index
int64
repo_name
string
branch_name
string
path
string
content
string
import_graph
string
40,462
colobas/aics-shparam
refs/heads/main
/aicsshparam/shtools.py
import vtk import pyshtools import numpy as np from typing import Tuple from vtk.util import numpy_support from skimage import transform as sktrans from skimage import filters as skfilters from skimage import morphology as skmorpho from sklearn import decomposition as skdecomp from scipy import interpolate as sciinterp from scipy import stats as scistats EPS = 1e-12 def get_mesh_from_image( image: np.array, sigma: float = 0, lcc: bool = True, translate_to_origin: bool = True, ): """Converts a numpy array into a vtkImageData and then into a 3d mesh using vtkContourFilter. The input is assumed to be binary and the isosurface value is set to 0.5. Optionally the input can be pre-processed by i) extracting the largest connected component and ii) applying a gaussian smooth to it. In case smooth is used, the image is binarize using thershold 1/e. A size threshold is applying to garantee that enough points will be used to compute the SH parametrization. Also, points as the edge of the image are set to zero (background) to make sure the mesh forms a manifold. Parameters ---------- image : np.array Input array where the mesh will be computed on Returns ------- mesh : vtkPolyData 3d mesh in VTK format img_output : np.array Input image after pre-processing centroid : np.array x, y, z coordinates of the mesh centroid Other parameters ---------------- lcc : bool, optional Wheather or not to compute the mesh only on the largest connected component found in the input connected component, default is True. sigma : float, optional The degree of smooth to be applied to the input image, default is 0 (no smooth). translate_to_origin : bool, optional Wheather or not translate the mesh to the origin (0,0,0), default is True. """ img = image.copy() # VTK requires YXZ img = np.swapaxes(img, 0, 2) # Extracting the largest connected component if lcc: img = skmorpho.label(img.astype(np.uint8)) counts = np.bincount(img.flatten()) lcc = 1 + np.argmax(counts[1:]) img[img != lcc] = 0 img[img == lcc] = 1 # Smooth binarize the input image and binarize if sigma: img = skfilters.gaussian(img.astype(np.float32), sigma=(sigma, sigma, sigma)) img[img < 1.0 / np.exp(1.0)] = 0 img[img > 0] = 1 if img.sum() == 0: raise ValueError( "No foreground voxels found after pre-processing. Try using sigma=0." ) # Set image border to 0 so that the mesh forms a manifold img[[0, -1], :, :] = 0 img[:, [0, -1], :] = 0 img[:, :, [0, -1]] = 0 img = img.astype(np.float32) if img.sum() == 0: raise ValueError( "No foreground voxels found after pre-processing." "Is the object of interest centered?" ) # Create vtkImageData imgdata = vtk.vtkImageData() imgdata.SetDimensions(img.shape) img = img.transpose(2, 1, 0) img_output = img.copy() img = img.flatten() arr = numpy_support.numpy_to_vtk(img, array_type=vtk.VTK_FLOAT) arr.SetName("Scalar") imgdata.GetPointData().SetScalars(arr) # Create 3d mesh cf = vtk.vtkContourFilter() cf.SetInputData(imgdata) cf.SetValue(0, 0.5) cf.Update() mesh = cf.GetOutput() # Calculate the mesh centroid coords = numpy_support.vtk_to_numpy(mesh.GetPoints().GetData()) centroid = coords.mean(axis=0, keepdims=True) # Translate to origin coords -= centroid mesh.GetPoints().SetData(numpy_support.numpy_to_vtk(coords)) return mesh, img_output, tuple(centroid.squeeze()) def rotate_image_2d(image: np.array, angle: float, interpolation_order: int = 0): """Rotate multichannel image in 2D by a given angle. The expected shape of image is (C,Z,Y,X). The rotation will be done clock-wise around the center of the image. Parameters ---------- angle : float Angle in degrees interpolation_order : int Order of interpolation used during the image rotation Returns ------- img_rot : np.array Rotated image """ if image.ndim != 4: raise ValueError( f"Invalid shape {image.shape} of input image." "Expected 4 dimensional images as input." ) if not isinstance(interpolation_order, int): raise ValueError("Only integer values are accepted for interpolation order.") # Make z to be the last axis. Required for skimage rotation image = np.swapaxes(image, 1, 3) img_aligned = [] for stack in image: stack_aligned = sktrans.rotate( image=stack, angle=-angle, resize=True, order=interpolation_order, preserve_range=True, ) img_aligned.append(stack_aligned) img_aligned = np.array(img_aligned) # Swap axes back img_aligned = np.swapaxes(img_aligned, 1, 3) img_aligned = img_aligned.astype(image.dtype) return img_aligned def align_image_2d( image: np.array, alignment_channel: int = None, make_unique: bool = False ): """Align a multichannel 3D image based on the channel specified by alignment_channel. The expected shape of image is (C,Z,Y,X) or (Z,Y,X). Parameters ---------- image : np.array Input array of shape (C,Z,Y,X) or (Z,Y,X). alignment_channel : int Number of channel to be used as reference for alignemnt. The alignment will be propagated to all other channels. make_unique : bool Set true to make sure the alignment rotation is unique. Returns ------- img_aligned : np.array Aligned image angle : float Angle used for align the shape. """ if image.ndim not in [3, 4]: raise ValueError(f"Invalid shape {image.shape} of input image.") if image.ndim == 4: if alignment_channel is None: raise ValueError( "An alignment channel must be provided with multichannel images." ) if not isinstance(alignment_channel, int): raise ValueError("Number of alignment channel must be an integer") if image.ndim == 3: alignment_channel = 0 image = image.reshape(1, *image.shape) z, y, x = np.where(image[alignment_channel]) xy = np.hstack([x.reshape(-1, 1), y.reshape(-1, 1)]) pca = skdecomp.PCA(n_components=2) pca = pca.fit(xy) eigenvecs = pca.components_ if make_unique: # Calculate angle with arctan2 angle = 180.0 * np.arctan2(eigenvecs[0][1], eigenvecs[0][0]) / np.pi # Rotate x coordinates x_rot = (x - x.mean()) * np.cos(np.pi * angle / 180) + (y - y.mean()) * np.sin( np.pi * angle / 180 ) # Check the skewness of the rotated x coordinate xsk = scistats.skew(x_rot) if xsk < 0.0: angle += 180 # Map all angles to anti-clockwise angle = angle % 360 else: # Calculate smallest angle angle = 0.0 if np.abs(eigenvecs[0][0]) > EPS: angle = 180.0 * np.arctan(eigenvecs[0][1] / eigenvecs[0][0]) / np.pi # Apply skimage rotation clock-wise img_aligned = rotate_image_2d(image=image, angle=angle) return img_aligned, angle def apply_image_alignment_2d(image: np.array, angle: float): """Apply an existing set of alignment parameters to a multichannel 3D image. The expected shape of image is (C,Z,Y,X) or (Z,Y,X). Parameters ---------- image : np.array Input array of shape (C,Z,Y,X) or (Z,Y,X). angle : float 2D rotation angle in degrees Returns ------- img_aligned : np.array Aligned image """ if image.ndim not in [3, 4]: raise ValueError(f"Invalid shape {image.shape} of input image.") if image.ndim == 3: image = image.reshape(1, *image.shape) img_aligned = rotate_image_2d(image=image, angle=angle) return img_aligned def update_mesh_points( mesh: vtk.vtkPolyData, x_new: np.array, y_new: np.array, z_new: np.array ): """Updates the xyz coordinates of points in the input mesh with new coordinates provided. Parameters ---------- mesh : vtkPolyData Mesh in VTK format to be updated. x_new, y_new and z_new : np.array Array containing the new coordinates. Returns ------- mesh_updated : vtkPolyData Mesh with updated coordinates. Notes ----- This function also re-calculate the new normal vectors for the updated mesh. """ mesh.GetPoints().SetData(numpy_support.numpy_to_vtk(np.c_[x_new, y_new, z_new])) mesh.Modified() # Fix normal vectors orientation normals = vtk.vtkPolyDataNormals() normals.SetInputData(mesh) normals.Update() mesh_updated = normals.GetOutput() return mesh_updated def get_even_reconstruction_from_grid( grid: np.array, npoints: int = 512, centroid: Tuple = (0, 0, 0) ): """Converts a parametric 2D grid of type (lon,lat,rad) into a 3d mesh. lon in [0,2pi], lat in [0,pi]. The method uses a spherical mesh with an even distribution of points. The even distribution is obtained via the Fibonacci grid rule. Parameters ---------- grid : np.array Input grid where the element grid[i,j] represents the radial coordinate at longitude i*2pi/grid.shape[0] and latitude j*pi/grid.shape[1]. Returns ------- mesh : vtkPolyData Mesh that represents the input parametric grid. Other parameters ---------------- npoints: int Number of points in the initial spherical mesh centroid : tuple of floats, optional x, y and z coordinates of the centroid where the mesh will be translated to, default is (0,0,0). """ res_lat = grid.shape[0] res_lon = grid.shape[1] # Creates an interpolator lon = np.linspace(start=0, stop=2 * np.pi, num=res_lon, endpoint=True) lat = np.linspace(start=0, stop=1 * np.pi, num=res_lat, endpoint=True) fgrid = sciinterp.RectBivariateSpline(lon, lat, grid.T) # Create x,y,z coordinates based on the Fibonacci Lattice # http://extremelearning.com.au/evenly-distributing-points-on-a-sphere/ golden_ratio = 0.5 * (1 + np.sqrt(5)) idxs = np.arange(0, npoints, dtype=np.float32) fib_theta = np.arccos(2 * ((idxs + 0.5) / npoints) - 1) fib_phi = (2 * np.pi * (idxs / golden_ratio)) % (2 * np.pi) - np.pi fib_lat = fib_theta fib_lon = fib_phi + np.pi fib_grid = fgrid.ev(fib_lon, fib_lat) # Assign to sphere fib_x = centroid[0] + fib_grid * np.sin(fib_theta) * np.cos(fib_phi) fib_y = centroid[1] + fib_grid * np.sin(fib_theta) * np.sin(fib_phi) fib_z = centroid[2] + fib_grid * np.cos(fib_theta) # Add points (x,y,z) to a polydata points = vtk.vtkPoints() for (x, y, z) in zip(fib_x, fib_y, fib_z): points.InsertNextPoint(x, y, z) rec = vtk.vtkPolyData() rec.SetPoints(points) # Calculates the connections between points via Delaunay triangulation delaunay = vtk.vtkDelaunay3D() delaunay.SetInputData(rec) delaunay.Update() surface_filter = vtk.vtkDataSetSurfaceFilter() surface_filter.SetInputData(delaunay.GetOutput()) surface_filter.Update() # Smooth the mesh to get a more even distribution of points NITER_SMOOTH = 128 smooth = vtk.vtkSmoothPolyDataFilter() smooth.SetInputData(surface_filter.GetOutput()) smooth.SetNumberOfIterations(NITER_SMOOTH) smooth.FeatureEdgeSmoothingOff() smooth.BoundarySmoothingOn() smooth.Update() rec.DeepCopy(smooth.GetOutput()) # Compute normal vectors normals = vtk.vtkPolyDataNormals() normals.SetInputData(rec) normals.Update() mesh = normals.GetOutput() return mesh def get_even_reconstruction_from_coeffs( coeffs: np.array, lrec: int = 0, npoints: int = 512 ): """Converts a set of spherical harmonic coefficients into a 3d mesh using the Fibonacci grid for generating a mesh with a more even distribution of points Parameters ---------- coeffs : np.array Input array of spherical harmonic coefficients. These array has dimensions 2xLxM, where the first dimension is 0 for cosine-associated coefficients and 1 for sine-associated coefficients. Second and thrid dimensions represent the expansion parameters (l,m). Returns ------- mesh : vtkPolyData Mesh that represents the input parametric grid. Other parameters ---------------- lrec : int, optional Only coefficients l<lrec will be used for creating the mesh, default is 0 meaning all coefficients available in the matrix coefficients will be used. npoints : int optional Number of points in the initial spherical mesh Notes ----- The mesh resolution is set by the size of the coefficients matrix and therefore not affected by lrec. """ coeffs_ = coeffs.copy() if (lrec > 0) and (lrec < coeffs_.shape[1]): coeffs_[:, lrec:, :] = 0 grid = pyshtools.expand.MakeGridDH(coeffs_, sampling=2) mesh = get_even_reconstruction_from_grid(grid, npoints) return mesh, grid def get_reconstruction_from_grid(grid: np.array, centroid: Tuple = (0, 0, 0)): """Converts a parametric 2D grid of type (lon,lat,rad) into a 3d mesh. lon in [0,2pi], lat in [0,pi]. Parameters ---------- grid : np.array Input grid where the element grid[i,j] represents the radial coordinate at longitude i*2pi/grid.shape[0] and latitude j*pi/grid.shape[1]. Returns ------- mesh : vtkPolyData Mesh that represents the input parametric grid. Other parameters ---------------- centroid : tuple of floats, optional x, y and z coordinates of the centroid where the mesh will be translated to, default is (0,0,0). """ res_lat = grid.shape[0] res_lon = grid.shape[1] # Creates an initial spherical mesh with right dimensions. rec = vtk.vtkSphereSource() rec.SetPhiResolution(res_lat + 2) rec.SetThetaResolution(res_lon) rec.Update() rec = rec.GetOutput() grid_ = grid.T.flatten() # Update the points coordinates of the spherical mesh according to the inout grid for j, lon in enumerate(np.linspace(0, 2 * np.pi, num=res_lon, endpoint=False)): for i, lat in enumerate( np.linspace(np.pi / (res_lat + 1), np.pi, num=res_lat, endpoint=False) ): theta = lat phi = lon - np.pi k = j * res_lat + i x = centroid[0] + grid_[k] * np.sin(theta) * np.cos(phi) y = centroid[1] + grid_[k] * np.sin(theta) * np.sin(phi) z = centroid[2] + grid_[k] * np.cos(theta) rec.GetPoints().SetPoint(k + 2, x, y, z) # Update coordinates of north and south pole points north = grid_[::res_lat].mean() south = grid_[(res_lat - 1) :: res_lat].mean() rec.GetPoints().SetPoint(0, centroid[0] + 0, centroid[1] + 0, centroid[2] + north) rec.GetPoints().SetPoint(1, centroid[0] + 0, centroid[1] + 0, centroid[2] - south) # Compute normal vectors normals = vtk.vtkPolyDataNormals() normals.SetInputData(rec) # Set splitting off to avoid output mesh from having different number of # points compared to input normals.SplittingOff() normals.Update() mesh = normals.GetOutput() return mesh def get_reconstruction_from_coeffs(coeffs: np.array, lrec: int = 0): """Converts a set of spherical harmonic coefficients into a 3d mesh. Parameters ---------- coeffs : np.array Input array of spherical harmonic coefficients. These array has dimensions 2xLxM, where the first dimension is 0 for cosine-associated coefficients and 1 for sine-associated coefficients. Second and thrid dimensions represent the expansion parameters (l,m). Returns ------- mesh : vtkPolyData Mesh that represents the input parametric grid. Other parameters ---------------- lrec : int, optional Degree of the reconstruction. If lrec<l, then only coefficients l<lrec will be used for creating the mesh. If lrec>l, then the mesh will be oversampled. Default is 0 meaning all coefficients available in the matrix coefficients will be used. Notes ----- The mesh resolution is set by the size of the coefficients matrix and therefore not affected by lrec. """ # Degree of the expansion lmax = coeffs.shape[1] if lrec == 0: lrec = lmax # Create array (oversampled if lrec>lrec) coeffs_ = np.zeros((2, lrec, lrec), dtype=np.float32) # Adjust lrec to the expansion degree if lrec > lmax: lrec = lmax # Copy coefficients coeffs_[:, :lrec, :lrec] = coeffs[:, :lrec, :lrec] # Expand into a grid grid = pyshtools.expand.MakeGridDH(coeffs_, sampling=2) # Get mesh mesh = get_reconstruction_from_grid(grid) return mesh, grid def get_reconstruction_error(grid_input: np.array, grid_rec: np.array): """Compute mean square error between two parametric grids. When applied to the input parametric grid and its corresponsing reconstructed version, it gives an idea of the quality of the parametrization with low values indicate good parametrization. Parameters ---------- grid_input : np.array Parametric grid grid_rec : np.array Reconstructed parametric grid Returns ------- mse : float Mean square error """ mse = np.power(grid_input - grid_rec, 2).mean() return mse def save_polydata(mesh: vtk.vtkPolyData, filename: str): """Saves a mesh as a vtkPolyData file. Parameters ---------- mesh : vtkPolyData Input mesh filename : str File path where the mesh will be saved output_type : vtk or ply Format of output polydata file """ # Output file format output_type = filename.split(".")[-1] if output_type not in ["vtk", "ply"]: raise ValueError( f"Output format {output_type} not supported. Please use vtk or ply." ) if output_type == "vtk": writer = vtk.vtkPolyDataWriter() else: writer = vtk.vtkPLYWriter() writer.SetInputData(mesh) writer.SetFileName(filename) writer.Write()
{"/aicsshparam/shparam.py": ["/aicsshparam/__init__.py"]}
40,463
colobas/aics-shparam
refs/heads/main
/aicsshparam/tests/dummy_test.py
import numpy as np def test_dummy(): a = np.ones((5, 5)) a[0, 0] = 2 assert np.any(a > 0)
{"/aicsshparam/shparam.py": ["/aicsshparam/__init__.py"]}
40,464
colobas/aics-shparam
refs/heads/main
/aicsshparam/bin/__init__.py
# This is necessary here for packaging
{"/aicsshparam/shparam.py": ["/aicsshparam/__init__.py"]}
40,465
colobas/aics-shparam
refs/heads/main
/aicsshparam/shparam.py
import warnings import pyshtools import numpy as np from vtk.util import numpy_support from skimage import transform as sktrans from scipy import interpolate as spinterp from . import shtools def get_shcoeffs( image: np.array, lmax: int, sigma: float = 0, compute_lcc: bool = True, alignment_2d: bool = True, make_unique: bool = False, ): """Compute spherical harmonics coefficients that describe an object stored as an image. Calculates the spherical harmonics coefficients that parametrize the shape formed by the foreground set of voxels in the input image. The input image does not need to be binary and all foreground voxels (background=0) are used in the computation. Foreground voxels must form a single connected component. If you are sure that this is the case for the input image, you can set compute_lcc to False to speed up the calculation. In addition, the shape is expected to be centered in the input image. Parameters ---------- image : ndarray Input image. Expected to have shape ZYX. lmax : int Order of the spherical harmonics parametrization. The higher the order the more shape details are represented. Returns ------- coeffs_dict : dict Dictionary with the spherical harmonics coefficients and the mean square error between input and its parametrization grid_rec : ndarray Parametric grid representing sh parametrization image_ : ndarray Input image after pre-processing (lcc calculation, smooth and binarization). mesh : vtkPolyData Polydata representation of image_. grid_down : ndarray Parametric grid representing input object. transform : tuple of floats (xc, yc, zc, angle) if alignment_2d is True or (xc, yc, zc) if alignment_2d is False. (xc, yc, zc) are the coordinates of the shape centroid after alignment; angle is the angle used to align the image Other parameters ---------------- sigma : float, optional The degree of smooth to be applied to the input image, default is 0 (no smooth) compute_lcc : bool, optional Whether to compute the largest connected component before appliying the spherical harmonic parametrization, default is True. Set compute_lcc to False in case you are sure the input image contains a single connected component. It is crucial that parametrization is calculated on a single connected component object. alignment_2d : bool Wheather the image should be aligned in 2d. Default is True. make_unique : bool Set true to make sure the alignment rotation is unique. Notes ----- Alignment mode '2d' allows for keeping the z axis unchanged which might be important for some applications. Examples -------- import numpy as np from aicsshparam import shparam, shtools img = np.ones((32,32,32), dtype=np.uint8) (coeffs, grid_rec), (image_, mesh, grid, transform) = shparam.get_shcoeffs(image=img, lmax=2) mse = shtools.get_reconstruction_error(grid, grid_rec) print('Coefficients:', coeffs) >>> Coefficients: {'shcoeffs_L0M0C': 18.31594310878251, 'shcoeffs_L0M1C': 0.0, 'shcoeffs_L0M2C': 0.0, 'shcoeffs_L1M0C': 0.020438775421611564, 'shcoeffs_L1M1C': -0.0030960466571801513, 'shcoeffs_L1M2C': 0.0, 'shcoeffs_L2M0C': -0.0185688727281408, 'shcoeffs_L2M1C': -2.9925077712704384e-05, 'shcoeffs_L2M2C': -0.009087503958673892, 'shcoeffs_L0M0S': 0.0, 'shcoeffs_L0M1S': 0.0, 'shcoeffs_L0M2S': 0.0, 'shcoeffs_L1M0S': 0.0, 'shcoeffs_L1M1S': 3.799611612562637e-05, 'shcoeffs_L1M2S': 0.0, 'shcoeffs_L2M0S': 0.0, 'shcoeffs_L2M1S': 3.672543904347801e-07, 'shcoeffs_L2M2S': 0.0002230857005948496} print('Error:', mse) >>> Error: 2.3738182456948795 """ if len(image.shape) != 3: raise ValueError( "Incorrect dimensions: {}. Expected 3 dimensions.".format(image.shape) ) if image.sum() == 0: raise ValueError("No foreground voxels found. Is the input image empty?") # Binarize the input. We assume that everything that is not background will # be use for parametrization image_ = image.copy() image_[image_ > 0] = 1 # Alignment if alignment_2d: # Align the points such that the longest axis of the 2d # xy max projected shape will be horizontal (along x) image_, angle = shtools.align_image_2d(image=image_, make_unique=make_unique) image_ = image_.squeeze() # Converting the input image into a mesh using regular marching cubes mesh, image_, centroid = shtools.get_mesh_from_image(image=image_, sigma=sigma) if not image_[tuple([int(u) for u in centroid[::-1]])]: warnings.warn( "Mesh centroid seems to fall outside the object. This indicates\ the mesh may not be a manifold suitable for spherical harmonics\ parameterization." ) # Get coordinates of mesh points coords = numpy_support.vtk_to_numpy(mesh.GetPoints().GetData()) x = coords[:, 0] y = coords[:, 1] z = coords[:, 2] transform = centroid + ((angle,) if alignment_2d else ()) # Translate and update mesh normals mesh = shtools.update_mesh_points(mesh, x, y, z) # Cartesian to spherical coordinates convertion rad = np.sqrt(x ** 2 + y ** 2 + z ** 2) lat = np.arccos(np.divide(z, rad, out=np.zeros_like(rad), where=(rad != 0))) lon = np.pi + np.arctan2(y, x) # Creating a meshgrid data from (lon,lat,r) points = np.concatenate( [np.array(lon).reshape(-1, 1), np.array(lat).reshape(-1, 1)], axis=1 ) grid_lon, grid_lat = np.meshgrid( np.linspace(start=0, stop=2 * np.pi, num=256, endpoint=True), np.linspace(start=0, stop=1 * np.pi, num=128, endpoint=True), ) # Interpolate the (lon,lat,r) data into a grid grid = spinterp.griddata(points, rad, (grid_lon, grid_lat), method="nearest") # Fit grid data with SH. Look at pyshtools for detail. coeffs = pyshtools.expand.SHExpandDH(grid, sampling=2, lmax_calc=lmax) # Reconstruct grid. Look at pyshtools for detail. grid_rec = pyshtools.expand.MakeGridDH(coeffs, sampling=2) # Resize the input grid to match the size of the reconstruction grid_down = sktrans.resize(grid, output_shape=grid_rec.shape, preserve_range=True) # Create (l,m) keys for the coefficient dictionary lvalues = np.repeat(np.arange(lmax + 1).reshape(-1, 1), lmax + 1, axis=1) keys = [] for suffix in ["C", "S"]: for (l, m) in zip(lvalues.flatten(), lvalues.T.flatten()): keys.append(f"shcoeffs_L{l}M{m}{suffix}") coeffs_dict = dict(zip(keys, coeffs.flatten())) return (coeffs_dict, grid_rec), (image_, mesh, grid_down, transform)
{"/aicsshparam/shparam.py": ["/aicsshparam/__init__.py"]}
40,466
colobas/aics-shparam
refs/heads/main
/aicsshparam/__init__.py
# -*- coding: utf-8 -*- """Top-level package for aics-shparam.""" __author__ = "Matheus Viana" __email__ = "matheus.viana@alleninstitute.org" # Do not edit this string manually, always use bumpversion # Details in CONTRIBUTING.md __version__ = "0.1.1" def get_module_version(): return __version__
{"/aicsshparam/shparam.py": ["/aicsshparam/__init__.py"]}
40,467
fkchong/mydjsite02
refs/heads/master
/empexp/apps.py
from django.apps import AppConfig class EmpexpConfig(AppConfig): name = 'empexp'
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,468
fkchong/mydjsite02
refs/heads/master
/empexp/migrations/0002_auto_20210627_1310.py
# Generated by Django 3.1.12 on 2021-06-27 05:10 from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('empexp', '0001_initial'), ] operations = [ migrations.RemoveField( model_name='experience', name='firstname', ), migrations.RemoveField( model_name='experience', name='lastname', ), ]
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,469
fkchong/mydjsite02
refs/heads/master
/userprefbook/views.py
from django.shortcuts import render from django.views.generic import FormView from .forms import upbform, bookform from .models import userprefbook from django.contrib import messages # Create your views here. class upbformview(FormView): model = userprefbook form_class = upbform template_name = "userprefbook/index.html" def get_success_url(self): return self.request.path def form_valid(self, form): form.save() messages.add_message(self.request, messages.INFO, 'Save successfully.') return super().form_valid(form) def form_invalid(self, form): form.add_error(None, 'Error in form...') return super().form_invalid(form)
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,470
fkchong/mydjsite02
refs/heads/master
/empexp/models.py
from django.db import models from django.contrib.auth.models import User from site02.models import employee # Create your models here. class experience(models.Model): user = models.ForeignKey(User, on_delete=models.CASCADE) employee = models.OneToOneField(employee, on_delete=models.CASCADE) companyname = models.CharField(max_length=200) fromdate = models.DateField() todate = models.DateField() rolesandresponsibility = models.TextField() reasonofleaving = models.TextField() currentexperience = models.BooleanField(default=True) def __str__(self): return f"{self.user.username}, {self.currentexperience}"
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,471
fkchong/mydjsite02
refs/heads/master
/empexp/views.py
