Split (1)

train · 675k rows

hexsha string	size int64	ext string	lang string	max_stars_repo_path string	max_stars_repo_name string	max_stars_repo_head_hexsha string	max_stars_repo_licenses list	max_stars_count int64	max_stars_repo_stars_event_min_datetime string	max_stars_repo_stars_event_max_datetime string	max_issues_repo_path string	max_issues_repo_name string	max_issues_repo_head_hexsha string	max_issues_repo_licenses list	max_issues_count int64	max_issues_repo_issues_event_min_datetime string	max_issues_repo_issues_event_max_datetime string	max_forks_repo_path string	max_forks_repo_name string	max_forks_repo_head_hexsha string	max_forks_repo_licenses list	max_forks_count int64	max_forks_repo_forks_event_min_datetime string	max_forks_repo_forks_event_max_datetime string	content string	avg_line_length float64	max_line_length int64	alphanum_fraction float64	qsc_code_num_words_quality_signal int64	qsc_code_num_chars_quality_signal float64	qsc_code_mean_word_length_quality_signal float64	qsc_code_frac_words_unique_quality_signal float64	qsc_code_frac_chars_top_2grams_quality_signal float64	qsc_code_frac_chars_top_3grams_quality_signal float64	qsc_code_frac_chars_top_4grams_quality_signal float64	qsc_code_frac_chars_dupe_5grams_quality_signal float64	qsc_code_frac_chars_dupe_6grams_quality_signal float64	qsc_code_frac_chars_dupe_7grams_quality_signal float64	qsc_code_frac_chars_dupe_8grams_quality_signal float64	qsc_code_frac_chars_dupe_9grams_quality_signal float64	qsc_code_frac_chars_dupe_10grams_quality_signal float64	qsc_code_frac_chars_digital_quality_signal float64	qsc_code_frac_chars_whitespace_quality_signal float64	qsc_code_size_file_byte_quality_signal float64	qsc_code_num_lines_quality_signal float64	qsc_code_num_chars_line_max_quality_signal float64	qsc_code_num_chars_line_mean_quality_signal float64	qsc_code_frac_chars_alphabet_quality_signal float64	qsc_code_frac_chars_comments_quality_signal float64	qsc_code_frac_lines_dupe_lines_quality_signal float64	qsc_code_cate_autogen_quality_signal float64	qsc_code_frac_lines_long_string_quality_signal float64	qsc_code_frac_chars_string_length_quality_signal float64	qsc_code_frac_chars_long_word_length_quality_signal float64	qsc_code_frac_lines_string_concat_quality_signal float64	qsc_code_frac_lines_prompt_comments_quality_signal float64	qsc_code_frac_lines_assert_quality_signal float64	qsc_codepython_cate_ast_quality_signal float64	qsc_codepython_frac_lines_func_ratio_quality_signal float64	qsc_codepython_cate_var_zero_quality_signal bool	qsc_codepython_frac_lines_pass_quality_signal float64	qsc_codepython_frac_lines_import_quality_signal float64	qsc_codepython_frac_lines_simplefunc_quality_signal float64	qsc_codepython_score_lines_no_logic_quality_signal float64	qsc_codepython_frac_lines_print_quality_signal float64	qsc_code_num_words int64	qsc_code_num_chars int64	qsc_code_frac_words_unique null	qsc_code_frac_chars_top_2grams int64	qsc_code_frac_chars_top_3grams int64	qsc_code_frac_chars_top_4grams int64	qsc_code_frac_chars_dupe_6grams int64	qsc_code_frac_chars_dupe_7grams int64	qsc_code_frac_chars_dupe_10grams int64	qsc_code_frac_chars_digital int64	qsc_code_num_lines int64	qsc_code_num_chars_line_max int64	qsc_code_frac_chars_alphabet int64	qsc_code_frac_chars_comments int64	qsc_code_cate_autogen int64	qsc_code_frac_lines_long_string int64	qsc_code_frac_chars_string_length int64	qsc_code_frac_chars_long_word_length int64	qsc_code_frac_lines_string_concat null	qsc_code_frac_lines_prompt_comments int64	qsc_codepython_cate_ast int64	qsc_codepython_frac_lines_func_ratio int64	qsc_codepython_cate_var_zero int64	qsc_codepython_frac_lines_pass int64	qsc_codepython_frac_lines_import int64	qsc_codepython_frac_lines_simplefunc int64	qsc_codepython_score_lines_no_logic int64	qsc_codepython_frac_lines_print int64	hits int64
a36b7a321d03ceb6242732e62556f3fd68b01130	2,140	py	Python	fcutils/maths/functions.py	FedeClaudi/fedes_utils	2ef6f037303fc426d5c5b2851d2c99f17efa4002	[ "MIT" ]	4	2020-09-19T23:42:53.000Z	2021-11-14T19:41:33.000Z	fcutils/maths/functions.py	FedeClaudi/fedes_utils	2ef6f037303fc426d5c5b2851d2c99f17efa4002	[ "MIT" ]	1	2022-02-21T13:09:43.000Z	2022-02-22T10:50:14.000Z	fcutils/maths/functions.py	FedeClaudi/fedes_utils	2ef6f037303fc426d5c5b2851d2c99f17efa4002	[ "MIT" ]	null	null	null	import numpy as np import math from scipy import stats # ------------------------ EXPONENTIALS AND LOGARITHMS ----------------------- # def fexponential(x, a, b, c): return a * np.exp(-b * x) + c def exponential(x, a, b, c, d): return a * np.exp(-c * (x - b)) + d def logarithmic(x, a, b, c): return a ...	22.765957	80	0.479907	360	2,140	2.825	0.236111	0.029499	0.017699	0.015733	0.460177	0.426745	0.424779	0.371681	0.316618	0.316618	0.036941	0.278972	2,140	93	81	23.010753	0.622165	0.286449	0.243902	0	0	0.018182	0	0	0	0	1	0.365854	false	0	0.073171	0.219512	0.804878	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
6e59545e425fb20d3491c6c5a0e5e611b2fd7915	256	py	Python	apps/uploads/admin.py	mehrbodjavadi79/AIC21-Backend	9f4342781f0722804a2eb704b43b52984c81b40a	[ "MIT" ]	3	2021-03-12T18:32:39.000Z	2021-11-08T10:21:04.000Z	apps/uploads/admin.py	mehrbodjavadi79/AIC21-Backend	9f4342781f0722804a2eb704b43b52984c81b40a	[ "MIT" ]	null	null	null	apps/uploads/admin.py	mehrbodjavadi79/AIC21-Backend	9f4342781f0722804a2eb704b43b52984c81b40a	[ "MIT" ]	2	2021-01-29T14:52:53.000Z	2022-03-05T10:24:24.000Z	from django.contrib import admin from django.contrib.admin import ModelAdmin from apps.uploads.models import FileUpload @admin.register(FileUpload) class FileUploadAdmin(ModelAdmin): list_display = ['name', '__str__'] list_editable = [] pass	23.272727	43	0.765625	30	256	6.333333	0.633333	0.105263	0.178947	0	0	0	0	0	0	0	0	0.144531	256	10	44	25.6	0.86758	0	0	0	0	0.042969	0	0	0	0	1	0	false	0.125	0.375	0	0.75	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	1	1	0	1	0	3
6e88ab3d0c30a87b0df3d01277d2108d183b0a09	95	py	Python	app/formulaire/apps.py	rach4you/secteur-app-api	c32093bc75db0ce84681df6cec5862542132e519	[ "MIT" ]	null	null	null	app/formulaire/apps.py	rach4you/secteur-app-api	c32093bc75db0ce84681df6cec5862542132e519	[ "MIT" ]	3	2021-03-10T22:56:54.000Z	2022-02-27T07:00:47.000Z	app/formulaire/apps.py	rach4you/secteur-app-api	c32093bc75db0ce84681df6cec5862542132e519	[ "MIT" ]	null	null	null	from django.apps import AppConfig class FormulaireConfig(AppConfig): name = 'formulaire'	15.833333	34	0.768421	10	95	7.3	0.9	0	0	0	0	0	0	0	0	0	0	0.157895	95	5	35	19	0.9125	0	0	0	0	0.105263	0	0	0	0	1	0	false	0	0.333333	0	1	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	0	0	3
6e8a4421ebef45d65c974d1dec4a31e576af837b	134	py	Python	telathbot/enums.py	telathio/telathbot	8bdb8a050d160d723619430d3f87ddf41f7866f7	[ "MIT" ]	9	2022-01-15T19:31:36.000Z	2022-03-09T11:46:14.000Z	telathbot/enums.py	telathio/telathbot	8bdb8a050d160d723619430d3f87ddf41f7866f7	[ "MIT" ]	22	2022-01-17T07:38:31.000Z	2022-03-24T21:57:50.000Z	telathbot/enums.py	telathio/telathbot	8bdb8a050d160d723619430d3f87ddf41f7866f7	[ "MIT" ]	null	null	null	from enum import Enum class SafetyToolsLevels(str, Enum): RED = "red" YELLOW = "yellow" GREEN = "green" ALL = "all"	14.888889	35	0.604478	16	134	5.0625	0.625	0	0	0	0	0	0	0	0	0	0	0.276119	134	8	36	16.75	0.835052	0	0	0	0	0.126866	0	0	0	0	1	0	false	0	0.166667	0	1	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	1	0	3
6e942f2a0c8984d1b0335ba471f9b845d758c915	363	py	Python	other/dingding/dingtalk/api/rest/OapiImChatScencegroupFileDownloadurlGetRequest.py	hth945/pytest	83e2aada82a2c6a0fdd1721320e5bf8b8fd59abc	[ "Apache-2.0" ]	null	null	null	other/dingding/dingtalk/api/rest/OapiImChatScencegroupFileDownloadurlGetRequest.py	hth945/pytest	83e2aada82a2c6a0fdd1721320e5bf8b8fd59abc	[ "Apache-2.0" ]	null	null	null	other/dingding/dingtalk/api/rest/OapiImChatScencegroupFileDownloadurlGetRequest.py	hth945/pytest	83e2aada82a2c6a0fdd1721320e5bf8b8fd59abc	[ "Apache-2.0" ]	null	null	null	''' Created by auto_sdk on 2021.04.01 ''' from dingtalk.api.base import RestApi class OapiImChatScencegroupFileDownloadurlGetRequest(RestApi): def __init__(self,url=None): RestApi.__init__(self,url) self.download_code = None def getHttpMethod(self): return 'POST' def getapiname(self): return 'dingtalk.oapi...	24.2	65	0.77686	47	363	5.787234	0.723404	0.058824	0.080882	0	0	0	0	0	0	0	0.024768	0.110193	363	14	66	25.928571	0.817337	0.090909	0	0	0	0.180124	0.167702	0	0	0	1	0.333333	false	0	0.111111	0.222222	0.777778	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
6e98de138350d2d06a5e5329f422bcd4de652128	213	py	Python	apps/shortener/models.py	shakib609/django-url-shortener	8880685c25d8a932c788ae68d7fc680b7da94f16	[ "MIT" ]	null	null	null	apps/shortener/models.py	shakib609/django-url-shortener	8880685c25d8a932c788ae68d7fc680b7da94f16	[ "MIT" ]	null	null	null	apps/shortener/models.py	shakib609/django-url-shortener	8880685c25d8a932c788ae68d7fc680b7da94f16	[ "MIT" ]	null	null	null	from django.db import models class ShortURL(models.Model): url = models.URLField(default=None) short_url = models.CharField(max_length=128, db_index=True) def __str__(self): return self.url	21.3	63	0.713615	30	213	4.833333	0.766667	0.124138	0	0	0	0	0	0	0	0	0.017341	0.187793	213	9	64	23.666667	0.820809	0	0	0	0	0	0	0	0	0	1	0.166667	false	0	0.166667	0.166667	1	0	0	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	1	1	0	3
6edbe30e2ecff76bb3c6368da8c483bbcbf3bd5e	1,828	py	Python	ros/src/tl_detector/light_classification/tl_classifier.py	rajaneesh-mutyalapati/autonomous	61e5fc9258f1c043b1e67d3ada1515c94521d370	[ "MIT" ]	null	null	null	ros/src/tl_detector/light_classification/tl_classifier.py	rajaneesh-mutyalapati/autonomous	61e5fc9258f1c043b1e67d3ada1515c94521d370	[ "MIT" ]	15	2020-09-26T01:06:18.000Z	2022-03-12T00:30:17.000Z	ros/src/tl_detector/light_classification/tl_classifier.py	JSachdev92/CarND-Capstone	62fefb52d4205188b174445467b6c64b8beb18b0	[ "MIT" ]	null	null	null	import os import time import calendar import tensorflow as tf from keras.preprocessing.image import array_to_img, img_to_array, load_img from PIL import Image, ImageOps import numpy as np import cv2 from object_classifier import ObjectClassifier from color_classifier import ColorClassifier #from traffic_light_colors...	29.967213	121	0.672867	226	1,828	5.225664	0.451327	0.11177	0.057578	0	0	0	0	0	0	0	0.004405	0.254923	1,828	60	122	30.466667	0.862702	0.212254	0	0	0	0.046143	0	0	0.016667	0	1	0.066667	false	0	0.4	0	0.533333	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	1	0	0	0	0	1	0	1	0	3
6eee5fbb9ca86d741651fcd0b551bcd1b95025eb	228	py	Python	__init__.py	squeezboks/geodesy	23d5272423324dc00176da517faf01743892d830	[ "MIT" ]	null	null	null	__init__.py	squeezboks/geodesy	23d5272423324dc00176da517faf01743892d830	[ "MIT" ]	null	null	null	__init__.py	squeezboks/geodesy	23d5272423324dc00176da517faf01743892d830	[ "MIT" ]	null	null	null	# tombstone __author__ = "N. Laughton" __copyright__ = "Copyright 2018, N. Laughton" __credits__ = ["N. Laughton"] __license__ = "MIT" __version__ = "0.1.0dev" __maintainer__ = "N. Laughton" __status__ = "development"	22.8	46	0.692982	23	228	5.652174	0.695652	0.276923	0	0	0	0	0	0	0	0	0.037037	0.171053	228	9	47	25.333333	0.650794	0.039474	0	0	0	0.394231	0	0	0	0	1	0	false	0	0	0	0	0	1	0	null	1	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
42b508539d22be25dd7c359ea01c7c0ee6af7c5a	493	py	Python	message_bot/database/_utils.py	kirillgashkov/message_bot	f29810c36e1ef98946f9f63b9c1c4745596fd584	[ "MIT" ]	2	2020-03-05T19:28:59.000Z	2020-03-10T06:01:43.000Z	message_bot/database/_utils.py	kirillgashkov/message_bot	f29810c36e1ef98946f9f63b9c1c4745596fd584	[ "MIT" ]	1	2021-02-08T20:29:08.000Z	2021-02-08T20:29:08.000Z	message_bot/database/_utils.py	kirillgashkov/message-bot	f29810c36e1ef98946f9f63b9c1c4745596fd584	[ "MIT" ]	null	null	null	""" Contains utility functions and classes shared between other database submodules. """ import collections class DatabaseView(collections.Mapping): def __init__(self, data: dict): self._data = data def __getitem__(self, key): item = self._data[key] if type(item) is dict: ...	18.961538	80	0.643002	58	493	5.103448	0.5	0.162162	0.074324	0	0	0	0	0	0	0	0	0.263692	493	25	81	19.72	0.815427	0.162272	0	0	0	0	0	0	0	0	1	0.307692	false	0	0.076923	0.153846	0.769231	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
