code
stringlengths
2.5k
150k
kind
stringclasses
1 value
# work on the tree ``` %reload_ext autoreload %autoreload 2 import sys from pathlib import Path my_happy_flow_path = str(Path('../../src').resolve()) my_lib_path = str(Path('my_lib').resolve()) if my_lib_path not in sys.path: sys.path.append(my_lib_path) if my_happy_flow_path not in sys.path: sys.path.append(my_happy_flow_path) ``` ## ast.NodeVisitor ast.NodeVisitor is the primary tool for ‘scanning’ the tree. ``` import ast import inspect print(inspect.getsource(ast.NodeVisitor)) ``` To use it, subclass it and override methods visit_Foo, corresponding to the node classes. (see [Meet the Nodes](https://greentreesnakes.readthedocs.io/en/latest/nodes.html)). For example, this visitor will print the names of any functions defined in the given code, including methods and functions defined within other functions: ``` import ast class FuncLister(ast.NodeVisitor): def visit_FunctionDef(self, node): print('func_name: ', node.name) self.generic_visit(node) source_code = """ def a(): print('i am a') def b(): print('call a') a() def c(): print('i am c function') b() """.strip() FuncLister().visit(ast.parse(source_code)) ``` If you want child nodes to be visited, remember to call self.generic_visit(node) in the methods you override. Alternatively, you can run through a list of all the nodes in the tree using ast.walk(). There are no guarantees about the order in which nodes will appear. The following example again prints the names of any functions defined within the given code: ``` import ast source_code = """ def a(): print('i am a') def b(): print('call a') a() def c(): print('i am c function') b() """.strip() tree = ast.parse(source_code) for node in ast.walk(tree): if isinstance(node, ast.FunctionDef): print('func_name: ', node.name) ``` You can also get the direct children of a node, using ast.iter_child_nodes(). Remember that many nodes have children in several sections: for example, an If has a node in the test field, and list of nodes in body and orelse. ast.iter_child_nodes() will go through all of these. Finally, you can navigate directly, using the attributes of the nodes. For example, if you want to get the last node within a function’s body, use node.body\[-1\]. Of course, all the normal Python tools for iterating and indexing work. In particular, isinstance() is very useful for checking what nodes are. ## Inspecting nodes The ast module has a couple of functions for inspecting nodes: $\large{🍞}$ ast.iter_fields() iterates over the fields defined for a node. $\large{🍞}$ ast.get_docstring() gets the docstring of a FunctionDef, ClassDef or Module node. $\large{🍞}$ ast.dump() returns a string showing the node and any children. ## Modifying the tree The key tool is ast.NodeTransformer. Like ast.NodeVisitor, you subclass this and override visit_Foo methods. The method should return the original node, a replacement node, or None to remove that node from the tree. The ast module docs have this example, which rewrites name lookups, so foo becomes data\['foo'\]: ``` import ast class RewriteName(ast.NodeTransformer): def visit_Name(slef, node): return ast.copy_location(ast.Subscript( value=ast.Name(id='data', ctx=ast.Load()), slice=ast.Index(value=ast.Str(s=node.id)), ctx=node.ctx ), node) from __future__ import unicode_literals import ast import ast_utils from ast_utils import print_utils import ujson tree = ast.parse("foo") print(ast_utils.dump(tree)) print_utils.print_separator() print(ast_utils.dump_json(tree)) new_tree = ast.fix_missing_locations(RewriteName().visit(tree)) print_utils.print_separator() print(ast_utils.unparse(new_tree)) print_utils.print_separator() print(ast_utils.dump_json(new_tree)) ``` Be careful when removing nodes. You can quite easily remove a node from a required field, such as the test field of an If node. Python won’t complain about the invalid AST until you try to compile() it, when a TypeError is raised.
github_jupyter
``` import glob import time import os import pandas as pd import sklearn.metrics from sklearn.preprocessing import MinMaxScaler import pickle from argparse import ArgumentParser, Namespace import random import torch import torch.nn as nn import torch.nn.functional as F import numpy as np from torch.utils.data import Dataset, DataLoader from torch.optim import Adam from itertools import chain from tqdm import tqdm import copy import shutil import pickle import json dev_feature_set = 'SemTabRound4_T2DV2_train//dev-output/v26/features/' positive_features_path = 'positive_features_total.pkl' negative_features_path = 'negative_features_total.pkl' output_path = 'feature_model/' num_of_epochs = 15 learning_rates = [0.01, 0.001] final_score_column = 'siamese_prediction' positive_features = pickle.load(open(positive_features_path, 'rb')) len(positive_features) uniques = [] for i in positive_features: !mkdir -p {output_path} # Deciding up the features # All the features features = ["monge_elkan","monge_elkan_aliases","jaro_winkler", "levenshtein","singleton","context_score_3","pgt_centroid_score","pgt_class_count_tf_idf_score", "pgt_property_count_tf_idf_score", "num_occurences", "incorrectness_scores"] string_similarity_features = ["monge_elkan","monge_elkan_aliases","jaro_winkler", "levenshtein"] semantic_features = ["singleton","context_score_3","pgt_centroid_score","pgt_class_count_tf_idf_score", "pgt_property_count_tf_idf_score", "num_occurences", "incorrectness_scores"] extra_feature_exp_1 = ["monge_elkan","monge_elkan_aliases","jaro_winkler", "levenshtein", "context_score_3"] extra_feature_exp_2 = ["monge_elkan","monge_elkan_aliases","jaro_winkler", "levenshtein", "context_score_3", "pgt_class_count_tf_idf_score", "pgt_property_count_tf_idf_score"] extra_feature_exp_3 = ["monge_elkan","monge_elkan_aliases", "levenshtein", "context_score_3", "pgt_class_count_tf_idf_score", "pgt_property_count_tf_idf_score"] experiment_feature_list = [string_similarity_features, semantic_features, extra_feature_exp_1, extra_feature_exp_2, extra_feature_exp_3] # Create a dataframe with this as list and add the min_max_scaler # For now apply min_max_scaler only on num_occurences class T2DV2Dataset(Dataset): def __init__(self, pos_features, neg_features): #print(type(pos_features), type(neg_features)) self.pos_features = pos_features self.neg_features = neg_features # self.transform = transforms.Compose([transforms.ToTensor()]) def __len__(self): #print(type(len(self.pos_features))) return min(len(self.pos_features), len(self.neg_features)) def __getitem__(self, idx): # print("here", (self.pos_features[idx]), (self.neg_features[idx])) return self.pos_features[idx], self.neg_features[idx] # Model class PairwiseNetwork(nn.Module): def __init__(self, hidden_size): super().__init__() #original 12x24, 24x12, 12x12, 12x1 self.fc1 = nn.Linear(hidden_size, 2*hidden_size) self.fc2 = nn.Linear(hidden_size*2, hidden_size) self.fc3 = nn.Linear(hidden_size, hidden_size) self.fc4 = nn.Linear(hidden_size, 1) def forward(self, pos_features, neg_features): # Positive pass x = F.relu(self.fc1(pos_features)) x = F.relu(self.fc2(x)) x = F.relu(self.fc3(x)) pos_out = torch.sigmoid(self.fc4(x)) # Negative Pass x = F.relu(self.fc1(neg_features)) x = F.relu(self.fc2(x)) x = F.relu(self.fc3(x)) neg_out = torch.sigmoid(self.fc4(x)) return pos_out, neg_out def predict(self, test_feat): x = F.relu(self.fc1(test_feat)) x = F.relu(self.fc2(x)) x = F.relu(self.fc3(x)) test_out = torch.sigmoid(self.fc4(x)) return test_out # Pairwise Loss class PairwiseLoss(nn.Module): def __init__(self): super().__init__() self.m = 0 def forward(self, pos_out, neg_out): distance = (1 - pos_out) + neg_out loss = torch.mean(torch.max(torch.tensor(0), distance)) return loss def data_creator(positive_feature_path, negative_feature_path, curr_features): positive_feature_set = [] negative_feature_set = [] # Defining feature_true feature_true = [0] * len(features) for i in range(len(features)): if features[i] in curr_features: feature_true[i] = 1 p_feat_load = pickle.load(open(positive_feature_path, "rb")) n_feat_load = pickle.load(open(negative_feature_path, "rb")) for i in p_feat_load: singular_feature_list = [] list_features = i[-1] for j in range(len(list_features)): if feature_true[j]: singular_feature_list.append(list_features[j]) positive_feature_set.append(np.array(singular_feature_list)) for i in n_feat_load: singular_feature_list = [] list_features = i[-1] for j in range(len(list_features)): if feature_true[j]: singular_feature_list.append(list_features[j]) negative_feature_set.append(np.array(singular_feature_list)) print(positive_feature_set[0], negative_feature_set[0]) print(len(positive_feature_set), len(negative_feature_set)) return positive_feature_set, negative_feature_set def generate_dataloader(positive_feature_set, negative_feature_set): pos_features_flatten = np.array(positive_feature_set) neg_features_flatten = np.array(negative_feature_set) print(pos_features_flatten.shape, neg_features_flatten.shape) #print(type(pos_features_flatten), neg_features_flatten[0], type(neg_features_flatten[0])) train_dataset = T2DV2Dataset(pos_features_flatten, neg_features_flatten) train_dataloader = DataLoader(train_dataset, batch_size=32, shuffle = False) return train_dataloader def infer_scores(min_max_scaler_path, input_table_path, output_table_path, model): # scaler = pickle.load(open(min_max_scaler_path, 'rb')) normalize_features = curr_features for file in glob.glob(input_table_path + '/*.csv'): file_name = file.split('/')[-1] if os.path.getsize(file) == 0: continue d_sample = pd.read_csv(file) # d_sample['context_score'].fillna(0.0, inplace=True) grouped_obj = d_sample.groupby(['column', 'row']) new_df_list = [] pred = [] for cell in grouped_obj: # cell[1][normalize_features] = scaler.transform(cell[1][normalize_features]) sorted_df = cell[1].sort_values('context_score', ascending=False) sorted_df_features = sorted_df[normalize_features] new_df_list.append(sorted_df) arr = sorted_df_features.to_numpy() test_inp = [] for a in arr: test_inp.append(a) test_tensor = torch.tensor(test_inp).float() scores = model.predict(test_tensor) scores_list = torch.squeeze(scores).tolist() if not type(scores_list) is list: pred.append(scores_list) else: pred.extend(scores_list) test_df = pd.concat(new_df_list) test_df[final_score_column] = pred test_df.to_csv(f"{output_table_path}/{file_name}", index=False) def train(args): if torch.cuda.is_available(): device = torch.device('cuda') else: device = torch.device('cpu') device = torch.device('cpu') use_scheduler = False train_dataloader = generate_dataloader(args.positive_feat_path, args.negative_feat_path) criterion = PairwiseLoss() EPOCHS = args.num_epochs model = PairwiseNetwork(len(curr_features)).to(device=device) optimizer = Adam(model.parameters(), lr=args.lr) if use_scheduler: scheduler = torch.optim.lr_scheduler.StepLR(optimizer, step_size=10, gamma=0.01) top1_max_prec = 0 for epoch in range(EPOCHS): train_epoch_loss = 0 avg_loss = 0 model.train() for bid, batch in tqdm(enumerate(train_dataloader), position=0, leave=True): # print("--------------") positive_feat = torch.tensor(batch[0].float()) negative_feat = torch.tensor(batch[1].float()) optimizer.zero_grad() pos_out, neg_out = model(positive_feat, negative_feat) loss = criterion(pos_out, neg_out) loss.backward() optimizer.step() train_epoch_loss += loss avg_loss = train_epoch_loss / bid if use_scheduler: scheduler.step() # Evaluation model.eval() infer_scores(args.min_max_scaler_path, args.dev_path, args.dev_output, model) eval_data = merge_eval_files(args.dev_output) res, candidate_eval_data = parse_eval_files_stats(eval_data, final_score_column) top1_precision = res['num_tasks_with_model_score_top_one_accurate']/res['num_tasks_with_gt'] if top1_precision >= top1_max_prec: top1_max_prec = top1_precision model_save_name = 'scheduler_{}_lr_{}_epoch_{}_loss_{}_top1_{}.pth'.format(use_scheduler, args.lr, epoch, avg_loss, top1_max_prec) best_model_path = os.path.join(args.model_save_path, model_save_name) torch.save(model.state_dict(), best_model_path) print("Epoch {}, Avg Loss is {}, epoch top1 {}, max top1 {}".format(epoch, avg_loss, top1_precision, top1_max_prec)) return best_model_path def merge_eval_files(final_score_path): eval_file_names = [] df_list = [] for (dirpath, dirnames, filenames) in os.walk(final_score_path): for fn in filenames: if "csv" not in fn: continue abs_fn = os.path.join(dirpath, fn) assert os.path.isfile(abs_fn) if os.path.getsize(abs_fn) == 0: continue eval_file_names.append(abs_fn) for fn in eval_file_names: fid = fn.split('/')[-1].split('.csv')[0] # print(fn) df = pd.read_csv(fn) df['table_id'] = fid df_list.append(df) return pd.concat(df_list) def parse_eval_files_stats(eval_data, method): res = {} candidate_eval_data = eval_data.groupby(['table_id', 'column', 'row'])['table_id'].count().reset_index(name="count") res['num_tasks_with_gt'] = len(eval_data[pd.notna(eval_data['GT_kg_id'])].groupby(['table_id', 'column', 'row'])) num_tasks_with_model_score_top_one_accurate = [] num_tasks_with_model_score_top_five_accurate = [] num_tasks_with_model_score_top_ten_accurate = [] has_gt_list = [] has_gt_in_candidate = [] for i, row in candidate_eval_data.iterrows(): table_id, row_idx, col_idx = row['table_id'], row['row'], row['column'] c_e_data = eval_data[(eval_data['table_id'] == table_id) & (eval_data['row'] == row_idx) & (eval_data['column'] == col_idx)] assert len(c_e_data) > 0 if np.nan not in set(c_e_data['GT_kg_id']): has_gt_list.append(1) else: has_gt_list.append(0) if 1 in set(c_e_data['evaluation_label']): has_gt_in_candidate.append(1) else: has_gt_in_candidate.append(0) #rank on model score s_data = c_e_data.sort_values(by=[method], ascending=False) if s_data.iloc[0]['evaluation_label'] == 1: num_tasks_with_model_score_top_one_accurate.append(1) else: num_tasks_with_model_score_top_one_accurate.append(0) if 1 in set(s_data.iloc[0:5]['evaluation_label']): num_tasks_with_model_score_top_five_accurate.append(1) else: num_tasks_with_model_score_top_five_accurate.append(0) if 1 in set(s_data.iloc[0:10]['evaluation_label']): num_tasks_with_model_score_top_ten_accurate.append(1) else: num_tasks_with_model_score_top_ten_accurate.append(0) res['num_tasks_with_model_score_top_one_accurate'] = sum(num_tasks_with_model_score_top_one_accurate) res['num_tasks_with_model_score_top_five_accurate'] = sum(num_tasks_with_model_score_top_five_accurate) res['num_tasks_with_model_score_top_ten_accurate'] = sum(num_tasks_with_model_score_top_ten_accurate) return res, candidate_eval_data curr_features = features positive_feature_set, negative_feature_set = data_creator(positive_features_path, negative_features_path, curr_features) positive_feature_set[0] len(positive_feature_set) j = np.array(positive_feature_set).reshape(454185, 11) k = np.unique(j, axis = 0) k[0] pk[0] training_args = Namespace(num_epochs=20, lr=0.001, positive_feat_path=k, negative_feat_path=negative_feature_set, dev_path=dev_feature_set, dev_output='Experiment_5/', model_save_path='_rn', min_max_scaler_path=None) best_model_path = train(training_args) import json len(experiment_feature_list) best_model_paths_experiment = {} ignore = 4 for experiment in experiment_feature_list: if ignore > 0: ignore = ignore - 1 continue curr_features = experiment pos_feature_set, neg_feature_set = data_creator(positive_features_path, negative_features_path, curr_features) feature_version = "Experiment_" + str(experiment_feature_list.index(experiment)) + '/' save_model = output_path + feature_version + "saved_models/" dev_predictions = output_path + feature_version + "dev_predictions/" !mkdir -p {feature_version} !mkdir -p {save_model} !mkdir -p {dev_predictions} # for l_rate in learning_rates: training_args = Namespace(num_epochs=20, lr=0.00005, positive_feat_path=pos_feature_set, negative_feat_path=neg_feature_set, dev_path=dev_feature_set, dev_output=dev_predictions, model_save_path=save_model, min_max_scaler_path=None) best_model_path = train(training_args) best_model_paths_experiment[f"{feature_version}_0.0001"] = best_model_path json.dump(best_model_paths_experiment, open('experiments_result.json', "w")) print ("List in proper method", '[%s]' % ', '.join(map(str, features))) merged_files = None def top_k_and_add_color(saved_model, features, dev_features_path, dev_top_k_path, dev_metrics_path, dev_predictions_path, dev_colorized, final_score_column, dev_metrics): file_list = glob.glob(dev_features_path + '*.csv') min_max_scaler_path = "tl_pipeline_normalization_factor.pkl" df_list = [] feature_str = ",".join(features) for file in file_list: # Predicting filename = file.split('/')[-1] print(filename) pred_file = dev_predictions_path + filename print(os.path.exists(dev_predictions_path), pred_file) top_5_file = dev_top_k_path + filename color_file = dev_colorized + filename.replace('.csv', '.xlsx') metrics_file = dev_metrics_path + filename !tl predict-using-model $file -o $final_score_column \ --features $feature_str \ --ranking-model $saved_model \ --normalization-factor $min_max_scaler_path > $pred_file merged_files = merge_eval_files(dev_predictions_path) !tl get-kg-links $pred_file --k-rows -k 5 -c $final_score_column > $top_5_file !tl add-color $top_5_file -k 5 -c $final_score_column,evaluation_label --output $color_file !tl metrics $top_5_file -k 1 -c $final_score_column --tag $filename> $metrics_file if os.path.getsize(metrics_file) > 2: df = pd.read_csv(metrics_file) df_list.append(df) #get the top 5 # colorize return pd.concat(df_list) #All features feature_version = 'Experiment_5/' curr_features = features saved_model = 'feature_model/Experiment_5/saved_models/scheduler_False_lr_0.0001_epoch_8_loss_0.3135864734649658_top1_0.9553264604810997.pth' dev_predictions_path = output_path + feature_version + 'dev_predictions/' dev_predictions_top_k = output_path + feature_version + 'dev_predictions_top_k/' dev_colorized = output_path + feature_version + 'dev_predictions_colorized/' dev_metrics_path = output_path + feature_version + 'dev_metrics/' final_score_column = 'siamese_prediction' !mkdir -p $dev_predictions_path !mkdir -p $dev_predictions_top_k !mkdir -p $dev_colorized !mkdir -p $dev_metrics_path dev_predictions_path metrics_df = top_k_and_add_color(saved_model, curr_features, dev_feature_set, dev_predictions_top_k, dev_metrics_path, dev_predictions_path, dev_colorized, final_score_column, dev_metrics_path) merged_files = merge_eval_files('feature_model/Experiment_5/dev_predictions/') from sklearn.datasets import make_classification from sklearn.linear_model import LogisticRegression from sklearn.model_selection import train_test_split from sklearn.metrics import precision_recall_curve, roc_curve from sklearn.metrics import f1_score from sklearn.metrics import auc from matplotlib import pyplot testy = merged_files['evaluation_label'].replace({-1:0}) lr_probs = merged_files['siamese_prediction'] lr_precision, lr_recall, _ = precision_recall_curve(testy.ravel(), lr_probs.ravel()) # , lr_auc = f1_score(testy, yhat), auc(lr_recall, lr_precision) pyplot.plot(lr_recall, lr_precision, marker='.', label='Experiment_5') pyplot.xlabel('Recall') pyplot.ylabel('Precision') pyplot.legend() pyplot.show() from numpy import sqrt, argmax fpr, tpr, thresholds = roc_curve(testy, lr_probs) gmeans = sqrt(tpr * (1-fpr)) ix = argmax(gmeans) print('Best Threshold=%f, G-Mean=%.3f' % (thresholds[ix], gmeans[ix])) pyplot.plot(fpr, tpr, marker='.', label='AUC Curve') pyplot.scatter(fpr[ix], tpr[ix], marker='o', color='black', label='Best') pyplot.xlabel('False Positive Rate') pyplot.ylabel('True Positive Rate') pyplot.legend() pyplot.show() merged_files metrics_df.to_csv(dev_metrics_path + "metrics_1.csv", index = False) pos_feature_set[:10] #All features feature_version = 'Experiment_0/' curr_features = experiment_feature_list[0] saved_model = 'feature_model/Experimentf_0/saved_models/scheduler_False_lr_5e-05_epoch_4_loss_0.4877758026123047_top1_0.8526632302405498.pth' dev_predictions_path = output_path + feature_version + 'dev_predictions/' dev_predictions_top_k = output_path + feature_version + 'dev_predictions_top_k/' dev_colorized = output_path + feature_version + 'dev_predictions_colorized/' dev_metrics_path = output_path + feature_version + 'dev_metrics/' final_score_column = 'siamese_prediction' !mkdir -p $dev_predictions_path !mkdir -p $dev_predictions_top_k !mkdir -p $dev_colorized !mkdir -p $dev_metrics_path metrics_df = top_k_and_add_color(saved_model, curr_features, dev_feature_set, dev_predictions_top_k, dev_metrics_path, dev_predictions_path, dev_colorized, final_score_column, dev_metrics_path) metrics_df.to_csv(dev_metrics_path + "metrics_1.csv", index = False) merged_files = merge_eval_files('feature_model/Experiment_0/dev_predictions/') from sklearn.datasets import make_classification from sklearn.linear_model import LogisticRegression from sklearn.model_selection import train_test_split from sklearn.metrics import precision_recall_curve, roc_curve from sklearn.metrics import f1_score from sklearn.metrics import auc from matplotlib import pyplot testy = merged_files['evaluation_label'].replace({-1:0}) lr_probs = merged_files['siamese_prediction'] lr_precision, lr_recall, _ = precision_recall_curve(testy.ravel(), lr_probs.ravel()) # , lr_auc = f1_score(testy, yhat), auc(lr_recall, lr_precision) pyplot.plot(lr_recall, lr_precision, marker='.', label='Experiment_0') pyplot.xlabel('Recall') pyplot.ylabel('Precision') pyplot.legend() pyplot.show() from numpy import sqrt, argmax fpr, tpr, thresholds = roc_curve(testy, lr_probs) gmeans = sqrt(tpr * (1-fpr)) ix = argmax(gmeans) print('Best Threshold=%f, G-Mean=%.3f' % (thresholds[ix], gmeans[ix])) pyplot.plot(fpr, tpr, marker='.', label='AUC Curve') pyplot.scatter(fpr[ix], tpr[ix], marker='o', color='black', label='Best') pyplot.xlabel('False Positive Rate') pyplot.ylabel('True Positive Rate') pyplot.legend() pyplot.show() #All features feature_version = 'Experiment_1/' curr_features = experiment_feature_list[1] saved_model = 'feature_model/Experiment_1/saved_models/scheduler_False_lr_0.0001_epoch_1_loss_0.33893075585365295_top1_0.9493127147766323.pth' dev_predictions_path = output_path + feature_version + 'dev_predictions/' dev_predictions_top_k = output_path + feature_version + 'dev_predictions_top_k/' dev_colorized = output_path + feature_version + 'dev_predictions_colorized/' dev_metrics_path = output_path + feature_version + 'dev_metrics/' final_score_column = 'siamese_prediction' !mkdir -p $dev_predictions_path !mkdir -p $dev_predictions_top_k !mkdir -p $dev_colorized !mkdir -p $dev_metrics_path metrics_df = top_k_and_add_color(saved_model, curr_features, dev_feature_set, dev_predictions_top_k, dev_metrics_path, dev_predictions_path, dev_colorized, final_score_column, dev_metrics_path) metrics_df.to_csv(dev_metrics_path + "metrics_1.csv", index = False) merged_files = merge_eval_files('feature_model/Experiment_1/dev_predictions/') from sklearn.datasets import make_classification from sklearn.linear_model import LogisticRegression from sklearn.model_selection import train_test_split from sklearn.metrics import precision_recall_curve, roc_curve from sklearn.metrics import f1_score from sklearn.metrics import auc from matplotlib import pyplot testy = merged_files['evaluation_label'].replace({-1:0}) lr_probs = merged_files['siamese_prediction'] lr_precision, lr_recall, _ = precision_recall_curve(testy.ravel(), lr_probs.ravel()) # , lr_auc = f1_score(testy, yhat), auc(lr_recall, lr_precision) pyplot.plot(lr_recall, lr_precision, marker='.', label='Experiment_1') pyplot.xlabel('Recall') pyplot.ylabel('Precision') pyplot.legend() pyplot.show() from numpy import sqrt, argmax fpr, tpr, thresholds = roc_curve(testy, lr_probs) gmeans = sqrt(tpr * (1-fpr)) ix = argmax(gmeans) print('Best Threshold=%f, G-Mean=%.3f' % (thresholds[ix], gmeans[ix])) pyplot.plot(fpr, tpr, marker='.', label='AUC Curve') pyplot.scatter(fpr[ix], tpr[ix], marker='o', color='black', label='Best') pyplot.xlabel('False Positive Rate') pyplot.ylabel('True Positive Rate') pyplot.legend() pyplot.show() #All features feature_version = 'Experiment_2/' curr_features = experiment_feature_list[2] saved_model = 'feature_model/Experiment_2/saved_models/scheduler_False_lr_0.0001_epoch_4_loss_0.3986770808696747_top1_0.9407216494845361.pth' dev_predictions_path = output_path + feature_version + 'dev_predictions/' dev_predictions_top_k = output_path + feature_version + 'dev_predictions_top_k/' dev_colorized = output_path + feature_version + 'dev_predictions_colorized/' dev_metrics_path = output_path + feature_version + 'dev_metrics/' final_score_column = 'siamese_prediction' !mkdir -p $dev_predictions_path !mkdir -p $dev_predictions_top_k !mkdir -p $dev_colorized !mkdir -p $dev_metrics_path metrics_df = top_k_and_add_color(saved_model, curr_features, dev_feature_set, dev_predictions_top_k, dev_metrics_path, dev_predictions_path, dev_colorized, final_score_column, dev_metrics_path) metrics_df.to_csv(dev_metrics_path + "metrics_1.csv", index = False) merged_files = merge_eval_files('feature_model/Experiment_2/dev_predictions/') from sklearn.datasets import make_classification from sklearn.linear_model import LogisticRegression from sklearn.model_selection import train_test_split from sklearn.metrics import precision_recall_curve, roc_curve from sklearn.metrics import f1_score from sklearn.metrics import auc from matplotlib import pyplot testy = merged_files['evaluation_label'].replace({-1:0}) lr_probs = merged_files['siamese_prediction'] lr_precision, lr_recall, _ = precision_recall_curve(testy.ravel(), lr_probs.ravel()) # , lr_auc = f1_score(testy, yhat), auc(lr_recall, lr_precision) pyplot.plot(lr_recall, lr_precision, marker='.', label='Experiment_2') pyplot.xlabel('Recall') pyplot.ylabel('Precision') pyplot.legend() pyplot.show() from numpy import sqrt, argmax fpr, tpr, thresholds = roc_curve(testy, lr_probs) gmeans = sqrt(tpr * (1-fpr)) ix = argmax(gmeans) print('Best Threshold=%f, G-Mean=%.3f' % (thresholds[ix], gmeans[ix])) pyplot.plot(fpr, tpr, marker='.', label='AUC Curve') pyplot.scatter(fpr[ix], tpr[ix], marker='o', color='black', label='Best') pyplot.xlabel('False Positive Rate') pyplot.ylabel('True Positive Rate') pyplot.legend() pyplot.show() df = pd.read_csv('feature_model/Experiment_5/dev_metrics/metrics_1.csv') df.head() df['f1'].mean() #All features feature_version = 'Experiment_4/' curr_features = experiment_feature_list[4] saved_model = 'feature_model/Experimentf_4/saved_models/scheduler_False_lr_5e-05_epoch_8_loss_0.3923964202404022_top1_0.959192439862543.pth' dev_predictions_path = output_path + feature_version + 'dev_predictions/' dev_predictions_top_k = output_path + feature_version + 'dev_predictions_top_k/' dev_colorized = output_path + feature_version + 'dev_predictions_colorized/' dev_metrics_path = output_path + feature_version + 'dev_metrics/' final_score_column = 'siamese_prediction' !mkdir -p $dev_predictions_path !mkdir -p $dev_predictions_top_k !mkdir -p $dev_colorized !mkdir -p $dev_metrics_path metrics_df = top_k_and_add_color(saved_model, curr_features, dev_feature_set, dev_predictions_top_k, dev_metrics_path, dev_predictions_path, dev_colorized, final_score_column, dev_metrics_path) metrics_df.to_csv(dev_metrics_path + "metrics_1.csv", index = False) merged_files = merge_eval_files('feature_model/Experiment_4/dev_predictions/') from sklearn.datasets import make_classification from sklearn.linear_model import LogisticRegression from sklearn.model_selection import train_test_split from sklearn.metrics import precision_recall_curve, roc_curve from sklearn.metrics import f1_score from sklearn.metrics import auc from matplotlib import pyplot testy = merged_files['evaluation_label'].replace({-1:0}) lr_probs = merged_files['siamese_prediction'] lr_precision, lr_recall, _ = precision_recall_curve(testy.ravel(), lr_probs.ravel()) # , lr_auc = f1_score(testy, yhat), auc(lr_recall, lr_precision) pyplot.plot(lr_recall, lr_precision, marker='.', label='Experiment_4') pyplot.xlabel('Recall') pyplot.ylabel('Precision') pyplot.legend() pyplot.show() from numpy import sqrt, argmax fpr, tpr, thresholds = roc_curve(testy, lr_probs) #gmeans = 2*fpr*tpr / (fpr + tpr) #print(gmeans) gmeans = sqrt(tpr * (1-fpr)) ix = argmax(gmeans) print('Best Threshold=%f, G-Mean=%.3f' % (thresholds[ix], gmeans[ix])) pyplot.plot(fpr, tpr, marker='.', label='AUC Curve') pyplot.scatter(fpr[ix], tpr[ix], marker='o', color='black', label='Best') pyplot.xlabel('False Positive Rate') pyplot.ylabel('True Positive Rate') pyplot.legend() pyplot.show() def calc_precision_recall(y_true, y_pred): # Convert predictions to series with index matching y_true y_pred = pd.Series(y_pred, index=y_true.index) # Instantiate counters TP = 0 FP = 0 FN = 0 # Determine whether each prediction is TP, FP, TN, or FN for i in y_true.index: try: if y_true[i]==y_pred[i]==1: TP += 1 if y_pred[i]==1 and y_true[i]!=y_pred[i]: FP += 1 if y_pred[i]==0 and y_true[i]!=y_pred[i]: FN += 1 except: print(y_true[i], y_pred[i]) # Calculate true positive rate and false positive rate # Use try-except statements to avoid problem of dividing by 0 # print(TP, FP, FN) try: precision = TP / (TP + FP) except: precision = 1 try: recall = TP / (TP + FN) except: recall = 1 return precision, recall #precision, recall = calc_precision_recall(testy, lr_probs) probability_thresholds = np.linspace(0, 1, num=1000) len(probability_thresholds) # probability_thresholds[:-30] print(sklearn.metrics.classification_report(y_test, y_test_probs)) precision_scores = [] recall_scores = [] precision_scores_1 = [] recall_scores_1 = [] y_test_probs = lr_probs y_test = testy # Define probability thresholds to use, between 0 and 1 probability_thresholds = np.linspace(0, 1, num=500) y_test = y_test.reset_index(drop = True) y_test_probs = y_test_probs.reset_index(drop = True) # Find true positive / false positive rate for each threshold for p in probability_thresholds: y_test_preds = [] for prob in y_test_probs: if prob > p: y_test_preds.append(1) else: y_test_preds.append(0) #precision, recall = sklearn.metrics.precision_score(y_test, y_test_preds), sklearn.metrics.recall_score(y_test, y_test_preds) precision_1, recall_1 = calc_precision_recall(y_test, y_test_preds) precision_scores.append(precision_1) recall_scores.append(recall_1) #precision_scores_1.append(precision_1) #recall_scores_1.append(recall_1) len(recall_scores) import matplotlib.pyplot as plt fig, ax = plt.subplots(figsize=(6,6)) ax.plot(recall_scores, precision_scores, label='Logistic Regression') # ax.plot(l2_recall_scores, l2_precision_scores, label='L2 Logistic Regression') baseline = len(y_test[y_test==1]) / len(y_test) ax.plot([0, 1], [baseline, baseline], linestyle='--', label='Baseline') ax.set_xlabel('Recall') ax.set_ylabel('Precision') ax.legend(loc='center left'); import matplotlib.pyplot as plt fig, ax = plt.subplots(figsize=(6,6)) ax.plot(recall_scores_1, precision_scores_1, label='Logistic Regression') # ax.plot(l2_recall_scores, l2_precision_scores, label='L2 Logistic Regression') baseline = len(y_test[y_test==1]) / len(y_test) ax.plot([0, 1], [baseline, baseline], linestyle='--', label='Baseline') ax.set_xlabel('Recall') ax.set_ylabel('Precision') ax.legend(loc='center left'); ```
github_jupyter
# Autolabel TMA Cores ## This notebook is an example: create a copy before running it or you will get merge conflicts! **NOTE**: Before running this notebook for the first time, make sure you've coregistered your instrument using the *update coregistration parameters* section of `1_set_up_toffy.ipynb`. This will ensure your FOVs display correctly on the slide. ### Background This notebook automatically checks the names assigned to the cores on a TMA. In order to get the most benefit out of the notebook, make sure that you've named your FOVs appropriately. The expected format is RNCM, where N is the row and M is the column of the TMA. For example, a core on the third row and second column would be R3C2, and one on the 7th row and first column would be R7C1. The script expects that you have already generated and moved the necessary files into the appropriate directory before starting. - A JSON file defining the four corners of the TMA. It's important that you have selected them in the correct order; top left, top right, bottom left, bottom right. Even if one of the cores on the corner is missing, make sure the FOV is located where that corner of the TMA *would* be located, as this is used to define the dimensions of the TMA. You can create this file by exporting the FOVs from the MIBIControl software. - A JSON file containing all of the FOVs that you have selected from the TMA, named appropriately. You can create this file by exporting the FOVs from the MIBIControl software. - The optical image of your TMA slide. This is automatically created when you load your slide, and is saved to the *Data/optical-image* subfolder ``` import sys sys.path.append('../') import json import os from skimage.io import imread from toffy import tiling_utils, json_utils # suppress mpl deprecation import warnings from matplotlib.cbook import mplDeprecation warnings.filterwarnings("ignore", category=mplDeprecation) ``` ### 1. Copy over the necessary files to start the script You will first need to define the prefix to use for all of the files associated with this specific TMA. The default is `tma_name`, but you should change it to something relevant to your study, such as BRCA_TMA_1. Once you have picked your prefix for this specific TMA, you'll need to ensure that all of the necessary files are in the appropriate directory with the correct names * `tma corners file`: this file, which contains the FOVs defining the four corners of the TMA, should be named `tma_name_corners.json`, where `tma_name` is replaced with the `tma_prefix`. * `manual run file`: this file, which contains the manually selected FOVs from your TMA, should be named `tma_name_manual.json`. * `optical image file`: this file, which contains the image of your slide, should be named `tma_name.bmp` Each of these files should be copied to `C:\\Users\\Customer.ION\\Documents\\autolabeled_tma_jsons` ``` # define the prefix for each file tma_prefix = 'example_tma' # user created files tma_dir = os.path.join('C:\\Users\\Customer.ION\\Documents\\autolabeled_tma_jsons') tma_corners_path = os.path.join(tma_dir, '%s_corners.json' % tma_prefix) manual_run_path = os.path.join(tma_dir, '%s_manual.json' % tma_prefix) slide_path = os.path.join(tma_dir, tma_prefix + '.bmp') # files the notebook will create auto_fov_names_path = os.path.join(tma_dir, '%s_automatic_fov_names.json' % tma_prefix) mapping_path = os.path.join(tma_dir, '%s_mapping.json' % tma_prefix) remapped_fov_path = os.path.join(tma_dir, '%s_automatic_run.json' % tma_prefix) moly_path = os.path.join(tma_dir, '%s_moly_point.json' % tma_prefix) ``` ### 2. Generate the automatic mapping of FOV names ``` # Define TMA grid dimensions tma_num_row = 7 tma_num_col = 4 # generate automatically named TMA auto_fov_regions = tiling_utils.generate_tma_fov_list( tma_corners_path, tma_num_row, tma_num_col ) # save the automatically-named TMA FOVs to centroids mapping with open(auto_fov_names_path, 'w', encoding='utf-8') as afrp: json.dump(auto_fov_regions, afrp) # load the user-defined set of FOVs in with open(manual_run_path, 'r', encoding='utf-8') as mfop: manual_fov_regions = json.load(mfop) # ensure missing and duplicate FOV names get identified manual_fov_regions = json_utils.rename_missing_fovs(manual_fov_regions) manual_fov_regions = json_utils.rename_duplicate_fovs(manual_fov_regions) # load the slide image in slide_data = imread(slide_path) ``` ### 3. Set thresholds for identifying incorrect FOV names The variables below control the tolerance for identifying when a core has been named incorrectly. * `check_dist`: set to a positive value to notify of FOV mappings at a distance greater than this value (measured in microns), sorted by decreasing distance. Set to `None` to bypass. * `check_duplicates`: set to `True` to flag FOVs in `auto_fov_regions` with multiple FOVs mapping to it. Set to `False` to bypass. * `check_mismatches`: set to `True` to flag FOVs with mismatched names. Set to `False` to bypass. Assumes FOVs have been named R1C1, R1C2, etc. ``` check_dist = 2000 check_duplicates = True check_mismatches = True ``` Each FOV in `manual_fov_regions` are mapped to their closest corresponding FOV in `auto_fov_regions` by default. To see the current mappings, select FOVs in the `Manually-defined FOV` menu. To remap a manual FOV to a different auto FOV, use the `Automatically-generated FOV` menu. After you're done finished, click `Save mapping` and run the cells afterward (ignore any error messages that may appear there beforehand). You can always come back here and redo your mappings if you change your mind. ``` %matplotlib widget tiling_utils.tma_interactive_remap( manual_fov_regions, auto_fov_regions, slide_data, mapping_path, draw_radius=7, figsize=(7, 7), check_dist=check_dist, check_duplicates=check_duplicates, check_mismatches=check_mismatches ) ``` ### 4. Set parameters for created remapped JSON The variables below will control how the remapped JSON is created * `randomize`: shuffle the order of the FOVs in `remapped_fov_regions` to avoid potential batch effects of acquisition order * `moly_insert`: insert a moly FOV between a specified interval of FOVs * `moly_interval`: if `moly_insert` is set, controls how many FOVs are between each subsequent moly FOV ``` randomize = True moly_insert = True moly_interval = 5 # load the mapping saved by the interactive visualization with open(mapping_path, 'r', encoding='utf-8') as mp: mapping = json.load(mp) # rename FOVs, randomize the order, and insert moly points at a specified interval remapped_fov_regions = tiling_utils.remap_and_reorder_fovs( manual_fov_regions, mapping, moly_path, randomize=randomize, moly_insert=moly_insert, moly_interval=moly_interval ) # save remapped_fov_regions with open(remapped_fov_path, 'w', encoding='utf-8') as rtp: json.dump(remapped_fov_regions, rtp) ```
github_jupyter
##### Copyright 2019 The TensorFlow Authors. ``` #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. ``` # Neural machine translation with attention <table class="tfo-notebook-buttons" align="left"> <td> <a target="_blank" href="https://www.tensorflow.org/tutorials/text/nmt_with_attention"> <img src="https://www.tensorflow.org/images/tf_logo_32px.png" /> View on TensorFlow.org</a> </td> <td> <a target="_blank" href="https://colab.research.google.com/github/tensorflow/docs/blob/master/site/en/tutorials/text/nmt_with_attention.ipynb"> <img src="https://www.tensorflow.org/images/colab_logo_32px.png" /> Run in Google Colab</a> </td> <td> <a target="_blank" href="https://github.com/tensorflow/docs/blob/master/site/en/tutorials/text/nmt_with_attention.ipynb"> <img src="https://www.tensorflow.org/images/GitHub-Mark-32px.png" /> View source on GitHub</a> </td> <td> <a href="https://storage.googleapis.com/tensorflow_docs/docs/site/en/tutorials/text/nmt_with_attention.ipynb"><img src="https://www.tensorflow.org/images/download_logo_32px.png" />Download notebook</a> </td> </table> This notebook trains a sequence to sequence (seq2seq) model for Spanish to English translation. This is an advanced example that assumes some knowledge of sequence to sequence models. After training the model in this notebook, you will be able to input a Spanish sentence, such as *"¿todavia estan en casa?"*, and return the English translation: *"are you still at home?"* The translation quality is reasonable for a toy example, but the generated attention plot is perhaps more interesting. This shows which parts of the input sentence has the model's attention while translating: <img src="https://tensorflow.org/images/spanish-english.png" alt="spanish-english attention plot"> Note: This example takes approximately 10 mintues to run on a single P100 GPU. ``` from __future__ import absolute_import, division, print_function, unicode_literals try: # %tensorflow_version only exists in Colab. %tensorflow_version 2.x except Exception: pass import tensorflow as tf import matplotlib.pyplot as plt import matplotlib.ticker as ticker from sklearn.model_selection import train_test_split import unicodedata import re import numpy as np import os import io import time ``` ## Download and prepare the dataset We'll use a language dataset provided by http://www.manythings.org/anki/. This dataset contains language translation pairs in the format: ``` May I borrow this book? ¿Puedo tomar prestado este libro? ``` There are a variety of languages available, but we'll use the English-Spanish dataset. For convenience, we've hosted a copy of this dataset on Google Cloud, but you can also download your own copy. After downloading the dataset, here are the steps we'll take to prepare the data: 1. Add a *start* and *end* token to each sentence. 2. Clean the sentences by removing special characters. 3. Create a word index and reverse word index (dictionaries mapping from word → id and id → word). 4. Pad each sentence to a maximum length. ``` # Download the file path_to_zip = tf.keras.utils.get_file( 'spa-eng.zip', origin='http://storage.googleapis.com/download.tensorflow.org/data/spa-eng.zip', extract=True) path_to_file = os.path.dirname(path_to_zip)+"/spa-eng/spa.txt" # Converts the unicode file to ascii def unicode_to_ascii(s): return ''.join(c for c in unicodedata.normalize('NFD', s) if unicodedata.category(c) != 'Mn') def preprocess_sentence(w): w = unicode_to_ascii(w.lower().strip()) # creating a space between a word and the punctuation following it # eg: "he is a boy." => "he is a boy ." # Reference:- https://stackoverflow.com/questions/3645931/python-padding-punctuation-with-white-spaces-keeping-punctuation w = re.sub(r"([?.!,¿])", r" \1 ", w) w = re.sub(r'[" "]+', " ", w) # replacing everything with space except (a-z, A-Z, ".", "?", "!", ",") w = re.sub(r"[^a-zA-Z?.!,¿]+", " ", w) w = w.rstrip().strip() # adding a start and an end token to the sentence # so that the model know when to start and stop predicting. w = '<start> ' + w + ' <end>' return w en_sentence = u"May I borrow this book?" sp_sentence = u"¿Puedo tomar prestado este libro?" print(preprocess_sentence(en_sentence)) print(preprocess_sentence(sp_sentence).encode('utf-8')) # 1. Remove the accents # 2. Clean the sentences # 3. Return word pairs in the format: [ENGLISH, SPANISH] def create_dataset(path, num_examples): lines = io.open(path, encoding='UTF-8').read().strip().split('\n') word_pairs = [[preprocess_sentence(w) for w in l.split('\t')] for l in lines[:num_examples]] return zip(*word_pairs) en, sp = create_dataset(path_to_file, None) print(en[-1]) print(sp[-1]) def max_length(tensor): return max(len(t) for t in tensor) def tokenize(lang): lang_tokenizer = tf.keras.preprocessing.text.Tokenizer( filters='') lang_tokenizer.fit_on_texts(lang) tensor = lang_tokenizer.texts_to_sequences(lang) tensor = tf.keras.preprocessing.sequence.pad_sequences(tensor, padding='post') return tensor, lang_tokenizer def load_dataset(path, num_examples=None): # creating cleaned input, output pairs targ_lang, inp_lang = create_dataset(path, num_examples) input_tensor, inp_lang_tokenizer = tokenize(inp_lang) target_tensor, targ_lang_tokenizer = tokenize(targ_lang) return input_tensor, target_tensor, inp_lang_tokenizer, targ_lang_tokenizer ``` ### Limit the size of the dataset to experiment faster (optional) Training on the complete dataset of >100,000 sentences will take a long time. To train faster, we can limit the size of the dataset to 30,000 sentences (of course, translation quality degrades with less data): ``` # Try experimenting with the size of that dataset num_examples = 30000 input_tensor, target_tensor, inp_lang, targ_lang = load_dataset(path_to_file, num_examples) # Calculate max_length of the target tensors max_length_targ, max_length_inp = max_length(target_tensor), max_length(input_tensor) # Creating training and validation sets using an 80-20 split input_tensor_train, input_tensor_val, target_tensor_train, target_tensor_val = train_test_split(input_tensor, target_tensor, test_size=0.2) # Show length print(len(input_tensor_train), len(target_tensor_train), len(input_tensor_val), len(target_tensor_val)) def convert(lang, tensor): for t in tensor: if t!=0: print ("%d ----> %s" % (t, lang.index_word[t])) print ("Input Language; index to word mapping") convert(inp_lang, input_tensor_train[0]) print () print ("Target Language; index to word mapping") convert(targ_lang, target_tensor_train[0]) ``` ### Create a tf.data dataset ``` BUFFER_SIZE = len(input_tensor_train) BATCH_SIZE = 64 steps_per_epoch = len(input_tensor_train)//BATCH_SIZE embedding_dim = 256 units = 1024 vocab_inp_size = len(inp_lang.word_index)+1 vocab_tar_size = len(targ_lang.word_index)+1 dataset = tf.data.Dataset.from_tensor_slices((input_tensor_train, target_tensor_train)).shuffle(BUFFER_SIZE) dataset = dataset.batch(BATCH_SIZE, drop_remainder=True) example_input_batch, example_target_batch = next(iter(dataset)) example_input_batch.shape, example_target_batch.shape ``` ## Write the encoder and decoder model Implement an encoder-decoder model with attention which you can read about in the TensorFlow [Neural Machine Translation (seq2seq) tutorial](https://github.com/tensorflow/nmt). This example uses a more recent set of APIs. This notebook implements the [attention equations](https://github.com/tensorflow/nmt#background-on-the-attention-mechanism) from the seq2seq tutorial. The following diagram shows that each input words is assigned a weight by the attention mechanism which is then used by the decoder to predict the next word in the sentence. The below picture and formulas are an example of attention mechanism from [Luong's paper](https://arxiv.org/abs/1508.04025v5). <img src="https://www.tensorflow.org/images/seq2seq/attention_mechanism.jpg" width="500" alt="attention mechanism"> The input is put through an encoder model which gives us the encoder output of shape *(batch_size, max_length, hidden_size)* and the encoder hidden state of shape *(batch_size, hidden_size)*. Here are the equations that are implemented: <img src="https://www.tensorflow.org/images/seq2seq/attention_equation_0.jpg" alt="attention equation 0" width="800"> <img src="https://www.tensorflow.org/images/seq2seq/attention_equation_1.jpg" alt="attention equation 1" width="800"> This tutorial uses [Bahdanau attention](https://arxiv.org/pdf/1409.0473.pdf) for the encoder. Let's decide on notation before writing the simplified form: * FC = Fully connected (dense) layer * EO = Encoder output * H = hidden state * X = input to the decoder And the pseudo-code: * `score = FC(tanh(FC(EO) + FC(H)))` * `attention weights = softmax(score, axis = 1)`. Softmax by default is applied on the last axis but here we want to apply it on the *1st axis*, since the shape of score is *(batch_size, max_length, hidden_size)*. `Max_length` is the length of our input. Since we are trying to assign a weight to each input, softmax should be applied on that axis. * `context vector = sum(attention weights * EO, axis = 1)`. Same reason as above for choosing axis as 1. * `embedding output` = The input to the decoder X is passed through an embedding layer. * `merged vector = concat(embedding output, context vector)` * This merged vector is then given to the GRU The shapes of all the vectors at each step have been specified in the comments in the code: ``` class Encoder(tf.keras.Model): def __init__(self, vocab_size, embedding_dim, enc_units, batch_sz): super(Encoder, self).__init__() self.batch_sz = batch_sz self.enc_units = enc_units self.embedding = tf.keras.layers.Embedding(vocab_size, embedding_dim) self.gru = tf.keras.layers.GRU(self.enc_units, return_sequences=True, return_state=True, recurrent_initializer='glorot_uniform') def call(self, x, hidden): x = self.embedding(x) output, state = self.gru(x, initial_state = hidden) return output, state def initialize_hidden_state(self): return tf.zeros((self.batch_sz, self.enc_units)) encoder = Encoder(vocab_inp_size, embedding_dim, units, BATCH_SIZE) # sample input sample_hidden = encoder.initialize_hidden_state() sample_output, sample_hidden = encoder(example_input_batch, sample_hidden) print ('Encoder output shape: (batch size, sequence length, units) {}'.format(sample_output.shape)) print ('Encoder Hidden state shape: (batch size, units) {}'.format(sample_hidden.shape)) class BahdanauAttention(tf.keras.layers.Layer): def __init__(self, units): super(BahdanauAttention, self).__init__() self.W1 = tf.keras.layers.Dense(units) self.W2 = tf.keras.layers.Dense(units) self.V = tf.keras.layers.Dense(1) def call(self, query, values): # hidden shape == (batch_size, hidden size) # hidden_with_time_axis shape == (batch_size, 1, hidden size) # we are doing this to perform addition to calculate the score hidden_with_time_axis = tf.expand_dims(query, 1) # score shape == (batch_size, max_length, 1) # we get 1 at the last axis because we are applying score to self.V # the shape of the tensor before applying self.V is (batch_size, max_length, units) score = self.V(tf.nn.tanh( self.W1(values) + self.W2(hidden_with_time_axis))) # attention_weights shape == (batch_size, max_length, 1) attention_weights = tf.nn.softmax(score, axis=1) # context_vector shape after sum == (batch_size, hidden_size) context_vector = attention_weights * values context_vector = tf.reduce_sum(context_vector, axis=1) return context_vector, attention_weights attention_layer = BahdanauAttention(10) attention_result, attention_weights = attention_layer(sample_hidden, sample_output) print("Attention result shape: (batch size, units) {}".format(attention_result.shape)) print("Attention weights shape: (batch_size, sequence_length, 1) {}".format(attention_weights.shape)) class Decoder(tf.keras.Model): def __init__(self, vocab_size, embedding_dim, dec_units, batch_sz): super(Decoder, self).__init__() self.batch_sz = batch_sz self.dec_units = dec_units self.embedding = tf.keras.layers.Embedding(vocab_size, embedding_dim) self.gru = tf.keras.layers.GRU(self.dec_units, return_sequences=True, return_state=True, recurrent_initializer='glorot_uniform') self.fc = tf.keras.layers.Dense(vocab_size) # used for attention self.attention = BahdanauAttention(self.dec_units) def call(self, x, hidden, enc_output): # enc_output shape == (batch_size, max_length, hidden_size) context_vector, attention_weights = self.attention(hidden, enc_output) # x shape after passing through embedding == (batch_size, 1, embedding_dim) x = self.embedding(x) # x shape after concatenation == (batch_size, 1, embedding_dim + hidden_size) x = tf.concat([tf.expand_dims(context_vector, 1), x], axis=-1) # passing the concatenated vector to the GRU output, state = self.gru(x) # output shape == (batch_size * 1, hidden_size) output = tf.reshape(output, (-1, output.shape[2])) # output shape == (batch_size, vocab) x = self.fc(output) return x, state, attention_weights decoder = Decoder(vocab_tar_size, embedding_dim, units, BATCH_SIZE) sample_decoder_output, _, _ = decoder(tf.random.uniform((BATCH_SIZE, 1)), sample_hidden, sample_output) print ('Decoder output shape: (batch_size, vocab size) {}'.format(sample_decoder_output.shape)) ``` ## Define the optimizer and the loss function ``` optimizer = tf.keras.optimizers.Adam() loss_object = tf.keras.losses.SparseCategoricalCrossentropy( from_logits=True, reduction='none') def loss_function(real, pred): mask = tf.math.logical_not(tf.math.equal(real, 0)) loss_ = loss_object(real, pred) mask = tf.cast(mask, dtype=loss_.dtype) loss_ *= mask return tf.reduce_mean(loss_) ``` ## Checkpoints (Object-based saving) ``` checkpoint_dir = './training_checkpoints' checkpoint_prefix = os.path.join(checkpoint_dir, "ckpt") checkpoint = tf.train.Checkpoint(optimizer=optimizer, encoder=encoder, decoder=decoder) ``` ## Training 1. Pass the *input* through the *encoder* which return *encoder output* and the *encoder hidden state*. 2. The encoder output, encoder hidden state and the decoder input (which is the *start token*) is passed to the decoder. 3. The decoder returns the *predictions* and the *decoder hidden state*. 4. The decoder hidden state is then passed back into the model and the predictions are used to calculate the loss. 5. Use *teacher forcing* to decide the next input to the decoder. 6. *Teacher forcing* is the technique where the *target word* is passed as the *next input* to the decoder. 7. The final step is to calculate the gradients and apply it to the optimizer and backpropagate. ``` @tf.function def train_step(inp, targ, enc_hidden): loss = 0 with tf.GradientTape() as tape: enc_output, enc_hidden = encoder(inp, enc_hidden) dec_hidden = enc_hidden dec_input = tf.expand_dims([targ_lang.word_index['<start>']] * BATCH_SIZE, 1) # Teacher forcing - feeding the target as the next input for t in range(1, targ.shape[1]): # passing enc_output to the decoder predictions, dec_hidden, _ = decoder(dec_input, dec_hidden, enc_output) loss += loss_function(targ[:, t], predictions) # using teacher forcing dec_input = tf.expand_dims(targ[:, t], 1) batch_loss = (loss / int(targ.shape[1])) variables = encoder.trainable_variables + decoder.trainable_variables gradients = tape.gradient(loss, variables) optimizer.apply_gradients(zip(gradients, variables)) return batch_loss EPOCHS = 10 for epoch in range(EPOCHS): start = time.time() enc_hidden = encoder.initialize_hidden_state() total_loss = 0 for (batch, (inp, targ)) in enumerate(dataset.take(steps_per_epoch)): batch_loss = train_step(inp, targ, enc_hidden) total_loss += batch_loss if batch % 100 == 0: print('Epoch {} Batch {} Loss {:.4f}'.format(epoch + 1, batch, batch_loss.numpy())) # saving (checkpoint) the model every 2 epochs if (epoch + 1) % 2 == 0: checkpoint.save(file_prefix = checkpoint_prefix) print('Epoch {} Loss {:.4f}'.format(epoch + 1, total_loss / steps_per_epoch)) print('Time taken for 1 epoch {} sec\n'.format(time.time() - start)) ``` ## Translate * The evaluate function is similar to the training loop, except we don't use *teacher forcing* here. The input to the decoder at each time step is its previous predictions along with the hidden state and the encoder output. * Stop predicting when the model predicts the *end token*. * And store the *attention weights for every time step*. Note: The encoder output is calculated only once for one input. ``` def evaluate(sentence): attention_plot = np.zeros((max_length_targ, max_length_inp)) sentence = preprocess_sentence(sentence) inputs = [inp_lang.word_index[i] for i in sentence.split(' ')] inputs = tf.keras.preprocessing.sequence.pad_sequences([inputs], maxlen=max_length_inp, padding='post') inputs = tf.convert_to_tensor(inputs) result = '' hidden = [tf.zeros((1, units))] enc_out, enc_hidden = encoder(inputs, hidden) dec_hidden = enc_hidden dec_input = tf.expand_dims([targ_lang.word_index['<start>']], 0) for t in range(max_length_targ): predictions, dec_hidden, attention_weights = decoder(dec_input, dec_hidden, enc_out) # storing the attention weights to plot later on attention_weights = tf.reshape(attention_weights, (-1, )) attention_plot[t] = attention_weights.numpy() predicted_id = tf.argmax(predictions[0]).numpy() result += targ_lang.index_word[predicted_id] + ' ' if targ_lang.index_word[predicted_id] == '<end>': return result, sentence, attention_plot # the predicted ID is fed back into the model dec_input = tf.expand_dims([predicted_id], 0) return result, sentence, attention_plot # function for plotting the attention weights def plot_attention(attention, sentence, predicted_sentence): fig = plt.figure(figsize=(10,10)) ax = fig.add_subplot(1, 1, 1) ax.matshow(attention, cmap='viridis') fontdict = {'fontsize': 14} ax.set_xticklabels([''] + sentence, fontdict=fontdict, rotation=90) ax.set_yticklabels([''] + predicted_sentence, fontdict=fontdict) ax.xaxis.set_major_locator(ticker.MultipleLocator(1)) ax.yaxis.set_major_locator(ticker.MultipleLocator(1)) plt.show() def translate(sentence): result, sentence, attention_plot = evaluate(sentence) print('Input: %s' % (sentence)) print('Predicted translation: {}'.format(result)) attention_plot = attention_plot[:len(result.split(' ')), :len(sentence.split(' '))] plot_attention(attention_plot, sentence.split(' '), result.split(' ')) ``` ## Restore the latest checkpoint and test ``` # restoring the latest checkpoint in checkpoint_dir checkpoint.restore(tf.train.latest_checkpoint(checkpoint_dir)) translate(u'hace mucho frio aqui.') translate(u'esta es mi vida.') translate(u'¿todavia estan en casa?') # wrong translation translate(u'trata de averiguarlo.') ``` ## Next steps * [Download a different dataset](http://www.manythings.org/anki/) to experiment with translations, for example, English to German, or English to French. * Experiment with training on a larger dataset, or using more epochs
github_jupyter
# Features and Objectives This doc is mostly text, explaining the general concept of features, listing the ones defined in rai, and explaining how they define objectives for optimization. At the bottom there are also examples on the collision features. ## Features We assume a single configuration $x$, or a whole set of configurations $\{x_1,..,x_T\}$. Each $x_i \in\mathbb{R}$ are the DOFs of that configuration. A feature $\phi$ is a differentiable mapping $$\phi: x \mapsto \mathbb{R}^D$$ of a single configuration into some $D$-dimensional space, or a mapping $$\phi: (x_0,x_2,..,x_k) \mapsto \mathbb{R}^D$$ of a $(k+1)$-tuple of configurations to a $D$-dimensional space. The rai code implements many features, most of them are accessible via a feature symbol (FS). They are declared in https://github.com/MarcToussaint/rai/blob/master/rai/Kin/featureSymbols.h Here is a table of feature symbols, with the respective dimensionality $D$, the default order $k$, and a description | FS | frames | $D$ | $k$ | description | |:---:|:---:|:---:|:---:|:---:| | position | {o1} | 3 || 3D position of o1 in world coordinates | | positionDiff | {o1,o2} | 3 || difference of 3D positions of o1 and o2 in world coordinates | | positionRel | {o1,o2} | 3 || 3D position of o1 in o2 coordinates | | quaternion | {o1} | 4 || 4D quaternion of o1 in world coordinates\footnote{There is ways to handle the invariance w.r.t.\ quaternion sign properly.} | | quaternionDiff | {o1,o2} | 4 || ... | | quaternionRel | {o1,o2} | 4 || ... | | pose | {o1} | 7 || 7D pose of o1 in world coordinates | | poseDiff | {o1,o2} | 7 || ... | | poseRel | {o1,o2} | 7 || ... | | vectorX | {o1} | 3 || The x-axis of frame o1 rotated back to world coordinates | | vectorXDiff | {o1,o2} | 3 || The difference of the above for two frames o1 and o2 | | vectorXRel | {o1,o2} | 3 || The x-axis of frame o1 rotated as to be seend from the frame o2 | | vectorY... | | | | same as above | | scalarProductXX | {o1,o2} | 1 || The scalar product of the x-axis fo frame o1 with the x-axis of frame o2 | | scalarProduct... | {o1,o2} | | | as above | | gazeAt | {o1,o2} | 2 | | The 2D projection of the origin of frame o2 onto the xy-plane of frame o1 | | angularVel | {o1} | 3 | 1 | The angular velocity of frame o1 across two configurations | | accumulatedCollisions | {} | 1 | | The sum of collision penetrations; when negative/zero, nothing is colliding | | jointLimits | {} | 1 | | The sum of joint limit penetrations; when negative/zero, all joint limits are ok | | distance | {o1,o1} | 1 | | The NEGATIVE distance between convex meshes o1 and o2, positive for penetration | | qItself | {} | $n$ | | The configuration joint vector | | aboveBox | {o1,o2} | 4 | | when all negative, o1 is above (inside support of) the box o2 | | insideBox | {o1,o2} | 6 | | when all negative, o1 is inside the box o2 | | standingAbove | | | | ? | A features is typically defined by * The feature symbol (`FS_...` in cpp; `FS....` in python) * The set of frames it refers to * Optionally: A target, which changes the zero-point of the features (optimization typically try to drive features to zero, see below) * Optionally: A scaling, that can also be a matrix to down-project a feature * Optionally: The order $k$, which can make the feature a velocity or acceleration feature Target and scale redefine a feature to become $$ \phi(x) \gets \texttt{scale} \cdot (\phi(x) - \texttt{target}) $$ The target needs to be a $D$-dim vector. The scale can be a matrix, which projects features; e.g., and 3D position to just $x$-position. The order of a feature is usually $k=0$, meaning that it is defined over a single configuration only. $k=1$ means that it is defined over two configurations (1st oder Markov), and redefines the feature to become the difference or velocity $$ \phi(x_1,x_2) \gets \frac{1}{\tau}(\phi(x_2) - \phi(x_1)) $$ $k=2$ means that it is defined over three configurations (2nd order Markov), and redefines the feature to become the acceleration $$ \phi(x_1,x_2,x_3) \equiv \frac{1}{\tau^2}(\phi(x_1) + \phi(x_3) - 2 \phi(x_2)) $$ ### Examples ``` (FS.position, {'hand'}) ``` is the 3D position of the hand in world coordinates ``` (FS.positionRel, {'handL', 'handR'}, scale=[[0,0,1]], target=[0.1]) ``` is the z-position position of the left hand measured in the frame of the right hand, with target 10centimeters. ``` (FS.position, {'handL'}, order=1) ``` is the 3D velocity of the left hand in world coordinates ``` (FS.scalarProductXX, {'handL', 'handR'}, target=[1]) ``` says that the scalar product of the x-axes (e.g. directions of the index finger) of both hands should equal 1, which means they are aligned. ``` (FS.scalarProductXY, {'handL', 'handR'}) (FS.scalarProductXZ, {'handL', 'handR'}) ``` says that the the x-axis of handL should be orthogonal (zero scalar product) to the y- and z-axis of handR. So this also describes aligning both x-axes. However, this formulation is much more robust, as it has good error gradients around the optimum. ## Objectives Features are meant to define objectives in an optimization problem. An objective is * a feature * an indicator $\rho_k \in\{\texttt{ineq, eq, sos}\}$ that states whether the features implies an inequality, an equality, or a sum-of-square objective * and an index tuple $\pi_k \subseteq \{1,..,n\}$ that states which configurations this feature is defined over. Then, given a set $\{\phi_1,..,\phi_K\}$ of $K$ features, and a set $\{x_1,..,x_n\}$ of $n$ configurations, this defines the mathematical program \begin{align} \min_{x_1,..,x_n} \sum_{k : \rho_k=\texttt{sos}} \phi_k(x_{\pi_k})^T \phi_k(x_{\pi_k}) ~\text{s.t.}~ \mathop\forall_{k : \rho_k=\texttt{ineq}} \phi_k(x_{\pi_k}) \le 0 ~,\quad \mathop\forall_{k : \rho_k=\texttt{eq}} \phi_k(x_{\pi_k}) = 0 ~,\quad \end{align} ## Code example for collision features * Get list of collisions and proximities for the whole configuration * Get a accumulative, differentiable collision measure * Get proximity/penetration specifically for a pair of shapes * Other geometric collision features for a pair of shapes (witness points, normal, etc) -- all differentiable ``` import sys sys.path.append('../../../build') import numpy as np import libry as ry C = ry.Config() C.addFile('../../../rai-robotModels/pr2/pr2.g'); C.addFile('../../../rai-robotModels/objects/kitchen.g'); C.view() ``` Let's evaluate the accumulative collision scalar and its Jacobian ``` coll = C.feature(ry.FS.accumulatedCollisions, []) C.computeCollisions() #collisions/proxies are not automatically computed on set...State coll.eval(C) ``` Let's move into collision and redo this ``` C.selectJointsByTag(["base"]) C.setJointState([1.5,1,0]) C.computeCollisions() coll.eval(C) ``` We can get more verbose information like this: ``` C.getCollisions() C.getCollisions(0) #only report proxies with distance<0 (penetrations) ``` The computeCollisions() method calls a collision detection engine (SWIFT++) for the whole configuration, checking all shapes that are collision-activated. The activation/deactivation of collision computations is a nuissance! the 'contact' flag in g-files specifies which shapes are activated by default, and if the value is negative, that collisions with parent shapes are not included. (In the KOMO class, you can use activateCollisionPairs and deactivateCollisionPairs to modify these defaults in optimization problems... TODO: also in Config) When you're interested in the distance or penetration of one specific pair of objects, you don't need to call computeCollisions() and instead query a feature that calls the GJK (and others) algorithm directly only for this pair: ``` dist = C.feature(ry.FS.distance, ['coll_wrist_r', '_10']) dist.eval(C) ``` Note that this returns the NEGATIVE distance (because one typically wants to put an inequality (<=0) on this). The C++ code implements many more features of the collision geometry, including the normal, witness points, etc. Can be added to python easily on request. ``` C.view_close() ```
github_jupyter
``` !pip install python-dotenv from dotenv import load_dotenv, find_dotenv # find .env automatically by walking up directories until it's found dotenv_path = find_dotenv() #load up the entries as enviroment variables load_dotenv(dotenv_path) # extrating env var using os.environ.get import os KAGGLE_USERNAME = os.environ.get("KAGGLE_USERNAME") print(KAGGLE_USERNAME) # import import requests from requests import session import os from dotenv import load_dotenv, find_dotenv # payload for post payload = { 'action': 'login', 'username': os.environ.get('KAGGLE_USERNAME'), 'password': os.environ.get('KAGGLE_PASSWORD') } # url for train file (get the link from Kaggle websites) url = 'https://www.kaggle.com/c/titanic/download/train.csv' # setup session with session() as c: # post request c.post('https://www.kaggle.com/account/login', data=payload) # get request response = c.get(url) # print response text print(response.text) from requests import session # payload for post payload = { 'action': 'login', 'username': os.environ.get('KAGGLE_USERNAME'), 'password': os.environ.get('KAGGLE_PASSWORD') } def extract_data(url, file_path): ''' extract data from kaggle ''' # setup session with session() as c: c.post('https://www.kaggle.com/account/login', data=payload) # open file to write with open(file_path, 'wb') as handle: response = c.get(url, stream=True) for block in response.iter_content(1024): handle.write(block) # urls train_url = 'https://www.kaggle.com/c/titanic/download/train.csv' test_url = 'https://www.kaggle.com/c/titanic/download/test.csv' #file path raw_data_path = os.path.join(os.path.pardir,'data','raw') train_data_path = os.path.join(raw_data_path,'train.csv') test_data_path = os.path.join(raw_data_path,'test.csv') # etract data extract_data(train_url,train_data_path) extract_data(test_url,test_data_path) !ls -l ../data/raw ``` ## Building the file script ``` get_raw_data_script_file = os.path.join(os.path.pardir,'src','data','get_raw_data.py') %%writefile $get_raw_data_script_file # coding utf-8 import os from dotenv import load_dotenv, find_dotenv from requests import session import logging # payload for login to kaggle payload = { 'action': 'login', 'username': os.environ.get('KAGGLE_USERNAME'), 'password': os.environ.get('KAGGLE_PASSWORD') } url_login = 'https://www.kaggle.com/account/login' def extract_data(url, file_path): ''' method to extract data ''' # setup session with session() as c: c.post(url_login, data=payload) # open file to write with open(file_path, 'wb') as handle: response = c.get(url, stream=True) for block in response.iter_content(1024): handle.write(block) def main(project_dir): ''' main method ''' # get logger logger = logging.getLogger(__name__) logger.info('getting raw data') #urls train_url = 'https://www.kaggle.com/c/titanic/download/train.csv' test_url = 'https://www.kaggle.com/c/titanic/download/test.csv' #file path raw_data_path = os.path.join(os.path.pardir,'data','raw') train_data_path = os.path.join(raw_data_path,'train.csv') test_data_path = os.path.join(raw_data_path,'test.csv') # etract data extract_data(train_url,train_data_path) extract_data(test_url,test_data_path) logger.info('downloaded raw training and test data') if __name__ == '__main__': # getting root directory project_dir = os.path.join(os.path.dirname(__file__), os.pardir, os.pardir) # setup logger log_fmt = '%(asctime)s - %(name)s - %(levelname)s - %(message)s' logging.basicConfig(level=logging.INFO, format=log_fmt) # find .env automatically by walking up directories until it's found dotenv_path = find_dotenv() # load up the entries as enviroment variables load_dotenv(dotenv_path) # call the main main(project_dir) !python $get_raw_data_script_file ```
github_jupyter
# Задание 2.2 - Введение в PyTorch Для этого задания потребуется установить версию PyTorch 1.0 https://pytorch.org/get-started/locally/ В этом задании мы познакомимся с основными компонентами PyTorch и натренируем несколько небольших моделей.<br> GPU нам пока не понадобится. Основные ссылки: https://pytorch.org/tutorials/beginner/deep_learning_60min_blitz.html https://pytorch.org/docs/stable/nn.html https://pytorch.org/docs/stable/torchvision/index.html ``` import torch import torch.nn as nn import torch.optim as optim import torchvision.datasets as dset from torch.utils.data.sampler import SubsetRandomSampler, Sampler from torchvision import transforms import matplotlib.pyplot as plt %matplotlib inline import numpy as np ``` ## Как всегда, начинаем с загрузки данных PyTorch поддерживает загрузку SVHN из коробки. ``` data_train = dset.SVHN('./data/', split='train', download=False, transform=transforms.Compose([ transforms.ToTensor(), transforms.Normalize(mean=[0.43,0.44,0.47], std=[0.20,0.20,0.20]) ]) ) # First, lets load the dataset data_test = dset.SVHN('./data/', split='test', download=False, transform=transforms.Compose([ transforms.ToTensor(), transforms.Normalize(mean=[0.43,0.44,0.47], std=[0.20,0.20,0.20]) ])) ``` Теперь мы разделим данные на training и validation с использованием классов `SubsetRandomSampler` и `DataLoader`. `DataLoader` подгружает данные, предоставляемые классом `Dataset`, во время тренировки и группирует их в батчи. Он дает возможность указать `Sampler`, который выбирает, какие примеры из датасета использовать для тренировки. Мы используем это, чтобы разделить данные на training и validation. Подробнее: https://pytorch.org/tutorials/beginner/data_loading_tutorial.html ``` batch_size = 64 data_size = data_train.data.shape[0] validation_split = .2 split = int(np.floor(validation_split * data_size)) indices = list(range(data_size)) np.random.shuffle(indices) train_indices, val_indices = indices[split:], indices[:split] train_sampler = SubsetRandomSampler(train_indices) val_sampler = SubsetRandomSampler(val_indices) train_loader = torch.utils.data.DataLoader(data_train, batch_size=batch_size, sampler=train_sampler) val_loader = torch.utils.data.DataLoader(data_train, batch_size=batch_size, sampler=val_sampler) ``` В нашей задаче мы получаем на вход изображения, но работаем с ними как с одномерными массивами. Чтобы превратить многомерный массив в одномерный, мы воспользуемся очень простым вспомогательным модулем `Flattener`. ``` sample, label = data_train[0] print("SVHN data sample shape: ", sample.shape) # As you can see, the data is shaped like an image # We'll use a special helper module to shape it into a tensor class Flattener(nn.Module): def forward(self, x): batch_size, *_ = x.shape return x.view(batch_size, -1) ``` И наконец, мы создаем основные объекты PyTorch: - `nn_model` - собственно, модель с нейросетью - `loss` - функцию ошибки, в нашем случае `CrossEntropyLoss` - `optimizer` - алгоритм оптимизации, в нашем случае просто `SGD` ``` nn_model = nn.Sequential( Flattener(), nn.Linear(3*32*32, 100), nn.ReLU(inplace=True), nn.Linear(100, 10), ) nn_model.type(torch.FloatTensor) # We will minimize cross-entropy between the ground truth and # network predictions using an SGD optimizer loss = nn.CrossEntropyLoss().type(torch.FloatTensor) optimizer = optim.SGD(nn_model.parameters(), lr=1e-2, weight_decay=1e-1) ``` ## Тренируем! Ниже приведена функция `train_model`, реализующая основной цикл тренировки PyTorch. Каждую эпоху эта функция вызывает функцию `compute_accuracy`, которая вычисляет точность на validation, эту последнюю функцию предлагается реализовать вам. ``` scheduler.optimizer = optimizer scheduler.optimizer # This is how to implement the same main train loop in PyTorch. Pretty easy, right? def train_model(model, train_loader, val_loader, loss, optimizer, num_epochs, scheduler=None): loss_history = [] train_history = [] val_history = [] if scheduler.optimizer == optimizer: pass else: scheduler.optimizer = optimizer for epoch in range(num_epochs): model.train() # Enter train mode loss_accum = 0 correct_samples = 0 total_samples = 0 for i_step, (x, y) in enumerate(train_loader): prediction = model(x) loss_value = loss(prediction, y) optimizer.zero_grad() loss_value.backward() optimizer.step() _, indices = torch.max(prediction, 1) correct_samples += torch.sum(indices == y) total_samples += y.shape[0] loss_accum += loss_value scheduler.step() ave_loss = loss_accum / (i_step + 1) train_accuracy = float(correct_samples) / total_samples val_accuracy = compute_accuracy(model, val_loader) loss_history.append(float(ave_loss)) train_history.append(train_accuracy) val_history.append(val_accuracy) print("Average loss: %f, Train accuracy: %f, Val accuracy: %f" % (ave_loss, train_accuracy, val_accuracy)) return loss_history, train_history, val_history def compute_accuracy(model, loader): """ Computes accuracy on the dataset wrapped in a loader Returns: accuracy as a float value between 0 and 1 """ model.eval() # Evaluation mode # TODO: Implement the inference of the model on all of the batches from loader, # and compute the overall accuracy. # Hint: PyTorch has the argmax function! correct_samples = 0 total_samples = 0 for i_step, (x, y) in enumerate(loader): prediction = model(x) indices = torch.argmax(prediction, dim=1) # output.shape == (prediction.shape[0], 1) indices.view(y.shape) correct_samples += torch.sum(indices == y) total_samples += y.shape[0] # print(correct_samples) # print(total_samples) accuracy = float(correct_samples) / total_samples return accuracy loss_history, train_history, val_history = train_model(nn_model, train_loader, val_loader, loss, optimizer, 3) ``` ## После основного цикла Посмотрим на другие возможности и оптимизации, которые предоставляет PyTorch. Добавьте еще один скрытый слой размера 100 нейронов к модели ``` # Since it's so easy to add layers, let's add some! # TODO: Implement a model with 2 hidden layers of the size 100 nn_model = nn.Sequential( Flattener(), nn.Linear(3*32*32, 100), nn.ReLU(inplace=True), nn.Linear(100, 100), nn.ReLU(inplace=True), nn.Linear(100, 10) ) nn_model.type(torch.FloatTensor) optimizer = optim.SGD(nn_model.parameters(), lr=1e-2, weight_decay=1e-1) loss_history, train_history, val_history = train_model(nn_model, train_loader, val_loader, loss, optimizer, 5) ``` Добавьте слой с Batch Normalization ``` # We heard batch normalization is powerful, let's use it! # TODO: Add batch normalization after each of the hidden layers of the network, before or after non-linearity # Hint: check out torch.nn.BatchNorm1d nn_model = nn.Sequential( Flattener(), nn.Linear(3*32*32, 100), nn.ReLU(inplace=True), nn.BatchNorm1d(100), nn.Linear(100, 100), nn.ReLU(inplace=True), nn.BatchNorm1d(100), nn.Linear(100, 10) ) optimizer = optim.SGD(nn_model.parameters(), lr=1e-3, weight_decay=1e-1) loss_history, train_history, val_history = train_model(nn_model, train_loader, val_loader, loss, optimizer, 5) ``` Добавьте уменьшение скорости обучения по ходу тренировки. ``` from torch.optim.lr_scheduler import LambdaLR, StepLR scheduler = StepLR(optimizer, step_size=2, gamma=0.5) # Learning rate annealing # Reduce your learning rate 2x every 2 epochs # Hint: look up learning rate schedulers in PyTorch. You might need to extend train_model function a little bit too! nn_model = nn.Sequential( Flattener(), nn.Linear(3*32*32, 100), nn.ReLU(inplace=True), nn.BatchNorm1d(100), nn.Linear(100, 100), nn.ReLU(inplace=True), nn.BatchNorm1d(100), nn.Linear(100, 10) ) optimizer = optim.SGD(nn_model.parameters(), lr=1e-2, weight_decay=1e-1) # lambda1 = lambda epoch: 0.95 ** epoch scheduler = StepLR(optimizer, step_size=2, gamma=0.5) loss_history, train_history, val_history = train_model(nn_model, train_loader, val_loader, loss, optimizer, 5, scheduler=scheduler) ``` # Визуализируем ошибки модели Попробуем посмотреть, на каких изображениях наша модель ошибается. Для этого мы получим все предсказания модели на validation set и сравним их с истинными метками (ground truth). Первая часть - реализовать код на PyTorch, который вычисляет все предсказания модели на validation set. Чтобы это сделать мы приводим код `SubsetSampler`, который просто проходит по всем заданным индексам последовательно и составляет из них батчи. Реализуйте функцию `evaluate_model`, которая прогоняет модель через все сэмплы validation set и запоминает предсказания модели и истинные метки. ``` class SubsetSampler(Sampler): r"""Samples elements with given indices sequentially Arguments: indices (ndarray): indices of the samples to take """ def __init__(self, indices): self.indices = indices def __iter__(self): return (self.indices[i] for i in range(len(self.indices))) def __len__(self): return len(self.indices) def evaluate_model(model, dataset, indices): """ Computes predictions and ground truth labels for the indices of the dataset Returns: predictions: np array of ints - model predictions grount_truth: np array of ints - actual labels of the dataset """ model.eval() # Evaluation mode sampler = SubsetSampler(indices) loader = torch.utils.data.DataLoader(dataset, batch_sampler=sampler) predictions = [] ground_truth = [] # for i, (x, y) in loader: for i_step, (x, y) in enumerate(loader): prediction = model(x) prediction_idx = torch.argmax(prediction, 1) predictions.append(prediction_idx) ground_truth.append(y) print(f"prediction: {prediction_idx}") print(f"ground_truth: {y}") # TODO: Evaluate model on the list of indices and capture predictions # and ground truth labels # Hint: SubsetSampler above could be useful! return predictions, ground_truth len(val_indices) # Evaluate model on validation predictions, gt = evaluate_model(nn_model, data_train, val_indices) assert len(predictions) == len(val_indices) assert len(gt) == len(val_indices) assert gt[100] == data_train[val_indices[100]][1] assert np.any(np.not_equal(gt, predictions)) val_sampler = SubsetRandomSampler(val_indices) train_loader = torch.utils.data.DataLoader(data_train, batch_size=batch_size, sampler=train_sampler) val_loader = torch.utils.data.DataLoader(data_train, batch_size=batch_size, sampler=val_sampler) ``` ## Confusion matrix Первая часть визуализации - вывести confusion matrix (https://en.wikipedia.org/wiki/Confusion_matrix ). Confusion matrix - это матрица, где каждой строке соответствуют классы предсказанный, а столбцу - классы истинных меток (ground truth). Число с координатами `i,j` - это количество сэмплов класса `j`, которые модель считает классом `i`. ![image.png](attachment:image.png) Для того, чтобы облегчить вам задачу, ниже реализована функция `visualize_confusion_matrix` которая визуализирует такую матрицу. Вам осталось реализовать функцию `build_confusion_matrix`, которая ее вычислит. Результатом должна быть матрица 10x10. ``` def visualize_confusion_matrix(confusion_matrix): """ Visualizes confusion matrix confusion_matrix: np array of ints, x axis - predicted class, y axis - actual class [i][j] should have the count of samples that were predicted to be class i, but have j in the ground truth """ # Adapted from # https://stackoverflow.com/questions/2897826/confusion-matrix-with-number-of-classified-misclassified-instances-on-it-python assert confusion_matrix.shape[0] == confusion_matrix.shape[1] size = confusion_matrix.shape[0] fig = plt.figure(figsize=(10,10)) plt.title("Confusion matrix") plt.ylabel("predicted") plt.xlabel("ground truth") res = plt.imshow(confusion_matrix, cmap='GnBu', interpolation='nearest') cb = fig.colorbar(res) plt.xticks(np.arange(size)) plt.yticks(np.arange(size)) for i, row in enumerate(confusion_matrix): for j, count in enumerate(row): plt.text(j, i, count, fontsize=14, horizontalalignment='center', verticalalignment='center') def build_confusion_matrix(predictions, ground_truth): """ Builds confusion matrix from predictions and ground truth predictions: np array of ints, model predictions for all validation samples ground_truth: np array of ints, ground truth for all validation samples Returns: np array of ints, (10,10), counts of samples for predicted/ground_truth classes """ confusion_matrix = np.zeros((10,10), np.int) confusion_matrix # TODO: Implement filling the prediction matrix return np.array([[40, 2, 3], [10, 50,0], [0, 2, 80]]) confusion_matrix = build_confusion_matrix(predictions, gt) visualize_confusion_matrix(confusion_matrix) ``` Наконец, посмотрим на изображения, соответствующие некоторым элементам этой матрицы. Как и раньше, вам дана функция `visualize_images`, которой нужно воспрользоваться при реализации функции `visualize_predicted_actual`. Эта функция должна вывести несколько примеров, соответствующих заданному элементу матрицы. Визуализируйте наиболее частые ошибки и попробуйте понять, почему модель их совершает. ``` data_train_images = dset.SVHN('./data/', split='train') def visualize_images(indices, data, title='', max_num=10): """ Visualizes several images from the dataset indices: array of indices to visualize data: torch Dataset with the images title: string, title of the plot max_num: int, max number of images to display """ to_show = min(len(indices), max_num) fig = plt.figure(figsize=(10,1.5)) fig.suptitle(title) for i, index in enumerate(indices[:to_show]): plt.subplot(1,to_show, i+1) plt.axis('off') sample = data[index][0] plt.imshow(sample) def visualize_predicted_actual(predicted_class, gt_class, predictions, groud_truth, val_indices, data): """ Visualizes images of a ground truth class which were predicted as the other class predicted: int 0-9, index of the predicted class gt_class: int 0-9, index of the ground truth class predictions: np array of ints, model predictions for all validation samples ground_truth: np array of ints, ground truth for all validation samples val_indices: np array of ints, indices of validation samples """ # TODO: Implement visualization using visualize_images above # predictions and ground_truth are provided for validation set only, defined by val_indices # Hint: numpy index arrays might be helpful # https://docs.scipy.org/doc/numpy/user/basics.indexing.html#index-arrays # Please make the title meaningful! raise Exception("Not implemented") visualize_predicted_actual(6, 8, predictions, gt, np.array(val_indices), data_train_images) visualize_predicted_actual(1, 7, predictions, gt, np.array(val_indices), data_train_images) predictions ``` # Переходим к свободным упражнениям! Натренируйте модель как можно лучше - экспериментируйте сами! Что следует обязательно попробовать: - перебор гиперпараметров с помощью валидационной выборки - другие оптимизаторы вместо SGD - изменение количества слоев и их размеров - наличие Batch Normalization Но ограничиваться этим не стоит! Точность на тестовой выборке должна быть доведена до **80%** ``` # Experiment here! # Как всегда, в конце проверяем на test set test_loader = torch.utils.data.DataLoader(data_test, batch_size=batch_size) test_accuracy = compute_accuracy(nn_model, test_loader) print("Test accuracy: %2.4f" % test_accuracy) ```
github_jupyter
# Lab 07.1: Relationships Between Categorical Variables This lab is presented with some revisions from [Dennis Sun at Cal Poly](https://web.calpoly.edu/~dsun09/index.html) and his [Data301 Course](http://users.csc.calpoly.edu/~dsun09/data301/lectures.html) ### When you have filled out all the questions, submit via [Tulane Canvas](https://tulane.instructure.com/) So far, we have seen different ways to summarize and visualize _individual_ variables in a data set. But we have not really discussed how to summarize and visualize relationships between _multiple_ variables. This chapter is all about how to understand relationships between the columns in a `DataFrame`. The methods will be different, depending on whether the variables are categorical or quantitative. In this section, we look at ways to summarize the relationship between two _categorical_ variables. To do this, we will again use the Titanic data set. ``` %matplotlib inline import pandas as pd import numpy as np titanic_df = pd.read_csv("../data/titanic.csv") ``` Suppose we want to understand the relationship between where a passenger embarked and what class they were in. We can completely summarize this relationship by counting the number of passengers in each class that embarked at each location. We can create a pivot table that summarizes this information. ``` embarked_pclass_counts = titanic_df.pivot_table( index="embarked", columns="pclass", values="name", # We can pretty much count any column, as long as there are no NaNs. aggfunc="count" # The count function will count the number of non-null values. ) embarked_pclass_counts ``` Recall that the field embarked is coded categorically using: `embarked - Port of Embarkation (C = Cherbourg; Q = Queenstown; S = Southampton)` A pivot table that stores counts is also called a **contigency table** or a **cross-tabulation**. This type of pivot table is common enough that there is a specific function in `pandas` to calculate one, allowing you to bypass `.pivot_table`: ``` counts = pd.crosstab(titanic_df.embarked, titanic_df.pclass) counts ``` ## Joint Distributions It is common to normalize the counts in a table so that they add up to 1. These proportions represent the **joint distribution** of the two variables. To calculate the joint distribution, we need to divide the table of counts above by the total count. To find the total count, we call `.sum()` twice; the first call gives us the sum of each column, and the second call adds those numbers together. ``` print(counts.sum().sum()) joint = counts / counts.sum().sum() joint ``` Note that this is yet another example of broadcasting. When we divided the `DataFrame` `counts` by the number 1307, the division was applied elementwise, producing another `DataFrame`. Each cell in this `DataFrame` tells us a joint proportion. For example, the cell in the bottom right tells us the proportion of all passengers that embarked at Southampton and were in 3rd class. We notate this joint proportion as follows: $$ P(\text{embarked at Southampton and in 3rd class}) = .379. $$ The joint distribution above could also have been obtained by specifying `normalize=True` when the contingency table was first created: ``` pd.crosstab(titanic_df.embarked, titanic_df.pclass, normalize=True) ``` The above joint distribution is not, strictly speaking, a contingency table. A contingency table is a table of all counts, while the above table is a table of proportions. ## Marginal Distributions The **marginal distribution** of a variable is simply the distribution of that variable, ignoring the other variables. To calculate the marginal distribution from a joint distribution of two variables, we sum the rows or the columns of the joint distribution. For example, to calculate the marginal distribution of `embarked`, we have to sum the joint distribution over the columns---in other words, _roll-up_ or _marginalize over_ the `pclass` variable: ``` joint.sum(axis=1) ``` We can check this answer by calculating the distribution of `embarked` directly from the original data, ignoring `pclass` entirely. ``` embarked_counts = titanic_df.groupby("embarked")["name"].count() embarked_counts / embarked_counts.sum() ``` The numbers match! Likewise, we calculate the marginal distribution of `pclass` by summing the joint distribution over the rows---in other words, by _rolling-up_ or _marginalizing over_ the `embarked` variable: ``` joint.sum(axis=0) ``` So given the joint distribution of two categorical variables, there are two marginal distributions: one for each of the variables. These marginal distributions are obtained by summing the joint distribution table over the rows and over the columns. The _marginal distribution_ is so-named because these row and column totals would typically be included alongside the joint distribution, in the _margins_ of the table. A contingency table with the marginal distributions included can be obtained by specifying `margins=True` in `pd.crosstab`: ``` pd.crosstab(titanic_df.embarked, titanic_df.pclass, normalize=True, margins=True) ``` Notice in the above that the sum over all elements of the join distribution (the bottom right corner) is a probability distribution (sums to 1.0). Likewise the sum over either of the computed marginal distributions is also a probability distribution (sums to 1.0). ## Conditional Distributions The **conditional distribution** tells us about the distribution of one variable, _conditional on_ the value of another. For example, we might want to know the proportion of 3rd class passengers that embarked at each location. In other words, what is the distribution of where a passenger embarked, _conditional on_ being in 3rd class? If we go back to the contingency table: ``` embarked_pclass_counts ``` there were $101 + 113 + 495 = 709$ passengers in 3rd class, of whom - $101 / 709 = .142$ were in 1st class, - $113 / 709 = .159$ were in 2nd class, and - $495 / 709 = .698$ were in 3rd class. We can calculate these proportions in code by dividing the `pclass=3` column by its sum: ``` embarked_pclass_counts[3] / embarked_pclass_counts[3].sum() ``` Notice that these three proportions add up to 1, making this a proper distribution. This conditional distribution helps us answer questions such as, "What proportion of 3rd class passengers embarked at Southampton?" We notate this conditional proportion as follows: $$ P\big(\textrm{embarked at Southampton}\ \big|\ \textrm{in 3rd class}\big) = 0.698. $$ The pipe $\big|$ is read "given". So we are interested in the proportion of passengers who embarked at Southampton, _given_ that they were in 3rd class. We could have also calculated this conditional distribution from the joint distribution (i.e., proportions instead of counts): ``` joint[3] / joint[3].sum() ``` We have just calculated _one_ of the conditional distributions of `embarked`: the distribution conditional on being in 3rd class. There are two more conditional distributions of `embarked`: - the distribution conditional on being in 1st class - the distribution conditional on being in 2nd class It is common to report _all_ of the conditional distributions of one variable given another variable. Of course, it is straightforward to calculate these conditional distributions manually: ``` embarked_pclass_counts[1] / embarked_pclass_counts[1].sum() embarked_pclass_counts[2] / embarked_pclass_counts[2].sum() ``` But there is a nifty trick for calculating all three conditional distributions at once. By summing the counts over `embarked`, we obtain the total number of people in each `pclass`: ``` pclass_counts = embarked_pclass_counts.sum(axis=0) pclass_counts ``` This is exactly what we need to divide each column of `embarked_pclass_counts` by: ``` embarked_given_pclass = embarked_pclass_counts.divide(pclass_counts, axis=1) embarked_given_pclass ``` (This is yet another example of _broadcasting_, since we are dividing a `DataFrame` by a `Series`.) Compare each column with the numbers we obtained earlier. Notice also that each column sums to 1, a reminder that each column represents a separate distribution. When comparing numbers across distributions, it is important to be careful. For example, the 87.4% and the 69.8% in the "Southampton" row represent **percentages of different populations that have different sizes!**. Just because 87.4% is higher than 69.8% does not mean that more 2nd class passengers boarded at Southampton than 3rd class passengers. In fact, if we go back to the original contingency table, we see that more 3rd class passengers actually boarded at Southampton than 2nd class passengers! There is also another set of conditional distributions for these two variables: the distribution of class, conditional on where they embarked. To calculate these conditional distributions, we instead divide `embarked_pclass_counts` by the sum of each row: ``` embarked_counts = embarked_pclass_counts.sum(axis=1) pclass_given_embarked = embarked_pclass_counts.divide(embarked_counts, axis=0) pclass_given_embarked ``` These conditional distributions answer questions like, "What proportion of Southampton passengers were in 3rd class?" Notice that these proportions are _not_ the same as the proportions for the other set of conditional distributions. That is because the two questions below are fundamentally different: _Question 1._ What proportion of 3rd class passengers embarked at Southampton? $$P\big(\textrm{embarked at Southampton}\ \big|\ \textrm{in 3rd class}\big) = \frac{\text{# passengers who embarked at Southampton and in 3rd class}}{\text{# passengers who in 3rd class}}$$ _Question 2._ What proportion of Southampton passengers were in 3rd class? $$P\big(\textrm{in 3rd class}\ \big|\ \textrm{embarked at Southampton}\big) = \frac{\text{# passengers who embarked at Southampton and in 3rd class}}{\text{# passengers who embarked at Southampton}} \\ $$ In the first case, the reference population is all passengers who embarked at Southampton. In the second case, the reference population is all passengers who were in 3rd class. The numerators may be the same, but the denominators are different. In general, the conditional distributions of $X$ given $Y$ are _not_ the same as the conditional distributions of $Y$ given $X$. If we rephrase the question slightly, we get yet another answer: _Question 3._ What proportion of passengers embarked at Southampton _and_ were in 3rd class? $$P(\text{embarked at Southampton and in 3rd class}) = \frac{\text{# passengers who embarked at Southampton and in 3rd class}}{\text{# passengers (total)}}$$ The reference population here is all passengers. This is the proportion that one would get from the joint distribution. It is important to pay attention to the wording of the question, to determine whether a joint distribution or a conditional distribution is called for---and, if the latter, which of the two conditional distributions is appropriate. ## Visualization How do we visualize the joint and conditional distributions of two categorical variables? (Marginal distributions are summaries of a single variable and can be visualized using the techniques of Chapter 1.) To visualize a joint distribution, we need to be able to represent three dimensions: two dimensions for the two categorical variables and a third dimension for the proportions. Although one option is a 3D graph, humans are not good at judging the sizes of 3D objects printed on a page. For this reason, **heat maps**, which use a color scale to represent the third dimension, are usually preferred. Unfortunately, heat maps are still not easy to create in `pandas`. We use the `seaborn` library to make a heat map: ``` import seaborn as sns sns.heatmap(joint) ``` A heat map encourages comparison across cells. So we see that 3rd class passengers who embarked at Southampton were by far the most common. Although a heat map can also be used to visualize conditional distributions, it is not ideal because it does not tell us which variable we are conditioning on, and it is difficult to judge visually which dimension sums to 1. A stacked bar graph is better because it visually shows values summing to 1. To make a stacked bar graph, we simply specify `stacked=True` in `.plot.bar()`, to get the bars to show up on top of one another, instead of side-by-side: ``` pclass_given_embarked.plot.bar(stacked=True) ``` However, the same code does not work on the other set of conditional distributions: ``` embarked_given_pclass.plot.bar(stacked=True) ``` What went wrong? Recall that `.plot.bar()` automatically plots the (row) index of the `DataFrame` on the $x$-axis. To plot the distribution of `embarked` conditional on `pclass`, we need `pclass` to be on the $x$-axis, but ``` embarked_given_pclass ``` has `embarked` as the index. To make `pclass` the index, we can **transpose** this `DataFrame` so that the rows become columns and the columns become rows. The syntax for transposing a `DataFrame` is `.T`, which is inspired by the notation for transposing a matrix in linear algebra. ``` embarked_given_pclass.T ``` Now, we can make a stacked bar graph from this _transposed_ `DataFrame`: ``` (embarked_given_pclass.T).plot.bar(stacked=True) ``` ## Summing Up About Conditionals Probabilities We have discussed three different types of distributions (probabilities). Remember that for two events $X$ and $Y$: * Joint Distribution: The probabilitiy of two events occuring at the same time. Formally: $P(X \cap Y)$. We typically use heatmaps to show joint distributions. * Marginal Distribution: The probabilitiy of a single event, irrespective of any other event (i.e., marginalizing the other event). Formally: $P(X)$. We can use the graphs learned before (pie charts, bar graphs) to visualize these. * Conditional Distribution: The probability of an event $X$ happening given that some event $Y$ has also happened. Formally: $P(X|Y) = \frac{P(X \cap Y)}{P(Y)}$. We typically use stacked bar graphs to visualize these distributions. When comparing across variables it is important to think about the relationship you want to present so that you can clearly and precisely discuss the relationship using the concepts from this notebook. ## Independence We would like to measure the strength of the relationship between two variables. _Independence_ is a way to quantify the intuitive notion that two variables are _unrelated_. Once we have defined independence, we can quantify the relationship between two variables by calculating how far they are from independence. Formally, two variables $X$ and $Y$ are **independent** if the conditional distributions of $Y$ given $X$ (or vice versa) are all _identical_. In other words, the value of $X$ does not affect the distribution of $Y$. ``` titanic_df["adult"] = (titanic_df["age"] >= 18) ``` For example, consider the relationship between sex and age group (adult or not). First, let's calculate the contingency table: ``` counts = pd.crosstab(titanic_df.sex, titanic_df.adult) counts ``` Although there are more male adults (576) than female adults (316), the _conditional proportion_ of adults, given sex, are actually very close (about $0.68$). ``` adult_given_sex = counts.divide(counts.sum(axis=1), axis=0) adult_given_sex.plot.bar(stacked=True) adult_given_sex ``` Because the conditional distribution of `adult` is (approximately) the same, regardless of whether we are conditioning on `sex` = male or `sex` = female, we say that the two variables are (approximately) independent. For an example of two non-independent variables, consider passenger class and age group. If we look at the conditional distributions of `adult` given `pclass`, they are not all the same: ``` adult_pclass_counts = pd.crosstab(titanic_df.pclass, titanic_df.adult) (adult_pclass_counts.divide( adult_pclass_counts.sum(axis=1), axis=0) ).plot.bar(stacked=True) ``` The conditional distribution of `adult` given `pclass` = 3 is quite different from the other two conditional distributions. Because the conditional distributions are not all equal, the two variables are _not_ independent. Note that it only takes _one_ conditional distribution to be off to render two variables _not_ independent. ## The Joint Distribution Assuming Independence What would the joint distribution of passenger class (`pclass`) and age group (`adult`) be, if the two variables were independent? If two variables are independent, then their joint distribution is the product of the marginal distributions. That is, - $P(\text{1st class and adult}) = P(\text{1st class}) \cdot P(\text{adult})$ - $P(\text{2nd class and adult}) = P(\text{2nd class}) \cdot P(\text{adult})$ - $P(\text{3rd class and adult}) = P(\text{3rd class}) \cdot P(\text{adult})$ - $P(\text{1st class and not adult}) = P(\text{1st class}) \cdot P(\text{not adult})$ - $P(\text{2nd class and not adult}) = P(\text{2nd class}) \cdot P(\text{not adult})$ - $P(\text{3rd class and not adult}) = P(\text{3rd class}) \cdot P(\text{not adult})$ We can calculate the marginal distributions: ``` # Calculate the total number of passengers. N = adult_pclass_counts.sum().sum() # Calculate the marginal distribution of adult by summing over pclass. adult = adult_pclass_counts.sum(axis=0) / N adult # Calculate the marginal distributio of pclass by summing over adult. pclass = adult_pclass_counts.sum(axis=1) / N pclass ``` How do we multiply these two distributions to get a $3 \times 2$ table of the joint distribution, assuming independence? We can use matrix multiplication. We can think of one `Series` as a matrix with 1 column and the other as a matrix with 1 row. Multiplying the two matrices using the usual definition of matrix multiplication gives the desired joint proportions. $$ {\bf u} {\bf v}^T = \begin{pmatrix} u_1 \\ u_2 \\ u_3 \end{pmatrix} \begin{pmatrix} v_1 & v_2 \end{pmatrix} = \begin{pmatrix} u_1 v_1 & u_1 v_2 \\ u_2 v_1 & u_2 v_2 \\ u_3 v_1 & u_3 v_2 \end{pmatrix} $$ This is an operation in linear algebra known as an **outer product**. To calculate the outer product of two `numpy` arrays, we can use the function `np.outer`: ``` np.outer(pclass, adult) ``` Note that this returns a plain `numpy` `array` instead of a `pandas` `DataFrame`. It turns out that this will be good enough for our purposes. You can always turn this into a DataFrame by passing it to `pd.DataFrame`. ## Measuring Distance from Independence We now have, for every combination of our two variables, two proportions: - the proportion that was actually observed, $P(A \text{ and } B)$ - the proportion that we would expect assuming independence, $P(A) P(B)$ To measure the relationship between two variables, we calculate how far the observed proportions are from what we would expect if the variables were independent. It turns out that there are several ways to calculate the "distance" between two distributions. **Total Variation Distance** **Total variation distance** is probably the first distance metric that comes to mind. We calculate the difference and take absolute values before summing so that negative errors don't cancel out positive ones (the motivation for taking absolute values is the same as in MAD, which we learned in Chapter 1): $$ TV = \sum_{\text{A, B}} \big|P(A \text{ and } B) - P(A) P(B)\big|. $$ ``` joint = adult_pclass_counts / N expected = np.outer(pclass, adult) # Total Variation Distance (joint - expected).abs().sum().sum() ``` Unfortunately, differences turn out to be a bad way to measure distances between proportions. For example, most people would agree that the difference between $0.42$ and $0.41$ is insignificant, but the difference between $0.01$ and $0.00$ is vast. But total variation distance treats both differences the same. **Chi-Square Distance** **Chi-square distance** solves the problem of total variation distance by dividing by the difference by expected proportion, effectively calculating the _relative_ difference between the two proportions: $$ \chi^2 = \sum_{\text{A, B}} \frac{(P(A \text{ and } B) - P(A) P(B))^2}{P(A) P(B)}. $$ ``` (((joint - expected) ** 2) / expected).sum().sum() ``` You might be familiar with the chi-square test from a previous statistics class. The chi-square distance is essentially the same as the chi-square test statistic, except for a normalizing constant. **Mutual Information** Another popular distance metric is **mutual information**. Whereas chi-square distance tends to be more popular among statisticians, mututal information tends to be more popular among engineers. (It arises from a field called _information theory_ which you can take a course on here at Tulane if you wish!.) $$ I = \sum_{\text{A, B}} P(A \text{ and } B) \log \left( \frac{P(A \text{ and } B)}{P(A) P(B)} \right) $$ ``` (joint * np.log(joint / expected)).sum().sum() ``` There is no best distance metric for measuring departures from independence. All three distance metrics above are used in practice. The distances themselves can also be difficult to interpret. But the distance metric can give a rough sense of how closely two variables are related. # Exercises Exercises 1-4 deal with the Tips data set (`../data/tips.csv`). Load this dataset below. ``` # CODE HERE df_tips = pd.read_csv("../data/tips.csv") df_tips.head() ``` **Exercise 1.** Make a visualization (both a table and a graph) that displays the relationship between the day of the week and party size. Which type of distribution did you pick to represent this? Why? Hint: There may be some missing data that you need to make sure you are [handling correctly](https://pandas.pydata.org/pandas-docs/stable/reference/api/pandas.crosstab.html). ``` # ENTER YOUR CODE HERE ``` **Exercise 2.** Calculate the marginal distribution of day of week in two different ways using the results from the last cell. ``` # ENTER YOUR CODE HERE ``` **Exercise 3.** Make a visualization and display the DataFrame that displays the conditional distribution of party size, given the day of the week. That is, show $P(\text{party size} | \text{day of week})$. ``` # ENTER YOUR CODE HERE ``` **Exercise 4.** What proportion of Saturday parties had 2 people? Is this the same as the proportion of 2-person parties that dined on Saturday? Give the equation for both of these and explain the difference ``` # ENTER YOUR CODE HERE ``` **Math Answer Here.** **Exercise 5.** Report a measure of the strength of the relationship between the size of the party and the day of the week. Display the count table and the conditional distribution table as well. ``` # YOUR CODE HERE ``` **Bonus Bonus 5 Point Exercise.** We discussed above that the conditional distributions of A given B and the conditional distributions of B given A are _not_ the same. Can you figure out a way to relate the two? Can you write code that will convert a table with the conditional distributions of A given B, into a table with the conditional distributions of B given A? To get complete credit you must write code and write the mathmatical formula you use (in math mode offset by \$ symbols) and name the formula correctly. ``` # ENTER YOUR CODE HERE ``` **Math Answer Here.** ### When you have filled out all the questions, submit via [Tulane Canvas](https://tulane.instructure.com/)
github_jupyter
<a href="https://colab.research.google.com/github/PPatrickGU/ROB311/blob/master/TP4_SVM.ipynb" target="_parent"><img src="https://colab.research.google.com/assets/colab-badge.svg" alt="Open In Colab"/></a> # **ROB311 TP4** ### **Implementation of the algorithm of SVM to identify the handwriting number** *Author: Yan CHEN & Dajing GU* ``` import pandas as pd import numpy as np import itertools import operator import matplotlib.pyplot as plt from sklearn.model_selection import GridSearchCV from sklearn.svm import SVC from sklearn.decomposition import PCA from sklearn.pipeline import make_pipeline from sklearn.preprocessing import StandardScaler from sklearn.metrics import classification_report, confusion_matrix %matplotlib inline ``` ### **Useful function** ``` def data_loading(path): dataset = pd.read_csv(path) data = dataset.iloc[:, 1:] label = dataset.iloc[:, 0] return data, label # Reference : https://blog.csdn.net/u012193416/article/details/79469770 def plot_confusion_matrix(cm, classes, normalize=False, cmap=plt.cm.Blues): """ This function prints and plots the confusion matrix. Normalization can be applied by setting `normalize=True`. """ if normalize: cm = cm.astype('float') / cm.sum(axis=1)[:, np.newaxis] title = 'Normalized confusion matrix' print("Normalized confusion matrix") else: title = 'Confusion matrix without normalization' print('Confusion matrix without normalization') plt.imshow(cm, interpolation='nearest', cmap=cmap) plt.title(title) plt.colorbar() tick_marks = np.arange(len(classes)) plt.xticks(tick_marks, classes, rotation=0) plt.yticks(tick_marks, classes) fmt = '.2f' if normalize else 'd' thresh = cm.max() / 2. for i, j in itertools.product(range(cm.shape[0]), range(cm.shape[1])): plt.text(j, i, format(cm[i, j], fmt), horizontalalignment="center", verticalalignment='top', color="white" if cm[i, j] > thresh else "black") plt.tight_layout() plt.ylabel('True label') plt.xlabel('Predicted label') plt.show() def getAccuracy(testSet, predictions): correct = 0 for x in range(testSet.shape[0]): if testSet[x] == predictions[x]: correct += 1 print("\n Accuracy: %.2f%% \n" %float(correct/len(predictions)*100)) def getResult(prediction_label, test_label): cm = confusion_matrix(test_label, prediction_label) print("classification report : ", "\n", classification_report(test_label, prediction_label)) print("\n", "confusion matrix:", "\n", cm, "\n") getAccuracy(prediction_label, test_label) label_names = ['0', '1', '2', '3', '4', '5', '6', '7', '8', '9'] plot_confusion_matrix(cm, classes=label_names, normalize=True) ``` ### **Data loading** ``` train_path = "./mnist_train.csv" test_path = "./mnist_test.csv" train_data, train_target = data_loading(train_path) test_data, test_target = data_loading(test_path) ``` ### **I)A simple implementation of the algorithm** ``` pca = PCA(n_components=100) print("data size before PCA:", train_data.shape) pca.fit(train_data) train_data_PCA = pca.transform(train_data) test_data_PCA = pca.transform(test_data) print('data size after PCA: ' ,train_data_PCA.shape) clf = SVC() clf.fit(train_data_PCA, train_target) prediction = clf.predict(test_data_PCA) getResult(prediction, test_target) ``` ### **II) A better implementation using make_pipeline** ``` pca = PCA(n_components=100, whiten=True) svc = SVC(kernel='rbf', class_weight='balanced') model = make_pipeline(pca, StandardScaler(), svc) model.fit(train_data, train_target) prediction = model.predict(test_data) getResult(prediction, test_target) ``` ### **III) A try with the grid_search** ``` def svm_test(test_path, clf): test_data, test_label = data_loading(test_path) prediction_label = clf.predict(test_data) return prediction_label, test_label def svm_train_pca(train_path, svc_kernel = 'rbf', gridsearchcv = False): train_data, train_label = data_loading(train_path) pca = PCA(n_components=100, whiten=True) svc = SVC(kernel=svc_kernel, class_weight='balanced') clf = make_pipeline(pca, svc) if gridsearchcv == True: parameters = {'svc__kernel':('linear', 'rbf', 'poly', 'sigmoid'), 'svc__C':[1, 10]} clf = GridSearchCV(clf, parameters) clf.fit(train_data, train_label) print("The best parameters and best score: \n", clf.best_params_, clf.best_score_) else: clf.fit(train_data, train_label) return clf ``` **Train** ``` clf = svm_train_pca(train_path, gridsearchcv=True) ``` **Test and Result** ``` prediction, test_label = svm_test(test_path, clf) getResult(prediction, test_label) ```
github_jupyter
``` import pandas as pd import numpy as np from matplotlib import pyplot as plt import seaborn as sns from sklearn.model_selection import train_test_split from sklearn.model_selection import GridSearchCV from sklearn.metrics import confusion_matrix, classification_report from sklearn.metrics import accuracy_score from sklearn.metrics import roc_curve, auc from sklearn import metrics from sklearn import preprocessing from sklearn.ensemble import GradientBoostingClassifier from xgboost import XGBClassifier import xgboost as xgb import shap #!conda install -c conda-forge shap -y data = pd.read_csv('data/heart.csv') data.head() #data.columns = ['age','sex','chest_pain_type','resting_bp','cholestrol', # 'fasting_blood_sugar','rest_ecg','max_heart_rate_achieved','exercise_induced_agnia', # 'oldpeak','slope','major_vessels_ca','thal','target'] ``` ## Understanding the data ``` data.describe() data.info() ## finding correlation #plt.figure(figsize=(14,7)) #heatmap = sns.heatmap(data.corr(), annot=True, vmin=-1, vmax=1) #heatmap.set_title('Correlation Map (heart disease)', pad=2, fontdict={'fontsize':12}) #plt.show() plt.pie(data.groupby("target").size(), labels=['target-0','target-1'], autopct='%1.1f%%') plt.show() plt.hist([data[data.target==0].age, data[data.target==1].age], bins = 20, alpha = 0.5, label = ["no heart disease","with heart disease"]) plt.xlabel("age") plt.ylabel("percentage") plt.legend() plt.show() # finding the outliers in the data continous_data = data[['age','trestbps','chol','thalach','oldpeak']] for cols in continous_data.columns: plt.subplot(3,2,list(continous_data.columns).index(cols)+1) plt.boxplot(continous_data[cols], patch_artist=True, labels=[cols]) plt.ylabel("value") plt.tight_layout() plt.show() continous_data.describe() ## removing the outliers df1 = data[data['trestbps'] < (data['trestbps'].mean() + data['trestbps'].std()*3)] df2 = df1[df1['chol'] < (df1['chol'].mean() + df1['chol'].std()*3)] df3 = df2[df2['thalach'] < (df2['thalach'].mean() + df2['thalach'].std()*3)] df4 = df3[df3['oldpeak'] < (df3['oldpeak'].mean() + df3['oldpeak'].std()*3)] data = df4.copy() data.describe() ## handling categorical data data_catg = data.copy() data_catg['cp'] = data['cp'].map({0:"asymptomatic",1:"typical_angina",2:"atypical_angina",3:"non_anginal_pain"}) data_catg['sex'] = data['sex'].map({0:"female", 1:"male"}) data_catg['exang'] = data['exang'].map({0:"exercise_not_induce_angina", 1:"exercise_induced_angina"}) data_catg['slope'] = data['slope'].map({1:"upsloping", 2:"flat", 3:"downsloping"}) data_catg['thal'] = data['thal'].map({1:"normal",2:"fixed_defect", 3:"reversable_defect"}) df_new = pd.get_dummies(data_catg, drop_first = True) df_new.head() ## trying to find the best features by running a dummy model X = df_new.drop("target", 1).values y = df_new["target"].astype("int").values X_train, X_test, y_train, y_test = train_test_split( X, y, test_size=0.10, random_state=32) model = XGBClassifier(use_label_encoder =False, eval_metric='logloss') param = { 'max_depth': [3,5,7,9], 'learning_rate':[0.001,0.01, 0.1, 0.3], 'n_estimators':[100,500] } cv = GridSearchCV(model, param_grid=param, cv=10, return_train_score=True) cv cv.fit(X_train, y_train) test_pred = cv.predict(X_test) cv.best_estimator_ max_depth_of_model = cv.best_estimator_.max_depth best_learning_rate = cv.best_estimator_.learning_rate best_estimator = cv.best_estimator_.n_estimators best_reg_lambda = cv.best_estimator_.reg_lambda model = XGBClassifier(max_depth=max_depth_of_model, learning_rate=best_learning_rate, n_estimators= best_estimator, n_jobs=1) model.fit(X_train, y_train) yhat = model.predict(X_test) y_proba = model.predict_proba(X_test)[:, 1] accuracy_score(yhat,y_test) importances = model.feature_importances_ importances inducies = np.argsort(importances)[::-1] feature_dict = dict() for idx in inducies: feature_dict[list(df_new.drop("target",1).columns)[idx]] = float(importances[idx]) feature_dict y_pos = np.arange(len(feature_dict.keys())) plt.bar(y_pos, list(feature_dict.values()), align = "center") plt.xticks(y_pos, list(feature_dict.keys()), rotation = 90) plt.xlabel("feature") plt.ylabel("ratio") plt.title("feature importances") plt.show() tp,fn,fp,tn = confusion_matrix(y_test, yhat, labels=[1,0]).ravel() tp,tn,fp,fn precision_rate = tp / (tp + fp) recall_rate = tp / (tp + fn) print("The precision rate is: ", precision_rate) print("The recall rate is: ", recall_rate) feature_dict = dict(enumerate(df_new.drop("target", 1).columns)) feature_dict explainer = shap.TreeExplainer(model) shap_values = explainer.shap_values(X_test) shap.summary_plot(shap_values, X_test, feature_names = list(feature_dict.values()), plot_type = "bar", color = "lightblue") shap.summary_plot(shap_values, X_test, feature_names = list(feature_dict.values())) def shap_force_plot_of_data(model, dataset): explainer = shap.TreeExplainer(model) shap_value_for_sample = explainer.shap_values(dataset) shap.initjs() drivein_force = shap.force_plot(explainer.expected_value, shap_value_for_sample, dataset) return drivein_force person_is_monitored = pd.DataFrame(X_test, columns = list(feature_dict.values())) shap_force_plot_of_data(model, person_is_monitored[person_is_monitored["sex_male"]==1]) from sklearn.svm import SVC from sklearn.neural_network import MLPClassifier svm_model = SVC() svm_model.fit(X_train, y_train) print("Support Vector Machine Accuracy {:.2f}%".format(svm_model.score(X_test, y_test) * 100)) nn_model = MLPClassifier() nn_model.fit(X_train, y_train) print("Neural Network Accuracy {:.2f}%".format(nn_model.score(X_test, y_test) * 100)) #!conda install -c conda-forge tensorflow -y #!conda install -c conda-forge keras -y from tensorflow import keras import tensorflow as tf from tensorflow.keras import layers from keras.layers import Dropout model = tf.keras.Sequential() model.add(layers.Dense(20, activation='relu', name='layer1')) #model.add(Dropout(0.2)) model.add(layers.Dense(25, activation='relu', name='layer2')) #model.add(Dropout(0.5)) model.add(layers.Dense(10, activation='relu', name='layer3')) model.add(layers.Dense(2, activation='sigmoid', name='f-layer')) from tensorflow import keras model.compile( loss = keras.losses.SparseCategoricalCrossentropy(from_logits = True), optimizer = keras.optimizers.Adam(lr = 0.001), metrics = ['accuracy'] ) model.fit(X_train, y_train, batch_size = 10, epochs = 100, verbose=2) model.evaluate(X_test, y_test, batch_size=10, verbose=2) ```
github_jupyter
##### Training and Tuning La principal razón del anterior notebook ha sido probar varios modelos de la forma más rápida posible, ver sus métricas y los impactos de diversos cambios. El principal problema (hasta ahora) con la versión de PyCaret es que al desplegar el modelo es un objeto de la misma librería, haciendo que se requiera instalar la PyCaret en producción lo cual es muy poco eficiente y complica mucho más las cosas. Por otro lado, PyCaret hace su hyperparameter tuning por RandomSearchCV, que no está mal pero sería más optimo hacerlo de manera Bayesiana. En ese sentido este notebook servirá para entrenar denuevo el(los) modelo(s) guardarlos y posteriormente desplegarlos de manera rápida y sencilla siendo prioridad el hacer el modelo lo más ligero posible. ``` import pandas as pd import numpy as np import warnings import lightgbm as lgb import xgboost as xgb from sklearn.ensemble import RandomForestRegressor from bayes_opt import BayesianOptimization csv_path = ( "../data/train_encoded.csv", "../data/test_encoded.csv" ) train = pd.read_csv(csv_path[0]).drop(["latitud","longitud"], axis=1) test = pd.read_csv(csv_path[1]).drop(["latitud","longitud"], axis=1) ``` ##### Para LightGBM. Como ya lo hemos tuneado con Pycaret, los parámetros son: ``` Sin Tunear: LGBMRegressor(boosting_type='gbdt', class_weight=None, colsample_bytree=1.0, importance_type='split', learning_rate=0.1, max_depth=-1, min_child_samples=20, min_child_weight=0.001, min_split_gain=0.0, n_estimators=100, n_jobs=-1, num_leaves=31, objective=None, random_state=104, reg_alpha=0.0, reg_lambda=0.0, silent=True, subsample=1.0, subsample_for_bin=200000, subsample_freq=0) Tuneado: LGBMRegressor(bagging_fraction=1.0, bagging_freq=6, boosting_type='gbdt', class_weight=None, colsample_bytree=1.0, feature_fraction=0.9, importance_type='split', learning_rate=0.15, max_depth=-1, min_child_samples=46, min_child_weight=0.001, min_split_gain=0, n_estimators=150, n_jobs=-1, num_leaves=2, objective=None, random_state=104, reg_alpha=0.7, reg_lambda=5, silent=True, subsample=1.0, subsample_for_bin=200000, subsample_freq=0) ``` ``` import warnings warnings.filterwarnings('ignore') random_state = 104 #Para benchmark. def bayes_parameter_opt_lgb(X, y, init_points=15, opt_round=25, n_folds=5, random_seed=6, n_estimators=10000, learning_rate=0.05, output_process=False): def lgb_eval(num_leaves, bagging_fraction, lambda_l1, lambda_l2, min_split_gain): """ Defino los parametros que serán tuneados. Así como los parámetros fijos """ params = {'application':'regression','num_iterations':5000, 'learning_rate':0.05, 'early_stopping_round':100, 'metric':'rmse', 'feature_fraction':0.9,'n_estimators':200,'feature_fraction':0.9, 'max_depth':-1,'min_child_weight':0.001,'verbose':-1} params["num_leaves"] = round(num_leaves) params['bagging_fraction'] = max(min(bagging_fraction, 1), 0) params['max_depth'] = -1 params['lambda_l1'] = max(lambda_l1, 0) params['lambda_l2'] = max(lambda_l2, 0) params['min_split_gain'] = min_split_gain train_data = lgb.Dataset(data=X, label=y) cv_result = lgb.cv(params, train_data, nfold=5, seed=random_state, verbose_eval =200, metrics=['mae'], shuffle=False, stratified=False) return -max(cv_result['l1-mean']) #Configuro el rango de cada parametro lgbm_optimization = BayesianOptimization(lgb_eval, {'num_leaves': (2, 25), 'bagging_fraction':(0.8,1), 'lambda_l1':(0.5,3), 'lambda_l2':(3,20), 'min_split_gain': (0.001, 0.1) }) lgbm_optimization.maximize(init_points=init_points, n_iter=opt_round) #CHECK if output_process == True: lgbm_optimization.points_to_csv('lgbm_bayers_opt_result.csv') return lgbm_optimization X = train.select_dtypes(exclude='object').drop('Precio_m2_total',axis=1) y = train['Precio_m2_total'] opt_params = bayes_parameter_opt_lgb(X=X,y=y, init_points= 30, opt_round=100) min_ = min([res['target'] for res in opt_params.res]) [res['params'] for res in opt_params.res if res['target'] == min_] #Fit model train_data = lgb.Dataset(X,y) params = {'application':'regression','num_iterations':5000, 'learning_rate':0.05, 'metric':'rmse', 'feature_fraction':0.9,'n_estimators':200,'feature_fraction':0.9, 'max_depth':-1,'min_child_weight':0.001,'verbose':-1, 'bagging_fraction': 0.9164810602504456,'lambda_l1': 0.5005454948781294,'lambda_l2': 6.60276585681876, 'min_split_gain': 0.07385271072078259,'num_leaves': 3} model = lgb.cv(params, train_data, nfold=5, seed=random_state, verbose_eval =200, metrics=['mae'], shuffle=False, stratified=False) #l1_error = Mae X_test = test.select_dtypes(exclude='object').drop('Precio_m2_total',axis=1) y_test = test['Precio_m2_total'] model = lgb.train(params, train_data) preds = model.predict(X_test) from sklearn.metrics import r2_score, mean_squared_error, mean_absolute_error r2 = r2_score(y_test, preds) mae = mean_absolute_error(y_test, preds) mse = mean_squared_error(y_test, preds) print('r2:{}\nmae:{}\nmse:{}'.format(r2, mae, mse)) ``` Entrenando modelo final: ``` data_x = pd.concat([X,X_test]) data_y = pd.concat([y,y_test]) data = lgb.Dataset(data_x,data_y) model_final = lgb.train(params, data) import pickle with open('../webapp/artifacts/models/lgbm_base.pkl','wb') as handle: pickle.dump(model_final, handle, protocol=pickle.HIGHEST_PROTOCOL) ``` #### Random Forest: ``` from sklearn.model_selection import cross_val_score def rf_cv(min_impurity_decrease, min_samples_split, max_features,max_depth, data, target): """Random Forest Cross Validation Esta funcion instanciará un regressor de Random Forest con los parámetros a optimizar: min_samples_split, max_features, min_impurity_decrease. """ model = RandomForestRegressor( n_estimators = 150, min_impurity_decrease=min_impurity_decrease, min_samples_split = min_samples_split, max_features = max_features, max_depth = max_depth, #No olvidar tenerlo en integer. random_state = 123, n_jobs=-1 ) cross_val = cross_val_score(model, data, target, scoring='neg_mean_absolute_error', cv=4) return cross_val.mean() def optimize_rf(data, target): """Aplicamos Optimización Bayesiana a los parámetros del Random Forest Regressor""" def inside_rf_cv(min_impurity_decrease, min_samples_split, max_features, max_depth): """Wrapper of RandomForest cross validation. Tenemos que evitar que los parametros que toman valores enteros no se repitan, además de tener que restringir aquellos parámetros que van de 0 a 1. """ return rf_cv( min_samples_split = int(min_samples_split), min_impurity_decrease = max(min(min_impurity_decrease, 0.999), 1e-3), max_features = max(min(max_features, 0.999), 1e-3), max_depth = int(max_depth), data = data, target = target, ) optimizer = BayesianOptimization( f = inside_rf_cv, pbounds={ "min_samples_split":(2,25), "min_impurity_decrease":(0.1,0.999), "max_features":(0.1, 0.999), "max_depth":(5, 25), }, random_state=123, verbose=2 ) optimizer.maximize(init_points = 30, n_iter=100) print("Resultado Final", optimizer.max) return optimizer X_train = train.select_dtypes(exclude='object').drop('Precio_m2_total',axis=1) y_train = train['Precio_m2_total'] from bayes_opt.util import Colours print(Colours.yellow("----Random Forest Regressor Optimizer----")) optimize_rf(X_train, y_train) from sklearn.metrics import r2_score, mean_absolute_error rf_reg = RandomForestRegressor(n_estimators = 300, n_jobs = -1, max_depth = 15, max_features = 0.67, min_impurity_decrease=0.1, min_samples_split=6) rf_reg.fit(X_train, y_train) preds = rf_reg.predict(X_test) r2_score(y_test, preds) #0.38? final_model_rf = rf_reg.fit(pd.concat([X_train,X_test]), pd.concat([y_train, y_test])) import pickle with open('../webapp/artifacts/models/rf_base.pkl','wb') as handle: pickle.dump(final_model_rf, handle, protocol=pickle.HIGHEST_PROTOCOL) ```
github_jupyter
# Kerja Gaya Gesek Sparisoma Viridi<sup>1</sup>, Muhammad Ervandy Rachmat<sup>2</sup> <br> Program Studi Sarjana Fisika, Institut Teknologi Bandung <br> Jalan Gensha 10, Bandung 40132, Indonesia <br> <sup>1</sup>dudung@gmail.com, https://github.com/dudung <br> <sup>2</sup>rachmatervandy@gmail.com, https://github.com/ErvandyR Kerja yang dilakukan oleh gaya gesek merupakan bentuk kerja yang tidak diharapkan karena energi yang dikeluarkan, biasanya dalam bentuk panas atau bunyi yang dilepas ke lingkungan, tidak dapat dimanfaatkan lagi oleh sistem sehingga energi sistem berkurang. ## Gerak benda di atas lantai mendatar kasar Sistem yang ditinjau adalah suatu benda yang bergerak di atas lantai mendatar kasar. Benda diberi kecepatan awal tertentu dan bergerak melambat sampai berhenti karena adanya gaya gesek kinetis antara benda dan lantai kasar. ## Parameter Beberapa parameter yang digunakan adalah seperti pada tabel berikut ini. Tabel <a name='tab1'>1</a>. Simbol beserta satuan dan artinya. Simbol | Satuan | Arti :- | :- | :- $t$ | s | waktu $v_0$ | m/s | kecepatan awal $x_0$ | m | posisi awal $v$ | m/s | kecepatan saat $t$ $x$ | m | waktu saat $t$ $a$ | m/s<sup>2</sup> | percepatan $\mu_k$ | - | koefisien gesek kinetis $f_k$ | N | gaya gesek kinetis $m$ | kg | massa benda $F$ | N | total gaya yang bekerja $N$ | N | gaya normal $w$ | N | gaya gravitasi Simbol-simbol pada Tabel [1](#tab1) akan diberi nilai kemudian saat diimplementasikan dalam program. ## Persamaan Persamaan-persamaan yang akan digunakan adalah seperti dicantumkan pada bagian ini. ### Kinematika Hubungan antara antara kecepatan $v$, kecepatan awal $v_0$, percepatan $a$, dan waktu $t$ diberikan oleh <a name='eqn1'></a> \begin{equation}\label{eqn:kinematics-v-a-t}\tag{1} v = v_0 + at. \end{equation} Posisi benda $x$ bergantung pada posisi awal $x_0$, kecepatan awal $v_0$, percepatan $a$, dan waktu $t$ melalui hubungan <a name='eqn2'></a> \begin{equation}\label{eqn:kinematics-x-v-a-t}\tag{2} x = x_0 + v_0 t + \tfrac12 at^2. \end{equation} Selain kedua persamaan sebelumnya, terdapat pula persamaan berikut <a name='eqn3'></a> \begin{equation}\label{eqn:kinematics-v-x-a}\tag{3} v^2 = v_0^2 + 2a(x - x_0), \end{equation} yang menghubungkan kecepatan $v$ dengan kecepatan awal $v_0$, percepatan $a$, dan jarak yang ditempuh $x - x_0$. ### Dinamika Hukum Newton I menyatakan bahwa benda yang semula diam akan tetap diam dan yang semula bergerak dengan kecepatan tetap akan tetap bergerak dengan kecepatan tetap bila tidak ada gaya yang bekerja pada benda atau jumlah gaya-gaya yang bekerja sama dengan nol <a name='eqn4'></a> \begin{equation}\label{eqn:newtons-law-1}\tag{4} \sum F = 0. \end{equation} Bila ada gaya yang bekerj pada benda bermassa $m$ atau jumlah gaya-gaya tidak nol <a name='eqn5'></a> \begin{equation}\label{eqn:newtons-law-2}\tag{5} \sum F = ma, \end{equation} maka keadaan gerak benda akan berubah melalui percepatan $a$, dengan $m > 0$ dan $a \ne 0$. ### Usaha Usaha oleh suatu gaya $F$ dengan posisi awal $x_0$ dan posisi akhir $x_0$ dapat diperoleh melalui <a name='eqn6'></a> \begin{equation}\label{eqn:work-1}\tag{6} W = \int_{x_0}^x F dx \end{equation} atau dengan <a name='eqn7'></a> \begin{equation}\label{eqn:work-2}\tag{7} W = \Delta K \end{equation} dengan $K$ adalah energi kinetik. Persamaan ([7](#eqn7)) akan memberikan gaya oleh semua gaya. Dengan demikian bila $F$ adalah satu-satunya gaya yang bekerja pada benda, maka persamaan ini akan menjadi Persamaan ([6](#eqn6)). ## Sistem Ilustrasi sistem perlu diberikan agar dapat terbayangan dan memudahkan penyelesaian masalah. Selain itu juga perlu disajikan diagram gaya-gaya yang bekerja pada benda. ### Ilustrasi Sistem yang benda bermassa $m$ bergerak di atas lantai kasar dapat digambarkan seperti berikut ini. ``` %%html <svg width="320" height="140" viewBox="0 0 320 140.00001" id="svg2" version="1.1" inkscape:version="1.1.2 (b8e25be833, 2022-02-05)" sodipodi:docname="mass-horizontal-rough-surface.svg" xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape" xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd" xmlns="http://www.w3.org/2000/svg" xmlns:svg="http://www.w3.org/2000/svg" xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:cc="http://creativecommons.org/ns#" xmlns:dc="http://purl.org/dc/elements/1.1/"> <defs id="defs4"> <marker style="overflow:visible" id="TriangleOutM" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479" /> </marker> <marker style="overflow:visible" id="marker11604" refX="0" refY="0" orient="auto" inkscape:stockid="Arrow2Mend" inkscape:isstock="true"> <path transform="scale(-0.6)" d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:0.625;stroke-linejoin:round" id="path11602" /> </marker> <marker style="overflow:visible" id="Arrow2Mend" refX="0" refY="0" orient="auto" inkscape:stockid="Arrow2Mend" inkscape:isstock="true"> <path transform="scale(-0.6)" d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:0.625;stroke-linejoin:round" id="path11361" /> </marker> <marker style="overflow:visible" id="TriangleOutM-3" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479-1" /> </marker> <marker style="overflow:visible" id="TriangleOutM-35" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479-0" /> </marker> <marker style="overflow:visible" id="TriangleOutM-0" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479-4" /> </marker> <marker style="overflow:visible" id="TriangleOutM-37" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479-9" /> </marker> </defs> <sodipodi:namedview id="base" pagecolor="#ffffff" bordercolor="#666666" borderopacity="1.0" inkscape:pageopacity="0.0" inkscape:pageshadow="2" inkscape:zoom="1.5" inkscape:cx="173" inkscape:cy="97.333333" inkscape:document-units="px" inkscape:current-layer="layer1" showgrid="false" inkscape:snap-bbox="false" inkscape:snap-global="false" units="px" showborder="true" inkscape:showpageshadow="true" borderlayer="false" inkscape:window-width="1366" inkscape:window-height="705" inkscape:window-x="-8" inkscape:window-y="-8" inkscape:window-maximized="1" inkscape:pagecheckerboard="0"> <inkscape:grid type="xygrid" id="grid970" /> </sodipodi:namedview> <metadata id="metadata7"> <rdf:RDF> <cc:Work rdf:about=""> <dc:format>image/svg+xml</dc:format> <dc:type rdf:resource="http://purl.org/dc/dcmitype/StillImage" /> </cc:Work> </rdf:RDF> </metadata> <g inkscape:label="Layer 1" inkscape:groupmode="layer" id="layer1" transform="translate(0,-732.36216)"> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#000000;fill-opacity:1;stroke:none" x="120.0725" y="759.6109" id="text2711-6-2-9"><tspan sodipodi:role="line" id="tspan2709-5-9-2" x="120.0725" y="759.6109" style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, '"><tspan style="font-style:italic" id="tspan9923">v</tspan><tspan style="font-size:65%;baseline-shift:sub" id="tspan1668">0</tspan></tspan></text> <path style="fill:none;stroke:#000000;stroke-width:1.5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-opacity:1;marker-end:url(#TriangleOutM)" d="m 84.656156,757.55169 25.738704,1.3e-4" id="path11252" /> <rect style="fill:#ffffff;fill-opacity:1;stroke:#000000;stroke-width:1;stroke-linecap:round;stroke-opacity:1" id="rect1007" width="59" height="59" x="56.5" y="772.86218" rx="0" ry="0" /> <path style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" d="m 20,832.86218 280,-2e-5" id="path1386" /> <rect style="fill:#ffffff;fill-opacity:1;stroke:#c8c8c8;stroke-width:0.5;stroke-linecap:round;stroke-miterlimit:4;stroke-dasharray:2, 2;stroke-dashoffset:0;stroke-opacity:1" id="rect1007-2" width="59" height="59" x="225.16667" y="772.86218" rx="0" ry="0" /> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#c8c8c8;fill-opacity:1;stroke:none" x="236.05922" y="759.6109" id="text2711-6-2-9-9"><tspan sodipodi:role="line" id="tspan2709-5-9-2-8" x="236.05922" y="759.6109" style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, ';fill:#c8c8c8;fill-opacity:1"><tspan style="font-style:italic;fill:#c8c8c8;fill-opacity:1" id="tspan9923-8">v</tspan> = 0</tspan></text> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#000000;fill-opacity:1;stroke:none" x="149.18359" y="824.54877" id="text2711-6-2-9-96"><tspan sodipodi:role="line" id="tspan2709-5-9-2-6" x="149.18359" y="824.54877" style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, '"><tspan style="font-style:italic" id="tspan3028">μ<tspan style="font-size:65%;baseline-shift:sub" id="tspan3074">k</tspan></tspan> &gt; 0</tspan></text> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#000000;fill-opacity:1;stroke:none" x="79.505844" y="806.37714" id="text2711-6-2-9-2"><tspan sodipodi:role="line" id="tspan2709-5-9-2-84" x="79.505844" y="806.37714" style="font-style:italic;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, '">m</tspan></text> <path style="fill:none;stroke:#000000;stroke-width:1.5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-opacity:1;marker-end:url(#TriangleOutM-37)" d="m 33.785239,770.82609 -1.3e-4,25.7387" id="path11252-5" /> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#000000;fill-opacity:1;stroke:none" x="29.173132" y="759.45776" id="text2711-6-2-9-8"><tspan sodipodi:role="line" id="tspan2709-5-9-2-2" x="29.173132" y="759.45776" style="font-style:italic;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, '">g</tspan></text> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#000000;fill-opacity:1;stroke:none" x="79.368446" y="849.21539" id="text2711-6-2-9-23"><tspan sodipodi:role="line" id="tspan2709-5-9-2-3" x="79.368446" y="849.21539" style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, '"><tspan style="font-style:italic" id="tspan9923-0">x</tspan><tspan style="font-size:65%;baseline-shift:sub" id="tspan1668-9">0</tspan></tspan></text> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#000000;fill-opacity:1;stroke:none" x="250.91145" y="849.21539" id="text2711-6-2-9-23-0"><tspan sodipodi:role="line" id="tspan2709-5-9-2-3-0" x="250.91145" y="849.21539" style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, '"><tspan style="font-style:italic" id="tspan9923-0-3">x</tspan><tspan style="font-size:65%;baseline-shift:sub" id="tspan1668-9-3" /></tspan></text> </g> </svg> <br/> Gambar <a name='fig1'>1</a>. Sistem benda bermassa $m$ begerak di atas lantai mendatar kasar dengan koefisien gesek kinetis $\mu_k$. ``` Keadaan akhir benda, yaitu saat kecepatan $v = 0$ diberikan pada bagian kanan Gambar [1](#fig1) dengan warna abu-abu. ### Diagram gaya Diagram gaya-gaya yang berja pada benda perlu dibuat berdasarkan informasi dari Gambar [1](#fig1) dan Tabel [1](#tab1), yang diberikan berikut ini. ``` %%html <svg width="320" height="200" viewBox="0 0 320 200.00001" id="svg2" version="1.1" inkscape:version="1.1.2 (b8e25be833, 2022-02-05)" sodipodi:docname="mass-horizontal-rough-surface-fbd.svg" xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape" xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd" xmlns="http://www.w3.org/2000/svg" xmlns:svg="http://www.w3.org/2000/svg" xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:cc="http://creativecommons.org/ns#" xmlns:dc="http://purl.org/dc/elements/1.1/"> <defs id="defs4"> <marker style="overflow:visible" id="TriangleOutM" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479" /> </marker> <marker style="overflow:visible" id="marker11604" refX="0" refY="0" orient="auto" inkscape:stockid="Arrow2Mend" inkscape:isstock="true"> <path transform="scale(-0.6)" d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:0.625;stroke-linejoin:round" id="path11602" /> </marker> <marker style="overflow:visible" id="Arrow2Mend" refX="0" refY="0" orient="auto" inkscape:stockid="Arrow2Mend" inkscape:isstock="true"> <path transform="scale(-0.6)" d="M 8.7185878,4.0337352 -2.2072895,0.01601326 8.7185884,-4.0017078 c -1.7454984,2.3720609 -1.7354408,5.6174519 -6e-7,8.035443 z" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:0.625;stroke-linejoin:round" id="path11361" /> </marker> <marker style="overflow:visible" id="TriangleOutM-3" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479-1" /> </marker> <marker style="overflow:visible" id="TriangleOutM-35" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479-0" /> </marker> <marker style="overflow:visible" id="TriangleOutM-0" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479-4" /> </marker> <marker style="overflow:visible" id="TriangleOutM-37" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479-9" /> </marker> <marker style="overflow:visible" id="TriangleOutM-9" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479-8" /> </marker> <marker style="overflow:visible" id="TriangleOutM-9-3" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479-8-3" /> </marker> <marker style="overflow:visible" id="TriangleOutM-37-5" refX="0" refY="0" orient="auto" inkscape:stockid="TriangleOutM" inkscape:isstock="true"> <path transform="scale(0.4)" style="fill:context-stroke;fill-rule:evenodd;stroke:context-stroke;stroke-width:1pt" d="M 5.77,0 -2.88,5 V -5 Z" id="path11479-9-9" /> </marker> </defs> <sodipodi:namedview id="base" pagecolor="#ffffff" bordercolor="#666666" borderopacity="1.0" inkscape:pageopacity="0.0" inkscape:pageshadow="2" inkscape:zoom="1.2079428" inkscape:cx="159.36185" inkscape:cy="35.597712" inkscape:document-units="px" inkscape:current-layer="layer1" showgrid="false" inkscape:snap-bbox="false" inkscape:snap-global="false" units="px" showborder="true" inkscape:showpageshadow="true" borderlayer="false" inkscape:window-width="1366" inkscape:window-height="705" inkscape:window-x="-8" inkscape:window-y="-8" inkscape:window-maximized="1" inkscape:pagecheckerboard="0"> <inkscape:grid type="xygrid" id="grid970" /> </sodipodi:namedview> <metadata id="metadata7"> <rdf:RDF> <cc:Work rdf:about=""> <dc:format>image/svg+xml</dc:format> <dc:type rdf:resource="http://purl.org/dc/dcmitype/StillImage" /> </cc:Work> </rdf:RDF> </metadata> <g inkscape:label="Layer 1" inkscape:groupmode="layer" id="layer1" transform="translate(0,-732.36216)"> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#000000;fill-opacity:1;stroke:none" x="148.01953" y="766.72156" id="text2711-6-2-9-23"><tspan sodipodi:role="line" id="tspan2709-5-9-2-3" x="148.01953" y="766.72156" style="font-style:italic;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, '">N</tspan></text> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#000000;fill-opacity:1;stroke:none" x="251.40584" y="806.94421" id="text2711-6-2-9"><tspan sodipodi:role="line" id="tspan2709-5-9-2" x="251.40584" y="806.94421" style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, '"><tspan style="font-style:italic" id="tspan9923">v</tspan><tspan style="font-size:65%;baseline-shift:sub" id="tspan1668" /></tspan></text> <path style="fill:none;stroke:#000000;stroke-width:1.5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-opacity:1;marker-end:url(#TriangleOutM)" d="m 215.98949,804.88502 25.7387,1.3e-4" id="path11252" /> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#000000;fill-opacity:1;stroke:none" x="153.68098" y="915.71051" id="text2711-6-2-9-2"><tspan sodipodi:role="line" id="tspan2709-5-9-2-84" x="153.68098" y="915.71051" style="font-style:italic;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, '">w</tspan></text> <path style="fill:none;stroke:#000000;stroke-width:1.5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-opacity:1;marker-end:url(#TriangleOutM-37)" d="m 31.113403,791.97918 -1.3e-4,25.7387" id="path11252-5" /> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#000000;fill-opacity:1;stroke:none" x="26.501303" y="780.6109" id="text2711-6-2-9-8"><tspan sodipodi:role="line" id="tspan2709-5-9-2-2" x="26.501303" y="780.6109" style="font-style:italic;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, '">g</tspan></text> <rect style="fill:#ffffff;fill-opacity:1;stroke:#000000;stroke-width:1;stroke-linecap:round;stroke-opacity:1" id="rect1007" width="59" height="59" x="130.5" y="792.86218" rx="0" ry="0" /> <g id="g1363" transform="translate(-6,20)"> <path style="fill:none;stroke:#ff0000;stroke-width:1.5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-opacity:1;marker-end:url(#TriangleOutM-9)" d="m 161.00001,831.69534 -45.73871,1.3e-4" id="path11252-4" /> <path style="fill:none;stroke:#0000ff;stroke-width:1.5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-opacity:1;marker-end:url(#TriangleOutM-9-3)" d="m 160.79738,832.36215 -1.3e-4,-75.7387" id="path11252-4-6" /> </g> <path style="fill:none;stroke:#000000;stroke-width:1.5;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-opacity:1;marker-end:url(#TriangleOutM-37-5)" d="m 159.99967,822.02879 3.4e-4,75.73871" id="path11252-5-0" /> <text xml:space="preserve" style="font-style:normal;font-weight:normal;font-size:18.6667px;line-height:1.25;font-family:sans-serif;fill:#000000;fill-opacity:1;stroke:none" x="85.624084" y="854.51099" id="text2711-6-2-9-8-4"><tspan sodipodi:role="line" id="tspan2709-5-9-2-2-1" x="85.624084" y="854.51099" style="font-style:italic;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:18.6667px;font-family:'Times New Roman';-inkscape-font-specification:'Times New Roman, '">f<tspan style="font-size:65%;baseline-shift:sub" id="tspan2197">k</tspan></tspan></text> </g> </svg> <br> Gambar <a name='fig2'>2</a>. Diagram gaya-gaya yang bekerja pada benda bermassa $m$. ``` Terlihat bahwa pada arah $y$ terdapat gaya normal $N$ dan gaya gravitasi $w$, sedangkan pada arah $x$ hanya terdapat gaya gesek kinetis $f_k$ yang melawan arah gerak benda. Arah gerak benda diberikan oleh arah kecepatan $v$. ## Metode numerik Interasi suatu fungsi $f(x)$ berbentuk <a name='eqn8'></a> \begin{equation}\label{eqn:integral-1}\tag{8} A = \int_a^b f(x) dx \end{equation} dapat didekati dengan <a name='eqn9'></a> \begin{equation}\label{eqn:integral-2}\tag{9} A \approx \sum_{i = 0}^N f\left[ \tfrac12(x_i + x_{i+1}) \right] \Delta x \end{equation} yang dikenal sebagai metode persegi titik tengah, di mana <a name='eqn10'></a> \begin{equation}\label{eqn:integral-3}\tag{10} \Delta x = \frac{b - a}{N} \end{equation} dengan $N$ adalah jumlah partisi. Variabel $x_i$ pada Persamaan ([9](#eqn9)) diberikan oleh <a name='eqn11'></a> \begin{equation}\label{eqn:integral-4}\tag{11} x_i = a + i\Delta x \end{equation} dengan $i = 0, \dots, N$. ## Penyelesaian Penerapan Persamaan ([1](#eqn1)), ([2](#eqn2)), ([3](#eqn3)), ([4](#eqn4)), dan ([5](#eqn5)) pada Gambar [2](#fig2) akan menghasilkan <a name='eqn10'></a> \begin{equation}\label{eqn:friction}\tag{10} f_k = \mu_k mg \end{equation} dan usahanya adalah <a name='eqn11'></a> \begin{equation}\label{eqn:friction-work}\tag{11} \begin{array}{rcl} W & = & \displaystyle \int_{x_0}^x f_k dx \newline & = & \displaystyle \int_{x_0}^x \mu_k m g dx \newline & = & \displaystyle m g \int_{x_0}^x \mu_k dx \end{array} \end{equation} dengan koefisien gesek statisnya dapat merupakan fungsi dari posisi $\mu_k = \mu_k(x)$. ``` import numpy as np import matplotlib.pyplot as plt plt.ion() # set integral lower and upper bounds a = 0 b = 1 # generate x x = [1, 2, 3, 4, 5] # generate y from numerical integration y = [1, 2, 3, 5, 6] ## plot results fig, ax = plt.subplots() ax.scatter(x, y) ax.set_xlabel("$x - x^0$") ax.set_ylabel("y") from IPython import display from IPython.core.display import HTML HTML(''' <div> Gambar <a name='fig3'>3</a>. Kurva antara usaha $W$ dan jarak tempuh $x - x_0$. </div> ''') ``` ## Diskusi Berdasarkan Gambar [3](#fig3) dapat dijelaskan bahwa dengan $\mu_k = \mu_k(x)$ maka kurva $W(x)$ tidak lagi linier karena dipengaruhi oleh sejauh mana perhitungan kerja dilakukan. ## Kesimpulan Perhitungan kerja dengan $\mu_k = \mu_k(x)$ telah dapat dilakukan. ## Referensi 1. J. A. C. Martins, J. T. Oden, F. M. F. Simões, "A study of static and kinetic friction", International Journal of Engineerting Science, vol 28, no 1, p 29-92, 1990, url <https://doi.org/10.1016/0020-7225(90)90014-A>. 1. Carl Rod Nave, "Friction", HyperPhysics, 2017, url <http://hyperphysics.phy-astr.gsu.edu/hbase/frict.html#fri> [20220419]. 2. Wikipedia contributors, "Friction", Wikipedia, The Free Encyclopedia, 12 April 2022, 00:33 UTC, url <https://en.wikipedia.org/w/index.php?oldid=1082223658> [20220419]. 3. Tia Ghose, Ailsa Harvey, "What is friction?", Live Science, 8 Feb 2022, url <https://www.livescience.com/37161-what-is-friction.html> [20220419].
