content stringlengths 1 103k ⌀ | path stringlengths 8 216 | filename stringlengths 2 179 | language stringclasses 15
values | size_bytes int64 2 189k | quality_score float64 0.5 0.95 | complexity float64 0 1 | documentation_ratio float64 0 1 | repository stringclasses 5
values | stars int64 0 1k | created_date stringdate 2023-07-10 19:21:08 2025-07-09 19:11:45 | license stringclasses 4
values | is_test bool 2
classes | file_hash stringlengths 32 32 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
from types import ModuleType\nfrom typing import Any, Dict, List, Mapping, Optional, Sequence\n\nWINEXE: bool\nWINSERVICE: bool\n\ndef set_executable(exe: str) -> None: ...\ndef get_executable() -> str: ...\ndef is_forking(argv: Sequence[str]) -> bool: ...\ndef freeze_support() -> None: ...\ndef get_command_line(**kwds: Any) -> List[str]: ...\ndef spawn_main(pipe_handle: int, parent_pid: Optional[int] = ..., tracker_fd: Optional[int] = ...) -> None: ...\n\n# undocumented\ndef _main(fd: int) -> Any: ...\ndef get_preparation_data(name: str) -> Dict[str, Any]: ...\n\nold_main_modules: List[ModuleType]\n\ndef prepare(data: Mapping[str, Any]) -> None: ...\ndef import_main_path(main_path: str) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\multiprocessing\spawn.pyi | spawn.pyi | Other | 690 | 0.95 | 0.47619 | 0.0625 | python-kit | 578 | 2023-11-04T23:36:47.352539 | BSD-3-Clause | false | 44f3152778e9810eea9daff6671b59e0 |
import sys\nimport threading\nfrom multiprocessing.context import BaseContext\nfrom typing import Any, Callable, ContextManager, Optional, Union\n\n_LockLike = Union[Lock, RLock]\n\nclass Barrier(threading.Barrier):\n def __init__(\n self, parties: int, action: Optional[Callable[..., Any]] = ..., timeout: Optional[float] = ..., *ctx: BaseContext\n ) -> None: ...\n\nclass BoundedSemaphore(Semaphore):\n def __init__(self, value: int = ..., *, ctx: BaseContext) -> None: ...\n\nclass Condition(ContextManager[bool]):\n def __init__(self, lock: Optional[_LockLike] = ..., *, ctx: BaseContext) -> None: ...\n if sys.version_info >= (3, 7):\n def notify(self, n: int = ...) -> None: ...\n else:\n def notify(self) -> None: ...\n def notify_all(self) -> None: ...\n def wait(self, timeout: Optional[float] = ...) -> bool: ...\n def wait_for(self, predicate: Callable[[], bool], timeout: Optional[float] = ...) -> bool: ...\n def acquire(self, block: bool = ..., timeout: Optional[float] = ...) -> bool: ...\n def release(self) -> None: ...\n\nclass Event(ContextManager[bool]):\n def __init__(self, lock: Optional[_LockLike] = ..., *, ctx: BaseContext) -> None: ...\n def is_set(self) -> bool: ...\n def set(self) -> None: ...\n def clear(self) -> None: ...\n def wait(self, timeout: Optional[float] = ...) -> bool: ...\n\nclass Lock(SemLock):\n def __init__(self, *, ctx: BaseContext) -> None: ...\n\nclass RLock(SemLock):\n def __init__(self, *, ctx: BaseContext) -> None: ...\n\nclass Semaphore(SemLock):\n def __init__(self, value: int = ..., *, ctx: BaseContext) -> None: ...\n\n# Not part of public API\nclass SemLock(ContextManager[bool]):\n def acquire(self, block: bool = ..., timeout: Optional[float] = ...) -> bool: ...\n def release(self) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\multiprocessing\synchronize.pyi | synchronize.pyi | Other | 1,799 | 0.95 | 0.617021 | 0.026316 | node-utils | 712 | 2024-07-08T06:14:01.769765 | BSD-3-Clause | false | 0bb03d76944f24af13004b0cc4575232 |
import sys\nfrom logging import Logger\nfrom multiprocessing import connection, pool, sharedctypes, synchronize\nfrom multiprocessing.context import (\n AuthenticationError as AuthenticationError,\n BaseContext,\n BufferTooShort as BufferTooShort,\n DefaultContext,\n Process as Process,\n ProcessError as ProcessError,\n SpawnContext,\n TimeoutError as TimeoutError,\n)\nfrom multiprocessing.managers import SyncManager\nfrom multiprocessing.process import active_children as active_children, current_process as current_process\n\n# These are technically functions that return instances of these Queue classes. See #4313 for discussion\nfrom multiprocessing.queues import JoinableQueue as JoinableQueue, Queue as Queue, SimpleQueue as SimpleQueue\nfrom multiprocessing.spawn import freeze_support as freeze_support\nfrom typing import Any, Callable, Iterable, List, Optional, Sequence, Tuple, Union, overload\nfrom typing_extensions import Literal\n\nif sys.version_info >= (3, 8):\n from multiprocessing.process import parent_process as parent_process\n\nif sys.platform != "win32":\n from multiprocessing.context import ForkContext, ForkServerContext\n\n# N.B. The functions below are generated at runtime by partially applying\n# multiprocessing.context.BaseContext's methods, so the two signatures should\n# be identical (modulo self).\n\n# Sychronization primitives\n_LockLike = Union[synchronize.Lock, synchronize.RLock]\n\ndef Barrier(parties: int, action: Optional[Callable[..., Any]] = ..., timeout: Optional[float] = ...) -> synchronize.Barrier: ...\ndef BoundedSemaphore(value: int = ...) -> synchronize.BoundedSemaphore: ...\ndef Condition(lock: Optional[_LockLike] = ...) -> synchronize.Condition: ...\ndef Event() -> synchronize.Event: ...\ndef Lock() -> synchronize.Lock: ...\ndef RLock() -> synchronize.RLock: ...\ndef Semaphore(value: int = ...) -> synchronize.Semaphore: ...\ndef Pipe(duplex: bool = ...) -> Tuple[connection.Connection, connection.Connection]: ...\ndef Pool(\n processes: Optional[int] = ...,\n initializer: Optional[Callable[..., Any]] = ...,\n initargs: Iterable[Any] = ...,\n maxtasksperchild: Optional[int] = ...,\n) -> pool.Pool: ...\n\n# Functions Array and Value are copied from context.pyi.\n# See https://github.com/python/typeshed/blob/ac234f25927634e06d9c96df98d72d54dd80dfc4/stdlib/2and3/turtle.pyi#L284-L291\n# for rationale\ndef Array(typecode_or_type: Any, size_or_initializer: Union[int, Sequence[Any]], *, lock: bool = ...) -> sharedctypes._Array: ...\ndef Value(typecode_or_type: Any, *args: Any, lock: bool = ...) -> sharedctypes._Value: ...\n\n# ----- multiprocessing function stubs -----\ndef allow_connection_pickling() -> None: ...\ndef cpu_count() -> int: ...\ndef get_logger() -> Logger: ...\ndef log_to_stderr(level: Optional[Union[str, int]] = ...) -> Logger: ...\ndef Manager() -> SyncManager: ...\ndef set_executable(executable: str) -> None: ...\ndef set_forkserver_preload(module_names: List[str]) -> None: ...\ndef get_all_start_methods() -> List[str]: ...\ndef get_start_method(allow_none: bool = ...) -> Optional[str]: ...\ndef set_start_method(method: str, force: Optional[bool] = ...) -> None: ...\n\nif sys.platform != "win32":\n @overload\n def get_context(method: None = ...) -> DefaultContext: ...\n @overload\n def get_context(method: Literal["spawn"]) -> SpawnContext: ...\n @overload\n def get_context(method: Literal["fork"]) -> ForkContext: ...\n @overload\n def get_context(method: Literal["forkserver"]) -> ForkServerContext: ...\n @overload\n def get_context(method: str) -> BaseContext: ...\n\nelse:\n @overload\n def get_context(method: None = ...) -> DefaultContext: ...\n @overload\n def get_context(method: Literal["spawn"]) -> SpawnContext: ...\n @overload\n def get_context(method: str) -> BaseContext: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\multiprocessing\__init__.pyi | __init__.pyi | Other | 3,802 | 0.95 | 0.402299 | 0.116883 | react-lib | 191 | 2024-12-09T05:30:17.773870 | MIT | false | 169c548a30621d5f06e685ec91998926 |
from queue import Queue\nfrom types import TracebackType\nfrom typing import Any, List, Optional, Tuple, Type, TypeVar, Union\n\nfamilies: List[None]\n\n_TConnection = TypeVar("_TConnection", bound=Connection)\n_TListener = TypeVar("_TListener", bound=Listener)\n_Address = Union[str, Tuple[str, int]]\n\nclass Connection(object):\n _in: Any\n _out: Any\n recv: Any\n recv_bytes: Any\n send: Any\n send_bytes: Any\n def __enter__(self: _TConnection) -> _TConnection: ...\n def __exit__(\n self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType]\n ) -> None: ...\n def __init__(self, _in: Any, _out: Any) -> None: ...\n def close(self) -> None: ...\n def poll(self, timeout: float = ...) -> bool: ...\n\nclass Listener(object):\n _backlog_queue: Optional[Queue[Any]]\n @property\n def address(self) -> Optional[Queue[Any]]: ...\n def __enter__(self: _TListener) -> _TListener: ...\n def __exit__(\n self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType]\n ) -> None: ...\n def __init__(self, address: Optional[_Address] = ..., family: Optional[int] = ..., backlog: int = ...) -> None: ...\n def accept(self) -> Connection: ...\n def close(self) -> None: ...\n\ndef Client(address: _Address) -> Connection: ...\ndef Pipe(duplex: bool = ...) -> Tuple[Connection, Connection]: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\multiprocessing\dummy\connection.pyi | connection.pyi | Other | 1,431 | 0.85 | 0.384615 | 0 | python-kit | 861 | 2025-07-02T03:48:05.316675 | BSD-3-Clause | false | ddd8946ea9530f24d53d3944766b9d68 |
import array\nimport threading\nimport weakref\nfrom queue import Queue as Queue\nfrom typing import Any, Callable, Iterable, List, Mapping, Optional, Sequence\n\nJoinableQueue = Queue\nBarrier = threading.Barrier\nBoundedSemaphore = threading.BoundedSemaphore\nCondition = threading.Condition\nEvent = threading.Event\nLock = threading.Lock\nRLock = threading.RLock\nSemaphore = threading.Semaphore\n\nclass DummyProcess(threading.Thread):\n _children: weakref.WeakKeyDictionary[Any, Any]\n _parent: threading.Thread\n _pid: None\n _start_called: int\n exitcode: Optional[int]\n def __init__(\n self,\n group: Any = ...,\n target: Optional[Callable[..., Any]] = ...,\n name: Optional[str] = ...,\n args: Iterable[Any] = ...,\n kwargs: Mapping[str, Any] = ...,\n ) -> None: ...\n\nProcess = DummyProcess\n\nclass Namespace:\n def __init__(self, **kwds: Any) -> None: ...\n def __getattr__(self, __name: str) -> Any: ...\n def __setattr__(self, __name: str, __value: Any) -> None: ...\n\nclass Value:\n _typecode: Any\n _value: Any\n value: Any\n def __init__(self, typecode: Any, value: Any, lock: Any = ...) -> None: ...\n\ndef Array(typecode: Any, sequence: Sequence[Any], lock: Any = ...) -> array.array[Any]: ...\ndef Manager() -> Any: ...\ndef Pool(\n processes: Optional[int] = ..., initializer: Optional[Callable[..., Any]] = ..., initargs: Iterable[Any] = ...\n) -> Any: ...\ndef active_children() -> List[Any]: ...\ndef current_process() -> threading.Thread: ...\ndef freeze_support() -> None: ...\ndef shutdown() -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\multiprocessing\dummy\__init__.pyi | __init__.pyi | Other | 1,572 | 0.85 | 0.288462 | 0 | vue-tools | 736 | 2024-06-11T22:42:49.253592 | Apache-2.0 | false | a097d96cb35b578fa42f8db622458c1b |
import os\nimport sys\nfrom _typeshed import AnyPath, BytesPath, StrPath\nfrom genericpath import exists as exists\nfrom typing import Any, AnyStr, Optional, Sequence, Tuple, TypeVar, overload\n\n_T = TypeVar("_T")\n\nif sys.version_info >= (3, 6):\n from builtins import _PathLike\n\n# ----- os.path variables -----\nsupports_unicode_filenames: bool\n# aliases (also in os)\ncurdir: str\npardir: str\nsep: str\nif sys.platform == "win32":\n altsep: str\nelse:\n altsep: Optional[str]\nextsep: str\npathsep: str\ndefpath: str\ndevnull: str\n\n# ----- os.path function stubs -----\nif sys.version_info >= (3, 6):\n # Overloads are necessary to work around python/mypy#3644.\n @overload\n def abspath(path: _PathLike[AnyStr]) -> AnyStr: ...\n @overload\n def abspath(path: AnyStr) -> AnyStr: ...\n @overload\n def basename(p: _PathLike[AnyStr]) -> AnyStr: ...\n @overload\n def basename(p: AnyStr) -> AnyStr: ...\n @overload\n def dirname(p: _PathLike[AnyStr]) -> AnyStr: ...\n @overload\n def dirname(p: AnyStr) -> AnyStr: ...\n @overload\n def expanduser(path: _PathLike[AnyStr]) -> AnyStr: ...\n @overload\n def expanduser(path: AnyStr) -> AnyStr: ...\n @overload\n def expandvars(path: _PathLike[AnyStr]) -> AnyStr: ...\n @overload\n def expandvars(path: AnyStr) -> AnyStr: ...\n @overload\n def normcase(s: _PathLike[AnyStr]) -> AnyStr: ...\n @overload\n def normcase(s: AnyStr) -> AnyStr: ...\n @overload\n def normpath(path: _PathLike[AnyStr]) -> AnyStr: ...\n @overload\n def normpath(path: AnyStr) -> AnyStr: ...\n if sys.platform == "win32":\n @overload\n def realpath(path: _PathLike[AnyStr]) -> AnyStr: ...\n @overload\n def realpath(path: AnyStr) -> AnyStr: ...\n else:\n @overload\n def realpath(filename: _PathLike[AnyStr]) -> AnyStr: ...\n @overload\n def realpath(filename: AnyStr) -> AnyStr: ...\n\nelse:\n def abspath(path: AnyStr) -> AnyStr: ...\n def basename(p: AnyStr) -> AnyStr: ...\n def dirname(p: AnyStr) -> AnyStr: ...\n def expanduser(path: AnyStr) -> AnyStr: ...\n def expandvars(path: AnyStr) -> AnyStr: ...\n def normcase(s: AnyStr) -> AnyStr: ...\n def normpath(path: AnyStr) -> AnyStr: ...\n if sys.platform == "win32":\n def realpath(path: AnyStr) -> AnyStr: ...\n else:\n def realpath(filename: AnyStr) -> AnyStr: ...\n\nif sys.version_info >= (3, 6):\n # In reality it returns str for sequences of StrPath and bytes for sequences\n # of BytesPath, but mypy does not accept such a signature.\n def commonpath(paths: Sequence[AnyPath]) -> Any: ...\n\nelif sys.version_info >= (3, 5):\n def commonpath(paths: Sequence[AnyStr]) -> AnyStr: ...\n\n# NOTE: Empty lists results in '' (str) regardless of contained type.\n# So, fall back to Any\ndef commonprefix(m: Sequence[AnyPath]) -> Any: ...\ndef lexists(path: AnyPath) -> bool: ...\n\n# These return float if os.stat_float_times() == True,\n# but int is a subclass of float.\ndef getatime(filename: AnyPath) -> float: ...\ndef getmtime(filename: AnyPath) -> float: ...\ndef getctime(filename: AnyPath) -> float: ...\ndef getsize(filename: AnyPath) -> int: ...\ndef isabs(s: AnyPath) -> bool: ...\ndef isfile(path: AnyPath) -> bool: ...\ndef isdir(s: AnyPath) -> bool: ...\ndef islink(path: AnyPath) -> bool: ...\ndef ismount(path: AnyPath) -> bool: ...\n\nif sys.version_info >= (3, 6):\n @overload\n def join(a: StrPath, *paths: StrPath) -> str: ...\n @overload\n def join(a: BytesPath, *paths: BytesPath) -> bytes: ...\n\nelse:\n def join(a: AnyStr, *paths: AnyStr) -> AnyStr: ...\n\n@overload\ndef relpath(path: BytesPath, start: Optional[BytesPath] = ...) -> bytes: ...\n@overload\ndef relpath(path: StrPath, start: Optional[StrPath] = ...) -> str: ...\ndef samefile(f1: AnyPath, f2: AnyPath) -> bool: ...\ndef sameopenfile(fp1: int, fp2: int) -> bool: ...\ndef samestat(s1: os.stat_result, s2: os.stat_result) -> bool: ...\n\nif sys.version_info >= (3, 6):\n @overload\n def split(p: _PathLike[AnyStr]) -> Tuple[AnyStr, AnyStr]: ...\n @overload\n def split(p: AnyStr) -> Tuple[AnyStr, AnyStr]: ...\n @overload\n def splitdrive(p: _PathLike[AnyStr]) -> Tuple[AnyStr, AnyStr]: ...\n @overload\n def splitdrive(p: AnyStr) -> Tuple[AnyStr, AnyStr]: ...\n @overload\n def splitext(p: _PathLike[AnyStr]) -> Tuple[AnyStr, AnyStr]: ...\n @overload\n def splitext(p: AnyStr) -> Tuple[AnyStr, AnyStr]: ...\n\nelse:\n def split(p: AnyStr) -> Tuple[AnyStr, AnyStr]: ...\n def splitdrive(p: AnyStr) -> Tuple[AnyStr, AnyStr]: ...\n def splitext(p: AnyStr) -> Tuple[AnyStr, AnyStr]: ...\n\nif sys.version_info < (3, 7) and sys.platform == "win32":\n def splitunc(p: AnyStr) -> Tuple[AnyStr, AnyStr]: ... # deprecated\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\os\path.pyi | path.pyi | Other | 4,721 | 0.95 | 0.493056 | 0.077519 | react-lib | 267 | 2025-04-09T13:51:25.357511 | MIT | false | d6525de34375179d12889a176a91255d |
import sys\nfrom _typeshed import (\n AnyPath,\n FileDescriptorLike,\n OpenBinaryMode,\n OpenBinaryModeReading,\n OpenBinaryModeUpdating,\n OpenBinaryModeWriting,\n OpenTextMode,\n)\nfrom builtins import OSError, _PathLike\nfrom io import BufferedRandom, BufferedReader, BufferedWriter, FileIO, TextIOWrapper as _TextIOWrapper\nfrom posix import listdir as listdir, times_result\nfrom typing import (\n IO,\n Any,\n AnyStr,\n BinaryIO,\n Callable,\n ContextManager,\n Dict,\n Generic,\n Iterable,\n Iterator,\n List,\n Mapping,\n MutableMapping,\n NoReturn,\n Optional,\n Sequence,\n Set,\n Tuple,\n TypeVar,\n Union,\n overload,\n)\nfrom typing_extensions import Literal\n\nfrom . import path as path\n\nif sys.version_info >= (3, 9):\n from types import GenericAlias\n\n# We need to use something from path, or flake8 and pytype get unhappy\n_supports_unicode_filenames = path.supports_unicode_filenames\n\n_T = TypeVar("_T")\n\n# ----- os variables -----\n\nerror = OSError\n\nsupports_bytes_environ: bool\n\nsupports_dir_fd: Set[Callable[..., Any]]\nsupports_fd: Set[Callable[..., Any]]\nsupports_effective_ids: Set[Callable[..., Any]]\nsupports_follow_symlinks: Set[Callable[..., Any]]\n\nif sys.platform != "win32":\n # Unix only\n PRIO_PROCESS: int\n PRIO_PGRP: int\n PRIO_USER: int\n\n F_LOCK: int\n F_TLOCK: int\n F_ULOCK: int\n F_TEST: int\n\n if sys.platform != "darwin":\n POSIX_FADV_NORMAL: int\n POSIX_FADV_SEQUENTIAL: int\n POSIX_FADV_RANDOM: int\n POSIX_FADV_NOREUSE: int\n POSIX_FADV_WILLNEED: int\n POSIX_FADV_DONTNEED: int\n\n SF_NODISKIO: int\n SF_MNOWAIT: int\n SF_SYNC: int\n\n if sys.platform == "linux":\n XATTR_SIZE_MAX: int\n XATTR_CREATE: int\n XATTR_REPLACE: int\n\n P_PID: int\n P_PGID: int\n P_ALL: int\n\n WEXITED: int\n WSTOPPED: int\n WNOWAIT: int\n\n CLD_EXITED: int\n CLD_DUMPED: int\n CLD_TRAPPED: int\n CLD_CONTINUED: int\n\n SCHED_OTHER: int # some flavors of Unix\n SCHED_BATCH: int # some flavors of Unix\n SCHED_IDLE: int # some flavors of Unix\n SCHED_SPORADIC: int # some flavors of Unix\n SCHED_FIFO: int # some flavors of Unix\n SCHED_RR: int # some flavors of Unix\n SCHED_RESET_ON_FORK: int # some flavors of Unix\n\nif sys.platform != "win32":\n RTLD_LAZY: int\n RTLD_NOW: int\n RTLD_GLOBAL: int\n RTLD_LOCAL: int\n RTLD_NODELETE: int\n RTLD_NOLOAD: int\n RTLD_DEEPBIND: int\n\nSEEK_SET: int\nSEEK_CUR: int\nSEEK_END: int\nif sys.platform != "win32":\n SEEK_DATA: int # some flavors of Unix\n SEEK_HOLE: int # some flavors of Unix\n\nO_RDONLY: int\nO_WRONLY: int\nO_RDWR: int\nO_APPEND: int\nO_CREAT: int\nO_EXCL: int\nO_TRUNC: int\n# We don't use sys.platform for O_* flags to denote platform-dependent APIs because some codes,\n# including tests for mypy, use a more finer way than sys.platform before using these APIs\n# See https://github.com/python/typeshed/pull/2286 for discussions\nO_DSYNC: int # Unix only\nO_RSYNC: int # Unix only\nO_SYNC: int # Unix only\nO_NDELAY: int # Unix only\nO_NONBLOCK: int # Unix only\nO_NOCTTY: int # Unix only\nO_CLOEXEC: int # Unix only\nO_SHLOCK: int # Unix only\nO_EXLOCK: int # Unix only\nO_BINARY: int # Windows only\nO_NOINHERIT: int # Windows only\nO_SHORT_LIVED: int # Windows only\nO_TEMPORARY: int # Windows only\nO_RANDOM: int # Windows only\nO_SEQUENTIAL: int # Windows only\nO_TEXT: int # Windows only\nO_ASYNC: int # Gnu extension if in C library\nO_DIRECT: int # Gnu extension if in C library\nO_DIRECTORY: int # Gnu extension if in C library\nO_NOFOLLOW: int # Gnu extension if in C library\nO_NOATIME: int # Gnu extension if in C library\nO_PATH: int # Gnu extension if in C library\nO_TMPFILE: int # Gnu extension if in C library\nO_LARGEFILE: int # Gnu extension if in C library\n\ncurdir: str\npardir: str\nsep: str\nif sys.platform == "win32":\n altsep: str\nelse:\n altsep: Optional[str]\nextsep: str\npathsep: str\ndefpath: str\nlinesep: str\ndevnull: str\nname: str\n\nF_OK: int\nR_OK: int\nW_OK: int\nX_OK: int\n\nclass _Environ(MutableMapping[AnyStr, AnyStr], Generic[AnyStr]):\n def copy(self) -> Dict[AnyStr, AnyStr]: ...\n def __delitem__(self, key: AnyStr) -> None: ...\n def __getitem__(self, key: AnyStr) -> AnyStr: ...\n def __setitem__(self, key: AnyStr, value: AnyStr) -> None: ...\n def __iter__(self) -> Iterator[AnyStr]: ...\n def __len__(self) -> int: ...\n\nenviron: _Environ[str]\nif sys.platform != "win32":\n environb: _Environ[bytes]\n\nif sys.platform != "win32":\n confstr_names: Dict[str, int]\n pathconf_names: Dict[str, int]\n sysconf_names: Dict[str, int]\n\n EX_OK: int\n EX_USAGE: int\n EX_DATAERR: int\n EX_NOINPUT: int\n EX_NOUSER: int\n EX_NOHOST: int\n EX_UNAVAILABLE: int\n EX_SOFTWARE: int\n EX_OSERR: int\n EX_OSFILE: int\n EX_CANTCREAT: int\n EX_IOERR: int\n EX_TEMPFAIL: int\n EX_PROTOCOL: int\n EX_NOPERM: int\n EX_CONFIG: int\n EX_NOTFOUND: int\n\nP_NOWAIT: int\nP_NOWAITO: int\nP_WAIT: int\nif sys.platform == "win32":\n P_DETACH: int\n P_OVERLAY: int\n\n# wait()/waitpid() options\nif sys.platform != "win32":\n WNOHANG: int # Unix only\n WCONTINUED: int # some Unix systems\n WUNTRACED: int # Unix only\n\nTMP_MAX: int # Undocumented, but used by tempfile\n\n# ----- os classes (structures) -----\nclass stat_result:\n # For backward compatibility, the return value of stat() is also\n # accessible as a tuple of at least 10 integers giving the most important\n # (and portable) members of the stat structure, in the order st_mode,\n # st_ino, st_dev, st_nlink, st_uid, st_gid, st_size, st_atime, st_mtime,\n # st_ctime. More items may be added at the end by some implementations.\n\n st_mode: int # protection bits,\n st_ino: int # inode number,\n st_dev: int # device,\n st_nlink: int # number of hard links,\n st_uid: int # user id of owner,\n st_gid: int # group id of owner,\n st_size: int # size of file, in bytes,\n st_atime: float # time of most recent access,\n st_mtime: float # time of most recent content modification,\n st_ctime: float # platform dependent (time of most recent metadata change on Unix, or the time of creation on Windows)\n st_atime_ns: int # time of most recent access, in nanoseconds\n st_mtime_ns: int # time of most recent content modification in nanoseconds\n st_ctime_ns: int # platform dependent (time of most recent metadata change on Unix, or the time of creation on Windows) in nanoseconds\n if sys.version_info >= (3, 8) and sys.platform == "win32":\n st_reparse_tag: int\n if sys.platform == "win32":\n st_file_attributes: int\n def __getitem__(self, i: int) -> int: ...\n # not documented\n def __init__(self, tuple: Tuple[int, ...]) -> None: ...\n # On some Unix systems (such as Linux), the following attributes may also\n # be available:\n st_blocks: int # number of blocks allocated for file\n st_blksize: int # filesystem blocksize\n st_rdev: int # type of device if an inode device\n st_flags: int # user defined flags for file\n\n # On other Unix systems (such as FreeBSD), the following attributes may be\n # available (but may be only filled out if root tries to use them):\n st_gen: int # file generation number\n st_birthtime: int # time of file creation\n\n # On Mac OS systems, the following attributes may also be available:\n st_rsize: int\n st_creator: int\n st_type: int\n\nPathLike = _PathLike # See comment in builtins\n\n_FdOrAnyPath = Union[int, AnyPath]\n\nclass DirEntry(Generic[AnyStr]):\n # This is what the scandir interator yields\n # The constructor is hidden\n\n name: AnyStr\n path: AnyStr\n def inode(self) -> int: ...\n def is_dir(self, *, follow_symlinks: bool = ...) -> bool: ...\n def is_file(self, *, follow_symlinks: bool = ...) -> bool: ...\n def is_symlink(self) -> bool: ...\n def stat(self, *, follow_symlinks: bool = ...) -> stat_result: ...\n def __fspath__(self) -> AnyStr: ...\n if sys.version_info >= (3, 9):\n def __class_getitem__(cls, item: Any) -> GenericAlias: ...\n\nif sys.platform != "win32":\n _Tuple10Int = Tuple[int, int, int, int, int, int, int, int, int, int]\n _Tuple11Int = Tuple[int, int, int, int, int, int, int, int, int, int, int]\n if sys.version_info >= (3, 7):\n # f_fsid was added in https://github.com/python/cpython/pull/4571\n class statvfs_result(_Tuple10Int): # Unix only\n def __new__(cls, seq: Union[_Tuple10Int, _Tuple11Int], dict: Dict[str, int] = ...) -> statvfs_result: ...\n n_fields: int\n n_sequence_fields: int\n n_unnamed_fields: int\n\n f_bsize: int\n f_frsize: int\n f_blocks: int\n f_bfree: int\n f_bavail: int\n f_files: int\n f_ffree: int\n f_favail: int\n f_flag: int\n f_namemax: int\n f_fsid: int = ...\n else:\n class statvfs_result(_Tuple10Int): # Unix only\n n_fields: int\n n_sequence_fields: int\n n_unnamed_fields: int\n\n f_bsize: int\n f_frsize: int\n f_blocks: int\n f_bfree: int\n f_bavail: int\n f_files: int\n f_ffree: int\n f_favail: int\n f_flag: int\n f_namemax: int\n\n# ----- os function stubs -----\ndef fsencode(filename: Union[str, bytes, PathLike[Any]]) -> bytes: ...\ndef fsdecode(filename: Union[str, bytes, PathLike[Any]]) -> str: ...\n@overload\ndef fspath(path: str) -> str: ...\n@overload\ndef fspath(path: bytes) -> bytes: ...\n@overload\ndef fspath(path: PathLike[AnyStr]) -> AnyStr: ...\ndef get_exec_path(env: Optional[Mapping[str, str]] = ...) -> List[str]: ...\n\n# NOTE: get_exec_path(): returns List[bytes] when env not None\ndef getlogin() -> str: ...\ndef getpid() -> int: ...\ndef getppid() -> int: ...\ndef strerror(__code: int) -> str: ...\ndef umask(__mask: int) -> int: ...\n\nif sys.platform != "win32":\n # Unix only\n def ctermid() -> str: ...\n def getegid() -> int: ...\n def geteuid() -> int: ...\n def getgid() -> int: ...\n def getgrouplist(user: str, gid: int) -> List[int]: ...\n def getgroups() -> List[int]: ... # Unix only, behaves differently on Mac\n def initgroups(username: str, gid: int) -> None: ...\n def getpgid(pid: int) -> int: ...\n def getpgrp() -> int: ...\n def getpriority(which: int, who: int) -> int: ...\n def setpriority(which: int, who: int, priority: int) -> None: ...\n if sys.platform != "darwin":\n def getresuid() -> Tuple[int, int, int]: ...\n def getresgid() -> Tuple[int, int, int]: ...\n def getuid() -> int: ...\n def setegid(__egid: int) -> None: ...\n def seteuid(__euid: int) -> None: ...\n def setgid(__gid: int) -> None: ...\n def setgroups(__groups: Sequence[int]) -> None: ...\n def setpgrp() -> None: ...\n def setpgid(__pid: int, __pgrp: int) -> None: ...\n def setregid(__rgid: int, __egid: int) -> None: ...\n if sys.platform != "darwin":\n def setresgid(rgid: int, egid: int, sgid: int) -> None: ...\n def setresuid(ruid: int, euid: int, suid: int) -> None: ...\n def setreuid(__ruid: int, __euid: int) -> None: ...\n def getsid(__pid: int) -> int: ...\n def setsid() -> None: ...\n def setuid(__uid: int) -> None: ...\n from posix import uname_result\n def uname() -> uname_result: ...\n\n@overload\ndef getenv(key: str) -> Optional[str]: ...\n@overload\ndef getenv(key: str, default: _T) -> Union[str, _T]: ...\n\nif sys.platform != "win32":\n @overload\n def getenvb(key: bytes) -> Optional[bytes]: ...\n @overload\n def getenvb(key: bytes, default: _T = ...) -> Union[bytes, _T]: ...\n\ndef putenv(__name: Union[bytes, str], __value: Union[bytes, str]) -> None: ...\n\nif sys.platform != "win32":\n def unsetenv(__name: Union[bytes, str]) -> None: ...\n\n_Opener = Callable[[str, int], int]\n@overload\ndef fdopen(\n fd: int,\n mode: OpenTextMode = ...,\n buffering: int = ...,\n encoding: Optional[str] = ...,\n errors: Optional[str] = ...,\n newline: Optional[str] = ...,\n closefd: bool = ...,\n opener: Optional[_Opener] = ...,\n) -> _TextIOWrapper: ...\n@overload\ndef fdopen(\n fd: int,\n mode: OpenBinaryMode,\n buffering: Literal[0],\n encoding: None = ...,\n errors: None = ...,\n newline: None = ...,\n closefd: bool = ...,\n opener: Optional[_Opener] = ...,\n) -> FileIO: ...\n@overload\ndef fdopen(\n fd: int,\n mode: OpenBinaryModeUpdating,\n buffering: Literal[-1, 1] = ...,\n encoding: None = ...,\n errors: None = ...,\n newline: None = ...,\n closefd: bool = ...,\n opener: Optional[_Opener] = ...,\n) -> BufferedRandom: ...\n@overload\ndef fdopen(\n fd: int,\n mode: OpenBinaryModeWriting,\n buffering: Literal[-1, 1] = ...,\n encoding: None = ...,\n errors: None = ...,\n newline: None = ...,\n closefd: bool = ...,\n opener: Optional[_Opener] = ...,\n) -> BufferedWriter: ...\n@overload\ndef fdopen(\n fd: int,\n mode: OpenBinaryModeReading,\n buffering: Literal[-1, 1] = ...,\n encoding: None = ...,\n errors: None = ...,\n newline: None = ...,\n closefd: bool = ...,\n opener: Optional[_Opener] = ...,\n) -> BufferedReader: ...\n@overload\ndef fdopen(\n fd: int,\n mode: OpenBinaryMode,\n buffering: int,\n encoding: None = ...,\n errors: None = ...,\n newline: None = ...,\n closefd: bool = ...,\n opener: Optional[_Opener] = ...,\n) -> BinaryIO: ...\n@overload\ndef fdopen(\n fd: int,\n mode: str,\n buffering: int = ...,\n encoding: Optional[str] = ...,\n errors: Optional[str] = ...,\n newline: Optional[str] = ...,\n closefd: bool = ...,\n opener: Optional[_Opener] = ...,\n) -> IO[Any]: ...\ndef close(fd: int) -> None: ...\ndef closerange(__fd_low: int, __fd_high: int) -> None: ...\ndef device_encoding(fd: int) -> Optional[str]: ...\ndef dup(__fd: int) -> int: ...\n\nif sys.version_info >= (3, 7):\n def dup2(fd: int, fd2: int, inheritable: bool = ...) -> int: ...\n\nelse:\n def dup2(fd: int, fd2: int, inheritable: bool = ...) -> None: ...\n\ndef fstat(fd: int) -> stat_result: ...\ndef fsync(fd: FileDescriptorLike) -> None: ...\ndef lseek(__fd: int, __position: int, __how: int) -> int: ...\ndef open(path: AnyPath, flags: int, mode: int = ..., *, dir_fd: Optional[int] = ...) -> int: ...\ndef pipe() -> Tuple[int, int]: ...\ndef read(__fd: int, __length: int) -> bytes: ...\n\nif sys.platform != "win32":\n # Unix only\n def fchmod(fd: int, mode: int) -> None: ...\n def fchown(fd: int, uid: int, gid: int) -> None: ...\n if sys.platform != "darwin":\n def fdatasync(fd: FileDescriptorLike) -> None: ... # Unix only, not Mac\n def fpathconf(__fd: int, __name: Union[str, int]) -> int: ...\n def fstatvfs(__fd: int) -> statvfs_result: ...\n def ftruncate(__fd: int, __length: int) -> None: ...\n def get_blocking(__fd: int) -> bool: ...\n def set_blocking(__fd: int, __blocking: bool) -> None: ...\n def isatty(__fd: int) -> bool: ...\n def lockf(__fd: int, __command: int, __length: int) -> None: ...\n def openpty() -> Tuple[int, int]: ... # some flavors of Unix\n if sys.platform != "darwin":\n def pipe2(flags: int) -> Tuple[int, int]: ... # some flavors of Unix\n def posix_fallocate(fd: int, offset: int, length: int) -> None: ...\n def posix_fadvise(fd: int, offset: int, length: int, advice: int) -> None: ...\n def pread(__fd: int, __length: int, __offset: int) -> bytes: ...\n def pwrite(__fd: int, __buffer: bytes, __offset: int) -> int: ...\n @overload\n def sendfile(__out_fd: int, __in_fd: int, offset: Optional[int], count: int) -> int: ...\n @overload\n def sendfile(\n __out_fd: int,\n __in_fd: int,\n offset: int,\n count: int,\n headers: Sequence[bytes] = ...,\n trailers: Sequence[bytes] = ...,\n flags: int = ...,\n ) -> int: ... # FreeBSD and Mac OS X only\n def readv(__fd: int, __buffers: Sequence[bytearray]) -> int: ...\n def writev(__fd: int, __buffers: Sequence[bytes]) -> int: ...\n\nclass terminal_size(Tuple[int, int]):\n columns: int\n lines: int\n\ndef get_terminal_size(fd: int = ...) -> terminal_size: ...\ndef get_inheritable(__fd: int) -> bool: ...\ndef set_inheritable(__fd: int, __inheritable: bool) -> None: ...\n\nif sys.platform != "win32":\n # Unix only\n def tcgetpgrp(__fd: int) -> int: ...\n def tcsetpgrp(__fd: int, __pgid: int) -> None: ...\n def ttyname(__fd: int) -> str: ...\n\ndef write(__fd: int, __data: bytes) -> int: ...\ndef access(\n path: _FdOrAnyPath, mode: int, *, dir_fd: Optional[int] = ..., effective_ids: bool = ..., follow_symlinks: bool = ...\n) -> bool: ...\ndef chdir(path: _FdOrAnyPath) -> None: ...\n\nif sys.platform != "win32":\n def fchdir(fd: FileDescriptorLike) -> None: ...\n\ndef getcwd() -> str: ...\ndef getcwdb() -> bytes: ...\ndef chmod(path: _FdOrAnyPath, mode: int, *, dir_fd: Optional[int] = ..., follow_symlinks: bool = ...) -> None: ...\n\nif sys.platform != "win32":\n def chflags(path: AnyPath, flags: int, follow_symlinks: bool = ...) -> None: ... # some flavors of Unix\n def chown(\n path: _FdOrAnyPath, uid: int, gid: int, *, dir_fd: Optional[int] = ..., follow_symlinks: bool = ...\n ) -> None: ... # Unix only\n\nif sys.platform != "win32":\n # Unix only\n def chroot(path: AnyPath) -> None: ...\n def lchflags(path: AnyPath, flags: int) -> None: ...\n def lchmod(path: AnyPath, mode: int) -> None: ...\n def lchown(path: AnyPath, uid: int, gid: int) -> None: ...\n\ndef link(\n src: AnyPath, dst: AnyPath, *, src_dir_fd: Optional[int] = ..., dst_dir_fd: Optional[int] = ..., follow_symlinks: bool = ...\n) -> None: ...\ndef lstat(path: AnyPath, *, dir_fd: Optional[int] = ...) -> stat_result: ...