from django.shortcuts import render from django.views.generic import FormView from .forms import EmpExpModelForm from django.contrib import messages # Create your views here. class MyEmpExpFormView(FormView): form_class = EmpExpModelForm template_name = "empexp/index.html" def get_success_url(self): return self.request.path def form_valid(self, form): form.save() messages.add_message(self.request, messages.INFO, 'Save successfully.') return super().form_valid(form) def form_invalid(self, form): form.add_error(None, 'Error in form...') return super().form_invalid(form)
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,472
fkchong/mydjsite02
refs/heads/master
/userprefbook/admin.py
from django.contrib import admin from .models import book, userprefbook # Register your models here. admin.site.register(book) admin.site.register(userprefbook)
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,473
fkchong/mydjsite02
refs/heads/master
/userprefbook/migrations/0001_initial.py
# Generated by Django 3.1.12 on 2021-06-29 01:17 from django.conf import settings from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): initial = True dependencies = [ migrations.swappable_dependency(settings.AUTH_USER_MODEL), ] operations = [ migrations.CreateModel( name='book', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('name', models.CharField(max_length=200)), ('author', models.CharField(max_length=100)), ('publishyear', models.DateField()), ], ), migrations.CreateModel( name='userprefbook', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('remark', models.TextField(null=True)), ('createddate', models.DateField(auto_now_add=True)), ('bookname', models.ManyToManyField(to='userprefbook.book')), ('user', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to=settings.AUTH_USER_MODEL)), ], ), ]
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,474
fkchong/mydjsite02
refs/heads/master
/site02/models.py
from django.db import models # Create your models here. class employee(models.Model): firstname = models.CharField(max_length=100) lastname = models.CharField(max_length=100) sex = models.CharField(max_length=20) dob = models.DateField() def __str__(self): return f"{self.firstname}, {self.lastname}, {self.sex}, {self.dob}"
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,475
fkchong/mydjsite02
refs/heads/master
/empexp/forms.py
from django import forms from .models import experience from django.core.exceptions import ValidationError class EmpExpModelForm(forms.ModelForm): class Meta: model = experience fields = "__all__" def clean_reasonofleaving(self): reasonofleaving = self.cleaned_data.get('reasonofleaving') if len(reasonofleaving) < 10: raise ValidationError('Reason of leaving is too short.') return reasonofleaving
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,476
fkchong/mydjsite02
refs/heads/master
/userprefbook/models.py
from django.db import models from django.contrib.auth.models import User # Create your models here. class book(models.Model): name = models.CharField(max_length=200) author = models.CharField(max_length=100) publishyear = models.DateField() def __str__(self): return f"{self.name}, {self.author}" class userprefbook(models.Model): user = models.ForeignKey(User, on_delete=models.CASCADE) bookname = models.ManyToManyField(book) remark = models.TextField(null=True) createddate = models.DateField(auto_now_add=True) def __str__(self): return f"{self.user.username}, {self.bookname}"
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,477
fkchong/mydjsite02
refs/heads/master
/site02/views.py
from django.shortcuts import render, HttpResponse # Create your views here. def appindex(request): #return HttpResponse("This is app index page.") progress = 'in progress' value = 1999 context = {'status1':progress,'status2':value} return render(request, 'app-about.html', context) def aboutpost(request): #print(request) if request.method == 'GET': temp = {} progress = request.GET.get('Text1') value = 1999 context = {'status1':progress,'status2':value} return render(request, 'aboutpost.html', context)
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,478
fkchong/mydjsite02
refs/heads/master
/userprefbook/apps.py
from django.apps import AppConfig class UserprefbookConfig(AppConfig): name = 'userprefbook'
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,479
fkchong/mydjsite02
refs/heads/master
/site02/apps.py
from django.apps import AppConfig class Site02Config(AppConfig): name = 'site02'
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,480
fkchong/mydjsite02
refs/heads/master
/userprefbook/forms.py
from django import forms from .models import book, userprefbook from django.core.exceptions import ValidationError class bookform(forms.ModelForm): class Meta: model = book fields = "__all__" def clean_name(self): name = self.cleaned_data.get('name') if len(name) < 10: raise ValidationError('Name is too short.') return name class upbform(forms.ModelForm): class Meta: model = userprefbook fields = ('user', 'bookname', 'remark') def clean_name(self): remark = self.cleaned_data.get('remark') if len(remark) < 10: raise ValidationError('Remark is too short.') return remark widgets = { 'user': forms.Select(attrs={'class': 'form-control'}), 'bookname': forms.Select(attrs={'class': 'form-control'}), 'remark': forms.Textarea(attrs={'class': 'form-control', 'placeholder': 'Please enter remark'}) }
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,481
fkchong/mydjsite02
refs/heads/master
/userprefbook/migrations/0003_userprefbook_remark.py
# Generated by Django 3.1.12 on 2021-06-29 05:40 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('userprefbook', '0002_remove_userprefbook_remark'), ] operations = [ migrations.AddField( model_name='userprefbook', name='remark', field=models.TextField(null=True), ), ]
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,482
fkchong/mydjsite02
refs/heads/master
/userprefbook/migrations/0002_remove_userprefbook_remark.py
# Generated by Django 3.1.12 on 2021-06-29 05:37 from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('userprefbook', '0001_initial'), ] operations = [ migrations.RemoveField( model_name='userprefbook', name='remark', ), ]
{"/userprefbook/views.py": ["/userprefbook/forms.py", "/userprefbook/models.py"], "/empexp/models.py": ["/site02/models.py"], "/empexp/views.py": ["/empexp/forms.py"], "/userprefbook/admin.py": ["/userprefbook/models.py"], "/empexp/forms.py": ["/empexp/models.py"], "/userprefbook/forms.py": ["/userprefbook/models.py"]}
40,483
IgorPodlawski/vending-machine-python
refs/heads/master
/Coin.py
class Coin: symbol = '' value = 0.00 def __init__(self, symbol: str, value: float): self.symbol = symbol self.value = value
{"/VendingMachine.py": ["/Product.py", "/Coin.py"], "/main.py": ["/VendingMachine.py"], "/tests/test_machine.py": ["/Product.py", "/Coin.py", "/VendingMachine.py"]}
40,484
IgorPodlawski/vending-machine-python
refs/heads/master
/VendingMachine.py
from Product import Product from Coin import Coin import random class VendingMachine: name = '' def __init__(self, name: str, **qwargs: dict): self.name = name self.insertedCoinsSum = 0.00 self.insertedCoins = [] self.slots = [] if qwargs.get('initialCash'): self.cash = qwargs.get('initialCash') else: self.cash = 100.00 def fill(self, productsQuantity: int): randomProductsNames = ['Mars', 'Snickers', 'Coffee', 'Coca-Cola', 'Pepsi 😂', 'iPhone'] for i in range(0, productsQuantity): product = Product(random.choice(randomProductsNames), random.randint(1, 9), random.choice([1.00, 1.50, 2.00, 3.00])) self.slots.append(product) def productsList(self): for product in self.slots: print('NAME:', product.name, 'QUANTITY:', product.quantity, 'PRICE:', product.price) def insertCoin(self, coin: Coin): self.insertedCoins.append(coin) def sumInsertedCoins(self): for coin in self.insertedCoins: self.insertedCoinsSum = self.insertedCoinsSum + coin.value def buyProduct(self, number: int): product = self.slots[number] if (product.price <= self.insertedCoinsSum and product.quantity > 0): product.decrease() self.insertedCoinsSum = self.insertedCoinsSum - product.price return product else: return None
{"/VendingMachine.py": ["/Product.py", "/Coin.py"], "/main.py": ["/VendingMachine.py"], "/tests/test_machine.py": ["/Product.py", "/Coin.py", "/VendingMachine.py"]}
40,485
IgorPodlawski/vending-machine-python
refs/heads/master
/main.py
from VendingMachine import VendingMachine def loop(): print('press CTRL+C or CTLR+D to exit') vm = VendingMachine('hospital', initialCash = 130) vm.fill(32) while True: try: data = input('MACHINE> ') if (data == 'PRODUCTS'): vm.productsList() except (KeyboardInterrupt, EOFError): print('goodbye!') break if __name__ == "__main__": loop()
{"/VendingMachine.py": ["/Product.py", "/Coin.py"], "/main.py": ["/VendingMachine.py"], "/tests/test_machine.py": ["/Product.py", "/Coin.py", "/VendingMachine.py"]}
40,486
IgorPodlawski/vending-machine-python
refs/heads/master
/Product.py
class Product: name = '' quantity = 0 price = 0.00 def __init__(self, name: str, quantity: int, price: float): self.name = name self.quantity = quantity self.price = price def increase(self): self.quantity = self.quantity + 1 def decrease(self): self.quantity = self.quantity - 1
{"/VendingMachine.py": ["/Product.py", "/Coin.py"], "/main.py": ["/VendingMachine.py"], "/tests/test_machine.py": ["/Product.py", "/Coin.py", "/VendingMachine.py"]}
40,487
IgorPodlawski/vending-machine-python
refs/heads/master
/tests/test_machine.py
from Product import Product from Coin import Coin from VendingMachine import VendingMachine def test_foo(): assert 2 + 2 def test_product_incease(): product = Product('Snickers', 0, 1.00) product.increase() assert 1 == product.quantity def test_coin_defitinion(): dollar = Coin('DOLLAR', 1.00) assert dollar.symbol == 'DOLLAR' and dollar.value == 1.00 def test_vending_machine_init(): vm = VendingMachine('hospital', initialCash = 130) assert vm.cash == 130 and vm.name == 'hospital' def test_vending_machine_fill(): vm = VendingMachine('hospital', initialCash = 130) vm.fill(32) vm.productsList() assert len(vm.slots) == 32 def test_insert_coin(): vm = VendingMachine('hospital', initialCash = 130) dollar = Coin('DOLLAR', 1.00) vm.insertCoin(dollar) insertedCoin = vm.insertedCoins[0] assert insertedCoin.symbol == 'DOLLAR' and insertedCoin.value == 1.00 def test_sum_inserted_coins(): vm = VendingMachine('hospital', initialCash = 130) dollar = Coin('DOLLAR', 1.00) quarter = Coin('Q', 0.25) vm.insertCoin(dollar) vm.insertCoin(dollar) vm.insertCoin(quarter) vm.sumInsertedCoins() assert vm.insertedCoinsSum == 2.25 def test_product_bought(): vm = VendingMachine('hospital', initialCash = 130) vm.fill(32) dollar = Coin('DOLLAR', 1.00) quarter = Coin('Q', 0.25) vm.insertCoin(dollar) vm.insertCoin(dollar) vm.insertCoin(dollar) vm.insertCoin(quarter) vm.sumInsertedCoins() product = vm.slots[5] boughtProduct = vm.buyProduct(5) assert boughtProduct != None def test_product_not_bought(): vm = VendingMachine('hospital', initialCash = 130) vm.fill(32) quarter = Coin('Q', 0.25) vm.insertCoin(quarter) vm.sumInsertedCoins() product = vm.slots[5] boughtProduct = vm.buyProduct(5) assert boughtProduct == None def test_rest(): vm = VendingMachine('hospital', initialCash = 130) vm.fill(32) dollar = Coin('DOLLAR', 1.00) quarter = Coin('Q', 0.25) vm.insertCoin(dollar) vm.insertCoin(dollar) vm.insertCoin(dollar) vm.insertCoin(quarter) vm.sumInsertedCoins() initialSum = vm.insertedCoinsSum product = vm.slots[5] boughtProduct = vm.buyProduct(5) assert vm.insertedCoinsSum != initialSum
{"/VendingMachine.py": ["/Product.py", "/Coin.py"], "/main.py": ["/VendingMachine.py"], "/tests/test_machine.py": ["/Product.py", "/Coin.py", "/VendingMachine.py"]}
40,509
mg-blvd/Images-Website-HW4
refs/heads/master
/txt_read_write_functions.py
'''Authors: Misael Guijarro && Jose Alfaro Date: 04/02/2019 Class: CST 205 Teacher: Wes Modes Description: Holds thst function that will write to the text file that keeps track of the images we used in the last refresh.''' # this function literally reads the names that are in former_images.txt # it then 'splits' the strings after the new line def read_in_names(): f = open("former_images.txt", "r") read_names = f.read().split('\n') f.close() return read_names #this function passes in name_list which is used to 'write' the name of the images # this we are using in the current page. We will call these names back at the #next refresh. # Writes out the name of image followed by a new line. def edit_text(name_list): f = open("former_images.txt", 'w') for i in range(3): f.write(name_list[i] + '\n') f.close()
{"/hw4.py": ["/txt_read_write_functions.py"]}
40,510
mg-blvd/Images-Website-HW4
refs/heads/master
/hw4.py
'''Authors: Misael Guijarro && Jose Alfaro Date: 04/02/2019 Class: CST 205 Teacher: Wes Modes Description: The home page displays three randoms images. Once clicked they take you to a separate page with the picture and a description of it.''' from flask import Flask, render_template from flask_bootstrap import Bootstrap from txt_read_write_functions import read_in_names, edit_text from image_info import image_info from PIL import Image import random import ast app = Flask(__name__, static_url_path = "/static", static_folder = "static") bootstrap = Bootstrap(app) #this function is so that the picture does not get repeated on the home page def assert_no_repeating(array1, array2): current = random.choice(image_info) while (current["title"] in array1 or current["title"] in array2): current = random.choice(image_info) return current #this will route the function to be our home page #this function allows the images to be displayed onto the page # Function: inside of the for loop it is making sure that the images will not be repeated or reuse images from the last refresh # by passing in the assert_no_repeating function and the read_in_names with the past_images variable. # after completion it will use the edit_text function to pass in the names of the images that # will be posted onto the home page to our text file. This will assure that different #images are used after each refresh. @app.route('/') def main_page(): past_images = read_in_names() current_images = [] current_image_titles = [] for i in range(3): current_images.append(assert_no_repeating(past_images, current_image_titles)) current_image_titles.append(current_images[i]["title"]) edit_text(current_image_titles) return render_template('home.html', image_list=current_images) #this will route the function to be the pages where the individual image description is on after clicking on it #this function will display the image resized onto another page with some description of it # Function: it is passing in var so it could be later used in the home.html to make print out the random images with # their respective 'locations' in the array in the previous function. # The .literal_eval(var) makes a dictionary out of string output from html code. # Images are being resized once clicked on and taken to new page. # We get the dimensions od the image using PIL. @app.route('/image_info/<var>') def image_page(var): new_var = ast.literal_eval(var) current_image = Image.open("static/" + new_var["id"] + ".jpg") dimensions_w, dimensions_h = current_image.size return render_template('image_info.html', pic=new_var, w=dimensions_w, h=dimensions_h) if __name__ == '__main__': print("Working!") app.run(debug=True)
{"/hw4.py": ["/txt_read_write_functions.py"]}
40,525
SicParvisMagna95/rain_detection
refs/heads/master
/train.py
import model import dataset import torch import torch.cuda as cuda import torch.utils.data as Data import torch.nn as nn import torch.optim as Optim import matplotlib.pyplot as plt import os from visdom import Visdom import numpy as np from loss import FocalLoss,FocalLoss_bce # hyper-parameter os.environ["CUDA_VISIBLE_DEVICES"] = "7" EPOCHS = 40 BATCH_SIZE = 500 if __name__ == '__main__': # gpu gpu_avail = cuda.is_available() # model # net = model.Ztk_vgg() net = model.MobileNet() if cuda.device_count()>1: print('cuda count:',cuda.device_count()) net = nn.DataParallel(net) # names = net.named_parameters() # for name,p in names: # print(name) # pass if gpu_avail: net = net.to("cuda") # make directory if not os.path.exists('./loss'): os.makedirs('./loss') model_saved_path = './model_saved_new_3/mobilenet_conv1x1' if not os.path.exists(model_saved_path): os.makedirs(model_saved_path) # data input_train_data = dataset.RainData(train=True) input_test_data = dataset.RainData(train=False) train_data_loader = Data.DataLoader(input_train_data,batch_size=BATCH_SIZE,shuffle=True) test_data_loader = Data.DataLoader(input_test_data,batch_size=BATCH_SIZE,shuffle=False) # optimizer optimizer = Optim.Adam(net.parameters()) scheduler = torch.optim.lr_scheduler.ReduceLROnPlateau(optimizer,verbose=True,patience=1000) # loss function loss_func = nn.CrossEntropyLoss() # loss_func = FocalLoss(2,alpha=0.25) # loss_func = FocalLoss_bce(alpha=1, gamma=2) # visualize env = Visdom(port=10022,env='mobilenet') # initialize some variables accuracy,accuracy_old = 0,0 train_loss_curve,val_loss_curve = [],[] iteration = 0 # start training for epoch in range(EPOCHS): # loss_train_epoch = 0.0 # loss_test_epoch = 0.0 net.train() for i,(img, label) in enumerate(train_data_loader): net.train() iteration = int(epoch*(len(input_train_data.train_data)/BATCH_SIZE+1)+i+1) # pytorch has to do these type cvt # img---float32(float), label---int64(long) img = img.float() label = label.long() if gpu_avail: img = img.to('cuda') label = label.to('cuda') # with SummaryWriter(log_dir='./model_graph', comment='my_vgg') as w: # w.add_graph(net, img) optimizer.zero_grad() out = net(img) # (Batch_size, 2) # value_range over channels (0.0, 1.0) loss = loss_func(out, label) loss.backward() # optimizer.step() scheduler.step(loss) # loss_train_epoch += loss.item() * label.shape[0] loss_train_iteration = loss.item() if i % 200 == 0: # print(f"Epoch {epoch}\tIteration {i}\tTrain loss: {loss.item()}") # env.text(f"Epoch {epoch}\tIteration {i}\tTrain loss: {loss.item()}\n", # win='log',env='mobilenet', # append=False if iteration == 1 else True # ) # print(epoch, iteration) # env.line(Y=np.array([loss.item()]),X=np.array([iteration]), # win='loss',env='mobilenet', # opts=dict(title='loss', # xlabel='iteration',ylabel='loss', # legend=['Train loss'], # showlegend=True # ), # update=None if iteration == 1 else 'append') # evaluation net.eval() correct = 0 loss_test_iteration = 0.0 for j, (img_val, label_val) in enumerate(test_data_loader): img_val = img_val.float() label_val = label_val.long() if gpu_avail: img_val = img_val.to("cuda") label_val = label_val.to("cuda") out_val = net(img_val) # (Batch_size, 2) # output the accuracy out_class = torch.argmax(out_val, dim=1) count = torch.sum(out_class==label_val).item() # print(count) correct += count loss_val = loss_func(out_val, label_val) # loss_test_epoch += loss_val.item() * label_val.shape[0] loss_test_iteration += loss_val.item() * label_val.shape[0] # loss_total_train = loss_train_iteration/len(input_train_data.train_data) # loss_total_train = loss_train_iteration loss_total_val = loss_test_iteration/len(input_test_data.train_data) accuracy = correct/len(input_test_data.train_data) if accuracy_old<accuracy: accuracy_old = accuracy torch.save({'model':net, 'epoch':epoch, 'batch_size':BATCH_SIZE, },f'{model_saved_path}/accuracy_{accuracy}.pkl') # record train_loss,val_loss # train_loss_curve.append(loss_total_train) train_loss_curve.append(loss_train_iteration) val_loss_curve.append(loss_total_val) env.line(Y=np.column_stack((loss_train_iteration,loss_total_val)), # X=np.column_stack((epoch,epoch)), X=np.array([iteration]), win='loss', env='mobilenet', opts=dict(title='Loss', xlabel='Iteration', ylabel='loss', legend=['Train loss','Validation loss'], markers=True, showlegend=True ), update=None if iteration == 201 else 'append') env.line(Y=np.array([accuracy]), # X=np.column_stack((epoch,epoch)), X=np.array([iteration]), win='accuracy', env='mobilenet', opts=dict(title='Accuracy', xlabel='Iteration', ylabel='accuracy', legend=['Accuracy'], markers=True, showlegend=True ), update=None if iteration == 1 else 'append') print(f'Iteration {iteration} finished! Train loss: {loss_train_iteration}\t' f'Val loss: {loss_total_val}\t' f'Accuracy: {accuracy}') env.text(f'Iteration {iteration} finished! Train loss: {loss_train_iteration}\t' f'Val loss: {loss_total_val}\t' f'Accuracy: {accuracy}\n\n', win='log', env='mobilenet', append=False if iteration == 1 else True) print() pass print(f'Epoch {epoch} finished!\n') env.text(f'Epoch {epoch} finished!\n', win='log', env='mobilenet', append=False if iteration == 1 else True) plt.plot(range(1,EPOCHS+1), train_loss_curve, label='train loss') plt.plot(range(1,EPOCHS+1), val_loss_curve, label='val loss') plt.title('Mobilenet') plt.xlabel('Epoch') plt.ylabel('Loss') plt.legend() plt.savefig(f'./loss/loss_epoch{EPOCHS}') plt.show()
{"/train.py": ["/model.py", "/dataset.py", "/loss.py"], "/main.py": ["/dataset.py", "/model.py"]}
40,526
SicParvisMagna95/rain_detection
refs/heads/master
/main.py
import torch import dataset import model import cv2 import os import torch.nn as nn import numpy as np import time import torch.cuda as cuda import glob if __name__ == '__main__': gpu_avail = cuda.is_available() os.environ["CUDA_VISIBLE_DEVICES"] = "3" scale = 0.8 img_dir = '/home/zhangtk/data/test/0/' # img_dir = r'E:\data\rain_full\rain_imgs\test\2' # img_list = os.listdir(img_dir) img_list_ = glob.glob(os.path.join(img_dir,'*.jpg')) img_list = [os.path.basename(i) for i in img_list_] # save_dir = f'/home/zhangtk/data/test/0_test_ztkvgg1_{scale}/' save_dir = os.path.join(img_dir, 'result_mobilenet_conv1x1_new_930') if not os.path.exists(save_dir): os.makedirs(save_dir) start = time.time() for img_path in img_list: img = cv2.imread(os.path.join(img_dir, img_path)) h = img.shape[0] w = img.shape[1] img = cv2.resize(img,(0,0),fx=scale,fy=scale) img = torch.from_numpy(img) img = img.float() img = torch.unsqueeze(img,dim=0) img = img.permute(0,3,1,2) if gpu_avail: info = torch.load('./model_saved_new/mobilenet_conv1x1/accuracy_0.9302765786860787.pkl') img = img.to("cuda") else: info = torch.load('./model_saved_new/mobilenet_conv1x1/accuracy_0.9302765786860787.pkl', map_location='cpu') net = info['model'] # net = net.module net = net.eval() # print(net) s = time.time() out = net(img) # cv2.imshow('i',out[0,:,:].detach().cpu().numpy()) # cv2.waitKey() out = torch.unsqueeze(out, dim=0) out = nn.Softmax2d()(out) out = out[0,1,:,:] out = out.cpu().detach().numpy() out = cv2.resize(out,(w,h)) out = out*255 # out = out[:,:,np.newaxis] # cv2.imshow('abc',out) # cv2.waitKey(0) print(img_path) e = time.time() # print(e-s, ' s') cv2.imwrite(os.path.join(save_dir, img_path[:-4]+'_test.jpg'), out) # cv2.imshow('img', out) # cv2.waitKey() pass end = time.time() print(end-start, ' s')
{"/train.py": ["/model.py", "/dataset.py", "/loss.py"], "/main.py": ["/dataset.py", "/model.py"]}
40,527
SicParvisMagna95/rain_detection
refs/heads/master
/model.py