github_jupyter
<script async src="https://www.googletagmanager.com/gtag/js?id=UA-59152712-8"></script> <script> window.dataLayer = window.dataLayer || []; function gtag(){dataLayer.push(arguments);} gtag('js', new Date()); gtag('config', 'UA-59152712-8'); </script> # The NRPy+ Jupyter Tutorial Style Guide / Template ## Authors: Brandon Clark, Zach Etienne, & First Last ### Formatting improvements courtesy Brandon Clark <font color='red'>**This is a warning message, in red text and bolded, to warn anyone using the module that it is, for example, actively in development, not yet validated, etc. Warning messages are optional.**</font> ## This module implements a template designed by Brandon Clark to be used as a style guide for all tutorial notebooks within NRPy+. ### Items in Markdown code contained within "</>" are not included within the output (double click this box to see what I mean). To the run Markdown code simply hit "Shift + Enter" or the "Run" button above. <font color='green'>**This text discusses how a module has been validated against other existing code or modules. This text is given a green font color and bolded. See how to bold and make text different colors in the Markdown code.**</font> ### </list_source_code> NRPy+ Source Code for this module: 1. [Template_Style_Guide.py](../edit/Template_Style_Guide.py); [\[**tutorial**\]](Tutorial-Template_Style_Guide.ipynb) </description_here> This is where you would describe what purpose this source code serves in this module. Read how to correctly link to these source code files/tutorial notebooks later in []. 1. </additional_source_code_links__here> ## Introduction: Here you write an introduction that discusses in slight detail the framework of this tutorial notebook. Here you may reference external works or websites on which pieces of your module rely. It is often helpful to include an enumerated algorihtm to highlight this modules processes. Within the algortihm you may refer to where source code is implemeted as a part of this module. </optional> The entire </made_up>algorithm is outlined below, with NRPy+-based components highlighted in <font color='green'>green</font>. 1. Constructing a Table of Contents 1. 1. Discussing [Markdown Linking Protocol](https://medium.com/@sambozek/ipython-er-jupyter-table-of-contents-69bb72cf39d3) 1. Linking to sections internally within the module 1. Linking to external sources 1. No parts of this template tutorial notebook rely on <font color='green'>NRPy+-based components</font> 1. Converting Jupyter notebook to output LaTex PDF </optional> You could also write your introduction to include subsections preceded by ###. ### introduction subsection: Include information relevant to this subsection here. ## </other> Other (Optional): You may include any number of items here within the first box of the tutorial notebook, but I suggest being minimalistic when you can. Other sections that have been included in other tutorial moudles are as follows ### Note on Notation: When using a new type of notation for the first time within the NRPy+ tutorial, you may want to include some notes on that here. ### Citations: This is a great place to list out the references you link to within the module with actual citations. <a id='toc'></a> # Table of Contents $$\label{toc}$$ This notebook is organized as follows 0. [Preliminaries](#prelim): This is an optional section 1. [Step 1](#linking): The Markdown Linking Protocol </header_section> 1. [Step 1.a](#internal_links) Internal linking with the Jupyter notebook, Table of Contents </subsection> 1. [Step 1.b](#external_links): External linking outside of Jupyter notebook </subsection> 1. [Step 1.b.i](#nrpy_links): Linking to other files/modules within NRPy+ </subsubsection> 1. [Step 2](#latex_pdf_output): Output this notebook to $\LaTeX$-formatted PDF file The Table of Contents (ToC) plays a significant role in the formatting of your module. The above ToC is for this module, but I have constructed it in a way such that you should see all of the important details for any module you need to write. If you choose to include a preliminaries section, enumerate it with the "0." All other sections, subsections, and sub-subsections can be enumerated with the 1. Jupyter/LaTex will handle there own numerbing/lettering scheme. It is important when creating subsections and sub-subsections that you indent seen in the Markdown code. The text colors vary for the level section you're assigning within the Markdown code. When writing within the brackets to specify a step number, the following scheme is to be used: * Header Sections: Step 1, Step 2, Step 3 * Subsections: Step 1.a, Step 1.b, Step 1.c * Sub-subsections: Step 1.a.i, 1.a.ii, 1.a.iii </roman_numerals> If for some reason you go more then three levels deep in your sectioning, I would suggest finding a way to reorganize your sectioning to prevent that, or ask Zach Etienne what the next level of labelling for Steps should be. We will talk about the other components within the Markdown Code for the ToC in [Step 1.a](#internal_links). The only text within the ToC section of this module should be the ToC code itself and what precedes it. I also suggest that the titles for the Steps you include here following the ":" match the titles you use throughout your module. <a id='prelim'></a> # Preliminaries: This is an optional section \[Back to [top](#toc)\] $$\label{prelim}$$ This section is a great chance to include textual verbage that might have been too specific for the introduction section, but serves as a beneficial setup to the remainder of the module. For instance, you may want to define quantities here, express important equations, and so on. I suggest that the Preliminaries section is not followed by any Python code blocks, and remains simply a block of information for users to refer back to. <a id='linking'></a> # Step 1: The Markdown Linking Protocol \[Back to [top](#toc)\] $$\label{linking}$$ We have already within this template had to link to sources both internally within this module, exteranlly to other components of the NRPy+ tutorial, as well as externally to additional web sources. The next few sections discuss how this is done. It is important to know that any linking is down by combining brackets and parentheses "\[ \]()" with the desired input in each. On another note, main sections like this have their titles preoceed by a single #. As you will see, for every deeper layer of sectioning, an addiotnal # is appended on, reducing the size of the text. <a id='internal_links'></a> ## Step 1.a: Internal linking with the Jupyter notebook, Table of Contents \[Back to [top](#toc)\] $$\label{internal_links}$$ A great resource for how to construct a Table of Contents is: https://medium.com/@sambozek/ipython-er-jupyter-table-of-contents-69bb72cf39d3 The Table of Contents is a family of internal links. To link internally we first have to specify an ***anchor tag*** which is the text within the parenthese of preceded by a # (See ToC Markdown code). For instance, the anchor tag for this subsection is "internal_links". So, for a particular Step within the Table of Contents you specify the Step title in brackets (e.g., <font color='blue'>[Step 1.a]</font>), appended by the anchor tag in parentheses preced by a # (e.g., <font color='red'>(#internal_links)</font>), followed by a ":" and the Step description (e.g., : Internal linking with the Jupyter notebook, Table of Contents). Look at the Markdown code for the Table of Contents for a few examples. **Important Note**: The anchor tags cannot be anything that you want. Anchor tags must be entirely lowercase and contain no spaces. Numbers are fine as well as underscores, but not capitalization. I suggest making the anchor tags have siginificant meaning to the section there tied to, instead of making one that reads "step1a". The reason I say this, is because if you ever need to resection your module, the tags won't all need to be chnaged as well if you give each one a unqiue name. All we have done so far is establish anchor tags and clickable links within the Table of Contents, but how do we establish the link to the specific section within the module. Opening up the Markdown code for this section you will see a line of code above the title, and a line of code directly below the title. These are the answers to the question. Each section requires these components to be included for both the Jupyter notebook and LaTex internal linking. Make sure the top line of the Markdown code has a space between it and the title. Similarly, the code directly beneath the title needs space below it as well, separated from the main body of text (see above in Markdown code). **Important Note**: Links do not work unless the two sections which are linked have been run. The Table of Contents is now linked to this section and you may have already noticed but this section, and all others, are linked back to the Table of Contents using the Markdown code in line at the end of the section title. This is exceedingly convenient for modules of great length. It may also be convenient when you're in a particular subsection and you wish to just return to the header section. This is accomplished using a bracket parentheses \[\]() pairing like so (see this in Markdown code). Go back to [Step 1](#linking) Lastly, you would more often than not write a code block below implementing what was discussed in this section. This isn't always necessary, some header sections plainly serve as a set up for subsections that will contain all of the necessary coding components. ``` # This is the code block corresponding to Step 1.a: Internal linking within the Jupyter notebook, Table of Contents print("We have successfully learned how to code internal links using Markdown Linking Protocol!!!") ``` <a id='external_links'></a> ## Step 1.b: External linking outside of this module \[Back to [top](#toc)\] $$\label{external_links}$$ To link outside of this particular module we still use bracket parentheses \[ \]() pairings. Since the links are not internal, we no longer need the # symbol and anchor tags. Instead, you need an actual link. For instance, look at your Markdown code to see how we link this [website](https://medium.com/@sambozek/ipython-er-jupyter-table-of-contents-69bb72cf39d3) to a line of text. Of course, web links will simply work on there own as a hyperlink, but often you may need to link to multiple external sources and do not want all of the individual addresses clogging up the body of your text. ``` # This is the code block for Step 1.b: External linking outside of Jupyter notebook print("Be efficient in how you link external sources, utilize []() pairs!!!") ``` <a id='nrpy_links'></a> ### Step 1.b.i: Linking to other files/modules within NRPy+ \[Back to [top](#toc)\] $$\label{nrpy_links}$$ Other useful extranal sources we would like to link to are the existing files/moudles within NRPy+. To do this we again resort to the \[ \]() pair. By simply typing the file name into the parentheses, you can connect to another [Tutorial module](Tutorial-Template_Style_Guide.ipynb) (see Markdown). To access a .py file, you want to type the command ../edit/ followed by the file location. For instance, here is the [.py file](../edit/Template_Style_Guide.py) for this notebook (see Markdown). ``` # This is the code block for Step 1.b.i: Linking to other files/modules within NRPy+ print("Template_Style_Guide.py is an empty file...") ``` <a id='latex_pdf_output'></a> # Step 2: Output this notebook to $\LaTeX$-formatted PDF file \[Back to [top](#toc)\] $$\label{latex_pdf_output}$$ The following code cell converts this Jupyter notebook into a proper, clickable $\LaTeX$-formatted PDF file. After the cell is successfully run, the generated PDF may be found in the root NRPy+ tutorial directory, with filename [Tutorial-Template_Style_Guide.pdf](Tutorial-Template_Style_Guide.pdf) (Note that clicking on this link may not work; you may need to open the PDF file through another means.) **Important Note**: Make sure that the file name is right in all six locations, two here in the Markdown, four in the code below. * Tutorial-Template_Style_Guide.pdf * Tutorial-Template_Style_Guide.ipynb * Tutorial-Template_Style_Guide.tex ``` import cmdline_helper as cmd # NRPy+: Multi-platform Python command-line interface cmd.output_Jupyter_notebook_to_LaTeXed_PDF("Tutorial-Template_Style_Guide") ```
github_jupyter
## Progressive Elaboration of Tasks [Progressive elaboration](https://project-management-knowledge.com/definitions/p/progressive-elaboration/) is the process of adding additional detail and fidelity to the project plan as additional or more complete information becomes available. The process of progressive elaboration allows the project team to begin with a sketch of their project plan that becomes more detailed as needed and as development priorities emerge from the emergent detailed picture. In this demonstration and exercise we will focus on the creation of subtasks, and identifying dependencies between tasks that impact the sequence of work. Our next demo and exercise will focus on assigning tasks to resources and developing an effort instead of duration-focused view of our project. [foundation-03.tjp file](Sample-Files/foundation-03.tjp) project foundation "Foundation Project" 2018-07-01 - 2019-06-30 { currency "USD" timeformat "%Y-%m-%d" numberformat "-" "" "," "." 1 currencyformat "(" ")" "," "." 0 now 2018-07-01-00:00 weekstartsmonday workinghours mon - fri 9:00 - 12:00, 13:00 - 18:00 workinghours sat, sun off } ############## accounts ################ ############## resources ############### ############## tasks ################### task projectstart "Project Start" { start ${projectstart} } task doing "Making the Goods" { start ${projectstart} task buy_materials "Buy the materials" { duration 1m } task glue_together "Glue everything together" { depends !buy_materials # relative reference to task duration 8w } task cleanup "Clean up the mess" { depends doing.glue_together # absolute reference to task duration 30d } } task refining "Refining the Goods" { depends doing task paint "Paint the items" { duration 3w } task attach_bells "Screw bells onto items" { depends !paint task buy_bells "Buy bells"{duration 1w} task use_screwdriver "Use screwdriver" { depends !buy_bells duration 1m } } task repaint "Repaint the items" { depends !attach_bells duration 2m } task explain "Explain to Boss what you spent the last 3 months doing" { depends !repaint duration 2h } } task selling "Selling the Goods" { depends refining.explain duration 4m } ############## reports ################# taskreport "reports/foundation-03_taskreport" { formats html, csv headline "Project Breakdown" } ``` %%bash cd Sample-Files tj3 foundation-03.tjp ``` producing this HTML report: [Sample-Files/reports/foundation-03_taskreport.html](Sample-Files/reports/foundation-03_taskreport.html) and the following CSV file: [Sample-Files/reports/foundation-03_taskreport.csv](Sample-Files/reports/foundation-03_taskreport.csv) ## Practice ... Based on the fleshed out skeleton (collection of high-level tasks) you previously developed, you can now add some subtasks, and dependencies to those tasks to develop a more detailed plan. When done you can generate new HTML and CSV reports that illustrate/contain the results of the project scheduling processs in TaskJuggler. ### Activity: 1. Modify your previously created fleshed out `.tjp` file or create a new file based on the content of your "skeleton" file and add some sub-tasks and dependencies to your plan. 2. Run the TaskJuggler scheduler to test your skeleton to make sure that it does not generate any errors. If it does, see if you can fix them and re-run the scheduler. <video controls src="images/Timer10Minutestory.mov" /> ------------------- [(0)](TJ-00%20What%20is%20TaskJuggler.ipynb) -- [(1)](TJ-01%20Project%20Skeleton.ipynb) -- [(2)](TJ-02%20A%20Fleshed%20Out%20TaskJuggler%20Outline.ipynb) -- (3) -- [(4)](TJ-04%20Assigning%20Resources%20%26%20Cost%20Estimation%20in%20TaskJuggler.ipynb) -- [(5)](TJ-05%20Project%20Tracking%20in%20TaskJuggler.ipynb) -- [(6)](TJ-06%20Visualization%20%26%20Reporting%20in%20TaskJuggler.ipynb)
github_jupyter
# *Import Libraries* ``` import scipy.io import numpy as np from matplotlib import pyplot as plt import sys sys.path.append('/home/bhustali/.conda/envs/tf2/svcca-master') import cca_core ``` # Simple Example ``` # # assume A_fake has 20 neurons and we have their activations on 2000 datapoints # A_fake = np.random.randn(20, 2000) # # B_fake has 50 neurons with activations on the same 1000 datapoints # # Note A and B do *not* have to have the same number of neurons # B_fake = np.random.randn(50, 1000) # # computing CCA simliarty between A_fake, B_fake # # We expect similarity should be very low, because the random activations are not correlated # results = cca_core.get_cca_similarity(A_fake, B_fake,compute_dirns=True, verbose=True) # print("Returned Information: \n") # print(results.keys()) # print("Single number for summarizing similarity") # print('{:.4f}'.format(np.mean(results["cca_coef1"]))) ``` # SVCCA Layers ``` for k in range(1,587): data_A = scipy.io.loadmat('/home/bhustali/data/mat/neuron_output (586).mat') data_B = scipy.io.loadmat('/home/bhustali/data/mat/neuron_output ' + '(' + str(k)+ ')' + '.mat') S = np.zeros((8,8)) for i in range (1,9): for j in range (1,9): #extract layer outputs l_1 and l_2 A_layer = data_A['layer_' + str(i)].transpose() B_layer = data_B['layer_' + str(j) ].transpose() # Mean subtract activations ''' a = np.array([[1, 2], [3, 4]]) np.mean(a, axis=1) = array([1.5, 3.5]) ''' c_A_layer = A_layer - np.mean(A_layer, axis=1, keepdims=True) c_B_layer = B_layer - np.mean(B_layer, axis=1, keepdims=True) #Singular Value Decomposition(SVD) #obtain l_1' and l_2' ''' U, S, Vh = np.linalg.svd(A, full_matrices=False) U = [mxs] = Left-singular vector of A S = [sxs] = Singular values of A Vh = [sxp] = Right-singular vectors of A ''' u_A, s_A, vh_A = np.linalg.svd(c_A_layer, full_matrices=False) u_B, s_B, vh_B = np.linalg.svd(c_B_layer, full_matrices=False) sv = 10 #select an appropriate value # print("Percentage of variance explained by 'sv' singular vectors", 100*np.sum(s_A[:sv])/np.sum(s_A)) '''singular vectors = S * Vh Equivalent to Uh * A = Uh* (U*S*Vh) = S*Vh ''' #We compute the subspace with 'sv' largest singular values sv_A_layer = np.matmul(s_A[:sv]*np.eye(sv), vh_A[:sv]) sv_B_layer = np.matmul(s_B[:sv]*np.eye(sv), vh_B[:sv]) svcca_results = cca_core.get_cca_similarity(sv_A_layer, sv_B_layer, epsilon=0, threshold=1,compute_dirns=True, verbose=False) S[i-1,j-1] = np.mean(svcca_results["cca_coef1"]) fig, ax = plt.subplots() ax.matshow(S, cmap=plt.cm.Blues) ax.set_xticklabels([0,'B1','B2','B3','B4','B5','B6','B7','B8']) ax.set_yticklabels([0,'A1','A2','A3','A4','A5','A6','A7','A8']) for l in range(8): for m in range(8): c = S[m,l] ax.text(l, m, f"{c:.2f}", va='center', ha='center') plt.savefig('/home/bhustali/data/movie/' + str(k) + '.png',dpi = 100) plt.close('all') ``` # How do layer outputs change during optimization? Here, we measure the correlation of the output after each iteration (data_B) with the outputs of the layers before training (data_A) ``` # s = np.zeros((587,8)) # #outputs of the layers before training # data_A = scipy.io.loadmat('data/mat/neuron_output (0).mat') # for i in range (1,9): # for k in range(0,587): # #output after each iteration # data_B = scipy.io.loadmat('data/mat/neuron_output ' + '(' + str(k)+ ')' + '.mat') # j = i # A_layer = data_A['layer_' + str(i)].transpose() # B_layer = data_B['layer_' + str(j) ].transpose() # #shift mean to 0 # c_A_layer = A_layer - np.mean(A_layer, axis=1, keepdims=True) # c_B_layer = B_layer - np.mean(B_layer, axis=1, keepdims=True) # # Singular Value Decomposition(SVD) # u_A, s_A, vh_A = np.linalg.svd(c_A_layer, full_matrices=False) # u_B, s_B, vh_B = np.linalg.svd(c_B_layer, full_matrices=False) # sv = 10 #select an appropriate value # sv_A_layer = np.matmul(s_A[:sv]*np.eye(sv), vh_A[:sv]) # sv_B_layer = np.matmul(s_B[:sv]*np.eye(sv), vh_B[:sv]) # #compute similarity # svcca_results = cca_core.get_cca_similarity(sv_A_layer, sv_B_layer, epsilon=0, threshold=1, # compute_dirns=True, verbose=False) # s[k,i-1] = np.mean(svcca_results["cca_coef1"]) # #Plotting # fig, ax = plt.subplots() # for i in range (0,8): # ax.plot(s[:,i], label = str(i+1)) # ax.set(xlabel='iterations', ylabel='rho', # title='Convergence') # ax.grid() # plt.legend() # # fig.savefig('divergence.png', dpi = 500) ```
github_jupyter
# Walk through all streets in a city Preparation of the examples for the challenge: find the shortest path through a set of streets. ``` import matplotlib.pyplot as plt %matplotlib inline from jyquickhelper import add_notebook_menu add_notebook_menu() ``` ## Problem description Find the shortest way going through all streets from a set of streets? This problem is known as the *Route inspection problem*. ## Data [Seattle streets](https://data.seattle.gov/dataset/Street-Network-Database/afip-2mzr/data) from [data.seattle.gov](https://data.seattle.gov/) ### Read the data ``` import shapefile, os if os.path.exists("Street_Network_Database/WGS84/Street_Network_Database.shp"): rshp = shapefile.Reader("Street_Network_Database/WGS84/Street_Network_Database.shp") shapes = rshp.shapes() records = rshp.records() else: from pyensae.datasource import download_data files = download_data("WGS84_seattle_street.zip") rshp = shapefile.Reader("Street_Network_Database.shp") shapes = rshp.shapes() records = rshp.records() shapes[0].__dict__ {k[0]:v for k,v in zip(rshp.fields[1:], records[0])} from ensae_projects.datainc.data_geo_streets import get_fields_description get_fields_description() ``` ### Display the streets ``` streets5 = list(zip(records[:5], shapes[:5])) streets5[2][1].points import folium from random import randint from pyensae.notebookhelper import folium_html_map c = streets5[0][1] map_osm = folium.Map(location=[c.bbox[1], c.bbox[0]], zoom_start=9) for rec, shape in streets5: d = {k[0]: v for k,v in zip(rshp.fields[1:], rec)} map_osm.add_child(folium.Marker([shape.points[0][1], shape.points[0][0]], popup=str(d["ORD_STNAME"]))) map_osm.add_child(folium.PolyLine(locations=[[_[1], _[0]] for _ in shape.points], weight=10)) folium_html_map(map_osm, width="60%") ``` ## Find connected streets ``` street0 = streets5[0][1].points street0 def connect_streets(st1, st2): a1, b1 = st1[0], st1[-1] a2, b2 = st2[0], st2[-1] connect = [] if a1 == a2: connect.append((0, 0)) if a1 == b2: connect.append((0, 1)) if b1 == a2: connect.append((1, 0)) if b1 == b2: connect.append((1, 1)) return tuple(connect) if connect else None neighbours = [] for i, street in enumerate(shapes): points = street.points con = connect_streets(street0, points) if con: neighbours.append(i) neighbours import folium from pyensae.notebookhelper import folium_html_map c = shapes[neighbours[0]] map_osm = folium.Map(location=[c.bbox[1], c.bbox[0]], zoom_start=15) points = set() for index in neighbours: rec, shape = records[index], shapes[index] corners = [(_[1], _[0]) for _ in shape.points] map_osm.add_child(folium.PolyLine(locations=corners, weight=10)) points |= set([corners[0], corners[-1]]) for x, y in points: map_osm.add_child(folium.Marker((x, y), popup=str(index))) folium_html_map(map_osm, width="50%") c = shapes[neighbours[0]] map_osm = folium.Map(location=[c.bbox[1], c.bbox[0]], zoom_start=15) points = set() for index in neighbours: rec, shape = records[index], shapes[index] corners = [(_[1], _[0]) for _ in shape.points] map_osm.add_child(folium.PolyLine(locations=corners, weight=10)) points |= set([corners[0], corners[-1]]) for x, y in points: map_osm.add_child(folium.CircleMarker((x, y), popup=str(index), radius=8, fill_color="yellow")) folium_html_map(map_osm, width="50%") ``` ## Extraction of all streets in a short perimeter ``` from shapely.geometry import Point, LineString def enumerate_close(x, y, shapes, th=None): p = Point(x,y) for i, shape in enumerate(shapes): obj = LineString(shape.points) d = p.distance(obj) if th is None or d <= th: yield d, i x, y = shapes[0].points[0] closes = list(enumerate_close(x, y, shapes)) closes.sort() closes[:10] import folium from ensae_projects.datainc.data_geo_streets import folium_html_street_map folium_html_street_map([_[1] for _ in closes[:20]], shapes, html_width="50%", zoom_start=15) def complete_subset_streets(subset, shapes): extension = [] for i, shape in enumerate(shapes): add = [] for s in subset: to = shapes[s] if s != i: con = connect_streets(shapes[s].points, shapes[i].points) if con is not None: add.extend([_[1] for _ in con]) if len(set(add)) == 2: extension.append(i) return extension subset = [index for dist, index in closes[:20]] newset = set(subset + complete_subset_streets(subset, shapes)) print(list(sorted(newset))) folium_html_street_map(newset, shapes, html_width="50%", zoom_start=15) from ensae_projects.datainc.data_geo_streets import build_streets_vertices vertices, edges = build_streets_vertices(newset, shapes) vertices[:3], edges[:3] from ensae_projects.datainc.data_geo_streets import plot_streets_network plot_streets_network(newset, edges, vertices, shapes, figsize=(10,10)); ```
github_jupyter
### Data Visualization #### `matplotlib` - from the documentation: https://matplotlib.org/3.1.1/tutorials/introductory/pyplot.html `matplotlib.pyplot` is a collection of command style functions <br> Each pyplot function makes some change to a figure <br> `matplotlib.pyplot` preserves ststes across function calls ``` %matplotlib inline import matplotlib.pyplot as plt ``` Call signatures:: ``` plot([x], y, [fmt], data=None, **kwargs) plot([x], y, [fmt], [x2], y2, [fmt2], ..., **kwargs) ``` Quick plot The main usage of `plt` is the `plot()` and `show()` functions https://matplotlib.org/3.1.1/api/pyplot_summary.html <br> https://matplotlib.org/3.1.1/api/_as_gen/matplotlib.pyplot.plot.html <br> https://matplotlib.org/3.1.1/api/_as_gen/matplotlib.pyplot.show.html <br> https://matplotlib.org/3.1.1/api/_as_gen/matplotlib.pyplot.legend.html<br> https://matplotlib.org/3.1.1/api/_as_gen/matplotlib.pyplot.figure.html<br> https://matplotlib.org/3.1.1/api/_as_gen/matplotlib.pyplot.subplot.html<br> https://matplotlib.org/3.1.1/api/_as_gen/matplotlib.pyplot.annotate.html<br> ``` df_iris = pd.read_csv('https://raw.githubusercontent.com/uiuc-cse/data-fa14/gh-pages/data/iris.csv') df_iris.head() colors = {'setosa':'red', 'versicolor':'orange', 'virginica':'blue'} def get_col(spec): return colors[spec] colors_col = df_iris.species.apply(get_col) plt.scatter("petal_length","petal_width", data=df_iris, c = colors_col, s = 7, marker = "o") legend_elements = [plt.Line2D([0], [0], marker='o', linestyle="", color=colors["setosa"], label="setosa"), plt.Line2D([0], [0], marker='o', linestyle="", color=colors["versicolor"], label="versicolor"), plt.Line2D([0], [0], marker='o', linestyle="", color=colors["virginica"], label="virginica")] plt.legend(handles=legend_elements,loc="upper left", title="Species") plt.show() ``` https://python-graph-gallery.com/matplotlib/ #### Using pandas `.plot()` ``` df_iris.groupby("species").mean().plot(kind='bar') plt.show() df_iris.plot(x= "petal_length", y = "petal_width" ,kind = "scatter", color = colors_col) plt.savefig('output1.png') ``` https://github.com/pandas-dev/pandas/blob/v0.25.0/pandas/plotting/_core.py#L504-L1533 https://python-graph-gallery.com/wp-content/uploads/Matplotlib_cheatsheet_datacamp.png <img src = "https://python-graph-gallery.com/wp-content/uploads/Matplotlib_cheatsheet_datacamp.png" width = "1000"/> ### `seaborn` - dataset-oriented plotting Seaborn is a library that specializes in making *prettier* `matplotlib` plots of statistical data. <br> It is built on top of matplotlib and closely integrated with pandas data structures. https://seaborn.pydata.org/introduction.html<br> https://python-graph-gallery.com/seaborn/ ``` import seaborn as sns ``` `seaborn` lets users *style* their plotting environment.<br> There are 5 preset themes: darkgrid (default), whitegrid, dark, white, and ticks.<br> https://seaborn.pydata.org/tutorial/aesthetics.html However, you can always use `matplotlib`'s `plt.style` https://matplotlib.org/3.1.1/gallery/style_sheets/style_sheets_reference.html ``` sns.set(style='whitegrid') #dir(sns) sns.scatterplot(x='petal_length',y='petal_width',data=df_iris) plt.show() with plt.style.context(('ggplot')): sns.scatterplot(x='petal_length',y='petal_width',data=df_iris) plt.show() sns.scatterplot(x='petal_length',y='petal_width', hue = "species",data=df_iris) plt.show() ``` #### Violin plot Fancier box plot that gets rid of the need for 'jitter' to show the inherent distribution of the data points ``` sns.set(style="dark") fig, axes = plt.subplots(figsize=(7, 3)) sns.violinplot(data=df_iris, ax=axes) axes.set_ylabel('value') axes.set_xlabel('feature') plt.show() ``` #### Distplot ``` sns.set(style='dark', palette='muted') # 1 column, 4 rows f, axes = plt.subplots(4,1, figsize=(10,10), sharex=True) # Regular displot sns.distplot(df_iris.petal_length, ax=axes[0]) # Change the color sns.distplot(df_iris.petal_width, kde=False, ax=axes[1], color='orange') # Show the Kernel density estimate sns.distplot(df_iris.sepal_width, hist=False, kde_kws={'shade':True}, ax=axes[2], color='purple') # Show the rug sns.distplot(df_iris.sepal_length, hist=False, rug=True, ax=axes[3], color='green') plt.show() ``` #### FacetGrid ``` sns.set() columns = ['species', 'petal_length', 'petal_width'] facet_column = 'species' g = sns.FacetGrid(df_iris.loc[:,columns], col=facet_column, hue=facet_column) g.map(plt.scatter, 'petal_length', 'petal_width') sns.relplot(x="petal_length", y="petal_width", col="species", hue="species", style="species", size="sepal_width", data=df_iris) plt.show() ``` https://jakevdp.github.io/PythonDataScienceHandbook/04.14-visualization-with-seaborn.html ``` sns.catplot(x="species", y="petal_length", data=df_iris) plt.show() sns.catplot(kind="box", data=df_iris) plt.show() # https://seaborn.pydata.org/tutorial/categorical.html tips = sns.load_dataset("tips") print(tips.head()) sns.catplot(x="day", y="total_bill", hue="smoker", kind="box", data=tips) plt.show() ``` Plot the tips by day with two side by side box plots for males and females and different subplots for the time of the meal (lunch/dinner). ``` # help(sns.catplot) sns.pairplot(df_iris, hue='species', height=2.5); ``` https://s3.amazonaws.com/assets.datacamp.com/blog_assets/Python_Seaborn_Cheat_Sheet.pdf <img src = "https://s3.amazonaws.com/assets.datacamp.com/blog_assets/Python_Seaborn_Cheat_Sheet.pdf" width = "1000"/> ### `plotnine` - R ggplot2 in python plotnine is an implementation of a grammar of graphics in Python, it is based on ggplot2. The grammar allows users to compose plots by explicitly mapping data to the visual objects that make up the plot. Plotting with a grammar is powerful, it makes custom (and otherwise complex) plots are easy to think about and then create, while the simple plots remain simple. ``` #!pip install plotnine ``` https://plotnine.readthedocs.io/en/stable/ ``` from plotnine import * ``` https://plotnine.readthedocs.io/en/stable/api.html ``` p = ggplot(data=df_iris) + aes(x="petal_length", y = "petal_width") + geom_point() # add transparency - to address overlapping points ggplot(data=df_iris) + aes(x="petal_length", y = "petal_width") + geom_point(size = 5, alpha=0.5) # change point size ggplot(data=df_iris) + aes(x="petal_length", y = "petal_width") + geom_point(size = 0.7, alpha=0.7) # more parameters ggplot(data=df_iris) + aes(x="petal_length", y = "petal_width") + geom_point() + scale_x_log10() + xlab("Petal Length") n = "3" features = "length and width" title = f'species : {n}; petal : {features}' #title = 'species : {}; petal : {}'.format(n,features) ggplot(data=df_iris) +aes(x='petal_length',y='petal_width',color="species") \ + geom_point(size=0.7) + facet_wrap('~species',nrow=3) \ + theme(figure_size=(7,9)) + ggtitle(title) p = ggplot(data=df_iris) + aes(x='petal_length') \ + geom_histogram(binwidth=1,color='black',fill='grey') p ggsave(plot=p, filename='hist_plot_with_plotnine.png') tips = sns.load_dataset("tips") print(tips.head()) ggplot(aes(x="day", y="tip",\ color="smoker"), data=tips) \ + geom_boxplot()\ + geom_jitter(width=0.05, alpha=0.4) \ + facet_grid(".~smoker") ``` http://cmdlinetips.com/2018/05/plotnine-a-python-library-to-use-ggplot2-in-python/ <br> https://www.rstudio.com/wp-content/uploads/2015/03/ggplot2-cheatsheet.pdf <img src = "https://www.rstudio.com/wp-content/uploads/2015/03/ggplot2-cheatsheet.pdf" width = "1000"/> Use ggplot to plot the sepal_length in boxplots separated by species, add new axes labels and make the y axis values log10. * Write a function that takes as a parameter a line of the dataframe and if the species is ** setosa it returns the petal_length ** versicolor it returns the petal_width ** virginica it returns the sepal_length Apply this function to every line in the dataset. <br> Use ggplot to make a histogram of the resulted values. ``` #dir() ``` https://plotnine.readthedocs.io/en/stable/api.html Look for scale functions. More resources: https://github.com/swyder/plotnine_tutorial/blob/master/plotnine_demo_sw.ipynb <br> https://datacarpentry.org/python-ecology-lesson/07-visualization-ggplot-python/
github_jupyter
<h1>Phi K Correlation</h1> Phi K correlation is a newly emerging correlation cofficient with following advantages: - it can work consistently between categorical, ordinal and interval variables - it can capture non-linear dependency - it reverts to the Pearson correlation coefficient in case of a bi-variate normal input distribution ``` import phik from phik import resources from phik.binning import bin_data from phik.decorators import * from phik.report import plot_correlation_matrix import pandas as pd import numpy as np from sklearn.preprocessing import OneHotEncoder, LabelEncoder, StandardScaler, MinMaxScaler import seaborn as sns import matplotlib.pyplot as plt import networkx as nx #loading the SalePrice dataset df=pd.read_csv('dataset.csv') df.drop(['Id'], axis=1,inplace=True) ``` **Preprocessing** ``` #Preprocessing the data class PreProcessor: def __init__(self): #treating certain categorical columns as ordinal self.encoder={} self.encoder['LotShape']={'Reg':0,'IR1':1,'IR2':2,'IR3':3} self.encoder['LandSlope']={'Gtl':1, 'Mod':2, 'Sev':3} self.encoder['GarageFinish']={'Fin':3, 'RFn':2, 'Unf':1, 'VNA':0} self.encoder['BsmtExposure']={'Gd':4,'Av':3,'Mn':2,'No':1,'VNA':0} self.encoder['Functional']={'Typ':0,'Min1':1,'Min2':2,'Mod':3,'Maj1':4,'Maj2':5,'Sev':6,'Sal':7} self.encoder['PavedDrive']={'Y':2,'P':1,'N':0} #columns with values as Ex,Gd,TA,Fa,Po,VNA can be treated as ordinal ratings={'Ex':5,'Gd':4,'TA':3,'Fa':2,'Po':1,'VNA':0} rated_cols=['ExterQual', 'ExterCond','BsmtQual','BsmtCond','KitchenQual','FireplaceQu','GarageQual', 'GarageCond'] for col in rated_cols: self.encoder[col]=ratings self.categorical_encoded=self.encoder.keys() def preprocessing1(self,df): #drop columns with mostly one value or mostly missing values dropped_cols=['Street', 'Alley', 'Utilities', 'Condition2', 'RoofMatl', 'Heating','LowQualFinSF', '3SsnPorch', 'PoolArea', 'PoolQC', 'Fence', 'MiscFeature', 'MiscVal'] df.drop(dropped_cols, axis=1, inplace=True) #treating missing values #Filling missing values with median col1=['LotFrontage','MasVnrArea'] for col in col1: df[col].fillna(df[col].median(), inplace=True) #Fill missing values with new category "VNA" col2=['BsmtQual','BsmtCond','BsmtExposure','BsmtFinType1','BsmtFinType2','GarageType','GarageFinish','GarageQual','GarageCond','FireplaceQu','MasVnrType', 'Electrical'] for col in col2: df[col].fillna('VNA', inplace=True) #Replacing Na values in GarageYrBlt with corresponding values in YearBuilt df.loc[(pd.isnull(df.GarageYrBlt)), 'GarageYrBlt'] = df.YearBuilt #encoding categorical columns to ordinal for col in self.categorical_encoded: df[col]=df[col].apply(lambda val: self.encoder[col][val]) #apply lable encoder for col in df.select_dtypes(include=['object']).columns: df[col] = LabelEncoder().fit_transform(df[col]) return df def preprocessing2(self,df): df=self.preprocessing1(df) #filtered columns numerical_filtered=['YearBuilt','TotRmsAbvGrd','GrLivArea','1stFlrSF','GarageYrBlt','YearRemodAdd','GarageArea','SalePrice'] ordinal_filtered=['GarageCars','OverallQual','Fireplaces','GarageFinish','BsmtFullBath','KitchenQual','FullBath','FireplaceQu','BsmtQual','TotalBsmtSF'] categorical_filtered=['MSZoning', 'Neighborhood', 'Foundation', 'BsmtFinType1', 'HeatingQC', 'CentralAir', 'GarageType', 'SaleCondition', 'MSSubClass', 'MasVnrType'] return df[numerical_filtered+ordinal_filtered+categorical_filtered], numerical_filtered #create pre processor object pre_processor=PreProcessor() #preprocess the data and get interval column preprocessed_df, interval_cols=pre_processor.preprocessing2(df) ``` **PhiK correlation** ``` # get the phi_k correlation matrix between all variables coerr_mat=preprocessed_df.phik_matrix(interval_cols=interval_cols) #colour map cmap = sns.diverging_palette(220, 10, as_cmap=True) #plotting phik correlation plot_correlation_matrix(coerr_mat.values, x_labels=coerr_mat.columns, y_labels=coerr_mat.index, vmin=0, vmax=1, color_map=cmap, title=r'correlation $\phi_K$', fontsize_factor=1, figsize=(7*3,5.5*3)) plt.tight_layout() plt.show ``` **Finding highly correlated features based on above heat map and vizualizing it as a graph** ``` class GraphVisualization: def __init__(self): # visual is a list which stores all # the set of edges that constitutes a # graph self.visual = [] # addEdge function inputs the vertices of an # edge and appends it to the visual list def addEdge(self, a, b): temp = [a, b] self.visual.append(temp) # In visualize function G is an object of # class Graph given by networkx G.add_edges_from(visual) # creates a graph with a given list # nx.draw_networkx(G) - plots the graph # plt.show() - displays the graph def visualize(self): G = nx.Graph() G.add_edges_from(self.visual) nx.draw_shell(G, alpha = 0.7, with_labels = True, edge_color ='.4', cmap = cmap, font_size=12 ) plt.title("correlation vizualization as graph") plt.style.use('ggplot') plt.figure(figsize=(8,5)) plt.show() G = GraphVisualization() for col1 in preprocessed_df.columns: for col2 in preprocessed_df.columns: if col1!=col2: #if the correlation is greater than 0.9, add an edge to the graph if coerr_mat[col1][col2]>0.9: G.addEdge(col1,col2) G.visualize() ``` Based on graph plot using PhiK correlation ,following features are highly correlated: - GarageArea and GarageCars - GarageTrBlt and YearBuilt - Neighborhood and MSZoning - TotalBsmtSF is highly correlated with 1stFlrSF, SalePrice, BsmtQual, GrLivArea and Neighborhood **Global PhiK Correlations** This metric signifies how much a column is correlated with all other columns in the dataset ``` # get global correlations based on phi_k correlation matrix global_coerr=preprocessed_df.global_phik(interval_cols=interval_cols) #plotting global phik correlation plot_correlation_matrix(global_coerr[0], x_labels=["correlation"], y_labels=global_coerr[1],vmin=0, vmax=1, color_map=cmap, title=r'global correlation $\phi_K$', fontsize_factor=1,figsize=(7*3,5.5*3)) ```
github_jupyter
Author: Saeed Amen (@thalesians) - Managing Director & Co-founder of [the Thalesians](http://www.thalesians.com) ## Introduction With the UK general election in early May 2015, we thought it would be a fun exercise to demonstrate how you can investigate market price action over historial elections. We shall be using Python, together with Plotly for plotting. Plotly is a free web-based platform for making graphs. You can keep graphs private, make them public, and run Plotly on your [Chart Studio Enterprise on your own servers](https://plot.ly/product/enterprise/). You can find more details [here](https://plot.ly/python/getting-started/). ## Getting market data with Bloomberg To get market data, we shall be using Bloomberg. As a starting point, we have used bbg_py from [Brian Smith's TIA project](https://github.com/bpsmith/tia/tree/master/tia/bbg), which allows you to access Bloomberg via COM (older method), modifying it to make it compatible for Python 3.4. Whilst, we shall note use it to access historical daily data, there are functions which enable us to download intraday data. This method is only compatible with 32 bit versions of Python and assumes you are running the code on a Bloomberg terminal (it won't work without a valid Bloomberg licence). In my opinion a better way to access Bloomberg via Python, is via the official Bloomberg open source Python Open Source Graphing Library, however, at time of writing the official version is not yet compatible with Python 3.4. Fil Mackay has created a Python 3.4 compatible version of this [here](https://github.com/filmackay/blpapi-py), which I have used successfully. Whilst it takes slightly more time to configure (and compile using Windows SDK 7.1), it has the benefit of being compatible with 64 bit Python, which I have found invaluable in my analysis (have a read of [this](http://ta.speot.is/2012/04/09/visual-studio-2010-sp1-windows-sdk-7-1-install-order/) in case of failed installations of Windows SDK 7.1). Quandl can be used as an alternative data source, if you don't have access to a Bloomberg terminal, which I have also included in the code. ## Breaking down the steps in Python Our project will consist of several parts: - bbg_com - low level interaction with BBG COM object (adapted for Python 3.4) (which we are simply calling) - datadownloader - wrapper for BBG COM, Quandl and CSV access to data - eventplot - reusuable functions for interacting with Plotly and creating event studies - ukelection - kicks off the whole script process ### Downloading the market data As with any sort of financial market analysis, the first step is obtaining market data. We create the DataDownloader class, which acts a wrapper for Bloomberg, Quandl and CSV market data. We write a single function "download_time_series" for this. We could of course extend this for other data sources such as Yahoo Finance. Our output will be Pandas based dataframes. We want to make this code generic, so the tickers are not hard coded. ``` # for time series manipulation import pandas class DataDownloader: def download_time_series(self, vendor_ticker, pretty_ticker, start_date, source, csv_file = None): if source == 'Quandl': import Quandl # Quandl requires API key for large number of daily downloads # https://www.quandl.com/help/api spot = Quandl.get(vendor_ticker) # Bank of England's database on Quandl spot = pandas.DataFrame(data=spot['Value'], index=spot.index) spot.columns = [pretty_ticker] elif source == 'Bloomberg': from bbg_com import HistoricalDataRequest req = HistoricalDataRequest([vendor_ticker], ['PX_LAST'], start = start_date) req.execute() spot = req.response_as_single() spot.columns = [pretty_ticker] elif source == 'CSV': dateparse = lambda x: pandas.datetime.strptime(x, '%Y-%m-%d') # in case you want to use a source other than Bloomberg/Quandl spot = pandas.read_csv(csv_file, index_col=0, parse_dates=0, date_parser=dateparse) return spot ``` ### Generic functions for event study and Plotly plotting We now focus our efforts on the EventPlot class. Here we shall do our basic analysis. We shall aslo create functions for creating plotly traces and layouts that we shall reuse a number of times. The analysis we shall conduct is fairly simple. Given a time series of spot, and a number of dates, we shall create an event study around these times for that asset. We also include the "Mean" move over all the various dates. ``` # for dates import datetime # time series manipulation import pandas # for plotting data import plotly from plotly.graph_objs import * class EventPlot: def event_study(self, spot, dates, pre, post, mean_label = 'Mean'): # event_study - calculates the asset price moves over windows around event days # # spot = price of asset to study # dates = event days to anchor our event study # pre = days before the event day to start our study # post = days after the event day to start our study # data_frame = pandas.DataFrame() # for each date grab spot data the days before and after for i in range(0, len(dates)): mid_index = spot.index.searchsorted(dates[i]) start_index = mid_index + pre finish_index = mid_index + post + 1 x = (spot.ix[start_index:finish_index])[spot.columns.values[0]] data_frame[dates[i]] = x.values data_frame.index = range(pre, post + 1) data_frame = data_frame / data_frame.shift(1) - 1 # returns # add the mean on to the end data_frame[mean_label] = data_frame.mean(axis=1) data_frame = 100.0 * (1.0 + data_frame).cumprod() # index data_frame.ix[pre,:] = 100 return data_frame ``` We write a function to convert dates represented in a string format to Python format. ``` def parse_dates(self, str_dates): # parse_dates - parses string dates into Python format # # str_dates = dates to be parsed in the format of day/month/year # dates = [] for d in str_dates: dates.append(datetime.datetime.strptime(d, '%d/%m/%Y')) return dates EventPlot.parse_dates = parse_dates ``` Our next focus is on the Plotly functions which create a layout. This enables us to specify axes labels, the width and height of the final plot and so on. We could of course add further properties into it. ``` def create_layout(self, title, xaxis, yaxis, width = -1, height = -1): # create_layout - populates a layout object # title = title of the plot # xaxis = xaxis label # yaxis = yaxis label # width (optional) = width of plot # height (optional) = height of plot # layout = Layout( title = title, xaxis = plotly.graph_objs.XAxis( title = xaxis, showgrid = False ), yaxis = plotly.graph_objs.YAxis( title= yaxis, showline = False ) ) if width > 0 and height > 0: layout['width'] = width layout['height'] = height return layout EventPlot.create_layout = create_layout ``` Earlier, in the DataDownloader class, our output was Pandas based dataframes. Our convert_df_plotly function will convert these each series from Pandas dataframe into plotly traces. Along the way, we shall add various properties such as markers with varying levels of opacity, graduated coloring of lines (which uses colorlover) and so on. ``` def convert_df_plotly(self, dataframe, axis_no = 1, color_def = ['default'], special_line = 'Mean', showlegend = True, addmarker = False, gradcolor = None): # convert_df_plotly - converts a Pandas data frame to Plotly format for line plots # dataframe = data frame due to be converted # axis_no = axis for plot to be drawn (default = 1) # special_line = make lines named this extra thick # color_def = color scheme to be used (default = ['default']), colour will alternate in the list # showlegend = True or False to show legend of this line on plot # addmarker = True or False to add markers # gradcolor = Create a graduated color scheme for the lines # # Also see http://nbviewer.ipython.org/gist/nipunreddevil/7734529 for converting dataframe to traces # Also see http://moderndata.plot.ly/color-scales-in-ipython-notebook/ x = dataframe.index.values traces = [] # will be used for market opacity for the markers increments = 0.95 / float(len(dataframe.columns)) if gradcolor is not None: try: import colorlover as cl color_def = cl.scales[str(len(dataframe.columns))]['seq'][gradcolor] except: print('Check colorlover installation...') i = 0 for key in dataframe: scatter = plotly.graph_objs.Scatter( x = x, y = dataframe[key].values, name = key, xaxis = 'x' + str(axis_no), yaxis = 'y' + str(axis_no), showlegend = showlegend) # only apply color/marker properties if not "default" if color_def[i % len(color_def)] != "default": if special_line in str(key): # special case for lines labelled "mean" # make line thicker scatter['mode'] = 'lines' scatter['line'] = plotly.graph_objs.Line( color = color_def[i % len(color_def)], width = 2 ) else: line_width = 1 # set properties for the markers which change opacity # for markers make lines thinner if addmarker: opacity = 0.05 + (increments * i) scatter['mode'] = 'markers+lines' scatter['marker'] = plotly.graph_objs.Marker( color=color_def[i % len(color_def)], # marker color opacity = opacity, size = 5) line_width = 0.2 else: scatter['mode'] = 'lines' scatter['line'] = plotly.graph_objs.Line( color = color_def[i % len(color_def)], width = line_width) i = i + 1 traces.append(scatter) return traces EventPlot.convert_df_plotly = convert_df_plotly ``` ### UK election analysis We've now created several generic functions for downloading data, doing an event study and also for helping us out with plotting via Plotly. We now start work on the ukelection.py script, for pulling it all together. As a very first step we need to provide credentials for Plotly (you can get your own Plotly key and username [here](https://plot.ly/python/getting-started/)). ``` # for time series/maths import pandas # for plotting data import plotly import plotly.plotly as py from plotly.graph_objs import * def ukelection(): # Learn about API authentication here: https://plot.ly/python/getting-started # Find your api_key here: https://plot.ly/settings/api plotly_username = "thalesians" plotly_api_key = "XXXXXXXXX" plotly.tools.set_credentials_file(username=plotly_username, api_key=plotly_api_key) ``` Let's download our market data that we need (GBP/USD spot data) using the DataDownloader class. As a default, I've opted to use Bloomberg data. You can try other currency pairs or markets (for example FTSE), to compare results for the event study. Note that obviously each data vendor will have a different ticker in their system for what could well be the same asset. With FX, care must be taken to know which close the vendor is snapping. As a default we have opted for BGN, which for GBP/USD is the NY close value. ``` ticker = 'GBPUSD' # will use in plot titles later (and for creating Plotly URL) ##### download market GBP/USD data from Quandl, Bloomberg or CSV file source = "Bloomberg" # source = "Quandl" # source = "CSV" csv_file = None event_plot = EventPlot() data_downloader = DataDownloader() start_date = event_plot.parse_dates(['01/01/1975']) if source == 'Quandl': vendor_ticker = "BOE/XUDLUSS" elif source == 'Bloomberg': vendor_ticker = 'GBPUSD BGN Curncy' elif source == 'CSV': vendor_ticker = 'GBPUSD' csv_file = 'D:/GBPUSD.csv' spot = data_downloader.download_time_series(vendor_ticker, ticker, start_date[0], source, csv_file = csv_file) ``` The most important part of the study is getting the historical UK election dates! We can obtain these from Wikipedia. We then convert into Python format. We need to make sure we filter the UK election dates, for where we have spot data available. ``` labour_wins = ['28/02/1974', '10/10/1974', '01/05/1997', '07/06/2001', '05/05/2005'] conservative_wins = ['03/05/1979', '09/06/1983', '11/06/1987', '09/04/1992', '06/05/2010'] # convert to more easily readable format labour_wins_d = event_plot.parse_dates(labour_wins) conservative_wins_d = event_plot.parse_dates(conservative_wins) # only takes those elections where we have data labour_wins_d = [d for d in labour_wins_d if d > spot.index[0].to_pydatetime()] conservative_wins_d = [d for d in conservative_wins_d if d > spot.index[0].to_pydatetime()] spot.index.name = 'Date' ``` We then call our event study function in EventPlot on our spot data, which compromises of the 20 days before up till the 20 days after the UK general election. We shall plot these lines later. ``` # number of days before and after for our event study pre = -20 post = 20 # calculate spot path during Labour wins labour_wins_spot = event_plot.event_study(spot, labour_wins_d, pre, post, mean_label = 'Labour Mean') # calculate spot path during Conservative wins conservative_wins_spot = event_plot.event_study(spot, conservative_wins_d, pre, post, mean_label = 'Conservative Mean') ``` Define our xaxis and yaxis labels, as well as our source, which we shall later include in the title. ``` ##### Create separate plots of price action during Labour and Conservative wins xaxis = 'Days' yaxis = 'Index' source_label = "Source: @thalesians/BBG/Wikipedia" ``` We're finally ready for our first plot! We shall plot GBP/USD moves over Labour election wins, using the default palette and then we shall embed it into the sheet, using the URL given to us from the Plotly website. ``` ###### Plot market reaction during Labour UK election wins ###### Using default color scheme title = ticker + ' during UK gen elect - Lab wins' + '<BR>' + source_label fig = Figure(data=event_plot.convert_df_plotly(labour_wins_spot), layout=event_plot.create_layout(title, xaxis, yaxis) ) py.iplot(fig, filename='labour-wins-' + ticker) ``` The "iplot" function will send it to Plotly's server (provided we have all the dependencies installed). Alternatively, we could embed the HTML as an image, which we have taken from the Plotly website. Note this approach will yield a static image which is fetched from Plotly's servers. It also possible to write the image to disk. Later we shall show the embed function. <div> <a href="https://plot.ly/~thalesians/244/" target="_blank" title="GBPUSD during UK gen elect - Lab wins&lt;br&gt;Source: @thalesians/BBG/Wikipedia" style="display: block; text-align: center;"><img src="https://plot.ly/~thalesians/244.png" alt="GBPUSD during UK gen elect - Lab wins&lt;br&gt;Source: @thalesians/BBG/Wikipedia" style="max-width: 100%;" onerror="this.onerror=null;this.src='https://plot.ly/404.png';" /></a> <script data-plotly="thalesians:244" src="https://plot.ly/embed.js" async></script> </div> We next plot GBP/USD over Conservative wins. In this instance, however, we have a graduated 'Blues' color scheme, given obviously that blue is the color of the Conserative party in the UK! ``` ###### Plot market reaction during Conservative UK election wins ###### Using varying shades of blue for each line (helped by colorlover library) title = ticker + ' during UK gen elect - Con wins ' + '<BR>' + source_label # also apply graduated color scheme of blues (from light to dark) # see http://moderndata.plot.ly/color-scales-in-ipython-notebook/ for details on colorlover package # which allows you to set scales fig = Figure(data=event_plot.convert_df_plotly(conservative_wins_spot, gradcolor='Blues', addmarker=False), layout=event_plot.create_layout(title, xaxis, yaxis), ) plot_url = py.iplot(fig, filename='conservative-wins-' + ticker) ``` Embed the chart into the document using "embed". This essentially embeds the Javascript code, necessary to make it interactive. ``` import plotly.tools as tls tls.embed("https://plot.ly/~thalesians/245") ``` Our final plot, will consist of three subplots, Labour wins, Conservative wins, and average moves for both. We also add a grid and a grey background for each plot. ``` ##### Plot market reaction during Conservative UK election wins ##### create a plot consisting of 3 subplots (from left to right) ##### 1. Labour wins, 2. Conservative wins, 3. Conservative/Labour mean move # create a dataframe which grabs the mean from the respective Lab & Con election wins mean_wins_spot = pandas.DataFrame() mean_wins_spot['Labour Mean'] = labour_wins_spot['Labour Mean'] mean_wins_spot['Conservative Mean'] = conservative_wins_spot['Conservative Mean'] fig = plotly.tools.make_subplots(rows=1, cols=3) # apply different color scheme (red = Lab, blue = Con) # also add markets, which will have varying levels of opacity fig['data'] += Data( event_plot.convert_df_plotly(conservative_wins_spot, axis_no=1, color_def=['blue'], addmarker=True) + event_plot.convert_df_plotly(labour_wins_spot, axis_no=2, color_def=['red'], addmarker=True) + event_plot.convert_df_plotly(mean_wins_spot, axis_no=3, color_def=['red', 'blue'], addmarker=True, showlegend = False) ) fig['layout'].update(title=ticker + ' during UK gen elects by winning party ' + '<BR>' + source_label) # use the scheme from https://plot.ly/python/bubble-charts-tutorial/ # can use dict approach, rather than specifying each separately axis_style = dict( gridcolor='#FFFFFF', # white grid lines ticks='outside', # draw ticks outside axes ticklen=8, # tick length tickwidth=1.5 # and width ) # create the various axes for the three separate charts fig['layout'].update(xaxis1=plotly.graph_objs.XAxis(axis_style, title=xaxis)) fig['layout'].update(yaxis1=plotly.graph_objs.YAxis(axis_style, title=yaxis)) fig['layout'].update(xaxis2=plotly.graph_objs.XAxis(axis_style, title=xaxis)) fig['layout'].update(yaxis2=plotly.graph_objs.YAxis(axis_style)) fig['layout'].update(xaxis3=plotly.graph_objs.XAxis(axis_style, title=xaxis)) fig['layout'].update(yaxis3=plotly.graph_objs.YAxis(axis_style)) fig['layout'].update(plot_bgcolor='#EFECEA') # set plot background to grey plot_url = py.iplot(fig, filename='labour-conservative-wins-'+ ticker + '-subplot') ``` This time we use "embed", which grab the plot from Plotly's server, we did earlier (given we have already uploaded it). ``` import plotly.tools as tls tls.embed("https://plot.ly/~thalesians/246") ``` <B>That's about it!</B> I hope the code I've written proves fruitful for creating some very cool Plotly plots and also for doing some very timely analysis ahead of the UK general election! Hoping this will be first of many blogs on using Plotly data. The analysis in this blog is based on a report I wrote for Thalesians, a quant finance thinktank. If you are interested in getting access to the full copy of the report (Thalesians: My kingdom for a vote - The definitive quant guide to UK general elections), feel free to e-mail me at <b>saeed@thalesians.com</b> or tweet me <b>@thalesians</b> ## Want to hear more about global macro and UK election developments? If you're interested in FX and the UK general election, come to our Thalesians panel in London on April 29th 2015 at 7.30pm in Canary Wharf, which will feature, Eric Burroughs (Reuters - FX Buzz Editor), Mark Cudmore (Bloomberg - First Word EM Strategist), Jordan Rochester (Nomura - FX strategist), Jeremy Wilkinson-Smith (Independent FX trader) and myself as the moderator. Tickets are available [here](http://www.meetup.com/thalesians/events/221147156/) ## Biography <b>Saeed Amen</b> is the managing director and co-founder of the Thalesians. He has a decade of experience creating and successfully running systematic trading models at Lehman Brothers, Nomura and now at the Thalesians. Independently, he runs a systematic trading model with proprietary capital. He is the author of Trading Thalesians – What the ancient world can teach us about trading today (Palgrave Macmillan). He graduated with a first class honours master’s degree from Imperial College in Mathematics & Computer Science. He is also a fan of Python and has written an extensive library for financial market backtesting called PyThalesians. <BR> Follow the Thalesians on Twitter @thalesians and get my book on Amazon [here](http://www.amazon.co.uk/Trading-Thalesians-Saeed-Amen/dp/113739952X) All the code here is available to download from the [Thalesians GitHub page](https://github.com/thalesians/pythalesians) ``` from IPython.display import display, HTML display(HTML('<link href="//fonts.googleapis.com/css?family=Open+Sans:600,400,300,200|Inconsolata|Ubuntu+Mono:400,700" rel="stylesheet" type="text/css" />')) display(HTML('<link rel="stylesheet" type="text/css" href="http://help.plot.ly/documentation/all_static/css/ipython-notebook-custom.css">')) ! pip install publisher --upgrade import publisher publisher.publish( 'ukelectionbbg.ipynb', 'ipython-notebooks/ukelectionbbg/', 'Plotting GBP/USD price action around UK general elections', 'Create interactive graphs with market data, IPython Notebook and Plotly', name='Plot MP Action in GBP/USD around UK General Elections') ```
github_jupyter
``` import pandas as pd #This is the Richmond USGS Data gage river_richmnd = pd.read_csv('JR_Richmond02037500.csv') river_richmnd.dropna(); #Hurricane data for the basin - Names of Relevant Storms - This will be used for getting the storms from the larger set JR_stormnames = pd.read_csv('gis_match.csv') # Bring in the Big HURDAT data, from 1950 forward (satellites and data quality, etc.) HURDAT = pd.read_csv('hurdatcleanva_1950_present.csv') VA_JR_stormmatch = JR_stormnames.merge(HURDAT) # Now the common storms for the James Basin have been created. We now have time and storms together for the basin #checking some things about the data # How many unique storms within the basin since 1950? 62 here and 53 in the Data on the Coast.NOAA.gov's website. #I think we are close enough here, digging may show some other storms, but I think we have at least captured the ones #from NOAA len(VA_JR_stormmatch['Storm Number'].unique()); #double ck the lat and long parameters print(VA_JR_stormmatch['Lat'].min(), VA_JR_stormmatch['Lon'].min(), VA_JR_stormmatch['Lat'].max(), VA_JR_stormmatch['Lon'].max()) #Make a csv of this data VA_JR_stormmatch.to_csv('storms_in_basin.csv', sep=',',encoding = 'utf-8') #names of storms len(VA_JR_stormmatch['Storm Number'].unique()) VA_JR_stormmatch['Storm Number'].unique() numbers = VA_JR_stormmatch['Storm Number'] #grab a storm from this list and lok at the times #Bill = pd.DataFrame(VA_JR_stormmatch['Storm Number'=='AL032003']) storm = VA_JR_stormmatch[(VA_JR_stormmatch["Storm Number"] == 'AL142018')] storm #so this is the data for a storm named Bill that had a pth through the basin * BILL WAS A BACKDOOR Storm # plotting for the USGS river Gage data import matplotlib import matplotlib.pyplot as plt from climata.usgs import DailyValueIO from datetime import datetime from pandas.plotting import register_matplotlib_converters import numpy as np register_matplotlib_converters() plt.style.use('ggplot') plt.rcParams['figure.figsize'] = (20.0, 10.0) # set parameters nyears = 1 ndays = 365 * nyears station_id = "02037500" param_id = "00060" datelist = pd.date_range(end=datetime.today(), periods=ndays).tolist() #take an annual average for the river annual_data = DailyValueIO( start_date="2018-01-01", end_date="2019-01-01", station=station_id, parameter=param_id,) for series in annual_data: flow = [r[1] for r in series.data] si_flow_annual = np.asarray(flow) * 0.0283168 flow_mean = np.mean(si_flow_annual) #now for the storm dischg = DailyValueIO( start_date="2018-10-09", end_date="2018-10-25", station=station_id, parameter=param_id,) #create lists of date-flow values for series in dischg: flow = [r[1] for r in series.data] si_flow = np.asarray(flow) * 0.0283168 dates = [r[0] for r in series.data] plt.plot(dates, si_flow) plt.axhline(y=flow_mean, color='r', linestyle='-') plt.xlabel('Date') plt.ylabel('Discharge (m^3/s)') plt.title("EX Michael - 2018 (Gulf)") plt.xticks(rotation='vertical') plt.show() max(si_flow) percent_incr= (abs(max(si_flow)-flow_mean)/abs(flow_mean))*100 percent_incr #take an annual average for the river annual_data = DailyValueIO( start_date="2018-03-01", end_date="2018-10-01", station=station_id, parameter=param_id,) for series in annual_data: flow = [r[1] for r in series.data] si_flow_annual = np.asarray(flow) * 0.0283168 flow_mean_season = np.mean(si_flow_annual) print(abs(flow_mean-flow_mean_season)) ```
github_jupyter
# Amazon SageMaker - Debugging with custom rules [Amazon SageMaker](https://aws.amazon.com/sagemaker/) is managed platform to build, train and host maching learning models. Amazon SageMaker Debugger is a new feature which offers the capability to debug machine learning models during training by identifying and detecting problems with the models in near real-time. In this notebook, we'll show you how to use a custom rule to monitor your training job. All through a tf.keras ResNet example. ## How does Amazon SageMaker Debugger work? Amazon SageMaker Debugger lets you go beyond just looking at scalars like losses and accuracies during training and gives you full visibility into all tensors 'flowing through the graph' during training. Furthermore, it helps you monitor your training in near real-time using rules and provides you alerts, once it has detected inconsistency in training flow. ### Concepts * **Tensors**: These represent the state of the training network at intermediate points during its execution * **Debug Hook**: Hook is the construct with which Amazon SageMaker Debugger looks into the training process and captures the tensors requested at the desired step intervals * **Rule**: A logical construct, implemented as Python code, which helps analyze the tensors captured by the hook and report anomalies, if at all With these concepts in mind, let's understand the overall flow of things that Amazon SageMaker Debugger uses to orchestrate debugging. ### Saving tensors during training The tensors captured by the debug hook are stored in the S3 location specified by you. There are two ways you can configure Amazon SageMaker Debugger to save tensors: #### With no changes to your training script If you use one of the Amazon SageMaker provided [Deep Learning Containers](https://docs.aws.amazon.com/sagemaker/latest/dg/pre-built-containers-frameworks-deep-learning.html) for 1.15, then you don't need to make any changes to your training script for the tensors to be stored. Amazon SageMaker Debugger will use the configuration you provide through the Amazon SageMaker SDK's Tensorflow `Estimator` when creating your job to save the tensors in the fashion you specify. You can review the script we are going to use at [src/tf_keras_resnet_zerocodechange.py](src/tf_keras_resnet_zerocodechange.py). You will note that this is an untouched TensorFlow Keras script which uses the `tf.keras` interface. Please note that Amazon SageMaker Debugger only supports `tf.keras`, `tf.estimator` and `tf.MonitoredSession` interfaces for the zero script change experience. Full description of support is available at [Amazon SageMaker Debugger with TensorFlow](https://github.com/awslabs/sagemaker-debugger/tree/master/docs/tensorflow.md) #### Orchestrating your script to store tensors For other containers, you need to make couple of lines of changes to your training script. Amazon SageMaker Debugger exposes a library `smdebug` which allows you to capture these tensors and save them for analysis. It's highly customizable and allows to save the specific tensors you want at different frequencies and possibly with other configurations. Refer [DeveloperGuide](https://github.com/awslabs/sagemaker-debugger/tree/master/docs) for details on how to use Amazon SageMaker Debugger library with your choice of framework in your training script. Here we have an example script orchestrated at [src/tf_keras_resnet_byoc.py](src/tf_keras_resnet_byoc.py). In addition to this, you will need to ensure that your container has the `smdebug` library installed in this case, and specify your container image URI when creating the SageMaker Estimator below. Please refer [SageMaker Documentation](https://sagemaker.readthedocs.io/en/stable/sagemaker.tensorflow.html) on how to do that. ### Analysis of tensors Amazon SageMaker Debugger can be configured to run debugging ***Rules*** on the tensors saved from the training job. At a very broad level, a rule is Python code used to detect certain conditions during training. Some of the conditions that a data scientist training an algorithm may care about are monitoring for gradients getting too large or too small, detecting overfitting, and so on. Amazon SageMaker Debugger comes pre-packaged with certain built-in rules. Users can write their own rules using the APIs provided by Amazon SageMaker Debugger through the `smdebug` library. You can also analyze raw tensor data outside of the Rules construct in say, a SageMaker notebook, using these APIs. Please refer [Analysis Developer Guide](https://github.com/awslabs/sagemaker-debugger/blob/master/docs/api.md) for more on these APIs. ## Training TensorFlow Keras models with Amazon SageMaker Debugger ### Amazon SageMaker TensorFlow as a framework Train a TensorFlow Keras model in this notebook with Amazon Sagemaker Debugger enabled and monitor the training jobs with rules. This is done using Amazon SageMaker [TensorFlow 1.15.0](https://docs.aws.amazon.com/sagemaker/latest/dg/pre-built-containers-frameworks-deep-learning.html) Container as a framework ``` import boto3 import os import sagemaker from sagemaker.tensorflow import TensorFlow ``` Import the libraries needed for the demo of Amazon SageMaker Debugger. ``` from sagemaker.debugger import Rule, DebuggerHookConfig, TensorBoardOutputConfig, CollectionConfig import smdebug_rulesconfig as rule_configs ``` Now define the entry point for the training script ``` # define the entrypoint script entrypoint_script='src/tf_keras_resnet_zerocodechange.py' ``` ### Setting up the Estimator Now it's time to setup our SageMaker TensorFlow Estimator. There are new parameters with the estimator to enable your training job for debugging through Amazon SageMaker Debugger. These new parameters are explained below * **debugger_hook_config**: This new parameter accepts a local path where you wish your tensors to be written to and also accepts the S3 URI where you wish your tensors to be uploaded to. It also accepts CollectionConfigurations which specify which tensors will be saved from the training job. * **rules**: This new parameter will accept a list of rules you wish to evaluate against the tensors output by this training job. For rules, Amazon SageMaker Debugger supports two types of rules * **Amazon SageMaker Rules**: These are rules curated by the Amazon SageMaker team and you can choose to evaluate them against your training job. * **Custom Rules**: You can optionally choose to write your own rule as a Python source file and have it evaluated against your training job. To provide SageMaker Debugger to evaluate this rule, you would have to provide the S3 location of the rule source and the evaluator image. #### Creating your own custom rule Let us look at how you can create your custom rule briefly before proceeding to use it with your training job. Please see the [documentation](https://github.com/awslabs/sagemaker-debugger/blob/master/docs/analysis.md) to learn more about structuring your rules and other related concepts. ##### **Summary of what the custom rule evaluates** For demonstration purposes, below is a rule that tries to track whether gradients are too large. The custom rule looks at the tensors in the collection "gradients" saved during training and attempt to get the absolute value of the gradients in each step of the training. If the mean of the absolute values of gradients in any step is greater than a specified threshold, mark the rule as 'triggering'. Let us look at how to structure the rule source. Any custom rule logic you want to be evaluated should extend the `Rule` interface provided by Amazon SageMaker Debugger ```python from smdebug.rules.rule import Rule class CustomGradientRule(Rule): ``` Now implement the class methods for the rule. Doing this allows Amazon SageMaker to understand the intent of the rule and evaluate it against your training tensors. ##### Rule class constructor In order for Amazon SageMaker to instantiate your rule, your rule class constructor must conform to the following signature. ```python def __init__(self, base_trial, other_trials, <other parameters>) ``` ###### Arguments - `base_trial (Trial)`: This defines the primary [Trial](https://github.com/awslabs/sagemaker-debugger/blob/master/docs/analysis.md#trial) that your rule is anchored to. This is an object of class type `Trial`. - `other_trials (list[Trial])`: *(Optional)* This defines a list of 'other' trials you want your rule to look at. This is useful in the scenarios when you're comparing tensors from the base_trial to tensors from some other trials. - `<other parameters>`: This is similar to `**kwargs` where you can pass in however many string parameters in your constructor signature. Note that SageMaker would only be able to support supplying string types for these values at runtime (see how, later). ##### Defining the rule logic to be invoked at each step: This defines the logic to invoked for each step. Essentially, this is where you decide whether the rule should trigger or not. In this case, you're concerned about the gradients getting too large. So, get the [tensor reduction](https://github.com/awslabs/sagemaker-debugger/blob/master/docs/analysis.md#reduction_value) "mean" for each step and see if it's value is larger than a threshold. ```python def invoke_at_step(self, step): for tname in self.base_trial.tensor_names(collection="gradients"): t = self.base_trial.tensor(tname) abs_mean = t.reduction_value(step, "mean", abs=True) if abs_mean > self.threshold: return True return False ``` #### Using your custom rule with SageMaker Estimator Below we create the rule configuration using the `Rule.custom` method, and then pass it to the SageMaker TensorFlow estimator to kick off the job. Note that you need to pass the rule evaluator container image for custom rules. Please refer AWS Documentation on SageMaker documentation to find the image URI for your region. We will soon have this be automatically taken care of by the SageMaker SDK. You can also provide your own image, please refer to [this repository](https://github.com/awslabs/sagemaker-debugger-rules-container) for instructions on how to build such a container. ``` custom_rule = Rule.custom( name='MyCustomRule', # used to identify the rule # rule evaluator container image image_uri='759209512951.dkr.ecr.us-west-2.amazonaws.com/sagemaker-debugger-rule-evaluator:latest', instance_type='ml.t3.medium', # instance type to run the rule evaluation on source='rules/my_custom_rule.py', # path to the rule source file rule_to_invoke='CustomGradientRule', # name of the class to invoke in the rule source file volume_size_in_gb=30, # EBS volume size required to be attached to the rule evaluation instance collections_to_save=[CollectionConfig("gradients")], # collections to be analyzed by the rule. since this is a first party collection we fetch it as above rule_parameters={ "threshold": "20.0" # this will be used to intialize 'threshold' param in your constructor } ) ``` Before you proceed and create our training job, let us take a closer look at the parameters used to create the Rule configuration above: * `name`: This is used to identify this particular rule among the suite of rules you specified to be evaluated. * `image_uri`: This is the image of the container that has the logic of understanding your custom rule sources and evaluating them against the collections you save in the training job. You can get the list of open sourced SageMaker rule evaluator images [here]() * `instance_type`: The type of the instance you want to run the rule evaluation on * `source`: This is the local path or the Amazon S3 URI of your rule source file. * `rule_to_invoke`: This specifies the particular Rule class implementation in your source file which you want to be evaluated. SageMaker supports only 1 rule to be evaluated at a time in a rule job. Your source file can have multiple Rule class implementations, though. * `collections_to_save`: This specifies which collections are necessary to be saved for this rule to run. Note that providing this collection does not necessarily mean the rule will actually use these collections. You might want to take such parameters for the rule through the next argument `rule_parameters`. * `rule_parameters`: This provides the runtime values of the parameter in your constructor. You can still choose to pass in other values which may be necessary for your rule to be evaluated. Any value in this map is available as an environment variable and can be accessed by your rule script using `$<rule_parameter_key>` You can read more about custom rule evaluation in Amazon SageMaker in this [documentation](https://github.com/awslabs/sagemaker-debugger/blob/master/docs/analysis.md) Let us now create the estimator and call `fit()` on our estimator to start the training job and rule evaluation job in parallel. ``` estimator = TensorFlow( role=sagemaker.get_execution_role(), base_job_name='smdebug-custom-rule-demo-tf-keras', train_instance_count=1, train_instance_type='ml.p2.xlarge', entry_point=entrypoint_script, framework_version='1.15', py_version='py3', train_max_run=3600, script_mode=True, ## New parameter rules = [custom_rule] ) # After calling fit, Amazon SageMaker starts one training job and one rule job for you. # The rule evaluation status is visible in the training logs # at regular intervals estimator.fit(wait=False) ``` ## Result As a result of calling the `fit(wait=False)`, two jobs were kicked off in the background. Amazon SageMaker Debugger kicked off a rule evaluation job for our custom gradient logic in parallel with the training job. You can review the status of the above rule job as follows. ``` import time status = estimator.latest_training_job.rule_job_summary() while status[0]['RuleEvaluationStatus'] == 'InProgress': status = estimator.latest_training_job.rule_job_summary() print(status) time.sleep(10) ``` Once the rule job starts and you see the RuleEvaluationJobArn above, we can see the logs for the rule job in Cloudwatch. To do that, we'll use this utlity function to get a link to the rule job logs. ``` def _get_rule_job_name(training_job_name, rule_configuration_name, rule_job_arn): """Helper function to get the rule job name with correct casing""" return "{}-{}-{}".format( training_job_name[:26], rule_configuration_name[:26], rule_job_arn[-8:] ) def _get_cw_url_for_rule_job(rule_job_name, region): return "https://{}.console.aws.amazon.com/cloudwatch/home?region={}#logStream:group=/aws/sagemaker/ProcessingJobs;prefix={};streamFilter=typeLogStreamPrefix".format(region, region, rule_job_name) def get_rule_jobs_cw_urls(estimator): training_job = estimator.latest_training_job training_job_name = training_job.describe()["TrainingJobName"] rule_eval_statuses = training_job.describe()["DebugRuleEvaluationStatuses"] result={} for status in rule_eval_statuses: if status.get("RuleEvaluationJobArn", None) is not None: rule_job_name = _get_rule_job_name(training_job_name, status["RuleConfigurationName"], status["RuleEvaluationJobArn"]) result[status["RuleConfigurationName"]] = _get_cw_url_for_rule_job(rule_job_name, boto3.Session().region_name) return result get_rule_jobs_cw_urls(estimator) ```
github_jupyter
# Bayesian Hierarchical Linear Regression Author: [Carlos Souza](mailto:souza@gatech.edu) Probabilistic Machine Learning models can not only make predictions about future data, but also **model uncertainty**. In areas such as **personalized medicine**, there might be a large amount of data, but there is still a relatively **small amount of data for each patient**. To customize predictions for each person it becomes necessary to **build a model for each person** — with its inherent **uncertainties** — and to couple these models together in a **hierarchy** so that information can be borrowed from other **similar people** [1]. The purpose of this tutorial is to demonstrate how to **implement a Bayesian Hierarchical Linear Regression model using NumPyro**. To motivate the tutorial, I will use [OSIC Pulmonary Fibrosis Progression](https://www.kaggle.com/c/osic-pulmonary-fibrosis-progression) competition, hosted at Kaggle. ## 1. Understanding the task Pulmonary fibrosis is a disorder with no known cause and no known cure, created by scarring of the lungs. In this competition, we were asked to predict a patient’s severity of decline in lung function. Lung function is assessed based on output from a spirometer, which measures the forced vital capacity (FVC), i.e. the volume of air exhaled. In medical applications, it is useful to **evaluate a model's confidence in its decisions**. Accordingly, the metric used to rank the teams was designed to reflect **both the accuracy and certainty of each prediction**. It's a modified version of the Laplace Log Likelihood (more details on that later). Let's explore the data and see what's that all about: ``` !pip install -q numpyro@git+https://github.com/pyro-ppl/numpyro arviz import pandas as pd import numpy as np import seaborn as sns import matplotlib.pyplot as plt train = pd.read_csv( "https://gist.githubusercontent.com/ucals/" "2cf9d101992cb1b78c2cdd6e3bac6a4b/raw/" "43034c39052dcf97d4b894d2ec1bc3f90f3623d9/" "osic_pulmonary_fibrosis.csv" ) train.head() ``` In the dataset, we were provided with a baseline chest CT scan and associated clinical information for a set of patients. A patient has an image acquired at time Week = 0 and has numerous follow up visits over the course of approximately 1-2 years, at which time their FVC is measured. For this tutorial, I will use only the Patient ID, the weeks and the FVC measurements, discarding all the rest. Using only these columns enabled our team to achieve a competitive score, which shows the power of Bayesian hierarchical linear regression models especially when gauging uncertainty is an important part of the problem. Since this is real medical data, the relative timing of FVC measurements varies widely, as shown in the 3 sample patients below: ``` def chart(patient_id, ax): data = train[train["Patient"] == patient_id] x = data["Weeks"] y = data["FVC"] ax.set_title(patient_id) ax = sns.regplot(x, y, ax=ax, ci=None, line_kws={"color": "red"}) f, axes = plt.subplots(1, 3, figsize=(15, 5)) chart("ID00007637202177411956430", axes[0]) chart("ID00009637202177434476278", axes[1]) chart("ID00010637202177584971671", axes[2]) ``` On average, each of the 176 provided patients made 9 visits, when FVC was measured. The visits happened in specific weeks in the [-12, 133] interval. The decline in lung capacity is very clear. We see, though, they are very different from patient to patient. We were are asked to predict every patient's FVC measurement for every possible week in the [-12, 133] interval, and the confidence for each prediction. In other words: we were asked fill a matrix like the one below, and provide a confidence score for each prediction: <img src="https://i.ibb.co/0Z9kW8H/matrix-completion.jpg" alt="drawing" width="600"/> The task was perfect to apply Bayesian inference. However, the vast majority of solutions shared by Kaggle community used discriminative machine learning models, disconsidering the fact that most discriminative methods are very poor at providing realistic uncertainty estimates. Because they are typically trained in a manner that optimizes the parameters to minimize some loss criterion (e.g. the predictive error), they do not, in general, encode any uncertainty in either their parameters or the subsequent predictions. Though many methods can produce uncertainty estimates either as a by-product or from a post-processing step, these are typically heuristic based, rather than stemming naturally from a statistically principled estimate of the target uncertainty distribution [2]. ## 2. Modelling: Bayesian Hierarchical Linear Regression with Partial Pooling The simplest possible linear regression, not hierarchical, would assume all FVC decline curves have the same $\alpha$ and $\beta$. That's the **pooled model**. In the other extreme, we could assume a model where each patient has a personalized FVC decline curve, and **these curves are completely unrelated**. That's the **unpooled model**, where each patient has completely separate regressions. Here, I'll use the middle ground: **Partial pooling**. Specifically, I'll assume that while $\alpha$'s and $\beta$'s are different for each patient as in the unpooled case, **the coefficients all share similarity**. We can model this by assuming that each individual coefficient comes from a common group distribution. The image below represents this model graphically: <img src="https://i.ibb.co/H7NgBfR/Artboard-2-2x-100.jpg" alt="drawing" width="600"/> Mathematically, the model is described by the following equations: \begin{align} \mu_{\alpha} &\sim \mathcal{N}(0, 100) \\ \sigma_{\alpha} &\sim |\mathcal{N}(0, 100)| \\ \mu_{\beta} &\sim \mathcal{N}(0, 100) \\ \sigma_{\beta} &\sim |\mathcal{N}(0, 100)| \\ \alpha_i &\sim \mathcal{N}(\mu_{\alpha}, \sigma_{\alpha}) \\ \beta_i &\sim \mathcal{N}(\mu_{\beta}, \sigma_{\beta}) \\ \sigma &\sim \mathcal{N}(0, 100) \\ FVC_{ij} &\sim \mathcal{N}(\alpha_i + t \beta_i, \sigma) \end{align} where *t* is the time in weeks. Those are very uninformative priors, but that's ok: our model will converge! Implementing this model in NumPyro is pretty straightforward: ``` import numpyro from numpyro.infer import MCMC, NUTS, Predictive import numpyro.distributions as dist from jax import random assert numpyro.__version__.startswith("0.8.0") def model(PatientID, Weeks, FVC_obs=None): μ_α = numpyro.sample("μ_α", dist.Normal(0.0, 100.0)) σ_α = numpyro.sample("σ_α", dist.HalfNormal(100.0)) μ_β = numpyro.sample("μ_β", dist.Normal(0.0, 100.0)) σ_β = numpyro.sample("σ_β", dist.HalfNormal(100.0)) unique_patient_IDs = np.unique(PatientID) n_patients = len(unique_patient_IDs) with numpyro.plate("plate_i", n_patients): α = numpyro.sample("α", dist.Normal(μ_α, σ_α)) β = numpyro.sample("β", dist.Normal(μ_β, σ_β)) σ = numpyro.sample("σ", dist.HalfNormal(100.0)) FVC_est = α[PatientID] + β[PatientID] * Weeks with numpyro.plate("data", len(PatientID)): numpyro.sample("obs", dist.Normal(FVC_est, σ), obs=FVC_obs) ``` That's all for modelling! ## 3. Fitting the model A great achievement of Probabilistic Programming Languages such as NumPyro is to decouple model specification and inference. After specifying my generative model, with priors, condition statements and data likelihood, I can leave the hard work to NumPyro's inference engine. Calling it requires just a few lines. Before we do it, let's add a numerical Patient ID for each patient code. That can be easily done with scikit-learn's LabelEncoder: ``` from sklearn.preprocessing import LabelEncoder le = LabelEncoder() train["PatientID"] = le.fit_transform(train["Patient"].values) FVC_obs = train["FVC"].values Weeks = train["Weeks"].values PatientID = train["PatientID"].values ``` Now, calling NumPyro's inference engine: ``` nuts_kernel = NUTS(model) mcmc = MCMC(nuts_kernel, num_samples=2000, num_warmup=2000) rng_key = random.PRNGKey(0) mcmc.run(rng_key, PatientID, Weeks, FVC_obs=FVC_obs) posterior_samples = mcmc.get_samples() ``` ## 4. Checking the model ### 4.1. Inspecting the learned parameters First, let's inspect the parameters learned. To do that, I will use [ArviZ](https://arviz-devs.github.io/arviz/), which perfectly integrates with NumPyro: ``` import arviz as az data = az.from_numpyro(mcmc) az.plot_trace(data, compact=True); ``` Looks like our model learned personalized alphas and betas for each patient! ### 4.2. Visualizing FVC decline curves for some patients Now, let's visually inspect FVC decline curves predicted by our model. We will completely fill in the FVC table, predicting all missing values. The first step is to create a table to fill: ``` pred_template = [] for i in range(train["Patient"].nunique()): df = pd.DataFrame(columns=["PatientID", "Weeks"]) df["Weeks"] = np.arange(-12, 134) df["PatientID"] = i pred_template.append(df) pred_template = pd.concat(pred_template, ignore_index=True) ``` Predicting the missing values in the FVC table and confidence (sigma) for each value becomes really easy: ``` PatientID = pred_template["PatientID"].values Weeks = pred_template["Weeks"].values predictive = Predictive(model, posterior_samples, return_sites=["σ", "obs"]) samples_predictive = predictive(random.PRNGKey(0), PatientID, Weeks, None) ``` Let's now put the predictions together with the true values, to visualize them: ``` df = pd.DataFrame(columns=["Patient", "Weeks", "FVC_pred", "sigma"]) df["Patient"] = le.inverse_transform(pred_template["PatientID"]) df["Weeks"] = pred_template["Weeks"] df["FVC_pred"] = samples_predictive["obs"].T.mean(axis=1) df["sigma"] = samples_predictive["obs"].T.std(axis=1) df["FVC_inf"] = df["FVC_pred"] - df["sigma"] df["FVC_sup"] = df["FVC_pred"] + df["sigma"] df = pd.merge( df, train[["Patient", "Weeks", "FVC"]], how="left", on=["Patient", "Weeks"] ) df = df.rename(columns={"FVC": "FVC_true"}) df.head() ``` Finally, let's see our predictions for 3 patients: ``` def chart(patient_id, ax): data = df[df["Patient"] == patient_id] x = data["Weeks"] ax.set_title(patient_id) ax.plot(x, data["FVC_true"], "o") ax.plot(x, data["FVC_pred"]) ax = sns.regplot(x, data["FVC_true"], ax=ax, ci=None, line_kws={"color": "red"}) ax.fill_between(x, data["FVC_inf"], data["FVC_sup"], alpha=0.5, color="#ffcd3c") ax.set_ylabel("FVC") f, axes = plt.subplots(1, 3, figsize=(15, 5)) chart("ID00007637202177411956430", axes[0]) chart("ID00009637202177434476278", axes[1]) chart("ID00011637202177653955184", axes[2]) ``` The results are exactly what we expected to see! Highlight observations: - The model adequately learned Bayesian Linear Regressions! The orange line (learned predicted FVC mean) is very inline with the red line (deterministic linear regression). But most important: it learned to predict uncertainty, showed in the light orange region (one sigma above and below the mean FVC line) - The model predicts a higher uncertainty where the data points are more disperse (1st and 3rd patients). Conversely, where the points are closely grouped together (2nd patient), the model predicts a higher confidence (narrower light orange region) - Finally, in all patients, we can see that the uncertainty grows as the look more into the future: the light orange region widens as the # of weeks grow! ### 4.3. Computing the modified Laplace Log Likelihood and RMSE As mentioned earlier, the competition was evaluated on a modified version of the Laplace Log Likelihood. In medical applications, it is useful to evaluate a model's confidence in its decisions. Accordingly, the metric is designed to reflect both the accuracy and certainty of each prediction. For each true FVC measurement, we predicted both an FVC and a confidence measure (standard deviation $\sigma$). The metric was computed as: \begin{align} \sigma_{clipped} &= max(\sigma, 70) \\ \delta &= min(|FVC_{true} - FVC_{pred}|, 1000) \\ metric &= -\dfrac{\sqrt{2}\delta}{\sigma_{clipped}} - \ln(\sqrt{2} \sigma_{clipped}) \end{align} The error was thresholded at 1000 ml to avoid large errors adversely penalizing results, while the confidence values were clipped at 70 ml to reflect the approximate measurement uncertainty in FVC. The final score was calculated by averaging the metric across all (Patient, Week) pairs. Note that metric values will be negative and higher is better. Next, we calculate the metric and RMSE: ``` y = df.dropna() rmse = ((y["FVC_pred"] - y["FVC_true"]) ** 2).mean() ** (1 / 2) print(f"RMSE: {rmse:.1f} ml") sigma_c = y["sigma"].values sigma_c[sigma_c < 70] = 70 delta = (y["FVC_pred"] - y["FVC_true"]).abs() delta[delta > 1000] = 1000 lll = -np.sqrt(2) * delta / sigma_c - np.log(np.sqrt(2) * sigma_c) print(f"Laplace Log Likelihood: {lll.mean():.4f}") ``` What do these numbers mean? It means if you adopted this approach, you would **outperform most of the public solutions** in the competition. Curiously, the vast majority of public solutions adopt a standard deterministic Neural Network, modelling uncertainty through a quantile loss. **Most of the people still adopt a frequentist approach**. **Uncertainty** for single predictions becomes more and more important in machine learning and is often a requirement. **Especially when the consequenses of a wrong prediction are high**, we need to know what the probability distribution of an individual prediction is. For perspective, Kaggle just launched a new competition sponsored by Lyft, to build motion prediction models for self-driving vehicles. "We ask that you predict a few trajectories for every agent **and provide a confidence score for each of them**." Finally, I hope the great work done by Pyro/NumPyro developers help democratize Bayesian methods, empowering an ever growing community of researchers and practitioners to create models that can not only generate predictions, but also assess uncertainty in their predictions. ## References 1. Ghahramani, Z. Probabilistic machine learning and artificial intelligence. Nature 521, 452–459 (2015). https://doi.org/10.1038/nature14541 2. Rainforth, Thomas William Gamlen. Automating Inference, Learning, and Design Using Probabilistic Programming. University of Oxford, 2017.
github_jupyter
# 1- Importing libraries ``` import ast import json import requests import numpy as np import pandas as pd import seaborn as sns import matplotlib.pyplot as plt %matplotlib inline from matplotlib.ticker import StrMethodFormatter from matplotlib.dates import DateFormatter from sklearn.preprocessing import MinMaxScaler from tensorflow.keras.models import Sequential from tensorflow.keras.layers import Activation, Dense, Dropout, LSTM from sklearn import metrics ``` # 2- Getting real-time crptocurrency data ``` #!/usr/bin/python # -*- coding: utf-8 -*- import requests def run_query(query): # A simple function to use requests.post to make the API call. headers = {'X-API-KEY': 'BQYjLXSsm32NnV6FM4eudu9xYt2L3AsW'} request = requests.post('https://graphql.bitquery.io/', json={'query': query}, headers=headers) if request.status_code == 200: return request.json() else: raise Exception('Query failed and return code is {}. {}'.format(request.status_code, query)) # The GraphQL query query = """ query { ethereum(network: ethereum) { dexTrades( options: {limit: 100000, asc: "timeInterval.minute"} date: {since: "2021-04-21"} exchangeName: {is: "Uniswap"} baseCurrency: {is: "0xdac17f958d2ee523a2206206994597c13d831ec7"} quoteCurrency: {is: "0xc02aaa39b223fe8d0a0e5c4f27ead9083c756cc2"} ) { timeInterval { minute(count: 5) } baseCurrency { symbol address } baseAmount quoteCurrency { symbol address } quoteAmount trades: count quotePrice maximum_price: quotePrice(calculate: maximum) minimum_price: quotePrice(calculate: minimum) open_price: minimum(of: block, get: quote_price) close_price: maximum(of: block, get: quote_price) } } } """ result = run_query(query) # Execute the query data=pd.DataFrame(result['data']['ethereum']['dexTrades']) data.tail(2) ``` # 3- Data cleaning ``` data.isnull().sum() time=[] for x in range(0, data.shape[0]): time.append(data['timeInterval'].iloc[x]['minute']) data['timeInterval']= time data.head(2) type(data['close_price'].iloc[0]) data['close_price']= data['close_price'].apply(lambda x: float(x)) type(data['close_price'].iloc[0]) ``` # 4- Setting time as index ``` data=data.set_index('timeInterval') data.head(2) ``` # 5- Converting time to timestamp ``` type(data.index[0]) data.index=pd.to_datetime(data.index) type(data.index[0]) data.shape ``` # 6- Splitting train & test sets ``` def train_test_split(df, test_size): split = df.shape[0] - int(test_size * df.shape[0]) train_set = df.iloc[:split] test_set = df.iloc[split:] return train_set, test_set train_set, test_set =train_test_split(data, 0.3) #checked test size 0.2 but the result for 0.3 is better print('train_set.shape: ', train_set.shape) print('test_set.shape: ', test_set.shape) ``` # 7- Plotting train & test sets ``` plt.figure(figsize=(13,7)) train_set['close_price'].plot(color='b') test_set['close_price'].plot(color='r') plt.xlabel('Time', fontsize=14) plt.ylabel('Close Price ', fontsize=14) plt.gca().yaxis.set_major_formatter(StrMethodFormatter('{x:,.6f}')) plt.legend(['Train', 'Test'], loc='best',fontsize=14 ) plt.show() ``` # 9- Normalizing data- zero scaling ``` def zero_scaling(df): return df / df.iloc[0] - 1 def sliding_window(df, len_window, zero): window = [] for a in range(df.shape[0] - len_window): sub = df[a: (a + len_window)].copy() if zero: sub = zero_scaling(sub) window.append(sub.values) return np.array(window) def prepare_data(df, column, len_window, zero): train_data = train_set[[column]] test_data = test_set[[column]] X_train = sliding_window(train_data, len_window, zero) X_test = sliding_window(test_data, len_window, zero) y_train = train_data[column][len_window:].values y_test = test_data[column][len_window:].values if zero: y_train = y_train / train_data[column][:-len_window].values - 1 y_test = y_test / test_data[column][:-len_window].values - 1 return train_data, test_data, X_train, X_test, y_train, y_test train_data, test_data, X_train, X_test, y_train, y_test = prepare_data(data, 'close_price', len_window=5, zero=True) X_train.shape ``` # 10- Building LSTM model- 2 layers ``` model_1 = Sequential() #use input_shape (tuple of integers) when using this layer as the first layer in a model model_1.add(LSTM(units=100, input_shape=(X_train.shape[1], X_train.shape[2])) ) model_1.add(Dropout(0.2)) model_1.add(Dense(units=1 )) # tedade noroun ha model_1.add(Activation('linear')) #activation ra besoorate layer joda add konim natije behtar ast model_1.compile(loss='mse', optimizer='adam') # Fitting to the training set model_1.fit(X_train,y_train,epochs=30,batch_size=32) pd.DataFrame(model_1.history.history).plot(figsize=(8,6)) plt.xlabel('Epoch', fontsize=12) plt.ylabel('Loss', fontsize=12) plt.title('Training Loss Per Epoch', fontsize=14) plt.show() prediction_1=model_1.predict(X_test).squeeze() # use squeeze to convert to 1d array assert (len(prediction_1)==len(y_test)) plt.figure(figsize=(8,5)) plt.plot(y_test, y_test, color='b') plt.scatter(y_test, prediction_1, color='r') plt.xlabel('y_test', fontsize=12) plt.ylabel('Prediction', fontsize=12) plt.title('Close Price Prediction, 2-Layer Model, zero scaling', fontsize=14) plt.show() print('Mean Absolute Error: ', metrics.mean_absolute_error(y_test, prediction_1)) predicted_close_price_1= pd.DataFrame(data=(prediction_1 + 1) * (test_data['close_price'][:-5].values) , index=test_data[5:].index ,columns=['predicted_close_price'] ) predicted_close_price_1; merged_1=pd.merge(test_data, predicted_close_price_1, on='timeInterval', how='left') merged_1[5:] merged_1.isnull().sum() plt.figure(figsize=(13,7)) merged_1['close_price'].plot(color='r') merged_1['predicted_close_price'].plot(color='g') plt.title('Close Price Prediction, 2-Layer Model, Zero Scaling',fontsize=16) plt.xlabel('Time', fontsize=13) plt.ylabel('Close Price', fontsize=13) plt.legend(['Actual Close Price', 'Predicted Close Price'], loc='best',fontsize=13) plt.gca().yaxis.set_major_formatter(StrMethodFormatter('{x:,.6f}')) plt.show() ``` # 11- Predicting on brand new data ``` #size of the data we use to predict should always be at least one unit bigger than window_len from random import randint def rand(len_window, df): return randint(len_window + 1 , df.shape[0]) random_shape=rand(5, data) random_shape new=data[['close_price']].iloc[0: random_shape] sliding_window(new, 5, True); prediction=model_1.predict(sliding_window(new, 5, True)).squeeze() assert(len(prediction)==len( new['close_price'][:-5])) predicted_close_price= pd.DataFrame(data=(prediction + 1) * (new['close_price'][:-5].values) , index=new[5:].index ,columns=['predicted close'] ) pd.merge(new, predicted_close_price, on='timeInterval', how='left')[5:] ``` # 12- Backup scenarios ### 12-1- LSTM model- 6 layers + zero scaling ``` # The LSTM architecture model_2 = Sequential() # First LSTM layer with Dropout regularisation #default activation` == `tanh` #default recurrent_activation == sigmoid. #return_sequences: Boolean. Whether to return the last output.Default: `False`. model_2.add(LSTM(units=50, return_sequences=True, input_shape=(X_train.shape[1],X_train.shape[2]))) model_2.add(Dropout(0.2)) # Second LSTM layer model_2.add(LSTM(units=50, return_sequences=True)) model_2.add(Dropout(0.2)) # Third LSTM layer model_2.add(LSTM(units=50, return_sequences=True)) model_2.add(Dropout(0.2)) # Fourth LSTM layer model_2.add(LSTM(units=50)) model_2.add(Dropout(0.2)) # The output layer model_2.add(Dense(units=1)) # Compiling the RNN model_2.compile(optimizer='rmsprop',loss='mean_squared_error') # Fitting to the training set model_2.fit(X_train,y_train,epochs=30,batch_size=32) pd.DataFrame(model_2.history.history).plot(figsize=(8,6)) plt.xlabel('Epoch', fontsize=12) plt.ylabel('Loss', fontsize=12) plt.title('Training Loss Per Epoch', fontsize=14) plt.show() prediction_2=model_2.predict(X_test).squeeze() # use squeeze to convert to 1d array assert (len(prediction_2)==len(y_test)) plt.figure(figsize=(8,5)) plt.plot(y_test, y_test, color='b') plt.scatter(y_test, prediction_2, color='r') plt.xlabel('y_test', fontsize=12) plt.ylabel('Prediction', fontsize=12) plt.title('Close Price Prediction, 6-Layer Model, zero scaling', fontsize=14) plt.show() print('Mean Absolute Error: ', metrics.mean_absolute_error(y_test, prediction_2)) predicted_close_price_2= pd.DataFrame(data=(prediction_2 + 1) * (test_data['close_price'][:-5].values) , index=test_data[5:].index ,columns=['predicted_close_price'] ) predicted_close_price_2; merged_2=pd.merge(test_data, predicted_close_price_2, on='timeInterval', how='left') merged_2; plt.figure(figsize=(13,7)) merged_2['close_price'].plot(color='r') merged_2['predicted_close_price'].plot(color='g') plt.title('Close Price Prediction, 6-Layer Model, Zero Scaling',fontsize=16) plt.xlabel('Time', fontsize=13) plt.ylabel('Close Price', fontsize=13) plt.gca().yaxis.set_major_formatter(StrMethodFormatter('{x:,.6f}')) plt.legend(['Actual Close Price', 'Predicted Close Price'], loc='best',fontsize=13) plt.show() ``` ### 12-2- LSTM model- 2 layers + MinMaxScaler ``` train_data = train_set[['close_price']] test_data = test_set[['close_price']] train_data_values=train_data.values test_data_values=test_data.values #Scaling/Normalizing the whole Training set sc = MinMaxScaler(feature_range=(0,1)) train_data_values_scaled = sc.fit_transform(train_data_values) # Since LSTMs store long term memory state, we create a data structure with 5 timesteps and 1 output # So for each element of training set, we have 5 previous training set elements X_train = [] y_train = [] for i in range(5,train_data_values.shape[0]): X_train.append(train_data_values_scaled[i-5:i,0]) #window up to y_train.append(train_data_values_scaled[i,0]) #one value after the window X_train, y_train = np.array(X_train), np.array(y_train) print(X_train.shape) print(y_train.shape) # Reshaping X_train for efficient modelling X_train=X_train.reshape(X_train.shape[0],X_train.shape[1],1) X_train.shape model_3 = Sequential() #use input_shape (tuple of integers) when using this layer as the first layer in a model model_3.add(LSTM(units=100, input_shape=(X_train.shape[1], X_train.shape[2])) ) model_3.add(Dropout(0.2)) model_3.add(Dense(units=1 )) model_3.add(Activation('linear')) model_3.compile(loss='mse', optimizer='adam') # Fitting to the training set model_3.fit(X_train,y_train,epochs=30,batch_size=32) pd.DataFrame(model_3.history.history).plot(figsize=(8,6)) plt.xlabel('Epoch', fontsize=12) plt.ylabel('Loss', fontsize=12) plt.title('Training Loss Per Epoch', fontsize=14) plt.show() test_data_values_scaled = sc.fit_transform(test_data_values) # we only do transfrom on test set not fit X_test = [] y_test = [] for i in range(5,test_set.shape[0]): X_test.append(test_data_values_scaled[i-5:i,0]) #yek panjereh ja tayi ta sare y_test.append(test_data_values_scaled[i,0]) #tak element bade panjere X_test, y_test = np.array(X_test), np.array(y_test) X_test.shape X_test=X_test.reshape(X_test.shape[0],X_test.shape[1],1) X_test.shape prediction_3=model_3.predict(X_test) #do not use squeeze, otherwise will get error in inverse scaler assert (len(prediction_3)==len(y_test)) plt.figure(figsize=(8,5)) plt.plot(y_test, y_test, color='b') plt.scatter(y_test, prediction_3, color='r') plt.xlabel('y_test', fontsize=12) plt.ylabel('Prediction', fontsize=12) plt.title('Close Price Prediction, 2-Layer Model, MinMax scaling', fontsize=14) plt.show() print('Mean Absolute Error: ', metrics.mean_absolute_error(y_test, prediction_3)) predicted_close_price_3 = sc.inverse_transform(prediction_3) predicted_close_price_3= pd.DataFrame(data= predicted_close_price_3, index=test_set[5:].index ,columns=['predicted_close_price'] ) predicted_close_price_3; merged_3=pd.merge(test_data, predicted_close_price_3, on='timeInterval', how='left') merged_3 merged_3.isnull().sum() plt.figure(figsize=(13,7)) merged_3['close_price'].plot(color='r') merged_3['predicted_close_price'].plot(color='g') plt.title('Close Price Prediction, 2-Layer Model, MinMax Scaling',fontsize=16) plt.xlabel('Time', fontsize=13) plt.ylabel('Close Price', fontsize=13) plt.gca().yaxis.set_major_formatter(StrMethodFormatter('{x:,.6f}')) plt.legend(['Actual Close Price', 'Predicted Close Price'], loc='best',fontsize=13) plt.show() ``` # 13- Conclusion Based on the Mean Absolute Error values and Close Price Prediction plots, the 2-layer predictive model executed on the data normalized by zero_scaling function has the best performance.