6e0cdaaea5803efba9bd43b127b0ae49fccfe142	627	py	Python	tsheets/repos/__init__.py	meilinger/api_python	c5ddd4f448ae1622ddd29a6166fee5db43df11f9	[ "MIT" ]	null	null	null	tsheets/repos/__init__.py	meilinger/api_python	c5ddd4f448ae1622ddd29a6166fee5db43df11f9	[ "MIT" ]	null	null	null	tsheets/repos/__init__.py	meilinger/api_python	c5ddd4f448ae1622ddd29a6166fee5db43df11f9	[ "MIT" ]	null	null	null	from notifications import Notifications from reminders import Reminders from project import Project from payroll import Payroll from current_totals import CurrentTotals from last_modified_timestamps import LastModifiedTimestamps from effective_settings import EffectiveSettings from geolocations import Geolocations from...	39.1875	59	0.899522	74	627	7.486486	0.445946	0.039711	0	0	0	0	0	0	0	0	0	0.100478	627	16	60	39.1875	0.98227	0	0	0	0	0	0	0	0	0	1	0	true	0	1	0	1	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	1	0	1	0	1	0	3
6e4904c9750d5fd2f55a844eb17a6435a9a931c6	288	py	Python	habitat/extravehicular/admin/contingency.py	matrach/habitatOS	1ae2a3caf6f279cf6d6d20bcd81f24d50f61d7d3	[ "MIT" ]	1	2021-02-01T19:04:39.000Z	2021-02-01T19:04:39.000Z	habitat/extravehicular/admin/contingency.py	matrach/habitatOS	1ae2a3caf6f279cf6d6d20bcd81f24d50f61d7d3	[ "MIT" ]	null	null	null	habitat/extravehicular/admin/contingency.py	matrach/habitatOS	1ae2a3caf6f279cf6d6d20bcd81f24d50f61d7d3	[ "MIT" ]	null	null	null	from django.contrib import admin from habitat._common.admin import HabitatAdmin from habitat.extravehicular.models import Contingency @admin.register(Contingency) class ContingencyAdmin(HabitatAdmin): list_display = ['identifier', 'severity', 'name'] list_filter = ['severity']	28.8	53	0.788194	31	288	7.225806	0.645161	0.098214	0	0	0	0	0	0	0	0	0	0.114583	288	9	54	32	0.878431	0	0	0	0	0.104167	0	0	0	0	1	0	false	0	0.428571	0	0.857143	0	0	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	1	0	3
280f9f5b8a870f684c046124fe5053d3dddb38e1	83	py	Python	Basics.py	hamzashabbir11/MoshPythonProgramming	95a96d1b394c358a670ea17d273c7e70ab07ff15	[ "MIT" ]	null	null	null	Basics.py	hamzashabbir11/MoshPythonProgramming	95a96d1b394c358a670ea17d273c7e70ab07ff15	[ "MIT" ]	null	null	null	Basics.py	hamzashabbir11/MoshPythonProgramming	95a96d1b394c358a670ea17d273c7e70ab07ff15	[ "MIT" ]	null	null	null	namee=input('Enter Name ') color=input('Enter Color ') print(namee+'likes '+color)	20.75	27	0.710843	12	83	4.916667	0.583333	0.338983	0	0	0	0	0	0	0	0	0	0.096386	83	3	28	27.666667	0.786667	0	0	0	0	0.349398	0	0	0	0	1	0	false	0	0	0	0	0.333333	1	0	null	1	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
2845203f2e1dab9dc8d7be6ac488c9dcc17aa0bd	1,532	py	Python	doubanfm/dal/dal_help.py	fakegit/douban.fm	d65126d3bd3e12d8a7109137caff8da0efc22b2f	[ "MIT" ]	783	2015-01-03T13:26:37.000Z	2022-03-30T07:21:07.000Z	doubanfm/dal/dal_help.py	snaildmy/douban.fm	d65126d3bd3e12d8a7109137caff8da0efc22b2f	[ "MIT" ]	124	2015-01-02T05:31:49.000Z	2020-07-05T05:47:51.000Z	doubanfm/dal/dal_help.py	snaildmy/douban.fm	d65126d3bd3e12d8a7109137caff8da0efc22b2f	[ "MIT" ]	267	2015-01-15T05:03:39.000Z	2021-01-13T20:42:28.000Z	#!/usr/bin/env python2 # -- coding: utf-8 -- from doubanfm.dal.dal_main import MainDal from doubanfm.colorset.colors import color_func # colors class HelpDal(MainDal): def __init__(self, data): super(HelpDal, self).__init__(data) self.keys = data.keys @property def lines(self): ...	41.405405	145	0.462794	184	1,532	3.777174	0.396739	0.205755	0.189928	0.168345	0.378417	0.22446	0.181295	0.181295	0.181295	0	0.0194	0.259791	1,532	36	146	42.555556	0.593474	0.032637	0	0	0	0.317321	0	0	0	0	1	0.083333	false	0	0.083333	0	0.25	0	0	0	null	1	1	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
2859dbc22c105e6af678964306277c216443ffab	504	py	Python	unit1/lecture3/exercises/weighted_edge.py	syenpark/Intro2CTandDS	a5a4b0c23e401a1c49db72cbb5797675c83d7fc5	[ "MIT" ]	null	null	null	unit1/lecture3/exercises/weighted_edge.py	syenpark/Intro2CTandDS	a5a4b0c23e401a1c49db72cbb5797675c83d7fc5	[ "MIT" ]	null	null	null	unit1/lecture3/exercises/weighted_edge.py	syenpark/Intro2CTandDS	a5a4b0c23e401a1c49db72cbb5797675c83d7fc5	[ "MIT" ]	null	null	null	# -- coding: utf-8 -- """ Spyder Editor @auther: syenpark Python Version: 3.6 """ class WeightedEdge(Edge): """ make a gragh weighted """ def __init__(self, src, dest, weight): self.src = src self.dest = dest self.weight = weight def getWeight(self): retur...	21.913043	94	0.549603	54	504	4.981481	0.555556	0.052045	0	0	0	0	0	0	0	0	0.008403	0.291667	504	22	95	22.909091	0.745098	0.19246	0	0	0	0.013021	0	0	0	0	1	0.3	false	0	0	0.2	0.6	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
285cf4c9e8bf8b07c55d541818f93e22bbd0031f	352	py	Python	test/context.py	rmcgibbo/pystream-protobuf	0018cf93da7c8baf66763044e3e507f9cd5d81d8	[ "MIT" ]	36	2016-11-08T15:23:18.000Z	2021-10-20T09:29:01.000Z	test/context.py	rmcgibbo/pystream-protobuf	0018cf93da7c8baf66763044e3e507f9cd5d81d8	[ "MIT" ]	21	2016-09-11T21:32:17.000Z	2021-11-01T11:09:56.000Z	test/context.py	rmcgibbo/pystream-protobuf	0018cf93da7c8baf66763044e3e507f9cd5d81d8	[ "MIT" ]	13	2017-05-10T09:32:57.000Z	2021-04-15T23:18:51.000Z	# coding=utf-8 """ test.context ~~~~~~~~~~~~ Import (relatively) the package which is under the test. :copyright: (c) 2016 by Ali Ghaffaari. :license: MIT, see LICENSE for more details. """ import os import sys sys.path.insert(0, os.path.abspath('..')) import stream #noqa pylint: disable=wron...	18.526316	72	0.659091	48	352	4.833333	0.770833	0	0	0	0	0	0	0	0	0	0.020979	0.1875	352	18	73	19.555556	0.79021	0.676136	0	0	0	0.023529	0	0	0	0	1	0	true	0	0.75	0	0.75	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	1	0	1	0	1	0	3
285eed8547976f91b8ec830f3c1c4dd563511742	600	py	Python	cpdb/data/management/commands/clean_up_falsy_race_fields.py	invinst/CPDBv2_backend	b4e96d620ff7a437500f525f7e911651e4a18ef9	[ "Apache-2.0" ]	25	2018-07-20T22:31:40.000Z	2021-07-15T16:58:41.000Z	cpdb/data/management/commands/clean_up_falsy_race_fields.py	invinst/CPDBv2_backend	b4e96d620ff7a437500f525f7e911651e4a18ef9	[ "Apache-2.0" ]	13	2018-06-18T23:08:47.000Z	2022-02-10T07:38:25.000Z	cpdb/data/management/commands/clean_up_falsy_race_fields.py	invinst/CPDBv2_backend	b4e96d620ff7a437500f525f7e911651e4a18ef9	[ "Apache-2.0" ]	6	2018-05-17T21:59:43.000Z	2020-11-17T00:30:26.000Z	from django.core.management import BaseCommand from django.db.models import Q from django.utils import timezone from data.constants import RACE_UNKNOWN_STRINGS from data.models import Victim, Complainant, Involvement, Officer class Command(BaseCommand): def handle(self, args, *kwargs): now = timezone.n...	35.294118	78	0.703333	75	600	5.506667	0.52	0.072639	0.087167	0.169492	0	0	0	0	0	0	0	0.21	600	16	79	37.5	0.871308	0	0	0	0	0.011667	0	0	0	0	1	0.076923	false	0	0.384615	0	0.538462	0	0	0	null	0	0	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	1	0	3
2874740a3a95fbba65966bed21206659cd9c1df9	996	py	Python	news/pybo/admin.py	Smashh712/nrib	375c9625e9efa6bb9a6f466312de3c6fcd5818a4	[ "MIT" ]	null	null	null	news/pybo/admin.py	Smashh712/nrib	375c9625e9efa6bb9a6f466312de3c6fcd5818a4	[ "MIT" ]	null	null	null	news/pybo/admin.py	Smashh712/nrib	375c9625e9efa6bb9a6f466312de3c6fcd5818a4	[ "MIT" ]	null	null	null	from django.contrib import admin from .models import Question, Answer, Issue, Issue_reply, Issue_rereply, Topic, Event class Search_Event(admin.ModelAdmin): search_fields = ["subject"] class Search_Topic(admin.ModelAdmin): search_fields = ["subject"] class Search_Question(admin.ModelAdmin): search_fie...	23.714286	85	0.778112	125	996	5.968	0.184	0.103217	0.197051	0.253351	0.495979	0.375335	0.375335	0.134048	0	0	0	0.113454	996	41	86	24.292683	0.844847	0.026104	0.304348	0	0	0.05062	0	0	0	0	1	0	false	0	0.086957	0	0.695652	0	0	0	null	0	1	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	1	0	3
287deeedbd9c44aab4d0927a4cd3a8795cca6f9f	24	py	Python	setup/brython/__init__.py	master-stm/brython	6b67509c628bc2d6c5489c5243a9d35bb4472540	[ "BSD-3-Clause" ]	1	2020-01-29T19:22:02.000Z	2020-01-29T19:22:02.000Z	setup/brython/__init__.py	master-stm/brython	6b67509c628bc2d6c5489c5243a9d35bb4472540	[ "BSD-3-Clause" ]	null	null	null	setup/brython/__init__.py	master-stm/brython	6b67509c628bc2d6c5489c5243a9d35bb4472540	[ "BSD-3-Clause" ]	null	null	null	implementation = "3.8.6"	24	24	0.708333	4	24	4.25	1	0	0	0	0	0	0	0	0	0	0.136364	0.083333	24	1	24	24	0.636364	0	0	0	0	0.2	0	0	0	0	1	0	false	0	0	0	0	0	1	1	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
28a20a9cd4c4add65dd8a586f25627be8df5ae36	237	py	Python	main/models.py	xod442/argus	e13bf4be756b9084a554754e33b61cf2098a2887	[ "Apache-2.0" ]	null	null	null	main/models.py	xod442/argus	e13bf4be756b9084a554754e33b61cf2098a2887	[ "Apache-2.0" ]	null	null	null	main/models.py	xod442/argus	e13bf4be756b9084a554754e33b61cf2098a2887	[ "Apache-2.0" ]	null	null	null	from mongoengine import signals from flask import url_for import os from application import db from utilities.common import utc_now_ts as now class Vendor(db.Document): vend = db.StringField(db_field="c",required=True, Uniqe=True)	23.7	65	0.797468	38	237	4.868421	0.684211	0	0	0	0	0	0	0	0	0	0	0.135021	237	9	66	26.333333	0.902439	0	0	0	0	0.004219	0	0	0	0	1	0	false	0	0.714286	0	1	0	0	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	1	0	3
957ad1ce1624721c97baaffa37cdc505eeac0bac	231	py	Python	tests/views.py	ekmartin/django-basis	31dd61738284135b107fa5543d8fc3a356e48aa7	[ "MIT" ]	null	null	null	tests/views.py	ekmartin/django-basis	31dd61738284135b107fa5543d8fc3a356e48aa7	[ "MIT" ]	null	null	null	tests/views.py	ekmartin/django-basis	31dd61738284135b107fa5543d8fc3a356e48aa7	[ "MIT" ]	null	null	null	from rest_framework import viewsets from .models import Person from .serializers import PersonSerializer class BasisModelViewSet(viewsets.ModelViewSet): queryset = Person.objects.all() serializer_class = PersonSerializer	25.666667	47	0.818182	24	231	7.791667	0.666667	0	0	0	0	0	0	0	0	0	0	0.12987	231	8	48	28.875	0.930348	0	0	0	0	0	0	0	0	0	1	0	false	0	0.5	0	1	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	0	0	3
95813b932d99f484d5e4631e55502d3bb0799a81	73	py	Python	Python/LEGB/module2.py	hotbaby/mmn	8dfefc2f41e3cee96efb9e81a3cba97ec3cb0f29	[ "MIT" ]	3	2020-12-09T02:52:02.000Z	2021-01-12T15:07:17.000Z	Python/LEGB/module2.py	hotbaby/mmn	8dfefc2f41e3cee96efb9e81a3cba97ec3cb0f29	[ "MIT" ]	null	null	null	Python/LEGB/module2.py	hotbaby/mmn	8dfefc2f41e3cee96efb9e81a3cba97ec3cb0f29	[ "MIT" ]	2	2020-11-18T02:31:18.000Z	2021-01-09T01:37:52.000Z	# encoding: utf8 owner = 'module2' def show_owner(): print(owner)	9.125	17	0.643836	9	73	5.111111	0.777778	0	0	0	0	0	0	0	0	0	0.035088	0.219178	73	7	18	10.428571	0.77193	0.191781	0	0	0	0.122807	0	0	0	0	1	0.333333	false	0	0	0	0.333333	0.333333	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	1	0	0	0	0	0	0	3
958a69d4adf2a1667321d6cd5de3ebef308295d0	1,483	py	Python	service/database/models.py	LP-22-Emotion-Catcher/backend	cfce484f06d7e392bf987840a5b9a5c2d437048a	[ "MIT" ]	null	null	null	service/database/models.py	LP-22-Emotion-Catcher/backend	cfce484f06d7e392bf987840a5b9a5c2d437048a	[ "MIT" ]	null	null	null	service/database/models.py	LP-22-Emotion-Catcher/backend	cfce484f06d7e392bf987840a5b9a5c2d437048a	[ "MIT" ]	1	2021-11-18T02:53:44.000Z	2021-11-18T02:53:44.000Z	from sqlalchemy import Column, Integer, String, ARRAY # from sqlalchemy.orm import relationship from service.database.db import Base, engine class Wall(Base): __tablename__ = 'walls' id = Column(Integer, primary_key=True) wall_id = Column(Integer) link = Column(String) last_post_id = Column(Inte...	25.135593	66	0.665543	185	1,483	5.07027	0.286486	0.235608	0.191898	0.070362	0.415778	0.371002	0.140725	0.063966	0.063966	0	0	0.211059	1,483	58	67	25.568966	0.801709	0.107889	0.435897	0	0	0.106141	0	0	0	0	1	0.076923	false	0	0.051282	0.076923	0.948718	0	0	0	null	1	1	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	1	0	3
95c238e3e00c6ba772cf16d49dbf3f539fcf7f15	85	py	Python	__init__.py	EadCat/Maze-Runner	2ef594237a1c19844fae306212bd733dbfb80e19	[ "MIT" ]	2	2021-02-03T03:51:39.000Z	2021-02-03T03:51:43.000Z	__init__.py	EadCat/Maze-Runner	2ef594237a1c19844fae306212bd733dbfb80e19	[ "MIT" ]	null	null	null	__init__.py	EadCat/Maze-Runner	2ef594237a1c19844fae306212bd733dbfb80e19	[ "MIT" ]	null	null	null	from option import Options if __name__ == '__main__': opt = Options().parse()	12.142857	27	0.658824	10	85	4.8	0.9	0	0	0	0	0	0	0	0	0	0	0.211765	85	6	28	14.166667	0.716418	0	0	0	0	0.095238	0	0	0	0	1	0	false	0	0.333333	0	0.333333	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	0	0	3