\ndef mkdir(path: AnyPath, mode: int = ..., *, dir_fd: Optional[int] = ...) -> None: ...\n\nif sys.platform != "win32":\n def mkfifo(path: AnyPath, mode: int = ..., *, dir_fd: Optional[int] = ...) -> None: ... # Unix only\n\ndef makedirs(name: AnyPath, mode: int = ..., exist_ok: bool = ...) -> None: ...\n\nif sys.platform != "win32":\n def mknod(path: AnyPath, mode: int = ..., device: int = ..., *, dir_fd: Optional[int] = ...) -> None: ...\n def major(__device: int) -> int: ...\n def minor(__device: int) -> int: ...\n def makedev(__major: int, __minor: int) -> int: ...\n def pathconf(path: _FdOrAnyPath, name: Union[str, int]) -> int: ... # Unix only\n\ndef readlink(path: Union[AnyStr, PathLike[AnyStr]], *, dir_fd: Optional[int] = ...) -> AnyStr: ...\ndef remove(path: AnyPath, *, dir_fd: Optional[int] = ...) -> None: ...\ndef removedirs(name: AnyPath) -> None: ...\ndef rename(src: AnyPath, dst: AnyPath, *, src_dir_fd: Optional[int] = ..., dst_dir_fd: Optional[int] = ...) -> None: ...\ndef renames(old: AnyPath, new: AnyPath) -> None: ...\ndef replace(src: AnyPath, dst: AnyPath, *, src_dir_fd: Optional[int] = ..., dst_dir_fd: Optional[int] = ...) -> None: ...\ndef rmdir(path: AnyPath, *, dir_fd: Optional[int] = ...) -> None: ...\n\nclass _ScandirIterator(Iterator[DirEntry[AnyStr]], ContextManager[_ScandirIterator[AnyStr]]):\n def __next__(self) -> DirEntry[AnyStr]: ...\n def close(self) -> None: ...\n\nif sys.version_info >= (3, 7):\n @overload\n def scandir(path: None = ...) -> _ScandirIterator[str]: ...\n @overload\n def scandir(path: int) -> _ScandirIterator[str]: ...\n @overload\n def scandir(path: Union[AnyStr, PathLike[AnyStr]]) -> _ScandirIterator[AnyStr]: ...\n\nelse:\n @overload\n def scandir(path: None = ...) -> _ScandirIterator[str]: ...\n @overload\n def scandir(path: Union[AnyStr, PathLike[AnyStr]]) -> _ScandirIterator[AnyStr]: ...\n\ndef stat(path: _FdOrAnyPath, *, dir_fd: Optional[int] = ..., follow_symlinks: bool = ...) -> stat_result: ...\n\nif sys.version_info < (3, 7):\n @overload\n def stat_float_times() -> bool: ...\n @overload\n def stat_float_times(__newvalue: bool) -> None: ...\n\nif sys.platform != "win32":\n def statvfs(path: _FdOrAnyPath) -> statvfs_result: ... # Unix only\n\ndef symlink(src: AnyPath, dst: AnyPath, target_is_directory: bool = ..., *, dir_fd: Optional[int] = ...) -> None: ...\n\nif sys.platform != "win32":\n def sync() -> None: ... # Unix only\n\ndef truncate(path: _FdOrAnyPath, length: int) -> None: ... # Unix only up to version 3.4\ndef unlink(path: AnyPath, *, dir_fd: Optional[int] = ...) -> None: ...\ndef utime(\n path: _FdOrAnyPath,\n times: Optional[Union[Tuple[int, int], Tuple[float, float]]] = ...,\n *,\n ns: Tuple[int, int] = ...,\n dir_fd: Optional[int] = ...,\n follow_symlinks: bool = ...,\n) -> None: ...\n\n_OnError = Callable[[OSError], Any]\n\ndef walk(\n top: Union[AnyStr, PathLike[AnyStr]], topdown: bool = ..., onerror: Optional[_OnError] = ..., followlinks: bool = ...\n) -> Iterator[Tuple[AnyStr, List[AnyStr], List[AnyStr]]]: ...\n\nif sys.platform != "win32":\n if sys.version_info >= (3, 7):\n @overload\n def fwalk(\n top: Union[str, PathLike[str]] = ...,\n topdown: bool = ...,\n onerror: Optional[_OnError] = ...,\n *,\n follow_symlinks: bool = ...,\n dir_fd: Optional[int] = ...,\n ) -> Iterator[Tuple[str, List[str], List[str], int]]: ...\n @overload\n def fwalk(\n top: bytes,\n topdown: bool = ...,\n onerror: Optional[_OnError] = ...,\n *,\n follow_symlinks: bool = ...,\n dir_fd: Optional[int] = ...,\n ) -> Iterator[Tuple[bytes, List[bytes], List[bytes], int]]: ...\n else:\n def fwalk(\n top: Union[str, PathLike[str]] = ...,\n topdown: bool = ...,\n onerror: Optional[_OnError] = ...,\n *,\n follow_symlinks: bool = ...,\n dir_fd: Optional[int] = ...,\n ) -> Iterator[Tuple[str, List[str], List[str], int]]: ...\n if sys.platform == "linux":\n def getxattr(path: _FdOrAnyPath, attribute: AnyPath, *, follow_symlinks: bool = ...) -> bytes: ...\n def listxattr(path: _FdOrAnyPath, *, follow_symlinks: bool = ...) -> List[str]: ...\n def removexattr(path: _FdOrAnyPath, attribute: AnyPath, *, follow_symlinks: bool = ...) -> None: ...\n def setxattr(\n path: _FdOrAnyPath, attribute: AnyPath, value: bytes, flags: int = ..., *, follow_symlinks: bool = ...\n ) -> None: ...\n\ndef abort() -> NoReturn: ...\n\n# These are defined as execl(file, *args) but the first *arg is mandatory.\ndef execl(file: AnyPath, __arg0: AnyPath, *args: AnyPath) -> NoReturn: ...\ndef execlp(file: AnyPath, __arg0: AnyPath, *args: AnyPath) -> NoReturn: ...\n\n# These are: execle(file, *args, env) but env is pulled from the last element of the args.\ndef execle(file: AnyPath, __arg0: AnyPath, *args: Any) -> NoReturn: ...\ndef execlpe(file: AnyPath, __arg0: AnyPath, *args: Any) -> NoReturn: ...\n\n# The docs say `args: tuple or list of strings`\n# The implementation enforces tuple or list so we can't use Sequence.\n# Not separating out PathLike[str] and PathLike[bytes] here because it doesn't make much difference\n# in practice, and doing so would explode the number of combinations in this already long union.\n# All these combinations are necessary due to List being invariant.\n_ExecVArgs = Union[\n Tuple[AnyPath, ...],\n List[bytes],\n List[str],\n List[PathLike[Any]],\n List[Union[bytes, str]],\n List[Union[bytes, PathLike[Any]]],\n List[Union[str, PathLike[Any]]],\n List[Union[bytes, str, PathLike[Any]]],\n]\n_ExecEnv = Union[Mapping[bytes, Union[bytes, str]], Mapping[str, Union[bytes, str]]]\n\ndef execv(__path: AnyPath, __argv: _ExecVArgs) -> NoReturn: ...\ndef execve(path: _FdOrAnyPath, argv: _ExecVArgs, env: _ExecEnv) -> NoReturn: ...\ndef execvp(file: AnyPath, args: _ExecVArgs) -> NoReturn: ...\ndef execvpe(file: AnyPath, args: _ExecVArgs, env: _ExecEnv) -> NoReturn: ...\ndef _exit(status: int) -> NoReturn: ...\ndef kill(__pid: int, __signal: int) -> None: ...\n\nif sys.platform != "win32":\n # Unix only\n def fork() -> int: ...\n def forkpty() -> Tuple[int, int]: ... # some flavors of Unix\n def killpg(__pgid: int, __signal: int) -> None: ...\n def nice(__increment: int) -> int: ...\n if sys.platform != "darwin":\n def plock(op: int) -> None: ... # ???op is int?\n\nclass _wrap_close(_TextIOWrapper):\n def close(self) -> Optional[int]: ... # type: ignore\n\ndef popen(cmd: str, mode: str = ..., buffering: int = ...) -> _wrap_close: ...\ndef spawnl(mode: int, file: AnyPath, arg0: AnyPath, *args: AnyPath) -> int: ...\ndef spawnle(mode: int, file: AnyPath, arg0: AnyPath, *args: Any) -> int: ... # Imprecise sig\n\nif sys.platform != "win32":\n def spawnv(mode: int, file: AnyPath, args: _ExecVArgs) -> int: ...\n def spawnve(mode: int, file: AnyPath, args: _ExecVArgs, env: _ExecEnv) -> int: ...\n\nelse:\n def spawnv(__mode: int, __path: AnyPath, __argv: _ExecVArgs) -> int: ...\n def spawnve(__mode: int, __path: AnyPath, __argv: _ExecVArgs, __env: _ExecEnv) -> int: ...\n\ndef system(command: AnyPath) -> int: ...\ndef times() -> times_result: ...\ndef waitpid(__pid: int, __options: int) -> Tuple[int, int]: ...\n\nif sys.platform == "win32":\n def startfile(path: AnyPath, operation: Optional[str] = ...) -> None: ...\n\nelse:\n # Unix only\n def spawnlp(mode: int, file: AnyPath, arg0: AnyPath, *args: AnyPath) -> int: ...\n def spawnlpe(mode: int, file: AnyPath, arg0: AnyPath, *args: Any) -> int: ... # Imprecise signature\n def spawnvp(mode: int, file: AnyPath, args: _ExecVArgs) -> int: ...\n def spawnvpe(mode: int, file: AnyPath, args: _ExecVArgs, env: _ExecEnv) -> int: ...\n def wait() -> Tuple[int, int]: ... # Unix only\n from posix import waitid_result\n def waitid(idtype: int, ident: int, options: int) -> waitid_result: ...\n def wait3(options: int) -> Tuple[int, int, Any]: ...\n def wait4(pid: int, options: int) -> Tuple[int, int, Any]: ...\n def WCOREDUMP(__status: int) -> bool: ...\n def WIFCONTINUED(status: int) -> bool: ...\n def WIFSTOPPED(status: int) -> bool: ...\n def WIFSIGNALED(status: int) -> bool: ...\n def WIFEXITED(status: int) -> bool: ...\n def WEXITSTATUS(status: int) -> int: ...\n def WSTOPSIG(status: int) -> int: ...\n def WTERMSIG(status: int) -> int: ...\n\nif sys.platform != "win32":\n from posix import sched_param\n def sched_get_priority_min(policy: int) -> int: ... # some flavors of Unix\n def sched_get_priority_max(policy: int) -> int: ... # some flavors of Unix\n def sched_setscheduler(pid: int, policy: int, param: sched_param) -> None: ... # some flavors of Unix\n def sched_getscheduler(pid: int) -> int: ... # some flavors of Unix\n def sched_setparam(pid: int, param: sched_param) -> None: ... # some flavors of Unix\n def sched_getparam(pid: int) -> sched_param: ... # some flavors of Unix\n def sched_rr_get_interval(pid: int) -> float: ... # some flavors of Unix\n def sched_yield() -> None: ... # some flavors of Unix\n def sched_setaffinity(pid: int, mask: Iterable[int]) -> None: ... # some flavors of Unix\n def sched_getaffinity(pid: int) -> Set[int]: ... # some flavors of Unix\n\ndef cpu_count() -> Optional[int]: ...\n\nif sys.platform != "win32":\n # Unix only\n def confstr(__name: Union[str, int]) -> Optional[str]: ...\n def getloadavg() -> Tuple[float, float, float]: ...\n def sysconf(__name: Union[str, int]) -> int: ...\n\nif sys.platform == "linux":\n def getrandom(size: int, flags: int = ...) -> bytes: ...\n\ndef urandom(__size: int) -> bytes: ...\n\nif sys.version_info >= (3, 7) and sys.platform != "win32":\n def register_at_fork(\n *,\n before: Optional[Callable[..., Any]] = ...,\n after_in_parent: Optional[Callable[..., Any]] = ...,\n after_in_child: Optional[Callable[..., Any]] = ...,\n ) -> None: ...\n\nif sys.version_info >= (3, 8):\n if sys.platform == "win32":\n class _AddedDllDirectory:\n path: Optional[str]\n def __init__(self, path: Optional[str], cookie: _T, remove_dll_directory: Callable[[_T], Any]) -> None: ...\n def close(self) -> None: ...\n def __enter__(self: _T) -> _T: ...\n def __exit__(self, *args: Any) -> None: ...\n def add_dll_directory(path: str) -> _AddedDllDirectory: ...\n if sys.platform == "linux":\n MFD_CLOEXEC: int\n MFD_ALLOW_SEALING: int\n MFD_HUGETLB: int\n MFD_HUGE_SHIFT: int\n MFD_HUGE_MASK: int\n MFD_HUGE_64KB: int\n MFD_HUGE_512KB: int\n MFD_HUGE_1MB: int\n MFD_HUGE_2MB: int\n MFD_HUGE_8MB: int\n MFD_HUGE_16MB: int\n MFD_HUGE_32MB: int\n MFD_HUGE_256MB: int\n MFD_HUGE_512MB: int\n MFD_HUGE_1GB: int\n MFD_HUGE_2GB: int\n MFD_HUGE_16GB: int\n def memfd_create(name: str, flags: int = ...) -> int: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\os\__init__.pyi | __init__.pyi | Other | 28,846 | 0.95 | 0.362214 | 0.058583 | vue-tools | 236 | 2024-09-11T12:11:33.705169 | BSD-3-Clause | false | 44abac18ae4dbd23f78045d2bfcbc43f |
from typing import Any, Mapping, Optional\n\nclass Dialog:\n command: Optional[Any] = ...\n master: Optional[Any] = ...\n options: Mapping[str, Any] = ...\n def __init__(self, master: Optional[Any] = ..., **options) -> None: ...\n def show(self, **options) -> Any: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\tkinter\commondialog.pyi | commondialog.pyi | Other | 277 | 0.85 | 0.375 | 0 | vue-tools | 384 | 2025-01-21T03:13:12.619975 | MIT | false | d3ae731449121e55f6ad880dd7829181 |
from typing_extensions import Literal\n\n# These are not actually bools. See #4669\nNO: bool\nYES: bool\nTRUE: bool\nFALSE: bool\nON: bool\nOFF: bool\nN: Literal["n"]\nS: Literal["s"]\nW: Literal["w"]\nE: Literal["e"]\nNW: Literal["nw"]\nSW: Literal["sw"]\nNE: Literal["ne"]\nSE: Literal["se"]\nNS: Literal["ns"]\nEW: Literal["ew"]\nNSEW: Literal["nsew"]\nCENTER: Literal["center"]\nNONE: Literal["none"]\nX: Literal["x"]\nY: Literal["y"]\nBOTH: Literal["both"]\nLEFT: Literal["left"]\nTOP: Literal["top"]\nRIGHT: Literal["right"]\nBOTTOM: Literal["bottom"]\nRAISED: Literal["raised"]\nSUNKEN: Literal["sunken"]\nFLAT: Literal["flat"]\nRIDGE: Literal["ridge"]\nGROOVE: Literal["groove"]\nSOLID: Literal["solid"]\nHORIZONTAL: Literal["horizontal"]\nVERTICAL: Literal["vertical"]\nNUMERIC: Literal["numeric"]\nCHAR: Literal["char"]\nWORD: Literal["word"]\nBASELINE: Literal["baseline"]\nINSIDE: Literal["inside"]\nOUTSIDE: Literal["outside"]\nSEL: Literal["sel"]\nSEL_FIRST: Literal["sel.first"]\nSEL_LAST: Literal["sel.last"]\nEND: Literal["end"]\nINSERT: Literal["insert"]\nCURRENT: Literal["current"]\nANCHOR: Literal["anchor"]\nALL: Literal["all"]\nNORMAL: Literal["normal"]\nDISABLED: Literal["disabled"]\nACTIVE: Literal["active"]\nHIDDEN: Literal["hidden"]\nCASCADE: Literal["cascade"]\nCHECKBUTTON: Literal["checkbutton"]\nCOMMAND: Literal["command"]\nRADIOBUTTON: Literal["radiobutton"]\nSEPARATOR: Literal["separator"]\nSINGLE: Literal["single"]\nBROWSE: Literal["browse"]\nMULTIPLE: Literal["multiple"]\nEXTENDED: Literal["extended"]\nDOTBOX: Literal["dotbox"]\nUNDERLINE: Literal["underline"]\nPIESLICE: Literal["pieslice"]\nCHORD: Literal["chord"]\nARC: Literal["arc"]\nFIRST: Literal["first"]\nLAST: Literal["last"]\nBUTT: Literal["butt"]\nPROJECTING: Literal["projecting"]\nROUND: Literal["round"]\nBEVEL: Literal["bevel"]\nMITER: Literal["miter"]\nMOVETO: Literal["moveto"]\nSCROLL: Literal["scroll"]\nUNITS: Literal["units"]\nPAGES: Literal["pages"]\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\tkinter\constants.pyi | constants.pyi | Other | 1,886 | 0.95 | 0 | 0.012658 | awesome-app | 976 | 2024-12-18T11:06:31.220956 | Apache-2.0 | false | d3bcbac5d960afdfa435f93ac7a3b707 |
from tkinter import Widget\nfrom typing import Any, Mapping, Optional\n\nDIALOG_ICON: str\n\nclass Dialog(Widget):\n widgetName: str = ...\n num: int = ...\n def __init__(self, master: Optional[Any] = ..., cnf: Mapping[str, Any] = ..., **kw) -> None: ...\n def destroy(self) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\tkinter\dialog.pyi | dialog.pyi | Other | 291 | 0.85 | 0.3 | 0 | python-kit | 209 | 2025-04-27T10:36:21.446060 | GPL-3.0 | false | f25b9a666199a8b26b12849d90a4500c |
from tkinter import Button, Entry, Frame, Listbox, Scrollbar, Toplevel, commondialog\nfrom typing import Any, Dict, Optional, Tuple\n\ndialogstates: Dict[Any, Tuple[Any, Any]]\n\nclass FileDialog:\n title: str = ...\n master: Any = ...\n directory: Optional[Any] = ...\n top: Toplevel = ...\n botframe: Frame = ...\n selection: Entry = ...\n filter: Entry = ...\n midframe: Entry = ...\n filesbar: Scrollbar = ...\n files: Listbox = ...\n dirsbar: Scrollbar = ...\n dirs: Listbox = ...\n ok_button: Button = ...\n filter_button: Button = ...\n cancel_button: Button = ...\n def __init__(\n self, master, title: Optional[Any] = ...\n ) -> None: ... # title is usually a str or None, but e.g. int doesn't raise en exception either\n how: Optional[Any] = ...\n def go(self, dir_or_file: Any = ..., pattern: str = ..., default: str = ..., key: Optional[Any] = ...): ...\n def quit(self, how: Optional[Any] = ...) -> None: ...\n def dirs_double_event(self, event) -> None: ...\n def dirs_select_event(self, event) -> None: ...\n def files_double_event(self, event) -> None: ...\n def files_select_event(self, event) -> None: ...\n def ok_event(self, event) -> None: ...\n def ok_command(self) -> None: ...\n def filter_command(self, event: Optional[Any] = ...) -> None: ...\n def get_filter(self): ...\n def get_selection(self): ...\n def cancel_command(self, event: Optional[Any] = ...) -> None: ...\n def set_filter(self, dir, pat) -> None: ...\n def set_selection(self, file) -> None: ...\n\nclass LoadFileDialog(FileDialog):\n title: str = ...\n def ok_command(self) -> None: ...\n\nclass SaveFileDialog(FileDialog):\n title: str = ...\n def ok_command(self): ...\n\nclass _Dialog(commondialog.Dialog): ...\n\nclass Open(_Dialog):\n command: str = ...\n\nclass SaveAs(_Dialog):\n command: str = ...\n\nclass Directory(commondialog.Dialog):\n command: str = ...\n\ndef askopenfilename(**options): ...\ndef asksaveasfilename(**options): ...\ndef askopenfilenames(**options): ...\ndef askopenfile(mode: str = ..., **options): ...\ndef askopenfiles(mode: str = ..., **options): ...\ndef asksaveasfile(mode: str = ..., **options): ...\ndef askdirectory(**options): ...\ndef test() -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\tkinter\filedialog.pyi | filedialog.pyi | Other | 2,247 | 0.95 | 0.477612 | 0 | vue-tools | 463 | 2025-04-26T05:10:47.189833 | MIT | false | 47afc5bce2e6a3aa9fcce3fe5db836a1 |
import tkinter\nfrom typing import Any, List, Optional, Tuple, TypeVar, Union, overload\nfrom typing_extensions import Literal, TypedDict\n\nNORMAL: Literal["normal"]\nROMAN: Literal["roman"]\nBOLD: Literal["bold"]\nITALIC: Literal["italic"]\n\ndef nametofont(name: str) -> Font: ...\n\n# See 'FONT DESCRIPTIONS' in font man page. This uses str because Literal\n# inside Tuple doesn't work.\n_FontDescription = Union[str, Font, Tuple[str, int], Tuple[str, int, str], Tuple[str, int, tkinter._TkinterSequence[str]]]\n\nclass _FontDict(TypedDict):\n family: str\n size: int\n weight: Literal["normal", "bold"]\n slant: Literal["roman", "italic"]\n underline: Literal[0, 1]\n overstrike: Literal[0, 1]\n\nclass _MetricsDict(TypedDict):\n ascent: int\n descent: int\n linespace: int\n fixed: Literal[0, 1]\n\nclass Font:\n name: str\n delete_font: bool\n def __init__(\n self,\n # In tkinter, 'root' refers to tkinter.Tk by convention, but the code\n # actually works with any tkinter widget so we use tkinter.Misc.\n root: Optional[tkinter.Misc] = ...,\n font: Optional[_FontDescription] = ...,\n name: Optional[str] = ...,\n exists: bool = ...,\n *,\n family: str = ...,\n size: int = ...,\n weight: Literal["normal", "bold"] = ...,\n slant: Literal["roman", "italic"] = ...,\n underline: bool = ...,\n overstrike: bool = ...,\n ) -> None: ...\n def __getitem__(self, key: str) -> Any: ...\n def __setitem__(self, key: str, value: Any) -> None: ...\n @overload\n def cget(self, option: Literal["family"]) -> str: ...\n @overload\n def cget(self, option: Literal["size"]) -> int: ...\n @overload\n def cget(self, option: Literal["weight"]) -> Literal["normal", "bold"]: ...\n @overload\n def cget(self, option: Literal["slant"]) -> Literal["roman", "italic"]: ...\n @overload\n def cget(self, option: Literal["underline", "overstrike"]) -> Literal[0, 1]: ...\n @overload\n def actual(self, option: Literal["family"], displayof: Optional[tkinter.Misc] = ...) -> str: ...\n @overload\n def actual(self, option: Literal["size"], displayof: Optional[tkinter.Misc] = ...) -> int: ...\n @overload\n def actual(self, option: Literal["weight"], displayof: Optional[tkinter.Misc] = ...) -> Literal["normal", "bold"]: ...\n @overload\n def actual(self, option: Literal["slant"], displayof: Optional[tkinter.Misc] = ...) -> Literal["roman", "italic"]: ...\n @overload\n def actual(self, option: Literal["underline", "overstrike"], displayof: Optional[tkinter.Misc] = ...) -> Literal[0, 1]: ...\n @overload\n def actual(self, option: None, displayof: Optional[tkinter.Misc] = ...) -> _FontDict: ...\n @overload\n def actual(self, *, displayof: Optional[tkinter.Misc] = ...) -> _FontDict: ...\n def config(\n self,\n *,\n family: str = ...,\n size: int = ...,\n weight: Literal["normal", "bold"] = ...,\n slant: Literal["roman", "italic"] = ...,\n underline: bool = ...,\n overstrike: bool = ...,\n ) -> Optional[_FontDict]: ...\n configure = config\n def copy(self) -> Font: ...\n @overload\n def metrics(self, __option: Literal["ascent", "descent", "linespace"], *, displayof: Optional[tkinter.Misc] = ...) -> int: ...\n @overload\n def metrics(self, __option: Literal["fixed"], *, displayof: Optional[tkinter.Misc] = ...) -> Literal[0, 1]: ...\n @overload\n def metrics(self, *, displayof: Optional[tkinter.Misc] = ...) -> _MetricsDict: ...\n def measure(self, text: str, displayof: Optional[tkinter.Misc] = ...) -> int: ...\n\ndef families(root: Optional[tkinter.Misc] = ..., displayof: Optional[tkinter.Misc] = ...) -> Tuple[str, ...]: ...\ndef names(root: Optional[tkinter.Misc] = ...) -> Tuple[str, ...]: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\tkinter\font.pyi | font.pyi | Other | 3,812 | 0.95 | 0.28125 | 0.067416 | vue-tools | 475 | 2023-07-18T03:43:28.016031 | MIT | false | 0984152d8e2670f5356f4444686bc34d |
from tkinter.commondialog import Dialog\nfrom typing import Any, Optional\n\nERROR: str\nINFO: str\nQUESTION: str\nWARNING: str\nABORTRETRYIGNORE: str\nOK: str\nOKCANCEL: str\nRETRYCANCEL: str\nYESNO: str\nYESNOCANCEL: str\nABORT: str\nRETRY: str\nIGNORE: str\nCANCEL: str\nYES: str\nNO: str\n\nclass Message(Dialog):\n command: str = ...\n\ndef showinfo(title: Optional[str] = ..., message: Optional[str] = ..., **options: Any) -> str: ...\ndef showwarning(title: Optional[str] = ..., message: Optional[str] = ..., **options: Any) -> str: ...\ndef showerror(title: Optional[str] = ..., message: Optional[str] = ..., **options: Any) -> str: ...\ndef askquestion(title: Optional[str] = ..., message: Optional[str] = ..., **options: Any) -> str: ...\ndef askokcancel(title: Optional[str] = ..., message: Optional[str] = ..., **options: Any) -> bool: ...\ndef askyesno(title: Optional[str] = ..., message: Optional[str] = ..., **options: Any) -> bool: ...\ndef askyesnocancel(title: Optional[str] = ..., message: Optional[str] = ..., **options: Any) -> Optional[bool]: ...\ndef askretrycancel(title: Optional[str] = ..., message: Optional[str] = ..., **options: Any) -> bool: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\tkinter\messagebox.pyi | messagebox.pyi | Other | 1,150 | 0.85 | 0.290323 | 0 | node-utils | 633 | 2025-05-26T04:50:40.769943 | GPL-3.0 | false | ff1bdea55c56f8dffabe56d854493b92 |
import _tkinter\nimport sys\nimport tkinter\nfrom tkinter.font import _FontDescription\nfrom typing import Any, Callable, Dict, List, Optional, Tuple, Union, overload\nfrom typing_extensions import Literal\n\ndef tclobjs_to_py(adict): ...\ndef setup_master(master: Optional[Any] = ...): ...\n\n# from ttk_widget (aka ttk::widget) manual page, differs from tkinter._Compound\n_TtkCompound = Literal["text", "image", tkinter._Compound]\n\nclass Style:\n master: Any\n tk: _tkinter.TkappType\n def __init__(self, master: Optional[Any] = ...): ...\n def configure(self, style, query_opt: Optional[Any] = ..., **kw): ...\n def map(self, style, query_opt: Optional[Any] = ..., **kw): ...\n def lookup(self, style, option, state: Optional[Any] = ..., default: Optional[Any] = ...): ...\n def layout(self, style, layoutspec: Optional[Any] = ...): ...\n def element_create(self, elementname, etype, *args, **kw): ...\n def element_names(self): ...\n def element_options(self, elementname): ...\n def theme_create(self, themename, parent: Optional[Any] = ..., settings: Optional[Any] = ...): ...\n def theme_settings(self, themename, settings): ...\n def theme_names(self): ...\n def theme_use(self, themename: Optional[Any] = ...): ...\n\nclass Widget(tkinter.Widget):\n def __init__(self, master: Optional[tkinter.Misc], widgetname, kw: Optional[Any] = ...): ...\n def identify(self, x, y): ...\n def instate(self, statespec, callback: Optional[Any] = ..., *args, **kw): ...\n def state(self, statespec: Optional[Any] = ...): ...\n\n_ButtonOptionName = Literal[\n "class",\n "command",\n "compound",\n "cursor",\n "default",\n "image",\n "padding",\n "state",\n "style",\n "takefocus",\n "text",\n "textvariable",\n "underline",\n "width",\n]\n\nclass Button(Widget):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n command: tkinter._ButtonCommand = ...,\n compound: _TtkCompound = ...,\n cursor: tkinter._Cursor = ...,\n default: Literal["normal", "active", "disabled"] = ...,\n image: tkinter._ImageSpec = ...,\n name: str = ...,\n padding: Any = ..., # undocumented\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n textvariable: tkinter.Variable = ...,\n underline: int = ...,\n width: Union[int, Literal[""]] = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n command: tkinter._ButtonCommand = ...,\n compound: _TtkCompound = ...,\n cursor: tkinter._Cursor = ...,\n default: Literal["normal", "active", "disabled"] = ...,\n image: tkinter._ImageSpec = ...,\n padding: Any = ...,\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n textvariable: tkinter.Variable = ...,\n underline: int = ...,\n width: Union[int, Literal[""]] = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _ButtonOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _ButtonOptionName) -> Any: ...\n def invoke(self): ...\n\n_CheckbuttonOptionName = Literal[\n "class",\n "command",\n "compound",\n "cursor",\n "image",\n "offvalue",\n "onvalue",\n "padding",\n "state",\n "style",\n "takefocus",\n "text",\n "textvariable",\n "underline",\n "variable",\n "width",\n]\n\nclass Checkbutton(Widget):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n command: tkinter._ButtonCommand = ...,\n compound: _TtkCompound = ...,\n cursor: tkinter._Cursor = ...,\n image: tkinter._ImageSpec = ...,\n name: str = ...,\n offvalue: Any = ...,\n onvalue: Any = ...,\n padding: Any = ..., # undocumented\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n textvariable: tkinter.Variable = ...,\n underline: int = ...,\n # Seems like variable can be empty string, but actually setting it to\n # empty string segfaults before Tcl 8.6.9. Search for ttk::checkbutton\n # here: https://sourceforge.net/projects/tcl/files/Tcl/8.6.9/tcltk-release-notes-8.6.9.txt/view\n variable: tkinter.Variable = ...,\n width: Union[int, Literal[""]] = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n command: tkinter._ButtonCommand = ...,\n compound: _TtkCompound = ...,\n cursor: tkinter._Cursor = ...,\n image: tkinter._ImageSpec = ...,\n offvalue: Any = ...,\n onvalue: Any = ...,\n padding: Any = ...,\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n textvariable: tkinter.Variable = ...,\n underline: int = ...,\n variable: tkinter.Variable = ...,\n width: Union[int, Literal[""]] = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _CheckbuttonOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _CheckbuttonOptionName) -> Any: ...\n def invoke(self): ...\n\n_EntryOptionName = Literal[\n "background",\n "class",\n "cursor",\n "exportselection",\n "font",\n "foreground",\n "invalidcommand",\n "justify",\n "show",\n "state",\n "style",\n "takefocus",\n "textvariable",\n "validate",\n "validatecommand",\n "width",\n "xscrollcommand",\n]\n\nclass Entry(Widget, tkinter.Entry):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n widget: Optional[str] = ...,\n *,\n background: tkinter._Color = ..., # undocumented\n class_: str = ...,\n cursor: tkinter._Cursor = ...,\n exportselection: bool = ...,\n font: _FontDescription = ...,\n foreground: tkinter._Color = ...,\n invalidcommand: tkinter._EntryValidateCommand = ...,\n justify: Literal["left", "center", "right"] = ...,\n name: str = ...,\n show: str = ...,\n state: Literal["normal", "disabled", "readonly"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n textvariable: tkinter.Variable = ...,\n validate: Literal["none", "focus", "focusin", "focusout", "key", "all"] = ...,\n validatecommand: tkinter._EntryValidateCommand = ...,\n width: int = ...,\n xscrollcommand: tkinter._XYScrollCommand = ...,\n ) -> None: ...\n @overload # type: ignore\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n background: tkinter._Color = ...,\n cursor: tkinter._Cursor = ...,\n exportselection: bool = ...,\n font: _FontDescription = ...,\n foreground: tkinter._Color = ...,\n invalidcommand: tkinter._EntryValidateCommand = ...,\n justify: Literal["left", "center", "right"] = ...,\n show: str = ...,\n state: Literal["normal", "disabled", "readonly"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n textvariable: tkinter.Variable = ...,\n validate: Literal["none", "focus", "focusin", "focusout", "key", "all"] = ...,\n validatecommand: tkinter._EntryValidateCommand = ...,\n width: int = ...,\n xscrollcommand: tkinter._XYScrollCommand = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _EntryOptionName) -> Tuple[str, str, str, Any, Any]: ...\n # config must be copy/pasted, otherwise ttk.Entry().config is mypy error (don't know why)\n @overload # type: ignore\n def config(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n background: tkinter._Color = ...,\n cursor: tkinter._Cursor = ...,\n exportselection: bool = ...,\n font: _FontDescription = ...,\n foreground: tkinter._Color = ...,\n invalidcommand: tkinter._EntryValidateCommand = ...,\n justify: Literal["left", "center", "right"] = ...,\n show: str = ...,\n state: Literal["normal", "disabled", "readonly"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n textvariable: tkinter.Variable = ...,\n validate: Literal["none", "focus", "focusin", "focusout", "key", "all"] = ...,\n validatecommand: tkinter._EntryValidateCommand = ...,\n width: int = ...,\n xscrollcommand: tkinter._XYScrollCommand = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def config(self, cnf: _EntryOptionName) -> Tuple[str, str, str, Any, Any]: ...\n def cget(self, key: _EntryOptionName) -> Any: ... # type: ignore\n def bbox(self, index): ...\n def identify(self, x, y): ...\n def validate(self): ...\n\n_ComboboxOptionName = Literal[\n "background",\n "class",\n "cursor",\n "exportselection",\n "font",\n "foreground",\n "height",\n "invalidcommand",\n "justify",\n "postcommand",\n "show",\n "state",\n "style",\n "takefocus",\n "textvariable",\n "validate",\n "validatecommand",\n "values",\n "width",\n "xscrollcommand",\n]\n\nclass Combobox(Entry):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n background: tkinter._Color = ..., # undocumented\n class_: str = ...,\n cursor: tkinter._Cursor = ...,\n exportselection: bool = ...,\n font: _FontDescription = ..., # undocumented\n foreground: tkinter._Color = ..., # undocumented\n height: int = ...,\n invalidcommand: tkinter._EntryValidateCommand = ..., # undocumented\n justify: Literal["left", "center", "right"] = ...,\n name: str = ...,\n postcommand: Union[Callable[[], Any], str] = ...,\n show: Any = ..., # undocumented\n state: Literal["normal", "readonly", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n textvariable: tkinter.Variable = ...,\n validate: Literal["none", "focus", "focusin", "focusout", "key", "all"] = ..., # undocumented\n validatecommand: tkinter._EntryValidateCommand = ..., # undocumented\n values: tkinter._TkinterSequence[str] = ...,\n width: int = ...,\n xscrollcommand: tkinter._XYScrollCommand = ..., # undocumented\n ) -> None: ...\n @overload # type: ignore\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n background: tkinter._Color = ...,\n cursor: tkinter._Cursor = ...,\n exportselection: bool = ...,\n font: _FontDescription = ...,\n foreground: tkinter._Color = ...,\n height: int = ...,\n invalidcommand: tkinter._EntryValidateCommand = ...,\n justify: Literal["left", "center", "right"] = ...,\n postcommand: Union[Callable[[], Any], str] = ...,\n show: Any = ...,\n state: Literal["normal", "readonly", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n textvariable: tkinter.Variable = ...,\n validate: Literal["none", "focus", "focusin", "focusout", "key", "all"] = ...,\n validatecommand: tkinter._EntryValidateCommand = ...,\n values: tkinter._TkinterSequence[str] = ...,\n width: int = ...,\n xscrollcommand: tkinter._XYScrollCommand = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _ComboboxOptionName) -> Tuple[str, str, str, Any, Any]: ...\n # config must be copy/pasted, otherwise ttk.Combobox().config is mypy error (don't know why)\n @overload # type: ignore\n def config(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n background: tkinter._Color = ...,\n cursor: tkinter._Cursor = ...,\n exportselection: bool = ...,\n font: _FontDescription = ...,\n foreground: tkinter._Color = ...,\n height: int = ...,\n invalidcommand: tkinter._EntryValidateCommand = ...,\n justify: Literal["left", "center", "right"] = ...,\n postcommand: Union[Callable[[], Any], str] = ...,\n show: Any = ...,\n state: Literal["normal", "readonly", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n textvariable: tkinter.Variable = ...,\n validate: Literal["none", "focus", "focusin", "focusout", "key", "all"] = ...,\n validatecommand: tkinter._EntryValidateCommand = ...,\n values: tkinter._TkinterSequence[str] = ...,\n width: int = ...,\n xscrollcommand: tkinter._XYScrollCommand = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def config(self, cnf: _ComboboxOptionName) -> Tuple[str, str, str, Any, Any]: ...\n def cget(self, key: _ComboboxOptionName) -> Any: ... # type: ignore\n def current(self, newindex: Optional[Any] = ...): ...\n def set(self, value): ...