hexsha string | size int64 | ext string | lang string | max_stars_repo_path string | max_stars_repo_name string | max_stars_repo_head_hexsha string | max_stars_repo_licenses list | max_stars_count int64 | max_stars_repo_stars_event_min_datetime string | max_stars_repo_stars_event_max_datetime string | max_issues_repo_path string | max_issues_repo_name string | max_issues_repo_head_hexsha string | max_issues_repo_licenses list | max_issues_count int64 | max_issues_repo_issues_event_min_datetime string | max_issues_repo_issues_event_max_datetime string | max_forks_repo_path string | max_forks_repo_name string | max_forks_repo_head_hexsha string | max_forks_repo_licenses list | max_forks_count int64 | max_forks_repo_forks_event_min_datetime string | max_forks_repo_forks_event_max_datetime string | content string | avg_line_length float64 | max_line_length int64 | alphanum_fraction float64 | qsc_code_num_words_quality_signal int64 | qsc_code_num_chars_quality_signal float64 | qsc_code_mean_word_length_quality_signal float64 | qsc_code_frac_words_unique_quality_signal float64 | qsc_code_frac_chars_top_2grams_quality_signal float64 | qsc_code_frac_chars_top_3grams_quality_signal float64 | qsc_code_frac_chars_top_4grams_quality_signal float64 | qsc_code_frac_chars_dupe_5grams_quality_signal float64 | qsc_code_frac_chars_dupe_6grams_quality_signal float64 | qsc_code_frac_chars_dupe_7grams_quality_signal float64 | qsc_code_frac_chars_dupe_8grams_quality_signal float64 | qsc_code_frac_chars_dupe_9grams_quality_signal float64 | qsc_code_frac_chars_dupe_10grams_quality_signal float64 | qsc_code_frac_chars_replacement_symbols_quality_signal float64 | qsc_code_frac_chars_digital_quality_signal float64 | qsc_code_frac_chars_whitespace_quality_signal float64 | qsc_code_size_file_byte_quality_signal float64 | qsc_code_num_lines_quality_signal float64 | qsc_code_num_chars_line_max_quality_signal float64 | qsc_code_num_chars_line_mean_quality_signal float64 | qsc_code_frac_chars_alphabet_quality_signal float64 | qsc_code_frac_chars_comments_quality_signal float64 | qsc_code_cate_xml_start_quality_signal float64 | qsc_code_frac_lines_dupe_lines_quality_signal float64 | qsc_code_cate_autogen_quality_signal float64 | qsc_code_frac_lines_long_string_quality_signal float64 | qsc_code_frac_chars_string_length_quality_signal float64 | qsc_code_frac_chars_long_word_length_quality_signal float64 | qsc_code_frac_lines_string_concat_quality_signal float64 | qsc_code_cate_encoded_data_quality_signal float64 | qsc_code_frac_chars_hex_words_quality_signal float64 | qsc_code_frac_lines_prompt_comments_quality_signal float64 | qsc_code_frac_lines_assert_quality_signal float64 | qsc_codepython_cate_ast_quality_signal float64 | qsc_codepython_frac_lines_func_ratio_quality_signal float64 | qsc_codepython_cate_var_zero_quality_signal bool | qsc_codepython_frac_lines_pass_quality_signal float64 | qsc_codepython_frac_lines_import_quality_signal float64 | qsc_codepython_frac_lines_simplefunc_quality_signal float64 | qsc_codepython_score_lines_no_logic_quality_signal float64 | qsc_codepython_frac_lines_print_quality_signal float64 | qsc_code_num_words int64 | qsc_code_num_chars int64 | qsc_code_mean_word_length int64 | qsc_code_frac_words_unique null | qsc_code_frac_chars_top_2grams int64 | qsc_code_frac_chars_top_3grams int64 | qsc_code_frac_chars_top_4grams int64 | qsc_code_frac_chars_dupe_5grams int64 | qsc_code_frac_chars_dupe_6grams int64 | qsc_code_frac_chars_dupe_7grams int64 | qsc_code_frac_chars_dupe_8grams int64 | qsc_code_frac_chars_dupe_9grams int64 | qsc_code_frac_chars_dupe_10grams int64 | qsc_code_frac_chars_replacement_symbols int64 | qsc_code_frac_chars_digital int64 | qsc_code_frac_chars_whitespace int64 | qsc_code_size_file_byte int64 | qsc_code_num_lines int64 | qsc_code_num_chars_line_max int64 | qsc_code_num_chars_line_mean int64 | qsc_code_frac_chars_alphabet int64 | qsc_code_frac_chars_comments int64 | qsc_code_cate_xml_start int64 | qsc_code_frac_lines_dupe_lines int64 | qsc_code_cate_autogen int64 | qsc_code_frac_lines_long_string int64 | qsc_code_frac_chars_string_length int64 | qsc_code_frac_chars_long_word_length int64 | qsc_code_frac_lines_string_concat null | qsc_code_cate_encoded_data int64 | qsc_code_frac_chars_hex_words int64 | qsc_code_frac_lines_prompt_comments int64 | qsc_code_frac_lines_assert int64 | qsc_codepython_cate_ast int64 | qsc_codepython_frac_lines_func_ratio int64 | qsc_codepython_cate_var_zero int64 | qsc_codepython_frac_lines_pass int64 | qsc_codepython_frac_lines_import int64 | qsc_codepython_frac_lines_simplefunc int64 | qsc_codepython_score_lines_no_logic int64 | qsc_codepython_frac_lines_print int64 | effective string | hits int64 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
2b7dfc3bf105ce8280ab057fa8b274010d100822 | 248 | py | Python | __init__.py | ShuvoMondal/flask_todo_app | 26f6bb73f93b7e6c9ee5611a1712bb0cab8d5a53 | [
"MIT"
] | 2 | 2021-12-17T09:02:43.000Z | 2021-12-18T11:08:53.000Z | __init__.py | Tatsumi251/flask_todo_app | 26f6bb73f93b7e6c9ee5611a1712bb0cab8d5a53 | [
"MIT"
] | null | null | null | __init__.py | Tatsumi251/flask_todo_app | 26f6bb73f93b7e6c9ee5611a1712bb0cab8d5a53 | [
"MIT"
] | 1 | 2021-06-23T17:19:23.000Z | 2021-06-23T17:19:23.000Z | from flask import Flask
from .main.routes import main
from .extensions import mongo
def create_app():
app = Flask(__name__)
app.config['MONGO_URI'] = ''
app.register_blueprint(main)
mongo.init_app(app)
return app
| 19.076923 | 33 | 0.669355 | 33 | 248 | 4.787879 | 0.515152 | 0.075949 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.237903 | 248 | 12 | 34 | 20.666667 | 0.835979 | 0 | 0 | 0 | 0 | 0 | 0.038136 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.111111 | false | 0 | 0.333333 | 0 | 0.555556 | 0.111111 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 2 |
2b879b2bd21dc4ed79358777ea7e39a26cd74ca1 | 805 | py | Python | test/persistence/test_EntitiesFilePersistence.py | pip-templates-services/pip-service-data-python | 74149496a4e02c6e7c14d5f4c9453bf196577a3c | [
"MIT"
] | null | null | null | test/persistence/test_EntitiesFilePersistence.py | pip-templates-services/pip-service-data-python | 74149496a4e02c6e7c14d5f4c9453bf196577a3c | [
"MIT"
] | null | null | null | test/persistence/test_EntitiesFilePersistence.py | pip-templates-services/pip-service-data-python | 74149496a4e02c6e7c14d5f4c9453bf196577a3c | [
"MIT"
] | null | null | null | # -*- coding: utf-8 -*-
from pip_service_data_python.persistence.EntitiesFilePersistence import EntitiesFilePersistence
from test.persistence.EntitiesPersistenceFixture import EntitiesPersistenceFixture
class TestEntitiesFilePersistence:
persistence: EntitiesFilePersistence
fixture: EntitiesPersistenceFixture
def setup_method(self):
self.persistence = EntitiesFilePersistence('data/entities.test.json')
self.fixture = EntitiesPersistenceFixture(self.persistence)
self.persistence.open(None)
self.persistence.clear(None)
def teardown_method(self):
self.persistence.close(None)
def test_crud_operations(self):
self.fixture.test_crud_operations()
def test_get_with_filters(self):
self.fixture.test_get_with_filters()
| 29.814815 | 95 | 0.765217 | 78 | 805 | 7.705128 | 0.410256 | 0.124792 | 0.046589 | 0.083195 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.001475 | 0.157764 | 805 | 26 | 96 | 30.961538 | 0.884956 | 0.026087 | 0 | 0 | 0 | 0 | 0.029412 | 0.029412 | 0 | 0 | 0 | 0 | 0 | 1 | 0.25 | false | 0 | 0.125 | 0 | 0.5625 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
2b8dac4ce214d8b313daea28f2622e403873e5ff | 237 | py | Python | src/assets/features.py | popcornell/SLOCount | 62d52c9141ba8def92408d54ba6a644b9df7f910 | [
"MIT"
] | null | null | null | src/assets/features.py | popcornell/SLOCount | 62d52c9141ba8def92408d54ba6a644b9df7f910 | [
"MIT"
] | null | null | null | src/assets/features.py | popcornell/SLOCount | 62d52c9141ba8def92408d54ba6a644b9df7f910 | [
"MIT"
] | null | null | null | import torch
# compute features in pytorch
def compute_features(audio, hp):
# compute spectrogram from first channel
stft = torch.stft(audio, hp.features.n_fft, hp.features.hop, hp.features.win_len, center=False)
return | 19.75 | 99 | 0.738397 | 34 | 237 | 5.058824 | 0.647059 | 0.174419 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.172996 | 237 | 12 | 100 | 19.75 | 0.877551 | 0.278481 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.25 | false | 0 | 0.25 | 0 | 0.75 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
2b9079e7bbe174d6414dd250531b40bc92a05cf0 | 93 | py | Python | HackerRank/Problem Solving/Algorithms/Strings/CamelCase.py | anubhab-code/Competitive-Programming | de28cb7d44044b9e7d8bdb475da61e37c018ac35 | [
"MIT"
] | null | null | null | HackerRank/Problem Solving/Algorithms/Strings/CamelCase.py | anubhab-code/Competitive-Programming | de28cb7d44044b9e7d8bdb475da61e37c018ac35 | [
"MIT"
] | null | null | null | HackerRank/Problem Solving/Algorithms/Strings/CamelCase.py | anubhab-code/Competitive-Programming | de28cb7d44044b9e7d8bdb475da61e37c018ac35 | [
"MIT"
] | null | null | null | import sys
s = input().strip()
count=1
for i in s:
count+=i.isupper()
print(count) | 10.333333 | 22 | 0.602151 | 16 | 93 | 3.5 | 0.75 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.014085 | 0.236559 | 93 | 9 | 23 | 10.333333 | 0.774648 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.166667 | 0 | 0.166667 | 0.166667 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
2b9282c38e9ebb4823af5443b2d838b47a968971 | 1,172 | py | Python | TimeWrapper_JE/venv/Lib/site-packages/requests_toolbelt/exceptions.py | JE-Chen/je_old_repo | a8b2f1ac2eec25758bd15b71c64b59b27e0bcda5 | [
"MIT"
] | null | null | null | TimeWrapper_JE/venv/Lib/site-packages/requests_toolbelt/exceptions.py | JE-Chen/je_old_repo | a8b2f1ac2eec25758bd15b71c64b59b27e0bcda5 | [
"MIT"
] | null | null | null | TimeWrapper_JE/venv/Lib/site-packages/requests_toolbelt/exceptions.py | JE-Chen/je_old_repo | a8b2f1ac2eec25758bd15b71c64b59b27e0bcda5 | [
"MIT"
] | null | null | null | # -*- coding: utf-8 -*-
"""Collection of exceptions raised by requests-toolbelt."""
class StreamingError(Exception):
"""Used in :mod:`requests_toolbelt.downloadutils.stream`."""
pass
class VersionMismatchError(Exception):
"""Used to indicate a version mismatch in the version of requests required.
The feature in use requires a newer version of Requests to function
appropriately but the version installed is not sufficient.
"""
pass
class RequestsVersionTooOld(Warning):
"""Used to indicate that the Requests version is too old.
If the version of Requests is too old to support a feature, we will issue
this warning to the user.
"""
pass
class IgnoringGAECertificateValidation(Warning):
"""Used to indicate that given GAE validation behavior will be ignored.
If the user has tried to specify certificate validation when using the
insecure AppEngine adapter, it will be ignored (certificate validation will
remain off), so we will issue this warning to the user.
In :class:`requests_toolbelt.adapters.appengine.InsecureAppEngineAdapter`.
"""
pass
| 30.842105 | 80 | 0.709044 | 146 | 1,172 | 5.678082 | 0.493151 | 0.057901 | 0.050663 | 0.048251 | 0.135103 | 0.074789 | 0.074789 | 0.074789 | 0 | 0 | 0 | 0.001099 | 0.223549 | 1,172 | 37 | 81 | 31.675676 | 0.90989 | 0.714164 | 0 | 0.5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0.5 | 0 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 2 |
2b94d939378947027f12c9cf1292d639e0f6b4da | 4,727 | py | Python | atomphys/laser.py | mgrau/atomphys | 8624748eb61a2c6e1f70a5784a9d3fc242ff50b1 | [
"MIT"
] | 3 | 2021-10-07T11:33:43.000Z | 2022-03-16T13:27:17.000Z | atomphys/laser.py | mgrau/atomphys | 8624748eb61a2c6e1f70a5784a9d3fc242ff50b1 | [
"MIT"
] | 2 | 2021-10-07T14:49:36.000Z | 2021-10-21T20:36:36.000Z | atomphys/laser.py | mgrau/atomphys | 8624748eb61a2c6e1f70a5784a9d3fc242ff50b1 | [
"MIT"
] | null | null | null | from math import inf
from math import pi as π
import pint
from . import _ureg
from .util import default_units
class Laser:
_ureg: pint.UnitRegistry
__omega = pint.Quantity
__linewidth = pint.Quantity
__electric_field = pint.Quantity
__A = 0
__theta_k = 0
__theta_p = π / 2
def __init__(self, ureg=None, laser=None, **new_laser):
if ureg is not None:
self._ureg = ureg
else:
self._ureg = _ureg
self.omega = 0
self.__linewidth = 0
self.__electric_field = 0
if laser is not None:
self._ureg = laser._ureg
self.__omega = laser.__omega
self.__linewidth = laser.__linewidth
self.__electric_field = laser.__electric_field
self.__A = laser.__A
self.__theta_k = laser.__theta_k
self.__theta_p = laser.__theta_p
for attr in new_laser:
if attr in dir(self):
self.__setattr__(attr, new_laser[attr])
def __repr__(self):
fmt = "0.4g~P"
return f"Laser(λ={self.λ:{fmt}})"
# ---------
# Frequency
# ---------
@property
def omega(self):
return self.__omega
@omega.setter
@default_units("THz")
def omega(self, ω):
self.__omega = ω
@property
def angular_frequency(self):
return self.omega
@angular_frequency.setter
def angular_frequency(self, ω):
self.omega = ω
@property
def ω(self):
return self.omega
@ω.setter
def ω(self, ω):
self.omega = ω
@property
def ν(self):
return self.omega / (2 * π)
@ν.setter
def ν(self, ν):
self.omega = 2 * π * ν
@property
def nu(self):
return self.ν
@nu.setter
def nu(self, ν):
self.ν = ν
@property
def frequency(self):
return self.ν
@frequency.setter
def frequency(self, ν):
self.ν = ν
# ----------
# Wavelength
# ----------
@property
def wavelength(self):
c = self._ureg.c
try:
return (2 * π * c / self.omega).to("nm")
except ZeroDivisionError:
return inf * self._ureg("nm")
@wavelength.setter
@default_units("nm")
def wavelength(self, λ):
c = self._ureg.c
self.omega = 2 * π * c / λ
@property
def λ(self):
return self.wavelength
@λ.setter
def λ(self, λ):
self.wavelength = λ
# ---------
# Linewidth
# ---------
@property
def linewidth(self):
return self.__linewidth
@linewidth.setter
@default_units("Hz")
def linewidth(self, linewidth):
self.__linewidth = linewidth
# --------------
# Electric Field
# --------------
@property
def electric_field(self):
return self.__electric_field
@electric_field.setter
@default_units("V/m")
def electric_field(self, E):
self.__electric_field = E
@property
def E(self):
return self.electric_field
@E.setter
def E(self, E):
self.electric_field = E
@property
def intensity(self):
c = self._ureg.c
ε_0 = self._ureg.ε_0
return self.electric_field ** 2 * (c * ε_0 / 2)
@intensity.setter
@default_units("W/m^2")
def intensity(self, I):
c = self._ureg.c
ε_0 = self._ureg.ε_0
self.electric_field = (2 * I / (c * ε_0)) ** (1 / 2)
@property
def I(self):
return self.intensity
@I.setter
def I(self, I):
self.intensity = I
# ------------
# Polarization
# ------------
@property
def A(self):
return self.__A
@A.setter
def A(self, A):
self.__A = A
@property
def theta_k(self):
return self.__theta_k
@theta_k.setter
def theta_k(self, theta_k):
self.__theta_k = theta_k
@property
def theta_p(self):
return self.__theta_p
@theta_p.setter
def theta_p(self, theta_p):
self.__theta_p = theta_p
# ---------------------
# high level properties
# ---------------------
def Rabi_frequency(self, transition):
# this is not quite right, as d is reduced dipole matrix element.
# also transition is not necessarily dipole
ħ = self._ureg.ħ
return (transition.d * self.E / ħ).to("MHz")
@property
def Ω(self):
return self.Rabi_frequency
@default_units("MHz")
def set_Rabi_frequency(self, Rabi_frequency, transition):
ħ = self._ureg.ħ
self.E = ħ * Rabi_frequency / transition.d
@property
def set_Ω(self):
return self.set_Rabi_frequency
| 20.375 | 73 | 0.545589 | 587 | 4,727 | 4.132879 | 0.151618 | 0.081616 | 0.092333 | 0.031327 | 0.197444 | 0.095218 | 0.078318 | 0.046167 | 0.018137 | 0.018137 | 0 | 0.007535 | 0.326211 | 4,727 | 231 | 74 | 20.463203 | 0.75416 | 0.07362 | 0 | 0.21519 | 0 | 0 | 0.012391 | 0.005278 | 0 | 0 | 0 | 0 | 0 | 1 | 0.240506 | false | 0 | 0.031646 | 0.101266 | 0.455696 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 2 |
2b966cc3356ea1fa502eafb7ab1fcf909b63f4b6 | 955 | py | Python | Training/list_comprehension.py | Orleanslindsay/Python_Programming | dacc08090e9ebf9eb43aec127ee3e2e3cdcb4f55 | [
"MIT"
] | 1 | 2021-08-16T10:25:01.000Z | 2021-08-16T10:25:01.000Z | Training/list_comprehension.py | Orleanslindsay/Python_Programming | dacc08090e9ebf9eb43aec127ee3e2e3cdcb4f55 | [
"MIT"
] | null | null | null | Training/list_comprehension.py | Orleanslindsay/Python_Programming | dacc08090e9ebf9eb43aec127ee3e2e3cdcb4f55 | [
"MIT"
] | null | null | null | my_list = []
for list in range(450,500,2):
lindsay = my_list.append(list)
print(my_list)
print(my_list[::])
print(my_list[-2:1])
#list comprehension
cubes = [i**3 for i in range(5)]
lindsay = [i**3 for i in range(5) if i**3 % 2 == 0]
print(cubes)
print(lindsay)
sto = ["{b},{b},{c}".format(a =5, b=4, c = 8)]
print(sto)
nums = [33,44,54,43,67,67]
if all([i > 5 for i in nums]):
print("All is greater than five")
if any([i % 2 == 0 for i in nums]):
print("At least a number is even")
for i in enumerate(nums):
print(nums)
def count_char(text, char):
count = 0
for c in text:
if c == char:
count += 1
return count
filename = input("Enter a filename: ")
with open(filename) as f:
text = f.read()
pass
print(count_char(text, "r"))
#forpercentage of characters each text contain
for char in "abcdefghijklmnopqrstuvwxyz":
perc = 100 * count_char(text, char) / len(text)
print("{0} - {1}%".format(char, round(perc, 2)))
pass | 23.875 | 51 | 0.636649 | 173 | 955 | 3.468208 | 0.393064 | 0.05 | 0.05 | 0.075 | 0.158333 | 0.108333 | 0.108333 | 0 | 0 | 0 | 0 | 0.054124 | 0.187435 | 955 | 40 | 52 | 23.875 | 0.719072 | 0 | 0 | 0.058824 | 0 | 0 | 0.129068 | 0.029181 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0.058824 | 0 | null | null | 0.323529 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 2 |
2ba19e075751353ac9ba47bbbd4542cffd9821f3 | 3,120 | py | Python | loops/loops.py | DeVatos-Lokos/PythonBasics | b9daca43cd0ddfc5a835212194bf934c904b45aa | [
"Apache-2.0"
] | null | null | null | loops/loops.py | DeVatos-Lokos/PythonBasics | b9daca43cd0ddfc5a835212194bf934c904b45aa | [
"Apache-2.0"
] | null | null | null | loops/loops.py | DeVatos-Lokos/PythonBasics | b9daca43cd0ddfc5a835212194bf934c904b45aa | [
"Apache-2.0"
] | 1 | 2021-07-07T06:55:20.000Z | 2021-07-07T06:55:20.000Z | class NaturalNumbers:
def __init__(self):
pass
def get_first_n_for(self, n): # Ejemplo
"""
Obtener los primeros n naturales en una lista con for
"""
first_n = [] # Se declara una lista donde almacenaremos los numeros
for i in range(n): # Se itera sobre range que genera un rango de 0 a n
first_n.append(i) # Almacenamos la variable del ciclo en la lista con append
print("FIRST n (n={}) FOR: {}".format(n, first_n))
return first_n # Regresamos la lista
def get_first_n_while(self, n): # Ejemplo
"""
Obtener los primeros n naturales en una lista con while
"""
first_n = [] # Se declara una lista donde almacenaremos los numeros
n_count = 0 # Inicializamos un contador para saber en que iteracion vamos dentro del ciclo
while n_count < n: # Condición de terminación del ciclo
first_n.append(n_count) # ALmacenamos el contador (contablizador del ciclo) en la lista
n_count += 1 # Sumamos uno al contador puesto que termina ek ciclo, si no nunca n_count será mayor o igual que n y tendremos un loop infinito
print(f"FIRST n (n={n}) WHILE: {first_n}")
return first_n
def get_first_n_pair_for(self, n): # Ejercicio
"""
Obtener los primeros n pares en una lista con for
"""
return []
def get_first_n_pair_while(self, n): # Ejercicio
"""
Obtener los primeros n pares en una lista con while
"""
return []
def get_factorial_for(self, n): # Ejercicio
"""
Obtener el factorial de n con for, regresa un int
"""
return 0
def get_factorial_while(self, n): # Ejercicio
"""
Obtener el factorial de n con while, regresa un int
"""
return 0
def get_factorial_recursive(self, n): #Ejemplo
"""
Obtener el factorial de n recursivamente, regresa un int
"""
if n <= 1:
return 1
return n * self.get_factorial_recursive(n-1)
def get_n_pow_2_for(self, n): # Ejemplo
"""
Obtener el cuadrado de los primeros n con for, regresa una lista
"""
n_pow_2 = []
for i in range(n):
n_pow_2.append(
i ** 2
)
print(f"FIRST n (n={n}) POW 2: {n_pow_2}")
return n_pow_2
def get_n_pow_2_while(self, n): # Ejercicio
"""
Obtener el cuadrado de los primeros n con while, regresa una lista
"""
return []
def get_n_sum_recursive(self, n): #Ejemplo
"""
Obtener la suma de los primeros n recursivamente, regresa un int
"""
if n <= 0:
return 0
return n + self.get_n_sum_recursive(n-1)
def get_n_sum_for(self, n): # Ejercicio
"""
Obtener la suma de los primeros n con for, regresa un int
"""
return 0
def get_n_sum_while(self, n): # Ejercicio
"""
Obtener la suma de los primeros n con while, regresa un int
"""
return 0 | 32.842105 | 153 | 0.580769 | 442 | 3,120 | 3.947964 | 0.208145 | 0.051576 | 0.061891 | 0.084241 | 0.64298 | 0.496275 | 0.445845 | 0.383954 | 0.303725 | 0.262464 | 0 | 0.010189 | 0.339423 | 3,120 | 95 | 154 | 32.842105 | 0.836487 | 0.426282 | 0 | 0.297872 | 0 | 0 | 0.057564 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.276596 | false | 0.021277 | 0 | 0 | 0.595745 | 0.06383 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
2bb54433df4a33be1c15828033b92db97d255dc1 | 185 | py | Python | coding/learn_numpy/np_array.py | yatao91/learning_road | e88dc43de98e35922bfc71c222ec71766851e618 | [
"MIT"
] | 3 | 2021-05-25T16:58:52.000Z | 2022-02-05T09:37:17.000Z | coding/learn_numpy/np_array.py | yataosu/learning_road | e88dc43de98e35922bfc71c222ec71766851e618 | [
"MIT"
] | null | null | null | coding/learn_numpy/np_array.py | yataosu/learning_road | e88dc43de98e35922bfc71c222ec71766851e618 | [
"MIT"
] | null | null | null | # -*- coding: UTF-8 -*-
import numpy as np
a = np.array([1, 2, 3])
b = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]])
b[1, 1] = 10
print(a.shape)
print(b.shape)
print(a.dtype)
print(b)
| 14.230769 | 47 | 0.524324 | 40 | 185 | 2.425 | 0.55 | 0.14433 | 0.164948 | 0.185567 | 0.206186 | 0 | 0 | 0 | 0 | 0 | 0 | 0.114094 | 0.194595 | 185 | 12 | 48 | 15.416667 | 0.536913 | 0.113514 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.125 | 0 | 0.125 | 0.5 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 2 |
2bb6b8dc9d6efeb962c91afa86582cc1b0e45838 | 5,549 | py | Python | musket/gs_ballistic.py | vashu1/data_snippets | b0ae5230d60c2054c7b9278093533b7f71f3758b | [
"MIT"
] | 1 | 2021-02-10T20:33:43.000Z | 2021-02-10T20:33:43.000Z | musket/gs_ballistic.py | vashu1/data_snippets | b0ae5230d60c2054c7b9278093533b7f71f3758b | [
"MIT"
] | null | null | null | musket/gs_ballistic.py | vashu1/data_snippets | b0ae5230d60c2054c7b9278093533b7f71f3758b | [
"MIT"
] | null | null | null | from array import array
from math import *
feetToMeter = 0.3048
poundToKg = 0.453592
#DIAMETER=125
DIAMETER = 55#18 # mm 1000 = 1 m
DENSITY = 5.5 #11.3 # kg/l 5.5 = density of iron 11.3 - lead
SPEED = 450 # m/s 320 - speed of sound
ELEVATION_D = 0 # degrees
ELEVATION_Y = 2 # meters
DISTANCE_STEP = 20 # meters
# ALGORITM SOURCE
# http://www.frfrogspad.com/coefdrag.gif
# http://arc.id.au/CannonBallistics.html
# http://arc.id.au/CannonballDrag.html
# DRAG TABLE SOURCE
# http://www.snipercountry.com/ballistics/software/mctraj4.zip
# GS ballistics raw - even indexes are speed in thousands of ft per sec, odd are ballistic coeff.
# TEST
# http://www.frfrogspad.com/extbal2.htm#Shotgun
# A 75 yd "zero" is assumed
# 00 buckshot: 3.48 gr, with a diameter of about 8.4 mm (.33 inch).
# SETTINGS:
# DIAMETER = 8.4 # mm 1000 = 1 m
# DENSITY = 11.3 # kg/l 11.3 - lead
# SPEED = 1290*feetToMeter # m/s 320 - speed of sound
# ELEVATION_D = 0.1 # degrees
# ELEVATION_Y = 10 # meters
# DISTANCE_STEP = 22.5 # meters
# Calculated: Weight(kg) = 0.00350683170222
# Data
# Range(ya) V(ya/s) Calculated
# 0 1290 1290
# 25 1050 1068
# 50 930 909
# 75 840 790
# 100 770 697
# 125 710 621
# 150 610 558
# relative error less that 10%(partially explained by different GS for small projectiles)
gsTable = array('d', [0.00 , 0.4662, 0.05 , 0.4689, 0.10 , 0.4717, 0.15 , 0.4745, 0.20 , 0.4772, 0.25 , 0.4800, 0.30 , 0.4827, 0.35 , 0.4852, 0.40 , 0.4882, 0.45 , 0.4920, 0.50 , 0.4970, 0.55 , 0.5080, 0.60 , 0.5260, 0.65 , 0.5590, 0.70 , 0.5920, 0.75 , 0.6258, 0.80 , 0.6610, 0.85 , 0.6985, 0.90 , 0.7370, 0.95 , 0.7757, 1.0 , 0.8140, 1.05 , 0.8512, 1.10 , 0.8870, 1.15 , 0.9210, 1.20 , 0.9510, 1.25 , 0.9740, 1.30 , 0.9910, 1.35 , 0.9990, 1.40 , 1.0030, 1.45 , 1.0060, 1.50 , 1.0080, 1.55 , 1.0090, 1.60 , 1.0090, 1.65 , 1.0090, 1.70 , 1.0090, 1.75 , 1.0080, 1.80 , 1.0070, 1.85 , 1.0060, 1.90 , 1.0040, 1.95 , 1.0025, 2.00 , 1.0010, 2.05 , 0.9990, 2.10 , 0.9970, 2.15 , 0.9956, 2.20 , 0.9940, 2.25 , 0.9916, 2.30 , 0.9890, 2.35 , 0.9869, 2.40 , 0.9850, 2.45 , 0.9830, 2.50 , 0.9810, 2.55 , 0.9790, 2.60 , 0.9770, 2.65 , 0.9750, 2.70 , 0.9730, 2.75 , 0.9710, 2.80 , 0.9690, 2.85 , 0.9670, 2.90 , 0.9650, 2.95 , 0.9630, 3.00 , 0.9610, 3.05 , 0.9589, 3.10 , 0.9570, 3.15 , 0.9555, 3.20 , 0.9540, 3.25 , 0.9520, 3.30 , 0.9500, 3.35 , 0.9485, 3.40 , 0.9470, 3.45 , 0.9450, 3.50 , 0.9430, 3.55 , 0.9414, 3.60 , 0.9400, 3.65 , 0.9385, 3.70 , 0.9370, 3.75 , 0.9355, 3.80 , 0.9340, 3.85 , 0.9325, 3.90 , 0.9310, 3.95 , 0.9295, 4.00 , 0.9280]);
gsTableLength = gsTable.buffer_info()[1];
# drag coefficien for any shrapnel shape
# FRAGMENTATION AND LETHALITY ANALISYS
# Ballistics 2013: 27th International Symposium on Ballistics, p. 665
# http://books.google.ru/books?id=7cdm9VOpB1oC&pg=PA668&lpg=PA668&dq=shrapnel+drag-function&source=bl&ots=fUdAkYPbx2&sig=X8qSKXfnX4XgzEAY9sYsV4d7eOg&hl=en&sa=X&ei=MwdtUp-ADqvU4wS2q4HYDw&ved=0CCUQ6AEwAA#v=onepage&q=shrapnel%20drag-function&f=false
# on subsonic speed it slightly worse than sphere
# on supersonic less than 10% better(sharp eges I'd guess)
def GSapprox(feetPerSecond):
tableSpeed = feetPerSecond*feetToMeter / 320.0 # ratio to sound speed
if(tableSpeed<0):
raise Exception('GSapprox: negative speed');
if(tableSpeed>=gsTable[gsTableLength-2]):
raise Exception('GSapprox: too big speed');
for i in range(0, gsTableLength-1, 2):
if( (gsTable[i] <= tableSpeed) and (tableSpeed < gsTable[i+2]) ):
return gsTable[i+1] + (tableSpeed-gsTable[i])/(gsTable[i+2]-gsTable[i])*(gsTable[i+3]-gsTable[i+1]);
def plotShrapnel(d, m, u, theta, y0):
g = 0#32.2; # acceleration due to gravity (9.8 m/s)
rho = 0.074; # density of air (1.225 kg/m^3)
phi = 3.158E-5; # atm density scale factor (9.626E-6 /m)
#Cd, decel, H; # drag coeff, deceleration, altitude factor
x = 0.0; # range
y = y0; # height
V = u; # magnitude of velocity vector
vx = V*cos(pi*theta/180.0); # x vel component
vy = V*sin(pi*theta/180.0);
#ax, ay; # acceleration components
dt = 0.0001; # time step size
distanceMark = 0;
while (y>0): # stop track when bullet hits ground
Cd = GSapprox(V);
H = exp(-phi*y);
decel = Cd*rho*H*pi*d*d/(m*8.0);
ax = -decel*V*vx;
ay = -g -decel*V*vy;
vx = vx + ax*dt;
vy = vy + ay*dt;
V = sqrt(vx*vx+vy*vy);
x = x + vx*dt + ax*dt*dt/2.0;
y = y + vy*dt + ay*dt*dt/2.0;
if((x*feetToMeter)>(distanceMark)):
distanceMark += DISTANCE_STEP;
print("Distance: " + str(round(x*feetToMeter)) + "(" + str(round(x/3.0)) + " ya) Speed: " + str(round(V*feetToMeter)) + "(" + str(round(V)) + \
" ft/s) Energy: " + str(round((V*feetToMeter)*(V*feetToMeter)*(m*poundToKg)/2.0)) + \
" Height=" + str(round(y*feetToMeter)))
print(" Range = "+str(round(x*feetToMeter))+" m")
def printShrapnel(speed, diam, density):
volume = (4.0/3.0)*pi*diam*diam*diam/8.0; # m^3
weight = density*volume*1000.0;
print("Volume(lt) = " + str(volume*1000.0))
print("Speed(m/s) = " + str(speed))
print("Weight(kg) = " + str(weight))
plotShrapnel(diam/feetToMeter, weight/poundToKg, speed / feetToMeter, ELEVATION_D, ELEVATION_Y / feetToMeter);
printShrapnel(SPEED, DIAMETER/1000.0, DENSITY)
| 51.37963 | 1,401 | 0.599207 | 963 | 5,549 | 3.442368 | 0.36864 | 0.019306 | 0.00724 | 0.004827 | 0.025943 | 0.016893 | 0.016893 | 0.016893 | 0.016893 | 0 | 0 | 0.21848 | 0.229591 | 5,549 | 107 | 1,402 | 51.859813 | 0.556959 | 0.346549 | 0 | 0 | 0 | 0 | 0.042596 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.052632 | false | 0 | 0.035088 | 0 | 0.105263 | 0.122807 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
2bc8ad0211378fff6dd5d1b4b61d11fb61dac432 | 34,391 | py | Python | lab9/tests.py | artuchavez/ArtificialIntelligence | 474af06898bd2b0bb78e916358d442b0f1f24168 | [
"MIT"
] | null | null | null | lab9/tests.py | artuchavez/ArtificialIntelligence | 474af06898bd2b0bb78e916358d442b0f1f24168 | [
"MIT"
] | 5 | 2018-08-01T14:06:01.000Z | 2021-06-25T15:16:57.000Z | lab9/tests.py | y1ngyang/ailab | f96b88e69448b7cd49cd6f6a31094893933de3ce | [
"Unlicense"
] | null | null | null | # MIT 6.034 Lab 9: Boosting (Adaboost)
from tester import make_test, get_tests
from utils import *
lab_number = 9 #for tester.py
F = Fraction #lazy alias
def initialize_2_getargs() : #TEST 1
return [["PointA"]]
initialize_2_expected = {"PointA":1}
def initialize_2_testanswer(val, original_val = None) :
return val == initialize_2_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = initialize_2_getargs,
testanswer = initialize_2_testanswer,
expected_val = str(initialize_2_expected),
name = 'initialize_weights')
def initialize_3_getargs() : #TEST 2
return [["-6","-5","-4","-3","-2","-1","0","1","2","3","4","5"]]
initialize_3_expected = {"-6":F(1,12),"-5":F(1,12),"-4":F(1,12),
"-3":F(1,12),"-2":F(1,12),"-1":F(1,12),
"0":F(1,12),"1":F(1,12),"2":F(1,12),
"3":F(1,12),"4":F(1,12),"5":F(1,12)}
def initialize_3_testanswer(val, original_val = None) :
return val == initialize_3_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = initialize_3_getargs,
testanswer = initialize_3_testanswer,
expected_val = str(initialize_3_expected),
name = 'initialize_weights')
# TEST 0 FOR CALCULATE_ERROR_RATE - ALL POINTS CORRECTLY CLASSIFIED
# only one classifier
def calculate_error_rates_0_getargs() : #TEST 3
return [{"0" : F(1,4), "1": F(1,4), "2": F(1,4), "3": F(1,4)}, {"classifier_0":[]}]
calculate_error_rates_0_expected = {"classifier_0" : 0}
def calculate_error_rates_0_testanswer(val, original_val = None) :
return val == calculate_error_rates_0_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = calculate_error_rates_0_getargs,
testanswer = calculate_error_rates_0_testanswer,
expected_val = str(calculate_error_rates_0_expected),
name = 'calculate_error_rates')
# TEST 2 FOR CALCULATE_ERROR_RATE - SOME POINTS MISCLASSIFIED
def calculate_error_rates_2_getargs() : #TEST 4
return [{"0" : F(1,8), "1": F(1,8), "2": F(1,8), "3": F(1,8), "4": F(1,2)},
{"classifier_0":["0", "1", "4"], "classifier_1":["0", "1", "2", "3"]}]
calculate_error_rates_2_expected = {"classifier_0" : F(3,4), "classifier_1": F(1,2)}
def calculate_error_rates_2_testanswer(val, original_val = None) :
return val == calculate_error_rates_2_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = calculate_error_rates_2_getargs,
testanswer = calculate_error_rates_2_testanswer,
expected_val = str(calculate_error_rates_2_expected),
name = 'calculate_error_rates')
def pick_best_classifier_0_getargs() : #TEST 5
#have a perfect test!
