) + sqrt(192))2 + 4 - (3(sqrt(768))2 - (sqrt(240)/sqrt(5) + -2)2). -16sqrt(3) + 7160 Simplify (-1 + 2 + (5(sqrt(704) - (0 + sqrt(704))) + -3(-1 + sqrt(704)) + sqrt(704))-1 + 5 + 0)*2. 96sqrt(11) + 2825 Simplify (sqrt(95) + -2(sqrt(95) + -1sqrt(95)) + (sqrt(95) - -2sqrt(95))1)/(-5sqrt(20)/sqrt(4) + sqrt(720)3). 4sqrt(19)/31 Simplify (((sqrt(117) - 2sqrt(117))6)/(sqrt(3)24))/(1-5sqrt(300)-3). -sqrt(13)/200 Simplify sqrt(468) + 4 - (4 + 3 + sqrt(13)) - (1 + sqrt(1573)5 + 4)2. -39353 - 545sqrt(13) Simplify (sqrt(50)/sqrt(5)1)/(-5sqrt(8)/sqrt(4)) + -4sqrt(5) + -1 + sqrt(5) + (sqrt(80) + (sqrt(80) + -4 - sqrt(80)) + sqrt(80))2 + -1. -336sqrt(5)/5 + 334 Simplify (-2sqrt(1900) + 1 - (1 + sqrt(1900))-3)*2-6 + (sqrt(1900) + 4sqrt(1900))1-2 + -2. -11498 - 580sqrt(19) Simplify ((0 + 3 + sqrt(588) - (sqrt(588) + sqrt(588) + 0)-6)-2 + -5)*2. 8008sqrt(3) + 397609 Simplify (sqrt(126)/(-5sqrt(9)) + sqrt(2016) + -2sqrt(2016) + sqrt(2016) + sqrt(2016))/((sqrt(28)-2)/sqrt(4) + (sqrt(7) - sqrt(175) - sqrt(7))-4). 59sqrt(2)/90 Simplify -3-4sqrt(130)/(sqrt(10) + sqrt(120)/sqrt(3)) - -4(-3 + sqrt(1872)1)2-3. -22572 + 868sqrt(13) Simplify (sqrt(147)-1 + 0 + (sqrt(147) - -1(sqrt(147) + -3)) + 3 + 1 + -5)2. -56sqrt(3) + 163 Simplify 4sqrt(57)/(sqrt(450)/sqrt(6)) + -4 + 6(1 + sqrt(1900)). 2 + 304sqrt(19)/5 Simplify (-4 + 6(6sqrt(125)1 + sqrt(125) - (sqrt(125) + (sqrt(125) - (sqrt(125) - 2-4sqrt(125))) - sqrt(125))) + -2 + 4)*2. -1800sqrt(5) + 1012504 Simplify ((4 + (1 + sqrt(192) - sqrt(192)) - (-5 + sqrt(192) + 1))*2 - (sqrt(27) + 1 + 5 + -4(sqrt(27) - sqrt(243)))*2) + -2. -1952 - 468sqrt(3) Simplify (((-2sqrt(425)5 + sqrt(425) - ((sqrt(425) - sqrt(425)1) + 4))2 - (2sqrt(425)-2 + 5)-2)2)*2. -2080sqrt(17) + 1149216 Simplify (sqrt(2448)1 + sqrt(2448) - sqrt(2448)) + -5 + -5(sqrt(2448) + -2) - 6((sqrt(2448) + 1)2 + -3)-6. 816sqrt(17) + 88061 Simplify (4(sqrt(160) - -11sqrt(160)))/((-3sqrt(80)2)/(sqrt(110)/sqrt(99))). -8sqrt(5)/9 Simplify ((0 + sqrt(208) + (sqrt(208) + 4 - sqrt(208) - sqrt(208)) + sqrt(208))	{ "pile_set_name": "DM Mathematics" }
dp = -12, 2h - h - p = -4 for h. 0 Let x be 0/1-3(-2)/12. Let m(j) = -2j + 8. Let p be m(x). Solve -3d - 5w = -32, -4d + pd + 2w = 24 for d. 4 Let a be -7 + 7 + 7 + 7. Solve 0 = -f + 5m - a - 11, 15 = f + 5m for f. -5 Suppose 3w - 8 + 20 = 0, -4m + 3w + 16 = 0. Solve -2q + o = -m, 18 = -4q - 4o + 2 for q. -1 Suppose -3g - 10 = -5g. Suppose 2k = -2k. Let w = g + k. Solve 5o + 13 + 13 = -a, -5o = -wa + 20 for a. -1 Suppose -7b = -0b. Suppose b = -4d - d - y + 24, -y + 8 = d. Let i = -4 + 6. Solve -io - t = 2, -dt = -0t + 16 for o. 1 Let r(j) = 22j + 3. Let w be r(1). Solve 0g - 5 = -4g + b, 5g - w = 5b for g. 0 Let r be 2 - -3 - (2 - 2). Suppose -rs + 15 = -0s. Solve -d - 1 = 2d + u, 4d = su + 16 for d. 1 Let t be 1/(-4 + ((-2480)/(-156))/4). Let h = t + 49. Solve -6r + r + h = l, r - 11 = -2l for l. 5 Suppose -95 + 135 = 2n. Solve 3o + 0r + 5 = 2r, 0 = -5r + n for o. 1 Suppose 4t + t = 25. Suppose -tf + 0f + u = 143, -43 = f - 5u. Let g be 8/20 - f/5. Solve 0 = -q - 4w - 0w - g, 10 = -5w for q. 2 Let i be ((-4)/3)/(4/(-30)). Let h be (682/385 + 3/7)5. Solve 0 = z + 4c + h + i, -21 = 5z - c for z. -5 Let n be 11 - (-6 - 2 - -14). Solve 0v + 4g + 1 = -3v, -ng = -v + 25 for v. 5 Let y(u) = -10u + 113. Let k be y(11). Solve h + 5 - k = -l, 5l + 12 = -4h for l. -4 Let a(d) = -d3 + 5d*2 + 16d - 9. Let n be a(7). Solve -n = -2o + 6o + i, -i + 3 = 0 for o. -2 Suppose -27 = -7c + 4c. Suppose -10m + 11m = c. Suppose mq - 4 = 7q. Solve -2y = qw, -w - 3w - 8 = -4y for w. -1 Suppose 0 = z - 1, -2n - 9 = 5z - 40. Solve 9s + t = 12s + n, -s + 4t = 8 for s. -4 Let h be (-2)/(-8) + 19/4. Solve -2i + 27 = -hc, -2i - 12 = i + 3c for i. 1 Let r(o) = -o2 - 9o - 23. Let i be r(-7). Let u = i + 12. Solve 4j + 8 = 0, uh - 4j + j - 12 = 0 for h. 2 Let g = 0 - 0. Suppose 14f + 94 = 61f. Let x be f + (0 - g) + 2. Solve -i = -xc + 9, -3i = -3c - 0i + 18 for c. 1 Let m = -20 + 24. Solve 0 = -u - 3y + 7, -u + 5 + 4 = my for u. 1 Suppose -107u + 80 = -91u. Solve -3b - 2b = -ua - 10, 4a - 2b - 2 = 0 for a. 3 Let m = -101 - -104. Let r(p) = p*3 - 4p*2 + 6p - 6. Let w be r(m). Solve c + 2 = 3l, 0 = 2l - wl + 3c - 10 for l. 2 Let c be 6/(-2) - (-4 + 1). Suppose -2v + c = 5z - 22, 0 = 5z - 4v - 16. Solve 0y + zy - 4 = -j, 3j - 12 = -y for j. 4 Let f = -151 + 151. Let c = -3 + 6. Suppose fd = d - c. Solve 2w - 5b = -w, -d = -b for w. 5 Let u(m) be the first derivative of m*2/2 - m - 13. Let d be u(6). Solve s - 3s - b = -7, 20 = ds + 5b for s. 3 Suppose 0 = -5v + 15. Suppose -3x + 10 = a, 0 + 2 = 2a - vx. Solve -2w + 12 = -0w + ay, -4w - y + 3 = 0 for w. 0 Let k be 1 + (-39)/(-4) + (-2)/(-8). Suppose 2t - k = -1. Solve tr = 3l, 2r = -2l + r for l. 0 Let f be -6 - (-17)/((-34)/(-16)). Solve 0l + fn = -2l, -n + 4 = -3l for l. -1 Let a = -48 - -53. Suppose t = 4j - 14, 0j = -aj - 5t + 5. Solve 8 = m + jx, 2m + 2x + 0x - 12 = 0 for m. 5 Let m = 114 - 114. Solve -3o + 0b = -4b - 20, m = -4o + 2b + 20 for o. 4 Let z be (-10-1(-3)/(-6))/((-115)/(-46)). Let u be (-1 + (-9)/(-5))5. Solve -n - 8 = -uy - 3n, -zn = y - 8 for y. 0 Let t(q) = q + 17. Let b be t(-6). Suppose -4m - b = -5m. Suppose m = -5u + 71. Solve -4g + 5g + 4o = u, 6 = 3o for g. 4 Let a = 69 - 64. Solve 0 = at - 2j - 4, 2 + 2 = -t + 2j for t. 2 Let a = -22 + 20. Let s be (-2)/4 + (-1)/a. Solve 0 = 3z - 6, sj - 3j + 5 = -5z for j. 5 Suppose -5a + 40 = -5l, -5a + 0a + 2l = -49. Suppose 12i = ai + 2. Solve 14 = -id + 4k, 17 + 4 = -5d + 3k for d. -3 Let o be (8/(-12))/(2/(-9)) + 0. Solve 2y + oj + 19 = 6j, 1 = 2y + j for y. -2 Suppose -4x = -0g + 2g - 34, 2x = -2g + 20. Suppose 5i - 74 = -3z, -z = -i + z + x. Solve -3j + s = 13, 7s + i = -j + 3s for j. -5 Let z be (0/(-3) - -5)/((-1)/(-1)). Solve 18 = -0r + r + 4n, zr + 5 = -n for r. -2 Let u(f) = f*2 - 5f - 1. Let o = 16 - 10. Let i be u(o). Suppose -1 = -3d + i. Solve -3v + 0v - 3 = -3j, -5v + 16 = dj for v. 2 Suppose 0 = d + 3f, -2f - 5 = -6d + 5d. Solve 3t = -2g + 11, dt + g - 15 + 2 = 0 for t. 5 Let h be 20/(-8)(-42)/(-15). Let l(r) = -r*3 + 5r*2 - 6r + 1. Let z be l(4). Let q = h - z. Solve q = 3d + 2d + 10, -d = -2a - 4 for a. -3 Suppose 2 = -c + 6. Let n(z) = -z + 2. Let m be n(2). Let q = m + 0. Solve 2x = -5j - 17, q = x - c - 0 for j. -5 Let r be 83/6 + -4. Suppose -2o = -ro + 3z - 33, -4o + 61 = z. Solve -2c - p + 5p - 10 = 0, -3c - o = -5p for c. -5 Suppose 234 = -10u + 36u. Solve -4b + 7 = 2f + u, -3b = 2f - 1 for b. -3 Let w = 203 - 200. Solve -ws = 4o + 2s - 35, 2s + 14 = 4o for o. 5 Let j = -56 + 59. Solve -m = r, 0 = jr - 4r - 5m for r. 0 Suppose -23x - 52 = -49x. Solve xo + 10 = n, 8o + 8 = 6o for n. 2 Let b be (2 - (-27)/(-2))/((-4)/8). Let q(v) = -v + 26. Let c be q(b). Solve 2a - 4j = 3 + c, 3j = 3 for a. 5 Let i = -12 + 27. Let v = 25 - i. Suppose 11k = vk. Solve -2f + 12 = -4u, k = f + u + u - 2 for f. 4 Suppose 2k = m - 4, -3m + 11 = -m - k. Suppose 0h + m = 2h. Let a = 5 - 0. Solve 3f - a = 4g + h, 4f = 5g + 10 for f. 0 Let h = -1337 - -1341. Solve 0 = 3a - hj + 1, 4 = 3j + 1 for a. 1 Let t be 122/4(-8 + 6)-1. Let w = -45 + t. Solve -4u - 4b = 0, -6u + 3u + w = -b for u. 4 Suppose 4y + 0y + 4p - 296 = 0, -y = 5p - 78. Suppose -yr = -71r - 10. Solve -k + 1 = o, rk - 19 + 4 = 5o for o. -1 Suppose -4t + m + 21 = 0, 0 = t - 2t - 4m - 16. Let s(q) = q*2 + q. Let o be s(1). Solve -18 + 6 = -4v + or, -2r = -t for v. 4 Suppose 53w - 54w + 2 = 0. Solve -3s - z + 3 = 0, -wz + 4 = 4s + s for s. 2 Let m be (2-2)/(4/(-18)). Suppose 3v = 12 + m. Let t be 6/(-30) + 22/v. Solve -k = 1, 2k - t - 2 = -2l for l. 3 Let m = 666 - 661. Solve 5h = -mk - 20, k = 5h - 2k + 4 for h. -2 Let s be (-1)/(-4)0 + 54. Suppose -5m - 34 = -s. Let o be 0/(m + (-3 - 0)). Solve -4x - 4 + 2 = 5n, o = 5n - 2x + 14 for n. -2 Let m = -17 - -23. Let z be 6(20/m + -3). Solve -4g - zu + 18 = 0, -4u = -5g + 3 - 0 for g. 3 Suppose 0 = -2p - 3v + 21, 2p + 0p = 2v + 26. Let w be (-15)/p - (-75)/12. Solve 0 = -x - 3t + t - w, 4x - t + 11 = 0 for x. -3 Suppose -2q = -6r + 4r, r = 5. Suppose -l = -ql - 64. Let s = l - -21. Solve 5h = t - 3t - 9, -4t + 27 = -sh for h. -3 Suppose 3r = 3 - 0, 5p - r - 34 = 0. Suppose -12b = -10b - 4. Solve 2q - 7q - 7 = 4h, q = bh - p for q. -3 Suppose -197n + 180 = -177n. Solve -5p + 4p + 8 = -3i, -p = -4i - n for i. -1 Let r(i) = -i + 3. Let h be r(-4). Let w be (-30)/(-4)(-12)/(-9)(200 - 199). Solve -l - y + 5 - w = 0, l - h = 5y for l. -3 Let b = 4 - -1. Solve 2l = 3m + 7, bl = m - 5m + 29 for m. 1 Let j be (5/(-2))/(9/(-18)). Let q be 15/30(j + 2/2). Solve 11 = qy - 0x + x, 2y - x - 4 = 0 for y. 3 Suppose 1 = 3v - 2q, q + 9 = 5v - 2. Suppose 0 + 25 = 5m. Solve -4i - 15 = mz, 3z + vi + 7 = -5 for z. 1 Let h(g) = 22g + 25. Let m be h(-1). Let n(j) = -j3 + 2j*2 + j - 2. Let f be n(2). Solve -x + 19 = -5k, 3k + 0k + mx - 3 = f for k. -3 Let u = -22 - -34. Let d be (1/((-2)/u))/(-2). Suppose 2f + 4t - 8 = 18, -f + 3t = 7. Solve 3k = dh + 21, k + fh = -25 + 8 for k. 3 Let p(r) = r3 - 5r*2 - r + 7. Let z be (-15)/6(0 + -2). Let c be p(z). Solve -cq = 3 + 3, -2v + 2q = 2 for v. -4 Let j = 1076 + -1061. Solve h - 6 = 2g, 4h - 7g = -2g + j for h. 0 Suppose 0 = -s - 5, 4k - 27 - 303 = -2s. Let v be (102/k)/(3/10). Suppose -4r = -v, -4p - 10 = r - 59. Solve -2q = 2d + p, d = -2d - 4q - 19 for d. -5 Let o(m) = -m3 + 7m*2 + 16m - 60. Let d be o(8). Solve 2t = 4, 21c - dt = 17c - 24 for c. -4 Suppose 14 = 13t - 12. Solve -3g + 5y - 13 = 0, y = 2g - y + t for g. 4 Suppose -2w = -w + b - 1, 0 = w - 2b - 4. Let q(n) = n*3. Let m be q(0). Let i be (m/(-3)1)/(-2). Solve 0 = -ws - 2, -5s + 20 = -5u - is for u. -5 Let y(u) = -2u2 - 24u - 10. Let j be y(-10). Let w be (j/12)/(2/4). Solve q - 4k + 14 - 1 = 0, -12 = -3q - wk for q. -1 Let m be (7/(252/(-48)))/(4/(-15)). Solve 6 = -q + mp, 4p = -18q + 13*q - 1 for q. -1 Let t = 16 - 13. Suppose 0 - t = -h	{ "pile_set_name": "DM Mathematics" }
2, 5 Suppose 1632 = -3v + 30142 + 6392. What are the prime factors of v? 2, 3, 7, 277 Let n = 1566 + -2728. Let s = -718 - n. What are the prime factors of s? 2, 3, 37 Suppose 0 = -4t + 20, -t + 2 = 2y - 3t. Let i be (y/(-5))/((-16)/40). List the prime factors of (290 - 3/(-1)) + i/(-1). 2, 5, 29 List the prime factors of ((-595)/(-25) - -3)4/(88/35915). 67, 653 Suppose -2d = -5v + 19, -5d - 25 = -2v - 10d. Suppose -i + 4673 = 5b - 1454, vi = 5b - 6145. What are the prime factors of b? 2, 613 Suppose 33 = -2z - 221. Let u = z - -338. List the prime factors of u. 211 Let x(y) = -222y + 1494. List the prime factors of x(-21). 2, 3, 19 Let a = 99 + -103. Let s be (362/8)/(a/(-16)). Let u = -27 + s. List the prime factors of u. 2, 7, 11 Let m be 10/20 + (0 - (-11)/2). Suppose -2z - 22 = -4z - 2t, 4z - 32 = -t. List the prime factors of 1131 + 0(z - m). 131 Suppose -5c = 134l - 140l + 52203, 0 = 5l + 3c - 43481. What are the prime factors of l? 2, 4349 Suppose -2i - 4h + 58 = 0, 3h - 6h = 3i - 102. Let t = i + -38. What are the prime factors of (t/((-6)/4))/((-5)/765)? 2, 3, 17 Suppose -30h + 11h - 14h + 10065 = 0. List the prime factors of h. 5, 61 Let s be 712/7 + (-10)/(-35) + -3. Let r = -32 + s. Suppose 3l - 268 = -5x, 0 = -5x - l + r + 209. List the prime factors of x. 2, 7 Suppose -4 = 2w, -4j + 2w + 282 = 5w. Let m = 6 + j. List the prime factors of m. 2, 3, 13 Let b = -204 - -132. Suppose -5t = -2i - i - 13, 0 = 3t + i - 5. Let f = t - b. List the prime factors of f. 2, 37 Let f(l) = -5688l - 615. List the prime factors of f(-2). 3, 17, 211 Let l(i) = -i3 + 2i*2 + 29i + 12. Let g be l(-8). Suppose g = -0o + 2o - 3k, 0 = 3k. What are the prime factors of o? 2, 3, 5, 7 Let l(c) = -c*3 + 16c*2 - 15c + 13. Let b = -8 - -23. Let n be l(b). Let f(m) = -m*3 + 14m*2 - 8m + 15. List the prime factors of f(n). 2, 5 Suppose i = -5y + 25, -5i + 13 = -4y + y. Suppose -4v = -io + 747, -2o - 30v + 282 = -26v. What are the prime factors of o? 3, 7 Suppose 4z - 75836 - 153536 = -9z. List the prime factors of z. 2, 11, 401 Suppose -3n - 2 = -4i, -2i - 12 = -7i - n. Suppose -f - 89 = -o, -if + 118 = 4o - 220. Let c = o - 37. List the prime factors of c. 7 Let j(t) = 2t3 + 5t*2 - 5t - 10. Let x be j(-4). Let s = 37 + x. List the prime factors of s/((-1)/1) + 99. 2, 5 Let v(t) = 6t2 - 18t - 258. Suppose -2i - 11m = -6m + 3, -3i + 5m = 42. List the prime factors of v(i). 2, 3, 5, 13 Suppose 3w - 3b - 400 = w, -958 = -5w - 3b. Suppose 3r - s - w = -5s, -s - 144 = -2r. List the prime factors of r. 2, 5, 7 Let g(k) = 11k + 7. Let n be g(4). Suppose 0 = -2t - 15 + n. Suppose 2i = 3l + 258, 5l + 2 = -t. What are the prime factors of i? 3, 41 Let y(f) = -22f*3 + 3f*2 + 7f + 2. List the prime factors of y(-7). 2, 3823 Let t(y) be the first derivative of y*4/4 + 5y*3 - 13y*2/2 + 30y - 51. List the prime factors of t(-14). 2, 3, 17 Suppose -48p + 17p = -17577. Let h = p - 95. List the prime factors of h. 2, 59 Suppose -1012 = 4j - 4t, -3t + 5t + 1018 = -4j. Let y = j + 1148. List the prime factors of y. 2, 3, 149 Let k(s) = -3s + 19. Let z be k(6). Let h be (3 - 5)z + 75. Let m = h + -54. List the prime factors of m. 19 Let p = -15897 + 18326. List the prime factors of p. 7, 347 Suppose -3w + 44877 = 5q, 66w - 26899 = -3q + 71w. What are the prime factors of q? 3, 997 Suppose 0 = 68570h - 68560h - 390590. List the prime factors of h. 139, 281 Let q(h) = -h*2 - 4h + 5. Let c be q(-4). Suppose -3k = -s + 244, 0 = -2s + 2k - ck + 533. List the prime factors of s. 7, 37 Let v be (-1)/(-4)-20. Suppose vd - 32 = -4d. Let c = 64 - d. List the prime factors of c. 2, 7 Suppose 3y = -k + 86024, 2k + 2725 + 111957 = 4y. List the prime factors of y. 53, 541 Let l = -33 - -39. Let z be -12l/4. What are the prime factors of (4 - (-2 + 20))z? 2, 3, 7 Suppose -18t - 30t + 359535 = -15t. List the prime factors of t. 5, 2179 Let v(t) = 75t*3 - 2t*2 + 45t - 277. List the prime factors of v(5). 3, 11, 281 What are the prime factors of 4((-43194)/8)/((93/2)/(-31))? 2, 23, 313 Suppose -370627 = -44t + 12481. What are the prime factors of t? 8707 Let r(b) = b*2 + 30b - 131. Let k be r(4). Suppose -4n - n = -2935. Suppose n - 52 = kt. What are the prime factors of t? 107 Suppose -12f - 8 = -14f. Suppose 2i = i - f, -4j + 2i = 24. List the prime factors of (27)/(j/(-132)). 3, 7, 11 Suppose -11c = -4c + 35. List the prime factors of c/253(-275)/5. 3, 11 Let h = 7 + -3. Let x(t) be the first derivative of t*4/4 - 6t - 266. List the prime factors of x(h). 2, 29 Let m(l) = -l*2 - 7l + 11. Let v(i) = 2i - 1. Let k(g) = m(g) - 5v(g). Let f = 8 + -20. List the prime factors of k(f). 2, 19 Let v be (-6)/(3/8-2). Suppose -vu = -u. Suppose u = -4r - 3r + 469. List the prime factors of r. 67 Suppose -1154k = -1152k - 3x - 24830, 5x = -40. What are the prime factors of k? 79, 157 Let j = 326 - -17. Suppose n - 4z - j = 0, 6 = 5z - 9. List the prime factors of n. 5, 71 Let b be (-11 + 17)(3 - -162). Suppose 8w + b = 11w. List the prime factors of w. 2, 3, 5, 11 Suppose f + 110 = -f. Suppose -3k + 12 = 0, -2k + 1128 + 260 = -4t. Let g = f - t. List the prime factors of g. 2, 5, 29 Suppose 5g + 2w - 933 = 0, 43w - 40w = 5g - 913. What are the prime factors of (g/(-111))/((-3)/2547)? 5, 283 Suppose 4k = -3k + 1015. Suppose 0 = -3m - 4p + k + 52, p = m - 75. List the prime factors of m. 71 Let o(c) = c3 + 8c*2 + 17c + 69. Let j be o(-7). What are the prime factors of 8 - 16 - (-1760 + j)? 1753 What are the prime factors of ((-1282)/32-12)/((-8 + 2)/(-744))? 3, 31, 641 Suppose -y = 5x - 100, x + y - 16 = -0y. Suppose -2 = -xq + 20q. Suppose -5j + 3h = -252, q = -2h + 4h. List the prime factors of j. 3, 17 Suppose d - 3d - 3x = -367, d - 173 = 2x. Let r = d - 11. List the prime factors of r. 2, 3, 7 Let v(f) = -f*3 - 20f*2 - 15f + 89. List the prime factors of v(-33). 14741 List the prime factors of 241 + (-846)/216 + 2/(-24). 3, 79 Let q(w) = -w*3 + 19w*2 + w - 49. Let h be q(12). Suppose 15 = -5k, 0 = 6g - 10g + k + h. List the prime factors of g. 2, 11 Suppose -2v - 39f + 9438 = -38f, f = 5v - 23602. List the prime factors of v. 2, 5, 59 Let z = 3977 - -37413. List the prime factors of z. 2, 5, 4139 Let n(z) = -z*3 + 26z*2 + 29z - 67. Suppose 6 = -2i, -2s - s + 81 = -2i. What are the prime factors of n(s)? 1283 Suppose 38p - 37p + 2y - 30224 = 0, -30224 = -p + 5y. List the prime factors of p. 2, 1889 Let n = -15310 + 27558. What are the prime factors of n? 2, 1531 Let f(d) = -2d + 25. Let o be f(13). Let c(b) = -117b3 + 3b*2 + 5b + 3. Let k be c(o). Suppose k = -26j + 28j. List the prime factors of j. 59 Suppose -5u + 5v - 15 = 0, -3u - 6v = -11v + 9. Let s be u(1 - (-12)/(-9)) - -42. Suppose -48b + 515 = -sb. What are the prime factors of b? 103 Let m = 194 + 202. Let t = m - -48. List the prime factors of t. 2, 3, 37 Suppose -5x - 3d - 15 + 51 = 0, -4x = -d - 22. Let j be 172 - (-5 - -6)/(2/x). Let g = j - 27. What are the prime factors of g? 2, 71 Let w be (-6)/9 - 85/(-15). Suppose -3g = wg - 16. Suppose 0n = -n - 2i + 28, -4 = -gi. List the prime factors of n. 2, 3 Suppose 8r - 17r = 0. Suppose r = -i - 3i + 12. Suppose -ix = -9, 2x - 1052 = -5t - 236. List the prime factors of t. 2, 3 Let l be 8/(-2) + (0 - -10). Suppose 2 - l = -y. Suppose yn = 3n + 79. What are the prime factors of n? 79 Let n = -348 + 350. Let m = 278 + -71. Suppose -4x = j - 0j - m, -4x + 202 = nj. What are the prime factors of x? 53 Let v = -66 - -36. Suppose -10u + 199 = 899. Let s = v - u. List the prime factors of s. 2, 5 Suppose 55710 = 2k - 4m, -k + 31m + 27852 = 28m. List the prime factors of k. 3, 37, 251 Let u = 11926 + -7050. What are the prime factors of u? 2, 23, 53 Suppose -2r = -10, 0t = -t - 5r + 26. Let n = t - 49. Let g = 102 + n. List the prime factors of g. 2, 3 Let m be (-60)/(-18)2/(12/2151). Suppose -4t = -3t - m. What are the prime factors of t? 5, 239 Let p = 9026 - 8210. Let g = 1 - -1. Suppose 4o - 5*d = p, o = -g	{ "pile_set_name": "DM Mathematics" }