\n\n_FrameOptionName = Literal[\n "border", "borderwidth", "class", "cursor", "height", "padding", "relief", "style", "takefocus", "width"\n]\n\nclass Frame(Widget):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n border: tkinter._ScreenUnits = ...,\n borderwidth: tkinter._ScreenUnits = ...,\n class_: str = ...,\n cursor: tkinter._Cursor = ...,\n height: tkinter._ScreenUnits = ...,\n name: str = ...,\n padding: tkinter._Padding = ...,\n relief: tkinter._Relief = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n width: tkinter._ScreenUnits = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n border: tkinter._ScreenUnits = ...,\n borderwidth: tkinter._ScreenUnits = ...,\n cursor: tkinter._Cursor = ...,\n height: tkinter._ScreenUnits = ...,\n padding: tkinter._Padding = ...,\n relief: tkinter._Relief = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n width: tkinter._ScreenUnits = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _FrameOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _FrameOptionName) -> Any: ...\n\n_LabelOptionName = Literal[\n "anchor",\n "background",\n "border",\n "borderwidth",\n "class",\n "compound",\n "cursor",\n "font",\n "foreground",\n "image",\n "justify",\n "padding",\n "relief",\n "state",\n "style",\n "takefocus",\n "text",\n "textvariable",\n "underline",\n "width",\n "wraplength",\n]\n\nclass Label(Widget):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n anchor: tkinter._Anchor = ...,\n background: tkinter._Color = ...,\n border: tkinter._ScreenUnits = ..., # alias for borderwidth\n borderwidth: tkinter._ScreenUnits = ..., # undocumented\n class_: str = ...,\n compound: _TtkCompound = ...,\n cursor: tkinter._Cursor = ...,\n font: _FontDescription = ...,\n foreground: tkinter._Color = ...,\n image: tkinter._ImageSpec = ...,\n justify: Literal["left", "center", "right"] = ...,\n name: str = ...,\n padding: tkinter._Padding = ...,\n relief: tkinter._Relief = ...,\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n textvariable: tkinter.Variable = ...,\n underline: int = ...,\n width: Union[int, Literal[""]] = ...,\n wraplength: tkinter._ScreenUnits = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n anchor: tkinter._Anchor = ...,\n background: tkinter._Color = ...,\n border: tkinter._ScreenUnits = ...,\n borderwidth: tkinter._ScreenUnits = ...,\n compound: _TtkCompound = ...,\n cursor: tkinter._Cursor = ...,\n font: _FontDescription = ...,\n foreground: tkinter._Color = ...,\n image: tkinter._ImageSpec = ...,\n justify: Literal["left", "center", "right"] = ...,\n padding: tkinter._Padding = ...,\n relief: tkinter._Relief = ...,\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n textvariable: tkinter.Variable = ...,\n underline: int = ...,\n width: Union[int, Literal[""]] = ...,\n wraplength: tkinter._ScreenUnits = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _LabelOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _LabelOptionName) -> Any: ...\n\n_LabelframeOptionName = Literal[\n "border",\n "borderwidth",\n "class",\n "cursor",\n "height",\n "labelanchor",\n "labelwidget",\n "padding",\n "relief",\n "style",\n "takefocus",\n "text",\n "underline",\n "width",\n]\n\nclass Labelframe(Widget):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n border: tkinter._ScreenUnits = ...,\n borderwidth: tkinter._ScreenUnits = ..., # undocumented\n class_: str = ...,\n cursor: tkinter._Cursor = ...,\n height: tkinter._ScreenUnits = ...,\n labelanchor: Literal["nw", "n", "ne", "en", "e", "es", "se", "s", "sw", "ws", "w", "wn"] = ...,\n labelwidget: tkinter.Misc = ...,\n name: str = ...,\n padding: tkinter._Padding = ...,\n relief: tkinter._Relief = ..., # undocumented\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n underline: int = ...,\n width: tkinter._ScreenUnits = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n border: tkinter._ScreenUnits = ...,\n borderwidth: tkinter._ScreenUnits = ...,\n cursor: tkinter._Cursor = ...,\n height: tkinter._ScreenUnits = ...,\n labelanchor: Literal["nw", "n", "ne", "en", "e", "es", "se", "s", "sw", "ws", "w", "wn"] = ...,\n labelwidget: tkinter.Misc = ...,\n padding: tkinter._Padding = ...,\n relief: tkinter._Relief = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n underline: int = ...,\n width: tkinter._ScreenUnits = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _LabelframeOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _LabelframeOptionName) -> Any: ...\n\nLabelFrame = Labelframe\n\n_MenubuttonOptionName = Literal[\n "class",\n "compound",\n "cursor",\n "direction",\n "image",\n "menu",\n "padding",\n "state",\n "style",\n "takefocus",\n "text",\n "textvariable",\n "underline",\n "width",\n]\n\nclass Menubutton(Widget):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n compound: _TtkCompound = ...,\n cursor: tkinter._Cursor = ...,\n direction: Literal["above", "below", "left", "right", "flush"] = ...,\n image: tkinter._ImageSpec = ...,\n menu: tkinter.Menu = ...,\n name: str = ...,\n padding: Any = ..., # undocumented\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n textvariable: tkinter.Variable = ...,\n underline: int = ...,\n width: Union[int, Literal[""]] = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n compound: _TtkCompound = ...,\n cursor: tkinter._Cursor = ...,\n direction: Literal["above", "below", "left", "right", "flush"] = ...,\n image: tkinter._ImageSpec = ...,\n menu: tkinter.Menu = ...,\n padding: Any = ...,\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n textvariable: tkinter.Variable = ...,\n underline: int = ...,\n width: Union[int, Literal[""]] = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _MenubuttonOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _MenubuttonOptionName) -> Any: ...\n\n_NotebookOptionName = Literal["class", "cursor", "height", "padding", "style", "takefocus", "width"]\n\nclass Notebook(Widget):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n cursor: tkinter._Cursor = ...,\n height: int = ...,\n name: str = ...,\n padding: tkinter._Padding = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n width: int = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n cursor: tkinter._Cursor = ...,\n height: int = ...,\n padding: tkinter._Padding = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n width: int = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _NotebookOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _NotebookOptionName) -> Any: ...\n def add(self, child, **kw): ...\n def forget(self, tab_id): ...\n def hide(self, tab_id): ...\n def identify(self, x, y): ...\n def index(self, tab_id): ...\n def insert(self, pos, child, **kw): ...\n def select(self, tab_id: Optional[Any] = ...): ...\n def tab(self, tab_id, option: Optional[Any] = ..., **kw): ...\n def tabs(self): ...\n def enable_traversal(self): ...\n\n_PanedwindowOptionName = Literal["class", "cursor", "height", "orient", "style", "takefocus", "width"]\n\nclass Panedwindow(Widget, tkinter.PanedWindow):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n cursor: tkinter._Cursor = ...,\n # width and height for tkinter.ttk.Panedwindow are int but for tkinter.PanedWindow they are screen units\n height: int = ...,\n name: str = ...,\n orient: Literal["vertical", "horizontal"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n width: int = ...,\n ) -> None: ...\n @overload # type: ignore\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n cursor: tkinter._Cursor = ...,\n height: int = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n width: int = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _PanedwindowOptionName) -> Tuple[str, str, str, Any, Any]: ...\n # config must be copy/pasted, otherwise ttk.Panedwindow().config is mypy error (don't know why)\n @overload # type: ignore\n def config(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n cursor: tkinter._Cursor = ...,\n height: int = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n width: int = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def config(self, cnf: _PanedwindowOptionName) -> Tuple[str, str, str, Any, Any]: ...\n def cget(self, key: _PanedwindowOptionName) -> Any: ... # type: ignore\n forget: Any\n def insert(self, pos, child, **kw): ...\n def pane(self, pane, option: Optional[Any] = ..., **kw): ...\n def sashpos(self, index, newpos: Optional[Any] = ...): ...\n\nPanedWindow = Panedwindow\n\n_ProgressbarOptionName = Literal[\n "class", "cursor", "length", "maximum", "mode", "orient", "phase", "style", "takefocus", "value", "variable"\n]\n\nclass Progressbar(Widget):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n cursor: tkinter._Cursor = ...,\n length: tkinter._ScreenUnits = ...,\n maximum: float = ...,\n mode: Literal["determinate", "indeterminate"] = ...,\n name: str = ...,\n orient: Literal["horizontal", "vertical"] = ...,\n phase: int = ..., # docs say read-only but assigning int to this works\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n value: float = ...,\n variable: tkinter.DoubleVar = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n cursor: tkinter._Cursor = ...,\n length: tkinter._ScreenUnits = ...,\n maximum: float = ...,\n mode: Literal["determinate", "indeterminate"] = ...,\n orient: Literal["horizontal", "vertical"] = ...,\n phase: int = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n value: float = ...,\n variable: tkinter.DoubleVar = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _ProgressbarOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _ProgressbarOptionName) -> Any: ...\n def start(self, interval: Optional[Any] = ...): ...\n def step(self, amount: Optional[Any] = ...): ...\n def stop(self): ...\n\n_RadiobuttonOptionName = Literal[\n "class",\n "command",\n "compound",\n "cursor",\n "image",\n "padding",\n "state",\n "style",\n "takefocus",\n "text",\n "textvariable",\n "underline",\n "value",\n "variable",\n "width",\n]\n\nclass Radiobutton(Widget):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n command: tkinter._ButtonCommand = ...,\n compound: _TtkCompound = ...,\n cursor: tkinter._Cursor = ...,\n image: tkinter._ImageSpec = ...,\n name: str = ...,\n padding: Any = ..., # undocumented\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n textvariable: tkinter.Variable = ...,\n underline: int = ...,\n value: Any = ...,\n variable: Union[tkinter.Variable, Literal[""]] = ...,\n width: Union[int, Literal[""]] = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n command: tkinter._ButtonCommand = ...,\n compound: _TtkCompound = ...,\n cursor: tkinter._Cursor = ...,\n image: tkinter._ImageSpec = ...,\n padding: Any = ...,\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n text: str = ...,\n textvariable: tkinter.Variable = ...,\n underline: int = ...,\n value: Any = ...,\n variable: Union[tkinter.Variable, Literal[""]] = ...,\n width: Union[int, Literal[""]] = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _RadiobuttonOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _RadiobuttonOptionName) -> Any: ...\n def invoke(self): ...\n\n_ScaleOptionName = Literal[\n "class", "command", "cursor", "from", "length", "orient", "state", "style", "takefocus", "to", "value", "variable"\n]\n\nclass Scale(Widget, tkinter.Scale):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n command: Union[str, Callable[[str], Any]] = ...,\n cursor: tkinter._Cursor = ...,\n from_: float = ...,\n length: tkinter._ScreenUnits = ...,\n name: str = ...,\n orient: Literal["horizontal", "vertical"] = ...,\n state: Any = ..., # undocumented\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n to: float = ...,\n value: float = ...,\n variable: tkinter.DoubleVar = ...,\n ) -> None: ...\n @overload # type: ignore\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n command: Union[str, Callable[[str], Any]] = ...,\n cursor: tkinter._Cursor = ...,\n from_: float = ...,\n length: tkinter._ScreenUnits = ...,\n orient: Literal["horizontal", "vertical"] = ...,\n state: Any = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n to: float = ...,\n value: float = ...,\n variable: tkinter.DoubleVar = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _ScaleOptionName) -> Tuple[str, str, str, Any, Any]: ...\n # config must be copy/pasted, otherwise ttk.Scale().config is mypy error (don't know why)\n @overload # type: ignore\n def config(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n command: Union[str, Callable[[str], Any]] = ...,\n cursor: tkinter._Cursor = ...,\n from_: float = ...,\n length: tkinter._ScreenUnits = ...,\n orient: Literal["horizontal", "vertical"] = ...,\n state: Any = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n to: float = ...,\n value: float = ...,\n variable: tkinter.DoubleVar = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def config(self, cnf: _ScaleOptionName) -> Tuple[str, str, str, Any, Any]: ...\n def cget(self, key: _ScaleOptionName) -> Any: ... # type: ignore\n def get(self, x: Optional[Any] = ..., y: Optional[Any] = ...): ...\n\n_ScrollbarOptionName = Literal["class", "command", "cursor", "orient", "style", "takefocus"]\n\nclass Scrollbar(Widget, tkinter.Scrollbar):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n command: Union[Callable[..., Optional[Tuple[float, float]]], str] = ...,\n cursor: tkinter._Cursor = ...,\n name: str = ...,\n orient: Literal["horizontal", "vertical"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n ) -> None: ...\n @overload # type: ignore\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n command: Union[Callable[..., Optional[Tuple[float, float]]], str] = ...,\n cursor: tkinter._Cursor = ...,\n orient: Literal["horizontal", "vertical"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _ScrollbarOptionName) -> Tuple[str, str, str, Any, Any]: ...\n # config must be copy/pasted, otherwise ttk.Scrollbar().config is mypy error (don't know why)\n @overload # type: ignore\n def config(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n command: Union[Callable[..., Optional[Tuple[float, float]]], str] = ...,\n cursor: tkinter._Cursor = ...,\n orient: Literal["horizontal", "vertical"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def config(self, cnf: _ScrollbarOptionName) -> Tuple[str, str, str, Any, Any]: ...\n def cget(self, key: _ScrollbarOptionName) -> Any: ... # type: ignore\n\n_SeparatorOptionName = Literal["class", "cursor", "orient", "style", "takefocus"]\n\nclass Separator(Widget):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n cursor: tkinter._Cursor = ...,\n name: str = ...,\n orient: Literal["horizontal", "vertical"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n cursor: tkinter._Cursor = ...,\n orient: Literal["horizontal", "vertical"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _SeparatorOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _SeparatorOptionName) -> Any: ...\n\n_SizegripOptionName = Literal["class", "cursor", "style", "takefocus"]\n\nclass Sizegrip(Widget):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n cursor: tkinter._Cursor = ...,\n name: str = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n cursor: tkinter._Cursor = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _SizegripOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _SizegripOptionName) -> Any: ...\n\nif sys.version_info >= (3, 7):\n _SpinboxOptionName = Literal[\n "background",\n "class",\n "command",\n "cursor",\n "exportselection",\n "font",\n "foreground",\n "format",\n "from",\n "increment",\n "invalidcommand",\n "justify",\n "show",\n "state",\n "style",\n "takefocus",\n "textvariable",\n "to",\n "validate",\n "validatecommand",\n "values",\n "width",\n "wrap",\n "xscrollcommand",\n ]\n class Spinbox(Entry):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n background: tkinter._Color = ..., # undocumented\n class_: str = ...,\n command: Union[Callable[[], Any], str, tkinter._TkinterSequence[str]] = ...,\n cursor: tkinter._Cursor = ...,\n exportselection: bool = ..., # undocumented\n font: _FontDescription = ..., # undocumented\n foreground: tkinter._Color = ..., # undocumented\n format: str = ...,\n from_: float = ...,\n increment: float = ...,\n invalidcommand: tkinter._EntryValidateCommand = ..., # undocumented\n justify: Literal["left", "center", "right"] = ..., # undocumented\n name: str = ...,\n show: Any = ..., # undocumented\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n textvariable: tkinter.Variable = ..., # undocumented\n to: float = ...,\n validate: Literal["none", "focus", "focusin", "focusout", "key", "all"] = ...,\n validatecommand: tkinter._EntryValidateCommand = ...,\n values: tkinter._TkinterSequence[str] = ...,\n width: int = ..., # undocumented\n wrap: bool = ...,\n xscrollcommand: tkinter._XYScrollCommand = ...,\n ) -> None: ...\n @overload # type: ignore\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n background: tkinter._Color = ...,\n command: Union[Callable[[], Any], str, tkinter._TkinterSequence[str]] = ...,\n cursor: tkinter._Cursor = ...,\n exportselection: bool = ...,\n font: _FontDescription = ...,\n foreground: tkinter._Color = ...,\n format: str = ...,\n from_: float = ...,\n increment: float = ...,\n invalidcommand: tkinter._EntryValidateCommand = ...,\n justify: Literal["left", "center", "right"] = ...,\n show: Any = ...,\n state: Literal["normal", "disabled"] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n textvariable: tkinter.Variable = ...,\n to: float = ...,\n validate: Literal["none", "focus", "focusin", "focusout", "key", "all"] = ...,\n validatecommand: tkinter._EntryValidateCommand = ...,\n values: tkinter._TkinterSequence[str] = ...,\n width: int = ...,\n wrap: bool = ...,\n xscrollcommand: tkinter._XYScrollCommand = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _SpinboxOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure # type: ignore\n def cget(self, key: _SpinboxOptionName) -> Any: ... # type: ignore\n def set(self, value: Any) -> None: ...\n\n_TreeviewOptionName = Literal[\n "class",\n "columns",\n "cursor",\n "displaycolumns",\n "height",\n "padding",\n "selectmode",\n "show",\n "style",\n "takefocus",\n "xscrollcommand",\n "yscrollcommand",\n]\n\nclass Treeview(Widget, tkinter.XView, tkinter.YView):\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n *,\n class_: str = ...,\n columns: Union[str, tkinter._TkinterSequence[str]] = ...,\n cursor: tkinter._Cursor = ...,\n displaycolumns: Union[str, tkinter._TkinterSequence[str], tkinter._TkinterSequence[int], Literal["#all"]] = ...,\n height: int = ...,\n name: str = ...,\n padding: tkinter._Padding = ...,\n selectmode: Literal["extended", "browse", "none"] = ...,\n # _TkinterSequences of Literal don't actually work, using str instead.\n #\n # 'tree headings' is same as ['tree', 'headings'], and I wouldn't be\n # surprised if someone was using it.\n show: Union[Literal["tree", "headings", "tree headings"], tkinter._TkinterSequence[str]] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n xscrollcommand: tkinter._XYScrollCommand = ...,\n yscrollcommand: tkinter._XYScrollCommand = ...,\n ) -> None: ...\n @overload\n def configure(\n self,\n cnf: Optional[Dict[str, Any]] = ...,\n *,\n columns: Union[str, tkinter._TkinterSequence[str]] = ...,\n cursor: tkinter._Cursor = ...,\n displaycolumns: Union[str, tkinter._TkinterSequence[str], tkinter._TkinterSequence[int], Literal["#all"]] = ...,\n height: int = ...,\n padding: tkinter._Padding = ...,\n selectmode: Literal["extended", "browse", "none"] = ...,\n show: Union[Literal["tree", "headings", "tree headings"], tkinter._TkinterSequence[str]] = ...,\n style: str = ...,\n takefocus: tkinter._TakeFocusValue = ...,\n xscrollcommand: tkinter._XYScrollCommand = ...,\n yscrollcommand: tkinter._XYScrollCommand = ...,\n ) -> Optional[Dict[str, Tuple[str, str, str, Any, Any]]]: ...\n @overload\n def configure(self, cnf: _TreeviewOptionName) -> Tuple[str, str, str, Any, Any]: ...\n config = configure\n def cget(self, key: _TreeviewOptionName) -> Any: ...\n def bbox(self, item, column: Optional[Any] = ...): ...\n def get_children(self, item: Optional[Any] = ...): ...\n def set_children(self, item, *newchildren): ...\n def column(self, column, option: Optional[Any] = ..., **kw): ...\n def delete(self, *items): ...\n def detach(self, *items): ...\n def exists(self, item): ...\n def focus(self, item: Optional[Any] = ...): ...\n def heading(self, column, option: Optional[Any] = ..., **kw): ...\n def identify(self, component, x, y): ...\n def identify_row(self, y): ...\n def identify_column(self, x): ...\n def identify_region(self, x, y): ...\n def identify_element(self, x, y): ...\n def index(self, item): ...\n def insert(self, parent, index, iid: Optional[Any] = ..., **kw): ...\n def item(self, item, option: Optional[Any] = ..., **kw): ...\n def move(self, item, parent, index): ...\n reattach: Any\n def next(self, item): ...\n def parent(self, item): ...\n def prev(self, item): ...\n def see(self, item): ...\n if sys.version_info >= (3, 8):\n def selection(self) -> List[Any]: ...\n else:\n def selection(self, selop: Optional[Any] = ..., items: Optional[Any] = ...) -> List[Any]: ...\n def selection_set(self, items): ...\n def selection_add(self, items): ...\n def selection_remove(self, items): ...\n def selection_toggle(self, items): ...\n def set(self, item, column: Optional[Any] = ..., value: Optional[Any] = ...): ...\n # There's no tag_unbind() or 'add' argument for whatever reason.\n # Also, it's 'callback' instead of 'func' here.\n @overload\n def tag_bind(\n self,\n tagname: str,\n sequence: Optional[str] = ...,\n callback: Optional[Callable[[tkinter.Event[Treeview]], Optional[Literal["break"]]]] = ...,\n ) -> str: ...\n @overload\n def tag_bind(self, tagname: str, sequence: Optional[str], callback: str) -> None: ...\n @overload\n def tag_bind(self, tagname: str, *, callback: str) -> None: ...\n def tag_configure(self, tagname, option: Optional[Any] = ..., **kw): ...\n def tag_has(self, tagname, item: Optional[Any] = ...): ...\n\nclass LabeledScale(Frame):\n label: Any\n scale: Any\n # TODO: don't any-type **kw. That goes to Frame.__init__.\n def __init__(\n self,\n master: Optional[tkinter.Misc] = ...,\n variable: Optional[Union[tkinter.IntVar, tkinter.DoubleVar]] = ...,\n from_: float = ...,\n to: float = ...,\n *,\n compound: Union[Literal["top"], Literal["bottom"]] = ...,\n **kw: Any,\n ) -> None: ...\n # destroy is overrided, signature does not change\n value: Any\n\nclass OptionMenu(Menubutton):\n def __init__(\n self,\n master,\n variable,\n default: Optional[str] = ...,\n *values: str,\n # rest of these are keyword-only because *args syntax used above\n style: str = ...,\n direction: Union[Literal["above"], Literal["below"], Literal["left"], Literal["right"], Literal["flush"]] = ...,\n command: Optional[Callable[[tkinter.StringVar], Any]] = ...,\n ) -> None: ...\n # configure, config, cget, destroy are inherited from Menubutton\n # destroy and __setitem__ are overrided, signature does not change\n def set_menu(self, default: Optional[Any] = ..., *values): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\tkinter\ttk.pyi | ttk.pyi | Other | 43,748 | 0.95 | 0.171266 | 0.054668 | react-lib | 787 | 2025-04-12T18:35:29.301533 | MIT | false | 35417de01237c3758bb2fd9c922f09bc |
import sys\nfrom typing import Any, Awaitable, Callable\n\nfrom .case import TestCase\n\nif sys.version_info >= (3, 8):\n class IsolatedAsyncioTestCase(TestCase):\n async def asyncSetUp(self) -> None: ...\n async def asyncTearDown(self) -> None: ...\n def addAsyncCleanup(self, __func: Callable[..., Awaitable[Any]], *args: Any, **kwargs: Any) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\unittest\async_case.pyi | async_case.pyi | Other | 372 | 0.85 | 0.5 | 0 | python-kit | 451 | 2023-08-22T06:38:09.767393 | GPL-3.0 | true | 177df89a5d31b965ef3991b625f82bdb |
import datetime\nimport logging\nimport sys\nimport unittest.result\nfrom types import TracebackType\nfrom typing import (\n Any,\n AnyStr,\n Callable,\n Container,\n ContextManager,\n Dict,\n FrozenSet,\n Generic,\n Iterable,\n List,\n Mapping,\n NoReturn,\n Optional,\n Pattern,\n Sequence,\n Set,\n Tuple,\n Type,\n TypeVar,\n Union,\n overload,\n)\nfrom warnings import WarningMessage\n\nif sys.version_info >= (3, 9):\n from types import GenericAlias\n\n_E = TypeVar("_E", bound=BaseException)\n_FT = TypeVar("_FT", bound=Callable[..., Any])\n\nif sys.version_info >= (3, 8):\n def addModuleCleanup(__function: Callable[..., Any], *args: Any, **kwargs: Any) -> None: ...\n def doModuleCleanups() -> None: ...\n\ndef expectedFailure(test_item: _FT) -> _FT: ...\ndef skip(reason: str) -> Callable[[_FT], _FT]: ...\ndef skipIf(condition: object, reason: str) -> Callable[[_FT], _FT]: ...\ndef skipUnless(condition: object, reason: str) -> Callable[[_FT], _FT]: ...\n\nclass SkipTest(Exception):\n def __init__(self, reason: str) -> None: ...\n\nclass TestCase:\n failureException: Type[BaseException]\n longMessage: bool\n maxDiff: Optional[int]\n # undocumented\n _testMethodName: str\n # undocumented\n _testMethodDoc: str\n def __init__(self, methodName: str = ...) -> None: ...\n def setUp(self) -> None: ...\n def tearDown(self) -> None: ...\n @classmethod\n def setUpClass(cls) -> None: ...\n @classmethod\n def tearDownClass(cls) -> None: ...\n def run(self, result: Optional[unittest.result.TestResult] = ...) -> Optional[unittest.result.TestResult]: ...\n def __call__(self, result: Optional[unittest.result.TestResult] = ...) -> Optional[unittest.result.TestResult]: ...\n def skipTest(self, reason: Any) -> None: ...\n def subTest(self, msg: Any = ..., **params: Any) -> ContextManager[None]: ...\n def debug(self) -> None: ...\n def _addSkip(self, result: unittest.result.TestResult, test_case: TestCase, reason: str) -> None: ...\n def assertEqual(self, first: Any, second: Any, msg: Any = ...) -> None: ...\n def assertNotEqual(self, first: Any, second: Any, msg: Any = ...) -> None: ...\n def assertTrue(self, expr: Any, msg: Any = ...) -> None: ...\n def assertFalse(self, expr: Any, msg: Any = ...) -> None: ...\n def assertIs(self, expr1: Any, expr2: Any, msg: Any = ...) -> None: ...\n def assertIsNot(self, expr1: Any, expr2: Any, msg: Any = ...) -> None: ...\n def assertIsNone(self, obj: Any, msg: Any = ...) -> None: ...\n def assertIsNotNone(self, obj: Any, msg: Any = ...) -> None: ...\n def assertIn(self, member: Any, container: Union[Iterable[Any], Container[Any]], msg: Any = ...) -> None: ...\n def assertNotIn(self, member: Any, container: Union[Iterable[Any], Container[Any]], msg: Any = ...) -> None: ...\n def assertIsInstance(self, obj: Any, cls: Union[type, Tuple[type, ...]], msg: Any = ...) -> None: ...\n def assertNotIsInstance(self, obj: Any, cls: Union[type, Tuple[type, ...]], msg: Any = ...) -> None: ...\n def assertGreater(self, a: Any, b: Any, msg: Any = ...) -> None: ...\n def assertGreaterEqual(self, a: Any, b: Any, msg: Any = ...) -> None: ...\n def assertLess(self, a: Any, b: Any, msg: Any = ...) -> None: ...\n def assertLessEqual(self, a: Any, b: Any, msg: Any = ...) -> None: ...\n @overload\n def assertRaises( # type: ignore\n self,\n expected_exception: Union[Type[BaseException], Tuple[Type[BaseException], ...]],\n callable: Callable[..., Any],\n *args: Any,\n **kwargs: Any,\n ) -> None: ...\n @overload\n def assertRaises(\n self, expected_exception: Union[Type[_E], Tuple[Type[_E], ...]], msg: Any = ...\n ) -> _AssertRaisesContext[_E]: ...\n @overload\n def assertRaisesRegex( # type: ignore\n self,\n expected_exception: Union[Type[BaseException], Tuple[Type[BaseException], ...]],\n expected_regex: Union[str, bytes, Pattern[str], Pattern[bytes]],\n callable: Callable[..., Any],\n *args: Any,\n **kwargs: Any,\n ) -> None: ...\n @overload\n def assertRaisesRegex(\n self,\n expected_exception: Union[Type[_E], Tuple[Type[_E], ...]],\n expected_regex: Union[str, bytes, Pattern[str], Pattern[bytes]],\n msg: Any = ...,\n ) -> _AssertRaisesContext[_E]: ...\n @overload\n def assertWarns( # type: ignore\n self,\n expected_warning: Union[Type[Warning], Tuple[Type[Warning], ...]],\n callable: Callable[..., Any],\n *args: Any,\n **kwargs: Any,\n ) -> None: ...\n @overload\n def assertWarns(\n self, expected_warning: Union[Type[Warning], Tuple[Type[Warning], ...]], msg: Any = ...\n ) -> _AssertWarnsContext: ...\n @overload\n def assertWarnsRegex( # type: ignore\n self,\n expected_warning: Union[Type[Warning], Tuple[Type[Warning], ...]],\n expected_regex: Union[str, bytes, Pattern[str], Pattern[bytes]],\n callable: Callable[..., Any],\n *args: Any,\n **kwargs: Any,\n ) -> None: ...\n @overload\n def assertWarnsRegex(\n self,\n expected_warning: Union[Type[Warning], Tuple[Type[Warning], ...]],\n expected_regex: Union[str, bytes, Pattern[str], Pattern[bytes]],\n msg: Any = ...,\n ) -> _AssertWarnsContext: ...\n def assertLogs(\n self, logger: Optional[Union[str, logging.Logger]] = ..., level: Union[int, str, None] = ...\n ) -> _AssertLogsContext: ...\n @overload\n def assertAlmostEqual(\n self, first: float, second: float, places: Optional[int] = ..., msg: Any = ..., delta: Optional[float] = ...\n ) -> None: ...\n @overload\n def assertAlmostEqual(\n self,\n first: datetime.datetime,\n second: datetime.datetime,\n places: Optional[int] = ...,\n msg: Any = ...,\n delta: Optional[datetime.timedelta] = ...,\n ) -> None: ...\n @overload\n def assertNotAlmostEqual(self, first: float, second: float, *, msg: Any = ...) -> None: ...\n @overload\n def assertNotAlmostEqual(self, first: float, second: float, places: Optional[int] = ..., msg: Any = ...) -> None: ...\n @overload\n def assertNotAlmostEqual(self, first: float, second: float, *, msg: Any = ..., delta: Optional[float] = ...) -> None: ...\n @overload\n def assertNotAlmostEqual(\n self,\n first: datetime.datetime,\n second: datetime.datetime,\n places: Optional[int] = ...,\n msg: Any = ...,\n delta: Optional[datetime.timedelta] = ...,\n ) -> None: ...\n def assertRegex(self, text: AnyStr, expected_regex: Union[AnyStr, Pattern[AnyStr]], msg: Any = ...) -> None: ...\n def assertNotRegex(self, text: AnyStr, unexpected_regex: Union[AnyStr, Pattern[AnyStr]], msg: Any = ...) -> None: ...\n def assertCountEqual(self, first: Iterable[Any], second: Iterable[Any], msg: Any = ...) -> None: ...\n def addTypeEqualityFunc(self, typeobj: Type[Any], function: Callable[..., None]) -> None: ...\n def assertMultiLineEqual(self, first: str, second: str, msg: Any = ...) -> None: ...\n def assertSequenceEqual(\n self, seq1: Sequence[Any], seq2: Sequence[Any], msg: Any = ..., seq_type: Optional[Type[Sequence[Any]]] = ...\n ) -> None: ...\n def assertListEqual(self, list1: List[Any], list2: List[Any], msg: Any = ...) -> None: ...\n def assertTupleEqual(self, tuple1: Tuple[Any, ...], tuple2: Tuple[Any, ...], msg: Any = ...) -> None: ...\n def assertSetEqual(\n self, set1: Union[Set[Any], FrozenSet[Any]], set2: Union[Set[Any], FrozenSet[Any]], msg: Any = ...\n ) -> None: ...\n def assertDictEqual(self, d1: Dict[Any, Any], d2: Dict[Any, Any], msg: Any = ...) -> None: ...\n def fail(self, msg: Any = ...) -> NoReturn: ...\n def countTestCases(self) -> int: ...\n def defaultTestResult(self) -> unittest.result.TestResult: ...\n def id(self) -> str: ...\n def shortDescription(self) -> Optional[str]: ...\n if sys.version_info >= (3, 8):\n def addCleanup(self, __function: Callable[..., Any], *args: Any, **kwargs: Any) -> None: ...\n else:\n def addCleanup(self, function: Callable[..., Any], *args: Any, **kwargs: Any) -> None: ...\n def doCleanups(self) -> None: ...\n if sys.version_info >= (3, 8):\n @classmethod\n def addClassCleanup(cls, __function: Callable[..., Any], *args: Any, **kwargs: Any) -> None: ...\n @classmethod\n def doClassCleanups(cls) -> None: ...\n def _formatMessage(self, msg: Optional[str], standardMsg: str) -> str: ... # undocumented\n def _getAssertEqualityFunc(self, first: Any, second: Any) -> Callable[..., None]: ... # undocumented\n # below is deprecated\n def failUnlessEqual(self, first: Any, second: Any, msg: Any = ...) -> None: ...\n def assertEquals(self, first: Any, second: Any, msg: Any = ...) -> None: ...\n def failIfEqual(self, first: Any, second: Any, msg: Any = ...) -> None: ...\n def assertNotEquals(self, first: Any, second: Any, msg: Any = ...) -> None: ...\n def failUnless(self, expr: bool, msg: Any = ...) -> None: ...\n def assert_(self, expr: bool, msg: Any = ...) -> None: ...\n def failIf(self, expr: bool, msg: Any = ...) -> None: ...\n @overload\n def failUnlessRaises( # type: ignore\n self,\n exception: Union[Type[BaseException], Tuple[Type[BaseException], ...]],\n callable: Callable[..., Any] = ...,\n *args: Any,\n **kwargs: Any,\n ) -> None: ...\n @overload\n def failUnlessRaises(self, exception: Union[Type[_E], Tuple[Type[_E], ...]], msg: Any = ...) -> _AssertRaisesContext[_E]: ...\n def failUnlessAlmostEqual(self, first: float, second: float, places: int = ..., msg: Any = ...) -> None: ...\n def assertAlmostEquals(self, first: float, second: float, places: int = ..., msg: Any = ..., delta: float = ...) -> None: ...\n def failIfAlmostEqual(self, first: float, second: float, places: int = ..., msg: Any = ...) -> None: ...\n def assertNotAlmostEquals(\n self, first: float, second: float, places: int = ..., msg: Any = ..., delta: float = ...\n ) -> None: ...\n def assertRegexpMatches(self, text: AnyStr, regex: Union[AnyStr, Pattern[AnyStr]], msg: Any = ...) -> None: ...\n def assertNotRegexpMatches(self, text: AnyStr, regex: Union[AnyStr, Pattern[AnyStr]], msg: Any = ...) -> None: ...\n @overload\n def assertRaisesRegexp( # type: ignore\n self,\n exception: Union[Type[BaseException], Tuple[Type[BaseException], ...]],\n expected_regex: Union[str, bytes, Pattern[str], Pattern[bytes]],\n callable: Callable[..., Any],\n *args: Any,\n **kwargs: Any,\n ) -> None: ...\n @overload\n def assertRaisesRegexp(\n self,\n exception: Union[Type[_E], Tuple[Type[_E], ...]],\n expected_regex: Union[str, bytes, Pattern[str], Pattern[bytes]],\n msg: Any = ...,\n ) -> _AssertRaisesContext[_E]: ...\n def assertDictContainsSubset(self, subset: Mapping[Any, Any], dictionary: Mapping[Any, Any], msg: object = ...) -> None: ...\n\nclass FunctionTestCase(TestCase):\n def __init__(\n self,\n testFunc: Callable[[], None],\n setUp: Optional[Callable[[], None]] = ...,\n tearDown: Optional[Callable[[], None]] = ...,\n description: Optional[str] = ...,\n ) -> None: ...\n def runTest(self) -> None: ...\n\nclass _AssertRaisesContext(Generic[_E]):\n exception: _E\n def __enter__(self) -> _AssertRaisesContext[_E]: ...\n def __exit__(\n self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType]\n ) -> bool: ...\n if sys.version_info >= (3, 9):\n def __class_getitem__(cls, item: Any) -> GenericAlias: ...\n\nclass _AssertWarnsContext:\n warning: WarningMessage\n filename: str\n lineno: int\n warnings: List[WarningMessage]\n def __enter__(self) -> _AssertWarnsContext: ...\n def __exit__(\n self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType]\n ) -> None: ...\n\nclass _AssertLogsContext:\n LOGGING_FORMAT: str\n records: List[logging.LogRecord]\n output: List[str]\n def __init__(self, test_case: TestCase, logger_name: str, level: int) -> None: ...\n def __enter__(self) -> _AssertLogsContext: ...\n def __exit__(\n self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType]\n ) -> Optional[bool]: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\unittest\case.pyi | case.pyi | Other | 12,483 | 0.95 | 0.392982 | 0.054545 | react-lib | 960 | 2024-08-15T03:55:41.031266 | MIT | true | a2cf208ea8ce28f53422781683580967 |