import torch as torch import torch.nn as nn import torchvision import torch.utils.model_zoo as model_zoo __all__ = ['VGG', 'vgg11', 'vgg11_bn', 'vgg13', 'vgg13_bn', 'vgg16', 'vgg16_bn', 'vgg19_bn', 'vgg19',] cfg = { 'A': [64, 'M', 128, 'M', 256, 256, 'M', 512, 512, 'M', 512, 512, 'M'], 'B': [64, 64, 'M', 128, 128, 'M', 256, 256, 'M', 512, 512, 'M', 512, 512, 'M'], 'D': [64, 64, 'M', 128, 128, 'M', 256, 256, 256, 'M', 512, 512, 512, 'M', 512, 512, 512, 'M'], 'E': [64, 64, 'M', 128, 128, 'M', 256, 256, 256, 256, 'M', 512, 512, 512, 512, 'M', 512, 512, 512, 512, 'M'], 'my_vgg':[32, 32, 'M', 64, 64, 'M', 128, 128, 'M', 256, 256, 'M', 256, 256, 'M'], 'xx_vgg':[], 'my_mobilenet':[], } class VGG(nn.Module): def __init__(self, features, init_weights=True): super(VGG, self).__init__() self.features = features self.conv_sub = nn.Conv2d(in_channels=256, out_channels=2, kernel_size=1) # self.softmax = nn.Softmax2d() # self.linear = nn.Linear(256,10) if init_weights: self._initialize_weights() def forward(self, x): x = self.features(x) # (Batch_size, 256, 1, 1) x = self.conv_sub(x) # (Batch_size, 2, 1, 1) x = torch.squeeze(x) # (Batch_size, 2) return x def _initialize_weights(self): for m in self.modules(): if isinstance(m, nn.Conv2d): nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu') if m.bias is not None: nn.init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): nn.init.constant_(m.weight, 1) nn.init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): nn.init.normal_(m.weight, 0, 0.01) nn.init.constant_(m.bias, 0) def make_layers(cfg, batch_norm=False): layers = [] in_channels = 3 for v in cfg: if v == 'M': layers += [nn.MaxPool2d(kernel_size=2, stride=2)] else: conv2d = nn.Conv2d(in_channels, v, kernel_size=3, padding=1) if batch_norm: layers += [conv2d, nn.BatchNorm2d(v), nn.ReLU(inplace=True)] else: layers += [conv2d, nn.ReLU(inplace=True)] in_channels = v return nn.Sequential(*layers) def my_vgg(batch_norm=True, **kwargs):\ return VGG(make_layers(cfg['my_vgg'], batch_norm=batch_norm), **kwargs) """""""""""""""""""""""""""""""""""" """============ZTK_vgg===========""" """""""""""""""""""""""""""""""""""" class Block1(nn.Module): # kernel_size=3*3 pad=1 def __init__(self, in_channel, out_channel, stride=1, padding=1): super(Block1,self).__init__() self.conv = nn.Conv2d(in_channels=in_channel,out_channels=out_channel, kernel_size=3,stride=stride,padding=padding) self.bn = nn.BatchNorm2d(out_channel) self.relu = nn.ReLU(inplace=True) self.block = nn.Sequential(self.conv,self.bn,self.relu) def forward(self, x): x = self.block(x) return x class Block2(nn.Module): # kernel_size=3*3 pad=0 def __init__(self, in_channel, out_channel): super(Block2,self).__init__() self.conv = nn.Conv2d(in_channels=in_channel, out_channels=out_channel, kernel_size=3, stride=1, padding=0) self.bn = nn.BatchNorm2d(out_channel) self.relu = nn.ReLU(inplace=True) self.block = nn.Sequential(self.conv, self.bn, self.relu) def forward(self, x): x = self.block(x) return x class Ztk_vgg(nn.Module): def __init__(self, in_channel=3, num_class=2): super(Ztk_vgg,self).__init__() self.unit1 = Block1(in_channel, 32) self.unit2 = Block1(32, 32) self.maxpool1 = nn.MaxPool2d(kernel_size=2, stride=2) self.down_sample1 = nn.Sequential(self.unit1,self.unit2,self.maxpool1) self.unit3 = Block1(32,64) self.unit4 = Block1(64,64) self.maxpool2 = nn.MaxPool2d(kernel_size=2, stride=2) self.down_sample2 = nn.Sequential(self.unit3,self.unit4,self.maxpool2) self.unit5 = Block2(64,128) self.unit6 = Block2(128,256) self.unit7 = Block2(256,512) self.maxpool3 = nn.MaxPool2d(kernel_size=2, stride=2) self.down_sample3 = nn.Sequential(self.unit5,self.unit6,self.unit7,self.maxpool3) self.conv_1x1 = nn.Conv2d(512,2,kernel_size=1) self._initialize_weights() # self.feature = nn.Sequential(self.down_sample1,self.down_sample2,self.down_sample3) def forward(self, x): x = self.down_sample1(x) x = self.down_sample2(x) x = self.down_sample3(x) x = self.conv_1x1(x) x = torch.squeeze(x) return x def _initialize_weights(self): for m in self.modules(): if isinstance(m, nn.Conv2d): nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu') if m.bias is not None: nn.init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): nn.init.constant_(m.weight, 1) nn.init.constant_(m.bias, 0) """""""""""""""""""""""""""""""""""" """============MobileNet=========""" """""""""""""""""""""""""""""""""""" class Depthwise_separable_conv(nn.Module): def __init__(self, in_channel, out_channel, stride=1 ,kernel_size=3, padding=1): super(Depthwise_separable_conv,self).__init__() self.depthwise = nn.Conv2d(in_channels=in_channel, out_channels=in_channel, kernel_size=kernel_size, padding=padding,stride=stride, groups=in_channel) self.pointwise = nn.Conv2d(in_channels=in_channel, out_channels=out_channel, kernel_size=1) self.bn_in = nn.BatchNorm2d(in_channel) self.bn_out = nn.BatchNorm2d(out_channel) self.relu = nn.ReLU(inplace=True) def forward(self, x): x = self.depthwise(x) x = self.bn_in(x) x = self.relu(x) x = self.pointwise(x) x = self.bn_out(x) x = self.relu(x) return x class MobileNet(nn.Module): def __init__(self, in_channel=3, out_channel=1000): super(MobileNet, self).__init__() self.conv1 = Block1(in_channel,32,stride=2,padding=1) # /2 self.depth_point_conv1 = Depthwise_separable_conv(32,64,stride=1,padding=1) # unchanged self.depth_point_conv2 = Depthwise_separable_conv(64,128,stride=2,padding=1) # /2 # self.depth_point_conv2 = nn.AvgPool2d(kernel_size=2,stride=2) self.depth_point_conv3 = Depthwise_separable_conv(128,128,stride=1,padding=1) # unchanged self.depth_point_conv4 = Depthwise_separable_conv(128,256,stride=1,padding=0) # -2 self.depth_point_conv5 = Depthwise_separable_conv(256,256,stride=1,padding=1) # unchanged self.depth_point_conv6 = Depthwise_separable_conv(256,512,stride=1,padding=0) # -2 self.depth_point_conv7_block = [Depthwise_separable_conv(512,512,stride=1,padding=1)]*5 self.depth_point_conv8 = Depthwise_separable_conv(512,1024,stride=1,padding=0) # -2 self.depth_point_conv9 = Depthwise_separable_conv(1024,1024,stride=2,padding=1) # /2 # self.depth_point_conv9 = nn.AvgPool2d(kernel_size=2,stride=2) self.conv1x1 = nn.Conv2d(1024,2,kernel_size=1) self.feature = nn.Sequential(self.conv1, self.depth_point_conv1, self.depth_point_conv2, self.depth_point_conv3, self.depth_point_conv4, self.depth_point_conv5, self.depth_point_conv6, *self.depth_point_conv7_block, self.depth_point_conv8, self.depth_point_conv9, self.conv1x1 ) self._initialize_weights() # self.average_pool = nn.AvgPool2d(kernel_size=7) # 1*1*1024 # self.fc = nn.Linear(1024,out_channel) # self.softmax = nn.Softmax() # self.classifier = nn.Sequential(self.fc,self.softmax) def forward(self, x): x = self.feature(x) # x = x.view(-1, x.shape[1]) # 1024 # x = self.classifier(x) # 1000 # x = self.fc(x) # x = self.softmax(x) x = torch.squeeze(x) return x def _initialize_weights(self): for m in self.modules(): if isinstance(m, nn.Conv2d): nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu') if m.bias is not None: nn.init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): nn.init.constant_(m.weight, 1) nn.init.constant_(m.bias, 0)
{"/train.py": ["/model.py", "/dataset.py", "/loss.py"], "/main.py": ["/dataset.py", "/model.py"]}
40,528
SicParvisMagna95/rain_detection
refs/heads/master
/dataset.py
import torch import torchvision.transforms as transforms import torch.utils.data as Data import os import glob import pickle import numpy as np class RainData(Data.Dataset): def __init__(self, train=True): super(RainData, self).__init__() root = '/data/rain/rain_detection_train/cropped/' self.train_data = [] if train: data_path = [os.path.join(root, 'train_True', '32.imdb'), os.path.join(root, 'train_False', '32.imdb')] else: data_path = [os.path.join(root, 'val_True', '32.imdb'), os.path.join(root, 'val_False', '32.imdb')] for file_train in data_path: # for j in range(2): imdb = open(file_train, 'rb') data = pickle.load(imdb) if 'True' in file_train: self.train_data += [[i,1] for i in data] # self.train_data += np.column_stack((data, np.ones(len(data),dtype=np.float))) else: self.train_data += [[i, 0] for i in data] # print(0) # self.train_data += np.column_stack((data, np.zeros(len(data),dtype=np.float))) imdb.close() pass def __len__(self): return len(self.train_data) def __getitem__(self, item): img = (self.train_data[item][0]).astype(np.float) label = float((self.train_data[item][1])) return img, label
{"/train.py": ["/model.py", "/dataset.py", "/loss.py"], "/main.py": ["/dataset.py", "/model.py"]}
40,529
SicParvisMagna95/rain_detection
refs/heads/master
/mess/test_time.py
import cv2 import torch import time import torch.cuda as cuda import os os.environ["CUDA_VISIBLE_DEVICES"] = "1" gpu_avail = cuda.is_available() if gpu_avail: info = torch.load('./model_saved/accuracy_0.9762699947266655.pkl') print('\nTest on gpu:') else: info = torch.load('./model_saved/accuracy_0.9762699947266655.pkl', map_location='cpu') print('\nTest on cpu:') net = info['model'] number = 100 start = time.time() img = cv2.imread('./RECORD2.20000201000408Front.mp4.432.jpg') img = torch.from_numpy(img) img = img.float() img = torch.unsqueeze(img,dim=0) img = img.permute(0,3,1,2) if gpu_avail: img = img.to('cuda') for i in range(number): a = net(img) end = time.time() print(end-start,f's for {number} images')
{"/train.py": ["/model.py", "/dataset.py", "/loss.py"], "/main.py": ["/dataset.py", "/model.py"]}
40,530
SicParvisMagna95/rain_detection
refs/heads/master
/loss.py
import torch import torch.nn as nn import torch.nn.functional as F # class FocalLoss(torch.nn.Module): # def __init__(self, gamma=2): # super().__init__() # self.gamma = gamma # # def forward(self, log_pred_prob_onehot, target): # pred_prob_oh = torch.exp(log_pred_prob_onehot) # pt = pred_prob_oh.gather(1, target.data.view(-1, 1)) # modulator = (1 - pt) ** self.gamma # mce = modulator * (-torch.log(pt)) # # return mce.mean() class FocalLoss(nn.Module): r""" This criterion is a implementation of Focal Loss, which is proposed in Focal Loss for Dense Object Detection. Loss(x, class) = - \alpha (1-softmax(x)[class])^gamma \log(softmax(x)[class]) The losses are averaged across observations for each mini-batch. Args: alpha(1D Tensor, Variable) : the scalar factor for this criterion gamma(float, double) : gamma > 0; reduces the relative loss for well-classified examples (p > .5), putting more focus on hard, misclassified examples size_average(bool): By default, the losses are averaged over observations for each mini-batch. However, if the field size_average is set to False, the losses are instead summed for each mini-batch. Input: inputs: [N, C] targets: [N, 1] """ def __init__(self, class_num, alpha=None, gamma=2, size_average=True): super(FocalLoss, self).__init__() if alpha is None: self.alpha = torch.ones(class_num, 1) else: self.alpha = torch.tensor([alpha,1-alpha]) self.gamma = gamma self.class_num = class_num self.size_average = size_average def forward(self, inputs, targets): N = inputs.size(0) # batch_size C = inputs.size(1) # 2 P = F.softmax(inputs,dim=1) # class_mask = inputs.new(N, C).fill_(0) class_mask = torch.zeros_like(inputs) # ids = targets.view(-1, 1) ids = targets.view(-1,1) class_mask.scatter_(1, ids, 1) # 生成 one-hot 标签 # print(class_mask) if inputs.is_cuda and not self.alpha.is_cuda: self.alpha = self.alpha.to("cuda") # alpha = self.alpha[ids.data.view(-1)] alpha = self.alpha[targets] probs = (P * class_mask).sum(1).view(-1, 1) probs += 1e-8 log_p = probs.log() # print('probs size= {}'.format(probs.size())) # print(probs) batch_loss = -alpha * (torch.pow((1 - probs), self.gamma)) * log_p # print('-----bacth_loss------') # print(batch_loss) if self.size_average: loss = batch_loss.mean() else: loss = batch_loss.sum() return loss class FocalLoss_bce(nn.Module): def __init__(self, alpha=1, gamma=2, logits=False, reduce=True): super(FocalLoss_bce, self).__init__() self.alpha = alpha self.gamma = gamma self.logits = logits self.reduce = reduce def forward(self, inputs, targets): targets = targets.float() if self.logits: BCE_loss = F.binary_cross_entropy_with_logits(F.softmax(inputs,dim=1)[:,1], targets, reduction='none') else: BCE_loss = F.binary_cross_entropy(F.softmax(inputs,dim=1)[:,1], targets, reduction='none') pt = torch.exp(-BCE_loss) F_loss = self.alpha * (1-pt)**self.gamma * BCE_loss if self.reduce: return torch.mean(F_loss) else: return F_loss # if __name__ == '__main__': # loss = FocalLoss(2) # # # conf_mask = torch.FloatTensor([0.0, 1.0, 0.0, 1.0, 1.0]) - 1 # # conf_data = torch.FloatTensor([-0.1, -0.9, 0.0, -0.2, -0.2]) # conf_data = torch.randn(3,2) # conf_mask = torch.tensor([1,0,1], dtype=torch.long) # # print(loss(conf_data, conf_mask))
{"/train.py": ["/model.py", "/dataset.py", "/loss.py"], "/main.py": ["/dataset.py", "/model.py"]}
40,531
SicParvisMagna95/rain_detection
refs/heads/master
/mess/xml_jpg.py
import os import xml.dom.minidom import cv2 ImgPath = r'E:\data\rain_full\rain_imgs\match\img' AnnoPath = r'E:\data\rain_full\rain_imgs\match\xml' ImgLabelPath = r'E:\data\rain_full\rain_imgs\match\img_label' imagelist = os.listdir(ImgPath) for image in imagelist: image_pre, ext = os.path.splitext(image) imgfile = os.path.join(ImgPath, image) xmlfile = os.path.join(AnnoPath, image_pre+'.xml') # 打开xml文档 DOMTree = xml.dom.minidom.parse(xmlfile) # 得到文档元素对象 collection = DOMTree.documentElement # 读取图片 img = cv2.imread(imgfile) # filenamelist = collection.getElementsByTagName("filename") # filename = filenamelist[0].childNodes[0].data # print(filename) # 得到标签名为object的信息 objectlist = collection.getElementsByTagName("object") for objects in objectlist: # 每个object中得到子标签名为name的信息 # namelist = objects.getElementsByTagName('name') # # 通过此语句得到具体的某个name的值 # objectname = namelist[0].childNodes[0].data bndbox = objects.getElementsByTagName('bndbox') for box in bndbox: x1_list = box.getElementsByTagName('xmin') x1 = int(x1_list[0].childNodes[0].data) y1_list = box.getElementsByTagName('ymin') y1 = int(y1_list[0].childNodes[0].data) x2_list = box.getElementsByTagName('xmax') x2 = int(x2_list[0].childNodes[0].data) y2_list = box.getElementsByTagName('ymax') y2 = int(y2_list[0].childNodes[0].data) cv2.rectangle(img, (x1, y1), (x2, y2), (0, 0, 255), thickness=2) # cv2.putText(img, objectname, (x1, y1), cv.FONT_HERSHEY_COMPLEX, 0.7, (0, 255, 0), # thickness=2) # cv2.imshow('head', img) # cv2.waitKey() cv2.imwrite(os.path.join(ImgLabelPath, image), img) #save picture
{"/train.py": ["/model.py", "/dataset.py", "/loss.py"], "/main.py": ["/dataset.py", "/model.py"]}
40,532
SicParvisMagna95/rain_detection
refs/heads/master
/mess/match.py
"""match the jpg with annotation""" import os import glob import shutil test_dir = r'E:\data\rain_full\rain_imgs\test' test_dir_list = glob.glob(os.path.join(test_dir,'*')) annotation_dir = r'E:\data\rain_full\Annotation' annotation_list = os.listdir(annotation_dir) match = [] for test_path in test_dir_list[1:]: test_list = os.listdir(test_path) for jpg in test_list: jpg_xml = jpg[:-4] + '.xml' if jpg_xml in annotation_list: shutil.copy(os.path.join(test_path,jpg), r'E:\data\rain_full\rain_imgs\match\img') shutil.copy(os.path.join(annotation_dir, jpg_xml), r'E:\data\rain_full\rain_imgs\match\xml') match.append(jpg[:-4]) pass pass
{"/train.py": ["/model.py", "/dataset.py", "/loss.py"], "/main.py": ["/dataset.py", "/model.py"]}
40,572
loyalist16/components
refs/heads/master
/ttf_ocr/baidu_ocr.py
# -*- coding: utf-8 -*- # @Time : 2021/2/23 11:45 # @Author : loyalist # @Email : lzl0118@foxmail.com # @File : baidu_ocr.py # @Desc : 百度的OCR项目 from aip import AipOcr APP_ID = '**' API_KEY = '**' SECRET_KEY = '**' client = AipOcr(APP_ID, API_KEY, SECRET_KEY) def accurate_ocr(file): ''' 通用文字识别(高精度版) ''' """ 读取图片 """ def get_file_content(filePath): with open(filePath, 'rb') as fp: return fp.read() image = get_file_content(file) """ 调用通用文字识别(高精度版) """ result = client.basicAccurate(image) return result
{"/proxy/adsl/dial.py": ["/proxy/dbConnect.py"], "/txhk/core.py": ["/txhk/gap.py"]}
40,573
loyalist16/components
refs/heads/master
/proxy/dbConnect.py
# -*- coding: utf-8 -*- # @Time : 2021/1/29 9:33 # @Author : loyalist # @Email : lzl0118@foxmail.com # @File : dbConnect.py # @Desc : 连接各种数据库 import redis import random from proxy import setting class MyRedisClient: """ redis连接客户端 """ def __init__(self, host=setting.REDIS_HOST, port=setting.REDIS_PORT, passwd=setting.REDIS_PASSWORD, proxy_key=setting.PROXY_KEY): """ 初始化redis连接 :param str host: 主机 :param str port: 端口 :param str passwd: 密码 :param str proxy_key: 哈希键名 """ self.db = redis.StrictRedis(host=host, port=port, password=passwd, decode_responses=True) self.proxy_key = proxy_key def set(self, name, proxy): """ 设置代理 :param str name: 主机名称 :param str proxy: 代理 :return: 设置结果 :rtype: int """ return self.db.hset(self.proxy_key, name, proxy) def get(self, name): """ 获取代理 :param str name: 主机名称 :return: 代理 :rtype: str """ return self.db.hget(self.proxy_key, name) def count(self): """ 获取代理总数 :return: 代理总数 :rtype: int """ return self.db.hlen(self.proxy_key) def remove(self, name): """ 删除代理 :param str name: 主机名称 :return: 删除结果 :rtype: int """ return self.db.hdel(self.proxy_key, name) def names(self): """ 获取主机名称列表 :return: 名称列表 :rtype: list """ return self.db.hkeys(self.proxy_key) def proxies(self): """ 获取代理列表 :return: 代理列表 :rtype: list """ return self.db.hvals(self.proxy_key) def random(self): """ 随机获取代理 :return: 代理 :rtype: str """ proxies = self.proxies() return random.choice(proxies) def all(self): """ 获取所有 主机:代理 键值对 :return: 所有代理 :rtype: dict """ return self.db.hgetall(self.proxy_key) if __name__ == '__main__': rc = MyRedisClient() # p = rc.set('2', "153.35.238.242") p = rc.names() # p = rc.get('1') print(p, type(p))
{"/proxy/adsl/dial.py": ["/proxy/dbConnect.py"], "/txhk/core.py": ["/txhk/gap.py"]}
40,574
loyalist16/components
refs/heads/master
/proxy/setting.py
# -*- coding: utf-8 -*- # @Time : 2021/1/29 9:36 # @Author : loyalist # @Email : lzl0118@foxmail.com # @File : setting.py # @Desc : 配置文件, 存储一些私密信息 # Redis 数据库 IP REDIS_HOST = 'localhost' # Redis 数据库密码,如无则填 None REDIS_PASSWORD = None # Redis 数据库端口 REDIS_PORT = 6379 # 代理池键名 PROXY_KEY = 'adsl'
{"/proxy/adsl/dial.py": ["/proxy/dbConnect.py"], "/txhk/core.py": ["/txhk/gap.py"]}
40,575
loyalist16/components
refs/heads/master
/txhk/gap.py
# -*- coding: utf-8 -*- # @Time : 2021/3/11 16:22 # @Author : loyalist # @Email : lzl0118@foxmail.com # @File : gap.py # @Desc : 获取到缺口所在位置的左边距 from PIL import Image def get_pixel_list(file_path): """ 获取图片像素列表 :param file_path: 文件路径 :return: 图片像素列表 """ img = Image.open(file_path) img = img.convert('RGBA') return img.load() def is_pixel_equal(img1_list, img2_list, x, y): """ 判断两张图相同坐标处像素是否相同 :param PixelAccess img1: 图片1的像素列表 :param PixelAccess img2: 图片2的像素列表 :param int x: 横坐标 :param int y: 纵坐标 :return: bool :rtype: bool """ pixel1 = img1_list[x, y] pixel2 = img2_list[x, y] threshold = 45 if abs(pixel1[0] - pixel2[0]) < threshold and abs(pixel1[1] - pixel2[1]) < threshold and abs( pixel1[2] - pixel2[2]) < threshold: return True else: return False def get_left_offset(img1, img2): """ 获取图片左边偏移量 :param img1: 全图 :param img2: 缺口图 :return: 缺口左边距离 """ left = 60 top = 30 img1_list = img1.load() img2_list = img2.load() for x in range(left, img1.size[0]): for y in range(top, img1.size[1]): if not is_pixel_equal(img1_list, img2_list, x, y): # 判断右边是否为白边 right_pixel = img2.load()[x + 1, y] if right_pixel[0] > 200 and right_pixel[1] > 200 and right_pixel[2] > 200: left = x + 1 return left if __name__ == '__main__': img1 = Image.open('full_img/penguin.png').convert('RGBA') img2 = Image.open('cap_union_new_getcapbysig (2).jpg').convert('RGBA') left = get_left_offset(img1, img2) print(left)
{"/proxy/adsl/dial.py": ["/proxy/dbConnect.py"], "/txhk/core.py": ["/txhk/gap.py"]}
40,576
loyalist16/components
refs/heads/master
/ttf_ocr/run.py
# -*- coding: utf-8 -*- # @Time : 2021/3/1 17:35 # @Author : loyalist # @Email : lzl0118@foxmail.com # @File : run.py # @Desc : 识别图片中的文字 from baidu_ocr import accurate_ocr from ttf2img import ttf2img from loguru import logger def get_fontMap(fontPath): """ 获取 编码:字符 映射表 :param str fontPath: 字体文件路径 :return: 字体映射 或者 ocr识别有缺漏,则返回code_list和识别后的字体列表, 核实完后手动dict(zip())生成映射 :rtype: dict|tuple """ code_list, img_name = ttf2img(fontPath=fontPath) result = accurate_ocr(img_name) print(result) words_result = [words.get('words') for words in result.get('words_result')] words = ''.join(words_result) words_list = list(words) if len(words_list) == len(code_list): font_map = dict(zip(code_list, words_list)) print(font_map) return font_map else: error_words = min(words_result, key=len) line = words_result.index(error_words) + 1 logger.error("第{}行, 字体有缺漏, 请核对 `{}` ", line, error_words) return code_list, words_list if __name__ == '__main__': get_fontMap('4165b8d8.woff')
{"/proxy/adsl/dial.py": ["/proxy/dbConnect.py"], "/txhk/core.py": ["/txhk/gap.py"]}
40,577
loyalist16/components
refs/heads/master
/proxy/adsl/dial.py
# -*- coding: utf-8 -*- # @Time : 2021/1/29 10:20 # @Author : loyalist # @Email : lzl0118@foxmail.com # @File : dial.py # @Desc : 定时拨号, 在服务器上运行 import re import subprocess import time import requests from proxy.dbConnect import MyRedisClient from requests.exceptions import ConnectionError, ReadTimeout # 拨号网卡 ADSL_IFNAME = 'ppp0' # 测试 URL TEST_URL = 'https://www.baidu.com' # 测试超时时间 TEST_TIMEOUT = 20 # 拨号间隔 ADSL_CYCLE = 100 # 拨号出错重试间隔 ADSL_ERROR_CYCLE = 5 # ADSL 命令 ADSL_BASH = 'adsl-stop;adsl-start' # 代理运行端口 PROXY_PORT = 8888 # 客户端唯一标识 CLIENT_NAME = 'adsl1' class Sender(): def get_ip(self, ifname=ADSL_IFNAME): """ 获取本机 IP :param str ifname: 网卡名称 :return: """ (status, output) = subprocess.getstatusoutput('ifconfig') if status == 0: pattern = re.compile(ifname + '.*?inet addr:(\d+\.\d+\.\d+\.\d+)?', re.S) result = re.search(pattern, output) if result: ip = result.group(1) return ip def test_proxy(self, proxy): """ 测试代理 :param proxy: 代理 :return: 测试结果 """ try: response = requests.get(TEST_URL, proxies={ 'http': 'http://' + proxy, 'https': 'https://' + proxy }, timeout=TEST_TIMEOUT) if response.status_code == 200: return True except (ConnectionError, ReadTimeout): return False def remove_proxy(self): """ 移除代理 :return: None """ self.redis = MyRedisClient() self.redis.remove(CLIENT_NAME) print('Successfully Removed Proxy') def set_proxy(self, proxy): """ 设置代理 :param str proxy: 代理 :return: None """ self.redis = MyRedisClient() if self.redis.set(CLIENT_NAME, proxy): print('Successfully Set Proxy', proxy) def adsl(self): """ 拨号主进程 :return: None """ while True: print('ADSL Start, Remove Proxy, Please wait') self.remove_proxy() (status, output) = subprocess.getstatusoutput(ADSL_BASH) if status == 0: print('ADSL Successfully') ip = self.get_ip() if ip: print('Now IP', ip) print('Testing Proxy, Please Wait') proxy = '{ip}:{port}'.format(ip=ip, port=PROXY_PORT) if self.test_proxy(proxy): print('Valid Proxy') self.set_proxy(proxy) print('Sleeping') time.sleep(ADSL_CYCLE) else: print('Invalid Proxy') else: print('Get IP Failed, Re Dialing') time.sleep(ADSL_ERROR_CYCLE) else: print('ADSL Failed, Please Check') time.sleep(ADSL_ERROR_CYCLE) def run(): sender = Sender() sender.adsl() if __name__ == '__main__': run()
{"/proxy/adsl/dial.py": ["/proxy/dbConnect.py"], "/txhk/core.py": ["/txhk/gap.py"]}
40,578
loyalist16/components
refs/heads/master
/ttf_ocr/ttf2img.py
# -*- coding: utf-8 -*- # @Time : 2021/2/23 11:00 # @Author : loyalist # @Email : lzl0118@foxmail.com # @File : ttf2img.py # @Desc : 将ttf文件转为图片 from PIL import Image, ImageDraw, ImageFont from fontTools.ttLib import TTFont import numpy def ttf2img(fontPath): """ 字体文件转换为图片 :param str fontPath: 字体文件路径 :return: 编码列表, 图片路径名字 :rtype: tuple """ im = Image.new('RGB', (1800, 1000), (255, 255, 255)) dr = ImageDraw.Draw(im) font = ImageFont.truetype(fontPath, 40) tt_font = TTFont(fontPath) code_list = tt_font.getGlyphOrder()[2:] array_list = numpy.array_split(code_list, 15) for i in range(15): newList = [j.replace("uni", "\\u") for j in array_list[i]] text = "".join(newList) text = text.encode('utf-8').decode('unicode_escape') dr.text((0, 50 * i), text, font=font, fill="#000000") font_imgName = "font.jpg" im.save(font_imgName) return code_list, font_imgName if __name__ == '__main__': ttf2img('4165b8d8.woff')
{"/proxy/adsl/dial.py": ["/proxy/dbConnect.py"], "/txhk/core.py": ["/txhk/gap.py"]}
40,579
loyalist16/components
refs/heads/master
/txhk/core.py