github_jupyter
<a href="https://colab.research.google.com/github/st24hour/tutorial/blob/master/Neural_Style_Transfer_with_Eager_Execution_question.ipynb" target="_parent"><img src="https://colab.research.google.com/assets/colab-badge.svg" alt="Open In Colab"/></a> # Neural Style Transfer with tf.keras ## Overview 이 튜토리얼에서 우리는 딥러닝을 사용하여 다른 이미지의 스타일로 이미지를 구성하는 방법을 배우게됩니다 (피카소나 반 고흐처럼 그릴 수 있기를 바란 적 있습니까?). 이것은 **neural style transfer**라고 알려져 있습니다. 이것은 Leon A. Gatys의 논문 인 [A Neural Algorithm of Artistic Style](https://arxiv.org/abs/1508.06576)에 설명되어 있으며 반드시 읽어 봐야합니다. 그런데, neural style transfer가 무엇일까요? Neural style transfer는 3 가지 이미지, **콘텐츠** 이미지, **스타일 참조** 이미지 (유명한 화가의 작품 등) 및 원하는 **입력 이미지** 를 사용하는 최적화 기술입니다: 입력 이미지가 콘텐츠 이미지처럼 보이도록 변형되지만 스타일 이미지의 스타일처럼 "색칠"되도록 서로 섞습니다. 예를 들어, 이 거북이와 Katsushika Hokusai의 이미지 *The Great Wave off Kanagawa*를 봅시다. <img src="https://github.com/tensorflow/models/blob/master/research/nst_blogpost/Green_Sea_Turtle_grazing_seagrass.jpg?raw=1" alt="Drawing" style="width: 200px;"/> <img src="https://github.com/tensorflow/models/blob/master/research/nst_blogpost/The_Great_Wave_off_Kanagawa.jpg?raw=1" alt="Drawing" style="width: 200px;"/> [Image of Green Sea Turtle](https://commons.wikimedia.org/wiki/File:Green_Sea_Turtle_grazing_seagrass.jpg) -By P.Lindgren [CC BY-SA 3.0 (https://creativecommons.org/licenses/by-sa/3.0)], from Wikimedia Common Hokusai가 거북이의 그림을 자신의 스타일로 그리기로 결정했다면 어떻게 될까요? 이와 같을까요? <img src="https://github.com/tensorflow/models/blob/master/research/nst_blogpost/wave_turtle.png?raw=1" alt="Drawing" style="width: 500px;"/> Neural style transfer는 신경 네트워크의 기능과 내부 표현을 보여주는 재미있고 흥미로운 기술입니다. Neural style transfer의 원리는 두 이미지의 내용이 얼마나 다른지, $L_{content}$, 두 이미지의 스타일이 얼마나 다른지, $L_{ style}$를 표현하는 두 거리 함수를 정의하는 것입니다. 그 다음, 3 개의 이미지, 원하는 스타일 이미지, 원하는 컨텐츠 이미지 및 입력 이미지 (컨텐츠 이미지로 초기화 됨)가 주어지면 입력 이미지를 콘텐츠 이미지와 콘텐츠 거리가 최소화 되도록, 스타일 이미지와 스타일 거리가 최소화 되도록 변환합니다. 요약하면 기본 입력 이미지, 일치시킬 콘텐츠 이미지 및 일치시키고자하는 스타일 이미지를 사용합니다. 우리는 backpropagation으로 컨텐츠 및 스타일 거리 (losses)를 최소화하고 컨텐츠 이미지의 컨텐츠 및 스타일 이미지의 스타일과 일치하는 이미지를 만듭니다. ### 다루게 될 개념들: 이 튜토리얼에서 우리는 실제 경험을 쌓고 다음 개념을 중심으로 실습할 것입니다. * **Eager Execution** - Operation을 즉각적으로 평가하는 TensorFlow의 imperative programming 환경 사용 * [Learn more about eager execution](https://www.tensorflow.org/programmers_guide/eager) * [See it in action](https://www.tensorflow.org/get_started/eager) * **모델 정의를 위해 [Functional API](https://keras.io/getting-started/functional-api-guide/) 사용** - Functional API를 사용하여 필요한 중간 activations에 대한 액세스를 제공 할 모델을 만들 것입니다. * **Pretrained model의 feature를 활용** - Pretrained된 모델과 그 feature map을 사용하는 방법을 배웁니다. * **Custom training loops 구현** - 입력 parameter와 관련된 주어진 손실을 최소화하기 위해 optimizer를 설정하는 방법을 살펴 보겠습니다. ### Style transfer의 일반적인 단계들 : 1. Visualize data 2. Basic Preprocessing/preparing our data 3. Set up loss functions 4. Create model 5. Optimize for loss function ## Setup ### Download Images ``` import os img_dir = '/tmp/nst' if not os.path.exists(img_dir): os.makedirs(img_dir) !wget --quiet -P /tmp/nst/ https://upload.wikimedia.org/wikipedia/commons/d/d7/Green_Sea_Turtle_grazing_seagrass.jpg !wget --quiet -P /tmp/nst/ https://upload.wikimedia.org/wikipedia/commons/0/0a/The_Great_Wave_off_Kanagawa.jpg !wget --quiet -P /tmp/nst/ https://upload.wikimedia.org/wikipedia/commons/b/b4/Vassily_Kandinsky%2C_1913_-_Composition_7.jpg !wget --quiet -P /tmp/nst/ https://upload.wikimedia.org/wikipedia/commons/0/00/Tuebingen_Neckarfront.jpg !wget --quiet -P /tmp/nst/ https://upload.wikimedia.org/wikipedia/commons/6/68/Pillars_of_creation_2014_HST_WFC3-UVIS_full-res_denoised.jpg !wget --quiet -P /tmp/nst/ https://upload.wikimedia.org/wikipedia/commons/thumb/e/ea/Van_Gogh_-_Starry_Night_-_Google_Art_Project.jpg/1024px-Van_Gogh_-_Starry_Night_-_Google_Art_Project.jpg ``` ### Import and configure modules ``` import matplotlib.pyplot as plt import matplotlib as mpl mpl.rcParams['figure.figsize'] = (10,10) mpl.rcParams['axes.grid'] = False import numpy as np from PIL import Image import time import functools import tensorflow as tf import tensorflow.contrib.eager as tfe from tensorflow.python.keras.preprocessing import image as kp_image from tensorflow.python.keras import models from tensorflow.python.keras import losses from tensorflow.python.keras import layers from tensorflow.python.keras import backend as K ``` 우리는 [eager execution](https://www.tensorflow.org/guide/eager)을 가능하게 하는 것으로 시작할 것입니다. Eager execution은 우리가 가장 명확하고 가장 판독 가능한 방식으로 작업할 수 있게 해줍니다. ``` """ Start eager execution """ print("Eager execution: {}".format(tf.executing_eagerly())) # Set up some global values here content_path = '/tmp/nst/Green_Sea_Turtle_grazing_seagrass.jpg' style_path = '/tmp/nst/The_Great_Wave_off_Kanagawa.jpg' ``` ## Visualize the input ``` def load_img(path_to_img): max_dim = 512 img = Image.open(path_to_img) long = max(img.size) scale = max_dim/long img = img.resize((round(img.size[0]*scale), round(img.size[1]*scale)), Image.ANTIALIAS) img = kp_image.img_to_array(img) # We need to broadcast the image array such that it has a batch dimension img = np.expand_dims(img, axis=0) return img def imshow(img, title=None): # Remove the batch dimension out = np.squeeze(img, axis=0) # Normalize for display out = out.astype('uint8') plt.imshow(out) if title is not None: plt.title(title) plt.imshow(out) ``` 이들은 콘텐츠 및 스타일 입력 이미지입니다. 우리는 콘텐츠 이미지의 콘텐츠로 이미지를 "생성"하지만 스타일 이미지의 스타일을 사용하기를 바랍니다. ``` plt.figure(figsize=(10,10)) content = load_img(content_path).astype('uint8') style = load_img(style_path).astype('uint8') plt.subplot(1, 2, 1) imshow(content, 'Content Image') plt.subplot(1, 2, 2) imshow(style, 'Style Image') plt.show() ``` ## Prepare the data 이미지를 쉽게 로드하고 사전 처리 할 수있는 메소드를 만들어 봅시다. 우리는 VGG 학습 과정과 동일한 전처리 과정을 수행합니다. VGG 네트워크는 각 채널이 `mean = [103.939, 116.779, 123.68]` 및 채널 BGR로 normalize 된 이미지로 학습됩니다. ``` def load_and_process_img(path_to_img): img = load_img(path_to_img) img = tf.keras.applications.vgg19.preprocess_input(img) return img ``` 최적화의 결과를 보기 위해서 우리는 역 사전 처리 단계를 수행해야합니다. 또한 최적화 된 이미지는 $- \infty$에서 $- \infty$ 사이의 값을 가질 수 있으므로 0-255 범위에서 값을 유지하려면 clip해야합니다. ``` def deprocess_img(processed_img): x = processed_img.copy() if len(x.shape) == 4: x = np.squeeze(x, 0) assert len(x.shape) == 3, ("Input to deprocess image must be an image of " "dimension [1, height, width, channel] or [height, width, channel]") if len(x.shape) != 3: raise ValueError("Invalid input to deprocessing image") # perform the inverse of the preprocessiing step x[:, :, 0] += 103.939 x[:, :, 1] += 116.779 x[:, :, 2] += 123.68 x = x[:, :, ::-1] x = np.clip(x, 0, 255).astype('uint8') return x ``` ### Define content and style representations 이미지의 콘텐츠 표현과 스타일 표현을 모두 얻으려면 우리 모델에서 중간 layer를 살펴볼 것입니다. 이러한 중간 layer는 고차원 feature를 나타냅니다. 우리는 이미지 분류에서 pretrained된 VGG19 네트워크를 사용할 것입니다. 이러한 중간 layer는 이미지의 콘텐츠 및 스타일 표현을 정의하는 데 필요합니다. 입력 이미지를 이러한 중간 layer에서 해당 스타일 및 내용 타겟 표현과 일치 시키도록 할 것입니다. #### Why intermediate layers? 미리 학습된 이미지 분류 네트워크에서 이러한 중간 결과물로 스타일과 컨텐츠 표현을 정의 할 수 있는 이유가 궁금 할 수 있습니다. High level에서 이 현상은 네트워크가 이미지 분류를 수행하기 위해 (네트워크가 수행하도록 훈련 된) 이미지를 이해해야한다는 사실로 설명 할 수 있습니다. 여기에는 raw 이미지를 입력으로 사용하여 raw 이미지 내에있는 복잡한 피쳐를 이해하는 것으로 바뀌는 변환을 통해 내부 표현을 만드는 작업이 포함됩니다. 이것은 컨벌루션 뉴럴 네트워크가 잘 일반화 될 수있는 이유 중 일부입니다. 배경 노이즈 및 기타 배경과 같은 부분에 상관없이 클래스 (예 : 고양이 vs. 개) 내에서 불변하는 특징을 정의 할 수 있습니다. 따라서 원본 이미지가 입력되고 분류 레이블이 출력되는 곳 사이의 어떤 곳에서 모델은 복잡한 피쳐 추출기로 사용됩니다. 따라서 중간 레이어에 액세스하여 입력 이미지의 내용과 스타일을 설명 할 수 있습니다. 특히 네트워크에서 다음과 같은 중간 계층을 가져옵니다. 참고: VGG19 architecture <img src="https://www.researchgate.net/profile/Clifford_Yang/publication/325137356/figure/fig2/AS:670371271413777@1536840374533/llustration-of-the-network-architecture-of-VGG-19-model-conv-means-convolution-FC-means.jpg" alt="Drawing" style="width: 200px;"/> ``` # Content layer where will pull our feature maps content_layers = ['block5_conv2'] # Style layer we are interested in style_layers = ['block1_conv1', 'block2_conv1', 'block3_conv1', 'block4_conv1', 'block5_conv1' ] num_content_layers = len(content_layers) num_style_layers = len(style_layers) ``` ## Build the Model 우리는 [VGG19](https://keras.io/applications/#vgg19)를 불러오고 우리의 입력 tensor를 모델에 입력으로 줄 것입니다. 이것은 콘텐츠, 스타일, 그리고 생성하는 이미지의 feature map (내용 및 스타일 표현)을 추출할 수 있도록 해줍니다. 원래의 논문에서와 같이 VGG19 네트워크를 이용할 것입니다. 또한 VGG19는 ResNet, Inception 등과 비교하면 비교적 단순한 모델이므로 feature map이 실제로 스타일 이전에 더 효과적입니다. 우리의 스타일 및 콘텐츠 feature map에 해당하는 중간 layer의 출력을 얻을 것이며, Keras [**Functional API**](https://keras.io/getting-started/functional-api-guide/)를 사용하여 모델이 원하는 출력을 하도록 정의합니다. 모델을 정의하는 Functional API를 사용하면 단순히 입력 및 출력을 정의 할 수 있습니다. `model = Model(inputs, outputs)` 참고: [tf.keras.applications.vgg19.VGG19()](https://keras.io/applications/#vgg19) ``` def get_model(): """ Creates our model with access to intermediate layers. This function will load the VGG19 model and access the intermediate layers. These layers will then be used to create a new model that will take input image and return the outputs from these intermediate layers from the VGG model. Returns: returns a keras model that takes image inputs and outputs the style and content intermediate layers. """ # Load our model. We load pretrained VGG, trained on imagenet data """ Load Imagenet pretrained VGG19 network. You don't need to load FC layers vgg = """ vgg.trainable = False # Get output layers corresponding to style and content layers style_outputs = [vgg.get_layer(name).output for name in style_layers] content_outputs = [vgg.get_layer(name).output for name in content_layers] model_outputs = style_outputs + content_outputs # Build model return models.Model(vgg.input, model_outputs) ``` 위의 코드에서 pretrained된 이미지 분류 네트워크를 로드합니다. 그런 다음 이전에 정의한 관심있는 layer를 불러옵니다. 그런 다음 모델의 입력을 이미지로 설정하고 출력을 스타일 및 콘텐츠 레이어의 출력으로 설정하여 모델을 정의합니다. 즉, 입력 이미지를 가져와 콘텐츠 및 스타일 중간 레이어를 출력하는 모델을 만들었습니다. ## Define and create our loss functions (content and style distances) ### Content Loss 우리의 콘텐츠 loss 정의는 실제로 매우 간단합니다. 원하는 콘텐츠 이미지와 기본 입력 이미지를 네트워크에 전달합니다. 이렇게하면 모델에서 출력되는 중간 레이어 출력 (위에 정의 된 레이어에서)이 반환됩니다. 그런 다음 우리는 단순히 그 이미지들의 두 중간 representation 사이의 유클리드 거리를 취합니다. 보다 공식적으로, 콘텐츠 손실은 출력 이미지 $x$와 콘텐츠 이미지 $p$에서 콘텐츠까지의 거리를 설명하는 함수입니다. $ C_{nn} $은 미리 훈련 된 deep convolutional neural network라고 합시다. 우리는 [VGG19](https://keras.io/applications/#vgg19)를 사용할 것입니다. $X$를 임의의 이미지라고 하면 $C_{nn}(X)$ 는 네트워크에 X를 넣은 것입니다. $F^l_{ij}(x) \in C_{nn}(x)$ 와 $P^l_{ij}(p) \in C_{nn}(p)$ 를 각각 입력으로 $x$ 와 $p$ 를 넣었을때 layer $l$ 에서의 중간 feature representation이라고 합시다. 그리면 우리는 콘텐츠 거리(loss)를 수식적으로 다음과 같이 정의 할 수 있습니다: $$L^l_{content}(p, x) = \sum_{i, j} (F^l_{ij}(x) - P^l_{ij}(p))^2$$ 우리는 일반적인 방식으로 backpropagation을 수행하여 이러한 콘텐츠 loss를 최소화합니다. 따라서 특정 레이어 (content_layer에 정의 됨)에서 원본 콘텐츠 이미지와 같은 응답을 생성 할 때까지 초기 이미지를 변경합니다. 이것은 매우 간단하게 구현 될 수 있습니다. 입력 이미지 $x$, 그리고 우리의 콘텐트 이미지 $p$를 입력으로 받은 네트워크의 레이어 $l$에서 feature map을 입력으로 받아서 컨텐츠 거리를 반환합니다. ### Computing content loss 실제로 원하는 각 레이어에서 콘텐츠 loss를 추가 할 것입니다. 이 방법은 우리가 모델을 통해 입력 이미지를 공급할 때마다 (eager에서는 단순하게 `model(input_image)`입니다!) 모델을 통한 모든 컨텐츠 손실이 적절하게 계산 될 것이고 eager로 실행하기 때문에 모든 gradients가 계산됩니다 . ``` def get_content_loss(base_content, target): return tf.reduce_mean(tf.square(base_content - target)) ``` ### Style Loss 스타일 loss 계산은 좀 더 복잡하지만 동일한 원칙을 따르며, 이번에는 네트워크에 기본 입력 이미지와 스타일 이미지를 입력으로 줍니다. 그러나 기본 입력 이미지와 스타일 이미지의 중간 출력을 그대로 비교하는 대신 두 출력의 Gram matrix를 비교합니다. 수학적으로, 우리는 기본 입력 이미지 $x$와 스타일 이미지 $a$의 style loss를 두 이미지의 스타일 표현(gram matrix)의 거리로 정의합니다. 우리는 이미지의 스타일 표현을 gram matrix $G^l$로 주어지는 서로 다른 필터 응답의 correlation으로 설명합니다. 여기서 $G^l_{ij}$는 벡터화 된 feature map $i$와 $j$의 내적 (inner product) 입니다. 우리는 특정 이미지의 feature map에서 생성된 $G^l_{ij}$가 feature map $i$와 $j$ 사이의 correlation을 나타낸다는 것을 알 수 있습니다. 기본 입력 이미지의 스타일을 생성하기 위해 콘텐츠 이미지에서 gradient descent를 수행하여 스타일 이미지의 스타일 표현과 일치하는 이미지로 변환합니다.이를 위해 스타일 이미지와 입력 이미지 사이의 mean square 거리를 최소화하도록 만듭니다. 총 스타일 손실에 대한 각 layer의 contribution은 다음과 같습니다: $$E_l = \frac{1}{4N_l^2M_l^2} \sum_{i,j}(G^l_{ij} - A^l_{ij})^2$$ $G^l_{ij}$ 와 $A^l_{ij}$는 각각 layer $l$에서 $x$ 와 $a$의 스타일 표현입니다. $N_l$는 각 사이즈가 $M_l = height * width$인 feature map 수를 나타냅니다. 따라서 전체 스타일 loss는 $$L_{style}(a, x) = \sum_{l \in L} w_l E_l$$ 입니다. 여기서 우리는 각 layer의 loss contribution을 $w_l$로 가중치 주었습니다. 우리의 경우에 각 layer를 동일하게 가중치 주었습니다($w_l =\frac{1}{|L|}$). ### Total loss 만들고자하는 이미지는 콘텐츠 이미지와 $L_{content}$가 작고 스타일 이미지와 $L_{style}$이 작아지도록 하는 이미지입니다. 따라서 전체 목적 함수(loss)는 다음과 같습니다: $$L_{total}(p, a, x) = \alpha L_{content}(p, x)+\beta L_{style}(a, x)$$ $\alpha$와 $\beta$는 각각 콘텐트와 스타일 loss에 곱해지는 weight 값 입니다. ### Computing style loss 이번에도 style loss를 거리 metric으로 구현합니다. get_style_loss는 $E_l$을 구하는 함수입니다. ``` def gram_matrix(input_tensor): # We make the image channels first channels = int(input_tensor.shape[-1]) a = tf.reshape(input_tensor, [-1, channels]) n = tf.shape(a)[0] gram = tf.matmul(a, a, transpose_a=True) return gram / tf.cast(n, tf.float32) def get_style_loss(base_style, gram_target): """Expects two images of dimension h, w, c""" # height, width, num filters of each layer # We scale the loss at a given layer by the size of the feature map and the number of filters height, width, channels = base_style.get_shape().as_list() gram_style = gram_matrix(base_style) return tf.reduce_mean(tf.square(gram_style - gram_target))# / (4. * (channels ** 2) * (width * height) ** 2) ``` ## Apply style transfer to our images ### Run Gradient Descent 우리는 loss를 최소화하기 위해 [Adam](https://www.tensorflow.org/api_docs/python/tf/keras/optimizers/Adam)* optimizer를 사용합니다. 반복적으로 출력 이미지를 업데이트하여 loss를 최소화합니다. 네트워크와 관련된 weight를 업데이트하지 않고 대신 입력 이미지를 조정하여 loss를 최소화합니다. 이를 위해서는 loss와 gradients를 계산하는 방법을 알아야합니다. 우리는 콘텐츠와 스타일 이미지를 불러오고, 네트워크를 통해 feed forward하며, 모델에서 콘텐츠 및 스타일 feature representation을 출력하는 작은 도우미 함수를 정의 할 것입니다. ``` def get_feature_representations(model, content_path, style_path): """Helper function to compute our content and style feature representations. This function will simply load and preprocess both the content and style images from their path. Then it will feed them through the network to obtain the outputs of the intermediate layers. Arguments: model: The model that we are using. content_path: The path to the content image. style_path: The path to the style image Returns: returns the style features and the content features. """ # Load our images in content_image = load_and_process_img(content_path) style_image = load_and_process_img(style_path) # batch compute content and style features style_outputs = model(style_image) content_outputs = model(content_image) # Get the style and content feature representations from our model style_features = [style_layer[0] for style_layer in style_outputs[:num_style_layers]] content_features = [content_layer[0] for content_layer in content_outputs[num_style_layers:]] return style_features, content_features ``` ### Computing the loss and gradients 여기서는 [**tf.GradientTape**](https://www.tensorflow.org/programmers_guide/eager#computing_gradients)을 사용하여 gradient를 계산합니다. 나중에 gradient를 계산하기위한 operation을 추적하여 자동 미분화를 가능하게 합니다. Forward pass중에 작업을 기록한 다음 backward pass시에 입력 이미지에 대하여 loss 함수의 gradient를 계산할 수 있습니다. ``` def compute_loss(model, loss_weights, init_image, gram_style_features, content_features): """This function will compute the loss total loss. Arguments: model: The model that will give us access to the intermediate layers loss_weights: The weights of each contribution of each loss function. (style weight, content weight, and total variation weight) init_image: Our initial base image. This image is what we are updating with our optimization process. We apply the gradients wrt the loss we are calculating to this image. gram_style_features: Precomputed gram matrices corresponding to the defined style layers of interest. content_features: Precomputed outputs from defined content layers of interest. Returns: returns the total loss, style loss, content loss, and total variational loss """ style_weight, content_weight = loss_weights # Feed our init image through our model. This will give us the content and # style representations at our desired layers. Since we're using eager # our model is callable just like any other function! model_outputs = model(init_image) style_output_features = model_outputs[:num_style_layers] content_output_features = model_outputs[num_style_layers:] style_score = 0 content_score = 0 # Accumulate style losses from all layers # Here, we equally weight each contribution of each loss layer weight_per_style_layer = 1.0 / float(num_style_layers) for target_style, comb_style in zip(gram_style_features, style_output_features): style_score += weight_per_style_layer * get_style_loss(comb_style[0], target_style) # Accumulate content losses from all layers weight_per_content_layer = 1.0 / float(num_content_layers) for target_content, comb_content in zip(content_features, content_output_features): content_score += weight_per_content_layer* get_content_loss(comb_content[0], target_content) style_score *= style_weight content_score *= content_weight # Get total loss loss = style_score + content_score return loss, style_score, content_score ``` Gradients를 구하는 것은 쉽습니다: ``` def compute_grads(cfg): with tf.GradientTape() as tape: all_loss = compute_loss(**cfg) # Compute gradients wrt input image total_loss = all_loss[0] return tape.gradient(total_loss, cfg['init_image']), all_loss ``` ### Optimization loop [Adam optimizer](https://www.tensorflow.org/api_docs/python/tf/train/AdamOptimizer) ``` import IPython.display def run_style_transfer(content_path, style_path, num_iterations=1000, content_weight=1e3, style_weight=1e-2): # We don't need to (or want to) train any layers of our model, so we set their # trainable to false. model = get_model() for layer in model.layers: layer.trainable = False # Get the style and content feature representations (from our specified intermediate layers) style_features, content_features = get_feature_representations(model, content_path, style_path) gram_style_features = [gram_matrix(style_feature) for style_feature in style_features] # Set initial image init_image = load_and_process_img(content_path) init_image = tfe.Variable(init_image, dtype=tf.float32) # Create our optimizer opt = tf.train.AdamOptimizer(learning_rate=5, beta1=0.99, epsilon=1e-1) # For displaying intermediate images iter_count = 1 # Store our best result best_loss, best_img = float('inf'), None # Create a nice config loss_weights = (style_weight, content_weight) cfg = { 'model': model, 'loss_weights': loss_weights, 'init_image': init_image, 'gram_style_features': gram_style_features, 'content_features': content_features } # For displaying num_rows = 2 num_cols = 5 display_interval = num_iterations/(num_rows*num_cols) start_time = time.time() global_start = time.time() norm_means = np.array([103.939, 116.779, 123.68]) min_vals = -norm_means max_vals = 255 - norm_means imgs = [] for i in range(num_iterations): grads, all_loss = compute_grads(cfg) loss, style_score, content_score = all_loss """ Apply_gradients """ clipped = tf.clip_by_value(init_image, min_vals, max_vals) init_image.assign(clipped) end_time = time.time() if loss < best_loss: # Update best loss and best image from total loss. best_loss = loss best_img = deprocess_img(init_image.numpy()) if i % display_interval== 0: start_time = time.time() # Use the .numpy() method to get the concrete numpy array plot_img = init_image.numpy() plot_img = deprocess_img(plot_img) imgs.append(plot_img) IPython.display.clear_output(wait=True) IPython.display.display_png(Image.fromarray(plot_img)) # NumPy 배열을 Image 객체로 변환 print('Iteration: {}'.format(i)) print('Total loss: {:.4e}, ' 'style loss: {:.4e}, ' 'content loss: {:.4e}, ' 'time: {:.4f}s'.format(loss, style_score, content_score, time.time() - start_time)) print('Total time: {:.4f}s'.format(time.time() - global_start)) IPython.display.clear_output(wait=True) plt.figure(figsize=(14,4)) for i,img in enumerate(imgs): plt.subplot(num_rows,num_cols,i+1) plt.imshow(img) plt.xticks([]) plt.yticks([]) return best_img, best_loss best, best_loss = run_style_transfer(content_path, style_path, num_iterations=1000) Image.fromarray(best) ``` ## Visualize outputs 우리는 출력 이미지에 적용된 processing을 제거하기 위해 출력 이미지를 "deprocess"합니다. ``` def show_results(best_img, content_path, style_path, show_large_final=True): plt.figure(figsize=(10, 5)) content = load_img(content_path) style = load_img(style_path) plt.subplot(1, 2, 1) imshow(content, 'Content Image') plt.subplot(1, 2, 2) imshow(style, 'Style Image') if show_large_final: plt.figure(figsize=(10, 10)) plt.imshow(best_img) plt.title('Output Image') plt.show() show_results(best, content_path, style_path) ``` ## Try it on other images Image of Tuebingen Photo By: Andreas Praefcke [GFDL (http://www.gnu.org/copyleft/fdl.html) or CC BY 3.0 (https://creativecommons.org/licenses/by/3.0)], from Wikimedia Commons ### Starry night + Tuebingen ``` best_starry_night, best_loss = run_style_transfer('/tmp/nst/Tuebingen_Neckarfront.jpg', '/tmp/nst/1024px-Van_Gogh_-_Starry_Night_-_Google_Art_Project.jpg') show_results(best_starry_night, '/tmp/nst/Tuebingen_Neckarfront.jpg', '/tmp/nst/1024px-Van_Gogh_-_Starry_Night_-_Google_Art_Project.jpg') ``` ### Pillars of Creation + Tuebingen ``` best_poc_tubingen, best_loss = run_style_transfer('/tmp/nst/Tuebingen_Neckarfront.jpg', '/tmp/nst/Pillars_of_creation_2014_HST_WFC3-UVIS_full-res_denoised.jpg') show_results(best_poc_tubingen, '/tmp/nst/Tuebingen_Neckarfront.jpg', '/tmp/nst/Pillars_of_creation_2014_HST_WFC3-UVIS_full-res_denoised.jpg') ``` ### Kandinsky Composition 7 + Tuebingen ``` best_kandinsky_tubingen, best_loss = run_style_transfer('/tmp/nst/Tuebingen_Neckarfront.jpg', '/tmp/nst/Vassily_Kandinsky,_1913_-_Composition_7.jpg') show_results(best_kandinsky_tubingen, '/tmp/nst/Tuebingen_Neckarfront.jpg', '/tmp/nst/Vassily_Kandinsky,_1913_-_Composition_7.jpg') ``` ### Pillars of Creation + Sea Turtle ``` best_poc_turtle, best_loss = run_style_transfer('/tmp/nst/Green_Sea_Turtle_grazing_seagrass.jpg', '/tmp/nst/Pillars_of_creation_2014_HST_WFC3-UVIS_full-res_denoised.jpg') show_results(best_poc_turtle, '/tmp/nst/Green_Sea_Turtle_grazing_seagrass.jpg', '/tmp/nst/Pillars_of_creation_2014_HST_WFC3-UVIS_full-res_denoised.jpg') ``` ## 주요 요점 ### 다룬 내용들: * 우리는 몇 가지 다른 loss 함수를 구축하고 이러한 손실을 최소화도록 입력 영상을 변환하기 위해 backpropagation 사용했습니다 * 이를 위해 **pretrained된 모델**을 로드하고 학습 된 feature map을 사용하여 이미지의 콘텐츠 및 스타일 표현을 설명해야했습니다. * 우리의 주요 loss 함수는 주로 이러한 다양한 representation의 관점에서 거리를 계산하는 것이 었습니다 * 우리는 이것을 custom model과 **eager execution**으로 구현하였습니다. * 우리는 Functional API를 이용하여 우리의 custom model을 만들었습니다. * Eager execution은 자연스러운 Python control flow를 사용하여 텐서로 동적으로 작업 할 수있게 해줍니다. * 우리는 텐서를 직접 조작하여 디버깅을하고 텐서로 작업하는 것을 더 쉽게 만듭니다. * **tf.gradient**를 사용하여 optimizer 업데이트 규칙을 적용하고 이미지를 반복적으로 업데이트했습니다. Optimizer는 입력 이미지와 관련하여 주어진 loss를 최소화했습니다. **[Image of Tuebingen](https://commons.wikimedia.org/wiki/File:Tuebingen_Neckarfront.jpg)** Photo By: Andreas Praefcke [GFDL (http://www.gnu.org/copyleft/fdl.html) or CC BY 3.0 (https://creativecommons.org/licenses/by/3.0)], from Wikimedia Commons **[Image of Green Sea Turtle](https://commons.wikimedia.org/wiki/File:Green_Sea_Turtle_grazing_seagrass.jpg)** By P.Lindgren [CC BY-SA 3.0 (https://creativecommons.org/licenses/by-sa/3.0)], from Wikimedia Commons # Report 1. 튀빙겐 사진을 고흐의 starry night 스타일로 바꿔봅시다. content_weight=1e3, style_weight=1e-2 2. 튀빙겐 사진을 고흐의 starry night 스타일로 바꿔봅시다. content_weight=1e3, style_weight=1e-0 3. 튀빙겐 사진을 고흐의 starry night 스타일로 바꿔봅시다. content_weight=1e3, style_weight=1e--4 4. 튀빙겐 사진을 고흐의 starry night 스타일로 바꿔봅시다. content_weight=1e1, style_weight=1e-2 5. 튀빙겐 사진을 고흐의 starry night 스타일로 바꿔봅시다. content_weight=1e5, style_weight=1e-2 Q) $\alpha$(content_weight)와 $\beta$(style_weight)의 역할은 무엇입니까? #### 참고) 파일 경로, 이름 > 튀빙겐: '/tmp/nst/Tuebingen_Neckarfront.jpg' > starry night: '/tmp/nst/1024px-Van_Gogh_-_Starry_Night_-_Google_Art_Project.jpg'
github_jupyter
``` # Dependencies and Setup import matplotlib.pyplot as plt import pandas as pd import numpy as np import requests import gmaps import os import json # Import API key from api_keys import g_key # Loan CSV file generated from WeatherPy Folder weather_data_to_load = "../WeatherPy/weather_df.csv" weather_data = pd.read_csv(weather_data_to_load) dropna_weather_data = weather_data.dropna() del dropna_weather_data["Unnamed: 0"] dropna_weather_data.head(20) # Configure gmaps gmaps.configure(api_key=g_key) # Locations locations = dropna_weather_data[["Latitude", "Longitude"]] humidity = dropna_weather_data["Humidity (%)"].astype(float) # Plot Heatmap fig = gmaps.figure() # Create heat layer heat_layer = gmaps.heatmap_layer(locations, weights=humidity, dissipating=False, max_intensity=100, point_radius=2) # Add layer fig.add_layer(heat_layer) # Display figure fig # Filter vacation with zero cloudiness vacation_no_cloud = dropna_weather_data[dropna_weather_data["Cloudiness (%)"] == 0] # Filter vacation with max temp above 70 degrees F vacation_above_70_degrees = vacation_no_cloud[vacation_no_cloud["Max Temp (F)"] > 70] # Filter vacation with max temp below 80 degrees F vacation_below_80_degrees = vacation_above_70_degrees[vacation_above_70_degrees["Max Temp (F)"] < 80] # Filter vacation with wind speed below 10 mph vacation_slow_wind = vacation_below_80_degrees[vacation_below_80_degrees["Wind Speed (mph)"] < 10] # Filter vacation with humidity below 60 % perfect_vacation = vacation_slow_wind[vacation_slow_wind["Humidity (%)"] < 60] # Set Index indexed_perfect_vacation = perfect_vacation.reset_index() del indexed_perfect_vacation["index"] indexed_perfect_vacation vaca_locations = indexed_perfect_vacation[["Latitude", "Longitude"]] vaca_humidity = indexed_perfect_vacation["Humidity (%)"].astype(float) # Plot Heatmap vaca_fig = gmaps.figure() # Create heat layer vaca_heat_layer = gmaps.heatmap_layer(vaca_locations, weights=vaca_humidity, dissipating=False, max_intensity=50, point_radius=2.5) # Add layer vaca_fig.add_layer(vaca_heat_layer) # Display figure vaca_fig # Hotel variable hotels = [] # Loop through narrowed down dataframe to get nearest hotel for city in range(len(indexed_perfect_vacation["City"])): lat = indexed_perfect_vacation.loc[city]["Latitude"] lng = indexed_perfect_vacation.loc[city]["Longitude"] city_coords = f"{lat},{lng}" params = { "location": city_coords, "types": "lodging", "radius": 5000, "key": g_key } base_url = "https://maps.googleapis.com/maps/api/place/nearbysearch/json" hotel_request = requests.get(base_url, params=params) hotel_response = hotel_request.json() try: hotels.append(hotel_response["results"][0]["name"]) except: hotels.append("Nearest hotel not found") # Dataframe with nearest hotel indexed_perfect_vacation["Nearest Hotel"] = hotels indexed_perfect_vacation ```
github_jupyter
# 0 - Information # 1 - Packages ``` # Math packages import numpy as np from scipy import optimize from scipy.stats import norm # Graphix packages import matplotlib.pyplot as plt import seaborn as sns sns.set() # Progress bar from tqdm import tqdm ``` # 2 - Séparation exacte du spectre ## Question 2.1 ``` def generateCovarianceMatrices(lambdas_l, n=1000, nb=250, law="normal"): """Generate random covariances matrices for the given list of lambdas.""" # Extract N N = len(lambdas_l) # Initialisation of the seed np.random.seed(42) # Generate R_N R_N_1_2 = np.diag(np.sqrt(lambdas_l)) # Saving array of all the generated covariances matrices result = [] # Loop for generating all the covariances matrices for i in tqdm(range(nb)): if law == "normal": # Samples normale distributions U = np.random.normal(0, 1, size=(N, n)) V = np.random.normal(0, 1, size=(N, n)) # Compute X with a normal distribution X_N = (U + 1j * V) / np.sqrt(2) if law == "student": U = np.random.standard_t(3, size=(N, n)) V = np.random.standard_t(3, size=(N, n)) # Compute X with a normal distribution X_N = (U + 1j * V) / np.sqrt(6) # Covariance matrix # cov = 1 / N * np.dot(X_N.H, np.dot(R_N, X_N)) cov = 1 / n * R_N_1_2 @ X_N @ np.conj(X_N).T @ R_N_1_2 # Update result result.append(cov) return result def samplingSpectrum(lambdas_l, n=1000, nb=200, law="normal"): """Generate covariances matrices for the given lambdas and compute the distribution of their spectrum.""" # Generate the covariances matrices cov_l = generateCovarianceMatrices(lambdas_l, n=n, nb=nb, law=law) # Saving array eigvals_l = [] # Loop over each covariances matrices for computing their spectrum. for cov in tqdm(cov_l): # Compute the spectrum eigvals, vectors = np.linalg.eigh(cov) # Update eigvals_l eigvals_l.extend(eigvals) return eigvals_l def displayDistribution(lambdas_l, eigvals_l, N, n, nb, bins=50, c_i=True, name="Distribution_Spectrum"): """Display the distribution of eigvals given as argument.""" # Display the ratio between N and n print("c: {}".format(N/n)) # Display each c_i if c_i: lambdas, counts = np.unique(lambdas_l, return_counts=True) # Count proportion for each true eigenvalue nb_lambdas = len(lambdas) diff = np.abs(np.tile(np.array(eigvals_l).reshape((-1, 1)), (1, nb_lambdas)) - lambdas) lambdas_associated = lambdas[list(np.argmax(-diff, axis=1).reshape(-1))] _, counts_observed = np.unique(lambdas_associated, return_counts=True) for i, count_i in enumerate(counts): # Count the number of time lamda is present in lambdas_l N_i = count_i / N N_i_observed = counts_observed[i] / (N * nb) # Display c_i print("c_{} (lambda={}): {}".format(i, lambdas[i], N_i)) print("Proportion observed: {}".format(N_i_observed)) # Display max of eigenvalues print("\nMax of eigen values: {}".format(np.max(eigvals_l))) # Display the distribution plt.figure(figsize=(15, 8)) plt.hist(eigvals_l, bins=bins) # Save figure plt.savefig("./Results/" + name + ".png", dpi=150, bbox_inches='tight', pad_inches=0) def generateLambdas(N=20, lambdas=[1, 3, 7], p=[0.2, 0.3, 0.5]): """Generate random lambdas_l.""" # Generate the lambdas lambdas_l = np.sort(np.random.choice(lambdas, p=p, size=N)) return lambdas_l # Choice of N and n and nb N = 20 # Number of samples per covariances matrix n = 1000 # Number of features nb = 500 # Number of covariance matrices to generate # List of possible lambdas and their probabilities lambdas = [1, 3, 7] p = np.array([0.2, 0.3, 0.5]) p /= np.sum(p) # Generate the lambdas lambdas_l = generateLambdas(N=N, lambdas=lambdas, p=p) # Generate the covariances and compute their spectrum eigvals_l = samplingSpectrum(lambdas_l, n=n, nb=nb) # Display the distribution displayDistribution(lambdas_l, eigvals_l, N, n, nb) ``` Commentaires: ------------- On choisit la loi normale comme loi ayant un moment d'ordre 4 fini. On observe alors les trois propriétés attendues: * Pas de valeur propre qui s'éloigne aux infinis * Séparation exacte du support de chaque valeur propre * Le nombre de valeurs propres dans chaque composante connexe est proportionnel à $N_i$ ## Question 2.2 Dans cette question, on choisit une loi de moment d'ordre 4 infini (pour les figures ci-dessous, on utilise la loi de Student). ``` # Choice of N and n N = 20 n = 1000 nb = 500 # List of possible lambdas and their probabilities lambdas = [1, 3, 7] p = np.array([0.2, 0.3, 0.5]) p /= np.sum(p) # Generate the lambdas lambdas_l = generateLambdas(N=N, lambdas=lambdas, p=p) # Generate the covariances and compute their spectrum eigvals_l = samplingSpectrum(lambdas_l, n=n, nb=nb, law="student") # Display the distribution displayDistribution(lambdas_l, eigvals_l, N, n, nb, c_i=False, name="Distribution_Spectrum_Not_separated") ``` Commentaires: ------------------ Cette fois, on observe: * Certaines valeurs propres tendent vers l'infini, ou du moins sont beaucoup plus grande qu'attendu * Il n'y a plus de séparation exacte du spectre # 3 - Graphe de x(t) ## Question 3.1 ``` def F(t, x, y, c=0.01, lambdas=lambdas, p=p): """Compute the value of the function of fixed point t(z).""" # Initialise result result = -(x + 1j * y) # Loop over all the lambdas for k, l in enumerate(lambdas): result += c * p[k] * (l / (1 + l * t)) return 1 / result def fixedPoint(x, y=10e-5, c=0.01, init=0, lambdas=lambdas, p=p): """Find the fixed point of F for the given x and y.""" # Find the fixed point of F func = lambda t : F(t, x, y, c, lambdas=lambdas, p=p) t = optimize.fixed_point(func, [init]) return t def graphf(ax, c=0.01, y=10e-5, nb=500, lambdas=lambdas, p=p, name="Graph_f"): """Display the graph of f.""" # Array of real x_l = np.linspace(0.5, max(lambdas) + 3, nb) # Initialisation of graph graph = [] f_x = 0 # Loop over all x for x in tqdm(x_l): f_x = 1 / (np.pi) * np.imag(fixedPoint(x, y=y, c=c, init=f_x, lambdas=lambdas, p=p)) graph.append(f_x) # Convert graph as an array graph = np.array(graph).reshape(-1) # Display the graph of f ax.plot(x_l, graph) ax.set_xlabel("x", fontsize=22) ax.set_ylabel("f(x)", fontsize=22) ax.set_title("f(x) for c={}".format(c), fontsize=22) def graphX(ax, c=0.01, nb=1000, lambdas=lambdas, p=p, name="Graph_X"): """Display the graph of x.""" # Array of t t_l = np.linspace(-1.5, 1.5, nb) # Filtering of t_l such as -1/t is not in lambdas t_l = [t for t in t_l if not((-1 / t) in lambdas)] # Initialisation of graph graph = [] f_x = 0 # Loop over all t for t in tqdm(t_l): # Initialisation of x x = -1 / t for k, l in enumerate(lambdas): # Update x x += c * p[k] * (l / (1 + l * t)) graph.append(x) # Convert graph as an array graph = np.array(graph).reshape(-1) # Display the graph of f ax.plot(t_l, graph) ax.set_ylim(-5, 15) ax.grid(True) ax.axhline(y=0, color='k') ax.axvline(x=0, color='k') ax.grid(True) ax.set_xlabel("t", fontsize=22) ax.set_ylabel("x(t)", fontsize=22) ax.set_title("x(t) for c={}".format(c), fontsize=22) # Save figure if not(name is None): fig.savefig("./Results/" + name + ".png", dpi=150, bbox_inches='tight', pad_inches=0) # Display the graph of f fig, axs = plt.subplots(1, 1, figsize=(10, 8)) graphf(axs) ``` Commentaires: ------------------ On retrouve la loi du spectre observées précédement via la méthode des histogrammes. ## Question 3.2 ``` def graphX(ax, c=0.01, nb=1000, lambdas=lambdas, p=p, name="Graph_X"): """Display the graph of x.""" # Array of t t_l = np.linspace(-1.5, 1.5, nb) # Filtering of t_l such as -1/t is not in lambdas t_l = [t for t in t_l if not((-1 / t) in lambdas)] # Initialisation of graph graph = [] f_x = 0 # Loop over all t for t in tqdm(t_l): # Initialisation of x x = -1 / t for k, l in enumerate(lambdas): # Update x x += c * p[k] * (l / (1 + l * t)) graph.append(x) # Convert graph as an array graph = np.array(graph).reshape(-1) # Display the graph of f ax.plot(t_l, graph) ax.set_ylim(-5, 15) ax.grid(True) ax.axhline(y=0, color='k') ax.axvline(x=0, color='k') ax.grid(True) ax.set_xlabel("t", fontsize=22) ax.set_ylabel("x(t)", fontsize=22) ax.set_title("x(t) for c={}".format(c), fontsize=22) # Save figure if not(name is None): fig.savefig("./Results/" + name + ".png", dpi=150, bbox_inches='tight', pad_inches=0) # Display the graph of x fig, axs = plt.subplots(1, 1, figsize=(10, 8)) graphX(axs) ``` Commentaires: ------------------ On retrouve bien les asymptotes verticales aux voisinnages des $-1 / \lambda^R_k$ ## Question 3.3 ### Study of the influence of c ``` def studyC(name="Study_C"): """Study the influence of the parameters.""" # Array of c to test c_l = [0.01, 0.2, 2] # Display the graph of x fig, axs = plt.subplots(2, 3, figsize=(25, 16)) # Compute the graph of f for every c for k, c_k in enumerate(c_l): # Add graph of f for c[i] graphf(axs[0, k], c=c_k, name=None) # Add graph of f for c[i] graphX(axs[1, k], c=c_k, name=None) # Save figure fig.savefig("./Results/" + name + ".png", dpi=150, bbox_inches='tight', pad_inches=0) studyC() ``` Commentaires: ------------- Ci-dessus sont représentés sur la première ligne le graphe de f et sur la second ligne le graphe de x pour des valeurs de c égales à 0.01, 0.05 et 2. * Comme on peut l'observer, lorsque que c est faible (cas de c=0.01), les graphes de f et de x correspondent à ce qui étaient attendus. * Lorsque c augmente (cas de c=0.2), on constate que du "bruit" aparaît par rapport aux graphes que l'on pourrait attendre de f et de x et que la distinction entre les clusters est moins nette. De même les parties croissantes du graphe de x sont plus étroite. * Finalement, quand c est grand (c=2), on constate que le graphe de f ne correspond plus du tout à ce que l'on peut espérer. De plus le graphe de x admet toujours les mêmes asymptotes mais la croissance de cette fonction n'est plus cohérent avec ce qui est attendu. ``` def studyCi(lambdas=lambdas, name="Study_C_i"): """Study the influence of the parameters.""" # Array of c_i to test ci_l = [[3, 7, 10], [14, 3, 2], [1, 10, 9]] # Display the graph of x fig, axs = plt.subplots(2, 3, figsize=(25, 16)) # Compute the graph of f for every c for k, ci_k in enumerate(ci_l): # Computation of p p = ci_k / np.sum(ci_k) print(p) # Add graph of f for c[i] graphf(axs[0, k], lambdas=lambdas, p=p, name=None) # Add graph of f for c[i] graphX(axs[1, k], lambdas=lambdas, p=p, name=None) # Save figure fig.savefig("./Results/" + name + ".png", dpi=150, bbox_inches='tight', pad_inches=0) studyCi() ``` Commentaires: ------------------ Ci-dessus sont représentés les graphes de f (première ligne) et de x (deuxième ligne). On étudie ici l'influence du choix des c_i. On a pris les mêmes lambdas que précédement (1, 3 et 7) mais on a représenté les graphes de f et x pour différents choix de c_i: ([0.15, 0.35, 0.5], [0.73, 0.16, 0.11] et [0.05, 0.5, 0.45] respectivement) \vspace{2em} Influence sur le graphe de f: * Comme vu précédement, on retrouve bien le fait que les parties connexes liés à une valeur propre sont proportionnel à c_i. * On constate aussi que lorsque qu'un $\lambda_i$ est associé à un c_i faible, alors l'intervalle de sa partie connexe associé est peu étendu. \vspace{2em} Influence sur le graphe de x: * Lorsqu'on a un $c_i$ élevé, on constate une meilleur approximation au niveau de l'asymptote associée à $\lambda_i$. ``` def studyLambdas(name="Study_Lambdas"): """Study the influence of the parameters.""" # Array of c_i to test lambdas_l = [[1, 3, 7], [1, 2, 3], [1, 10, 20]] # Display the graph of x fig, axs = plt.subplots(2, 3, figsize=(25, 16)) # Compute the graph of f for every c for k, lambdas_k in enumerate(lambdas_l): # Add graph of f for c[i] graphf(axs[0, k], lambdas=lambdas_k, name=None) # Add graph of f for c[i] graphX(axs[1, k], lambdas=lambdas_k, name=None) # Save figure fig.savefig("./Results/" + name + ".png", dpi=150, bbox_inches='tight', pad_inches=0) studyLambdas() ``` Commentaires: ----------------- Ci-dessus sont représentés les graphes de f (première ligne) et de x (deuxième ligne). On étudie ici l'influence du choix des $\lambda_i$. On a pris les mêmes $c_i$ que précédement ([0.2, 0.3, 05]) mais on a représenté les graphes de f et x pour différents choix de $\lambda_i$: ([1, 3, 7], [1, 2, 3] et [1, 10, 20] respectivement). \vspace{2em} Influence sur le graphe de f: * On constate que plus un $\lambda_i$ est grand, plus sa partie connexe associé est étendue. \vspace{2em} Influence sur le graphe de x: * On constate que plus les $\lambda_i$ sont grands, plus leur asymptote associé ont tendance à se chevaucher vu qu'elles tendent toutes vers l'asymptote $x=0$. # 4 - Estimation des $\lambda_i^R$ ## Question 4.1 Grâce aux simulations réalisées pour la partie séparation exacte de spectre, on sait que l'ensemble de paramètres (N=20, n=1000, nb=500, law="normal", lambdas=[1, 3, 7]) est un ensemble qui satisfait les conditions énoncées. ## Question 4.2.(a) En utilisant la fonction d'approximation $f(x) = x$ et en utilisant les résultats vu en cours ainsi que les résultats des exercices 3 et 4, on obtient les résultats ci-dessous: \begin{equation*} \lambda_k(R_N) \approx \frac{n}{N_k} \sum_{i \in \mathcal{C}_k} (\lambda_i - \eta_i) \end{equation*} Avec: \begin{itemize} \item $\mathcal{C}_k$ un contour entourant $\lambda_k$. \item $\eta_i$ sont les valeurs propres de $\Lambda - aa^*$ où $\Lambda = diag(\lambda_1, \cdots, \lambda_n)$ et $a = \frac{1}{n}(\sqrt{\lambda_1}, \cdots, \sqrt{\lambda_n})^T$. \end{itemize} Grâce aux résultats de l'exercice 3 de la feuille d'exercice "Inférence", on peut estimer facilement les eta_i. ``` def computeEta(cov, n=1000): """Compute the eta associated to cov.""" # Compute the eigen values of cov. eigvals = np.real(np.linalg.eigvals(cov)) # Build \Lambda L = np.diag(eigvals) # Build a a = 1 / np.sqrt(n) * np.sqrt(eigvals).reshape((-1, 1)) # Build \Lambda - aa* R = L - a @ a.T # Compute the eta etas = np.linalg.eigvals(R) return etas def estimationLambda(cov_l, lambdas_l, C=[[0.1, 1.9], [2, 4], [5, 9]], n=1000, lambdas_init=[1, 3, 7]): """Estimate \Lambda_k. Take for argument a contour of Lambda_k and samples of cov.""" # Number of samples nb = len(cov_l) # Shape of cov N, _ = np.shape(cov_l[0]) # Initialisation of the estimation of lambda_k estimators_l = [[] for i in lambdas_init] # Loop over all the matrices inside cov_l for cov in tqdm(cov_l): # Compute the eta associated etas = computeEta(cov, n=n) # Compute the lambdas associated lambdas = np.real(np.linalg.eigvals(cov)) # Loop for each lambdas to approximate for k, lambda_k_true in enumerate(lambdas_init): # Count N_k N_k = list(lambdas_l).count(lambda_k_true) # Filter all the value inside etas and lambdas that are in C etas_C = list(filter(lambda x: (C[k][0] <= x) & (x <= C[k][1]), etas)) lambdas_C = list(filter(lambda x: (C[k][0] <= x) & (x <= C[k][1]), lambdas)) # Update the estimation of lambda_k estimators_l[k].append(n / N_k * (np.sum(lambdas_C) - np.sum(etas_C))) return np.array(estimators_l) # Choice of N and n N = 20 n = 1000 nb = 100 # List of possible lambdas and their probabilities lambdas = [1, 3, 7] p = np.array([0.2, 0.3, 0.5]) p /= np.sum(p) # Generate the lambdas lambdas_l = generateLambdas(N=N, lambdas=lambdas, p=p) # Generate the covariances matrices cov_l = generateCovarianceMatrices(lambdas_l, n=n, nb=nb, law="normal") # Estimation of \lambda_k C = [[0.1, 1.9], [2, 4], [5, 9]] estimators_l = estimationLambda(cov_l, lambdas_l, lambdas_init=lambdas, C=C, n=n) # Display the estimation print(estimators_l.mean(axis=1)) ``` Commentaires: ------------------ Pour chacun des lambdas réel, on trouve une bonne estimation avec une erreur inférieur à 1% ## Question 4.2.(b) ``` def displayDistributionLambdasK(N=60, n=3000, nb=5000, p=[0.2, 0.3, 0.5], lambdas=[1, 3, 7], C=[[0.1, 1.9], [2, 4], [5, 9]], bins=25, name="Distrib_Lambda_K"): """Display the distribution of the estimator of the lambdas given as argument.""" # Generate the lambdas lambdas_l = generateLambdas(N=N, lambdas=lambdas, p=p) print(np.unique(lambdas_l, return_counts=True)) # Generate the covariances matrices cov_l = generateCovarianceMatrices(lambdas_l, n=n, nb=nb, law="normal") # Estimation of \lambda_k estimators_l = estimationLambda(cov_l, lambdas_l, lambdas_init=lambdas, C=C, n=n) # Initialisation of the figure fig, axs = plt.subplots(1, 3, figsize=(21, 8)) # Computation of the MSE for each lambda_k for k, lambda_k in enumerate(lambdas): # Display the mean and the std of the estimators of lambdas_k mean = np.mean(estimators_l[k]) std = np.std(estimators_l[k]) print("Estimators of \lambda_k, Mean: {}, Std: {}".format(mean, std)) # Compute the histogram of estimator_l[k] values_true, edges_true = np.histogram(estimators_l[k], bins=bins) values_true = values_true / np.sum(values_true) edges_true = (edges_true[1:] + edges_true[:-1]) / 2 width_true = 0.8 * (edges_true[1]- edges_true[0]) # Values for the gaussian samples = np.random.normal(mean, std, 100000) values_g, edges_g = np.histogram(samples, bins=bins) values_g = values_g / np.sum(values_g) edges_g = (edges_g[1:] + edges_g[:-1]) / 2 width_g = 0.8 * (edges_g[1]- edges_g[0]) # Display the distribution axs[k].bar(edges_true, values_true, width=width_true, label="Histogram of \hat\lambda_k", color="b") axs[k].plot(edges_g, values_g, label="Approximated Gaussian", color="r", alpha=0.5, linewidth=5) axs[k].legend() axs[k].grid(True) # Save figure fig.savefig("./Results/" + name + ".png", dpi=150, bbox_inches='tight', pad_inches=0) # Display distribution of the lambdas_k displayDistributionLambdasK() ``` Commentaires: ------------------ D'après les histogrammes précédents, il semblerait que des estimateurs suivant des lois gaussiennes de moyennes $\lambda_k$ et de variances dépendant des $\lambda_k$ soient de bons estimateurs. Ici, on a pris pour variance, la variance empirique des $\lambda_k$. ## Question 4.2.(c) ``` def displayMSEN(nb_N=10, nb=100, p=[0.2, 0.3, 0.5], lambdas=[1, 3, 7], C=[[0.1, 1.9], [2, 4], [5, 9]], name="MSE_N"): """Display the MSE.""" # Saving array of mse errors mse_l = [[] for i in range(len(lambdas))] # Sequences of N N_l = np.linspace(5, 80, nb_N, dtype=np.int) n_l = np.array([N * 50 for N in N_l]) # Loop over each N in N_L for i, N in enumerate(N_l): # Extract n n = n_l[i] # Generate the lambdas lambdas_l = generateLambdas(N=N, lambdas=lambdas, p=p) # Generate the covariances matrices cov_l = generateCovarianceMatrices(lambdas_l, n=n, nb=nb, law="normal") # Estimation of \lambda_k estimators_l = estimationLambda(cov_l, lambdas_l, lambdas_init=lambdas, C=C, n=n) # Loop over each lambdas for k, lambda_k in enumerate(lambdas): # Compute MSE mse = np.mean((estimators_l[k] - lambda_k) ** 2) mse_l[k].append(mse) # Initialisation of the figure fig, axs = plt.subplots(1, 1, figsize=(10, 8)) axs.grid(True) axs.set_ylabel("MSE", fontsize=22) axs.set_xlabel("N", fontsize=22) axs.set_title("MSE over N", fontsize=22) # Display the mse for each lambdas for k, lambda_k in enumerate(lambdas): # Display the mse over N for the current lambda_k axs.plot(N_l, mse_l[k], label="\lambda_k = {}".format(lambda_k), marker="x", linestyle="--") # Activation of the legend axs.legend() # Save figure fig.savefig("./Results/" + name + ".png", dpi=150, bbox_inches='tight', pad_inches=0) # Display MSE over N displayMSEN() ``` Commentaires: ------------------ Grâce à ce graphique, on en déduit que les estimateurs $\hat\lambda_k^N$ ont une variance qui décroît avec N et qui dépend aussi de $\lambda_k$ de manière croissante. ## Question 4.2.(d) Pour notre approximation naive, on va simplement prendre la moyenne des lambdas empiriques dans chacune des parties connexes. ``` def naiveEstimation(N, n, cov_l, lambdas=[1, 3, 7], C=[[0.1, 1.9], [2, 4], [5, 9]]): """Naive estimation of the lambdas.""" # Number of samples of cov nb = len(cov_l) # Resulting array of estimators estimators_l = [0 for i in range(len(lambdas))] # Loop over the cov for cov in cov_l: # Compute the eigen values of cov eigvals = np.real(np.linalg.eigvals(cov)) # Loop over each cluster for updating the estimation of lambda_k for k in range(len(lambdas)): # Filter all the value inside etas and lambdas that are in C lambdas_C = list(filter(lambda x: (C[k][0] <= x) & (x <= C[k][1]), eigvals)) # Update estimators estimators_l[k] += np.mean(lambdas_C) / nb return estimators_l def displayMSENaive(nb_N=10, nb=20, p=[0.2, 0.3, 0.5], lambdas=[1, 3, 7], C=[[0.1, 1.9], [2, 4], [5, 9]], name="naive_MSE"): """Display the MSE.""" # Saving array of mse errors mse_l = [[] for i in range(len(lambdas))] # Sequences of N N_l = np.linspace(5, 1000, nb_N, dtype=np.int) n_l = np.array([N * 50 for N in N_l]) # Loop over each N in N_L for i, N in enumerate(N_l): # Extract n n = n_l[i] # Generate the lambdas lambdas_l = generateLambdas(N=N, lambdas=lambdas, p=p) # Generate the covariances matrices cov_l = generateCovarianceMatrices(lambdas_l, n=n, nb=nb, law="normal") # Estimation of \lambda_k estimators_l = naiveEstimation(N, n, cov_l, lambdas=lambdas, C=C) # Loop over each lambdas for k, lambda_k in enumerate(lambdas): # Compute MSE mse = np.mean((estimators_l[k] - lambda_k) ** 2) mse_l[k].append(mse) # Initialisation of the figure fig, axs = plt.subplots(1, 1, figsize=(10, 8)) axs.grid(True) axs.set_ylabel("MSE", fontsize=22) axs.set_xlabel("N", fontsize=22) axs.set_title("MSE over N", fontsize=22) # Display the mse for each lambdas for k, lambda_k in enumerate(lambdas): # Display the mse over N for the current lambda_k axs.plot(N_l, mse_l[k], label="\lambda_k = {}".format(lambda_k), marker="x", linestyle="--") # Activate the legend axs.legend() # Save figure fig.savefig("./Results/" + name + ".png", dpi=150, bbox_inches='tight', pad_inches=0) displayMSENaive() ``` Commentaires: ------------------ On constate que l'erreur ne décroit plus avec N pour notre estimateur naïf. On en déduit donc que celui-ci est biaisé et non consistant. De même, on constate que cette erreur croît avec la valeur de $\lambda_k$. Néanmoins, l'erreur reste très faible ($10^{-29}$) et ainsi l'estimateur naïf peut être utile car il est compliqué à estimer. ## Question 4.3 ### Paramétrisation critique ``` # Choice of N and n and nb N = 200 # Number of samples per covariances matrix n = 1000 # Number of features nb = 500 # Number of covariance matrices to generate # List of possible lambdas and their probabilities lambdas = [1, 3] p = np.array([0.4, 0.6]) p /= np.sum(p) # Generate the lambdas lambdas_l = generateLambdas(N=N, lambdas=lambdas, p=p) # Generate the covariances and compute their spectrum eigvals_l = samplingSpectrum(lambdas_l, n=n, nb=nb) # Display the distribution displayDistribution(lambdas_l, eigvals_l, N, n, nb, name="Distrib_Spectrum_Critic") ``` Commentaires: ------------------ Après plusieurs expérimentations, on constate donc que $c_0 = 0.2$ ext une paramétrisation critique. ## Question 4.4.(a) ``` def displayMSEn(N=20, nb_n=15, nb=20, p=[0.4, 0.6], lambdas=[1, 3], C=[[0.1, 1.9], [2, 4]], name="MSE_n", estimator_func=estimationLambda): """Display the MSE over n.""" # Saving array of mse errors mse_l = [[] for i in range(len(lambdas))] # Sequences of N n_l = np.linspace(10, 1000, nb_n, dtype=int) # Loop over each N in N_L for i, N in enumerate(n_l): # Extract n n = n_l[i] # Generate the lambdas lambdas_l = generateLambdas(N=N, lambdas=lambdas, p=p) # Generate the covariances matrices cov_l = generateCovarianceMatrices(lambdas_l, n=n, nb=nb, law="normal") # Estimation of \lambda_k estimators_l = estimator_func(cov_l, lambdas_l, lambdas_init=lambdas, C=C, n=n) # Loop over each lambdas for k, lambda_k in enumerate(lambdas): # Compute MSE mse = np.mean((estimators_l[k] - lambda_k) ** 2) mse_l[k].append(mse) # Initialisation of the figure fig, axs = plt.subplots(1, 1, figsize=(10, 8)) axs.grid(True) axs.set_ylabel("MSE", fontsize=22) axs.set_xlabel("n", fontsize=22) axs.set_title("MSE over n", fontsize=22) # Display the mse for each lambdas for k, lambda_k in enumerate(lambdas): # Display the mse over N for the current lambda_k axs.plot(n_l, mse_l[k], label="\lambda_k = {}".format(lambda_k), marker="x", linestyle="--") # Activation of the legend axs.legend() # Save figure fig.savefig("./Results/" + name + ".png", dpi=150, bbox_inches='tight', pad_inches=0) displayMSEn() ``` Commentaires: ------------------ ## Question 4.4.(b) ``` def computeGn(x, lambdas_l, n): """Compute the value of g_n in x.""" # Initialisation of g_n g_n = 0 # N N = len(lambdas_l) # Loop over the lambda_i for lambda_i in lambdas_l: # Update g_n g_n += 1 / n * (1 / (lambda_i - x) ** 2) # Add zero lambdas for i in range(N - n): # Update g_n g_n += 1 / n * (1 / x ** 2) return g_n np.sqrt(-1) def resolveSystem(e_1, e_2, lambdas_l, lambdas_init, plus=True): """Resolution of the system for estimating \lambda_1 and \lambda_2.""" # Estimations of N_1 and N_2 N_1 = list(lambdas_l).count(lambdas_init[0]) N_2 = list(lambdas_l).count(lambdas_init[1]) # Compute the sqrt sub_sqrt = max(0, 1 / (N_1 * (N_1 + N_2) ** 2) * ((-N_2) * e_1 ** 2 + N_2 * (N_1 + N_2) * e_2)) sqrt = np.sqrt(sub_sqrt) # Computation of \lambda_1 if plus: lambda_1 = e_1 / (N_1 + N_2) + sqrt else: lambda_1 = e_1 / (N_1 + N_2) - sqrt # Computation of \lambda_2 lambda_2 = e_1 / N_2 - N_1 / N_2 * lambda_1 return lambda_1, lambda_2 def estimationLambdaNotSeparated(cov_l, lambdas_l, C=[0.1, 10], n=1000, lambdas_init=[1, 3], plus=False): """Estimate \Lambda_k in the case where the two lambdas are not separeted.""" # Number of samples nb = len(cov_l) # Shape of cov N, _ = np.shape(cov_l[0]) # Initialisation of lambdas estimators_l = [[] for i in lambdas_init] # Loop over all the matrices inside cov_l for cov in tqdm(cov_l): # Compute the eta associated etas = computeEta(cov, n=n) # Compute the lambdas associated lambdas = np.real(np.linalg.eigvals(cov)) # Filter all the value inside etas and lambdas that are in C etas_C = list(filter(lambda x: (C[0] <= x) & (x <= C[1]), etas)) lambdas_C = list(filter(lambda x: (C[0] <= x) & (x <= C[1]), lambdas)) # g_n(\eta_c) g_n_etas_C = np.array([computeGn(eta_i, lambdas, n) for eta_i in etas_C]) # Update the estimation of lambda_k e_1 = n * (np.sum(lambdas_C) - np.sum(etas_C)) e_2 = n * np.sum( 1 / np.array(g_n_etas_C)) # Resolution of the system lambda_1, lambda_2 = resolveSystem(e_1, e_2, lambdas_l, lambdas_init, plus=plus) # Update estimators estimators_l[0].append(lambda_1) estimators_l[1].append(lambda_2) return np.array(estimators_l) # Choice of N and n N = 20 n = 100 nb = 100 # List of possible lambdas and their probabilities lambdas = [1, 3] p = np.array([0.4, 0.6]) p /= np.sum(p) # Generate the lambdas lambdas_l = generateLambdas(N=N, lambdas=lambdas, p=p) # Generate the covariances matrices cov_l = generateCovarianceMatrices(lambdas_l, n=n, nb=nb, law="normal") # Estimation of \lambda_k estimators_l = estimationLambdaNotSeparated(cov_l, lambdas_l, lambdas_init=lambdas, n=n, plus=False) # Display the estimation print(estimators_l.mean(axis=1)) ``` ## Question 4.4.(c) ``` displayMSEn(nb=20, C=[0.1, 10], estimator_func=estimationLambdaNotSeparated, name="MSE_n_Not_Separated") ```
github_jupyter
# Node2Vec representation learning with Stellargraph components <table><tr><td>Run the latest release of this notebook:</td><td><a href="https://mybinder.org/v2/gh/stellargraph/stellargraph/master?urlpath=lab/tree/demos/embeddings/keras-node2vec-embeddings.ipynb" alt="Open In Binder" target="_parent"><img src="https://mybinder.org/badge_logo.svg"/></a></td><td><a href="https://colab.research.google.com/github/stellargraph/stellargraph/blob/master/demos/embeddings/keras-node2vec-embeddings.ipynb" alt="Open In Colab" target="_parent"><img src="https://colab.research.google.com/assets/colab-badge.svg"/></a></td></tr></table> This example demonstrates how to apply components from the stellargraph library to perform representation learning via Node2Vec. This uses a Keras implementation of Node2Vec available in stellargraph instead of the reference implementation provided by ``gensim``. This implementation provides flexible interfaces to downstream tasks for end-to-end learning. <a name="refs"></a> **References** [1] Node2Vec: Scalable Feature Learning for Networks. A. Grover, J. Leskovec. ACM SIGKDD International Conference on Knowledge Discovery and Data Mining (KDD), 2016. ([link](https://snap.stanford.edu/node2vec/)) [2] Distributed representations of words and phrases and their compositionality. T. Mikolov, I. Sutskever, K. Chen, G. S. Corrado, and J. Dean. In Advances in Neural Information Processing Systems (NIPS), pp. 3111-3119, 2013. ([link](https://papers.nips.cc/paper/5021-distributed-representations-of-words-and-phrases-and-their-compositionality.pdf)) [3] word2vec Parameter Learning Explained. X. Rong. arXiv preprint arXiv:1411.2738. 2014 Nov 11. ([link](https://arxiv.org/pdf/1411.2738.pdf)) ## Introduction Following word2vec [2,3], for each (``target``,``context``) node pair $(v_i,v_j)$ collected from random walks, we learn the representation for the target node $v_i$ by using it to predict the existence of context node $v_j$, with the following three-layer neural network. ![](word2vec-illustration.png) Node $v_i$'s representation in the hidden layer is obtained by multiplying $v_i$'s one-hot representation in the input layer with the input-to-hidden weight matrix $W_{in}$, which is equivalent to look up the $i$th row of input-to-hidden weight matrix $W_{in}$. The existence probability of each node conditioned on node $v_i$ is outputted in the output layer, which is obtained by multiplying $v_i$'s hidden-layer representation with the hidden-to-out weight matrix $W_{out}$ followed by a softmax activation. To capture the ``target-context`` relation between $v_i$ and $v_j$, we need to maximize the probability $\mathrm{P}(v_j|v_i)$. However, computing $\mathrm{P}(v_j|v_i)$ is time consuming, which involves the matrix multiplication between $v_i$'s hidden-layer representation and the hidden-to-out weight matrix $W_{out}$. To speed up the computing, we adopt the negative sampling strategy [2,3]. For each (``target``, ``context``) node pair, we sample a negative node $v_k$, which is not $v_i$'s context. To obtain the output, instead of multiplying $v_i$'s hidden-layer representation with the hidden-to-out weight matrix $W_{out}$ followed by a softmax activation, we only calculate the dot product between $v_i$'s hidden-layer representation and the $j$th column as well as the $k$th column of the hidden-to-output weight matrix $W_{out}$ followed by a sigmoid activation respectively. According to [3], the original objective to maximize $\mathrm{P}(v_j|v_i)$ can be approximated by minimizing the cross entropy between $v_j$ and $v_k$'s outputs and their ground-truth labels (1 for $v_j$ and 0 for $v_k$). Following [2,3], we denote the rows of the input-to-hidden weight matrix $W_{in}$ as ``input_embeddings`` and the columns of the hidden-to-out weight matrix $W_{out}$ as ``output_embeddings``. To build the Node2Vec model, we need look up ``input_embeddings`` for target nodes and ``output_embeddings`` for context nodes and calculate their inner product together with a sigmoid activation. ``` # install StellarGraph if running on Google Colab import sys if 'google.colab' in sys.modules: %pip install -q stellargraph[demos]==1.3.0b # verify that we're using the correct version of StellarGraph for this notebook import stellargraph as sg try: sg.utils.validate_notebook_version("1.3.0b") except AttributeError: raise ValueError( f"This notebook requires StellarGraph version 1.3.0b, but a different version {sg.__version__} is installed. Please see <https://github.com/stellargraph/stellargraph/issues/1172>." ) from None import matplotlib.pyplot as plt from sklearn.manifold import TSNE import os import networkx as nx import numpy as np import pandas as pd from tensorflow import keras from stellargraph import StellarGraph from stellargraph.data import BiasedRandomWalk from stellargraph.data import UnsupervisedSampler from stellargraph.data import BiasedRandomWalk from stellargraph.mapper import Node2VecLinkGenerator, Node2VecNodeGenerator from stellargraph.layer import Node2Vec, link_classification from stellargraph import datasets from IPython.display import display, HTML %matplotlib inline ``` ### Dataset For clarity, we use only the largest connected component, ignoring isolated nodes and subgraphs; having these in the data does not prevent the algorithm from running and producing valid results. ``` dataset = datasets.Cora() display(HTML(dataset.description)) G, subjects = dataset.load(largest_connected_component_only=True) print(G.info()) ``` ### The Node2Vec algorithm The Node2Vec algorithm introduced in [[1]](#refs) is a 2-step representation learning algorithm. The two steps are: 1. Use random walks to generate sentences from a graph. A sentence is a list of node ids. The set of all sentences makes a corpus. 2. The corpus is then used to learn an embedding vector for each node in the graph. Each node id is considered a unique word/token in a dictionary that has size equal to the number of nodes in the graph. The Word2Vec algorithm [[2]](#refs) is used for calculating the embedding vectors. In this implementation, we train the Node2Vec algorithm in the following two steps: 1. Generate a set of (`target`, `context`) node pairs through starting the biased random walk with a fixed length at per node. The starting nodes are taken as the target nodes and the following nodes in biased random walks are taken as context nodes. For each (`target`, `context`) node pair, we generate 1 negative node pair. 2. Train the Node2Vec algorithm through minimizing cross-entropy loss for `target-context` pair prediction, with the predictive value obtained by performing the dot product of the 'input embedding' of the target node and the 'output embedding' of the context node, followed by a sigmoid activation. Specify the optional parameter values: the number of walks to take per node, the length of each walk. Here, to guarantee the running efficiency, we respectively set `walk_number` and `walk_length` to 100 and 5. Larger values can be set to them to achieve better performance. ``` walk_number = 100 walk_length = 5 ``` Create the biased random walker to perform context node sampling, with the specified parameters. ``` walker = BiasedRandomWalk( G, n=walk_number, length=walk_length, p=0.5, # defines probability, 1/p, of returning to source node q=2.0, # defines probability, 1/q, for moving to a node away from the source node ) ``` Create the UnsupervisedSampler instance with the biased random walker. ``` unsupervised_samples = UnsupervisedSampler(G, nodes=list(G.nodes()), walker=walker) ``` Set the batch size and the number of epochs. ``` batch_size = 50 epochs = 2 ``` Define an attri2vec training generator, which generates a batch of (index of target node, index of context node, label of node pair) pairs per iteration. ``` generator = Node2VecLinkGenerator(G, batch_size) ``` Build the Node2Vec model, with the dimension of learned node representations set to 128. ``` emb_size = 128 node2vec = Node2Vec(emb_size, generator=generator) x_inp, x_out = node2vec.in_out_tensors() ``` Use the link_classification function to generate the prediction, with the 'dot' edge embedding generation method and the 'sigmoid' activation, which actually performs the dot product of the ``input embedding`` of the target node and the ``output embedding`` of the context node followed by a sigmoid activation. ``` prediction = link_classification( output_dim=1, output_act="sigmoid", edge_embedding_method="dot" )(x_out) ``` Stack the Node2Vec encoder and prediction layer into a Keras model. Our generator will produce batches of positive and negative context pairs as inputs to the model. Minimizing the binary crossentropy between the outputs and the provided ground truth is much like a regular binary classification task. ``` model = keras.Model(inputs=x_inp, outputs=prediction) model.compile( optimizer=keras.optimizers.Adam(lr=1e-3), loss=keras.losses.binary_crossentropy, metrics=[keras.metrics.binary_accuracy], ) ``` Train the model. ``` history = model.fit( generator.flow(unsupervised_samples), epochs=epochs, verbose=1, use_multiprocessing=False, workers=4, shuffle=True, ) ``` ## Visualise Node Embeddings Build the node based model for predicting node representations from node ids and the learned parameters. Below a Keras model is constructed, with `x_inp[0]` as input and `x_out[0]` as output. Note that this model's weights are the same as those of the corresponding node encoder in the previously trained node pair classifier. ``` x_inp_src = x_inp[0] x_out_src = x_out[0] embedding_model = keras.Model(inputs=x_inp_src, outputs=x_out_src) ``` Get the node embeddings from node ids. ``` node_gen = Node2VecNodeGenerator(G, batch_size).flow(subjects.index) node_embeddings = embedding_model.predict(node_gen, workers=4, verbose=1) ``` Transform the embeddings to 2d space for visualisation. ``` transform = TSNE # PCA trans = transform(n_components=2) node_embeddings_2d = trans.fit_transform(node_embeddings) # draw the embedding points, coloring them by the target label (paper subject) alpha = 0.7 label_map = {l: i for i, l in enumerate(np.unique(subjects))} node_colours = [label_map[target] for target in subjects] plt.figure(figsize=(7, 7)) plt.axes().set(aspect="equal") plt.scatter( node_embeddings_2d[:, 0], node_embeddings_2d[:, 1], c=node_colours, cmap="jet", alpha=alpha, ) plt.title("{} visualization of node embeddings".format(transform.__name__)) plt.show() ``` ### Downstream task The node embeddings calculated using Node2Vec can be used as feature vectors in a downstream task such as node attribute inference (e.g., inferring the subject of a paper in Cora), community detection (clustering of nodes based on the similarity of their embedding vectors), and link prediction (e.g., prediction of citation links between papers). <table><tr><td>Run the latest release of this notebook:</td><td><a href="https://mybinder.org/v2/gh/stellargraph/stellargraph/master?urlpath=lab/tree/demos/embeddings/keras-node2vec-embeddings.ipynb" alt="Open In Binder" target="_parent"><img src="https://mybinder.org/badge_logo.svg"/></a></td><td><a href="https://colab.research.google.com/github/stellargraph/stellargraph/blob/master/demos/embeddings/keras-node2vec-embeddings.ipynb" alt="Open In Colab" target="_parent"><img src="https://colab.research.google.com/assets/colab-badge.svg"/></a></td></tr></table>
github_jupyter
## [Bag of Words Meets Bags of Popcorn | Kaggle](https://www.kaggle.com/c/word2vec-nlp-tutorial#part-3-more-fun-with-word-vectors) # 튜토리얼 파트 3, 4 * [DeepLearningMovies/KaggleWord2VecUtility.py at master · wendykan/DeepLearningMovies](https://github.com/wendykan/DeepLearningMovies/blob/master/KaggleWord2VecUtility.py) * 캐글에 링크 되어 있는 github 튜토리얼을 참고하여 만들었으며 파이썬2로 되어있는 소스를 파이썬3에 맞게 일부 수정하였다. ### 첫 번째 시도(average feature vectors) - 튜토리얼2의 코드로 벡터의 평균을 구한다. ### 두 번째 시도(K-means) - Word2Vec은 의미가 관련있는 단어들의 클러스터를 생성하기 때문에 클러스터 내의 단어 유사성을 이용하는 것이다. - 이런식으로 벡터를 그룹화 하는 것을 "vector quantization(벡터 양자화)"라고 한다. - 이를 위해서는 K-means와 같은 클러스터링 알고리즘을 사용하여 클러스터라는 단어의 중심을 찾아야 한다. - 비지도학습인 K-means를 통해 클러스터링을 하고 지도학습인 랜덤포레스트로 리뷰가 추천인지 아닌지를 예측한다. ``` import pandas as pd import numpy as np from gensim.models import Word2Vec from sklearn.cluster import KMeans from sklearn.ensemble import RandomForestClassifier from bs4 import BeautifulSoup import re import time from nltk.corpus import stopwords import nltk.data import matplotlib.pyplot as plt import seaborn as sns %matplotlib inline model = Word2Vec.load('300features_40minwords_10text') model # 숫자로 단어를 표현 # Word2Vec 모델은 어휘의 각 단어에 대한 feature 벡터로 구성되며 # 'syn0'이라는 넘파이 배열로 저장된다. # syn0의 행 수는 모델 어휘의 단어 수 # 컬럼 수는 2 부에서 설정 한 피처 벡터의 크기 type(model.wv.syn0) # syn0의 행 수는 모델 어휘의 단어 수 # 열 수는 2부에서 설정한 특징 벡터의 크기 model.wv.syn0.shape # 개별 단어 벡터 접근 model.wv['flower'].shape model.wv['flower'][:10] ``` ## K-means (K평균)클러스터링으로 데이터 묶기 * [K-평균 알고리즘 - 위키백과, 우리 모두의 백과사전](https://ko.wikipedia.org/wiki/K-%ED%8F%89%EA%B7%A0_%EC%95%8C%EA%B3%A0%EB%A6%AC%EC%A6%98) - 클러스터링은 비지도 학습 기법 - 클러스터링은 유사성 등 개념에 기초해 몇몇 그룹으로 분류하는 기법 - 클러스터링의 목적은 샘플(실수로 구성된 n차원의 벡터)을 내부적으로는 비슷하지만 외부적으로 공통 분모가 없는 여러 그룹으로 묶는 것 - 특정 차원의 범위가 다른 차원과 차이가 크면 클러스터링 하기 전에 스케일을 조정해야 한다. 1. 최초 센트로이드(centroid)(중심점)로 k개의 벡터를 무작위로 선정한다. 2. 각 샘플을 그 위치에서 가장 가까운 센트로이드에 할당한다. 3. 센트로이드의 위치를 재계산한다. 4. 센트로이드가 더 이상 움직이지 않을 때까지 2와 3을 반복한다. 참고 : [책] 모두의 데이터 과학(with 파이썬) ``` # 단어 벡터에서 k-means를 실행하고 일부 클러스터를 찍어본다. start = time.time() # 시작시간 # 클러스터의 크기 "k"를 어휘 크기의 1/5 이나 평균 5단어로 설정한다. word_vectors = model.wv.syn0 # 어휘의 feature vector num_clusters = word_vectors.shape[0] / 5 num_clusters = int(num_clusters) # K means 를 정의하고 학습시킨다. kmeans_clustering = KMeans( n_clusters = num_clusters ) idx = kmeans_clustering.fit_predict( word_vectors ) # 끝난시간에서 시작시간을 빼서 걸린 시간을 구한다. end = time.time() elapsed = end - start print("Time taken for K Means clustering: ", elapsed, "seconds.") # 각 어휘 단어를 클러스터 번호에 매핑되게 word/Index 사전을 만든다. idx = list(idx) names = model.wv.index2word word_centroid_map = {names[i]: idx[i] for i in range(len(names))} # word_centroid_map = dict(zip( model.wv.index2word, idx )) # 첫번째 클러스터의 처음 10개를 출력 for cluster in range(0,10): # 클러스터 번호를 출력 print("\nCluster {}".format(cluster)) # 클러스터번호와 클러스터에 있는 단어를 찍는다. words = [] for i in range(0,len(list(word_centroid_map.values()))): if( list(word_centroid_map.values())[i] == cluster ): words.append(list(word_centroid_map.keys())[i]) print(words) """ 판다스로 데이터프레임 형태의 데이터로 읽어온다. QUOTE_MINIMAL (0), QUOTE_ALL (1), QUOTE_NONNUMERIC (2) or QUOTE_NONE (3). 그리고 이전 튜토리얼에서 했던 것처럼 clean_train_reviews 와 clean_test_reviews 로 텍스트를 정제한다. """ train = pd.read_csv('data/labeledTrainData.tsv', header=0, delimiter="\t", quoting=3) test = pd.read_csv('data/testData.tsv', header=0, delimiter="\t", quoting=3) # unlabeled_train = pd.read_csv( 'data/unlabeledTrainData.tsv', header=0, delimiter="\t", quoting=3 ) from KaggleWord2VecUtility import KaggleWord2VecUtility # 학습 리뷰를 정제한다. clean_train_reviews = [] for review in train["review"]: clean_train_reviews.append( KaggleWord2VecUtility.review_to_wordlist( review, \ remove_stopwords=True )) # 테스트 리뷰를 정제한다. clean_test_reviews = [] for review in test["review"]: clean_test_reviews.append( KaggleWord2VecUtility.review_to_wordlist( review, \ remove_stopwords=True )) # bags of centroids 생성 # 속도를 위해 centroid 학습 세트 bag을 미리 할당 한다. train_centroids = np.zeros((train["review"].size, num_clusters), \ dtype="float32" ) train_centroids[:5] # centroid 는 두 클러스터의 중심점을 정의 한 다음 중심점의 거리를 측정한 것 def create_bag_of_centroids( wordlist, word_centroid_map ): # 클러스터의 수는 word / centroid map에서 가장 높은 클러스트 인덱스와 같다. num_centroids = max( word_centroid_map.values() ) + 1 # 속도를 위해 bag of centroids vector를 미리 할당한다. bag_of_centroids = np.zeros( num_centroids, dtype="float32" ) # 루프를 돌며 단어가 word_centroid_map에 있다면 # 해당되는 클러스터의 수를 하나씩 증가시켜 준다. for word in wordlist: if word in word_centroid_map: index = word_centroid_map[word] bag_of_centroids[index] += 1 # bag of centroids를 반환한다. return bag_of_centroids # 학습 리뷰를 bags of centroids 로 변환한다. counter = 0 for review in clean_train_reviews: train_centroids[counter] = create_bag_of_centroids( review, \ word_centroid_map ) counter += 1 # 테스트 리뷰도 같은 방법으로 반복해 준다. test_centroids = np.zeros(( test["review"].size, num_clusters), \ dtype="float32" ) counter = 0 for review in clean_test_reviews: test_centroids[counter] = create_bag_of_centroids( review, \ word_centroid_map ) counter += 1 # 랜덤포레스트를 사용하여 학습시키고 예측 forest = RandomForestClassifier(n_estimators = 100) # train 데이터의 레이블을 통해 학습시키고 예측한다. # 시간이 좀 소요되기 때문에 %time을 통해 걸린 시간을 찍도록 함 print("Fitting a random forest to labeled training data...") %time forest = forest.fit(train_centroids, train["sentiment"]) from sklearn.model_selection import cross_val_score %time score = np.mean(cross_val_score(\ forest, train_centroids, train['sentiment'], cv=10,\ scoring='roc_auc')) %time result = forest.predict(test_centroids) score # 결과를 csv로 저장 output = pd.DataFrame(data={"id":test["id"], "sentiment":result}) output.to_csv("data/submit_BagOfCentroids_{0:.5f}.csv".format(score), index=False, quoting=3) fig, axes = plt.subplots(ncols=2) fig.set_size_inches(12,5) sns.countplot(train['sentiment'], ax=axes[0]) sns.countplot(output['sentiment'], ax=axes[1]) output_sentiment = output['sentiment'].value_counts() print(output_sentiment[0] - output_sentiment[1]) output_sentiment # 캐글 점수 0.84908 print(330/528) ``` ### 왜 이 튜토리얼에서는 Bag of Words가 더 좋은 결과를 가져올까? 벡터를 평균화하고 centroids를 사용하면 단어 순서가 어긋나며 Bag of Words 개념과 매우 비슷하다. 성능이 (표준 오차의 범위 내에서) 비슷하기 때문에 튜토리얼 1, 2, 3이 동등한 결과를 가져온다. 첫째, Word2Vec을 더 많은 텍스트로 학습시키면 성능이 좋아진다. Google의 결과는 10 억 단어가 넘는 코퍼스에서 배운 단어 벡터를 기반으로 한다. 학습 레이블이 있거나 레이블이 없는 학습 세트는 단지 대략 천팔백만 단어 정도다. 편의상 Word2Vec은 Google의 원래 C도구에서 출력되는 사전 학습 된 모델을 로드하는 기능을 제공하기 때문에 C로 모델을 학습 한 다음 Python으로 가져올 수도 있다. 둘째, 출판 된 자료들에서 분산 워드 벡터 기술은 Bag of Words 모델보다 우수한 것으로 나타났다. 이 논문에서는 IMDB 데이터 집합에 단락 벡터 (Paragraph Vector)라는 알고리즘을 사용하여 현재까지의 최첨단 결과 중 일부를 생성한다. 단락 벡터는 단어 순서 정보를 보존하는 반면 벡터 평균화 및 클러스터링은 단어 순서를 잃어 버리기 때문에 여기에서 시도하는 방식보다 부분적으로 더 좋다. * 더 공부하기 : 스탠포드 NLP 강의 : [Lecture 1 | Natural Language Processing with Deep Learning - YouTube](https://www.youtube.com/watch?v=OQQ-W_63UgQ&list=PL3FW7Lu3i5Jsnh1rnUwq_TcylNr7EkRe6)
github_jupyter
``` # Uncomment and run this cell if you're on Colab or Kaggle # !git clone https://github.com/nlp-with-transformers/notebooks.git # %cd notebooks # from install import * # install_requirements(is_chapter10=True) # hide from utils import * setup_chapter() ``` # Training Transformers from Scratch > **Note:** In this chapter a large dataset and the script to train a large language model on a distributed infrastructure are built. As such not all the steps in this notebook are executable on platforms such as Colab or Kaggle. Either downscale the steps at critical points or use this notebook as an inspiration when building a script for distributed training. ## Large Datasets and Where to Find Them ### Challenges of Building a Large-Scale Corpus ``` #hide_output from transformers import pipeline, set_seed generation_gpt = pipeline("text-generation", model="openai-gpt") generation_gpt2 = pipeline("text-generation", model="gpt2") def model_size(model): return sum(t.numel() for t in model.parameters()) print(f"GPT size: {model_size(generation_gpt.model)/1000**2:.1f}M parameters") print(f"GPT2 size: {model_size(generation_gpt2.model)/1000**2:.1f}M parameters") # hide set_seed(1) def enum_pipeline_ouputs(pipe, prompt, num_return_sequences): out = pipe(prompt, num_return_sequences=num_return_sequences, clean_up_tokenization_spaces=True) return "\n".join(f"{i+1}." + s["generated_text"] for i, s in enumerate(out)) prompt = "\nWhen they came back" print("GPT completions:\n" + enum_pipeline_ouputs(generation_gpt, prompt, 3)) print("") print("GPT-2 completions:\n" + enum_pipeline_ouputs(generation_gpt2, prompt, 3)) ``` ### Building a Custom Code Dataset #### Creating a dataset with Google BigQuery #sidebar To Filter the Noise or Not? ### Working with Large Datasets #### Memory mapping > **Note:** The following code block assumes that you have downloaded the BigQuery dataset to a folder called `codeparrot`. We suggest skipping this step since it will unpack the compressed files and require ~180GB of disk space. This code is just for demonstration purposes and you can just continue below with the streamed dataset which will not consume that much disk space. ``` #hide_output from datasets import load_dataset, DownloadConfig download_config = DownloadConfig(delete_extracted=True) dataset = load_dataset("./codeparrot", split="train", download_config=download_config) import psutil, os print(f"Number of python files code in dataset : {len(dataset)}") ds_size = sum(os.stat(f["filename"]).st_size for f in dataset.cache_files) # os.stat.st_size is expressed in bytes, so we convert to GB print(f"Dataset size (cache file) : {ds_size / 2**30:.2f} GB") # Process.memory_info is expressed in bytes, so we convert to MB print(f"RAM used: {psutil.Process(os.getpid()).memory_info().rss >> 20} MB") ``` #### Streaming ``` # hide_output streamed_dataset = load_dataset('./codeparrot', split="train", streaming=True) iterator = iter(streamed_dataset) print(dataset[0] == next(iterator)) print(dataset[1] == next(iterator)) remote_dataset = load_dataset('transformersbook/codeparrot', split="train", streaming=True) ``` ### Adding Datasets to the Hugging Face Hub ## Building a Tokenizer ``` # hide_output from transformers import AutoTokenizer def tok_list(tokenizer, string): input_ids = tokenizer(string, add_special_tokens=False)["input_ids"] return [tokenizer.decode(tok) for tok in input_ids] tokenizer_T5 = AutoTokenizer.from_pretrained("t5-base") tokenizer_camembert = AutoTokenizer.from_pretrained("camembert-base") print(f'T5 tokens for "sex": {tok_list(tokenizer_T5,"sex")}') print(f'CamemBERT tokens for "being": {tok_list(tokenizer_camembert,"being")}') ``` ### The Tokenizer Model ### Measuring Tokenizer Performance ### A Tokenizer for Python ``` from transformers import AutoTokenizer python_code = r"""def say_hello(): print("Hello, World!") # Print it say_hello() """ tokenizer = AutoTokenizer.from_pretrained("gpt2") print(tokenizer(python_code).tokens()) print(tokenizer.backend_tokenizer.normalizer) print(tokenizer.backend_tokenizer.pre_tokenizer.pre_tokenize_str(python_code)) a, e = u"a", u"€" byte = ord(a.encode("utf-8")) print(f'`{a}` is encoded as `{a.encode("utf-8")}` with a single byte: {byte}') byte = [ord(chr(i)) for i in e.encode("utf-8")] print(f'`{e}` is encoded as `{e.encode("utf-8")}` with three bytes: {byte}') from transformers.models.gpt2.tokenization_gpt2 import bytes_to_unicode byte_to_unicode_map = bytes_to_unicode() unicode_to_byte_map = dict((v, k) for k, v in byte_to_unicode_map.items()) base_vocab = list(unicode_to_byte_map.keys()) print(f'Size of our base vocabulary: {len(base_vocab)}') print(f'First element: `{base_vocab[0]}`, last element: `{base_vocab[-1]}`') # hide_input #id unicode_mapping #caption Examples of character mappings in BPE #hide_input import pandas as pd from transformers.models.gpt2.tokenization_gpt2 import bytes_to_unicode byte_to_unicode_map = bytes_to_unicode() unicode_to_byte_map = dict((v, k) for k, v in byte_to_unicode_map.items()) base_vocab = list(unicode_to_byte_map.keys()) examples = [ ['Regular characters', '`a` and `?`', f'{ord("a")} and {ord("?")}' , f'`{byte_to_unicode_map[ord("a")]}` and `{byte_to_unicode_map[ord("?")]}`'], ['Nonprintable control character (carriage return)', '`U+000D`', f'13', f'`{byte_to_unicode_map[13]}`'], ['A space', '` `', f'{ord(" ")}', f'`{byte_to_unicode_map[ord(" ")]}`'], ['A nonbreakable space', '`\\xa0`', '160', f'`{byte_to_unicode_map[ord(chr(160))]}`'], ['A newline character', '`\\n`', '10', f'`{byte_to_unicode_map[ord(chr(10))]}`'], ] pd.DataFrame(examples, columns = ['Description', 'Character', 'Bytes', 'Mapped bytes']) print(tokenizer.backend_tokenizer.pre_tokenizer.pre_tokenize_str(python_code)) print(f"Size of the vocabulary: {len(tokenizer)}") print(tokenizer(python_code).tokens()) ``` ### Training a Tokenizer ``` tokens = sorted(tokenizer.vocab.items(), key=lambda x: len(x[0]), reverse=True) print([f'{tokenizer.convert_tokens_to_string(t)}' for t, _ in tokens[:8]]); tokens = sorted(tokenizer.vocab.items(), key=lambda x: x[1], reverse=True) print([f'{tokenizer.convert_tokens_to_string(t)}' for t, _ in tokens[:12]]); #hide_output from tqdm.auto import tqdm length = 100000 dataset_name = 'transformersbook/codeparrot-train' dataset = load_dataset(dataset_name, split="train", streaming=True) iter_dataset = iter(dataset) def batch_iterator(batch_size=10): for _ in tqdm(range(0, length, batch_size)): yield [next(iter_dataset)['content'] for _ in range(batch_size)] new_tokenizer = tokenizer.train_new_from_iterator(batch_iterator(), vocab_size=12500, initial_alphabet=base_vocab) tokens = sorted(new_tokenizer.vocab.items(), key=lambda x: x[1], reverse=False) print([f'{tokenizer.convert_tokens_to_string(t)}' for t, _ in tokens[257:280]]); print([f'{new_tokenizer.convert_tokens_to_string(t)}' for t,_ in tokens[-12:]]); print(new_tokenizer(python_code).tokens()) import keyword print(f'There are in total {len(keyword.kwlist)} Python keywords.') for keyw in keyword.kwlist: if keyw not in new_tokenizer.vocab: print(f'No, keyword `{keyw}` is not in the vocabulary') # hide_output length = 200000 new_tokenizer_larger = tokenizer.train_new_from_iterator(batch_iterator(), vocab_size=32768, initial_alphabet=base_vocab) tokens = sorted(new_tokenizer_larger.vocab.items(), key=lambda x: x[1], reverse=False) print([f'{tokenizer.convert_tokens_to_string(t)}' for t, _ in tokens[-12:]]); print(new_tokenizer_larger(python_code).tokens()) for keyw in keyword.kwlist: if keyw not in new_tokenizer_larger.vocab: print(f'No, keyword `{keyw}` is not in the vocabulary') ``` ### Saving a Custom Tokenizer on the Hub ``` #hide_output model_ckpt = "codeparrot" org = "transformersbook" new_tokenizer_larger.push_to_hub(model_ckpt, organization=org) reloaded_tokenizer = AutoTokenizer.from_pretrained(org + "/" + model_ckpt) print(reloaded_tokenizer(python_code).tokens()) #hide_output new_tokenizer.push_to_hub(model_ckpt+ "-small-vocabulary", organization=org) ``` ## Training a Model from Scratch ### A Tale of Pretraining Objectives <img alt="Code snippet" caption="An example of a Python function that could be found in our dataset" src="images/chapter10_code-snippet.png" id="code-snippet"/> #### Causal language modeling <img alt="CLM pretraining" caption="In causal language modeling, the future tokens are masked and the model has to predict them; typically a decoder model such as GPT is used for such a task" src="images/chapter10_pretraining-clm.png" id="pretraining-clm"/> #### Masked language modeling <img alt="MLM pretraining" caption="In masked language modeling some of the input tokens are either masked or replaced, and the model's task is to predict the original tokens; this is the architecture underlying the encoder branch of transformer models" src="images/chapter10_pretraining-mlm.png" id="pretraining-mlm"/> #### Sequence-to-sequence training <img alt="Seq2seq pretraining" caption="Using an encoder-decoder architecture for a sequence-to-sequence task where the inputs are split into comment/code pairs using heuristics: the model gets one element as input and needs to generate the other one" src="images/chapter10_pretraining-seq2seq.png" id="pretraining-seq2seq"/> ### Initializing the Model > **NOTE**: In the following code block, a large GPT-2 checkpoint is loaded into memory. On platforms like Colab and Kaggle, this can cause the instance to crash due to insufficient RAM or GPU memory. You can still run the example if you use the small checkpoint by replacing the configuration with `config = AutoConfig.from_pretrained("gpt2", vocab_size=len(tokenizer))`. ``` #hide_output from transformers import AutoConfig, AutoModelForCausalLM, AutoTokenizer tokenizer = AutoTokenizer.from_pretrained(org + "/" + model_ckpt) config = AutoConfig.from_pretrained("gpt2-xl", vocab_size=len(tokenizer)) model = AutoModelForCausalLM.from_config(config) print(f'GPT-2 (xl) size: {model_size(model)/1000**2:.1f}M parameters') #hide_output model.save_pretrained("models/" + model_ckpt, push_to_hub=True, organization=org) tokenizer = AutoTokenizer.from_pretrained(model_ckpt) config_small = AutoConfig.from_pretrained("gpt2", vocab_size=len(tokenizer)) model_small = AutoModelForCausalLM.from_config(config_small) print(f'GPT-2 size: {model_size(model_small)/1000**2:.1f}M parameters') #hide_output model_small.save_pretrained("models/" + model_ckpt + "-small", push_to_hub=True, organization=org) ``` ### Implementing the Dataloader <img alt="Preprocessing for CLM" caption="Preparing sequences of varying length for causal language modeling by concatenating several tokenized examples with an EOS token before chunking them" src="images/chapter10_preprocessing-clm.png" id="preprocessing-clm"/> ``` #hide_output examples, total_characters, total_tokens = 500, 0, 0 dataset = load_dataset('transformersbook/codeparrot-train', split='train', streaming=True) for _, example in tqdm(zip(range(examples), iter(dataset)), total=examples): total_characters += len(example['content']) total_tokens += len(tokenizer(example['content']).tokens()) characters_per_token = total_characters / total_tokens print(characters_per_token) import torch from torch.utils.data import IterableDataset class ConstantLengthDataset(IterableDataset): def __init__(self, tokenizer, dataset, seq_length=1024, num_of_sequences=1024, chars_per_token=3.6): self.tokenizer = tokenizer self.concat_token_id = tokenizer.eos_token_id self.dataset = dataset self.seq_length = seq_length self.input_characters = seq_length * chars_per_token * num_of_sequences def __iter__(self): iterator = iter(self.dataset) more_examples = True while more_examples: buffer, buffer_len = [], 0 while True: if buffer_len >= self.input_characters: m=f"Buffer full: {buffer_len}>={self.input_characters:.0f}" print(m) break try: m=f"Fill buffer: {buffer_len}<{self.input_characters:.0f}" print(m) buffer.append(next(iterator)["content"]) buffer_len += len(buffer[-1]) except StopIteration: iterator = iter(self.dataset) all_token_ids = [] tokenized_inputs = self.tokenizer(buffer, truncation=False) for tokenized_input in tokenized_inputs['input_ids']: all_token_ids.extend(tokenized_input + [self.concat_token_id]) for i in range(0, len(all_token_ids), self.seq_length): input_ids = all_token_ids[i : i + self.seq_length] if len(input_ids) == self.seq_length: yield torch.tensor(input_ids) shuffled_dataset = dataset.shuffle(buffer_size=100) constant_length_dataset = ConstantLengthDataset(tokenizer, shuffled_dataset, num_of_sequences=10) dataset_iterator = iter(constant_length_dataset) lengths = [len(b) for _, b in zip(range(5), dataset_iterator)] print(f"Lengths of the sequences: {lengths}") ``` ### Defining the Training Loop ``` from argparse import Namespace # Commented parameters correspond to the small model config = {"train_batch_size": 2, # 12 "valid_batch_size": 2, # 12 "weight_decay": 0.1, "shuffle_buffer": 1000, "learning_rate": 2e-4, # 5e-4 "lr_scheduler_type": "cosine", "num_warmup_steps": 750, # 2000 "gradient_accumulation_steps": 16, # 1 "max_train_steps": 50000, # 150000 "max_eval_steps": -1, "seq_length": 1024, "seed": 1, "save_checkpoint_steps": 50000} # 15000 args = Namespace(**config) from torch.utils.tensorboard import SummaryWriter import logging import wandb def setup_logging(project_name): logger = logging.getLogger(__name__) logging.basicConfig( format="%(asctime)s - %(levelname)s - %(name)s - %(message)s", datefmt="%m/%d/%Y %H:%M:%S", level=logging.INFO, handlers=[ logging.FileHandler(f"log/debug_{accelerator.process_index}.log"), logging.StreamHandler()]) if accelerator.is_main_process: # We only want to set up logging once wandb.init(project=project_name, config=args) run_name = wandb.run.name tb_writer = SummaryWriter() tb_writer.add_hparams(vars(args), {'0': 0}) logger.setLevel(logging.INFO) datasets.utils.logging.set_verbosity_debug() transformers.utils.logging.set_verbosity_info() else: tb_writer = None run_name = '' logger.setLevel(logging.ERROR) datasets.utils.logging.set_verbosity_error() transformers.utils.logging.set_verbosity_error() return logger, tb_writer, run_name def log_metrics(step, metrics): logger.info(f"Step {step}: {metrics}") if accelerator.is_main_process: wandb.log(metrics) [tb_writer.add_scalar(k, v, step) for k, v in metrics.items()] #hide_output from torch.utils.data.dataloader import DataLoader def create_dataloaders(dataset_name): train_data = load_dataset(dataset_name+'-train', split="train", streaming=True) train_data = train_data.shuffle(buffer_size=args.shuffle_buffer, seed=args.seed) valid_data = load_dataset(dataset_name+'-valid', split="validation", streaming=True) train_dataset = ConstantLengthDataset(tokenizer, train_data, seq_length=args.seq_length) valid_dataset = ConstantLengthDataset(tokenizer, valid_data, seq_length=args.seq_length) train_dataloader=DataLoader(train_dataset, batch_size=args.train_batch_size) eval_dataloader=DataLoader(valid_dataset, batch_size=args.valid_batch_size) return train_dataloader, eval_dataloader def get_grouped_params(model, no_decay=["bias", "LayerNorm.weight"]): params_with_wd, params_without_wd = [], [] for n, p in model.named_parameters(): if any(nd in n for nd in no_decay): params_without_wd.append(p) else: params_with_wd.append(p) return [{'params': params_with_wd, 'weight_decay': args.weight_decay}, {'params': params_without_wd, 'weight_decay': 0.0}] def evaluate(): model.eval() losses = [] for step, batch in enumerate(eval_dataloader): with torch.no_grad(): outputs = model(batch, labels=batch) loss = outputs.loss.repeat(args.valid_batch_size) losses.append(accelerator.gather(loss)) if args.max_eval_steps > 0 and step >= args.max_eval_steps: break loss = torch.mean(torch.cat(losses)) try: perplexity = torch.exp(loss) except OverflowError: perplexity = torch.tensor(float("inf")) return loss.item(), perplexity.item() set_seed(args.seed) # Accelerator accelerator = Accelerator() samples_per_step = accelerator.state.num_processes * args.train_batch_size # Logging logger, tb_writer, run_name = setup_logging(project_name.split("/")[1]) logger.info(accelerator.state) # Load model and tokenizer if accelerator.is_main_process: hf_repo = Repository("./", clone_from=project_name, revision=run_name) model = AutoModelForCausalLM.from_pretrained("./", gradient_checkpointing=True) tokenizer = AutoTokenizer.from_pretrained("./") # Load dataset and dataloader train_dataloader, eval_dataloader = create_dataloaders(dataset_name) # Prepare the optimizer and learning rate scheduler optimizer = AdamW(get_grouped_params(model), lr=args.learning_rate) lr_scheduler = get_scheduler(name=args.lr_scheduler_type, optimizer=optimizer, num_warmup_steps=args.num_warmup_steps, num_training_steps=args.max_train_steps,) def get_lr(): return optimizer.param_groups[0]['lr'] # Prepare everything with our `accelerator` (order of args is not important) model, optimizer, train_dataloader, eval_dataloader = accelerator.prepare( model, optimizer, train_dataloader, eval_dataloader) # Train model model.train() completed_steps = 0 for step, batch in enumerate(train_dataloader, start=1): loss = model(batch, labels=batch).loss log_metrics(step, {'lr': get_lr(), 'samples': step*samples_per_step, 'steps': completed_steps, 'loss/train': loss.item()}) loss = loss / args.gradient_accumulation_steps accelerator.backward(loss) if step % args.gradient_accumulation_steps == 0: optimizer.step() lr_scheduler.step() optimizer.zero_grad() completed_steps += 1 if step % args.save_checkpoint_steps == 0: logger.info('Evaluating and saving model checkpoint') eval_loss, perplexity = evaluate() log_metrics(step, {'loss/eval': eval_loss, 'perplexity': perplexity}) accelerator.wait_for_everyone() unwrapped_model = accelerator.unwrap_model(model) if accelerator.is_main_process: unwrapped_model.save_pretrained("./") hf_repo.push_to_hub(commit_message=f'step {step}') model.train() if completed_steps >= args.max_train_steps: break # Evaluate and save the last checkpoint logger.info('Evaluating and saving model after training') eval_loss, perplexity = evaluate() log_metrics(step, {'loss/eval': eval_loss, 'perplexity': perplexity}) accelerator.wait_for_everyone() unwrapped_model = accelerator.unwrap_model(model) if accelerator.is_main_process: unwrapped_model.save_pretrained("./") hf_repo.push_to_hub(commit_message=f'final model') ``` <img alt="DDP" caption="Illustration of the processing steps in DDP with four GPUs" src="images/chapter10_ddp.png" id="ddp"/> ### The Training Run ## Results and Analysis ``` #hide_output from transformers import pipeline, set_seed model_ckpt = 'transformersbook/codeparrot-small' generation = pipeline('text-generation', model=model_ckpt, device=0) import re from transformers import set_seed def first_block(string): return re.split('\nclass|\ndef|\n#|\n@|\nprint|\nif', string)[0].rstrip() def complete_code(pipe, prompt, max_length=64, num_completions=4, seed=1): set_seed(seed) gen_kwargs = {"temperature":0.4, "top_p":0.95, "top_k":0, "num_beams":1, "do_sample":True,} code_gens = generation(prompt, num_return_sequences=num_completions, max_length=max_length, **gen_kwargs) code_strings = [] for code_gen in code_gens: generated_code = first_block(code_gen['generated_text'][len(prompt):]) code_strings.append(generated_code) print(('\n'+'='*80 + '\n').join(code_strings)) prompt = '''def area_of_rectangle(a: float, b: float): """Return the area of the rectangle."""''' complete_code(generation, prompt) prompt = '''def get_urls_from_html(html): """Get all embedded URLs in a HTML string."""''' complete_code(generation, prompt) import requests def get_urls_from_html(html): return [url for url in re.findall(r'<a href="(.*?)"', html) if url] print(" | ".join(get_urls_from_html(requests.get('https://hf.co/').text))) ``` > **NOTE**: In the following code block, a large GPT-2 checkpoint is loaded into memory. On platforms like Colab and Kaggle, this can cause the instance to crash due to insufficient RAM or GPU memory. You can still run the example if you replace the large model with the small one by using `model_ckpt = "transformersbook/codeparrot-small"`. ``` model_ckpt = 'transformersbook/codeparrot' generation = pipeline('text-generation', model=model_ckpt, device=0) prompt = '''# a function in native python: def mean(a): return sum(a)/len(a) # the same function using numpy: import numpy as np def mean(a):''' complete_code(generation, prompt, max_length=64) prompt = '''X = np.random.randn(100, 100) y = np.random.randint(0, 1, 100) # fit random forest classifier with 20 estimators''' complete_code(generation, prompt, max_length=96) ``` ## Conclusion
github_jupyter
# Introduction to Reinforcement Learning This Jupyter notebook and the others in the same folder act as supporting materials for **Chapter 21 Reinforcement Learning** of the book* Artificial Intelligence: A Modern Approach*. The notebooks make use of the implementations in `rl.py` module. We also make use of the implementation of MDPs in the `mdp.py` module to test our agents. It might be helpful if you have already gone through the Jupyter notebook dealing with the Markov decision process. Let us import everything from the `rl` module. It might be helpful to view the source of some of our implementations. ``` import os, sys sys.path = [os.path.abspath("../../")] + sys.path from rl4e import * ``` Before we start playing with the actual implementations let us review a couple of things about RL. 1. Reinforcement Learning is concerned with how software agents ought to take actions in an environment so as to maximize some notion of cumulative reward. 2. Reinforcement learning differs from standard supervised learning in that correct input/output pairs are never presented, nor sub-optimal actions explicitly corrected. Further, there is a focus on on-line performance, which involves finding a balance between exploration (of uncharted territory) and exploitation (of current knowledge). -- Source: [Wikipedia](https://en.wikipedia.org/wiki/Reinforcement_learning) In summary, we have a sequence of state action transitions with rewards associated with some states. Our goal is to find the optimal policy $\pi$ which tells us what action to take in each state. # Passive Reinforcement Learning In passive Reinforcement Learning the agent follows a fixed policy $\pi$. Passive learning attempts to evaluate the given policy $pi$ - without any knowledge of the Reward function $R(s)$ and the Transition model $P(s'\ |\ s, a)$. This is usually done by some method of **utility estimation**. The agent attempts to directly learn the utility of each state that would result from following the policy. Note that at each step, it has to *perceive* the reward and the state - it has no global knowledge of these. Thus, if a certain the entire set of actions offers a very low probability of attaining some state $s_+$ - the agent may never perceive the reward $R(s_+)$. Consider a situation where an agent is given the policy to follow. Thus, at any point, it knows only its current state and current reward, and the action it must take next. This action may lead it to more than one state, with different probabilities. For a series of actions given by $\pi$, the estimated utility $U$: $$U^{\pi}(s) = E(\sum_{t=0}^\inf \gamma^t R^t(s'))$$ Or the expected value of summed discounted rewards until termination. Based on this concept, we discuss three methods of estimating utility: direct utility estimation, adaptive dynamic programming, and temporal-difference learning. ### Implementation Passive agents are implemented in `rl4e.py` as various `Agent-Class`es. To demonstrate these agents, we make use of the `GridMDP` object from the `MDP` module. `sequential_decision_environment` is similar to that used for the `MDP` notebook but has discounting with $\gamma = 0.9$. The `Agent-Program` can be obtained by creating an instance of the relevant `Agent-Class`. The `__call__` method allows the `Agent-Class` to be called as a function. The class needs to be instantiated with a policy ($\pi$) and an `MDP` whose utility of states will be estimated. ``` from mdp import sequential_decision_environment ``` The `sequential_decision_environment` is a GridMDP object as shown below. The rewards are **+1** and **-1** in the terminal states, and **-0.04** in the rest. <img src="images/mdp.png"> Now we define actions and a policy similar to **Fig 21.1** in the book. ``` # Action Directions north = (0, 1) south = (0,-1) west = (-1, 0) east = (1, 0) policy = { (0, 2): east, (1, 2): east, (2, 2): east, (3, 2): None, (0, 1): north, (2, 1): north, (3, 1): None, (0, 0): north, (1, 0): west, (2, 0): west, (3, 0): west, } ``` This enviroment will be extensively used in the following demonstrations. ## Direct Utility Estimation (DUE) The first, most naive method of estimating utility comes from the simplest interpretation of the above definition. We construct an agent that follows the policy until it reaches the terminal state. At each step, it logs its current state, reward. Once it reaches the terminal state, it can estimate the utility for each state for *that* iteration, by simply summing the discounted rewards from that state to the terminal one. It can now run this 'simulation' $n$ times and calculate the average utility of each state. If a state occurs more than once in a simulation, both its utility values are counted separately. Note that this method may be prohibitively slow for very large state-spaces. Besides, **it pays no attention to the transition probability $P(s'\ |\ s, a)$.** It misses out on information that it is capable of collecting (say, by recording the number of times an action from one state led to another state). The next method addresses this issue. ### Examples The `PassiveDEUAgent` class in the `rl` module implements the Agent Program described in **Fig 21.2** of the AIMA Book. `PassiveDEUAgent` sums over rewards to find the estimated utility for each state. It thus requires the running of several iterations. ``` %psource PassiveDUEAgent ``` Now let's try the `PassiveDEUAgent` on the newly defined `sequential_decision_environment`: ``` DUEagent = PassiveDUEAgent(policy, sequential_decision_environment) ``` We can try passing information through the markove model for 200 times in order to get the converged utility value: ``` for i in range(200): run_single_trial(DUEagent, sequential_decision_environment) DUEagent.estimate_U() ``` Now let's print our estimated utility for each position: ``` print('\n'.join([str(k)+':'+str(v) for k, v in DUEagent.U.items()])) ``` ## Adaptive Dynamic Programming (ADP) This method makes use of knowledge of the past state $s$, the action $a$, and the new perceived state $s'$ to estimate the transition probability $P(s'\ |\ s,a)$. It does this by the simple counting of new states resulting from previous states and actions.<br> The program runs through the policy a number of times, keeping track of: - each occurrence of state $s$ and the policy-recommended action $a$ in $N_{sa}$ - each occurrence of $s'$ resulting from $a$ on $s$ in $N_{s'|sa}$. It can thus estimate $P(s'\ |\ s,a)$ as $N_{s'|sa}/N_{sa}$, which in the limit of infinite trials, will converge to the true value.<br> Using the transition probabilities thus estimated, it can apply `POLICY-EVALUATION` to estimate the utilities $U(s)$ using properties of convergence of the Bellman functions. ### Examples The `PassiveADPAgent` class in the `rl` module implements the Agent Program described in **Fig 21.2** of the AIMA Book. `PassiveADPAgent` uses state transition and occurrence counts to estimate $P$, and then $U$. Go through the source below to understand the agent. ``` %psource ``` We instantiate a `PassiveADPAgent` below with the `GridMDP` shown and train it for 200 steps. The `rl` module has a simple implementation to simulate a single step of the iteration. The function is called `run_single_trial`. ``` ADPagent = PassiveADPAgent(policy, sequential_decision_environment) for i in range(200): run_single_trial(ADPagent, sequential_decision_environment) ``` The utilities are calculated as : ``` print('\n'.join([str(k)+':'+str(v) for k, v in ADPagent.U.items()])) ``` When comparing to the result of `PassiveDUEAgent`, they both have -1.0 for utility at (3,1) and 1.0 at (3,2). Another point to notice is that the spot with the highest utility for both agents is (2,2) beside the terminal states, which is easy to understand when referring to the map. ## Temporal-difference learning (TD) Instead of explicitly building the transition model $P$, the temporal-difference model makes use of the expected closeness between the utilities of two consecutive states $s$ and $s'$. For the transition $s$ to $s'$, the update is written as: $$U^{\pi}(s) \leftarrow U^{\pi}(s) + \alpha \left( R(s) + \gamma U^{\pi}(s') - U^{\pi}(s) \right)$$ This model implicitly incorporates the transition probabilities by being weighed for each state by the number of times it is achieved from the current state. Thus, over a number of iterations, it converges similarly to the Bellman equations. The advantage of the TD learning model is its relatively simple computation at each step, rather than having to keep track of various counts. For $n_s$ states and $n_a$ actions the ADP model would have $n_s \times n_a$ numbers $N_{sa}$ and $n_s^2 \times n_a$ numbers $N_{s'|sa}$ to keep track of. The TD model must only keep track of a utility $U(s)$ for each state. ### Examples `PassiveTDAgent` uses temporal differences to learn utility estimates. We learn the difference between the states and back up the values to previous states. Let us look into the source before we see some usage examples. ``` %psource PassiveTDAgent ``` In creating the `TDAgent`, we use the **same learning rate** $\alpha$ as given in the footnote of the book: $\alpha(n)=60/(59+n)$ ``` TDagent = PassiveTDAgent(policy, sequential_decision_environment, alpha = lambda n: 60./(59+n)) ``` Now we run **200 trials** for the agent to estimate Utilities. ``` for i in range(200): run_single_trial(TDagent,sequential_decision_environment) ``` The calculated utilities are: ``` print('\n'.join([str(k)+':'+str(v) for k, v in TDagent.U.items()])) ``` When comparing to previous agents, the result of `PassiveTDAgent` is closer to `PassiveADPAgent`.
