hexsha string | size int64 | ext string | lang string | max_stars_repo_path string | max_stars_repo_name string | max_stars_repo_head_hexsha string | max_stars_repo_licenses list | max_stars_count int64 | max_stars_repo_stars_event_min_datetime string | max_stars_repo_stars_event_max_datetime string | max_issues_repo_path string | max_issues_repo_name string | max_issues_repo_head_hexsha string | max_issues_repo_licenses list | max_issues_count int64 | max_issues_repo_issues_event_min_datetime string | max_issues_repo_issues_event_max_datetime string | max_forks_repo_path string | max_forks_repo_name string | max_forks_repo_head_hexsha string | max_forks_repo_licenses list | max_forks_count int64 | max_forks_repo_forks_event_min_datetime string | max_forks_repo_forks_event_max_datetime string | content string | avg_line_length float64 | max_line_length int64 | alphanum_fraction float64 | qsc_code_num_words_quality_signal int64 | qsc_code_num_chars_quality_signal float64 | qsc_code_mean_word_length_quality_signal float64 | qsc_code_frac_words_unique_quality_signal float64 | qsc_code_frac_chars_top_2grams_quality_signal float64 | qsc_code_frac_chars_top_3grams_quality_signal float64 | qsc_code_frac_chars_top_4grams_quality_signal float64 | qsc_code_frac_chars_dupe_5grams_quality_signal float64 | qsc_code_frac_chars_dupe_6grams_quality_signal float64 | qsc_code_frac_chars_dupe_7grams_quality_signal float64 | qsc_code_frac_chars_dupe_8grams_quality_signal float64 | qsc_code_frac_chars_dupe_9grams_quality_signal float64 | qsc_code_frac_chars_dupe_10grams_quality_signal float64 | qsc_code_frac_chars_replacement_symbols_quality_signal float64 | qsc_code_frac_chars_digital_quality_signal float64 | qsc_code_frac_chars_whitespace_quality_signal float64 | qsc_code_size_file_byte_quality_signal float64 | qsc_code_num_lines_quality_signal float64 | qsc_code_num_chars_line_max_quality_signal float64 | qsc_code_num_chars_line_mean_quality_signal float64 | qsc_code_frac_chars_alphabet_quality_signal float64 | qsc_code_frac_chars_comments_quality_signal float64 | qsc_code_cate_xml_start_quality_signal float64 | qsc_code_frac_lines_dupe_lines_quality_signal float64 | qsc_code_cate_autogen_quality_signal float64 | qsc_code_frac_lines_long_string_quality_signal float64 | qsc_code_frac_chars_string_length_quality_signal float64 | qsc_code_frac_chars_long_word_length_quality_signal float64 | qsc_code_frac_lines_string_concat_quality_signal float64 | qsc_code_cate_encoded_data_quality_signal float64 | qsc_code_frac_chars_hex_words_quality_signal float64 | qsc_code_frac_lines_prompt_comments_quality_signal float64 | qsc_code_frac_lines_assert_quality_signal float64 | qsc_codepython_cate_ast_quality_signal float64 | qsc_codepython_frac_lines_func_ratio_quality_signal float64 | qsc_codepython_cate_var_zero_quality_signal bool | qsc_codepython_frac_lines_pass_quality_signal float64 | qsc_codepython_frac_lines_import_quality_signal float64 | qsc_codepython_frac_lines_simplefunc_quality_signal float64 | qsc_codepython_score_lines_no_logic_quality_signal float64 | qsc_codepython_frac_lines_print_quality_signal float64 | qsc_code_num_words int64 | qsc_code_num_chars int64 | qsc_code_mean_word_length int64 | qsc_code_frac_words_unique null | qsc_code_frac_chars_top_2grams int64 | qsc_code_frac_chars_top_3grams int64 | qsc_code_frac_chars_top_4grams int64 | qsc_code_frac_chars_dupe_5grams int64 | qsc_code_frac_chars_dupe_6grams int64 | qsc_code_frac_chars_dupe_7grams int64 | qsc_code_frac_chars_dupe_8grams int64 | qsc_code_frac_chars_dupe_9grams int64 | qsc_code_frac_chars_dupe_10grams int64 | qsc_code_frac_chars_replacement_symbols int64 | qsc_code_frac_chars_digital int64 | qsc_code_frac_chars_whitespace int64 | qsc_code_size_file_byte int64 | qsc_code_num_lines int64 | qsc_code_num_chars_line_max int64 | qsc_code_num_chars_line_mean int64 | qsc_code_frac_chars_alphabet int64 | qsc_code_frac_chars_comments int64 | qsc_code_cate_xml_start int64 | qsc_code_frac_lines_dupe_lines int64 | qsc_code_cate_autogen int64 | qsc_code_frac_lines_long_string int64 | qsc_code_frac_chars_string_length int64 | qsc_code_frac_chars_long_word_length int64 | qsc_code_frac_lines_string_concat null | qsc_code_cate_encoded_data int64 | qsc_code_frac_chars_hex_words int64 | qsc_code_frac_lines_prompt_comments int64 | qsc_code_frac_lines_assert int64 | qsc_codepython_cate_ast int64 | qsc_codepython_frac_lines_func_ratio int64 | qsc_codepython_cate_var_zero int64 | qsc_codepython_frac_lines_pass int64 | qsc_codepython_frac_lines_import int64 | qsc_codepython_frac_lines_simplefunc int64 | qsc_codepython_score_lines_no_logic int64 | qsc_codepython_frac_lines_print int64 | effective string | hits int64 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
a543b801539e80d8c8d286dc0606fdd79bc1d263 | 285 | py | Python | tools/__init__.py | chamhoo/cfec2 | 7baab37381cd689f9987f5c0f634f3a35b92252d | [
"MIT"
] | null | null | null | tools/__init__.py | chamhoo/cfec2 | 7baab37381cd689f9987f5c0f634f3a35b92252d | [
"MIT"
] | null | null | null | tools/__init__.py | chamhoo/cfec2 | 7baab37381cd689f9987f5c0f634f3a35b92252d | [
"MIT"
] | null | null | null | from .auto_tunning import Tuning, CVGetScore
from .cv import CV
from .emkeras import linear_regression, fm, deepfm, xdeepfm, dcn, afm, auto_int, fibinet
from .callback import CyclicLR, MaxLrFinder
from .encoder import LE, IdxValEncoder
from .keras_utils import focal_loss, mish, gelu
| 35.625 | 88 | 0.807018 | 41 | 285 | 5.487805 | 0.707317 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.129825 | 285 | 7 | 89 | 40.714286 | 0.907258 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
a550862d004f9af15b7bc84f7c5173b3bfac62e8 | 600 | py | Python | ctx_ticketing/domain/booking/itinerary.py | ddd-tw/ts-strategy-to-tactical-workshop | 5f712712f4cfbe8274f2cf25fecd317303a8e132 | [
"MIT"
] | null | null | null | ctx_ticketing/domain/booking/itinerary.py | ddd-tw/ts-strategy-to-tactical-workshop | 5f712712f4cfbe8274f2cf25fecd317303a8e132 | [
"MIT"
] | null | null | null | ctx_ticketing/domain/booking/itinerary.py | ddd-tw/ts-strategy-to-tactical-workshop | 5f712712f4cfbe8274f2cf25fecd317303a8e132 | [
"MIT"
] | null | null | null | from enum import Enum
from typing import cast, List
from datetime import datetime
from dataclasses import dataclass
from pydomain.basecls.valueobject import ValueObject
from .passenger import Passenger
from .baggage import AdditionalBaggage
from .flightinfo import FlightInfo
class PassengerReservation(ValueObject):
passenger: Passenger
extra_baggage: AdditionalBaggage
@dataclass(frozen=True)
class Itinerary(ValueObject):
departing_at: datetime
arriving_at: datetime
departure: str
destiation: str
flight: FlightInfo
passengers_resv: List[PassengerReservation]
| 25 | 52 | 0.806667 | 65 | 600 | 7.384615 | 0.476923 | 0.041667 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.15 | 600 | 23 | 53 | 26.086957 | 0.941176 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0.210526 | 0.421053 | 0 | 0.947368 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 1 | 0 | 1 | 0 | 0 | 4 |
a581dcb73239704984f3b3281a8e12e5d22f74f6 | 14 | py | Python | tests/simple.py | Skydler/blockpy | dfbddc30bba1f10b53d6bddc87af119ae010254c | [
"Apache-2.0"
] | 184 | 2015-02-14T03:26:32.000Z | 2019-08-11T13:53:23.000Z | tests/simple.py | ki-macht-schule/blockpy | befb98ce24cb67ab0e2f9a90135b429a4a7da2c8 | [
"Apache-2.0"
] | 87 | 2019-08-20T20:39:48.000Z | 2021-09-17T08:26:53.000Z | tests/simple.py | ki-macht-schule/blockpy | befb98ce24cb67ab0e2f9a90135b429a4a7da2c8 | [
"Apache-2.0"
] | 69 | 2016-02-26T00:04:22.000Z | 2019-08-10T00:51:38.000Z | a = 0
print(a) | 7 | 8 | 0.571429 | 4 | 14 | 2 | 0.75 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.090909 | 0.214286 | 14 | 2 | 8 | 7 | 0.636364 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0.5 | 1 | 1 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 4 |
a5a508f70828eb8773f459320e0ef7d830e95709 | 2,114 | py | Python | user.py | LucaPetrucci/test_image | bb21d4714ee6c2a7e866ae2baf6e041e8a0d761c | [
"BSD-4-Clause"
] | null | null | null | user.py | LucaPetrucci/test_image | bb21d4714ee6c2a7e866ae2baf6e041e8a0d761c | [
"BSD-4-Clause"
] | 1 | 2021-06-02T01:28:41.000Z | 2021-06-02T01:28:41.000Z | user.py | LucaPetrucci/test_image | bb21d4714ee6c2a7e866ae2baf6e041e8a0d761c | [
"BSD-4-Clause"
] | null | null | null | import datetime
from bson.json_util import dumps
class User:
def __init__(self, username, password=None, role="user"):
self.username = username
self.password = password
self.role = role
def save_to_db(self, mongo_connection, user_collection):
return mongo_connection[user_collection].insert_one({"userID": self.username, "password": self.password,
"role": self.role, "last_login": "never",
"creationTime": datetime.datetime.now().isoformat()})
def remove_from_db(self, mongo_connection, user_collection):
token_to_remove = dict(mongo_connection[user_collection].find_one({"userID": self.username})).get('token', None)
mongo_connection[user_collection].delete_one({"userID": self.username})
return token_to_remove
def get_role(self, mongo_connection, user_collection):
user = mongo_connection[user_collection].find_one({"userID": self.username}, {'id': 0})
return user['role']
# thi function checks if the current user are allowed to perform the requested operation.
# return true if the user has sufficient permission
def check_user_permission(self, mongo_connection, user_collection, user_id):
user = mongo_connection[user_collection].find_one({"userID": self.username}, {'id': 0})
if user['role'] != 'admin':
if user['userID'] != user_id:
return False
else:
return True
else:
return True
def check_admin_permission(self, mongo_connection, user_collection):
user = mongo_connection[user_collection].find_one({"userID": self.username}, {'id': 0})
return user['role'] == 'admin'
@classmethod
def find_by_username(cls, mongo_connection, user_collection, tenant_id):
user = mongo_connection[user_collection].find_one({"userID": tenant_id}, {'id': 0})
if user is not None:
return user['userID'], user['password']
return None, None
| 44.041667 | 120 | 0.634816 | 245 | 2,114 | 5.240816 | 0.265306 | 0.151869 | 0.192368 | 0.293614 | 0.395639 | 0.395639 | 0.341122 | 0.296729 | 0.296729 | 0.215732 | 0 | 0.002536 | 0.254021 | 2,114 | 47 | 121 | 44.978723 | 0.811668 | 0.064806 | 0 | 0.194444 | 0 | 0 | 0.070922 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.194444 | false | 0.111111 | 0.055556 | 0.027778 | 0.527778 | 0 | 0 | 0 | 0 | null | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 4 |
a5aaab36a3a6e562f05f5cc13432612432b42079 | 8,094 | py | Python | python/flickr-get-stats/src/ilg/flickr/collections/get/html/writer.py | ilg-ul/flickr-get-stats | 80928a66fd9a2fb7d8d8c2dbec2fda54db120019 | [
"MIT"
] | 1 | 2020-12-04T06:40:59.000Z | 2020-12-04T06:40:59.000Z | python/flickr-get-stats/src/ilg/flickr/collections/get/html/writer.py | ilg-ul/flickr-get-stats | 80928a66fd9a2fb7d8d8c2dbec2fda54db120019 | [
"MIT"
] | null | null | null | python/flickr-get-stats/src/ilg/flickr/collections/get/html/writer.py | ilg-ul/flickr-get-stats | 80928a66fd9a2fb7d8d8c2dbec2fda54db120019 | [
"MIT"
] | null | null | null | '''
Created on Sep 3, 2010
@author: ilg
'''
from flickr.collections.get.writerbase import WriterBase
bUseTables = True
class Writer(WriterBase):
'''
classdocs
'''
def __init__(self, sDescription='Main'):
'''
Constructor
'''
super(Writer, self).__init__(sDescription)
def writeBegin(self, s):
if s == None:
s = 'Collections'
self.oOutStream.write(u'<h3>%s</h3>\n' % s)
return
def writeEnd(self):
return
def _computeCollectionRef(self):
if self.sLocalUrl != None:
return '<a href="%s#C%s">' % (self.sLocalUrl, self.sCollectionID)
else:
return '<a href="%scollections/%s/">' % (self.sUserUrl, self.sCollectionID)
def _computeCollectionImg(self):
return '<img src="%s" width="91" height="68" alt="%s" />' % (self.sCollectionSmallIcon, self.sCollectionTitle)
def _computeCollectionStats(self):
s = ('%d album' % self.nSets)
if self.nSets != 1:
s += 's'
s += (', %d photo' % self.nPhotos)
if self.nPhotos != 1:
s += 's'
return s
def writeCollectionBegin(self):
if self.bVerbose:
print '%s%d Collection "%s" "%s" %s %d %d %d' % (self.sIndent, self.nDepth, self.sCollectionTitle, self.sCollectionDescription, self.sCollectionSmallIcon, self.nCollections, self.nSets, self.nPhotos)
if bUseTables:
#self.oOutStream.write('<a name="C%s"> </a>' % (self.sCollectionID))
self.oOutStream.write(u'<table class="f_coll">\n')
self.oOutStream.write(u' <tr class="f_coll_r1">\n')
self.oOutStream.write(u' <td class="f_coll_icon">\n')
self.oOutStream.write(u' <div class="f_coll_icon">%s%s</a></div>\n' % (self._computeCollectionRef(), self._computeCollectionImg()))
self.oOutStream.write(u' </td>\n')
self.oOutStream.write(u' <td class="f_coll_info">\n')
self.oOutStream.write(u' <div class="f_coll_info">\n')
self.oOutStream.write(u' <h4><a name="C%s">%s</a></h4>\n' % (self.sCollectionID, self.sCollectionTitle))
self.oOutStream.write(u' <div class="f_coll_stat">%s</div>\n' % (self._computeCollectionStats()))
self.oOutStream.write(u' <div class="f_coll_desc">%s</div>\n' % (self.sCollectionDescription))
self.oOutStream.write(u' </div>\n')
self.oOutStream.write(u' </td>\n')
self.oOutStream.write(u' </tr>\n')
else:
self.oOutStream.write('<div class="f_coll">\n')
self.oOutStream.write(' <div class="f_coll_r1">\n')
self.oOutStream.write(' <div class="f_coll_icon">\n')
self.oOutStream.write(' <div class="f_coll_icon">%s%s</a></div>\n' % (self._computeCollectionRef(), self._computeCollectionImg()))
self.oOutStream.write(' </div>\n')
self.oOutStream.write(' <div class="f_coll_info">\n')
self.oOutStream.write(' <h4>%s</h4>\n' % (self.sCollectionTitle))
self.oOutStream.write(' <div class="f_coll_stat">%s</div>\n' % (self._computeCollectionStats()))
self.oOutStream.write(' <div class="f_coll_desc">%s</div>\n' % (self.sCollectionDescription))
self.oOutStream.write(' </div>\n')
self.oOutStream.write(' </div>\n')
return
def writeEmbeddedBegin(self):
if bUseTables:
self.oOutStream.write(u' <tr class="f_coll_r2">\n')
self.oOutStream.write(u' <td class="f_coll_space">\n')
self.oOutStream.write(u' </td>\n')
self.oOutStream.write(u' <td class="f_coll_content">\n')
else:
self.oOutStream.write(' <div class="f_coll_r2">\n')
self.oOutStream.write(' <div class="f_coll_space">\n')
self.oOutStream.write(' </div>\n')
self.oOutStream.write(' <div class="f_coll_content">\n')
return
def writeEmbeddedEnd(self):
if bUseTables:
self.oOutStream.write(u' </td>\n')
self.oOutStream.write(u' </tr>\n')
else:
self.oOutStream.write(' </div>\n')
self.oOutStream.write(' </div>\n')
return
def writeCollectionEnd(self):
if bUseTables:
self.oOutStream.write(u'</table>\n')
else:
self.oOutStream.write('</div>\n')
return
def _computePhotosetRef(self, sType):
s = sType
if s == 'thumb':
s = None
sRet = '<a href="%ssets/%s/' % (self.sUserUrl, self.sPhotosetID)
if s != None:
sRet += '%s/' % s
sRet += '">'
return sRet
def _computePhotosetImg(self):
return '<img src="%s" width="75" height="75" alt="%s" />' % (self.sPhotosetIcon, self.sPhotosetTitle)
def _computePhotosetLink(self, sText, sType):
s = '<span class="f_set_link_%s">' % sType
s += '%s%s</a>' % (self._computePhotosetRef(sType), sText)
s += '</span>'
return s
def writePhotosetBegin(self):
if self.bVerbose:
print '%s\tSet "%s" "%s" %s %d' % (self.sIndent, self.sPhotosetTitle, self.sPhotosetDescription, self.sPhotosetIcon, self.nPhotosetPhotos)
if bUseTables:
#self.oOutStream.write('<a name="A%s"> </a>' % (self.sPhotosetID))
self.oOutStream.write(u'<table class="f_set">\n')
self.oOutStream.write(u' <tr>\n')
self.oOutStream.write(u' <td class="f_set_icon">\n')
self.oOutStream.write(u' <div class="f_set_icon">%s%s</a></div>\n' % (self._computePhotosetRef('show'), self._computePhotosetImg()))
self.oOutStream.write(u' </td>\n')
self.oOutStream.write(u' <td class="f_set_info">\n')
self.oOutStream.write(u' <div class="f_set_info">\n')
self.oOutStream.write(u' <h4><a name="A%s">%s</a></h4>\n' % (self.sPhotosetID, self.sPhotosetTitle))
self.oOutStream.write(u' <div class="f_set_stat">%d photos</div>\n' % (self.nPhotosetPhotos))
self.oOutStream.write(u' <div class="f_set_links">')
self.oOutStream.write(u'%s' % (self._computePhotosetLink('Slideshow', 'show')))
self.oOutStream.write(u'%s' % (self._computePhotosetLink('Thumbnails', 'thumb')))
self.oOutStream.write(u'%s' % (self._computePhotosetLink('Details', 'detail')))
self.oOutStream.write(u'%s' % (self._computePhotosetLink('Map', 'map')))
self.oOutStream.write(u'</div></div>\n')
self.oOutStream.write(u' <div class="f_set_desc">%s</div>\n' % (self.sPhotosetDescription))
self.oOutStream.write(u' </td>\n')
self.oOutStream.write(u' </tr>\n')
self.oOutStream.write(u'</table>\n')
else:
self.oOutStream.write('<div class="f_set">\n')
self.oOutStream.write(' <div class="f_set_icon">\n')
self.oOutStream.write(' %s\n' % (self._computePhotosetRef(None)))
self.oOutStream.write(' %s\n' % (self._computePhotosetImg()))
self.oOutStream.write(' </a>\n')
self.oOutStream.write(' </div>\n')
self.oOutStream.write(' <div class="f_set_info">\n')
self.oOutStream.write(' <p>%s (%s photos)</p>\n' % (self.sPhotosetTitle, self.sPhotosetPhotos))
self.oOutStream.write(' <p>%sSlideshow</a> %sThumbnails</a> %sDetails</a> %sMap</a></p>\n' % (self._computePhotosetRef('show'), self._computePhotosetRef(None), self._computePhotosetRef('detail'), self._computePhotosetRef('map')))
self.oOutStream.write(' <p>%s</p>\n' % (self.sPhotosetDescription))
self.oOutStream.write(' </div>\n')
self.oOutStream.write('</div>\n')
return
def writePhotosetEnd(self):
return
| 46.786127 | 244 | 0.561404 | 938 | 8,094 | 4.742004 | 0.13113 | 0.226619 | 0.307554 | 0.179856 | 0.629047 | 0.579137 | 0.534397 | 0.441547 | 0.375225 | 0.269784 | 0 | 0.004529 | 0.263405 | 8,094 | 172 | 245 | 47.05814 | 0.74153 | 0.016308 | 0 | 0.333333 | 0 | 0.007246 | 0.246595 | 0.086951 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.007246 | null | null | 0.014493 | 0 | 0 | 0 | null | 1 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
3c3d4605d3d8dd8fff031595a6c65e7ea4aeb615 | 100 | py | Python | python/8Kyu/noobCode 01 SUPERSIZE ME.py | athasv/Codewars-data | 5e106466e709fd776f23585ad9f652d0d65b48d3 | [
"MIT"
] | null | null | null | python/8Kyu/noobCode 01 SUPERSIZE ME.py | athasv/Codewars-data | 5e106466e709fd776f23585ad9f652d0d65b48d3 | [
"MIT"
] | null | null | null | python/8Kyu/noobCode 01 SUPERSIZE ME.py | athasv/Codewars-data | 5e106466e709fd776f23585ad9f652d0d65b48d3 | [
"MIT"
] | null | null | null | def super_size(n):
temp =[x for x in str(n)]
return int("".join(sorted(temp, reverse=True))) | 33.333333 | 51 | 0.63 | 18 | 100 | 3.444444 | 0.833333 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.18 | 100 | 3 | 51 | 33.333333 | 0.756098 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.333333 | false | 0 | 0 | 0 | 0.666667 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 4 |
3c419f7051ce573c9bc13dfc706520cf2649f4f8 | 142 | py | Python | Services/ExpMath.py | JohnSalas8/api_derivadas | 6c08a92d45b208617eb7953a2a02f6ac0f79a0d9 | [
"MIT"
] | null | null | null | Services/ExpMath.py | JohnSalas8/api_derivadas | 6c08a92d45b208617eb7953a2a02f6ac0f79a0d9 | [
"MIT"
] | null | null | null | Services/ExpMath.py | JohnSalas8/api_derivadas | 6c08a92d45b208617eb7953a2a02f6ac0f79a0d9 | [
"MIT"
] | null | null | null | exp_math = [
['^', '**'],
['e', 'math.e'],
['cos', 'math.cos'],
['sen', 'math.sin'],
['&', '/'],
['tan', 'math.tan']
] | 17.75 | 24 | 0.309859 | 14 | 142 | 3.071429 | 0.5 | 0.232558 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.274648 | 142 | 8 | 25 | 17.75 | 0.417476 | 0 | 0 | 0 | 0 | 0 | 0.314685 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
3c70a74466ac9c9da76e2d4e7b80f3669caf373d | 5,772 | py | Python | FlightBooking/tests/booking_app/test_option_callbacks.py | davewalker5/FlightBooking | 6e5d1bb83789415edb2f9f35404eb0e5bf773111 | [
"MIT"
] | null | null | null | FlightBooking/tests/booking_app/test_option_callbacks.py | davewalker5/FlightBooking | 6e5d1bb83789415edb2f9f35404eb0e5bf773111 | [
"MIT"
] | null | null | null | FlightBooking/tests/booking_app/test_option_callbacks.py | davewalker5/FlightBooking | 6e5d1bb83789415edb2f9f35404eb0e5bf773111 | [
"MIT"
] | null | null | null | import unittest
import os
from unittest.mock import patch
from src.booking_app.option_callbacks import add_passenger_to_flight, \
save_flight, \
load_flight, \
allocate_seat, \
remove_passenger, \
print_boarding_cards
from tests.helpers import get_flight_data_file_path, \
delete_flight_data_file, \
create_test_flight, \
create_test_passenger, \
binary_card_generator, \
remove_files, \
get_flight_boarding_card_file_path
class TestOptionCallbacks(unittest.TestCase):
def setUp(self) -> None:
self._flight = create_test_flight()
self._passenger = create_test_passenger()
@patch("flight_booking.airport.airport_codes",
{"LGW": {"code": "LGW", "name": "London Gatwick", "tz": "Europe/London"},
"RMU": {"code": "RMU", "name": "Murcia International Airport", "tz": "Europe/Madrid"}})
@patch("builtins.input", side_effect=["Some Passenger", "M", "01/02/1970", "England", "UK", "1234567890"])
def test_can_add_passenger(self, _):
add_passenger_to_flight(self._flight)
self.assertEqual(1, len(self._flight.passengers))
@patch("flight_booking.airport.airport_codes",
{"LGW": {"code": "LGW", "name": "London Gatwick", "tz": "Europe/London"},
"RMU": {"code": "RMU", "name": "Murcia International Airport", "tz": "Europe/Madrid"}})
@patch("builtins.input", side_effect=[""])
def test_can_cancel_add_passenger(self, _):
add_passenger_to_flight(self._flight)
self.assertEqual(0, len(self._flight.passengers))
def test_can_save_flight(self):
delete_flight_data_file(self._flight)
save_flight(self._flight)
self.assertTrue(os.path.exists(get_flight_data_file_path(self._flight)))
@patch("flight_booking.airport.airport_codes",
{"LGW": {"code": "LGW", "name": "London Gatwick", "tz": "Europe/London"},
"RMU": {"code": "RMU", "name": "Murcia International Airport", "tz": "Europe/Madrid"}})
@patch("builtins.input", side_effect=["U28549", "20/11/2099"])
def test_can_load_flight(self, _):
delete_flight_data_file(self._flight)
save_flight(self._flight)
flight = load_flight()
self.assertEqual("LGW", flight.embarkation_airport_code)
self.assertEqual("RMU", flight.destination_airport_code)
self.assertEqual("EasyJet", flight.airline)
self.assertEqual("U28549", flight.number)
self.assertEqual("20/11/2099", flight.departs_localtime.strftime("%d/%m/%Y"))
self.assertEqual((2, 35), flight.duration)
@patch("builtins.input", side_effect=[""])
def test_can_cancel_load_flight_at_flight_number(self, _):
flight = load_flight()
self.assertIsNone(flight)
@patch("builtins.input", side_effect=["U28549", ""])
def test_can_cancel_load_flight_at_date(self, _):
flight = load_flight()
self.assertIsNone(flight)
@patch("builtins.input", side_effect=["1", "5D"])
def test_can_allocate_seat(self, _):
self._flight.load_seating("A321", "neo")
self._flight.add_passenger(self._passenger)
allocate_seat(self._flight)
self.assertTrue("5D", self._flight.get_allocated_seat(self._passenger["id"]))
@patch("builtins.input", side_effect=[""])
def test_can_cancel_allocate_seat_at_passenger(self, _):
self._flight.load_seating("A321", "neo")
self._flight.add_passenger(self._passenger)
allocate_seat(self._flight)
self.assertIsNone(self._flight.get_allocated_seat(self._passenger["id"]))
@patch("builtins.input", side_effect=["1", ""])
def test_can_cancel_allocate_seat_at_seat_number(self, _):
self._flight.load_seating("A321", "neo")
self._flight.add_passenger(self._passenger)
allocate_seat(self._flight)
self.assertIsNone(self._flight.get_allocated_seat(self._passenger["id"]))
@patch("builtins.input", side_effect=["1"])
def test_can_remove_passenger(self, _):
self._flight.load_seating("A321", "neo")
self._flight.add_passenger(self._passenger)
remove_passenger(self._flight)
self.assertEqual(0, len(self._flight.passengers))
@patch("builtins.input", side_effect=[""])
def test_can_cancel_remove_passenger(self, _):
self._flight.load_seating("A321", "neo")
self._flight.add_passenger(self._passenger)
remove_passenger(self._flight)
self.assertEqual(1, len(self._flight.passengers))
@patch("src.flight_booking.flight.card_generator_map", {"pdf": binary_card_generator})
@patch("builtins.input", side_effect=["28A"])
def test_can_generate_boarding_cards(self, _):
self._flight.load_seating("A321", "neo")
self._flight.add_passenger(self._passenger)
self._flight.allocate_seat("5D", self._passenger["id"])
remove_files("boarding_cards")
boarding_card_file = get_flight_boarding_card_file_path(self._flight, "5D", "pdf")
self.assertFalse(os.path.exists(boarding_card_file))
print_boarding_cards(self._flight)
self.assertTrue(os.path.exists(boarding_card_file))
remove_files("boarding_cards")
@patch("builtins.input", side_effect=[""])
def test_can_cancel_generate_boarding_cards(self, _):
self._flight.load_seating("A321", "neo")
self._flight.add_passenger(self._passenger)
self._flight.allocate_seat("5D", self._passenger["id"])
remove_files("boarding_cards")
boarding_card_file = get_flight_boarding_card_file_path(self._flight, "5D", "pdf")
self.assertFalse(os.path.exists(boarding_card_file))
print_boarding_cards(self._flight)
self.assertFalse(os.path.exists(boarding_card_file))
| 43.727273 | 110 | 0.684511 | 702 | 5,772 | 5.250712 | 0.153846 | 0.113945 | 0.035269 | 0.071622 | 0.752306 | 0.733315 | 0.71758 | 0.684482 | 0.673901 | 0.616386 | 0 | 0.018422 | 0.172384 | 5,772 | 131 | 111 | 44.061069 | 0.753192 | 0 | 0 | 0.553571 | 0 | 0 | 0.147436 | 0.026334 | 0 | 0 | 0 | 0 | 0.178571 | 1 | 0.125 | false | 0.267857 | 0.044643 | 0 | 0.178571 | 0.026786 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 4 |
3c80894b3846bfdf5f9899de4959bf0dbc736cee | 327 | py | Python | main.py | stopwhispering/comprehensible-sudoku-solver | 2591293255c549e270debb95bc602efb7d0a94c3 | [
"MIT"
] | null | null | null | main.py | stopwhispering/comprehensible-sudoku-solver | 2591293255c549e270debb95bc602efb7d0a94c3 | [
"MIT"
] | null | null | null | main.py | stopwhispering/comprehensible-sudoku-solver | 2591293255c549e270debb95bc602efb7d0a94c3 | [
"MIT"
] | null | null | null | import os.path
from sudoku_solver.shared.constants import SUDOKU_DIR, DEFAULT_SUDOKU
from sudoku_solver.shared.puzzle import read_sudoku_file
from sudoku_solver.init import start_sudoku
if __name__ == '__main__':
sudoku = read_sudoku_file(path=os.path.join(SUDOKU_DIR, DEFAULT_SUDOKU))
start_sudoku(sudoku=sudoku)
| 25.153846 | 76 | 0.813456 | 48 | 327 | 5.104167 | 0.395833 | 0.122449 | 0.195918 | 0.179592 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.11315 | 327 | 12 | 77 | 27.25 | 0.844828 | 0 | 0 | 0 | 0 | 0 | 0.024691 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.571429 | 0 | 0.571429 | 0 | 0 | 0 | 0 | null | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
3c872087d09565ca04ebd5dda886efabb9297a99 | 5,167 | py | Python | test/DynamicArray/test_dynamic_array_realization.py | shapovalovdev/AlgorythmsAndDataStructures | 34d5f38c089e0ba902813607f08847fbdc7361ab | [
"Apache-2.0"
] | null | null | null | test/DynamicArray/test_dynamic_array_realization.py | shapovalovdev/AlgorythmsAndDataStructures | 34d5f38c089e0ba902813607f08847fbdc7361ab | [
"Apache-2.0"
] | null | null | null | test/DynamicArray/test_dynamic_array_realization.py | shapovalovdev/AlgorythmsAndDataStructures | 34d5f38c089e0ba902813607f08847fbdc7361ab | [
"Apache-2.0"
] | null | null | null | from src.DynamicArray.dynamic_array_realization import DynArray
import unittest
class TestDynArray(unittest.TestCase):
def test_insert_into_empty_array(self):
da=DynArray()
with self.assertRaises(IndexError) as context:
da.insert(10,5)
self.assertTrue('Index is out of bounds' in str(context.exception))
#insert buffer is not changed
def test_insert_into_array(self):
da=DynArray()
for i in range(10):
da.append(i)
self.assertEqual(da.count,10, "After insert there is 11 elements")
self.assertEqual(da.capacity,16, "Capacity is default")
da.insert(3,777)
self.assertEqual(da.capacity,16, "Capacity is default after insert")
self.assertEqual(da.count,11, "After insert there is 11 elements")
self.assertEqual(da[3],777,"The 3d element is 777")
def test_insert_into_array_and_resize(self):
da=DynArray()
for i in range(16):
da.append(i)
self.assertEqual(da.count,16, "After insert there is 11 elements")
self.assertEqual(da.capacity,16, "Capacity is default")
self.assertEqual(da[15],15, "The element in 15th cell is 16 ")
da.insert(3,777)
self.assertEqual(da.capacity,32, "Capacity is default after insert")
self.assertEqual(da.count,17, "After insert there is 11 elements")
self.assertEqual(da[3],777,"The element in 3d cell is 777")
self.assertEqual(da[16],15, "The last element is 16 in the cell")
def test_insert_into_array_in_the_end_and_resize(self):
da=DynArray()
for i in range(16):
da.append(i)
self.assertEqual(da.count,16, "After insert there is 11 elements")
self.assertEqual(da.capacity,16, "Capacity is default")
self.assertEqual(da[15],15, "The element in 15th cell is 16 ")
da.insert(16,777)
self.assertEqual(da.capacity,32, "Capacity is default after insert")
self.assertEqual(da.count,17, "After insert there is 11 elements")
self.assertEqual(da[16],777,"The element in 3d cell is 777")
self.assertEqual(da[15],15, "The last element is 15 in the cell")
def test_insert_into_beginning(self):
da=DynArray()
for i in range(5):
da.append(i)
da.insert(0,-1)
self.assertEqual(da.count,6, "After insert there is 6 elements")
self.assertEqual(da.capacity,16, "Capacity is default")
self.assertEqual(da[5],4)
self.assertEqual(da[0],-1,)
def test_insert_out_of_bounds(self):
da=DynArray()
for i in range(5):
da.append(i)
with self.assertRaises(IndexError) as context:
da.insert(10,5)
self.assertTrue('Index is out of bounds' in str(context.exception))
def test_delete_from_empty_list(self):
da=DynArray()
with self.assertRaises(IndexError) as context:
da.delete(3)
self.assertTrue('Index is out of bounds' in str(context.exception))
def test_delete_from_out_of_bound(self):
da=DynArray()
for i in range(5):
da.append(i)
with self.assertRaises(IndexError) as context:
da.delete(6)
self.assertTrue('Index is out of bounds' in str(context.exception))
with self.assertRaises(IndexError) as context:
da.delete(-100)
self.assertTrue('Index is out of bounds' in str(context.exception))
def test_delete_from_the_beginning_with_shrink_minimal(self):
da=DynArray()
for i in range(5):
da.append(i)
self.assertEqual(da.count,5, "There is 5 elements")
self.assertEqual(da.capacity,16, "Capacity is 16 elements")
da.delete(0)
self.assertEqual(da.count,4, "After delete there is 4 elements")
self.assertEqual(da.capacity,16, "Capacity was not shrinked because there min 16 elements")
self.assertEqual(da[0],1)
self.assertEqual(da[3],4)
def test_delete_from_the_middle_with_shrink(self):
da=DynArray()
for i in range(17):
da.append(i)
self.assertEqual(da.count,17, "There is 17 elements")
self.assertEqual(da.capacity,32, "Capacity is 32 elements")
da.delete(5)
self.assertEqual(da.count,16, "After delete there is 16 elements")
self.assertEqual(da.capacity,32, "Capacity was not shrinked because 16 < 16 == False")
self.assertEqual(da[5],6)
self.assertEqual(da[15],16)
with self.assertRaises(IndexError) as context:
da[16]
self.assertTrue('Index is out of bounds' in str(context.exception))
da.delete(10)
self.assertEqual(da.count,15)
self.assertEqual(da.capacity,21, "Capacity was shrinked to 21 because 15 < 16 == True")
self.assertEqual(da[10],12)
self.assertEqual(da[14],16)
self.assertEqual(da[0],0)
with self.assertRaises(IndexError) as context:
da[15]
self.assertTrue('Index is out of bounds' in str(context.exception))
| 38.559701 | 99 | 0.632669 | 719 | 5,167 | 4.475661 | 0.121001 | 0.186451 | 0.211311 | 0.082039 | 0.794282 | 0.721877 | 0.71069 | 0.5867 | 0.541952 | 0.526414 | 0 | 0.053003 | 0.258758 | 5,167 | 133 | 100 | 38.849624 | 0.787206 | 0.005419 | 0 | 0.504673 | 0 | 0 | 0.209031 | 0 | 0 | 0 | 0 | 0 | 0.504673 | 1 | 0.093458 | false | 0 | 0.018692 | 0 | 0.121495 | 0 | 0 | 0 | 0 | null | 0 | 1 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
3c9a0653ce40eeb8f70f04e1aaa6e4e9c0dab67c | 97 | py | Python | payment/settings/local.py | monapayjp/monapay | c896b104b5bea328d119f009710589ffd174386a | [
"BSD-3-Clause"
] | 4 | 2015-02-12T18:54:44.000Z | 2021-04-15T05:21:06.000Z | payment/settings/staging.py | monapayjp/monapay | c896b104b5bea328d119f009710589ffd174386a | [
"BSD-3-Clause"
] | 1 | 2018-02-03T17:35:36.000Z | 2018-02-03T17:35:36.000Z | payment/settings/staging.py | monapayjp/monapay | c896b104b5bea328d119f009710589ffd174386a | [
"BSD-3-Clause"
] | null | null | null | # -*- coding: utf-8 -*-
from payment.settings.base import *
DEBUG = True
TEMPLATE_DEBUG = True
| 13.857143 | 35 | 0.680412 | 13 | 97 | 5 | 0.846154 | 0.276923 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.0125 | 0.175258 | 97 | 6 | 36 | 16.166667 | 0.8 | 0.216495 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.333333 | 0 | 0.333333 | 0 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
b1ba4f88e47337671133aac99d340672e6d25b0e | 103 | py | Python | zoo/globalsearch/apps.py | aexvir/the-zoo | 7816afb9a0a26c6058b030b4a987c73e952d92bd | [
"MIT"
] | 90 | 2018-11-20T10:58:24.000Z | 2022-02-19T16:12:46.000Z | zoo/globalsearch/apps.py | kiwicom/the-zoo | fee0108ea7b65112e5b572a146cff4b1c54033fd | [
"MIT"
] | 348 | 2018-11-21T09:22:31.000Z | 2021-11-03T13:45:08.000Z | zoo/globalsearch/apps.py | aexvir/the-zoo | 7816afb9a0a26c6058b030b4a987c73e952d92bd | [
"MIT"
] | 11 | 2018-12-08T18:42:07.000Z | 2021-02-21T06:27:58.000Z | from django.apps import AppConfig
class GlobalSearchConfig(AppConfig):
name = "zoo.globalsearch"
| 17.166667 | 36 | 0.776699 | 11 | 103 | 7.272727 | 0.909091 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.145631 | 103 | 5 | 37 | 20.6 | 0.909091 | 0 | 0 | 0 | 0 | 0 | 0.15534 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.333333 | 0 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
b1c5b031df9fd022089e77374a91b0e428e7ad3e | 51 | py | Python | tests/test_app2/sql_config.py | JiriKr/django-migrate-sql | b848acb14679ce8bf472d91e52c85afcce2c5db2 | [
"ISC"
] | 13 | 2016-01-05T12:21:11.000Z | 2021-08-30T05:41:39.000Z | tests/test_app2/sql_config.py | JiriKr/django-migrate-sql | b848acb14679ce8bf472d91e52c85afcce2c5db2 | [
"ISC"
] | 10 | 2015-12-27T14:40:31.000Z | 2020-04-01T11:40:36.000Z | tests/test_app2/sql_config.py | JiriKr/django-migrate-sql | b848acb14679ce8bf472d91e52c85afcce2c5db2 | [
"ISC"
] | 3 | 2017-10-29T11:26:27.000Z | 2019-01-03T17:16:54.000Z | sql_items = [
# TODO: Insert SQL items here.
]
| 12.75 | 34 | 0.607843 | 7 | 51 | 4.285714 | 0.714286 | 0.533333 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.27451 | 51 | 3 | 35 | 17 | 0.810811 | 0.54902 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.333333 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
b1c9f79e4e11e02f21f3c8bb5b8df1f03294c734 | 368 | py | Python | player.py | riconaef/Guess-Game | 21fe9f5ed698898ba0c53089858b46f71e4a4926 | [
"CNRI-Python"
] | null | null | null | player.py | riconaef/Guess-Game | 21fe9f5ed698898ba0c53089858b46f71e4a4926 | [
"CNRI-Python"
] | null | null | null | player.py | riconaef/Guess-Game | 21fe9f5ed698898ba0c53089858b46f71e4a4926 | [
"CNRI-Python"
] | null | null | null | # -*- coding: utf-8 -*-
"""
Created on Wed Jan 6 19:46:21 2021
@author: ricon
"""
class Player:
def __init__(self, guess_num=0):
self.guess_num = guess_num
print('Make a first guess.')
#input function of the player
def new_guess(self):
self.guess_num = int(input())
def get(self):
return self.guess_num | 20.444444 | 37 | 0.584239 | 53 | 368 | 3.867925 | 0.641509 | 0.195122 | 0.234146 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.049808 | 0.290761 | 368 | 18 | 38 | 20.444444 | 0.735632 | 0.277174 | 0 | 0 | 0 | 0 | 0.073643 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.375 | false | 0 | 0 | 0.125 | 0.625 | 0.125 | 0 | 0 | 0 | null | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 4 |
b1d5bb56e42bf1e3b1a47724909c9933e2e343bc | 2,379 | py | Python | synergine/core/simulation/MetaStates.py | buxx/synergine | da05d762cdbc993362807d4851e1ca74784438ae | [
"Apache-2.0"
] | 6 | 2015-04-03T08:04:22.000Z | 2016-11-13T22:47:11.000Z | synergine/core/simulation/MetaStates.py | buxx/synergine | da05d762cdbc993362807d4851e1ca74784438ae | [
"Apache-2.0"
] | 2 | 2019-10-21T15:41:39.000Z | 2021-06-10T14:15:27.000Z | synergine/core/simulation/MetaStates.py | buxx/synergine | da05d762cdbc993362807d4851e1ca74784438ae | [
"Apache-2.0"
] | 2 | 2015-02-27T12:05:51.000Z | 2016-05-11T07:25:20.000Z | from synergine.synergy.Simulation import Simulation
class MetaStates():
def __init__(self, list):
self._list = list
# TODO: have_list etc
def have_list(self, object_id, states):
for state in states:
if not self._list.have(Simulation.STATE, object_id, state, allow_empty=True):
return False
return True
def have(self, object_id, state):
return self.have_list(object_id, [state])
def dont_have_list(self, object_id, states):
for state in states:
if self._list.have(Simulation.STATE, object_id, state, allow_empty=True):
return False
return True
def dont_have(self, object_id, state):
return self.dont_have_list(object_id, [state])
def have_one(self, object_id, states):
for state in states:
if self._list.have(Simulation.STATE, object_id, state, allow_empty=True):
return True
return False
def dont_have_one(self, object_id, states):
for state in states:
if not self._list.have(Simulation.STATE, object_id, state, allow_empty=True):
return True
return False
def add(self, object_id, state):
self._list.add(Simulation.STATE, object_id, state)
def add_list(self, object_id, states):
for state in states:
self.add(object_id, state)
def remove(self, object_id, state, allow_empty=False, allow_not_in=False):
self._list.remove(Simulation.STATE, object_id, state, allow_empty=allow_empty, allow_not_in=allow_not_in)
def remove_list(self, object_id, states, allow_empty=False, allow_not_in=False):
for state in states:
self.remove(object_id, state, allow_empty=allow_empty, allow_not_in=allow_not_in)
def add_remove(self, object_id, state_add, state_remove, allow_empty=False, allow_not_in=False):
self.add(object_id, state_add)
self.remove(object_id, state_remove, allow_empty=allow_empty, allow_not_in=allow_not_in)
def add_remove_lists(self, objec_id, states_add, states_remove, allow_empty=False, allow_not_in=False):
for state_add in states_add:
self.add(objec_id, state_add)
for state_remove in states_remove:
self.remove(objec_id, state_remove, allow_empty=allow_empty, allow_not_in=allow_not_in)
| 37.761905 | 113 | 0.678436 | 344 | 2,379 | 4.386628 | 0.09593 | 0.121935 | 0.146455 | 0.083499 | 0.801856 | 0.695825 | 0.664016 | 0.612989 | 0.559973 | 0.484427 | 0 | 0 | 0.235393 | 2,379 | 62 | 114 | 38.370968 | 0.829577 | 0.007987 | 0 | 0.391304 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.016129 | 0 | 1 | 0.282609 | false | 0 | 0.021739 | 0.043478 | 0.543478 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 4 |
b1e2656c61c71ba48effb93b22a78bedb84d2db5 | 249 | py | Python | dame_dd/__init__.py | ManuelBuenAbad/dame_dd | 5cd6b9d39499630bf4ce498613d1bd03727fb617 | [
"MIT"
] | 1 | 2021-02-16T17:07:55.000Z | 2021-02-16T17:07:55.000Z | dame_dd/__init__.py | jtbuch/dame_dd | 5cd6b9d39499630bf4ce498613d1bd03727fb617 | [
"MIT"
] | null | null | null | dame_dd/__init__.py | jtbuch/dame_dd | 5cd6b9d39499630bf4ce498613d1bd03727fb617 | [
"MIT"
] | 2 | 2020-11-13T15:29:33.000Z | 2020-11-13T19:48:47.000Z | import astrophysics.astrophysics as ap
import semiconductors.semiconductors as sc
import rates.rates as rt
# these would need to be called, for example, de.ap.astrophysics
#import astrophysics as ap
#import semiconductors as sc
#import rates as rt
| 27.666667 | 64 | 0.815261 | 38 | 249 | 5.342105 | 0.447368 | 0.17734 | 0.157635 | 0.216749 | 0.571429 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.140562 | 249 | 8 | 65 | 31.125 | 0.948598 | 0.53012 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
5943f43cce710ed8476ca6d34397139a4f69a716 | 326 | py | Python | nitorch/nn/__init__.py | liamchalcroft/nitorch | 0de179aff97244a82213c528f0d6393725c868c9 | [
"MIT"
] | null | null | null | nitorch/nn/__init__.py | liamchalcroft/nitorch | 0de179aff97244a82213c528f0d6393725c868c9 | [
"MIT"
] | null | null | null | nitorch/nn/__init__.py | liamchalcroft/nitorch | 0de179aff97244a82213c528f0d6393725c868c9 | [
"MIT"
] | null | null | null | """Modules (Networks or Layers)."""
from .activations import *
from .metrics import *
from .modules import *
from .losses import *
from .generators import *
from .training import *
from . import activations
from . import modules
from . import losses
from . import training
from . import generators
from . import experimental
| 21.733333 | 35 | 0.754601 | 40 | 326 | 6.15 | 0.3 | 0.243902 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.162577 | 326 | 14 | 36 | 23.285714 | 0.901099 | 0.088957 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
3ca487db1d7e296ab01bd85a32d834239af94450 | 1,100 | py | Python | stdZone/models.py | jaiswalshubhamm/estudycorner | 1d8162175580d8b13085b287d4c8ffd5eab876cf | [
"MIT"
] | null | null | null | stdZone/models.py | jaiswalshubhamm/estudycorner | 1d8162175580d8b13085b287d4c8ffd5eab876cf | [
"MIT"
] | 1 | 2022-02-10T13:26:46.000Z | 2022-02-10T13:26:46.000Z | stdZone/models.py | jaiswalshubhamm/estudycorner | 1d8162175580d8b13085b287d4c8ffd5eab876cf | [
"MIT"
] | null | null | null | from django.db import models
# Create your models here.
class Feedback(models.Model):
name=models.CharField(max_length=50)
email=models.CharField(max_length=50)
mobno=models.CharField(max_length=50)
topic=models.CharField(max_length=50)
feedback=models.TextField()
class Meta:
db_table = 'feedback'
class Question(models.Model):
email=models.CharField(max_length=50)
question=models.TextField()
imgname=models.TextField()
dt=models.CharField(max_length=50)
class Meta:
db_table = 'question'
class Answer(models.Model):
qid=models.CharField(max_length=5)
email=models.CharField(max_length=50)
answer=models.TextField()
imgname=models.TextField()
dt=models.CharField(max_length=50)
class Meta:
db_table = 'answer'
class Assignment(models.Model):
name=models.CharField(max_length=50)
email=models.CharField(max_length=50)
title=models.TextField()
doc=models.TextField()
description=models.TextField()
dt=models.CharField(max_length=50)
class Meta:
db_table = 'assignment' | 28.947368 | 41 | 0.713636 | 141 | 1,100 | 5.453901 | 0.22695 | 0.23407 | 0.280884 | 0.374512 | 0.622887 | 0.555267 | 0.474642 | 0.474642 | 0.474642 | 0.474642 | 0 | 0.025219 | 0.170909 | 1,100 | 38 | 42 | 28.947368 | 0.817982 | 0.021818 | 0 | 0.454545 | 0 | 0 | 0.029767 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.030303 | 0 | 0.878788 | 0 | 0 | 0 | 0 | null | 1 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 4 |
3cc208b7dcab56dfa29813669be578b5bc516688 | 438 | py | Python | Final/Belly_Button_Biodiversity/models.py | kgouldthorpe/plotly-challenge | 963418f36dce2e9eadbe58ebbe758f1105acc510 | [
"ADSL"
] | null | null | null | Final/Belly_Button_Biodiversity/models.py | kgouldthorpe/plotly-challenge | 963418f36dce2e9eadbe58ebbe758f1105acc510 | [
"ADSL"
] | null | null | null | Final/Belly_Button_Biodiversity/models.py | kgouldthorpe/plotly-challenge | 963418f36dce2e9eadbe58ebbe758f1105acc510 | [
"ADSL"
] | null | null | null | from .app import db
class BellyButton(db.Model):
__tablename__ = 'belly_button'
sample = db.Column(db.Integer, primary_key=True)
ETHNICITY = db.Column(db.String(100))
GENDER = db.Column(db.String(5))
AGE = db.Column(db.Integer)
LOCATION = db.Column(db.String(100))
BBTYPE = db.Column(db.String(50))
WFREQ = db.Column(db.Integer)
def __repr__(self):
return '<Belly Button %r>' % (self.name)
| 25.764706 | 52 | 0.652968 | 62 | 438 | 4.451613 | 0.516129 | 0.202899 | 0.253623 | 0.231884 | 0.137681 | 0 | 0 | 0 | 0 | 0 | 0 | 0.025641 | 0.19863 | 438 | 16 | 53 | 27.375 | 0.760684 | 0 | 0 | 0 | 0 | 0 | 0.06621 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.083333 | false | 0 | 0.083333 | 0.083333 | 1 | 0 | 0 | 0 | 0 | null | 1 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 4 |
3cc2604024a6f7941feb1b08c32365f0bb84b47c | 2,335 | py | Python | src/petl/fluent.py | obsoleter/petl | e3e8ff5423482f7c61974e66acea631027762ea3 | [
"MIT"
] | 1 | 2016-05-27T03:06:27.000Z | 2016-05-27T03:06:27.000Z | src/petl/fluent.py | obsoleter/petl | e3e8ff5423482f7c61974e66acea631027762ea3 | [
"MIT"
] | null | null | null | src/petl/fluent.py | obsoleter/petl | e3e8ff5423482f7c61974e66acea631027762ea3 | [
"MIT"
] | null | null | null | """
As the root :mod:`petl` module but with modifications to allow for fluent style
usage.
.. versionadded:: 0.6
"""
import sys
from .util import valueset, RowContainer
import collections
petl = sys.modules['petl']
thismodule = sys.modules[__name__]
class FluentWrapper(object):
def __init__(self, inner):
object.__setattr__(self, '_inner', inner)
def __iter__(self):
return iter(self._inner)
def __getattr__(self, attr):
# pass through
return getattr(self._inner, attr)
def __setattr__(self, attr, value):
# pass through
setattr(self._inner, attr, value)
def __getitem__(self, item):
# pass through
return self._inner[item]
def __setitem__(self, item, value):
# pass through
self._inner[item] = value
def __str__(self):
return str(self._inner)
def __repr__(self):
return repr(self._inner)
# define a wrapper function
def wrap(f):
def wrapper(*args, **kwargs):
_innerresult = f(*args, **kwargs)
if isinstance(_innerresult, RowContainer):
return FluentWrapper(_innerresult)
else:
return _innerresult
wrapper.__name__ = f.__name__
wrapper.__doc__ = f.__doc__
return wrapper
# import and wrap all functions from root petl module
for n, c in list(petl.__dict__.items()):
if isinstance(c, collections.Callable):
setattr(thismodule, n, wrap(c))
else:
setattr(thismodule, n, c)
# add module functions as methods on the wrapper class
# TODO add only those methods that expect to have row container as first argument
for n, c in list(thismodule.__dict__.items()):
if isinstance(c, collections.Callable):
setattr(FluentWrapper, n, c)
# need to manually override for facet(), because it returns a dict
def facet(table, field):
fct = dict()
for v in valueset(table, field):
fct[v] = getattr(thismodule, 'selecteq')(table, field, v)
return fct
# need to manually override for diff(), because it returns a tuple
def diff(*args, **kwargs):
a, b = petl.diff(*args, **kwargs)
return FluentWrapper(a), FluentWrapper(b)
| 24.578947 | 82 | 0.616702 | 278 | 2,335 | 4.906475 | 0.356115 | 0.059384 | 0.02346 | 0.010264 | 0.123167 | 0.070381 | 0.070381 | 0.070381 | 0 | 0 | 0 | 0.001201 | 0.286938 | 2,335 | 94 | 83 | 24.840426 | 0.818018 | 0.215846 | 0 | 0.083333 | 0 | 0 | 0.010496 | 0 | 0 | 0 | 0 | 0.010638 | 0 | 1 | 0.25 | false | 0 | 0.0625 | 0.104167 | 0.541667 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 4 |
3ccc2782e7ec9377e3e271df278eb2464fd9ed4b | 70 | py | Python | Python/__init__.py | hancheyn/MicroDev | 5d976fcad85f1b45a3e77070c7a766836f32f425 | [
"CC0-1.0"
] | null | null | null | Python/__init__.py | hancheyn/MicroDev | 5d976fcad85f1b45a3e77070c7a766836f32f425 | [
"CC0-1.0"
] | null | null | null | Python/__init__.py | hancheyn/MicroDev | 5d976fcad85f1b45a3e77070c7a766836f32f425 | [
"CC0-1.0"
] | null | null | null | # This is a test comment (Connor Inglat) test testing #2
#Nates Test | 17.5 | 56 | 0.728571 | 12 | 70 | 4.25 | 0.833333 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.017857 | 0.2 | 70 | 4 | 57 | 17.5 | 0.892857 | 0.9 | 0 | null | 0 | null | 0 | 0 | null | 0 | 0 | 0 | null | 1 | null | true | 0 | 0 | null | null | null | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
3ccfb1f797a5020a38a25bb1f8f5442a55a1460c | 75 | py | Python | Blockchain-master/src/main/java/agent/untitled.py | JerryPan2718/How-to-build-a-private-chain-on-your-Macbook--Blockchain-Technology | 5957c5053cb121129717e06ee04a1063fb308760 | [
"MIT"
] | 3 | 2019-07-17T21:02:27.000Z | 2020-02-18T13:45:31.000Z | Blockchain-master/src/main/java/agent/untitled.py | JerryPan2718/How-to-build-a-private-chain-on-your-Macbook--Blockchain-Technology | 5957c5053cb121129717e06ee04a1063fb308760 | [
"MIT"
] | null | null | null | Blockchain-master/src/main/java/agent/untitled.py | JerryPan2718/How-to-build-a-private-chain-on-your-Macbook--Blockchain-Technology | 5957c5053cb121129717e06ee04a1063fb308760 | [
"MIT"
] | null | null | null | Jerry Pan.py
i = 0
String = "Jerry Pan"
for n in range(1,100):
n =+ 1;
n
| 9.375 | 22 | 0.586667 | 17 | 75 | 2.588235 | 0.705882 | 0.363636 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.107143 | 0.253333 | 75 | 7 | 23 | 10.714286 | 0.678571 | 0 | 0 | 0 | 0 | 0 | 0.12 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0 | null | null | 0 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
3cfc197cbb50c1403526b9d449d825d669ac7627 | 140 | py | Python | test/gwill_test.py | Zev3691/godwill | bc4b29ede3fe2424dc844f87d3f93248c0777210 | [
"Apache-2.0"
] | 64 | 2019-06-09T02:41:52.000Z | 2022-03-06T19:18:05.000Z | test/gwill_test.py | Zev3691/godwill | bc4b29ede3fe2424dc844f87d3f93248c0777210 | [
"Apache-2.0"
] | 5 | 2019-06-13T13:07:33.000Z | 2020-12-01T03:14:43.000Z | test/gwill_test.py | Zev3691/godwill | bc4b29ede3fe2424dc844f87d3f93248c0777210 | [
"Apache-2.0"
] | 18 | 2019-02-18T16:32:16.000Z | 2022-01-21T13:49:05.000Z | # -*- coding: utf-8 -*-
class TestGwill():
def test_godwill(self):
from gwill.changes.BChanges import godwill
godwill() | 23.333333 | 50 | 0.621429 | 16 | 140 | 5.375 | 0.875 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.009434 | 0.242857 | 140 | 6 | 51 | 23.333333 | 0.801887 | 0.15 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.25 | false | 0 | 0.25 | 0 | 0.75 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 4 |
a715e8a75c35734640147d023a9db7f14bbabfe3 | 914 | py | Python | CodingInterview2/53_04_MissingNumberOnce/test_find_once_number.py | hscspring/TheAlgorithms-Python | 5c2faea1d2d25a9a81a4786e053b0cc58ab46c6f | [
"MIT"
] | 10 | 2020-07-06T11:00:58.000Z | 2022-01-29T09:25:24.000Z | CodingInterview2/53_04_MissingNumberOnce/test_find_once_number.py | hscspring/TheAlgorithms-Python | 5c2faea1d2d25a9a81a4786e053b0cc58ab46c6f | [
"MIT"
] | null | null | null | CodingInterview2/53_04_MissingNumberOnce/test_find_once_number.py | hscspring/TheAlgorithms-Python | 5c2faea1d2d25a9a81a4786e053b0cc58ab46c6f | [
"MIT"
] | 3 | 2020-07-13T06:39:23.000Z | 2020-08-15T16:29:48.000Z | from find_once_number import find
def test1():
lst = [1,1,2,2,3,4,4,5,5,6,6]
assert (find(lst)) == 3
def test2():
lst = [1,1,2,2,3,4,4,5,5]
assert (find(lst)) == 3
def test3():
lst = [1,1,2,3,3]
assert (find(lst)) == 2
def test4():
lst = [1,2,2,3,3,4,4,5,5,6,6]
assert (find(lst)) == 1
def test5():
lst = [1,1,2,2,3]
assert (find(lst)) == 3
def test6():
lst = [1,2,2,3,3]
assert(find(lst)) == 1
def test7():
lst = [2,2,3,4,4]
assert(find(lst)) == 3
def test8():
lst = [0,0,1,2,2]
assert(find(lst)) == 1
def test9():
lst = [4,4,5,5,6,7,7,8,8]
assert (find(lst)) == 6
def test10():
lst = [2,2]
assert(find(lst)) == -1
def test11():
lst = [2,3]
assert(find(lst)) == 2
def test12():
lst = [-1,-1,2,3,3]
assert (find(lst)) == 2
def test13():
lst = [1,1,2,2,3,3,4,4,5,6,6]
assert (find(lst)) == 5
| 15.233333 | 33 | 0.485777 | 182 | 914 | 2.428571 | 0.164835 | 0.294118 | 0.382353 | 0.081448 | 0.683258 | 0.515837 | 0.359729 | 0.273756 | 0.246606 | 0.246606 | 0 | 0.17037 | 0.261488 | 914 | 59 | 34 | 15.491525 | 0.484444 | 0 | 0 | 0.25 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.325 | 1 | 0.325 | false | 0 | 0.025 | 0 | 0.35 | 0 | 0 | 0 | 0 | null | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
a72ec04912847ca1a75d92b0960561a88d611b35 | 228 | py | Python | DQM/SiTrackerPhase2/python/Phase2ITMonitorRecHit_cff.py | ckamtsikis/cmssw | ea19fe642bb7537cbf58451dcf73aa5fd1b66250 | [
"Apache-2.0"
] | 852 | 2015-01-11T21:03:51.000Z | 2022-03-25T21:14:00.000Z | DQM/SiTrackerPhase2/python/Phase2ITMonitorRecHit_cff.py | ckamtsikis/cmssw | ea19fe642bb7537cbf58451dcf73aa5fd1b66250 | [
"Apache-2.0"
] | 30,371 | 2015-01-02T00:14:40.000Z | 2022-03-31T23:26:05.000Z | DQM/SiTrackerPhase2/python/Phase2ITMonitorRecHit_cff.py | ckamtsikis/cmssw | ea19fe642bb7537cbf58451dcf73aa5fd1b66250 | [
"Apache-2.0"
] | 3,240 | 2015-01-02T05:53:18.000Z | 2022-03-31T17:24:21.000Z | import FWCore.ParameterSet.Config as cms
from DQMServices.Core.DQMEDAnalyzer import DQMEDAnalyzer
from DQM.SiTrackerPhase2.Phase2ITMonitorRecHit_cfi import Phase2ITMonitorRecHit
rechitMonitorIT = Phase2ITMonitorRecHit.clone()
| 38 | 80 | 0.881579 | 22 | 228 | 9.090909 | 0.727273 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.018957 | 0.074561 | 228 | 5 | 81 | 45.6 | 0.92891 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.75 | 0 | 0.75 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
59577b1aec31d8bbf32465800b68d346b38e66b7 | 81 | py | Python | backend/generated/config.py | malvela/offshoreSingleBladeInstallation | 4ee10c42e4cc240a829ada1745a5ccb00a8022f3 | [
"MIT"
] | 2 | 2021-01-21T15:39:49.000Z | 2021-02-10T11:50:08.000Z | backend/generated/config.py | malvela/offshoreSingleBladeInstallation | 4ee10c42e4cc240a829ada1745a5ccb00a8022f3 | [
"MIT"
] | 56 | 2021-01-21T16:46:12.000Z | 2021-09-04T14:09:45.000Z | backend/generated/config.py | malvela/offshoreSingleBladeInstallation | 4ee10c42e4cc240a829ada1745a5ccb00a8022f3 | [
"MIT"
] | 3 | 2021-03-29T16:41:19.000Z | 2021-08-01T14:32:07.000Z | def run_config (config):
print("Config_File" + config)
config = 830
| 16.2 | 33 | 0.617284 | 10 | 81 | 4.8 | 0.6 | 0.5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.050847 | 0.271605 | 81 | 4 | 34 | 20.25 | 0.762712 | 0 | 0 | 0 | 0 | 0 | 0.135802 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.333333 | false | 0 | 0 | 0 | 0.333333 | 0.333333 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
595a1ed10714cdadbf43da1f0e14b7a6bdcc2de1 | 110 | py | Python | streetteam/apps/twilio_integration/apps.py | alysivji/street-team | fe891d738b449956d56fe5e53535b98fa04d9a3a | [
"MIT"
] | 2 | 2020-01-22T17:49:10.000Z | 2021-06-18T19:35:23.000Z | streetteam/apps/twilio_integration/apps.py | alysivji/street-team | fe891d738b449956d56fe5e53535b98fa04d9a3a | [
"MIT"
] | 41 | 2019-11-08T18:28:16.000Z | 2022-03-12T00:28:51.000Z | streetteam/apps/twilio_integration/apps.py | alysivji/street-team | fe891d738b449956d56fe5e53535b98fa04d9a3a | [
"MIT"
] | null | null | null | from django.apps import AppConfig
class TwilioIntegrationConfig(AppConfig):
name = "twilio_integration"
| 18.333333 | 41 | 0.8 | 11 | 110 | 7.909091 | 0.909091 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.136364 | 110 | 5 | 42 | 22 | 0.915789 | 0 | 0 | 0 | 0 | 0 | 0.163636 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.333333 | 0 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
596c5a81368adeb60becd7c6d081502efdeb2fe9 | 271,764 | py | Python | keepercommander/APIRequest_pb2.py | zachgarwood/Commander | 108d26766eb33e654e0b1b9caa27fc2b170c0b37 | [
"MIT"
] | 1 | 2021-02-21T22:24:52.000Z | 2021-02-21T22:24:52.000Z | keepercommander/APIRequest_pb2.py | zachgarwood/Commander | 108d26766eb33e654e0b1b9caa27fc2b170c0b37 | [
"MIT"
] | null | null | null | keepercommander/APIRequest_pb2.py | zachgarwood/Commander | 108d26766eb33e654e0b1b9caa27fc2b170c0b37 | [
"MIT"
] | null | null | null | # -*- coding: utf-8 -*-
# Generated by the protocol buffer compiler. DO NOT EDIT!
# source: APIRequest.proto
"""Generated protocol buffer code."""