x. -10x - 10131 Collect the terms in 0f*3 + 9 + 5 - 3f*3 + 9f*3 - 3 - 11. 6f*3 Collect the terms in -3p*2 - 2p + 243202172p3 - 243202165p*3 + 3p*2 + 3p - p. 7p3 Collect the terms in -5b - 5908 - 5088 + 16080 + 3b - 5084. -2b Collect the terms in -64f3 + 16724 - 16724 + 665f*3. 601f*3 Collect the terms in 7088i + 10i2 - 2052 + 2923i + 2051. 10i2 + 10011i - 1 Collect the terms in 57922y2 + 32 + 19y*3 - 91 + 59 - 57922y*2. 19y*3 Collect the terms in -92 - 89 + 122i*2 - 127i*2 - 94 + 279. -5i*2 + 4 Collect the terms in -8293d*3 - 4 + 0 + 4 + 16611d*3 - 8177d*3. 141d*3 Collect the terms in 222101c - 604936c + 2269460c + 1281393c. 3168018c Collect the terms in 16 + 826916m2 - 16 - 273244m*2. 553672m*2 Collect the terms in 224331x*2 - 41875x*2 + 157281x*2. 339737x*2 Collect the terms in 8 + 304266528f - 304266528f - 3f*2. -3f*2 + 8 Collect the terms in -305592n - 305573n - 305576n + 916743n. 2n Collect the terms in -255s3 - 1 + 26s*2 - 1125s - 26s2 + 2313s - 1188s. -255s*3 - 1 Collect the terms in -341g - 1006g + 210g - 1662g - 1771g. -4570g Collect the terms in -2192h - 1711h - 1 + 761h + 79h. -3063h - 1 Collect the terms in -49k2 - 338k*2 - 253k - 263k + 516k. -387k2 Collect the terms in 27h2 + h2 - 24h2 - 3646h. 4h2 - 3646h Collect the terms in 289z + 2159 + 2782 - 4941. 289z Collect the terms in -78379131 + 11x2 + 78379131. 11x*2 Collect the terms in 1557l*3 + 2907l - 734l3 - 2907l - 690l3. 133l*3 Collect the terms in 5908 + 2d*3 - 12952 - 3d3 + 7044. -d3 Collect the terms in 1145x - 4649x + 1147x + 1208x + 1160x. 11x Collect the terms in 1872l3 - 264l*3 - 9l*2 - 382l*3 + 3031l*3. 4257l*3 - 9l*2 Collect the terms in -171k + 147k + 146k + 145k - 265k. 2k Collect the terms in -o2 - 5405o + 4436o + 951o. -o*2 - 18o Collect the terms in 152b + 951b + 1100b + 862b - 101b. 2964b Collect the terms in -3 - 54707y - 10 + 1154709y + 13. 1100002y Collect the terms in -2355071388 - 2355071359 - 5m*3 + 4710142747. -5m*3 Collect the terms in 9v - 2434v3 - 7v - 9 + 6. -2434v3 + 2v - 3 Collect the terms in 87o2 + 98o*2 + 100o*2 - 396o*2 + 98o*2 + 16. -13o*2 + 16 Collect the terms in -316584649 + 17f*2 + 316584649. 17f*2 Collect the terms in 231 + o - 101 - 4o + 2o + 2o*2 - 130 + 45o. 2o2 + 44o Collect the terms in -356t - 27t + 63 + 3t3 + 384t. 3t3 + t + 63 Collect the terms in -545 - 1099f*3 + 498f*3 + 598f*3. -3f*3 - 545 Collect the terms in -134413b + 6898685 - 6898685 + 134393b. -20b Collect the terms in 60266 + 6c2 + 21c - 14c2 - 60257. -8c*2 + 21c + 9 Collect the terms in 11571 + 8207 - 5i3 + 41i*2 + 7i*3 - 39i*2. 2i*3 + 2i*2 + 19778 Collect the terms in -227895 + 796072b + 227895 - 397970b - 398101b. b Collect the terms in -75j - 40j + 17 + 284j - 92j - 78j. -j + 17 Collect the terms in 10 - 34040q + 34048q - 10. 8q Collect the terms in 159498 + 155014 - 12r - 314512. -12r Collect the terms in 340s + 10 + 20s - 9 - 1. 360s Collect the terms in -4720b*3 + 23612b*3 - 4730b*3 - 4718b*3 - 4718b*3 - 4715b*3. 11b*3 Collect the terms in -34h - 690h + 379h + 369h. 24h Collect the terms in -48t3 - 15 + 15 + 187t*3 - 66t*3 - 67t*3. 6t*3 Collect the terms in -23435n*2 + 2n - 2n - 23439n*2 + 70298n*2 - 23434n*2. -10n*2 Collect the terms in 19 - 89 + 35268g + 35273g - 18 - 70545g. -4g - 88 Collect the terms in 687a + 543a + 538a + 537a + 532a - 2835a. 2a Collect the terms in 2y2 - 31641 - 31699 + 63368. 2y*2 + 28 Collect the terms in 98 + 111 - 49z + 38z + 111 - 98z - 321. -109z - 1 Collect the terms in -34505z*3 - 33784z*3 + 68303z*3. 14z*3 Collect the terms in 429159 - 87g*2 - 429159. -87g*2 Collect the terms in -9x*3 + 12715x*2 + 9x - 6375x2 - 6340x*2. -9x*3 + 9x Collect the terms in 584 + 570 + 21r2 - 2282 + 564 + 564. 21r*2 Collect the terms in 1175 + 14k - 438 - 737. 14k Collect the terms in 32c*2 + 39c*2 - 75c*2 + 19c*2 + 12c2 + c3. c*3 + 27c*2 Collect the terms in 295433u*2 - 590866u*2 + 295451u*2. 18u*2 Collect the terms in 3c*2 - 142c + 661c - 177c - 72c. 3c*2 + 270c Collect the terms in 32835 - 335k3 - 32835. -335k*3 Collect the terms in -51801z*2 - 51796z*2 + 310766z*2 - 51793z*2 - 51792z*2 - 51793z*2 - 51792z2. -z2 Collect the terms in -1455r + 5265r + 599r + 2402r + 1680r. 8491r Collect the terms in -18b + 42 - 13b - 42 - 140b. -171b Collect the terms in -160d2 + 174d*2 + 168d*2 - 343d*2 + 175d*2. 14d*2 Collect the terms in 9704m*2 + 9726m*2 + 9707m*2 - 58271m*2 + 9707m*2 + 9716m*2 + 9710m2. -m2 Collect the terms in 176a - 3826255811 + 3826255811. 176a Collect the terms in -30j2 - 3j*2 + 74 - 9j - 74 + 2j2. -31j*2 - 9j Collect the terms in -763839 + 511907 - 2212016 + o. o - 2463948 Collect the terms in 4795m - 4793m - 21 + 145 + 91. 2m + 215 Collect the terms in 22 + 120q*2 + 17 + 26 - 65 - 5q. 120q2 - 5q Collect the terms in 63 - 17 + 17 + 4g + 54 + 33. 4g + 150 Collect the terms in 5x2 + 26 - 45x*3 - 130x*3 - 5x*2 + 11x. -175x3 + 11x + 26 Collect the terms in -126g2 - 33g*2 - 8g*3 + 176g*2. -8g*3 + 17g*2 Collect the terms in 129w*2 - 6 + 6 - 53w*2 - 116w - 82w2. -6w*2 - 116w Collect the terms in -547125 - 22v2 + 547125. -22v*2 Collect the terms in 23703 - 11814 + 167q*3 - 11889. 167q*3 Collect the terms in 299295219u + 1 - 149647624u - 1 - 149647620u. -25u Collect the terms in -3062380 + 1530236 + 1532144 - 7s. -7s Collect the terms in 98g + 59g - 148g + 110 - 207 + 117. 9g + 20 Collect the terms in -102308i*2 + 204632i*2 - 17i*3 - 102324i*2 - 25i*3. -42i*3 Collect the terms in -103c*2 + 3098c*2 - 2537c*2. 458c*2 Collect the terms in 642i*3 + 1711i*3 - 1662i*2 + 3317i*2 - 1655i*2. 2353i*3 Collect the terms in -2 - 2y*2 - 3y*2 + 2 - 520270y. -5y2 - 520270y Collect the terms in -283t2 - 18t*2 - 638t*2 - 2t - 139t2 - 51t*2 + 356t*2. -773t*2 - 2t Collect the terms in k + 1738965036328028 - 1738965036328028. k Collect the terms in 0l + 36l*3 + 0l + 56668l2 - 48l*3 - 56665l*2. -12l*3 + 3l*2 Collect the terms in 14639b*3 - 2751b*3 + 32203b*3. 44091b*3 Collect the terms in 243a*2 - 35a*2 + 476a*2 - 272a*2 + 461a*2. 873a*2 Collect the terms in -318k - 969k - 364k - 733k - 977k. -3361k Collect the terms in 2502916734a*2 - 1251458405a*2 - 1251458331a*2. -2a*2 Collect the terms in 2p*3 + 0 + 6549p*2 - 6p*3 + 68p - 33p + 1 - 40p. -4p3 + 6549p*2 - 5p + 1 Collect the terms in -38009h + 9 + 38961h - 9. 952h Collect the terms in 4k*3 + 0k*3 - 60890k + 60889k - 2k*3. 2k*3 - k Collect the terms in 31798h + 67283h - 31051h + 238521h. 306551h Collect the terms in k + k - 2k + 143887756363k*2 - 143887756182k*2. 181k*2 Collect the terms in 1501r*2 - r + r - 30357270r*3 + 30357269r3. -r3 + 1501r2 Collect the terms in 2p*2 + 5p*2 + 30253 - 57946 + 27693. 7p*2 Collect the terms in -m + 25978557733 - 25978557733. -m Collect the terms in 43c*2 - 129 - 263c*2 - 137 + 518 - 134 - 119. -220c*2 - 1 Collect the terms in 3 + 27r - 5 + 0 - 33r + 1 + 7814r*2. 7814r*2 - 6r - 1 Collect the terms in 3g - 3g - 114113134g3 + 114113112g*3. -22g*3 Collect the terms in -5720r*3 + 9r + 4382r3 - 3r - 6r. -1338r*3 Collect the terms in -4z - 7323 - 6z + 9z + 7380. -z + 57 Collect the terms in -1652l3 - 2407l*3 - 2809l*3. -6868l*3 Collect the terms in 9d - 54d3 - 41d*3 + 196d*3 - 50d*3 - 45d*3 - 13 + 3d. 6d3 + 12d - 13 Collect the terms in -2l + 4 + 41 - 8 - 6l. -8l + 37 Collect the terms in -44334p*2 + 83715p*2 - 39448p*2. -67p*2 Collect the terms in -8997 - 2j + 1937 - 4984. -2j - 12044 Collect the terms in 23743b*3 - 79920b*3 - 128360b*3 - 86954b*3. -271491b**3 Collect the te	{ "pile_set_name": "DM Mathematics" }
nd give j. 8 Express (4 - 4 - k)(-2 - 1 + 1)(2 - 18 - 7) in the form zk + y and give z. -46 Express c2 - 6c*3 + 13c*3 + 22c*3 as gc*2 + tc*3 + pc + h and give p. 0 Rearrange -71 - 2r3 + 3r*3 - 2r + 69 to the form fr3 + o + gr + kr2 and give o. -2 Express -p - 7 + 11 + p + p3 + p in the form d + bp*2 + op*3 + sp and give o. 1 Rearrange g*4 - 146g*3 + 2 + 143g*3 + 0g*4 to kg*4 + ag*2 + m + tg*3 + pg and give k. 1 Express -r*2 - 25r*2 + 6 - 6 in the form kr*2 + br + l and give k. -26 Express v + 6v4 + 2 - 6 + 0 in the form kv*2 + b + nv + av3 + xv*4 and give x. 6 Rearrange (9o - 2o - o)(7o + 2o*2 - 10o + 0o2 + 1)(-4 + 2 + 0) to bo2 + m + vo + do3 and give b. 36 Express (a3 + a - a)(-9 + 9 - a)(0 - 3 + 5) in the form sa*2 + ma*4 + ja*3 + k + xa and give m. -2 Rearrange -4m2 + 3m*2 + 0m*2 + (m + 3m + 10m)(3m - m - m) to the form pm + vm2 + t and give v. 13 Express 3g - 3g + g + g + 3g*3 as xg*3 + vg + u + fg2 and give x. 3 Rearrange (12d*2 - 14d*2 + 6d*2 + (d - 3d + 0d)(-d - 2d + d))(8 - d + 3d + 2) to td*2 + qd + w + rd3 and give t. 80 Rearrange -2s - 27s - 4s to cs + u and give c. -33 Rearrange 1 - 6 + 20x - x*3 - 17x - 10x to h + kx + ux3 + lx*2 and give u. -1 Express 3y - 5y - 13y*2 + 5y*2 + y in the form ty + qy2 + s and give q. -8 Rearrange h2 - 2h2 - h2 + (1 - 1 + 1)(-8h2 - 5 + 5) - h2 + h - h to the form yh + f + mh*2 and give m. -11 Express -b + 0b*3 + 2b + 3 - 2b3 in the form tb*3 + jb*2 + zb + s and give s. 3 Express o2 - o3 - o*2 + (7o*2 - 3o*2 - 2o*2)(14o + 59o + 23o) as co*3 + vo + b + lo2 and give c. 191 Rearrange (2q - 4 + 4 + (1 - 2 - 2)(2q + 0q - q))(3 - 1 - 4) to hq + v and give h. 2 Rearrange (-8 - 3 - 4)(4 - 4 + w) to o + fw and give f. -15 Express -3w*3 + 8w + 2w3 + 63w*2 - 61w*2 as lw*3 + vw + iw2 + b and give l. -1 Rearrange -f + 0f + 3f + 3f to the form df + w and give w. 0 Rearrange (2 + h - 2h + 1)(-5h*3 + 7h - 7h) to the form uh + kh2 + xh*4 + gh*3 + n and give g. -15 Express 14l - 111 + 111 as gl + w and give g. 14 Rearrange -3u + 263 - 536 + 12u4 + 271 to the form gu*4 + tu + ou3 + z + xu*2 and give z. -2 Rearrange 13 + 2c*3 + 16 - 2 to b + qc*3 + mc*2 + gc and give q. 2 Rearrange -9 - 33y2 + 9 to fy*2 + r + sy and give f. -33 Rearrange 2h2 - h - 2h*4 + 5 - 2h*3 - 3h*2 + 4h*2 to the form gh + jh3 + dh*2 + kh*4 + z and give g. -1 Rearrange 10b*2 - 4b*2 + 4 + 3b + 1 - 4 to the form n + qb + kb*2 and give n. 1 Rearrange -26 + 20t - 9t - 8t to the form u + st and give u. -26 Rearrange 3y + 93 - 93 to py + s and give p. 3 Rearrange (0 + 4 - 2)(-37c + 2c*2 - 45c + 76c) to dc*2 + x + wc and give w. -12 Express o*4 + 6o*2 - 4o*2 + 2o3 - o2 + 3o4 as u + yo + xo3 + jo*4 + zo*2 and give z. 1 Rearrange (-2 + 5 - 5)(1 + 5 - 4)(2o*2 - 2o + 2o) to h + ro + yo2 and give y. -8 Rearrange 5g - 17g + 46g to i + ug and give u. 34 Express (-5n - n + 2n)(-3 - 2 + 1)(-2 - 6n*2 + 2) in the form g + hn*3 + kn + an2 and give h. -96 Rearrange -119w*2 + 47w*2 + 50w*2 - 1 to hw + aw2 + b and give a. -22 Express (-4 + 1 - 2)(-2 - 5 + 5)(3b2 + b2 - b*2) as yb + w + cb2 and give c. 30 Rearrange (-g + 3g - 3g)(g2 - g2 + g*2)(-68 - g + 68) to the form ag + m + ig*3 + wg*2 + qg*4 and give q. 1 Rearrange -1 - 2 - 3t*2 + 5 to the form g + ot*2 + st and give g. 2 Rearrange ((1 + 1 - 3)(-1 - 2y + 1) + y - 3y + 3y)(-4 - 1 - 2) to l + vy and give v. -21 Express (z - 3z + 3z)(1 + 2 - 2 + 6z) as iz2 + tz + l and give t. 1 Express -r*2 + 2r*2 - 3r*2 + (4 - 2r - 4)(-83 + 6r + 83) + 3r2 - 4r*2 + 0r*2 as hr*2 + fr + d and give h. -15 Rearrange -12p2 + 10p*2 + 3p*3 - 4 + 4 to k + qp*2 + xp*3 + jp and give q. -2 Express -15t3 - 2 + 5 + 17t*3 + 0 + 15t as vt3 + z + ct*2 + xt and give x. 15 Rearrange -1 + c*2 + 2 - 2c*3 + 2 - 4 to jc*2 + p + lc*3 + bc and give l. -2 Rearrange 1 + 71q + 1 - 6q*2 - 71q to the form oq + yq*2 + b and give b. 2 Rearrange 16b*2 + 26b*2 + 0b*2 to the form ub + qb2 + o and give q. 42 Express (-6h + 4h + 3h)(-2h*2 - 9h*2 + 3h*2 + (-3 + 3 - h)(h - 2 + 2)) in the form oh + rh*3 + k + ih2 and give r. -9 Express -p3 - 2p2 + p2 + 0p*2 - 9p*2 as jp*2 + r + up*3 + fp and give r. 0 Express k*2 + 10k - 7k + 26k + 0k2 in the form bk*2 + yk + j and give y. 29 Rearrange -6o2 - 23 + 12 + 7o*2 to the form no + lo2 + u and give n. 0 Rearrange (-3 + 3 - 1)(-4 + 5 + 0)(41x - 21 + 14 + 8) to the form o + dx and give d. -41 Express 3l*4 + 3 - l - 3l*4 - 2l*4 as ml*3 + sl + yl4 + d + ol*2 and give s. -1 Express (3y + y - 2y)(2y - 3 + 3)(-y + 2y - 2y + (6 - 2 - 2)(-2y - 5 + 5) - 32 - 6y + 32) as c + ly*3 + oy*2 + ky and give l. -44 Rearrange -5 + 31 - 2o - 3 to so + d and give d. 23 Rearrange -27o + 24o - 15o - 29o to the form yo + d and give y. -47 Express (3s - 2s - 3s)(-145s*2 + 74s*2 + 11 + s + 70s*2) as us*2 + j + ws*3 + ps and give p. -22 Express (-1 + 3 - 4 + 3 - 2 - 4 + (-2 + 4 - 4)(-1 + 1 - 2))(-14 + 14 + 8v) as jv + t and give j. -8 Express -5i2 - 3i*2 + 2i*3 - 29 + 17 + 10 in the form f + yi*2 + wi + li3 and give y. -8 Express -2p - 24 - 2p3 - p3 - 5p*4 + 26 + 2p*3 as qp*4 + tp*2 + dp*3 + c + ip and give q. -5 Express 9q2 + 30q - 17q - 14q in the form mq + tq*2 + j and give t. 9 Rearrange 72i + 65i - 33i + 47i to the form z + vi and give v. 151 Express m - 1 - m*3 + 8m*2 - 8m*2 + 0m + m*4 in the form q + jm + vm3 + lm*2 + nm*4 and give v. -1 Express 2h*3 + 3h3 - h3 + (19h - 19h + 3h3)(4 - 3 + 0) as nh + vh*2 + gh*3 + k and give g. 7 Express 0g*2 - 8 - 7 + 2g*4 + 2 + 2g*2 as bg + tg3 + jg*4 + s + og2 and give s. -13 Express (-h2 + 4h2 - 1 - 4h*2)(-3 - 2 - 14) as o + qh2 + rh and give q. 19 Express 2p + p - p as m + jp and give j. 2 Rearrange 1 + 105u3 - 51u3 + u2 - 55u3 to the form r + tu + hu3 + nu*2 and give r. 1 Rearrange (9i - 6i2 + 2 - 11i + 5i2)(0i2 - 3i*2 + 5i*2)(2 - 2 + 2) to wi + pi*3 + c + vi*4 + ji*2 and give v. -4 Rearrange (18 + 4x - 18)(-3 - 2 + 4 + (-4 + 5 - 2)(-1 - 2 + 1)) to a + sx and give s. 4 Rearrange (0l2 - l2 + 4l2 + (1 - l - 1)(-l + 2l - 3l) - 2l - l2 + 2l + 2)(4l - 3l - 3l) to il2 + o + rl*3 + wl and give o. 0 Express (7 - 7 - 3r2)(-r + 4r + r)(4 - 7 + 4) in the form ur + ar*3 + v + pr*2 and give a. -12 Rearrange 8t*3 + 1 - 4t*3 - 2t*3 + 2t to the form m + vt2 + at*3 + pt and give p. 2 Rearrange -5j2 - 1 - 52j*2 + 1 to r + aj*2 + uj and give a. -57 Express -12 + 167q2 - 169q*2 + 3 in the form tq + nq2 + s and give n. -2 Rearrange (10 + 5 - 20)(u*4 + 3u - 3u) + 5u*4 - 3u*4 + 0u*4 to the form hu*3 + j + lu + tu2 + qu4 and give q. -3 Rearrange -y3 + 87y2 - 87y*2 + y to ty*3 + ky*2 + hy + n and give t. -1 Rearrange -2s3 + 2s4 + s4 - 4s4 + (3s*2 - 4s*2 + 2s*2)(4s2 - s2 + 2s*2) to the form cs*3 + i + us*4 + ms*2 + hs and give m. 0 Express (3 - 3 - o)(9 - 4 + 1) in the form k + io and give i. -6 Express (3m + 5m*2 - 3m)(4 + 0 - 2) + (-2 + 2 + m)(-4m - 2m - m) in the form om + nm*2 + s and give n. 3 Rearrange 0k + 4k - 2k + (-4 + 2 + 1)(2k + 2k - 3k) + (-21 + 9 + 9)(-2k - 2k + 6k) to the form vk + h and give v. -5 Express -56 + 56 - 18j in the form zj + l and give z. -18 Rearrange (-168 + 167 + 11d - 12d)((1 + 2 - 4)(1 - 4 + 4) + 6 - 3 - 4) to m + cd and give m. 2 Express -8 + 23 - 29q - 15 as f + oq and give o. -29 Rearrange -2d3 + d2 - d2 + (0d - 3d + d)(30d2 - 22d*2 + 11d*2) to the form s + zd*3 + cd*2 + vd and give z. -40 Rearrange (0x2 + 3x2 - x2)(2 + 1 + 17x - 13x) to the form tx + hx2 + qx*	{ "pile_set_name": "DM Mathematics" }
5a3/6 - 571a*2. Determine -5j(x) + 12u(x). 15x*2 Let w(g) = -169g*2 - 104g + 13. Let r(c) = -39c2 - 26c + 3. What is 18r(m) - 4w(m)? -26m2 - 52m + 2 Let w(p) = 6p2 + 3p + 3. Let t = 0 + -3. Let h(r) = -6r + 14. Let v = -95 + 98. Let j be h(v). Let q(z) = -5z*2 - 2z - 3. Determine jq(d) + tw(d). 2d2 - d + 3 Let u(y) = 1. Let b(s) = -6s. Let q(j) = j + 1. Let m(n) = 4b(n) + 28q(n). Suppose -64r + 47 + 57 = -24. Determine rm(v) - 56u(v). 8v Let h(n) = -8n - 12218. Let a(q) = 3q + 6123. What is -5a(b) - 2h(b)? b - 6179 Let s be 0 + 0/(-1) + (-3)/(-1). Suppose 22 = 4t + 4j - sj, 3j = 3t - 24. Let m(b) = -12b + 7b + tb. Let d(x) = 2. Give -d(q) + m(q). q - 2 Let x(l) = 8l + 1. Let r(a) = 23a + 3. Let f be 8 + (251)/(-28 + 27). Determine fx(w) + 6r(w). 2w + 1 Let u(j) = -298 + 899 - 305 + 2j - 298. Let y(g) = 3g - 3. What is -4u(z) + 3y(z)? z - 1 Let o(p) = p*2 - 36p + 7. Let m(j) = -j*2 + 45j - 9. Let r(i) = -4m(i) - 5o(i). Suppose -2y - 3y = 5. Let t(q) = q*2 - q - 4. What is yt(c) - 2r(c)? c2 + c + 2 Suppose 47d - 52d - 22 = -2i, -4d = 16. Let f(r) = -6r*3 + 5r*2 + 5r + 9. Let x(n) = -n*2 - n - 1. Give if(z) + 5x(z). -6z*3 + 4 Let v(z) = -41z*2 - 97z + 7. Let c(k) = 41k2 + 86k - 9. Calculate -9c(t) - 8v(t). -41t2 + 2t + 25 Let q(z) = 2z2 + 30. Let a(w) be the third derivative of -w5/60 - 5w*3/2 - 2w*2 + 131. What is -5a(d) - 2q(d)? d2 + 15 Let q(a) = -17a*3 - 11a*2 + 7a. Suppose 58n = 154n + 111n - 828. Let x(s) = -9s*3 - 6s*2 + 4s. Determine nq(m) - 7x(m). -5m3 - 2m*2 Let q(m) = 433m + 36. Let k(z) = 1301z + 125. What is 2k(s) - 7q(s)? -429s - 2 Suppose 2s - 68 = -5f + 6s, 0 = -f - 3s + 6. Suppose 0 = 26r - 17 - 87. Let j(b) = -b3 + 3. Let g(v) = v3 - 1. Determine fg(m) + rj(m). 8m*3 Let g(f) = -3f*2 - 23. Let p(x) = 2x*2 + 24. Suppose 2d + 7 = h, 3d + 4h + 174 = 158. Give dp(o) - 3g(o). o*2 - 27 Let y(m) = 36m*3 + 4m*2 + 4m - 13. Let r(l) = -l*3 + 2l*2 + 2l - 3. What is -2r(v) + y(v)? 38v*3 - 7 Let a(p) = 2p3 + p2 + 4p + 3. Let c(w) be the second derivative of 3/10w*5 - 3 + 9/2w*2 + 11/6w*3 + 1/6w*4 + 9w. Determine -11a(b) + 4c(b). 2b3 - 3b*2 + 3 Let w(g) = 14g*2 - 35g. Let r(a) = 16a2 - 48a. What is -3r(t) + 4w(t)? 8t2 + 4t Let h(i) = -i*2 + 3i2 - i2. Suppose 0 = b + n - 3n - 2, 10 = 5n. Let q(o) = -8o2 + 2o + 2. Let g be (-2)/2(-1)/44. Give bh(s) + gq(s). -2s2 + 2s + 2 Let s(f) = -7f3 - 6f*2 - 6. Let d(t) = 4t*3 - 5t3 - t2 + 0t3 - 162201 + 2t*3 + 162200. Calculate 6d(p) - s(p). 13p3 Let z(d) be the first derivative of d3 + 2d*2 + 5d - 54. Let n(w) = 17 + 26 - w - 70 - w*2 + 26. Give 5n(p) + z(p). -2p2 - p Let t = 12818 + -12821. Let n(c) = 4c*3 + 2c*2 - 4c + 1. Let q(p) = -3p2 + 5p - 2 + 0p3 - 5p*3 + 0. Determine tn(u) - 2q(u). -2u*3 + 2u + 1 Suppose 0 = 4q + j + 24, -5q - 3j = -2785 + 2829. Let d(t) = -910t*2 - 105t + 105. Let z(v) = 35v2 + 4v - 4. Give qd(h) - 105z(h). -35h2 Let i = -18 + 34. Let h(z) = 6z*2 - 16z + 16. Let g(x) = -x*2 - x + 1. Let k(j) = 4j*2 + 8j - 8. Let l(a) = 5g(a) + k(a). What is il(c) + 3h(c)? 2c*2 Let c(z) = -150z*3 + 9z*2 - 3z + 9. Let s(o) = -74o3 + 4o*2 - o + 4. Give -4c(m) + 9s(m). -66m*3 + 3m Let f(i) = 26647i + 14. Let k(d) = -8904d - 4. Determine 2f(l) + 7k(l). -9034l Let n(y) = 7y*2 + 11y + 158. Let s(w) = 4w2 + 5w + 77. Determine 2n(z) - 5s(z). -6z2 - 3z - 69 Let t(r) = 808r + 12. Let y(a) = -429065a - 6370. Give 3185t(g) + 6y(g). -910g Let c(q) = 68q*3 + 5q*2 - q + 54. Let i(o) = 67o*3 + 6o*2 - 2o + 64. What is -6c(j) + 5i(j)? -73j3 - 4j - 4 Let k(c) = -19c - 9c - 6 - 29c + 77c. Let q be 4/2(4 - 2). Let w(m) = 7m - 2. Calculate qk(y) - 11w(y). 3y - 2 Let i(w) = 21w*2 + 46w - 11. Let t(u) = -2u2 - 11u. Let v = 174 + -172. Let g(h) = -h*2 + h + 1. Let n(f) = vg(f) + t(f). Determine 2i(s) + 11n(s). -2s2 - 7s Let m(v) = -629v3 - 37v*2 + 37v. Let y(a) be the second derivative of -7a5/4 - a4/6 + a3/3 + 245a + 5. Determine -2m(q) + 37y(q). -37q3 Let o(r) = 2 - 1 + 6 - 3. Let f(c) = c3 - 7. Let w(l) = -l2 - 10l - 16. Let v be w(-9). What is vo(s) - 4f(s)? -4s3 Let v(g) = g3 - 37g*2 - 38g - 11. Let d be v(38). Let t(b) = 9b3 + 13b*2 + 3b - 17. Let r(y) = 5y3 + 7y*2 + 2y - 9. What is dr(f) + 6t(f)? -f3 + f2 - 4f - 3 Let g be 3/(-9) + (-8)/(-6). Let h be g + 1 + (-4 - -5). Suppose 8720m - 6 - 42 = 8708m. Let j(w) = -6w - 5. Let n(k) = 7k + 6. Calculate hn(d) + mj(d). -3d - 2 Let w(l) = l. Let s(u) = 1. Let g = 0 - -1. Suppose 21 = 5o + 6. What is gs(i) + ow(i)? 3i + 1 Let y(c) = -218c + 314. Let m(h) = 145h - 194. Determine -8m(z) - 5y(z). -70z - 18 Let c = -8 + 2. Let h = -373 - -322. Let r be h(10/8 + (-66)/72). Let f(w) = -w*2 - 7w - 8. Let s(o) = 3o2 + 20o + 23. What is cs(k) + rf(k)? -k*2 - k - 2 Let i(n) = -2n*2 + n. Suppose -375 = -59l + 18l - 34l. Let k(h) = -2h + h2 - 3h + 4h. Calculate lk(s) + 5i(s). -5s*2 Let p(y) = 11y. Let x(g) be the first derivative of -7g2 - 18g*2 - 7 + 9g*2. Let b be ((-34)/(-10))/(7/35). Determine bp(f) + 6x(f). -5f Let o(m) = -17m3 + 7m. Let w(i) = -6i3 + 2i. Suppose 150p = -2j + 152p - 6, -2j - 41 = 5p. Determine jw(d) + 3o(d). -3d*3 + 5d Let a(m) = 3m - 8. Let f(s) be the first derivative of -s2 + 4s - 313. Let c = 662 + -665. Give ca(i) - 5f(i). i + 4 Let x(j) = 173j + 5. Let g(b) = 119b + 4. Give 7g(z) - 5x(z). -32z + 3 Let n(t) = -1. Let l(x) = 88x - 528. Let y be l(6). Let k(o) be the third derivative of -1/24o4 + 0 + yo + 22o2 + 1/2o*3. What is 2k(d) + 5n(d)? -2d + 1 Let y(k) = k*2 - 6k - 1. Let o(v) = 6v2 - 345v - 2. What is -o(r) + 4y(r)? -2r*2 + 321r - 2 Let w(s) = s*2. Let k(m) = 11m*2 + 9m. Let o(q) = -k(q) + 4w(q). Let p(h) be the second derivative of h4/2 + 4h*3/3 - 29h. Determine 5o(u) + 6p(u). u*2 + 3u Let f(b) = b*2 + 5b - 4. Let u be (-12)/(-10)(-30)/(-9). Let z(p) = -4p + 3. Let x be 7/1 - (-8 - -10). What is uf(q) + xz(q)? 4q2 - 1 Let i(y) = -376y*3 + 5 - 5 - 379y*3 + 4y + 758y3 + 3y*2. Let f(h) = -3h*3 - 2h*2 - 3h. Give 4f(n) + 3i(n). -3n3 + n2 Let m(a) = -13a + 17280 + 17282 - 34560. Let r(f) = -31f + 11. Let h(l) = 16l - 6. Let x(j) = 7h(j) + 4r(j). Give -3m(p) + 4x(p). -9p + 2 Let r(p) = 116p + 3711. Let n be r(-32). Let t(i) = 7i - 4. Let k(a) = -5a + 1. Let u(j) = 9j - 2. Let h(w) = -7k(w) - 4u(w). Determine nt(c) - 4h(c). -3c Let q(a) = -6a. Let x(f) = 2f - 2. Let i(r) = -15r - 173. Let d(u) = -i(u) - 5x(u). Let l be d(-36). Let m(k) = -5k - 1. Determine lm(y) - 2q(y). -3y - 3 Let u(z) = 7z2 + 2z + 5. Let o(t) = 11t2 + 4t + 10. Give 2o(q) - 5u(q). -13q2 - 2q - 5 Let b(v) = -1. Let a be (-8)/(-6) + (-196)/(-6). Suppose z = 1, -3o + a = -0o - 2z. Suppose -o = 34f - 32f. Let c(r) = -r + 4. Give fb(q) - c(q). q + 2 Let x(y) = -1. Suppose -3 + 13 = 5c, -v - 9 = -5c. Let r(f) be the third derivative of f*4/8 + 4f*3/3 + 15f*2. What is vr(u) + 5x(u)? 3u + 3 Let o(c) = -5c2 + 793300 - 5c - 793298 + 0c2 - 9c*2. Let b(w) = 9w*2 + 3w - 1. What is -8b(z) - 5o(z)? -2z2 + z - 2 Let d = 8152 - 8152. Let c(f) be the third derivative of -f3 + df + 0 + 1/24f4 + 10f*2. Let x(l) = -l + 7. Give -6c(h) - 5x(h). -h + 1 Let y(k) = 5k + 89. Let u(x) = -15691x + 31394x - 15704x - 18. Give 11u(w) + 2y(w). -w - 20 Let a be ((-40)/(-6))/(60/45). Let i(p) = 1. Let s(t) = -4t + 8. Calculate ai(b) - s(b). 4b - 3 Let v(w) = -19w3 - 13w*2 - 31w. Let a(g) = -9g3 - 6g*2 - 15g. Let t(p) = -p*2 - 77p - 774. Let o be t(-65). Determine ov(j) - 13a(j). 3j3 + 9j Let q(w) = -14w2 + 29w + 419. Let a(x) = 20x2 - 41x - 628. What is 5a(g) + 7q(g)? 2g2 - 2g - 207 Let y(d) = 649d2 + 6d + 8. Let s(x) = -1302x2 - 10x - 14. Give -5s(m) - 9y(m). 669m2 - 4m - 2 Let t(o) = o**2 + 3. Let d(q) =	{ "pile_set_name": "DM Mathematics" }