95e2e5f161affe0ca3dc7ffaa9cd660916ff0226	521	py	Python	autograd/__init__.py	RInterested/autograd	a2c8d44c686ceafb697c0a51efa374cd643d9d6b	[ "MIT" ]	1	2021-06-20T11:43:57.000Z	2021-06-20T11:43:57.000Z	autograd/__init__.py	RInterested/autograd	a2c8d44c686ceafb697c0a51efa374cd643d9d6b	[ "MIT" ]	null	null	null	autograd/__init__.py	RInterested/autograd	a2c8d44c686ceafb697c0a51efa374cd643d9d6b	[ "MIT" ]	null	null	null	from __future__ import absolute_import from .core import primitive, make_vjp, getval from . import container_types from .container_types import make_tuple, make_list, make_dict from .convenience_wrappers import (grad, multigrad, multigrad_dict, elementwise_grad, value_and_grad, grad_a...	57.888889	90	0.683301	58	521	5.689655	0.5	0.084848	0	0	0	0	0	0	0	0	0	0.272553	521	8	91	65.125	0.870712	0	0	0	0	0	0	0	0	0	1	0	true	0	0.625	0	0.625	0	0	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	1	0	1	0	0	0	3
251dd4220dc5c0337f111934c227715cd5736c7a	33	py	Python	tests/core/full_node/full_sync/config.py	joshpainter/chia-blockchain	647cf6b52b3b85415b9ba3804be3d67644693938	[ "Apache-2.0" ]	null	null	null	tests/core/full_node/full_sync/config.py	joshpainter/chia-blockchain	647cf6b52b3b85415b9ba3804be3d67644693938	[ "Apache-2.0" ]	null	null	null	tests/core/full_node/full_sync/config.py	joshpainter/chia-blockchain	647cf6b52b3b85415b9ba3804be3d67644693938	[ "Apache-2.0" ]	null	null	null	job_timeout = 60 parallel = True	11	16	0.757576	5	33	4.8	1	0	0	0	0	0	0	0	0	0	0.074074	0.181818	33	2	17	16.5	0.814815	0	0	0	0	0	0	0	0	0	1	0	false	0	0	0	0	0	1	1	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
254f3b937039f4040d7f0e1ffc14a98921b82638	280	py	Python	breeze-server/breezeapi/config.py	rsk700/breezewiki	b109e554c9d2bc83915279fc29f2787da951ec1b	[ "MIT" ]	null	null	null	breeze-server/breezeapi/config.py	rsk700/breezewiki	b109e554c9d2bc83915279fc29f2787da951ec1b	[ "MIT" ]	null	null	null	breeze-server/breezeapi/config.py	rsk700/breezewiki	b109e554c9d2bc83915279fc29f2787da951ec1b	[ "MIT" ]	null	null	null	# -- coding: utf-8 -- """ """ from __future__ import division from __future__ import absolute_import from __future__ import print_function class Config(object): """Docstring for Config. """ DB_URL = '' API_PER_PAGE = 50 API_ROOT = '/api' config = Config()	14.736842	38	0.660714	34	280	4.911765	0.647059	0.179641	0.287425	0	0	0	0	0	0	0	0.013575	0.210714	280	18	39	15.555556	0.742081	0.160714	0	0	0	0.018018	0	0	0	0	1	0	false	0	0.375	0	0.875	0.125	0	0	null	0	1	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	1	0	3
2566f08c5846509693ffffc21812b5aca1439c9e	315	py	Python	oop/ej_3.py	albertomartinezcaballero/ejercicios-oop	6d4602108928edd49001706bf1b88f1632be70ee	[ "Apache-2.0" ]	2	2019-02-15T15:52:49.000Z	2019-02-15T17:08:37.000Z	oop/ej_3.py	albertomartinezcaballero/ejercicios-oop	6d4602108928edd49001706bf1b88f1632be70ee	[ "Apache-2.0" ]	null	null	null	oop/ej_3.py	albertomartinezcaballero/ejercicios-oop	6d4602108928edd49001706bf1b88f1632be70ee	[ "Apache-2.0" ]	null	null	null	class libro(): def __init__(self,prestamo,devolucion,dame_info): self.prestamo = prestamo self.devolucion = devolucion self.dame_info = dame_info def get_prestamo(self): return def get_devolucion(self): return def get_dame_info(self): return	24.230769	53	0.622222	36	315	5.138889	0.305556	0.172973	0.12973	0.172973	0	0	0	0	0	0	0	0.301587	315	12	54	26.25	0.840909	0	0.272727	0	0	0	0	0	0	0	1	0.363636	false	0	0	0.272727	0.727273	0	0	0	null	0	0	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	0	0	3
c2602eeddaa84a59d98d41bf351e69d4b7ea3fdd	173	py	Python	search/urls.py	indoriyasboyz/E-commerce	a71e7d043899769e48992216bebebc4b43d647ca	[ "MIT" ]	null	null	null	search/urls.py	indoriyasboyz/E-commerce	a71e7d043899769e48992216bebebc4b43d647ca	[ "MIT" ]	null	null	null	search/urls.py	indoriyasboyz/E-commerce	a71e7d043899769e48992216bebebc4b43d647ca	[ "MIT" ]	null	null	null	from django.urls import path from .views import SearchProductListView app_name = "search" urlpatterns = [ path('', SearchProductListView.as_view(), name="products"), ]	21.625	63	0.745665	19	173	6.684211	0.736842	0	0	0	0	0	0	0	0	0	0	0.132948	173	8	64	21.625	0.846667	0	0	0	0	0.08046	0	0	0	0	1	0	false	0	0.333333	0	0.333333	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	0	0	3
c26cc2220ac7ba1f1bee7687ff1e71d3bd1872e6	324	py	Python	desafio29.py	lucasmc64/Curso_de_Python_CeV	aed942828913ff405941a7d86fb65ddcc79c414d	[ "MIT" ]	1	2021-02-19T05:13:32.000Z	2021-02-19T05:13:32.000Z	desafio29.py	lucasmc64/python_cev	aed942828913ff405941a7d86fb65ddcc79c414d	[ "MIT" ]	null	null	null	desafio29.py	lucasmc64/python_cev	aed942828913ff405941a7d86fb65ddcc79c414d	[ "MIT" ]	null	null	null	print('{} DESAFIO 29 {}'.format('='10, '='10)) vel = float(input('Digite a velocidade do caro (Km/h): ')) if vel <= 80.0: print('Você está dentro do limite!') else: dif = vel - 80 print('Você ultrapassou o limite!\nTerá de paga uma multa de R$7,00 para cada Km rodado, no total será R${:.2f}!'.format(dif *...	46.285714	134	0.623457	56	324	3.607143	0.732143	0.049505	0	0	0	0	0	0	0	0	0.060606	0.185185	324	7	134	46.285714	0.704545	0	0	0	0.142857	0.572308	0	0	0	0	1	0	false	0.142857	0	0	0	0.428571	0	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	1	0	0	0	1	3
c26e0ddc4ca3f4851074074cdfd66c279d6f6929	1,461	py	Python	umap/tests/test_merge_conflicts.py	nick-less/umap	5458abd12f455d745a84d4dba63cd3e9b5ccc626	[ "WTFPL" ]	2	2021-10-04T12:47:29.000Z	2021-12-10T11:45:46.000Z	umap/tests/test_merge_conflicts.py	nick-less/umap	5458abd12f455d745a84d4dba63cd3e9b5ccc626	[ "WTFPL" ]	1	2021-06-02T10:22:38.000Z	2021-06-02T10:22:38.000Z	umap/tests/test_merge_conflicts.py	nick-less/umap	5458abd12f455d745a84d4dba63cd3e9b5ccc626	[ "WTFPL" ]	null	null	null	from umap.utils import merge_conflicts def test_adding_one_element(): assert merge_conflicts(["A", "B"], ["A", "B", "C"], ["A", "B", "D"]) == [ "A", "B", "C", "D", ] def test_adding_elements(): assert merge_conflicts(["A", "B"], ["A", "B", "C", "D"], ["A", "B", "E", "F"])...	23.564516	87	0.451745	191	1,461	3.293194	0.225131	0.063593	0.286169	0.300477	0.523052	0.438792	0.400636	0.282989	0.124006	0	0	0.289528	1,461	61	88	23.95082	0.605973	0.102669	0.488372	0	0	0.067381	0	0	0	0.209302	1	0.162791	true	0	0.023256	0	0.186047	0	0	0	null	0	1	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	1	0	0	0	0	0	3
c27741779157d4f4a8739fac8b6bf039c6e9113a	75	py	Python	card_masks.py	frederikja163/coolshop-application-assignment	472d8a9f8f6dba11b891827a8e2df45d71a31b97	[ "MIT" ]	null	null	null	card_masks.py	frederikja163/coolshop-application-assignment	472d8a9f8f6dba11b891827a8e2df45d71a31b97	[ "MIT" ]	3	2017-03-07T15:20:43.000Z	2017-07-04T11:53:47.000Z	card_masks.py	frederikja163/coolshop-application-assignment	472d8a9f8f6dba11b891827a8e2df45d71a31b97	[ "MIT" ]	4	2017-03-07T15:04:17.000Z	2021-09-30T17:20:30.000Z	def get_card_mask(card_type, card_number): raise NotImplementedError()	25	42	0.8	10	75	5.6	0.8	0	0	0	0	0	0	0	0	0	0	0.12	75	2	43	37.5	0.848485	0	0	0	0	0	0	0	0	0	1	0.5	false	0	0	0	0.5	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	1	0	0	0	0	0	0	3
c27935e698021e8efd0aa28bb66af6ae4c8fd28c	3,015	py	Python	contracts/reports/base.py	mepsd/CLAC	ee15111e9ad12e51fe349d3339319e30b3b69d9e	[ "CC0-1.0" ]	126	2015-03-24T17:37:33.000Z	2022-03-29T18:37:39.000Z	contracts/reports/base.py	mepsd/CLAC	ee15111e9ad12e51fe349d3339319e30b3b69d9e	[ "CC0-1.0" ]	1,815	2015-03-16T21:01:30.000Z	2019-09-09T18:47:29.000Z	contracts/reports/base.py	mepsd/CLAC	ee15111e9ad12e51fe349d3339319e30b3b69d9e	[ "CC0-1.0" ]	69	2015-03-27T23:44:26.000Z	2021-02-14T09:45:28.000Z	from typing import Union from textwrap import dedent, fill import abc from django.utils.safestring import SafeString from django.urls import reverse import markdown from ..models import Contract, ContractsQuerySet number = Union[int, float] def format_text(text: str) -> str: return fill(dedent(text)).strip() ...	25.550847	64	0.641459	373	3,015	5.093834	0.367292	0.037895	0.047895	0.036842	0.214211	0.195789	0.108421	0	0	0	0.003198	0.273964	3,015	117	65	25.769231	0.864778	0.338308	0.14	0	0	0.021789	0.014908	0	0	0	1	0.28	false	0	0.14	0.16	0.72	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
c28058a0bc5cd7b30ec911a2305e2870f1a70225	851	py	Python	main.py	Ciahaking/D.H.C_team	9c1cb661d3d3c9595ac0611b39f9560c35c008d9	[ "Apache-2.0" ]	null	null	null	main.py	Ciahaking/D.H.C_team	9c1cb661d3d3c9595ac0611b39f9560c35c008d9	[ "Apache-2.0" ]	null	null	null	main.py	Ciahaking/D.H.C_team	9c1cb661d3d3c9595ac0611b39f9560c35c008d9	[ "Apache-2.0" ]	null	null	null	#--coding:utf8;-- #qpy:console import time print ("BEM VINDO") print ("criado por:") time.sleep (2) print ("jose lucas") time.sleep (2) print ("escolha o que vai usar") time.sleep (2) print ("[1]attack ddos") print ("[2]sql injection") time.sleep (8) print ("==========CAREGANDO===========") time.sleep (2) print ("...	19.340909	49	0.568743	118	851	4.584746	0.491525	0.232902	0.12939	0.194085	0	0	0	0	0	0	0.037975	0.164512	851	43	50	19.790698	0.642757	0.034078	0.333333	0	0	0.454768	0.09291	0	0	0	1	0	false	0	0.027778	0	0.027778	0.527778	0	0	null	1	0	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	1	3
c28afb672bf0a062aea5d9c5185297a60cb65cdc	76	py	Python	codeforces/268B.py	andraantariksa/code-exercise-answer	69b7dbdc081cdb094cb110a72bc0c9242d3d344d	[ "MIT" ]	1	2019-11-06T15:17:48.000Z	2019-11-06T15:17:48.000Z	codeforces/268B.py	andraantariksa/code-exercise-answer	69b7dbdc081cdb094cb110a72bc0c9242d3d344d	[ "MIT" ]	null	null	null	codeforces/268B.py	andraantariksa/code-exercise-answer	69b7dbdc081cdb094cb110a72bc0c9242d3d344d	[ "MIT" ]	1	2018-11-13T08:43:26.000Z	2018-11-13T08:43:26.000Z	'''input 2000 ''' inp = int(input('')) print(int((inp-1)inp(inp+1)/6+inp))	15.2	37	0.565789	14	76	3.071429	0.5	0.186047	0	0	0	0	0	0	0	0	0.1	0.078947	76	5	37	15.2	0.514286	0.131579	0	0	0	0	0	0	0	0	1	0	false	0	0	0	0	0.5	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	1	3
c2c5f5f35f06c5f87b593edf8e44508ae6251f74	397	py	Python	ACME/color/depth_channel.py	mauriziokovacic/ACME	2615b66dd4addfd5c03d9d91a24c7da414294308	[ "MIT" ]	3	2019-10-23T23:10:55.000Z	2021-09-01T07:30:14.000Z	ACME/color/depth_channel.py	mauriziokovacic/ACME-Python	2615b66dd4addfd5c03d9d91a24c7da414294308	[ "MIT" ]	null	null	null	ACME/color/depth_channel.py	mauriziokovacic/ACME-Python	2615b66dd4addfd5c03d9d91a24c7da414294308	[ "MIT" ]	1	2020-07-11T11:35:43.000Z	2020-07-11T11:35:43.000Z	from .channel import * def depth_channel(C, dim=-1): """ Extracts the depth channel from colors in RGBD format Parameters ---------- C : Tensor the RGBD color tensor dim : int (optional) the dimension along the operation is performed (default is -1) Returns ------- ...	18.045455	70	0.579345	49	397	4.673469	0.571429	0.104803	0	0	0	0	0	0	0	0	0.010989	0.312343	397	21	71	18.904762	0.827839	0.619647	0	0	0	0	0	0	0	0	1	0.333333	false	0	0.333333	0	1	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	1	0	1	0	3
c2eac72515b160fd3c4af6c29c774d92ba9488ca	935	py	Python	spikes/googledrive_addon/bin/splunklib/searchcommands/csv/__init__.py	logan-wipro/splunk-ref-pas-code	0fd165410dd3c5a7b14993fd295fa2af16d3f1e2	[ "Apache-2.0" ]	26	2015-03-17T20:21:09.000Z	2021-01-02T07:23:24.000Z	spikes/googledrive_addon/bin/splunklib/searchcommands/csv/__init__.py	logan-wipro/splunk-ref-pas-code	0fd165410dd3c5a7b14993fd295fa2af16d3f1e2	[ "Apache-2.0" ]	6	2015-03-16T04:54:56.000Z	2016-09-17T00:52:07.000Z	spikes/googledrive_addon/bin/splunklib/searchcommands/csv/__init__.py	logan-wipro/splunk-ref-pas-code	0fd165410dd3c5a7b14993fd295fa2af16d3f1e2	[ "Apache-2.0" ]	19	2015-06-18T02:34:26.000Z	2022-03-27T09:02:28.000Z	# Copyright 2011-2014 Splunk, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"): you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in wri...	33.392857	75	0.776471	145	935	4.944828	0.641379	0.083682	0.036262	0.04463	0	0	0	0	0	0	0.038412	0.164706	935	27	76	34.62963	0.879641	0.771123	0	0	0	0	0	0	0	0	1	0	true	0	0.833333	0	0.833333	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	1	0	1	0	1	0	3
6c4bf192eb16367d5b26b1e7ba417a7b372e859c	3,767	py	Python	dekespo_ai_sdk/core/dimensions.py	dekespo/AI_ToolKit	54c7784693189aa0c5d95d48666876f9a18cf922	[ "Apache-2.0" ]	null	null	null	dekespo_ai_sdk/core/dimensions.py	dekespo/AI_ToolKit	54c7784693189aa0c5d95d48666876f9a18cf922	[ "Apache-2.0" ]	56	2018-03-03T14:38:31.000Z	2019-12-29T22:23:25.000Z	dekespo_ai_sdk/core/dimensions.py	dekespo/AI_ToolKit	54c7784693189aa0c5d95d48666876f9a18cf922	[ "Apache-2.0" ]	null	null	null	from __future__ import annotations import math from typing import Iterator, List, Tuple, Union class Dim2D: def __init__(self, x: float, y: float): self.x = x self.y = y def __str__(self) -> str: return f"(x: {self.x}, y: {self.y})" def __repr__(self) -> str: # pragma: no cover ...	31.132231	81	0.627821	477	3,767	4.683438	0.18239	0.040286	0.024172	0.042972	0.34154	0.30573	0.27171	0.27171	0.189794	0.159355	0.015563	0.266525	3,767	120	82	31.391667	0.792979	0.00876	0.184783	0	0.01087	0.02573	0	0	0	0	1	0.282609	false	0	0.032609	0.184783	0.586957	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