import sys\nimport unittest.case\nimport unittest.result\nimport unittest.suite\nfrom types import ModuleType\nfrom typing import Any, Callable, List, Optional, Sequence, Type\n\n_SortComparisonMethod = Callable[[str, str], int]\n_SuiteClass = Callable[[List[unittest.case.TestCase]], unittest.suite.TestSuite]\n\nclass TestLoader:\n errors: List[Type[BaseException]]\n testMethodPrefix: str\n sortTestMethodsUsing: _SortComparisonMethod\n\n if sys.version_info >= (3, 7):\n testNamePatterns: Optional[List[str]]\n\n suiteClass: _SuiteClass\n def loadTestsFromTestCase(self, testCaseClass: Type[unittest.case.TestCase]) -> unittest.suite.TestSuite: ...\n def loadTestsFromModule(self, module: ModuleType, *args: Any, pattern: Any = ...) -> unittest.suite.TestSuite: ...\n def loadTestsFromName(self, name: str, module: Optional[ModuleType] = ...) -> unittest.suite.TestSuite: ...\n def loadTestsFromNames(self, names: Sequence[str], module: Optional[ModuleType] = ...) -> unittest.suite.TestSuite: ...\n def getTestCaseNames(self, testCaseClass: Type[unittest.case.TestCase]) -> Sequence[str]: ...\n def discover(self, start_dir: str, pattern: str = ..., top_level_dir: Optional[str] = ...) -> unittest.suite.TestSuite: ...\n\ndefaultTestLoader: TestLoader\n\nif sys.version_info >= (3, 7):\n def getTestCaseNames(\n testCaseClass: Type[unittest.case.TestCase],\n prefix: str,\n sortUsing: _SortComparisonMethod = ...,\n testNamePatterns: Optional[List[str]] = ...,\n ) -> Sequence[str]: ...\n\nelse:\n def getTestCaseNames(\n testCaseClass: Type[unittest.case.TestCase], prefix: str, sortUsing: _SortComparisonMethod = ...\n ) -> Sequence[str]: ...\n\ndef makeSuite(\n testCaseClass: Type[unittest.case.TestCase],\n prefix: str = ...,\n sortUsing: _SortComparisonMethod = ...,\n suiteClass: _SuiteClass = ...,\n) -> unittest.suite.TestSuite: ...\ndef findTestCases(\n module: ModuleType, prefix: str = ..., sortUsing: _SortComparisonMethod = ..., suiteClass: _SuiteClass = ...\n) -> unittest.suite.TestSuite: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\unittest\loader.pyi | loader.pyi | Other | 2,067 | 0.85 | 0.26 | 0 | node-utils | 250 | 2024-01-29T09:57:09.800106 | GPL-3.0 | true | 8c3a20b954366a1458d63ef9345a4795 |
import sys\nimport unittest.case\nimport unittest.loader\nimport unittest.result\nimport unittest.suite\nfrom types import ModuleType\nfrom typing import Any, Iterable, List, Optional, Protocol, Type, Union\n\nclass _TestRunner(Protocol):\n def run(self, test: Union[unittest.suite.TestSuite, unittest.case.TestCase]) -> unittest.result.TestResult: ...\n\n# not really documented\nclass TestProgram:\n result: unittest.result.TestResult\n module: Union[None, str, ModuleType]\n verbosity: int\n failfast: Optional[bool]\n catchbreak: Optional[bool]\n buffer: Optional[bool]\n progName: Optional[str]\n warnings: Optional[str]\n\n if sys.version_info >= (3, 7):\n testNamePatterns: Optional[List[str]]\n def __init__(\n self,\n module: Union[None, str, ModuleType] = ...,\n defaultTest: Union[str, Iterable[str], None] = ...,\n argv: Optional[List[str]] = ...,\n testRunner: Union[Type[_TestRunner], _TestRunner, None] = ...,\n testLoader: unittest.loader.TestLoader = ...,\n exit: bool = ...,\n verbosity: int = ...,\n failfast: Optional[bool] = ...,\n catchbreak: Optional[bool] = ...,\n buffer: Optional[bool] = ...,\n warnings: Optional[str] = ...,\n *,\n tb_locals: bool = ...,\n ) -> None: ...\n def usageExit(self, msg: Any = ...) -> None: ...\n def parseArgs(self, argv: List[str]) -> None: ...\n if sys.version_info >= (3, 7):\n def createTests(self, from_discovery: bool = ..., Loader: Optional[unittest.loader.TestLoader] = ...) -> None: ...\n else:\n def createTests(self) -> None: ...\n def runTests(self) -> None: ... # undocumented\n\nmain = TestProgram\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\unittest\main.pyi | main.pyi | Other | 1,691 | 0.95 | 0.22449 | 0.044444 | awesome-app | 71 | 2024-02-02T21:52:32.829704 | MIT | true | f0dd0c8580683fc47304a9dee6e9b97e |
import sys\nfrom typing import Any, Callable, Generic, List, Mapping, Optional, Sequence, Tuple, Type, TypeVar, Union, overload\n\n_F = TypeVar("_F", bound=Callable[..., Any])\n_T = TypeVar("_T")\n_TT = TypeVar("_TT", bound=Type[Any])\n_R = TypeVar("_R")\n\n__all__ = [\n "Mock",\n "MagicMock",\n "patch",\n "sentinel",\n "DEFAULT",\n "ANY",\n "call",\n "create_autospec",\n "AsyncMock",\n "FILTER_DIR",\n "NonCallableMock",\n "NonCallableMagicMock",\n "mock_open",\n "PropertyMock",\n "seal",\n]\n__version__: str\n\nFILTER_DIR: Any\n\nclass _slotted: ...\n\nclass _SentinelObject:\n name: Any\n def __init__(self, name: Any) -> None: ...\n\nclass _Sentinel:\n def __init__(self) -> None: ...\n def __getattr__(self, name: str) -> Any: ...\n\nsentinel: Any\nDEFAULT: Any\n\nclass _Call(Tuple[Any, ...]):\n def __new__(\n cls, value: Any = ..., name: Optional[Any] = ..., parent: Optional[Any] = ..., two: bool = ..., from_kall: bool = ...\n ) -> Any: ...\n name: Any\n parent: Any\n from_kall: Any\n def __init__(\n self, value: Any = ..., name: Optional[Any] = ..., parent: Optional[Any] = ..., two: bool = ..., from_kall: bool = ...\n ) -> None: ...\n def __eq__(self, other: Any) -> bool: ...\n __ne__: Any\n def __call__(self, *args: Any, **kwargs: Any) -> _Call: ...\n def __getattr__(self, attr: Any) -> Any: ...\n def count(self, *args: Any, **kwargs: Any) -> Any: ...\n def index(self, *args: Any, **kwargs: Any) -> Any: ...\n def call_list(self) -> Any: ...\n\ncall: _Call\n\nclass _CallList(List[_Call]):\n def __contains__(self, value: Any) -> bool: ...\n\nclass _MockIter:\n obj: Any\n def __init__(self, obj: Any) -> None: ...\n def __iter__(self) -> Any: ...\n def __next__(self) -> Any: ...\n\nclass Base:\n def __init__(self, *args: Any, **kwargs: Any) -> None: ...\n\nclass NonCallableMock(Base, Any): # type: ignore\n def __new__(__cls, *args: Any, **kw: Any) -> NonCallableMock: ...\n def __init__(\n self,\n spec: Union[List[str], object, Type[object], None] = ...,\n wraps: Optional[Any] = ...,\n name: Optional[str] = ...,\n spec_set: Union[List[str], object, Type[object], None] = ...,\n parent: Optional[NonCallableMock] = ...,\n _spec_state: Optional[Any] = ...,\n _new_name: str = ...,\n _new_parent: Optional[NonCallableMock] = ...,\n _spec_as_instance: bool = ...,\n _eat_self: Optional[bool] = ...,\n unsafe: bool = ...,\n **kwargs: Any,\n ) -> None: ...\n def __getattr__(self, name: str) -> Any: ...\n if sys.version_info >= (3, 8):\n def _calls_repr(self, prefix: str = ...) -> str: ...\n def assert_called_with(self, *args: Any, **kwargs: Any) -> None: ...\n def assert_not_called(self) -> None: ...\n def assert_called_once_with(self, *args: Any, **kwargs: Any) -> None: ...\n def _format_mock_failure_message(self, args: Any, kwargs: Any, action: str = ...) -> str: ...\n elif sys.version_info >= (3, 5):\n def assert_called_with(_mock_self, *args: Any, **kwargs: Any) -> None: ...\n def assert_not_called(_mock_self) -> None: ...\n def assert_called_once_with(_mock_self, *args: Any, **kwargs: Any) -> None: ...\n def _format_mock_failure_message(self, args: Any, kwargs: Any) -> str: ...\n if sys.version_info >= (3, 8):\n def assert_called(self) -> None: ...\n def assert_called_once(self) -> None: ...\n elif sys.version_info >= (3, 6):\n def assert_called(_mock_self) -> None: ...\n def assert_called_once(_mock_self) -> None: ...\n if sys.version_info >= (3, 6):\n def reset_mock(self, visited: Any = ..., *, return_value: bool = ..., side_effect: bool = ...) -> None: ...\n elif sys.version_info >= (3, 5):\n def reset_mock(self, visited: Any = ...) -> None: ...\n if sys.version_info >= (3, 7):\n def _extract_mock_name(self) -> str: ...\n def _get_call_signature_from_name(self, name: str) -> Any: ...\n def assert_any_call(self, *args: Any, **kwargs: Any) -> None: ...\n def assert_has_calls(self, calls: Sequence[_Call], any_order: bool = ...) -> None: ...\n def mock_add_spec(self, spec: Any, spec_set: bool = ...) -> None: ...\n def _mock_add_spec(self, spec: Any, spec_set: bool, _spec_as_instance: bool = ..., _eat_self: bool = ...) -> None: ...\n def attach_mock(self, mock: NonCallableMock, attribute: str) -> None: ...\n def configure_mock(self, **kwargs: Any) -> None: ...\n return_value: Any\n side_effect: Any\n called: bool\n call_count: int\n call_args: Any\n call_args_list: _CallList\n mock_calls: _CallList\n def _format_mock_call_signature(self, args: Any, kwargs: Any) -> str: ...\n def _call_matcher(self, _call: Tuple[_Call, ...]) -> _Call: ...\n def _get_child_mock(self, **kw: Any) -> NonCallableMock: ...\n\nclass CallableMixin(Base):\n side_effect: Any\n def __init__(\n self,\n spec: Optional[Any] = ...,\n side_effect: Optional[Any] = ...,\n return_value: Any = ...,\n wraps: Optional[Any] = ...,\n name: Optional[Any] = ...,\n spec_set: Optional[Any] = ...,\n parent: Optional[Any] = ...,\n _spec_state: Optional[Any] = ...,\n _new_name: Any = ...,\n _new_parent: Optional[Any] = ...,\n **kwargs: Any,\n ) -> None: ...\n def __call__(_mock_self, *args: Any, **kwargs: Any) -> Any: ...\n\nclass Mock(CallableMixin, NonCallableMock): ...\n\nclass _patch(Generic[_T]):\n attribute_name: Any\n getter: Callable[[], Any]\n attribute: str\n new: _T\n new_callable: Any\n spec: Any\n create: bool\n has_local: Any\n spec_set: Any\n autospec: Any\n kwargs: Mapping[str, Any]\n additional_patchers: Any\n if sys.version_info >= (3, 8):\n @overload\n def __init__(\n self: _patch[Union[MagicMock, AsyncMock]],\n getter: Callable[[], Any],\n attribute: str,\n *,\n spec: Optional[Any],\n create: bool,\n spec_set: Optional[Any],\n autospec: Optional[Any],\n new_callable: Optional[Any],\n kwargs: Mapping[str, Any],\n ) -> None: ...\n # This overload also covers the case, where new==DEFAULT. In this case, self is _patch[Any].\n # Ideally we'd be able to add an overload for it so that self is _patch[MagicMock],\n # but that's impossible with the current type system.\n @overload\n def __init__(\n self: _patch[_T],\n getter: Callable[[], Any],\n attribute: str,\n new: _T,\n spec: Optional[Any],\n create: bool,\n spec_set: Optional[Any],\n autospec: Optional[Any],\n new_callable: Optional[Any],\n kwargs: Mapping[str, Any],\n ) -> None: ...\n else:\n @overload\n def __init__(\n self: _patch[MagicMock],\n getter: Callable[[], Any],\n attribute: str,\n *,\n spec: Optional[Any],\n create: bool,\n spec_set: Optional[Any],\n autospec: Optional[Any],\n new_callable: Optional[Any],\n kwargs: Mapping[str, Any],\n ) -> None: ...\n @overload\n def __init__(\n self: _patch[_T],\n getter: Callable[[], Any],\n attribute: str,\n new: _T,\n spec: Optional[Any],\n create: bool,\n spec_set: Optional[Any],\n autospec: Optional[Any],\n new_callable: Optional[Any],\n kwargs: Mapping[str, Any],\n ) -> None: ...\n def copy(self) -> _patch[_T]: ...\n def __call__(self, func: Callable[..., _R]) -> Callable[..., _R]: ...\n def decorate_class(self, klass: _TT) -> _TT: ...\n def decorate_callable(self, func: _F) -> _F: ...\n def get_original(self) -> Tuple[Any, bool]: ...\n target: Any\n temp_original: Any\n is_local: bool\n def __enter__(self) -> _T: ...\n def __exit__(self, *exc_info: Any) -> None: ...\n def start(self) -> _T: ...\n def stop(self) -> None: ...\n\nclass _patch_dict:\n in_dict: Any\n values: Any\n clear: Any\n def __init__(self, in_dict: Any, values: Any = ..., clear: Any = ..., **kwargs: Any) -> None: ...\n def __call__(self, f: Any) -> Any: ...\n def decorate_class(self, klass: Any) -> Any: ...\n def __enter__(self) -> Any: ...\n def __exit__(self, *args: Any) -> Any: ...\n start: Any\n stop: Any\n\nclass _patcher:\n TEST_PREFIX: str\n dict: Type[_patch_dict]\n if sys.version_info >= (3, 8):\n @overload\n def __call__( # type: ignore\n self,\n target: Any,\n *,\n spec: Optional[Any] = ...,\n create: bool = ...,\n spec_set: Optional[Any] = ...,\n autospec: Optional[Any] = ...,\n new_callable: Optional[Any] = ...,\n **kwargs: Any,\n ) -> _patch[Union[MagicMock, AsyncMock]]: ...\n # This overload also covers the case, where new==DEFAULT. In this case, the return type is _patch[Any].\n # Ideally we'd be able to add an overload for it so that the return type is _patch[MagicMock],\n # but that's impossible with the current type system.\n @overload\n def __call__(\n self,\n target: Any,\n new: _T,\n spec: Optional[Any] = ...,\n create: bool = ...,\n spec_set: Optional[Any] = ...,\n autospec: Optional[Any] = ...,\n new_callable: Optional[Any] = ...,\n **kwargs: Any,\n ) -> _patch[_T]: ...\n else:\n @overload\n def __call__( # type: ignore\n self,\n target: Any,\n *,\n spec: Optional[Any] = ...,\n create: bool = ...,\n spec_set: Optional[Any] = ...,\n autospec: Optional[Any] = ...,\n new_callable: Optional[Any] = ...,\n **kwargs: Any,\n ) -> _patch[MagicMock]: ...\n @overload\n def __call__(\n self,\n target: Any,\n new: _T,\n spec: Optional[Any] = ...,\n create: bool = ...,\n spec_set: Optional[Any] = ...,\n autospec: Optional[Any] = ...,\n new_callable: Optional[Any] = ...,\n **kwargs: Any,\n ) -> _patch[_T]: ...\n if sys.version_info >= (3, 8):\n @overload\n def object( # type: ignore\n self,\n target: Any,\n attribute: str,\n *,\n spec: Optional[Any] = ...,\n create: bool = ...,\n spec_set: Optional[Any] = ...,\n autospec: Optional[Any] = ...,\n new_callable: Optional[Any] = ...,\n **kwargs: Any,\n ) -> _patch[Union[MagicMock, AsyncMock]]: ...\n @overload\n def object(\n self,\n target: Any,\n attribute: str,\n new: _T = ...,\n spec: Optional[Any] = ...,\n create: bool = ...,\n spec_set: Optional[Any] = ...,\n autospec: Optional[Any] = ...,\n new_callable: Optional[Any] = ...,\n **kwargs: Any,\n ) -> _patch[_T]: ...\n else:\n @overload\n def object( # type: ignore\n self,\n target: Any,\n attribute: str,\n *,\n spec: Optional[Any] = ...,\n create: bool = ...,\n spec_set: Optional[Any] = ...,\n autospec: Optional[Any] = ...,\n new_callable: Optional[Any] = ...,\n **kwargs: Any,\n ) -> _patch[MagicMock]: ...\n @overload\n def object(\n self,\n target: Any,\n attribute: str,\n new: _T = ...,\n spec: Optional[Any] = ...,\n create: bool = ...,\n spec_set: Optional[Any] = ...,\n autospec: Optional[Any] = ...,\n new_callable: Optional[Any] = ...,\n **kwargs: Any,\n ) -> _patch[_T]: ...\n def multiple(\n self,\n target: Any,\n spec: Optional[Any] = ...,\n create: bool = ...,\n spec_set: Optional[Any] = ...,\n autospec: Optional[Any] = ...,\n new_callable: Optional[Any] = ...,\n **kwargs: _T,\n ) -> _patch[_T]: ...\n def stopall(self) -> None: ...\n\npatch: _patcher\n\nclass MagicMixin:\n def __init__(self, *args: Any, **kw: Any) -> None: ...\n\nclass NonCallableMagicMock(MagicMixin, NonCallableMock):\n def mock_add_spec(self, spec: Any, spec_set: bool = ...) -> None: ...\n\nclass MagicMock(MagicMixin, Mock):\n def mock_add_spec(self, spec: Any, spec_set: bool = ...) -> None: ...\n\nif sys.version_info >= (3, 8):\n class AsyncMockMixin(Base):\n def __init__(self, *args: Any, **kwargs: Any) -> None: ...\n async def _execute_mock_call(self, *args: Any, **kwargs: Any) -> Any: ...\n def assert_awaited(self) -> None: ...\n def assert_awaited_once(self) -> None: ...\n def assert_awaited_with(self, *args: Any, **kwargs: Any) -> None: ...\n def assert_awaited_once_with(self, *args: Any, **kwargs: Any) -> None: ...\n def assert_any_await(self, *args: Any, **kwargs: Any) -> None: ...\n def assert_has_awaits(self, calls: _CallList, any_order: bool = ...) -> None: ...\n def assert_not_awaited(self) -> None: ...\n def reset_mock(self, *args, **kwargs) -> None: ...\n await_count: int\n await_args: Optional[_Call]\n await_args_list: _CallList\n class AsyncMagicMixin(MagicMixin):\n def __init__(self, *args: Any, **kw: Any) -> None: ...\n class AsyncMock(AsyncMockMixin, AsyncMagicMixin, Mock): ...\n\nclass MagicProxy:\n name: Any\n parent: Any\n def __init__(self, name: Any, parent: Any) -> None: ...\n def __call__(self, *args: Any, **kwargs: Any) -> Any: ...\n def create_mock(self) -> Any: ...\n def __get__(self, obj: Any, _type: Optional[Any] = ...) -> Any: ...\n\nclass _ANY:\n def __eq__(self, other: Any) -> bool: ...\n def __ne__(self, other: Any) -> bool: ...\n\nANY: Any\n\ndef create_autospec(\n spec: Any, spec_set: Any = ..., instance: Any = ..., _parent: Optional[Any] = ..., _name: Optional[Any] = ..., **kwargs: Any\n) -> Any: ...\n\nclass _SpecState:\n spec: Any\n ids: Any\n spec_set: Any\n parent: Any\n instance: Any\n name: Any\n def __init__(\n self,\n spec: Any,\n spec_set: Any = ...,\n parent: Optional[Any] = ...,\n name: Optional[Any] = ...,\n ids: Optional[Any] = ...,\n instance: Any = ...,\n ) -> None: ...\n\ndef mock_open(mock: Optional[Any] = ..., read_data: Any = ...) -> Any: ...\n\nPropertyMock = Any\n\nif sys.version_info >= (3, 7):\n def seal(mock: Any) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\unittest\mock.pyi | mock.pyi | Other | 14,809 | 0.95 | 0.29932 | 0.056098 | react-lib | 825 | 2024-01-09T17:21:43.518460 | MIT | true | c3eec2f91e9df5ce4deca90bbb08513a |
import unittest.case\nfrom types import TracebackType\nfrom typing import Any, Callable, List, Optional, TextIO, Tuple, Type, TypeVar, Union\n\n_SysExcInfoType = Union[Tuple[Type[BaseException], BaseException, TracebackType], Tuple[None, None, None]]\n\n_F = TypeVar("_F", bound=Callable[..., Any])\n\n# undocumented\ndef failfast(method: _F) -> _F: ...\n\nclass TestResult:\n errors: List[Tuple[unittest.case.TestCase, str]]\n failures: List[Tuple[unittest.case.TestCase, str]]\n skipped: List[Tuple[unittest.case.TestCase, str]]\n expectedFailures: List[Tuple[unittest.case.TestCase, str]]\n unexpectedSuccesses: List[unittest.case.TestCase]\n shouldStop: bool\n testsRun: int\n buffer: bool\n failfast: bool\n tb_locals: bool\n def __init__(\n self, stream: Optional[TextIO] = ..., descriptions: Optional[bool] = ..., verbosity: Optional[int] = ...\n ) -> None: ...\n def printErrors(self) -> None: ...\n def wasSuccessful(self) -> bool: ...\n def stop(self) -> None: ...\n def startTest(self, test: unittest.case.TestCase) -> None: ...\n def stopTest(self, test: unittest.case.TestCase) -> None: ...\n def startTestRun(self) -> None: ...\n def stopTestRun(self) -> None: ...\n def addError(self, test: unittest.case.TestCase, err: _SysExcInfoType) -> None: ...\n def addFailure(self, test: unittest.case.TestCase, err: _SysExcInfoType) -> None: ...\n def addSuccess(self, test: unittest.case.TestCase) -> None: ...\n def addSkip(self, test: unittest.case.TestCase, reason: str) -> None: ...\n def addExpectedFailure(self, test: unittest.case.TestCase, err: _SysExcInfoType) -> None: ...\n def addUnexpectedSuccess(self, test: unittest.case.TestCase) -> None: ...\n def addSubTest(\n self, test: unittest.case.TestCase, subtest: unittest.case.TestCase, err: Optional[_SysExcInfoType]\n ) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\unittest\result.pyi | result.pyi | Other | 1,859 | 0.95 | 0.414634 | 0.027027 | node-utils | 841 | 2025-06-15T16:23:15.996898 | Apache-2.0 | true | e449cf43a17268b103b35a968979f346 |
import unittest.case\nimport unittest.result\nimport unittest.suite\nfrom typing import Callable, Optional, TextIO, Tuple, Type, Union\n\n_ResultClassType = Callable[[TextIO, bool, int], unittest.result.TestResult]\n\nclass TextTestResult(unittest.result.TestResult):\n descriptions: bool # undocumented\n dots: bool # undocumented\n separator1: str\n separator2: str\n showall: bool # undocumented\n stream: TextIO # undocumented\n def __init__(self, stream: TextIO, descriptions: bool, verbosity: int) -> None: ...\n def getDescription(self, test: unittest.case.TestCase) -> str: ...\n def printErrors(self) -> None: ...\n def printErrorList(self, flavour: str, errors: Tuple[unittest.case.TestCase, str]) -> None: ...\n\nclass TextTestRunner(object):\n resultclass: _ResultClassType\n def __init__(\n self,\n stream: Optional[TextIO] = ...,\n descriptions: bool = ...,\n verbosity: int = ...,\n failfast: bool = ...,\n buffer: bool = ...,\n resultclass: Optional[_ResultClassType] = ...,\n warnings: Optional[Type[Warning]] = ...,\n *,\n tb_locals: bool = ...,\n ) -> None: ...\n def _makeResult(self) -> unittest.result.TestResult: ...\n def run(self, test: Union[unittest.suite.TestSuite, unittest.case.TestCase]) -> unittest.result.TestResult: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\unittest\runner.pyi | runner.pyi | Other | 1,339 | 0.95 | 0.257143 | 0.03125 | vue-tools | 442 | 2025-02-22T19:58:06.049731 | BSD-3-Clause | true | 004a02943015b6a6ee87306c2b2e970b |
import unittest.result\nfrom typing import Any, Callable, TypeVar, overload\n\n_F = TypeVar("_F", bound=Callable[..., Any])\n\ndef installHandler() -> None: ...\ndef registerResult(result: unittest.result.TestResult) -> None: ...\ndef removeResult(result: unittest.result.TestResult) -> bool: ...\n@overload\ndef removeHandler(method: None = ...) -> None: ...\n@overload\ndef removeHandler(method: _F) -> _F: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\unittest\signals.pyi | signals.pyi | Other | 402 | 0.85 | 0.416667 | 0 | awesome-app | 970 | 2023-09-29T10:14:56.622586 | BSD-3-Clause | true | 5fe17a24d084bd3510c205890bcc4ca1 |
import unittest.case\nimport unittest.result\nfrom typing import Iterable, Iterator, List, Union\n\n_TestType = Union[unittest.case.TestCase, TestSuite]\n\nclass BaseTestSuite(Iterable[_TestType]):\n _tests: List[unittest.case.TestCase]\n _removed_tests: int\n def __init__(self, tests: Iterable[_TestType] = ...) -> None: ...\n def __call__(self, result: unittest.result.TestResult) -> unittest.result.TestResult: ...\n def addTest(self, test: _TestType) -> None: ...\n def addTests(self, tests: Iterable[_TestType]) -> None: ...\n def run(self, result: unittest.result.TestResult) -> unittest.result.TestResult: ...\n def debug(self) -> None: ...\n def countTestCases(self) -> int: ...\n def __iter__(self) -> Iterator[_TestType]: ...\n\nclass TestSuite(BaseTestSuite):\n def run(self, result: unittest.result.TestResult, debug: bool = ...) -> unittest.result.TestResult: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\unittest\suite.pyi | suite.pyi | Other | 892 | 0.85 | 0.55 | 0 | awesome-app | 403 | 2025-02-25T16:03:33.011868 | BSD-3-Clause | true | d9aa8e7b6676ac8354519ae461fb36c0 |
from typing import Any, List, Sequence, Tuple, TypeVar\n\n_T = TypeVar("_T")\n_Mismatch = Tuple[_T, _T, int]\n\n_MAX_LENGTH: int\n_PLACEHOLDER_LEN: int\n_MIN_BEGIN_LEN: int\n_MIN_END_LEN: int\n_MIN_COMMON_LEN: int\n_MIN_DIFF_LEN: int\n\ndef _shorten(s: str, prefixlen: int, suffixlen: int) -> str: ...\ndef _common_shorten_repr(*args: str) -> Tuple[str]: ...\ndef safe_repr(obj: object, short: bool = ...) -> str: ...\ndef strclass(cls: type) -> str: ...\ndef sorted_list_difference(expected: Sequence[_T], actual: Sequence[_T]) -> Tuple[List[_T], List[_T]]: ...\ndef unorderable_list_difference(expected: Sequence[_T], actual: Sequence[_T]) -> Tuple[List[_T], List[_T]]: ...\ndef three_way_cmp(x: Any, y: Any) -> int: ...\ndef _count_diff_all_purpose(actual: Sequence[_T], expected: Sequence[_T]) -> List[_Mismatch[_T]]: ...\ndef _count_diff_hashable(actual: Sequence[_T], expected: Sequence[_T]) -> List[_Mismatch[_T]]: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\unittest\util.pyi | util.pyi | Other | 906 | 0.85 | 0.428571 | 0 | react-lib | 347 | 2023-11-19T04:35:57.994501 | MIT | true | c10efa40774d05856e5fbed7fb24977f |
from typing import Optional\nfrom unittest.async_case import *\nfrom unittest.case import *\nfrom unittest.loader import *\nfrom unittest.main import *\nfrom unittest.result import TestResult as TestResult\nfrom unittest.runner import *\nfrom unittest.signals import *\nfrom unittest.suite import *\n\ndef load_tests(loader: TestLoader, tests: TestSuite, pattern: Optional[str]) -> TestSuite: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\unittest\__init__.pyi | __init__.pyi | Other | 387 | 0.85 | 0.090909 | 0 | vue-tools | 807 | 2023-10-07T19:18:38.572787 | BSD-3-Clause | true | f3e45a66a6542e8cb711f5faf92b9254 |
from typing import IO, Mapping, Optional, Union\nfrom urllib.response import addinfourl\n\n# Stubs for urllib.error\n\nclass URLError(IOError):\n reason: Union[str, BaseException]\n\nclass HTTPError(URLError, addinfourl):\n code: int\n def __init__(self, url: str, code: int, msg: str, hdrs: Mapping[str, str], fp: Optional[IO[bytes]]) -> None: ...\n\nclass ContentTooShortError(URLError): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\urllib\error.pyi | error.pyi | Other | 391 | 0.95 | 0.384615 | 0.111111 | python-kit | 515 | 2024-10-26T05:37:29.207396 | BSD-3-Clause | false | 690aa8f83efbe9041b57ac5973255685 |
import sys\nfrom typing import Any, AnyStr, Callable, Dict, Generic, List, Mapping, NamedTuple, Optional, Sequence, Tuple, Union, overload\n\nif sys.version_info >= (3, 9):\n from types import GenericAlias\n\n_Str = Union[bytes, str]\n\nuses_relative: List[str]\nuses_netloc: List[str]\nuses_params: List[str]\nnon_hierarchical: List[str]\nuses_query: List[str]\nuses_fragment: List[str]\nscheme_chars: str\nMAX_CACHE_SIZE: int\n\nclass _ResultMixinBase(Generic[AnyStr]):\n def geturl(self) -> AnyStr: ...\n\nclass _ResultMixinStr(_ResultMixinBase[str]):\n def encode(self, encoding: str = ..., errors: str = ...) -> _ResultMixinBytes: ...\n\nclass _ResultMixinBytes(_ResultMixinBase[str]):\n def decode(self, encoding: str = ..., errors: str = ...) -> _ResultMixinStr: ...\n\nclass _NetlocResultMixinBase(Generic[AnyStr]):\n username: Optional[AnyStr]\n password: Optional[AnyStr]\n hostname: Optional[AnyStr]\n port: Optional[int]\n if sys.version_info >= (3, 9):\n def __class_getitem__(cls, item: Any) -> GenericAlias: ...\n\nclass _NetlocResultMixinStr(_NetlocResultMixinBase[str], _ResultMixinStr): ...\nclass _NetlocResultMixinBytes(_NetlocResultMixinBase[bytes], _ResultMixinBytes): ...\n\nclass _DefragResultBase(Tuple[Any, ...], Generic[AnyStr]):\n url: AnyStr\n fragment: AnyStr\n\nclass _SplitResultBase(NamedTuple):\n scheme: str\n netloc: str\n path: str\n query: str\n fragment: str\n\nclass _SplitResultBytesBase(NamedTuple):\n scheme: bytes\n netloc: bytes\n path: bytes\n query: bytes\n fragment: bytes\n\nclass _ParseResultBase(NamedTuple):\n scheme: str\n netloc: str\n path: str\n params: str\n query: str\n fragment: str\n\nclass _ParseResultBytesBase(NamedTuple):\n scheme: bytes\n netloc: bytes\n path: bytes\n params: bytes\n query: bytes\n fragment: bytes\n\n# Structured result objects for string data\nclass DefragResult(_DefragResultBase[str], _ResultMixinStr): ...\nclass SplitResult(_SplitResultBase, _NetlocResultMixinStr): ...\nclass ParseResult(_ParseResultBase, _NetlocResultMixinStr): ...\n\n# Structured result objects for bytes data\nclass DefragResultBytes(_DefragResultBase[bytes], _ResultMixinBytes): ...\nclass SplitResultBytes(_SplitResultBytesBase, _NetlocResultMixinBytes): ...\nclass ParseResultBytes(_ParseResultBytesBase, _NetlocResultMixinBytes): ...\n\nif sys.version_info >= (3, 8):\n def parse_qs(\n qs: Optional[AnyStr],\n keep_blank_values: bool = ...,\n strict_parsing: bool = ...,\n encoding: str = ...,\n errors: str = ...,\n max_num_fields: Optional[int] = ...,\n ) -> Dict[AnyStr, List[AnyStr]]: ...\n def parse_qsl(\n qs: Optional[AnyStr],\n keep_blank_values: bool = ...,\n strict_parsing: bool = ...,\n encoding: str = ...,\n errors: str = ...,\n max_num_fields: Optional[int] = ...,\n ) -> List[Tuple[AnyStr, AnyStr]]: ...\n\nelse:\n def parse_qs(\n qs: Optional[AnyStr], keep_blank_values: bool = ..., strict_parsing: bool = ..., encoding: str = ..., errors: str = ...\n ) -> Dict[AnyStr, List[AnyStr]]: ...\n def parse_qsl(\n qs: Optional[AnyStr], keep_blank_values: bool = ..., strict_parsing: bool = ..., encoding: str = ..., errors: str = ...\n ) -> List[Tuple[AnyStr, AnyStr]]: ...\n\n@overload\ndef quote(string: str, safe: _Str = ..., encoding: Optional[str] = ..., errors: Optional[str] = ...) -> str: ...\n@overload\ndef quote(string: bytes, safe: _Str = ...) -> str: ...\ndef quote_from_bytes(bs: bytes, safe: _Str = ...) -> str: ...\n@overload\ndef quote_plus(string: str, safe: _Str = ..., encoding: Optional[str] = ..., errors: Optional[str] = ...) -> str: ...\n@overload\ndef quote_plus(string: bytes, safe: _Str = ...) -> str: ...\ndef unquote(string: str, encoding: str = ..., errors: str = ...) -> str: ...\ndef unquote_to_bytes(string: _Str) -> bytes: ...\ndef unquote_plus(string: str, encoding: str = ..., errors: str = ...) -> str: ...\n@overload\ndef urldefrag(url: str) -> DefragResult: ...\n@overload\ndef urldefrag(url: Optional[bytes]) -> DefragResultBytes: ...\ndef urlencode(\n query: Union[Mapping[Any, Any], Mapping[Any, Sequence[Any]], Sequence[Tuple[Any, Any]], Sequence[Tuple[Any, Sequence[Any]]]],\n doseq: bool = ...,\n safe: AnyStr = ...,\n encoding: str = ...,\n errors: str = ...,\n quote_via: Callable[[str, AnyStr, str, str], str] = ...,\n) -> str: ...\ndef urljoin(base: AnyStr, url: Optional[AnyStr], allow_fragments: bool = ...) -> AnyStr: ...\n@overload\ndef urlparse(url: str, scheme: Optional[str] = ..., allow_fragments: bool = ...) -> ParseResult: ...\n@overload\ndef urlparse(url: Optional[bytes], scheme: Optional[bytes] = ..., allow_fragments: bool = ...) -> ParseResultBytes: ...\n@overload\ndef urlsplit(url: str, scheme: Optional[str] = ..., allow_fragments: bool = ...) -> SplitResult: ...\n@overload\ndef urlsplit(url: Optional[bytes], scheme: Optional[bytes] = ..., allow_fragments: bool = ...) -> SplitResultBytes: ...\n@overload\ndef urlunparse(\n components: Tuple[Optional[AnyStr], Optional[AnyStr], Optional[AnyStr], Optional[AnyStr], Optional[AnyStr], Optional[AnyStr]]\n) -> AnyStr: ...\n@overload\ndef urlunparse(components: Sequence[Optional[AnyStr]]) -> AnyStr: ...\n@overload\ndef urlunsplit(\n components: Tuple[Optional[AnyStr], Optional[AnyStr], Optional[AnyStr], Optional[AnyStr], Optional[AnyStr]]\n) -> AnyStr: ...\n@overload\ndef urlunsplit(components: Sequence[Optional[AnyStr]]) -> AnyStr: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\urllib\parse.pyi | parse.pyi | Other | 5,436 | 0.95 | 0.328947 | 0.014925 | vue-tools | 283 | 2023-10-25T16:38:03.230664 | Apache-2.0 | false | 6e70da9b61c45eb9108a9e98ebcd83dc |