45010? -43545003 In base 9, what is -2635 + 20? -2615 In base 14, what is -4 - d9153? -d9157 In base 14, what is -13 + -19423? -19436 In base 16, what is 2 + -a778? -a776 In base 7, what is 604 + -1156? -252 In base 13, what is -2a8c7 - 1? -2a8c8 In base 3, what is -11 + 1022112020? 1022112002 In base 11, what is 5a5 - a4? 501 In base 11, what is 1a7a + 5? 1a84 In base 13, what is 1 - -a575? a576 In base 6, what is 42 - -2143240? 2143322 In base 12, what is -21346 + 5? -21341 In base 15, what is 431 - -147? 578 In base 12, what is 71945 - 26? 7191b In base 4, what is -1 - -313321101? 313321100 In base 12, what is -1 - 5115b? -51160 In base 11, what is -27 + 177? 150 In base 12, what is -106329 - -12? -106317 In base 12, what is 117 - 21b0? -2095 In base 11, what is 36 + 34645? 34680 In base 10, what is -4 + 339784? 339780 In base 3, what is 10 + 101111220? 101112000 In base 13, what is 3 + -c397? -c394 In base 13, what is 54 + 224? 278 In base 5, what is 4 + 31412? 31421 In base 6, what is -20045305 - -5? -20045300 In base 11, what is -37064 - -4? -37060 In base 8, what is 5 + -21332? -21325 In base 5, what is 3 - -13201011? 13201014 In base 7, what is -254 + 41435? 41151 In base 3, what is 120200121221 - 11? 120200121210 In base 11, what is -57a - 489? -a58 In base 15, what is -b + -272? -27d In base 8, what is -11 - -355636? 355625 In base 5, what is -10 + 4122432? 4122422 In base 11, what is -583 + 8? -576 In base 14, what is -4ad8 + 59? -4a7d In base 6, what is -24 + 215? 151 In base 12, what is 71158 - 5? 71153 In base 11, what is 73 + -727? -664 In base 16, what is -84a8 + -f? -84b7 In base 11, what is 5 - -5a6334? 5a6339 In base 4, what is 201 - -302300? 303101 In base 5, what is -13413 + -1? -13414 In base 14, what is -51a3 + -4? -51a7 In base 6, what is -124411 + 0? -124411 In base 5, what is 212202 - -111? 212313 In base 13, what is -8 + 2448a? 24482 In base 10, what is 850 - -280? 1130 In base 6, what is -122344 + -124? -122512 In base 3, what is -1122201012 - 120? -1122201202 In base 6, what is 105115305 + -4? 105115301 In base 5, what is 33432324 - -2? 33432331 In base 12, what is -1871223 + -3? -1871226 In base 12, what is -10912 + 113? -107bb In base 6, what is -14552431 + 0? -14552431 In base 6, what is -13254533 - 5? -13254542 In base 14, what is -6cb5 + -18? -6ccd In base 8, what is 44637 + 1? 44640 In base 2, what is -10 - -1010101100? 1010101010 In base 16, what is 12e1 + 1c6? 14a7 In base 12, what is 17 - -159? 174 In base 13, what is -2256 + -92? -2318 In base 8, what is -5 - 4115553? -4115560 In base 11, what is -10a0 - 0? -10a0 In base 16, what is 7 - 9e2? -9db In base 14, what is 1 - 6a021? -6a020 In base 5, what is 20412112 + -2? 20412110 In base 14, what is -20d391 - -6? -20d389 In base 2, what is -1001 - 101110001011100110? -101110001011101111 In base 14, what is 2b - -b58? b85 In base 16, what is -db1 + -10? -dc1 In base 8, what is -244611 + 2? -244607 In base 5, what is 244 - -1401? 2200 In base 9, what is 66 - -2732? 2808 In base 2, what is -100 - -10111011001010? 10111011000110 In base 7, what is 501 - -106? 610 In base 11, what is -2713 - 14? -2727 In base 14, what is -1 + -3b6a? -3b6b In base 6, what is 2 - -123543? 123545 In base 14, what is 3ad - 740? -371 In base 15, what is -8e1 + a? -8d6 In base 7, what is -4 - 103443? -103450 In base 9, what is 78 + 55021? 55110 In base 5, what is 1034132102 - 4? 1034132043 In base 8, what is -46 - 1342? -1410 In base 3, what is -220200221 - 2? -220201000 In base 15, what is -1 - -36047? 36046 In base 12, what is -b84301 + 0? -b84301 In base 8, what is 37 - 2166? -2127 In base 4, what is 213130 - 2223? 210301 In base 4, what is 122 + 3331? 10113 In base 3, what is -121 - -22202202? 22202011 In base 6, what is 1130 + -504? 222 In base 11, what is 1617 + -116a? 458 In base 7, what is -3251126 + 3? -3251123 In base 11, what is 197 + 1a2? 389 In base 2, what is -11000111 - -1011011101010? 1011000100011 In base 4, what is -3002310300 + -11? -3002310311 In base 7, what is -14 + 542225? 542211 In base 5, what is -104 - -2112414? 2112310 In base 13, what is -10 + 2940? 2930 In base 5, what is -242403 - -21? -242332 In base 13, what is 2 + -39b15? -39b13 In base 9, what is -2 + 53105? 53103 In base 7, what is -2 + -2421? -2423 In base 16, what is 5 - -28cd? 28d2 In base 9, what is -156251 + -14? -156265 In base 8, what is -1637 + -503? -2342 In base 9, what is -2 + 476311? 476308 In base 9, what is -4 - -56430? 56425 In base 16, what is 4 - 63b7? -63b3 In base 10, what is 0 + 117988? 117988 In base 4, what is -11212120 - -23? -11212031 In base 14, what is 31840 + -4? 3183a In base 14, what is 4ac - -118? 5c6 In base 12, what is -9 - -54a5a? 54a51 In base 14, what is -5a1ab - -5? -5a1a6 In base 4, what is -20333310 + 2? -20333302 In base 14, what is -1196 + -d? -11a5 In base 8, what is 1151 + -45? 1104 In base 15, what is e + -84bd? -84ae In base 10, what is -4415 - -11? -4404 In base 4, what is 11 - 230131? -230120 In base 12, what is -7a69 - -7? -7a62 In base 16, what is f5 - -2cd? 3c2 In base 9, what is -80 + -252? -342 In base 5, what is -103410314 - 4? -103410323 In base 8, what is -253401 + -4? -253405 In base 4, what is -1100 - -2020? 320 In base 13, what is -7 + -96757? -96761 In base 14, what is 5a018 + -2? 5a016 In base 16, what is -1c8 - -858? 690 In base 11, what is -4036 + 42? -3aa4 In base 2, what is -1100 + -1000101111101110? -1000101111111010 In base 7, what is -16242 + 66? -16143 In base 9, what is 2 + 2307440? 2307442 In base 3, what is -1012010120 - -1? -1012010112 In base 7, what is 3 - -36632? 36635 In base 15, what is -27 - -a1? 79 In base 16, what is -9 - -5333? 532a In base 4, what is 21313 + -112? 21201 In base 7, what is -12 - 1030? -1042 In base 10, what is 1516 + -133? 1383 In base 8, what is -31 + 14456? 14425 In base 16, what is -3b3c6 + 2? -3b3c4 In base 11, what is 2a + 13a3? 1422 In base 5, what is 22142234 - 10? 22142224 In base 4, what is 2030 + -121031? -113001 In base 3, what is -11120 - -111? -11002 In base 13, what is 12a61 + -3? 12a5b In base 7, what is -50 - -204645? 204565 In base 4, what is 132213 + -3113? 123100 In base 3, what is -11 + 102122011? 102122000 In base 6, what is -142 - -5503? 5321 In base 15, what is 17bd4 + 4? 17bd8 In base 10, what is 775 - -532? 1307 In base 3, what is 122111 + -10222? 111112 In base 3, what is -1122002001 - -11? -1122001220 In base 14, what is 548 + 141? 689 In base 6, what is 1 - 1510043? -1510042 In base 5, what is -212133 + -2443? -220131 In base 6, what is -202354 + 24? -202330 In base 11, what is 22764 + 3? 22767 In base 8, what is -3567 + 631? -2736 In base 4, what is -1213323312 + -2? -1213323320 In base 9, what is -370638 - 3? -370642 In base 12, what is -381 - aa? -46b In base 6, what is -2454 - -2? -2452 In base 8, what is -4 + -6024? -6030 In base 12, what is 264 + 2633? 2897 In base 4, what is 220 - -20123? 21003 In base 11, what is -16 - 118116? -118131 In base 15, what is -de + -9b? -18a In base 6, what is 40421 + 1? 40422 In base 7, what is 0 + 45536? 45536 In base 13, what is 125 + -94ca? -93a5 In base 14, what is -c - -142ad? 142a1 In base 5, what is -20402020 - 22? -20402042 In base 12, what is 5 + 1a0a1? 1a0a6 In base 4, what is 0 - -1030102? 1030102 In base 5, what is 203330103 + 0? 203330103 In base 11, what is a82 + -5? a78 In base 4, what is -21212213022 - 3? -21212213031 In base 6, what is 5 - 404214? -404205 In base 6, what is -3301514 + 3? -3301511 In base 9, what is -1 - 1222472? -1222473 In base 5, what is 2222 + 1010? 3232 In base 15, what is 1d4be - 3? 1d4bb In base 15, what is 6191 + -4? 618c In base 14, what is -c45 - 40a? -1251 In base 11, what is 33389 + 11? 3339a In base 6, what is 5055041 + -2? 5055035 In base 13, what is -216 - 350? -566 In base 16, what is -45e - ad? -50b In base 15, what is 1a74 - -48? 1abc In base 8, what is -24227 + 3? -24224 In base 16, what is 0 - 10afe? -10afe In base 4, what is 23100 + 2? 23102 In base 11, what is -2 + -62011? -62013 In base 11, what is -15 + -939? -953 In base 2, what is -10 - -1101011110? 1101011100 In base 2, what is 100000110101101 + 101? 100000110110010 In base 10, what is -477 - 20? -497 In base 8, what is 3 + -125	{ "pile_set_name": "DM Mathematics" }
. Let a be p(11). Let f be -2 - (-27)/15 - (-4)/(-5). Put a, -5, f in descending order. a, f, -5 Suppose -8f - 2 = 30. Let l = 15 - 17. Sort f, l, 29 in decreasing order. 29, l, f Let x be 371/(-119) - 8/(-68). Sort 1/6, -0.3, -0.2, x. x, -0.3, -0.2, 1/6 Suppose 0 = -50n - 678 - 322. Put -4, 3, 5, n in descending order. 5, 3, -4, n Let s(f) be the first derivative of -f*2/2 - 14f - 14. Let l be s(-13). Sort l, -5, -8 in increasing order. -8, -5, l Let c(k) = -11k3 + k. Let u be c(-1). Suppose uj = 8j. Suppose n - 1 + 4 = 0. Sort j, 5, n in descending order. 5, j, n Suppose -3c - 4w = 35, -15 = -28c + 32c - w. Put 3, c, 68 in ascending order. c, 3, 68 Let i(w) be the second derivative of -w5/20 + w4/4 - w3/2 + w2/2 + w. Let x be i(2). Suppose 0 = 8y - 9y - 5. Sort y, 2, x in descending order. 2, x, y Let c be 16/5(-2)/(-8). Let o = -1017.9 - -937. Let b = -81 - o. Put c, b, 0 in increasing order. b, 0, c Suppose j = 4j - 3q - 45, -j - 5q + 45 = 0. Put -7, 1, j in decreasing order. j, 1, -7 Let j = -13.49 - -12.69. Sort -1.1, j, 0.2. -1.1, j, 0.2 Suppose f - 3 = i + 1, -2i + f - 8 = 0. Suppose -14 = 3x + 5t, -x - 14 = 3x + 2t. Sort i, 19, x in descending order. 19, x, i Let f = 48.7 - -0.5. Let v = -48 + f. Let p = 960/5159 + -2/469. Put 2, v, p in ascending order. p, v, 2 Let c be (4 - 1023/258)(-4)/3. Sort c, -4, 2/9. -4, c, 2/9 Let c = 0.22 + 2.92. Let x = c + -3. Let b = x + 1.86. Sort b, 3, -0.1 in descending order. 3, b, -0.1 Let s = 2 - 7. Let u = 3.41 + -0.41. Sort 0.05, s, u in decreasing order. u, 0.05, s Let y be -1(-4 - -2)5. Suppose y = -2x + 8. Let r be (-4)/(-14 + (-1 - -2)). Sort x, r, -0.3. x, -0.3, r Let b = 1.26 + 0.14. Let u = 1 - b. Let a be 10/(-8) + 868/784. Put a, u, 0 in increasing order. u, a, 0 Let i = 272 - 271.5. Sort i, -4, 2/51 in increasing order. -4, 2/51, i Let k be -31 + ((-8109)/(-162))/17. Let o be ((-8)/6)/((-12)/(-2)). Let m = o - k. Put 1, -3, m in increasing order. -3, m, 1 Let v = 25 + -26. Let b(w) = -4w3 - w - 1. Let t(h) = h3 - 3h2 + 2h - 1. Let x be t(1). Let l be b(x). Put 1, v, l in decreasing order. l, 1, v Let t be (-3)/(3(-2)/22). Suppose -10 = -6i + ti. Sort 2, i, 3 in decreasing order. 3, 2, i Let k be ((-1)/3)/(20/420) - -5. Let s = -3 - -2.97. Put s, k, -3 in ascending order. -3, k, s Let o be 62/(-30) + (-12)/20. Let h = 30 + -47. Let f = h - -14. Sort f, 5, o in descending order. 5, o, f Let h be 4/(-10) - 34/(-10). Suppose -5v - 2 = h. Put v, 1, -5 in increasing order. -5, v, 1 Suppose -14m - 125 + 153 = 0. Sort m, -9, -11 in decreasing order. m, -9, -11 Suppose -4a - g + 2g = 17, -2g = a - 7. Let y be 1 - (-3 - -1)/2. Let j be 1(-1)/(3 - y). Put 3, j, a in increasing order. a, j, 3 Let m be -6 - 13/((-65)/50). Put 2, -5, -2, m in increasing order. -5, -2, 2, m Let t = 1/449 + -456/3143. Sort 2, 4, t, 6. t, 2, 4, 6 Let r = -466 + 468. Sort 32, r, -3. -3, r, 32 Suppose -6q + 16q = 40. Suppose -4 = -qv + 6v. Sort -4, v, 0 in descending order. 0, v, -4 Let g = -39 + 39. Let a be g + -1 - ((-39)/9 + 4). Sort -3, 1, 5, a in decreasing order. 5, 1, a, -3 Let c be (48/(-15))/(-5(-8)/100). Sort c, 10, -2 in increasing order. c, -2, 10 Let g(q) = q*3 - 7q*2 + 7q + 6. Let h be g(6). Suppose 0t = -4t - h. Put -1, 3, t, 0 in descending order. 3, 0, -1, t Let l = -234 + 234. Sort l, -271, -3 in descending order. l, -3, -271 Suppose 0 = 4s + 4r + 4, 9s + 15 = 10s - 3r. Sort -4, s, -1, 2 in descending order. s, 2, -1, -4 Suppose 0 = -5c - k - 270, 432 = -4c - 4c + 5k. Sort 1, c, 2. c, 1, 2 Let t be ((120/(-16))/(-5))/((-3)/(-8)). Put -1/5, t, -19 in decreasing order. t, -1/5, -19 Let d = 1498 - 1493. Sort -5, 397, d. -5, d, 397 Suppose 0 = -28n - 736 - 356. Sort n, -4/5, 0.5, 1. n, -4/5, 0.5, 1 Let g(d) = d2 - d + 3. Let j(k) be the third derivative of k6/120 + k*4/24 + 3k*2. Let p be j(0). Let a be g(p). Sort -5, 1, a in decreasing order. a, 1, -5 Suppose 5i - 10 = 2q + q, 0 = 3q - 15. Suppose 0l + l + 2 = ik, -l + k = -2. Let t = 1.79 + -2.29. Sort l, t, 0 in descending order. l, 0, t Suppose -193k + 191k = -8. Put 1, -4, k, -158 in decreasing order. k, 1, -4, -158 Suppose 104q - 59q = 90. Sort 0, -4, q in descending order. q, 0, -4 Let x = -63 - -50. Sort 5, x, 8 in descending order. 8, 5, x Suppose 5b - 8 - 2 = 0, -3y - b + 17 = 0. Sort y, 3, -18 in decreasing order. y, 3, -18 Let o = 10 + -10. Let s = o - -5. Let l(j) = -j*3 - 8j*2 - 3j + 29. Let w be l(-7). Put w, s, 4 in descending order. s, 4, w Let s = 627 + -632. Let p = 249 - 8219/33. Put 4, s, p in ascending order. s, p, 4 Let z = -2 + 51. Let y = 47.9 - z. Sort y, 2, -0.2, -3. -3, y, -0.2, 2 Let m = 6 + -10. Let t = 7.42 + -7.44. Sort t, 4, m, 5 in increasing order. m, t, 4, 5 Let u be -5 + (-25)/(-5) + 17. Sort 3, u, 5 in ascending order. 3, 5, u Let p be 15/(-10) - (-2)/(-4). Let q be (-24)/p5/20. Suppose qo = -12 + 3. Sort 5, 0, o in ascending order. o, 0, 5 Let f(d) = d*2 - 12d + 9. Let m(g) = -2g + 3. Let t be m(-4). Let s be f(t). Let u(i) = i2 + 11i + 14. Let y be u(-10). Sort 2, s, y. s, 2, y Let p = 1604.8 + -1605. Let f = -13 - -19. Let t = 8 - f. Sort 0.2, p, t in descending order. t, 0.2, p Let n be (-8)/(-2)3/12. Let j(m) = -m3 + 7m*2 - 8m + 12. Let k be j(6). Suppose k = -3q - 3i, -2i + 9 = -2q + q. Put -2, n, q in descending order. n, -2, q Let h = -80 - -75. Let i(x) = -x*2. Let v be i(1). Put h, v, 6 in decreasing order. 6, v, h Let p be ((-4)/(-1) + -2)/2. Let n = p - 2. Sort 2, 0, n in descending order. 2, 0, n Let s = 3.0275 - 0.0275. Sort 3/2, -2, s in increasing order. -2, 3/2, s Let p(m) = -6m + 55. Let d be p(10). Let v be 6/(-8)10/15-2. Put v, 5, d in decreasing order. 5, v, d Let z be (-12)/22 - (-5513)/407. Let a = 11 + -7. Put -1, z, a in ascending order. -1, a, z Let h = 12 + -18. Let f = -17 - h. Let s be 12 + f + (1 - -3). Put s, -4, 2 in descending order. s, 2, -4 Suppose 2g = -12, -w = -g + 104 - 115. Let z = 21 + -15. Sort 0, z, w, 2 in decreasing order. z, w, 2, 0 Let o(p) = 9p + 27. Let t be o(-5). Let y be 1 + (-4)/5 - t/(-90). Sort -9, y, 3. -9, y, 3 Suppose -9 - 1 = 5d. Let j(m) = -m3 - 5m*2 - 2m + 3. Let b be j(-4). Let o = -4 - b. Sort o, 5, d in ascending order. d, o, 5 Let q = -61/134 + -3/67. Put 2/7, 0, -0.3, q in decreasing order. 2/7, 0, -0.3, q Let h = 11 - 14. Suppose -5f - 4d - 68 = -28, -2d = -f - 8. Let r be (f/9)/((-4)/(-6)). Put r, -2, h in increasing order. h, -2, r Let j = -0.346 - -0.292. Sort 4, 5/6, -5, j in ascending order. -5, j, 5/6, 4 Let a = -0.1 - -0.3. Let q = 195.5 - 195. Let n = 1 + -0.9. Sort q, n, a in descending order. q, a, n Let s = -83 + 57. Let w be (-57)/(-18) - 3 - s/60. Sort -2, w, -0.2 in increasing order. -2, -0.2, w Let v(d) = 3d*3 + 5d*2 - 4d - 2. Let o be v(-2). Sort o, -18, -4, 0 in increasing order. -18, -4, 0, o Let p = -17 + 12. Let g = -4172 - -4145. Put g, p, -1 in increasing order. g, p, -1 Let r = 12/5 + -17/7. Sort 2/5, 3, r in decreasing order. 3, 2/5, r Suppose -3c + 1 = -11. Suppose 0 = 5n + c + 21. Sort -1, n, -19. -19, n, -1 Suppose 0 = b + 3j + 2 - 1, 2 = -j. Suppose 101w = 96w - 20. Sort b, w, 0 in ascending order. w, 0, b Let l be (508/16(-42)/7)/(-6). Sort 5/2, -1/3, l in descending order. l, 5/2, -1/3 Let p = 0.061 + -0.001. Let g = p - 0.16. Put g, -5, 6/25 in increasing order. -5, g, 6/25 Suppose -1 + 8 = -5z - k, -3k = -9. Suppose 8m + 44 = -12. Let u = z - m. Sort -1, u, 1 in decreasing order. u, 1, -1 Suppose 18 = 3d - 3r, r = 5d - 3d - 9. Let p(g) = -g + 10. Let j be p(10). Sort j, 4, 2, d. j, 2, d, 4 Let j = 104 + -107. Let i be (0 - j)3/(-522). Sort 4, -2, -3, i. -3, -2, i, 4 Let g be ((-1)/2)/((-15)/30). Put -13, g, -8 in descending order. g, -8, -13 Suppose -5y - 5j - 4 = 1, 2y = -3j - 3. Let l = -1402 + 1399. Sort -1, y, l, -4 in descending order. y, -1, l, -4 Let p = 1218 - 1214. Sort p, -141, 3 in ascending order. -141, 3, p Let z be 3 + (-3)/2 - 60/8. Sort 3, 5, z in descending order. 5, 3, z Suppose 0y - 6y = -24. Suppose 4o - 3m = -32, -3o = -3m + y*m + 11. Sort 6, 3, o, -3 in ascending order. o, -3, 3, 6 Let m = 63 - 66. Sort -5, m, 3, -4 in ascending order. -5,	{ "pile_set_name": "DM Mathematics" }
-731.4 and 3117749604? 3117750335.4 0.5 + -18855439.83902 -18855439.33902 Subtract 0.23748 from 0.13770868. -0.09977132 What is 291623929122 + 68? 291623929190 What is -0.5 less than -3859.800522? -3859.300522 Add -458276 and -361283950. -361742226 -125915200607+5 -125915200602 Calculate 0.1 + 124789459250. 124789459250.1 What is the difference between -97.1 and 1606302770? 1606302867.1 Add together -201727495 and 3166.1. -201724328.9 What is -41.265 - 9203.54026? -9244.80526 Subtract 304 from -26554.7477. -26858.7477 1809772624887 - 0.136 1809772624886.864 Add together 0.4765 and 0.61305378. 1.08955378 What is 4141.8 plus 130950512? 130954653.8 Calculate 0.153337 + 3.57912228. 3.73245928 Work out 47760279314 + -1484. 47760277830 Work out 358809 + 20275.871. 379084.871 Calculate -9455690 - -15197943. 5742253 Work out 4.11294352164 + -3. 1.11294352164 What is -27192 - -1975762070? 1975734878 Sum 0.20595 and -9386508. -9386507.79405 Calculate -8 + 11981167360892. 11981167360884 -21.411 + -5040173 -5040194.411 -6867 - 222463.6 -229330.6 What is -8122 + -0.0142708839? -8122.0142708839 -6480326093863+0.5 -6480326093862.5 294.5615 + 56478 56772.5615 Add together 40066 and -2344040140. -2344000074 0.0575+258.249494 258.306994 Subtract -4786731856 from 23527. 4786755383 584 - 633224852 -633224268 What is 632482670.94 plus 1012? 632483682.94 Calculate 7617606132.8 - 3247. 7617602885.8 What is 3682521.1 + -884.64? 3681636.46 Calculate 0.94 - 134396317434. -134396317433.06 What is -0.2 - -0.00126143003342? -0.19873856996658 -0.9 - 3007588479433 -3007588479433.9 Add together -160174873.316 and 4135. -160170738.316 Calculate 9.006 + 301403.8451. 301412.8511 Total of 356087445262 and -0.6. 356087445261.4 What is -13518658271 + 46.8? -13518658224.2 Calculate -16.1706 - 973394398. -973394414.1706 Add 3 and 646204.9260809. 646207.9260809 Subtract 15742 from -1.898758602. -15743.898758602 What is -5865 + -2015461.267? -2021326.267 -0.00701 - 135379905 -135379905.00701 Calculate 400 - 263109545. -263109145 Add -133208389266 and -46. -133208389312 What is -0.06 less than -483307.8788008? -483307.8188008 Add together -22099673.3 and 2.19607. -22099671.10393 What is -52363506.613 minus -11? -52363495.613 What is 1 take away 13847553219.711? -13847553218.711 0.3 + 9730548296075 9730548296075.3 0.0161578 - 13736290 -13736289.9838422 What is the difference between -88665579 and 1.0662? 88665580.0662 What is the distance between -4330.5 and -890.183069? 3440.316931 105.1 + -108014256 -108014150.9 Sum -127484.021 and -71.668. -127555.689 What is -32210 + -199.025934? -32409.025934 What is -187.2 minus 29804312? -29804499.2 2493+87411228.53 87413721.53 Total of 15 and 0.237857254356. 15.237857254356 Work out -7667890982.24 - -0.4. -7667890981.84 Total of -147633218 and -3721. -147636939 Sum -121 and -170138250728. -170138250849 What is 0.180337 take away 38463? -38462.819663 What is the difference between -367454901 and 2.86? 367454903.86 Calculate 593.5208 - 70557904. -70557310.4792 What is 10 less than 8820636116156? 8820636116146 What is -1552139 - -463176? -1088963 -2885.8 + -55872.4397 -58758.2397 What is 4798783 less than -5013? -4803796 Subtract 1417.997 from -32157824. -32159241.997 Calculate -2100442 - -2477.9. -2097964.1 What is 1177 take away 196601952? -196600775 What is 0.2 take away 813703.786376? -813703.586376 Total of 0.02487 and -0.435011756. -0.410141756 What is 54280664677 plus -304.3? 54280664372.7 -1573914.1 - -852 -1573062.1 Subtract 540882567.371 from -2.65. -540882570.021 What is 8132074998 take away -34.89? 8132075032.89 What is -0.1845091 take away -32603? 32602.8154909 Calculate -0.09994382884 - -84.443. 84.34305617116 Calculate 14.83607842 + 0.34. 