# -*- coding: utf-8 -*- # @Time : 2021/2/3 13:33 # @Author : loyalist # @Email : lzl0118@foxmail.com # @File : core.py # @Desc : 腾讯滑块破解 import base64 import requests import re import time import warnings import execjs from urllib.parse import quote from txhk.gap import get_left_offset from PIL import Image warnings.filterwarnings('ignore') class Txhk: def __init__(self, ua, aid, refer_url, app_version): """ 初始化 :param ua: User-Agent :param aid: 滑块使用者aid :param refer_url: 来源url :param app_version: navigator.appVersion值 """ self._ua = ua self.aid = aid self.refer_url = refer_url self.app_version = app_version @property def ua(self): return base64.b64encode(self._ua.encode()).decode() def initCaptcha(self): """ 初始化验证 获取sess, sid :param str aid: 用户id :param str ua: ua :return: 结果 :rtype: dict """ url = "https://t.captcha.qq.com/cap_union_prehandle" params = { 'aid': self.aid, 'protocol': 'https', 'accver': '1', 'showtype': 'popup', 'ua': self.ua, 'noheader': '1', 'fb': '1', 'enableDarkMode': '0', 'grayscale': '1', 'clientype': '2', 'lang': 'zh-CN', 'subsid': '1', 'callback': '_aq_716998' } headers = { 'Host': 't.captcha.qq.com', 'sec-ch-ua': '"Chromium";v="88", "Google Chrome";v="88", ";Not A Brand";v="99"', 'sec-ch-ua-mobile': '?0', 'User-Agent': self._ua, 'Accept': '*/*', 'Sec-Fetch-Site': 'cross-site', 'Sec-Fetch-Mode': 'no-cors', 'Sec-Fetch-Dest': 'script', 'Referer': self.refer_url, # 根据不同程序改变 'Accept-Language': 'zh-CN,zh-TW;q=0.9,zh;q=0.8,en-US;q=0.7,en;q=0.6' } response = requests.get(url, headers=headers, params=params, verify=False) s = re.search('_aq_716998\((.*)\)', response.text).group(1) result = eval(s) # {"state":1,"ticket":"","capclass":"1","subcapclass":"15","src_1":"cap_union_new_show","src_2":"template/new_placeholder.html","src_3":"template/new_slide_placeholder.html","sess":"s0On0zvlytShIM4z6GoUJV5m0WYGy0Dj1O4bOxPpmlARN9P7uJNkP5UADIPDMQtEcA3uwzHdf_zq9Z4BSw8tM3NTTM9H5lA1MTdRSrbfCNsUx5rKJak4b2Zorv1zVNQZfwkEbTcSwuoEjzIFvyjZ0K_yjVY0YwceLjkN4O0SierPzIJ-BWI0uaWxoWCv1dY7w0E8cnx24D1Ek*","randstr":"","sid":"6762554139436920832"} return result def showCaptcha(self, sess, sid): """ 验证码显示页面, 获取验证码id :param str sess: initCaptcha 生成 :param str sid: initCaptcha 生成 :return: 请求url, nonce, tdc_url :rtype: (str, str, str) """ self.rnd = '535739' self.createIframeStart = f'{int(time.time() * 1000)}' self.prehandleLoadTime = '273' url = "https://t.captcha.qq.com/cap_union_new_show" params = { 'aid': self.aid, 'protocol': 'https', 'accver': '1', 'showtype': 'popup', 'ua': self.ua, 'noheader': '1', 'fb': '1', 'enableDarkMode': '0', 'grayscale': '1', 'clientype': '2', 'sess': sess, 'fwidth': '0', 'sid': sid, 'forcestyle': 'undefined', 'tcScale': '1', 'rnd': self.rnd, 'TCapIframeLoadTime': 'undefined', 'prehandleLoadTime': self.prehandleLoadTime, 'createIframeStart': self.createIframeStart, 'subsid': '2' } headers = { 'Host': 't.captcha.qq.com', 'sec-ch-ua': '"Chromium";v="88", "Google Chrome";v="88", ";Not A Brand";v="99"', 'sec-ch-ua-mobile': '?0', 'Upgrade-Insecure-Requests': '1', 'User-Agent': self._ua, 'Accept': 'text/html,application/xhtml+xml,application/xml;q=0.9,image/avif,image/webp,image/apng,*/*;q=0.8,application/signed-exchange;v=b3;q=0.9', 'Sec-Fetch-Site': 'cross-site', 'Sec-Fetch-Mode': 'navigate', 'Sec-Fetch-Dest': 'iframe', 'Referer': self.refer_url, 'Accept-Language': 'zh-CN,zh-TW;q=0.9,zh;q=0.8,en-US;q=0.7,en;q=0.6' } response = requests.get(url, headers=headers, params=params, verify=False) # img_id = re.search('image=(\d+)?', response.text).group(1) nonce = re.search('nonce:"(.*?)"', response.text).group(1) tdc_url = re.search('dcFileName:"(.*?)"', response.text).group(1) return response.request.url, nonce, tdc_url def resetSess(self, sess, sid, show_url): """ 重置sess, 并获取初始滑动位置 :param str sess: initCaptcha 生成 :param str sid: initCaptcha 生成 :param str show_url: 验证码显示页面url :return: 结果 :rtype: dict """ url = "https://t.captcha.qq.com/cap_union_new_getsig" payload = f"aid={self.aid}&protocol=https&accver=1&showtype=popup&ua={quote(self.ua)}" \ f"&noheader=1&fb=1&enableDarkMode=0&grayscale=1&clientype=2&sess={sess}&fwidth=0&sid={sid}&forcestyle=undefined" \ f"&wxLang=&tcScale=1&uid=&cap_cd=&rnd={self.rnd}&TCapIframeLoadTime=undefined&prehandleLoadTime={self.prehandleLoadTime}&" \ f"createIframeStart={self.createIframeStart}&subsid=2&rand=99947704" headers = { 'Host': 't.captcha.qq.com', 'sec-ch-ua': '"Chromium";v="88", "Google Chrome";v="88", ";Not A Brand";v="99"', 'Accept': 'application/json, text/javascript, */*; q=0.01', 'X-Requested-With': 'XMLHttpRequest', 'sec-ch-ua-mobile': '?0', 'User-Agent': self._ua, 'Content-Type': 'application/x-www-form-urlencoded; charset=UTF-8', 'Origin': 'https://t.captcha.qq.com', 'Sec-Fetch-Site': 'same-origin', 'Sec-Fetch-Mode': 'cors', 'Sec-Fetch-Dest': 'empty', 'Referer': show_url, 'Accept-Language': 'zh-CN,zh-TW;q=0.9,zh;q=0.8,en-US;q=0.7,en;q=0.6' } response = requests.request("POST", url, headers=headers, data=payload, verify=False) # {'ret': '0', 'sess': 's0RtRP3ArZ4B7NVpRRZnCjofZ7RDj0qBLHRme1xLyGllMt5ElSEollN9UD41KZcP9fdtyVDWfuUeXpyyJ14kI0g55UPi9srdReuc9GOFWwe4EvAwJtMoe_jwi2-81TEelOA3ERgbepgmobOrK-ckUaQUcNP5EeC0Gcj51wTN2BfPDikyvKdQtjNRKKUS4Exfjb7ojieTJsBb6YUZXYhI7R4_vfU8ejqRFpdQbMA8pIIbY*', 'cdnPic1': '/hycdn?index=1&image=937032639779710976', 'cdnPic2': '/hycdn?index=2&image=937032639779710976', 'initx': '68', 'inity': '66'} return response.json() def loadImage(self, sess, sid, show_url): """ 下载验证码图片 :param sess: resetSess生成 :param sid: initCaptcha生成 :param referer: 验证码显示页面url :return: None """ # 缺口图片 url1 = f"https://t.captcha.qq.com/cap_union_new_getcapbysig?aid={self.aid}&" \ f"sess={sess}&sid={sid}&img_index=1&subsid=7" headers = { 'Host': 't.captcha.qq.com', 'Connection': 'keep-alive', 'sec-ch-ua': '"Chromium";v="88", "Google Chrome";v="88", ";Not A Brand";v="99"', 'sec-ch-ua-mobile': '?0', 'User-Agent': self._ua, 'Accept': 'image/avif,image/webp,image/apng,image/svg+xml,image/*,*/*;q=0.8', 'Sec-Fetch-Site': 'same-origin', 'Sec-Fetch-Mode': 'no-cors', 'Sec-Fetch-Dest': 'image', 'Referer': show_url, 'Accept-Language': 'zh-CN,zh-TW;q=0.9,zh;q=0.8,en-US;q=0.7,en;q=0.6' } response = requests.request("GET", url1, headers=headers, verify=False) with open('topic7_1.png', 'wb') as f: f.write(response.content) # 小图片 url2 = f"https://t.captcha.qq.com/cap_union_new_getcapbysig?aid={self.aid}&" \ f"sess={sess}&sid={sid}&img_index=2&subsid=8" response = requests.request("GET", url2, headers=headers, verify=False) with open('topic7_2.png', 'wb') as f: f.write(response.content) # 完整图片 url3 = f"https://t.captcha.qq.com/cap_union_new_getcapbysig?aid={self.aid}&" \ f"sess={sess}&sid={sid}&img_index=0&subsid=9" response = requests.request("GET", url3, headers=headers, verify=False) with open('topic7_0.png', 'wb') as f: f.write(response.content) def get_tdc_js(self, tdc_url, show_url): """ 获取到tdc_js文件 :param str tdc_url: tdc文件url :param show_url: 验证码展示窗口url :return: tdc_js文件内容 :rtype: str """ url = "https://t.captcha.qq.com/" + tdc_url payload = {} headers = { 'Host': 't.captcha.qq.com', 'sec-ch-ua': '"Chromium";v="88", "Google Chrome";v="88", ";Not A Brand";v="99"', 'sec-ch-ua-mobile': '?0', 'User-Agent': self._ua, 'Accept': '*/*', 'Sec-Fetch-Site': 'same-origin', 'Sec-Fetch-Mode': 'no-cors', 'Sec-Fetch-Dest': 'script', 'Referer': show_url, 'Accept-Language': 'zh-CN,zh-TW;q=0.9,zh;q=0.8,en-US;q=0.7,en;q=0.6' } response = requests.request("GET", url, headers=headers, data=payload, verify=False) return response.text def get_collect(self, tdc, location_href, start_pos, end_pos): """ 获取加密参数collect :param str tdc: 动态tdc文件 :param str location_href: 验证码的展示链接 :param list start_pos: 滑块开始滑动坐标 :param list end_pos: 滑块结束滑动坐标 :return: collect参数 :rtype: str """ jscode = """const {JSDOM} = require('jsdom'); // 重写require库, 过fs检测 var ori_require = require; require = function (v) { console.log("重写require", v); if (v === 'fs') { return false; } else { return ori_require(v); } } """ jscode += "const dom = new JSDOM('', {url: '%s',referrer: '%s',contentType: 'text/html',includeNodeLocations: true,storageQuota: 10000000})" % ( location_href, self.refer_url) jscode += """ // 加载 dom.window.dispatchEvent(new dom.window.Event('load')); // window设为全局 var window = global; delete process.cwd;; window.addEventListener = function (event, callback, flag) { dom.window.addEventListener(event, callback, flag); } window.location = dom.window.location; window.WebGLRenderingContext = function () { } WebGLRenderingContext.toString = function () { return "function WebGLRenderingContext() { [native code] }"; } document = dom.window.document; """ jscode += """// navigator navigator = dom.window.navigator; Object.defineProperties(navigator, { appVersion: {value: "%s"}, platform: {value: "Win32"}, languages: {value: ["zh-CN", "zh-TW", "zh", "en-US", "en"]}, userAgent: {value: "%s"}, plugins: {value: [{name: "Chrome PDF Plugin"}, {name: "Chrome PDF Plugin"}, {name: "Chrome PDF Viewer"}]}, }) """ % (self.app_version, self._ua) jscode += """navigator.getBattery = function () { let num = 0.6; return new Promise((resolve, reject) => { }) } // plugins: [{name: "Chrome PDF Plugin"}, {name: "Chrome PDF Plugin"}, {name: "Chrome PDF Viewer"}], window.innerWidth = 360; window.innerHeight = 360; screen = dom.window.screen; Object.defineProperties(screen, { availHeight: {value: 1040}, availLeft: {value: 1920}, availTop: {value: 0}, availWidth: {value: 1920}, colorDepth: {value: 24}, height: {value: 1080}, pixelDepth: {value: 24}, width: {value: 1920}, orientation: { value: { angle: 0, onchange: null, type: "landscape-primary" } } }) // canvas dom.window.HTMLCanvasElement.prototype.toDataURL = function () { return "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAMgAAADICAYAAACtWK6eAAAgAElEQVR4Xu2dCZgU1bn3f2dm2BFRUFAQBQU1GlFjjKKoMcYNl2gSzKJe4wIuNyYmMeaquZpEvXrNouZGCSrXm2i+iNkNJHFf0KhRiQoqKCICCrJFGNmZ+p5/dZ2emp7q6aru6pqunjrPM8/MdJ/lrfecf73Lec97DDVeHJwhwEeBPYHdgGHADsBAYOci5C8AlgPvAfp7HvAa8IrBLLZtHJw+wEeAvXy/twF6AT293/rb/qjpuoKf9d7/q4DZwKv2t8F8mKfPifc5MK3PUeNTmGryTK1R7+AICJ8CxgIHAzvFTOMaoBnoAWwbc9/57oTGaf1Y+bc92PDCQfRddQRbuU8kWMdTFgJ/B54EHsYYDRmqOBNwQlWss0pmMpHXe+QG1eCZg3MQcApwoicpqjFM1ft8Bvg9cL8nrgIH3Bc4BBjjvQLig78AoqF/jzEipWjJABJ+KXQaQBwcvUvPAs4B9ghL8gXMYBKvsgf9uYqP8UUe5q8czzEMDdtFpHoaT+U2DuVDNjOehxhGX/d/FelxdwF3Aq9H6tmrrFfDOOAkYB9fB7MXwZRH4JJxMHRA1J5Fiki6C2NEYms5b/Jtx5tXzp/KZPqwIWq/gfUv4Mu8w7bE2WcshBV0Ep8EOff2QTS0PNZm4TrmWG6f8LdKCXdwZE9cBEyM2tctzOI2XuUxTmQQvfgbiziW6Z0CkAs5lJ8BP4/6EB3VP9qToZKjzRUBxD+KSPwZxrzifpgBJNKMtZcgE35+MXAzhYA4b/JtwB/KBYmDo/fjpcDpkSj0Vdbb/B2amcpR9KGp3G4itSuUIMfxEEvpy1xPgkTqLGxluQcOXwQNj8Ct42CXyBIkaKS7gRuZcPsFXVqCnPGLPvRcPxV4h9snXFBqStoC5LzJx2CcuzHOUfz8/JdKNQ7zvYOzHXCVJzXCNClapzMB8n0O5Uo2M5mHgL5QTYC4HFgEPAK7j4NzB+SU0TgM/Fv+Muuo2X/Z+w9dVcUqGyC2oXH+xuSJtwSu0qDOrTrmmMfyiPQ+u3bagY8c9+7QM492pve9kYO4gX/yOv9yu5bdsC8DOIL785/dzBguZu92Qy9lXZt6qnA+H+F89uQopnE3R+ZtEGsnTOedfD/+fv12hCrInrHfv8QKt7/lyHObG0NlFvAyh7KazZAHSH/gaW8MvfJlSNg3va1naSj83lv8HOn1keNJznK3z2/reP3usAKGTYOP94RrT4R+8jwXlNXr4Ef3wxKvv72Hwa6DYN5SmHAU9GiCe2bQ9MRUvs9dzOAshrGS27gn39GH9GA8EziG2RzOXI7iEiZxD1M4hOkebcczq429YW2Qs3mKz3ma80CaeYifMNoFOrzEULev5e7LRfN/iztGYQmyZyxNflpv4Ui+xmn55rY/O87neDH/XL6x7wM+2eZV45hJRSXJxEmjWyXIxEmjccxDOOb0DtUoqWCOOYb1PcfzyzM/xLaTvdrScAR3nLf0ov2fPOWJxUumPLh0XP8lrHUX3UB65m0H2RJf42n3s4cYx2gGoM9+wIv5/4MAWihB7IK2ALFAOoId80Z04Wd+APmNe9vXd9k/D9LLmcV/uSAQUGSU+xe+fzHLkH/LB5K5HlgsYPT9u56BoYWtRTMdEMhkcOgzwfBFXx9+gPT2HFT9oO9RcFYTnA3s5+OSBceoHeHLOQcCMvRvmQ4Cig8gPCENYzJ7cAgbOJy/8yMGsdpt8jf24nTOdhe3iha1il3sS+nHEXyTESzPg0SLehKHcT5PuIvSLmi1k+HeTA+3zQU8zsWSiq73YAyf54V2jgL/+H5wncYE7mWyC7hCEKnNsVycB11hH7b+9HUfz6EzjIrlretCgNyLcU7rUL3KNWytZwFjnP4Y50Ln5xMPutnMuvUBZ1GDbIU3+aDdWz5oMdqFfBNjinqkSgGk0Ii3y0fG/Ok84oJvN7Z2PVG5yWu1ZQr7lmV7EZvZ0kalsgDJLR3ydpD2DuVhFZDaS0BY4W5V5LZ3BJoC6eBSU9iHrXMMMNN7FN+Y2uL8jvcjc+yRWfD4q/DNAulyzwxY2RwIEJD2ewkXM4Wbvbe5FpOKFrp9836XafmFXQiioAVbDGh3MyVQavhfhhaAfjBJWmjRC2xvsh1+sKhtoYTxA1RS7UpO5jF+xODJqw1hVayczT0sOkD8qti6Xnd6aJwCnH3Jn/bu/+OlB4/RYtuT/u6buPAtrwcKAoP97AI+EqhmqV0pgPgNaj/T/TQcyuB2rlorVeQqFs0TgNvzHeTcvG0liFzKfiD4VS/v7e26h7Wp7i/Hg+uOjgIQqWf9CgDp61NuYgGl2aPTSg9bRcCRJAmQILhu3hwgzuMefuBJh5uY6i5kAaRwMaquBY5d8EFqkf8tvhvLXLVNKlqhelbAIPdfPyD0v1X5JH2stAhqZyWYn0apdFb9ct28YQDiW+OtAGl17d5W1AaxVOXQBY65GuNM+eGTB/1n8+KN9z63ZtmuP2UMZ/Aot3KoqzqlCSAHMpSH2dvdmm4tUQHyMU+aqAerPkmCTAPX5ogCEKlh24Or/vhtnIDl8ckZueEusQD16pQEiKJsxgM/Ym92Yh3jecpTueICSJAd0hFQ/OMuYWu+znhXAkgNFED8/wcBRZ9ZSfQ6g2MCiPsamXwbxjnC2hLFBifn7boJx9ww4u2tTpr34Bf2f4kVO1/IDP6Tj/F/zOV2DnNdsUkCpCMV6+s87dpAfekWKEGO5iFeoS9r2ninrNqzY4EEKfRi+QEgrknP9i9oa3OUI0HUjzbJ/TZO0MzMgK2b4aqj4BLPBb5hM0zOqZPFJYik0zddhRP2ZRveYzqPIMFUKCnsqHrD38bh+UVbSoJYgNj2QXaG/4n8joLX3LC7nMoXJL2KrVGrKu7Je3laQ6tYPinT1s3bKloObOfq9e+D5KTN7/q+3W3Ybx749FCpJlZNWcl69mVg3khOEiAdGelWdQvaDX8AOCZvOBca31KTgox0u9iteqW3vF7hawukhQWZPEvlAmRrz3v2fgeSxIJ0RM5I/29t7c+Ce58uaqTnVCwVSTZJEjkLfuWqgNoRHuR5nuSRsm/wILukFEA0wkyGcZbn9SsFENVXne8zjv6s4zp+n/eGWfC8xcA8Tap/GafyJZ5z6wnAP2Cc61iw6p08YJMm35Nb7559kXc0BaEsJwT+Ghxq4n3Zpl3BxuFeh9w3fctTLcfZXW3Vtd6pIO+Q3xVbLRtENAS5ef30FAJEis8J+Qe1b3r7gRb0294/fi9Wd2Cju9eUKwow9hvt8khZF7A8VQKdpEpUFcsvifweNAu0wpm1IFkPikn+1hhcUdChDaI+pPbJW6VnnYwFzk8Zyve4hBv5LTdwDFJXVG7m3jZGeymAWENeni6VQhdw0PoM8pb561nPmf3M2hnWRvHT6LNbvuaaD62e14F05OY9b/IxZcViOTgKiqg47KSYeAz7uaTTaTzMvXzKtXeilpzkqPPy+Rkw1ufF0uNOLJx2v5rl35sYSj8uYWoI71MauBhfLFYHT+tF3irMutOL3LfWtlBsVpSicFfF0td38aSO3P+/PhRGeE/bDiCthnrOIWBLTrLcxBS+FrCplzbeVR0gDo4OKD3ewUGlxHgWZEuEHVwnqA73TlKFbVP79aReKTpIaoyNU/NtYO45ANfO1eZiG4DoWIwc25IcuU28QoBszxSeY3bR02m1z5schUkA5AnvFEOn8cQfdnI8w8oKXNQSauvK7bTHiXngQhvKv1PveYz/oG1sq2JpD0Tc0LS2hpsUAgSmMJbZbq00l6oCxMGR9XZemhkk2ttuAqb9acqk/wQD8lxHLJp8LYK0lqoBxMHR2Y1JaWWMpVvhI+en/SFiod/AceUdZtYiiHyQJxaaK++kKgBxcLQJ8DLQWDmJndeDdjN0IGVL55FQeyMrZvurkcmS5T8aYwrjaCJ3lIYGJd28Do7cuXLrprrInSu3blYKOHAtcHlkrjyAMXXvIRdXOgSIg/PvwE8js6/GGvxPWS/KGnuIapJzM6BzpNHKVzFGrK3rUhQg3knAN71Q0tQyYZmXTMvv3U/tw1STcKV40BmT8EUs3Q1jxOK6LR0BRG8HJVdIdZEIVHKFrITgwL1eYG+Iql4VJYMQi+u2BALES7AQy5n0zuScPAujO5OAtI2tiJM/ebuo4WmXwS5W12UpBpBfVpJ9pFY4dQagVB5ZicCBUcBfaA1LKd30bowRq+uytAOIl7eqzRthAx+ymiVsoJkt7rlsWfeGRrrTh23YikE0JpSGJ+wsKAmUPw9buHbKyKndaIVtWIewzrZ2AzfZhM6B7B6uq6rVmuNlTlVw5i7eKIrCFc0x0fdZ4DeRHmCffN6tgGZnPcfgpkaGtDTRPGU0eoBEy/kz2WVzCwPKGT8IIPm9oC1sYgVvs84XwNZAowuOFlpwaHEftIEmBjCM3m6MdW0UbQhGT+qmvNZLvAdocJ8st+i0BRTjAqyIRQkARPRdA1wRmtCfY0zRPdi6AYiXDtT1SmxhI+/zJhtZh6GBfmzP1uzg/m3LWv7FKhaymY000o3tGEEPL61LaNZWoaJybSodQfRi38RSxkdGb55Ii4QAomf5s3c+K9xzbdcuzanXrp4A8i03+x6wjHkIAFr4AxlOT7YKZNNG1rpAkrTpQR8GMaoNiMLxNt5aP/RSOEbv1QLEr75E76W6LRIEiGIoHiRs3NalGCPWtyv1BBAdft5DtoYWfQtb2JrB9EdXdBQvq1hMM8voTm8GsDNreJ/VvE8vV+60fRN/yEpWsMBVz/TtNgW3G7zPG65KZ79bwhzX9hEN3enFSldi5Y6KCrySaluxnQvQlbzjtj2SFua5kk5HVXXar1SaUguMwmdUO9Gvo67FVCydLFTOqw+8vFnqQ+0USSu+FY5tF7iiBXU8V+1UdJ5FNoV+yxbS1SaShZu8/VzlxtKz6NYD3d5QzAbRmDrpqOR36kf2k1Iy6mx3kE9G2xlSK0WLtbtUT9lUBsGXB7T1dGyYA1uaodsQaOgFmxZDy3oanfVvn/3qIae0NLFq3gcsfuyTnrGqDOVFbJCrZ9N90Xp2BXo3OGxc1423fjma1jtVii05B3P2THZocNwH0wPiNLGhcRNLNrbQVGjvFNogZ82nZ9NK5I7o1r0ni2/dK69X50ec8Dy9TQMj8xzzH4SS2qQFLsNbC1wLP0qxIFB7SZQm9yqOXLF962+pY4N9Ru8m1rOUuS4wJbV60x8LEEknSSsVqXkCmIPj2kP9GMxaVqH2L9HIye7CyNlHuJJP9+60qobtn0ULSvffqI1+rP0h20Pzt7QIQNRGbXOOi9ZwNbvQNHc6pZTLV5YrFiD22K7GEL3ikeZMY2t/VteYqOh/TZP6VH/6Xy+IIIAIjOpLdW2/HfFBINSP2mgM28YPlB3glh1aY7YsQBr6QIvmQ21z7fZaNfUrBy+9Xv6RtW+u5g0LkiCAHPEoTSP6smtDA32jgONqh4bFz7Gb05RTaZwWWhocHKeRRv3W2C2GPn6DPMhIn/A8u7YY+re00Dzl4+0dBxfOZvDG9QzxA+QG4Nsa1C5KAUML2G93tF9c7T+R/bKEue5bXRKlj++emiW8jrxiKk10bwOgZpa7UkCAErAkISwtOUD1YSAj3HbypknaCDQCiXxqGut79HfzFYAMbi1sLSgt8mAVsS31xVSsIC+R3tBveGfT9bbV218eLxW94ef7vnNfVgUAEesHeVJGX9lFLcDJDBTdkjKqU9in/g8CiD7XOJI0kmAq4oEknIAiy0zf2f4ERPu5Tg/a5SAA6lIuJZzoCTuOgie75bBuAeJitw/0GAFGYIde62bdesarH71TJDTAokmjXdHbToK4i/wldnO2uJOyqftq3rr1ky7TSpbz/8mQzVsYLGCYLbx7x0HuA3LGS/TpvpHhpiH3Ni4FkIueZcDaRnbu3sAWp4U3Jh/gvX0B0ffuC4wS0PwAUXTmnlp4eotvYl2gilTyCbwK1obxq1FWQqhKDuySkcPp5apCUmLeppkVrjdMBr+KBYjAMoiRdPMdrV3NUlaxyIWHVLB+DHLzj+SuWtICVgpQvd01+covVapEAYj1eOmtLQllwWHHkATQItMClNpjF7qVIAKVHzhqJ3VNNGuBKkFCoWorV7OApz6DACJQ6dBn4cVZllYrpbSgpVbpR3+LjkJVUOqdwCrpMBLO6+3lc/BULNMNeozMqVn50vL6uS82niqVyTEsv3N/9/q7NgAZtg9v+CRAJHBIJVu4mVFmMz2aGlkyaV/3LZgvZ7/OVo2r2VXSpBRAJjxPN6eJUc4Wem7cwJJfjGnt68LZ9N30oTupuVeGd+2ZG76st34OIOvpywAG5H3tpRZX2+9lh2jxakFbKWRVr570ddUoSZJt3IU92JUIGncz69nWvaIml8q8VcVqq47pO9tfAw2uKjiP3l66aX0r3V2LTUDRQstl5Oi4RAGI7qiRJNSbWhIqqEjCSMf3e8UsQIL2LKSyiQZNi2yfQtAJGGov1SYIIFKFtU9TqE6KTtGil5IkXRh3/ErvULL6Ei29dfkFHOsBpKEv9Gy/J/TRRZeP+8T7/7W0qYEVk/bLpYSxKlaDw4ctmvYmF8GRwKF+LniZbTZuYJemRloK3/qW+xNnMnJLC/1KAUT1JzzPsBbDdqJrx48x92rtXgBnPs2Q7j0YLPXLAiQftSvdXotSqkuQkV1qidnvJYGWepNi7Rhrf/RnR9c1LJVKdsZ27Mo6PmA58111TupVN9dIbAVIEFgLATKZ3r7jDdUESNi+ZVBLy9Bb1r6lg7xQlmvSFrRRGSRdbB1JEC3eIIBo3Q0PmKIw9Epq6UeajqSf1CupfdZR0TuXQuihOWCaoWkAdLcbla1D9m9+9KrPzT1yWhBA/ISZBraYLcyffEDeS1FyaVmgmUbWm83MnXyA+xZsU855kZ2Nw8AwADlrJv0bNzNctku3Prx56140S71a9CK7NzTRq2Udiy1A2oSpWU9SuTaIpTgHNEmJoa5E0P/yQEmt0m9JGGtvSOJ8wJJ2oLQSJAxAzqC3mx8wV8IsikL2hpUgYfuWCiMtwL/gOwJIUP0wNJZyTxejV5JF9AkUhfd6amnoMx9ARMrVc+DS4gDpvv6VaWe+us9VxQDSYtjc0kJLk3F1u7VD92eOfXOXQkgYgAQ5BIrtpMtRMHxrRjU69LJq1oTn2dppZLhsnM3bMtcCRMpm/jpJhZXIdRvWiyVpI5tDdoJsAbtnoj7Ul6SEPpcKpZ14SQhJEAFRRRJGYJE716pcfpDp8zAA2Y3erhO0dgBiJYhf9QkjQfy2QhSAhJEgssdkDwkUSmcq8EiNsrdei1bZzpIgMiF8KpZI6TMHHmyGjwVLELPhzXfPmT3ypCIA2dTSh/lNzTR4i7AxyJYoBpQwALnwFXbauJHtw0gQjWPVKatmvT+LIWrf4PCvyQcwz3j3kOduOfFK1H2Qf7HYfftr8fuN7vWsyQNHEkT1BB4Bwm9zyLiWca43VqFbOawE2cxI1zHcWsK+5f1PHlaCqI1d6OXaIEGbkdoTkQqlUszzZm2fIBVLNkvQfajWYeC3Qax9JGDIxsh5olpLgA3ifjkHJjbDLcEAYePbHL7w4uP3XHP/a4U2iH/RnvV3dmnqzgBJlJ49mCf1phgw7OfnPM229GbnppZ4bBD1mzfIu4FUvk0NDKGFnr23sOBnn2CFAHKsF7/Zhj7rUSq1ky4wLeMt17jv6fqRWjcGLQjk9pWxXighrKdL9oZULr9Bb4kJC5CZjOSkRAES1oslPd7vJOhIgsjjJseC3t5+l6zlhl3o6jMIIHbfptClbV3HVtVTf9aBUSxqQB44ec0KVCwBpE8z/GMA7NneBhFAhq+69+Jj3vvO/R0BxPVIrWWU3LKmkTVDRvNmKVWrlBdLrt5u69mtoYmmsBJEnDj7H+yu/ZjNDazoJq+LYZO1cQQQJWX9cSF6tahlZMubFRSLJTetoPEB77nSoFgslvY1JEdUCiWMddPasYN27cMC5NeM5NJEAVLpPkixhSk7RPsW0n61+229b7IXJF1swuli+yBSz2SoWw+Y+rObgdpXsf1ZoKq+XOpW+krySqGQRy3ABrGS8z8GwHXBABnYPOPHn3vnjJ92BBDN+YTnGbgJhmnnpqkX7wbtaBeuy472QXo67CK3rdpEAci5zzCooRdDtmzEMQ00NDgsm3xALvGyAFL05KDe6pIOdgfbLnL9tjvZ+luGtlQrbeQVFn9oiSSF3QBUPauCyeVbCJ6oEuRaRjIpUYCIwkp20juK9/KHvvh30jWmpEQxCSJvmQAkb2XhTrrsEy1ou/VlVSi7026T1thddPUlsOh7v2vYA9aQAfDPXdpfLLrxbfqum3Xf6fNP/HYpgOhpznqGkU3dXD/4pq028MZPxrjis2gptZMulU27pX4bqFS4uz/0RMb5libm37Vf7jJNAUR3h7UmOC8gTZLiQ1a4LllF9toQd23OacH3ZltXsdL/QUUgy+1vbGznofLvuSjOant397zthlVYCTKRkUxPHCB6Ym3u6Y0r9ceGnOidKNtEb+xisVilAiIldeX2tRJDfUqiSFUv5uZVn9rjkHPAtpOEkFEeFN8sm0eqoo3b8sVguf3YPRe/uudTEW/cBRTe6i8b36bnhnlPnjXvqDPDAERqUY/NrsHVbfMmVt91kOe56QglQbFYLWxoNO6DD1QISRSAeNLMDT3ZYlg3/wPm2jAZAeR5QNcipbocALxQtSeI+UBS1ehMuGPdQqfrE9vHgr6AMZqSxMvZL7F7w2b6+nfywxBhY7MKd9UFEM2+4hNSXaQEuHENVSkZQIqy9RcKhGr37QKMCTBQKpucS56m15oeOS/Q5gbesWqQ7fWsR10n6cju3ejmjwUrNartt9FgCnfoBZDCHaJS/dXk9yUz4FVEtXWJFttnqKjzdDf+vHd7W+FTGBP7lPg39hQG0mR4y+6me7FVwxUAqdD3nZqYe/Verv4bWK6+OheP89jhNIzoy7CGBraxex/+BhlAii5PGaiKdpUuL8NV8y1BG/2innQjoAT18hlpa6ZQB6kCQETJObPZlrXs7HmbHBnV+lwBivqtEJaWdbxz5xjXUCta7J6KkX8oVwJjwzKAFGWhnCmSHAKKeK9o4DJSotc1OryHU+7NwuxYVQKIRpRh37uFHVugj9PSCgyzhTWrerHwvg4kh50OHYhqMW7EbrfNjntmfGGhyuYCLlOxxAZ5cnTOR4HykhpygdsTfcUsG70y7Uk9/S1HzJ7ARwPC1OscJUEX8lURIElys4sCREB42LtGR7fJtUZwxcN8hbXpgrexwKc84MTTc832ojSD/jxLGUBqa6pKW4S6lfD3gLZ9ckeqkiuSLLoi+hRyMeN1WH4AXOl7rjoCSB27eXUq7i5AmZllSdZCUTDhOdpD9lS0WqApBhokMO3N1/K4V8HNGwOVkbuo041C2RNKWR09dVxkDlbUQHc1KT+47JY6KDLlcn6MTtsojJuLJUNN4h6wWv1JgfmzexGW0nqlLSPv6V4mr+jJUqvFz7L6lQb7GbflnzFGU5L6IoDoVXthup9kGRfxPW5N+0UHoy6CuVeVnRey0+fwO8B/uVTUzbUIRcPdO53ZoQlQMPIV/ITVfCN0mxqtqEMHI/vBTdfCwym8duNA4FmXt9/AmJ/UKJcjkVX0wFSkXjqlspKw6ChL7ubBv5K7uDXVRdcO6Piayh1HwyU/gWYlMkpR0cHQbTkOYzQlqS+BR25r/6lkfOsNa8PLc1t9Om2d6qKoeX8qrEcbYcLP4M0UXbz8R+AkhmJMm5xVaZ0Xm7RByZvCpB6sgeecANweSIfNXFsDREYnQXuL7hm2giLQfOE8eGpy9D47ocU2F7Nm1S1GB6DqoliA6IynTuPUcFHIh+KqnyxK42lFAktr+KFaSRsPKPlSsfK5sfBbXfxV2ycTjjqQ9x56ztRN0JoFSE5zrNmiXfAvlDzxkerrnoMC/grn4xs7w09+XdO78Tf2Y+Wlq03dhDzLBtFB8pIpVzoPOzLCw91ZrwCSlJm0rWx1MyOH4PJ9uon2b4AiBGuveI/R12BKX2NQe+S3o0gA+TjwXG3SOq2j4/KBJLcmr67NJwqkSkHBUW4bl12yU7Trn5LghvDtJniGAw3mH0mMWe0xBBAFBf1vtQeK3n94yeHv+zLwrj+IPmKntVAeaxnoYXJKWyLdvA21JUl0d4bu0AC+YjAKgkt9EUB0ncaltfUksjkU/Ra9lN8y+lixtpBpIS9DlKJNuYMUrl8bEcI+Sm40GPeumbQXAUR6zPG18yDyVh1e0iDviF6J+lqJ3Q3N168AU0LXbq14z85w+uOd7t1SjLLvEMF0gxlXxtPUXBMBREHK5b2uq/I4h3Xoyg0zZPmXeIbpvUp1lL5Ku1GFKXLDDPe9sXD1E2FqVq2OQkR9KbKeNphDqjZYgh0LIMpstG+CY3YwVPFNwCj0lX8NdJRRqlD3N8Bny+z39PPgns7bTJSPIXflkVtmGsz+ZT5JTTUTQNybbTufKoWPFL2LPjJ56qnWT4O0e6hvAoEXKYd4fBntx0+CZ5MPS9GIk9qSOMdgamBNheBbiSo1kjhOzkGdhbB5YSt/MB2ZSt3pii8Cv6rg2Z9tguNfgpXJ7gbpFE7Bka+FBmNvC63ggTq/qQCiBLBhbrisIrXaCMxF5cZZFJiSqqNTJ5O7B7CSMvlomCj3bzJFR70UAFNQVhiMT+NKhpZqjCKAdHKgYvUCRPRmG10NrlWrT2VIVqbkSssBP4UXkjlPUpjMxCN9rcG0T/Vf6XN1QnsBRJnR2qcfToQYmXbK3SWMVqdomejIZCqKNgo7zAcY8in+1A9OVn6voIzuIfsIUU2n6fV6CyqG+FOPhiAp9iqdDJDqL9/qQzDGOdGBA/lKdeq20vLHi+CkYsu30s7d9nqr7YYx7YJkHJwrDeaaWPvzTOgAABDGSURBVEbp5E46UcVKTgGqnhIX8+zppmhdv/E93SZbYd9uYFQRBajCrr3mX8WYdgh0cES5ANJJWkk8D2d76UQjPVkTujpugHgngyOAR70+JUW+X2H/N5wO3w4woSvs1vWoGNMuxNoDhyhfY6iPQ1Od5OZN3gkrR7IM9tZDupWvkth7KHTzfheoRFHRxVKzXoaBsebdki9+H4zxAndzXPCBQ/8uMZgaP4AXbvY6aaOwc7bx4t2KDMfgSLWCNgqvAK6L1Evbyt+YCD8q2MaroDt3N9eYNnuwBeBQ7/MMRt6X1JdOCDXp3ECQeIJZqjTvxUJN/gO4vswxdbXhM8tg/1i2JW7HGLEwXwLAoe9eMZjU7dMGcbgTghU7P5Sw8nDIMhdrR81KBStWctDl+hvhssLbNiM/w5MYI9aVAoe+f8ZgaigANvKz5ht0Qrh75wejVx5QXz7Di7YME+6uUzvlxGodtwdMryijfY5lxuQvSykiOezj1VW4e4IHpmrnOFPtUOKtqbAHpiQIfhQRoLpkbMnfYbuyD1YdjDFimVtKgENV6urAVIJHbivREyIuihDVyzvUG6LjqFXk75kd4citcqxGTew59dvwee9AbDT6jsGYfKBcCHCo97o6cptg0obaS6kQPS1EtNUVqra21qLunn8duDlU77lKF+wJt7bxzIZpfALGiEVhJYetWldJGxJK+1O7SXk6VZJIeihAsZxUaxcDyqcVpriZG8PmFnI7LEdyWErqJ+2Pp1POB2K/+L3tvNV2wEe41HRhVmLEOuVID/8QUcLZXvgp7F8yyleG+Bci2hx+it42mOERuVCz1W1mxQQSN9R+YtDSyU1jnsdKpIefFN3uclsI2q4dD5d3lN/Uzet6RgRvVdCgdePB0sNZgCTgyUpPaunENhPjvLooTHDCwTvB00EZst11Phlj2pzXDWmQF4KkbjxYfoCcBChxfZVK+i4nUCyFzjvEdwi4gLXnFk1SX/4cfLWDAxq21w2LoLv/jgU3PO3fQ4SPhKXrZIP5U9jKtV7PShAlrlYC6yqVdF5v0/aKnhhZo3wfL8TYn7+rUi7gBX+BYfaWHvec8yUlAg+jEjrAYOI49hV13KrUz18v7uAoT58u0apCkdM+vRek5S55i/Hco1MFFvu77Gi76dkfw4GX6LDTFR2c54jqdLajP2cwn6jy0yXavR8gun5R1zDGX7Y/5wPen7J1/B0n16OOzekcU0XHd6usyLbhxpXAte35c9qvTltw7xd//fEiJwEr9aldbzAKrayb4geILvDVRb7xly/tP5/LZg5P5Q3NBdwo+6JpRePqzZ5k8Z1MzF80fc3Il82Vb7TLZVGmQV74NKcYTKV5WZLkUMmx/ACR01E3TcVfrhi6mGsW5yxDnZXSazh1Wd3asiX0Y4irks3/Fj9bw/Q48Tq46Apf3qpvDX3X/HBRGys9JnCInB0N5r0wdKWlTh4gIrhqeXrv2Go55zS3PZCgYyFKkH9nGjNNt05v0ccQMOQ0Pa/MXfIKVpBSGp4DKMjOZboS59pc62cPWGOmrMjfIRgjOP5uMGMqILsmmxYCRJrrD2Kn9BEDn+ygV21jS7m7v22K8NjpCOpQK2h9PHdsuY+xA9w/EV5LGBg6RHAicEqxyxBu8m7NPhXM7/L7X5XaHH6OfrdeMpn4H6oQIDoFplQY8ZbXDeweskuFbD3sJXjXhRMLQ7YLW00xSTrKMxb4lHftmRzcAqcubdLvjWE78+opI7tW5wne7wG5qwCSfoySVEu1/RWYp9E5oDjBoaFHG4xMtLoqbQDiqVnxX1u02pR/ybT2GKXwa8XN864NkZYr3SZ/fKdgTnQRrCSD1Bxt4Ot0tF6xyl3QRvsOmMsNXvpPXSAmi0xj2d+qrj4VWGh/KxZa7g2dCOygJP0YRUlRAviJjsz3cl25QV0/YGif5aQekBIEEEWzhY0RDceDSgASboSsVlgOuFe3xb4R81VD+xxZYUmq5XpBANH7Vxc09YyN8CgqVmyDZh0FckDhAXvFChBZcHsYWo/j1hPn2wHEU7OmAp+P7UFLGemxDZR1VJIDMoyOihUg9xnM+JLjprRCMYAo7eEvYnumIDdvbJ1nHUXiwJ19l3PumlhyAHnjnmkwVUnfGOm5qlS5GECUV1VXs+0dy7j+jcJYOsw6KZsDV+24iO8vHlp2+7YNZwH7GUxNJ6ys5FkDAeKpWcqfoS2myotCTe6ZWTenzCpnSCf2cMa+b3H3zBExUXCpwZSTiCim4avfTUcAkRiWFKn8bTPms/N46ne7Vv9xshFKcmDsqW8w47cjS9YrXWGRJz3kcK/bUhQgnhTRrrp21ysrw/5zPgt+kEmQyrgYT+tdvvsWC74fhwS5xmCUXruuSymAaItNUqRvRVzo/celfPgZ5RrPSmdzoM8flrD25MEVktHsSQ9dY1XXpUOAeFJEm4YlU2F0yCWzaCMtOykgIyudzYGGhRtxhlY6F/9jMDrgW/clDED28yKjKruU8fGeSzlsQyZFOnNJPdFjKYevr3QOPlQkm8FIs6j7UhIgnhSpPMr3K594jSnPKSIqK53FgbMPfI3/fbbSOajLqN1iUxIWINoXUc6ksrMfM/i6hbx3hWJps9JZHNjh2oUsubySOVBEv6RH3e57FE5NKIB4UqTCa+5fg3c+ApVMT2ctrHoYV8cGhkVKPRr01J8xmCqmh6o9RocGiAcSBUvrKFB55caBS/jWiko9KOWN3dVb/XDAEi5dXgnvbze0vV2qK7A0KkDkP5eqVU6qZfj4mXN47pdhj051Bf4n94wHnjGHf/yiXN7rRIxUq7eSI7g2RooEEE+KyL13S1nkd5uxivVjt0EXumQlOQ606PDCk6vYdOg2ZQ56scHEe0aoTEKSbhYZIB5I7ga+XBaxv91qIac2Z5ZIWcwrs9Hv+i7ks2vK5fk9BqOsQV2ylAsQqVhKW7lXZK4de+6j/OXOjlI4RO4ya1CCA8ed8yh/vaMcnuveq6MNpjrpoFIwcWUBxJMi47w0B9Ees9uSl2neYR8q3cuNNmrXra0EFH3fe5lNg8u5lvkEQ+sNU12RiWUDxAOJUtZeE5lxF4x9hltnlL+nEnnALtzgwkOf4bYny+H1lQYTkLy0a/GyIoB4IPkN8NlIbOs2833m7b99ticSiWvRK2vvY9cX32fTfttHbPxbg/lcxDZ1WT0OgMj1+xdgVCQOnXbYa/z6yUrDHiIN2eUqf2Hsa9z7RFQezwWO64ou3aD1UTFAPClyOKBLU/IpLUsuRvNyC8+ObkB5pbISPweU1+sTL7Xg7BPFqa5rEU4ymMfjJyidPcYCEA8kymzR4QV47Vh02Klzefz30SRPOvmcPNWHnzKXJ34XlbenGYwy2mTF40BsAPFAcraXjjokg5fBH3Zcy8mbe4dskFULw4E/Nq3lM+/2hu3C1LZ1zjGYKVEadIW6sQLEA4lu7w5/xf2I781h3tXlhkB0hTmK/oy7Xj2Ht66KwtOvGUx50RHRqUtVi9gB4oHk8uD7jYrw5vrhs7ns7eibjqlidULE3rDLbL4zPwovrzCY6xKiLnXDVAUgHkjCx2w1vvIBM0b35SCnMXUcrCWCnzUtHPLSGrZ8NOx1d102xirstFUNIB5IjgOmhyJmh/+ez6zLhqP7drMSnQNKSr33DfN579ths8ccbzByz2elAw5UFSAeSBQD9EioWTjipDd59H5lUslKVA588oQ3eSw07440mEejDtEV61cdIB5IdGWNLncsvaN78a4LuPktZZjPSlgOfG3EAm6ZF4Zn7+s2E4PR1URZCcGBRADigUTZUe7xrrLpgLQFcMfe7e80DPEwXbKKm4x61kAoiQ9dQfTlrpKNJK61kBhAPJAoLOW/S8duPQPPHAx1dSV9XFPm6+dZpdGQMCgZi/hbXeOZhY9En4NEAWLJc3BCRAE/ACuOITPai0yqe1NUqNvysqjc6LjIt+gUgHjSROdJbuj40NU0WHhCHOmzK2BRDTZV2uiddOOoWFi06LDTZV39PEels9dpAPFAopOJUrk6OL77AEw9Js77rirlWee2vw8YX1JyyNaTStVlTwLGNUmdChCfyqVNxe8Uz5byDFw4bjU/Wxk+WjguDtVSPxdtu5pbp/XrwOYQIK7vqgkWqjFVNQEQnwEvkBTJu7UAjjphOQ/KY9MFy6f3Xs5Df+7IW3W7B44ul5qnmquhZgDikybK4CigBLtm9jhtKQ9OHRTDtT7V5Gt8fcve+PT4Jbx+b7Gkb0oHKqnRpTIexsfgjnuqOYB40kS5gAUS/bTPKr/1Tcv43TcGcKQT5TBQUjyNb5xHzBZO/fFKPvh6UNy6sqxf74Gjy+TKjY+54XqqSYD4pIk2F3XG5Kx2l/g0zFrLdSfOr9soYEXlXn7/cFr2Ljwro8tr7gKmZJt+4RZ5JbVqGiA+oCg+6988oLS9M1HnSX58zU51c+hKh52+ceXCgPMcUrYEjP8zmLq/2amSRR1n21QAxAcUGeiSJgKL74rqZXDYxLn88PejUnvGXWfIv6Vjsj8fVXASUFct/5/AYTB1fWFmnAs7rr5SBRAfUGSjfBE40fvp6X6nRBDj/30ONz65Z2pSCik1z6VjX2Pq/+zuS7CwHrjf+/l/Xek+jrgWdlz9pBIg/od3cBSlZ4FytPud8m6de/Fb3DTjoJrN4KiMh18/9BnuuGWEL2+V0rm6wDCYBXFNctZP+RxIPUAKwKL0mid5MRgHoTSnn75iOedPHcm45p06Pau8sqxP67uQSePf4MFrB3rpQOWmnaa0SQbzcvlTmbWsBgfqCiAFYFE287HAGOAQuj25E2Nue5cv/XUAJ6zascwbTqLPgfa2/7TNu/z62JU8fcEObBorpeop4GndtWIw+j8rNcqBugVIIb8dHBn4AsyhbPX8YWwtoPzhQ06ftR2HxHz77lM9lnL33sv482f68MGxK1hzwBPADA8QmaFdo2AIIqvLACTo4R0cxXYdzOCZR2NeO5wVi/ei99wtDJ27gd0WO4xa2cRHVm2NTrHYk97zAQVzvLrNB8zddjNvDjEsGtWTtaMaGDBkNuz5OO/tJ1vi7wajTIVZSTEHujRAUjxvGekJcSADSEKMzoZJJwcygKRz3jKqE+JABpCEGJ0Nk04OZABJ57xlVCfEgQwgCTE6GyadHMgAks55y6hOiAMZQBJidDZMOjmQASSd85ZRnRAHMoAkxOhsmHRyIANIOuctozohDmQASYjR2TDp5EAGkHTOW0Z1QhzIAJIQo7Nh0smBDCDpnLeM6oQ4kAEkIUZnw6STAxlA0jlvGdUJcSADSEKMzoZJJwcygKRz3jKqE+JABpCEGJ0Nk04OZABJ57xlVCfEgQwgCTE6GyadHMgAks55y6hOiAMZQBJidDZMOjmQASSd85ZRnRAHMoAkxOhsmHRyIANIOuctozohDmQASYjR2TDp5EAGkHTOW0Z1QhzIAJIQo7Nh0smBDCDpnLeM6oQ4kAEkIUZnw6STAxlA0jlvGdUJcSADSEKMzoZJJwcygKRz3jKqE+JABpCEGJ0Nk04OZABJ57xlVCfEgQwgCTE6GyadHMgAks55y6hOiAMZQBJidDZMOjmQASSd85ZRnRAHMoAkxOhsmHRyIANIOuctozohDmQASYjR2TDp5EAGkHTOW0Z1QhzIAJIQo7Nh0smBDCDpnLeM6oQ4kAEkIUZnw6STAxlA0jlvGdUJcSADSEKMzoZJJwf+P7njubHn9k00AAAAAElFTkSuQmCC" } dom.window.HTMLCanvasElement.prototype.getContext = function (v) { if (v === '2d') { return { isPointInPath: function (args) { return false }, rect: function (args) { }, fillRect: function (args) { }, fillText: function (args) { }, beginPath: function () { }, arc: function (args) { }, closePath: function () { }, fill: function () { } }; } else { return { getExtension: function (args) { return { UNMASKED_RENDERER_WEBGL: 1 } }, getParameter: function (args) { return "ANGLE(Intel(R)UHDGraphics630Direct3D11vs_5_0ps_5_0)" } }; } } // 监听事件 var md = new dom.window.Event('mousedown'); var mu = new dom.window.Event('mouseup'); var cl = new dom.window.Event('click'); var mv = new dom.window.Event('mousemove'); // 轨迹函数 function track(start_pos, end_pos) { /* start_pos 点击的坐标 * end_pos 结束的坐标 * */ const distance = end_pos[0]; let click_pos = start_pos[0]; let a = 0.00035, // 加速度 current = 0, //当前位移 t = 0.02, //计算间隔 v = 0, //初速度 mid = distance * 4 / 5; // 减速阈值 while (current < distance) { v0 = v; //初速度v0 v = v0 + a * t; //当前速度 move = v0 * t + 1 / 2 * a * t * t; // 移动距离 // console.log("每次移动: ", move) if (parseInt(move) > 0) { current += parseInt(move); //当前位移 if (current < mid) { if (current % (parseInt(Math.random() * 5)) == 0) { mv.pageX = current; mv.pageY = start_pos[1]; document.dispatchEvent(mv); } if (current >= click_pos) { md.pageX = current; md.pageY = start_pos[1]; document.dispatchEvent(md); click_pos += 9999; } } else { mv.pageX = current; mv.pageY = start_pos[1]; document.dispatchEvent(mv); if (current == end_pos[0]) { mu.pageX = cl.pageX = current; mu.pageY = cl.pageY = start_pos[1]; document.dispatchEvent(mv); document.dispatchEvent(cl); } } } } } """ jscode += tdc jscode += """function run(start_pos, end_pos) { track(start_pos, end_pos); collect = window.TDC.getData(!0); return decodeURIComponent(collect); } """ ctx = execjs.compile(jscode) collect = ctx.call('run', start_pos, end_pos) return collect def verify(self, sess, sid, nonce, eks, show_url, ans, collect): """ 滑块验证码验证 :param str ssess: resetSess生成 :param str sid: initCaptcha生成 :param str nonce: showCaptcha生成 :param str eks: tdc文件中动态变量 :param str show_url: 验证码展示url :param str sans: 验证码终点坐标 格式: 'x,y;' :param str collect: 环境检测后的加密参数 :return: 验证结果,errorCode为0表示成功 :rtype: dict """ url = "https://t.captcha.qq.com/cap_union_new_verify" payload = { 'aid': self.aid, 'protocol': 'https', 'accver': '1', 'showtype': 'popup', 'ua': self.ua, 'noheader': '1', 'fb': '1', 'enableDarkMode': '0', 'grayscale': '1', 'clientype': '2', 'sess': sess, 'fwidth': '0', 'sid': sid, 'forcestyle': 'undefined', 'wxLang': '', 'tcScale': '1', 'uid': '', 'cap_cd': '', 'rnd': self.rnd, 'TCapIframeLoadTime': 'undefined', 'prehandleLoadTime': self.prehandleLoadTime, 'createIframeStart': self.createIframeStart, 'subsid': '2', 'cdata': '0', 'ans': ans, # '320,107;' 'collect': collect, 'vsig': '', 'websig': '', 'subcapclass': '', 'tlg': len(collect), 'eks': eks, 'nonce': nonce, 'vlg': '0_0_1' # 'vData': vData } headers = { 'Host': 't.captcha.qq.com', 'sec-ch-ua': '"Chromium";v="88", "Google Chrome";v="88", ";Not A Brand";v="99"', 'Accept': 'application/json, text/javascript, */*; q=0.01', 'X-Requested-With': 'XMLHttpRequest', 'sec-ch-ua-mobile': '?0', 'User-Agent': self._ua, 'Content-Type': 'application/x-www-form-urlencoded; charset=UTF-8', 'Origin': 'https://t.captcha.qq.com', 'Sec-Fetch-Site': 'same-origin', 'Sec-Fetch-Mode': 'cors', 'Sec-Fetch-Dest': 'empty', 'Referer': show_url, 'Accept-Language': 'zh-CN,zh-TW;q=0.9,zh;q=0.8,en-US;q=0.7,en;q=0.6' } response = requests.request("POST", url, headers=headers, data=payload) return response.json() def run(tx): """ 执行函数 :param tx: Txhk对象 :return: 验证结果 """ # 初始化滑块 init_obj = tx.initCaptcha() sess = init_obj['sess'] sid = init_obj['sid'] # 获取验证码url, nonce, tdc文件url location_href, nonce, tdc_url = tx.showCaptcha(sess, sid) # 重置sess获取缺口初始位置 r = tx.resetSess(sess, sid, location_href) sess = r.get('sess') # 下载图片并获取缺口左边位置 tx.loadImage(sess, sid, location_href) img1 = Image.open('topic7_0.png').convert('RGBA') img2 = Image.open('topic7_1.png').convert('RGBA') left_offset = get_left_offset(img1, img2) ans = f"{left_offset - 20},{r.get('inity')};" # 20是小图片左边距 print(ans) # 起点坐标 start_pos = [68, 285] # 终点坐标 end_pos = [(left_offset + 44) // 2 + 12, 285] # 44是小图片宽度, 12是图片距窗口左边距离 # 获取tdc文件 tdc = tx.get_tdc_js(tdc_url=tdc_url, show_url=location_href) tdc = tdc.replace('=254;', '=200;').replace('+=5293}', '+=0}') # 将检测电源值转为200, 以及是否有process函数改为0 eks = re.search('\.info="(.*?)"', tdc).group(1) # 执行js, 获取collect加密参数 collect = tx.get_collect(tdc=tdc, location_href=location_href, start_pos=start_pos, end_pos=end_pos) result = tx.verify(sess=sess, sid=sid, nonce=nonce, eks=eks, show_url=location_href, ans=ans, collect=collect) return result if __name__ == '__main__': tx = Txhk( ua="Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/88.0.4324.104 Safari/537.36", aid="2005597573", refer_url="http://www.glidedsky.com/", app_version="5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/89.0.4389.82 Safari/537.36" ) result = run(tx) print(result)
{"/proxy/adsl/dial.py": ["/proxy/dbConnect.py"], "/txhk/core.py": ["/txhk/gap.py"]}