import os\nimport ssl\nfrom email.message import Message\nfrom http.client import HTTPMessage, HTTPResponse, _HTTPConnectionProtocol\nfrom http.cookiejar import CookieJar\nfrom typing import (\n IO,\n Any,\n Callable,\n ClassVar,\n Dict,\n List,\n Mapping,\n NoReturn,\n Optional,\n Pattern,\n Sequence,\n Tuple,\n TypeVar,\n Union,\n overload,\n)\nfrom urllib.error import HTTPError\nfrom urllib.response import addinfourl\n\n_T = TypeVar("_T")\n_UrlopenRet = Any\n\ndef urlopen(\n url: Union[str, Request],\n data: Optional[bytes] = ...,\n timeout: Optional[float] = ...,\n *,\n cafile: Optional[str] = ...,\n capath: Optional[str] = ...,\n cadefault: bool = ...,\n context: Optional[ssl.SSLContext] = ...,\n) -> _UrlopenRet: ...\ndef install_opener(opener: OpenerDirector) -> None: ...\ndef build_opener(*handlers: Union[BaseHandler, Callable[[], BaseHandler]]) -> OpenerDirector: ...\ndef url2pathname(pathname: str) -> str: ...\ndef pathname2url(pathname: str) -> str: ...\ndef getproxies() -> Dict[str, str]: ...\ndef parse_http_list(s: str) -> List[str]: ...\ndef parse_keqv_list(l: List[str]) -> Dict[str, str]: ...\ndef proxy_bypass(host: str) -> Any: ... # Undocumented\n\nclass Request:\n @property\n def full_url(self) -> str: ...\n @full_url.setter\n def full_url(self, value: str) -> None: ...\n @full_url.deleter\n def full_url(self) -> None: ...\n type: str\n host: str\n origin_req_host: str\n selector: str\n data: Optional[bytes]\n headers: Dict[str, str]\n unverifiable: bool\n method: Optional[str]\n def __init__(\n self,\n url: str,\n data: Optional[bytes] = ...,\n headers: Dict[str, str] = ...,\n origin_req_host: Optional[str] = ...,\n unverifiable: bool = ...,\n method: Optional[str] = ...,\n ) -> None: ...\n def get_method(self) -> str: ...\n def add_header(self, key: str, val: str) -> None: ...\n def add_unredirected_header(self, key: str, val: str) -> None: ...\n def has_header(self, header_name: str) -> bool: ...\n def remove_header(self, header_name: str) -> None: ...\n def get_full_url(self) -> str: ...\n def set_proxy(self, host: str, type: str) -> None: ...\n @overload\n def get_header(self, header_name: str) -> Optional[str]: ...\n @overload\n def get_header(self, header_name: str, default: _T) -> Union[str, _T]: ...\n def header_items(self) -> List[Tuple[str, str]]: ...\n def has_proxy(self) -> bool: ...\n\nclass OpenerDirector:\n addheaders: List[Tuple[str, str]]\n def add_handler(self, handler: BaseHandler) -> None: ...\n def open(self, fullurl: Union[str, Request], data: Optional[bytes] = ..., timeout: Optional[float] = ...) -> _UrlopenRet: ...\n def error(self, proto: str, *args: Any) -> _UrlopenRet: ...\n def close(self) -> None: ...\n\nclass BaseHandler:\n handler_order: ClassVar[int]\n parent: OpenerDirector\n def add_parent(self, parent: OpenerDirector) -> None: ...\n def close(self) -> None: ...\n def http_error_nnn(self, req: Request, fp: IO[str], code: int, msg: int, headers: Mapping[str, str]) -> _UrlopenRet: ...\n\nclass HTTPDefaultErrorHandler(BaseHandler):\n def http_error_default(\n self, req: Request, fp: IO[bytes], code: int, msg: str, hdrs: Mapping[str, str]\n ) -> HTTPError: ... # undocumented\n\nclass HTTPRedirectHandler(BaseHandler):\n max_redirections: ClassVar[int] # undocumented\n max_repeats: ClassVar[int] # undocumented\n inf_msg: ClassVar[str] # undocumented\n def redirect_request(\n self, req: Request, fp: IO[str], code: int, msg: str, headers: Mapping[str, str], newurl: str\n ) -> Optional[Request]: ...\n def http_error_301(\n self, req: Request, fp: IO[str], code: int, msg: int, headers: Mapping[str, str]\n ) -> Optional[_UrlopenRet]: ...\n def http_error_302(\n self, req: Request, fp: IO[str], code: int, msg: int, headers: Mapping[str, str]\n ) -> Optional[_UrlopenRet]: ...\n def http_error_303(\n self, req: Request, fp: IO[str], code: int, msg: int, headers: Mapping[str, str]\n ) -> Optional[_UrlopenRet]: ...\n def http_error_307(\n self, req: Request, fp: IO[str], code: int, msg: int, headers: Mapping[str, str]\n ) -> Optional[_UrlopenRet]: ...\n\nclass HTTPCookieProcessor(BaseHandler):\n cookiejar: CookieJar\n def __init__(self, cookiejar: Optional[CookieJar] = ...) -> None: ...\n def http_request(self, request: Request) -> Request: ... # undocumented\n def http_response(self, request: Request, response: HTTPResponse) -> HTTPResponse: ... # undocumented\n def https_request(self, request: Request) -> Request: ... # undocumented\n def https_response(self, request: Request, response: HTTPResponse) -> HTTPResponse: ... # undocumented\n\nclass ProxyHandler(BaseHandler):\n def __init__(self, proxies: Optional[Dict[str, str]] = ...) -> None: ...\n def proxy_open(self, req: Request, proxy: str, type: str) -> Optional[_UrlopenRet]: ... # undocumented\n # TODO add a method for every (common) proxy protocol\n\nclass HTTPPasswordMgr:\n def add_password(self, realm: str, uri: Union[str, Sequence[str]], user: str, passwd: str) -> None: ...\n def find_user_password(self, realm: str, authuri: str) -> Tuple[Optional[str], Optional[str]]: ...\n def is_suburi(self, base: str, test: str) -> bool: ... # undocumented\n def reduce_uri(self, uri: str, default_port: bool = ...) -> str: ... # undocumented\n\nclass HTTPPasswordMgrWithDefaultRealm(HTTPPasswordMgr):\n def add_password(self, realm: Optional[str], uri: Union[str, Sequence[str]], user: str, passwd: str) -> None: ...\n def find_user_password(self, realm: Optional[str], authuri: str) -> Tuple[Optional[str], Optional[str]]: ...\n\nclass HTTPPasswordMgrWithPriorAuth(HTTPPasswordMgrWithDefaultRealm):\n def add_password(\n self, realm: Optional[str], uri: Union[str, Sequence[str]], user: str, passwd: str, is_authenticated: bool = ...\n ) -> None: ...\n def update_authenticated(self, uri: Union[str, Sequence[str]], is_authenticated: bool = ...) -> None: ...\n def is_authenticated(self, authuri: str) -> bool: ...\n\nclass AbstractBasicAuthHandler:\n rx: ClassVar[Pattern[str]] # undocumented\n def __init__(self, password_mgr: Optional[HTTPPasswordMgr] = ...) -> None: ...\n def http_error_auth_reqed(self, authreq: str, host: str, req: Request, headers: Mapping[str, str]) -> None: ...\n def http_request(self, req: Request) -> Request: ... # undocumented\n def http_response(self, req: Request, response: HTTPResponse) -> HTTPResponse: ... # undocumented\n def https_request(self, req: Request) -> Request: ... # undocumented\n def https_response(self, req: Request, response: HTTPResponse) -> HTTPResponse: ... # undocumented\n def retry_http_basic_auth(self, host: str, req: Request, realm: str) -> Optional[_UrlopenRet]: ... # undocumented\n\nclass HTTPBasicAuthHandler(AbstractBasicAuthHandler, BaseHandler):\n auth_header: ClassVar[str] # undocumented\n def http_error_401(\n self, req: Request, fp: IO[str], code: int, msg: int, headers: Mapping[str, str]\n ) -> Optional[_UrlopenRet]: ...\n\nclass ProxyBasicAuthHandler(AbstractBasicAuthHandler, BaseHandler):\n auth_header: ClassVar[str]\n def http_error_407(\n self, req: Request, fp: IO[str], code: int, msg: int, headers: Mapping[str, str]\n ) -> Optional[_UrlopenRet]: ...\n\nclass AbstractDigestAuthHandler:\n def __init__(self, passwd: Optional[HTTPPasswordMgr] = ...) -> None: ...\n def reset_retry_count(self) -> None: ...\n def http_error_auth_reqed(self, auth_header: str, host: str, req: Request, headers: Mapping[str, str]) -> None: ...\n def retry_http_digest_auth(self, req: Request, auth: str) -> Optional[_UrlopenRet]: ...\n def get_cnonce(self, nonce: str) -> str: ...\n def get_authorization(self, req: Request, chal: Mapping[str, str]) -> str: ...\n def get_algorithm_impls(self, algorithm: str) -> Tuple[Callable[[str], str], Callable[[str, str], str]]: ...\n def get_entity_digest(self, data: Optional[bytes], chal: Mapping[str, str]) -> Optional[str]: ...\n\nclass HTTPDigestAuthHandler(BaseHandler, AbstractDigestAuthHandler):\n auth_header: ClassVar[str] # undocumented\n def http_error_401(\n self, req: Request, fp: IO[str], code: int, msg: int, headers: Mapping[str, str]\n ) -> Optional[_UrlopenRet]: ...\n\nclass ProxyDigestAuthHandler(BaseHandler, AbstractDigestAuthHandler):\n auth_header: ClassVar[str] # undocumented\n def http_error_407(\n self, req: Request, fp: IO[str], code: int, msg: int, headers: Mapping[str, str]\n ) -> Optional[_UrlopenRet]: ...\n\nclass AbstractHTTPHandler(BaseHandler): # undocumented\n def __init__(self, debuglevel: int = ...) -> None: ...\n def set_http_debuglevel(self, level: int) -> None: ...\n def do_request_(self, request: Request) -> Request: ...\n def do_open(self, http_class: _HTTPConnectionProtocol, req: Request, **http_conn_args: Any) -> HTTPResponse: ...\n\nclass HTTPHandler(AbstractHTTPHandler):\n def http_open(self, req: Request) -> HTTPResponse: ...\n def http_request(self, request: Request) -> Request: ... # undocumented\n\nclass HTTPSHandler(AbstractHTTPHandler):\n def __init__(\n self, debuglevel: int = ..., context: Optional[ssl.SSLContext] = ..., check_hostname: Optional[bool] = ...\n ) -> None: ...\n def https_open(self, req: Request) -> HTTPResponse: ...\n def https_request(self, request: Request) -> Request: ... # undocumented\n\nclass FileHandler(BaseHandler):\n names: ClassVar[Optional[Tuple[str, ...]]] # undocumented\n def file_open(self, req: Request) -> addinfourl: ...\n def get_names(self) -> Tuple[str, ...]: ... # undocumented\n def open_local_file(self, req: Request) -> addinfourl: ... # undocumented\n\nclass DataHandler(BaseHandler):\n def data_open(self, req: Request) -> addinfourl: ...\n\nclass ftpwrapper: # undocumented\n def __init__(\n self, user: str, passwd: str, host: str, port: int, dirs: str, timeout: Optional[float] = ..., persistent: bool = ...\n ) -> None: ...\n\nclass FTPHandler(BaseHandler):\n def ftp_open(self, req: Request) -> addinfourl: ...\n def connect_ftp(\n self, user: str, passwd: str, host: str, port: int, dirs: str, timeout: float\n ) -> ftpwrapper: ... # undocumented\n\nclass CacheFTPHandler(FTPHandler):\n def setTimeout(self, t: float) -> None: ...\n def setMaxConns(self, m: int) -> None: ...\n def check_cache(self) -> None: ... # undocumented\n def clear_cache(self) -> None: ... # undocumented\n def connect_ftp(\n self, user: str, passwd: str, host: str, port: int, dirs: str, timeout: float\n ) -> ftpwrapper: ... # undocumented\n\nclass UnknownHandler(BaseHandler):\n def unknown_open(self, req: Request) -> NoReturn: ...\n\nclass HTTPErrorProcessor(BaseHandler):\n def http_response(self, request: Request, response: HTTPResponse) -> _UrlopenRet: ...\n def https_response(self, request: Request, response: HTTPResponse) -> _UrlopenRet: ...\n\ndef urlretrieve(\n url: str,\n filename: Optional[Union[str, os.PathLike[Any]]] = ...,\n reporthook: Optional[Callable[[int, int, int], None]] = ...,\n data: Optional[bytes] = ...,\n) -> Tuple[str, HTTPMessage]: ...\ndef urlcleanup() -> None: ...\n\nclass URLopener:\n version: ClassVar[str]\n def __init__(self, proxies: Optional[Dict[str, str]] = ..., **x509: str) -> None: ...\n def open(self, fullurl: str, data: Optional[bytes] = ...) -> _UrlopenRet: ...\n def open_unknown(self, fullurl: str, data: Optional[bytes] = ...) -> _UrlopenRet: ...\n def retrieve(\n self,\n url: str,\n filename: Optional[str] = ...,\n reporthook: Optional[Callable[[int, int, int], None]] = ...,\n data: Optional[bytes] = ...,\n ) -> Tuple[str, Optional[Message]]: ...\n def addheader(self, *args: Tuple[str, str]) -> None: ... # undocumented\n def cleanup(self) -> None: ... # undocumented\n def close(self) -> None: ... # undocumented\n def http_error(\n self, url: str, fp: IO[bytes], errcode: int, errmsg: str, headers: Mapping[str, str], data: Optional[bytes] = ...\n ) -> _UrlopenRet: ... # undocumented\n def http_error_default(\n self, url: str, fp: IO[bytes], errcode: int, errmsg: str, headers: Mapping[str, str]\n ) -> _UrlopenRet: ... # undocumented\n def open_data(self, url: str, data: Optional[bytes] = ...) -> addinfourl: ... # undocumented\n def open_file(self, url: str) -> addinfourl: ... # undocumented\n def open_ftp(self, url: str) -> addinfourl: ... # undocumented\n def open_http(self, url: str, data: Optional[bytes] = ...) -> _UrlopenRet: ... # undocumented\n def open_https(self, url: str, data: Optional[bytes] = ...) -> _UrlopenRet: ... # undocumented\n def open_local_file(self, url: str) -> addinfourl: ... # undocumented\n def open_unknown_proxy(self, proxy: str, fullurl: str, data: Optional[bytes] = ...) -> None: ... # undocumented\n\nclass FancyURLopener(URLopener):\n def prompt_user_passwd(self, host: str, realm: str) -> Tuple[str, str]: ...\n def get_user_passwd(self, host: str, realm: str, clear_cache: int = ...) -> Tuple[str, str]: ... # undocumented\n def http_error_301(\n self, url: str, fp: IO[str], errcode: int, errmsg: str, headers: Mapping[str, str], data: Optional[bytes] = ...\n ) -> Optional[Union[_UrlopenRet, addinfourl]]: ... # undocumented\n def http_error_302(\n self, url: str, fp: IO[str], errcode: int, errmsg: str, headers: Mapping[str, str], data: Optional[bytes] = ...\n ) -> Optional[Union[_UrlopenRet, addinfourl]]: ... # undocumented\n def http_error_303(\n self, url: str, fp: IO[str], errcode: int, errmsg: str, headers: Mapping[str, str], data: Optional[bytes] = ...\n ) -> Optional[Union[_UrlopenRet, addinfourl]]: ... # undocumented\n def http_error_307(\n self, url: str, fp: IO[str], errcode: int, errmsg: str, headers: Mapping[str, str], data: Optional[bytes] = ...\n ) -> Optional[Union[_UrlopenRet, addinfourl]]: ... # undocumented\n def http_error_401(\n self,\n url: str,\n fp: IO[str],\n errcode: int,\n errmsg: str,\n headers: Mapping[str, str],\n data: Optional[bytes] = ...,\n retry: bool = ...,\n ) -> Optional[_UrlopenRet]: ... # undocumented\n def http_error_407(\n self,\n url: str,\n fp: IO[str],\n errcode: int,\n errmsg: str,\n headers: Mapping[str, str],\n data: Optional[bytes] = ...,\n retry: bool = ...,\n ) -> Optional[_UrlopenRet]: ... # undocumented\n def http_error_default(\n self, url: str, fp: IO[bytes], errcode: int, errmsg: str, headers: Mapping[str, str]\n ) -> addinfourl: ... # undocumented\n def redirect_internal(\n self, url: str, fp: IO[str], errcode: int, errmsg: str, headers: Mapping[str, str], data: Optional[bytes]\n ) -> Optional[_UrlopenRet]: ... # undocumented\n def retry_http_basic_auth(\n self, url: str, realm: str, data: Optional[bytes] = ...\n ) -> Optional[_UrlopenRet]: ... # undocumented\n def retry_https_basic_auth(\n self, url: str, realm: str, data: Optional[bytes] = ...\n ) -> Optional[_UrlopenRet]: ... # undocumented\n def retry_proxy_http_basic_auth(\n self, url: str, realm: str, data: Optional[bytes] = ...\n ) -> Optional[_UrlopenRet]: ... # undocumented\n def retry_proxy_https_basic_auth(\n self, url: str, realm: str, data: Optional[bytes] = ...\n ) -> Optional[_UrlopenRet]: ... # undocumented\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\urllib\request.pyi | request.pyi | Other | 15,581 | 0.95 | 0.460411 | 0.006452 | react-lib | 965 | 2024-03-14T08:25:22.998265 | Apache-2.0 | false | 7fb084c63fb675579e92fb8b474a560c |
from email.message import Message\nfrom types import TracebackType\nfrom typing import IO, Any, BinaryIO, Callable, Iterable, List, Optional, Tuple, Type, TypeVar\n\n_AIUT = TypeVar("_AIUT", bound=addbase)\n\nclass addbase(BinaryIO):\n fp: IO[bytes]\n def __init__(self, fp: IO[bytes]) -> None: ...\n def __enter__(self: _AIUT) -> _AIUT: ...\n def __exit__(\n self, type: Optional[Type[BaseException]], value: Optional[BaseException], traceback: Optional[TracebackType]\n ) -> None: ...\n def __iter__(self: _AIUT) -> _AIUT: ...\n def __next__(self) -> bytes: ...\n def close(self) -> None: ...\n # These methods don't actually exist, but the class inherits at runtime from\n # tempfile._TemporaryFileWrapper, which uses __getattr__ to delegate to the\n # underlying file object. To satisfy the BinaryIO interface, we pretend that this\n # class has these additional methods.\n def fileno(self) -> int: ...\n def flush(self) -> None: ...\n def isatty(self) -> bool: ...\n def read(self, n: int = ...) -> bytes: ...\n def readable(self) -> bool: ...\n def readline(self, limit: int = ...) -> bytes: ...\n def readlines(self, hint: int = ...) -> List[bytes]: ...\n def seek(self, offset: int, whence: int = ...) -> int: ...\n def seekable(self) -> bool: ...\n def tell(self) -> int: ...\n def truncate(self, size: Optional[int] = ...) -> int: ...\n def writable(self) -> bool: ...\n def write(self, s: bytes) -> int: ...\n def writelines(self, lines: Iterable[bytes]) -> None: ...\n\nclass addclosehook(addbase):\n closehook: Callable[..., object]\n hookargs: Tuple[Any, ...]\n def __init__(self, fp: IO[bytes], closehook: Callable[..., object], *hookargs: Any) -> None: ...\n\nclass addinfo(addbase):\n headers: Message\n def __init__(self, fp: IO[bytes], headers: Message) -> None: ...\n def info(self) -> Message: ...\n\nclass addinfourl(addinfo):\n url: str\n code: int\n def __init__(self, fp: IO[bytes], headers: Message, url: str, code: Optional[int] = ...) -> None: ...\n def geturl(self) -> str: ...\n def getcode(self) -> int: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\urllib\response.pyi | response.pyi | Other | 2,107 | 0.95 | 0.627451 | 0.086957 | react-lib | 155 | 2023-10-13T07:37:32.419931 | GPL-3.0 | false | 529a069b361cc6d954d5a0138183eeb4 |
import sys\nfrom typing import Iterable, List, NamedTuple, Optional\n\nclass _RequestRate(NamedTuple):\n requests: int\n seconds: int\n\nclass RobotFileParser:\n def __init__(self, url: str = ...) -> None: ...\n def set_url(self, url: str) -> None: ...\n def read(self) -> None: ...\n def parse(self, lines: Iterable[str]) -> None: ...\n def can_fetch(self, user_agent: str, url: str) -> bool: ...\n def mtime(self) -> int: ...\n def modified(self) -> None: ...\n def crawl_delay(self, useragent: str) -> Optional[str]: ...\n def request_rate(self, useragent: str) -> Optional[_RequestRate]: ...\n if sys.version_info >= (3, 8):\n def site_maps(self) -> Optional[List[str]]: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\urllib\robotparser.pyi | robotparser.pyi | Other | 704 | 0.85 | 0.684211 | 0 | python-kit | 523 | 2024-03-28T03:33:39.882464 | MIT | false | d83b78b0db0bd71e8dae29d9b1173d24 |
import sys\nfrom _typeshed import AnyPath\nfrom types import SimpleNamespace\nfrom typing import Optional, Sequence\n\nclass EnvBuilder:\n system_site_packages: bool\n clear: bool\n symlinks: bool\n upgrade: bool\n with_pip: bool\n if sys.version_info >= (3, 6):\n prompt: Optional[str]\n\n if sys.version_info >= (3, 9):\n def __init__(\n self,\n system_site_packages: bool = ...,\n clear: bool = ...,\n symlinks: bool = ...,\n upgrade: bool = ...,\n with_pip: bool = ...,\n prompt: Optional[str] = ...,\n upgrade_deps: bool = ...,\n ) -> None: ...\n elif sys.version_info >= (3, 6):\n def __init__(\n self,\n system_site_packages: bool = ...,\n clear: bool = ...,\n symlinks: bool = ...,\n upgrade: bool = ...,\n with_pip: bool = ...,\n prompt: Optional[str] = ...,\n ) -> None: ...\n else:\n def __init__(\n self,\n system_site_packages: bool = ...,\n clear: bool = ...,\n symlinks: bool = ...,\n upgrade: bool = ...,\n with_pip: bool = ...,\n ) -> None: ...\n def create(self, env_dir: AnyPath) -> None: ...\n def clear_directory(self, path: AnyPath) -> None: ... # undocumented\n def ensure_directories(self, env_dir: AnyPath) -> SimpleNamespace: ...\n def create_configuration(self, context: SimpleNamespace) -> None: ...\n def symlink_or_copy(self, src: AnyPath, dst: AnyPath, relative_symlinks_ok: bool = ...) -> None: ... # undocumented\n def setup_python(self, context: SimpleNamespace) -> None: ...\n def _setup_pip(self, context: SimpleNamespace) -> None: ... # undocumented\n def setup_scripts(self, context: SimpleNamespace) -> None: ...\n def post_setup(self, context: SimpleNamespace) -> None: ...\n def replace_variables(self, text: str, context: SimpleNamespace) -> str: ... # undocumented\n def install_scripts(self, context: SimpleNamespace, path: str) -> None: ...\n if sys.version_info >= (3, 9):\n def upgrade_dependencies(self, context: SimpleNamespace) -> None: ...\n\nif sys.version_info >= (3, 9):\n def create(\n env_dir: AnyPath,\n system_site_packages: bool = ...,\n clear: bool = ...,\n symlinks: bool = ...,\n with_pip: bool = ...,\n prompt: Optional[str] = ...,\n upgrade_deps: bool = ...,\n ) -> None: ...\n\nelif sys.version_info >= (3, 6):\n def create(\n env_dir: AnyPath,\n system_site_packages: bool = ...,\n clear: bool = ...,\n symlinks: bool = ...,\n with_pip: bool = ...,\n prompt: Optional[str] = ...,\n ) -> None: ...\n\nelse:\n def create(\n env_dir: AnyPath, system_site_packages: bool = ..., clear: bool = ..., symlinks: bool = ..., with_pip: bool = ...\n ) -> None: ...\n\ndef main(args: Optional[Sequence[str]] = ...) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\venv\__init__.pyi | __init__.pyi | Other | 2,967 | 0.95 | 0.282353 | 0 | react-lib | 487 | 2025-05-21T23:03:47.831347 | GPL-3.0 | false | 1b46712fdb9eff70d82cb7b143c14ab7 |
import gzip\nimport http.client\nimport sys\nimport time\nfrom _typeshed import SupportsRead, SupportsWrite\nfrom datetime import datetime\nfrom io import BytesIO\nfrom types import TracebackType\nfrom typing import Any, Callable, Dict, Iterable, List, Mapping, Optional, Protocol, Tuple, Type, Union, overload\nfrom typing_extensions import Literal\n\nclass _SupportsTimeTuple(Protocol):\n def timetuple(self) -> time.struct_time: ...\n\n_DateTimeComparable = Union[DateTime, datetime, str, _SupportsTimeTuple]\n_Marshallable = Union[None, bool, int, float, str, bytes, tuple, list, dict, datetime, DateTime, Binary]\n_XMLDate = Union[int, datetime, Tuple[int, ...], time.struct_time]\n_HostType = Union[Tuple[str, Dict[str, str]], str]\n\ndef escape(s: str) -> str: ... # undocumented\n\nPARSE_ERROR: int # undocumented\nSERVER_ERROR: int # undocumented\nAPPLICATION_ERROR: int # undocumented\nSYSTEM_ERROR: int # undocumented\nTRANSPORT_ERROR: int # undocumented\n\nNOT_WELLFORMED_ERROR: int # undocumented\nUNSUPPORTED_ENCODING: int # undocumented\nINVALID_ENCODING_CHAR: int # undocumented\nINVALID_XMLRPC: int # undocumented\nMETHOD_NOT_FOUND: int # undocumented\nINVALID_METHOD_PARAMS: int # undocumented\nINTERNAL_ERROR: int # undocumented\n\nclass Error(Exception): ...\n\nclass ProtocolError(Error):\n\n url: str\n errcode: int\n errmsg: str\n headers: Dict[str, str]\n def __init__(self, url: str, errcode: int, errmsg: str, headers: Dict[str, str]) -> None: ...\n\nclass ResponseError(Error): ...\n\nclass Fault(Error):\n\n faultCode: str\n faultString: str\n def __init__(self, faultCode: str, faultString: str, **extra: Any) -> None: ...\n\nboolean = bool\nBoolean = bool\n\ndef _iso8601_format(value: datetime) -> str: ... # undocumented\ndef _strftime(value: _XMLDate) -> str: ... # undocumented\n\nclass DateTime:\n\n value: str # undocumented\n def __init__(self, value: Union[int, str, datetime, time.struct_time, Tuple[int, ...]] = ...) -> None: ...\n def __lt__(self, other: _DateTimeComparable) -> bool: ...\n def __le__(self, other: _DateTimeComparable) -> bool: ...\n def __gt__(self, other: _DateTimeComparable) -> bool: ...\n def __ge__(self, other: _DateTimeComparable) -> bool: ...\n def __eq__(self, other: _DateTimeComparable) -> bool: ... # type: ignore\n def make_comparable(self, other: _DateTimeComparable) -> Tuple[str, str]: ... # undocumented\n def timetuple(self) -> time.struct_time: ... # undocumented\n def decode(self, data: Any) -> None: ...\n def encode(self, out: SupportsWrite[str]) -> None: ...\n\ndef _datetime(data: Any) -> DateTime: ... # undocumented\ndef _datetime_type(data: str) -> datetime: ... # undocumented\n\nclass Binary:\n\n data: bytes\n def __init__(self, data: Optional[bytes] = ...) -> None: ...\n def decode(self, data: bytes) -> None: ...\n def encode(self, out: SupportsWrite[str]) -> None: ...\n\ndef _binary(data: bytes) -> Binary: ... # undocumented\n\nWRAPPERS: Tuple[Type[DateTime], Type[Binary]] # undocumented\n\nclass ExpatParser: # undocumented\n def __init__(self, target: Unmarshaller) -> None: ...\n def feed(self, data: Union[str, bytes]) -> None: ...\n def close(self) -> None: ...\n\nclass Marshaller:\n\n dispatch: Dict[\n Type[Any], Callable[[Marshaller, Any, Callable[[str], Any]], None]\n ] = ... # TODO: Replace 'Any' with some kind of binding\n\n memo: Dict[Any, None]\n data: None\n encoding: Optional[str]\n allow_none: bool\n def __init__(self, encoding: Optional[str] = ..., allow_none: bool = ...) -> None: ...\n def dumps(self, values: Union[Fault, Iterable[_Marshallable]]) -> str: ...\n def __dump(self, value: Union[_Marshallable], write: Callable[[str], Any]) -> None: ... # undocumented\n def dump_nil(self, value: None, write: Callable[[str], Any]) -> None: ...\n def dump_bool(self, value: bool, write: Callable[[str], Any]) -> None: ...\n def dump_long(self, value: int, write: Callable[[str], Any]) -> None: ...\n def dump_int(self, value: int, write: Callable[[str], Any]) -> None: ...\n def dump_double(self, value: float, write: Callable[[str], Any]) -> None: ...\n def dump_unicode(self, value: str, write: Callable[[str], Any], escape: Callable[[str], str] = ...) -> None: ...\n def dump_bytes(self, value: bytes, write: Callable[[str], Any]) -> None: ...\n def dump_array(self, value: Iterable[_Marshallable], write: Callable[[str], Any]) -> None: ...\n def dump_struct(\n self, value: Mapping[str, _Marshallable], write: Callable[[str], Any], escape: Callable[[str], str] = ...\n ) -> None: ...\n def dump_datetime(self, value: _XMLDate, write: Callable[[str], Any]) -> None: ...\n def dump_instance(self, value: object, write: Callable[[str], Any]) -> None: ...\n\nclass Unmarshaller:\n\n dispatch: Dict[str, Callable[[Unmarshaller, str], None]] = ...\n\n _type: Optional[str]\n _stack: List[_Marshallable]\n _marks: List[int]\n _data: List[str]\n _value: bool\n _methodname: Optional[str]\n _encoding: str\n append: Callable[[Any], None]\n _use_datetime: bool\n _use_builtin_types: bool\n def __init__(self, use_datetime: bool = ..., use_builtin_types: bool = ...) -> None: ...\n def close(self) -> Tuple[_Marshallable, ...]: ...\n def getmethodname(self) -> Optional[str]: ...\n def xml(self, encoding: str, standalone: Any) -> None: ... # Standalone is ignored\n def start(self, tag: str, attrs: Dict[str, str]) -> None: ...\n def data(self, text: str) -> None: ...\n def end(self, tag: str) -> None: ...\n def end_dispatch(self, tag: str, data: str) -> None: ...\n def end_nil(self, data: str) -> None: ...\n def end_boolean(self, data: str) -> None: ...\n def end_int(self, data: str) -> None: ...\n def end_double(self, data: str) -> None: ...\n def end_bigdecimal(self, data: str) -> None: ...\n def end_string(self, data: str) -> None: ...\n def end_array(self, data: str) -> None: ...\n def end_struct(self, data: str) -> None: ...\n def end_base64(self, data: str) -> None: ...\n def end_dateTime(self, data: str) -> None: ...\n def end_value(self, data: str) -> None: ...\n def end_params(self, data: str) -> None: ...\n def end_fault(self, data: str) -> None: ...\n def end_methodName(self, data: str) -> None: ...\n\nclass _MultiCallMethod: # undocumented\n\n __call_list: List[Tuple[str, Tuple[_Marshallable, ...]]]\n __name: str\n def __init__(self, call_list: List[Tuple[str, _Marshallable]], name: str) -> None: ...\n def __getattr__(self, name: str) -> _MultiCallMethod: ...\n def __call__(self, *args: _Marshallable) -> None: ...\n\nclass MultiCallIterator: # undocumented\n\n results: List[List[_Marshallable]]\n def __init__(self, results: List[List[_Marshallable]]) -> None: ...\n def __getitem__(self, i: int) -> _Marshallable: ...\n\nclass MultiCall:\n\n __server: ServerProxy\n __call_list: List[Tuple[str, Tuple[_Marshallable, ...]]]\n def __init__(self, server: ServerProxy) -> None: ...\n def __getattr__(self, item: str) -> _MultiCallMethod: ...\n def __call__(self) -> MultiCallIterator: ...\n\n# A little white lie\nFastMarshaller: Optional[Marshaller]\nFastParser: Optional[ExpatParser]\nFastUnmarshaller: Optional[Unmarshaller]\n\ndef getparser(use_datetime: bool = ..., use_builtin_types: bool = ...) -> Tuple[ExpatParser, Unmarshaller]: ...\ndef dumps(\n params: Union[Fault, Tuple[_Marshallable, ...]],\n methodname: Optional[str] = ...,\n methodresponse: Optional[bool] = ...,\n encoding: Optional[str] = ...,\n allow_none: bool = ...,\n) -> str: ...\ndef loads(\n data: str, use_datetime: bool = ..., use_builtin_types: bool = ...\n) -> Tuple[Tuple[_Marshallable, ...], Optional[str]]: ...\ndef gzip_encode(data: bytes) -> bytes: ... # undocumented\ndef gzip_decode(data: bytes, max_decode: int = ...) -> bytes: ... # undocumented\n\nclass GzipDecodedResponse(gzip.GzipFile): # undocumented\n\n io: BytesIO\n def __init__(self, response: SupportsRead[bytes]) -> None: ...\n def close(self) -> None: ...\n\nclass _Method: # undocumented\n\n __send: Callable[[str, Tuple[_Marshallable, ...]], _Marshallable]\n __name: str\n def __init__(self, send: Callable[[str, Tuple[_Marshallable, ...]], _Marshallable], name: str) -> None: ...\n def __getattr__(self, name: str) -> _Method: ...\n def __call__(self, *args: _Marshallable) -> _Marshallable: ...\n\nclass Transport:\n\n user_agent: str = ...\n accept_gzip_encoding: bool = ...\n encode_threshold: Optional[int] = ...\n\n _use_datetime: bool\n _use_builtin_types: bool\n _connection: Tuple[Optional[_HostType], Optional[http.client.HTTPConnection]]\n _headers: List[Tuple[str, str]]\n _extra_headers: List[Tuple[str, str]]\n\n if sys.version_info >= (3, 8):\n def __init__(\n self, use_datetime: bool = ..., use_builtin_types: bool = ..., *, headers: Iterable[Tuple[str, str]] = ...\n ) -> None: ...\n else:\n def __init__(self, use_datetime: bool = ..., use_builtin_types: bool = ...) -> None: ...\n def request(self, host: _HostType, handler: str, request_body: bytes, verbose: bool = ...) -> Tuple[_Marshallable, ...]: ...\n def single_request(\n self, host: _HostType, handler: str, request_body: bytes, verbose: bool = ...\n ) -> Tuple[_Marshallable, ...]: ...\n def getparser(self) -> Tuple[ExpatParser, Unmarshaller]: ...\n def get_host_info(self, host: _HostType) -> Tuple[str, List[Tuple[str, str]], Dict[str, str]]: ...\n def make_connection(self, host: _HostType) -> http.client.HTTPConnection: ...\n def close(self) -> None: ...\n def send_request(self, host: _HostType, handler: str, request_body: bytes, debug: bool) -> http.client.HTTPConnection: ...\n def send_headers(self, connection: http.client.HTTPConnection, headers: List[Tuple[str, str]]) -> None: ...\n def send_content(self, connection: http.client.HTTPConnection, request_body: bytes) -> None: ...\n def parse_response(self, response: http.client.HTTPResponse) -> Tuple[_Marshallable, ...]: ...\n\nclass SafeTransport(Transport):\n\n if sys.version_info >= (3, 8):\n def __init__(\n self,\n use_datetime: bool = ...,\n use_builtin_types: bool = ...,\n *,\n headers: Iterable[Tuple[str, str]] = ...,\n context: Optional[Any] = ...,\n ) -> None: ...\n else:\n def __init__(self, use_datetime: bool = ..., use_builtin_types: bool = ..., *, context: Optional[Any] = ...) -> None: ...\n def make_connection(self, host: _HostType) -> http.client.HTTPSConnection: ...\n\nclass ServerProxy:\n\n __host: str\n __handler: str\n __transport: Transport\n __encoding: str\n __verbose: bool\n __allow_none: bool\n\n if sys.version_info >= (3, 8):\n def __init__(\n self,\n uri: str,\n transport: Optional[Transport] = ...,\n encoding: Optional[str] = ...,\n verbose: bool = ...,\n allow_none: bool = ...,\n use_datetime: bool = ...,\n use_builtin_types: bool = ...,\n *,\n headers: Iterable[Tuple[str, str]] = ...,\n context: Optional[Any] = ...,\n ) -> None: ...\n else:\n def __init__(\n self,\n uri: str,\n transport: Optional[Transport] = ...,\n encoding: Optional[str] = ...,\n verbose: bool = ...,\n allow_none: bool = ...,\n use_datetime: bool = ...,\n use_builtin_types: bool = ...,\n *,\n context: Optional[Any] = ...,\n ) -> None: ...\n def __getattr__(self, name: str) -> _Method: ...\n @overload\n def __call__(self, attr: Literal["close"]) -> Callable[[], None]: ...\n @overload\n def __call__(self, attr: Literal["transport"]) -> Transport: ...\n @overload\n def __call__(self, attr: str) -> Union[Callable[[], None], Transport]: ...\n def __enter__(self) -> ServerProxy: ...\n def __exit__(\n self, exc_type: Optional[Type[BaseException]], exc_val: Optional[BaseException], exc_tb: Optional[TracebackType]\n ) -> None: ...\n def __close(self) -> None: ... # undocumented\n def __request(self, methodname: str, params: Tuple[_Marshallable, ...]) -> Tuple[_Marshallable, ...]: ... # undocumented\n\nServer = ServerProxy\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\xmlrpc\client.pyi | client.pyi | Other | 12,285 | 0.95 | 0.405844 | 0.015444 | react-lib | 374 | 2023-08-15T05:35:43.755197 | MIT | false | ce9880d0740969df21046b65e097588f |