15.17607842 What is -13576 + -7967584.96? -7981160.96 0.4 - 12568830319714 -12568830319713.6 What is 876.286 minus 12.6519? 863.6341 Calculate -181 - -347423536182. 347423536001 What is -10189 + 231295525.1? 231285336.1 What is the difference between 286075.441 and -0.26734? 286075.70834 What is -78482 minus -216598.07? 138116.07 0.151 + 371.34753403 371.49853403 Sum -14.7115 and -0.0480623. -14.7595623 2.8 + 882626699448 882626699450.8 What is the difference between 0.0623017021885 and 2660? 2659.9376982978115 -257305 - -0.085075372 -257304.914924628 What is -42994157566 - -561? -42994157005 Calculate 0.182165651 + 67953. 67953.182165651 What is -19 + 1003897278016? 1003897277997 Calculate -42.87 - 15522305. -15522347.87 What is the distance between -36389782209 and 1? 36389782210 What is -19343 take away 19513934? -19533277 Calculate -80.01887 + -1030192. -1030272.01887 What is 2373272001 + 296? 2373272297 What is 153372.8149 take away 23.9? 153348.9149 What is the difference between -26 and 337220091716? 337220091742 What is -0.08 + -2481433.3384? -2481433.4184 What is -147 plus 602.9544951? 455.9544951 29805429383+96.75 29805429479.75 Add together -348.994108264 and 396. 47.005891736 What is -4756.8612534 - 0.03011? -4756.8913634 Work out -10 - -208775445.3693. 208775435.3693 What is 3045659618.3 + -692? 3045658926.3 Work out -0.66 - 3596.013544. -3596.673544 Work out 7894853 + -307199. 7587654 Calculate -3651.406 - -779.098. -2872.308 What is -0.1248466 minus -797576238? 797576237.8751534 What is 4540916165.3 minus 0.3? 4540916165 Subtract 108.659 from -5275356612. -5275356720.659 What is the difference between -0.0156431655 and -1395? 1394.9843568345 Add together -325.3939 and -18914. -19239.3939 Work out 22368969550117 + -0.24. 22368969550116.76 Calculate 3899026968 - 0.11. 3899026967.89 What is -4597016 + -29590496? -34187512 What is 24282.093 + -0.15954? 24281.93346 Total of 0.265 and 2247112732122. 2247112732122.265 0.376436 - -375910195 375910195.376436 What is -255644 take away 261.2131? -255905.2131 Calculate -626 + -2831.62855. -3457.62855 1001+648670108 648671109 What is 5591153 less than 412127? -5179026 Calculate -1490303.84 + -21627.54. -1511931.38 Work out -0.122 + -336073865. -336073865.122 Calculate -50364.9678 + 0.0133. -50364.9545 Calculate 5 - 128886.955633318. -128881.955633318 What is -21549233 take away 9333.77? -21558566.77 Put together 1632.245793 and 53. 1685.245793 What is the distance between 1.082776811 and -33828? 33829.082776811 Work out 0.88 - -461641977963. 461641977963.88 What is the difference between 288604039086 and -1526? 288604040612 Work out -12834808790 - -408. -12834808382 What is 0.910579119 + -5.226? -4.315420881 -247855480713 + -0.4 -247855480713.4 -3539.77932+91451 87911.22068 Sum -1356436736 and 9.4. -1356436726.6 15709367.149 + -0.05 15709367.099 Add together 117468653007 and 1643. 117468654650 Add together -7 and 498951232712. 498951232705 What is 656.295505 plus 170? 826.295505 Work out 634883787 - 141. 634883646 Work out -2994.7 + 5354464375. 5354461380.3 What is 0.3156372 plus 0.876667? 1.1923042 Calculate 107372274549 + -8158. 107372266391 What is 5 take away 1363618531342? -1363618531337 Add together 100298237388749 and -0.1. 100298237388748.9 Sum -2 and -202099632509. -202099632511 What is 1.84 less than 1042875963? 1042875961.16 Calculate -155363806 - -0.4991. -155363805.5009 1062331+1219122 2281453 What is -1249.80622609 less than -0.2? 1249.60622609 What is 229419 + 43554102? 43783521 What is 48711325134 less than 0.172? -48711325133.828 What is 0.03 minus -448952101825? 448952101825.03 Calculate 114.0519940633 - -871. 985.0519940633 Total of -171315.645 and -25.226. -171340.871 10452 - -10932315973 10932326425 What is -55365078617 - -4? -55365078613 What is the difference between 0.9175 and -50510645? 50510645.9175 What is 3217897471 plus 12968? 3217910439 Sum 0.8 and 2215253540.5. 2215253541.3 Put together -11850557854 and -0.25. -11850557854.25 What is -67272.46 - -213129.21? 145856.75 -110937901 + 2.281395 -110937898.718605 Work out -21.73320027 - -0.08. -21.65320027 Add -8999 and 252156702. 252147703 Calculate -2 - 79580965812. -79580965814 What is 38.304 take away 3073424966? -3073424927.696 Add -45 and 20060447308. 20060447263 What is the distance between 176338286 and 0.563? 176338285.437 Calculate 172976 - 944.536. 172031.464 What is -38.923947636 less than 0.4? 39.323947636 What is the distance between -2044169.6422 and 21	{ "pile_set_name": "DM Mathematics" }
t from {e: 1, j: 5, u: 3, d: 3, m: 6}. What is prob of sequence uj? 5/102 Two letters picked without replacement from {r: 2, e: 3, l: 1, f: 2, p: 3, o: 4}. What is prob of sequence lp? 1/70 Four letters picked without replacement from kdekq. What is prob of sequence dqek? 1/60 Two letters picked without replacement from ffqggtgqxfzgg. What is prob of sequence gx? 5/156 Two letters picked without replacement from {n: 2, p: 1, z: 1, i: 1, a: 2}. What is prob of sequence az? 1/21 Calculate prob of sequence iaa when three letters picked without replacement from {a: 7, i: 9}. 9/80 What is prob of sequence xffa when four letters picked without replacement from {a: 1, x: 7, v: 2, u: 4, f: 2}? 1/3120 What is prob of sequence aa when two letters picked without replacement from {o: 3, a: 11}? 55/91 Calculate prob of sequence xfx when three letters picked without replacement from {f: 6, x: 7, b: 6}. 14/323 What is prob of sequence hb when two letters picked without replacement from hsfffbfafh? 1/45 What is prob of sequence fj when two letters picked without replacement from {q: 1, v: 1, f: 2, g: 1, b: 1, j: 1}? 1/21 Calculate prob of sequence sw when two letters picked without replacement from wrrsnrrrn. 1/72 What is prob of sequence lk when two letters picked without replacement from {k: 3, d: 3, l: 2, h: 4, g: 7}? 1/57 Four letters picked without replacement from {h: 2, z: 1, i: 1}. What is prob of sequence hiii? 0 Two letters picked without replacement from {g: 3, i: 2}. Give prob of sequence ii. 1/10 Two letters picked without replacement from {y: 2, d: 1, l: 1, k: 2, q: 4, x: 4}. Give prob of sequence dk. 1/91 Calculate prob of sequence vxsa when four letters picked without replacement from sxvra. 1/120 Calculate prob of sequence mrrm when four letters picked without replacement from {r: 8, m: 2}. 1/45 Four letters picked without replacement from ixwigwii. Give prob of sequence wxig. 1/210 Three letters picked without replacement from {d: 1, b: 3, z: 1}. What is prob of sequence bdz? 1/20 Calculate prob of sequence tn when two letters picked without replacement from tdytnttydtytttyttyyn. 1/19 Three letters picked without replacement from uuuuxuuuxuuuuuuuuuuu. What is prob of sequence uxx? 1/190 What is prob of sequence oeo when three letters picked without replacement from foefo? 1/30 Two letters picked without replacement from {s: 2, n: 7}. What is prob of sequence nn? 7/12 What is prob of sequence vl when two letters picked without replacement from {d: 3, v: 1, l: 4}? 1/14 Calculate prob of sequence zgag when four letters picked without replacement from gzrrgarzzlg. 1/440 Calculate prob of sequence jj when two letters picked without replacement from rrrjjjj. 2/7 Two letters picked without replacement from {p: 7, c: 3, m: 2, d: 2, v: 4}. What is prob of sequence dd? 1/153 Calculate prob of sequence rz when two letters picked without replacement from zquurruurrqqu. 1/39 Three letters picked without replacement from {s: 1, n: 1, e: 1, a: 1, r: 1, w: 2}. What is prob of sequence wes? 1/105 Calculate prob of sequence ma when two letters picked without replacement from ammaaaaaaaa. 9/55 Calculate prob of sequence ooig when four letters picked without replacement from wiiiigiogoi. 1/330 Calculate prob of sequence kk when two letters picked without replacement from {e: 9, m: 5, k: 2, c: 2}. 1/153 Three letters picked without replacement from ofofffoofoofof. What is prob of sequence off? 7/52 What is prob of sequence spps when four letters picked without replacement from ppiipppsppsspisssipp? 15/646 What is prob of sequence kt when two letters picked without replacement from {t: 1, s: 1, k: 1}? 1/6 Calculate prob of sequence ooo when three letters picked without replacement from {e: 3, o: 7}. 7/24 Three letters picked without replacement from tttttttbttttttt. What is prob of sequence ttb? 1/15 What is prob of sequence yfny when four letters picked without replacement from ygynncwf? 1/420 Two letters picked without replacement from kpppm. Give prob of sequence pm. 3/20 Calculate prob of sequence rn when two letters picked without replacement from tgngrn. 1/15 Calculate prob of sequence hhs when three letters picked without replacement from hhfhfhfssf. 1/30 Two letters picked without replacement from {m: 3, v: 4, h: 5, d: 5, j: 1}. Give prob of sequence mh. 5/102 Calculate prob of sequence dgdd when four letters picked without replacement from {d: 9, a: 1, j: 1, g: 4}. 4/65 What is prob of sequence dd when two letters picked without replacement from dddddddwddwwdd? 55/91 Four letters picked without replacement from jwwwwjwwwwjwwjwj. Give prob of sequence wjwj. 55/1092 Two letters picked without replacement from {i: 1, c: 1, n: 1, e: 1, v: 1, a: 2}. Give prob of sequence cv. 1/42 Four letters picked without replacement from uooiuoguougujguuguu. Give prob of sequence gigu. 3/2584 What is prob of sequence mm when two letters picked without replacement from dmccmmcdc? 1/12 Calculate prob of sequence zzzs when four letters picked without replacement from {t: 13, z: 3, s: 4}. 1/4845 Two letters picked without replacement from {a: 1, e: 8, g: 5, z: 2, c: 2, y: 2}. What is prob of sequence gg? 1/19 Three letters picked without replacement from {h: 2, e: 3}. Give prob of sequence eeh. 1/5 Two letters picked without replacement from {s: 1, y: 6, a: 11}. Give prob of sequence sy. 1/51 What is prob of sequence jcx when three letters picked without replacement from cjxjxcccc? 5/126 Three letters picked without replacement from {b: 3, u: 5, y: 2}. Give prob of sequence yyu. 1/72 Calculate prob of sequence ffat when four letters picked without replacement from qjtaffgaaqjjq. 1/2860 Three letters picked without replacement from gnvnvvvfvvlfnvngt. What is prob of sequence ngn? 1/170 Two letters picked without replacement from {y: 3, c: 13}. Give prob of sequence yc. 13/80 Calculate prob of sequence ioxo when four letters picked without replacement from ocyoyooxooxiycxccxyy. 1/969 Three letters picked without replacement from {o: 7, d: 2}. Give prob of sequence dod. 1/36 Two letters picked without replacement from {j: 4}. What is prob of sequence jj? 1 Four letters picked without replacement from {w: 7, s: 2}. Give prob of sequence swww. 5/36 What is prob of sequence je when two letters picked without replacement from {j: 1, e: 2, h: 2, w: 7}? 1/66 Calculate prob of sequence hqqh when four letters picked without replacement from qhqhhh. 1/15 Two letters picked without replacement from {r: 1, w: 2, g: 1, b: 1}. What is prob of sequence br? 1/20 Two letters picked without replacement from {m: 1, p: 4, r: 4, d: 2, y: 6}. Give prob of sequence yp. 3/34 What is prob of sequence orme when four letters picked without replacement from rrrrooopoomeooo? 4/4095 Four letters picked without replacement from iricsrviirrsiyv. Give prob of sequence csir. 1/819 Calculate prob of sequence djg when three letters picked without replacement from {j: 1, d: 1, y: 2, q: 2, g: 1, b: 1}. 1/336 Two letters picked without replacement from {c: 1, t: 2, w: 1, b: 2, s: 1, x: 1}. Give prob of sequence bx. 1/28 What is prob of sequence dd when two letters picked without replacement from {d: 3}? 1 What is prob of sequence sbw when three letters picked without replacement from {w: 1, k: 8, s: 2, b: 4}? 4/1365 Two letters picked without replacement from brnqrhbq. Give prob of sequence nh. 1/56 Calculate prob of sequence ctt when three letters picked without replacement from tbct. 1/12 Calculate prob of sequence eepp when four letters picked without replacement from epeepe. 1/15 Calculate prob of sequence hmq when three letters picked without replacement from {m: 2, l: 1, h: 2, q: 1}. 1/30 Three letters picked without replacement from {v: 3, e: 2, l: 4, t: 2, k: 2}. What is prob of sequence ltl? 2/143 Three letters picked without replacement from xzwiwiiwixzzx. What is prob of sequence zwz? 3/286 Two letters picked without replacement from {a: 3, j: 5}. Give prob of sequence aj. 15/56 Three letters picked without replacement from jllnnejzehzz. What is prob of sequence nhl? 1/330 What is prob of sequence dq when two letters picked without replacement from ffppppfdfppppqfwfwf? 1/342 Calculate prob of sequence	{ "pile_set_name": "DM Mathematics" }
i + 7i + p = 12, -5p + 20 = 0. Suppose 3n + q + i = 0, -6q = 2n - q + 10. Solve 0 = -5v + o + 17, -2o - 2 = -2v - no for v. 4 Let y be (-2)/(-7) - (4 + 611/(-91)). Solve -2v - 7 = -ya - 2, v = 4a for v. -4 Let b be (-13 - -11) + (5 - 0). Suppose 0j = -bj + 9. Suppose 3i + f - 1 = 5, 4 = 2i - jf. Solve 4l = il + 4g + 2, 0 = 3l + 5g + 8 for l. -1 Let r(f) = -11f*2 - 5f - 4. Let v be r(-2). Let u = -34 - v. Solve uc + 9 = 4l + l, 0 = 4l - 3c - 7 for l. 1 Let l(p) = 170p + 1. Let t be l(-2). Let g be 2/(-8) + t/(-12). Suppose -512o + 527o - 60 = 0. Solve 0 = 3f - 12, om - 5f + g = -0m for m. -2 Let i = -13 + 15. Suppose 3b + 8 = 3t - 10, it - b = 9. Suppose -3n + 3 + 21 = tz, -2n + 7 = -z. Solve -20 = -2d + 5v, 5d + 13 = -nv + 28 for d. 5 Let b = 10 - 6. Suppose -14 = 5z - 39, -3a + 25 = 5z. Solve a = 3s + bt + 5, -10 = 2s + 4t - 0t for s. 5 Suppose 2r - 3r = 3g - 15, 3g + 3 = 5r. Suppose -3v + 4t = -7v + 28, -4v + rt - 7 = 0. Solve -a = vy + 13, -4a = -y - a + 11 for y. -4 Suppose -5h + 25 = -3f + 4, h - 9 = 3f. Let w = 31 + -31. Let x = h + w. Solve 3a = 2m + xm + 7, 0 = -m + 2a - 7 for m. 1 Let j be -44/(-8)1. Let b be (j + -1)/(1/3). Suppose -bx + 2 + 10 = 0. Solve -p + 5 = -2p, -30 = -5f + xp for f. 2 Let c(p) = -p. Let x be c(0). Suppose 4b = -2o + 24, -4b + 4 = -x. Solve -1 - 21 = n - 5z, 0 = -2z + o for n. 3 Let t(r) be the third derivative of -1/6r*4 + 3/2r*3 + 1/30r*5 - 11r*2 + 0r + 0. Let a be t(4). Solve 2m - 5y - a = 0, 0y + 5y = 3m - 30 for m. 5 Let j(d) = -d3 - 6d*2 + 30. Let l be j(-5). Suppose -2h + 2 = -h. Solve f + hf = -lv, -5v + 2f = 0 for v. 0 Suppose -50 = -5g - 5v, -5v - 14 = -4g + 26. Suppose g = -3d + 8d. Let b be ((-15)/(-10))/(1/d). Solve -15 = 5r, -bs + 0r + 3 = 2r for s. 3 Suppose 3i = 5i. Suppose i = -5y - 5v - 15, 4y - v = y + 11. Suppose yu - 8 = 0, 2u = 3k - 0u + 5. Solve z - 9 = p - k, 0 = p + 4z - 7 for p. -5 Let w = -30 - -53. Let r = 26 - w. Suppose 0 = -4z + rp + 111, -5z + 0p + 4p + 139 = 0. Solve z = -5q - o, 0 = -4q + q + 2o - 11 for q. -5 Let g(p) = p*3 + 10p*2 + 7p - 7. Let m be g(-9). Suppose -ml = -15l + 8. Suppose 2x - x = 11. Solve -u + s = -2s - 8, -lu + x = -s for u. 5 Let s(w) = w - 4. Let q be s(9). Suppose 0 = 5r + c - 70, 4c - 55 = -qr + 6c. Solve 4f = -5t - r, -6 = -f + 4t - 4 for f. -2 Let i be (9 - (9 - 0))/(-1). Solve -2y = 4f + 3 - 1, i = -4f + 4y + 28 for f. 2 Suppose 5c = c + 20. Suppose 7n = cr + 2n - 5, -5r + 12 = 2n. Suppose 0 = -rq - 2q + 88. Solve -3h + 4o = -q, -4h - 5o - 3 = 9 for h. 2 Let m be -9 + -12(-3)/(-6). Let o = 15 + m. Let d be 2/(-2)6/(-2). Solve 3w = -15, 3j + dw = -o - 3 for j. 4 Suppose c = 3t - 4, 56 - 21 = 5t + 4c. Solve -tk - u = -15, -2u - 20 = -4k + 3u for k. 5 Let q = -2 + 4. Suppose 0 = -j + 5d + 23, -2d - 4 + 30 = 4j. Let p be jq(-3)/(-12). Solve -1 - 2 = -h, -pa + 4h = 8 for a. 1 Let o(u) = -u3 - 4u*2 - 2u + 3. Let j = 16 - 4. Suppose j = -n - 2n. Let a be o(n). Solve 0f - 5f + 3r + a = 0, -3f + r = -5 for f. 1 Let h(x) = x2 + 5x - 6. Let c be h(-6). Suppose c = -f + 4f - 9. Suppose -4 = 2o - fo. Solve z + 4 = -2d, -oz = -7z - 4d - 6 for z. 2 Let u = -593 + 596. Let o = -5 - -7. Solve -3z + uk = -z - 7, -z + ok + 4 = 0 for z. 2 Let f = -519 - -519. Solve -5d = 4q + 21, -5q - 4d = -fq + 15 for q. 1 Let h be (-4)/26 + (318/13)/3. Suppose 0 = -4d + h + 4. Solve 5v - 5 = -5i, 3 + 2 = i - dv for i. 2 Let o = 267 - 257. Solve p + p = 2v - o, -3v + 23 = -5p for v. 1 Suppose -35 = 8y - 9y. Let w = y + -33. Solve 4r - 3f + 4f - 16 = 0, -w = -2r + f for r. 3 Suppose 0 = n + 3f - 3, n - f + 2f = 3. Suppose 5a = -4v - 16, -2v + 0 - 8 = na. Let o be 16/10 + 4/10. Solve -4j + ad - 14 = -od, d + 18 = -3j for j. -5 Let x be -9 + 4 + 0/(-2) + 5. Solve -d + 11 = -xl - 5l, -d - 3l - 13 = 0 for d. -4 Let c(f) = f3 + 2f*2 + 2f + 3. Let t be c(-2). Let q be t/((-4 + 1)/9). Solve -qg - z + 2 = 0, 0g - 2z = g + 6 for g. 2 Let z = -5 + 5. Let l be (-7)/(-3) - 2/(-3). Let s = -249 - -252. Solve ln = sq + 3, 4q - 5n = -z - 9 for q. 4 Suppose 2r - 12 = -r. Suppose -k + 22 = 10. Suppose -s + 12 - k = 0. Solve 12 = -2n + 2c, n + rc + 4 - 13 = s for n. -3 Let n(l) = l3 - 3l*2 + 3l - 1. Let f be n(3). Let q(c) = -c*2 + 10c - 11. Let y be q(f). Solve -p + 0j + j = -4, 2p - 8 = -yj for p. 4 Suppose 30 - 2 = -7x. Let g be 0/x + 4 + 19. Let t = -1 + 1. Solve 3p - 5c + 31 = -0c, -p - 5c + g = t for p. -2 Let c be 17/4 + 9/12. Suppose z + cj = -0z - 15, -2z - 2j + 2 = 0. Suppose zw = 30 - 5. Solve 5x + 15 = -0, 2x = wn + 19 for n. -5 Let h(o) = o*3 + 5 - 1 + 1 - 8o*2 - 2o. Let b be h(8). Let x = -9 - b. Solve 5u - 18 = -2s, s - 5 = -xs - 2u for s. -1 Let t(f) = -f*3 + 14f*2 + 12f + 50. Let r be t(15). Solve 3d = h - 10, -3h + rd = 2h - 20 for h. 1 Suppose -u + 14 = -3g + 4, -4u + 14 = g. Suppose -a + 2l = -ua + 30, 5a = -l + 50. Solve -3h - 6 = -2n + 10, 3n = h + a for n. 2 Let p(d) = d*2 - 3d + 2. Let x = 2 + 1. Let o be p(x). Suppose ok + 48 = 6k. Solve 2l - 4v + k = 0, l + 2l + 5v - 15 = 0 for l. 0 Suppose -89 - 703 = 12u. Let s = -64 - u. Solve -2i - 8 = 2g, -4 = -sg + i - 0 for g. 0 Suppose 4t = 20, 5d = 3t - 9 + 4. Solve di + 9 = -3a, 4i = a + 14 + 3 for a. -5 Let f be (-5 + 4)-4 - -15. Solve 2x - 22 = -5d, -3x - 7d = -3d - f for x. 1 Suppose -3c + 34 = -3s + 58, 3s + 3c = 6. Solve -2p = -4n, -3n = sp - n - 12 for p. 2 Suppose 0 = -3y - 3, 5y - 215 = -4v - 0y. Let s(p) = -36p + 1. Let a be s(1). Let j = v + a. Solve 2t - 5k = 7t + 5, -4t - j = -4k for t. -3 Suppose -2i = -3u + 9, 17u - 7i = 13u + 12. Let g = -10 + 16. Solve -5a = -k + g, ua + 4 = -a for k. 1 Let g(j) = j2 - 21j + 23. Let r be g(20). Suppose 0 = 2t + rt - 10. Solve 3d = 2l - 3 + 6, -tl - 5d + 21 = 0 for l. 3 Let l(t) = -6t - 6. Let y be l(-3). Let w be (-3)/(-12) - (-45)/y. Solve -4o - wj = -16, 0 = -4j + 5j - 1 for o. 3 Suppose 0 = 2u - d - 13, 6d - 11 = -u + 8d. Solve uc - c + 2i - 12 = 0, 4i + 16 = 0 for c. 5 Let x(z) = -3z + 40. Let o be x(12). Solve op + 17 = a, 2a + a = -3p - 24 for p. -5 Suppose r + 3r = 16. Suppose 11 = 3x - r. Suppose xz - z = 40. Solve v - 3c + 5 = 0, -4c + z + 0 = 2v for v. 1 Let r(z) = -z2 - 9z - 6. Let w be r(-8). Suppose -b = -w - 5. Solve -3t - 2v + b = 0, -4t + v + v = -28 for t. 5 Let m be (-105)/630(-1 - 17). Solve 2c = 6, -5v + m = c - 0 for v. 0 Suppose -41 + 26 = -3a. Solve -4h - p = 0, -ap + 2p = 3h for h. 0 Suppose -4u + 2k + 50 = 0, -u + 2k = 3k - 14. Solve 2f - 3f = -4b + u, -b = -2 for f. -5 Let y = -603 + 607. Solve 3t = 4o - 3, -4o = -t + 3 + y for t. -5 Let y(h) = -19h - 91. Let b be y(-5). Solve 2o + 8 = bp, -2 = o + p - 1 for o. -2 Let f be (0 + 0)/(-1 + 0). Suppose r + 19 = 20. Solve 0 = -3x - 4p - r, fp + 20 = -5p for x. 5 Suppose -l + 19 = x, -l = -3x + l + 57. Suppose xq - 95 = 14q. Solve 3w = 4u + 7, 2u + 4w + q = -1 for u. -4 Let d be (15/(-2))/(-1 + (-12)/(-24)). Let c be ((-4)/(-6))/(4/30). Solve 3j - d = -0l + 3l, -cl + 10 = 2j for l. 0 Let b(p) = -9p3 - p2 + 2p - 1. Let w be b(1). Let d = -5 - w. Solve 5f + a - 4 = 5a, -da = 4f - 32 for f. 4 Suppose 253t - 235t = 54. Solve 0 = -3l + 8l + tu - 37, 5l - 29 = -u for l. 5 Let k(b) = -2b - 7. Let u be k(-11). Suppose -c = 5h - u, -30 = -h - 4h - 4c. Let x be h + -1 + 4 + 0. Solve -3f - 9 + 0 = -2j, xj + 2f + 25 = 0 for j. -3 Suppose 0 = -5m + 10, 25m = -3v + 28m + 9. Solve -2 = -4y - 0y - s, 0 = -3y + s + v for y. 1 Let u(r) = -2r*2. Let l be u(-2). Let a = l - -9. Suppose 4d - a - 7 = 0. Solve -t + 2t + 2 = 0, 4b - dt = -16 for b. -5 Let h(m) = -8m*2 + 3m - 3. Let u be h(-3). Let q be 10/14 - 24/u. Let x be 8/(-28) + (-37)/(-7). Solve n = xj - 7, j - 2 = -q for n. -2 Let x = -89 + 92. Let z = 29 + -8. Solve 2u - xh = -z, -4u = u + 3h for u. -3 Suppose 14 - 26 = -3h. Suppose 0 = -f + ha + 4, 12 = 3f - 0a - 3a. Solve -c = -1, -t + 0 = 2*c - f for t. 2	{ "pile_set_name": "DM Mathematics" }