40,761
phillipboy07/cves
refs/heads/master
/cve_db_app/forms.py
from django.forms import ModelForm,forms from django import forms from cve_db_app.models import Scan class ScanUploadForm(ModelForm,forms.Form): file = forms.FileField(required=False, label="Scan in CSV format") site = forms.CharField(required=True, label="Site Name that the Scan is based off of") class Meta: model = Scan fields = ['name'] labels = { 'name': ('Scan Name') }
{"/cve_db_app/forms.py": ["/cve_db_app/models.py"], "/cve_db_app/admin.py": ["/cve_db_app/models.py"], "/cve_db_app/views.py": ["/cve_db_app/forms.py", "/cve_db_app/models.py"]}
40,762
phillipboy07/cves
refs/heads/master
/cve_db_app/urls.py
from django.urls import path from . import views urlpatterns = [ path('', views.index, name='index'), path('upload_scan',views.upload_scan), path('cve_search', views.cve_search), path('ajax/get_cve_info/', views.ajax_get_cve_info), ]
{"/cve_db_app/forms.py": ["/cve_db_app/models.py"], "/cve_db_app/admin.py": ["/cve_db_app/models.py"], "/cve_db_app/views.py": ["/cve_db_app/forms.py", "/cve_db_app/models.py"]}
40,763
phillipboy07/cves
refs/heads/master
/cve_db_app/OLD_models.py
from django.db import models from django.contrib.postgres.fields import HStoreField # Create your models here. class Scan(models.Model): scan_date = models.DateTimeField("scan date") scan_results = HStoreField() class Site(models.Model): site_name = models.CharField(max_length=200) class Device(models.Model): site = models.ForeignKey(Site, on_delete=models.CASCADE) device_name = models.CharField(max_length=200) dns_name = models.CharField(max_length=200) device_ip = models.GenericIPAddressField() device_version = models.CharField(max_length=200) device_net_bios = models.CharField(max_length=200) # Potential Table for the processing the CVE scan data results # class Threat(models.Model)
{"/cve_db_app/forms.py": ["/cve_db_app/models.py"], "/cve_db_app/admin.py": ["/cve_db_app/models.py"], "/cve_db_app/views.py": ["/cve_db_app/forms.py", "/cve_db_app/models.py"]}
40,764
phillipboy07/cves
refs/heads/master
/cve_db_app/apps.py
from django.apps import AppConfig class CveDbAppConfig(AppConfig): name = 'cve_db_app'
{"/cve_db_app/forms.py": ["/cve_db_app/models.py"], "/cve_db_app/admin.py": ["/cve_db_app/models.py"], "/cve_db_app/views.py": ["/cve_db_app/forms.py", "/cve_db_app/models.py"]}
40,765
phillipboy07/cves
refs/heads/master
/cve_db_app/models.py
from django.db import models from datetime import datetime # Create your models here. #constants STATUS_CHOICES = ( ('On', 'Online'), ('Off', 'Offline'), ) class Scan(models.Model): date = models.DateTimeField(blank=True) name = models.CharField(max_length=200, blank=True) class Site(models.Model): name = models.CharField(max_length=200, blank=True) class Contact(models.Model): first_name = models.CharField(max_length=200, blank=True) last_name = models.CharField(max_length=200, blank=True) gdit_group = models.CharField(max_length=200, blank=True) phone_number = models.CharField(max_length=200, blank=True) email_address = models.EmailField(max_length=200, blank=True) # Asset Mgmt from Dashboard View (broken up into Device and Device Location) class Device(models.Model): site = models.ForeignKey(Site, on_delete=models.PROTECT) contact = models.ForeignKey(Contact, on_delete=models.PROTECT) dns_name = models.CharField(max_length=200, blank=True) ip = models.GenericIPAddressField() net_bios = models.CharField(max_length=200, blank=True) mac_address = models.CharField(max_length=200, blank=True) os_vendor = models.CharField(max_length=200, blank=True) os_type = models.CharField(max_length=200, blank=True) os_version = models.CharField(max_length=200, blank=True) os_revision = models.CharField(max_length=200, blank=True) switch = models.CharField(max_length=200, blank=True) port = models.CharField(max_length=200, blank=True) vlan = models.CharField(max_length=200, blank=True) make = models.CharField(max_length=200, null=True) model = models.CharField(max_length=200, null=True) serial_number = models.CharField(max_length=200, blank=True) asset_tag = models.CharField(max_length=200, blank=True) poc = models.CharField(max_length=200, blank=True) role = models.CharField(max_length=200, blank=True) function = models.CharField(max_length=200, blank=True) mission_criticality = models.CharField(max_length=200, blank=True) status = models.CharField( max_length=200, choices=STATUS_CHOICES, default='On', ) # Asset Mgmt from Dashboard View (broken up into Device and Device Location) class Device_Location(models.Model): device = models.ForeignKey(Device, on_delete=models.CASCADE) building = models.CharField(max_length=200, blank=True) physical_location = models.CharField(max_length=200, blank=True) floor = models.CharField(max_length=200, blank=True) room = models.CharField(max_length=200, blank=True) rack_row = models.CharField(max_length=200, blank=True) rack_name = models.CharField(max_length=200, blank=True) rack_unit = models.CharField(max_length=200, blank=True) # Potential Table for the processing the CVE scan data results class Vulnerability(models.Model): scan = models.ForeignKey(Scan,on_delete=models.CASCADE) device = models.ForeignKey(Device, on_delete=models.CASCADE) plugin = models.CharField(max_length=500,blank=True,null=True) plugin_name = models.CharField(max_length=200,blank=True,null=True) family = models.CharField(max_length=500,blank=True,null=True) severity = models.CharField(max_length=500,blank=True,null=True) protocol = models.CharField(max_length=500,blank=True,null=True) port = models.CharField(max_length=500,blank=True,null=True) exploit = models.CharField(max_length=50,blank=True,null=True) repository = models.CharField(max_length=500,blank=True,null=True) plugin_text = models.TextField(max_length=500, blank=True,null=True) cve = models.TextField(max_length=500,blank=True,null=True) first_discovered = models.DateTimeField(max_length=500,blank=True,null=True) last_observed = models.DateTimeField(max_length=500,blank=True,null=True) exploit_frameworks = models.CharField(max_length=500, blank=True,null=True) synopsis = models.CharField(max_length=500,blank=True,null=True) description = models.TextField(max_length=1000, blank=True,null=True) solution = models.CharField(max_length=500,blank=True,null=True) see_also = models.URLField(max_length=500, blank=True,null=True) risk_factor = models.CharField(max_length=50,blank=True,null=True) stig_severity = models.CharField(max_length=500, blank=True,null=True) cvss_base_score = models.DecimalField(blank=True, max_digits=5, decimal_places=2,null=True) cvss_temporal_score = models.DecimalField(blank=True, max_digits=5, decimal_places=2,null=True) cvss_vector = models.CharField(max_length=300,blank=True,null=True) cpe = models.TextField(max_length=500,blank=True,null=True) #bid = models.BigIntegerField(blank=True,null=True) bid = models.TextField(max_length=1000, blank=True,null=True) cross_references = models.CharField(max_length=500,blank=True,null=True) vuln_publication_date = models.CharField(max_length=500,blank=True,null=True) patch_publication_date = models.CharField(max_length=500,blank=True,null=True) plugin_publication_date = models.DateTimeField(blank=True,null=True) plugin_modification_date = models.DateTimeField(blank=True,null=True) exploit_ease = models.CharField(max_length=500,blank=True,null=True) check_type = models.CharField(max_length=300,blank=True,null=True) version = models.CharField(max_length=300,blank=True,null=True) class Meta: verbose_name_plural = "Vulnerabilities"
{"/cve_db_app/forms.py": ["/cve_db_app/models.py"], "/cve_db_app/admin.py": ["/cve_db_app/models.py"], "/cve_db_app/views.py": ["/cve_db_app/forms.py", "/cve_db_app/models.py"]}
40,766
phillipboy07/cves
refs/heads/master
/cve_db_app/admin.py
from django.contrib import admin # Register your models here. from .models import Site,Device,Scan,Vulnerability as Vuln admin.site.register(Site) admin.site.register(Scan) admin.site.register(Vuln) admin.site.register(Device)
{"/cve_db_app/forms.py": ["/cve_db_app/models.py"], "/cve_db_app/admin.py": ["/cve_db_app/models.py"], "/cve_db_app/views.py": ["/cve_db_app/forms.py", "/cve_db_app/models.py"]}
40,767
phillipboy07/cves
refs/heads/master
/cve_db_app/migrations/0002_auto_20180812_0323.py
# Generated by Django 2.0.6 on 2018-08-12 03:23 from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): dependencies = [ ('cve_db_app', '0001_initial'), ] operations = [ migrations.AlterField( model_name='vulnerability', name='device', field=models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to='cve_db_app.Device'), ), ]
{"/cve_db_app/forms.py": ["/cve_db_app/models.py"], "/cve_db_app/admin.py": ["/cve_db_app/models.py"], "/cve_db_app/views.py": ["/cve_db_app/forms.py", "/cve_db_app/models.py"]}
40,768
phillipboy07/cves
refs/heads/master
/cve_db_app/migrations/0001_initial.py
# Generated by Django 2.0.6 on 2018-08-12 03:01 from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): initial = True dependencies = [ ] operations = [ migrations.CreateModel( name='Device', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('dns_name', models.CharField(blank=True, max_length=200)), ('ip', models.GenericIPAddressField()), ('net_bios', models.CharField(blank=True, max_length=200)), ('mac_address', models.CharField(blank=True, max_length=200)), ], ), migrations.CreateModel( name='Scan', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('date', models.DateTimeField(auto_now=True)), ('name', models.CharField(blank=True, max_length=200)), ], ), migrations.CreateModel( name='Site', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('name', models.CharField(blank=True, max_length=200)), ], ), migrations.CreateModel( name='Vulnerability', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('plugin', models.IntegerField()), ('plugin_name', models.CharField(max_length=200)), ('family', models.CharField(max_length=200)), ('severity', models.CharField(max_length=200)), ('protocol', models.CharField(max_length=200)), ('port', models.CharField(max_length=200)), ('exploit', models.CharField(max_length=50)), ('repository', models.CharField(max_length=200)), ('plugin_text', models.TextField(blank=True, max_length=500)), ('cve', models.CharField(blank=True, max_length=100)), ('first_discovered', models.DateTimeField(max_length=200)), ('last_observed', models.DateTimeField(max_length=200)), ('exploit_frameworks', models.CharField(blank=True, max_length=200)), ('synopsis', models.CharField(max_length=200)), ('description', models.TextField(blank=True, max_length=500)), ('solution', models.CharField(max_length=200)), ('see_also', models.URLField(blank=True)), ('risk_factor', models.CharField(max_length=50)), ('stig_severity', models.CharField(blank=True, max_length=200)), ('cvss_base_score', models.DecimalField(blank=True, decimal_places=2, max_digits=5)), ('cvss_temporal_score', models.DecimalField(blank=True, decimal_places=2, max_digits=5)), ('cvss_vector', models.CharField(blank=True, max_length=100)), ('cpe', models.CharField(blank=True, max_length=100)), ('bid', models.BigIntegerField(blank=True)), ('cross_references', models.CharField(blank=True, max_length=200)), ('vuln_publication_date', models.CharField(max_length=200)), ('patch_publication_date', models.CharField(max_length=200)), ('plugin_publication_date', models.DateTimeField()), ('plugin_modification_date', models.DateTimeField()), ('exploit_ease', models.CharField(blank=True, max_length=200)), ('check_type', models.CharField(max_length=100)), ('version', models.CharField(max_length=100)), ('device', models.ForeignKey(on_delete=django.db.models.deletion.PROTECT, to='cve_db_app.Device')), ('scan', models.ForeignKey(on_delete=django.db.models.deletion.CASCADE, to='cve_db_app.Scan')), ], options={ 'verbose_name_plural': 'Vulnerabilities', }, ), migrations.AddField( model_name='device', name='site', field=models.ForeignKey(on_delete=django.db.models.deletion.PROTECT, to='cve_db_app.Site'), ), ]
{"/cve_db_app/forms.py": ["/cve_db_app/models.py"], "/cve_db_app/admin.py": ["/cve_db_app/models.py"], "/cve_db_app/views.py": ["/cve_db_app/forms.py", "/cve_db_app/models.py"]}
40,769
phillipboy07/cves
refs/heads/master
/cve_db_app/views.py
from django.shortcuts import render,redirect from django.http import HttpResponse from django.http import JsonResponse from django.template import loader from django.utils import timezone from cve_db_app.forms import ScanUploadForm from cve_db_app.models import Scan, Device, Vulnerability, Site #from django.contrib.auth.models import Device from django.utils.dateparse import parse_date from datetime import datetime import csv, requests, json # Create your views here. def index(request): template = loader.get_template('cve_db_app/index.html') #empty dict because no data is being passed. return HttpResponse(template.render({},request)) #TODO - place this in a helper class?! def decode_utf8(input_iterator): for l in input_iterator: yield l.decode('utf-8') def upload_scan(request): if request.method == 'POST': form = ScanUploadForm(request.POST) if form.is_valid(): scan_entry = form.save(commit=False) scan_entry.date = timezone.now() scan_entry.save() #Save the Site Info site = Site(name=form.cleaned_data['site']) site.save() csv_file = request.FILES['file'] #check if the file uploaded is a CSV file if not csv_file.name.endswith('.csv'): return HttpResponse('<h1>No CSV file??</h1>') #if file is too large, return if csv_file.multiple_chunks(): return HttpResponse("Uploaded file is too big (%.2f MB)." % (csv_file.size/(1000*1000),)) #if we get this far lets process the CSV now.. reader = csv.DictReader(decode_utf8(csv_file)) for row in reader: lower_row = {k.lower(): v for k, v in row.items()} #TODO - replace with regex for the removal of all special chars minus_spec_row = {k.replace("?", ""): v for k, v in lower_row.items()} trimmed_row = {k.replace(" ", "_"): v for k, v in minus_spec_row.items()} #factor in foreign keys trimmed_row['scan_id'] = scan_entry.id device = Device(ip = trimmed_row['ip_address'], site_id = site.id) device.save() trimmed_row['device_id'] = device.id #pop out device specfic fields device_fields = ('dns_name', 'ip_address', 'netbios_name','mac_address') for key in device_fields: if key in trimmed_row: del trimmed_row[key] #remove all unecessary data like N/A, empty values, etc trimmed_row = {k:v for (k,v) in trimmed_row.items() if v != 'N/A' if v != 'n/a' if v != ''} #remove commas from integers (bid) for (k,v) in trimmed_row.items(): if (k=='bid'): trimmed_row[k] = v.replace(',','') #convert datetime strings to valid formats datetime_fields = ('first_discovered','plugin_modification_date','last_observed','plugin_publication_date','vuln_publication_date','patch_publication_date') for key in datetime_fields: if (key in trimmed_row): trimmed_row[key] = parse_date(trimmed_row[key]) #TODO - add Try Catch due to the data inconsistences vuln = Vulnerability(**trimmed_row) vuln.save() #return render(request,'cve_db_app/detail.html',{'data':trimmed_row}) return HttpResponse('<h1>Scan has been sucessfully uploaded.</h1>') else: return HttpResponse(form.errors) # template = loader.get_template('cve_db_app/index.html') # #empty dict because no data is being passed. # return HttpResponse(template.render({},request)) else: form = ScanUploadForm() return render(request,'cve_db_app/upload_scan.html',{'form':form}) def process_csv(request): csv_file = request.FILES['file'] #check if the file uploaded is a CSV file if not csv_file.name.endswith('.csv'): return HttpResponse('<h1>No CSV file??</h1>') #if file is too large, return if csv_file.multiple_chunks(): return HttpResponse("Uploaded file is too big (%.2f MB)." % (csv_file.size/(1000*1000),)) #if we get this far lets process the CSV now.. file_data = csv_file.read().decode("utf-8") lines = file_data.split("\n") return HttpResponse("Uploaded file is too big (%.2f MB)." % (lines)) def cve_search(request): if request.method == 'POST': #insert CVE API call CVE_SEARCHURL = "http://cve.circl.lu/api/cve/" + request.POST['cve-id'] r = requests.get(CVE_SEARCHURL) if r.status_code != 200: return HttpResponse('Error %s.' % r.text) else: parsed_json = json.loads(r.text) data = { 'cve_id' : parsed_json['id'], 'cwe_id' : parsed_json['cwe'], 'cvss_score': parsed_json['cvss'], 'summary': parsed_json['summary'] } return JsonResponse(data) else: return render(request,'cve_db_app/cve_search.html') def ajax_get_cve_info(request): #insert CVE API call CVE_SEARCHURL = "http://cve.circl.lu/api/cve/" + request.GET['cve_id']; r = requests.get(CVE_SEARCHURL) if r.status_code != 200: return HttpResponse('Error %s.' % r.text) else: parsed_json = json.loads(r.text) data = { 'cve_id' : parsed_json['id'], 'cwe_id' : parsed_json['cwe'], 'cvss_score': parsed_json['cvss'], 'summary': parsed_json['summary'] } return JsonResponse(data)
{"/cve_db_app/forms.py": ["/cve_db_app/models.py"], "/cve_db_app/admin.py": ["/cve_db_app/models.py"], "/cve_db_app/views.py": ["/cve_db_app/forms.py", "/cve_db_app/models.py"]}
40,778
Sanjivkumar100/i-30-workshop
refs/heads/main
/Pattern 3.py
row=int(input("Enter a row:")) k=2*row-2 for i in range(0,row): for j in range(0,k): print(end=" ") k-=1 for l in range(0,i+1): print('*',end=' ') print("\r")
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,779
Sanjivkumar100/i-30-workshop
refs/heads/main
/todolist.py
from todolistpriorty import hightask,lowtask,medtask,edithig,editlow,editmed,deletehig,deletelow,deletemed def addtask(): add={1:hightask,2:medtask,3:lowtask} print("Choose the priority level\n\tPress 1 High\n\tPress 2 Medium \n\tPress 3 Low ") while True: options=int(input("Enter your choice: ")) if options in add: action=add[options] action() elif options==0: break; def edittask(): edit={1:edithig,2:editmed,3:editlow} print("Choose the priority level\n\tPress 1 High\n\tPress 2 Medium \n\tPress 3 Low ") while True: options=int(input("Enter your choice: ")) if options in edit: action=edit[options] action() elif options==0: break; def delete(): delete={1:deletehig,2:deletemed,3:deletelow} print("Choose the priority level\n\tPress 1 High\n\tPress 2 Medium \n\tPress 3 Low ") while True: options=int(input("Enter your choice: ")) if options in delete: action=delete[options] action() elif options==0: break; actions={1:addtask,2:edittask,3:delete} while True: print("Todolist App\n\tPress 1 to add new task\n\tPress 2 to edit the task \n\tPress 3 to delete the task ") choice=int(input("Enter your choice: ")) if choice in actions: action=actions[choice] action() elif choice==0: break;
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,780
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 13.py
l1=[] l2=[] l3=[] def fl(n): print("elements for first list") for i in range(1,n+1): inp=int(input(f"Enter element {i}:")) l1.extend([inp]) def sl(n): print("elements for Second list") for i in range(1,n+1): inp=int(input(f"Enter element {i}:")) l2.extend([inp]) def ml(l1,l2): for j in range(len(l1)): if (l1[j]%2)!=0: l3.extend([l1[j]]) for k in range(len(l2)): if (l2[k]%2)==0: l3.extend([l2[k]]) print(f"Merged list:{l3}") n=int(input("Enter a range:")) fl(n) sl(n) ml(l1,l2)
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,781
Sanjivkumar100/i-30-workshop
refs/heads/main
/pattern 1.py
def plusrow(): print("+",end=' ') for i in range(4): print('-',end=' ') print('+',end=' ') for i in range(4): print('-',end=' ') print('+') def otherrow(): print('|',end=' ') for i in range(4): print(' ',end=' ') print('|',end=' ') for i in range(4): print(' ',end=' ') print('|') for i in range(1,12): if i==1 or i==6 or i==11: plusrow() else: otherrow()
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,782
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 6.py
c=str(input("Enter a character:")) vowels=['A','a','E','e','I','i','o','O','u','U'] if c in vowels: print("Vowel") else: print('Consonant')
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,783
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 7.py
n=int(input("Enter range:")) add=0 for i in range(1,n+1): add=add+i print(add)
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,784
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 9.py
def fact(n): factorial=1 for i in range(1,n+1): factorial*=i print(f"factoial of {n}:{factorial}") a=int(input("Enter a number:")) fact(a)
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,785
Sanjivkumar100/i-30-workshop
refs/heads/main
/rstfunc.py
from random import randint pscore=0 cscore=0 def maingame(n): print("Enter rock or paper or scissors") rounds=0 game=['rock','paper','scissors'] computer=game[randint(0,2)] global pscore global cscore while(rounds!=n): player=input("Player game:") if player=='rock': if computer==game[2]: pscore+=1 print(f"Player score:{pscore}") print(f"Computer score :{cscore}") elif computer==game[1]: cscore+=1 print(f"Player score:{pscore}") print(f"Computer score :{cscore}") else: print("Same") elif player=='scissors': if computer==game[0]: cscore+=1 print(f"Player score:{pscore}") print(f"Computer score :{cscore}") elif computer==game[1]: pscore+=1 print(f"Player score:{pscore}") print(f"Computer score :{cscore}") else: print("Same") elif player=='paper': if computer==game[0]: pscore+=1 print(f"Player score:{pscore}") print(f"Computer score :{cscore}") elif computer==game[2]: cscore+=1 print(f"Player score:{pscore}") print(f"Computer score :{cscore}") else: print("Same") rounds+=1 def score(): global pscore global cscore if pscore>cscore: print("Player wins") elif cscore>pscore: print("Computer wins") else: print("Tie")
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,786
Sanjivkumar100/i-30-workshop
refs/heads/main
/pattern 2.py
def starrow(n): for i in range(n): print('*',end='') rows=int(input("Enter the numbers of rows:")) for i in range(1,rows+1): starrow(i) print()
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,787
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 2.py
a=int(input("Enter a number:")) if a%2==0: print("even"); else: print(odd)
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,788
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 5 1.py
def addcontact(): name=input('Enter name:') phoneno=int(input("Enter phone number")) contactbook[name]=phoneno def deletecontact(): name=input("Enter the name to delete:") del contactbook[name] print(contactbook) def editcontact(): name=input('Enter name:') phoneno=int(input("Enter phone number")) contactbook[name]=phoneno def searchcontact(): name=input('Enter name:') if name in contactbook: print(f"Number={contactbook[name]}") def show(): print(contactbook) contactbook={} directory={1:addcontact,2:deletecontact,3:editcontact,4:searchcontact,5:show} choice=0 while True: print("Contact directory App\n\tPress 1 to add new number\n\tPress 2 to delete the number \n\tPress 3 to edit the number\n\tPress 4 to search the number \n\tPress 5 to show the number") choice=int(input("Enter your choice: ")) if choice in directory: book=directory[choice] book() elif choice==0: break;