classifier_to_error_rate = {}
classifier_to_error_rate["classifier_0"] = 0
classifier_to_error_rate["classifier_1/10"] = F(1,10)
classifier_to_error_rate["classifier_1/2"] = F(1,2)
classifier_to_error_rate["classifier_9/10"] = F(9,10)
return [classifier_to_error_rate]
pick_best_classifier_0_expected = "classifier_0"
def pick_best_classifier_0_testanswer(val, original_val = None) :
return val == pick_best_classifier_0_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = pick_best_classifier_0_getargs,
testanswer = pick_best_classifier_0_testanswer,
expected_val = str(pick_best_classifier_0_expected),
name = 'pick_best_classifier')
def pick_best_classifier_1_getargs() : #TEST 6
#have a pretty good test
classifier_to_error_rate = {}
classifier_to_error_rate["classifier_1/10"] = F(1,10)
classifier_to_error_rate["classifier_1/2"] = F(1,2)
classifier_to_error_rate["classifier_9/10"] = F(9,10)
return [classifier_to_error_rate]
pick_best_classifier_1_expected = "classifier_1/10"
def pick_best_classifier_1_testanswer(val, original_val = None) :
return val == pick_best_classifier_1_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = pick_best_classifier_1_getargs,
testanswer = pick_best_classifier_1_testanswer,
expected_val = str(pick_best_classifier_1_expected),
name = 'pick_best_classifier')
def pick_best_classifier_2_getargs() : #TEST 7
#no good tests; raise error
classifier_to_error_rate = {}
classifier_to_error_rate["classifier_1/2"] = F(1,2)
classifier_to_error_rate["classifier_6/10"] = F(6,10)
classifier_to_error_rate["classifier_9/10"] = F(9,10)
return [classifier_to_error_rate]
pick_best_classifier_2_expected = NoGoodClassifiersError
def pick_best_classifier_2_testanswer(val, original_val = None) :
return val == pick_best_classifier_2_expected
make_test(type = 'FUNCTION_EXPECTING_EXCEPTION',
getargs = pick_best_classifier_2_getargs,
testanswer = pick_best_classifier_2_testanswer,
expected_val = str(pick_best_classifier_2_expected),
name = 'pick_best_classifier')
def pick_best_classifier_2a_getargs() : #TEST 8
#no good tests; raise error
return [dict(cl1=F(1,2), cl2=F(1,2)), False]
pick_best_classifier_2a_expected = NoGoodClassifiersError
def pick_best_classifier_2a_testanswer(val, original_val = None) :
return val == pick_best_classifier_2a_expected
make_test(type = 'FUNCTION_EXPECTING_EXCEPTION',
getargs = pick_best_classifier_2a_getargs,
testanswer = pick_best_classifier_2a_testanswer,
expected_val = str(pick_best_classifier_2a_expected),
name = 'pick_best_classifier')
def pick_best_classifier_2b_getargs() : #TEST 9
#lowest error rate is 1/2, but best test is 9/10
classifier_to_error_rate = {}
classifier_to_error_rate["classifier_1/2"] = F(1,2)
classifier_to_error_rate["classifier_6/10"] = F(6,10)
classifier_to_error_rate["classifier_9/10"] = F(9,10)
return [classifier_to_error_rate, False]
pick_best_classifier_2b_expected = "classifier_9/10"
def pick_best_classifier_2b_testanswer(val, original_val = None) :
return val == pick_best_classifier_2b_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = pick_best_classifier_2b_getargs,
testanswer = pick_best_classifier_2b_testanswer,
expected_val = str(pick_best_classifier_2b_expected),
name = 'pick_best_classifier')
def pick_best_classifier_4_getargs() : #TEST 10
#have perfectly wrong test
classifier_to_error_rate = {}
classifier_to_error_rate["classifier_1/10"] = F(1,10)
classifier_to_error_rate["classifier_6/10"] = F(6,10)
classifier_to_error_rate["classifier_9/10"] = F(9,10)
classifier_to_error_rate["classifier_1"] = 1
return [classifier_to_error_rate, False]
pick_best_classifier_4_expected = "classifier_1"
def pick_best_classifier_4_testanswer(val, original_val = None) :
return val == pick_best_classifier_4_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = pick_best_classifier_4_getargs,
testanswer = pick_best_classifier_4_testanswer,
expected_val = str(pick_best_classifier_4_expected),
name = 'pick_best_classifier')
#check tie-breaking
def pick_best_classifier_5_getargs() : #TEST 11
return [dict(B=F(3,10), A=F(4,10), C=F(3,10))]
pick_best_classifier_5_expected = "B"
def pick_best_classifier_5_testanswer(val, original_val = None) :
return val == pick_best_classifier_5_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = pick_best_classifier_5_getargs,
testanswer = pick_best_classifier_5_testanswer,
expected_val = str(pick_best_classifier_5_expected) \
+' (Hint: This test checks tie-breaking.)',
name = 'pick_best_classifier')
#check not comparing floats
def pick_best_classifier_6_getargs() : #TEST 12
return [dict(cl_1=F(2,3), cl_2=F(1,3)), False]
pick_best_classifier_6_expected = "cl_1"
def pick_best_classifier_6_testanswer(val, original_val = None) :
return val == pick_best_classifier_6_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = pick_best_classifier_6_getargs,
testanswer = pick_best_classifier_6_testanswer,
expected_val = str(pick_best_classifier_6_expected) \
+" (Hint: Make sure you're using Fractions, and not comparing floats!)",
name = 'pick_best_classifier')
def calculate_voting_power_0_getargs() : #TEST 13
return [.001]
calculate_voting_power_0_expected = 3.453377389324277
def calculate_voting_power_0_testanswer(val, original_val = None) :
return approx_equal(val, calculate_voting_power_0_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = calculate_voting_power_0_getargs,
testanswer = calculate_voting_power_0_testanswer,
expected_val = str(calculate_voting_power_0_expected),
name = 'calculate_voting_power')
def calculate_voting_power_3_getargs() : #TEST 14
return [.3]
calculate_voting_power_3_expected = 0.42364893019360184
def calculate_voting_power_3_testanswer(val, original_val = None) :
return approx_equal(val, calculate_voting_power_3_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = calculate_voting_power_3_getargs,
testanswer = calculate_voting_power_3_testanswer,
expected_val = str(calculate_voting_power_3_expected),
name = 'calculate_voting_power')
def calculate_voting_power_4_getargs() : #TEST 15
return [.7]
calculate_voting_power_4_expected = -0.4236489301936017
def calculate_voting_power_4_testanswer(val, original_val = None) :
return approx_equal(val, calculate_voting_power_4_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = calculate_voting_power_4_getargs,
testanswer = calculate_voting_power_4_testanswer,
expected_val = str(calculate_voting_power_4_expected),
name = 'calculate_voting_power')
#perfect classifier -> INF
def calculate_voting_power_5_getargs() : #TEST 16
return [0]
calculate_voting_power_5_expected = INF
def calculate_voting_power_5_testanswer(val, original_val = None) :
return val == calculate_voting_power_5_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = calculate_voting_power_5_getargs,
testanswer = calculate_voting_power_5_testanswer,
expected_val = str(calculate_voting_power_5_expected),
name = 'calculate_voting_power')
#perfectly wrong classifier -> -INF
def calculate_voting_power_6_getargs() : #TEST 17
return [1]
calculate_voting_power_6_expected = -INF
def calculate_voting_power_6_testanswer(val, original_val = None) :
return val == calculate_voting_power_6_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = calculate_voting_power_6_getargs,
testanswer = calculate_voting_power_6_testanswer,
expected_val = str(calculate_voting_power_6_expected),
name = 'calculate_voting_power')
def get_overall_misclassifications_0_getargs() : #TEST 18
return [[("h1", 1)], ['ptA','ptB'], {'h1':['ptA','ptB'],'h2':['ptA']}]
get_overall_misclassifications_0_expected = set(['ptA', 'ptB'])
def get_overall_misclassifications_0_testanswer(val, original_val = None) :
return val == get_overall_misclassifications_0_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = get_overall_misclassifications_0_getargs,
testanswer = get_overall_misclassifications_0_testanswer,
expected_val = str(get_overall_misclassifications_0_expected),
name = 'get_overall_misclassifications')
#All classifiers included in H
#h with voting power of 0
#H misclassifies A
def get_overall_misclassifications_1_getargs() : #TEST 19
return [[("h1", 1),("h2", 0)], ['A','B'], {'h1': ['A'], 'h2': ['B']}]
get_overall_misclassifications_1_expected = set('A')
def get_overall_misclassifications_1_testanswer(val, original_val = None) :
return val == get_overall_misclassifications_1_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = get_overall_misclassifications_1_getargs,
testanswer = get_overall_misclassifications_1_testanswer,
expected_val = str(get_overall_misclassifications_1_expected),
name = 'get_overall_misclassifications')
# Not all points misclassified by any classifier
# H misclassifies A & B
def get_overall_misclassifications_2_getargs() : #TEST 20
return [[("h1", .5),("h2", .3),("h3", .76)], ['A','B','C','D'],
{'h1': ['A'], 'h2': ['A','B'], 'h3': ['B','C']}]
get_overall_misclassifications_2_expected = set('AB')
def get_overall_misclassifications_2_testanswer(val, original_val = None) :
return val == get_overall_misclassifications_2_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = get_overall_misclassifications_2_getargs,
testanswer = get_overall_misclassifications_2_testanswer,
expected_val = str(get_overall_misclassifications_2_expected),
name = 'get_overall_misclassifications')
#No points misclassified by h3
#H misclassifies C
def get_overall_misclassifications_3_getargs() : #TEST 21
return [[("h1", .5),("h2", -.3),("h3", .76)], ['A','B','C'],
{'h1': ['A','C'], 'h2': ['A','B'], 'h3': []}]
get_overall_misclassifications_3_expected = set('C')
def get_overall_misclassifications_3_testanswer(val, original_val = None) :
return val == get_overall_misclassifications_3_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = get_overall_misclassifications_3_getargs,
testanswer = get_overall_misclassifications_3_testanswer,
expected_val = str(get_overall_misclassifications_3_expected),
name = 'get_overall_misclassifications')
#All negative voting powers
#H misclassifies A,B,D
def get_overall_misclassifications_4_getargs() : #TEST 22
return [[("h1", -.5),("h2", -.3),("h3", -.45)], ['A','B','C','D'],
{'h1': ['A','C'], 'h2': ['B','C'], 'h3': ['D']}]
get_overall_misclassifications_4_expected = set('ABD')
def get_overall_misclassifications_4_testanswer(val, original_val = None) :
return val == get_overall_misclassifications_4_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = get_overall_misclassifications_4_getargs,
testanswer = get_overall_misclassifications_4_testanswer,
expected_val = str(get_overall_misclassifications_4_expected),
name = 'get_overall_misclassifications')
#misclassified training point is not listed in misclassifications
#same classifier used multiple times
def get_overall_misclassifications_5_getargs() : #TEST 23
return [[("h1", -0.549),("h2", 0.347),("h1", -0.255)], list('ABCD'),
dict(h1=list('ABC'), h2=list('AC'), h3=list('BC'))]
get_overall_misclassifications_5_expected = set('D')
def get_overall_misclassifications_5_testanswer(val, original_val = None) :
return val == get_overall_misclassifications_5_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = get_overall_misclassifications_5_getargs,
testanswer = get_overall_misclassifications_5_testanswer,
expected_val = str(get_overall_misclassifications_5_expected) \
+' (Hint: What happens if a training point is misclassified by ' \
+'H, but not misclassified by any weak classifier?)',
name = 'get_overall_misclassifications')
#one point misclassified, vote is a tie
# (No, this particular situation would not happen in Adaboost.)
def get_overall_misclassifications_6_getargs() : #TEST 24
return [[("h1", 0.5), ("h2", 0.5)], ['A','B'],
{'h1': ['A'], 'h2': []}]
get_overall_misclassifications_6_expected = set('A')
def get_overall_misclassifications_6_testanswer(val, original_val = None) :
return val == get_overall_misclassifications_6_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = get_overall_misclassifications_6_getargs,
testanswer = get_overall_misclassifications_6_testanswer,
expected_val = str(get_overall_misclassifications_6_expected) \
+' (Hint: This test checks what happens when the vote is a tie.)',
name = 'get_overall_misclassifications')
#violates triangle sum property
def get_overall_misclassifications_7_getargs() : #TEST 25
return [[("h1", 0.5), ("h2", 0.2), ("h3", 0.2)], list('ABCD'),
{'h1': ['A'], 'h2': ['B'], 'h3': ['C']}]
get_overall_misclassifications_7_expected = set('A')
def get_overall_misclassifications_7_testanswer(val, original_val = None) :
return val == get_overall_misclassifications_7_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = get_overall_misclassifications_7_getargs,
testanswer = get_overall_misclassifications_7_testanswer,
expected_val = str(get_overall_misclassifications_7_expected) \
+" (Hint: Make sure you're summing voting powers, not just "
+'counting classifiers.)',
name = 'get_overall_misclassifications')
# recitation problem from 2012 Q4; all points correctly classified
def get_overall_misclassifications_8_getargs() : #TEST 26
H = [('<6', 0.693), ('<2', 0.549), ('>4', 0.805)]
classifier_to_misclassified = {'<6': ['C'], '<4': ['C', 'B', 'E'],
'<2': ['B', 'E'], '>2': ['A', 'C', 'D'],
'>4': ['A', 'D'], '>6': ['A', 'B', 'D', 'E']}
return [H, list('ABCDE'), classifier_to_misclassified]
get_overall_misclassifications_8_expected = set()
def get_overall_misclassifications_8_testanswer(val, original_val = None) :
return val == get_overall_misclassifications_8_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = get_overall_misclassifications_8_getargs,
testanswer = get_overall_misclassifications_8_testanswer,
expected_val = str(get_overall_misclassifications_8_expected),
name = 'get_overall_misclassifications')
#same classifier used multiple times
def get_overall_misclassifications_9_getargs() : #TEST 27
H = [('good_h', 0.1), ('bad_h1', 0.14), ('good_h', 0.1), ('bad_h2', 0.14),
('good_h', 0.1), ('bad_h3', 0.04)]
classifier_to_misclassified = {'good_h': ['A'], 'bad_h1': ['B', 'C'],
'bad_h2': ['C', 'D'], 'bad_h3': ['B', 'D']}
return [H, list('ABCD'), classifier_to_misclassified]
get_overall_misclassifications_9_expected = set()
def get_overall_misclassifications_9_testanswer(val, original_val = None) :
return val == get_overall_misclassifications_9_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = get_overall_misclassifications_9_getargs,
testanswer = get_overall_misclassifications_9_testanswer,
expected_val = str(get_overall_misclassifications_9_expected),
name = 'get_overall_misclassifications')
def is_good_enough_0_getargs() : #TEST 28
return [[("h1", 1)], ['A','B'], {'h1':['A','B'],'h2':['A']}, 1]
is_good_enough_0_expected = False
def is_good_enough_0_testanswer(val, original_val = None) :
return val == is_good_enough_0_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = is_good_enough_0_getargs,
testanswer = is_good_enough_0_testanswer,
expected_val = str(is_good_enough_0_expected),
name = 'is_good_enough')
#All classifiers included in H
#h with voting power of 0
#H misclassifies A = mistake_tolerance
def is_good_enough_1_getargs() : #TEST 29
return [[("h1", 1),("h2", 0)], ['A','B'], {'h1': ['A'], 'h2': ['B']}, 1]
is_good_enough_1_expected = True
def is_good_enough_1_testanswer(val, original_val = None) :
return val == is_good_enough_1_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = is_good_enough_1_getargs,
testanswer = is_good_enough_1_testanswer,
expected_val = str(is_good_enough_1_expected) + \
' (Hint: What should happen when H misclassifies exactly' \
+ ' mistake_tolerance points?)',
name = 'is_good_enough')
# Not all points misclassified by any classifier
# H misclassifies A & B > mistake tolerance
def is_good_enough_2_getargs() : #TEST 30
return [[("h1", .5),("h2", .3),("h3", .76)], ['A','B','C','D'],
{'h1': ['A'], 'h2': ['A','B'], 'h3': ['B','C']}, 1]
is_good_enough_2_expected = False
def is_good_enough_2_testanswer(val, original_val = None) :
return val == is_good_enough_2_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = is_good_enough_2_getargs,
testanswer = is_good_enough_2_testanswer,
expected_val = str(is_good_enough_2_expected),
name = 'is_good_enough')
#No points misclassified by h3
#H misclassifies C = mistake_tolerance
def is_good_enough_3_getargs() : #TEST 31
return [[("h1", .5),("h2", -.3),("h3", .76)], ['A','B','C'],
{'h1': ['A','C'], 'h2': ['A','B'], 'h3': []}, 1]
is_good_enough_3_expected = True
def is_good_enough_3_testanswer(val, original_val = None) :
return val == is_good_enough_3_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = is_good_enough_3_getargs,
testanswer = is_good_enough_3_testanswer,
expected_val = str(is_good_enough_3_expected) + \
' (Hint: What should happen when H misclassifies exactly' \
+ ' mistake_tolerance points?)',
name = 'is_good_enough')
#All negative voting powers
#H misclassifies A,B,D > mistake_tolerance
def is_good_enough_4_getargs() : #TEST 32
return [[("h1", -.5),("h2", -.3),("h3", -.45)], ['A','B','C','D'],
{'h1': ['A','C'], 'h2': ['B','C'], 'h3': ['D']}, 2]
is_good_enough_4_expected = False
def is_good_enough_4_testanswer(val, original_val = None) :
return val == is_good_enough_4_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = is_good_enough_4_getargs,
testanswer = is_good_enough_4_testanswer,
expected_val = str(is_good_enough_4_expected),
name = 'is_good_enough')
#misclassified training point is not listed in misclassifications
def is_good_enough_5_getargs() : #TEST 33
return [[("h1", -0.549),("h2", 0.347)], list('ABCD'),
dict(h1=list('ABC'), h2=list('AC'), h3=list('BC')), 0]
is_good_enough_5_expected = False
def is_good_enough_5_testanswer(val, original_val = None) :
return val == is_good_enough_5_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = is_good_enough_5_getargs,
testanswer = is_good_enough_5_testanswer,
expected_val = str(is_good_enough_5_expected) \
+' (Hint: What happens if a training point is misclassified by ' \
+'H, but not misclassified by any weak classifier?)',
name = 'is_good_enough')
#one point misclassified, vote is a tie
# (No, this particular situation would not happen in Adaboost.)
def is_good_enough_6_getargs() : #TEST 34
return [[("h1", 0.5), ("h2", 0.5)], ['A','B'],
{'h1': ['A'], 'h2': []}, 0]
is_good_enough_6_expected = False
def is_good_enough_6_testanswer(val, original_val = None) :
return val == is_good_enough_6_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = is_good_enough_6_getargs,
testanswer = is_good_enough_6_testanswer,
expected_val = str(is_good_enough_6_expected) \
+' (Hint: This test checks what happens when the vote is a tie.)',
name = 'is_good_enough')
#violates triangle sum property
def is_good_enough_7_getargs() : #TEST 35
return [[("h1", 0.5), ("h2", 0.2), ("h3", 0.2)], list('ABCD'),
{'h1': ['A'], 'h2': ['B'], 'h3': ['C']}, 0]
is_good_enough_7_expected = False
def is_good_enough_7_testanswer(val, original_val = None) :
return val == is_good_enough_7_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = is_good_enough_7_getargs,
testanswer = is_good_enough_7_testanswer,
expected_val = str(is_good_enough_7_expected) \
+" (Hint: Make sure you're summing voting powers, not just "
+'counting classifiers.)',
name = 'is_good_enough')
# recitation problem from 2012 Q4
def is_good_enough_8_getargs() : #TEST 36
H = [('<6', 0.693), ('<2', 0.549), ('>4', 0.805)]
classifier_to_misclassified = {'<6': ['C'], '<4': ['C', 'B', 'E'],
'<2': ['B', 'E'], '>2': ['A', 'C', 'D'],
'>4': ['A', 'D'], '>6': ['A', 'B', 'D', 'E']}
return [H, list('ABCDE'), classifier_to_misclassified, 0]
is_good_enough_8_expected = True
def is_good_enough_8_testanswer(val, original_val = None) :
return val == is_good_enough_8_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = is_good_enough_8_getargs,
testanswer = is_good_enough_8_testanswer,
expected_val = str(is_good_enough_8_expected),
name = 'is_good_enough')
#same classifier used multiple times
def is_good_enough_9_getargs() : #TEST 37
H = [('good_h', 0.1), ('bad_h1', 0.14), ('good_h', 0.1), ('bad_h2', 0.14),
('good_h', 0.1), ('bad_h3', 0.04)]
classifier_to_misclassified = {'good_h': ['A'], 'bad_h1': ['B', 'C'],
'bad_h2': ['C', 'D'], 'bad_h3': ['B', 'D']}
return [H, list('ABCD'), classifier_to_misclassified, 0]
is_good_enough_9_expected = True
def is_good_enough_9_testanswer(val, original_val = None) :
return val == is_good_enough_9_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = is_good_enough_9_getargs,
testanswer = is_good_enough_9_testanswer,
expected_val = str(is_good_enough_9_expected),
name = 'is_good_enough')
def update_weights_0_getargs() : #TEST 38
return [{'A':F(1,6), 'B':F(1,6), 'C':F(1,6), 'D':F(1,6), 'E':F(1,6), 'F': F(1,6)}, ['A', 'B'], F(2,6)]
update_weights_0_expected = {'A':F(1,4), 'B':F(1,4), 'C':F(1,8), 'D':F(1,8), 'E':F(1,8), 'F':F(1,8)}
def update_weights_0_testanswer(val, original_val = None) :
return val == update_weights_0_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = update_weights_0_getargs,
testanswer = update_weights_0_testanswer,
expected_val = str(update_weights_0_expected),
name = 'update_weights')
def update_weights_2_getargs() : #TEST 39
return [{'A':F(1,2), 'B':F(1,2)}, [], 0]
update_weights_2_expected = {'A':F(1,4), 'B':F(1,4)}
def update_weights_2_testanswer(val, original_val = None) :
return val == update_weights_2_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = update_weights_2_getargs,
testanswer = update_weights_2_testanswer,
expected_val = str(update_weights_2_expected),
name = 'update_weights')
def update_weights_3_getargs() : #TEST 40
return [{'A':F(1,2), 'B':F(1,2)}, ['A', 'B'], 1]
update_weights_3_expected = {'A':F(1,4), 'B':F(1,4)}
def update_weights_3_testanswer(val, original_val = None) :
return val == update_weights_3_expected
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = update_weights_3_getargs,
testanswer = update_weights_3_testanswer,
expected_val = str(update_weights_3_expected),
name = 'update_weights')
#recitation problem, from 2012 Quiz 4
boost_2012_tr_pts = ["A","B","C","D","E"]
boost_2012_cl_to_miscl = {"<2":["B","E"], "<4":["C","B","E"], "<6":["C"],
">2":["A","C","D"], ">4":["A","D"],
">6":["A","B","D","E"]}
#1 round
def adaboost_0_getargs() : #TEST 41
return [boost_2012_tr_pts, boost_2012_cl_to_miscl, True, 0, 1]
adaboost_0_expected = [("<6",.5*ln(4))]
def adaboost_0_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_0_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_0_getargs,
testanswer = adaboost_0_testanswer,
expected_val = str(adaboost_0_expected),
name = 'adaboost')
#2 rounds
def adaboost_1_getargs() : #TEST 42
return [boost_2012_tr_pts, boost_2012_cl_to_miscl, True, 0, 2]
adaboost_1_expected = [("<6",.5*ln(4)), ("<2", .5*ln(3))]
def adaboost_1_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_1_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_1_getargs,
testanswer = adaboost_1_testanswer,
expected_val = str(adaboost_1_expected),
name = 'adaboost')
#3 rounds
def adaboost_2_getargs() : #TEST 43
return [boost_2012_tr_pts, boost_2012_cl_to_miscl, True, 0, 3]
adaboost_2_expected = [("<6",.5*ln(4)), ("<2", .5*ln(3)), (">4",.5*ln(5))]
def adaboost_2_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_2_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_2_getargs,
testanswer = adaboost_2_testanswer,
expected_val = str(adaboost_2_expected),
name = 'adaboost')
#4 rounds (stops after 3)
def adaboost_3_getargs() : #TEST 44
return [boost_2012_tr_pts, boost_2012_cl_to_miscl, True, 0, 4]
adaboost_3_expected = [("<6",.5*ln(4)), ("<2", .5*ln(3)), (">4",.5*ln(5))]
def adaboost_3_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_3_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_3_getargs,
testanswer = adaboost_3_testanswer,
expected_val = str(adaboost_3_expected),
name = 'adaboost')
#INF rounds (stops after 3)
def adaboost_4_getargs() : #TEST 45
return [boost_2012_tr_pts, boost_2012_cl_to_miscl, True, 0, INF]
adaboost_4_expected = [("<6",.5*ln(4)), ("<2", .5*ln(3)), (">4",.5*ln(5))]
def adaboost_4_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_4_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_4_getargs,
testanswer = adaboost_4_testanswer,
expected_val = str(adaboost_4_expected),
name = 'adaboost')
#4 rounds (stops after 3); use error furthest from 1/2
def adaboost_5_getargs() : #TEST 46
return [boost_2012_tr_pts, boost_2012_cl_to_miscl, False, 0, 4]
adaboost_5_expected = [("<6",.5*ln(4)), ("<2", .5*ln(3)), ("<4",-.5*ln(5))]
def adaboost_5_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_5_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_5_getargs,
testanswer = adaboost_5_testanswer,
expected_val = str(adaboost_5_expected),
name = 'adaboost')
#allow 1 misclassification; stops after 1 round
def adaboost_6_getargs() : #TEST 47
return [boost_2012_tr_pts, boost_2012_cl_to_miscl, True, 1, 4]
adaboost_6_expected = [("<6",.5*ln(4))]
def adaboost_6_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_6_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_6_getargs,
testanswer = adaboost_6_testanswer,
expected_val = str(adaboost_6_expected),
name = 'adaboost')
#toy problem: exits after 1 round with all error rates = 1/2
def adaboost_7_getargs() : #TEST 48
return [list('XYZ'), {'cl_1':['Z'], 'cl_2':['X','Y']}, True, 0, 3]
adaboost_7_expected = [('cl_1', 0.5*ln(2))]
def adaboost_7_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_7_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_7_getargs,
testanswer = adaboost_7_testanswer,
expected_val = str(adaboost_7_expected) \
+ ' (Hint: What should happen when the best error rate is 1/2?)',
name = 'adaboost')
boost_toy1_tr_pts = list('ABCD')
boost_toy1_cl_to_miscl = {'h1':['A'], 'h2':list('BCD'), 'h3':list('ABC')}
#toy problem: exits after 1 round with smallest error rate = 1/2
def adaboost_8_getargs() : #TEST 49
return [boost_toy1_tr_pts, boost_toy1_cl_to_miscl, True, 0, 4]
adaboost_8_expected = [('h1', 0.5*ln(3))]
def adaboost_8_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_8_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_8_getargs,
testanswer = adaboost_8_testanswer,
expected_val = str(adaboost_8_expected),
name = 'adaboost')
#toy problem: has smallest error rate = 1/2 after 1 round, but continues
def adaboost_9_getargs() : #TEST 50
return [boost_toy1_tr_pts, boost_toy1_cl_to_miscl, False, 0, 2]
adaboost_9_expected = [('h1', 0.5*ln(3)), ('h3', -0.5*ln(5))]
def adaboost_9_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_9_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_9_getargs,
testanswer = adaboost_9_testanswer,
expected_val = str(adaboost_9_expected),
name = 'adaboost')
#picks same classifier multiple times
def adaboost_91_getargs() : #TEST 51
return [boost_toy1_tr_pts, boost_toy1_cl_to_miscl, False, 0, 4]
adaboost_91_expected = [('h1', 0.5*ln(3)), ('h3', -0.5*ln(5)),
('h1', 0.5*ln(F(7,3))), ('h3', -0.5*ln(F(9,5)))]
def adaboost_91_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_91_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_91_getargs,
testanswer = adaboost_91_testanswer,
expected_val = str(adaboost_91_expected),
name = 'adaboost')
#tolerance > 1 but continues multiple rounds; exits with error_rate=0.5
def adaboost_92_getargs() : #TEST 52
return [list('ABCDEFG'),
dict(h1=list('ABC'), h2=list('ABD'), h3=list('ABE')),
True, 2, 5]
adaboost_92_expected = [('h1', 0.1438410362258895), ('h2', 0.08352704233158378),
('h3', 0.041982690058667164)]
def adaboost_92_testanswer(val, original_val = None) :
return classifier_approx_equal(val, adaboost_92_expected)
make_test(type = 'FUNCTION_ENCODED_ARGS',
getargs = adaboost_92_getargs,
testanswer = adaboost_92_testanswer,
expected_val = str(adaboost_92_expected),
name = 'adaboost')
| 46.411606 | 106 | 0.68579 | 4,728 | 34,391 | 4.597504 | 0.054992 | 0.036804 | 0.10305 | 0.057414 | 0.857478 | 0.652206 | 0.593642 | 0.499057 | 0.481529 | 0.410912 | 0 | 0.048236 | 0.187404 | 34,391 | 740 | 107 | 46.474324 | 0.729586 | 0.07185 | 0 | 0.279339 | 0 | 0 | 0.124752 | 0.048983 | 0 | 0 | 0 | 0 | 0 | 1 | 0.171901 | false | 0 | 0.003306 | 0.157025 | 0.347107 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 2 |
2bcf0befbf511c74112319421a44b006ea574e12 | 15,442 | py | Python | automol/tests/test_rings.py | sjklipp/automol | ba87f4443ebe2ceb5929d4269c4be93fd28f68ca | [
"Apache-2.0"
] | null | null | null | automol/tests/test_rings.py | sjklipp/automol | ba87f4443ebe2ceb5929d4269c4be93fd28f68ca | [
"Apache-2.0"
] | null | null | null | automol/tests/test_rings.py | sjklipp/automol | ba87f4443ebe2ceb5929d4269c4be93fd28f68ca | [
"Apache-2.0"
] | 7 | 2019-12-18T20:11:06.000Z | 2020-10-14T08:54:16.000Z | """ test ring functionality in graph
"""
from automol import graph
from automol import smiles
from automol import inchi
from automol import geom
from automol import zmat
import numpy
# cyclohexane
ICH1 = 'InChI=1S/C6H12/c1-2-4-6-5-3-1/h1-6H2'
# benzene
ICH2 = 'InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H'
# cyclic-ether
ICH3 = 'InChI=1S/C7H14O/c1-2-4-6-8-7-5-3-1/h1-7H2'
# 1-propylcyclopentane
ICH4 = 'InChI=1S/C8H16/c1-2-5-8-6-3-4-7-8/h8H,2-7H2,1H3'
# polycycle: cyclohexane+cyclopentane
ICH5 = 'InChI=1S/C9H16/c1-2-5-9-7-3-6-8(9)4-1/h8-9H,1-7H2/t8-,9-/m1/s1'
GEO1 = inchi.geometry(ICH1)
GEO2 = inchi.geometry(ICH2)
GEO3 = inchi.geometry(ICH3)
GEO4 = inchi.geometry(ICH4)
GEO5 = inchi.geometry(ICH5)
ZMA1 = geom.zmatrix(GEO1)
ZMA2 = geom.zmatrix(GEO2)
ZMA3 = geom.zmatrix(GEO3)
ZMA4 = geom.zmatrix(GEO4)
ZMA5 = geom.zmatrix(GEO5)
def test__rings():
""" test graph.rings
"""
c5h5n5o_cgr = (
{0: ('C', 1, None), 1: ('C', 0, None), 2: ('C', 0, None),
3: ('C', 0, None), 4: ('C', 0, None), 5: ('N', 2, None),
6: ('N', 0, None), 7: ('N', 0, None), 8: ('N', 0, None),
9: ('N', 1, None), 10: ('O', 1, None)},
{frozenset({10, 4}): (1, None), frozenset({8, 2}): (1, None),
frozenset({0, 6}): (1, None), frozenset({9, 3}): (1, None),
frozenset({1, 2}): (1, None), frozenset({3, 7}): (1, None),
frozenset({2, 5}): (1, None), frozenset({1, 6}): (1, None),
frozenset({0, 7}): (1, None), frozenset({9, 4}): (1, None),
frozenset({1, 3}): (1, None), frozenset({8, 4}): (1, None)})
assert graph.rings(c5h5n5o_cgr) == (
({0: ('C', 1, None), 1: ('C', 0, None), 3: ('C', 0, None),
6: ('N', 0, None), 7: ('N', 0, None)},
{frozenset({0, 6}): (1, None), frozenset({3, 7}): (1, None),
frozenset({0, 7}): (1, None), frozenset({1, 6}): (1, None),
frozenset({1, 3}): (1, None)}),
({1: ('C', 0, None), 2: ('C', 0, None), 3: ('C', 0, None),
4: ('C', 0, None), 8: ('N', 0, None), 9: ('N', 1, None)},
{frozenset({8, 2}): (1, None), frozenset({9, 3}): (1, None),
frozenset({1, 2}): (1, None), frozenset({9, 4}): (1, None),
frozenset({1, 3}): (1, None), frozenset({8, 4}): (1, None)})
)
def test__ring_systems():
""" test graph.ring_systems
"""
# molecule:
# InChI=1S/C19H30/c1-2-4-14-10-12(9-13(14)3-1)5-7-17-16-8-6-15-11-
# 18(16)19(15)17/h12-19H,1-11H2/
gra = ({0: ('C', 1, None), 1: ('C', 1, None), 2: ('C', 2, None),
3: ('C', 1, None), 4: ('C', 1, None), 5: ('C', 1, None),
6: ('C', 2, None), 7: ('C', 2, None), 8: ('C', 1, None),
9: ('C', 2, None), 10: ('C', 2, None), 11: ('C', 2, None),
12: ('C', 1, None), 13: ('C', 1, None), 14: ('C', 2, None),
15: ('C', 2, None), 16: ('C', 2, None), 17: ('C', 2, None),
18: ('C', 2, None)},
{frozenset({9, 13}): (1, None), frozenset({3, 6}): (1, None),
frozenset({0, 5}): (1, None), frozenset({11, 12}): (1, None),
frozenset({13, 14}): (1, None), frozenset({3, 5}): (1, None),
frozenset({0, 2}): (1, None), frozenset({1, 4}): (1, None),
frozenset({12, 13}): (1, None), frozenset({0, 1}): (1, None),
frozenset({1, 7}): (1, None), frozenset({12, 15}): (1, None),
frozenset({6, 7}): (1, None), frozenset({8, 9}): (1, None),
frozenset({16, 15}): (1, None), frozenset({4, 5}): (1, None),
frozenset({16, 17}): (1, None), frozenset({2, 3}): (1, None),
frozenset({18, 4}): (1, None), frozenset({17, 14}): (1, None),
frozenset({8, 10}): (1, None), frozenset({18, 10}): (1, None),
frozenset({8, 11}): (1, None)})
rsys = graph.ring_systems(gra)
assert len(rsys) == 2
rsy_rngs = list(map(graph.rings, rsys))
assert tuple(map(len, rsy_rngs)) == (3, 2)
def test__ring_systems_decomposed_atom_keys():
""" test graph.ring_systems_decomposed_atom_keys
"""
# molecule:
# InChI=1S/C19H30/c1-2-4-14-10-12(9-13(14)3-1)5-7-17-16-8-6-15-11-
# 18(16)19(15)17/h12-19H,1-11H2/
gra = ({0: ('C', 1, None), 1: ('C', 1, None), 2: ('C', 2, None),
3: ('C', 1, None), 4: ('C', 1, None), 5: ('C', 1, None),
6: ('C', 2, None), 7: ('C', 2, None), 8: ('C', 1, None),
9: ('C', 2, None), 10: ('C', 2, None), 11: ('C', 2, None),
12: ('C', 1, None), 13: ('C', 1, None), 14: ('C', 2, None),
15: ('C', 2, None), 16: ('C', 2, None), 17: ('C', 2, None),
18: ('C', 2, None)},
{frozenset({9, 13}): (1, None), frozenset({3, 6}): (1, None),
frozenset({0, 5}): (1, None), frozenset({11, 12}): (1, None),
frozenset({13, 14}): (1, None), frozenset({3, 5}): (1, None),
frozenset({0, 2}): (1, None), frozenset({1, 4}): (1, None),
frozenset({12, 13}): (1, None), frozenset({0, 1}): (1, None),
frozenset({1, 7}): (1, None), frozenset({12, 15}): (1, None),
frozenset({6, 7}): (1, None), frozenset({8, 9}): (1, None),
frozenset({16, 15}): (1, None), frozenset({4, 5}): (1, None),
frozenset({16, 17}): (1, None), frozenset({2, 3}): (1, None),
frozenset({18, 4}): (1, None), frozenset({17, 14}): (1, None),
frozenset({8, 10}): (1, None), frozenset({18, 10}): (1, None),
frozenset({8, 11}): (1, None)})
decomps = graph.ring_systems_decomposed_atom_keys(gra)
assert decomps == (((0, 1, 4, 5), (0, 2, 3, 5), (1, 7, 6, 3)),
((8, 9, 13, 12, 11), (13, 14, 17, 16, 15, 12)))
# a1 = +/-q
# a2 = +/-a1
def test__ring_puckering():
""" ring pucker
"""
smi = 'CC1CCCCC1'
ich = smiles.inchi(smi)
geo = inchi.geometry(ich)
zma = geom.zmatrix(geo)
gra = zmat.graph(zma)
rings_atoms = graph.rings_atom_keys(gra)
val_dct = zmat.value_dictionary(zma)
coos = zmat.coordinates(zma)
geo = zmat.geometry(zma)
da_names = zmat.dihedral_angle_names(zma)
for ring_atoms in rings_atoms:
rotate_hyds = []
ngbs = graph.atom_sorted_neighbor_atom_keys(gra, ring_atoms[0])
symbs = geom.symbols(geo)
for ngb in ngbs:
if symbs[ngb] == 'H':
rotate_hyds.append(ngb)
ring_value_dct = {}
for da_name in da_names:
da_idxs = list(coos[da_name])[0]
if len(list(set(da_idxs) & set(ring_atoms))) == 4:
print(da_name, da_idxs)
ring_value_dct[da_name] = val_dct[da_name]
dist_value_dct = {}
for i, _ in enumerate(ring_atoms):
dist_value_dct[i] = zmat.distance(
zma, ring_atoms[i-1], ring_atoms[i])
samp_range_dct = {}
for key, value in ring_value_dct.items():
samp_range_dct[key] = (value - numpy.pi/4, value + numpy.pi/4)
print(zmat.samples(zma, 5, samp_range_dct))
def __zmat_ring():
""" test (add TS)
"""
def _chk_ring_dct(ring_dct, ref_ring_dct):
""" Ring dictionaries by checking the keys and subkeys and tha
the floats match in the arrays.