vvivvnnnn. 1/380 Calculate prob of sequence daad when four letters picked without replacement from {b: 1, d: 2, x: 1, f: 1, a: 1, c: 1}. 0 What is prob of sequence iii when three letters picked without replacement from {i: 10}? 1 Three letters picked without replacement from {a: 2, w: 5}. What is prob of sequence waw? 4/21 What is prob of sequence fkkf when four letters picked without replacement from fffffkffkffff? 1/78 Four letters picked without replacement from aeegeuyueeygegeygoea. What is prob of sequence yeug? 8/4845 Calculate prob of sequence nl when two letters picked without replacement from {x: 7, w: 3, n: 1, l: 1, p: 2}. 1/182 Two letters picked without replacement from vee. What is prob of sequence ve? 1/3 Two letters picked without replacement from jjsnkjnkjjj. Give prob of sequence nj. 6/55 Three letters picked without replacement from {s: 1, q: 2, k: 2, m: 1, f: 1}. Give prob of sequence qfs. 1/105 Calculate prob of sequence kk when two letters picked without replacement from kkkkkkkkk. 1 Four letters picked without replacement from {p: 2, n: 2, h: 2}. What is prob of sequence nnpp? 1/90 What is prob of sequence yta when three letters picked without replacement from {d: 1, a: 2, t: 11, y: 2}? 11/840 Three letters picked without replacement from {f: 4, w: 8, q: 1}. What is prob of sequence fwf? 8/143 Calculate prob of sequence zl when two letters picked without replacement from llobzbflzb. 1/15 What is prob of sequence df when two letters picked without replacement from mffmdnkdfmkddnfnnkdd? 6/95 What is prob of sequence gv when two letters picked without replacement from {g: 3, v: 1, d: 1, e: 9}? 3/182 Two letters picked without replacement from {y: 2, j: 1, c: 3, s: 3, p: 10}. What is prob of sequence pc? 5/57 Three letters picked without replacement from aanjqyqeaaye. Give prob of sequence jae. 1/165 What is prob of sequence geh when three letters picked without replacement from yehhxgxhhhyxk? 5/1716 Four letters picked without replacement from {f: 1, k: 3, w: 3, g: 4}. What is prob of sequence kfkw? 1/440 What is prob of sequence fg when two letters picked without replacement from {f: 1, z: 5, o: 4, g: 1, x: 4}? 1/210 Calculate prob of sequence gtrt when four letters picked without replacement from {t: 2, g: 1, i: 2, b: 3, r: 4}. 1/1485 Calculate prob of sequence mh when two letters picked without replacement from {h: 6, m: 4}. 4/15 Two letters picked without replacement from {y: 1, t: 3, p: 1, b: 2, v: 3, z: 1}. Give prob of sequence yb. 1/55 Calculate prob of sequence kk when two letters picked without replacement from {k: 3, x: 3}. 1/5 Three letters picked without replacement from {y: 1, o: 1, x: 1, f: 1, m: 1, v: 2}. Give prob of sequence xfo. 1/210 Three letters picked without replacement from jjjjjzjzzzzzjzzz. Give prob of sequence zzj. 3/20 Four letters picked without replacement from {b: 1, d: 2, o: 1, x: 3, j: 1, r: 3}. Give prob of sequence xroj. 1/880 Calculate prob of sequence tf when two letters picked without replacement from tff. 1/3 Three letters picked without replacement from {y: 4, g: 1, z: 6, c: 7}. What is prob of sequence ygc? 7/1224 Three letters picked without replacement from teejtttututteejeu. Give prob of sequence eee. 1/68 Four letters picked without replacement from {t: 1, q: 5, p: 5}. Give prob of sequence pqpt. 5/396 Two letters picked without replacement from {a: 2, r: 1, d: 8, i: 5}. What is prob of sequence rd? 1/30 Two letters picked without replacement from {q: 3, f: 13}. Give prob of sequence qq. 1/40 Calculate prob of sequence zzik when four letters picked without replacement from {f: 2, i: 1, n: 3, k: 1, l: 1, z: 5}. 1/858 Calculate prob of sequence fe when two letters picked without replacement from {c: 7, f: 2, p: 1, e: 9}. 1/19 Four letters picked without replacement from {t: 3, y: 5, k: 1, o: 1, v: 5, u: 5}. What is prob of sequence yukv? 25/23256 Calculate prob of sequence iiii when four letters picked without replacement from iiiiii. 1 What is prob of sequence ss when two letters picked without replacement from sssssss? 1 Three letters picked without replacement from hzh. Give prob of sequence hzh. 1/3 Three letters picked without replacement from gnqjgdgqgndgndqgqg. What is prob of sequence ggj? 7/816 Calculate prob of sequence wwb when three letters picked without replacement from mwmwmcmtwmmwtbcmwt. 5/1224 Two letters picked without replacement from {m: 1, j: 2, c: 2, q: 1}. What is prob of sequence jm? 1/15 Three letters picked without replacement from oyj. What is prob of sequence jyo? 1/6 Three letters picked without replacement from {x: 7, v: 12}. Give prob of sequence vvx. 154/969 Calculate prob of sequence yy when two letters picked without replacement from {s: 2, y: 3, w: 10}. 1/35 What is prob of sequence av when two letters picked without replacement from {d: 3, f: 3, a: 7, v: 1}? 1/26 What is prob of sequence ni when two letters picked without replacement from iiiiinbinniin? 8/39 Three letters picked without replacement from yaddaad. What is prob of sequence dad? 3/35 Two letters picked without replacement from {v: 7, y: 2, c: 1, b: 6, x: 3}. What is prob of sequence vx? 7/114 Four letters picked without replacement from uvujvjzsjevvvvj. What is prob of sequence uzvs? 1/2730 Calculate prob of sequence yzp when three letters picked without replacement from zpvym. 1/60 What is prob of sequence ul when two letters picked without replacement from eezuuudluucuucue? 1/30 Four letters picked without replacement from {t: 1, q: 1, i: 3}. What is prob of sequence itiq? 1/20 Three letters picked without replacement from {u: 3, x: 1, g: 3, w: 3, m: 1, z: 2}. What is prob of sequence zgm? 1/286 Three letters picked without replacement from aazzz. What is prob of sequence aza? 1/10 What is prob of sequence on when two letters picked without replacement from qnoqnsmmqmnqq? 1/52 Two letters picked without replacement from {f: 2, c: 1, b: 5, r: 1, v: 11}. What is prob of sequence bv? 11/76 Calculate prob of sequence jk when two letters picked without replacement from {g: 2, s: 4, i: 1, j: 4, k: 6}. 3/34 Calculate prob of sequence qh when two letters picked without replacement from hhhhhhhhhhqh. 1/12 Three letters picked without replacement from {q: 10, m: 9}. Give prob of sequence mmm. 28/323 What is prob of sequence gk when two letters picked without replacement from ikigkaoookkiitiioi? 2/153 What is prob of sequence xr when two letters picked without replacement from tzrtgxrzztzz? 1/66 Two letters picked without replacement from oorzwfw. What is prob of sequence wz? 1/21 What is prob of sequence pi when two letters picked without replacement from {i: 1, o: 8, r: 4, p: 2, m: 1}? 1/120 Four letters picked without replacement from ttrttactu. Give prob of sequence cuta. 5/3024 Four letters picked without replacement from {e: 8, a: 5, y: 1, l: 1, m: 5}. Give prob of sequence ayyy. 0 Calculate prob of sequence vvva when four letters picked without replacement from {v: 3, n: 2, m: 3, a: 2, t: 3}. 1/1430 Three letters picked without replacement from ztkntk. What is prob of sequence znt? 1/60 What is prob of sequence mnv when three letters picked without replacement from {h: 1, r: 2, n: 2, x: 1, m: 1, v: 1}? 1/168 What is prob of sequence hxrh when four letters picked without replacement from xxxrhhxrrrxhxxxx? 9/1820 What is prob of sequence tgt when three letters picked without replacement from {g: 17, t: 2}? 1/171 Calculate prob of sequence yo when two letters picked without replacement from yoyoyo. 3/10 Two letters picked without replacement from siidddiiidiid. Give prob of sequence si. 7/156 Four letters picked without replacement from {k: 8, p: 2}. What is prob of sequence kkpk? 2/15 What is prob of sequence kea when three letters picked without replacement from {k: 5, e: 6, a: 1, v: 4}? 1/112 Three letters picked without replacement from tqitqlrlqqrqrtrti. What is prob of sequence qlt? 1/102 What is prob of sequence ry when two letters picked without replacement from yyryrrg? 3/14 Four letters picked without replacement from {g: 3, j: 7, x: 2}. What is prob of sequence xjjx? 7/990 Two letters picked without replacement from fxfxffcc. Give prob of sequence cf. 1/7 Two letters picke	{ "pile_set_name": "DM Mathematics" }
ivative of 4l + s + 8l + hl wrt l. 15 Suppose 50 = -19j + 29j. What is the third derivative of 218n*6 + 6n - n - 3n3 - jn - 229n6 + 47n*2 wrt n? -1320n*3 - 18 Let s(z) = 6z - 20 - 15 + 40. Let y(v) = -v - 2. Let o(h) = 2s(h) - 14y(h). Differentiate o(x) wrt x. 26 Let b(z) be the first derivative of 0z2 - 16z*5 - 1/4z*4 + 96 + 0z + 61/3z3. What is the third derivative of b(p) wrt p? -1920p - 6 Let l(w) = -2549w2 - 953w - 1. Let i(r) = 7648r2 + 2859r + 2. Let t(u) = -2i(u) - 7l(u). Find the second derivative of t(g) wrt g. 5094 Suppose 0 = -62w + 81 + 43. Let c(r) be the third derivative of 0r + 8/3r3 + 0r*5 - 7r*w + 0r*4 + 0 - 1/24r*6. Differentiate c(k) wrt k. -15k*2 Let k be 4 - (-11)/(44/36). What is the second derivative of 5m*4 + km*3 + 33m + 64m - 34m3 - m4 wrt m? 48m2 - 126m Let z(g) be the third derivative of g*6/60 - 83g*4/8 + 1015g*3/3 - 2601g*2. Find the first derivative of z(k) wrt k. 6k*2 - 249 Let h(z) be the first derivative of 0z - 173/2z2 - 99 - 20/3z*3. What is the second derivative of h(g) wrt g? -40 What is the third derivative of 2s - 6622s3 - 2555s*3 - 13s*2 - 17s*2 - 2010 + 28s*2 + 6355 wrt s? -55062 Let f(t) = -429t*2 + 1692. Let n(h) = -145h*2 + 563. Let r(a) = 6f(a) - 17n(a). What is the derivative of r(c) wrt c? -218c Let a(q) be the third derivative of 0q6 + 0q*5 - 21q*2 - 2q + 0q3 - 17/70q*7 + 35/6q*4 + 0. What is the second derivative of a(h) wrt h? -612h2 Let a(b) be the second derivative of b6/5 - 13b3/6 + 1525b*2/2 - 2b + 3. Differentiate a(q) wrt q. 24q3 - 13 Suppose -14w + 183 + 307 = 0. What is the derivative of 51 + wu2 + 8u*2 + 3u*2 wrt u? 92u Suppose 22x = 25x + 3. Let a be (3/x)/((-6)/4). Find the third derivative of 18r3 - 38r*a + 1 - 1 + 28r*2 wrt r. 108 Find the second derivative of 5c*2 - 2565c + 4120c - 90c*3 - 2c*2 + 3c*2 wrt c. -540c + 12 Let h(c) = -c*2 + 133c - 21. Let l = -11 - -14. Let j(m) = -2m2 + 263m - 44. Let z(o) = lj(o) - 5h(o). Find the first derivative of z(b) wrt b. -2b + 124 Differentiate -461 - 1278 + 3649j*2 - 55 - 869 with respect to j. 7298j Let o(l) be the second derivative of -179l4/3 - l3/3 - 574l*2 - 411l - 6. Find the second derivative of o(z) wrt z. -1432 Let g(h) = -2h3 - 2h*2 + 2h + 4. Let o be g(0). Find the second derivative of -253k - 16k*2 - 3k*o + 36k*2 - 20k*2 - 52k*3 wrt k. -36k*2 - 312k Suppose 255 = -6g + 11g. Differentiate 19 + 161z2 + g + 59 with respect to z. 322z Suppose -5k - f = -22 - 1, 2k = 4f - 4. Find the second derivative of 3a*3 - 2a2 + a2 - 2 + 0a3 - 2a*2 - ka wrt a. 18a - 6 Let y(r) be the third derivative of 61r5/30 - r4/6 + 565r3/2 - 921r*2 + 2r. Differentiate y(t) with respect to t. 244t - 4 What is the third derivative of 3150a*2 + 424a*6 + 936a*6 + 28a*6 wrt a? 166560a*3 Let a(z) be the second derivative of -37z*5/10 - 664z*2 - 1634z. What is the first derivative of a(q) wrt q? -222q2 Suppose 5s = 208 + 12. Differentiate -45z + 8 + sz + 38 + 128z3 wrt z. 384z*2 - 1 Let u be 97/147 - 8/(-14). Let s be u + ((-6)/(-24) - 3/(-4)). What is the third derivative of 41o2 + 21o*5 + 3o*5 + 8o*5 - 5o*s wrt o? 1920o*2 Let s = -2 + 16. Suppose -s - 166 = -5w. Find the first derivative of 31q3 + wq*3 - 72q*3 - 12 wrt q. -15q*2 Let o be (54/(-252))/(1/(-14)). Let v(n) be the second derivative of 0n*4 - 11/10n*5 - 21n + 12n2 + 0 + 0n*o. Differentiate v(a) with respect to a. -66a*2 Let h(p) be the second derivative of 305p7/14 - p6/30 + p*4/6 + 1087p*2/2 + 101p - 1. Find the third derivative of h(y) wrt y. 54900y2 - 24y Let f(g) = -2g - 20. Let y be f(-10). Suppose 24x = 21x + 12. Differentiate -17 + 35h*x - 2 + y - 7 wrt h. 140h*3 Let l be (-5 - 120/(-16))8. What is the second derivative of -34h2 - 98h - lh2 - 3 - 96h + 199h - 60h*2 wrt h? -228 Let v(w) = -4074w*3 - 17w*2 + 34w + 3127. Let b(p) = 679p3 + 3p*2 - 6p - 521. Let h(z) = -34b(z) - 6v(z). Find the first derivative of h(r) wrt r. 4074r2 Suppose 4r + 3a - 13 + 2 = 0, -3r + a = -5. Find the third derivative of -107sr - 29s*6 - 2 - 34s*6 + 2 - 43s*2 wrt s. -7560s*3 Suppose -8y + 10y - 3c = 9, -4y + 2c = -14. Find the third derivative of -234b2 + 31b*2 + 129b*y + 27b*3 wrt b. 936 What is the second derivative of 344m*5 - 1520971m - 2856m5 + 1520278m wrt m? -50240m3 Let l be (78 + -77)(0 + 2). Find the third derivative of -6 - 31c2 + 6 - 18c*l + 0c*2 - 172c*5 wrt c. -10320c*2 Suppose -69 = -3f - 66. Differentiate f - l*3 + 80 + 20 - 4l with respect to l. -3l2 - 4 Let o be 16/(-2 + 10) + 2/2. What is the derivative of o + 34d - 62 - 12 wrt d? 34 What is the first derivative of 0w4 - 574w + 3w4 + 149w + 3606 - 4690 + w*4 wrt w? 16w*3 - 425 Let s be ((-2)/(-8) + -1)(-15 + 11). What is the third derivative of 4o4 + 4o*2 - 38o*4 - 5 - so*2 + 37o + 5 wrt o? -816o Suppose -6p - 8 = -2p. Let c be (11/p)/((-4)/8). What is the third derivative of 6o*2 - co*4 - 12o*4 - 4o*2 wrt o? -552o Let a(x) = -32x5 + 425x*3 - 6955x. Let l(q) = 17q5 - 212q*3 + 3477q. Let n(v) = 6a(v) + 11l(v). Find the second derivative of n(m) wrt m. -100m3 + 1308m Suppose -18 = -21f + 45. Find the third derivative of -fm - 14m6 - 16m*6 - 7m*2 - 3m*6 + 12m*2 wrt m. -3960m*3 Let c(u) = -3086u*2 + 5u + 1034. Let t(f) = 3085f2 - 6f - 1040. Let w(q) = 6c(q) + 5t(q). What is the first derivative of w(x) wrt x? -6182x Suppose p = 15k - 14k + 5, 4k + 2 = -2p. What is the second derivative of 8a*3 - 3a*3 - 30a*2 - 2a*p - 74a - 153a wrt a? 18a - 60 Let v(o) = -o*2 - 8o - 14. Let c be v(-4). Find the second derivative of -1 + 431r - 3r*3 - 485r + 0r2 + 3r*c wrt r. -18r + 6 Let m(k) = -206k - 68. Let i(v) = 69v + 23. Let d be 1184/144 - (-4)/(-18). Let s(c) = di(c) + 3m(c). What is the first derivative of s(r) wrt r? -66 Let y(x) be the second derivative of -613x3/3 - 307x*2 - 250x + 2. Differentiate y(w) wrt w. -1226 Let b(c) = 1179c + 1746. Let n(r) = -148557r - 219995. Let y(s) = 253b(s) + 2n(s). What is the derivative of y(l) wrt l? 1173 Let i = -688 - -691. What is the third derivative of 0mi - 545m*2 - 169m*5 + 2m*3 - 522m*2 + 1271m*2 wrt m? -10140m2 + 12 Let n(k) be the first derivative of -k4/2 - 485k3/3 + k2 - 6206k - 11297. What is the derivative of n(r) wrt r? -6r2 - 970r + 2 Let q(w) = -4070w3 - 18w*2 + 6w - 5095. Let o(v) = 12213v3 + 51v*2 - 17v + 15285. Let t(c) = 6o(c) + 17q(c). What is the derivative of t(u) wrt u? 12264u2 Let d(l) be the first derivative of 2l + 1/4l4 - l3 + 68 - 27l*2. What is the second derivative of d(y) wrt y? 6y - 6 Let o(k) = -10156k - 4682. Let u(d) = 3371d + 1561. Let f(z) = -3o(z) - 8u(z). What is the first derivative of f(m) wrt m? 3500 Differentiate -1136 - 3z2 + 447z*4 + 442z*4 + 25z*2 - 879z*4 wrt z. 40z*3 + 44z What is the third derivative of 400z5 - 2z*3 - 2z*2 - 2876 - 9z + 10z + 3588z*4 - 3589z*4 wrt z? 24000z*2 - 24z - 12 Let g be 21 - 1 - (0 - -1). Let r(v) = -v*2 - 27v + 474. Let x be r(12). What is the derivative of -x - 38j + 6 - g wrt j? -38 What is the second derivative of 3254788c*3 - 3254595c*3 + 9034c - 6c2 + 3c*2 wrt c? 1158c - 6 Let v(j) be the second derivative of 0j5 + 0 + 23/2j*2 + 0j*3 - 34j + 26/15j6 + 0j*4. Differentiate v(f) wrt f. 208f*3 Let b(m) be the first derivative of -232m*5 - 6m*2 - 77m - 1070. What is the second derivative of b(a) wrt a? -13920a2 What is the third derivative of -1242s*5 + 111 + 3s*2 + 13 + 0s*2 + 102 wrt s? -74520s*2 What is the third derivative of 199s*2 - 3 + s - 146324868s*3 - 2 + 146331063s*3 wrt s? 37170 Suppose 2p - t + 0t - 13 = 0, -p + 2 = -5t. Suppose po - 2o - 10 = 0, h - 37 = o. Find the third derivative of -32f4 + 29f*4 + hf*2 + 0f*2 wrt f. -72f Let a(n) = 15*n + 1 + 5 + 10 + 42	{ "pile_set_name": "DM Mathematics" }
of -21170, -20744, -20318, -19892, -19466? 426o - 21596 What is the q'th term of -380806, -381611, -382416, -383221? -805q - 380001 What is the c'th term of 59805197, 59805200, 59805203, 59805206, 59805209? 3c + 59805194 What is the s'th term of -520460, -1040904, -1561346, -2081786, -2602224? s2 - 520447s - 14 What is the q'th term of -1124027, -2247998, -3371913, -4495772, -5619575, -6743322, -7867013? 28q2 - 1124055q What is the j'th term of 1068472, 1068492, 1068512, 1068532, 1068552? 20j + 1068452 What is the j'th term of 5914455, 5914437, 5914409, 5914371? -5j*2 - 3j + 5914463 What is the g'th term of -15486860, -30973742, -46460624, -61947506, -77434388, -92921270? -15486882g + 22 What is the v'th term of -73157, -139489, -205821, -272153? -66332v - 6825 What is the i'th term of 20250, 20251, 20264, 20289, 20326? 6i2 - 17i + 20261 What is the f'th term of -96233, -384765, -865601, -1538741? -96152f2 - 76f - 5 What is the i'th term of -916810, -916851, -916892, -916933, -916974? -41i - 916769 What is the w'th term of 159581, 319051, 478521, 637991? 159470w + 111 What is the x'th term of 727, 1281, 1793, 2275, 2739, 3197, 3661? 2x3 - 33x*2 + 639x + 119 What is the g'th term of -9762019, -19524033, -29286047, -39048061, -48810075, -58572089? -9762014g - 5 What is the z'th term of 81981, 81112, 80243, 79374, 78505? -869z + 82850 What is the t'th term of 114646, 114918, 115190, 115462? 272t + 114374 What is the t'th term of -43618, -43649, -43670, -43681, -43682, -43673, -43654? 5t*2 - 46t - 43577 What is the j'th term of 180361, 360817, 541373, 722029? 50j2 + 180306j + 5 What is the g'th term of 4735, 3262, 833, -2552? -478g2 - 39g + 5252 What is the d'th term of -28593, -28902, -29729, -31332, -33969, -37898, -43377, -50664? -43d3 - d2 - 5d - 28544 What is the r'th term of -183093, -183161, -183223, -183279? 3r2 - 77r - 183019 What is the w'th term of 15367, 61238, 137733, 244852, 382595, 550962? 15312w2 - 65w + 120 What is the c'th term of 289, -476, -1241, -2006, -2771? -765c + 1054 What is the d'th term of -400, -3774, -12990, -30970, -60636, -104910, -166714, -248970? -487d3 + d2 + 32d + 54 What is the m'th term of 4055970, 8111947, 12167924, 16223901, 20279878, 24335855? 4055977m - 7 What is the g'th term of -5211, -9026, -12819, -16578, -20291, -23946? 2g3 - g2 - 3826g - 1386 What is the n'th term of -33185423, -33185422, -33185421, -33185420? n - 33185424 What is the s'th term of -8598, -16952, -25304, -33654, -42002? s*2 - 8357s - 242 What is the k'th term of 365956, 731980, 1098004, 1464028? 366024k - 68 What is the p'th term of 84194, 84109, 83970, 83777, 83530, 83229? -27p*2 - 4p + 84225 What is the v'th term of 3913546, 15654206, 35221972, 62616844, 97838822, 140887906? 3913553v2 + v - 8 What is the y'th term of 55385, 110769, 166143, 221501, 276837, 332145? -y3 + y2 + 55388y - 3 What is the n'th term of 14245, 13905, 13565, 13225, 12885? -340n + 14585 What is the v'th term of 2299, 3983, 5055, 5515, 5363? -306v*2 + 2602v + 3 What is the k'th term of 157, 1122, 3711, 8734, 17001, 29322, 46507, 69366? 135k3 + 2k*2 + 14k + 6 What is the q'th term of -27158948, -27158943, -27158938, -27158933, -27158928, -27158923? 5q - 27158953 What is the w'th term of 1087131, 2174256, 3261381, 4348506, 5435631? 1087125w + 6 What is the t'th term of 334399, 334246, 334093, 333940, 333787, 333634? -153t + 334552 What is the m'th term of 14427150, 14427160, 14427176, 14427198, 14427226? 3m*2 + m + 14427146 What is the f'th term of 2184, 4763, 7358, 9969, 12596, 15239, 17898? 8f*2 + 2555f - 379 What is the k'th term of 500, 349, -174, -1255, -3080, -5835? -31k3 + 66k + 465 What is the a'th term of 10896661, 10896669, 10896677, 10896685? 8a + 10896653 What is the d'th term of 153248, 613093, 1379536, 2452577, 3832216? 