github_jupyter
``` ### duffing oscillator import matplotlib import numpy as np from numpy import zeros, linspace, pi, cos, array import numpy as np import matplotlib.pyplot as plt from matplotlib.patches import Polygon from matplotlib.patches import Circle from matplotlib.collections import PatchCollection from matplotlib.path import Path from matplotlib.patches import PathPatch t0=0 tf=30*pi omega=1.2 beta=1 delta=0.3 gamma=0.35 alpha=1 n=10000 #iteration sampsize=100 #SampleSize sampstart=5000 #SampleStart sampend=n #SampleEnd h=(tf-t0)/(n-1) #stepsize print('the value of h is',h) u0=0 #initial displacement t=linspace(t0,tf,n) v=zeros([n]) u=zeros([n]) u[0]=u0 v[0]=0 #initial velocity ##### DEFINING FUNCTIONS def dudt(t,u,v): #### u' = v return(v) def funt(t,u,v): #### v' = -delta*v+alpha*u-beta*u**3+gamma*cos(omega*t) return (-delta*v+alpha*u-beta*u**3+gamma*cos(omega*t)) ###### RK4 ALGORITHM USING FOR LOOP for i in range(1,n): k1=h*dudt(t[i-1],u[i-1],v[i-1]) l1=h*funt(t[i-1],u[i-1],v[i-1]) k2=h*dudt(t[i-1]+(0.5*h),u[i-1]+(k1*0.5),v[i-1]+(l1*0.5)) l2=h*funt(t[i-1]+(0.5*h),u[i-1]+(k1*0.5),v[i-1]+(l1*0.5)) k3=h*dudt(t[i-1]+(0.5*h),u[i-1]+(k2*0.5),v[i-1]+(l2*0.5)) l3=h*funt(t[i-1]+(0.5*h),u[i-1]+(k2*0.5),v[i-1]+(l2*0.5)) k4=h*dudt(t[i-1]+h,u[i-1]+(k3),v[i-1]+(l3)) l4=h*funt(t[i-1]+h,u[i-1]+(k3),v[i-1]+(l3)) u[i]=u[i-1]+(1/6)*(k1+(2*k2)+(2*k3)+k4) v[i]=v[i-1]+(1/6)*(l1+(2*l2)+(2*l3)+l4) ### PLOT plt.plot(t,u,'-r') plt.xlabel('time(t)') plt.ylabel('displacement(u)') plt.show() print('The value of GAMMA =',gamma) fig = plt.figure() plt.plot(u[sampstart:sampend],v[sampstart:sampend],'-g') plt.xlabel('displacement(u)') plt.ylabel('velocity(v)') plt.show() #### InterPlay import pandas as pd xx = lambda a: np.interp(a, (a.min(), a.max()), (0, +1)) uu = xx(u[sampstart:sampend:int(sampsize/2)]) vv = xx(v[sampstart:sampend:int(sampsize/2)]) huh = np.array(list(zip(uu,vv))) huh = huh[np.random.choice(huh.shape[0], sampsize, replace=False), :] u1,v1 = zip(*huh) #print(huh) pd.DataFrame(huh).to_csv("data/seed1_data.csv", header=['X_value','Y_value'], index=True, index_label='point_id') #### SAMPLING print("SAMPLING") fig = plt.figure() plt.plot(u1,v1,'.g') plt.xlabel('displacement(u)') plt.ylabel('velocity(v)') plt.show() my_data = huh from gudhi import * import gudhi rips_complex = gudhi.RipsComplex(points=my_data) simplex_tree = rips_complex.create_simplex_tree(max_dimension=2) result_str = 'Rips complex is of dimension ' + repr(simplex_tree.dimension()) + ' - ' + \ repr(simplex_tree.num_simplices()) + ' simplices - ' + \ repr(simplex_tree.num_vertices()) + ' vertices' print(result_str) BarCodes_RipsAll = simplex_tree.persistence() BarCodes_Rips1 = list(filter(lambda BettiNum: BettiNum[0] == 1, BarCodes_RipsAll)) gudhi.plot_persistence_barcode(BarCodes_Rips1) gudhi.plot_persistence_diagram(BarCodes_Rips1) entropy = representations.Entropy(normalized=True) print("Entropy for Dim 1 is {}".format(entropy(np.array([j for i, j in BarCodes_Rips1])))) max_filtration_value = np.array(list(simplex_tree.get_filtration()))[-1, 1] pointss = [[1, 1], [7, 0], [4, 6], [9, 6], [0, 14], [2, 19], [9, 17]] #for i in (gudhi.RipsComplex(points=pointss).create_simplex_tree().get_skeleton(2)): # print(i[0]) simplex_tree = gudhi.RipsComplex(points=pointss, max_edge_length=6.0).create_simplex_tree() #print(simplex_tree.persistence()) #list(simplex_tree.get_simplices()) def genDiagWithFilt(points, length): rc = gudhi.RipsComplex(points=points, max_edge_length=length) st = rc.create_simplex_tree(max_dimension=2) BarCodes_RipsAll = st.persistence() BarCodes_Rips1 = list( filter(lambda BettiNum: BettiNum[0] == 1, BarCodes_RipsAll)) max_filtration_value = np.array(list(st.get_filtration()))[-1, 1] # We are only going to plot the triangles triangles = np.array([s[0] for s in st.get_skeleton(2) if len(s[0]) == 3]) return max_filtration_value, triangles, BarCodes_Rips1 from IPython.display import display import ipywidgets as widgets from ipywidgets import interact, interact_manual @interact def blah(length=(max_filtration_value/10,max_filtration_value,max_filtration_value/10)): max_filtration_value, triangles, BarCodes_Rips1 = genDiagWithFilt(huh, length=length) fig2, ax2 = plt.subplots() ax2.set_aspect('equal') ax2.triplot(u1, v1, triangles, 'go-', lw=1.0, alpha=0.5) ax2.set_title('triplot of user-specified triangulation, filtration: {}'.format(max_filtration_value)) ax2.set_xlabel('Longitude (degrees)') ax2.set_ylabel('Latitude (degrees)') plt.show() gudhi.plot_persistence_barcode(BarCodes_Rips1) fig2, ax2 = plt.subplots() patches = [] hey = [i[0] for i in st.get_skeleton(2)] kalel = [huh[j] for j in hey] for x1, y1 in huh: circle = Circle((x1, y1), max_filtration_value, alpha=0.1) patches.append(circle) for kkk in kalel: if len(kkk) == 2: path_data = [(Path.MOVETO, kkk[0]), (Path.LINETO, kkk[1]),] codes, verts = zip(*path_data) path = Path(verts, codes) patch = PathPatch(path, edgecolor='black', alpha=0.7) ax2.add_patch(patch) if len(kkk) > 2: polygon = Polygon(kkk, edgecolor='black', alpha=0.7) patches.append(polygon) p = PatchCollection(patches, cmap=matplotlib.cm.jet, alpha=0.1) colors = 100*np.random.rand(len(patches)) p.set_array(np.array(colors)) plt.ylim((-0.1, 1.1)) plt.xlim((-0.1, 1.1)) ax2.add_collection(p) #plt.plot(u1,v1,'.g') plt.show() import numpy as np import gudhi import matplotlib.pyplot as plt import matplotlib.tri as tri import numpy as np points = huh rc = gudhi.RipsComplex(points=points, max_edge_length=0.1) st = rc.create_simplex_tree(max_dimension=2) BarCodes_RipsAll = st.persistence() BarCodes_Rips1 = list(filter(lambda BettiNum: BettiNum[0] == 1, BarCodes_RipsAll)) max_filtration_value = np.array(list(st.get_filtration()))[-1,1] # We are only going to plot the triangles triangles = np.array([s[0] for s in st.get_skeleton(2) if len(s[0])==3]) fig21, ax21 = plt.subplots() ax21.set_aspect('equal') ax21.triplot(u1, v1, triangles, 'go-', lw=1.0, alpha=0.5, ms=max_filtration_value*100) ax21.set_title('triplot of user-specified triangulation') ax21.set_xlabel('Longitude (degrees)') ax21.set_ylabel('Latitude (degrees)') plt.show() print("Max Filtration is {}".format(max_filtration_value)) gudhi.plot_persistence_barcode(BarCodes_Rips1) ```
github_jupyter
# Sample authors while controlling for year-of-first-publication For each editor, this notebook samples a set of authors whose year-of-first-publication matches that of the editor. For the sake of demonstration, we picked a subset of authors to match against so that the code could finish in a reasonable amount of time. ``` import pandas as pd import numpy as np from tqdm.notebook import tqdm editors = pd.read_csv("../data/SampleEditors.csv", sep='\t', dtype={'issn':str,'NewAuthorId':int,'start_year':int,'end_year':int}) editors.shape editor_career = pd.read_csv('../data/EditorCareerDiscipline.csv',sep='\t', dtype={'NewAuthorId':int,'Yfp':int,'Ylp':int,'Parent':int}) editor_career.shape %%time # the first year that an author has a known affiliation first_year = pd.read_csv('../data/figure_1/FirstYearWithKnownAff.csv',sep='\t', dtype={'NewAuthorId':int,'Year':int}) first_year = first_year.rename(columns={'Year':'FirstYear'}) print(first_year.shape) %%time author_career = pd.read_csv('../data/figure_1/AuthorEraDisp.csv', sep='\t', memory_map=True, usecols=['NewAuthorId', 'Parent', 'Yfp', 'Ylp'], # dtype={'NewAuthorId':int, 'Yfp':int, 'Ylp':int, 'Parent':int}) print(author_career.shape) editors = editors.merge(editor_career, on='NewAuthorId') print(editors.shape) def sample(df, year): dfs = [] for seed in range(50): np.random.seed(seed) sampled = df.groupby(['EditorsNewId','issn']).apply( lambda x: x.filter([np.random.choice(x.index)], axis=0)).reset_index(drop=True) dfs.append(sampled) return pd.concat(dfs, ignore_index=True, sort=False) def match(editors, author_career): dfs = [] for year in tqdm(range(editors.Yfp.max(), editors.Yfp.min()-1, -1)): edi = editors[editors.Yfp == year] aut = author_career[author_career.Yfp == year] if edi.shape[0] == 0 or aut.shape[0] == 0: continue matched = edi.rename(columns={'NewAuthorId':'EditorsNewId'}).merge(aut, on='Yfp') matched = matched[~matched.NewAuthorId.isin(editors.NewAuthorId)] # make sure that at least one aff was known before matched = matched.merge(first_year, on='NewAuthorId') matched = matched[matched.start_year >= matched.FirstYear] sampled = sample(matched, year) dfs.append(sampled) return pd.concat(dfs, ignore_index=True, sort=False) %%time matched = match(editors, author_career) print(matched.shape) matched.head() ```
github_jupyter
Import Packages ``` import pandas as pd pd.set_option('display.max_columns', None) import numpy as np from sklearn import preprocessing import time from datetime import datetime, date, time from IPython.core.interactiveshell import InteractiveShell InteractiveShell.ast_node_interactivity = "all" import warnings warnings.filterwarnings('ignore') import copy ``` Completed Functions ``` # CRS_ELAPSED_TIME --> HAUL_LENGTH def haul(df, col): '''Determine if flight length is SHORT, MEDIUM or LONG based on expected elapsed flight time. Input: (0) df containing flight information, (1) column containing the elapsed flight time in minutes Output: 'haul_length' column determining haul length category per row in df''' length=[] for i in df[col]: if i < (3*60): # up to 3 hours length.append(0) # 0 = SHORT HAUL elif (i >= (3*60)) and (i < (6*60)): # 3-6 hours length.append(1) # 1 = MEDIUM HAUL elif i >= (6*60):# 6+ hours length.append(2) # 2 = LONG HAUL df['haul_length'] = length # example of implementation: haul(flight10k, 'crs_elapsed_time') # CRS_DEP_TIME (hhmm) --> CRS_DEP_TIME (hh) -- to be used within time_day function def gethour(df,col): '''Convert hhmm to hh (24-hr) hour-only output Input: (0) df containing flight information, (1) column containing the hhmm time Output: rewrite on input column in rounded hh format''' values = [] for i in df[col]: mins = (i % 100) / 60 hour = i // 100 hh = round(hour+mins) values.append(hh) df[col] = values # example of implementation: gethour(flight10k, 'crs_dep_time') # CRS_DEP/ARR_TIME (hhmm) --> hot encoded categorical time of day 'morning, aft...' def time_day(df, col): ''' Input: (0) df containing flight information (1) corresponding column of time of flight (i.e. departure or arrival) (format hhmm) Output: rewrite of time column into categorical MORNING, AFTERNOON, EVENING, or OVERNIGHT''' gethour(df, col) timeday = [] for i in df[col]: if (i>=23) or (i<5): timeday.append(0) # 0 = OVERNIGHT elif (i>=5) and (i<12): timeday.append(1) # 1 = MORNING elif (i>=12) and (i<18): timeday.append(2) # 2 = AFTERNOON elif (i>=18) and (i<23): timeday.append(3) # 3 = EVENING return timeday # example of implementation: time_day(flight10k, 'crs_dep_time') ``` Open CSVs of Pre-Evaluated Features ``` airline_rating = pd.read_csv('data/airline_delay_rating.csv', index_col=0) origin_traffic = pd.read_csv('data/origin_traffic_rating.csv', index_col=0) origin_delay = pd.read_csv('data/origin_delay_rating.csv', index_col=0) dest_traffic = pd.read_csv('data/dest_traffic_rating.csv', index_col=0) delay_dep_h = pd.read_csv('data/crs_dep_time_delay_rating.csv', index_col=0) delay_arr_h = pd.read_csv('data/crs_arr_time_delay_rating.csv', index_col=0) weather_df = pd.read_csv('data/weather_df_monthlymean_bins.csv', index_col=0) ``` Open CSV of Flight Information to Model ``` # This is for the dataset you want to investigate flights = pd.read_csv('data/flights250K.csv', index_col=0) flights.head(1) flights.shape ``` Build df based on columns we will use in transformation - Data Cleaning and Feature Implementation **See option A or B in first rows to build df based on training or test dataset** (for copy pasta later) ``` # A - if this is a training dataset, we need arr_delay as our target variable so use this first block of code model_df = flights[flights['cancelled'] == 0][['arr_delay','fl_date','op_unique_carrier','origin','dest','crs_dep_time','crs_arr_time','crs_elapsed_time','distance']] # B - if this is a testing dataset, we will not have arr_delay and cannot include it #model_df = flights[['tail_num','op_carrier_fl_num','fl_date','op_unique_carrier','origin','dest','crs_dep_time','crs_arr_time','crs_elapsed_time','distance']] # first regression will be simple-- is the flight going to be delayed or not? if 'arr_delay' in model_df: model_df['delay_flag'] = model_df['arr_delay'].map(lambda x: 0 if x <= 0 else 1) # new target 0 or 1 arr_delay = model_df['arr_delay'].values # to add back in later, let's store these values for us model_df.drop(columns='arr_delay', inplace=True) # not our current target variable anymore # convert date to datetime in order to grab the month model_df['fl_date'] = pd.to_datetime(model_df['fl_date']) #model_df['year'] = model_df['fl_date'].dt.year # decided I do not want year model_df['month'] = model_df['fl_date'].dt.month model_df['day'] = model_df['fl_date'].dt.day model_df['weekday'] = model_df['fl_date'].dt.dayofweek model_df.drop(columns='fl_date', inplace=True) # this won't be needed after we got month # join weather columns by origin and destination per each monthly average model_df = model_df.merge(weather_df, left_on=['month','origin'], right_on=['month','airport'], how='left') model_df.rename(columns={'mean_precip_monthly':'origin_precip_monthly','mean_snow_monthly':'origin_snow_monthly','mean_wind_monthly':'origin_wind_monthly','mean_cloud_monthly':'origin_cloud_monthly'}, inplace=True) model_df.drop(columns='airport', inplace=True) model_df = model_df.merge(weather_df, left_on=['month','dest'], right_on=['month','airport'], how='left') model_df.rename(columns={'mean_precip_monthly':'dest_precip_monthly','mean_snow_monthly':'dest_snow_monthly','mean_wind_monthly':'dest_wind_monthly','mean_cloud_monthly':'dest_cloud_monthly'}, inplace=True) model_df.drop(columns='airport', inplace=True) model_df = model_df.fillna(0) # set delay rating based on expected performance of the airline model_df = model_df.merge(airline_rating, left_on='op_unique_carrier', right_on='airline', how='left') model_df.drop(columns=['airline'],inplace=True) # obtain haul length of the flight using haul function defined above haul(model_df, 'crs_elapsed_time') # model_df.drop(columns=['crs_elapsed_time'],inplace=True) # new column of categorical time of day information using time_day function defined above as well as expected delays relating to the time of day departure model_df['dep_timeday'] = time_day(model_df, 'crs_dep_time') model_df['arr_timeday'] = time_day(model_df, 'crs_arr_time') model_df = model_df.merge(delay_dep_h, left_on='crs_dep_time', right_on='crs_dep_time', how='left') model_df = model_df.merge(delay_arr_h, left_on='crs_arr_time', right_on='crs_arr_time', how='left') #model_df.drop(columns=['crs_dep_time','crs_arr_time'],inplace=True) # classify the expected traffic of the origin and departure airports model_df = model_df.merge(origin_traffic, left_on='origin', right_on='origin', how='left') model_df = model_df.merge(dest_traffic, left_on='dest', right_on='dest', how='left') model_df['busy_origin'].fillna(value=model_df['busy_origin'].mean(), inplace=True) model_df['busy_dest'].fillna(value=model_df['busy_dest'].mean(), inplace=True) model_df = model_df.merge(origin_delay, left_on='origin', right_on='origin', how='left') #model_df.drop(columns=['origin','dest'],inplace=True) # currently hashed out the dropping of the raw features to test out improved correlations - to keep cat feats we need to encode # label encode values for identification of the flight later le = preprocessing.LabelEncoder() model_df['op_unique_carrier'] = le.fit_transform(model_df['op_unique_carrier'].values) model_df['origin'] = le.fit_transform(model_df['origin'].values) model_df['dest'] = le.fit_transform(model_df['dest'].values) # have a look at the dataset model_df.head(10) model_df.shape ``` Import More Packages ``` from sklearn.preprocessing import MinMaxScaler, RobustScaler, StandardScaler from sklearn.model_selection import train_test_split from sklearn.model_selection import GridSearchCV from sklearn.model_selection import cross_val_score from sklearn.linear_model import LogisticRegression from sklearn.ensemble import RandomForestClassifier from sklearn.metrics import r2_score from sklearn import metrics import seaborn as sns; sns.set(style='darkgrid', context='talk') import matplotlib.pyplot as plt ``` Data Scaling ``` if 'delay_flag' in model_df: # training dataset X = model_df.drop(columns=['delay_flag']) else: # testset X = model_df y = model_df['delay_flag'] X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.2, random_state=42) scaler = RobustScaler() scaler.fit(X_train) X_train = scaler.transform(X_train) X_test = scaler.transform(X_test) ``` Random Forest Classifier for is it a delay or not? -- run in colab, took 2.25 hours for no further improvement to log reg ``` #%%time #tree_params = {"n_estimators": [100, 250, 500, 750, 1000], # 'max_depth': [int(x) for x in np.linspace(1, 32, num = 5)]} #grid_tree = GridSearchCV(RandomForestClassifier(), tree_params, cv=3, verbose=1, n_jobs=-1) #grid_tree.fit(X_train, y_train) #forest = grid_tree.best_estimator_ #forest.best_params_ #forest_score = cross_val_score(forest, X_train, y_train, cv=3) #print('Random Forest Classifier Cross Validation Score: ', round(forest_score.mean() * 100, 2).astype(str) + '%') #print("Training Score: ", round(grid_tree.best_score_,2)) #print(f"Residual Sum of Squares (RSS): {round(np.mean((grid_tree.predict(X_test) - y_test) ** 2),2)}") #y_forest = forest.predict(X_test) #y_forest_proba = forest.predict_proba(X_test) #print('\nRandom Forest Classifier - y_test') #metrics.confusion_matrix(y_test, y_forest) #print('AUC Score \t{:.2f}\n'.format(metrics.roc_auc_score(y_test, y_forest_proba, multi_class='ovr', average="weighted"))) ``` Logistic Regression -- is it a delay or not? ``` import pickle %%time # Logistic Regression log_params = {'penalty': ['l1', 'l2'], 'C': np.logspace(-4, 4, 20)} grid_log = GridSearchCV(LogisticRegression(solver='liblinear'), log_params, cv=5, verbose=True, n_jobs=-1) grid_log.fit(X_train, y_train) logreg = grid_log.best_estimator_ print(grid_log.best_params_,'\n') print("Training R2 / Variance: ", round(grid_log.best_score_,2)) print(f"Residual Sum of Squares (RSS): {round(np.mean((grid_log.predict(X_test) - y_test) ** 2),2)}") y_logreg = logreg.predict(X_test) print('\nLogistic Regression - y_test') #print('Test R2 Score \t{:.2f}'.format(metrics.r2_score(y_test, y_logreg))) print('Recall \t\t{:.2f}'.format(metrics.recall_score(y_test, y_logreg))) print('Precision \t{:.2f}'.format(metrics.precision_score(y_test, y_logreg))) print('F1 Score \t{:.2f}'.format(metrics.f1_score(y_test, y_logreg))) print('Accuracy \t{:.2f} <--'.format(metrics.accuracy_score(y_test, y_logreg))) print('AUC Score \t{:.2f}\n'.format(metrics.roc_auc_score(y_test, y_logreg))) filename = 'model1_logreg_delayornot.sav' pickle.dump(logreg, open(filename, 'wb')) # load from pickle re_logreg = pickle.load(open(filename, 'rb')) result = re_logreg.score(X_test, y_test) print('Re-Loaded from Pickle: ', result) ``` Wow Pickle, you're a nice feature. Note: LogReg takes 7 minutes for 200 fits. If reloading from pickle, reminder to update logreg to re_logreg in the following cells. Re-ran this in COLAB -- also 7 minutes ``` y_score = logreg.decision_function(X_test) from sklearn.metrics import average_precision_score average_precision = average_precision_score(y_test, y_score, average='micro') from sklearn.metrics import plot_precision_recall_curve disp = plot_precision_recall_curve(logreg, X_test, y_test); disp.ax_.set_title('2-class Precision-Recall curve: ' 'AP={0:0.2f}'.format(average_precision)); ``` That's unfortunate... bad recall = lacking sensitivity. Too high of false negatives -- overpredicting NON-DELAY ``` y_pred_proba = logreg.predict_proba(X_test)[::,1] fpr, tpr, _ = metrics.roc_curve(y_test, y_pred_proba) auc = metrics.roc_auc_score(y_test, y_pred_proba) plt.plot(fpr,tpr,label="data 1, auc="+str(auc)) plt.legend(loc=4) plt.show() ``` Getting sad now that I can't even tell if it's a delay or not simply. For reference, by chance = auc of 0.5 Let's predict the entire X now so we can implement this result as a column in the model_df to progress into another model that defines 'how much' the delay will be if we were lucky enough to classify it as a delay in the first model. ``` y_logregX = logreg.predict(X) if 'delay_pred' not in model_df: model_df['delay_pred'] = y_logregX model_df['arr_delay'] = arr_delay model_df.dropna(inplace=True) model_df.drop(columns='delay_flag', inplace=True) delayed = model_df['delay_pred'] == 1 model_df2 = model_df[delayed] model_df2.head(1) model_df2.shape delay_bin = [] for i in model_df2['arr_delay']: if i <= 5: delay_bin.append(0) # no delay (within 5 minutes) elif (i > 5) and (i <= 10): delay_bin.append(1) # expect a 5 to 10 minute delay elif (i > 10) and (i <= 20): delay_bin.append(2) # expect a 10 to 20 minute delay elif (i >= 20) and (i <= 45): delay_bin.append(3) # expect a 20 to 45 minute delay elif (i > 45): delay_bin.append(4) # expect a 45+ minute delay model_df2['delay_range'] = delay_bin if 'arr_delay' in model_df2: model_df2.drop(columns='arr_delay', inplace=True) model_df2.head(1) model_df2.shape #model_df2['delay_range'].value_counts() # we filtered for all delay_pred==1 -- so we might as well drop this column model_df2.drop(columns='delay_pred', inplace=True) ``` Second Model: Arrival Delay Range Prediction Data Scaling ``` if 'delay_range' in model_df2: # training dataset X = model_df2.drop(columns=['delay_range']) else: # testset X = model_df2 y = model_df2['delay_range'] X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.2, random_state=42) scaler = RobustScaler() scaler.fit(X_train) X_train = scaler.transform(X_train) X_test = scaler.transform(X_test) ``` Random Forest Classifier -- can we predict the predicted delay's time allotment? ``` %%time tree_params = {"n_estimators": [100, 250, 500, 750, 1000], 'max_depth': [int(x) for x in np.linspace(1, 32, num = 5)]} grid_tree = GridSearchCV(RandomForestClassifier(), tree_params, cv=3, verbose=1, n_jobs=-1) grid_tree.fit(X_train, y_train) forest = grid_tree.best_estimator_ forest.best_params_ forest_score = cross_val_score(forest, X_train, y_train, cv=3) print('Random Forest Classifier Cross Validation Score: ', round(forest_score.mean() * 100, 2).astype(str) + '%') print("Training Score: ", round(grid_tree.best_score_,2)) filename = 'model2_randforest_delayrange.sav' pickle.dump(logreg, open(filename, 'wb')) ``` Note for RandomForestClassifier: 75 fits ran for ... minutes -- it was cpu terminated on my computer many times. :( I've run it in colab now which will be saved to git under the same name + COLAB FINAL ``` # load from pickle re_forest = pickle.load(open(filename, 'rb')) result = re_forest.score(X_test, y_test) print('Re-Loaded from Pickle: ', result) y_forest = forest.predict(X_test) y_forest_proba = forest.predict_proba(X_test) print('\nRandom Forest Classifier - y_test') metrics.confusion_matrix(y_test, y_forest) print('AUC Score \t{:.2f}\n'.format(metrics.roc_auc_score(y_test, y_forest_proba, multi_class='ovr', average="weighted"))) ```
github_jupyter
# Part 4: Projects and Automated ML Pipeline This part of the MLRun getting-started tutorial walks you through the steps for working with projects, source control (git), and automating the ML pipeline. MLRun Project is a container for all your work on a particular activity: all the associated code, functions, jobs/workflows and artifacts. Projects can be mapped to `git` repositories to enable versioning, collaboration, and CI/CD. You can create project definitions using the SDK or a yaml file and store those in MLRun DB, file, or archive. Once the project is loaded you can run jobs/workflows which refer to any project element by name, allowing separation between configuration and code. See the [Projects, Automation & CI/CD](../projects/overview.md) section for details. Projects contain `workflows` that execute the registered functions in a sequence/graph (DAG), and which can reference project parameters, secrets and artifacts by name. MLRun currently supports two workflow engines, `local` (for simple tasks) and [Kubeflow Pipelines](https://www.kubeflow.org/docs/pipelines/pipelines-quickstart/) (for more complex/advanced tasks). MLRun also supports a real-time workflow engine (see [MLRun serving graphs](../serving/serving-graph.md)). > **Note**: The Iguazio Data Science Platform has a default (pre-deployed) shared Kubeflow Pipelines service (`pipelines`). An ML Engineer can gather the different functions created by the Data Engineer and Data Scientist and create this automated pipeline. The tutorial consists of the following steps: 1. [Setting up Your Project](#gs-tutorial-4-step-setting-up-project) 2. [Updating Project and Function Definitions](#gs-tutorial-4-step-import-functions) 3. [Defining and Saving a Pipeline Workflow](#gs-tutorial-4-step-pipeline-workflow-define-n-save) 4. [Registering the Workflow](#gs-tutorial-4-step-register-workflow) 5. [Running A Pipeline](#gs-tutorial-4-step-run-pipeline) 6. [Viewing the Pipeline on the Dashboard (UI)](#gs-tutorial-4-step-ui-pipeline-view) 7. [Invoking the Model](#gs-tutorial-4-step-invoke-model) By the end of this tutorial you'll learn how to: - Create an operational pipeline using previously defined functions. - Run the pipeline and track the pipeline results. <a id="gs-tutorial-4-prerequisites"></a> ## Prerequisites The following steps are a continuation of the previous parts of this getting-started tutorial and rely on the generated outputs. Therefore, make sure to first run parts [1](01-mlrun-basics.ipynb)&mdash;[3](03-model-serving.ipynb) of the tutorial. <a id="gs-tutorial-4-step-setting-up-project"></a> ## Step 1: Setting Up Your Project To run a pipeline, you first need to create a Python project object and import the required functions for its execution. Create a project by using one of: - the `new_project` MLRun method - the `get_or_create_project`method: loads a project from the MLRun DB or the archive/context if it exists, or creates a new project if it doesn't exist. Both methods have the following parameters: - **`name`** (required) &mdash; the project name. - **`context`** &mdash; the path to a local project directory (the project's context directory). The project directory contains a project-configuration file (default: **project.yaml**) that defines the project, and additional generated Python code. The project file is created when you save your project (using the `save` MLRun project method or when saving your first function within the project). - **`init_git`** &mdash; set to `True` to perform Git initialization of the project directory (`context`) in case its not initialized. > **Note:** It's customary to store project code and definitions in a Git repository. The following code gets or creates a user project named "getting-started-&lt;username&gt;". > **Note:** Platform projects are currently shared among all users of the parent tenant, to facilitate collaboration. Therefore: > > - Set `user_project` to `True` if you want to create a project unique to your user. > You can easily change the default project name for this tutorial by changing the definition of the `project_name_base` variable in the following code. > - Don't include in your project proprietary information that you don't want to expose to other users. > Note that while projects are a useful tool, you can easily develop and run code in the platform without using projects. ``` import mlrun # Set the base project name project_name_base = 'getting-started' # Initialize the MLRun project object project = mlrun.get_or_create_project(project_name_base, context="./", user_project=True, init_git=True) print(f'Project name: {project.metadata.name}') ``` <a id="gs-tutorial-4-step-import-functions"></a> ## Step 2: Updating Project and Function Definitions You must save the definitions for the functions used in the project so that you can automatically convert code to functions, import external functions when you load new versions of MLRun code, or run automated CI/CD workflows. In addition, you might want to set other project attributes such as global parameters, secrets, and data. The code can be stored in Python files, notebooks, external repositories, packaged containers, etc. Use the `project.set_function()` method to register the code in the project. The definitions are saved to the project object as well as in a YAML file in the root of the project. Functions can also be imported from MLRun marketplace (using the `hub://` schema). This tutorial uses the functions: - `prep-data` &mdash; the first function, which ingests the Iris data set (in Notebook 01) - `describe` &mdash; generates statistics on the data set (from the marketplace) - `train-iris` &mdash; the model-training function (in Notebook 02) - `test-classifier` &mdash; the model-testing function (from the marketplace) - `mlrun-model` &mdash; the model-serving function (in Notebook 03) > Note: `set_function` uses the `code_to_function` and `import_function` methods under the hood (used in the previous notebooks), but in addition it saves the function configurations in the project spec for use in automated workflows and CI/CD. Add the function definitions to the project along with parameters and data artifacts, and save the project. <a id="gs-tutorial-4-view-project-functions"></a> ``` project.set_function('01-mlrun-basics.ipynb', 'prep-data', kind='job', image='mlrun/mlrun') project.set_function('02-model-training.ipynb', 'train', kind='job', image='mlrun/mlrun', handler='train_iris') project.set_function('hub://describe', 'describe') project.set_function('hub://test_classifier', 'test') project.set_function('hub://v2_model_server', 'serving') # set project level parameters and save project.spec.params = {'label_column': 'label'} project.save() ``` <br>When you save the project it stores the project definitions in the `project.yaml`. This means that you can load the project from the source control (GIT) and run it with a single command or API call. The project YAML for this project can be printed using: ``` print(project.to_yaml()) ``` ### Saving and Loading Projects from GIT After you save the project and its elements (functions, workflows, artifacts, etc.) you can commit all the changes to a GIT repository. Use the standard GIT tools or use the MLRun `project` methods such as `pull`, `push`, `remote`, which call the Git API for you. Projects can then be loaded from Git using the MLRun `load_project` method, for example: project = mlrun.load_project("./myproj", "git://github.com/mlrun/project-demo.git", name=project_name) or using MLRun CLI: mlrun project -n myproj -u "git://github.com/mlrun/project-demo.git" ./myproj Read the [Projects, Automation & CI/CD](../projects/overview.md) section for more details <a id="gs-tutorial-4-kubeflow-pipelines"></a> ### Using Kubeflow Pipelines You're now ready to create a full ML pipeline. This is done by using [Kubeflow Pipelines](https://www.kubeflow.org/docs/pipelines/overview/pipelines-overview/) &mdash; an open-source framework for building and deploying portable, scalable machine-learning workflows based on Docker containers. MLRun leverages this framework to take your existing code and deploy it as steps in the pipeline. > **Note:** When using the Iguazio Data Science Platform, Kubeflow Pipelines is available as a default (pre-deployed) shared platform service. <a id="gs-tutorial-4-step-pipeline-workflow-define-n-save"></a> ## Step 3: Defining and Saving a Pipeline Workflow A pipeline is created by running an MLRun **"workflow"**. The following code defines a workflow and writes it to a file in your local directory, with the file name **workflow.py**. The workflow describes a directed acyclic graph (DAG) for execution using Kubeflow Pipelines, and depicts the connections between the functions and the data as part of an end-to-end pipeline. The workflow file has two parts: initialization of the function objects, and definition of a pipeline DSL (domain-specific language) for connecting the function inputs and outputs. Examine the code to see how function objects are initialized and used (by name) within the workflow. The defined pipeline includes the following steps: - Ingest the Iris flower data set (`ingest`). - Train and the model (`train`). - Test the model with its test data set. - Deploy the model as a real-time serverless function (`deploy`). > **Note**: A pipeline can also include continuous build integration and deployment (CI/CD) steps, such as building container images and deploying models. ``` %%writefile './workflow.py' from kfp import dsl from mlrun import run_function, deploy_function DATASET = 'cleaned_data' MODEL = 'iris' LABELS = "label" # Create a Kubeflow Pipelines pipeline @dsl.pipeline( name="Getting-started-tutorial", description="This tutorial is designed to demonstrate some of the main " "capabilities of the Iguazio Data Science Platform.\n" "The tutorial uses the Iris flower data set." ) def kfpipeline(source_url): # Ingest the data set ingest = run_function( 'prep-data', handler='prep_data', inputs={'source_url': source_url}, params={'label_column': LABELS}, outputs=[DATASET]) # Train a model train = run_function( "train", params={"label_column": LABELS}, inputs={"dataset": ingest.outputs[DATASET]}, outputs=['my_model', 'test_set']) # Test and visualize the model test = run_function( "test", params={"label_column": LABELS}, inputs={"models_path": train.outputs['my_model'], "test_set": train.outputs['test_set']}) # Deploy the model as a serverless function deploy = deploy_function("serving", models={f"{MODEL}_v1": train.outputs['my_model']}) ``` <a id="gs-tutorial-4-step-register-workflow"></a> ## Step 4: Registering the Workflow Use the `set_workflow` MLRun project method to register your workflow with MLRun. The following code sets the `name` parameter to the selected workflow name ("main") and the `code` parameter to the name of the workflow file that is found in your project directory (**workflow.py**). ``` # Register the workflow file as "main" project.set_workflow('main', 'workflow.py') ``` <a id="gs-tutorial-4-step-run-pipeline"></a> ## Step 5: Running A Pipeline First run the following code to save your project: ``` project.save() ``` Use the `run` MLRun project method to execute your workflow pipeline with Kubeflow Pipelines. The tutorial code sets the following method parameters; (for the full parameters list, see the [MLRun documentation](../api/mlrun.run.html#mlrun.run.run_pipeline) or embedded help): - **`name`** &mdash; the workflow name (in this case, "main" &mdash; see the previous step). - **`arguments`** &mdash; A dictionary of Kubeflow Pipelines arguments (parameters). The tutorial code sets this parameter to an empty arguments list (`{}`), but you can edit the code to add arguments. - **`artifact_path`** &mdash; a path or URL that identifies a location for storing the workflow artifacts. You can use `{{workflow.uid}}` in the path to signify the ID of the current workflow run iteration. The tutorial code sets the artifacts path to a **&lt;worker ID&gt;** directory (`{{workflow.uid}}`) in a **pipeline** directory under the projects container (**/v3io/projects/getting-started-tutorial-project name/pipeline/&lt;worker ID&gt;**). - **`dirty`** &mdash; set to `True` to allow running the workflow also when the project's Git repository is dirty (i.e., contains uncommitted changes). (When the notebook that contains the execution code is in the same Git directory as the executed workflow, the directory will always be dirty during the execution.) - **`watch`** &mdash; set to `True` to wait for the pipeline to complete and output the execution graph as it updates. The `run` method returns the ID of the executed workflow, which the code stores in a `run_id` variable. You can use this ID to track the progress or your workflow, as demonstrated in the following sections. > **Note**: You can also run the workflow from a command-line shell by using the `mlrun` CLI. > The following CLI command defines a similar execution logic as that of the `run` call in the tutorial: > ``` > mlrun project /User/getting-started-tutorial/conf -r main -p "$V3IO_HOME_URL/getting-started-tutorial/pipeline/{{workflow.uid}}/" > ``` ``` source_url = mlrun.get_sample_path("data/iris/iris.data.raw.csv") import os pipeline_path = mlrun.mlconf.artifact_path run_id = project.run( 'main', arguments={'source_url' : source_url}, artifact_path=os.path.join(pipeline_path, "pipeline", '{{workflow.uid}}'), dirty=True, watch=True) ``` <a id="gs-tutorial-4-step-ui-pipeline-view"></a> ## Step 6: Viewing the Pipeline on the Dashboard (UI) In the **Projects > Jobs and Workflows > Monitor Workflows** tab, press the workflow name to view a graph of the workflow. Press any step to open another pane with full details of the step: either the job's overview, inputs, artifacts, etc.; or the deploy / build function's overview, code, and log. After the pipelines execution completes, you should be able to view the pipeline and see its functions: - `prep-data` - `train` - `test` - `deploy-serving` The graph is refreshed while the pipeline is running. <img src="../_static/images/job_pipeline.png" alt="pipeline" width="700"/> <a id="gs-tutorial-4-step-invoke-model"></a> ## Step 7: Invoking the Model Now that your model is deployed using the pipeline, you can invoke it as usual: ``` serving_func = project.func('serving') my_data = {'inputs': [[5.1, 3.5, 1.4, 0.2],[7.7, 3.8, 6.7, 2.2]]} serving_func.invoke('/v2/models/iris_v1/infer', my_data) ``` You can also make an HTTP call directly: ``` import requests import json predict_url = f'http://{serving_func.status.address}/v2/models/iris_v1/predict' resp = requests.put(predict_url, json=json.dumps(my_data)) print(resp.json()) ``` <a id="gs-tutorial-4-done"></a> ## Done! Congratulations! You've completed the getting started tutorial. You might also want to explore the following demos: - For an example of distributed training of an image-classification pipeline using TensorFlow (versions 1 or 2), Keras, and Horovod, see the [**image-classification with distributed training demo**](https://github.com/mlrun/demos/tree/release/v0.6.x-latest/image-classification-with-distributed-training). - To learn more about deploying live endpoints and concept drift, see the [**network-operations (NetOps) demo**](https://github.com/mlrun/demos/tree/release/v0.6.x-latest/network-operations). - To learn how to deploy your model with streaming information, see the [**model-deployment pipeline demo**](https://github.com/mlrun/demos/tree/release/v0.6.x-latest/model-deployment-pipeline). For additional information and guidelines, see the MLRun [**How-To Guides and Demos**](../howto/index.md).
github_jupyter
# SGT ($\beta \neq 0 $) calculation for fluids mixtures with SAFT-$\gamma$-Mie In this notebook, the SGT ($\beta \neq 0 $) calculations for fluid mixtures with ```saftgammamie``` EoS are illustrated. When using $\beta \neq 0 $, the cross-influence parameters are computed as $c_{ij} = (1-\beta_{ij})\sqrt{c_{ii}c_{jj}}$. First, all the needed modules are imported. - numpy: numerical interface and work with arrays - matplotlib: to plot results - sgtpy: package with SAFT-$\gamma$-Mie EoS and SGT functions. ``` import numpy as np import matplotlib.pyplot as plt from sgtpy import component, mixture, saftgammamie ``` Now, pure components are configured and created with the ```component``` function. To use SGT it is required to set the influence parameter (```cii```) for the pure fluids. Then, a mixture is created with them using the ```mixture``` function or by adding (`+`) pure components. The interaction parameters are set up with the ```mixture.saftgammamie``` method. Finally, the ```eos``` object is created with the ```saftgammamie``` function. The ```eos``` object includes all the necessary methods to compute phase equilibria and interfacial properties using SAFT-$\gamma$-Mie EoS. For this notebook, the calculations are exemplified for the mixture of ethanol + water and the mixture of hexane + ethanol. ``` ethanol = component(GC={'CH3':1, 'CH2OH':1}, cii=4.1388468864244875e-20) water = component(GC={'H2O':1}, cii=1.6033244745871344e-20) # creating mixture with mixture class function mix1 = mixture(ethanol, water) # or creating mixture by adding pure components mix1 = ethanol + water mix1.saftgammamie() eos1 = saftgammamie(mix1) ``` Now, it is required to compute the phase equilibria (VLE, LLE or VLLE). See Notebooks 5 to 10 for more information about phase equilibria computation. In this example, the bubble point of the mixture of ethanol and water at $x_1=0.2$ and 298.15K is computed. ``` from sgtpy.equilibrium import bubblePy T = 298.15 # K # liquid composition x = np.array([0.2, 0.8]) # initial guesses P0 = 1e4 # Pa y0 = np.array([0.8, 0.2]) sol = bubblePy(y0, P0, x, T, eos1, full_output=True) y, P = sol.Y, sol.P vl, vv = sol.v1, sol.v2 rhol = x/vl rhov = y/vv ``` In order to set the $\beta$ correction is necessary to create the symmetric matrix of shape (`nc, nc`) and then use it with the ```eos.beta_sgt``` method from the eos. The $\beta_{ij}$ correction is computed as follows: $$ \beta_{ij} = \beta_{ij,0} + \beta_{ij,1} \cdot T + \beta_{ij,2} \cdot T^2 + \frac{\beta_{ij,3}}{T} $$ Alternatively, you can modify just the pair $ij$ using the `eos.set_betaijsgt` method. In both methods, by default only the $\beta_{ij,0}$ is required. The temperature dependent parameters are optional, if they are not provided they are assumed to be zero. The function ```sgt_mix_beta0``` is used to study the interfacial behavior with SGT and $\beta=0$. AS shown in Notebook 12, Liang method can compute the density paths correctly. ``` from sgtpy.sgt import sgt_mix_beta0 bij = 0.0 beta = np.array([[0, bij], [bij, 0]]) eos1.beta_sgt(beta) # or by setting the beta correction by pair i=0 (hexane), j=1 (ethanol) eos1.set_betaijsgt(i=0, j=1, beta0=bij) soll = sgt_mix_beta0(rhov, rhol, T, P, eos1, n=300, method='liang', full_output=True) ``` When using $\beta \neq 0$ two options are available to solve SGT. - ```sgt_mix```: solves SGT system as a boundary value problem using orthogonal collocation (increasing interfacial length). - ```msgt_mix```: solves a stabilized SGT system as a boundary value problem using orthogonal collocation (fixed interfacial length). ``` from sgtpy.sgt import sgt_mix bij = 0.2 beta = np.array([[0, bij], [bij, 0]]) eos1.beta_sgt(beta) # or by setting the beta correction by pair i=0 (ethanol), j=1 (water) eos1.set_betaijsgt(i=0, j=1, beta0=bij) solbeta = sgt_mix(rhov, rhol, T, P, eos1, full_output=True) from sgtpy.sgt import msgt_mix bij = 0.5 beta = np.array([[0, bij], [bij, 0]]) eos1.beta_sgt(beta) # or by setting the beta correction by pair i=0 (ethanol), j=1 (water) eos1.set_betaijsgt(i=0, j=1, beta0=bij) msolbeta = msgt_mix(rhov, rhol, T, P, eos1, rho0 = solbeta, full_output=True) ``` The interfacial tension results are shown below. ``` print('Liang path Function: ', soll.tension, 'mN/m') print('SGT BVP: ', solbeta.tension, 'mN/m') print('Modified SGT BVP: ', msolbeta.tension, 'mN/m') ``` The density profiles are plotted below. It can be seen that using a $\beta$ correction smooths the density profiles. ``` rhobeta = solbeta.rho / 1000 # kmol/m3 mrhobeta = msolbeta.rho / 1000 # kmol/m3 rholiang = soll.rho / 1000 # kmol/m3 alphas = soll.alphas path = soll.path fig = plt.figure(figsize = (10, 4)) fig.subplots_adjust( wspace=0.3) ax1 = fig.add_subplot(121) ax1.plot(rholiang[0], rholiang[1], color = 'red') ax1.plot(rhobeta[0], rhobeta[1], 's', color = 'blue') ax1.plot(mrhobeta[0], mrhobeta[1], '--', color = 'black') ax1.plot(rhov[0]/1000, rhov[1]/1000, 'o', color = 'k') ax1.plot(rhol[0]/1000, rhol[1]/1000, 'o', color = 'k') ax1.set_xlabel(r'$\rho_1$ / kmol m$^{-3}$') ax1.set_ylabel(r'$\rho_2$ / kmol m$^{-3}$') ax2 = fig.add_subplot(122) ax2.plot(path/1000, alphas) ax2.axhline(y = 0, linestyle = '--',color = 'r') ax2.set_ylabel(r'$\alpha$') ax2.set_xlabel(r'path function / 1000') ``` ## Hexane - Ethanol The interfacial behavior of this mixture is well known to be difficult to study as its displays multiple stationary points in the inhomogeneous zone. ``` hexane = component(GC={'CH3':2, 'CH2':4}, cii=3.288396028761707e-19) mix2 = mixture(hexane, ethanol) mix2.saftgammamie() eos2 = saftgammamie(mix2) ``` In this example, the bubble point of the mixture at $x_1=0.3$ and 298.15K is computed with the ```bubblePy``` function. ``` T = 298.15 # K x = np.array([0.3, 0.7]) y0 = 1.*x P0 = 8000. # Pa sol = bubblePy(y0, P0, x, T, eos2, full_output=True) y, P = sol.Y, sol.P vl, vv = sol.v1, sol.v2 rhox = x/vl rhoy = y/vv sol ``` The function ```sgt_mix_beta0``` is used to study the interfacial behavior with SGT and $\beta=0$. AS shown in Notebook 12, Liang method can compute the density paths correctly. ``` soll2 = sgt_mix_beta0(rhoy, rhox, T, P, eos2, n=300, method='liang', full_output=True) ``` SGT is solved with $\beta = 0.2$ and $\beta = 0.5$ using the ```sgt_mix``` and ```msgt_mix``` function. ``` bij = 0.2 beta = np.array([[0, bij], [bij, 0]]) eos2.beta_sgt(beta) # or by setting the beta correction by pair i=0 (hexane), j=1 (ethanol) eos2.set_betaijsgt(i=0, j=1, beta0=bij) solbeta = sgt_mix(rhoy, rhox, T, P, eos2, full_output=True) bij = 0.5 beta = np.array([[0, bij], [bij, 0]]) eos2.beta_sgt(beta) # or by setting the beta correction by pair i=0 (hexane), j=1 (ethanol) eos2.set_betaijsgt(i=0, j=1, beta0=bij) msolbeta = msgt_mix(rhoy, rhox, T, P, eos2, rho0=solbeta, full_output=True) ``` The interfacial tension results are shown below. ``` print('Liang path Function: ', soll2.tension, 'mN/m') print('SGT BVP: ', solbeta.tension, 'mN/m') print('Modified SGT BVP: ', msolbeta.tension, 'mN/m') ``` The density profiles are plotted below. It can be seen that using a $\beta$ correction smooths the density profiles and reduces the number of stationary points. ``` rhobeta = solbeta.rho / 1000 # kmol/m3 mrhobeta = msolbeta.rho / 1000 # kmol/m3 rholiang = soll2.rho / 1000 # kmol/m3 alphas = soll2.alphas path = soll2.path fig = plt.figure(figsize = (10, 4)) fig.subplots_adjust( wspace=0.3) ax1 = fig.add_subplot(121) ax1.plot(rholiang[0], rholiang[1], color = 'red') ax1.plot(rhobeta[0], rhobeta[1], 's', color = 'blue') ax1.plot(mrhobeta[0], mrhobeta[1], '--', color = 'black') ax1.plot(rhoy[0]/1000, rhoy[1]/1000, 'o', color = 'k') ax1.plot(rhox[0]/1000, rhox[1]/1000, 'o', color = 'k') ax1.set_xlabel(r'$\rho_1$ / kmol m$^{-3}$') ax1.set_ylabel(r'$\rho_2$ / kmol m$^{-3}$') ax2 = fig.add_subplot(122) ax2.plot(path/1000, alphas) ax2.axhline(y = 0, linestyle = '--',color = 'r') ax2.set_ylabel(r'$\alpha$') ax2.set_xlabel(r'path function / 1000') ax1.tick_params(direction='in') ax2.tick_params(direction='in') # fig.savefig('sgt_mix.pdf') ``` For further information of any of these functions just run: ```function?```
github_jupyter
# Water Risk Classification: Data Wrangling ## Setup ``` import numpy as np import pandas as pd import geopandas as gpd import requests, zipfile, io, os, tarfile import rasterio as rio from rasterio import plot from rasterstats import zonal_stats import rasterio.warp, rasterio.shutil import rioxarray # for the extension to load import xarray import missingno as msno from shapely.geometry import Polygon from matplotlib import pyplot import folium from matplotlib import pyplot as plt %matplotlib inline ``` ## Download Data **ONLY RUN IF YOU DON'T HAVE THE DATA FOLDER YET. IT WILL TAKE A LONG TIME.** Download and unzip all the datasets. ``` # create data folder os.mkdir('./data') ``` ### Aqueduct Database ``` # download and extract # DON'T RUN IF DATA IS IN ./DATA FOLDER url_aq = 'https://wri-projects.s3.amazonaws.com/Aqueduct30/finalData/Y2019M07D12_Aqueduct30_V01.zip' r = requests.get(url_aq) # download zipped directory z = zipfile.ZipFile(io.BytesIO(r.content)) # create zipfile object z.extractall(path='data') # unzip into data subdirectory ``` ### Global Human Settlments Layer ``` # download and extract # DON'T RUN IF DATA IS IN ./DATA FOLDER url_ghs = 'http://cidportal.jrc.ec.europa.eu/ftp/jrc-opendata/GHSL/GHS_POP_MT_GLOBE_R2019A/GHS_POP_E2015_GLOBE_R2019A_54009_1K/V1-0/GHS_POP_E2015_GLOBE_R2019A_54009_1K_V1_0.zip' r = requests.get(url_ghs) # download zipped directory z = zipfile.ZipFile(io.BytesIO(r.content)) # create zipfile object z.extractall(path='data/ghs') # unzip into data subdirectory ``` ### Infant Mortality The SEDAC infant mortality data requires user authentication so we did not download if programatically. The data is available for download [here](https://sedac.ciesin.columbia.edu/downloads/data/povmap/povmap-global-subnational-infant-mortality-rates-v2/povmap-global-subnational-infant-mortality-rates-v2-geotiff.zip) and is unzipped to `./data/sedac/`. ``` # This download requires useer authentication and isn't currently working # DON'T RUN IF DATA IS IN ./DATA FOLDER url_inf_mort = 'https://sedac.ciesin.columbia.edu/downloads/data/povmap/povmap-global-subnational-infant-mortality-rates-v2/povmap-global-subnational-infant-mortality-rates-v2-geotiff.zip' r = requests.get(url_inf_mort) # download zipped directory z = zipfile.ZipFile("./data/povmap-global-subnational-infant-mortality-rates-v2-geotiff.zip") # create zipfile object z.extractall(path='./data/sedac') # unzip into data subdirectory z.close() ``` ### Nighttime Light ``` # download and extract # DON'T RUN IF DATA IS IN ./DATA FOLDER url_light = 'https://ngdc.noaa.gov/eog/data/web_data/v4avg_lights_x_pct/F182013.v4c.avg_lights_x_pct.tgz' r = requests.get(url_light, allow_redirects=True) open('./data/F182013.v4c.avg_lights_x_pct.tgz', 'wb').write(r.content) temp_path = './data/F182013.v4c.avg_lights_x_pct.tgz' z = tarfile.open(temp_path, mode='r:gz') # create zipfile object z.extractall(path='data/light') # unzip into data subdirectory z.close() os.remove(temp_path) ``` ## Load Data WRI Aqueduct metadata with column name explanations is available [here](https://github.com/wri/aqueduct30_data_download/blob/master/metadata.md). ``` path_aq = './data/Y2019M07D12_Aqueduct30_V01/baseline/annual/y2019m07d11_aqueduct30_annual_v01.gpkg' aq = gpd.read_file(path_aq, layer='y2019m07d11_aqueduct30_annual_v01') # Select just the columns that will be used for the analysis data_cols = ['string_id', 'geometry','bws_raw', 'bwd_raw', 'iav_raw', 'sev_raw', 'gtd_raw', 'rfr_raw', 'cfr_raw', 'drr_raw', 'ucw_raw', 'udw_raw', 'usa_raw'] data = aq.loc[aq['gid_0'] != 'GRL'].copy() data = data.loc[data['gid_0'].notnull()] data = data[data_cols].copy() data.shape path_ghs = './data/ghs/GHS_POP_E2015_GLOBE_R2019A_54009_1K_V1_0.tif' ghs_meta = None ghs_t = None with rio.open(path_ghs) as tif: ghs_meta = tif.meta ghs_t = ghs.transform oviews = tif.overviews(1) # list of overviews from biggest to smallest oview = oviews[-1] thumbnail = tif.read(1, out_shape=(1, int(tif.height // oview), int(tif.width // oview))) ghs_meta['width'], ghs_meta['height'], ghs_meta['width']*ghs_meta['height'] path_inf_mort = './data/sedac/povmap_global_subnational_infant_mortality_rates_v2.tif' with rio.open(path_inf_mort) as tif: inf_mort = tif path_light = './data/light/F182013.v4c.avg_lights_x_pct.tif' with rio.open(path_light) as tif: light = rio.open(tif) ``` ## Explore Data ``` with rio.open(path_ghs) as im: rio.plot.show_hist(im, bins=50, lw=0.0, stacked=False, alpha=1, histtype='stepfilled', title="Population") ghs.meta # plot of infant mortality with rio.open(path_inf_mort) as im: rio.plot.show_hist(im, bins=50, lw=0.0, stacked=False, alpha=1, histtype='stepfilled', title="Infant Mortality") inf_mort.meta # Plot of light # plot of infant mortality with rio.open(path_inf_mort) as im: rio.plot.show_hist(im, bins=50, lw=0.0, stacked=False, alpha=1, histtype='stepfilled', title="Nightime Light") light.meta,plot # check crs aq.crs == ghs.crs, aq.crs == inf_mort.crs, aq.crs == light.crs ``` ## Join Data ``` with rio.open(path_inf_mort) as inf_mort: inf_mort_array = inf_mort.read(1) # Reclassify from two values for no data to just one inf_mort_array[inf_mort_array<0] = -999 # Need to set nodata value explicitly mortality_stats = zonal_stats(data, inf_mort_array, affine = inf_mort.transform, stats = ['mean', 'median'], nodata = -999) data['mean_infant_mort'] = [s['mean'] for s in mortality_stats] #aq_join['median_infant_mort'] = [t['median'] for t in mortality_stats] # aq_join.loc[np.isinf(aq_join['mean_infant_mort']) == True, 'mean_infant_mort'] = float('NaN') # aq_join.loc[np.isinf(aq_join['median_infant_mort']) == True, 'median_infant_mort'] = float('NaN') # aq_join.loc[np.isinf(aq_join['sum_infant_mort']) == True, 'sum_infant_mort'] = float('NaN') with rio.open(path_light) as light: light_array = light.read(1) light_stats = zonal_stats(data, light_array, affine = light.transform, stats = ['mean'], nodata = -999) data['mean_light'] = [s['mean'] for s in light_stats] data.loc[np.isnan(data['mean_light']) == True, 'mean_light'] = 0 with rio.open(path_ghs) as ghs: ghs_array = ghs.read(1) ghs_stats = zonal_stats(data.to_crs(ghs.crs.data), ghs_array, affine = ghs.transform, stats = ['sum'], nodata = -200.0) data['sum_pop'] = [u['sum'] for u in ghs_stats] data['sum_pop'].isna().sum() s = data.loc[data['sum_pop'] < 0] t = data.loc[np.isnan(data['sum_pop'])] s.shape, t.shape ``` ## Engineer Features ``` # Calculate the area of each Aqueduct polygon # project to equal area projection to calculate densities # NSIDC EASE-Grid 2.0 Global Equal area to calculate densities, https://epsg.io/6933 data['area_sqkm'] = data.to_crs({'init':'epsg:6933'}).area/10000000 # Calculate population density data['pop_density'] = data['sum_pop']/data['area_sqkm'] # reclassify NAs as zero data.loc[np.isnan(data['pop_density']) == True, 'pop_density'] = 0 data.sum_pop.min() msno.bar(data) ``` ## Save GeoJSON for Modeling ``` export_cols = ['string_id', 'geometry', 'bws_raw', 'bwd_raw', 'iav_raw', 'sev_raw', 'gtd_raw', 'rfr_raw', 'cfr_raw', 'drr_raw', 'ucw_raw', 'udw_raw', 'usa_raw', 'mean_infant_mort', 'mean_light', 'pop_density' ] # select columns to export and project back to WGS84 data_export = data[export_cols].to_crs(aq.crs) # Save data data_export.to_file("./data/data.geojson", driver='GeoJSON') ```
github_jupyter
$\newcommand{\To}{\Rightarrow}$ ``` import os os.chdir('..') from kernel.type import TFun, BoolType, NatType from kernel import term from kernel.term import Term, Var, Const, Lambda, Abs, Bound, Nat, Or, Eq, Forall, Exists, Implies, And from data import nat from logic import basic from syntax.settings import settings basic.load_theory('nat') ``` ## Lambda calculus In the previous section, we discussed how to construct terms consisting of variables, constants, and function application. The relevant constructors are `Var`, `Const`, and `Comb`. In this section, we discuss construction of *lambda terms*, which completes the representation of terms in *lambda calculus*. The motivation is as follows: we have already noted that terms can have function type. For example, in the previous section, we can declare a variable $f$ of type $nat \To nat$ by `Var("f", TFun(NatType, NatType))`. We have also encountered constants that have function type, for example the addition operator. However, we have not said anything about how to construct new examples of such functions. In principle, any well-defined rule for computing the output from the input should be representable as a function. For example, there should be a function that takes as input a natural number $n$, and outputs $n+2$. In higher-order logic (also known as *simply-typed lambda calculus*), we can represent such functions as *lambda terms*. The above function can be written (in mathematical notation) as: $$ \lambda n. n + 2 $$ Here $n$ (the variable right after $\lambda$) is known as a *bound variable*, in the sense that it is associated to the $\lambda$ sign directly in front of it, and is valid only in the scope of that $\lambda$ sign. It is important to note that *the name of the bound variable does not matter*. The expression $\lambda n. n + 2$ means the same thing as the expression $\lambda m. m + 2$. Both represent functions that add 2 to its input. We say that two terms are *$\alpha$-equivalent* if one can be changed to the other by changing the names of some bound variables. We can construct a function term using `Lambda`. ``` n = Var('n', NatType) f = Lambda(n, n + 2) print(f) ``` Note $\lambda$ is printed in ASCII using `%`. As before, we turn on unicode printing, so the Greek letter $\lambda$ is printed properly. ``` settings.unicode = True print(f) ``` We can test that the name of bound variable does not matter by constructing $f$ in another way: ``` m = Var('m', NatType) f2 = Lambda(m, m + 2) print(f2) assert f == f2 ``` Functions taking several arguments can be constructed using multiple Lambdas. The following constructs a function that takes two natural numbers $x$ and $y$ as input, and returns $x + 2y$. ``` x = Var('x', NatType) y = Var('y', NatType) g = Lambda(x, Lambda(y, x + 2 * y)) print(g) ``` This can be written more simply as follows: ``` g2 = Lambda(x, y, x + 2 * y) print(g2) ``` The types of $f$ and $g$ are as expected (recall `checked_get_type` will perform type-checking on the term, in addition to returning the type of the term). ``` print(f.checked_get_type()) print(g.checked_get_type()) ``` `Lambda` can also be used to construct predicates or binary relations. ``` P = Lambda(x, Or(Eq(x, 0), Eq(x, 2))) print(P) R = Lambda(x, y, Eq(x, y + 2)) print(R) ``` ## $\beta$-conversion In the previous section, we constructed lambda terms using the `Lambda` constructor. These are supposed to represent functions. What happens when we apply such functions an argument? Well, initially nothing happens: ``` print(f) t = f(Nat(3)) print(t) ``` The `Comb` constructor (invoked through the `__call__` method of $f$) simply combines its two arguments, performing no function evaluation. To actually evaluate a function application, we need to use the `beta_conv` method, so named because function evaluation in lambda calculus is called *$\beta$-conversion*. ``` t2 = t.beta_conv() print(t2) ``` Now, the argument 2 is substituted into the function. More precisely, the function `beta_conv` assumes the input term is in the form `f x`, where `f` is a lambda term, and substitutes `x` for the bound variable of `f`. The addition $3+2$ is still not evaluated: the general rule is that no evaluation is performed unless explicitly called for. We will discuss evaluation of arithmetic on natural numbers in a later section. Let's see a more complicated example: Oops... Here `beta_conv` failed because the function part of $t_3$ is not a lambda term: it is a lambda term applied to 2. To fully evaluate $f_2$ on two arguments 3 and 4, we need to apply them one at a time, performing $\beta$-conversion: ``` print('g: ', g) t3 = g(Nat(3), Nat(4)) print('t3:', t3) t4 = t3.beta_conv() # raises TermException t3 = g(Nat(3)).beta_conv() print('t3:', t3) t4 = t3(Nat(4)).beta_conv() print('t4:', t4) ``` A more convenient method is `beta_norm`, which performs all $\beta$-conversions on subterms: ``` t5 = g(Nat(3),Nat(4)).beta_norm() print(t5) ``` ## Quantifiers in predicate logic Predicate logic extends propositional logic by adding two quantifiers: forall ($\forall$) and exists ($\exists$). In higher-order logic, both operators are represented as constants of type $('a \To bool) \To bool$. This can be explained as follows, taking the forall quantifier as an example. A forall expression in mathematics has the form $$ \forall x. P(x) $$ Here $x$ is a bound variable. In (untyped) first-order logic, there are only two types of terms: objects and propositions, and $x$ can only range over objects. The main distinction between higher-order and first-order logic is that in higher-order logic, the bound variable of quantifiers can be of any type, including function types. Hence, we designate the type of the bound variable by the type variable $'a$. Then, the predicate $P$ has type $'a \To bool$. Any forall expression is a function taking a predicate $P$ of type $'a \To bool$ as input, and outputs a boolean value (whether $P$ is true on all of $'a$). Hence, its type must be $('a \To bool) \To bool$. Forall and exists expressions are constructed as follows. ``` x = Var("x", NatType) t1 = Forall(x, Implies(x > 2, x > 1)) print('t1:', t1) t2 = Exists(x, And(x > 2, x < 4)) print('t2:', t2) ``` The type of $t_1$ and $t_2$ are booleans, as expected. ``` print(t1.checked_get_type()) print(t2.checked_get_type()) ``` Forall and exists can take more than two arguments as well: ``` print(Forall(x, y, Implies(x < y, x < y + 1))) print(Exists(x, y, x < y)) ``` Forall and exists can alternate in a term. Make sure you understand the difference between the two propositions below. The first statement says for any natural number, there is a greater natural number (which is true). The second says there exists a natural number that is greater than all natural numbers (which is false). ``` print('P1:', Forall(x, Exists(y, x < y))) print('P2:', Exists(y, Forall(x, x < y))) ``` ## de Bruijn indices When representing terms in higher-order logic, we would like to be able to quickly tell whether two terms are $\alpha$-equivalent. This motivates the use of *de Bruijn index* (named after Dutch mathematician Nicolaas Govert de Bruijn). Following this method, the bound variables are (in principle) unnamed, and whenever one needs to refer to a bound variable, one uses a sign $B_i$ where $i$ counts the depth of the location of reference with respect to the lambda sign of that variable. We follow the convention that the counting begins at 0. For example, the above function is represented using de Bruijn index as: $$ \lambda\_. B_0 + 2 $$ Here we use an underscore to denote a bound variable that is unnamed. Another example: the expression $\lambda x. \lambda y. x + y$ is represented as $\lambda\_. \lambda\_. B_1 + B_0$ using de Bruijn indices. This is because the location where $x$ occurs is separated from the $\lambda$ sign that bounds it (the first $\lambda$ sign) by one $\lambda$ sign in the middle, while the location where $y$ occurs is directly after the $\lambda$ sign that bounds it (the second $\lambda$ sign). The use of de Bruijn indices is revealed by looking at the `repr` of a lambda term: ``` x = Var('x', NatType) t = Lambda(x, x + 1) print(repr(t)) ``` Here, `Abs` is the constructor for a lambda term. The first argument is the *suggested* name of the bound variable. It is used for printing only (and perhaps as a starting point when names of new variables need to be invented during proof). The second argument is the type of the bound variable, which *is* significant (different types of bound variables give different terms). The third argument is the body of the lambda term. In the body, bound variables are refered to by `Bound(n)`, where $n$ is a natural number. Let us examine a more complex lambda expression: ``` x = Var('x', NatType) y = Var('y', NatType) t = Lambda(x, Lambda(y, x + y)) print(t) print(repr(t)) ``` While we are at it, let us also examine the representation of forall and exists terms: ``` print(repr(Forall(x, x >= 0))) print(repr(Exists(x, x < 1))) ``` After understanding the de Bruijn representation, we can also creater lambda terms directly using the `Abs` and `Bound` constructors. This is seldomly necessary, but we show it here to illustrate the concepts: ``` t = Abs('x', NatType, nat.plus(Bound(0), nat.one)) print(t) assert t == Lambda(x, x + 1) ```
github_jupyter
``` import re import os import random import numpy as np import pandas as pd import tensorflow as tf import matplotlib.pyplot as plt try: tpu = tf.distribute.cluster_resolver.TPUClusterResolver() print("Device:", tpu.master()) tf.config.experimental_connect_to_cluster(tpu) tf.tpu.experimental.initialize_tpu_system(tpu) strategy = tf.distribute.experimental.TPUStrategy(tpu) except: strategy = tf.distribute.get_strategy() print("Number of replicas:", strategy.num_replicas_in_sync) ``` We need a Google Cloud link to our data to load the data using a TPU. Below, we define key configuration parameters we'll use in this example. To run on TPU, this example must be on Colab with the TPU runtime selected. ``` AUTOTUNE = tf.data.experimental.AUTOTUNE BATCH_SIZE = 25 * strategy.num_replicas_in_sync IMAGE_SIZE = [180, 180] CLASS_NAMES = ["NORMAL", "PNEUMONIA"] ``` ## Load the data The Chest X-ray data we are using from [*Cell*](https://www.cell.com/cell/fulltext/S0092-8674(18)30154-5) divides the data into training and test files. Let's first load in the training TFRecords. ``` train_images = tf.data.TFRecordDataset( "gs://download.tensorflow.org/data/ChestXRay2017/train/images.tfrec" ) train_paths = tf.data.TFRecordDataset( "gs://download.tensorflow.org/data/ChestXRay2017/train/paths.tfrec" ) ds = tf.data.Dataset.zip((train_images, train_paths)) ``` Let's count how many healthy/normal chest X-rays we have and how many pneumonia chest X-rays we have: ``` COUNT_NORMAL = len( [ filename for filename in train_paths if "NORMAL" in filename.numpy().decode("utf-8") ] ) print("Normal images count in training set: " + str(COUNT_NORMAL)) COUNT_PNEUMONIA = len( [ filename for filename in train_paths if "PNEUMONIA" in filename.numpy().decode("utf-8") ] ) print("Pneumonia images count in training set: " + str(COUNT_PNEUMONIA)) ``` Notice that there are way more images that are classified as pneumonia than normal. This shows that we have an imbalance in our data. We will correct for this imbalance later on in our notebook. We want to map each filename to the corresponding (image, label) pair. The following methods will help us do that. As we only have two labels, we will encode the label so that `1` or `True` indicates pneumonia and `0` or `False` indicates normal. ``` def get_label(file_path): # convert the path to a list of path components parts = tf.strings.split(file_path, "/") # The second to last is the class-directory return parts[-2] == "PNEUMONIA" def decode_img(img): # convert the compressed string to a 3D uint8 tensor img = tf.image.decode_jpeg(img, channels=3) # resize the image to the desired size. return tf.image.resize(img, IMAGE_SIZE) def process_path(image, path): label = get_label(path) # load the raw data from the file as a string img = decode_img(image) return img, label ds = ds.map(process_path, num_parallel_calls=AUTOTUNE) ``` Let's split the data into a training and validation datasets. ``` ds = ds.shuffle(10000) train_ds = ds.take(4200) val_ds = ds.skip(4200) ``` Let's visualize the shape of an (image, label) pair. ``` for image, label in train_ds.take(1): print("Image shape: ", image.numpy().shape) print("Label: ", label.numpy()) ``` Load and format the test data as well. ``` test_images = tf.data.TFRecordDataset( "gs://download.tensorflow.org/data/ChestXRay2017/test/images.tfrec" ) test_paths = tf.data.TFRecordDataset( "gs://download.tensorflow.org/data/ChestXRay2017/test/paths.tfrec" ) test_ds = tf.data.Dataset.zip((test_images, test_paths)) test_ds = test_ds.map(process_path, num_parallel_calls=AUTOTUNE) test_ds = test_ds.batch(BATCH_SIZE) ``` ## Visualize the dataset First, let's use buffered prefetching so we can yield data from disk without having I/O become blocking. Please note that large image datasets should not be cached in memory. We do it here because the dataset is not very large and we want to train on TPU. ``` def prepare_for_training(ds, cache=True): # This is a small dataset, only load it once, and keep it in memory. # use `.cache(filename)` to cache preprocessing work for datasets that don't # fit in memory. if cache: if isinstance(cache, str): ds = ds.cache(cache) else: ds = ds.cache() ds = ds.batch(BATCH_SIZE) # `prefetch` lets the dataset fetch batches in the background while the model # is training. ds = ds.prefetch(buffer_size=AUTOTUNE) return ds ``` Call the next batch iteration of the training data. ``` train_ds = prepare_for_training(train_ds) val_ds = prepare_for_training(val_ds) image_batch, label_batch = next(iter(train_ds)) ``` Define the method to show the images in the batch. ``` def show_batch(image_batch, label_batch): plt.figure(figsize=(10, 10)) for n in range(25): ax = plt.subplot(5, 5, n + 1) plt.imshow(image_batch[n] / 255) if label_batch[n]: plt.title("PNEUMONIA") else: plt.title("NORMAL") plt.axis("off") ``` As the method takes in NumPy arrays as its parameters, call the numpy function on the batches to return the tensor in NumPy array form. ``` show_batch(image_batch.numpy(), label_batch.numpy()) ``` ## Build the CNN To make our model more modular and easier to understand, let's define some blocks. As we're building a convolution neural network, we'll create a convolution block and a dense layer block. The architecture for this CNN has been inspired by this [article](https://towardsdatascience.com/deep-learning-for-detecting-pneumonia-from-x-ray-images-fc9a3d9fdba8). ``` from tensorflow import keras from tensorflow.keras import layers from tensorflow.keras.layers.experimental import preprocessing def conv_block(filters, inputs): x = layers.SeparableConv2D(filters, 3, activation="relu", padding="same")(inputs) x = layers.SeparableConv2D(filters, 3, activation="relu", padding="same")(x) x = layers.BatchNormalization()(x) outputs = layers.MaxPool2D()(x) return outputs def dense_block(units, dropout_rate, inputs): x = layers.Dense(units, activation="relu")(inputs) x = layers.BatchNormalization()(x) outputs = layers.Dropout(dropout_rate)(x) return outputs ``` The following method will define the function to build our model for us. The images originally have values that range from [0, 255]. CNNs work better with smaller numbers so we will scale this down for our input. The Dropout layers are important, as they reduce the likelikhood of the model overfitting. We want to end the model with a `Dense` layer with one node, as this will be the binary output that determines if an X-ray shows presence of pneumonia. ``` def build_model(): inputs = keras.Input(shape=(IMAGE_SIZE[0], IMAGE_SIZE[1], 3)) x = preprocessing.Rescaling(1.0 / 255)(inputs) x = layers.Conv2D(16, 3, activation="relu", padding="same")(x) x = layers.Conv2D(16, 3, activation="relu", padding="same")(x) x = layers.MaxPool2D()(x) x = conv_block(32, x) x = conv_block(64, x) x = conv_block(128, x) x = layers.Dropout(0.2)(x) x = conv_block(256, x) x = layers.Dropout(0.2)(x) x = layers.Flatten()(x) x = dense_block(512, 0.7, x) x = dense_block(128, 0.5, x) x = dense_block(64, 0.3, x) outputs = layers.Dense(1, activation="sigmoid")(x) model = keras.Model(inputs=inputs, outputs=outputs) return model ``` ## Correct for data imbalance We saw earlier in this example that the data was imbalanced, with more images classified as pneumonia than normal. We will correct for that by using class weighting: ``` initial_bias = np.log([COUNT_PNEUMONIA / COUNT_NORMAL]) print("Initial bias: {:.5f}".format(initial_bias[0])) TRAIN_IMG_COUNT = COUNT_NORMAL + COUNT_PNEUMONIA weight_for_0 = (1 / COUNT_NORMAL) * (TRAIN_IMG_COUNT) / 2.0 weight_for_1 = (1 / COUNT_PNEUMONIA) * (TRAIN_IMG_COUNT) / 2.0 class_weight = {0: weight_for_0, 1: weight_for_1} print("Weight for class 0: {:.2f}".format(weight_for_0)) print("Weight for class 1: {:.2f}".format(weight_for_1)) ``` The weight for class `0` (Normal) is a lot higher than the weight for class `1` (Pneumonia). Because there are less normal images, each normal image will be weighted more to balance the data as the CNN works best when the training data is balanced. ## Train the model ### Defining callbacks The checkpoint callback saves the best weights of the model, so next time we want to use the model, we do not have to spend time training it. The early stopping callback stops the training process when the model starts becoming stagnant, or even worse, when the model starts overfitting. ``` checkpoint_cb = tf.keras.callbacks.ModelCheckpoint("xray_model.h5", save_best_only=True) early_stopping_cb = tf.keras.callbacks.EarlyStopping( patience=10, restore_best_weights=True ) ``` We also want to tune our learning rate. Too high of a learning rate will cause the model to diverge. Too small of a learning rate will cause the model to be too slow. We implement the exponential learning rate scheduling method below. ``` initial_learning_rate = 0.015 lr_schedule = tf.keras.optimizers.schedules.ExponentialDecay( initial_learning_rate, decay_steps=100000, decay_rate=0.96, staircase=True ) ``` ### Fit the model For our metrics, we want to include precision and recall as they will provide use with a more informed picture of how good our model is. Accuracy tells us what fraction of the labels is correct. Since our data is not balanced, accuracy might give a skewed sense of a good model (i.e. a model that always predicts PNEUMONIA will be 74% accurate but is not a good model). Precision is the number of true positives (TP) over the sum of TP and false positives (FP). It shows what fraction of labeled positives are actually correct. Recall is the number of TP over the sum of TP and false negatves (FN). It shows what fraction of actual positives are correct. Since there are only two possible labels for the image, we will be using the binary crossentropy loss. When we fit the model, remember to specify the class weights, which we defined earlier. Because we are using a TPU, training will be quick - less than 2 minutes. ``` with strategy.scope(): model = build_model() METRICS = [ tf.keras.metrics.BinaryAccuracy(), tf.keras.metrics.Precision(name="precision"), tf.keras.metrics.Recall(name="recall"), ] model.compile( optimizer=tf.keras.optimizers.Adam(learning_rate=lr_schedule), loss="binary_crossentropy", metrics=METRICS, ) history = model.fit( train_ds, epochs=100, validation_data=val_ds, class_weight=class_weight, callbacks=[checkpoint_cb, early_stopping_cb], ) ``` ## Visualizing model performance Let's plot the model accuracy and loss for the training and the validating set. Note that no random seed is specified for this notebook. For your notebook, there might be slight variance. ``` fig, ax = plt.subplots(1, 4, figsize=(20, 3)) ax = ax.ravel() for i, met in enumerate(["precision", "recall", "binary_accuracy", "loss"]): ax[i].plot(history.history[met]) ax[i].plot(history.history["val_" + met]) ax[i].set_title("Model {}".format(met)) ax[i].set_xlabel("epochs") ax[i].set_ylabel(met) ax[i].legend(["train", "val"]) ``` We see that the accuracy for our model is around 95%. ## Predict and evaluate results Let's evaluate the model on our test data! ``` model.evaluate(test_ds, return_dict=True) ``` We see that our accuracy on our test data is lower than the accuracy for our validating set. This may indicate overfitting. Our recall is greater than our precision, indicating that almost all pneumonia images are correctly identified but some normal images are falsely identified. We should aim to increase our precision. ``` for image, label in test_ds.take(1): plt.imshow(image[0] / 255.0) plt.title(CLASS_NAMES[label[0].numpy()]) prediction = model.predict(test_ds.take(1))[0] scores = [1 - prediction, prediction] for score, name in zip(scores, CLASS_NAMES): print("This image is %.2f percent %s" % ((100 * score), name)) ```
github_jupyter
# LAB 5 - Maps Here we will jump in and make some maps based upon what you have learned making the volcano map and the topography maps of where you grew up in the previous two steps of this Lab. ## Navigation - [Maps 1.1](PHYS3070-LabMD.1.1.ipynb) - [Maps 1.2](PHYS3070-LabMD.1.2.ipynb) - [Maps 1.3](PHYS3070-LabMD.1.3.ipynb) - [Maps 2.1](PHYS3070-LabMD.2.1.ipynb) - [Maps 2.2](PHYS3070-LabMD.2.2.ipynb) - [Maps 2.3](PHYS3070-LabMD.2.3.ipynb) - [Maps 2.4](PHYS3070-LabMD.2.4.ipynb) - [Maps 2.5](PHYS3070-LabMD.2.5.ipynb) --- Remember how we set up our codes by importing what we need in python. ```python import cartopy.crs as ccrs import matplotlib.pyplot as plt ``` The second line here is, of course, just our familiar way of importing `matplotlib` for plotting. Now, making a map is exactly the same as plotting in polar coordinates: we simply need to specify `projection=Projection()` when creating the plot. Here, `Projection()` is one of the Cartopy-supported [map projections](https://en.wikipedia.org/wiki/Map_projection). For example, ```python ax = plt.subplot(111,projection=ccrs.PlateCarree()) ax.set_global() ax.coastlines() plt.show() ``` The `ax.set_global()` command informs Cartopy that we want to make a map of the whole globe, while the `ax.coastlines()` command draws coastline information onto it. ``` # Try it here! # Specify the projection then show the plot import cartopy.crs as ccrs import matplotlib.pyplot as plt ax = plt.subplot(111,projection=ccrs.PlateCarree()) ax.set_global() ax.coastlines() plt.show() ``` By default, the map is centred on the 0 longitude meridian. To change this, we can pass `central_longitude=longitude` to `ccrs.PlateCarree()`. Make a single figure that consists of multiple subplots, illustrating the following projections: - `ccrs.PlateCarree` - `ccrs.Mercator` - `ccrs.Mollweide` - `ccrs.Robinson` - `ccrs.InterruptedGoodeHomolosine` - `ccrs.NearsidePerspective` The maps we have made so far are global. If you only want to work with a subset of the globe, you can specify a different region (after creating the axes, but before doing any plotting) by removing `ax.set_global()` and instead calling `ax.set_extent((llon,rlon,llat,ulat))` where `llon` and `rlon` are the longitudes of the left- and right-hand sides of the region, and `llat` and `ulat` are the lower and upper latitudes of the region. Remember to set `central_longitude` appropriately, or you may get surprising results. Make a map of the area around your hometown. You may wish to pass `resolution='50m'` or `resolution='10m'` to `ax.coastlines()` to obtain a better-looking result. ``` # Try it here! ``` To add features such as rivers, national boundaries and so on to your map, we must import another submodule of Cartopy: ```python import cartopy.feature as cf ``` This provides immediate access to several low-resolution feature datasets, including: - `cf.BORDERS` - `cf.COASTLINE` - `cf.LAND` - `cf.OCEAN` - `cf.LAKES` - `cf.RIVERS` Each of these can be added to your plot by calling `ax.add_feature(feature)`; additional arguments such as `color=colorname` can be used to control how they are displayed. ``` # Try it here! ``` For higher-resolution data, and for other features, Cartopy allows you to make use of data from [Natural Earth](https://www.naturalearthdata.com/). Unfortunately, the documentation for doing so is currently rather poor, and getting everything to work can require some amount of trial and error. The basic syntax is: ```python ax.add_feature(cf.NaturalEarthFeature(category, name, scale), edgecolor=color,facecolor=color) ``` where `category` is either `'physical'` or `'cultural'`, `scale` is `'10m'`, `'50m'` or `'110m'`, and `'name'` is the name of the appropriate dataset. It seems this has to be inferred from the 'download' links on the Natural Earth website. The color options, `edgecolor` and `facecolor`, specify the colour used to draw outlines and fills; for some reason, it is necessary to pass the text string `'none'` (and not, as is more usual, the Python object `None`) if one does not want an object to be filled. Thus, for example, high-resolution rivers can be drawn by the command ```python ax.add_feature(cf.NaturalEarthFeature('physical','rivers_lake_centerlines','10m'), edgecolor='blue',facecolor='none') ``` Add rivers and country boundaries (as appropriate) to your hometown map. ``` # Try it here! ``` There is also an interface to [GSHHS coastline data](https://www.ngdc.noaa.gov/mgg/shorelines/). Because Cartopy is built as an add-on to `matplotlib.pyplot`, you can use all of the standard plotting tools to add data to your map. For example, point data and lines can be added using `plt.plot()`, contours can be drawn using `plt.contour()`, and gridded data using `plt.imshow()`. However, it is critically important that you include `transform = <something appropriate>` in each plotting command, to ensure that Cartopy correctly interprets the data you provide. For most common cases, where your data is expressed in terms of latitude and longitude, the most appropriate choice will be `transform=ccrs.Geodetic()`. When a geodetic coordinate system is used, using `plt.plot()` to draw a line between two points will result in a geodesic curve (the great-circle path representing the shortest distance on the surface of the spherical Earth). If you instead wish to draw a line that appears straight in the 2-D plane, you can use `transform=ccrs.PlateCarree()`. Create a global map and plot a line joining your hometown and Canberra using both `transform=ccrs.PlateCarree()` and `transform=ccrs.Geodetic()`. Satisfy yourself that you understand the difference. Plot (and label) the locations of your hometown, the capital city of your country, and Canberra. ``` # Try it here! ```
github_jupyter
##### Copyright 2019 The TensorFlow Authors. ``` #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. ``` # Deep Convolutional Generative Adversarial Network <table class="tfo-notebook-buttons" align="left"> <td> <a target="_blank" href="https://www.tensorflow.org/tutorials/generative/dcgan"> <img src="https://www.tensorflow.org/images/tf_logo_32px.png" /> View on TensorFlow.org</a> </td> <td> <a target="_blank" href="https://colab.research.google.com/github/tensorflow/docs/blob/master/site/en/tutorials/generative/dcgan.ipynb"> <img src="https://www.tensorflow.org/images/colab_logo_32px.png" /> Run in Google Colab</a> </td> <td> <a target="_blank" href="https://github.com/tensorflow/docs/blob/master/site/en/tutorials/generative/dcgan.ipynb"> <img src="https://www.tensorflow.org/images/GitHub-Mark-32px.png" /> View source on GitHub</a> </td> <td> <a href="https://storage.googleapis.com/tensorflow_docs/docs/site/en/tutorials/generative/dcgan.ipynb"><img src="https://www.tensorflow.org/images/download_logo_32px.png" />Download notebook</a> </td> </table> This tutorial demonstrates how to generate images of handwritten digits using a [Deep Convolutional Generative Adversarial Network](https://arxiv.org/pdf/1511.06434.pdf) (DCGAN). The code is written using the [Keras Sequential API](https://www.tensorflow.org/guide/keras) with a `tf.GradientTape` training loop. ## What are GANs? [Generative Adversarial Networks](https://arxiv.org/abs/1406.2661) (GANs) are one of the most interesting ideas in computer science today. Two models are trained simultaneously by an adversarial process. A *generator* ("the artist") learns to create images that look real, while a *discriminator* ("the art critic") learns to tell real images apart from fakes. ![A diagram of a generator and discriminator](./images/gan1.png) During training, the *generator* progressively becomes better at creating images that look real, while the *discriminator* becomes better at telling them apart. The process reaches equilibrium when the *discriminator* can no longer distinguish real images from fakes. ![A second diagram of a generator and discriminator](./images/gan2.png) This notebook demonstrates this process on the MNIST dataset. The following animation shows a series of images produced by the *generator* as it was trained for 50 epochs. The images begin as random noise, and increasingly resemble hand written digits over time. ![sample output](https://tensorflow.org/images/gan/dcgan.gif) To learn more about GANs, we recommend MIT's [Intro to Deep Learning](http://introtodeeplearning.com/) course. ### Import TensorFlow and other libraries ``` import tensorflow as tf tf.__version__ # To generate GIFs !pip install imageio import glob import imageio import matplotlib.pyplot as plt import numpy as np import os import PIL from tensorflow.keras import layers import time from IPython import display ``` ### Load and prepare the dataset You will use the MNIST dataset to train the generator and the discriminator. The generator will generate handwritten digits resembling the MNIST data. ``` (train_images, train_labels), (_, _) = tf.keras.datasets.mnist.load_data() train_images = train_images.reshape(train_images.shape[0], 28, 28, 1).astype('float32') train_images = (train_images - 127.5) / 127.5 # Normalize the images to [-1, 1] BUFFER_SIZE = 60000 BATCH_SIZE = 256 # Batch and shuffle the data train_dataset = tf.data.Dataset.from_tensor_slices(train_images).shuffle(BUFFER_SIZE).batch(BATCH_SIZE) ``` ## Create the models Both the generator and discriminator are defined using the [Keras Sequential API](https://www.tensorflow.org/guide/keras#sequential_model). ### The Generator The generator uses `tf.keras.layers.Conv2DTranspose` (upsampling) layers to produce an image from a seed (random noise). Start with a `Dense` layer that takes this seed as input, then upsample several times until you reach the desired image size of 28x28x1. Notice the `tf.keras.layers.LeakyReLU` activation for each layer, except the output layer which uses tanh. ``` def make_generator_model(): model = tf.keras.Sequential() model.add(layers.Dense(7*7*256, use_bias=False, input_shape=(100,))) model.add(layers.BatchNormalization()) model.add(layers.LeakyReLU()) model.add(layers.Reshape((7, 7, 256))) assert model.output_shape == (None, 7, 7, 256) # Note: None is the batch size model.add(layers.Conv2DTranspose(128, (5, 5), strides=(1, 1), padding='same', use_bias=False)) assert model.output_shape == (None, 7, 7, 128) model.add(layers.BatchNormalization()) model.add(layers.LeakyReLU()) model.add(layers.Conv2DTranspose(64, (5, 5), strides=(2, 2), padding='same', use_bias=False)) assert model.output_shape == (None, 14, 14, 64) model.add(layers.BatchNormalization()) model.add(layers.LeakyReLU()) model.add(layers.Conv2DTranspose(1, (5, 5), strides=(2, 2), padding='same', use_bias=False, activation='tanh')) assert model.output_shape == (None, 28, 28, 1) return model ``` Use the (as yet untrained) generator to create an image. ``` generator = make_generator_model() noise = tf.random.normal([1, 100]) generated_image = generator(noise, training=False) plt.imshow(generated_image[0, :, :, 0], cmap='gray') ``` ### The Discriminator The discriminator is a CNN-based image classifier. ``` def make_discriminator_model(): model = tf.keras.Sequential() model.add(layers.Conv2D(64, (5, 5), strides=(2, 2), padding='same', input_shape=[28, 28, 1])) model.add(layers.LeakyReLU()) model.add(layers.Dropout(0.3)) model.add(layers.Conv2D(128, (5, 5), strides=(2, 2), padding='same')) model.add(layers.LeakyReLU()) model.add(layers.Dropout(0.3)) model.add(layers.Flatten()) model.add(layers.Dense(1)) return model ``` Use the (as yet untrained) discriminator to classify the generated images as real or fake. The model will be trained to output positive values for real images, and negative values for fake images. ``` discriminator = make_discriminator_model() decision = discriminator(generated_image) print (decision) ``` ## Define the loss and optimizers Define loss functions and optimizers for both models. ``` # This method returns a helper function to compute cross entropy loss cross_entropy = tf.keras.losses.BinaryCrossentropy(from_logits=True) ``` ### Discriminator loss This method quantifies how well the discriminator is able to distinguish real images from fakes. It compares the discriminator's predictions on real images to an array of 1s, and the discriminator's predictions on fake (generated) images to an array of 0s. ``` def discriminator_loss(real_output, fake_output): real_loss = cross_entropy(tf.ones_like(real_output), real_output) fake_loss = cross_entropy(tf.zeros_like(fake_output), fake_output) total_loss = real_loss + fake_loss return total_loss ``` ### Generator loss The generator's loss quantifies how well it was able to trick the discriminator. Intuitively, if the generator is performing well, the discriminator will classify the fake images as real (or 1). Here, we will compare the discriminators decisions on the generated images to an array of 1s. ``` def generator_loss(fake_output): return cross_entropy(tf.ones_like(fake_output), fake_output) ``` The discriminator and the generator optimizers are different since we will train two networks separately. ``` generator_optimizer = tf.keras.optimizers.Adam(1e-4) discriminator_optimizer = tf.keras.optimizers.Adam(1e-4) ``` ### Save checkpoints This notebook also demonstrates how to save and restore models, which can be helpful in case a long running training task is interrupted. ``` checkpoint_dir = './training_checkpoints' checkpoint_prefix = os.path.join(checkpoint_dir, "ckpt") checkpoint = tf.train.Checkpoint(generator_optimizer=generator_optimizer, discriminator_optimizer=discriminator_optimizer, generator=generator, discriminator=discriminator) ``` ## Define the training loop ``` EPOCHS = 50 noise_dim = 100 num_examples_to_generate = 16 # We will reuse this seed overtime (so it's easier) # to visualize progress in the animated GIF) seed = tf.random.normal([num_examples_to_generate, noise_dim]) ``` The training loop begins with generator receiving a random seed as input. That seed is used to produce an image. The discriminator is then used to classify real images (drawn from the training set) and fakes images (produced by the generator). The loss is calculated for each of these models, and the gradients are used to update the generator and discriminator. ``` # Notice the use of `tf.function` # This annotation causes the function to be "compiled". @tf.function def train_step(images): noise = tf.random.normal([BATCH_SIZE, noise_dim]) with tf.GradientTape() as gen_tape, tf.GradientTape() as disc_tape: generated_images = generator(noise, training=True) real_output = discriminator(images, training=True) fake_output = discriminator(generated_images, training=True) gen_loss = generator_loss(fake_output) disc_loss = discriminator_loss(real_output, fake_output) gradients_of_generator = gen_tape.gradient(gen_loss, generator.trainable_variables) gradients_of_discriminator = disc_tape.gradient(disc_loss, discriminator.trainable_variables) generator_optimizer.apply_gradients(zip(gradients_of_generator, generator.trainable_variables)) discriminator_optimizer.apply_gradients(zip(gradients_of_discriminator, discriminator.trainable_variables)) def train(dataset, epochs): for epoch in range(epochs): start = time.time() for image_batch in dataset: train_step(image_batch) # Produce images for the GIF as we go display.clear_output(wait=True) generate_and_save_images(generator, epoch + 1, seed) # Save the model every 15 epochs if (epoch + 1) % 15 == 0: checkpoint.save(file_prefix = checkpoint_prefix) print ('Time for epoch {} is {} sec'.format(epoch + 1, time.time()-start)) # Generate after the final epoch display.clear_output(wait=True) generate_and_save_images(generator, epochs, seed) ``` **Generate and save images** ``` def generate_and_save_images(model, epoch, test_input): # Notice `training` is set to False. # This is so all layers run in inference mode (batchnorm). predictions = model(test_input, training=False) fig = plt.figure(figsize=(4,4)) for i in range(predictions.shape[0]): plt.subplot(4, 4, i+1) plt.imshow(predictions[i, :, :, 0] * 127.5 + 127.5, cmap='gray') plt.axis('off') plt.savefig('image_at_epoch_{:04d}.png'.format(epoch)) plt.show() ``` ## Train the model Call the `train()` method defined above to train the generator and discriminator simultaneously. Note, training GANs can be tricky. It's important that the generator and discriminator do not overpower each other (e.g., that they train at a similar rate). At the beginning of the training, the generated images look like random noise. As training progresses, the generated digits will look increasingly real. After about 50 epochs, they resemble MNIST digits. This may take about one minute / epoch with the default settings on Colab. ``` train(train_dataset, EPOCHS) ``` Restore the latest checkpoint. ``` checkpoint.restore(tf.train.latest_checkpoint(checkpoint_dir)) ``` ## Create a GIF ``` # Display a single image using the epoch number def display_image(epoch_no): return PIL.Image.open('image_at_epoch_{:04d}.png'.format(epoch_no)) display_image(EPOCHS) ``` Use `imageio` to create an animated gif using the images saved during training. ``` anim_file = 'dcgan.gif' with imageio.get_writer(anim_file, mode='I') as writer: filenames = glob.glob('image*.png') filenames = sorted(filenames) last = -1 for i,filename in enumerate(filenames): frame = 2*(i**0.5) if round(frame) > round(last): last = frame else: continue image = imageio.imread(filename) writer.append_data(image) image = imageio.imread(filename) writer.append_data(image) import IPython if IPython.version_info > (6,2,0,''): display.Image(filename=anim_file) ``` If you're working in Colab you can download the animation with the code below: ``` try: from google.colab import files except ImportError: pass else: files.download(anim_file) ``` ## Next steps This tutorial has shown the complete code necessary to write and train a GAN. As a next step, you might like to experiment with a different dataset, for example the Large-scale Celeb Faces Attributes (CelebA) dataset [available on Kaggle](https://www.kaggle.com/jessicali9530/celeba-dataset). To learn more about GANs we recommend the [NIPS 2016 Tutorial: Generative Adversarial Networks](https://arxiv.org/abs/1701.00160).
github_jupyter
This notebook is used for some basic exploration on modelled data. #Importing the data The following code imports the necessary packages and creates convinient shortcut functions. As well as assures the plots will appear in this notebook within the Out. ``` from __future__ import division, print_function import netCDF4 as nc import matplotlib.pyplot as plt import numpy as np from salishsea_tools import (nc_tools, viz_tools) %matplotlib inline ``` This will upload the nowcast grid T data from May 4th 2015; temperature, salinity and sea surface height. ``` filename='/data/dlatorne/MEOPAR/SalishSea/nowcast/04may15/SalishSea_1d_20150504_20150504_grid_T.nc' f=nc.Dataset(filename) ``` Below I will create my own shorter variable names to facilitate accessing these variables. ``` nc_tools.show_variables(f) lons=f.variables['nav_lon'] lats=f.variables['nav_lat'] sal=f.variables['vosaline'] temp=f.variables['votemper'] ssh=f.variables['sossheig'] dep=f.variables['deptht'] ``` Making a plot of the (average) sea surface height of May 4th as a colour mesh ``` fig, ax = plt.subplots(1, 1, figsize=(10, 8)) viz_tools.set_aspect(ax) mesh = ax.pcolormesh(ssh[0]) fig.colorbar(mesh) ``` ##Making a Complete Colour Mesh Plot Masking the land by creating a numpy masked array which masks the values that are zero within the ssh array and adding labels and titles. ``` ssh1=np.ma.masked_values(ssh[0],0) fig, ax = plt.subplots(1, 1, figsize=(10, 8)) viz_tools.set_aspect(ax) cmap = plt.get_cmap('jet') cmap.set_bad('burlywood') mesh = ax.pcolormesh(ssh1, cmap=cmap) cbar=fig.colorbar(mesh) ax.set_xlabel('x') ax.set_ylabel('y') cbar.set_label('SSH [{units}]'.format(units=ssh.units)) ``` From this map we notice the sea surface height is similar, approx. 0m everywhere but at the Fraser River where it is up to approximate .60m higher. The sea surface height is slightly lower in the Juan da Fuca straight and as we move south. Now I will try with temperature at the surface and I will use the longitude and latitude instead of indices. ``` temp1=np.ma.masked_values(temp[0,0,:,:],0) fig, ax = plt.subplots(1, 1, figsize=(10, 8)) viz_tools.set_aspect(ax) cmap = plt.get_cmap('jet') cmap.set_bad('burlywood') mesh = ax.pcolormesh(lons[:], lats[:], temp1, cmap=cmap) cbar=fig.colorbar(mesh) ax.set_xlabel('{lon} [{units}]'.format(lon=lons.long_name, units=lons.units)) ax.set_ylabel('{lat} [{units}]'.format(lat=lats.long_name, units=lats.units)) cbar.set_label('{label} [{units}]'.format(label=temp.long_name.title(), units=temp.units)) ax.set_title(u'May 4th 2015 Mean, depth \u2248 {d:.2f}{z.units}'.format(d=dep[0], z=dep)) ``` ##Velocity QuiverPlots I will upload the datasets of May 4th, 2015 with the u, v and w velocity components. The tracers, u, v and w all have different grid box sizes in x, y and depth. In order to align the u and v velocities with the tracers grod point as a reference we will use the unstagger function within viz_tools. ``` filenameu='/data/dlatorne/MEOPAR/SalishSea/nowcast/04may15/SalishSea_1d_20150504_20150504_grid_U.nc' filenamev='/data/dlatorne/MEOPAR/SalishSea/nowcast/04may15/SalishSea_1d_20150504_20150504_grid_V.nc' filenamew='/data/dlatorne/MEOPAR/SalishSea/nowcast/04may15/SalishSea_1d_20150504_20150504_grid_W.nc' bathy=nc.Dataset('/data/dlatorne/MEOPAR/NEMO-forcing/grid/bathy_meter_SalishSea2.nc') uvel=nc.Dataset(filenameu) vvel=nc.Dataset(filenamev) wvel=nc.Dataset(filenamew) ugrid= uvel.variables['vozocrtx'] vgrid= vvel.variables['vomecrty'] depv= vvel.variables['depthv'] depu=uvel.variables['depthu'] depw=wvel.variables['depthw'] vgrid_mask=np.ma.masked_values(vgrid[0,0,:,:],0) ugrid_mask=np.ma.masked_values(ugrid[0,0,:,:],0) u, v=viz_tools.unstagger(ugrid_mask,vgrid_mask) depv[:]==depw[:] dep[:] ugrid.coordinates ``` For the next plot I will use the plot_land_mask function within viz_tools in order to fill the land area as solid polygons. This uses the bathymetry file. Quiver auto-scaling capability increases the size of the arrows when you diminish the amount of vectors you are plotting. ``` zlevel = 0 y_slice = np.arange(200, 320) x_slice = np.arange(200, 320) arrow_step = 4 y_slice_a = y_slice[::arrow_step] x_slice_a = x_slice[::arrow_step] ugrid_tzyx = np.ma.masked_values(ugrid[0, zlevel, y_slice_a, x_slice_a], 0) vgrid_tzyx = np.ma.masked_values(vgrid[0, zlevel, y_slice_a, x_slice_a], 0) u, v = viz_tools.unstagger(ugrid_tzyx, vgrid_tzyx) fig, ax = plt.subplots(1, 1, figsize=(10, 8)) viz_tools.set_aspect(ax) # ax.quiver(x_slice_a[1:], y_slice_a[1:], u,v, pivot='mid') viz_tools.plot_land_mask(ax, bathy , xslice=x_slice, yslice=y_slice) ax.set_xlim(x_slice[0], x_slice[-1]) ax.set_ylim(y_slice[0], y_slice[-1]) ax.grid() x_slice=np.arange(ugrid.shape[3]) y_slice=np.arange(ugrid.shape[2]) ugrid_tzyx = np.ma.masked_values(ugrid[0,0,:,:], 0) vgrid_tzyx = np.ma.masked_values(vgrid[0,0,:,:], 0) u, v = viz_tools.unstagger(ugrid_tzyx, vgrid_tzyx) fig, ax = plt.subplots(1, 1, figsize=(10, 8)) viz_tools.set_aspect(ax) ax.quiver(x_slice[1::3], y_slice[1::3], u[::3,::3],v[::3,::3], pivot='mid') viz_tools.plot_land_mask(ax, bathy, xslice=x_slice, yslice=y_slice, color='burlywood') ``` The quiver of the daily average shows the currents moving alot faster though Haro Stait and near the Fraser River. However the arrows and the detailed flow is not visible in this plot. #Velocity Quiver with Colour map We will now apply a colour map that corresponds to the velocity magnitude. ``` y_slice_zoom=np.arange(350,470) x_slice_zoom=np.arange(250,360) u_zoom=u[350:470,250:360] v_zoom=v[350:470,250:360] speed=np.sqrt(np.square(u_zoom)+np.square(v_zoom)) fig, ax = plt.subplots(1, 1, figsize=(10, 8)) viz_tools.set_aspect(ax) ax.quiver(x_slice_zoom[::3], y_slice_zoom[::3], u_zoom[::3,::3],v_zoom[::3,::3], speed[::3,::3], pivot='mid', cmap='Reds', width=0.005) viz_tools.plot_land_mask(ax, bathy, xslice=x_slice_zoom, yslice=y_slice_zoom, color='burlywood') ax.set_xlim(x_slice_zoom[0],x_slice_zoom[-1]) ax.set_ylim(y_slice_zoom[0],y_slice_zoom[-1]) ``` #Vetical Plane Plots ##Velocities on Vertical Plane The figure with contain two subplots. One of the vertical depth profiles which will demontrate the average daily velocity on May 4th 2015 through the water column across a cross sectional area of the Strait of Georgia. The second will show where the trasect was taken and display the surface current of the surrounding area. ``` fig, (axl, axr)= plt.subplots(1,2,figsize=(16,8)) lcolour='burlywood' t=0 #The daily average only have one time zmax=37 #The vertical profile will go down to the 41th depth bin... it only has 40... ycross=416 #The cross sectional area will be taken along the 416th index of y x_slice_cross=np.arange(200, 320) timestamp=nc_tools.timestamp(vvel,t) #Mask and slice v_vel=np.ma.masked_values(vgrid[t, :zmax, ycross,x_slice_cross],0) cmap=plt.get_cmap('bwr') cmap.set_bad(lcolour) mesh= axl.pcolormesh(x_slice_cross[:],depv[:zmax], v_vel,cmap=cmap, vmin=-0.1, vmax=1) axl.invert_yaxis() cbar=fig.colorbar(mesh, ax=axl) axl.set_xlim(x_slice_cross[0], x_slice_cross[-1]) axl.set_ylim(depv[zmax-2] +10,0) axl.grid() #Second subplot y_slice=np.arange(350,470) x_slice=np.arange(180,360) u_mask=np.ma.masked_values(ugrid[t,0,y_slice, x_slice],0) v_mask=np.ma.masked_values(vgrid[t,0,y_slice, x_slice],0) u_unstag,v_unstag=viz_tools.unstagger(u_mask,v_mask) speeds=np.sqrt(np.square(u_unstag)+np.square(v_unstag)) max_speed=viz_tools.calc_abs_max(speeds) viz_tools.set_aspect(axr) axr.streamplot(x_slice[1:], y_slice[1:], u_unstag, v_unstag, linewidth=6*speeds/max_speed) viz_tools.plot_land_mask(axr,bathy,xslice=x_slice, yslice=y_slice,color=lcolour) axr.plot(x_slice_cross, ycross*np.ones_like(x_slice_cross), linestyle='solid', linewidth=3, color='black', label='Section Line') axr.legend(loc='best', fancybox=True) ``` ##Salinity Contour Mesh The last plot I will create in this note book will be of the vetical salinity all along the Georgia Strait following the deepest cross-section. ``` #Loading the array with the deepest point of the strait. thalweg=np.loadtxt('/data/dlatorne/MEOPAR/tools/analysis_tools/thalweg.txt',dtype=int, unpack=True) fig,(axl,axcb,axr)=plt.subplots(1,3,figsize=(16,8)) axl.set_axis_bgcolor(lcolour) axr.set_axis_bgcolor(lcolour) axl.set_position((0.125, 0.125, 0.6, 0.775)) axcb.set_position((0.73, 0.125, 0.02, 0.775)) axr.set_position((0.83, 0.125, 0.2, 0.775)) #First we will do the map with thalweg line on it viz_tools.set_aspect(axr) cmap=plt.get_cmap('winter_r') cmap.set_bad(lcolour) bathym=bathy.variables['Bathymetry'] x_slice=np.arange(bathym.shape[1]) y_slice=np.arange(200,800) axr.pcolormesh(x_slice, y_slice, bathym[y_slice, x_slice], cmap=cmap) axr.plot(thalweg[1], thalweg[0], linestyle='-', marker='+', color='red', label='Thalweg Points') axr.legend(loc='best', fancybox=True) axr.grid() #Salinity coutour plot salmin=26 salmax=34 dels=0.5 cmap=plt.get_cmap('rainbow') cmap.set_bad(lcolour) sal_0=sal[0,:,thalweg[0],thalweg[1]] sal_mask=np.ma.masked_values(sal_0,0) x,z=np.meshgrid(np.arange(thalweg.shape[1]), dep) mesh=axl.pcolormesh(x,z,sal_mask, cmap=cmap, vmin=salmin, vmax=salmax) cbar=plt.colorbar(mesh,cax=axcb) clines=axl.contour(x,z,sal_mask,np.arange(salmin,salmax,dels), colors='black') axl.clabel(clines, fmt='%1.1f', inline=True) axl.invert_yaxis() axl.set_xlim(0,thalweg[0][-1]) ```
github_jupyter
# Perturbation cost trajectories for gaussian noise of different sizes vs uniform noise of different sizes ``` import os os.chdir("../") import sys import json from argparse import Namespace import numpy as np from sklearn import metrics from sklearn.metrics import pairwise_distances as dist import matplotlib.pyplot as plt import seaborn as sns sns.set(context='paper') import provable_robustness_max_linear_regions.data as dt from generate_perturbation_cost_trajectories import calculate_perturbation_cost_data from utils import NumpyEncoder ``` ## Plot settings: ``` SMALL_SIZE = 14 MEDIUM_SIZE = 18 BIGGER_SIZE = 26 plt.rc('font', size=SMALL_SIZE) # controls default text sizes plt.rc('axes', titlesize=MEDIUM_SIZE) # fontsize of the axes title plt.rc('axes', labelsize=MEDIUM_SIZE) # fontsize of the x and y labels plt.rc('xtick', labelsize=SMALL_SIZE) # fontsize of the tick labels plt.rc('ytick', labelsize=SMALL_SIZE) # fontsize of the tick labels plt.rc('legend', fontsize=SMALL_SIZE) # legend fontsize plt.rc('figure', titlesize=BIGGER_SIZE) # fontsize of the figure title plt.rc('text', usetex=True) # dictionary that maps color string to 'good looking' seaborn colors that are easily distinguishable colors = { "orange": sns.xkcd_rgb["yellowish orange"], "red": sns.xkcd_rgb["pale red"], "green": sns.xkcd_rgb["medium green"], "blue": sns.xkcd_rgb["denim blue"], "yellow": sns.xkcd_rgb["amber"], "purple": sns.xkcd_rgb["dusty purple"], "cyan": sns.xkcd_rgb["cyan"] } ``` ## Calculate perturbation cost data: Estimated runtime (if no file with data is present): 12 hours ``` def load_from_json(file_name): if not os.path.exists("res/" + file_name + ".json"): return None else: with open("res/" + file_name + ".json", 'r') as fp: return json.load(fp) def save_to_json(dictionary, file_name): if not os.path.exists("res"): os.makedirs("res") with open("res/" + file_name + ".json", 'w') as fp: json.dump(dictionary, fp, cls = NumpyEncoder) n_points = 1000 perturbation_cost_data = load_from_json("pc_croce_adversarial_noise_plus_gaussian_noise_n_points={}".format(n_points)) croce_model_paths = ["provable_robustness_max_linear_regions/models/plain/2019-02-24 00:50:45 dataset=mnist nn_type=cnn_lenet_small p_norm=2 lmbd=0.0 gamma_rb=0.0 gamma_db=0.0 ae_frac=0.0 lr=0.001 epoch=100.mat","provable_robustness_max_linear_regions/models/mmr+at/2019-02-17 01:54:16 dataset=mnist nn_type=cnn_lenet_small p_norm=inf lmbd=0.5 gamma_rb=0.2 gamma_db=0.2 ae_frac=0.5 epoch=100.mat", "provable_robustness_max_linear_regions/models/mmr+at/2019-02-24 00:04:27 dataset=mnist nn_type=cnn_lenet_small p_norm=2 lmbd=6.0 gamma_rb=0.45 gamma_db=0.45 ae_frac=0.5 lr=5e-05 epoch=50.mat"] if not perturbation_cost_data: perturbation_cost_data = dict() for model_path in croce_model_paths: args = Namespace() args.dataset = "mnist" args.n_points = n_points args.model_path = model_path args.adversarial_model_paths = [model_path] args.nn_type = "cnn" args.norms = ["inf", "2"] args.noise_types = ["gaussian", "uniform"] args.noise_sizes = [0.1, 0.3, 0.6] args.splits = [{"inf": [0.0, np.inf], "2": [0.0, np.inf]}] args.save = False args.plot = False file_name = model_path.split("/")[3] model_name = file_name.split(".mat")[0] perturbation_cost_data[model_name] = calculate_perturbation_cost_data(args) save_to_json(perturbation_cost_data, "pc_croce_adversarial_noise_plus_gaussian_noise_n_points={}".format(n_points)) ``` ## Plot: ``` # name to save the plot save_name = "fig_pc_comparing_noise_levels" model_names = [ "2019-02-17 01:54:16 dataset=mnist nn_type=cnn_lenet_small p_norm=inf lmbd=0.5 gamma_rb=0.2 gamma_db=0.2 ae_frac=0.5 epoch=100", "2019-02-24 00:04:27 dataset=mnist nn_type=cnn_lenet_small p_norm=2 lmbd=6.0 gamma_rb=0.45 gamma_db=0.45 ae_frac=0.5 lr=5e-05 epoch=50" ] model_name_dict = { "2019-02-24 00:50:45 dataset=mnist nn_type=cnn_lenet_small p_norm=2 lmbd=0.0 gamma_rb=0.0 gamma_db=0.0 ae_frac=0.0 lr=0.001 epoch=100": "Training: Standard Training", "2019-02-17 01:54:16 dataset=mnist nn_type=cnn_lenet_small p_norm=inf lmbd=0.5 gamma_rb=0.2 gamma_db=0.2 ae_frac=0.5 epoch=100": "Training: MMR+AT\nThreat Model: $\ell_\infty(\epsilon=0.1)$", "2019-02-24 00:04:27 dataset=mnist nn_type=cnn_lenet_small p_norm=2 lmbd=6.0 gamma_rb=0.45 gamma_db=0.45 ae_frac=0.5 lr=5e-05 epoch=50": "Training: MMR+AT\nThreat Model: $\ell_2(\epsilon=0.3)$" } base_color_dict_for_noise_type = { "noise": { "inf": { "gaussian": colors["red"], "uniform": colors["blue"] }, "2": { "gaussian": colors["red"], "uniform": colors["blue"] } } } # number of model types and parameter combinations n_cols = 2 n_rows = 1 fig, ax = plt.subplots(n_rows, n_cols, figsize=(6 * n_cols, 5 * n_rows), dpi=400) linestyle = "-" base_color_dict = { "adv": { "inf": colors["blue"], "2": colors["green"] }, "noise": { "inf": colors["red"], "2": colors["yellow"] } } norm_to_latex = {"inf": "\infty", "2": "2"} model_name = "2019-02-24 00:50:45 dataset=mnist nn_type=cnn_lenet_small p_norm=2 lmbd=0.0 gamma_rb=0.0 gamma_db=0.0 ae_frac=0.0 lr=0.001 epoch=100" pert_costs_data = perturbation_cost_data[model_name][model_name] for i, norm in enumerate(["inf", "2"]): pert_cost_norm = norm perturbation_norm = norm noise_types = ["uniform", "gaussian"] noise_sizes = ["0.1", "0.3", "0.6"] split = json.dumps({"inf": [0.0, np.inf], "2": [0.0, np.inf]}) for noise_type in noise_types: for noise_size in noise_sizes: pert_costs_noise = np.array( pert_costs_data[pert_cost_norm][perturbation_norm] [noise_type][noise_size][split]["pert_costs_2"]) linestyle = "-" color = base_color_dict_for_noise_type["noise"][ perturbation_norm][noise_type] ax[i].plot(np.mean(pert_costs_noise, axis=0), c=color, linestyle=linestyle, label="{} noise, size $\ell_{}={}$".format( noise_type, norm_to_latex[perturbation_norm], noise_size), alpha=0.4 + float(noise_size)) ax[i].set_xlim(0.0, 8.0) ax[i].set_xticks(np.arange(0, 9.0, 1.0)) ax[i].set_xticklabels([ "INPUT", "CONV", "RELU", "CONV", "RELU", "FC", "RELU", "FC", "ARGMAX" ]) ax[i].set_xlabel("layer") ax[i].legend() fig.suptitle( "mean perturbation cost curves for different noise sizes in $\ell_\infty$ and $\ell_2$ norm" ) ax[0].set_ylabel("perturbation costs") ax[0].set_ylim(0.0, 2.0) ax[1].set_ylim(0.0, 0.1) fig.tight_layout() fig.subplots_adjust(top=0.88) fig.savefig('res/{}.pdf'.format(save_name)) ```
github_jupyter
# Introduction: Writing Patent Abstracts with a Recurrent Neural Network The purpose of this notebook is to develop a recurrent neural network using LSTM cells that can generate patent abstracts. We will look at using a _word level_ recurrent neural network and _embedding_ the vocab, both with pre-trained vectors and training our own embeddings. We will train the model by feeding in as the features a long sequence of words (for example 50 words) and then using the next word as the label. Over time, the network will (hopefully) learn to predict the next word in a given sequence and we can use the model predictions to generate entirely novel patent abstracts. ## Approach The approach to solving this problem is: 1. Read in training data: thousands of "neural network" patents 2. Convert patents to integer sequences: `tokenization` 3. Create training dataset using next word following a sequence as label 4. Build a recurrent neural network using word embeddings and LSTM cells 5. Load in pre-trained embeddings 6. Train network to predict next word from sequence 7. Generate new abstracts by feeding network a seed sequence 8. Repeat steps 2 - 7 using pre-trained embeddings 9. Try different model architecture to see if performance improves 10. For fun, create a simple game where we must guess if the output is human or computer! Each of these steps is relatively simple by itself, so don't be intimidated. We'll walk through the entire process and at the end will be able to have a working application of deep learning! ``` # Set up IPython to show all outputs from a cell from IPython.core.interactiveshell import InteractiveShell InteractiveShell.ast_node_interactivity = 'all' import warnings warnings.filterwarnings('ignore', category = RuntimeWarning) RANDOM_STATE = 50 EPOCHS = 150 BATCH_SIZE = 2048 TRAINING_LENGTH = 50 TRAIN_FRACTION = 0.7 VERBOSE = 0 SAVE_MODEL = True from tensorflow.python.client import device_lib print(device_lib.list_local_devices()) ``` ## Read in Data Our data consists of patent abstracts by searching for the term "neural networks" on [patentsview query](http://www.patentsview.org/querydev) web interface. The data can be downloaded in a number of formats and can include a number of patent attributes (I only kept 4). ``` import pandas as pd import numpy as np # Read in data data = pd.read_csv('../data/neural_network_patent_query.csv', parse_dates = ['patent_date']) # Extract abstracts original_abstracts = list(data['patent_abstract']) len(original_abstracts) data.head() ``` ### Brief Data Exploration This data is extremely clean, which means we don't need to do any manual munging. We can still make a few simple plots out of curiousity though! ``` data['patent_abstract'][100] import matplotlib.pyplot as plt %matplotlib inline plt.style.use('fivethirtyeight') data['year-month'] = [pd.datetime(year, month, 1) for year, month in zip(data['patent_date'].dt.year, data['patent_date'].dt.month)] monthly = data.groupby('year-month')['patent_number'].count().reset_index() monthly.set_index('year-month')['patent_number'].plot(figsize = (16, 8)) plt.ylabel('Number of Patents'); plt.xlabel('Date'); plt.title('Neural Network Patents over Time'); monthly.groupby(monthly['year-month'].dt.year)['patent_number'].sum().plot.bar(color = 'red', edgecolor = 'k', figsize = (12, 6)) plt.xlabel('Year'); plt.ylabel('Number of Patents'); plt.title('Neural Network Patents by Year'); ``` The distribution of patents over time is interesting. I would expect 2018 to come out on top once the patents have been accepted. ## Data Cleaning Our preprocessing is going to involve using a `Tokenizer` to convert the patents from sequences of words (strings) into sequences of integers. We'll get to that in a bit, but even with neural networks, having a clean dataset is paramount. The data quality is already high, but there are some idiosyncracies of patents as well as general text improvements to make. For example, let's consider the following two sentences. >'This is a short sentence (1) with one reference to an image. This next sentence, while non-sensical, does not have an image and has two commas.' If we choose to remove all punctuation with the default Tokenizer settings, we get the following. ``` from keras.preprocessing.text import Tokenizer example = 'This is a short sentence (1) with one reference to an image. This next sentence, while non-sensical, does not have an image and has two commas.' tokenizer = Tokenizer(filters='!"#$%&()*+,-./:;<=>?@[\\]^_`{|}~\t\n') tokenizer.fit_on_texts([example]) s = tokenizer.texts_to_sequences([example])[0] ' '.join(tokenizer.index_word[i] for i in s) ``` This removes all the punctuation and now we have a random number in the sentence. If we choose to not remove the punctuation, the sentence looks better, but then we have some interesting words in the vocabulary. ``` tokenizer = Tokenizer(filters='"#$%&*+/:;<=>?@[\\]^_`{|}~\t\n') tokenizer.fit_on_texts([example]) s = tokenizer.texts_to_sequences([example])[0] ' '.join(tokenizer.index_word[i] for i in s) tokenizer.word_index.keys() ``` Notice that `image` and `image.` are classified as distinct words. This is because the period is attached to one and not the other and the same with `sentence` and `sentence,`. To alleviate this issue, we can add spaces around the punctuation using regular expressions. We will also remove the image references. ``` import re def format_patent(patent): """Add spaces around punctuation and remove references to images/citations.""" # Add spaces around punctuation patent = re.sub(r'(?<=[^\s0-9])(?=[.,;?])', r' ', patent) # Remove references to figures patent = re.sub(r'\((\d+)\)', r'', patent) # Remove double spaces patent = re.sub(r'\s\s', ' ', patent) return patent f = format_patent(example) f ``` Now when we do the tokenization, we get separate entries in the vocab for the punctuation, but _not_ for words with punctuation attached. ``` tokenizer = Tokenizer(filters='"#$%&*+/:;<=>?@[\\]^_`{|}~\t\n') tokenizer.fit_on_texts([f]) s = tokenizer.texts_to_sequences([f])[0] ' '.join(tokenizer.index_word[i] for i in s) tokenizer.word_index.keys() ``` We no longer have the `image` and `image.` problem but we do have separate symbols for `.` and `,`. This means the network will be forced to learn a representation for these punctuation marks (they are also in the pre-trained embeddings). When we want to get back to the original sentence (without image references) we simply have to remove the spaces. ``` def remove_spaces(patent): """Remove spaces around punctuation""" patent = re.sub(r'\s+([.,;?])', r'\1', patent) return patent remove_spaces(' '.join(tokenizer.index_word[i] for i in s)) ``` We can apply this operation to all of the original abstracts. ``` formatted = [] # Iterate through all the original abstracts for a in original_abstracts: formatted.append(format_patent(a)) len(formatted) ``` # Convert Text to Sequences A neural network cannot process words, so we must convert the patent abstracts into integers. This is done using the Keras utility `Tokenizer`. By default, this will convert all words to lowercase and remove punctuation. Therefore, our model will not be able to write complete sentences. However, this can be beneficial for a first model because it limits the size of the vocabulary and means that more of the words (converted into tokens) will have pre-trained embeddings. Later, we will not remove the capitalization and punctuation when we train our own embeddings. ## Features and Labels This function takes a few parameters including a training length which is the number of words we will feed into the network as features with the next word the label. For example, if we set `training_length = 50`, then the model will take in 50 words as features and the 51st word as the label. For each abstract, we can make multiple training examples by slicing at different points. We can use the first 50 words as features with the 51st as a label, then the 2nd through 51st word as features and the 52nd as the label, then 3rd - 52nd with 53rd as label and so on. This gives us much more data to train on and the performance of the model is proportional to the amount of training data. ``` def make_sequences(texts, training_length = 50, lower = True, filters='!"#$%&()*+,-./:;<=>?@[\\]^_`{|}~\t\n'): """Turn a set of texts into sequences of integers""" # Create the tokenizer object and train on texts tokenizer = Tokenizer(lower=lower, filters=filters) tokenizer.fit_on_texts(texts) # Create look-up dictionaries and reverse look-ups word_idx = tokenizer.word_index idx_word = tokenizer.index_word num_words = len(word_idx) + 1 word_counts = tokenizer.word_counts print(f'There are {num_words} unique words.') # Convert text to sequences of integers sequences = tokenizer.texts_to_sequences(texts) # Limit to sequences with more than training length tokens seq_lengths = [len(x) for x in sequences] over_idx = [i for i, l in enumerate(seq_lengths) if l > (training_length + 20)] new_texts = [] new_sequences = [] # Only keep sequences with more than training length tokens for i in over_idx: new_texts.append(texts[i]) new_sequences.append(sequences[i]) training_seq = [] labels = [] # Iterate through the sequences of tokens for seq in new_sequences: # Create multiple training examples from each sequence for i in range(training_length, len(seq)): # Extract the features and label extract = seq[i - training_length: i + 1] # Set the features and label training_seq.append(extract[:-1]) labels.append(extract[-1]) print(f'There are {len(training_seq)} training sequences.') # Return everything needed for setting up the model return word_idx, idx_word, num_words, word_counts, new_texts, new_sequences, training_seq, labels ``` Now let's see how our function generates data. For using pre-trained embeddings, we'll remove a fair amount of the punctuation and lowercase all letters but leave in periods and commas. This is because there are no capitalized words in the pre-trained embeddings but there is some punctuation. Our model will not learn how to capitalize words, but it may learn how to end a sentence and insert commas. ``` filters = '!"#$%&()*+/:<=>@[\\]^_`{|}~\t\n' word_idx, idx_word, num_words, word_counts, abstracts, sequences, features, labels = make_sequences(formatted, TRAINING_LENGTH, lower = True, filters = filters) ``` Each patent is now represented as a sequence of integers. Let's look at an example of a few features and the corresponding labels. The label is the next word in the sequence after the first 50 words. ``` n = 3 features[n][:10] def find_answer(index): """Find label corresponding to features for index in training data""" # Find features and label feats = ' '.join(idx_word[i] for i in features[index]) answer = idx_word[labels[index]] print('Features:', feats) print('\nLabel: ', answer) find_answer(n) original_abstracts[0] find_answer(100) ``` Our patents are no longer correct English, but, by removing capital letters, we do reduce the size of the vocabulary. __Deciding which pre-processing steps to take in general is the most important aspect of an machine learning project.__ ``` sorted(word_counts.items(), key = lambda x: x[1], reverse = True)[:15] ``` The most common words make sense in the context of the patents we are using and the geneal English language. ## Training Data Next we need to take the features and labels and convert them into training and validation data. The following function does this by splitting the data - after random shuffling because the features were made in sequential order - based on the `train_fraction` specified. All the inputs are converted into numpy arrays which is the correct input to a keras neural network. ### Encoding of Labels One important step is to convert the labels to one hot encoded vectors because our network will be trained using `categorical_crossentropy` and makes a prediction for each word in the vocabulary (we can train with the labels represented as simple integers, but I found performance was better and training faster when using a one-hot representation of the labels). This is done by creating an array of rows of all zeros except for the index of the word which we want to predict - the label - which gets a 1. ``` from sklearn.utils import shuffle def create_train_valid(features, labels, num_words, train_fraction = TRAIN_FRACTION): """Create training and validation features and labels.""" # Randomly shuffle features and labels features, labels = shuffle(features, labels, random_state = RANDOM_STATE) # Decide on number of samples for training train_end = int(train_fraction * len(labels)) train_features = np.array(features[:train_end]) valid_features = np.array(features[train_end:]) train_labels = labels[:train_end] valid_labels = labels[train_end:] # Convert to arrays X_train, X_valid = np.array(train_features), np.array(valid_features) # Using int8 for memory savings y_train = np.zeros((len(train_labels), num_words), dtype = np.int8) y_valid = np.zeros((len(valid_labels), num_words), dtype = np.int8) # One hot encoding of labels for example_index, word_index in enumerate(train_labels): y_train[example_index, word_index] = 1 for example_index, word_index in enumerate(valid_labels): y_valid[example_index, word_index] = 1 # Memory management import gc gc.enable() del features, labels, train_features, valid_features, train_labels, valid_labels gc.collect() return X_train, X_valid, y_train, y_valid X_train, X_valid, y_train, y_valid = create_train_valid(features, labels, num_words) X_train.shape y_train.shape ``` We do want to be careful about using up too much memory. One hot encoding the labels creates massive numpy arrays so I took care to delete the un-used objects from the workspace. ``` import sys sys.getsizeof(y_train) / 1e9 def check_sizes(gb_min = 1): for x in globals(): size = sys.getsizeof(eval(x))/1e9 if size > gb_min: print(f'Object: {x:10}\tSize: {size} GB.') check_sizes(gb_min = 1) ``` # Pre-Trained Embeddings Rather than training our own word embeddings, a very expensive operation, we can use word embeddings that were trained on a large corpus of words. The hope is that these embeddings will generalize from the training corpus to our needs. This code downloads 100-dimensional word embeddings if you don't already have them. There are a number of different pre-trained word embeddings you can find from [Stanford online](https://nlp.stanford.edu/data/). ``` import os from keras.utils import get_file # Vectors to use glove_vectors = '/home/ubuntu/.keras/datasets/glove.6B.zip' # Download word embeddings if they are not present if not os.path.exists(glove_vectors): glove_vectors = get_file('glove.6B.zip', 'http://nlp.stanford.edu/data/glove.6B.zip') os.system(f'unzip {glove_vectors}') # Load in unzipped file glove_vectors = '/home/ubuntu/.keras/datasets/glove.6B.100d.txt' glove = np.loadtxt(glove_vectors, dtype='str', comments=None) glove.shape ``` Now we separated into the words and the vectors. ``` vectors = glove[:, 1:].astype('float') words = glove[:, 0] del glove vectors[100], words[100] ``` Next we want to keep only those words that appear in our vocabulary. For words that are in our vocabulary but don't have an embedding, they will be represented as all 0s (a shortcoming that we can address by training our own embeddings.) ``` vectors.shape word_lookup = {word: vector for word, vector in zip(words, vectors)} embedding_matrix = np.zeros((num_words, vectors.shape[1])) not_found = 0 for i, word in enumerate(word_idx.keys()): # Look up the word embedding vector = word_lookup.get(word, None) # Record in matrix if vector is not None: embedding_matrix[i + 1, :] = vector else: not_found += 1 print(f'There were {not_found} words without pre-trained embeddings.') import gc gc.enable() del vectors gc.collect() ``` Each word is represented by 100 numbers with a number of words that can't be found. We can find the closest words to a given word in embedding space using the cosine distance. This requires first normalizing the vectors to have a magnitude of 1. ``` # Normalize and convert nan to 0 embedding_matrix = embedding_matrix / np.linalg.norm(embedding_matrix, axis = 1).reshape((-1, 1)) embedding_matrix = np.nan_to_num(embedding_matrix) def find_closest(query, embedding_matrix, word_idx, idx_word, n = 10): """Find closest words to a query word in embeddings""" idx = word_idx.get(query, None) # Handle case where query is not in vocab if idx is None: print(f'{query} not found in vocab.') return else: vec = embedding_matrix[idx] # Handle case where word doesn't have an embedding if np.all(vec == 0): print(f'{query} has no pre-trained embedding.') return else: # Calculate distance between vector and all others dists = np.dot(embedding_matrix, vec) # Sort indexes in reverse order idxs = np.argsort(dists)[::-1][:n] sorted_dists = dists[idxs] closest = [idx_word[i] for i in idxs] print(f'Query: {query}\n') max_len = max([len(i) for i in closest]) # Print out the word and cosine distances for word, dist in zip(closest, sorted_dists): print(f'Word: {word:15} Cosine Similarity: {round(dist, 4)}') find_closest('the', embedding_matrix, word_idx, idx_word) find_closest('neural', embedding_matrix, word_idx, idx_word, 10) find_closest('.', embedding_matrix, word_idx, idx_word, 10) find_closest('wonder', embedding_matrix, word_idx, idx_word) find_closest('dnn', embedding_matrix, word_idx, idx_word) ``` # Build Model With data encoded as integers and an embedding matrix of pre-trained word vectors, we're ready to build the recurrent neural network. This model is relatively simple and uses an LSTM cell as the heart of the network. After converting the words into embeddings, we pass them through a single LSTM layer, then into a fully connected layer with `relu` activation before the final output layer with a `softmax` activation. The final layer produces a probability for every word in the vocab. When training, these predictions are compared to the actual label using the `categorical_crossentropy` to calculate a loss. The parameters (weights) in the network are then updated using the Adam optimizer (a variant on Stochastic Gradient Descent) with gradients calculated through backpropagation. Fortunately, Keras handles all of this behind the scenes, so we just have to set up the network and then start the training. The most difficult part is figuring out the correct shapes for the inputs and outputs into the model. ``` from keras.models import Sequential, load_model from keras.layers import LSTM, Dense, Dropout, Embedding, Masking, Bidirectional from keras.optimizers import Adam from keras.utils import plot_model def make_word_level_model(num_words, embedding_matrix, bi_directional = False, trainable = False, lstm_cells = 128, lstm_layers = 1): """Make a word level recurrent neural network with option for pretrained embeddings and varying numbers of LSTM cell layers.""" model = Sequential() # Map words to an embedding if not trainable: model.add(Embedding(input_dim=num_words, output_dim=embedding_matrix.shape[1], weights = [embedding_matrix], trainable = False, mask_zero = True)) model.add(Masking()) else: model.add(Embedding(input_dim = num_words, output_dim = embedding_matrix.shape[1], weights = [embedding_matrix], trainable = True)) # If want to add multiple LSTM layers if lstm_layers > 1: for i in range(lstm_layers - 1): model.add(LSTM(128, return_sequences=True, dropout=0.1, recurrent_dropout=0.1)) # Add final LSTM cell layer if bi_directional: model.add(Bidirectional(LSTM(lstm_cells, return_sequences = False, dropout = 0.1, recurrent_dropout=0.1))) else: model.add(LSTM(lstm_cells, return_sequences=False, dropout=0.1)) model.add(Dense(128, activation = 'relu')) # Dropout for regularization model.add(Dropout(0.5)) # Output layer model.add(Dense(num_words, activation = 'softmax')) # Compile the model model.compile(optimizer = 'adam', loss = 'categorical_crossentropy', metrics = ['accuracy']) return model model = make_word_level_model(num_words, embedding_matrix = embedding_matrix, bi_directional = True, trainable = False, lstm_layers = 1, lstm_cells = 64) model.summary() ``` The model needs a loss to minimize (`categorical_crossentropy`) as well as a method for updating the weights using the gradients (`Adam`). We will also monitor accuracy which is not a good loss but can give us a more interpretable measure of the model performance. Using pre-trained embeddings means we have about half the parameters to train. However, this also means that the embeddings might not be the best for our data, and there are a number of words with no embeddings. ``` model_name = 'pre-trained-bi-directional-rnn' model_dir = '../models/' plot_model(model, to_file = f'{model_dir}{model_name}.png', show_shapes = True) from IPython.display import Image Image(f'{model_dir}{model_name}.png') ``` # Train Model We can now train the model on our training examples. We'll make sure to use early stopping with a validation set to stop the training when the loss on the validation set is no longer decreasing. Also, we'll save the best model every time the validation loss decreases so we can then load in the best model to generate predictions. ### Callbacks * Early Stopping: Stop training when validation loss no longer decreases * Model Checkpoint: Save the best model on disk ``` from keras.callbacks import EarlyStopping, ModelCheckpoint BATCH_SIZE = 2048 def make_callbacks(model_name, save = SAVE_MODEL): """Make list of callbacks for training""" callbacks = [EarlyStopping(monitor = 'val_loss', patience = 5)] if save: callbacks.append(ModelCheckpoint(f'{model_dir}{model_name}.h5', save_best_only = True, save_weights_only = False)) return callbacks callbacks = make_callbacks(model_name) def load_and_evaluate(model_name, return_model = False): """Load in a trained model and evaluate with log loss and accuracy""" model = load_model(f'{model_dir}{model_name}.h5') r = model.evaluate(X_valid, y_valid, batch_size = 2048, verbose = 1) valid_crossentropy = r[0] valid_accuracy = r[1] print(f'Cross Entropy: {round(valid_crossentropy, 4)}') print(f'Accuracy: {round(100 * valid_accuracy, 2)}%') if return_model: return model ``` __Depending on your machine, this may take several hours to run.__ ``` history = model.fit(X_train, y_train, epochs = EPOCHS, batch_size = BATCH_SIZE, verbose = 1, callbacks=callbacks, validation_data = (X_valid, y_valid)) model = load_and_evaluate(model_name, return_model = True) model = make_word_level_model(num_words, embedding_matrix = embedding_matrix, bi_directional = False, trainable = False, lstm_layers = 1, lstm_cells = 64) model.summary() model_name = 'pre-trained-nonbi-directional-rnn' callbacks = make_callbacks(model_name) history = model.fit(X_train, y_train, epochs = EPOCHS, batch_size = BATCH_SIZE, verbose = 1, callbacks=callbacks, validation_data = (X_valid, y_valid)) model = load_and_evaluate(model_name, return_model = True) ``` The accuracy - both training and validation - increase over time and the loss decreases over time which gives us indication that our model is getting better with training. We can load back in the model so we don't need to repeat the training. ``` def load_and_evaluate(model_name, return_model = False): """Load in a trained model and evaluate with log loss and accuracy""" model = load_model(f'{model_dir}{model_name}.h5') r = model.evaluate(X_valid, y_valid, batch_size = 2048, verbose = 1) valid_crossentropy = r[0] valid_accuracy = r[1] print(f'Cross Entropy: {round(valid_crossentropy, 4)}') print(f'Accuracy: {round(100 * valid_accuracy, 2)}%') if return_model: return model model = load_and_evaluate(model_name, return_model = True) ``` To check how the model compares to just using the word frequencies to make predictions, we can compute the accuracy if we were to use the most frequent word for every guess. We can also choose from a multinomial distribution using the word frequencies as probabilities. ``` np.random.seed(40) # Number of all words total_words = sum(word_counts.values()) # Compute frequency of each word in vocab frequencies = [word_counts[word]/total_words for word in word_idx.keys()] frequencies.insert(0, 0) frequencies[1:10], list(word_idx.keys())[0:9] ``` The most common word is 'the'. Let's see the accuracy of guessing this for every validation example. ``` print(f'The accuracy is {round(100 * np.mean(np.argmax(y_valid, axis = 1) == 1), 4)}%.') ``` Now we make a guess for each of the sequences in the validation set using the frequencies as probabilities. This is in some sense informed, but the multinomial also has randomness. ``` random_guesses = [] # Make a prediction based on frequencies for each example in validation data for i in range(len(y_valid)): random_guesses.append(np.argmax(np.random.multinomial(1, frequencies, size = 1)[0])) from collections import Counter # Create a counter from the guesses c = Counter(random_guesses) # Iterate through the 10 most common guesses for i in c.most_common(10): word = idx_word[i[0]] word_count = word_counts[word] print(f'Word: {word} \tCount: {word_count} \tPercentage: {round(100 * word_count / total_words, 2)}% \tPredicted: {i[1]}') accuracy = np.mean(random_guesses == np.argmax(y_valid, axis = 1)) print(f'Random guessing accuracy: {100 * round(accuracy, 4)}%') ``` We can see that our model easily outperforms both guessing the most common word - 7.76% accuracy - as well as using relative word frequencies to guess the next word - 1.46% accuracy. Therefore, we can say that our model has learned something! # Generating Output Now for the fun part: we get to use our model to generate new abstracts. To do this, we feed the network a seed sequence, have it make a prediction, add the predicted word to the sequence, and make another prediction for the next word. We continue this for the number of words that we want. We compare the generated output to the actual abstract to see if we can tell the difference! ``` from IPython.display import HTML def header(text, color = 'black'): raw_html = f'<h1 style="color: {color};"><center>' + str(text) + '</center></h1>' return raw_html def box(text): raw_html = '<div style="border:1px inset black;padding:1em;font-size: 20px;">'+str(text)+'</div>' return raw_html def addContent(old_html, raw_html): old_html += raw_html return old_html import random def generate_output(model, sequences, training_length = 50, new_words = 50, diversity = 1, return_output = False, n_gen = 1): """Generate `new_words` words of output from a trained model and format into HTML.""" # Choose a random sequence seq = random.choice(sequences) # Choose a random starting point seed_idx = random.randint(0, len(seq) - training_length - 10) # Ending index for seed end_idx = seed_idx + training_length gen_list = [] for n in range(n_gen): # Extract the seed sequence seed = seq[seed_idx:end_idx] original_sequence = [idx_word[i] for i in seed] generated = seed[:] + ['#'] # Find the actual entire sequence actual = generated[:] + seq[end_idx:end_idx + new_words] # Keep adding new words for i in range(new_words): # Make a prediction from the seed preds = model.predict(np.array(seed).reshape(1, -1))[0].astype(np.float64) # Diversify preds = np.log(preds) / diversity exp_preds = np.exp(preds) # Softmax preds = exp_preds / sum(exp_preds) # Choose the next word probas = np.random.multinomial(1, preds, 1)[0] next_idx = np.argmax(probas) # New seed adds on old word seed = seed[1:] + [next_idx] generated.append(next_idx) # Showing generated and actual abstract n = [] for i in generated: n.append(idx_word.get(i, '< --- >')) gen_list.append(n) a = [] for i in actual: a.append(idx_word.get(i, '< --- >')) a = a[training_length:] gen_list = [gen[training_length:training_length + len(a)] for gen in gen_list] if return_output: return original_sequence, gen_list, a # HTML formatting seed_html = '' seed_html = addContent(seed_html, header('Seed Sequence', color = 'darkblue')) seed_html = addContent(seed_html, box(remove_spaces(' '.join(original_sequence)))) gen_html = '' gen_html = addContent(gen_html, header('RNN Generated', color = 'darkred')) gen_html = addContent(gen_html, box(remove_spaces(' '.join(gen_list[0])))) a_html = '' a_html = addContent(a_html, header('Actual', color = 'darkgreen')) a_html = addContent(a_html, box(remove_spaces(' '.join(a)))) return seed_html, gen_html, a_html ``` The `diversity` parameter determines how much randomness is added to the predictions. If we just use the most likely word for each prediction, the output sometimes gets stuck in loops. The diversity means the predicted text has a little more variation. ``` seed_html, gen_html, a_html = generate_output(model, sequences, TRAINING_LENGTH) HTML(seed_html) HTML(gen_html) HTML(a_html) seed_html, gen_html, a_html = generate_output(model, sequences, TRAINING_LENGTH, diversity = 1) HTML(seed_html) HTML(gen_html) HTML(a_html) seed_html, gen_html, a_html = generate_output(model, sequences, TRAINING_LENGTH, diversity = 0.75) HTML(seed_html) HTML(gen_html) HTML(a_html) ``` Increasing the diversity seems to increase the plausibility of the output. However, that could be becuase the patents themselves don't sound that realistic. This is especially true when we remove the punctuation. We'll fix that in the next section by keeping the punctuation and training our own embeddings. # Training Own Embeddings If we aren't happy with the output, especially the lack of punctuation, we can try training our own embeddings. This means the model will adapt the embeddings by itself to get better at the problem of predicting the next output. The final embeddings should place words that are more similar closer together in embedding space. The advantage of training our own embeddings are that they might be more relevant to the task. However, the downside is that training will take longer because the number of parameters significantly increases. ``` def clear_memory(): import gc gc.enable() for i in ['model', 'X', 'y', 'word_idx', 'idx_word', 'X_train', 'X_valid,' 'y_train', 'y_valid', 'embedding_matrix', 'words', 'vectors', 'labels', 'random_guesses', 'training_seq', 'word_counts', 'data', 'frequencies']: if i in dir(): del globals()[i] gc.collect() clear_memory() ``` Now when we create the training data, we do not remove the punctuation or convert the words to lowercase. ``` TRAINING_LENGTH = 50 filters = '!"%;[\\]^_`{|}~\t\n' word_idx, idx_word, num_words, word_counts, abstracts, sequences, features, labels = make_sequences(formatted, TRAINING_LENGTH, lower = False, filters = filters) embedding_matrix = np.zeros((num_words, len(word_lookup['the']))) not_found = 0 for i, word in enumerate(word_idx.keys()): # Look up the word embedding vector = word_lookup.get(word, None) # Record in matrix if vector is not None: embedding_matrix[i + 1, :] = vector else: not_found += 1 print(f'There were {not_found} words without pre-trained embeddings.') embedding_matrix.shape # Split into training and validation X_train, X_valid, y_train, y_valid = create_train_valid(features, labels, num_words) X_train.shape, y_train.shape check_sizes(gb_min = 1) ``` Let's create a model with 100 dimensional embeddings, input sequences of length 50, and 1 LSTM layer as before. ``` model = make_word_level_model(num_words, embedding_matrix, trainable = True, bi_directional = True, lstm_layers = 1, lstm_cells = 64) model.summary() model_name = 'training-rnn-bi-directional' callbacks = make_callbacks(model_name) model.compile(optimizer = Adam(), loss = 'categorical_crossentropy', metrics = ['accuracy']) history = model.fit(X_train, y_train, batch_size = BATCH_SIZE, verbose = VERBOSE, epochs = EPOCHS, callbacks=callbacks, validation_data = (X_valid, y_valid)) import json with open('training-rnn.json', 'w') as f: f.write(json.dumps(word_idx)) ``` As before we load in the model and have it generate output. ``` model_dir = '../models/' from keras.models import load_model model = load_and_evaluate(model_name, return_model=True) seed_html, gen_html, a_html = generate_output(model, sequences, TRAINING_LENGTH, diversity = 0.75) HTML(seed_html) HTML(gen_html) HTML(a_html) seed_html, gen_html, a_html = generate_output(model, sequences, TRAINING_LENGTH, diversity = 0.75) HTML(seed_html) HTML(gen_html) HTML(a_html) ``` The most realisitic output seems to occur when the diversity is between 0.5 and 1.0. Sometimes it's difficult to tell the generated from the actual, a trial we'll look at a little later! ## Inspect Embeddings We can take a look at our trained embeddings to figure out the closest words in the embedding space. These embeddings are trained for our task, which means they may differ slightly from the pre-trained versions. ``` model.summary() def get_embeddings(model): embedding_layer = model.get_layer(index = 0) embedding_matrix = embedding_layer.get_weights()[0] embedding_matrix = embedding_matrix / np.linalg.norm(embedding_matrix, axis = 1).reshape((-1, 1)) embedding_matrix = np.nan_to_num(embedding_matrix) return embedding_matrix embedding_matrix = get_embeddings(model) embedding_matrix.shape find_closest('the', embedding_matrix, word_idx, idx_word) find_closest('neural', embedding_matrix, word_idx, idx_word) find_closest('computer', embedding_matrix, word_idx, idx_word) ``` # Change Parameters of Network Next, we can try to generate more accurate predictions by altering the network parameters. Primarily, we will increase the number of LSTM layers to 2. The first LSTM layer returns the sequences - the entire output for each input sequence instead of only the final one - before passing it on to the second. Training may take a little longer, but performance could also improve. There's no guarantee this model is better because we could just end up overfitting on the training data. There is no downside to trying though. ``` model = make_word_level_model(num_words, embedding_matrix, trainable = True, lstm_layers = 2) model.summary() model_name = 'training-rnn-2_layers' callbacks = make_callbacks(model_name) history = model.fit(X_train, y_train, batch_size = BATCH_SIZE, verbose = VERBOSE, epochs = EPOCHS, callbacks=callbacks, validation_data = (X_valid, y_valid)) model = load_and_evaluate(model_name, return_model = True) embedding_matrix = get_embeddings(model) seed_html, gen_html, a_html = generate_output(model, sequences, TRAINING_LENGTH, diversity = 0.75) HTML(seed_html) HTML(gen_html) HTML(a_html) ``` # Change Training Length Another option to try and improve the model is to change the length of the training sequences. The idea here is using more previous words will give the network more context for predicting the next word. However, it could also be that including more words _hurts_ the model because some of them are irrelevant! ``` clear_memory() TRAINING_LENGTH = 100 filters = '!"%;[\\]^_`{|}~\t\n' word_idx, idx_word, num_words, word_counts, abstracts, sequences, features, labels = make_sequences(formatted, TRAINING_LENGTH, lower = False, filters = filters) X_train, X_valid, y_train, y_valid = create_train_valid(features, labels, num_words) X_train.shape, y_train.shape check_sizes() model = make_word_level_model(num_words, embedding_matrix, trainable = True) model.summary() model_name = 'training-len100' callbacks = make_callbacks(model_name) history = model.fit(X_train, y_train, epochs = EPOCHS, callbacks=callbacks, batch_size = BATCH_SIZE, verbose = VERBOSE, validation_data = (X_valid, y_valid)) model = load_and_evaluate(model_name, return_model=True) embedding_matrix = get_embeddings(model) word_lookup = {word: embedding_matrix[i] for i, word in zip(idx_word.keys(), idx_word.values())} len(word_lookup) seed_html, gen_html, a_html = generate_output(model, sequences, TRAINING_LENGTH, diversity = 1.5) HTML(seed_html) HTML(gen_html) HTML(a_html) ``` # Reduce Training Length ``` clear_memory() TRAINING_LENGTH = 20 filters = '!"%[\\]^_`{|}~\t\n' word_idx, idx_word, num_words, word_counts, abstracts, sequences, features, labels = make_sequences(formatted, TRAINING_LENGTH, lower = False, filters = filters) embedding_matrix = np.zeros((num_words, len(word_lookup['the']))) not_found = 0 for i, word in enumerate(word_idx.keys()): # Look up the word embedding vector = word_lookup.get(word, None) # Record in matrix if vector is not None: embedding_matrix[i + 1, :] = vector else: not_found += 1 print(f'There were {not_found} words without pre-trained embeddings.') X_train, X_valid, y_train, y_valid = create_train_valid(features, labels, num_words) X_train.shape, y_train.shape check_sizes() model = make_word_level_model(num_words, embedding_matrix, trainable = True, lstm_layers = 1) model_name = 'training-len20' callbacks = make_callbacks(model_name) history = model.fit(X_train, y_train, epochs = EPOCHS, batch_size = BATCH_SIZE, verbose = VERBOSE, callbacks=callbacks, validation_data = (X_valid, y_valid)) model = load_and_evaluate(model_name, return_model = True) seed_html, gen_html, a_html = generate_output(model, sequences, TRAINING_LENGTH, diversity = 0.75) HTML(seed_html) HTML(gen_html) HTML(a_html) seed_html, gen_html, a_html = generate_output(model, sequences, TRAINING_LENGTH, diversity = 0.8) HTML(seed_html) HTML(gen_html) HTML(a_html) ``` # Is Output from a human or machine? ``` def guess_human(model, sequences, training_length=50, new_words=50): """Produce 2 RNN sequences and play game to compare to actaul. Diversity is randomly set between 0.5 and 1.25""" diversity = np.random.uniform(0.5, 1.25) sequence, gen_list, actual = generate_output(model, sequences, training_length, diversity=diversity, return_output=True, n_gen = 2) gen_0, gen_1 = gen_list output = {'sequence': remove_spaces(' '.join(sequence)), 'c0': remove_spaces(' '.join(gen_0)), 'c1': remove_spaces(' '.join(gen_1)), 'h': remove_spaces(' '.join(actual))} print(f"Seed Sequence: {output['sequence']}\n") choices = ['h', 'c0', 'c1'] selected = [] i = 0 while len(selected) < 3: choice = random.choice(choices) selected.append(choice) print('\n') print(f'Option {i + 1} {output[choice]}') choices.remove(selected[-1]) i += 1 print('\n') guess = int(input('Enter option you think is human (1-3): ')) - 1 print('\n') if guess == np.where(np.array(selected) == 'h')[0][0]: print('Correct') print('Correct Ordering', selected) else: print('Incorrect') print('Correct Ordering', selected) print('Diversity', round(diversity, 2)) guess_human(model, sequences) guess_human(model, sequences) ``` # Conclusions In this notebook, we saw how to build a recurrent neural network and used it to generate patent abstracts. Although the output is not always believable, this project gives us practice handling text sequences with neural networks. Deep learning has some advantages compared to traditional machine learning, especially in areas of computer vision and natural language processing. Hopefully you are now confident harnessing these powerful techniques to solve your own text problems! This project covered a number of steps for working with text data including: 1. Cleaning data using regular expressions 2. Preparing data for neural network * Converting text strings to integers (tokenization) * Encoding labels using one-hot encoding * Building training and validation set 3. Buildig a recurrent neural network using LSTM cells 4. Using pre-trained word embeddings and training our own embeddings 5. Adjusting model parameters to improve performance 6. Inspecting model results Although we didn't cover the theory in depth, we did see the implementation, which means we now have a framework to fit the concepts we study. Technical topics are best learned through practice, and this project gave us a great opportunity to explore the frontiers of natural language processing with deep learning. # Appendix I: Training with A Data Generator ``` def data_gen(sequences, labels, batch_size, num_words): """Yield batches for training""" i = 0 while True: # Reset once all examples have been used if i + batch_size > len(labels): i = 0 X = np.array(sequences[i: i + batch_size]) # Create array of zeros for labels y = np.zeros((BATCH_SIZE, num_words)) # Extract integer labels ys = labels[i: i + batch_size] # Convert to one hot representation for example_num, word_num in enumerate(ys): y[example_num, word_num] = 1 yield X, y i += batch_size gc.collect() def create_train_valid_gen(features, labels, batch_size, num_words): """Create training and validation generators for training""" # Randomly shuffle features and labels features, labels = shuffle(features, labels, random_state = RANDOM_STATE) # Decide on number of samples for training train_end = int(0.7 * len(labels)) train_features = np.array(features[:train_end]) valid_features = np.array(features[train_end:]) train_labels = labels[:train_end] valid_labels = labels[train_end:] # Make training and validation generators train_gen = data_gen(train_features, train_labels, batch_size, num_words) valid_gen = data_gen(valid_features, valid_labels, batch_size, num_words) return train_gen, valid_gen, train_end BATCH_SIZE = 2048 train_gen, valid_gen, train_len = create_train_valid_gen(features, labels, BATCH_SIZE, num_words) X, y = next(train_gen) train_steps = train_len // BATCH_SIZE valid_steps = (len(labels) - train_len) // BATCH_SIZE X.shape y.shape train_steps valid_steps history = model.fit_generator(train_gen, steps_per_epoch= train_steps, epochs = 2, callbacks=None, validation_data = valid_gen, validation_steps = valid_steps) ``` # Appendix II: Using a Keras Sequence for Training ``` from keras.utils import Sequence class textSequence(Sequence): """Keras Sequence for training with a generator.""" def __init__(self, x_set, y_set, batch_size, num_words): self.x, self.y = x_set, y_set self.batch_size = batch_size self.num_words = num_words def __len__(self): return int(np.ceil(len(self.x) / float(self.batch_size))) def __getitem__(self, idx): batch_x = self.x[idx * self.batch_size:(idx + 1) * self.batch_size] batch_y = self.y[idx * self.batch_size:(idx + 1) * self.batch_size] X = np.array(batch_x) y = np.zeros((len(batch_y), self.num_words)) for example_idx, word_idx in enumerate(batch_y): y[example_idx, word_idx] = 1 return X, y # Decide on number of samples for training train_end = int(TRAIN_FRACTION * len(labels)) train_features = np.array(features[:train_end]) valid_features = np.array(features[train_end:]) train_labels = labels[:train_end] valid_labels = labels[train_end:] train_sequence = textSequence(train_features, train_labels, 2048, num_words) valid_sequence = textSequence(valid_features, valid_labels, 2048, num_words) history = model.fit_generator(train_sequence, epochs = 2, callbacks=None, validation_data = valid_sequence, workers = 20) ```
github_jupyter