"""
for key, rkey in zip(ring_dct.keys(), ref_ring_dct.keys()):
assert key == rkey
rdct, ref_dct = ring_dct[key], ref_ring_dct[rkey]
for key2, rkey2 in zip(rdct.keys(), ref_dct.keys()):
assert key2 == rkey2
assert numpy.allclose(rdct[key2], ref_dct[rkey2],
atol=0.0001, rtol=0.0)
ref_rng_dct1 = {
'1-2-5-8-11-14': {'D7': [0.16168073524433701, 1.7324770620392336],
'D10': [4.550708773750596, 6.121505100545493],
'D13': [0.16167968490856266, 1.7324760117034592]}
}
ref_rng_dct2 = {
'1-2-4-6-8-10': {'D5': [5.497778966967656, 7.068575293762552],
'D7': [-0.7853916433944105, 0.7854046834004861],
'D9': [-0.7853965979951805, 0.7853997287997161]}
}
ref_rng_dct3 = {
'1-2-5-8-11-14-15-18': {'D7': [4.107068942834604, 5.677865269629501],
'D10': [0.2823332978102957, 1.853129624605192],
'D13': [3.7747759383709774, 5.345572265165874],
'D14': [1.3922420091755172, 2.963038335970413],
'D17': [4.0726811920433565, 5.643477518838253]}
}
ref_rng_dct4 = {
'1-2-5-8-11': {'D7': [4.965369609998152, 6.536165936793049],
'D10': [-0.06067570281684087, 1.5101206239780556]}
}
ref_rng_dct5 = {
'1-2-5-8-11': {'D7': [4.877800020154778, 6.4485963469496745],
'D10': [-0.012877983213259836, 1.5579183435816368]},
'5-8-21-18-15-9': {'D17': [-0.33350277464453076, 1.2372935521503658],
'D20': [4.488064445840583, 6.058860772635479]}
}
# Get lists of atoms in the ring
rng_atoms1 = zmat.all_rings_atoms(ZMA1, zrxn=None)
rng_atoms2 = zmat.all_rings_atoms(ZMA2, zrxn=None)
rng_atoms3 = zmat.all_rings_atoms(ZMA3, zrxn=None)
rng_atoms4 = zmat.all_rings_atoms(ZMA4, zrxn=None)
rng_atoms5 = zmat.all_rings_atoms(ZMA5, zrxn=None)
# Sampling ranges (includes dihedral calls)
rng_dct1 = zmat.all_rings_dct(ZMA1, rng_atoms1)
rng_dct2 = zmat.all_rings_dct(ZMA2, rng_atoms2)
rng_dct3 = zmat.all_rings_dct(ZMA3, rng_atoms3)
rng_dct4 = zmat.all_rings_dct(ZMA4, rng_atoms4)
rng_dct5 = zmat.all_rings_dct(ZMA5, rng_atoms5)
_chk_ring_dct(rng_dct1, ref_rng_dct1)
_chk_ring_dct(rng_dct2, ref_rng_dct2)
_chk_ring_dct(rng_dct3, ref_rng_dct3)
_chk_ring_dct(rng_dct4, ref_rng_dct4)
_chk_ring_dct(rng_dct5, ref_rng_dct5)
# Check distances (includes distance calc)
# still need a dist check failure for testing
assert zmat.all_rings_distances_reasonable(ZMA1, rng_atoms1)
assert zmat.all_rings_distances_reasonable(ZMA2, rng_atoms2)
assert zmat.all_rings_distances_reasonable(ZMA3, rng_atoms3)
assert zmat.all_rings_distances_reasonable(ZMA4, rng_atoms4)
assert zmat.all_rings_distances_reasonable(ZMA5, rng_atoms5)
def __geom_ring():
""" test
"""
# Check fragments
ref_frag1 = (
('C', (-4.678309211005585, 0.9507582225493368, 1.3283943630808774)),
('C', (-5.121751782500965, -0.938130104907219, -0.8105253645907926)),
('C', (-1.8183184542355333, 1.124802798603796, 1.679473859905406)),
('H', (-5.596045421215773, 0.3417726406642164, 3.080387789063853)),
('H', (-5.472315138734762, 2.795412023268741, 0.8240154865962166)),
('C', (-2.5431899261233295, -2.0739380012437003, -1.3930195681295054)),
('H', (-5.852499087712589, 0.05531532655919256, -2.475545119599078)),
('H', (-6.503039672160678, -2.388190468828352, -0.2948252443802334)),
('C', (-0.7061241675458045, 0.061496234243248286, -0.764480412567453)),
('H', (-2.394903577788051, -2.688224956361526, -3.3620755359797467)),
('H', (-2.2076515854285743, -3.721079537831081, -0.17992394099843007)),
('C', (2.0244139428425885, -0.8586191572573748, -0.5328743916778614)),
('H', (-0.8215175624787503, 1.5073535945698067, -2.249882522830806)),
('H', (-1.2484554395000416, -0.024690004182670054, 3.307711745513383)),
('H', (-1.213466703672248, 3.0695743548570653, 2.0397346958319655)))
ref_frag2 = (
('C', (-4.75275159254756, -0.8859368224809074, 0.05204272094591431)),
('C', (-2.6316145805140074, -2.781457031057775, 0.617675595973341)),
('C', (-3.469373724017983, 1.644203318184678, -0.5508463526763928)),
('H', (-6.020017911796573, -0.6793342485754604, 1.6757584497553977)),
('H', (-5.894535909176483, -1.541597262442682, -1.545311764072632)),
('C', (-0.2860088109004335, -1.148940006016929, 0.961220215463222)),
('H', (-3.0413520136248446, -3.922314862417004, 2.293255681709448)),
('H', (-2.4141209511227446, -4.0740160313602765, -0.9873049704822309)),
('C', (2.2490731922647558, -2.457979419683331, 0.5439361499900985)),
('C', (-0.7009866699077159, 0.9649583926305777, -0.9504147216562486)),
('H', (-0.3133961766730456, -0.3543813002328926, 2.882320427181015)),
('C', (1.200527146395269, 3.101000420082161, -0.5817249641001333)),
('H', (-0.4809624718722801, 0.2063149270378129, -2.873628003146178)),
('H', (-4.297962624106833, 2.5542573283204937, -2.212847874618906)),
('H', (-3.6981964276399215, 2.9346249752146134, 1.054281230413613)),
('C', (4.277907565282426, -0.6204973771653151, -0.42814819707015134)),
('C', (3.775171063722607, 2.1216311210353376, 0.3399582461004284)),
('H', (4.349010775297676, -0.7282474510540757, -2.4981877728699335)),
('H', (6.139118315609488, -1.2222378958530145, 0.25232279110138667)),
('H', (3.8464710144147634, 2.255925498026601, 2.408439361912304)),
('H', (5.279790586767728, 3.3507823389200784, -0.3773631616284865)),
('H', (1.4381199118411645, 4.1005566214301385, -2.3820194923439555)),
('H', (0.5015487139955048, 4.508608348000816, 0.7687730045421981)),
('H', (2.075693517927493, -4.028187328133698, -0.7970212520506802)),
('H', (2.8688480603817905, -3.297736252410089, 2.3348346516273333)))
frag1 = geom.ring_fragments_geometry(GEO4)
frag2 = geom.ring_fragments_geometry(GEO5)
assert geom.almost_equal_dist_matrix(frag1, ref_frag1)
assert geom.almost_equal_dist_matrix(frag2, ref_frag2)
# Check angles passing
# rng_atoms1 = zmat.all_rings_atoms(ZMA1, zrxn=None)
# rng_atoms2 = zmat.all_rings_atoms(ZMA2, zrxn=None)
# rng_atoms3 = zmat.all_rings_atoms(ZMA3, zrxn=None)
# rng_atoms4 = zmat.all_rings_atoms(ZMA4, zrxn=None)
# rng_atoms5 = zmat.all_rings_atoms(ZMA5, zrxn=None)
# assert geom.all_rings_angles_reasonable(GEO1, rng_atoms1)
# assert geom.all_rings_angles_reasonable(GEO2, rng_atoms2)
# assert geom.all_rings_angles_reasonable(GEO3, rng_atoms3)
# assert geom.all_rings_angles_reasonable(GEO4, rng_atoms4)
# assert geom.all_rings_angles_reasonable(GEO5, rng_atoms5)
# # Make fake ring with a bad angle
# bad_geo = (
# ('C', (-5.5877937580, -0.9968691886, -0.4989724332)),
# ('C', (-2.7396917422, -0.5869879179, -0.3495489041)),
# ('H', (-6.2131071344, -2.2170574292, 1.0990444734)),
# ('H', (-6.2375188836, -1.8516712887, -2.3026059381)),
# ('C', (-5.5653523999, 1.1009499352, 0.6068939227)),
# ('H', (-1.6185907638, -2.3610282320, -0.3017615543)),
# ('C', (-2.5439758909, 0.9534327614, 2.0676109788)),
# ('H', (-2.1053962916, 0.5765661495, -1.9857880223)),
# ('C', (-4.8046407570, 2.7722969017, 1.9610434891)),
# ('H', (-7.3189290824, 1.5474187146, 1.4538721624)),
# ('H', (-5.6843643376, 2.5317510457, -1.5414484200)),
# ('H', (-0.6915593935, 1.8574930579, 2.4592560449)),
# ('H', (-2.9167136073, -0.4107171297, 3.6299854071)),
# ('H', (-5.7060177389, 2.8094515351, 3.8587924532)),
# ('H', (-4.2677394999, 4.7261055569, 1.4049815516)))
# rng_atoms = ((0, 1, 4, 6, 8),)
# assert not geom.all_rings_angles_reasonable(bad_geo, rng_atoms)
| 47.513846 | 79 | 0.572335 | 2,049 | 15,442 | 4.192289 | 0.206442 | 0.052387 | 0.107567 | 0.019208 | 0.316997 | 0.310361 | 0.252037 | 0.247846 | 0.227939 | 0.224331 | 0 | 0.327905 | 0.232548 | 15,442 | 324 | 80 | 47.660494 | 0.396929 | 0.1516 | 0 | 0.176211 | 0 | 0.022026 | 0.03482 | 0.016948 | 0 | 0 | 0 | 0 | 0.061674 | 1 | 0.030837 | false | 0 | 0.026432 | 0 | 0.057269 | 0.008811 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
2bd7c88b64df6d01ccfe2f56819d07d42a12960f | 573 | py | Python | ews/migrations/0017_auto_20210121_1749.py | mrustl/plattform | 7c9fce2a697b7c9d3de0bd08382571ed89469281 | [
"MIT"
] | null | null | null | ews/migrations/0017_auto_20210121_1749.py | mrustl/plattform | 7c9fce2a697b7c9d3de0bd08382571ed89469281 | [
"MIT"
] | 3 | 2021-06-07T10:30:55.000Z | 2021-06-07T14:00:32.000Z | ews/migrations/0017_auto_20210121_1749.py | mrustl/plattform | 7c9fce2a697b7c9d3de0bd08382571ed89469281 | [
"MIT"
] | null | null | null | # Generated by Django 3.1.5 on 2021-01-21 16:49
from django.db import migrations, models
import djgeojson.fields
class Migration(migrations.Migration):
dependencies = [
('ews', '0016_auto_20210121_1327'),
]
operations = [
migrations.AddField(
model_name='site',
name='location',
field=djgeojson.fields.PointField(null=True),
),
migrations.AddField(
model_name='site',
name='ref_name',
field=models.CharField(max_length=64, null=True),
),
]
| 22.92 | 61 | 0.586387 | 61 | 573 | 5.393443 | 0.688525 | 0.091185 | 0.139818 | 0.164134 | 0.212766 | 0.212766 | 0 | 0 | 0 | 0 | 0 | 0.08209 | 0.298429 | 573 | 24 | 62 | 23.875 | 0.736318 | 0.078534 | 0 | 0.333333 | 1 | 0 | 0.095057 | 0.043726 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.111111 | 0 | 0.277778 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
2bda8a0559ef784a0cf57e5e5dfb3da7f383c7c9 | 441 | py | Python | rov/hardware/motor_control/__init__.py | jiena76/X11-Core | 95aec844822ab4e53c09accc48ef25d70e9b4f08 | [
"MIT"
] | 9 | 2017-09-21T22:00:46.000Z | 2018-12-26T15:46:40.000Z | rov/hardware/motor_control/__init__.py | jiena76/X11-Core | 95aec844822ab4e53c09accc48ef25d70e9b4f08 | [
"MIT"
] | 25 | 2017-10-06T17:25:51.000Z | 2018-04-19T00:51:50.000Z | rov/hardware/motor_control/__init__.py | jiena76/X11-Core | 95aec844822ab4e53c09accc48ef25d70e9b4f08 | [
"MIT"
] | 2 | 2017-10-19T22:41:37.000Z | 2018-05-10T20:33:45.000Z | def MotorControl(*args, **kwargs):
try:
from MotorControl import MotorControl as MotorControl
return MotorControl(*args, **kwargs)
except Exception as e:
print "Failed to Initialize Hardware Motor Control (I2C PWM Device)"
print "Error: %s" % e.message
print "Using Mock Motor Control"
from MotorControl_Mock import MotorControl as MotorControl_Mock
return MotorControl_Mock()
| 40.090909 | 76 | 0.687075 | 50 | 441 | 6 | 0.54 | 0.16 | 0.146667 | 0.213333 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.003012 | 0.247166 | 441 | 10 | 77 | 44.1 | 0.900602 | 0 | 0 | 0 | 0 | 0 | 0.210884 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.2 | null | null | 0.3 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
2bf2969cf9b63edc0bb8cc3251a1e5e9b440d46f | 831 | py | Python | learning_curve.py | zenmood/IndoorFarmWiz | 0f5075007cbd1d15c83ed3aef820ec3d72048a90 | [
"MIT"
] | 11 | 2020-06-28T04:30:26.000Z | 2022-03-26T08:40:47.000Z | learning_curve.py | zenmood/IndoorFarmWiz | 0f5075007cbd1d15c83ed3aef820ec3d72048a90 | [
"MIT"
] | 4 | 2020-07-27T19:45:27.000Z | 2020-07-28T13:58:41.000Z | learning_curve.py | zenmood/IndoorFarmWiz | 0f5075007cbd1d15c83ed3aef820ec3d72048a90 | [
"MIT"
] | null | null | null | import pandas as pd
waste_rates = pd.DataFrame({'High': [0, 0.1254, 0.1129, 0.1016, 0.0934, 0.0860, 0.0791, 0.0728, 0.0684, 0.0643, 0.0604,
0.0568, 0.0534, 0.0502, 0.0472, 0.0444, 0.0444, 0.0444, 0.0444, 0.0444, 0.0444],
'Medium': [0, 0.1777, 0.1599, 0.1439, 0.1324, 0.1218, 0.1121, 0.1031, 0.0969, 0.0911,
0.0856, 0.0805, 0.0757, 0.0711, 0.0668, 0.0628, 0.0628, 0.0628, 0.0628, 0.0628,
0.0628],
'Low': [0, 0.2404, 0.2163, 0.1947, 0.1791, 0.1648, 0.1516, 0.1395, 0.1311, 0.1232, 0.1158,
0.1089, 0.1024, 0.0962, 0.0904, 0.0850, 0.0850, 0.0850, 0.0850, 0.0850, 0.0850]})
waste_rates.index = range(0, 21)
print(waste_rates)
| 59.357143 | 119 | 0.474128 | 143 | 831 | 2.734266 | 0.41958 | 0.076726 | 0.076726 | 0.127877 | 0.230179 | 0.230179 | 0.230179 | 0.230179 | 0.230179 | 0.230179 | 0 | 0.5625 | 0.345367 | 831 | 13 | 120 | 63.923077 | 0.15625 | 0 | 0 | 0 | 0 | 0 | 0.015644 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.1 | 0 | 0.1 | 0.1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
920361755ac6c33be8f40196ffa5844f403eb8a2 | 2,262 | py | Python | api/settings/base.py | uk-gov-mirror/ministryofjustice.manchester_traffic_offences_pleas | 4c625b13fa2826bdde083a0270dcea1791f6dc18 | [
"MIT"
] | 3 | 2015-12-22T16:37:14.000Z | 2018-01-22T18:44:38.000Z | api/settings/base.py | uk-gov-mirror/ministryofjustice.manchester_traffic_offences_pleas | 4c625b13fa2826bdde083a0270dcea1791f6dc18 | [
"MIT"
] | 145 | 2015-03-04T11:17:50.000Z | 2022-03-21T12:10:13.000Z | api/settings/base.py | uk-gov-mirror/ministryofjustice.manchester_traffic_offences_pleas | 4c625b13fa2826bdde083a0270dcea1791f6dc18 | [
"MIT"
] | 3 | 2015-12-29T14:59:12.000Z | 2021-04-11T06:24:11.000Z | from make_a_plea.settings.base import *
ROOT_URLCONF = 'api.urls'
INSTALLED_APPS = [
'django.contrib.auth',
'django.contrib.contenttypes',
'django.contrib.messages',
'django.contrib.postgres',
'django.contrib.sessions',
'django.contrib.sites',
'django.contrib.staticfiles',
'django_extensions',
'rest_framework',
]
MIDDLEWARE_CLASSES = (
'django.middleware.cache.UpdateCacheMiddleware',
'django.contrib.sessions.middleware.SessionMiddleware',
'django.middleware.locale.LocaleMiddleware',
'django.middleware.common.CommonMiddleware',
'django.middleware.csrf.CsrfViewMiddleware',
'django.contrib.auth.middleware.AuthenticationMiddleware',
'django.contrib.messages.middleware.MessageMiddleware',
'django.middleware.clickjacking.XFrameOptionsMiddleware',
'make_a_plea.middleware.AdminLocaleURLMiddleware',
'make_a_plea.middleware.TimeoutRedirectMiddleware',
'django.middleware.cache.FetchFromCacheMiddleware'
)
PROJECT_APPS = [
'apps.forms',
'apps.plea',
'apps.result',
'api',
'api.v0',
]
# Django-rest-framework throttling config
REST_FRAMEWORK = {
'DEFAULT_THROTTLE_CLASSES': (
'rest_framework.throttling.AnonRateThrottle',
),
'DEFAULT_THROTTLE_RATES': {
'anon': '100/day',
},
'DEFAULT_AUTHENTICATION_CLASSES': (
'rest_framework.authentication.BasicAuthentication',
),
'DEFAULT_PERMISSION_CLASSES': (
'rest_framework.permissions.IsAuthenticated',
),
'DEFAULT_RENDERER_CLASSES': (
'rest_framework.renderers.JSONRenderer',
)
}
INSTALLED_APPS = INSTALLED_APPS + PROJECT_APPS
TEMPLATES = [
{
'BACKEND': 'django.template.backends.django.DjangoTemplates',
'APP_DIRS': True,
}
]
# Options for Premailer, which inlines the CSS on the fly in email templates and
# makes all URLs absolute
PREMAILER_OPTIONS = {"base_url": os.environ.get("PREMAILER_BASE_URL", "https://www.makeaplea.service.gov.uk"),
"remove_classes": False,
"keep_style_tags": True,
"cssutils_logging_level": logging.ERROR}
# .local.py overrides all the common settings.
try:
from .local import *
except ImportError:
pass
| 28.275 | 110 | 0.69496 | 217 | 2,262 | 7.059908 | 0.520737 | 0.084856 | 0.052219 | 0.024804 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.00217 | 0.185234 | 2,262 | 79 | 111 | 28.632911 | 0.829083 | 0.08267 | 0 | 0.046154 | 0 | 0 | 0.601449 | 0.488406 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0.015385 | 0.046154 | 0 | 0.046154 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
920a4417a77ca2b968b9be1cb0e88026aa6a0c96 | 72 | py | Python | ForLoopPractice2.py | anayakoti/FirstSample | 8ef05772991644e63a4fd6759458f449cd2b00c0 | [
"bzip2-1.0.6"
] | null | null | null | ForLoopPractice2.py | anayakoti/FirstSample | 8ef05772991644e63a4fd6759458f449cd2b00c0 | [
"bzip2-1.0.6"
] | null | null | null | ForLoopPractice2.py | anayakoti/FirstSample | 8ef05772991644e63a4fd6759458f449cd2b00c0 | [
"bzip2-1.0.6"
] | null | null | null | letter="Sai Teja";
for i in letter:
print(i);
| 12 | 18 | 0.430556 | 9 | 72 | 3.444444 | 0.777778 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.458333 | 72 | 5 | 19 | 14.4 | 0.794872 | 0 | 0 | 0 | 0 | 0 | 0.111111 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0.333333 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
9219081094f353a1e33b78b38402aefce0b7dbaf | 214 | py | Python | plugins/constants.py | PalashTanejaPro/cvbot | 429514bf235e410f6cea436a1846ab9880e0615c | [
"MIT"
] | null | null | null | plugins/constants.py | PalashTanejaPro/cvbot | 429514bf235e410f6cea436a1846ab9880e0615c | [
"MIT"
] | null | null | null | plugins/constants.py | PalashTanejaPro/cvbot | 429514bf235e410f6cea436a1846ab9880e0615c | [
"MIT"
] | null | null | null | import os
API_DOCS = 'http://api.cloudcv.io/en/latest'
USER_DOCS = 'http://docs.cloudcv.io/en/latest'
GH_ORG_NAME = os.environ.get('GH_ORG_NAME', 'cloudcv')
GL_ORG_NAME = os.environ.get('GL_ORG_NAME', 'cloudcv')
| 26.75 | 54 | 0.728972 | 38 | 214 | 3.842105 | 0.421053 | 0.191781 | 0.150685 | 0.232877 | 0.260274 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.084112 | 214 | 7 | 55 | 30.571429 | 0.744898 | 0 | 0 | 0 | 0 | 0 | 0.462617 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.2 | 0 | 0.2 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
9219dccb57b9c99be64219ed05e1d50a0ed1dbb6 | 549 | py | Python | arca/backend/current_environment.py | encukou/arca | edc3e81d27a5c194da10d54402923c27085e0e96 | [
"MIT"
] | 6 | 2017-09-25T00:43:01.000Z | 2018-09-05T07:59:08.000Z | arca/backend/current_environment.py | encukou/arca | edc3e81d27a5c194da10d54402923c27085e0e96 | [
"MIT"
] | 41 | 2017-10-05T21:10:11.000Z | 2019-09-10T16:48:22.000Z | arca/backend/current_environment.py | encukou/arca | edc3e81d27a5c194da10d54402923c27085e0e96 | [
"MIT"
] | 2 | 2019-12-09T15:12:17.000Z | 2019-12-09T20:00:53.000Z | import sys
from pathlib import Path
from git import Repo
from .base import BaseRunInSubprocessBackend
class CurrentEnvironmentBackend(BaseRunInSubprocessBackend):
""" Uses the current Python to run the tasks, however they're launched in a :mod:`subprocess`.
The requirements of the repository are completely ignored.
"""
def get_or_create_environment(self, repo: str, branch: str, git_repo: Repo, repo_path: Path) -> str:
""" Returns the path to the current Python executable.
"""
return sys.executable
| 28.894737 | 104 | 0.728597 | 69 | 549 | 5.724638 | 0.623188 | 0.050633 | 0.081013 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.200364 | 549 | 18 | 105 | 30.5 | 0.899772 | 0.36612 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.142857 | false | 0 | 0.571429 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 2 |
ecf858203bb6398c53b5dd66e250e316b72b0da4 | 928 | py | Python | services/datastream/models/vrf.py | sbworth/getnoc | a9a5647df31822062db3db7afe7ae1c005d166f7 | [
"BSD-3-Clause"
] | null | null | null | services/datastream/models/vrf.py | sbworth/getnoc | a9a5647df31822062db3db7afe7ae1c005d166f7 | [
"BSD-3-Clause"
] | null | null | null | services/datastream/models/vrf.py | sbworth/getnoc | a9a5647df31822062db3db7afe7ae1c005d166f7 | [
"BSD-3-Clause"
] | null | null | null | # ----------------------------------------------------------------------
# vrf datastream model
# ----------------------------------------------------------------------
# Copyright (C) 2007-2019 The NOC Project
# See LICENSE for details
# ----------------------------------------------------------------------
# Python modules
from typing import Optional, List
# Third-party modules
from pydantic import BaseModel
# NOC modules
from .utils import StateItem, ProjectItem
class AFIItem(BaseModel):
ipv4: bool
ipv6: bool
class VRFProfileItem(BaseModel):
id: str
name: str
class VRFGroupDataStreamItem(BaseModel):
id: str
name: str
change_id: str
vpn_id: str
afi: AFIItem
source: str
state: StateItem
profile: VRFProfileItem
description: Optional[str]
rd: Optional[str]
labels: Optional[List[str]]
tags: Optional[List[str]]
project: Optional[ProjectItem]
| 22.095238 | 72 | 0.538793 | 87 | 928 | 5.724138 | 0.551724 | 0.040161 | 0.056225 | 0.072289 | 0.084337 | 0 | 0 | 0 | 0 | 0 | 0 | 0.013055 | 0.174569 | 928 | 41 | 73 | 22.634146 | 0.637076 | 0.37069 | 0 | 0.173913 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 0.130435 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
ecfa9d9011d45dd6d2957f6da2c1fb04dd9212c9 | 147 | py | Python | scripts/scheduler/__main__.py | OCHA-DAP/hdx-scraper-unosat-flood-portal | 80b0bcd404993e4bd1dae442f794c9f86b6d5328 | [
"MIT"
] | 1 | 2016-07-22T13:32:54.000Z | 2016-07-22T13:32:54.000Z | scripts/scheduler/__main__.py | OCHA-DAP/hdx-scraper-unosat-flood-portal | 80b0bcd404993e4bd1dae442f794c9f86b6d5328 | [
"MIT"
] | 21 | 2015-07-08T21:30:32.000Z | 2015-08-27T17:52:24.000Z | scripts/scheduler/__main__.py | OCHA-DAP/hdxscraper-unosat-flood-portal | 80b0bcd404993e4bd1dae442f794c9f86b6d5328 | [
"MIT"
] | null | null | null | #!/usr/bin/python
# -*- coding: utf-8 -*-
import scheduler
def Main():
'''Wrapper.'''
scheduler.Main()
if __name__ == '__main__':
Main()
| 11.307692 | 26 | 0.585034 | 17 | 147 | 4.588235 | 0.764706 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.008333 | 0.183673 | 147 | 12 | 27 | 12.25 | 0.641667 | 0.319728 | 0 | 0 | 0 | 0 | 0.086022 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.2 | true | 0 | 0.2 | 0 | 0.4 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
ecfb879fb4d3dfcebde0a0e730e7e31faaf03f7b | 1,016 | py | Python | pavo/helpers/_context.py | getpavo/pavo | 8b751a296d4acf4dc3fdb7290c096f5ac23e8451 | [
"MIT"
] | 1 | 2021-08-07T15:08:51.000Z | 2021-08-07T15:08:51.000Z | pavo/helpers/_context.py | jackmanapp/core | 1150bdcaa4700d8dc1ee04f843058ab072193f3a | [
"MIT"
] | 1 | 2021-07-13T09:09:37.000Z | 2021-07-13T09:09:38.000Z | pavo/helpers/_context.py | jackmanapp/core | 1150bdcaa4700d8dc1ee04f843058ab072193f3a | [
"MIT"
] | null | null | null | from typing import Optional, Type
from types import TracebackType
class Expects:
"""Context manager when we are expecting that an error could occur, and we accept this.
Args:
expected_errors (list): A list of expected errors to skip.
Raises:
ValueError: The provided argument is not a list.
Attributes:
expected_errors (list): A list of expected errors to skip.
"""
def __init__(self, expected_errors: list[Type[BaseException]]) -> None:
if not isinstance(expected_errors, list):
raise ValueError('Expected list as list of expected errors')
self.expected_errors: list[Type[BaseException]] = expected_errors
def __enter__(self) -> None:
pass
def __exit__(self, err: Optional[Type[BaseException]],
value: Optional[BaseException], traceback: Optional[TracebackType]) -> bool:
if not err:
return True
if err in self.expected_errors:
return True
raise err
| 30.787879 | 93 | 0.658465 | 123 | 1,016 | 5.284553 | 0.471545 | 0.215385 | 0.138462 | 0.092308 | 0.258462 | 0.258462 | 0.138462 | 0.138462 | 0.138462 | 0.138462 | 0 | 0 | 0.266732 | 1,016 | 32 | 94 | 31.75 | 0.872483 | 0.287402 | 0 | 0.125 | 0 | 0 | 0.058055 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.1875 | false | 0.0625 | 0.125 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 2 |
ecfe37263f6bddba6a60517d6da35a437a83ae63 | 214 | py | Python | display/display/handlers/ui/timeline.py | owlsn/h_crawl | c0431ee6484e61d9339553c3350962ea517749d6 | [
"MIT"
] | null | null | null | display/display/handlers/ui/timeline.py | owlsn/h_crawl | c0431ee6484e61d9339553c3350962ea517749d6 | [
"MIT"
] | 8 | 2021-03-18T20:33:29.000Z | 2022-03-11T23:21:04.000Z | display/display/handlers/ui/timeline.py | owlsn/h_crawl | c0431ee6484e61d9339553c3350962ea517749d6 | [
"MIT"
] | null | null | null | from display.handlers.base import BaseHandler
class UiTimelineHandler(BaseHandler):
def get(self):
title = 'UiTimelineHandler'
self.render('ui/timeline.html', title = title, **self.render_dict) | 35.666667 | 74 | 0.719626 | 24 | 214 | 6.375 | 0.708333 | 0.130719 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.168224 | 214 | 6 | 74 | 35.666667 | 0.859551 | 0 | 0 | 0 | 0 | 0 | 0.153488 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.2 | false | 0 | 0.2 | 0 | 0.6 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
a6183d8545be0265a966996b691125bbc13e4d42 | 1,093 | py | Python | scripts/geodata/statistics/tf_idf.py | Fillr/libpostal | bce153188aff9fbe65aef12c3c639d8069e707fc | [
"MIT"
] | 3,489 | 2015-03-03T00:21:38.000Z | 2022-03-29T09:03:05.000Z | scripts/geodata/statistics/tf_idf.py | StephenHildebrand/libpostal | d8c9847c5686a1b66056e65128e1774f060ff36f | [
"MIT"
] | 488 | 2015-05-29T23:04:28.000Z | 2022-03-29T11:20:24.000Z | scripts/geodata/statistics/tf_idf.py | StephenHildebrand/libpostal | d8c9847c5686a1b66056e65128e1774f060ff36f | [
"MIT"
] | 419 | 2015-11-24T16:53:07.000Z | 2022-03-27T06:51:28.000Z | import math
from collections import defaultdict
class IDFIndex(object):
finalized = False
def __init__(self):
self.idf_counts = defaultdict(int)
self.N = 0
def update(self, doc):
if self.finalized or not doc:
return
for feature, count in doc.iteritems():
self.idf_counts[feature] += 1
self.N += 1
def prune(self, min_count):
self.idf_counts = {k: count for k, count in self.idf_counts.iteritems() if count >= min_count}
def corpus_frequency(self, key):
return self.idf_counts.get(key, 0)
def tfidf_score(self, key, count=1):
if count < 0:
return 0.0
idf_count = self.idf_counts.get(key, None)
if idf_count is None:
return 0.0
return (math.log(count + 1.0) * (math.log(float(self.N) / idf_count)))
def tfidf_vector(self, token_counts):
tf_idf = [self.tfidf_score(t, count=c) for t, c in token_counts.iteritems()]
norm = math.sqrt(sum((t ** 2 for t in tf_idf)))
return [t / norm for t in tf_idf]
| 27.325 | 102 | 0.600183 | 163 | 1,093 | 3.877301 | 0.319018 | 0.066456 | 0.123418 | 0.056962 | 0.094937 | 0 | 0 | 0 | 0 | 0 | 0 | 0.016753 | 0.290027 | 1,093 | 39 | 103 | 28.025641 | 0.79768 | 0 | 0 | 0.071429 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.214286 | false | 0 | 0.071429 | 0.035714 | 0.571429 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
a61b35b043b4cd5196fd336c4ae9d6477dbfbcf3 | 3,890 | py | Python | pythonProject1/venv/Lib/site-packages/jsonfile.py | mjtomlinson/CNE330_Python_1_Final_Project | 05020806860937ef37b9a0ad2e27de4897a606de | [
"CC0-1.0"
] | null | null | null | pythonProject1/venv/Lib/site-packages/jsonfile.py | mjtomlinson/CNE330_Python_1_Final_Project | 05020806860937ef37b9a0ad2e27de4897a606de | [
"CC0-1.0"
] | null | null | null | pythonProject1/venv/Lib/site-packages/jsonfile.py | mjtomlinson/CNE330_Python_1_Final_Project | 05020806860937ef37b9a0ad2e27de4897a606de | [
"CC0-1.0"
] | null | null | null | """
jsonfile - incrementally write files in JSON format.
"""
import json
import enum
from functools import partial, update_wrapper
__version__ = "1.0.1"
@enum.unique
class State(enum.Enum):
List = ('', ',', 'List', ']')
ListStart = ('[', '', 'List', ']')
DictBeforeKey = ('', ',', 'DictBeforeValue', '}')
DictBeforeValue = ('', ':', 'DictBeforeKey', NotImplemented)
DictStart = ('{', '', 'DictBeforeValue', '}')
TopLevel = ('', '', 'ExtraTopLevel', '')
ExtraTopLevel = ('', NotImplemented, 'ExtraTopLevel', '')
def __init__(self, on_enter, before_item, state_on_item_str, on_exit):
self.on_enter = on_enter
self.before_item = before_item
self.state_on_item_str = state_on_item_str
self.on_exit = on_exit
@property
def state_on_item(self):
return type(self)[self.state_on_item_str]
class JsonProto:
"""
Incrementally generate a file in JSON format.
"""
def __init__(self):
"""
"""
self.context = [State.TopLevel]
def _before_item(self):
old = self.swap_state(self.top_state.state_on_item)
return old.before_item
def _start_container(self, state):
self.push_state(state)
return state.on_enter
def start_list(self):
return (
self._before_item() +
self._start_container(State.ListStart)
)
def toplevel_item(self, item):
"""
If your file only contains one item, why are using this library?
But in any case, you can write one item using this.
"""
assert self.top_state == State.TopLevel
return self._any_item(item)
def _any_item(self, item):
return (
self._before_item() +
json.dumps(item)
)
def list_item(self, item):
assert self.top_state in (State.List, State.ListStart)
return self._any_item(item)
def _end_container(self):
return self.context.pop().on_exit
def end_list(self):
assert self.top_state in (State.List, State.ListStart)
return self._end_container()
def start_dict(self):
return (
self._before_item() +
self._start_container(State.DictStart)
)
def dict_item(self, key, value):
assert self.top_state in (State.DictStart, State.DictBeforeKey)
return (self.dict_key(key) + self.dict_value(value))
def dict_key(self, key):
assert self.top_state in (State.DictStart, State.DictBeforeKey)
return self._any_item(key)
def dict_value(self, value):
assert self.top_state == State.DictBeforeValue
return self._any_item(value)
def end_dict(self):
assert self.top_state in (State.DictBeforeKey, State.DictStart)
return self._end_container()
@property
def top_state(self):
return self.context[-1]
def swap_state(self, new_state):
old = self.top_state
self.context[-1] = new_state
return old
def push_state(self, new_state):
self.context.append(new_state)
@property
def done(self):
return len(self.context) == 1
def finish_all(self):
parts = []
while not self.done:
parts.append(self._end_container())
return ''.join(parts)
class JsonWriter:
def __init__(self, out):
self.protocol = JsonProto()
self.out = out
def _write_proto_result(self, method, *args, **kwargs):
result = method(*args, **kwargs)
assert type(result) is str
self.out.write(result)
def __getattr__(self, name):
value = getattr(self.protocol, name)
if callable(value):
writer = partial(self._write_proto_result, value)
update_wrapper(writer, value)
return writer
else:
return value
| 26.107383 | 74 | 0.609512 | 464 | 3,890 | 4.855603 | 0.209052 | 0.053262 | 0.047936 | 0.055925 | 0.216156 | 0.175322 | 0.158455 | 0.143808 | 0.143808 | 0.102086 | 0 | 0.002131 | 0.276093 | 3,890 | 148 | 75 | 26.283784 | 0.79794 | 0.057841 | 0 | 0.168317 | 0 | 0 | 0.025243 | 0 | 0 | 0 | 0 | 0 | 0.079208 | 1 | 0.237624 | false | 0 | 0.029703 | 0.069307 | 0.564356 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
a622e5490289c9e8968304e5f3c03fb5590e99d3 | 167 | py | Python | mooc/037.py | hiyouga/PY-Learning | 296f08e7964845c314874906039f244010d5422a | [
"MIT"
] | 2 | 2017-12-09T14:41:29.000Z | 2017-12-27T11:12:16.000Z | mooc/037.py | hiyouga/PY-Learning | 296f08e7964845c314874906039f244010d5422a | [
"MIT"
] | null | null | null | mooc/037.py | hiyouga/PY-Learning | 296f08e7964845c314874906039f244010d5422a | [
"MIT"
] | null | null | null | #encode.py
#ASCII
print(ord('A'))
print(ord('a'))
print(chr(65))
#UTF-8
s = "世界,你好!"