153299d*2 - 52d + 1 What is the j'th term of -24498, -5366, 13764, 32892? -j*2 + 19135j - 43632 What is the k'th term of -774534, -1549072, -2323612, -3098154? -k*2 - 774535k + 2 What is the t'th term of -761073, -1522173, -2283259, -3044325, -3805365, -4566373? t3 + t2 - 761110t + 35 What is the o'th term of -614, -435, -108, 391, 1086? 4o*3 + 50o*2 + o - 669 What is the w'th term of 821630, 1643361, 2465092? 821731w - 101 What is the s'th term of 6348, 6153, 5958, 5763? -195s + 6543 What is the l'th term of -370520, -741044, -1111568, -1482092? -370524l + 4 What is the f'th term of -75755, -151518, -227283, -303050, -378819, -454590? -f*2 - 75760f + 6 What is the j'th term of -460, -1115, -1824, -2611, -3500, -4515, -5680, -7019? -4j3 - 3j*2 - 618j + 165 What is the k'th term of 8384, 17952, 27520? 9568k - 1184 What is the x'th term of 199, 238, 347, 610, 1111, 1934, 3163? 14x*3 - 49x*2 + 88x + 146 What is the s'th term of -99127, -99633, -100139, -100645, -101151? -506s - 98621 What is the z'th term of -34284, -72419, -110540, -148641, -186716, -224759, -262764, -300725? z3 + z2 - 38145z + 3859 What is the l'th term of -228, -1955, -6734, -16119, -31664, -54923, -87450, -130799? -259l3 + 28l*2 + 2l + 1 What is the b'th term of -3854271, -3854201, -3854131? 70b - 3854341 What is the m'th term of 5209, 5828, 6493, 7204, 7961, 8764? 23m*2 + 550m + 4636 What is the n'th term of -306554, -613131, -919708, -1226285, -1532862, -1839439? -306577n + 23 What is the z'th term of 20008, 40096, 60172, 80230, 100264, 120268? -z3 + 20095z - 86 What is the x'th term of 34813921, 34813947, 34813991, 34814053, 34814133, 34814231? 9x2 - x + 34813913 What is the h'th term of 37756, 75509, 113254, 150991, 188720? -4h*2 + 37765h - 5 What is the c'th term of 3167199, 6334389, 9501581, 12668775, 15835971, 19003169, 22170369? c*2 + 3167187c + 11 What is the g'th term of 200617308, 200617317, 200617332, 200617353, 200617380? 3g2 + 200617305 What is the a'th term of 688, 1419, 2216, 3109, 4128, 5303, 6664? 5a*3 + 3a*2 + 687a - 7 What is the p'th term of -1371, -2650, -3931, -5214? -p*2 - 1276p - 94 What is the c'th term of -10982, -10978, -10980, -10994, -11026, -11082, -11168? -c*3 + 3c*2 + 2c - 10986 What is the r'th term of -11689, -11883, -12077? -194r - 11495 What is the k'th term of 27222592, 27222586, 27222580, 27222574? -6k + 27222598 What is the l'th term of 108834433, 108834437, 108834455, 108834493, 108834557, 108834653? l3 + l2 - 6l + 108834437 What is the t'th term of -1591088, -3182261, -4773434? -1591173t + 85 What is the t'th term of 6628, 13055, 19328, 25453, 31436? t*3 - 83t*2 + 6669t + 41 What is the v'th term of 5179, 7347, 6519, 2695, -4125? -1498v2 + 6662v + 15 What is the f'th term of -2120, -2435, -2742, -3041, -3332, -3615? 4f2 - 327f - 1797 What is the i'th term of -367276742, -367276741, -367276740, -367276739, -367276738, -367276737? i - 367276743 What is the z'th term of 464304, 1856420, 4176614, 7424886, 11601236? 464039z2 - z + 266 What is the m'th term of 4416, 8801, 13192, 17589, 21992, 26401, 30816? 3m*2 + 4376m + 37 What is the z'th term of 102180, 102215, 102250? 35z + 102145 What is the r'th term of -32998, -131865, -296642, -527329? -32955r*2 - 2r - 41 What is the s'th term of -61196, -121650, -182102, -242552, -303000? s*2 - 60457s - 740 What is the r'th term of 348808, 697647, 1046486, 1395325, 1744164? 348839r - 31 What is the p'th term of 153, 417, 739, 1119, 1557? 29p*2 + 177p - 53 What is the i'th term of -295, -1060, -2225, -3706, -5419, -7280, -9205, -11110? 14i3 - 284i*2 - 11i - 14 What is the y'th term of -12, -7, 166, 645, 1568? 23y3 - 54y*2 + 6y + 13 What is the k'th term of 1720824, 1720838, 1720862, 1720902, 1720964, 1721054, 1721178, 1721342? k3 - k2 + 10k + 1720814 What is the b'th term of 630, 2242, 4832, 8406, 12970, 18530, 25092, 32662? b3 + 483b*2 + 156b - 10 What is the r'th term of -48277, -193104, -434493, -772444, -1206957? -48281r2 + 16r - 12 What is the s'th term of -80927, -161830, -242733, -323636, -404539, -485442? -80903s - 24 What is the b'th term of 19650, 16060, 10076, 1698, -9074, -22240, -37800? -1197b**2 + b + 20846 What is the w'th ter	{ "pile_set_name": "DM Mathematics" }
.79 + -1.99. Let v = -11/20 - -4/5. Which is the second biggest value? (a) v (b) 1/5 (c) g b Let b = -6 - -1. Let h = -35.5 + 36. What is the second biggest value in b, -4/5, h? -4/5 Let p = -0.88 - 0.12. Which is the third biggest value? (a) 1/3 (b) p (c) -4 c Let g = 2.8 + -3.2. Which is the third biggest value? (a) g (b) -6/7 (c) 0 b Let h = -1272/7 - -182. Which is the smallest value? (a) 2 (b) 0.2 (c) h (d) -3/7 d Let i be 111/(-8)(-2)/(-3). Let m = 40652 + -1463147/36. Let j = i + m. Which is the third smallest value? (a) -2/3 (b) 3 (c) j b Let m = -8 + 3. Let n be (3/(-2))/(3/(-4)). Suppose 13l = 12l - 4. What is the third biggest value in l, n, m? m Let d be 18/(-30) - 123/(-5). Suppose -5r = 3o + 2 + 15, 4r = -5o - d. Which is the third biggest value? (a) -4/5 (b) -1/2 (c) r c Let v(x) = x3 + 11x*2 + 9x - 15. Let f be v(-10). Which is the smallest value? (a) -0.1 (b) 3 (c) f (d) 5 c Suppose -4x + 24 = -4s, -4x - 4s - 15 = x. What is the second smallest value in x, -3, 11? x Let u = 16 - 15.8. Which is the biggest value? (a) 3 (b) u (c) 0.1 a Let y be ((-28)/21)/(10/(-6)). Let k = -1 - -4. What is the smallest value in k, 2, y? y Let m = 62 - 60. Which is the third biggest value? (a) -3 (b) m (c) 4 (d) 1/8 d Let b = 4/37 - -95/148. Let t = 11 + -6. Let c = 3.92 + 0.08. What is the third biggest value in t, c, b? b Let n = -8.7 - -9.29. Let k = n + -0.19. Suppose -3o = 2o + 20. What is the smallest value in k, o, 1? o Let w = 0.02 - 4.02. Let n = 0 - 1. Let d = n + 1.1. Which is the second smallest value? (a) w (b) -0.5 (c) d b Let w = -1/39 + 9/13. What is the fourth biggest value in w, -2, 5, 0.4? -2 Suppose 0 = -5j + 6j - 4k + 5, k = 5j + 25. Let u = 4 + -3.6. What is the second smallest value in u, 2, j? u Let q be (-1)/(-2) + 2/(-12). Let k = -16 + 16. What is the second biggest value in k, q, 1/4? 1/4 Let h be (-7)/28(-16)/26. Let a be (6/(-72))/((-2)/6). What is the biggest value in -4/7, a, h? a Let f = -30 + 31. Which is the fourth biggest value? (a) 0.5 (b) f (c) -1 (d) -4 d Let b = -4.615 - -0.015. Let j = -5 - b. Let q be (-10)/(-25)(-20)/44. What is the second biggest value in -2, q, j? j Let f be (-6)/410/6. Which is the third smallest value? (a) f (b) -3 (c) 3 c Let r = 84 + -84.3. Which is the fourth biggest value? (a) 0.2 (b) 0 (c) -1 (d) r c Let k = -17 - -17.9. Let h = 0.7 - k. Which is the second biggest value? (a) -2 (b) -0.5 (c) h b Let t = 391/5 - 78. What is the second biggest value in -0.1, t, -1? -0.1 Let t = 208 + -208.4. What is the third smallest value in t, -0.1, 5, 4? 4 Suppose 5s - 3 - 7 = 0. Let x = -2 - s. What is the second biggest value in x, -0.3, -1? -1 Suppose q = -3w + 4q - 417, -20 = 4q. Let k be 4/w - 4/18. What is the biggest value in k, -2/21, 0? 0 Suppose 10 - 2 = 2p. Let y = -0.03 - -0.07. Which is the second smallest value? (a) 1/10 (b) p (c) y a Suppose 5m + 5 = 4s, 4m + 5s + 4 = -0. Let k be (3 - (-5 + 3)) + m. Which is the third smallest value? (a) -4 (b) k (c) -1/7 b Let d = 1.2 + -1. Which is the third smallest value? (a) d (b) 0.4 (c) -1 b Let z = 0.1 - 0.1. Let o = -20 + 35. Let s = o - 14. What is the second smallest value in z, 2, s? s Let v be (13/(-65))/((-3)/10). Which is the second biggest value? (a) -5 (b) v (c) 0.35 c Let i = -0.29 + -1.91. Let v = 0.2 + i. Let u = v + 2.2. What is the third biggest value in 3/2, -5, u? -5 Let s = 3.5 - 3.4. Let m = 1 + -3. Let j = -7 + 4. Which is the third biggest value? (a) m (b) j (c) s b Suppose -6t + 2t = 0. Suppose 0 = -2u + 4u, 5o - 2u + 5 = t. Which is the third biggest value? (a) o (b) -0.3 (c) 2/7 a Let z be (-6)/(0/1 - 1). Which is the second smallest value? (a) z (b) -0.7 (c) -2/3 c Let j = 52 + -207/4. Let n = 4.8 - 4.7. What is the smallest value in j, n, -0.2? -0.2 Let w = -10 + 3. Let q = w - -9. Which is the third smallest value? (a) 0.1 (b) q (c) 0.3 b Let f = -39 - -34. Let j(c) = c*3 + 6c*2 + 3c - 6. Let i be j(f). Let s = 0 + 1. What is the third smallest value in i, -2, s? i Let v = 12 - 11.95. What is the third biggest value in -5, v, 1? -5 Let g be 13/(-3) - 1/(-3). Let r be (-6)/(-27) - (-60)/(-27). Let j be -23r/18 - 3. What is the third biggest value in g, j, 0.2? g Let g = 10 + -5. Let y = -6 + g. What is the smallest value in y, 2/13, -2/9? y Let a = 1 + -0.99. Let s = a - -4.99. What is the second smallest value in s, -3, 3/4? 3/4 Let x be (-45)/62/3. Which is the smallest value? (a) 2 (b) x (c) 5 b Let m = -5 + 4.89. Let h = m + 0.01. Which is the third smallest value? (a) 0.4 (b) h (c) 2 c Let y = -14 - -14.01. Let f = 0.09 + y. Which is the biggest value? (a) 2/9 (b) -5 (c) f a Let w(j) = -j*2 - 5j + 3. Let q be w(3). Let y be (-22)/(-28) + 6/q. Which is the biggest value? (a) 5 (b) y (c) -3/7 a Let m be ((-34)/(-765))/((-1)/5). What is the third smallest value in -0.3, 0.3, 2, m? 0.3 Let w be (-1 + 4)/((-21)/2). Let p = 13 + -19. Let c = -5 - p. What is the smallest value in c, w, -0.5? -0.5 Let q = 0.7 - 0.5. Suppose 16 = -2r - 4y - 0, 2y + 14 = -4r. What is the second biggest value in -1, r, q? -1 Let a = -38 - -37.8. Let m(k) = -k - 6. Let s be m(-7). What is the smallest value in 0, s, a? a Let g = -3 + 2.9. Let r = 0 - g. Let u = 0.27 - 0.57. Which is the smallest value? (a) r (b) -1 (c) u b Let i(r) = r*3 + 2r*2 + 2r. Let f be i(-2). Let s = -0.104 + -2.896. Which is the third biggest value? (a) 2 (b) f (c) s b Suppose -3y + 5t = t + 17, 0 = -y + 3t - 4. Let v = 3 + y. Which is the third biggest value? (a) -1/3 (b) -2/5 (c) v c Let s = 29 - 27. Which is the second biggest value? (a) s (b) 0.5 (c) -3 (d) -0.2 b Let o = -2 + 1. Let k = 3.08 + -0.08. Let n = o + k. What is the smallest value in n, 1/5, -2? -2 Let b = -2.5 - -2. Let r = b + 0. Let w = -0.6 - r. What is the biggest value in -4, w, 0.1? 0.1 Suppose 0 = -2t + 5t. Let u = -163336 + 2121667/13. Let w = 131 + u. What is the third smallest value in w, t, 1/2? 1/2 Let k = 7 - 16. Let i = k + 9. Let y = -6 + 4. Which is the third biggest value? (a) i (b) y (c) 2/15 b Let k = 4 + -8. Let x be (-2)/11 + k/(-22). Suppose x = r - 0r. What is the biggest value in -0.3, r, -1? r Suppose 9s = 4s + 3f - 10, 25 = -4s - f. Which is the third smallest value? (a) 0 (b) -1 (c) s a Let w = 0.108 - 0.008. What is the second biggest value in 2, 4, -5, w? 2 Let z = 3 + -2.5. Let x = z - 0.9. Let y be 0/2 + (1 - 0). What is the smallest value in 3, y, x? x Let h(g) = g*2 - 6g + 3. Let u be h(6). Let f(p) = p*3 - 3p2 + 2. Let q be f(u). Let s be 20/6 - q/6. What is the second smallest value in -2, -1, s? -1 Let o = -1.7 - -2. Let x = 36 + -41. Which is the smallest value? (a) 2 (b) o (c) x c Let i = -0.2 - 0.3. Let q = -42 + 42. Which is the third biggest value? (a) q (b) -0.3 (c) i c Let g(u) = -u2 + 6u + 2. Let p be g(6). What is the biggest value in 1/7, 1/8, 3, p? 3 Let s = -16.3 - -17. Let j = s + -0.7. Let p be ((-6)/20)/((-24)/20). What is the third biggest value in p, -0.3, j? -0.3 Let f = -1.78 - 0.39. Let s = -0.17 - f. What is the smallest value in -1, s, 0.5? -1 Let l = -0.4 + 0.2. Let q = 1/140 + 39/140. What is the second biggest value in 3, l, q? q Let x = 253/36 - 29/4. Let l be 46/6 - 1/(-3). Let j = -13 + l. What is the second smallest value in 5/4, j, x? x Let k = 2.05 - 2. Let b = -0.35 - k. Let z = b - 0. What is the smallest value in 0, z, -3/5? -3/5 Let d be 1/((-4)/(-2) + 1). Let z = 467/5 + -93. Which is the third smallest value? (a) d (b) 3 (c) z b Let o = 0.3 - -0.2. Let c = -17 + 21.4. Let p = -4 + c. What is the third biggest value in o, -3, p? -3 Suppose 22 = -7y - 27. Which is the second smallest value? (a) -1/3 (b) -3 (c) y b Let w = 7 - 5. Let b = -27 - -28. What is the third biggest value in b, -2, w? -2 Let f(v) = -v*3 - 3v*2 + 4v + 1. Let w be f(-4). Let i be (-21)/28 - w/(-1). Which is the biggest value? (a) i (b) 4 (c) 1/12 b Let i = 1.8 - 3.8. What is the third biggest value in -4/5, 5, -5, i? i Let y = 11 + -11.2. What is the smallest value in y, 3, -2? -2 Let b be 6/24 - 0/1. What is the second biggest value in b, 2, -2/3, -1? b	{ "pile_set_name": "DM Mathematics" }
? 132 What is the eighth root of 285709 to the nearest integer? 5 What is 286126 to the power of 1/2, to the nearest integer? 535 What is 1458756 to the power of 1/5, to the nearest integer? 17 What is 905934 to the power of 1/5, to the nearest integer? 16 What is 3159166 to the power of 1/7, to the nearest integer? 8 What is 2337627 to the power of 1/2, to the nearest integer? 1529 What is the square root of 1745636 to the nearest integer? 1321 What is the square root of 180639 to the nearest integer? 425 What is 38810 to the power of 1/3, to the nearest integer? 34 What is 17834245 to the power of 1/2, to the nearest integer? 4223 What is 31017682 to the power of 1/7, to the nearest integer? 12 What is the sixth root of 1203259 to the nearest integer? 10 What is the third root of 172745 to the nearest integer? 56 What is 905746 to the power of 1/7, to the nearest integer? 7 What is 3363586 to the power of 1/2, to the nearest integer? 1834 What is the third root of 1679426 to the nearest integer? 119 What is the fourth root of 9714153 to the nearest integer? 56 What is the cube root of 32075909 to the nearest integer? 318 What is the eighth root of 517125 to the nearest integer? 5 What is 35234 to the power of 1/2, to the nearest integer? 188 What is 570659 to the power of 1/2, to the nearest integer? 755 What is the fifth root of 8436653 to the nearest integer? 24 What is the square root of 151597 to the nearest integer? 389 What is 8277071 to the power of 1/3, to the nearest integer? 202 What is 66243 to the power of 1/4, to the nearest integer? 16 What is 298908 to the power of 1/3, to the nearest integer? 67 What is the sixth root of 67529 to the nearest integer? 6 What is the square root of 3925912 to the nearest integer? 1981 What is 12477531 to the power of 1/5, to the nearest integer? 26 What is the third root of 8142282 to the nearest integer? 201 What is 208128 to the power of 1/2, to the nearest integer? 456 What is the seventh root of 464980 to the nearest integer? 6 What is the fourth root of 121036 to the nearest integer? 19 What is 303325 to the power of 1/8, to the nearest integer? 5 What is the ninth root of 1858882 to the nearest integer? 5 What is the sixth root of 2865866 to the nearest integer? 12 What is 278006 to the power of 1/5, to the nearest integer? 12 What is the square root of 3775976 to the nearest integer? 1943 What is the square root of 19638193 to the nearest integer? 4432 What is the fourth root of 5570731 to the nearest integer? 49 What is 147538 to the power of 1/2, to the nearest integer? 384 What is the cube root of 882773 to the nearest integer? 96 What is 21672650 to the power of 1/3, to the nearest integer? 279 What is the eighth root of 1708300 to the nearest integer? 6 What is the square root of 269231 to the nearest integer? 519 What is 8179037 to the power of 1/9, to the nearest integer? 6 What is 204721 to the power of 1/3, to the nearest integer? 59 What is 35860972 to the power of 1/2, to the nearest integer? 5988 What is the cube root of 20129045 to the nearest integer? 272 What is the square root of 4659952 to the nearest integer? 2159 What is 5808366 to the power of 1/2, to the nearest integer? 2410 What is the square root of 1362841 to the nearest integer? 1167 What is the cube root of 86211 to the nearest integer? 44 What is 25974 to the power of 1/2, to the nearest integer? 161 What is the cube root of 989849 to the nearest integer? 100 What is the tenth root of 5013522 to the nearest integer? 5 What is the third root of 6241110 to the nearest integer? 184 What is the square root of 5280036 to the nearest integer? 2298 What is the fourth root of 617175 to the nearest integer? 28 What is 1660699 to the power of 1/2, to the nearest integer? 1289 What is 12352116 to the power of 1/9, to the nearest integer? 6 What is 47569 to the power of 1/2, to the nearest integer? 218 What is 4241865 to the power of 1/3, to the nearest integer? 162 What is 8558182 to the power of 1/3, to the nearest integer? 205 What is 95906 to the power of 1/2, to the nearest integer? 310 What is 7053451 to the power of 1/3, to the nearest integer? 192 What is 378619 to the power of 1/7, to the nearest integer? 6 What is the square root of 30187853 to the nearest integer? 5494 What is the sixth root of 7775269 to the nearest integer? 14 What is the cube root of 730027 to the nearest integer? 90 What is the square root of 256702 to the nearest integer? 507 What is the fourth root of 759747 to the nearest integer? 30 What is 20417041 to the power of 1/2, to the nearest integer? 4519 What is the square root of 370370 to the nearest integer? 609 What is the cube root of 965031 to the nearest integer? 99 What is the third root of 2295820 to the nearest integer? 132 What is 407119 to the power of 1/3, to the nearest integer? 74 What is the square root of 96170 to the nearest integer? 310 What is the square root of 4951237 to the nearest integer? 2225 What is 21259599 to the power of 1/3, to the nearest integer? 277 What is the third root of 285781 to the nearest integer? 66 What is the square root of 6181490 to the nearest integer? 2486 What is the fifth root of 336851 to the nearest integer? 13 What is 1205162 to the power of 1/5, to the nearest integer? 16 What is the square root of 36843206 to the nearest integer? 6070 What is the cube root of 367401 to the nearest integer? 72 What is the tenth root of 5150783 to the nearest integer? 5 What is the cube root of 179695 to the nearest integer? 56 What is the cube root of 507329 to the nearest integer? 80 What is 30941251 to the power of 1/10, to the nearest integer? 6 What is 28343 to the power of 1/5, to the nearest integer? 8 What is the ninth root of 6356532 to the nearest integer? 6 What is the fifth root of 104243 to the nearest integer? 10 What is 5647424 to the power of 1/3, to the nearest integer? 178 What is the cube root of 918245 to the nearest integer? 97 What is the third root of 116568 to the nearest integer? 49 What is the cube root of 4368215 to the nearest integer? 163 What is 397326 to the power of 1/2, to the nearest integer? 630 What is 44029 to the power of 1/3, to the nearest integer? 35 What is 907709 to the power of 1/3, to the nearest integer? 97 What is the cube root of 109658 to the nearest integer? 48 What is 14355272 to the power of 1/2, to the nearest integer? 3789 What is 12634250 to the power of 1/9, to the nearest integer? 6 What is 825617 to the power of 1/2, to the nearest integer? 909 What is the third root of 141695 to the nearest integer? 52 What is 469951 to the power of 1/3, to the nearest integer? 78 What is 867998 to the power of 1/10, to the nearest integer? 4 What is the cube root of 1249182 to the nearest integer? 108 What is 84595 to the power of 1/6, to the nearest integer? 7 What is the eighth root of 32022028 to the nearest integer? 9 What is 727171 to the power of 1/2, to the nearest integer? 853 What is 7860135 to the power of 1/5, to the nearest integer? 24 What is the third root of 539784 to the nearest integer? 81 What is 931116 to the power of 1/10, to the nearest integer? 4 What is the third root of 74584 to the nearest integer? 42 What is the square root of 121734 to the nearest integer? 349 What is 818939 to the power of 1/2, to the nearest integer? 905 What is the square root of 258799 to the nearest integer? 509 What is the cube root of 55749 to the nearest integer? 38 What is 1979575 to the power of 1/7, to the nearest integer? 8 What is the ninth root of 197956 to the nearest integer? 4 What is 14435661 to the power of 1/2, to the nearest integer? 3799 What is the third root of 38115312 to the nearest integer? 337 What is the third root of 13373946 to the nearest integer? 237 What is 35308308 to the power of 1/9, to the nearest integer? 7 What is the third root of 6479034 to the nearest integer? 186 What is 1549270 to the power of 1/3, to the nearest integer? 116 What is 477185 to the power of 1/3, to the nearest integer? 78 What is 227657 to the power of 1/2, to the nearest integer? 477 What is the square root of 23936 to the nearest integer? 155 What is the third root of 53123 to the nearest integer? 38 What	{ "pile_set_name": "DM Mathematics" }