from google.protobuf.internal import enum_type_wrapper
from google.protobuf import descriptor as _descriptor
from google.protobuf import message as _message
from google.protobuf import reflection as _reflection
from google.protobuf import symbol_database as _symbol_database
# @@protoc_insertion_point(imports)
from .commands import enterprise_pb2 as enterprise__pb2
_sym_db = _symbol_database.Default()
DESCRIPTOR = _descriptor.FileDescriptor(
name='APIRequest.proto',
package='Authentication',
syntax='proto3',
serialized_options=b'\n\030com.keepersecurity.protoB\016Authentication',
create_key=_descriptor._internal_create_key,
serialized_pb=b'\n\x10\x41PIRequest.proto\x12\x0e\x41uthentication\x1a\x10\x65nterprise.proto\"\xb0\x01\n\nApiRequest\x12 \n\x18\x65ncryptedTransmissionKey\x18\x01 \x01(\x0c\x12\x13\n\x0bpublicKeyId\x18\x02 \x01(\x05\x12\x0e\n\x06locale\x18\x03 \x01(\t\x12\x18\n\x10\x65ncryptedPayload\x18\x04 \x01(\x0c\x12\x16\n\x0e\x65ncryptionType\x18\x05 \x01(\x05\x12\x11\n\trecaptcha\x18\x06 \x01(\t\x12\x16\n\x0esubEnvironment\x18\x07 \x01(\t\"j\n\x11\x41piRequestPayload\x12\x0f\n\x07payload\x18\x01 \x01(\x0c\x12\x1d\n\x15\x65ncryptedSessionToken\x18\x02 \x01(\x0c\x12\x11\n\ttimeToken\x18\x03 \x01(\x0c\x12\x12\n\napiVersion\x18\x04 \x01(\x05\"6\n\tTransform\x12\x0b\n\x03key\x18\x01 \x01(\x0c\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x02 \x01(\x0c\":\n\rDeviceRequest\x12\x15\n\rclientVersion\x18\x01 \x01(\t\x12\x12\n\ndeviceName\x18\x02 \x01(\t\"T\n\x0b\x41uthRequest\x12\x15\n\rclientVersion\x18\x01 \x01(\t\x12\x10\n\x08username\x18\x02 \x01(\t\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x03 \x01(\x0c\"\x8b\x01\n\x14NewUserMinimumParams\x12\x19\n\x11minimumIterations\x18\x01 \x01(\x05\x12\x1a\n\x12passwordMatchRegex\x18\x02 \x03(\t\x12 \n\x18passwordMatchDescription\x18\x03 \x03(\t\x12\x1a\n\x12isEnterpriseDomain\x18\x04 \x01(\x08\"\x89\x01\n\x0fPreLoginRequest\x12\x30\n\x0b\x61uthRequest\x18\x01 \x01(\x0b\x32\x1b.Authentication.AuthRequest\x12,\n\tloginType\x18\x02 \x01(\x0e\x32\x19.Authentication.LoginType\x12\x16\n\x0etwoFactorToken\x18\x03 \x01(\x0c\"\x80\x02\n\x0cLoginRequest\x12\x30\n\x0b\x61uthRequest\x18\x01 \x01(\x0b\x32\x1b.Authentication.AuthRequest\x12,\n\tloginType\x18\x02 \x01(\x0e\x32\x19.Authentication.LoginType\x12\x1f\n\x17\x61uthenticationHashPrime\x18\x03 \x01(\x0c\x12\x1b\n\x13\x65ncryptedLoginToken\x18\x04 \x01(\x0c\x12\x14\n\x0c\x61uthResponse\x18\x05 \x01(\x0c\x12\x16\n\x0emcEnterpriseId\x18\x06 \x01(\x05\x12\x12\n\npush_token\x18\x07 \x01(\t\x12\x10\n\x08platform\x18\x08 \x01(\t\"\\\n\x0e\x44\x65viceResponse\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x01 \x01(\x0c\x12,\n\x06status\x18\x02 \x01(\x0e\x32\x1c.Authentication.DeviceStatus\"V\n\x04Salt\x12\x12\n\niterations\x18\x01 \x01(\x05\x12\x0c\n\x04salt\x18\x02 \x01(\x0c\x12\x11\n\talgorithm\x18\x03 \x01(\x05\x12\x0b\n\x03uid\x18\x04 \x01(\x0c\x12\x0c\n\x04name\x18\x05 \x01(\t\" \n\x10TwoFactorChannel\x12\x0c\n\x04type\x18\x01 \x01(\x05\"\xce\x02\n\x11StartLoginRequest\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x01 \x01(\x0c\x12\x10\n\x08username\x18\x02 \x01(\t\x12\x15\n\rclientVersion\x18\x03 \x01(\t\x12\x19\n\x11messageSessionUid\x18\x04 \x01(\x0c\x12\x1b\n\x13\x65ncryptedLoginToken\x18\x05 \x01(\x0c\x12,\n\tloginType\x18\x06 \x01(\x0e\x32\x19.Authentication.LoginType\x12\x16\n\x0emcEnterpriseId\x18\x07 \x01(\x05\x12\x30\n\x0bloginMethod\x18\x08 \x01(\x0e\x32\x1b.Authentication.LoginMethod\x12\x15\n\rforceNewLogin\x18\t \x01(\x08\x12\x11\n\tcloneCode\x18\n \x01(\x0c\x12\x18\n\x10v2TwoFactorToken\x18\x0b \x01(\t\"\x85\x04\n\rLoginResponse\x12.\n\nloginState\x18\x01 \x01(\x0e\x32\x1a.Authentication.LoginState\x12\x12\n\naccountUid\x18\x02 \x01(\x0c\x12\x17\n\x0fprimaryUsername\x18\x03 \x01(\t\x12\x18\n\x10\x65ncryptedDataKey\x18\x04 \x01(\x0c\x12\x42\n\x14\x65ncryptedDataKeyType\x18\x05 \x01(\x0e\x32$.Authentication.EncryptedDataKeyType\x12\x1b\n\x13\x65ncryptedLoginToken\x18\x06 \x01(\x0c\x12\x1d\n\x15\x65ncryptedSessionToken\x18\x07 \x01(\x0c\x12:\n\x10sessionTokenType\x18\x08 \x01(\x0e\x32 .Authentication.SessionTokenType\x12\x0f\n\x07message\x18\t \x01(\t\x12\x0b\n\x03url\x18\n \x01(\t\x12\x36\n\x08\x63hannels\x18\x0b \x03(\x0b\x32$.Authentication.TwoFactorChannelInfo\x12\"\n\x04salt\x18\x0c \x03(\x0b\x32\x14.Authentication.Salt\x12\x11\n\tcloneCode\x18\r \x01(\x0c\x12\x1a\n\x12stateSpecificValue\x18\x0e \x01(\t\x12\x18\n\x10ssoClientVersion\x18\x0f \x01(\t\"\x8c\x01\n\x0bSsoUserInfo\x12\x13\n\x0b\x63ompanyName\x18\x01 \x01(\t\x12\x13\n\x0bsamlRequest\x18\x02 \x01(\t\x12\x17\n\x0fsamlRequestType\x18\x03 \x01(\t\x12\x15\n\rssoDomainName\x18\x04 \x01(\t\x12\x10\n\x08loginUrl\x18\x05 \x01(\t\x12\x11\n\tlogoutUrl\x18\x06 \x01(\t\"\xd6\x01\n\x10PreLoginResponse\x12\x32\n\x0c\x64\x65viceStatus\x18\x01 \x01(\x0e\x32\x1c.Authentication.DeviceStatus\x12\"\n\x04salt\x18\x02 \x03(\x0b\x32\x14.Authentication.Salt\x12\x38\n\x0eOBSOLETE_FIELD\x18\x03 \x03(\x0b\x32 .Authentication.TwoFactorChannel\x12\x30\n\x0bssoUserInfo\x18\x04 \x01(\x0b\x32\x1b.Authentication.SsoUserInfo\"*\n\x10LoginToMcRequest\x12\x16\n\x0emcEnterpriseId\x18\x01 \x01(\x05\"L\n\x11LoginToMcResponse\x12\x1d\n\x15\x65ncryptedSessionToken\x18\x01 \x01(\x0c\x12\x18\n\x10\x65ncryptedTreeKey\x18\x02 \x01(\t\"&\n\x12LoginAsUserRequest\x12\x10\n\x08username\x18\x01 \x01(\t\"W\n\x13LoginAsUserResponse\x12\x1d\n\x15\x65ncryptedSessionToken\x18\x01 \x01(\x0c\x12!\n\x19\x65ncryptedSharedAccountKey\x18\x02 \x01(\x0c\"\x84\x01\n\x17ValidateAuthHashRequest\x12\x36\n\x0epasswordMethod\x18\x01 \x01(\x0e\x32\x1e.Authentication.PasswordMethod\x12\x14\n\x0c\x61uthResponse\x18\x02 \x01(\x0c\x12\x1b\n\x13\x65ncryptedLoginToken\x18\x03 \x01(\x0c\"\xf5\x01\n\x14TwoFactorChannelInfo\x12\x39\n\x0b\x63hannelType\x18\x01 \x01(\x0e\x32$.Authentication.TwoFactorChannelType\x12\x13\n\x0b\x63hannel_uid\x18\x02 \x01(\x0c\x12\x13\n\x0b\x63hannelName\x18\x03 \x01(\t\x12\x11\n\tchallenge\x18\x04 \x01(\t\x12\x14\n\x0c\x63\x61pabilities\x18\x05 \x03(\t\x12\x13\n\x0bphoneNumber\x18\x06 \x01(\t\x12:\n\rmaxExpiration\x18\x07 \x01(\x0e\x32#.Authentication.TwoFactorExpiration\"\xc9\x01\n\x18TwoFactorValidateRequest\x12\x1b\n\x13\x65ncryptedLoginToken\x18\x01 \x01(\x0c\x12\x35\n\tvalueType\x18\x02 \x01(\x0e\x32\".Authentication.TwoFactorValueType\x12\r\n\x05value\x18\x03 \x01(\t\x12\x13\n\x0b\x63hannel_uid\x18\x04 \x01(\x0c\x12\x35\n\x08\x65xpireIn\x18\x05 \x01(\x0e\x32#.Authentication.TwoFactorExpiration\"8\n\x19TwoFactorValidateResponse\x12\x1b\n\x13\x65ncryptedLoginToken\x18\x01 \x01(\x0c\"\xb8\x01\n\x18TwoFactorSendPushRequest\x12\x1b\n\x13\x65ncryptedLoginToken\x18\x01 \x01(\x0c\x12\x33\n\x08pushType\x18\x02 \x01(\x0e\x32!.Authentication.TwoFactorPushType\x12\x13\n\x0b\x63hannel_uid\x18\x03 \x01(\x0c\x12\x35\n\x08\x65xpireIn\x18\x04 \x01(\x0e\x32#.Authentication.TwoFactorExpiration\"\x83\x01\n\x07License\x12\x0f\n\x07\x63reated\x18\x01 \x01(\x03\x12\x12\n\nexpiration\x18\x02 \x01(\x03\x12\x34\n\rlicenseStatus\x18\x03 \x01(\x0e\x32\x1d.Authentication.LicenseStatus\x12\x0c\n\x04paid\x18\x04 \x01(\x08\x12\x0f\n\x07message\x18\x05 \x01(\t\"G\n\x0fOwnerlessRecord\x12\x11\n\trecordUid\x18\x01 \x01(\x0c\x12\x11\n\trecordKey\x18\x02 \x01(\x0c\x12\x0e\n\x06status\x18\x03 \x01(\x05\"L\n\x10OwnerlessRecords\x12\x38\n\x0fownerlessRecord\x18\x01 \x03(\x0b\x32\x1f.Authentication.OwnerlessRecord\"\xd7\x01\n\x0fUserAuthRequest\x12\x0b\n\x03uid\x18\x01 \x01(\x0c\x12\x0c\n\x04salt\x18\x02 \x01(\x0c\x12\x12\n\niterations\x18\x03 \x01(\x05\x12\x1a\n\x12\x65ncryptedClientKey\x18\x04 \x01(\x0c\x12\x10\n\x08\x61uthHash\x18\x05 \x01(\x0c\x12\x18\n\x10\x65ncryptedDataKey\x18\x06 \x01(\x0c\x12,\n\tloginType\x18\x07 \x01(\x0e\x32\x19.Authentication.LoginType\x12\x0c\n\x04name\x18\x08 \x01(\t\x12\x11\n\talgorithm\x18\t \x01(\x05\"\x19\n\nUidRequest\x12\x0b\n\x03uid\x18\x01 \x03(\x0c\"\xab\x01\n\x13\x44\x65viceUpdateRequest\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x01 \x01(\x0c\x12\x15\n\rclientVersion\x18\x02 \x01(\t\x12\x12\n\ndeviceName\x18\x03 \x01(\t\x12\x17\n\x0f\x64\x65vicePublicKey\x18\x04 \x01(\x0c\x12\x32\n\x0c\x64\x65viceStatus\x18\x05 \x01(\x0e\x32\x1c.Authentication.DeviceStatus\"\x81\x01\n\x1dRegisterDeviceInRegionRequest\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x01 \x01(\x0c\x12\x15\n\rclientVersion\x18\x02 \x01(\t\x12\x12\n\ndeviceName\x18\x03 \x01(\t\x12\x17\n\x0f\x64\x65vicePublicKey\x18\x04 \x01(\x0c\"\xf8\x02\n\x13RegistrationRequest\x12\x30\n\x0b\x61uthRequest\x18\x01 \x01(\x0b\x32\x1b.Authentication.AuthRequest\x12\x38\n\x0fuserAuthRequest\x18\x02 \x01(\x0b\x32\x1f.Authentication.UserAuthRequest\x12\x1a\n\x12\x65ncryptedClientKey\x18\x03 \x01(\x0c\x12\x1b\n\x13\x65ncryptedPrivateKey\x18\x04 \x01(\x0c\x12\x11\n\tpublicKey\x18\x05 \x01(\x0c\x12\x18\n\x10verificationCode\x18\x06 \x01(\t\x12\x1e\n\x16\x64\x65precatedAuthHashHash\x18\x07 \x01(\x0c\x12$\n\x1c\x64\x65precatedEncryptedClientKey\x18\x08 \x01(\x0c\x12%\n\x1d\x64\x65precatedEncryptedPrivateKey\x18\t \x01(\x0c\x12\"\n\x1a\x64\x65precatedEncryptionParams\x18\n \x01(\x0c\"\xd0\x01\n\x16\x43onvertUserToV3Request\x12\x30\n\x0b\x61uthRequest\x18\x01 \x01(\x0b\x32\x1b.Authentication.AuthRequest\x12\x38\n\x0fuserAuthRequest\x18\x02 \x01(\x0b\x32\x1f.Authentication.UserAuthRequest\x12\x1a\n\x12\x65ncryptedClientKey\x18\x03 \x01(\x0c\x12\x1b\n\x13\x65ncryptedPrivateKey\x18\x04 \x01(\x0c\x12\x11\n\tpublicKey\x18\x05 \x01(\x0c\"$\n\x10RevisionResponse\x12\x10\n\x08revision\x18\x01 \x01(\x03\"&\n\x12\x43hangeEmailRequest\x12\x10\n\x08newEmail\x18\x01 \x01(\t\"8\n\x13\x43hangeEmailResponse\x12!\n\x19\x65ncryptedChangeEmailToken\x18\x01 \x01(\x0c\"6\n\x1d\x45mailVerificationLinkResponse\x12\x15\n\remailVerified\x18\x01 \x01(\x08\")\n\x0cSecurityData\x12\x0b\n\x03uid\x18\x01 \x01(\x0c\x12\x0c\n\x04\x64\x61ta\x18\x02 \x01(\x0c\"\x91\x01\n\x13SecurityDataRequest\x12\x38\n\x12recordSecurityData\x18\x01 \x03(\x0b\x32\x1c.Authentication.SecurityData\x12@\n\x1amasterPasswordSecurityData\x18\x02 \x03(\x0b\x32\x1c.Authentication.SecurityData\"\xb5\x01\n\x1dSecurityReportIncrementalData\x12\x18\n\x10\x65nterpriseUserId\x18\x01 \x01(\x03\x12\x1b\n\x13\x63urrentSecurityData\x18\x02 \x01(\x0c\x12#\n\x1b\x63urrentSecurityDataRevision\x18\x03 \x01(\x03\x12\x17\n\x0foldSecurityData\x18\x04 \x01(\x0c\x12\x1f\n\x17oldSecurityDataRevision\x18\x05 \x01(\x03\"\xf5\x01\n\x0eSecurityReport\x12\x18\n\x10\x65nterpriseUserId\x18\x01 \x01(\x03\x12\x1b\n\x13\x65ncryptedReportData\x18\x02 \x01(\x0c\x12\x10\n\x08revision\x18\x03 \x01(\x03\x12\x11\n\ttwoFactor\x18\x04 \x01(\t\x12\x11\n\tlastLogin\x18\x05 \x01(\x03\x12\x1e\n\x16numberOfReusedPassword\x18\x06 \x01(\x05\x12T\n\x1dsecurityReportIncrementalData\x18\x07 \x03(\x0b\x32-.Authentication.SecurityReportIncrementalData\"S\n\x19SecurityReportSaveRequest\x12\x36\n\x0esecurityReport\x18\x01 \x03(\x0b\x32\x1e.Authentication.SecurityReport\")\n\x15SecurityReportRequest\x12\x10\n\x08\x66romPage\x18\x01 \x01(\x03\"\xb8\x01\n\x16SecurityReportResponse\x12\x1c\n\x14\x65nterprisePrivateKey\x18\x01 \x01(\x0c\x12\x36\n\x0esecurityReport\x18\x02 \x03(\x0b\x32\x1e.Authentication.SecurityReport\x12\x14\n\x0c\x61sOfRevision\x18\x03 \x01(\x03\x12\x10\n\x08\x66romPage\x18\x04 \x01(\x03\x12\x0e\n\x06toPage\x18\x05 \x01(\x03\x12\x10\n\x08\x63omplete\x18\x06 \x01(\x08\"\'\n\x16ReusedPasswordsRequest\x12\r\n\x05\x63ount\x18\x01 \x01(\x05\">\n\x14SummaryConsoleReport\x12\x12\n\nreportType\x18\x01 \x01(\x05\x12\x12\n\nreportData\x18\x02 \x01(\x0c\"|\n\x12\x43hangeToKeyTypeOne\x12/\n\nobjectType\x18\x01 \x01(\x0e\x32\x1b.Authentication.ObjectTypes\x12\x12\n\nprimaryUid\x18\x02 \x01(\x0c\x12\x14\n\x0csecondaryUid\x18\x03 \x01(\x0c\x12\x0b\n\x03key\x18\x04 \x01(\x0c\"[\n\x19\x43hangeToKeyTypeOneRequest\x12>\n\x12\x63hangeToKeyTypeOne\x18\x01 \x03(\x0b\x32\".Authentication.ChangeToKeyTypeOne\"U\n\x18\x43hangeToKeyTypeOneStatus\x12\x0b\n\x03uid\x18\x01 \x01(\x0c\x12\x0c\n\x04type\x18\x02 \x01(\t\x12\x0e\n\x06status\x18\x03 \x01(\t\x12\x0e\n\x06reason\x18\x04 \x01(\t\"h\n\x1a\x43hangeToKeyTypeOneResponse\x12J\n\x18\x63hangeToKeyTypeOneStatus\x18\x01 \x03(\x0b\x32(.Authentication.ChangeToKeyTypeOneStatus\"!\n\x06SetKey\x12\n\n\x02id\x18\x01 \x01(\x03\x12\x0b\n\x03key\x18\x02 \x01(\x0c\"5\n\rSetKeyRequest\x12$\n\x04keys\x18\x01 \x03(\x0b\x32\x16.Authentication.SetKey\"\xce\x04\n\x11\x43reateUserRequest\x12\x10\n\x08username\x18\x01 \x01(\t\x12\x14\n\x0c\x61uthVerifier\x18\x02 \x01(\x0c\x12\x18\n\x10\x65ncryptionParams\x18\x03 \x01(\x0c\x12\x14\n\x0crsaPublicKey\x18\x04 \x01(\x0c\x12\x1e\n\x16rsaEncryptedPrivateKey\x18\x05 \x01(\x0c\x12\x14\n\x0c\x65\x63\x63PublicKey\x18\x06 \x01(\x0c\x12\x1e\n\x16\x65\x63\x63\x45ncryptedPrivateKey\x18\x07 \x01(\x0c\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x08 \x01(\x0c\x12\x1a\n\x12\x65ncryptedClientKey\x18\t \x01(\x0c\x12\x15\n\rclientVersion\x18\n \x01(\t\x12\x1e\n\x16\x65ncryptedDeviceDataKey\x18\x0b \x01(\x0c\x12\x1b\n\x13\x65ncryptedLoginToken\x18\x0c \x01(\x0c\x12\x19\n\x11messageSessionUid\x18\r \x01(\x0c\x12\x17\n\x0finstallReferrer\x18\x0e \x01(\t\x12\x0e\n\x06mccMNC\x18\x0f \x01(\x05\x12\x0b\n\x03mfg\x18\x10 \x01(\t\x12\r\n\x05model\x18\x11 \x01(\t\x12\r\n\x05\x62rand\x18\x12 \x01(\t\x12\x0f\n\x07product\x18\x13 \x01(\t\x12\x0e\n\x06\x64\x65vice\x18\x14 \x01(\t\x12\x0f\n\x07\x63\x61rrier\x18\x15 \x01(\t\x12\x18\n\x10verificationCode\x18\x16 \x01(\t\x12\x42\n\x16\x65nterpriseRegistration\x18\x17 \x01(\x0b\x32\".Enterprise.EnterpriseRegistration\"W\n!NodeEnforcementAddOrUpdateRequest\x12\x0e\n\x06nodeId\x18\x01 \x01(\x03\x12\x13\n\x0b\x65nforcement\x18\x02 \x01(\t\x12\r\n\x05value\x18\x03 \x01(\t\"C\n\x1cNodeEnforcementRemoveRequest\x12\x0e\n\x06nodeId\x18\x01 \x01(\x03\x12\x13\n\x0b\x65nforcement\x18\x02 \x01(\t\"\"\n\x0cUserAccounts\x12\x12\n\naccountUid\x18\x01 \x03(\x0c\"\x9f\x01\n\x0f\x41piRequestByKey\x12\r\n\x05keyId\x18\x01 \x01(\x05\x12\x0f\n\x07payload\x18\x02 \x01(\x0c\x12\x10\n\x08username\x18\x03 \x01(\t\x12\x0e\n\x06locale\x18\x04 \x01(\t\x12<\n\x11supportedLanguage\x18\x05 \x01(\x0e\x32!.Authentication.SupportedLanguage\x12\x0c\n\x04type\x18\x06 \x01(\x05\".\n\x0fMemcacheRequest\x12\x0b\n\x03key\x18\x01 \x01(\t\x12\x0e\n\x06userId\x18\x02 \x01(\x05\".\n\x10MemcacheResponse\x12\x0b\n\x03key\x18\x01 \x01(\t\x12\r\n\x05value\x18\x02 \x01(\t\"w\n\x1cMasterPasswordReentryRequest\x12\x16\n\x0epbkdf2Password\x18\x01 \x01(\t\x12?\n\x06\x61\x63tion\x18\x02 \x01(\x0e\x32/.Authentication.MasterPasswordReentryActionType\"_\n\x19\x44\x65viceRegistrationRequest\x12\x15\n\rclientVersion\x18\x01 \x01(\t\x12\x12\n\ndeviceName\x18\x02 \x01(\t\x12\x17\n\x0f\x64\x65vicePublicKey\x18\x03 \x01(\x0c\"\x9a\x01\n\x19\x44\x65viceVerificationRequest\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x01 \x01(\x0c\x12\x10\n\x08username\x18\x02 \x01(\t\x12\x1b\n\x13verificationChannel\x18\x03 \x01(\t\x12\x19\n\x11messageSessionUid\x18\x04 \x01(\x0c\x12\x15\n\rclientVersion\x18\x05 \x01(\t\"\xb2\x01\n\x1a\x44\x65viceVerificationResponse\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x01 \x01(\x0c\x12\x10\n\x08username\x18\x02 \x01(\t\x12\x19\n\x11messageSessionUid\x18\x03 \x01(\x0c\x12\x15\n\rclientVersion\x18\x04 \x01(\t\x12\x32\n\x0c\x64\x65viceStatus\x18\x05 \x01(\x0e\x32\x1c.Authentication.DeviceStatus\"\xc8\x01\n\x15\x44\x65viceApprovalRequest\x12\r\n\x05\x65mail\x18\x01 \x01(\t\x12\x18\n\x10twoFactorChannel\x18\x02 \x01(\t\x12\x15\n\rclientVersion\x18\x03 \x01(\t\x12\x0e\n\x06locale\x18\x04 \x01(\t\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x05 \x01(\x0c\x12\x10\n\x08totpCode\x18\x06 \x01(\t\x12\x10\n\x08\x64\x65viceIp\x18\x07 \x01(\t\x12\x1d\n\x15\x64\x65viceTokenExpireDays\x18\x08 \x01(\t\"9\n\x16\x44\x65viceApprovalResponse\x12\x1f\n\x17\x65ncryptedTwoFactorToken\x18\x01 \x01(\x0c\"~\n\x14\x41pproveDeviceRequest\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x01 \x01(\x0c\x12\x1e\n\x16\x65ncryptedDeviceDataKey\x18\x02 \x01(\x0c\x12\x14\n\x0c\x64\x65nyApproval\x18\x03 \x01(\x08\x12\x12\n\nlinkDevice\x18\x04 \x01(\x08\"E\n\x1a\x45nterpriseUserAliasRequest\x12\x18\n\x10\x65nterpriseUserId\x18\x01 \x01(\x03\x12\r\n\x05\x61lias\x18\x02 \x01(\t\"&\n\x06\x44\x65vice\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x01 \x01(\x0c\"\\\n\x1cRegisterDeviceDataKeyRequest\x12\x1c\n\x14\x65ncryptedDeviceToken\x18\x01 \x01(\x0c\x12\x1e\n\x16\x65ncryptedDeviceDataKey\x18\x02 \x01(\x0c\"n\n)ValidateCreateUserVerificationCodeRequest\x12\x10\n\x08username\x18\x01 \x01(\t\x12\x15\n\rclientVersion\x18\x02 \x01(\t\x12\x18\n\x10verificationCode\x18\x03 \x01(\t\"\x85\x01\n%ValidateDeviceVerificationCodeRequest\x12\x10\n\x08username\x18\x01 \x01(\t\x12\x15\n\rclientVersion\x18\x02 \x01(\t\x12\x18\n\x10verificationCode\x18\x03 \x01(\t\x12\x19\n\x11messageSessionUid\x18\x04 \x01(\x0c\"Y\n\x19SendSessionMessageRequest\x12\x19\n\x11messageSessionUid\x18\x01 \x01(\x0c\x12\x0f\n\x07\x63ommand\x18\x02 \x01(\t\x12\x10\n\x08username\x18\x03 \x01(\t\"M\n\x11GlobalUserAccount\x12\x10\n\x08username\x18\x01 \x01(\t\x12\x12\n\naccountUid\x18\x02 \x01(\x0c\x12\x12\n\nregionName\x18\x03 \x01(\t\"7\n\x0f\x41\x63\x63ountUsername\x12\x10\n\x08username\x18\x01 \x01(\t\x12\x12\n\ndateActive\x18\x02 \x01(\t\"P\n\x19SsoServiceProviderRequest\x12\x0c\n\x04name\x18\x01 \x01(\t\x12\x15\n\rclientVersion\x18\x02 \x01(\t\x12\x0e\n\x06locale\x18\x03 \x01(\t\"a\n\x1aSsoServiceProviderResponse\x12\x0c\n\x04name\x18\x01 \x01(\t\x12\r\n\x05spUrl\x18\x02 \x01(\t\x12\x0f\n\x07isCloud\x18\x03 \x01(\x08\x12\x15\n\rclientVersion\x18\x04 \x01(\t\"4\n\x12UserSettingRequest\x12\x0f\n\x07setting\x18\x01 \x01(\t\x12\r\n\x05value\x18\x02 \x01(\t\"f\n\rThrottleState\x12*\n\x04type\x18\x01 \x01(\x0e\x32\x1c.Authentication.ThrottleType\x12\x0b\n\x03key\x18\x02 \x01(\t\x12\r\n\x05value\x18\x03 \x01(\t\x12\r\n\x05state\x18\x04 \x01(\x08\"\x97\x01\n\x11\x44\x65viceInformation\x12\x10\n\x08\x64\x65viceId\x18\x01 \x01(\x03\x12\x12\n\ndeviceName\x18\x02 \x01(\t\x12\x15\n\rclientVersion\x18\x03 \x01(\t\x12\x11\n\tlastLogin\x18\x04 \x01(\x03\x12\x32\n\x0c\x64\x65viceStatus\x18\x05 \x01(\x0e\x32\x1c.Authentication.DeviceStatus\"*\n\x0bUserSetting\x12\x0c\n\x04name\x18\x01 \x01(\t\x12\r\n\x05value\x18\x02 \x01(\x08\".\n\x12UserDataKeyRequest\x12\x18\n\x10\x65nterpriseUserId\x18\x01 \x03(\x03\"Q\n\x1b\x45nterpriseUserIdDataKeyPair\x12\x18\n\x10\x65nterpriseUserId\x18\x01 \x01(\x03\x12\x18\n\x10\x65ncryptedDataKey\x18\x02 \x01(\x0c\"\x95\x01\n\x0bUserDataKey\x12\x0e\n\x06roleId\x18\x01 \x01(\x03\x12\x0f\n\x07roleKey\x18\x02 \x01(\x0c\x12\x12\n\nprivateKey\x18\x03 \x01(\t\x12Q\n\x1c\x65nterpriseUserIdDataKeyPairs\x18\x04 \x03(\x0b\x32+.Authentication.EnterpriseUserIdDataKeyPair\"z\n\x13UserDataKeyResponse\x12\x31\n\x0cuserDataKeys\x18\x01 \x03(\x0b\x32\x1b.Authentication.UserDataKey\x12\x14\n\x0c\x61\x63\x63\x65ssDenied\x18\x02 \x03(\x03\x12\x1a\n\x12noEncryptedDataKey\x18\x03 \x03(\x03*\xb9\x02\n\x11SupportedLanguage\x12\x0b\n\x07\x45NGLISH\x10\x00\x12\n\n\x06\x41RABIC\x10\x01\x12\x0b\n\x07\x42RITISH\x10\x02\x12\x0b\n\x07\x43HINESE\x10\x03\x12\x15\n\x11\x43HINESE_HONG_KONG\x10\x04\x12\x12\n\x0e\x43HINESE_TAIWAN\x10\x05\x12\t\n\x05\x44UTCH\x10\x06\x12\n\n\x06\x46RENCH\x10\x07\x12\n\n\x06GERMAN\x10\x08\x12\t\n\x05GREEK\x10\t\x12\n\n\x06HEBREW\x10\n\x12\x0b\n\x07ITALIAN\x10\x0b\x12\x0c\n\x08JAPANESE\x10\x0c\x12\n\n\x06KOREAN\x10\r\x12\n\n\x06POLISH\x10\x0e\x12\x0e\n\nPORTUGUESE\x10\x0f\x12\x15\n\x11PORTUGUESE_BRAZIL\x10\x10\x12\x0c\n\x08ROMANIAN\x10\x11\x12\x0b\n\x07RUSSIAN\x10\x12\x12\n\n\x06SLOVAK\x10\x13\x12\x0b\n\x07SPANISH\x10\x14*E\n\tLoginType\x12\n\n\x06NORMAL\x10\x00\x12\x07\n\x03SSO\x10\x01\x12\x07\n\x03\x42IO\x10\x02\x12\r\n\tALTERNATE\x10\x03\x12\x0b\n\x07OFFLINE\x10\x04*q\n\x0c\x44\x65viceStatus\x12\x19\n\x15\x44\x45VICE_NEEDS_APPROVAL\x10\x00\x12\r\n\tDEVICE_OK\x10\x01\x12\x1b\n\x17\x44\x45VICE_DISABLED_BY_USER\x10\x02\x12\x1a\n\x16\x44\x45VICE_LOCKED_BY_ADMIN\x10\x03*A\n\rLicenseStatus\x12\t\n\x05OTHER\x10\x00\x12\n\n\x06\x41\x43TIVE\x10\x01\x12\x0b\n\x07\x45XPIRED\x10\x02\x12\x0c\n\x08\x44ISABLED\x10\x03*7\n\x0b\x41\x63\x63ountType\x12\x0c\n\x08\x43ONSUMER\x10\x00\x12\n\n\x06\x46\x41MILY\x10\x01\x12\x0e\n\nENTERPRISE\x10\x02*\xcc\x01\n\x10SessionTokenType\x12\x12\n\x0eNO_RESTRICTION\x10\x00\x12\x14\n\x10\x41\x43\x43OUNT_RECOVERY\x10\x01\x12\x11\n\rSHARE_ACCOUNT\x10\x02\x12\x0c\n\x08PURCHASE\x10\x03\x12\x0c\n\x08RESTRICT\x10\x04\x12\x11\n\rACCEPT_INVITE\x10\x05\x12\x12\n\x0eSUPPORT_SERVER\x10\x06\x12\x17\n\x13\x45NTERPRISE_CREATION\x10\x07\x12\x1f\n\x1b\x45XPIRED_BUT_ALLOWED_TO_SYNC\x10\x08*G\n\x07Version\x12\x13\n\x0finvalid_version\x10\x00\x12\x13\n\x0f\x64\x65\x66\x61ult_version\x10\x01\x12\x12\n\x0esecond_version\x10\x02*7\n\x1fMasterPasswordReentryActionType\x12\n\n\x06UNMASK\x10\x00\x12\x08\n\x04\x43OPY\x10\x01*l\n\x0bLoginMethod\x12\x17\n\x13INVALID_LOGINMETHOD\x10\x00\x12\x14\n\x10\x45XISTING_ACCOUNT\x10\x01\x12\x0e\n\nSSO_DOMAIN\x10\x02\x12\r\n\tAFTER_SSO\x10\x03\x12\x0f\n\x0bNEW_ACCOUNT\x10\x04*\xc7\x03\n\nLoginState\x12\x16\n\x12INVALID_LOGINSTATE\x10\x00\x12\x0e\n\nLOGGED_OUT\x10\x01\x12\x1c\n\x18\x44\x45VICE_APPROVAL_REQUIRED\x10\x02\x12\x11\n\rDEVICE_LOCKED\x10\x03\x12\x12\n\x0e\x41\x43\x43OUNT_LOCKED\x10\x04\x12\x19\n\x15\x44\x45VICE_ACCOUNT_LOCKED\x10\x05\x12\x0b\n\x07UPGRADE\x10\x06\x12\x13\n\x0fLICENSE_EXPIRED\x10\x07\x12\x13\n\x0fREGION_REDIRECT\x10\x08\x12\x16\n\x12REDIRECT_CLOUD_SSO\x10\t\x12\x17\n\x13REDIRECT_ONSITE_SSO\x10\n\x12\x10\n\x0cREQUIRES_2FA\x10\x0c\x12\x16\n\x12REQUIRES_AUTH_HASH\x10\r\x12\x15\n\x11REQUIRES_USERNAME\x10\x0e\x12\x19\n\x15\x41\x46TER_CLOUD_SSO_LOGIN\x10\x0f\x12\x1d\n\x19REQUIRES_ACCOUNT_CREATION\x10\x10\x12&\n\"REQUIRES_DEVICE_ENCRYPTED_DATA_KEY\x10\x11\x12\x17\n\x13LOGIN_TOKEN_EXPIRED\x10\x12\x12\r\n\tLOGGED_IN\x10\x63*k\n\x14\x45ncryptedDataKeyType\x12\n\n\x06NO_KEY\x10\x00\x12\x18\n\x14\x42Y_DEVICE_PUBLIC_KEY\x10\x01\x12\x0f\n\x0b\x42Y_PASSWORD\x10\x02\x12\x10\n\x0c\x42Y_ALTERNATE\x10\x03\x12\n\n\x06\x42Y_BIO\x10\x04*-\n\x0ePasswordMethod\x12\x0b\n\x07\x45NTERED\x10\x00\x12\x0e\n\nBIOMETRICS\x10\x01*\xb9\x01\n\x11TwoFactorPushType\x12\x14\n\x10TWO_FA_PUSH_NONE\x10\x00\x12\x13\n\x0fTWO_FA_PUSH_SMS\x10\x01\x12\x16\n\x12TWO_FA_PUSH_KEEPER\x10\x02\x12\x18\n\x14TWO_FA_PUSH_DUO_PUSH\x10\x03\x12\x18\n\x14TWO_FA_PUSH_DUO_TEXT\x10\x04\x12\x18\n\x14TWO_FA_PUSH_DUO_CALL\x10\x05\x12\x13\n\x0fTWO_FA_PUSH_DNA\x10\x06*\xc3\x01\n\x12TwoFactorValueType\x12\x14\n\x10TWO_FA_CODE_NONE\x10\x00\x12\x14\n\x10TWO_FA_CODE_TOTP\x10\x01\x12\x13\n\x0fTWO_FA_CODE_SMS\x10\x02\x12\x13\n\x0fTWO_FA_CODE_DUO\x10\x03\x12\x13\n\x0fTWO_FA_CODE_RSA\x10\x04\x12\x13\n\x0fTWO_FA_RESP_U2F\x10\x05\x12\x18\n\x14TWO_FA_RESP_WEBAUTHN\x10\x06\x12\x13\n\x0fTWO_FA_CODE_DNA\x10\x07*\xe1\x01\n\x14TwoFactorChannelType\x12\x12\n\x0eTWO_FA_CT_NONE\x10\x00\x12\x12\n\x0eTWO_FA_CT_TOTP\x10\x01\x12\x11\n\rTWO_FA_CT_SMS\x10\x02\x12\x11\n\rTWO_FA_CT_DUO\x10\x03\x12\x11\n\rTWO_FA_CT_RSA\x10\x04\x12\x14\n\x10TWO_FA_CT_BACKUP\x10\x05\x12\x11\n\rTWO_FA_CT_U2F\x10\x06\x12\x16\n\x12TWO_FA_CT_WEBAUTHN\x10\x07\x12\x14\n\x10TWO_FA_CT_KEEPER\x10\x08\x12\x11\n\rTWO_FA_CT_DNA\x10\t*\xab\x01\n\x13TwoFactorExpiration\x12\x1a\n\x16TWO_FA_EXP_IMMEDIATELY\x10\x00\x12\x18\n\x14TWO_FA_EXP_5_MINUTES\x10\x01\x12\x17\n\x13TWO_FA_EXP_12_HOURS\x10\x02\x12\x17\n\x13TWO_FA_EXP_24_HOURS\x10\x03\x12\x16\n\x12TWO_FA_EXP_30_DAYS\x10\x04\x12\x14\n\x10TWO_FA_EXP_NEVER\x10\x05*@\n\x0bLicenseType\x12\t\n\x05VAULT\x10\x00\x12\x08\n\x04\x43HAT\x10\x01\x12\x0b\n\x07STORAGE\x10\x02\x12\x0f\n\x0b\x42REACHWATCH\x10\x03*i\n\x0bObjectTypes\x12\n\n\x06RECORD\x10\x00\x12\x16\n\x12SHARED_FOLDER_USER\x10\x01\x12\x16\n\x12SHARED_FOLDER_TEAM\x10\x02\x12\x0f\n\x0bUSER_FOLDER\x10\x03\x12\r\n\tTEAM_USER\x10\x04*`\n\x1b\x41lternateAuthenticationType\x12\x1d\n\x19\x41LTERNATE_MASTER_PASSWORD\x10\x00\x12\r\n\tBIOMETRIC\x10\x01\x12\x13\n\x0f\x41\x43\x43OUNT_RECOVER\x10\x02*\x9a\x02\n\x0cThrottleType\x12\x1b\n\x17PASSWORD_RETRY_THROTTLE\x10\x00\x12\"\n\x1ePASSWORD_RETRY_LEGACY_THROTTLE\x10\x01\x12\x13\n\x0fTWO_FA_THROTTLE\x10\x02\x12\x1a\n\x16TWO_FA_LEGACY_THROTTLE\x10\x03\x12\x15\n\x11QA_RETRY_THROTTLE\x10\x04\x12\x1c\n\x18\x41\x43\x43OUNT_RECOVER_THROTTLE\x10\x05\x12.\n*VALIDATE_DEVICE_VERIFICATION_CODE_THROTTLE\x10\x06\x12\x33\n/VALIDATE_CREATE_USER_VERIFICATION_CODE_THROTTLE\x10\x07\x42*\n\x18\x63om.keepersecurity.protoB\x0e\x41uthenticationb\x06proto3'
,
dependencies=[enterprise__pb2.DESCRIPTOR,])
_SUPPORTEDLANGUAGE = _descriptor.EnumDescriptor(
name='SupportedLanguage',
full_name='Authentication.SupportedLanguage',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='ENGLISH', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ARABIC', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='BRITISH', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='CHINESE', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='CHINESE_HONG_KONG', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='CHINESE_TAIWAN', index=5, number=5,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='DUTCH', index=6, number=6,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='FRENCH', index=7, number=7,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='GERMAN', index=8, number=8,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='GREEK', index=9, number=9,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='HEBREW', index=10, number=10,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ITALIAN', index=11, number=11,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='JAPANESE', index=12, number=12,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='KOREAN', index=13, number=13,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='POLISH', index=14, number=14,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='PORTUGUESE', index=15, number=15,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='PORTUGUESE_BRAZIL', index=16, number=16,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ROMANIAN', index=17, number=17,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='RUSSIAN', index=18, number=18,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='SLOVAK', index=19, number=19,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='SPANISH', index=20, number=20,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=10379,
serialized_end=10692,
)
_sym_db.RegisterEnumDescriptor(_SUPPORTEDLANGUAGE)
SupportedLanguage = enum_type_wrapper.EnumTypeWrapper(_SUPPORTEDLANGUAGE)
_LOGINTYPE = _descriptor.EnumDescriptor(
name='LoginType',
full_name='Authentication.LoginType',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='NORMAL', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='SSO', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='BIO', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ALTERNATE', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='OFFLINE', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=10694,
serialized_end=10763,
)
_sym_db.RegisterEnumDescriptor(_LOGINTYPE)
LoginType = enum_type_wrapper.EnumTypeWrapper(_LOGINTYPE)
_DEVICESTATUS = _descriptor.EnumDescriptor(
name='DeviceStatus',
full_name='Authentication.DeviceStatus',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='DEVICE_NEEDS_APPROVAL', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='DEVICE_OK', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='DEVICE_DISABLED_BY_USER', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='DEVICE_LOCKED_BY_ADMIN', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=10765,
serialized_end=10878,
)
_sym_db.RegisterEnumDescriptor(_DEVICESTATUS)
DeviceStatus = enum_type_wrapper.EnumTypeWrapper(_DEVICESTATUS)
_LICENSESTATUS = _descriptor.EnumDescriptor(
name='LicenseStatus',
full_name='Authentication.LicenseStatus',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='OTHER', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ACTIVE', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='EXPIRED', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='DISABLED', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=10880,
serialized_end=10945,
)
_sym_db.RegisterEnumDescriptor(_LICENSESTATUS)
LicenseStatus = enum_type_wrapper.EnumTypeWrapper(_LICENSESTATUS)
_ACCOUNTTYPE = _descriptor.EnumDescriptor(
name='AccountType',
full_name='Authentication.AccountType',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='CONSUMER', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='FAMILY', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ENTERPRISE', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=10947,
serialized_end=11002,
)
_sym_db.RegisterEnumDescriptor(_ACCOUNTTYPE)
AccountType = enum_type_wrapper.EnumTypeWrapper(_ACCOUNTTYPE)
_SESSIONTOKENTYPE = _descriptor.EnumDescriptor(
name='SessionTokenType',
full_name='Authentication.SessionTokenType',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='NO_RESTRICTION', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ACCOUNT_RECOVERY', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='SHARE_ACCOUNT', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='PURCHASE', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='RESTRICT', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ACCEPT_INVITE', index=5, number=5,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='SUPPORT_SERVER', index=6, number=6,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ENTERPRISE_CREATION', index=7, number=7,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='EXPIRED_BUT_ALLOWED_TO_SYNC', index=8, number=8,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=11005,
serialized_end=11209,
)
_sym_db.RegisterEnumDescriptor(_SESSIONTOKENTYPE)
SessionTokenType = enum_type_wrapper.EnumTypeWrapper(_SESSIONTOKENTYPE)
_VERSION = _descriptor.EnumDescriptor(
name='Version',
full_name='Authentication.Version',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='invalid_version', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='default_version', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='second_version', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=11211,
serialized_end=11282,
)
_sym_db.RegisterEnumDescriptor(_VERSION)
Version = enum_type_wrapper.EnumTypeWrapper(_VERSION)
_MASTERPASSWORDREENTRYACTIONTYPE = _descriptor.EnumDescriptor(
name='MasterPasswordReentryActionType',
full_name='Authentication.MasterPasswordReentryActionType',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='UNMASK', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='COPY', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=11284,
serialized_end=11339,
)
_sym_db.RegisterEnumDescriptor(_MASTERPASSWORDREENTRYACTIONTYPE)
MasterPasswordReentryActionType = enum_type_wrapper.EnumTypeWrapper(_MASTERPASSWORDREENTRYACTIONTYPE)
_LOGINMETHOD = _descriptor.EnumDescriptor(
name='LoginMethod',
full_name='Authentication.LoginMethod',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='INVALID_LOGINMETHOD', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='EXISTING_ACCOUNT', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='SSO_DOMAIN', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='AFTER_SSO', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='NEW_ACCOUNT', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=11341,
serialized_end=11449,
)
_sym_db.RegisterEnumDescriptor(_LOGINMETHOD)
LoginMethod = enum_type_wrapper.EnumTypeWrapper(_LOGINMETHOD)
_LOGINSTATE = _descriptor.EnumDescriptor(
name='LoginState',
full_name='Authentication.LoginState',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='INVALID_LOGINSTATE', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='LOGGED_OUT', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='DEVICE_APPROVAL_REQUIRED', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='DEVICE_LOCKED', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ACCOUNT_LOCKED', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='DEVICE_ACCOUNT_LOCKED', index=5, number=5,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='UPGRADE', index=6, number=6,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='LICENSE_EXPIRED', index=7, number=7,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='REGION_REDIRECT', index=8, number=8,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='REDIRECT_CLOUD_SSO', index=9, number=9,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='REDIRECT_ONSITE_SSO', index=10, number=10,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='REQUIRES_2FA', index=11, number=12,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='REQUIRES_AUTH_HASH', index=12, number=13,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='REQUIRES_USERNAME', index=13, number=14,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='AFTER_CLOUD_SSO_LOGIN', index=14, number=15,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='REQUIRES_ACCOUNT_CREATION', index=15, number=16,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='REQUIRES_DEVICE_ENCRYPTED_DATA_KEY', index=16, number=17,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='LOGIN_TOKEN_EXPIRED', index=17, number=18,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='LOGGED_IN', index=18, number=99,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=11452,
serialized_end=11907,
)
_sym_db.RegisterEnumDescriptor(_LOGINSTATE)
LoginState = enum_type_wrapper.EnumTypeWrapper(_LOGINSTATE)
_ENCRYPTEDDATAKEYTYPE = _descriptor.EnumDescriptor(
name='EncryptedDataKeyType',
full_name='Authentication.EncryptedDataKeyType',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='NO_KEY', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='BY_DEVICE_PUBLIC_KEY', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='BY_PASSWORD', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='BY_ALTERNATE', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='BY_BIO', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=11909,
serialized_end=12016,
)
_sym_db.RegisterEnumDescriptor(_ENCRYPTEDDATAKEYTYPE)
EncryptedDataKeyType = enum_type_wrapper.EnumTypeWrapper(_ENCRYPTEDDATAKEYTYPE)
_PASSWORDMETHOD = _descriptor.EnumDescriptor(
name='PasswordMethod',
full_name='Authentication.PasswordMethod',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='ENTERED', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='BIOMETRICS', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=12018,
serialized_end=12063,
)
_sym_db.RegisterEnumDescriptor(_PASSWORDMETHOD)
PasswordMethod = enum_type_wrapper.EnumTypeWrapper(_PASSWORDMETHOD)
_TWOFACTORPUSHTYPE = _descriptor.EnumDescriptor(
name='TwoFactorPushType',
full_name='Authentication.TwoFactorPushType',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='TWO_FA_PUSH_NONE', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_PUSH_SMS', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_PUSH_KEEPER', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_PUSH_DUO_PUSH', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_PUSH_DUO_TEXT', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_PUSH_DUO_CALL', index=5, number=5,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_PUSH_DNA', index=6, number=6,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=12066,
serialized_end=12251,
)
_sym_db.RegisterEnumDescriptor(_TWOFACTORPUSHTYPE)
TwoFactorPushType = enum_type_wrapper.EnumTypeWrapper(_TWOFACTORPUSHTYPE)
_TWOFACTORVALUETYPE = _descriptor.EnumDescriptor(
name='TwoFactorValueType',
full_name='Authentication.TwoFactorValueType',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='TWO_FA_CODE_NONE', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CODE_TOTP', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CODE_SMS', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CODE_DUO', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CODE_RSA', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_RESP_U2F', index=5, number=5,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_RESP_WEBAUTHN', index=6, number=6,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CODE_DNA', index=7, number=7,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=12254,
serialized_end=12449,
)
_sym_db.RegisterEnumDescriptor(_TWOFACTORVALUETYPE)
TwoFactorValueType = enum_type_wrapper.EnumTypeWrapper(_TWOFACTORVALUETYPE)
_TWOFACTORCHANNELTYPE = _descriptor.EnumDescriptor(
name='TwoFactorChannelType',
full_name='Authentication.TwoFactorChannelType',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='TWO_FA_CT_NONE', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CT_TOTP', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CT_SMS', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CT_DUO', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CT_RSA', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CT_BACKUP', index=5, number=5,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CT_U2F', index=6, number=6,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CT_WEBAUTHN', index=7, number=7,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CT_KEEPER', index=8, number=8,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_CT_DNA', index=9, number=9,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=12452,
serialized_end=12677,
)
_sym_db.RegisterEnumDescriptor(_TWOFACTORCHANNELTYPE)
TwoFactorChannelType = enum_type_wrapper.EnumTypeWrapper(_TWOFACTORCHANNELTYPE)
_TWOFACTOREXPIRATION = _descriptor.EnumDescriptor(
name='TwoFactorExpiration',
full_name='Authentication.TwoFactorExpiration',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='TWO_FA_EXP_IMMEDIATELY', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_EXP_5_MINUTES', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_EXP_12_HOURS', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_EXP_24_HOURS', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_EXP_30_DAYS', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_EXP_NEVER', index=5, number=5,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=12680,
serialized_end=12851,
)
_sym_db.RegisterEnumDescriptor(_TWOFACTOREXPIRATION)
TwoFactorExpiration = enum_type_wrapper.EnumTypeWrapper(_TWOFACTOREXPIRATION)
_LICENSETYPE = _descriptor.EnumDescriptor(
name='LicenseType',
full_name='Authentication.LicenseType',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='VAULT', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='CHAT', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='STORAGE', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='BREACHWATCH', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=12853,
serialized_end=12917,
)
_sym_db.RegisterEnumDescriptor(_LICENSETYPE)
LicenseType = enum_type_wrapper.EnumTypeWrapper(_LICENSETYPE)
_OBJECTTYPES = _descriptor.EnumDescriptor(
name='ObjectTypes',
full_name='Authentication.ObjectTypes',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='RECORD', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='SHARED_FOLDER_USER', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='SHARED_FOLDER_TEAM', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='USER_FOLDER', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TEAM_USER', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=12919,
serialized_end=13024,
)
_sym_db.RegisterEnumDescriptor(_OBJECTTYPES)
ObjectTypes = enum_type_wrapper.EnumTypeWrapper(_OBJECTTYPES)
_ALTERNATEAUTHENTICATIONTYPE = _descriptor.EnumDescriptor(
name='AlternateAuthenticationType',
full_name='Authentication.AlternateAuthenticationType',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='ALTERNATE_MASTER_PASSWORD', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='BIOMETRIC', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ACCOUNT_RECOVER', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=13026,
serialized_end=13122,
)
_sym_db.RegisterEnumDescriptor(_ALTERNATEAUTHENTICATIONTYPE)
AlternateAuthenticationType = enum_type_wrapper.EnumTypeWrapper(_ALTERNATEAUTHENTICATIONTYPE)
_THROTTLETYPE = _descriptor.EnumDescriptor(
name='ThrottleType',
full_name='Authentication.ThrottleType',
filename=None,
file=DESCRIPTOR,
create_key=_descriptor._internal_create_key,
values=[
_descriptor.EnumValueDescriptor(
name='PASSWORD_RETRY_THROTTLE', index=0, number=0,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='PASSWORD_RETRY_LEGACY_THROTTLE', index=1, number=1,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_THROTTLE', index=2, number=2,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='TWO_FA_LEGACY_THROTTLE', index=3, number=3,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='QA_RETRY_THROTTLE', index=4, number=4,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='ACCOUNT_RECOVER_THROTTLE', index=5, number=5,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='VALIDATE_DEVICE_VERIFICATION_CODE_THROTTLE', index=6, number=6,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
_descriptor.EnumValueDescriptor(
name='VALIDATE_CREATE_USER_VERIFICATION_CODE_THROTTLE', index=7, number=7,
serialized_options=None,
type=None,
create_key=_descriptor._internal_create_key),
],
containing_type=None,
serialized_options=None,
serialized_start=13125,
serialized_end=13407,
)
_sym_db.RegisterEnumDescriptor(_THROTTLETYPE)
ThrottleType = enum_type_wrapper.EnumTypeWrapper(_THROTTLETYPE)
ENGLISH = 0
ARABIC = 1
BRITISH = 2
CHINESE = 3
CHINESE_HONG_KONG = 4
CHINESE_TAIWAN = 5
DUTCH = 6
FRENCH = 7
GERMAN = 8
GREEK = 9
HEBREW = 10
ITALIAN = 11
JAPANESE = 12
KOREAN = 13
POLISH = 14
PORTUGUESE = 15
PORTUGUESE_BRAZIL = 16
ROMANIAN = 17
RUSSIAN = 18
SLOVAK = 19
SPANISH = 20
NORMAL = 0
SSO = 1
BIO = 2
ALTERNATE = 3
OFFLINE = 4
DEVICE_NEEDS_APPROVAL = 0
DEVICE_OK = 1
DEVICE_DISABLED_BY_USER = 2
DEVICE_LOCKED_BY_ADMIN = 3
OTHER = 0
ACTIVE = 1
EXPIRED = 2
DISABLED = 3
CONSUMER = 0
FAMILY = 1
ENTERPRISE = 2
NO_RESTRICTION = 0
ACCOUNT_RECOVERY = 1
SHARE_ACCOUNT = 2
PURCHASE = 3
RESTRICT = 4
ACCEPT_INVITE = 5
SUPPORT_SERVER = 6
ENTERPRISE_CREATION = 7
EXPIRED_BUT_ALLOWED_TO_SYNC = 8
invalid_version = 0
default_version = 1
second_version = 2
UNMASK = 0
COPY = 1
INVALID_LOGINMETHOD = 0
EXISTING_ACCOUNT = 1
SSO_DOMAIN = 2
AFTER_SSO = 3
NEW_ACCOUNT = 4
INVALID_LOGINSTATE = 0
LOGGED_OUT = 1
DEVICE_APPROVAL_REQUIRED = 2
DEVICE_LOCKED = 3
ACCOUNT_LOCKED = 4
DEVICE_ACCOUNT_LOCKED = 5
UPGRADE = 6
LICENSE_EXPIRED = 7
REGION_REDIRECT = 8
REDIRECT_CLOUD_SSO = 9
REDIRECT_ONSITE_SSO = 10
REQUIRES_2FA = 12
REQUIRES_AUTH_HASH = 13
REQUIRES_USERNAME = 14
AFTER_CLOUD_SSO_LOGIN = 15
REQUIRES_ACCOUNT_CREATION = 16
REQUIRES_DEVICE_ENCRYPTED_DATA_KEY = 17
LOGIN_TOKEN_EXPIRED = 18
LOGGED_IN = 99
NO_KEY = 0
BY_DEVICE_PUBLIC_KEY = 1
BY_PASSWORD = 2
BY_ALTERNATE = 3
BY_BIO = 4
ENTERED = 0
BIOMETRICS = 1
TWO_FA_PUSH_NONE = 0
TWO_FA_PUSH_SMS = 1
TWO_FA_PUSH_KEEPER = 2
TWO_FA_PUSH_DUO_PUSH = 3
TWO_FA_PUSH_DUO_TEXT = 4
TWO_FA_PUSH_DUO_CALL = 5
TWO_FA_PUSH_DNA = 6
TWO_FA_CODE_NONE = 0
TWO_FA_CODE_TOTP = 1
TWO_FA_CODE_SMS = 2
TWO_FA_CODE_DUO = 3
TWO_FA_CODE_RSA = 4
TWO_FA_RESP_U2F = 5
TWO_FA_RESP_WEBAUTHN = 6
TWO_FA_CODE_DNA = 7
TWO_FA_CT_NONE = 0
TWO_FA_CT_TOTP = 1
TWO_FA_CT_SMS = 2
TWO_FA_CT_DUO = 3
TWO_FA_CT_RSA = 4
TWO_FA_CT_BACKUP = 5
TWO_FA_CT_U2F = 6
TWO_FA_CT_WEBAUTHN = 7
TWO_FA_CT_KEEPER = 8
TWO_FA_CT_DNA = 9
TWO_FA_EXP_IMMEDIATELY = 0
TWO_FA_EXP_5_MINUTES = 1
TWO_FA_EXP_12_HOURS = 2
TWO_FA_EXP_24_HOURS = 3
TWO_FA_EXP_30_DAYS = 4
TWO_FA_EXP_NEVER = 5
VAULT = 0
CHAT = 1
STORAGE = 2
BREACHWATCH = 3
RECORD = 0
SHARED_FOLDER_USER = 1
SHARED_FOLDER_TEAM = 2
USER_FOLDER = 3
TEAM_USER = 4
ALTERNATE_MASTER_PASSWORD = 0
BIOMETRIC = 1
ACCOUNT_RECOVER = 2
PASSWORD_RETRY_THROTTLE = 0
PASSWORD_RETRY_LEGACY_THROTTLE = 1
TWO_FA_THROTTLE = 2
TWO_FA_LEGACY_THROTTLE = 3
QA_RETRY_THROTTLE = 4
ACCOUNT_RECOVER_THROTTLE = 5
VALIDATE_DEVICE_VERIFICATION_CODE_THROTTLE = 6
VALIDATE_CREATE_USER_VERIFICATION_CODE_THROTTLE = 7
_APIREQUEST = _descriptor.Descriptor(
name='ApiRequest',
full_name='Authentication.ApiRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedTransmissionKey', full_name='Authentication.ApiRequest.encryptedTransmissionKey', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='publicKeyId', full_name='Authentication.ApiRequest.publicKeyId', index=1,
number=2, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='locale', full_name='Authentication.ApiRequest.locale', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedPayload', full_name='Authentication.ApiRequest.encryptedPayload', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptionType', full_name='Authentication.ApiRequest.encryptionType', index=4,
number=5, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='recaptcha', full_name='Authentication.ApiRequest.recaptcha', index=5,
number=6, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='subEnvironment', full_name='Authentication.ApiRequest.subEnvironment', index=6,
number=7, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=55,
serialized_end=231,
)
_APIREQUESTPAYLOAD = _descriptor.Descriptor(
name='ApiRequestPayload',
full_name='Authentication.ApiRequestPayload',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='payload', full_name='Authentication.ApiRequestPayload.payload', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedSessionToken', full_name='Authentication.ApiRequestPayload.encryptedSessionToken', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='timeToken', full_name='Authentication.ApiRequestPayload.timeToken', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='apiVersion', full_name='Authentication.ApiRequestPayload.apiVersion', index=3,
number=4, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=233,
serialized_end=339,
)
_TRANSFORM = _descriptor.Descriptor(
name='Transform',
full_name='Authentication.Transform',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='key', full_name='Authentication.Transform.key', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.Transform.encryptedDeviceToken', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=341,
serialized_end=395,
)
_DEVICEREQUEST = _descriptor.Descriptor(
name='DeviceRequest',
full_name='Authentication.DeviceRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.DeviceRequest.clientVersion', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deviceName', full_name='Authentication.DeviceRequest.deviceName', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=397,
serialized_end=455,
)
_AUTHREQUEST = _descriptor.Descriptor(
name='AuthRequest',
full_name='Authentication.AuthRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.AuthRequest.clientVersion', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.AuthRequest.username', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.AuthRequest.encryptedDeviceToken', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=457,
serialized_end=541,
)
_NEWUSERMINIMUMPARAMS = _descriptor.Descriptor(
name='NewUserMinimumParams',
full_name='Authentication.NewUserMinimumParams',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='minimumIterations', full_name='Authentication.NewUserMinimumParams.minimumIterations', index=0,
number=1, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='passwordMatchRegex', full_name='Authentication.NewUserMinimumParams.passwordMatchRegex', index=1,
number=2, type=9, cpp_type=9, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='passwordMatchDescription', full_name='Authentication.NewUserMinimumParams.passwordMatchDescription', index=2,
number=3, type=9, cpp_type=9, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='isEnterpriseDomain', full_name='Authentication.NewUserMinimumParams.isEnterpriseDomain', index=3,
number=4, type=8, cpp_type=7, label=1,
has_default_value=False, default_value=False,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=544,
serialized_end=683,
)
_PRELOGINREQUEST = _descriptor.Descriptor(
name='PreLoginRequest',
full_name='Authentication.PreLoginRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='authRequest', full_name='Authentication.PreLoginRequest.authRequest', index=0,
number=1, type=11, cpp_type=10, label=1,
has_default_value=False, default_value=None,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='loginType', full_name='Authentication.PreLoginRequest.loginType', index=1,
number=2, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='twoFactorToken', full_name='Authentication.PreLoginRequest.twoFactorToken', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=686,
serialized_end=823,
)
_LOGINREQUEST = _descriptor.Descriptor(
name='LoginRequest',
full_name='Authentication.LoginRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='authRequest', full_name='Authentication.LoginRequest.authRequest', index=0,
number=1, type=11, cpp_type=10, label=1,
has_default_value=False, default_value=None,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='loginType', full_name='Authentication.LoginRequest.loginType', index=1,
number=2, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='authenticationHashPrime', full_name='Authentication.LoginRequest.authenticationHashPrime', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedLoginToken', full_name='Authentication.LoginRequest.encryptedLoginToken', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='authResponse', full_name='Authentication.LoginRequest.authResponse', index=4,
number=5, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='mcEnterpriseId', full_name='Authentication.LoginRequest.mcEnterpriseId', index=5,
number=6, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='push_token', full_name='Authentication.LoginRequest.push_token', index=6,
number=7, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='platform', full_name='Authentication.LoginRequest.platform', index=7,
number=8, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=826,
serialized_end=1082,
)
_DEVICERESPONSE = _descriptor.Descriptor(
name='DeviceResponse',
full_name='Authentication.DeviceResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.DeviceResponse.encryptedDeviceToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='status', full_name='Authentication.DeviceResponse.status', index=1,
number=2, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=1084,
serialized_end=1176,
)
_SALT = _descriptor.Descriptor(
name='Salt',
full_name='Authentication.Salt',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='iterations', full_name='Authentication.Salt.iterations', index=0,
number=1, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='salt', full_name='Authentication.Salt.salt', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='algorithm', full_name='Authentication.Salt.algorithm', index=2,
number=3, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='uid', full_name='Authentication.Salt.uid', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='name', full_name='Authentication.Salt.name', index=4,
number=5, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=1178,
serialized_end=1264,
)
_TWOFACTORCHANNEL = _descriptor.Descriptor(
name='TwoFactorChannel',
full_name='Authentication.TwoFactorChannel',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='type', full_name='Authentication.TwoFactorChannel.type', index=0,
number=1, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=1266,
serialized_end=1298,
)
_STARTLOGINREQUEST = _descriptor.Descriptor(
name='StartLoginRequest',
full_name='Authentication.StartLoginRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.StartLoginRequest.encryptedDeviceToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.StartLoginRequest.username', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.StartLoginRequest.clientVersion', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='messageSessionUid', full_name='Authentication.StartLoginRequest.messageSessionUid', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedLoginToken', full_name='Authentication.StartLoginRequest.encryptedLoginToken', index=4,
number=5, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='loginType', full_name='Authentication.StartLoginRequest.loginType', index=5,
number=6, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='mcEnterpriseId', full_name='Authentication.StartLoginRequest.mcEnterpriseId', index=6,
number=7, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='loginMethod', full_name='Authentication.StartLoginRequest.loginMethod', index=7,
number=8, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='forceNewLogin', full_name='Authentication.StartLoginRequest.forceNewLogin', index=8,
number=9, type=8, cpp_type=7, label=1,
has_default_value=False, default_value=False,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='cloneCode', full_name='Authentication.StartLoginRequest.cloneCode', index=9,
number=10, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='v2TwoFactorToken', full_name='Authentication.StartLoginRequest.v2TwoFactorToken', index=10,
number=11, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=1301,
serialized_end=1635,
)
_LOGINRESPONSE = _descriptor.Descriptor(
name='LoginResponse',
full_name='Authentication.LoginResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='loginState', full_name='Authentication.LoginResponse.loginState', index=0,
number=1, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='accountUid', full_name='Authentication.LoginResponse.accountUid', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='primaryUsername', full_name='Authentication.LoginResponse.primaryUsername', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedDataKey', full_name='Authentication.LoginResponse.encryptedDataKey', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedDataKeyType', full_name='Authentication.LoginResponse.encryptedDataKeyType', index=4,
number=5, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedLoginToken', full_name='Authentication.LoginResponse.encryptedLoginToken', index=5,
number=6, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedSessionToken', full_name='Authentication.LoginResponse.encryptedSessionToken', index=6,
number=7, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='sessionTokenType', full_name='Authentication.LoginResponse.sessionTokenType', index=7,
number=8, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='message', full_name='Authentication.LoginResponse.message', index=8,
number=9, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='url', full_name='Authentication.LoginResponse.url', index=9,
number=10, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='channels', full_name='Authentication.LoginResponse.channels', index=10,
number=11, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='salt', full_name='Authentication.LoginResponse.salt', index=11,
number=12, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='cloneCode', full_name='Authentication.LoginResponse.cloneCode', index=12,
number=13, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='stateSpecificValue', full_name='Authentication.LoginResponse.stateSpecificValue', index=13,
number=14, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='ssoClientVersion', full_name='Authentication.LoginResponse.ssoClientVersion', index=14,
number=15, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=1638,
serialized_end=2155,
)
_SSOUSERINFO = _descriptor.Descriptor(
name='SsoUserInfo',
full_name='Authentication.SsoUserInfo',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='companyName', full_name='Authentication.SsoUserInfo.companyName', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='samlRequest', full_name='Authentication.SsoUserInfo.samlRequest', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='samlRequestType', full_name='Authentication.SsoUserInfo.samlRequestType', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='ssoDomainName', full_name='Authentication.SsoUserInfo.ssoDomainName', index=3,
number=4, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='loginUrl', full_name='Authentication.SsoUserInfo.loginUrl', index=4,
number=5, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='logoutUrl', full_name='Authentication.SsoUserInfo.logoutUrl', index=5,
number=6, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=2158,
serialized_end=2298,
)
_PRELOGINRESPONSE = _descriptor.Descriptor(
name='PreLoginResponse',
full_name='Authentication.PreLoginResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='deviceStatus', full_name='Authentication.PreLoginResponse.deviceStatus', index=0,
number=1, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='salt', full_name='Authentication.PreLoginResponse.salt', index=1,
number=2, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='OBSOLETE_FIELD', full_name='Authentication.PreLoginResponse.OBSOLETE_FIELD', index=2,
number=3, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='ssoUserInfo', full_name='Authentication.PreLoginResponse.ssoUserInfo', index=3,
number=4, type=11, cpp_type=10, label=1,
has_default_value=False, default_value=None,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=2301,
serialized_end=2515,
)
_LOGINTOMCREQUEST = _descriptor.Descriptor(
name='LoginToMcRequest',
full_name='Authentication.LoginToMcRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='mcEnterpriseId', full_name='Authentication.LoginToMcRequest.mcEnterpriseId', index=0,
number=1, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=2517,
serialized_end=2559,
)
_LOGINTOMCRESPONSE = _descriptor.Descriptor(
name='LoginToMcResponse',
full_name='Authentication.LoginToMcResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedSessionToken', full_name='Authentication.LoginToMcResponse.encryptedSessionToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedTreeKey', full_name='Authentication.LoginToMcResponse.encryptedTreeKey', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=2561,
serialized_end=2637,
)
_LOGINASUSERREQUEST = _descriptor.Descriptor(
name='LoginAsUserRequest',
full_name='Authentication.LoginAsUserRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.LoginAsUserRequest.username', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=2639,
serialized_end=2677,
)
_LOGINASUSERRESPONSE = _descriptor.Descriptor(
name='LoginAsUserResponse',
full_name='Authentication.LoginAsUserResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedSessionToken', full_name='Authentication.LoginAsUserResponse.encryptedSessionToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedSharedAccountKey', full_name='Authentication.LoginAsUserResponse.encryptedSharedAccountKey', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=2679,
serialized_end=2766,
)
_VALIDATEAUTHHASHREQUEST = _descriptor.Descriptor(
name='ValidateAuthHashRequest',
full_name='Authentication.ValidateAuthHashRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='passwordMethod', full_name='Authentication.ValidateAuthHashRequest.passwordMethod', index=0,
number=1, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='authResponse', full_name='Authentication.ValidateAuthHashRequest.authResponse', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedLoginToken', full_name='Authentication.ValidateAuthHashRequest.encryptedLoginToken', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=2769,
serialized_end=2901,
)
_TWOFACTORCHANNELINFO = _descriptor.Descriptor(
name='TwoFactorChannelInfo',
full_name='Authentication.TwoFactorChannelInfo',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='channelType', full_name='Authentication.TwoFactorChannelInfo.channelType', index=0,
number=1, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='channel_uid', full_name='Authentication.TwoFactorChannelInfo.channel_uid', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='channelName', full_name='Authentication.TwoFactorChannelInfo.channelName', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='challenge', full_name='Authentication.TwoFactorChannelInfo.challenge', index=3,
number=4, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='capabilities', full_name='Authentication.TwoFactorChannelInfo.capabilities', index=4,
number=5, type=9, cpp_type=9, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='phoneNumber', full_name='Authentication.TwoFactorChannelInfo.phoneNumber', index=5,
number=6, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='maxExpiration', full_name='Authentication.TwoFactorChannelInfo.maxExpiration', index=6,
number=7, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=2904,
serialized_end=3149,
)
_TWOFACTORVALIDATEREQUEST = _descriptor.Descriptor(
name='TwoFactorValidateRequest',
full_name='Authentication.TwoFactorValidateRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedLoginToken', full_name='Authentication.TwoFactorValidateRequest.encryptedLoginToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='valueType', full_name='Authentication.TwoFactorValidateRequest.valueType', index=1,
number=2, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='value', full_name='Authentication.TwoFactorValidateRequest.value', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='channel_uid', full_name='Authentication.TwoFactorValidateRequest.channel_uid', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='expireIn', full_name='Authentication.TwoFactorValidateRequest.expireIn', index=4,
number=5, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=3152,
serialized_end=3353,
)
_TWOFACTORVALIDATERESPONSE = _descriptor.Descriptor(
name='TwoFactorValidateResponse',
full_name='Authentication.TwoFactorValidateResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedLoginToken', full_name='Authentication.TwoFactorValidateResponse.encryptedLoginToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=3355,
serialized_end=3411,
)
_TWOFACTORSENDPUSHREQUEST = _descriptor.Descriptor(
name='TwoFactorSendPushRequest',
full_name='Authentication.TwoFactorSendPushRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedLoginToken', full_name='Authentication.TwoFactorSendPushRequest.encryptedLoginToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='pushType', full_name='Authentication.TwoFactorSendPushRequest.pushType', index=1,
number=2, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='channel_uid', full_name='Authentication.TwoFactorSendPushRequest.channel_uid', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='expireIn', full_name='Authentication.TwoFactorSendPushRequest.expireIn', index=3,
number=4, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=3414,
serialized_end=3598,
)
_LICENSE = _descriptor.Descriptor(
name='License',
full_name='Authentication.License',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='created', full_name='Authentication.License.created', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='expiration', full_name='Authentication.License.expiration', index=1,
number=2, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='licenseStatus', full_name='Authentication.License.licenseStatus', index=2,
number=3, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='paid', full_name='Authentication.License.paid', index=3,
number=4, type=8, cpp_type=7, label=1,
has_default_value=False, default_value=False,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='message', full_name='Authentication.License.message', index=4,
number=5, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=3601,
serialized_end=3732,
)
_OWNERLESSRECORD = _descriptor.Descriptor(
name='OwnerlessRecord',
full_name='Authentication.OwnerlessRecord',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='recordUid', full_name='Authentication.OwnerlessRecord.recordUid', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='recordKey', full_name='Authentication.OwnerlessRecord.recordKey', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='status', full_name='Authentication.OwnerlessRecord.status', index=2,
number=3, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=3734,
serialized_end=3805,
)
_OWNERLESSRECORDS = _descriptor.Descriptor(
name='OwnerlessRecords',
full_name='Authentication.OwnerlessRecords',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='ownerlessRecord', full_name='Authentication.OwnerlessRecords.ownerlessRecord', index=0,
number=1, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=3807,
serialized_end=3883,
)
_USERAUTHREQUEST = _descriptor.Descriptor(
name='UserAuthRequest',
full_name='Authentication.UserAuthRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='uid', full_name='Authentication.UserAuthRequest.uid', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='salt', full_name='Authentication.UserAuthRequest.salt', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='iterations', full_name='Authentication.UserAuthRequest.iterations', index=2,
number=3, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedClientKey', full_name='Authentication.UserAuthRequest.encryptedClientKey', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='authHash', full_name='Authentication.UserAuthRequest.authHash', index=4,
number=5, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedDataKey', full_name='Authentication.UserAuthRequest.encryptedDataKey', index=5,
number=6, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='loginType', full_name='Authentication.UserAuthRequest.loginType', index=6,
number=7, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='name', full_name='Authentication.UserAuthRequest.name', index=7,
number=8, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='algorithm', full_name='Authentication.UserAuthRequest.algorithm', index=8,
number=9, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=3886,
serialized_end=4101,
)
_UIDREQUEST = _descriptor.Descriptor(
name='UidRequest',
full_name='Authentication.UidRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='uid', full_name='Authentication.UidRequest.uid', index=0,
number=1, type=12, cpp_type=9, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=4103,
serialized_end=4128,
)
_DEVICEUPDATEREQUEST = _descriptor.Descriptor(
name='DeviceUpdateRequest',
full_name='Authentication.DeviceUpdateRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.DeviceUpdateRequest.encryptedDeviceToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.DeviceUpdateRequest.clientVersion', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deviceName', full_name='Authentication.DeviceUpdateRequest.deviceName', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='devicePublicKey', full_name='Authentication.DeviceUpdateRequest.devicePublicKey', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deviceStatus', full_name='Authentication.DeviceUpdateRequest.deviceStatus', index=4,
number=5, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=4131,
serialized_end=4302,
)
_REGISTERDEVICEINREGIONREQUEST = _descriptor.Descriptor(
name='RegisterDeviceInRegionRequest',
full_name='Authentication.RegisterDeviceInRegionRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.RegisterDeviceInRegionRequest.encryptedDeviceToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.RegisterDeviceInRegionRequest.clientVersion', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deviceName', full_name='Authentication.RegisterDeviceInRegionRequest.deviceName', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='devicePublicKey', full_name='Authentication.RegisterDeviceInRegionRequest.devicePublicKey', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=4305,
serialized_end=4434,
)
_REGISTRATIONREQUEST = _descriptor.Descriptor(
name='RegistrationRequest',
full_name='Authentication.RegistrationRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='authRequest', full_name='Authentication.RegistrationRequest.authRequest', index=0,
number=1, type=11, cpp_type=10, label=1,
has_default_value=False, default_value=None,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='userAuthRequest', full_name='Authentication.RegistrationRequest.userAuthRequest', index=1,
number=2, type=11, cpp_type=10, label=1,
has_default_value=False, default_value=None,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedClientKey', full_name='Authentication.RegistrationRequest.encryptedClientKey', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedPrivateKey', full_name='Authentication.RegistrationRequest.encryptedPrivateKey', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='publicKey', full_name='Authentication.RegistrationRequest.publicKey', index=4,
number=5, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='verificationCode', full_name='Authentication.RegistrationRequest.verificationCode', index=5,
number=6, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deprecatedAuthHashHash', full_name='Authentication.RegistrationRequest.deprecatedAuthHashHash', index=6,
number=7, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deprecatedEncryptedClientKey', full_name='Authentication.RegistrationRequest.deprecatedEncryptedClientKey', index=7,
number=8, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deprecatedEncryptedPrivateKey', full_name='Authentication.RegistrationRequest.deprecatedEncryptedPrivateKey', index=8,
number=9, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deprecatedEncryptionParams', full_name='Authentication.RegistrationRequest.deprecatedEncryptionParams', index=9,
number=10, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=4437,
serialized_end=4813,
)
_CONVERTUSERTOV3REQUEST = _descriptor.Descriptor(
name='ConvertUserToV3Request',
full_name='Authentication.ConvertUserToV3Request',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='authRequest', full_name='Authentication.ConvertUserToV3Request.authRequest', index=0,
number=1, type=11, cpp_type=10, label=1,
has_default_value=False, default_value=None,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='userAuthRequest', full_name='Authentication.ConvertUserToV3Request.userAuthRequest', index=1,
number=2, type=11, cpp_type=10, label=1,
has_default_value=False, default_value=None,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedClientKey', full_name='Authentication.ConvertUserToV3Request.encryptedClientKey', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedPrivateKey', full_name='Authentication.ConvertUserToV3Request.encryptedPrivateKey', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='publicKey', full_name='Authentication.ConvertUserToV3Request.publicKey', index=4,
number=5, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=4816,
serialized_end=5024,
)
_REVISIONRESPONSE = _descriptor.Descriptor(
name='RevisionResponse',
full_name='Authentication.RevisionResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='revision', full_name='Authentication.RevisionResponse.revision', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=5026,
serialized_end=5062,
)
_CHANGEEMAILREQUEST = _descriptor.Descriptor(
name='ChangeEmailRequest',
full_name='Authentication.ChangeEmailRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='newEmail', full_name='Authentication.ChangeEmailRequest.newEmail', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=5064,
serialized_end=5102,
)
_CHANGEEMAILRESPONSE = _descriptor.Descriptor(
name='ChangeEmailResponse',
full_name='Authentication.ChangeEmailResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedChangeEmailToken', full_name='Authentication.ChangeEmailResponse.encryptedChangeEmailToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=5104,
serialized_end=5160,
)
_EMAILVERIFICATIONLINKRESPONSE = _descriptor.Descriptor(
name='EmailVerificationLinkResponse',
full_name='Authentication.EmailVerificationLinkResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='emailVerified', full_name='Authentication.EmailVerificationLinkResponse.emailVerified', index=0,
number=1, type=8, cpp_type=7, label=1,
has_default_value=False, default_value=False,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=5162,
serialized_end=5216,
)
_SECURITYDATA = _descriptor.Descriptor(
name='SecurityData',
full_name='Authentication.SecurityData',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='uid', full_name='Authentication.SecurityData.uid', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='data', full_name='Authentication.SecurityData.data', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=5218,
serialized_end=5259,
)
_SECURITYDATAREQUEST = _descriptor.Descriptor(
name='SecurityDataRequest',
full_name='Authentication.SecurityDataRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='recordSecurityData', full_name='Authentication.SecurityDataRequest.recordSecurityData', index=0,
number=1, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='masterPasswordSecurityData', full_name='Authentication.SecurityDataRequest.masterPasswordSecurityData', index=1,
number=2, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=5262,
serialized_end=5407,
)
_SECURITYREPORTINCREMENTALDATA = _descriptor.Descriptor(
name='SecurityReportIncrementalData',
full_name='Authentication.SecurityReportIncrementalData',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='enterpriseUserId', full_name='Authentication.SecurityReportIncrementalData.enterpriseUserId', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='currentSecurityData', full_name='Authentication.SecurityReportIncrementalData.currentSecurityData', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='currentSecurityDataRevision', full_name='Authentication.SecurityReportIncrementalData.currentSecurityDataRevision', index=2,
number=3, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='oldSecurityData', full_name='Authentication.SecurityReportIncrementalData.oldSecurityData', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='oldSecurityDataRevision', full_name='Authentication.SecurityReportIncrementalData.oldSecurityDataRevision', index=4,
number=5, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=5410,
serialized_end=5591,
)
_SECURITYREPORT = _descriptor.Descriptor(
name='SecurityReport',
full_name='Authentication.SecurityReport',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='enterpriseUserId', full_name='Authentication.SecurityReport.enterpriseUserId', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedReportData', full_name='Authentication.SecurityReport.encryptedReportData', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='revision', full_name='Authentication.SecurityReport.revision', index=2,
number=3, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='twoFactor', full_name='Authentication.SecurityReport.twoFactor', index=3,
number=4, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='lastLogin', full_name='Authentication.SecurityReport.lastLogin', index=4,
number=5, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='numberOfReusedPassword', full_name='Authentication.SecurityReport.numberOfReusedPassword', index=5,
number=6, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='securityReportIncrementalData', full_name='Authentication.SecurityReport.securityReportIncrementalData', index=6,
number=7, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=5594,
serialized_end=5839,
)
_SECURITYREPORTSAVEREQUEST = _descriptor.Descriptor(
name='SecurityReportSaveRequest',
full_name='Authentication.SecurityReportSaveRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='securityReport', full_name='Authentication.SecurityReportSaveRequest.securityReport', index=0,
number=1, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=5841,
serialized_end=5924,
)
_SECURITYREPORTREQUEST = _descriptor.Descriptor(
name='SecurityReportRequest',
full_name='Authentication.SecurityReportRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='fromPage', full_name='Authentication.SecurityReportRequest.fromPage', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=5926,
serialized_end=5967,
)
_SECURITYREPORTRESPONSE = _descriptor.Descriptor(
name='SecurityReportResponse',
full_name='Authentication.SecurityReportResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='enterprisePrivateKey', full_name='Authentication.SecurityReportResponse.enterprisePrivateKey', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='securityReport', full_name='Authentication.SecurityReportResponse.securityReport', index=1,
number=2, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='asOfRevision', full_name='Authentication.SecurityReportResponse.asOfRevision', index=2,
number=3, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='fromPage', full_name='Authentication.SecurityReportResponse.fromPage', index=3,
number=4, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='toPage', full_name='Authentication.SecurityReportResponse.toPage', index=4,
number=5, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='complete', full_name='Authentication.SecurityReportResponse.complete', index=5,
number=6, type=8, cpp_type=7, label=1,
has_default_value=False, default_value=False,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=5970,
serialized_end=6154,
)
_REUSEDPASSWORDSREQUEST = _descriptor.Descriptor(
name='ReusedPasswordsRequest',
full_name='Authentication.ReusedPasswordsRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='count', full_name='Authentication.ReusedPasswordsRequest.count', index=0,
number=1, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=6156,
serialized_end=6195,
)
_SUMMARYCONSOLEREPORT = _descriptor.Descriptor(
name='SummaryConsoleReport',
full_name='Authentication.SummaryConsoleReport',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='reportType', full_name='Authentication.SummaryConsoleReport.reportType', index=0,
number=1, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='reportData', full_name='Authentication.SummaryConsoleReport.reportData', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=6197,
serialized_end=6259,
)
_CHANGETOKEYTYPEONE = _descriptor.Descriptor(
name='ChangeToKeyTypeOne',
full_name='Authentication.ChangeToKeyTypeOne',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='objectType', full_name='Authentication.ChangeToKeyTypeOne.objectType', index=0,
number=1, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='primaryUid', full_name='Authentication.ChangeToKeyTypeOne.primaryUid', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='secondaryUid', full_name='Authentication.ChangeToKeyTypeOne.secondaryUid', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='key', full_name='Authentication.ChangeToKeyTypeOne.key', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=6261,
serialized_end=6385,
)
_CHANGETOKEYTYPEONEREQUEST = _descriptor.Descriptor(
name='ChangeToKeyTypeOneRequest',
full_name='Authentication.ChangeToKeyTypeOneRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='changeToKeyTypeOne', full_name='Authentication.ChangeToKeyTypeOneRequest.changeToKeyTypeOne', index=0,
number=1, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=6387,
serialized_end=6478,
)
_CHANGETOKEYTYPEONESTATUS = _descriptor.Descriptor(
name='ChangeToKeyTypeOneStatus',
full_name='Authentication.ChangeToKeyTypeOneStatus',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='uid', full_name='Authentication.ChangeToKeyTypeOneStatus.uid', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='type', full_name='Authentication.ChangeToKeyTypeOneStatus.type', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='status', full_name='Authentication.ChangeToKeyTypeOneStatus.status', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='reason', full_name='Authentication.ChangeToKeyTypeOneStatus.reason', index=3,
number=4, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=6480,