bs = s.encode("utf-8")
print(bs)
print(bs.decode("utf-8"))
print(bs.encode("gbk")) | 15.181818 | 25 | 0.616766 | 33 | 167 | 3.121212 | 0.484848 | 0.116505 | 0.174757 | 0.271845 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.03268 | 0.083832 | 167 | 11 | 26 | 15.181818 | 0.640523 | 0.113772 | 0 | 0 | 0 | 0 | 0.143836 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0.75 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 2 |
a62bbb63d79ddf9760e4d67c29d117a424bcc7b3 | 408 | py | Python | flas/decorators.py | hectorbenitez/flask-heroku | f0b147d79875f0d28945aa51b37bdb8ea435617b | [
"MIT"
] | 2 | 2019-04-03T12:31:53.000Z | 2020-03-22T17:49:00.000Z | flas/decorators.py | hectorbenitez/flask-heroku | f0b147d79875f0d28945aa51b37bdb8ea435617b | [
"MIT"
] | null | null | null | flas/decorators.py | hectorbenitez/flask-heroku | f0b147d79875f0d28945aa51b37bdb8ea435617b | [
"MIT"
] | null | null | null | from functools import wraps
import os
from flask import request
from werkzeug.utils import redirect
ssl_required_flag = os.environ.get('SSL_REQUIRED', False) == 'True'
def ssl_required(fn):
@wraps(fn)
def decorated_view(*args, **kwargs):
if ssl_required_flag and not request.is_secure:
return redirect(request.url.replace("http://", "https://"))
return fn(*args, **kwargs)
return decorated_view
| 25.5 | 67 | 0.747549 | 59 | 408 | 5.016949 | 0.559322 | 0.148649 | 0.101351 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.127451 | 408 | 15 | 68 | 27.2 | 0.831461 | 0 | 0 | 0 | 0 | 0 | 0.07598 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.166667 | false | 0 | 0.333333 | 0 | 0.75 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 2 |
a63a19c54726987f9442e2c7cd49b4fb9b77f7d9 | 170 | py | Python | stream_app.py | jmillerbrooks/kc_stream | 1b0a7d3a7039d6f200cd4ba4fbbe419adfe7215c | [
"CC0-1.0"
] | null | null | null | stream_app.py | jmillerbrooks/kc_stream | 1b0a7d3a7039d6f200cd4ba4fbbe419adfe7215c | [
"CC0-1.0"
] | null | null | null | stream_app.py | jmillerbrooks/kc_stream | 1b0a7d3a7039d6f200cd4ba4fbbe419adfe7215c | [
"CC0-1.0"
] | null | null | null | import streamlit as st
import pandas as pd
st.title('Streamlit Demo with KC Housing Data')
map_data = pd.read_pickle('./data/forest_pred_map_df.pkl')
st.map(map_data) | 18.888889 | 58 | 0.770588 | 31 | 170 | 4.032258 | 0.612903 | 0.112 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.123529 | 170 | 9 | 59 | 18.888889 | 0.838926 | 0 | 0 | 0 | 0 | 0 | 0.374269 | 0.169591 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.4 | 0 | 0.4 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 2 |
a648be03f4cf7081e283eefd4f15fd7ae0f64206 | 1,136 | py | Python | verify_conn.py | CodingDuckmx/Sauti-Africa-Market-Monitoring-DS | 57117c54eec75c568944b1a9819f87664c376bf3 | [
"MIT"
] | null | null | null | verify_conn.py | CodingDuckmx/Sauti-Africa-Market-Monitoring-DS | 57117c54eec75c568944b1a9819f87664c376bf3 | [
"MIT"
] | null | null | null | verify_conn.py | CodingDuckmx/Sauti-Africa-Market-Monitoring-DS | 57117c54eec75c568944b1a9819f87664c376bf3 | [
"MIT"
] | 5 | 2020-06-20T21:52:57.000Z | 2020-07-30T16:04:20.000Z | import os
import psycopg2
from dotenv import load_dotenv, find_dotenv
from psycopg2.extensions import ISOLATION_LEVEL_AUTOCOMMIT
from psycopg2 import sql
load_dotenv()
############################################################################################################
'''Verify the credentials before running deployment. '''
############################################################################################################
connection = psycopg2.connect(user=os.environ.get('aws_db_user'),
password=os.environ.get('aws_db_password'),
host=os.environ.get('aws_db_host'),
port=os.environ.get('aws_db_port'))#,
#database=os.environ.get('db_name'))
connection.set_isolation_level(ISOLATION_LEVEL_AUTOCOMMIT)
# Create the cursor.
cursor = connection.cursor()
print(connection)
#Q_create_DB = """
# CREATE DATABASE sautidb;
# """
#cursor.execute(sql.SQL("CREATE DATABASE sautidb"))
#cursor.execute(Q_create_DB)
#connection.commit()
cursor.close()
connection.close()
| 22.27451 | 108 | 0.52993 | 106 | 1,136 | 5.471698 | 0.367925 | 0.077586 | 0.103448 | 0.103448 | 0.234483 | 0 | 0 | 0 | 0 | 0 | 0 | 0.004348 | 0.190141 | 1,136 | 50 | 109 | 22.72 | 0.626087 | 0.191021 | 0 | 0 | 0 | 0 | 0.075353 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0.066667 | 0.333333 | 0 | 0.333333 | 0.066667 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 2 |
a6750164341a6a81a43df8546daa14432ce3c4f1 | 6,107 | py | Python | tests/mapping_to_schema_test.py | rtkwlf/esfdw | 09bd0929bd2c55c996d9dccd7e2b7506817284a7 | [
"MIT"
] | 18 | 2016-02-08T01:53:38.000Z | 2020-01-08T02:55:48.000Z | tests/mapping_to_schema_test.py | rtkwlf/esfdw | 09bd0929bd2c55c996d9dccd7e2b7506817284a7 | [
"MIT"
] | 3 | 2016-07-25T11:17:33.000Z | 2019-08-13T15:15:03.000Z | tests/mapping_to_schema_test.py | rtkwlf/esfdw | 09bd0929bd2c55c996d9dccd7e2b7506817284a7 | [
"MIT"
] | 12 | 2016-04-12T14:57:00.000Z | 2019-08-16T10:08:20.000Z | from mock import patch
import unittest
from esfdw.mapping_to_schema import generate_table_spec, generate_schema, TableSpec, ColumnSpec
class TestMappingToSchema(unittest.TestCase):
def test_generate_table_spec(self):
mapping = {
'index1': {
'mappings': {
'_default_': {
'dynamic_templates': {}
},
'doc1': {
'properties': {
'a': {
'index': 'not_analyzed',
'type': 'string',
'doc_values': True
},
'b': {
'properties': {
'c': {
'properties': {
'd': {
'type': 'date',
'format': 'dateOptionalTime'
}
}
},
'e': {
'type': 'boolean'
}
}
},
'f-f': {
'type': 'double'
},
'g': {
'type': 'long'
},
'h': {
'type': 'short'
}
}
},
'doc2': {
'properties': {
'a': {
'type': 'string'
}
}
},
'doc-3': {
'properties': {
'z': {
'type': 'boolean'
}
}
}
}
},
'index2': {
'mappings': {
'doc1': {
'properties': {
'aa': {
'type': 'date'
}
}
}
}
}
}
spec = sorted(list(generate_table_spec(mapping, ['index1'], [
'doc1', 'doc-3'])), key=lambda x: (x.index, x.name))
self.assertEqual(
spec, [
TableSpec(
'doc1', [
ColumnSpec(
'a', 'text'), ColumnSpec(
'f_f', 'double precision'), ColumnSpec(
'b__c__d', 'timestamp'), ColumnSpec(
'b__e', 'boolean'), ColumnSpec(
'g', 'bigint'), ColumnSpec(
'h', 'smallint')], 'doc1', 'index1'), TableSpec(
'doc_3', [
ColumnSpec(
'z', 'boolean')], 'doc-3', 'index1')])
spec = sorted(list(generate_table_spec(mapping, ['index1'], None)),
key=lambda x: (x.index, x.name))
self.assertEqual(spec,
[TableSpec('doc1',
[ColumnSpec('a', 'text'),
ColumnSpec('f_f', 'double precision'),
ColumnSpec('b__c__d', 'timestamp'),
ColumnSpec('b__e', 'boolean'),
ColumnSpec('g', 'bigint'),
ColumnSpec('h', 'smallint')],
'doc1', 'index1'),
TableSpec('doc2', [ColumnSpec('a', 'text')], 'doc2', 'index1'),
TableSpec('doc_3', [ColumnSpec('z', 'boolean')], 'doc-3', 'index1')]
)
spec = sorted(list(generate_table_spec(
mapping, [], ['doc1', 'doc-3'])), key=lambda x: (x.index, x.name))
self.assertEqual(spec,
[TableSpec('doc1',
[ColumnSpec('a', 'text'),
ColumnSpec('f_f', 'double precision'),
ColumnSpec('b__c__d', 'timestamp'),
ColumnSpec('b__e', 'boolean'),
ColumnSpec('g', 'bigint'),
ColumnSpec('h', 'smallint')],
'doc1', 'index1'),
TableSpec('doc_3', [ColumnSpec('z', 'boolean')], 'doc-3', 'index1'),
TableSpec('doc1', [ColumnSpec('aa', 'timestamp')], 'doc1', 'index2')],
)
@patch('esfdw.mapping_to_schema.generate_table_spec')
def test_generate_schema(self, generate_table_spec_mock):
generate_table_spec_mock.return_value = [
TableSpec(
'table1', [
ColumnSpec(
'a', 'text'), ColumnSpec(
'b', 'integer')], 'table1', 'myindex')]
expected_schema = [
"""DROP FOREIGN TABLE IF EXISTS table1;
CREATE FOREIGN TABLE table1 (
a text,
b integer
) SERVER es_srv OPTIONS (
doc_type 'table1',
index 'myindex',
column_name_translation 'true'
);
"""]
schema = list(generate_schema(None, None, None, 'es_srv'))
self.assertEqual(expected_schema, schema)
if __name__ == '__main__':
unittest.main()
| 40.986577 | 99 | 0.304732 | 349 | 6,107 | 5.126075 | 0.246418 | 0.020123 | 0.07602 | 0.055897 | 0.46171 | 0.46171 | 0.46171 | 0.46171 | 0.433762 | 0.433762 | 0 | 0.016047 | 0.581628 | 6,107 | 148 | 100 | 41.263514 | 0.684149 | 0 | 0 | 0.3 | 1 | 0 | 0.128305 | 0.007288 | 0 | 0 | 0 | 0 | 0.030769 | 1 | 0.015385 | false | 0 | 0.023077 | 0 | 0.046154 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
a681b3027488ffc36dc467d8b2de9c530b5de3ee | 9,243 | py | Python | docusign_esign/models/display_appliance_page.py | joekohlsdorf/docusign-esign-python-client | 40407544f79c88716d36fabf36f65c3ef1a5c3ba | [
"MIT"
] | 58 | 2017-10-18T23:06:57.000Z | 2021-04-15T23:14:58.000Z | docusign_esign/models/display_appliance_page.py | joekohlsdorf/docusign-esign-python-client | 40407544f79c88716d36fabf36f65c3ef1a5c3ba | [
"MIT"
] | 49 | 2017-10-27T05:54:09.000Z | 2021-04-29T22:06:17.000Z | docusign_esign/models/display_appliance_page.py | joekohlsdorf/docusign-esign-python-client | 40407544f79c88716d36fabf36f65c3ef1a5c3ba | [
"MIT"
] | 49 | 2017-09-16T07:23:41.000Z | 2021-05-07T20:21:20.000Z | # coding: utf-8
"""
DocuSign REST API
The DocuSign REST API provides you with a powerful, convenient, and simple Web services API for interacting with DocuSign.
OpenAPI spec version: v2.1
Contact: devcenter@docusign.com
Generated by: https://github.com/swagger-api/swagger-codegen.git
"""
from pprint import pformat
from six import iteritems
import re
class DisplayAppliancePage(object):
"""
NOTE: This class is auto generated by the swagger code generator program.
Do not edit the class manually.
"""
def __init__(self, doc_name=None, document_id=None, external_document_id=None, height=None, is_first_page=None, page_id=None, page_no=None, page_status=None, page_type=None, width=None):
"""
DisplayAppliancePage - a model defined in Swagger
:param dict swaggerTypes: The key is attribute name
and the value is attribute type.
:param dict attributeMap: The key is attribute name
and the value is json key in definition.
"""
self.swagger_types = {
'doc_name': 'str',
'document_id': 'str',
'external_document_id': 'str',
'height': 'int',
'is_first_page': 'bool',
'page_id': 'str',
'page_no': 'int',
'page_status': 'str',
'page_type': 'str',
'width': 'int'
}
self.attribute_map = {
'doc_name': 'docName',
'document_id': 'documentId',
'external_document_id': 'externalDocumentId',
'height': 'height',
'is_first_page': 'isFirstPage',
'page_id': 'pageId',
'page_no': 'pageNo',
'page_status': 'pageStatus',
'page_type': 'pageType',
'width': 'width'
}
self._doc_name = doc_name
self._document_id = document_id
self._external_document_id = external_document_id
self._height = height
self._is_first_page = is_first_page
self._page_id = page_id
self._page_no = page_no
self._page_status = page_status
self._page_type = page_type
self._width = width
@property
def doc_name(self):
"""
Gets the doc_name of this DisplayAppliancePage.
:return: The doc_name of this DisplayAppliancePage.
:rtype: str
"""
return self._doc_name
@doc_name.setter
def doc_name(self, doc_name):
"""
Sets the doc_name of this DisplayAppliancePage.
:param doc_name: The doc_name of this DisplayAppliancePage.
:type: str
"""
self._doc_name = doc_name
@property
def document_id(self):
"""
Gets the document_id of this DisplayAppliancePage.
Specifies the document ID number that the tab is placed on. This must refer to an existing Document's ID attribute.
:return: The document_id of this DisplayAppliancePage.
:rtype: str
"""
return self._document_id
@document_id.setter
def document_id(self, document_id):
"""
Sets the document_id of this DisplayAppliancePage.
Specifies the document ID number that the tab is placed on. This must refer to an existing Document's ID attribute.
:param document_id: The document_id of this DisplayAppliancePage.
:type: str
"""
self._document_id = document_id
@property
def external_document_id(self):
"""
Gets the external_document_id of this DisplayAppliancePage.
:return: The external_document_id of this DisplayAppliancePage.
:rtype: str
"""
return self._external_document_id
@external_document_id.setter
def external_document_id(self, external_document_id):
"""
Sets the external_document_id of this DisplayAppliancePage.
:param external_document_id: The external_document_id of this DisplayAppliancePage.
:type: str
"""
self._external_document_id = external_document_id
@property
def height(self):
"""
Gets the height of this DisplayAppliancePage.
Height of the tab in pixels.
:return: The height of this DisplayAppliancePage.
:rtype: int
"""
return self._height
@height.setter
def height(self, height):
"""
Sets the height of this DisplayAppliancePage.
Height of the tab in pixels.
:param height: The height of this DisplayAppliancePage.
:type: int
"""
self._height = height
@property
def is_first_page(self):
"""
Gets the is_first_page of this DisplayAppliancePage.
:return: The is_first_page of this DisplayAppliancePage.
:rtype: bool
"""
return self._is_first_page
@is_first_page.setter
def is_first_page(self, is_first_page):
"""
Sets the is_first_page of this DisplayAppliancePage.
:param is_first_page: The is_first_page of this DisplayAppliancePage.
:type: bool
"""
self._is_first_page = is_first_page
@property
def page_id(self):
"""
Gets the page_id of this DisplayAppliancePage.
:return: The page_id of this DisplayAppliancePage.
:rtype: str
"""
return self._page_id
@page_id.setter
def page_id(self, page_id):
"""
Sets the page_id of this DisplayAppliancePage.
:param page_id: The page_id of this DisplayAppliancePage.
:type: str
"""
self._page_id = page_id
@property
def page_no(self):
"""
Gets the page_no of this DisplayAppliancePage.
:return: The page_no of this DisplayAppliancePage.
:rtype: int
"""
return self._page_no
@page_no.setter
def page_no(self, page_no):
"""
Sets the page_no of this DisplayAppliancePage.
:param page_no: The page_no of this DisplayAppliancePage.
:type: int
"""
self._page_no = page_no
@property
def page_status(self):
"""
Gets the page_status of this DisplayAppliancePage.
:return: The page_status of this DisplayAppliancePage.
:rtype: str
"""
return self._page_status
@page_status.setter
def page_status(self, page_status):
"""
Sets the page_status of this DisplayAppliancePage.
:param page_status: The page_status of this DisplayAppliancePage.
:type: str
"""
self._page_status = page_status
@property
def page_type(self):
"""
Gets the page_type of this DisplayAppliancePage.
:return: The page_type of this DisplayAppliancePage.
:rtype: str
"""
return self._page_type
@page_type.setter
def page_type(self, page_type):
"""
Sets the page_type of this DisplayAppliancePage.
:param page_type: The page_type of this DisplayAppliancePage.
:type: str
"""
self._page_type = page_type
@property
def width(self):
"""
Gets the width of this DisplayAppliancePage.
Width of the tab in pixels.
:return: The width of this DisplayAppliancePage.
:rtype: int
"""
return self._width
@width.setter
def width(self, width):
"""
Sets the width of this DisplayAppliancePage.
Width of the tab in pixels.
:param width: The width of this DisplayAppliancePage.
:type: int
"""
self._width = width
def to_dict(self):
"""
Returns the model properties as a dict
"""
result = {}
for attr, _ in iteritems(self.swagger_types):
value = getattr(self, attr)
if isinstance(value, list):
result[attr] = list(map(
lambda x: x.to_dict() if hasattr(x, "to_dict") else x,
value
))
elif hasattr(value, "to_dict"):
result[attr] = value.to_dict()
elif isinstance(value, dict):
result[attr] = dict(map(
lambda item: (item[0], item[1].to_dict())
if hasattr(item[1], "to_dict") else item,
value.items()
))
else:
result[attr] = value
return result
def to_str(self):
"""
Returns the string representation of the model
"""
return pformat(self.to_dict())
def __repr__(self):
"""
For `print` and `pprint`
"""
return self.to_str()
def __eq__(self, other):
"""
Returns true if both objects are equal
"""
return self.__dict__ == other.__dict__
def __ne__(self, other):
"""
Returns true if both objects are not equal
"""
return not self == other
| 26.484241 | 190 | 0.578384 | 1,041 | 9,243 | 4.90682 | 0.139289 | 0.046985 | 0.203602 | 0.065779 | 0.569303 | 0.481793 | 0.344753 | 0.191073 | 0.129992 | 0.095536 | 0 | 0.000985 | 0.34069 | 9,243 | 348 | 191 | 26.560345 | 0.837217 | 0.393595 | 0 | 0.251969 | 0 | 0 | 0.074865 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.204724 | false | 0 | 0.023622 | 0 | 0.354331 | 0.007874 | 0 | 0 | 0 | null | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
a69dd8c71325c3eedd89f1d5eaff535905421065 | 407 | py | Python | tests/test_conf.py | johnfraney/django-ner-trainer | 38a02a858412eab2d4721659ee33a6e8721199ea | [
"MIT"
] | 6 | 2018-07-26T12:11:21.000Z | 2021-07-14T07:08:55.000Z | tests/test_conf.py | johnfraney/django-ner-trainer | 38a02a858412eab2d4721659ee33a6e8721199ea | [
"MIT"
] | null | null | null | tests/test_conf.py | johnfraney/django-ner-trainer | 38a02a858412eab2d4721659ee33a6e8721199ea | [
"MIT"
] | 4 | 2019-03-31T06:29:53.000Z | 2022-03-18T17:27:33.000Z | from django.test import TestCase
from ner_trainer.conf import settings, DEFAULTS
class SettingsTests(TestCase):
def test_default_settings(self):
for setting_name, default_value in DEFAULTS.items():
self.assertEqual(getattr(settings, setting_name), default_value)
def test_nonexistant_setting(self):
with self.assertRaises(AttributeError):
settings.BANANA
| 29.071429 | 76 | 0.737101 | 47 | 407 | 6.191489 | 0.595745 | 0.04811 | 0.123711 | 0.158076 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.191646 | 407 | 13 | 77 | 31.307692 | 0.884498 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.222222 | 1 | 0.222222 | false | 0 | 0.222222 | 0 | 0.555556 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
a6a512a3f69cae226b737f9acf859287826be0c7 | 1,042 | py | Python | common/helper.py | Acheng-dot/tele-vdo-rider | ad58fab90691425093eac7fb4c8627bf8d706f37 | [
"MIT"
] | 18 | 2020-07-11T15:23:06.000Z | 2021-12-05T17:33:20.000Z | common/helper.py | Acheng-dot/tele-vdo-rider | ad58fab90691425093eac7fb4c8627bf8d706f37 | [
"MIT"
] | 1 | 2021-01-06T13:49:09.000Z | 2021-01-06T13:49:09.000Z | common/helper.py | Acheng-dot/tele-vdo-rider | ad58fab90691425093eac7fb4c8627bf8d706f37 | [
"MIT"
] | 5 | 2020-11-10T05:16:07.000Z | 2022-01-30T02:47:20.000Z | import json
import os
import time
from datetime import datetime
def datetime_from_timestamp(unix_timestamp):
return datetime.fromtimestamp(int(unix_timestamp)).strftime("%Y-%m-%d %H:%M:%S")
def datetime_now():
return datetime_from_timestamp(time.time())
def load_json(file_name):
with open(file_name, "r") as json_file:
return json.loads(json_file.read())
def save_json(file_name, data):
with open(file_name, "w") as json_file:
return json_file.write(json.dumps(data))
def format_size(size):
units = ["B", "KiB", "MiB", "GiB", "TiB", "PiB", "EiB"]
size = float(size)
i = 0
while size >= 1024.0 and i < len(units):
i += 1
size /= 1024.0
return "%.2f %s" % (size, units[i])
def rename_file(old_filename, new_filename):
full_path, filename = os.path.split(old_filename)
filename, extension = os.path.splitext(filename)
temp_filename = os.path.join(full_path, new_filename + extension)
os.rename(old_filename, temp_filename)
return temp_filename
| 25.414634 | 84 | 0.675624 | 154 | 1,042 | 4.383117 | 0.409091 | 0.071111 | 0.062222 | 0.047407 | 0.059259 | 0 | 0 | 0 | 0 | 0 | 0 | 0.015366 | 0.1881 | 1,042 | 40 | 85 | 26.05 | 0.782506 | 0 | 0 | 0 | 0 | 0 | 0.043186 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.214286 | false | 0 | 0.142857 | 0.071429 | 0.571429 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
a6b5eedae0f789b4e35986f3d7c3b2ac5641d294 | 260 | py | Python | hc-sr501/python/pir_gpiozero.py | holsteiner/raspberry-examples | f6f0620aa0b49a304d393953002d2e42062d572f | [
"Unlicense"
] | 3 | 2019-12-09T12:03:24.000Z | 2022-01-10T10:24:48.000Z | hc-sr501/python/pir_gpiozero.py | holsteiner/raspberry-examples | f6f0620aa0b49a304d393953002d2e42062d572f | [
"Unlicense"
] | null | null | null | hc-sr501/python/pir_gpiozero.py | holsteiner/raspberry-examples | f6f0620aa0b49a304d393953002d2e42062d572f | [
"Unlicense"
] | null | null | null | from gpiozero import MotionSensor
PIN_PIR = 23
pir = MotionSensor(PIN_PIR)
try:
while(True):
if(pir.motion_detected):
print("Motion detected.")
else:
print("No motion.")
except KeyboardInterrupt:
print("END")
| 17.333333 | 37 | 0.615385 | 29 | 260 | 5.413793 | 0.655172 | 0.191083 | 0.229299 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.010638 | 0.276923 | 260 | 14 | 38 | 18.571429 | 0.824468 | 0 | 0 | 0 | 0 | 0 | 0.111538 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.090909 | 0 | 0.090909 | 0.272727 | 1 | 0 | 0 | null | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
a6b82ea6bd5bfbb174918e09f8a5800ce1a247d0 | 1,004 | py | Python | CentralBlockML/code/modelBranch.py | DistributedML/Biscotti | dfba71b3924e1bafd2ab2545881fb741193f224e | [
"BSD-2-Clause"
] | 61 | 2019-01-13T22:07:00.000Z | 2022-02-16T16:53:13.000Z | CentralBlockML/code/modelBranch.py | cm20210602/Biscotti | dfba71b3924e1bafd2ab2545881fb741193f224e | [
"BSD-2-Clause"
] | null | null | null | CentralBlockML/code/modelBranch.py | cm20210602/Biscotti | dfba71b3924e1bafd2ab2545881fb741193f224e | [
"BSD-2-Clause"
] | 14 | 2019-05-26T15:11:39.000Z | 2022-03-02T16:10:24.000Z | import numpy as np
import pdb
class ModelBranch:
def __init__(self, initialW, initialGrad):
print("initializing model")
self.chain = [[initialW, initialGrad]]
self.pendingGradients = []
self.gradientHistory = []
def updateModel(self):
### TODO:: Refactor out ###
acc = np.zeros(self.chain[0][0].size)
numPending = len(self.pendingGradients)
for grad in self.pendingGradients:
acc += grad
newGrad = acc / numPending
###
newW = self.chain[-1][0] + newGrad
self.chain.append([newW, newGrad])
### Testing to see if gradients can be linked ###
self.gradientHistory.append(self.pendingGradients[:])
###
self.pendingGradients = []
def getWeights(self):
return self.chain[-1][0]
def getPreviousGrad(self):
return self.chain[-1][1]
def submitGradient(self, grad):
self.pendingGradients.append(grad) | 28.685714 | 61 | 0.582669 | 102 | 1,004 | 5.696078 | 0.460784 | 0.092943 | 0.051635 | 0.037866 | 0.068847 | 0 | 0 | 0 | 0 | 0 | 0 | 0.011331 | 0.296813 | 1,004 | 35 | 62 | 28.685714 | 0.811615 | 0.061753 | 0 | 0.083333 | 0 | 0 | 0.019651 | 0 | 0 | 0 | 0 | 0.028571 | 0 | 1 | 0.208333 | false | 0 | 0.083333 | 0.083333 | 0.416667 | 0.041667 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
a6c2b3e1a16d386e50068125ca75e7e4023faee0 | 383 | py | Python | spax/types.py | jackd/spax | bc55a2660d468838aa1c080d6152d0be73eab118 | [
"Apache-2.0"
] | 1 | 2021-08-11T23:25:15.000Z | 2021-08-11T23:25:15.000Z | spax/types.py | jackd/spax | bc55a2660d468838aa1c080d6152d0be73eab118 | [
"Apache-2.0"
] | null | null | null | spax/types.py | jackd/spax | bc55a2660d468838aa1c080d6152d0be73eab118 | [
"Apache-2.0"
] | null | null | null | import typing as tp
import jax.numpy as jnp
from jax.experimental.sparse.ops import JAXSparse
ArrayFun = tp.Callable[[jnp.ndarray], jnp.ndarray]
ArrayOrFun = tp.Union[ArrayFun, jnp.ndarray, JAXSparse]
class EigenPair(tp.NamedTuple):
"""Result of eigendecomposition, or a single eigenpair."""
w: jnp.ndarray # [...] eigenvalue
v: jnp.ndarray # [N, ...] eigenvector
| 25.533333 | 62 | 0.715405 | 50 | 383 | 5.48 | 0.62 | 0.182482 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.156658 | 383 | 14 | 63 | 27.357143 | 0.848297 | 0.237598 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.375 | 0 | 0.75 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 2 |
a6e755b40f5f2aad0fa2c095df98cd20cd9ab848 | 923 | py | Python | lioght/light_controller/milight_controller.py | Ketouem/lioght | ae016a314653cf547b992b06e5d77e13d8f62afc | [
"MIT"
] | null | null | null | lioght/light_controller/milight_controller.py | Ketouem/lioght | ae016a314653cf547b992b06e5d77e13d8f62afc | [
"MIT"
] | null | null | null | lioght/light_controller/milight_controller.py | Ketouem/lioght | ae016a314653cf547b992b06e5d77e13d8f62afc | [
"MIT"
] | null | null | null | from milight import MiLight, LightBulb, color_from_hex
from . import LightController
class MiLightController(LightController):
VENDOR = "milight"
def __init__(self, host, port, bulbs, *args, **kwargs):
super(MiLightController, self).__init__(*args, **kwargs)
self._milight = MiLight({'host': host, 'port': int(port)},
wait_duration=0)
self._bulbs = LightBulb(bulbs)
def switch_on(self, light_id):
self._milight.send(self._bulbs.on(light_id))
def switch_all_on(self):
self._milight.send(self._bulbs.all_on())
def switch_off(self, light_id):
self._milight.send(self._bulbs.off(light_id))
def switch_all_off(self):
self._milight.send(self._bulbs.all_off())
def change_color(self, light_id, color_code):
self._milight.send(
self._bulbs.color(color_from_hex(color_code), light_id))
| 29.774194 | 68 | 0.658722 | 118 | 923 | 4.79661 | 0.271186 | 0.116608 | 0.132509 | 0.167845 | 0.342756 | 0.233216 | 0.233216 | 0.123675 | 0 | 0 | 0 | 0.001387 | 0.218852 | 923 | 30 | 69 | 30.766667 | 0.783634 | 0 | 0 | 0 | 0 | 0 | 0.016251 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.3 | false | 0 | 0.1 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
a6f63185f940c893daa75531356070515622979e | 2,942 | py | Python | api/service/plugins/azure/servicebus/workspaceDelete.py | KAIYO-OSS/titan | 0a4e296ded466785334279f7106d390c1dd4c30b | [
"Apache-2.0"
] | 55 | 2021-01-27T18:39:39.000Z | 2022-03-16T10:56:46.000Z | api/service/plugins/azure/servicebus/workspaceDelete.py | KAIYO-OSS/titan | 0a4e296ded466785334279f7106d390c1dd4c30b | [
"Apache-2.0"
] | 17 | 2021-06-05T12:28:35.000Z | 2022-02-14T13:11:26.000Z | api/service/plugins/azure/servicebus/workspaceDelete.py | KAIYO-OSS/titan | 0a4e296ded466785334279f7106d390c1dd4c30b | [
"Apache-2.0"
] | null | null | null | # from util.azure import Azure
# import util.mongoUtil as mu
# from util.utilityHelpers import Utils
# from models.enums.workflows import DeleteWorkspace
# from azure.servicebus import Message
# import util.serviceBusUtil as ServiceBusUtil
# import time
# import logging
# logger = logging.getLogger("ODIN")
# class WorkspaceDelete:
# # success-deleteWorkspace
# @staticmethod
# def startSuccessWorkflow(message: Message):
# logger.info(".....success workflow path.....")
# workspaceId = (message.properties.message_id).decode('utf-8')
# workspaceDB = mu.find_by_id("workspace", workspaceId)
# rg = workspaceDB["resourceGroupName"]
# cluster = workspaceDB["clusterName"]
# if (workspaceDB["status"] == str(DeleteWorkspace.Deleted.name)):
# message.complete()
# try:
# if (workspaceDB["status"] == str(DeleteWorkspace.DeleteWorkspaceAccepted.name)):
# mu.updateStatus("workspace", workspaceId, str(DeleteWorkspace.DeletingCluster.name))
# # Azure
# Azure.deleteAKSCluster(rg, cluster)
# mu.updateStatus("workspace", workspaceId, str(DeleteWorkspace.DeletedCluster.name))
# except Exception as ex:
# mu.updateStatus("workspace", workspaceId, str(DeleteWorkspace.ClusterDeleteFailed.name), str(ex), True)
# logger.exception(ex)
# message.complete()
# workspaceDB = mu.find_by_id("workspace", workspaceId)
# try:
# if (workspaceDB["status"] == str(DeleteWorkspace.DeletedCluster.name)):
# mu.updateStatus("workspace", workspaceId, str(DeleteWorkspace.DeletingRG.name))
# # Azure
# Azure.deleteResourceGroup(rg)
# mu.updateStatus("workspace", workspaceId, str(DeleteWorkspace.Deleted.name))
# message.complete()
# except Exception as ex:
# mu.updateStatus("workspace", workspaceId, str(DeleteWorkspace.RGDeleteFailed.name), str(ex), True)
# logger.exception(ex)
# message.complete()
# # api-deleteWorkspace
# @staticmethod
# def startWorkflow(message: Message):
# try:
# logger.info(".....start workflow path.....")
# ServiceBusUtil.azureLogin()
# messageString = str(message.message)
# workspaceId = (message.properties.message_id).decode('utf-8')
# mu.updateStatus("workspace", workspaceId, str(DeleteWorkspace.DeleteWorkspaceAccepted.name))
# message.complete()
# ServiceBusUtil.sendQueueMessage("success-deleteWorkspace", messageString, workspaceId, "str",
# str(DeleteWorkspace.DeletingCluster.name))
# except Exception as ex:
# mu.save("FailedWorkflows", str(message.message))
# logger.exception(ex)
| 43.910448 | 117 | 0.625085 | 250 | 2,942 | 7.332 | 0.288 | 0.10802 | 0.087834 | 0.129842 | 0.476814 | 0.466448 | 0.283688 | 0.177851 | 0.126568 | 0.077469 | 0 | 0.000911 | 0.253909 | 2,942 | 66 | 118 | 44.575758 | 0.834169 | 0.956492 | 0 | null | 0 | null | 0 | 0 | null | 0 | 0 | 0 | null | 1 | null | true | 0 | 0 | null | null | null | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
a6f800761ebf034a378006dfaf9eee9cb5cc9564 | 116 | py | Python | datacatalog/views/challenge_problem_view/__init__.py | SD2E/python-datacatalog | 51ab366639505fb6e8a14cd6b446de37080cd20d | [
"CNRI-Python"
] | null | null | null | datacatalog/views/challenge_problem_view/__init__.py | SD2E/python-datacatalog | 51ab366639505fb6e8a14cd6b446de37080cd20d | [
"CNRI-Python"
] | 2 | 2019-07-25T15:39:04.000Z | 2019-10-21T15:31:46.000Z | datacatalog/views/challenge_problem_view/__init__.py | SD2E/python-datacatalog | 51ab366639505fb6e8a14cd6b446de37080cd20d | [
"CNRI-Python"
] | 1 | 2019-10-15T14:33:44.000Z | 2019-10-15T14:33:44.000Z | AUTHOR = 'vaughn@tacc.utexas.edu'
DESCRIPTION = 'Challenge problems'
# MONGODB_VIEW_NAME = 'challenge_problem_view'
| 29 | 46 | 0.793103 | 14 | 116 | 6.285714 | 0.857143 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.094828 | 116 | 3 | 47 | 38.666667 | 0.838095 | 0.37931 | 0 | 0 | 0 | 0 | 0.571429 | 0.314286 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
4709e851af012d56bb0a970db15a60b6f203c2b8 | 362 | py | Python | stubs/micropython-esp32-1_13-103/uasyncio/event.py | RonaldHiemstra/micropython-stubs | d97f879b01f6687baaebef1c7e26a80909c3cff3 | [
"MIT"
] | 38 | 2020-10-18T21:59:44.000Z | 2022-03-17T03:03:28.000Z | stubs/micropython-esp32-1_13-103/uasyncio/event.py | RonaldHiemstra/micropython-stubs | d97f879b01f6687baaebef1c7e26a80909c3cff3 | [
"MIT"
] | 176 | 2020-10-18T14:31:03.000Z | 2022-03-30T23:22:39.000Z | stubs/micropython-esp32-1_13-103/uasyncio/event.py | RonaldHiemstra/micropython-stubs | d97f879b01f6687baaebef1c7e26a80909c3cff3 | [
"MIT"
] | 6 | 2020-12-28T21:11:12.000Z | 2022-02-06T04:07:50.000Z | """
Module: 'uasyncio.event' on esp32 1.13.0-103
"""
# MCU: (sysname='esp32', nodename='esp32', release='1.13.0', version='v1.13-103-gb137d064e on 2020-10-09', machine='ESP32 module (spiram) with ESP32')
# Stubber: 1.3.4
class Event:
''
def clear():
pass
def is_set():
pass
def set():
pass
wait = None
core = None
| 18.1 | 150 | 0.58011 | 53 | 362 | 3.943396 | 0.641509 | 0.028708 | 0.038278 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.161172 | 0.245856 | 362 | 19 | 151 | 19.052632 | 0.604396 | 0.577348 | 0 | 0.3 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.3 | false | 0.3 | 0 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 2 |
47148bc55fabddc91775039ed711d312eb351276 | 332 | py | Python | backend/sponsor/views.py | AroraShreshth/officialWebsite | 927fec11bbc4c0d64619c597afca6448075ab430 | [
"MIT"
] | null | null | null | backend/sponsor/views.py | AroraShreshth/officialWebsite | 927fec11bbc4c0d64619c597afca6448075ab430 | [
"MIT"
] | null | null | null | backend/sponsor/views.py | AroraShreshth/officialWebsite | 927fec11bbc4c0d64619c597afca6448075ab430 | [
"MIT"
] | null | null | null | from django.shortcuts import render
from . import models
from . import serializers
from rest_framework import viewsets, status, mixins, generics
class SponsorViewSet(viewsets.ModelViewSet):
"""Manage sponsors in the database"""
serializer_class = serializers.SponsorSerializer
queryset = models.Sponsor.objects.all()
| 27.666667 | 61 | 0.786145 | 37 | 332 | 7 | 0.72973 | 0.07722 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.141566 | 332 | 11 | 62 | 30.181818 | 0.908772 | 0.093373 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.571429 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 2 |
47283eb0184e0f7348532493403a71ee00f415d8 | 4,326 | py | Python | test/test_physics.py | aandergr/kspalculator | b9fbe946f297b56ddf681c59480212a522c745b4 | [
"MIT"
] | 25 | 2016-05-25T12:53:03.000Z | 2022-01-30T10:04:52.000Z | test/test_physics.py | aandergr/kspalculator | b9fbe946f297b56ddf681c59480212a522c745b4 | [
"MIT"
] | 17 | 2016-07-21T15:38:58.000Z | 2017-11-13T01:29:03.000Z | test/test_physics.py | aandergr/kspalculator | b9fbe946f297b56ddf681c59480212a522c745b4 | [
"MIT"
] | 11 | 2016-05-28T16:33:18.000Z | 2021-05-06T02:47:21.000Z | # Note that these unit tests are expected to work on both python2 and python3.