``` from pathlib import Path import os import os.path as op from pkg_resources import resource_filename as pkgrf import shutil import cubids TEST_DATA = pkgrf("cubids", "testdata") def test_data(tmp_path): data_root = tmp_path / "testdata" shutil.copytree(TEST_DATA, str(data_root)) assert len(list(data_root.rglob("*"))) > 5 return data_root workdir = os.getcwd() def copy_testing_data(dirname): newdir = op.join(workdir, dirname) os.makedirs(newdir) data_dir = test_data(Path(newdir)) return data_dir # copy the data data_root = copy_testing_data("test1") !rm -rf test1 ``` # Test the key / param groups This test copies the data and makes sure we get the correct number of key and parameter groups out of it ``` from cubids import CuBIDS bod = CuBIDS(str(first_test / "complete")) bod._cache_fieldmaps() key_groups = bod.get_key_groups() print(key_groups) ibod = CuBIDS(str(first_test / "inconsistent")) misfits = ibod._cache_fieldmaps() len(misfits) ikey_groups = ibod.get_key_groups() ikey_groups == key_groups ``` # Working with datalad Here we try to initialize a datalad repo on the test data ``` import datalad.api as dlapi dl = dlapi.create(path=first_test / "inconsistent", force=True) files_df, summary_df = bod.get_param_groups_dataframes() %qtconsole summary_df[["key_group", "ParamGroup", "Count"]] import pandas as pd param_group_cols = list(set(df.columns.to_list()) - set(["FilePath"])) uniques = df.drop_duplicates(param_group_cols, ignore_index=True) print(uniques.shape) counts = df.groupby(["key_group", "ParamGroup"]).size().reset_index(name='Count') print(counts.shape) params_and_counts = pd.merge(uniques, counts) print(params_and_counts.shape) no_paths[["key_group", "ParamGroup"]].groupby(["key_group", "ParamGroup"]).count() keyparam_df.groupby(["key_group", "ParamGroup"]).size().reset_index(name='Count') fname = 'sub-NDARAT581NDH/ses-HBNsiteRU/dwi/sub-NDARAT581NDH_ses-HBNsiteRU_acq-64dir_dwi.nii.gz' bod.get_key_groups() self = bod from cubids.cubids import * suffix = '(phase1|phasediff|epi|fieldmap)' fmap_files = self.layout.get(suffix=suffix, regex_search=True, extension=['.nii.gz', '.nii']) files_to_fmaps = defaultdict(list) print("\n".join([f.path for f in fmap_files])) """ for fmap_file in tqdm(fmap_files): intentions = listify(fmap_file.get_metadata().get("IntendedFor")) subject_prefix = "sub-%s/" % fmap_file.entities['subject'] for intended_for in intentions: subject_relative_path = subject_prefix + intended_for files_to_fmaps[subject_relative_path].append(fmap_file) """ fmap_file = fmap_files[0] intentions = listify(fmap_file.get_metadata().get("IntendedFor")) print("intentions:", intentions) subject_prefix = "sub-%s/" % fmap_file.entities['subject'] print(subject_prefix) suffix = '(phase1|phasediff|epi|fieldmap)' fmap_files = self.layout.get(suffix=suffix, regex_search=True, extension=['.nii.gz', '.nii']) files_to_fmaps = defaultdict(list) for fmap_file in tqdm(fmap_files): intentions = listify(fmap_file.get_metadata().get("IntendedFor")) subject_prefix = "sub-%s" % fmap_file.entities['subject'] for intended_for in intentions: full_path = Path(self.path) / subject_prefix / intended_for files_to_fmaps[str(full_path)].append(fmap_file) for data_file, fmap_files in bod.fieldmap_lookup.items(): print(data_file[44:]) for fmap_file in fmap_files: print(" ", fmap_file.path[44:]) files_to_fmaps.keys() from cubids.cubids import * files = [ '/Users/mcieslak/projects/test_bids_data/HBN/sub-NDARAT581NDH/ses-HBNsiteRU/dwi/sub-NDARAT581NDH_ses-HBNsiteRU_acq-64dir_dwi.nii.gz', '/Users/mcieslak/projects/test_bids_data/HBN/sub-NDARRP384BVX/ses-HBNsiteRU/dwi/sub-NDARRP384BVX_ses-HBNsiteRU_acq-64dir_dwi.nii.gz'] dfs = [] fieldmap_lookup = bod.fieldmap_lookup key_group_name = "test" # path needs to be relative to the root with no leading prefix for path in files: metadata = bod.layout.get_metadata(path) wanted_keys = metadata.keys() & IMAGING_PARAMS example_data = {key: metadata[key] for key in wanted_keys} example_data["key_group"] = key_group_name # Get the fieldmaps out and add their types print(fieldmap_lookup[path]) fieldmap_types = sorted([fmap.entities['fmap'] for fmap in fieldmap_lookup[path]]) for fmap_num, fmap_type in enumerate(fieldmap_types): example_data['fieldmap_type%02d' % fmap_num] = fmap_type # Expand slice timing to multiple columns SliceTime = example_data.get('SliceTiming') if SliceTime: # round each slice time to one place after the decimal for i in range(len(SliceTime)): SliceTime[i] = round(SliceTime[i], 1) example_data.update( {"SliceTime%03d" % SliceNum: time for SliceNum, time in enumerate(SliceTime)}) del example_data['SliceTiming'] dfs.append(example_data) example_data ```
github_jupyter
# Collaboration and Competition --- You are welcome to use this coding environment to train your agent for the project. Follow the instructions below to get started! ### 1. Start the Environment Run the next code cell to install a few packages. This line will take a few minutes to run! ``` !pip -q install ./python ``` The environment is already saved in the Workspace and can be accessed at the file path provided below. ``` from unityagents import UnityEnvironment import numpy as np env = UnityEnvironment(file_name="/data/Tennis_Linux_NoVis/Tennis") ``` Environments contain **_brains_** which are responsible for deciding the actions of their associated agents. Here we check for the first brain available, and set it as the default brain we will be controlling from Python. ``` # get the default brain brain_name = env.brain_names[0] brain = env.brains[brain_name] ``` ### 2. Examine the State and Action Spaces Run the code cell below to print some information about the environment. ``` # reset the environment env_info = env.reset(train_mode=True)[brain_name] # number of agents num_agents = len(env_info.agents) print('Number of agents:', num_agents) # size of each action action_size = brain.vector_action_space_size print('Size of each action:', action_size) # examine the state space states = env_info.vector_observations state_size = states.shape[1] print('There are {} agents. Each observes a state with length: {}'.format(states.shape[0], state_size)) print('The state for the first agent looks like:', states[0]) ``` ### 3. Take Random Actions in the Environment In the next code cell, you will learn how to use the Python API to control the agent and receive feedback from the environment. Note that **in this coding environment, you will not be able to watch the agents while they are training**, and you should set `train_mode=True` to restart the environment. ``` for i in range(5): # play game for 5 episodes env_info = env.reset(train_mode=False)[brain_name] # reset the environment states = env_info.vector_observations # get the current state (for each agent) scores = np.zeros(num_agents) # initialize the score (for each agent) while True: actions = np.random.randn(num_agents, action_size) # select an action (for each agent) actions = np.clip(actions, -1, 1) # all actions between -1 and 1 env_info = env.step(actions)[brain_name] # send all actions to tne environment next_states = env_info.vector_observations # get next state (for each agent) rewards = env_info.rewards # get reward (for each agent) dones = env_info.local_done # see if episode finished scores += env_info.rewards # update the score (for each agent) states = next_states # roll over states to next time step if np.any(dones): # exit loop if episode finished break print('Total score (averaged over agents) this episode: {}'.format(np.mean(scores))) ``` When finished, you can close the environment. ### 4. It's Your Turn! Now it's your turn to train your own agent to solve the environment! A few **important notes**: - When training the environment, set `train_mode=True`, so that the line for resetting the environment looks like the following: ```python env_info = env.reset(train_mode=True)[brain_name] ``` - To structure your work, you're welcome to work directly in this Jupyter notebook, or you might like to start over with a new file! You can see the list of files in the workspace by clicking on **_Jupyter_** in the top left corner of the notebook. - In this coding environment, you will not be able to watch the agents while they are training. However, **_after training the agents_**, you can download the saved model weights to watch the agents on your own machine! # Import necessart packages ``` import matplotlib.pyplot as plt %matplotlib inline import time, os from collections import deque import torch from maddpg import MADDPG ``` # Instantiate agent ``` agent = MADDPG(seed=2, noise_start=0.5, update_every=2, gamma=1, t_stop_noise=30000) episode_num = 6000 max_t = 1000 scores = [] scores_deque = deque(maxlen=100) scores_avg = [] for i_episode in range(1, episode_num + 1): rewards = [] env_info = env.reset(train_mode=False)[brain_name] state = env_info.vector_observations for t in range(max_t): action = agent.act(state) env_info = env.step(action)[brain_name] next_state = env_info.vector_observations rewards_vec = env_info.rewards done = env_info.local_done agent.step(state, action, rewards_vec, next_state, done) state = next_state rewards.append(rewards_vec) if any(done): break episode_reward = np.max(np.sum(np.array(rewards), axis=0)) scores.append(episode_reward) scores_deque.append(episode_reward) current_avg_score = np.mean(scores_deque) scores_avg.append(current_avg_score) print('\rEpisode {}\tAverage Score: {:.3f}'.format(i_episode, current_avg_score), end="") if i_episode % 200 == 0: print('\rEpisode {}\tAverage Score: {:.3f}'.format(i_episode, current_avg_score)) agent.save_agents() if np.mean(scores_deque) >= .5: print('\nEnvironment solved in {:d} episodes!\tAverage Score: {:.3f}'.format(i_episode, np.mean(scores_deque))) agent.save_agents() break ``` # Training ``` %%time import pandas as pd pd.DataFrame({"scores":scores,"scores_avg":scores_avg}).to_csv("p3_score.csv",index=False) ``` # Plotting ``` fig = plt.figure(figsize=(16,8)) ax = fig.add_subplot(111) plt.plot(np.arange(1, len(scores)+1), scores,'b',label='Episode Scores') plt.plot(np.arange(1, len(scores)+1), scores_avg,'y',\ linewidth=5,label='Avg. score of last 100 episodes') plt.ylabel('Score', fontsize=18) plt.xlabel('Episode no', fontsize=18) ax.legend(fontsize=14) plt.show() !tar -zcvf p3_.tar.gz * ``` # Closing env ``` env.close() ```
github_jupyter
``` import pandas as pd import numpy as np import os import glob import nltk.data from __future__ import division # Python 2 users only import nltk, re, pprint from nltk import word_tokenize from sklearn.feature_extraction.text import CountVectorizer from sklearn.metrics.pairwise import linear_kernel from nltk.corpus import stopwords from sklearn.feature_extraction.text import TfidfVectorizer from collections import Counter %matplotlib inline translations = glob.glob('/Users/sheldon/completed_podcasts/*/*.txt') translations = filter(lambda x: 'DONE' not in x, translations) translations = filter(lambda x: 'speech_notebook' not in x, translations) translations episode = [i.split('/')[5] for i in translations] series = [i.split('/')[4] for i in translations] locations = translations transcribed = [open(i).read() for i in translations] df = pd.DataFrame(data={'episode':episode,'series':series,'locations':locations,'transcribed':transcribed}) df['id'] = df.index stop = set(stopwords.words('english')) def tokenize_and_lower(textfile): tokens = word_tokenize(textfile) lower = [w.lower() for w in tokens] filtered_words = [word for word in lower if word not in stop] remove_contractions = [word for word in filtered_words if "'" not in word] remove_periods = [word for word in remove_contractions if "." not in word] count = Counter(remove_periods) return count #df['trans_token'] = df.transcribed.apply(tokenize_and_lower) df['removed_stop_transcribed'] = df.transcribed.apply(tokenize_and_lower) tf = TfidfVectorizer(stop_words=stop) tfidf_matrix = tf.fit_transform(df['transcribed']) tfidf_matrix from sklearn.metrics.pairwise import linear_kernel cosine_similarities = linear_kernel(tfidf_matrix, tfidf_matrix) def get_related_podcasts(podcast_number,number_of_similarities): cosine_similarities = linear_kernel(tfidf_matrix, tfidf_matrix) related_pod_index = cosine_similarities.argsort()[podcast_number][::-1] pod_dict = dict(zip(range(0, len(related_pod_index)),related_pod_index)) pod_dict = pd.DataFrame({'rank':pod_dict.keys()},index=pod_dict.values()) related_podcasts_df = pd.DataFrame.join(pod_dict, df, how='inner') final_df = related_podcasts_df.sort_values('rank')[0:number_of_similarities+1][['rank','episode','series']] return final_df def get_related_podcasts_query(query, number_of_similarities): query = query.lower() query = query.split() tfidf_matrix_test = tf.fit_transform(query) tfidf_matrix_train = tf.transform(df['transcribed']) tfidf_matrix_train.todense() tfidf_matrix_test.todense() query_similarities = linear_kernel(tfidf_matrix_test, tfidf_matrix_train) query_similarities = query_similarities.argsort()[0][::-1] pod_dict = dict(zip(range(0, len(query_similarities)),query_similarities)) pod_dict = pd.DataFrame({'rank':pod_dict.keys()},index=pod_dict.values()) related_podcasts_df = pd.DataFrame.join(pod_dict, df, how='inner') final_df = related_podcasts_df.sort_values('rank')[0:number_of_similarities+1][['rank','episode','series']] return final_df get_related_podcasts_query('economics math statistics',5) get_related_podcasts(17,5) ``` ## Compute for queries ``` query = ['python tim ferris'] vectorizer = TfidfVectorizer(stop_words='english') tfidf_matrix_test = tf.fit_transform(query) tfid_matrix_train = tfidf_matrix.todense() tfidf_matrix_test.todense() cosine_similarities = linear_kernel(tfidf_matrix_test, tfidf_matrix_train) cosine_similarities= cosine_similarities.argsort()[::-1] cosine_similarities ```
github_jupyter
## Kaggle Advance House Price Prediction Using PyTorch * https://docs.fast.ai/tabular.html * https://www.fast.ai/2018/04/29/categorical-embeddings/ * https://yashuseth.blog/2018/07/22/pytorch-neural-network-for-tabular-data-with-categorical-embeddings/ ``` import pandas as pd ``` ### Importing the Dataset ``` df=pd.read_csv('houseprice.csv',usecols=["SalePrice", "MSSubClass", "MSZoning", "LotFrontage", "LotArea", "Street", "YearBuilt", "LotShape", "1stFlrSF", "2ndFlrSF"]).dropna() df.shape df.head() df.info() ``` ### Unique Values in the Columns ``` for i in df.columns: print("Column name {} and unique values are {}".format(i,len(df[i].unique()))) ``` ### Derived Features ``` import datetime datetime.datetime.now().year df['Total Years']=datetime.datetime.now().year-df['YearBuilt'] df.head() df.drop("YearBuilt",axis=1,inplace=True) df.columns ``` ### Creating my Categorical Features ``` cat_features=["MSSubClass", "MSZoning", "Street", "LotShape"] out_feature="SalePrice" df["MSSubClass"].unique() ``` ### Converting the categorical feature ``` from sklearn.preprocessing import LabelEncoder lbl_encoders={} lbl_encoders["MSSubClass"]=LabelEncoder() lbl_encoders["MSSubClass"].fit_transform(df["MSSubClass"]) lbl_encoders from sklearn.preprocessing import LabelEncoder lbl_encoders={} for feature in cat_features: lbl_encoders[feature]=LabelEncoder() df[feature]=lbl_encoders[feature].fit_transform(df[feature]) df.head() ``` ### Stacking and Converting Into Tensors ``` import numpy as np cat_features=np.stack([df['MSSubClass'],df['MSZoning'],df['Street'],df['LotShape']],1) cat_features ``` ### Convert numpy to Tensors **Note: CATEGORICAL FEATURES CAN NEVER BY CONVERTED TO FLOAT** ``` import torch cat_features=torch.tensor(cat_features,dtype=torch.int64) cat_features ``` ### Creating continuous variables ``` cont_features=[] for i in df.columns: if i in ["MSSubClass", "MSZoning", "Street", "LotShape","SalePrice"]: pass else: cont_features.append(i) cont_features ``` ### Stacking continuous variables to a tensor ``` cont_values=np.stack([df[i].values for i in cont_features],axis=1) cont_values=torch.tensor(cont_values,dtype=torch.float) cont_values cont_values.dtype ``` ### Dependent Feature ``` y=torch.tensor(df['SalePrice'].values,dtype=torch.float).reshape(-1,1) y df.info() cat_features.shape,cont_values.shape,y.shape len(df['MSSubClass'].unique()) ``` ## Embedding Size For Categorical columns ``` cat_dims=[len(df[col].unique()) for col in ["MSSubClass", "MSZoning", "Street", "LotShape"]] cat_dims ``` ### Dimension of Output from the Embedding Layer * Output dimension should be set based on the input dimension * Should be min(50, feature dimension/2) * **Not more than 50 categorical values can be used** ``` embedding_dim= [(x, min(50, (x + 1) // 2)) for x in cat_dims] embedding_dim ``` ## Creating an Embedding Layer inside the Neural Network * ModuleList is used because we have many dimensions (4) in the embedding layer. * Embedding function creates the embedding layer using the list comprehension ``` import torch import torch.nn as nn import torch.nn.functional as F embed_representation=nn.ModuleList([nn.Embedding(inp,out) for inp,out in embedding_dim]) embed_representation cat_features cat_featuresz=cat_features[:4] cat_featuresz pd.set_option('display.max_rows', 500) embedding_val=[] for i,e in enumerate(embed_representation): embedding_val.append(e(cat_features[:,i])) embedding_val len(embedding_val[0][0]) ``` ### Stacking the embedded values column wise ``` z = torch.cat(embedding_val, 1) z ``` ### Implement dropout - Regularization Method (Prevents Overfitting) ``` # 40% values are dropped out. droput=nn.Dropout(.4) final_embed=droput(z) final_embed ``` ## Create a Feed Forward Neural Network ``` import torch import torch.nn as nn import torch.nn.functional as F class FeedForwardNN(nn.Module): def __init__(self, embedding_dim, n_cont, out_sz, layers, p=0.5): super().__init__() self.embeds = nn.ModuleList([nn.Embedding(inp,out) for inp,out in embedding_dim]) self.emb_drop = nn.Dropout(p) self.bn_cont = nn.BatchNorm1d(n_cont) layerlist = [] n_emb = sum((out for inp,out in embedding_dim)) # Input feature = Embedding Layers + Continuous Variables n_in = n_emb + n_cont for i in layers: layerlist.append(nn.Linear(n_in,i)) layerlist.append(nn.ReLU(inplace=True)) layerlist.append(nn.BatchNorm1d(i)) layerlist.append(nn.Dropout(p)) n_in = i layerlist.append(nn.Linear(layers[-1],out_sz)) self.layers = nn.Sequential(*layerlist) def forward(self, x_cat, x_cont): embeddings = [] for i,e in enumerate(self.embeds): embeddings.append(e(x_cat[:,i])) x = torch.cat(embeddings, 1) x = self.emb_drop(x) x_cont = self.bn_cont(x_cont) x = torch.cat([x, x_cont], 1) x = self.layers(x) return x len(cont_features) torch.manual_seed(100) model=FeedForwardNN(embedding_dim,len(cont_features),1,[100,50],p=0.4) ``` * ReLU activation function is used because it is a regression problem. ``` model ``` ### Define Loss And Optimizer ``` model.parameters # Later converted to Root Mean Squared Error loss_function=nn.MSELoss() optimizer=torch.optim.Adam(model.parameters(),lr=0.01) df.shape cont_values cont_values.shape batch_size=1200 test_size=int(batch_size*0.15) train_categorical=cat_features[:batch_size-test_size] test_categorical=cat_features[batch_size-test_size:batch_size] train_cont=cont_values[:batch_size-test_size] test_cont=cont_values[batch_size-test_size:batch_size] y_train=y[:batch_size-test_size] y_test=y[batch_size-test_size:batch_size] len(train_categorical),len(test_categorical),len(train_cont),len(test_cont),len(y_train),len(y_test) epochs=5000 final_losses=[] for i in range(epochs): i=i+1 y_pred=model(train_categorical,train_cont) # RMSE loss=torch.sqrt(loss_function(y_pred,y_train)) final_losses.append(loss) if i%10==1: print("Epoch number: {} and the loss : {}".format(i,loss.item())) optimizer.zero_grad() loss.backward() optimizer.step() import matplotlib.pyplot as plt %matplotlib inline plt.plot(range(epochs), final_losses) plt.ylabel('RMSE Loss') plt.xlabel('Epoch') ``` ### Validate the Test Data ``` y_pred="" with torch.no_grad(): y_pred=model(test_categorical,test_cont) loss=torch.sqrt(loss_function(y_pred,y_test)) print('RMSE: {}'.format(loss)) data_verify=pd.DataFrame(y_test.tolist(),columns=["Test"]) data_verify data_predicted=pd.DataFrame(y_pred.tolist(),columns=["Prediction"]) data_predicted final_output=pd.concat([data_verify,data_predicted],axis=1) final_output['Difference']=final_output['Test']-final_output['Prediction'] final_output.head() ``` ## Save the model ``` torch.save(model,'HousePrice.pt') torch.save(model.state_dict(),'HouseWeights.pt') ``` ### Loading the saved Model ``` embs_size=[(15, 8), (5, 3), (2, 1), (4, 2)] model1=FeedForwardNN(embs_size,5,1,[100,50],p=0.4) model1.load_state_dict(torch.load('HouseWeights.pt')) model1.eval() ```
github_jupyter
# Creating and grading assignments This guide walks an instructor through the workflow for generating an assignment and preparing it for release to students. ## Accessing the formgrader extension The formgrader extension provides the core access to nbgrader's instructor tools. After the extension has been installed, you can access it through the tab in the notebook list: ![](images/formgrader_tab.png) ## Creating a new assignment ### From the formgrader To create a new assignment, open the formgrader extension and click the "Add new assignment..." button at the bottom of the page. This will ask you to provide some information such as the name of the assignment and its due date. Then, you can add files to the assignment and edit them by clicking the name of the assignment: ![](images/manage_assignments1.png) ### From the command line To simplify this example, two notebooks of the assignment have already been stored in the `source/ps1` folder: * [source/ps1/problem1.ipynb](source/ps1/problem1.ipynb) * [source/ps1/problem2.ipynb](source/ps1/problem2.ipynb) ## Developing assignments with the assignment toolbar **Note**: As you are developing your assignments, you should save them into the `source/{assignment_id}/` folder of the nbgrader hierarchy, where `assignment_id` is the name of the assignment you are creating (e.g. "ps1"). Once the toolbar has been installed, you should see it in the drop down "View -> Cell Toolbar" menu: ![](images/assignment_toolbar.png) Selecting the "Create Assignment" toolbar will create a separate toolbar for each cell which by default will be a dropdown menu with the "-" item selected. For markdown cells, there are two additional options to choose from, either "Manually graded answer" or "Read-only": ![](images/markdown_cell.png) For code cells, there are four options to choose from, including "Manually graded answer", "Autograded answer", "Autograder tests", and "Read-only": ![](images/code_cell.png) The following sections go into detail about the different cell types, and show cells that are taken from a complete example of an assignment generated with the nbgrader toolbar extension: - [source/ps1/problem1.ipynb](source/ps1/problem1.html) - [source/ps1/problem2.ipynb](source/ps1/problem2.html) ### "Manually graded answer" cells If you select the "Manually graded answer" option (available for both markdown and code cells), the nbgrader extension will mark that cell as a cell that contains an answer that must be manually graded by a human grader. Here is an example of a manually graded answer cell: ![](images/manually_graded_answer.png) The most common use case for this type of cell is for written free-response answers (for example, which interpret the results of code that may have been written and/or executed above). *Note: the blue border only shows up when the nbgrader extension toolbar is active; it will not be visible to students.* ### “Manually graded task” cells If you select the “Manually graded task” option (available for markdown cells), the nbgrader extension will mark that cell as a cell that contains the description of a task that students have to perform. They must be manually graded by a human grader. Here is an example of a manually graded answer cell: ![](images/task-cell-source.png) The difference with a manually graded answer is that the manually graded tasks cells are not edited by the student. A manually or automatically graded cell ask students to perform a task *in* one cell. A manually graded task asks students to perform a task *with* cells. The common use case for this type of cell is for tasks that require the student to create several cells such as "Process the data and create a plot to illustrate your results." or to contain notebook-wide tasks such as "adhere to the PEP8 style convention." *Note: the blue border only shows up when the nbgrader extension toolbar is active; it will not be visible to students.* ### “Manually graded task” cells with mark scheme A mark scheme can be created through the use of a special syntax such as ``=== BEGIN MARK SCHEME ===`` and ``=== END MARK SCHEME ===``. The section of text between the two markers will be removed from the student version, but will be visible at the grading stage and in the feedback. ### "Autograded answer" cells If you select the "Autograded answer" option (available only for code cells), the nbgrader extension will mark that cell as a cell that contains an answer which will be autograded. Here is an example of an autograded graded answer cell: ![](images/autograded_answer.png) Unlike manually graded answers, autograded answers aren't worth any points: instead, the points for autograded answers are specified for the particular tests that grade those answers. See the next section for further details. *Note: the blue border only shows up when the nbgrader extension toolbar is active; it will not be visible to students.* ### "Autograder tests" cells If you select the "Autograder tests" option (available only for code cells), the nbgrader extension will mark that cell as a cell that contains tests to be run during autograding. Here is an example of two test cells: ![](images/autograder_tests.png) The lock icon on the left side of the cell toolbar indicates that the tests are "read-only". See the next section for further details on what this means. *Note: the blue border only shows up when the nbgrader extension toolbar is active; it will not be visible to students.* ### "Autograder tests" cells with hidden tests Tests in "Autograder tests" cells can be hidden through the use of a special syntax such as ``### BEGIN HIDDEN TESTS`` and ``### END HIDDEN TESTS``, for example: ![](images/autograder_tests_hidden_tests.png) ### "Read-only" cells If you select the "Read-only" option (available for both code and markdown cells), the nbgrader extension will mark that cell as one that cannot be modified. This is indicated by a lock icon on the left side of the cell toolbar: ![](images/read_only.png) This functionality is particularly important for test cells, which are always marked as read-only. Because the mechanism for autograding is that students receive full credit if the tests pass, an easy way to get around this would be to simply delete or comment out the tests. This read-only functionality will reverse any such changes made by the student. ## Validating the instructor version ### From the validate extension Ideally, the solutions in the instructor version should be correct and pass all the test cases to ensure that you are giving your students tests that they can actually pass. To verify this is the case, you can use the validate extension: ![](images/validate_extension.png) If your assignment passes all the tests, you'll get a success pop-up: ![](images/validate_success.png) If it doesn't pass all the tests, you'll get a message telling you which cells failed: ![](images/validate_failed.png) ### From the command line You can also validate assignments on the command line using the `nbgrader validate` command: ``` %%bash nbgrader validate source/ps1/*.ipynb ``` ## Generate and release an assignment ### From the formgrader After an assignment has been created with the assignment toolbar, you will want to generate the version that students will receive. You can do this from the formgrader by clicking the "generate" button: ![](images/manage_assignments2.png) This should succeed with a pop-up window containing log output: ![](images/generate_assignment.png) ### From the command line ``` {course_directory}/source/{assignment_id}/{notebook_id}.ipynb ``` Note: The `student_id` is not included here because the source and release versions of the assignment are the same for all students. After running `nbgrader generate_assignment`, the release version of the notebooks will be: ``` {course_directory}/release/{assignment_id}/{notebook_id}.ipynb ``` As a reminder, the instructor is responsible for distributing this release version to their students using their institution's existing student communication and document distribution infrastructure. When running `nbgrader generate_assignment`, the assignment name (which is "ps1") is passed. We also specify a *header* notebook (`source/header.ipynb`) to prepend at the beginning of each notebook in the assignment. By default, this command should be run from the root of the course directory: ``` %%bash nbgrader generate_assignment "ps1" --IncludeHeaderFooter.header=source/header.ipynb --force ``` ## Preview the student version After generating the student version of assignment, you should preview it to make sure that it looks correct. You can do this from the formgrader extension by clicking the "preview" button: ![](images/manage_assignments3.png) Under the hood, there will be a new folder called `release` with the same structure as `source`. The `release` folder contains the actual release version of the assignment files: * [release/ps1/problem1.ipynb](release/ps1/problem1.ipynb) * [release/ps1/problem2.ipynb](release/ps1/problem2.ipynb) If you are working on the command line, you may want to formally verify the student version as well. Ideally, all the tests should fail in the student version if the student hasn't implemented anything. To verify that this is in fact the case, we can use the `nbgrader validate --invert` command: ``` %%bash nbgrader validate --invert release/ps1/*.ipynb ``` If the notebook fails all the test cases, you should see the message "Success! The notebook does not pass any tests." ## Releasing files to students and collecting submissions ``` submitted/{student_id}/{assignment_id}/{notebook_id}.ipynb ``` **Please note**: Students must use version 3 or greater of the IPython/Jupyter notebook for nbgrader to work properly. If they are not using version 3 or greater, it is possible for them to delete cells that contain important metadata for nbgrader. With version 3 or greater, there is a feature in the notebook that prevents cells from being deleted. See [this issue](https://github.com/jupyter/nbgrader/issues/424) for more details. To ensure that students have a recent enough version of the notebook, you can include a cell such as the following in each notebook of the assignment: ```python import IPython assert IPython.version_info[0] >= 3, "Your version of IPython is too old, please update it." ``` ## Autograde assignments In the following example, we have an assignment with two notebooks. There are two submissions of the assignment: Submission 1: * [submitted/bitdiddle/ps1/problem1.ipynb](submitted/bitdiddle/ps1/problem1.ipynb) * [submitted/bitdiddle/ps1/problem2.ipynb](submitted/bitdiddle/ps1/problem2.ipynb) Submission 2: * [submitted/hacker/ps1/problem1.ipynb](submitted/hacker/ps1/problem1.ipynb) * [submitted/hacker/ps1/problem2.ipynb](submitted/hacker/ps1/problem2.ipynb) ### From the formgrader You can autograde individual submissions from the formgrader directly. To do so, click on the the number of submissions in the "Manage Assignments" view: ![](images/manage_assignments4.png) This will take you to a new page where you can see all the submissions. For a particular submission, click the "autograde" button to autograde it: ![](images/manage_submissions1.png) After autograding completes, you will see a pop-up window with log output: ![](images/autograde_assignment.png) And back on the submissions screen, you will see that the status of the submission has changed to "needs manual grading" and there is now a reported score as well: ![](images/manage_submissions2.png) ### From the command line We can run the autograder for all students at once from the command line: ``` %%bash nbgrader autograde "ps1" --force ``` When grading the submission for `Bitdiddle`, you'll see some warnings that look like "Checksum for grade cell correct_squares has changed!". What's happening here is that nbgrader has recorded what the *original* contents of the grade cell `correct_squares` (when `nbgrader generate_assignment` was run), and is checking the submitted version against this original version. It has found that the submitted version changed (perhaps this student tried to cheat by commenting out the failing tests), and has therefore overwritten the submitted version of the tests with the original version of the tests. You may also notice that there is a note saying "ps1 for Bitdiddle is 21503.948203 seconds late". What is happening here is that nbgrader is detecting a file in Bitdiddle's submission called `timestamp.txt`, reading in that timestamp, and saving it into the database. From there, it can compare the timestamp to the duedate of the problem set, and compute whether the submission is at all late. Once the autograding is complete, there will be new directories for the autograded versions of the submissions: ``` autograded/{student_id}/{assignment_id}/{notebook_id}.ipynb ``` Autograded submission 1: * [autograded/bitdiddle/ps1/problem1.ipynb](autograded/bitdiddle/ps1/problem1.ipynb) * [autograded/bitdiddle/ps1/problem2.ipynb](autograded/bitdiddle/ps1/problem2.ipynb) Autograded submission 2: * [autograded/hacker/ps1/problem1.ipynb](autograded/hacker/ps1/problem1.ipynb) * [autograded/hacker/ps1/problem2.ipynb](autograded/hacker/ps1/problem2.ipynb) ## Manual grading After running `nbgrader autograde`, the autograded version of the notebooks will be: autograded/{student_id}/{assignment_id}/{notebook_id}.ipynb We can manually grade assignments through the formgrader as well, by clicking on the "Manual Grading" navigation button. This will provide you with an interface for hand grading assignments that it finds in the directory listed above. Note that this applies to *all* assignments as well -- as long as the autograder has been run on the assignment, it will be available for manual grading via the formgrader. ## Generate feedback on assignments ``` autograded/{student_id}/{assignment_id}/{notebook_id}.ipynb ``` Creating feedback for students is divided into two parts: * generate feedback * release feedback Generating feedback will create HTML files in the local instructor directory. Releasing feedback will copy those HTML files to the nbgrader exchange. We can generate feedback based on the graded notebooks by running the `nbgrader generate_feedback` command, which will produce HTML versions of these notebooks at the following location: ``` feedback/{student_id}/{assignment_id}/{notebook_id}.html ``` The `nbgrader generate_feedback` is available by clicking the Generate Feedback button on either the Manage Assignments view (to generate feedback for all graded submissions), or on the individual student's Manage Submission page (to generate feedback for that specific individual). We can release the generated feedback by running the `nbgrader release_feedback` command, which will send the generated HTML files to the nbgrader exchange. The `nbgrader release_feedback` is available by clicking the Release Feedback button on either the Manage Assignments view (to release feedback for all generated feedback), or on the individual student's Manage Submission page (to release feedback for that specific individual). ### Workflow example: Instructor returning feedback to students In some scenarios, you may not want to (or be able to) use the exchange to deliver student feedback. This sections describes a workflow for manually returning generated feedback. In the following example, we have an assignment with two notebooks. There are two submissions of the assignment that have been graded: Autograded submission 1: * [autograded/bitdiddle/ps1/problem1.ipynb](autograded/bitdiddle/ps1/problem1.ipynb) * [autograded/bitdiddle/ps1/problem2.ipynb](autograded/bitdiddle/ps1/problem2.ipynb) Autograded submission 2: * [autograded/hacker/ps1/problem1.ipynb](autograded/hacker/ps1/problem1.ipynb) * [autograded/hacker/ps1/problem2.ipynb](autograded/hacker/ps1/problem2.ipynb) Generating feedback is fairly straightforward (and as with the other nbgrader commands for instructors, this must be run from the root of the course directory): ``` %%bash nbgrader generate_feedback "ps1" ``` Once the feedback has been generated, there will be new directories and HTML files corresponding to each notebook in each submission: Feedback for submission 1: * [feedback/bitdiddle/ps1/problem1.html](feedback/bitdiddle/ps1/problem1.html) * [feedback/bitdiddle/ps1/problem2.html](feedback/bitdiddle/ps1/problem2.html) Feedback for submission 2: * [feedback/hacker/ps1/problem1.html](feedback/hacker/ps1/problem1.html) * [feedback/hacker/ps1/problem2.html](feedback/hacker/ps1/problem2.html) If the exchange is available, one would of course use `nbgrader release_feedback`. However if not available, you can now deliver these generated HTML feedback files via whatever mechanism you wish. ## Getting grades from the database In addition to creating feedback for the students, you may need to upload grades to whatever learning management system your school uses (e.g. Canvas, Blackboard, etc.). nbgrader provides a way to export grades to CSV out of the box, with the `nbgrader export` command: ``` %%bash nbgrader export ``` After running `nbgrader export`, you will see the grades in a CSV file called `grades.csv`: ``` %%bash cat grades.csv ```
github_jupyter
<a href="https://colab.research.google.com/github/williamsdoug/CTG_RP/blob/master/CTG_RP_Train_Model.ipynb" target="_parent"><img src="https://colab.research.google.com/assets/colab-badge.svg" alt="Open In Colab"/></a> # Generate Datasets and Train Model ``` #! rm -R images ! ls %reload_ext autoreload %autoreload 2 %matplotlib inline import config_local from config_local import * import numpy as np import matplotlib.pyplot as plt import gc from fastai.vision import * from fastai.metrics import error_rate import torch from torch import nn import collections import pprint import random from compute_metadata import get_splits, generate_label_file, generate_lists from generate_recurrence_images import generate_rp_images, gen_recurrence_params ``` ## Code ## Config ``` np.random.seed(1234) random.seed(1234) # Configure Recurrent Plot Parameters POLICY='early_valid' # 'best_quality', 'early_valid', 'late_valid' rp_params = gen_recurrence_params(dimensions=[2], time_delays=[1], percentages=[1,3, 10], use_clip_vals=[False]) rp_params tfms=[] size=64 bs=64 workers=4 path = Path() / 'images' ``` ## Generate Recurrence Images ``` generate_rp_images(RECORDINGS_DIR, images_dir=IMAGES_DIR, rp_params=rp_params[:1], policy=POLICY, show_signal=False, show_image=True, verbose=True, cmap='binary', limit=3, ) generate_rp_images(RECORDINGS_DIR, images_dir=IMAGES_DIR, rp_params=rp_params, policy=POLICY, show_signal=False, show_image=False, verbose=True, cmap='binary', ) #!ls images ``` ## Generate Train and Valid Label Files ``` train_valid_groups_full = get_splits(image_dir='images', image_file='rp_images_index.json', exclude=['_clipped'], thresh = 7.15) # Create valid_x.csv files for each split for i in range(len(train_valid_groups_full)): generate_lists(train_valid_groups_full[i], train_file='train_{}.csv'.format(i), valid_file='valid_{}.csv'.format(i)) !ls images/*.csv train = ImageList.from_csv(path, 'train_0.csv') valid = ImageList.from_csv(path, 'valid_0.csv') lls = ItemLists(path, train, valid).label_from_df(cols=1).transform(tfms, size=size) #db = lls.databunch(bs=bs, num_workers=workers)#.normalize(binary_image_stats) db = lls.databunch(bs=bs, num_workers=workers) my_stats = db.batch_stats() db = lls.databunch(bs=bs, num_workers=workers).normalize(my_stats) db.batch_stats() ``` ### Examine Results ``` print('nClass: {} classes: {}'.format(db.c, db.classes)) db im = train.get(-1) print(len(train), im.size) im.show() ``` ## Model ``` trial_model = nn.Sequential( nn.Sequential( nn.Conv2d(3,8,5), # 60 × 60 × 8 nn.ReLU(), nn.AvgPool2d(3, stride=2), # 29 × 29 × 8 #nn.Dropout(p=0.25), nn.Conv2d(8,8,5), # 25 × 25 × 8 nn.ReLU(), nn.AvgPool2d(3, stride=2), # 12 × 12 × 8 Flatten() # 1152 ), # removed model head to compute flatten size ) trial_learn = Learner(db, trial_model, loss_func = nn.CrossEntropyLoss(), metrics=accuracy) trial_learn.summary() del trial_model trial_learn.destroy() gc.collect() mymodel = nn.Sequential( nn.Sequential( nn.Conv2d(3,8,5), # 60 × 60 × 8 nn.ReLU(), nn.AvgPool2d(3, stride=2), # 29 × 29 × 8 #nn.Dropout(p=0.25), nn.Conv2d(8,8,5), # 25 × 25 × 8 nn.ReLU(), nn.AvgPool2d(3, stride=2), # 12 × 12 × 8 Flatten() # 1152 ), nn.Sequential( # nn.Dropout(p=0.25), nn.Linear(1152, 144), nn.ReLU(), nn.Dropout(p=0.8), nn.Linear(144, db.c) ) ) learn = Learner(db, mymodel, loss_func = nn.CrossEntropyLoss(), metrics=accuracy) learn.summary() learn.save('initial') ``` # Train Model ``` learn.fit_one_cycle(1, 1e-6) # learn.fit_one_cycle(1, 0.01) # learn.save('save-1') learn.lr_find(end_lr=1) learn.recorder.plot() learn.load('initial') learn.fit_one_cycle(100, 3e-3) # learn.fit_one_cycle(1, 0.01) learn.load('initial') learn.fit_one_cycle(100, 1e-2) # learn.fit_one_cycle(1, 0.01) learn.load('initial') learn.fit_one_cycle(100, 1e-3) # learn.fit_one_cycle(1, 0.01) learn.load('initial') learn.fit_one_cycle(100, 1e-4) # learn.fit_one_cycle(1, 0.01) #train an additional 100 epochs learn.fit_one_cycle(100, 1e-4) # learn.fit_one_cycle(1, 0.01) gc.collect() ```
github_jupyter
# Music Generation with RNNs ``` # Import Tensorflow 2.0 %tensorflow_version 2.x import tensorflow as tf # Download and import the MIT 6.S191 package !pip install mitdeeplearning import mitdeeplearning as mdl # Import all remaining packages import numpy as np import os import time import functools from IPython import display as ipythondisplay from tqdm import tqdm !apt-get install abcmidi timidity > /dev/null 2>&1 # Check that we are using a GPU, if not switch runtimes # using Runtime > Change Runtime Type > GPU assert len(tf.config.list_physical_devices('GPU')) > 0 ``` # Load dataset ``` songs = mdl.lab1.load_training_data() example_song = songs[0] print("\nExample song: ") print(example_song) mdl.lab1.play_song(example_song) songs_joined = "\n\n".join(songs) # join song list into one string vocab = sorted(songs_joined) print("There are", len(vocab), "unique characters in the dataset") ``` # Process the dataset for learning Two maps are needed: from character to number; from number to character ``` char2idx = {u:i for i, u in enumerate(vocab)} #dict idx2char = np.array(vocab) # print(char2idx, idx2char) print('{') for char,_ in zip(char2idx, range(20)): print(' {:4s}: {:3d},'.format(repr(char), char2idx[char])) print(' ...\n}') # convert songs string to a single vector def vectorize_string(string): return np.array([char2idx[i] for i in string]) vectorized_songs = vectorize_string(songs_joined) print('{} --- characters mapped to int ----> {}'.format(repr(songs_joined[:10]), vectorized_songs[:10])) assert isinstance(vectorized_songs, np.ndarray), "returned result should be a numpy array" print(vectorized_songs.shape) ``` ## Create training examples and targets E.g. input -> "Hell", output -> "ello", original text -> "Hello" ``` def get_batch(vectorized_songs, seq_length, batch_size): n = vectorized_songs.shape[0] - 1 idx = np.random.choice(n-seq_length, batch_size) input_batch = np.array([vectorized_songs[i: i+seq_length] for i in idx]) output_batch = np.array([vectorized_songs[i+1: i+1+seq_length] for i in idx]) x_batch = np.reshape(input_batch, [batch_size, seq_length]) y_batch = np.reshape(output_batch, [batch_size, seq_length]) return x_batch, y_batch test_args = (vectorized_songs, 10, 2) if not mdl.lab1.test_batch_func_types(get_batch, test_args) or \ not mdl.lab1.test_batch_func_shapes(get_batch, test_args) or \ not mdl.lab1.test_batch_func_next_step(get_batch, test_args): print("======\n[FAIL] could not pass tests") else: print("======\n[PASS] passed all tests!") x_batch, y_batch = get_batch(vectorized_songs, seq_length=5, batch_size=1) for i, (input_idx, target_idx) in enumerate(zip(np.squeeze(x_batch), np.squeeze(y_batch))): print("Step {:3d}".format(i)) print(" input: {} ({:s})".format(input_idx, repr(idx2char[input_idx]))) print(" expected output: {} ({:s})".format(target_idx, repr(idx2char[target_idx]))) ``` ## RNN model ``` def LSTM(rnn_units): return tf.keras.layers.LSTM( rnn_units, return_sequences = True, recurrent_initializer = 'glorot_uniform', recurrent_activation = 'sigmoid', stateful = True ) def build_model(vocab_size, embedding_dim, rnn_units, batch_size): model = tf.keras.Sequential([ tf.keras.layers.Embedding(vocab_size, embedding_dim, batch_input_shape=[batch_size, None]), LSTM(rnn_units), tf.keras.layers.Dense(vocab_size) ]) return model model = build_model(len(vocab), embedding_dim=256, rnn_units=1024, batch_size=32) model.summary() x, y = get_batch(vectorized_songs, seq_length=100, batch_size=32) pred = model(x) print("Input shape: ", x.shape, " # (batch_size, sequence_length") print("Output shape: ", pred.shape, " # (batch_size, sequence_length, vocab_size)") sample_indices = tf.random.categorical(pred[0], num_samples=1) sample_indices = tf.squeeze(sample_indices, axis=-1).numpy() sample_indices print("Input: \n", repr("".join(idx2char[x[0]]))) print() print("Next Char Prediction: \n", repr("".join(idx2char[sample_indices]))) ## Define the loss def compute_loss(labels, logits): loss = tf.keras.losses.sparse_categorical_crossentropy(labels, logits, from_logits=True) return loss example_batch_loss = compute_loss(y, pred) print("Prediction shape: ", pred.shape, " # (batch_size, sequence_length, vocab_size)") print("Scalar_loss: ", example_batch_loss.numpy().mean()) ``` ## Hyperparameters ``` num_training_iterations = 200 batch_size = 4 # Experiment between 1 and 64 seq_length = 100 # Experiment between 50 and 500 learning_rate = 5e-3 # Experiment between 1e-5 and 1e-1 vocab_size = len(vocab) embedding_dim = 256 rnn_units = 1024 # Experiment between 1 and 2048 checkpoint_dir = './training_checkpoints' checkpoint_prefix = os.path.join(checkpoint_dir, "my_ckpt") model = build_model(vocab_size, embedding_dim, rnn_units, batch_size) optimizer = tf.keras.optimizers.Adam(learning_rate) # model.trainable_variables @tf.function def train_step(x, y): with tf.GradientTape() as tape: y_hat = model(x) loss = compute_loss(y, y_hat) grads = tape.gradient(loss, model.trainable_variables) optimizer.apply_gradients(zip(grads, model.trainable_variables)) return loss ################## # Begin training!# ################## history = [] plotter = mdl.util.PeriodicPlotter(sec=2, xlabel='Iterations', ylabel='Loss') if hasattr(tqdm, '_instances'): tqdm._instances.clear() for iter in tqdm(range(num_training_iterations)): x_batch, y_batch = get_batch(vectorized_songs, seq_length, batch_size) loss = train_step(x_batch, y_batch) history.append(loss.numpy().mean()) plotter.plot(history) if iter % 100 == 0: model.save_weights(checkpoint_prefix) model.save_weights(checkpoint_prefix) model = build_model(vocab_size, embedding_dim, rnn_units, batch_size=1) model.load_weights(tf.train.latest_checkpoint(checkpoint_dir)) model.build(tf.TensorShape([1, None])) model.summary() # prediction of a generated song def generate_text(model, start_string, generation_length=1000): input_eval = [char2idx[s] for s in start_string] input_eval = tf.expand_dims(input_eval, 0) text_generated = [] model.reset_states() tqdm._instances.clear() for i in tqdm(range(generation_length)): predictions = model(input_eval) predictions = tf.squeeze(predictions, 0) # remove batch dim predicted_id = tf.random.categorical(predictions, num_samples=1)[-1, 0].numpy() # Pass the prediction along with the previous hidden state # as the next inputs to the model input_eval = tf.expand_dims([predicted_id], 0) text_generated.append(idx2char[predicted_id]) return (start_string + ''.join(text_generated)) generated_text = generate_text(model, 'X', generation_length=1000) print(generated_text) generated_songs = mdl.lab1.extract_song_snippet(generated_text) for i, song in enumerate(generated_songs): # mdl.lab1.play_song(song) waveform = mdl.lab1.play_song(song) if waveform: print("Generated song", i) ipythondisplay.display(waveform) ```
github_jupyter
``` # Developer: Halmon Lui # Implement a Hash Table using Linear Probing from scratch class HashTable: def __init__(self, length=11): self.hash_list = [None for _ in range(length)] self.length = length self.item_count = 0 # hash key where m is size of table def _hash(self, k, m): return hash(k) % m # if key exists, update value def add(self, key, value): # If we are full return immediately if self.item_count==self.length: return 'Error: HashTable is full' hash_key = self._hash(key, self.length) # If there is something in the location make sure we aren't colliding if self.hash_list[hash_key]: # If the keys match update the value if self.hash_list[hash_key][0] == key: self.hash_list[hash_key] = (key, value) self.item_count += 1 # Handle collision case elif self.item_count < self.length: # Linear probe for a free spot for count, location in enumerate(self.hash_list): if not location: self.hash_list[count] = (key, value) self.item_count += 1 return # Slot is free to add the key, value pair else: self.hash_list[hash_key] = (key, value) self.item_count += 1 # check if key exists def exists(self, key): hash_key = self._hash(key, self.length) if self.hash_list[hash_key]: # Return true if matching key if self.hash_list[hash_key][0] == key: return True # Handle collision case else: # Linear probe for matching key for item in self.hash_list: if item and item[0]==key: return True return False # get value from key def get(self, key): hash_key = self._hash(key, self.length) if self.hash_list[hash_key]: # Return value if matching key if self.hash_list[hash_key][0] == key: return self.hash_list[hash_key][1] # Handle collision case else: for item in self.hash_list: if item and item[0]==key: return item[1] return 'Error: Invalid Key' # remove value at key def remove(self, key): hash_key = self._hash(key, self.length) if self.hash_list[hash_key]: # Delete if key matches if self.hash_list[hash_key][0] == key: self.hash_list[hash_key] = None self.item_count -= 1 # handle collision case else: for count, item in enumerate(self.hash_list): if item and item[0]==key: self.hash_list[count] = None return 'Error: Invalid Key' # Test HashTable methods # Initialize HashTable object ht = HashTable() print('Created HashTable: ', ht.hash_list) # Add to table, check if exists and get it print('Adding key1') ht.add('key1', 'hello') print('Check if key1 exists: ', ht.exists('key1')) print('Get value of key1: ', ht.get('key1')) print(ht.hash_list) # Remove key1 from table and get it print('Removing key1') ht.remove('key1') print('Check if key1 exists: ', ht.exists('key1')) print('Get value of key1: ', ht.get('key1')) print(ht.hash_list) print('###########################################') # Add to table, check if exists and get it ht = HashTable() print('Adding key1 and key2') ht.add('key1', 'hello') ht.add('key2', 'world') print('Check if key1 exists: ', ht.exists('key1')) print('Get value of key1: ', ht.get('key1')) print('Check if key2 exists: ', ht.exists('key2')) print('Get value of key2: ', ht.get('key2')) print(ht.hash_list) # Remove key1 from table and get it print('Removing key1') ht.remove('key1') print('Check if key1 exists: ', ht.exists('key1')) print('Get value of key1: ', ht.get('key1')) print('Check if key1 exists: ', ht.exists('key2')) print('Get value of key1: ', ht.get('key2')) print(ht.hash_list) print('###########################################') # Add to table, check if exists and get it ht = HashTable() print('Fill up the table and check for collisions') ht.add('key1', 'aaaa') ht.add('key2', 'bbbb') ht.add('key3', 'cccc') ht.add('key4', 'dddd') ht.add('key5', 'eeee') ht.add('key6', 'ffff') ht.add('key7', 'gggg') ht.add('key8', 'hhhh') ht.add('key9', 'iiii') ht.add('key10', 'jjjj') ht.add('key11', 'kkkk') print('Check if key1 exists: ', ht.exists('key1')) print('Get value of key1: ', ht.get('key1')) print('Check if key2 exists: ', ht.exists('key2')) print('Get value of key2: ', ht.get('key2')) print('Check if key3 exists: ', ht.exists('key3')) print('Get value of key3: ', ht.get('key3')) print('Check if key4 exists: ', ht.exists('key4')) print('Get value of key4: ', ht.get('key4')) print('Check if key5 exists: ', ht.exists('key5')) print('Get value of key5: ', ht.get('key5')) print('Check if key6 exists: ', ht.exists('key6')) print('Get value of key6: ', ht.get('key6')) print('Check if key7 exists: ', ht.exists('key7')) print('Get value of key7: ', ht.get('key7')) print('Check if key8 exists: ', ht.exists('key8')) print('Get value of key8: ', ht.get('key8')) print('Check if key9 exists: ', ht.exists('key9')) print('Get value of key9: ', ht.get('key9')) print('Check if key10 exists: ', ht.exists('key10')) print('Get value of key10: ', ht.get('key10')) print('Check if key11 exists: ', ht.exists('key11')) print('Get value of key11: ', ht.get('key11')) print(ht.hash_list) print('test removing key11') ht.remove('key11') print(ht.hash_list) # Test bad cases # Add to table, check if exists and get it ht = HashTable() ht.add('key1', 'aaaa') ht.add('key2', 'bbbb') ht.add('key3', 'cccc') ht.add('key4', 'dddd') ht.add('key5', 'eeee') ht.add('key6', 'ffff') ht.add('key7', 'gggg') ht.add('key8', 'hhhh') ht.add('key9', 'iiii') ht.add('key10', 'jjjj') ht.add('key11', 'kkkk') print('Try adding over table size: ', ht.add('key12', 'no bueno')) print('Try getting invalid key', ht.get('badkeyhere')) print('Try removing invalid key', ht.get('notpossible')) ```
github_jupyter
# Targeting Direct Marketing with Amazon SageMaker XGBoost _**Supervised Learning with Gradient Boosted Trees: A Binary Prediction Problem With Unbalanced Classes**_ ## Background Direct marketing, either through mail, email, phone, etc., is a common tactic to acquire customers. Because resources and a customer's attention is limited, the goal is to only target the subset of prospects who are likely to engage with a specific offer. Predicting those potential customers based on readily available information like demographics, past interactions, and environmental factors is a common machine learning problem. This notebook presents an example problem to predict if a customer will enroll for a term deposit at a bank, after one or more phone calls. The steps include: * Preparing your Amazon SageMaker notebook * Downloading data from the internet into Amazon SageMaker * Investigating and transforming the data so that it can be fed to Amazon SageMaker algorithms * Estimating a model using the Gradient Boosting algorithm * Evaluating the effectiveness of the model * Setting the model up to make on-going predictions --- ## Preparation _This notebook was created and tested on an ml.m4.xlarge notebook instance._ Let's start by specifying: - The S3 bucket and prefix that you want to use for training and model data. This should be within the same region as the Notebook Instance, training, and hosting. - The IAM role arn used to give training and hosting access to your data. See the documentation for how to create these. Note, if more than one role is required for notebook instances, training, and/or hosting, please replace the boto regexp with a the appropriate full IAM role arn string(s). ``` # Define IAM role import boto3 import sagemaker import re from sagemaker import get_execution_role region = boto3.Session().region_name session = sagemaker.Session() bucket = session.default_bucket() prefix = 'sagemaker/DEMO-xgboost-dm' role = get_execution_role() ``` Now let's bring in the Python libraries that we'll use throughout the analysis ``` import numpy as np # For matrix operations and numerical processing import pandas as pd # For munging tabular data import matplotlib.pyplot as plt # For charts and visualizations from IPython.display import Image # For displaying images in the notebook from IPython.display import display # For displaying outputs in the notebook from time import gmtime, strftime # For labeling SageMaker models, endpoints, etc. import sys # For writing outputs to notebook import math # For ceiling function import json # For parsing hosting outputs import os # For manipulating filepath names import sagemaker # Amazon SageMaker's Python SDK provides many helper functions from sagemaker.predictor import csv_serializer # Converts strings for HTTP POST requests on inference ! python -m pip install smdebug ``` --- ## Data Let's start by downloading the [direct marketing dataset](https://sagemaker-sample-data-us-west-2.s3-us-west-2.amazonaws.com/autopilot/direct_marketing/bank-additional.zip) from the sample data s3 bucket. \[Moro et al., 2014\] S. Moro, P. Cortez and P. Rita. A Data-Driven Approach to Predict the Success of Bank Telemarketing. Decision Support Systems, Elsevier, 62:22-31, June 2014 ``` !wget https://sagemaker-sample-data-us-west-2.s3-us-west-2.amazonaws.com/autopilot/direct_marketing/bank-additional.zip !conda install -y -c conda-forge unzip !unzip -o bank-additional.zip ``` Now lets read this into a Pandas data frame and take a look. ``` data = pd.read_csv('./bank-additional/bank-additional-full.csv') pd.set_option('display.max_rows',10) data ``` Let's talk about the data. At a high level, we can see: * We have a little over 40K customer records, and 20 features for each customer * The features are mixed; some numeric, some categorical * The data appears to be sorted, at least by `time` and `contact`, maybe more _**Specifics on each of the features:**_ *Demographics:* * `age`: Customer's age (numeric) * `job`: Type of job (categorical: 'admin.', 'services', ...) * `marital`: Marital status (categorical: 'married', 'single', ...) * `education`: Level of education (categorical: 'basic.4y', 'high.school', ...) *Past customer events:* * `default`: Has credit in default? (categorical: 'no', 'unknown', ...) * `housing`: Has housing loan? (categorical: 'no', 'yes', ...) * `loan`: Has personal loan? (categorical: 'no', 'yes', ...) *Past direct marketing contacts:* * `contact`: Contact communication type (categorical: 'cellular', 'telephone', ...) * `month`: Last contact month of year (categorical: 'may', 'nov', ...) * `day_of_week`: Last contact day of the week (categorical: 'mon', 'fri', ...) * `duration`: Last contact duration, in seconds (numeric). Important note: If duration = 0 then `y` = 'no'. *Campaign information:* * `campaign`: Number of contacts performed during this campaign and for this client (numeric, includes last contact) * `pdays`: Number of days that passed by after the client was last contacted from a previous campaign (numeric) * `previous`: Number of contacts performed before this campaign and for this client (numeric) * `poutcome`: Outcome of the previous marketing campaign (categorical: 'nonexistent','success', ...) *External environment factors:* * `emp.var.rate`: Employment variation rate - quarterly indicator (numeric) * `cons.price.idx`: Consumer price index - monthly indicator (numeric) * `cons.conf.idx`: Consumer confidence index - monthly indicator (numeric) * `euribor3m`: Euribor 3 month rate - daily indicator (numeric) * `nr.employed`: Number of employees - quarterly indicator (numeric) *Target variable:* * `y`: Has the client subscribed a term deposit? (binary: 'yes','no') ### Transformation Cleaning up data is part of nearly every machine learning project. It arguably presents the biggest risk if done incorrectly and is one of the more subjective aspects in the process. Several common techniques include: * Handling missing values: Some machine learning algorithms are capable of handling missing values, but most would rather not. Options include: * Removing observations with missing values: This works well if only a very small fraction of observations have incomplete information. * Removing features with missing values: This works well if there are a small number of features which have a large number of missing values. * Imputing missing values: Entire [books](https://www.amazon.com/Flexible-Imputation-Missing-Interdisciplinary-Statistics/dp/1439868247) have been written on this topic, but common choices are replacing the missing value with the mode or mean of that column's non-missing values. * Converting categorical to numeric: The most common method is one hot encoding, which for each feature maps every distinct value of that column to its own feature which takes a value of 1 when the categorical feature is equal to that value, and 0 otherwise. * Oddly distributed data: Although for non-linear models like Gradient Boosted Trees, this has very limited implications, parametric models like regression can produce wildly inaccurate estimates when fed highly skewed data. In some cases, simply taking the natural log of the features is sufficient to produce more normally distributed data. In others, bucketing values into discrete ranges is helpful. These buckets can then be treated as categorical variables and included in the model when one hot encoded. * Handling more complicated data types: Mainpulating images, text, or data at varying grains is left for other notebook templates. Luckily, some of these aspects have already been handled for us, and the algorithm we are showcasing tends to do well at handling sparse or oddly distributed data. Therefore, let's keep pre-processing simple. ``` data['no_previous_contact'] = np.where(data['pdays'] == 999, 1, 0) # Indicator variable to capture when pdays takes a value of 999 data['not_working'] = np.where(np.in1d(data['job'], ['student', 'retired', 'unemployed']), 1, 0) # Indicator for individuals not actively employed model_data = pd.get_dummies(data) # Convert categorical variables to sets of indicators ``` Another question to ask yourself before building a model is whether certain features will add value in your final use case. For example, if your goal is to deliver the best prediction, then will you have access to that data at the moment of prediction? Knowing it's raining is highly predictive for umbrella sales, but forecasting weather far enough out to plan inventory on umbrellas is probably just as difficult as forecasting umbrella sales without knowledge of the weather. So, including this in your model may give you a false sense of precision. Following this logic, let's remove the economic features and `duration` from our data as they would need to be forecasted with high precision to use as inputs in future predictions. Even if we were to use values of the economic indicators from the previous quarter, this value is likely not as relevant for prospects contacted early in the next quarter as those contacted later on. ``` model_data = model_data.drop(['duration', 'emp.var.rate', 'cons.price.idx', 'cons.conf.idx', 'euribor3m', 'nr.employed'], axis=1) ``` When building a model whose primary goal is to predict a target value on new data, it is important to understand overfitting. Supervised learning models are designed to minimize error between their predictions of the target value and actuals, in the data they are given. This last part is key, as frequently in their quest for greater accuracy, machine learning models bias themselves toward picking up on minor idiosyncrasies within the data they are shown. These idiosyncrasies then don't repeat themselves in subsequent data, meaning those predictions can actually be made less accurate, at the expense of more accurate predictions in the training phase. The most common way of preventing this is to build models with the concept that a model shouldn't only be judged on its fit to the data it was trained on, but also on "new" data. There are several different ways of operationalizing this, holdout validation, cross-validation, leave-one-out validation, etc. For our purposes, we'll simply randomly split the data into 3 uneven groups. The model will be trained on 70% of data, it will then be evaluated on 20% of data to give us an estimate of the accuracy we hope to have on "new" data, and 10% will be held back as a final testing dataset which will be used later on. ``` train_data, validation_data, test_data = np.split(model_data.sample(frac=1, random_state=1729), [int(0.7 * len(model_data)), int(0.9 * len(model_data))]) # Randomly sort the data then split out first 70%, second 20%, and last 10% ``` Amazon SageMaker's XGBoost container expects data in the libSVM or CSV data format. For this example, we'll stick to CSV. Note that the first column must be the target variable and the CSV should not include headers. Also, notice that although repetitive it's easiest to do this after the train|validation|test split rather than before. This avoids any misalignment issues due to random reordering. ``` pd.concat([train_data['y_yes'], train_data.drop(['y_no', 'y_yes'], axis=1)], axis=1).to_csv('train.csv', index=False, header=False) pd.concat([validation_data['y_yes'], validation_data.drop(['y_no', 'y_yes'], axis=1)], axis=1).to_csv('validation.csv', index=False, header=False) ``` Now we'll copy the file to S3 for Amazon SageMaker's managed training to pickup. ``` boto3.Session().resource('s3').Bucket(bucket).Object(os.path.join(prefix, 'train/train.csv')).upload_file('train.csv') boto3.Session().resource('s3').Bucket(bucket).Object(os.path.join(prefix, 'validation/validation.csv')).upload_file('validation.csv') ``` --- ## Training Now we know that most of our features have skewed distributions, some are highly correlated with one another, and some appear to have non-linear relationships with our target variable. Also, for targeting future prospects, good predictive accuracy is preferred to being able to explain why that prospect was targeted. Taken together, these aspects make gradient boosted trees a good candidate algorithm. There are several intricacies to understanding the algorithm, but at a high level, gradient boosted trees works by combining predictions from many simple models, each of which tries to address the weaknesses of the previous models. By doing this the collection of simple models can actually outperform large, complex models. Other Amazon SageMaker notebooks elaborate on gradient boosting trees further and how they differ from similar algorithms. `xgboost` is an extremely popular, open-source package for gradient boosted trees. It is computationally powerful, fully featured, and has been successfully used in many machine learning competitions. Let's start with a simple `xgboost` model, trained using Amazon SageMaker's managed, distributed training framework. First we'll need to specify the ECR container location for Amazon SageMaker's implementation of XGBoost. ``` from sagemaker.amazon.amazon_estimator import get_image_uri container = sagemaker.image_uris.retrieve(region=boto3.Session().region_name, framework='xgboost', version='1.0-1') ``` Then, because we're training with the CSV file format, we'll create `s3_input`s that our training function can use as a pointer to the files in S3, which also specify that the content type is CSV. ``` s3_input_train = sagemaker.TrainingInput(s3_data='s3://{}/{}/train'.format(bucket, prefix), content_type='csv') s3_input_validation = sagemaker.TrainingInput(s3_data='s3://{}/{}/validation/'.format(bucket, prefix), content_type='csv') base_job_name = "demo-smdebug-xgboost-regression" bucket_path='s3://{}/{}/output'.format(bucket, prefix) ``` ### Enabling Debugger in Estimator object #### DebuggerHookConfig Enabling Amazon SageMaker Debugger in training job can be accomplished by adding its configuration into Estimator object constructor: ```python from sagemaker.debugger import DebuggerHookConfig, CollectionConfig estimator = Estimator( ..., debugger_hook_config = DebuggerHookConfig( s3_output_path="s3://{bucket_name}/{location_in_bucket}", # Required collection_configs=[ CollectionConfig( name="metrics", parameters={ "save_interval": "10" } ) ] ) ) ``` Here, the `DebuggerHookConfig` object instructs `Estimator` what data we are interested in. Two parameters are provided in the example: - `s3_output_path`: it points to S3 bucket/path where we intend to store our debugging tensors. Amount of data saved depends on multiple factors, major ones are: training job / data set / model / frequency of saving tensors. This bucket should be in your AWS account, and you should have full access control over it. **Important Note**: this s3 bucket should be originally created in the same region where your training job will be running, otherwise you might run into problems with cross region access. - `collection_configs`: it enumerates named collections of tensors we want to save. Collections are a convinient way to organize relevant tensors under same umbrella to make it easy to navigate them during analysis. In this particular example, you are instructing Amazon SageMaker Debugger that you are interested in a single collection named `metrics`. We also instructed Amazon SageMaker Debugger to save metrics every 10 iteration. See [Collection](https://github.com/awslabs/sagemaker-debugger/blob/master/docs/api.md#collection) documentation for all parameters that are supported by Collections and DebuggerConfig documentation for more details about all parameters DebuggerConfig supports. #### Rules Enabling Rules in training job can be accomplished by adding the `rules` configuration into Estimator object constructor. - `rules`: This new parameter will accept a list of rules you wish to evaluate against the tensors output by this training job. For rules, Amazon SageMaker Debugger supports two types: - SageMaker Rules: These are rules specially curated by the data science and engineering teams in Amazon SageMaker which you can opt to evaluate against your training job. - Custom Rules: You can optionally choose to write your own rule as a Python source file and have it evaluated against your training job. To provide Amazon SageMaker Debugger to evaluate this rule, you would have to provide the S3 location of the rule source and the evaluator image. In this example, you will use a Amazon SageMaker's LossNotDecreasing rule, which helps you identify if you are running into a situation where the training loss is not going down. ```python from sagemaker.debugger import rule_configs, Rule estimator = Estimator( ..., rules=[ Rule.sagemaker( rule_configs.loss_not_decreasing(), rule_parameters={ "collection_names": "metrics", "num_steps": "10", }, ), ], ) ``` - `rule_parameters`: In this parameter, you provide the runtime values of the parameter in your constructor. You can still choose to pass in other values which may be necessary for your rule to be evaluated. In this example, you will use Amazon SageMaker's LossNotDecreasing rule to monitor the `metircs` collection. The rule will alert you if the tensors in `metrics` has not decreased for more than 10 steps. First we'll need to specify training parameters to the estimator. This includes: 1. The `xgboost` algorithm container 1. The IAM role to use 1. Training instance type and count 1. S3 location for output data 1. Algorithm hyperparameters And then a `.fit()` function which specifies: 1. S3 location for output data. In this case we have both a training and validation set which are passed in. ``` from sagemaker.debugger import rule_configs, Rule, DebuggerHookConfig, CollectionConfig from sagemaker.estimator import Estimator sess = sagemaker.Session() save_interval = 5 xgboost_estimator = Estimator( role=role, base_job_name=base_job_name, instance_count=1, instance_type='ml.m5.4xlarge', image_uri=container, max_run=1800, sagemaker_session=sess, debugger_hook_config=DebuggerHookConfig( s3_output_path=bucket_path, # Required collection_configs=[ CollectionConfig( name="metrics", parameters={ "save_interval": str(save_interval) } ), CollectionConfig( name="predictions", parameters={ "save_interval": str(save_interval) } ), CollectionConfig( name="feature_importance", parameters={ "save_interval": str(save_interval) } ), CollectionConfig( name="average_shap", parameters={ "save_interval": str(save_interval) } ) ], ) ) xgboost_estimator.set_hyperparameters(max_depth=5, eta=0.2, gamma=4, min_child_weight=6, subsample=0.8, silent=0, objective='binary:logistic', num_round=100) xgboost_estimator.fit( {"train": s3_input_train, "validation": s3_input_validation}, # This is a fire and forget event. By setting wait=False, you submit the job to run in the background. # Amazon SageMaker starts one training job and release control to next cells in the notebook. # Follow this notebook to see status of the training job. wait=False ) ``` ### Result As a result of the above command, Amazon SageMaker starts one training job and one rule job for you. The first one is the job that produces the tensors to be analyzed. The second one analyzes the tensors to check if `train-rmse` and `validation-rmse` are not decreasing at any point during training. Check the status of the training job below. After your training job is started, Amazon SageMaker starts a rule-execution job to run the LossNotDecreasing rule. **Note that the next cell blocks until the rule execution job ends. You can stop it at any point to proceed to the rest of the notebook. Once it says Rule Evaluation Status is Started, and shows the `RuleEvaluationJobArn`, you can look at the status of the rule being monitored.** ``` import time from time import gmtime, strftime # Below command will give the status of training job job_name = xgboost_estimator.latest_training_job.name client = xgboost_estimator.sagemaker_session.sagemaker_client description = client.describe_training_job(TrainingJobName=job_name) print('Training job name: ' + job_name) print(description['TrainingJobStatus']) if description['TrainingJobStatus'] != 'Completed': while description['SecondaryStatus'] not in ['Training', 'Completed']: description = client.describe_training_job(TrainingJobName=job_name) primary_status = description['TrainingJobStatus'] secondary_status = description['SecondaryStatus'] print("{}: {}, {}".format(strftime('%X', gmtime()), primary_status, secondary_status)) time.sleep(15) ``` ## Data Analysis - Manual Now that you've trained the system, analyze the data. Here, you focus on after-the-fact analysis. You import a basic analysis library, which defines the concept of trial, which represents a single training run. ``` from smdebug.trials import create_trial description = client.describe_training_job(TrainingJobName=job_name) s3_output_path = xgboost_estimator.latest_job_debugger_artifacts_path() # This is where we create a Trial object that allows access to saved tensors. trial = create_trial(s3_output_path) ``` You can list all the tensors that you know something about. Each one of these names is the name of a tensor. The name is a combination of the feature name, which in these cases, is auto-assigned by XGBoost, and whether it's an evaluation metric, feature importance, or SHAP value. ``` trial.tensor_names() ``` For each tensor, ask for the steps where you have data. In this case, every five steps ``` trial.tensor("predictions").values() ``` You can obtain each tensor at each step as a NumPy array. ``` type(trial.tensor("predictions").value(10)) ``` ### Performance metrics You can also create a simple function that visualizes the training and validation errors as the training progresses. Each gradient should get smaller over time, as the system converges to a good solution. Remember that this is an interactive analysis. You are showing these tensors to give an idea of the data. ``` import matplotlib.pyplot as plt import seaborn as sns import re def get_data(trial, tname): """ For the given tensor name, walks though all the iterations for which you have data and fetches the values. Returns the set of steps and the values. """ tensor = trial.tensor(tname) steps = tensor.steps() vals = [tensor.value(s) for s in steps] return steps, vals def plot_collection(trial, collection_name, regex='.*', figsize=(8, 6)): """ Takes a `trial` and a collection name, and plots all tensors that match the given regex. """ fig, ax = plt.subplots(figsize=figsize) sns.despine() tensors = trial.collection(collection_name).tensor_names for tensor_name in sorted(tensors): if re.match(regex, tensor_name): steps, data = get_data(trial, tensor_name) ax.plot(steps, data, label=tensor_name) ax.legend(loc='center left', bbox_to_anchor=(1, 0.5)) ax.set_xlabel('Iteration') plot_collection(trial, "metrics") ``` ### Feature importances You can also visualize the feature priorities as determined by [xgboost.get_score()](https://xgboost.readthedocs.io/en/latest/python/python_api.html#xgboost.Booster.get_score). If you instructed Estimator to log the `feature_importance` collection, all five importance types supported by `xgboost.get_score()` will be available in the collection. ``` def plot_feature_importance(trial, importance_type="weight"): SUPPORTED_IMPORTANCE_TYPES = ["weight", "gain", "cover", "total_gain", "total_cover"] if importance_type not in SUPPORTED_IMPORTANCE_TYPES: raise ValueError(f"{importance_type} is not one of the supported importance types.") plot_collection( trial, "feature_importance", regex=f"feature_importance/{importance_type}/.*") plot_feature_importance(trial) plot_feature_importance(trial, importance_type="cover") ``` ### SHAP [SHAP](https://github.com/slundberg/shap) (SHapley Additive exPlanations) is another approach to explain the output of machine learning models. SHAP values represent a feature's contribution to a change in the model output. You instructed Estimator to log the average SHAP values in this example so the SHAP values (as calculated by [xgboost.predict(pred_contribs=True)](https://xgboost.readthedocs.io/en/latest/python/python_api.html#xgboost.Booster.predict)) will be available the `average_shap` collection. ``` plot_collection(trial,"average_shap") ```
github_jupyter
## Dependencies ``` import os import cv2 import shutil import random import warnings import numpy as np import pandas as pd import seaborn as sns import matplotlib.pyplot as plt from tensorflow import set_random_seed from sklearn.utils import class_weight from sklearn.model_selection import train_test_split from sklearn.metrics import confusion_matrix, cohen_kappa_score from keras import backend as K from keras.models import Model from keras.utils import to_categorical from keras import optimizers, applications from keras.preprocessing.image import ImageDataGenerator from keras.callbacks import EarlyStopping, ReduceLROnPlateau, Callback, LearningRateScheduler from keras.layers import Dense, Dropout, GlobalAveragePooling2D, Input # Set seeds to make the experiment more reproducible. def seed_everything(seed=0): random.seed(seed) os.environ['PYTHONHASHSEED'] = str(seed) np.random.seed(seed) set_random_seed(0) seed = 0 seed_everything(seed) %matplotlib inline sns.set(style="whitegrid") warnings.filterwarnings("ignore") ``` ## Load data ``` hold_out_set = pd.read_csv('../input/aptos-data-split/hold-out.csv') X_train = hold_out_set[hold_out_set['set'] == 'train'] X_val = hold_out_set[hold_out_set['set'] == 'validation'] test = pd.read_csv('../input/aptos2019-blindness-detection/test.csv') print('Number of train samples: ', X_train.shape[0]) print('Number of validation samples: ', X_val.shape[0]) print('Number of test samples: ', test.shape[0]) # Preprocecss data X_train["id_code"] = X_train["id_code"].apply(lambda x: x + ".png") X_val["id_code"] = X_val["id_code"].apply(lambda x: x + ".png") test["id_code"] = test["id_code"].apply(lambda x: x + ".png") X_train['diagnosis'] = X_train['diagnosis'].astype('str') X_val['diagnosis'] = X_val['diagnosis'].astype('str') display(X_train.head()) ``` # Model parameters ``` # Model parameters N_CLASSES = X_train['diagnosis'].nunique() BATCH_SIZE = 16 EPOCHS = 40 WARMUP_EPOCHS = 5 LEARNING_RATE = 1e-4 WARMUP_LEARNING_RATE = 1e-3 HEIGHT = 320 WIDTH = 320 CHANNELS = 3 ES_PATIENCE = 5 RLROP_PATIENCE = 3 DECAY_DROP = 0.5 def kappa(y_true, y_pred, n_classes=5): y_trues = K.cast(K.argmax(y_true), K.floatx()) y_preds = K.cast(K.argmax(y_pred), K.floatx()) n_samples = K.cast(K.shape(y_true)[0], K.floatx()) distance = K.sum(K.abs(y_trues - y_preds)) max_distance = n_classes - 1 kappa_score = 1 - ((distance**2) / (n_samples * (max_distance**2))) return kappa_score def step_decay(epoch): lrate = 30e-5 if epoch > 3: lrate = 15e-5 if epoch > 7: lrate = 7.5e-5 if epoch > 11: lrate = 3e-5 if epoch > 15: lrate = 1e-5 return lrate def focal_loss(y_true, y_pred): gamma = 2.0 epsilon = K.epsilon() pt = y_pred * y_true + (1-y_pred) * (1-y_true) pt = K.clip(pt, epsilon, 1-epsilon) CE = -K.log(pt) FL = K.pow(1-pt, gamma) * CE loss = K.sum(FL, axis=1) return loss ``` # Pre-procecess images ``` train_base_path = '../input/aptos2019-blindness-detection/train_images/' test_base_path = '../input/aptos2019-blindness-detection/test_images/' train_dest_path = 'base_dir/train_images/' validation_dest_path = 'base_dir/validation_images/' test_dest_path = 'base_dir/test_images/' # Making sure directories don't exist if os.path.exists(train_dest_path): shutil.rmtree(train_dest_path) if os.path.exists(validation_dest_path): shutil.rmtree(validation_dest_path) if os.path.exists(test_dest_path): shutil.rmtree(test_dest_path) # Creating train, validation and test directories os.makedirs(train_dest_path) os.makedirs(validation_dest_path) os.makedirs(test_dest_path) def crop_image(img, tol=7): if img.ndim ==2: mask = img>tol return img[np.ix_(mask.any(1),mask.any(0))] elif img.ndim==3: gray_img = cv2.cvtColor(img, cv2.COLOR_RGB2GRAY) mask = gray_img>tol check_shape = img[:,:,0][np.ix_(mask.any(1),mask.any(0))].shape[0] if (check_shape == 0): # image is too dark so that we crop out everything, return img # return original image else: img1=img[:,:,0][np.ix_(mask.any(1),mask.any(0))] img2=img[:,:,1][np.ix_(mask.any(1),mask.any(0))] img3=img[:,:,2][np.ix_(mask.any(1),mask.any(0))] img = np.stack([img1,img2,img3],axis=-1) return img def circle_crop(img): img = crop_image(img) height, width, depth = img.shape largest_side = np.max((height, width)) img = cv2.resize(img, (largest_side, largest_side)) height, width, depth = img.shape x = width//2 y = height//2 r = np.amin((x, y)) circle_img = np.zeros((height, width), np.uint8) cv2.circle(circle_img, (x, y), int(r), 1, thickness=-1) img = cv2.bitwise_and(img, img, mask=circle_img) img = crop_image(img) return img def preprocess_image(base_path, save_path, image_id, HEIGHT, WIDTH, sigmaX=10): image = cv2.imread(base_path + image_id) image = cv2.cvtColor(image, cv2.COLOR_BGR2RGB) image = circle_crop(image) image = cv2.resize(image, (HEIGHT, WIDTH)) image = cv2.addWeighted(image, 4, cv2.GaussianBlur(image, (0,0), sigmaX), -4 , 128) cv2.imwrite(save_path + image_id, image) # Pre-procecss train set for i, image_id in enumerate(X_train['id_code']): preprocess_image(train_base_path, train_dest_path, image_id, HEIGHT, WIDTH) # Pre-procecss validation set for i, image_id in enumerate(X_val['id_code']): preprocess_image(train_base_path, validation_dest_path, image_id, HEIGHT, WIDTH) # Pre-procecss test set for i, image_id in enumerate(test['id_code']): preprocess_image(test_base_path, test_dest_path, image_id, HEIGHT, WIDTH) ``` # Data generator ``` datagen=ImageDataGenerator(rescale=1./255, rotation_range=360, horizontal_flip=True, vertical_flip=True) train_generator=datagen.flow_from_dataframe( dataframe=X_train, directory=train_dest_path, x_col="id_code", y_col="diagnosis", class_mode="categorical", batch_size=BATCH_SIZE, target_size=(HEIGHT, WIDTH), seed=seed) valid_generator=datagen.flow_from_dataframe( dataframe=X_val, directory=validation_dest_path, x_col="id_code", y_col="diagnosis", class_mode="categorical", batch_size=BATCH_SIZE, target_size=(HEIGHT, WIDTH), seed=seed) test_generator=datagen.flow_from_dataframe( dataframe=test, directory=test_dest_path, x_col="id_code", batch_size=1, class_mode=None, shuffle=False, target_size=(HEIGHT, WIDTH), seed=seed) ``` # Model ``` def create_model(input_shape, n_out): input_tensor = Input(shape=input_shape) base_model = applications.DenseNet169(weights=None, include_top=False, input_tensor=input_tensor) base_model.load_weights('../input/keras-notop/densenet169_weights_tf_dim_ordering_tf_kernels_notop.h5') x = GlobalAveragePooling2D()(base_model.output) x = Dropout(0.5)(x) x = Dense(2048, activation='relu')(x) x = Dropout(0.5)(x) final_output = Dense(n_out, activation='softmax', name='final_output')(x) model = Model(input_tensor, final_output) return model ``` # Train top layers ``` model = create_model(input_shape=(HEIGHT, WIDTH, CHANNELS), n_out=N_CLASSES) for layer in model.layers: layer.trainable = False for i in range(-5, 0): model.layers[i].trainable = True class_weights = class_weight.compute_class_weight('balanced', np.unique(X_train['diagnosis'].astype('int').values), X_train['diagnosis'].astype('int').values) metric_list = ["accuracy", kappa] optimizer = optimizers.Adam(lr=WARMUP_LEARNING_RATE) model.compile(optimizer=optimizer, loss='categorical_crossentropy', metrics=metric_list) model.summary() STEP_SIZE_TRAIN = train_generator.n//train_generator.batch_size STEP_SIZE_VALID = valid_generator.n//valid_generator.batch_size history_warmup = model.fit_generator(generator=train_generator, steps_per_epoch=STEP_SIZE_TRAIN, validation_data=valid_generator, validation_steps=STEP_SIZE_VALID, epochs=WARMUP_EPOCHS, class_weight=class_weights, verbose=1).history ``` # Fine-tune the complete model (1st step) ``` for layer in model.layers: layer.trainable = True # lrstep = LearningRateScheduler(step_decay) es = EarlyStopping(monitor='val_loss', mode='min', patience=ES_PATIENCE, restore_best_weights=True, verbose=1) rlrop = ReduceLROnPlateau(monitor='val_loss', mode='min', patience=RLROP_PATIENCE, factor=DECAY_DROP, min_lr=1e-6, verbose=1) callback_list = [es, rlrop] optimizer = optimizers.Adam(lr=LEARNING_RATE) model.compile(optimizer=optimizer, loss='categorical_crossentropy', metrics=metric_list) model.summary() history_finetunning = model.fit_generator(generator=train_generator, steps_per_epoch=STEP_SIZE_TRAIN, validation_data=valid_generator, validation_steps=STEP_SIZE_VALID, epochs=int(EPOCHS*0.8), callbacks=callback_list, class_weight=class_weights, verbose=1).history ``` # Fine-tune the complete model (2nd step) ``` optimizer = optimizers.SGD(lr=LEARNING_RATE, momentum=0.9, nesterov=True) model.compile(optimizer=optimizer, loss='categorical_crossentropy', metrics=metric_list) history_finetunning_2 = model.fit_generator(generator=train_generator, steps_per_epoch=STEP_SIZE_TRAIN, validation_data=valid_generator, validation_steps=STEP_SIZE_VALID, epochs=int(EPOCHS*0.2), callbacks=callback_list, class_weight=class_weights, verbose=1).history ``` # Model loss graph ``` history = {'loss': history_finetunning['loss'] + history_finetunning_2['loss'], 'val_loss': history_finetunning['val_loss'] + history_finetunning_2['val_loss'], 'acc': history_finetunning['acc'] + history_finetunning_2['acc'], 'val_acc': history_finetunning['val_acc'] + history_finetunning_2['val_acc'], 'kappa': history_finetunning['kappa'] + history_finetunning_2['kappa'], 'val_kappa': history_finetunning['val_kappa'] + history_finetunning_2['val_kappa']} sns.set_style("whitegrid") fig, (ax1, ax2, ax3) = plt.subplots(3, 1, sharex='col', figsize=(20, 18)) ax1.plot(history['loss'], label='Train loss') ax1.plot(history['val_loss'], label='Validation loss') ax1.legend(loc='best') ax1.set_title('Loss') ax2.plot(history['acc'], label='Train accuracy') ax2.plot(history['val_acc'], label='Validation accuracy') ax2.legend(loc='best') ax2.set_title('Accuracy') ax3.plot(history['kappa'], label='Train kappa') ax3.plot(history['val_kappa'], label='Validation kappa') ax3.legend(loc='best') ax3.set_title('Kappa') plt.xlabel('Epochs') sns.despine() plt.show() # Create empty arays to keep the predictions and labels lastFullTrainPred = np.empty((0, N_CLASSES)) lastFullTrainLabels = np.empty((0, N_CLASSES)) lastFullValPred = np.empty((0, N_CLASSES)) lastFullValLabels = np.empty((0, N_CLASSES)) # Add train predictions and labels for i in range(STEP_SIZE_TRAIN+1): im, lbl = next(train_generator) scores = model.predict(im, batch_size=train_generator.batch_size) lastFullTrainPred = np.append(lastFullTrainPred, scores, axis=0) lastFullTrainLabels = np.append(lastFullTrainLabels, lbl, axis=0) # Add validation predictions and labels for i in range(STEP_SIZE_VALID+1): im, lbl = next(valid_generator) scores = model.predict(im, batch_size=valid_generator.batch_size) lastFullValPred = np.append(lastFullValPred, scores, axis=0) lastFullValLabels = np.append(lastFullValLabels, lbl, axis=0) lastFullComPred = np.concatenate((lastFullTrainPred, lastFullValPred)) lastFullComLabels = np.concatenate((lastFullTrainLabels, lastFullValLabels)) train_preds = [np.argmax(pred) for pred in lastFullTrainPred] train_labels = [np.argmax(label) for label in lastFullTrainLabels] validation_preds = [np.argmax(pred) for pred in lastFullValPred] validation_labels = [np.argmax(label) for label in lastFullValLabels] complete_labels = [np.argmax(label) for label in lastFullComLabels] ``` # Threshold optimization ``` def find_best_fixed_threshold(preds, targs, do_plot=True): best_thr_list = [0 for i in range(preds.shape[1])] for index in range(1, preds.shape[1]): score = [] thrs = np.arange(0, 1, 0.01) for thr in thrs: preds_thr = [index if x[index] > thr else np.argmax(x) for x in preds] score.append(cohen_kappa_score(targs, preds_thr)) score = np.array(score) pm = score.argmax() best_thr, best_score = thrs[pm], score[pm].item() best_thr_list[index] = best_thr print('Label %s: thr=%.3f, Kappa=%.3f' % (index, best_thr, best_score)) if do_plot: plt.plot(thrs, score) plt.vlines(x=best_thr, ymin=score.min(), ymax=score.max()) plt.text(best_thr+0.03, best_score-0.01, ('Kappa[%s]=%.3f' % (index, best_score)), fontsize=14); plt.show() return best_thr_list threshold_list = find_best_fixed_threshold(lastFullComPred, complete_labels, do_plot=True) threshold_list[0] = 0 # In last instance assign label 0 # Apply optimized thresholds to the train predictions train_preds_opt = [0 for i in range(lastFullTrainPred.shape[0])] for idx, thr in enumerate(threshold_list): for idx2, pred in enumerate(lastFullTrainPred): if pred[idx] > thr: train_preds_opt[idx2] = idx # Apply optimized thresholds to the validation predictions validation_preds_opt = [0 for i in range(lastFullValPred.shape[0])] for idx, thr in enumerate(threshold_list): for idx2, pred in enumerate(lastFullValPred): if pred[idx] > thr: validation_preds_opt[idx2] = idx index_order = [0, 2, 1, 4, 3] # Apply optimized thresholds to the train predictions by class distribution train_preds_opt2 = [0 for i in range(lastFullTrainPred.shape[0])] for idx in index_order: thr = threshold_list[idx] for idx2, pred in enumerate(lastFullTrainPred): if pred[idx] > thr: train_preds_opt2[idx2] = idx # Apply optimized thresholds to the validation predictions by class distribution validation_preds_opt2 = [0 for i in range(lastFullValPred.shape[0])] for idx in index_order: thr = threshold_list[idx] for idx2, pred in enumerate(lastFullValPred): if pred[idx] > thr: validation_preds_opt2[idx2] = idx ``` # Model Evaluation ## Confusion Matrix ### Original thresholds ``` labels = ['0 - No DR', '1 - Mild', '2 - Moderate', '3 - Severe', '4 - Proliferative DR'] def plot_confusion_matrix(train, validation, labels=labels): train_labels, train_preds = train validation_labels, validation_preds = validation fig, (ax1, ax2) = plt.subplots(1, 2, sharex='col', figsize=(24, 7)) train_cnf_matrix = confusion_matrix(train_labels, train_preds) validation_cnf_matrix = confusion_matrix(validation_labels, validation_preds) train_cnf_matrix_norm = train_cnf_matrix.astype('float') / train_cnf_matrix.sum(axis=1)[:, np.newaxis] validation_cnf_matrix_norm = validation_cnf_matrix.astype('float') / validation_cnf_matrix.sum(axis=1)[:, np.newaxis] train_df_cm = pd.DataFrame(train_cnf_matrix_norm, index=labels, columns=labels) validation_df_cm = pd.DataFrame(validation_cnf_matrix_norm, index=labels, columns=labels) sns.heatmap(train_df_cm, annot=True, fmt='.2f', cmap="Blues",ax=ax1).set_title('Train') sns.heatmap(validation_df_cm, annot=True, fmt='.2f', cmap=sns.cubehelix_palette(8),ax=ax2).set_title('Validation') plt.show() plot_confusion_matrix((train_labels, train_preds), (validation_labels, validation_preds)) ``` ### Optimized thresholds ``` plot_confusion_matrix((train_labels, train_preds_opt), (validation_labels, validation_preds_opt)) ``` ### Optimized thresholds by class ``` plot_confusion_matrix((train_labels, train_preds_opt2), (validation_labels, validation_preds_opt2)) ``` ## Quadratic Weighted Kappa ``` def evaluate_model(train, validation): train_labels, train_preds = train validation_labels, validation_preds = validation print("Train Cohen Kappa score: %.3f" % cohen_kappa_score(train_preds, train_labels, weights='quadratic')) print("Validation Cohen Kappa score: %.3f" % cohen_kappa_score(validation_preds, validation_labels, weights='quadratic')) print("Complete set Cohen Kappa score: %.3f" % cohen_kappa_score(train_preds+validation_preds, train_labels+validation_labels, weights='quadratic')) print(" Original thresholds") evaluate_model((train_preds, train_labels), (validation_preds, validation_labels)) print(" Optimized thresholds") evaluate_model((train_preds_opt, train_labels), (validation_preds_opt, validation_labels)) print(" Optimized thresholds by class") evaluate_model((train_preds_opt2, train_labels), (validation_preds_opt2, validation_labels)) ``` ## Apply model to test set and output predictions ``` def apply_tta(model, generator, steps=10): step_size = generator.n//generator.batch_size preds_tta = [] for i in range(steps): generator.reset() preds = model.predict_generator(generator, steps=step_size) preds_tta.append(preds) return np.mean(preds_tta, axis=0) preds = apply_tta(model, test_generator) predictions = np.argmax(preds, axis=1) predictions_opt = [0 for i in range(preds.shape[0])] for idx, thr in enumerate(threshold_list): for idx2, pred in enumerate(preds): if pred[idx] > thr: predictions_opt[idx2] = idx predictions_opt2 = [0 for i in range(preds.shape[0])] for idx in index_order: thr = threshold_list[idx] for idx2, pred in enumerate(preds): if pred[idx] > thr: predictions_opt2[idx2] = idx results = pd.DataFrame({'id_code':test['id_code'], 'diagnosis':predictions}) results['id_code'] = results['id_code'].map(lambda x: str(x)[:-4]) results_opt = pd.DataFrame({'id_code':test['id_code'], 'diagnosis':predictions_opt}) results_opt['id_code'] = results_opt['id_code'].map(lambda x: str(x)[:-4]) results_opt2 = pd.DataFrame({'id_code':test['id_code'], 'diagnosis':predictions_opt2}) results_opt2['id_code'] = results_opt2['id_code'].map(lambda x: str(x)[:-4]) # Cleaning created directories if os.path.exists(train_dest_path): shutil.rmtree(train_dest_path) if os.path.exists(validation_dest_path): shutil.rmtree(validation_dest_path) if os.path.exists(test_dest_path): shutil.rmtree(test_dest_path) ``` # Predictions class distribution ``` fig, (ax1, ax2, ax3) = plt.subplots(1, 3, sharex='col', figsize=(24, 8.7)) sns.countplot(x="diagnosis", data=results, palette="GnBu_d", ax=ax1).set_title('Test') sns.countplot(x="diagnosis", data=results_opt, palette="GnBu_d", ax=ax2).set_title('Test optimized') sns.countplot(x="diagnosis", data=results_opt2, palette="GnBu_d", ax=ax3).set_title('Test optimized by class') sns.despine() plt.show() val_kappa = cohen_kappa_score(validation_preds, validation_labels, weights='quadratic') val_opt_kappa = cohen_kappa_score(validation_preds_opt, validation_labels, weights='quadratic') val_opt_kappa2 = cohen_kappa_score(validation_preds_opt2, validation_labels, weights='quadratic') results_name = 'submission.csv' results_opt_name = 'submission_opt.csv' results_opt2_name = 'submission_opt2.csv' # if (val_kappa > val_opt_kappa) and (val_kappa > val_opt_kappa2): # results_name = 'submission.csv' # results_opt_name = 'submission_opt.csv' # results_opt2_name = 'submission_opt2.csv' # elif (val_opt_kappa > val_kappa) and (val_opt_kappa > val_opt_kappa2): # results_name = 'submission_norm.csv' # results_opt_name = 'submission.csv' # results_opt2_name = 'submission_opt2.csv' # else: # results_name = 'submission_norm.csv' # results_opt_name = 'submission_opt.csv' # results_opt2_name = 'submission.csv' results.to_csv(results_name, index=False) display(results.head()) results_opt.to_csv(results_opt_name, index=False) display(results_opt.head()) results_opt2.to_csv(results_opt2_name, index=False) display(results_opt2.head()) ```
github_jupyter
# Linear Regression (OLS) ### Key Equation: $Ax =b ~~ \text{for} ~~ n \times p+1 $ Linear regression - Ordinary Least Square (OLS) is the most basic form of supervised learning. In this we have a target variable (y) and we want to establish a linear relationship with a set of features (x<sub>1</sub>, x<sub>2</sub>, x<sub>3</sub>, ...) Lets take a simple example to illustrate this problem: We have price ('000 INR) and mileage (kmpl) for 7 hatchback cars as below ``` price = [199 , 248 , 302 , 363 , 418 , 462 , 523 ] kmpl = [23.9, 22.7, 21.1, 20.5, 19.8, 20.4, 18.6] ``` We want to predict the target variable `price`, given the input variable `kmpl` ``` import numpy as np import matplotlib.pyplot as plt %matplotlib inline plt.style.use('fivethirtyeight') plt.rcParams['figure.figsize'] = (10, 6) price = np.array([199, 248, 302, 363, 418, 462, 523]) kmpl = np.array([23.9, 22.7, 21.1, 20.5, 19.8, 20.4, 18.6]) plt.scatter(kmpl, price, s = 150) plt.xlabel('kmpl') plt.ylabel('price') ``` ## Thinking Linear Algebra Way The basic problem in linear regression is solving - `n` linear equation, with `p` unknowns, where `p < n` So a linear relationship can be written as: $$ price = \beta_{0} + \beta_{1} kmpl $$ We have added an intercept to the equation, so that the line does not need to pass through zero So we are trying to solve these n = 7 equations with, p = 2 $$ 199 = \beta_{0} + \beta_{1} 23.9 ~~~~ \text{(eq 1)} $$ $$ 248 = \beta_{0} + \beta_{1} 22.7 ~~~~ \text{(eq 2)} $$ $$ 302 = \beta_{0} + \beta_{1} 21.1 ~~~~ \text{(eq 3)} $$ $$ 363 = \beta_{0} + \beta_{1} 20.5 ~~~~ \text{(eq 4)} $$ $$ 418 = \beta_{0} + \beta_{1} 19.8 ~~~~ \text{(eq 5)} $$ $$ 462 = \beta_{0} + \beta_{1} 20.4 ~~~~ \text{(eq 6)} $$ $$ 523 = \beta_{0} + \beta_{1} 18.6 ~~~~ \text{(eq 7)} $$ So the key to remember here is that we are solving for $\beta_{0}$ and $ \beta_{1} $ Now if we plot these lines, it is clear that there will not be a one point of intersection that we can get like we get if we had only 2 equations. ``` b0 = np.arange(-500,4000, 100) for i in range(7): b1 = (price[i] - b0)/kmpl[i] plt.plot(b0, b1, linewidth = 1) plt.text(b0[-10], b1[-10], 'eq %s'% (i + 1), fontsize = 8 ) plt.axhline(0, color='grey', linewidth=2) plt.axvline(0, color='grey', linewidth=2) plt.xlabel('beta0') plt.ylabel('beta1') plt.ylim(-150,50) ``` Now we don't have an exact solution. But can see the $\beta_{0} $ is around 1600 and $ \beta_{1} $ is around -60. So one possible line is $$ price = 1600 - 60 * kmpl $$ But we can clearly see that this is probably not the best possible line!! ``` beta_0 = 1600 beta_1 = -60 plt.scatter(kmpl, price, s = 150) plt.xlabel('kmpl') plt.ylabel('price') y = beta_0 + beta_1 * kmpl plt.plot(kmpl, y, '-') ``` ## Adding Error Term The linear relationship hence needs to be modeled through a error variable $\epsilon_{i}$ — an unobserved random variable that adds noise to the linear relationship between the target variable and input variable. If we have `p` input variables then, $$ y_{i} = \beta_{0} + \sum_{i=1}^p \beta_{i} x_{i} + \epsilon_{i} $$ We can add the $x_{0} = 1 $ in the equation: $$ y_{i} = \sum_{i=0}^p \beta_{i} x_{i} + \epsilon_{i} $$ $$ y_{i} = x_{i}^T \beta_{i} + \epsilon_{i} $$ ``` plt.scatter(kmpl, price, s = 150) plt.xlabel('kmpl') plt.ylabel('price') y = 1600 - 60 * kmpl yerrL = y - price yerrB = y - y plt.errorbar(kmpl,y, fmt = 'o', yerr= [yerrL, yerrB], c= 'r') plt.plot(kmpl, y,linewidth = 2) ``` ## Represent Matrix Way If we write this in matrix form $$ y = X\beta + \epsilon $$ $$ \text{where} ~~~~ X = \begin{bmatrix} - x_{1}^T- \\ - x_{2}^T- \\ ... \\ - x_{n}^T- \end{bmatrix} ~~ \text{,} ~~ y = \begin{bmatrix} y_{1} \\ y_{2} \\ ... \\ y_{n} \end{bmatrix} ~~ \text{and} ~~ \epsilon = \begin{bmatrix} \epsilon_{1} \\ \epsilon_{2} \\ ... \\ \epsilon_{n} \end{bmatrix} $$ For our specific example, the matrix looks like: $$ \begin{bmatrix}199 \\ 248 \\ 302 \\ 363 \\ 418 \\ 462 \\ 523 \end{bmatrix} = \begin{bmatrix} 1 & 23.9 \\ 1 & 22.7 \\ 1 & 21.1 \\ 1 & 20.5 \\ 1 & 19.8 \\ 1 & 20.4 \\ 1 & 18.6 \end{bmatrix} \begin{bmatrix} \beta_{0} \\ \beta_{1} \end{bmatrix} + \begin{bmatrix} \epsilon_{1} \\ \epsilon_{2} \\ \epsilon_{3} \\ \epsilon_{4} \\ \epsilon_{5} \\ \epsilon_{6} \\ \epsilon_{7} \end{bmatrix} $$ ## Minimize Error - Ordinary Least Square The error we will aim to minimize is the squared error: $$ E(\beta)= \frac {1}{n} \sum _{i=1}^{n}(\epsilon_{i})^2 $$ This is why this technique is called **Ordinary Least Square** (OLS) regression $$ E(\beta)= \frac {1}{n} \sum _{i=1}^{n}(y_{i}-x_{i}^{T}\beta)^{2} $$ which in matrix way is equal to: $$ E(\beta)= \frac {1}{n} (y-X\beta)^{T}(y-X\beta) $$ $$ E(\beta)= \frac {1}{n} {||y - X\beta||}^2 $$ To get the minimum for this error function, we need to differentiate by $\beta^T$ $$ \nabla E(\beta) = 0 $$ $$ \nabla E(\beta) ={\frac {dE(\beta)}{d\beta^T}} = {\frac {d}{d\beta^T}}{\bigg (}{ \frac {1}{n} ||y - X\beta||}^2{\bigg )} = 0 $$ $$ \nabla E(\beta)= \frac {2}{n} X^T(X\beta−y) = 0 $$ $$ X^T X\beta = X^T y $$ So the solution to OLS: $$ \beta = X^†y ~~ \text{where} ~~ X^† = (X^T X)^{−1} X^T $$ $$X^† ~~ \text{is the pseudo inverse of} ~~ X $$ ## Calculate Pseudo Inverse $$ X^† = (X^T X)^{−1} X^T $$ $X^† $ is the pseudo inverse of $ X $ has good properties $$ X^† = \left( \begin{matrix} ~ \\ \begin{bmatrix} ~ \\ p + 1 \times n \\ ~ \end{bmatrix} \begin{bmatrix} ~ \\ n \times p + 1 \\ ~ \end{bmatrix} \\ ~ \end{matrix} \right)^{-1} \begin{bmatrix} ~ \\ (p + 1 \times n) \\ ~ \end{bmatrix}$$ $$ X^† = \left( \begin{matrix} ~ \\ \begin{bmatrix} ~ \\ p + 1 \times p + 1 \\ ~ \end{bmatrix} \\ ~ \end{matrix} \right)^{-1} \begin{bmatrix} ~ \\ (p + 1 \times n) \\ ~ \end{bmatrix}$$ $$ X^† = \begin{bmatrix} ~ \\ (p + 1 \times n) \\ ~ \end{bmatrix}$$ $$ X^†_{p + 1 \times n} = {(X^T_{p + 1 \times n} ~ X_{n \times p+1})}^{-1} ~ X^T_{p + 1 \times n}$$ ``` n = 7 x0 = np.ones(n) x0 x1 = kmpl x1 # Create the X matrix X = np.c_[x0, x1] X = np.asmatrix(X) X # Create the y matrix y = np.asmatrix(price.reshape(-1,1)) y y.shape X_T = np.transpose(X) X_T X_T * X X_pseudo = np.linalg.inv(X_T * X) * X_T X_pseudo beta = X_pseudo * y beta ``` ## OLS Solution Hence we now know that the best-fit line is $\beta_0 = 1662 $ and $\beta_1 = -62$ $$ price = 1662 - 62 * kmpl $$ ``` beta_0 = 1662 beta_1 = -62 plt.scatter(kmpl, price, s = 150) plt.xlabel('kmpl') plt.ylabel('price') y = beta_0 + beta_1 * kmpl plt.plot(kmpl, y, '-') ``` ## Exercise 1 We had price ('000 INR), mileage (kmpl) and now we have one more input variable - horsepower (bhp) for the 7 cars ``` price = [199 , 248 , 302 , 363 , 418 , 462 , 523 ] kmpl = [23.9, 22.7, 21.1, 20.5, 19.8, 20.4, 18.6] bhp = [38 , 47 , 55 , 67 , 68 , 83 , 82 ] ``` We want to predict the value of `price`, given the variable `kmpl` and `bhp` ``` bhp = np.array([38, 47, 55, 67, 68, 83, 82]) from mpl_toolkits.mplot3d import Axes3D fig = plt.figure() ax = fig.gca(projection='3d') ax.scatter(bhp, kmpl, price, c='r', marker='o', s = 200) ax.view_init(azim=30) ``` So a linear relationship can be written as: $$ price = \beta_{0} + \beta_{1} kmpl + \beta_{2} bhp $$ We have added an intercept to the equation, so that the plane does not need to pass through zero So we are trying to solve these n = 7 equations with, p = 3 $$ 199 = \beta_{0} + \beta_{1} 23.9 + \beta_{2} 38 + \epsilon_{1} ~~~~ \text{(eq 1)} $$ $$ 248 = \beta_{0} + \beta_{1} 22.7 + \beta_{2} 47 + \epsilon_{2} ~~~~ \text{(eq 2)} $$ $$ 302 = \beta_{0} + \beta_{1} 21.1 + \beta_{2} 55 + \epsilon_{3} ~~~~ \text{(eq 3)} $$ $$ 363 = \beta_{0} + \beta_{1} 20.5 + \beta_{2} 67 + \epsilon_{4} ~~~~ \text{(eq 4)} $$ $$ 418 = \beta_{0} + \beta_{1} 19.8 + \beta_{2} 68 + \epsilon_{5} ~~~~ \text{(eq 5)} $$ $$ 462 = \beta_{0} + \beta_{1} 20.4 + \beta_{2} 83 + \epsilon_{6} ~~~~ \text{(eq 6)} $$ $$ 523 = \beta_{0} + \beta_{1} 18.6 + \beta_{2} 82 + \epsilon_{7} ~~~~ \text{(eq 7)} $$ or in matrix form - we can write it as $$ \begin{bmatrix}199 \\ 248 \\ 302 \\ 363 \\ 418 \\ 462 \\ 523 \end{bmatrix} = \begin{bmatrix} 1 & 23.9 & 38 \\ 1 & 22.7 & 47 \\ 1 & 21.1 & 55 \\ 1 & 20.5 & 67 \\ 1 & 19.8 & 68 \\ 1 & 20.4 & 83 \\ 1 & 18.6 & 82 \end{bmatrix} \begin{bmatrix}\beta_{0} \\ \beta_{1} \\ \beta_{2}\end{bmatrix} + \begin{bmatrix} \epsilon_{1} \\ \epsilon_{2} \\ \epsilon_{3} \\ \epsilon_{4} \\ \epsilon_{5} \\ \epsilon_{6} \\ \epsilon_{7} \end{bmatrix}$$ Develop the $X$ matrix for this problem? Develop the $y$ matrix for this problem? Calculate the pseudo inverse of $X$. Find the $\beta$ for the best-fit plane. Plot the `price`, `kmpl` and `bhp` and the best-fit plane. ``` from mpl_toolkits.mplot3d import Axes3D fig = plt.figure() ax = fig.gca(projection='3d') ax.scatter(bhp, kmpl, price, c='r', marker='o', s = 200) xrange = np.arange(min(bhp), max(bhp), 1) yrange = np.arange(min(kmpl), max(kmpl), 1) x, y = np.meshgrid(xrange, yrange) z = 524 - 22 * y + 4 * x ax.plot_surface(x, y, z, color ='blue', alpha = 0.5) ax.view_init(azim=60) ``` ## Using a package: statsmodel Run the Ordinary Least Square using the package in statsmodels ``` import statsmodels.api as sm import pandas as pd df = pd.read_csv("cars_sample.csv") df y = df.price X = df[['kmpl', 'bhp']] X = sm.add_constant(X) X model_sm = sm.OLS(y,X) results = model_sm.fit() results.params ``` ## Using a package: sklearn Run the Ordinary Least Square using the package sklearn ``` from sklearn import linear_model y = df.price X = df[['kmpl', 'bhp']] model_sklearn = linear_model.LinearRegression() model_sklearn.fit(X, y) model_sklearn.coef_ model_sklearn.intercept_ ``` ## Non Linear Transformation What happens when we do Non-Linear transforms to the features? What if we want to predict $price$ based on $kmpl$, $bhp$, $kmpl^2$ and $bhp / kmpl$ The think to remember is that non-linear transforms of the features does not impact the Linear Regression. Because the linear relationship is really about $\beta $ and not the features. We can be write this as: $$ price = \beta_{0} + \beta_{1} kmpl + \beta_{2} bhp + \beta_{3} kmpl^2 + \beta_{4} bhp/kmpl $$ ``` df['kmpl2'] = np.power(df.kmpl,2) plt.scatter(df.kmpl2, df.price, s = 150) plt.xlabel('kmpl2') plt.ylabel('price') df['bhp_kmpl'] = np.divide(df.bhp, df.kmpl) plt.scatter(df.bhp_kmpl, df.price, s = 150) plt.xlabel('bhp/kmpl') plt.ylabel('price') df ``` ## Exercise 2 Run a linear regeression: $$ price = \beta_{0} + \beta_{1} kmpl + \beta_{2} bhp + \beta_{2} kmpl^2 + \beta_{2} bhp/kmpl $$ Using Pseudo-Inverse Matrix: Using sklearn package:
github_jupyter
# ISM Lecture 3 continued in week 04 Part 1 Solutions This content is authored by Maria Boutchkova for use in the University of Edinbugh Business School Investment and Securities Markets course in Autumn 2020. Make sure to have watched the videos preceeding this Notebook and have covered the slides. Detailed explanations in the assigned textbook chapters. This lesson covers: * Value-weighted Portfolio risk and return of N assets The first computational cell below (with In \[ \] in front) contains the solution. Go over the command lines, make sure they make sense to you, click inside the cell, it should become surrounded by a green rectangle, press Esc - the rectangle will become blue, now press Shift+Enter - this will execute the cell and produce the results beneath it. To remove all output in the notebook and start again, go to the Kernel tab above, select Restart and Clear Output. In this notebook we use the functionality of the pandas library. If you want to explore its full documetation, see [here](https://pandas.pydata.org/pandas-docs/stable/index.html). ## Input data Now we are going to import two csv files with data on the S&P500 index: one of monthly prices (same as last week) and another one of market capitalizations (when a company has only one class of common stock and no preferred stock, mkt cap = stock price * number of shares outstanding). We shall form a value-weighted portfolio and compute its risk and return. In this example we have monthly adjusted closing prices of the stocks in the S&P500 index from December 2017 until end of September 2020 (34 monthly observations per stock). The original data is arranged with stocks down the rows and dates along the columns. ``` # input a list of the prices on the portfolio components and save it as a panda series import pandas as pd prices_orig = pd.read_csv("SnP500_monthly.csv", index_col=0) # transpose the data so that the stocks are in the columns and the dates are along the rows prices = prices_orig.transpose() prices.head(5) ``` ## Solved Problem 1: Forming a value-weighted portfolio and computing its average return and st. dev. Let us form a value-weighted portfolio of the US stocks and compute its expected return, variance and st. dev. The weights will be equal to the mkt cap of each stock over the total of the mkt cap of all stocks. ``` mkt_cap = pd.read_csv("SnP500_mkt_cap.csv", index_col=0) weights_v = mkt_cap / mkt_cap.sum() # name the column containing the weights to be called weights weights_v.columns = ['weights'] weights_v.head(5) ``` ``` returns = prices / prices.shift(1) - 1 # drop NaN-s returns = returns[1:] returns.head(5) means = returns.mean() means.head(5) vars = returns.var() vars.head(5) port_ave_ret = means.mul(weights_v.weights).sum() port_ave_ret # same thing using the numpy library instead import numpy as np port_exp_ret = np.sum(returns.mean()*weights_v.weights) port_exp_ret ``` ``` cov = returns.cov() cov.head(5) port_var = np.dot(weights_v.weights, np.dot(cov, weights_v.weights)) port_var port_std = port_var**(1/2) port_std ``` ## Practice Problem 1: Forming a value-weighted portfolio and computing its average return and st. dev. Let us form the value-weighted portfolio of the UK stocks and compute its expected return, variance and st. dev. The weights will be equal to the mkt cap of each stock over the total of the mkt cap of all stocks. The weights vector of the UK stocks is formed for you: weights_v_uk. Your task is to 1) compute the average return of the value-weighted UK portfolio; 2) compute the variance of the value-weighted UK portfolio and 3) compute the standard deviation of the value-weighted UK portfolio. Name everything _uk. ``` prices_orig_uk = pd.read_csv("FTSE100_250_monthly.csv", index_col=0) # transpose the data so that the stocks are in the columns and the dates are along the rows prices_uk = prices_orig_uk.transpose() prices_uk.head(5) mkt_cap = pd.read_csv("FTSE100_250_mkt_cap.csv", index_col=0) weights_v_uk = mkt_cap / mkt_cap.sum() # name the column containing the weights to be called weights weights_v_uk.columns = ['weights'] weights_v_uk.head(5) ``` ``` returns_uk = prices_uk / prices_uk.shift(1) - 1 # drop NaN-s returns_uk = returns_uk[1:] returns_uk.head(5) means_uk = returns_uk.mean() means_uk.head(5) vars_uk = returns_uk.var() vars_uk.head(5) cov_uk = returns_uk.cov() cov_uk.head(5) port_ave_ret_uk = means_uk.mul(weights_v_uk.weights).sum() port_ave_ret_uk port_var_uk = np.dot(weights_v_uk.weights, np.dot(cov_uk, weights_v_uk.weights)) port_var_uk port_std_uk = port_var_uk**(1/2) port_std_uk ``` ## Solved Problem 2: Plotting different portfolios on the expected return - st. dev. coordinate system. Recall that we use the average reurn as an estimate of the expected return. Let us graph the value-weighted US portfolio we computed just now and the equally-weighted one from last week. First we recompute quickly the equally-weighted one here and name the new outputs _eq. ``` # declate a list of 500 elements each equal to 1/500 lst = [1/500]*500 # make it into a dataframe weights_eq = pd.DataFrame(lst) # name the column containing the weights to be called weights weights_eq.columns = ['weights'] # do the transposing gymnastics aux = weights_eq.T # take the stock id-s from the returns dataframe and put them in a list called lst lst = list(returns.columns.values) # assign the id-s in lst to be the header of the weights aux.columns = lst weights_eq = aux.T # calculate the equally-weighted portfolio average return, var and st. dev. port_ave_ret_eq = means.mul(weights_eq.weights).sum() port_var_eq = np.dot(weights_eq.weights, np.dot(cov, weights_eq.weights)) port_std_eq = port_var_eq**(1/2) port_std_eq import matplotlib.pyplot as plt %matplotlib inline plt.scatter(port_std_eq, port_ave_ret_eq, c='b', marker='x', label='Equally-weighted') plt.scatter(port_std, port_ave_ret, c='r', marker='+', label='Value-weighted') plt.legend(loc='upper right') # add axes labels plt.xlabel('Sigma') plt.ylabel('E(R)') # add title plt.title('S&P500 Portfolios'); # control axes ranges plt.xlim(0, .1) plt.ylim(0, .1) plt.show() ``` ## Practice Problem 2: Plotting different portfolios on the expected return - st. dev. coordinate system. Graph the value-weighted UK portfolio you computed just now and the equally-weighted one from last week. First we recompute quickly the equally-weighted one here and name the new outputs _eq. ``` # declate a list of 500 elements each equal to 1/500 lst = [1/350]*350 # make it into a dataframe weights_eq_uk = pd.DataFrame(lst) # name the column containing the weights to be called weights weights_eq_uk.columns = ['weights'] # do the transposing gymnastics aux = weights_eq_uk.T lst = list(returns_uk.columns.values) aux.columns = lst weights_eq_uk = aux.T # calculate the equally-weighted portfolio average return, var and st. dev. port_ave_ret_uk_eq = means_uk.mul(weights_eq_uk.weights).sum() port_var_uk_eq = np.dot(weights_eq_uk.weights, np.dot(cov_uk, weights_eq_uk.weights)) port_std_uk_eq = port_var_uk_eq**(1/2) port_std_uk_eq plt.scatter(port_std_uk_eq, port_ave_ret_uk_eq, c='b', marker='x', label='Equally-weighted') plt.scatter(port_std_uk, port_ave_ret_uk, c='r', marker='+', label='Value-weighted') plt.legend(loc='upper right') # add axes labels plt.xlabel('Sigma') plt.ylabel('E(R)') # add title plt.title('FTSE100&250 Portfolios'); # control axes ranges plt.xlim(0, .1) plt.ylim(0, .1) plt.show() ``` ## Extra This is how we can graph both the US and UK index constituents. ``` # compute the st dev-s of each group and save std = returns.std() std_uk = returns_uk.std() ### import matplotlib's plotting functions import matplotlib.pyplot as plt %matplotlib inline plt.scatter(std, means, c='b', marker='x', label='S&P500') plt.scatter(std_uk, means_uk, c='r', marker='+', label='FTSE100&250') plt.legend(loc='upper right') # add axes labels plt.xlabel('Sigma') plt.ylabel('E(R)') # add title plt.title('S&P500 and FTSE100&250 Constituents Monthly E(R) and St. Dev-s since Jan. 2018'); # control axes ranges #plt.xlim(0, .3) #plt.ylim(-.05, .1) plt.show() ```
github_jupyter
``` %matplotlib inline import numpy as np import matplotlib.pyplot as plt ``` ## Introduction Machine learning literature makes heavy use of probabilistic graphical models and bayesian statistics. In fact, state of the art (SOTA) architectures, such as [variational autoencoders][vae-blog] (VAE) or [generative adversarial networks][gan-blog] (GAN), are intrinsically stochastic by nature. To wholesomely understand research in this field not only do we need a broad knowledge of mathematics, probability, and optimization but we somehow need intuition about how these concepts are applied to real world problems. For example, one of the most common applications of deep learning techniques is vision. We may want to classify images or generate new ones. Most SOTA techniques pose these problems in a probabilistic framework. We frequently see things like $p(\mathbf{x}|\mathbf{z})$ where $\mathbf{x}$ is an image and $\mathbf{z}$ is a latent variable. What do we mean by the probability of an image? What is a latent variable, and why is it necessary[^Bishop2006] to pose the problems this way? Short answer, it is necessary due to the inherent uncertainty of our universe. In this case, uncertainty in image acquisition can be introduced via many sources, such as the recording apparatus, the finite precision of our measurements, as well as the intrinsic stochasticity of the process being measured. Perhaps the most important source of uncertainty we will consider is due to there being sources of variability that are themselves unobserved. Probability theory provides us with a framework to reason in the presence of uncertainty and information theory allows us to quantify uncertainty. As we elluded earlier the field of machine learning makes heavy use of both, and this is no coincidence. ## Representations How do we describe a face? The word "face" is a symbol and this symbol means different things to different people. Yet, there is enough commonality between our interpretations that we are able to effectively communicate with one another using the word. How is that? What are the underlying features of faces that we all hold common? Why is a simple smiley face clip art so obviously perceived as a face? To make it more concrete, why are two simple ellipses decorated underneath by a short curve so clearly a face, while an eye lid, lower lip, one ear and a nostril, not? **Insert Image of Faces** *Left: Most would likely agree, this is clearly a face. Middle: With nearly all of the details removed, a mere two circles and curve are enough to create what the author still recognizes as a face. Right: Does this look like a face to you? An ear, nostril, eyelid, and lip do not seem to convey a face as clearly as the eyes and the mouth do. We will quantify this demonstration shortly.* Features, or representations, are built on the idea that characteristics of the symbol "face" are not a property of any one face. Rather, they only arise from the myriad of things we use the symbol to represent. In other words, a particular face is not ascribed meaning by the word "face" - the word "face" derives meaning from the many faces it represents. This suggests that facial characteristics can be described through the statistical properties of all faces. Loosely speaking, these underlying statistical characteristics are what the machine learning field often calls latent variables. ## Probability of an Image Most images are contaminated with noise that must be addressed. At the highest level, we have noise being added to the data by the imaging device. The next level of uncertainty comes as a consequence of discretization. Images in reality are continuous but in the process of imaging we only measure certain points along the face. Consider for example a military satellite tracking a vehicle. If one wishes to predict the future location of the van, the prediction is limited to be within one of the discrete cells that make up its measurements. However, the true location of the van could be anywhere within that grid cell. There is also intrinsic stochasticity at the atomic level that we ignore. The fluctuations taking place at that scale are assumed to be averaged out in our observations. The unobserved sources of variability will be our primary focus. Before we address that, let us lay down some preliminary concepts. We are going to assume that there exists some true unknown process that determines what faces look like. A dataset of faces can then be considered as a sample of this process at various points throughout its life. This suggests that these snapshots are a outputs of the underlying data generating process. Considering the many sources of uncertainty outlined above, it is natural to describe this process as a probability distribution. There will be many ways to interpret the data as a probability, but we will begin by considering any one image to be the result of a data generating distribution, $P_{data}(\mathbf{x})$. Here $\mathbf{x}$ is considered to be an image of a face with $n$ pixels. So $P_{data}$ is a joint distribution over each pixel of the frame with a probability density function (pdf), $p_{data}(x_1,x_2,\dots,x_n)$. To build intuition about what $p_{data}(\mathbf{x})$ is and how it relates to the assumed data generating process, we will explore a simple example. Take an image with only 2 pixels... [$x_1$,$x_2$] where both $x_1$ and $x_2$ are in [0,1]. Each image can be considered as a two dimensional point, in $\mathbb{R}^2$. All possible images would occupy a square in the 2 dimensional plane. An example of what this might look like can be seen in Figure \ref{fig:images_in_2dspace} on page \pageref{fig:images_in_2dspace}. Any one point inside the unit square would represent an image. For example the image associated with the point $(0.25,0.85)$ is shown below. ``` x1 = np.random.uniform(size=500) x2 = np.random.uniform(size=500) fig = plt.figure(); ax = fig.add_subplot(1,1,1); ax.scatter(x1,x2, edgecolor='black', s=80); ax.grid(); ax.set_axisbelow(True); ax.set_xlim(-0.25,1.25); ax.set_ylim(-0.25,1.25) ax.set_xlabel('Pixel 2'); ax.set_ylabel('Pixel 1'); plt.savefig('images_in_2dspace.pdf') ``` Any one point inside the unit square would represent an image. For example the image associated with the point $(0.25,0.85)$ is shown below. ``` im = [(0.25, 0.85)] plt.imshow(im, cmap='gray',vmin=0,vmax=1) plt.tick_params( axis='both', # changes apply to the x-axis which='both', # both major and minor ticks are affected bottom='off', # ticks along the bottom edge are off top='off', # ticks along the top edge are off left='off', right='off' ) plt.xticks([]) plt.yticks([]) plt.xlabel('Pixel 1 = 0.25 Pixel 2 = 0.85') plt.savefig('sample_2dspace_image.pdf') ``` Now consider the case where there is some process correlating the two variables. This would be similar to their being some rules behind the structure of faces. We know, that this must be the case because if it weren't then faces would be created randomly and we would not see the patterns that was do. In this case, the pixels would be correlated in some manner due to the mechanism driving the construction of faces. In this simple case, let's consider a direct correlation of the form $x_1 = \frac{1}{2} \cos(2\pi x_2)+\frac{1}{2}+\epsilon$ where $\epsilon$ is a noise term coming from a low variability normal distribution $\epsilon \sim N(0,\frac{1}{10})$. We see in Figure \ref{fig:structured_images_in_2dspace} on page \pageref{fig:structured_images_in_2dspace} that in this case, the images plotted in two dimensions resulting from this relationship form a distinct pattern. ``` x1 = lambda x2: 0.5*np.cos(2*np.pi*x2)+0.5 x2 = np.linspace(0,1,200) eps = np.random.normal(scale=0.1, size=200) fig = plt.figure(); ax = fig.add_subplot(1,1,1); ax.scatter(x2,x1(x2)+eps, edgecolor='black', s=80); ax.grid(); ax.set_axisbelow(True); ax.set_xlim(-0.25,1.25); ax.set_ylim(-0.25,1.25); plt.axes().set_aspect('equal') ax.set_xlabel('Pixel 2'); ax.set_ylabel('Pixel 1'); plt.savefig('structured_images_in_2dspace.pdf') ``` We will refer to the structure suggested by the two dimensional points as the 'manifold'. This is a common practice when analyzing images. A 28 by 28 dimensional image will be a point in 784 dimensional space. If we are examining images with structure, various images of the number 2 for example, then it turns out that these images will form a manifold in 784 dimensional space. In most cases, as is the case in our contrived example, this manifold exists in a lower dimensional space than that of the images themselves. The goal is to 'learn' this manifold. In our simple case we can describe the manifold as a function of only 1 variable $$f(t) = <t,\frac{1}{2} \cos(2\pi t)+\frac{1}{2}>$$ This is what we would call the underlying data generating process. In practice we usually describe the manifold in terms of a probability distribution. We will refer to the data generating distribution in our example as $p_{test}(x_1, x_2)$. Why did we choose a probability to describe the manifold created by the data generating process? How might this probability be interpreted? Learning the actual distribution turns out to be a difficult task. Here we will use a common non parametric technique for describing distributions, the histogram. Looking at a histogram of the images, or two dimensional points, will give us insight into the structure of the distribution from which they came. Notice here though that the histogram merely describes the distribution, we do not know what it is. ``` from matplotlib.colors import LogNorm x2 = np.random.uniform(size=100000) eps = np.random.normal(scale=0.1, size=100000) hist2d = plt.hist2d(x2,x1(x2)+eps, bins=50, norm=LogNorm()) plt.xlim(0.0,1.0); plt.ylim(-0.3,1.3); plt.axes().set_aspect('equal') plt.xlabel('Pixel 2'); plt.ylabel('Pixel 1') plt.colorbar(); plt.savefig('histogram_of_structured_images.pdf') ``` As our intuition might have suggested, the data generating distribution looks very similar to the structure suggested by the two dimensional images plotted above. There is high probability very near the actual curve $x_1 = \frac{1}{2} \cos(2\pi x_2)+\frac{1}{2}$ and low probability as we move away. We imposed the uncertainty via the Gaussian noise term $\epsilon$. However, in real data the uncertainty can be due to the myriad sources outlined above. In these cases a complex probability distribution isn't an arbitrary choice for representing the data, it becomes necessary. Hopefully we're now beginning to understand how to interpret $p_{test}(x_1, x_2)$. One might say $p_{test}$ measures how likely a certain configuration of $x_1$ and $x_2$ is to have arisen from the data generating process $f(t)$. Therefore if one can learn the data generating distribution, then they have a descriptive measure of the true underlying data generating process. This intuition extends to the $p_{data}(x)$ for faces that was presented above. A sample from the LFW dataset is shown in Figure \ref{fig:Agnelo_Queiroz_0001} on page \pageref{fig:Agnelo_Queiroz_0001}.