serialized_end=6565,
)
_CHANGETOKEYTYPEONERESPONSE = _descriptor.Descriptor(
name='ChangeToKeyTypeOneResponse',
full_name='Authentication.ChangeToKeyTypeOneResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='changeToKeyTypeOneStatus', full_name='Authentication.ChangeToKeyTypeOneResponse.changeToKeyTypeOneStatus', index=0,
number=1, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=6567,
serialized_end=6671,
)
_SETKEY = _descriptor.Descriptor(
name='SetKey',
full_name='Authentication.SetKey',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='id', full_name='Authentication.SetKey.id', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='key', full_name='Authentication.SetKey.key', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=6673,
serialized_end=6706,
)
_SETKEYREQUEST = _descriptor.Descriptor(
name='SetKeyRequest',
full_name='Authentication.SetKeyRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='keys', full_name='Authentication.SetKeyRequest.keys', index=0,
number=1, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=6708,
serialized_end=6761,
)
_CREATEUSERREQUEST = _descriptor.Descriptor(
name='CreateUserRequest',
full_name='Authentication.CreateUserRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.CreateUserRequest.username', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='authVerifier', full_name='Authentication.CreateUserRequest.authVerifier', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptionParams', full_name='Authentication.CreateUserRequest.encryptionParams', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='rsaPublicKey', full_name='Authentication.CreateUserRequest.rsaPublicKey', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='rsaEncryptedPrivateKey', full_name='Authentication.CreateUserRequest.rsaEncryptedPrivateKey', index=4,
number=5, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='eccPublicKey', full_name='Authentication.CreateUserRequest.eccPublicKey', index=5,
number=6, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='eccEncryptedPrivateKey', full_name='Authentication.CreateUserRequest.eccEncryptedPrivateKey', index=6,
number=7, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.CreateUserRequest.encryptedDeviceToken', index=7,
number=8, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedClientKey', full_name='Authentication.CreateUserRequest.encryptedClientKey', index=8,
number=9, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.CreateUserRequest.clientVersion', index=9,
number=10, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedDeviceDataKey', full_name='Authentication.CreateUserRequest.encryptedDeviceDataKey', index=10,
number=11, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedLoginToken', full_name='Authentication.CreateUserRequest.encryptedLoginToken', index=11,
number=12, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='messageSessionUid', full_name='Authentication.CreateUserRequest.messageSessionUid', index=12,
number=13, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='installReferrer', full_name='Authentication.CreateUserRequest.installReferrer', index=13,
number=14, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='mccMNC', full_name='Authentication.CreateUserRequest.mccMNC', index=14,
number=15, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='mfg', full_name='Authentication.CreateUserRequest.mfg', index=15,
number=16, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='model', full_name='Authentication.CreateUserRequest.model', index=16,
number=17, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='brand', full_name='Authentication.CreateUserRequest.brand', index=17,
number=18, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='product', full_name='Authentication.CreateUserRequest.product', index=18,
number=19, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='device', full_name='Authentication.CreateUserRequest.device', index=19,
number=20, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='carrier', full_name='Authentication.CreateUserRequest.carrier', index=20,
number=21, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='verificationCode', full_name='Authentication.CreateUserRequest.verificationCode', index=21,
number=22, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='enterpriseRegistration', full_name='Authentication.CreateUserRequest.enterpriseRegistration', index=22,
number=23, type=11, cpp_type=10, label=1,
has_default_value=False, default_value=None,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=6764,
serialized_end=7354,
)
_NODEENFORCEMENTADDORUPDATEREQUEST = _descriptor.Descriptor(
name='NodeEnforcementAddOrUpdateRequest',
full_name='Authentication.NodeEnforcementAddOrUpdateRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='nodeId', full_name='Authentication.NodeEnforcementAddOrUpdateRequest.nodeId', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='enforcement', full_name='Authentication.NodeEnforcementAddOrUpdateRequest.enforcement', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='value', full_name='Authentication.NodeEnforcementAddOrUpdateRequest.value', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=7356,
serialized_end=7443,
)
_NODEENFORCEMENTREMOVEREQUEST = _descriptor.Descriptor(
name='NodeEnforcementRemoveRequest',
full_name='Authentication.NodeEnforcementRemoveRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='nodeId', full_name='Authentication.NodeEnforcementRemoveRequest.nodeId', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='enforcement', full_name='Authentication.NodeEnforcementRemoveRequest.enforcement', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=7445,
serialized_end=7512,
)
_USERACCOUNTS = _descriptor.Descriptor(
name='UserAccounts',
full_name='Authentication.UserAccounts',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='accountUid', full_name='Authentication.UserAccounts.accountUid', index=0,
number=1, type=12, cpp_type=9, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=7514,
serialized_end=7548,
)
_APIREQUESTBYKEY = _descriptor.Descriptor(
name='ApiRequestByKey',
full_name='Authentication.ApiRequestByKey',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='keyId', full_name='Authentication.ApiRequestByKey.keyId', index=0,
number=1, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='payload', full_name='Authentication.ApiRequestByKey.payload', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.ApiRequestByKey.username', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='locale', full_name='Authentication.ApiRequestByKey.locale', index=3,
number=4, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='supportedLanguage', full_name='Authentication.ApiRequestByKey.supportedLanguage', index=4,
number=5, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='type', full_name='Authentication.ApiRequestByKey.type', index=5,
number=6, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=7551,
serialized_end=7710,
)
_MEMCACHEREQUEST = _descriptor.Descriptor(
name='MemcacheRequest',
full_name='Authentication.MemcacheRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='key', full_name='Authentication.MemcacheRequest.key', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='userId', full_name='Authentication.MemcacheRequest.userId', index=1,
number=2, type=5, cpp_type=1, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=7712,
serialized_end=7758,
)
_MEMCACHERESPONSE = _descriptor.Descriptor(
name='MemcacheResponse',
full_name='Authentication.MemcacheResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='key', full_name='Authentication.MemcacheResponse.key', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='value', full_name='Authentication.MemcacheResponse.value', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=7760,
serialized_end=7806,
)
_MASTERPASSWORDREENTRYREQUEST = _descriptor.Descriptor(
name='MasterPasswordReentryRequest',
full_name='Authentication.MasterPasswordReentryRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='pbkdf2Password', full_name='Authentication.MasterPasswordReentryRequest.pbkdf2Password', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='action', full_name='Authentication.MasterPasswordReentryRequest.action', index=1,
number=2, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=7808,
serialized_end=7927,
)
_DEVICEREGISTRATIONREQUEST = _descriptor.Descriptor(
name='DeviceRegistrationRequest',
full_name='Authentication.DeviceRegistrationRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.DeviceRegistrationRequest.clientVersion', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deviceName', full_name='Authentication.DeviceRegistrationRequest.deviceName', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='devicePublicKey', full_name='Authentication.DeviceRegistrationRequest.devicePublicKey', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=7929,
serialized_end=8024,
)
_DEVICEVERIFICATIONREQUEST = _descriptor.Descriptor(
name='DeviceVerificationRequest',
full_name='Authentication.DeviceVerificationRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.DeviceVerificationRequest.encryptedDeviceToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.DeviceVerificationRequest.username', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='verificationChannel', full_name='Authentication.DeviceVerificationRequest.verificationChannel', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='messageSessionUid', full_name='Authentication.DeviceVerificationRequest.messageSessionUid', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.DeviceVerificationRequest.clientVersion', index=4,
number=5, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=8027,
serialized_end=8181,
)
_DEVICEVERIFICATIONRESPONSE = _descriptor.Descriptor(
name='DeviceVerificationResponse',
full_name='Authentication.DeviceVerificationResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.DeviceVerificationResponse.encryptedDeviceToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.DeviceVerificationResponse.username', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='messageSessionUid', full_name='Authentication.DeviceVerificationResponse.messageSessionUid', index=2,
number=3, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.DeviceVerificationResponse.clientVersion', index=3,
number=4, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deviceStatus', full_name='Authentication.DeviceVerificationResponse.deviceStatus', index=4,
number=5, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=8184,
serialized_end=8362,
)
_DEVICEAPPROVALREQUEST = _descriptor.Descriptor(
name='DeviceApprovalRequest',
full_name='Authentication.DeviceApprovalRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='email', full_name='Authentication.DeviceApprovalRequest.email', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='twoFactorChannel', full_name='Authentication.DeviceApprovalRequest.twoFactorChannel', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.DeviceApprovalRequest.clientVersion', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='locale', full_name='Authentication.DeviceApprovalRequest.locale', index=3,
number=4, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.DeviceApprovalRequest.encryptedDeviceToken', index=4,
number=5, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='totpCode', full_name='Authentication.DeviceApprovalRequest.totpCode', index=5,
number=6, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deviceIp', full_name='Authentication.DeviceApprovalRequest.deviceIp', index=6,
number=7, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deviceTokenExpireDays', full_name='Authentication.DeviceApprovalRequest.deviceTokenExpireDays', index=7,
number=8, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=8365,
serialized_end=8565,
)
_DEVICEAPPROVALRESPONSE = _descriptor.Descriptor(
name='DeviceApprovalResponse',
full_name='Authentication.DeviceApprovalResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedTwoFactorToken', full_name='Authentication.DeviceApprovalResponse.encryptedTwoFactorToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=8567,
serialized_end=8624,
)
_APPROVEDEVICEREQUEST = _descriptor.Descriptor(
name='ApproveDeviceRequest',
full_name='Authentication.ApproveDeviceRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.ApproveDeviceRequest.encryptedDeviceToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedDeviceDataKey', full_name='Authentication.ApproveDeviceRequest.encryptedDeviceDataKey', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='denyApproval', full_name='Authentication.ApproveDeviceRequest.denyApproval', index=2,
number=3, type=8, cpp_type=7, label=1,
has_default_value=False, default_value=False,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='linkDevice', full_name='Authentication.ApproveDeviceRequest.linkDevice', index=3,
number=4, type=8, cpp_type=7, label=1,
has_default_value=False, default_value=False,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=8626,
serialized_end=8752,
)
_ENTERPRISEUSERALIASREQUEST = _descriptor.Descriptor(
name='EnterpriseUserAliasRequest',
full_name='Authentication.EnterpriseUserAliasRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='enterpriseUserId', full_name='Authentication.EnterpriseUserAliasRequest.enterpriseUserId', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='alias', full_name='Authentication.EnterpriseUserAliasRequest.alias', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=8754,
serialized_end=8823,
)
_DEVICE = _descriptor.Descriptor(
name='Device',
full_name='Authentication.Device',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.Device.encryptedDeviceToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=8825,
serialized_end=8863,
)
_REGISTERDEVICEDATAKEYREQUEST = _descriptor.Descriptor(
name='RegisterDeviceDataKeyRequest',
full_name='Authentication.RegisterDeviceDataKeyRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='encryptedDeviceToken', full_name='Authentication.RegisterDeviceDataKeyRequest.encryptedDeviceToken', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedDeviceDataKey', full_name='Authentication.RegisterDeviceDataKeyRequest.encryptedDeviceDataKey', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=8865,
serialized_end=8957,
)
_VALIDATECREATEUSERVERIFICATIONCODEREQUEST = _descriptor.Descriptor(
name='ValidateCreateUserVerificationCodeRequest',
full_name='Authentication.ValidateCreateUserVerificationCodeRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.ValidateCreateUserVerificationCodeRequest.username', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.ValidateCreateUserVerificationCodeRequest.clientVersion', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='verificationCode', full_name='Authentication.ValidateCreateUserVerificationCodeRequest.verificationCode', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=8959,
serialized_end=9069,
)
_VALIDATEDEVICEVERIFICATIONCODEREQUEST = _descriptor.Descriptor(
name='ValidateDeviceVerificationCodeRequest',
full_name='Authentication.ValidateDeviceVerificationCodeRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.ValidateDeviceVerificationCodeRequest.username', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.ValidateDeviceVerificationCodeRequest.clientVersion', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='verificationCode', full_name='Authentication.ValidateDeviceVerificationCodeRequest.verificationCode', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='messageSessionUid', full_name='Authentication.ValidateDeviceVerificationCodeRequest.messageSessionUid', index=3,
number=4, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=9072,
serialized_end=9205,
)
_SENDSESSIONMESSAGEREQUEST = _descriptor.Descriptor(
name='SendSessionMessageRequest',
full_name='Authentication.SendSessionMessageRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='messageSessionUid', full_name='Authentication.SendSessionMessageRequest.messageSessionUid', index=0,
number=1, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='command', full_name='Authentication.SendSessionMessageRequest.command', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.SendSessionMessageRequest.username', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=9207,
serialized_end=9296,
)
_GLOBALUSERACCOUNT = _descriptor.Descriptor(
name='GlobalUserAccount',
full_name='Authentication.GlobalUserAccount',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.GlobalUserAccount.username', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='accountUid', full_name='Authentication.GlobalUserAccount.accountUid', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='regionName', full_name='Authentication.GlobalUserAccount.regionName', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=9298,
serialized_end=9375,
)
_ACCOUNTUSERNAME = _descriptor.Descriptor(
name='AccountUsername',
full_name='Authentication.AccountUsername',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='username', full_name='Authentication.AccountUsername.username', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='dateActive', full_name='Authentication.AccountUsername.dateActive', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=9377,
serialized_end=9432,
)
_SSOSERVICEPROVIDERREQUEST = _descriptor.Descriptor(
name='SsoServiceProviderRequest',
full_name='Authentication.SsoServiceProviderRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='name', full_name='Authentication.SsoServiceProviderRequest.name', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.SsoServiceProviderRequest.clientVersion', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='locale', full_name='Authentication.SsoServiceProviderRequest.locale', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=9434,
serialized_end=9514,
)
_SSOSERVICEPROVIDERRESPONSE = _descriptor.Descriptor(
name='SsoServiceProviderResponse',
full_name='Authentication.SsoServiceProviderResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='name', full_name='Authentication.SsoServiceProviderResponse.name', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='spUrl', full_name='Authentication.SsoServiceProviderResponse.spUrl', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='isCloud', full_name='Authentication.SsoServiceProviderResponse.isCloud', index=2,
number=3, type=8, cpp_type=7, label=1,
has_default_value=False, default_value=False,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.SsoServiceProviderResponse.clientVersion', index=3,
number=4, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=9516,
serialized_end=9613,
)
_USERSETTINGREQUEST = _descriptor.Descriptor(
name='UserSettingRequest',
full_name='Authentication.UserSettingRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='setting', full_name='Authentication.UserSettingRequest.setting', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='value', full_name='Authentication.UserSettingRequest.value', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=9615,
serialized_end=9667,
)
_THROTTLESTATE = _descriptor.Descriptor(
name='ThrottleState',
full_name='Authentication.ThrottleState',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='type', full_name='Authentication.ThrottleState.type', index=0,
number=1, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='key', full_name='Authentication.ThrottleState.key', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='value', full_name='Authentication.ThrottleState.value', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='state', full_name='Authentication.ThrottleState.state', index=3,
number=4, type=8, cpp_type=7, label=1,
has_default_value=False, default_value=False,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=9669,
serialized_end=9771,
)
_DEVICEINFORMATION = _descriptor.Descriptor(
name='DeviceInformation',
full_name='Authentication.DeviceInformation',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='deviceId', full_name='Authentication.DeviceInformation.deviceId', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deviceName', full_name='Authentication.DeviceInformation.deviceName', index=1,
number=2, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='clientVersion', full_name='Authentication.DeviceInformation.clientVersion', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='lastLogin', full_name='Authentication.DeviceInformation.lastLogin', index=3,
number=4, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='deviceStatus', full_name='Authentication.DeviceInformation.deviceStatus', index=4,
number=5, type=14, cpp_type=8, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=9774,
serialized_end=9925,
)
_USERSETTING = _descriptor.Descriptor(
name='UserSetting',
full_name='Authentication.UserSetting',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='name', full_name='Authentication.UserSetting.name', index=0,
number=1, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='value', full_name='Authentication.UserSetting.value', index=1,
number=2, type=8, cpp_type=7, label=1,
has_default_value=False, default_value=False,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=9927,
serialized_end=9969,
)
_USERDATAKEYREQUEST = _descriptor.Descriptor(
name='UserDataKeyRequest',
full_name='Authentication.UserDataKeyRequest',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='enterpriseUserId', full_name='Authentication.UserDataKeyRequest.enterpriseUserId', index=0,
number=1, type=3, cpp_type=2, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=9971,
serialized_end=10017,
)
_ENTERPRISEUSERIDDATAKEYPAIR = _descriptor.Descriptor(
name='EnterpriseUserIdDataKeyPair',
full_name='Authentication.EnterpriseUserIdDataKeyPair',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='enterpriseUserId', full_name='Authentication.EnterpriseUserIdDataKeyPair.enterpriseUserId', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='encryptedDataKey', full_name='Authentication.EnterpriseUserIdDataKeyPair.encryptedDataKey', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=10019,
serialized_end=10100,
)
_USERDATAKEY = _descriptor.Descriptor(
name='UserDataKey',
full_name='Authentication.UserDataKey',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='roleId', full_name='Authentication.UserDataKey.roleId', index=0,
number=1, type=3, cpp_type=2, label=1,
has_default_value=False, default_value=0,
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='roleKey', full_name='Authentication.UserDataKey.roleKey', index=1,
number=2, type=12, cpp_type=9, label=1,
has_default_value=False, default_value=b"",
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='privateKey', full_name='Authentication.UserDataKey.privateKey', index=2,
number=3, type=9, cpp_type=9, label=1,
has_default_value=False, default_value=b"".decode('utf-8'),
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='enterpriseUserIdDataKeyPairs', full_name='Authentication.UserDataKey.enterpriseUserIdDataKeyPairs', index=3,
number=4, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=10103,
serialized_end=10252,
)
_USERDATAKEYRESPONSE = _descriptor.Descriptor(
name='UserDataKeyResponse',
full_name='Authentication.UserDataKeyResponse',
filename=None,
file=DESCRIPTOR,
containing_type=None,
create_key=_descriptor._internal_create_key,
fields=[
_descriptor.FieldDescriptor(
name='userDataKeys', full_name='Authentication.UserDataKeyResponse.userDataKeys', index=0,
number=1, type=11, cpp_type=10, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='accessDenied', full_name='Authentication.UserDataKeyResponse.accessDenied', index=1,
number=2, type=3, cpp_type=2, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
_descriptor.FieldDescriptor(
name='noEncryptedDataKey', full_name='Authentication.UserDataKeyResponse.noEncryptedDataKey', index=2,
number=3, type=3, cpp_type=2, label=3,
has_default_value=False, default_value=[],
message_type=None, enum_type=None, containing_type=None,
is_extension=False, extension_scope=None,
serialized_options=None, file=DESCRIPTOR, create_key=_descriptor._internal_create_key),
],
extensions=[
],
nested_types=[],
enum_types=[
],
serialized_options=None,
is_extendable=False,
syntax='proto3',
extension_ranges=[],
oneofs=[
],
serialized_start=10254,
serialized_end=10376,
)
_PRELOGINREQUEST.fields_by_name['authRequest'].message_type = _AUTHREQUEST
_PRELOGINREQUEST.fields_by_name['loginType'].enum_type = _LOGINTYPE
_LOGINREQUEST.fields_by_name['authRequest'].message_type = _AUTHREQUEST
_LOGINREQUEST.fields_by_name['loginType'].enum_type = _LOGINTYPE
_DEVICERESPONSE.fields_by_name['status'].enum_type = _DEVICESTATUS
_STARTLOGINREQUEST.fields_by_name['loginType'].enum_type = _LOGINTYPE
_STARTLOGINREQUEST.fields_by_name['loginMethod'].enum_type = _LOGINMETHOD
_LOGINRESPONSE.fields_by_name['loginState'].enum_type = _LOGINSTATE
_LOGINRESPONSE.fields_by_name['encryptedDataKeyType'].enum_type = _ENCRYPTEDDATAKEYTYPE
_LOGINRESPONSE.fields_by_name['sessionTokenType'].enum_type = _SESSIONTOKENTYPE
_LOGINRESPONSE.fields_by_name['channels'].message_type = _TWOFACTORCHANNELINFO
_LOGINRESPONSE.fields_by_name['salt'].message_type = _SALT
_PRELOGINRESPONSE.fields_by_name['deviceStatus'].enum_type = _DEVICESTATUS
_PRELOGINRESPONSE.fields_by_name['salt'].message_type = _SALT
_PRELOGINRESPONSE.fields_by_name['OBSOLETE_FIELD'].message_type = _TWOFACTORCHANNEL
_PRELOGINRESPONSE.fields_by_name['ssoUserInfo'].message_type = _SSOUSERINFO
_VALIDATEAUTHHASHREQUEST.fields_by_name['passwordMethod'].enum_type = _PASSWORDMETHOD
_TWOFACTORCHANNELINFO.fields_by_name['channelType'].enum_type = _TWOFACTORCHANNELTYPE
_TWOFACTORCHANNELINFO.fields_by_name['maxExpiration'].enum_type = _TWOFACTOREXPIRATION
_TWOFACTORVALIDATEREQUEST.fields_by_name['valueType'].enum_type = _TWOFACTORVALUETYPE
_TWOFACTORVALIDATEREQUEST.fields_by_name['expireIn'].enum_type = _TWOFACTOREXPIRATION
_TWOFACTORSENDPUSHREQUEST.fields_by_name['pushType'].enum_type = _TWOFACTORPUSHTYPE
_TWOFACTORSENDPUSHREQUEST.fields_by_name['expireIn'].enum_type = _TWOFACTOREXPIRATION
_LICENSE.fields_by_name['licenseStatus'].enum_type = _LICENSESTATUS
_OWNERLESSRECORDS.fields_by_name['ownerlessRecord'].message_type = _OWNERLESSRECORD
_USERAUTHREQUEST.fields_by_name['loginType'].enum_type = _LOGINTYPE
_DEVICEUPDATEREQUEST.fields_by_name['deviceStatus'].enum_type = _DEVICESTATUS
_REGISTRATIONREQUEST.fields_by_name['authRequest'].message_type = _AUTHREQUEST
_REGISTRATIONREQUEST.fields_by_name['userAuthRequest'].message_type = _USERAUTHREQUEST
_CONVERTUSERTOV3REQUEST.fields_by_name['authRequest'].message_type = _AUTHREQUEST
_CONVERTUSERTOV3REQUEST.fields_by_name['userAuthRequest'].message_type = _USERAUTHREQUEST
_SECURITYDATAREQUEST.fields_by_name['recordSecurityData'].message_type = _SECURITYDATA
_SECURITYDATAREQUEST.fields_by_name['masterPasswordSecurityData'].message_type = _SECURITYDATA
_SECURITYREPORT.fields_by_name['securityReportIncrementalData'].message_type = _SECURITYREPORTINCREMENTALDATA
_SECURITYREPORTSAVEREQUEST.fields_by_name['securityReport'].message_type = _SECURITYREPORT
_SECURITYREPORTRESPONSE.fields_by_name['securityReport'].message_type = _SECURITYREPORT
_CHANGETOKEYTYPEONE.fields_by_name['objectType'].enum_type = _OBJECTTYPES
_CHANGETOKEYTYPEONEREQUEST.fields_by_name['changeToKeyTypeOne'].message_type = _CHANGETOKEYTYPEONE
_CHANGETOKEYTYPEONERESPONSE.fields_by_name['changeToKeyTypeOneStatus'].message_type = _CHANGETOKEYTYPEONESTATUS
_SETKEYREQUEST.fields_by_name['keys'].message_type = _SETKEY
_CREATEUSERREQUEST.fields_by_name['enterpriseRegistration'].message_type = enterprise__pb2._ENTERPRISEREGISTRATION
_APIREQUESTBYKEY.fields_by_name['supportedLanguage'].enum_type = _SUPPORTEDLANGUAGE
_MASTERPASSWORDREENTRYREQUEST.fields_by_name['action'].enum_type = _MASTERPASSWORDREENTRYACTIONTYPE
_DEVICEVERIFICATIONRESPONSE.fields_by_name['deviceStatus'].enum_type = _DEVICESTATUS
_THROTTLESTATE.fields_by_name['type'].enum_type = _THROTTLETYPE
_DEVICEINFORMATION.fields_by_name['deviceStatus'].enum_type = _DEVICESTATUS
_USERDATAKEY.fields_by_name['enterpriseUserIdDataKeyPairs'].message_type = _ENTERPRISEUSERIDDATAKEYPAIR
_USERDATAKEYRESPONSE.fields_by_name['userDataKeys'].message_type = _USERDATAKEY
DESCRIPTOR.message_types_by_name['ApiRequest'] = _APIREQUEST
DESCRIPTOR.message_types_by_name['ApiRequestPayload'] = _APIREQUESTPAYLOAD
DESCRIPTOR.message_types_by_name['Transform'] = _TRANSFORM
DESCRIPTOR.message_types_by_name['DeviceRequest'] = _DEVICEREQUEST
DESCRIPTOR.message_types_by_name['AuthRequest'] = _AUTHREQUEST
DESCRIPTOR.message_types_by_name['NewUserMinimumParams'] = _NEWUSERMINIMUMPARAMS
DESCRIPTOR.message_types_by_name['PreLoginRequest'] = _PRELOGINREQUEST
DESCRIPTOR.message_types_by_name['LoginRequest'] = _LOGINREQUEST
DESCRIPTOR.message_types_by_name['DeviceResponse'] = _DEVICERESPONSE
DESCRIPTOR.message_types_by_name['Salt'] = _SALT
DESCRIPTOR.message_types_by_name['TwoFactorChannel'] = _TWOFACTORCHANNEL
DESCRIPTOR.message_types_by_name['StartLoginRequest'] = _STARTLOGINREQUEST
DESCRIPTOR.message_types_by_name['LoginResponse'] = _LOGINRESPONSE
DESCRIPTOR.message_types_by_name['SsoUserInfo'] = _SSOUSERINFO
DESCRIPTOR.message_types_by_name['PreLoginResponse'] = _PRELOGINRESPONSE
DESCRIPTOR.message_types_by_name['LoginToMcRequest'] = _LOGINTOMCREQUEST
DESCRIPTOR.message_types_by_name['LoginToMcResponse'] = _LOGINTOMCRESPONSE
DESCRIPTOR.message_types_by_name['LoginAsUserRequest'] = _LOGINASUSERREQUEST
DESCRIPTOR.message_types_by_name['LoginAsUserResponse'] = _LOGINASUSERRESPONSE
DESCRIPTOR.message_types_by_name['ValidateAuthHashRequest'] = _VALIDATEAUTHHASHREQUEST
DESCRIPTOR.message_types_by_name['TwoFactorChannelInfo'] = _TWOFACTORCHANNELINFO
DESCRIPTOR.message_types_by_name['TwoFactorValidateRequest'] = _TWOFACTORVALIDATEREQUEST
DESCRIPTOR.message_types_by_name['TwoFactorValidateResponse'] = _TWOFACTORVALIDATERESPONSE
DESCRIPTOR.message_types_by_name['TwoFactorSendPushRequest'] = _TWOFACTORSENDPUSHREQUEST
DESCRIPTOR.message_types_by_name['License'] = _LICENSE
DESCRIPTOR.message_types_by_name['OwnerlessRecord'] = _OWNERLESSRECORD
DESCRIPTOR.message_types_by_name['OwnerlessRecords'] = _OWNERLESSRECORDS
DESCRIPTOR.message_types_by_name['UserAuthRequest'] = _USERAUTHREQUEST
DESCRIPTOR.message_types_by_name['UidRequest'] = _UIDREQUEST
DESCRIPTOR.message_types_by_name['DeviceUpdateRequest'] = _DEVICEUPDATEREQUEST
DESCRIPTOR.message_types_by_name['RegisterDeviceInRegionRequest'] = _REGISTERDEVICEINREGIONREQUEST
DESCRIPTOR.message_types_by_name['RegistrationRequest'] = _REGISTRATIONREQUEST
DESCRIPTOR.message_types_by_name['ConvertUserToV3Request'] = _CONVERTUSERTOV3REQUEST
DESCRIPTOR.message_types_by_name['RevisionResponse'] = _REVISIONRESPONSE
DESCRIPTOR.message_types_by_name['ChangeEmailRequest'] = _CHANGEEMAILREQUEST
DESCRIPTOR.message_types_by_name['ChangeEmailResponse'] = _CHANGEEMAILRESPONSE
DESCRIPTOR.message_types_by_name['EmailVerificationLinkResponse'] = _EMAILVERIFICATIONLINKRESPONSE
DESCRIPTOR.message_types_by_name['SecurityData'] = _SECURITYDATA
DESCRIPTOR.message_types_by_name['SecurityDataRequest'] = _SECURITYDATAREQUEST
DESCRIPTOR.message_types_by_name['SecurityReportIncrementalData'] = _SECURITYREPORTINCREMENTALDATA
DESCRIPTOR.message_types_by_name['SecurityReport'] = _SECURITYREPORT
DESCRIPTOR.message_types_by_name['SecurityReportSaveRequest'] = _SECURITYREPORTSAVEREQUEST
DESCRIPTOR.message_types_by_name['SecurityReportRequest'] = _SECURITYREPORTREQUEST
DESCRIPTOR.message_types_by_name['SecurityReportResponse'] = _SECURITYREPORTRESPONSE
DESCRIPTOR.message_types_by_name['ReusedPasswordsRequest'] = _REUSEDPASSWORDSREQUEST
DESCRIPTOR.message_types_by_name['SummaryConsoleReport'] = _SUMMARYCONSOLEREPORT
DESCRIPTOR.message_types_by_name['ChangeToKeyTypeOne'] = _CHANGETOKEYTYPEONE
DESCRIPTOR.message_types_by_name['ChangeToKeyTypeOneRequest'] = _CHANGETOKEYTYPEONEREQUEST
DESCRIPTOR.message_types_by_name['ChangeToKeyTypeOneStatus'] = _CHANGETOKEYTYPEONESTATUS
DESCRIPTOR.message_types_by_name['ChangeToKeyTypeOneResponse'] = _CHANGETOKEYTYPEONERESPONSE
DESCRIPTOR.message_types_by_name['SetKey'] = _SETKEY
DESCRIPTOR.message_types_by_name['SetKeyRequest'] = _SETKEYREQUEST
DESCRIPTOR.message_types_by_name['CreateUserRequest'] = _CREATEUSERREQUEST
DESCRIPTOR.message_types_by_name['NodeEnforcementAddOrUpdateRequest'] = _NODEENFORCEMENTADDORUPDATEREQUEST
DESCRIPTOR.message_types_by_name['NodeEnforcementRemoveRequest'] = _NODEENFORCEMENTREMOVEREQUEST
DESCRIPTOR.message_types_by_name['UserAccounts'] = _USERACCOUNTS
DESCRIPTOR.message_types_by_name['ApiRequestByKey'] = _APIREQUESTBYKEY
DESCRIPTOR.message_types_by_name['MemcacheRequest'] = _MEMCACHEREQUEST
DESCRIPTOR.message_types_by_name['MemcacheResponse'] = _MEMCACHERESPONSE
DESCRIPTOR.message_types_by_name['MasterPasswordReentryRequest'] = _MASTERPASSWORDREENTRYREQUEST
DESCRIPTOR.message_types_by_name['DeviceRegistrationRequest'] = _DEVICEREGISTRATIONREQUEST
DESCRIPTOR.message_types_by_name['DeviceVerificationRequest'] = _DEVICEVERIFICATIONREQUEST
DESCRIPTOR.message_types_by_name['DeviceVerificationResponse'] = _DEVICEVERIFICATIONRESPONSE
DESCRIPTOR.message_types_by_name['DeviceApprovalRequest'] = _DEVICEAPPROVALREQUEST
DESCRIPTOR.message_types_by_name['DeviceApprovalResponse'] = _DEVICEAPPROVALRESPONSE
DESCRIPTOR.message_types_by_name['ApproveDeviceRequest'] = _APPROVEDEVICEREQUEST
DESCRIPTOR.message_types_by_name['EnterpriseUserAliasRequest'] = _ENTERPRISEUSERALIASREQUEST
DESCRIPTOR.message_types_by_name['Device'] = _DEVICE
DESCRIPTOR.message_types_by_name['RegisterDeviceDataKeyRequest'] = _REGISTERDEVICEDATAKEYREQUEST
DESCRIPTOR.message_types_by_name['ValidateCreateUserVerificationCodeRequest'] = _VALIDATECREATEUSERVERIFICATIONCODEREQUEST
DESCRIPTOR.message_types_by_name['ValidateDeviceVerificationCodeRequest'] = _VALIDATEDEVICEVERIFICATIONCODEREQUEST
DESCRIPTOR.message_types_by_name['SendSessionMessageRequest'] = _SENDSESSIONMESSAGEREQUEST
DESCRIPTOR.message_types_by_name['GlobalUserAccount'] = _GLOBALUSERACCOUNT
DESCRIPTOR.message_types_by_name['AccountUsername'] = _ACCOUNTUSERNAME
DESCRIPTOR.message_types_by_name['SsoServiceProviderRequest'] = _SSOSERVICEPROVIDERREQUEST
DESCRIPTOR.message_types_by_name['SsoServiceProviderResponse'] = _SSOSERVICEPROVIDERRESPONSE
DESCRIPTOR.message_types_by_name['UserSettingRequest'] = _USERSETTINGREQUEST
DESCRIPTOR.message_types_by_name['ThrottleState'] = _THROTTLESTATE
DESCRIPTOR.message_types_by_name['DeviceInformation'] = _DEVICEINFORMATION
DESCRIPTOR.message_types_by_name['UserSetting'] = _USERSETTING
DESCRIPTOR.message_types_by_name['UserDataKeyRequest'] = _USERDATAKEYREQUEST
DESCRIPTOR.message_types_by_name['EnterpriseUserIdDataKeyPair'] = _ENTERPRISEUSERIDDATAKEYPAIR
DESCRIPTOR.message_types_by_name['UserDataKey'] = _USERDATAKEY
DESCRIPTOR.message_types_by_name['UserDataKeyResponse'] = _USERDATAKEYRESPONSE
DESCRIPTOR.enum_types_by_name['SupportedLanguage'] = _SUPPORTEDLANGUAGE
DESCRIPTOR.enum_types_by_name['LoginType'] = _LOGINTYPE
DESCRIPTOR.enum_types_by_name['DeviceStatus'] = _DEVICESTATUS
DESCRIPTOR.enum_types_by_name['LicenseStatus'] = _LICENSESTATUS
DESCRIPTOR.enum_types_by_name['AccountType'] = _ACCOUNTTYPE
DESCRIPTOR.enum_types_by_name['SessionTokenType'] = _SESSIONTOKENTYPE
DESCRIPTOR.enum_types_by_name['Version'] = _VERSION
DESCRIPTOR.enum_types_by_name['MasterPasswordReentryActionType'] = _MASTERPASSWORDREENTRYACTIONTYPE
DESCRIPTOR.enum_types_by_name['LoginMethod'] = _LOGINMETHOD
DESCRIPTOR.enum_types_by_name['LoginState'] = _LOGINSTATE
DESCRIPTOR.enum_types_by_name['EncryptedDataKeyType'] = _ENCRYPTEDDATAKEYTYPE
DESCRIPTOR.enum_types_by_name['PasswordMethod'] = _PASSWORDMETHOD
DESCRIPTOR.enum_types_by_name['TwoFactorPushType'] = _TWOFACTORPUSHTYPE
DESCRIPTOR.enum_types_by_name['TwoFactorValueType'] = _TWOFACTORVALUETYPE
DESCRIPTOR.enum_types_by_name['TwoFactorChannelType'] = _TWOFACTORCHANNELTYPE
DESCRIPTOR.enum_types_by_name['TwoFactorExpiration'] = _TWOFACTOREXPIRATION
DESCRIPTOR.enum_types_by_name['LicenseType'] = _LICENSETYPE
DESCRIPTOR.enum_types_by_name['ObjectTypes'] = _OBJECTTYPES
DESCRIPTOR.enum_types_by_name['AlternateAuthenticationType'] = _ALTERNATEAUTHENTICATIONTYPE
DESCRIPTOR.enum_types_by_name['ThrottleType'] = _THROTTLETYPE
_sym_db.RegisterFileDescriptor(DESCRIPTOR)
ApiRequest = _reflection.GeneratedProtocolMessageType('ApiRequest', (_message.Message,), {
'DESCRIPTOR' : _APIREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ApiRequest)
})
_sym_db.RegisterMessage(ApiRequest)
ApiRequestPayload = _reflection.GeneratedProtocolMessageType('ApiRequestPayload', (_message.Message,), {
'DESCRIPTOR' : _APIREQUESTPAYLOAD,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ApiRequestPayload)
})
_sym_db.RegisterMessage(ApiRequestPayload)
Transform = _reflection.GeneratedProtocolMessageType('Transform', (_message.Message,), {
'DESCRIPTOR' : _TRANSFORM,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.Transform)
})
_sym_db.RegisterMessage(Transform)
DeviceRequest = _reflection.GeneratedProtocolMessageType('DeviceRequest', (_message.Message,), {
'DESCRIPTOR' : _DEVICEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.DeviceRequest)
})
_sym_db.RegisterMessage(DeviceRequest)
AuthRequest = _reflection.GeneratedProtocolMessageType('AuthRequest', (_message.Message,), {
'DESCRIPTOR' : _AUTHREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.AuthRequest)
})
_sym_db.RegisterMessage(AuthRequest)
NewUserMinimumParams = _reflection.GeneratedProtocolMessageType('NewUserMinimumParams', (_message.Message,), {
'DESCRIPTOR' : _NEWUSERMINIMUMPARAMS,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.NewUserMinimumParams)
})
_sym_db.RegisterMessage(NewUserMinimumParams)
PreLoginRequest = _reflection.GeneratedProtocolMessageType('PreLoginRequest', (_message.Message,), {
'DESCRIPTOR' : _PRELOGINREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.PreLoginRequest)
})
_sym_db.RegisterMessage(PreLoginRequest)
LoginRequest = _reflection.GeneratedProtocolMessageType('LoginRequest', (_message.Message,), {
'DESCRIPTOR' : _LOGINREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.LoginRequest)
})
_sym_db.RegisterMessage(LoginRequest)
DeviceResponse = _reflection.GeneratedProtocolMessageType('DeviceResponse', (_message.Message,), {
'DESCRIPTOR' : _DEVICERESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.DeviceResponse)
})
_sym_db.RegisterMessage(DeviceResponse)
Salt = _reflection.GeneratedProtocolMessageType('Salt', (_message.Message,), {
'DESCRIPTOR' : _SALT,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.Salt)
})
_sym_db.RegisterMessage(Salt)
TwoFactorChannel = _reflection.GeneratedProtocolMessageType('TwoFactorChannel', (_message.Message,), {
'DESCRIPTOR' : _TWOFACTORCHANNEL,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.TwoFactorChannel)
})
_sym_db.RegisterMessage(TwoFactorChannel)
StartLoginRequest = _reflection.GeneratedProtocolMessageType('StartLoginRequest', (_message.Message,), {
'DESCRIPTOR' : _STARTLOGINREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.StartLoginRequest)
})
_sym_db.RegisterMessage(StartLoginRequest)
LoginResponse = _reflection.GeneratedProtocolMessageType('LoginResponse', (_message.Message,), {
'DESCRIPTOR' : _LOGINRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.LoginResponse)
})
_sym_db.RegisterMessage(LoginResponse)
SsoUserInfo = _reflection.GeneratedProtocolMessageType('SsoUserInfo', (_message.Message,), {
'DESCRIPTOR' : _SSOUSERINFO,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SsoUserInfo)
})
_sym_db.RegisterMessage(SsoUserInfo)
PreLoginResponse = _reflection.GeneratedProtocolMessageType('PreLoginResponse', (_message.Message,), {
'DESCRIPTOR' : _PRELOGINRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.PreLoginResponse)
})
_sym_db.RegisterMessage(PreLoginResponse)
LoginToMcRequest = _reflection.GeneratedProtocolMessageType('LoginToMcRequest', (_message.Message,), {
'DESCRIPTOR' : _LOGINTOMCREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.LoginToMcRequest)
})
_sym_db.RegisterMessage(LoginToMcRequest)
LoginToMcResponse = _reflection.GeneratedProtocolMessageType('LoginToMcResponse', (_message.Message,), {
'DESCRIPTOR' : _LOGINTOMCRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.LoginToMcResponse)
})
_sym_db.RegisterMessage(LoginToMcResponse)
LoginAsUserRequest = _reflection.GeneratedProtocolMessageType('LoginAsUserRequest', (_message.Message,), {
'DESCRIPTOR' : _LOGINASUSERREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.LoginAsUserRequest)
})
_sym_db.RegisterMessage(LoginAsUserRequest)
LoginAsUserResponse = _reflection.GeneratedProtocolMessageType('LoginAsUserResponse', (_message.Message,), {
'DESCRIPTOR' : _LOGINASUSERRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.LoginAsUserResponse)
})
_sym_db.RegisterMessage(LoginAsUserResponse)
ValidateAuthHashRequest = _reflection.GeneratedProtocolMessageType('ValidateAuthHashRequest', (_message.Message,), {
'DESCRIPTOR' : _VALIDATEAUTHHASHREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ValidateAuthHashRequest)
})
_sym_db.RegisterMessage(ValidateAuthHashRequest)
TwoFactorChannelInfo = _reflection.GeneratedProtocolMessageType('TwoFactorChannelInfo', (_message.Message,), {
'DESCRIPTOR' : _TWOFACTORCHANNELINFO,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.TwoFactorChannelInfo)
})
_sym_db.RegisterMessage(TwoFactorChannelInfo)
TwoFactorValidateRequest = _reflection.GeneratedProtocolMessageType('TwoFactorValidateRequest', (_message.Message,), {
'DESCRIPTOR' : _TWOFACTORVALIDATEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.TwoFactorValidateRequest)
})
_sym_db.RegisterMessage(TwoFactorValidateRequest)
TwoFactorValidateResponse = _reflection.GeneratedProtocolMessageType('TwoFactorValidateResponse', (_message.Message,), {
'DESCRIPTOR' : _TWOFACTORVALIDATERESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.TwoFactorValidateResponse)
})
_sym_db.RegisterMessage(TwoFactorValidateResponse)
TwoFactorSendPushRequest = _reflection.GeneratedProtocolMessageType('TwoFactorSendPushRequest', (_message.Message,), {
'DESCRIPTOR' : _TWOFACTORSENDPUSHREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.TwoFactorSendPushRequest)
})
_sym_db.RegisterMessage(TwoFactorSendPushRequest)
License = _reflection.GeneratedProtocolMessageType('License', (_message.Message,), {
'DESCRIPTOR' : _LICENSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.License)
})
_sym_db.RegisterMessage(License)
OwnerlessRecord = _reflection.GeneratedProtocolMessageType('OwnerlessRecord', (_message.Message,), {
'DESCRIPTOR' : _OWNERLESSRECORD,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.OwnerlessRecord)
})
_sym_db.RegisterMessage(OwnerlessRecord)
OwnerlessRecords = _reflection.GeneratedProtocolMessageType('OwnerlessRecords', (_message.Message,), {
'DESCRIPTOR' : _OWNERLESSRECORDS,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.OwnerlessRecords)
})
_sym_db.RegisterMessage(OwnerlessRecords)
UserAuthRequest = _reflection.GeneratedProtocolMessageType('UserAuthRequest', (_message.Message,), {
'DESCRIPTOR' : _USERAUTHREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.UserAuthRequest)
})
_sym_db.RegisterMessage(UserAuthRequest)
UidRequest = _reflection.GeneratedProtocolMessageType('UidRequest', (_message.Message,), {
'DESCRIPTOR' : _UIDREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.UidRequest)
})
_sym_db.RegisterMessage(UidRequest)
DeviceUpdateRequest = _reflection.GeneratedProtocolMessageType('DeviceUpdateRequest', (_message.Message,), {
'DESCRIPTOR' : _DEVICEUPDATEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.DeviceUpdateRequest)
})
_sym_db.RegisterMessage(DeviceUpdateRequest)
RegisterDeviceInRegionRequest = _reflection.GeneratedProtocolMessageType('RegisterDeviceInRegionRequest', (_message.Message,), {
'DESCRIPTOR' : _REGISTERDEVICEINREGIONREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.RegisterDeviceInRegionRequest)
})
_sym_db.RegisterMessage(RegisterDeviceInRegionRequest)
RegistrationRequest = _reflection.GeneratedProtocolMessageType('RegistrationRequest', (_message.Message,), {
'DESCRIPTOR' : _REGISTRATIONREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.RegistrationRequest)
})
_sym_db.RegisterMessage(RegistrationRequest)
ConvertUserToV3Request = _reflection.GeneratedProtocolMessageType('ConvertUserToV3Request', (_message.Message,), {
'DESCRIPTOR' : _CONVERTUSERTOV3REQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ConvertUserToV3Request)
})
_sym_db.RegisterMessage(ConvertUserToV3Request)
RevisionResponse = _reflection.GeneratedProtocolMessageType('RevisionResponse', (_message.Message,), {
'DESCRIPTOR' : _REVISIONRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.RevisionResponse)
})
_sym_db.RegisterMessage(RevisionResponse)
ChangeEmailRequest = _reflection.GeneratedProtocolMessageType('ChangeEmailRequest', (_message.Message,), {
'DESCRIPTOR' : _CHANGEEMAILREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ChangeEmailRequest)
})
_sym_db.RegisterMessage(ChangeEmailRequest)
ChangeEmailResponse = _reflection.GeneratedProtocolMessageType('ChangeEmailResponse', (_message.Message,), {
'DESCRIPTOR' : _CHANGEEMAILRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ChangeEmailResponse)
})
_sym_db.RegisterMessage(ChangeEmailResponse)
EmailVerificationLinkResponse = _reflection.GeneratedProtocolMessageType('EmailVerificationLinkResponse', (_message.Message,), {
'DESCRIPTOR' : _EMAILVERIFICATIONLINKRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.EmailVerificationLinkResponse)
})
_sym_db.RegisterMessage(EmailVerificationLinkResponse)
SecurityData = _reflection.GeneratedProtocolMessageType('SecurityData', (_message.Message,), {
'DESCRIPTOR' : _SECURITYDATA,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SecurityData)
})
_sym_db.RegisterMessage(SecurityData)
SecurityDataRequest = _reflection.GeneratedProtocolMessageType('SecurityDataRequest', (_message.Message,), {
'DESCRIPTOR' : _SECURITYDATAREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SecurityDataRequest)
})
_sym_db.RegisterMessage(SecurityDataRequest)
SecurityReportIncrementalData = _reflection.GeneratedProtocolMessageType('SecurityReportIncrementalData', (_message.Message,), {
'DESCRIPTOR' : _SECURITYREPORTINCREMENTALDATA,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SecurityReportIncrementalData)
})
_sym_db.RegisterMessage(SecurityReportIncrementalData)
SecurityReport = _reflection.GeneratedProtocolMessageType('SecurityReport', (_message.Message,), {
'DESCRIPTOR' : _SECURITYREPORT,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SecurityReport)
})
_sym_db.RegisterMessage(SecurityReport)
SecurityReportSaveRequest = _reflection.GeneratedProtocolMessageType('SecurityReportSaveRequest', (_message.Message,), {
'DESCRIPTOR' : _SECURITYREPORTSAVEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SecurityReportSaveRequest)
})
_sym_db.RegisterMessage(SecurityReportSaveRequest)
SecurityReportRequest = _reflection.GeneratedProtocolMessageType('SecurityReportRequest', (_message.Message,), {
'DESCRIPTOR' : _SECURITYREPORTREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SecurityReportRequest)
})
_sym_db.RegisterMessage(SecurityReportRequest)
SecurityReportResponse = _reflection.GeneratedProtocolMessageType('SecurityReportResponse', (_message.Message,), {
'DESCRIPTOR' : _SECURITYREPORTRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SecurityReportResponse)
})
_sym_db.RegisterMessage(SecurityReportResponse)
ReusedPasswordsRequest = _reflection.GeneratedProtocolMessageType('ReusedPasswordsRequest', (_message.Message,), {
'DESCRIPTOR' : _REUSEDPASSWORDSREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ReusedPasswordsRequest)
})
_sym_db.RegisterMessage(ReusedPasswordsRequest)
SummaryConsoleReport = _reflection.GeneratedProtocolMessageType('SummaryConsoleReport', (_message.Message,), {
'DESCRIPTOR' : _SUMMARYCONSOLEREPORT,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SummaryConsoleReport)
})
_sym_db.RegisterMessage(SummaryConsoleReport)
ChangeToKeyTypeOne = _reflection.GeneratedProtocolMessageType('ChangeToKeyTypeOne', (_message.Message,), {
'DESCRIPTOR' : _CHANGETOKEYTYPEONE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ChangeToKeyTypeOne)
})
_sym_db.RegisterMessage(ChangeToKeyTypeOne)
ChangeToKeyTypeOneRequest = _reflection.GeneratedProtocolMessageType('ChangeToKeyTypeOneRequest', (_message.Message,), {
'DESCRIPTOR' : _CHANGETOKEYTYPEONEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ChangeToKeyTypeOneRequest)
})
_sym_db.RegisterMessage(ChangeToKeyTypeOneRequest)
ChangeToKeyTypeOneStatus = _reflection.GeneratedProtocolMessageType('ChangeToKeyTypeOneStatus', (_message.Message,), {
'DESCRIPTOR' : _CHANGETOKEYTYPEONESTATUS,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ChangeToKeyTypeOneStatus)
})
_sym_db.RegisterMessage(ChangeToKeyTypeOneStatus)
ChangeToKeyTypeOneResponse = _reflection.GeneratedProtocolMessageType('ChangeToKeyTypeOneResponse', (_message.Message,), {
'DESCRIPTOR' : _CHANGETOKEYTYPEONERESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ChangeToKeyTypeOneResponse)
})
_sym_db.RegisterMessage(ChangeToKeyTypeOneResponse)
SetKey = _reflection.GeneratedProtocolMessageType('SetKey', (_message.Message,), {
'DESCRIPTOR' : _SETKEY,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SetKey)
})
_sym_db.RegisterMessage(SetKey)
SetKeyRequest = _reflection.GeneratedProtocolMessageType('SetKeyRequest', (_message.Message,), {
'DESCRIPTOR' : _SETKEYREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SetKeyRequest)
})
_sym_db.RegisterMessage(SetKeyRequest)
CreateUserRequest = _reflection.GeneratedProtocolMessageType('CreateUserRequest', (_message.Message,), {
'DESCRIPTOR' : _CREATEUSERREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.CreateUserRequest)
})
_sym_db.RegisterMessage(CreateUserRequest)
NodeEnforcementAddOrUpdateRequest = _reflection.GeneratedProtocolMessageType('NodeEnforcementAddOrUpdateRequest', (_message.Message,), {
'DESCRIPTOR' : _NODEENFORCEMENTADDORUPDATEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.NodeEnforcementAddOrUpdateRequest)
})
_sym_db.RegisterMessage(NodeEnforcementAddOrUpdateRequest)
NodeEnforcementRemoveRequest = _reflection.GeneratedProtocolMessageType('NodeEnforcementRemoveRequest', (_message.Message,), {
'DESCRIPTOR' : _NODEENFORCEMENTREMOVEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.NodeEnforcementRemoveRequest)
})
_sym_db.RegisterMessage(NodeEnforcementRemoveRequest)
UserAccounts = _reflection.GeneratedProtocolMessageType('UserAccounts', (_message.Message,), {
'DESCRIPTOR' : _USERACCOUNTS,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.UserAccounts)
})
_sym_db.RegisterMessage(UserAccounts)
ApiRequestByKey = _reflection.GeneratedProtocolMessageType('ApiRequestByKey', (_message.Message,), {
'DESCRIPTOR' : _APIREQUESTBYKEY,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ApiRequestByKey)
})
_sym_db.RegisterMessage(ApiRequestByKey)
MemcacheRequest = _reflection.GeneratedProtocolMessageType('MemcacheRequest', (_message.Message,), {
'DESCRIPTOR' : _MEMCACHEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.MemcacheRequest)
})
_sym_db.RegisterMessage(MemcacheRequest)
MemcacheResponse = _reflection.GeneratedProtocolMessageType('MemcacheResponse', (_message.Message,), {
'DESCRIPTOR' : _MEMCACHERESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.MemcacheResponse)
})
_sym_db.RegisterMessage(MemcacheResponse)
MasterPasswordReentryRequest = _reflection.GeneratedProtocolMessageType('MasterPasswordReentryRequest', (_message.Message,), {
'DESCRIPTOR' : _MASTERPASSWORDREENTRYREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.MasterPasswordReentryRequest)
})
_sym_db.RegisterMessage(MasterPasswordReentryRequest)
DeviceRegistrationRequest = _reflection.GeneratedProtocolMessageType('DeviceRegistrationRequest', (_message.Message,), {
'DESCRIPTOR' : _DEVICEREGISTRATIONREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.DeviceRegistrationRequest)
})
_sym_db.RegisterMessage(DeviceRegistrationRequest)
DeviceVerificationRequest = _reflection.GeneratedProtocolMessageType('DeviceVerificationRequest', (_message.Message,), {
'DESCRIPTOR' : _DEVICEVERIFICATIONREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.DeviceVerificationRequest)
})
_sym_db.RegisterMessage(DeviceVerificationRequest)
DeviceVerificationResponse = _reflection.GeneratedProtocolMessageType('DeviceVerificationResponse', (_message.Message,), {
'DESCRIPTOR' : _DEVICEVERIFICATIONRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.DeviceVerificationResponse)
})
_sym_db.RegisterMessage(DeviceVerificationResponse)
DeviceApprovalRequest = _reflection.GeneratedProtocolMessageType('DeviceApprovalRequest', (_message.Message,), {
'DESCRIPTOR' : _DEVICEAPPROVALREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.DeviceApprovalRequest)
})
_sym_db.RegisterMessage(DeviceApprovalRequest)
DeviceApprovalResponse = _reflection.GeneratedProtocolMessageType('DeviceApprovalResponse', (_message.Message,), {
'DESCRIPTOR' : _DEVICEAPPROVALRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.DeviceApprovalResponse)
})
_sym_db.RegisterMessage(DeviceApprovalResponse)
ApproveDeviceRequest = _reflection.GeneratedProtocolMessageType('ApproveDeviceRequest', (_message.Message,), {
'DESCRIPTOR' : _APPROVEDEVICEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ApproveDeviceRequest)
})
_sym_db.RegisterMessage(ApproveDeviceRequest)
EnterpriseUserAliasRequest = _reflection.GeneratedProtocolMessageType('EnterpriseUserAliasRequest', (_message.Message,), {
'DESCRIPTOR' : _ENTERPRISEUSERALIASREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.EnterpriseUserAliasRequest)
})
_sym_db.RegisterMessage(EnterpriseUserAliasRequest)
Device = _reflection.GeneratedProtocolMessageType('Device', (_message.Message,), {
'DESCRIPTOR' : _DEVICE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.Device)
})
_sym_db.RegisterMessage(Device)
RegisterDeviceDataKeyRequest = _reflection.GeneratedProtocolMessageType('RegisterDeviceDataKeyRequest', (_message.Message,), {
'DESCRIPTOR' : _REGISTERDEVICEDATAKEYREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.RegisterDeviceDataKeyRequest)
})
_sym_db.RegisterMessage(RegisterDeviceDataKeyRequest)
ValidateCreateUserVerificationCodeRequest = _reflection.GeneratedProtocolMessageType('ValidateCreateUserVerificationCodeRequest', (_message.Message,), {
'DESCRIPTOR' : _VALIDATECREATEUSERVERIFICATIONCODEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ValidateCreateUserVerificationCodeRequest)
})
_sym_db.RegisterMessage(ValidateCreateUserVerificationCodeRequest)
ValidateDeviceVerificationCodeRequest = _reflection.GeneratedProtocolMessageType('ValidateDeviceVerificationCodeRequest', (_message.Message,), {
'DESCRIPTOR' : _VALIDATEDEVICEVERIFICATIONCODEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ValidateDeviceVerificationCodeRequest)
})
_sym_db.RegisterMessage(ValidateDeviceVerificationCodeRequest)
SendSessionMessageRequest = _reflection.GeneratedProtocolMessageType('SendSessionMessageRequest', (_message.Message,), {
'DESCRIPTOR' : _SENDSESSIONMESSAGEREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SendSessionMessageRequest)
})
_sym_db.RegisterMessage(SendSessionMessageRequest)
GlobalUserAccount = _reflection.GeneratedProtocolMessageType('GlobalUserAccount', (_message.Message,), {
'DESCRIPTOR' : _GLOBALUSERACCOUNT,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.GlobalUserAccount)
})
_sym_db.RegisterMessage(GlobalUserAccount)
AccountUsername = _reflection.GeneratedProtocolMessageType('AccountUsername', (_message.Message,), {
'DESCRIPTOR' : _ACCOUNTUSERNAME,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.AccountUsername)
})
_sym_db.RegisterMessage(AccountUsername)
SsoServiceProviderRequest = _reflection.GeneratedProtocolMessageType('SsoServiceProviderRequest', (_message.Message,), {
'DESCRIPTOR' : _SSOSERVICEPROVIDERREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SsoServiceProviderRequest)
})
_sym_db.RegisterMessage(SsoServiceProviderRequest)
SsoServiceProviderResponse = _reflection.GeneratedProtocolMessageType('SsoServiceProviderResponse', (_message.Message,), {
'DESCRIPTOR' : _SSOSERVICEPROVIDERRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.SsoServiceProviderResponse)
})
_sym_db.RegisterMessage(SsoServiceProviderResponse)
UserSettingRequest = _reflection.GeneratedProtocolMessageType('UserSettingRequest', (_message.Message,), {
'DESCRIPTOR' : _USERSETTINGREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.UserSettingRequest)
})
_sym_db.RegisterMessage(UserSettingRequest)
ThrottleState = _reflection.GeneratedProtocolMessageType('ThrottleState', (_message.Message,), {
'DESCRIPTOR' : _THROTTLESTATE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.ThrottleState)
})
_sym_db.RegisterMessage(ThrottleState)
DeviceInformation = _reflection.GeneratedProtocolMessageType('DeviceInformation', (_message.Message,), {
'DESCRIPTOR' : _DEVICEINFORMATION,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.DeviceInformation)
})
_sym_db.RegisterMessage(DeviceInformation)
UserSetting = _reflection.GeneratedProtocolMessageType('UserSetting', (_message.Message,), {
'DESCRIPTOR' : _USERSETTING,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.UserSetting)
})
_sym_db.RegisterMessage(UserSetting)
UserDataKeyRequest = _reflection.GeneratedProtocolMessageType('UserDataKeyRequest', (_message.Message,), {
'DESCRIPTOR' : _USERDATAKEYREQUEST,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.UserDataKeyRequest)
})
_sym_db.RegisterMessage(UserDataKeyRequest)
EnterpriseUserIdDataKeyPair = _reflection.GeneratedProtocolMessageType('EnterpriseUserIdDataKeyPair', (_message.Message,), {
'DESCRIPTOR' : _ENTERPRISEUSERIDDATAKEYPAIR,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.EnterpriseUserIdDataKeyPair)
})
_sym_db.RegisterMessage(EnterpriseUserIdDataKeyPair)
UserDataKey = _reflection.GeneratedProtocolMessageType('UserDataKey', (_message.Message,), {
'DESCRIPTOR' : _USERDATAKEY,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.UserDataKey)
})
_sym_db.RegisterMessage(UserDataKey)
UserDataKeyResponse = _reflection.GeneratedProtocolMessageType('UserDataKeyResponse', (_message.Message,), {
'DESCRIPTOR' : _USERDATAKEYRESPONSE,
'__module__' : 'APIRequest_pb2'
# @@protoc_insertion_point(class_scope:Authentication.UserDataKeyResponse)
})
_sym_db.RegisterMessage(UserDataKeyResponse)
DESCRIPTOR._options = None
# @@protoc_insertion_point(module_scope)
| 44.25403 | 23,484 | 0.765348 | 31,643 | 271,764 | 6.249091 | 0.036754 | 0.046849 | 0.084652 | 0.074416 | 0.697997 | 0.66151 | 0.652513 | 0.641352 | 0.638015 | 0.608885 | 0 | 0.037955 | 0.120292 | 271,764 | 6,140 | 23,485 | 44.261238 | 0.789156 | 0.023336 | 0 | 0.706188 | 1 | 0.003813 | 0.189622 | 0.14369 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0.007974 | 0.00104 | 0 | 0.00104 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
596e2d5b8702f4c4b303d7c69c34540e912a7c94 | 4,200 | py | Python | api_v1/tests/test_bucketlists.py | clementm916/django-bucketlist-api | 2f83374b752363e04db631e2e10658177807a13c | [
"MIT"
] | null | null | null | api_v1/tests/test_bucketlists.py | clementm916/django-bucketlist-api | 2f83374b752363e04db631e2e10658177807a13c | [
"MIT"
] | null | null | null | api_v1/tests/test_bucketlists.py | clementm916/django-bucketlist-api | 2f83374b752363e04db631e2e10658177807a13c | [
"MIT"
] | null | null | null | from . import BaseAPITestCase
from .. models import Bucketlist, Item
class TestBucketLists(BaseAPITestCase):
def test_creating_bucketlist(self):
# with correct fields
payload = {'name': 'cook'}
request = self.test_client.post(
'/api/v1/bucketlists/', payload, HTTP_AUTHORIZATION=self.auth, format='json')
self.assertEqual(request.status_code, 201)
print(request)
response = request
print(response.data)
self.assertIn('date_created', request.data)
self.assertIn('date_modified', request.data)
self.assertIn('cook', str(request.data))
# with wrong fields
payload = {'wrongfieldname': 'cook'}
request = self.test_client.post(
'/api/v1/bucketlists/', payload, HTTP_AUTHORIZATION=self.auth, format='json')
self.assertEqual(request.status_code, 400)
self.assertEqual(request.data, {"name": ["This field is required."]})
# with a missing payload
request = self.test_client.post(
'/api/v1/bucketlists/', HTTP_AUTHORIZATION=self.auth, format='json')
self.assertEqual(request.status_code, 400)
self.assertIn('name', str(request.data))
self.assertIn('This field is required', str(request.data))
def test_retrieving_all_bucketlist(self):
bucket_1 = Bucketlist(name="Play", created_by=self.user)
bucket_1.save()
bucket_2 = Bucketlist(name="Cook", created_by=self.user)
bucket_2.save()
bucket_3 = Bucketlist(name="Swim", created_by=self.user)
bucket_3.save()
request = self.test_client.get(
'/api/v1/bucketlists/', HTTP_AUTHORIZATION=self.auth, format='json')
self.assertEqual(request.status_code, 200)
self.assertIn('Play', str(request.data))
self.assertIn('Cook', str(request.data))
self.assertIn('next', str(request.data))
# test retrieving with a search query
request = self.test_client.get(
'/api/v1/bucketlists/?q=play', HTTP_AUTHORIZATION=self.auth, format='json')
self.assertEqual(request.status_code, 200)
self.assertIn('Play', str(request.data))
def test_retrieving_a_single_bucketlist(self):
# an existing bucketlist
bucket = Bucketlist(name="Play", created_by=self.user)
bucket.save()
bucket_id = bucket.id
request = self.test_client.get(
'/api/v1/bucketlists/' + str(bucket_id), HTTP_AUTHORIZATION=self.auth, format='json')
self.assertEqual(request.status_code, 200)
# a non-existent bucketlist
bucket_id = 'notthere'
request = self.test_client.get(
'/api/v1/bucketlists/' + str(bucket_id), HTTP_AUTHORIZATION=self.auth, format='json')
self.assertEqual(request.status_code, 404)
def test_editing_a_bucketlist(self):
# an existing bucketlist
bucket = Bucketlist(name="Play", created_by=self.user)
bucket.save()
bucket_id = bucket.id
payload = {'name': 'Playing'}
request = self.test_client.put(
'/api/v1/bucketlists/' + str(bucket_id), payload, HTTP_AUTHORIZATION=self.auth, format='json')
self.assertEqual(request.status_code, 200)
self.assertIn('Playing', str(request.data))
# a non-existent bucketlist
bucket_id = 'notthere'
request = self.test_client.put(
'/api/v1/bucketlists/' + str(bucket_id), payload, HTTP_AUTHORIZATION=self.auth, format='json')
self.assertEqual(request.status_code, 404)
def test_deleting_a_bucketlist(self):
# an existing bucketlist
bucket = Bucketlist(name="Play", created_by=self.user)
bucket.save()
bucket_id = bucket.id
request = self.test_client.delete(
'/api/v1/bucketlists/' + str(bucket_id), HTTP_AUTHORIZATION=self.auth, format='json')
self.assertEqual(request.status_code, 204)
# a non-existent bucketlist
request = self.test_client.delete(
'/api/v1/bucketlists/' + str(bucket_id), HTTP_AUTHORIZATION=self.auth, format='json')
self.assertEqual(request.status_code, 404)
| 42 | 106 | 0.647143 | 494 | 4,200 | 5.354251 | 0.163968 | 0.042344 | 0.099811 | 0.087335 | 0.768998 | 0.73724 | 0.719093 | 0.719093 | 0.6431 | 0.6431 | 0 | 0.015408 | 0.227381 | 4,200 | 99 | 107 | 42.424242 | 0.799692 | 0.057857 | 0 | 0.573333 | 0 | 0 | 0.1148 | 0.006842 | 0 | 0 | 0 | 0 | 0.293333 | 1 | 0.066667 | false | 0 | 0.026667 | 0 | 0.106667 | 0.026667 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 1 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
59722d18e17fe68b182198a040e872f9372d64f4 | 265 | py | Python | molecule/shared/tests/test_default.py | zerodowntime/ansible-role-epel_repo | 3c99660e1aea5f47a0e31f919b8f989c401d7c1a | [
"Apache-2.0"
] | null | null | null | molecule/shared/tests/test_default.py | zerodowntime/ansible-role-epel_repo | 3c99660e1aea5f47a0e31f919b8f989c401d7c1a | [
"Apache-2.0"
] | null | null | null | molecule/shared/tests/test_default.py | zerodowntime/ansible-role-epel_repo | 3c99660e1aea5f47a0e31f919b8f989c401d7c1a | [
"Apache-2.0"
] | null | null | null | import os
import testinfra.utils.ansible_runner
testinfra_hosts = testinfra.utils.ansible_runner.AnsibleRunner(
os.environ['MOLECULE_INVENTORY_FILE']).get_hosts('all')
def test_package_is_installed(host):
assert host.package("epel-release").is_installed
| 26.5 | 63 | 0.807547 | 35 | 265 | 5.828571 | 0.657143 | 0.137255 | 0.205882 | 0.264706 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.086792 | 265 | 9 | 64 | 29.444444 | 0.842975 | 0 | 0 | 0 | 0 | 0 | 0.143396 | 0.086792 | 0 | 0 | 0 | 0 | 0.166667 | 1 | 0.166667 | false | 0 | 0.333333 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
5977e89e494ea56beca997013bfc58e35252a461 | 126 | py | Python | database/__init__.py | StephenSorriaux/pastepwn | 0b6e1366a3d2bcca9622e646c839fb01cd0776b1 | [
"MIT"
] | null | null | null | database/__init__.py | StephenSorriaux/pastepwn | 0b6e1366a3d2bcca9622e646c839fb01cd0776b1 | [
"MIT"
] | null | null | null | database/__init__.py | StephenSorriaux/pastepwn | 0b6e1366a3d2bcca9622e646c839fb01cd0776b1 | [
"MIT"
] | null | null | null | # -*- coding: utf-8 -*-
from .abstractdb import AbstractDB
from .mongodb import MongoDB
__all__ = ('AbstractDB', 'MongoDB')
| 18 | 35 | 0.698413 | 14 | 126 | 6 | 0.571429 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.009346 | 0.150794 | 126 | 6 | 36 | 21 | 0.775701 | 0.166667 | 0 | 0 | 0 | 0 | 0.165049 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.666667 | 0 | 0.666667 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
5983110d161ed1076285b104f97549ba8dfd147b | 164 | py | Python | env/bin/django-admin.py | wilbrone/Hood | 6e59a0628b88dcf3f67b4a42af1a0d88447ca858 | [
"MIT"
] | null | null | null | env/bin/django-admin.py | wilbrone/Hood | 6e59a0628b88dcf3f67b4a42af1a0d88447ca858 | [
"MIT"
] | 7 | 2021-03-18T23:56:59.000Z | 2021-09-08T01:41:03.000Z | env/bin/django-admin.py | wilbrone/Hood | 6e59a0628b88dcf3f67b4a42af1a0d88447ca858 | [
"MIT"
] | null | null | null | #!/home/aphya/moringa-projects/hoodTracker/env/bin/python
from django.core import management
if __name__ == "__main__":
management.execute_from_command_line()
| 27.333333 | 57 | 0.792683 | 21 | 164 | 5.666667 | 0.904762 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.091463 | 164 | 5 | 58 | 32.8 | 0.798658 | 0.341463 | 0 | 0 | 0 | 0 | 0.074766 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 0.333333 | 0 | 0.333333 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
598d2c180ca353d5666e5b6e345354704f438629 | 137 | py | Python | locale/pot/api/utilities/_autosummary/pyvista-ParametricRandomHills-1.py | tkoyama010/pyvista-doc-translations | 23bb813387b7f8bfe17e86c2244d5dd2243990db | [
"MIT"
] | 4 | 2020-08-07T08:19:19.000Z | 2020-12-04T09:51:11.000Z | locale/pot/api/utilities/_autosummary/pyvista-ParametricRandomHills-1.py | tkoyama010/pyvista-doc-translations | 23bb813387b7f8bfe17e86c2244d5dd2243990db | [
"MIT"
] | 19 | 2020-08-06T00:24:30.000Z | 2022-03-30T19:22:24.000Z | locale/pot/api/utilities/_autosummary/pyvista-ParametricRandomHills-1.py | tkoyama010/pyvista-doc-translations | 23bb813387b7f8bfe17e86c2244d5dd2243990db | [
"MIT"
] | 1 | 2021-03-09T07:50:40.000Z | 2021-03-09T07:50:40.000Z | # Create a ParametricRandomHills mesh.
#
import pyvista
mesh = pyvista.ParametricRandomHills()
mesh.plot(color='w', smooth_shading=True)
| 22.833333 | 41 | 0.79562 | 16 | 137 | 6.75 | 0.75 | 0.462963 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.094891 | 137 | 5 | 42 | 27.4 | 0.870968 | 0.262774 | 0 | 0 | 0 | 0 | 0.010204 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.333333 | 0 | 0.333333 | 0 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
59951cbac4b9ff0cd8528d10c5f2bdbb0bd542e7 | 595 | py | Python | Xtracker/core/xt_core.py | abkabhishek/Xtracker | 8b555e38a0f3953720feed3d58a52b8531ca2a07 | [
"MIT"
] | null | null | null | Xtracker/core/xt_core.py | abkabhishek/Xtracker | 8b555e38a0f3953720feed3d58a52b8531ca2a07 | [
"MIT"
] | null | null | null | Xtracker/core/xt_core.py | abkabhishek/Xtracker | 8b555e38a0f3953720feed3d58a52b8531ca2a07 | [
"MIT"
] | null | null | null | """
This is the core class of Xtracker
All processing should be initiated through this class only
Basic Structure
Project
TC Track
- Provide following info:
-- Test Location
-- File Pattern
-- Test Pattern
-- Other Info to parse from Test File
- Fetch Test Info and Save into DB
TC Update
- Provide Test Result File
- Process and save status of Test Result in DB
TC Analyse
- Get info of Test as per History Test Results
"""
class XTcore:
def __init__(self):
pass
| 16.081081 | 58 | 0.594958 | 76 | 595 | 4.605263 | 0.671053 | 0.04 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.364706 | 595 | 36 | 59 | 16.527778 | 0.925926 | 0.878992 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.333333 | false | 0.333333 | 0 | 0 | 0.666667 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 4 |
599febfb3c5dff04e8ade48e985c66994feb3be1 | 209 | py | Python | src/ur_fabrication_control/direct_control/utilities/__init__.py | augmentedfabricationlab/ur_fabrication_control | e2af04e3ad7bba0ad5131844e4ccab2e2a4a1663 | [
"MIT"
] | 5 | 2021-08-12T07:20:02.000Z | 2022-02-26T02:48:32.000Z | src/ur_fabrication_control/direct_control/utilities/__init__.py | augmentedfabricationlab/ur_fabrication_control | e2af04e3ad7bba0ad5131844e4ccab2e2a4a1663 | [
"MIT"
] | 7 | 2021-01-20T16:31:21.000Z | 2021-01-21T15:36:45.000Z | src/ur_fabrication_control/direct_control/utilities/__init__.py | augmentedfabricationlab/ur_fabrication_control | e2af04e3ad7bba0ad5131844e4ccab2e2a4a1663 | [
"MIT"
] | 2 | 2020-11-19T14:26:41.000Z | 2020-12-11T13:32:55.000Z | from .files import read_file_to_list, read_file_to_string
from .lists import flatten_list, divide_list_by_number, isclose
from .numbers import argsort, sign, convert_float_to_int
from .ping import is_available | 52.25 | 63 | 0.861244 | 35 | 209 | 4.742857 | 0.657143 | 0.096386 | 0.120482 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.095694 | 209 | 4 | 64 | 52.25 | 0.878307 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
59d834e2dd16ad16d44eb0e75ed06b9264f06bf2 | 155 | py | Python | Leetcode/1518. Water Bottles/solution3.py | asanoviskhak/Outtalent | c500e8ad498f76d57eb87a9776a04af7bdda913d | [
"MIT"
] | 51 | 2020-07-12T21:27:47.000Z | 2022-02-11T19:25:36.000Z | coding_intereview/1518. Water Bottles.py | purusharthmalik/Python-Bootcamp | 2ed1cf886d1081de200b0fdd4cb4e28008c7e3d1 | [
"MIT"
] | null | null | null | coding_intereview/1518. Water Bottles.py | purusharthmalik/Python-Bootcamp | 2ed1cf886d1081de200b0fdd4cb4e28008c7e3d1 | [
"MIT"
] | 32 | 2020-07-27T13:54:24.000Z | 2021-12-25T18:12:50.000Z | class Solution:
def numWaterBottles(self, numBottles: int, numExchange: int) -> int:
return numBottles + (numBottles - 1) // (numExchange - 1)
| 38.75 | 72 | 0.670968 | 16 | 155 | 6.5 | 0.625 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.01626 | 0.206452 | 155 | 3 | 73 | 51.666667 | 0.829268 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.333333 | false | 0 | 0 | 0.333333 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 4 |
59e1f0f1b407fe0029873bf70534014d50532950 | 160 | py | Python | diagram.py | micronode/terraform-aws-lambda-layer | af68f84a56e23ddba0746b8d9cfdf8f566cb75d4 | [
"MIT"
] | null | null | null | diagram.py | micronode/terraform-aws-lambda-layer | af68f84a56e23ddba0746b8d9cfdf8f566cb75d4 | [
"MIT"
] | null | null | null | diagram.py | micronode/terraform-aws-lambda-layer | af68f84a56e23ddba0746b8d9cfdf8f566cb75d4 | [
"MIT"
] | 1 | 2022-02-22T02:37:37.000Z | 2022-02-22T02:37:37.000Z | from diagrams import Diagram
from diagrams.aws.compute import Lambda
with Diagram("AWS Lambda Layer", show=False, direction="TB"):
Lambda("lambda layer")
| 22.857143 | 61 | 0.75625 | 22 | 160 | 5.5 | 0.590909 | 0.198347 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.1375 | 160 | 6 | 62 | 26.666667 | 0.876812 | 0 | 0 | 0 | 0 | 0 | 0.1875 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 0.5 | 0 | 0.5 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
59e851d20bfd38266e05d672b3a5985735961ed9 | 91 | py | Python | workshop/apps.py | akshaya9/fosswebsite | 5669a90ebb1fea2213c207a938236fba7643375c | [
"MIT"
] | 369 | 2017-10-02T03:04:24.000Z | 2022-03-26T10:54:55.000Z | pizzeria/workshop/apps.py | Zachary-Jackson/Django-Pizzeria | 5948b10e9e99e7f2e8ffdbe6c0efbb87000808a9 | [
"BSD-2-Clause"
] | 121 | 2017-10-01T14:21:48.000Z | 2018-11-08T16:57:26.000Z | GroupProject/workshop/apps.py | itachikryst/GroupProject | 5f030cb9bf686f3aed31d30e37f724ca99cf57bf | [
"MIT"
] | 69 | 2017-10-13T11:04:38.000Z | 2021-12-08T06:23:19.000Z | from django.apps import AppConfig
class WorkshopConfig(AppConfig):
name = 'workshop'
| 15.166667 | 33 | 0.758242 | 10 | 91 | 6.9 | 0.9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.164835 | 91 | 5 | 34 | 18.2 | 0.907895 | 0 | 0 | 0 | 0 | 0 | 0.087912 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.333333 | 0 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
ab8b1c94035c081b9bbaa7d79c9727b8dc1de0ee | 132 | py | Python | artifacts/com.example.mqtt/1.0.0/mqtt.py | ochemerys/aws-iot-greengrass | 3aec4bae7f8512da8e3d0aec4edf1f7236b15357 | [
"MIT"
] | null | null | null | artifacts/com.example.mqtt/1.0.0/mqtt.py | ochemerys/aws-iot-greengrass | 3aec4bae7f8512da8e3d0aec4edf1f7236b15357 | [
"MIT"
] | null | null | null | artifacts/com.example.mqtt/1.0.0/mqtt.py | ochemerys/aws-iot-greengrass | 3aec4bae7f8512da8e3d0aec4edf1f7236b15357 | [
"MIT"
] | null | null | null | import awsiot.greengrasscoreipc
print("---connecting---")
ipc_client = awsiot.greengrasscoreipc.connect()
print("---connected---")
| 22 | 47 | 0.742424 | 12 | 132 | 8.083333 | 0.75 | 0.474227 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.060606 | 132 | 5 | 48 | 26.4 | 0.782258 | 0 | 0 | 0 | 0 | 0 | 0.234848 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.25 | 0 | 0.25 | 0.5 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 4 |
ab8e9b9c60b476d558466a93e6f57d9652427845 | 87 | py | Python | github_activity/__init__.py | blink1073/github-activity | f994a6944fc50b167a7799b464af425f794ba1c8 | [
"BSD-3-Clause"
] | 19 | 2020-09-17T16:02:21.000Z | 2022-02-20T20:19:52.000Z | github_activity/__init__.py | blink1073/github-activity | f994a6944fc50b167a7799b464af425f794ba1c8 | [
"BSD-3-Clause"
] | 34 | 2020-08-11T05:39:10.000Z | 2022-03-11T13:50:01.000Z | github_activity/__init__.py | blink1073/github-activity | f994a6944fc50b167a7799b464af425f794ba1c8 | [
"BSD-3-Clause"
] | 5 | 2020-10-29T10:42:05.000Z | 2021-11-24T15:01:15.000Z | __version__ = "0.2.0"
from .github_activity import get_activity, generate_activity_md
| 21.75 | 63 | 0.816092 | 13 | 87 | 4.846154 | 0.769231 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.038462 | 0.103448 | 87 | 3 | 64 | 29 | 0.769231 | 0 | 0 | 0 | 1 | 0 | 0.057471 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.5 | 0 | 0.5 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
ab997b954871fcc5bd142aa20c265cefdce142fd | 22 | py | Python | arec/python/antchain_sdk_arec/__init__.py | alipay/antchain-openapi-prod-sdk | f78549e5135d91756093bd88d191ca260b28e083 | [
"MIT"
] | 6 | 2020-06-28T06:40:50.000Z | 2022-02-25T11:02:18.000Z | arec/python/antchain_sdk_arec/__init__.py | alipay/antchain-openapi-prod-sdk | f78549e5135d91756093bd88d191ca260b28e083 | [
"MIT"
] | null | null | null | arec/python/antchain_sdk_arec/__init__.py | alipay/antchain-openapi-prod-sdk | f78549e5135d91756093bd88d191ca260b28e083 | [
"MIT"
] | 6 | 2020-06-30T09:29:03.000Z | 2022-01-07T10:42:22.000Z | __version__ = '1.4.10' | 22 | 22 | 0.681818 | 4 | 22 | 2.75 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.2 | 0.090909 | 22 | 1 | 22 | 22 | 0.35 | 0 | 0 | 0 | 0 | 0 | 0.26087 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
ab9a78e58615ed02ca0a611a31d004dd01e29ae3 | 43 | py | Python | chatbot/constants.py | IronEdward/chatbot | dbfcc5ba90dbb8bc18f335e3d6637771c8c5a996 | [
"MIT"
] | null | null | null | chatbot/constants.py | IronEdward/chatbot | dbfcc5ba90dbb8bc18f335e3d6637771c8c5a996 | [
"MIT"
] | null | null | null | chatbot/constants.py | IronEdward/chatbot | dbfcc5ba90dbb8bc18f335e3d6637771c8c5a996 | [
"MIT"
] | null | null | null | symbols = "@+*=/_#$%&'~^[]{}`"
padding = 20 | 21.5 | 30 | 0.395349 | 3 | 43 | 5.333333 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.052632 | 0.116279 | 43 | 2 | 31 | 21.5 | 0.368421 | 0 | 0 | 0 | 0 | 0 | 0.409091 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
abc1f8451e951c414a7ea3a6d467e18868ab7a8b | 181 | py | Python | src/core/app/app/crud/crud_city.py | WeAreBeep/FrontlineUkraine | 9ace8222af347f8ebbcaf444f375b2736f49cd9f | [
"MIT"
] | null | null | null | src/core/app/app/crud/crud_city.py | WeAreBeep/FrontlineUkraine | 9ace8222af347f8ebbcaf444f375b2736f49cd9f | [
"MIT"
] | null | null | null | src/core/app/app/crud/crud_city.py | WeAreBeep/FrontlineUkraine | 9ace8222af347f8ebbcaf444f375b2736f49cd9f | [
"MIT"
] | null | null | null | from pydantic import BaseModel
from .base import CRUDBase
from app.models.city import City
class CRUDCity(CRUDBase[City, BaseModel, BaseModel]):
pass
city = CRUDCity(City)
| 15.083333 | 53 | 0.767956 | 24 | 181 | 5.791667 | 0.5 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.160221 | 181 | 11 | 54 | 16.454545 | 0.914474 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0.166667 | 0.5 | 0 | 0.666667 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 1 | 0 | 0 | 4 |
abdfb032e5ebd7c73bfb7e17362291c6b105b4c5 | 384 | py | Python | day47/decorator_exercise.py | nurmatthias/100DaysOfCode | 22002e4b31d13e6b52e6b9222d2e91c2070c5744 | [
"Apache-2.0"
] | null | null | null | day47/decorator_exercise.py | nurmatthias/100DaysOfCode | 22002e4b31d13e6b52e6b9222d2e91c2070c5744 | [
"Apache-2.0"
] | null | null | null | day47/decorator_exercise.py | nurmatthias/100DaysOfCode | 22002e4b31d13e6b52e6b9222d2e91c2070c5744 | [
"Apache-2.0"
] | null | null | null | # Create the logging_decorator() function 👇
def logging_decorator(function):
def wrapper(*args, **kwargs):
print(f"call {function.__name__} with {args} and {kwargs}: {function(*args, **kwargs)}")
return wrapper
# Use the decorator 👇
@logging_decorator
def function_to_log(value, key):
return f"getting {value} and {key}"
function_to_log("dies und das", "key") | 25.6 | 96 | 0.695313 | 53 | 384 | 4.867925 | 0.490566 | 0.186047 | 0.186047 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.164063 | 384 | 15 | 97 | 25.6 | 0.797508 | 0.158854 | 0 | 0 | 0 | 0.125 | 0.367601 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.375 | false | 0 | 0 | 0.125 | 0.625 | 0.125 | 0 | 0 | 0 | null | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 4 |
e60abb4fb59d6c712ff9af0750a9c709b61facfe | 8,012 | py | Python | dlkit/abstract_osid/id/managers.py | UOC/dlkit | a9d265db67e81b9e0f405457464e762e2c03f769 | [
"MIT"
] | 2 | 2018-02-23T12:16:11.000Z | 2020-10-08T17:54:24.000Z | dlkit/abstract_osid/id/managers.py | UOC/dlkit | a9d265db67e81b9e0f405457464e762e2c03f769 | [
"MIT"
] | 87 | 2017-04-21T18:57:15.000Z | 2021-12-13T19:43:57.000Z | dlkit/abstract_osid/id/managers.py | UOC/dlkit | a9d265db67e81b9e0f405457464e762e2c03f769 | [
"MIT"
] | 1 | 2018-03-01T16:44:25.000Z | 2018-03-01T16:44:25.000Z | """Implementations of id abstract base class managers."""