# Python 2.7 support.
from __future__ import division
import unittest
import kspalculator.physics as physics
class TestPhysics(unittest.TestCase):
def assertListAlmostEqual(self, first, second):
if len(first) != len(second):
raise self.failureException("List length mismatch")
for i in range(len(first)):
self.assertAlmostEqual(first[i], second[i], places=1)
def test_lf_needed_fuel(self):
m_c = physics.lf_needed_fuel([1750, 580, 310, 792], 4*[345], 1500, 1/8)
self.assertAlmostEqual(m_c, 3378.94, places=1)
m_c = physics.lf_needed_fuel([1750, 580, 310, 792], 3*[345]+[300], 1500, 1/8)
self.assertAlmostEqual(m_c, 3625.64, places=1)
def test_lf_performance(self):
r_dv, r_p, r_a_s, r_a_t, r_m_s, r_m_t, r_solid, r_op = \
physics.lf_performance([1750,580,310,792], 4*[345], 4*[60000], 4*[0], 2005, 5000, 1/8)
self.assertListAlmostEqual(r_dv, [1750, 580, 310, 792, 171.56])
self.assertListEqual(r_p, 5*[0])
self.assertListEqual(r_solid, 5*[False])
self.assertListEqual(r_op, list(range(4))+[3])
self.assertListAlmostEqual(r_a_s, [7.86, 13.19, 15.65, 17.15, 21.68])
self.assertListAlmostEqual(r_a_t, [13.19, 15.65, 17.15, 21.68, 22.81])
self.assertListAlmostEqual(r_m_s, [7630.0, 4548.69, 3832.08, 3496.57, 2766.80])
self.assertListAlmostEqual(r_m_t, [4548.69, 3832.08, 3496.57, 2766.80, 2630.0])
def test_sflf_needed_fuel(self):
m_c = physics.sflf_needed_fuel([2500, 2000], [250, 320], [195,220], 15000, 50, 24000, 4500)
self.assertAlmostEqual(m_c, 104716.64, places=1)
# tests which once failed
m_c = physics.sflf_needed_fuel([2000], [250], [150], 10000, 200, 10000, 2000)
self.assertAlmostEqual(m_c, 10106.61, places=1)
m_c = physics.sflf_needed_fuel([150, 2000], [240, 250], [130, 150], 10000, 200, 10000, 2000)
self.assertAlmostEqual(m_c, 12298.56, places=1)
m_ca = physics.sflf_needed_fuel([2150], [250], [150], 10000, 200, 10000, 2000)
m_cb = physics.sflf_needed_fuel([150, 2000], 2*[250], 2*[150], 10000, 200, 10000, 2000)
self.assertAlmostEqual(m_ca, 11990.20, places=1)
self.assertAlmostEqual(m_cb, 11990.20, places=1)
m_c = physics.sflf_needed_fuel([905, 3650], [260, 284.6], [195, 215.5], 10040, 50, 24000, 4500)
self.assertAlmostEqual(m_c, 63162.60, places=1)
def test_sflf_performance(self):
# pylint:disable=unused-variable
r_dv, r_p, r_a_s, r_a_t, r_m_s, r_m_t, r_solid, r_op = \
physics.sflf_performance([1000, 500], [250, 260], [150, 170],
[0,0], [0,0], [0,0], 10000, 7000, 100, 5000, 1000)
self.assertListAlmostEqual(r_dv, [281.37, 718.62, 500.0, 19.68])
self.assertListAlmostEqual(r_m_s, [22975.0, 17875.0, 13333.60, 10959.29])
self.assertListAlmostEqual(r_m_t, [18975.0, 13333.60, 10959.29, 10875.0])
self.assertListEqual(r_solid, [True, False, False, False])
self.assertListEqual(r_op, [0, 0, 1, 1])
r_dv, r_p, r_a_s, r_a_t, r_m_s, r_m_t, r_solid, r_op = \
physics.sflf_performance([2000], [250], [150], [0], [0], [0],
10000, 11000, 200, 10000, 2000)
self.assertListAlmostEqual(r_dv, [414.54, 1585.45, 73.16])
self.assertListAlmostEqual(r_m_s, [32575.0, 22375.0, 11719.57])
self.assertListAlmostEqual(r_m_t, [24575.0, 11719.57, 11375.0])
self.assertListEqual(r_solid, [True, False, False])
self.assertListEqual(r_op, [0, 0, 0])
r_dv, r_p, r_a_s, r_a_t, r_m_s, r_m_t, r_solid, r_op = \
physics.sflf_performance([100, 900, 500], [250, 250, 260], [150, 150, 170],
[0,0,0], [0,0,0], [0,0,0], 10000, 7000, 100, 5000, 1000)
self.assertListAlmostEqual(r_dv, [100.0, 181.37, 718.62, 500.0, 19.68])
self.assertListAlmostEqual(r_m_s, [22975.0, 21465.04, 17875.0, 13333.60, 10959.29])
self.assertListAlmostEqual(r_m_t, [21465.04, 18975.0, 13333.60, 10959.29, 10875.0])
self.assertListEqual(r_solid, [True, True, False, False, False])
self.assertListEqual(r_op, [0, 1, 1, 2, 2]) | 60.083333 | 103 | 0.627832 | 689 | 4,326 | 3.751814 | 0.261248 | 0.013927 | 0.140812 | 0.013927 | 0.607737 | 0.52882 | 0.468472 | 0.419729 | 0.318375 | 0.254159 | 0 | 0.243227 | 0.214979 | 4,326 | 72 | 104 | 60.083333 | 0.517962 | 0.034905 | 0 | 0.063492 | 0 | 0 | 0.004795 | 0 | 0 | 0 | 0 | 0 | 0.52381 | 1 | 0.079365 | false | 0 | 0.047619 | 0 | 0.142857 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
47292cdadf69360e454f3b4e583993532cf2b6ef | 252 | py | Python | toxpipenv/setup.py | cassiobotaro/Rivendell | dcdb2543e42dea26dc07c9134d65b48f2c99bcc7 | [
"Apache-2.0"
] | 31 | 2018-01-07T21:25:07.000Z | 2021-06-18T13:30:43.000Z | toxpipenv/setup.py | cassiobotaro/Rivendell | dcdb2543e42dea26dc07c9134d65b48f2c99bcc7 | [
"Apache-2.0"
] | 3 | 2018-01-10T12:08:42.000Z | 2020-03-31T01:12:46.000Z | toxpipenv/setup.py | cassiobotaro/Rivendell | dcdb2543e42dea26dc07c9134d65b48f2c99bcc7 | [
"Apache-2.0"
] | 4 | 2018-01-10T02:27:04.000Z | 2019-08-15T19:38:03.000Z | #!/usr/bin/env python
from distutils.core import setup
setup(name='toxpipenv',
version='1.0',
description='Just some tests',
author='Cássio Botaro',
author_email='cassiobotaro@gmail.com',
packages=['toxpipenv'],
)
| 21 | 44 | 0.638889 | 29 | 252 | 5.517241 | 0.896552 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.010101 | 0.214286 | 252 | 11 | 45 | 22.909091 | 0.79798 | 0.079365 | 0 | 0 | 0 | 0 | 0.307359 | 0.095238 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 0.125 | 0 | 0.125 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
5b269a12cf1da5c1475db6d524ff1814e1723b8b | 527 | py | Python | georiviere/watershed/tests/test_models.py | georiviere/Georiviere-admin | 4ac532f84a7a8fef3e01384fad63e8e288d397c0 | [
"BSD-2-Clause"
] | 7 | 2021-11-05T14:52:25.000Z | 2022-03-24T21:18:02.000Z | georiviere/watershed/tests/test_models.py | georiviere/Georiviere-admin | 4ac532f84a7a8fef3e01384fad63e8e288d397c0 | [
"BSD-2-Clause"
] | 57 | 2021-11-02T10:27:34.000Z | 2022-03-31T14:08:32.000Z | georiviere/watershed/tests/test_models.py | georiviere/Georiviere-admin | 4ac532f84a7a8fef3e01384fad63e8e288d397c0 | [
"BSD-2-Clause"
] | 1 | 2021-12-05T14:55:42.000Z | 2021-12-05T14:55:42.000Z | from django.test import TestCase
from georiviere.watershed.tests import factories
class StationTest(TestCase):
@classmethod
def setUpTestData(cls):
cls.watershed_type = factories.WatershedTypeFactory(name="Toto")
cls.watershed = factories.WatershedFactory(name="Tata", watershed_type=cls.watershed_type)
def test_watershed_str(self):
self.assertEqual(str(self.watershed), 'Toto - Tata')
def test_watershed_type_str(self):
self.assertEqual(str(self.watershed_type), 'Toto')
| 29.277778 | 98 | 0.73814 | 61 | 527 | 6.229508 | 0.393443 | 0.171053 | 0.084211 | 0.115789 | 0.2 | 0.2 | 0.2 | 0 | 0 | 0 | 0 | 0 | 0.159393 | 527 | 17 | 99 | 31 | 0.857788 | 0 | 0 | 0 | 0 | 0 | 0.043643 | 0 | 0 | 0 | 0 | 0 | 0.181818 | 1 | 0.272727 | false | 0 | 0.181818 | 0 | 0.545455 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
5b2a83b40e1493899cd575a16c2096c565c8f0d9 | 1,129 | py | Python | restapi/modules/errors.py | haukurk/flask-restapi-recipe | 2bacf0f502fc751f4dbbeddc5bf964f4320fcfe7 | [
"MIT"
] | 63 | 2015-01-01T00:36:11.000Z | 2022-02-17T08:38:29.000Z | restapi/modules/errors.py | haukurk/flask-restapi-recipe | 2bacf0f502fc751f4dbbeddc5bf964f4320fcfe7 | [
"MIT"
] | 4 | 2015-12-10T13:07:45.000Z | 2022-02-02T03:19:43.000Z | restapi/modules/errors.py | haukurk/flask-restapi-recipe | 2bacf0f502fc751f4dbbeddc5bf964f4320fcfe7 | [
"MIT"
] | 17 | 2015-02-02T10:38:19.000Z | 2021-07-31T12:35:36.000Z | __author__ = 'haukurk'
def log_exception(sender, exception, **extra):
"""
Log an exception to our logging framework.
@param sender: sender
@param exception: exception triggered
@**extra: other params.
@return: void
"""
sender.logger.debug('Got exception during processing: %s', exception)
def error_incorrect_version(version):
"""
Return a response when the client is using incorrect API version.
@param version: version in use.
@return: dict
"""
return {"status": "error", "message": "incorrect API version "+str(version)+" used."}
def error_object_not_found():
"""
Return an error response when something is not found, like a object in a database.
@return: dict
"""
return {"status": "error", "message": "object not found"}
def error_commit_error(ex):
"""
Return an error response when database commit fails somehow.
Like when inserting into a database and you get a unique constraint violated.
@return: dict
"""
return {"status": "error", "message": "error when committing object to database", "exception": ex.message} | 29.710526 | 110 | 0.673162 | 140 | 1,129 | 5.342857 | 0.435714 | 0.032086 | 0.064171 | 0.088235 | 0.203209 | 0.136364 | 0 | 0 | 0 | 0 | 0 | 0 | 0.212578 | 1,129 | 38 | 110 | 29.710526 | 0.841395 | 0.444641 | 0 | 0 | 0 | 0 | 0.355932 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.444444 | false | 0 | 0 | 0 | 0.777778 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
5b2c58a438f51931144d7ccc0e9d6335f58b2f35 | 1,715 | py | Python | control.py | rogerwim/pi_globe | 5165f5113c8bd7bc722011b4bf1325f9d39dabc7 | [
"Unlicense"
] | 1 | 2021-08-28T10:19:28.000Z | 2021-08-28T10:19:28.000Z | control.py | rogerwim/pi_globe | 5165f5113c8bd7bc722011b4bf1325f9d39dabc7 | [
"Unlicense"
] | 3 | 2020-07-10T19:42:21.000Z | 2021-03-27T15:52:37.000Z | control.py | rogerwim/pi_globe | 5165f5113c8bd7bc722011b4bf1325f9d39dabc7 | [
"Unlicense"
] | 1 | 2021-03-27T15:46:17.000Z | 2021-03-27T15:46:17.000Z | import serial
steps_per_rev = 1540
arduino = serial.Serial('/dev/ttyUSB1',9600)
def bits_to_byte(bits):
byte = 0
if type(bits) != list:
raise TypeError("type must be list")
if len(bits) != 8:
raise ValueError("you must input 8 bits, no more or less")
for i in range(0,8):
if bits[i] != 1 and bits[i] != 0:
raise TypeError("bits can only be 0 or 1")
byte += bits[i] << i
return bytes([byte])
def send_command(command, data1,data2,data3,data4,data5,data6): # example command [1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0]
command1 = 0
command2 = 0
print(command)
command1 = bits_to_byte(command[0:8])
command2 = bits_to_byte(command[8:])
print(command1,command2)
data_and_command = command1 + command2 + bytes([data1]) + bytes([data2]) + bytes([data3]) + bytes([data4]) + bytes([data5]) + bytes([data6])
print(data_and_command)
arduino.write(data_and_command)
print(arduino.read())
def step_with_home(ang):
steps = (ang/360)*steps_per_rev
print(steps)
steps = int(steps)
print(steps)
data1 = (steps & 65280) >> 8
data2 = (steps & 255) >> 0
print(data1,data2)
send_command([1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0],data1,data2,0,0,0,0)
def step_without_home(ang):
steps = 1+((ang/360)*steps_per_rev)
print(steps)
steps = int(steps)
print(steps)
data1 = (steps & 65280) >> 8
data2 = (steps & 255) >> 0
print(data1,data2)
send_command([0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0],data1,data2,0,0,0,0)
def home():
send_command([0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0],0,0,0,0,0,0)
def servo_goto(ang):
ang = ang + 90
send_command([0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0],0,ang,0,0,0,0)
| 35 | 144 | 0.611079 | 317 | 1,715 | 3.217666 | 0.214511 | 0.162745 | 0.214706 | 0.25098 | 0.335294 | 0.332353 | 0.332353 | 0.332353 | 0.332353 | 0.332353 | 0 | 0.13387 | 0.202915 | 1,715 | 48 | 145 | 35.729167 | 0.61229 | 0.028571 | 0 | 0.25 | 0 | 0 | 0.054087 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.125 | false | 0 | 0.020833 | 0 | 0.166667 | 0.208333 | 0 | 0 | 0 | null | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
5b40cdda39cd66398599ac679f80e1811d7f3475 | 2,059 | py | Python | assignment/if_elif_else/get_next_date.py | arc-arnob/256131 | 645437d7607f186967e0f84c80e6ca976f266622 | [
"Apache-2.0"
] | null | null | null | assignment/if_elif_else/get_next_date.py | arc-arnob/256131 | 645437d7607f186967e0f84c80e6ca976f266622 | [
"Apache-2.0"
] | 1 | 2021-04-17T02:47:03.000Z | 2021-04-17T02:47:03.000Z | assignment/if_elif_else/get_next_date.py | arc-arnob/256131 | 645437d7607f186967e0f84c80e6ca976f266622 | [
"Apache-2.0"
] | null | null | null | import sys
def check_leap_year(year):
if (year % 4) == 0:
if (year % 100) == 0:
if (year % 400) == 0:
return 1
else:
return 0
else:
return 1
else:
return 0
def get_next_date(dd, mm, yy):
if check_leap_year(yy):
if mm == 2:
if dd == 29:
dd = 1
mm += 1
else :
dd += 1
if mm == 12:
mm = 1
yy += 1
print("{0}/{1}/{2}".format(dd,mm,yy))
else:
if dd == 31 or dd == 30:
dd = 1
mm += 1
else:
dd += 1
if mm == 12:
mm = 1
yy += 1
print("{0}/{1}/{2}".format(dd,mm,yy))
else:
if mm == 2:
if dd == 28:
dd = 1
mm += 1
else:
dd += 1
if mm == 12:
mm = 1
yy += 1
print("{0}/{1}/{2}".format(dd,mm,yy))
else:
if dd == 31 or dd == 30:
dd = 1
mm += 1
else:
dd += 1
if mm == 12:
mm = 1
yy += 1
print("{0}/{1}/{2}".format(dd,mm,yy))
def validate_input(dd,mm,yy):
if check_leap_year(yy):
if dd > 29:
print("Invalid day")
sys.exit(0)
else:
if dd > 28:
print("Invalid Date")
sys.exit(0)
if mm > 12:
print("Invalid date")
sys.exit(0)
if mm % 2 == 0 and mm > 30:
print("Invalid Date")
sys.exit(0)
if mm % 2 != 0 and mm > 31:
print("Invalid Date")
sys.exit(0)
dd = int(input("Enter date"))
mm = int(input("Enter month"))
yy = int(input("Enter year"))
validate_input(dd,mm,yy)
get_next_date(dd,mm,yy)
| 22.380435 | 49 | 0.3322 | 248 | 2,059 | 2.709677 | 0.153226 | 0.053571 | 0.071429 | 0.035714 | 0.744048 | 0.622024 | 0.544643 | 0.544643 | 0.502976 | 0.428571 | 0 | 0.091966 | 0.540554 | 2,059 | 91 | 50 | 22.626374 | 0.618393 | 0 | 0 | 0.730769 | 0 | 0 | 0.065112 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.038462 | false | 0 | 0.012821 | 0 | 0.102564 | 0.115385 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
5b494537057de91abdbb4eae43e795439b9c3fbc | 254 | py | Python | SunScanWeather/urls.py | dominiceggerman/SunScan | 0e72ee7e4435fcff25ebbc392b5a5e03b3b2a730 | [
"MIT"
] | null | null | null | SunScanWeather/urls.py | dominiceggerman/SunScan | 0e72ee7e4435fcff25ebbc392b5a5e03b3b2a730 | [
"MIT"
] | null | null | null | SunScanWeather/urls.py | dominiceggerman/SunScan | 0e72ee7e4435fcff25ebbc392b5a5e03b3b2a730 | [
"MIT"
] | null | null | null | from django.urls import path, include
from . import views
urlpatterns = [
path("", views.index, name="index"),
path("removecity", views.removeCity, name="removecity"),
path("removeallcities", views.removeAllCities, name="removeallcities")
]
| 28.222222 | 74 | 0.712598 | 27 | 254 | 6.703704 | 0.444444 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.137795 | 254 | 8 | 75 | 31.75 | 0.826484 | 0 | 0 | 0 | 0 | 0 | 0.216535 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.285714 | 0 | 0.285714 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
5b57436a8e4ed48c0229614b152d036c4f4613ff | 2,929 | py | Python | assignment1/q2_neural.py | bogatyy/cs224d | cfa36b582f681d425ae373baf61a6a1940170c9a | [
"MIT"
] | 254 | 2016-10-11T03:25:04.000Z | 2022-03-20T09:13:38.000Z | assignment1/q2_neural.py | bogatyy/cs224d | cfa36b582f681d425ae373baf61a6a1940170c9a | [
"MIT"
] | 5 | 2017-03-27T09:54:17.000Z | 2020-06-11T10:40:52.000Z | assignment1/q2_neural.py | bogatyy/cs224d | cfa36b582f681d425ae373baf61a6a1940170c9a | [
"MIT"
] | 115 | 2016-10-11T06:41:09.000Z | 2021-10-01T06:16:53.000Z | import numpy as np
import random
from q1_softmax import softmax
from q2_sigmoid import sigmoid, sigmoid_grad
from q2_gradcheck import gradcheck_naive
def forward_backward_prop(data, labels, params, dimensions):
"""
Forward and backward propagation for a two-layer sigmoidal network
Compute the forward propagation and for the cross entropy cost,
and backward propagation for the gradients for all parameters.
"""
### Unpack network parameters (do not modify)
ofs = 0
Dx, H, Dy = (dimensions[0], dimensions[1], dimensions[2])
W1 = np.reshape(params[ofs:ofs+ Dx * H], (Dx, H))
ofs += Dx * H
b1 = np.reshape(params[ofs:ofs + H], (1, H))
ofs += H
W2 = np.reshape(params[ofs:ofs + H * Dy], (H, Dy))
ofs += H * Dy
b2 = np.reshape(params[ofs:ofs + Dy], (1, Dy))
### YOUR CODE HERE: forward propagation
h_per_item = sigmoid(np.dot(data, W1) + b1)
yhat_per_item = softmax(np.dot(h_per_item, W2) + b2)
cost = -np.sum(labels * np.log(yhat_per_item))
### END YOUR CODE
### YOUR CODE HERE: backward propagation
grad_softmax_per_item = yhat_per_item - labels
grad_b2 = np.sum(grad_softmax_per_item, axis=0, keepdims=True)
grad_W2 = np.dot(h_per_item.T, grad_softmax_per_item)
grad_sigmoid_per_item = sigmoid_grad(h_per_item)
grad_b1_per_item = np.dot(grad_softmax_per_item, W2.T) * grad_sigmoid_per_item
grad_b1 = np.sum(grad_b1_per_item, axis=0, keepdims=True)
grad_W1 = np.dot(data.T, grad_b1_per_item)
### END YOUR CODE
assert grad_b2.shape == b2.shape
assert grad_W2.shape == W2.shape
assert grad_b1.shape == b1.shape
assert grad_W1.shape == W1.shape
### Stack gradients (do not modify)
grad = np.concatenate((grad_W1.flatten(), grad_b1.flatten(),
grad_W2.flatten(), grad_b2.flatten()))
return cost, grad
def sanity_check():
"""
Set up fake data and parameters for the neural network, and test using
gradcheck.
"""
print "Running sanity check..."
N = 20
dimensions = [10, 5, 10]
data = np.random.randn(N, dimensions[0]) # each row will be a datum
labels = np.zeros((N, dimensions[2]))
for i in xrange(N):
labels[i,random.randint(0,dimensions[2]-1)] = 1
params = np.random.randn((dimensions[0] + 1) * dimensions[1] + (
dimensions[1] + 1) * dimensions[2], )
gradcheck_naive(lambda params: forward_backward_prop(data, labels, params,
dimensions), params)
def your_sanity_checks():
"""
Use this space add any additional sanity checks by running:
python q2_neural.py
This function will not be called by the autograder, nor will
your additional tests be graded.
"""
print "Running your sanity checks..."
### YOUR CODE HERE
raise NotImplementedError
### END YOUR CODE
if __name__ == "__main__":
sanity_check()
your_sanity_checks()
| 32.910112 | 82 | 0.661659 | 436 | 2,929 | 4.263761 | 0.275229 | 0.060247 | 0.032275 | 0.038731 | 0.15815 | 0.102205 | 0.078537 | 0 | 0 | 0 | 0 | 0.025968 | 0.224309 | 2,929 | 88 | 83 | 33.284091 | 0.792254 | 0.077842 | 0 | 0 | 0 | 0 | 0.027998 | 0 | 0 | 0 | 0 | 0.022727 | 0.08 | 0 | null | null | 0 | 0.1 | null | null | 0.04 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
5b67dff16f4978cd4568cbd1db24a78e7109ac5e | 902 | py | Python | proteus/tests/unit/test_views.py | jrenato7/PROTEuS-Django | ceb776d3a87af8798adf981b380764c79846c0ff | [
"Apache-2.0"
] | null | null | null | proteus/tests/unit/test_views.py | jrenato7/PROTEuS-Django | ceb776d3a87af8798adf981b380764c79846c0ff | [
"Apache-2.0"
] | 2 | 2020-02-12T00:45:11.000Z | 2020-06-05T18:21:49.000Z | proteus/tests/unit/test_views.py | jrenato7/PROTEuS-Django | ceb776d3a87af8798adf981b380764c79846c0ff | [
"Apache-2.0"
] | null | null | null | # coding=utf-8
from django.test import TestCase
from django.urls import reverse
from django.http import HttpResponseNotAllowed
class IndexViewTestCase(TestCase):
def setUp(self):
self.response = self.client.get(reverse("index"))
def test_status_code(self):
self.assertEquals(self.response.status_code, 200)
def test_template_used(self):
self.assertTemplateUsed(self.response, 'index.html')
# def test_form(self):
class ResultViewTestCase(TestCase):
pass
class ProcessViewTestCase(TestCase):
def test_request_wrong_method(self):
response = self.client.post(reverse('process'))
self.assertEquals(response.status_code, 405)
self.assertIsInstance(response, HttpResponseNotAllowed)
def test_right_method(self):
response = self.client.get(reverse('process'))
self.assertEquals(response.status_code, 200) | 25.771429 | 63 | 0.726164 | 104 | 902 | 6.173077 | 0.394231 | 0.093458 | 0.074766 | 0.102804 | 0.291277 | 0.238318 | 0.149533 | 0 | 0 | 0 | 0 | 0.013423 | 0.174058 | 902 | 35 | 64 | 25.771429 | 0.848322 | 0.036585 | 0 | 0 | 0 | 0 | 0.033449 | 0 | 0 | 0 | 0 | 0 | 0.25 | 1 | 0.25 | false | 0.05 | 0.15 | 0 | 0.55 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
5b6b1e2137c411be720db97909446f02e399e8f0 | 2,863 | py | Python | admin/admin.py | N-Harish/multilingual_sentiment_analysis_and_visualization | cc0d506efd1859e58be1e1082884eca0714eb085 | [
"BSD-3-Clause"
] | 1 | 2021-08-08T03:13:06.000Z | 2021-08-08T03:13:06.000Z | admin/admin.py | N-Harish/sentiment_analysis_with_visualization | cc0d506efd1859e58be1e1082884eca0714eb085 | [
"BSD-3-Clause"
] | null | null | null | admin/admin.py | N-Harish/sentiment_analysis_with_visualization | cc0d506efd1859e58be1e1082884eca0714eb085 | [
"BSD-3-Clause"
] | null | null | null | import pyrebase
import re
from validate_email import validate_email
from werkzeug.security import check_password_hash
config = {
"apiKey": <your API key>,
"authDomain": <your auth domain>,
"databaseURL": <your db url>,
"projectId": <your project id>,
"storageBucket": <your storage bucket>,
"messagingSenderId": <your sender id>,
"appId": <your app id>,
"measurementId": <your measurement id>
}
def store(value):
firebase = pyrebase.initialize_app(config)
db = firebase.database()
db.child("Details").push({"Details": value})
def store_feedback(value):
firebase = pyrebase.initialize_app(config)
db = firebase.database()
db.child("Feedback").push({"Details": value})
def ret_feedback():
b = []
c = []
firebase = pyrebase.initialize_app(config)
db = firebase.database()
Details = db.child("Details").get().val()
for key, value in Details.items():
b.append(value)
for i in b:
for x in i.values():
c.append(x)
return c
def ret():
b = []
c = []
firebase = pyrebase.initialize_app(config)
db = firebase.database()
Details = db.child("Details").get().val()
for key, value in Details.items():
b.append(value)
for i in b:
for x in i.values():
c.append(x)
return c
def check(em, pw, c):
count = 0
for i in c:
if i["email"] == em and i["password"] == pw:
count = count + 1
if count >= 1:
return True
else:
return False
# a = ret()
def email_check(em, c1):
c = 0
for i in c1:
if i["email"] == em:
c = c + 1
if c > 0:
return False
else:
return True
# b = ret()
# a = unique("dereckjos12@gmail.com", b)
def email_valid(text):
# s = text
# match = re.search(r'\b[A-Z0-9._%+-]+@[A-Z0-9.-]+\.[A-Z]{2,}\b', s, re.I)
is_valid = validate_email(email_address=text, check_regex=True, check_mx=True,
smtp_timeout=10, dns_timeout=10, use_blacklist=True, debug=False)
return is_valid
def pass_check(t1, t2):
if t1 == t2:
return True
else:
return False
def ret_pass(email):
b = []
c = []
firebase = pyrebase.initialize_app(config)
db = firebase.database()
Details = db.child("Details").get().val()
for key, value in Details.items():
b.append(value)
for i in b:
for x in i.values():
c.append(x)
for i in c:
if i["email"]==email:
return i["password"]
def email_pass(email,pas):
passs = ret_pass(email)
def check2(em, pw, c):
count = 0
for i in c:
if i["email"] == em and check_password_hash(i["password"],pw):
count = count + 1
if count >= 1:
return True
else:
return False
| 21.365672 | 95 | 0.565491 | 392 | 2,863 | 4.056122 | 0.255102 | 0.01761 | 0.026415 | 0.091195 | 0.505031 | 0.489308 | 0.489308 | 0.479874 | 0.479874 | 0.479874 | 0 | 0.013327 | 0.292351 | 2,863 | 133 | 96 | 21.526316 | 0.771471 | 0.0489 | 0 | 0.581633 | 0 | 0 | 0.065538 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0.081633 | 0.040816 | null | null | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 2 |
5b6cd5023f64491731ef3cac021e9dc1aefc1ad9 | 259 | py | Python | Find Number +ve,-ve,zero.py | Ratheshprabakar/Python-Programs | fca9d4f0b5f5f5693b3d7e25c6d890f4973dc19e | [
"MIT"
] | 2 | 2019-07-10T06:32:05.000Z | 2019-11-13T07:52:53.000Z | Find Number +ve,-ve,zero.py | Ratheshprabakar/Python-Programs | fca9d4f0b5f5f5693b3d7e25c6d890f4973dc19e | [
"MIT"
] | null | null | null | Find Number +ve,-ve,zero.py | Ratheshprabakar/Python-Programs | fca9d4f0b5f5f5693b3d7e25c6d890f4973dc19e | [
"MIT"
] | 1 | 2019-10-12T06:56:13.000Z | 2019-10-12T06:56:13.000Z | #To find whether the number is +ve,-ve or 0
x=int(input("Enter a number"))
def check_num(x):
if x>0:
print("The",x,"is positive")
elif x<0:
print("The",x,"is negative")
else:
print("The",x,"is zero")
check_num(x)
| 23.545455 | 44 | 0.548263 | 45 | 259 | 3.111111 | 0.533333 | 0.171429 | 0.192857 | 0.235714 | 0.185714 | 0.185714 | 0 | 0 | 0 | 0 | 0 | 0.016043 | 0.277992 | 259 | 10 | 45 | 25.9 | 0.73262 | 0.162162 | 0 | 0 | 0 | 0 | 0.252427 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.111111 | false | 0 | 0 | 0 | 0.111111 | 0.333333 | 0 | 0 | 0 | null | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
5b75948cb4045c37ba19fd674f1c8316adf94c33 | 281 | py | Python | propensity_matching/config.py | Bhaskers-Blu-Org2/pyspark_propensity_matching | d2f4344dc41132d919e92562f39c2c9bcf1e4288 | [
"MIT"
] | 6 | 2019-12-26T18:39:07.000Z | 2021-04-20T16:16:21.000Z | propensity_matching/config.py | microsoft/pyspark_propensity_matching | d2f4344dc41132d919e92562f39c2c9bcf1e4288 | [
"MIT"
] | null | null | null | propensity_matching/config.py | microsoft/pyspark_propensity_matching | d2f4344dc41132d919e92562f39c2c9bcf1e4288 | [
"MIT"
] | 7 | 2019-11-03T14:53:48.000Z | 2021-09-13T12:51:43.000Z | """Constants for propensity_matching library."""
MINIMUM_DF_COUNT = 4000
MINIMUM_POS_COUNT = 1000
UTIL_BOOST_THRESH_1 = MINIMUM_POS_COUNT
UTIL_BOOST_THRESH_2 = MINIMUM_DF_COUNT
UTIL_BOOST_THRESH_3 = 50000
SAMPLES_PER_FEATURE = 100
SMALL_MATCH_THRESHOLD = 3000**3
| 20.071429 | 49 | 0.790036 | 41 | 281 | 4.878049 | 0.634146 | 0.135 | 0.225 | 0.2 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.10084 | 0.153025 | 281 | 13 | 50 | 21.615385 | 0.739496 | 0.149466 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
5b75d9adbd56ad7350aa6ee1d4498688a1b4b652 | 242 | py | Python | workflow/scripts/make_conference_schedule.py | euronion/snakemake-demo | 69b3f764249c09c7028c9545ceb2900b6ee56754 | [
"MIT"
] | null | null | null | workflow/scripts/make_conference_schedule.py | euronion/snakemake-demo | 69b3f764249c09c7028c9545ceb2900b6ee56754 | [
"MIT"
] | null | null | null | workflow/scripts/make_conference_schedule.py | euronion/snakemake-demo | 69b3f764249c09c7028c9545ceb2900b6ee56754 | [
"MIT"
] | null | null | null | import pandas as pd
tickets = pd.read_csv(snakemake.input["tickets"])
conferences = pd.read_csv(snakemake.input["conferences"])
schedule = conferences[conferences["City"].isin(tickets["city"])]
schedule.to_csv(snakemake.output["schedule"]) | 30.25 | 65 | 0.768595 | 31 | 242 | 5.903226 | 0.483871 | 0.196721 | 0.098361 | 0.196721 | 0.251366 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.066116 | 242 | 8 | 66 | 30.25 | 0.809735 | 0 | 0 | 0 | 0 | 0 | 0.139918 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.2 | 0 | 0.2 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
5b7abef1904b9dc318b62b0507bed4d169716ad1 | 1,587 | py | Python | brawlstats/errors.py | bananaboy21/brawlstats | 2c56bb40ba054ee5000bc7a21d1ed1a1779d1ad1 | [
"MIT"
] | null | null | null | brawlstats/errors.py | bananaboy21/brawlstats | 2c56bb40ba054ee5000bc7a21d1ed1a1779d1ad1 | [
"MIT"
] | null | null | null | brawlstats/errors.py | bananaboy21/brawlstats | 2c56bb40ba054ee5000bc7a21d1ed1a1779d1ad1 | [
"MIT"
] | null | null | null | class RequestError(Exception):
"""The base class for all errors."""
def __init__(self, code, error, retry_after=None):
pass
class Unauthorized(RequestError):
"""Raised if your API Key is invalid or blocked."""
def __init__(self, url, code):
self.code = code
self.error = 'Your API Key is invalid or blocked.\nURL: ' + url
super().__init__(self.code, self.error)
class NotFoundError(RequestError):
"""Raised if an invalid player tag or club tag has been passed."""
def __init__(self, url, code):
self.code = code
self.error = 'An incorrect tag has been passed.\nURL: ' + url
super().__init__(self.code, self.error)
class RateLimitError(RequestError):
"""Raised when the rate limit is reached."""
def __init__(self, url, code, retry_after):
self.code = code
self.retry_after = retry_after
self.error = 'The rate limit has been reached.\nURL: ' + url
super().__init__(self.code, self.error, retry_after=self.retry_after)
class UnexpectedError(RequestError):
"""Raised if an unknown error has occured."""
def __init__(self, url, code):
self.code = code
self.error = 'An unexpected error has occured.\nURL: ' + url
super().__init__(self.code, self.error)
class ServerError(RequestError):
"""Raised if the API is down."""
def __init__(self, url, code):
self.code = code
self.error = 'The API is down. Please be patient and try again later.\nURL: ' + url
super().__init__(self.code, self.error)
| 31.117647 | 91 | 0.645243 | 211 | 1,587 | 4.616114 | 0.270142 | 0.11499 | 0.120123 | 0.071869 | 0.425051 | 0.406571 | 0.406571 | 0.349076 | 0.281314 | 0.164271 | 0 | 0 | 0.235665 | 1,587 | 50 | 92 | 31.74 | 0.802968 | 0.153119 | 0 | 0.448276 | 0 | 0 | 0.169078 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.206897 | false | 0.068966 | 0 | 0 | 0.413793 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 2 |
5b88360c7f8fc0c85130b58c84ad5979e666c05d | 2,412 | py | Python | src/testoob/reporting/color_support.py | sshyran/testoob | 729fa6a17660d0bd8c75907a89ed6998180b5765 | [
"Apache-2.0"
] | null | null | null | src/testoob/reporting/color_support.py | sshyran/testoob | 729fa6a17660d0bd8c75907a89ed6998180b5765 | [
"Apache-2.0"
] | null | null | null | src/testoob/reporting/color_support.py | sshyran/testoob | 729fa6a17660d0bd8c75907a89ed6998180b5765 | [
"Apache-2.0"
] | null | null | null | # Testoob, Python Testing Out Of (The) Box
# Copyright (C) 2005-2009 The Testoob Team
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
import sys, os
DISABLE_COLOR_SUPPORT_ENV_VAR_NAME = "TESTOOB_DISABLE_COLOR_SUPPORT"
def can_autodetect_color_support():
# On Windows, we can only autodetect if ctypes is available
if sys.platform.startswith("win"):
try:
import ctypes
return True
except ImportError:
return False
# On POSIX, autodetection is strong enough to consider it always working
return True
def auto_color_support(stream):
if sys.platform.startswith("win"):
try:
import ctypes
return _win_ctypes_color_support()
except ImportError:
pass
# TODO: use win32console if available, and add support to setcolor.exe
# as a final fallback
# Check if explicitly disabled via environment
if DISABLE_COLOR_SUPPORT_ENV_VAR_NAME in os.environ:
return False
# 'True' by default on Windows, because we can currently only
# autodetect if ctypes is available
return True
return _curses_color_support(stream)
def _win_ctypes_color_support():
import ctypes
STD_OUTPUT_HANDLE = -11
out_handle = ctypes.windll.kernel32.GetStdHandle(STD_OUTPUT_HANDLE)
csbi = ctypes.create_string_buffer(22)
res = ctypes.windll.kernel32.GetConsoleScreenBufferInfo(out_handle, csbi)
return res != 0
def _curses_color_support(stream):
if not hasattr(stream, "isatty"):
return False
if not stream.isatty():
return False # auto color only on TTYs
try:
import curses
curses.setupterm()
return curses.tigetnum("colors") > 2
except:
# guess false in case of error
return False
| 32.594595 | 79 | 0.671227 | 310 | 2,412 | 5.093548 | 0.470968 | 0.068398 | 0.036099 | 0.020266 | 0.138062 | 0.138062 | 0.059531 | 0.059531 | 0.059531 | 0 | 0 | 0.013621 | 0.269486 | 2,412 | 73 | 80 | 33.041096 | 0.88252 | 0.419983 | 0 | 0.461538 | 0 | 0 | 0.036126 | 0.022291 | 0 | 0 | 0 | 0.013699 | 0 | 1 | 0.102564 | false | 0.025641 | 0.179487 | 0 | 0.589744 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
5b9fe345789a2a5ba67330f61126fed2eb766621 | 270 | py | Python | tests/units/config/stubs/database.py | LaravelPython/framework | 35bb64816731b360e2296dccbbb8523352190d23 | [
"MIT"
] | 1 | 2019-10-18T05:31:40.000Z | 2019-10-18T05:31:40.000Z | tests/units/config/stubs/database.py | LaravelPython/framework | 35bb64816731b360e2296dccbbb8523352190d23 | [
"MIT"
] | null | null | null | tests/units/config/stubs/database.py | LaravelPython/framework | 35bb64816731b360e2296dccbbb8523352190d23 | [
"MIT"
] | null | null | null | database = {
'default': 'mysql',
'connections': {
'mysql': {
'name': 'mytodo',
'username': 'root',
'password': '',
'connection': 'mysql:host=127.0.0.1',
},
},
'migrations': 'migrations',
}
| 19.285714 | 49 | 0.411111 | 19 | 270 | 5.842105 | 0.789474 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.035928 | 0.381481 | 270 | 13 | 50 | 20.769231 | 0.628743 | 0 | 0 | 0 | 0 | 0 | 0.4 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0.083333 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 2 |
5ba6b920112aebe515f725bea8be51da82e74de3 | 88 | py | Python | sanic-user/__init__.py | monobot/sanic-user | 33c45cf47c6cbb1743e56df9ea421800a8318daa | [
"MIT"
] | null | null | null | sanic-user/__init__.py | monobot/sanic-user | 33c45cf47c6cbb1743e56df9ea421800a8318daa | [
"MIT"
] | null | null | null | sanic-user/__init__.py | monobot/sanic-user | 33c45cf47c6cbb1743e56df9ea421800a8318daa | [
"MIT"
] | null | null | null | __author__ = 'Héctor Alvarez'
__email__ = 'monobot.soft@gmail.com'
__version__ = '0.0.1' | 29.333333 | 36 | 0.738636 | 12 | 88 | 4.416667 | 0.916667 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.037975 | 0.102273 | 88 | 3 | 37 | 29.333333 | 0.632911 | 0 | 0 | 0 | 0 | 0 | 0.460674 | 0.247191 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
5ba7560f6e15138ca0bad58798bbc2aeae27b265 | 8,711 | py | Python | examples/conv_gru_skip_connection.py | KingMV/ConvGRU | c458024d5c379ef990f72b6f6b738301e1895cff | [
"MIT"
] | 18 | 2018-07-24T16:45:10.000Z | 2022-02-11T01:50:34.000Z | examples/conv_gru_skip_connection.py | coderclear/ConvGRU | c458024d5c379ef990f72b6f6b738301e1895cff | [
"MIT"
] | null | null | null | examples/conv_gru_skip_connection.py | coderclear/ConvGRU | c458024d5c379ef990f72b6f6b738301e1895cff | [
"MIT"
] | 4 | 2018-05-26T07:15:22.000Z | 2019-07-18T10:03:40.000Z | """ This script demonstrates the use of a convolutional GRU network.
This network is used to predict the next frame of an artificially
generated movie which contains moving squares.
"""
import os
import h5py
from keras.models import Model, Sequential, load_model
from keras import backend as K
import keras.layers as layers
from keras.layers import Input
from keras.layers import Bidirectional
from keras.layers.convolutional import Conv3D
from keras.layers.convolutional_recurrent import ConvGRU2D
from keras.layers.normalization import BatchNormalization
from keras.utils import plot_model
import numpy as np
import matplotlib
matplotlib.use('Agg')
import matplotlib.pyplot as plt
#import pylab as plt
def identity_block(input_tensor, kernel_size, filters, stage, block):
"""The identity block is the block that has no ConvGRU layer at shortcut.
# Arguments
input_tensor: input tensor
kernel_size: default 3, the kernel size of middle conv layer at main path
filters: list of integers, the filters of 3 ConvGRU layer at main path
stage: integer, current stage label, used for generating layer names
block: 'a','b'..., current block label, used for generating layer names
# Returns
Output tensor for the block.
"""
filters1, filters2, filters3 = filters
if K.image_data_format() == 'channels_last':
bn_axis = 3
else:
bn_axis = 1
conv_name_base = 'res' + str(stage) + block + '_branch'
bn_name_base = 'bn' + str(stage) + block + '_branch'
x = ConvGRU2D(filters1, (1, 1), padding='same', return_sequences=True, name=conv_name_base + '2a')(input_tensor)
x = BatchNormalization(axis=bn_axis, name=bn_name_base + '2a')(x)
#x = Activation('relu')(x)
x = ConvGRU2D(filters2, kernel_size, padding='same', return_sequences=True, name=conv_name_base + '2b')(x)
x = BatchNormalization(axis=bn_axis, name=bn_name_base + '2b')(x)
#x = Activation('relu')(x)
x = ConvGRU2D(filters2,(1, 1), padding='same', return_sequences=True, name=conv_name_base + '2c')(x)
x = BatchNormalization(axis=bn_axis, name=bn_name_base + '2c')(x)
x = layers.add([x, input_tensor])
#x = Activation('relu')(x)
return x
def conv_block(input_tensor, kernel_size, filters, stage, block, strides=(2, 2)):
"""A block that has a conv layer at shortcut.