import http.server\nimport pydoc\nimport socketserver\nimport sys\nfrom datetime import datetime\nfrom typing import Any, Callable, Dict, Iterable, List, Mapping, Optional, Pattern, Protocol, Tuple, Type, Union\nfrom xmlrpc.client import Fault\n\n_Marshallable = Union[\n None, bool, int, float, str, bytes, tuple, list, dict, datetime\n] # TODO: Recursive type on tuple, list, dict\n\n# The dispatch accepts anywhere from 0 to N arguments, no easy way to allow this in mypy\nclass _DispatchArity0(Protocol):\n def __call__(self) -> _Marshallable: ...\n\nclass _DispatchArity1(Protocol):\n def __call__(self, __arg1: _Marshallable) -> _Marshallable: ...\n\nclass _DispatchArity2(Protocol):\n def __call__(self, __arg1: _Marshallable, __arg2: _Marshallable) -> _Marshallable: ...\n\nclass _DispatchArity3(Protocol):\n def __call__(self, __arg1: _Marshallable, __arg2: _Marshallable, __arg3: _Marshallable) -> _Marshallable: ...\n\nclass _DispatchArity4(Protocol):\n def __call__(\n self, __arg1: _Marshallable, __arg2: _Marshallable, __arg3: _Marshallable, __arg4: _Marshallable\n ) -> _Marshallable: ...\n\nclass _DispatchArityN(Protocol):\n def __call__(self, *args: _Marshallable) -> _Marshallable: ...\n\n_DispatchProtocol = Union[_DispatchArity0, _DispatchArity1, _DispatchArity2, _DispatchArity3, _DispatchArity4, _DispatchArityN]\n\ndef resolve_dotted_attribute(obj: Any, attr: str, allow_dotted_names: bool = ...) -> Any: ... # undocumented\ndef list_public_methods(obj: Any) -> List[str]: ... # undocumented\n\nclass SimpleXMLRPCDispatcher: # undocumented\n\n funcs: Dict[str, _DispatchProtocol]\n instance: Optional[Any]\n allow_none: bool\n encoding: str\n use_builtin_types: bool\n def __init__(self, allow_none: bool = ..., encoding: Optional[str] = ..., use_builtin_types: bool = ...) -> None: ...\n def register_instance(self, instance: Any, allow_dotted_names: bool = ...) -> None: ...\n if sys.version_info >= (3, 7):\n def register_function(\n self, function: Optional[_DispatchProtocol] = ..., name: Optional[str] = ...\n ) -> Callable[..., Any]: ...\n else:\n def register_function(self, function: _DispatchProtocol, name: Optional[str] = ...) -> Callable[..., Any]: ...\n def register_introspection_functions(self) -> None: ...\n def register_multicall_functions(self) -> None: ...\n def _marshaled_dispatch(\n self,\n data: str,\n dispatch_method: Optional[\n Callable[[Optional[str], Tuple[_Marshallable, ...]], Union[Fault, Tuple[_Marshallable, ...]]]\n ] = ...,\n path: Optional[Any] = ...,\n ) -> str: ... # undocumented\n def system_listMethods(self) -> List[str]: ... # undocumented\n def system_methodSignature(self, method_name: str) -> str: ... # undocumented\n def system_methodHelp(self, method_name: str) -> str: ... # undocumented\n def system_multicall(self, call_list: List[Dict[str, _Marshallable]]) -> List[_Marshallable]: ... # undocumented\n def _dispatch(self, method: str, params: Iterable[_Marshallable]) -> _Marshallable: ... # undocumented\n\nclass SimpleXMLRPCRequestHandler(http.server.BaseHTTPRequestHandler):\n\n rpc_paths: Tuple[str, str] = ...\n encode_threshold: int = ... # undocumented\n aepattern: Pattern[str] # undocumented\n def accept_encodings(self) -> Dict[str, float]: ...\n def is_rpc_path_valid(self) -> bool: ...\n def do_POST(self) -> None: ...\n def decode_request_content(self, data: bytes) -> Optional[bytes]: ...\n def report_404(self) -> None: ...\n def log_request(self, code: Union[int, str] = ..., size: Union[int, str] = ...) -> None: ...\n\nclass SimpleXMLRPCServer(socketserver.TCPServer, SimpleXMLRPCDispatcher):\n\n allow_reuse_address: bool = ...\n _send_traceback_handler: bool = ...\n def __init__(\n self,\n addr: Tuple[str, int],\n requestHandler: Type[SimpleXMLRPCRequestHandler] = ...,\n logRequests: bool = ...,\n allow_none: bool = ...,\n encoding: Optional[str] = ...,\n bind_and_activate: bool = ...,\n use_builtin_types: bool = ...,\n ) -> None: ...\n\nclass MultiPathXMLRPCServer(SimpleXMLRPCServer): # undocumented\n\n dispatchers: Dict[str, SimpleXMLRPCDispatcher]\n allow_none: bool\n encoding: str\n def __init__(\n self,\n addr: Tuple[str, int],\n requestHandler: Type[SimpleXMLRPCRequestHandler] = ...,\n logRequests: bool = ...,\n allow_none: bool = ...,\n encoding: Optional[str] = ...,\n bind_and_activate: bool = ...,\n use_builtin_types: bool = ...,\n ) -> None: ...\n def add_dispatcher(self, path: str, dispatcher: SimpleXMLRPCDispatcher) -> SimpleXMLRPCDispatcher: ...\n def get_dispatcher(self, path: str) -> SimpleXMLRPCDispatcher: ...\n def _marshaled_dispatch(\n self,\n data: str,\n dispatch_method: Optional[\n Callable[[Optional[str], Tuple[_Marshallable, ...]], Union[Fault, Tuple[_Marshallable, ...]]]\n ] = ...,\n path: Optional[Any] = ...,\n ) -> str: ...\n\nclass CGIXMLRPCRequestHandler(SimpleXMLRPCDispatcher):\n def __init__(self, allow_none: bool = ..., encoding: Optional[str] = ..., use_builtin_types: bool = ...) -> None: ...\n def handle_xmlrpc(self, request_text: str) -> None: ...\n def handle_get(self) -> None: ...\n def handle_request(self, request_text: Optional[str] = ...) -> None: ...\n\nclass ServerHTMLDoc(pydoc.HTMLDoc): # undocumented\n def docroutine(self, object: object, name: str, mod: Optional[str] = ..., funcs: Mapping[str, str] = ..., classes: Mapping[str, str] = ..., methods: Mapping[str, str] = ..., cl: Optional[type] = ...) -> str: ... # type: ignore\n def docserver(self, server_name: str, package_documentation: str, methods: Dict[str, str]) -> str: ...\n\nclass XMLRPCDocGenerator: # undocumented\n\n server_name: str\n server_documentation: str\n server_title: str\n def __init__(self) -> None: ...\n def set_server_title(self, server_title: str) -> None: ...\n def set_server_name(self, server_name: str) -> None: ...\n def set_server_documentation(self, server_documentation: str) -> None: ...\n def generate_html_documentation(self) -> str: ...\n\nclass DocXMLRPCRequestHandler(SimpleXMLRPCRequestHandler):\n def do_GET(self) -> None: ...\n\nclass DocXMLRPCServer(SimpleXMLRPCServer, XMLRPCDocGenerator):\n def __init__(\n self,\n addr: Tuple[str, int],\n requestHandler: Type[SimpleXMLRPCRequestHandler] = ...,\n logRequests: bool = ...,\n allow_none: bool = ...,\n encoding: Optional[str] = ...,\n bind_and_activate: bool = ...,\n use_builtin_types: bool = ...,\n ) -> None: ...\n\nclass DocCGIXMLRPCRequestHandler(CGIXMLRPCRequestHandler, XMLRPCDocGenerator):\n def __init__(self) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3\xmlrpc\server.pyi | server.pyi | Other | 6,810 | 0.95 | 0.4 | 0.007353 | awesome-app | 999 | 2025-04-13T16:56:51.894468 | MIT | false | 1fc94d7947d5b0c04786c01caf953e4b |
import sys\nfrom typing import Any, Callable, ClassVar, Generic, Iterator, Mapping, TypeVar, Union, overload\n\nif sys.version_info >= (3, 9):\n from types import GenericAlias\n\n_T = TypeVar("_T")\n_D = TypeVar("_D")\n\nclass ContextVar(Generic[_T]):\n def __init__(self, name: str, *, default: _T = ...) -> None: ...\n @property\n def name(self) -> str: ...\n @overload\n def get(self) -> _T: ...\n @overload\n def get(self, default: Union[_D, _T]) -> Union[_D, _T]: ...\n def set(self, value: _T) -> Token[_T]: ...\n def reset(self, token: Token[_T]) -> None: ...\n if sys.version_info >= (3, 9):\n def __class_getitem__(cls, item: Any) -> GenericAlias: ...\n\nclass Token(Generic[_T]):\n @property\n def var(self) -> ContextVar[_T]: ...\n @property\n def old_value(self) -> Any: ... # returns either _T or MISSING, but that's hard to express\n MISSING: ClassVar[object]\n if sys.version_info >= (3, 9):\n def __class_getitem__(cls, item: Any) -> GenericAlias: ...\n\ndef copy_context() -> Context: ...\n\n# It doesn't make sense to make this generic, because for most Contexts each ContextVar will have\n# a different value.\nclass Context(Mapping[ContextVar[Any], Any]):\n def __init__(self) -> None: ...\n def run(self, callable: Callable[..., _T], *args: Any, **kwargs: Any) -> _T: ...\n def copy(self) -> Context: ...\n def __getitem__(self, key: ContextVar[Any]) -> Any: ...\n def __iter__(self) -> Iterator[ContextVar[Any]]: ...\n def __len__(self) -> int: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3.7\contextvars.pyi | contextvars.pyi | Other | 1,514 | 0.95 | 0.571429 | 0.055556 | vue-tools | 716 | 2025-01-15T19:29:06.433324 | BSD-3-Clause | false | 2ed6c43738d6d2ef3cdbffcd7d366d52 |
import sys\nfrom typing import Any, Callable, Dict, Generic, Iterable, List, Mapping, Optional, Tuple, Type, TypeVar, Union, overload\n\nif sys.version_info >= (3, 9):\n from types import GenericAlias\n\n_T = TypeVar("_T")\n\nclass _MISSING_TYPE: ...\n\nMISSING: _MISSING_TYPE\n@overload\ndef asdict(obj: Any) -> Dict[str, Any]: ...\n@overload\ndef asdict(obj: Any, *, dict_factory: Callable[[List[Tuple[str, Any]]], _T]) -> _T: ...\n@overload\ndef astuple(obj: Any) -> Tuple[Any, ...]: ...\n@overload\ndef astuple(obj: Any, *, tuple_factory: Callable[[List[Any]], _T]) -> _T: ...\n@overload\ndef dataclass(_cls: Type[_T]) -> Type[_T]: ...\n@overload\ndef dataclass(_cls: None) -> Callable[[Type[_T]], Type[_T]]: ...\n@overload\ndef dataclass(\n *, init: bool = ..., repr: bool = ..., eq: bool = ..., order: bool = ..., unsafe_hash: bool = ..., frozen: bool = ...\n) -> Callable[[Type[_T]], Type[_T]]: ...\n\nclass Field(Generic[_T]):\n name: str\n type: Type[_T]\n default: _T\n default_factory: Callable[[], _T]\n repr: bool\n hash: Optional[bool]\n init: bool\n compare: bool\n metadata: Mapping[str, Any]\n if sys.version_info >= (3, 9):\n def __class_getitem__(cls, item: Any) -> GenericAlias: ...\n\n# NOTE: Actual return type is 'Field[_T]', but we want to help type checkers\n# to understand the magic that happens at runtime.\n@overload # `default` and `default_factory` are optional and mutually exclusive.\ndef field(\n *,\n default: _T,\n init: bool = ...,\n repr: bool = ...,\n hash: Optional[bool] = ...,\n compare: bool = ...,\n metadata: Optional[Mapping[str, Any]] = ...,\n) -> _T: ...\n@overload\ndef field(\n *,\n default_factory: Callable[[], _T],\n init: bool = ...,\n repr: bool = ...,\n hash: Optional[bool] = ...,\n compare: bool = ...,\n metadata: Optional[Mapping[str, Any]] = ...,\n) -> _T: ...\n@overload\ndef field(\n *,\n init: bool = ...,\n repr: bool = ...,\n hash: Optional[bool] = ...,\n compare: bool = ...,\n metadata: Optional[Mapping[str, Any]] = ...,\n) -> Any: ...\ndef fields(class_or_instance: Any) -> Tuple[Field[Any], ...]: ...\ndef is_dataclass(obj: Any) -> bool: ...\n\nclass FrozenInstanceError(AttributeError): ...\n\nclass InitVar(Generic[_T]):\n if sys.version_info >= (3, 9):\n def __class_getitem__(cls, type: Any) -> GenericAlias: ...\n\ndef make_dataclass(\n cls_name: str,\n fields: Iterable[Union[str, Tuple[str, type], Tuple[str, type, Field[Any]]]],\n *,\n bases: Tuple[type, ...] = ...,\n namespace: Optional[Dict[str, Any]] = ...,\n init: bool = ...,\n repr: bool = ...,\n eq: bool = ...,\n order: bool = ...,\n unsafe_hash: bool = ...,\n frozen: bool = ...,\n) -> type: ...\ndef replace(obj: _T, **changes: Any) -> _T: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3.7\dataclasses.pyi | dataclasses.pyi | Other | 2,737 | 0.95 | 0.242105 | 0.081395 | node-utils | 966 | 2023-08-22T01:17:39.396241 | Apache-2.0 | false | a464e0cdf35141573b1ef43c21788aae |
from typing import Any, Dict, Tuple, Type, TypeVar\n\n_T = TypeVar("_T")\n\n# TODO: Change the return into a NewType bound to int after pytype/#597\ndef get_cache_token() -> object: ...\n\nclass ABCMeta(type):\n def __new__(__mcls, __name: str, __bases: Tuple[Type[Any], ...], __namespace: Dict[str, Any]) -> ABCMeta: ...\n def register(cls, subclass: Type[_T]) -> Type[_T]: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3.7\_py_abc.pyi | _py_abc.pyi | Other | 376 | 0.95 | 0.4 | 0.142857 | awesome-app | 293 | 2024-12-30T01:40:49.679552 | MIT | false | de6c81f198119cc2add3f4de7c913f46 |
from _typeshed import SupportsItems\nfrom typing import Generic, Iterable, Optional, Tuple, TypeVar\n\n_T = TypeVar("_T")\n\nclass TopologicalSorter(Generic[_T]):\n def __init__(self, graph: Optional[SupportsItems[_T, Iterable[_T]]] = ...) -> None: ...\n def add(self, node: _T, *predecessors: _T) -> None: ...\n def prepare(self) -> None: ...\n def is_active(self) -> bool: ...\n def __bool__(self) -> bool: ...\n def done(self, *nodes: _T) -> None: ...\n def get_ready(self) -> Tuple[_T, ...]: ...\n def static_order(self) -> Iterable[_T]: ...\n\nclass CycleError(ValueError): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3.9\graphlib.pyi | graphlib.pyi | Other | 592 | 0.85 | 0.625 | 0 | node-utils | 25 | 2024-07-24T07:17:40.477254 | BSD-3-Clause | false | 41736cc7564c28ad27ed2a841c7c5af4 |
import os\nimport typing\nfrom datetime import tzinfo\nfrom typing import Any, AnyStr, Iterable, Optional, Protocol, Sequence, Set, Type, Union\n\n_T = typing.TypeVar("_T", bound="ZoneInfo")\n\nclass _IOBytes(Protocol):\n def read(self, __size: int) -> bytes: ...\n def seek(self, __size: int, __whence: int = ...) -> Any: ...\n\nclass ZoneInfo(tzinfo):\n @property\n def key(self) -> str: ...\n def __init__(self, key: str) -> None: ...\n @classmethod\n def no_cache(cls: Type[_T], key: str) -> _T: ...\n @classmethod\n def from_file(cls: Type[_T], __fobj: _IOBytes, key: Optional[str] = ...) -> _T: ...\n @classmethod\n def clear_cache(cls, *, only_keys: Iterable[str] = ...) -> None: ...\n\n# Note: Both here and in clear_cache, the types allow the use of `str` where\n# a sequence of strings is required. This should be remedied if a solution\n# to this typing bug is found: https://github.com/python/typing/issues/256\ndef reset_tzpath(to: Optional[Sequence[Union[os.PathLike[AnyStr], str]]] = ...) -> None: ...\ndef available_timezones() -> Set[str]: ...\n\nTZPATH: Sequence[str]\n\nclass ZoneInfoNotFoundError(KeyError): ...\nclass InvalidTZPathWarning(RuntimeWarning): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\stdlib\3.9\zoneinfo\__init__.pyi | __init__.pyi | Other | 1,183 | 0.95 | 0.4375 | 0.115385 | awesome-app | 702 | 2024-02-08T09:26:12.566460 | GPL-3.0 | false | 26c847b4f4cf57e0b3b737fa5db87adb |
import sys\nfrom abc import ABCMeta\nfrom typing import Any, Dict, Iterator, List, Mapping, Type, TypeVar, Union\n\n_T = TypeVar("_T")\n_S = TypeVar("_S", bound=Type[Enum])\n\n# Note: EnumMeta actually subclasses type directly, not ABCMeta.\n# This is a temporary workaround to allow multiple creation of enums with builtins\n# such as str as mixins, which due to the handling of ABCs of builtin types, cause\n# spurious inconsistent metaclass structure. See #1595.\n# Structurally: Iterable[T], Reversible[T], Container[T] where T is the enum itself\nclass EnumMeta(ABCMeta):\n def __iter__(self: Type[_T]) -> Iterator[_T]: ...\n def __reversed__(self: Type[_T]) -> Iterator[_T]: ...\n def __contains__(self: Type[_T], member: object) -> bool: ...\n def __getitem__(self: Type[_T], name: str) -> _T: ...\n @property\n def __members__(self: Type[_T]) -> Mapping[str, _T]: ...\n def __len__(self) -> int: ...\n\nclass Enum(metaclass=EnumMeta):\n name: str\n value: Any\n _name_: str\n _value_: Any\n _member_names_: List[str] # undocumented\n _member_map_: Dict[str, Enum] # undocumented\n _value2member_map_: Dict[int, Enum] # undocumented\n if sys.version_info >= (3, 7):\n _ignore_: Union[str, List[str]]\n _order_: str\n __order__: str\n @classmethod\n def _missing_(cls, value: object) -> Any: ...\n @staticmethod\n def _generate_next_value_(name: str, start: int, count: int, last_values: List[Any]) -> Any: ...\n def __new__(cls: Type[_T], value: object) -> _T: ...\n def __repr__(self) -> str: ...\n def __str__(self) -> str: ...\n def __dir__(self) -> List[str]: ...\n def __format__(self, format_spec: str) -> str: ...\n def __hash__(self) -> Any: ...\n def __reduce_ex__(self, proto: object) -> Any: ...\n\nclass IntEnum(int, Enum):\n value: int\n\ndef unique(enumeration: _S) -> _S: ...\n\n_auto_null: Any\n\n# subclassing IntFlag so it picks up all implemented base functions, best modeling behavior of enum.auto()\nclass auto(IntFlag):\n value: Any\n\nclass Flag(Enum):\n def __contains__(self: _T, other: _T) -> bool: ...\n def __repr__(self) -> str: ...\n def __str__(self) -> str: ...\n def __bool__(self) -> bool: ...\n def __or__(self: _T, other: _T) -> _T: ...\n def __and__(self: _T, other: _T) -> _T: ...\n def __xor__(self: _T, other: _T) -> _T: ...\n def __invert__(self: _T) -> _T: ...\n\nclass IntFlag(int, Flag):\n def __or__(self: _T, other: Union[int, _T]) -> _T: ...\n def __and__(self: _T, other: Union[int, _T]) -> _T: ...\n def __xor__(self: _T, other: Union[int, _T]) -> _T: ...\n __ror__ = __or__\n __rand__ = __and__\n __rxor__ = __xor__\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\enum.pyi | enum.pyi | Other | 2,643 | 0.95 | 0.465753 | 0.09375 | python-kit | 840 | 2024-11-15T20:36:50.728971 | GPL-3.0 | false | f25e6805a5089e1f879d11ed586cee48 |
from typing import Any, Container, Generic, Iterable, Iterator, Optional, SupportsInt, Text, Tuple, TypeVar, overload\n\n# Undocumented length constants\nIPV4LENGTH: int\nIPV6LENGTH: int\n\n_A = TypeVar("_A", IPv4Address, IPv6Address)\n_N = TypeVar("_N", IPv4Network, IPv6Network)\n_T = TypeVar("_T")\n\ndef ip_address(address: object) -> Any: ... # morally Union[IPv4Address, IPv6Address]\ndef ip_network(address: object, strict: bool = ...) -> Any: ... # morally Union[IPv4Network, IPv6Network]\ndef ip_interface(address: object) -> Any: ... # morally Union[IPv4Interface, IPv6Interface]\n\nclass _IPAddressBase:\n def __eq__(self, other: Any) -> bool: ...\n def __ge__(self: _T, other: _T) -> bool: ...\n def __gt__(self: _T, other: _T) -> bool: ...\n def __le__(self: _T, other: _T) -> bool: ...\n def __lt__(self: _T, other: _T) -> bool: ...\n def __ne__(self, other: Any) -> bool: ...\n @property\n def compressed(self) -> Text: ...\n @property\n def exploded(self) -> Text: ...\n @property\n def reverse_pointer(self) -> Text: ...\n @property\n def version(self) -> int: ...\n\nclass _BaseAddress(_IPAddressBase, SupportsInt):\n def __init__(self, address: object) -> None: ...\n def __add__(self: _T, other: int) -> _T: ...\n def __hash__(self) -> int: ...\n def __int__(self) -> int: ...\n def __sub__(self: _T, other: int) -> _T: ...\n @property\n def is_global(self) -> bool: ...\n @property\n def is_link_local(self) -> bool: ...\n @property\n def is_loopback(self) -> bool: ...\n @property\n def is_multicast(self) -> bool: ...\n @property\n def is_private(self) -> bool: ...\n @property\n def is_reserved(self) -> bool: ...\n @property\n def is_unspecified(self) -> bool: ...\n @property\n def max_prefixlen(self) -> int: ...\n @property\n def packed(self) -> bytes: ...\n\nclass _BaseNetwork(_IPAddressBase, Container[_A], Iterable[_A], Generic[_A]):\n network_address: _A\n netmask: _A\n def __init__(self, address: object, strict: bool = ...) -> None: ...\n def __contains__(self, other: Any) -> bool: ...\n def __getitem__(self, n: int) -> _A: ...\n def __iter__(self) -> Iterator[_A]: ...\n def address_exclude(self: _T, other: _T) -> Iterator[_T]: ...\n @property\n def broadcast_address(self) -> _A: ...\n def compare_networks(self: _T, other: _T) -> int: ...\n def hosts(self) -> Iterator[_A]: ...\n @property\n def is_global(self) -> bool: ...\n @property\n def is_link_local(self) -> bool: ...\n @property\n def is_loopback(self) -> bool: ...\n @property\n def is_multicast(self) -> bool: ...\n @property\n def is_private(self) -> bool: ...\n @property\n def is_reserved(self) -> bool: ...\n @property\n def is_unspecified(self) -> bool: ...\n @property\n def max_prefixlen(self) -> int: ...\n @property\n def num_addresses(self) -> int: ...\n def overlaps(self, other: _BaseNetwork[_A]) -> bool: ...\n @property\n def prefixlen(self) -> int: ...\n def subnets(self: _T, prefixlen_diff: int = ..., new_prefix: Optional[int] = ...) -> Iterator[_T]: ...\n def supernet(self: _T, prefixlen_diff: int = ..., new_prefix: Optional[int] = ...) -> _T: ...\n @property\n def with_hostmask(self) -> Text: ...\n @property\n def with_netmask(self) -> Text: ...\n @property\n def with_prefixlen(self) -> Text: ...\n @property\n def hostmask(self) -> _A: ...\n\nclass _BaseInterface(_BaseAddress, Generic[_A, _N]):\n hostmask: _A\n netmask: _A\n network: _N\n @property\n def ip(self) -> _A: ...\n @property\n def with_hostmask(self) -> Text: ...\n @property\n def with_netmask(self) -> Text: ...\n @property\n def with_prefixlen(self) -> Text: ...\n\nclass IPv4Address(_BaseAddress): ...\nclass IPv4Network(_BaseNetwork[IPv4Address]): ...\nclass IPv4Interface(IPv4Address, _BaseInterface[IPv4Address, IPv4Network]): ...\n\nclass IPv6Address(_BaseAddress):\n @property\n def ipv4_mapped(self) -> Optional[IPv4Address]: ...\n @property\n def is_site_local(self) -> bool: ...\n @property\n def sixtofour(self) -> Optional[IPv4Address]: ...\n @property\n def teredo(self) -> Optional[Tuple[IPv4Address, IPv4Address]]: ...\n\nclass IPv6Network(_BaseNetwork[IPv6Address]):\n @property\n def is_site_local(self) -> bool: ...\n\nclass IPv6Interface(IPv6Address, _BaseInterface[IPv6Address, IPv6Network]): ...\n\ndef v4_int_to_packed(address: int) -> bytes: ...\ndef v6_int_to_packed(address: int) -> bytes: ...\n@overload\ndef summarize_address_range(first: IPv4Address, last: IPv4Address) -> Iterator[IPv4Network]: ...\n@overload\ndef summarize_address_range(first: IPv6Address, last: IPv6Address) -> Iterator[IPv6Network]: ...\ndef collapse_addresses(addresses: Iterable[_N]) -> Iterator[_N]: ...\n@overload\ndef get_mixed_type_key(obj: _A) -> Tuple[int, _A]: ...\n@overload\ndef get_mixed_type_key(obj: IPv4Network) -> Tuple[int, IPv4Address, IPv4Address]: ...\n@overload\ndef get_mixed_type_key(obj: IPv6Network) -> Tuple[int, IPv6Address, IPv6Address]: ...\n\nclass AddressValueError(ValueError): ...\nclass NetmaskValueError(ValueError): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\ipaddress.pyi | ipaddress.pyi | Other | 5,107 | 0.95 | 0.547297 | 0.007407 | react-lib | 364 | 2025-05-14T19:44:41.480982 | BSD-3-Clause | false | 04b18c3a87282922574289dbb20f85d9 |
import os\nimport sys\nfrom _typeshed import OpenBinaryMode, OpenBinaryModeReading, OpenBinaryModeUpdating, OpenBinaryModeWriting, OpenTextMode\nfrom io import BufferedRandom, BufferedReader, BufferedWriter, FileIO, TextIOWrapper\nfrom types import TracebackType\nfrom typing import IO, Any, BinaryIO, Generator, List, Optional, Sequence, Text, TextIO, Tuple, Type, TypeVar, Union, overload\nfrom typing_extensions import Literal\n\n_P = TypeVar("_P", bound=PurePath)\n\n_PurePathBase = object\n_PathLike = PurePath\n\nclass PurePath(_PurePathBase):\n parts: Tuple[str, ...]\n drive: str\n root: str\n anchor: str\n name: str\n suffix: str\n suffixes: List[str]\n stem: str\n def __new__(cls: Type[_P], *args: Union[str, _PathLike]) -> _P: ...\n def __hash__(self) -> int: ...\n def __lt__(self, other: PurePath) -> bool: ...\n def __le__(self, other: PurePath) -> bool: ...\n def __gt__(self, other: PurePath) -> bool: ...\n def __ge__(self, other: PurePath) -> bool: ...\n def __truediv__(self: _P, key: Union[str, _PathLike]) -> _P: ...\n def __rtruediv__(self: _P, key: Union[str, _PathLike]) -> _P: ...\n def __div__(self: _P, key: Union[str, PurePath]) -> _P: ...\n def __bytes__(self) -> bytes: ...\n def as_posix(self) -> str: ...\n def as_uri(self) -> str: ...\n def is_absolute(self) -> bool: ...\n def is_reserved(self) -> bool: ...\n def match(self, path_pattern: str) -> bool: ...\n def relative_to(self: _P, *other: Union[str, _PathLike]) -> _P: ...\n def with_name(self: _P, name: str) -> _P: ...\n def with_suffix(self: _P, suffix: str) -> _P: ...\n def joinpath(self: _P, *other: Union[str, _PathLike]) -> _P: ...\n @property\n def parents(self: _P) -> Sequence[_P]: ...\n @property\n def parent(self: _P) -> _P: ...\n\nclass PurePosixPath(PurePath): ...\nclass PureWindowsPath(PurePath): ...\n\nclass Path(PurePath):\n def __new__(cls: Type[_P], *args: Union[str, _PathLike], **kwargs: Any) -> _P: ...\n def __enter__(self) -> Path: ...\n def __exit__(\n self, exc_type: Optional[Type[BaseException]], exc_value: Optional[BaseException], traceback: Optional[TracebackType]\n ) -> Optional[bool]: ...\n @classmethod\n def cwd(cls: Type[_P]) -> _P: ...\n def stat(self) -> os.stat_result: ...\n def chmod(self, mode: int) -> None: ...\n def exists(self) -> bool: ...\n def glob(self, pattern: str) -> Generator[Path, None, None]: ...\n def group(self) -> str: ...\n def is_dir(self) -> bool: ...\n def is_file(self) -> bool: ...\n def is_symlink(self) -> bool: ...\n def is_socket(self) -> bool: ...\n def is_fifo(self) -> bool: ...\n def is_block_device(self) -> bool: ...\n def is_char_device(self) -> bool: ...\n def iterdir(self) -> Generator[Path, None, None]: ...\n def lchmod(self, mode: int) -> None: ...\n def lstat(self) -> os.stat_result: ...\n def mkdir(self, mode: int = ..., parents: bool = ...) -> None: ...\n # Adapted from _io.open\n def open(\n self,\n mode: Text = ...,\n buffering: int = ...,\n encoding: Optional[Text] = ...,\n errors: Optional[Text] = ...,\n newline: Optional[Text] = ...,\n ) -> IO[Any]: ...\n def owner(self) -> str: ...\n def rename(self, target: Union[str, PurePath]) -> None: ...\n def replace(self, target: Union[str, PurePath]) -> None: ...\n def resolve(self: _P) -> _P: ...\n def rglob(self, pattern: str) -> Generator[Path, None, None]: ...\n def rmdir(self) -> None: ...\n def symlink_to(self, target: Union[str, Path], target_is_directory: bool = ...) -> None: ...\n def touch(self, mode: int = ..., exist_ok: bool = ...) -> None: ...\n def unlink(self) -> None: ...\n @classmethod\n def home(cls: Type[_P]) -> _P: ...\n def absolute(self: _P) -> _P: ...\n def expanduser(self: _P) -> _P: ...\n def read_bytes(self) -> bytes: ...\n def read_text(self, encoding: Optional[str] = ..., errors: Optional[str] = ...) -> str: ...\n def samefile(self, other_path: Union[str, bytes, int, Path]) -> bool: ...\n def write_bytes(self, data: bytes) -> int: ...\n def write_text(self, data: str, encoding: Optional[str] = ..., errors: Optional[str] = ...) -> int: ...\n\nclass PosixPath(Path, PurePosixPath): ...\nclass WindowsPath(Path, PureWindowsPath): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\pathlib2.pyi | pathlib2.pyi | Other | 4,283 | 0.95 | 0.631068 | 0.010309 | awesome-app | 914 | 2023-10-15T22:05:33.239936 | BSD-3-Clause | false | 6790d0560cb397b03b78c85ede270a6a |
from datetime import date, datetime, time\nfrom typing import Any, Dict, Iterable, List, Optional, Sequence, Tuple, Union\n\nScalar = Union[int, float, str, datetime, date, time]\nResult = Union[Tuple[Scalar, ...], Dict[str, Scalar]]\n\nclass Connection(object):\n def __init__(self, user, password, host, database, timeout, login_timeout, charset, as_dict) -> None: ...\n def autocommit(self, status: bool) -> None: ...\n def close(self) -> None: ...\n def commit(self) -> None: ...\n def cursor(self) -> Cursor: ...\n def rollback(self) -> None: ...\n\nclass Cursor(object):\n def __init__(self) -> None: ...\n def __iter__(self): ...\n def __next__(self) -> Any: ...\n def callproc(self, procname: str, **kwargs) -> None: ...\n def close(self) -> None: ...\n def execute(self, stmt: str, params: Optional[Union[Scalar, Tuple[Scalar, ...], Dict[str, Scalar]]]) -> None: ...\n def executemany(self, stmt: str, params: Optional[Sequence[Tuple[Scalar, ...]]]) -> None: ...\n def fetchall(self) -> List[Result]: ...\n def fetchmany(self, size: Optional[int]) -> List[Result]: ...\n def fetchone(self) -> Result: ...\n\ndef connect(\n server: Optional[str],\n user: Optional[str],\n password: Optional[str],\n database: Optional[str],\n timeout: Optional[int],\n login_timeout: Optional[int],\n charset: Optional[str],\n as_dict: Optional[bool],\n host: Optional[str],\n appname: Optional[str],\n port: Optional[str],\n conn_properties: Optional[Union[str, Sequence[str]]],\n autocommit: Optional[bool],\n tds_version: Optional[str],\n) -> Connection: ...\ndef get_max_connections() -> int: ...\ndef set_max_connections(n: int) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\pymssql.pyi | pymssql.pyi | Other | 1,685 | 0.85 | 0.477273 | 0 | node-utils | 192 | 2025-02-22T11:30:19.199179 | MIT | false | b78cdae8d79dabb33a524fa714ba6f46 |
from typing import Any, Optional\n\nfrom ._base import Executor\n\nEXTRA_QUEUED_CALLS: Any\n\nclass ProcessPoolExecutor(Executor):\n def __init__(self, max_workers: Optional[int] = ...) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\concurrent\futures\process.pyi | process.pyi | Other | 195 | 0.85 | 0.25 | 0 | python-kit | 507 | 2024-08-29T11:27:00.121458 | MIT | false | 82745a588b697825fde495c0c7bccc5d |
from typing import Any, Callable, Generic, Iterable, Mapping, Optional, Tuple, TypeVar\n\nfrom ._base import Executor, Future\n\n_S = TypeVar("_S")\n\nclass ThreadPoolExecutor(Executor):\n def __init__(self, max_workers: Optional[int] = ..., thread_name_prefix: str = ...) -> None: ...\n\nclass _WorkItem(Generic[_S]):\n future: Future[_S]\n fn: Callable[..., _S]\n args: Iterable[Any]\n kwargs: Mapping[str, Any]\n def __init__(self, future: Future[_S], fn: Callable[..., _S], args: Iterable[Any], kwargs: Mapping[str, Any]) -> None: ...\n def run(self) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\concurrent\futures\thread.pyi | thread.pyi | Other | 574 | 0.85 | 0.3125 | 0 | node-utils | 499 | 2024-11-11T15:06:11.111634 | Apache-2.0 | false | 41be21ecc0ebbf07a5c86697dcbc20a3 |