# pylint: disable=invalid-name
# Method names comply with OSID specification.
# pylint: disable=no-init
# Abstract classes do not define __init__.
# pylint: disable=too-few-public-methods
# Some interfaces are specified as 'markers' and include no methods.
# pylint: disable=too-many-public-methods
# Number of methods are defined in specification
# pylint: disable=too-many-ancestors
# Inheritance defined in specification
# pylint: disable=too-many-arguments
# Argument signature defined in specification.
# pylint: disable=duplicate-code
# All apparent duplicates have been inspected. They aren't.
import abc
class IdProfile:
"""The ``IdProfile`` describes the interoperability among id services."""
__metaclass__ = abc.ABCMeta
@abc.abstractmethod
def supports_id_lookup(self):
"""Tests if ``Id`` lookup is supported.
:return: ``true`` if ``Id`` lookup is supported, ``false`` otherwise
:rtype: ``boolean``
*compliance: mandatory -- This method must be implemented.*
"""
return # boolean
@abc.abstractmethod
def supports_id_issue(self):
"""Tests if an ``Id`` issue service is supported.
:return: ``true`` if ``Id`` issuing is supported, ``false`` otherwise
:rtype: ``boolean``
*compliance: mandatory -- This method must be implemented.*
"""
return # boolean
@abc.abstractmethod
def supports_id_admin(self):
"""Tests if an ``Id`` administrative service is supported.
:return: ``true`` if ``Id`` administration is supported, ``false`` otherwise
:rtype: ``boolean``
*compliance: mandatory -- This method must be implemented.*
"""
return # boolean
@abc.abstractmethod
def supports_id_batch(self):
"""Tests for the availability of an Id batch service.
:return: ``true`` if an Id batch service is available, ``false`` otherwise
:rtype: ``boolean``
*compliance: mandatory -- This method must be implemented.*
"""
return # boolean
class IdManager:
"""This manager provides access to the available sessions of the Id service.
``Ids`` are created through the ``IdAdminSession`` which provides
the means for creating a unique identifier.
The ``IdLookupSession`` can be used for mapping one ``Id`` to
another in addition to getting a list of the assigned identifiers.
"""
__metaclass__ = abc.ABCMeta
@abc.abstractmethod
def get_id_lookup_session(self):
"""Gets the session associated with the id lookup service.
:return: an ``IdLookupSession``
:rtype: ``osid.id.IdLookupSession``
:raise: ``OperationFailed`` -- unable to complete request
:raise: ``Unimplemented`` -- ``supports_id_lookup()`` is ``false``
*compliance: optional -- This method must be implemented if
``supports_id_lookup()`` is ``true``.*
"""
return # osid.id.IdLookupSession
id_lookup_session = property(fget=get_id_lookup_session)
@abc.abstractmethod
def get_id_issue_session(self):
"""Gets the session associated with the id issue service.
:return: an ``IdIssueSession``
:rtype: ``osid.id.IdIssueSession``
:raise: ``OperationFailed`` -- unable to complete request
:raise: ``Unimplemented`` -- ``supports_id_issue()`` is ``false``
*compliance: optional -- This method must be implemented if
``supports_id_issue()`` is ``true``.*
"""
return # osid.id.IdIssueSession
id_issue_session = property(fget=get_id_issue_session)
@abc.abstractmethod
def get_id_admin_session(self):
"""Gets the session associated with the id admin service.
:return: an ``IdAdminSession``
:rtype: ``osid.id.IdAdminSession``
:raise: ``OperationFailed`` -- unable to complete request
:raise: ``Unimplemented`` -- ``supports_id_admin()`` is ``false``
*compliance: optional -- This method must be implemented if
``supports_id_admin()`` is ``true``.*
"""
return # osid.id.IdAdminSession
id_admin_session = property(fget=get_id_admin_session)
@abc.abstractmethod
def get_id_batch_manager(self):
"""Gets an ``IdBatchManager``.
:return: an ``IdBatchManager``
:rtype: ``osid.id.batch.IdBatchManager``
:raise: ``OperationFailed`` -- unable to complete request
:raise: ``Unimplemented`` -- ``supports_id_batch()`` is ``false``
*compliance: optional -- This method must be implemented if
``supports_id_batch()`` is ``true``.*
"""
return # osid.id.batch.IdBatchManager
id_batch_manager = property(fget=get_id_batch_manager)
class IdProxyManager:
"""This manager provides access to the available sessions of the Id service.
Methods in this manager support the passing of a ``Proxy`` object
for the purpose of pasisng information from a server envrionment.
``Ids`` are created through the ``IdAdminSession`` which provides
the means for creating a unique identifier. The ``IdBrowserSession``
can be used for mapping one ``Id`` to another in addition to getting
a list of the assigned identifiers.
"""
__metaclass__ = abc.ABCMeta
@abc.abstractmethod
def get_id_lookup_session(self, proxy):
"""Gets the session associated with the id lookup service.
:param proxy: a proxy
:type proxy: ``osid.proxy.Proxy``
:return: an ``IdLookupSession``
:rtype: ``osid.id.IdLookupSession``
:raise: ``NullArgument`` -- ``proxy`` is ``null``
:raise: ``OperationFailed`` -- unable to complete request
:raise: ``Unimplemented`` -- ``supports_id_lookup()`` is ``false``
*compliance: optional -- This method must be implemented if
``supports_id_lookup()`` is ``true``.*
"""
return # osid.id.IdLookupSession
@abc.abstractmethod
def get_id_issue_session(self, proxy):
"""Gets the session associated with the id issue service.
:param proxy: a proxy
:type proxy: ``osid.proxy.Proxy``
:return: an ``IdIssueSession``
:rtype: ``osid.id.IdIssueSession``
:raise: ``NullArgument`` -- ``proxy`` is ``null``
:raise: ``OperationFailed`` -- ``unable to complete request``
:raise: ``Unimplemented`` -- ``supports_id_issue()`` is ``false``
*compliance: optional -- This method must be implemented if
``supports_id_issue()`` is ``true``.*
"""
return # osid.id.IdIssueSession
@abc.abstractmethod
def get_id_admin_session(self, proxy):
"""Gets the session associated with the id administrative service.
:param proxy: a proxy
:type proxy: ``osid.proxy.Proxy``
:return: an ``IdAdminSession``
:rtype: ``osid.id.IdAdminSession``
:raise: ``NullArgument`` -- ``proxy`` is ``null``
:raise: ``OperationFailed`` -- ``unable to complete request``
:raise: ``Unimplemented`` -- ``supports_id_admin()`` is ``false``
*compliance: optional -- This method must be implemented if
``supports_id_admin()`` is ``true``.*
"""
return # osid.id.IdAdminSession
@abc.abstractmethod
def get_id_batch_proxy_manager(self):
"""Gets an ``IdnProxyManager``.
:return: an ``IdBatchProxyManager``
:rtype: ``osid.id.batch.IdBatchProxyManager``
:raise: ``OperationFailed`` -- unable to complete request
:raise: ``Unimplemented`` -- ``supports_id_batch()`` is ``false``
*compliance: optional -- This method must be implemented if
``supports_id_batch()`` is ``true``.*
"""
return # osid.id.batch.IdBatchProxyManager
id_batch_proxy_manager = property(fget=get_id_batch_proxy_manager)
| 33.244813 | 84 | 0.637918 | 888 | 8,012 | 5.634009 | 0.176802 | 0.039976 | 0.047971 | 0.038377 | 0.781531 | 0.744154 | 0.703578 | 0.673996 | 0.597641 | 0.56626 | 0 | 0 | 0.238642 | 8,012 | 240 | 85 | 33.383333 | 0.820164 | 0.699825 | 0 | 0.5625 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.25 | false | 0 | 0.020833 | 0 | 0.75 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 4 |
e6198c5d5a0921a4ff0a7d844fef961ceb8792b3 | 603 | py | Python | day07/test_util.py | aschmied/advent-of-code-2016 | 90d6f2415a84b3d2db740252a1a87193d3a47aaa | [
"BSD-2-Clause"
] | null | null | null | day07/test_util.py | aschmied/advent-of-code-2016 | 90d6f2415a84b3d2db740252a1a87193d3a47aaa | [
"BSD-2-Clause"
] | null | null | null | day07/test_util.py | aschmied/advent-of-code-2016 | 90d6f2415a84b3d2db740252a1a87193d3a47aaa | [
"BSD-2-Clause"
] | null | null | null | import unittest
import util
class TestUtil(unittest.TestCase):
def test_flat_map(self):
self.assertEqual(util.flatten([]), [])
self.assertEqual(util.flatten([[]]), [])
self.assertEqual(util.flatten([[], []]), [])
self.assertEqual(util.flatten([[1], [2, 3]]), [1, 2, 3])
def test_map_flatten(self):
callable_returning_list = lambda x: [x, x]
self.assertEqual(util.map_flatten(callable_returning_list, []), [])
self.assertEqual(util.map_flatten(callable_returning_list, [1]), [1, 1])
self.assertEqual(util.map_flatten(callable_returning_list, [1, 2]), [1, 1, 2, 2])
| 35.470588 | 85 | 0.6733 | 80 | 603 | 4.8875 | 0.2625 | 0.268542 | 0.340153 | 0.265985 | 0.654731 | 0.654731 | 0.654731 | 0.654731 | 0.526854 | 0.265985 | 0 | 0.028791 | 0.135987 | 603 | 16 | 86 | 37.6875 | 0.721689 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.538462 | 1 | 0.153846 | false | 0 | 0.153846 | 0 | 0.384615 | 0 | 0 | 0 | 0 | null | 1 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
05376bf1c11a7cb90005d2b6f119ea1ab2c34f9a | 927 | py | Python | aiotdlib/api/functions/close_chat.py | jraylan/aiotdlib | 4528fcfca7c5c69b54a878ce6ce60e934a2dcc73 | [
"MIT"
] | 37 | 2021-05-04T10:41:41.000Z | 2022-03-30T13:48:05.000Z | aiotdlib/api/functions/close_chat.py | jraylan/aiotdlib | 4528fcfca7c5c69b54a878ce6ce60e934a2dcc73 | [
"MIT"
] | 13 | 2021-07-17T19:54:51.000Z | 2022-02-26T06:50:00.000Z | aiotdlib/api/functions/close_chat.py | jraylan/aiotdlib | 4528fcfca7c5c69b54a878ce6ce60e934a2dcc73 | [
"MIT"
] | 7 | 2021-09-22T21:27:11.000Z | 2022-02-20T02:33:19.000Z | # =============================================================================== #
# #
# This file has been generated automatically!! Do not change this manually! #
# #
# =============================================================================== #
from __future__ import annotations
from pydantic import Field
from ..base_object import BaseObject
class CloseChat(BaseObject):
"""
Informs TDLib that the chat is closed by the user. Many useful activities depend on the chat being opened or closed
:param chat_id: Chat identifier
:type chat_id: :class:`int`
"""
ID: str = Field("closeChat", alias="@type")
chat_id: int
@staticmethod
def read(q: dict) -> CloseChat:
return CloseChat.construct(**q)
| 33.107143 | 119 | 0.435814 | 77 | 927 | 5.142857 | 0.675325 | 0.045455 | 0.050505 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.332255 | 927 | 27 | 120 | 34.333333 | 0.639742 | 0.626753 | 0 | 0 | 1 | 0 | 0.046205 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.111111 | false | 0 | 0.333333 | 0.111111 | 0.888889 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 1 | 0 | 0 | 4 |
05551eaeba4da195c25fbc8d6e5e02277545db29 | 58 | py | Python | snippets/python/network/request/pyquery.py | c6401/Snippets | a88d97005658eeda99f1a2766e3d069a64e142cb | [
"MIT"
] | null | null | null | snippets/python/network/request/pyquery.py | c6401/Snippets | a88d97005658eeda99f1a2766e3d069a64e142cb | [
"MIT"
] | null | null | null | snippets/python/network/request/pyquery.py | c6401/Snippets | a88d97005658eeda99f1a2766e3d069a64e142cb | [
"MIT"
] | null | null | null | from pyquery import PyQuery as PQ
pq = PQ('https://...')
| 14.5 | 33 | 0.637931 | 9 | 58 | 4.111111 | 0.666667 | 0.216216 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.172414 | 58 | 3 | 34 | 19.333333 | 0.770833 | 0 | 0 | 0 | 0 | 0 | 0.189655 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.5 | 0 | 0.5 | 0 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
0563c8f7660ae70cb7dd32841a4d3519ca5f8080 | 28 | py | Python | tests/test_schema.py | sparesnmechs/sparesnmechs | 44a7178fcfd0c89004d9f31734405c8d0fd5cd97 | [
"MIT"
] | null | null | null | tests/test_schema.py | sparesnmechs/sparesnmechs | 44a7178fcfd0c89004d9f31734405c8d0fd5cd97 | [
"MIT"
] | 9 | 2021-02-27T13:13:38.000Z | 2021-06-04T11:57:12.000Z | tests/test_schema.py | sparesnmechs/sparesnmechs | 44a7178fcfd0c89004d9f31734405c8d0fd5cd97 | [
"MIT"
] | null | null | null | """GraphQL schema tests."""
| 14 | 27 | 0.642857 | 3 | 28 | 6 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.107143 | 28 | 1 | 28 | 28 | 0.72 | 0.75 | 0 | null | 0 | null | 0 | 0 | null | 0 | 0 | 0 | null | 1 | null | true | 0 | 0 | null | null | null | 1 | 1 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
5565c84c1bea21c16e2de2bfc76a9b366d50efa5 | 157 | py | Python | Chapter 06/Praktikum-3/operasi.py | icaksh/Python-Projects-Protek | dfd56ea5afc637a8850911a9296131652de383c5 | [
"MIT"
] | null | null | null | Chapter 06/Praktikum-3/operasi.py | icaksh/Python-Projects-Protek | dfd56ea5afc637a8850911a9296131652de383c5 | [
"MIT"
] | null | null | null | Chapter 06/Praktikum-3/operasi.py | icaksh/Python-Projects-Protek | dfd56ea5afc637a8850911a9296131652de383c5 | [
"MIT"
] | null | null | null | from operation import *
a = 10
b = 7
print(a,'+',b,'=',jumlah(a,b))
print(a,'-',b,'=',kurang(a,b))
print(a,'*',b,'=',kali(a,b))
print(a,'/',b,'=',bagi(a,b)) | 19.625 | 30 | 0.509554 | 31 | 157 | 2.580645 | 0.387097 | 0.2 | 0.35 | 0.3 | 0.3375 | 0 | 0 | 0 | 0 | 0 | 0 | 0.020979 | 0.089172 | 157 | 8 | 31 | 19.625 | 0.538462 | 0 | 0 | 0 | 0 | 0 | 0.050633 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.142857 | 0 | 0.142857 | 0.571429 | 0 | 0 | 0 | null | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 4 |
558b402d06f114f5431a4f0bc66f0207a02e96bb | 4,344 | py | Python | reconstruction/globals/global_values.py | tecdatalab/biostructure | a30e907e83fa5bbfb934d951b7c663b622104fcc | [
"Apache-2.0"
] | null | null | null | reconstruction/globals/global_values.py | tecdatalab/biostructure | a30e907e83fa5bbfb934d951b7c663b622104fcc | [
"Apache-2.0"
] | 15 | 2019-06-17T16:13:39.000Z | 2022-02-27T05:23:59.000Z | reconstruction/globals/global_values.py | tecdatalab/biostructure | a30e907e83fa5bbfb934d951b7c663b622104fcc | [
"Apache-2.0"
] | null | null | null | maps_with_pdb_origin = ['emd_0009.map', 'emd_0244.map', 'emd_0293.map', 'emd_0355.map', 'emd_0362.map', 'emd_0366.map',
'emd_0367.map', 'emd_0404.map', 'emd_0434.map', 'emd_0493.map', 'emd_0646.map', 'emd_0647.map',
'emd_0648.map', 'emd_0695.map', 'emd_0728.map', 'emd_0729.map', 'emd_0777.map', 'emd_0778.map',
'emd_0790.map', 'emd_0901.map', 'emd_0979.map', 'emd_10132.map', 'emd_10194.map',
'emd_10373.map',
'emd_10464.map', 'emd_10699.map', 'emd_1181.map', 'emd_1261.map', 'emd_1263.map',
'emd_1884.map',
'emd_1918.map', 'emd_1983.map', 'emd_1988.map', 'emd_1989.map', 'emd_1990.map', 'emd_2005.map',
'emd_20267.map', 'emd_20287.map', 'emd_20493.map', 'emd_20511.map', 'emd_2071.map',
'emd_2072.map',
'emd_20721.map', 'emd_20813.map', 'emd_20924.map', 'emd_20931.map', 'emd_21121.map',
'emd_21335.map',
'emd_21585.map', 'emd_21602.map', 'emd_2233.map', 'emd_2528.map', 'emd_2594.map',
'emd_2595.map',
'emd_2605.map', 'emd_2676.map', 'emd_2706.map', 'emd_2751.map', 'emd_2752.map', 'emd_2786.map',
'emd_2813.map', 'emd_2845.map', 'emd_2860.map', 'emd_2917.map', 'emd_2925.map', 'emd_30036.map',
'emd_3101.map', 'emd_3133.map', 'emd_3164.map', 'emd_3165.map', 'emd_3166.map', 'emd_3167.map',
'emd_3168.map', 'emd_3169.map', 'emd_3170.map', 'emd_3235.map', 'emd_3241.map', 'emd_3305.map',
'emd_3329.map', 'emd_3352.map', 'emd_3355.map', 'emd_3356.map', 'emd_3433.map', 'emd_3445.map',
'emd_3467.map', 'emd_3468.map', 'emd_3469.map', 'emd_3470.map', 'emd_3471.map', 'emd_3472.map',
'emd_3473.map', 'emd_3474.map', 'emd_3475.map', 'emd_3477.map', 'emd_3478.map', 'emd_3479.map',
'emd_3480.map', 'emd_3481.map', 'emd_3482.map', 'emd_3483.map', 'emd_3484.map', 'emd_3522.map',
'emd_3527.map', 'emd_3529.map', 'emd_3530.map', 'emd_3604.map', 'emd_3634.map', 'emd_3669.map',
'emd_3696.map', 'emd_3706.map', 'emd_3778.map', 'emd_3803.map', 'emd_3850.map', 'emd_3894.map',
'emd_3896.map', 'emd_3954.map', 'emd_4021.map', 'emd_4025.map', 'emd_4057.map', 'emd_4078.map',
'emd_4100.map', 'emd_4154.map', 'emd_4318.map', 'emd_4515.map', 'emd_4671.map', 'emd_4680.map',
'emd_4707.map', 'emd_4708.map', 'emd_4710.map', 'emd_4742.map', 'emd_4743.map', 'emd_4744.map',
'emd_4764.map', 'emd_4918.map', 'emd_4940.map', 'emd_4975.map', 'emd_5002.map', 'emd_5100.map',
'emd_5258.map', 'emd_5335.map', 'emd_5391.map', 'emd_5395.map', 'emd_5423.map', 'emd_5607.map',
'emd_5609.map', 'emd_5610.map', 'emd_6102.map', 'emd_6284.map', 'emd_6285.map', 'emd_6286.map',
'emd_6369.map', 'emd_6476.map', 'emd_6779.map', 'emd_6781.map', 'emd_6782.map', 'emd_6783.map',
'emd_6823.map', 'emd_6826.map', 'emd_6850.map', 'emd_7065.map', 'emd_7090.map', 'emd_7305.map',
'emd_7328.map', 'emd_7463.map', 'emd_7529.map', 'emd_7896.map', 'emd_7939.map', 'emd_7940.map',
'emd_8132.map', 'emd_8133.map', 'emd_8134.map', 'emd_8148.map', 'emd_8149.map', 'emd_8190.map',
'emd_8427.map', 'emd_8513.map', 'emd_8539.map', 'emd_8579.map', 'emd_8886.map', 'emd_8898.map',
'emd_8981.map', 'emd_9043.map', 'emd_9134.map', 'emd_9147.map', 'emd_9163.map', 'emd_9272.map',
'emd_9302.map', 'emd_9303.map', 'emd_9378.map', 'emd_9387.map', 'emd_9388.map', 'emd_9594.map',
'emd_9621.map', 'emd_9714.map', 'emd_9715.map', 'emd_9716.map', 'emd_9757.map', 'emd_9841.map',
'emd_9881.map', 'emd_9882.map', 'emd_10944.map', 'emd_10960.map', 'emd_10748.map',
'emd_10754.map',
'emd_11173.map']
maps_with_pdb_origin_problems = ["3235", "3706", "4680"]
| 101.023256 | 120 | 0.538444 | 627 | 4,344 | 3.392345 | 0.338118 | 0.575458 | 0.010343 | 0.015985 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.269546 | 0.269797 | 4,344 | 42 | 121 | 103.428571 | 0.401009 | 0 | 0 | 0 | 0 | 0 | 0.574355 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
559de769046aaaee0afe102944cba54828cf12fe | 1,427 | py | Python | src/maps.py | BSathvik/FarmWorker | 1495a75051fdbf2f29b4a193f9a0df2f47203e32 | [
"MIT"
] | null | null | null | src/maps.py | BSathvik/FarmWorker | 1495a75051fdbf2f29b4a193f9a0df2f47203e32 | [
"MIT"
] | null | null | null | src/maps.py | BSathvik/FarmWorker | 1495a75051fdbf2f29b4a193f9a0df2f47203e32 | [
"MIT"
] | 1 | 2019-06-18T06:43:18.000Z | 2019-06-18T06:43:18.000Z | # -*- coding: utf-8 -*-
import json
import requests
class GoogleMaps:
def __init__(self):
pass
def distance_json(self, latitude, longitude, destination_param):
destination = (destination_param+"").replace(" ", "+")
key = "AIzaSyA79fdTvjbYAJCx3CEzMe31PexdQZI9TZE"
req = requests.get("https://maps.googleapis.com/maps/api/distancematrix/json?origins="+latitude+","+longitude+"&destinations="+destination+"&key="+key)
data = json.loads(req.text)
distance_str_km = data["rows"][0]["elements"][0]["distance"]["text"]
time = data["rows"][0]["elements"][0]["duration"]["text"]
distance = float(distance_str_km[:-3])
json_data = {"d": distance, "t": time}
return json.dumps(json_data)
def trade_off_analytics(self, latitude, longitude, destination_param):
destination = (destination_param + "").replace(" ", "+")
key = "AIzaSyA79fdTvjbYAJCx3CEzMe31PexdQZI9TZE"
req = requests.get(
"https://maps.googleapis.com/maps/api/distancematrix/json?origins=" + latitude + "," + longitude + "&destinations=" + destination + "&key=" + key)
data = json.loads(req.text)
distance = data["rows"][0]["elements"][0]["distance"]["value"]
time = data["rows"][0]["elements"][0]["duration"]["value"]
json_data = {"d": distance, "t": time}
return json.dumps(json_data)
| 29.729167 | 159 | 0.616678 | 150 | 1,427 | 5.74 | 0.333333 | 0.078978 | 0.041812 | 0.078978 | 0.826945 | 0.826945 | 0.766551 | 0.696864 | 0.696864 | 0.696864 | 0 | 0.019332 | 0.202523 | 1,427 | 47 | 160 | 30.361702 | 0.737258 | 0.014716 | 0 | 0.4 | 0 | 0 | 0.252137 | 0.055556 | 0 | 0 | 0 | 0 | 0 | 1 | 0.12 | false | 0.04 | 0.08 | 0 | 0.32 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 1 | 1 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
55a8349be4e6a41b81f460ba95d7d706f822fc98 | 137 | py | Python | 3.Python/nithish9.py | tony21122000/Learn-Coding | 11862f3a372069693bd381b1f99063d95d3b2b65 | [
"MIT"
] | 54 | 2020-10-01T07:06:36.000Z | 2021-10-21T03:24:30.000Z | 3.Python/nithish9.py | tony21122000/Learn-Coding | 11862f3a372069693bd381b1f99063d95d3b2b65 | [
"MIT"
] | 19 | 2020-10-01T13:04:55.000Z | 2020-10-27T06:10:52.000Z | 3.Python/nithish9.py | tony21122000/Learn-Coding | 11862f3a372069693bd381b1f99063d95d3b2b65 | [
"MIT"
] | 97 | 2020-10-01T07:07:17.000Z | 2021-10-21T03:25:20.000Z | name, age = "nithish", *18*
username = "*nithish9"
print ('Hello!')
print("Name: {}\nAge: {}\nUsername: {}".format(name, age, username))
| 27.4 | 68 | 0.620438 | 16 | 137 | 5.3125 | 0.6875 | 0.164706 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.024793 | 0.116788 | 137 | 4 | 69 | 34.25 | 0.677686 | 0 | 0 | 0 | 0 | 0 | 0.386861 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0 | null | null | 0.5 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 4 |
e954fd311cae220e9b5ed13a586ca04cc2d272b1 | 105 | py | Python | 6-Patron/python/FabricaBotas.py | TanZng/patrones-combinados | 93796d9d5296649bd76b7b2ee7c723156b9a120f | [
"MIT"
] | 1 | 2021-09-13T15:45:48.000Z | 2021-09-13T15:45:48.000Z | 6-Patron/python/FabricaBotas.py | TanZng/patrones-combinados | 93796d9d5296649bd76b7b2ee7c723156b9a120f | [
"MIT"
] | null | null | null | 6-Patron/python/FabricaBotas.py | TanZng/patrones-combinados | 93796d9d5296649bd76b7b2ee7c723156b9a120f | [
"MIT"
] | 1 | 2021-09-24T03:00:47.000Z | 2021-09-24T03:00:47.000Z | import abc
class FabricaBotas(abc.ABC):
@abc.abstractmethod
def crearBotas(self):
pass
| 13.125 | 28 | 0.666667 | 12 | 105 | 5.833333 | 0.75 | 0.171429 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.247619 | 105 | 7 | 29 | 15 | 0.886076 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.2 | false | 0.2 | 0.2 | 0 | 0.6 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 4 |
e95a885231b71da76be23dc4180bda50b439233c | 80 | py | Python | mpunet/errors/__init__.py | alexsosn/MultiPlanarUNet | 2d1cecdee391be8e9f72da95e33077ed82a2183a | [
"MIT"
] | 156 | 2018-12-19T19:21:30.000Z | 2022-03-10T13:14:52.000Z | mpunet/errors/__init__.py | alexsosn/MultiPlanarUNet | 2d1cecdee391be8e9f72da95e33077ed82a2183a | [
"MIT"
] | 25 | 2019-07-30T07:45:26.000Z | 2022-02-10T00:38:31.000Z | mpunet/errors/__init__.py | alexsosn/MultiPlanarUNet | 2d1cecdee391be8e9f72da95e33077ed82a2183a | [
"MIT"
] | 33 | 2019-01-26T16:34:50.000Z | 2022-02-20T13:48:44.000Z | from .implementation_change_errors import raise_non_sparse_metric_or_loss_error
| 40 | 79 | 0.9375 | 12 | 80 | 5.583333 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.05 | 80 | 1 | 80 | 80 | 0.881579 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
e96209dbcf1e817865e2ef611a6ae769dc486e3e | 110 | py | Python | src/pycounts/__init__.py | Annabgm/pycounts | 60173b8caa212c97665d6906991d8a2c94d4edbe | [
"MIT"
] | null | null | null | src/pycounts/__init__.py | Annabgm/pycounts | 60173b8caa212c97665d6906991d8a2c94d4edbe | [
"MIT"
] | null | null | null | src/pycounts/__init__.py | Annabgm/pycounts | 60173b8caa212c97665d6906991d8a2c94d4edbe | [
"MIT"
] | null | null | null | # read version from installed package
from importlib_metadata import version
__version__ = version("pycounts") | 36.666667 | 38 | 0.836364 | 13 | 110 | 6.692308 | 0.692308 | 0.321839 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.109091 | 110 | 3 | 39 | 36.666667 | 0.887755 | 0.318182 | 0 | 0 | 0 | 0 | 0.108108 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.5 | 0 | 0.5 | 0 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
75a6b0f07f651cea75005db2de4649f655480c9e | 142 | py | Python | components/core/conftest.py | LourensVeen/QCG-PilotJob | e78c35a9b16b1042a2d5b54352a2ca2e3a58c6b9 | [
"Apache-2.0"
] | null | null | null | components/core/conftest.py | LourensVeen/QCG-PilotJob | e78c35a9b16b1042a2d5b54352a2ca2e3a58c6b9 | [
"Apache-2.0"
] | null | null | null | components/core/conftest.py | LourensVeen/QCG-PilotJob | e78c35a9b16b1042a2d5b54352a2ca2e3a58c6b9 | [
"Apache-2.0"
] | null | null | null | import random
import time
from datetime import timedelta
import sys
import pytest
from qcg.pilotjob.service import QCGPMService
# FIXTURES
| 12.909091 | 45 | 0.830986 | 19 | 142 | 6.210526 | 0.684211 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.147887 | 142 | 10 | 46 | 14.2 | 0.975207 | 0.056338 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
75c24a0cbe0c4f20a032ff5aaf3eefd5019897ae | 69 | py | Python | __init__.py | notsoseamless/mancala | b8493c720c0eba80c7ea9a352efe4406012ed525 | [
"MIT"
] | null | null | null | __init__.py | notsoseamless/mancala | b8493c720c0eba80c7ea9a352efe4406012ed525 | [
"MIT"
] | null | null | null | __init__.py | notsoseamless/mancala | b8493c720c0eba80c7ea9a352efe4406012ed525 | [
"MIT"
] | null | null | null | '''
Python version of the Mancala game
'''
from mancala import main
| 11.5 | 34 | 0.724638 | 10 | 69 | 5 | 0.9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.188406 | 69 | 5 | 35 | 13.8 | 0.892857 | 0.492754 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
75e12dc012bbfa1d42d6128e5b4b65861f8ba443 | 221 | py | Python | py_Learn/ex13.py | tripdubroot/archive | 2442ac067c358ac537614050c029ae424ca9ed04 | [
"MIT"
] | null | null | null | py_Learn/ex13.py | tripdubroot/archive | 2442ac067c358ac537614050c029ae424ca9ed04 | [
"MIT"
] | null | null | null | py_Learn/ex13.py | tripdubroot/archive | 2442ac067c358ac537614050c029ae424ca9ed04 | [
"MIT"
] | null | null | null | from sys import argv
script, first, second, third = argv
print "The script is called:", script
print "Your first var is called:", first
print "Your second var is called:", second
print "Your third var is called:", third | 27.625 | 42 | 0.737557 | 36 | 221 | 4.527778 | 0.388889 | 0.196319 | 0.202454 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.171946 | 221 | 8 | 43 | 27.625 | 0.89071 | 0 | 0 | 0 | 0 | 0 | 0.436937 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.166667 | null | null | 0.666667 | 0 | 0 | 0 | null | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 4 |
75fe9a275449dbba7055b71f55ed4c4e7e30a6c0 | 280 | py | Python | authentik/policies/hibp/apps.py | BeryJu/passbook | 350f0d836580f4411524614f361a76c4f27b8a2d | [
"MIT"
] | 15 | 2020-01-05T09:09:57.000Z | 2020-11-28T05:27:39.000Z | authentik/policies/hibp/apps.py | BeryJu/passbook | 350f0d836580f4411524614f361a76c4f27b8a2d | [
"MIT"
] | 302 | 2020-01-21T08:03:59.000Z | 2020-12-04T05:04:57.000Z | authentik/policies/hibp/apps.py | BeryJu/passbook | 350f0d836580f4411524614f361a76c4f27b8a2d | [
"MIT"
] | 3 | 2020-03-04T08:21:59.000Z | 2020-08-01T20:37:18.000Z | """Authentik hibp app config"""
from django.apps import AppConfig
class AuthentikPolicyHIBPConfig(AppConfig):
"""Authentik hibp app config"""
name = "authentik.policies.hibp"
label = "authentik_policies_hibp"
verbose_name = "authentik Policies.HaveIBeenPwned"
| 23.333333 | 54 | 0.742857 | 29 | 280 | 7.068966 | 0.551724 | 0.24878 | 0.156098 | 0.214634 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.157143 | 280 | 11 | 55 | 25.454545 | 0.868644 | 0.182143 | 0 | 0 | 0 | 0 | 0.362385 | 0.316514 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.2 | 0 | 1 | 0 | 1 | 0 | 0 | null | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 4 |
f92fd9e8f49589970fef531665c58623fce5a352 | 70 | py | Python | sdc/__init__.py | KawashimaHirotaka/SensorDatasetCollection | 9aaea00404123235ada27dcab178e4c03b1b54a9 | [
"MIT"
] | 1 | 2020-04-18T03:09:20.000Z | 2020-04-18T03:09:20.000Z | sdc/__init__.py | khirotaka/SensorDatasetCollection | 9aaea00404123235ada27dcab178e4c03b1b54a9 | [
"MIT"
] | 3 | 2019-06-23T15:11:53.000Z | 2019-11-12T14:59:33.000Z | sdc/__init__.py | khirotaka/SensorDatasetCollection | 9aaea00404123235ada27dcab178e4c03b1b54a9 | [
"MIT"
] | 3 | 2019-07-03T14:52:57.000Z | 2019-07-03T15:16:24.000Z | from . import datasets
from . import utils
__version__ = "0.1-alpha"
| 14 | 25 | 0.728571 | 10 | 70 | 4.7 | 0.8 | 0.425532 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.034483 | 0.171429 | 70 | 4 | 26 | 17.5 | 0.775862 | 0 | 0 | 0 | 0 | 0 | 0.128571 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.666667 | 0 | 0.666667 | 0 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
f941d889cf4cf1cf37fa8414b1a9a717c66492ae | 373 | py | Python | Topics/Methods and attributes/Piggy bank/main.py | the-rennegade/jet-brains-coffee-machine | cd7c395d748e951b2fd9c724a8121d0f076a4633 | [
"MIT"
] | null | null | null | Topics/Methods and attributes/Piggy bank/main.py | the-rennegade/jet-brains-coffee-machine | cd7c395d748e951b2fd9c724a8121d0f076a4633 | [
"MIT"
] | null | null | null | Topics/Methods and attributes/Piggy bank/main.py | the-rennegade/jet-brains-coffee-machine | cd7c395d748e951b2fd9c724a8121d0f076a4633 | [
"MIT"
] | null | null | null | class PiggyBank:
def __init__(self, dollars, cents):
self.cents = cents % 100
self.dollars = cents // 100
self.dollars += dollars
def add_money(self, deposit_dollars, deposit_cents):
self.dollars += (self.cents + deposit_cents) // 100
self.cents = (self.cents + deposit_cents) % 100
self.dollars += deposit_dollars
| 31.083333 | 59 | 0.630027 | 44 | 373 | 5.113636 | 0.25 | 0.244444 | 0.213333 | 0.253333 | 0.248889 | 0.248889 | 0 | 0 | 0 | 0 | 0 | 0.043636 | 0.262735 | 373 | 11 | 60 | 33.909091 | 0.774545 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.222222 | false | 0 | 0 | 0 | 0.333333 | 0 | 0 | 0 | 0 | null | 1 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
f9a0163a2e6ed1c0438284fbb23d14930da8a23d | 62 | py | Python | library/demo/config.py | park-sungmoo/jquery.flowchart_ultide | 873b1b00caf832b67f9261d076ec71e61a64c513 | [
"MIT"
] | 81 | 2016-09-11T22:45:27.000Z | 2022-02-22T15:12:21.000Z | library/demo/config.py | park-sungmoo/jquery.flowchart_ultide | 873b1b00caf832b67f9261d076ec71e61a64c513 | [
"MIT"
] | 2 | 2019-01-26T20:39:14.000Z | 2020-08-01T13:14:19.000Z | library/demo/config.py | park-sungmoo/jquery.flowchart_ultide | 873b1b00caf832b67f9261d076ec71e61a64c513 | [
"MIT"
] | 34 | 2016-12-25T12:23:51.000Z | 2021-06-11T10:12:57.000Z | name = 'Demo'
main_js = 'static/modules/demo/javascript/main' | 20.666667 | 47 | 0.741935 | 9 | 62 | 5 | 0.777778 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.096774 | 62 | 3 | 47 | 20.666667 | 0.803571 | 0 | 0 | 0 | 0 | 0 | 0.619048 | 0.555556 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
f9d4c48913dab5a0da9f66dd8633ad38f7a34e6c | 148 | py | Python | tests/data/src/pep518-3.0/setup.py | smartsammler/pip | 54b983c2bd56dfbd61bbcc2dcc9177d4e55e25af | [
"MIT"
] | 1 | 2021-01-03T00:58:11.000Z | 2021-01-03T00:58:11.000Z | tests/data/src/pep518-3.0/setup.py | smartsammler/pip | 54b983c2bd56dfbd61bbcc2dcc9177d4e55e25af | [
"MIT"
] | null | null | null | tests/data/src/pep518-3.0/setup.py | smartsammler/pip | 54b983c2bd56dfbd61bbcc2dcc9177d4e55e25af | [
"MIT"
] | null | null | null | #!/usr/bin/env python
from setuptools import find_packages, setup
setup(name='pep518',
version='3.0',
packages=find_packages()
)
| 18.5 | 43 | 0.662162 | 19 | 148 | 5.052632 | 0.789474 | 0.25 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.042373 | 0.202703 | 148 | 7 | 44 | 21.142857 | 0.771186 | 0.135135 | 0 | 0 | 0 | 0 | 0.070866 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 0.2 | 0 | 0.2 | 0 | 1 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
f9d9a18049d919c1442946198bf6c09e5c5bbf45 | 1,335 | py | Python | lib/systems/alpha-d-psicopyranose.py | pulsar-chem/BPModule | f8e64e04fdb01947708f098e833600c459c2ff0e | [
"BSD-3-Clause"
] | null | null | null | lib/systems/alpha-d-psicopyranose.py | pulsar-chem/BPModule | f8e64e04fdb01947708f098e833600c459c2ff0e | [
"BSD-3-Clause"
] | null | null | null | lib/systems/alpha-d-psicopyranose.py | pulsar-chem/BPModule | f8e64e04fdb01947708f098e833600c459c2ff0e | [
"BSD-3-Clause"
] | null | null | null | import pulsar as psr
def load_ref_system():
""" Returns alpha-d-psicopyranose as found in the IQMol fragment library.
All credit to https://github.com/nutjunkie/IQmol
"""
return psr.make_system("""
O -0.8523 2.0191 0.6536
C -0.6803 0.9081 -0.2279
O 0.4856 1.2959 -0.9631
C 1.3351 0.2704 -1.5196
C 1.6070 -0.9064 -0.5712
O 2.4885 -0.5317 0.4760
C 0.2766 -1.4581 0.0015
O 0.5344 -2.5036 0.9184
C -0.5184 -0.3287 0.6918
O 0.2579 0.0386 1.8423
C -1.8746 0.8337 -1.2049
O -2.9669 0.1442 -0.6022
H 0.8797 -0.0602 -2.4691
H 2.2621 0.8478 -1.7198
H -1.5147 -0.6922 1.0428
H -0.3440 -1.9497 -0.7850
H 2.1772 -1.7145 -1.0918
H -1.6258 0.2177 -2.0903
H -2.1802 1.8431 -1.5330
H -0.2049 2.7370 0.4201
H -0.1042 0.8825 2.2275
H 1.1229 -2.1676 1.6503
H 2.0361 0.1134 1.0977
H -3.4053 0.7244 0.0631
""")
| 41.71875 | 77 | 0.401498 | 199 | 1,335 | 2.678392 | 0.527638 | 0.015009 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.538117 | 0.498876 | 1,335 | 31 | 78 | 43.064516 | 0.258595 | 0.08839 | 0 | 0 | 0 | 0 | 0.929825 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.035714 | true | 0 | 0.035714 | 0 | 0.107143 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
f9e8f6ee3f4b3a141978f750a01f3e2f885b6eb2 | 120 | py | Python | dataVIZ/admin.py | anish03/Logistic-Regression | dd4607a0c239e43c5c60fd713c9ce69a632e01d2 | [
"MIT"
] | null | null | null | dataVIZ/admin.py | anish03/Logistic-Regression | dd4607a0c239e43c5c60fd713c9ce69a632e01d2 | [
"MIT"
] | null | null | null | dataVIZ/admin.py | anish03/Logistic-Regression | dd4607a0c239e43c5c60fd713c9ce69a632e01d2 | [
"MIT"
] | null | null | null | from django.contrib import admin
from dataVIZ.models import studentInformation
admin.site.register(studentInformation)
| 24 | 45 | 0.866667 | 14 | 120 | 7.428571 | 0.714286 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.083333 | 120 | 4 | 46 | 30 | 0.945455 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 0.666667 | 0 | 0.666667 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
ddb98df423f8701b77667e2c8ffbe237e69814c3 | 7,767 | py | Python | src/xbase_test/layout/mos/base.py | skyworksinc/xbase | fde050e928d5d89b5507c818b41f5ef3253f38cd | [
"Apache-2.0"
] | 3 | 2020-10-15T04:33:57.000Z | 2021-12-22T07:42:30.000Z | src/xbase_test/layout/mos/base.py | skyworksinc/xbase | fde050e928d5d89b5507c818b41f5ef3253f38cd | [
"Apache-2.0"
] | null | null | null | src/xbase_test/layout/mos/base.py | skyworksinc/xbase | fde050e928d5d89b5507c818b41f5ef3253f38cd | [
"Apache-2.0"
] | 4 | 2020-04-27T16:42:57.000Z | 2021-10-19T15:25:59.000Z | # SPDX-License-Identifier: Apache-2.0
# Copyright 2019 Blue Cheetah Analog Design Inc.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from typing import Any, Dict, List, Tuple, Optional
from bag.util.immutable import Param
from bag.layout.template import TemplateDB
from xbase.layout.enum import MOSType, Alignment
from xbase.layout.wires import WireData
from xbase.layout.mos.placement.data import MOSArrayPlaceInfo, make_pinfo_compact
from xbase.layout.mos.data import MOSRowSpecs
from xbase.layout.mos.base import MOSBasePlaceInfo, MOSBase
class MOSOnly(MOSBase):
"""A MOSBase of only rows of transistors, no connection specs.
"""
def __init__(self, temp_db: TemplateDB, params: Param, **kwargs: Any) -> None:
MOSBase.__init__(self, temp_db, params, **kwargs)
@classmethod
def get_params_info(cls) -> Dict[str, str]:
return dict(
lch='channel length.',
fg='number of fingers.',
row_list='list of mos_type/width/threshold tuples.',
min_ntr='minimum number of horizontal tracks per row.',
w_list='list of transistor widths.',
)
@classmethod
def get_default_param_values(cls) -> Dict[str, Any]:
return dict(min_ntr=0, w_list=None)
def draw_layout(self):
lch: int = self.params['lch']
fg: int = self.params['fg']
row_list: List[Tuple[str, int, str]] = self.params['row_list']
min_ntr: int = self.params['min_ntr']
w_list: Optional[List[int]] = self.params['w_list']
if not row_list:
raise ValueError('Cannot draw empty rows.')
if w_list is None:
w_list = [info[1] for info in row_list]
elif len(w_list) != len(row_list):
raise ValueError('width list length mismatch')
row_specs = []
hm_layer = MOSBasePlaceInfo.get_conn_layer(self.grid.tech_info, lch) + 1
empty_wires = WireData.make_wire_data([], Alignment.CENTER_COMPACT, '')
for info in row_list:
mtype, w, th = info[:3]
if len(info) > 3:
flip = info[3]
else:
flip = False
row_specs.append(MOSRowSpecs(MOSType[mtype], w, th, empty_wires, empty_wires,
flip=flip))
ainfo = MOSArrayPlaceInfo(self.grid, lch, {}, {})
min_height = self.grid.get_track_pitch(hm_layer) * min_ntr
pinfo = make_pinfo_compact(ainfo, row_specs, True, True, min_height=min_height)
self.draw_base(pinfo)
self.set_mos_size(fg)
for ridx in range(len(row_list)):
self.add_mos(ridx, 0, fg, w=w_list[ridx])
class MOSOnlySPM(MOSBase):
"""A MOSBase of only rows of transistors with space in middle.
"""
def __init__(self, temp_db: TemplateDB, params: Param, **kwargs: Any) -> None:
MOSBase.__init__(self, temp_db, params, **kwargs)
@classmethod
def get_params_info(cls) -> Dict[str, str]:
return dict(
lch='channel length.',
fg='number of fingers.',
fg_sp='number of fingers in space block.',
row_list='list of mos_type/width/threshold tuples.',
min_ntr='minimum number of horizontal tracks per row.',
mos_sub='True to draw transistor and substrate.',
)
@classmethod
def get_default_param_values(cls) -> Dict[str, Any]:
return dict(mos_sub=False, min_ntr=0)
def draw_layout(self):
lch: int = self.params['lch']
fg: int = self.params['fg']
fg_sp: int = self.params['fg_sp']
row_list: List[Tuple[str, int, str]] = self.params['row_list']
min_ntr: int = self.params['min_ntr']
mos_sub: bool = self.params['mos_sub']
if not row_list:
raise ValueError('Cannot draw empty rows.')
row_specs = []
empty_wires = WireData.make_wire_data([], Alignment.CENTER_COMPACT, '')
hm_layer = MOSBasePlaceInfo.get_conn_layer(self.grid.tech_info, lch) + 1
for mtype, w, th in row_list:
row_specs.append(MOSRowSpecs(MOSType[mtype], w, th, empty_wires, empty_wires))
ainfo = MOSArrayPlaceInfo(self.grid, lch, {}, {})
min_height = self.grid.get_track_pitch(hm_layer) * min_ntr
pinfo = make_pinfo_compact(ainfo, row_specs, True, True, min_height=min_height)
self.draw_base(pinfo)
self.set_mos_size(2 * fg + fg_sp)
for ridx in range(len(row_list)):
self.add_mos(ridx, 0, fg)
if mos_sub:
self.add_substrate_contact(ridx, fg + fg_sp, seg=fg)
else:
self.add_mos(ridx, fg + fg_sp, fg)
class MOSOnlySPE(MOSBase):
"""A MOSBase of only rows of transistors with space on edges.
"""
def __init__(self, temp_db: TemplateDB, params: Param, **kwargs: Any) -> None:
MOSBase.__init__(self, temp_db, params, **kwargs)
@classmethod
def get_params_info(cls) -> Dict[str, str]:
return dict(
lch='channel length.',
fg='number of fingers.',
fg_sp='number of fingers in space block.',
row_list='list of mos_type/width/threshold tuples.',
)
def draw_layout(self):
lch: int = self.params['lch']
fg: int = self.params['fg']
fg_sp: int = self.params['fg_sp']
row_list: List[Tuple[str, int, str]] = self.params['row_list']
if not row_list:
raise ValueError('Cannot draw empty rows.')
row_specs = []
empty_wires = WireData.make_wire_data([], Alignment.CENTER_COMPACT, '')
for mtype, w, th in row_list:
row_specs.append(MOSRowSpecs(MOSType[mtype], w, th, empty_wires, empty_wires))
ainfo = MOSArrayPlaceInfo(self.grid, lch, {}, {})
pinfo = make_pinfo_compact(ainfo, row_specs, True, True)
self.draw_base(pinfo)
self.set_mos_size(2 * fg_sp + fg)
for ridx in range(len(row_list)):
self.add_mos(ridx, fg_sp, fg)
class SubOnly(MOSBase):
"""A MOSBase of only rows of substrates.
"""
def __init__(self, temp_db: TemplateDB, params: Param, **kwargs: Any) -> None:
MOSBase.__init__(self, temp_db, params, **kwargs)
@classmethod
def get_params_info(cls) -> Dict[str, str]:
return dict(
lch='channel length.',
fg='number of fingers.',
row_list='list of mos_type/width/threshold tuples.',
)
def draw_layout(self):
lch: int = self.params['lch']
fg: int = self.params['fg']
row_list: List[Tuple[str, int, str]] = self.params['row_list']
if not row_list:
raise ValueError('Cannot draw empty rows.')
row_specs = []
empty_wires = WireData.make_wire_data([], Alignment.CENTER_COMPACT, '')
for mtype, w, th in row_list:
row_specs.append(MOSRowSpecs(MOSType[mtype], w, th, empty_wires, empty_wires))
ainfo = MOSArrayPlaceInfo(self.grid, lch, {}, {})
pinfo = make_pinfo_compact(ainfo, row_specs, True, True)
self.draw_base(pinfo)
self.set_mos_size(fg)
for ridx in range(len(row_list)):
self.add_substrate_contact(ridx, 0, seg=fg)
| 35.958333 | 90 | 0.623793 | 1,052 | 7,767 | 4.407795 | 0.18251 | 0.03925 | 0.036446 | 0.024154 | 0.724391 | 0.704119 | 0.704119 | 0.698296 | 0.690101 | 0.690101 | 0 | 0.004013 | 0.262135 | 7,767 | 215 | 91 | 36.125581 | 0.805095 | 0.108407 | 0 | 0.716216 | 0 | 0 | 0.104049 | 0.013931 | 0 | 0 | 0 | 0 | 0 | 1 | 0.094595 | false | 0 | 0.054054 | 0.040541 | 0.216216 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
dde314fdb862f93b601e69e961dcd8ffb52bf20b | 100 | py | Python | catalog_queue/apps.py | VladimirFilonov/graphql-shop-example | 7f95b904ac29ed96ee1ad6692729359ca29ce40b | [
"MIT"
] | 1 | 2020-07-07T09:39:16.000Z | 2020-07-07T09:39:16.000Z | catalog_queue/apps.py | VladimirFilonov/graphql-shop-example | 7f95b904ac29ed96ee1ad6692729359ca29ce40b | [
"MIT"
] | 9 | 2019-12-04T23:07:42.000Z | 2022-02-10T09:46:29.000Z | catalog_queue/apps.py | VladimirFilonov/graphql-shop-example | 7f95b904ac29ed96ee1ad6692729359ca29ce40b | [
"MIT"
] | 4 | 2019-06-10T11:57:34.000Z | 2020-07-07T04:11:38.000Z | from django.apps import AppConfig
class CatalogQueueConfig(AppConfig):
name = 'catalog_queue'
| 16.666667 | 36 | 0.78 | 11 | 100 | 7 | 0.909091 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.15 | 100 | 5 | 37 | 20 | 0.905882 | 0 | 0 | 0 | 0 | 0 | 0.13 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.333333 | 0 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
fb28054bce5dc9f26e3f3f727c0672056947caf7 | 1,705 | py | Python | seligimus/maths/vector_2.py | AustinScola/seligimus | 206654fd8cf5e9b9a9da25439ccde2efe5a6cc7a | [
"MIT"
] | 1 | 2021-01-30T15:57:40.000Z | 2021-01-30T15:57:40.000Z | seligimus/maths/vector_2.py | AustinScola/seligimus | 206654fd8cf5e9b9a9da25439ccde2efe5a6cc7a | [
"MIT"
] | 100 | 2021-01-30T16:01:46.000Z | 2021-07-24T14:00:04.000Z | seligimus/maths/vector_2.py | AustinScola/seligimus | 206654fd8cf5e9b9a9da25439ccde2efe5a6cc7a | [
"MIT"
] | null | null | null | """A two-dimensional vector."""
from typing import Generic, TypeVar
from seligimus.python.decorators.operators.equality.standard_equality import standard_equality
from seligimus.python.decorators.standard_representation import standard_representation
T = TypeVar('T', int, float, complex) # pylint: disable=invalid-name
class Vector2(Generic[T]):
"""A two-dimensional vector."""
def __init__(self, x: T, y: T): # pylint: disable=invalid-name
self.x: T = x # pylint: disable=invalid-name
self.y: T = y # pylint: disable=invalid-name
__eq__ = standard_equality()
def __bool__(self) -> bool:
return bool(self.x) or bool(self.y)
@standard_representation
def __repr__(self) -> str:
pass # pragma: no cover
def __add__(self, other: 'Vector2') -> 'Vector2':
x: T = self.x + other.x # pylint: disable=invalid-name
y: T = self.y + other.y # pylint: disable=invalid-name
sum_ = Vector2(x, y)
return sum_
def __sub__(self, other: 'Vector2') -> 'Vector2':
x: T = self.x - other.x # pylint: disable=invalid-name
y: T = self.y - other.y # pylint: disable=invalid-name
difference = Vector2(x, y)
return difference
def __iadd__(self, other: 'Vector2') -> 'Vector2':
self.x += other.x
self.y += other.y
return self
def __isub__(self, other: 'Vector2') -> 'Vector2':
self.x -= other.x
self.y -= other.y
return self
def __neg__(self) -> 'Vector2':
x: T = -self.x # pylint: disable=invalid-name
y: T = -self.y # pylint: disable=invalid-name
negation = Vector2(x, y)
return negation
| 32.788462 | 94 | 0.619355 | 221 | 1,705 | 4.579186 | 0.226244 | 0.128459 | 0.197628 | 0.237154 | 0.455534 | 0.337945 | 0.337945 | 0.337945 | 0.337945 | 0.306324 | 0 | 0.010188 | 0.251613 | 1,705 | 51 | 95 | 33.431373 | 0.782915 | 0.210557 | 0 | 0.054054 | 0 | 0 | 0.048302 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.216216 | false | 0.027027 | 0.081081 | 0.027027 | 0.513514 | 0 | 0 | 0 | 0 | null | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 4 |
348b83f44e8a6bfb5f915a98c2b5c4861d226404 | 860 | py | Python | roman_numerals/2021-12-01/test.py | rbuchmeier/kata | aefd50ca9c8dd0daa04dcf1b6f4ec4eef7dd8f2f | [
"MIT"
] | null | null | null | roman_numerals/2021-12-01/test.py | rbuchmeier/kata | aefd50ca9c8dd0daa04dcf1b6f4ec4eef7dd8f2f | [
"MIT"
] | null | null | null | roman_numerals/2021-12-01/test.py | rbuchmeier/kata | aefd50ca9c8dd0daa04dcf1b6f4ec4eef7dd8f2f | [
"MIT"
] | null | null | null | import unittest
from main import *
class TestCase(unittest.TestCase):
def test_main(self):
self.assertEqual(1, 1)
class TestRoman(unittest.TestCase):
def test_roman_to_int(self):
self.assertEqual(roman_numeral(1), 'I')
self.assertEqual(roman_numeral(2), 'II')
self.assertEqual(roman_numeral(3), 'III')
self.assertEqual(roman_numeral(4), 'IV')
self.assertEqual(roman_numeral(5), 'V')
self.assertEqual(roman_numeral(8), 'VIII')
self.assertEqual(roman_numeral(9), 'IX')
self.assertEqual(roman_numeral(10), 'X')
self.assertEqual(roman_numeral(31), 'XXXI')
self.assertEqual(roman_numeral(345), 'CCCXLV')
self.assertEqual(roman_numeral(458), 'CDLVIII')
self.assertEqual(roman_numeral(3999), 'MMMCMXCIX')
if __name__ == '__main__':
unittest.main()
| 34.4 | 58 | 0.666279 | 104 | 860 | 5.278846 | 0.394231 | 0.355191 | 0.437158 | 0.590164 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.033046 | 0.190698 | 860 | 24 | 59 | 35.833333 | 0.755747 | 0 | 0 | 0 | 0 | 0 | 0.05814 | 0 | 0 | 0 | 0 | 0 | 0.619048 | 1 | 0.095238 | false | 0 | 0.095238 | 0 | 0.285714 | 0 | 0 | 0 | 0 | null | 1 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
34a660238bed2c514232ae01439382626e343bc5 | 245 | py | Python | pythonExamples/tutorial/variable.py | davidruffner/computation-physics-nyu-2009 | 754d48f820773cd6b1b3cd3a7444363b78e1ea00 | [
"MIT"
] | null | null | null | pythonExamples/tutorial/variable.py | davidruffner/computation-physics-nyu-2009 | 754d48f820773cd6b1b3cd3a7444363b78e1ea00 | [
"MIT"
] | null | null | null | pythonExamples/tutorial/variable.py | davidruffner/computation-physics-nyu-2009 | 754d48f820773cd6b1b3cd3a7444363b78e1ea00 | [
"MIT"
] | null | null | null | #variables demonstrated
print "This program is a demo of variables"
v=1
print "The value of v is now", v
v=v+1
print "v now equals itself plus one, making it worth", v
v=51
print "v can store any numerical value, to be used"
print "now v is", v
| 24.5 | 56 | 0.726531 | 51 | 245 | 3.490196 | 0.568627 | 0.033708 | 0.078652 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.020202 | 0.191837 | 245 | 9 | 57 | 27.222222 | 0.878788 | 0.089796 | 0 | 0 | 0 | 0 | 0.684685 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0 | null | null | 0.625 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 4 |
34ab3fe8845765aa5c612c00efe3eb9d249ce444 | 9,228 | py | Python | 32x32.py | noahzhy/kendryte-standalone-sdk | d358d8aca7245669a65330180e08eaf92b8a2dd9 | [
"Apache-2.0"
] | null | null | null | 32x32.py | noahzhy/kendryte-standalone-sdk | d358d8aca7245669a65330180e08eaf92b8a2dd9 | [
"Apache-2.0"
] | null | null | null | 32x32.py | noahzhy/kendryte-standalone-sdk | d358d8aca7245669a65330180e08eaf92b8a2dd9 | [
"Apache-2.0"
] | null | null | null | import numpy as np
import matplotlib.pyplot as plt
# data = [3045,2955,3005,3265,3405,3625,3485,3495,3205,3235,3295,3095,2885,3235,3125,2915,3055,3055,3165,3265,3055,3175,2975,3005,3005,3045,3075,3145,2955,2985,3055,3025,3165,3345,3395,3585,3395,3895,3625,3435,3205,3225,3345,3345,2985,3295,2975,3165,2885,3275,2955,3135,3005,3185,2985,3075,3045,3005,3045,3045,3005,2975,2895,2975,3595,3535,3525,3645,3795,3775,3685,3585,3365,3235,3445,3185,3445,3215,3345,3225,2975,3185,2975,3085,2945,2925,3045,3165,3165,3055,3075,2985,3225,3165,3275,2955,3555,3645,3885,3725,3595,3585,3525,3445,3815,3595,3185,3355,3135,3055,2995,3225,2955,3145,3055,3225,3145,3365,3275,3115,3275,3185,3005,2955,3185,3085,3225,3085,3675,3725,3815,3755,3585,3615,3645,3715,3625,3885,3495,3265,3055,3115,3295,3355,3185,3145,3115,3235,3205,3255,3115,3095,2975,3165,3235,3165,3075,2985,3095,2855,3675,3795,3595,3555,3645,3715,3755,3835,3615,3795,3675,3225,3235,3165,3055,3125,3075,3185,3135,3385,3235,3115,3185,3185,3115,3125,3055,3225,3055,3025,2955,2955,3925,3585,3665,3625,3645,3585,3505,3545,3415,3555,3805,3505,3415,3075,3265,2975,3115,3055,3055,3025,3115,3165,3185,2985,3265,3115,3055,3095,2985,3055,3225,2975,3505,3705,3645,3615,3735,3575,3625,3685,3805,3665,3725,3595,3525,3135,2995,3265,3135,3075,3125,3355,3085,3365,3165,3085,2955,3075,3025,3145,3165,3225,3025,3045,3555,3535,3665,3725,3625,3705,3625,3865,3575,3825,3595,3635,3635,3275,3035,3165,3225,3045,3085,3045,3255,3325,3025,2995,3165,3165,3185,3185,3205,3315,3055,3145,3615,3555,3725,3525,3635,3775,3545,3715,3645,3535,3485,3675,3585,3455,2975,3085,2995,3205,3075,2985,3125,3365,3215,3125,3185,3095,3185,3395,3225,3185,3085,3005,3685,3625,3685,3635,3795,3455,3615,3535,3595,3675,3875,3725,3665,3085,3135,3185,2985,3085,2985,3125,2975,3135,3265,2995,3315,3025,3175,3185,3055,3275,3235,3025,3435,3645,3615,3685,3575,3535,3585,3675,3855,3735,3505,3645,3265,3185,2955,3135,3295,3325,3075,3045,3235,3355,3235,3175,3235,3145,2975,3035,3115,3075,2955,3115,3545,3345,3545,3465,3615,3765,3575,3895,3645,3575,3465,3235,3225,3255,3205,3305,3505,3365,3325,3325,3295,3215,3135,3325,3075,3325,3035,3035,3055,3175,2785,3115,3265,2975,2735,3345,3415,3545,3665,3635,3395,3355,3405,3175,3275,3545,3275,3125,3185,3435,2915,3175,3255,3085,3205,3125,3035,3115,3165,2975,3075,3085,3225,3225,2975,2635,2615,3265,3445,3415,3405,3345,3355,3405,3595,3385,3435,3175,3385,3075,3025,3085,3175,2945,2955,2955,2975,2995,2915,3025,3035,3075,3145,3135,3535,3415,2715,2405,2915,3225,3075,3255,3465,3345,3495,3225,3185,3235,3255,3235,3095,3465,3495,3165,3075,3175,3255,3175,3135,3085,3135,3165,3295,3055,3095,3275,3365,3365,2805,2705,2645,3185,3365,3365,3125,3205,3325,3365,3325,3495,3415,3205,3295,3505,3235,3455,3275,3165,2955,3255,3385,3185,3175,3055,3125,3255,3145,3055,3265,3295,2815,2975,2925,3075,3325,3415,3585,3315,3365,3115,3365,3115,3185,3185,3405,3305,3075,3485,3125,3255,3525,3075,3215,3315,3225,3165,3135,3095,3185,3025,3255,2985,2575,2885,2665,3145,3465,3235,3405,3435,3275,3255,3215,3365,3445,3275,3325,3675,3315,3495,3345,3405,3275,3315,3225,3125,3025,3275,3175,3205,3265,3215,3465,3205,2955,2675,2925,3095,3265,3295,3405,3535,3405,3485,3255,3265,3165,3405,3185,3175,3275,3225,3275,3315,3275,3225,3355,3205,3255,3145,3225,2975,3035,3225,3405,3525,2815,2685,2875,3135,3505,3465,3235,3385,3395,3465,3225,3685,3465,3205,3405,3495,3185,3295,3215,3165,3135,3085,2915,2975,3075,3125,2815,3035,3055,3365,3465,3555,2845,2885,2885,2825,3275,3315,3585,3325,3175,3205,3455,3025,3165,3075,3205,3085,3075,3095,3215,3175,3115,2975,2785,3075,2995,3215,2825,2955,2665,2825,3165,3225,2855,3095,2845,2915,3145,2975,3095,3495,3325,3325,2995,3225,3235,3205,3075,3225,3225,3215,2975,3045,2975,3225,3075,3145,3165,2945,2755,2815,2885,2955,2735,2925,2825,2815,3095,2805,2745,3075,3075,3325,3085,3165,3035,3135,3265,3305,3295,3175,3165,3085,3115,3115,3305,3455,3455,3295,3315,2855,2855,2945,2595,2805,2735,2665,2885,2635,2845,2605,2925,2975,3075,3205,3275,3325,3255,3485,3325,3365,3175,3415,3115,3315,3615,3685,3465,3435,3275,3295,2995,2785,2815,2785,2595,2375,2675,2815,2815,2785,2845,2595,2665,2745,2925,2815,3145,3095,3405,3075,3095,3235,3185,3035,3125,3595,3495,3465,3615,3495,3535,3495,3025,2885,2675,2615,2915,2395,2855,2645,2785,2955,2615,2805,2755,2785,2805,3025,3075,3215,3325,3405,3295,3135,3165,3325,3625,3705,3485,3555,3705,3495,3645,3555,3035,2985,3025,2925,2775,2885,2915,2735,2895,2895,2675,2815,2475,2925,2685,2855,2775,3025,3125,3055,3215,3385,3265,3305,3495,3545,3495,3405,3545,3545,3615,3225,2955,2845,2915,2735,2735,2775,2675,2805,2605,2635,2805,2815,2705,2805,2875,2705,2745,2635,2945,3455,3095,3185,3345,3385,3225,3525,3665,3325,3365,3465,3525,2975,2635,2735,2535,2925,2545,2715,2595,2745,2975,2545,2705,2525,2745,2815,2595,2845,2785,2805,2955,2635,2745,3045,3235,2785,2745,3145,3095,3365,3445,3465,3345,3585,3125,3215,2775,2925,2825,2535,2735,2975,2575,3005,2755,2785,2595,2505,2595,2805,2615,2715,2575,2845,2785,3025,2435,2635,2715,2975,2985,3095,3045,3345,3365,3645,3355,3355,3215,3185,4185,3305,2815,2955,2745,2165,2975,2925,2805,2685,2805,2745,2545,2885,2745,2465,2665,2735,2635,2535,2465,2615,2635,2735,2955,3185,3175,3265,3175,3205,3435,3005,2975,3115,2755,2975]
data = [37,60,47,74,63,78,74,153,139,159,125,159,165,153,165,187,170,187,159,153,146,132,177,143,156,129,132,145,139,126,132,163,88,69,72,68,64,58,75,97,176,156,129,157,185,160,170,193,160,170,165,170,143,145,136,115,132,119,136,160,160,137,139,122,12,63,47,78,63,64,78,88,137,171,129,170,170,165,176,151,159,163,187,159,163,125,97,115,145,159,132,112,142,122,115,111,44,60,80,44,72,75,60,91,78,132,132,163,185,157,115,205,185,165,153,119,119,112,129,139,136,149,126,115,136,145,115,151,64,78,57,89,78,88,60,83,69,145,97,129,143,159,190,170,165,153,153,145,136,132,126,146,160,160,151,132,151,143,126,143,30,63,64,109,68,63,49,52,68,103,122,160,173,176,173,163,165,160,157,106,109,142,151,132,170,153,137,173,139,171,129,176,12,32,27,63,44,68,49,54,49,95,111,160,166,166,126,159,160,159,136,177,225,213,222,230,190,179,179,173,137,166,131,122,27,52,75,23,63,60,60,68,52,72,88,163,196,183,213,236,233,216,205,225,204,211,222,233,221,179,187,126,149,165,156,139,69,30,41,88,49,74,88,32,64,83,57,153,219,216,222,217,221,251,255,205,219,197,255,225,228,236,213,180,153,123,190,176,43,88,83,44,60,34,68,75,57,64,52,142,217,233,238,205,233,221,211,185,219,213,242,222,238,234,225,210,166,176,187,165,3,75,52,64,41,89,58,41,41,68,68,190,221,200,199,234,185,236,222,221,241,227,238,199,222,234,253,241,160,166,166,129,58,78,83,37,43,58,57,47,44,54,109,191,210,230,221,227,217,217,233,210,233,221,219,211,217,197,238,211,157,171,163,177,43,44,78,69,75,38,34,74,41,125,196,205,197,210,221,211,207,217,241,225,228,205,238,222,233,233,205,177,151,156,185,193,88,78,74,69,63,32,74,102,117,196,205,230,204,245,210,221,227,225,238,200,238,234,225,187,238,216,210,187,177,193,171,191,43,38,68,74,91,137,171,173,173,207,219,213,225,227,225,191,205,193,196,230,236,244,225,193,193,221,197,183,157,179,157,183,83,78,111,119,125,160,211,187,199,213,200,199,230,222,236,238,216,217,180,225,225,193,210,205,211,177,196,176,180,179,204,166,146,146,156,157,165,191,230,196,210,207,199,213,210,210,216,193,230,217,210,221,234,217,222,207,205,177,197,222,238,207,204,157,171,149,170,176,199,210,205,207,213,197,217,225,190,185,211,200,217,216,221,217,199,225,213,213,185,210,196,207,222,241,205,219,165,153,179,199,200,190,190,205,216,200,179,193,210,211,225,221,221,216,244,251,200,228,225,219,190,179,180,185,210,210,200,187,170,228,221,193,183,200,185,187,197,207,207,165,200,210,200,234,230,211,185,196,180,211,225,204,180,183,213,197,185,210,227,210,176,190,196,179,177,205,225,199,213,213,163,204,205,200,219,179,204,213,199,165,111,166,191,204,205,199,193,211,191,222,221,211,211,217,219,177,199,221,176,187,191,171,197,193,222,197,210,216,191,241,221,170,97,63,129,153,151,177,180,197,165,170,196,217,160,173,165,207,197,205,200,185,204,196,197,200,225,230,199,200,204,216,180,123,88,74,91,88,83,85,95,91,103,117,123,123,165,230,221,227,207,185,211,196,159,177,187,219,244,217,219,205,200,200,179,83,57,88,85,54,74,47,75,60,57,41,64,74,190,217,200,241,217,160,211,119,131,103,191,217,217,210,200,156,204,185,115,64,74,83,85,44,43,47,54,75,88,57,47,34,210,191,197,211,210,219,132,88,122,119,142,213,193,204,205,230,171,160,80,38,57,52,43,43,78,75,63,85,58,72,72,69,183,210,200,196,234,187,146,117,119,160,112,180,205,216,196,185,131,74,57,69,64,68,83,52,60,88,27,74,57,10,6,41,196,242,227,236,193,166,187,197,139,111,153,193,221,187,157,185,103,58,75,78,47,98,68,54,60,21,64,85,47,23,74,52,157,204,219,213,227,193,190,187,196,179,179,221,153,117,95,88,85,91,69,52,54,64,57,43,72,52,64,49,44,92,41,52,185,190,177,211,216,221,199,211,176,199,219,238,102,91,88,85,44,69,69,68,30,88,58,63,69,58,85,72,68,57,23,102,163,146,163,145,211,213,247,190,216,207,177,179,123,54,57,85,69,69,44,57,15,78,38,21,49,58,64,44,78,54,34,21,145,204,190,156,177,221,219,199,234,230,170,123,85,75,69,80,69,52,95,68,41,49,18,57,38,26,95,37,0,27,85,52,]
raw_data = np.array(data)
data = np.array(data)
data = data.reshape(32, 32)
# print(np.average(data)/100)
plt.imshow(data)
plt.show()
# data = np.sort(raw_data)
# data = data[-30:-10]
# print(data)
# data = np.mean(data)
# print(data) | 512.666667 | 5,130 | 0.766905 | 2,100 | 9,228 | 3.369048 | 0.120952 | 0.006784 | 0.003392 | 0.00424 | 0.004806 | 0 | 0 | 0 | 0 | 0 | 0 | 0.749592 | 0.005093 | 9,228 | 18 | 5,131 | 512.666667 | 0.021022 | 0.568596 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.25 | 0 | 0.25 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
34ca7859aa0c73ffb5a411b36522b3ff36fff39a | 29,108 | py | Python | chebpy/cheba.py | liuyxpp/chebpy | 05a9492d0d78591a39923e4a85a0f24bcc79ae4f | [
"BSD-3-Clause"
] | null | null | null | chebpy/cheba.py | liuyxpp/chebpy | 05a9492d0d78591a39923e4a85a0f24bcc79ae4f | [
"BSD-3-Clause"
] | null | null | null | chebpy/cheba.py | liuyxpp/chebpy | 05a9492d0d78591a39923e4a85a0f24bcc79ae4f | [
"BSD-3-Clause"
] | null | null | null | # -*- coding: utf-8 -*-
"""
chebpy.cheba
============
Applications of Chebyshev spectral methods to solve PDEs.