6c4dfcb184a6031893243b9f14103ea447acacb9	536	py	Python	ftp/models.py	lj2007331/panel	411ef59f4c06b696aa9e30ee87879643256bf1c0	[ "Apache-2.0" ]	25	2017-04-16T15:28:39.000Z	2018-11-20T06:02:01.000Z	ftp/models.py	linuxeye/panel	411ef59f4c06b696aa9e30ee87879643256bf1c0	[ "Apache-2.0" ]	2	2018-04-13T12:26:39.000Z	2018-09-04T06:35:55.000Z	ftp/models.py	lj2007331/panel	411ef59f4c06b696aa9e30ee87879643256bf1c0	[ "Apache-2.0" ]	10	2017-05-24T05:18:12.000Z	2018-12-17T08:05:48.000Z	from django.db import models # Create your models here. class User(models.Model): name = models.CharField(max_length=150, unique=True, blank=True, null=True, default='') password = models.CharField(max_length=128, blank=True, null=True, default='') path = models.FilePathField(max_length=255, blank=True, nu...	48.727273	91	0.73694	73	536	5.328767	0.479452	0.092545	0.133676	0.174807	0.308483	0.18509	0.18509	0.18509	0	0	0.027778	0.126866	536	10	92	53.6	0.803419	0.044776	0	0	0	0	0	0	0	0	1	0	false	0.125	0.125	0	1	0	0	0	null	0	0	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	1	0	0	1	0	3
6c7605990b2c9e44cae385b4c1d4a558b378932a	1,123	py	Python	src/sima/riflex/blueprints/soilitem.py	SINTEF/simapy	650b8c2f15503dad98e2bfc0d0788509593822c7	[ "MIT" ]	null	null	null	src/sima/riflex/blueprints/soilitem.py	SINTEF/simapy	650b8c2f15503dad98e2bfc0d0788509593822c7	[ "MIT" ]	null	null	null	src/sima/riflex/blueprints/soilitem.py	SINTEF/simapy	650b8c2f15503dad98e2bfc0d0788509593822c7	[ "MIT" ]	null	null	null	# # Generated with SoilItemBlueprint from dmt.blueprint import Blueprint from dmt.dimension import Dimension from dmt.attribute import Attribute from dmt.enum_attribute import EnumAttribute from dmt.blueprint_attribute import BlueprintAttribute from sima.sima.blueprints.moao import MOAOBlueprint class SoilItemBluepri...	56.15	156	0.748887	126	1,123	6.571429	0.444444	0.101449	0.144928	0.140097	0.141304	0.101449	0	0	0	0	0.002012	0.114871	1,123	20	157	56.15	0.830986	0.028495	0	1	0	0.231978	0.023105	0	0	0	1	0.066667	false	0	0.4	0	0.533333	0.4	0	0	null	0	0	0	0	0	0	0	0	0	0	0	1	0	0	0	null	0	0	0	0	0	1	0	1	0	3
665a8c15dcb5dda900d136b0e8c109c4750f447c	611	py	Python	node.py	WPI-CS4341/Bayesian-Networks	0efcf6ae5aa0806a2404b075a6bc1ca669dd5669	[ "MIT" ]	null	null	null	node.py	WPI-CS4341/Bayesian-Networks	0efcf6ae5aa0806a2404b075a6bc1ca669dd5669	[ "MIT" ]	null	null	null	node.py	WPI-CS4341/Bayesian-Networks	0efcf6ae5aa0806a2404b075a6bc1ca669dd5669	[ "MIT" ]	2	2019-10-04T16:03:03.000Z	2019-10-07T02:38:03.000Z	class Node(object): TRUE = 't' FALSE = 'f' QUERY = '?' NOTHING = '-' def __init__(self, name): self.name = name self.status = self.NOTHING self.cpt = [] self.index = None self.__children = [] self.__parents = [] return def __str__(self):...	19.09375	36	0.541735	67	611	4.641791	0.358209	0.07717	0.135048	0	0	0	0	0	0	0	0	0.343699	611	31	37	19.709677	0.775561	0	0	0	0	0.006547	0	0	0	0	1	0.25	false	0	0	0.125	0.625	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
665f64f667218c4fd9809023c89feaccf945bc07	385	py	Python	generators/simple/templates/src/platform/extensionRunner/cdf/__init__.py	jfallaire/generator-ps-boilerplate-project	36f544a54442c191430451715425da98ea76a63e	[ "MIT" ]	2	2019-07-24T16:00:51.000Z	2019-10-03T18:36:20.000Z	generators/simple/templates/src/platform/extensionRunner/cdf/__init__.py	jfallaire/generator-ps-boilerplate-project	36f544a54442c191430451715425da98ea76a63e	[ "MIT" ]	19	2019-06-20T21:58:44.000Z	2020-11-05T13:48:42.000Z	generators/simple/templates/src/platform/extensionRunner/cdf/__init__.py	jfallaire/generator-ps-boilerplate-project	36f544a54442c191430451715425da98ea76a63e	[ "MIT" ]	1	2019-06-22T17:30:42.000Z	2019-06-22T17:30:42.000Z	# no modules depend on distribution_framework, but it contains types that may be returned by CMF such as # generic exceptions and stuff. if it's not imported, it cannot be discovered, so we'll force it. try: from . import distribution_framework except ImportError: ... # this might happen when regenerating the...	48.125	114	0.774026	59	385	5.016949	0.847458	0.141892	0	0	0	0	0	0	0	0	0	0.181818	385	7	115	55	0.939683	0.784416	0	0	0	0	0	0	0	0	1	0	true	0	0.5	0	0.5	0	0	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	1	0	1	0	0	0	3
6673e4f050725fdc1ce5f10d5b61bcea3922159d	3,167	py	Python	c130/datacleaing.py	Gyaanendra/all-class-code-whitehatjr	2ab11820111d8b2fa575c158b41636599570361c	[ "MIT" ]	null	null	null	c130/datacleaing.py	Gyaanendra/all-class-code-whitehatjr	2ab11820111d8b2fa575c158b41636599570361c	[ "MIT" ]	null	null	null	c130/datacleaing.py	Gyaanendra/all-class-code-whitehatjr	2ab11820111d8b2fa575c158b41636599570361c	[ "MIT" ]	null	null	null	import csv import pandas as pd data_file = pd.read_csv("c130/final.csv") # to dispaly rows and columns of csv file print(data_file.shape) # to remove a column from the csv file del data_file["pl_orbpererr1"] print(data_file.shape) # to dispaly the column names print(list(data_file)) # to rename a ...	29.324074	82	0.709504	489	3,167	4.243354	0.255624	0.296867	0.355181	0.231807	0.119036	0.045301	0.045301	0.045301	0.045301	0.045301	0.012094	0.164509	3,167	108	83	29.324074	0.772109	0.094727	0.068966	0	0	0.372955	0.025445	0	0	0	1	0	false	0	0.022989	0	0.022989	0.045977	0	0	null	1	1	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
668d7d2532adb359014e1afcc2cc30086cb4846d	166	py	Python	exercicio07.py	juniooor/Exercicios-python	aed87da4f93d0e6083b1a8c3af4081a028f145de	[ "MIT" ]	null	null	null	exercicio07.py	juniooor/Exercicios-python	aed87da4f93d0e6083b1a8c3af4081a028f145de	[ "MIT" ]	null	null	null	exercicio07.py	juniooor/Exercicios-python	aed87da4f93d0e6083b1a8c3af4081a028f145de	[ "MIT" ]	null	null	null	print('Cálculo de area de um quadrado e em seguida multiplicar por 2') l=int(input('Digite o lado do quadrado: ')) a= ll print('a area do qudrado é {}'.format(a2))	33.2	70	0.698795	33	166	3.515152	0.69697	0	0	0	0	0	0	0	0	0	0.014286	0.156627	166	4	71	41.5	0.814286	0	0	0	0	0.662651	0	0	0	0	1	0	false	0	0	0	0	0.5	0	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	1	0	null	0	0	0	0	0	0	0	0	1	3
66a69032b0e3ff80ca67f5a893e51caa62c5c6bf	194	py	Python	alpyro_msgs/control_msgs/pointheadresult.py	rho2/alpyro_msgs	b5a680976c40c83df70d61bb2db1de32a1cde8d3	[ "MIT" ]	1	2020-12-13T13:07:10.000Z	2020-12-13T13:07:10.000Z	alpyro_msgs/control_msgs/pointheadresult.py	rho2/alpyro_msgs	b5a680976c40c83df70d61bb2db1de32a1cde8d3	[ "MIT" ]	null	null	null	alpyro_msgs/control_msgs/pointheadresult.py	rho2/alpyro_msgs	b5a680976c40c83df70d61bb2db1de32a1cde8d3	[ "MIT" ]	null	null	null	from alpyro_msgs import RosMessage class PointHeadResult(RosMessage): __msg_typ__ = "control_msgs/PointHeadResult" __msg_def__ = "Cg==" __md5_sum__ = "d41d8cd98f00b204e9800998ecf8427e"	21.555556	50	0.798969	19	194	7.263158	0.789474	0	0	0	0	0	0	0	0	0	0.129412	0.123711	194	8	51	24.25	0.682353	0	0	0	0	0.331606	0.310881	0	0	0	1	0	false	0	0.2	0	1	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	1	0	3
66b8e3591939c50fa11d0365d6da8a07bf7aa99c	336	py	Python	Data structure/Searching techniques/Sequential Search.py	NirmalSilwal/Problem-Solving	3af3867db4972bd6fc49025d6795341bbe77cdd5	[ "MIT" ]	16	2020-04-05T08:29:32.000Z	2022-01-07T12:31:56.000Z	Data structure/Searching techniques/Sequential Search.py	annu12340/Problem-Solving	9a8b9845ff158501b981e4c5521f7fd798a4e81d	[ "MIT" ]	2	2020-03-04T08:16:54.000Z	2020-03-04T11:27:59.000Z	Data structure/Searching techniques/Sequential Search.py	NirmalSilwal/Problem-Solving	3af3867db4972bd6fc49025d6795341bbe77cdd5	[ "MIT" ]	4	2020-09-20T06:04:03.000Z	2022-01-13T04:29:24.000Z	def seq_search(lst, element): pos = 0 found = False while pos < len(lst) and not found: if lst[pos] == element: found = True else: pos += 1 return found arr = [1,2,3,4,5,56] print(seq_search(arr,3)) print(seq_search(arr,56)) print(seq_search(arr,1)) print(se...	16.8	39	0.571429	54	336	3.462963	0.481481	0.240642	0.299465	0.363636	0.203209	0	0	0	0	0	0.058577	0.28869	336	20	40	16.8	0.723849	0	0	0	0	0	0	0	0	0	1	0.071429	false	0	0	0	0.142857	0.285714	0	0	null	1	1	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
66de604da9d2892b7c05f32bd9ae92ed97366c11	73	py	Python	python/1041.A.py	arechesk/cf	8d2209398f0fc4a73c139f4101634a8ed8c62ff6	[ "BSD-3-Clause" ]	null	null	null	python/1041.A.py	arechesk/cf	8d2209398f0fc4a73c139f4101634a8ed8c62ff6	[ "BSD-3-Clause" ]	null	null	null	python/1041.A.py	arechesk/cf	8d2209398f0fc4a73c139f4101634a8ed8c62ff6	[ "BSD-3-Clause" ]	null	null	null	n=int(input()) s=list(map(int,input().split())) print(max(s)-min(s)-n+1)	18.25	32	0.616438	16	73	2.8125	0.6875	0.355556	0	0	0	0	0	0	0	0	0.014286	0.041096	73	3	33	24.333333	0.628571	0	0	0	0	0	0	0	0	0	1	0	false	0	0	0	0	0.333333	1	0	null	1	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
66ec06d767765a81f422b6b4f17c68a7acecde11	594	py	Python	SCA11H/commands/bcg/GetDirection.py	ihutano/SCA11H	ee8a38ec9e47bc015851c20fa121651d2601cde0	[ "MIT" ]	null	null	null	SCA11H/commands/bcg/GetDirection.py	ihutano/SCA11H	ee8a38ec9e47bc015851c20fa121651d2601cde0	[ "MIT" ]	null	null	null	SCA11H/commands/bcg/GetDirection.py	ihutano/SCA11H	ee8a38ec9e47bc015851c20fa121651d2601cde0	[ "MIT" ]	null	null	null	from SCA11H.commands.base.GetCommand import GetCommand from SCA11H.commands.bcg.Direction import Direction from SCA11H.commands.base import enum_from_value class GetDirection(GetCommand): """ Query BCG Measurement Direction """ def __init__(self, kwargs): super().__init__(endpoint='/bcg/dir', kwa...	27	68	0.690236	71	594	5.56338	0.422535	0.075949	0.136709	0.111392	0	0	0	0	0	0	0.012448	0.188552	594	21	69	28.285714	0.807054	0.052189	0.142857	0	0	0.095496	0	0	0	0	1	0.285714	false	0	0.214286	0.214286	0.785714	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
dd2d462da5c31e25825a93a3fb282d0e53f86eb2	209	py	Python	ub/modules/space.py	parv779/javes-3.0	d510717b2756a65b39ff18d9f53d4adc46d8e23f	[ "MIT" ]	15	2020-12-13T17:37:05.000Z	2021-06-23T00:00:49.000Z	ub/modules/space.py	parv779/javes-3.0	d510717b2756a65b39ff18d9f53d4adc46d8e23f	[ "MIT" ]	2	2021-01-11T16:39:31.000Z	2021-01-25T22:35:28.000Z	ub/modules/space.py	parv779/javes-3.0	d510717b2756a65b39ff18d9f53d4adc46d8e23f	[ "MIT" ]	78	2020-12-13T17:52:51.000Z	2022-03-24T03:43:09.000Z	from ub import bot from ub.utils import admin_cmd @bot.on(admin_cmd(pattern=r"space")) async def space(e): await e.edit("ㅤ") @bot.on(admin_cmd(pattern=r"blank")) async def blank(e): await e.edit("")	20.9	36	0.688995	40	209	3.55	0.475	0.169014	0.140845	0.183099	0.295775	0.295775	0	0	0	0	0	0.138756	209	9	37	23.222222	0.783333	0	0	0	0	0.057416	0	0	0	0	1	0	true	0	0.25	0	0.25	0	0	0	null	0	0	1	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	1	0	0	0	0	0	3
dd35657cc02b95005b32267d44ce227b4ddcf550	254	py	Python	profiles/source/application/dtos.py	elpapi42/reactive-microservices-with-kafka-python	e14cf09ea814244dc794522464ff2945f3a02c13	[ "MIT" ]	null	null	null	profiles/source/application/dtos.py	elpapi42/reactive-microservices-with-kafka-python	e14cf09ea814244dc794522464ff2945f3a02c13	[ "MIT" ]	null	null	null	profiles/source/application/dtos.py	elpapi42/reactive-microservices-with-kafka-python	e14cf09ea814244dc794522464ff2945f3a02c13	[ "MIT" ]	null	null	null	from typing import List, Optional from uuid import UUID from pydantic import BaseModel from source.domain.enums import Gender class ProfileOutputDTO(BaseModel): user_id:UUID bio:Optional[str] age:Optional[int] gender:Optional[Gender]	18.142857	38	0.767717	34	254	5.705882	0.588235	0	0	0	0	0	0	0	0	0	0	0.169291	254	13	39	19.538462	0.919431	0	0	0	0	0	0	0	0	0	1	0	true	0	0.444444	0	1	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	1	0	1	0	1	0	3