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,789
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 10.py
n=int(input("Enter range:")) for i in range(1,n+1): if (i%2!=0): print(" ",i," ")
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,790
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 14.py
l=[] n=int(input("Enter range:")) i=0 for i in range(i,n): x= int(input("Enter a value: ")) l.append(x); l.sort() print(f"The second smallest number is {l[1]}")
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,791
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 5.py
def SI(p,r,t): si=(p*r*t)/100 print(f"Simple interest:{si}") p=float(input("Enter principle:")) r=float(input("Enter rate:")) t=float(input("Enter time:")) SI(p,r,t)
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,792
Sanjivkumar100/i-30-workshop
refs/heads/main
/Car.py
import turtle bob=turtle.Turtle() bob.color("black","red") bob.begin_fill() bob.forward(100) bob.left(90) bob.forward(100) bob.right(90) bob.forward(200) bob.right(90) bob.forward(100) bob.left(90) bob.forward(100) bob.right(90) bob.forward(100) bob.right(90) bob.forward(50) bob.right(90) bob.circle(50) bob.left(90) bob.forward(200) bob.right(90) bob.circle(50) bob.left(90) bob.forward(100) bob.forward(50) bob.right(90) bob.forward(100) bob.end_fill() bob.color("black","yellow") bob.begin_fill() bob.right(90) bob.forward(25) bob.right(90) bob.forward(25) bob.right(90) bob.forward(25) bob.end_fill()
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,793
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 12.py
n=int(input("Enter a range:")) even=[i for i in range(1,n+1) if i%2==0] print(even)
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,794
Sanjivkumar100/i-30-workshop
refs/heads/main
/rsptrial.py
from rstfunc import maingame,score print("Rock Paper & Scissors game") n=int(input("Enter number of rounds:")) maingame(n) score()
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,795
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 8.py
a=int(input("Start range:")) b=int(input("End range:")) add=0 for i in range(a,b+1): add=add+i print(add)
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,796
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 1.py
a=int(input("Enter first number:")) b=int(input("Enter second number:")) if a>b: print(f"{b} is smaller than {a}") else: print(f"{a} is smaller than {b}")
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,797
Sanjivkumar100/i-30-workshop
refs/heads/main
/task 4 4.py
marks=float(input("Enter student mark:")) if marks>90: print('grade:O') elif marks>81 and marks<90: print('grade:A') elif marks>71and marks<80: print('grade:B') elif marks >61 and marks<70: print('grade:C') elif marks >51 and marks<60: print('grade:D') else: print("U")
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,798
Sanjivkumar100/i-30-workshop
refs/heads/main
/todolistpriorty.py
todolisthig=[] todolistmed=[] todolistlow=[] def hightask(): task=input("Enter the new task:") todolisthig.append(task) print(todolisthig) def medtask(): task=input("Enter the new task:") todolistmed.append(task) print(todolistmed) def lowtask(): task=input("Enter the new task:") todolistlow.append(task) print(todolistlow) def edithig(): newtask=input("Enter the new task") oldtask=input("Enter old task:") indexno=todolisthig.index(oldtask) todolisthig[indexno]=newtask print(todolisthig) def editmed(): newtask=input("Enter the new task") oldtask=input("Enter old task:") indexno=todolistmed.index(oldtask) todolistmed[indexno]=newtask print(todolistmed) def editlow(): newtask=input("Enter the new task") oldtask=input("Enter old task:") indexno=todolistlow.index(oldtask) todolistlow[indexno]=newtask print(todolistlow) def deletehig(): task=input("Enter the task:") todolisthig.remove(task) print(todolisthig) def deletemed(): task=input("Enter the task:") todolisthig.remove(task) print(todolistmed) def deletelow(): task=input("Enter the task:") todolistlow.remove(task) print(todolistlow)
{"/todolist.py": ["/todolistpriorty.py"], "/rsptrial.py": ["/rstfunc.py"]}
40,807
clairewangjia/Text-Sentiment-Analysis
refs/heads/master
/Step2_fused_analyzer.py
import os import pandas as pd import numpy as np from sklearn.model_selection import KFold from sklearn.naive_bayes import MultinomialNB from sklearn.neighbors import KNeighborsClassifier from sklearn.linear_model import LogisticRegression from sklearn.linear_model import Lasso from sklearn.ensemble import RandomForestClassifier from sklearn.svm import SVC from sklearn.metrics import classification_report, precision_score, recall_score, f1_score import vader_sentiment_analyzer import hashtag data_dir = './data' print("Loading data...") x = pd.read_csv('./data/features_processed.csv') x = x.values # convert pandas dataframe to ndarray with open(os.path.join(data_dir, 'labels.txt'), 'r') as f: y = np.array([ int(line.strip()) for line in f.readlines()]) print("----------------------------------------------------") print("Training RF classifer with features: favourites, followers, friends, likes, lists, retweets, statuses") print("----------------------------------------------------") n = 3 prob_count= np.empty(shape=[0, n]) kf = KFold(n_splits=10) avg_p = 0 avg_r = 0 macro_f1 = 0 for train, test in kf.split(x): # model = MultinomialNB().fit(x[train], y[train]) # model = KNeighborsClassifier(n_neighbors=3).fit(x[train], y[train]) model = RandomForestClassifier(n_estimators = 300, max_features = 4, random_state=0).fit(x[train], y[train]) # model = LogisticRegression().fit(x[train], y[train]) # model = Lasso(alpha = 0.1).fit(x[train], y[train]) # model = svm.SVC(probability=True).fit(x[train], y[train]) prob = model.predict_proba(x[test]) predicts = model.predict(x[test]) prob_count = np.concatenate((prob_count, prob),axis=0) # print(classification_report(y[test],predicts)) avg_p += precision_score(y[test],predicts, average='macro') avg_r += recall_score(y[test],predicts, average='macro') macro_f1 += f1_score(y[test],predicts, average='macro') print('Feature importances of the above features in the RandomForestClassifier:') print(model.feature_importances_) print('probability: neg, neu, pos') print(prob_count) print('Average Precision of features_set_classifier is %f.' %(avg_p/10.0)) print('Average Recall of features_set_classifier is %f.' %(avg_r/10.0)) print('Average Macro-F1 of features_set_classifier is %f.' %(macro_f1/10.0)) print("----------------------------------------------------") print("Training VADER sentiment classifer for tweets text and emoji") prob_text = vader_sentiment_analyzer.main() print("----------------------------------------------------") print("Training ML TF-IDF classifer for hashtag") print("----------------------------------------------------") prob_hashtag = hashtag.main() # fuse two models print("----------------------------------------------------") print("Combining 2 models in the rule-based late fusion model: text + social features") print("----------------------------------------------------") weights = [] for w1 in np.arange(0,0.8,0.01): w2 = 1-w1 weights.append([w1,w2]) precisions = [] recalls = [] macrof1 = [] for i in range(len(weights)): w_count, w_text = weights[i] result_prob = w_count*prob_count + w_text*prob_text result = np.argmax(result_prob, axis=1) avg_p = precision_score(y, result, average='macro') avg_r = recall_score(y, result, average='macro') macro_f1 = f1_score(y,result, average='macro') precisions.append(avg_p) recalls.append(avg_r) macrof1.append(macro_f1) opt_id = np.argmax(macrof1) print('Weight of social_feature_classifier: ' + str(weights[opt_id][0]) + ', Weight of vader_sentiment_analyzer: '+ str(weights[opt_id][1])) print('Optimal Precision of late fusion model is %f.' %precisions[opt_id]) print('Optimal Recall of late fusion model is %f.' %recalls[opt_id]) print('Optimal Macro-F1 of late fusion model is %f.' %macrof1[opt_id]) # fuse 3 models print("----------------------------------------------------") print("Combining 3 models in the rule-based late fusion model: text + social features + hashtags ") print("----------------------------------------------------") weights = [] for w1 in np.arange(0,0.7,0.01): for w2 in np.arange(0,0.7,0.01): w3 = 1-w1-w2 weights.append([w1, w2, w3]) precisions = [] recalls = [] macrof1 = [] for i in range(len(weights)): w_count, w_text, w_hashtag = weights[i] result_prob = w_count*prob_count + w_text*prob_text + w_hashtag*prob_hashtag result = np.argmax(result_prob, axis=1) avg_p = precision_score(y, result, average='macro') avg_r = recall_score(y, result, average='macro') macro_f1 = f1_score(y,result, average='macro') precisions.append(avg_p) recalls.append(avg_r) macrof1.append(macro_f1) opt_id = np.argmax(macrof1) print('Weight of social_feature_classifier: ' + str(weights[opt_id][0])) print('Weight of vader_sentiment_analyzer: '+ str(weights[opt_id][1])) print('Weight of hashtag_classifier: '+ str(weights[opt_id][2])) print('Optimal Precision of late fusion model is %f.' %precisions[opt_id]) print('Optimal Recall of late fusion model is %f.' %recalls[opt_id]) print('Optimal Macro-F1 of late fusion model is %f.' %macrof1[opt_id])
{"/Step2_fused_analyzer.py": ["/hashtag.py"]}
40,808
clairewangjia/Text-Sentiment-Analysis
refs/heads/master
/Step1_social_hashtag_preprocess.py
# encoding=utf8 import sys reload(sys) sys.setdefaultencoding('utf8') import os import re import nltk # nltk.download() from nltk.corpus import stopwords import simplejson as json import pickle import numpy as np import pandas as pd def rm_html_tags(str): html_prog = re.compile(r'<[^>]+>',re.S) return html_prog.sub('', str) def rm_html_escape_characters(str): pattern_str = r'&quot;|&amp;|&lt;|&gt;|&nbsp;|&#34;|&#38;|&#60;|&#62;|&#160;|&#20284;|&#30524;|&#26684|&#43;|&#20540|&#23612;' escape_characters_prog = re.compile(pattern_str, re.S) return escape_characters_prog.sub('', str) def rm_at_user(str): return re.sub(r'@[a-zA-Z_0-9]*', '', str) def rm_url(str): return re.sub(r'http[s]?:[/+]?[a-zA-Z0-9_\.\/]*', '', str) def rm_repeat_chars(str): return re.sub(r'(.)(\1){2,}', r'\1\1', str) def rm_hashtag_symbol(str): return re.sub(r'#', '', str) def replace_emoticon(emoticon_dict, str): for k, v in emoticon_dict.items(): str = str.replace(k, v) return str def rm_time(str): return re.sub(r'[0-9][0-9]:[0-9][0-9]', '', str) def rm_punctuation(current_tweet): return re.sub(r'[^\w\s]','',current_tweet) def pre_process(str, porter): # do not change the preprocessing order only if you know what you're doing str = str.lower() str = rm_url(str) str = rm_at_user(str) str = rm_repeat_chars(str) str = rm_hashtag_symbol(str) str = rm_time(str) str = rm_punctuation(str) try: str = nltk.tokenize.word_tokenize(str) try: str = [porter.stem(t) for t in str] except: print(str) pass except: print(str) pass return str if __name__ == "__main__": data_dir = './data' ##Setting your own file path here. x_filename = 'tweets.txt' y_filename = 'labels.txt' porter = nltk.PorterStemmer() stops = set(stopwords.words('english')) stops.add('rt') ##load and process samples print('start extract social features...') retweets = [] likes = [] friends = [] followers = [] lists = [] favourites = [] statuses = [] cnt = 0 with open(os.path.join(data_dir, x_filename)) as f: for i, line in enumerate(f): tweet_obj = json.loads(line.strip(), encoding='utf-8') retweet = tweet_obj['retweet_count'] like = tweet_obj['favorite_count'] friend = tweet_obj['user']['friends_count'] follower = tweet_obj['user']['followers_count'] listed = tweet_obj['user']['listed_count'] favourite = tweet_obj['user']['favourites_count'] statuse = tweet_obj['user']['statuses_count'] retweets.append(retweet) likes.append(like) friends.append(friend) followers.append(follower) lists.append(listed) favourites.append(favourite) statuses.append(statuse) tweets_df = pd.DataFrame( {'retweets': retweets, 'likes': likes, 'friends': friends, 'followers': followers, 'lists': lists, 'favourites': favourites, 'statuses': statuses }) print('Samples of extracted features...') print tweets_df.head(5) ###Save df to csv tweets_df.to_csv('./data/features_processed.csv', index=False) print("Social features preprocessing is completed") ##load and process hashtags print("Start extract and process hashtags...") words_stat = {} hashtags = [] cnt = 0 with open(os.path.join(data_dir, x_filename)) as f: for i, line in enumerate(f): postprocess_tweet = [] tweet_obj = json.loads(line.strip(), encoding='utf-8') hashtag_dict = tweet_obj['entities']['hashtags'] if len(hashtag_dict) > 0: hashtag_list = [] for h in hashtag_dict: single_tag = h['text'] hashtag_list.append(single_tag) hashtag = ' '.join(hashtag_list) else: hashtag = "" words = pre_process(hashtag, porter) for word in words: if word not in stops: postprocess_tweet.append(word) if word in words_stat.keys(): words_stat[word][0] += 1 if i != words_stat[word][2]: words_stat[word][1] += 1 words_stat[word][2] = i else: words_stat[word] = [1,1,i] hashtags.append(' '.join(postprocess_tweet)) ##saving the statistics of tf and df for each words into file print("The number of unique words in hashtag data set is %i." %len(words_stat.keys())) lowTF_words = set() # with open(os.path.join(data_dir, 'words_statistics_hashtag.txt'), 'w', encoding='utf-8') as f: # f.write('TF\tDF\tWORD\n') for word, stat in sorted(words_stat.items(), key=lambda i: i[1], reverse=True): if stat[0]<2: lowTF_words.add(word) print("The number of low frequency words of hashtags is %d." %len(lowTF_words)) # print(stops) ###Re-process samples, filter low frequency words... fout = open(os.path.join(data_dir, 'hashtag_processed.txt'), 'w') hashtag_new = [] for hashtag in hashtags: words = hashtag.split(' ') new = [] for w in words: if w not in lowTF_words: new.append(w) new_hashtag = ' '.join(new) hashtag_new.append(new_hashtag) fout.write('%s\n' %new_hashtag) fout.close() print("Hashtag preprocessing is completed")
{"/Step2_fused_analyzer.py": ["/hashtag.py"]}
40,809
clairewangjia/Text-Sentiment-Analysis
refs/heads/master
/hashtag.py
import os import numpy as np from sklearn.feature_extraction.text import TfidfVectorizer from sklearn.model_selection import KFold from sklearn.naive_bayes import MultinomialNB from sklearn.neighbors import KNeighborsClassifier from sklearn.linear_model import LogisticRegression from sklearn.ensemble import RandomForestClassifier from sklearn.metrics import classification_report, precision_score, recall_score, f1_score from sklearn.linear_model import SGDClassifier def main(): # if __name__ == "__main__": data_dir = './data' print("Loading data...") with open(os.path.join(data_dir, 'hashtag_processed.txt'), 'r') as f_hashtag: x_hashtag = f_hashtag.readlines() with open(os.path.join(data_dir, 'labels.txt'), 'r') as f: y = np.array(f.readlines()) print("Extract features...") x_hashtag_feats = TfidfVectorizer().fit_transform(x_hashtag) print(x_hashtag_feats.shape) print("Start training and predict...") n = 3 prob_hashtag= np.empty(shape=[0, n]) kf = KFold(n_splits=10) avg_p = 0 avg_r = 0 macro_f1 = 0 for train, test in kf.split(x_hashtag_feats): model = MultinomialNB().fit(x_hashtag_feats[train], y[train]) # model = KNeighborsClassifier(n_neighbors=7).fit(x_hashtag_feats[train], y[train]) # model = RandomForestClassifier(n_estimators=500, max_features=7, random_state=0).fit(x_hashtag_feats[train], y[train]) # model = LogisticRegression().fit(x_hashtag_feats[train], y[train]) # model = SGDClassifier(loss='log', penalty='l2', alpha=1e-3, random_state=0, max_iter=100).fit(x_hashtag_feats[train], y[train]) prob = model.predict_proba(x_hashtag_feats[test]) predicts = model.predict(x_hashtag_feats[test]) # print(classification_report(y[test],predicts)) prob_hashtag = np.concatenate((prob_hashtag, prob)) avg_p += precision_score(y[test],predicts, average='macro') avg_r += recall_score(y[test],predicts, average='macro') macro_f1 += f1_score(y[test],predicts, average='macro') print('Average Precision of hashtag classifer is %f.' %(avg_p/10.0)) print('Average Recall of hashtag classifer is %f.' %(avg_r/10.0)) print('Average Macro-F1 of hashtag classifer is %f.' %(macro_f1/10.0)) return prob_hashtag
{"/Step2_fused_analyzer.py": ["/hashtag.py"]}
40,813
Chetan8462/hackowasp
refs/heads/main
/user/models.py
from django.db import models from phonenumber_field.modelfields import PhoneNumberField from django.contrib.auth.models import AbstractUser from django.contrib.auth.base_user import BaseUserManager from phonenumber_field.modelfields import PhoneNumberField from home.models import * class CustomUserManager(BaseUserManager): def create_superuser(self, email, password=None): user = self.model(email=email, is_staff=True, is_superuser=True) user.set_password(password) user.save() return user class User(AbstractUser): """docstring for User""" username = None email = models.EmailField(verbose_name='Email Address', unique=True) # name = models.CharField(max_length=50) # contact_no = PhoneNumberField(help_text='Add country code before the contact no.', null=True) USERNAME_FIELD = 'email' user_permissions = None groups = None REQUIRED_FIELDS = [] objects = CustomUserManager() def __str__(self): return self.email
{"/user/forms.py": ["/user/models.py"], "/user/views.py": ["/user/forms.py", "/user/models.py"]}
40,814
Chetan8462/hackowasp
refs/heads/main
/user/forms.py
from django import forms from django.contrib.auth.forms import UserCreationForm from phonenumber_field.formfields import PhoneNumberField from django.db import transaction from .models import User from django.contrib.auth import get_user_model User = get_user_model() class RegistrationForm(UserCreationForm): class Meta(UserCreationForm.Meta): model = User fields = ['email', 'password1','password2']
{"/user/forms.py": ["/user/models.py"], "/user/views.py": ["/user/forms.py", "/user/models.py"]}
40,815
Chetan8462/hackowasp
refs/heads/main
/user/views.py
from django.shortcuts import render, redirect from django.contrib.auth.forms import UserCreationForm from .forms import RegistrationForm from django.contrib import messages from django.contrib.auth import get_user_model from .models import User User = get_user_model() def register(request): if request.method == 'POST': form = RegistrationForm(request.POST) if form.is_valid(): user = form.save() user.save() return redirect('login') else: form = RegistrationForm() return render(request, 'user/register.html', {'form': form})
{"/user/forms.py": ["/user/models.py"], "/user/views.py": ["/user/forms.py", "/user/models.py"]}
40,817
raulium/jarvis
refs/heads/master
/vacation_mod.py
#!/usr/local/env python # ============== CONFIG PARAMETERS from config import SNOOZE_TIME, READING_TIME, BED_TIME # ============== INTERNAL LIBRARIES from timing_mod import snooze from IFTTT_mod import IFTTT from mac_mod import openApp, setLivingRoom, startRadio, setVolume, setDisplay, macTerm # ============== EXTERNAL LIBRARIES import os.path def vMorningRoutine(): snooze(SNOOZE_TIME) def vEveningRoutine(): snooze(READING_TIME) # closeApp("Google Chrome") IFTTT("reading") snooze(BED_TIME) IFTTT("sunset") IFTTT("lights_off") def away(): if not checkAwayStatus(): cmd = ['touch', '/tmp/away.lock'] macTerm(cmd) # setLivingRoom() # setVolume(5) def back(): if checkAwayStatus(): cmd = ['rm', '/tmp/away.lock'] macTerm(cmd) # setDisplay() def checkAwayStatus(): result = os.path.exists('/tmp/away.lock') return result def setVacation(): cmd = 'touch /tmp/vacation.lock' macTerm(cmd) def rmVacation(): cmd = 'rm /tmp/vacation.lock' macTerm(cmd) def checkVacationStatus(): result = os.path.exists('/tmp/vacation.lock') return result
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,818
raulium/jarvis
refs/heads/master
/gmail_mod.py
from __future__ import print_function # ============== CONFIG PARAMETERS from config import EMAIL, USERNAME # ============== INTERNAL LIBRARIES # ============== EXTERNAL LIBRARIES import httplib2 import os import base64 from apiclient import discovery, errors from oauth2client import client from oauth2client import tools from oauth2client.file import Storage from email.MIMEText import MIMEText try: import argparse flags = argparse.ArgumentParser(parents=[tools.argparser]).parse_args() except ImportError: flags = None SCOPES = 'https://www.googleapis.com/auth/gmail.send' CLIENT_SECRET_FILE = 'client_secret.json' APPLICATION_NAME = 'GMAIL API Python Quickstart' def get_credentials(): home_dir = os.path.expanduser('/Users/' + USERNAME + '/') credential_dir = os.path.join(home_dir, '.credentials') if not os.path.exists(credential_dir): os.makedirs(credential_dir) credential_path = os.path.join(credential_dir, 'gmail-python-quickstart.json') store = Storage(credential_path) credentials = store.get() if not credentials or credentials.invalid: flow = client.flow_from_clientsecrets(CLIENT_SECRET_FILE, SCOPES) flow.user_agent = APPLICATION_NAME if flags: credentials = tools.run_flow(flow, store, flags) else: credentials = tools.run(flow, store) print('Storing credentials to ' + credential_path) return credentials def create_message(sender, to, subject, message_text): message = MIMEText(message_text) message['to'] = to message['from'] = sender message['subject'] = subject return {'raw': base64.urlsafe_b64encode(message.as_string())} def send_message(service, user_id, message): try: message = (service.users().messages().send(userId=user_id, body=message) .execute()) print("Message Id: " + str(message['id'])) return message except errors.HttpError as error: print('An error occurred: ' + str(error)) def sendGmail(mail_to, mail_subject, mail_body): credentials = get_credentials() http = credentials.authorize(httplib2.Http()) service = discovery.build('gmail', 'v1', http=http) sender = EMAIL to = mail_to subject = mail_subject message_text = mail_body compose_message = create_message(sender=sender, to=to, subject=subject, message_text=message_text) send_message(service=service, user_id='me', message=compose_message)
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,819
raulium/jarvis
refs/heads/master
/morning_mod.py
#!/usr/bin/python # ============== EXTERNAL LIBRARIES import time import random from datetime import datetime from atd import atd # ============== CONFIG PARAMETERS\ from config import DOW, NAME, SNOOZE_TIME, NORMAL_TIME # ============== INTERNAL LIBRARIES from interaction_mod import GREETING, WAKE, say, laboratoryOptions, volunteerOptions, dayOffOptions, DAY_ASSES from timing_mod import holidayDict, snooze, t_minus, getTime from IFTTT_mod import IFTTT, IFTTTcmd from lab_mod import labStatus from mac_mod import setVolume, setDisplay, startMusic, openPage from weather_mod import getSunsetDTO, newDailyReport from math_mod import maths from motivation_mod import daysToWeekend, weeksToDate, counterString, motivate # ======================================================================= # [Good] Morning [Raul]. | The time is [Time], and [All is well]. | [It seems today will be a] [beautiful] [day of the week] # The temperature is [temp], with an expected high of [high] and a low of [low]. # [Bad conditions] # - conditions # - dew point # - dew point distance # [Holiday condition] # And may I also wish you a happy [holiday] # NEW MORNING def dayMessage(): WD = datetime.today().weekday() day_evaluation, bad_conditions, weather_segment = newDailyReport() print("Bad Conditions: " + ', '.join(bad_conditions)) day_segment = random.choice(DAY_ASSES) + day_evaluation + " " + DOW[WD] + "." bad_segment = " " if len(bad_conditions) > 0: bad_segment = "Weather conditions to consider are: " + ', '.join(bad_conditions) holiday_segment = "" holString = holidayDict() if holString: holiday_segment = "And may I also wish you a happy " + holString + "." message = day_segment + ". " + weather_segment + ". " + bad_segment + ". " + holiday_segment + "." return message def morningRoutine(): WD = datetime.today().weekday() statusMessage = dayMessage() if WD >= 5: # It's a weekend snooze(t_minus(SNOOZE_TIME, 30)) IFTTT("sunrise") snooze(SNOOZE_TIME) else: if labStatus(): # Where "True" or "1" means closed if not holString: openPage("http://www.ll.mit.edu/status/index.html") statusMessage = "The laboratory appears to be closed today. I've opened the lab's status page, if you care to learn more. " + statusMessage snooze(t_minus(SNOOZE_TIME, 30)) IFTTT("sunrise") snooze(SNOOZE_TIME) else: snooze(t_minus(NORMAL_TIME, 30)) IFTTT("sunrise") snooze(NORMAL_TIME) setVolume(5) setDisplay() sunset = getSunsetDTO() l = IFTTTcmd('living_room_lifx') w = IFTTTcmd('living_room_wink') atd.at(l, sunset) atd.at(w, sunset) startMusic() time.sleep(30) greeting_segment = random.choice(GREETING) + ", " + NAME + "." time_segment = "The time is " + getTime() + " " + random.choice(WAKE) say(greeting_segment + ". " + time_segment) time.sleep(40) myStatus = 0 if datetime.today().weekday() <= 4: myStatus = laboratoryOptions() elif datetime.today().weekday() == 5: myStatus = volunteerOptions() else: myStatus = dayOffOptions() if myStatus < 1: maths() time.sleep(5) IFTTT("lights_on") IFTTT("wakeup") say(statusMessage) semesterEnd = datetime(2018, 06, 22) say(counterString(daysToWeekend(), "day") + " the weekend, and " + counterString(weeksToDate(semesterEnd),"week") + " the Chad returns.") say(motivate()) else: say("Everything has been taken care of. Feel free to go back to bed.")