"""
from time import time
from math import cos, acos
import numpy as np
from scipy.linalg import expm, expm2, expm3, inv
from scipy.fftpack import dst, idst, dct, idct
import matplotlib.pyplot as plt
from chebpy import cheb_fast_transform, cheb_inverse_fast_transform
from chebpy import cheb_D1_mat, cheb_D2_mat_dirichlet_dirichlet
from chebpy import cheb_D2_mat_robin_dirichlet
from chebpy import cheb_D2_mat_dirichlet_robin, cheb_D2_mat_robin_robin
from chebpy import etdrk4_coeff_nondiag, etdrk4_coeff_contour_hyperbolic
from chebpy import etdrk4_coeff_scale_square
from chebpy import etdrk4_scheme_coxmatthews, etdrk4_scheme_krogstad
from chebpy import etdrk4_coeff_nondiag_krogstad
from chebpy import etdrk4_coeff_contour_hyperbolic_krogstad
from chebpy import etdrk4_coeff_scale_square_krogstad
from chebpy import solve_tridiag_complex_thual
__all__ = ['cheb_mde_oss',
'cheb_mde_osc',
'cheb_mde_neumann_split',
'cheb_mde_dirichlet_oscheb',
'cheb_mde_neumann_oscheb',
'cheb_mde_dirichlet_etdrk4',
'cheb_mde_neumann_etdrk4',
'cheb_mde_neumann_dirichlet_etdrk4',
'cheb_mde_dirichlet_neumann_etdrk4',
'cheb_mde_robin_dirichlet_etdrk4',
'cheb_mde_dirichlet_robin_etdrk4',
'cheb_mde_robin_neumann_etdrk4',
'cheb_mde_neumann_robin_etdrk4',
'cheb_mde_robin_etdrk4',
'cheb_mde_robin_etdrk4_1',
'cheb_mde_robin_etdrk4_2',
'cheb_mde_mixed_etdrk4',
'cheb_allen_cahn_etdrk4',
]
def cheb_mde_oss(W, u0, Lx, Ns):
'''
Solution of modified diffusion equation (MDE)
via Strang operator splitting as time-stepping scheme
and fast sine transform.
The MDE is:
dq/dt = Dq - Wq
in the interval [0, L], with Dirichlet boundary conditions,
where D is Laplace operator.
Discretization:
x_j = j*L_x/N, j = 0, 1, 2, ..., N
:param:W: W_j, j = 0, 1, ..., N
:param:u0: u0_j, j = 0, 1, ..., N
:param:Lx: the physical length of the interval [0, L_x]
:param:Ns: contour index, s_j, j = 0, 1, ..., N_s
'''
ds = 1. / (Ns - 1)
N = np.size(u0) - 1
v = np.zeros(N-1)
v = u0[1:N] # v = {u[1], u[2], ..., u[N-1]}
k2 = (np.pi/Lx)**2 * np.arange(1, N)**2
expd = np.exp(-ds * k2)
expw = np.exp(-0.5 * ds * W[1:N])
for i in xrange(Ns-1):
v = expw * v
ak = dst(v, type=1) / N * expd
v = 0.5 * idst(ak, type=1)
v = expw * v
ii = np.arange(N+1)
x = 1. * ii * Lx / N
u = u0.copy()
u[1:N] = v
u[0] = 0.; u[N] = 0.;
return (u, x)
def cheb_mde_osc(W, u0, Lx, Ns):
'''
Solution of modified diffusion equation (MDE)
via Strang operator splitting as time-stepping scheme
and fast cosine transform.
The MDE is:
dq/dt = Dq - Wq
in the interval [0, L], with Neumann boundary conditions,
where D is Laplace operator.
Discretization:
x_j = j*L_x/N, j = 0, 1, 2, ..., N
:param:W: W_j, j = 0, 1, ..., N
:param:u0: u0_j, j = 0, 1, ..., N
:param:Lx: the physical length of the interval [0, L_x]
:param:Ns: contour index, s_j, j = 0, 1, ..., N_s
'''
ds = 1. / (Ns - 1)
N = np.size(u0) - 1
u = u0.copy()
k2 = (np.pi/Lx)**2 * np.arange(N+1)**2
expd = np.exp(-ds * k2)
expw = np.exp(-0.5 * ds * W)
for i in xrange(Ns-1):
u = expw * u
ak = dct(u, type=1) / N * expd
u = 0.5 * idct(ak, type=1)
u = expw * u
ii = np.arange(N+1)
x = 1. * ii * Lx / N
return (u, x)
def cheb_mde_neumann_split(W, u0, Lx, Ns):
'''
Solution of modified diffusion equation (MDE)
via Strang operator splitting as time-stepping scheme
and pseudospectral methods on Chebyshev grids.
The MDE is:
dq/dt = Dq + Wq
where D is Laplace operator. Neumann boundary condition is assumed.
'''
ds = 1. / (Ns - 1)
N = np.size(W) - 1
u = u0.copy()
u[0] = 0.; u[N] = 0.
k2 = (np.pi * np.pi) / (Lx * Lx) * np.arange(N+1) * np.arange(N+1)
expw = np.exp(-0.5 * ds * W)
for i in xrange(Ns-1):
u = expw * u
ak = cheb_fast_transform(u) * np.exp(-ds * k2)
u = cheb_inverse_fast_transform(ak)
u = expw * u
ii = np.arange(N+1)
x = 1. * ii * Lx / N
return (u, x)
def cheb_mde_oscheb(W, u0, Lx, Ns, bc_even, bc_odd):
'''
Solution of modified diffusion equation (MDE)
via Strang operator splitting as time-stepping scheme
and fast Chebyshev transform.
Ref:
Her, S. M.; Garcia-Cervera, C. J.; Fredrickson, G. H. macromolecules, 2012, 45, 2905.
The MDE is:
dq/dt = Dq - Wq
in the interval [0, L], with homogeneous Dirichlet boundary conditions at both boundaries.
where D is Laplace operator.
Discretization:
x_j = cos(j*L_x/N), j = 0, 1, 2, ..., N
:param:W: W_j, j = 0, 1, ..., N
:param:u0: u0_j, j = 0, 1, ..., N
:param:Lx: the physical length of the interval [0, L_x]
:param:Ns: contour index, s_j, j = 0, 1, ..., N_s
'''
ds = 1. / (Ns - 1)
N = u0.size - 1
u = u0.reshape(u0.size) # force 1D array
K = (Lx/2.)**2
lambp = K * (1. + 1j) / ds # \lambda_+
lambn = K * (1. - 1j) / ds # \lambda_-
c = np.ones(N+1)
c[0] = 2.; c[-1] = 2. # c_0=c_N=2, c_1=c_2=...=c_{N-1}=1
b = np.ones(N+3)
b[N-1:] = 0. # b_{N-1}=...=b_{N+2}=0, b_0=b_1=...=b_{N-2}=1
n = np.arange(N+1)
pe = 0.25 * c[0:N-1:2] / n[2:N+1:2] / (n[2:N+1:2] - 1)
po = 0.25 * c[1:N-1:2] / n[3:N+1:2] / (n[3:N+1:2] - 1)
pep = -pe * lambp
pen = -pe * lambn
pop = -po * lambp
pon = -po * lambn
qe = 0.5 * b[2:N+1:2] / (n[2:N+1:2]**2 - 1)
qo = 0.5 * b[3:N+1:2] / (n[3:N+1:2]**2 - 1)
qep = 1 + qe * lambp
qen = 1 + qe * lambn
qop = 1 + qo * lambp
qon = 1 + qo * lambn
re = 0.25 * b[4:N+3:2] / n[2:N+1:2] / (n[2:N+1:2] + 1)
ro = 0.25 * b[5:N+3:2] / n[3:N+1:2] / (n[3:N+1:2] + 1)
rep = -re * lambp
ren = -re * lambn
rop = -ro * lambp
ron = -ro * lambn
pg = np.zeros(pe.size + po.size)
pg[0:N-1:2] = pe
pg[1:N-1:2] = po
qg = np.zeros(qe.size + qo.size)
qg[0:N-1:2] = qe
qg[1:N-1:2] = qo
rg = np.zeros(re.size + ro.size)
rg[0:N-1:2] = re
rg[1:N-1:2] = ro
#dbce = np.ones(pe.size + 1)
#dbco = np.ones(po.size + 1)
dbce = bc_even
dbco = bc_odd
f = np.zeros(u.size + 2) # u.size is N+1
ge = np.zeros(pe.size + 1)
go = np.zeros(po.size + 1)
uc = u.astype(complex)
fc = f.astype(complex)
gec = ge.astype(complex)
goc = go.astype(complex)
expw = np.exp(-0.5 * ds * W)
for i in xrange(Ns-1):
u = expw * u
u = cheb_fast_transform(u)
f[:N+1] = u
g = pg * f[0:N-1] - qg * f[2:N+1] + rg * f[4:N+3]
ge[1:] = g[0:N-1:2]
go[1:] = g[1:N-1:2]
ue = solve_tridiag_complex_thual(pen, qen, ren, dbce, ge)
uo = solve_tridiag_complex_thual(pon, qon, ron, dbco, go)
uc[0:N+1:2] = ue
uc[1:N+1:2] = uo
fc[:N+1] = uc
gc = pg * fc[0:N-1] - qg * fc[2:N+1] + rg * fc[4:N+3]
gec[1:] = gc[0:N-1:2]
goc[1:] = gc[1:N-1:2]
ue = solve_tridiag_complex_thual(pep, qep, rep, dbce, gec)
uo = solve_tridiag_complex_thual(pop, qop, rop, dbco, goc)
uc[0:N+1:2] = ue
uc[1:N+1:2] = uo
u = uc.real
u = cheb_inverse_fast_transform(u)
u = 2. * (K/ds)**2 * expw * u
return u
def cheb_mde_dirichlet_oscheb(W, u0, Lx, Ns):
'''
Solution of modified diffusion equation (MDE)
via Strang operator splitting as time-stepping scheme
and fast Chebyshev transform.
Ref:
Hur, S. M.; Garcia-Cervera, C. J.; Fredrickson, G. H. macromolecules, 2012, 45, 2905.
The MDE is:
dq/dt = Dq - Wq
in the interval [0, L], with homogeneous Dirichlet boundary conditions at both boundaries.
where D is Laplace operator.
Discretization:
x_j = cos(j*L_x/N), j = 0, 1, 2, ..., N
:param:W: W_j, j = 0, 1, ..., N
:param:u0: u0_j, j = 0, 1, ..., N
:param:Lx: the physical length of the interval [0, L_x]
:param:Ns: contour index, s_j, j = 0, 1, ..., N_s
'''
N = u0.size - 1 # 0, 1, ..., N
if N % 2 == 0:
Ne = N/2 + 1 # even index: 0, 2, ..., N
else:
Ne = (N-1)/2 + 1 # even index: 0, 2, ..., N-1
No = (N+1) - Ne
dbce = np.ones(Ne)
dbco = np.ones(No)
return cheb_mde_oscheb(W, u0, Lx, Ns, dbce, dbco)
def cheb_mde_neumann_oscheb(W, u0, Lx, Ns):
'''
Solution of modified diffusion equation (MDE)
via Strang operator splitting as time-stepping scheme
and fast Chebyshev transform.
Ref:
Hur, S. M.; Garcia-Cervera, C. J.; Fredrickson, G. H. macromolecules, 2012, 45, 2905.
The MDE is:
dq/dt = Dq - Wq
in the interval [0, L], subjects to homogeneous Neumann boundary conditions at both boundaries,
where D is Laplace operator.
Discretization:
x_j = cos(j*L_x/N), j = 0, 1, 2, ..., N
:param:W: W_j, j = 0, 1, ..., N
:param:u0: u0_j, j = 0, 1, ..., N
:param:Lx: the physical length of the interval [0, L_x]
:param:Ns: contour index, s_j, j = 0, 1, ..., N_s
'''
N = u0.size - 1
if N % 2 == 0:
Ne = N/2 + 1 # even index: 0, 2, ..., N
else:
Ne = (N-1)/2 + 1 # even index: 0, 2, ..., N-1
No = (N+1) - Ne
nbce = np.arange(Ne)**2
nbco = np.arange(No)**2
return cheb_mde_oscheb(W, u0, Lx, Ns, nbce, nbco)
def cheb_mde_core_etdrk4(w, v, L, Ns, h, q=None, algo=1, scheme=1):
'''
The core of ETDRK4 methods.
It contains the generation of ETDRK4 coefficients and carrying out
ETDRK4 schemes.
'''
#Ns = int(round(1./h)) + 1
M = 32
R = 15.
if scheme == 0:
if algo == 0:
E, E2, Q, f1, f2, f3 = etdrk4_coeff_nondiag(L, h, M, R)
elif algo == 1:
E, E2, Q, f1, f2, f3 = etdrk4_coeff_contour_hyperbolic(L, h, M)
elif algo == 2:
E, E2, Q, f1, f2, f3 = etdrk4_coeff_scale_square(L, h)
else:
raise ValueError('No such ETDRK4 coefficient algorithm!')
v = etdrk4_scheme_coxmatthews(Ns, w, v, E, E2, Q, f1, f2, f3)
elif scheme == 1:
if algo == 0:
E, E2, f1, f2, f3, f4, f5, f6 = etdrk4_coeff_nondiag_krogstad(L, h, M, R)
elif algo == 1:
E, E2, f1, f2, f3, f4, f5, f6 = etdrk4_coeff_contour_hyperbolic_krogstad(L, h, M)
elif algo == 2:
E, E2, f1, f2, f3, f4, f5, f6 = etdrk4_coeff_scale_square_krogstad(L, h)
else:
raise ValueError('No such ETDRK4 coefficient algorithm!')
v = etdrk4_scheme_krogstad(Ns, w, v,
E, E2, f1, f2, f3, f4, f5, f6, q)
else:
raise ValueError('No such ETDRK4 scheme!')
return v
def cheb_mde_dirichlet_etdrk4(W, u0, Lx, Ns, h=None, q=None, algo=1, scheme=1):
'''
Solution of modified diffusion equation (MDE) wth homogeneous
Dirichlet boundary condtions (DBC-DBC) by ETDRK4 shceme.
This method allows very large time step.
Thus ETDRK4 is much faster than Strang Splitting or DCT.
For example, when space is discretized in N = 256, then Splitting
method needs at leat Ns = 1601 to achieve the same accuracy of ETDRK4
with Ns = 11. This is remarkable.
The MDE is:
dq/dt = Dq + Wq
q(-1,t) = 0, t>=0
q(+1,t) = 0, t>=0
q(x,0) = u0, -1<x<1
where D is Laplace operator.
Computation is based on Chebyshev points, so linear term is
non-diagonal.
'''
if h is None:
h = 1. / (Ns-1)
N = np.size(W) - 1
u = u0.copy()
u.shape = (N+1, 1)
u[0] = 0.; u[N] = 0. # Dirichlet boundary condition
v = u[1:N]
w = -W[1:N]
w.shape = (N-1, 1)
D1t, L, x = cheb_D2_mat_dirichlet_dirichlet(N)
L = (4. / Lx**2) * L
#M = 32
#R = 15.
#if scheme == 0:
# if algo == 0:
# E, E2, Q, f1, f2, f3 = etdrk4_coeff_nondiag(L, h, M, R)
# elif algo == 1:
# E, E2, Q, f1, f2, f3 = etdrk4_coeff_contour_hyperbolic(L, h, M)
# elif algo == 2:
# E, E2, Q, f1, f2, f3 = etdrk4_coeff_scale_square(L, h)
# else:
# raise ValueError('No such ETDRK4 coefficient algorithm!')
# v = etdrk4_scheme_coxmatthews(Ns, w, v, E, E2, Q, f1, f2, f3)
#elif scheme == 1:
# if algo == 0:
# E, E2, f1, f2, f3, f4, f5, f6 = etdrk4_coeff_nondiag_krogstad(L, h, M, R)
# elif algo == 1:
# E, E2, f1, f2, f3, f4, f5, f6 = etdrk4_coeff_contour_hyperbolic_krogstad(L, h, M)
# elif algo == 2:
# E, E2, f1, f2, f3, f4, f5, f6 = etdrk4_coeff_scale_square_krogstad(L, h)
# else:
# raise ValueError('No such ETDRK4 coefficient algorithm!')
# v = etdrk4_scheme_krogstad(Ns, w, v, E, E2, f1, f2, f3, f4, f5, f6)
#else:
# raise ValueError('No such ETDRK4 scheme!')
if q is None:
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q, algo, scheme)
else:
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q[:,1:N], algo, scheme)
u[1:N] = v
return (u, .5*(x+1.)*Lx)
def cheb_mde_neumann_etdrk4(W, u0, Lx, Ns, h=None, q=None, algo=1, scheme=1):
'''
Solution of modified diffusion equation (MDE) with
homogeneous Neumann boundary conditions (NBC-NBC) by ETDRK4 shceme.
NBC is also called Fixed flux boundary condition.
The MDE is:
dq/dt = Dq - Wq
dq/dx |(x=-1) = 0, t>=0
dq/dx |(x=+1) = 0, t>=0
q(x,0) = 1, -1<x<1
where D is Laplace operator.
:param:q: Optional. If present, it should be an Ns x Lx array.
'''
if h is None:
h = 1. / (Ns-1)
N = np.size(W) - 1
u = u0.copy()
u.shape = (N+1,1)
v = u.copy()
w = -W
w.shape = (N+1, 1)
D1t, L, x = cheb_D2_mat_robin_robin(N, 0., 0.)
L = (4. / Lx**2) * L
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q, algo, scheme)
return (v, .5*(x+1.)*Lx)
def cheb_mde_neumann_dirichlet_etdrk4(W, u0, Lx, Ns, h=None, q=None, algo=1, scheme=1):
'''
Solution of modified diffusion equation (MDE) with
NBC at lower boundary and DBC at higher boundary (NBC-DBC)
by ETDRK4 shceme.
The MDE is:
dq/dt = Dq - Wq
dq/dx |(x=-1) = 0, t>=0
q(x=+1) = 0, t>=0
q(x,0) = 1, -1<x<1
where D is Laplace operator.
'''
if h is None:
h = 1. / (Ns-1)
N = np.size(W) - 1
u = u0.copy()
u.shape = (N+1,1)
v = u[1:]
w = -W[1:]
w.shape = (N, 1)
D1t, L, x = cheb_D2_mat_robin_dirichlet(N, 0.)
L = (4. / Lx**2) * L
if q is None:
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q, algo, scheme)
else:
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q[:,1:], algo, scheme)
u[1:] = v
return (u, .5*(x+1.)*Lx)
def cheb_mde_dirichlet_neumann_etdrk4(W, u0, Lx, Ns, h=None, q=None, algo=1, scheme=1):
'''
Solution of modified diffusion equation (MDE) with
DBC at lower boundary and NBC at higher boundary (DBC-NBC)
by ETDRK4 shceme.
The MDE is:
dq/dt = Dq - Wq
q(x=-1) = 0, t>=0
dq/dx |(x=+1) = 0, t>=0
q(x,0) = 1, -1<x<1
where D is Laplace operator.
'''
if h is None:
h = 1. / (Ns-1)
N = np.size(W) - 1
u = u0.copy()
u.shape = (N+1,1)
v = u[:-1]
w = -W[:-1]
w.shape = (N, 1)
D1t, L, x = cheb_D2_mat_dirichlet_robin(N, 0.)
L = (4. / Lx**2) * L
if q is None:
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q, algo, scheme)
else:
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q[:,:-1], algo, scheme)
u[:-1] = v
return (u, .5*(x+1.)*Lx)
def cheb_mde_robin_dirichlet_etdrk4(W, u0, Lx, Ns, ka, h=None, q=None, algo=1, scheme=1):
'''
Solution of modified diffusion equation (MDE) with
RBC at lower boundary and DBC at higher boundary (RBC-DBC)
by ETDRK4 shceme.
The MDE is:
dq/dt = Dq - Wq
kq + dq/dx = 0, x = -1 (ka) t>=0
q(x=+1) = 0, t>=0
q(x,0) = 1, -1<x<1
where D is Laplace operator.
'''
if h is None:
h = 1. / (Ns-1)
N = np.size(W) - 1
u = u0.copy()
u.shape = (N+1,1)
v = u[1:]
w = -W[1:]
w.shape = (N, 1)
D1t, L, x = cheb_D2_mat_robin_dirichlet(N, ka)
L = (4. / Lx**2) * L
if q is None:
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q, algo, scheme)
else:
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q[:,1:], algo, scheme)
u[1:] = v
return (u, .5*(x+1.)*Lx)
def cheb_mde_dirichlet_robin_etdrk4(W, u0, Lx, Ns, kb, h=None, q=None, algo=1, scheme=1):
'''
Solution of modified diffusion equation (MDE) with
DBC at lower boundary and RBC at higher boundary (DBC-RBC)
by ETDRK4 shceme.
The MDE is:
dq/dt = Dq + Wq
q(x=-1) = 0, t>=0
kq + dq/dx = 0, x = +1 (kb), t>=0
q(x,0) = 1, -1<x<1
where D is Laplace operator.
'''
if h is None:
h = 1. / (Ns-1)
N = np.size(W) - 1
u = u0.copy()
u.shape = (N+1,1)
v = u[:-1]
w = -W[:-1]
w.shape = (N, 1)
D1t, L, x = cheb_D2_mat_dirichlet_robin(N, kb)
L = (4. / Lx**2) * L
if q is None:
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q, algo, scheme)
else:
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q[:,:-1], algo, scheme)
u[:-1] = v
return (u, .5*(x+1.)*Lx)
def cheb_mde_robin_neumann_etdrk4(W, u0, Lx, Ns, ka, h=None, q=None, algo=1, scheme=1):
'''
Solution of modified diffusion equation (MDE) with
RBC at lower boundary and NBC at higher boundary (RBC-RBC)
by ETDRK4 shceme.
NBC is also called Fixed flux boundary condition.
The MDE is:
dq/dt = Dq + Wq
kq + dq/dx = 0, x = -1 (ka), t>=0
dq/dx = 0, x = +1, t>=0
q(x,0) = 1, -1<x<1
where D is Laplace operator.
'''
if h is None:
h = 1. / (Ns-1)
N = np.size(W) - 1
u = u0.copy()
u.shape = (N+1,1)
v = u.copy()
w = -W
w.shape = (N+1, 1)
D1t, L, x = cheb_D2_mat_robin_robin(N, ka, 0.)
L = (4. / Lx**2) * L
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q, algo, scheme)
return (v, .5*(x+1.)*Lx)
def cheb_mde_neumann_robin_etdrk4(W, u0, Lx, Ns, kb, h=None, q=None, algo=1, scheme=1):
'''
Solution of modified diffusion equation (MDE) with
NBC at lower boundary and RBC at higher boundary (RBC-RBC)
by ETDRK4 shceme.
NBC is also called Fixed flux boundary condition.
The MDE is:
dq/dt = Dq + Wq
dq/dx = 0, x = -1, t>=0
kq + dq/dx = 0, x = +1 (kb), t>=0
q(x,0) = 1, -1<x<1
where D is Laplace operator.
'''
if h is None:
h = 1. / (Ns-1)
N = np.size(W) - 1
u = u0.copy()
u.shape = (N+1,1)
v = u.copy()
w = -W
w.shape = (N+1, 1)
D1t, L, x = cheb_D2_mat_robin_robin(N, 0., kb)
L = (4. / Lx**2) * L
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q, algo, scheme)
return (v, .5*(x+1.)*Lx)
def cheb_mde_robin_etdrk4(W, u0, Lx, Ns, ka, kb, h=None, q=None, algo=1, scheme=1):
'''
Solution of modified diffusion equation (MDE) with
RBCs at both boundaries (RBC-RBC) by ETDRK4 shceme.
NBC is also called Fixed flux boundary condition.
The MDE is:
dq/dt = Dq + Wq
kq + dq/dx = 0, x = -1 (ka), t>=0
kq + dq/dx = 0, x = +1 (kb), t>=0
q(x,0) = 1, -1<x<1
where D is Laplace operator.
'''
if h is None:
h = 1. / (Ns-1)
N = np.size(W) - 1
u = u0.copy()
u.shape = (N+1,1)
v = u.copy()
w = -W
w.shape = (N+1, 1)
D1t, L, x = cheb_D2_mat_robin_robin(N, ka, kb)
L = (4. / Lx**2) * L
v = cheb_mde_core_etdrk4(w, v, L, Ns, h, q, algo, scheme)
return (v, .5*(x+1.)*Lx)
def cheb_mde_robin_etdrk4_1(W, u0, Lx, Ns, ka, kb):
'''
Solution of modified diffusion equation (MDE) with
Neumann boundary condition (NBC) by ETDRK4 shceme.
NBC is also called Fixed flux boundary condition.
The MDE is:
dq/dt = Dq + Wq
kq + dq/dx = 0, x=+1(kb) or x=-1(ka), t>=0
q(x,0) = 1, -1<x<1
where D is Laplace operator.
'''
ds = 1. / (Ns-1)
N = np.size(W) - 1
D, xx = cheb_D1_mat(N)
u = u0.copy()
u.shape = (N+1,1)
v = u[1:N]
w = -W[1:N]
w.shape = (N-1, 1)
# Robin boundary
d00 = D[0,0]; d0N = D[0,N]; dN0 = D[N,0]; dNN = D[N,N]
D2 = np.dot(D, D)
kk = (kb + d00) * (ka + dNN) - d0N * dN0
L = np.zeros_like(D2)
for i in xrange(1,N):
for j in xrange(1,N):
Xij = (d0N * D2[i,0] - (kb+d00) * D2[i,N]) / kk * D[N,j]
Yij = (dN0 * D2[i,N] - (ka+dNN) * D2[i,0]) / kk * D[0,j]
L[i,j] = D2[i,j] + Xij + Yij
h = ds
M = 32
R = 15.
L = (4. / Lx**2) * L[1:N,1:N]
Q, f1, f2, f3 = etdrk4_coeff_nondiag(L, h, M, R)
A = h * L
E = expm(A)
E2 = expm(A/2)
for j in xrange(Ns-1):
Nu = w * v
a = np.dot(E2, v) + np.dot(Q, Nu)
Na = w * a
b = np.dot(E2, v) + np.dot(Q, Na)
Nb = w * b
c = np.dot(E2, a) + np.dot(Q, 2*Nb-Nu)
Nc = w * c
v = np.dot(E, v) + np.dot(f1, Nu) + 2 * np.dot(f2, Na+Nb) + \
np.dot(f3, Nc)
sum0 = np.dot(D[0,1:N], v)
sumN = np.dot(D[N,1:N], v)
u[0] = (d0N * sumN - (ka + dNN) * sum0) / kk
u[N] = (dN0 * sum0 - (kb + d00) * sumN) / kk
u[1:N] = v[:]
return (u, .5*(xx+1.)*Lx)
def cheb_mde_robin_etdrk4_3(W, u0, Lx, Ns, ka, kb):
'''
This produce incorrect result. Should not be used.
'''
ds = 1. / (Ns-1)
N = np.size(W) - 1
D, xx = cheb_D1_mat(N)
u = u0.copy()
u.shape = (N+1,1)
v = u[1:N]
w = -W[1:N]
w.shape = (N-1, 1)
# Robin boundary
d00 = D[0,0]; d0N = D[0,N]; dN0 = D[N,0]; dNN = D[N,N]
D2 = np.dot(D, D)
kk = (ka + d00) * (kb + dNN) - d0N * dN0
k1 = (dN0 - kb - dNN) / kk
k2 = (d0N - ka - d00) / kk
L = np.zeros_like(D2)
for i in xrange(1,N):
sumDij = np.sum(D[i,:])
for k in xrange(1,N):
L[i,k] = D2[i,k] + (k1 * D[i,0] * D[0,k] +
k2 * D[i,N] * D[N,k]) * sumDij
h = ds
M = 32
R = 15.
L = (4. / Lx**2) * L[1:N,1:N]
Q, f1, f2, f3 = etdrk4_coeff_nondiag(L, h, M, R)
A = h * L
E = expm(A)
E2 = expm(A/2)
for j in xrange(Ns-1):
Nu = w * v
a = np.dot(E2, v) + np.dot(Q, Nu)
Na = w * a
b = np.dot(E2, v) + np.dot(Q, Na)
Nb = w * b
c = np.dot(E2, a) + np.dot(Q, 2*Nb-Nu)
Nc = w * c
v = np.dot(E, v) + np.dot(f1, Nu) + 2 * np.dot(f2, Na+Nb) + \
np.dot(f3, Nc)
sum0 = np.dot(D[0,1:N], v)
sumN = np.dot(D[N,1:N], v)
u[0] = (d0N * sumN - (kb + dNN) * sum0) / kk
u[N] = (dN0 * sum0 - (ka + d00) * sumN) / kk
u[1:N] = v[:]
return (u, .5*(xx+1.)*Lx)
def cheb_mde_robin_etdrk4_2(W, u0, Lx, Ns, ka, kb):
ds = 1. / (Ns-1)
N = np.size(W) - 1
u = u0.copy()
u.shape = (N+1,1)
v = u.copy()
w = -W
w.shape = (N+1, 1)
# Robin boundary
D1t, L, xx = cheb_D2_mat_robin_robin(N, ka, kb)
h = ds
M = 32
R = 15.
L = (4. / Lx**2) * L
Q, f1, f2, f3 = etdrk4_coeff_nondiag(L, h, M, R)
A = h * L
E = expm(A)
E2 = expm(A/2)
for j in xrange(Ns-1):
Nu = w * v
a = np.dot(E2, v) + np.dot(Q, Nu)
Na = w * a
b = np.dot(E2, v) + np.dot(Q, Na)
Nb = w * b
c = np.dot(E2, a) + np.dot(Q, 2*Nb-Nu)
Nc = w * c
v = np.dot(E, v) + np.dot(f1, Nu) + 2 * np.dot(f2, Na+Nb) + \
np.dot(f3, Nc)
return (v, .5*(xx+1.)*Lx)
def cheb_mde_robin_etdrk4_4(W, u0, Lx, Ns, ka, kb):
'''
Solution of modified diffusion equation (MDE) with
Robin boundary condition (RBC) by ETDRK4 shceme.
The MDE is:
dq/dt = Dq + Wq
kq + dq/dx = 0, x=+1 or x=-1, t>=0
q(x,0) = 1, -1<x<1
where D is Laplace operator.
The disrete matrix for Laplace operator is
sum_{k=0}^N L_{ik} u_k
where
L_{ik} = D_{ij} * D1_{jk}, for i = 0, 1, ..., N; k = 1, 2, ..., N-1
with
D1_{jk} = D_{jk} for j = 1, 2, ..., N-1; k = 0, 1, ..., N
D1_{jk} = 0 for j = 0 or j = N; k = 0, 1, ..., N
and
L-{i0} = D_{ij} * D1_{j0} - ka * D_{i0}
L-{iN} = D_{ij} * D1_{jN} - ka * D_{iN}
'''
ds = 1. / (Ns-1)
N = np.size(W) - 1
D, xx = cheb_D1_mat(N)
u = u0.copy()
u.shape = (N+1,1)
v = u.copy()
w = -W
w.shape = (N+1, 1)
h = ds
M = 32
R = 15.
D1 = np.zeros_like(D)
D1[1:N,:] = D[1:N,:]
L = np.dot(D, D1)
L[:,0] -= D[:,0] * kb
L[:,N] -= D[:,N] * ka
L = (4. / Lx**2) * L
Q, f1, f2, f3 = etdrk4_coeff_nondiag(L, h, M, R)
A = h * L
E = expm(A)
E2 = expm(A/2)
for j in xrange(Ns-1):
Nu = w * v
a = np.dot(E2, v) + np.dot(Q, Nu)
Na = w * a
b = np.dot(E2, v) + np.dot(Q, Na)
Nb = w * b
c = np.dot(E2, a) + np.dot(Q, 2*Nb-Nu)
Nc = w * c
v = np.dot(E, v) + np.dot(f1, Nu) + 2 * np.dot(f2, Na+Nb) + \
np.dot(f3, Nc)
return (v, .5*(xx+1.)*Lx)
def cheb_mde_mixed_etdrk4(W, u0, Lx, Ns, kb):
'''
Solution of modified diffusion equation (MDE) with
mixed DBC-RBC by ETDRK4 shceme.
The MDE is:
dq/dt = Dq + Wq
where D is Laplace operator.
For RBC-DBC
kq + dq/dx = 0, x=-1 (ka), t>=0
q = 0, x=+1, t>=0
q(x,0) = 1, -1<x<1
The disrete matrix for Laplace operator is
sum_{k=1}^N L_{ik} u_k
where
L_{ik} = D_{ij} * D1_{jk}, for i = 0, 1, ..., N; k = 1, 2, ..., N-1
with
D1_{jk} = D_{jk} for j = 1, 2, ..., N-1; k = 0, 1, ..., N
D1_{jk} = 0 for j = N; k = 0, 1, ..., N
and
L_{iN} = D_{ij} * D1_{jN} - ka * D_{iN}
For DBC-RBC
q = 0, x=-1, t>=0
kq + dq/dx = 0, x=+1, t>=0
q(x,0) = 1, -1<x<1
'''
ds = 1. / (Ns-1)
N = np.size(W) - 1
u = u0.copy()
u.shape = (N+1,1)
v = np.zeros(N)
v = u[:-1]
v.shape = (N, 1)
w = -W[:-1]
w.shape = (N, 1)
h = ds
M = 32
R = 15.
D1, L, xx = cheb_D2_mat_dirichlet_robin(N, kb)
L = (4. / Lx**2) * L
Q, f1, f2, f3 = etdrk4_coeff_ndiag(L, h, M, R)
A = h * L
E = expm(A)
E2 = expm(A/2)
for j in xrange(Ns-1):
Nu = w * v
a = np.dot(E2, v) + np.dot(Q, Nu)
Na = w * a
b = np.dot(E2, v) + np.dot(Q, Na)
Nb = w * b
c = np.dot(E2, a) + np.dot(Q, 2*Nb-Nu)
Nc = w * c
v = np.dot(E, v) + np.dot(f1, Nu) + 2 * np.dot(f2, Na+Nb) + \
np.dot(f3, Nc)
u[:-1] = v
return (u, .5*(xx+1.)*Lx)
def cheb_allen_cahn_etdrk4():
'''
Solution of Allen-Cahn equation by ETDRK4 shceme.
u_t = eps*u_xx + u - u^3 on
[-1,1], u(-1) = -1, u(1) = 1
Computation is based on Chebyshev points, so linear term is
non-diagonal.
'''
N = 80
D, xx = cheb_D1_mat(N)
x = xx[1:N]
w = .53*x + .47*np.sin(-1.5*np.pi*x) - x
u = np.concatenate(([[1]], w+x, [[-1]]))
h = 1./4
M = 32 # Number of points in upper half-plane
kk = np.arange(1, M+1)
# theta = pi/64 * {1, 3, 5, ..., 2*M-1}
# the radius of the circular contour is 15.0
r = 15.0 * np.exp(1j * np.pi * (kk - .5) / M)
L = np.dot(D, D) # L = D^2
L = .01 * L[1:N,1:N]
A = h * L
E = expm(A)
E2 = expm(A/2)
I = np.eye(N-1)
Z = 1j * np.zeros((N-1,N-1))
f1 = Z; f2 = Z; f3 = Z; Q = Z
for j in xrange(M):
z = r[j]
zIA = inv(z * I - A)
hzIA = h * zIA
hzIAz2 = hzIA / z**2
Q = Q + hzIA * (np.exp(z/2) - 1)
f1 = f1 + hzIAz2 * (-4 - z + np.exp(z) * (4 - 3*z + z**2))
f2 = f2 + hzIAz2 * (2 + z + np.exp(z) * (z - 2))
f3 = f3 + hzIAz2 * (-4 - 3*z - z*z + np.exp(z) * (4 - z))
f1 = np.real(f1 / M)
f2 = np.real(f2 / M)
f3 = np.real(f3 / M)
Q = np.real(Q / M)
tt = 0.
tmax = 70
nmax = int(round(tmax / h))
nplt = int(round(5. / h))
print nmax,nplt
for n in xrange(nmax):
t = (n+1) * h
Nu = (w+x) - np.power(w+x, 3)
a = np.dot(E2, w) + np.dot(Q, Nu)
Na = (a+x) - np.power(a+x, 3)
b = np.dot(E2, w) + np.dot(Q, Na)
Nb = (b+x) - np.power(b+x, 3)
c = np.dot(E2, a) + np.dot(Q, 2*Nb-Nu)
Nc = (c+x) - np.power(c+x, 3)
w = np.dot(E, w) + np.dot(f1, Nu) + 2 * np.dot(f2, Na+Nb) + \
np.dot(f3, Nc)
if ((n+1) % nplt) == 0:
print n+1
u = np.concatenate(([[1]],w+x,[[-1]])).T
plt.plot(xx, u[0,:])
plt.show()
| 27.408663 | 99 | 0.500412 | 5,276 | 29,108 | 2.67627 | 0.069181 | 0.013881 | 0.006586 | 0.013031 | 0.767139 | 0.732932 | 0.710977 | 0.682365 | 0.660411 | 0.64483 | 0 | 0.067765 | 0.326749 | 29,108 | 1,061 | 100 | 27.434496 | 0.652753 | 0.051876 | 0 | 0.594406 | 0 | 0 | 0.029063 | 0.022532 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.02972 | null | null | 0.003497 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
34dcde2796720ff383ca18956d7cd77cf354acf7 | 429 | py | Python | split_query/core/__init__.py | simonbowly/split-query | 773102b70330dad7304d3eaf958563cba506aff2 | [
"MIT"
] | null | null | null | split_query/core/__init__.py | simonbowly/split-query | 773102b70330dad7304d3eaf958563cba506aff2 | [
"MIT"
] | null | null | null | split_query/core/__init__.py | simonbowly/split-query | 773102b70330dad7304d3eaf958563cba506aff2 | [
"MIT"
] | null | null | null | ''' The core module holds objects for constructing and manipulating
expressions. Other components (caches, engines, interfaces, etc) should
communicate by passing core expression objects. '''
from .expand import to_dnf_simplified
from .expressions import Attribute, And, Or, Not, Eq, Le, Lt, Ge, Gt, Eq, In
from .logic import simplify_tree
from .serialise import default, object_hook
from .wrappers import attribute, expression
| 42.9 | 76 | 0.794872 | 59 | 429 | 5.711864 | 0.745763 | 0.089021 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.135198 | 429 | 9 | 77 | 47.666667 | 0.908356 | 0.426573 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
34e5ef188fbac3bc1513767938a65fde87cbf48e | 321 | py | Python | photos/admin.py | kiira254/Gallery | 5505bf2e1809d3a009c27f88490d75e5d421380d | [
"MIT"
] | null | null | null | photos/admin.py | kiira254/Gallery | 5505bf2e1809d3a009c27f88490d75e5d421380d | [
"MIT"
] | null | null | null | photos/admin.py | kiira254/Gallery | 5505bf2e1809d3a009c27f88490d75e5d421380d | [
"MIT"
] | null | null | null | from django.contrib import admin
from django.contrib import admin
from .models import Image, Categories, Image_Location
# Register your models here.
class ImageAdmin(admin.ModelAdmin):
filter_horizontal =('Categories',)
admin.site.register(Image)
admin.site.register(Categories)
admin.site.register(Image_Location) | 26.75 | 53 | 0.809969 | 41 | 321 | 6.268293 | 0.439024 | 0.105058 | 0.198444 | 0.178988 | 0.48249 | 0.233463 | 0 | 0 | 0 | 0 | 0 | 0 | 0.099688 | 321 | 12 | 54 | 26.75 | 0.889273 | 0.080997 | 0 | 0.25 | 0 | 0 | 0.034014 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.375 | 0 | 0.625 | 0 | 0 | 0 | 0 | null | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
34fcd61c05da6083ed20fd82cdb77c99ab9de5e7 | 27 | py | Python | cinder/volume/drivers/violin/vxg/version.py | rlucio/cinder-violin-driver-icehouse | 1632bf1bdf67f7e26a586c819dd836f6541c4f3d | [
"Apache-2.0"
] | null | null | null | cinder/volume/drivers/violin/vxg/version.py | rlucio/cinder-violin-driver-icehouse | 1632bf1bdf67f7e26a586c819dd836f6541c4f3d | [
"Apache-2.0"
] | 1 | 2021-01-12T23:22:22.000Z | 2021-01-12T23:22:22.000Z | cinder/volume/drivers/violin/vxg/version.py | rlucio/cinder-violin-driver-icehouse | 1632bf1bdf67f7e26a586c819dd836f6541c4f3d | [
"Apache-2.0"
] | null | null | null | __version__="1.5.0-alpha1"
| 13.5 | 26 | 0.740741 | 5 | 27 | 3.2 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.153846 | 0.037037 | 27 | 1 | 27 | 27 | 0.461538 | 0 | 0 | 0 | 0 | 0 | 0.444444 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
550fc6eab71c465933bdb76d510cc7d0f2970fee | 365 | py | Python | app/ingredients/admin.py | noemiko/diet_plan_generator | 41e183f1c83c724ee77dea24e62bcd32ebf1efcf | [
"MIT"
] | null | null | null | app/ingredients/admin.py | noemiko/diet_plan_generator | 41e183f1c83c724ee77dea24e62bcd32ebf1efcf | [
"MIT"
] | null | null | null | app/ingredients/admin.py | noemiko/diet_plan_generator | 41e183f1c83c724ee77dea24e62bcd32ebf1efcf | [
"MIT"
] | null | null | null | from django.contrib import admin
from ingredients.models import Ingredients
# Register your models here.
class AuthorAdmin(admin.ModelAdmin):
pass
admin.site.register(Ingredients, AuthorAdmin)
#
# for i in Protein.__subclasses__():
# admin.site.register(i, AuthorAdmin)
#
# for i in Vegetable.__subclasses__():
# admin.site.register(i, AuthorAdmin)
| 21.470588 | 45 | 0.756164 | 44 | 365 | 6.090909 | 0.477273 | 0.100746 | 0.190299 | 0.126866 | 0.291045 | 0.291045 | 0 | 0 | 0 | 0 | 0 | 0 | 0.142466 | 365 | 16 | 46 | 22.8125 | 0.85623 | 0.487671 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0.2 | 0.4 | 0 | 0.6 | 0 | 0 | 0 | 0 | null | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 1 | 0 | 0 | 0 | 0 | 4 |
551f239c6f144c73d4abd831dff710318f9d3a00 | 8,976 | py | Python | Solution/1- Armo datasets/4-Armo_dataset_marzo_boosting.py | Lucerago/MELI_Datachallenge2021 | f783478037038bc2209d9b0ef26e0c15341f311b | [
"MIT"
] | null | null | null | Solution/1- Armo datasets/4-Armo_dataset_marzo_boosting.py | Lucerago/MELI_Datachallenge2021 | f783478037038bc2209d9b0ef26e0c15341f311b | [
"MIT"
] | null | null | null | Solution/1- Armo datasets/4-Armo_dataset_marzo_boosting.py | Lucerago/MELI_Datachallenge2021 | f783478037038bc2209d9b0ef26e0c15341f311b | [
"MIT"
] | null | null | null | #Creo el dataset para la predicción del boosting
import gc
gc.collect()
import pandas as pd
import seaborn as sns
import numpy as np
#%% marzo
marzo = pd.read_csv(r'C:\Users\argomezja\Desktop\Data Science\MELI challenge\Project MELI\Dataset_limpios\marzo_limpio.csv.gz')
marzo = marzo.loc[marzo['day']>=4].reset_index(drop=True)
marzo['day']=marzo['day']-3
#Trabajo mejor el price
marzo = marzo.assign(current_price=marzo.groupby('currency').transform(lambda x: (x - x.min()) / (x.max()- x.min())))
subtest1 = marzo[['sku', 'day', 'sold_quantity']]
subtest1= subtest1.pivot_table(index = 'sku', columns= 'day', values = 'sold_quantity').add_prefix('sales')
subtest2 = marzo[['sku', 'day', 'current_price']]
subtest2= subtest2.pivot_table(index = 'sku', columns= 'day', values = 'current_price').add_prefix('price')
subtest3 = marzo[['sku', 'day', 'minutes_active']]
subtest3= subtest3.pivot_table(index = 'sku', columns= 'day', values = 'minutes_active').add_prefix('active_time')
subtest4 = marzo[['sku', 'day', 'listing_type']]
subtest4= subtest4.pivot_table(index = 'sku', columns= 'day', values = 'listing_type').add_prefix('listing_type')
subtest6 = marzo[['sku', 'day', 'shipping_logistic_type']]
subtest6= subtest6.pivot_table(index = 'sku', columns= 'day', values = 'shipping_logistic_type').add_prefix('shipping_logistic_type')
subtest7 = marzo[['sku', 'day', 'shipping_payment']]
subtest7= subtest7.pivot_table(index = 'sku', columns= 'day', values = 'shipping_payment').add_prefix('shipping_payment')
final = pd.merge(subtest1, subtest2, left_index=True, right_index=True )
final = pd.merge(final, subtest3, left_index=True, right_index=True)
final = pd.merge(final, subtest4, left_index=True, right_index=True)
final = pd.merge(final, subtest6, left_index=True, right_index=True)
final = pd.merge(final, subtest7, left_index=True, right_index=True)
del subtest1,subtest2,subtest3,subtest4,subtest6, subtest7
#%% Promedios cada 3 dias
marzo_test = marzo.sort_values(['sku','day']).reset_index(drop=True).copy()
marzo_test['promedio_3'] = marzo.groupby(['sku'])['sold_quantity'].rolling(3, min_periods=3).mean().reset_index(drop=True)
marzo_test['promedio_7'] = marzo.groupby(['sku'])['sold_quantity'].rolling(7, min_periods=7).mean().reset_index(drop=True)
marzo_test['promedio_15'] = marzo.groupby(['sku'])['sold_quantity'].rolling(15, min_periods=15).mean().reset_index(drop=True)
marzo_test['promedio_20'] = marzo.groupby(['sku'])['sold_quantity'].rolling(20, min_periods=20).mean().reset_index(drop=True)
# Pivoteo y mergeo
subtest3 = marzo_test[['sku', 'day', 'promedio_3']]
subtest3= subtest3.pivot_table(index = 'sku', columns= 'day', values = 'promedio_3', dropna=False).add_prefix('promedio_3')
subtest4 = marzo_test[['sku', 'day', 'promedio_7']]
subtest4= subtest4.pivot_table(index = 'sku', columns= 'day', values = 'promedio_7', dropna=False).add_prefix('promedio_7')
subtest6 = marzo_test[['sku', 'day', 'promedio_15']]
subtest6= subtest6.pivot_table(index = 'sku', columns= 'day', values = 'promedio_15', dropna=False).add_prefix('promedio_15')
subtest7 = marzo_test[['sku', 'day', 'promedio_20']]
subtest7= subtest7.pivot_table(index = 'sku', columns= 'day', values = 'promedio_20', dropna=False).add_prefix('promedio_20')
final = pd.merge(final, subtest3, left_index=True, right_index=True)
final = pd.merge(final, subtest4, left_index=True, right_index=True)
final = pd.merge(final, subtest6, left_index=True, right_index=True)
final = pd.merge(final, subtest7, left_index=True, right_index=True)
final = final.dropna(axis=1, how='all')
del subtest3,subtest4,subtest6, subtest7
marzo_test['promedio_3_active_time'] = marzo.groupby(['sku'])['minutes_active'].rolling(3, min_periods=3).mean().reset_index(drop=True)
marzo_test['promedio_7_active_time'] = marzo.groupby(['sku'])['minutes_active'].rolling(7, min_periods=7).mean().reset_index(drop=True)
marzo_test['promedio_15_active_time'] = marzo.groupby(['sku'])['minutes_active'].rolling(15, min_periods=15).mean().reset_index(drop=True)
marzo_test['promedio_20_active_time'] = marzo.groupby(['sku'])['minutes_active'].rolling(20, min_periods=20).mean().reset_index(drop=True)
# Pivoteo y mergeo
subtest3 = marzo_test[['sku', 'day', 'promedio_3_active_time']]
subtest3= subtest3.pivot_table(index = 'sku', columns= 'day', values = 'promedio_3_active_time', dropna=False).add_prefix('promedio_3_active_time')
subtest4 = marzo_test[['sku', 'day', 'promedio_7_active_time']]
subtest4= subtest4.pivot_table(index = 'sku', columns= 'day', values = 'promedio_7_active_time', dropna=False).add_prefix('promedio_7_active_time')
subtest6 = marzo_test[['sku', 'day', 'promedio_15_active_time']]
subtest6= subtest6.pivot_table(index = 'sku', columns= 'day', values = 'promedio_15_active_time', dropna=False).add_prefix('promedio_15_active_time')
subtest7 = marzo_test[['sku', 'day', 'promedio_20_active_time']]
subtest7= subtest7.pivot_table(index = 'sku', columns= 'day', values = 'promedio_20_active_time', dropna=False).add_prefix('promedio_20_active_time')
final = pd.merge(final, subtest3, left_index=True, right_index=True)
final = pd.merge(final, subtest4, left_index=True, right_index=True)
final = pd.merge(final, subtest6, left_index=True, right_index=True)
final = pd.merge(final, subtest7, left_index=True, right_index=True)
final = final.dropna(axis=1, how='all')
del subtest3,subtest4,subtest6, subtest7
#Sumas active time
marzo_test['suma_3_active_time'] = marzo.groupby(['sku'])['minutes_active'].rolling(3, min_periods=3).sum().reset_index(drop=True)
marzo_test['suma_7_active_time'] = marzo.groupby(['sku'])['minutes_active'].rolling(7, min_periods=7).sum().reset_index(drop=True)
marzo_test['suma_15_active_time'] = marzo.groupby(['sku'])['minutes_active'].rolling(15, min_periods=15).sum().reset_index(drop=True)
marzo_test['suma_20_active_time'] = marzo.groupby(['sku'])['minutes_active'].rolling(20, min_periods=20).sum().reset_index(drop=True)
# Pivoteo y mergeo
subtest3 = marzo_test[['sku', 'day', 'suma_3_active_time']]
subtest3= subtest3.pivot_table(index = 'sku', columns= 'day', values = 'suma_3_active_time', dropna=False).add_prefix('suma_3_active_time')
subtest4 = marzo_test[['sku', 'day', 'suma_7_active_time']]
subtest4= subtest4.pivot_table(index = 'sku', columns= 'day', values = 'suma_7_active_time', dropna=False).add_prefix('suma_7_active_time')
subtest6 = marzo_test[['sku', 'day', 'suma_15_active_time']]
subtest6= subtest6.pivot_table(index = 'sku', columns= 'day', values = 'suma_15_active_time', dropna=False).add_prefix('suma_15_active_time')
subtest7 = marzo_test[['sku', 'day', 'suma_20_active_time']]
subtest7= subtest7.pivot_table(index = 'sku', columns= 'day', values = 'suma_20_active_time', dropna=False).add_prefix('suma_20_active_time')
final = pd.merge(final, subtest3, left_index=True, right_index=True)
final = pd.merge(final, subtest4, left_index=True, right_index=True)
final = pd.merge(final, subtest6, left_index=True, right_index=True)
final = pd.merge(final, subtest7, left_index=True, right_index=True)
final = final.dropna(axis=1, how='all')
del subtest3,subtest4,subtest6, subtest7
#Sumas sales time
marzo_test['sumas_3'] = marzo.groupby(['sku'])['sold_quantity'].rolling(3, min_periods=3).sum().reset_index(drop=True)
marzo_test['sumas_7'] = marzo.groupby(['sku'])['sold_quantity'].rolling(7, min_periods=7).sum().reset_index(drop=True)
marzo_test['sumas_15'] = marzo.groupby(['sku'])['sold_quantity'].rolling(15, min_periods=15).sum().reset_index(drop=True)
marzo_test['sumas_20'] = marzo.groupby(['sku'])['sold_quantity'].rolling(20, min_periods=20).sum().reset_index(drop=True)
# Pivoteo y mergeo
subtest3 = marzo_test[['sku', 'day', 'sumas_3']]
subtest3= subtest3.pivot_table(index = 'sku', columns= 'day', values = 'sumas_3', dropna=False).add_prefix('sumas_3')
subtest4 = marzo_test[['sku', 'day', 'sumas_7']]
subtest4= subtest4.pivot_table(index = 'sku', columns= 'day', values = 'sumas_7', dropna=False).add_prefix('sumas_7')
subtest6 = marzo_test[['sku', 'day', 'sumas_15']]
subtest6= subtest6.pivot_table(index = 'sku', columns= 'day', values = 'sumas_15', dropna=False).add_prefix('sumas_15')
subtest7 = marzo_test[['sku', 'day', 'sumas_20']]
subtest7= subtest7.pivot_table(index = 'sku', columns= 'day', values = 'sumas_20', dropna=False).add_prefix('sumas_20')
final = pd.merge(final, subtest3, left_index=True, right_index=True)
final = pd.merge(final, subtest4, left_index=True, right_index=True)
final = pd.merge(final, subtest6, left_index=True, right_index=True)
final = pd.merge(final, subtest7, left_index=True, right_index=True)
final = final.dropna(axis=1, how='all')
del subtest3,subtest4,subtest6, subtest7
final = final.reset_index(drop = False)
final.to_csv('marzo_lgbm_price_norm.csv.gz',index=False, compression="gzip")
| 63.659574 | 150 | 0.733066 | 1,301 | 8,976 | 4.807071 | 0.086088 | 0.060441 | 0.052766 | 0.063319 | 0.82811 | 0.801727 | 0.771506 | 0.694915 | 0.649344 | 0.617365 | 0 | 0.032017 | 0.0918 | 8,976 | 140 | 151 | 64.114286 | 0.735157 | 0.022616 | 0 | 0.27451 | 0 | 0.009804 | 0.219555 | 0.060891 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.039216 | 0 | 0.039216 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 1 | 1 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
9b2abc850334f14983d2153277155001c92f73a3 | 182,841 | py | Python | test.py | Evyatar108/frontier192 | 198794737316517d445544e005916d7b0d8623fd | [
"MIT"
] | null | null | null | test.py | Evyatar108/frontier192 | 198794737316517d445544e005916d7b0d8623fd | [
"MIT"
] | null | null | null | test.py | Evyatar108/frontier192 | 198794737316517d445544e005916d7b0d8623fd | [
"MIT"
] | null | null | null | import kaHIP
if __name__ == "__main__":
ncount = 5
vwgt = None
xadj = [0,2,5,7,9,12]
adjcwgt = [1,1,1,1,1,1,1,1,1,1,1,1]
adjncy = [1,4,0,2,4,1,3,2,4,0,1,3]
nparts = 2
imbalance = 0.03
suppress_output = False
mode = kaHIP.STRONG
seed = 0
xadj = [0, 15, 31, 45, 60, 75, 91, 106, 122, 136, 151, 165, 182, 201, 219, 240, 255, 272, 291, 306, 322, 339, 354, 369, 384, 398, 414, 435, 453, 469, 483, 497, 513, 532, 550, 566, 583, 597, 614, 629, 643, 661, 679, 696, 713, 729, 744, 759, 774, 790, 805, 821, 835, 850, 866, 884, 898, 915, 929, 947, 963, 983, 1001, 1019, 1036, 1056, 1074, 1089, 1107, 1125, 1141, 1158, 1173, 1189, 1209, 1226, 1243, 1263, 1278, 1297, 1313, 1330, 1348, 1364, 1383, 1399, 1413, 1430, 1446, 1461, 1481, 1502, 1517, 1533, 1552, 1567, 1583, 1601, 1617, 1631, 1646, 1660, 1676, 1690, 1705, 1721, 1736, 1751, 1766, 1788, 1811, 1825, 1839, 1853, 1867, 1881, 1898, 1913, 1929, 1944, 1961, 1977, 1993, 2007, 2024, 2043, 2063, 2083, 2102, 2120, 2138, 2156, 2170, 2184, 2199, 2215, 2232, 2247, 2262, 2281, 2298, 2318, 2332, 2346, 2360, 2378, 2393, 2408, 2425, 2440, 2457, 2472, 2487, 2501, 2515, 2532, 2550, 2571, 2587, 2603, 2619, 2633, 2649, 2665, 2681, 2696, 2713, 2729, 2743, 2758, 2772, 2786, 2802, 2820, 2839, 2855, 2873, 2889, 2904, 2921, 2941, 2956, 2973, 2991, 3009, 3026, 3041, 3057, 3073, 3090, 3104, 3118, 3137, 3152, 3169, 3183, 3197, 3211, 3227, 3242, 3257, 3272, 3289, 3303, 3320, 3335, 3354, 3374, 3394, 3414, 3430, 3445, 3462, 3477, 3491, 3505, 3520, 3535, 3554, 3568, 3584, 3598, 3614, 3629, 3644, 3660, 3675, 3689, 3704, 3719, 3736, 3756, 3770, 3789, 3805, 3823, 3841, 3856, 3872, 3890, 3906, 3923, 3942, 3960, 3976, 3992, 4008, 4026, 4040, 4056, 4071, 4091, 4109, 4125, 4142, 4159, 4177, 4195, 4211, 4228, 4243, 4260, 4276, 4290, 4305, 4320, 4336, 4351, 4366, 4385, 4403, 4419, 4434, 4452, 4469, 4484, 4499, 4516, 4534, 4550, 4565, 4581, 4599, 4616, 4632, 4648, 4664, 4682, 4696, 4713, 4733, 4747, 4763, 4780, 4796, 4815, 4833, 4849, 4867, 4881, 4899, 4914, 4933, 4948, 4964, 4981, 4999, 5017, 5035, 5049, 5071, 5090, 5104, 5119, 5135, 5155, 5171, 5188, 5204, 5219, 5234, 5252, 5270, 5286, 5307, 5325, 5342, 5357, 5371, 5386, 5406, 5423, 5441, 5457, 5479, 5498, 5517, 5534, 5550, 5565, 5581, 5596, 5614, 5628, 5644, 5658, 5677, 5691, 5710, 5725, 5740, 5756, 5776, 5796, 5814, 5828, 5842, 5856, 5870, 5884, 5899, 5913, 5927, 5941, 5956, 5972, 5988, 6003, 6018, 6033, 6049, 6063, 6078, 6095, 6109, 6123, 6138, 6156, 6173, 6189, 6207, 6226, 6242, 6256, 6270, 6284, 6300, 6317, 6335, 6352, 6369, 6389, 6405, 6420, 6435, 6449, 6463, 6477, 6491, 6510, 6529, 6543, 6559, 6574, 6593, 6608, 6623, 6640, 6659, 6675, 6692, 6707, 6724, 6743, 6759, 6777, 6792, 6806, 6826, 6848, 6862, 6881, 6898, 6914, 6928, 6943, 6959, 6974, 6989, 7006, 7026, 7042, 7059, 7076, 7091, 7108, 7124, 7144, 7158, 7173, 7189, 7205, 7221, 7236, 7253, 7268, 7283, 7298, 7323, 7343, 7363, 7380, 7395, 7410, 7426, 7445, 7466, 7486, 7506, 7523, 7541, 7559, 7576, 7593, 7609, 7628, 7645, 7662, 7678, 7696, 7714, 7732, 7746, 7761, 7777, 7791, 7809, 7827, 7843, 7859, 7873, 7889, 7908, 7925, 7942, 7961, 7979, 7997, 8012, 8027, 8043, 8063, 8079, 8094, 8111, 8129, 8145, 8162, 8179, 8198, 8217, 8232, 8247, 8267, 8286, 8304, 8318, 8337, 8351, 8366, 8381, 8397, 8412, 8427, 8442, 8464, 8480, 8495, 8511, 8526, 8542, 8566, 8582, 8596, 8616, 8633, 8651, 8665, 8680, 8694, 8711, 8727, 8742, 8756, 8770, 8786, 8802, 8817, 8832, 8847, 8861, 8876, 8892, 8907, 8921, 8937, 8953, 8967, 8981, 8996, 9010, 9026, 9043, 9057, 9071, 9086, 9102, 9117, 9131, 9145, 9161, 9177, 9194, 9210, 9224, 9241, 9255, 9271, 9285, 9300, 9319, 9333, 9347, 9365, 9384, 9399, 9416, 9432, 9447, 9462, 9479, 9495, 9514, 9531, 9551, 9568, 9584, 9599, 9617, 9635, 9652, 9668, 9683, 9702, 9720, 9737, 9753, 9767, 9787, 9809, 9826, 9840, 9854, 9870, 9887, 9905, 9925, 9945, 9966, 9987, 10006, 10025, 10046, 10066, 10087, 10103, 10122, 10143, 10161, 10177, 10192, 10209, 10223, 10240, 10254, 10271, 10285, 10302, 10317, 10337, 10355, 10372, 10387, 10403, 10421, 10438, 10452, 10466, 10482, 10500, 10515, 10532, 10550, 10566, 10585, 10609, 10625, 10639, 10653, 10669, 10683, 10701, 10718, 10735, 10749, 10768, 10789, 10805, 10820, 10838, 10853, 10871, 10887, 10904, 10920, 10937, 10954, 10972, 10986, 11003, 11022, 11047, 11062, 11077, 11093, 11109, 11124, 11139, 11158, 11175, 11193, 11212, 11226, 11245, 11261, 11277, 11292, 11309, 11323, 11342, 11359, 11373, 11390, 11408, 11422, 11436, 11452, 11466, 11486, 11501, 11515, 11534, 11549, 11567, 11586, 11601, 11615, 11629, 11644, 11659, 11673, 11687, 11702, 11720, 11736, 11754, 11772, 11787, 11803, 11823, 11840, 11857, 11880, 11899, 11915, 11938, 11964, 11984, 12009, 12029, 12051, 12067, 12091, 12107, 12123, 12140, 12164, 12180, 12195, 12214, 12231, 12247, 12265, 12281, 12296, 12313, 12327, 12345, 12362, 12379, 12393, 12409, 12430, 12444, 12458, 12472, 12487, 12506, 12520, 12535, 12551, 12565, 12584, 12603, 12622, 12638, 12652, 12671, 12689, 12706, 12724, 12740, 12754, 12773, 12789, 12806, 12821, 12835, 12850, 12865, 12881, 12897, 12917, 12934, 12955, 12971, 12987, 13001, 13016, 13031, 13045, 13059, 13075, 13091, 13106, 13120, 13134, 13150, 13164, 13181, 13196, 13210, 13225, 13241, 13256, 13273, 13293, 13314, 13331, 13347, 13364, 13381, 13396, 13411, 13425, 13440, 13457, 13472, 13489, 13508, 13523, 13537, 13554, 13570, 13585, 13600, 13614, 13633, 13650, 13673, 13693, 13713, 13735, 13750, 13766, 13782, 13799, 13816, 13833, 13848, 13866, 13880, 13895, 13912, 13927, 13941, 13955, 13970, 13985, 14001, 14017, 14036, 14052, 14072, 14086, 14100, 14114, 14128, 14145, 14161, 14175, 14189, 14204, 14218, 14234, 14249, 14267, 14280, 14295, 14311, 14334, 14356, 14371, 14390, 14409, 14426, 14446, 14464, 14481, 14495, 14512, 14525, 14540, 14555, 14574, 14589, 14609, 14632, 14647, 14661, 14677, 14697, 14711, 14725, 14740, 14758, 14778, 14794, 14811, 14829, 14845, 14863, 14879, 14897, 14912, 14927, 14941, 14958, 14974, 14989, 15008, 15023, 15039, 15055, 15073, 15090, 15104, 15120, 15134, 15151, 15165, 15179, 15200, 15223, 15238, 15259, 15279, 15298, 15314, 15328, 15342, 15356, 15374, 15393, 15410, 15427, 15445, 15467, 15486, 15500, 15518, 15538, 15561, 15584, 15604, 15618, 15632, 15646, 15661, 15675, 15694, 15708, 15724, 15740, 15755, 15771, 15787, 15805, 15821, 15839, 15856, 15873, 15892, 15910, 15926, 15945, 15964, 15982, 15999, 16017, 16033, 16050, 16068, 16084, 16098, 16113, 16130, 16145, 16164, 16181, 16197, 16213, 16229, 16243, 16258, 16272, 16287, 16302, 16324, 16343, 16359, 16375, 16390, 16406, 16420, 16436, 16450, 16466, 16480, 16494, 16512]