dd66e31d3009689a426f0ecfc5e95d7d5e85eeb9	1,209	py	Python	oi/Contest/self/IOI-Test-Round/satellite/data/gen.py	Riteme/test	b511d6616a25f4ae8c3861e2029789b8ee4dcb8d	[ "BSD-Source-Code" ]	3	2018-08-30T09:43:20.000Z	2019-12-03T04:53:43.000Z	oi/Contest/self/IOI-Test-Round/satellite/data/gen.py	Riteme/test	b511d6616a25f4ae8c3861e2029789b8ee4dcb8d	[ "BSD-Source-Code" ]	null	null	null	oi/Contest/self/IOI-Test-Round/satellite/data/gen.py	Riteme/test	b511d6616a25f4ae8c3861e2029789b8ee4dcb8d	[ "BSD-Source-Code" ]	null	null	null	#!/usr/bin/env pypy from os import system as sh def gen(n, mode, limit, idx): for i in idx: print "(info) Generating 'satellite%s.in'..." % i sh("echo %s %s %s > satellite%s.in" % (n, mode, limit, i)) sh("touch satellite%s.out" % i) def gen_chain(n, limit, idx): for i in idx: ...	24.673469	73	0.557486	239	1,209	2.799163	0.32636	0.06278	0.071749	0.058296	0.286996	0.227205	0.227205	0.227205	0.152466	0.152466	0.24659	0.211745	1,209	48	74	25.1875	0.455404	0.07196	0.171429	0	0	0.163832	0	0	0	0	0	null	null	0	0.028571	null	null	0.057143	0	0	null	0	0	0	0	0	0	1	0	0	1	0	0	0	0	0	null	0	1	0	0	0	0	0	0	0	3
06ddaac8268fd37794392b1e12b7349d672f4d0b	169	py	Python	swesite/pointtracker/urls.py	alshar/SWE-ULL-Website	cad5e538c86c1416b95876dbb043a7b7da27b71f	[ "MIT" ]	null	null	null	swesite/pointtracker/urls.py	alshar/SWE-ULL-Website	cad5e538c86c1416b95876dbb043a7b7da27b71f	[ "MIT" ]	null	null	null	swesite/pointtracker/urls.py	alshar/SWE-ULL-Website	cad5e538c86c1416b95876dbb043a7b7da27b71f	[ "MIT" ]	1	2020-07-17T21:12:56.000Z	2020-07-17T21:12:56.000Z	from django.urls import path from pointtracker.views import PointTrackerLoginView urlpatterns = [ path('', PointTrackerLoginView.as_view(), name='pointtracker'), ]	24.142857	67	0.775148	17	169	7.647059	0.705882	0	0	0	0	0	0	0	0	0	0	0.118343	169	7	68	24.142857	0.872483	0	0	0	0	0.070588	0	0	0	0	1	0	false	0	0.4	0	0.4	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	0	0	3
660fe6e4159b1e8b5b8af082545867a0158c536c	23	py	Python	vacancies/__init__.py	st4lk/moscowdjango	7ec109ce1e8b8cbb4088cedfaa42ff635528fb37	[ "BSD-3-Clause" ]	2	2016-01-06T22:45:12.000Z	2021-02-17T13:11:51.000Z	vacancies/__init__.py	st4lk/moscowdjango	7ec109ce1e8b8cbb4088cedfaa42ff635528fb37	[ "BSD-3-Clause" ]	null	null	null	vacancies/__init__.py	st4lk/moscowdjango	7ec109ce1e8b8cbb4088cedfaa42ff635528fb37	[ "BSD-3-Clause" ]	1	2016-01-06T22:48:52.000Z	2016-01-06T22:48:52.000Z	__author__ = 'prophet'	11.5	22	0.73913	2	23	6.5	1	0	0	0	0	0	0	0	0	0	0	0.130435	23	1	23	23	0.65	0	0	0	0	0.304348	0	0	0	0	1	0	false	0	0	0	0	0	1	1	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
66117b7f4a255bbed91275d489841c75d2fc8534	3,479	py	Python	django_hstore_mixin/data_types.py	OspreyInformatics/django-hstore-mixin	c4e12d84a5e7560ca8090e9895f64926b80501f1	[ "MIT" ]	null	null	null	django_hstore_mixin/data_types.py	OspreyInformatics/django-hstore-mixin	c4e12d84a5e7560ca8090e9895f64926b80501f1	[ "MIT" ]	null	null	null	django_hstore_mixin/data_types.py	OspreyInformatics/django-hstore-mixin	c4e12d84a5e7560ca8090e9895f64926b80501f1	[ "MIT" ]	1	2020-07-23T15:34:02.000Z	2020-07-23T15:34:02.000Z	from django_hstore_mixin.serializers import deserializeValue, serializeValue, serializeDict __all__ = ('JsonDict',) class JsonDict(dict): """ A dict-like object where all values are serialized to and from JSON upon setting and getting, allowing it to be stored in and retrieved from Hstore field while ma...	34.79	91	0.6453	435	3,479	4.958621	0.298851	0.015763	0.020862	0.029207	0.290218	0.280482	0.241076	0.179879	0.171535	0.171535	0.000385	0.253234	3,479	99	92	35.141414	0.829869	0.253809	0.087719	0	0	0.005104	0	0	0	0	1	0.350877	false	0	0.017544	0.175439	0.631579	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
6614edca19409492f7e2a8e3e6585e356e5ad7c7	235	py	Python	adsocket_transport/utils.py	AwesomeDevelopersUG/adsocket-transport	96486d11558fc2b31310f556e85b399d6e86ef53	[ "MIT" ]	null	null	null	adsocket_transport/utils.py	AwesomeDevelopersUG/adsocket-transport	96486d11558fc2b31310f556e85b399d6e86ef53	[ "MIT" ]	null	null	null	adsocket_transport/utils.py	AwesomeDevelopersUG/adsocket-transport	96486d11558fc2b31310f556e85b399d6e86ef53	[ "MIT" ]	null	null	null	import importlib def import_driver(name): """ :param pth: :return: """ the_module = importlib.import_module(f'adsocket_transport.broker.{name}') class_ptr = getattr(the_module, 'broker') return class_ptr	18.076923	77	0.668085	28	235	5.357143	0.607143	0.12	0	0	0	0	0	0	0	0	0	0.208511	235	13	78	18.076923	0.806452	0.085106	0	0	0	0.194872	0.164103	0	0	0	1	0.2	false	0	0.6	0	1	0	1	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	1	0	3
661eefc7c9fc2103f57075df6a11b913e110cc8b	15,354	py	Python	promoprice/prom/moduls/magent.py	odlsandrey/crawlers	de6be94719a3bbee56213cee1d31690f0551c21c	[ "MIT" ]	null	null	null	promoprice/prom/moduls/magent.py	odlsandrey/crawlers	de6be94719a3bbee56213cee1d31690f0551c21c	[ "MIT" ]	null	null	null	promoprice/prom/moduls/magent.py	odlsandrey/crawlers	de6be94719a3bbee56213cee1d31690f0551c21c	[ "MIT" ]	null	null	null	#!/usr/bin/env python3 # -- coding: utf-8 -- import random import json from urllib import parse class UserAgent: def __init__(self): self.user_agents = [ 'Mozilla/5.0 (X11; Linux x86_64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/79.0.3945.130 Safari/537.36', 'Mozilla/5.0 (X11; Linux x86_64)...	97.796178	6,179	0.655139	2,405	15,354	4.101871	0.211642	0.010542	0.051698	0.056868	0.448049	0.396351	0.367968	0.342625	0.294475	0.287988	0.116654	0.201055	15,354	156	6,180	98.423077	0.687536	0.004168	0.047244	0	0.425197	0.837601	0.093576	0	0	0	1	0.086614	false	0.007874	0.023622	0	0.204724	0	0	0	null	0	0	0	0	0	0	0	0	1	0	0	0	1	1	0	null	0	0	0	0	0	0	0	0	0	3
663282df111e3af15e08967c43a2272474f8cf8f	92	py	Python	flarumpy/__init__.py	Nearata/flarumpy	70fb2f38d0fac6dfff2658cb7861ca34696f0de6	[ "Unlicense" ]	1	2021-07-14T02:27:40.000Z	2021-07-14T02:27:40.000Z	flarumpy/__init__.py	Nearata/flarumpy	70fb2f38d0fac6dfff2658cb7861ca34696f0de6	[ "Unlicense" ]	null	null	null	flarumpy/__init__.py	Nearata/flarumpy	70fb2f38d0fac6dfff2658cb7861ca34696f0de6	[ "Unlicense" ]	null	null	null	"""Python wrapper for the Flarum API.""" __version__ = "1.0a2" from .flarum import Flarum	15.333333	40	0.706522	13	92	4.692308	0.846154	0	0	0	0	0	0	0	0	0	0.038961	0.163043	92	5	41	18.4	0.753247	0.369565	0	0	0	0.096154	0	0	0	0	1	0	false	0	0.5	0	0.5	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	0	0	3
6654b2a706cb470079cef57d46d0b19e9c591dce	541	py	Python	xchainpy/xchainpy_thorchain/xchainpy_thorchain/cosmos/models/AminoWrapping.py	SLjavad/xchainpy-lib	e79b1fd341adaf9267964f3368500dd48de60917	[ "MIT" ]	8	2021-02-16T23:14:14.000Z	2022-03-22T09:35:58.000Z	xchainpy/xchainpy_thorchain/xchainpy_thorchain/cosmos/models/AminoWrapping.py	SLjavad/xchainpy-lib	e79b1fd341adaf9267964f3368500dd48de60917	[ "MIT" ]	12	2021-04-06T19:31:46.000Z	2022-03-22T14:34:13.000Z	xchainpy/xchainpy_thorchain/xchainpy_thorchain/cosmos/models/AminoWrapping.py	SLjavad/xchainpy-lib	e79b1fd341adaf9267964f3368500dd48de60917	[ "MIT" ]	10	2021-03-04T05:45:31.000Z	2022-03-31T14:44:01.000Z	import json class AminoWrapping: def __init__(self, type : str , value): self._type = type self._value = value @property def type(self): return self._type @type.setter def type(self, type): self._type = type @property def value(self): return self._...	21.64	112	0.597043	69	541	4.449275	0.347826	0.130293	0.117264	0	0	0	0	0	0	0	0	0.2939	541	25	112	21.64	0.803665	0	0.315789	0	0	0.001845	0	0	0	0	1	0.315789	false	0	0.052632	0.157895	0.578947	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
b0a2e447ff20246b7ce35f26802fdba836dbb0b7	2,233	py	Python	tests/component/url/test_resolver_no_creds.py	cwegrzyn/records-mover	e3b71d6c09d99d0bcd6a956b9d09d20f8abe98d2	[ "Apache-2.0" ]	36	2020-03-17T11:56:51.000Z	2022-01-19T16:03:32.000Z	tests/component/url/test_resolver_no_creds.py	cwegrzyn/records-mover	e3b71d6c09d99d0bcd6a956b9d09d20f8abe98d2	[ "Apache-2.0" ]	60	2020-03-02T23:13:29.000Z	2021-05-19T15:05:42.000Z	tests/component/url/test_resolver_no_creds.py	cwegrzyn/records-mover	e3b71d6c09d99d0bcd6a956b9d09d20f8abe98d2	[ "Apache-2.0" ]	4	2020-08-11T13:17:37.000Z	2021-11-05T21:11:52.000Z	from records_mover.url.resolver import file_url_ctors, UrlResolver from records_mover.url.base import BaseFileUrl from mock import Mock import unittest class NeedyFileUrl(BaseFileUrl): def __init__(self, url, boto3_session, gcs_client, gcp_creden...	43.784314	83	0.657859	255	2,233	5.392157	0.168627	0.085091	0.069818	0.045818	0.728	0.709818	0.709818	0.660364	0.660364	0.608	0.007908	0.263771	2,233	50	84	44.66	0.828467	0	0.545455	0	0	0.077026	0.036274	0	0	0.068182	1	0.090909	false	0	0.090909	0	0.227273	0	0	0	null	0	0	0	1	1	1	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
b0c1c4e7578dde2b5cbf17f81d472b53d88e5dcf	5,172	py	Python	CommonLayerCode/datalake-library/python/datalake_library/octagon/config.py	davidwebstar34/codepipeline-lambda-docker-images	ef30ab3f455d67f40910e0f2b2178bf40c028883	[ "MIT-0" ]	267	2020-10-26T16:21:49.000Z	2022-03-27T21:37:17.000Z	CommonLayerCode/datalake-library/python/datalake_library/octagon/config.py	davidwebstar34/codepipeline-lambda-docker-images	ef30ab3f455d67f40910e0f2b2178bf40c028883	[ "MIT-0" ]	28	2020-10-28T08:17:14.000Z	2022-01-21T18:47:23.000Z	CommonLayerCode/datalake-library/python/datalake_library/octagon/config.py	davidwebstar34/codepipeline-lambda-docker-images	ef30ab3f455d67f40910e0f2b2178bf40c028883	[ "MIT-0" ]	101	2020-10-27T15:36:20.000Z	2022-03-23T19:54:52.000Z	import json import logging import os from enum import Enum from .utils import throw_if_false class ConfigObjectEnum(Enum): OCTAGON_OBJECT_DATASETS = "Datasets" OCTAGON_OBJECT_DATASCHEMAS = "DataSchemas" OCTAGON_OBJECT_PIPELINES = "Pipelines" OCTAGON_OBJECT_PIPELINEHISTORY = "PipelineExecutionHistory" ...	37.751825	135	0.642885	609	5,172	5.126437	0.146141	0.049007	0.045804	0.063421	0.316464	0.251762	0.21877	0.21877	0.158552	0.158552	0.001851	0.268755	5,172	136	136	38.029412	0.823638	0	0.019608	0	0.009804	0.119296	0.026295	0	0	0	1	0.205882	false	0	0.04902	0.176471	0.539216	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
b0cda763925cee5049ceecdbb620b01e0f101307	2,325	py	Python	MaksimovKA_solution/utils/losses.py	ktncktnc/SpaceNet_Off_Nadir_Solutions	2a9ef1c3b72fb749c808ddb8593a85cb16b9f1ca	[ "Apache-2.0" ]	164	2019-01-31T16:37:09.000Z	2022-03-31T02:47:49.000Z	MaksimovKA_solution/utils/losses.py	xiaofanglegoc/SpaceNet_Off_Nadir_Solutions	812f151d244565f29987ebec7683ef42622ae16e	[ "Apache-2.0" ]	3	2019-11-20T03:32:29.000Z	2021-12-20T05:52:50.000Z	MaksimovKA_solution/utils/losses.py	xiaofanglegoc/SpaceNet_Off_Nadir_Solutions	812f151d244565f29987ebec7683ef42622ae16e	[ "Apache-2.0" ]	36	2019-02-08T19:12:35.000Z	2021-12-23T06:52:35.000Z	import sys; sys.path.append('..') import keras.backend as K def binary_crossentropy(y, p): return K.mean(K.binary_crossentropy(y, p)) def dice_coef(y_true, y_pred, smooth=1): y_true_f = K.flatten(y_true) y_pred_f = K.flatten(y_pred) intersection = K.sum(y_true_f * y_pred_f) return K.mean((2. * in...	32.291667	97	0.643871	403	2,325	3.419355	0.121588	0.083454	0.056604	0.09434	0.782293	0.699565	0.584906	0.397678	0.361393	0.361393	0.027427	0.215914	2,325	72	98	32.291667	0.72847	0	0.352941	0	0	0.028805	0	0	0	0	1	0.27451	false	0	0.039216	0.176471	0.666667	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
b0e20c5f4f455e179d92f8665889822bcd18255f	106	py	Python	tick/hawkes/simulation/base/__init__.py	sumau/tick	1b56924a35463e12f7775bc0aec182364f26f2c6	[ "BSD-3-Clause" ]	411	2017-03-30T15:22:05.000Z	2022-03-27T01:58:34.000Z	tick/hawkes/simulation/base/__init__.py	saurabhdash/tick	bbc561804eb1fdcb4c71b9e3e2d83a66e7b13a48	[ "BSD-3-Clause" ]	345	2017-04-13T14:53:20.000Z	2022-03-26T00:46:22.000Z	tick/hawkes/simulation/base/__init__.py	saurabhdash/tick	bbc561804eb1fdcb4c71b9e3e2d83a66e7b13a48	[ "BSD-3-Clause" ]	102	2017-04-25T11:47:53.000Z	2022-02-15T11:45:49.000Z	# License: BSD 3 clause from .simu_point_process import SimuPointProcess __all__ = ["SimuPointProcess"]	17.666667	48	0.792453	12	106	6.5	0.916667	0	0	0	0	0	0	0	0	0	0.01087	0.132075	106	5	49	21.2	0.836957	0.198113	0	0	0	0.192771	0	0	0	0	1	0	false	0	0.5	0	0.5	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	0	0	3