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,820
raulium/jarvis
refs/heads/master
/evening_mod.py
#!/usr/local/env python # ============== CONFIG PARAMETERS from config import READING_TIME, BED_TIME # ============== INTERNAL LIBRARIES from interaction_mod import WARN, saiff from timing_mod import getCurrentTime, snooze, t_minus from mac_mod import notification, setLivingRoom, setDisplay from IFTTT_mod import IFTTT # ============== EXTERNAL LIBRARIES import time import random def eveningRoutine(): h, m, t = getCurrentTime() timestring = str(h) + ":" + str(m) + " " + t title = "Time Notification" msg = "It is " + timestring + "." notification(title, msg) snooze(t_minus(READING_TIME, 10)) h, m, t = getCurrentTime() timestring = str(h) + ":" + str(m) + " " + t title = "Time Notification" msg = "It is " + timestring + "." notification(title, msg) notification(title, msg) rmsg = random.choice(WARN) + " It is " + timestring + "." setLivingRoom() time.sleep(1) saiff(rmsg, 'evening') setDisplay() notification(title, "This computer will lock in 10 min.") snooze(READING_TIME) IFTTT("reading") snooze(t_minus(BED_TIME, 5)) IFTTT("light_notice") snooze(BED_TIME) IFTTT("light_notice") IFTTT("sunset") IFTTT("lights_off")
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,821
raulium/jarvis
refs/heads/master
/web_mod.py
#!/usr/local/env python # ============== CONFIG PARAMETERS # ============== INTERNAL LIBRARIES # ============== EXTERNAL LIBRARIES import re import urllib from BeautifulSoup import BeautifulSoup as bsp class MyOpener(urllib.FancyURLopener): version = 'Mozilla/5.0 (Windows NT 6.1) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/41.0.2228.0 Safari/537.36' def ripText(URL): soup = bsp(urllib.urlopen(URL).read()) p = soup.body.div.findAll('p') strings = str(p[0]) strings = re.sub("<p>", '', strings) strings = re.sub("</p>", '', strings) strings = strings.split('.') return strings
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,822
raulium/jarvis
refs/heads/master
/lab_mod.py
#!/usr/local/env python # ============== CONFIG PARAMETERS # ============== INTERNAL LIBRARIES from web_mod import ripText # ============== EXTERNAL LIBRARIES def labStatus(): """Check status of the Laboratory, returning 0 if open & 1 if closed""" statMSG = ripText("http://www.ll.mit.edu/status/index.html") if "closed" in str(statMSG[0]): return 1 if "open" in str(statMSG[0]): return 0
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,823
raulium/jarvis
refs/heads/master
/math_mod.py
#!/usr/local/env python # ============== EXTERNAL LIBRARIES import random from word2number import w2n # ============== CONFIG PARAMETERS # ============== INTERNAL LIBRARIES from interaction_mod import POSITIVE, NEGATIVE, say, getReply def do_math(): # COULD USE REWORK. WHAT HAPPENS IF YOU NEVER HEAR A REPLY? (BREAK!) """ Function poses the user a math problem, evaluates the response and determines if the user got the problem right (1) or wrong (0) """ val1 = random.randint(3, 9) val2 = random.randint(6, 9) answer = val1 * val2 say('What is ' + str(val1) + ' multiplied by ' + str(val2) + '?') reply = getReply() try: reply = w2n.word_to_num(reply) except ValueError: say(random.choice(NEGATIVE)) return 0 if reply == answer: say(random.choice(POSITIVE)) return 1 else: say(random.choice(NEGATIVE)) return 0 def maths(): # Maybe rename this? """ Function traps user in a loop, requiring the user to answer three (3) math problems correctly before exiting. """ say("How about a little exercise?") i = 0 while i < 3: result = do_math() if result < 1: i = 0 else: i += result def main(): """ run maths """ maths() if __name__ == '__main__': main()
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,824
raulium/jarvis
refs/heads/master
/interaction_mod.py
#!/usr/local/env python # ============== EXTERNAL LIBRARIES import random import time from subprocess import Popen import speech_recognition as sr from gmail_mod import sendGmail # ============== CONFIG PARAMETERS from config import NAME, WORK_LIST_STRING, ILL_MSG, WFH_MSG, VOLUNTEER_EMAIL, VOLUNTEER_ILL_MSG, VOLUNTEER_WFH_MSG # ============== INTERNAL LIBRARIES from mac_mod import check_process # ============== CUSTOM REACTIONS & INTERACTION SPEECH GREETING = ["Good morning", "Top of the morning", "Rise and shine", "Another dawn, another day", "Time to get up"] WAKE = ["This is your monring wake up call.", "It is time to start your day.", "which means it's that time again.", "So let's not be lazy.", "And all is well."] LAZY = ["It is time to get up.", "You can't blame anyone but yourself.", "It will only get worse from here if you don't get up."] POSITIVE = ["Excellent!", "Perfect!", "Splended!", "Good enough.", "Wonderful.", "Outstanding!", "Marvelous!", "Great!", "Fantastic!", "Okay."] NEGATIVE = ["Incorrect", "No.", "That's offensive", "Inferior performance", "R you even trying", "I think not.", "This is sad."] WARN = [NAME + ", it's that time again.", "It is time to get ready for bed.", "The bells are tolling, " + NAME + ".", "Early to bed, early to rise."] ILL_KEYS = ["not feeling well", "sick", "don't feel", "ill"] WFH_KEYS = ["staying", "sleeping", "not going in", "day off", "working from home"] DAY_ASSES = ["It seems today will be a", "It appears today will be a", "Today will be a", "It looks as though today might be a"] GREAT = ["n amazing", " great", " beautiful", " terrific", " perfect"] GOOD = [" good", " pretty good", " plesant", " favorable"] OKAY = ["n alright", " decent", "n okay", " satisfactory"] BAD = [" terrible", "bad", "unfavorable", "n unsatisfactory", "n ugly"] # ============== INTERACTION functions def say(STRING): cmd = 'say -v Lee "' + STRING + '"' Popen(cmd, shell=True) saytrap() def saiff(STRING, NAME): cmd = 'say -v Lee "' + STRING + '" -o /tmp/' + NAME + '.aiff' Popen(cmd, shell=True) paiff(NAME) def paiff(NAME): cmd = 'afplay /tmp/' + NAME + '.aiff' Popen(cmd, shell=True) aifftrap() def saytrap(): while (check_process('say') == True): continue def aifftrap(): while (check_process('afplay') == True): continue def laboratoryOptions(): while 1: say("Are you ready to start your day?") reply = getReply() if reply is "ERR": say("I'm sorry, I didn't quite catch that.") elif reply is "NULL": mystring = NAME + " " + random.choice(LAZY) say(mystring) elif any(o in reply for o in ILL_KEYS): say("I'm sorry to hear that. Would you like me to contact the Laboratory?") confirm = getReply() if 'yes' in confirm: say("Very well. Sending message now.") sendGmail(WORK_LIST_STRING, "Sick Day", ILL_MSG) return 1 if 'no' in confirm: say("Then you shouldn't say you're feeling ill.") return 0 elif any(o in reply for o in WFH_KEYS): say("Would you like me to notify the Laboratory?") confirm = getReply() if 'yes' in confirm: say("Very well. Sending message now.") sendGmail(WORK_LIST_STRING, "WFH Today", WFH_MSG) return 0 if 'no' in confirm: say("Then you should have said you were ready to start your day.") return 0 else: say(random.choice(POSITIVE)) break def volunteerOptions(): while 1: say("Are you ready to start your day?") reply = getReply() if reply is "ERR": say("I'm sorry, I didn't quite catch that.") elif reply is "NULL": mystring = NAME + " " + random.choice(LAZY) say(mystring) elif any(o in reply for o in ILL_KEYS): say("I'm sorry to hear that. Would you like me to contact the Museum?") confirm = getReply() if 'yes' in confirm: say("Very well. Sending message now.") sendGmail(VOLUNTEER_EMAIL, "Out Sick", VOLUNTEER_ILL_MSG) return 1 if 'no' in confirm: say("Then you shouldn't say you're feeling ill.") return 0 elif any(o in reply for o in WFH_KEYS): say("Would you like me to notify the Museum?") confirm = getReply() if 'yes' in confirm: say("Very well. Sending message now.") sendGmail(VOLUNTEER_EMAIL, "Out Today", VOLUNTEER_WFH_MSG) return 1 if 'no' in confirm: say("Then you should have said you were ready to start your day.") return 0 else: say(random.choice(POSITIVE)) break def dayOffOptions(): while 1: say("Are you ready to start your day?") reply = getReply() if reply is "ERR": say("I'm sorry, I didn't quite catch that.") elif reply is "NULL": mystring = NAME + " " + random.choice(LAZY) say(mystring) else: say(random.choice(POSITIVE)) return 0 def getReply(): r = sr.Recognizer() with sr.Microphone() as source: reply = "NULL" r.adjust_for_ambient_noise(source, duration=1) audio = r.listen(source, timeout=10) try: reply = r.recognize_sphinx(audio) print("R:\t" + str(reply)) except sr.WaitTimeoutError: reply = "NULL" except sr.UnknownValueError: reply = "ERR" except sr.RequestError as e: print("Spinx error; {0}".format(e)) return reply # def getReply(): # try: # r = sr.Recognizer() # with sr.Microphone() as source: # r.adjust_for_ambient_noise(source, duration=1) # audio = r.listen(source, timeout=10) # try: # reply = r.recognize_google(audio) # except LookupError: # reply = "ERR" # Bad input condition # except sr.WaitTimeoutError: # reply = "NULL" # Nil heard # except sr.UnknownValueError: # reply = "ERR" # Bad input condition # return reply # Return transcript of reply def micTest(): say("Voice authorization required.") r = getReply() if 'authorization' in r: r = r.split('authorization') r = r[1] time.sleep(0.2) say(r + " recieved.") say('Authorization accepted. Hello, ' + NAME + ".")
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,825
raulium/jarvis
refs/heads/master
/timing_mod.py
#!/usr/local/env python # ============== EXTERNAL LIBRARIES from __future__ import print_function import holidays import time from datetime import datetime, timedelta, date # ============== INTERNAL LIBRARIES # ============== CONFIG PARAMETERS from config import MY_STATE def getCurrentTime(): hour = datetime.now().hour if hour > 12: hour = hour - 12 tod = "PM" else: tod = "AM" m = datetime.now().minute if m < 10: m = "0" + str(m) return hour, m, tod def getTime(): hour, m, tod = getCurrentTime() myTime = str(hour) + ":" + str(m) + " " + str(tod) return myTime def snooze(new_alarm): newhour = int(new_alarm.split(':')[0]) newmin = int(new_alarm.split(':')[1].split(' ')[0]) newperiod = new_alarm.split(' ')[1] year = datetime.now().year month = datetime.now().month day = datetime.now().day if newperiod == "PM": newhour += 12 wait = 1 while wait > 0: time.sleep(wait) wait = int((datetime(year, month, day, newhour, newmin) - datetime.now()).total_seconds()) def dto_to_string(MY_DTO): hour = MY_DTO.hour mins = MY_DTO.minute if hour > 12: return str(hour - 12) + ':' + str(mins) + " PM" else: return str(hour) + ':' + str(mins) + " AM" def t_minus(time_string, minus): h = int(time_string.split(':')[0]) m = int(time_string.split(':')[1].split(' ')[0]) t = time_string.split(' ')[1] year = datetime.now().year month = datetime.now().month day = datetime.now().day if t == "PM": if h < 12: h += 12 else: if h == 12: h -= 12 diff = datetime(year, month, day, h, m) - timedelta(minutes=minus) print(diff) if diff.hour > 12: th = int(diff.hour) - 12 tp = "PM" else: th = int(diff.hour) tp = "AM" new_string = str(th) + ':' + str(diff.minute) + " " + tp return new_string def holidayDict(): us_holidays = holidays.UnitedStates(state=MY_STATE) t = datetime.now().date() if t in us_holidays: return us_holidays.get(t) else: return None def julianDate(): return date.today().timetuple().tm_yday def whatSeason(**keyword_parameters): """ Returns integer 0-3 for the season of a given julian date, or current date if no julian is provided. 0 = spring 1 = summer 2 = fall 3 = winter """ JULIAN = julianDate() if 'julian' in keyword_parameters: JULIAN = keyword_parameters['julian'] # "day of year" ranges for the northern hemisphere spring = range(80, 171) summer = range(172, 263) fall = range(264, 354) # winter = everything else if JULIAN in spring: return 0 elif JULIAN in summer: return 1 elif JULIAN in fall: return 2 else: return 3
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,826
raulium/jarvis
refs/heads/master
/main.py
#!/usr/bin/python # ============== CONFIG PARAMETERS from config import MASTERKEY, HOST_IP, BASE_PATH # ============== INTERNAL LIBRARIES from vacation_mod import vMorningRoutine, vEveningRoutine, checkVacationStatus, setVacation, rmVacation from interaction_mod import say, micTest from mac_mod import startMusic, setLivingRoom, setDisplay from morning_mod import morningRoutine, dayMessage from evening_mod import eveningRoutine from IFTTT_mod import IFTTT # ============== EXTERNAL LIBRARIES import time import sys import logging from flask import Flask, request, abort from subprocess import Popen from datetime import datetime app = Flask(__name__) def data_check(): data = request.get_json(force=True) if data is not None: app.logger.debug("JSON Recieved -- " + str(data)) if MASTERKEY in data["key"]: return True else: app.logger.debug("Bad Key") return False else: app.logger.debug("No JSON recieved") return False def apiReturn(myString): return str(datetime.now()) + ":\t" + myString + "\t -- SUCCESS!\n" @app.route('/') def index(): abort(404) # @app.route('/away', methods=['POST']) # def iaway(): # data = request.get_json(force=True) # # if data is not None: # app.logger.debug("JSON Recieved -- " + str(data)) # # if MASTERKEY in data["key"]: # away() # return str(datetime.now()) + ":\tTEST - SUCCESS!\n" # else: # abort(404) # else: # app.logger.debug("No JSON recieved") # abort(404) # # @app.route('/back', methods=['POST']) # def iback(): # data = request.get_json(force=True) # # if data is not None: # app.logger.debug("JSON Recieved -- " + str(data)) # # if MASTERKEY in data["key"]: # back() # return str(datetime.now()) + ":\tTEST - SUCCESS!\n" # else: # abort(404) # else: # app.logger.debug("No JSON recieved") # abort(404) @app.route('/load', methods=['POST']) def loading(): f = "LOADING" status = data_check() if status: say("Loading system services.") return apiReturn(f) else: abort(404) @app.route('/away', methods=['POST']) def gone(): f = 'AWAY' status = data_check() if status: if checkVacationStatus(): say('Vacation mode already active.') return apiReturn('REDUNDANT') setVacation() say("Vacation mode activated.") return apiReturn(f) else: abort(404) @app.route('/back', methods=['POST']) def here(): f = 'BACK' status = data_check() if status: if not checkVacationStatus(): say("Vacation mode already deactivated.") return apiReturn("REDUNDANT") rmVacation() say("Vacation mode deactivated.") return apiReturn(f) else: abort(404) @app.route('/test', methods=['POST']) def testing(): f = "TESTING" status = data_check() if status: say("Test complete. All systems are functioning as expected.") return apiReturn(f) else: abort(404) @app.route('/morning', methods=['POST']) def morn_func(): f = "MORNING" status = data_check() if status: if checkVacationStatus(): vMorningRoutine() else: morningRoutine() return apiReturn(f) else: abort(404) @app.route('/evening', methods=['POST']) def eve_func(): f = "EVENING" status = data_check() if status: if checkVacationStatus(): vEveningRoutine() else: eveningRoutine() return apiReturn(f) else: abort(404) @app.route('/movie', methods=['POST']) def movie_time(): f = "MOVIE" status = data_check() if status: IFTTT('dim_lighting') IFTTT('movie_time') return apiReturn(f) else: abort(404) @app.route('/music', methods=['POST']) def music_time(): f = "MUSIC" status = data_check() if status: startMusic() return apiReturn(f) else: abort(404) @app.route('/living', methods=['POST']) def living(): f = "LIVINGROOM" status = data_check() if status: setLivingRoom() return apiReturn(f) else: abort(404) @app.route('/display', methods=['POST']) def display(): f = "DISPLAY" status = data_check() if status: setDisplay() return apiReturn(f) else: abort(404) @app.route('/mic', methods=['POST']) def mic(): f = "MIC" status = data_check() if status: micTest() return apiReturn(f) else: abort(404) @app.route('/redalert', methods=['POST']) def redalert(): f = "REDALERT" status = data_check() if status: setLivingRoom() time.sleep(3) IFTTT('dim_lighting') Popen(["afplay", BASE_PATH + "/git/jarvis/redalert.mp3"]) IFTTT('klaxon') time.sleep(10) setDisplay() return apiReturn(f) else: abort(404) @app.route('/weather', methods=['POST']) def current(): f = "WEATHER" status = data_check() if status: msg = dayMessage() say(msg) return apiReturn(f) else: abort(404) if __name__ == '__main__': logging.basicConfig(stream=sys.stdout, level=logging.DEBUG) app.run(host=HOST_IP, threaded=True, debug=True)
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,827
raulium/jarvis
refs/heads/master
/mac_mod.py
#!/usr/local/env python # ============== CONFIG PARAMETERS from __future__ import print_function from config import BASE_PATH, EMAIL, ICLOUD, IPHONE_ID, HOME_COORD, USERNAME # ============== INTERNAL LIBRARIES # ============== EXTERNAL LIBRARIES import time import csv from subprocess import Popen, PIPE from pyicloud import PyiCloudService def iCloudConnect(): api = PyiCloudService(EMAIL) if api.requires_2fa: import click print("Two-factor authentication required. Your trusted devices are:") devices = api.trusted_devices for i, device in enumerate(devices): print(" %s: %s" % (i, device.get('deviceName', "SMS to %s" % device.get('phoneNumber')))) device = click.prompt('Which device would you like to use?', default=0) device = devices[device] if not api.send_verification_code(device): print("Failed to send verification code") sys.exit(1) code = click.prompt('Please enter validation code') if not api.validate_verification_code(device, code): print("Failed to verify verification code") sys.exit(1) def check_process(PROCESS_NAME): cmd = "ps -ef | grep " + PROCESS_NAME process_list = Popen( cmd, stdout=PIPE, shell=True ) out, err = process_list.communicate() fields = ['UID', 'PID', 'PPID', 'C', 'STIME', 'TTY', 'TIME', 'CMD'] reader = csv.DictReader(out.decode('ascii').splitlines(), delimiter=' ', skipinitialspace=True, fieldnames=fields) for row in reader: if row['CMD'] == PROCESS_NAME: return True; else: continue return False; def macTerm(CMD): runcmd = 'sudo -u ' + USERNAME + ' ' + CMD Popen(runcmd, shell=True) def appleScript(CMD): c = 'osascript -e ' + CMD macTerm(c) def setVolume(VALUE): """ ... for an ungodly reason, Apple has made it such that the volume scale is from 0 - 7. And real numbers. Meaning 3.5 is the center of the scale. ... w... t... f... """ cmd = '"set Volume ' + str(VALUE) + '"' appleScript(cmd) def setLivingRoom(): """ Set Audio Output to Living Room. """ setVolume(7) cmd = BASE_PATH + 'AppleScripts/audioLivingRoom.applescript' macTerm(cmd) time.sleep(2) def setDisplay(): """ Set Audio Output to Cinema Display. """ setVolume(4) cmd = BASE_PATH + 'AppleScripts/audioDisplay.applescript' macTerm(cmd) time.sleep(2) # THIS DOESN'T APPEAR TO WORK... INVESTIGATE # def lockScreen(): # """Lock the screen""" # Popen(['/System/Library/CoreServices/Menu Extras/User.menu/Contents/Resources/CGSession', '-suspend']) def notification(TITLE, MSG): """ Send notification to Notificaiton Center. """ cmd = "display notification " + '"' + MSG + '"' + " with title " + '"' + TITLE + '" sound name "Hero"' appleScript(cmd) def ifMuted(): out, err = Popen(['osascript', '-e', 'get volume settings'], stdout=PIPE).communicate() l = out.split(',') if 'true' in str(l[3]): return 1 else: return 0 # STOPPED WORKING -- FIX THIS def startRadio(): openPage("http://www.wgbh.org/audioPlayers/wgbh.cfm") def startMusic(): openApp('Spotify') time.sleep(5) cmd1 = "osascript -e 'tell application " + '"' + "Spotify" + '"' + "' -e 'activate' -e 'end tell'" macTerm(cmd1) cmd2 = "osascript -e 'tell application " + '"' + "Spotify" + '"' + "' -e 'play track " + '"' + "spotify:user:spotify:playlist:37i9dQZEVXcR6wHtFF48p2" + '"' + "' -e 'end tell'" time.sleep(5) macTerm(cmd2) # Popen(cmd2, shell=True) # Popen(cmd2, shell=True) def openPage(URL): Popen(["open", "-a", "Google Chrome", URL]) def closeApp(APPNAME): cmd = "osascript -e ' quit app " + '"' + str(APPNAME) + '"' + "'" Popen(cmd, shell=True) def openApp(APPNAME): cmd = "open -a '" + str(APPNAME) + "'" macTerm(cmd) ''' I really don't like this option. it doens't do well to identify the coordinates of the user ''' def ishome(): api = PyiCloudService(EMAIL, ICLOUD) place = dict() for i in api.devices: if IPHONE_ID in str(i): if i.location() is not None: place = i.location() else: place['latitude'] = HOME_COORD['minlat'] place['longitude'] = HOME_COORD['minlon'] if HOME_COORD['minlat'] <= place['latitude'] <= HOME_COORD['maxlat']: if HOME_COORD['minlon'] <= place['longitude'] <= HOME_COORD['maxlon']: return True else: return False else: return False
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,828
raulium/jarvis
refs/heads/master
/IFTTT_mod.py
#!/usr/local/env python # ============== CONFIG PARAMETERS from config import IFTTT_KEY # ============== INTERNAL LIBRARIES # ============== EXTERNAL LIBRARIES from subprocess import Popen def IFTTT(EVENT): url = 'https://maker.ifttt.com/trigger/' + EVENT + '/with/key/' + IFTTT_KEY Popen(['curl', '-X', 'POST', url]) def IFTTTcmd(EVENT): url = 'https://maker.ifttt.com/trigger/' + EVENT + '/with/key/' + IFTTT_KEY cmd = 'curl -X POST ' + url return cmd
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,829
raulium/jarvis
refs/heads/master
/weather_mod.py
#!/usr/local/env python # ============== EXTERNAL LIBRARIES import email import json import math import random from datetime import datetime, timedelta from web_mod import MyOpener # ============== CONFIG PARAMETERS from config import WUNDERGROUND_KEY # ============== INTERNAL LIBRARIES from interaction_mod import GREAT, GOOD, OKAY, BAD from timing_mod import whatSeason WEATHER_SCORE = { # SPRING, SUMMER, FALL, WINTER 'HeavyBlowing Sand': [0.2, 0.2, 0.2, 0.2], 'Blowing Sand': [0.3, 0.3, 0.3, 0.3], 'LightBlowing Sand': [0.3, 0.3, 0.3, 0.3], 'HeavyBlowing Snow': [0.1, 0.0, 0.1, 0.4], 'Blowing Snow': [0.2, 0.0, 0.2, 0.5], 'LightBlowing Snow': [0.3, 0.0, 0.3, 0.6], 'HeavyBlowing Widespread Dust': [0.2, 0.2, 0.2, 0.2], 'Blowing Widespread Dust': [0.3, 0.3, 0.3, 0.3], 'LightBlowing Widespread Dust': [0.4, 0.4, 0.4, 0.4], 'Clear': [1, 1, 1, 1], 'HeavyDrizzle': [0.7, 0.8, 0.6, 0.5], 'Drizzle': [0.8, 0.9, 0.7, 0.6], 'LightDrizzle': [0.9, 0.9, 0.8, 0.7], 'HeavyDust Whirls': [0.1, 0.1, 0.1, 0.1], 'Dust Whirls': [0.2, 0.2, 0.2, 0.2], 'LightDust Whirls': [0.3, 0.3, 0.3, 0.3], 'HeavyFog': [0.8, 0.9, 0.7, 0.7], 'Fog': [0.9, 0.9, 0.8, 0.8], 'LightFog': [1, 1, 0.9, 0.9], 'HeavyFog Patches': [0.9, 0.9, 0.8, 0.8], 'Fog Patches': [1, 1, 0.9, 0.9], 'LightFog Patches': [1, 1, 0.9, 0.9], 'HeavyFreezing Drizzle': [0.1, 0.0, 0.1, 0.4], 'Freezing Drizzle': [0.2, 0.0, 0.2, 0.5], 'LightFreezing Drizzle': [0.3, 0.0, 0.3, 0.6], 'HeavyFreezing Fog': [0.1, 0.0, 0.1, 0.4], 'Freezing Fog': [0.2, 0.0, 0.2, 0.5], 'LightFreezing Fog': [0.3, 0.0, 0.3, 0.6], 'HeavyFreezing Rain': [0.1, 0.0, 0.1, 0.4], 'Freezing Rain': [0.2, 0.0, 0.2, 0.5], 'LightFreezing Rain': [0.3, 0.0, 0.3, 0.6], 'Funnel Cloud': [0.0, 0.0, 0.0, 0.0], 'HeavyHail': [0.3, 0.4, 0.3, 0.4], 'Hail': [0.4, 0.5, 0.4, 0.5], 'LightHail': [0.5, 0.6, 0.5, 0.6], 'HeavyHail Showers': [0.2, 0.3, 0.2, 0.3], 'Hail Showers': [0.3, 0.4, 0.3, 0.4], 'LightHail Showers': [0.4, 0.5, 0.4, 0.5], 'HeavyHaze': [0.3, 0.3, 0.3, 0.3], 'Haze': [0.4, 0.4, 0.4, 0.4], 'LightHaze': [0.5, 0.5, 0.5, 0.5], 'HeavyIce Crystals': [0.1, 0.0, 0.1, 0.4], 'Ice Crystals': [0.2, 0.0, 0.2, 0.5], 'LightIce Crystals': [0.3, 0.0, 0.3, 0.6], 'HeavyIce Pellet Showers': [0.1, 0.0, 0.1, 0.4], 'Ice Pellet Showers': [0.2, 0.0, 0.2, 0.5], 'LightIce Pellet Showers': [0.3, 0.0, 0.3, 0.6], 'HeavyIce Pellets': [0.1, 0.0, 0.1, 0.4], 'Ice Pellets': [0.2, 0.0, 0.2, 0.5], 'LightIce Pellets': [0.3, 0.0, 0.3, 0.6], 'HeavyLow Drifting Sand': [0.5, 0.5, 0.5, 0.5], 'Low Drifting Sand': [0.6, 0.6, 0.6, 0.6], 'LightLow Drifting Sand': [0.7, 0.7, 0.7, 0.7], 'HeavyLow Drifting Snow': [0.1, 0.0, 0.1, 0.4], 'Low Drifting Snow': [0.2, 0.0, 0.2, 0.5], 'LightLow Drifting Snow': [0.3, 0.0, 0.3, 0.6], 'HeavyLow Drifting Widespread Dust': [0.3, 0.3, 0.3, 0.3], 'Low Drifting Widespread Dust': [0.4, 0.4, 0.4, 0.4], 'LightLow Drifting Widespread Dust': [0.5, 0.5, 0.5, 0.5], 'HeavyMist': [0.6, 0.7, 0.5, 0.5], 'Mist': [0.7, 0.8, 0.6, 0.6], 'LightMist': [0.8, 0.9, 0.7, 0.7], 'Mostly Cloudy': [0.9, 1, 0.9, 0.9], 'Overcast': [0.8, 0.9, 0.7, 0.7], 'Partial Fog': [0.7, 0.8, 0.7, 0.7], 'Partly Cloudy': [1, 1, 0.9, 1], 'Patches of Fog': [0.7, 0.8, 0.7, 0.7], 'HeavyRain': [0.8, 0.9, 0.7, 0.6], 'Rain': [0.9, 0.9, 0.8, 0.7], 'LightRain': [0.9, 1, 0.9, 0.8], 'HeavyRain Mist': [0.8, 0.9, 0.7, 0.6], 'Rain Mist': [0.9, 0.9, 0.8, 0.7], 'LightRain Mist': [1, 1, 0.9, 0.8], 'HeavyRain Showers': [0.6, 0.7, 0.5, 0.5], 'Rain Showers': [0.7, 0.8, 0.6, 0.6], 'LightRain Showers': [0.8, 0.9, 0.7, 0.7], 'HeavySand': [0.3, 0.3, 0.3, 0.3], 'Sand': [0.4, 0.4, 0.4, 0.4], 'LightSand': [0.5, 0.5, 0.5, 0.5], 'HeavySandstorm': [0.2, 0.2, 0.2, 0.2], 'Sandstorm': [0.3, 0.3, 0.3, 0.3], 'LightSandstorm': [0.4, 0.4, 0.4, 0.4], 'Scattered Clouds': [1, 1, 1, 1], 'Shallow Fog': [0.7, 0.8, 0.7, 0.7], 'Small Hail': [0.5, 0.6, 0.5, 0.6], 'HeavySmall Hail Showers': [0.4, 0.5, 0.3, 0.5], 'Small Hail Showers': [0.5, 0.6, 0.4, 0.6], 'LightSmall Hail Showers': [0.6, 0.7, 0.5, 0.7], 'HeavySmoke': [0.3, 0.3, 0.3, 0.3], 'Smoke': [0.4, 0.4, 0.4, 0.4], 'LightSmoke': [0.5, 0.5, 0.5, 0.5], 'HeavySnow': [0.1, 0.0, 0.1, 0.4], 'Snow': [0.2, 0.0, 0.2, 0.5], 'LightSnow': [0.3, 0.0, 0.3, 0.6], 'HeavySnow Blowing Snow Mist': [0.1, 0.0, 0.1, 0.4], 'Snow Blowing Snow Mist': [0.2, 0.0, 0.2, 0.5], 'LightSnow Blowing Snow Mist': [0.3, 0.0, 0.3, 0.6], 'HeavySnow Grains': [0.2, 0.0, 0.2, 0.5], 'Snow Grains': [0.3, 0.0, 0.3, 0.6], 'LightSnow Grains': [0.4, 0.0, 0.4, 0.7], 'HeavySnow Showers': [0.0, 0.0, 0.0, 0.5], 'Snow Showers': [0.1, 0.0, 0.1, 0.6], 'LightSnow Showers': [0.2, 0.0, 0.2, 0.7], 'HeavySpray': [0.2, 0.2, 0.2, 0.2], 'Spray': [0.3, 