# Arguments
input_tensor: input tensor
kernel_size: default 3, the kernel size of middle conv layer at main path
filters: list of integers, the filters of 3 conv layer at main path
stage: integer, current stage label, used for generating layer names
block: 'a','b'..., current block label, used for generating layer names
# Returns
Output tensor for the block.
Note that from stage 3, the first conv layer at main path is with strides=(2,2)
And the shortcut should have strides=(2,2) as well
"""
filters1, filters2, filters3 = filters
if K.image_data_format() == 'channels_last':
bn_axis = 3
else:
bn_axis = 1
conv_name_base = 'res' + str(stage) + block + '_branch'
bn_name_base = 'bn' + str(stage) + block + '_branch'
x = ConvGRU2D(filters1, (1, 1), strides=strides, padding='same', return_sequences=True, name=conv_name_base + '2a')(input_tensor)
x = BatchNormalization(axis=bn_axis, name=bn_name_base + '2a')(x)
#x = Activation('relu')(x)
x = ConvGRU2D(filters2, kernel_size, padding='same', return_sequences=True, name=conv_name_base + '2b')(x)
x = BatchNormalization(axis=bn_axis, name=bn_name_base + '2b')(x)
#x = Activation('relu')(x)
x = ConvGRU2D(filters3, (1, 1), padding='same', return_sequences=True, name=conv_name_base + '2c')(x)
x = BatchNormalization(axis=bn_axis, name=bn_name_base + '2c')(x)
shortcut = ConvGRU2D(filters3, (1, 1), strides=strides, padding='same', return_sequences=True, name=conv_name_base + '1')(input_tensor)
shortcut = BatchNormalization(axis=bn_axis, name=bn_name_base + '1')(shortcut)
x = layers.add([x, shortcut])
#x = Activation('relu')(x)
return x
# Generate movies with 3 to 7 moving squares inside.
# The squares are of shape 1x1 or 2x2 pixels,
# which move linearly over time.
# For convenience we first create movies with bigger width and height (80x80)
# and at the end we select a 40x40 window.
def generate_movies(n_samples=1200, n_frames=15):
row = 80
col = 80
noisy_movies = np.zeros((n_samples, n_frames, row, col, 1), dtype=np.float)
shifted_movies = np.zeros((n_samples, n_frames, row, col, 1),
dtype=np.float)
np.random.seed(0)
for i in range(n_samples):
# Add 3 to 7 moving squares
n = np.random.randint(3, 8)
for j in range(n):
# Initial position
xstart = np.random.randint(20, 60)
ystart = np.random.randint(20, 60)
# Direction of motion
directionx = np.random.randint(0, 3) - 1
directiony = np.random.randint(0, 3) - 1
# Size of the square
w = np.random.randint(2, 4)
for t in range(n_frames):
x_shift = xstart + directionx * t
y_shift = ystart + directiony * t
noisy_movies[i, t, x_shift - w: x_shift + w,
y_shift - w: y_shift + w, 0] += 1
# Make it more robust by adding noise.
# The idea is that if during inference,
# the value of the pixel is not exactly one,
# we need to train the network to be robust and still
# consider it as a pixel belonging to a square.
if np.random.randint(0, 2):
noise_f = (-1)**np.random.randint(0, 2)
noisy_movies[i, t,
x_shift - w - 1: x_shift + w + 1,
y_shift - w - 1: y_shift + w + 1,
0] += noise_f * 0.1
# Shift the ground truth by 1
x_shift = xstart + directionx * (t + 1)
y_shift = ystart + directiony * (t + 1)
shifted_movies[i, t, x_shift - w: x_shift + w,
y_shift - w: y_shift + w, 0] += 1
# Cut to a 40x40 window
noisy_movies = noisy_movies[::, ::, 20:60, 20:60, ::]
shifted_movies = shifted_movies[::, ::, 20:60, 20:60, ::]
noisy_movies[noisy_movies >= 1] = 1
shifted_movies[shifted_movies >= 1] = 1
return noisy_movies, shifted_movies
# Create a data set
noisy_movies, shifted_movies = generate_movies(n_samples=1200)
# Load a trained model if exists or train a model otherwise
modelPath = os.getcwd() + '/conv_gru_model_skip_connection.h5'
if os.path.isfile(modelPath):
print "Loading Model located at: " + modelPath
model = load_model(modelPath)
model.summary()
else:
# We create a layer which take as input movies of shape
# (n_frames, width, height, channels) and returns a movie
# of identical shape.
inputs = Input(shape=(None, 40, 40, 1))
x = identity_block(inputs, 3, [40, 40, 40], stage=1, block='a')
x = identity_block(x, 3, [40, 40, 40], stage=1, block='b')
x = Conv3D(filters=1, kernel_size=(3, 3, 3), activation='sigmoid', padding='same', data_format='channels_last')(x)
model = Model(inputs, x, name='ConvGRU_skip_connection')
model.compile(loss='binary_crossentropy', optimizer='adadelta')
# Train the network
model.fit(noisy_movies[:1000], shifted_movies[:1000], batch_size=10, epochs=300, validation_split=0.05)
#Save the model
model.save(modelPath)
# Testing the network on one movie
# feed it with the first 7 positions and then
# predict the new positions
which = 1017
track = noisy_movies[which][:7, ::, ::, ::]
for j in range(16):
new_pos = model.predict(track[np.newaxis, ::, ::, ::, ::])
new = new_pos[::, -1, ::, ::, ::]
track = np.concatenate((track, new), axis=0)
# And then compare the predictions
# to the ground truth
track2 = noisy_movies[which][::, ::, ::, ::]
for i in range(15):
fig = plt.figure(figsize=(10, 5))
ax = fig.add_subplot(121)
if i >= 7:
ax.text(1, 3, 'Predictions !', fontsize=20, color='w')
else:
ax.text(1, 3, 'Initial trajectory', fontsize=20)
toplot = track[i, ::, ::, 0]
plt.imshow(toplot)
ax = fig.add_subplot(122)
plt.text(1, 3, 'Ground truth', fontsize=20)
toplot = track2[i, ::, ::, 0]
if i >= 2:
toplot = shifted_movies[which][i - 1, ::, ::, 0]
plt.imshow(toplot)
plt.savefig('%s/%i_animate.png' % (os.getcwd(), (i + 1)))
| 37.873913 | 139 | 0.63173 | 1,250 | 8,711 | 4.2784 | 0.2256 | 0.026926 | 0.020194 | 0.034031 | 0.465969 | 0.409499 | 0.394166 | 0.378459 | 0.353029 | 0.353029 | 0 | 0.036845 | 0.24911 | 8,711 | 229 | 140 | 38.039301 | 0.780767 | 0.132476 | 0 | 0.245902 | 1 | 0 | 0.051117 | 0.009163 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.114754 | null | null | 0.008197 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
5ba851427ee34f21ace977a62d19131fba86a196 | 322 | py | Python | src/utils/creds.py | Ritacheta/CryptoTradingBot | 5c3292f9a11e4fe81f7f5efba0192b6a18ebe8b3 | [
"MIT"
] | 2 | 2021-06-16T06:56:22.000Z | 2021-06-17T12:47:55.000Z | src/utils/creds.py | Ritacheta/CryptoTradingBot | 5c3292f9a11e4fe81f7f5efba0192b6a18ebe8b3 | [
"MIT"
] | null | null | null | src/utils/creds.py | Ritacheta/CryptoTradingBot | 5c3292f9a11e4fe81f7f5efba0192b6a18ebe8b3 | [
"MIT"
] | null | null | null | import json
import os
from . import _dirpath
def get_credentials() -> dict:
"""
Get the credentials from Data/credentials.json
Returns:
dict -> key, secret
"""
with open(os.path.join(_dirpath, "..", "..", "Data", "credentials.json")) as jsonf:
creds = json.load(jsonf)
return creds
| 18.941176 | 87 | 0.618012 | 39 | 322 | 5.025641 | 0.589744 | 0.153061 | 0.193878 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.23913 | 322 | 16 | 88 | 20.125 | 0.8 | 0.236025 | 0 | 0 | 0 | 0 | 0.108108 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.142857 | false | 0 | 0.428571 | 0 | 0.714286 | 0 | 0 | 0 | 0 | null | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 2 |
5bc651982d3151997349d1f1940b747f351d2eff | 510 | py | Python | tfmap.py | markliou/TF_EVO_Opt | 1ae3c1a57b540d245fa04d34f925878ddfd232f5 | [
"MIT"
] | 1 | 2021-08-24T16:11:17.000Z | 2021-08-24T16:11:17.000Z | tfmap.py | markliou/TF_EVO_Opt | 1ae3c1a57b540d245fa04d34f925878ddfd232f5 | [
"MIT"
] | null | null | null | tfmap.py | markliou/TF_EVO_Opt | 1ae3c1a57b540d245fa04d34f925878ddfd232f5 | [
"MIT"
] | null | null | null | import tensorflow as tf
import numpy as np
def sample_nn():
Input = tf.keras.Input([3])
fc1 = tf.keras.layers.Dense(3)(Input)
fc2 = tf.keras.layers.Dense(2)(fc1)
out = tf.keras.layers.Dense(1)(fc2)
return tf.keras.Model(inputs=Input, outputs=out)
def assignWeights(nn, wights):
pass
nn = sample_nn()
print(nn(np.random.random([2,3])))
flated_weights = tf.Variable(tf.concat([tf.reshape(weights, [-1]) for weights in nn], axis=-1))
pop['weights'] =
print(nn.trainable_weights)
| 21.25 | 95 | 0.676471 | 82 | 510 | 4.158537 | 0.463415 | 0.102639 | 0.11437 | 0.158358 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.027842 | 0.154902 | 510 | 23 | 96 | 22.173913 | 0.763341 | 0 | 0 | 0 | 0 | 0 | 0.013725 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0.066667 | 0.133333 | null | null | 0.133333 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 2 |
5bcf60f80103df51d66c3bbb77a4d18ca7d99cd3 | 375 | py | Python | h2o-py/tests/testdir_misc/pyunit_hist.py | kyoren/https-github.com-h2oai-h2o-3 | 77b27109c84c4739f9f1b7a3078f8992beefc813 | [
"Apache-2.0"
] | 1 | 2016-09-30T05:58:18.000Z | 2016-09-30T05:58:18.000Z | h2o-py/tests/testdir_misc/pyunit_hist.py | kyoren/https-github.com-h2oai-h2o-3 | 77b27109c84c4739f9f1b7a3078f8992beefc813 | [
"Apache-2.0"
] | null | null | null | h2o-py/tests/testdir_misc/pyunit_hist.py | kyoren/https-github.com-h2oai-h2o-3 | 77b27109c84c4739f9f1b7a3078f8992beefc813 | [
"Apache-2.0"
] | null | null | null | import sys
sys.path.insert(1, "../../")
import h2o, tests
def hist_test():
kwargs = {}
kwargs['server'] = True
print "Import small prostate dataset"
hex = h2o.import_file(tests.locate("smalldata/logreg/prostate.csv"))
hex["AGE"].hist(**kwargs)
hex["VOL"].hist(**kwargs)
if __name__ == "__main__":
tests.run_test(sys.argv, hist_test)
| 19.736842 | 72 | 0.626667 | 49 | 375 | 4.55102 | 0.612245 | 0.071749 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.009934 | 0.194667 | 375 | 18 | 73 | 20.833333 | 0.728477 | 0 | 0 | 0 | 0 | 0 | 0.224 | 0.077333 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.333333 | null | null | 0.083333 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 2 |
5bcf71d66ca3ff94d6f4bd04fb470429a03dc482 | 412 | py | Python | external/anomaly/ote_anomalib/exportable_code/__init__.py | bes-dev/training_extensions | 7b016e3bd02ae7c74d60fd5a0ae0912a42ef87cb | [
"Apache-2.0"
] | 775 | 2019-03-01T02:13:33.000Z | 2020-09-07T22:49:15.000Z | external/anomaly/ote_anomalib/exportable_code/__init__.py | bes-dev/training_extensions | 7b016e3bd02ae7c74d60fd5a0ae0912a42ef87cb | [
"Apache-2.0"
] | 229 | 2019-02-28T21:37:08.000Z | 2020-09-07T15:11:49.000Z | external/anomaly/ote_anomalib/exportable_code/__init__.py | bes-dev/training_extensions | 7b016e3bd02ae7c74d60fd5a0ae0912a42ef87cb | [
"Apache-2.0"
] | 290 | 2019-02-28T20:32:11.000Z | 2020-09-07T05:51:41.000Z | """Exportable code for Anomaly tasks."""
# Copyright (C) 2021-2022 Intel Corporation
# SPDX-License-Identifier: Apache-2.0
#
from .anomaly_classification import AnomalyClassification
from .anomaly_detection import AnomalyDetection
from .anomaly_segmentation import AnomalySegmentation
from .base import AnomalyBase
__all__ = ["AnomalyBase", "AnomalyClassification", "AnomalyDetection", "AnomalySegmentation"]
| 31.692308 | 93 | 0.815534 | 41 | 412 | 8.02439 | 0.682927 | 0.100304 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.026882 | 0.097087 | 412 | 12 | 94 | 34.333333 | 0.857527 | 0.274272 | 0 | 0 | 0 | 0 | 0.230241 | 0.072165 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.8 | 0 | 0.8 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 2 |
750f86b184af6304e920d8f7a0a3878a57a60ab3 | 872 | py | Python | annotation/management/commands/annotate_unannotated_variants.py | SACGF/variantgrid | 515195e2f03a0da3a3e5f2919d8e0431babfd9c9 | [
"RSA-MD"
] | 5 | 2021-01-14T03:34:42.000Z | 2022-03-07T15:34:18.000Z | annotation/management/commands/annotate_unannotated_variants.py | SACGF/variantgrid | 515195e2f03a0da3a3e5f2919d8e0431babfd9c9 | [
"RSA-MD"
] | 551 | 2020-10-19T00:02:38.000Z | 2022-03-30T02:18:22.000Z | annotation/management/commands/annotate_unannotated_variants.py | SACGF/variantgrid | 515195e2f03a0da3a3e5f2919d8e0431babfd9c9 | [
"RSA-MD"
] | null | null | null | #!/usr/bin/env python3
import logging
from django.core.management.base import BaseCommand
from django.db.utils import DatabaseError
from annotation.annotation_versions import get_variant_annotation_version
from annotation.tasks.annotation_scheduler_task import annotation_scheduler
from snpdb.models.models_genome import GenomeBuild
class Command(BaseCommand):
def handle(self, *args, **options):
logging.info("Checking/Creating VariantAnnotationVersion...")
for genome_build in GenomeBuild.builds_with_annotation():
vav = get_variant_annotation_version(genome_build)
try:
# Some upgrade migrations caused partitions to be deleted
vav.create_partition()
except DatabaseError:
pass
logging.info("Scheduling annotation...")
annotation_scheduler()
| 32.296296 | 75 | 0.723624 | 93 | 872 | 6.602151 | 0.623656 | 0.092834 | 0.065147 | 0.087948 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.001451 | 0.209862 | 872 | 26 | 76 | 33.538462 | 0.889695 | 0.088303 | 0 | 0 | 0 | 0 | 0.087011 | 0.034048 | 0 | 0 | 0 | 0 | 0 | 1 | 0.058824 | false | 0.058824 | 0.352941 | 0 | 0.470588 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 2 |
751048a053e0f5f9123e31d97a317aa13be09dcf | 406 | py | Python | models/registry.py | justincosentino/robust-sparse-networks | 2445b1c7e562031ce6ee8787ff1505d574a4e7bd | [
"MIT"
] | 12 | 2019-11-14T07:41:20.000Z | 2022-02-02T02:51:16.000Z | models/registry.py | justincosentino/robust-sparse-networks | 2445b1c7e562031ce6ee8787ff1505d574a4e7bd | [
"MIT"
] | 5 | 2020-01-28T23:13:33.000Z | 2022-02-10T02:00:24.000Z | models/registry.py | justincosentino/robust-sparse-networks | 2445b1c7e562031ce6ee8787ff1505d574a4e7bd | [
"MIT"
] | 2 | 2019-12-07T06:18:45.000Z | 2020-11-23T16:22:35.000Z | """Basic registry for model builders."""
BUILDERS = dict()
def register(name):
"""Registers a new model builder function under the given model name."""
def add_to_dict(func):
BUILDERS[name] = func
return func
return add_to_dict
def get_builder(model_name):
"""Fetches the model builder function associated with the given model name"""
return BUILDERS[model_name]
| 21.368421 | 81 | 0.692118 | 55 | 406 | 4.981818 | 0.454545 | 0.131387 | 0.145985 | 0.124088 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.216749 | 406 | 18 | 82 | 22.555556 | 0.861635 | 0.426108 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.375 | false | 0 | 0 | 0 | 0.75 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
7510b2c66316d2165caef1e918de647e425f8fe5 | 428 | py | Python | userprofile/utils.py | praekelt/django-userprofile | 09e2e08982ffa9fb7e96c715138a0e5537759cd9 | [
"BSD-3-Clause"
] | null | null | null | userprofile/utils.py | praekelt/django-userprofile | 09e2e08982ffa9fb7e96c715138a0e5537759cd9 | [
"BSD-3-Clause"
] | null | null | null | userprofile/utils.py | praekelt/django-userprofile | 09e2e08982ffa9fb7e96c715138a0e5537759cd9 | [
"BSD-3-Clause"
] | 1 | 2020-05-30T07:13:51.000Z | 2020-05-30T07:13:51.000Z | from django.conf import settings
from django.db.models.loading import get_model
def get_profile_model():
"""
Returns configured user profile model or None if not found
"""
user_profile_module = getattr(settings, 'USER_PROFILE_MODULE', None)
if user_profile_module:
app_label, model_name = user_profile_module.split('.')
return get_model(app_label, model_name)
else:
return None
| 28.533333 | 72 | 0.714953 | 58 | 428 | 5 | 0.482759 | 0.189655 | 0.234483 | 0.117241 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.207944 | 428 | 14 | 73 | 30.571429 | 0.855457 | 0.135514 | 0 | 0 | 0 | 0 | 0.056497 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.111111 | false | 0 | 0.222222 | 0 | 0.555556 | 0 | 0 | 0 | 0 | null | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
751f8c881006d1c51fcc09c055f6c3e2a5143741 | 942 | py | Python | ai/get_cannabis_data/get_data_ma_draft.py | cannlytics/cannlytics-ai | c9d94e6fe9961129d1e29cd70c11ad6d267f3d48 | [
"MIT"
] | 2 | 2021-11-14T00:57:23.000Z | 2022-02-05T23:31:05.000Z | ai/get_cannabis_data/get_data_ma_draft.py | cannlytics/cannlytics-ai | c9d94e6fe9961129d1e29cd70c11ad6d267f3d48 | [
"MIT"
] | null | null | null | ai/get_cannabis_data/get_data_ma_draft.py | cannlytics/cannlytics-ai | c9d94e6fe9961129d1e29cd70c11ad6d267f3d48 | [
"MIT"
] | 1 | 2021-11-14T09:07:00.000Z | 2021-11-14T09:07:00.000Z | """
Title | Project
Author: Keegan Skeate
Contact: <keegan@cannlytics.com>
Created:
Updated:
License: MIT License <https://github.com/cannlytics/cannlytics-ai/blob/main/LICENSE>
"""
# Initialize a Socrata client.
# app_token = os.environ.get('APP_TOKEN', None)
# client = Socrata('opendata.mass-cannabis-control.com', app_token)
# # Get sales by product type.
# products = client.get('xwf2-j7g9', limit=2000)
# products_data = pd.DataFrame.from_records(products)
# # Get licensees.
# licensees = client.get("hmwt-yiqy", limit=2000)
# licensees_data = pd.DataFrame.from_records(licensees)
# # Get the monthly average price per ounce.
# avg_price = client.get("rqtv-uenj", limit=2000)
# avg_price_data = pd.DataFrame.from_records(avg_price)
# # Get production stats (total employees, total plants, etc.)
# production = client.get("j3q7-3usu", limit=2000, order='saledate DESC')
# production_data = pd.DataFrame.from_records(production) | 31.4 | 84 | 0.744161 | 128 | 942 | 5.367188 | 0.53125 | 0.052402 | 0.087336 | 0.110626 | 0.151383 | 0 | 0 | 0 | 0 | 0 | 0 | 0.026347 | 0.113588 | 942 | 30 | 85 | 31.4 | 0.796407 | 0.950106 | 0 | null | 0 | null | 0 | 0 | null | 0 | 0 | 0 | null | 1 | null | true | 0 | 0 | null | null | null | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
753751cd37b96f97ab8377718f2f2a0a05035834 | 120 | py | Python | src/randomizer/randomizer/models/enums/enemizer.py | neomatamune/IoGR | 4fea85523c1e9a436b66bc78552864616d304aac | [
"Unlicense"
] | 12 | 2019-05-06T12:31:06.000Z | 2020-07-21T19:24:44.000Z | src/randomizer/randomizer/models/enums/enemizer.py | neomatamune/IoGR | 4fea85523c1e9a436b66bc78552864616d304aac | [
"Unlicense"
] | 2 | 2020-06-11T22:12:15.000Z | 2021-10-20T22:53:42.000Z | src/randomizer/randomizer/models/enums/enemizer.py | neomatamune/IoGR | 4fea85523c1e9a436b66bc78552864616d304aac | [
"Unlicense"
] | 7 | 2019-08-11T00:06:03.000Z | 2021-06-13T04:19:19.000Z | from enum import Enum
class Enemizer(Enum):
NONE = 0
LIMITED = 1
BALANCED = 2
FULL = 3
INSANE = 4
| 12 | 21 | 0.575 | 17 | 120 | 4.058824 | 0.882353 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.064935 | 0.358333 | 120 | 9 | 22 | 13.333333 | 0.831169 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.142857 | 0 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
75388431cbba0d66fc44f19e0b0296fa52e70fc8 | 459 | py | Python | skelm/__init__.py | GrumpySapiens/scikit-elm | 799ecbddc3a4feffac52be0f71b441705cd445a1 | [
"MIT"
] | 13 | 2019-08-15T11:14:55.000Z | 2022-02-17T06:32:16.000Z | skelm/__init__.py | EspinosaLeal/scikit-elm | 7fa426476b515826c16fc33ec491e9f2fb0f9d42 | [
"MIT"
] | 1 | 2021-09-30T20:05:28.000Z | 2021-09-30T20:05:41.000Z | skelm/__init__.py | EspinosaLeal/scikit-elm | 7fa426476b515826c16fc33ec491e9f2fb0f9d42 | [
"MIT"
] | 6 | 2021-01-29T04:42:51.000Z | 2021-12-22T08:16:57.000Z | from .elm import ELMRegressor
from .elm import ELMClassifier
from .elm_large import LargeELMRegressor
from .elm_lanczos import LanczosELM
from .hidden_layer import HiddenLayer
from .solver_batch import BatchCholeskySolver
from .utils import PairwiseRandomProjection
from ._version import __version__
__all__ = ['ELMRegressor', 'ELMClassifier', 'HiddenLayer',
'LargeELMRegressor', 'BatchCholeskySolver', 'PairwiseRandomProjection', '__version__']
| 35.307692 | 97 | 0.814815 | 44 | 459 | 8.113636 | 0.431818 | 0.078431 | 0.072829 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.117647 | 459 | 12 | 98 | 38.25 | 0.881481 | 0 | 0 | 0 | 0 | 0 | 0.233115 | 0.052288 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.8 | 0 | 0.8 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 2 |
75513bcf461bcb5f109be15a7e58336b4fba54b6 | 4,356 | py | Python | MudAction.py | fhaynes/slithermud | f14da3d65cdc5187678e8e7cc05e56643a663c56 | [
"Artistic-1.0"
] | null | null | null | MudAction.py | fhaynes/slithermud | f14da3d65cdc5187678e8e7cc05e56643a663c56 | [
"Artistic-1.0"
] | null | null | null | MudAction.py | fhaynes/slithermud | f14da3d65cdc5187678e8e7cc05e56643a663c56 | [
"Artistic-1.0"
] | null | null | null | class MudAction:
"""
Contains all of the information about attempted physical actions within
the world. Whenever a Mob, Item, Character, etc tries to do anything in
the game world, an instance is created and sent around to all the other
chars, items, room, etc.
"""
def __init__(self, actionType, playerRef, data1='', \
data2='', data3='', string=''):
self.info = {}
self.info['actionType'] = actionType
self.info['playerRef'] = playerRef
self.info['data1'] = data1
self.info['data2'] = data2
self.info['data3'] = data3
self.info['string'] = string
def setType(self, type):
"""Sets the action type to the provided string."""
self.info['actionType'] = type
def setData1(self, data):
"""Sets the Data1 field of the action."""
self.info['data1'] = data
def setData2(self, data):
"""Sets the Data2 field of the action."""
self.info['data2'] = data
def setData3(self, data):
"""Sets the Data3 field of the action."""
self.info['data3'] = data
def setString(self, data):
"""Sets the string field of the action."""
# TODO: Probably not neccessary to call this string. Holdover from
# the translated C++ code.
self.string = data
def getType(self):
"""Returns the type of action."""
return self.info['actionType']
def getPlayerRef(self):
"""Returns a reference to the player who generated the action."""
return self.info['playerRef']
def getString(self):
"""Returns the String value of the action."""
return self.info['string']
def getData1(self):
"""Returns the data1 field."""
return self.info['data1']
def getData2(self):
"""Returns the data2 field."""
return self.info['data2']
def getData3(self):
"""Returns the data3 field."""
return self.info['data3']
class TimedAction(MudAction):
def __init__(self, actionType, playerRef, data1='', \
data2='', data3='', string=''):
MudAction.__init__(self, actionType, playerRef, data1='', \
data2='', data3='', string='')
self.executionTime = None
self.actionEvent = None
self.valid = True
def getExecutionTime(self):
"""
Returns the time (in miliseconds after start of MUD) that the
action should be executed.
"""
return self.executionTime
def setExecutionTime(self, time):
"""
Sets the time (in milliseconds after the MUD has started) that the
action should be executed.
"""
self.executionTime = time
def hook(self):
"""
This hooks a timed action to all it's references.
"""
# TODO: Some error checking code in case the instance/hook no longer
# exists? Same for unhook...
if type(self.getPlayerRef()) == 'instance':
self.getPlayerRef().addHook(self)
if type(self.getData1()) == 'instance':
self.getData1().addHook(self)
if type(self.getData2()) == 'instance':
self.getData1().addHook(self)
if type(self.getData3()) == 'instance':
self.getData1().addHook(self)
def unhook(self):
"""
This removes a timed action from all it's references.
"""
if type(self.getPlayerRef()) == 'instance':
self.getPlayerRef().removeHook(self)
if type(self.getData1()) == 'instance':
self.getData1().removeHook(self)
if type(self.getData2()) == 'instance':
self.getData1().removeHook(self)
if type(self.getData3()) == 'instance':
self.getData1().removeHook(self)
def setValid(self, value):
"""
Sets the validity of the action.
"""
if value == True:
self.valid = True
elif value == False:
self.valid = False
else:
#TODO: Code to notify that it is an invalid value?
return
| 32.507463 | 76 | 0.541322 | 465 | 4,356 | 5.045161 | 0.275269 | 0.057971 | 0.034101 | 0.035806 | 0.321398 | 0.283887 | 0.228474 | 0.189258 | 0.067349 | 0 | 0 | 0.015636 | 0.339302 | 4,356 | 134 | 77 | 32.507463 | 0.799514 | 0.273186 | 0 | 0.289855 | 0 | 0 | 0.057308 | 0 | 0 | 0 | 0 | 0.022388 | 0 | 1 | 0.26087 | false | 0 | 0 | 0 | 0.405797 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
f3383c7f8d8f6eaf1a71e3a6716683c0fd0e224f | 4,611 | py | Python | release/stubs.min/System/Linq/Dynamic.py | tranconbv/ironpython-stubs | a601759e6c6819beff8e6b639d18a24b7e351851 | [
"MIT"
] | null | null | null | release/stubs.min/System/Linq/Dynamic.py | tranconbv/ironpython-stubs | a601759e6c6819beff8e6b639d18a24b7e351851 | [
"MIT"
] | null | null | null | release/stubs.min/System/Linq/Dynamic.py | tranconbv/ironpython-stubs | a601759e6c6819beff8e6b639d18a24b7e351851 | [
"MIT"
] | null | null | null | # encoding: utf-8
# module System.Linq.Dynamic calls itself Dynamic
# from Wms.RemotingImplementation,Version=1.23.1.0,Culture=neutral,PublicKeyToken=null
# by generator 1.145
# no doc
# no important
# no functions
# classes
class DynamicClass(object):
# no doc
def ZZZ(self):
"""hardcoded/mock instance of the class"""
return DynamicClass()
instance=ZZZ()
"""hardcoded/returns an instance of the class"""
def ToString(self):
""" ToString(self: DynamicClass) -> str """
pass
class DynamicExpression(object):
# no doc
def ZZZ(self):
"""hardcoded/mock instance of the class"""
return DynamicExpression()
instance=ZZZ()
"""hardcoded/returns an instance of the class"""
@staticmethod
def CreateClass(properties):
"""
CreateClass(*properties: Array[DynamicProperty]) -> Type
CreateClass(properties: IEnumerable[DynamicProperty]) -> Type
"""
pass
@staticmethod
def Parse(resultType,expression,values):
""" Parse(resultType: Type,expression: str,*values: Array[object]) -> Expression """
pass
@staticmethod
def ParseLambda(*__args):
"""
ParseLambda(itType: Type,resultType: Type,expression: str,*values: Array[object]) -> LambdaExpression
ParseLambda(parameters: Array[ParameterExpression],resultType: Type,expression: str,*values: Array[object]) -> LambdaExpression
ParseLambda[(T,S)](expression: str,*values: Array[object]) -> Expression[Func[T,S]]
"""
pass
__all__=[
'CreateClass',
'Parse',
'ParseLambda',
]
class DynamicProperty(object):
""" DynamicProperty(name: str,type: Type) """
def ZZZ(self):
"""hardcoded/mock instance of the class"""
return DynamicProperty()
instance=ZZZ()
"""hardcoded/returns an instance of the class"""
@staticmethod
def __new__(self,name,type):
""" __new__(cls: type,name: str,type: Type) """
pass
Name=property(lambda self: object(),lambda self,v: None,lambda self: None)
"""Get: Name(self: DynamicProperty) -> str
"""
Type=property(lambda self: object(),lambda self,v: None,lambda self: None)
"""Get: Type(self: DynamicProperty) -> Type
"""
class DynamicQueryable(object):
# no doc
def ZZZ(self):
"""hardcoded/mock instance of the class"""
return DynamicQueryable()
instance=ZZZ()
"""hardcoded/returns an instance of the class"""
@staticmethod
def Any(source):
""" Any(source: IQueryable) -> bool """
pass
@staticmethod
def Count(source):
""" Count(source: IQueryable) -> int """
pass
@staticmethod
def GroupBy(source,keySelector,elementSelector,values):
""" GroupBy(source: IQueryable,keySelector: str,elementSelector: str,*values: Array[object]) -> IQueryable """
pass
@staticmethod
def OrderBy(source,ordering,values):
"""
OrderBy[T](source: IQueryable[T],ordering: str,*values: Array[object]) -> IQueryable[T]
OrderBy(source: IQueryable,ordering: str,*values: Array[object]) -> IQueryable
"""
pass
@staticmethod
def Select(source,selector,values):
""" Select(source: IQueryable,selector: str,*values: Array[object]) -> IQueryable """
pass
@staticmethod
def Skip(source,count):
""" Skip(source: IQueryable,count: int) -> IQueryable """
pass
@staticmethod
def Take(source,count):
""" Take(source: IQueryable,count: int) -> IQueryable """
pass
@staticmethod
def Where(source,predicate,values):
"""
Where[T](source: IQueryable[T],predicate: str,*values: Array[object]) -> IQueryable[T]
Where(source: IQueryable,predicate: str,*values: Array[object]) -> IQueryable
"""
pass
__all__=[
'Any',
'Count',
'GroupBy',
'OrderBy',
'Select',
'Skip',
'Take',
'Where',
]
class ParseException(Exception):
""" ParseException(message: str,position: int) """
def ZZZ(self):
"""hardcoded/mock instance of the class"""
return ParseException()
instance=ZZZ()
"""hardcoded/returns an instance of the class"""
def ToString(self):
""" ToString(self: ParseException) -> str """
pass
def __init__(self,*args):
""" x.__init__(...) initializes x; see x.__class__.__doc__ for signaturex.__init__(...) initializes x; see x.__class__.__doc__ for signaturex.__init__(...) initializes x; see x.__class__.__doc__ for signature """
pass
@staticmethod
def __new__(self,message,position):
""" __new__(cls: type,message: str,position: int) """
pass
def __str__(self,*args):
pass
Position=property(lambda self: object(),lambda self,v: None,lambda self: None)
"""Get: Position(self: ParseException) -> int
"""
SerializeObjectState=None
| 28.288344 | 215 | 0.675125 | 516 | 4,611 | 5.897287 | 0.203488 | 0.064082 | 0.042721 | 0.059152 | 0.493592 | 0.493592 | 0.43444 | 0.41998 | 0.336839 | 0.290174 | 0 | 0.002621 | 0.172631 | 4,611 | 162 | 216 | 28.462963 | 0.79502 | 0.448493 | 0 | 0.511628 | 0 | 0 | 0.037486 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.255814 | false | 0.197674 | 0 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 2 |
f3480bac7fc16744be3efa670469652f640ddcf8 | 1,615 | py | Python | setup.py | Animenosekai/googlesearch | 346bcaf7b344c6cf7c8fdd63d9493648dad9a163 | [
"MIT"
] | 7 | 2021-07-01T22:45:36.000Z | 2022-02-20T23:59:00.000Z | apis/stackoverflow/googlesearch/setup.py | lannguyen0910/SAB | 12c787cf592cb26c2a91829038ad1c2f9bac1f16 | [
"MIT"
] | null | null | null | apis/stackoverflow/googlesearch/setup.py | lannguyen0910/SAB | 12c787cf592cb26c2a91829038ad1c2f9bac1f16 | [
"MIT"
] | 1 | 2022-02-21T12:52:29.000Z | 2022-02-21T12:52:29.000Z | from setuptools import setup
from os import path
with open(path.join(path.abspath(path.dirname(__file__)), 'README.md'), encoding='utf-8') as f:
readme_description = f.read()
setup(
name ="python-googlesearch",
packages = ["googlesearch"],
version = "1.1.1",
license = "MIT License",
description = "This module lets you use Google Searching capabilities right from your Python code",
author = "Anime no Sekai",
author_email = "niichannomail@gmail.com",
url = "https://github.com/Animenosekai/googlesearch",
download_url = "https://github.com/Animenosekai/googlesearch/archive/v1.1.1.tar.gz",
keywords = ['python', 'Anime no Sekai', "animenosekai", "googlesearch"],
install_requires = ['beautifulsoup4', 'requests', 'pyuseragents', 'inquirer'],
classifiers = ['Development Status :: 5 - Production/Stable', 'License :: OSI Approved :: MIT License', 'Programming Language :: Python :: 3', 'Programming Language :: Python :: 3.2', 'Programming Language :: Python :: 3.3', 'Programming Language :: Python :: 3.4', 'Programming Language :: Python :: 3.5', 'Programming Language :: Python :: 3.6', 'Programming Language :: Python :: 3.7', 'Programming Language :: Python :: 3.8', 'Programming Language :: Python :: 3.9'],
long_description = readme_description,
long_description_content_type = "text/markdown",
include_package_data=True,
python_requires='>=3.2, <4',
entry_points={
'console_scripts': [
'googlesearch = googlesearch.__main__:main'
]
},
package_data={
'googlesearch': ['LICENSE'],
},
) | 50.46875 | 475 | 0.668731 | 182 | 1,615 | 5.807692 | 0.516484 | 0.161779 | 0.212867 | 0.221381 | 0.128666 | 0.077578 | 0 | 0 | 0 | 0 | 0 | 0.021805 | 0.176471 | 1,615 | 32 | 476 | 50.46875 | 0.772932 | 0 | 0 | 0 | 0 | 0.033333 | 0.547649 | 0.030322 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.066667 | 0 | 0.066667 | 0 | 0 | 0 | 0 | null | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
f35198d7deb40389a7b65e10c1801aaaa490a68d | 599 | py | Python | dltb/types.py | Petr-By/qtpyvis | 0b9a151ee6b9a56b486c2bece9c1f03414629efc | [
"MIT"
] | 3 | 2017-10-04T14:51:26.000Z | 2017-10-22T09:35:50.000Z | dltb/types.py | Petr-By/qtpyvis | 0b9a151ee6b9a56b486c2bece9c1f03414629efc | [
"MIT"
] | 13 | 2017-09-05T12:56:11.000Z | 2017-11-22T10:38:27.000Z | dltb/types.py | krumnack/qtpyvis | 0b9a151ee6b9a56b486c2bece9c1f03414629efc | [
"MIT"
] | 2 | 2017-09-24T21:39:42.000Z | 2017-10-04T15:29:54.000Z | """General types an utility functions used in the deep learning toolbox.
"""
from typing import Union
from pathlib import Path
Pathlike = Union[str, Path]
def as_path(pathlike: Pathlike) -> Path:
"""Create a `Path` from a `Pathlike` object. If `path` is an
object itself, it will be returned, otherwise a new `Path` is
constructed.
Arguments
---------
pathlike:
The `Pathlike` object from which the path is to be created.
Result
------
path
The resulting `Path`.