import threading\nfrom abc import abstractmethod\nfrom logging import Logger\nfrom types import TracebackType\nfrom typing import Any, Callable, Container, Generic, Iterable, Iterator, List, Optional, Protocol, Set, Tuple, TypeVar\n\nFIRST_COMPLETED: str\nFIRST_EXCEPTION: str\nALL_COMPLETED: str\nPENDING: str\nRUNNING: str\nCANCELLED: str\nCANCELLED_AND_NOTIFIED: str\nFINISHED: str\nLOGGER: Logger\n\nclass Error(Exception): ...\nclass CancelledError(Error): ...\nclass TimeoutError(Error): ...\n\n_T = TypeVar("_T")\n\n_T_co = TypeVar("_T_co", covariant=True)\n\n# Copied over Collection implementation as it does not exist in Python 2 and <3.6.\n# Also to solve pytype issues with _Collection.\nclass _Collection(Iterable[_T_co], Container[_T_co], Protocol[_T_co]):\n # Implement Sized (but don't have it as a base class).\n @abstractmethod\n def __len__(self) -> int: ...\n\nclass Future(Generic[_T]):\n def __init__(self) -> None: ...\n def cancel(self) -> bool: ...\n def cancelled(self) -> bool: ...\n def running(self) -> bool: ...\n def done(self) -> bool: ...\n def add_done_callback(self, fn: Callable[[Future[_T]], Any]) -> None: ...\n def result(self, timeout: Optional[float] = ...) -> _T: ...\n def set_running_or_notify_cancel(self) -> bool: ...\n def set_result(self, result: _T) -> None: ...\n def exception(self, timeout: Optional[float] = ...) -> Any: ...\n def exception_info(self, timeout: Optional[float] = ...) -> Tuple[Any, Optional[TracebackType]]: ...\n def set_exception(self, exception: Any) -> None: ...\n def set_exception_info(self, exception: Any, traceback: Optional[TracebackType]) -> None: ...\n\nclass Executor:\n def submit(self, fn: Callable[..., _T], *args: Any, **kwargs: Any) -> Future[_T]: ...\n def map(self, func: Callable[..., _T], *iterables: Iterable[Any], timeout: Optional[float] = ...) -> Iterator[_T]: ...\n def shutdown(self, wait: bool = ...) -> None: ...\n def __enter__(self: _T) -> _T: ...\n def __exit__(self, exc_type: Any, exc_val: Any, exc_tb: Any) -> Optional[bool]: ...\n\ndef as_completed(fs: Iterable[Future[_T]], timeout: Optional[float] = ...) -> Iterator[Future[_T]]: ...\ndef wait(\n fs: _Collection[Future[_T]], timeout: Optional[float] = ..., return_when: str = ...\n) -> Tuple[Set[Future[_T]], Set[Future[_T]]]: ...\n\nclass _Waiter:\n event: threading.Event\n finished_futures: List[Future[Any]]\n def __init__(self) -> None: ...\n def add_result(self, future: Future[Any]) -> None: ...\n def add_exception(self, future: Future[Any]) -> None: ...\n def add_cancelled(self, future: Future[Any]) -> None: ...\n\nclass _AsCompletedWaiter(_Waiter):\n lock: threading.Lock\n def __init__(self) -> None: ...\n def add_result(self, future: Future[Any]) -> None: ...\n def add_exception(self, future: Future[Any]) -> None: ...\n def add_cancelled(self, future: Future[Any]) -> None: ...\n\nclass _FirstCompletedWaiter(_Waiter):\n def add_result(self, future: Future[Any]) -> None: ...\n def add_exception(self, future: Future[Any]) -> None: ...\n def add_cancelled(self, future: Future[Any]) -> None: ...\n\nclass _AllCompletedWaiter(_Waiter):\n num_pending_calls: int\n stop_on_exception: bool\n lock: threading.Lock\n def __init__(self, num_pending_calls: int, stop_on_exception: bool) -> None: ...\n def add_result(self, future: Future[Any]) -> None: ...\n def add_exception(self, future: Future[Any]) -> None: ...\n def add_cancelled(self, future: Future[Any]) -> None: ...\n\nclass _AcquireFutures:\n futures: Iterable[Future[Any]]\n def __init__(self, futures: Iterable[Future[Any]]) -> None: ...\n def __enter__(self) -> None: ...\n def __exit__(self, *args: Any) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\concurrent\futures\_base.pyi | _base.pyi | Other | 3,701 | 0.95 | 0.554348 | 0.037975 | python-kit | 308 | 2024-01-27T08:14:54.279652 | MIT | false | 868143b8e332563273bd990b7300c605 |
from ._base import (\n ALL_COMPLETED as ALL_COMPLETED,\n FIRST_COMPLETED as FIRST_COMPLETED,\n FIRST_EXCEPTION as FIRST_EXCEPTION,\n CancelledError as CancelledError,\n Executor as Executor,\n Future as Future,\n TimeoutError as TimeoutError,\n as_completed as as_completed,\n wait as wait,\n)\nfrom .process import ProcessPoolExecutor as ProcessPoolExecutor\nfrom .thread import ThreadPoolExecutor as ThreadPoolExecutor\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\concurrent\futures\__init__.pyi | __init__.pyi | Other | 436 | 0.85 | 0 | 0 | vue-tools | 920 | 2024-02-27T13:49:45.047638 | MIT | false | 9e8668577c64c86045ef3fbf021c242f |
from typing import Any\n\nfrom thrift.Thrift import TProcessor # type: ignore\n\nfastbinary: Any\n\nclass Iface:\n def getName(self): ...\n def getVersion(self): ...\n def getStatus(self): ...\n def getStatusDetails(self): ...\n def getCounters(self): ...\n def getCounter(self, key): ...\n def setOption(self, key, value): ...\n def getOption(self, key): ...\n def getOptions(self): ...\n def getCpuProfile(self, profileDurationInSec): ...\n def aliveSince(self): ...\n def reinitialize(self): ...\n def shutdown(self): ...\n\nclass Client(Iface):\n def __init__(self, iprot, oprot=...) -> None: ...\n def getName(self): ...\n def send_getName(self): ...\n def recv_getName(self): ...\n def getVersion(self): ...\n def send_getVersion(self): ...\n def recv_getVersion(self): ...\n def getStatus(self): ...\n def send_getStatus(self): ...\n def recv_getStatus(self): ...\n def getStatusDetails(self): ...\n def send_getStatusDetails(self): ...\n def recv_getStatusDetails(self): ...\n def getCounters(self): ...\n def send_getCounters(self): ...\n def recv_getCounters(self): ...\n def getCounter(self, key): ...\n def send_getCounter(self, key): ...\n def recv_getCounter(self): ...\n def setOption(self, key, value): ...\n def send_setOption(self, key, value): ...\n def recv_setOption(self): ...\n def getOption(self, key): ...\n def send_getOption(self, key): ...\n def recv_getOption(self): ...\n def getOptions(self): ...\n def send_getOptions(self): ...\n def recv_getOptions(self): ...\n def getCpuProfile(self, profileDurationInSec): ...\n def send_getCpuProfile(self, profileDurationInSec): ...\n def recv_getCpuProfile(self): ...\n def aliveSince(self): ...\n def send_aliveSince(self): ...\n def recv_aliveSince(self): ...\n def reinitialize(self): ...\n def send_reinitialize(self): ...\n def shutdown(self): ...\n def send_shutdown(self): ...\n\nclass Processor(Iface, TProcessor): # type: ignore\n def __init__(self, handler) -> None: ...\n def process(self, iprot, oprot): ...\n def process_getName(self, seqid, iprot, oprot): ...\n def process_getVersion(self, seqid, iprot, oprot): ...\n def process_getStatus(self, seqid, iprot, oprot): ...\n def process_getStatusDetails(self, seqid, iprot, oprot): ...\n def process_getCounters(self, seqid, iprot, oprot): ...\n def process_getCounter(self, seqid, iprot, oprot): ...\n def process_setOption(self, seqid, iprot, oprot): ...\n def process_getOption(self, seqid, iprot, oprot): ...\n def process_getOptions(self, seqid, iprot, oprot): ...\n def process_getCpuProfile(self, seqid, iprot, oprot): ...\n def process_aliveSince(self, seqid, iprot, oprot): ...\n def process_reinitialize(self, seqid, iprot, oprot): ...\n def process_shutdown(self, seqid, iprot, oprot): ...\n\nclass getName_args:\n thrift_spec: Any\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getName_result:\n thrift_spec: Any\n success: Any\n def __init__(self, success=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getVersion_args:\n thrift_spec: Any\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getVersion_result:\n thrift_spec: Any\n success: Any\n def __init__(self, success=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getStatus_args:\n thrift_spec: Any\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getStatus_result:\n thrift_spec: Any\n success: Any\n def __init__(self, success=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getStatusDetails_args:\n thrift_spec: Any\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getStatusDetails_result:\n thrift_spec: Any\n success: Any\n def __init__(self, success=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getCounters_args:\n thrift_spec: Any\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getCounters_result:\n thrift_spec: Any\n success: Any\n def __init__(self, success=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getCounter_args:\n thrift_spec: Any\n key: Any\n def __init__(self, key=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getCounter_result:\n thrift_spec: Any\n success: Any\n def __init__(self, success=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass setOption_args:\n thrift_spec: Any\n key: Any\n value: Any\n def __init__(self, key=..., value=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass setOption_result:\n thrift_spec: Any\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getOption_args:\n thrift_spec: Any\n key: Any\n def __init__(self, key=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getOption_result:\n thrift_spec: Any\n success: Any\n def __init__(self, success=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getOptions_args:\n thrift_spec: Any\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getOptions_result:\n thrift_spec: Any\n success: Any\n def __init__(self, success=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getCpuProfile_args:\n thrift_spec: Any\n profileDurationInSec: Any\n def __init__(self, profileDurationInSec=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass getCpuProfile_result:\n thrift_spec: Any\n success: Any\n def __init__(self, success=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass aliveSince_args:\n thrift_spec: Any\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass aliveSince_result:\n thrift_spec: Any\n success: Any\n def __init__(self, success=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass reinitialize_args:\n thrift_spec: Any\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass shutdown_args:\n thrift_spec: Any\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\fb303\FacebookService.pyi | FacebookService.pyi | Other | 8,692 | 0.95 | 0.761745 | 0 | react-lib | 191 | 2024-06-08T01:14:38.692099 | GPL-3.0 | false | ca755ec8171878f1a4ef31fb61381991 |
from typing import Any\n\nstring_types: Any\nbytes_types: Any\nLOST_STATES: Any\nENVI_VERSION: Any\nENVI_VERSION_KEY: Any\nlog: Any\n\nclass KazooClient:\n logger: Any\n handler: Any\n auth_data: Any\n default_acl: Any\n randomize_hosts: Any\n hosts: Any\n chroot: Any\n state: Any\n state_listeners: Any\n read_only: Any\n retry: Any\n Barrier: Any\n Counter: Any\n DoubleBarrier: Any\n ChildrenWatch: Any\n DataWatch: Any\n Election: Any\n NonBlockingLease: Any\n MultiNonBlockingLease: Any\n Lock: Any\n Party: Any\n Queue: Any\n LockingQueue: Any\n SetPartitioner: Any\n Semaphore: Any\n ShallowParty: Any\n def __init__(\n self,\n hosts=...,\n timeout=...,\n client_id=...,\n handler=...,\n default_acl=...,\n auth_data=...,\n read_only=...,\n randomize_hosts=...,\n connection_retry=...,\n command_retry=...,\n logger=...,\n **kwargs,\n ) -> None: ...\n @property\n def client_state(self): ...\n @property\n def client_id(self): ...\n @property\n def connected(self): ...\n def set_hosts(self, hosts, randomize_hosts=...): ...\n def add_listener(self, listener): ...\n def remove_listener(self, listener): ...\n def start(self, timeout=...): ...\n def start_async(self): ...\n def stop(self): ...\n def restart(self): ...\n def close(self): ...\n def command(self, cmd=...): ...\n def server_version(self, retries=...): ...\n def add_auth(self, scheme, credential): ...\n def add_auth_async(self, scheme, credential): ...\n def unchroot(self, path): ...\n def sync_async(self, path): ...\n def sync(self, path): ...\n def create(self, path, value=..., acl=..., ephemeral=..., sequence=..., makepath=...): ...\n def create_async(self, path, value=..., acl=..., ephemeral=..., sequence=..., makepath=...): ...\n def ensure_path(self, path, acl=...): ...\n def ensure_path_async(self, path, acl=...): ...\n def exists(self, path, watch=...): ...\n def exists_async(self, path, watch=...): ...\n def get(self, path, watch=...): ...\n def get_async(self, path, watch=...): ...\n def get_children(self, path, watch=..., include_data=...): ...\n def get_children_async(self, path, watch=..., include_data=...): ...\n def get_acls(self, path): ...\n def get_acls_async(self, path): ...\n def set_acls(self, path, acls, version=...): ...\n def set_acls_async(self, path, acls, version=...): ...\n def set(self, path, value, version=...): ...\n def set_async(self, path, value, version=...): ...\n def transaction(self): ...\n def delete(self, path, version=..., recursive=...): ...\n def delete_async(self, path, version=...): ...\n def reconfig(self, joining, leaving, new_members, from_config=...): ...\n def reconfig_async(self, joining, leaving, new_members, from_config): ...\n\nclass TransactionRequest:\n client: Any\n operations: Any\n committed: Any\n def __init__(self, client) -> None: ...\n def create(self, path, value=..., acl=..., ephemeral=..., sequence=...): ...\n def delete(self, path, version=...): ...\n def set_data(self, path, value, version=...): ...\n def check(self, path, version): ...\n def commit_async(self): ...\n def commit(self): ...\n def __enter__(self): ...\n def __exit__(self, exc_type, exc_value, exc_tb): ...\n\nclass KazooState: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\kazoo\client.pyi | client.pyi | Other | 3,400 | 0.85 | 0.477064 | 0.009524 | python-kit | 346 | 2024-04-06T09:01:55.822403 | MIT | false | 9610e48860215027299e466808657585 |
from typing import Any\n\nclass KazooException(Exception): ...\nclass ZookeeperError(KazooException): ...\nclass CancelledError(KazooException): ...\nclass ConfigurationError(KazooException): ...\nclass ZookeeperStoppedError(KazooException): ...\nclass ConnectionDropped(KazooException): ...\nclass LockTimeout(KazooException): ...\nclass WriterNotClosedException(KazooException): ...\n\nEXCEPTIONS: Any\n\nclass RolledBackError(ZookeeperError): ...\nclass SystemZookeeperError(ZookeeperError): ...\nclass RuntimeInconsistency(ZookeeperError): ...\nclass DataInconsistency(ZookeeperError): ...\nclass ConnectionLoss(ZookeeperError): ...\nclass MarshallingError(ZookeeperError): ...\nclass UnimplementedError(ZookeeperError): ...\nclass OperationTimeoutError(ZookeeperError): ...\nclass BadArgumentsError(ZookeeperError): ...\nclass NewConfigNoQuorumError(ZookeeperError): ...\nclass ReconfigInProcessError(ZookeeperError): ...\nclass APIError(ZookeeperError): ...\nclass NoNodeError(ZookeeperError): ...\nclass NoAuthError(ZookeeperError): ...\nclass BadVersionError(ZookeeperError): ...\nclass NoChildrenForEphemeralsError(ZookeeperError): ...\nclass NodeExistsError(ZookeeperError): ...\nclass NotEmptyError(ZookeeperError): ...\nclass SessionExpiredError(ZookeeperError): ...\nclass InvalidCallbackError(ZookeeperError): ...\nclass InvalidACLError(ZookeeperError): ...\nclass AuthFailedError(ZookeeperError): ...\nclass SessionMovedError(ZookeeperError): ...\nclass NotReadOnlyCallError(ZookeeperError): ...\nclass ConnectionClosedError(SessionExpiredError): ...\n\nConnectionLossException: Any\nMarshallingErrorException: Any\nSystemErrorException: Any\nRuntimeInconsistencyException: Any\nDataInconsistencyException: Any\nUnimplementedException: Any\nOperationTimeoutException: Any\nBadArgumentsException: Any\nApiErrorException: Any\nNoNodeException: Any\nNoAuthException: Any\nBadVersionException: Any\nNoChildrenForEphemeralsException: Any\nNodeExistsException: Any\nInvalidACLException: Any\nAuthFailedException: Any\nNotEmptyException: Any\nSessionExpiredException: Any\nInvalidCallbackException: Any\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\kazoo\exceptions.pyi | exceptions.pyi | Other | 2,054 | 0.85 | 0.568966 | 0 | node-utils | 586 | 2025-06-28T03:22:46.646615 | GPL-3.0 | false | ebf69672c113a9a120b357edee67ed81 |
from typing import Any\n\nlog: Any\n\nclass DataWatch:\n def __init__(self, client, path, func=..., *args, **kwargs) -> None: ...\n def __call__(self, func): ...\n\nclass ChildrenWatch:\n def __init__(self, client, path, func=..., allow_session_lost=..., send_event=...) -> None: ...\n def __call__(self, func): ...\n\nclass PatientChildrenWatch:\n client: Any\n path: Any\n children: Any\n time_boundary: Any\n children_changed: Any\n def __init__(self, client, path, time_boundary=...) -> None: ...\n asy: Any\n def start(self): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\kazoo\recipe\watchers.pyi | watchers.pyi | Other | 551 | 0.85 | 0.428571 | 0 | node-utils | 347 | 2023-10-16T09:16:25.645508 | BSD-3-Clause | false | a8677a67afe02d4be19d25f25e936dd7 |
from datetime import datetime\nfrom typing import Any, Callable, Iterable, List, Optional, Set, Text, Tuple, Union\n\nfrom cryptography.hazmat.primitives.asymmetric import dsa, rsa\n\nFILETYPE_PEM: int\nFILETYPE_ASN1: int\nFILETYPE_TEXT: int\nTYPE_RSA: int\nTYPE_DSA: int\n\nclass Error(Exception): ...\n\n_Key = Union[rsa.RSAPublicKey, rsa.RSAPrivateKey, dsa.DSAPublicKey, dsa.DSAPrivateKey]\n\nclass PKey:\n def __init__(self) -> None: ...\n def to_cryptography_key(self) -> _Key: ...\n @classmethod\n def from_cryptography_key(cls, crypto_key: _Key): ...\n def generate_key(self, type: int, bits: int) -> None: ...\n def check(self) -> bool: ...\n def type(self) -> int: ...\n def bits(self) -> int: ...\n\nclass _EllipticCurve:\n name: Text\n\ndef get_elliptic_curves() -> Set[_EllipticCurve]: ...\ndef get_elliptic_curve(name: str) -> _EllipticCurve: ...\n\nclass X509Name:\n def __init__(self, name: X509Name) -> None: ...\n countryName: Union[str, unicode]\n stateOrProvinceName: Union[str, unicode]\n localityName: Union[str, unicode]\n organizationName: Union[str, unicode]\n organizationalUnitName: Union[str, unicode]\n commonName: Union[str, unicode]\n emailAddress: Union[str, unicode]\n C: Union[str, unicode]\n ST: Union[str, unicode]\n L: Union[str, unicode]\n O: Union[str, unicode]\n OU: Union[str, unicode]\n CN: Union[str, unicode]\n def hash(self) -> int: ...\n def der(self) -> bytes: ...\n def get_components(self) -> List[Tuple[str, str]]: ...\n\nclass X509Extension:\n def __init__(\n self, type_name: bytes, critical: bool, value: bytes, subject: Optional[X509] = ..., issuer: Optional[X509] = ...\n ) -> None: ...\n def get_critical(self) -> bool: ...\n def get_short_name(self) -> str: ...\n def get_data(self) -> str: ...\n\nclass X509Req:\n def __init__(self) -> None: ...\n def set_pubkey(self, pkey: PKey) -> None: ...\n def get_pubkey(self) -> PKey: ...\n def set_version(self, version: int) -> None: ...\n def get_version(self) -> int: ...\n def get_subject(self) -> X509Name: ...\n def add_extensions(self, extensions: Iterable[X509Extension]) -> None: ...\n def get_extensions(self) -> List[X509Extension]: ...\n def sign(self, pkey: PKey, digest: str) -> None: ...\n def verify(self, pkey: PKey) -> bool: ...\n\nclass X509:\n def __init__(self) -> None: ...\n def set_version(self, version: int) -> None: ...\n def get_version(self) -> int: ...\n def get_pubkey(self) -> PKey: ...\n def set_pubkey(self, pkey: PKey) -> None: ...\n def sign(self, pkey: PKey, digest: str) -> None: ...\n def get_signature_algorithm(self) -> str: ...\n def digest(self, digest_name: str) -> str: ...\n def subject_name_hash(self) -> str: ...\n def set_serial_number(self, serial: int) -> None: ...\n def get_serial_number(self) -> int: ...\n def gmtime_adj_notAfter(self, amount: int) -> None: ...\n def gmtime_adj_notBefore(self, amount: int) -> None: ...\n def has_expired(self) -> bool: ...\n def get_notBefore(self) -> str: ...\n def set_notBefore(self, when: str) -> None: ...\n def get_notAfter(self) -> str: ...\n def set_notAfter(self, when: str) -> None: ...\n def get_issuer(self) -> X509Name: ...\n def set_issuer(self, issuer: X509Name) -> None: ...\n def get_subject(self) -> X509Name: ...\n def set_subject(self, subject: X509Name) -> None: ...\n def get_extension_count(self) -> int: ...\n def add_extensions(self, extensions: Iterable[X509Extension]) -> None: ...\n def get_extension(self, index: int) -> X509Extension: ...\n\nclass X509StoreFlags:\n CRL_CHECK: int\n CRL_CHECK_ALL: int\n IGNORE_CRITICAL: int\n X509_STRICT: int\n ALLOW_PROXY_CERTS: int\n POLICY_CHECK: int\n EXPLICIT_POLICY: int\n INHIBIT_MAP: int\n NOTIFY_POLICY: int\n CHECK_SS_SIGNATURE: int\n CB_ISSUER_CHECK: int\n\nclass X509Store:\n def __init__(self) -> None: ...\n def add_cert(self, cert: X509) -> None: ...\n def add_crl(self, crl: CRL) -> None: ...\n def set_flags(self, flags: int) -> None: ...\n def set_time(self, vfy_time: datetime) -> None: ...\n\nclass X509StoreContextError(Exception):\n certificate: X509\n def __init__(self, message: str, certificate: X509) -> None: ...\n\nclass X509StoreContext:\n def __init__(self, store: X509Store, certificate: X509) -> None: ...\n def set_store(self, store: X509Store) -> None: ...\n def verify_certificate(self) -> None: ...\n\ndef load_certificate(type: int, buffer: Union[str, unicode]) -> X509: ...\ndef dump_certificate(type: int, cert: X509) -> bytes: ...\ndef dump_publickey(type: int, pkey: PKey) -> bytes: ...\ndef dump_privatekey(\n type: int, pkey: PKey, cipher: Optional[str] = ..., passphrase: Optional[Union[str, Callable[[int], int]]] = ...\n) -> bytes: ...\n\nclass Revoked:\n def __init__(self) -> None: ...\n def set_serial(self, hex_str: str) -> None: ...\n def get_serial(self) -> str: ...\n def set_reason(self, reason: str) -> None: ...\n def get_reason(self) -> str: ...\n def all_reasons(self) -> List[str]: ...\n def set_rev_date(self, when: str) -> None: ...\n def get_rev_date(self) -> str: ...\n\nclass CRL:\n def __init__(self) -> None: ...\n def get_revoked(self) -> Tuple[Revoked, ...]: ...\n def add_revoked(self, revoked: Revoked) -> None: ...\n def get_issuer(self) -> X509Name: ...\n def set_version(self, version: int) -> None: ...\n def set_lastUpdate(self, when: str) -> None: ...\n def set_nextUpdate(self, when: str) -> None: ...\n def sign(self, issuer_cert: X509, issuer_key: PKey, digest: str) -> None: ...\n def export(self, cert: X509, key: PKey, type: int = ..., days: int = ..., digest: str = ...) -> bytes: ...\n\nclass PKCS7:\n def type_is_signed(self) -> bool: ...\n def type_is_enveloped(self) -> bool: ...\n def type_is_signedAndEnveloped(self) -> bool: ...\n def type_is_data(self) -> bool: ...\n def get_type_name(self) -> str: ...\n\nclass PKCS12:\n def __init__(self) -> None: ...\n def get_certificate(self) -> X509: ...\n def set_certificate(self, cert: X509) -> None: ...\n def get_privatekey(self) -> PKey: ...\n def set_privatekey(self, pkey: PKey) -> None: ...\n def get_ca_certificates(self) -> Tuple[X509, ...]: ...\n def set_ca_certificates(self, cacerts: Iterable[X509]) -> None: ...\n def set_friendlyname(self, name: bytes) -> None: ...\n def get_friendlyname(self) -> bytes: ...\n def export(self, passphrase: Optional[str] = ..., iter: int = ..., maciter: int = ...): ...\n\nclass NetscapeSPKI:\n def __init__(self) -> None: ...\n def sign(self, pkey: PKey, digest: str) -> None: ...\n def verify(self, key: PKey) -> bool: ...\n def b64_encode(self) -> str: ...\n def get_pubkey(self) -> PKey: ...\n def set_pubkey(self, pkey: PKey) -> None: ...\n\ndef load_publickey(type: int, buffer: Union[str, unicode]) -> PKey: ...\ndef load_privatekey(type: int, buffer: bytes, passphrase: Optional[Union[str, Callable[[int], int]]] = ...): ...\ndef dump_certificate_request(type: int, req: X509Req): ...\ndef load_certificate_request(type, buffer: Union[str, unicode]) -> X509Req: ...\ndef sign(pkey: PKey, data: Union[str, unicode], digest: str) -> bytes: ...\ndef verify(cert: X509, signature: bytes, data: Union[str, unicode], digest: str) -> None: ...\ndef dump_crl(type: int, crl: CRL) -> bytes: ...\ndef load_crl(type: int, buffer: Union[str, unicode]) -> CRL: ...\ndef load_pkcs7_data(type: int, buffer: Union[str, unicode]) -> PKCS7: ...\ndef load_pkcs12(buffer: Union[str, unicode], passphrase: Optional[Union[str, Callable[[int], int]]] = ...) -> PKCS12: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\OpenSSL\crypto.pyi | crypto.pyi | Other | 7,588 | 0.85 | 0.675393 | 0 | node-utils | 368 | 2024-01-15T15:58:55.579099 | Apache-2.0 | false | d75e9ff554de3fc1b05cfe1d32ea1c4e |
from typing import Any\n\nCOLLECTION_ACTIONS: Any\nMEMBER_ACTIONS: Any\n\ndef strip_slashes(name): ...\n\nclass SubMapperParent:\n def submapper(self, **kargs): ...\n def collection(\n self,\n collection_name,\n resource_name,\n path_prefix=...,\n member_prefix=...,\n controller=...,\n collection_actions=...,\n member_actions=...,\n member_options=...,\n **kwargs,\n ): ...\n\nclass SubMapper(SubMapperParent):\n kwargs: Any\n obj: Any\n collection_name: Any\n member: Any\n resource_name: Any\n formatted: Any\n def __init__(self, obj, resource_name=..., collection_name=..., actions=..., formatted=..., **kwargs) -> None: ...\n def connect(self, *args, **kwargs): ...\n def link(self, rel=..., name=..., action=..., method=..., formatted=..., **kwargs): ...\n def new(self, **kwargs): ...\n def edit(self, **kwargs): ...\n def action(self, name=..., action=..., method=..., formatted=..., **kwargs): ...\n def index(self, name=..., **kwargs): ...\n def show(self, name=..., **kwargs): ...\n def create(self, **kwargs): ...\n def update(self, **kwargs): ...\n def delete(self, **kwargs): ...\n def add_actions(self, actions): ...\n def __enter__(self): ...\n def __exit__(self, type, value, tb): ...\n\nclass Mapper(SubMapperParent):\n matchlist: Any\n maxkeys: Any\n minkeys: Any\n urlcache: Any\n prefix: Any\n req_data: Any\n directory: Any\n always_scan: Any\n controller_scan: Any\n debug: Any\n append_slash: Any\n sub_domains: Any\n sub_domains_ignore: Any\n domain_match: Any\n explicit: Any\n encoding: Any\n decode_errors: Any\n hardcode_names: Any\n minimization: Any\n create_regs_lock: Any\n def __init__(self, controller_scan=..., directory=..., always_scan=..., register=..., explicit=...) -> None: ...\n environ: Any\n def extend(self, routes, path_prefix=...): ...\n def make_route(self, *args, **kargs): ...\n def connect(self, *args, **kargs): ...\n def create_regs(self, *args, **kwargs): ...\n def match(self, url=..., environ=...): ...\n def routematch(self, url=..., environ=...): ...\n obj: Any\n def generate(self, *args, **kargs): ...\n def resource(self, member_name, collection_name, **kwargs): ...\n def redirect(self, match_path, destination_path, *args, **kwargs): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\routes\mapper.pyi | mapper.pyi | Other | 2,362 | 0.85 | 0.38961 | 0.013889 | vue-tools | 663 | 2023-12-05T14:52:44.383672 | GPL-3.0 | false | 56b02b975738c032bfa06f166f4ea730 |
from typing import Any\n\nclass RoutesException(Exception): ...\nclass MatchException(RoutesException): ...\nclass GenerationException(RoutesException): ...\n\ndef url_for(*args, **kargs): ...\n\nclass URLGenerator:\n mapper: Any\n environ: Any\n def __init__(self, mapper, environ) -> None: ...\n def __call__(self, *args, **kargs): ...\n def current(self, *args, **kwargs): ...\n\ndef redirect_to(*args, **kargs): ...\ndef cache_hostinfo(environ): ...\ndef controller_scan(directory=...): ...\ndef as_unicode(value, encoding, errors=...): ...\ndef ascii_characters(string): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\routes\util.pyi | util.pyi | Other | 576 | 0.85 | 0.65 | 0 | vue-tools | 683 | 2024-06-29T10:59:03.958453 | Apache-2.0 | false | e34c93590a7674ea72dcc97e9bac084e |
from . import mapper, util\n\nclass _RequestConfig:\n def __getattr__(self, name): ...\n def __setattr__(self, name, value): ...\n def __delattr__(self, name): ...\n def load_wsgi_environ(self, environ): ...\n\ndef request_config(original=...): ...\n\nMapper = mapper.Mapper\nredirect_to = util.redirect_to\nurl_for = util.url_for\nURLGenerator = util.URLGenerator\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\routes\__init__.pyi | __init__.pyi | Other | 364 | 0.85 | 0.428571 | 0 | awesome-app | 985 | 2025-07-04T08:15:04.209623 | BSD-3-Clause | false | 42dac0ea1ef49860c81a6e9e45323c72 |
from typing import Any\n\nimport fb303.FacebookService\nfrom thrift.Thrift import TProcessor # type: ignore # We don't have thrift stubs in typeshed\n\nfrom .ttypes import * # noqa: F403\n\nclass Iface(fb303.FacebookService.Iface):\n def Log(self, messages): ...\n\nclass Client(fb303.FacebookService.Client, Iface):\n def __init__(self, iprot, oprot=...) -> None: ...\n def Log(self, messages): ...\n def send_Log(self, messages): ...\n def recv_Log(self): ...\n\nclass Processor(fb303.FacebookService.Processor, Iface, TProcessor): # type: ignore\n def __init__(self, handler) -> None: ...\n def process(self, iprot, oprot): ...\n def process_Log(self, seqid, iprot, oprot): ...\n\nclass Log_args:\n thrift_spec: Any\n messages: Any\n def __init__(self, messages=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n\nclass Log_result:\n thrift_spec: Any\n success: Any\n def __init__(self, success=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\scribe\scribe.pyi | scribe.pyi | Other | 1,216 | 0.95 | 0.625 | 0 | node-utils | 518 | 2023-10-24T02:50:31.344421 | MIT | false | b4159e77d66978befeed14276cb1408e |
from typing import Any\n\nfastbinary: Any\n\nclass ResultCode:\n OK: Any\n TRY_LATER: Any\n\nclass LogEntry:\n thrift_spec: Any\n category: Any\n message: Any\n def __init__(self, category=..., message=...) -> None: ...\n def read(self, iprot): ...\n def write(self, oprot): ...\n def validate(self): ...\n def __eq__(self, other): ...\n def __ne__(self, other): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\scribe\ttypes.pyi | ttypes.pyi | Other | 383 | 0.85 | 0.444444 | 0 | node-utils | 328 | 2024-01-17T14:22:12.117422 | Apache-2.0 | false | bc13e8a738ce8d05801c7fe0f75846e9 |
from __future__ import print_function\n\nimport types\nimport typing\nimport unittest\nfrom __builtin__ import unichr as unichr\nfrom functools import wraps as wraps\nfrom StringIO import StringIO as StringIO\nfrom typing import (\n Any,\n AnyStr,\n Callable,\n Dict,\n ItemsView,\n Iterable,\n KeysView,\n Mapping,\n NoReturn,\n Optional,\n Pattern,\n Text,\n Tuple,\n Type,\n TypeVar,\n Union,\n ValuesView,\n overload,\n)\n\nfrom . import moves\n\nBytesIO = StringIO\n\n_T = TypeVar("_T")\n_K = TypeVar("_K")\n_V = TypeVar("_V")\n\n__version__: str\n\n# TODO make constant, then move this stub to 2and3\n# https://github.com/python/typeshed/issues/17\nPY2 = True\nPY3 = False\nPY34 = False\n\nstring_types = (str, unicode)\ninteger_types = (int, long)\nclass_types = (type, types.ClassType)\ntext_type = unicode\nbinary_type = str\n\nMAXSIZE: int\n\ndef advance_iterator(it: typing.Iterator[_T]) -> _T: ...\n\nnext = advance_iterator\n\ndef callable(obj: object) -> bool: ...\ndef get_unbound_function(unbound: types.MethodType) -> types.FunctionType: ...\ndef create_bound_method(func: types.FunctionType, obj: object) -> types.MethodType: ...\ndef create_unbound_method(func: types.FunctionType, cls: Union[type, types.ClassType]) -> types.MethodType: ...\n\nclass Iterator:\n def next(self) -> Any: ...\n\ndef get_method_function(meth: types.MethodType) -> types.FunctionType: ...\ndef get_method_self(meth: types.MethodType) -> Optional[object]: ...\ndef get_function_closure(fun: types.FunctionType) -> Optional[Tuple[types._Cell, ...]]: ...\ndef get_function_code(fun: types.FunctionType) -> types.CodeType: ...\ndef get_function_defaults(fun: types.FunctionType) -> Optional[Tuple[Any, ...]]: ...\ndef get_function_globals(fun: types.FunctionType) -> Dict[str, Any]: ...\ndef iterkeys(d: Mapping[_K, _V]) -> typing.Iterator[_K]: ...\ndef itervalues(d: Mapping[_K, _V]) -> typing.Iterator[_V]: ...\ndef iteritems(d: Mapping[_K, _V]) -> typing.Iterator[Tuple[_K, _V]]: ...\n\n# def iterlists\n\ndef viewkeys(d: Mapping[_K, _V]) -> KeysView[_K]: ...\ndef viewvalues(d: Mapping[_K, _V]) -> ValuesView[_V]: ...\ndef viewitems(d: Mapping[_K, _V]) -> ItemsView[_K, _V]: ...\ndef b(s: str) -> binary_type: ...\ndef u(s: str) -> text_type: ...\n\nint2byte = chr\n\ndef byte2int(bs: binary_type) -> int: ...\ndef indexbytes(buf: binary_type, i: int) -> int: ...\ndef iterbytes(buf: binary_type) -> typing.Iterator[int]: ...\ndef assertCountEqual(self: unittest.TestCase, first: Iterable[_T], second: Iterable[_T], msg: str = ...) -> None: ...\n@overload\ndef assertRaisesRegex(self: unittest.TestCase, msg: str = ...) -> Any: ...\n@overload\ndef assertRaisesRegex(self: unittest.TestCase, callable_obj: Callable[..., Any], *args: Any, **kwargs: Any) -> Any: ...\ndef assertRegex(\n self: unittest.TestCase, text: AnyStr, expected_regex: Union[AnyStr, Pattern[AnyStr]], msg: str = ...\n) -> None: ...\ndef reraise(\n tp: Optional[Type[BaseException]], value: Optional[BaseException], tb: Optional[types.TracebackType] = ...\n) -> NoReturn: ...\ndef exec_(_code_: Union[unicode, types.CodeType], _globs_: Dict[str, Any] = ..., _locs_: Dict[str, Any] = ...): ...\ndef raise_from(value: Union[BaseException, Type[BaseException]], from_value: Optional[BaseException]) -> NoReturn: ...\n\nprint_ = print\n\ndef with_metaclass(meta: type, *bases: type) -> type: ...\ndef add_metaclass(metaclass: type) -> Callable[[_T], _T]: ...\ndef ensure_binary(s: Union[bytes, Text], encoding: str = ..., errors: str = ...) -> bytes: ...\ndef ensure_str(s: Union[bytes, Text], encoding: str = ..., errors: str = ...) -> str: ...\ndef ensure_text(s: Union[bytes, Text], encoding: str = ..., errors: str = ...) -> Text: ...\ndef python_2_unicode_compatible(klass: _T) -> _T: ...\n\nclass _LazyDescriptor:\n name: str\n def __init__(self, name: str) -> None: ...\n def __get__(self, obj: Optional[object], type: Optional[type] = ...) -> Any: ...\n\nclass MovedModule(_LazyDescriptor):\n mod: str\n def __init__(self, name: str, old: str, new: Optional[str] = ...) -> None: ...\n def __getattr__(self, attr: str) -> Any: ...\n\nclass MovedAttribute(_LazyDescriptor):\n mod: str\n attr: str\n def __init__(\n self, name: str, old_mod: str, new_mod: str, old_attr: Optional[str] = ..., new_attr: Optional[str] = ...\n ) -> None: ...\n\ndef add_move(move: Union[MovedModule, MovedAttribute]) -> None: ...\ndef remove_move(name: str) -> None: ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\__init__.pyi | __init__.pyi | Other | 4,390 | 0.95 | 0.369231 | 0.028037 | vue-tools | 546 | 2023-09-06T17:05:03.135880 | GPL-3.0 | false | e4b18f587554c4dc747fafee5dd5fcae |