adjcwgt = [1565, 1328, 1751, 1053, 1734, 1891, 1269, 2145, 1368, 1728, 1611, 2587, 940, 595, 1267, 1241, 1152, 646, 1201, 1351, 1731, 1479, 1394, 942, 1473, 1087, 1072, 1068, 1612, 880, 1027, 534, 1624, 1531, 1644, 997, 1329, 1624, 1433, 693, 1097, 1495, 777, 1752, 1708, 1152, 733, 1530, 1479, 730, 760, 1282, 1520, 1315, 1305, 1252, 1355, 1213, 1397, 715, 1239, 1541, 777, 1474, 1453, 997, 1563, 689, 1569, 652, 1786, 1231, 1180, 1142, 1673, 409, 1815, 1474, 989, 1433, 1420, 1235, 1440, 477, 1334, 989, 1172, 1257, 339, 360, 498, 631, 1453, 989, 955, 997, 1497, 467, 926, 1127, 1101, 1205, 561, 774, 800, 653, 1246, 1615, 1249, 1780, 1626, 997, 499, 1261, 570, 736, 1006, 1381, 863, 1103, 195, 1607, 1144, 1258, 1212, 1415, 1291, 1497, 499, 506, 1205, 1065, 891, 701, 1565, 581, 1494, 902, 53, 1114, 1704, 493, 1670, 1743, 580, 1691, 1262, 1155, 2260, 1131, 1160, 1009, 1312, 530, 744, 1559, 493, 733, 1484, 707, 1674, 1690, 1811, 1304, 1603, 1125, 1435, 1742, 1966, 1310, 193, 1237, 1254, 621, 1272, 1534, 1548, 1382, 1832, 1944, 1356, 1224, 1067, 1503, 1780, 1434, 1925, 1743, 193, 1256, 1180, 428, 1369, 1366, 1740, 1202, 1861, 2125, 2128, 1440, 1400, 2391, 2148, 2123, 2280, 1440, 254, 1750, 2233, 1395, 2315, 2185, 2137, 1964, 1304, 1137, 1070, 1233, 333, 2511, 1717, 2023, 1851, 1461, 824, 1206, 1680, 1389, 2055, 2005, 1831, 1768, 1242, 1704, 2458, 1488, 1263, 928, 975, 2147, 1624, 730, 14, 1322, 1277, 1604, 1105, 1512, 1230, 1238, 1236, 1447, 827, 708, 1070, 847, 760, 1233, 1362, 1308, 972, 1238, 1443, 1301, 729, 1190, 1137, 1262, 675, 1366, 1394, 1475, 1278, 1467, 1433, 689, 1101, 1381, 1286, 1173, 1268, 1171, 1129, 1199, 879, 1236, 1014, 1924, 1092, 1247, 1228, 443, 974, 526, 1911, 1342, 863, 701, 512, 1298, 1339, 853, 1107, 507, 1167, 755, 739, 1041, 643, 1520, 1221, 98, 654, 966, 1124, 1236, 1301, 1236, 1167, 792, 696, 1438, 1219, 301, 1223, 1315, 1436, 1162, 752, 1205, 1811, 327, 1447, 729, 1269, 792, 1222, 1224, 1225, 1087, 1305, 845, 1365, 1245, 643, 1190, 55, 74, 738, 810, 1265, 1575, 1389, 768, 1072, 1252, 864, 1416, 1297, 665, 1137, 55, 124, 704, 824, 1290, 1619, 1430, 817, 1068, 1355, 786, 1291, 1173, 666, 1262, 74, 124, 810, 840, 1201, 1555, 1315, 693, 1612, 1177, 1213, 1557, 1480, 693, 1328, 675, 1222, 738, 704, 810, 691, 1202, 1714, 1696, 1591, 1259, 1581, 188, 2480, 1593, 1366, 1886, 810, 824, 840, 691, 1334, 1063, 2989, 1386, 2369, 1446, 1866, 1261, 3452, 3882, 805, 2042, 2006, 2233, 1029, 1264, 3527, 1492, 2820, 15, 2493, 545, 1039, 2806, 1508, 4885, 3597, 2353, 5294, 1240, 2805, 3326, 3092, 3965, 2776, 7329, 2820, 2307, 3931, 2614, 2588, 2074, 2484, 1542, 501, 3254, 3482, 2237, 1722, 2132, 710, 805, 2307, 792, 1184, 1093, 1520, 6824, 6733, 3212, 3619, 3041, 4927, 6838, 4206, 4223, 744, 4775, 3993, 1952, 5489, 4902, 5399, 4214, 1916, 4589, 5792, 3312, 2323, 5169, 2272, 1219, 3204, 1952, 3541, 1454, 1947, 2300, 2536, 2900, 3097, 3317, 2195, 2451, 3627, 1723, 1322, 4747, 2377, 5489, 3541, 1944, 499, 3366, 1149, 1455, 1774, 3118, 2190, 2508, 2972, 1146, 270, 2763, 6080, 1454, 2865, 6824, 4902, 2995, 499, 1569, 3832, 680, 955, 1324, 1738, 2248, 2736, 746, 5399, 230, 3261, 1947, 3238, 3566, 3238, 2763, 1924, 2487, 1620, 1055, 1076, 1727, 2219, 1416, 2705, 2161, 2135, 940, 953, 2127, 1883, 1710, 2002, 1620, 950, 2210, 689, 2152, 1826, 2197, 1047, 760, 699, 1812, 2481, 1301, 2484, 352, 487, 2332, 1055, 2481, 2678, 2074, 2739, 1986, 2470, 2789, 861, 2686, 1783, 1776, 1726, 1175, 648, 1312, 1616, 1125, 972, 1364, 1114, 744, 855, 1451, 1547, 1342, 1162, 1268, 1203, 83, 949, 1002, 623, 1242, 832, 1271, 365, 816, 469, 1151, 471, 1271, 523, 945, 471, 3108, 1905, 2666, 2669, 2170, 2136, 1409, 1495, 1905, 2699, 2251, 2151, 2600, 924, 671, 983, 591, 1307, 1364, 1523, 596, 1388, 898, 1104, 1322, 1308, 1286, 1107, 98, 752, 794, 1532, 120, 1160, 44, 1268, 1261, 1205, 1255, 1207, 604, 1341, 1173, 512, 654, 1205, 596, 1227, 1338, 1101, 1157, 568, 1299, 1673, 1145, 83, 1046, 1388, 1131, 733, 925, 1437, 1471, 1298, 1225, 1255, 1281, 1188, 1373, 1234, 1733, 1655, 855, 151, 898, 1670, 1484, 972, 966, 327, 1207, 1328, 1009, 925, 1200, 1201, 691, 971, 1671, 2041, 834, 1224, 1610, 1592, 1510, 895, 262, 1757, 2047, 1202, 322, 1476, 1989, 1909, 861, 1073, 666, 998, 257, 789, 1634, 1239, 1447, 1527, 1149, 579, 1631, 1954, 1699, 1099, 1159, 413, 257, 911, 1709, 1470, 1377, 1528, 904, 1182, 732, 2046, 1546, 1221, 1787, 1133, 789, 911, 1273, 858, 825, 875, 1735, 1402, 1357, 1585, 1235, 484, 2011, 1634, 1709, 858, 1605, 1006, 1125, 1526, 1606, 1621, 437, 633, 688, 1806, 1966, 2125, 1628, 666, 2062, 1989, 1954, 1585, 2002, 1403, 1105, 1783, 1947, 607, 1371, 1256, 1763, 1195, 1262, 1690, 1272, 1369, 1125, 1637, 2002, 1623, 1061, 1366, 1440, 132, 1122, 988, 1441, 1720, 1862, 1534, 1366, 1479, 1034, 1259, 1841, 596, 260, 1638, 1522, 1820, 659, 1808, 639, 1854, 1610, 1643, 1536, 1286, 1702, 851, 1856, 1629, 1879, 1350, 1377, 605, 1039, 1580, 1532, 902, 959, 1592, 762, 1453, 1577, 1007, 1024, 909, 1073, 1360, 751, 1395, 1521, 634, 490, 1688, 1852, 379, 854, 1588, 1259, 1702, 1451, 1063, 838, 1930, 2304, 1365, 1053, 1915, 1540, 1889, 1829, 1382, 1202, 1539, 1748, 829, 260, 1451, 853, 1338, 1495, 1282, 1231, 794, 1227, 1198, 708, 1443, 1092, 1467, 696, 1269, 1536, 804, 695, 1450, 1465, 1675, 1202, 1499, 2298, 973, 841, 1062, 1064, 1087, 958, 566, 1034, 1940, 990, 1755, 1032, 488, 1981, 466, 679, 1832, 1861, 607, 996, 1978, 2149, 838, 1863, 1817, 2152, 1576, 2192, 1568, 1711, 954, 312, 1844, 1985, 1144, 1639, 1500, 1377, 1695, 602, 187, 1569, 1281, 1785, 2460, 1479, 1401, 900, 1865, 2337, 2193, 946, 2332, 1406, 1238, 1374, 2289, 1902, 312, 416, 499, 1301, 1268, 2037, 1649, 1857, 1032, 499, 1874, 2963, 1791, 1667, 1413, 2250, 2885, 1588, 187, 754, 1285, 1738, 1326, 2445, 1675, 1732, 2388, 1595, 3036, 3568, 543, 2010, 2366, 3085, 643, 1707, 545, 2614, 1093, 2054, 496, 1968, 1983, 2036, 2018, 2756, 3401, 1038, 2504, 2671, 516, 3122, 2176, 1039, 2588, 1520, 1658, 496, 1848, 4753, 4333, 7708, 6462, 2837, 3096, 2762, 3959, 2791, 2196, 2264, 4248, 2449, 2989, 2806, 2985, 1826, 2445, 1968, 1848, 3716, 2933, 3488, 4829, 1003, 3441, 3685, 3495, 3249, 6456, 6309, 3452, 1508, 3254, 6733, 3036, 2756, 2197, 1713, 1922, 2140, 1609, 2020, 1654, 505, 1897, 1820, 1947, 2022, 647, 1895, 1726, 1987, 981, 637, 767, 1218, 703, 1619, 624, 2036, 855, 2022, 1350, 765, 781, 1298, 1096, 1064, 462, 646, 1168, 1363, 984, 949, 1141, 1312, 1232, 1404, 845, 864, 786, 1557, 1591, 1649, 437, 760, 584, 1531, 984, 417, 148, 784, 496, 1418, 1365, 1416, 1291, 913, 885, 1480, 1569, 1561, 600, 1333, 949, 148, 505, 917, 641, 1909, 1699, 1245, 1297, 1173, 1062, 1581, 919, 1443, 1415, 494, 593, 862, 406, 1511, 861, 1018, 861, 1099, 1221, 2011, 1966, 1622, 2526, 1817, 1883, 1006, 1176, 2282, 1250, 1280, 1477, 1985, 1862, 1741, 639, 1688, 1285, 1460, 1852, 1740, 1853, 1303, 637, 1721, 1840, 1338, 1961, 1250, 497, 1086, 1042, 724, 1831, 1760, 1854, 1240, 1157, 521, 1646, 981, 653, 945, 767, 1012, 1280, 497, 1579, 1391, 1846, 1144, 1284, 1862, 948, 885, 23, 1419, 1470, 1028, 1051, 1312, 1070, 641, 530, 1223, 1389, 1386, 1063, 1703, 439, 1043, 1218, 1352, 1615, 558, 496, 902, 402, 2283, 856, 482, 1094, 2657, 4096, 2441, 4072, 1863, 1852, 2268, 2729, 1100, 1115, 2155, 2328, 1114, 759, 2378, 189, 1985, 2400, 1439, 3015, 2086, 464, 1990, 2321, 999, 1047, 2236, 1991, 2366, 1416, 1047, 1550, 1595, 567, 779, 1654, 1077, 1580, 2129, 1734, 2159, 1580, 1987, 2279, 2470, 2183, 1013, 689, 1151, 792, 1723, 1152, 638, 1072, 43, 499, 998, 517, 1326, 1558, 1509, 1688, 1869, 1501, 846, 1250, 1162, 1558, 1000, 938, 542, 499, 1139, 498, 1497, 1691, 1571, 1115, 1284, 1794, 1109, 1342, 1130, 1381, 1061, 801, 2187, 1470, 1440, 1415, 1041, 998, 498, 826, 999, 1390, 827, 962, 1841, 1483, 1474, 1468, 61, 1101, 2135, 1334, 1415, 1054, 1497, 999, 607, 1189, 1091, 1054, 1411, 1133, 1024, 1615, 1405, 4591, 4053, 533, 1746, 2193, 1964, 1771, 2118, 1689, 4701, 793, 1673, 3713, 3131, 1101, 2042, 1044, 1936, 2370, 2106, 1489, 1995, 1557, 1304, 1549, 1599, 1499, 1313, 2952, 2197, 1558, 2176, 560, 1036, 625, 1022, 1137, 2323, 1248, 1101, 1499, 1010, 2086, 1894, 2576, 2160, 2440, 1959, 945, 1441, 1852, 2576, 2156, 2877, 1680, 497, 996, 1993, 2219, 683, 1929, 2106, 2148, 1943, 2449, 958, 1429, 2268, 2525, 1755, 2437, 497, 499, 2489, 2453, 186, 2426, 2587, 2638, 1443, 2947, 1167, 1545, 4072, 2729, 2530, 1383, 2049, 996, 499, 2789, 313, 2926, 248, 706, 1453, 2046, 1778, 2324, 2502, 1544, 1100, 1210, 2457, 2555, 2065, 2017, 974, 1074, 1442, 2671, 769, 1584, 773, 863, 2348, 2407, 1971, 1567, 2206, 1115, 1652, 2576, 3542, 3925, 1545, 2219, 2453, 2789, 974, 1572, 2391, 2222, 1864, 1048, 1583, 2522, 2151, 2043, 1864, 2499, 2458, 2499, 928, 783, 2798, 1613, 1635, 2475, 1096, 936, 1852, 981, 1470, 122, 1693, 928, 483, 1274, 988, 892, 1493, 709, 1566, 642, 1464, 605, 2126, 1569, 1443, 1883, 1534, 1077, 1149, 904, 1735, 1783, 1196, 1575, 1619, 1555, 1063, 1811, 1467, 1239, 1150, 1303, 1160, 1603, 1356, 1440, 1075, 1681, 1947, 132, 1753, 1129, 1497, 1414, 859, 2055, 2191, 1319, 1817, 1944, 2125, 1866, 609, 1757, 1034, 1940, 1978, 2551, 2334, 732, 2217, 1368, 1702, 2706, 1647, 2656, 499, 902, 1381, 4291, 1001, 1890, 248, 773, 1253, 1684, 1931, 1471, 499, 874, 2098, 1192, 402, 1880, 4140, 1475, 2160, 1436, 706, 863, 1753, 2021, 1469, 1044, 611, 569, 173, 792, 469, 1200, 507, 839, 1396, 940, 958, 1414, 1410, 940, 1774, 1475, 1334, 1176, 482, 1175, 1808, 1667, 659, 1395, 1284, 1582, 1755, 1027, 1334, 2498, 986, 2481, 1290, 2046, 2123, 2144, 2100, 1405, 1936, 1036, 2037, 2155, 2042, 3488, 2210, 1264, 2390, 1250, 3579, 2330, 2113, 2220, 423, 1261, 2353, 501, 972, 1595, 2018, 6462, 4829, 2735, 5908, 2562, 4177, 5984, 2439, 7410, 5090, 5294, 6089, 4927, 5792, 2369, 2361, 2515, 498, 2657, 1632, 1615, 3204, 945, 958, 1167, 2461, 1006, 2384, 2453, 2760, 2525, 2481, 498, 2851, 3803, 1135, 1562, 3517, 1441, 1429, 1545, 2763, 1447, 2684, 1955, 1552, 813, 1179, 1290, 1233, 2603, 1440, 1812, 2348, 533, 2106, 625, 1306, 2169, 1182, 1983, 2046, 1233, 1969, 254, 2075, 1140, 2092, 1746, 1489, 1022, 1313, 1234, 2443, 79, 1326, 537, 1978, 1935, 1969, 1349, 1750, 1653, 946, 1068, 1995, 2031, 755, 2088, 1928, 2231, 2448, 3329, 1389, 1594, 1209, 411, 2473, 703, 671, 2509, 945, 2356, 1077, 1825, 1225, 1154, 1306, 578, 1186, 815, 2414, 1838, 2456, 2825, 2192, 2055, 404, 2083, 1602, 3387, 2481, 1516, 1486, 2461, 3896, 1063, 1840, 2526, 2032, 1865, 1850, 237, 1990, 815, 6929, 4760, 7823, 7161, 7299, 10576, 8745, 9464, 402, 852, 1928, 582, 10272, 10655, 6974, 7199, 5020, 7651, 7144, 10343, 10219, 8524, 402, 493, 1543, 905, 9197, 9872, 7409, 5504, 7773, 7441, 9893, 10016, 8572, 852, 493, 7326, 1327, 1204, 9173, 9441, 6841, 6694, 6773, 6514, 8698, 7378, 1928, 1543, 1327, 5795, 2442, 7901, 8527, 8937, 7336, 7822, 4883, 8383, 7624, 11045, 11125, 9322, 582, 905, 1204, 2442, 10046, 10618, 2755, 4339, 2463, 2000, 1464, 2428, 1918, 935, 2207, 2918, 1194, 535, 3713, 444, 1418, 5812, 3654, 2990, 499, 3085, 2595, 1837, 3170, 3010, 2809, 2974, 2516, 2572, 3342, 3070, 1223, 2509, 1030, 4487, 2339, 2799, 2548, 3400, 2928, 3514, 2226, 3502, 3269, 3152, 2605, 3066, 3511, 2757, 1817, 1943, 1831, 1313, 755, 1320, 1070, 1558, 1616, 1550, 1313, 2086, 1248, 2162, 1386, 930, 781, 1001, 1285, 521, 23, 1410, 1828, 1166, 1270, 1841, 939, 878, 1602, 1401, 1493, 1049, 553, 1189, 1495, 1553, 1460, 1831, 1419, 1401, 1619, 1603, 596, 1856, 1063, 853, 1863, 1406, 3107, 1976, 498, 2170, 2204, 875, 2414, 2476, 1488, 3070, 876, 2508, 1639, 2287, 2325, 1048, 1631, 1115, 1263, 1369, 2388, 670, 1173, 1211, 563, 1260, 566, 1530, 500, 2334, 2786, 2409, 2061, 792, 1284, 1199, 2411, 1956, 2821, 1252, 1314, 71, 1476, 1034, 500, 2540, 658, 2042, 2433, 1847, 1373, 2166, 1297, 2221, 2055, 1243, 2215, 1038, 1411, 1780, 2179, 602, 416, 754, 1455, 1672, 843, 1068, 509, 946, 1307, 1501, 2008, 2006, 1870, 690, 492, 861, 1952, 1385, 1930, 1144, 1243, 1285, 578, 763, 711, 1835, 611, 1087, 1301, 1738, 1354, 578, 1463, 1760, 1380, 86, 1464, 1407, 1651, 1569, 1455, 1738, 1080, 1297, 607, 1830, 379, 1268, 2168, 1631, 2213, 763, 424, 1214, 111, 2088, 974, 1248, 1281, 1672, 1326, 1297, 1171, 1040, 161, 1175, 1246, 1144, 120, 1157, 1188, 641, 1244, 1278, 443, 739, 1219, 671, 1338, 1325, 1099, 1040, 1515, 1202, 1874, 1881, 648, 1258, 1494, 1009, 1373, 1477, 1609, 914, 1523, 974, 1160, 1525, 568, 161, 1202, 1363, 1312, 1249, 1212, 44, 1299, 1234, 578, 1363, 1129, 526, 643, 1223, 591, 1198, 1086, 1265, 2264, 1307, 708, 2016, 769, 2142, 1884, 355, 2267, 2206, 1052, 2622, 2160, 1881, 192, 1788, 1042, 1626, 1291, 1736, 1101, 1911, 1377, 1250, 723, 1791, 1160, 792, 629, 701, 781, 1242, 1108, 1275, 1481, 901, 1502, 749, 1277, 1214, 1269, 1418, 1351, 1115, 1155, 760, 417, 505, 490, 558, 1494, 1389, 1430, 1315, 814, 1473, 513, 668, 1583, 1158, 935, 859, 1141, 784, 490, 1379, 530, 1146, 1087, 457, 1255, 1067, 752, 917, 1108, 1631, 938, 1472, 1533, 869, 389, 1022, 523, 961, 644, 1535, 706, 1776, 973, 1613, 1394, 713, 857, 575, 1275, 365, 715, 1090, 452, 507, 1327, 667, 562, 1379, 667, 685, 1369, 109, 1244, 1378, 1370, 1162, 1466, 713, 120, 119, 2270, 1672, 1678, 1027, 1491, 1385, 492, 2030, 1553, 2234, 1826, 1983, 1633, 1377, 2148, 1092, 1801, 693, 2008, 1114, 1596, 1924, 4440, 2384, 2045, 2958, 2758, 2756, 2342, 2202, 3616, 1853, 3329, 2526, 10576, 10219, 10016, 8698, 11125, 2428, 3618, 3706, 1993, 2924, 3345, 2448, 3447, 2488, 2561, 1391, 2471, 999, 2770, 3258, 1253, 1942, 444, 1046, 2699, 2931, 2130, 3404, 686, 999, 3371, 2517, 4053, 618, 943, 555, 2046, 3310, 3643, 3824, 1220, 1615, 1562, 2696, 1901, 1604, 2506, 2156, 1755, 1383, 3780, 2526, 3202, 978, 2836, 1153, 1764, 2092, 693, 862, 2185, 1776, 2026, 1317, 1895, 710, 1187, 2055, 2490, 1790, 1352, 1729, 2155, 891, 2006, 1029, 1667, 946, 2194, 1831, 1729, 499, 1616, 2370, 2073, 2107, 2132, 1719, 1240, 1596, 951, 1290, 1068, 2137, 1768, 1345, 1895, 499, 1550, 1781, 1807, 752, 975, 301, 1313, 1114, 1594, 2083, 2148, 2698, 710, 1254, 2789, 496, 1818, 1915, 1521, 1481, 790, 376, 969, 1209, 1336, 1596, 3618, 1602, 1187, 1271, 496, 1368, 1449, 1336, 1289, 1924, 2042, 1182, 79, 2031, 333, 1997, 1062, 2055, 2794, 1689, 1558, 1010, 1386, 1258, 2377, 2443, 902, 1509, 1971, 2045, 1913, 537, 1342, 2280, 1645, 891, 1240, 2370, 1248, 1913, 2550, 1866, 1787, 1697, 490, 931, 990, 1627, 1441, 1022, 2462, 1741, 1389, 1900, 1973, 539, 1196, 123, 654, 2264, 1548, 2069, 2148, 1700, 2160, 2132, 2215, 950, 1580, 2039, 986, 862, 1434, 1400, 1232, 2868, 793, 2326, 2421, 2712, 2238, 950, 2828, 1652, 2481, 2128, 1245, 774, 2080, 8, 2062, 1856, 1444, 1726, 1065, 1672, 1978, 2051, 1214, 1769, 1130, 1644, 1977, 1553, 1219, 1655, 1163, 1750, 1249, 1757, 966, 452, 510, 1922, 1970, 1167, 1214, 1859, 1763, 2985, 3441, 2384, 1461, 1864, 1250, 1401, 3868, 2055, 2020, 2498, 2238, 1035, 1256, 3533, 15, 2805, 792, 1490, 543, 1038, 1826, 3495, 3106, 2659, 2636, 1992, 2514, 2025, 1034, 1463, 1498, 2493, 3931, 2498, 2054, 1658, 2449, 3238, 3382, 3002, 3703, 1885, 1026, 529, 466, 2962, 3637, 2239, 3311, 3122, 1498, 497, 2995, 2763, 2887, 2505, 3207, 2762, 1388, 530, 33, 963, 3142, 1763, 2847, 3649, 1992, 497, 1944, 1569, 1528, 1118, 1820, 559, 871, 1356, 2351, 1788, 1723, 3317, 1885, 1388, 764, 496, 2332, 563, 1131, 1308, 1085, 2971, 2280, 2225, 1742, 2302, 2028, 2981, 1980, 2338, 496, 2487, 1986, 954, 1600, 1762, 1561, 2654, 2663, 2536, 3729, 1547, 2290, 818, 1486, 2660, 1687, 848, 1616, 902, 1312, 1733, 1850, 1396, 1806, 1371, 2066, 1696, 776, 1683, 1673, 1239, 1624, 733, 1307, 1291, 1617, 1115, 1524, 14, 1233, 1221, 1436, 841, 695, 1066, 1245, 1201, 584, 600, 494, 1158, 1070, 1557, 1439, 1075, 768, 817, 693, 1480, 1259, 780, 1467, 668, 128, 1629, 981, 1042, 1641, 1338, 1012, 1623, 1605, 964, 1039, 216, 1001, 320, 1506, 1443, 977, 1135, 516, 717, 471, 1201, 1221, 1586, 1420, 1580, 830, 1744, 949, 1859, 961, 516, 649, 983, 1293, 691, 949, 1526, 1320, 1532, 1060, 1278, 434, 1655, 1572, 312, 717, 649, 543, 1083, 1817, 971, 550, 1797, 1905, 1915, 834, 1221, 902, 1785, 1417, 1270, 471, 983, 1083, 1096, 1671, 1626, 1148, 1576, 954, 1673, 1831, 2638, 1755, 1230, 1440, 1162, 1350, 1624, 1091, 1106, 1588, 1239, 1444, 1249, 834, 2027, 972, 1445, 1473, 1356, 2648, 1566, 1581, 1466, 1837, 759, 1586, 1585, 3052, 1147, 448, 2412, 619, 1509, 1650, 491, 1780, 1639, 235, 2464, 827, 963, 1237, 1256, 1597, 1406, 1479, 1860, 854, 1539, 1619, 607, 1279, 1866, 1609, 1396, 625, 1451, 2254, 580, 707, 1254, 1180, 1112, 1125, 1748, 1736, 1437, 1075, 2186, 624, 1417, 1605, 1862, 724, 1144, 603, 1402, 372, 1570, 1414, 1375, 1480, 1390, 1166, 483, 1190, 162, 54, 1503, 51, 807, 2186, 1561, 1504, 266, 1503, 1511, 1532, 1013, 1514, 1507, 419, 823, 2145, 1393, 957, 702, 720, 1268, 681, 1146, 476, 445, 710, 720, 1617, 804, 1617, 1284, 493, 1157, 251, 1067, 1301, 1401, 1094, 1248, 476, 916, 1152, 251, 1207, 1255, 910, 1207, 1206, 1368, 1192, 1007, 1580, 242, 902, 929, 920, 1500, 1598, 957, 493, 1381, 821, 242, 1244, 1007, 1243, 1104, 1220, 693, 1066, 1532, 1730, 1648, 1010, 1494, 1070, 1014, 1438, 1730, 1773, 804, 652, 2527, 2840, 4429, 1913, 3101, 4197, 4278, 5083, 3630, 2974, 1809, 1468, 3318, 3793, 1534, 3967, 6425, 3995, 2860, 4285, 3215, 3341, 3526, 3430, 3668, 4602, 4262, 3713, 2459, 1468, 2497, 1852, 2325, 2516, 3105, 1875, 1769, 1769, 3099, 3530, 2529, 2946, 3983, 2779, 1918, 3170, 3318, 1852, 2323, 500, 4051, 2340, 4023, 3182, 1876, 1639, 1482, 3363, 4900, 1825, 2056, 2631, 3648, 2323, 1418, 3342, 3793, 2325, 500, 1850, 4279, 4406, 5830, 6178, 5544, 5823, 5187, 6226, 5296, 6239, 497, 4283, 4777, 7159, 3724, 4730, 4891, 6021, 6029, 5749, 5443, 6389, 6603, 5690, 10939, 6468, 497, 3892, 4380, 6663, 3689, 4919, 4642, 4518, 3958, 4768, 4831, 4498, 3453, 9077, 7373, 4283, 3892, 500, 4853, 3877, 4757, 4569, 4394, 7940, 4068, 4295, 4344, 4028, 3337, 8826, 7007, 4777, 4380, 500, 4273, 4688, 3460, 4321, 2981, 2663, 956, 2966, 2954, 2895, 2535, 2935, 13, 1067, 2205, 2728, 2513, 1989, 1980, 1486, 2942, 1726, 2337, 3026, 3159, 2997, 2705, 2030, 2959, 1988, 1988, 1989, 388, 462, 1571, 1443, 1853, 653, 1028, 763, 1564, 162, 1712, 1574, 1535, 1318, 1228, 1049, 1760, 642, 1119, 1336, 835, 593, 1059, 986, 322, 579, 732, 1585, 963, 1600, 2196, 2005, 1576, 1464, 1652, 1817, 1545, 1147, 1228, 1326, 1079, 1284, 1729, 2132, 2508, 902, 2493, 1789, 2563, 609, 2271, 2851, 2540, 2345, 995, 2920, 2918, 2099, 2812, 2255, 1970, 1672, 2711, 2042, 3000, 506, 198, 2345, 1350, 2073, 577, 2809, 2630, 2743, 1402, 2349, 1186, 2806, 2726, 1856, 1545, 995, 1350, 2828, 1924, 2939, 2627, 2952, 2969, 2838, 2713, 2395, 2870, 1149, 680, 489, 646, 1528, 2357, 2856, 3845, 261, 1463, 897, 3858, 2536, 4246, 3382, 2887, 1455, 955, 489, 730, 1118, 1981, 2472, 3468, 737, 978, 1184, 4216, 2900, 3002, 2505, 1731, 1404, 1075, 1415, 1559, 1362, 2000, 643, 665, 666, 693, 188, 1495, 1077, 1561, 2193, 1447, 2063, 494, 1267, 1469, 538, 156, 207, 2868, 2069, 1202, 1263, 1284, 636, 2267, 1602, 2034, 1896, 494, 2039, 2081, 1940, 1027, 627, 695, 1156, 2148, 1499, 1369, 1199, 707, 2563, 2697, 2676, 2386, 1385, 1330, 2458, 2370, 2550, 2779, 2204, 2016, 2014, 2104, 3590, 1021, 3381, 2751, 1391, 686, 10343, 9893, 11045, 4701, 4055, 143, 949, 3201, 2370, 3942, 4156, 1079, 2255, 1868, 1320, 637, 1539, 843, 1349, 2233, 308, 2194, 2578, 1557, 1342, 1346, 854, 1190, 3201, 2698, 2348, 1801, 1002, 2471, 2517, 1781, 2490, 2118, 2794, 3134, 1723, 2438, 2826, 2908, 2831, 2349, 2150, 3196, 2362, 2163, 2927, 1171, 3220, 4295, 6206, 456, 282, 9195, 6425, 3470, 4768, 3195, 6549, 1358, 828, 2790, 2605, 3635, 2802, 2618, 3375, 1475, 3422, 4344, 5751, 456, 617, 8772, 5985, 3776, 4831, 3628, 6251, 1722, 1284, 2342, 2046, 3029, 2353, 2099, 2893, 1352, 3428, 4028, 6330, 282, 617, 9198, 6467, 3616, 4498, 3019, 6430, 1111, 769, 1751, 555, 1230, 536, 1751, 884, 455, 927, 492, 723, 1363, 1522, 2019, 1558, 1670, 764, 1368, 1028, 1095, 559, 1636, 2311, 1347, 492, 527, 1205, 1685, 684, 1742, 1671, 281, 1266, 499, 338, 1167, 1159, 1765, 1041, 1691, 2147, 677, 864, 1159, 1951, 2086, 1167, 709, 982, 751, 1259, 1675, 706, 1423, 1516, 1083, 1706, 1211, 1601, 304, 1312, 1249, 497, 1819, 2234, 1954, 1776, 1942, 2154, 1717, 2133, 1141, 1249, 808, 1746, 2146, 1764, 1408, 1840, 1246, 1592, 973, 1913, 1842, 1358, 1823, 1376, 333, 1786, 497, 808, 1506, 564, 1097, 1933, 1786, 2641, 1613, 2145, 1741, 1518, 1474, 1514, 1773, 1746, 1506, 1819, 1160, 618, 1404, 1595, 720, 731, 1678, 2735, 1147, 1313, 899, 1224, 951, 543, 624, 1122, 1351, 918, 2593, 1425, 1440, 1027, 2059, 448, 314, 1146, 1146, 2145, 3060, 1224, 2692, 701, 1068, 1581, 2006, 2588, 699, 2663, 2583, 2412, 2950, 2831, 1870, 2159, 1362, 2271, 2692, 2798, 1845, 2032, 2508, 1749, 1826, 2125, 1877, 1038, 635, 639, 856, 1772, 1908, 749, 2089, 1882, 1860, 1331, 939, 1007, 917, 1125, 1726, 901, 485, 936, 924, 1009, 152, 1080, 2523, 1342, 1318, 2491, 1182, 1194, 1087, 128, 3392, 2080, 1550, 749, 2659, 1530, 2169, 1876, 1740, 1436, 1089, 966, 847, 1248, 2036, 1790, 1053, 637, 1088, 1072, 152, 1068, 994, 870, 1236, 1550, 331, 191, 992, 1913, 1265, 1518, 1556, 982, 1413, 1080, 1321, 994, 1778, 1616, 499, 1635, 1782, 1842, 2016, 1331, 1745, 1486, 1989, 1951, 1845, 2523, 2100, 1385, 499, 2276, 2088, 1351, 2358, 1283, 1691, 1767, 1645, 2012, 2237, 2125, 1827, 1853, 1882, 1925, 582, 1154, 2221, 1113, 1653, 1885, 1708, 1575, 2230, 1787, 1422, 1602, 804, 2296, 1815, 1909, 1911, 1649, 1713, 1940, 1846, 1738, 1933, 1404, 2009, 1819, 2023, 2006, 2507, 582, 2296, 1528, 594, 2187, 2229, 1819, 1955, 1560, 2001, 2897, 2265, 1215, 1384, 1637, 1154, 1528, 1668, 2123, 1794, 1979, 730, 878, 428, 1092, 1971, 1596, 1180, 2319, 1797, 941, 1668, 1445, 825, 1226, 1384, 1636, 303, 939, 1581, 1249, 633, 1071, 1046, 981, 755, 1951, 1331, 557, 1436, 1550, 1571, 2443, 2828, 1837, 2296, 1984, 1640, 2036, 1957, 2784, 2059, 699, 2522, 2659, 1540, 825, 1537, 1485, 985, 248, 1763, 1503, 1442, 1288, 462, 156, 2192, 75, 1305, 1801, 522, 939, 1089, 2, 1537, 840, 2204, 1589, 1524, 51, 316, 1517, 1528, 1568, 999, 1524, 1538, 368, 772, 1061, 1423, 1384, 220, 830, 1946, 1814, 1226, 1455, 1409, 1374, 1159, 1478, 2011, 917, 1512, 847, 191, 1636, 840, 1789, 1452, 1670, 1829, 773, 807, 1928, 742, 1538, 837, 816, 841, 2680, 895, 1125, 1420, 2204, 1452, 1703, 685, 2186, 732, 2185, 1274, 699, 677, 2204, 1230, 683, 1709, 2583, 957, 1653, 2187, 1979, 990, 2550, 1351, 1121, 938, 1790, 2147, 1717, 1924, 1486, 1051, 1082, 1885, 2229, 730, 939, 1872, 1763, 1598, 1814, 1829, 1542, 328, 423, 1242, 884, 1694, 2452, 1142, 1555, 1524, 773, 685, 1529, 1504, 296, 1500, 1545, 179, 105, 1524, 1915, 1246, 1712, 2082, 1878, 1632, 1575, 1955, 428, 1249, 2548, 1725, 1946, 328, 902, 663, 1551, 1811, 1270, 2106, 1370, 1230, 2230, 1092, 633, 1442, 1197, 1409, 423, 663, 1574, 925, 1278, 1598, 1624, 1369, 1784, 1726, 721, 1790, 1518, 319, 1445, 1288, 316, 742, 2185, 1342, 1500, 266, 1375, 1311, 1088, 1309, 1056, 1562, 679, 1531, 1526, 1787, 1560, 1596, 1888, 1274, 1872, 1545, 1811, 1786, 1004, 1689, 1622, 1651, 780, 565, 2831, 1517, 837, 699, 179, 1503, 116, 1531, 1689, 1669, 75, 1516, 1909, 1323, 2214, 1709, 1797, 1528, 816, 677, 105, 1511, 191, 1526, 1622, 75, 1839, 1528, 1899, 1279, 1695, 2151, 1634, 755, 75, 1568, 1478, 315, 1694, 1422, 1532, 1369, 1309, 459, 228, 1571, 1373, 452, 924, 911, 1072, 2897, 1957, 2680, 1230, 1915, 2941, 1914, 1651, 1909, 1899, 958, 1700, 1362, 2531, 2265, 2319, 2784, 1928, 683, 2452, 1246, 2482, 780, 1323, 1279, 958, 1382, 1078, 2271, 1574, 1602, 1215, 1797, 1407, 1709, 2082, 2106, 565, 2214, 2151, 1700, 1078, 2663, 1440, 2232, 805, 1333, 2009, 1465, 1257, 376, 266, 250, 1831, 1268, 367, 329, 1517, 1606, 951, 1254, 1574, 1491, 1256, 1533, 1079, 888, 1819, 989, 1500, 2443, 1004, 1385, 619, 855, 1322, 1492, 543, 701, 1254, 1285, 1624, 1037, 407, 1752, 2023, 1180, 339, 774, 1321, 1573, 1242, 225, 1424, 1247, 1110, 1574, 44, 543, 1939, 451, 1708, 2006, 1142, 360, 800, 1347, 1596, 1268, 181, 1468, 1228, 1149, 1606, 44, 588, 137, 1673, 498, 653, 1607, 1477, 1378, 1038, 769, 882, 1093, 1492, 680, 1256, 543, 588, 1593, 2114, 1763, 2069, 1882, 1123, 2030, 972, 1987, 2003, 1894, 1992, 1247, 2673, 1130, 2475, 1583, 1068, 2961, 978, 713, 661, 736, 697, 703, 685, 1455, 1445, 906, 1109, 720, 1160, 1122, 805, 1079, 1161, 1785, 1541, 409, 631, 1615, 1422, 1055, 632, 1017, 1467, 1143, 766, 1333, 407, 451, 137, 1585, 1688, 2021, 1978, 502, 996, 1035, 1125, 1067, 491, 1974, 1071, 988, 751, 1053, 1189, 990, 1604, 1874, 192, 1907, 964, 1780, 1415, 1889, 1846, 1828, 1163, 1453, 1179, 1915, 646, 1089, 1713, 199, 1721, 2066, 1617, 787, 347, 1550, 1417, 1267, 689, 2064, 823, 2005, 936, 2169, 1571, 563, 954, 1482, 1775, 692, 824, 671, 2942, 1294, 1819, 2126, 1961, 2481, 2301, 2954, 2337, 2103, 1421, 2444, 1528, 2264, 2439, 2464, 1256, 799, 1981, 2167, 2141, 2420, 2191, 1250, 780, 2077, 1977, 2070, 1864, 1440, 1734, 1072, 1675, 2059, 8, 1219, 1760, 1123, 78, 379, 2920, 577, 1924, 1799, 2032, 2800, 2125, 2829, 845, 2821, 2475, 754, 2721, 1131, 1600, 1387, 692, 2070, 206, 66, 2047, 1691, 1128, 1499, 1277, 2062, 1922, 3026, 1488, 1308, 1762, 1235, 824, 1864, 206, 271, 1894, 1018, 1317, 1215, 1856, 1750, 3159, 1297, 1085, 1561, 1447, 671, 66, 271, 2041, 1631, 1157, 1552, 1290, 2128, 1970, 2997, 1554, 1727, 1826, 787, 1278, 2211, 1609, 779, 805, 1484, 1001, 801, 1757, 2079, 1573, 2115, 2739, 1693, 1765, 1439, 2517, 2219, 2022, 347, 1840, 2041, 1524, 805, 2020, 1580, 1402, 925, 345, 151, 805, 2404, 928, 1564, 1974, 1667, 201, 1478, 1256, 1100, 1789, 1237, 1597, 2049, 2235, 1588, 1932, 996, 1151, 1382, 2168, 2462, 2630, 2206, 1762, 799, 2129, 2125, 2049, 2215, 1631, 2388, 2540, 1744, 2551, 2280, 2161, 1068, 2789, 1958, 1461, 1484, 2536, 2129, 925, 1743, 581, 1962, 1195, 1267, 1570, 1274, 1712, 2207, 2135, 2036, 689, 1961, 2130, 1450, 1001, 345, 1734, 1414, 581, 490, 875, 2190, 988, 1574, 1891, 721, 1502, 910, 913, 455, 527, 1063, 1600, 1168, 1614, 1171, 1431, 672, 777, 1728, 1542, 275, 1152, 1501, 347, 1133, 445, 916, 1381, 308, 1152, 2174, 1602, 859, 1611, 1507, 1580, 72, 1367, 1529, 131, 1893, 1014, 710, 1152, 308, 1367, 1561, 2170, 1869, 821, 1303, 1218, 242, 1271, 1025, 959, 1097, 1155, 1296, 720, 251, 1152, 1367, 987, 1380, 1077, 1345, 1077, 1602, 1370, 3016, 1904, 251, 1470, 977, 1534, 1877, 2441, 990, 1490, 1364, 1092, 2140, 1872, 3126, 1838, 1042, 379, 121, 451, 1886, 2195, 1175, 1489, 2333, 1092, 1612, 2090, 811, 706, 698, 681, 1108, 1102, 1690, 1632, 1349, 1267, 2186, 842, 4034, 2729, 844, 2243, 2176, 465, 1482, 1707, 255, 1332, 2031, 1338, 1107, 853, 639, 1155, 662, 1889, 2140, 2090, 1282, 1038, 1486, 1732, 1082, 1800, 1528, 1226, 2193, 2344, 1869, 1794, 1841, 1745, 749, 1259, 1311, 2068, 1298, 1249, 1483, 1232, 588, 1657, 1780, 1707, 1903, 855, 1510, 657, 657, 952, 151, 1494, 494, 194, 1501, 509, 542, 1965, 702, 1170, 986, 1507, 967, 891, 891, 910, 1371, 1494, 999, 1496, 1490, 1120, 1371, 1360, 1081, 1867, 1124, 1154, 235, 235, 617, 377, 494, 999, 1659, 530, 579, 1671, 444, 447, 1290, 294, 1248, 699, 1463, 879, 495, 399, 1411, 1290, 919, 1038, 1354, 547, 1676, 1806, 607, 1758, 676, 1400, 626, 626, 854, 167, 1058, 194, 1507, 530, 1022, 1025, 720, 871, 1277, 1352, 1408, 1598, 1351, 453, 194, 1483, 1118, 465, 1421, 917, 579, 1017, 1462, 1508, 687, 1358, 1394, 151, 1437, 1562, 740, 2017, 701, 2298, 2095, 544, 17, 1328, 1057, 608, 1249, 1761, 1979, 999, 1601, 1084, 1650, 1126, 1563, 691, 714, 770, 1142, 1973, 1880, 1547, 999, 1599, 1256, 1048, 1328, 1276, 1169, 1054, 1644, 1067, 1340, 1725, 759, 1695, 1797, 402, 1190, 1641, 780, 1053, 782, 1326, 812, 743, 490, 1610, 1242, 1030, 745, 593, 597, 599, 469, 687, 1693, 744, 556, 1359, 1108, 15, 1511, 1538, 780, 1130, 669, 499, 433, 1321, 1358, 2498, 3472, 903, 1419, 1491, 1107, 1403, 468, 388, 657, 1479, 1793, 1437, 1428, 814, 1374, 896, 1129, 1181, 780, 557, 1057, 1266, 1335, 824, 1025, 1557, 32, 55, 554, 1623, 1465, 929, 999, 997, 1010, 840, 1394, 1328, 1859, 744, 1283, 1148, 1171, 733, 1333, 1508, 467, 1376, 386, 878, 1208, 866, 151, 1590, 556, 1403, 1283, 1433, 1637, 890, 571, 1324, 603, 139, 1452, 966, 563, 2404, 1164, 1276, 1247, 1354, 1335, 1148, 1497, 1615, 1360, 1303, 1381, 1829, 1475, 1462, 584, 1419, 1849, 2019, 47, 1936, 2597, 1156, 1140, 1731, 2104, 1782, 977, 457, 1912, 328, 2272, 1950, 1795, 2877, 1791, 2943, 2483, 3015, 419, 2613, 1715, 2264, 1252, 2493, 877, 2963, 3182, 1959, 1747, 740, 1190, 1359, 1479, 890, 1496, 2086, 1374, 2533, 1778, 1355, 862, 751, 2168, 962, 1577, 1079, 1801, 1811, 1645, 1277, 1110, 1835, 1826, 1606, 1651, 1141, 1822, 499, 1181, 1902, 1857, 2036, 1456, 1408, 1572, 1828, 948, 1568, 1678, 1852, 1782, 641, 1698, 499, 702, 1947, 1660, 2052, 457, 701, 1704, 15, 733, 571, 1374, 1718, 1095, 765, 1496, 1525, 1142, 684, 494, 444, 1323, 1213, 1537, 812, 539, 1038, 32, 830, 1303, 1273, 80, 580, 1597, 1489, 950, 1025, 1024, 1037, 1047, 1142, 1548, 743, 548, 1048, 55, 860, 1381, 1218, 80, 499, 1678, 1410, 938, 994, 993, 1005, 1033, 806, 1631, 490, 760, 1170, 554, 1206, 1146, 897, 580, 499, 1471, 1886, 912, 1078, 1010, 1012, 1018, 836, 1480, 1554, 1610, 1957, 1076, 1772, 1902, 1471, 417, 582, 1758, 1218, 1405, 544, 1130, 814, 603, 862, 1142, 560, 1569, 1150, 1013, 1306, 1518, 2167, 2002, 1830, 946, 1035, 1290, 1543, 1504, 2079, 957, 1003, 17, 669, 1374, 1376, 139, 1579, 751, 2035, 684, 1446, 2106, 560, 1504, 1346, 1039, 592, 2297, 1251, 428, 1862, 1239, 1412, 1408, 1857, 1753, 1886, 417, 997, 1903, 1867, 1460, 1517, 1404, 947, 1030, 1500, 1711, 1465, 834, 1489, 1410, 912, 582, 997, 1602, 998, 1373, 3768, 2605, 2030, 2680, 2638, 1252, 1064, 2791, 3269, 2896, 1768, 2342, 822, 2885, 1941, 975, 2803, 1424, 1814, 1759, 2493, 2572, 1930, 2416, 2534, 1203, 1177, 1813, 843, 1768, 2379, 1695, 1902, 1588, 1629, 1248, 965, 745, 1486, 929, 482, 1191, 1276, 950, 938, 1078, 1012, 1385, 251, 244, 257, 100, 1158, 737, 1635, 593, 1537, 999, 725, 225, 1119, 1025, 994, 1010, 1602, 958, 251, 7, 11, 1162, 744, 1628, 597, 1537, 997, 718, 218, 1121, 1024, 993, 1012, 958, 244, 7, 15, 1147, 736, 599, 1010, 732, 227, 1107, 1274, 1037, 1005, 1018, 948, 257, 11, 15, 340, 168, 711, 969, 1052, 726, 446, 32, 699, 260, 926, 684, 597, 780, 1478, 1210, 472, 898, 717, 1065, 188, 371, 969, 469, 891, 1023, 727, 838, 1377, 1158, 1162, 1147, 340, 1210, 402, 1181, 961, 1487, 1213, 1142, 806, 1480, 1218, 862, 1862, 947, 965, 737, 744, 736, 1357, 472, 558, 1008, 971, 637, 1196, 529, 157, 724, 381, 855, 594, 713, 913, 1218, 168, 898, 1143, 558, 681, 1073, 1142, 858, 1380, 836, 710, 1143, 1308, 937, 583, 1416, 828, 1294, 1365, 1606, 1147, 711, 717, 1008, 1073, 1365, 675, 540, 1001, 912, 1173, 628, 1281, 1411, 1246, 1012, 958, 958, 948, 969, 1599, 1190, 985, 499, 557, 1345, 1247, 999, 539, 548, 760, 1957, 1500, 1486, 1537, 1537, 1705, 1256, 1641, 499, 1057, 1997, 1827, 1354, 499, 1038, 1048, 1170, 1852, 1711, 985, 1901, 1601, 1048, 999, 499, 1557, 1497, 1615, 1212, 1835, 1537, 1548, 1631, 1359, 1733, 1084, 1644, 1997, 1497, 1957, 1697, 982, 1826, 1678, 1730, 1798, 330, 1945, 1746, 2188, 1492, 975, 1053, 1345, 1827, 824, 1497, 1314, 830, 860, 1206, 1456, 1469, 1483, 1365, 482, 725, 718, 732, 558, 1255, 1255, 1444, 675, 1328, 1314, 1118, 1207, 1267, 918, 748, 1233, 747, 647, 1191, 1274, 1068, 188, 529, 836, 540, 1320, 1207, 479, 1180, 633, 728, 1117, 912, 1027, 1276, 1119, 1121, 1107, 446, 371, 157, 710, 1001, 1020, 694, 479, 1156, 669, 244, 946, 652, 582, 771, 1480, 32, 1159, 720, 857, 960, 1464, 452, 1277, 879, 1385, 1351, 1455, 686, 693, 556, 748, 697, 557, 1385, 1156, 499, 999, 1374, 969, 724, 1021, 1025, 622, 1132, 481, 782, 669, 499, 499, 473, 418, 594, 1281, 952, 1376, 1380, 699, 469, 381, 937, 1173, 982, 691, 1188, 633, 244, 999, 499, 1186, 655, 338, 532, 1364, 1629, 1275, 260, 891, 855, 583, 628, 918, 728, 946, 887, 1410, 1186, 887, 896, 658, 1190, 1398, 1263, 926, 588, 698, 1292, 457, 456, 164, 1184, 607, 1232, 1290, 1777, 767, 2027, 1180, 340, 625, 1249, 1042, 748, 769, 757, 1023, 1042, 1184, 1051, 601, 644, 109, 1136, 1326, 949, 1192, 1005, 1614, 1305, 1233, 167, 157, 442, 607, 601, 690, 700, 880, 776, 725, 1229, 646, 1411, 1456, 747, 788, 798, 1078, 1232, 644, 690, 645, 1541, 1045, 1198, 349, 1003, 1003, 1246, 1273, 647, 868, 1013, 1128, 857, 1190, 1290, 109, 700, 645, 1238, 1379, 1422, 970, 1136, 1508, 1693, 1859, 1590, 999, 1190, 1704, 889, 1691, 1504, 1499, 1528, 1260, 1703, 1183, 1354, 1837, 1836, 1047, 1808, 1844, 1777, 1485, 1857, 1499, 1615, 1621, 1437, 1706, 1114, 1112, 872, 848, 753, 767, 1136, 880, 1541, 1238, 1261, 1464, 1106, 1142, 48, 1622, 947, 82, 1094, 1611, 73, 1086, 1561, 1474, 1415, 2488, 1390, 721, 1293, 1167, 1672, 2062, 44, 1791, 1669, 1359, 1256, 1814, 1211, 1455, 1261, 1293, 1368, 395, 1685, 1340, 1794, 55, 864, 1333, 1029, 1564, 69, 1324, 1006, 1828, 1553, 1491, 1553, 679, 82, 1368, 1152, 1743, 2105, 111, 1735, 1590, 1909, 1740, 1471, 1005, 1135, 1464, 1672, 395, 1743, 1633, 1548, 1720, 1729, 2196, 2203, 2170, 1817, 2115, 1797, 1492, 2047, 2079, 574, 891, 2197, 2828, 1685, 1548, 2149, 2104, 1852, 2050, 1820, 561, 1703, 1991, 1563, 711, 2161, 991, 1840, 2170, 1983, 2114, 36, 146, 1712, 789, 1909, 1072, 2366, 1459, 1074, 625, 1229, 634, 1706, 1142, 2382, 1794, 2006, 1729, 2114, 1685, 2396, 166, 1683, 752, 2043, 1939, 1035, 2378, 1492, 1038, 588, 1192, 602, 1703, 1114, 1791, 1653, 1735, 2149, 36, 166, 863, 1937, 1154, 1154, 1344, 1947, 698, 1305, 2449, 759, 1844, 1112, 1669, 1805, 1590, 2104, 146, 1075, 1850, 1442, 352, 1611, 2022, 1707, 2193, 2405, 2553, 1196, 986, 2170, 685, 1075, 776, 2151, 1426, 2193, 2267, 1631, 2336, 2284, 2256, 123, 862, 1480, 2070, 1850, 776, 2202, 1447, 1602, 2127, 2056, 1560, 1525, 1491, 654, 1434, 2198, 2082, 1282, 1674, 971, 1549, 1401, 1274, 668, 975, 921, 1711, 1373, 1068, 611, 1830, 1442, 2151, 1302, 1179, 1339, 1045, 1799, 1314, 2264, 1400, 1909, 2170, 2050, 1960, 352, 1426, 2202, 1302, 1736, 2379, 1834, 1363, 1921, 2248, 1548, 1232, 2480, 1820, 660, 691, 1265, 2265, 499, 1465, 1742, 1925, 2254, 1803, 2125, 1195, 768, 1303, 1319, 2066, 1728, 499, 966, 1966, 2128, 2186, 2005, 1628, 1061, 1265, 1154, 1129, 1817, 1683, 2223, 1747, 1465, 966, 1939, 2106, 2204, 2232, 666, 1440, 2260, 1414, 1239, 2021, 2012, 1892, 691, 1154, 2106, 1310, 1503, 1780, 275, 1931, 1366, 576, 1497, 859, 1059, 344, 384, 1594, 441, 1038, 1060, 871, 691, 1625, 1392, 563, 1086, 1006, 1099, 1087, 453, 837, 992, 1099, 696, 1113, 1374, 1484, 443, 1054, 1514, 1338, 853, 1024, 495, 836, 1165, 799, 1164, 613, 1028, 1764, 43, 542, 1041, 490, 1286, 1550, 1545, 1724, 1537, 1608, 1033, 766, 537, 578, 1618, 691, 962, 742, 247, 1622, 1553, 1637, 1072, 1620, 426, 1388, 1426, 1802, 913, 927, 1347, 764, 1170, 1208, 1534, 1190, 1144, 889, 1563, 558, 1762, 1639, 1980, 885, 613, 638, 1000, 1440, 905, 1683, 1023, 842, 1650, 1528, 1943, 987, 1859, 964, 905, 1408, 490, 517, 938, 1415, 812, 1629, 1923, 1265, 1258, 433, 1797, 968, 1683, 1971, 1063, 1357, 1629, 764, 723, 1205, 954, 875, 1653, 1484, 1170, 1277, 1494, 1087, 1325, 1063, 1555, 1605, 1600, 625, 981, 1442, 680, 21, 297, 1268, 916, 1208, 1618, 1061, 1703, 1006, 1513, 981, 996, 1495, 995, 828, 569, 900, 608, 1716, 1321, 1273, 1004, 1392, 1230, 742, 1125, 996, 976, 1521, 957, 499, 1336, 1379, 903, 762, 297, 501, 1391, 563, 1075, 247, 976, 1390, 1324, 2197, 1256, 1385, 1439, 1332, 1189, 913, 814, 457, 977, 439, 1324, 947, 680, 1495, 659, 1142, 1062, 1557, 1194, 1214, 675, 769, 679, 1352, 1087, 648, 1323, 1046, 1662, 970, 1079, 1121, 1244, 984, 721, 558, 766, 1190, 1269, 1473, 1067, 1321, 1043, 1606, 1614, 625, 21, 995, 1445, 659, 318, 1273, 918, 1129, 1043, 1130, 1101, 1008, 586, 1031, 413, 604, 1043, 1283, 703, 558, 427, 1167, 1152, 1493, 1210, 889, 1418, 1379, 1352, 1419, 1621, 1670, 1431, 1653, 297, 828, 1290, 977, 318, 685, 1424, 1234, 1708, 955, 2005, 1655, 603, 1615, 1273, 437, 1268, 569, 957, 1644, 1557, 1273, 1637, 1234, 585, 415, 1068, 1462, 1539, 1067, 1724, 1072, 633, 900, 499, 1256, 1402, 1708, 585, 999, 1583, 500, 1218, 1357, 688, 1541, 916, 608, 1336, 1142, 918, 955, 415, 999, 999, 4000, 4544, 3546, 3123, 4777, 2974, 4694, 2404, 2527, 3995, 4279, 4730, 1474, 999, 4268, 4543, 3544, 2546, 2762, 4396, 2348, 5492, 3180, 2840, 4262, 4406, 4891, 3974, 4487, 4000, 3092, 3495, 3181, 4611, 4216, 3819, 1901, 2831, 1026, 2901, 4429, 5588, 5830, 6021, 4779, 2965, 2658, 354, 250, 2719, 1776, 1774, 1456, 1200, 738, 725, 1546, 2451, 402, 4420, 706, 1572, 2387, 1619, 354, 103, 1625, 1626, 1806, 1551, 664, 569, 2195, 1457, 2193, 144, 4642, 698, 1812, 2168, 1478, 250, 103, 1514, 2965, 1662, 1662, 1704, 1448, 668, 598, 1474, 2652, 190, 4575, 681, 1738, 2229, 720, 983, 1734, 1738, 1653, 2005, 1777, 1384, 1585, 1099, 891, 914, 415, 1904, 1838, 255, 2395, 1499, 2084, 1290, 1657, 1153, 3249, 1653, 1420, 920, 1493, 1847, 2511, 739, 1239, 1305, 251, 1042, 1889, 1849, 1990, 3205, 2005, 1420, 1981, 499, 84, 2196, 1938, 1471, 1705, 1470, 379, 1368, 451, 3134, 1777, 920, 499, 572, 1779, 1714, 2268, 1076, 1415, 2211, 977, 121, 2031, 932, 1656, 1405, 1359, 485, 956, 816, 1333, 1356, 1470, 1334, 150, 1330, 1493, 1648, 1606, 1409, 1384, 485, 499, 1636, 885, 1355, 1369, 359, 632, 885, 1323, 1008, 1165, 1380, 983, 956, 499, 1155, 385, 855, 1165, 141, 1092, 385, 1046, 586, 975, 498, 1009, 1186, 1536, 871, 962, 1058, 1408, 1230, 1075, 1662, 1828, 1724, 1525, 810, 810, 1553, 753, 1333, 885, 385, 799, 469, 1410, 1463, 526, 1308, 970, 13, 1561, 413, 1498, 1451, 444, 444, 1491, 690, 1426, 1355, 855, 432, 469, 1263, 995, 1365, 1379, 1079, 469, 1474, 604, 1508, 1488, 1289, 53, 1356, 1369, 1625, 1058, 1165, 1151, 1139, 1342, 987, 1419, 1632, 194, 843, 847, 891, 694, 1091, 1300, 1476, 1159, 443, 1738, 1273, 1305, 639, 732, 399, 1941, 1529, 638, 504, 1613, 1484, 1764, 1723, 1250, 801, 607, 1655, 493, 448, 1745, 1023, 594, 828, 878, 878, 376, 1023, 42, 601, 1117, 652, 720, 473, 655, 797, 1010, 1101, 1290, 684, 727, 713, 1030, 821, 912, 582, 857, 418, 338, 797, 221, 1039, 1292, 1018, 597, 838, 1218, 913, 1032, 1027, 771, 960, 594, 532, 1010, 221, 831, 1137, 801, 780, 2710, 1816, 612, 6389, 2466, 1667, 1842, 1875, 2140, 499, 6718, 1982, 3934, 2573, 2367, 1101, 1887, 1653, 1111, 2582, 6481, 2554, 2409, 1686, 1525, 1594, 1914, 499, 6127, 2496, 2473, 4120, 2830, 2304, 1514, 1387, 1391, 1110, 5263, 2496, 5727, 2173, 2332, 2629, 2493, 2027, 2010, 1823, 547, 1966, 2612, 1813, 3008, 2754, 2102, 2568, 2396, 3457, 4938, 2786, 773, 3241, 1292, 2240, 555, 3932, 3806, 2947, 3172, 3100, 3387, 3427, 1380, 3484, 2968, 2107, 1982, 2473, 2240, 4081, 1695, 2054, 2868, 1589, 3414, 3309, 2654, 3013, 2696, 2904, 3846, 3275, 867, 2715, 1796, 555, 1695, 4566, 3475, 3341, 3466, 917, 1367, 614, 623, 1499, 576, 1069, 681, 1115, 452, 952, 1024, 732, 1101, 1397, 816, 1282, 1355, 547, 509, 455, 1355, 1015, 1277, 1376, 1629, 1758, 1137, 1674, 1753, 1292, 986, 1659, 1040, 540, 1377, 862, 1544, 1242, 1485, 1819, 1480, 1380, 1275, 1689, 1218, 801, 1460, 998, 1018, 499, 1040, 1478, 1621, 1357, 1045, 987, 1385, 1281, 1364, 1405, 831, 1517, 1373, 1039, 1496, 540, 499, 1180, 1118, 1621, 1713, 836, 1707, 1707, 428, 1404, 1552, 1483, 1490, 1689, 1676, 1826, 473, 2195, 1458, 849, 913, 1927, 1419, 1170, 907, 1811, 1456, 476, 1471, 1847, 1352, 1590, 2055, 1875, 1574, 1647, 2218, 1337, 1863, 1394, 473, 1579, 1890, 546, 1079, 1584, 1849, 461, 1645, 1408, 1979, 1585, 1650, 946, 1938, 1704, 1460, 1118, 1878, 1579, 1822, 1189, 1949, 358, 1396, 1277, 1572, 1554, 1263, 1239, 1159, 1458, 1890, 1993, 1982, 2554, 1203, 1186, 47, 1733, 2067, 1828, 1011, 432, 1920, 3138, 340, 2231, 1909, 1749, 1713, 1201, 2027, 1822, 1541, 1199, 1504, 1433, 819, 2650, 1224, 1224, 1457, 714, 588, 1081, 607, 849, 546, 1189, 1982, 889, 1303, 1936, 1099, 750, 1110, 948, 1224, 1469, 1585, 1976, 1961, 1487, 1326, 985, 985, 1266, 1212, 1651, 1273, 1218, 897, 1076, 1412, 834, 1819, 913, 1079, 1949, 1203, 889, 1957, 1982, 1156, 263, 1500, 1181, 702, 892, 1478, 1122, 1180, 1531, 1584, 358, 1504, 1303, 819, 1304, 1606, 1852, 1772, 957, 1408, 1848, 1707, 2518, 961, 1422, 782, 1025, 558, 1118, 1180, 1047, 1033, 1146, 912, 100, 225, 218, 227, 2107, 2458, 2255, 1967, 2719, 906, 2123, 3574, 2559, 2840, 2439, 1663, 1787, 1266, 2805, 1650, 1733, 982, 1731, 1737, 2052, 1982, 2135, 1188, 2696, 1407, 1860, 970, 1947, 1221, 2310, 2095, 1374, 907, 461, 1396, 2111, 750, 1565, 1500, 1304, 1749, 1689, 1822, 1698, 1383, 2169, 940, 1841, 1147, 1436, 1267, 1443, 1847, 1394, 1263, 1433, 1469, 716, 957, 940, 1907, 2264, 1603, 260, 2177, 1497, 1547, 649, 715, 1126, 1169, 1108, 1445, 1171, 1095, 507, 1392, 432, 1878, 788, 1765, 1320, 1535, 1267, 588, 1462, 1563, 1054, 780, 467, 1324, 1360, 715, 765, 882, 1041, 1502, 1446, 717, 1102, 1576, 1093, 882, 691, 759, 1511, 1733, 1333, 1829, 507, 1496, 1730, 313, 1401, 970, 1593, 1598, 3930, 914, 739, 1471, 1076, 1556, 726, 2788, 1738, 499, 1458, 990, 1175, 1155, 1919, 1565, 1118, 415, 1239, 1705, 1415, 1420, 771, 1514, 1273, 499, 2124, 1490, 1489, 662, 1787, 1671, 725, 1458, 4047, 918, 1305, 2211, 1320, 559, 1021, 1502, 1458, 1501, 918, 1364, 2333, 1359, 1510, 967, 1154, 1400, 1707, 933, 1324, 1325, 1224, 1575, 1103, 918, 384, 513, 657, 891, 235, 626, 1707, 933, 1324, 1325, 1224, 1103, 1575, 235, 918, 384, 513, 657, 891, 1674, 626, 632, 1408, 384, 1457, 1847, 1489, 1101, 559, 384, 1877, 801, 1428, 952, 910, 617, 854, 1063, 1973, 2840, 1860, 1802, 1881, 1907, 1573, 1242, 1450, 999, 1177, 1609, 1605, 603, 630, 1965, 1880, 1746, 2439, 970, 1672, 1805, 2074, 2140, 999, 1730, 1052, 771, 1478, 1500, 1627, 2200, 3523, 1402, 1663, 1947, 895, 2719, 2751, 1177, 1052, 1225, 947, 462, 1227, 1561, 3879, 2019, 1993, 2188, 2226, 2332, 1787, 1221, 938, 1835, 1804, 1609, 771, 947, 1174, 1949, 2185, 2587, 3061, 1449, 1266, 2310, 1062, 947, 2934, 1605, 1478, 462, 1174, 2731, 1540, 1906, 1109, 1856, 2805, 1542, 1932, 1973, 1928, 841, 888, 603, 1500, 1227, 1949, 1540, 382, 729, 1529, 1226, 1549, 1591, 1606, 1216, 1179, 630, 1627, 1561, 2185, 1906, 382, 2098, 1249, 1321, 1129, 1164, 1267, 1323, 1013, 1251, 1633, 2098, 1107, 1374, 2031, 2456, 1294, 1492, 764, 1516, 1003, 1445, 559, 511, 1529, 1152, 1824, 1017, 1761, 1547, 469, 1516, 840, 866, 1747, 1271, 649, 457, 1093, 1081, 588, 1456, 1306, 1003, 806, 902, 1107, 1979, 1125, 1803, 1759, 1703, 1765, 918, 839, 874, 1661, 1010, 1946, 1867, 1063, 1965, 2200, 2587, 1109, 729, 1374, 1241, 611, 277, 1168, 1531, 949, 935, 1363, 713, 663, 1484, 1274, 1332, 461, 799, 1115, 901, 569, 1363, 629, 1002, 859, 857, 1389, 914, 277, 1218, 1189, 396, 954, 1155, 1405, 461, 396, 701, 623, 1255, 1290, 575, 819, 173, 1377, 1424, 1091, 1083, 1260, 1091, 940, 1422, 1091, 609, 471, 1077, 667, 1123, 1027, 1617, 1207, 1007, 684, 1077, 254, 474, 1479, 1200, 994, 1290, 609, 832, 1472, 715, 1199, 777, 1363, 1184, 916, 1675, 1524, 366, 684, 609, 1375, 1303, 1440, 1218, 242, 1271, 1025, 959, 1097, 1155, 1296, 1297, 720, 251, 1152, 1367, 987, 1328, 1077, 1380, 1345, 1077, 376, 481, 309, 902, 1583, 959, 1022, 1403, 758, 1268, 1067, 1501, 1529, 959, 1854, 1601, 723, 1691, 424, 1105, 1414, 1021, 474, 945, 1097, 1533, 1090, 538, 678, 1362, 684, 1696, 245, 1301, 929, 1423, 1097, 1913, 474, 1610, 978, 1422, 1649, 1235, 281, 284, 1650, 1548, 286, 276, 624, 1581, 376, 1037, 1573, 1596, 1378, 1931, 1479, 1291, 1560, 1199, 869, 1348, 499, 816, 675, 1277, 1512, 1730, 785, 1842, 2145, 1516, 94, 1628, 1644, 1132, 1617, 1375, 389, 1610, 499, 747, 318, 1604, 1032, 1083, 2154, 1358, 1741, 593, 1268, 1178, 997, 1115, 1022, 816, 747, 499, 1105, 1550, 1010, 1706, 1823, 1518, 1450, 1563, 864, 1207, 1317, 1329, 1407, 1524, 523, 675, 318, 499, 1512, 1079, 1494, 2133, 1376, 1474, 1211, 762, 1352, 1473, 1397, 1245, 1184, 961, 1528, 94, 593, 864, 762, 1230, 1603, 1601, 696, 1549, 1403, 906, 2660, 605, 1345, 2296, 1359, 713, 1624, 759, 1290, 833, 832, 2113, 1313, 314, 2950, 855, 790, 1548, 2150, 3183, 2725, 1409, 2498, 2649, 1638, 3386, 1540, 1087, 1603, 852, 450, 852, 2049, 2017, 1184, 2225, 1262, 1832, 1819, 1734, 1526, 1128, 1018, 1157, 1224, 1812, 712, 1218, 339, 1726, 966, 1599, 1552, 1572, 2126, 1072, 1499, 1317, 1588, 1596, 1733, 712, 932, 1188, 1008, 1065, 452, 1894, 1675, 1420, 1320, 664, 1576, 1239, 1610, 1555, 1551, 1218, 932, 1292, 1431, 1672, 510, 1711, 1672, 1992, 1632, 855, 1160, 1612, 128, 1240, 948, 1494, 1639, 1480, 1089, 1007, 90, 939, 443, 1905, 1400, 1318, 90, 1611, 765, 1250, 1628, 216, 1157, 885, 1410, 1625, 1390, 1179, 1024, 878, 533, 1915, 1351, 1228, 804, 1218, 823, 1086, 1579, 1573, 805, 603, 1195, 875, 771, 1602, 122, 763, 1770, 1298, 723, 1643, 320, 1646, 1284, 1783, 646, 1073, 533, 1270, 1760, 1716, 443, 766, 1172, 561, 1103, 1565, 1787, 1673, 577, 1317, 608, 1603, 1582, 1110, 1149, 680, 1161, 937, 776, 1113, 1203, 1495, 1155, 1304, 1009, 1736, 1394, 1224, 1202, 1334, 1281, 880, 1410, 954, 437, 885, 919, 752, 1379, 1051, 1068, 799, 1265, 1290, 1201, 1194, 1260, 513, 780, 1576, 1523, 1480, 1521, 1223, 1527, 1528, 875, 484, 1325, 1061, 1521, 1324, 1321, 1424, 603, 1067, 500, 1267, 1280, 1022, 790, 1722, 1484, 672, 2333, 1563, 764, 281, 1602, 1647, 794, 1719, 1711, 2387, 2168, 2229, 1218, 1689, 1065, 1663, 1943, 1962, 1002, 2134, 2039, 1298, 1611, 1847, 878, 4652, 3824, 3603, 3688, 4027, 2178, 4616, 4425, 2806, 3670, 4406, 3946, 4607, 3541, 1688, 1774, 1611, 1629, 1006, 1303, 945, 930, 1770, 1122, 1522, 1632, 1360, 1365, 553, 1621, 1368, 874, 4057, 448, 2369, 2760, 655, 482, 3824, 4190, 2289, 1680, 2148, 2638, 1544, 1567, 2331, 659, 471, 908, 1283, 1466, 730, 1360, 900, 344, 975, 1033, 1488, 499, 1716, 903, 947, 864, 972, 769, 1382, 499, 1252, 768, 1263, 1378, 384, 498, 766, 1289, 1859, 1321, 762, 1415, 1333, 1435, 1244, 2028, 2290, 3176, 1419, 1482, 1795, 1250, 1387, 1235, 1447, 2952, 1832, 1572, 2159, 1957, 1245, 1977, 2966, 484, 2338, 2660, 484, 1775, 1899, 780, 1488, 1297, 1554, 1599, 1188, 1936, 1623, 2219, 2316, 774, 1553, 1882, 2884, 1584, 1795, 1899, 492, 2271, 2077, 1924, 2112, 1973, 2053, 2525, 3151, 733, 457, 1512, 2080, 2895, 2522, 2304, 1419, 1623, 492, 1977, 1924, 2371, 2279, 2076, 2931, 619, 747, 1978, 2535, 1776, 1625, 1662, 1981, 19, 1916, 2134, 1607, 365, 1986, 1598, 1753, 4093, 1108, 1730, 1774, 1626, 1662, 1990, 4074, 1924, 4257, 349, 2137, 1627, 19, 2005, 1604, 1755, 1102, 1725, 1621, 1035, 1175, 1154, 728, 2439, 215, 1740, 1593, 2216, 963, 1237, 1638, 1610, 379, 1829, 1406, 679, 1571, 1943, 954, 1123, 994, 938, 678, 1085, 1348, 1132, 1407, 1403, 1018, 611, 751, 1942, 1246, 1123, 2022, 1834, 703, 2193, 2068, 2483, 1992, 2894, 2585, 1130, 1985, 2055, 1874, 1703, 1383, 2043, 1947, 1707, 1339, 1363, 2437, 1168, 1992, 2340, 992, 2429, 1617, 2459, 2326, 1741, 711, 2006, 1492, 1344, 2193, 1045, 1921, 1792, 2197, 992, 2027, 1936, 1612, 2093, 2547, 2421, 1814, 1471, 1563, 1459, 1917, 733, 1988, 1841, 59, 1737, 2208, 2174, 1869, 941, 932, 990, 1904, 2531, 1235, 1974, 1627, 2195, 1787, 1938, 2268, 1936, 2684, 1910, 1784, 1607, 1941, 1886, 2195, 2186, 1642, 1732, 521, 476, 946, 2415, 1011, 1224, 892, 977, 1095, 1383, 1568, 994, 1264, 1193, 1835, 2372, 2425, 1878, 1471, 1938, 1674, 432, 2221, 1478, 1521, 457, 2135, 994, 3334, 1604, 2710, 3081, 770, 1742, 1545, 1476, 2296, 1708, 1819, 878, 1581, 1826, 1538, 1703, 884, 1529, 902, 1278, 1004, 1709, 1634, 2346, 2531, 1574, 1440, 1784, 1146, 746, 4509, 261, 737, 648, 1788, 2611, 3111, 1715, 927, 3769, 2451, 3637, 3142, 1027, 715, 841, 1524, 1510, 785, 1268, 1207, 1352, 827, 1475, 1730, 1536, 1649, 696, 701, 1830, 668, 1001, 1238, 1747, 1360, 1544, 492, 1687, 1010, 1543, 1299, 1487, 1600, 1500, 1411, 1667, 86, 1214, 270, 230, 3612, 897, 1184, 1534, 1723, 2344, 2822, 927, 5169, 1937, 3034, 6344, 1723, 3052, 3352, 3311, 2847, 2763, 3261, 4688, 1602, 3858, 7410, 4414, 2402, 1747, 5319, 3769, 3034, 3491, 6698, 4216, 4223, 2272, 1322, 6080, 6309, 3997, 2897, 3515, 5090, 3005, 3279, 6344, 3491, 4087, 744, 1219, 4747, 3741, 3597, 4520, 4440, 4257, 949, 2206, 1942, 10272, 9872, 9441, 8527, 10618, 943, 1038, 4040, 2908, 2989, 1498, 2624, 2279, 2925, 1021, 444, 555, 2438, 3713, 3267, 894, 1498, 3147, 1490, 2941, 2324, 3170, 1855, 2370, 1046, 2046, 3202, 2826, 3131, 2536, 2227, 2989, 1490, 2359, 1985, 1694, 1883, 352, 1152, 2279, 850, 1922, 1765, 1895, 1013, 588, 1014, 1997, 1456, 326, 1879, 1710, 487, 2686, 636, 2186, 1439, 1726, 689, 2191, 906, 955, 1415, 2169, 1745, 326, 2659, 924, 2335, 1871, 1926, 1457, 1227, 1184, 971, 1226, 2400, 2023, 1226, 1613, 1684, 534, 1239, 1631, 1758, 1931, 1628, 1178, 1317, 1750, 1924, 1220, 2234, 1840, 564, 1939, 1774, 1324, 646, 730, 1820, 2691, 3174, 4169, 648, 1547, 1534, 4414, 3207, 3703, 3097, 1207, 1963, 567, 2511, 1994, 1222, 3308, 1087, 3116, 3757, 3182, 1403, 3409, 1507, 2552, 2958, 1929, 2231, 1838, 2755, 3085, 1976, 1897, 1987, 199, 1760, 2067, 1533, 801, 151, 1580, 1375, 1068, 490, 771, 2203, 892, 1535, 1525, 848, 1125, 1685, 53, 530, 1655, 1780, 625, 1737, 1256, 1113, 2223, 1145, 1150, 53, 1466, 1252, 1762, 1405, 1409, 1594, 1009, 1164, 1152, 1162, 1381, 964, 1470, 1741, 1665, 1328, 1013, 1618, 1215, 393, 910, 1967, 1426, 536, 559, 968, 1168, 1521, 1510, 790, 2837, 1003, 2727, 3579, 4177, 3661, 3868, 3916, 4001, 6104, 3882, 1240, 3482, 6838, 3568, 3401, 1306, 2743, 1590, 2375, 2109, 3680, 2205, 1818, 2179, 2016, 1275, 2058, 3326, 2498, 2271, 1094, 1632, 3517, 1184, 1646, 1895, 2290, 1895, 1830, 1147, 2918, 1830, 915, 513, 1539, 1503, 1541, 1645, 579, 1439, 2045, 1796, 1010, 1835, 1129, 1228, 2099, 1089, 2162, 915, 2088, 843, 674, 631, 2197, 1913, 1924, 1062, 1739, 1652, 2812, 1618, 513, 1089, 2316, 1868, 2319, 1756, 1699, 1092, 1207, 1360, 1621, 2267, 1058, 675, 1501, 1354, 1631, 942, 839, 914, 1232, 1481, 816, 777, 452, 663, 1528, 1027, 1510, 835, 1362, 819, 1068, 1027, 703, 1617, 1623, 1042, 1391, 804, 1524, 1536, 372, 1461, 1450, 1533, 1494, 1410, 1410, 709, 859, 388, 2671, 2866, 2805, 3818, 3059, 2262, 2384, 2634, 1502, 3178, 3834, 3008, 1538, 2178, 2331, 1757, 2635, 1006, 1447, 2441, 2509, 1604, 2291, 683, 186, 313, 2675, 2576, 2612, 4291, 4140, 1338, 3204, 3517, 4046, 4072, 2291, 4190, 2877, 2437, 2049, 3542, 2506, 775, 684, 1151, 1025, 1535, 1327, 781, 611, 916, 1602, 1255, 821, 1312, 1025, 1786, 245, 684, 1295, 1295, 1416, 1665, 1078, 816, 359, 141, 526, 995, 1632, 1285, 954, 525, 1121, 703, 1552, 1470, 1212, 1573, 150, 632, 1092, 1655, 1463, 1419, 1390, 1189, 1460, 954, 1543, 589, 1481, 2954, 1640, 2699, 3052, 2673, 2792, 460, 3060, 1870, 928, 2148, 2400, 991, 1839, 2803, 2036, 2251, 2961, 2576, 2969, 3100, 460, 2159, 783, 2294, 2023, 958, 1085, 1083, 254, 523, 1328, 366, 562, 1560, 835, 1274, 1549, 781, 1244, 254, 538, 2552, 4458, 2881, 2406, 1849, 606, 5911, 1993, 3387, 3011, 2038, 444, 565, 2323, 1825, 1215, 804, 804, 1294, 740, 1330, 885, 385, 793, 13, 469, 1398, 525, 1460, 984, 427, 2739, 1222, 383, 2455, 25, 2473, 2481, 2023, 1654, 2572, 2435, 876, 2372, 1539, 172, 2137, 883, 3308, 2446, 2397, 1223, 3152, 2367, 2372, 2394, 2508, 3218, 2832, 3275, 3967, 2381, 388, 1848, 2014, 3282, 1859, 2605, 3264, 2342, 2803, 2852, 2832, 443, 2244, 3763, 2623, 2609, 2986, 2911, 877, 2044, 3066, 3141, 822, 2534, 2852, 479, 2514, 1786, 2206, 3009, 2894, 419, 2797, 2843, 1733, 3511, 2671, 1064, 2572, 3282, 479, 3015, 2921, 1925, 2681, 95, 2379, 1638, 2104, 3182, 1637, 2757, 2919, 1941, 3275, 443, 2514, 2921, 1801, 1862, 1894, 1845, 1959, 2250, 2036, 1924, 975, 843, 2244, 1786, 1925, 1801, 2088, 1764, 1925, 2507, 1637, 978, 957, 520, 461, 1632, 1231, 1266, 353, 1448, 1815, 1681, 1124, 2516, 1593, 1453, 1590, 429, 2294, 2298, 2348, 2540, 3135, 1588, 2547, 2817, 2548, 2259, 2513, 2516, 2654, 956, 2952, 2942, 2884, 2971, 2522, 2938, 1075, 2194, 2718, 13, 1988, 1593, 956, 3176, 3044, 2525, 2304, 2375, 2796, 2022, 628, 1791, 2228, 956, 2942, 3752, 4257, 3249, 3205, 3134, 3176, 4121, 4503, 3930, 3158, 4047, 3016, 3126, 2537, 3564, 8354, 8217, 6874, 7883, 6206, 5751, 6330, 4435, 1950, 8147, 7940, 5494, 7313, 7035, 1907, 1788, 1641, 977, 961, 312, 1270, 1200, 542, 1105, 605, 1628, 465, 1643, 1129, 1612, 1455, 1351, 1135, 1293, 1817, 1244, 1350, 1127, 1129, 1812, 1596, 664, 1803, 1585, 1163, 1462, 1096, 3135, 1905, 1688, 499, 1436, 1997, 1515, 912, 2706, 1466, 2267, 1634, 2426, 2730, 2817, 1609, 1370, 499, 2388, 938, 1497, 1015, 415, 1261, 1905, 1460, 2212, 2231, 2294, 1512, 1078, 1667, 1436, 938, 575, 115, 524, 1901, 1468, 1569, 2205, 2198, 1295, 2298, 1561, 1404, 1997, 1818, 1497, 575, 483, 1090, 1967, 1701, 1441, 2649, 2210, 1868, 739, 2348, 1441, 1176, 1627, 1515, 1015, 115, 483, 1964, 606, 1433, 1473, 2179, 2126, 1216, 2540, 1516, 1141, 912, 415, 524, 1090, 606, 1294, 2119, 1720, 1503, 2176, 1818, 953, 699, 1783, 2330, 509, 1757, 1077, 1445, 1892, 2000, 1232, 1608, 1014, 955, 1017, 1530, 1334, 1127, 1586, 1516, 1537, 1148, 1171, 1649, 1336, 608, 1268, 1424, 1468, 882, 713, 1437, 1846, 1318, 105, 119, 1369, 1473, 1290, 496, 1422, 618, 1351, 367, 888, 276, 1109, 1143, 1738, 989, 444, 432, 286, 1458, 1336, 496, 899, 1603, 329, 1322, 1321, 1347, 1093, 1591, 1071, 248, 1589, 1178, 768, 1561, 1375, 425, 98, 2184, 315, 1190, 1812, 901, 1053, 1046, 462, 1237, 1226, 777, 1574, 425, 451, 459, 1606, 485, 940, 637, 1413, 1540, 981, 156, 1538, 1119, 98, 1507, 1598, 1311, 451, 1776, 2156, 228, 1204, 678, 936, 1088, 414, 2192, 772, 1420, 2184, 1878, 823, 1088, 1797, 1839, 769, 1194, 1754, 2156, 365, 1540, 2, 841, 2204, 1591, 1524, 54, 319, 1516, 1528, 1571, 999, 1524, 1540, 769, 999, 1951, 1305, 999, 1789, 1190, 1013, 1056, 1606, 1204, 1194, 1373, 963, 1703, 1524, 895, 732, 296, 1514, 1562, 1786, 116, 191, 1524, 1914, 1382, 1651, 1826, 1754, 1590, 1979, 2184, 340, 1976, 1193, 1945, 1032, 328, 1407, 2362, 1660, 1122, 770, 1963, 2751, 1804, 2934, 2180, 2688, 2416, 1596, 2016, 1598, 2799, 2919, 2030, 3218, 388, 2609, 3015, 95, 1862, 673, 975, 1475, 1633, 1444, 1614, 1045, 1621, 838, 1385, 1635, 1628, 1073, 1422, 806, 1057, 1695, 1528, 499, 386, 966, 1462, 1577, 1320, 494, 1593, 717, 1569, 1039, 2414, 499, 1390, 902, 608, 1260, 433, 878, 563, 1079, 2236, 444, 1102, 1150, 592, 2140, 2388, 1884, 1535, 499, 1802, 1633, 1645, 1797, 1705, 1901, 1623, 1208, 1469, 584, 1576, 1597, 1678, 1857, 1073, 1390, 1802, 1653, 1805, 302, 1483, 1068, 803, 823, 1051, 1180, 949, 776, 349, 970, 1615, 838, 1052, 1685, 2396, 2587, 1797, 1297, 2877, 2168, 189, 437, 1949, 2386, 1136, 1183, 2459, 2388, 1840, 2382, 1397, 1013, 1365, 1397, 721, 426, 555, 1028, 433, 1555, 1618, 1299, 1402, 1290, 1280, 3256, 4543, 999, 1999, 1881, 2498, 2666, 2035, 2262, 2666, 1150, 2412, 2896, 2339, 2728, 4544, 3544, 999, 999, 2881, 3472, 3410, 2864, 3256, 3597, 2150, 3312, 3585, 2226, 4122, 6178, 2910, 3546, 2546, 1999, 999, 3881, 3150, 4253, 3773, 4251, 4253, 4387, 2548, 3400, 5544, 6029, 2901, 2017, 1881, 2881, 3881, 733, 903, 1452, 1314, 525, 1801, 1313, 2076, 3400, 2035, 849, 2031, 2986, 3009, 1518, 3945, 1150, 2150, 3150, 733, 1419, 2088, 1386, 1692, 1132, 2533, 1532, 2387, 2928, 1582, 2456, 2167, 1125, 2666, 3410, 4253, 1491, 2088, 702, 1092, 1759, 837, 1818, 319, 908, 963, 2002, 2244, 2549, 1856, 1529, 1294, 1803, 2035, 2864, 3773, 1452, 1107, 702, 1248, 907, 1386, 554, 1002, 1351, 1388, 1830, 1928, 1492, 1683, 721, 1585, 1159, 1199, 1585, 819, 1147, 260, 1969, 1802, 2376, 1699, 1657, 1735, 1758, 1924, 3176, 2084, 1493, 84, 572, 1936, 1916, 1556, 1787, 1534, 451, 2244, 1289, 368, 836, 1437, 2666, 3597, 1314, 468, 1759, 907, 1433, 1092, 1692, 353, 1374, 978, 975, 946, 1343, 764, 1562, 2262, 3256, 4251, 525, 388, 1759, 1248, 1637, 836, 1132, 1496, 931, 2119, 1035, 1579, 686, 1516, 1703, 2412, 3312, 4253, 1313, 657, 837, 554, 931, 353, 1532, 1146, 1032, 1049, 1290, 1547, 1003, 275, 2083, 1633, 768, 1265, 2232, 1548, 1740, 1860, 1849, 1623, 2298, 2149, 584, 1753, 609, 1844, 1469, 1940, 1996, 1849, 1803, 1528, 1319, 1262, 2005, 943, 973, 1530, 1956, 1757, 918, 2896, 3585, 4387, 1793, 2387, 319, 1002, 1374, 1146, 965, 1025, 1751, 1934, 1802, 2230, 1542, 1226, 1445, 1516, 839, 1437, 908, 1351, 978, 1032, 990, 1445, 965, 59, 1560, 1543, 2609, 1881, 1932, 1549, 559, 1456, 874, 1428, 963, 1388, 975, 1049, 960, 1392, 1025, 59, 1516, 1504, 1907, 1973, 1591, 511, 1081, 1661, 714, 1067, 1538, 1560, 1798, 1525, 432, 1041, 313, 1516, 1481, 658, 1529, 1508, 770, 1340, 1852, 1359, 330, 2016, 1188, 2036, 1947, 1401, 1481, 1870, 1805, 1878, 1271, 1010, 1142, 1725, 1502, 1818, 1718, 788, 1751, 970, 960, 658, 1870, 990, 1573, 2074, 2719, 1928, 1606, 1152, 1658, 1332, 1691, 2771, 1394, 2965, 2120, 2649, 1352, 1650, 1920, 1912, 1841, 