"""
return pathlike if isinstance(pathlike, Path) else Path(pathlike)
| 23.96 | 72 | 0.652755 | 79 | 599 | 4.936709 | 0.544304 | 0.092308 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.24374 | 599 | 24 | 73 | 24.958333 | 0.860927 | 0.57429 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.2 | false | 0 | 0.4 | 0 | 0.8 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 2 |
f35df5e0b3342c8ed69418410afc7eb614c1c75c | 982 | py | Python | pysnow/utils/requestor.py | patrotom/pysnow | dfe8a535fad4510dbc13f07092c3eb1273b171ef | [
"MIT"
] | null | null | null | pysnow/utils/requestor.py | patrotom/pysnow | dfe8a535fad4510dbc13f07092c3eb1273b171ef | [
"MIT"
] | null | null | null | pysnow/utils/requestor.py | patrotom/pysnow | dfe8a535fad4510dbc13f07092c3eb1273b171ef | [
"MIT"
] | null | null | null | import requests
class Requestor:
def __init__(self, opts):
self.__opts = opts
self.__headers = {}
self.__authenticate()
# TODO: Handle expired token
# TODO: Handle HTTP and Connection errors
def send(self, data, endpoint, method):
url = f"{self.__opts['api_url']}{endpoint}"
response = requests.request(method, url, headers=self.__headers,
json=data).json()
return response
def __authenticate(self):
data = {
"client_id": self.__opts["client_id"],
"username": self.__opts["username"],
"password": self.__opts["password"],
"connection": "Username-Password-Authentication",
"grant_type": "password",
"scope": "openid"
}
response = requests.post(self.__opts['auth_url'], json=data).json()
self.__headers["Authorization"] = f"Bearer {response['id_token']}"
| 29.757576 | 75 | 0.566191 | 96 | 982 | 5.458333 | 0.4375 | 0.10687 | 0.045802 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.302444 | 982 | 32 | 76 | 30.6875 | 0.764964 | 0.06721 | 0 | 0 | 0 | 0 | 0.224535 | 0.096386 | 0 | 0 | 0 | 0.03125 | 0 | 1 | 0.136364 | false | 0.136364 | 0.045455 | 0 | 0.272727 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 2 |
f37b5807404ee6c1cc0ccc5f26fc18aca285bc88 | 117 | py | Python | google.py | vrishabh22/Some-Python-Programs | ea53aeed3eb5939cdf44f5567c204928d7de1901 | [
"MIT"
] | null | null | null | google.py | vrishabh22/Some-Python-Programs | ea53aeed3eb5939cdf44f5567c204928d7de1901 | [
"MIT"
] | null | null | null | google.py | vrishabh22/Some-Python-Programs | ea53aeed3eb5939cdf44f5567c204928d7de1901 | [
"MIT"
] | null | null | null | import sys,re,webbrowser
i=0
while i <= 100:
webbrowser.open_new_tab('www.google.com')
i=i+1
print (i)
| 16.714286 | 46 | 0.641026 | 21 | 117 | 3.47619 | 0.761905 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.054348 | 0.213675 | 117 | 6 | 47 | 19.5 | 0.73913 | 0 | 0 | 0 | 0 | 0 | 0.126126 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.166667 | 0 | 0.166667 | 0.166667 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
f38e602e7abbdf4a0aa4cc72d5718432c4f65cb7 | 224 | wsgi | Python | flasky.wsgi | BioWar/Flask-Social-Blogging-Web-App | b5f4f88d95dc870e651ac24ecd4f0a737a36380a | [
"MIT"
] | null | null | null | flasky.wsgi | BioWar/Flask-Social-Blogging-Web-App | b5f4f88d95dc870e651ac24ecd4f0a737a36380a | [
"MIT"
] | null | null | null | flasky.wsgi | BioWar/Flask-Social-Blogging-Web-App | b5f4f88d95dc870e651ac24ecd4f0a737a36380a | [
"MIT"
] | null | null | null | activate_this = " /home/admin/Flask-Social-Blogging-Web-App/flask-venv/bin/activate"
with open(activate_this) as file_:
exec(file_.read(), dict(__file__=activate_this))
from flasky import create_app
app = create_app()
| 28 | 84 | 0.767857 | 34 | 224 | 4.735294 | 0.647059 | 0.223602 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.102679 | 224 | 7 | 85 | 32 | 0.800995 | 0 | 0 | 0 | 0 | 0.2 | 0.294643 | 0.290179 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.2 | 0 | 0.2 | 0 | 0 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
f390d536cea1da150d04e3224ebc7b96ff1d900d | 8,369 | py | Python | pysnmp/ATM-TC-MIB.py | agustinhenze/mibs.snmplabs.com | 1fc5c07860542b89212f4c8ab807057d9a9206c7 | [
"Apache-2.0"
] | 11 | 2021-02-02T16:27:16.000Z | 2021-08-31T06:22:49.000Z | pysnmp/ATM-TC-MIB.py | agustinhenze/mibs.snmplabs.com | 1fc5c07860542b89212f4c8ab807057d9a9206c7 | [
"Apache-2.0"
] | 75 | 2021-02-24T17:30:31.000Z | 2021-12-08T00:01:18.000Z | pysnmp/ATM-TC-MIB.py | agustinhenze/mibs.snmplabs.com | 1fc5c07860542b89212f4c8ab807057d9a9206c7 | [
"Apache-2.0"
] | 10 | 2019-04-30T05:51:36.000Z | 2022-02-16T03:33:41.000Z | #
# PySNMP MIB module ATM-TC-MIB (http://snmplabs.com/pysmi)
# ASN.1 source file:///Users/davwang4/Dev/mibs.snmplabs.com/asn1/ATM-TC-MIB
# Produced by pysmi-0.3.4 at Mon Apr 29 17:04:02 2019
# On host DAVWANG4-M-1475 platform Darwin version 18.5.0 by user davwang4
# Using Python version 3.7.3 (default, Mar 27 2019, 09:23:15)
#
Integer, ObjectIdentifier, OctetString = mibBuilder.importSymbols("ASN1", "Integer", "ObjectIdentifier", "OctetString")
NamedValues, = mibBuilder.importSymbols("ASN1-ENUMERATION", "NamedValues")
ValueSizeConstraint, ValueRangeConstraint, ConstraintsUnion, SingleValueConstraint, ConstraintsIntersection = mibBuilder.importSymbols("ASN1-REFINEMENT", "ValueSizeConstraint", "ValueRangeConstraint", "ConstraintsUnion", "SingleValueConstraint", "ConstraintsIntersection")
NotificationGroup, ModuleCompliance = mibBuilder.importSymbols("SNMPv2-CONF", "NotificationGroup", "ModuleCompliance")
ObjectIdentity, NotificationType, Integer32, ModuleIdentity, TimeTicks, Gauge32, Bits, MibScalar, MibTable, MibTableRow, MibTableColumn, Counter64, iso, MibIdentifier, IpAddress, Counter32, Unsigned32, mib_2 = mibBuilder.importSymbols("SNMPv2-SMI", "ObjectIdentity", "NotificationType", "Integer32", "ModuleIdentity", "TimeTicks", "Gauge32", "Bits", "MibScalar", "MibTable", "MibTableRow", "MibTableColumn", "Counter64", "iso", "MibIdentifier", "IpAddress", "Counter32", "Unsigned32", "mib-2")
TextualConvention, DisplayString = mibBuilder.importSymbols("SNMPv2-TC", "TextualConvention", "DisplayString")
atmTCMIB = ModuleIdentity((1, 3, 6, 1, 2, 1, 37, 3))
if mibBuilder.loadTexts: atmTCMIB.setLastUpdated('9810190200Z')
if mibBuilder.loadTexts: atmTCMIB.setOrganization('IETF AToMMIB Working Group')
class AtmAddr(TextualConvention, OctetString):
status = 'current'
displayHint = '1x'
subtypeSpec = OctetString.subtypeSpec + ValueSizeConstraint(0, 40)
class AtmConnCastType(TextualConvention, Integer32):
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3))
namedValues = NamedValues(("p2p", 1), ("p2mpRoot", 2), ("p2mpLeaf", 3))
class AtmConnKind(TextualConvention, Integer32):
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5))
namedValues = NamedValues(("pvc", 1), ("svcIncoming", 2), ("svcOutgoing", 3), ("spvcInitiator", 4), ("spvcTarget", 5))
class AtmIlmiNetworkPrefix(TextualConvention, OctetString):
reference = 'ATM Forum, Integrated Local Management Interface (ILMI) Specification, Version 4.0, af-ilmi-0065.000, September 1996, Section 9 ATM Forum, ATM User-Network Interface Signalling Specification, Version 4.0 (UNI 4.0), af-sig-0061.000, June 1996, Section 3'
status = 'current'
subtypeSpec = OctetString.subtypeSpec + ConstraintsUnion(ValueSizeConstraint(8, 8), ValueSizeConstraint(13, 13), )
class AtmInterfaceType(TextualConvention, Integer32):
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13))
namedValues = NamedValues(("other", 1), ("autoConfig", 2), ("ituDss2", 3), ("atmfUni3Dot0", 4), ("atmfUni3Dot1", 5), ("atmfUni4Dot0", 6), ("atmfIispUni3Dot0", 7), ("atmfIispUni3Dot1", 8), ("atmfIispUni4Dot0", 9), ("atmfPnni1Dot0", 10), ("atmfBici2Dot0", 11), ("atmfUniPvcOnly", 12), ("atmfNniPvcOnly", 13))
class AtmServiceCategory(TextualConvention, Integer32):
reference = 'ATM Forum Traffic Management Specification, Version 4.0, af-tm-0056.000, June 1996.'
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3, 4, 5, 6))
namedValues = NamedValues(("other", 1), ("cbr", 2), ("rtVbr", 3), ("nrtVbr", 4), ("abr", 5), ("ubr", 6))
class AtmSigDescrParamIndex(TextualConvention, Integer32):
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ValueRangeConstraint(0, 2147483647)
class AtmTrafficDescrParamIndex(TextualConvention, Integer32):
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ValueRangeConstraint(0, 2147483647)
class AtmVcIdentifier(TextualConvention, Integer32):
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ValueRangeConstraint(0, 65535)
class AtmVpIdentifier(TextualConvention, Integer32):
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ValueRangeConstraint(0, 4095)
class AtmVorXAdminStatus(TextualConvention, Integer32):
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2))
namedValues = NamedValues(("up", 1), ("down", 2))
class AtmVorXLastChange(TextualConvention, TimeTicks):
status = 'current'
class AtmVorXOperStatus(TextualConvention, Integer32):
status = 'current'
subtypeSpec = Integer32.subtypeSpec + ConstraintsUnion(SingleValueConstraint(1, 2, 3))
namedValues = NamedValues(("up", 1), ("down", 2), ("unknown", 3))
atmTrafficDescriptorTypes = MibIdentifier((1, 3, 6, 1, 2, 1, 37, 1, 1))
atmObjectIdentities = MibIdentifier((1, 3, 6, 1, 2, 1, 37, 3, 1))
atmNoTrafficDescriptor = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 1))
if mibBuilder.loadTexts: atmNoTrafficDescriptor.setStatus('deprecated')
atmNoClpNoScr = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 2))
if mibBuilder.loadTexts: atmNoClpNoScr.setStatus('current')
atmClpNoTaggingNoScr = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 3))
if mibBuilder.loadTexts: atmClpNoTaggingNoScr.setStatus('deprecated')
atmClpTaggingNoScr = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 4))
if mibBuilder.loadTexts: atmClpTaggingNoScr.setStatus('deprecated')
atmNoClpScr = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 5))
if mibBuilder.loadTexts: atmNoClpScr.setStatus('current')
atmClpNoTaggingScr = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 6))
if mibBuilder.loadTexts: atmClpNoTaggingScr.setStatus('current')
atmClpTaggingScr = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 7))
if mibBuilder.loadTexts: atmClpTaggingScr.setStatus('current')
atmClpNoTaggingMcr = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 8))
if mibBuilder.loadTexts: atmClpNoTaggingMcr.setStatus('current')
atmClpTransparentNoScr = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 9))
if mibBuilder.loadTexts: atmClpTransparentNoScr.setStatus('current')
atmClpTransparentScr = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 10))
if mibBuilder.loadTexts: atmClpTransparentScr.setStatus('current')
atmNoClpTaggingNoScr = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 11))
if mibBuilder.loadTexts: atmNoClpTaggingNoScr.setStatus('current')
atmNoClpNoScrCdvt = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 12))
if mibBuilder.loadTexts: atmNoClpNoScrCdvt.setStatus('current')
atmNoClpScrCdvt = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 13))
if mibBuilder.loadTexts: atmNoClpScrCdvt.setStatus('current')
atmClpNoTaggingScrCdvt = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 14))
if mibBuilder.loadTexts: atmClpNoTaggingScrCdvt.setStatus('current')
atmClpTaggingScrCdvt = ObjectIdentity((1, 3, 6, 1, 2, 1, 37, 1, 1, 15))
if mibBuilder.loadTexts: atmClpTaggingScrCdvt.setStatus('current')
mibBuilder.exportSymbols("ATM-TC-MIB", atmNoTrafficDescriptor=atmNoTrafficDescriptor, PYSNMP_MODULE_ID=atmTCMIB, AtmInterfaceType=AtmInterfaceType, AtmVcIdentifier=AtmVcIdentifier, atmClpTaggingScr=atmClpTaggingScr, AtmVpIdentifier=AtmVpIdentifier, atmObjectIdentities=atmObjectIdentities, atmNoClpNoScrCdvt=atmNoClpNoScrCdvt, AtmIlmiNetworkPrefix=AtmIlmiNetworkPrefix, atmClpNoTaggingMcr=atmClpNoTaggingMcr, AtmServiceCategory=AtmServiceCategory, atmNoClpScrCdvt=atmNoClpScrCdvt, AtmVorXAdminStatus=AtmVorXAdminStatus, AtmVorXLastChange=AtmVorXLastChange, AtmSigDescrParamIndex=AtmSigDescrParamIndex, AtmAddr=AtmAddr, atmNoClpScr=atmNoClpScr, atmTrafficDescriptorTypes=atmTrafficDescriptorTypes, AtmVorXOperStatus=AtmVorXOperStatus, atmClpTaggingScrCdvt=atmClpTaggingScrCdvt, AtmTrafficDescrParamIndex=AtmTrafficDescrParamIndex, AtmConnKind=AtmConnKind, atmClpTaggingNoScr=atmClpTaggingNoScr, AtmConnCastType=AtmConnCastType, atmClpNoTaggingScr=atmClpNoTaggingScr, atmNoClpTaggingNoScr=atmNoClpTaggingNoScr, atmClpNoTaggingScrCdvt=atmClpNoTaggingScrCdvt, atmNoClpNoScr=atmNoClpNoScr, atmClpNoTaggingNoScr=atmClpNoTaggingNoScr, atmTCMIB=atmTCMIB, atmClpTransparentScr=atmClpTransparentScr, atmClpTransparentNoScr=atmClpTransparentNoScr)
| 76.779817 | 1,236 | 0.7664 | 855 | 8,369 | 7.498246 | 0.237427 | 0.007799 | 0.008423 | 0.011231 | 0.330838 | 0.292466 | 0.286539 | 0.286539 | 0.279676 | 0.249727 | 0 | 0.066471 | 0.102999 | 8,369 | 108 | 1,237 | 77.490741 | 0.787532 | 0.037519 | 0 | 0.191011 | 0 | 0.022472 | 0.162192 | 0.005469 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.067416 | 0 | 0.595506 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
f3aa7ff491d297ccc114a1192de680a67a869e7e | 774 | py | Python | python/array_string/two_sum/solution_test.py | Lumexralph/solving-algorithm-questions | 0791c174cdd7bb6804dd33405dd2d9b441e0e166 | [
"MIT"
] | null | null | null | python/array_string/two_sum/solution_test.py | Lumexralph/solving-algorithm-questions | 0791c174cdd7bb6804dd33405dd2d9b441e0e166 | [
"MIT"
] | null | null | null | python/array_string/two_sum/solution_test.py | Lumexralph/solving-algorithm-questions | 0791c174cdd7bb6804dd33405dd2d9b441e0e166 | [
"MIT"
] | null | null | null | from unittest import TestCase
from .solution import Solution
class TestTwoSum(TestCase):
def test_list_with_element_that_have_sum(self):
nums = [0, 2, 4, 6, 7]
result = Solution().twoSum(nums, 13)
self.assertListEqual(result, [3, 4])
def test_list_with_element_that_have_no_sum(self):
nums = [0, 2, 4, 6, 7]
result = Solution().twoSum(nums, 20)
self.assertListEqual(result, [])
def test_with_invalid_input(self):
nums = "abcdefgt"
result = Solution().twoSum(nums, "ball")
self.assertListEqual(result, [])
def test_with_list_of_alphanumeric(self):
nums = [1, 2, 3, 'b', '=']
result = Solution().twoSum(nums, 2)
self.assertListEqual(result, [])
| 28.666667 | 54 | 0.614987 | 96 | 774 | 4.75 | 0.385417 | 0.061404 | 0.175439 | 0.210526 | 0.464912 | 0.464912 | 0.307018 | 0.175439 | 0.175439 | 0.175439 | 0 | 0.034722 | 0.255814 | 774 | 26 | 55 | 29.769231 | 0.756944 | 0 | 0 | 0.263158 | 0 | 0 | 0.018111 | 0 | 0 | 0 | 0 | 0 | 0.210526 | 1 | 0.210526 | false | 0 | 0.105263 | 0 | 0.368421 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
f3b2835f8868a54083bc85c2dee977c828288549 | 306 | py | Python | Code/Basic/get_frequency.py | JoelBuenrostro/micropython-for-esp32 | d4ba9777ec4459b09089762be9287985d19bbe28 | [
"MIT"
] | 1 | 2019-10-12T00:06:05.000Z | 2019-10-12T00:06:05.000Z | Code/Basic/get_frequency.py | JoelBuenrostro/micropython-for-esp32 | d4ba9777ec4459b09089762be9287985d19bbe28 | [
"MIT"
] | null | null | null | Code/Basic/get_frequency.py | JoelBuenrostro/micropython-for-esp32 | d4ba9777ec4459b09089762be9287985d19bbe28 | [
"MIT"
] | 1 | 2019-09-20T12:54:53.000Z | 2019-09-20T12:54:53.000Z | # Chip: ESP32-WROOM-32 (ESP32-D0WDQ6)
# Microprocessor: Dual-Core Xtensa® 32-bit LX6
# Clock: 80MHz to 240Mhz
# Crystal: 40MHz
# SPÍ flash: 4 MB
# Operating voltage: 3.0V-3.6V
# Operating current: 80mA
# Purpose: Get and set CPU frequency to 240MHz
import machine
machine.freq()
machine.freq(240000000)
| 20.4 | 46 | 0.738562 | 48 | 306 | 4.729167 | 0.8125 | 0.070485 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.142857 | 0.153595 | 306 | 14 | 47 | 21.857143 | 0.72973 | 0.75817 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 0.333333 | 0 | 0.333333 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 2 |
45e826003999e82bebefe73a6d43d833d1591487 | 774 | py | Python | Tutorials/43virtEnv/guide.py | Aaryan-R-S/Python-Tutorials | 89e5ec69e529511137263231d735410e92f0a65d | [
"MIT"
] | null | null | null | Tutorials/43virtEnv/guide.py | Aaryan-R-S/Python-Tutorials | 89e5ec69e529511137263231d735410e92f0a65d | [
"MIT"
] | null | null | null | Tutorials/43virtEnv/guide.py | Aaryan-R-S/Python-Tutorials | 89e5ec69e529511137263231d735410e92f0a65d | [
"MIT"
] | null | null | null | '''
-- Make required Folder & open Integrated CMD in it !
In CMD type :
[To make exact copy of system base python but no modules included!]
-- pip install virtualenv
-- virtualenv [nameOfSubFolderInRequiredFolder] // Here I used VirtualEnvironment
--OR--
To make exact copy of system base python[with Modules] :
-- virtualenv --system-site-packages [nameOfSubFolderInRequiredFolder] // Here I used VirtualEnvironment
To activate :
-- .\[nameOfSubFolderInRequiredFolder]\Scripts\activate // Here I used VirtualEnvironment
To deactivate :
-- deactivate
To get guide in Virtual Environment :
-- pip freeze > requirements.txt
To install modules mentioned in requirements.txt :
-- pip install -r .\requirements.txt
''' | 26.689655 | 106 | 0.70801 | 86 | 774 | 6.372093 | 0.511628 | 0.027372 | 0.04927 | 0.14781 | 0.388686 | 0.120438 | 0.120438 | 0.120438 | 0 | 0 | 0 | 0 | 0.206718 | 774 | 29 | 107 | 26.689655 | 0.892508 | 0.963824 | 0 | null | 0 | null | 0 | 0 | null | 0 | 0 | 0 | null | 1 | null | true | 0 | 0 | null | null | null | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
45f2b38f940353a872ea74751fdd0ea71eabc7b9 | 449 | py | Python | src/setup.py | hvod2000/a9a | 6b5cddbac885e2aff56e32936b966f4ce05afbba | [
"MIT"
] | null | null | null | src/setup.py | hvod2000/a9a | 6b5cddbac885e2aff56e32936b966f4ce05afbba | [
"MIT"
] | null | null | null | src/setup.py | hvod2000/a9a | 6b5cddbac885e2aff56e32936b966f4ce05afbba | [
"MIT"
] | null | null | null | import setuptools
with open("../readme.md", "r") as f:
long_description = f.read()
setuptools.setup(
name="a9a",
version="0.0.2",
author="Uladzislau Khamkou",
description="a9a archivator",
long_description=long_description,
long_description_content_type="text/markdown",
packages=setuptools.find_packages(),
python_requires=">=3.6",
py_modules=["a9a"],
package_dir={"": "."},
install_requires=[],
)
| 23.631579 | 50 | 0.66147 | 52 | 449 | 5.5 | 0.711538 | 0.20979 | 0.132867 | 0.20979 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.021448 | 0.169265 | 449 | 18 | 51 | 24.944444 | 0.745308 | 0 | 0 | 0 | 0 | 0 | 0.167038 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.0625 | 0 | 0.0625 | 0 | 0 | 0 | 0 | null | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
45f52e63858fe180dbc02a78b9066f700a437e60 | 157 | py | Python | funds/src/playground/tinyDB.py | biztudio/richlab | 8378671575150e13b9361a1e208959b8acd93e81 | [
"MIT"
] | null | null | null | funds/src/playground/tinyDB.py | biztudio/richlab | 8378671575150e13b9361a1e208959b8acd93e81 | [
"MIT"
] | 4 | 2017-10-17T11:04:57.000Z | 2017-12-26T09:35:01.000Z | funds/src/playground/tinyDB.py | biztudio/richlab | 8378671575150e13b9361a1e208959b8acd93e81 | [
"MIT"
] | null | null | null | from tinydb import TinyDB, Query
db = TinyDB('./fundlist_db.json')
fund_table = db.table('fund')
idr = Query()
print(fund_table.count(idr.code > '000000')) | 22.428571 | 44 | 0.713376 | 24 | 157 | 4.541667 | 0.583333 | 0.165138 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.043165 | 0.11465 | 157 | 7 | 44 | 22.428571 | 0.741007 | 0 | 0 | 0 | 0 | 0 | 0.177215 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.2 | 0 | 0.2 | 0.2 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
45fba89e0f6b8b9474e6578d79f4f4049cd84f8e | 252 | py | Python | project/apps/analyses/urls.py | edcarlosneves/api-calibration-ciurve | 2922b89252545e1fd250b6a52b169ddee42784eb | [
"MIT"
] | null | null | null | project/apps/analyses/urls.py | edcarlosneves/api-calibration-ciurve | 2922b89252545e1fd250b6a52b169ddee42784eb | [
"MIT"
] | null | null | null | project/apps/analyses/urls.py | edcarlosneves/api-calibration-ciurve | 2922b89252545e1fd250b6a52b169ddee42784eb | [
"MIT"
] | 1 | 2022-03-13T20:00:51.000Z | 2022-03-13T20:00:51.000Z | from django.urls import include, path
from rest_framework import routers
from . import views
router = routers.DefaultRouter()
router.register(r"", views.AnalysisViewSet, basename="Analysis")
urlpatterns = [path("v1/analysis/", include(router.urls))]
| 28 | 64 | 0.777778 | 31 | 252 | 6.290323 | 0.612903 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.004405 | 0.099206 | 252 | 8 | 65 | 31.5 | 0.854626 | 0 | 0 | 0 | 0 | 0 | 0.079365 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.5 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 2 |
3439a5f5a5981f3652ad56c4a81044f0f2a9b4e5 | 2,126 | py | Python | tutorials/Jupyter/inputs/parameter.py | Oltanis/undergrad_MC_course | 64c24c2598a5581956b9774257ce3dcf851aedaa | [
"CC-BY-4.0"
] | 2 | 2018-09-21T08:39:03.000Z | 2020-06-01T06:31:34.000Z | tutorials/Jupyter/inputs/parameter.py | Oltanis/undergrad_MC_course | 64c24c2598a5581956b9774257ce3dcf851aedaa | [
"CC-BY-4.0"
] | 7 | 2017-11-30T08:25:40.000Z | 2017-11-30T10:13:44.000Z | tutorials/Jupyter/inputs/parameter.py | Oltanis/undergrad_MC_course | 64c24c2598a5581956b9774257ce3dcf851aedaa | [
"CC-BY-4.0"
] | 2 | 2018-06-20T12:08:48.000Z | 2020-06-01T06:53:19.000Z | """Utility to store int or float parameters with a label
The label is added merely for information: there is no
extra functionality associated with it.
The module has a factory class Parameter(value, label)
which returns either ParameterInt ot ParameterFloat
depending on type(value).
"""
class ParameterInt(int):
"""Integer parameter with a label"""
def __new__(cls, *args):
"""Arguements:
args[0] is the value
"""
return super(ParameterInt, cls).__new__(cls, args[0])
def __init__(self, value, label):
"""Arguments
value (integer): the value
label (string, Label, ...): associated label
"""
super(ParameterInt, self).__init__()
self.label = label
def __repr__(self):
"""Return string including the label"""
parameter = "value= {!s}, label= {!r}".format(self, self.label)
return "ParameterInt({!s})".format(parameter)
class ParameterFloat(float):
"""Real parameter with label"""
def __new__(cls, *args):
"""Arguments:
args[0] is the value
"""
return super(ParameterFloat, cls).__new__(cls, args[0])
def __init__(self, value, label):
"""Arguments
value (float): the value
label (string, Label, ...): a description
"""
super(ParameterFloat, self).__init__()
self.label = label
def __repr__(self):
"""Return a string including the label"""
parameter = "value= {!s}, label= {!r}".format(self, self.label)
return "ParameterFloat({!s})".format(parameter)
class Parameter(object):
"""A factory to return a Parameter of the correct type"""
def __new__(cls, value, label):
"""Arguments:
value (int or float)
label (string or Label)
"""
if isinstance(value, int):
return ParameterInt(value, label)
elif isinstance(value, float):
return ParameterFloat(value, label)
else:
raise TypeError("A Parameter is either int or float")
| 22.617021 | 71 | 0.591722 | 237 | 2,126 | 5.122363 | 0.278481 | 0.065898 | 0.032949 | 0.059308 | 0.370675 | 0.301483 | 0.301483 | 0.258649 | 0.258649 | 0.194399 | 0 | 0.002646 | 0.288805 | 2,126 | 93 | 72 | 22.860215 | 0.800265 | 0.364534 | 0 | 0.384615 | 0 | 0 | 0.101266 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.269231 | false | 0 | 0 | 0 | 0.615385 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
3442e6d6fa4d024eee78b04cbc420aec1f7bd752 | 2,235 | py | Python | views/__init__.py | CloudCIX/membership | a7a62918c7d7c65dd1bf2068431dbf2ec2573e4b | [
"Apache-2.0"
] | null | null | null | views/__init__.py | CloudCIX/membership | a7a62918c7d7c65dd1bf2068431dbf2ec2573e4b | [
"Apache-2.0"
] | null | null | null | views/__init__.py | CloudCIX/membership | a7a62918c7d7c65dd1bf2068431dbf2ec2573e4b | [
"Apache-2.0"
] | null | null | null | from .address import AddressCollection, AddressResource, VerboseAddressCollection
from .address_link import AddressLinkResource
from .app_settings import AppSettingsCollection, AppSettingsResource
from .auth import AuthResource
from .country import CountryCollection, CountryResource
from .currency import CurrencyCollection, CurrencyResource
from .department import DepartmentCollection, DepartmentResource
from .email_confirmation import EmailConfirmationResource
from .language import LanguageCollection, LanguageResource
from .member import MemberCollection, MemberResource
from .member_link import MemberLinkCollection, MemberLinkResource
from .notification import NotificationCollection
from .subdivision import SubdivisionCollection, SubdivisionResource
from .profile import ProfileCollection, ProfileResource
from .team import TeamCollection, TeamResource
from .territory import TerritoryCollection, TerritoryResource
from .transaction_type import TransactionTypeCollection, TransactionTypeResource
from .user import UserCollection, UserResource
__all__ = [
# Address
'AddressCollection',
'AddressResource',
'VerboseAddressCollection',
# AddressLink
'AddressLinkResource',
# App Settings
'AppSettingsCollection',
'AppSettingsResource',
# Auth
'AuthResource',
# Country
'CountryCollection',
'CountryResource',
# Currency
'CurrencyCollection',
'CurrencyResource',
# Department
'DepartmentCollection',
'DepartmentResource',
# EmailConfirmationResource
'EmailConfirmationResource',
# Language
'LanguageCollection',
'LanguageResource',
# Member
'MemberCollection',
'MemberResource',
# MemberLink
'MemberLinkCollection',
'MemberLinkResource',
# Notification
'NotificationCollection',
# Profile
'ProfileCollection',
'ProfileResource',
# Subdivision
'SubdivisionCollection',
'SubdivisionResource',
# Team
'TeamCollection',
'TeamResource',
# Territory
'TerritoryCollection',
'TerritoryResource',
# TransactionType
'TransactionTypeCollection',
'TransactionTypeResource',
# User
'UserCollection',
'UserResource',
]
| 24.56044 | 81 | 0.759732 | 145 | 2,235 | 11.648276 | 0.406897 | 0.013025 | 0.066311 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.171812 | 2,235 | 90 | 82 | 24.833333 | 0.91248 | 0.083669 | 0 | 0 | 0 | 0 | 0.289798 | 0.079349 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.339623 | 0 | 0.339623 | 0 | 0 | 0 | 1 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 2 |
3451ace8d9aaacc619452018e4e429db8cb4c0b5 | 1,571 | py | Python | DataHelper.py | dukeNashor/ChessMaster | 0b1f7b75a76e5c9129e73e0722af9e5b3b76f033 | [
"MIT"
] | null | null | null | DataHelper.py | dukeNashor/ChessMaster | 0b1f7b75a76e5c9129e73e0722af9e5b3b76f033 | [
"MIT"
] | null | null | null | DataHelper.py | dukeNashor/ChessMaster | 0b1f7b75a76e5c9129e73e0722af9e5b3b76f033 | [
"MIT"
] | null | null | null | import os
import cv2
from skimage import io
import numpy as np
import glob
import h5py
# get clean name by a path, where in our case this gets the FEN conviniently
def GetCleanNameByPath(file_name):
return os.path.splitext(os.path.basename(file_name))[0]
# get full paths to the files in a directory.
def GetFileNamesInDir(path_name, extension="*", num_return = 0):
if num_return == 0:
return glob.glob(path_name + "/*." + extension)
else:
return glob.glob(path_name + "/*." + extension)[:num_return]
# get name list
def GetCleanNamesInDir(path_name, extension = "*", num_return = 0):
names = GetFileNamesInDir(path_name, extension)
offset = len(extension) + 1
clean_names = [os.path.basename(x)[:-offset] for x in names]
if num_return == 0:
return clean_names
else:
return clean_names[:num_return]
# read dataset
def ReadImages(file_names, path = "", format = cv2.IMREAD_COLOR):
if path == "":
return [cv2.imread(f, format) for f in file_names]
else:
return [cv2.imread(path + "/" + f, format) for f in file_names]
# read image by name
def ReadImage(file_name, gray = False):
return io.imread(file_name, as_gray = gray)
# h5py functions
# read h5py file
# we assume the labels and
def ReadH5pyFile(file_name, data_name):
h5_buffer = h5py.File(file_name)
return h5_buffer[data_name].copy()
# write h5py file
def WriteH5pyFile(file_name, mat, data_name = "dataset"):
with h5py.File(file_name, 'w') as f:
f.create_dataset(data_name, data = mat)
| 28.563636 | 76 | 0.684278 | 232 | 1,571 | 4.487069 | 0.336207 | 0.061479 | 0.081652 | 0.057637 | 0.191162 | 0.153698 | 0.042267 | 0 | 0 | 0 | 0 | 0.016026 | 0.205602 | 1,571 | 54 | 77 | 29.092593 | 0.818109 | 0.150223 | 0 | 0.147059 | 0 | 0 | 0.01283 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.205882 | false | 0 | 0.176471 | 0.058824 | 0.647059 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
34566db3eaf80f98bceb62ed7f6449b685c04288 | 179 | py | Python | ex015.py | Roninho514/Treinamento-Python | fc6ad0b64fb3dc3cfa5381f8fc53b5b3243a7ff6 | [
"MIT"
] | null | null | null | ex015.py | Roninho514/Treinamento-Python | fc6ad0b64fb3dc3cfa5381f8fc53b5b3243a7ff6 | [
"MIT"
] | null | null | null | ex015.py | Roninho514/Treinamento-Python | fc6ad0b64fb3dc3cfa5381f8fc53b5b3243a7ff6 | [
"MIT"
] | null | null | null | diasAlugados = int(input('Quantos dias foi alugado:'))
km = float(input('Quantos kilometros foram rodados:'))
print('Você precisa pagar {}'.format((60.0*diasAlugados)+(0.15*km)))
| 44.75 | 68 | 0.72067 | 25 | 179 | 5.16 | 0.8 | 0.186047 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.03681 | 0.089385 | 179 | 3 | 69 | 59.666667 | 0.754601 | 0 | 0 | 0 | 0 | 0 | 0.441341 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0.333333 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
345f91f27be969733a56ac8cb7a928ee5056ca0c | 2,083 | py | Python | fellowcrm/upgrade/forms.py | Fellow-Consulting-AG/fellowcrm | 5cdee0289482b4de4a7d0c47181dfc12d95ac279 | [
"MIT"
] | null | null | null | fellowcrm/upgrade/forms.py | Fellow-Consulting-AG/fellowcrm | 5cdee0289482b4de4a7d0c47181dfc12d95ac279 | [
"MIT"
] | null | null | null | fellowcrm/upgrade/forms.py | Fellow-Consulting-AG/fellowcrm | 5cdee0289482b4de4a7d0c47181dfc12d95ac279 | [
"MIT"
] | null | null | null | from flask_wtf import FlaskForm
from wtforms import StringField, PasswordField, SubmitField, BooleanField
from wtforms.validators import DataRequired, Length, Email, EqualTo
from wtforms_sqlalchemy.fields import QuerySelectField
from fellowcrm.settings.models import Currency, TimeZone
class NewSystemUser(FlaskForm):
first_name = StringField('First Name', validators=[DataRequired(message='Please enter your first name')])
last_name = StringField('Last Name',
validators=[DataRequired(message='Please enter your last name'), Length(min=2, max=20)])
email = StringField('Email',
validators=[DataRequired(
message='Email address is mandatory'),
Email(message='Please enter a valid email address e.g. abc@yourcompany.com')])
password = PasswordField('Password',
validators=[DataRequired(message='Password is mandatory')])
confirm_password = PasswordField('Confirm Password',
validators=[DataRequired(
message='Confirm Password is mandatory'),
EqualTo('password', 'Passwords do not match')])
submit = SubmitField('Next: Setup Company Details')
class CurrencyTz(FlaskForm):
currency = QuerySelectField('Default Currency', query_factory=Currency.get_list_query, get_pk=lambda a: a.id,
get_label='name',
validators=[DataRequired(message='Please select default currency')])
time_zone = QuerySelectField('Your Time Zone', query_factory=TimeZone.get_list_query, get_pk=lambda a: a.id,
get_label='name',
validators=[DataRequired(message='Please select your timezone')])
submit = SubmitField('Next: Finish Installation')
class FinishInstall(FlaskForm):
import_sample_data = BooleanField('Install Sample Data')
submit = SubmitField('Complete Installation')
| 52.075 | 116 | 0.635142 | 199 | 2,083 | 6.557789 | 0.386935 | 0.118008 | 0.155556 | 0.101149 | 0.196169 | 0.196169 | 0.196169 | 0.122605 | 0.122605 | 0.122605 | 0 | 0.001988 | 0.275564 | 2,083 | 39 | 117 | 53.410256 | 0.862823 | 0 | 0 | 0.129032 | 0 | 0 | 0.21854 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0.193548 | 0.193548 | 0 | 0.645161 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 2 |
346648ce30caa0980d272f224f4e750b978e02dc | 1,352 | py | Python | embeddings/utils.py | joni115/neuralFrame | 23f249e01c915856919c7e87247b3678f5d1a887 | [
"MIT"
] | null | null | null | embeddings/utils.py | joni115/neuralFrame | 23f249e01c915856919c7e87247b3678f5d1a887 | [
"MIT"
] | null | null | null | embeddings/utils.py | joni115/neuralFrame | 23f249e01c915856919c7e87247b3678f5d1a887 | [
"MIT"
] | null | null | null | import numpy as np
from sklearn.decomposition import TruncatedSVD
def compute_pc(X, npc=1):
"""
Compute the principal components. DO NOT MAKE THE DATA ZERO MEAN!
:param X: X[i,:] is a data point
:param npc: number of principal components to remove
:return: component_[i,:] is the i-th pc
"""
svd = TruncatedSVD(n_components=npc, n_iter=7, random_state=0)
svd.fit(X)
return svd.components_
def remove_pc(X, npc=1):
"""
Remove the projection on the principal components
:param X: X[i,:] is a data point for a sentences
:param npc: number of principal components to remove
:return: XX[i, :] is the data point after removing its projection
"""
pc = compute_pc(X, npc)
if npc==1:
XX = X - X.dot(pc.transpose()) * pc
else:
XX = X - X.dot(pc.transpose()).dot(pc)
return XX
def save_word_embeddings(embeddings, file_to_dump):
"""
dump the embeddings into a .txt file.
:embeddings: the embeddings has to be an numpy type.
"""
np.save(file_to_dump, embedding_deco, allow_pickle=False)
def load_word_embedding(file_to_load):
"""
load word embeddings from a txt file.
:file_to_load: a path to a file with the embeddings (.npy)
return the embeddings with a numpy type
"""
return np.load(file_to_load, allow_pickle=False)
| 28.765957 | 69 | 0.667899 | 212 | 1,352 | 4.141509 | 0.353774 | 0.034169 | 0.020501 | 0.029613 | 0.198178 | 0.198178 | 0.157175 | 0.157175 | 0.111617 | 0 | 0 | 0.004817 | 0.232249 | 1,352 | 46 | 70 | 29.391304 | 0.84104 | 0.471154 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.235294 | false | 0 | 0.117647 | 0 | 0.529412 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
347e39aad25dcb14118b0584e340d89bdf122f3c | 553 | py | Python | lists_iteration/sum_of_lengths.py | magicalcarpet/the_complete_python_course | 0ac0c5015a93607d7d29258ac0a3fc38dda81bd2 | [
"MIT"
] | null | null | null | lists_iteration/sum_of_lengths.py | magicalcarpet/the_complete_python_course | 0ac0c5015a93607d7d29258ac0a3fc38dda81bd2 | [
"MIT"
] | null | null | null | lists_iteration/sum_of_lengths.py | magicalcarpet/the_complete_python_course | 0ac0c5015a93607d7d29258ac0a3fc38dda81bd2 | [
"MIT"
] | null | null | null | # Define a sum_of_lengths function that accepts a list of strings.