from BaseHTTPServer import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\BaseHTTPServer.pyi | BaseHTTPServer.pyi | Other | 29 | 0.65 | 0 | 0 | react-lib | 409 | 2024-05-11T12:08:37.298203 | GPL-3.0 | false | 3aa1366df5ff152a2757620f907c0a17 |
from CGIHTTPServer import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\CGIHTTPServer.pyi | CGIHTTPServer.pyi | Other | 28 | 0.65 | 0 | 0 | node-utils | 787 | 2025-07-04T21:26:54.570870 | GPL-3.0 | false | 89f4c38f71e5342649d2ebf98b5ea803 |
from collections import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\collections_abc.pyi | collections_abc.pyi | Other | 26 | 0.65 | 0 | 0 | awesome-app | 49 | 2025-07-05T03:30:59.441991 | GPL-3.0 | false | 1bd2bebf32e24cbfa61db0567943cabc |
from ConfigParser import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\configparser.pyi | configparser.pyi | Other | 27 | 0.65 | 0 | 0 | react-lib | 357 | 2024-06-06T14:42:56.069372 | BSD-3-Clause | false | 0d2faaab04b3d3c2cbc7bd7e604bc00a |
from cPickle import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\cPickle.pyi | cPickle.pyi | Other | 22 | 0.65 | 0 | 0 | vue-tools | 282 | 2024-04-19T14:43:36.736406 | GPL-3.0 | false | e00ab8085ba3a6ef0f314bd659f0a1bc |
from email.mime.base import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\email_mime_base.pyi | email_mime_base.pyi | Other | 30 | 0.65 | 0 | 0 | python-kit | 789 | 2025-04-26T03:57:41.614511 | Apache-2.0 | false | ff4bcee3cf8667ab29fba8f01d4849e2 |
from email.mime.multipart import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\email_mime_multipart.pyi | email_mime_multipart.pyi | Other | 35 | 0.65 | 0 | 0 | node-utils | 595 | 2024-03-01T04:03:31.305332 | GPL-3.0 | false | f117994bd56265ad287f2057dba3800e |
from email.mime.nonmultipart import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\email_mime_nonmultipart.pyi | email_mime_nonmultipart.pyi | Other | 38 | 0.65 | 0 | 0 | python-kit | 971 | 2024-06-08T05:35:01.301994 | Apache-2.0 | false | 2f0f0cf7b13e1cb958547790f2565320 |
from email.MIMEText import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\email_mime_text.pyi | email_mime_text.pyi | Other | 29 | 0.65 | 0 | 0 | python-kit | 449 | 2024-10-20T17:16:25.028099 | BSD-3-Clause | false | 720fac1565c973b0a7f9ba4377f4e2ec |
from htmlentitydefs import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\html_entities.pyi | html_entities.pyi | Other | 29 | 0.65 | 0 | 0 | awesome-app | 639 | 2024-03-29T11:43:28.438225 | MIT | false | 3d98944028163d5cc7e2b32d28a264c3 |
from HTMLParser import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\html_parser.pyi | html_parser.pyi | Other | 25 | 0.65 | 0 | 0 | awesome-app | 956 | 2024-08-06T02:47:48.677128 | MIT | false | d236f3eeba7a10ccb670139f71d6bce4 |
from httplib import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\http_client.pyi | http_client.pyi | Other | 22 | 0.65 | 0 | 0 | vue-tools | 727 | 2025-03-17T05:10:50.340074 | BSD-3-Clause | false | ac3f6ad3be26e697f6d9eb7830ef242f |
from cookielib import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\http_cookiejar.pyi | http_cookiejar.pyi | Other | 24 | 0.65 | 0 | 0 | vue-tools | 742 | 2024-11-15T09:53:57.723594 | BSD-3-Clause | false | 0b5610f813514754a252ad72e73a8ef8 |
from Cookie import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\http_cookies.pyi | http_cookies.pyi | Other | 21 | 0.65 | 0 | 0 | awesome-app | 410 | 2025-06-22T04:50:24.059406 | BSD-3-Clause | false | 970e3f1daece8a88ce8c38b754b82126 |
from Queue import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\queue.pyi | queue.pyi | Other | 20 | 0.65 | 0 | 0 | node-utils | 821 | 2024-12-26T00:31:55.574157 | MIT | false | d79b1dec5e43e38bf83c2f21cd2ae7f2 |
from repr import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\reprlib.pyi | reprlib.pyi | Other | 19 | 0.65 | 0 | 0 | react-lib | 406 | 2023-09-18T19:41:16.745482 | BSD-3-Clause | false | 6e3d1da6b332789a74089a908723ae0d |
from SimpleHTTPServer import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\SimpleHTTPServer.pyi | SimpleHTTPServer.pyi | Other | 31 | 0.65 | 0 | 0 | awesome-app | 609 | 2024-12-26T04:17:35.205817 | BSD-3-Clause | false | cee67c1ee87c4a47b9ede0ad827b5f2c |
from SocketServer import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\socketserver.pyi | socketserver.pyi | Other | 27 | 0.65 | 0 | 0 | awesome-app | 983 | 2024-08-16T05:14:40.228509 | BSD-3-Clause | false | 2f32d55931554c4dba19c1830da4e5a5 |
from .urllib.error import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\urllib_error.pyi | urllib_error.pyi | Other | 28 | 0.65 | 0 | 0 | node-utils | 603 | 2025-02-25T10:04:41.924883 | Apache-2.0 | false | d62a122dade693ceda5c03611f91e067 |
from .urllib.parse import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\urllib_parse.pyi | urllib_parse.pyi | Other | 28 | 0.65 | 0 | 0 | vue-tools | 225 | 2024-05-17T20:19:16.856718 | BSD-3-Clause | false | 52aed230c1b89b50c212511ea71522f8 |
from .urllib.request import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\urllib_request.pyi | urllib_request.pyi | Other | 30 | 0.65 | 0 | 0 | node-utils | 733 | 2024-01-30T07:44:39.935374 | Apache-2.0 | false | 6cab3b7235e3533561f8a62233222aa2 |
from .urllib.response import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\urllib_response.pyi | urllib_response.pyi | Other | 31 | 0.65 | 0 | 0 | node-utils | 44 | 2023-09-09T17:27:31.433806 | Apache-2.0 | false | 2cdece13bcc1f06cc37015a2bc994768 |
from robotparser import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\urllib_robotparser.pyi | urllib_robotparser.pyi | Other | 26 | 0.65 | 0 | 0 | vue-tools | 872 | 2025-04-27T05:45:24.360660 | MIT | false | 2001244fb626446c148df7d47c732d20 |
from xmlrpclib import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\xmlrpc_client.pyi | xmlrpc_client.pyi | Other | 24 | 0.65 | 0 | 0 | vue-tools | 312 | 2024-07-31T12:24:33.366827 | GPL-3.0 | false | 06aea48bc661cf0feae9fb43c95e952f |
from dummy_thread import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\_dummy_thread.pyi | _dummy_thread.pyi | Other | 27 | 0.65 | 0 | 0 | node-utils | 595 | 2024-10-22T17:20:51.216333 | GPL-3.0 | false | 773b417b3b12a5d63389481328a4e867 |
from thread import *\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\_thread.pyi | _thread.pyi | Other | 21 | 0.65 | 0 | 0 | react-lib | 96 | 2025-06-13T04:43:26.941631 | MIT | false | a965ea101a280434b22962e8ba88033d |
# Stubs for six.moves\n#\n# Note: Commented out items means they weren't implemented at the time.\n# Uncomment them when the modules have been added to the typeshed.\nimport __builtin__\nimport itertools\nimport os\nimport pipes\nfrom __builtin__ import intern as intern, reduce as reduce, xrange as xrange\nfrom cStringIO import StringIO as _cStringIO\nfrom StringIO import StringIO as StringIO\nfrom UserDict import UserDict as UserDict\nfrom UserList import UserList as UserList\nfrom UserString import UserString as UserString\n\n# import Tkinter as tkinter\n# import Dialog as tkinter_dialog\n# import FileDialog as tkinter_filedialog\n# import ScrolledText as tkinter_scrolledtext\n# import SimpleDialog as tkinter_simpledialog\n# import Tix as tkinter_tix\n# import ttk as tkinter_ttk\n# import Tkconstants as tkinter_constants\n# import Tkdnd as tkinter_dnd\n# import tkColorChooser as tkinter_colorchooser\n# import tkCommonDialog as tkinter_commondialog\n# import tkFileDialog as tkinter_tkfiledialog\n# import tkFont as tkinter_font\n# import tkMessageBox as tkinter_messagebox\n# import tkSimpleDialog as tkinter_tksimpledialog\n# import email.MIMEBase as email_mime_base\n# import email.MIMEMultipart as email_mime_multipart\n# import email.MIMENonMultipart as email_mime_nonmultipart\n# import copy_reg as copyreg\n# import gdbm as dbm_gnu\nfrom . import (\n BaseHTTPServer,\n CGIHTTPServer,\n SimpleHTTPServer,\n _dummy_thread,\n _thread,\n configparser,\n cPickle,\n email_mime_text,\n html_entities,\n html_parser,\n http_client,\n http_cookiejar,\n http_cookies,\n queue,\n reprlib,\n socketserver,\n urllib,\n urllib_error,\n urllib_parse,\n urllib_robotparser,\n xmlrpc_client,\n)\n\n# import SimpleXMLRPCServer as xmlrpc_server\n\nbuiltins = __builtin__\ninput = __builtin__.raw_input\nreload_module = __builtin__.reload\nrange = __builtin__.xrange\n\ncStringIO = _cStringIO\n\nfilter = itertools.ifilter\nfilterfalse = itertools.ifilterfalse\nmap = itertools.imap\nzip = itertools.izip\nzip_longest = itertools.izip_longest\n\ngetcwdb = os.getcwd\ngetcwd = os.getcwdu\n\nshlex_quote = pipes.quote\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\__init__.pyi | __init__.pyi | Other | 2,105 | 0.95 | 0.012821 | 0.352113 | python-kit | 53 | 2024-10-20T22:42:42.936430 | BSD-3-Clause | false | 1eba8ba31b5c79907b92aae683ab36f3 |
from urllib import ContentTooShortError as ContentTooShortError\nfrom urllib2 import HTTPError as HTTPError, URLError as URLError\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\urllib\error.pyi | error.pyi | Other | 129 | 0.85 | 0 | 0 | python-kit | 339 | 2024-03-15T23:57:42.501475 | GPL-3.0 | false | 20c31e78df79fbeab15ef8b55102af5d |
from urllib import (\n quote as quote,\n quote_plus as quote_plus,\n splitquery as splitquery,\n splittag as splittag,\n splituser as splituser,\n unquote as unquote,\n unquote_plus as unquote_plus,\n urlencode as urlencode,\n)\nfrom urlparse import (\n ParseResult as ParseResult,\n SplitResult as SplitResult,\n parse_qs as parse_qs,\n parse_qsl as parse_qsl,\n urldefrag as urldefrag,\n urljoin as urljoin,\n urlparse as urlparse,\n urlsplit as urlsplit,\n urlunparse as urlunparse,\n urlunsplit as urlunsplit,\n uses_fragment as uses_fragment,\n uses_netloc as uses_netloc,\n uses_params as uses_params,\n uses_query as uses_query,\n uses_relative as uses_relative,\n)\n\nunquote_to_bytes = unquote\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\urllib\parse.pyi | parse.pyi | Other | 744 | 0.85 | 0 | 0 | react-lib | 39 | 2023-09-27T20:23:52.944536 | MIT | false | 6e907d50cedbaa964995dd327697994f |
from urllib import (\n FancyURLopener as FancyURLopener,\n URLopener as URLopener,\n getproxies as getproxies,\n pathname2url as pathname2url,\n proxy_bypass as proxy_bypass,\n url2pathname as url2pathname,\n urlcleanup as urlcleanup,\n urlretrieve as urlretrieve,\n)\nfrom urllib2 import (\n AbstractBasicAuthHandler as AbstractBasicAuthHandler,\n AbstractDigestAuthHandler as AbstractDigestAuthHandler,\n BaseHandler as BaseHandler,\n CacheFTPHandler as CacheFTPHandler,\n FileHandler as FileHandler,\n FTPHandler as FTPHandler,\n HTTPBasicAuthHandler as HTTPBasicAuthHandler,\n HTTPCookieProcessor as HTTPCookieProcessor,\n HTTPDefaultErrorHandler as HTTPDefaultErrorHandler,\n HTTPDigestAuthHandler as HTTPDigestAuthHandler,\n HTTPErrorProcessor as HTTPErrorProcessor,\n HTTPHandler as HTTPHandler,\n HTTPPasswordMgr as HTTPPasswordMgr,\n HTTPPasswordMgrWithDefaultRealm as HTTPPasswordMgrWithDefaultRealm,\n HTTPRedirectHandler as HTTPRedirectHandler,\n HTTPSHandler as HTTPSHandler,\n OpenerDirector as OpenerDirector,\n ProxyBasicAuthHandler as ProxyBasicAuthHandler,\n ProxyDigestAuthHandler as ProxyDigestAuthHandler,\n ProxyHandler as ProxyHandler,\n Request as Request,\n UnknownHandler as UnknownHandler,\n build_opener as build_opener,\n install_opener as install_opener,\n parse_http_list as parse_http_list,\n parse_keqv_list as parse_keqv_list,\n urlopen as urlopen,\n)\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\urllib\request.pyi | request.pyi | Other | 1,453 | 0.85 | 0 | 0 | vue-tools | 562 | 2023-11-24T18:38:19.926399 | Apache-2.0 | false | 9d106c3651feb58ea6e8beb0350b0900 |
from urllib import addbase as addbase, addclosehook as addclosehook, addinfo as addinfo, addinfourl as addinfourl\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\urllib\response.pyi | response.pyi | Other | 114 | 0.85 | 0 | 0 | node-utils | 97 | 2023-08-02T08:57:42.337778 | BSD-3-Clause | false | c27641fe3d481375587549f828b6d74c |
from robotparser import RobotFileParser as RobotFileParser\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\urllib\robotparser.pyi | robotparser.pyi | Other | 59 | 0.65 | 0 | 0 | node-utils | 530 | 2023-10-22T01:56:03.720968 | BSD-3-Clause | false | 5afd2fdc564f8acca84917c0ab0d39f4 |
import six.moves.urllib.error as error\nimport six.moves.urllib.parse as parse\nimport six.moves.urllib.request as request\nimport six.moves.urllib.response as response\nimport six.moves.urllib.robotparser as robotparser\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\six\moves\urllib\__init__.pyi | __init__.pyi | Other | 217 | 0.85 | 0 | 0 | node-utils | 352 | 2024-05-21T03:25:51.001076 | GPL-3.0 | false | f3ae2c07dd91df9d44c138f71bd45f37 |
from typing import Any\n\nfutures: Any\n\nclass ReturnValueIgnoredError(Exception): ...\n\nclass _TracebackLogger:\n exc_info: Any\n formatted_tb: Any\n def __init__(self, exc_info) -> None: ...\n def activate(self): ...\n def clear(self): ...\n def __del__(self): ...\n\nclass Future:\n def __init__(self) -> None: ...\n def cancel(self): ...\n def cancelled(self): ...\n def running(self): ...\n def done(self): ...\n def result(self, timeout=...): ...\n def exception(self, timeout=...): ...\n def add_done_callback(self, fn): ...\n def set_result(self, result): ...\n def set_exception(self, exception): ...\n def exc_info(self): ...\n def set_exc_info(self, exc_info): ...\n def __del__(self): ...\n\nTracebackFuture: Any\nFUTURES: Any\n\ndef is_future(x): ...\n\nclass DummyExecutor:\n def submit(self, fn, *args, **kwargs): ...\n def shutdown(self, wait=...): ...\n\ndummy_executor: Any\n\ndef run_on_executor(*args, **kwargs): ...\ndef return_future(f): ...\ndef chain_future(a, b): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\tornado\concurrent.pyi | concurrent.pyi | Other | 1,016 | 0.85 | 0.627907 | 0 | python-kit | 692 | 2025-03-21T00:23:47.837265 | BSD-3-Clause | false | f20e98d65bee9d7cc3f5083d90d50545 |
from typing import Any, Dict, NamedTuple, Tuple\n\nsingledispatch: Any\n\nclass KeyReuseError(Exception): ...\nclass UnknownKeyError(Exception): ...\nclass LeakedCallbackError(Exception): ...\nclass BadYieldError(Exception): ...\nclass ReturnValueIgnoredError(Exception): ...\nclass TimeoutError(Exception): ...\n\ndef engine(func): ...\ndef coroutine(func, replace_callback=...): ...\n\nclass Return(Exception):\n value: Any\n def __init__(self, value=...) -> None: ...\n\nclass WaitIterator:\n current_index: Any\n def __init__(self, *args, **kwargs) -> None: ...\n def done(self): ...\n def next(self): ...\n\nclass YieldPoint:\n def start(self, runner): ...\n def is_ready(self): ...\n def get_result(self): ...\n\nclass Callback(YieldPoint):\n key: Any\n def __init__(self, key) -> None: ...\n runner: Any\n def start(self, runner): ...\n def is_ready(self): ...\n def get_result(self): ...\n\nclass Wait(YieldPoint):\n key: Any\n def __init__(self, key) -> None: ...\n runner: Any\n def start(self, runner): ...\n def is_ready(self): ...\n def get_result(self): ...\n\nclass WaitAll(YieldPoint):\n keys: Any\n def __init__(self, keys) -> None: ...\n runner: Any\n def start(self, runner): ...\n def is_ready(self): ...\n def get_result(self): ...\n\ndef Task(func, *args, **kwargs): ...\n\nclass YieldFuture(YieldPoint):\n future: Any\n io_loop: Any\n def __init__(self, future, io_loop=...) -> None: ...\n runner: Any\n key: Any\n result_fn: Any\n def start(self, runner): ...\n def is_ready(self): ...\n def get_result(self): ...\n\nclass Multi(YieldPoint):\n keys: Any\n children: Any\n unfinished_children: Any\n quiet_exceptions: Any\n def __init__(self, children, quiet_exceptions=...) -> None: ...\n def start(self, runner): ...\n def is_ready(self): ...\n def get_result(self): ...\n\ndef multi_future(children, quiet_exceptions=...): ...\ndef maybe_future(x): ...\ndef with_timeout(timeout, future, io_loop=..., quiet_exceptions=...): ...\ndef sleep(duration): ...\n\nmoment: Any\n\nclass Runner:\n gen: Any\n result_future: Any\n future: Any\n yield_point: Any\n pending_callbacks: Any\n results: Any\n running: Any\n finished: Any\n had_exception: Any\n io_loop: Any\n stack_context_deactivate: Any\n def __init__(self, gen, result_future, first_yielded) -> None: ...\n def register_callback(self, key): ...\n def is_ready(self, key): ...\n def set_result(self, key, result): ...\n def pop_result(self, key): ...\n def run(self): ...\n def handle_yield(self, yielded): ...\n def result_callback(self, key): ...\n def handle_exception(self, typ, value, tb): ...\n\nclass Arguments(NamedTuple):\n args: Tuple[str, ...]\n kwargs: Dict[str, Any]\n\ndef convert_yielded(yielded): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\tornado\gen.pyi | gen.pyi | Other | 2,785 | 0.85 | 0.545455 | 0 | react-lib | 13 | 2024-08-13T07:35:51.620390 | Apache-2.0 | false | 322043eb1d4438147de799186335dfb1 |
from typing import Any\n\nfrom tornado.util import Configurable\n\nclass HTTPClient:\n def __init__(self, async_client_class=..., **kwargs) -> None: ...\n def __del__(self): ...\n def close(self): ...\n def fetch(self, request, **kwargs): ...\n\nclass AsyncHTTPClient(Configurable):\n @classmethod\n def configurable_base(cls): ...\n @classmethod\n def configurable_default(cls): ...\n def __new__(cls, io_loop=..., force_instance=..., **kwargs): ...\n io_loop: Any\n defaults: Any\n def initialize(self, io_loop, defaults=...): ...\n def close(self): ...\n def fetch(self, request, callback=..., raise_error=..., **kwargs): ...\n def fetch_impl(self, request, callback): ...\n @classmethod\n def configure(cls, impl, **kwargs): ...\n\nclass HTTPRequest:\n proxy_host: Any\n proxy_port: Any\n proxy_username: Any\n proxy_password: Any\n url: Any\n method: Any\n body_producer: Any\n auth_username: Any\n auth_password: Any\n auth_mode: Any\n connect_timeout: Any\n request_timeout: Any\n follow_redirects: Any\n max_redirects: Any\n user_agent: Any\n decompress_response: Any\n network_interface: Any\n streaming_callback: Any\n header_callback: Any\n prepare_curl_callback: Any\n allow_nonstandard_methods: Any\n validate_cert: Any\n ca_certs: Any\n allow_ipv6: Any\n client_key: Any\n client_cert: Any\n ssl_options: Any\n expect_100_continue: Any\n start_time: Any\n def __init__(\n self,\n url,\n method=...,\n headers=...,\n body=...,\n auth_username=...,\n auth_password=...,\n auth_mode=...,\n connect_timeout=...,\n request_timeout=...,\n if_modified_since=...,\n follow_redirects=...,\n max_redirects=...,\n user_agent=...,\n use_gzip=...,\n network_interface=...,\n streaming_callback=...,\n header_callback=...,\n prepare_curl_callback=...,\n proxy_host=...,\n proxy_port=...,\n proxy_username=...,\n proxy_password=...,\n allow_nonstandard_methods=...,\n validate_cert=...,\n ca_certs=...,\n allow_ipv6=...,\n client_key=...,\n client_cert=...,\n body_producer=...,\n expect_100_continue=...,\n decompress_response=...,\n ssl_options=...,\n ) -> None: ...\n @property\n def headers(self): ...\n @headers.setter\n def headers(self, value): ...\n @property\n def body(self): ...\n @body.setter\n def body(self, value): ...\n\nclass HTTPResponse:\n request: Any\n code: Any\n reason: Any\n headers: Any\n buffer: Any\n effective_url: Any\n error: Any\n request_time: Any\n time_info: Any\n def __init__(\n self, request, code, headers=..., buffer=..., effective_url=..., error=..., request_time=..., time_info=..., reason=...\n ) -> None: ...\n body: bytes\n def rethrow(self): ...\n\nclass HTTPError(Exception):\n code: Any\n response: Any\n def __init__(self, code, message=..., response=...) -> None: ...\n\nclass _RequestProxy:\n request: Any\n defaults: Any\n def __init__(self, request, defaults) -> None: ...\n def __getattr__(self, name): ...\n\ndef main(): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\tornado\httpclient.pyi | httpclient.pyi | Other | 3,219 | 0.85 | 0.228346 | 0 | vue-tools | 95 | 2024-10-27T21:06:08.360138 | GPL-3.0 | false | 24204dc57c541ff7ac0a0cf82bf530c8 |
from typing import Any\n\nfrom tornado import httputil\nfrom tornado.tcpserver import TCPServer\nfrom tornado.util import Configurable\n\nclass HTTPServer(TCPServer, Configurable, httputil.HTTPServerConnectionDelegate):\n def __init__(self, *args, **kwargs) -> None: ...\n request_callback: Any\n no_keep_alive: Any\n xheaders: Any\n protocol: Any\n conn_params: Any\n def initialize(\n self,\n request_callback,\n no_keep_alive=...,\n io_loop=...,\n xheaders=...,\n ssl_options=...,\n protocol=...,\n decompress_request=...,\n chunk_size=...,\n max_header_size=...,\n idle_connection_timeout=...,\n body_timeout=...,\n max_body_size=...,\n max_buffer_size=...,\n ): ...\n @classmethod\n def configurable_base(cls): ...\n @classmethod\n def configurable_default(cls): ...\n def close_all_connections(self): ...\n def handle_stream(self, stream, address): ...\n def start_request(self, server_conn, request_conn): ...\n def on_close(self, server_conn): ...\n\nclass _HTTPRequestContext:\n address: Any\n protocol: Any\n address_family: Any\n remote_ip: Any\n def __init__(self, stream, address, protocol) -> None: ...\n\nclass _ServerRequestAdapter(httputil.HTTPMessageDelegate):\n server: Any\n connection: Any\n request: Any\n delegate: Any\n def __init__(self, server, server_conn, request_conn) -> None: ...\n def headers_received(self, start_line, headers): ...\n def data_received(self, chunk): ...\n def finish(self): ...\n def on_connection_close(self): ...\n\nHTTPRequest: Any\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\tornado\httpserver.pyi | httpserver.pyi | Other | 1,617 | 0.85 | 0.298246 | 0 | node-utils | 359 | 2024-08-18T05:17:49.912349 | BSD-3-Clause | false | 2d259f35c0437622e4a16bb385ffd09d |
from typing import Any, Dict, List, NamedTuple, Optional\n\nfrom tornado.util import ObjectDict\n\nclass SSLError(Exception): ...\n\nclass _NormalizedHeaderCache(Dict[Any, Any]):\n size: Any\n queue: Any\n def __init__(self, size) -> None: ...\n def __missing__(self, key): ...\n\nclass HTTPHeaders(Dict[Any, Any]):\n def __init__(self, *args, **kwargs) -> None: ...\n def add(self, name, value): ...\n def get_list(self, name): ...\n def get_all(self): ...\n def parse_line(self, line): ...\n @classmethod\n def parse(cls, headers): ...\n def __setitem__(self, name, value): ...\n def __getitem__(self, name): ...\n def __delitem__(self, name): ...\n def __contains__(self, name): ...\n def get(self, name, default=...): ...\n def update(self, *args, **kwargs): ...\n def copy(self): ...\n __copy__: Any\n def __deepcopy__(self, memo_dict): ...\n\nclass HTTPServerRequest:\n path: str\n query: str\n method: Optional[str]\n uri: Optional[str]\n version: str\n headers: HTTPHeaders\n body: bytes\n remote_ip: Any\n protocol: Any\n host: str\n files: Dict[str, List[HTTPFile]]\n connection: Optional[HTTPConnection]\n arguments: Dict[str, List[bytes]]\n query_arguments: Dict[str, List[bytes]]\n body_arguments: Dict[str, List[bytes]]\n def __init__(\n self, method=..., uri=..., version=..., headers=..., body=..., host=..., files=..., connection=..., start_line=...\n ) -> None: ...\n def supports_http_1_1(self): ...\n @property\n def cookies(self): ...\n def write(self, chunk, callback=...): ...\n def finish(self): ...\n def full_url(self): ...\n def request_time(self): ...\n def get_ssl_certificate(self, binary_form=...): ...\n\nclass HTTPInputError(Exception): ...\nclass HTTPOutputError(Exception): ...\n\nclass HTTPServerConnectionDelegate:\n def start_request(self, server_conn, request_conn): ...\n def on_close(self, server_conn): ...\n\nclass HTTPMessageDelegate:\n def headers_received(self, start_line, headers): ...\n def data_received(self, chunk): ...\n def finish(self): ...\n def on_connection_close(self): ...\n\nclass HTTPConnection:\n def write_headers(self, start_line, headers, chunk=..., callback=...): ...\n def write(self, chunk, callback=...): ...\n def finish(self): ...\n\ndef url_concat(url, args): ...\n\nclass HTTPFile(ObjectDict): ...\n\ndef parse_body_arguments(content_type, body, arguments, files, headers=...): ...\ndef parse_multipart_form_data(boundary, data, arguments, files): ...\ndef format_timestamp(ts): ...\n\nclass RequestStartLine(NamedTuple):\n method: str\n path: str\n version: str\n\ndef parse_request_start_line(line): ...\n\nclass ResponseStartLine(NamedTuple):\n version: str\n code: str\n reason: str\n\ndef parse_response_start_line(line): ...\ndef doctests(): ...\ndef split_host_and_port(netloc): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\tornado\httputil.pyi | httputil.pyi | Other | 2,853 | 0.85 | 0.535354 | 0 | awesome-app | 268 | 2025-01-04T19:09:57.308965 | BSD-3-Clause | false | c73a4fe6157909270777f8f3b8f284ad |
from typing import Any\n\nfrom tornado.util import Configurable\n\nsignal: Any\n\nclass TimeoutError(Exception): ...\n\nclass IOLoop(Configurable):\n NONE: Any\n READ: Any\n WRITE: Any\n ERROR: Any\n @staticmethod\n def instance(): ...\n @staticmethod\n def initialized(): ...\n def install(self): ...\n @staticmethod\n def clear_instance(): ...\n @staticmethod\n def current(instance=...): ...\n def make_current(self): ...\n @staticmethod\n def clear_current(): ...\n @classmethod\n def configurable_base(cls): ...\n @classmethod\n def configurable_default(cls): ...\n def initialize(self, make_current=...): ...\n def close(self, all_fds=...): ...\n def add_handler(self, fd, handler, events): ...\n def update_handler(self, fd, events): ...\n def remove_handler(self, fd): ...\n def set_blocking_signal_threshold(self, seconds, action): ...\n def set_blocking_log_threshold(self, seconds): ...\n def log_stack(self, signal, frame): ...\n def start(self): ...\n def stop(self): ...\n def run_sync(self, func, timeout=...): ...\n def time(self): ...\n def add_timeout(self, deadline, callback, *args, **kwargs): ...\n def call_later(self, delay, callback, *args, **kwargs): ...\n def call_at(self, when, callback, *args, **kwargs): ...\n def remove_timeout(self, timeout): ...\n def add_callback(self, callback, *args, **kwargs): ...\n def add_callback_from_signal(self, callback, *args, **kwargs): ...\n def spawn_callback(self, callback, *args, **kwargs): ...\n def add_future(self, future, callback): ...\n def handle_callback_exception(self, callback): ...\n def split_fd(self, fd): ...\n def close_fd(self, fd): ...\n\nclass PollIOLoop(IOLoop):\n time_func: Any\n def initialize(self, impl, time_func=..., **kwargs): ...\n def close(self, all_fds=...): ...\n def add_handler(self, fd, handler, events): ...\n def update_handler(self, fd, events): ...\n def remove_handler(self, fd): ...\n def set_blocking_signal_threshold(self, seconds, action): ...\n def start(self): ...\n def stop(self): ...\n def time(self): ...\n def call_at(self, deadline, callback, *args, **kwargs): ...\n def remove_timeout(self, timeout): ...\n def add_callback(self, callback, *args, **kwargs): ...\n def add_callback_from_signal(self, callback, *args, **kwargs): ...\n\nclass _Timeout:\n deadline: Any\n callback: Any\n tiebreaker: Any\n def __init__(self, deadline, callback, io_loop) -> None: ...\n def __lt__(self, other): ...\n def __le__(self, other): ...\n\nclass PeriodicCallback:\n callback: Any\n callback_time: Any\n io_loop: Any\n def __init__(self, callback, callback_time, io_loop=...) -> None: ...\n def start(self): ...\n def stop(self): ...\n def is_running(self): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\tornado\ioloop.pyi | ioloop.pyi | Other | 2,798 | 0.85 | 0.670588 | 0 | vue-tools | 774 | 2024-09-30T03:08:10.086645 | Apache-2.0 | false | 1c642ef4bae7d1668a2838002c124bc9 |
from typing import Any, Optional\n\nclass _TimeoutGarbageCollector:\n def __init__(self): ...\n\nclass Condition(_TimeoutGarbageCollector):\n io_loop: Any\n def __init__(self): ...\n def wait(self, timeout: Optional[Any] = ...): ...\n def notify(self, n: int = ...): ...\n def notify_all(self): ...\n\nclass Event:\n def __init__(self): ...\n def is_set(self): ...\n def set(self): ...\n def clear(self): ...\n def wait(self, timeout: Optional[Any] = ...): ...\n\nclass _ReleasingContextManager:\n def __init__(self, obj): ...\n def __enter__(self): ...\n def __exit__(self, exc_type, exc_val, exc_tb): ...\n\nclass Semaphore(_TimeoutGarbageCollector):\n def __init__(self, value: int = ...): ...\n def release(self): ...\n def acquire(self, timeout: Optional[Any] = ...): ...\n def __enter__(self): ...\n __exit__: Any\n def __aenter__(self): ...\n def __aexit__(self, typ, value, tb): ...\n\nclass BoundedSemaphore(Semaphore):\n def __init__(self, value: int = ...): ...\n def release(self): ...\n\nclass Lock:\n def __init__(self): ...\n def acquire(self, timeout: Optional[Any] = ...): ...\n def release(self): ...\n def __enter__(self): ...\n __exit__: Any\n def __aenter__(self): ...\n def __aexit__(self, typ, value, tb): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\tornado\locks.pyi | locks.pyi | Other | 1,279 | 0.85 | 0.755556 | 0 | python-kit | 294 | 2025-06-07T03:07:27.827474 | GPL-3.0 | false | 7965b83f4ccec57fa8f1518d70a2584f |
from typing import Any\n\nfrom tornado.util import Configurable\n\nssl: Any\ncertifi: Any\nxrange: Any\nssl_match_hostname: Any\nSSLCertificateError: Any\n\ndef bind_sockets(port, address=..., family=..., backlog=..., flags=...): ...\ndef bind_unix_socket(file, mode=..., backlog=...): ...\ndef add_accept_handler(sock, callback, io_loop=...): ...\ndef is_valid_ip(ip): ...\n\nclass Resolver(Configurable):\n @classmethod\n def configurable_base(cls): ...\n @classmethod\n def configurable_default(cls): ...\n def resolve(self, host, port, family=..., callback=...): ...\n def close(self): ...\n\nclass ExecutorResolver(Resolver):\n io_loop: Any\n executor: Any\n close_executor: Any\n def initialize(self, io_loop=..., executor=..., close_executor=...): ...\n def close(self): ...\n def resolve(self, host, port, family=...): ...\n\nclass BlockingResolver(ExecutorResolver):\n def initialize(self, io_loop=...): ...\n\nclass ThreadedResolver(ExecutorResolver):\n def initialize(self, io_loop=..., num_threads=...): ...\n\nclass OverrideResolver(Resolver):\n resolver: Any\n mapping: Any\n def initialize(self, resolver, mapping): ...\n def close(self): ...\n def resolve(self, host, port, *args, **kwargs): ...\n\ndef ssl_options_to_context(ssl_options): ...\ndef ssl_wrap_socket(socket, ssl_options, server_hostname=..., **kwargs): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\tornado\netutil.pyi | netutil.pyi | Other | 1,350 | 0.85 | 0.5 | 0 | python-kit | 719 | 2023-08-30T01:39:16.149428 | GPL-3.0 | false | 2ad999e18eb5ff74e867efabc249f8bf |
from typing import Any, Optional\n\nlong = int\nCalledProcessError: Any\n\ndef cpu_count() -> int: ...\ndef fork_processes(num_processes, max_restarts: int = ...) -> Optional[int]: ...\ndef task_id() -> int: ...\n\nclass Subprocess:\n STREAM: Any = ...\n io_loop: Any = ...\n stdin: Any = ...\n stdout: Any = ...\n stderr: Any = ...\n proc: Any = ...\n returncode: Any = ...\n def __init__(self, *args, **kwargs) -> None: ...\n def set_exit_callback(self, callback): ...\n def wait_for_exit(self, raise_error: bool = ...): ...\n @classmethod\n def initialize(cls, io_loop: Optional[Any] = ...): ...\n @classmethod\n def uninitialize(cls): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\tornado\process.pyi | process.pyi | Other | 662 | 0.85 | 0.375 | 0 | python-kit | 79 | 2024-09-11T02:43:45.517591 | BSD-3-Clause | false | 98e5e351e9d336a561106b0f5a4f6973 |
from typing import Any\n\nssl: Any\n\nclass TCPServer:\n io_loop: Any\n ssl_options: Any\n max_buffer_size: Any\n read_chunk_size: Any\n def __init__(self, io_loop=..., ssl_options=..., max_buffer_size=..., read_chunk_size=...) -> None: ...\n def listen(self, port, address=...): ...\n def add_sockets(self, sockets): ...\n def add_socket(self, socket): ...\n def bind(self, port, address=..., family=..., backlog=...): ...\n def start(self, num_processes=...): ...\n def stop(self): ...\n def handle_stream(self, stream, address): ...\n | .venv\Lib\site-packages\jedi\third_party\typeshed\third_party\2\tornado\tcpserver.pyi | tcpserver.pyi | Other | 556 | 0.85 | 0.529412 | 0 | python-kit | 700 | 2025-04-28T13:07:49.004859 | GPL-3.0 | false | ebc4b1012ccc06be257c1aaecdc68ca1 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.