2016, 2776, 2282, 794, 2129, 1264, 1604, 1665, 1342, 1867, 3775, 2244, 2559, 2508, 888, 1934, 2609, 515, 2140, 1450, 6239, 6468, 2332, 1449, 1402, 1179, 2806, 1485, 1437, 1513, 2612, 3081, 260, 2776, 499, 1982, 1733, 2207, 3280, 2742, 1245, 3138, 1109, 1522, 3103, 2710, 688, 2282, 499, 2921, 1487, 1524, 2048, 2313, 2055, 1412, 1720, 1479, 2148, 1967, 1835, 1742, 2171, 794, 1982, 1487, 1602, 2045, 1601, 2035, 3791, 2458, 1909, 2411, 706, 1950, 2372, 1545, 1992, 2129, 2184, 1733, 1524, 1602, 287, 540, 2213, 1875, 1259, 129, 1868, 1496, 1650, 3031, 3195, 3628, 3019, 1466, 2317, 1745, 4518, 4273, 3082, 2019, 2423, 2022, 823, 2952, 2013, 2425, 1645, 1332, 1736, 1431, 1798, 960, 1183, 2792, 1411, 2617, 3031, 2786, 3280, 3082, 1450, 2015, 1380, 2056, 2021, 1587, 7313, 1920, 2019, 2398, 1358, 1722, 1111, 2603, 9866, 7262, 3189, 3877, 3460, 6691, 922, 1576, 1323, 2411, 1587, 1340, 7035, 997, 3007, 2423, 828, 1284, 769, 3353, 9967, 7230, 3020, 4757, 4321, 7129, 922, 2125, 1688, 811, 1782, 13, 499, 616, 2240, 1630, 2514, 2015, 1903, 2349, 2790, 2342, 2820, 3279, 1631, 1875, 2022, 2015, 1576, 811, 2137, 1205, 811, 314, 1029, 1861, 4569, 2150, 2605, 2046, 2543, 11176, 8497, 1833, 4919, 1259, 1380, 1323, 1782, 1205, 3127, 1774, 1423, 1532, 3064, 4394, 3196, 3635, 3029, 1588, 2188, 1618, 4642, 129, 2952, 2056, 2411, 13, 811, 1774, 499, 602, 2239, 1643, 2522, 2018, 1900, 2362, 2802, 2353, 2827, 3273, 1676, 1617, 1868, 2013, 2021, 1587, 499, 314, 1423, 499, 1961, 8354, 1702, 2938, 2394, 824, 2163, 2618, 2099, 2836, 8566, 1743, 1496, 2425, 1587, 1340, 616, 1029, 1532, 602, 824, 2228, 2245, 2873, 2187, 1822, 2425, 2927, 3375, 2893, 3114, 1137, 1015, 1650, 1645, 2398, 2125, 2240, 2007, 2239, 2344, 2228, 1501, 1658, 1612, 664, 440, 475, 1158, 2198, 818, 1332, 2562, 1630, 1861, 3064, 1643, 1702, 6874, 2528, 2083, 2307, 2761, 2245, 1171, 1475, 1352, 10182, 7339, 7710, 1920, 997, 2514, 2522, 2938, 7883, 1612, 2083, 2664, 999, 1847, 2055, 2873, 3220, 3422, 3428, 452, 8750, 2296, 2704, 5925, 2792, 3007, 2015, 2305, 2018, 2187, 664, 2307, 999, 847, 1139, 2307, 1809, 3470, 3776, 3616, 1019, 1454, 1798, 3020, 1903, 1576, 1900, 2394, 1822, 440, 2761, 1847, 847, 640, 1285, 1766, 1825, 1024, 960, 2122, 1966, 2152, 1805, 2240, 2425, 475, 1189, 2055, 1139, 640, 690, 1888, 385, 1183, 2571, 516, 2126, 1924, 2371, 1306, 2666, 234, 552, 889, 1638, 1267, 809, 1658, 809, 1843, 868, 1871, 515, 2423, 209, 1466, 1261, 1468, 1701, 1433, 1294, 3352, 973, 3517, 963, 2334, 2257, 2112, 2669, 1184, 2807, 633, 234, 499, 1064, 1540, 1213, 767, 1816, 767, 1613, 1095, 1926, 2170, 1646, 1068, 552, 499, 859, 1087, 721, 268, 2198, 268, 1783, 1104, 1457, 469, 2053, 2136, 1217, 889, 1064, 859, 1603, 1152, 877, 2792, 2576, 877, 1978, 1864, 1983, 1227, 1905, 1895, 1326, 809, 767, 268, 877, 852, 457, 2432, 2499, 1904, 1217, 1226, 3035, 1495, 2290, 1783, 1267, 1213, 721, 1152, 450, 3742, 457, 2969, 457, 2458, 2086, 1569, 971, 1905, 1895, 1326, 809, 767, 268, 877, 852, 457, 2432, 3100, 2499, 1904, 1217, 1226, 2404, 3180, 2901, 5148, 3594, 3372, 3702, 3691, 3592, 5138, 3650, 4162, 2166, 1534, 2459, 4051, 6226, 6603, 5982, 972, 1474, 2348, 2965, 4451, 3276, 4493, 4656, 4536, 5828, 4161, 4810, 2011, 972, 1809, 3105, 5296, 5690, 4619, 1445, 1321, 1560, 1631, 545, 1473, 900, 932, 1561, 1283, 1022, 1487, 1070, 1675, 964, 1537, 1847, 1500, 2237, 1377, 1664, 749, 333, 1854, 1873, 481, 600, 901, 293, 1067, 1567, 1459, 1679, 1625, 1063, 266, 1484, 1924, 1916, 1751, 2146, 600, 1051, 1466, 872, 468, 968, 1631, 1275, 1072, 1216, 726, 1208, 2370, 1219, 1389, 1857, 1904, 421, 1070, 901, 1466, 608, 1356, 1880, 1260, 1361, 1209, 1469, 604, 608, 1691, 1805, 1900, 1792, 187, 1675, 293, 872, 608, 1333, 1828, 1327, 1422, 734, 1334, 1486, 1658, 1669, 1700, 1506, 1764, 1067, 468, 1333, 499, 1863, 1681, 1856, 1233, 1051, 1900, 1531, 1793, 1408, 1567, 968, 1828, 499, 1353, 1479, 1331, 1827, 454, 451, 1612, 1512, 1575, 1713, 1561, 56, 1016, 709, 1969, 1877, 1469, 1321, 49, 211, 419, 724, 1519, 1345, 424, 1031, 999, 1265, 1243, 1345, 1459, 1631, 1260, 1327, 1863, 1081, 1124, 804, 1384, 941, 1434, 1905, 1082, 1555, 1566, 1230, 1784, 1784, 618, 2232, 2034, 210, 378, 760, 1565, 1303, 376, 1030, 959, 1295, 1206, 1303, 1500, 1679, 1275, 1361, 49, 1033, 1778, 2276, 499, 1580, 1061, 1162, 1532, 1655, 1587, 395, 1189, 499, 1764, 2032, 1860, 451, 1740, 870, 1616, 2088, 499, 1463, 1423, 1129, 1919, 1974, 444, 690, 338, 1265, 1448, 1093, 454, 1236, 210, 323, 627, 1482, 1440, 481, 1894, 1240, 1697, 870, 1124, 1368, 1014, 1445, 1377, 1625, 1072, 1209, 211, 378, 323, 921, 1793, 1822, 1293, 1376, 580, 1542, 1507, 1218, 1570, 1393, 1284, 1192, 691, 1358, 1218, 309, 1321, 1664, 1216, 1469, 419, 760, 627, 921, 881, 1105, 1865, 1355, 569, 1560, 749, 1063, 726, 604, 1422, 1856, 724, 1565, 1482, 1793, 881, 1648, 1861, 790, 333, 266, 1208, 608, 734, 1233, 1519, 1842, 1351, 1014, 210, 2341, 1146, 1552, 2178, 2366, 2082, 1167, 1866, 2399, 1516, 2358, 1014, 1085, 2263, 2449, 1706, 2162, 2293, 1216, 2419, 243, 2059, 1787, 1275, 2075, 2370, 1782, 1283, 210, 1085, 2163, 1336, 2294, 2445, 2216, 1201, 1697, 2370, 1424, 1697, 1894, 1822, 1865, 2341, 2263, 2163, 677, 733, 2090, 1487, 545, 490, 1626, 1219, 1805, 1509, 992, 1828, 1030, 1240, 1293, 1422, 1155, 1022, 1021, 954, 1555, 775, 1401, 920, 1259, 1954, 1592, 1031, 1155, 1734, 1697, 1376, 1500, 199, 1296, 1403, 1861, 1841, 681, 1094, 347, 131, 1296, 1473, 884, 691, 1943, 677, 2013, 1861, 59, 2171, 1893, 958, 900, 931, 1857, 1728, 1185, 1973, 2016, 1691, 2311, 2460, 1146, 1706, 1336, 1281, 1327, 1704, 2214, 3012, 1942, 2000, 1925, 1280, 2936, 2491, 383, 959, 870, 580, 1355, 1084, 1297, 758, 1509, 884, 1728, 1737, 1146, 1248, 1133, 1014, 348, 964, 1973, 1356, 1792, 999, 1083, 1316, 2271, 3520, 2293, 2311, 1350, 961, 2446, 2262, 2534, 2719, 1610, 2740, 2376, 4425, 1142, 2719, 2965, 4105, 1466, 1521, 2384, 2254, 2933, 1773, 2684, 1198, 1814, 2312, 2806, 2425, 2649, 2689, 2082, 1216, 2216, 2214, 1802, 1350, 2580, 1211, 1274, 2634, 2477, 2437, 2324, 2476, 1208, 1850, 2092, 2732, 2419, 1502, 2348, 961, 2933, 1211, 2486, 3012, 2801, 2950, 709, 3670, 1167, 243, 1201, 2090, 2228, 2171, 1942, 2208, 2446, 1274, 2486, 1816, 2718, 1627, 1988, 1098, 2314, 2367, 2587, 2599, 1972, 2059, 1487, 1074, 958, 941, 2580, 1816, 1847, 1441, 2601, 2563, 1595, 1291, 630, 2752, 2432, 2075, 2643, 3178, 739, 1773, 2477, 2801, 2718, 1972, 910, 640, 1278, 2108, 4406, 1541, 2449, 2013, 3834, 1988, 2684, 2437, 2228, 1074, 910, 2462, 1528, 1812, 795, 2181, 2516, 219, 2451, 1308, 2652, 1824, 1517, 2403, 3008, 2569, 1198, 2950, 2601, 640, 1528, 993, 2241, 3946, 1213, 1572, 1812, 1738, 993, 1066, 1414, 1583, 1814, 1769, 1278, 1812, 2243, 1734, 2005, 1548, 4607, 2622, 645, 968, 2584, 890, 2211, 1280, 23, 2719, 1372, 1469, 2776, 950, 1772, 1903, 1550, 897, 1407, 323, 2048, 967, 1503, 1822, 1192, 2150, 848, 968, 1908, 1356, 1318, 1865, 609, 978, 1580, 1093, 1648, 1351, 1480, 530, 1484, 467, 1167, 626, 1873, 1484, 1334, 1353, 1469, 2034, 2645, 645, 967, 2399, 868, 2233, 1281, 2740, 1349, 2608, 1449, 2791, 969, 23, 1749, 1919, 1530, 898, 1415, 1516, 2075, 1697, 383, 2376, 2476, 2314, 897, 1865, 898, 2647, 2692, 1056, 1494, 2127, 1655, 1542, 2089, 2169, 3496, 2267, 2100, 1853, 2681, 2634, 2558, 2800, 2024, 2370, 1538, 1721, 1610, 2312, 1208, 709, 2367, 2108, 2516, 2241, 3541, 242, 2685, 1325, 2671, 1083, 2425, 1850, 2552, 2069, 2622, 4652, 2201, 2645, 2647, 2558, 2674, 323, 2035, 1925, 645, 1263, 1638, 1226, 2318, 738, 645, 1826, 1475, 1342, 1542, 825, 2658, 1954, 1685, 2622, 2805, 1206, 1142, 2689, 2732, 2599, 630, 1541, 219, 1213, 2024, 3824, 897, 2246, 1984, 2270, 1755, 2113, 2296, 1481, 1839, 2145, 2588, 1583, 1789, 1215, 1247, 1978, 1475, 1494, 1421, 1046, 1587, 1154, 1639, 201, 2206, 1521, 1751, 1032, 965, 1221, 502, 2012, 1494, 1500, 2444, 603, 728, 1435, 1434, 235, 1478, 1531, 1441, 2083, 634, 1540, 1495, 488, 2055, 1453, 3044, 2565, 2648, 2631, 2109, 1370, 1078, 1404, 1176, 1141, 1023, 2423, 1688, 3248, 2958, 1841, 986, 1564, 1983, 1418, 1333, 1511, 1456, 1559, 666, 413, 1133, 2062, 1457, 1816, 1593, 1523, 605, 1557, 703, 119, 1911, 1336, 1420, 1438, 15, 1378, 1581, 1516, 1359, 432, 1423, 731, 1440, 250, 1004, 281, 1477, 1059, 598, 499, 861, 1747, 1456, 1073, 1159, 1787, 1105, 816, 1848, 2480, 1534, 697, 105, 1909, 1433, 1431, 1327, 15, 1370, 1566, 1530, 1345, 444, 1415, 720, 1425, 266, 989, 284, 1492, 1055, 1440, 467, 570, 1065, 1389, 1015, 1171, 1571, 1268, 1339, 577, 1242, 1268, 1038, 591, 1758, 632, 1531, 1940, 997, 477, 926, 1458, 1389, 1649, 1171, 1648, 1317, 225, 181, 769, 461, 1532, 1129, 530, 1121, 978, 1571, 783, 1041, 142, 1916, 1669, 1531, 1575, 1566, 520, 1422, 2001, 1180, 1752, 1480, 2521, 938, 1542, 978, 1270, 1624, 1691, 857, 1919, 1900, 618, 1989, 1587, 1974, 2011, 1561, 1657, 1199, 2086, 1310, 639, 1549, 1182, 2036, 1913, 1745, 1767, 1503, 2178, 2294, 3100, 1327, 868, 499, 1657, 1187, 1814, 1263, 890, 1038, 2713, 1194, 1056, 2083, 1486, 1645, 2427, 1822, 2366, 2445, 1704, 1349, 499, 1199, 1135, 1638, 1372, 635, 1087, 1494, 1969, 1299, 1439, 1741, 1521, 885, 1571, 1028, 1072, 1534, 1522, 812, 875, 1757, 575, 1365, 1357, 1168, 842, 1475, 1391, 1265, 1286, 1326, 1363, 1685, 954, 1381, 2207, 575, 2093, 1962, 845, 1795, 1640, 1580, 1757, 1550, 1558, 1691, 1023, 1923, 1381, 1874, 1651, 1769, 749, 1974, 2199, 1002, 2284, 1525, 2041, 156, 627, 1319, 401, 594, 77, 1244, 2160, 1062, 1173, 1252, 2256, 1491, 2105, 207, 695, 1262, 332, 77, 1308, 2132, 1064, 1211, 1314, 657, 2793, 2338, 2132, 797, 1267, 1156, 1996, 2394, 1244, 1308, 2339, 1485, 1087, 563, 71, 651, 2336, 1560, 2264, 538, 1027, 943, 401, 332, 1485, 2215, 958, 1260, 1476, 852, 1890, 1436, 2743, 2838, 2461, 2763, 1094, 2675, 2740, 2829, 655, 1993, 2489, 2017, 2206, 244, 2844, 2414, 79, 440, 924, 1204, 2017, 1402, 2713, 2420, 2499, 845, 1744, 2671, 953, 1705, 480, 2564, 2639, 1877, 2154, 1236, 2349, 2167, 1799, 2425, 1762, 2324, 953, 995, 1250, 1962, 2339, 1684, 2021, 331, 1908, 2392, 2475, 2328, 1446, 1754, 2765, 2428, 2453, 1442, 1705, 995, 2551, 2391, 969, 1350, 823, 1011, 2084, 1186, 2395, 754, 2374, 2215, 2457, 2414, 480, 1250, 1754, 2491, 2209, 1931, 1469, 2806, 2870, 2491, 2384, 2684, 1114, 2612, 659, 1929, 2426, 2926, 79, 2222, 287, 2065, 499, 1471, 1044, 2726, 226, 471, 2721, 2587, 759, 2747, 2209, 2691, 2259, 2106, 440, 1584, 1864, 2428, 2639, 499, 312, 2851, 506, 1856, 1995, 78, 2168, 2786, 2793, 2844, 924, 1877, 2551, 823, 2747, 312, 2540, 198, 1545, 2060, 379, 2790, 2462, 2740, 1204, 2154, 2765, 1011, 2691, 4057, 2361, 2525, 3245, 4096, 3101, 1220, 1338, 2440, 1943, 1443, 3925, 1757, 3747, 69, 1367, 605, 1388, 1455, 509, 1458, 1324, 1324, 1408, 1747, 509, 1371, 1544, 1045, 69, 1397, 673, 1456, 1464, 455, 1501, 1325, 1325, 1428, 1734, 542, 1360, 1485, 987, 467, 2565, 506, 1905, 1609, 1512, 1561, 1441, 1516, 515, 3183, 686, 2079, 3326, 467, 2648, 972, 2267, 1905, 1569, 1441, 1473, 1720, 973, 2725, 3035, 835, 1813, 4079, 3245, 3803, 3381, 2561, 3404, 2696, 3237, 3257, 4072, 4257, 2925, 1855, 3982, 3135, 223, 714, 302, 1327, 367, 1826, 1077, 1840, 1461, 1153, 2006, 1596, 975, 969, 1457, 1611, 637, 612, 1534, 1188, 1327, 2034, 2386, 1935, 1825, 824, 1026, 1029, 951, 1913, 2170, 2019, 1145, 963, 572, 1071, 367, 963, 2045, 1225, 2032, 1206, 1352, 1667, 1290, 1313, 1336, 65, 1632, 1796, 594, 598, 499, 223, 1534, 572, 1633, 1154, 1865, 1680, 978, 2155, 1719, 752, 790, 509, 1504, 1647, 827, 795, 499, 714, 2034, 1071, 1377, 1306, 1850, 862, 1009, 301, 376, 1557, 1666, 1225, 1184, 1779, 2100, 813, 1140, 1553, 2714, 1395, 1081, 1781, 2026, 1024, 1248, 1470, 1416, 2627, 1062, 1319, 1081, 4055, 2148, 1812, 2075, 1092, 2315, 3258, 3371, 854, 1776, 1664, 1771, 2323, 3987, 3741, 3267, 1723, 1997, 1504, 1907, 1239, 837, 2697, 1841, 2294, 826, 1371, 1207, 886, 2012, 2466, 2409, 606, 1355, 2165, 1450, 2057, 630, 1871, 1149, 826, 1190, 1063, 990, 1667, 1686, 2968, 5576, 4181, 1249, 1381, 2385, 1825, 1842, 1525, 2173, 4354, 1422, 2339, 2327, 2221, 1371, 1190, 163, 528, 1623, 6976, 7389, 2134, 1699, 1779, 1908, 2604, 603, 1202, 2458, 454, 2342, 2189, 1583, 1873, 1207, 1063, 163, 377, 1615, 1875, 1594, 2332, 1850, 1831, 1058, 2169, 1977, 4847, 3831, 2564, 1534, 935, 592, 2559, 2250, 2089, 1292, 1764, 2125, 195, 73, 451, 1983, 2140, 1914, 2629, 1948, 2551, 2026, 2267, 886, 990, 528, 377, 1483, 2122, 1864, 2121, 1833, 2013, 2261, 2100, 2521, 1848, 390, 681, 2493, 3182, 2461, 2500, 2012, 1623, 1615, 2559, 1483, 710, 645, 1528, 1107, 1966, 668, 2395, 2621, 2139, 909, 1578, 1523, 2122, 1852, 1873, 2638, 1414, 5830, 1393, 1020, 1422, 2356, 3655, 5493, 2106, 2250, 2122, 710, 999, 1564, 1331, 1884, 1059, 2063, 2299, 1800, 1240, 2027, 5777, 2559, 2256, 1933, 1825, 1873, 2089, 1864, 645, 999, 922, 464, 1549, 66, 1950, 2157, 1716, 270, 2186, 1996, 2373, 3621, 2369, 1971, 5972, 5108, 1986, 2812, 7035, 1854, 7521, 1292, 1023, 1528, 1564, 922, 2010, 499, 1725, 934, 1203, 1365, 1037, 737, 464, 499, 1823, 5545, 2148, 2283, 1522, 2134, 1764, 1107, 1331, 7013, 7490, 1430, 459, 1653, 1836, 1451, 239, 2351, 3294, 2205, 1734, 2302, 5785, 976, 2304, 1725, 6243, 1699, 1850, 2121, 1966, 1549, 547, 1430, 1485, 1368, 1966, 2522, 2190, 1952, 1779, 1831, 2125, 1833, 668, 1059, 66, 934, 459, 1485, 1990, 2194, 1760, 242, 2224, 2050, 2424, 3659, 2424, 1963, 4844, 3904, 2632, 1673, 832, 195, 682, 2395, 2063, 1950, 1203, 1653, 1990, 236, 263, 1863, 4782, 3758, 2616, 1464, 905, 73, 645, 2621, 2299, 2157, 1365, 1836, 2194, 236, 499, 2054, 4946, 4094, 2566, 789, 1922, 848, 451, 2653, 2139, 1800, 1716, 1037, 1451, 1760, 263, 499, 1649, 270, 7522, 1813, 5739, 2289, 2155, 1760, 1908, 1977, 1983, 2013, 909, 1240, 7050, 737, 239, 1368, 242, 1863, 2054, 1649, 2249, 3517, 2368, 2099, 2004, 2590, 2008, 2489, 345, 1504, 1450, 2604, 2458, 2261, 2710, 3100, 3414, 2102, 1812, 736, 1041, 618, 2649, 1775, 1829, 2152, 1907, 2100, 1578, 1393, 2186, 1831, 1491, 2224, 5674, 736, 1777, 417, 2621, 2474, 2453, 2572, 2521, 1523, 1020, 1996, 2378, 2351, 2021, 2050, 5694, 2566, 2249, 2099, 1041, 1777, 1595, 1988, 2198, 915, 1213, 2150, 1805, 1239, 2057, 1848, 2122, 1420, 1176, 2617, 618, 417, 1595, 2257, 2344, 2179, 2704, 2240, 2102, 1852, 1422, 2373, 1995, 2087, 2424, 5800, 2004, 1988, 1958, 2187, 1736, 908, 837, 630, 603, 454, 390, 1873, 1816, 1653, 3427, 4390, 2302, 1876, 2820, 2649, 2621, 2827, 2257, 8217, 1501, 2528, 452, 1019, 1825, 1888, 2428, 2066, 2786, 5755, 2008, 1775, 2474, 915, 2179, 1658, 499, 2307, 1766, 1189, 2199, 1841, 855, 1999, 1736, 2489, 1829, 2453, 1213, 2102, 2428, 1158, 499, 2664, 1809, 1285, 690, 2294, 2252, 367, 2375, 1431, 1922, 482, 1587, 1722, 1477, 1593, 1469, 1789, 851, 1852, 831, 1275, 839, 1037, 1064, 1129, 1506, 1572, 1221, 1400, 1202, 859, 676, 1190, 1958, 1349, 959, 1351, 1592, 1716, 1566, 1119, 943, 971, 2152, 2054, 1964, 364, 1812, 702, 1393, 913, 2142, 2086, 2488, 2042, 2055, 1922, 2186, 725, 635, 1884, 2564, 364, 1576, 985, 1736, 2300, 679, 1992, 2183, 2509, 2006, 2020, 2279, 2366, 505, 1808, 2064, 1985, 1469, 2079, 2159, 1536, 2033, 1517, 250, 2134, 2110, 2191, 1644, 1947, 2002, 2219, 702, 985, 2033, 1327, 1612, 2267, 1866, 2282, 1413, 1694, 1879, 1912, 1688, 3747, 2155, 2453, 1955, 2169, 3135, 4156, 2770, 3643, 2526, 2831, 1673, 2576, 4020, 2627, 824, 4520, 3147, 1985, 1253, 764, 1924, 1776, 1294, 1691, 1894, 1631, 818, 2517, 1743, 2207, 1045, 2629, 2030, 506, 2631, 1634, 1460, 1667, 1868, 1627, 1503, 3557, 209, 972, 3680, 794, 2474, 686, 835, 3386, 2426, 2212, 2198, 2210, 2126, 2176, 963, 794, 3742, 2645, 3248, 2547, 2194, 1791, 1957, 2219, 733, 619, 2016, 1625, 2126, 2257, 2070, 2419, 538, 2205, 2718, 2228, 2159, 2316, 457, 747, 1830, 1186, 1658, 1816, 2198, 1978, 2432, 2844, 2432, 2310, 538, 1531, 2728, 2082, 2466, 2230, 1448, 636, 707, 1528, 594, 657, 651, 852, 841, 670, 658, 1943, 971, 2034, 2319, 8, 2215, 2466, 1543, 2338, 56, 2409, 2332, 2006, 1463, 1669, 3000, 2969, 975, 2039, 2316, 1544, 2221, 1677, 8, 2339, 56, 2411, 2337, 2008, 1464, 1942, 921, 2451, 2179, 2267, 2394, 56, 1657, 1487, 56, 2081, 2289, 1952, 1407, 1887, 1789, 1924, 638, 1293, 1010, 2779, 1058, 1815, 2552, 1787, 712, 1600, 899, 1219, 1813, 1072, 1385, 1651, 974, 1328, 2728, 849, 896, 1928, 686, 1343, 2943, 962, 1547, 1582, 1447, 957, 1346, 1452, 1884, 2911, 2797, 1824, 661, 1318, 2246, 2828, 1336, 1351, 109, 1230, 1356, 605, 230, 228, 1595, 918, 1465, 1285, 499, 1327, 2069, 1161, 2542, 1789, 2659, 1462, 492, 834, 1509, 790, 506, 521, 1711, 1624, 1068, 499, 1583, 1730, 1215, 1973, 1760, 2027, 2279, 1983, 2148, 2294, 2310, 1769, 1635, 1760, 1068, 602, 759, 1088, 392, 2257, 558, 2321, 2093, 573, 340, 1326, 725, 1198, 1422, 1437, 1106, 2386, 1052, 634, 91, 972, 1210, 1089, 1594, 117, 1099, 2444, 1620, 1435, 1508, 1385, 44, 1256, 111, 1633, 2018, 766, 908, 1129, 1084, 27, 1059, 91, 1525, 1608, 1382, 1451, 1379, 48, 1340, 55, 1720, 2108, 675, 983, 2264, 2390, 1401, 943, 725, 2025, 1644, 1976, 1576, 59, 2167, 2012, 1386, 2074, 2636, 1675, 1983, 2532, 983, 1045, 1307, 2036, 971, 635, 1413, 2363, 2399, 1978, 1674, 2369, 923, 2384, 3106, 2706, 559, 1978, 708, 1350, 60, 937, 2509, 2126, 1014, 2555, 2453, 1935, 1492, 2219, 2127, 950, 2678, 1264, 1232, 1864, 1536, 2054, 1987, 973, 1415, 862, 379, 1866, 3597, 1542, 1152, 2388, 1619, 1478, 1514, 1862, 2322, 883, 1317, 915, 1336, 1795, 2752, 2176, 1769, 1800, 1991, 878, 1421, 1428, 1422, 1137, 2137, 1359, 1365, 992, 638, 1558, 1061, 61, 1212, 1082, 1127, 1707, 1354, 1113, 1713, 594, 2123, 2641, 2550, 2521, 2346, 2548, 2482, 1888, 2941, 2735, 1407, 1905, 1053, 1862, 1215, 1980, 1971, 789, 1751, 1636, 1475, 1580, 952, 668, 1722, 1218, 2493, 2288, 1330, 2213, 55, 2104, 2289, 1631, 1815, 2680, 1814, 1848, 1596, 1638, 1894, 2508, 2290, 55, 1385, 2168, 2058, 2250, 1588, 1787, 2638, 1759, 1859, 1598, 1637, 1845, 2764, 1207, 380, 2430, 2448, 2456, 2005, 1644, 2410, 2595, 25, 875, 2397, 1514, 2570, 173, 1963, 3038, 1169, 2933, 2399, 2529, 1853, 2825, 3591, 1474, 935, 606, 2056, 1794, 2968, 3388, 3396, 567, 1644, 1654, 2595, 1474, 2038, 2756, 2192, 2326, 3252, 2418, 2207, 3010, 2946, 2631, 2476, 1987, 1938, 1494, 2472, 3101, 2144, 1632, 1135, 2603, 3237, 3447, 1901, 2193, 2576, 2525, 2530, 1989, 2509, 2536, 824, 1319, 2443, 1416, 2384, 2498, 4079, 1552, 3590, 2137, 2448, 2931, 1190, 1133, 2176, 3485, 2472, 3597, 2624, 2324, 538, 1688, 1284, 1970, 1756, 2939, 1558, 1503, 674, 1653, 308, 2391, 329, 2592, 1549, 1645, 1429, 2413, 1545, 1672, 1699, 2627, 1831, 1541, 631, 1978, 637, 329, 2638, 1599, 1971, 2552, 1587, 2322, 1588, 1075, 628, 2958, 3151, 2931, 2743, 3316, 1980, 3729, 2419, 2844, 1067, 2959, 3279, 2543, 1588, 3273, 2836, 3114, 3337, 3574, 1774, 3096, 6389, 3453, 1466, 2603, 3353, 2966, 2283, 3204, 3144, 3457, 4321, 3346, 3418, 1882, 773, 2107, 867, 3456, 3048, 3430, 2580, 1745, 1443, 1746, 2423, 3334, 2965, 260, 688, 2171, 1992, 2462, 3031, 2794, 2127, 2211, 1378, 2588, 2665, 1443, 2120, 2837, 1437, 1109, 1479, 2411, 2951, 2936, 1732, 2678, 1783, 1303, 1322, 2837, 1495, 1882, 2649, 1498, 1292, 3484, 1796, 4581, 1670, 1881, 1546, 1457, 1474, 365, 349, 2244, 2120, 2005, 1910, 2242, 1910, 1596, 3832, 844, 1890, 2327, 2537, 2511, 1368, 1714, 1289, 1612, 3804, 2684, 1730, 2788, 1006, 2441, 1725, 1890, 2729, 5425, 5412, 4620, 3474, 3564, 5309, 5173, 4127, 3048, 4581, 3806, 4081, 3846, 3736, 4861, 3750, 5027, 5576, 4321, 3934, 4120, 5065, 4938, 3387, 4566, 1427, 3474, 4474, 3475, 4390, 2333, 5552, 4181, 4354, 3456, 2573, 2830, 5710, 3932, 2054, 1427, 3736, 3047, 3795, 7292, 5494, 7710, 6549, 6251, 6430, 4367, 3718, 7159, 6663, 4853, 4688, 6691, 7129, 2706, 1087, 554, 2451, 2509, 173, 2968, 1494, 2147, 2461, 2443, 3654, 2509, 172, 1048, 2394, 1566, 1986, 5674, 5800, 8147, 5755, 5925, 4118, 4847, 5830, 3916, 5972, 5415, 4844, 4782, 4946, 5694, 4300, 2478, 3430, 3831, 5493, 5777, 5108, 5545, 5739, 3904, 3758, 4094, 1986, 242, 2674, 1102, 2866, 1316, 2649, 2092, 2317, 1956, 2584, 2528, 2002, 2608, 2692, 2800, 2587, 2037, 2480, 703, 2038, 1791, 2340, 2460, 2433, 950, 2605, 2192, 2623, 2206, 1852, 2079, 2711, 986, 1179, 1234, 2578, 1233, 1779, 2592, 2638, 1615, 1044, 560, 1943, 2402, 1258, 3560, 1971, 2502, 5164, 5660, 1986, 2564, 3182, 2559, 1391, 2148, 1734, 2522, 2632, 2616, 2653, 2289, 2190, 2502, 1958, 2498, 5561, 2256, 5981, 2385, 1422, 1583, 1948, 2461, 1887, 1387, 1110, 2283, 976, 4861, 3795, 2155, 2590, 3750, 2551, 2267, 6717, 2697, 1871, 2339, 2342, 3457, 2498, 612, 1111, 7016, 3457, 1380, 2904, 2333, 5309, 789, 2187, 963, 1465, 1852, 1424, 1018, 1848, 1816, 1239, 1470, 825, 1235, 2041, 2373, 1655, 1521, 1492, 1462, 1084, 730, 768, 638, 1096, 441, 1186, 537, 1273, 297, 1094, 1029, 1352, 2115, 1539, 1089, 1360, 1263, 1465, 638, 1038, 1536, 578, 1526, 2049, 1644, 1004, 501, 1611, 1564, 1797, 1068, 1594, 1076, 689, 2074, 2066, 1410, 1278, 2140, 567, 2041, 2130, 2067, 509, 1536, 1911, 1972, 850, 636, 1297, 1939, 2038, 2379, 2068, 1168, 1792, 1439, 1649, 2257, 1089, 1837, 1937, 561, 1909, 3819, 1990, 5188, 5676, 1583, 3355, 2887, 1919, 1040, 4607, 5138, 5828, 1833, 961, 6554, 1901, 4774, 2052, 1584, 3490, 3007, 1919, 941, 2711, 3650, 4161, 3693, 2881, 5083, 2831, 1536, 4957, 5457, 1015, 3045, 2546, 1040, 941, 3575, 4162, 4810, 2757, 1989, 5701, 2974, 3974, 1026, 3115, 3878, 3683, 4404, 4607, 2711, 3575, 2166, 3630, 4602, 5187, 5443, 5564, 2011, 1385, 1882, 444, 395, 1557, 1455, 1571, 1708, 1549, 1037, 677, 1882, 1484, 56, 1265, 1635, 2012, 690, 1861, 1189, 467, 1790, 1752, 783, 1037, 864, 920, 1231, 1751, 1700, 1793, 1016, 1971, 303, 522, 1255, 1374, 1670, 768, 1242, 1551, 925, 1342, 777, 678, 452, 1703, 1125, 618, 1248, 1556, 1226, 1192, 2460, 1449, 1187, 1135, 1310, 3264, 1963, 1469, 856, 2530, 128, 2127, 1747, 1801, 368, 1125, 1812, 1712, 419, 679, 1669, 1695, 365, 963, 1651, 1776, 414, 2405, 2070, 2127, 1274, 1406, 2585, 1747, 1870, 1657, 1669, 1677, 2039, 1639, 1038, 1791, 1738, 2071, 1797, 2553, 2248, 2264, 1089, 1130, 1985, 2547, 1617, 1930, 2589, 950, 3141, 2671, 991, 2102, 940, 1397, 1773, 393, 952, 1168, 1645, 1802, 884, 684, 1357, 1391, 1135, 794, 2134, 1784, 1125, 1127, 1650, 1359, 493, 1545, 1509, 1115, 827, 1091, 1651, 179, 1259, 12, 1642, 1291, 1082, 189, 1244, 448, 1724, 1688, 1284, 962, 1054, 1769, 179, 1311, 2012, 1301, 379, 972, 1490, 1911, 1964, 2183, 1608, 1145, 2053, 1745, 550, 1492, 3326, 1184, 1456, 2010, 2504, 1403, 1470, 1843, 945, 2019, 1514, 3345, 1063, 1263, 1938, 912, 1539, 1639, 965, 1264, 1270, 1566, 1275, 2041, 2259, 1841, 1904, 2730, 2231, 1295, 739, 1216, 1818, 2079, 1813, 2049, 1988, 1843, 2334, 1613, 1783, 2474, 2086, 1904, 2645, 983, 2070, 1584, 2076, 2058, 2600, 868, 1095, 1104, 469, 2017, 1569, 1217, 2954, 2803, 1217, 1531, 2043, 1760, 1684, 778, 1674, 616, 1479, 2250, 1207, 2289, 690, 683, 1825, 430, 1010, 1439, 712, 1629, 1568, 1847, 1649, 1080, 424, 1129, 1739, 675, 2413, 2322, 1675, 1785, 778, 2271, 1399, 1181, 1282, 701, 1203, 1943, 1942, 1887, 1072, 2042, 843, 711, 1171, 4268, 3256, 2910, 2901, 3945, 2491, 2990, 1030, 2700, 3768, 2137, 2381, 3763, 2688, 2681, 4777, 4396, 3409, 2921, 1659, 2491, 2764, 3396, 499, 3101, 2860, 2739, 3107, 883, 2706, 3514, 1702, 2098, 1193, 2126, 2065, 2800, 2084, 1585, 2520, 1453, 2348, 1236, 331, 2017, 828, 1118, 2921, 1507, 2428, 2697, 380, 2356, 1987, 1717, 2382, 2809, 383, 498, 2446, 1470, 2376, 2407, 554, 5415, 4300, 1971, 1883, 1510, 1023, 592, 2500, 2356, 1933, 2612, 1522, 1952, 682, 645, 789, 1760, 1397, 1396, 1405, 1377, 781, 1618, 777, 1388, 1230, 1095, 1797, 1442, 1773, 1445, 830, 1419, 1022, 1844, 1675, 1528, 2215, 2265, 1892, 1633, 1631, 2235, 2230, 2132, 1465, 1631, 2061, 1034, 1995, 2060, 2073, 2828, 2215, 2063, 1896, 2129, 2032, 2041, 2105, 797, 2264, 1675, 1115, 792, 2499, 1448, 1244, 914, 1363, 1163, 1101, 1547, 1006, 506, 1341, 1471, 1571, 1242, 853, 1071, 1889, 1736, 465, 830, 1060, 543, 954, 1510, 994, 1537, 1349, 909, 1783, 1787, 1592, 27, 900, 1101, 1096, 1060, 117, 1498, 1618, 1378, 1426, 1391, 73, 1359, 69, 1740, 2135, 648, 1336, 2126, 501, 862, 598, 1939, 1983, 2371, 1476, 1631, 2046, 1403, 1330, 1852, 2203, 1611, 1631, 2056, 1179, 1736, 2371, 2437, 2197, 1989, 1548, 1700, 793, 2047, 2296, 835, 501, 1811, 406, 499, 2204, 1564, 998, 1182, 1546, 1585, 1308, 1424, 2079, 1619, 542, 1221, 949, 550, 1626, 834, 1536, 857, 762, 1625, 994, 1729, 676, 1639, 2508, 2248, 2357, 1981, 2691, 871, 499, 1490, 2611, 1303, 2344, 3513, 2514, 1026, 530, 2972, 2736, 2856, 2472, 3174, 2791, 1356, 499, 995, 3111, 1729, 2822, 3653, 2025, 529, 33, 2196, 2351, 3845, 3468, 4169, 1490, 995, 2497, 3085, 2697, 3527, 2671, 3533, 1034, 466, 963, 2264, 3249, 2399, 1622, 2220, 3916, 1035, 2488, 2300, 1576, 2497, 2962, 2286, 1029, 3092, 1722, 1463, 643, 516, 1604, 3158, 2395, 1849, 451, 932, 368, 4718, 1886, 1598, 1919, 2124, 1872, 811, 1910, 1006, 2302, 1290, 1961, 1744, 1278, 1797, 1215, 2059, 895, 1803, 2629, 339, 1008, 1292, 1729, 1277, 963, 2051, 1167, 1936, 11176, 4435, 10182, 9195, 8772, 9198, 10818, 2941, 10939, 9077, 8826, 4367, 9866, 9967, 8497, 8566, 1950, 7339, 8750, 6425, 5985, 6467, 2941, 7373, 7007, 3718, 7262, 7230, 5164, 5561, 6717, 7035, 499, 6976, 6389, 6127, 5263, 7013, 5785, 5027, 5552, 7050, 5660, 5981, 7016, 499, 7521, 7389, 6718, 6481, 5727, 7490, 6243, 5065, 5710, 7522, 5588, 2847, 5013, 5435, 2746, 3588, 3284, 6501, 5926, 1833, 3693, 2757, 5424, 7324, 11301, 5593, 999, 4779, 2578, 5367, 5829, 2304, 3693, 3289, 7493, 961, 2881, 1989, 5564, 8298, 5982, 6273, 999, 1027, 965, 2103, 1597, 839, 1571, 2134, 1151, 1629, 1930, 787, 1991, 1817, 374, 1334, 1221, 2141, 1961, 1037, 1943, 2110, 1382, 1879, 2304, 617, 2008, 2152, 374, 1099, 1585, 1086, 1791, 955, 195, 581, 1101, 591, 550, 1071, 1199, 755, 1161, 1593, 2552, 2317, 1250, 2318, 2791, 3520, 3264, 1851, 2776, 2150, 873, 3392, 3496, 1543, 2685, 825, 2508, 2528, 1614, 1415, 2083, 2427, 1747, 2267, 778, 1407, 609, 788, 1876, 1543, 897, 1571, 2638, 3108, 2648, 2660, 589, 991, 2659, 2593, 2006, 1048, 2542, 1730, 2114, 1683, 1273, 1492, 1328, 991, 2400, 1190, 1015, 1292, 1249, 1005, 646, 1088, 1354, 302, 673, 1645, 1712, 1143, 1255, 1165, 1295, 810, 444, 887, 1042, 499, 1003, 804, 1043, 12, 499, 499, 681, 1281, 1384, 983, 1218, 753, 690, 658, 1078, 740, 1320, 1130, 500, 3495, 3422, 3922, 522, 1509, 1010, 1990, 2052, 1536, 3878, 3594, 4451, 4285, 2847, 2578, 6578, 4945, 3388, 2734, 2881, 2507, 1082, 1913, 2412, 7680, 6303, 5188, 3582, 4957, 2466, 3215, 1875, 1876, 5013, 5367, 3422, 499, 3944, 2463, 4864, 2933, 2430, 2406, 2013, 583, 2413, 2912, 6273, 5676, 3442, 5457, 1973, 3341, 1769, 1639, 5435, 5829, 3922, 499, 4444, 2000, 3181, 522, 3944, 4444, 2031, 1532, 1583, 1584, 1015, 3683, 3702, 4493, 2746, 2304, 6232, 509, 1009, 1754, 302, 1026, 65, 2008, 1186, 1990, 1242, 1317, 1729, 1345, 1254, 1271, 1591, 1843, 579, 578, 1815, 1162, 1463, 1226, 1485, 220, 669, 1557, 1598, 1237, 1725, 1197, 1255, 1167, 1422, 1007, 1612, 966, 331, 1794, 557, 985, 669, 830, 618, 1142, 940, 1370, 721, 1178, 1765, 1119, 911, 1009, 1068, 992, 2548, 2796, 1512, 1924, 1094, 2678, 516, 3316, 633, 1068, 1217, 2150, 1783, 1326, 1625, 1326, 1186, 1988, 983, 2335, 429, 2938, 2022, 1023, 3557, 1632, 2388, 1901, 1967, 1964, 2119, 2807, 3352, 2706, 1980, 2678, 2041, 2935, 2622, 738, 664, 668, 1977, 1579, 2120, 172, 2403, 523, 2167, 2643, 1349, 1414, 2193, 1689, 883, 1269, 1317, 1967, 789, 2167, 2224, 675, 2311, 2207, 1874, 1645, 2344, 2333, 1065, 725, 569, 598, 2134, 2137, 2058, 1686, 172, 2005, 2569, 425, 2224, 1267, 1583, 2068, 1663, 915, 1143, 1255, 1165, 1295, 810, 444, 887, 1042, 499, 1003, 804, 1043, 12, 1787, 1113, 1137, 1639, 1360, 504, 1537, 1501, 1109, 826, 1101, 1640, 12, 189, 1249, 12, 12, 500, 1267, 1636, 1155, 1285, 799, 432, 896, 1051, 1147, 1013, 793, 1031, 1402, 1484, 1218, 1424, 749, 1146, 1386, 1671, 1144, 1558, 1171, 625, 1513, 830, 947, 625, 685, 1711, 1541, 940, 1091, 609, 471, 1077, 667, 1123, 1027, 1617, 1207, 1007, 684, 1077, 254, 474, 1203, 496, 490, 1374, 2058, 1621, 2104, 861, 2107, 430, 1299, 1796, 2036, 899, 1203, 1377, 1780, 1413, 1380, 111, 1645, 1588, 1618, 3264, 2919, 1924, 1829, 1631, 2896, 2919, 1844, 1865, 1857, 683, 1399, 1177, 987, 496, 1687, 638, 1307, 1760, 607, 2478, 1883, 3560, 1657, 1534, 3517, 3655, 3621, 2812, 3294, 3659, 1673, 1464, 1922, 3916, 2227, 1831, 2378, 1420, 1995, 2066, 818, 855, 2296, 1454, 1024, 385, 367, 1411, 3430, 2572, 1510, 2369, 935, 2368, 2638, 2106, 1657, 1854, 2205, 2424, 832, 905, 848, 4118, 2102, 1491, 2021, 1176, 2087, 908, 1999, 2375, 1971, 606, 1249, 1202, 1058, 681, 1414, 1884, 2554, 1963, 1961, 2630, 1325, 2035, 1102, 3100, 2936, 2271, 2681, 1317, 2211, 2048, 945, 2233, 1250, 1614, 2201, 1475, 945, 2002, 2659, 2713, 2530, 2634, 981, 1903, 1356, 1919, 873, 788, 1552, 1275, 1424, 992, 2181, 1185, 1235, 2324, 1098, 1291, 1537, 539, 2195, 1880, 2337, 61, 1875, 1704, 1521, 925, 1904, 1465, 1735, 1436, 1497, 440, 3430, 1665, 1670, 2947, 3466, 1234, 344, 322, 1574, 1460, 1862, 875, 2936, 1961, 1664, 1802, 1267, 1547, 422, 1878, 1567, 1342, 1881, 3172, 2035, 344, 1839, 1826, 1647, 1557, 970, 1950, 1432, 1683, 1374, 1443, 481, 1246, 1658, 1732, 3008, 61, 322, 1432, 1015, 1878, 1201, 1906, 1531, 2678, 1565, 716, 1754, 1697, 721, 1780, 5412, 1664, 1465, 1806, 1246, 1015, 682, 1931, 2027, 2518, 1699, 2169, 1603, 1570, 2966, 1783, 2754, 4620, 3309, 2282, 1234, 1567, 1557, 1697, 682, 1913, 2650, 2376, 1704, 2264, 2283, 1303, 2576, 2102, 4127, 2654, 1521, 1862, 970, 2195, 1931, 1913, 2211, 491, 1322, 2218, 2111, 3204, 1332, 2921, 980, 2568, 1720, 3013, 925, 875, 1950, 2576, 980, 1378, 1498, 1472, 3144, 2794, 1691, 2313, 2742, 2396, 1601, 2696, 1904, 1839, 1565, 1570, 1598, 1380, 1583, 199, 1943, 1917, 702, 1157, 275, 72, 1380, 1631, 2130, 1084, 1647, 881, 3232, 2597, 2554, 2771, 2255, 755, 2221, 1746, 2588, 1513, 1522, 2148, 706, 867, 2284, 2031, 2193, 2137, 2187, 1360, 1986, 2005, 2135, 521, 1359, 1613, 1974, 2242, 1244, 1226, 4420, 4642, 4575, 4093, 4074, 3512, 4006, 3832, 4105, 4718, 3804, 4034, 4503, 3603, 1954, 1456, 1806, 1704, 2327, 3512, 1824, 499, 1977, 3818, 2058, 1466, 1852, 2432, 1690, 1548, 3688, 1685, 1200, 1551, 1448, 4006, 1517, 1579, 1686, 1521, 2322, 2075, 1632, 1066, 1561, 499, 4027, 1170, 1337, 1186, 1099, 1095, 1697, 1140, 1737, 1749, 1141, 641, 263, 1521, 2016, 1032, 481, 1927, 1570, 1704, 491, 2665, 1906, 1689, 1907, 1863, 3346, 1394, 1495, 1472, 2786, 1967, 3275, 440, 422, 353, 1655, 2221, 626, 990, 857, 142, 1708, 920, 1159, 1265, 1658, 1479, 1713, 1434, 1206, 2162, 3059, 2531, 2254, 1802, 2348, 1988, 1595, 739, 795, 1308, 2005, 1721, 2337, 4616, 1071, 1931, 1737, 1531, 1691, 1674, 621, 428, 1406, 1112, 1637, 1034, 829, 1603, 1681, 1806, 736, 1437, 2296, 1129, 1438, 120, 1091, 1586, 833, 16, 1551, 1500, 1146, 1533, 230, 506, 1431, 1987, 720, 1422, 228, 1127, 1423, 119, 1106, 1585, 832, 16, 1555, 1146, 1517, 1492, 521, 1415, 2003, 1742, 940, 861, 2301, 1972, 2211, 1547, 1892, 2404, 1962, 2190, 2183, 1045, 1988, 1105, 949, 434, 834, 1417, 1585, 262, 857, 1262, 1733, 1431, 1577, 1349, 963, 1644, 1349, 1340, 1033, 1674, 1014, 2163, 2086, 1992, 2520, 1866, 1052, 2365, 884, 2555, 2287, 2167, 1812, 862, 423, 4001, 1256, 550, 2000, 1690, 2286, 2217, 1264, 2776, 710, 1997, 1707, 2176, 2022, 1284, 1751, 2288, 2282, 831, 2216, 1517, 1932, 1643, 2365, 1443, 787, 617, 647, 1582, 2005, 1741, 1275, 2115, 250, 2279, 2203, 1286, 2282, 1443, 1991, 2008, 1994, 2410, 1557, 167, 1457, 411, 1632, 1504, 2924, 404, 1704, 2418, 1591, 1818, 1368, 2435, 2382, 912, 1112, 1082, 2443, 2699, 3310, 538, 2377, 2675, 2402, 3827, 1989, 3982, 3942, 1470, 1723, 1723, 793, 1894, 3780, 2037, 1306, 2443, 1253, 4040, 2941, 2359, 2137, 2714, 2234, 2751, 2488, 2130, 1002, 2836, 2789, 1664, 2726, 2206, 2279, 3170, 2675, 2570, 1225, 1279, 637, 1145, 594, 827, 703, 1516, 928, 1790, 2073, 1781, 1521, 1336, 579, 1112, 2287, 2376, 1264, 49, 2407, 1184, 1249, 612, 1188, 598, 795, 671, 1486, 975, 1764, 2107, 1807, 1481, 1289, 578, 1082, 2325, 1270, 49, 1001, 1475, 828, 2622, 489, 1877, 2289, 2470, 2872, 1863, 627, 1387, 1935, 769, 1545, 1962, 969, 2564, 2259, 1253, 1753, 1118, 2160, 1437, 2155, 144, 972, 1492, 2287, 1074, 1572, 2339, 1350, 489, 2428, 2217, 499, 1585, 559, 837, 1488, 2532, 1265, 1340, 2046, 2407, 1908, 1387, 972, 499, 2656, 2036, 60, 1296, 994, 2564, 2065, 769, 1033, 2502, 2392, 1877, 1437, 1488, 2025, 1045, 355, 994, 1812, 1576, 2286, 1912, 937, 884, 1966, 2872, 2428, 59, 923, 2206, 2132, 913, 679, 1966, 1612, 1986, 1622, 2555, 2217, 2053, 1446, 1461, 2659, 1732, 2036, 1647, 1192, 2809, 2515, 2851, 244, 856, 2635, 2790, 448, 2470, 1959, 2449, 2947, 1778, 1971, 2374, 287, 226, 609, 1092, 1829, 579, 2676, 1928, 1346, 1429, 1587, 2290, 2107, 1509, 2288, 1219, 1062, 1825, 1675, 3116, 6856, 3901, 2507, 2013, 1431, 1169, 2340, 2202, 2595, 2459, 3896, 535, 565, 1850, 5360, 681, 6338, 1082, 583, 12046, 2996, 2399, 1769, 3616, 3418, 2216, 1417, 3494, 1464, 1431, 3526, 1849, 1482, 4884, 4611, 5670, 4607, 3045, 2996, 498, 6772, 3355, 3490, 4258, 4197, 3430, 3099, 3363, 3588, 3693, 1509, 1913, 2413, 2031, 3691, 4656, 4216, 1010, 2412, 2912, 1532, 498, 4949, 3494, 2887, 3007, 2546, 4404, 3592, 4278, 3668, 3530, 3284, 3289, 4536, 1086, 7680, 4858, 1496, 2990, 4454, 7161, 7144, 7441, 6773, 7624, 5890, 6501, 7493, 2554, 6303, 6273, 6338, 6772, 1496, 1495, 2968, 7299, 7199, 7409, 6514, 7822, 4397, 6856, 5926, 6191, 5943, 4048, 4945, 4864, 4884, 5670, 2990, 1495, 1481, 7823, 7651, 7773, 6694, 8383, 5812, 5360, 2901, 5911, 5593, 4696, 7227, 4458, 3901, 3418, 4607, 4949, 4454, 2968, 1481, 1451, 3248, 5522, 8641, 4900, 5424, 6273, 3582, 3442, 8745, 8524, 8572, 7378, 9322, 4339, 3706, 3011, 2459, 2216, 4258, 5890, 4397, 2901, 1451, 1798, 6949, 9895, 3983, 3648, 3591, 2734, 2430, 9464, 9197, 9173, 7901, 10046, 2918, 11560, 3757, 6191, 2466, 1973, 1417, 1794, 1215, 2342, 3248, 10655, 3252, 8740, 8937, 1194, 681, 1798, 2779, 2323, 4696, 3979, 1086, 2554, 4048, 5522, 6929, 6974, 7326, 6841, 7336, 6949, 7324, 8298, 8740, 3979, 12046, 4858, 5943, 7227, 8641, 4760, 5020, 5504, 5795, 4883, 9895, 11301, 11560, 1600, 1330, 1622, 816, 1239, 1457, 1447, 1377, 1308, 607, 1850, 1886, 1196, 2000, 2108, 1799, 2041, 2049, 2135, 1989, 1936, 498, 2062, 2712, 1211, 2105, 1005, 574, 2018, 2449, 1314, 2526, 2373, 1548, 2429, 1612, 498, 2488, 2238, 1455, 1135, 891, 2444, 1033, 1014, 691, 1104, 881, 987, 723, 1828, 691, 1973, 1974, 804, 910, 859, 821, 987, 1283, 348, 1081, 3485, 2726, 3257, 143, 1253, 618, 3134, 4591, 3987, 1038, 894, 2227, 3827, 4020, 2069, 738, 1317, 1956, 1814, 2000, 969, 2534, 1963, 1851, 950, 848, 981, 2080, 1655, 778, 1295, 1124, 1358, 569, 790, 1601, 1626, 1741, 1487, 481, 1051, 421, 187, 1506, 2195, 1265, 1946, 3555, 2549, 2123, 2696, 1999, 2230, 515, 1242, 1730, 895, 1835, 947, 841, 1216, 3012, 2213, 2231, 2180, 2284, 1672, 906, 2095, 1999, 2296, 2508, 1672, 1225, 938, 1062, 2272, 3954, 2104, 2067, 2016, 755, 2719, 2415, 1674, 1745, 2127, 2362, 1485, 1245, 1412, 287, 827, 3492, 1967, 1749, 867, 2226, 1795, 827, 2425, 1476, 2462, 2951, 2048, 2207, 1963, 2045, 540, 2731, 1672, 345, 2150, 1736, 2267, 2199, 1355, 1149, 2327, 2189, 2026, 2367, 2582, 2868, 3341, 1961, 1499, 1812, 4474, 1876, 789, 2267, 2630, 2165, 1381, 2221, 2169, 3418, 1101, 1514, 3241, 1589, 2715, 3047, 1499, 1631, 1833, 1618, 1617, 1743, 1015, 2562, 2122, 2571, 3096, 2423, 2612, 3103, 1745, 1450, 3189, 628, 1688, 2137, 2188, 1676, 1961, 1137, 2007, 2252, 2305, 1576, 1966, 2227, 2580, 2806, 2317, 823, 628, 1530, 1515, 1363, 1687, 1685, 972, 1325, 983, 1704, 1559, 151, 847, 1041, 301, 1338, 1177, 1714, 937, 1046, 3791, 3879, 3232, 3061, 4068, 2107, 3127, 3012, 3555, 1774, 3775, 3954, 5823, 5749, 3958, 3031, 3523, 3492, 558, 2031, 1529, 799, 792, 846, 1130, 1258, 1357, 845, 1439, 1125, 1291, 1082, 1847, 1113, 1022, 1428, 1734, 152, 835, 276, 1656, 686, 1021, 837, 1552, 843, 1474, 878, 501, 1482, 614, 444, 8, 1025, 8, 1422, 1738, 154, 836, 277, 1648, 693, 1025, 836, 1543, 847, 1468, 878, 502, 1486, 623, 447, 971, 1142, 501, 502, 647, 334, 225, 1020, 556, 622, 982, 1305, 376, 1030, 1338, 816, 919, 1052, 871, 152, 1365, 1585, 981, 422, 748, 1132, 696, 694, 1415, 1023, 647, 1332, 576, 294, 154, 1065, 637, 858, 835, 836, 334, 981, 559, 694, 697, 481, 691, 42, 821, 1032, 1069, 1248, 726, 1277, 1196, 276, 277, 225, 422, 559, 557, 782, 1113, 1573, 1091, 601, 1188, 681, 699, 1352, 605, 673, 1384, 702, 863, 1385, 1300, 1565, 1420, 1320, 1575, 1575, 1338, 1115, 1015, 1463, 1408, 1729, 1388, 1456, 983, 1153, 2196, 1779, 863, 1489, 1476, 726, 771, 1021, 1370, 1886, 1107, 1170, 1035, 1154, 991, 26, 295, 457, 769, 167, 788, 868, 1836, 872, 803, 1633, 558, 1072, 1038, 1154, 1015, 26, 292, 456, 757, 157, 798, 857, 848, 823, 573, 1074, 752, 863, 1190, 295, 292, 164, 1023, 442, 1078, 1128, 1808, 753, 1051, 392, 789, 864, 1754, 2282, 4121, 819, 1969, 2177, 1502, 1103, 1103, 1101, 834, 5173, 855, 1965, 1124, 676, 1750, 1018, 1555, 644, 1696, 1512, 1032, 1550, 1079, 1603, 1602, 304, 1141, 333, 1514, 1327, 2363, 760, 973, 2113, 1976, 2237, 1410, 1393, 1736, 1595, 1986, 1445, 1690, 1145, 2233, 2238, 588, 906, 641, 1477, 578, 1569, 1205, 736, 891, 604, 1015, 1242, 879, 507, 1124, 1104, 1467, 1582, 550, 437, 2298, 2297, 1930, 2404, 1649, 2613, 464, 1778, 2140, 1528, 889, 1485, 2414, 2843, 2161, 1949, 2095, 2106, 2076, 2119, 1715, 1990, 1355, 2589, 2079, 1691, 2791, 1447, 2044, 1733, 1528, 4694, 6425, 3092, 6578, 5492, 6232, 6554, 4774, 5701, 3115, 5148, 4619, 3724, 3689, 7292, 10818, 3123, 2762, 4122, 3400, 2700, 1659, 3276, 1837, 3502, 2497, 4023, 3372, 2367, 1913, 2190, 1738, 1463, 978, 1547, 559, 1303, 4046, 2697, 1715, 1937, 3627, 1729, 2239, 1763, 402, 144, 190, 1753, 1755, 1852, 1561, 523, 425, 1596, 842, 1734, 2039, 1336, 1552, 1107, 1747, 1734, 714, 1848, 834, 1359, 513, 513, 801, 151, 1371, 377, 167, 595, 1991, 1510, 668, 675, 2019, 1742, 2093, 2170, 2563, 2130, 1135, 2199, 1719, 1611, 1929, 2430, 3038, 2326, 1851, 1915, 1449, 2455, 167, 1279, 1249, 2451, 965, 2428, 1611, 2758, 1796, 1647, 1666, 1754, 578, 237, 2865, 3238, 3473, 1302, 6236, 6089, 3685, 3096, 899, 3513, 3653, 3694, 3052, 2402, 4087, 3649, 4775, 3204, 2377, 3118, 3566, 3720, 407, 4246, 5984, 3262, 3959, 5768, 3352, 1747, 3279, 899, 3993, 2323, 2195, 1181, 1549, 900, 987, 509, 616, 1001, 490, 2451, 1293, 1424, 954, 1297, 1032, 1087, 379, 685, 1480, 2198, 1960, 660, 2296, 1383, 1741, 2071, 2102, 1580, 1652, 2079, 2166, 1983, 933, 1541, 1657, 1729, 864, 1107, 725, 933, 1602, 632, 3752, 5425, 1232, 1501, 1120, 1058, 4753, 3716, 998, 3172, 2985, 2735, 3661, 3262, 4688, 3005, 4885, 3473, 3212, 3312, 1381, 1880, 1193, 2016, 1296, 2283, 2286, 837, 1350, 2163, 1210, 1652, 2425, 1446, 627, 144, 4248, 2933, 998, 3732, 3530, 2439, 2727, 3720, 5319, 3997, 3965, 3694, 4206, 4214, 3366, 3172, 3732, 5528, 5908, 3832, 4333, 407, 4509, 3612, 1602, 2897, 1302, 3619, 1916, 2300, 1604, 576, 1500, 1675, 1265, 1728, 1224, 1400, 1279, 584, 1806, 1763, 1576, 732, 7708, 2985, 3530, 5528, 2562, 6456, 6104, 5768, 6698, 3515, 7329, 6236, 3041, 4589, 996, 1334, 1046, 603, 2264, 1722, 215, 2288, 827, 1100, 1720, 1808, 490, 1889, 1553, 466, 1597, 1961]
adjncy = [902, 518, 209, 776, 652, 274, 878, 177, 210, 275, 276, 661, 823, 986, 477, 450, 3, 68, 165, 134, 199, 454, 137, 524, 463, 21, 22, 23, 24, 475, 501, 512, 164, 684, 460, 461, 462, 15, 17, 180, 215, 56, 4, 252, 253, 1, 164, 961, 459, 15, 16, 56, 19, 20, 21, 22, 23, 24, 463, 501, 512, 257, 2, 5, 6, 684, 461, 17, 978, 180, 215, 56, 252, 253, 254, 257, 227, 4, 6, 682, 680, 458, 683, 684, 559, 561, 473, 250, 252, 253, 254, 257, 4, 5, 861, 7, 8, 683, 684, 559, 17, 978, 473, 252, 253, 254, 128, 257, 130, 259, 132, 6, 8, 41, 683, 978, 840, 17, 18, 473, 861, 254, 128, 129, 130, 259, 132, 6, 7, 840, 41, 683, 978, 18, 473, 861, 129, 163, 516, 37, 961, 10, 43, 12, 174, 912, 50, 474, 362, 42, 94, 129, 163, 516, 37, 961, 9, 42, 43, 174, 912, 50, 20, 474, 94, 258, 677, 360, 361, 363, 12, 173, 174, 912, 50, 51, 590, 55, 58, 95, 94, 997, 258, 363, 516, 677, 360, 9, 11, 173, 174, 912, 50, 51, 590, 55, 58, 95, 361, 94, 997, 784, 139, 100, 150, 105, 106, 107, 204, 717, 718, 144, 146, 83, 84, 85, 118, 803, 149, 514, 835, 537, 987, 712, 713, 714, 715, 108, 109, 779, 145, 146, 872, 921, 202, 121, 827, 924, 925, 798, 2, 3, 164, 40, 459, 460, 461, 462, 463, 16, 19, 20, 501, 56, 180, 961, 3, 164, 199, 40, 43, 15, 56, 19, 20, 21, 22, 23, 24, 25, 474, 501, 128, 257, 2, 4, 6, 7, 40, 41, 683, 684, 130, 861, 978, 19, 180, 512, 56, 252, 253, 128, 129, 130, 132, 37, 7, 8, 41, 42, 683, 840, 40, 978, 19, 861, 128, 961, 130, 3, 164, 40, 41, 43, 978, 15, 16, 17, 18, 20, 56, 180, 128, 961, 130, 3, 164, 37, 40, 41, 10, 43, 15, 16, 56, 19, 24, 474, 42, 1, 3, 68, 69, 70, 199, 16, 22, 23, 24, 25, 475, 93, 134, 165, 1, 3, 68, 69, 70, 199, 16, 21, 23, 24, 25, 475, 93, 134, 165, 1, 3, 68, 69, 70, 199, 16, 21, 22, 24, 25, 475, 93, 134, 165, 1, 961, 3, 68, 165, 199, 43, 16, 20, 21, 22, 23, 25, 474, 961, 163, 68, 165, 70, 199, 681, 679, 16, 946, 21, 22, 23, 24, 474, 93, 64, 769, 770, 931, 772, 101, 65, 519, 28, 747, 748, 977, 850, 918, 849, 826, 27, 156, 157, 62, 63, 64, 65, 993, 772, 101, 102, 519, 156, 826, 850, 995, 918, 998, 26, 28, 157, 62, 63, 769, 35, 772, 101, 65, 519, 977, 850, 931, 918, 26, 27, 156, 826, 62, 63, 32, 65, 993, 996, 998, 102, 519, 995, 504, 505, 988, 989, 30, 31, 32, 33, 995, 996, 998, 102, 993, 989, 503, 504, 505, 988, 29, 31, 32, 33, 996, 197, 198, 513, 160, 989, 500, 983, 503, 504, 505, 988, 29, 30, 160, 33, 996, 197, 198, 513, 989, 983, 847, 848, 500, 503, 504, 505, 31, 988, 29, 30, 159, 32, 160, 996, 197, 198, 513, 983, 847, 848, 500, 30, 503, 504, 31, 988, 989, 158, 159, 752, 162, 35, 36, 810, 268, 269, 78, 190, 272, 273, 915, 558, 772, 509, 510, 750, 34, 772, 101, 810, 747, 268, 66, 78, 977, 558, 918, 36, 826, 28, 509, 510, 161, 34, 35, 772, 810, 268, 162, 78, 272, 915, 510, 558, 752, 190, 128, 129, 130, 163, 516, 961, 40, 9, 10, 43, 174, 840, 18, 20, 41, 474, 42, 450, 451, 452, 133, 454, 455, 137, 524, 98, 529, 884, 277, 534, 457, 453, 864, 625, 620, 622, 623, 624, 465, 626, 627, 532, 533, 91, 829, 511, 128, 961, 130, 164, 37, 129, 41, 42, 43, 978, 15, 16, 17, 18, 19, 20, 56, 180, 128, 129, 130, 37, 7, 8, 42, 43, 978, 840, 17, 18, 19, 20, 40, 56, 961, 861, 128, 129, 130, 163, 516, 37, 961, 40, 9, 10, 43, 174, 840, 18, 20, 41, 474, 128, 129, 130, 163, 516, 37, 961, 40, 9, 10, 16, 19, 20, 41, 24, 474, 42, 550, 167, 168, 169, 170, 267, 846, 466, 468, 53, 841, 852, 916, 155, 265, 746, 192, 843, 49, 70, 71, 681, 679, 845, 46, 47, 48, 807, 946, 476, 93, 192, 843, 49, 70, 71, 681, 679, 45, 47, 48, 807, 946, 476, 93, 845, 192, 843, 845, 71, 681, 679, 45, 46, 381, 48, 807, 476, 93, 382, 383, 192, 807, 476, 71, 45, 46, 47, 372, 373, 374, 809, 378, 380, 381, 382, 383, 163, 71, 360, 361, 362, 679, 45, 46, 845, 50, 843, 681, 93, 94, 946, 163, 516, 997, 360, 9, 10, 11, 12, 174, 912, 49, 590, 361, 363, 362, 94, 480, 258, 677, 999, 74, 11, 12, 173, 912, 54, 119, 120, 55, 490, 480, 66, 99, 999, 72, 73, 490, 919, 749, 920, 54, 745, 120, 859, 860, 67, 132, 550, 166, 167, 168, 169, 746, 44, 846, 259, 916, 469, 470, 841, 472, 480, 258, 99, 676, 677, 999, 72, 745, 490, 173, 270, 51, 52, 55, 120, 58, 859, 860, 480, 258, 259, 677, 999, 490, 11, 12, 173, 174, 912, 51, 54, 120, 128, 2, 3, 4, 40, 41, 130, 15, 16, 17, 978, 19, 20, 501, 180, 164, 461, 838, 839, 200, 201, 590, 591, 757, 693, 694, 695, 696, 122, 123, 95, 258, 99, 676, 677, 262, 999, 490, 11, 12, 173, 270, 95, 590, 54, 120, 859, 860, 997, 802, 830, 357, 990, 60, 886, 492, 125, 821, 502, 885, 314, 124, 61, 126, 127, 831, 802, 830, 357, 990, 886, 759, 492, 125, 758, 821, 502, 885, 760, 314, 59, 124, 61, 126, 127, 802, 830, 886, 990, 60, 492, 300, 821, 502, 885, 543, 313, 314, 59, 124, 125, 126, 127, 64, 769, 931, 772, 101, 65, 519, 156, 826, 748, 849, 850, 918, 26, 27, 28, 157, 63, 64, 769, 931, 101, 65, 519, 156, 826, 849, 850, 158, 918, 26, 27, 28, 157, 62, 65, 993, 996, 998, 102, 519, 988, 159, 989, 848, 849, 850, 995, 158, 26, 27, 156, 157, 62, 63, 64, 993, 995, 101, 102, 519, 156, 988, 157, 850, 998, 505, 26, 27, 28, 29, 62, 63, 35, 260, 745, 810, 268, 269, 78, 749, 515, 52, 750, 919, 920, 509, 510, 515, 166, 73, 74, 471, 525, 846, 175, 273, 469, 269, 53, 470, 119, 472, 92, 746, 191, 1, 450, 451, 69, 70, 135, 75, 524, 199, 21, 22, 23, 24, 25, 501, 475, 134, 165, 450, 68, 134, 70, 135, 75, 679, 21, 22, 23, 376, 475, 476, 93, 199, 165, 679, 68, 69, 134, 135, 75, 45, 46, 21, 22, 23, 376, 25, 475, 93, 199, 165, 192, 843, 845, 679, 681, 807, 45, 46, 47, 48, 49, 946, 948, 349, 93, 480, 99, 919, 73, 74, 745, 749, 175, 920, 52, 54, 119, 120, 92, 490, 191, 480, 67, 260, 269, 166, 273, 72, 74, 471, 525, 175, 120, 515, 52, 469, 470, 119, 472, 92, 191, 480, 67, 166, 72, 73, 471, 525, 259, 175, 472, 51, 469, 470, 119, 120, 92, 191, 475, 68, 165, 70, 135, 476, 451, 883, 372, 373, 376, 378, 383, 380, 381, 134, 69, 96, 97, 994, 932, 481, 697, 103, 706, 527, 528, 926, 86, 87, 88, 89, 90, 927, 700, 702, 703, 352, 576, 822, 865, 811, 300, 301, 979, 980, 766, 342, 343, 573, 350, 351, 34, 35, 260, 977, 810, 268, 66, 558, 269, 272, 273, 749, 515, 772, 920, 36, 915, 509, 510, 400, 963, 402, 517, 369, 690, 366, 80, 81, 370, 691, 692, 824, 825, 282, 881, 963, 402, 517, 774, 369, 370, 366, 79, 400, 81, 82, 692, 690, 824, 825, 282, 881, 400, 963, 517, 774, 402, 904, 394, 369, 370, 366, 79, 80, 881, 82, 531, 824, 825, 282, 288, 964, 965, 774, 881, 904, 394, 967, 365, 80, 81, 402, 531, 824, 825, 286, 783, 717, 803, 100, 950, 142, 105, 106, 782, 13, 718, 205, 149, 203, 922, 751, 507, 508, 85, 194, 803, 100, 150, 105, 106, 107, 204, 13, 784, 785, 85, 118, 196, 522, 149, 783, 803, 100, 105, 106, 13, 718, 717, 83, 84, 149, 118, 922, 751, 97, 706, 932, 103, 104, 76, 782, 143, 528, 481, 87, 88, 697, 90, 527, 702, 703, 481, 706, 932, 103, 104, 76, 782, 143, 528, 86, 88, 697, 90, 527, 702, 703, 481, 706, 932, 103, 104, 711, 76, 782, 143, 528, 86, 87, 90, 527, 702, 96, 97, 834, 928, 932, 699, 929, 481, 76, 994, 701, 771, 702, 697, 90, 927, 700, 698, 926, 703, 96, 97, 834, 928, 932, 481, 697, 76, 994, 527, 528, 706, 926, 86, 87, 88, 89, 927, 700, 702, 703, 864, 675, 231, 39, 829, 624, 625, 626, 627, 532, 533, 218, 511, 765, 255, 67, 260, 72, 73, 74, 471, 268, 269, 175, 272, 273, 515, 119, 525, 746, 191, 192, 679, 843, 69, 70, 71, 681, 199, 45, 46, 47, 49, 946, 21, 22, 23, 25, 845, 165, 163, 516, 360, 9, 10, 11, 12, 174, 912, 49, 50, 590, 361, 363, 362, 363, 677, 262, 360, 361, 11, 12, 173, 590, 591, 838, 57, 58, 271, 122, 997, 928, 481, 834, 771, 932, 929, 97, 76, 994, 528, 926, 697, 89, 90, 927, 700, 702, 703, 96, 481, 834, 932, 76, 994, 528, 926, 86, 697, 89, 90, 927, 700, 702, 703, 450, 451, 452, 133, 38, 454, 137, 524, 837, 884, 534, 457, 475, 453, 480, 676, 999, 72, 745, 490, 749, 270, 52, 54, 919, 920, 58, 859, 860, 783, 803, 104, 105, 106, 13, 782, 717, 83, 84, 85, 922, 751, 149, 65, 35, 772, 769, 156, 519, 558, 977, 850, 918, 26, 27, 28, 826, 62, 63, 64, 65, 993, 996, 998, 519, 989, 995, 504, 505, 27, 988, 29, 30, 481, 706, 932, 104, 76, 782, 143, 528, 86, 87, 88, 697, 527, 702, 751, 481, 706, 100, 103, 932, 711, 782, 143, 528, 86, 87, 88, 697, 527, 702, 751, 783, 717, 803, 100, 106, 782, 13, 718, 205, 83, 84, 85, 922, 751, 149, 139, 100, 105, 107, 13, 718, 717, 144, 83, 84, 85, 118, 803, 922, 149, 193, 150, 785, 713, 106, 204, 13, 784, 145, 146, 84, 149, 118, 522, 933, 514, 779, 140, 14, 147, 148, 921, 537, 924, 925, 798, 827, 835, 712, 713, 714, 715, 716, 987, 872, 109, 121, 514, 779, 780, 781, 14, 921, 147, 148, 535, 537, 924, 925, 798, 934, 827, 712, 140, 714, 715, 716, 987, 872, 108, 944, 945, 940, 938, 939, 140, 941, 942, 111, 112, 113, 114, 506, 943, 944, 939, 945, 940, 938, 203, 140, 941, 110, 112, 113, 114, 942, 506, 939, 945, 940, 938, 203, 140, 941, 110, 111, 944, 113, 114, 942, 506, 944, 940, 938, 939, 140, 941, 110, 111, 112, 945, 114, 942, 506, 943, 944, 939, 945, 940, 938, 203, 140, 941, 110, 111, 112, 113, 942, 506, 514, 941, 869, 870, 935, 140, 183, 780, 781, 942, 943, 934, 182, 535, 184, 940, 798, 832, 833, 514, 779, 982, 183, 781, 835, 181, 182, 537, 184, 121, 538, 798, 832, 385, 578, 570, 580, 581, 582, 833, 579, 982, 313, 538, 539, 540, 541, 542, 193, 803, 785, 106, 107, 204, 13, 784, 145, 146, 84, 85, 150, 522, 149, 480, 67, 166, 72, 73, 74, 525, 259, 175, 472, 51, 469, 470, 471, 120, 92, 191, 480, 258, 677, 999, 72, 73, 74, 119, 173, 912, 51, 52, 54, 55, 58, 490, 833, 514, 835, 713, 202, 779, 108, 781, 14, 116, 537, 538, 827, 924, 925, 798, 838, 839, 200, 201, 271, 757, 693, 694, 695, 696, 57, 591, 123, 95, 704, 758, 838, 839, 200, 201, 759, 591, 264, 693, 694, 695, 696, 57, 122, 271, 757, 831, 802, 830, 357, 991, 990, 759, 492, 125, 758, 821, 502, 885, 760, 59, 60, 61, 126, 127, 831, 357, 990, 60, 886, 523, 759, 758, 821, 830, 502, 885, 760, 761, 314, 59, 124, 61, 126, 127, 831, 521, 357, 990, 60, 821, 523, 125, 758, 886, 885, 502, 759, 760, 761, 59, 124, 61, 830, 127, 886, 357, 990, 60, 778, 523, 777, 125, 830, 502, 885, 543, 761, 314, 59, 124, 61, 126, 831, 129, 130, 37, 7, 8, 41, 42, 43, 978, 840, 17, 18, 19, 20, 40, 56, 961, 861, 128, 961, 130, 259, 132, 37, 8, 9, 10, 43, 978, 174, 840, 40, 18, 41, 516, 42, 128, 129, 961, 37, 7, 8, 41, 42, 43, 978, 840, 17, 18, 19, 20, 40, 56, 861, 928, 769, 770, 771, 994, 929, 747, 748, 930, 750, 931, 917, 926, 927, 129, 259, 550, 166, 7, 8, 841, 840, 18, 53, 470, 472, 861, 469, 98, 451, 452, 837, 38, 135, 137, 524, 450, 274, 883, 372, 376, 378, 380, 1, 450, 451, 68, 69, 70, 135, 75, 372, 21, 22, 23, 376, 378, 475, 165, 383, 165, 450, 451, 68, 69, 134, 380, 75, 883, 372, 376, 452, 378, 475, 70, 133, 512, 491, 454, 457, 459, 460, 461, 462, 463, 976, 529, 212, 213, 214, 215, 1, 450, 451, 452, 133, 38, 454, 457, 524, 98, 529, 884, 534, 475, 453, 256, 560, 763, 551, 680, 682, 171, 172, 464, 913, 914, 675, 468, 216, 217, 250, 251, 764, 255, 717, 923, 712, 106, 715, 716, 13, 718, 205, 144, 872, 147, 148, 149, 506, 783, 714, 514, 987, 781, 943, 934, 935, 780, 108, 109, 110, 111, 112, 113, 114, 115, 148, 942, 535, 921, 827, 783, 782, 923, 711, 203, 205, 142, 751, 718, 950, 506, 507, 508, 922, 783, 923, 711, 203, 141, 718, 205, 83, 950, 506, 507, 508, 922, 751, 481, 706, 103, 104, 711, 782, 527, 528, 86, 87, 88, 922, 751, 508, 715, 923, 712, 925, 106, 139, 716, 13, 718, 717, 872, 146, 147, 148, 149, 205, 924, 714, 193, 715, 150, 712, 713, 714, 107, 204, 14, 872, 146, 118, 202, 924, 925, 193, 715, 150, 712, 713, 714, 107, 13, 14, 872, 144, 145, 118, 924, 925, 715, 712, 716, 714, 139, 108, 109, 718, 205, 144, 872, 923, 148, 921, 987, 924, 925, 715, 716, 712, 108, 714, 139, 140, 109, 144, 872, 147, 921, 987, 924, 925, 139, 100, 105, 106, 107, 13, 718, 717, 144, 205, 83, 84, 85, 118, 803, 922, 783, 193, 933, 785, 521, 522, 107, 204, 13, 784, 145, 146, 84, 118, 713, 202, 647, 648, 649, 650, 653, 495, 660, 661, 630, 663, 952, 633, 634, 655, 893, 354, 355, 356, 358, 359, 200, 201, 844, 693, 694, 696, 153, 991, 821, 354, 355, 356, 358, 359, 200, 844, 493, 494, 947, 948, 152, 349, 991, 261, 267, 484, 485, 486, 263, 265, 266, 171, 466, 467, 468, 487, 852, 155, 765, 255, 916, 484, 485, 263, 168, 551, 266, 171, 44, 466, 467, 468, 265, 267, 852, 154, 167, 255, 64, 65, 770, 931, 772, 101, 769, 519, 747, 748, 157, 977, 