b0e2de402a44563ab655f7f828bc28da79a3b0d5	2,553	py	Python	sdk/storage/azure-mgmt-storageimportexport/azure/mgmt/storageimportexport/models/__init__.py	iscai-msft/azure-sdk-for-python	83715b95c41e519d5be7f1180195e2fba136fc0f	[ "MIT" ]	8	2021-01-13T23:44:08.000Z	2021-03-17T10:13:36.000Z	sdk/storage/azure-mgmt-storageimportexport/azure/mgmt/storageimportexport/models/__init__.py	iscai-msft/azure-sdk-for-python	83715b95c41e519d5be7f1180195e2fba136fc0f	[ "MIT" ]	226	2019-07-24T07:57:21.000Z	2019-10-15T01:07:24.000Z	sdk/storage/azure-mgmt-storageimportexport/azure/mgmt/storageimportexport/models/__init__.py	iscai-msft/azure-sdk-for-python	83715b95c41e519d5be7f1180195e2fba136fc0f	[ "MIT" ]	2	2020-05-21T22:51:22.000Z	2020-05-26T20:53:01.000Z	# coding=utf-8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for # license information. # # Code generated by Microsoft (R) AutoRest Code Generator. # Changes ...	34.5	76	0.719154	237	2,553	7.489451	0.303797	0.169014	0.109859	0.160563	0.057465	0	0	0	0	0	0.007554	0.170388	2,553	73	77	34.972603	0.8305	0.177047	0	0	0	0.147847	0.034928	0	0	0	1	0	false	0	0.590164	0	0.590164	0	0	0	null	0	0	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	1	0	3
b0ee1f73c51d8b11051268f666211d78567ec9af	427	py	Python	egov_emr/admin.py	lanfia/egov	9d97fef31eb9bca05cd0ceef8a4606b7c2bfceba	[ "MIT" ]	null	null	null	egov_emr/admin.py	lanfia/egov	9d97fef31eb9bca05cd0ceef8a4606b7c2bfceba	[ "MIT" ]	null	null	null	egov_emr/admin.py	lanfia/egov	9d97fef31eb9bca05cd0ceef8a4606b7c2bfceba	[ "MIT" ]	null	null	null	from django.contrib import admin from egov_emr.models import * admin.site.register(Country) admin.site.register(HealthCenter) admin.site.register(Allergy) admin.site.register(Reaction) admin.site.register(NextOfKin) admin.site.register(PatienceRecord) admin.site.register(PatienceAllegy) admin.site.register(Diagnostic...	26.6875	39	0.840749	54	427	6.62963	0.388889	0.276536	0.522346	0	0	0	0	0	0	0	0	0.04918	427	15	40	28.466667	0.881773	0	0	0	0	0	0	0	0	0	1	0	true	0	0.153846	0	0.153846	0	0	0	null	1	1	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	1	0	0	0	0	0	3
9fd4056901bf7b8e9ba89d511a0562576bf148bb	812	py	Python	app/models/shop/coupon.py	Hugking/lin-cms-flask	5f79e744e60d0f1b81c6e8bd045ab4ffa00043ce	[ "MIT" ]	null	null	null	app/models/shop/coupon.py	Hugking/lin-cms-flask	5f79e744e60d0f1b81c6e8bd045ab4ffa00043ce	[ "MIT" ]	null	null	null	app/models/shop/coupon.py	Hugking/lin-cms-flask	5f79e744e60d0f1b81c6e8bd045ab4ffa00043ce	[ "MIT" ]	null	null	null	from lin.exception import NotFound, ParameterException from lin.interface import InfoCrud as Base from sqlalchemy import Column, String, Integer, Text,ForeignKey, DateTime,DECIMAL class Coupon(Base): id = Column(Integer, primary_key=True, autoincrement=True) name = Column(String(255),nullable=False,default='')...	47.764706	81	0.748768	114	812	5.201754	0.394737	0.131535	0.202361	0.177066	0.306914	0.306914	0.306914	0.306914	0.306914	0.306914	0.039381	0.124384	812	16	82	50.75	0.794655	0	0	0	0	0.020936	0	0	0	0	1	0	false	0	0.2	0	1	0	0	0	null	0	1	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	1	0	3
9febb006d25a2e585cb8ab963d7d9ba7cc6ca861	2,407	py	Python	dictdata/migrations/0011_auto_20180604_1511.py	szatjp/rabbitplan	bae942e4673863027fe7f1936e58f2d9d4ebc5c7	[ "CC0-1.0" ]	null	null	null	dictdata/migrations/0011_auto_20180604_1511.py	szatjp/rabbitplan	bae942e4673863027fe7f1936e58f2d9d4ebc5c7	[ "CC0-1.0" ]	null	null	null	dictdata/migrations/0011_auto_20180604_1511.py	szatjp/rabbitplan	bae942e4673863027fe7f1936e58f2d9d4ebc5c7	[ "CC0-1.0" ]	null	null	null	# -- coding: utf-8 -- # Generated by Django 1.11.11 on 2018-06-04 07:11 from __future__ import unicode_literals from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): dependencies = [ ('dictdata', '0010_remove_jaword_fcreater'), ] oper...	38.822581	114	0.574574	232	2,407	5.849138	0.293103	0.047163	0.072218	0.113486	0.734709	0.734709	0.649226	0.649226	0.649226	0.649226	0.017992	0.284171	2,407	61	115	39.459016	0.769588	0.028666	0.685185	1	0	0.117345	0.011563	0	0	0	1	0	false	0	0.055556	0	0.111111	0	0	0	null	0	0	0	1	0	1	0	0	0	0	0	1	0	0	0	null	0	0	0	0	0	0	0	0	0	3
b007b356a93c2c2ae8f02d8bbf0a9bee500424dc	139	py	Python	run.py	moeenn/flask-blog	182487cf127b977a7263cb80d50c9ed00f1eed32	[ "MIT" ]	null	null	null	run.py	moeenn/flask-blog	182487cf127b977a7263cb80d50c9ed00f1eed32	[ "MIT" ]	null	null	null	run.py	moeenn/flask-blog	182487cf127b977a7263cb80d50c9ed00f1eed32	[ "MIT" ]	null	null	null	from flaskblog import create_app app = create_app() if __name__ == '__main__': # start the app in debug mode app.run(debug=True)	17.375	33	0.697842	21	139	4.142857	0.714286	0.206897	0	0	0	0	0	0	0	0	0	0.208633	139	7	34	19.857143	0.790909	0.194245	0	0	0	0.072727	0	0	0	0	1	0	false	0	0.25	0	0.25	0	1	0	null	1	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
b00865f357760e44c12b13b0ce4a187d28b4ea6a	627	py	Python	pyobs/events/focusfound.py	pyobs/pyobs-core	e3401e63eb31587c2bc535f7346b7e4ef69d64ab	[ "MIT" ]	4	2020-02-14T10:50:03.000Z	2022-03-25T04:15:06.000Z	pyobs/events/focusfound.py	pyobs/pyobs-core	e3401e63eb31587c2bc535f7346b7e4ef69d64ab	[ "MIT" ]	60	2020-09-14T09:10:20.000Z	2022-03-25T17:51:42.000Z	pyobs/events/focusfound.py	pyobs/pyobs-core	e3401e63eb31587c2bc535f7346b7e4ef69d64ab	[ "MIT" ]	2	2020-10-14T09:34:57.000Z	2021-04-27T09:35:57.000Z	from .event import Event class FocusFoundEvent(Event): """Event to be sent when a new best focus has been found, e.g. after a focus series.""" __module__ = 'pyobs.events' def __init__(self, focus: float = None, error: float = None, filter_name: str = None): Event.__init__(self) self.data ...	24.115385	91	0.631579	80	627	4.7125	0.45	0.084881	0.111406	0.143236	0	0	0	0	0	0	0	0.240829	627	25	92	25.08	0.792017	0.129187	0.1875	0	0	0.109259	0	0	0	0	1	0.25	false	0	0.0625	0.1875	0.625	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
b012069232cc5405fbf62d2b4dd61d6b231eda30	2,511	py	Python	444444.py	HAKERBOYMDALAMIN/MDALAMIN.SMS.PY	f45113e10b024ca554f945d13d51e071e48131a6	[ "Apache-2.0" ]	null	null	null	444444.py	HAKERBOYMDALAMIN/MDALAMIN.SMS.PY	f45113e10b024ca554f945d13d51e071e48131a6	[ "Apache-2.0" ]	null	null	null	444444.py	HAKERBOYMDALAMIN/MDALAMIN.SMS.PY	f45113e10b024ca554f945d13d51e071e48131a6	[ "Apache-2.0" ]	null	null	null	import requests, os, time, sys, smtplib blue = '\x1b[94m' lightblue = '\x1b[94m' red = '\x1b[91m' white = '\x1b[97m' green = '\x1b[93m' green = '\x1b[1;32m' cyan = '\x1b[96m' end = '\x1b[0m' yellow = '\n\n\x1b[1;93m' def alamin(z): for word in z + '\n': sys.stdout.write(word) sys.stdout.flush() ...	25.886598	727	0.560733	215	2,511	4.153488	0.35814	0.047032	0.06383	0.080627	0.318029	0.318029	0.318029	0.318029	0.318029	0.215006	0.027575	0.234568	2,511	96	728	26.15625	0.437045	0.004779	0.296296	0	0.037037	0.556891	0.27524	0	0	0	0	null	null	0.111111	0.018519	null	null	0.074074	0	0	null	0	0	0	0	0	0	0	0	0	1	0	0	0	0	0	null	0	1	0	0	1	0	0	0	0	3
b01ee8d880c32018753d5e08920dd652b17f1e34	6,213	py	Python	social_app/settings.py	sh3b/social_app	64aadd05570373ea75834b53b0b4abd2b16c8451	[ "MIT" ]	null	null	null	social_app/settings.py	sh3b/social_app	64aadd05570373ea75834b53b0b4abd2b16c8451	[ "MIT" ]	4	2021-06-04T23:11:02.000Z	2022-02-10T11:23:57.000Z	social_app/settings.py	shuayb/social_app	64aadd05570373ea75834b53b0b4abd2b16c8451	[ "MIT" ]	null	null	null	""" Django settings for social_app project. Generated by 'django-admin startproject' using Django 2.2.7. For more information on this file, see https://docs.djangoproject.com/en/2.2/topics/settings/ For the full list of settings and their values, see https://docs.djangoproject.com/en/2.2/ref/settings/ """ import os...	28.369863	91	0.686625	692	6,213	6.001445	0.385838	0.062605	0.049121	0.048158	0.177221	0.126415	0.078738	0.064291	0.028895	0	0.009199	0.177692	6,213	218	92	28.5	0.80368	0.323676	0.049587	1	0	0.506024	0.403373	0	0	0	1	0	false	0.07438	0.024793	0	0.024793	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	1	0	0	1	null	0	0	0	0	1	0	0	0	0	3
c67e69bfdfe230d53f5969431c958e8a6e117177	184	py	Python	configs/cbnet/mask_rcnn_cbv2_swin_tiny_patch4_window7_mstrain_480-800_adamw_3x_coco.py	Jack-Hu-2001/UniverseNet	03e7b8442286f951c65fe730ec86b9441005ac1b	[ "Apache-2.0" ]	314	2020-06-26T20:41:19.000Z	2022-03-30T06:05:47.000Z	configs/cbnet/mask_rcnn_cbv2_swin_tiny_patch4_window7_mstrain_480-800_adamw_3x_coco.py	Smasher-z/UniverseNet	794e7d3d2c7a8f2f6601a60b67366d93a3f30a1f	[ "Apache-2.0" ]	33	2020-07-26T12:39:06.000Z	2022-01-28T09:15:45.000Z	configs/cbnet/mask_rcnn_cbv2_swin_tiny_patch4_window7_mstrain_480-800_adamw_3x_coco.py	Smasher-z/UniverseNet	794e7d3d2c7a8f2f6601a60b67366d93a3f30a1f	[ "Apache-2.0" ]	39	2020-07-17T12:10:05.000Z	2022-03-21T19:42:22.000Z	_base_ = '../swin_original/mask_rcnn_swin_tiny_patch4_window7_mstrain_480-800_adamw_3x_coco.py' # noqa model = dict(backbone=dict(type='CBSwinTransformer'), neck=dict(type='CBFPN'))	46	103	0.798913	27	184	4.962963	0.851852	0.119403	0	0	0	0	0	0	0	0	0.052023	0.059783	184	3	104	61.333333	0.722543	0.021739	0	0	0	0.595506	0.47191	0	0	0	1	0	false	0	0	0	0	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	1	null	0	0	0	0	0	0	0	0	0	3
c6848921df4f65b86255bb31831f44dfa4a54681	609	py	Python	world_generator/voronoi/events/event.py	byfron/Project-iom	fd78ddedbd5722d83a22f44b7f653f294b70f99b	[ "MIT" ]	null	null	null	world_generator/voronoi/events/event.py	byfron/Project-iom	fd78ddedbd5722d83a22f44b7f653f294b70f99b	[ "MIT" ]	null	null	null	world_generator/voronoi/events/event.py	byfron/Project-iom	fd78ddedbd5722d83a22f44b7f653f294b70f99b	[ "MIT" ]	null	null	null	class Event: circle_event = False @property def x(self): return 0 @property def y(self): return 0 def __lt__(self, other): if self.y == other.y and self.x == other.x: return self.circle_event and not other.circle_event if self.y == other.y: ...	21	63	0.550082	87	609	3.632184	0.252874	0.063291	0.126582	0.139241	0.278481	0.158228	0.158228	0.158228	0.158228	0	0.005102	0.356322	609	28	64	21.75	0.80102	0.021346	0.2	0	0	0	0	0	0	0	1	0.25	false	0	0	0.15	0.75	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
c69c3b554fce8e6c7375ff6636dd0a7024a75704	87	py	Python	cpy_deploy/helpers.py	tammymakesthings/cpydeploy	3ced5a5a1fbfcaf3816874b2d9766c146c9d748e	[ "MIT" ]	null	null	null	cpy_deploy/helpers.py	tammymakesthings/cpydeploy	3ced5a5a1fbfcaf3816874b2d9766c146c9d748e	[ "MIT" ]	null	null	null	cpy_deploy/helpers.py	tammymakesthings/cpydeploy	3ced5a5a1fbfcaf3816874b2d9766c146c9d748e	[ "MIT" ]	null	null	null	class Helpers: def __init__(self): self.description = "CPY_Deploy Helpers"	21.75	47	0.678161	10	87	5.4	0.8	0	0	0	0	0	0	0	0	0	0	0.229885	87	3	48	29	0.80597	0	0	0	0	0.206897	0	0	0	0	1	0.333333	false	0	0	0	0.666667	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	1	0	0	0	0	0	0	3
c69fd4c565bb2deb1b5554146768a467846a0a9c	23,918	py	Python	pyinjective/proto/injective/peggy/v1/genesis_pb2.py	CtheSky/sdk-python	c1b1ae931f4970832466a004eb193027bdc1dea5	[ "Apache-2.0" ]	10	2021-09-07T08:03:52.000Z	2022-03-08T08:39:30.000Z	pyinjective/proto/injective/peggy/v1/genesis_pb2.py	CtheSky/sdk-python	c1b1ae931f4970832466a004eb193027bdc1dea5	[ "Apache-2.0" ]	39	2021-08-19T20:09:35.000Z	2022-03-22T19:51:59.000Z	pyinjective/proto/injective/peggy/v1/genesis_pb2.py	CtheSky/sdk-python	c1b1ae931f4970832466a004eb193027bdc1dea5	[ "Apache-2.0" ]	5	2021-11-02T16:23:48.000Z	2022-01-20T22:30:05.000Z	# -- coding: utf-8 -- # Generated by the protocol buffer compiler. DO NOT EDIT! # source: injective/peggy/v1/genesis.proto """Generated protocol buffer code.""" from google.protobuf import descriptor as _descriptor from google.protobuf import message as _message from google.protobuf import reflection as _reflection ...	64.818428	3,063	0.779664	3,361	23,918	5.200536	0.081523	0.048973	0.077178	0.043481	0.777218	0.736598	0.686424	0.661594	0.591624	0.564849	0.050345	0.103938	23,918	368	3,064	64.994565	0.765211	0.01501	0.616279	1	0.017442	0.27477	0.241772	0	0	0	1	0	false	0	0.02907	0	0.02907	0	0	0	null	0	0	0	1	0	0	0	0	1	0	0	1	0	0	0	null	0	0	0	0	0	0	0	0	0	3
c6b5092e7529cb079004ea679dd5d643d26d1a75	563	py	Python	checkin/templatetags/checkin_tags.py	mahoyen/web	1d190a86e3277315804bfcc0b8f9abd4f9c1d780	[ "MIT" ]	null	null	null	checkin/templatetags/checkin_tags.py	mahoyen/web	1d190a86e3277315804bfcc0b8f9abd4f9c1d780	[ "MIT" ]	null	null	null	checkin/templatetags/checkin_tags.py	mahoyen/web	1d190a86e3277315804bfcc0b8f9abd4f9c1d780	[ "MIT" ]	null	null	null	from django import template register = template.Library() @register.filter(name='has_voter') def has_voter(suggestion, user): return suggestion.voters.filter(user=user).exists() @register.filter(name='locale_title') def locale_title(skill, language_code): return skill.locale_title(language_code) @registe...	23.458333	56	0.781528	76	563	5.552632	0.355263	0.132701	0.170616	0.099526	0.132701	0.132701	0	0	0	0	0	0.095915	563	23	57	24.478261	0.829077	0	0	0	0	0.207815	0.134991	0	0	0	1	0.285714	false	0	0.071429	0.285714	0.642857	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