0.3, 0.3, 0.3], 'LightSpray': [0.4, 0.4, 0.4, 0.4], 'Squalls': [0.5, 0.5, 0.5, 0.5], 'HeavyThunderstorm': [0.6, 0.7, 0.6, 0.5], 'Thunderstorm': [0.7, 0.8, 0.7, 0.6], 'LightThunderstorm': [0.8, 0.9, 0.8, 0.7], 'HeavyThunderstorms and Ice Pellets': [0.4, 0.5, 0.4, 0.5], 'Thunderstorms and Ice Pellets': [0.5, 0.6, 0.5, 0.6], 'LightThunderstorms and Ice Pellets': [0.6, 0.7, 0.6, 0.7], 'HeavyThunderstorms and Rain': [0.5, 0.6, 0.5, 0.4], 'Thunderstorms and Rain': [0.6, 0.7, 0.6, 0.5], 'LightThunderstorms and Rain': [0.7, 0.8, 0.7, 0.6], 'HeavyThunderstorms and Snow': [0.0, 0.0, 0.0, 0.3], 'Thunderstorms and Snow': [0.1, 0.0, 0.1, 0.4], 'LightThunderstorms and Snow': [0.2, 0.0, 0.2, 0.5], 'HeavyThunderstorms with Hail': [0.4, 0.5, 0.4, 0.5], 'Thunderstorms with Hail': [0.5, 0.6, 0.5, 0.6], 'LightThunderstorms with Hail': [0.6, 0.7, 0.6, 0.7], 'HeavyThunderstorms with Small Hail': [0.5, 0.6, 0.5, 0.6], 'Thunderstorms with Small Hail': [0.6, 0.7, 0.6, 0.7], 'LightThunderstorms with Small Hail': [0.7, 0.8, 0.7, 0.8], 'Unknown': [0.5, 0.5, 0.5, 0.5], 'Unknown Precipitation': [0.9, 0.9, 0.7, 0.6], 'HeavyVolcanic Ash': [0.0, 0.0, 0.0, 0.0], 'Volcanic Ash': [0.0, 0.0, 0.0, 0.0], 'LightVolcanic Ash': [0.0, 0.0, 0.0, 0.0], 'HeavyWidespread Dust': [0.2, 0.2, 0.2, 0.2], 'Widespread Dust': [0.3, 0.3, 0.3, 0.3], 'LightWidespread Dust': [0.4, 0.4, 0.4, 0.4] } DISTANCE_SCORE = { 0: 1.0, 2: 0.9, 4: 0.8, 6: 0.7, 8: 0.6, 10: 0.5, 12: 0.4, 14: 0.3, 16: 0.2, 18: 0.1, 20: 0.0 } def temperatureScore(x): return -3.044 * (10 ** -8) * (x ** 4) + 3.81 * (10 ** -6) * (x ** 3) - 0.00028 * (x ** 2) + 0.028 * x - 0.17 def dew_point_formula(x): return -0.00036 * (x ** 2) + 0.04056 * x - 0.144 def dew_distance_formula(x): return -0.1121 * (10 ** -6) * (x ** 4) + 0.00003 * (x ** 3) - 0.00263 * (x ** 2) + 0.07037 * x + 0.36842 def feels_like_distance(FEELS, TEMP): r = abs(FEELS - TEMP) r = math.ceil(r / 2.0) * 2 if r > 20: r = 20 return DISTANCE_SCORE[r] def dayCalculator(TEMP, FEELS, DEW, CONDITION): bad_conditions = list() a = temperatureScore(TEMP) print("Temperature Score: " + str(a)) if a < 0.3: bad_conditions.append("unfavorable temperature") b = feels_like_distance(FEELS, TEMP) print("Feels-Like Distance: " + str(b)) if b < 0.3: bad_conditions.append("unfavorable temperature disparity between what it feels like and what it is") c = dew_point_formula(DEW) print("Dew Point: " + str(c)) if c < 0.3: bad_conditions.append("unfavorable dew point") d = dew_distance_formula(TEMP - DEW) print("Dew Point Distance: " + str(d)) if d < 0.3: bad_conditions.append("unfavorable humidity disparity") e = WEATHER_SCORE[CONDITION][whatSeason()] print("Season Condition: " + str(e)) if e < 0.3: bad_conditions.append("unfavorable weather conditions") score = a * b * c * d * e evaluation = None if score >= 0.9: evaluation = random.choice(GREAT) elif (score < 0.9) and (score >= 0.5): evaluation = random.choice(GOOD) elif (score < 0.5) and (score >= 0.3): evaluation = random.choice(OKAY) else: evaluation = random.choice(BAD) return evaluation, bad_conditions def newDailyReport(): data = getWeatherJSON('current') observation_time = datetime.fromtimestamp( email.Utils.mktime_tz(email.Utils.parsedate_tz(data['current_observation']['observation_time_rfc822']))) observation_time = observation_time.strftime("%I:%M %p") conditions = data['current_observation']['weather'] feels_like = float(data['current_observation']['feelslike_f']) temp = float(data['current_observation']['temp_f']) data = getWeatherJSON('forecast') high = int(data['forecast']['simpleforecast']['forecastday'][0]['high']['fahrenheit']) low = int(data['forecast']['simpleforecast']['forecastday'][0]['low']['fahrenheit']) if (feels_like < temp) and (temp - feels_like > 5): weather_string = "Though the temperature is " + str(temp) + ", it feels like " + str( feels_like) + " degrees. It's expected to reach " + str(high) + " today, with a low of " + str(low) + "." else: weather_string = "The temperature is " + str(temp) + " degrees, with a high of " + str( high) + " and a low of " + str(low) + "." weather_segment = "As of " + str(observation_time) + " it is currently " + conditions + ". " + weather_string dew = dewPointAverage(getWeatherJSON('hourly')) day_score, bad_conditions = dayCalculator(temp, feels_like, dew, conditions) return day_score, bad_conditions, weather_segment def dewPointAverage(data): dewList = list() for d in data['hourly_forecast']: i = d['dewpoint']['english'] i = float(i) i = int(i) dewList.append(i) return sum(dewList) / len(dewList) # def dailyReport(): # data = getWeatherJSON('current') # # conditions = data['current_observation']['weather'] # # feels_like = data['current_observation']['feelslike_f'] # temp = data['current_observation']['temp_f'] # # observation_time = datetime.fromtimestamp( # email.Utils.mktime_tz(email.Utils.parsedate_tz(data['current_observation']['observation_time_rfc822']))) # observation_time = observation_time.strftime("%I:%M %p") # # data = getWeatherJSON('forecast') # # high = data['forecast']['simpleforecast']['forecastday'][0]['high']['fahrenheit'] # low = data['forecast']['simpleforecast']['forecastday'][0]['low']['fahrenheit'] # # if feels_like < temp: # temperature_string = "Though the temperature is " + str(temp) + ", it feels like " + str( # feels_like) + " degrees. It's expected to reach " + str(high) + " today, with a low of " + str(low) + "." # else: # temperature_string = "The temperature is " + str(temp) + " degrees, with a high of " + str( # high) + " and a low of " + str(low) + "." # # fullReport = "As of " + str(observation_time) + " it is currently " + conditions + ". " + temperature_string # saiff(fullReport, "/tmp/DailyReport.aiff") def getWeatherJSON(weather_type): if weather_type == 'current': url = "http://api.wunderground.com/api/" + WUNDERGROUND_KEY + "/conditions/q/MA/waltham.json" if weather_type == 'forecast': url = "http://api.wunderground.com/api/" + WUNDERGROUND_KEY + "/forecast/q/MA/waltham.json" if weather_type == 'astronomy': url = "http://api.wunderground.com/api/" + WUNDERGROUND_KEY + "/astronomy/q/MA/waltham.json" if weather_type == 'hourly': url = "http://api.wunderground.com/api/" + WUNDERGROUND_KEY + "/hourly/q/MA/waltham.json" agent = MyOpener() page = agent.open(url) jsonurl = page.read() data = json.loads(jsonurl) return data def getSunsetDTO(): data = getWeatherJSON('astronomy') h = data['sun_phase']['sunset']['hour'] m = data['sun_phase']['sunset']['minute'] t = datetime.now().replace(hour=int(h), minute=int(m), second=0, microsecond=0) t = t - timedelta(minutes=40) return t
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,830
raulium/jarvis
refs/heads/master
/yoga_mod.py
#!/usr/local/env python # ============== EXTERNAL LIBRARIES import random import time # ============== CONFIG PARAMETERS from config import NAME # ============== INTERNAL LIBRARIES from interaction_mod import POSITIVE, say from mac_mod import setVolume def stretch_Spinal(): say('Sit cross-legged.') time.sleep(5) i = 0 while i < 2: say('Twist left.') time.sleep(10) say('Return to center.') time.sleep(5) say('Twist right.') time.sleep(10) say('Return to center.') time.sleep(5) i += 1 say('Put your left hand on the floor. Inhale. Raise your right arm. While exhaling, reach left.') time.sleep(10) say('Inhale, and relax a moment.') time.sleep(5) say('Exhale and reach left, again.') time.sleep(10) say('Time to switch.') time.sleep(5) say('Put your right hand on the floor. Inhale. Raise your left arm. While exhaling, reach right.') time.sleep(10) say('Inhale, and relax a moment.') time.sleep(5) say('Exhale and reach right, again.') time.sleep(10) def stretch_Cat(): say('Come to all fours') time.sleep(5) i = 0 while i < 3: say('Curve your back toward the ceiling. Drawing your chin to your stomach.') time.sleep(10) say('Inhale deeply') time.sleep(5) say('Exhale and arch your back.') time.sleep(5) say('Slowly raise your head to the ceiling.') time.sleep(5) i += 1 def stretch_Lunge(): say('Come to all fours') time.sleep(5) i = 0 while i < 3: say('Lunge with your right foot') time.sleep(5) say("Don't forget to breathe.") time.sleep(5) say('Lunge with left foot.') time.sleep(10) i += 1 def fuckGreg2(): setVolume(3) say("I've been instructed to try to further motivate you, " + NAME + ".") time.sleep(5) say('Now for a real exercise. Stretching.') time.sleep(5) stretch_Spinal() stretch_Cat() stretch_Lunge() say(random.choice(POSITIVE) + 'All done. I hope that woke you up.')
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,831
raulium/jarvis
refs/heads/master
/motivation_mod.py
#!/usr/local/env python # ============== EXTERNAL LIBRARIES from random import choice from math import floor from datetime import datetime # ============== CONFIG PARAMETERS from config import NAME # ============== INTERNAL LIBRARIES #? def daysToWeekend(): n = datetime.today().weekday() if n < 5: return 5 - n else: return 0 def counterString(i, unit): s = ["Only", "A mere", ""] e = ["more", "additional", ""] if i == 1: return choice(s) + " " + str(i) + " " + choice(e) + " " + unit + " until" else: return choice(s) + " " + str(i) + " " + choice(e) + " " + unit + "s until" def weeksToDate(dto): n = datetime.today() return int(floor((dto - n).days / 7)) def motivate(): c = ['You can do it.', "I have full confidence you'll make it.", "You'll be fine.", "Seize the day!", "You've got this.", "Don't forget to breathe.", "Just do it.", "Failure is not an option.", "Resistance is futile.", "Hang in there."] return choice(c)
{"/vacation_mod.py": ["/timing_mod.py", "/IFTTT_mod.py", "/mac_mod.py"], "/evening_mod.py": ["/interaction_mod.py", "/timing_mod.py", "/mac_mod.py", "/IFTTT_mod.py"], "/lab_mod.py": ["/web_mod.py"], "/math_mod.py": ["/interaction_mod.py"], "/interaction_mod.py": ["/gmail_mod.py", "/mac_mod.py"], "/main.py": ["/vacation_mod.py", "/interaction_mod.py", "/mac_mod.py", "/morning_mod.py", "/evening_mod.py", "/IFTTT_mod.py"], "/weather_mod.py": ["/web_mod.py", "/interaction_mod.py", "/timing_mod.py"], "/yoga_mod.py": ["/interaction_mod.py", "/mac_mod.py"]}
40,834
simshadows/dpcutipy
refs/heads/master
/errors.py
""" errors.py Author: simshadows Defines errors for dpcutipy. """ from ctypes import c_int # Error codes from dpcdefs.h revision 07/22/2004 _errors_src = """ const ERC ercNoError = 0; const ERC ercConnReject = 3001; const ERC ercConnType = 3002; const ERC ercConnNoMode = 3003; const ERC ercInvParam = 3004; const ERC ercInvCmd = 3005; const ERC ercUnknown = 3006; const ERC ercJtagConflict = 3007; const ERC ercNotImp = 3008; const ERC ercNoMem = 3009; const ERC ercTimeout = 3010; const ERC ercConflict = 3011; const ERC ercBadPacket = 3012; const ERC ercInvOption = 3013; const ERC ercAlreadyCon = 3014; const ERC ercConnected = 3101; const ERC ercNotInit = 3102; const ERC ercCantConnect = 3103; const ERC ercAlreadyConnect = 3104; const ERC ercSendError = 3105; const ERC ercRcvError = 3106; const ERC ercAbort = 3107; const ERC ercTimeOut = 3108; const ERC ercOutOfOrder = 3109; const ERC ercExtraData = 3110; const ERC ercMissingData = 3111; const ERC ercTridNotFound = 3201; const ERC ercNotComplete = 3202; const ERC ercNotConnected = 3203; const ERC ercWrongMode = 3204; const ERC ercWrongVersion = 3205; const ERC ercDvctableDne = 3301; const ERC ercDvctableCorrupt= 3302; const ERC ercDvcDne = 3303; const ERC ercDpcutilInitFail= 3304; const ERC ercUnknownErr = 3305; const ERC ercDvcTableOpen = 3306; const ERC ercRegError = 3307; const ERC ercNotifyRegFull = 3308; const ERC ercNotifyNotFound = 3309; const ERC ercOldDriverNewFw = 3310; const ERC ercInvHandle = 3311; const ERC ercInterfaceNotSupported = 3312; """ # Error documentation from DPCUTIL Programmer’s Manual revision 06/03/05 # https://reference.digilentinc.com/_media/dpcutil_programmers_reference_manual.pdf _errors_doc = """ ercNoError 0 No error occurred in transaction ercInvParam 3004 Invalid parameter sent in API call ercInvCmd 3005 Internal error. Please report occurrence as a bug ercUnknown 3006 Internal error. Please report occurrence as a bug ercNoMem 3009 Not enough memory to carry out transaction ercNotInit 3102 Communication device not initialized ercCantConnect 3103 Can’t connect to communication module ercAlreadyConnect 3104 Already connected to communication device ercSendError 3105 Error occurred while sending data to communication device ercRcvError 3106 Error occurred while receiving data from communication device ercAbort 3107 Error occurred while trying to abort transaction(s) ercOutOfOrder 3109 Completion out of order ercExtraData 3110 Too much data received from communication device ercMissingData 3111 Nothing to send or data/address mismatched pairs ercTridNotFound 3201 Unable to find matching TRID in transaction queue ercNotComplete 3202 Transaction being cleared is not complete ercNotConnected 3203 Not connected to communication device ercWrongMode 3204 Connected in wrong mode (JTAG or data transfer) ercWrongVersion 3205 Internal error. Please report occurrence as a bug ercDvctableDne 3301 Device table doesn’t exist (an empty one has been created) ercDvctableCorrupt 3302 All or part of the device table is corrupted ercDvcDne 3303 Device does not exist in device table ercDpcutilInitFail 3304 DpcInit API call failed ercDvcTableOpen 3306 Communications devices dialog box already open. ercRegError 3307 Error occurred while accessing the registry """ # This is the user exception. class DpcUtiPyException(Exception): ERCNOERROR = 0 _errors = {} # _errors[error_code] = error name string _error_descriptions = {} # _error_descriptions[error_code] = error description string # Parse the error code source and documentation for line in _errors_src.strip().splitlines(): substrings = line.rsplit(maxsplit=1) # E.g. "const ERC ercNoError = 0;" # Becomes ["const ERC ercNoError =", "0;"] assert substrings[0][-1] == "=" assert substrings[1][-1] == ";" assert len(substrings) == 2 error_code = int(substrings[1][:-1]) substrings = substrings[0][:-1].rsplit(maxsplit=1) # E.g. ["const ERC ercNoError =", "0;"] # Becomes ["const ERC", "ercNoError"] assert substrings[0] == "const ERC" assert len(substrings) == 2 error_name = substrings[1] _errors[error_code] = error_name for line in _errors_doc.strip().splitlines(): substrings = line.split(maxsplit=2) # E.g. "ercNoError 0 No error occurred in transaction" # Becomes ["ercNoError", "0", "No error occurred in transaction"] error_code = int(substrings[1]) assert substrings[0].lower() == _errors[error_code].lower() assert len(substrings) == 3 _error_descriptions[error_code] = substrings[2] # TODO: Clean up this spaghettified mess. # # ARGUMENTS: # DpcUtiPyException() # Constructions an exception with no args. # DpcUtiPyException(msg:str) # Constructs an exception with the message `msg` describing the error # context. # DpcUtiPyException(erc:int) # DpcUtiPyException(erc:c_int) # Constructs an exception with the DPCUTIL error code being used to # describe the error, as defined in dpcdefs.h. # DpcUtiPyException(msg:str, erc:int) # DpcUtiPyException(msg:str, erc:c_int) # DpcUtiPyException(erc:int, msg:str) # DpcUtiPyException(erc:c_int, msg:str) # Constructs an exception with a combination of both a context # message and a DPCUTIL error code. # PRECONDITIONS: # - If `msg` is supplied, then it is a non-empty string (after whitespace # stripping). # - Behaviour is undefined for argument combinations other than those # documented above. This is assert-checked. def __init__(self, *args): assert len(args) < 3 # These will remain None if unused. self.error_cntxt = None # Error context self.erc = None # Error code from dpcdefs.h self.error_name = None # Error name from dpcdefs.h self.error_desc = None # Error description from documentation buf = "" buf_msg = None buf_erc = None # Read Arguments if len(args) == 0: buf_msg = "Unknown error (no error code or context string given)." else: for arg in args: if isinstance(arg, int): assert self.erc is None self.erc = arg elif isinstance(arg, c_int): assert self.erc is None self.erc = arg.value else: # Assumed to be a string assert isinstance(arg, str) and (len(arg.strip()) > 0) assert self.error_cntxt is None buf_msg = self.error_cntxt = arg.strip() if not self.erc is None: template = "DPCUTIL error {name} ({erc}){desc}" erc = self.erc # Easier reference name = None desc = None if erc in self._errors: name = self.error_name = self._errors[erc] else: name = "UNKNOWN_DPCUTIL_ERROR" if erc in self._error_descriptions: self.error_desc = self._error_descriptions[erc] desc = " " + self.error_desc else: desc = "" buf_erc = template.format(name=name, erc=str(erc), desc=desc) assert (buf_msg is None) or isinstance(buf_msg, str) assert (buf_erc is None) or isinstance(buf_erc, str) assert not buf_msg is buf_erc is None if not buf_msg is None: buf = buf_msg if (not buf_erc is None) and (self.erc != self.ERCNOERROR): if len(buf) > 0: if not buf.endswith("."): buf += "." buf += " " buf += buf_erc return super(DpcUtiPyException, self).__init__(buf)
{"/testdpcutipy.py": ["/dpcutipy.py"], "/dpcutipy.py": ["/errors.py"]}
40,835
simshadows/dpcutipy
refs/heads/master
/testdpcutipy.py
""" testdpcutipy.py Author: simshadows A very simple test file that just writes to a register, then reads and prints it back. This also provides a simple demonstration of the operation of the dpcutipy library. """ import os import sys import random import traceback from dpcutipy import dpcutipy reg_id = random.randint(0,64) reg_val = random.randint(0,256) dpcutipy.DvmgStartConfigureDevices() # Comment back in if needed. dev_id = dpcutipy.DvmgGetDefaultDev() dev_name = dpcutipy.DvmgGetDevName(dev_id) print("Default device: " + dev_name) dpcutipy.put_single_register(reg_id, reg_val, dev_name) print("REGISTER {} WRITE: {}".format(str(reg_id), str(reg_val))) ret = dpcutipy.get_single_register(reg_id, dev_name) print("REGISTER {} READ: {}".format(str(reg_id), str(ret))) print("DONE!")
{"/testdpcutipy.py": ["/dpcutipy.py"], "/dpcutipy.py": ["/errors.py"]}
40,836
simshadows/dpcutipy
refs/heads/master
/dpcutipy.py
""" dpcutipy.py Author: simshadows dpcutipy is a glue code module for dpcutil Design documentation used to build this module: https://reference.digilentinc.com/_media/dpcutil_programmers_reference_manual.pdf http://hamsterworks.co.nz/mediawiki/index.php/Module_18 """ import os import sys import traceback import collections import atexit from ctypes import * from .errors import DpcUtiPyException BUFFER_SIZE = 512 # Placeholder value for mutable ctypes buffers. # TODO: Please secure for buffer overflow issues. ############################################################################### # MODULE INITIALIZATION ####################################################### ############################################################################### _dpcutil = None _cwd = os.path.dirname(__file__) # Attempt to load dpcutil _dpcutil = cdll.dpcutil # try: # TODO: Make something more robust. # _dpcutil = cdll.dpcutil # except Exception as e: # # Alternative Imports. # pass # # try: # # _dpcutil = CDLL(os.path.join(_cwd, "dpcutil_sys32.dll")) # # except Exception as e0: # # try: # # _dpcutil = CDLL(os.path.join(_cwd, "dpcutil_syswow64.dll")) # # except Exception as e1: # # _dpcutil = None if _dpcutil is None: raise DpcUtiPyException("Failed to import dpcutil.") def _DpcInit(): erc = c_int(0) if not _dpcutil.DpcInit(byref(erc)): raise DpcUtiPyException(erc) return def _DpcTerm(): _dpcutil.DpcTerm() return _DpcInit() atexit.register(_DpcTerm) ############################################################################### # MODULE BASIC INTERFACE ###################################################### ############################################################################### # For function behaviour, see DPCUTIL Programmers Reference Manual. # PARAMETERS: # hwnd (Optional) # Handle to parent window. No type-checking is done, but this should be # a relevant ctypes type, likely `c_void_p`. def DvmgStartConfigureDevices(hwnd=None): erc = c_int(0) _dpcutil.DvmgStartConfigureDevices(hwnd, byref(erc)) if erc.value != DpcUtiPyException.ERCNOERROR: raise DpcUtiPyException(erc) return # RETURNS: # The index of the default device, as an integer. def DvmgGetDefaultDev(): erc = c_int(0) device_id = _dpcutil.DvmgGetDefaultDev(byref(erc)) if device_id == -1: raise DpcUtiPyException("No devices in the device table.", erc) assert isinstance(device_id, int) return device_id # RETURNS: # Name of the queried device. def DvmgGetDevName(device_id): erc = c_int(0) cbuf = create_string_buffer(BUFFER_SIZE) if not _dpcutil.DvmgGetDevName(device_id, cbuf, byref(erc)): raise DpcUtiPyException(erc) ret = cbuf.value.decode("ascii") assert isinstance(ret, str) return ret # RETURNS: # A class that represents the data transfer HANDLE object from the DLL API. # This class contains methods that mimic the operations available to be # performed on this HANDLE. def DpcOpenData(dev_name): return EPPDataTransferHandle(dev_name) class EPPDataTransferHandle: def __init__(self, dev_name): self._chif = c_void_p(0) # ctypes pointer to a HANDLE. erc = c_int(0) buf = dev_name.encode() # str to bytes if not _dpcutil.DpcOpenData(byref(self._chif), buf, byref(erc), None): raise DpcUtiPyException(erc) return def DpcCloseData(self): erc = c_int(0) if not _dpcutil.DpcCloseData(self._chif, byref(erc)): raise DpcUtiPyException(erc) return def DpcPutReg(self, b_addr, b_data): assert isinstance(b_addr, int) and (0x00 <= b_addr <= 0xFF) assert isinstance(b_data, int) and (0x00 <= b_data <= 0xFF) b_addr = c_byte(b_addr) b_data = c_byte(b_data) erc = c_int(0) if not _dpcutil.DpcPutReg(self._chif, b_addr, b_data, byref(erc), None): raise DpcUtiPyException(erc) return def DpcGetReg(self, b_addr): assert isinstance(b_addr, int) and (0x00 <= b_addr <= 0xFF) b_addr = c_byte(b_addr) b_data = c_byte(0) erc = c_int(0) if not _dpcutil.DpcGetReg(self._chif, b_addr, byref(b_data), byref(erc), None): raise DpcUtiPyException(erc) b_data = b_data.value b_data = (b_data + 0x100) % 0x100 assert isinstance(b_data, int) and (0x00 <= b_data <= 0xFF) return b_data def DpcPutRegSet(*args, **kwargs): raise NotImplementedError def DpcGetRegSet(*args, **kwargs): raise NotImplementedError def DpcPutRegRepeat(*args, **kwargs): raise NotImplementedError def DpcGetRegRepeat(*args, **kwargs): raise NotImplementedError # RETURNS: # Nothing. # EXCEPTIONS: # If DPCUTIL's DpcGetFirstError returns an error code, this method will # raise the error code as an exception. # TODO: # Reimplement error codes as enum, and make this method return the error # as an enum. This may require refactoring. def DpcGetFirstError(self): ret = _dpcutil.DpcGetFirstError(self._chif) if ret != DpcUtiPyException.ERCNOERROR: raise DpcUtiPyException(ret) return ############################################################################### # MODULE EXTENDED INTERFACE ################################################### ############################################################################### def put_single_register(b_addr, b_data, dev_name): handle = DpcOpenData(dev_name) try: handle.DpcPutReg(b_addr, b_data) handle.DpcGetFirstError() finally: handle.DpcCloseData() return def get_single_register(b_addr, dev_name): handle = DpcOpenData(dev_name) data = None try: data = handle.DpcGetReg(b_addr) handle.DpcGetFirstError() finally: handle.DpcCloseData() return data
{"/testdpcutipy.py": ["/dpcutipy.py"], "/dpcutipy.py": ["/errors.py"]}
40,883
ErrorMakerqwq/EE308
refs/heads/master
/main.py
''' @Project :pythonProject1 @File :main.py @Author :ErrorMaker @Date :2021/9/21 22:21 ''' #ui def ui(): # input data path = input('请输入文件路径(默认路径为File.c):') level = input('请输入运行等级:') return path,level #choosing def chooseingFuction(path,level): #level1 if(level=='1'): countingKwords(path) #level2 elif(level=='2'): keywrdsList = countingKwords(path) couterSClist = countingswtichStructure(keywrdsList) print('case num: ',end='') for i in range(0, len(couterSClist)): print(couterSClist[i]," ",end='') else: print('no finishing......') # Counting fuction def countingKwords(path): countkeywrds = 0 keywrdsList = list() with open(path) as fileStream: #split str strarr = fileStream.read().split() #loop traverse str for str in strarr: #loop traverse keywords for kw in keywrds: #if contains keyword countkeywrds + 1 if (str.__contains__(kw)): countkeywrds = countkeywrds + 1 #add item keywrdsList.append(kw) break print('total num:', countkeywrds) return keywrdsList # Counting swtich structure def countingswtichStructure(keywrdsList): counterSwitch = 0 couterSClist = [] i = 0; # find "swtich" for i in range(len(keywrdsList)): counter2 = 0 if (keywrdsList[i] == "switch"): counterSwitch = counterSwitch + 1 for j in range(i + 1, len(keywrdsList)): if (keywrdsList[j] == "case"): counter2 = counter2 + 1 elif (keywrdsList[j] == 'switch'): break couterSClist.append(counter2) print('switch num:', counterSwitch) return couterSClist # Counting if-else and if-elseif-else structure #def countingEifStructure(keywrdsList): #list of keywords keywrds = ["auto", "break", "case", "char", "const", "continue", "default" , "double", "do", "else", "enum", "extern", "float", "for", "goto", "if" , "int", "long", "register", "return", "short", "signed", "sizeof", "static" , "struct", "switch", "typedef", "union", "unsigned", "void", "volatile", "while"] if __name__ == '__main__': path,level=ui() chooseingFuction(path, level)
{"/test_main.py": ["/main.py"]}
40,884
ErrorMakerqwq/EE308
refs/heads/master
/test_main.py
import unittest import main class TestcountingKwords(unittest.TestCase): def test_countingKwords(self): self.assertEqual(len(main.countingKwords(path="File.c")), 35) # add assertion here if __name__ == '__main__': unittest.main()
{"/test_main.py": ["/main.py"]}