# The function should return the sum of the string lengths.
#
# EXAMPLES
# sum_of_lengths(["Hello", "Bob"]) => 8
# sum_of_lengths(["Nonsense"]) => 8
# sum_of_lengths(["Nonsense", "or", "confidence"]) => 20
def sum_of_lengths(array):
sum = 0
for element in array:
sum += len(element)
return sum
print(sum_of_lengths(['Hello', 'Bob']))
print(sum_of_lengths(['Nonsense']))
print(sum_of_lengths(['Nonsense', 'or', 'confidence'])) | 32.529412 | 66 | 0.631103 | 75 | 553 | 4.44 | 0.4 | 0.135135 | 0.288288 | 0.24024 | 0.468468 | 0.192192 | 0 | 0 | 0 | 0 | 0 | 0.011547 | 0.216998 | 553 | 17 | 67 | 32.529412 | 0.757506 | 0.537071 | 0 | 0 | 0 | 0 | 0.144578 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.125 | false | 0 | 0 | 0 | 0.25 | 0.375 | 0 | 0 | 0 | null | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
ca9f8527ae0970f084f276d7c7ca8bfc422611a6 | 790 | py | Python | src/school_college/models.py | paceite/Seelife---An-NGO-Website | 02e6b5ec94d9a76079eccde54b3cd40b9e979def | [
"MIT"
] | null | null | null | src/school_college/models.py | paceite/Seelife---An-NGO-Website | 02e6b5ec94d9a76079eccde54b3cd40b9e979def | [
"MIT"
] | null | null | null | src/school_college/models.py | paceite/Seelife---An-NGO-Website | 02e6b5ec94d9a76079eccde54b3cd40b9e979def | [
"MIT"
] | null | null | null | from django.db import models
from django.contrib.auth import get_user_model, authenticate, login, logout
User = get_user_model()
# Create your models here.
class Teacher(models.Model):
name = models.CharField(max_length=100)
email = models.EmailField(max_length=255, unique=True, verbose_name='email address')
class Parents(models.Model):
name = models.CharField(max_length=100)
email = models.EmailField(max_length=255, unique=True, verbose_name='email address')
class Student(models.Model):
name = models.CharField(max_length=100)
school = models.CharField(max_length=100)
is_present = models.BooleanField(default=False)
teacher = models.ForeignKey(Teacher, on_delete=models.CASCADE)
parents = models.ForeignKey(Parents, on_delete=models.CASCADE)
| 35.909091 | 88 | 0.765823 | 106 | 790 | 5.566038 | 0.396226 | 0.091525 | 0.122034 | 0.162712 | 0.5 | 0.454237 | 0.454237 | 0.454237 | 0.383051 | 0.383051 | 0 | 0.026125 | 0.127848 | 790 | 21 | 89 | 37.619048 | 0.830189 | 0.03038 | 0 | 0.333333 | 0 | 0 | 0.034031 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.133333 | 0 | 0.933333 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
cab5b34af7ca312cb5dcc48e803b2376e7b76a40 | 379 | py | Python | trainer/da/source_only.py | weigq/UDA-1 | 4f97980980cafd0a2d02a77211ac7dbaf3e331f6 | [
"MIT"
] | 32 | 2021-11-08T15:45:30.000Z | 2022-03-30T09:08:57.000Z | trainer/da/source_only.py | weigq/UDA-1 | 4f97980980cafd0a2d02a77211ac7dbaf3e331f6 | [
"MIT"
] | 3 | 2021-11-16T02:38:51.000Z | 2022-02-21T13:29:58.000Z | trainer/da/source_only.py | weigq/UDA-1 | 4f97980980cafd0a2d02a77211ac7dbaf3e331f6 | [
"MIT"
] | 4 | 2021-11-09T02:53:18.000Z | 2021-12-21T22:11:35.000Z | # --------------------------------------------------------
# Copyright (c) 2021 Microsoft
# Licensed under The MIT License
# --------------------------------------------------------
from trainer.base_trainer import BaseTrainer
__all__ = ['SourceOnly']
class SourceOnly(BaseTrainer):
def __init__(self, cfg):
super(SourceOnly, self).__init__(cfg)
| 23.6875 | 59 | 0.474934 | 29 | 379 | 5.758621 | 0.758621 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.012618 | 0.163588 | 379 | 15 | 60 | 25.266667 | 0.514196 | 0.456464 | 0 | 0 | 0 | 0 | 0.054054 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.2 | false | 0 | 0.2 | 0 | 0.6 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
cad833eb69111a4438b70094d39c1838a00c569e | 1,526 | py | Python | server/apps/user/views.py | taras1k/flask_auth_service | 72ee75ecd556fa553aad091063391de495555dce | [
"MIT"
] | null | null | null | server/apps/user/views.py | taras1k/flask_auth_service | 72ee75ecd556fa553aad091063391de495555dce | [
"MIT"
] | null | null | null | server/apps/user/views.py | taras1k/flask_auth_service | 72ee75ecd556fa553aad091063391de495555dce | [
"MIT"
] | null | null | null | from flask import Blueprint, request, jsonify
from flask.ext.login import login_user, login_required
from flask.ext.login import logout_user
from extensions import login_manager, db
from app_exceptions import UserInputError
from .models import User
user_app = Blueprint('user_app', __name__)
@login_manager.user_loader
def load_user(userid):
return User.query.filter_by(id=userid).first()
@user_app.route('/logout')
@login_required
def logout():
logout_user()
return jsonify({'status': True})
@user_app.route('/login', methods=['POST'])
def login():
email = request.form.get('email', '')
password = request.form.get('pasword', '')
user = User.query.filter_by(email=email).first()
if user and user.check_password(password):
login_user(user)
else:
raise UserInputError('login error')
return jsonify({'status': True})
@user_app.route('/register', methods=['POST'])
def reqister():
email = request.form.get('email')
password = request.form.get('password')
#! TODO add password required and email validation
password_confirm = request.form.get('password_confirm')
if password != password_confirm:
raise UserInputError('password_missmatch', payload={'password': 'mismatch'})
user = User.query.filter_by(email=email).first()
if user:
raise UserInputError('email_exists ', payload={'email': 'email_exists'})
user = User(email, password)
db.session.add(user)
db.session.commit()
return jsonify({'status': True})
| 29.346154 | 84 | 0.704456 | 194 | 1,526 | 5.386598 | 0.293814 | 0.038278 | 0.066986 | 0.048804 | 0.279426 | 0.235407 | 0.235407 | 0.168421 | 0.168421 | 0.080383 | 0 | 0 | 0.15924 | 1,526 | 51 | 85 | 29.921569 | 0.814497 | 0.03211 | 0 | 0.128205 | 0 | 0 | 0.116531 | 0 | 0 | 0 | 0 | 0.019608 | 0 | 1 | 0.102564 | false | 0.179487 | 0.153846 | 0.025641 | 0.358974 | 0.051282 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 2 |
cadf70102c08db368d8af4a7d8830679371cc279 | 11,754 | py | Python | visualize.py | jainabhishek/UNOVOST | a6e804e82e40f8789cde4f5b2a6aa808d02440a7 | [
"MIT"
] | 42 | 2020-04-05T19:52:46.000Z | 2022-03-22T07:01:01.000Z | visualize.py | jainabhishek/UNOVOST | a6e804e82e40f8789cde4f5b2a6aa808d02440a7 | [
"MIT"
] | 5 | 2020-04-25T17:11:31.000Z | 2021-08-11T20:53:44.000Z | visualize.py | jainabhishek/UNOVOST | a6e804e82e40f8789cde4f5b2a6aa808d02440a7 | [
"MIT"
] | 9 | 2020-04-27T02:57:46.000Z | 2021-03-25T21:26:40.000Z | #!/usr/bin/env python3
import numpy as np
import os
import shutil
from PIL import Image
import cv2
from scipy.misc import imread
pascal_colormap = [
0, 0, 0,
0.5020, 0, 0,
0, 0.5020, 0,
0.5020, 0.5020, 0,
0, 0, 0.5020,
0.5020, 0, 0.5020,
0, 0.5020, 0.5020,
0.5020, 0.5020, 0.5020,
0.2510, 0, 0,
0.7529, 0, 0,
0.2510, 0.5020, 0,
0.7529, 0.5020, 0,
0.2510, 0, 0.5020,
0.7529, 0, 0.5020,
0.2510, 0.5020, 0.5020,
0.7529, 0.5020, 0.5020,
0, 0.2510, 0,
0.5020, 0.2510, 0,
0, 0.7529, 0,
0.5020, 0.7529, 0,
0, 0.2510, 0.5020,
0.5020, 0.2510, 0.5020,
0, 0.7529, 0.5020,
0.5020, 0.7529, 0.5020,
0.2510, 0.2510, 0,
0.7529, 0.2510, 0,
0.2510, 0.7529, 0,
0.7529, 0.7529, 0,
0.2510, 0.2510, 0.5020,
0.7529, 0.2510, 0.5020,
0.2510, 0.7529, 0.5020,
0.7529, 0.7529, 0.5020,
0, 0, 0.2510,
0.5020, 0, 0.2510,
0, 0.5020, 0.2510,
0.5020, 0.5020, 0.2510,
0, 0, 0.7529,
0.5020, 0, 0.7529,
0, 0.5020, 0.7529,
0.5020, 0.5020, 0.7529,
0.2510, 0, 0.2510,
0.7529, 0, 0.2510,
0.2510, 0.5020, 0.2510,
0.7529, 0.5020, 0.2510,
0.2510, 0, 0.7529,
0.7529, 0, 0.7529,
0.2510, 0.5020, 0.7529,
0.7529, 0.5020, 0.7529,
0, 0.2510, 0.2510,
0.5020, 0.2510, 0.2510,
0, 0.7529, 0.2510,
0.5020, 0.7529, 0.2510,
0, 0.2510, 0.7529,
0.5020, 0.2510, 0.7529,
0, 0.7529, 0.7529,
0.5020, 0.7529, 0.7529,
0.2510, 0.2510, 0.2510,
0.7529, 0.2510, 0.2510,
0.2510, 0.7529, 0.2510,
0.7529, 0.7529, 0.2510,
0.2510, 0.2510, 0.7529,
0.7529, 0.2510, 0.7529,
0.2510, 0.7529, 0.7529,
0.7529, 0.7529, 0.7529,
0.1255, 0, 0,
0.6275, 0, 0,
0.1255, 0.5020, 0,
0.6275, 0.5020, 0,
0.1255, 0, 0.5020,
0.6275, 0, 0.5020,
0.1255, 0.5020, 0.5020,
0.6275, 0.5020, 0.5020,
0.3765, 0, 0,
0.8784, 0, 0,
0.3765, 0.5020, 0,
0.8784, 0.5020, 0,
0.3765, 0, 0.5020,
0.8784, 0, 0.5020,
0.3765, 0.5020, 0.5020,
0.8784, 0.5020, 0.5020,
0.1255, 0.2510, 0,
0.6275, 0.2510, 0,
0.1255, 0.7529, 0,
0.6275, 0.7529, 0,
0.1255, 0.2510, 0.5020,
0.6275, 0.2510, 0.5020,
0.1255, 0.7529, 0.5020,
0.6275, 0.7529, 0.5020,
0.3765, 0.2510, 0,
0.8784, 0.2510, 0,
0.3765, 0.7529, 0,
0.8784, 0.7529, 0,
0.3765, 0.2510, 0.5020,
0.8784, 0.2510, 0.5020,
0.3765, 0.7529, 0.5020,
0.8784, 0.7529, 0.5020,
0.1255, 0, 0.2510,
0.6275, 0, 0.2510,
0.1255, 0.5020, 0.2510,
0.6275, 0.5020, 0.2510,
0.1255, 0, 0.7529,
0.6275, 0, 0.7529,
0.1255, 0.5020, 0.7529,
0.6275, 0.5020, 0.7529,
0.3765, 0, 0.2510,
0.8784, 0, 0.2510,
0.3765, 0.5020, 0.2510,
0.8784, 0.5020, 0.2510,
0.3765, 0, 0.7529,
0.8784, 0, 0.7529,
0.3765, 0.5020, 0.7529,
0.8784, 0.5020, 0.7529,
0.1255, 0.2510, 0.2510,
0.6275, 0.2510, 0.2510,
0.1255, 0.7529, 0.2510,
0.6275, 0.7529, 0.2510,
0.1255, 0.2510, 0.7529,
0.6275, 0.2510, 0.7529,
0.1255, 0.7529, 0.7529,
0.6275, 0.7529, 0.7529,
0.3765, 0.2510, 0.2510,
0.8784, 0.2510, 0.2510,
0.3765, 0.7529, 0.2510,
0.8784, 0.7529, 0.2510,
0.3765, 0.2510, 0.7529,
0.8784, 0.2510, 0.7529,
0.3765, 0.7529, 0.7529,
0.8784, 0.7529, 0.7529,
0, 0.1255, 0,
0.5020, 0.1255, 0,
0, 0.6275, 0,
0.5020, 0.6275, 0,
0, 0.1255, 0.5020,
0.5020, 0.1255, 0.5020,
0, 0.6275, 0.5020,
0.5020, 0.6275, 0.5020,
0.2510, 0.1255, 0,
0.7529, 0.1255, 0,
0.2510, 0.6275, 0,
0.7529, 0.6275, 0,
0.2510, 0.1255, 0.5020,
0.7529, 0.1255, 0.5020,
0.2510, 0.6275, 0.5020,
0.7529, 0.6275, 0.5020,
0, 0.3765, 0,
0.5020, 0.3765, 0,
0, 0.8784, 0,
0.5020, 0.8784, 0,
0, 0.3765, 0.5020,
0.5020, 0.3765, 0.5020,
0, 0.8784, 0.5020,
0.5020, 0.8784, 0.5020,
0.2510, 0.3765, 0,
0.7529, 0.3765, 0,
0.2510, 0.8784, 0,
0.7529, 0.8784, 0,
0.2510, 0.3765, 0.5020,
0.7529, 0.3765, 0.5020,
0.2510, 0.8784, 0.5020,
0.7529, 0.8784, 0.5020,
0, 0.1255, 0.2510,
0.5020, 0.1255, 0.2510,
0, 0.6275, 0.2510,
0.5020, 0.6275, 0.2510,
0, 0.1255, 0.7529,
0.5020, 0.1255, 0.7529,
0, 0.6275, 0.7529,
0.5020, 0.6275, 0.7529,
0.2510, 0.1255, 0.2510,
0.7529, 0.1255, 0.2510,
0.2510, 0.6275, 0.2510,
0.7529, 0.6275, 0.2510,
0.2510, 0.1255, 0.7529,
0.7529, 0.1255, 0.7529,
0.2510, 0.6275, 0.7529,
0.7529, 0.6275, 0.7529,
0, 0.3765, 0.2510,
0.5020, 0.3765, 0.2510,
0, 0.8784, 0.2510,
0.5020, 0.8784, 0.2510,
0, 0.3765, 0.7529,
0.5020, 0.3765, 0.7529,
0, 0.8784, 0.7529,
0.5020, 0.8784, 0.7529,
0.2510, 0.3765, 0.2510,
0.7529, 0.3765, 0.2510,
0.2510, 0.8784, 0.2510,
0.7529, 0.8784, 0.2510,
0.2510, 0.3765, 0.7529,
0.7529, 0.3765, 0.7529,
0.2510, 0.8784, 0.7529,
0.7529, 0.8784, 0.7529,
0.1255, 0.1255, 0,
0.6275, 0.1255, 0,
0.1255, 0.6275, 0,
0.6275, 0.6275, 0,
0.1255, 0.1255, 0.5020,
0.6275, 0.1255, 0.5020,
0.1255, 0.6275, 0.5020,
0.6275, 0.6275, 0.5020,
0.3765, 0.1255, 0,
0.8784, 0.1255, 0,
0.3765, 0.6275, 0,
0.8784, 0.6275, 0,
0.3765, 0.1255, 0.5020,
0.8784, 0.1255, 0.5020,
0.3765, 0.6275, 0.5020,
0.8784, 0.6275, 0.5020,
0.1255, 0.3765, 0,
0.6275, 0.3765, 0,
0.1255, 0.8784, 0,
0.6275, 0.8784, 0,
0.1255, 0.3765, 0.5020,
0.6275, 0.3765, 0.5020,
0.1255, 0.8784, 0.5020,
0.6275, 0.8784, 0.5020,
0.3765, 0.3765, 0,
0.8784, 0.3765, 0,
0.3765, 0.8784, 0,
0.8784, 0.8784, 0,
0.3765, 0.3765, 0.5020,
0.8784, 0.3765, 0.5020,
0.3765, 0.8784, 0.5020,
0.8784, 0.8784, 0.5020,
0.1255, 0.1255, 0.2510,
0.6275, 0.1255, 0.2510,
0.1255, 0.6275, 0.2510,
0.6275, 0.6275, 0.2510,
0.1255, 0.1255, 0.7529,
0.6275, 0.1255, 0.7529,
0.1255, 0.6275, 0.7529,
0.6275, 0.6275, 0.7529,
0.3765, 0.1255, 0.2510,
0.8784, 0.1255, 0.2510,
0.3765, 0.6275, 0.2510,
0.8784, 0.6275, 0.2510,
0.3765, 0.1255, 0.7529,
0.8784, 0.1255, 0.7529,
0.3765, 0.6275, 0.7529,
0.8784, 0.6275, 0.7529,
0.1255, 0.3765, 0.2510,
0.6275, 0.3765, 0.2510,
0.1255, 0.8784, 0.2510,
0.6275, 0.8784, 0.2510,
0.1255, 0.3765, 0.7529,
0.6275, 0.3765, 0.7529,
0.1255, 0.8784, 0.7529,
0.6275, 0.8784, 0.7529,
0.3765, 0.3765, 0.2510,
0.8784, 0.3765, 0.2510,
0.3765, 0.8784, 0.2510,
0.8784, 0.8784, 0.2510,
0.3765, 0.3765, 0.7529,
0.8784, 0.3765, 0.7529,
0.3765, 0.8784, 0.7529,
0.8784, 0.8784, 0.7529]
detectron_colormap = [
0.000, 0.447, 0.741,
0.850, 0.325, 0.098,
0.929, 0.694, 0.125,
0.494, 0.184, 0.556,
0.466, 0.674, 0.188,
0.301, 0.745, 0.933,
0.635, 0.078, 0.184,
0.300, 0.300, 0.300,
0.600, 0.600, 0.600,
1.000, 0.000, 0.000,
1.000, 0.500, 0.000,
0.749, 0.749, 0.000,
0.000, 1.000, 0.000,
0.000, 0.000, 1.000,
0.667, 0.000, 1.000,
0.333, 0.333, 0.000,
0.333, 0.667, 0.000,
0.333, 1.000, 0.000,
0.667, 0.333, 0.000,
0.667, 0.667, 0.000,
0.667, 1.000, 0.000,
1.000, 0.333, 0.000,
1.000, 0.667, 0.000,
1.000, 1.000, 0.000,
0.000, 0.333, 0.500,
0.000, 0.667, 0.500,
0.000, 1.000, 0.500,
0.333, 0.000, 0.500,
0.333, 0.333, 0.500,
0.333, 0.667, 0.500,
0.333, 1.000, 0.500,
0.667, 0.000, 0.500,
0.667, 0.333, 0.500,
0.667, 0.667, 0.500,
0.667, 1.000, 0.500,
1.000, 0.000, 0.500,
1.000, 0.333, 0.500,
1.000, 0.667, 0.500,
1.000, 1.000, 0.500,
0.000, 0.333, 1.000,
0.000, 0.667, 1.000,
0.000, 1.000, 1.000,
0.333, 0.000, 1.000,
0.333, 0.333, 1.000,
0.333, 0.667, 1.000,
0.333, 1.000, 1.000,
0.667, 0.000, 1.000,
0.667, 0.333, 1.000,
0.667, 0.667, 1.000,
0.667, 1.000, 1.000,
1.000, 0.000, 1.000,
1.000, 0.333, 1.000,
1.000, 0.667, 1.000,
0.167, 0.000, 0.000,
0.333, 0.000, 0.000,
0.500, 0.000, 0.000,
0.667, 0.000, 0.000,
0.833, 0.000, 0.000,
1.000, 0.000, 0.000,
0.000, 0.167, 0.000,
0.000, 0.333, 0.000,
0.000, 0.500, 0.000,
0.000, 0.667, 0.000,
0.000, 0.833, 0.000,
0.000, 1.000, 0.000,
0.000, 0.000, 0.167,
0.000, 0.000, 0.333,
0.000, 0.000, 0.500,
0.000, 0.000, 0.667,
0.000, 0.000, 0.833,
0.000, 0.000, 1.000,
0.000, 0.000, 0.000,
0.143, 0.143, 0.143,
0.286, 0.286, 0.286,
0.429, 0.429, 0.429,
0.571, 0.571, 0.571,
0.714, 0.714, 0.714,
0.857, 0.857, 0.857,
1.000, 1.000, 1.000
]
def draw_mask(im, mask, alpha=0.5, color=None):
colmap = (np.array(pascal_colormap) * 255).round().astype("uint8").reshape(256, 3)
if color is None:
color = detectron_colormap[np.random.choice(len(detectron_colormap))][::-1]
else:
while color >= 255:
color = color - 254
color = colmap[color]
im = np.where(np.repeat((mask > 0)[:, :, None], 3, axis=2),
im * (1 - alpha) + color * alpha, im)
im = im.astype('uint8')
return im
def save_jpg(masks, t, image_dir, viz_dir, mask_ids, name=None):
if name is not None:
viz_dir = viz_dir % name
if not os.path.exists(viz_dir):
os.makedirs(viz_dir)
img = imread(image_dir)
img = img[:, :, :3]
for i, (idx, mask) in enumerate(zip(mask_ids, masks)):
img = draw_mask(img, mask, color=idx)
cv2.imwrite(viz_dir + '/' + str(t + 1).zfill(5) + '.jpg', cv2.cvtColor(img, cv2.COLOR_RGB2BGR))
def save_with_pascal_colormap(img_dir, img):
colmap = (np.array(pascal_colormap) * 255).round().astype("uint8")
palimage = Image.new('P', (16, 16))
palimage.putpalette(colmap)
im = Image.fromarray(np.squeeze(img.astype("uint8")))
im2 = im.quantize(palette=palimage)
im2.save(img_dir)
def visualize_tracklets(tracklets, all_props, image_size, output_directory, name=None):
if name is not None:
output_directory = output_directory % name
if os.path.exists(output_directory): # os.path.exists(output_directory % name):
shutil.rmtree(output_directory)
png = np.zeros(image_size, dtype=int)
if len(tracklets) > 0:
for t, props in enumerate(all_props):
if len(props) > 0:
props_to_use = tracklets[:, t]
props_to_use_ind = np.where(tracklets[:, t] != -1)[0].tolist()
for j, i in enumerate(props_to_use_ind):
png[props["mask"][props_to_use[i]].astype("bool")] = 2
tracklet_directory = output_directory + 'tracklet_' + str(i) + '/'
if not os.path.exists(tracklet_directory):
os.makedirs(tracklet_directory)
save_with_pascal_colormap(tracklet_directory + str(t + 1).zfill(5) + '.png', png)
png = np.zeros(image_size)
def visualize_proposals(proposals, image_size, output_directory, name=None):
png = np.zeros(image_size, dtype=int)
if name is not None:
output_directory = output_directory % name
for t, props in enumerate(proposals):
directory = output_directory + 'time_' + str(t) + '/'
if not os.path.exists(directory):
os.makedirs(directory)
if len(props['seg']) > 0:
for i in range(len(props['mask'])):
png[props["mask"][i].astype("bool")] = 2
save_with_pascal_colormap(directory + str(i).zfill(5) + '.png', png)
png = np.zeros_like(props["mask"][0])
else:
save_with_pascal_colormap(directory + str(i).zfill(5) + '.png', png)
| 27.145497 | 101 | 0.531138 | 2,323 | 11,754 | 2.656909 | 0.065433 | 0.041478 | 0.124433 | 0.037589 | 0.775762 | 0.569832 | 0.5465 | 0.500162 | 0.47197 | 0.36698 | 0 | 0.505133 | 0.270716 | 11,754 | 432 | 102 | 27.208333 | 0.214886 | 0.005275 | 0 | 0.046798 | 0 | 0 | 0.006929 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.012315 | false | 0 | 0.014778 | 0 | 0.029557 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
cae29d2f23973e2dcd1d3e930c9773167dd222d4 | 2,354 | py | Python | multimedia_chat/urls.py | faizans-cuelogic/django-multimedia-basic-chat | 8a5f19cee5d7a9e9dd52ebeb57483667850bd633 | [
"MIT"
] | null | null | null | multimedia_chat/urls.py | faizans-cuelogic/django-multimedia-basic-chat | 8a5f19cee5d7a9e9dd52ebeb57483667850bd633 | [
"MIT"
] | null | null | null | multimedia_chat/urls.py | faizans-cuelogic/django-multimedia-basic-chat | 8a5f19cee5d7a9e9dd52ebeb57483667850bd633 | [
"MIT"
] | null | null | null | #/********************************************************************************
#* AUDETEMI INC. ("COMPANY") CONFIDENTIAL
#*_______________________________________
#*
#* Unpublished Copyright (c) 2015-2017 [AUDETEMI INC].
#* http://www.audetemi.com.
#* All Rights Reserved.
#*
#* NOTICE: All information contained herein is, and remains the property of COMPANY. * The intellectual and #technical concepts contained herein are proprietary to COMPANY * and may be covered by U.S. and Foreign Patents, #patents in process, and are
#* protected by trade secret or copyright law.
#* Dissemination of this information or reproduction of this material is strictly
#* forbidden unless prior written permission is obtained from COMPANY.
#* Access to the source code contained herein is hereby forbidden to anyone except
#* current COMPANY employees, managers or contractors who have executed
#* Confidentiality and Non-disclosure agreements explicitly covering such access.
#*
#* The copyright notice above does not evidence any actual or intended publication or * disclosure of this source #code, which includes information that is confidential
#* and/or proprietary, and is a trade secret, of the COMPANY.
#*
#* ANY SUB-LICENSING, REPRODUCTION, REVERSE ENGINEERING, DECOMPILATION, MODIFICATION, * DISTRIBUTION, PUBLIC #PERFORMANCE, OR PUBLIC DISPLAY OF OR THROUGH USE OF THIS
#* SOURCE CODE WITHOUT THE EXPRESS WRITTEN CONSENT OF COMPANY IS STRICTLY PROHIBITED,
#* AND IN VIOLATION OF APPLICABLE LAWS AND INTERNATIONAL TREATIES. THE RECEIPT OR
#* POSSESSION OF THIS SOURCE CODE AND/OR RELATED INFORMATION DOES NOT CONVEY OR IMPLY * ANY RIGHTS TO REPRODUCE, #DISCLOSE OR DISTRIBUTE ITS CONTENTS, OR TO MANUFACTURE,
#* USE, OR SELL ANYTHING THAT IT MAY DESCRIBE, IN WHOLE OR IN PART.
#*/
from django.conf.urls import url
from rest_framework.urlpatterns import format_suffix_patterns
from multimedia_chat import views
urlpatterns = [
url(r'^chat/$', views.MessageList.as_view(),
name='chat'),
# url(r'^chat/feeds/$', views.RetrieveLatestFeed.as_view(),
# name='chat_feeds'),
# url(r'^update/chat/$', views.MessageActivity.as_view(),
# name='update_chat'),
# url(r'^message/(?P<id>[0-9]+)/$', views.MessageDetailAPI.as_view(),
# name='message_detail'),
]
# urlpatterns = format_suffix_patterns(urlpatterns)
| 52.311111 | 251 | 0.730246 | 302 | 2,354 | 5.519868 | 0.523179 | 0.017996 | 0.023995 | 0.028794 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.00498 | 0.146984 | 2,354 | 44 | 252 | 53.5 | 0.825199 | 0.86576 | 0 | 0 | 0 | 0 | 0.039427 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.428571 | 0 | 0.428571 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 2 |
caebb177a6d5c87f8b09e0507f76b02ac300af12 | 185 | py | Python | init/CreateParam.py | Berni1557/MDDoc | 06dd3cae302e6f125ebfbb2fc513bb754d72f07d | [
"BSD-3-Clause"
] | null | null | null | init/CreateParam.py | Berni1557/MDDoc | 06dd3cae302e6f125ebfbb2fc513bb754d72f07d | [
"BSD-3-Clause"
] | null | null | null | init/CreateParam.py | Berni1557/MDDoc | 06dd3cae302e6f125ebfbb2fc513bb754d72f07d | [
"BSD-3-Clause"
] | null | null | null | # Import Param
import Param
xmlpath = 'H:/cloud/cloud_data/Projects/MDDoc/init/init.xml'
Param.param.init(xmlpath)
Param.param.create()
Param.param.write()
Param.param.printParams()
| 16.818182 | 60 | 0.767568 | 27 | 185 | 5.222222 | 0.481481 | 0.283688 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.081081 | 185 | 10 | 61 | 18.5 | 0.829412 | 0.064865 | 0 | 0 | 0 | 0 | 0.284024 | 0.284024 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.166667 | 0 | 0.166667 | 0.166667 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
caf3a8ed680d12e8ae901e5d8e093a8011145f69 | 726 | py | Python | VBYO-2017/kodlar/YuksekBasarimliHesaplama/Theano/multi_16.py | metinuslu/VeriBilimiYazOkullari | 474c4481a779532fb667874a44bcb03f8852e8e0 | [
"MIT"
] | 3 | 2020-02-17T19:17:56.000Z | 2021-09-03T10:38:32.000Z | VBYO-2017/kodlar/YuksekBasarimliHesaplama/Theano/multi_16.py | gokhangemici/VeriBilimiYazOkullari | 474c4481a779532fb667874a44bcb03f8852e8e0 | [
"MIT"
] | null | null | null | VBYO-2017/kodlar/YuksekBasarimliHesaplama/Theano/multi_16.py | gokhangemici/VeriBilimiYazOkullari | 474c4481a779532fb667874a44bcb03f8852e8e0 | [
"MIT"
] | 3 | 2019-12-07T01:11:03.000Z | 2021-09-03T10:38:35.000Z | #export THEANO_FLAGS="contexts=dev0->cuda0;dev1->cuda1"; python multi_16.py
import numpy
import theano
import time
N = 16 * 1024;
v01 = theano.shared(numpy.random.random((N, N)).astype('float32'),
target='dev0')
v02 = theano.shared(numpy.random.random((N, N)).astype('float32'),
target='dev0')
v11 = theano.shared(numpy.random.random((N, N)).astype('float32'),
target='dev1')
v12 = theano.shared(numpy.random.random((N, N)).astype('float32'),
target='dev1')
f = theano.function([], [theano.tensor.dot(v01, v02),
theano.tensor.dot(v11, v12)])
t = time.time()
f();
print "completed in %f seconds" %(time.time() - t)
| 30.25 | 76 | 0.589532 | 94 | 726 | 4.531915 | 0.37234 | 0.112676 | 0.159624 | 0.215962 | 0.507042 | 0.507042 | 0.507042 | 0.507042 | 0.507042 | 0.507042 | 0 | 0.071429 | 0.22865 | 726 | 23 | 77 | 31.565217 | 0.689286 | 0.101928 | 0 | 0.235294 | 0 | 0 | 0.103077 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.176471 | null | null | 0.058824 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 2 |
caff2b9bad013d3fb4a40ad33053fa02101f777c | 1,450 | py | Python | tests/AllTests.py | Mohammed-El-Nabulsi/single-electron-transistor | db1abd3627312403be83197c27d06ac4e3a61746 | [
"BSD-2-Clause"
] | null | null | null | tests/AllTests.py | Mohammed-El-Nabulsi/single-electron-transistor | db1abd3627312403be83197c27d06ac4e3a61746 | [
"BSD-2-Clause"
] | null | null | null | tests/AllTests.py | Mohammed-El-Nabulsi/single-electron-transistor | db1abd3627312403be83197c27d06ac4e3a61746 | [
"BSD-2-Clause"
] | null | null | null | #!/usr/bin/env python3
# -*- coding: utf-8 -*-
import HaPPPy
import unittest
from tests.HaPPPyTest import HappyBasicTestSuite
from tests.OneBodyTest import OneBodyTestSuite
from tests.TwoBodyTest import TwoBodyTestSuite
from tests.TransmissionTest import TransmissionTestSuite
from tests.RatesTest import RatesTestSuite
from tests.MasterEquationTest import MasterEquationTestSuite
from tests.ParameterHandlerTest import ParameterHandlerTestSuite
if __name__ == '__main__':
happy_suite = unittest.TestLoader().loadTestsFromTestCase(HappyBasicTestSuite)
one_body_suite = unittest.TestLoader().loadTestsFromTestCase(OneBodyTestSuite)
two_body_suite = unittest.TestLoader().loadTestsFromTestCase(TwoBodyTestSuite)
transmission_suite = unittest.TestLoader().loadTestsFromTestCase(TransmissionTestSuite)
rates_suite = unittest.TestLoader().loadTestsFromTestCase(RatesTestSuite)
master_equation_suite = unittest.TestLoader().loadTestsFromTestCase(MasterEquationTestSuite)
# unittest.TextTestRunner(verbosity=2, buffer=True).run(happy_suite)
unittest.TextTestRunner(verbosity=2, buffer=True).run(one_body_suite)
unittest.TextTestRunner(verbosity=2, buffer=True).run(two_body_suite)
unittest.TextTestRunner(verbosity=2, buffer=True).run(transmission_suite)
unittest.TextTestRunner(verbosity=2, buffer=True).run(rates_suite)
unittest.TextTestRunner(verbosity=2, buffer=True).run(master_equation_suite)
| 53.703704 | 96 | 0.824138 | 145 | 1,450 | 8.062069 | 0.317241 | 0.122327 | 0.11805 | 0.225834 | 0.341317 | 0.259196 | 0.259196 | 0.220701 | 0.092387 | 0 | 0 | 0.00607 | 0.091034 | 1,450 | 26 | 97 | 55.769231 | 0.88088 | 0.075862 | 0 | 0 | 0 | 0 | 0.005984 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.428571 | 0 | 0.428571 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 2 |
1b0313842cc2c2d12ce0412511b39fe3cee2452b | 1,147 | py | Python | rx/core/operators/materialize.py | mmpio/RxPY | 4ed60bb5c04aa85de5210e5537a6adfe1b667d50 | [
"MIT"
] | 4,342 | 2015-01-06T09:00:23.000Z | 2022-03-28T15:05:50.000Z | rx/core/operators/materialize.py | mmpio/RxPY | 4ed60bb5c04aa85de5210e5537a6adfe1b667d50 | [
"MIT"
] | 613 | 2015-01-07T20:44:56.000Z | 2022-03-20T06:14:20.000Z | rx/core/operators/materialize.py | mmpio/RxPY | 4ed60bb5c04aa85de5210e5537a6adfe1b667d50 | [
"MIT"
] | 420 | 2015-01-07T14:30:30.000Z | 2022-03-11T22:47:46.000Z | from typing import Callable
from rx.core import Observable
from rx.core.notification import OnNext, OnError, OnCompleted
def _materialize() -> Callable[[Observable], Observable]:
def materialize(source: Observable) -> Observable:
"""Partially applied materialize operator.
Materializes the implicit notifications of an observable
sequence as explicit notification values.
Args:
source: Source observable to materialize.
Returns:
An observable sequence containing the materialized
notification values from the source sequence.
"""
def subscribe(observer, scheduler=None):
def on_next(value):
observer.on_next(OnNext(value))
def on_error(exception):
observer.on_next(OnError(exception))
observer.on_completed()
def on_completed():
observer.on_next(OnCompleted())
observer.on_completed()
return source.subscribe_(on_next, on_error, on_completed, scheduler)
return Observable(subscribe)
return materialize
| 31.861111 | 80 | 0.646905 | 113 | 1,147 | 6.451327 | 0.380531 | 0.041152 | 0.057613 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.285963 | 1,147 | 35 | 81 | 32.771429 | 0.89011 | 0.267655 | 0 | 0.117647 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.352941 | false | 0 | 0.176471 | 0 | 0.705882 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
1b06a4290f76358ccdc23172913bf940363abed4 | 2,690 | py | Python | caso/loading.py | alexcos78/caso | 364d669115419a19af88292d700d3ca7a6f55ee9 | [
"Apache-2.0"
] | 4 | 2018-04-27T10:32:07.000Z | 2021-11-25T02:52:31.000Z | caso/loading.py | alexcos78/caso | 364d669115419a19af88292d700d3ca7a6f55ee9 | [
"Apache-2.0"
] | 69 | 2015-01-15T11:16:50.000Z | 2021-11-15T15:33:22.000Z | caso/loading.py | enolfc/caso | d1bd16b496d441d5eccfbb7780978135d416c21e | [
"Apache-2.0"
] | 22 | 2015-01-20T00:01:52.000Z | 2022-03-31T11:13:20.000Z | # -*- coding: utf-8 -*-
# Copyright 2019 Spanish National Research Council (CSIC)
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
# License for the specific language governing permissions and limitations
# under the License.
import stevedore
from caso import exception
EXTRACTOR_NAMESPACE = "caso.extractors"
MESSENGER_NAMESPACE = "caso.messenger"
def _get_names(what):
mgr = stevedore.ExtensionManager(namespace=what)
return frozenset(mgr.names())
def _get(what):
mgr = stevedore.ExtensionManager(namespace=what,
propagate_map_exceptions=True)
return dict(mgr.map(lambda ext: (ext.entry_point.name, ext.plugin)))
def get_available_extractor_names():
"""Get the names of all the extractors that are available on the system.
:returns: A list of names.
:rtype: frozenset
"""
return _get_names(EXTRACTOR_NAMESPACE)
def get_available_extractors():
"""Retrieve all the extractors available on the system.
:returns: A dict with the entrypoint name as the key and the extractor
as the value.
:rtype: dict
"""
return _get(EXTRACTOR_NAMESPACE)
def get_available_messenger_names():
"""Get the names of all the messengers that are available on the system.
:returns: A list of names.
:rtype: frozenset
"""
return _get_names(MESSENGER_NAMESPACE)
def get_available_messengers():
"""Retrieve all the messengers available on the system.
:returns: A dict with the entrypoint name as the key and the messenger
as the value.
:rtype: dict
"""
return _get(MESSENGER_NAMESPACE)
def get_enabled_messengers(names):
"""Retrieve all the enabled messengers on the system.
:returns: An extension manager.
"""
def cb(names):
raise exception.MessengerNotFound(names=",".join(list(names)))
mgr = stevedore.NamedExtensionManager(namespace=MESSENGER_NAMESPACE,
names=names,
name_order=True,
on_missing_entrypoints_callback=cb,
invoke_on_load=True,
propagate_map_exceptions=True)
return mgr
| 29.56044 | 77 | 0.66171 | 328 | 2,690 | 5.307927 | 0.378049 | 0.024124 | 0.031591 | 0.051694 | 0.348076 | 0.273406 | 0.221712 | 0.161976 | 0.161976 | 0.161976 | 0 | 0.004541 | 0.263197 | 2,690 | 90 | 78 | 29.888889 | 0.873865 | 0.461338 | 0 | 0.068966 | 0 | 0 | 0.022371 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.275862 | false | 0 | 0.068966 | 0 | 0.586207 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 2 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.