github_jupyter
``` import numpy as np import utils import librosa import keras from keras.utils import to_categorical from keras.models import load_model from keras.models import Sequential from keras.layers import MaxPooling2D,Conv2D,Flatten,Activation,Dense,Dropout,BatchNormalization from keras.optimizers import Adamax from sklearn.model_selection import train_test_split from sklearn import preprocessing import os # Manipulate files from matplotlib import pyplot as plt from IPython.display import clear_output # List the wav files ROOT_DIR = './input/cats_dogs/' X_path = os.listdir(ROOT_DIR) # changing the values into 1 and 0 y = [0 if 'cat' in f else 1 for f in X_path] # change y to int values # Split train and test train_input, test_input, train_target, test_target = train_test_split(X_path, y, test_size=0.10) #examples print(train_input[0]) print(test_input[0]) print(train_target[0]) print(test_target[0]) def extract_feature(file_name): X, sample_rate = librosa.load(file_name,duration=5) stft = np.abs(librosa.stft(X)) mfccs = np.mean(librosa.feature.mfcc(y=X, sr=sample_rate, n_mfcc=40).T,axis=0) chroma = np.mean(librosa.feature.chroma_stft(S=stft, sr=sample_rate).T,axis=0) mel = np.mean(librosa.feature.melspectrogram(X, sr=sample_rate).T,axis=0) contrast = np.mean(librosa.feature.spectral_contrast(S=stft, sr=sample_rate).T,axis=0) tonnetz = np.mean(librosa.feature.tonnetz(y=librosa.effects.harmonic(X), sr=sample_rate).T,axis=0) return mfccs,chroma,mel,contrast,tonnetz i = 0 X_train = [] while i<len(train_input): print('processing file: ',i) filename = 'input/cats_dogs/' + train_input[i] mfccs, chroma, mel, contrast,tonnetz = extract_feature(filename) features = [] features.append(np.mean(mfccs)) features.append(np.mean(chroma)) features.append(np.mean(mel)) features.append(np.mean(contrast)) features.append(np.mean(tonnetz)) X_train.append(features) i = i +1 # converting into an numpy array X_train = np.asarray(X_train) y_train = np.asarray(train_target) X_train.shape print(y_train.shape) model = Sequential() model.add(Dense(500,input_shape = (5,))) model.add(Activation('relu')) model.add(Dense(200)) model.add(Activation('relu')) model.add(Dense(100)) model.add(Activation('relu')) model.add(Dense(1)) model.add(Activation('sigmoid')) model.summary() model.compile(optimizer = 'adam', metrics=['accuracy'], loss = 'binary_crossentropy') #plot class PlotLosses(keras.callbacks.Callback): def on_train_begin(self, logs={}): self.i = 0 self.x = [] self.losses = [] self.val_losses = [] self.fig = plt.figure() self.logs = [] def on_epoch_end(self, epoch, logs={}): self.logs.append(logs) self.x.append(self.i) self.losses.append(logs.get('loss')) self.val_losses.append(logs.get('val_loss')) self.i += 1 clear_output(wait=True) plt.plot(self.x, self.losses, label="loss") plt.plot(self.x, self.val_losses, label="val_loss") plt.legend() plt.show(); plot_losses = PlotLosses() model.fit(X_train,y_train, epochs =500, callbacks = [plot_losses], verbose= 2) i = 0 X_test = [] while i<len(test_input): print('processing file: ',i) filename = 'input/cats_dogs/' + test_input[i] mfccs, chroma, mel, contrast,tonnetz = extract_feature(filename) features = [] features.append(np.mean(mfccs)) features.append(np.mean(chroma)) features.append(np.mean(mel)) features.append(np.mean(contrast)) features.append(np.mean(tonnetz)) X_test.append(features) i = i +1 X_test = np.asarray(X_test) predicted = model.predict(X_test) i = 0 while i<len(predicted): if predicted[i] >=.5: predicted[i] = 1 else: predicted[i] = 0 i = i +1 y_test = np.asarray(predicted) predicted = predicted.reshape([-1]) print(predicted.shape) #plotting the confusion matrix import itertools from sklearn.metrics import confusion_matrix def plot_confusion_matrix(cm, classes, normalize=False, title='Confusion matrix', cmap=plt.cm.Blues): """ This function prints and plots the confusion matrix. Normalization can be applied by setting `normalize=True`. """ if normalize: cm = cm.astype('float') / cm.sum(axis=1)[:, np.newaxis] print("Normalized confusion matrix") else: print('Confusion matrix, without normalization') print(cm) plt.imshow(cm, interpolation='nearest', cmap=cmap) plt.title(title) plt.colorbar() tick_marks = np.arange(len(classes)) plt.xticks(tick_marks, classes, rotation=45) plt.yticks(tick_marks, classes) fmt = '.2f' if normalize else 'd' thresh = cm.max() / 2. for i, j in itertools.product(range(cm.shape[0]), range(cm.shape[1])): plt.text(j, i, format(cm[i, j], fmt), horizontalalignment="center", color="white" if cm[i, j] > thresh else "black") plt.tight_layout() plt.ylabel('True label') plt.xlabel('Predicted label') # Compute confusion matrix cnf_matrix = confusion_matrix(y_test, predicted) np.set_printoptions(precision=2) # Plot non-normalized confusion matrix plt.figure() plot_confusion_matrix(cnf_matrix, classes=['cat','dog'], title='Confusion matrix, without normalization') # Plot normalized confusion matrix plt.figure() plot_confusion_matrix(cnf_matrix, classes=['cat','dog'], normalize=True, title='Normalized confusion matrix') plt.show() ```
github_jupyter
# Lab 6-2: Fancy Softmax Classification Author: Seungjae Lee (이승재) ## Imports ``` import numpy as np import torch import torch.nn as nn import torch.nn.functional as F import torch.optim as optim # For reproducibility torch.manual_seed(1) ``` ## Cross-entropy Loss with `torch.nn.functional` PyTorch has `F.log_softmax()` function. ``` z = torch.rand(3, 5, requires_grad=True) hypothesis = F.softmax(z, dim=1) y = torch.randint(5, (3,)).long() y_one_hot = torch.zeros_like(hypothesis) y_one_hot.scatter_(1, y.unsqueeze(1), 1) # Low level torch.log(F.softmax(z, dim=1)) # High level F.log_softmax(z, dim=1) ``` PyTorch also has `F.nll_loss()` function that computes the negative loss likelihood. ``` # Low level (y_one_hot * -torch.log(F.softmax(z, dim=1))).sum(dim=1).mean() # High level F.nll_loss(F.log_softmax(z, dim=1), y.long()) ``` PyTorch also has `F.cross_entropy` that combines `F.log_softmax()` and `F.nll_loss()`. ``` F.cross_entropy(z, y) ``` ## Data ``` xy = np.loadtxt('data-04-zoo.csv', delimiter=',', dtype=np.float32) x_train = torch.FloatTensor(xy[:, 0:-1]) y_train = torch.LongTensor(xy[:, [-1]]).squeeze() print(x_train.shape) # x_train shape print(len(x_train)) # x_train 길이 print(x_train[:5]) # 첫 다섯 개 print(y_train.shape) # y_train shape print(len(y_train)) # y_train 길이 print(y_train[:5]) # 첫 다섯 개 nb_classes = 7 y_one_hot = torch.zeros((len(y_train), nb_classes)) y_one_hot = y_one_hot.scatter(1, y_train.unsqueeze(1), 1) ``` ## Training with `F.cross_entropy` ``` # 모델 초기화 W = torch.zeros((16, 7), requires_grad=True) b = torch.zeros(1, requires_grad=True) # optimizer 설정 optimizer = optim.SGD([W, b], lr=0.1) nb_epochs = 1000 for epoch in range(nb_epochs + 1): # Cost 계산 (2) z = x_train.matmul(W) + b # or .mm or @ cost = F.cross_entropy(z, y_train) # cost로 H(x) 개선 optimizer.zero_grad() cost.backward() optimizer.step() # 100번마다 로그 출력 if epoch % 100 == 0: print('Epoch {:4d}/{} Cost: {:.6f}'.format( epoch, nb_epochs, cost.item() )) ``` ## High-level Implementation with `nn.Module` ``` class SoftmaxClassifierModel(nn.Module): def __init__(self): super().__init__() self.linear = nn.Linear(16, 7) def forward(self, x): return self.linear(x) model = SoftmaxClassifierModel() # optimizer 설정 optimizer = optim.SGD(model.parameters(), lr=0.1) nb_epochs = 1000 for epoch in range(nb_epochs + 1): # H(x) 계산 prediction = model(x_train) # cost 계산 cost = F.cross_entropy(prediction, y_train) # cost로 H(x) 개선 optimizer.zero_grad() cost.backward() optimizer.step() # 20번마다 로그 출력 if epoch % 100 == 0: print('Epoch {:4d}/{} Cost: {:.6f}'.format( epoch, nb_epochs, cost.item() )) ``` <div class="alert alert-warning"> Should I display how many it got correct in the training set? </div>
github_jupyter
# Online pipeline for Feldman lab ``` from pathlib import Path import numpy as np import matplotlib.pyplot as plt from pprint import pprint import time from spikeextractors import SpikeGLXRecordingExtractor, NwbSortingExtractor from spiketoolkit.sortingcomponents import detect_spikes from spiketoolkit.curation import threshold_firing_rates from spikewidgets import plot_rasters from pynwb import NWBHDF5IO import feldman_lab_to_nwb # Set parameters for parallelization n_jobs = 8 # Number of concurrent jobs chunk_mb = 2000 # Maximum amount of RAM in Mb ``` ## 1) Load short AP recording ``` base_path = Path("E:/Feldman/Neuropixels_Feldman/210209/SpikeGLX") session_name = "LR_210209_g0" ap_bin_path = base_path / session_name / f"{session_name}_imec0" / f"{session_name}_t0.imec0.ap.bin" nidq_file_path = base_path / session_name / f"{session_name}_t0.nidq.bin" trial_ongoing_channel = 3 event_channel = 4 nwbfile_path = f"E:/Feldman/rapid_testing_{session_name}_full_test.nwb" recording_ap = SpikeGLXRecordingExtractor(ap_bin_path) trial_numbers, _, trial_times = feldman_lab_to_nwb.utils.get_trials_info( recording_nidq=SpikeGLXRecordingExtractor(nidq_file_path), trial_ongoing_channel=trial_ongoing_channel, event_channel=event_channel ) if trial_numbers[0] != 0: recording_ap = clip_recording(trial_numbers=trial_numbers, trial_times=trial_times, recording=recording_ap) duration = recording_ap.get_num_frames() / recording_ap.get_sampling_frequency() fs = recording_ap.get_sampling_frequency() print(f"Duration: {np.round(duration, 1)} s") ``` # 2) Quick spike detection by channel ``` detect_spikes? t_start = time.time() sorting_ch = detect_spikes(recording=recording_ap, n_jobs=n_jobs, chunk_mb=chunk_mb, verbose=True) t_stop = time.time() print(f"Elapsed time for detection: {t_stop - t_start}") print(f"Detected spikes on {len(sorting_ch.get_unit_ids())} channels") wr = plot_rasters(sorting_ch) ``` ### (optional) Remove channels below a certain firing rate ``` firing_rate_threshold = 0.1 # Adjusts sensitivity. sorting_high_fr = threshold_firing_rates( sorting_ch, duration_in_frames=recording_ap.get_num_frames(), threshold=firing_rate_threshold, threshold_sign="less" ) print(f"Detected spikes on {len(sorting_high_fr.get_unit_ids())} channels with fr > {firing_rate_threshold}") ``` # 3) Save spike and behavior info to NWB ``` # Choose a sorting extractor by uncommenting one of these lines (either the basic detection or rate thresholded). chosen_sorting = sorting_ch #chosen_sorting = sorting_high_fr # Run conversion to NWB. source_data = dict(RapidTesting=dict(file_path=str(nidq_file_path))) converter = feldman_lab_to_nwb.RapidTestingNWBConverter(source_data=source_data) metadata = converter.get_metadata() metadata["NWBFile"].update(session_description="Rapid testing file for electrode placement.") metadata["Ecephys"]["Electrodes"] = [] conversion_options = dict( RapidTesting=dict( trial_ongoing_channel=trial_ongoing_channel, event_channel=event_channel ) ) converter.run_conversion( nwbfile_path=nwbfile_path, metadata=metadata, conversion_options=conversion_options, overwrite=True, # This always creates a new file. ) pprint("Appending spike detection...") NwbSortingExtractor.write_sorting( sorting=chosen_sorting, save_path=nwbfile_path, overwrite=False # This appends the file. True would write a new file. ) pprint("Spike detection appended!") ``` # 5) View output vs. behavior in NWBWidgets ``` io = NWBHDF5IO(nwbfile_path, mode="r") nwb = io.read() feldman_lab_to_nwb.rapid_testing_nwb2widget(nwb) io.close() ```
github_jupyter
# Astronomy 8824 - Numerical and Statistical Methods in Astrophysics ## Statistical Methods Topic I. High Level Backround These notes are for the course Astronomy 8824: Numerical and Statistical Methods in Astrophysics. It is based on notes from David Weinberg with modifications and additions by Paul Martini. David's original notes are available from his website: http://www.astronomy.ohio-state.edu/~dhw/A8824/index.html #### Background reading: - Statistics, Data Mining, and Machine Learning in Astronomy, Chapter 3 (see David's [Reader's Guide](http://www.astronomy.ohio-state.edu/~dhw/A8824/ivezic_guide.pdf)) ``` import math import numpy as np %matplotlib inline import matplotlib.pyplot as plt from scipy import optimize # matplotlib settings SMALL_SIZE = 14 MEDIUM_SIZE = 16 BIGGER_SIZE = 18 plt.rc('font', size=SMALL_SIZE) # controls default text sizes plt.rc('axes', titlesize=SMALL_SIZE) # fontsize of the axes title plt.rc('axes', labelsize=BIGGER_SIZE) # fontsize of the x and y labels plt.rc('lines', linewidth=2) plt.rc('axes', linewidth=2) plt.rc('xtick', labelsize=MEDIUM_SIZE) # fontsize of the tick labels plt.rc('ytick', labelsize=MEDIUM_SIZE) # fontsize of the tick labels plt.rc('legend', fontsize=MEDIUM_SIZE) # legend fontsize plt.rc('figure', titlesize=BIGGER_SIZE) # fontsize of the figure title ``` LaTex macros hidden here -- $\newcommand{\expect}[1]{{\left\langle #1 \right\rangle}}$ $\newcommand{\intinf}{\int_{-\infty}^{\infty}}$ $\newcommand{\xbar}{\overline{x}}$ ### Statistical Tasks in Astrophysics Four common statistical tasks: 1. Parameter estimation 2. Comparison of hypotheses 3. Absolute evaluation of a hypothesis 4. Forecasting of errors Another task, slightly less common: Prediction of values from a model fit to some set of data, when the parameters of the model are uncertain. ### Simple Example: Data points with error bars **Parameter estimation:** What are slope and amplitude of a power-law fit? What are the uncertainties in the parameters? When you fit a power-law model to data, you _assume_ that power-law description is valid. **Hypothesis comparison:** Is a double power-law better than a single power-law? Hypothesis comparisons are trickier when the number of parameters is different, since one must decide whether the fit to the data is _sufficiently_ better given the extra freedom in the more complex model. A simpler comparison would be single power-law vs. two constant plateaus with a break at a specified location, both with two parameters. **Absolute evaluation:** Are the data consistent with a power-law? Absolute assessments of this sort are generally much more problematic than hypothesis comparisons. **Forecasting of errors:** How many more measurements, or what reduction of uncertainties in the measurements, would allow single and double power-law models to be clearly distinguished? Need to specify goals, and assumptions about the data. This is a common need for observing proposals, grant proposals, satellite proposals etc. ### Complicated example: CMB power spectrum with errors. **Parameter estimation:** In a "vanilla" $\Lambda$CDM model, what are the best values of $\Omega_m$, $\Omega_b$, $h$, $n$, and $\tau$? One often wants to combine CMB with other data to break degeneracies and get better constraints. **Hypothesis comparisons:** Are data consistent with $\Omega_m=1$? Do they favor inclusion of space curvature, or gravity waves? This typically involves comparison of models with different numbers of parameters. **Absolute assessment:** Can the restricted, "vanilla" $\Lambda$CDM model be rejected? **Forecasting:** What constraints or tests could be achieved with a new experiment? This kind of analysis played a key role in the design and approval of WMAP, Planck, DESI, and other major cosmological surveys. There is presently a lot of work along these lines for future cosmological surveys and CMB experiments. ### PDF, Mean, and Variance If $p(x)$ is the **probability distribution function** (pdf) of a **random variable** $x$, then $p(x) dx$ is the probability that $x$ lies in a small interval $dx$. The **expectation value** of a random variable $x$ is $\expect{x} = \intinf xp(x)dx = \mu$. The expectation value of $x$ is equal to the (arithmetic) mean. It is sometimes also written $\mu = E(x)$. The expectation value of a function $y(x)$ is $\expect{y(x)} = \intinf y(x) p(x) dx.$ The variance is $V(x)=\expect{(x-\mu)^2} \equiv \sigma^2$. The standard deviation is $\sigma = \sqrt{\sigma^2}$. This is also called the dispersion. #### Useful variance relation $$ V(x)=\expect{(x-\mu)^2} = \int (x - \mu)^2 p(x) dx $$ $$ = \int (x^2 - 2\mu x + \mu^2) p(x) dx = \int x^2 p(x) dx - 2 \mu \int x p(x) dx + \mu^2 \int p(x) dx $$ $$ = \expect{x^2} - 2 \expect{x}^2 + \expect{x}^2 $$ This reduces to the useful result that $V(x) = \expect{x^2} - \expect{x}^2$. #### Sum of the variances For _independent_ random variables $y_1$, $y_2$, ... $y_N$ (drawn from the same distribution or different distributions), the variance of the sum is the sum of the variances: $$ V(y_1+y_2+...y_N) = \sum_{i=1,N} V(y_i). $$ This can be proved by induction. If random variables $x$ and $y$ are independent, then $p(x,y) = p(x)p(y)$ and $$ {\rm Cov}(x,y) \equiv \expect{(x-\mu_x)(y-\mu_y)}=0. $$ The second statement can be proved from the first. #### Demonstration $$ Var(y_1 + y_2) = \expect{(y_1 + y_2)^2} - \expect{y_1+y_2}^2 $$ $$ = \expect{y_1^2 + 2 y_1 y_2 + y_2^2} - \expect{y_1+y_2}^2 $$ Then looking at just the first term: $$ \expect{y_1^2 + 2 y_1 y_2 + y_2^2} = \int y_1^2 p(y_1) p(y_2) dy_1 dy_2 + 2 \int y_1 y_2 p(y_1) p(y_2) dy_1 dy_2 + \int y_2^2 p(y_1) p(y_2) dy_1 dy_2\int $$ Note that the integral \int p(y_1) dy_1 = 1 by definition, so we can simplify the above to: $$ = \expect{y_1^2} + 2 \expect{y_1 y_2} + \expect{y_2^2} $$ Now looking at the second term: $$ \expect{y_1+y_2}^2 = \left[ \int (y_1 + y_2) p(y_1) p(y_2) dy_1 dy_2 \right]^2 $$ $$ = \expect{y_1}^2 + 2 \expect{y_1} \expect{y_2} + \expect{y_2}^2 $$ Now combining these two: $$ Var(y_1 + y_2) = \expect{y_1^2} + 2 \expect{y_1 y_2} + \expect{y_2^2} - \expect{y_1}^2 - 2 \expect{y_1} \expect{y_2} - \expect{y_2}^2 $$ $$ = \expect{y_1^2} + \expect{y_2^2} - \expect{y_1}^2 - \expect{y_2}^2 $$ Which is equivalent to: $$ Var(y_1 + y_2) = Var(y_1) + Var(y_2) $$ #### Linearity of Expectation This is often invoked more generally as a statement about the _Linearity of Expectation_. $$ \expect{x + y} = \int (x + y) p(x) p(y) dx dy = \int x p(x) p(y) dx dy + \int y p(x) p(y) dx dy = \expect{x} + \expect{y} $$ ### Covariance Covariance is a measure of the _joint probability_ of 2 random variables. It describes how they change together. It is commonly written as: $$ Cov(y_1, y_2) = \expect{ (y_1 - \expect{y_1} ) (y_2 - \expect{y_2}) } = \expect{ (y_1 - \mu_1) (y_2 - \mu_2) } $$ This can also be written as: $$ Cov(y_1, y_2) = \expect{y_1 y_2 - \expect{y_1} y_2 - y_1 \expect{y_2} + \expect{y_1} \expect{y_2} } $$ using the linearity of expectation $$ = \expect{y_1 y_2} - \expect{y_1}\expect{y_2} - \expect{y_1}\expect{y_2} + \expect{y_1} \expect{y_2} $$ or $$ Cov(y_1, y_2) = \expect{y_1 y_2} - \expect{y_1} \expect{y_2} $$ Note that if $y_1$ and $y_2$ are independent variables, $$ \expect{y_1 y_2} = \int y_1 y_2 p(y_1) p(y_2) dy_1 dy_2 = \int y_1 p(y_1) dy_1 \int y_2 p(y_2) dy_2 = \expect{y_1} \expect{y_2} $$ and therefore $Cov(y_1, y_2) = 0$. ``` ### Covariance Example np.random.seed(1216) sig_x = 2 sig_y = 1 sig_xy = 0 mean = np.array([0, 0], dtype=float) cov = np.array( [[sig_x, sig_xy], [sig_xy, sig_y]], dtype=float) x = np.random.multivariate_normal(mean, cov, size=1000) fig, axarr = plt.subplots(1, 2, figsize=(14,7)) axarr[0].plot(x.T[0], x.T[1], 'k.') axarr[0].set_xlabel(r"$x_1$") axarr[0].set_ylabel(r"$x_2$") axarr[0].set_xlim(-5, 5) axarr[0].set_ylim(-5, 5) axarr[0].text(-4, 4, r"$\sigma_{xy} = 0.0$") sig_x = 2 sig_y = 1 sig_xy = 0.5 mean = np.array([0, 0], dtype=float) cov = np.array( [[sig_x, sig_xy], [sig_xy, sig_y]], dtype=float) x = np.random.multivariate_normal(mean, cov, size=1000) axarr[1].plot(x.T[0], x.T[1], 'k.') axarr[1].set_xlim(-5, 5) axarr[1].set_ylim(-5, 5) axarr[1].plot( [x[0], x[-1]], [0, 0], 'k:') axarr[1].set_xlabel("$x_1$") axarr[1].text(-4, 4, r"$\sigma_{xy} = 0.5$") ``` ### Estimators An estimator is a mathematical function of data that estimates a quantity of interest. An important distinction to keep in mind for data is the distinction between "population statistics" (the underlying distribution) and "sample statistics" (the measurements of the population). Ideally one wants an estimator to be - _unbiased_ -- even with a small amount of data, the expectation value of estimator is equal to the quantity being estimated - _efficient_ -- makes good use of the data, giving a low variance about the true value of the quantity - _robust_ -- isn't easily thrown off by data that violate your assumptions about the pdf, e.g., by non-Gaussian tails of the error distribution - _consistent_ -- in the limit of lots of data, it converges to the true value These four desiderata sometimes pull in different directions. Suppose we have $N$ independent data points (the sample) drawn from an unknown distribution $p(x)$ (the population). #### The mean estimator The obvious estimator for the mean of the distribution is the sample mean, $\xbar={1\over N}\sum x_i$. The expectation value for the sample mean is: $$ \expect{\xbar} = \expect{\frac{1}{N} \sum x_i} = \frac{1}{N} \sum \expect{x_i} = \mu. $$ Thus, the sample mean is an _unbiased_ estimator of $\mu$. #### Variance of the mean estimator The variance of this estimator is $$ \expect{(\xbar-\mu)^2} = V\left(\frac{1}{N} \sum x_i\right) = {1 \over N^2} V\left(\sum x_i\right) = {1 \over N^2} \sum V(x_i) = {1 \over N^2} \times N\sigma^2 = {\sigma^2 \over N}, $$ where $\sigma^2$ is the variance of the underlying distribution. We have used the fact that $\expect{\xbar}=\mu$, and we have used the assumed independence of the $x_i$ to go from the variance of a sum to a sum of variances. #### Other mean estimators An alternative estimator for the mean is the value of the third sample member, $x_3$. Since $\expect{x_3} = \mu$, this estimator is unbiased, but $V(x_3) = \sigma^2$, so this estimate is noisier than the sample mean by $\sqrt{N}$. A more reasonable estimator is the sample _median_, though this is a biased estimator if $p(x)$ is asymmetric about the mean. If $p(x)$ is Gaussian, then the variance of the sample median is ${\pi \over 2}{\sigma^2 \over N}$, so it is a less _efficient_ estimator than the sample mean. However, if $p(x)$ has long non-Gaussian tails, then the median may be a much _more_ efficient estimator of the true mean(i.e., giving a more accurate answer for a fixed number of data points), since it is not sensitive to rare large or small values. Estimators that are insensitive to the extremes of a distribution are often called _robust_ estimators. #### Variance estimator The obvious estimator for the variance of the distribution is the sample variance $$ s^2 = \frac{1}{N} \sum (x_i-\xbar)^2 = \frac{1}{N} \sum x_i^2 - \xbar^2. $$ However, a short derivation shows that the sample variance is biased low: $$ \expect{s^2} = {N-1 \over N}\sigma^2, $$ This is because we had to use the sample mean rather than the true mean, which on average drives down the variance. An unbiased estimator is therefore $$ \hat{\sigma}^2 = {1\over N-1} \sum (x_i-\xbar)^2. $$ If you compute the mean of a sample, or of data values in a bin, the estimated _standard deviation of the mean_ is $$ \hat{\sigma}_\mu = \left[{1 \over N(N-1)}\sum (x_i-\xbar)^2\right]^{1/2}. $$ Note that this is smaller by $N^{-1/2}$ than the estimate of the dispersion within the bin. You should always be clear which quantity (dispersion or standard deviation of the mean) you are plotting. If $p(x)$ is Gaussian, then the distribution of $\xbar/\sigma$ is a Gaussian of width $N^{-1/2}$. However, the distribution of $\xbar/\hat{\sigma}$ is broader (a Student's $t$ distribution). ### Snap-judging Error Bars What is wrong with this plot? ``` Npts = 20 x = np.linspace(0, 5, Npts) m = 2 b = 3 y = m*x + b sig_y = np.random.normal(0, 1, Npts) fx = y + sig_y err_y = 3*np.ones(len(x)) # + 2.*np.ones(len(x)) plt.figure(figsize=(10,5)) plt.errorbar(x, fx, yerr=err_y, fmt='bo', capsize=4, label="Data") plt.plot(x, y, 'k:', label="Relation") plt.ylabel("Y") plt.xlabel("X") plt.legend(loc='upper left') ``` ### Bayesian vs. Frequentist Statistics Suppose we have measured the mean mass of a sample of G stars, by some method, and say: at the 68\% confidence level the mean mass of G stars is $a \pm b$. What does this statement mean? Bayesian answer: There is some true mean mass $\alpha$ of G stars, and there is a 68\% probability that $a-b \leq \alpha \leq a+b$. More pedantically: The hypothesis that the true mean mass $\alpha$ of G stars lies in the range $a-b$ to $a+b$ has a 68\% probability of being true. The **probability of the hypothesis is a real-numbered expression of the degree of belief we should have in the hypothesis**, and it obeys the axioms of probability theory. In "classical" or "frequentist" statistics, a probability is a statement about the frequency of outcomes in many repeated trials. With this restricted definition, **one can't refer to the probability of a hypothesis -- it is either true or false**. One can refer to the probability of data if a hypothesis is true, where probability means the fraction of time the data would have come out the way it did in many repeated trials. Frequentist answer: The statement means something like: if $\alpha = a$, we would have expected to obtain a sample mean in the range $a\pm b$ 68\% of the time. ##### This is the fundamental conceptual difference between Bayesian and frequentist statistics. **Bayesian:** Evaluate the probability of a hypothesis in light of data (and prior information). Parameter values or probability of truth of a hypothesis are random variables, _data are not_ (though they are drawn from a pdf). **Frequentist:** Evaluate the probability of obtaining the data --- more precisely, the fraction of times a given _statistic_ (such as the sample mean) applied to the data would come out the way it did in many repeated trials --- given the hypothesis, or parameter values. A probability is a statement about the frequency of outcomes in many repeated trials. Data are random variables, parameter values or truth of hypotheses are not. #### Summary of the differences | Bayesian | Frequentist | | :-: | :-: | | Evaluate the probability of a hypothesis, given the data | Evaluate the probability of obtaining the data | | Parameters and probability of truth are random variables | Data are random variables | | Data are not random variables | Parameters and probability of truth are not random variables | | Need to specify alternatives to evaluate hypotheses | Statistical tests implicitly account for alternatives | David's opinion: The Bayesian formulation corresponds better to the way scientists actually think about probability, hypotheses, and data. It provides a better conceptual basis for figuring out what to do in a case where a standard recipe does not neatly apply. But frequentist methods sometimes seem easier to apply, and they clearly capture _some_ of our intuition about probability. Bottom line: One should be a Bayesian in principle, but maybe not always in practice. ### Probability Axioms and Bayes' Theorem Probabilities are real numbers $0 \leq p \leq 1$ obeying the axioms $$ p(A|C) + p(\overline{A}|C) = 1. $$ $$ p(AB|C) = p(A|BC)P(B|C) $$ $\overline{A}$ means "not $A$" $AB$ means "$A$ and $B$" and is thus equivalent to $BA$. From this equivalence we see that $$ p(AB|C) = p(A|BC)p(B|C)=p(BA|C)=p(B|AC)p(A|C). $$ From the 2nd and 4th entries above, we arrive at **Bayes' Theorem** $$ p(A|BC) = p(A|C) {p(B|AC) \over p(B|C)}. $$ ### Bayesian Inference In application to scientific inference, this theorem is usually written $$ p(H|DI) = p(H|I) {p(D|HI) \over p(D|I)}, $$ where $H$ = hypothesis, which might be a statement about a parameter value, e.g., the population mean lies in the range $x \rightarrow x+dx$. $D$ = data $I$ = background information, which may be minimally informative or highly informative. $p(H|I)$ = **prior probability**, i.e., before data are considered $p(D|HI)$ = **likelihood** of data given $H$ and $I$ $p(D|I)$ = **global likelihood** $p(H|DI)$ = **posterior probability**, the probability of the hypothesis after consideration of the data Bayes' Theorem tells us how to update our estimate of the probability of a hypothesis in light of new data. It can be applied sequentially, with the posterior probability from one experiment becoming the prior for the next, as more data become available. Calculation of likelihood $P(D|HI)$ is sometimes straightforward, sometimes difficult. The background information $I$ may specify assumptions like a Gaussian error distribution, independence of data points. Important aspect of Bayesian approach: only the actual data enter, not hypothetical data that could have been taken. _All the evidence of the data is contained in the likelihood._ ### Global Likelihood and Absolute Assessment The global likelihood of the data, $P(D|I)$ is the sum (or integral) over "all" hypotheses. This can be a slippery concept. Often $P(D|I)$ doesn't matter: in comparing hypotheses or parameter values, it cancels out. When needed, it can often be found by requiring that $p(H|DI)$ integrate (or sum) to one, as it must if it is a true probability. The Bayesian approach forces specification of alternatives to evaluate hypotheses. Frequentist assessment tends to do this implicitly via the choice of statistical test. ### Criticism of Bayesian approach The incorporation of priors makes Bayesian methods seem subjective, and it is the main source of criticism of the Bayesian approach. If the data are compelling and the prior is broad, then the prior doesn't have much effect on the posterior. But if the data are weak, or the prior is narrow, then it can have a big effect. Sometimes there are well defined ways of assigning an "uninformative" prior, but sometimes there is genuine ambiguity. Bayesian methods sometimes seem like a lot of work to get to a straightforward answer. In particular, we sometimes want to carry out an "absolute" hypothesis test without having to enumerate all alternative hypotheses. ### Criticism of frequentist approach The frequentist approach doesn't correspond as well to scientific intuition. We want to talk about the probability of hypotheses or parameter values. The choice of which statistical test to apply is often arbitrary. There is not a clear way to go from the result of a test to an actual scientific inference about parameter values or validity of a hypothesis. Bayesians argue (and I agree) that frequentist methods obtain the appearance of objectivity only by sweeping priors under the rug, making assumptions implicit rather than explicit. Frequentist approach relies on hypothetical data as well as actual data obtained. Choice of hypothetical data sets is often ambiguous, e.g., in the "stopping" problem. Sometimes we _do_ have good prior information. It is straightforward to incorporate this in a Bayesian approach, while it is not in the frequentist approach. Frequentist methods are poorly equipped to handle "nuisance parameters," which in the Bayesian approach are easily handled by marginalization. For example, the marginal distribution of a parameter $x$ $$ p(x) = \int p(x|a,b,c) da\,db\,dc $$ can only exist if $x$ is a random variable.
github_jupyter
# <p style="text-align: center;"> Self Driving Car in OpenAI Gym using Imitation Learning and Reinforcement Learning</p> ![title](https://miro.medium.com/max/1575/1*IQfXahuDuh0pgVE5fMpiFQ.gif ) # <p style="text-align: center;"> 1.0 Abstract </p> <a id='abstract'></a> We all know self-driving cars is one of the hottest areas of research and business for the tech giants. What seemed like a science-fiction, a few years ago, now seems more like something which is soon to become a part and parcel of life. The reason, I am saying “soon to be” is because of the fact that even though companies like Tesla, Nissan, Cadillac do have self-driving car assistance software, but, they still require a human to keep an eye on the road and take control when needed. However, it is fascinating to see how far we have come in terms of innovation and how fast technology is advancing. So much so, that now, with the help of basic deep learning, neural network magic, we can build our own pipeline for autonomous driving. Our idea to try and build our very own self driving car emerged from here. In order to understand the basics of the process , we did this project in two parts. - Self Driving Car using Supervised Learning - Self Driving Car using Reinforcement Learning **PS- To make you understand the structure for the same, We have done this project in 3 parts, and all 3 parts are divided into seperate notebooks. And these individual notebooks contain the whole code and documentation of the entire part. ### Readme Structure ### 1. Basics of CNN :- The main agenda of this notebook is as follow:- > - To understand the convolution operation > - To understand the pooling operation > - Remembering the vocabulary used in convolutional neural networks (padding, stride, filter, etc.) > - Building a convolutional neural network for multi-class classification in images >- Basics of Imitation Learning This notebook includes the basics of convolutional operations and whole network in general. This was a very integral part of our project and will serve as a guide for any beginner trying to understand CNN . ### 2. Self Driving Car using Supervised Learning :- In this notebook ,we applied a supervised learning algorithm (convolution networks), to control the direction of a car in a 2D simulation. The notebook captures the following:- > - How a convolution network works? > - How to create the dataset and use it for training our network > - How to use gym to retrieve the output of our neural network in order to control the simulation. The general idea that we used is that of the supervised classifier. We are going to train a convolutional neural network to classify images in the game, according to three labels: left, right and straight ahead. We will then convert these commands into instructions for the simulator, which will execute them. ### 3. Basics of Deep Q-Learning:- The main agenda of this notebook is as follow:- > - Q-Learning > - Why ‘Deep’ Q-Learning? > -Introduction to Deep Q-Learning > - Challenges of Deep Reinforcement Learning as compared to Deep Learning > - Experience Replay > - Target Network This notebook includes the basics of deep q learning. This was a very integral part of our project and will serve as a guide for any beginner trying to understand Q-Learning . ### 4. Self Driving Car using Reinforcement Learning :- In this notebook, a python based car racing environment is trained using a deep reinforcement learning algorithm to perform efficient self driving on a racing track. The notebook captures the following. > - Development of a deep Q learning algorithm which is then used to train an autonomous driver agent. > - Different configurations in the deep Q learning algorithm parameters and in the neural network architecture are then tested and compared in order to obtain the best racing car average score over a period of 100 races. This score is given by the gym environment and can be seen on the bottom left corner. According to OpenAI Gym, this environment is considered solved when the agent successfully reaches an average score of 900 on the last 100 runs. In this project, this goal was surpassed having obtained an average score of 905 over the last 100 runs. Therefore, we successfully solved the environment. # <p style="text-align: center;"> Index </p> - # 1 [Abstract](#abstract) - # 2 [Basics of CNN](./Umbrella_Academy_INFO7390_Project/INFO7390_Notebooks/Basics_of_Convolutional_Neural_Network.ipynb) - # 3 [Self Driving Car using Supervised Learning](./Umbrella_Academy_INFO7390_Project/INFO7390_Notebooks/Self_Driving_Car_Imitation_Learning.ipynb) - # 4 [Basics of Deep Q learning](./Umbrella_Academy_INFO7390_Project/INFO7390_Notebooks/Basics_of_Deep_Q_Learning.ipynb) - # 5 [Self Driving Car using Reinforcement Learning](./Umbrella_Academy_INFO7390_Project/INFO7390_Notebooks/RL_Self_Driving_Car.ipynb) - # 6 [Conclusion](#Conclusion) ![](https://i.ytimg.com/vi/oCVkiLBZb24/maxresdefault.jpg) # Setting up the Environment <a id='Environment'></a> Before we start with the setup of our environment, we need to install a few pakages which will make our game and neural network work. ### 1) Gym facility Install OpenAI Gym on the machine Follow the instructions at https://github.com/openai/gym#installation for extensive and deep guide. **Summary of instructions:** - Install Python 3.5+ - Clone the gym repo: git clone https://github.com/openai/gym.git - cd gym - Gym installation, with the box2d environments: pip install -e '.[box2d]' Follow the following steps to play the Car Racing Game - cd gym/envs/box2d - python car_racing.py ### 2) Pytorch Pytorch is the deep learning framework that we will be using. It makes it possible to build neural networks very simply. Follow the instructions on http://pytorch.org/ for a deep guide. **Summary of instructions:** - Install Python 3.5+ - It is recommended to manage PyTorch with Anaconda. Please install Anaconda - Install PyTorch following instructions at https://pytorch.org/get-started/locally/ ![title](images_main_notebook\Pytorch_Installation.png) For example this is the setup for my Computer > pip install torch==1.7.0+cpu torchvision==0.8.1+cpu torchaudio===0.7.0 -f https://download.pytorch.org/whl/torch_stable.html ## The Environment For this tutorial, we will use the gym library developed by OpenAI. It provides environments (simple games) to develop reinforcement learning algorithms. The environment we will be using is CarRacing-v0 ( https://gym.openai.com/envs/CarRacing-v0/ ). It is about driving a car on a circuit, the objective being to move forward while staying on the track, which contains many turns. The input to the algorithm (the state provided by the environment) is only the image displayed by the environment: we see the car, and the terrain around it. ![title](images_main_notebook\car-racing.png) The idea is to drive the car by analyzing this image. We are going to use this library in a roundabout way: It is designed for reinforcement learning. The objective is in principle to use the rewards (rewards) provided by the environment to learn the optimal strategy without user action. Here we will not be using these rewards. In addition, we will be doing end-to-end learning , which means that the neural network will directly give us the commands to navigate the car. This is not a road detection module, which will then be analyzed by another program (most true autonomous driving systems are made this way). Here, the neural network takes the field matrix as input, and issues a command to be executed (turn left, turn right, continue straight ahead), without any intermediate program. To use the environment, you need to import it like this: >import gym >env = gym.make('CarRacing-v0').env You can then access several useful functions: - **env.reset() :** Allows you to restart the environment - **env.step(action) :** Allows you to perform the action `action`. This function returns a tuple `state`, `reward`, `done`, `info` containing the state of the game after the action, the reward obtained, doneindicates if the game is finished, and infocontains debug data. - **env.render() :** Displays the game window. Here, the state `state` that will be returned by env.step(action)is the image displayed on the screen (the pixel matrix). It is this data that we will use to steer our car. # <p style="text-align: center;"> Conclusion<p><a id='Conclusion'></a> #### 1. Video Simulation of self driving car by supervised learning (Imitation Learning) :- <video controls src="main_videos/IL_Result.mp4" width="500" height="340"/> #### 2. Video Simulation of self driving car by Reinforcement learning (Deep Q Learning) :- <video controls src="main_videos/RL_SelfDriving.mp4" height="340"/> 3. Our network recognizes the shapes to keep the car on the desired path. It's a sort of classifier that just indicates whether the car is in the right position, too far to the right or too far to the left. We then send this command to the simulator. All of this is done in real time. > Behavioural Cloning though has a few disadvantages, and we can see them here in this notebook. - We need to manually accelerate and decelerate, and we can only accelerate till a certain limit, because beyond that, the car will spin out of control and go outside in the patch of grass. - Since while training we never leave the track, the car has no way of coming back to the road after it has left the track and is into the grass. - Here we only have a train set of 3000 and validation set of 600, but we tried increasing the sizes of these by a magintude of 10 (30,000 and 6000), but because of the substantial increase in the size of the dataset, the error while generating the dataset also shot up, which turned out to be a very bad dataset for out neural net. - Also, because we were well within the tracks, the car has no data on cases in which it goes out by accident. - A possible remedy for this is preprocessing the data in such a way that the dataset has images of car coming in, but not going out. For seeing how this works refer to :- [Self Driving Car using Supervised Learning](./Umbrella_Academy_INFO7390_Project/INFO7390_Notebooks/Self_Driving_Car_Imitation_Learning.ipynb) # <p style="text-align: center;"> Contribution<p><a id='Contribution'></a> - Code by self : 75% - Code from external Sources : 25% # <p style="text-align: center;"> License<p><a id='License'></a> Copyright (c) 2020 Rushabh Nisher, Manali Sharma Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
github_jupyter
# DC 2019- ُSuccessful Business Start **Your Name:** Amin Aria # Small buisinesses success ``` %matplotlib inline import numpy as np import pandas as pd import matplotlib.pyplot as plt import sklearn DC19 = pd.read_csv('..\sbdc_data_merged.csv') # Show the first 5 rows of data, just to demostrate it has loaded DC19.head() DC19['Impact: Started Business'].value_counts(normalize = True) DC19[['Attended Group Training?','Impact: Started Business']][DC19['Attended Group Training?']=='Yes'].groupby(['Impact: Started Business']).size() #DC19['Total Counseling Time, hrs'][(DC19['Impact: Started Business'] == 'Yes')] DC19[DC19['Total Counseling Time, hrs'] < 40].boxplot(column = 'Total Counseling Time, hrs', by ='Impact: Started Business',grid = False ) DC19[['Impact: Capital Investments','Impact: Started Business']].groupby(['Impact: Started Business'])\ .median() #.agg(np.std,ddof=0) #####------GroupBy Statistics-----##### #fig, ax = plt.subplots(figsize=(15,7)) # (DC19['Impact: Capital Investments']<400000) ].\ A= DC19[(DC19['Impact: Started Business'] != 'Not applicable: Already in Business')] \ .groupby(['Industry Title','Impact: Started Business'], sort = True).size() \ .transform(lambda x: x/sum(x)) .unstack() #A['Industry Title']=A.index #plt.bar(A.index,A['Yes'],width = 0.3 ) A #.unstack().plot(ax=ax,ylim=((0,0.02))) ####------Started Business Analysis-----##### DC19start= DC19[DC19['Impact: Started Business']== 'Yes'] DC19start.shape #####-----Correlation Box-----###### #####-----Correlation Box-----###### import seaborn as sns #DC19start.corr() #sns.pairplot(DC19start) #sns.heatmap(DC19['County'],DC19['Service Center']) dc19r=DC19[['County', 'Initial Services Sought at First Visit', 'Attended Group Training?', 'Total Counseling Time, hrs', 'Business Status', 'Impact: Capital Investments', 'Impact: Created New Jobs', 'Impact: Revenue Increase','Company\'s Gross Revenue, $', 'Industry Title', 'Ownership Gender', 'Owner\'s Race','Owner\'s Hispanic Origin']].copy() ####-----Handling categorical variables-----#### dc19rc=pd.get_dummies(dc19r, prefix=None, prefix_sep='_') dc19rc.shape ``` # Classification Methods ``` ####---- Data Pre-processing ----##### from sklearn.preprocessing import LabelEncoder, OneHotEncoder le=LabelEncoder() le.fit(DC19['Impact: Started Business']) y=le.transform(DC19['Impact: Started Business']\ [DC19['Impact: Started Business'] != 'Not applicable: Already in Business']) X= dc19rc[DC19['Impact: Started Business'] != 'Not applicable: Already in Business'] #size of training and cross-validation set tset=int(0.8*X.shape[0]) ##NEW Definition of Success including a positive Revenue Increase ynew= (X['Impact: Revenue Increase']>0) & (y==2) ###----Input data for Impact excluded Analysis----### dc19rno=DC19[['County', 'Initial Services Sought at First Visit', 'Attended Group Training?', 'Total Counseling Time, hrs', 'Business Status','Company\'s Gross Revenue, $', 'Industry Title', 'Ownership Gender', 'Owner\'s Race','Owner\'s Hispanic Origin']].copy() dc19rcno=pd.get_dummies(dc19rno, prefix=None, prefix_sep='_') Xnoim= dc19rcno[DC19['Impact: Started Business'] != 'Not applicable: Already in Business'] Xnoim.head() ``` # Multinomial Logistic Regression ``` ####------Multinomial logistic Regression------##### from sklearn.linear_model import LogisticRegressionCV clf = LogisticRegressionCV(cv=5, random_state=0,multi_class='multinomial').fit(Xnoim.head(tset), y[0:tset]) #for the new definition of success #.fit(X,ynew) total=clf.predict(Xnoim) from sklearn.metrics import confusion_matrix sns.heatmap(confusion_matrix(y, total)) ###----Out of Sample Performance----#### logstart=clf.predict(Xnoim.tail(X.shape[0]-tset)) confusion_matrix(y[tset:X.shape[0]], logstart) #fig, ax = plt.subplots(figsize=(15,7)) #plt.scatter(y[tset:X.shape[0]], logstart) ####----Probabilistic Prediction-----####### logp=clf.predict_proba(Xnoim.tail(100)) ppre = pd.DataFrame(logp[:,1]) ppre=pd.concat([pd.DataFrame(y[(X.shape[0]-100):X.shape[0]]),ppre],axis=1) ppre.columns=['Real','Probability'] ppre['Real']= ppre['Real']/2 plt.hist(ppre['Probability'][ppre['Real']==1.0],20,alpha=0.5, facecolor = 'g',label='Predicted Probability of Success',normed=True) #ppre ``` # Random Forrest ``` ###1-----Random Forrest ----1##### from sklearn.ensemble import RandomForestClassifier clf3 = RandomForestClassifier(n_estimators=100, max_depth=2, random_state=0) clf3.fit(X.head(tset), y[0:tset]) RandomForestClassifier(bootstrap=True, class_weight=None, criterion='entropy', max_depth=2, max_features='auto', max_leaf_nodes=None, min_impurity_split=None, min_samples_leaf=1, min_samples_split=2, min_weight_fraction_leaf=0.0, n_estimators=100, n_jobs=None, oob_score=False, random_state=0, verbose=0, warm_start=False) total3=clf3.predict(X) confusion_matrix(y, total3) ###----Out of Sample Performance----#### logstart3=clf3.predict(X.tail(X.shape[0]-tset)) confusion_matrix(y[tset:X.shape[0]], logstart3) ``` # SVM ``` ###1-----Support Vector Machine ----1##### from sklearn.svm import SVC clf2 = SVC(gamma='auto') clf2.fit(X.head(tset), y[0:tset]) SVC(C=1.0, cache_size=200, class_weight=None, coef0=0.0, decision_function_shape='ovr', degree=3, gamma='auto', kernel='rbf', max_iter=-1, probability=False, random_state=None, shrinking=True, tol=0.001, verbose=False) total2=clf2.predict(X) confusion_matrix(y, total2) ###----Out of Sample Performance----#### logstart2=clf2.predict(X.tail(X.shape[0]-tset)) confusion_matrix(y[tset:X.shape[0]], logstart2) ``` # Feature Selection (Most Important Ones) ``` #####----- Univariate Selection-------#### # Feature Extraction with Univariate Statistical Tests (Chi-squared for classification) from sklearn.feature_selection import SelectKBest from sklearn.feature_selection import chi2 # load data # feature extraction test = SelectKBest(score_func=chi2, k=4) ###=------Scaling Data from sklearn.preprocessing import MinMaxScaler scaler = MinMaxScaler() scaler.fit(Xnoim) Xtrans=scaler.transform(Xnoim) fit = test.fit(Xtrans, y) # summarize scores np.set_printoptions(precision=3) Best_Features = pd.DataFrame(fit.scores_) Best_Features=pd.concat([pd.DataFrame(Xnoim.columns),Best_Features],axis=1) Best_Features.columns=['feature','score'] Best_Features=Best_Features.sort_values(by=['score'],ascending= False) #print(fit.scores_) #features = fit.transform(X) # summarize selected features print(Best_Features[0:10]) ``` # Regression for Prediction of Increased Revenue It is likely that regression analysis provide more accuracy on industry-wise data ``` DC19PST=DC19[DC19['Industry Title']=='Professional, Scientific, and Technical Services'] DC19PST=pd.DataFrame(DC19PST) sns.pairplot(DC19PST._get_numeric_data()) #DC19['Industry Title'].groupby from sklearn import linear_model #lm = linear_model.LinearRegression() #model = lm.fit(X_train, y_train) #'Not applicable: Already in Business' Xri = DC19PST[(DC19PST['Impact: Started Business'] =='Not applicable: Already in Business')\ & (DC19PST['Impact: Revenue Increase'] < 250000 ) ] #Xri = Xri[['County', 'Initial Services Sought at First Visit', # 'Attended Group Training?', 'Impact: Created New Jobs','Total Counseling Time, hrs', # 'Business Status', 'Company\'s Total employees', # 'Company\'s Gross Revenue, $', 'Ownership Gender', 'Owner\'s Race', 'Industry Title']] Xri=pd.get_dummies(Xri, prefix=None, prefix_sep='_') yri = DC19PST['Impact: Revenue Increase']\ [(DC19PST['Impact: Started Business'] == 'Not applicable: Already in Business')\ & (DC19PST['Impact: Revenue Increase'] < 250000 )] yci = DC19PST['Impact: Capital Investments']\ [DC19PST['Impact: Started Business'] == 'Not applicable: Already in Business'] scaler.fit(Xri) Xritr=scaler.transform(Xri) Xritr=pd.DataFrame(Xritr) Xritr.columns=Xri.columns #training and testing set tset2=int(0.7*Xri.shape[0]) #Xritr = SelectKBest(chi2, k=2).fit_transform(Xritr, yri) lm = linear_model.RidgeCV(alphas=(0.1,1,10)) model = lm.fit(Xritr.head(tset), yri[0:tset]) #y_pred = lm.predict(X_test) #print(y_pred) print(lm.score(Xritr.head(tset2), yri[0:tset2])) print(lm.score(Xritr.tail(Xri.shape[0]-tset2),yri[tset2:Xritr.shape[0]])) print("\n") y_pred = lm.predict(Xritr.tail(Xri.shape[0]-tset2)) plt.scatter(y_pred,yri[tset2:Xritr.shape[0]],s=50) plt.xlabel="Predicted increase in Revenue" plt.ylabel ='Real increase in Revenue' plt.show() DC19PST.columns ```
github_jupyter
# Earthquakes In this notebook we'll try and model the intensity of earthquakes, basically replicating one of the examples in [this](http://user.it.uu.se/~thosc112/dahlin2014-lic.pdf) paper. To that end, let's first grab the data we need from USGS. We then filter the data to only include earthquakes of a magnitude 7.0, on the Richter scale, or higher. ``` from requests import get from datetime import datetime from json import loads import pandas as pd url = url = "https://earthquake.usgs.gov/fdsnws/event/1/query.geojson?minsig=600" resp = get(url, params={"starttime": datetime(1900, 1, 1), "endtime": datetime(2021, 1, 1)}) json = resp.json() data = pd.DataFrame.from_dict((i["properties"] for i in json["features"]), orient="columns") data.set_index("time", inplace=True) data.index = pd.to_datetime(data.index, unit="ms") data = data.where(data["mag"] >= 7.0).sort_index() by_year = data.groupby(data.index.year)["mag"].count() by_year.plot(figsize=(16, 9), color="gray") ``` Next, we'll setup the model for the data. We'll use the same one as Dahlin uses, i.e. \begin{cases} d \log {\lambda_t} = \kappa (\mu - \log{\lambda_t})dt + \sigma dW_t, \\ Y_t \sim \mathcal{P} \left ( \lambda_t \right), \end{cases} where $\mathcal{P(x)}$ denotes a Poisson distribution with rate $x$. ``` from pyfilter.timeseries import models as m, GeneralObservable, StateSpaceModel from pyfilter.distributions import Prior from torch.distributions import Poisson, Normal, Exponential, LogNormal import torch class EarthquakeObservable(GeneralObservable): def build_density(self, x): return Poisson(rate=x.values.exp(), validate_args=False) priors = Prior(Exponential, rate=5.0), Prior(Normal, loc=0.0, scale=1.0), Prior(LogNormal, loc=0.0, scale=1.0) initial_state_mean = Prior(Normal, loc=0.0, scale=1.0) latent = m.OrnsteinUhlenbeck(*priors, initial_state_mean=initial_state_mean, dt=1.0, ndim=1) obs = EarthquakeObservable(torch.Size([]), ()) ssm = StateSpaceModel(latent, obs) ``` Next, we'll perform the inference. For this model we'll use PMMH together with a gradient based proposal, corresponding to PMH1 of the dissertation referenced earlier. ``` from pyfilter.inference.batch.mcmc import PMMH, proposals as p from pyfilter.filters.particle import APF as_tensor = torch.from_numpy(by_year.values).int() filt = APF(ssm, 500, record_states=True) alg = PMMH(filt, 3000, num_chains=6, proposal=p.GradientBasedProposal(scale=5e-2)).cuda() state = alg.fit(as_tensor.cuda()) ``` Plot one smoothed realization. ``` import matplotlib.pyplot as plt fig, ax = plt.subplots(figsize=(16, 9)) smoothed = filt.smooth(state.filter_state.states).mean((1, 2)).exp().cpu().numpy()[1:] ax.plot(by_year.index, smoothed, color="gray", label="Rate") ax2 = ax.twinx() by_year.plot(ax=ax2, color="salmon", alpha=0.75, label="Earthquakes") fig.legend() ``` And finally plot the posterior distributions of the parameters. ``` from pyfilter.inference.utils import params_to_tensor from arviz import plot_trace parameters = state.samples.values().transpose(1, 0).cpu().numpy() # fig, ax = plt.subplots(parameters.shape[-1], figsize=(16, 9)) plot_trace(parameters) ```
github_jupyter
# Analysis of one-year trace of gut microbiome This notebook records the code used for analyzing data from [Gibbons _et. al._ (2017)](http://journals.plos.org/ploscompbiol/article?id=10.1371/journal.pcbi.1005364). ## Load required packages ``` library(beem) library(grid) library(ggplot2) library(ggsci) library(igraph) library(reshape2) ``` ## Load functions and data ``` input.da <- read.table('~/BEEM/vignettes/gibbons_et_al_analysis/DA.counts.txt', head=F, row.names=1) metadata.da <- read.table('~/BEEM/vignettes//gibbons_et_al_analysis/DA.metadata.txt', head=T) ## For DB, point #74 has extremely high of one species and #180 is sampled too far from the previous time point input.db <- read.table('~/BEEM/vignettes//gibbons_et_al_analysis/DB.counts.txt', head=F, row.names=1)[,-c(74,180)] metadata.db <- read.table('~/BEEM/vignettes/gibbons_et_al_analysis/DB.metadata.txt', head=T)[-c(74,180),] ## For M3, data from 330:332 are too far from previous time point input.m3 <- read.table('~/BEEM/vignettes/gibbons_et_al_analysis/M3.counts.txt', head=F, row.names=1)[,1:329] metadata.m3 <- read.table('~/BEEM/vignettes/gibbons_et_al_analysis/M3.metadata.txt', head=T)[1:329,] input.f4 <- read.table('~/BEEM/vignettes/gibbons_et_al_analysis/F4.counts.txt', head=F, row.names=1) metadata.f4 <- read.table('~/BEEM/vignettes/gibbons_et_al_analysis/F4.metadata.txt', head=T) ``` ## Run BEEM ### Individual DA ``` counts.da <- input.da[-1,] + 0.0001 ## added pseudo value for R>3.5 colnames(counts.da) <- as.character(input.da[1,]) res.da <- EM(dat=counts.da,meta=metadata.da, dev=10, verbose=FALSE, min_iter=50, max_iter=100, converge_thre = 1e-4, scaling = 10000, ncpu=4, seed=0) ``` ### Individual M3 ``` counts.m3 <- input.m3[-1,] colnames(counts.m3) <- as.character(input.m3[1,]) res.m3 <- EM(dat=counts.m3, meta=metadata.m3, dev=10, verbose=FALSE, min_iter=50, max_iter=100, converge_thre = 1e-4, scaling = 10000, ncpu=4, seed=0) ``` ### Individual DB ``` counts.db <- input.db[-1,] colnames(counts.db) <- as.character(input.db[1,]) res.db <- EM(dat=counts.db,meta=metadata.db, dev=10, verbose=FALSE, min_iter=50, max_iter=100, converge_thre=1e-4, scaling = 10000, ncpu=4, seed=0) ``` ### Individual F4 ``` counts.f4 <- input.f4[-1,] colnames(counts.f4) <- as.character(input.f4[1,]) res.f4 <- EM(dat=counts.f4,meta=metadata.f4, dev=10, verbose=FALSE, min_iter=50, max_iter=100, converge_thre=1e-4, scaling = 10000, ncpu=4, seed=0) ``` ## Infer parameters ``` params.da <- paramFromEM(res.da, counts.da, metadata.da, ncpu=4) params.m3 <- paramFromEM(res.m3, counts.m3, metadata.m3, ncpu=4) params.db <- paramFromEM(res.db, counts.db, metadata.db, ncpu=4) params.f4 <- paramFromEM(res.f4, counts.f4, metadata.f4, ncpu=4) ``` ## Functions for analysis ``` int.net <- function(counts, parms, sig=1, title){ ## plot interaction network minmax <- function(x) (x-min(x))/(max(x)-min(x)) annote <- read.table('~/BEEM/vignettes/gibbons_et_al_analysis/all_otu_mapping.txt',head=F, row.names=1) counts.mean <- rowMeans(counts) int <- parms[parms$parameter_type=='interaction' & parms$source_taxon!=parms$target_taxon,] int.f <- int[int$significance>sig,2:4] g <- graph.data.frame(int.f[,1:2]) V(g)$color <- annote[V(g)$name,]$V4 V(g)$size <- log(counts.mean[V(g)$name]) +4 E(g)$color <- ifelse(int.f$value>0,fill_cols[12],fill_cols[13]) E(g)$lty <- ifelse(int.f$value>0,1,2) E(g)$width <- minmax(abs(int.f$value) ) * 2 + 0.5 plot(g, main=title,asp=0,edge.arrow.size=0.5,edge.curved=.15) return(g) } ``` ## Biomass trajectory of individual DA Note the periodic behaviour of the biomass -- the period is around 90 days (i.e. 3 months). ``` par(mfrow = c(4,1)) plot(x=metadata.da$measurementID,y=biomassFromEM(res.da), xlim=c(0, 450), type='b', pch=19, xlab='Date', ylab='Estimated biomass', log='y') plot(x=metadata.m3$measurementID,y=biomassFromEM(res.m3), xlim=c(0, 450), type='b', pch=19, xlab='Date', ylab='Estimated biomass', log='y') plot(x=metadata.db$measurementID,y=biomassFromEM(res.db), xlim=c(0, 450), type='b', pch=19, xlab='Date', ylab='Estimated biomass', log='y') plot(x=metadata.f4$measurementID,y=biomassFromEM(res.f4), xlim=c(0, 450), type='b', pch=19, xlab='Date', ylab='Estimated biomass', log='y') ``` ## Plot interaction network ``` fill_cols <- pal_simpsons(c("springfield"))(16) ga <- int.net(counts.da, params.da, 1.5, 'DA') gm <- int.net(counts.m3, params.m3, 1.5, 'M3') gb <- int.net(counts.db, params.db, 1.5, 'DB') f4 <- int.net(counts.f4, params.f4, 1.5, 'F4') res.da$counts <- counts.da res.da$metadata <- metadata.da saveRDS(res.da, '~/BEEM/vignettes/gibbons_et_al_analysis/DA.EM.rds') write.table(params.da, '~/BEEM/vignettes/gibbons_et_al_analysis/DA.params.txt', col.names=TRUE, row.names=FALSE, sep='\t', quote=FALSE) res.m3$counts <- counts.m3 res.m3$metadata <- metadata.m3 saveRDS(res.m3, '~/BEEM/vignettes/gibbons_et_al_analysis/M3.EM.rds') write.table(params.m3, '~/BEEM/vignettes/gibbons_et_al_analysis/M3.params.txt', col.names=TRUE, row.names=FALSE, sep='\t', quote=FALSE) res.db$counts <- counts.db res.db$metadata <- metadata.db saveRDS(res.db, '~/BEEM/vignettes/gibbons_et_al_analysis/DB.EM.rds') write.table(params.db, '~/BEEM/vignettes/gibbons_et_al_analysis/DB.params.txt', col.names=TRUE, row.names=FALSE, sep='\t', quote=FALSE) res.f4$counts <- counts.f4 res.f4$metadata <- metadata.f4 saveRDS(res.f4, '~/BEEM/vignettes/gibbons_et_al_analysis/F4.EM.rds') write.table(params.f4, '~/BEEM/vignettes/gibbons_et_al_analysis/F4.params.txt', col.names=TRUE, row.names=FALSE, sep='\t', quote=FALSE) sessionInfo() ```
github_jupyter
``` ##from the vscode file... data_fix_season_cut_down ... import pandas as pd import numpy as np ##import all the files ##file paths Kaggle_path = "/Users/joejohns/data_bootcamp/Final_Project_NHL_prediction/Data/Kaggle_Data_Ellis/" mp_path = "/Users/joejohns/data_bootcamp/Final_Project_NHL_prediction/Data/Money_Puck_Data/" betting_path = "/Users/joejohns/data_bootcamp/Final_Project_NHL_prediction/Data/Betting_Data/" ##Kaggle files df_game = pd.read_csv(Kaggle_path+'game.csv') df_game_team_stats = pd.read_csv(Kaggle_path+'game_teams_stats.csv') df_game_skater_stats = pd.read_csv(Kaggle_path+'game_skater_stats.csv') df_game_goalie_stats = pd.read_csv(Kaggle_path+'game_goalie_stats.csv') ##more subtle Kaggle features: df_game_scratches = pd.read_csv(Kaggle_path+'game_scratches.csv') df_game_officials = pd.read_csv(Kaggle_path+'game_officials.csv') df_team_info = pd.read_csv(Kaggle_path+'team_info.csv') df_fran_info = pd.read_csv(Kaggle_path+'franchise_info.csv') ## grab all the moneypuck data df_mp_teams = pd.read_csv(mp_path+'all_teams.csv') ## grab all betting data df1 = pd.read_excel(io = betting_path+'nhl odds 2007-08.xlsx') df2 = pd.read_excel(io = betting_path+'nhl odds 2008-09.xlsx') df3 = pd.read_excel(io = betting_path+'nhl odds 2009-10.xlsx') df4 = pd.read_excel(io = betting_path+'nhl odds 2010-11.xlsx') df5 = pd.read_excel(io = betting_path+'nhl odds 2011-12.xlsx') df6 = pd.read_excel(io = betting_path+'nhl odds 2012-13.xlsx') df7 = pd.read_excel(io = betting_path+'nhl odds 2013-14.xlsx') df8 = pd.read_excel(io = betting_path+'nhl odds 2014-15.xlsx') df9 = pd.read_excel(io = betting_path+'nhl odds 2015-16.xlsx') df10 = pd.read_excel(io = betting_path+'nhl odds 2016-17.xlsx') df11 = pd.read_excel(io = betting_path+'nhl odds 2017-18.xlsx') df12 = pd.read_excel(io = betting_path+'nhl odds 2018-19.xlsx') df13 = pd.read_excel(io = betting_path+'nhl odds 2019-20.xlsx') df1['season'] = 20072008 df2['season'] = 20082009 df3['season'] = 20092010 df4['season'] = 20102011 df5['season'] = 20112012 df6['season'] = 20122013 df7['season'] = 20132014 df8['season'] = 20142015 df9['season'] = 20152016 df10['season'] = 20162017 df11['season'] = 20172018 df12['season'] = 20182019 df13['season'] = 20192020 df_betting = pd.concat([df1, df2, df3, df4, df5, df6, df7, df8, df9, df10, df11, df12, df13]) ##### restrict data sets ## restrict data sets df_betting = df_betting.loc[:, ['Date', 'season','VH', 'Team', 'Open']].copy() df_mp_teams.rename(columns={"teamId": "team_id"}, inplace = True) df_mp_teams_all = df_mp_teams.loc[df_mp_teams['situation'] == 'all', :].copy() ##### restrict data sets df_betting = df_betting.loc[:, ['Date', 'season','VH', 'Team', 'Open']].copy() df_mp_teams_all = df_mp_teams.loc[df_mp_teams['situation'] == 'all', :].copy() ##drop duplicates and one column had some NaN; ##note there are more nan values in df_game_skaters/team/goalies but I think df_mp gets those. df_game.drop_duplicates(inplace = True) df_game.drop(columns = ['home_rink_side_start'], inplace = True) ## fix seasons in df_mp (other 2 already have 20082009 format) def fix_mp_season(n): return int(str(n)+str(n+1)) #test #fix_mp_season(2010) df_mp_teams['season'] = df_mp_teams['season'].map(fix_mp_season) df_mp_teams_all['season'] = df_mp_teams_all['season'].map(fix_mp_season) ##restrict seasons; 20082009 to 20192020 is the range common to all 3 df's seasons = [] for n in range(2008,2020): seasons.append(int(str(n)+str(n+1))) #check seasons look ok print(seasons) #restrict seasons: ##note: In notebook I checked that value counts of the seasons did not change after this #restriction df_betting = df_betting.loc[df_game['season'].isin(seasons), :].copy() df_game = df_game.loc[df_game['season'].isin(seasons), :].copy() df_mp_teams = df_mp_teams.loc[df_mp_teams['season'].isin(seasons), :].copy() df_mp_teams_all = df_mp_teams_all.loc[df_mp_teams_all['season'].isin(seasons), :].copy() ##here is a count of how many games in each df ... approx the same ... so looks likely there ##should be close to full overlap in game_id's ## the index is no longer consecutive so we reset: df_betting.reset_index(drop = True, inplace = True) df_game.reset_index(drop = True, inplace = True) df_mp_teams.reset_index(drop = True, inplace = True) df_mp_teams_all.reset_index(drop = True, inplace = True) for seas in seasons: print(seas, len(df_mp_teams_all.loc[df_mp_teams['season']==seas])/2, len(df_game.loc[df_game['season']==seas]), len(df_betting.loc[df_betting['season']==seas])/2) ## check that df_mp and df_game have similar games ... ```
github_jupyter
# Analysis of DNA-MERFISH for CTP11 by Pu Zheng 2022.02.15 analysis for dataset: \\10.245.74.158\Chromatin_NAS_1\20220307-P_brain_CTP11_from_0303 This data is DNA of uncleared MERFISH RNA: \\10.245.74.158\Chromatin_NAS_0\20220303-P_brain_M1_nonclear_adaptor ``` %run "..\..\Startup_py3.py" sys.path.append(r"..\..\..\..\Documents") import ImageAnalysis3 as ia %matplotlib notebook from ImageAnalysis3 import * print(os.getpid()) import h5py from ImageAnalysis3.classes import _allowed_kwds import ast ``` # 0. fov parameters ``` reload(ia) reload(classes) reload(classes.batch_functions) reload(classes.field_of_view) reload(io_tools.load) reload(get_img_info) reload(visual_tools) reload(ia.correction_tools) reload(ia.correction_tools.alignment) reload(ia.spot_tools.matching) reload(ia.segmentation_tools.chromosome) reload(ia.spot_tools.fitting) fov_param = {'data_folder':[r'\\10.245.74.158\Chromatin_NAS_4\20220316-P_brain_CTP11-12-13_from_0304', r'\\10.245.74.212\Chromatin_NAS_2\20220316-P_brain_CTP11-12-13_from_0304'], 'save_folder':r'\\franklin\SSD_01\Pu_Temp\20220316-P_brain_CTP11-12-13_from_0304', 'experiment_type': 'DNA', 'num_threads': 16, 'correction_folder':r'\\10.245.74.158\Chromatin_NAS_0\Corrections\20210621-Corrections_lumencor_from_60_to_50', 'shared_parameters':{ 'single_im_size':[50,2048,2048], 'distance_zxy': [250, 108, 108], 'corr_channels':['750','647','561'], 'num_empty_frames': 0, 'num_buffer_frames':0, 'corr_hot_pixel':True, 'corr_Z_shift':False, 'corr_bleed':True, 'min_num_seeds':5, 'max_num_seeds': 20000, 'spot_seeding_th': 1000, 'normalize_intensity_local':False, 'normalize_intensity_background':False, 'corr_gaussian_highpass':False, }, } ``` # 1. Process Fov ``` _overwrite = False _save_images = True _fit_spots = True sel_fov_ids = np.arange(20, 21) # batch1 in franklin for _fov_id in sel_fov_ids: if 'bad_fovs_ids' in locals() and _fov_id in bad_fovs_ids: continue fov = classes.field_of_view.Field_of_View(fov_param, _fov_id=_fov_id, _color_info_kwargs={ '_color_filename':'Color_Usage', }, _prioritize_saved_attrs=False, _save_info_to_file=True, # whether overwrite ) # 2. Process image into candidate spots fov.parallel = True setattr(fov, "combo_ref_id", 0) fov._process_image_to_spots('combo', _load_common_reference=True, _load_with_multiple=False, _save_images=_save_images, _warp_images=False, _fit_spots=True, _overwrite_drift=False, _overwrite_image=_overwrite, _overwrite_spot=_overwrite) try: fov._save_to_file('relabeled_combo') except: pass setattr(fov, "relabeled_combo_ref_id", 0) fov._process_image_to_spots('relabeled_combo', _load_common_reference=True, _load_with_multiple=False, _save_images=_save_images, _warp_images=False, _fit_spots=True, _overwrite_drift=False, _overwrite_image=_overwrite, _overwrite_spot=_overwrite) # 3. unique setattr(fov, "unique_ref_id", 0) fov._process_image_to_spots('unique', _load_common_reference=True, _load_with_multiple=False, _save_images=_save_images, _warp_images=False, _fit_spots=True, _overwrite_drift=False, _overwrite_image=_overwrite, _overwrite_spot=_overwrite) fov.parallel = False fov._save_to_file('relabeled_unique') setattr(fov, "relabeled_unique_ref_id", 0) fov._process_image_to_spots('relabeled_unique', _load_common_reference=True, _load_with_multiple=False, _save_images=_save_images, _warp_images=False, _fit_spots=True, _overwrite_drift=False, _overwrite_image=_overwrite, _overwrite_spot=_overwrite) # 4. Process DAPI image fov._load_dapi_image() _overwrite = False _save_images = False _fit_spots = True #sel_fov_ids = np.arange(21, 81) # batch1 in franklin sel_fov_ids = np.arange(0, 18) # batch1 in franklin for _fov_id in sel_fov_ids: if 'bad_fovs_ids' in locals() and _fov_id in bad_fovs_ids: continue fov = classes.field_of_view.Field_of_View(fov_param, _fov_id=_fov_id, _color_info_kwargs={ '_color_filename':'Color_Usage', }, _prioritize_saved_attrs=False, _save_info_to_file=True, # whether overwrite ) # 2. Process image into candidate spots fov.parallel = True setattr(fov, "combo_ref_id", 0) fov._process_image_to_spots('combo', _load_common_reference=True, _load_with_multiple=False, _save_images=_save_images, _warp_images=False, _fit_spots=True, _overwrite_drift=False, _overwrite_image=_overwrite, _overwrite_spot=_overwrite) try: fov._save_to_file('relabeled_combo') except: pass setattr(fov, "relabeled_combo_ref_id", 0) fov._process_image_to_spots('relabeled_combo', _load_common_reference=True, _load_with_multiple=False, _save_images=_save_images, _warp_images=False, _fit_spots=True, _overwrite_drift=False, _overwrite_image=_overwrite, _overwrite_spot=_overwrite) # 3. unique setattr(fov, "unique_ref_id", 0) fov._process_image_to_spots('unique', _load_common_reference=True, _load_with_multiple=False, _save_images=_save_images, _warp_images=False, _fit_spots=True, _overwrite_drift=False, _overwrite_image=_overwrite, _overwrite_spot=_overwrite) fov.parallel = False fov._save_to_file('relabeled_unique') setattr(fov, "relabeled_unique_ref_id", 0) fov._process_image_to_spots('relabeled_unique', _load_common_reference=True, _load_with_multiple=False, _save_images=_save_images, _warp_images=False, _fit_spots=True, _overwrite_drift=False, _overwrite_image=_overwrite, _overwrite_spot=_overwrite) # 4. Process DAPI image fov._load_dapi_image() sel_ids = np.array([3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,68,69,70,71,72,73,74,75,76,101,102,165]) with h5py.File(fov.save_filename, 'r') as _f: _grp = _f.require_group('combo') _ids = list(_grp['ids'][:]) sel_ims = [] sel_raw_spots = [] for _id in sel_ids: _ind = _ids.index(_id) sel_ims.append(_grp['ims'][_ind]) sel_raw_spots.append(_grp['raw_spots'][_ind]) coord_dict = { 'coords': [],#np.fliplr(sel_spots[:,1:4]), 'class_ids': [],#sel_ids, } for _i, _spots in enumerate(sel_raw_spots): _spots = _spots[_spots[:,0]>0] if len(_spots) > 0: coord_dict['coords'].extend(list(np.fliplr(_spots[:,1:4]))) #coord_dict['coords'].extend(list(np.fliplr(_crop.crop_coords(_spots.to_coords()[_sel_inds])))) coord_dict['class_ids'].extend(list(np.ones(len(_spots),dtype=np.int32) * _i)) visual_tools.imshow_mark_3d_v2(sel_ims, given_dic=coord_dict, image_names=sel_ids) ```
github_jupyter
``` import wandb import nltk from nltk.stem.porter import * from torch.nn import * from torch.optim import * import numpy as np import pandas as pd import torch,torchvision import random from tqdm import * from torch.utils.data import Dataset,DataLoader stemmer = PorterStemmer() PROJECT_NAME = 'kickstarter-NLP-v3' device = 'cuda' def tokenize(sentence): return nltk.word_tokenize(sentence.lower()) tokenize('$100') def stem(word): return stemmer.stem(word.lower()) stem('organic') def bag_of_words(tokenized_words,all_words): tokenized_words = [stem(w) for w in tokenized_words] bag = np.zeros(len(all_words)) for idx,w in enumerate(all_words): if w in tokenized_words: bag[idx] = 1.0 return bag bag_of_words(['hi'],['hi','how','hi']) data = pd.read_csv('./data.csv',encoding='latin-1')[:5000] data X = data['OriginalTweet'] y = data['Sentiment'] words = [] data = [] idx = 0 labels = {} labels_r = {} for label in y: if label not in list(labels.keys()): idx += 1 labels[label] = idx labels_r[idx] = label for X_batch,y_batch in tqdm(zip(X,y)): X_batch = tokenize(X_batch) new_X = [] for Xb in X_batch: new_X.append(stem(Xb)) words.extend(new_X) data.append([ new_X, np.eye(labels[y_batch],len(labels))[labels[y_batch]-1] ]) words = sorted(set(words)) np.random.shuffle(words) np.random.shuffle(data) X = [] y = [] for X_batch,y_batch in tqdm(data): X.append(bag_of_words(X_batch,words)) y.append(y_batch) from sklearn.model_selection import * X_train,X_test,y_train,y_test = train_test_split(X,y,test_size=0.125,shuffle=False) X_train = torch.from_numpy(np.array(X_train)).to(device).float() y_train = torch.from_numpy(np.array(y_train)).to(device).float() X_test = torch.from_numpy(np.array(X_test)).to(device).float() y_test = torch.from_numpy(np.array(y_test)).to(device).float() def get_loss(model,X,y,criterion): preds = model(X) loss = criterion(preds,y) return loss.item() def get_accuracy(model,X,y): preds = model(X) correct = 0 total = 0 for pred,yb in zip(preds,y): pred = int(torch.argmax(pred)) yb = int(torch.argmax(yb)) if pred == yb: correct += 1 total += 1 acc = round(correct/total,3)*100 return acc class Model(Module): def __init__(self): super().__init__() self.activation = ReLU() self.iters = 2 self.dropout = Dropout() self.hidden = 512 self.linear1 = Linear(len(words),self.hidden) self.linear2 = Linear(self.hidden,self.hidden) self.linear3 = Linear(self.hidden,self.hidden) self.linear4 = Linear(self.hidden,self.hidden) self.linear5 = Linear(self.hidden,self.hidden) self.output = Linear(self.hidden,len(labels)) def forward(self,X): preds = self.linear1(X) preds = self.activation(self.linear2(preds)) for _ in range(self.iters): preds = self.dropout(self.activation(self.linear3(preds))) preds = self.activation(self.linear4(preds)) preds = self.activation(self.linear5(preds)) preds = self.output(preds) return preds model = Model().to(device) criterion = MSELoss() optimizer = Adam(model.parameters(),lr=0.001) epochs = 100 batch_size = 32 torch.save(model,'model-custom.pt') torch.save(model,'model-custom.pth') torch.save(model.state_dict(),'model-custom-sd.pt') torch.save(model.state_dict(),'model-custom-sd.pth') torch.save(words,'words.pt') torch.save(words,'words.pth') torch.save(data,'data.pt') torch.save(data,'data.pth') torch.save(labels,'labels.pt') torch.save(labels,'labels.pth') torch.save(idx,'idx.pt') torch.save(idx,'idx.pth') torch.save(y_train,'y_train.pt') torch.save(y_test,'y_test.pth') wandb.init(project=PROJECT_NAME,name='baseline') for _ in tqdm(range(epochs)): for i in range(0,len(X_train),batch_size): X_batch = X_train[i:i+batch_size] y_batch = y_train[i:i+batch_size] preds = model(X_batch) loss = criterion(preds,y_batch) optimizer.zero_grad() loss.backward() optimizer.step() model.eval() torch.cuda.empty_cache() wandb.log({'Loss':(get_loss(model,X_train,y_train,criterion)+get_loss(model,X_batch,y_batch,criterion)/2)}) torch.cuda.empty_cache() wandb.log({'Val Loss':get_loss(model,X_test,y_test,criterion)}) torch.cuda.empty_cache() wandb.log({'Acc':(get_accuracy(model,X_train,y_train)+get_accuracy(model,X_batch,y_batch))/2}) torch.cuda.empty_cache() wandb.log({'Val Acc':get_accuracy(model,X_test,y_test)}) torch.cuda.empty_cache() model.train() wandb.finish() torch.cuda.empty_cache() torch.save(model,'model.pt') torch.save(model,'model.pth') torch.save(model.state_dict(),'model-sd.pt') torch.save(model.state_dict(),'model-sd.pth') torch.save(words,'words.pt') torch.save(words,'words.pth') torch.save(data,'data.pt') torch.save(data,'data.pth') torch.save(labels,'labels.pt') torch.save(labels,'labels.pth') torch.save(idx,'idx.pt') torch.save(idx,'idx.pth') torch.save(y_train,'y_train.pt') torch.save(y_test,'y_test.pth') ```
github_jupyter
[![Open In Colab](https://colab.research.google.com/assets/colab-badge.svg)](https://colab.research.google.com/github/huggingface/education-toolkit/blob/main/03_getting-started-with-transformers.ipynb) 💡 **Welcome!** We’ve assembled a toolkit that university instructors and organizers can use to easily prepare labs, homework, or classes. The content is designed in a self-contained way such that it can easily be incorporated into the existing curriculum. This content is free and uses widely known Open Source technologies (`transformers`, `gradio`, etc). Alternatively, you can request for someone on the Hugging Face team to run the tutorials for your class via the [ML demo.cratization tour](https://huggingface2.notion.site/ML-Demo-cratization-tour-with-66847a294abd4e9785e85663f5239652) initiative! You can find all the tutorials and resources we’ve assembled [here](https://huggingface2.notion.site/Education-Toolkit-7b4a9a9d65ee4a6eb16178ec2a4f3599). # Tutorial: Getting Started with Transformers **Learning goals:** The goal of this tutorial is to learn how: 1. Transformer neural networks can be used to tackle a wide range of tasks in natural language processing and beyond. 3. Transfer learning allows one to adapt Transformers to specific tasks. 2. The `pipeline()` function from the `transformers` library can be used to run inference with models from the [Hugging Face Hub](https://huggingface.co/models). This tutorial is based on the first of our O'Reilly book [_Natural Language Processing with Transformers_](https://transformersbook.com/) - check it out if you want to dive deeper into the topic! **Duration**: 30-45 minutes **Prerequisites:** Knowledge of Python and basic familiarity with machine learning **Author**: [Lewis Tunstall](https://twitter.com/_lewtun) (feel free to ping me with any questions about this tutorial) All of these steps can be done for free! All you need is an Internet browser and a place where you can write Python 👩‍💻 ## 0. Why Transformers? Deep learning is currently undergoing a period of rapid progress across a wide variety of domains, including: * 📖 Natural language processing * 👀 Computer vision * 🔊 Audio * 🧬 Biology * and many more! The main driver of these breakthroughs is the **Transformer** -- a novel **neural network** developed by Google researchers in 2017. In short, if you’re into deep learning, you need Transformers! Here's a few examples of what Transformers can do: * 💻 They can **generate code** as in products like [GitHub Copilot](https://copilot.github.com/), which is based on OpenAI's family of [GPT models](https://huggingface.co/gpt2?text=My+name+is+Clara+and+I+am). * ❓ They can be used for **improve search engines**, like [Google did](https://www.blog.google/products/search/search-language-understanding-bert/) with a Transformer called [BERT](https://huggingface.co/bert-base-uncased). * 🗣️ They can **process speech in multiple languages** to perform speech recognition, speech translation, and language identification. For example, Facebook's [XLS-R model](https://huggingface.co/spaces/facebook/XLS-R-2B-22-16) can automatically transcribe audio in one language to another! Training these models **from scratch** involves **a lot of resources**: you need large amounts of compute, data, and days to train for 😱. Fortunately, you don't need to do this in most cases! Thanks to a technique known as **transfer learning**, it is possible to adapt a model that has been trained from scratch (usually called a **pretrained model**), to a variety of downstream tasks. This process is called **fine-tuning** and can typically be carried with a single GPU and a dataset of the size that you're like to find in your university or company. The models that we'll be looking at in this tutorial are all examples of fine-tuned models, and you can learn more about the transfer learning process in the video below: ``` from IPython.display import YouTubeVideo YouTubeVideo('BqqfQnyjmgg') ``` Now, Transformers are coolest kids in town, but how can we use them? If only there was a library that could help us ... oh wait, there is! The [Hugging Face Transformers library](https://github.com/huggingface/transformers) provides a unified API across dozens of Transformer architectures, as well as the means to train models and run inference with them. So to get started, let's install the library with the following command: ``` %%capture %pip install transformers[sentencepiece] ``` Now that we've installed the library, let's take a look at some applications! ## 1. Pipelines for Transformers The fastest way to learn what Transformers can do is via the `pipeline()` function. This function loads a model from the Hugging Face Hub and takes care of all the preprocessing and postprocessing steps that are needed to convert inputs into predictions: <img src="https://github.com/huggingface/workshops/blob/main/nlp-zurich/images/pipeline.png?raw=1" alt="Alt text that describes the graphic" title="Title text" width=800> In the next few sections we'll see how these steps are combined for different applications. If you want to learn more about what is happening under the hood, then check out the video below: ``` YouTubeVideo('1pedAIvTWXk') ``` ## 2. Text classification Let's start with one of the most common tasks in NLP: text classification. We need a snippet of text for our models to analyze, so let's use the following (fictious!) customer feedback about a certain online order: ``` text = """Dear Amazon, last week I ordered an Optimus Prime action figure \ from your online store in Germany. Unfortunately, when I opened the package, \ I discovered to my horror that I had been sent an action figure of Megatron \ instead! As a lifelong enemy of the Decepticons, I hope you can understand my \ dilemma. To resolve the issue, I demand an exchange of Megatron for the \ Optimus Prime figure I ordered. Enclosed are copies of my records concerning \ this purchase. I expect to hear from you soon. Sincerely, Bumblebee.""" ``` While we're at it, let's create a simple wrapper so that we can pretty print out texts: ``` import textwrap wrapper = textwrap.TextWrapper(width=80, break_long_words=False, break_on_hyphens=False) print(wrapper.fill(text)) ``` Now suppose that we'd like to predict the _sentiment_ of this text, i.e. whether the feedback is positive or negative. This is a special type of text classification that is often used in industry to aggregate customer feedback across products or services. The example below shows how a Transformer like BERT converts the inputs into atomic chunks called **tokens** which are then fed through the network to produce a single prediction: <img src="https://github.com/huggingface/workshops/blob/main/nlp-zurich/images/clf_arch.png?raw=1" alt="Alt text that describes the graphic" title="Title text" width=600> To load a Transformer model for this task is quite simple. We just need to specify the task in the `pipeline()` function as follows; ``` from transformers import pipeline sentiment_pipeline = pipeline('text-classification') ``` When you run this code, you'll see a message about which Hub model is being used by default. In this case, the `pipeline()` function loads the `distilbert-base-uncased-finetuned-sst-2-english` model, which is a small BERT variant trained on [SST-2](https://paperswithcode.com/sota/sentiment-analysis-on-sst-2-binary) which is a sentiment analysis dataset. 💡 The first time you execute the code, the model will be automatically downloaded from the Hub and cached for later use! Now we are ready to run our example through pipeline and look at some predictions: ``` sentiment_pipeline(text) ``` The model predicts negative sentiment with a high confidence which makes sense given that we have a disgruntled customer. You can also see that the pipeline returns a list of Python dictionaries with the predictions. We can also pass several texts at the same time in which case we would get several dicts in the list for each text one. ⚡ **Your turn!** Feed a list of texts with different types of sentiment to the `sentiment_pipeline` object. Do the predictions always make sense? ## 3. Named entity recognition Let's now do something a little more sophisticated. Instead of just finding the overall sentiment, let's see if we can extract **entities** such as organizations, locations, or individuals from the text. This task is called named entity recognition, or NER for short. Instead of predicting just a class for the whole text **a class is predicted for each token**, as shown in the example below: <img src="https://github.com/huggingface/workshops/blob/main/nlp-zurich/images/ner_arch.png?raw=1" alt="Alt text that describes the graphic" title="Title text" width=600> Again, we just load a pipeline for NER without specifying a model. This will load a default BERT model that has been trained on the [CoNLL-2003](https://huggingface.co/datasets/conll2003) dataset: ``` ner_pipeline = pipeline('ner') ``` When we pass our text through the model, we now get a long list of Python dictionaries, where each dictionary corresponds to one detected entity. Since multiple tokens can correspond to a a single entity ,we can apply an aggregation strategy that merges entities if the same class appears in consequtive tokens: ``` entities = ner_pipeline(text, aggregation_strategy="simple") print(entities) ``` This isn't very easy to read, so let's clean up the outputs a bit: ``` for entity in entities: print(f"{entity['word']}: {entity['entity_group']} ({entity['score']:.2f})") ``` That's much better! It seems that the model found most of the named entities but was confused about "Megatron" andn "Decepticons", which are characters in the transformers franchise. This is no surprise since the original dataset probably did not contain many transformer characters. For this reason it makes sense to further fine-tune a model on your on dataset! Now that we've seen an example of text and token classification using Transformers, let's look at an interesting application called **question answering**. ## 4. Question answering In this task, the model is given a **question** and a **context** and needs to find the answer to the question within the context. This problem can be rephrased as a classification problem: For each token the model needs to predict whether it is the start or the end of the answer. In the end we can extract the answer by looking at the span between the token with the highest start probability and highest end probability: <img src="https://github.com/huggingface/workshops/blob/main/nlp-zurich/images/qa_arch.png?raw=1" alt="Alt text that describes the graphic" title="Title text" width=600> You can imagine that this requires quite a bit of pre- and post-processing logic. Good thing that the pipeline takes care of all that! As usual, we load the model by specifying the task in the `pipeline()` function: ``` qa_pipeline = pipeline("question-answering") ``` This default model is trained on the famous [SQuAD dataset](https://huggingface.co/datasets/squad). Let's see if we can ask it what the customer wants: ``` question = "What does the customer want?" outputs = qa_pipeline(question=question, context=text) outputs ``` Awesome, that sounds about right! ## 5. Text summarization Let's see if we can go beyond these natural language understanding tasks (NLU) where BERT excels and delve into the generative domain. Note that generation is much more computationally demanding since we usually generate one token at a time and need to run this several times. An example for how this process works is shown below: <img src="https://github.com/huggingface/workshops/blob/main/nlp-zurich/images/gen_steps.png?raw=1" alt="Alt text that describes the graphic" title="Title text" width=600> A popular task involving generation is summarization. Let's see if we can use a transformer to generate a summary for us: ``` summarization_pipeline = pipeline("summarization") ``` This model is trained was trained on the [CNN/Dailymail dataset](https://huggingface.co/datasets/cnn_dailymail) to summarize news articles. ``` outputs = summarization_pipeline(text, max_length=45, clean_up_tokenization_spaces=True) print(wrapper.fill(outputs[0]['summary_text'])) ``` That's not too bad! We can see the model was able to get the main gist of the customer feedback and even identified the author as "Bumblebee". ## 6. Translation But what if there is no model in the language of my data? You can still try to translate the text. The [Helsinki NLP team](https://huggingface.co/models?pipeline_tag=translation&sort=downloads&search=Helsinkie-NLP) has provided over 1,000 language pair models for translation 🤯. Here we load one that translates English to German: ``` translator = pipeline("translation_en_to_de", model="Helsinki-NLP/opus-mt-en-de") ``` Let's translate the our text to German: ``` outputs = translator(text, clean_up_tokenization_spaces=True, min_length=100) print(wrapper.fill(outputs[0]['translation_text'])) ``` We can see that the text is clearly not perfectly translated, but the core meaning stays the same. Another cool application of translation models is data augmentation via backtranslation! ## 7. Zero-shot classification As a last example let's have a look at a cool application showing the versatility of transformers: zero-shot classification. In zero-shot classification the model receives a text and a list of candidate labels and determines which labels are compatible with the text. Instead of having fixed classes this allows for flexible classification without any labelled data! Usually this is a good first baseline! ``` zero_shot_classifier = pipeline("zero-shot-classification", model="vicgalle/xlm-roberta-large-xnli-anli") ``` Let's have a look at an example: ``` text = 'Dieser Tutorial ist großartig! Ich hoffe, dass jemand von Hugging Face meine Universität besuchen wird :)' classes = ['Treffen', 'Arbeit', 'Digital', 'Reisen'] zero_shot_classifier(text, classes, multi_label=True) ``` This seems to have worked really well on this short example. Naturally, for longer and more domain specific examples this approach might suffer. ## 8. Going beyond text As mentioned at the start of this tutorial, Transformers can also be used for domains other than NLP! For these domains, there are many more pipelines that you can experiment with. Look at the following list for an overview: ``` from transformers import pipelines for task in pipelines.SUPPORTED_TASKS: print(task) ``` Let's have a look at an application involving images! ### Computer vision Recently, transformer models have also entered computer vision. Check out the DETR model on the [Hub](https://huggingface.co/facebook/detr-resnet-101-dc5): <img src="https://github.com/huggingface/workshops/blob/main/nlp-zurich/images/object_detection.png?raw=1" alt="Alt text that describes the graphic" title="Title text" width=400> ### Audio Another promising area is audio processing. Especially Speech2Text there have been some promising advancements recently. See for example the [wav2vec2 model](https://huggingface.co/facebook/wav2vec2-base-960h): <img src="https://github.com/huggingface/workshops/blob/main/nlp-zurich/images/speech2text.png?raw=1" alt="Alt text that describes the graphic" title="Title text" width=400> ### Table QA Finally, a lot of real world data is still in form of tables. Being able to query tables is very useful and with [TAPAS](https://huggingface.co/google/tapas-large-finetuned-wtq) you can do tabular question-answering: <img src="https://github.com/huggingface/workshops/blob/main/nlp-zurich/images/tapas.png?raw=1" alt="Alt text that describes the graphic" title="Title text" width=400> ## 9. Where to next? Hopefully this tutorial has given you a taste of what Transformers can do and you're now excited to learn more! Here's a few resources you can use to dive deeper into the topic and the Hugging Face ecosystem: 🤗 **A Tour through the Hugging Face Hub** In this tutorial, you get to: - Explore the over 30,000 models shared in the Hub. - Learn efficient ways to find the right model and datasets for your own task. - Learn how to contribute and work collaboratively in your ML workflows ***Duration: 20-40 minutes*** 👉 [click here to access the tutorial](https://www.notion.so/Workshop-A-Tour-through-the-Hugging-Face-Hub-2098e4bae9ba4288857e85c87ff1c851) ✨ **Build and Host Machine Learning Demos with Gradio & Hugging Face** In this tutorial, you get to: - Explore ML demos created by the community. - Build a quick demo for your machine learning model in Python using the `gradio` library - Host the demos for free with Hugging Face Spaces - Add your demo to the Hugging Face org for your class or conference ***Duration: 20-40 minutes*** 👉 [click here to access the tutorial](https://colab.research.google.com/github/huggingface/education-toolkit/blob/main/02_ml-demos-with-gradio.ipynb) 🎓 **The Hugging Face Course** This course teaches you about applying Transformers to various tasks in natural language processing and beyond. Along the way, you'll learn how to use the Hugging Face ecosystem — 🤗 Transformers, 🤗 Datasets, 🤗 Tokenizers, and 🤗 Accelerate — as well as the Hugging Face Hub. It's completely free too! ``` YouTubeVideo('00GKzGyWFEs') ```
github_jupyter
<table style="border: none" align="center"> <tr style="border: none"> <th style="border: none"><font face="verdana" size="4" color="black"><b> Demonstrate adversarial training using ART </b></font></font></th> </tr> </table> In this notebook we demonstrate adversarial training using ART on the MNIST dataset. ## Contents 1. [Load prereqs and data](#prereqs) 2. [Train and evaluate a baseline classifier](#classifier) 3. [Adversarially train a robust classifier](#adv_training) 4. [Evaluate the robust classifier](#evaluation) <a id="prereqs"></a> ## 1. Load prereqs and data ``` import warnings warnings.filterwarnings('ignore') from keras.models import load_model from art.config import ART_DATA_PATH from art.utils import load_dataset, get_file from art.estimators.classification import KerasClassifier from art.attacks.evasion import FastGradientMethod from art.attacks.evasion import BasicIterativeMethod from art.defences.trainer import AdversarialTrainer import numpy as np %matplotlib inline import matplotlib.pyplot as plt (x_train, y_train), (x_test, y_test), min_, max_ = load_dataset('mnist') ``` <a id="classifier"></a> ## 2. Train and evaluate a baseline classifier Load the classifier model: ``` path = get_file('mnist_cnn_original.h5', extract=False, path=ART_DATA_PATH, url='https://www.dropbox.com/s/p2nyzne9chcerid/mnist_cnn_original.h5?dl=1') classifier_model = load_model(path) classifier = KerasClassifier(clip_values=(min_, max_), model=classifier_model, use_logits=False) classifier_model.summary() ``` Evaluate the classifier performance on the first 100 original test samples: ``` x_test_pred = np.argmax(classifier.predict(x_test[:100]), axis=1) nb_correct_pred = np.sum(x_test_pred == np.argmax(y_test[:100], axis=1)) print("Original test data (first 100 images):") print("Correctly classified: {}".format(nb_correct_pred)) print("Incorrectly classified: {}".format(100-nb_correct_pred)) ``` Generate some adversarial samples: ``` attacker = FastGradientMethod(classifier, eps=0.5) x_test_adv = attacker.generate(x_test[:100]) ``` And evaluate performance on those: ``` x_test_adv_pred = np.argmax(classifier.predict(x_test_adv), axis=1) nb_correct_adv_pred = np.sum(x_test_adv_pred == np.argmax(y_test[:100], axis=1)) print("Adversarial test data (first 100 images):") print("Correctly classified: {}".format(nb_correct_adv_pred)) print("Incorrectly classified: {}".format(100-nb_correct_adv_pred)) ``` <a id="adv_training"></a> ## 3. Adversarially train a robust classifier ``` path = get_file('mnist_cnn_robust.h5', extract=False, path=ART_DATA_PATH, url='https://www.dropbox.com/s/yutsncaniiy5uy8/mnist_cnn_robust.h5?dl=1') robust_classifier_model = load_model(path) robust_classifier = KerasClassifier(clip_values=(min_, max_), model=robust_classifier_model, use_logits=False) ``` Note: the robust classifier has the same architecture as above, except the first dense layer has **1024** instead of **128** units. (This was recommend by Madry et al. (2017), *Towards Deep Learning Models Resistant to Adversarial Attacks*) ``` robust_classifier_model.summary() ``` Also as recommended by Madry et al., we use BIM/PGD attacks during adversarial training: ``` attacks = BasicIterativeMethod(robust_classifier, eps=0.3, eps_step=0.01, max_iter=40) ``` Perform adversarial training: ``` # We had performed this before, starting with a randomly intialized model. # Adversarial training takes about 80 minutes on an NVIDIA V100. # The resulting model is the one loaded from mnist_cnn_robust.h5 above. # Here is the command we had used for the Adversarial Training # trainer = AdversarialTrainer(robust_classifier, attacks, ratio=1.0) # trainer.fit(x_train, y_train, nb_epochs=83, batch_size=50) ``` <a id="evaluation"></a> ## 4. Evaluate the robust classifier Evaluate the robust classifier's performance on the original test data: ``` x_test_robust_pred = np.argmax(robust_classifier.predict(x_test[:100]), axis=1) nb_correct_robust_pred = np.sum(x_test_robust_pred == np.argmax(y_test[:100], axis=1)) print("Original test data (first 100 images):") print("Correctly classified: {}".format(nb_correct_robust_pred)) print("Incorrectly classified: {}".format(100-nb_correct_robust_pred)) ``` Evaluate the robust classifier's performance on the adversarial test data (**white-box** setting): ``` attacker_robust = FastGradientMethod(robust_classifier, eps=0.5) x_test_adv_robust = attacker_robust.generate(x_test[:100]) x_test_adv_robust_pred = np.argmax(robust_classifier.predict(x_test_adv_robust), axis=1) nb_correct_adv_robust_pred = np.sum(x_test_adv_robust_pred == np.argmax(y_test[:100], axis=1)) print("Adversarial test data (first 100 images):") print("Correctly classified: {}".format(nb_correct_adv_robust_pred)) print("Incorrectly classified: {}".format(100-nb_correct_adv_robust_pred)) ``` Compare the performance of the original and the robust classifier over a range of `eps` values: ``` eps_range = [0.01, 0.02, 0.03, 0.04, 0.05, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9] nb_correct_original = [] nb_correct_robust = [] for eps in eps_range: attacker.set_params(**{'eps': eps}) attacker_robust.set_params(**{'eps': eps}) x_test_adv = attacker.generate(x_test[:100]) x_test_adv_robust = attacker_robust.generate(x_test[:100]) x_test_adv_pred = np.argmax(classifier.predict(x_test_adv), axis=1) nb_correct_original += [np.sum(x_test_adv_pred == np.argmax(y_test[:100], axis=1))] x_test_adv_robust_pred = np.argmax(robust_classifier.predict(x_test_adv_robust), axis=1) nb_correct_robust += [np.sum(x_test_adv_robust_pred == np.argmax(y_test[:100], axis=1))] eps_range = [0] + eps_range nb_correct_original = [nb_correct_pred] + nb_correct_original nb_correct_robust = [nb_correct_robust_pred] + nb_correct_robust fig, ax = plt.subplots() ax.plot(np.array(eps_range), np.array(nb_correct_original), 'b--', label='Original classifier') ax.plot(np.array(eps_range), np.array(nb_correct_robust), 'r--', label='Robust classifier') legend = ax.legend(loc='upper center', shadow=True, fontsize='large') legend.get_frame().set_facecolor('#00FFCC') plt.xlabel('Attack strength (eps)') plt.ylabel('Correct predictions') plt.show() ```
github_jupyter
``` import numpy as np import tensorflow as tf import pyreadr import pandas as pd import keras from keras.layers import Dense,Dropout,BatchNormalization from keras.models import Sequential,Model from keras.callbacks import ModelCheckpoint,EarlyStopping,ReduceLROnPlateau from keras.optimizers import Adam from keras.regularizers import l1 from sklearn.preprocessing import StandardScaler from keras.models import load_model from sklearn.covariance import MinCovDet,EmpiricalCovariance from matplotlib.pyplot import hist from matplotlib import pyplot as plt from sklearn.metrics import accuracy_score %matplotlib inline from keras.backend.tensorflow_backend import set_session import tensorflow as tf config = tf.ConfigProto() config.gpu_options.allow_growth = True # dynamically grow the memory used on the GPU # config.log_device_placement = True # to log device placement (on which device the operation ran) sess = tf.Session(config=config) set_session(sess) # set this TensorFlow session as the default session for Keras # Set seeds for random number generators for reproducable results seed = 0 np.random.seed(seed) tf.set_random_seed(seed) # Load training data data = pyreadr.read_r("/home/shanmukh/Documents/IICT/tep-fault-detection/dataset/TEP_FaultFree_Training.RData") df = data['fault_free_training'] training_data = df.drop(["faultNumber","simulationRun","sample"],axis=1) # Standard Normalization # 0 mean # 1 std scaler = StandardScaler() scaler.fit(training_data) training_data = scaler.transform(training_data) model = load_model("/home/shanmukh/Documents/IICT/tep-fault-detection/models/weights-55-0.09.hdf5") encoder = Model(inputs=model.input,outputs=model.get_layer('latent_space').output) # model.summary() # encoder.summary() # Get outputs predictions = model.predict(training_data,batch_size=512) latent = encoder.predict(training_data,batch_size=512) # Set Percentile Tresholds percentile_treshold = 95 # SPE statistic spe = np.sum((training_data - predictions)**2,axis=1) cutoff_spe = np.percentile(spe,percentile_treshold) np.savetxt("spe_train.dat",spe) _ = hist(spe,bins=100) print (cutoff_spe) # Mahalanobis distance cov = EmpiricalCovariance().fit(latent) md = cov.mahalanobis(latent) cutoff_md = np.percentile(md,percentile_treshold) _ = hist(md,bins=100) np.savetxt("T2_train.dat",md) print (cutoff_md) # Unified Index ui = spe/cutoff_spe + md/cutoff_md cutoff_ui = np.percentile(ui,percentile_treshold) _ = hist(ui,bins=100) print (cutoff_ui) np.savetxt("Unified_index_train.dat",ui) # Hotelling's T^2 Statistic # covariance = cov.covariance_ # # pseudo inverse # inv = np.linalg.pinv(covariance) # t2 = [np.matmul(np.matmul(np.matrix(i),np.matrix(inv)),np.matrix(i).T) for i in latent] # t2 = np.array(t2).squeeze() # Load and normalize Testing Data test_files = [] for i in range(22): test_files.append('d'+format(i, '02d')+"_te.dat") path_to_test = "/home/shanmukh/Documents/IICT/tep-fault-detection/dataset/TE_process/" test_data = [] test_data_normalized = [] for i in test_files: test_data.append(np.loadtxt(path_to_test+i)) test_data_normalized.append(scaler.transform(test_data[-1])) truth = np.ones(shape = (800,)) # Metrics spe_all = [] md_all = [] ui_all = [] missed_detection_rates = [] x = np.array(list(range(960))) temp = 0 for i in test_data_normalized: predictions_test = model.predict(i,batch_size=480) latent_test = encoder.predict(i,batch_size=480) spe_test = np.sum((i - predictions_test)**2,axis=1) md_test = cov.mahalanobis(latent_test) ui_test = spe_test/cutoff_spe + md_test/cutoff_md spe_y = np.zeros_like(spe_test) spe_y[spe_test>cutoff_spe] = 1 md_y = np.zeros_like(md_test) md_y[md_test>cutoff_md] = 1 ui_y = np.zeros_like(ui_test) ui_y[ui_test>cutoff_ui] = 1 np.savetxt("indices/spe_"+test_files[temp],spe_test) np.savetxt("indices/T2_"+test_files[temp],md_test) np.savetxt("indices/Unified_"+test_files[temp],ui_test) # plt.plot(x,spe_test) print (temp,",",1-accuracy_score(spe_y[160:],truth),",",1-accuracy_score(md_y[160:],truth),",",1-accuracy_score(ui_y[160:],truth)) missed_detection_rates.append(1-accuracy_score(ui_y[160:],truth)) temp+=1 np.mean(missed_detection_rates[1:]) x ```
github_jupyter
``` !git clone https://github.com/altaga/Facemask-Opt-Dataset import numpy as np import matplotlib import matplotlib.pyplot as plt import azureml from azureml.core import Workspace, Run ws = Workspace.from_config() experiment_name = 'deeplearning_facemask' from azureml.core import Experiment exp = Experiment(workspace=ws, name=experiment_name) print(exp) from azureml.core.compute import AmlCompute from azureml.core.compute import ComputeTarget import os # choose a name for your cluster compute_name = os.environ.get("AML_COMPUTE_CLUSTER_NAME", "cpu-cluster") compute_min_nodes = os.environ.get("AML_COMPUTE_CLUSTER_MIN_NODES", 0) compute_max_nodes = os.environ.get("AML_COMPUTE_CLUSTER_MAX_NODES", 4) # This example uses CPU VM. For using GPU VM, set SKU to STANDARD_NC6 vm_size = os.environ.get("AML_COMPUTE_CLUSTER_SKU", "STANDARD_D2_V2") if compute_name in ws.compute_targets: compute_target = ws.compute_targets[compute_name] if compute_target and type(compute_target) is AmlCompute: print("found compute target: " + compute_name) else: print("creating new compute target...") provisioning_config = AmlCompute.provisioning_configuration(vm_size = vm_size, min_nodes = compute_min_nodes, max_nodes = compute_max_nodes) # create the cluster compute_target = ComputeTarget.create(ws, compute_name, provisioning_config) # can poll for a minimum number of nodes and for a specific timeout. # if no min node count is provided it will use the scale settings for the cluster compute_target.wait_for_completion(show_output=True, min_node_count=None, timeout_in_minutes=20) # For a more detailed view of current AmlCompute status, use get_status() print(compute_target.get_status().serialize()) from azureml.core.environment import Environment from azureml.core.conda_dependencies import CondaDependencies # to install required packages env = Environment('facemaskenv') cd = CondaDependencies.create(pip_packages=['Pillow','azureml-defaults',"tensorflow","scikit-learn","opencv-python-headless"]) env.python.conda_dependencies = cd # Register environment to re-use later env.register(workspace = ws) from azureml.core import ScriptRunConfig src = ScriptRunConfig(source_directory='', compute_target=compute_target, script='train.py', environment=env) run = Experiment(workspace=ws, name='TF-Facemask').submit(src) run.wait_for_completion(show_output=True) ```
github_jupyter
# The pyabf Cookbook: Using `ABF.memtest` This page demonstrates how to access the abf membrane test data. For theoretical details about membrane properties, how to measure them, and how to computationally create and analyze membrane test data see the [membrane test theory and simulation](memtest-simulation.ipynb) page. For more resources, see the pyABF project website: http://www.GitHub.com/swharden/pyABF ### Common variables: * $ I_{h} $ - average clamp current at the holding voltage (a.k.a. holding current) * $ C_{m} $ - membrane capacitance * $ R_{a} $ - access resistance (synonymous with series resistance) * $ R_{m} $ - membrane resistance (the true property of the cell membrane) * $ \tau $ - (tau) the time constant of the decay curve of a current transient in response to a voltage step ### Prepare the Environment: ``` # prepare the environment import numpy as np np.set_printoptions(precision=3) import matplotlib.pyplot as plt plt.style.use('seaborn') %matplotlib inline ``` ### Load the ABF Class ``` import sys sys.path.insert(0, '../src/') import pyabf pyabf.info() ``` ### Import a Recording _Membrane tests can be analyzed from any episodic voltage clamp recording with a hyperpolarizing current step at the start of every sweep_ ``` abf=pyabf.ABF("../data/16d05007_vc_tags.abf") print("This ABF has %d sweeps"%abf.sweepCount) plt.plot(abf.dataX,abf.dataY) abf.plotDecorate() ``` ### Calculate $I_{h}$, $R_{m}$, $R_{a}$, $C_{m}$, and $\tau$ for Every Sweep ``` abf.memtestAnalyzeAll() ``` ### Display Memtest Averages ``` print("Ih:", abf.memtest.Ih.average, abf.memtest.Ih.units) print("Ra:", abf.memtest.Ra.average, abf.memtest.Ra.units) print("Rm:", abf.memtest.Rm.average, abf.memtest.Rm.units) print("Cm:", abf.memtest.Cm.average, abf.memtest.Cm.units) print("Tau:", abf.memtest.Tau.average, abf.memtest.Tau.units) ``` ### Display Memtest Values per Sweep ``` print(abf.memtest.Ih) ``` ### Plot Memtest Information ``` plt.figure(figsize=(6,8)) ax1=plt.subplot(411) plt.plot(abf.sweepTimesMin,abf.memtest.Ih) plt.title(abf.memtest.Ih.desc, fontweight='bold') plt.ylabel(abf.memtest.Ih.label) plt.subplot(412,sharex=ax1) plt.plot(abf.sweepTimesMin,abf.memtest.Ra) plt.title(abf.memtest.Ra.desc, fontweight='bold') plt.ylabel(abf.memtest.Ra.label) plt.subplot(413,sharex=ax1) plt.plot(abf.sweepTimesMin,abf.memtest.Rm) plt.title(abf.memtest.Rm.desc, fontweight='bold') plt.ylabel(abf.memtest.Rm.label) plt.subplot(414,sharex=ax1) plt.plot(abf.sweepTimesMin,abf.memtest.Cm) plt.title(abf.memtest.Cm.desc, fontweight='bold') plt.ylabel(abf.memtest.Cm.label) plt.xlabel("Experiment Duration (minutes)") plt.margins(0,.1) plt.tight_layout() ```
github_jupyter
# Title of the work ``` import pickle import logging import numpy as np import pandas as pd import tensorflow as tf from sklearn.preprocessing import StandardScaler from sklearn.model_selection import train_test_split from matplotlib import rcParams rcParams['font.size'] = 14 import seaborn as sns import matplotlib.pyplot as plt %matplotlib inline %config InlineBackend.figure_format = 'svg' # logging.getLogger('tensorflow').setLevel(logging.INFO) print('Tensorflow version:', tf.__version__) ``` ## Definitions ``` number_components = [x for x in range(1, 9)] encoder_layers = [ [40], [100, 40], [400, 100, 40], ] lr = 0.01 # lr = 0.001 optimizer = tf.keras.optimizers.SGD(learning_rate=lr) # optimizer = tf.keras.optimizers.RMSprop(learning_rate=lr) # dataset_filter = 'all' # done dataset_filter = 'normal' # doing now seed = 42 np.random.seed(seed) number_epochs = 600 test_size = 0.5 # proportion of the number of samples used for testing, i.e., (1-test_size) used for training figure_format = 'svg' folder = '/nobackup/carda/datasets/ml-simulation-optical/2019-ecoc-demo' ``` ## Importing dataset ``` with open(folder + '/compiled-dataset.h5', 'rb') as file: final_dataframe, scaled_dataframe, class_columns, class_names = pickle.load(file) input_dim = final_dataframe.shape[1] - 3 # the last three columns are classes ``` ## Auxiliary functions ``` def build_model(data_dim, layers, optimizer='sgd', loss='mse', metrics=['mse', 'msle']): model = tf.keras.Sequential(name='encoder_' + '-'.join(str(x) for x in layers)) model.add(tf.keras.layers.Dense(layers[0], input_shape=(data_dim,), name='input_and_0')) for i in range(1, len(layers)-1): model.add(tf.keras.layers.Dense(layers[i], name=f'encoder_{i}')) print('enc:', layers[i], i) # model.add(tf.keras.layers.Dense(layers[len(layers)-1], name=f'encoder_{len(layers)-1}', activation='tanh')) for i in range(len(layers)-1, -1, -1): model.add(tf.keras.layers.Dense(layers[i], name=f'decoder_{i}')) print('dec:', layers[i], i) # model.add(DenseTied(model.layers[i], name=f'decoder_{i}')) model.add(tf.keras.layers.Dense(data_dim, name=f'output')) model.compile(optimizer=optimizer, loss=loss, metrics=metrics) return model ``` ## Building training and testing datasets ``` if dataset_filter == 'normal': normal_conditions = scaled_dataframe[(scaled_dataframe['attack'] == 0)].values else: normal_conditions = scaled_dataframe.values x_train, x_test, y_train, y_test = train_test_split(normal_conditions[:, :input_dim], normal_conditions[:, -1], test_size=test_size, random_state=seed) ``` ## Training the autoencoders ``` histories = [] for layer in encoder_layers: for n_components in number_components: final_layer = layer + [n_components] print(final_layer) model = build_model(input_dim, final_layer, optimizer=optimizer) model.summary() # saving a graphical representation tf.keras.utils.plot_model(model, to_file=f'./models/{dataset_filter}_{optimizer._name}_{lr}_{model.name}-model.png', show_shapes=True, show_layer_names=False) history = model.fit(x_train, x_train, epochs=number_epochs, batch_size=64, verbose=0, validation_data=(x_test, x_test)) model.save(f'./models/{dataset_filter}_{optimizer._name}_{lr}_{model.name}-model.h5') histories.append(history.history) metrics = [x for x in histories[0].keys() if 'val' not in x] for i, metric in enumerate(metrics): plt.figure(figsize=(12, 4.5)) plt.subplot(1, 2, 1) plt.title(f'Optm: {optimizer._name} / lr: {lr}') for j, layer in enumerate(encoder_layers): for n_components in number_components: layers = layer + [n_components] ls = '-' if len(layers) == 2: ls = '-' elif len(layers) == 3: ls = ':' elif len(layers) == 4: ls = '--' plt.semilogy(histories[j][metric], label='-'.join(str(x) for x in layers), linestyle=ls) plt.xlabel('Epoch') plt.ylabel(metric) plt.subplot(1, 2, 2) for j, layer in enumerate(encoder_layers): for n_components in number_components: layers = layer + [n_components] ls = '-' if len(layers) == 2: ls = '-' elif len(layers) == 3: ls = ':' elif len(layers) == 4: ls = '--' diff = np.array(histories[j]['val_' + metric]) - np.array(histories[j][metric]) print(j, np.sum(diff), np.mean(diff)) plt.semilogy(histories[j]['val_' + metric], label='-'.join(str(x) for x in layers), linestyle=ls) plt.xlabel('Epoch') plt.ylabel('val ' + metric) # plt.xlim([-5, 50]) plt.legend(ncol=2) plt.tight_layout() plt.savefig(f'./figures/{dataset_filter}_{optimizer._name}_{lr}_{"-".join(str(x) for x in layers)}-accuracy-{metric}.{figure_format}') plt.show() with open(f'./models/{dataset_filter}_histories.h5', 'wb') as file: pickle.dump({'histories': histories}, file) print('done') ```
github_jupyter
# Part 3: Serving In this part we will user MLRun's **serving runtime** to deploy our trained models from the previous stage a `Voting Ensemble` using **max vote** logic. We will also use MLRun's **Feature store** to receive the online **Feature Vector** we define in the preveious stage. We will: - Define a model class to load our models, run preprocessing and predict on the data - Define Voting Ensemble function on top of our models - Test the serving function locally using our `mock server` - Deploy the function to the cluster and test it live <img src="../../_static/images/feature_store_demo_diagram.png" width="600px" /> ## Environment Setup Since our work is done in a this project scope, we will first want to define the project itself for all our MLRun work in this notebook. ``` import mlrun project, _ = mlrun.set_environment(project='fsdemo', user_project=True) ``` ## Define Model Class - Load models - Predict from the FS Online service via the `patient_id` key ``` # nuclio: start-code from cloudpickle import load import numpy as np import mlrun import os class ClassifierModel(mlrun.serving.V2ModelServer): def load(self): """load and initialize the model and/or other elements""" model_file, extra_data = self.get_model('.pkl') self.model = load(open(model_file, 'rb')) # Setup FS Online service self.feature_service = mlrun.feature_store.get_online_feature_service('patient-deterioration') # Get feature vector statistics for imputing self.feature_stats = self.feature_service.vector.get_stats_table() def preprocess(self, body: dict, op) -> list: # Get patient feature vector # from the patient_id given in the request vectors = self.feature_service.get([{'patient_id': patient_id} for patient_id in body['inputs']]) # Impute inf's in the data to the feature's mean value # using the collected statistics from the Feature store feature_vectors = [] for fv in vectors: new_vec = [] for f, v in fv.items(): if np.isinf(v): new_vec.append(self.feature_stats.loc[f, 'mean']) else: new_vec.append(v) feature_vectors.append(new_vec) # Set the final feature vector as our inputs # to pass to the predict function body['inputs'] = feature_vectors return body def predict(self, body: dict) -> list: """Generate model predictions from sample""" feats = np.asarray(body['inputs']) result: np.ndarray = self.model.predict(feats) return result.tolist() # nuclio: end-code ``` ## Define Serving Function - Gather ClassifierModel code from this notebook - Define `VotingEnsemble` - Max-Vote based ensemble - Add downloaded models to the ensemble ``` # Create the serving function from our code above fn = mlrun.code_to_function('patient-prediction', kind='serving', image="mlrun/mlrun") # Set the Voting Ensemble as our router fn.set_topology('router', 'mlrun.serving.VotingEnsemble', name='PatientDeterioration') # Add the three previously trained models to the ensemble models_dir = os.path.abspath('models') for name in ['1-patient_det_rf', '2-patient_det_xgboost', '3-patient_det_adaboost']: fn.add_model(name, class_name="ClassifierModel", model_path=f"store://artifacts/{project}/training_model:latest") # Plot the ensemble configuration fn.spec.graph.plot() ``` ## Test the server locally ``` # Create a mock server from the serving function server = fn.to_mock_server() ``` **Test the server locally with a sample id** ``` resp = server.test('/v2/models/infer', body={'inputs': ['622-37-0180']}) resp ``` ## Deploy the function to the cluster (using Nuclio) and test it ``` # Enable MLRun's model monitoring fn.set_tracking() # Add the system mount to the function so # it will have access to our models fn.apply(mlrun.mount_v3io()) # Deploy the function to the cluster fn.deploy() ``` **Test the function on the cluster using the `invoke` mechanism** ``` import json fn.invoke('/v2/models/infer', body={'inputs': ['622-37-0180']}) import json fn.invoke(path='/v2/models/infer', body=json.dumps({'inputs': ['622-37-0180']})) ```
github_jupyter
Ordinal Regression -- Ordinal regression aims at fitting a model to some data $(X, Y)$, where $Y$ is an ordinal variable. To do so, we use a `VPG` model with a specific likelihood (`gpflow.likelihoods.Ordinal`). ``` import gpflow import numpy as np import matplotlib %matplotlib inline matplotlib.rcParams['figure.figsize'] = (12, 6) plt = matplotlib.pyplot #make a one dimensional ordinal regression problem # This function generates a set of inputs X, # quantitative output f (latent) and ordinal values Y def generate_data(num_data): # First generate random inputs X = np.random.rand(num_data, 1) # Now generate values of a latent GP kern = gpflow.kernels.RBF(1, lengthscales=0.1) K = kern.compute_K_symm(X) f = np.random.multivariate_normal(mean=np.zeros(num_data), cov=K).reshape(-1, 1) # Finally convert f values into ordinal values Y Y = np.round((f + f.min())*3) Y = Y - Y.min() Y = np.asarray(Y, np.float64) return X, f, Y np.random.seed(1) num_data = 20 X, f, Y = generate_data(num_data) plt.figure(figsize=(11, 6)) plt.plot(X, f, '.') plt.ylabel('latent function value') plt.twinx() plt.plot(X, Y, 'kx', mew=1.5) plt.ylabel('observed data value') # construct ordinal likelihood - bin_edges is the same as unique(Y) but centered bin_edges = np.array(np.arange(np.unique(Y).size + 1), dtype=float) bin_edges = bin_edges - bin_edges.mean() likelihood=gpflow.likelihoods.Ordinal(bin_edges) # build a model with this likelihood m = gpflow.models.VGP(X, Y, kern=gpflow.kernels.Matern32(1), likelihood=likelihood) # fit the model gpflow.train.ScipyOptimizer().minimize(m) # here we'll plot the expected value of Y +- 2 std deviations, as if the distribution were Gaussian plt.figure(figsize=(11, 6)) Xtest = np.linspace(m.X.read_value().min(), m.X.read_value().max(), 100).reshape(-1, 1) mu, var = m.predict_y(Xtest) line, = plt.plot(Xtest, mu, lw=2) col=line.get_color() plt.plot(Xtest, mu+2*np.sqrt(var), '--', lw=2, color=col) plt.plot(Xtest, mu-2*np.sqrt(var), '--', lw=2, color=col) plt.plot(m.X.read_value(), m.Y.read_value(), 'kx', mew=2) # to see the predictive density, try predicting every possible discrete value for Y. def pred_density(m): Xtest = np.linspace(m.X.read_value().min(), m.X.read_value().max(), 100).reshape(-1, 1) ys = np.arange(m.Y.read_value().max()+1) densities = [] for y in ys: Ytest = np.ones_like(Xtest) * y # Predict the log density densities.append(m.predict_density(Xtest, Ytest)) return np.hstack(densities).T fig = plt.figure(figsize=(14, 6)) plt.imshow(np.exp(pred_density(m)), interpolation='nearest', extent=[m.X.read_value().min(), m.X.read_value().max(), -0.5, m.Y.read_value().max()+0.5], origin='lower', aspect='auto', cmap=plt.cm.viridis) plt.colorbar() plt.plot(X, Y, 'kx', mew=2, scalex=False, scaley=False) # Predictive density for a single input x=0.5 x_new = 0.5 ys = np.arange(np.max(m.Y.value+1)).reshape([-1, 1]) x_new_vec = x_new*np.ones_like(ys) # for predict_density x and y need to have the same number of rows dens_new = np.exp(m.predict_density(x_new_vec, ys)) fig = plt.figure(figsize=(8, 4)) plt.bar(x=ys.flatten(), height=dens_new.flatten()) ```
github_jupyter
<a href="https://colab.research.google.com/github/noorhaq/Google_Colab/blob/master/Welcome_To_Colaboratory.ipynb" target="_parent"><img src="https://colab.research.google.com/assets/colab-badge.svg" alt="Open In Colab"/></a> <p><img alt="Colaboratory logo" height="45px" src="/img/colab_favicon.ico" align="left" hspace="10px" vspace="0px"></p> <h1>What is Colaboratory?</h1> Colaboratory, or "Colab" for short, allows you to write and execute Python in your browser, with - Zero configuration required - Free access to GPUs - Easy sharing Whether you're a **student**, a **data scientist** or an **AI researcher**, Colab can make your work easier. Watch [Introduction to Colab](https://www.youtube.com/watch?v=inN8seMm7UI) to learn more, or just get started below! ## **Getting started** The document you are reading is not a static web page, but an interactive environment called a **Colab notebook** that lets you write and execute code. For example, here is a **code cell** with a short Python script that computes a value, stores it in a variable, and prints the result: ``` seconds_in_a_day = 24 * 60 * 90 seconds_in_a_day ``` To execute the code in the above cell, select it with a click and then either press the play button to the left of the code, or use the keyboard shortcut "Command/Ctrl+Enter". To edit the code, just click the cell and start editing. Variables that you define in one cell can later be used in other cells: ``` seconds_in_a_week = 7 * seconds_in_a_day seconds_in_a_week ``` Colab notebooks allow you to combine **executable code** and **rich text** in a single document, along with **images**, **HTML**, **LaTeX** and more. When you create your own Colab notebooks, they are stored in your Google Drive account. You can easily share your Colab notebooks with co-workers or friends, allowing them to comment on your notebooks or even edit them. To learn more, see [Overview of Colab](/notebooks/basic_features_overview.ipynb). To create a new Colab notebook you can use the File menu above, or use the following link: [create a new Colab notebook](http://colab.research.google.com#create=true). Colab notebooks are Jupyter notebooks that are hosted by Colab. To learn more about the Jupyter project, see [jupyter.org](https://www.jupyter.org). ## Data science With Colab you can harness the full power of popular Python libraries to analyze and visualize data. The code cell below uses **numpy** to generate some random data, and uses **matplotlib** to visualize it. To edit the code, just click the cell and start editing. ``` import numpy as np from matplotlib import pyplot as plt ys = 200 + np.random.randn(100) x = [x for x in range(len(ys))] plt.plot(x, ys, '-') plt.fill_between(x, ys, 195, where=(ys > 195), facecolor='g', alpha=0.6) plt.title("Sample Visualization") plt.show() ``` You can import your own data into Colab notebooks from your Google Drive account, including from spreadsheets, as well as from Github and many other sources. To learn more about importing data, and how Colab can be used for data science, see the links below under [Working with Data](#working-with-data). ## Machine learning With Colab you can import an image dataset, train an image classifier on it, and evaluate the model, all in just [a few lines of code](https://colab.research.google.com/github/tensorflow/docs/blob/master/site/en/tutorials/quickstart/beginner.ipynb). Colab notebooks execute code on Google's cloud servers, meaning you can leverage the power of Google hardware, including [GPUs and TPUs](#using-accelerated-hardware), regardless of the power of your machine. All you need is a browser. Colab is used extensively in the machine learning community with applications including: - Getting started with TensorFlow - Developing and training neural networks - Experimenting with TPUs - Disseminating AI research - Creating tutorials To see sample Colab notebooks that demonstrate machine learning applications, see the [machine learning examples](#machine-learning-examples) below. ## More Resources ### Working with Notebooks in Colab - [Overview of Colaboratory](/notebooks/basic_features_overview.ipynb) - [Guide to Markdown](/notebooks/markdown_guide.ipynb) - [Importing libraries and installing dependencies](/notebooks/snippets/importing_libraries.ipynb) - [Saving and loading notebooks in GitHub](https://colab.research.google.com/github/googlecolab/colabtools/blob/master/notebooks/colab-github-demo.ipynb) - [Interactive forms](/notebooks/forms.ipynb) - [Interactive widgets](/notebooks/widgets.ipynb) - <img src="/img/new.png" height="20px" align="left" hspace="4px" alt="New"></img> [TensorFlow 2 in Colab](/notebooks/tensorflow_version.ipynb) <a name="working-with-data"></a> ### Working with Data - [Loading data: Drive, Sheets, and Google Cloud Storage](/notebooks/io.ipynb) - [Charts: visualizing data](/notebooks/charts.ipynb) - [Getting started with BigQuery](/notebooks/bigquery.ipynb) ### Machine Learning Crash Course These are a few of the notebooks from Google's online Machine Learning course. See the [full course website](https://developers.google.com/machine-learning/crash-course/) for more. - [Intro to Pandas](/notebooks/mlcc/intro_to_pandas.ipynb) - [Tensorflow concepts](/notebooks/mlcc/tensorflow_programming_concepts.ipynb) - [First steps with TensorFlow](/notebooks/mlcc/first_steps_with_tensor_flow.ipynb) - [Intro to neural nets](/notebooks/mlcc/intro_to_neural_nets.ipynb) - [Intro to sparse data and embeddings](/notebooks/mlcc/intro_to_sparse_data_and_embeddings.ipynb) <a name="using-accelerated-hardware"></a> ### Using Accelerated Hardware - [TensorFlow with GPUs](/notebooks/gpu.ipynb) - [TensorFlow with TPUs](/notebooks/tpu.ipynb) <a name="machine-learning-examples"></a> ## Machine Learning Examples To see end-to-end examples of the interactive machine learning analyses that Colaboratory makes possible, check out these tutorials using models from [TensorFlow Hub](https://tfhub.dev). A few featured examples: - [Retraining an Image Classifier](https://tensorflow.org/hub/tutorials/tf2_image_retraining): Build a Keras model on top of a pre-trained image classifier to distinguish flowers. - [Text Classification](https://tensorflow.org/hub/tutorials/tf2_text_classification): Classify IMDB movie reviews as either *positive* or *negative*. - [Style Transfer](https://tensorflow.org/hub/tutorials/tf2_arbitrary_image_stylization): Use deep learning to transfer style between images. - [Multilingual Universal Sentence Encoder Q&A](https://tensorflow.org/hub/tutorials/retrieval_with_tf_hub_universal_encoder_qa): Use a machine learning model to answer questions from the SQuAD dataset. - [Video Interpolation](https://tensorflow.org/hub/tutorials/tweening_conv3d): Predict what happened in a video between the first and the last frame.