c6b5b759a1aed3df48b3235af32af9a6f52fb26c	19	py	Python	prompt/config.py	dyabel/detpro	73974a3b67b38548a4b2a8ade45e47fea31a5ddc	[ "Apache-2.0" ]	23	2022-03-28T02:32:53.000Z	2022-03-31T17:09:14.000Z	prompt/config.py	dyabel/detpro	73974a3b67b38548a4b2a8ade45e47fea31a5ddc	[ "Apache-2.0" ]	1	2022-03-30T13:06:00.000Z	2022-03-31T04:49:58.000Z	prompt/config.py	dyabel/detpro	73974a3b67b38548a4b2a8ade45e47fea31a5ddc	[ "Apache-2.0" ]	1	2022-03-31T09:06:29.000Z	2022-03-31T09:06:29.000Z	temperature = 0.01	9.5	18	0.736842	3	19	4.666667	1	0	0	0	0	0	0	0	0	0	0.1875	0.157895	19	2	18	9.5	0.6875	0	0	0	0	0	0	0	0	0	1	0	false	0	0	0	0	0	1	1	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
c6d0f7c6268d2fafdc8607bc8e7534b957441fea	4,068	py	Python	trec2015/cuttsum/corpora.py	kedz/cuttsum	992c21192af03fd2ef863f5ab7d10752f75580fa	[ "Apache-2.0" ]	6	2015-09-10T02:22:21.000Z	2021-10-01T16:36:46.000Z	trec2015/cuttsum/corpora.py	kedz/cuttsum	992c21192af03fd2ef863f5ab7d10752f75580fa	[ "Apache-2.0" ]	null	null	null	trec2015/cuttsum/corpora.py	kedz/cuttsum	992c21192af03fd2ef863f5ab7d10752f75580fa	[ "Apache-2.0" ]	2	2018-04-04T10:44:32.000Z	2021-10-01T16:37:26.000Z	import streamcorpus as sc def get_raw_corpus(event): if event.query_id.startswith(u"TS13"): return EnglishAndUnknown2013() elif event.query_id.startswith(u"TS14") \ or event.query_id.startswith(u"TS15"): return SerifOnly2014() else: raise Exception("Bad query id {}".for...	27.486486	76	0.635447	521	4,068	4.786948	0.205374	0.088212	0.035285	0.026063	0.706095	0.647554	0.639535	0.628308	0.591419	0.457097	0.044982	0.267699	4,068	147	77	27.673469	0.792212	0.126106	0.636364	0	0	0.206282	0.085456	0	0	0	1	0.333333	false	0	0.010101	0.222222	0.666667	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
05aac4386eb759d6fd9e14f320948e1bef97932b	8,591	py	Python	amino/either.py	tek/amino	51b314933e047a45587a24ecff02c836706d27ff	[ "MIT" ]	33	2016-12-21T07:05:46.000Z	2020-04-29T04:26:46.000Z	amino/either.py	tek/amino	51b314933e047a45587a24ecff02c836706d27ff	[ "MIT" ]	1	2019-04-19T17:15:52.000Z	2019-04-20T18:28:23.000Z	amino/either.py	tek/amino	51b314933e047a45587a24ecff02c836706d27ff	[ "MIT" ]	4	2017-09-04T18:46:23.000Z	2021-11-02T04:18:13.000Z	import abc import importlib from typing import TypeVar, Generic, Union, Any, cast, Iterator, Type, Callable from types import ModuleType from pathlib import Path import amino from amino import boolean from amino.func import I from amino.tc.base import F from amino.util.mod import unsafe_import_name from amino.tc.monoi...	32.418868	116	0.60738	1,160	8,591	4.324138	0.130172	0.029904	0.025917	0.020335	0.341507	0.264553	0.227273	0.191986	0.164075	0.120614	0.00093	0.249098	8,591	264	117	32.541667	0.776624	0	0.275	0	0	0.09475	0.022	0	0	0	1	0.265	false	0	0.215	0.15	0.755	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	1	1	0	3
05aeed90562ffe42128425ab26819ecb38d46aba	1,608	py	Python	synergine/synergy/event/Action.py	buxx/synergine	da05d762cdbc993362807d4851e1ca74784438ae	[ "Apache-2.0" ]	6	2015-04-03T08:04:22.000Z	2016-11-13T22:47:11.000Z	synergine/synergy/event/Action.py	buxx/synergine	da05d762cdbc993362807d4851e1ca74784438ae	[ "Apache-2.0" ]	2	2019-10-21T15:41:39.000Z	2021-06-10T14:15:27.000Z	synergine/synergy/event/Action.py	buxx/synergine	da05d762cdbc993362807d4851e1ca74784438ae	[ "Apache-2.0" ]	2	2015-02-27T12:05:51.000Z	2016-05-11T07:25:20.000Z	class Action(): """ ``Action`` own the code intended for modify synergies objects. """ _listen = None """The ``Event`` class to listen.""" _depend = [] """List of ``Action`` who need to be executed before this.""" @classmethod def get_listened_class(cls): """ :retu...	25.125	80	0.584577	177	1,608	5.163842	0.372881	0.052516	0.039387	0.032823	0.089716	0.089716	0.089716	0.089716	0.089716	0.089716	0	0.314677	1,608	64	81	25.125	0.829401	0.415423	0.157895	0	0	0	0	0	0	0	1	0.315789	false	0.052632	0	0	0.631579	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	1	0	0	1	0	3
05b65d8f905f121f82373b3b32b3cc64ed79c412	2,240	py	Python	sites/AgentJbzd.py	Crystalzord/Spreader	b4b0b1d81fe6c8adf3c15353dbc6aaafa286b9d9	[ "MIT" ]	1	2020-04-11T21:25:17.000Z	2020-04-11T21:25:17.000Z	sites/AgentJbzd.py	Crystalzord/spreader	b4b0b1d81fe6c8adf3c15353dbc6aaafa286b9d9	[ "MIT" ]	null	null	null	sites/AgentJbzd.py	Crystalzord/spreader	b4b0b1d81fe6c8adf3c15353dbc6aaafa286b9d9	[ "MIT" ]	null	null	null	import logging from selenium import webdriver from selenium.common.exceptions import NoSuchElementException from selenium.webdriver.common.by import By from selenium.webdriver.support import expected_conditions as ec from selenium.webdriver.support.ui import WebDriverWait from sites.FormalAgenttInterface import Forma...	33.939394	116	0.708036	260	2,240	5.919231	0.4	0.08447	0.127355	0.120858	0.241715	0.075374	0.042885	0	0	0	0.004956	0.189286	2,240	65	117	34.461538	0.842511	0.041071	0.162791	0	0	0.142257	0.072761	0	0.015385	0	1	0.209302	false	0.069767	0.186047	0	0.418605	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	1	0	1	0	1	0	0	0	0	3
05d2e80d95a20d54c5f12a79c569263065534de0	374	py	Python	Aula01/teste_dobradura/dobradura.py	felipemamore/SalaGreen-Felipe	73664b77fdd09400e9129364308dded0fc15234d	[ "Apache-2.0" ]	null	null	null	Aula01/teste_dobradura/dobradura.py	felipemamore/SalaGreen-Felipe	73664b77fdd09400e9129364308dded0fc15234d	[ "Apache-2.0" ]	null	null	null	Aula01/teste_dobradura/dobradura.py	felipemamore/SalaGreen-Felipe	73664b77fdd09400e9129364308dded0fc15234d	[ "Apache-2.0" ]	null	null	null	class Dobradura: def get_dobrar(self, numero_dobradura): self.numero_dobradura = 1 if type(numero_dobradura) == int and numero_dobradura > 0: for i in range(0,numero_dobradura): self.numero_dobradura = 2**numero_dobradura return self.numero_dobradura el...	10.685714	66	0.585561	41	374	5.121951	0.512195	0.571429	0.361905	0.238095	0.32381	0	0	0	0	0	0.016529	0.352941	374	34	67	11	0.85124	0	0	0	0	0	0	0	0	0	1	0.111111	false	0	0	0	0.444444	0	0	0	null	1	1	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
05e28e20b4663e9f730d2d63532815015c801bf7	945	py	Python	Scripts/682.py	zzz0906/LeetCode	cd0b4a4fd03d0dff585c9ef349984eba1922ece0	[ "MIT" ]	17	2018-08-23T08:53:56.000Z	2021-04-17T00:06:13.000Z	Scripts/682.py	zzz0906/LeetCode	cd0b4a4fd03d0dff585c9ef349984eba1922ece0	[ "MIT" ]	null	null	null	Scripts/682.py	zzz0906/LeetCode	cd0b4a4fd03d0dff585c9ef349984eba1922ece0	[ "MIT" ]	null	null	null	class Solution(object): def calPoints(self, ops): """ :type ops: List[str] :rtype: int """ listvalue = [] last1 = 0 last2 = 0 sum = 0 for i in range(len(ops)): if (ops[i] == '+'): sum = listvalue[len(listvalue)-1] + ...	35	91	0.416931	94	945	4.191489	0.329787	0.213198	0.373096	0.279188	0.464467	0.464467	0.370558	0.22335	0	0	0.02682	0.447619	945	26	92	36.346154	0.727969	0.033862	0.136364	0	0	0.003405	0	0	0	0	1	0.045455	false	0	0	0	0.136364	0	0	0	null	1	1	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
af1cead9554d5a1a5a2657fd1b18028a11bbf4ef	839	py	Python	OtrosEjemplos/blackjack/features/steps/steps.py	GLUD/Guide-Behaver	f62a0d02af4702f5301b45a8b20c544e7e067a31	[ "BSD-3-Clause" ]	null	null	null	OtrosEjemplos/blackjack/features/steps/steps.py	GLUD/Guide-Behaver	f62a0d02af4702f5301b45a8b20c544e7e067a31	[ "BSD-3-Clause" ]	null	null	null	OtrosEjemplos/blackjack/features/steps/steps.py	GLUD/Guide-Behaver	f62a0d02af4702f5301b45a8b20c544e7e067a31	[ "BSD-3-Clause" ]	null	null	null	from behave import * from twentyone import * @given('a dealer') def step_impl(context): context.dealer = Dealer() ## NEW STEP @given('a hand {total:d}') def step_impl(context, total): context.dealer = Dealer() context.total = total @given('a {hand}') def step_impl(context, hand): context.dealer = De...	22.675676	70	0.693683	119	839	4.798319	0.260504	0.204904	0.134851	0.220666	0.252189	0.203152	0	0	0	0	0.001416	0.158522	839	36	71	23.305556	0.807365	0.020262	0.32	0	0	0.170135	0	0	0	0.12	1	0.28	false	0	0.08	0	0.36	0	0	0	null	1	0	1	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	0	0	0	3
af1f0e8578f84033c5ecb81366801237cdbe1de5	132	py	Python	designpattern/facade.py	junkainiu/learning	4968bf1c5f21caa285eac57c85292ebc6b900b21	[ "MIT" ]	1	2017-03-31T05:52:55.000Z	2017-03-31T05:52:55.000Z	designpattern/facade.py	junkainiu/python-notebook	4968bf1c5f21caa285eac57c85292ebc6b900b21	[ "MIT" ]	null	null	null	designpattern/facade.py	junkainiu/python-notebook	4968bf1c5f21caa285eac57c85292ebc6b900b21	[ "MIT" ]	null	null	null	import abc class Server(object): __metaclass = abc.ABCMeta @abc.abstractmethod def __init__(self): pass	12	29	0.628788	14	132	5.5	0.857143	0	0	0	0	0	0	0	0	0	0	0.295455	132	10	30	13.2	0.827957	0	0	0	0	0	0	0	0	0	1	0.166667	false	0.166667	0.166667	0	0.666667	0	1	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	1	0	0	1	0	3
af23681a724ce4e53bda9914d197bcb306d6050c	125	py	Python	utilities/getsubjects.py	IshaanIvaturi/rucs24-bot	27735d9247ca97a66c70164cad7d74df367dc955	[ "MIT" ]	6	2020-08-29T15:41:35.000Z	2020-10-28T20:12:02.000Z	utilities/getsubjects.py	IshaanIvaturi/rucs24-bot	27735d9247ca97a66c70164cad7d74df367dc955	[ "MIT" ]	73	2020-08-26T19:32:40.000Z	2020-11-23T05:16:51.000Z	utilities/getsubjects.py	IshaanIvaturi/rucs24-bot	27735d9247ca97a66c70164cad7d74df367dc955	[ "MIT" ]	17	2020-08-26T21:15:41.000Z	2020-11-10T02:02:07.000Z	import json # Load subjects into subject_list with open("apidata/subjects.json", "r") as f: subject_list = json.load(f)	20.833333	45	0.72	20	125	4.4	0.65	0.181818	0	0	0	0	0	0	0	0	0	0.16	125	5	46	25	0.838095	0.248	0	0	0	0.23913	0.228261	0	0	0	1	0	false	0	0.333333	0	0.333333	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	0	0	3
af427ff0f9149ce9eec1baff08b2ec77b3fe171e	166	py	Python	13_modules/current_date_and_time.py	njoroge33/py_learn	6ad55f37789045bc5c03f3dd668cf1ea497f4e84	[ "MIT" ]	null	null	null	13_modules/current_date_and_time.py	njoroge33/py_learn	6ad55f37789045bc5c03f3dd668cf1ea497f4e84	[ "MIT" ]	2	2019-04-15T06:29:55.000Z	2019-04-19T17:34:32.000Z	13_modules/current_date_and_time.py	njoroge33/py_learn	6ad55f37789045bc5c03f3dd668cf1ea497f4e84	[ "MIT" ]	1	2019-11-19T04:51:18.000Z	2019-11-19T04:51:18.000Z	# Write a program which prints the current day,date and time of the system # for more info on this quiz, go to this url: http://www.programmr.com/current-date-n-time	83	90	0.759036	32	166	3.9375	0.84375	0	0	0	0	0	0	0	0	0	0	0.156627	166	2	90	83	0.9	0.975904	null	0	null	0	0	null	0	null	1	null	true	0	0	null	null	null	0	0	null	0	0	0	0	0	0	0	1	0	0	1	0	0	0	0	null	0	0	0	1	0	0	0	0	0	3
af6f3cef3d147c146ab5f4c9fcdaf7d94482ca84	193	py	Python	python/Core/Runner/Template/__init__.py	toilatester/sample-automation-frameworks-across-languages	4c1ceb3f8fff14ed838f94c92be7d92013c95d4a	[ "Apache-2.0" ]	8	2020-12-11T06:57:12.000Z	2021-10-11T12:53:49.000Z	python/Core/Runner/Template/__init__.py	toilatester/sample-automation-frameworks-across-languages	4c1ceb3f8fff14ed838f94c92be7d92013c95d4a	[ "Apache-2.0" ]	null	null	null	python/Core/Runner/Template/__init__.py	toilatester/sample-automation-frameworks-across-languages	4c1ceb3f8fff14ed838f94c92be7d92013c95d4a	[ "Apache-2.0" ]	2	2021-04-06T08:14:35.000Z	2021-08-05T01:43:54.000Z	import os TEMPLATE_FILE_NAME = "index.html" TEMPLATE_FOLDER_PATH = os.path.join( os.path.dirname(__file__)) TEMPLATE_FILE_PATH = os.path.join( os.path.dirname(__file__), "index.html")	24.125	44	0.746114	29	193	4.482759	0.37931	0.184615	0.153846	0.215385	0.476923	0.476923	0.476923	0.476923	0	0	0	0.119171	193	7	45	27.571429	0.764706	0	0	0	0	0.103627	0	0	0	0	1	0	false	0	0.166667	0	0.166667	0	1	0	null	0	0	1	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
af7cfe869f69db94c0886cd72dfdfd3c875b01d1	391	py	Python	nonebot_plugin_arcaea/exceptions.py	iyume/nonebot-plugin-arcaea	cd2110b11ae41707396a0db21f228474cc3e35b4	[ "MIT" ]	35	2021-02-08T09:55:51.000Z	2022-03-19T08:22:07.000Z	nonebot_plugin_arcaea/exceptions.py	iyume/nonebot-plugin-arcaea	cd2110b11ae41707396a0db21f228474cc3e35b4	[ "MIT" ]	10	2021-02-22T04:15:58.000Z	2022-03-28T02:55:02.000Z	nonebot_plugin_arcaea/exceptions.py	iyume/nonebot-plugin-arcaea	cd2110b11ae41707396a0db21f228474cc3e35b4	[ "MIT" ]	1	2022-01-18T03:57:07.000Z	2022-01-18T03:57:07.000Z	class ConfigError(Exception): ... class HTTPException(Exception): def __init__(self, status_code: int, detail: str = None) -> None: self.status_code = status_code self.detail = detail or 'no detail' def __repr__(self) -> str: class_name = self.__class__.__name__ return f"{...	30.076923	88	0.664962	50	391	4.74	0.4	0.21097	0.177215	0	0	0	0	0	0	0	0	0.207161	391	12	89	32.583333	0.764516	0	0	0	0	0.202046	0.176471	0	0	0	1	0.222222	false	0	0	0	0.555556	0	0	0	null	1	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	0	1	0	3