(-15)(14 + -2). What is the units digit of (m/(-20))/((-1)/70)? 8 Let x(r) = -r - 9. Let z(y) = 2y + 10. Let h(o) = 3x(o) + 2z(o). Let a be h(3). What is the units digit of 3/((-3)/a2)? 2 Let w(f) = -50f*2 - 14f + 24. Let v be w(12). What is the tens digit of v/(-90) + ((-2)/(-5))/1? 8 Suppose 0 = 2p + 11a - 10a - 7454, 4a = 4p - 14884. What is the units digit of p? 5 Let u(k) = 438k*2 + k - 2. What is the units digit of u(1)? 7 Let v = 8094 + -5213. What is the thousands digit of v? 2 Suppose -3v = 3k - 8v - 8594, 5v = 25. What is the thousands digit of k? 2 Let j(a) be the third derivative of -a5/12 + a4/6 - 7a*3/6 + 4a*2. Let b(p) be the first derivative of j(p). What is the units digit of b(-2)? 4 Let f = 4 - 4. Suppose g - u = 3, g - 14 = -2g - 2u. Suppose -gk + 0k + 28 = f. What is the units digit of k? 7 Let t(z) = 2z + 16. Let q be (7/(-2))/(-5(-8)/80). What is the units digit of t(q)? 2 Suppose 750 = -2o - 140. Let w = o - -715. What is the hundreds digit of w? 2 Suppose 14312 = -18l + 21l + 4u, -4u = -3l + 14296. What is the thousands digit of l? 4 Suppose 333 = 2m + m + 2w, -4w = 2m - 222. What is the units digit of m? 1 Suppose -4a = a + 10. Let r be 24/10 - (-11)/((-220)/8). What is the units digit of (3 + a)(r - -37)? 9 Suppose -126 = -4p + 758. Let q = -85 + p. What is the hundreds digit of q? 1 Let a(v) be the third derivative of -v4/6 + v3 - 8v2. Let u be a(3). Let q(z) = z3 + 6z*2 - 7z - 3. What is the tens digit of q(u)? 3 Let v(x) = 4x2 - 21x - 59. What is the tens digit of v(-4)? 8 Suppose 0 = h - 1 + 22. Let n = h - -24. Suppose k = nk - 4. What is the units digit of k? 2 Let s(i) = -i3 - i2 + i + 191. Suppose -2f - 4 = -t + 2, f + 3 = 4t. Let o be s(t). Suppose 127 = 6r - o. What is the units digit of r? 3 Let r = 3 - -1. Let f = 261 - 163. Suppose -rd + f = 14. What is the units digit of d? 1 Let y = 11 + 2. Suppose yh - 15h = -2. What is the units digit of h? 1 Suppose 0p + 3p - 93 = 0. Suppose 2l - l = -5, 3b - 5l = p. Suppose 0 = 2m + 2j - 50, -2m + bj + 41 = -29. What is the units digit of m? 0 Let w(o) = -9o - 19. Let a(s) = -9s - 19. Let n(i) = -6a(i) + 7w(i). What is the units digit of n(-8)? 3 Suppose -5i - 2c + 6023 = 0, 13i - 17i - 5c + 4832 = 0. What is the hundreds digit of i? 2 Let p(n) = -8n*2 - 20n*3 + 45n*3 - 5n - 26n3 + 6. What is the tens digit of p(-8)? 4 Let g(s) = 3 - 83s + 75s + 5s2 + s3 - 3s2. What is the units digit of g(4)? 7 Let t = 8 - 3. Suppose -y - 5g + 22 = -6g, 3y = -tg + 50. Suppose 4a = -16, -2m + y = a + 3a. What is the units digit of m? 8 Let w = -19 + 29. Suppose -w = -3u + 2, 4c = -2u + 256. What is the units digit of c? 2 Let b = 3655 - 1992. What is the tens digit of b? 6 Let n be ((-1)/42)/((-2)/116). Let c = n + 49. What is the tens digit of c? 7 Let l be (2(-36)/8)/1. Let c be 2/((-3)/l + 0). What is the units digit of (1 - 6)/(c/(-24))? 0 Let d = -11 + 19. Suppose -db + 3b + 2c - 4 = 0, 2b + 6 = 3c. Suppose b = 2m - 6, -4t + 36 + 89 = 3m. What is the tens digit of t? 2 Let f = 2442 - 1655. What is the tens digit of f? 8 Suppose -3c + 1054 = 2c - 3z, 414 = 2c - 5z. What is the units digit of c? 2 Suppose 2g = 3d + 66, 0 = 2g - 5d - 41 - 25. What is the units digit of (482/12 + (-22)/g)4? 8 Suppose 2t - 6t + 44 = -3w, -4w - 4t = 96. Let n = w - -30. What is the units digit of n? 0 Let j = 11 + -8. Suppose -jr + 15 = -5w, 7r - 3r - 20 = -3w. What is the units digit of r? 5 Let l(j) = -41j*2 + 2j - 4. Let t(z) = 1. Let k(x) = -l(x) - 3t(x). What is the units digit of k(1)? 0 Let s(m) be the third derivative of 11m*4/12 + 17m*3/6 - 10m*2 - 1. What is the tens digit of s(3)? 8 Suppose 15 = -5j + 135. Suppose -5m - 2i = -81, 0m + 2m - 2i = j. Let y = -9 + m. What is the units digit of y? 6 Let z = -34 + 33. What is the units digit of ((-24)/(-60))/(z/(-35))? 4 What is the thousands digit of (-61460)/(-26) - (-5 + (-441)/(-91))? 2 Let y(h) = 8h*2 + 62h - 125. What is the tens digit of y(17)? 4 Suppose 4o = -4i + 2i - 12, 0 = -2i - 3o - 9. Suppose b + v = -ib + 16, 4b = -2v + 60. What is the tens digit of b? 1 Suppose 0 = 20a + 5540 - 27540. What is the tens digit of a? 0 Suppose -4f + 8 = -0f + 4m, 0 = f - 5m + 10. Suppose -p - 13 = 2v - 3v, f = -v + 5p + 9. What is the units digit of v? 4 Suppose 254 + 263 = q. Let u = q + -273. What is the tens digit of u? 4 Suppose 4v = 2y + 8, 2v - 4y = 2 + 2. Let r(g) = -10 + 8g2 - 7g*3 + 4g*v + g + 6g3. What is the units digit of r(12)? 2 Let y(i) = i3 - 24i2 + 25i - 37. Suppose -78 = 6d - 216. What is the units digit of y(d)? 9 Let p(z) = -3z + 17. Let w be p(-5). Suppose h + w = 44. What is the units digit of h? 2 Let h(k) = 42k2 + 17k + 18. What is the units digit of h(-4)? 2 Let t be ((-612)/10)/((-6)/20). Let o be (t/8)/36. Suppose 3s = 5s - 5a - o, 64 = 3s - 5a. What is the tens digit of s? 1 Suppose 4o - 5v = 2885, 9v = -2o + 14v + 1445. What is the units digit of o? 0 Let m be (-9 + 2)(-2 + 25). What is the tens digit of 12/36 - m/3? 5 Suppose c + 319 = -j, -4c + 643 = -6c - 3j. Let z = -114 - c. What is the hundreds digit of z? 2 Let i(s) = 10 + 2s*3 - 3s*3 + 16s + 14s2 + 0s3 - 17. What is the units digit of i(15)? 8 Let j(l) = l2 + 12l + 31. Let n be j(-9). Suppose -g = nd - 140, 0d + 590 = 4g + d. What is the tens digit of g? 4 Let x = 2 + -2. Suppose xw = 4w - 88. Suppose 88 = 5c - w. What is the units digit of c? 2 Let j(f) = -14 + 4 + 15f + 5. What is the tens digit of j(3)? 4 Let g(o) = 128o - 262. What is the thousands digit of g(14)? 1 Suppose r + 7h + 6 = 4h, 5h = -5r - 60. Let s = r - -15. What is the tens digit of -1 - (-30 + s/3)? 2 Suppose -3h + 0f - 3f = 24, 3h + 10 = 4f. What is the units digit of (33/h + 4)/((-3)/6)? 3 Suppose -26d + 12 = -22d. What is the tens digit of ((25 - 4) + d)/(1 - 0)? 2 Suppose -3o + 2 = -2x, 5o = -5x - 0 - 30. Let d be o/(-6) - (-884)/39. Suppose 5y + 0c - 2c - d = 0, -3 = 3y + 3c. What is the units digit of y? 3 Let k(p) = 3p - 8. Let g(z) = 2z - 8. Let d(s) = -4g(s) + 3k(s). Let h be d(4). Suppose -2c - c = 4r - 40, -3c = -h. What is the units digit of r? 7 Let y(f) = 11f2 - 367f - 46. What is the units digit of y(40)? 4 Suppose -17398 = -38r + 17448. What is the units digit of r? 7 Suppose -c = -5 + 1. Suppose -605 = -cw - w. What is the tens digit of w? 2 Suppose b - 407 = -2b + j, -b + 149 = -3j. Suppose -5i - b = -5t - 4, 5t = 2i + 136. What is the units digit of t? 8 Let l(v) be the third derivative of v6/120 - v5/60 - v*4/24 + 5v*3/3 - 2v*2. Let b be l(0). What is the units digit of (-5)/25 - (-72)/b? 7 Suppose z + 2a = 563, 46z - 47z + 591 = -5a. What is the tens digit of z? 7 Suppose -3v = 3p + 15, 0 = -13v + 16v - 3p - 9. Let w(i) = i*2 - 4i - 2. Let l be w(4). Let c = v - l. What is the units digit of c? 1 Let m(g) be the second derivative of g*3/6 - 3g*2 + 3g. Let u be m(8). What is the tens digit of (-1 + u)/((-2)/(-30))? 1 Suppose 2n + 517 = 2299. What is the tens digit of n? 9 Let p(f) = 8f*2 - 49f - 2. What is the tens digit of p(20)? 1 Let s = 84 - 67. Suppose 2u - 3667 = -su. What is the tens digit of u? 9 Let p = -1874 + 2725. What is the units digit of p? 1 Let j(h) = -h. Let w be j(-4). Suppose 35 = wt - 17. Let y = -7 + t. What is the units digit of y? 6 Let b(x) be the third derivative of x5/4 - x4/24 - 4x*3/3 - 18x2. What is the hundreds digit of b(4)? 2 Let d(o) be the second derivative of o3/3 + o*2 + 3o. Let a be d(-1). Suppose y + ay = 5u + 59, -85 = -2y - u. What is the units digit of y? 4 Suppose 1764 = v - 5m, 6v - 8874 = v - 2m. What is the tens digit of v? 7 Let t(j) = j*2 - j + 1. Let h be t(0). Suppose 3m = d + h, 0d = d + 4m - 13. Suppose -4 = -3w + d. What is the units digit of w? 3 Suppose 5t - 5f - 25 = -f, -3t + 2f = -15. Suppose l = 4, p - 2l + 112 = tp. What is the units digit of p? 6 Let m(v) = -v*2 - v - 1. Let h be m(-3). Let q = -31 - -49. Let o = q + h. What is the tens digit of o? 1 Let m be 2382/2	{ "pile_set_name": "DM Mathematics" }
281. Let b(d) = 5d + 284. What is 4b(t) + 3l(t)? 2t + 293 Let l(v) = -26v3 - 5v + 5. Suppose 0 = -110i + 133i - 2852. Let x(t) = -651t3 - 124t + 124. Give il(g) - 5x(g). 31g3 Let f(u) = 4u. Let t(n) = 19 + 2n - 1 + 16 + 0n. Let p be t(-19). Let b(c) = -5c. Suppose -13 = 4r - 1. Give pf(k) + rb(k). -k Let x(z) = -2z + 93. Let c(f) = -12f + 746. Let l(y) = c(y) - 8x(y). Let i be 5/(-11)1. Let q(n) = 4n + 3. Calculate il(j) + 4q(j). -4j + 2 Let z(q) = 9q - 4. Let f = 713 + -718. Let o(l) = 8l - 4. Calculate fz(x) + 6o(x). 3x - 4 Let p(m) = 308m. Let a(f) = -385f - 99. Let o(q) = -12q - 3. Let x(t) = -4a(t) + 132o(t). Give -3p(c) - 22x(c). 44c Let c(t) = -45t - 5. Let i(w) = 168w + 21. Calculate -15c(u) - 4i(u). 3u - 9 Let k(u) be the second derivative of -u3/2 + u2 + 3350u. Let g(h) be the second derivative of 2h3/3 - 3h*2/2 - 2h. What is 5g(i) + 6k(i)? 2i - 3 Let y(h) = 12h*3 + 28h*2 + 2h + 8. Let x(c) = -5c3 - 14c*2 - 4. Determine 5x(b) + 2y(b). -b3 - 14b*2 + 4b - 4 Let j(n) = 9n3 - 6n*2 - 6n + 12. Let y(b) = -b3 + b2 + b - 1. Let q be -3 - (1/(((-12)/27)/4))/1. Determine qy(s) + j(s). 3s*3 + 6 Let x = -112 - -101. Let d(f) = -23f + 5. Let o(p) = 8p. Let z(q) = 1. Let i(u) = -o(u) + 2z(u). What is xi(r) + 4d(r)? -4r - 2 Let p(o) = 2o - 2. Let n be p(3). Let f(s) = 82s - 1. Let m(x) = -33x + 1. Let u(z) = -2f(z) - 5m(z). Let j(v) = 2v - 6. Calculate nj(d) - 7u(d). d - 3 Let h(x) = -33x*2 + 1013. Let m(l) = 83l*2 - 2028. Calculate 5h(n) + 2m(n). n2 + 1009 Let b(f) = 6f + 16. Let t(n) = -132 - 6n + 127 + 4n. Suppose 28 = 5x + 78. Let w(d) = -d3 - 10d*2 - 3. Let p be w(x). Give pb(m) - 10t(m). 2m + 2 Let b(y) = -y + 1. Let l(i) = -33i + 4. Suppose -63f + 1 = c - 62f, -3c - 3 = 5f. Give cb(n) - l(n). 29n Let f(p) = 8p + 4. Let u(c) = 54c + 3 - 95c + 49c. Suppose 0 = 3l - 6g + 5g - 13, 3l = 3g + 21. Determine lu(j) - 2f(j). 8j + 1 Let g(q) be the first derivative of -7q*4/4 - 35q*3/3 + 5q*2/2 + 1809. Let c(d) = -4d*3 - 18d*2 + 3d. Determine -5c(a) + 3g(a). -a*3 - 15a*2 Suppose 0 = 5k - 0k + 5u - 5, 5k = u + 11. Let j(o) = 3o + 2. Let m(w) = 8 + 2w + 10 - 15. Calculate km(v) - 3j(v). -5v Let g(i) be the second derivative of -i*3/3 + 7i*2/2 + i. Suppose 2z = -3 + 13. Let n(w) = 80 - 181 + 95 + 2w. Give zg(x) + 6n(x). 2x - 1 Suppose 295y - 299y = -20. Let r(i) = -2i - 3i*3 - 121i*2 + 74i*2 + 52i*2. Let f(k) = 4k*3 - 6k*2 + 0k*3 + 0k*2 + 3k. Give yr(b) + 4f(b). b3 + b2 + 2b Let p(w) = -20w*2 - 6w - 14. Suppose -3u - 17 + 33 = -2z, u + 3z = 9. Let m(c) = 7c*2 + 2c + 5. Calculate up(r) + 17m(r). -r*2 - 2r + 1 Let v be (-1)/(3 - 7/2) + 1. Let s(z) = -12z - 2 + 0 + 11z + v. Let f(u) = 8 + 5u - 5 - 1 - 6. Determine -f(g) - 6s(g). g - 2 Let y(g) = -1847g + 3694. Let u(w) = -w3 + w - 2. Give -3694u(a) - 2y(a). 3694a*3 Let w(j) = 120j*2 - 22j + 22. Let p(g) = 17g2 - 3g + 3. Let k = 5962 - 5968. Determine kw(h) + 44p(h). 28h2 Let j(z) = -4z*2 + 2z. Let r(m) = 21m2 - 11m. Let o(d) = 2d3 - d2 + 1. Let q be o(-1). Suppose -11f = -8f + 33. Give fj(t) + qr(t). 2t*2 Let g(m) = -31m*3 - 2m*2 - 21m + 1. Let r(q) = 33q3 + 3q*2 + 22q - 1. Determine 3g(k) + 2r(k). -27k3 - 19k + 1 Let h(o) = -1225o - 59. Let k(s) = 613s + 24. What is -2h(y) - 5k(y)? -615y - 2 Let o(l) = 10l - 3. Let i = 3884 + -3885. Let f(b) = b. Calculate io(w) + 5f(w). -5w + 3 Let w(p) be the second derivative of 3p5/20 + p4/2 - 20p3/3 - 2p*2 - 3p - 222. Let n(c) = 8c3 + 17c*2 - 119c - 11. Determine 4n(f) - 11w(f). -f*3 + 2f*2 - 36f Let i(g) = 4g3 + 36g*2 + 22g + 7. Let n(a) = 2a3 + 18a*2 + 13a + 4. Determine 3i(j) - 5n(j). 2j3 + 18j*2 + j + 1 Suppose 0 = -4r + 2f + 32, 0 = 4r - 7f + 10f - 2. Let j(a) = -3a3 - 5a*2 + 18a - 2. Let q(y) = -y*3 - 2y*2 + 9y - 1. Calculate rq(i) - 2j(i). i*3 + 9i - 1 Let p(h) = -9h + 3. Let m(b) = 20b - 13. Let l(v) = -30v + 20. Let d = -344 + 349. Let u(z) = dl(z) + 8m(z). What is -6p(i) - 5u(i)? 4i + 2 Let u(x) = 10x3 - 1546x*2 + 8. Let i(k) = -2k*3 - 2. Give 4i(f) + u(f). 2f3 - 1546f*2 Let n(h) = -5h*3 + 2h*2 - 8h + 96. Let v(r) = -10r3 + 5r*2 - 20r + 193. Give 5n(l) - 2v(l). -5l3 + 94 Let l(u) be the second derivative of -u5/4 - u4/6 - u3/6 - 80411u. Let s(n) = 3n3 + 0n2 + n3 + 2n2 + n. Calculate -5l(t) - 6s(t). t3 - 2t*2 - t Let o(y) = -4y - 5. Let j(s) = -405s + 23. Determine -j(u) - 5o(u). 425u + 2 Let r(n) = 7n*3 + 6. Let g(f) = 4f*3 + 10f*2 + 5f + 6. Let z(b) = -3b3 - 8b*2 - 4b - 5. Let o(i) = 4g(i) + 5z(i). Calculate -5o(k) + r(k). 2k*3 + 11 Let v(p) = 2p*3 - 5p*2 - 2p - 1728. Let t(x) = -4x3 + 13x*2 + 5x + 3456. Determine -2t(o) - 5v(o). -2o3 - o2 + 1728 Let p(n) = -7n - 4. Let l(i) = 6i + 3. Let v = -101 + -77. Let w = -173 - v. Determine wp(k) + 6l(k). k - 2 Let o(d) = 2d*3 - 2d*2 - 4d - 1. Let t(n) = 485n3 - 8n*2 - 16n - 4. Calculate -4o(v) + t(v). 477v*3 Let w be 1/(20/1400-10). Let f(s) = -81s - 4. Let l(j) = -40j - 2. Determine wl(o) + 3f(o). 37o + 2 Let f(b) = -2b*3 + 7b*2. Let r = -116 - -119. Suppose 3x + 2 = 8. Let s(a) = 2a2 + a3 - ra3 - ax + 5a2. Determine -5f(k) + 6s(k). -2k3 + k2 Let y(q) = 366q + 228. Let p(v) = 548v + 360. Give -5p(j) + 8y(j). 188j + 24 Let c(k) = 1256k - 1. Let u(s) = 16s. Calculate -c(o) + 6u(o). -1160o + 1 Let f(r) = -5r*2 + 3r*2 - 5 + 6r*2 - 4r. Suppose 15i - 96 = 4i - 5i. Let v(u) = 5u*2 - 4u - 6. Suppose -7o = -5o + 10. Give if(l) + ov(l). -l*2 - 4l Let i(r) = -5r3 + 6r*2 + 6r - 6. Suppose t + 89 - 67 = -3y, 38 = -3y - 5t. Let z(c) = -6c*3 + 5c*2 + 5c - 5. Calculate yz(p) + 5i(p). 11p3 Suppose -232 = -155z + 201 + 342. Let l(w) = 10w3 + 6w*2 - 2w - 5. Let o(p) = -15p3 - 9p*2 + 3p + 8. Give zo(j) + 8l(j). 5j3 + 3j*2 - j Let u(w) = 21w*3 + 7w*2 - 3. Let h(m) = -7m*3 - 2m*2 + 1. Suppose 0 = -4j - 3i + 31, 2j - i - 19 = -6. Calculate jh(d) + 2u(d). -7d3 + 1 Let s(l) = -6l*2 - l + 2. Let k(n) = 233n*2 - 936n*2 - 1 + 233n*2 + 231n*2 + n + 238n*2. What is -k(h) - s(h)? 7h*2 - 1 Let i(z) = -252z*2 + 95z. Let y(w) = 84w2 - 31w. What is -4i(b) - 13y(b)? -84b2 + 23b Suppose -3k = 15, -5k + 1 = -v + 34. Let p(y) = -18y - 5. Let t(o) be the second derivative of o3 + o2 - 108o + 2. What is vt(q) + 3p(q)? -6q + 1 Let t(p) = -p2 - p. Suppose 0 = g + 13 - 18. Let q(l) = 0 - g + 0l + l*2 + 4 - 3l. Calculate q(k) - t(k). 2k2 - 2k - 1 Let k = -8 - -19. Suppose 0 = -3t - 7 - k. Let a(q) be the second derivative of q3/3 - 2q*2 - 1137q. Let i(z) = -4z + 7. Determine ti(u) - 11a(u). 2u + 2 Let s(m) = 4m - 652. Let z(g) = -16g + 1952. What is -7s(b) - 2z(b)? 4b + 660 Let c(g) = -g2 - g - 1. Let u = -554 + 101. Let p = u + 452. Let r(f) be the first derivative of -4f*3/3 - 3f*2 - 4f + 1. Calculate pr(l) + 5c(l). -l*2 + l - 1 Let t(y) = 10y + 109. Let f(v) = -2v - 6. What is 2f(w) - t(w)? -14w - 121 Let m(f) = 94f + 5 - 5f3 + 87f + 5f2 - 2f*2 - 285f + 98f. Let a(w) = 4w*3 - 2w*2 + 5w - 4. Give 6a(i) + 5m(i). -i*3 + 3i*2 + 1 Let s(i) = -16i*2 - 3i + 4. Let d(v) = -v - 31 - 39 - 35 - 33 + 139. Determine 3d(w) - s(w). 16w*2 - 1 Suppose -i + 5u - 13 = 0, 0 = 2i - 2u + u + 53. Let a be (i/21)/(-4)-3. Let o(h) = -h3 + h2. Let b(p) = 3p*3 - 5p*2 + 1. Calculate ab(v) - 5o(v). 2v*3 - 1 Let w(c) = 14c*2 - 7c + 5. Let n(x) = 12x2 - 4x + 4. Give 6n(q) - 5w(q). 2q2 + 11q - 1 Suppose 258l + 349 = -941. Let w(z) = 85z*3 - 5z*2 + 5. Let s(j) = 43j*3 - 2j*2 + 2. Calculate ls(t) + 2w(t). -45t*3 Suppose -182 = -48g + 106. Let z(t) = -14t2 - 13t - 13. Let o(v) = 7v2 + 6v + 6. Calculate gz(k) + 13o(k). 7k2 Let v(a) = -a2 + 5a - 7. Let x be v(5). Let l(p) = -5p + 16p*2 - 11p*2 - 3 + 5 + 0 - 4p. Let d(n) = 3n2 - 5n + 1. What is x	{ "pile_set_name": "DM Mathematics" }
arest to -0.1 in -1/5, i, s? -1/5 Let s = -0.26 - -1.56. Let f = s - 1.6. What is the closest to 1 in -2/11, f, -1/4? -2/11 Let o = 0.1 - 0.1. Let x = 2.93 - 2.73. Which is the nearest to o? (a) 3/2 (b) x (c) 2 b Let h = 72.73 + -73. Which is the nearest to 0.1? (a) 0.3 (b) h (c) 0.4 a Let o = -0.04 + -0.16. Which is the nearest to o? (a) 0.2 (b) 0 (c) 0.5 b Let k = -221 - -222. What is the nearest to -4 in k, -0.1, 0.4? -0.1 Let x = 2.99 + 0.01. Let o = 1.3 - 0.3. Let d = 30 + -28. What is the closest to o in x, 2/7, d? 2/7 Let s = -38 + 37.8. Which is the nearest to 0.1? (a) 0.5 (b) 3/5 (c) s c Let o = 0.9 + -5.9. Let f be 3/12 - 646/(-4040). Let y = f + -1/101. What is the closest to 1/4 in y, 4, o? y Let l = 1.2 + -6.2. What is the nearest to 0.5 in -0.2, l, -0.4? -0.2 Let d be 3/(-6) - 3/(-8). Let n be 1/411 + -381 + 378. Let f = -156/7 - -22. Which is the closest to 1/3? (a) n (b) f (c) d c Suppose -5y - 4485 = 140. Let h = y - -109149/118. Let l = h - 227/1062. Which is the nearest to 0.1? (a) l (b) -2 (c) -5 a Let v be (-2)/(-10) - 32/60. Let p = 4 + -5. Which is the closest to p? (a) -0.1 (b) v (c) -2/17 b Let q = 1.57 - 1.07. What is the nearest to 0.1 in -10, 4, q? q Let w be (-2)/24 - (-1)/3. Let z = 0.06 + 1.94. Let n = -4 + z. Which is the nearest to 0? (a) n (b) 4 (c) w c Let p = -4 - -4. Suppose -g - 3g + 20 = p. Suppose 6r - 5r - 3d + 19 = 0, 3r - gd + 37 = 0. Which is the nearest to 0? (a) r (b) 2/7 (c) -1/3 b Suppose 10 = 7f - 4. Let s be (f/(-5))/(-1) - 0. What is the closest to 1 in 2, -2, s? s Let p be (702/(-65))/(16/(-250)). Let g = 168 - p. What is the closest to 1 in g, 5, 3? g Let p(y) = y3 + 10y*2 + 17y + 4. Let m be p(-8). Let t = 7 + -5.1. Let c = t + -2. What is the closest to c in m, -1, 0.3? 0.3 Let m = 0.85 + 0.15. What is the nearest to -4 in 2, m, -3? -3 Let t = 1.2 + -8.2. Let d = t + 6.7. Let a = 5/17 - -19/51. What is the closest to -1 in d, a, -3? d Let n = -7.9 - 0.1. Let k = n + 10. Let x be 1/(-1) - 26/(-30). Which is the nearest to k? (a) x (b) -5 (c) 0 c Let j = -10 + 9.9. Let r = 11 + -8. Let u = -5 - -11/2. What is the closest to r in j, -2/9, u? u Suppose 5u = -3 + 8. Let g be 2 + ((-15)/18 - u). What is the nearest to -2/5 in -0.2, g, -0.1? -0.2 Let f be (-23)/(-21)-3 + 3. Let q = -2 + 1.7. Which is the closest to -2/7? (a) f (b) q (c) -2/15 a Let z be ((-42)/27)/(-2) - 1. Let r = 0 - -0.2. Let m = 2 - 2. Which is the nearest to m? (a) z (b) r (c) 2 b Suppose -2s - s + 15 = 0. Suppose 3o - 7 = -3k + 14, 20 = sk. Suppose -od = -4d - 3. Which is the nearest to 1/3? (a) 3 (b) -2 (c) d b Let f = 0.17 + -0.05. Let z = f - -0.28. What is the closest to 1/3 in 0.1, 0.5, z? z Let m = -4.16 + 0.16. Let t = -3 + 5. What is the nearest to t in 1/8, 0.4, m? 0.4 Let k = 1.1 + -1.55. Let s = k - 0.05. What is the nearest to 0.1 in 3/4, s, -1? s Let y = 1 + 0. Let q = y - 4. Let v be -5 + 125/15 + -3. Which is the nearest to v? (a) 5 (b) q (c) 2/13 c Let g = 8 + -10. What is the closest to g in -1, 11, -0.5? -1 Let l = 0.2 + -0.4. Let n = l + 0.19. Let u = n - -0.01. Which is the nearest to -1? (a) 0.5 (b) -0.4 (c) u b Let q(u) = u - 1. Let n(c) = -c*3 - 7c*2 - 2c - 5. Let z = -4 - -8. Let p(r) = zq(r) - n(r). Let m be p(-6). What is the nearest to 1 in -1, 2, m? m Suppose -4n - n + 4j = 36, 0 = n - 5j + 3. Let s = n - -4. Which is the nearest to 2/13? (a) 2 (b) s (c) 4 a Let s = -44 + 40. What is the nearest to 0.2 in -5/2, 5, s? -5/2 Let d = 27 + -26. Let c = -1.99 - 0.01. Let a = 3 + c. What is the nearest to a in -1, 1/4, d? d Let w be 2/6 - 2/(-12). Which is the closest to 0? (a) -2/13 (b) -4 (c) w a Let n = 2.2 + -2. Let t = 0.4 - n. Let d be 16/(-8) + (-6)/(-2). Which is the closest to d? (a) t (b) -0.3 (c) -3 a Let x = -0.9 - -1.1. Suppose -l = -0l. Which is the nearest to -1? (a) l (b) x (c) -0.2 c Let p = -1.1 + 0.1. Suppose m + 2g + 10 = 0, 4g - 27 + 5 = 5m. Let x be (1/2)/(m/(-4)). What is the closest to p in -1, x, 0.3? -1 Let p = 26/3 - 25/3. Let t be (-30)/27(-12)/10. What is the closest to -1/3 in t, p, -0.3? -0.3 Let u be 15/100(-5)/2. Let j = 2.317 + -0.017. Let v = j - 2. What is the nearest to -2/3 in u, v, -1/2? -1/2 Let r = 539 - 108338/201. Let s = r + 598/1005. Let j = -3 - -2. Which is the nearest to -0.1? (a) 2/5 (b) s (c) j a Let k be 1/(-39)-23. Suppose 25 = -0q + 5q. What is the nearest to -2/5 in q, -0.5, k? -0.5 Let y = -13/20 + 9/10. Let x = 39 - 36. What is the nearest to 0 in y, x, 0.5? y Let l = -16 + 16.28. Let n = -0.02 - l. Which is the closest to -1? (a) n (b) -1/4 (c) -4 a Let r(a) = -a - 1. Let m be r(-3). Suppose d - 7 = -4g, -3g = -mg - 4d - 23. Let o = -16 - -16. What is the closest to -0.1 in -0.3, g, o? o Let r = 1.4 + -0.4. Let k = -0.2 + -1.8. What is the closest to r in 1/5, k, 0.5? 