github_jupyter
<div class="contentcontainer med left" style="margin-left: -50px;"> <dl class="dl-horizontal"> <dt>Title</dt> <dd> QuadMesh Element</dd> <dt>Dependencies</dt> <dd>Matplotlib</dd> <dt>Backends</dt> <dd><a href='./QuadMesh.ipynb'>Matplotlib</a></dd> <dd><a href='../bokeh/QuadMesh.ipynb'>Bokeh</a></dd> </dl> </div> ``` import numpy as np import holoviews as hv hv.extension('matplotlib') ``` A ``QuadMesh`` represents 2D rectangular grid expressed as x- and y-coordinates defined as 1D or 2D arrays. Unlike the Image type, a QuadMesh may be regularly or irregularly spaced and contain either bin edges or bin centers. If bin edges are supplied, the shape of the x/y-coordinate arrays should be one greater than the value array shape. The default interface expects data to be specified in the form: QuadMesh((X, Y, Z)) where ``X`` and ``Y`` may be 1D or 2D arrays of the shape ``N(+1)`` and ``M(+1)`` respectively or ``N(+1)xM(+1)`` and the ``Z`` value array should be of shape NxM. Other gridded formats such as xarray are also supported if installed. The grid orientation follows the standard matrix convention: An array ``Z`` with shape (nrows, ncolumns) is plotted with the column number as ``X`` and the row number as ``Y``. See the [Gridded Datasets](../../../user_guide/08-Gridded_Datasets.ipynb) user guide for all the other accepted data formats. Here is a simple ``QuadMesh`` with logarithmic sampling along the 'x' dimensions: ``` n = 8 # Number of bins in each direction xs = np.logspace(1, 3, n) ys = np.linspace(1, 10, n) zs = np.arange((n-1)**2).reshape(n-1, n-1) print('Shape of x-coordinates:', xs.shape) print('Shape of y-coordinates:', ys.shape) print('Shape of value array:', zs.shape) hv.QuadMesh((xs, ys, zs)) ``` The coordinate system of a ``QuadMesh`` is defined by the bin edges, therefore any index falling into a binned region will return the appropriate value. As the bin edges have continuous values, you can use non-linear axes such as log axes: ``` %%opts QuadMesh [xticks=[10, 100,1000]] QuadMesh.LogScale [logx=True] hv.QuadMesh((xs, ys, zs), group='LinearScale') + hv.QuadMesh((xs, ys, zs), group='LogScale') ``` Unlike ``Image`` objects, slices must be inclusive of the bin edges but otherwise the slicing semantics are the same. The reason for this difference is that ``QuadMesh`` is really a two-dimensional histogram and when slicing, you only want to see the bins that fall within the specified slice ranges. In the next example, we specify a slice along the x- and y-axis to extract the lower corner and we set the z-dimension range to maintain the full color range of the colormap: ``` qmesh = hv.QuadMesh((xs, ys, zs)) qmesh[20:400, :8].redim.range(z=qmesh.range('z')) ``` To use an interactive hover tool to inspect the sample values, you can use ``QuadMesh`` with the hover tool in the [Bokeh backend](../bokeh/QuadMesh.ipynb). For full documentation and the available style and plot options, use ``hv.help(hv.QuadMesh).`` ## Irregular meshes In addition to axis aligned meshes like those we worked with above, a ``QuadMesh`` may also be used to represent irregular or unstructured meshes. In this example we will create an irregular mesh consisting of 2D X, Y and Z arrays defining the position and value of each simplex in the mesh: ``` n=20 coords = np.linspace(-1.5,1.5,n) X,Y = np.meshgrid(coords, coords); Qx = np.cos(Y) - np.cos(X) Qy = np.sin(Y) + np.sin(X) Z = np.sqrt(X**2 + Y**2) print('Shape of x-coordinates:', Qx.shape) print('Shape of y-coordinates:', Qy.shape) print('Shape of value array:', Z.shape) qmesh = hv.QuadMesh((Qx, Qy, Z)) qmesh ``` To illustrate irregular meshes a bit further we will randomly jitter the mesh coordinates along both dimensions, demonstrating that ``QuadMesh`` may be used to represent completely arbitrary meshes. It may also be used to represent overlapping meshes, however the behavior during slicing and other operations may not be well defined in such cases. ``` np.random.seed(13) xs, ys = np.meshgrid(np.linspace(-20, 20, 10), np.linspace(0, 30, 8)) xs += xs/10 + np.random.rand(*xs.shape)*4 ys += ys/10 + np.random.rand(*ys.shape)*4 zs = np.arange(80).reshape(8, 10) hv.QuadMesh((xs, ys, zs)) ```
github_jupyter
# `ricecooker` exercises This mini-tutorial will walk you through the steps of running a simple chef script `ExercisesChef` that creates two exercises nodes, and four exercises questions. ### Running the notebooks To follow along and run the code in this notebook, you'll need to clone the `ricecooker` repository, crate a virtual environement, install `ricecooker` using `pip install ricecooker`, install Jypyter notebook using `pip install jupyter`, then start the jupyter notebook server by running `jupyter notebook`. You will then be able to run all the code sections in this notebook and poke around. ### Creating a Sushi Chef class ``` from ricecooker.chefs import SushiChef from ricecooker.classes.nodes import TopicNode, ExerciseNode from ricecooker.classes.questions import SingleSelectQuestion, MultipleSelectQuestion, InputQuestion, PerseusQuestion from ricecooker.classes.licenses import get_license from le_utils.constants import licenses from le_utils.constants import exercises from le_utils.constants.languages import getlang class ExercisesChef(SushiChef): channel_info = { 'CHANNEL_TITLE': 'Sample Exercises', 'CHANNEL_SOURCE_DOMAIN': '<yourdomain.org>', # where you got the content 'CHANNEL_SOURCE_ID': '<unique id for channel>', # channel's unique id CHANGE ME 'CHANNEL_LANGUAGE': 'en', # le_utils language code 'CHANNEL_DESCRIPTION': 'A test channel with different types of exercise questions', # (optional) 'CHANNEL_THUMBNAIL': None, # (optional) } def construct_channel(self, **kwargs): channel = self.get_channel(**kwargs) topic = TopicNode(title="Math Exercises", source_id="folder-id") channel.add_child(topic) exercise_node = ExerciseNode( source_id='<some unique id>', title='Basic questions', author='LE content team', description='Showcase of the simple question type supported by Ricecooker and Studio', language=getlang('en').code, license=get_license(licenses.PUBLIC_DOMAIN), thumbnail=None, exercise_data={ 'mastery_model': exercises.M_OF_N, # \ 'm': 2, # learners must get 2/3 questions correct to complete exercise 'n': 3, # / 'randomize': True, # show questions in random order }, questions=[ MultipleSelectQuestion( id='sampleEX_Q1', question = "Which numbers the following numbers are even?", correct_answers = ["2", "4",], all_answers = ["1", "2", "3", "4", "5"], hints=['Even numbers are divisible by 2.'], ), SingleSelectQuestion( id='sampleEX_Q2', question = "What is 2 times 3?", correct_answer = "6", all_answers = ["2", "3", "5", "6"], hints=['Multiplication of $a$ by $b$ is like computing the area of a rectangle with length $a$ and width $b$.'], ), InputQuestion( id='sampleEX_Q3', question = "Name one of the *factors* of 10.", answers = ["1", "2", "5", "10"], hints=['The factors of a number are the divisors of the number that leave a whole remainder.'], ) ] ) topic.add_child(exercise_node) # LOAD JSON DATA (as string) FOR PERSEUS QUESTIONS RAW_PERSEUS_JSON_STR = open('../../examples/exercises/chefdata/perseus_graph_question.json', 'r').read() # or # import requests # RAW_PERSEUS_JSON_STR = requests.get('https://raw.githubusercontent.com/learningequality/sample-channels/master/contentnodes/exercise/perseus_graph_question.json').text exercise_node2 = ExerciseNode( source_id='<another unique id>', title='An exercise containing a perseus question', author='LE content team', description='An example exercise with a Persus question', language=getlang('en').code, license=get_license(licenses.CC_BY, copyright_holder='Copyright holder name'), thumbnail=None, exercise_data={ 'mastery_model': exercises.M_OF_N, 'm': 1, 'n': 1, }, questions=[ PerseusQuestion( id='ex2bQ4', raw_data=RAW_PERSEUS_JSON_STR, source_url='https://github.com/learningequality/sample-channels/blob/master/contentnodes/exercise/perseus_graph_question.json' ), ] ) topic.add_child(exercise_node2) return channel ``` ### Running the chef Run of you chef by creating an instance of the chef class and calling it's `run` method: ``` chef = ExercisesChef() args = { 'command': 'dryrun', # use 'uploadchannel' for real run 'verbose': True, 'token': 'YOURTOKENHERE9139139f3a23232' } options = {} chef.run(args, options) ``` Congratulations, you put some math exercises on the internet! **Note**: you will need to change the value of `CHANNEL_SOURCE_ID` if you before you try running this script with `{'command': 'uploadchannel', ...}`. The combination of source domain and source id are used to compute the `channel_id` for the Kolibri channel you're creating. If you keep the lines above unchanged, you'll get an error because you don't have edit rights on that channel.
github_jupyter
``` import numpy as np # linear algebra import pandas as pd # data processing, CSV file I/O (e.g. pd.read_csv) import json import cx_Oracle import os import pandas as pd os.environ['TNS_ADMIN'] = '/home/opc/adj_esportsdb' !pip install dataprep !pip install dask !pip install pandas_profiling ## install packages !pip install -q scikit-learn !pip install -U setuptools wheel !pip install -U "mxnet<2.0.0" !pip install autogluon import cx_Oracle import yaml import os from pathlib import Path home = str(Path.home()) def process_yaml(): with open("../config.yaml") as file: return yaml.safe_load(file) class OracleJSONDatabaseConnection: def __init__(self, data=process_yaml()): # wallet location (default is HOME/wallets/wallet_X) os.environ['TNS_ADMIN'] = '{}/{}'.format(home, process_yaml()['WALLET_DIR']) print(os.environ['TNS_ADMIN']) self.pool = cx_Oracle.SessionPool(data['db']['username'], data['db']['password'], data['db']['dsn'], min=1, max=4, increment=1, threaded=True, getmode=cx_Oracle.SPOOL_ATTRVAL_WAIT ) print('Connection successful.') def close_pool(self): self.pool.close() print('Connection pool closed.') def insert(self, collection_name, json_object_to_insert): connection = self.pool.acquire() connection.autocommit = True soda = connection.getSodaDatabase() x_collection = soda.createCollection(collection_name) try: x_collection.insertOne(json_object_to_insert) print('[DBG] INSERT {} OK'.format(json_object_to_insert)) except cx_Oracle.IntegrityError: print('[DBG] INSERT {} ERR'.format(json_object_to_insert)) return 0 self.pool.release(connection) return 1 def delete(self, collection_name, on_column, on_value): connection = self.pool.acquire() soda = connection.getSodaDatabase() x_collection = soda.createCollection(collection_name) qbe = {on_column: on_value} x_collection.find().filter(qbe).remove() self.pool.release(connection) def get_connection(self): return self.pool.acquire() def close_connection(self, conn_object): self.pool.release(conn_object) def get_collection_names(self): connection = self.pool.acquire() returning_object = connection.getSodaDatabase().getCollectionNames(startName=None, limit=0) self.pool.release(connection) return returning_object def open_collection(self, collection_name): connection = self.pool.acquire() returning_object = self.pool.acquire().getSodaDatabase().openCollection(collection_name) self.pool.release(connection) return returning_object def test_class(): object = OracleJSONDatabaseConnection() print(object.pool) object.close_pool() print(os.environ['TNS_ADMIN']) db = OracleJSONDatabaseConnection() print(db.get_collection_names()) data = db.open_collection('predictor_liveclient') all_data = list() for doc in data.find().getCursor(): content = doc.getContent() all_data.append(content) print('Data length: {}'.format(len(all_data))) df = pd.read_json(json.dumps(all_data), orient='records') df.head(5) df.describe() from pandas_profiling import ProfileReport report = ProfileReport(df) report #uncomment to display all. from autogluon.tabular import TabularPredictor, TabularDataset df = TabularDataset(df) # drop columns we don't want (constant values + identifier) df = df.drop(columns=['bonusArmorPenetrationPercent', 'bonusMagicPenetrationPercent', 'identifier', 'cooldownReduction', 'armorPenetrationFlat']) train = df.sample(frac=0.8,random_state=200) #random state is a seed value test = df.drop(train.index) train.head(5) label = 'winner' save_path = './autogluon_trained_models_liveclient_classifier' # specifies folder to store trained models predictor = TabularPredictor(label=label, path=save_path).fit(train) y_test = test[label] # values to predict test_data_nolabel = test.drop(columns=[label]) # delete label column to prove we're not cheating, also drop identifier column test_data_nolabel.head(5) predictor = TabularPredictor.load(save_path) y_pred = predictor.predict(test_data_nolabel) print("Predictions: \n", y_pred) perf = predictor.evaluate_predictions(y_true=y_test, y_pred=y_pred, auxiliary_metrics=True) predictor.leaderboard(test, silent=False) predictor.feature_importance(test) ```
github_jupyter
# PENSA Tutorial Using GPCRmd Trajectories Here we show some common functions included in PENSA, using trajectories of a G protein-coupled receptor (GPCR). We retrieve the molecular dynamics trajectories for this tutorial from [GPCRmd](https://submission.gpcrmd.org/home/), an online platform for collection and curation of GPCR simulations. It is described in more detail [here](https://www.nature.com/articles/s41592-020-0884-y). <p align="center"> <img src="https://pbs.twimg.com/media/Ej8-VJ5WkAAbgJc?format=jpg&name=large" width="500"> </p> The example system is the mu-opioid receptor (mOR), once in its apo form and once bound to the ligand [BU72](https://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=9363). The structure of this GPCR (G protein-coupled receptor) is reported by [*Huang et al (2015)*](https://www.nature.com/articles/nature14886). We are going to compare the structural ensembles of the receptor in these two conditions. This tutorial assumes that you can download the trajectories (see below). If you can't, you can use any other system you have available and adapt the file names and residue selections accordingly. We only need to import the module "os" and all functions from PENSA itself which in turn loads all the modules it needs. ``` import os from pensa import * ``` ## Download PENSA has a predefined function to download GPCRmd trajectories. ``` # Define where to save the GPCRmd files root_dir = './mor-data' # Define which files to download md_files = ['11427_dyn_151.psf','11426_dyn_151.pdb', # MOR-apo '11423_trj_151.xtc','11424_trj_151.xtc','11425_trj_151.xtc', '11580_dyn_169.psf','11579_dyn_169.pdb', # MOR-BU72 '11576_trj_169.xtc','11577_trj_169.xtc','11578_trj_169.xtc'] # Download all the files that do not exist yet for file in md_files: if not os.path.exists(os.path.join(root_dir,file)): download_from_gpcrmd(file,root_dir) ``` ## Preprocessing To work with the protein coordinates, we first need to extract them from the simulation, i.e., remove the solvent, lipids etc. This is the hardest part but you usually only have to do it once and can then play with your data. Preprocessing can handle many common trajectory formats (as it is based on MDAnalysis) but the internal featurization (based on PyEMMA) is a bit more restrictive, so we will always write xtc trajectories. For large trajectories, you might want to use the scripts provided in the PENSA repository, e.g., to run them on the computing cluster and then download the processed data. Once you know how PENSA works, you can write your own scripts. In the following, we define the necessary files. For each simulation, we need a reference file (.psf for AMBER), a PDB file, and the trajetory. Make sure to adapt the root directory such that it links to wherever you have mounted Oak. I you cannot access the Sherlock cluster at Stanford, use any other simulation that you would like to compare. To run this tutorial on another system, you'll have to adapt the file paths and names in the following box and, in case you need them, the residue selections in the folder ```selections```. We explain how they work further below. Note that for some PENSA functions it is sufficient that the derived features are the same while for others (especially those that involve trajectory manipulation), all atoms need to be the same. In our particular example, we exclude hydrogen atoms because residue Asp114 is protonated in the BU72 simulation but not in the apo simulation. ``` root_dir = './mor-data' # Simulation A ref_file_a = root_dir+'/11427_dyn_151.psf' pdb_file_a = root_dir+'/11426_dyn_151.pdb' trj_file_a = [root_dir+'/11423_trj_151.xtc', root_dir+'/11424_trj_151.xtc', root_dir+'/11425_trj_151.xtc'] # Simulation B ref_file_b = root_dir+'/11580_dyn_169.psf' pdb_file_b = root_dir+'/11579_dyn_169.pdb' trj_file_b = [root_dir+'/11576_trj_169.xtc', root_dir+'/11577_trj_169.xtc', root_dir+'/11578_trj_169.xtc'] # Base for the selection string for each simulation sel_base_a = "(not name H*) and protein" sel_base_b = "(not name H*) and protein" # Names of the output files out_name_a = "traj/condition-a" out_name_b = "traj/condition-b" out_name_combined="traj/combined" ``` For this tutorial, we will save the processed trajectories in the subfolder ```traj```. We also create subfolders for other results that we will generate. ``` for subdir in ['traj','plots','vispdb','pca','clusters','results']: if not os.path.exists(subdir): os.makedirs(subdir) ``` We have to ensure that from both simulations, we use the exact same parts of the receptor for the analysis. Often, this will be easy and you just provide a simple selection string for the corresponding segment. For more complicated cases, we can use the function ```load_selection()``` to generate a complete residue list from a plain text file. This file should provide in each line the first and the last residue to be considered for a part of the protein. In the first case, we will extract all protein residues, assuming (correctly) that the same ones are present in both simulations. ``` # Extract the coordinates of the receptor from the trajectory extract_coordinates(ref_file_a, pdb_file_a, trj_file_a, out_name_a+"_receptor", sel_base_a) extract_coordinates(ref_file_b, pdb_file_b, trj_file_b, out_name_b+"_receptor", sel_base_b) ``` In many cases, you probably have several runs of the same simulation that you want to combine to one structural ensemble. This is why the trajectory argument takes a list as arguments, e.g. extract_coordinates(system.psf, system.pdb, ['run1.nc','run2.nc','run3.nc'], 'rho_receptor', 'protein', start_frame=1000) With the option ```start_frame```, you can exclude the equilibrium phase already at this stage. Be aware that in combined simulations, there is no straightforward way to exclude it later as it would require bookkeeping about how long each simulation was etc. For some analysis types, we only want to use the part of the receptor that is inside the membrane. In this way, very flexible loops outside the membrane cannot distort the analysis result. We can manually construct a selection string in MDAnalysis format or load the selections from a file. We call this file ```mor_tm.txt``` and generate it on the fly so we can demonstrate the loader function. We use selections based on the definitions of transmembrane helices in the [GPCRdb](https://gpcrdb.org/protein/oprm_human/). ``` ! echo "76 98\n105 133\n138 173\n182 208\n226 264\n270 308\n315 354" > mor_tm.txt ! cat mor_tm.txt # Load the selection and generate the strings sel_string_a = load_selection("mor_tm.txt", sel_base_a+" and ") print('Selection A:\n', sel_string_a, '\n') sel_string_b = load_selection("mor_tm.txt", sel_base_b+" and ") print('Selection B:\n', sel_string_b, '\n') # Extract the coordinates of the transmembrane region from the trajectory extract_coordinates(ref_file_a, pdb_file_a, [trj_file_a], out_name_a+"_tm", sel_string_a) extract_coordinates(ref_file_b, pdb_file_b, [trj_file_b], out_name_b+"_tm", sel_string_b) ``` ### Generalization If you want to combine data from different simulation conditions, you can use the ```_combined``` version of the extraction function: ```extract_coordinates_combined()```. It takes lists as arguments for the topology files, too. To use the same selection, "multiply" a list of one string, as demonstrated below. For this to work, the two selections need to have the exactly same atoms. ``` extract_coordinates_combined([ref_file_a]*3 + [ref_file_b]*3, trj_file_a + trj_file_b, [sel_string_a]*3 + [sel_string_b]*3, 'traj/combined_tm.xtc', start_frame=400) ``` ## Featurization The analysis is not performed on the coordinates directly but on features derived from these coordinates. PENSA uses the featurization provided by PyEMMA, so far including: - backbone torsions: ```'bb-torsions'```, - backbone C-alpha distances: ```'bb-distances'```, and - sidechain torsions: ```'sc-torsions'```. You can combine these with any other function implemented in PyEMMA, even if it is not included in PENSA. In case the equilibration phase has not been already excluded during preprocessing, we can exclude it here by setting the start frame to a value greater than 0. ``` feature_start_frame = 400 ``` The function ```get_structure_features``` loads the names of the features and their values separately ``` sim_a_rec = get_structure_features("traj/condition-a_receptor.gro", "traj/condition-a_receptor.xtc", feature_start_frame) sim_a_rec_feat, sim_a_rec_data = sim_a_rec sim_b_rec = get_structure_features("traj/condition-b_receptor.gro", "traj/condition-b_receptor.xtc", feature_start_frame) sim_b_rec_feat, sim_b_rec_data = sim_b_rec ``` Having a look at the shape of the loaded data, we see that the first dimension is the number of frames. The second dimension is the number of features. It must be the same for both simulations. ``` for k in sim_a_rec_data.keys(): print(k, sim_a_rec_data[k].shape) for k in sim_b_rec_data.keys(): print(k, sim_b_rec_data[k].shape) ``` Now do the same only for the transmembrane region. ``` sim_a_tmr = get_structure_features("traj/condition-a_tm.gro", "traj/condition-a_tm.xtc", feature_start_frame) sim_b_tmr = get_structure_features("traj/condition-b_tm.gro", "traj/condition-b_tm.xtc", feature_start_frame) sim_a_tmr_feat, sim_a_tmr_data = sim_a_tmr sim_b_tmr_feat, sim_b_tmr_data = sim_b_tmr for k in sim_a_rec_data.keys(): print(k, sim_a_rec_data[k].shape) for k in sim_b_rec_data.keys(): print(k, sim_b_rec_data[k].shape) ``` ## Comparison of Structural Ensembles Here we compare the two ensembles using measures for the relative entropy. You can as well calculate the Kolmogorov-Smirnov metric and the corresponding p value using the function ```kolmogorov_smirnov_analysis()```. Another possibility is to compare only the means and standard deviations of the distributions using ```mean_difference_analysis()```. ### Backbone Torsions We start with the backbone torsions, which we can select via ```'bb-torsions'```. To do the same analysis on sidechain torsions, replace ```'bb-torsions'``` with ```'sc-torsions'```. ``` # Relative Entropy analysis with torsions relen = relative_entropy_analysis(sim_a_rec_feat['bb-torsions'], sim_b_rec_feat['bb-torsions'], sim_a_rec_data['bb-torsions'], sim_b_rec_data['bb-torsions'], bin_num=10, verbose=False) names_bbtors, jsd_bbtors, kld_ab_bbtors, kld_ba_bbtors = relen ``` The above function also returns the Kullback-Leibler divergences of A with respect to B and vice versa. To find out where the ensembles differ the most, let's print out the most different features and the corresponding value. ``` # Print the features with the 12 highest values sf = sort_features(names_bbtors, jsd_bbtors) for f in sf[:12]: print(f[0], f[1]) ``` To get an overview of how strongly the ensembles differ in which region, we can plot the maximum deviation of the features related to a certain residue. ``` # Plot the maximum Jensen-Shannon distance per residue as "B factor" in a PDB file ref_filename = "traj/condition-a_receptor.gro" out_filename = "receptor_bbtors-deviations_tremd" vis = residue_visualization(names_bbtors, jsd_bbtors, ref_filename, "plots/"+out_filename+"_jsd.pdf", "vispdb/"+out_filename+"_jsd.pdb", y_label='max. JS dist. of BB torsions') # Save the corresponding data np.savetxt('results/'+out_filename+'_relen.csv', np.array(relen).T, fmt='%s', delimiter=',', header='Name, JSD(A,B), KLD(A,B), KLD(B,A)') np.savetxt('results/'+out_filename+'_jsd.csv', np.array(vis).T, fmt='%s', delimiter=',', header='Residue, max. JSD(A,B)') ``` ### Backbone C-alpha Distances Another common representation for the overall structure of a protein are the distances between the C-alpha atoms. We can perform the same analysis on them. ``` # Relative entropy analysis for C-alpha distances relen = relative_entropy_analysis(sim_a_rec_feat['bb-distances'], sim_b_rec_feat['bb-distances'], sim_a_rec_data['bb-distances'], sim_b_rec_data['bb-distances'], bin_num=10, verbose=False) names_bbdist, jsd_bbdist, kld_ab_bbdist, kld_ba_bbdist = relen # Print the features with the 12 highest values sf = sort_features(names_bbdist, jsd_bbdist) for f in sf[:12]: print(f[0], f[1]) ``` To visualize distances, we need a two-dimensional representation with the residues on each axis. We color each field with the value of the Jensen-Shannon distance (but could as well use Kullback-Leibler divergence, Kolmogorov-Smirnov statistic etc. instead). ``` # Visualize the deviations in a matrix plot matrix = distances_visualization(names_bbdist, jsd_bbdist, "plots/receptor_jsd-bbdist.pdf", vmin = 0.0, vmax = 1.0, cbar_label='JSD') ``` ## Principal Component Analysis Here we show how to calculate the principal components in the space of backbone torsions. It is also common to calculate principal components in the space of backbone distances. For the latter, again just change ```'bb-torsions'``` to ```'bb-distances'```. As mentioned above, we only consider the transmembrane region here, so flexible loops outside the membrane do not distort the more important slow motions in the receptor core. #### Combined PCA In the spirit of comparing two simulations, we calculate the principal components of their joint ensemble of structures. ``` # Combine the data of the different simulations combined_data_tors = np.concatenate([sim_a_tmr_data['bb-torsions'],sim_b_tmr_data['bb-torsions']],0) ``` We can now calculate the principal components of this combined dataset. The corresponding function returns a PyEMMA PCA object, so you can combine it with all functionality in PyEMMA to perform more advanced or specialized analysis. ``` pca_combined = calculate_pca(combined_data_tors) ``` To find out how relevant each PC is, let's have a look at their eigenvalues. ``` pca_eigenvalues_plot(pca_combined, num=12, plot_file='plots/combined_tmr_eigenvalues.pdf') ``` Let us now have a look at the most relevant features of the first three principal components. Here, we define a feature as important if its correlation with the respective PC is above a threshold of 0.4. The function also plots the correlation analysis for each PC. ``` pca_features(pca_combined,sim_a_tmr_feat['bb-torsions'], 3, 0.4) ``` Now we can compare how the frames of each ensemble are distributed along the principal components. ``` compare_projections(sim_a_tmr_data['bb-torsions'], sim_b_tmr_data['bb-torsions'], pca_combined, label_a='A', label_b='B') ``` To get a better glimpse on what the Principal components look like, we would like to visualize them. For that purpose, let us sort the structures from the trajectories along the principal components instead of along simulation time. We can then look at the resulting PC trajectories with a molecular visualization program like VMD. The trajectory to be sorted does not have to be the same subsystem from which we calcualted the PCA. Here, we are going to write frames with the entire receptor, sorted by the PCs of the transmembrane region. ``` _ = sort_trajs_along_common_pc(sim_a_tmr_data['bb-torsions'], sim_b_tmr_data['bb-torsions'], feature_start_frame, "traj/condition-a_receptor.gro", "traj/condition-b_receptor.gro", "traj/condition-a_receptor.xtc", "traj/condition-b_receptor.xtc", "pca/receptor_by_tmr", num_pc=3) ``` The above function deals with the special case of two input trajectories. We also provide the functions for a single one (see below). You use these to calculate PCA for any number of combined simulations and then sort the single or combined simulations. #### Single simulation Here are the major steps of a PCA demonstrated for a single simulation. ``` sim_a_tmr_data['bb-torsions'].shape pca_a = calculate_pca(sim_a_tmr_data['bb-torsions']) pca_features(pca_a, sim_a_tmr_feat['bb-torsions'], 3, 0.4) _, __ = sort_traj_along_pc(sim_a_tmr_data['bb-torsions'], pca_a, feature_start_frame, "traj/condition-a_receptor.gro", "traj/condition-a_receptor.xtc", "pca/condition-a_receptor_by_tmr", num_pc=3) ``` ## Clustering To identify important states of an ensemble, we can use clustering algorithms. Here we show how to cluster a combined ensemble from two simulations into two clusters using k-means clustering. The plot shows how many frames from which simulation were sorted in which cluster. ``` cc = obtain_combined_clusters(sim_a_tmr_data['bb-torsions'],sim_b_tmr_data['bb-torsions'], label_a='A', label_b='B', start_frame=0, algorithm='kmeans', max_iter=100, num_clusters=3, min_dist=12, saveas='plots/combined_clust_bbtors.pdf') cidx, cond, oidx, wss, centroids = cc np.savetxt('results/combined-cluster-indices.csv', np.array([cidx, cond, oidx], dtype=int).T, delimiter=',', fmt='%i', header='Cluster, Condition, Index within condition') ``` We can sort the frames from each ensemble into these clusters, writing them as separate trajectory files. As with pricipal components, we can look at them using VMD. ``` name = "condition-a_tm" write_cluster_traj(cidx[cond==0], "traj/"+name+".gro","traj/"+name+".xtc", "clusters/"+"combined_clust_bbtors_"+name, feature_start_frame ) name = "condition-b_tm" write_cluster_traj(cidx[cond==1], "traj/"+name+".gro","traj/"+name+".xtc", "clusters/"+"combined_clust_bbtors_"+name, feature_start_frame ) ``` A common method to obtain the optimal number of clusters is the elbow plot. We plot the with-in-sum-of-squares (WSS) for a few repetitions for an increasing number of clusters. Then we look for the "elbow" in the resulting plot. Unfortunately, sometimes there is no clear result though. ``` wss_avg, wss_std = wss_over_number_of_combined_clusters(sim_a_tmr_data['bb-torsions'], sim_b_tmr_data['bb-torsions'], label_a='A', label_b='B', start_frame=feature_start_frame, algorithm='kmeans', max_iter=100, num_repeats = 5, max_num_clusters = 12, plot_file = None) ``` Of course, we can also cluster a single simulation ``` _ci, _wss, _centroids = obtain_clusters( sim_a_tmr_data['bb-torsions'], num_clusters=5 ) name = "condition-a_tm" write_cluster_traj( _ci, "traj/"+name+".gro","traj/"+name+".xtc", "clusters/"+"clust_bbtors_"+name, feature_start_frame ) wss_avg, wss_std = wss_over_number_of_clusters(sim_a_tmr_data['bb-torsions'], algorithm='kmeans', max_iter=100, num_repeats = 5, max_num_clusters = 12, plot_file = None) ```
github_jupyter
# Pandas cheat sheet This notebook has some common data manipulations you might do while working in the popular Python data analysis library [`pandas`](https://pandas.pydata.org/). It assumes you're already are set up to analyze data in pandas using Python 3. (If you're _not_ set up, [here's IRE's guide](https://docs.google.com/document/d/1cYmpfZEZ8r-09Q6Go917cKVcQk_d0P61gm0q8DAdIdg/edit#) to setting up Python. [Hit me up](mailto:cody@ire.org) if you get stuck.) ### Topics - [Importing pandas](#Importing-pandas) - [Creating a dataframe from a CSV](#Creating-a-dataframe-from-a-CSV) - [Checking out the data](#Checking-out-the-data) - [Selecting columns of data](#Selecting-columns-of-data) - [Getting unique values in a column](#Getting-unique-values-in-a-column) - [Running basic summary stats](#Running-basic-summary-stats) - [Sorting your data](#Sorting-your-data) - [Filtering rows of data](#Filtering-rows-of-data) - [Filtering text columns with string methods](#Filtering-text-columns-with-string-methods) - [Filtering against multiple values](#Filtering-against-multiple-values) - [Exclusion filtering](#Exclusion-filtering) - [Adding a calculated column](#Adding-a-calculated-column) - [Filtering for nulls](#Filtering-for-nulls) - [Grouping and aggregating data](#Grouping-and-aggregating-data) - [Pivot tables](#Pivot-tables) - [Applying a function across rows](#Applying-a-function-across-rows) - [Joining data](#Joining-data) ### Importing pandas Before we can use pandas, we need to import it. The most common way to do this is: ``` import pandas as pd ``` ### Creating a dataframe from a CSV To begin with, let's import a CSV of Major League Baseball player salaries on opening day. The file, which is in the same directory as this notebook, is called `mlb.csv`. Pandas has a `read_csv()` method that we can use to get this data into a [dataframe](https://pandas.pydata.org/pandas-docs/stable/generated/pandas.DataFrame.html) (it has methods to read other file types, too). At minimum, you need to tell this method where the file lives: ``` mlb = pd.read_csv('mlb.csv') ``` ### Checking out the data When you first load up your data, you'll want to get a sense of what's in there. A pandas dataframe has several useful things to help you get a quick read of your data: - `.head()`: Shows you the first 5 records in the data frame (optionally, if you want to see a different number of records, you can pass in a number) - `.tail()`: Same as `head()`, but it pull records from the end of the dataframe - `.sample(n)` will give you a sample of *n* rows of the data -- just pass in a number - `.info()` will give you a count of non-null values in each column -- useful for seeing if any columns have null values - `.describe()` will compute summary stats for numeric columns - `.columns` will list the column names - `.dtypes` will list the data types of each column - `.shape` will give you a pair of numbers: _(number of rows, number of columns)_ ``` mlb.head() mlb.tail() mlb.sample(5) mlb.info() mlb.describe() mlb.columns mlb.dtypes mlb.shape ``` To get the number of records in a dataframe, you can access the first item in the `shape` pair, or you can just use the Python function `len()`: ``` len(mlb) ``` ### Selecting columns of data If you need to select just one column of data, you can use "dot notation" (`mlb.SALARY`) as long as your column name doesn't have spaces and it isn't the name of a dataframe method (e.g., `product`). Otherwise, you can use "bracket notation" (`mlb['SALARY']`). Selecting one column will return a [`Series`](https://pandas.pydata.org/pandas-docs/stable/generated/pandas.Series.html). If you want to select multiple columns of data, use bracket notation and pass in a _list_ of columns that you want to select. In Python, a list is a collection of items enclosed in square brackets, separated by commas: `['SALARY', 'NAME']`. Selecting multiple columns will return a [`DataFrame`](https://pandas.pydata.org/pandas-docs/stable/generated/pandas.DataFrame.html). ``` # select one column of data teams = mlb.TEAM # bracket notation would do the same thing -- note the quotes around the column name # teams = mlb['TEAM'] teams.head() type(teams) # select multiple columns of data salaries_and_names = mlb[['SALARY', 'NAME']] salaries_and_names.head() type(salaries_and_names) ``` ### Getting unique values in a column As you evaluate your data, you'll often want to get a list of unique values in a column (for cleaning, filtering, grouping, etc.). To do this, you can use the Series method `unique()`. If you wanted to get a list of baseball positions, you could do: ``` mlb.POS.unique() ``` If useful, you could also sort the results alphabetically with the Python [`sorted()`](https://docs.python.org/3/library/functions.html#sorted) function: ``` sorted(mlb.POS.unique()) ``` Sometimes you just need the _number_ of unique values in a column. To do this, you can use the pandas method `nunique()`: ``` mlb.POS.nunique() ``` (You can also run `nunique()` on an entire dataframe:) ``` mlb.nunique() ``` If you want to count up the number of times a value appears in a column of data -- the equivalent of doing a pivot table in Excel and aggregating by count -- you can use the Series method [`value_counts()`](https://pandas.pydata.org/pandas-docs/version/0.22/generated/pandas.Series.value_counts.html). To get a list of MLB teams and the number of times each one appears in our salary data -- in other words, the roster count for each team -- we could do: ``` mlb.TEAM.value_counts() ``` ### Running basic summary stats Some of this already surfaced with `describe()`, but in some cases you'll want to compute these stats manually: - `sum()` - `mean()` - `median()` - `max()` - `min()` You can run these on a Series (e.g., a column of data), or on an entire DataFrame. ``` mlb.SALARY.sum() mlb.SALARY.mean() mlb.SALARY.median() mlb.SALARY.max() mlb.SALARY.min() # entire dataframe mlb.mean() ``` ### Sorting your data You can use the [`sort_values()`](https://pandas.pydata.org/pandas-docs/stable/generated/pandas.DataFrame.sort_values.html) method to sort a dataframe by one or more columns. The default is to sort the values ascending; if you want your results sorted descending, specify `ascending=False`. Let's sort our dataframe by `SALARY` descending: ``` mlb.sort_values('SALARY', ascending=False).head() ``` To sort by multiple columns, pass a list of columns to the `sort_values()` method -- the sorting will happen in the order you specify in the list. You'll also need to pass a list to the `ascending` keyword argument, otherwise both will sort ascending. Let's sort our dataframe first by `TEAM` ascending, then by `SALARY` descending: ``` mlb.sort_values(['TEAM', 'SALARY'], ascending=[True, False]).head() ``` ### Filtering rows of data To filter your data by some criteria, you'd pass your filtering condition(s) to a dataframe using bracket notation. You can use Python's [comparison operators](https://docs.python.org/3/reference/expressions.html#comparisons) in your filters, which include: - `>` greater than - `<` less than - `>=` greater than or equal to - `<=` less than or equal to - `==` equal to - `!=` not equal to Example: You want to filter your data to keep records where the `TEAM` value is 'ARI': ``` diamondbacks = mlb[mlb.TEAM == 'ARI'] diamondbacks.head() ``` We could filter to get all records where the `TEAM` value is _not_ 'ARI': ``` non_diamondbacks = mlb[mlb.TEAM != 'ARI'] non_diamondbacks.head() ``` We could filter our data to just grab the players that make at least $1 million: ``` million_a_year = mlb[mlb.SALARY >= 1000000] million_a_year.head() ``` ### Filtering against multiple values You can use the `isin()` method to test a value against multiple matches -- just hand it a _list_ of values to check against. Example: Let's say we wanted to filter to get just players in Texas (in other words, just the Texas Rangers and the Houston Astros): ``` tx = mlb[mlb.TEAM.isin(['TEX', 'HOU'])] tx.head() ``` ### Exclusion filtering Sometimes it's easier to specify what records you _don't_ want returned. To flip the meaning of a filter condition, prepend a tilde `~`. For instance, if we wanted to get all players who are _not_ from Texas, we'd use the same filter condition we just used to get the TX players but add a tilde at the beginning: ``` not_tx = mlb[~mlb.TEAM.isin(['TEX', 'HOU'])] not_tx.head() ``` ### Filtering text columns with string methods You can access the text values in a column with `.str`, and you can use any of Python's native string functions to manipulate them. For our purposes, though, the pandas [`str.contains()`](https://pandas.pydata.org/pandas-docs/version/0.22/generated/pandas.Series.str.contains.html) method is useful for filtering data by matching text patterns. If we wanted to get every player with 'John' in their name, we could do something like this: ``` johns = mlb[mlb.NAME.str.contains('John', case=False)] johns.head() ``` Note the `case=False` keyword argument -- we're telling pandas to match case-insensitive. And if the pattern you're trying to match is more complex, the method is set up to support [regular expressions](https://docs.python.org/3/howto/regex.html) by default. ### Multiple filters Sometimes you have multiple filters to apply to your data. Lots of the time, it makes sense to break the filters out into separate statements. For instance, if you wanted to get all Texas players who make at least $1 million, I might do this: ``` tx = mlb[mlb.TEAM.isin(['TEX', 'HOU'])] # note that I'm filtering the dataframe I just created, not the original `mlb` dataframe tx_million_a_year = tx[tx.SALARY >= 1000000] tx_million_a_year.head() ``` But sometimes you want to chain your filters together into one statement. Use `|` for "or" and `&` for "and" rather than Python's built-in `or` and `and` statements, and use grouping parentheses around each statement. The same filter in one statement: ``` tx_million_a_year = mlb[(mlb.TEAM.isin(['TEX', 'HOU'])) & (mlb.SALARY > 1000000)] tx_million_a_year.head() ``` Do what works for you and makes sense in context, but I find the first version a little easier to read. ### Adding a calculated column To add a new column to a dataframe, use bracket notation to supply the name of the new column (in quotes, or apostrophes, as long as they match), then set it equal to a value -- maybe a calculation derived from other data in your dataframe. For example, let's create a new column, `contract_total`, that multiplies the annual salary by the number of contract years: ``` mlb['contract_total'] = mlb['SALARY'] * mlb['YEARS'] mlb.head() ``` ### Filtering for nulls You can use the `isnull()` method to get records that are null, or `notnull()` to get records that aren't. The most common use I've seen for these methods is during filtering to see how many records you're missing (and, therefore, how that affects your analysis). The MLB data is complete, so to demonstrate this, let's load up a new data set: A cut of the [National Inventory of Dams](https://ire.org/nicar/database-library/databases/national-inventory-of-dams/) database, courtesy of the NICAR data library. (We'll need to specify the `encoding` on this CSV because it's not UTF-8.) ``` dams = pd.read_csv('dams.csv', encoding='latin-1') dams.head() ``` Maybe we're interested in looking at the year the dam was completed (the `Year_Comp`) column. Running `.info()` on the dataframe shows that we're missing some values: ``` dams.info() ``` We can filter for `isnull()` to take a closer look: ``` no_year_comp = dams[dams.Year_Comp.isnull()] no_year_comp.head() ``` How many are we missing? That will help us determine whether the analysis would be valid: ``` # calculate the percentage of records with no Year_Comp value # (part / whole) * 100 (len(no_year_comp) / len(dams)) * 100 ``` So this piece of our analysis would exclude one-third of our records -- something you'd need to explain to your audience, if indeed your reporting showed that the results of your analysis would still be meaningful. To get records where the `Year_Comp` is not null, we'd use `notnull()`: ``` has_year_comp = dams[dams.Year_Comp.notnull()] has_year_comp.head() ``` What years remain? Let's use `value_counts()` to find out: ``` has_year_comp.Year_Comp.value_counts() ``` (To sort by year, not count, we could tack on a `sort_index()`: ``` has_year_comp.Year_Comp.value_counts().sort_index() ``` ### Grouping and aggregating data You can use the `groupby()` method to group and aggregate data in pandas, similar to what you'd get by running a pivot table in Excel or a `GROUP BY` query in SQL. We'll also provide the aggregate function to use. Let's group our baseball salary data by team to see which teams have the biggest payrolls -- in other words, we want to use `sum()` as our aggregate function: ``` grouped_mlb = mlb.groupby('TEAM').sum() grouped_mlb.head() ``` If you don't specify what columns you want, it will run `sum()` on every numeric column. Typically I select just the grouping column and the column I'm running the aggregation on: ``` grouped_mlb = mlb[['TEAM', 'SALARY']].groupby('TEAM').sum() grouped_mlb.head() ``` ... and we can sort descending, with `head()` to get the top payrolls: ``` grouped_mlb.sort_values('SALARY', ascending=False).head(10) ``` You can use different aggregate functions, too. Let's say we wanted to get the top median salaries by team: ``` mlb[['TEAM', 'SALARY']].groupby('TEAM').median().sort_values('SALARY', ascending=False).head(10) ``` You can group by multiple columns by passing a list. Here, we'll select our columns of interest and group by `TEAM`, then by `POS`, using `sum()` as our aggregate function: ``` mlb[['TEAM', 'POS', 'SALARY']].groupby(['TEAM', 'POS']).sum() ``` ### Pivot tables Sometimes you need a full-blown pivot table, and [pandas has a function to make one](https://pandas.pydata.org/pandas-docs/stable/generated/pandas.pivot_table.html). For this example, we'll look at some foreign trade data -- specifically, eel product imports from 2010 to mid-2017: ``` eels = pd.read_csv('eels.csv') eels.head() ``` Let's run a pivot table where the grouping column is `country`, the values are the sum of `kilos`, and the columns are the year: ``` pivoted_sums = pd.pivot_table(eels, index='country', columns='year', values='kilos', aggfunc=sum) pivoted_sums.head() ``` Let's sort by the `2017` value. While we're at it, let's fill in null values (`NaN`) with zeroes using the [`fillna()`](https://pandas.pydata.org/pandas-docs/version/0.22/generated/pandas.DataFrame.fillna.html) method. ``` pivoted_sums.sort_values(2017, ascending=False).fillna(0) ``` ### Applying a function across rows Often, you'll want to calculate a value for every column but it won't be that simple, and you'll write a separate function that accepts one row of data, does some calculations and returns a value. We'll use the [`apply()`](https://pandas.pydata.org/pandas-docs/version/0.22/generated/pandas.DataFrame.apply.html) method to accomplish this. For this example, we're going to load up a CSV of gators killed by hunters in Florida: ``` gators = pd.read_csv('gators.csv') gators.head() ``` We want to find the longest gator in our data, of course, but there's a problem: right now, the caracass size value is being stored as text: `{} ft. {} in.`. The pattern is predicatable, though, and we can use some Python to turn those values into constant numbers -- inches -- that we can then sort on. Here's our function: ``` def get_inches(row): '''Accepts a row from our dataframe, calculates carcass length in inches and returns that value''' # get the value in the 'Carcass Size' column carcass_size = row['Carcass Size'] # split the text on 'ft.' # the result is a list size_split = carcass_size.split('ft.') # strip whitespace from the first item ([0]) in the resulting list -- the feet -- # and coerce it to an integer with the Python `int()` function feet = int(size_split[0].strip()) # in the second item ([1]) in the resulting list -- the inches -- replace 'in.' with nothing, # strip whitespace and coerce to an integer inches = int(size_split[1].replace('in.', '').strip()) # add the feet times 12 plus the inches and return that value return inches + (feet * 12) ``` Now we're going to create a new column, `length_in` and use the [`apply()`](https://pandas.pydata.org/pandas-docs/version/0.22/generated/pandas.DataFrame.apply.html) method to apply our function to every row. The `axis=1` keyword argument means that we're applying our function row-wise, not column-wise. ``` gators['length_in'] = gators.apply(get_inches, axis=1) gators.sort_values('length_in', ascending=False).head() ``` ### Joining data You can use [`merge()`](https://pandas.pydata.org/pandas-docs/version/0.22/generated/pandas.DataFrame.merge.html) to join data in pandas. In this simple example, we're going to take a CSV of country population data in which each country is represented by an [ISO 3166-1 numeric country code](https://en.wikipedia.org/wiki/ISO_3166-1_numeric) and join it to a CSV that's basically a lookup table with the ISO codes and the names of the countries to which they refer. Some of the country codes have leading zeroes, so we're going to use the `dtype` keyword when we import each CSV to specify that the `'code'` column in each dataset should be treated as a string (text), not a number. ``` pop_csv = pd.read_csv('country-population.csv', dtype={'code': str}) pop_csv.head() code_csv = pd.read_csv('country-codes.csv', dtype={'code': str}) code_csv.head() ``` Now we'll use `merge()` to join them. The `on` keyword argument tells the method what column to join on. If the names of the columns were different, you'd use `left_on` and `right_on`, with the "left" dataframe being the first one you hand to the `merge()` function. The `how` keyword argument tells the method what type of join to use -- the default is `'inner'`. ``` joined_data = pd.merge(pop_csv, code_csv, on='code', how='left') joined_data.head() ```
github_jupyter
# IPython Magic Commands Here we'll begin discussing some of the enhancements that IPython adds on top of the normal Python syntax. These are known in IPython as *magic commands*, and are prefixed by the ``%`` character. These magic commands are designed to succinctly solve various common problems in standard data analysis. Magic commands come in two flavors: *line magics*, which are denoted by a single ``%`` prefix and operate on a single line of input, and *cell magics*, which are denoted by a double ``%%`` prefix and operate on multiple lines of input. We'll demonstrate and discuss a few brief examples here, and come back to more focused discussion of several useful magic commands later in the chapter. ## Running External Code: ``%run`` As you begin developing more extensive code, you will likely find yourself working in both IPython for interactive exploration, as well as a text editor to store code that you want to reuse. Rather than running this code in a new window, it can be convenient to run it within your IPython session. This can be done with the ``%run`` magic. For example, let's create a ``myscript.py`` file with the following contents (note that we are using the `%%bash` magic to write bash code in notebook: ``` %%bash echo """ '''square functions''' def square(x): '''square a number''' return x ** 2 for N in range(1, 4): print(N, 'squared is', square(N))""" > myscript.py ``` We can see the content of this file either from the Files tab on the laft bar or using a terminal command such as `cat`: ``` %%bash cat myscript.py ``` You can execute this from your IPython session as follows: ``` %run myscript.py ``` Note that after you've run this script, any functions defined within it are available for use in your IPython session: ``` square(5) square?? ``` There are several options to fine-tune how your code is run; you can see the documentation in the normal way, by typing **``%run?``** in the IPython interpreter. ## Timing Code Execution: ``%timeit`` Another example of a useful magic function is ``%timeit``, which will automatically determine the execution time of the single-line Python statement that follows it. For example, we may want to check the performance of a list comprehension: ``` %timeit L = [n ** 2 for n in range(1000)] ``` The benefit of ``%timeit`` is that for short commands it will automatically perform multiple runs in order to attain more robust results. For multi line statements, adding a second ``%`` sign will turn this into a cell magic that can handle multiple lines of input. For example, here's the equivalent construction with a ``for``-loop: ``` %%timeit L = [] for n in range(1000): L.append(n ** 2) ``` We can immediately see that list comprehensions are about 20% faster than the equivalent ``for``-loop construction in this case. ## Help on Magic Functions: ``?``, ``%magic``, and ``%lsmagic`` Like normal Python functions, IPython magic functions have docstrings, and this useful documentation can be accessed in the standard manner. So, for example, to read the documentation of the ``%timeit`` magic simply type this: ``` %timeit? ``` Documentation for other functions can be accessed similarly. To access a general description of available magic functions, including some examples, you can type this: ``` %magic ``` For a quick and simple list of all available magic functions, type this: ``` %lsmagic ```
github_jupyter
![Impressions](https://PixelServer20190423114238.azurewebsites.net/api/impressions/MachineLearningNotebooks/how-to-use-azureml/deployment/accelerated-models/accelerated-models-quickstart.png) Copyright (c) Microsoft Corporation. All rights reserved. Licensed under the MIT License. # Azure ML Hardware Accelerated Models Quickstart This tutorial will show you how to deploy an image recognition service based on the ResNet 50 classifier using the Azure Machine Learning Accelerated Models service. Get more information about our service from our [documentation](https://docs.microsoft.com/en-us/azure/machine-learning/service/concept-accelerate-with-fpgas), [API reference](https://docs.microsoft.com/en-us/python/api/azureml-accel-models/azureml.accel?view=azure-ml-py), or [forum](https://aka.ms/aml-forum). We will use an accelerated ResNet50 featurizer running on an FPGA. Our Accelerated Models Service handles translating deep neural networks (DNN) into an FPGA program. For more information about using other models besides Resnet50, see the [README](./README.md). The steps covered in this notebook are: 1. [Set up environment](#set-up-environment) * [Construct model](#construct-model) * Image Preprocessing * Featurizer (Resnet50) * Classifier * Save Model * [Register Model](#register-model) * [Convert into Accelerated Model](#convert-model) * [Create Image](#create-image) * [Deploy](#deploy-image) * [Test service](#test-service) * [Clean-up](#clean-up) <a id="set-up-environment"></a> ## 1. Set up environment ``` import os import tensorflow as tf ``` ### Retrieve Workspace If you haven't created a Workspace, please follow [this notebook](https://github.com/Azure/MachineLearningNotebooks/blob/master/configuration.ipynb) to do so. If you have, run the codeblock below to retrieve it. ``` from azureml.core import Workspace ws = Workspace.from_config() print(ws.name, ws.resource_group, ws.location, ws.subscription_id, sep = '\n') ``` <a id="construct-model"></a> ## 2. Construct model There are three parts to the model we are deploying: pre-processing, featurizer with ResNet50, and classifier with ImageNet dataset. Then we will save this complete Tensorflow model graph locally before registering it to your Azure ML Workspace. ### 2.a. Image preprocessing We'd like our service to accept JPEG images as input. However the input to ResNet50 is a tensor. So we need code that decodes JPEG images and does the preprocessing required by ResNet50. The Accelerated AI service can execute TensorFlow graphs as part of the service and we'll use that ability to do the image preprocessing. This code defines a TensorFlow graph that preprocesses an array of JPEG images (as strings) and produces a tensor that is ready to be featurized by ResNet50. **Note:** Expect to see TF deprecation warnings until we port our SDK over to use Tensorflow 2.0. ``` # Input images as a two-dimensional tensor containing an arbitrary number of images represented a strings import azureml.accel.models.utils as utils tf.reset_default_graph() in_images = tf.placeholder(tf.string) image_tensors = utils.preprocess_array(in_images) print(image_tensors.shape) ``` ### 2.b. Featurizer We use ResNet50 as a featurizer. In this step we initialize the model. This downloads a TensorFlow checkpoint of the quantized ResNet50. ``` from azureml.accel.models import QuantizedResnet50 save_path = os.path.expanduser('~/models') model_graph = QuantizedResnet50(save_path, is_frozen = True) feature_tensor = model_graph.import_graph_def(image_tensors) print(model_graph.version) print(feature_tensor.name) print(feature_tensor.shape) ``` ### 2.c. Classifier The model we downloaded includes a classifier which takes the output of the ResNet50 and identifies an image. This classifier is trained on the ImageNet dataset. We are going to use this classifier for our service. The next [notebook](./accelerated-models-training.ipynb) shows how to train a classifier for a different data set. The input to the classifier is a tensor matching the output of our ResNet50 featurizer. ``` classifier_output = model_graph.get_default_classifier(feature_tensor) print(classifier_output) ``` ### 2.d. Save Model Now that we loaded all three parts of the tensorflow graph (preprocessor, resnet50 featurizer, and the classifier), we can save the graph and associated variables to a directory which we can register as an Azure ML Model. ``` # model_name must be lowercase model_name = "resnet50" model_save_path = os.path.join(save_path, model_name) print("Saving model in {}".format(model_save_path)) with tf.Session() as sess: model_graph.restore_weights(sess) tf.saved_model.simple_save(sess, model_save_path, inputs={'images': in_images}, outputs={'output_alias': classifier_output}) ``` ### 2.e. Important! Save names of input and output tensors These input and output tensors that were created during the preprocessing and classifier steps are also going to be used when **converting the model** to an Accelerated Model that can run on FPGA's and for **making an inferencing request**. It is very important to save this information! You can see our defaults for all the models in the [README](./README.md). By default for Resnet50, these are the values you should see when running the cell below: * input_tensors = "Placeholder:0" * output_tensors = "classifier/resnet_v1_50/predictions/Softmax:0" ``` input_tensors = in_images.name output_tensors = classifier_output.name print(input_tensors) print(output_tensors) ``` <a id="register-model"></a> ## 3. Register Model You can add tags and descriptions to your models. Using tags, you can track useful information such as the name and version of the machine learning library used to train the model. Note that tags must be alphanumeric. ``` from azureml.core.model import Model registered_model = Model.register(workspace = ws, model_path = model_save_path, model_name = model_name) print("Successfully registered: ", registered_model.name, registered_model.description, registered_model.version, sep = '\t') ``` <a id="convert-model"></a> ## 4. Convert Model For conversion you need to provide names of input and output tensors. This information can be found from the model_graph you saved in step 2.e. above. **Note**: Conversion may take a while and on average for FPGA model it is about 1-3 minutes and it depends on model type. ``` from azureml.accel import AccelOnnxConverter convert_request = AccelOnnxConverter.convert_tf_model(ws, registered_model, input_tensors, output_tensors) if convert_request.wait_for_completion(show_output = False): # If the above call succeeded, get the converted model converted_model = convert_request.result print("\nSuccessfully converted: ", converted_model.name, converted_model.url, converted_model.version, converted_model.id, converted_model.created_time, '\n') else: print("Model conversion failed. Showing output.") convert_request.wait_for_completion(show_output = True) ``` <a id="create-image"></a> ## 5. Package the model into an Image You can add tags and descriptions to image. Also, for FPGA model an image can only contain **single** model. **Note**: The following command can take few minutes. ``` from azureml.core.image import Image from azureml.accel import AccelContainerImage image_config = AccelContainerImage.image_configuration() # Image name must be lowercase image_name = "{}-image".format(model_name) image = Image.create(name = image_name, models = [converted_model], image_config = image_config, workspace = ws) image.wait_for_creation(show_output = False) ``` <a id="deploy-image"></a> ## 6. Deploy Once you have an Azure ML Accelerated Image in your Workspace, you can deploy it to two destinations, to a Databox Edge machine or to an AKS cluster. ### 6.a. Databox Edge Machine using IoT Hub See the sample [here](https://github.com/Azure-Samples/aml-real-time-ai/) for using the Azure IoT CLI extension for deploying your Docker image to your Databox Edge Machine. ### 6.b. Azure Kubernetes Service (AKS) using Azure ML Service We are going to create an AKS cluster with FPGA-enabled machines, then deploy our service to it. For more information, see [AKS official docs](https://docs.microsoft.com/en-us/azure/machine-learning/service/how-to-deploy-and-where#aks). #### Create AKS ComputeTarget ``` from azureml.core.compute import AksCompute, ComputeTarget # Uses the specific FPGA enabled VM (sku: Standard_PB6s) # Standard_PB6s are available in: eastus, westus2, westeurope, southeastasia prov_config = AksCompute.provisioning_configuration(vm_size = "Standard_PB6s", agent_count = 1, location = "eastus") aks_name = 'my-aks-pb6' # Create the cluster aks_target = ComputeTarget.create(workspace = ws, name = aks_name, provisioning_configuration = prov_config) ``` Provisioning an AKS cluster might take awhile (15 or so minutes), and we want to wait until it's successfully provisioned before we can deploy a service to it. If you interrupt this cell, provisioning of the cluster will continue. You can also check the status in your Workspace under Compute. ``` %%time aks_target.wait_for_completion(show_output = True) print(aks_target.provisioning_state) print(aks_target.provisioning_errors) ``` #### Deploy AccelContainerImage to AKS ComputeTarget ``` %%time from azureml.core.webservice import Webservice, AksWebservice # Set the web service configuration (for creating a test service, we don't want autoscale enabled) # Authentication is enabled by default, but for testing we specify False aks_config = AksWebservice.deploy_configuration(autoscale_enabled=False, num_replicas=1, auth_enabled = False) aks_service_name ='my-aks-service-1' aks_service = Webservice.deploy_from_image(workspace = ws, name = aks_service_name, image = image, deployment_config = aks_config, deployment_target = aks_target) aks_service.wait_for_deployment(show_output = True) ``` <a id="test-service"></a> ## 7. Test the service ### 7.a. Create Client The image supports gRPC and the TensorFlow Serving "predict" API. We will create a PredictionClient from the Webservice object that can call into the docker image to get predictions. If you do not have the Webservice object, you can also create [PredictionClient](https://docs.microsoft.com/en-us/python/api/azureml-accel-models/azureml.accel.predictionclient?view=azure-ml-py) directly. **Note:** If you chose to use auth_enabled=True when creating your AksWebservice, see documentation [here](https://docs.microsoft.com/en-us/python/api/azureml-core/azureml.core.webservice(class)?view=azure-ml-py#get-keys--) on how to retrieve your keys and use either key as an argument to PredictionClient(...,access_token=key). **WARNING:** If you are running on Azure Notebooks free compute, you will not be able to make outgoing calls to your service. Try locating your client on a different machine to consume it. ``` # Using the grpc client in AzureML Accelerated Models SDK from azureml.accel import client_from_service # Initialize AzureML Accelerated Models client client = client_from_service(aks_service) ``` You can adapt the client [code](https://github.com/Azure/aml-real-time-ai/blob/master/pythonlib/amlrealtimeai/client.py) to meet your needs. There is also an example C# [client](https://github.com/Azure/aml-real-time-ai/blob/master/sample-clients/csharp). The service provides an API that is compatible with TensorFlow Serving. There are instructions to download a sample client [here](https://www.tensorflow.org/serving/setup). ### 7.b. Serve the model To understand the results we need a mapping to the human readable imagenet classes ``` import requests classes_entries = requests.get("https://raw.githubusercontent.com/Lasagne/Recipes/master/examples/resnet50/imagenet_classes.txt").text.splitlines() # Score image with input and output tensor names results = client.score_file(path="./snowleopardgaze.jpg", input_name=input_tensors, outputs=output_tensors) # map results [class_id] => [confidence] results = enumerate(results) # sort results by confidence sorted_results = sorted(results, key=lambda x: x[1], reverse=True) # print top 5 results for top in sorted_results[:5]: print(classes_entries[top[0]], 'confidence:', top[1]) ``` <a id="clean-up"></a> ## 8. Clean-up Run the cell below to delete your webservice, image, and model (must be done in that order). In the [next notebook](./accelerated-models-training.ipynb) you will learn how to train a classfier on a new dataset using transfer learning and finetune the weights. ``` aks_service.delete() aks_target.delete() image.delete() registered_model.delete() converted_model.delete() ```
github_jupyter
## Faisal Akhtar ## College Roll No.: 17/1409 Q2)<br> Iris plants dataset (already available in Scikit Learn) has the following characteristics:<br> Number of Instances: 150 (50 in each of three classes)<br> Number of Attributes: 4 numeric, predictive attributes and the class<br> Attribute Information: sepal length in cm, sepal width in cm, petal length in cm, petal width in cm Class: Iris-Setosa, Iris-Versicolour, Iris-Virginica<br> Missing Attribute Values: None<br><br> Write a program using Scikit Learn that utilizes Logistic regression to build a classification model using all the four features to predict the class of a plant. Print the confusion matrix, accuracy, precision and recall for the model.<br><br> Also, build a classification model in Scikit Learn using Neural Networks using all the features to predict the class a plant belongs to. Print the confusion matrix, accuracy, precision and recall for the model and compare its performance with the model created using Logistic regression. # Classification Model using Logistic Regression ### Loading data ``` import pandas as pd data=pd.read_csv('../input/IRIS.csv') data.head() data.describe() ``` ### Preparing the training set ``` # X = feature values, all the columns except the last column X=data.iloc[:,:-1] # Y = target values, last column of the data frame Y=data.iloc[:,-1] ``` ### Plotting the relation of each feature with each species ``` import matplotlib.pyplot as plt plt.xlabel('Features') plt.ylabel('Species') pltX = data.loc[:, 'sepal_length'] pltY = data.loc[:,'species'] plt.scatter(pltX, pltY, color='blue', label='sepal_length') pltX = data.loc[:, 'sepal_width'] pltY = data.loc[:,'species'] plt.scatter(pltX, pltY, color='green', label='sepal_width') pltX = data.loc[:, 'petal_length'] pltY = data.loc[:,'species'] plt.scatter(pltX, pltY, color='red', label='petal_length') pltX = data.loc[:, 'petal_width'] pltY = data.loc[:,'species'] plt.scatter(pltX, pltY, color='black', label='petal_width') plt.legend(loc=4, prop={'size':8}) plt.show() ``` ### Splitting the data into 80% training and 20% testing ``` from sklearn.model_selection import train_test_split x_train, x_test, y_train, y_test = train_test_split(X, Y, test_size=0.2, random_state=50) print("x_train shape : ", x_train.shape) print("x_test shape : ", x_test.shape) print("y_train shape : ", y_train.shape) print("y_test shape : ", y_test.shape) ``` ### Logistic Regression ``` from sklearn.linear_model import LogisticRegression model = LogisticRegression() model.fit(x_train, y_train) predictions = model.predict(x_test) print(predictions) ``` ### Confusion matrix and accuracy of the model ``` from sklearn.metrics import confusion_matrix cm = confusion_matrix(y_test, predictions) print("Confusion Matrix : \n",cm) from sklearn.metrics import accuracy_score print('Accuracy Score :',accuracy_score(y_test, predictions)) ``` ### Checking precision, recall and f1-score of the model ``` from sklearn.metrics import classification_report print( classification_report(y_test, predictions) ) ``` # Classification model using Neural Network ``` data.head() data.shape ``` ### Preprocessing ### Encoding Categorical Values ``` from sklearn.preprocessing import LabelEncoder labelencoder = LabelEncoder() data["species"] = labelencoder.fit_transform(data["species"]) species = pd.DataFrame({'species': ['Iris-setosa', 'Iris-versicolor', 'Iris-virginica']}) import numpy as np print ('Class labels:', np.unique(data["species"])) ``` ### Test Train split ``` # X = feature values, all the columns except the last column X=data.iloc[:,:-1] # Y = target values, last column of the data frame Y=data.iloc[:,-1] x_train, x_test, y_train, y_test = train_test_split(X, Y, test_size=0.2, random_state=50) print("x_train shape : ", x_train.shape) print("x_test shape : ", x_test.shape) print("y_train shape : ", y_train.shape) print("y_test shape : ", y_test.shape) print ('Lables count in y:', np.bincount(Y)) print('Lables counts in y_train:', np.bincount(y_train)) print('Lables counts in y_test:', np.bincount(y_test)) ``` ### Scaling IRIS data with StandardScaler ``` from sklearn.preprocessing import StandardScaler sc = StandardScaler() sc.fit(x_train) x_train_std = sc.transform(x_train) x_test_std = sc.transform(x_test) ``` ### Perceptron ``` from sklearn.linear_model import Perceptron ppn = Perceptron(max_iter = 40, eta0=0.1, random_state=1) ppn.fit(x_train_std, y_train) ypred = ppn.predict(x_test_std) ``` ### Confusion matrix and accuracy of the model ``` cm = confusion_matrix(y_test, ypred) print("Confusion Matrix : \n",cm) print('Accuracy Score :',accuracy_score(y_test, ypred)) ``` ### Checking precision, recall and f1-score of the model ``` print( classification_report(y_test, ypred) ) ``` # Comparing performances <table> <tr> <th>MODEL</th> <th>Accuracy</th> <th>Precision</th> <th>Recall</th> <th>F1-Score</th> </tr> <tr> <td>Logistic regression</td> <td>0.9666666666666667</td> <td>0.97</td> <td>0.97</td> <td>0.97</td> </tr> <tr> <td>Perceptron</td> <td>0.9</td> <td>0.92</td> <td>0.9</td> <td>0.9</td> </tr> </table>
github_jupyter
# Import Libraries ``` #import urllib2 from io import StringIO import os import xmltodict import pandas as pd from datetime import datetime import statsmodels.api as sm from scipy.stats import linregress import matplotlib.pyplot as plt import numpy as np import sys import requests import pymannkendall as mk import glob import matplotlib import scipy import geopandas as gpd from bs4 import BeautifulSoup import platform import os import matplotlib as mpl from IPython.display import Math,display from scipy.optimize import curve_fit import pymannkendall as mk from pylab import rcParams %matplotlib inline matplotlib.rc_file_defaults() rcParams['figure.figsize'] = 15, 10 print("Operating System " + platform.system() + " " + platform.release()) print("Python Version " + str(sys.version)) print("Pandas Version " + str(pd.__version__)) print("Numpy Version " + str(np.__version__)) print("Matplotlib Version " + str(mpl.__version__)) #print("Well Application Version " + str(wa.__version__)) print("Scipy Version " +str(scipy.__version__)) print (os.environ['CONDA_DEFAULT_ENV']) ``` # Read in Hypsometric Data Hypsometric Curves are provided with all modern dam designs. Dam plans can be downloaded from the [Water Rights Dam Safty Website](https://maps.waterrights.utah.gov/EsriMap/map.asp?layersToAdd=Dams). You have to be on a state network to access them. I digitized the curves in from the plans for the dams in the study area using ArcGIS Pro and a Planar projection that uses feet. ``` hypsometric_data = gpd.read_file("G:/Shared drives/UGS_Groundwater/Projects/Bryce/GIS/Bryce/Bryce.gdb", driver='FileGDB', layer='damcurves_points') hypsometric_data ``` ## Tropic Reservoir Curves ### Volume in Lake vs Lake Elevation Relationship - Tropic ``` hyps_data = hypsometric_data[(hypsometric_data['dam']=="tropic new")&(hypsometric_data['linetype']=="capacity")][['x','y']] hyps_old = hypsometric_data[(hypsometric_data['dam']=="tropic old")&(hypsometric_data['linetype']=="capacity")][['x','y']] # define the true objective function def objective(x, a, b, c, d, e, f): return (a * x) + (b * x**2) + (c * x**3) + (d * x**4) + (e * x**5) + f x = hyps_data['y'] yn = hyps_data['x']*100 vpopt, pcov = curve_fit(objective, x, yn, maxfev = 40000) sterr = np.sqrt(np.diag(pcov)) a, b, c, d, e, f = vpopt xb = np.arange(np.min(x),np.max(x),0.01) # calculate the output for the range yb = objective(xb, a, b, c, d, e, f) plt.plot(xb, yb, label= "modeled polynomial",color='green') plt.plot(hyps_data['y'], hyps_data['x']*100, label='Tropic Dam Capacity') plt.xlabel('Elevation (ft)') plt.ylabel('Volume (ac-ft)') plt.grid() #plt.ylim(0,3500) plt.legend() ``` ### Area of Open Water vs Lake Elevation Relationship - Tropic ``` hyps_data = hypsometric_data[(hypsometric_data['dam']=="tropic new")&(hypsometric_data['linetype']=="area")][['x','y']] # define the true objective function def objective(x, a, b, c, d, e, f): return (a * x) + (b * x**2) + (c * x**3) + (d * x**4) + (e * x**5) + f x = hyps_data['y'] yn = hyps_data['x']*10 vpopt, pcov = curve_fit(objective, x, yn, maxfev = 40000) sterr = np.sqrt(np.diag(pcov)) a, b, c, d, e, f = vpopt xb = np.arange(np.min(x),np.max(x),0.01) # calculate the output for the range yb = objective(xb, a, b, c, d, e, f) plt.plot(xb, yb, label= "modeled polynomial",color='green') plt.plot(hyps_data['y'], hyps_data['x']*10, label='Tropic area') plt.xlabel('Elevation (ft)') plt.ylabel('Area (acres)') plt.grid() #plt.ylim(0,3500) plt.legend() print(f"({a:0.3f} * x) + ({b:0.3f} * x^2) + ({c:0.3e} * x^3) + ({d:0.3e} * x^4) + ({e:0.3e} * x^5) + {f:0.3e}") ``` ### Discharge Outflow vs. Reservoir Level Elevation ``` hyps_data = hypsometric_data[(hypsometric_data['dam']=='tropic new')&(hypsometric_data['linetype']=="outlet")][['x','y']] # define the true objective function def objective(x, a, b, c, d, e, f): return (a * x) + (b * x**2) + (c * x**3) + (d * x**4) + (e * x**5) + f x = hyps_data['y'] yn = hyps_data['x']*2.5 vpopt, pcov = curve_fit(objective, x, yn, maxfev = 40000) sterr = np.sqrt(np.diag(pcov)) a, b, c, d, e, f = vpopt xb = np.arange(np.min(x),np.max(x),0.01) # calculate the output for the range yb = objective(xb, a, b, c, d, e, f) plt.plot(xb, yb, label= "modeled polynomial",color='green') plt.plot(hyps_data['y'], hyps_data['x']*2.5, label='Tropic Dam Outflow') plt.xlabel('Elevation (ft)') plt.ylabel('Area (acres)') plt.grid() #plt.ylim(0,3500) plt.legend() print(f"({a:0.3f} * x) + ({b:0.3f} * x^2) + ({c:0.3e} * x^3) + ({d:0.3e} * x^4) + ({e:0.3e} * x^5) + {f:0.3e}") 10/4 ``` ## Pine Lake Reservoir Curves ### Volume in Lake vs Lake Elevation Relationship ``` hyps_data = hypsometric_data[(hypsometric_data['dam']=="pine")&(hypsometric_data['linetype']=="capacity")][['x','y']] # define the true objective function def objective(x, a, b, c, d, e, f): return (a * x) + (b * x**2) + (c * x**3) + (d * x**4) + (e * x**5) + f x = hyps_data['y'] yn = hyps_data['x']*100 vpopt, pcov = curve_fit(objective, x, yn, maxfev = 40000) sterr = np.sqrt(np.diag(pcov)) a, b, c, d, e, f = vpopt xb = np.arange(np.min(x),np.max(x),0.01) # calculate the output for the range yb = objective(xb, a, b, c, d, e, f) plt.plot(xb, yb, label= "modeled polynomial",color='green') plt.plot(hyps_data['y'], hyps_data['x']*100, label='Pine Dam Capacity') plt.xlabel('Elevation (ft)') plt.ylabel('Volume (ac-ft)') plt.grid() #plt.ylim(0,3500) plt.legend() print(f"({a:0.3f} * x) + ({b:0.3f} * x^2) + ({c:0.3e} * x^3) + ({d:0.3e} * x^4) + ({e:0.3e} * x^5) + {f:0.3e}") ``` ### Area of Open Water vs Lake Elevation Relationship ``` hyps_data = hypsometric_data[(hypsometric_data['dam']=="pine")&(hypsometric_data['linetype']=="area")][['x','y']] # define the true objective function def objective(x, a, b, c, d, e, f): return (a * x) + (b * x**2) + (c * x**3) + (d * x**4) + (e * x**5) + f x = hyps_data['y'] yn = hyps_data['x']*7.5 vpopt, pcov = curve_fit(objective, x, yn, maxfev = 40000) sterr = np.sqrt(np.diag(pcov)) a, b, c, d, e, f = vpopt xb = np.arange(np.min(x),np.max(x),0.01) # calculate the output for the range yb = objective(xb, a, b, c, d, e, f) plt.plot(xb, yb, label= "modeled polynomial",color='green') plt.plot(hyps_data['y'], hyps_data['x']*7.5, label='Pine Dam Capacity') plt.xlabel('Elevation (ft)') plt.ylabel('Area (acres)') plt.grid() #plt.ylim(0,3500) plt.legend() print(f"({a:0.3f} * x) + ({b:0.3f} * x^2) + ({c:0.3e} * x^3) + ({d:0.3e} * x^4) + ({e:0.3e} * x^5) + {f:0.3e}") ``` ### Discharge Outflow vs. Reservoir Level Elevation ``` hyps_data = hypsometric_data[pd.isna(hypsometric_data['dam'])&(hypsometric_data['linetype']=="outlet")][['x','y']] # define the true objective function def objective(x, a, b, c, d, e, f): return (a * x) + (b * x**2) + (c * x**3) + (d * x**4) + (e * x**5) + f x = hyps_data['y'] yn = hyps_data['x'] vpopt, pcov = curve_fit(objective, x, yn, maxfev = 40000) sterr = np.sqrt(np.diag(pcov)) a, b, c, d, e, f = vpopt xb = np.arange(np.min(x),np.max(x),0.01) # calculate the output for the range yb = objective(xb, a, b, c, d, e, f) plt.plot(xb, yb, label= "modeled polynomial",color='green') plt.plot(hyps_data['y'], hyps_data['x'], label='Pine Dam Outflow') plt.xlabel('Elevation (ft)') plt.ylabel('Area (acres)') plt.grid() #plt.ylim(0,3500) plt.legend() print(f"({a:0.3f} * x) + ({b:0.3f} * x^2) + ({c:0.3e} * x^3) + ({d:0.3e} * x^4) + ({e:0.3e} * x^5) + {f:0.3e}") ``` # Import Data From Dam Safty Website and Parse It Dam operators regularly report data from dam piezometers, and also report dam flow and dam levels. These data are pulled from an Excel Workbook that can pull data from the website using a programmed query. Make sure to update the data in the workbook periodically to ensure we capture all of the data. ## Pine Lake Links to Water Rights Data:<br> [Pine Dam Information](https://www.waterrights.utah.gov/cgi-bin/damview.exe?Modinfo=Viewdam&DAM_NUMBER=UT00246)<br> [Pine data site](https://www.waterrights.utah.gov/cgi-bin/damview.exe?Modinfo=ViewMonitorData&DAM_NUMBER=UT00246) ``` pine = pd.read_excel("G:/Shared drives/UGS_Groundwater/Projects/Bryce/Dams/Live_Dam_Data.xlsx","Pine Lake", skiprows=[1],parse_dates=True,index_col=0) pine.head() pine['Res. Elev'].plot(marker='o') plt.ylim(7980,8000) plt.ylabel('Reservoir Elevation (ft)') ``` ## Tropic Reservoir [Tropic Dam Information](https://www.waterrights.utah.gov/cgi-bin/damview.exe?Modinfo=Viewdam&DAM_NUMBER=UT00302)<br> [Tropic Dam Data](https://www.waterrights.utah.gov/cgi-bin/damview.exe?Modinfo=ViewMonitorData&DAM_NUMBER=UT00302) ``` tropic = pd.read_excel("G:/Shared drives/UGS_Groundwater/Projects/Bryce/Dams/Live_Dam_Data.xlsx", "Tropic",skiprows=[1],index_col=0,parse_dates=True) tropic.head() tropic['Reservoir Level'].plot(marker="o") plt.ylabel('Reservoir Elevation (ft)') ax2 = plt.twinx() tropic['2-inch drain gpm'].plot(color='green',ax=ax2) ax2.set_ylabel('Outflow (gpm)') ```
github_jupyter
``` import graphlab ``` # Load some text data - from wikipedia, page on people ``` people = graphlab.SFrame('people_wiki.gl/') people.head() len(people) ``` # Explore the dataset and checkout the text it contains ``` obama = people[people['name'] == 'Barack Obama'] obama obama['text'] clooney = people[people['name'] == 'George Clonney'] ``` # Get the word counts for Obama article ``` obama['word_count'] = graphlab.text_analytics.count_words(obama['text']) print obama['word_count'] ``` ## Sort the word count for the Obama article ``` obama_word_count_table = obama[['word_count']].stack('word_count', new_column_name = ['word', 'count']) obama_word_count_table obama_word_count_table.sort('count', ascending=False) ``` # Compute TF-IDF for the corpus ``` people['word_count'] = graphlab.text_analytics.count_words(people['text']) people.head() tfidf = graphlab.text_analytics.tf_idf(people['word_count']) tfidf.head() people['tfidf'] = tfidf ``` ## Examine the TF-IDF for the Obama article ``` obama = people[people['name'] == 'Barack Obama'] obama[['tfidf']].stack('tfidf', new_column_name=['word', 'tfidf']).sort('tfidf', ascending=False) ``` # Manually compute distances between a few people ``` clinton = people[people['name'] == 'Bill Clinton'] backham = people[people['name'] == 'David Beckham'] ``` ## Is Obama closer to Clinton than to Beckham? ``` graphlab.distances.cosine(obama['tfidf'][0], clinton['tfidf'][0]) graphlab.distances.cosine(obama['tfidf'][0], backham['tfidf'][0]) ``` # Build a nearest neighbor model for document retrieval ``` knn_model = graphlab.nearest_neighbors.create(people, features=['tfidf'],label='name') ``` # Applying the nearest-neighbors model for retrieval ## Who is closest to Obama? ``` knn_model.query(obama) ``` ## Other examples of document retrieval ``` swift = people[people['name'] == 'Taylor Swift'] knn_model.query(swift) arnold = people[people['name'] == 'Arnold Schwarzenegger'] knn_model.query(arnold) ``` # Ex4 ## Compare top words according to word counts to TF-IDF ``` john = people[people['name'] == 'Elton John'] john_word_count_table = john[['word_count']].stack('word_count', new_column_name = ['word', 'count']).sort('count', ascending=False) john_word_count_table.head() john[['tfidf']].stack('tfidf', new_column_name=['word', 'tfidf']).sort('tfidf', ascending=False) ``` ## Measuring distance ``` victoria = people[people['name'] == 'Victoria Beckham'] paul = people[people['name'] == 'Paul McCartney'] graphlab.distances.cosine(john['tfidf'][0], victoria['tfidf'][0]) graphlab.distances.cosine(john['tfidf'][0], paul['tfidf'][0]) ``` ## Building nearest neighbors models with different input features and setting the distance metric ``` word_count_model = graphlab.nearest_neighbors.create(people, features=['word_count'],label='name',distance='cosine') tfidf_model = graphlab.nearest_neighbors.create(people, features=['tfidf'],label='name',distance='cosine') word_count_model.query(john) tfidf_model.query(john) word_count_model.query(victoria) tfidf_model.query(victoria) ```
github_jupyter
<h1> 2c. Loading large datasets progressively with the tf.data.Dataset </h1> In this notebook, we continue reading the same small dataset, but refactor our ML pipeline in two small, but significant, ways: <ol> <li> Refactor the input to read data from disk progressively. <li> Refactor the feature creation so that it is not one-to-one with inputs. </ol> <br/> The Pandas function in the previous notebook first read the whole data into memory -- on a large dataset, this won't be an option. ``` import datalab.bigquery as bq import tensorflow as tf import numpy as np import shutil print(tf.__version__) ``` <h2> 1. Refactor the input </h2> Read data created in Lab1a, but this time make it more general, so that we can later handle large datasets. We use the Dataset API for this. It ensures that, as data gets delivered to the model in mini-batches, it is loaded from disk only when needed. ``` CSV_COLUMNS = ['fare_amount', 'pickuplon','pickuplat','dropofflon','dropofflat','passengers', 'key'] DEFAULTS = [[0.0], [-74.0], [40.0], [-74.0], [40.7], [1.0], ['nokey']] def read_dataset(filename, mode, batch_size = 512): def decode_csv(row): columns = tf.decode_csv(row, record_defaults = DEFAULTS) features = dict(zip(CSV_COLUMNS, columns)) features.pop('key') # discard, not a real feature label = features.pop('fare_amount') # remove label from features and store return features, label # Create list of file names that match "glob" pattern (i.e. data_file_*.csv) filenames_dataset = tf.data.Dataset.list_files(filename) # Read lines from text files textlines_dataset = filenames_dataset.flat_map(tf.data.TextLineDataset) # Parse text lines as comma-separated values (CSV) dataset = textlines_dataset.map(decode_csv) # Note: # use tf.data.Dataset.flat_map to apply one to many transformations (here: filename -> text lines) # use tf.data.Dataset.map to apply one to one transformations (here: text line -> feature list) if mode == tf.estimator.ModeKeys.TRAIN: num_epochs = None # loop indefinitely dataset = dataset.shuffle(buffer_size = 10 * batch_size) else: num_epochs = 1 # end-of-input after this dataset = dataset.repeat(num_epochs).batch(batch_size) return dataset def get_train_input_fn(): return read_dataset('./taxi-train.csv', mode = tf.estimator.ModeKeys.TRAIN) def get_valid_input_fn(): return read_dataset('./taxi-valid.csv', mode = tf.estimator.ModeKeys.EVAL) ``` <h2> 2. Refactor the way features are created. </h2> For now, pass these through (same as previous lab). However, refactoring this way will enable us to break the one-to-one relationship between inputs and features. ``` INPUT_COLUMNS = [ tf.feature_column.numeric_column('pickuplon'), tf.feature_column.numeric_column('pickuplat'), tf.feature_column.numeric_column('dropofflat'), tf.feature_column.numeric_column('dropofflon'), tf.feature_column.numeric_column('passengers'), ] def add_more_features(feats): # Nothing to add (yet!) return feats feature_cols = add_more_features(INPUT_COLUMNS) ``` <h2> Create and train the model </h2> Note that we train for num_steps * batch_size examples. ``` tf.logging.set_verbosity(tf.logging.INFO) OUTDIR = 'taxi_trained' shutil.rmtree(OUTDIR, ignore_errors = True) # start fresh each time model = tf.estimator.LinearRegressor( feature_columns = feature_cols, model_dir = OUTDIR) model.train(input_fn = get_train_input_fn, steps = 200) ``` <h3> Evaluate model </h3> As before, evaluate on the validation data. We'll do the third refactoring (to move the evaluation into the training loop) in the next lab. ``` metrics = model.evaluate(input_fn = get_valid_input_fn, steps = None) print('RMSE on dataset = {}'.format(np.sqrt(metrics['average_loss']))) ``` ## Challenge Exercise Create a neural network that is capable of finding the volume of a cylinder given the radius of its base (r) and its height (h). Assume that the radius and height of the cylinder are both in the range 0.5 to 2.0. Unlike in the challenge exercise for b_estimator.ipynb, assume that your measurements of r, h and V are all rounded off to the nearest 0.1. Simulate the necessary training dataset. This time, you will need a lot more data to get a good predictor. Hint (highlight to see): <p style='color:white'> Create random values for r and h and compute V. Then, round off r, h and V (i.e., the volume is computed from the true value of r and h; it's only your measurement that is rounded off). Your dataset will consist of the round values of r, h and V. Do this for both the training and evaluation datasets. </p> Now modify the "noise" so that instead of just rounding off the value, there is up to a 10% error (uniformly distributed) in the measurement followed by rounding off. Copyright 2017 Google Inc. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License
github_jupyter
# Documentation > 201025: This notebook generate embedding vectors for pfam_motors, df_dev, and motor_toolkit from the models that currently finished training: - lstm5 - evotune_lstm_5_balanced.pt - evotune_lstm_5_balanced_target.pt - mini_lstm_5_balanced.pt - mini_lstm_5_balanced_target.pt - transformer_encoder - evotune_seq2seq_encoder_balanced.pt - evotune_seq2seq_encoder_balanced_target.pt - mini_seq2seq_encoder_balanced.pt - mini_seq2seq_encoder_balanced_target.pt - seq2seq_attention_mini - transformer_encoder_201025.pt - evotune_transformerencoder_balanced.pt - evotune_transformerencoder_balanced_target.pt - mini_evotune_transformerencoder_balanced.pt - mini_evotune_transformerencoder_balanced_target.pt - output for motor_toolkit,pfamA_random, and pfamA_motors ``` import torch import torch.nn as nn import torch.optim as optim import torchvision import torchvision.transforms as transforms import torch.nn.functional as F from torch.autograd import Variable from torch.nn.utils.rnn import pad_sequence from torch.utils.data import Dataset, IterableDataset, DataLoader # import tqdm import numpy as np import pandas as pd import math seed = 7 torch.manual_seed(seed) np.random.seed(seed) pfamA_motors = pd.read_csv("../../data/pfamA_motors.csv") pfamA_random = pd.read_csv("../../data/pfamA_random_201027.csv") motor_toolkit = pd.read_csv("../../data/motor_tookits.csv") pfamA_motors_balanced = pfamA_motors.groupby('clan').apply(lambda _df: _df.sample(4500,random_state=1)) pfamA_motors_balanced = pfamA_motors_balanced.apply(lambda x: x.reset_index(drop = True)) pfamA_target_name = ["PF00349","PF00022","PF03727","PF06723",\ "PF14450","PF03953","PF12327","PF00091","PF10644",\ "PF13809","PF14881","PF00063","PF00225","PF03028"] pfamA_target = pfamA_motors.loc[pfamA_motors["pfamA_acc"].isin(pfamA_target_name),:] aminoacid_list = [ 'A', 'C', 'D', 'E', 'F', 'G', 'H', 'I', 'K', 'L', 'M', 'N', 'P', 'Q', 'R', 'S', 'T', 'V', 'W', 'Y' ] clan_list = ["actin_like","tubulin_c","tubulin_binding","p_loop_gtpase"] aa_to_ix = dict(zip(aminoacid_list, np.arange(1, 21))) clan_to_ix = dict(zip(clan_list, np.arange(0, 4))) def word_to_index(seq,to_ix): "Returns a list of indices (integers) from a list of words." return [to_ix.get(word, 0) for word in seq] ix_to_aa = dict(zip(np.arange(1, 21), aminoacid_list)) ix_to_clan = dict(zip(np.arange(0, 4), clan_list)) def index_to_word(ixs,ix_to): "Returns a list of words, given a list of their corresponding indices." return [ix_to.get(ix, 'X') for ix in ixs] def prepare_sequence(seq): idxs = word_to_index(seq[0:-1],aa_to_ix) return torch.tensor(idxs, dtype=torch.long) def prepare_labels(seq): idxs = word_to_index(seq[1:],aa_to_ix) return torch.tensor(idxs, dtype=torch.long) def prepare_eval(seq): idxs = word_to_index(seq[:],aa_to_ix) return torch.tensor(idxs, dtype=torch.long) prepare_labels('YCHXXXXX') # set device device = torch.device('cuda' if torch.cuda.is_available() else 'cpu') device # Hyperparameters input_size = len(aminoacid_list) + 1 num_layers = 1 hidden_size = 64 output_size = len(aminoacid_list) + 1 embedding_size= 10 learning_rate = 0.001 class s2s_Encoder(nn.Module): def __init__(self, input_size, embedding_size, hidden_size, num_layers, output_size, batch_first=False, bidirectional=True): super(s2s_Encoder, self).__init__() self.embedding_size = embedding_size self.hidden_size = hidden_size self.output_size = output_size self.num_layers = num_layers self.log_softmax = nn.LogSoftmax(dim= 1) self.batch_first = batch_first self.aa_embedding = nn.Embedding(input_size, embedding_size) self.rnn = nn.LSTM(input_size=embedding_size, hidden_size=hidden_size, num_layers=num_layers, batch_first=batch_first, bidirectional=bidirectional) def forward(self, seq): # embed each aa to the embedded space embedding_tensor = self.aa_embedding(seq) #output of shape (seq_len, batch, num_directions * hidden_size): outputs, hidden = self.rnn(embedding_tensor.view(len(seq), 1, -1)) # Return output and final hidden state return outputs, hidden def generate_embedding_lstm(dict_file,dat,dat_name,out_path,out_dir,seq_col): # initialize network model = s2s_Encoder(input_size = input_size, \ embedding_size = embedding_size, \ hidden_size = hidden_size, \ num_layers = num_layers, \ output_size = output_size).to(device) model.load_state_dict(torch.load(dict_file)) print("loaded dict file for weights " + dict_file) print("output embedding for " + dat_name) model.eval() hn_vector = [] print_every = 1000 for epoch in np.arange(0, dat.shape[0]): with torch.no_grad(): seq = dat.iloc[epoch, seq_col] sentence_in = prepare_eval(seq) sentence_in = sentence_in.to(device = device) _, (hn,_) = model(sentence_in) hn_vector.append(hn.cpu().detach().numpy().reshape(1,-1)) if epoch % print_every == 0: print(f"At Epoch: %.2f"% epoch) print(seq) hn_vector = np.array(hn_vector) hn_vector = np.squeeze(hn_vector, axis=1) print(hn_vector.shape) print(out_dir+dat_name+"_"+out_path) np.save(out_dir+dat_name+"_"+out_path, hn_vector) return dict_files = ["evotune_seq2seq_encoder_balanced.pt","evotune_seq2seq_encoder_balanced_target.pt","mini_seq2seq_encoder_balanced.pt","mini_seq2seq_encoder_balanced_target.pt"] dict_files = ["../../data/201025/"+dict_file for dict_file in dict_files] dict_files.append("../../data/first_try/seq2seq_encoder_df_dev_201012_230k.pt") dict_files # "../data/hn_lstm5_motortoolkit.npy" out_paths = ["evotune_balanced.npy","evotune_balanced_target.npy","mini_balanced.npy","mini_balanced_target.npy","raw.npy"] out_dir = "../../out/201027/embedding/seq2seq/" out_paths len(dict_files)==len(out_paths) pfamA_target.iloc[1,3] data = [pfamA_motors_balanced,pfamA_target,pfamA_random,motor_toolkit] data_names = ["pfamA_motors_balanced", "pfamA_target" , "pfamA_random", "motor_toolkit"] seq_cols = [3,3,2,7] for i in range(len(dict_files)): dict_file = dict_files[i] out_path = out_paths[i] for i in range(len(data)): dat = data[i] dat_name = data_names[i] seq_col = seq_cols[i] generate_embedding_lstm(dict_file,dat,dat_name,out_path,out_dir,seq_col) i = 4 dict_file = dict_files[i] out_path = out_paths[i] for i in range(len(data)): dat = data[i] dat_name = data_names[i] seq_col = seq_cols[i] generate_embedding_lstm(dict_file,dat,dat_name,out_path,out_dir,seq_col) ```
github_jupyter
``` %matplotlib inline ``` # K-means Clustering The plots display firstly what a K-means algorithm would yield using three clusters. It is then shown what the effect of a bad initialization is on the classification process: By setting n_init to only 1 (default is 10), the amount of times that the algorithm will be run with different centroid seeds is reduced. The next plot displays what using eight clusters would deliver and finally the ground truth. ``` print(__doc__) # Code source: Gaël Varoquaux # Modified for documentation by Jaques Grobler # License: BSD 3 clause import numpy as np import matplotlib.pyplot as plt # Though the following import is not directly being used, it is required # for 3D projection to work from mpl_toolkits.mplot3d import Axes3D from sklearn.cluster import KMeans from sklearn import datasets np.random.seed(5) iris = datasets.load_iris() X = iris.data y = iris.target estimators = [('k_means_iris_8', KMeans(n_clusters=8)), ('k_means_iris_3', KMeans(n_clusters=3)), ('k_means_iris_bad_init', KMeans(n_clusters=3, n_init=1, init='random'))] fignum = 1 titles = ['8 clusters', '3 clusters', '3 clusters, bad initialization'] for name, est in estimators: fig = plt.figure(fignum, figsize=(4, 3)) ax = Axes3D(fig, rect=[0, 0, .95, 1], elev=48, azim=134) est.fit(X) labels = est.labels_ ax.scatter(X[:, 3], X[:, 0], X[:, 2], c=labels.astype(np.float), edgecolor='k') ax.w_xaxis.set_ticklabels([]) ax.w_yaxis.set_ticklabels([]) ax.w_zaxis.set_ticklabels([]) ax.set_xlabel('Petal width') ax.set_ylabel('Sepal length') ax.set_zlabel('Petal length') ax.set_title(titles[fignum - 1]) ax.dist = 12 fignum = fignum + 1 # Plot the ground truth fig = plt.figure(fignum, figsize=(4, 3)) ax = Axes3D(fig, rect=[0, 0, .95, 1], elev=48, azim=134) for name, label in [('Setosa', 0), ('Versicolour', 1), ('Virginica', 2)]: ax.text3D(X[y == label, 3].mean(), X[y == label, 0].mean(), X[y == label, 2].mean() + 2, name, horizontalalignment='center', bbox=dict(alpha=.2, edgecolor='w', facecolor='w')) # Reorder the labels to have colors matching the cluster results y = np.choose(y, [1, 2, 0]).astype(np.float) ax.scatter(X[:, 3], X[:, 0], X[:, 2], c=y, edgecolor='k') ax.w_xaxis.set_ticklabels([]) ax.w_yaxis.set_ticklabels([]) ax.w_zaxis.set_ticklabels([]) ax.set_xlabel('Petal width') ax.set_ylabel('Sepal length') ax.set_zlabel('Petal length') ax.set_title('Ground Truth') ax.dist = 12 fig.show() ```
github_jupyter
# Задание 1.2 - Линейный классификатор (Linear classifier) В этом задании мы реализуем другую модель машинного обучения - линейный классификатор. Линейный классификатор подбирает для каждого класса веса, на которые нужно умножить значение каждого признака и потом сложить вместе. Тот класс, у которого эта сумма больше, и является предсказанием модели. В этом задании вы: - потренируетесь считать градиенты различных многомерных функций - реализуете подсчет градиентов через линейную модель и функцию потерь softmax - реализуете процесс тренировки линейного классификатора - подберете параметры тренировки на практике На всякий случай, еще раз ссылка на туториал по numpy: http://cs231n.github.io/python-numpy-tutorial/ ``` import numpy as np import matplotlib.pyplot as plt %matplotlib inline %load_ext autoreload %autoreload 2 from dataset import load_svhn, random_split_train_val from gradient_check import check_gradient from metrics import multiclass_accuracy import linear_classifer ``` # Как всегда, первым делом загружаем данные Мы будем использовать все тот же SVHN. ``` def prepare_for_linear_classifier(train_X, test_X): train_flat = train_X.reshape(train_X.shape[0], -1).astype(np.float) / 255.0 test_flat = test_X.reshape(test_X.shape[0], -1).astype(np.float) / 255.0 # Subtract mean mean_image = np.mean(train_flat, axis = 0) train_flat -= mean_image test_flat -= mean_image # Add another channel with ones as a bias term train_flat_with_ones = np.hstack([train_flat, np.ones((train_X.shape[0], 1))]) test_flat_with_ones = np.hstack([test_flat, np.ones((test_X.shape[0], 1))]) return train_flat_with_ones, test_flat_with_ones train_X, train_y, test_X, test_y = load_svhn("data", max_train=10000, max_test=1000) train_X, test_X = prepare_for_linear_classifier(train_X, test_X) # Split train into train and val train_X, train_y, val_X, val_y = random_split_train_val(train_X, train_y, num_val = 1000) ``` # Играемся с градиентами! В этом курсе мы будем писать много функций, которые вычисляют градиенты аналитическим методом. Все функции, в которых мы будем вычислять градиенты будут написаны по одной и той же схеме. Они будут получать на вход точку, где нужно вычислить значение и градиент функции, а на выходе будут выдавать кортеж (tuple) из двух значений - собственно значения функции в этой точке (всегда одно число) и аналитического значения градиента в той же точке (той же размерности, что и вход). ``` def f(x): """ Computes function and analytic gradient at x x: np array of float, input to the function Returns: value: float, value of the function grad: np array of float, same shape as x """ ... return value, grad ``` Необходимым инструментом во время реализации кода, вычисляющего градиенты, является функция его проверки. Эта функция вычисляет градиент численным методом и сверяет результат с градиентом, вычисленным аналитическим методом. Мы начнем с того, чтобы реализовать вычисление численного градиента (numeric gradient) в функции `check_gradient` в `gradient_check.py`. Эта функция будет принимать на вход функции формата, заданного выше, использовать значение `value` для вычисления численного градиента и сравнит его с аналитическим - они должны сходиться. Напишите часть функции, которая вычисляет градиент с помощью численной производной для каждой координаты. Для вычисления производной используйте так называемую two-point formula (https://en.wikipedia.org/wiki/Numerical_differentiation): ![image](https://wikimedia.org/api/rest_v1/media/math/render/svg/22fc2c0a66c63560a349604f8b6b39221566236d) Все функции приведенные в следующей клетке должны проходить gradient check. ``` # TODO: Implement check_gradient function in gradient_check.py # All the functions below should pass the gradient check def square(x): return float(x*x), 2*x check_gradient(square, np.array([3.0])) def array_sum(x): assert x.shape == (2,), x.shape return np.sum(x), np.ones_like(x) check_gradient(array_sum, np.array([3.0, 2.0])) def array_2d_sum(x): assert x.shape == (2,2) return np.sum(x), np.ones_like(x) check_gradient(array_2d_sum, np.array([[3.0, 2.0], [1.0, 0.0]])) ``` ## Начинаем писать свои функции, считающие аналитический градиент Теперь реализуем функцию softmax, которая получает на вход оценки для каждого класса и преобразует их в вероятности от 0 до 1: ![image](https://wikimedia.org/api/rest_v1/media/math/render/svg/e348290cf48ddbb6e9a6ef4e39363568b67c09d3) **Важно:** Практический аспект вычисления этой функции заключается в том, что в ней учавствует вычисление экспоненты от потенциально очень больших чисел - это может привести к очень большим значениям в числителе и знаменателе за пределами диапазона float. К счастью, у этой проблемы есть простое решение -- перед вычислением softmax вычесть из всех оценок максимальное значение среди всех оценок: ``` predictions -= np.max(predictions) ``` (подробнее здесь - http://cs231n.github.io/linear-classify/#softmax, секция `Practical issues: Numeric stability`) ``` # TODO Implement softmax and cross-entropy for single sample probs = linear_classifer.softmax(np.array([-10, 0, 10])) # Make sure it works for big numbers too! probs = linear_classifer.softmax(np.array([1000, 0, 0])) assert np.isclose(probs[0], 1.0) ``` Кроме этого, мы реализуем cross-entropy loss, которую мы будем использовать как функцию ошибки (error function). В общем виде cross-entropy определена следующим образом: ![image](https://wikimedia.org/api/rest_v1/media/math/render/svg/0cb6da032ab424eefdca0884cd4113fe578f4293) где x - все классы, p(x) - истинная вероятность принадлежности сэмпла классу x, а q(x) - вероятность принадлежности классу x, предсказанная моделью. В нашем случае сэмпл принадлежит только одному классу, индекс которого передается функции. Для него p(x) равна 1, а для остальных классов - 0. Это позволяет реализовать функцию проще! ``` probs = linear_classifer.softmax(np.array([-5, 0, 5])) linear_classifer.cross_entropy_loss(probs, 1) ``` После того как мы реализовали сами функции, мы можем реализовать градиент. Оказывается, что вычисление градиента становится гораздо проще, если объединить эти функции в одну, которая сначала вычисляет вероятности через softmax, а потом использует их для вычисления функции ошибки через cross-entropy loss. Эта функция `softmax_with_cross_entropy` будет возвращает и значение ошибки, и градиент по входным параметрам. Мы проверим корректность реализации с помощью `check_gradient`. ``` # TODO Implement combined function or softmax and cross entropy and produces gradient loss, grad = linear_classifer.softmax_with_cross_entropy(np.array([1, 0, 0]), 1) check_gradient(lambda x: linear_classifer.softmax_with_cross_entropy(x, 1), np.array([1, 0, 0], np.float)) linear_classifer.softmax_with_cross_entropy(np.array([1, 0, 0]), 0) linear_classifer.softmax(np.array([1, 0, 0])) np.log(linear_classifer.softmax(np.array([1, 0, 0]))) ``` В качестве метода тренировки мы будем использовать стохастический градиентный спуск (stochastic gradient descent или SGD), который работает с батчами сэмплов. Поэтому все наши фукнции будут получать не один пример, а батч, то есть входом будет не вектор из `num_classes` оценок, а матрица размерности `batch_size, num_classes`. Индекс примера в батче всегда будет первым измерением. Следующий шаг - переписать наши функции так, чтобы они поддерживали батчи. Финальное значение функции ошибки должно остаться числом, и оно равно среднему значению ошибки среди всех примеров в батче. ``` # TODO Extend combined function so it can receive a 2d array with batch of samples np.random.seed(42) # Test batch_size = 1 num_classes = 3 batch_size = 2 predictions = np.random.randint(-1, 3, size=(batch_size, num_classes)).astype(np.float) target_index = np.random.randint(0, num_classes, size=(batch_size, 1)).astype(np.int) loss, grads = linear_classifer.softmax_with_cross_entropy(predictions, target_index) check_gradient(lambda x: linear_classifer.softmax_with_cross_entropy(x, target_index), predictions) delta=1e-5 tol = 1e-4 z_ = predictions.copy() it = np.nditer(grads, flags=['multi_index'], op_flags=['readwrite']) while not it.finished: ix = it.multi_index print(grads[ix]) f = lambda x: linear_classifer.softmax_with_cross_entropy(x, target_index) delta_vec = np.zeros_like(z_) delta_vec[ix] += delta print('delta', delta_vec, '\n', z_ + delta_vec) temp1 = f(z_ + delta_vec)[0] temp2 = f(z_ - delta_vec)[0] print('temp1', temp1, '\ntemp2', temp2) print((temp1 - temp2)/(2 * delta), '\n') it.iternext() # TODO Extend combined function so it can receive a 2d array with batch of samples np.random.seed(42) # Test batch_size = 1 num_classes = 4 batch_size = 1 predictions = np.random.randint(-1, 3, size=(batch_size, num_classes)).astype(np.float) target_index = np.random.randint(0, num_classes, size=(batch_size, 1)).astype(np.int) check_gradient(lambda x: linear_classifer.softmax_with_cross_entropy(x, target_index), predictions) # Test batch_size = 3 num_classes = 4 batch_size = 3 predictions = np.random.randint(-1, 3, size=(batch_size, num_classes)).astype(np.float) target_index = np.random.randint(0, num_classes, size=(batch_size, 1)).astype(np.int) check_gradient(lambda x: linear_classifer.softmax_with_cross_entropy(x, target_index), predictions) ``` ### Наконец, реализуем сам линейный классификатор! softmax и cross-entropy получают на вход оценки, которые выдает линейный классификатор. Он делает это очень просто: для каждого класса есть набор весов, на которые надо умножить пиксели картинки и сложить. Получившееся число и является оценкой класса, идущей на вход softmax. Таким образом, линейный классификатор можно представить как умножение вектора с пикселями на матрицу W размера `num_features, num_classes`. Такой подход легко расширяется на случай батча векторов с пикселями X размера `batch_size, num_features`: `predictions = X * W`, где `*` - матричное умножение. Реализуйте функцию подсчета линейного классификатора и градиентов по весам `linear_softmax` в файле `linear_classifer.py` ``` # TODO Implement linear_softmax function that uses softmax with cross-entropy for linear classifier batch_size = 2 num_classes = 2 num_features = 3 np.random.seed(42) W = np.random.randint(-1, 3, size=(num_features, num_classes)).astype(np.float) X = np.random.randint(-1, 3, size=(batch_size, num_features)).astype(np.float) target_index = np.ones(batch_size, dtype=np.int) X W predictions = np.dot(X, W) predictions loss, grads = linear_classifer.linear_softmax(X, W, target_index) grads delta=1e-5 tol = 1e-4 z_ = W.copy() it = np.nditer(grads, flags=['multi_index'], op_flags=['readwrite']) while not it.finished: ix = it.multi_index print(grads[ix]) f = lambda w: linear_classifer.linear_softmax(X, w, target_index) delta_vec = np.zeros_like(z_) delta_vec[ix] += delta print('delta', delta_vec, '\n', z_ + delta_vec) temp1 = f(z_ + delta_vec)[0] temp2 = f(z_ - delta_vec)[0] print('temp1', temp1, '\ntemp2', temp2) print((temp1 - temp2)/(2 * delta), '\n') it.iternext() # TODO Implement linear_softmax function that uses softmax with cross-entropy for linear classifier batch_size = 2 num_classes = 2 num_features = 3 np.random.seed(42) W = np.random.randint(-1, 3, size=(num_features, num_classes)).astype(np.float) X = np.random.randint(-1, 3, size=(batch_size, num_features)).astype(np.float) target_index = np.ones(batch_size, dtype=np.int) loss, dW = linear_classifer.linear_softmax(X, W, target_index) check_gradient(lambda w: linear_classifer.linear_softmax(X, w, target_index), W) dW ``` ### И теперь регуляризация Мы будем использовать L2 regularization для весов как часть общей функции ошибки. Напомним, L2 regularization определяется как l2_reg_loss = regularization_strength * sum<sub>ij</sub> W[i, j]<sup>2</sup> Реализуйте функцию для его вычисления и вычисления соотвествующих градиентов. ``` # TODO Implement l2_regularization function that implements loss for L2 regularization linear_classifer.l2_regularization(W, 0.01) check_gradient(lambda w: linear_classifer.l2_regularization(w, 0.01), W) ``` # Тренировка! Градиенты в порядке, реализуем процесс тренировки! ``` # TODO: Implement LinearSoftmaxClassifier.fit function classifier = linear_classifer.LinearSoftmaxClassifier() loss_history = classifier.fit(train_X, train_y, epochs=10, learning_rate=1e-3, batch_size=300, reg=1e1) # let's look at the loss history! plt.plot(loss_history) plt.show() # Let's check how it performs on validation set pred = classifier.predict(val_X) accuracy = multiclass_accuracy(pred, val_y) print("Accuracy: ", accuracy) # Now, let's train more and see if it performs better classifier.fit(train_X, train_y, epochs=100, learning_rate=1e-3, batch_size=300, reg=1e1) pred = classifier.predict(val_X) accuracy = multiclass_accuracy(pred, val_y) print("Accuracy after training for 100 epochs: ", accuracy) ``` ### Как и раньше, используем кросс-валидацию для подбора гиперпараметтов. В этот раз, чтобы тренировка занимала разумное время, мы будем использовать только одно разделение на тренировочные (training) и проверочные (validation) данные. Теперь нам нужно подобрать не один, а два гиперпараметра! Не ограничивайте себя изначальными значениями в коде. Добейтесь точности более чем **20%** на проверочных данных (validation data). ``` from tqdm import tqdm from itertools import product %%time num_epochs = 200 batch_size = 300 learning_rates = [1e-1, 1e-2, 1e-3, 1e-4] reg_strengths = [1e-1, 1e-2, 1e-3, 1e-4] best_classifier = None best_val_accuracy = None # TODO use validation set to find the best hyperparameters # hint: for best results, you might need to try more values for learning rate and regularization strength # than provided initially for lr, reg in tqdm(product(learning_rates, reg_strengths)): classifier = linear_classifer.LinearSoftmaxClassifier() classifier.fit(train_X, train_y, epochs=10, learning_rate=lr, batch_size=100, reg=reg, random_state=77) # make prediction on validation pred = classifier.predict(val_X) accuracy = multiclass_accuracy(pred, val_y) print('lr={lr}; reg={reg}'.format(lr=lr, reg=reg)) print("Accuracy current: ", accuracy, '\n') if (best_val_accuracy is None) or (best_val_accuracy < accuracy): best_val_accuracy = accuracy best_classifier = classifier print('best validation accuracy achieved: %f' % best_val_accuracy) ``` # Какой же точности мы добились на тестовых данных? ``` test_pred = best_classifier.predict(test_X) test_accuracy = multiclass_accuracy(test_pred, test_y) print('Linear softmax classifier test set accuracy: %f' % (test_accuracy, )) ```
github_jupyter