af8a14bfe4a45c58352e996e3efd8cbf79be8f86	251	py	Python	pystratis/api/node/requestmodels/rewindrequest.py	TjadenFroyda/pyStratis	9cc7620d7506637f8a2b84003d931eceb36ac5f2	[ "MIT" ]	8	2021-06-30T20:44:22.000Z	2021-12-07T14:42:22.000Z	pystratis/api/node/requestmodels/rewindrequest.py	TjadenFroyda/pyStratis	9cc7620d7506637f8a2b84003d931eceb36ac5f2	[ "MIT" ]	2	2021-07-01T11:50:18.000Z	2022-01-25T18:39:49.000Z	pystratis/api/node/requestmodels/rewindrequest.py	TjadenFroyda/pyStratis	9cc7620d7506637f8a2b84003d931eceb36ac5f2	[ "MIT" ]	4	2021-07-01T04:36:42.000Z	2021-09-17T10:54:19.000Z	from pystratis.api import Model # noinspection PyUnresolvedReferences class RewindRequest(Model): """A request model for the node/rewind endpoint. Args: height (int): The height to rewind to on node restart. """ height: int	20.916667	62	0.697211	31	251	5.645161	0.709677	0.102857	0	0	0	0	0	0	0	0	0	0.227092	251	11	63	22.818182	0.902062	0.589641	0	0	0	0	0	0	0	0	1	0	true	0	0.333333	0	1	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	1	0	1	0	1	0	3
af9aae72871fa2f7ab736b62b27acf85bf1ca9d9	686	py	Python	CodeforcesAPI/Exceptions.py	hsuan1117/CodeforcesAPI	468591059f40202082ef9931ee1e6d88dc112fd3	[ "MIT" ]	1	2021-06-14T09:41:49.000Z	2021-06-14T09:41:49.000Z	CodeforcesAPI/Exceptions.py	hsuan1117/CodeforcesAPI	468591059f40202082ef9931ee1e6d88dc112fd3	[ "MIT" ]	1	2021-08-31T16:39:36.000Z	2021-09-17T15:13:46.000Z	CodeforcesAPI/Exceptions.py	hsuan1117/CodeforcesAPI	468591059f40202082ef9931ee1e6d88dc112fd3	[ "MIT" ]	1	2021-06-16T13:07:08.000Z	2021-06-16T13:07:08.000Z	class CodeforcesException(Exception): """Exception raised for errors in the input salary. Attributes: message -- explanation of the error """ def __init__(self, message="Salary is not in (5000, 15000) range"): self.message = message super().__init__(self.message) class Codefo...	29.826087	71	0.695335	70	686	6.471429	0.428571	0.218543	0.198676	0.119205	0.476821	0.313466	0.313466	0.313466	0.207506	0	0.016484	0.204082	686	22	72	31.181818	0.813187	0.14723	0.5	0	0	0.15371	0	0	0	0	1	0.25	false	0	0	0	0.5	0	0	0	null	1	1	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	0	0	0	3
af9e4e350c9565b73d0e307530e31396c4eb965c	210	py	Python	oscar_support/defaults.py	SalahAdDin/django-oscar-support	4accc6e144cb1d1af278c4deb15271b10baf5a58	[ "BSD-3-Clause" ]	2	2018-04-17T22:58:36.000Z	2020-12-25T11:39:02.000Z	oscar_support/defaults.py	SalahAdDin/django-oscar-support	4accc6e144cb1d1af278c4deb15271b10baf5a58	[ "BSD-3-Clause" ]	1	2020-06-27T11:48:01.000Z	2020-06-27T11:48:01.000Z	oscar_support/defaults.py	SalahAdDin/django-oscar-support	4accc6e144cb1d1af278c4deb15271b10baf5a58	[ "BSD-3-Clause" ]	1	2021-01-06T14:09:47.000Z	2021-01-06T14:09:47.000Z	from django.utils.translation import ugettext_lazy as _ SUPPORT_INITIAL_STATUS = _("New") SUPPORT_INITIAL_STATUS_SLUG = "new" SUPPORT_RESOLVED_STATUS = _("Resolved") SUPPORT_RESOLVED_STATUS_SLUG = "resolved"	26.25	55	0.819048	26	210	6.076923	0.538462	0.177215	0.253165	0	0	0	0	0	0	0	0	0.095238	210	7	56	30	0.831579	0	0	0	0	0.104762	0	0	0	0	1	0	false	0	0.2	0	0.2	0	1	0	null	0	1	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
afb2edf8de60a9ab1074dd5e2d37170e7e8ef3c4	351	py	Python	main/settings/dev.py	Eleazar-Harold/weatherapp_django	091c0fcc963c7e57bba53413bb2fca6caa94bc93	[ "MIT" ]	2	2019-04-27T15:39:45.000Z	2019-06-11T14:01:47.000Z	main/settings/dev.py	Eleazar-Harold/weatherapp_django	091c0fcc963c7e57bba53413bb2fca6caa94bc93	[ "MIT" ]	6	2019-12-04T22:48:55.000Z	2021-06-10T17:57:27.000Z	main/settings/ci.py	Eleazar-Harold/weatherapp_django	091c0fcc963c7e57bba53413bb2fca6caa94bc93	[ "MIT" ]	1	2019-06-11T14:01:50.000Z	2019-06-11T14:01:50.000Z	from main.settings.base import * import os DEBUG = True DATABASES = { 'default': { 'ENGINE': 'django.db.backends.postgresql', 'NAME': os.environ['DB_NAME'], 'USER': os.environ['DB_USER'], 'PASSWORD': os.environ['DB_PASSWORD'], 'HOST': os.environ['DB_HOST'], 'PORT': ...	21.9375	50	0.566952	41	351	4.731707	0.512195	0.231959	0.283505	0	0	0	0	0	0	0	0	0.245014	351	15	51	23.4	0.732075	0	0	0	0	0.299145	0.082621	0	0	0	1	0	false	0.076923	0.153846	0	0.153846	0	0	0	null	1	1	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	1	0	0	0	0	3
afbb1be0637f76b7dbc6701458b5746f8628c55f	754	py	Python	fetch.py	nickklein/motion-sensor	8a066b73956b28c2b982335b387c25570538c26c	[ "MIT" ]	null	null	null	fetch.py	nickklein/motion-sensor	8a066b73956b28c2b982335b387c25570538c26c	[ "MIT" ]	null	null	null	fetch.py	nickklein/motion-sensor	8a066b73956b28c2b982335b387c25570538c26c	[ "MIT" ]	null	null	null	import requests from app import config class Fetch: def get(url): bearerToken = 'Bearer ' + config['PERSONAL_ACCESS_TOKEN'] header = {'Authorization': bearerToken} response = requests.get(url, headers=header) return response.json() def patch(url): bearerToken = ...	34.272727	77	0.64191	77	754	6.207792	0.324675	0.106695	0.144351	0.194561	0.784519	0.719665	0.719665	0.564854	0.564854	0.564854	0	0.245358	754	21	78	35.904762	0.84007	0	0.5	0	0	0.16313	0.083554	0	0	0	1	0.166667	false	0	0.111111	0	0.5	0	0	0	null	0	0	1	1	1	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	0	0	0	0	3
afbcd3bb3393d0d95b067182cb664ab68c632359	798	py	Python	controllerconfig/controllerconfig/controllerconfig/common/exceptions.py	etaivan/stx-config	281e1f110973f96e077645fb01f67b646fc253cc	[ "Apache-2.0" ]	null	null	null	controllerconfig/controllerconfig/controllerconfig/common/exceptions.py	etaivan/stx-config	281e1f110973f96e077645fb01f67b646fc253cc	[ "Apache-2.0" ]	null	null	null	controllerconfig/controllerconfig/controllerconfig/common/exceptions.py	etaivan/stx-config	281e1f110973f96e077645fb01f67b646fc253cc	[ "Apache-2.0" ]	null	null	null	# # Copyright (c) 2014 Wind River Systems, Inc. # # SPDX-License-Identifier: Apache-2.0 # """ Configuration Errors """ from configutilities import ConfigError class BackupFail(ConfigError): """Backup error.""" pass class UpgradeFail(ConfigError): """Upgrade error.""" pass class BackupWarn(Config...	14	45	0.657895	77	798	6.818182	0.571429	0.137143	0.16	0.099048	0.118095	0	0	0	0	0	0.009449	0.204261	798	56	46	14.25	0.817323	0.330827	0.473684	0	0	0	0	0	0	0	1	0	true	0.473684	0.052632	0	0.526316	0	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	1	1	0	0	1	0	3
afcd19c7491066633811bdd8a894d9d1d61e72df	496	py	Python	cohort/week8/cs3.py	jamestiotio/DW2020	a8c575f1afd34d66dce2798a11b2fa15d1214a43	[ "MIT" ]	null	null	null	cohort/week8/cs3.py	jamestiotio/DW2020	a8c575f1afd34d66dce2798a11b2fa15d1214a43	[ "MIT" ]	1	2021-11-04T16:30:26.000Z	2021-11-04T16:30:26.000Z	cohort/week8/cs3.py	jamestiotio/DW2020	a8c575f1afd34d66dce2798a11b2fa15d1214a43	[ "MIT" ]	null	null	null	import time class StopWatch: def __init__(self): self.start_time = time.time() self.end_time = -1 def start(self): self.start_time = time.time() self.end_time = -1 def stop(self): self.end_time = time.time() def elapsed_time(self): if self.end_time == ...	23.619048	60	0.5625	67	496	3.940299	0.283582	0.181818	0.25	0.136364	0.484848	0.484848	0.30303	0.30303	0.30303	0.30303	0.015152	0.334677	496	21	60	23.619048	0.784848	0	0.352941	0	0	0	0	0	0	0	1	0.235294	false	0	0.058824	0	0.529412	0	0	0	null	0	1	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	0	0	0	1	0	3
afd161c9a4cb35137a17afdf824468f5a64cce5d	205	py	Python	vault/forms.py	royaleagle-dev/infosafe	fcb00a67d6a8fdd3d2e032b53b56bbcf35d844b6	[ "Apache-2.0" ]	null	null	null	vault/forms.py	royaleagle-dev/infosafe	fcb00a67d6a8fdd3d2e032b53b56bbcf35d844b6	[ "Apache-2.0" ]	null	null	null	vault/forms.py	royaleagle-dev/infosafe	fcb00a67d6a8fdd3d2e032b53b56bbcf35d844b6	[ "Apache-2.0" ]	null	null	null	from django import forms from . models import Vault class VaultForm(forms.ModelForm): #meta information for the model class Meta: model = Vault exclude = ['date_created', 'last_edited', 'locked']	20.5	53	0.736585	27	205	5.518519	0.740741	0	0	0	0	0	0	0	0	0	0	0.170732	205	9	54	22.777778	0.876471	0.146341	0	0	0	0.166667	0	0	0	0	1	0	false	0	0.333333	0	0.666667	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	0	0	3
bb7611c52dade0944b939a8450781408f6af556e	92	py	Python	Nite_Mode/apps.py	thechawla225/NIte-Mode	8d7f5f1d571fe151cd933e47041515b20f124f25	[ "MIT" ]	1	2021-02-20T20:09:41.000Z	2021-02-20T20:09:41.000Z	Nite_Mode/apps.py	thechawla225/NIte-Mode	8d7f5f1d571fe151cd933e47041515b20f124f25	[ "MIT" ]	2	2021-04-13T12:03:53.000Z	2021-05-20T04:04:16.000Z	Nite_Mode/apps.py	thechawla225/NIte-Mode	8d7f5f1d571fe151cd933e47041515b20f124f25	[ "MIT" ]	null	null	null	from django.apps import AppConfig class NiteModeConfig(AppConfig): name = 'Nite_Mode'	15.333333	33	0.76087	11	92	6.272727	0.909091	0	0	0	0	0	0	0	0	0	0	0.163043	92	5	34	18.4	0.896104	0	0	0	0	0.097826	0	0	0	0	1	0	false	0	0.333333	0	1	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	0	0	3
bb7d41a347a04e8bfc3ebffb1e4defb9fcd16afc	571	py	Python	Open.py	gazawayj/HowYouPython	d634210d3494e86a6b6783ba11c5c99a1f750d7b	[ "MIT" ]	null	null	null	Open.py	gazawayj/HowYouPython	d634210d3494e86a6b6783ba11c5c99a1f750d7b	[ "MIT" ]	null	null	null	Open.py	gazawayj/HowYouPython	d634210d3494e86a6b6783ba11c5c99a1f750d7b	[ "MIT" ]	null	null	null	from random import seed from random import randint print("What do I want to use Python for on this project?") print("1. Create API/backend for the project.") print("2. Attempt machine learning in order to do something pretty cool sounding.") print("3. Choose one of the above randomly. That way I learn how to write ra...	43.923077	101	0.767075	94	571	4.670213	0.659574	0.045558	0.072893	0	0	0	0	0	0	0	0.041237	0.150613	571	13	102	43.923077	0.861856	0.094571	0	0	0.1	0.637597	0	0	0	0	0	null	null	0	0.2	null	null	0.6	0	0	null	0	0	0	0	0	0	0	0	0	0	0	0	0	1	0	null	0	1	0	0	0	0	0	0	1	3
bb8a2bb3ca234ce1b1b13edd67f8eb96258f0cd5	396	py	Python	modules/ReloadSystem.py	camargo2019/conecta	3bf67a7aa5280d1d263e5ee40cbc48f0045fcb99	[ "MIT" ]	1	2021-08-01T05:40:31.000Z	2021-08-01T05:40:31.000Z	modules/ReloadSystem.py	camargo2019/conecta	3bf67a7aa5280d1d263e5ee40cbc48f0045fcb99	[ "MIT" ]	null	null	null	modules/ReloadSystem.py	camargo2019/conecta	3bf67a7aa5280d1d263e5ee40cbc48f0045fcb99	[ "MIT" ]	null	null	null	#!/usr/bin/python3 import os import sys import json from socket import * from tkinter import * from .autoupdate import * from .user import * from .logged import * import subprocess from .database.database import * from .database.datalocal import * from .RequiredInternet import * class ReloadSystem: ...	23.294118	55	0.722222	48	396	5.875	0.541667	0.212766	0	0	0	0	0	0	0	0	0.003106	0.186869	396	17	55	23.294118	0.872671	0.042929	0	0	0	0.077135	0.077135	0	0	0	1	0.066667	false	0	0.8	0	0.933333	0	0	0	null	1	0	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	1	0	3
bbcd67587bc140f4f8e0cfc812ebbef7053699e3	118	py	Python	inscribete/urls.py	Kiri23/Django-custom-user-template	74ed531ade35c3018ca3068e8c68b966bcc4f316	[ "MIT" ]	null	null	null	inscribete/urls.py	Kiri23/Django-custom-user-template	74ed531ade35c3018ca3068e8c68b966bcc4f316	[ "MIT" ]	3	2020-02-12T00:04:04.000Z	2021-06-10T21:33:23.000Z	inscribete/urls.py	Kiri23/Django-custom-user-template	74ed531ade35c3018ca3068e8c68b966bcc4f316	[ "MIT" ]	null	null	null	from django.urls import path from . import views urlpatterns = [ path('', views.inscribete, name='inscribete') ]	16.857143	49	0.70339	14	118	5.928571	0.642857	0	0	0	0	0	0	0	0	0	0	0.169492	118	6	50	19.666667	0.846939	0	0	0	0	0.084746	0	0	0	0	1	0	false	0	0.4	0	0.4	0	1	0	null	0	0	0	0	0	0	0	1	0	0	0	0	0	0	0	null	0	0	0	0	0	1	0	0	0	3
bbe481cd79918aa27b768b7b34c4014adc6d10e6	498	py	Python	rl/env.py	iQua/fl-lottery	360d9c2d54c12e2631ac123a4dd5ac9184d913f0	[ "MIT" ]	1	2021-10-05T12:27:32.000Z	2021-10-05T12:27:32.000Z	rl/env.py	iQua/fl-lottery	360d9c2d54c12e2631ac123a4dd5ac9184d913f0	[ "MIT" ]	null	null	null	rl/env.py	iQua/fl-lottery	360d9c2d54c12e2631ac123a4dd5ac9184d913f0	[ "MIT" ]	2	2021-11-15T10:46:34.000Z	2022-01-05T11:33:41.000Z	class Environment(object): def __init__(self, fl_server): self.fl_server = fl_server self.fl_server.boot() # Run federated learning self.fl_server.run() def reset(self): pass # Delete global model os.remove(self.fl_server.paths.mod...	14.228571	57	0.546185	58	498	4.482759	0.465517	0.184615	0.230769	0.107692	0.153846	0	0	0	0	0	0	0.363454	498	35	58	14.228571	0.820189	0.084337	0.3125	0	0	0.015556	0	0	0	0	1	0.375	false	0.3125	0	0	0.4375	0	0	0	null	0	1	0	0	0	0	0	0	0	0	0	0	0	0	0	null	0	0	1	0	1	0	0	0	0	3

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.