0.5 Let n = 0.1 - 0.3. Let m = n - -0.2. Let i(h) = -4h + 46. Let x be i(12). Which is the nearest to m? (a) -5 (b) 1/3 (c) x b Let t = 0 + 0. Let f = 0.5 - t. Which is the closest to -1? (a) -0.1 (b) -5 (c) f a Let s = -56.9 + 57. Let z be (4/8)/(17/(-4)). What is the nearest to s in z, -0.1, -0.2? -0.1 Let l = 0.63 - -4.37. What is the closest to 2/15 in -0.3, l, 0.2? 0.2 Let r = -0.9 - -0.8. Which is the closest to r? (a) 2/7 (b) 2 (c) 0 c Let o = -2 + 1.5. Let k = o - -0.3. Let u = k + 0.2. What is the closest to u in 2, 0.5, -0.3? -0.3 Let o be (-3)/(-15) + 66/(-105). Which is the nearest to 3? (a) o (b) -1 (c) 1 c Let p = 5 + 2. Let y = p - 6. What is the nearest to 0.1 in 0, y, 5? 0 Let q = 0.4 + -0.1. Which is the closest to -8? (a) -3 (b) 2/9 (c) q a Let s = 0.3 + -0.3. Let u be ((-18)/(-28))/(24/(-14)). What is the nearest to -2 in s, -5/2, u? -5/2 Let y = 472 - 1397/3. Let h = 6 - y. Which is the closest to 0.1? (a) 2 (b) 2/11 (c) h b Let j = -8.11 + 0.11. Let y = 7 + j. Which is the nearest to 1? (a) 1 (b) y (c) 2 a Let o be 1 + -1(-22)/(-18). Let q = -0.08 + 0.08. Let m = 2 - q. What is the closest to o in 2/17, m, 3? 2/17 Let d = -3.6 - -3.6. Which is the closest to 1/2? (a) 1/4 (b) -4 (c) d a Let g = -49 - -47.92. Let l = -0.08 - g. Which is the closest to 0? (a) -2 (b) l (c) -3 b Let f = -46 + 45.5. Which is the nearest to 2/15? (a) -2/7 (b) f (c) -1 a Let i = 1.4 - 1.5. What is the closest to 1 in i, -0.5, -0.3? i Suppose 7i = 4i - 6. What is the nearest to -2/3 in i, 2.2, -0.4? -0.4 Let u = 5.1 + -0.1. Let i = -4.9 + u. Let f = -2.2 + -0.8. Which is the nearest to i? (a) 0.4 (b) 1/3 (c) f b Let v(c) = -c*3 + 9c*2 - 9c + 9. Let w be v(8). Let a = -139/3 - -46. What is the nearest to w in 3, a, 3/8? 3/8 Let h be ((-2)/(-3) - 0)9. Let u be (4/(-18))/((-10)/h). Which is the closest to 0? (a) 1/4 (b) u (c) -3 b Let o = 5 - 5.2. Which is the closest to o? (a) 0.2 (b) -1 (c) -4 a Let t = 60 + -60. What is the nearest to t in 4, 0.5, 5? 0.5 Let g = 10 + -10.2. What is the nearest to -2/7 in -4, g, 5? g Let s be 2/(-56) - (-4)/14. Let t = 14 - 13.8. Which is the closest to s? (a) 3 (b) -2 (c) t c Let o be -2(-2 + (-58)/(-24)). What is the closest to -4 in 1/4, -4, o? -4 Let u = 0.2 - 0. Let f = u + -1.2. Let t = 14 - 14. Which is the nearest to t? (a) f (b) -3 (c) 5 a Let x(i) = -i - 11. Let p be x(-9). Which is the nearest to -6/5? (a) p (b) 2/11 (c) -1/4 a Let m be (-1 - 12/(-7)) + -1. Let h = -0.7 + -0.3. Let q = 3 + h. Which is the closest to -1? (a) q (b) m (c) 1 b Let d = -6 - -5.6. Which is the closest to -2? (a) d (b) 5 (c) -5 a Let p = -0.22 - -3.22. What is the nearest to 1/2 in 2/3, p, -5? 2/3 Let n = 0.37 - -4.63. Let g = 47 - 142/3. Which is the closest to g? (a) n (b) -0.1 (c) 0.2 b Let w = 4 - 7. Let n = 2.9 + w. Which is the nearest to n? (a) -1/6 (b) 1/2 (c) 3 a Let m be 0 + (4/(-6))/(-2). Let s be (15/9)/1 + -1. What is the closest to m in s, 4, 0.5? 0.5 Let n = 0.37 - 1.37. What is the nearest to 2/5 in -3/5, -2, n? -3/5 Let r be ((-65)/28 - -2) + (-5)/20. What is the nearest to 0 in 2/5, -6, r? 2/5 Let q = -8 - -7. Let g = 481/6 - 80. Let u = 7 + -6. What is the nearest to u in g, -1/2, q? g Let l = -29/2 - -211/14. Let d = -6 + 11. Suppose 0 = -da - 2o - 3, 2*o - 2 = -0. Wh	{ "pile_set_name": "DM Mathematics" }
e prime factors of 135191? 7, 31, 89 List the prime factors of 12786. 2, 3, 2131 What are the prime factors of 424? 2, 53 What are the prime factors of 7545? 3, 5, 503 List the prime factors of 15603. 3, 7, 743 List the prime factors of 5995. 5, 11, 109 List the prime factors of 1119. 3, 373 What are the prime factors of 2631? 3, 877 What are the prime factors of 10679? 59, 181 List the prime factors of 19167. 3, 6389 What are the prime factors of 2750? 2, 5, 11 What are the prime factors of 37352? 2, 7, 23, 29 List the prime factors of 11054. 2, 5527 List the prime factors of 108553. 108553 What are the prime factors of 1295? 5, 7, 37 What are the prime factors of 982? 2, 491 What are the prime factors of 28408? 2, 53, 67 What are the prime factors of 18854? 2, 11, 857 What are the prime factors of 3503? 31, 113 List the prime factors of 2744. 2, 7 What are the prime factors of 14636? 2, 3659 List the prime factors of 2982. 2, 3, 7, 71 List the prime factors of 12317. 109, 113 What are the prime factors of 4123? 7, 19, 31 List the prime factors of 29341. 13, 37, 61 List the prime factors of 391. 17, 23 What are the prime factors of 27426? 2, 3, 7, 653 What are the prime factors of 23185? 5, 4637 What are the prime factors of 10594? 2, 5297 What are the prime factors of 18017? 43, 419 List the prime factors of 24072. 2, 3, 17, 59 What are the prime factors of 49307? 49307 List the prime factors of 431. 431 What are the prime factors of 3449? 3449 What are the prime factors of 18609? 3, 6203 What are the prime factors of 13022? 2, 17, 383 What are the prime factors of 10897? 17, 641 List the prime factors of 23944. 2, 41, 73 What are the prime factors of 2698? 2, 19, 71 What are the prime factors of 1337? 7, 191 What are the prime factors of 6517? 7, 19 List the prime factors of 1690. 2, 5, 13 What are the prime factors of 24566? 2, 71, 173 List the prime factors of 366. 2, 3, 61 List the prime factors of 1053. 3, 13 List the prime factors of 473. 11, 43 What are the prime factors of 423? 3, 47 What are the prime factors of 1000? 2, 5 What are the prime factors of 4982? 2, 47, 53 What are the prime factors of 39415? 5, 7883 What are the prime factors of 29523? 3, 13, 757 List the prime factors of 5040. 2, 3, 5, 7 List the prime factors of 56132. 2, 14033 List the prime factors of 3098. 2, 1549 What are the prime factors of 315? 3, 5, 7 What are the prime factors of 2222? 2, 11, 101 List the prime factors of 84908. 2, 21227 What are the prime factors of 5995? 5, 11, 109 List the prime factors of 96312. 2, 3, 4013 What are the prime factors of 29912? 2, 3739 List the prime factors of 2571. 3, 857 What are the prime factors of 8079? 3, 2693 List the prime factors of 19115. 5, 3823 List the prime factors of 869. 11, 79 What are the prime factors of 867? 3, 17 What are the prime factors of 20634? 2, 3, 19, 181 List the prime factors of 5123. 47, 109 List the prime factors of 4475. 5, 179 List the prime factors of 7849. 47, 167 What are the prime factors of 29156? 2, 37, 197 List the prime factors of 871. 13, 67 List the prime factors of 6385. 5, 1277 What are the prime factors of 1984? 2, 31 What are the prime factors of 61057? 61057 What are the prime factors of 86906? 2, 19, 2287 What are the prime factors of 1255? 5, 251 List the prime factors of 18406. 2, 9203 List the prime factors of 33060. 2, 3, 5, 19, 29 What are the prime factors of 121497? 3, 40499 What are the prime factors of 25513? 31, 823 What are the prime factors of 11280? 2, 3, 5, 47 List the prime factors of 1624. 2, 7, 29 List the prime factors of 20952. 2, 3, 97 What are the prime factors of 17251? 13, 1327 What are the prime factors of 42223? 42223 List the prime factors of 3060. 2, 3, 5, 17 What are the prime factors of 2095? 5, 419 What are the prime factors of 1018? 2, 509 List the prime factors of 5434. 2, 11, 13, 19 What are the prime factors of 60284? 2, 7, 2153 What are the prime factors of 1922? 2, 31 What are the prime factors of 23691? 3, 53, 149 List the prime factors of 286. 2, 11, 13 What are the prime factors of 6152? 2, 769 What are the prime factors of 24021? 3, 17, 157 List the prime factors of 13870. 2, 5, 19, 73 List the prime factors of 52582. 2, 61, 431 List the prime factors of 4349. 4349 What are the prime factors of 2604? 2, 3, 7, 31 What are the prime factors of 46922? 2, 29, 809 What are the prime factors of 10694? 2, 5347 List the prime factors of 174318. 2, 3, 17, 1709 List the prime factors of 1767. 3, 19, 31 List the prime factors of 2228. 2, 557 List the prime factors of 180. 2, 3, 5 What are the prime factors of 11887? 11887 List the prime factors of 35115. 3, 5, 2341 List the prime factors of 9560. 2, 5, 239 What are the prime factors of 16017? 3, 19, 281 List the prime factors of 3968. 2, 31 List the prime factors of 8470. 2, 5, 7, 11 List the prime factors of 223. 223 List the prime factors of 1052. 2, 263 List the prime factors of 39430. 2, 5, 3943 List the prime factors of 11335. 5, 2267 List the prime factors of 852. 2, 3, 71 List the prime factors of 24253. 79, 307 List the prime factors of 2662. 2, 11 List the prime factors of 5187. 3, 7, 13, 19 What are the prime factors of 15587? 11, 13, 109 List the prime factors of 8150. 2, 5, 163 List the prime factors of 212. 2, 53 List the prime factors of 8778. 2, 3, 7, 11, 19 List the prime factors of 5761. 7, 823 List the prime factors of 3679. 13, 283 What are the prime factors of 6152? 2, 769 What are the prime factors of 5175? 3, 5, 23 List the prime factors of 39107. 39107 What are the prime factors of 74489? 74489 What are the prime factors of 68108? 2, 17027 List the prime factors of 102213. 3, 41, 277 List the prime factors of 8256. 2, 3, 43 What are the prime factors of 1677? 3, 13, 43 What are the prime factors of 2736? 2, 3, 19 List the prime factors of 53070. 2, 3, 5, 29, 61 List the prime factors of 54512. 2, 3407 What are the prime factors of 2794? 2, 11, 127 List the prime factors of 10447. 31, 337 List the prime factors of 1408. 2, 11 What are the prime factors of 1776? 2, 3, 37 What are the prime factors of 1132? 2, 283 What are the prime factors of 670? 2, 5, 67 List the prime factors of 1458. 2, 3 List the prime factors of 20824. 2, 19, 137 What are the prime factors of 6695? 5, 13, 103 What are the prime factors of 84135? 3, 5, 71, 79 What are the prime factors of 97408? 2, 761 List the prime factors of 56468. 2, 19, 743 What are the prime factors of 61076? 2, 15269 List the prime factors of 17996. 2, 11, 409 List the prime factors of 8784. 2, 3, 61 What are the prime factors of 1541? 23, 67 List the prime factors of 72267. 3, 13, 17, 109 What are the prime factors of 173012? 2, 7, 37, 167 List the prime factors of 99599. 137, 727 What are the prime factors of 84157? 23, 3659 What are the prime factors of 110142? 2, 3, 29, 211 List the prime factors of 1905. 3, 5, 127 List the prime factors of 10715. 5, 2143 What are the prime factors of 63490? 2, 5, 7, 907 What are the prime factors of 6463? 23, 281 List the prime factors of 2742. 2, 3, 457 What are the prime factors of 3872? 2, 11 What are the prime factors of 4024? 2, 503 What are the prime factors of 74? 2, 37 What are the prime factors of 68994? 2, 3, 3833 What are the prime factors of 1055? 5, 211 What are the prime factors of 422? 2, 211 What are the prime factors of 4174? 2, 2087 List the prime factors of 159216. 2, 3, 31, 107 What are the prime factors of 14711? 47, 313 What are the prime factors of 34? 2, 17 List the prime factors of 23984. 2, 1499 What are the prime factors of 3992? 2, 499 List the prime factors of 6934. 2, 3467 What are the prime factors of 59527? 13, 19, 241 List the prime factors of 680. 2, 5, 17 What are the prime factors of 522? 2, 3, 29 List the prime factors of 60672. 2, 3, 79 List the prime factors of 887. 887 List the prime factors of 2916. 2, 3 List the prime factors of 13319. 19, 701 What are the prime factors of 1315? 5, 263 What are the prime factors of 69? 3, 23 List the prime factors of 10323. 3, 31, 37 What are the prime factors of 46571? 7, 6653 What are the prime factors of 4168? 2, 521 List the prime factors of 3495. 3, 5, 233 List the prime factors of 839. 839 List the prime	{ "pile_set_name": "DM Mathematics" }
f = -q - 2q + 6. Solve 0 = qb - 2 - 0 for b. 1 Suppose 3k + 422 + 723 = 5i, 913 = 4i - 3k. Solve 0 = -6w - 208 + i for w. 4 Let w(o) = -o - 11. Let t(p) = 3p - 63. Let c be t(22). Suppose l = -7a + ca - 18, -l - 2a - 16 = 0. Let s be w(l). Solve su = -1 + 13 for u. 4 Suppose -5h + 11 = -t - 7h, 0 = 3h + 12. Let u be 5 + (-147 + t)/(-6). Solve 0 = -p + 7p - u for p. 5 Suppose 0 = u - 5u. Suppose 3d = 5y - 22, -139y + 134y - d = -26. Solve yv - 2v = u for v. 0 Suppose 77n - 150 = 27n. Let c = 11 + -9. Let h = c + -2. Solve nv + 1 - 4 = h for v. 1 Let u(a) = -9a2 + 80a + 11. Let d be u(9). Suppose dw + 27w = 0. Solve -v - v - 3v = w for v. 0 Let j be 216/42 - (2 + -23). Solve -21q + 60 = -j for q. 4 Let h = -151 - -153. Let a(k) = -4 - 18k + 11k + 10k. Let l be a(2). Solve -4 + h = -ls for s. 1 Let f(s) = -10s + 95. Let x be f(9). Solve -n + x = 1 for n. 4 Suppose -39 = 14j - 109. Let q(g) = -1 + 1 + 0 - 1 + 2g. Let a be q(j). Solve -af = -4f - 25 for f. 5 Let p = 2 + 2. Let c = -2446 + 2458. Solve c = pr - 0r for r. 3 Let o(j) = j*3 + 25j*2 - 36j - 251. Let f be o(-24). Solve -fw + 1183w - 12 = 0 for w. -2 Suppose 0 = 3l - i + 807, -5l + i - 174 = 1171. Let o = l + 272. Solve 5 = ob - 4b for b. -5 Let m(k) = -k*3 + 4k*2 - k - 3. Let r be m(2). Suppose v - 96 = -rv. Solve -16 = -2f - v for f. -4 Let q(g) be the first derivative of -3g*2/2 + 27g + 29. Let f be q(8). Solve -fd = -7d + 8 for d. 2 Suppose 3g - 8g = -15. Let l(f) = -f*3 - 32f*2 + 68f + 1. Let r be l(-34). Solve r = u + g for u. -2 Let h(l) = 3l + 54. Let t be h(-5). Suppose 4n + 5x - t = 0, 4n = 5x + 10 - 1. Suppose -6i = -8i + n. Solve -io = -5o for o. 0 Let t be (-4)/(-18) - 3512/(-72). Let m = t + -41. Solve -mv - 6 = -10v for v. 3 Let p(m) = -m2 - 37m + 40. Let q be p(-38). Suppose qk + 0k - 26 = -2v, 5v + 54 = 2k. Solve -k = 2r - 23 for r. 3 Let n be -8 - 170/(-10) - 27/(-3). Solve -8a - 14 = n for a. -4 Let z = 1 - 1. Suppose -3s - 3 = q, 2s + 27 = -2q + 25. Let i be (-152)/38 + s-22. Solve l + i + 5 = z for l. -5 Suppose 8 = -4f + 212. Suppose 4r - 252 = -4z, 4r = 3r + 5z + f. Let u = 64 - r. Solve -8w = -uw for w. 0 Suppose -4j = 3y - 79, -9j = 4y - 4j - 106. Let r be y/9 + (-16)/72 + 3. Solve 0 = -rk - 10 - 8 for k. -3 Suppose 2b = -6, -3k = -k + 3b + 9. Suppose 32 = -z + 3y, -4z - y + 8 + 20 = 0. Solve i + ki = -z for i. -4 Let d = -29003 + 29024. Solve 0 = -do + 3 - 108 for o. -5 Let d be 52 - 40 - -9(-2)/3. Suppose 440f = 442f - d. Solve h - 4 = -fh for h. 1 Let n(p) be the first derivative of -p3/3 + 19p*2/2 + 97p + 64. Let x be n(23). Solve x = -2w - 5 for w. -5 Let l = 1740 + -1725. Solve -53 + 128 = lm for m. 5 Let t(w) = -w*3 + 21w*2 + 7w - 139. Let l be t(21). Solve -26 = -lm - 5m for m. 2 Let y(a) = -413a3 - a2 - 4a - 2. Let z be y(-1). Solve -208o + 70o = -z for o. 3 Let q(t) = 13t + 122. Let b be q(-7). Solve 37v - bv = -6 for v. -1 Let u be (8 - 0)/4 + 2. Suppose 12 = -p + up. Let h be (-3)/(12/(-8))5/10. Solve -h - 7 = -px for x. 2 Let z = -29 + 45. Suppose -h + 17 = -4y, 210y - 16 = 4h + 215y. Solve -z + h = -5q for q. 3 Let u = -10 - -16. Let h = -66914 - -66924. Solve hk + 8 = uk for k. -2 Suppose 0 = 8x + 144 - 24. Let k(i) = -i*3 - 15i*2 + 7i - 10. Let j be k(x). Let y = -115 - j. Solve 0w + 4w = y for w. 0 Let w be 2 - ((-3)/(-1) + -6). Let r(h) = 3h2 + 14h + 29. Let m be r(-3). Suppose o = y - 7, 4o + m = 2y - 8. Solve yf = wf for f. 0 Let p(k) = -414k - 989. Let r be p(-3). Solve 0 = 17a + 168 - r for a. 5 Suppose 3a = -2a - 2u + 27, 1 = 3a + 5u. Suppose -m = -9 + a. Solve -mk = -0k for k. 0 Let u(j) be the first derivative of -j - 12 + 0j*2 + 1/3j*3. Let m be u(1). Solve 2q + m = 6 for q. 3 Suppose 0 = -s + 2n - 3 - 26, -n - 73 = 2s. Let q = 39 + s. Solve 0 = -4z - 0z + q for z. 1 Suppose -5767 = -9x - 25x - 327. Solve x = -5z + 150 for z. -2 Let z = -16350 + 16398. Solve -5u = u + z for u. -8 Let c be (126/12)/(2/8). Let x(g) = -g*3 - 7g*2 - g + 5. Let f be x(-5). Let k = f + c. Solve z + 0 - k = 0 for z. 2 Let l = 2011 + -2007. Solve -9a - l = -40 for a. 4 Let b be (-225)/(-30) - (-1)/2. Suppose 4 = 4j, c - 3j = -42 + 55. Solve 4i = b - c for i. -2 Suppose 61b = 2v + 58b + 5, -2v + 25 = 3b. Solve -81 = vd - 71 for d. -2 Let s be (7 - 121)/((-6)/4). Suppose 6 = -7p + s. Suppose p = 3l - f, -l = -4l + 5f - 10. Solve -lv = 8 + 2 for v. -2 Suppose -7 + 4 = o. Let r(a) = -a*2 - 4a - 2. Let n be r(o). Suppose n = -2j + 31. Solve 5b - j = 2b for b. 5 Suppose -5h = 2x - 8, 310h - 4x - 32 = 308h. Let o = 15 + -13. Solve -oz - 4 = h for z. -4 Suppose -8 = -u + 5u. Let f(b) = 12b + 10. Let v be f(u). Let s be (28/v)/((-1)/2). Solve -7 = -sd + 13 for d. 5 Suppose -4b + 560 = 18j - 14j, -3b + 415 = 4j. Solve -2i + b = 139 for i. 3 Suppose i = -6q + 65, -4i + 243 = 5q + 59. Solve 8 = ia - 39a for a. 4 Let d(q) = 411q - 8. Let z be d(1). Let a = 411 - z. Solve -ai + 4 = -4 for i. 1 Suppose -3n + 141 = 3l, 0 = 5n + 27 - 7. Suppose -lv - 3 = -52v. Suppose 2u - 18 = vx - x, -u - 5x = 21. Solve -10 = -uf + 2 for f. 3 Let w = -37 + 43. Suppose 6x - w = 3x. Solve 0q - 4 = -xq for q. 2 Suppose -c = 2 - 4. Suppose t = ct. Let b(y) = 4y - 39. Let p be b(16). Solve -5z = -tz + p for z. -5 Let h = -23172 - -23185. Solve -99 = -hv - 164 for v. -5 Let c = -1 - -10. Suppose 0 = z + 2z + c. Let x(m) = m*3 + 3m*2 - 3m - 7. Let l be x(z). Solve -l + 1 = -h for h. 1 Suppose -11166 = -17d - 9058. Solve 0 = -55n + d + 151 for n. 5 Suppose -12k = -27k - 15. Let p be 1/(3k/12). Let a be 0/22 - 6/p6. Solve 2i - 5i - a = 0 for i. -3 Let b = -255 - -259. Let g = b + 0. Let j = -3 + 8. Solve -jp + p = -g for p. 1 Let p(w) = 2w*3 + 20w*2 + 33w + 15. Let c be p(-5). Solve 41y - c = 64 for y. 4 Let a = 6084 - 6028. Solve 65x = 9x - a for x. -1 Suppose 15c - 568 = -478. Suppose -5l = -4k - 85, cl = l + 5k + 90. Solve -1 = lb - 14b for b. 1 Suppose -q - 5n + 20 + 7 = 0, -5n = 5q - 35. Suppose -5k + qt = -2t - 30, 4k = 2t + 30. Solve k = -g - g for g. -5 Let a = -397 - -247. Let k = 152 + a. Solve 4 = -c + kc for c. 4 Suppose -o - 4o = 4k - 125, 0 = o + 5k - 46. Suppose -26c = -oc - 15. Solve 6 = ca - 3 for a. 3 Let a = -14747 + 14747. Solve -20r - 80 = -ar for r. -4 Let o = 217 - 206. Suppose -oj + 86 = 42. Solve 23 = jc + 7 for c. 4 Let w(a) = -a2 - 27a + 87. Let o be w(-30). Let y be 10 + o + 8 + -11. Solve -yn + 19 = 11 for n. 2 Let n(l) = -2254l + 2263. Let i be n(1). Solve 160c - 157c + i = 0 for c. -3 Let t = -61 - -57. Let f be (6/(-8))/(-7 + (-27)/t). Suppose 0p + fp - 4p = 0. Solve 2z = -pz - 8 for z. -4 Suppose 10p + 3 = 11p, -10 = 5b + 5p. Let i be -7 - (b + -7) - 3. Solve z - 3z = i for z. -1 Suppose 40k - 3720 = 20k. Suppose 195b = kb + 45. Solve b = -z + 2 for z. -3 Suppose -v = 4v - 55. Let a be (-26)/(-12)9 + 1/2. Suppose 0 = 5h + 5s - a, -5h + 9 = -4s - 20. Solve 2c - h = -v for c. -3 Suppose -298 = -9w - 280. Suppose 0 = c - wg - 2g - 5, -5c + 101 = -g. Solve -i - 6i = c for i. -3 Let d(c) = -c*3 + 16c*2 + 37c - 9. Let r(w) = 33w - 180. Let o be r(6). Let q be d(o). Solve j + q - 5 = 0 for j. -4 Suppose 2f - 30 = 4y + y, -24 = -2f + 4y. Solve fn = 21n for n. 0 Suppose 377k - 396k + 175 = 61. Solve kn + 88 = 28n for n. 4 Let s = -7763 - -7781. Solve 23m - 29m = s for m. -3 Suppose 0 = -4n - 3d + 351, 24d - 260 = -3n + 25d. Solve -5t = -34t + n for t. 3 Suppose -r = 2r - 2a, r = 2a. Suppose -4f = -rg + 5g - 4, 3g = -12. Solve m + f = -m for m. -3 Let v = 31 + -34. Let y be 2/v - 66/(-18) - 0. Solve -4m = -y + 19 for m. -4 Let c be (206/2 + -2)162/162. Solve -y = -c + 103 for y. -2 Let d(h) = 2h*3 - 3h + 31. Let p be d(0). Solve -11 = 21g + p for g. -2 Suppose -3h - 18 - 58 = -o, -3o - h = -198. Solve -2u + 67 - o = 0 for u. 0 Let o = -3159 + 3245. Solve -o + 86 = -11y for y. 0 Suppose 0 = -6u - 3q + 381, -3u + 2q + 66 = -142. Solve -ui + 15 = -71i for i. -3 Suppose 5z + 15 = 2x, 3z - x + 3*x =	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.