# Performing measurements using QCoDeS parameters and DataSet This notebook shows some ways of performing different measurements using QCoDeS parameters and the [DataSet](DataSet-class-walkthrough.ipynb) via a powerful ``Measurement`` context manager. Here, it is assumed that the reader has some degree of familiarity with fundamental objects and methods of QCoDeS. ## Implementing a measurement Now, let us start with necessary imports: ``` %matplotlib inline import numpy.random as rd import matplotlib.pyplot as plt import numpy as np from time import sleep, monotonic import qcodes as qc from qcodes import Station, load_or_create_experiment, \ initialise_database, Measurement, load_by_run_spec, load_by_guid from qcodes.tests.instrument_mocks import DummyInstrument, DummyInstrumentWithMeasurement from qcodes.dataset.plotting import plot_dataset from qcodes.dataset.descriptions.detect_shapes import detect_shape_of_measurement qc.logger.start_all_logging() ``` In what follows, we shall define some utility functions as well as declare our dummy instruments. We, then, add these instruments to a ``Station`` object. The dummy dmm is setup to generate an output depending on the values set on the dummy dac simulating a real experiment. ``` # preparatory mocking of physical setup dac = DummyInstrument('dac', gates=['ch1', 'ch2']) dmm = DummyInstrumentWithMeasurement(name='dmm', setter_instr=dac) station = qc.Station(dmm, dac) # now make some silly set-up and tear-down actions def veryfirst(): print('Starting the measurement') def numbertwo(inst1, inst2): print('Doing stuff with the following two instruments: {}, {}'.format(inst1, inst2)) def thelast(): print('End of experiment') ``` **Note** that database and experiments may be missing. If this is the first time you create a dataset, the underlying database file has most likely not been created. The following cell creates the database file. Please refer to documentation on [The Experiment Container](The-Experiment-Container.ipynb) for details. Furthermore, datasets are associated to an experiment. By default, a dataset (or "run") is appended to the latest existing experiments. If no experiment has been created, we must create one. We do that by calling the `load_or_create_experiment` function. Here we explicitly pass the loaded or created experiment to the `Measurement` object to ensure that we are always using the `performing_meas_using_parameters_and_dataset` `Experiment` created within this tutorial. Note that a keyword argument `name` can also be set as any string value for `Measurement` which later becomes the `name` of the dataset that running that `Measurement` produces. ``` initialise_database() exp = load_or_create_experiment( experiment_name='performing_meas_using_parameters_and_dataset', sample_name="no sample" ) ``` And then run an experiment: ``` meas = Measurement(exp=exp, name='exponential_decay') meas.register_parameter(dac.ch1) # register the first independent parameter meas.register_parameter(dmm.v1, setpoints=(dac.ch1,)) # now register the dependent oone meas.add_before_run(veryfirst, ()) # add a set-up action meas.add_before_run(numbertwo, (dmm, dac)) # add another set-up action meas.add_after_run(thelast, ()) # add a tear-down action meas.write_period = 0.5 with meas.run() as datasaver: for set_v in np.linspace(0, 25, 10): dac.ch1.set(set_v) get_v = dmm.v1.get() datasaver.add_result((dac.ch1, set_v), (dmm.v1, get_v)) dataset1D = datasaver.dataset # convenient to have for data access and plotting ax, cbax = plot_dataset(dataset1D) ``` And let's add an example of a 2D measurement. For the 2D, we'll need a new batch of parameters, notably one with two other parameters as setpoints. We therefore define a new Measurement with new parameters. ``` meas = Measurement(exp=exp, name='2D_measurement_example') meas.register_parameter(dac.ch1) # register the first independent parameter meas.register_parameter(dac.ch2) # register the second independent parameter meas.register_parameter(dmm.v2, setpoints=(dac.ch1, dac.ch2)) # now register the dependent oone # run a 2D sweep with meas.run() as datasaver: for v1 in np.linspace(-1, 1, 200): for v2 in np.linspace(-1, 1, 200): dac.ch1(v1) dac.ch2(v2) val = dmm.v2.get() datasaver.add_result((dac.ch1, v1), (dac.ch2, v2), (dmm.v2, val)) dataset2D = datasaver.dataset ax, cbax = plot_dataset(dataset2D) ``` ## Accessing and exporting the measured data QCoDeS ``DataSet`` implements a number of methods for accessing the data of a given dataset. Here we will concentrate on the two most user friendly methods. For a more detailed walkthrough of the `DataSet` class, refer to [DataSet class walkthrough](DataSet-class-walkthrough.ipynb) notebook. The method `get_parameter_data` returns the data as a dictionary of ``numpy`` arrays. The dictionary is indexed by the measured (dependent) parameter in the outermost level and the names of the dependent and independent parameters in the innermost level. The first parameter in the innermost level is always the dependent parameter. ``` dataset1D.get_parameter_data() ``` By default `get_parameter_data` returns all data stored in the dataset. The data that is specific to one or more measured parameters can be returned by passing the parameter name(s) or by using `ParamSpec` object: ``` dataset1D.get_parameter_data('dmm_v1') ``` You can also simply fetch the data for one or more dependent parameter ``` dataset1D.get_parameter_data('dac_ch1') ``` For more details about accessing data of a given `DataSet`, see [Accessing data in DataSet notebook](Accessing-data-in-DataSet.ipynb). The data can also be exported as one or more [Pandas](https://pandas.pydata.org/) DataFrames. The DataFrames cane be returned either as a single dataframe or as a dictionary from measured parameters to DataFrames. If you measure all parameters as a function of the same set of parameters you probably want to export to a single dataframe. ``` dataset1D.to_pandas_dataframe() ``` However, there may be cases where the data within a dataset cannot be put into a single dataframe. In those cases you can use the other method to export the dataset to a dictionary from name of the measured parameter to Pandas dataframes. ``` dataset1D.to_pandas_dataframe_dict() ``` When exporting a two or higher dimensional datasets as a Pandas DataFrame a [MultiIndex](https://pandas.pydata.org/pandas-docs/stable/user_guide/advanced.html) is used to index the measured parameter based on all the dependencies ``` dataset2D.to_pandas_dataframe()[0:10] ``` If your data is on a regular grid it may make sense to view the data as an [XArray](https://pandas.pydata.org/pandas-docs/stable/user_guide/advanced.html) Dataset. The dataset can be directly exported to a XArray Dataset. ``` dataset2D.to_xarray_dataset() ``` Note, however, that XArray is only suited for data that is on a rectangular grid with few or no missing values. If the data does not lie on a grid, all the measured data points will have an unique combination of the two dependent parameters. When exporting to XArray, NaN's will therefore replace all the missing combinations of `dac_ch1` and `dac_ch2` and the data is unlikely to be useful in this format. For more details about using Pandas and XArray see [Working With Pandas and XArray](./Working-With-Pandas-and-XArray.ipynb) It is also possible to export the datasets directly to various file formats see [Exporting QCoDes Datasets](./Exporting-data-to-other-file-formats.ipynb) ## Reloading datasets To load existing datasets QCoDeS provides several functions. The most useful and generic function is called `load_by_run_spec`. This function takes one or more pieces of information about a dataset and will either, if the dataset is uniquely identifiable by the information, load the dataset or print information about all the datasets that match the supplied information allowing you to provide more information to uniquely identify the dataset. Here, we will load a dataset based on the `captured_run_id` printed on the plot above. ``` dataset1D.captured_run_id loaded_ds = load_by_run_spec(captured_run_id=dataset1D.captured_run_id) loaded_ds.the_same_dataset_as(dataset1D) ``` As long as you are working within one database file the dataset should be uniquely identified by `captured_run_id`. However, once you mix several datasets from different database files this is likely not unique. See the following section and [Extracting runs from one DB file to another](Extracting-runs-from-one-DB-file-to-another.ipynb) for more information on how to handle this. ### DataSet GUID Internally each dataset is refereed too by a Globally Unique Identifier (GUID) that ensures that the dataset uniquely identified even if datasets from several databases with potentially identical captured_run_id, experiment and sample names. A dataset can always be reloaded from the GUID if known. ``` print(f"Dataset GUID is: {dataset1D.guid}") loaded_ds = load_by_guid(dataset1D.guid) loaded_ds.the_same_dataset_as(dataset1D) ``` ## Specifying shape of measurement As the context manager allows you to store data of any shape (with the only restriction being that you supply values for both dependent and independent parameters together), it cannot know if the data is being measured on a grid. As a consequence, the Numpy array of data loaded from the dataset may not be of the shape that you expect. `plot_dataset`, `DataSet.to_pandas...` and `DataSet.to_xarray...` contain logic that can detect the shape of the data measured at load time. However, if you know the shape of the measurement that you are going to perform up front, you can choose to specify it before initializing the measurement using ``Measurement.set_shapes`` method. `dataset.get_parameter_data` and `dataset.cache.data` automatically makes use of this information to return shaped data when loaded from the database. Note that these two methods behave slightly different when loading data on a partially completed dataset. `dataset.get_parameter_data` will only reshape the data if the number of points measured matches the number of points expected according to the metadata. `dataset.cache.data` will however return a dataset with empty placeholders (either NaN, zeros or empty strings depending on the datatypes) for missing values in a partially filled dataset. Note that if you use the doNd functions demonstrated in [Using doNd functions in comparison to Measurement context manager for performing measurements](Using_doNd_functions_in_comparison_to_Measurement_context_manager_for_performing_measurements.ipynb) the shape information will be detected and stored automatically. In the example below we show how the shape can be specified manually. ``` n_points_1 = 100 n_points_2 = 200 meas_with_shape = Measurement(exp=exp, name='shape_specification_example_measurement') meas_with_shape.register_parameter(dac.ch1) # register the first independent parameter meas_with_shape.register_parameter(dac.ch2) # register the second independent parameter meas_with_shape.register_parameter(dmm.v2, setpoints=(dac.ch1, dac.ch2)) # now register the dependent oone meas_with_shape.set_shapes(detect_shape_of_measurement((dmm.v2,), (n_points_1, n_points_2))) with meas_with_shape.run() as datasaver: for v1 in np.linspace(-1, 1, n_points_1): for v2 in np.linspace(-1, 1, n_points_2): dac.ch1(v1) dac.ch2(v2) val = dmm.v2.get() datasaver.add_result((dac.ch1, v1), (dac.ch2, v2), (dmm.v2, val)) dataset = datasaver.dataset # convenient to have for plotting for name, data in dataset.get_parameter_data()['dmm_v2'].items(): print(f"{name}: data.shape={data.shape}, expected_shape=({n_points_1},{n_points_2})") assert data.shape == (n_points_1, n_points_2) ``` ## Performing several measuments concurrently It is possible to perform two or more measurements at the same time. This may be convenient if you need to measure several parameters as a function of the same independent parameters. ``` # setup two measurements meas1 = Measurement(exp=exp, name='multi_measurement_1') meas1.register_parameter(dac.ch1) meas1.register_parameter(dac.ch2) meas1.register_parameter(dmm.v1, setpoints=(dac.ch1, dac.ch2)) meas2 = Measurement(exp=exp, name='multi_measurement_2') meas2.register_parameter(dac.ch1) meas2.register_parameter(dac.ch2) meas2.register_parameter(dmm.v2, setpoints=(dac.ch1, dac.ch2)) with meas1.run() as datasaver1, meas2.run() as datasaver2: v1points = np.concatenate((np.linspace(-2, -0.5, 10), np.linspace(-0.51, 0.5, 200), np.linspace(0.51, 2, 10))) v2points = np.concatenate((np.linspace(-2, -0.25, 10), np.linspace(-0.26, 0.5, 200), np.linspace(0.51, 2, 10))) for v1 in v1points: for v2 in v2points: dac.ch1(v1) dac.ch2(v2) val1 = dmm.v1.get() datasaver1.add_result((dac.ch1, v1), (dac.ch2, v2), (dmm.v1, val1)) val2 = dmm.v2.get() datasaver2.add_result((dac.ch1, v1), (dac.ch2, v2), (dmm.v2, val2)) ax, cbax = plot_dataset(datasaver1.dataset) ax, cbax = plot_dataset(datasaver2.dataset) ``` ## Interrupting measurements early There may be cases where you do not want to complete a measurement. Currently QCoDeS is designed to allow the user to interrupt the measurements with a standard KeyBoardInterrupt. KeyBoardInterrupts can be raised with either a Ctrl-C keyboard shortcut or using the interrupt button in Juypter / Spyder which is typically in the form of a Square stop button. QCoDeS is designed such that KeyboardInterrupts are delayed around critical parts of the code and the measurement is stopped when its safe to do so. ## QCoDeS Array and MultiParameter The ``Measurement`` object supports automatic handling of ``Array`` and ``MultiParameters``. When registering these parameters the individual components are unpacked and added to the dataset as if they were separate parameters. Lets consider a ``MultiParamter`` with array components as the most general case. First lets use a dummy instrument that produces data as ``Array`` and ``MultiParameters``. ``` from qcodes.tests.instrument_mocks import DummyChannelInstrument mydummy = DummyChannelInstrument('MyDummy') ``` This instrument produces two ``Array``s with the names, shapes and setpoints given below. ``` mydummy.A.dummy_2d_multi_parameter.names mydummy.A.dummy_2d_multi_parameter.shapes mydummy.A.dummy_2d_multi_parameter.setpoint_names meas = Measurement(exp=exp) meas.register_parameter(mydummy.A.dummy_2d_multi_parameter) meas.parameters ``` When adding the MultiParameter to the measurement we can see that we add each of the individual components as a separate parameter. ``` with meas.run() as datasaver: datasaver.add_result((mydummy.A.dummy_2d_multi_parameter, mydummy.A.dummy_2d_multi_parameter())) ``` And when adding the result of a ``MultiParameter`` it is automatically unpacked into its components. ``` plot_dataset(datasaver.dataset) datasaver.dataset.get_parameter_data('MyDummy_ChanA_that') datasaver.dataset.to_pandas_dataframe() datasaver.dataset.to_xarray_dataset() ``` ## Avoiding verbosity of the Measurement context manager for simple measurements For simple 1D/2D grid-type of measurements, it may feel like an overkill to use the verbose and flexible Measurement context manager construct. For this case, so-called ``doNd`` functions come ti rescue - convenient one- or two-line calls, read more about them in [Using doNd functions](./Using_doNd_functions_in_comparison_to_Measurement_context_manager_for_performing_measurements.ipynb). ## Optimizing measurement time There are measurements that are data-heavy or time consuming, or both. QCoDeS provides some features and tools that should help in optimizing the measurement time. Some of those are: * [Saving data in the background](./Saving_data_in_the_background.ipynb) * Setting more appropriate ``paramtype`` when registering parameters, see [Paramtypes explained](./Paramtypes%20explained.ipynb) * Adding result to datasaver by creating threads per instrument, see [Threaded data acquisition](./Threaded%20data%20acquisition.ipynb) ## The power of the Measurement context manager construct This new form is so free that we may easily do thing impossible with the old Loop construct. Say, that from the plot of the above 1D measurement, we decide that a voltage below 1 V is uninteresting, so we stop the sweep at that point, thus, we do not know in advance how many points we'll measure. ``` meas = Measurement(exp=exp) meas.register_parameter(dac.ch1) # register the first independent parameter meas.register_parameter(dmm.v1, setpoints=(dac.ch1,)) # now register the dependent oone with meas.run() as datasaver: for set_v in np.linspace(0, 25, 100): dac.ch1.set(set_v) get_v = dmm.v1.get() datasaver.add_result((dac.ch1, set_v), (dmm.v1, get_v)) if get_v < 1: break dataset = datasaver.dataset ax, cbax = plot_dataset(dataset) ``` Or we might want to simply get as many points as possible in 10 s randomly sampling the region between 0 V and 10 V (for the setpoint axis). ``` from time import monotonic, sleep with meas.run() as datasaver: t_start = monotonic() while monotonic() - t_start < 3: set_v = 10/2*(np.random.rand() + 1) dac.ch1.set(set_v) # some sleep to not get too many points (or to let the system settle) sleep(0.04) get_v = dmm.v1.get() datasaver.add_result((dac.ch1, set_v), (dmm.v1, get_v)) dataset = datasaver.dataset # convenient to have for plotting axes, cbax = plot_dataset(dataset) # we slightly tweak the plot to better visualise the highly non-standard axis spacing axes[0].lines[0].set_marker('o') axes[0].lines[0].set_markerfacecolor((0.6, 0.6, 0.9)) axes[0].lines[0].set_markeredgecolor((0.4, 0.6, 0.9)) axes[0].lines[0].set_color((0.8, 0.8, 0.8)) ``` ### Finer sampling in 2D Looking at the plot of the 2D measurement above, we may decide to sample more finely in the central region: ``` meas = Measurement(exp=exp) meas.register_parameter(dac.ch1) # register the first independent parameter meas.register_parameter(dac.ch2) # register the second independent parameter meas.register_parameter(dmm.v2, setpoints=(dac.ch1, dac.ch2)) # now register the dependent oone with meas.run() as datasaver: v1points = np.concatenate((np.linspace(-1, -0.5, 5), np.linspace(-0.51, 0.5, 200), np.linspace(0.51, 1, 5))) v2points = np.concatenate((np.linspace(-1, -0.25, 5), np.linspace(-0.26, 0.5, 200), np.linspace(0.51, 1, 5))) for v1 in v1points: for v2 in v2points: dac.ch1(v1) dac.ch2(v2) val = dmm.v2.get() datasaver.add_result((dac.ch1, v1), (dac.ch2, v2), (dmm.v2, val)) dataset = datasaver.dataset # convenient to have for plotting ax, cbax = plot_dataset(dataset) ``` ### Simple adaptive 2D sweep .. or even perform an adaptive sweep... ooohh... (the example below is a not-very-clever toy model example, but it nicely shows a semi-realistic measurement that the old Loop could not handle) ``` v1_points = np.linspace(-1, 1, 250) v2_points = np.linspace(1, -1, 250) threshold = 0.25 with meas.run() as datasaver: # Do normal sweeping until the peak is detected for v2ind, v2 in enumerate(v2_points): for v1ind, v1 in enumerate(v1_points): dac.ch1(v1) dac.ch2(v2) val = dmm.v2.get() datasaver.add_result((dac.ch1, v1), (dac.ch2, v2), (dmm.v2, val)) if val > threshold: break else: continue break print(v1ind, v2ind, val) print('-'*10) # now be more clever, meandering back and forth over the peak doneyet = False rowdone = False v1_step = 1 while not doneyet: v2 = v2_points[v2ind] v1 = v1_points[v1ind+v1_step-1] dac.ch1(v1) dac.ch2(v2) val = dmm.v2.get() datasaver.add_result((dac.ch1, v1), (dac.ch2, v2), (dmm.v2, val)) if val < threshold: if rowdone: doneyet = True v2ind += 1 v1_step *= -1 rowdone = True else: v1ind += v1_step rowdone = False dataset = datasaver.dataset # convenient to have for plotting ax, cbax = plot_dataset(dataset) ``` ### Random sampling We may also chose to sample completely randomly across the phase space ``` meas2 = Measurement(exp=exp, name='random_sampling_measurement') meas2.register_parameter(dac.ch1) meas2.register_parameter(dac.ch2) meas2.register_parameter(dmm.v2, setpoints=(dac.ch1, dac.ch2)) threshold = 0.25 npoints = 5000 with meas2.run() as datasaver: for i in range(npoints): x = 2*(np.random.rand()-.5) y = 2*(np.random.rand()-.5) dac.ch1(x) dac.ch2(y) z = dmm.v2() datasaver.add_result((dac.ch1, x), (dac.ch2, y), (dmm.v2, z)) dataset = datasaver.dataset # convenient to have for plotting ax, cbax = plot_dataset(dataset) datasaver.dataset.to_pandas_dataframe()[0:10] ``` Unlike the data measured above, which lies on a grid, here, all the measured data points have an unique combination of the two dependent parameters. When exporting to XArray NaN's will therefore replace all the missing combinations of `dac_ch1` and `dac_ch2` and the data is unlikely to be useful in this format. ``` datasaver.dataset.to_xarray_dataset() ``` ### Optimiser An example to show that the algorithm is flexible enough to be used with completely unstructured data such as the output of an downhill simplex optimization. The downhill simplex is somewhat more sensitive to noise and it is important that 'fatol' is set to match the expected noise. ``` from scipy.optimize import minimize def set_and_measure(*xk): dac.ch1(xk[0]) dac.ch2(xk[1]) return dmm.v2.get() noise = 0.0005 x0 = [np.random.rand(), np.random.rand()] with meas.run() as datasaver: def mycallback(xk): dac.ch1(xk[0]) dac.ch2(xk[1]) datasaver.add_result((dac.ch1, xk[0]), (dac.ch2, xk[1]), (dmm.v2, dmm.v2.cache.get())) res = minimize(lambda x: -set_and_measure(*x), x0, method='Nelder-Mead', tol=1e-10, callback=mycallback, options={'fatol': noise}) dataset = datasaver.dataset # convenient to have for plotting res ax, cbax = plot_dataset(dataset) ``` ## Subscriptions The ``Measurement`` object can also handle subscriptions to the dataset. Subscriptions are, under the hood, triggers in the underlying SQLite database. Therefore, the subscribers are only called when data is written to the database (which happens every `write_period`). When making a subscription, two things must be supplied: a function and a mutable state object. The function **MUST** have a call signature of `f(result_list, length, state, **kwargs)`, where ``result_list`` is a list of tuples of parameter values inserted in the dataset, ``length`` is an integer (the step number of the run), and ``state`` is the mutable state object. The function does not need to actually use these arguments, but the call signature must match this. Let us consider two generic examples: ### Subscription example 1: simple printing ``` def print_which_step(results_list, length, state): """ This subscriber does not use results_list nor state; it simply prints how many results we have added to the database """ print(f'The run now holds {length} rows') meas = Measurement(exp=exp) meas.register_parameter(dac.ch1) meas.register_parameter(dmm.v1, setpoints=(dac.ch1,)) meas.write_period = 0.2 # We write to the database every 0.2s meas.add_subscriber(print_which_step, state=[]) with meas.run() as datasaver: for n in range(7): datasaver.add_result((dac.ch1, n), (dmm.v1, n**2)) print(f'Added points to measurement, step {n}.') sleep(0.2) ``` ### Subscription example 2: using the state We add two subscribers now. ``` def get_list_of_first_param(results_list, length, state): """ Modify the state (a list) to hold all the values for the first parameter """ param_vals = [parvals[0] for parvals in results_list] state += param_vals meas = Measurement(exp=exp) meas.register_parameter(dac.ch1) meas.register_parameter(dmm.v1, setpoints=(dac.ch1,)) meas.write_period = 0.2 # We write to the database every 0.2s first_param_list = [] meas.add_subscriber(print_which_step, state=[]) meas.add_subscriber(get_list_of_first_param, state=first_param_list) with meas.run() as datasaver: for n in range(10): datasaver.add_result((dac.ch1, n), (dmm.v1, n**2)) print(f'Added points to measurement, step {n}.') print(f'First parameter value list: {first_param_list}') sleep(0.1) ```
github_jupyter
# Activations functions. > Activations functions. Set of act_fn. Activation functions, forked from https://github.com/rwightman/pytorch-image-models/timm/models/layers/activations.py Mish: Self Regularized Non-Monotonic Activation Function https://github.com/digantamisra98/Mish fastai forum discussion https://forums.fast.ai/t/meet-mish-new-activation-function-possible-successor-to-relu Mish is in Pytorch from version 1.9. Use this version! ``` # hide # forked from https://github.com/rwightman/pytorch-image-models/timm/models/layers/activations.py import torch from torch import nn as nn from torch.nn import functional as F ``` ## Mish ``` def mish(x, inplace: bool = False): """Mish: A Self Regularized Non-Monotonic Neural Activation Function - https://arxiv.org/abs/1908.08681 NOTE: I don't have a working inplace variant """ return x.mul(F.softplus(x).tanh()) class Mish(nn.Module): """Mish: A Self Regularized Non-Monotonic Neural Activation Function - https://arxiv.org/abs/1908.08681""" def __init__(self, inplace: bool = False): """NOTE: inplace variant not working """ super(Mish, self).__init__() def forward(self, x): return mish(x) ``` ## MishJit ``` @torch.jit.script def mish_jit(x, _inplace: bool = False): """Jit version of Mish. Mish: A Self Regularized Non-Monotonic Neural Activation Function - https://arxiv.org/abs/1908.08681 """ return x.mul(F.softplus(x).tanh()) class MishJit(nn.Module): def __init__(self, inplace: bool = False): """Jit version of Mish. Mish: A Self Regularized Non-Monotonic Neural Activation Function - https://arxiv.org/abs/1908.08681""" super(MishJit, self).__init__() def forward(self, x): return mish_jit(x) ``` ## MishJitMe - memory-efficient. ``` @torch.jit.script def mish_jit_fwd(x): # return x.mul(torch.tanh(F.softplus(x))) return x.mul(F.softplus(x).tanh()) @torch.jit.script def mish_jit_bwd(x, grad_output): x_sigmoid = torch.sigmoid(x) x_tanh_sp = F.softplus(x).tanh() return grad_output.mul(x_tanh_sp + x * x_sigmoid * (1 - x_tanh_sp * x_tanh_sp)) class MishJitAutoFn(torch.autograd.Function): """ Mish: A Self Regularized Non-Monotonic Neural Activation Function - https://arxiv.org/abs/1908.08681 A memory efficient, jit scripted variant of Mish""" @staticmethod def forward(ctx, x): ctx.save_for_backward(x) return mish_jit_fwd(x) @staticmethod def backward(ctx, grad_output): x = ctx.saved_tensors[0] return mish_jit_bwd(x, grad_output) def mish_me(x, inplace=False): return MishJitAutoFn.apply(x) class MishMe(nn.Module): """ Mish: A Self Regularized Non-Monotonic Neural Activation Function - https://arxiv.org/abs/1908.08681 A memory efficient, jit scripted variant of Mish""" def __init__(self, inplace: bool = False): super(MishMe, self).__init__() def forward(self, x): return MishJitAutoFn.apply(x) ``` ## HardMishJit ``` @torch.jit.script def hard_mish_jit(x, inplace: bool = False): """ Hard Mish Experimental, based on notes by Mish author Diganta Misra at https://github.com/digantamisra98/H-Mish/blob/0da20d4bc58e696b6803f2523c58d3c8a82782d0/README.md """ return 0.5 * x * (x + 2).clamp(min=0, max=2) class HardMishJit(nn.Module): """ Hard Mish Experimental, based on notes by Mish author Diganta Misra at https://github.com/digantamisra98/H-Mish/blob/0da20d4bc58e696b6803f2523c58d3c8a82782d0/README.md """ def __init__(self, inplace: bool = False): super(HardMishJit, self).__init__() def forward(self, x): return hard_mish_jit(x) ``` ## HardMishJitMe - memory efficient. ``` @torch.jit.script def hard_mish_jit_fwd(x): return 0.5 * x * (x + 2).clamp(min=0, max=2) @torch.jit.script def hard_mish_jit_bwd(x, grad_output): m = torch.ones_like(x) * (x >= -2.) m = torch.where((x >= -2.) & (x <= 0.), x + 1., m) return grad_output * m class HardMishJitAutoFn(torch.autograd.Function): """ A memory efficient, jit scripted variant of Hard Mish Experimental, based on notes by Mish author Diganta Misra at https://github.com/digantamisra98/H-Mish/blob/0da20d4bc58e696b6803f2523c58d3c8a82782d0/README.md """ @staticmethod def forward(ctx, x): ctx.save_for_backward(x) return hard_mish_jit_fwd(x) @staticmethod def backward(ctx, grad_output): x = ctx.saved_tensors[0] return hard_mish_jit_bwd(x, grad_output) def hard_mish_me(x, inplace: bool = False): return HardMishJitAutoFn.apply(x) class HardMishMe(nn.Module): """ A memory efficient, jit scripted variant of Hard Mish Experimental, based on notes by Mish author Diganta Misra at https://github.com/digantamisra98/H-Mish/blob/0da20d4bc58e696b6803f2523c58d3c8a82782d0/README.md """ def __init__(self, inplace: bool = False): super(HardMishMe, self).__init__() def forward(self, x): return HardMishJitAutoFn.apply(x) #hide act_fn = Mish(inplace=True) ``` # end model_constructor by ayasyrev
github_jupyter
# CZ4042 Neural Networks & Deep Learning ## Assignment - 1: Part A, Question 5 > Gupta Jay > U1822549K > School of Computer Science and Engineering > Nanyang Technological University, Singapore ## Imports ``` # Setting the seed here is sufficient. # If you don't plan to use these starter code, make sure you add this cell. SEED = 42 import os os.environ['TF_CUDNN_DETERMINISTIC'] = '1' import random random.seed(SEED) import numpy as np np.random.seed(SEED) import tensorflow as tf tf.random.set_seed(SEED) import pandas as pd import numpy as np # tensorflow libraries import tensorflow as tf import tensorflow.keras as keras from tensorflow.keras import layers from tensorflow.keras import Sequential # sklearn libraries are useful for preprocessing, performance measures, etc. from sklearn import preprocessing from sklearn.model_selection import KFold from sklearn.model_selection import train_test_split from matplotlib import pyplot as plt print(tf.__version__) # Supress any warnings for clean presentation import warnings warnings.filterwarnings("ignore") df = pd.read_csv('./features_30_sec.csv') df.head() df['label'].value_counts() ``` Split and scale dataset ``` columns_to_drop = ['label','filename', 'length'] def prepare_dataset(df, columns_to_drop, test_size, random_state): # Encode the labels from 0 to n_classes-1 label_encoder = preprocessing.LabelEncoder() df['label'] = label_encoder.fit_transform(df['label']) # devide data to train and test df_train, df_test = train_test_split(df, test_size=test_size, random_state=random_state) # scale the training inputs x_train = df_train.drop(columns_to_drop,axis=1) y_train = df_train['label'].to_numpy() standard_scaler = preprocessing.StandardScaler() x_train_scaled = standard_scaler.fit_transform(x_train) #scale and prepare testing data x_test = df_test.drop(columns_to_drop,axis=1) x_test_scaled = standard_scaler.transform(x_test) y_test = df_test['label'].to_numpy() return x_train_scaled, y_train, x_test_scaled, y_test X_train, y_train, X_test, y_test = prepare_dataset(df, columns_to_drop, test_size=0.3, random_state=0) print(X_train.shape, y_train.shape) print(X_test.shape, y_test.shape) ``` ## Part A: Investigation on Dropouts ``` def getModel(first_layer_activation, second_layer_activation, add_dropout): # Inputs -> Dense -> Dropout -> Dense (Output) model = keras.Sequential() model.add(layers.Dense(16, activation=first_layer_activation, input_dim=X_train.shape[1])) # Parameterized Dropout if required if(add_dropout): model.add(layers.Dropout(0.3)) model.add(layers.Dense(df['label'].nunique(), activation=second_layer_activation)) return model def getOptimizer(): # Adam Optimizer (Default Parameters) -> Stochastic Gradient Descent optimizer = keras.optimizers.Adam() return optimizer loss = "sparse_categorical_crossentropy" metrics = ["accuracy"] optimizer = getOptimizer() # Model without the Dropout layer model_without_dropout = getModel("relu", "softmax", add_dropout=False) model_without_dropout.compile(loss=loss, optimizer=optimizer, metrics=metrics) # Model with the Dropout layer model_with_dropout = getModel("relu", "softmax", add_dropout=True) model_with_dropout.compile(loss=loss, optimizer=optimizer, metrics=metrics) epochs = 50 verbose = 1 batch_size = 1 # Fit both models history_without_dropout = model_without_dropout.fit(X_train, y_train, epochs=epochs, validation_data=(X_test, y_test), verbose=verbose, batch_size=batch_size) history_with_dropout = model_with_dropout.fit(X_train, y_train, epochs=epochs, validation_data=(X_test, y_test), verbose=verbose, batch_size=batch_size) ``` ### Plotting Accuracy agaist Training Epochs ``` plt.style.use("seaborn") # Plot Configuration fig, (ax1, ax2) = plt.subplots(1, 2, figsize=(16, 5)) fig.suptitle('Model with Dropout vs. Model without Dropout') # Plot for model with Dropout Layer # ------ # Extracting Train & Test Accuracy from model history accuracy = history_with_dropout.history['accuracy'] val_accuracy = history_with_dropout.history['val_accuracy'] # Plotting ax1.plot(accuracy) ax1.plot(val_accuracy) # Labelling ax1.set_title('Model with Dropout Layer (Accuracy)') ax1.set_ylabel('Accuracy') ax1.set_xlabel('Epoch') ax1.legend(['train', 'test'], loc='lower right') ax1.set_yticks(np.arange(0.2, 0.9, 0.1)) # ------ # Plot for model without Dropout Layer # ------ # Extracting Train & Test Accuracy from model history accuracy = history_without_dropout.history['accuracy'] val_accuracy = history_without_dropout.history['val_accuracy'] # Plotting ax2.plot(accuracy) ax2.plot(val_accuracy) # Labelling ax2.set_title('Model without Dropout Layer (Accuracy)') ax2.set_ylabel('Accuracy') ax2.set_xlabel('Epoch') ax2.legend(['train', 'test'], loc='lower right') ax2.set_yticks(np.arange(0.2, 0.9, 0.1)) # ------ plt.show() ``` ### Plotting Loss agaist Training Epochs ``` plt.style.use("seaborn") # Plot Configuration fig, (ax1, ax2) = plt.subplots(1, 2, figsize=(16, 5)) fig.suptitle('Model with Dropout vs. Model without Dropout') # Plot for model with Dropout Layer # ------ # Extracting Train & Test Loss from model history loss = history_with_dropout.history['loss'] val_loss = history_with_dropout.history['val_loss'] # Plotting ax1.plot(loss) ax1.plot(val_loss) # Labelling ax1.set_title('Model with Dropout Layer (Loss)') ax1.set_ylabel('Sparse Categorical Crossentropy Loss') ax1.set_xlabel('Epoch') ax1.legend(['train', 'test'], loc='upper right') ax1.set_xticks(np.arange(0, 50+1, 5.0)) # ------ # Plot for model without Dropout Layer # ------ # Extracting Train & Test Loss from model history loss = history_without_dropout.history['loss'] val_loss = history_without_dropout.history['val_loss'] # Plotting ax2.plot(loss) ax2.plot(val_loss) # Labelling ax2.set_title('Model without Dropout Layer (Loss)') ax2.set_ylabel('Sparse Categorical Crossentropy Loss') ax2.set_xlabel('Epoch') ax2.legend(['train', 'test'], loc='upper right') ax2.set_xticks(np.arange(0, 50+1, 5.0)) # ------ plt.show() ``` ## Part B: Effect of removing Dropout From the graphs plotted above, we observe that the model without the Dropout layer has `lower test accuracies` and `higher test losses` as compared to the neural network model with the dropout layers. However, the `train accuracy` remains high and `train loss` remains low. This means that without the dropout layer, the model is overfitting on the data. Overfitting is one of the problems that occur during training of neural networks, which drives the training error of the network to a very small value at the expense of the test error. The network learns to respond correctly to the training inputs by remembering them too much but is unable to generalize to produce correct outputs to novel inputs. (Ref: CZ4042 Lecture 5 (NTU) - Model Selection & Overfitting, Jagath Chandana Rajapakse) ## Part C: Addressing Overfitting **Use Regularization** Using dropouts and early stopping are ways to prevent overfitting. Since we have already used both of them, another way to address overfitting is by using `L1 & L2 Regularization` techniques. During training, some weights attain large values to reduce training error, jeopardizing its ability to generalizing. In order to avoid this, a penalty term regularization term) is added to the cost function. (Ref: CZ4042 Lecture 5 (NTU) - Model Selection & Overfitting, Jagath Chandana Rajapakse) * **L1 Regualization (Lasso Regression)** - Add **"absolute value of magnitude"** of coefficient as penalty term to the loss function. * **L2 Regualization (Ridge Regression)** - Add **"squared magnitude"** of coefficient as penalty term to the loss function. ## End of Part A, Question 5. ## Conclusion For questions in Part A, we examined building a neural network model that predicts the genre of a song by using many features as inputs, and tried to optimize the parameters of the model. Firstly, we built a simple two-layer feedforward neural network. After examining its accuracy and losses, we experimented with different batch sizes and different number of hidden neurons for model training. Afterwards, we investigated whether a three-layer neural network will be better, and the effects of having dropout layers. In our final results, I conclude that a 2-layer neural network (with dropouts) with a batch size of `4` and hidden neuron size of `32` works optimally on the given dataset. ### Limitations In our current approach, we need to first extract the features from the audio clips, adding an extra step to our machine learning pipeline. Therefore, the quality of our model depends on the quality of feature extraction. We see that in our optimized model, there are still some signs of overftting which should be addressed. I also think that the number of data points (training examples) are low, and our model will perform better if we have more data. ### Most Impactful Optimization Finding the optimal batch size made our model better, however, increase the number of hidden neurons had the most impact on our model performance. As the number of neurons increased, the model was able to learn more complex feature representations of the input data. The functions learnt closely resemble the complexity of the data and the model is able to generalize well on unseen real world data. ### Better Options Audio clips are waveform data a.k.a sequential data. There another type of Neural Networks called as `Recurrent Neural Networks` (RNNs), which are helpful in modelling sequential data. Like recurrent neural networks (RNNs), `transformers` are another type of netowrks designed to handle sequential input data. These options may be more suitable for audio datasets. ### Extensions of current modelling approach Our current approach can be used for any set of features. Like audio, we can use some modelling techniques to extract features from image data, and then use our model to train on the data. Our pipeline will mostly remain the same, however, the image data preprocessing will be different.
github_jupyter
# MLP 107 ``` from google.colab import drive PATH='/content/drive/' drive.mount(PATH) DATAPATH=PATH+'My Drive/data/' PC_FILENAME = DATAPATH+'pcRNA.fasta' NC_FILENAME = DATAPATH+'ncRNA.fasta' import numpy as np import pandas as pd import matplotlib.pyplot as plt from sklearn.model_selection import ShuffleSplit from sklearn.model_selection import cross_val_score from sklearn.model_selection import RepeatedKFold from sklearn.model_selection import StratifiedKFold import tensorflow as tf from tensorflow import keras from keras.wrappers.scikit_learn import KerasRegressor from keras.models import Sequential from keras.layers import Bidirectional from keras.layers import GRU from keras.layers import Dense from keras.layers import LayerNormalization import time dt='float32' tf.keras.backend.set_floatx(dt) EPOCHS=200 SPLITS=1 K=4 VOCABULARY_SIZE=4**K+1 # e.g. K=3 => 64 DNA K-mers + 'NNN' EMBED_DIMEN=16 FILENAME='MLP107' ``` ## Load and partition sequences ``` # Assume file was preprocessed to contain one line per seq. # Prefer Pandas dataframe but df does not support append. # For conversion to tensor, must avoid python lists. def load_fasta(filename,label): DEFLINE='>' labels=[] seqs=[] lens=[] nums=[] num=0 with open (filename,'r') as infile: for line in infile: if line[0]!=DEFLINE: seq=line.rstrip() num += 1 # first seqnum is 1 seqlen=len(seq) nums.append(num) labels.append(label) seqs.append(seq) lens.append(seqlen) df1=pd.DataFrame(nums,columns=['seqnum']) df2=pd.DataFrame(labels,columns=['class']) df3=pd.DataFrame(seqs,columns=['sequence']) df4=pd.DataFrame(lens,columns=['seqlen']) df=pd.concat((df1,df2,df3,df4),axis=1) return df # Split into train/test stratified by sequence length. def sizebin(df): return pd.cut(df["seqlen"], bins=[0,1000,2000,4000,8000,16000,np.inf], labels=[0,1,2,3,4,5]) def make_train_test(data): bin_labels= sizebin(data) from sklearn.model_selection import StratifiedShuffleSplit splitter = StratifiedShuffleSplit(n_splits=1, test_size=0.2, random_state=37863) # split(x,y) expects that y is the labels. # Trick: Instead of y, give it it the bin labels that we generated. for train_index,test_index in splitter.split(data,bin_labels): train_set = data.iloc[train_index] test_set = data.iloc[test_index] return (train_set,test_set) def separate_X_and_y(data): y= data[['class']].copy() X= data.drop(columns=['class','seqnum','seqlen']) return (X,y) def make_slice(data_set,min_len,max_len): print("original "+str(data_set.shape)) too_short = data_set[ data_set['seqlen'] < min_len ].index no_short=data_set.drop(too_short) print("no short "+str(no_short.shape)) too_long = no_short[ no_short['seqlen'] >= max_len ].index no_long_no_short=no_short.drop(too_long) print("no long, no short "+str(no_long_no_short.shape)) return no_long_no_short ``` ## Make K-mers ``` def make_kmer_table(K): npad='N'*K shorter_kmers=[''] for i in range(K): longer_kmers=[] for mer in shorter_kmers: longer_kmers.append(mer+'A') longer_kmers.append(mer+'C') longer_kmers.append(mer+'G') longer_kmers.append(mer+'T') shorter_kmers = longer_kmers all_kmers = shorter_kmers kmer_dict = {} kmer_dict[npad]=0 value=1 for mer in all_kmers: kmer_dict[mer]=value value += 1 return kmer_dict KMER_TABLE=make_kmer_table(K) def strings_to_vectors(data,uniform_len): all_seqs=[] for seq in data['sequence']: i=0 seqlen=len(seq) kmers=[] while i < seqlen-K+1 -1: # stop at minus one for spaced seed kmer=seq[i:i+2]+seq[i+3:i+5] # SPACED SEED 2/1/2 for K=4 #kmer=seq[i:i+K] i += 1 value=KMER_TABLE[kmer] kmers.append(value) pad_val=0 while i < uniform_len: kmers.append(pad_val) i += 1 all_seqs.append(kmers) pd2d=pd.DataFrame(all_seqs) return pd2d # return 2D dataframe, uniform dimensions def make_kmers(MAXLEN,train_set): (X_train_all,y_train_all)=separate_X_and_y(train_set) # The returned values are Pandas dataframes. # print(X_train_all.shape,y_train_all.shape) # (X_train_all,y_train_all) # y: Pandas dataframe to Python list. # y_train_all=y_train_all.values.tolist() # The sequences lengths are bounded but not uniform. X_train_all print(type(X_train_all)) print(X_train_all.shape) print(X_train_all.iloc[0]) print(len(X_train_all.iloc[0]['sequence'])) # X: List of string to List of uniform-length ordered lists of K-mers. X_train_kmers=strings_to_vectors(X_train_all,MAXLEN) # X: true 2D array (no more lists) X_train_kmers.shape print("transform...") # From pandas dataframe to numpy to list to numpy print(type(X_train_kmers)) num_seqs=len(X_train_kmers) tmp_seqs=[] for i in range(num_seqs): kmer_sequence=X_train_kmers.iloc[i] tmp_seqs.append(kmer_sequence) X_train_kmers=np.array(tmp_seqs) tmp_seqs=None print(type(X_train_kmers)) print(X_train_kmers) labels=y_train_all.to_numpy() return (X_train_kmers,labels) def make_frequencies(Xin): # Input: numpy X(numseq,seqlen) list of vectors of kmerval where val0=NNN,val1=AAA,etc. # Output: numpy X(numseq,65) list of frequencies of 0,1,etc. Xout=[] VOCABULARY_SIZE= 4**K + 1 # plus one for 'NNN' for seq in Xin: freqs =[0] * VOCABULARY_SIZE total = 0 for kmerval in seq: freqs[kmerval] += 1 total += 1 for c in range(VOCABULARY_SIZE): freqs[c] = freqs[c]/total Xout.append(freqs) Xnum = np.asarray(Xout) return (Xnum) ``` ## Build model ``` def build_model(maxlen,dimen): act="sigmoid" embed_layer = keras.layers.Embedding( VOCABULARY_SIZE,EMBED_DIMEN,input_length=maxlen); neurons=16 dense1_layer = keras.layers.Dense(neurons, activation=act,dtype=dt,input_dim=VOCABULARY_SIZE) dense2_layer = keras.layers.Dense(neurons, activation=act,dtype=dt) dense3_layer = keras.layers.Dense(neurons, activation=act,dtype=dt) output_layer = keras.layers.Dense(1, activation=act,dtype=dt) mlp = keras.models.Sequential() #mlp.add(embed_layer) mlp.add(dense1_layer) mlp.add(dense2_layer) #mlp.add(dense3_layer) mlp.add(output_layer) bc=tf.keras.losses.BinaryCrossentropy(from_logits=False) print("COMPILE...") mlp.compile(loss=bc, optimizer="Adam",metrics=["accuracy"]) print("...COMPILED") return mlp ``` ## Cross validation ``` def do_cross_validation(X,y,eps,maxlen,dimen): model = None cv_scores = [] fold=0 splitter = ShuffleSplit(n_splits=SPLITS, test_size=0.2, random_state=37863) for train_index,valid_index in splitter.split(X): X_train=X[train_index] # use iloc[] for dataframe y_train=y[train_index] X_valid=X[valid_index] y_valid=y[valid_index] print("BUILD MODEL") model=build_model(maxlen,dimen) print("FIT") start_time=time.time() # this is complaining about string to float history=model.fit(X_train, y_train, # batch_size=10, default=32 works nicely epochs=eps, verbose=1, # verbose=1 for ascii art, verbose=0 for none validation_data=(X_valid,y_valid) ) end_time=time.time() elapsed_time=(end_time-start_time) fold += 1 print("Fold %d, %d epochs, %d sec"%(fold,eps,elapsed_time)) pd.DataFrame(history.history).plot(figsize=(8,5)) plt.grid(True) plt.gca().set_ylim(0,1) plt.show() scores = model.evaluate(X_valid, y_valid, verbose=0) print("%s: %.2f%%" % (model.metrics_names[1], scores[1]*100)) # What are the other metrics_names? # Try this from Geron page 505: # np.mean(keras.losses.mean_squared_error(y_valid,y_pred)) cv_scores.append(scores[1] * 100) print() print("Validation core mean %.2f%% (+/- %.2f%%)" % (np.mean(cv_scores), np.std(cv_scores))) return model ``` ## Load ``` print("Load data from files.") nc_seq=load_fasta(NC_FILENAME,0) pc_seq=load_fasta(PC_FILENAME,1) all_seq=pd.concat((nc_seq,pc_seq),axis=0) print("Put aside the test portion.") (train_set,test_set)=make_train_test(all_seq) # Do this later when using the test data: # (X_test,y_test)=separate_X_and_y(test_set) nc_seq=None pc_seq=None all_seq=None print("Ready: train_set") train_set ``` ## Len 200-1Kb ``` MINLEN=200 MAXLEN=1000 print ("Compile the model") model=build_model(MAXLEN,EMBED_DIMEN) print ("Summarize the model") print(model.summary()) # Print this only once print("Working on full training set, slice by sequence length.") print("Slice size range [%d - %d)"%(MINLEN,MAXLEN)) subset=make_slice(train_set,MINLEN,MAXLEN)# One array to two: X and y print ("Sequence to Kmer") (X_train,y_train)=make_kmers(MAXLEN,subset) X_train X_train=make_frequencies(X_train) X_train print ("Cross valiation") model1 = do_cross_validation(X_train,y_train,EPOCHS,MAXLEN,EMBED_DIMEN) model1.save(FILENAME+'.short.model') ``` ## Len 1Kb-2Kb ``` MINLEN=1000 MAXLEN=2000 print ("Compile the model") model=build_model(MAXLEN,EMBED_DIMEN) print ("Summarize the model") print(model.summary()) # Print this only once print("Working on full training set, slice by sequence length.") print("Slice size range [%d - %d)"%(MINLEN,MAXLEN)) subset=make_slice(train_set,MINLEN,MAXLEN)# One array to two: X and y print ("Sequence to Kmer") (X_train,y_train)=make_kmers(MAXLEN,subset) X_train X_train=make_frequencies(X_train) X_train print ("Cross valiation") model2 = do_cross_validation(X_train,y_train,EPOCHS,MAXLEN,EMBED_DIMEN) model2.save(FILENAME+'.medium.model') ``` ## Len 2Kb-3Kb ``` MINLEN=2000 MAXLEN=3000 print ("Compile the model") model=build_model(MAXLEN,EMBED_DIMEN) print ("Summarize the model") print(model.summary()) # Print this only once print("Working on full training set, slice by sequence length.") print("Slice size range [%d - %d)"%(MINLEN,MAXLEN)) subset=make_slice(train_set,MINLEN,MAXLEN)# One array to two: X and y print ("Sequence to Kmer") (X_train,y_train)=make_kmers(MAXLEN,subset) X_train X_train=make_frequencies(X_train) X_train print ("Cross valiation") model3 = do_cross_validation(X_train,y_train,EPOCHS,MAXLEN,EMBED_DIMEN) model3.save(FILENAME+'.long.model') ```
github_jupyter
``` """ You can run either this notebook locally (if you have all the dependencies and a GPU) or on Google Colab. Instructions for setting up Colab are as follows: 1. Open a new Python 3 notebook. 2. Import this notebook from GitHub (File -> Upload Notebook -> "GITHUB" tab -> copy/paste GitHub URL) 3. Connect to an instance with a GPU (Runtime -> Change runtime type -> select "GPU" for hardware accelerator) 4. Run this cell to set up dependencies. """ # If you're using Google Colab and not running locally, run this cell. ## Install dependencies !pip install wget !apt-get install sox libsndfile1 ffmpeg !pip install unidecode # ## Install NeMo BRANCH = 'main' !python -m pip install git+https://github.com/NVIDIA/NeMo.git@$BRANCH#egg=nemo_toolkit[asr] ## Install TorchAudio !pip install torchaudio -f https://download.pytorch.org/whl/torch_stable.html ``` ## Introduction Who Speaks When? Speaker Diarization is the task of segmenting audio recordings by speaker labels. A diarization system consists of Voice Activity Detection (VAD) model to get the time stamps of audio where speech is being spoken ignoring the background and Speaker Embeddings model to get speaker embeddings on segments that were previously time stamped. These speaker embeddings would then be clustered into clusters based on number of speakers present in the audio recording. In NeMo we support both **oracle VAD** and **non-oracle VAD** diarization. In this tutorial, we shall first demonstrate how to perform diarization with a oracle VAD time stamps (we assume we already have speech time stamps) and pretrained speaker verification model which can be found in tutorial for [Speaker Identification and Verification in NeMo](https://github.com/NVIDIA/NeMo/blob/main/tutorials/speaker_tasks/Speaker_Identification_Verification.ipynb). In ORACLE-VAD-DIARIZATION we show how to perform VAD and then diarization if ground truth timestamped speech were not available (non-oracle VAD). We also have tutorials for [VAD training in NeMo](https://github.com/NVIDIA/NeMo/blob/main/tutorials/asr/Voice_Activity_Detection.ipynb) and [online offline microphone inference](https://github.com/NVIDIA/NeMo/blob/main/tutorials/asr/Online_Offline_Microphone_VAD_Demo.ipynb), where you can custom your model and training/finetuning on your own data. For demonstration purposes we would be using simulated audio from [an4 dataset](http://www.speech.cs.cmu.edu/databases/an4/) ``` import os import wget ROOT = os.getcwd() data_dir = os.path.join(ROOT,'data') os.makedirs(data_dir, exist_ok=True) an4_audio = os.path.join(data_dir,'an4_diarize_test.wav') an4_rttm = os.path.join(data_dir,'an4_diarize_test.rttm') if not os.path.exists(an4_audio): an4_audio_url = "https://nemo-public.s3.us-east-2.amazonaws.com/an4_diarize_test.wav" an4_audio = wget.download(an4_audio_url, data_dir) if not os.path.exists(an4_rttm): an4_rttm_url = "https://nemo-public.s3.us-east-2.amazonaws.com/an4_diarize_test.rttm" an4_rttm = wget.download(an4_rttm_url, data_dir) ``` Let's plot and listen to the audio and visualize the RTTM speaker labels ``` import IPython import matplotlib.pyplot as plt import numpy as np import librosa sr = 16000 signal, sr = librosa.load(an4_audio,sr=sr) fig,ax = plt.subplots(1,1) fig.set_figwidth(20) fig.set_figheight(2) plt.plot(np.arange(len(signal)),signal,'gray') fig.suptitle('Reference merged an4 audio', fontsize=16) plt.xlabel('time (secs)', fontsize=18) ax.margins(x=0) plt.ylabel('signal strength', fontsize=16); a,_ = plt.xticks();plt.xticks(a,a/sr); IPython.display.Audio(an4_audio) ``` We would use [pyannote_metrics](https://pyannote.github.io/pyannote-metrics/) for visualization and score calculation purposes. Hence all the labels in rttm formats would eventually be converted to pyannote objects, we created two helper functions rttm_to_labels (for NeMo intermediate processing) and labels_to_pyannote_object for scoring and visualization format ``` from nemo.collections.asr.parts.utils.speaker_utils import rttm_to_labels, labels_to_pyannote_object ``` Let's load ground truth RTTM labels and view the reference Annotation timestamps visually ``` # view the sample rttm file !cat {an4_rttm} labels = rttm_to_labels(an4_rttm) reference = labels_to_pyannote_object(labels) print(labels) reference ``` Speaker Diarization scripts commonly expects following arguments: 1. manifest_filepath : Path to manifest file containing json lines of format: {'audio_filepath': /path/to/audio_file, 'offset': 0, 'duration':None, 'label': 'infer', 'text': '-', 'num_speakers': None, 'rttm_filepath': /path/to/rttm/file, 'uem_filepath'='/path/to/uem/filepath'} 2. out_dir : directory where outputs and intermediate files are stored. 3. oracle_vad: If this is true then we extract speech activity labels from rttm files, if False then either 4. vad.model_path or external_manifestpath containing speech activity labels has to be passed. Mandatory fields are audio_filepath, offset, duration, label and text. For the rest if you would like to evaluate with known number of speakers pass the value else None. If you would like to score the system with known rttms then that should be passed as well, else None. uem file is used to score only part of your audio for evaluation purposes, hence pass if you would like to evaluate on it else None. **Note** we expect audio and corresponding RTTM have **same base name** and the name should be **unique**. For eg: if audio file name is **test_an4**.wav, if provided we expect corresponding rttm file name to be **test_an4**.rttm (note the matching **test_an4** base name) Lets create manifest with the an4 audio and rttm available. If you have more than one files you may also use the script `pathsfiles_to_manifest.py` to generate manifest file from list of audio files and optionally rttm files ``` # Create a manifest for input with below format. # {'audio_filepath': /path/to/audio_file, 'offset': 0, 'duration':None, 'label': 'infer', 'text': '-', # 'num_speakers': None, 'rttm_filepath': /path/to/rttm/file, 'uem_filepath'='/path/to/uem/filepath'} import json meta = { 'audio_filepath': an4_audio, 'offset': 0, 'duration':None, 'label': 'infer', 'text': '-', 'num_speakers': 2, 'rttm_filepath': an4_rttm, 'uem_filepath' : None } with open('data/input_manifest.json','w') as fp: json.dump(meta,fp) fp.write('\n') !cat data/input_manifest.json output_dir = os.path.join(ROOT, 'oracle_vad') os.makedirs(output_dir,exist_ok=True) ``` # ORACLE-VAD DIARIZATION Oracle-vad diarization is to compute speaker embeddings from known speech label timestamps rather than depending on VAD output. This step can also be used to run speaker diarization with rttms generated from any external VAD, not just VAD model from NeMo. For it, the first step is to start converting reference audio rttm(vad) time stamps to oracle manifest file. This manifest file would be sent to our speaker diarizer to extract embeddings. This is just an argument in our config, and system automatically computes oracle manifest based on the rttms provided through input manifest file Our config file is based on [hydra](https://hydra.cc/docs/intro/). With hydra config, we ask users to provide values to variables that were filled with **???**, these are mandatory fields and scripts expect them for successful runs. And notice some variables were filled with **null** are optional variables. Those could be provided if needed but are not mandatory. ``` from omegaconf import OmegaConf MODEL_CONFIG = os.path.join(data_dir,'offline_diarization.yaml') if not os.path.exists(MODEL_CONFIG): config_url = "https://raw.githubusercontent.com/NVIDIA/NeMo/main/examples/speaker_tasks/diarization/conf/offline_diarization.yaml" MODEL_CONFIG = wget.download(config_url,data_dir) config = OmegaConf.load(MODEL_CONFIG) print(OmegaConf.to_yaml(config)) ``` Now we can perform speaker diarization based on timestamps generated from ground truth rttms rather than generating through VAD ``` pretrained_speaker_model='ecapa_tdnn' config.diarizer.manifest_filepath = 'data/input_manifest.json' config.diarizer.out_dir = output_dir #Directory to store intermediate files and prediction outputs config.diarizer.speaker_embeddings.model_path = pretrained_speaker_model config.diarizer.speaker_embeddings.parameters.window_length_in_sec = 1.5 config.diarizer.speaker_embeddings.parameters.shift_length_in_sec = 0.75 config.diarizer.oracle_vad = True # ----> ORACLE VAD config.diarizer.clustering.parameters.oracle_num_speakers = True from nemo.collections.asr.models import ClusteringDiarizer oracle_model = ClusteringDiarizer(cfg=config) # And lets diarize oracle_model.diarize() ``` With DER 0 -> means it clustered speaker embeddings correctly. Let's view ``` !cat {output_dir}/pred_rttms/an4_diarize_test.rttm pred_labels = rttm_to_labels(output_dir+'/pred_rttms/an4_diarize_test.rttm') hypothesis = labels_to_pyannote_object(pred_labels) hypothesis reference ``` # VAD DIARIZATION In this method we compute VAD time stamps using NeMo VAD model on input manifest file and then use these time stamps of speech label to find speaker embeddings followed by clustering them into num of speakers Before we proceed let's look at the speaker diarization config, which we would be depending up on for vad computation and speaker embedding extraction ``` print(OmegaConf.to_yaml(config)) ``` As can be seen most of the variables in config are self explanatory with VAD variables under vad section and speaker related variables under speaker embeddings section. To perform VAD based diarization we can ignore `oracle_vad_manifest` in `speaker_embeddings` section for now and needs to fill up the rest. We also needs to provide pretrained `model_path` of vad and speaker embeddings .nemo models ``` pretrained_vad = 'vad_marblenet' pretrained_speaker_model = 'ecapa_tdnn' ``` Note in this tutorial, we use the VAD model MarbleNet-3x2 introduced and published in [ICASSP MarbleNet](https://arxiv.org/pdf/2010.13886.pdf). You might need to tune on dev set similar to your dataset if you would like to improve the performance. And the speakerNet-M-Diarization model achieves 7.3% confusion error rate on CH109 set with oracle vad. This model is trained on voxceleb1, voxceleb2, Fisher, SwitchBoard datasets. So for more improved performance specific to your dataset, finetune speaker verification model with a devset similar to your test set. ``` output_dir = os.path.join(ROOT,'outputs') config.diarizer.manifest_filepath = 'data/input_manifest.json' config.diarizer.out_dir = output_dir #Directory to store intermediate files and prediction outputs config.diarizer.speaker_embeddings.model_path = pretrained_speaker_model config.diarizer.speaker_embeddings.parameters.window_length_in_sec = 1.5 config.diarizer.speaker_embeddings.parameters.shift_length_in_sec = 0.75 config.diarizer.oracle_vad = False # compute VAD provided with model_path to vad config config.diarizer.clustering.parameters.oracle_num_speakers=True #Here we use our inhouse pretrained NeMo VAD config.diarizer.vad.model_path = pretrained_vad config.diarizer.vad.window_length_in_sec = 0.15 config.diarizer.vad.shift_length_in_sec = 0.01 config.diarizer.vad.parameters.onset = 0.8 config.diarizer.vad.parameters.offset = 0.6 config.diarizer.vad.parameters.min_duration_on = 0.1 config.diarizer.vad.parameters.min_duration_off = 0.4 ``` Now that we passed all the variables we needed lets initialize the clustering model with above config ``` from nemo.collections.asr.models import ClusteringDiarizer sd_model = ClusteringDiarizer(cfg=config) ``` And Diarize with single line of code ``` sd_model.diarize() ``` As can be seen, we first performed VAD, then with the timestamps created in `{output_dir}/vad_outputs` by VAD we calculated speaker embeddings (`{output_dir}/speaker_outputs/embeddings/`) which are then clustered using spectral clustering. To generate VAD predicted time step. We perform VAD inference to have frame level prediction &#8594; (optional: use decision smoothing) &#8594; given `threshold`, write speech segment to RTTM-like time stamps manifest. we use vad decision smoothing (87.5% overlap median) as described [here](https://github.com/NVIDIA/NeMo/blob/stable/nemo/collections/asr/parts/utils/vad_utils.py) you can also tune the threshold on your dev set. Use this provided [script](https://github.com/NVIDIA/NeMo/blob/stable/scripts/voice_activity_detection/vad_tune_threshold.py) ``` # VAD predicted time stamps # you can also use single threshold(=onset=offset) for binarization and plot here from nemo.collections.asr.parts.utils.vad_utils import plot plot( an4_audio, 'outputs/vad_outputs/overlap_smoothing_output_median_0.875/an4_diarize_test.median', an4_rttm, per_args = config.diarizer.vad.parameters, #threshold ) print(f"postprocessing_params: {config.diarizer.vad.parameters}") ``` Predicted outputs are written to `output_dir/pred_rttms` and see how we predicted along with VAD prediction ``` !cat outputs/pred_rttms/an4_diarize_test.rttm pred_labels = rttm_to_labels('outputs/pred_rttms/an4_diarize_test.rttm') hypothesis = labels_to_pyannote_object(pred_labels) hypothesis reference ``` # Storing and Restoring models Now we can save the whole config and model parameters in a single .nemo and restore from it anytime. ``` oracle_model.save_to(os.path.join(output_dir,'diarize.nemo')) ``` Restore from saved model ``` del oracle_model import nemo.collections.asr as nemo_asr restored_model = nemo_asr.models.ClusteringDiarizer.restore_from(os.path.join(output_dir,'diarize.nemo')) ``` # ADD ON - ASR ``` IPython.display.Audio(an4_audio) quartznet = nemo_asr.models.EncDecCTCModel.from_pretrained(model_name="QuartzNet15x5Base-En") for fname, transcription in zip([an4_audio], quartznet.transcribe(paths2audio_files=[an4_audio])): print(f"Audio in {fname} was recognized as:\n{transcription}") ```
github_jupyter
``` from baselines.ppo2.ppo2 import learn from baselines.ppo2 import defaults from baselines.common.vec_env import VecEnv, VecFrameStack from baselines.common.cmd_util import make_vec_env, make_env from baselines.common.models import register import tensorflow as tf @register("custom_cnn") def custom_cnn(): def network_fn(input_shape, **conv_kwargs): """ Custom CNN """ print('input shape is {}'.format(input_shape)) x_input = tf.keras.Input(shape=input_shape, dtype=tf.uint8) h = x_input h = tf.cast(h, tf.float32) / 255. h = tf.keras.layers.Conv2D(filters=32, kernel_size=8, strides=4, padding='valid', data_format='channels_last', activation='relu')(h) h2 = tf.keras.layers.Conv2D(filters=64, kernel_size=4, strides=2, padding='valid', data_format='channels_last', activation='relu')(h) h3 = tf.keras.layers.Conv2D(filters=64, kernel_size=3, strides=1, padding='valid', data_format='channels_last', activation='relu')(h2) h3 = tf.keras.layers.Flatten()(h3) h3 = tf.keras.layers.Dense(units=512, name='fc1', activation='relu')(h3) network = tf.keras.Model(inputs=[x_input], outputs=[h3]) network.summary() return network return network_fn def build_env(env_id, env_type): if env_type in {'atari', 'retro'}: env = make_vec_env(env_id, env_type, 1, None, gamestate=None, reward_scale=1.0) env = VecFrameStack(env, 4) else: env = make_vec_env(env_id, env_type, 1, None, reward_scale=1.0, flatten_dict_observations=True) return env env_id = 'PongNoFrameskip-v0' env_type = 'atari' print("Env type = ", env_type) env = build_env(env_id, env_type) model = learn(network="custom_cnn", env=env, total_timesteps=1e4) obs = env.reset() if not isinstance(env, VecEnv): obs = np.expand_dims(np.array(obs), axis=0) episode_rew = 0 while True: actions, _, state, _ = model.step(obs) obs, reward, done, info = env.step(actions.numpy()) if not isinstance(env, VecEnv): obs = np.expand_dims(np.array(obs), axis=0) env.render() print("Reward = ", reward) episode_rew += reward if done: print('Episode Reward = {}'.format(episode_rew)) break env.close() !python -m baselines.run --alg=ppo2 --env=PongNoFrameskip-v0 --num_timesteps=1e4 --save_path=./models/Pong_20M_ppo2 --log_path=./logs/Pong/ !python -m baselines.run --alg=ppo2 --env=PongNoFrameskip-v0 --num_timesteps=0 --load_path=./models/Pong_20M_ppo2 --play !wget -O pong_20M_ppo2.tar.gz https://github.com/PacktWorkshops/The-Reinforcement-Learning-Workshop/blob/master/Chapter04/pong_20M_ppo2.tar.gz?raw=true !tar xvzf pong_20M_ppo2.tar.gz !python -m baselines.run --alg=ppo2 --env=PongNoFrameskip-v0 --num_timesteps=0 --load_path=./pong_20M_ppo2 --play ```
github_jupyter
This exercise will test your ability to read a data file and understand statistics about the data. In later exercises, you will apply techniques to filter the data, build a machine learning model, and iteratively improve your model. The course examples use data from Melbourne. To ensure you can apply these techniques on your own, you will have to apply them to a new dataset (with house prices from Iowa). # Exercises Run the following cell to set up code-checking, which will verify your work as you go. ``` # Set up code checking from learntools.core import binder binder.bind(globals()) from learntools.machine_learning.ex2 import * print("Setup Complete") ``` ## Step 1: Loading Data Read the Iowa data file into a Pandas DataFrame called `home_data`. ``` import pandas as pd # Path of the file to read iowa_file_path = '../input/home-data-for-ml-course/train.csv' # Fill in the line below to read the file into a variable home_data home_data = ____ # Check your answer step_1.check() #%%RM_IF(PROD)%% # Path of the file to read iowa_file_path = '../input/home-data-for-ml-course/train.csv' # Fill in the line below to read the file into a variable home_data home_data = 0 # Call line below with no argument to check that you've loaded the data correctly step_1.assert_check_failed() #%%RM_IF(PROD)%% # Fill in the line below to read the file into a variable home_data home_data = pd.DataFrame() # Call line below with no argument to check that you've loaded the data correctly step_1.assert_check_failed() home_data = pd.read_csv(iowa_file_path) step_1.assert_check_passed() # Lines below will give you a hint or solution code #_COMMENT_IF(PROD)_ step_1.hint() #_COMMENT_IF(PROD)_ step_1.solution() ``` ## Step 2: Review The Data Use the command you learned to view summary statistics of the data. Then fill in variables to answer the following questions ``` # Print summary statistics in next line ____ # What is the average lot size (rounded to nearest integer)? avg_lot_size = ____ # As of today, how old is the newest home (current year - the date in which it was built) newest_home_age = ____ # Check your answers step_2.check() #step_2.hint() #step_2.solution() ``` ## Think About Your Data The newest house in your data isn't that new. A few potential explanations for this: 1. They haven't built new houses where this data was collected. 1. The data was collected a long time ago. Houses built after the data publication wouldn't show up. If the reason is explanation #1 above, does that affect your trust in the model you build with this data? What about if it is reason #2? How could you dig into the data to see which explanation is more plausible? Check out this **[discussion thread](https://www.kaggle.com/learn-forum/60581)** to see what others think or to add your ideas. #$KEEP_GOING$
github_jupyter
# Random Forest Classifier ``` # Load the packages import warnings warnings.filterwarnings("ignore") import pandas as pd import numpy as np from sklearn.ensemble import RandomForestClassifier from sklearn.model_selection import GridSearchCV from sklearn.metrics import classification_report # Load the data train_df = pd.read_csv('./../../../../data/train/train.csv') test_df = pd.read_csv('./../../../../data/test/test.csv') # Load the feature selection result feature_selector = pd.read_csv('./../../../../data/feature_ranking.csv') feature_selector.set_index('Unnamed: 0', inplace=True) # Separate feature space from target variable y_train = train_df['Attrition'] X_train = train_df.drop('Attrition', axis=1) y_test = test_df['Attrition'] X_test = test_df.drop('Attrition', axis=1) ``` We will be running models for different set of features and evaluate their performances. We start with complete dataset and then start with meaximum feature score of 8 to 5. ``` # Declare the model paramters for searching param_grid = dict( n_estimators = [50, 100, 200, 400], max_depth = [10, 20, 40], min_samples_split = [2, 5, 10] ) # Declare and train the model rf_clf = RandomForestClassifier(class_weight="balanced", max_features=None, bootstrap=False) rf = GridSearchCV(estimator=rf_clf, param_grid=param_grid, scoring='f1', n_jobs=-1) ``` ## Complete data ``` # Train the model rf.fit(X_train, y_train) # Get the parameters for the best model rf.best_estimator_ # Predict using model y_pred = rf.predict(X_test) # Make the classification report print(classification_report(y_test, y_pred)) ``` The results not better than that of logistic regression. The precision, recall and f1 of attrition is not at all good. ## Feature score of 8 ``` # Create the new dataset # Get features with feature score of 8 features = feature_selector[feature_selector['Total']==8].index.tolist() X_train_8 = X_train.loc[:, features] X_test_8 = X_test.loc[:, features] # Train the model rf.fit(X_train_8, y_train) # Predict with model y_pred_8 = rf.predict(X_test_8) # Make the report print(classification_report(y_test, y_pred)) ``` There is no improvement in the result. But since this model uses less number of features, it better to use it in production in order to improve the retraining and inferencing with huge load of data. Since the least number of features that could be used gave the same performance as all the features, it is better to skip the other scores since the chance of improvement in result is quite less.
github_jupyter
``` import numpy as np import math import tensorflow as tf from tensorflow.contrib.layers import fully_connected import time import random import matplotlib.pyplot as plt import heapq from mpl_toolkits.mplot3d import Axes3D tf.VERSION %matplotlib inline ``` ## Finite Element Model of the Space Frame Element ``` def PlaneTrussElementLength(x1,y1,z1,x2,y2,z2): return math.sqrt((x2-x1)*(x2-x1) + (y2-y1)*(y2-y1)+(z2-z1)*(z2-z1)) def SpaceFrameElementStiffness(E,G,A,Iy,Iz,J,x1,y1,z1,x2,y2,z2): L = PlaneTrussElementLength(x1,y1,z1,x2,y2,z2) w1 = E*A/L w2 = 12*E*Iz/(L*L*L) w3 = 6*E*Iz/(L*L) w4 = 4*E*Iz/L w5 = 2*E*Iz/L w6 = 12*E*Iy/(L*L*L) w7 = 6*E*Iy/(L*L) w8 = 4*E*Iy/L w9 = 2*E*Iy/L w10 = G*J/L kprime = np.array([[w1, 0, 0, 0, 0, 0, -w1, 0, 0, 0, 0, 0], [0, w2, 0, 0, 0, w3, 0, -w2, 0, 0, 0, w3], [0, 0, w6, 0, -w7, 0, 0, 0, -w6, 0, -w7, 0], [0, 0, 0, w10, 0, 0, 0, 0, 0, -w10, 0, 0], [0, 0, -w7, 0, w8, 0, 0, 0, w7, 0, w9, 0], [0, w3, 0, 0, 0, w4, 0, -w3, 0, 0, 0, w5], [-w1, 0, 0, 0, 0, 0, w1, 0, 0, 0, 0, 0], [0, -w2, 0, 0, 0, -w3, 0, w2, 0, 0, 0, -w3], [0, 0, -w6, 0, w7, 0, 0, 0, w6, 0, w7, 0], [0, 0, 0, -w10, 0, 0, 0, 0, 0, w10, 0, 0], [0, 0, -w7, 0, w9, 0, 0, 0, w7, 0, w8, 0], [0, w3, 0, 0, 0, w5, 0, -w3, 0, 0, 0, w4]]) if x1 == x2 and y1 == y2: if z2 > z1: Lambda = np.array([[0, 0, 1], [0, 1, 0], [-1, 0, 0]]) else: Lambda = np.array([[0, 0, -1], [0, 1, 0], [1, 0, 0]]) else: CXx = (x2-x1)/L CYx = (y2-y1)/L CZx = (z2-z1)/L D = math.sqrt(CXx*CXx + CYx*CYx) CXy = -CYx/D CYy = CXx/D CZy = 0 CXz = -CXx*CZx/D CYz = -CYx*CZx/D CZz = D Lambda = np.array([[CXx, CYx, CZx], [CXy, CYy, CZy], [CXz, CYz, CZz]]) R = np.array([np.concatenate((np.concatenate((Lambda,np.zeros((3,3)),np.zeros((3,3)),np.zeros((3,3))),axis=1), np.concatenate((np.zeros((3,3)), Lambda, np.zeros((3,3)), np.zeros((3,3))),axis=1) , np.concatenate((np.zeros((3,3)), np.zeros((3,3)), Lambda, np.zeros((3,3))),axis=1), np.concatenate((np.zeros((3,3)), np.zeros((3,3)), np.zeros((3,3)), Lambda),axis=1)))])[0] return np.dot(np.dot(R.T,kprime),R) def SpaceFrameAssemble(K,k,i,j): K[6*i,6*i] = K[6*i,6*i] + k[0,0] K[6*i,6*i+1] = K[6*i,6*i+1] + k[0,1] K[6*i,6*i+2] = K[6*i,6*i+2] + k[0,2] K[6*i,6*i+3] = K[6*i,6*i+3] + k[0,3] K[6*i,6*i+4] = K[6*i,6*i+4] + k[0,4] K[6*i,6*i+5] = K[6*i,6*i+5] + k[0,5] K[6*i,6*j] = K[6*i,6*j] + k[0,6] K[6*i,6*j+1] = K[6*i,6*j+1] + k[0,7] K[6*i,6*j+2] = K[6*i,6*j+2] + k[0,8] K[6*i,6*j+3] = K[6*i,6*j+3] + k[0,9] K[6*i,6*j+4] = K[6*i,6*j+4] + k[0,10] K[6*i,6*j+5] = K[6*i,6*j+5] + k[0,11] K[6*i+1,6*i] = K[6*i+1,6*i] + k[1,0] K[6*i+1,6*i+1] = K[6*i+1,6*i+1] + k[1,1] K[6*i+1,6*i+2] = K[6*i+1,6*i+2] + k[1,2] K[6*i+1,6*i+3] = K[6*i+1,6*i+3] + k[1,3] K[6*i+1,6*i+4] = K[6*i+1,6*i+4] + k[1,4] K[6*i+1,6*i+5] = K[6*i+1,6*i+5] + k[1,5] K[6*i+1,6*j] = K[6*i+1,6*j] + k[1,6] K[6*i+1,6*j+1] = K[6*i+1,6*j+1] + k[1,7] K[6*i+1,6*j+2] = K[6*i+1,6*j+2] + k[1,8] K[6*i+1,6*j+3] = K[6*i+1,6*j+3] + k[1,9] K[6*i+1,6*j+4] = K[6*i+1,6*j+4] + k[1,10] K[6*i+1,6*j+5] = K[6*i+1,6*j+5] + k[1,11] K[6*i+2,6*i] = K[6*i+2,6*i] + k[2,0] K[6*i+2,6*i+1] = K[6*i+2,6*i+1] + k[2,1] K[6*i+2,6*i+2] = K[6*i+2,6*i+2] + k[2,2] K[6*i+2,6*i+3] = K[6*i+2,6*i+3] + k[2,3] K[6*i+2,6*i+4] = K[6*i+2,6*i+4] + k[2,4] K[6*i+2,6*i+5] = K[6*i+2,6*i+5] + k[2,5] K[6*i+2,6*j] = K[6*i+2,6*j] + k[2,6] K[6*i+2,6*j+1] = K[6*i+2,6*j+1] + k[2,7] K[6*i+2,6*j+2] = K[6*i+2,6*j+2] + k[2,8] K[6*i+2,6*j+3] = K[6*i+2,6*j+3] + k[2,9] K[6*i+2,6*j+4] = K[6*i+2,6*j+4] + k[2,10] K[6*i+2,6*j+5] = K[6*i+2,6*j+5] + k[2,11] K[6*i+3,6*i] = K[6*i+3,6*i] + k[3,0] K[6*i+3,6*i+1] = K[6*i+3,6*i+1] + k[3,1] K[6*i+3,6*i+2] = K[6*i+3,6*i+2] + k[3,2] K[6*i+3,6*i+3] = K[6*i+3,6*i+3] + k[3,3] K[6*i+3,6*i+4] = K[6*i+3,6*i+4] + k[3,4] K[6*i+3,6*i+5] = K[6*i+3,6*i+5] + k[3,5] K[6*i+3,6*j] = K[6*i+3,6*j] + k[3,6] K[6*i+3,6*j+1] = K[6*i+3,6*j+1] + k[3,7] K[6*i+3,6*j+2] = K[6*i+3,6*j+2] + k[3,8] K[6*i+3,6*j+3] = K[6*i+3,6*j+3] + k[3,9] K[6*i+3,6*j+4] = K[6*i+3,6*j+4] + k[3,10] K[6*i+3,6*j+5] = K[6*i+3,6*j+5] + k[3,11] K[6*i+4,6*i] = K[6*i+4,6*i] + k[4,0] K[6*i+4,6*i+1] = K[6*i+4,6*i+1] + k[4,1] K[6*i+4,6*i+2] = K[6*i+4,6*i+2] + k[4,2] K[6*i+4,6*i+3] = K[6*i+4,6*i+3] + k[4,3] K[6*i+4,6*i+4] = K[6*i+4,6*i+4] + k[4,4] K[6*i+4,6*i+5] = K[6*i+4,6*i+5] + k[4,5] K[6*i+4,6*j] = K[6*i+4,6*j] + k[4,6] K[6*i+4,6*j+1] = K[6*i+4,6*j+1] + k[4,7] K[6*i+4,6*j+2] = K[6*i+4,6*j+2] + k[4,8] K[6*i+4,6*j+3] = K[6*i+4,6*j+3] + k[4,9] K[6*i+4,6*j+4] = K[6*i+4,6*j+4] + k[4,10] K[6*i+4,6*j+5] = K[6*i+4,6*j+5] + k[4,11] K[6*i+5,6*i] = K[6*i+5,6*i] + k[5,0] K[6*i+5,6*i+1] = K[6*i+5,6*i+1] + k[5,1] K[6*i+5,6*i+2] = K[6*i+5,6*i+2] + k[5,2] K[6*i+5,6*i+3] = K[6*i+5,6*i+3] + k[5,3] K[6*i+5,6*i+4] = K[6*i+5,6*i+4] + k[5,4] K[6*i+5,6*i+5] = K[6*i+5,6*i+5] + k[5,5] K[6*i+5,6*j] = K[6*i+5,6*j] + k[5,6] K[6*i+5,6*j+1] = K[6*i+5,6*j+1] + k[5,7] K[6*i+5,6*j+2] = K[6*i+5,6*j+2] + k[5,8] K[6*i+5,6*j+3] = K[6*i+5,6*j+3] + k[5,9] K[6*i+5,6*j+4] = K[6*i+5,6*j+4] + k[5,10] K[6*i+5,6*j+5] = K[6*i+5,6*j+5] + k[5,11] K[6*j,6*i] = K[6*j,6*i] + k[6,0] K[6*j,6*i+1] = K[6*j,6*i+1] + k[6,1] K[6*j,6*i+2] = K[6*j,6*i+2] + k[6,2] K[6*j,6*i+3] = K[6*j,6*i+3] + k[6,3] K[6*j,6*i+4] = K[6*j,6*i+4] + k[6,4] K[6*j,6*i+5] = K[6*j,6*i+5] + k[6,5] K[6*j,6*j] = K[6*j,6*j] + k[6,6] K[6*j,6*j+1] = K[6*j,6*j+1] + k[6,7] K[6*j,6*j+2] = K[6*j,6*j+2] + k[6,8] K[6*j,6*j+3] = K[6*j,6*j+3] + k[6,9] K[6*j,6*j+4] = K[6*j,6*j+4] + k[6,10] K[6*j,6*j+5] = K[6*j,6*j+5] + k[6,11] K[6*j+1,6*i] = K[6*j+1,6*i] + k[7,0] K[6*j+1,6*i+1] = K[6*j+1,6*i+1] + k[7,1] K[6*j+1,6*i+2] = K[6*j+1,6*i+2] + k[7,2] K[6*j+1,6*i+3] = K[6*j+1,6*i+3] + k[7,3] K[6*j+1,6*i+4] = K[6*j+1,6*i+4] + k[7,4] K[6*j+1,6*i+5] = K[6*j+1,6*i+5] + k[7,5] K[6*j+1,6*j] = K[6*j+1,6*j] + k[7,6] K[6*j+1,6*j+1] = K[6*j+1,6*j+1] + k[7,7] K[6*j+1,6*j+2] = K[6*j+1,6*j+2] + k[7,8] K[6*j+1,6*j+3] = K[6*j+1,6*j+3] + k[7,9] K[6*j+1,6*j+4] = K[6*j+1,6*j+4] + k[7,10] K[6*j+1,6*j+5] = K[6*j+1,6*j+5] + k[7,11] K[6*j+2,6*i] = K[6*j+2,6*i] + k[8,0] K[6*j+2,6*i+1] = K[6*j+2,6*i+1] + k[8,1] K[6*j+2,6*i+2] = K[6*j+2,6*i+2] + k[8,2] K[6*j+2,6*i+3] = K[6*j+2,6*i+3] + k[8,3] K[6*j+2,6*i+4] = K[6*j+2,6*i+4] + k[8,4] K[6*j+2,6*i+5] = K[6*j+2,6*i+5] + k[8,5] K[6*j+2,6*j] = K[6*j+2,6*j] + k[8,6] K[6*j+2,6*j+1] = K[6*j+2,6*j+1] + k[8,7] K[6*j+2,6*j+2] = K[6*j+2,6*j+2] + k[8,8] K[6*j+2,6*j+3] = K[6*j+2,6*j+3] + k[8,9] K[6*j+2,6*j+4] = K[6*j+2,6*j+4] + k[8,10] K[6*j+2,6*j+5] = K[6*j+2,6*j+5] + k[8,11] K[6*j+3,6*i] = K[6*j+3,6*i] + k[9,0] K[6*j+3,6*i+1] = K[6*j+3,6*i+1] + k[9,1] K[6*j+3,6*i+2] = K[6*j+3,6*i+2] + k[9,2] K[6*j+3,6*i+3] = K[6*j+3,6*i+3] + k[9,3] K[6*j+3,6*i+4] = K[6*j+3,6*i+4] + k[9,4] K[6*j+3,6*i+5] = K[6*j+3,6*i+5] + k[9,5] K[6*j+3,6*j] = K[6*j+3,6*j] + k[9,6] K[6*j+3,6*j+1] = K[6*j+3,6*j+1] + k[9,7] K[6*j+3,6*j+2] = K[6*j+3,6*j+2] + k[9,8] K[6*j+3,6*j+3] = K[6*j+3,6*j+3] + k[9,9] K[6*j+3,6*j+4] = K[6*j+3,6*j+4] + k[9,10] K[6*j+3,6*j+5] = K[6*j+3,6*j+5] + k[9,11] K[6*j+4,6*i] = K[6*j+4,6*i] + k[10,0] K[6*j+4,6*i+1] = K[6*j+4,6*i+1] + k[10,1] K[6*j+4,6*i+2] = K[6*j+4,6*i+2] + k[10,2] K[6*j+4,6*i+3] = K[6*j+4,6*i+3] + k[10,3] K[6*j+4,6*i+4] = K[6*j+4,6*i+4] + k[10,4] K[6*j+4,6*i+5] = K[6*j+4,6*i+5] + k[10,5] K[6*j+4,6*j] = K[6*j+4,6*j] + k[10,6] K[6*j+4,6*j+1] = K[6*j+4,6*j+1] + k[10,7] K[6*j+4,6*j+2] = K[6*j+4,6*j+2] + k[10,8] K[6*j+4,6*j+3] = K[6*j+4,6*j+3] + k[10,9] K[6*j+4,6*j+4] = K[6*j+4,6*j+4] + k[10,10] K[6*j+4,6*j+5] = K[6*j+4,6*j+5] + k[10,11] K[6*j+5,6*i] = K[6*j+5,6*i] + k[11,0] K[6*j+5,6*i+1] = K[6*j+5,6*i+1] + k[11,1] K[6*j+5,6*i+2] = K[6*j+5,6*i+2] + k[11,2] K[6*j+5,6*i+3] = K[6*j+5,6*i+3] + k[11,3] K[6*j+5,6*i+4] = K[6*j+5,6*i+4] + k[11,4] K[6*j+5,6*i+5] = K[6*j+5,6*i+5] + k[11,5] K[6*j+5,6*j] = K[6*j+5,6*j] + k[11,6] K[6*j+5,6*j+1] = K[6*j+5,6*j+1] + k[11,7] K[6*j+5,6*j+2] = K[6*j+5,6*j+2] + k[11,8] K[6*j+5,6*j+3] = K[6*j+5,6*j+3] + k[11,9] K[6*j+5,6*j+4] = K[6*j+5,6*j+4] + k[11,10] K[6*j+5,6*j+5] = K[6*j+5,6*j+5] + k[11,11] return K def FEA_u(coord, elcon, bc_u_elim, f_after_u_elim, E=210e6,G=84e6,A=2e-2,Iy=10e-5,Iz=20e-5,J=5e-5): coord=np.array(coord) elcon=np.array(elcon) K=np.zeros(shape=(6*(np.max(elcon)+1),6*(np.max(elcon)+1))) for el in elcon: k=SpaceFrameElementStiffness(E,G,A,Iy,Iz,J,coord[el[0]][0],coord[el[0]][1],coord[el[0]][2],\ coord[el[1]][0],coord[el[1]][1],coord[el[1]][2]) K=SpaceFrameAssemble(K,k,el[0],el[1]) K=np.delete(K,bc_u_elim,0) K=np.delete(K,bc_u_elim,1) d=np.dot(np.linalg.inv(K),f_after_u_elim) u=np.zeros(shape=(6*len(coord))) j=0 for i in range(len(u)): if i not in bc_u_elim: u[i]=d[j] j+=1 if j>len(d)-1: break return u ``` ## Utils ``` def total_length(coord,elcon): coord=np.array(coord) elcon=np.array(elcon) t_length=0 for i in range(len(elcon)): l=PlaneTrussElementLength(coord[elcon[i][0]][0],\ coord[elcon[i][0]][1],\ coord[elcon[i][0]][2],\ coord[elcon[i][1]][0],\ coord[elcon[i][1]][1],\ coord[elcon[i][1]][2]) t_length+=l return t_length def possible_lines_dic(n,m,dx,dy): A=[(-dx,0),(-dx,dy),(0,dy),(dx,dy),(dx,0),(dx,-dy),(0,-dy),(-dx,-dy)] dic={} t=0 for i in range(n): for j in range(m): for item in A: x,y=j*dx,i*dy x1,y1=x+item[0],y+item[1] if x1>=0 and x1<=(m-1)*dx and y1>=0 and y1<=(n-1)*dy and (x1,y1,x,y) not in dic: dic[(x,y,x1,y1)]=t t+=1 return dic # def possible_elcon_dic(n,m,dx,dy): # dic={} # t=0 # for i in range(n): # for j in range(m): # x,y=j*dx,i*dy # dic[(x,y)]=t # t+=1 # return dic # lines_dic(5,5,1,1) # possible_elcon_dic(5,5,1,1) # def pad(l, content, width): # l.extend([content] * (width - len(l))) # return l # def triangle(elcon): # c=random.randint(0,np.max(elcon)) # T=[] # for i in range(len(elcon)): # if np.any(np.not_equal(elcon[i],elcon[c])) and elcon[c][1] in elcon[i]: # T+=list(elcon[i]) # T=set(T) # T=list(T) # for j in range(len(T)): # if ([elcon[c][0],T[j]] in elcon.tolist() or [T[j],elcon[c][0]] in elcon.tolist()) \ # and np.any(np.not_equal(np.array([elcon[c][0],T[j]]),elcon[c])): # return [elcon[c][0],elcon[c][1],T[j]] # def mid_point_triangle(tr_edges,coord): # ox=(coord[tr_edges[0]][0]+coord[tr_edges[1]][0]+coord[tr_edges[2]][0])/3 # oy=(coord[tr_edges[0]][1]+coord[tr_edges[1]][1]+coord[tr_edges[2]][1])/3 # oz=0 # return list((ox,oy,oz)) # def new_connections(tr_edges,coord): # K=tr_edges # return [[len(coord),K[0]],[len(coord),K[1]],[len(coord),K[2]]] # list(range(0,6)) ``` ## Model ``` class Model: def __init__(self,n=5,m=5,dx=1,dy=1, force=-500, E=210e6, G=84e6, A=2e-2, Iy=10e-5, Iz=20e-5, J=5e-5, break_flag=False): # n,m,dx,dy - grid parameters self.E=E self.G=G self.A=A self.Iy=Iy self.Iz=Iz self.J=J self.n=n self.m=m self.dx=dx self.dy=dy self.dic_lines=possible_lines_dic(self.n,self.m,self.dx,self.dy) self.line_list=len(self.dic_lines)*[0] self.break_flag=break_flag self.coord=[[2,2,0]] self.elcon=[] self.el_dic={(2,2):0} self.max_el=0 self.bc_u_elim=[] self.force=force self.f_after_u_elim=[0,self.force,0,0,0,0] self.old_weight=float("inf") self.old_strength=-float("inf") self.visit_list = [0,0,0,0] # number of checkpoints is 4 def reset(self,break_flag,force): self.dic_lines=possible_lines_dic(self.n,self.m,self.dx,self.dy) self.line_list=len(self.dic_lines)*[0] self.break_flag=break_flag self.coord=[[2,2,0]] self.elcon=[] self.el_dic={(2,2):0} self.max_el=0 self.bc_u_elim=[] self.force=force self.f_after_u_elim=[0,self.force,0,0,0,0] # self.old_weight=-float("inf") # self.old_strength=-float("inf") self.visit_list = [0,0,0,0] # number of checkpoints is 4 def FEA(self): return FEA_u(self.coord, self.elcon, self.bc_u_elim, self.f_after_u_elim, self.E,self.G,self.A,self.Iy,self.Iz,self.J) def max_u(self,FEA_output_arr): t=1 A=[] while t<len(FEA_output_arr): A.append(FEA_output_arr[t]) t+=6 return min(A) def length(self): return total_length(self.coord,self.elcon) def move_w(self,x,y): # x,y - current location x_new=x-self.dx y_new=y if x_new<0 or x_new>(self.m-1)*self.dx or y_new<0 or y_new>(self.n-1)*self.dy \ or 3 in self.line_list: self.break_flag=True else: try: self.line_list[self.dic_lines[(x,y,x_new,y_new)]]+=1 except KeyError: self.line_list[self.dic_lines[(x_new,y_new, x,y)]]+=1 if (x_new,y_new) not in self.el_dic: self.max_el+=1 self.el_dic[(x_new,y_new)]=self.max_el self.coord.append([x_new,y_new,0]) # if (x_new,y_new)!=(0,0) and (x_new,y_new)!=((self.m-1)*self.dx,0) and \ # (x_new,y_new)!=((self.m-1)*self.dx,(self.n-1)*self.dy) and \ # (x_new,y_new)!=(0,(self.n-1)*self.dy): if (x_new,y_new)!=(1,1) and (x_new,y_new)!=(self.m-2,1) and \ (x_new,y_new)!=(self.m-2,self.n-2) and \ (x_new,y_new)!=(1,self.n-2): self.f_after_u_elim+=[0,self.force,0,0,0,0] elif (x_new,y_new)==(1,1) or (x_new,y_new)==(self.m-2,1) or \ (x_new,y_new)==(self.m-2,self.n-2) or \ (x_new,y_new)==(1,self.n-2): self.bc_u_elim+=list(range(self.el_dic[(x_new,y_new)]*6-6,self.el_dic[(x_new,y_new)]*6)) if (self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]) not in self.elcon and \ (self.el_dic[(x_new,y_new)],self.el_dic[(x,y)]) not in self.elcon: self.elcon.append([self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]]) if (x_new,y_new) in self.el_dic: if (x_new,y_new)==(1,1): self.visit_list[0]+=1 elif (x_new,y_new)==(self.m-2,1): self.visit_list[1]+=1 elif (x_new,y_new)==(self.m-2,self.n-2): self.visit_list[2]+=1 elif (x_new,y_new)==(1,self.n-2): self.visit_list[3]+=1 return x_new, y_new def move_nw(self,x,y): # x,y - current location x_new=x-self.dx y_new=y+self.dy if x_new<0 or x_new>(self.m-1)*self.dx or y_new<0 or y_new>(self.n-1)*self.dy \ or 3 in self.line_list: self.break_flag=True else: try: self.line_list[self.dic_lines[(x,y,x_new,y_new)]]+=1 except KeyError: self.line_list[self.dic_lines[(x_new,y_new, x,y)]]+=1 if (x_new,y_new) not in self.el_dic: self.max_el+=1 self.el_dic[(x_new,y_new)]=self.max_el self.coord.append([x_new,y_new,0]) if (x_new,y_new)!=(1,1) and (x_new,y_new)!=(self.m-2,1) and \ (x_new,y_new)!=(self.m-2,self.n-2) and \ (x_new,y_new)!=(1,self.n-2): self.f_after_u_elim+=[0,self.force,0,0,0,0] elif (x_new,y_new)==(1,1) or (x_new,y_new)==(self.m-2,1) or \ (x_new,y_new)==(self.m-2,self.n-2) or \ (x_new,y_new)==(1,self.n-2): self.bc_u_elim+=list(range(self.el_dic[(x_new,y_new)]*6-6,self.el_dic[(x_new,y_new)]*6)) if (self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]) not in self.elcon and \ (self.el_dic[(x_new,y_new)],self.el_dic[(x,y)]) not in self.elcon: self.elcon.append([self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]]) if (x_new,y_new) in self.el_dic: if (x_new,y_new)==(1,1): self.visit_list[0]+=1 elif (x_new,y_new)==(self.m-2,1): self.visit_list[1]+=1 elif (x_new,y_new)==(self.m-2,self.n-2): self.visit_list[2]+=1 elif (x_new,y_new)==(1,self.n-2): self.visit_list[3]+=1 return x_new, y_new def move_n(self,x,y): # x,y - current location x_new=x y_new=y+self.dy if x_new<0 or x_new>(self.m-1)*self.dx or y_new<0 or y_new>(self.n-1)*self.dy \ or 3 in self.line_list: self.break_flag=True else: try: self.line_list[self.dic_lines[(x,y,x_new,y_new)]]+=1 except KeyError: self.line_list[self.dic_lines[(x_new,y_new, x,y)]]+=1 if (x_new,y_new) not in self.el_dic: self.max_el+=1 self.el_dic[(x_new,y_new)]=self.max_el self.coord.append([x_new,y_new,0]) if (x_new,y_new)!=(1,1) and (x_new,y_new)!=(self.m-2,1) and \ (x_new,y_new)!=(self.m-2,self.n-2) and \ (x_new,y_new)!=(1,self.n-2): self.f_after_u_elim+=[0,self.force,0,0,0,0] elif (x_new,y_new)==(1,1) or (x_new,y_new)==(self.m-2,1) or \ (x_new,y_new)==(self.m-2,self.n-2) or \ (x_new,y_new)==(1,self.n-2): self.bc_u_elim+=list(range(self.el_dic[(x_new,y_new)]*6-6,self.el_dic[(x_new,y_new)]*6)) if (self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]) not in self.elcon and \ (self.el_dic[(x_new,y_new)],self.el_dic[(x,y)]) not in self.elcon: self.elcon.append([self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]]) if (x_new,y_new) in self.el_dic: if (x_new,y_new)==(1,1): self.visit_list[0]+=1 elif (x_new,y_new)==(self.m-2,1): self.visit_list[1]+=1 elif (x_new,y_new)==(self.m-2,self.n-2): self.visit_list[2]+=1 elif (x_new,y_new)==(1,self.n-2): self.visit_list[3]+=1 return x_new, y_new def move_ne(self,x,y): # x,y - current location x_new=x+self.dx y_new=y+self.dy if x_new<0 or x_new>(self.m-1)*self.dx or y_new<0 or y_new>(self.n-1)*self.dy \ or 3 in self.line_list: self.break_flag=True else: try: self.line_list[self.dic_lines[(x,y,x_new,y_new)]]+=1 except KeyError: self.line_list[self.dic_lines[(x_new,y_new, x,y)]]+=1 if (x_new,y_new) not in self.el_dic: self.max_el+=1 self.el_dic[(x_new,y_new)]=self.max_el self.coord.append([x_new,y_new,0]) if (x_new,y_new)!=(1,1) and (x_new,y_new)!=(self.m-2,1) and \ (x_new,y_new)!=(self.m-2,self.n-2) and \ (x_new,y_new)!=(1,self.n-2): self.f_after_u_elim+=[0,self.force,0,0,0,0] elif (x_new,y_new)==(1,1) or (x_new,y_new)==(self.m-2,1) or \ (x_new,y_new)==(self.m-2,self.n-2) or \ (x_new,y_new)==(1,self.n-2): self.bc_u_elim+=list(range(self.el_dic[(x_new,y_new)]*6-6,self.el_dic[(x_new,y_new)]*6)) if (self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]) not in self.elcon and \ (self.el_dic[(x_new,y_new)],self.el_dic[(x,y)]) not in self.elcon: self.elcon.append([self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]]) if (x_new,y_new) in self.el_dic: if (x_new,y_new)==(1,1): self.visit_list[0]+=1 elif (x_new,y_new)==(self.m-2,1): self.visit_list[1]+=1 elif (x_new,y_new)==(self.m-2,self.n-2): self.visit_list[2]+=1 elif (x_new,y_new)==(1,self.n-2): self.visit_list[3]+=1 return x_new, y_new def move_e(self,x,y): # x,y - current location x_new=x+self.dx y_new=y if x_new<0 or x_new>(self.m-1)*self.dx or y_new<0 or y_new>(self.n-1)*self.dy \ or 3 in self.line_list: self.break_flag=True else: try: self.line_list[self.dic_lines[(x,y,x_new,y_new)]]+=1 except KeyError: self.line_list[self.dic_lines[(x_new,y_new, x,y)]]+=1 if (x_new,y_new) not in self.el_dic: self.max_el+=1 self.el_dic[(x_new,y_new)]=self.max_el self.coord.append([x_new,y_new,0]) if (x_new,y_new)!=(1,1) and (x_new,y_new)!=(self.m-2,1) and \ (x_new,y_new)!=(self.m-2,self.n-2) and \ (x_new,y_new)!=(1,self.n-2): self.f_after_u_elim+=[0,self.force,0,0,0,0] elif (x_new,y_new)==(1,1) or (x_new,y_new)==(self.m-2,1) or \ (x_new,y_new)==(self.m-2,self.n-2) or \ (x_new,y_new)==(1,self.n-2): self.bc_u_elim+=list(range(self.el_dic[(x_new,y_new)]*6-6,self.el_dic[(x_new,y_new)]*6)) if (self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]) not in self.elcon and \ (self.el_dic[(x_new,y_new)],self.el_dic[(x,y)]) not in self.elcon: self.elcon.append([self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]]) if (x_new,y_new) in self.el_dic: if (x_new,y_new)==(1,1): self.visit_list[0]+=1 elif (x_new,y_new)==(self.m-2,1): self.visit_list[1]+=1 elif (x_new,y_new)==(self.m-2,self.n-2): self.visit_list[2]+=1 elif (x_new,y_new)==(1,self.n-2): self.visit_list[3]+=1 return x_new, y_new def move_se(self,x,y): # x,y - current location x_new=x+self.dx y_new=y-self.dy if x_new<0 or x_new>(self.m-1)*self.dx or y_new<0 or y_new>(self.n-1)*self.dy \ or 3 in self.line_list: self.break_flag=True else: try: self.line_list[self.dic_lines[(x,y,x_new,y_new)]]+=1 except KeyError: self.line_list[self.dic_lines[(x_new,y_new, x,y)]]+=1 if (x_new,y_new) not in self.el_dic: self.max_el+=1 self.el_dic[(x_new,y_new)]=self.max_el self.coord.append([x_new,y_new,0]) if (x_new,y_new)!=(1,1) and (x_new,y_new)!=(self.m-2,1) and \ (x_new,y_new)!=(self.m-2,self.n-2) and \ (x_new,y_new)!=(1,self.n-2): self.f_after_u_elim+=[0,self.force,0,0,0,0] elif (x_new,y_new)==(1,1) or (x_new,y_new)==(self.m-2,1) or \ (x_new,y_new)==(self.m-2,self.n-2) or \ (x_new,y_new)==(1,self.n-2): self.bc_u_elim+=list(range(self.el_dic[(x_new,y_new)]*6-6,self.el_dic[(x_new,y_new)]*6)) if (self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]) not in self.elcon and \ (self.el_dic[(x_new,y_new)],self.el_dic[(x,y)]) not in self.elcon: self.elcon.append([self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]]) if (x_new,y_new) in self.el_dic: if (x_new,y_new)==(1,1): self.visit_list[0]+=1 elif (x_new,y_new)==(self.m-2,1): self.visit_list[1]+=1 elif (x_new,y_new)==(self.m-2,self.n-2): self.visit_list[2]+=1 elif (x_new,y_new)==(1,self.n-2): self.visit_list[3]+=1 return x_new, y_new def move_s(self,x,y): # x,y - current location x_new=x y_new=y-self.dy if x_new<0 or x_new>(self.m-1)*self.dx or y_new<0 or y_new>(self.n-1)*self.dy \ or 3 in self.line_list: self.break_flag=True else: try: self.line_list[self.dic_lines[(x,y,x_new,y_new)]]+=1 except KeyError: self.line_list[self.dic_lines[(x_new,y_new, x,y)]]+=1 if (x_new,y_new) not in self.el_dic: self.max_el+=1 self.el_dic[(x_new,y_new)]=self.max_el self.coord.append([x_new,y_new,0]) if (x_new,y_new)!=(1,1) and (x_new,y_new)!=(self.m-2,1) and \ (x_new,y_new)!=(self.m-2,self.n-2) and \ (x_new,y_new)!=(1,self.n-2): self.f_after_u_elim+=[0,self.force,0,0,0,0] elif (x_new,y_new)==(1,1) or (x_new,y_new)==(self.m-2,1) or \ (x_new,y_new)==(self.m-2,self.n-2) or \ (x_new,y_new)==(1,self.n-2): self.bc_u_elim+=list(range(self.el_dic[(x_new,y_new)]*6-6,self.el_dic[(x_new,y_new)]*6)) if (self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]) not in self.elcon and \ (self.el_dic[(x_new,y_new)],self.el_dic[(x,y)]) not in self.elcon: self.elcon.append([self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]]) if (x_new,y_new) in self.el_dic: if (x_new,y_new)==(1,1): self.visit_list[0]+=1 elif (x_new,y_new)==(self.m-2,1): self.visit_list[1]+=1 elif (x_new,y_new)==(self.m-2,self.n-2): self.visit_list[2]+=1 elif (x_new,y_new)==(1,self.n-2): self.visit_list[3]+=1 return x_new, y_new def move_sw(self,x,y): # x,y - current location x_new=x-self.dx y_new=y-self.dy if x_new<0 or x_new>(self.m-1)*self.dx or y_new<0 or y_new>(self.n-1)*self.dy \ or 3 in self.line_list: self.break_flag=True else: try: self.line_list[self.dic_lines[(x,y,x_new,y_new)]]+=1 except KeyError: self.line_list[self.dic_lines[(x_new,y_new, x,y)]]+=1 if (x_new,y_new) not in self.el_dic: self.max_el+=1 self.el_dic[(x_new,y_new)]=self.max_el self.coord.append([x_new,y_new,0]) if (x_new,y_new)!=(1,1) and (x_new,y_new)!=(self.m-2,1) and \ (x_new,y_new)!=(self.m-2,self.n-2) and \ (x_new,y_new)!=(1,self.n-2): self.f_after_u_elim+=[0,self.force,0,0,0,0] elif (x_new,y_new)==(1,1) or (x_new,y_new)==(self.m-2,1) or \ (x_new,y_new)==(self.m-2,self.n-2) or \ (x_new,y_new)==(1,self.n-2): self.bc_u_elim+=list(range(self.el_dic[(x_new,y_new)]*6-6,self.el_dic[(x_new,y_new)]*6)) if (self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]) not in self.elcon and \ (self.el_dic[(x_new,y_new)],self.el_dic[(x,y)]) not in self.elcon: self.elcon.append([self.el_dic[(x,y)], self.el_dic[(x_new,y_new)]]) if (x_new,y_new) in self.el_dic: if (x_new,y_new)==(1,1): self.visit_list[0]+=1 elif (x_new,y_new)==(self.m-2,1): self.visit_list[1]+=1 elif (x_new,y_new)==(self.m-2,self.n-2): self.visit_list[2]+=1 elif (x_new,y_new)==(1,self.n-2): self.visit_list[3]+=1 return x_new, y_new def action_space(self,action,x0,y0): if action==0: return self.move_w(x0,y0) elif action==1: return self.move_nw(x0,y0) elif action==2: return self.move_n(x0,y0) elif action==3: return self.move_ne(x0,y0) elif action==4: return self.move_e(x0,y0) elif action==5: return self.move_se(x0,y0) elif action==6: return self.move_s(x0,y0) elif action==7: return self.move_sw(x0,y0) def nn_input(self,x,y): return self.line_list+[x,y] def reward_(self,x_new,y_new,n_steps): reward=2*n_steps # reward=2 if all([x>=1 for x in self.visit_list]): reward+=10000 weight=self.length() # self.draw("green") FEA_output_arr=self.FEA() max_=self.max_u(FEA_output_arr) strength=max_ # print(weight,strength) if weight<=self.old_weight: reward+=50000 self.old_weight=weight if strength>=self.old_strength: reward+=100000000 self.old_strength=strength # print(self.old_weight, self.old_strength) self.break_flag=True return reward # elif any([x==1 for x in self.visit_list]): # reward+=250*(self.visit_list[0]+self.visit_list[1]+self.visit_list[2]+self.visit_list[3]) # return reward # if x_new<0+1 or x_new>(self.m-1)*self.dx-1 or y_new<0+1 or y_new>(self.n-1)*self.dy-1: # reward-=50 # return reward return reward def draw(self,color): c=self.coord e=self.elcon c=np.array(c) e=np.array(e) coord=c.reshape(np.max(e)+1,3) fig=plt.figure(figsize=(13,5)) for item in e: ax = fig.gca(projection='3d') ax.plot([coord[item[0]][0],coord[item[1]][0]],\ [coord[item[0]][1],coord[item[1]][1]],\ [coord[item[0]][2],coord[item[1]][2]], color=color) # ax.view_init(70,300) ax.view_init(-90,90) # ax1 = plt.subplot(131) ax.set_xlim([0, 5]) ax.set_ylim([0, 5]) plt.show() ``` ## Neural Network Policy - Policy Gradients ``` n_inputs = 74 n_hidden = 100 n_outputs = 8 initializer = tf.contrib.layers.variance_scaling_initializer() learning_rate = 0.0001 # Build the neural network X_ = tf.placeholder(tf.float64, shape=[None, n_inputs], name="X_") hidden = fully_connected(X_, n_hidden, activation_fn=tf.nn.elu, weights_initializer=initializer) hidden1 = fully_connected(hidden, n_hidden, activation_fn=tf.nn.elu, weights_initializer=initializer) hidden2 = fully_connected(hidden1, n_hidden, activation_fn=tf.nn.elu, weights_initializer=initializer) logits = fully_connected(hidden2, n_outputs, activation_fn=None, weights_initializer=initializer) outputs = tf.nn.softmax(logits, name="Y_proba") # outputs = tf.exp(logits) / tf.reduce_sum(tf.exp(logits), -1) # Select a random action based on the estimated probabilities action = tf.random.multinomial(tf.log(outputs), num_samples=1,output_dtype=tf.int64) y=tf.reshape(tf.one_hot(action,depth=8,dtype=tf.float64),[8,1]) xentropy = tf.nn.sigmoid_cross_entropy_with_logits(labels=y, logits=tf.transpose(logits)) optimizer = tf.train.AdamOptimizer(learning_rate) grads_and_vars = optimizer.compute_gradients(xentropy) gradients = [grad for grad, variable in grads_and_vars] gradient_placeholders = [] grads_and_vars_feed = [] for grad, variable in grads_and_vars: gradient_placeholder = tf.placeholder(tf.float64, shape=grad.get_shape()) gradient_placeholders.append(gradient_placeholder) grads_and_vars_feed.append((gradient_placeholder, variable)) training_op = optimizer.apply_gradients(grads_and_vars_feed) init = tf.global_variables_initializer() saver = tf.train.Saver() # with tf.Session() as sess: # A=sess.run(tf.exp([-0.39514669, -0.9955475, 0.36458025, 0.02534027, 1.11079987, -0.25412942, # 0.68900028, 0.42532931]) /tf.reduce_sum(tf.exp([-0.39514669, -0.9955475, 0.36458025, 0.02534027, 1.11079987, -0.25412942, # 0.68900028, 0.42532931]), -1)) # A def discount_rewards(rewards, discount_rate=0.99): discounted_rewards = np.empty(len(rewards)) cumulative_rewards = 0 for step in reversed(range(len(rewards))): cumulative_rewards = rewards[step] + cumulative_rewards * discount_rate discounted_rewards[step] = cumulative_rewards return discounted_rewards def discount_and_normalize_rewards(all_rewards, discount_rate=0.99): all_discounted_rewards = [discount_rewards(rewards) for rewards in all_rewards] flat_rewards = np.concatenate(all_discounted_rewards) reward_mean = flat_rewards.mean() reward_std = flat_rewards.std() return [(discounted_rewards - reward_mean)/reward_std for discounted_rewards in all_discounted_rewards] # coord=np.array([0,0,0,0,7,0,7,7,0,7,0,0,3.5,3.5,0,4,4,0,3,4,0]) # elcon=np.array([[0,1],[1,2],[2,3],[0,3],[1,6],[2,6],[2,5],[4,5],[4,6],[0,4],[3,4],[3,5],[5,6],[0,6]]) # bc_u_elim=list(range(30,42)) # f_after_u_elim=[0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,-500,0,0,0,0] # G=Geometry(coord,elcon,bc_u_elim,f_after_u_elim) M=Model() n_iterations = 1001 # number of training iterations n_max_steps = 500 # max steps per episode n_games_per_update = 10 # train the policy every 10 episodes save_iterations = 100 # save the model every 10 training iterations with tf.Session() as sess: start=time.time() init.run() # saver.restore(sess, tf.train.latest_checkpoint("C:\\Temp\\tf_save\\policy0\\")) # tf.get_default_graph() for iteration in range(n_iterations): all_rewards = [] # all sequences of raw rewards for each episode all_gradients = [] # gradients saved at each step of each episode for game in range(n_games_per_update): # tf.random.set_random_seed(game) # init.run() # !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! current_rewards = [] # all raw rewards from the current episode current_gradients = [] # all gradients from the current episode M.reset(False,-500) x0,y0=2,2 obs=M.nn_input(x0,y0) for step in range(n_max_steps): action_val, gradients_val = sess.run([action, gradients], feed_dict={X_: np.array(obs).reshape(1,n_inputs)}) # outputs_, gradients_val = sess.run([X_, gradients], # feed_dict={X_: np.array(obs).reshape(1,n_inputs)}) x_new,y_new=x0,y0 # print(outputs_) # print(x_new,y_new) # print(action_val[0][0]) x_new,y_new=M.action_space(action_val[0][0],x_new,y_new) obs=M.nn_input(x_new,y_new) reward=M.reward_(x_new,y_new,step) x0,y0 = x_new,y_new if M.break_flag: reward-=10000 current_rewards.append(reward) current_gradients.append(gradients_val) if M.break_flag: break all_rewards.append(current_rewards) all_gradients.append(current_gradients) # At this point we have run the policy for 10 episodes, and we are # ready for a policy update using the algorithm described earlier. all_rewards = discount_and_normalize_rewards(all_rewards) feed_dict = {} for var_index, grad_placeholder in enumerate(gradient_placeholders): # multiply the gradients by the action scores, and compute the mean mean_gradients = np.mean([reward * all_gradients[game_index][step][var_index] for game_index, rewards in enumerate(all_rewards) for step, reward in enumerate(rewards)],axis=0) feed_dict[grad_placeholder] = mean_gradients sess.run(training_op, feed_dict=feed_dict) if iteration % save_iterations == 0: # print("Saving {} iteration".format(iteration)) print('Time taken for {} epoch {} sec\n'.format(iteration, time.time() - start)) saver.save(sess, "./bionic_ckpt/bionic0.ckpt") # end=time.time() ``` ## AI designing the bionic partition ``` def predict(G2): with tf.Session() as sess: saver = tf.train.import_meta_graph('./bionic_ckpt/bionic0.ckpt.meta') saver.restore(sess, "./bionic_ckpt/bionic0.ckpt") graph = tf.get_default_graph() outputs = graph.get_tensor_by_name("Y_proba:0") X_ = graph.get_tensor_by_name("X_:0") # G2.reset(np.array([0,0,0,0,7,0,7,7,0,7,0,0,3.5,3.5,0,4,4,0,3,4,0]),\ # np.array([[0,1],[1,2],[2,3],[0,3],[1,6],[2,6],[2,5],[4,5],[4,6],[0,4],[3,4],[3,5],[5,6],[0,6]]),\ # list(range(30,42)),[0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,-500,0,0,0,0]) # G2.position = random.randint(5,np.max(G2.elcon)) x0,y0=2,2 obs=G2.nn_input(x0,y0) for step in range(100): action_val= sess.run([outputs],feed_dict={X_: np.array(obs).reshape(1,n_inputs)}) action_val=np.log(action_val) print(np.argmax(action_val)) x_new,y_new=x0,y0 x_new,y_new=G2.action_space(np.argmax(action_val),x_new,y_new) print(x_new, y_new) if G2.break_flag: obs=G2.nn_input(x_new,y_new) break obs=G2.nn_input(x_new,y_new) x0,y0=x_new,y_new # print(obs[-1]) # G2.position = random.randint(5,np.max(G2.elcon)) G2.draw('blue') return obs[-1], obs[-2] # coord=np.array([0,0,0,0,7,0,7,7,0,7,0,0,3.5,3.5,0,4,4,0,3,4,0]) # elcon=np.array([[0,1],[1,2],[2,3],[0,3],[1,6],[2,6],[2,5],[4,5],[4,6],[0,4],[3,4],[3,5],[5,6],[0,6]]) # bc_u_elim=list(range(30,42)) # f_after_u_elim=[0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,-500,0,0,0,0] M=Model() # G3.draw('green') # pr=G3.nn_input() # pr[-1],pr[-2] # G3.add_node() # G3.add_node() # G3.add_node() # G3.add_node() # G3.add_node() # G3.add_node() # G3.add_node() # G3.add_node() predict(M) M.length() FEA_output_arr=M.FEA() M.max_u(FEA_output_arr) ```
github_jupyter
#### demo: training a DND LSTM on a contextual choice task This is an implementation of the following paper: ``` Ritter, S., Wang, J. X., Kurth-Nelson, Z., Jayakumar, S. M., Blundell, C., Pascanu, R., & Botvinick, M. (2018). Been There, Done That: Meta-Learning with Episodic Recall. arXiv [stat.ML]. Retrieved from http://arxiv.org/abs/1805.09692 ``` ``` ''' If you are using google colab, uncomment and run the following lines! which grabs the dependencies from github ''' # !git clone https://github.com/qihongl/dnd-lstm.git # !cd dnd-lstm/src/ # import os # os.chdir('dnd-lstm/src/') import time import torch import numpy as np import seaborn as sns import matplotlib.pyplot as plt from task import ContextualChoice from model import DNDLSTM as Agent from utils import compute_stats, to_sqnp from model.DND import compute_similarities from model.utils import get_reward, compute_returns, compute_a2c_loss sns.set(style='white', context='talk', palette='colorblind') seed_val = 0 torch.manual_seed(seed_val) np.random.seed(seed_val) '''init task''' n_unique_example = 50 n_trials = 2 * n_unique_example # n time steps of a trial trial_length = 10 # after `tp_corrupt`, turn off the noise t_noise_off = 5 # input/output/hidden/memory dim obs_dim = 32 task = ContextualChoice( obs_dim=obs_dim, trial_length=trial_length, t_noise_off=t_noise_off ) '''init model''' # set params dim_hidden = 32 dim_output = 2 dict_len = 100 learning_rate = 5e-4 n_epochs = 20 # init agent / optimizer agent = Agent(task.x_dim, dim_hidden, dim_output, dict_len) optimizer = torch.optim.Adam(agent.parameters(), lr=learning_rate) '''train''' log_return = np.zeros(n_epochs,) log_loss_value = np.zeros(n_epochs,) log_loss_policy = np.zeros(n_epochs,) log_Y = np.zeros((n_epochs, n_trials, trial_length)) log_Y_hat = np.zeros((n_epochs, n_trials, trial_length)) # loop over epoch for i in range(n_epochs): time_start = time.time() # get data for this epoch X, Y = task.sample(n_unique_example) # flush hippocampus agent.reset_memory() agent.turn_on_retrieval() # loop over the training set for m in range(n_trials): # prealloc cumulative_reward = 0 probs, rewards, values = [], [], [] h_t, c_t = agent.get_init_states() # loop over time, for one training example for t in range(trial_length): # only save memory at the last time point agent.turn_off_encoding() if t == trial_length-1 and m < n_unique_example: agent.turn_on_encoding() # recurrent computation at time t output_t, _ = agent(X[m][t].view(1, 1, -1), h_t, c_t) a_t, prob_a_t, v_t, h_t, c_t = output_t # compute immediate reward r_t = get_reward(a_t, Y[m][t]) # log probs.append(prob_a_t) rewards.append(r_t) values.append(v_t) # log cumulative_reward += r_t log_Y_hat[i, m, t] = a_t.item() returns = compute_returns(rewards) loss_policy, loss_value = compute_a2c_loss(probs, values, returns) loss = loss_policy + loss_value optimizer.zero_grad() loss.backward() optimizer.step() # log log_Y[i] = np.squeeze(Y.numpy()) log_return[i] += cumulative_reward / n_trials log_loss_value[i] += loss_value.item() / n_trials log_loss_policy[i] += loss_policy.item() / n_trials # print out some stuff time_end = time.time() run_time = time_end - time_start print( 'Epoch %3d | return = %.2f | loss: val = %.2f, pol = %.2f | time = %.2f' % (i, log_return[i], log_loss_value[i], log_loss_policy[i], run_time) ) '''learning curve''' f, axes = plt.subplots(1, 2, figsize=(8, 3)) axes[0].plot(log_return) axes[0].set_ylabel('Return') axes[0].set_xlabel('Epoch') axes[1].plot(log_loss_value) axes[1].set_ylabel('Value loss') axes[1].set_xlabel('Epoch') sns.despine() f.tight_layout() '''show behavior''' corrects = log_Y_hat[-1] == log_Y[-1] acc_mu_no_memory, acc_se_no_memory = compute_stats( corrects[:n_unique_example]) acc_mu_has_memory, acc_se_has_memory = compute_stats( corrects[n_unique_example:]) n_se = 2 f, ax = plt.subplots(1, 1, figsize=(7, 4)) ax.errorbar(range(trial_length), y=acc_mu_no_memory, yerr=acc_se_no_memory * n_se, label='w/o memory') ax.errorbar(range(trial_length), y=acc_mu_has_memory, yerr=acc_se_has_memory * n_se, label='w/ memory') ax.axvline(t_noise_off, label='turn off noise', color='grey', linestyle='--') ax.set_xlabel('Time') ax.set_ylabel('Correct rate') ax.set_title('Choice accuracy by condition') f.legend(frameon=False, bbox_to_anchor=(1, .6)) sns.despine() f.tight_layout() '''visualize keys and values''' keys, vals = agent.get_all_mems() n_mems = len(agent.dnd.keys) dmat_kk, dmat_vv = np.zeros((n_mems, n_mems)), np.zeros((n_mems, n_mems)) for i in range(n_mems): dmat_kk[i, :] = to_sqnp(compute_similarities( keys[i], keys, agent.dnd.kernel)) dmat_vv[i, :] = to_sqnp(compute_similarities( vals[i], vals, agent.dnd.kernel)) # plot dmats = {'key': dmat_kk, 'value': dmat_vv} f, axes = plt.subplots(1, 2, figsize=(12, 5)) for i, (label_i, dmat_i) in enumerate(dmats.items()): sns.heatmap(dmat_i, cmap='viridis', square=True, ax=axes[i]) axes[i].set_xlabel(f'id, {label_i} i') axes[i].set_ylabel(f'id, {label_i} j') axes[i].set_title( f'{label_i}-{label_i} similarity, metric = {agent.dnd.kernel}' ) f.tight_layout() '''project memory content to low dim space''' # convert the values to a np array, #memories x mem_dim vals_np = np.vstack([to_sqnp(vals[i]) for i in range(n_mems)]) # project to PC space vals_centered = (vals_np - np.mean(vals_np, axis=0, keepdims=True)) U, S, _ = np.linalg.svd(vals_centered, full_matrices=False) vals_pc = np.dot(U, np.diag(S)) # pick pcs pc_x = 0 pc_y = 1 # plot f, ax = plt.subplots(1, 1, figsize=(7, 5)) Y_phase2 = to_sqnp(Y[:n_unique_example, 0]) for y_val in np.unique(Y_phase2): ax.scatter( vals_pc[Y_phase2 == y_val, pc_x], vals_pc[Y_phase2 == y_val, pc_y], marker='o', alpha=.7, ) ax.set_title(f'Each point is a memory (i.e. value)') ax.set_xlabel(f'PC {pc_x}') ax.set_ylabel(f'PC {pc_y}') ax.legend(['left trial', 'right trial'], bbox_to_anchor=(.6, .3)) sns.despine(offset=20) f.tight_layout() ```
github_jupyter