850, 918, 849, 26, 27, 28, 826, 62, 63, 64, 65, 770, 931, 769, 159, 847, 848, 849, 850, 158, 26, 27, 156, 62, 63, 64, 33, 197, 198, 513, 160, 847, 848, 849, 850, 500, 983, 503, 63, 157, 159, 32, 33, 197, 198, 513, 64, 160, 847, 848, 849, 500, 983, 503, 988, 157, 158, 32, 33, 197, 198, 513, 983, 847, 848, 849, 500, 503, 31, 158, 159, 752, 162, 36, 261, 265, 266, 267, 546, 272, 466, 915, 852, 484, 189, 190, 485, 161, 34, 36, 261, 265, 266, 267, 546, 189, 272, 786, 915, 484, 752, 190, 485, 961, 516, 37, 9, 10, 43, 946, 174, 49, 50, 361, 25, 474, 362, 42, 94, 2, 3, 40, 459, 460, 461, 462, 15, 16, 19, 20, 501, 56, 180, 463, 1, 68, 69, 70, 135, 75, 679, 376, 199, 21, 22, 23, 24, 25, 475, 93, 134, 469, 480, 67, 132, 550, 73, 74, 525, 175, 259, 53, 470, 119, 472, 746, 191, 550, 551, 168, 169, 170, 44, 846, 559, 468, 53, 841, 852, 916, 155, 550, 167, 169, 170, 551, 44, 846, 466, 468, 53, 841, 852, 916, 155, 746, 550, 167, 168, 841, 170, 551, 44, 846, 852, 469, 470, 916, 746, 53, 256, 916, 550, 167, 168, 169, 551, 44, 846, 559, 468, 841, 473, 250, 864, 675, 763, 263, 138, 551, 464, 913, 914, 467, 468, 154, 155, 764, 765, 255, 256, 560, 763, 864, 682, 680, 138, 231, 464, 913, 914, 532, 216, 217, 218, 251, 764, 458, 258, 363, 676, 677, 262, 999, 490, 11, 12, 270, 912, 51, 590, 54, 55, 120, 58, 997, 95, 129, 163, 516, 37, 360, 9, 10, 11, 12, 912, 50, 55, 474, 42, 94, 361, 67, 260, 166, 72, 73, 74, 471, 269, 525, 272, 273, 515, 469, 470, 119, 92, 746, 191, 566, 232, 233, 235, 236, 562, 239, 242, 244, 245, 246, 567, 568, 564, 820, 565, 0, 644, 179, 902, 455, 456, 652, 655, 178, 275, 276, 277, 884, 949, 453, 644, 179, 902, 455, 456, 457, 651, 652, 655, 177, 275, 276, 277, 884, 529, 949, 453, 640, 643, 644, 453, 276, 455, 456, 457, 651, 652, 902, 177, 178, 275, 529, 277, 534, 884, 638, 949, 512, 2, 164, 40, 459, 684, 461, 462, 15, 17, 19, 501, 215, 56, 4, 384, 385, 386, 982, 833, 936, 937, 813, 815, 116, 629, 182, 183, 184, 628, 538, 981, 384, 833, 868, 869, 870, 935, 936, 937, 815, 385, 115, 628, 181, 982, 183, 184, 116, 629, 869, 870, 935, 936, 937, 780, 781, 942, 943, 115, 116, 181, 182, 535, 184, 628, 934, 982, 514, 869, 870, 935, 936, 941, 535, 780, 781, 942, 943, 115, 116, 181, 182, 183, 934, 384, 385, 386, 579, 580, 962, 815, 628, 629, 599, 186, 187, 188, 797, 981, 384, 385, 386, 580, 962, 815, 787, 628, 629, 853, 599, 185, 187, 188, 797, 981, 609, 610, 604, 962, 206, 207, 208, 787, 853, 854, 185, 186, 188, 797, 606, 607, 609, 610, 549, 962, 206, 207, 208, 787, 853, 854, 185, 186, 187, 604, 797, 606, 607, 161, 162, 547, 484, 261, 486, 487, 876, 546, 786, 755, 756, 545, 190, 161, 162, 547, 36, 261, 265, 266, 267, 34, 752, 786, 546, 915, 189, 525, 67, 260, 166, 72, 73, 74, 471, 269, 175, 272, 273, 515, 469, 470, 119, 472, 92, 746, 843, 845, 71, 681, 679, 45, 46, 47, 48, 807, 946, 349, 381, 476, 93, 523, 118, 785, 521, 522, 107, 204, 784, 145, 146, 778, 150, 777, 761, 202, 933, 831, 704, 705, 195, 196, 264, 521, 522, 523, 204, 784, 785, 803, 84, 759, 704, 705, 194, 196, 839, 264, 932, 271, 697, 698, 699, 701, 702, 703, 704, 705, 194, 195, 839, 264, 784, 785, 84, 759, 697, 698, 701, 702, 32, 33, 198, 513, 160, 847, 848, 849, 500, 983, 503, 504, 31, 989, 158, 159, 32, 33, 197, 513, 160, 847, 848, 849, 500, 983, 503, 504, 31, 158, 159, 1, 68, 165, 70, 679, 16, 946, 21, 22, 23, 24, 25, 474, 93, 69, 355, 356, 839, 201, 695, 591, 696, 693, 694, 153, 152, 57, 122, 123, 757, 355, 356, 758, 839, 200, 759, 760, 591, 696, 693, 694, 695, 152, 57, 122, 123, 757, 193, 835, 933, 713, 778, 777, 14, 145, 150, 761, 121, 570, 539, 542, 783, 507, 711, 923, 141, 142, 111, 112, 114, 83, 718, 950, 506, 205, 508, 922, 751, 193, 194, 523, 118, 785, 521, 522, 107, 13, 784, 145, 803, 84, 150, 933, 718, 783, 203, 147, 105, 139, 923, 141, 142, 717, 144, 83, 149, 950, 922, 507, 508, 506, 751, 608, 609, 610, 611, 612, 613, 615, 616, 188, 549, 207, 208, 853, 854, 617, 187, 604, 797, 606, 607, 608, 609, 610, 611, 612, 613, 615, 616, 188, 549, 206, 208, 853, 854, 617, 187, 604, 797, 606, 607, 608, 609, 610, 611, 612, 613, 615, 616, 188, 549, 206, 207, 853, 854, 617, 187, 604, 797, 606, 607, 0, 577, 837, 518, 776, 823, 274, 368, 210, 371, 691, 690, 986, 883, 380, 477, 0, 577, 837, 518, 776, 878, 368, 209, 274, 371, 691, 823, 986, 883, 477, 544, 641, 642, 873, 234, 874, 685, 686, 237, 816, 817, 910, 224, 687, 668, 637, 223, 491, 651, 454, 136, 457, 459, 460, 461, 462, 463, 976, 529, 213, 214, 215, 512, 651, 136, 491, 460, 237, 462, 976, 212, 214, 215, 632, 635, 636, 512, 491, 651, 136, 457, 459, 460, 461, 462, 976, 529, 212, 213, 215, 512, 2, 227, 4, 775, 136, 459, 460, 461, 462, 976, 180, 213, 214, 212, 256, 560, 227, 763, 682, 680, 138, 775, 172, 464, 561, 217, 250, 251, 458, 256, 560, 763, 864, 682, 680, 138, 231, 172, 464, 913, 914, 675, 532, 216, 218, 251, 764, 458, 864, 675, 231, 249, 236, 172, 464, 243, 532, 533, 247, 248, 217, 91, 224, 641, 863, 669, 673, 225, 637, 688, 689, 687, 819, 666, 667, 221, 670, 816, 641, 230, 232, 873, 234, 818, 241, 562, 563, 564, 246, 874, 222, 223, 224, 673, 667, 654, 687, 688, 689, 819, 862, 951, 666, 219, 892, 669, 670, 863, 641, 230, 232, 873, 234, 818, 687, 241, 562, 563, 564, 246, 220, 874, 223, 641, 642, 230, 873, 234, 874, 687, 816, 241, 818, 211, 563, 220, 637, 222, 641, 642, 225, 817, 649, 647, 654, 637, 688, 689, 687, 211, 219, 221, 670, 816, 224, 641, 642, 647, 648, 649, 654, 688, 689, 817, 631, 219, 637, 670, 816, 544, 228, 229, 910, 775, 237, 238, 499, 240, 241, 243, 686, 249, 639, 228, 5, 682, 680, 458, 775, 684, 560, 561, 215, 216, 250, 251, 252, 253, 544, 226, 227, 229, 775, 237, 238, 499, 240, 243, 686, 247, 248, 249, 639, 544, 226, 228, 230, 775, 874, 237, 238, 499, 240, 241, 818, 243, 686, 248, 249, 639, 229, 242, 232, 873, 234, 235, 818, 238, 499, 240, 241, 562, 563, 564, 246, 567, 220, 874, 222, 223, 864, 251, 763, 172, 464, 675, 532, 533, 247, 248, 217, 218, 91, 764, 566, 230, 233, 873, 874, 562, 238, 176, 241, 242, 563, 564, 565, 246, 567, 820, 818, 220, 222, 566, 232, 235, 236, 562, 239, 176, 242, 244, 245, 246, 567, 568, 564, 820, 565, 641, 642, 230, 873, 874, 240, 238, 563, 816, 241, 818, 211, 246, 687, 220, 637, 222, 223, 230, 233, 567, 236, 818, 238, 239, 176, 248, 242, 499, 244, 245, 566, 247, 568, 820, 565, 233, 235, 499, 239, 176, 568, 242, 243, 244, 245, 566, 247, 248, 249, 218, 544, 226, 228, 229, 910, 775, 668, 685, 686, 817, 211, 213, 632, 635, 636, 639, 226, 228, 229, 230, 243, 232, 873, 234, 235, 686, 240, 241, 818, 499, 246, 248, 874, 639, 233, 235, 236, 499, 176, 568, 242, 243, 244, 245, 566, 247, 248, 820, 249, 565, 544, 226, 228, 229, 230, 775, 873, 234, 238, 499, 241, 818, 243, 686, 249, 874, 639, 226, 229, 230, 232, 873, 234, 238, 240, 563, 818, 499, 564, 686, 246, 639, 220, 874, 222, 223, 566, 230, 232, 233, 235, 236, 818, 239, 176, 562, 564, 565, 246, 567, 568, 820, 244, 245, 226, 228, 229, 775, 236, 238, 239, 240, 568, 499, 244, 245, 247, 248, 249, 218, 233, 235, 236, 239, 176, 568, 242, 243, 820, 245, 566, 247, 248, 249, 499, 565, 233, 235, 236, 239, 176, 568, 242, 243, 244, 565, 566, 247, 248, 820, 249, 499, 230, 232, 233, 234, 562, 238, 873, 176, 241, 242, 563, 564, 566, 567, 818, 220, 874, 222, 228, 231, 235, 236, 239, 775, 568, 243, 244, 245, 248, 249, 218, 499, 228, 229, 231, 235, 236, 238, 239, 775, 243, 244, 245, 247, 568, 249, 218, 499, 226, 228, 229, 775, 236, 239, 240, 243, 244, 245, 247, 248, 218, 499, 639, 256, 257, 227, 763, 5, 458, 682, 680, 170, 559, 560, 561, 914, 253, 216, 251, 252, 138, 254, 913, 256, 560, 227, 682, 913, 231, 680, 138, 172, 464, 561, 914, 216, 217, 250, 763, 764, 458, 257, 2, 227, 4, 5, 6, 561, 458, 683, 684, 559, 17, 473, 250, 253, 254, 512, 257, 2, 227, 4, 5, 6, 561, 458, 683, 684, 559, 17, 473, 250, 252, 254, 257, 4, 5, 6, 7, 680, 458, 683, 684, 559, 561, 682, 473, 250, 252, 253, 861, 864, 155, 763, 485, 263, 138, 171, 913, 914, 467, 468, 675, 532, 154, 91, 764, 765, 533, 458, 560, 763, 913, 682, 680, 138, 551, 172, 464, 561, 914, 216, 217, 250, 251, 764, 170, 4, 5, 6, 7, 458, 683, 684, 559, 17, 561, 473, 250, 252, 253, 254, 861, 480, 363, 676, 677, 999, 490, 11, 12, 173, 270, 912, 51, 54, 55, 120, 58, 997, 129, 132, 550, 166, 7, 8, 841, 74, 119, 840, 53, 470, 55, 472, 469, 66, 515, 73, 810, 525, 268, 269, 78, 175, 272, 273, 749, 471, 920, 92, 510, 191, 161, 162, 484, 485, 265, 266, 267, 546, 752, 466, 467, 852, 154, 915, 189, 190, 859, 676, 677, 838, 999, 490, 173, 270, 271, 58, 699, 860, 698, 95, 484, 485, 486, 487, 265, 266, 171, 466, 467, 468, 852, 154, 155, 765, 255, 704, 705, 194, 195, 196, 699, 839, 834, 271, 697, 698, 123, 700, 701, 703, 161, 162, 484, 261, 263, 266, 267, 44, 752, 466, 467, 852, 154, 155, 190, 485, 161, 162, 484, 261, 263, 265, 267, 752, 466, 467, 852, 154, 155, 190, 485, 161, 162, 484, 261, 265, 266, 44, 752, 466, 467, 852, 154, 155, 190, 485, 34, 35, 260, 810, 915, 66, 78, 269, 272, 273, 515, 558, 749, 471, 920, 36, 92, 509, 510, 752, 34, 67, 260, 73, 810, 525, 268, 66, 78, 175, 272, 273, 515, 471, 915, 92, 191, 258, 99, 676, 677, 262, 999, 745, 490, 173, 271, 838, 54, 919, 58, 859, 860, 704, 705, 195, 676, 699, 262, 839, 264, 270, 701, 838, 122, 123, 698, 95, 161, 34, 515, 36, 746, 525, 268, 162, 78, 269, 752, 273, 915, 471, 260, 175, 92, 191, 752, 34, 67, 260, 73, 810, 525, 268, 269, 78, 175, 272, 515, 471, 915, 92, 191, 0, 577, 133, 518, 368, 209, 210, 371, 372, 823, 378, 883, 380, 477, 837, 0, 644, 902, 455, 456, 652, 655, 177, 178, 179, 276, 277, 495, 477, 949, 0, 644, 179, 902, 455, 456, 652, 653, 655, 177, 178, 275, 277, 630, 986, 495, 949, 640, 644, 179, 38, 529, 456, 457, 651, 652, 177, 178, 275, 276, 949, 902, 884, 638, 453, 992, 971, 548, 390, 391, 392, 393, 586, 439, 793, 434, 435, 436, 279, 281, 851, 548, 390, 391, 392, 393, 586, 971, 496, 434, 435, 436, 278, 793, 281, 851, 387, 388, 389, 488, 489, 906, 907, 877, 879, 496, 984, 905, 793, 792, 665, 773, 288, 964, 774, 390, 967, 393, 970, 971, 365, 401, 434, 435, 391, 278, 279, 412, 286, 965, 496, 963, 773, 369, 904, 877, 878, 79, 80, 81, 402, 692, 824, 825, 879, 478, 881, 416, 992, 421, 585, 897, 425, 311, 975, 436, 437, 438, 439, 985, 284, 285, 287, 992, 707, 708, 975, 970, 971, 413, 287, 436, 437, 438, 439, 985, 283, 285, 415, 416, 992, 707, 708, 421, 311, 975, 436, 437, 438, 439, 985, 283, 284, 413, 287, 288, 435, 964, 965, 390, 967, 968, 969, 970, 333, 365, 401, 82, 403, 966, 281, 774, 412, 416, 897, 421, 585, 975, 436, 437, 438, 439, 985, 992, 283, 284, 285, 964, 965, 390, 967, 969, 970, 971, 434, 333, 365, 401, 82, 435, 281, 774, 412, 286, 448, 432, 342, 293, 294, 296, 297, 587, 588, 301, 581, 304, 979, 980, 309, 310, 762, 572, 573, 447, 448, 449, 291, 327, 328, 428, 431, 432, 433, 595, 596, 597, 440, 441, 448, 290, 325, 326, 327, 296, 298, 431, 432, 328, 595, 596, 597, 433, 572, 574, 321, 325, 326, 295, 329, 426, 423, 305, 306, 307, 308, 414, 312, 315, 316, 317, 318, 448, 289, 342, 296, 297, 301, 431, 304, 433, 595, 432, 309, 310, 572, 573, 447, 289, 578, 579, 581, 582, 583, 584, 297, 587, 588, 589, 301, 592, 593, 594, 309, 310, 762, 447, 321, 292, 325, 326, 423, 298, 329, 426, 327, 305, 306, 307, 574, 312, 315, 316, 317, 318, 448, 289, 291, 342, 293, 297, 298, 431, 304, 433, 595, 432, 310, 572, 573, 574, 448, 289, 342, 293, 294, 296, 587, 588, 301, 304, 432, 309, 310, 762, 572, 573, 979, 447, 291, 325, 326, 295, 296, 329, 327, 432, 305, 306, 433, 571, 572, 574, 417, 418, 443, 420, 422, 903, 424, 908, 428, 955, 303, 497, 498, 598, 569, 954, 603, 956, 576, 802, 762, 492, 77, 541, 979, 980, 822, 313, 314, 540, 61, 542, 543, 448, 289, 342, 293, 294, 297, 588, 77, 304, 582, 979, 980, 309, 310, 576, 762, 572, 573, 581, 417, 418, 419, 422, 327, 328, 425, 423, 908, 429, 303, 424, 308, 311, 596, 417, 418, 419, 420, 422, 497, 328, 425, 299, 908, 429, 302, 424, 596, 569, 428, 448, 289, 342, 293, 296, 297, 301, 597, 431, 432, 433, 595, 309, 310, 572, 573, 447, 321, 327, 292, 325, 326, 295, 329, 298, 423, 306, 307, 574, 312, 315, 316, 317, 318, 426, 321, 327, 292, 325, 326, 295, 329, 298, 423, 305, 307, 574, 312, 315, 316, 317, 318, 426, 321, 327, 292, 325, 326, 295, 329, 426, 423, 305, 306, 308, 311, 312, 315, 316, 317, 318, 416, 321, 419, 292, 325, 423, 425, 302, 307, 311, 312, 413, 414, 415, 289, 293, 294, 297, 301, 304, 310, 572, 573, 447, 448, 581, 582, 583, 584, 587, 588, 589, 593, 594, 980, 762, 448, 289, 293, 294, 296, 297, 588, 301, 581, 304, 432, 980, 309, 342, 762, 572, 573, 979, 447, 416, 321, 419, 423, 425, 302, 413, 307, 308, 312, 283, 285, 414, 415, 416, 321, 292, 325, 326, 295, 423, 305, 306, 307, 308, 311, 316, 414, 415, 832, 802, 570, 777, 778, 300, 541, 980, 117, 886, 314, 539, 540, 61, 542, 543, 539, 990, 777, 778, 300, 541, 125, 570, 540, 885, 886, 761, 543, 313, 542, 59, 60, 61, 830, 127, 321, 292, 325, 295, 329, 330, 331, 305, 306, 307, 324, 571, 316, 317, 318, 426, 320, 321, 571, 292, 325, 295, 329, 426, 331, 305, 306, 307, 312, 324, 315, 317, 318, 320, 321, 571, 292, 325, 295, 329, 426, 331, 305, 306, 307, 324, 315, 316, 318, 320, 321, 292, 295, 329, 426, 331, 330, 305, 306, 307, 324, 315, 316, 317, 320, 322, 323, 324, 966, 968, 331, 332, 334, 335, 336, 403, 404, 405, 414, 321, 322, 323, 324, 968, 331, 332, 334, 335, 336, 403, 404, 405, 414, 316, 317, 318, 319, 320, 292, 295, 426, 423, 305, 306, 307, 308, 405, 414, 311, 312, 315, 316, 317, 318, 415, 320, 323, 324, 966, 968, 969, 331, 332, 334, 335, 336, 403, 404, 405, 867, 319, 320, 880, 322, 867, 324, 966, 968, 396, 331, 332, 866, 398, 335, 336, 530, 403, 536, 399, 395, 882, 319, 320, 322, 323, 329, 330, 331, 332, 426, 335, 336, 867, 340, 341, 315, 316, 317, 318, 319, 291, 292, 423, 326, 295, 329, 298, 327, 305, 306, 307, 308, 312, 315, 316, 317, 574, 291, 292, 325, 295, 328, 329, 298, 327, 305, 306, 307, 596, 312, 423, 574, 290, 291, 325, 326, 295, 328, 298, 423, 302, 305, 306, 307, 596, 433, 290, 291, 326, 327, 424, 908, 428, 302, 303, 433, 595, 596, 569, 441, 443, 865, 571, 292, 325, 326, 295, 298, 330, 305, 306, 307, 340, 574, 575, 324, 315, 316, 317, 318, 426, 880, 866, 571, 324, 865, 329, 426, 331, 882, 336, 338, 339, 340, 341, 315, 318, 575, 320, 322, 323, 324, 867, 330, 332, 426, 335, 336, 403, 404, 405, 315, 316, 317, 318, 319, 320, 322, 323, 324, 966, 968, 331, 333, 334, 335, 336, 403, 404, 405, 414, 319, 401, 403, 404, 405, 708, 412, 413, 286, 415, 288, 707, 964, 965, 966, 967, 968, 969, 970, 332, 334, 335, 365, 320, 322, 964, 965, 966, 967, 968, 969, 332, 333, 335, 403, 404, 405, 415, 412, 413, 414, 319, 320, 322, 323, 324, 966, 968, 969, 331, 332, 333, 334, 336, 403, 404, 405, 415, 413, 414, 319, 320, 322, 323, 324, 330, 331, 332, 866, 398, 335, 880, 882, 867, 341, 536, 399, 319, 352, 353, 865, 972, 973, 974, 338, 339, 340, 341, 343, 344, 494, 575, 766, 351, 865, 866, 330, 972, 973, 974, 880, 337, 882, 339, 340, 341, 344, 766, 575, 352, 865, 571, 353, 330, 972, 973, 974, 337, 338, 340, 341, 344, 575, 766, 351, 865, 324, 329, 330, 972, 973, 974, 337, 338, 339, 341, 344, 571, 766, 575, 880, 866, 324, 865, 330, 972, 882, 974, 973, 336, 337, 338, 339, 340, 344, 399, 766, 575, 576, 289, 293, 296, 297, 77, 301, 304, 979, 980, 310, 343, 572, 573, 352, 576, 865, 811, 972, 77, 974, 353, 337, 979, 574, 342, 575, 571, 766, 351, 352, 353, 972, 973, 974, 337, 338, 339, 340, 341, 346, 348, 766, 351, 768, 367, 482, 347, 808, 809, 842, 364, 398, 399, 483, 948, 375, 377, 346, 379, 348, 947, 767, 352, 353, 842, 767, 494, 947, 948, 344, 345, 347, 348, 349, 768, 351, 768, 482, 483, 808, 809, 842, 375, 364, 397, 398, 399, 367, 377, 345, 346, 379, 348, 947, 767, 352, 353, 358, 842, 494, 947, 948, 344, 345, 346, 347, 767, 349, 768, 351, 192, 843, 358, 71, 808, 809, 807, 844, 845, 947, 948, 375, 153, 346, 348, 352, 353, 802, 358, 359, 811, 492, 77, 494, 493, 979, 822, 576, 354, 991, 351, 352, 353, 865, 974, 811, 972, 77, 494, 973, 337, 339, 766, 343, 344, 576, 346, 493, 348, 350, 575, 576, 353, 865, 974, 493, 811, 972, 77, 494, 973, 337, 339, 766, 343, 344, 346, 575, 348, 350, 351, 352, 974, 811, 972, 973, 494, 493, 337, 339, 948, 766, 343, 344, 346, 575, 348, 350, 351, 355, 356, 358, 359, 844, 492, 493, 494, 821, 822, 152, 153, 350, 991, 354, 356, 358, 359, 200, 201, 844, 696, 693, 694, 152, 153, 991, 821, 354, 355, 359, 200, 201, 821, 844, 696, 693, 694, 152, 153, 991, 757, 831, 830, 758, 990, 60, 821, 502, 759, 760, 59, 124, 125, 126, 127, 354, 355, 359, 844, 493, 494, 947, 948, 152, 153, 348, 349, 350, 991, 354, 355, 356, 358, 844, 811, 492, 493, 494, 822, 152, 153, 802, 350, 991, 363, 997, 838, 361, 362, 11, 12, 174, 591, 49, 50, 590, 94, 95, 163, 997, 360, 362, 11, 12, 174, 591, 49, 50, 590, 363, 94, 95, 163, 516, 681, 360, 361, 843, 363, 845, 590, 49, 50, 9, 94, 946, 258, 677, 838, 360, 361, 362, 11, 12, 173, 590, 912, 50, 997, 94, 95, 768, 482, 483, 517, 808, 809, 842, 397, 367, 400, 374, 375, 345, 347, 767, 377, 288, 964, 774, 390, 967, 969, 333, 402, 401, 82, 435, 966, 281, 412, 286, 965, 400, 963, 517, 369, 690, 402, 79, 80, 81, 370, 691, 692, 824, 825, 881, 768, 482, 483, 808, 809, 842, 364, 397, 374, 375, 345, 347, 381, 382, 767, 577, 837, 518, 823, 274, 209, 210, 371, 372, 373, 690, 378, 883, 380, 477, 963, 517, 881, 776, 690, 366, 79, 80, 81, 370, 371, 692, 691, 824, 282, 478, 400, 483, 517, 369, 397, 366, 79, 80, 81, 690, 371, 692, 691, 963, 577, 837, 518, 369, 776, 274, 823, 370, 368, 209, 210, 691, 690, 380, 477, 368, 133, 134, 135, 476, 75, 577, 48, 274, 883, 373, 837, 376, 378, 380, 381, 383, 368, 577, 476, 75, 48, 883, 372, 374, 376, 378, 380, 381, 382, 383, 482, 483, 808, 809, 364, 397, 367, 48, 373, 375, 476, 381, 382, 383, 768, 482, 483, 808, 809, 842, 364, 397, 367, 374, 345, 347, 349, 382, 767, 165, 450, 451, 69, 134, 135, 380, 75, 476, 883, 372, 373, 378, 383, 70, 381, 475, 133, 768, 482, 347, 808, 364, 842, 395, 396, 397, 398, 399, 530, 483, 536, 345, 379, 767, 368, 133, 134, 135, 476, 75, 48, 274, 883, 372, 373, 837, 376, 380, 381, 383, 768, 866, 867, 842, 395, 396, 882, 398, 399, 880, 482, 530, 377, 536, 345, 347, 394, 767, 368, 133, 135, 75, 837, 48, 209, 274, 371, 372, 373, 577, 376, 378, 883, 476, 381, 382, 383, 192, 807, 476, 75, 47, 48, 372, 373, 374, 809, 376, 378, 367, 380, 382, 383, 809, 807, 808, 476, 397, 367, 48, 373, 374, 375, 47, 380, 381, 383, 135, 476, 75, 47, 48, 883, 372, 373, 374, 376, 378, 380, 381, 382, 385, 386, 579, 580, 982, 833, 815, 981, 628, 181, 182, 185, 186, 629, 384, 832, 578, 579, 580, 982, 833, 629, 981, 628, 181, 182, 185, 186, 815, 117, 384, 981, 868, 871, 936, 937, 812, 813, 814, 815, 628, 181, 857, 185, 186, 858, 629, 674, 388, 389, 657, 488, 489, 906, 907, 877, 879, 792, 664, 984, 905, 280, 665, 478, 773, 387, 389, 488, 489, 906, 907, 877, 879, 496, 792, 904, 984, 905, 280, 665, 478, 773, 387, 388, 773, 657, 488, 489, 906, 907, 877, 879, 792, 664, 984, 905, 280, 665, 478, 288, 971, 964, 965, 391, 392, 393, 970, 967, 365, 401, 434, 435, 278, 279, 281, 851, 412, 586, 286, 992, 971, 548, 390, 392, 393, 586, 439, 793, 434, 435, 436, 278, 279, 281, 851, 489, 548, 390, 391, 488, 393, 586, 971, 496, 434, 435, 278, 279, 793, 851, 548, 390, 391, 392, 586, 971, 793, 496, 434, 435, 436, 278, 279, 281, 851, 964, 517, 774, 395, 396, 530, 398, 400, 81, 82, 531, 536, 379, 965, 323, 517, 867, 394, 396, 882, 398, 399, 400, 530, 531, 536, 377, 379, 866, 323, 867, 394, 395, 882, 398, 399, 880, 530, 531, 536, 377, 379, 482, 483, 517, 808, 809, 364, 367, 400, 370, 374, 375, 377, 347, 382, 768, 880, 866, 347, 867, 394, 395, 396, 882, 399, 336, 531, 530, 323, 377, 536, 345, 379, 842, 768, 880, 866, 347, 867, 842, 395, 396, 882, 398, 336, 530, 323, 341, 377, 536, 345, 379, 767, 482, 483, 517, 394, 395, 364, 397, 366, 79, 80, 81, 370, 531, 530, 288, 964, 965, 390, 967, 969, 970, 971, 333, 365, 434, 435, 966, 281, 412, 286, 496, 963, 774, 881, 904, 365, 366, 79, 80, 81, 82, 531, 824, 825, 282, 320, 322, 323, 964, 965, 966, 967, 968, 969, 331, 332, 333, 334, 335, 404, 405, 412, 286, 319, 320, 322, 966, 968, 331, 332, 333, 334, 335, 403, 405, 415, 413, 414, 319, 320, 321, 322, 968, 331, 332, 333, 334, 335, 403, 404, 415, 413, 414, 319, 736, 741, 806, 855, 719, 720, 721, 722, 724, 407, 856, 410, 795, 796, 957, 958, 805, 741, 806, 957, 856, 890, 719, 720, 721, 722, 724, 406, 855, 408, 410, 795, 796, 730, 958, 805, 804, 805, 855, 407, 856, 721, 722, 724, 725, 727, 728, 729, 730, 731, 836, 735, 896, 898, 899, 900, 901, 806, 795, 909, 788, 958, 791, 410, 411, 796, 794, 894, 895, 736, 795, 741, 806, 791, 720, 788, 406, 407, 409, 794, 411, 796, 957, 958, 736, 898, 899, 900, 901, 806, 794, 909, 788, 958, 791, 409, 410, 795, 796, 957, 894, 288, 707, 964, 965, 390, 967, 968, 969, 970, 333, 334, 365, 401, 403, 708, 966, 281, 413, 286, 707, 708, 412, 970, 333, 334, 335, 308, 405, 438, 311, 404, 284, 285, 414, 415, 320, 321, 707, 292, 708, 423, 332, 334, 335, 416, 308, 405, 311, 312, 404, 415, 413, 319, 416, 321, 707, 708, 333, 334, 335, 308, 405, 311, 312, 404, 284, 413, 414, 425, 419, 415, 421, 308, 437, 438, 311, 312, 985, 283, 285, 414, 287, 896, 418, 900, 420, 422, 424, 909, 299, 908, 429, 302, 303, 497, 498, 430, 598, 569, 602, 894, 895, 896, 900, 908, 909, 430, 417, 419, 420, 422, 424, 425, 299, 429, 302, 303, 569, 585, 598, 497, 498, 894, 895, 416, 897, 418, 421, 422, 424, 425, 429, 302, 303, 308, 430, 311, 585, 417, 418, 443, 422, 903, 424, 908, 299, 428, 955, 303, 497, 498, 598, 601, 569, 954, 603, 956, 416, 897, 898, 419, 992, 585, 425, 430, 975, 899, 437, 438, 439, 985, 283, 285, 287, 417, 418, 419, 420, 424, 425, 299, 908, 429, 302, 303, 497, 430, 585, 569, 895, 321, 292, 325, 326, 295, 327, 302, 305, 306, 307, 308, 311, 312, 414, 417, 418, 419, 420, 422, 328, 428, 299, 908, 429, 302, 303, 497, 498, 569, 416, 897, 418, 419, 421, 422, 585, 429, 302, 303, 308, 430, 311, 985, 283, 898, 321, 571, 292, 295, 329, 330, 331, 305, 306, 307, 324, 315, 316, 317, 318, 962, 603, 903, 956, 955, 954, 953, 787, 599, 440, 441, 442, 443, 444, 445, 290, 420, 328, 299, 908, 303, 424, 498, 596, 953, 569, 440, 441, 442, 443, 444, 954, 896, 417, 418, 419, 900, 422, 897, 424, 425, 908, 909, 302, 303, 497, 898, 430, 598, 585, 894, 895, 896, 417, 418, 419, 421, 422, 897, 425, 429, 909, 899, 898, 585, 975, 894, 895, 448, 432, 290, 291, 293, 593, 296, 304, 433, 594, 595, 596, 597, 449, 572, 573, 447, 448, 289, 290, 291, 293, 296, 297, 298, 431, 304, 433, 595, 597, 310, 572, 573, 574, 448, 432, 290, 291, 293, 327, 296, 298, 431, 304, 328, 595, 596, 597, 572, 288, 548, 390, 391, 392, 393, 586, 971, 793, 401, 435, 436, 278, 279, 281, 851, 970, 288, 390, 391, 392, 393, 970, 971, 365, 401, 434, 851, 278, 279, 281, 586, 286, 992, 707, 548, 438, 391, 393, 970, 439, 971, 975, 434, 708, 437, 278, 279, 985, 283, 284, 285, 287, 416, 992, 707, 708, 421, 970, 975, 436, 439, 985, 283, 284, 285, 287, 416, 992, 707, 708, 421, 975, 970, 285, 436, 439, 985, 283, 284, 413, 287, 992, 707, 438, 421, 391, 971, 975, 436, 437, 278, 985, 708, 283, 284, 285, 287, 449, 290, 427, 428, 592, 593, 594, 597, 953, 599, 441, 442, 443, 444, 445, 446, 449, 290, 328, 427, 428, 954, 596, 597, 599, 440, 953, 442, 443, 444, 445, 446, 449, 962, 599, 427, 428, 953, 597, 569, 440, 441, 954, 443, 444, 445, 446, 962, 299, 420, 328, 956, 599, 427, 428, 954, 953, 569, 440, 441, 442, 444, 445, 446, 449, 962, 599, 427, 428, 954, 953, 569, 440, 441, 442, 443, 956, 445, 446, 449, 583, 427, 592, 593, 594, 597, 953, 599, 440, 441, 442, 443, 444, 446, 449, 583, 592, 593, 594, 597, 953, 599, 440, 441, 442, 443, 444, 445, 447, 289, 293, 294, 297, 431, 304, 309, 310, 573, 446, 448, 449, 581, 582, 583, 584, 587, 588, 589, 592, 593, 594, 595, 597, 762, 289, 290, 291, 293, 593, 296, 297, 301, 597, 431, 304, 433, 595, 432, 594, 309, 310, 572, 573, 447, 290, 583, 584, 587, 589, 431, 592, 593, 594, 595, 597, 953, 599, 440, 441, 442, 444, 445, 446, 447, 1, 98, 451, 68, 69, 38, 135, 454, 137, 524, 883, 534, 376, 452, 475, 134, 133, 98, 68, 133, 38, 135, 137, 75, 524, 450, 883, 376, 452, 475, 134, 837, 450, 451, 133, 38, 135, 454, 137, 524, 98, 837, 883, 884, 534, 475, 453, 98, 651, 452, 454, 38, 455, 137, 491, 524, 177, 178, 179, 529, 277, 534, 457, 1, 98, 491, 452, 453, 38, 136, 137, 459, 524, 450, 463, 529, 212, 501, 534, 457, 884, 460, 640, 643, 644, 179, 38, 529, 456, 457, 651, 652, 655, 177, 178, 275, 276, 949, 534, 884, 902, 638, 453, 640, 643, 644, 179, 902, 455, 651, 652, 655, 177, 178, 275, 276, 277, 631, 952, 949, 634, 638, 645, 98, 651, 453, 38, 455, 136, 137, 534, 491, 524, 454, 976, 529, 178, 179, 212, 277, 214, 884, 460, 256, 257, 227, 5, 680, 682, 172, 464, 561, 560, 216, 217, 250, 251, 252, 253, 254, 512, 3, 164, 534, 454, 136, 491, 460, 461, 462, 15, 976, 180, 501, 214, 215, 212, 463, 512, 2, 491, 164, 454, 136, 457, 459, 461, 462, 15, 976, 212, 213, 214, 215, 463, 501, 512, 2, 164, 136, 459, 460, 462, 15, 976, 180, 212, 214, 215, 56, 4, 463, 501, 512, 2, 491, 164, 136, 459, 460, 461, 15, 976, 180, 213, 214, 215, 212, 463, 501, 1, 3, 164, 454, 136, 524, 459, 460, 461, 462, 15, 976, 212, 501, 534, 491, 256, 864, 763, 682, 231, 680, 138, 171, 172, 560, 913, 914, 675, 216, 217, 218, 251, 764, 458, 875, 709, 710, 39, 520, 555, 620, 754, 622, 623, 624, 625, 626, 627, 828, 829, 511, 161, 916, 484, 261, 263, 168, 265, 266, 267, 44, 551, 467, 468, 852, 154, 155, 485, 267, 484, 261, 263, 265, 266, 171, 551, 916, 466, 468, 485, 852, 154, 155, 255, 263, 167, 168, 551, 170, 171, 44, 914, 913, 466, 467, 852, 916, 154, 155, 764, 138, 255, 480, 67, 132, 550, 166, 73, 74, 525, 846, 175, 259, 53, 470, 119, 472, 169, 746, 191, 469, 480, 67, 132, 550, 166, 73, 74, 525, 846, 175, 259, 53, 119, 472, 169, 746, 191, 525, 67, 260, 73, 74, 268, 269, 175, 272, 273, 515, 119, 92, 191, 480, 67, 132, 550, 166, 73, 74, 841, 259, 53, 470, 119, 191, 746, 469, 257, 5, 6, 7, 8, 841, 170, 683, 684, 559, 561, 978, 252, 253, 254, 861, 961, 163, 516, 37, 199, 9, 10, 43, 174, 16, 20, 24, 25, 42, 1, 98, 451, 68, 69, 70, 135, 137, 75, 524, 450, 21, 22, 23, 376, 452, 134, 165, 192, 679, 69, 807, 75, 45, 46, 47, 48, 372, 373, 374, 376, 378, 380, 381, 382, 383, 0, 577, 837, 518, 776, 371, 274, 878, 368, 209, 210, 275, 902, 823, 986, 883, 387, 388, 389, 776, 877, 878, 879, 369, 691, 692, 823, 984, 282, 986, 963, 773, 672, 674, 905, 906, 907, 526, 911, 656, 657, 659, 662, 664, 665, 671, 258, 99, 470, 166, 72, 73, 74, 119, 472, 51, 52, 469, 54, 55, 120, 490, 96, 97, 706, 932, 103, 104, 697, 76, 143, 528, 926, 86, 87, 88, 89, 90, 527, 702, 703, 768, 379, 517, 808, 809, 842, 364, 397, 367, 400, 483, 374, 375, 345, 347, 767, 377, 768, 482, 517, 808, 809, 842, 364, 397, 367, 400, 370, 374, 375, 345, 347, 767, 377, 161, 162, 547, 487, 261, 486, 263, 265, 266, 267, 546, 466, 467, 756, 755, 154, 155, 189, 485, 161, 162, 484, 261, 486, 263, 265, 266, 267, 466, 467, 852, 487, 755, 756, 154, 155, 255, 546, 829, 484, 485, 487, 520, 263, 620, 622, 765, 624, 547, 786, 755, 756, 875, 154, 189, 546, 547, 484, 485, 486, 263, 875, 620, 765, 829, 786, 755, 756, 154, 189, 387, 388, 389, 392, 489, 586, 879, 496, 792, 904, 851, 984, 905, 280, 793, 387, 388, 389, 392, 905, 586, 548, 792, 879, 496, 488, 904, 851, 984, 280, 793, 480, 258, 99, 676, 677, 262, 999, 72, 745, 919, 173, 270, 51, 52, 54, 55, 120, 58, 859, 860, 651, 453, 454, 136, 457, 534, 459, 460, 462, 463, 976, 529, 212, 213, 214, 884, 354, 359, 802, 60, 811, 300, 493, 541, 821, 822, 59, 124, 61, 350, 991, 352, 353, 354, 358, 359, 844, 811, 492, 802, 494, 948, 822, 576, 153, 991, 350, 351, 352, 353, 354, 358, 359, 811, 844, 493, 337, 947, 948, 766, 822, 153, 346, 348, 350, 351, 902, 650, 663, 652, 653, 655, 660, 275, 276, 661, 630, 151, 633, 911, 893, 949, 489, 388, 881, 392, 393, 586, 793, 792, 824, 488, 402, 851, 279, 280, 825, 282, 904, 417, 418, 955, 420, 422, 424, 299, 908, 429, 303, 498, 598, 569, 602, 603, 956, 895, 417, 418, 955, 420, 903, 424, 908, 299, 428, 497, 789, 598, 601, 600, 569, 602, 603, 956, 954, 226, 228, 229, 230, 568, 235, 236, 238, 239, 240, 241, 243, 244, 245, 775, 247, 248, 249, 639, 32, 33, 996, 197, 198, 513, 160, 847, 848, 983, 503, 504, 31, 158, 159, 1, 3, 164, 454, 524, 459, 460, 461, 462, 15, 16, 180, 56, 68, 463, 831, 521, 357, 990, 60, 821, 523, 759, 125, 886, 830, 758, 885, 760, 761, 59, 124, 61, 126, 127, 32, 33, 996, 197, 198, 513, 160, 847, 848, 500, 30, 983, 504, 505, 31, 988, 989, 158, 159, 32, 33, 993, 996, 197, 102, 513, 988, 989, 995, 500, 503, 505, 998, 198, 29, 30, 31, 32, 65, 995, 996, 998, 102, 993, 989, 503, 504, 988, 29, 30, 31, 718, 783, 751, 139, 711, 203, 923, 141, 110, 111, 112, 113, 114, 142, 950, 922, 205, 508, 507, 783, 923, 711, 203, 141, 142, 205, 83, 718, 950, 506, 751, 508, 922, 783, 923, 711, 203, 141, 142, 143, 205, 83, 782, 950, 506, 507, 922, 751, 750, 34, 35, 772, 748, 810, 747, 268, 66, 78, 977, 558, 918, 826, 510, 750, 34, 35, 36, 810, 747, 268, 66, 78, 749, 977, 558, 772, 260, 826, 509, 864, 39, 875, 620, 622, 623, 624, 465, 626, 627, 532, 533, 625, 91, 829, 2, 4, 136, 684, 459, 460, 461, 462, 976, 17, 180, 213, 214, 215, 253, 32, 33, 197, 198, 160, 847, 848, 849, 500, 983, 503, 504, 159, 158, 31, 779, 780, 781, 14, 921, 537, 538, 798, 934, 943, 184, 827, 833, 835, 535, 140, 987, 108, 109, 115, 116, 121, 66, 67, 260, 73, 810, 525, 268, 269, 78, 175, 272, 273, 471, 920, 92, 191, 129, 163, 37, 961, 9, 10, 43, 12, 174, 912, 50, 474, 362, 42, 94, 400, 482, 483, 369, 394, 395, 364, 397, 366, 79, 80, 81, 370, 531, 690, 530, 0, 577, 837, 776, 823, 274, 878, 368, 209, 210, 371, 691, 690, 986, 477, 64, 65, 995, 101, 102, 993, 156, 850, 918, 998, 26, 27, 28, 29, 62, 63, 620, 786, 545, 547, 678, 753, 554, 555, 556, 755, 828, 829, 709, 465, 486, 875, 876, 621, 622, 623, 625, 626, 627, 756, 193, 194, 502, 522, 523, 204, 784, 785, 886, 933, 830, 150, 885, 761, 126, 831, 193, 194, 523, 118, 521, 107, 204, 784, 785, 84, 150, 761, 933, 831, 193, 194, 886, 521, 522, 759, 204, 758, 784, 785, 933, 830, 502, 885, 760, 761, 831, 125, 126, 127, 1, 98, 451, 68, 133, 38, 454, 137, 450, 463, 884, 501, 534, 457, 452, 475, 453, 67, 260, 166, 73, 74, 471, 269, 846, 175, 272, 273, 515, 469, 470, 119, 92, 746, 191, 672, 801, 674, 906, 911, 656, 657, 658, 659, 662, 663, 664, 671, 479, 481, 706, 932, 103, 104, 76, 782, 143, 528, 86, 87, 88, 697, 90, 702, 96, 97, 706, 103, 104, 983, 76, 527, 481, 86, 87, 88, 90, 143, 651, 453, 38, 455, 136, 137, 534, 491, 454, 976, 178, 179, 212, 277, 214, 457, 884, 880, 866, 323, 517, 867, 394, 395, 396, 398, 399, 400, 882, 531, 536, 377, 379, 964, 517, 774, 969, 394, 395, 396, 402, 398, 400, 81, 82, 536, 530, 965, 864, 675, 829, 231, 39, 172, 255, 624, 533, 217, 218, 91, 765, 511, 864, 675, 829, 231, 39, 255, 624, 626, 627, 532, 218, 91, 765, 511, 98, 491, 452, 453, 38, 455, 454, 137, 459, 524, 450, 463, 529, 179, 884, 457, 514, 941, 869, 870, 935, 780, 940, 140, 109, 942, 781, 115, 934, 183, 184, 943, 880, 866, 323, 867, 394, 395, 396, 882, 398, 399, 336, 530, 531, 377, 379, 833, 514, 835, 987, 779, 108, 109, 14, 781, 116, 921, 121, 538, 827, 798, 832, 833, 514, 835, 779, 116, 117, 982, 537, 798, 121, 570, 539, 542, 181, 832, 570, 777, 202, 541, 778, 117, 886, 313, 314, 540, 538, 542, 543, 832, 802, 570, 581, 762, 300, 980, 117, 822, 313, 314, 539, 541, 542, 543, 802, 581, 492, 300, 762, 979, 980, 117, 822, 313, 314, 539, 540, 570, 542, 543, 832, 570, 314, 777, 202, 300, 778, 117, 886, 313, 538, 539, 540, 541, 543, 570, 777, 778, 300, 61, 885, 886, 313, 314, 539, 540, 541, 542, 127, 641, 226, 228, 229, 668, 237, 686, 685, 240, 817, 211, 910, 642, 873, 636, 639, 546, 547, 678, 520, 876, 554, 555, 556, 557, 552, 786, 755, 553, 875, 828, 189, 545, 162, 547, 484, 261, 486, 161, 487, 876, 786, 755, 756, 189, 190, 545, 546, 484, 678, 486, 487, 520, 875, 876, 786, 755, 756, 189, 190, 992, 489, 391, 392, 393, 586, 975, 905, 434, 851, 436, 278, 279, 793, 794, 612, 742, 615, 616, 206, 207, 208, 853, 854, 799, 188, 797, 606, 607, 259, 132, 166, 167, 168, 169, 170, 44, 846, 916, 53, 470, 841, 472, 746, 469, 256, 763, 167, 168, 169, 138, 171, 914, 913, 466, 467, 468, 852, 916, 155, 764, 170, 545, 709, 678, 553, 554, 555, 556, 557, 876, 621, 710, 753, 754, 828, 545, 709, 678, 552, 876, 554, 555, 556, 557, 621, 710, 753, 754, 828, 545, 709, 678, 753, 552, 553, 555, 556, 557, 876, 621, 710, 520, 754, 828, 545, 709, 678, 552, 520, 553, 554, 556, 557, 876, 621, 710, 465, 754, 753, 828, 545, 709, 678, 753, 552, 553, 554, 555, 876, 557, 621, 710, 520, 754, 828, 545, 709, 678, 552, 553, 554, 555, 556, 621, 876, 710, 753, 754, 828, 34, 35, 36, 101, 810, 268, 78, 977, 915, 918, 772, 826, 509, 510, 257, 682, 5, 6, 167, 680, 841, 170, 683, 684, 561, 473, 250, 252, 253, 254, 256, 913, 227, 763, 682, 680, 138, 172, 464, 561, 914, 216, 217, 250, 251, 458, 256, 257, 227, 5, 682, 680, 458, 684, 559, 560, 216, 473, 250, 251, 252, 253, 254, 566, 230, 232, 233, 874, 818, 176, 242, 563, 564, 565, 246, 567, 820, 220, 222, 230, 232, 873, 234, 818, 241, 562, 564, 246, 567, 220, 874, 222, 223, 566, 230, 232, 233, 874, 562, 176, 241, 242, 563, 820, 565, 246, 567, 818, 220, 222, 820, 232, 233, 235, 562, 239, 176, 242, 244, 245, 566, 567, 568, 564, 820, 232, 233, 235, 236, 562, 239, 176, 242, 244, 245, 246, 567, 568, 564, 565, 566, 230, 232, 233, 235, 562, 176, 242, 563, 564, 565, 246, 820, 818, 233, 235, 236, 239, 176, 242, 243, 244, 245, 566, 247, 248, 820, 499, 565, 417, 418, 603, 420, 422, 497, 328, 908, 299, 428, 955, 303, 424, 498, 956, 442, 443, 444, 954, 832, 314, 777, 202, 778, 117, 886, 313, 538, 539, 540, 541, 542, 543, 865, 329, 298, 972, 330, 339, 340, 343, 575, 315, 316, 317, 574, 426, 448, 289, 291, 342, 293, 296, 297, 298, 301, 431, 304, 433, 432, 309, 310, 979, 573, 574, 448, 289, 342, 293, 296, 297, 301, 77, 304, 432, 309, 310, 979, 576, 762, 431, 572, 574, 447, 865, 291, 325, 326, 295, 296, 329, 298, 432, 305, 306, 343, 571, 572, 573, 352, 353, 865, 329, 330, 972, 973, 974, 337, 338, 339, 340, 341, 343, 571, 766, 351, 352, 802, 822, 811, 300, 301, 77, 979, 980, 766, 342, 343, 493, 573, 350, 351, 837, 518, 691, 823, 274, 368, 209, 210, 371, 372, 373, 690, 883, 380, 477, 832, 385, 579, 580, 581, 294, 583, 584, 588, 587, 582, 589, 592, 117, 762, 384, 385, 578, 580, 581, 294, 583, 584, 588, 587, 582, 589, 592, 117, 982, 185, 832, 384, 385, 578, 579, 581, 582, 583, 584, 588, 589, 592, 117, 982, 185, 186, 832, 289, 578, 579, 580, 582, 294, 584, 587, 588, 301, 589, 980, 117, 310, 762, 447, 540, 541, 309, 832, 578, 579, 580, 581, 294, 583, 584, 587, 588, 301, 589, 592, 117, 762, 447, 309, 449, 578, 579, 580, 294, 582, 584, 587, 588, 589, 597, 592, 593, 594, 309, 599, 953, 445, 446, 447, 449, 578, 579, 580, 581, 294, 583, 588, 587, 582, 589, 592, 593, 594, 309, 762, 447, 896, 897, 418, 419, 421, 422, 425, 429, 430, 975, 895, 899, 898, 283, 894, 287, 489, 548, 390, 391, 392, 393, 496, 488, 434, 435, 278, 279, 792, 793, 851, 588, 289, 578, 579, 581, 294, 449, 584, 297, 583, 582, 589, 592, 593, 594, 309, 762, 447, 289, 578, 579, 580, 581, 294, 583, 584, 297, 587, 582, 301, 589, 980, 309, 310, 762, 447, 449, 578, 579, 580, 581, 294, 583, 584, 588, 587, 582, 592, 593, 594, 309, 762, 447, 363, 677, 838, 360, 361, 362, 11, 12, 173, 591, 50, 57, 58, 997, 94, 95, 838, 200, 201, 695, 590, 360, 757, 693, 694, 361, 696, 57, 122, 123, 95, 449, 578, 579, 580, 294, 582, 583, 584, 587, 589, 593, 594, 597, 599, 440, 953, 445, 446, 447, 448, 449, 294, 583, 584, 587, 589, 597, 431, 592, 594, 595, 309, 599, 440, 445, 446, 447, 448, 449, 294, 583, 584, 587, 589, 597, 431, 592, 593, 595, 309, 440, 445, 446, 447, 448, 449, 290, 291, 293, 593, 328, 304, 431, 432, 433, 594, 596, 597, 447, 296, 290, 291, 326, 327, 328, 908, 428, 302, 303, 433, 595, 597, 441, 431, 448, 449, 290, 291, 432, 583, 304, 431, 592, 433, 594, 595, 596, 593, 440, 441, 442, 445, 446, 447, 896, 900, 901, 903, 909, 789, 790, 791, 417, 418, 420, 299, 429, 955, 600, 601, 602, 603, 497, 498, 894, 895, 449, 962, 583, 427, 954, 445, 592, 593, 953, 441, 440, 185, 186, 443, 444, 442, 446, 960, 955, 790, 903, 959, 498, 789, 598, 601, 602, 603, 956, 605, 901, 955, 420, 790, 903, 959, 498, 789, 598, 600, 900, 602, 603, 956, 901, 417, 955, 900, 790, 903, 909, 497, 498, 789, 598, 600, 601, 603, 956, 901, 895, 962, 427, 420, 790, 903, 299, 497, 498, 789, 598, 569, 600, 601, 602, 955, 956, 954, 608, 609, 610, 611, 612, 613, 962, 206, 207, 208, 787, 960, 959, 187, 188, 605, 606, 607, 608, 960, 610, 611, 612, 613, 614, 743, 744, 617, 618, 619, 616, 888, 739, 789, 742, 600, 604, 959, 608, 609, 610, 611, 612, 549, 615, 604, 613, 206, 207, 208, 787, 853, 854, 959, 187, 188, 797, 607, 608, 609, 610, 611, 612, 549, 615, 616, 604, 206, 207, 208, 787, 853, 854, 617, 187, 188, 797, 606, 613, 960, 609, 610, 611, 612, 613, 614, 615, 616, 617, 618, 206, 207, 208, 742, 787, 959, 604, 605, 606, 607, 608, 960, 610, 611, 612, 613, 615, 188, 206, 207, 208, 787, 853, 854, 959, 187, 604, 606, 607, 608, 609, 962, 611, 612, 613, 615, 188, 206, 207, 208, 787, 960, 959, 187, 604, 605, 606, 607, 608, 609, 610, 612, 613, 614, 615, 616, 617, 618, 206, 207, 208, 742, 787, 960, 959, 604, 605, 606, 607, 608, 609, 610, 611, 960, 549, 615, 616, 618, 613, 206, 207, 208, 787, 854, 959, 604, 605, 606, 607, 608, 609, 610, 611, 612, 614, 615, 616, 617, 618, 619, 206, 207, 208, 787, 960, 959, 604, 605, 606, 607, 608, 960, 611, 740, 613, 742, 743, 616, 617, 618, 619, 744, 739, 888, 605, 959, 608, 609, 610, 611, 612, 549, 742, 616, 617, 618, 613, 206, 207, 208, 853, 854, 797, 606, 607, 608, 611, 612, 549, 614, 615, 744, 617, 618, 619, 613, 206, 207, 208, 742, 854, 888, 740, 799, 605, 607, 608, 960, 611, 613, 614, 615, 616, 618, 619, 743, 744, 206, 207, 208, 742, 888, 605, 607, 608, 960, 611, 612, 613, 614, 615, 616, 617, 619, 744, 743, 742, 888, 605, 959, 960, 737, 739, 740, 613, 614, 743, 616, 617, 618, 744, 742, 888, 605, 959, 875, 755, 486, 487, 520, 39, 622, 623, 624, 465, 626, 627, 756, 625, 828, 829, 511, 709, 678, 753, 552, 553, 554, 555, 556, 557, 876, 710, 520, 754, 828, 755, 486, 39, 520, 876, 875, 620, 623, 624, 465, 626, 627, 756, 625, 828, 829, 511, 39, 520, 875, 620, 622, 624, 465, 626, 627, 756, 625, 828, 829, 511, 829, 486, 39, 875, 620, 622, 623, 465, 626, 627, 532, 533, 625, 756, 91, 765, 511, 39, 520, 875, 620, 622, 623, 624, 465, 626, 756, 91, 828, 829, 511, 710, 39, 520, 875, 620, 622, 623, 624, 465, 754, 627, 533, 625, 91, 828, 829, 511, 39, 520, 875, 620, 622, 623, 624, 465, 626, 756, 533, 91, 828, 829, 511, 384, 385, 386, 981, 868, 982, 871, 936, 937, 812, 813, 814, 815, 181, 182, 183, 185, 186, 858, 629, 384, 385, 386, 868, 982, 871, 936, 937, 812, 813, 814, 815, 628, 181, 182, 185, 186, 981, 643, 644, 645, 902, 650, 652, 653, 495, 276, 949, 151, 952, 633, 634, 655, 893, 661, 640, 225, 643, 644, 645, 646, 456, 668, 952, 632, 633, 634, 635, 636, 638, 640, 643, 645, 646, 668, 237, 685, 817, 213, 631, 952, 633, 634, 635, 636, 638, 640, 643, 644, 645, 646, 649, 650, 151, 653, 495, 952, 630, 631, 632, 634, 655, 893, 638, 640, 643, 644, 645, 646, 456, 650, 151, 655, 952, 630, 631, 632, 633, 635, 636, 638, 645, 646, 668, 237, 910, 685, 817, 952, 213, 631, 632, 634, 636, 638, 544, 645, 646, 237, 686, 685, 817, 213, 631, 632, 634, 635, 668, 910, 224, 225, 642, 641, 873, 234, 685, 910, 687, 816, 817, 211, 689, 219, 668, 223, 640, 643, 644, 645, 646, 455, 456, 651, 655, 952, 179, 277, 631, 632, 633, 634, 635, 949, 544, 226, 228, 229, 910, 775, 237, 238, 685, 240, 241, 499, 686, 249, 668, 643, 644, 645, 646, 455, 456, 651, 655, 952, 179, 277, 631, 632, 633, 634, 638, 949, 224, 225, 642, 668, 234, 873, 685, 910, 687, 816, 817, 211, 544, 219, 220, 637, 222, 223, 224, 225, 641, 873, 234, 685, 686, 687, 816, 817, 211, 910, 544, 668, 637, 223, 640, 644, 645, 646, 455, 456, 650, 651, 652, 655, 952, 179, 949, 630, 631, 632, 633, 634, 638, 640, 643, 645, 646, 650, 651, 652, 655, 275, 276, 277, 902, 177, 178, 179, 949, 952, 455, 456, 630, 631, 633, 634, 638, 640, 643, 644, 646, 456, 650, 655, 952, 630, 631, 632, 633, 634, 635, 636, 638, 640, 643, 644, 645, 668, 817, 952, 631, 632, 633, 634, 635, 636, 638, 224, 225, 648, 649, 650, 654, 893, 688, 689, 658, 660, 151, 669, 670, 225, 647, 649, 650, 663, 654, 911, 656, 658, 659, 660, 661, 151, 893, 670, 671, 224, 225, 647, 648, 650, 654, 688, 689, 658, 660, 151, 633, 893, 670, 643, 644, 645, 647, 648, 649, 653, 495, 660, 661, 630, 151, 952, 633, 634, 655, 893, 949, 640, 643, 644, 453, 455, 456, 457, 491, 976, 529, 178, 179, 212, 213, 214, 638, 277, 0, 643, 644, 179, 902, 455, 456, 653, 495, 177, 178, 275, 276, 277, 630, 655, 949, 902, 650, 663, 652, 495, 660, 276, 661, 630, 151, 633, 655, 893, 949, 224, 225, 656, 819, 647, 648, 649, 669, 688, 689, 658, 659, 660, 951, 673, 666, 891, 221, 670, 640, 643, 644, 645, 902, 455, 456, 650, 652, 653, 495, 177, 178, 275, 276, 949, 630, 151, 633, 634, 638, 672, 801, 891, 862, 648, 654, 658, 659, 660, 526, 951, 666, 671, 669, 670, 479, 674, 387, 389, 905, 906, 907, 526, 911, 659, 662, 663, 664, 665, 671, 479, 672, 801, 674, 647, 648, 649, 654, 911, 656, 661, 659, 660, 526, 662, 663, 893, 670, 671, 672, 801, 674, 648, 526, 911, 656, 657, 658, 660, 654, 662, 664, 671, 479, 647, 648, 649, 650, 663, 653, 654, 495, 656, 658, 659, 661, 662, 151, 911, 893, 670, 671, 0, 674, 662, 648, 650, 663, 653, 495, 658, 660, 630, 151, 664, 986, 911, 893, 674, 773, 906, 907, 877, 526, 911, 657, 658, 659, 660, 661, 663, 664, 665, 671, 479, 674, 648, 653, 526, 495, 657, 658, 660, 661, 662, 151, 664, 665, 911, 893, 671, 674, 387, 911, 389, 906, 907, 877, 526, 879, 657, 659, 661, 662, 663, 665, 671, 479, 674, 387, 388, 389, 664, 907, 877, 879, 657, 773, 662, 663, 280, 984, 911, 906, 479, 672, 673, 667, 801, 688, 891, 654, 669, 656, 689, 819, 862, 951, 219, 892, 221, 670, 863, 673, 891, 669, 688, 689, 819, 862, 951, 666, 219, 892, 221, 670, 863, 544, 641, 642, 646, 237, 686, 685, 816, 817, 211, 910, 631, 632, 635, 636, 637, 639, 672, 673, 667, 647, 688, 891, 654, 656, 689, 801, 819, 862, 951, 666, 219, 892, 221, 670, 863, 647, 648, 649, 654, 656, 658, 660, 666, 667, 669, 672, 801, 688, 689, 819, 951, 673, 219, 221, 862, 863, 224, 225, 891, 892, 672, 801, 674, 648, 526, 911, 656, 657, 658, 659, 660, 662, 663, 664, 479, 801, 863, 891, 526, 656, 658, 659, 862, 951, 666, 479, 892, 669, 670, 671, 801, 667, 891, 654, 669, 688, 689, 819, 862, 951, 666, 219, 892, 221, 670, 863, 387, 906, 907, 877, 526, 911, 657, 658, 659, 661, 662, 663, 664, 665, 671, 479, 864, 763, 231, 138, 171, 464, 913, 532, 533, 217, 218, 91, 764, 765, 255, 258, 99, 677, 262, 999, 745, 490, 173, 270, 271, 54, 919, 58, 859, 860, 258, 363, 676, 997, 262, 999, 490, 11, 12, 173, 270, 912, 51, 590, 54, 55, 120, 58, 95, 545, 547, 709, 710, 753, 520, 553, 554, 555, 556, 557, 876, 621, 552, 754, 786, 828, 192, 845, 843, 69, 70, 71, 681, 199, 45, 46, 47, 49, 946, 807, 25, 476, 93, 165, 256, 560, 227, 763, 5, 913, 682, 138, 172, 559, 464, 561, 914, 216, 217, 250, 251, 458, 254, 192, 843, 845, 71, 362, 679, 45, 46, 47, 49, 946, 807, 25, 93, 256, 560, 227, 5, 913, 763, 680, 138, 172, 559, 464, 561, 914, 216, 217, 250, 251, 458, 254, 257, 5, 6, 7, 8, 684, 978, 559, 840, 17, 18, 473, 252, 253, 254, 861, 512, 257, 2, 227, 4, 5, 6, 561, 683, 559, 17, 180, 473, 252, 253, 254, 544, 641, 642, 668, 237, 686, 816, 817, 211, 910, 632, 635, 636, 637, 639, 544, 226, 228, 229, 817, 668, 775, 237, 238, 685, 240, 241, 211, 910, 642, 636, 639, 224, 641, 642, 234, 637, 688, 689, 211, 819, 219, 816, 221, 222, 223, 224, 225, 667, 647, 649, 891, 654, 669, 689, 687, 819, 951, 673, 666, 219, 892, 221, 670, 863, 224, 225, 863, 667, 647, 649, 654, 669, 688, 687, 819, 673, 666, 219, 221, 670, 637, 577, 963, 517, 518, 369, 80, 366, 79, 368, 209, 370, 371, 692, 691, 577, 963, 518, 369, 776, 823, 370, 366, 79, 209, 210, 371, 692, 878, 690, 986, 478, 963, 773, 881, 776, 690, 366, 79, 80, 369, 370, 691, 878, 824, 825, 282, 904, 986, 478, 355, 356, 839, 200, 201, 591, 696, 757, 694, 695, 152, 57, 122, 123, 355, 356, 839, 200, 201, 591, 696, 693, 695, 152, 57, 122, 123, 757, 704, 758, 838, 839, 200, 201, 591, 760, 693, 694, 759, 696, 57, 122, 123, 757, 355, 356, 839, 200, 201, 591, 693, 694, 695, 152, 57, 122, 123, 757, 96, 97, 195, 196, 103, 104, 76, 527, 705, 264, 481, 86, 87, 89, 90, 932, 704, 701, 702, 703, 704, 705, 834, 195, 196, 262, 839, 264, 271, 89, 699, 700, 701, 926, 703, 704, 705, 834, 195, 262, 264, 994, 271, 89, 698, 700, 701, 926, 927, 96, 97, 834, 928, 929, 264, 76, 994, 701, 705, 703, 771, 89, 698, 699, 704, 90, 926, 927, 704, 705, 834, 195, 196, 264, 932, 271, 89, 697, 698, 699, 700, 702, 703, 96, 97, 195, 196, 701, 103, 104, 76, 527, 481, 86, 87, 88, 697, 90, 932, 89, 703, 96, 97, 195, 932, 481, 264, 87, 76, 704, 701, 705, 926, 86, 697, 89, 90, 700, 698, 702, 705, 194, 195, 196, 839, 264, 271, 123, 695, 697, 698, 699, 700, 701, 703, 704, 194, 195, 196, 839, 264, 932, 271, 697, 698, 699, 700, 701, 703, 481, 103, 104, 711, 76, 782, 143, 528, 86, 87, 88, 90, 527, 751, 708, 412, 970, 971, 333, 413, 436, 437, 438, 439, 985, 284, 285, 414, 415, 707, 412, 970, 971, 333, 413, 436, 437, 438, 439, 985, 284, 285, 414, 415, 710, 678, 753, 552, 553, 554, 555, 556, 557, 621, 465, 754, 828, 520, 709, 678, 753, 552, 553, 554, 555, 556, 557, 621, 465, 626, 754, 828, 783, 706, 104, 203, 141, 142, 143, 782, 950, 88, 506, 507, 508, 922, 751, 715, 716, 872, 713, 714, 139, 108, 109, 14, 144, 145, 146, 147, 148, 921, 987, 924, 925, 715, 925, 712, 716, 202, 107, 108, 14, 872, 145, 146, 150, 121, 827, 924, 714, 715, 716, 712, 713, 139, 108, 109, 14, 144, 145, 146, 147, 148, 872, 921, 987, 924, 925, 716, 712, 713, 714, 139, 108, 109, 14, 144, 145, 146, 147, 148, 872, 921, 987, 924, 925, 715, 712, 713, 714, 139, 108, 109, 144, 872, 147, 148, 921, 987, 924, 925, 803, 100, 105, 106, 139, 923, 13, 718, 205, 144, 83, 85, 922, 783, 751, 149, 783, 717, 203, 147, 105, 106, 139, 13, 141, 142, 205, 144, 923, 83, 85, 950, 506, 507, 922, 149, 736, 737, 739, 741, 806, 743, 744, 720, 721, 722, 724, 725, 406, 407, 890, 957, 958, 736, 739, 741, 806, 957, 719, 721, 722, 724, 406, 407, 410, 795, 796, 890, 958, 805, 727, 406, 407, 408, 796, 805, 806, 957, 958, 719, 720, 722, 724, 725, 855, 856, 729, 730, 731, 735, 736, 741, 890, 736, 741, 806, 957, 805, 727, 719, 720, 721, 724, 725, 406, 407, 408, 730, 731, 890, 958, 735, 799, 800, 804, 887, 889, 836, 725, 726, 727, 728, 729, 731, 732, 733, 734, 735, 406, 407, 408, 805, 806, 957, 958, 719, 720, 721, 722, 725, 726, 727, 730, 731, 735, 736, 737, 738, 739, 741, 890, 408, 804, 805, 836, 719, 721, 722, 723, 724, 726, 727, 728, 729, 730, 731, 732, 733, 734, 735, 737, 738, 739, 740, 741, 889, 890, 799, 737, 738, 740, 836, 887, 800, 889, 723, 724, 725, 727, 728, 729, 890, 731, 732, 733, 734, 735, 408, 800, 804, 805, 836, 721, 722, 723, 724, 725, 726, 728, 729, 730, 731, 732, 733, 734, 735, 737, 738, 740, 887, 889, 890, 799, 800, 804, 887, 855, 889, 856, 723, 836, 725, 726, 727, 408, 729, 730, 731, 732, 733, 734, 735, 727, 728, 408, 800, 804, 805, 836, 721, 723, 725, 726, 855, 856, 730, 731, 732, 733, 734, 735, 738, 887, 889, 804, 741, 855, 805, 407, 728, 856, 721, 722, 724, 725, 727, 408, 729, 731, 735, 408, 804, 805, 836, 721, 722, 723, 724, 725, 726, 727, 728, 729, 730, 732, 733, 734, 735, 737, 738, 740, 887, 889, 890, 799, 800, 804, 887, 889, 723, 836, 725, 726, 727, 728, 729, 731, 733, 734, 735, 799, 800, 804, 887, 889, 723, 836, 725, 726, 727, 728, 729, 731, 732, 734, 735, 799, 800, 738, 836, 887, 889, 723, 804, 725, 726, 727, 728, 729, 731, 732, 733, 735, 727, 856, 408, 800, 804, 805, 836, 721, 722, 723, 724, 725, 726, 855, 728, 729, 730, 731, 732, 733, 734, 738, 887, 889, 739, 741, 806, 743, 744, 957, 719, 720, 721, 722, 724, 406, 410, 411, 890, 958, 738, 739, 740, 742, 743, 744, 619, 719, 724, 725, 726, 727, 888, 890, 731, 799, 737, 739, 740, 742, 743, 744, 889, 724, 725, 726, 727, 888, 729, 890, 731, 800, 734, 735, 736, 737, 738, 740, 741, 614, 743, 744, 957, 619, 719, 720, 724, 725, 888, 890, 605, 737, 738, 739, 742, 614, 743, 616, 619, 744, 725, 726, 727, 888, 890, 731, 799, 736, 739, 805, 806, 957, 890, 719, 720, 721, 722, 724, 725, 406, 407, 410, 796, 730, 958, 608, 737, 738, 611, 740, 549, 614, 615, 616, 617, 618, 619, 744, 888, 605, 799, 736, 737, 738, 739, 740, 614, 744, 617, 618, 619, 957, 719, 888, 890, 605, 736, 737, 738, 739, 740, 742, 614, 743, 616, 617, 618, 619, 719, 960, 888, 890, 605, 66, 99, 676, 999, 72, 490, 749, 270, 52, 54, 919, 920, 859, 860, 67, 550, 166, 168, 169, 469, 44, 525, 846, 175, 272, 916, 53, 470, 841, 472, 92, 191, 769, 770, 35, 772, 826, 748, 930, 750, 977, 931, 131, 917, 850, 26, 156, 509, 510, 769, 770, 131, 929, 747, 930, 750, 977, 850, 931, 917, 826, 771, 26, 156, 509, 62, 66, 99, 260, 72, 745, 268, 78, 52, 750, 919, 920, 859, 860, 510, 769, 66, 35, 772, 747, 748, 749, 977, 931, 131, 917, 920, 770, 509, 510, 930, 783, 706, 100, 103, 104, 105, 711, 203, 141, 142, 143, 205, 83, 85, 950, 717, 782, 506, 507, 508, 922, 161, 34, 36, 261, 265, 266, 267, 162, 269, 272, 273, 915, 852, 190, 709, 678, 552, 553, 554, 555, 556, 557, 876, 621, 710, 520, 754, 828, 709, 710, 465, 552, 553, 554, 555, 556, 557, 621, 753, 626, 828, 678, 545, 546, 547, 484, 485, 486, 487, 520, 875, 620, 622, 829, 786, 756, 189, 546, 547, 484, 485, 486, 487, 520, 875, 620, 622, 623, 624, 625, 786, 627, 765, 755, 829, 189, 356, 758, 838, 839, 200, 201, 591, 693, 694, 695, 696, 57, 122, 123, 831, 357, 201, 523, 759, 124, 757, 502, 695, 760, 123, 60, 125, 126, 821, 194, 196, 357, 201, 523, 502, 124, 821, 758, 695, 760, 123, 60, 125, 126, 831, 357, 990, 124, 523, 695, 758, 821, 502, 759, 201, 60, 125, 126, 831, 193, 522, 886, 990, 521, 202, 523, 777, 785, 778, 830, 502, 885, 933, 314, 831, 125, 126, 127, 289, 578, 581, 294, 584, 588, 587, 300, 301, 589, 582, 980, 309, 310, 297, 573, 540, 541, 447, 256, 560, 675, 231, 680, 551, 138, 171, 172, 464, 913, 914, 216, 217, 250, 251, 764, 682, 255, 256, 864, 675, 231, 551, 138, 171, 172, 464, 913, 914, 468, 251, 217, 763, 255, 864, 675, 486, 263, 171, 487, 624, 532, 533, 756, 154, 91, 829, 255, 352, 353, 865, 974, 811, 972, 77, 494, 973, 337, 338, 339, 340, 341, 343, 344, 576, 575, 351, 768, 482, 379, 808, 809, 842, 364, 948, 367, 483, 399, 375, 345, 346, 347, 348, 947, 377, 482, 379, 808, 842, 364, 767, 398, 367, 483, 399, 375, 345, 346, 347, 348, 947, 377, 770, 131, 101, 156, 747, 748, 930, 750, 977, 850, 931, 918, 826, 26, 28, 157, 62, 63, 928, 769, 930, 131, 929, 747, 748, 750, 977, 850, 771, 917, 26, 931, 156, 157, 96, 928, 770, 131, 994, 929, 930, 748, 834, 917, 89, 700, 926, 927, 750, 34, 35, 36, 101, 558, 156, 810, 747, 78, 977, 510, 918, 826, 26, 27, 28, 509, 62, 387, 388, 389, 776, 907, 877, 878, 879, 984, 692, 662, 280, 665, 282, 986, 478, 288, 964, 965, 881, 904, 394, 967, 365, 402, 80, 81, 82, 531, 825, 824, 281, 286, 226, 227, 228, 229, 215, 237, 686, 499, 240, 248, 243, 247, 216, 249, 639, 0, 773, 518, 369, 371, 878, 209, 210, 691, 692, 823, 986, 477, 478, 193, 933, 202, 127, 778, 885, 830, 886, 761, 313, 314, 539, 570, 542, 543, 193, 933, 777, 202, 127, 885, 830, 886, 761, 313, 314, 539, 570, 542, 543, 833, 514, 835, 987, 108, 109, 14, 781, 921, 116, 537, 121, 538, 827, 924, 798, 514, 987, 934, 870, 935, 183, 140, 109, 942, 781, 115, 535, 184, 943, 798, 869, 833, 514, 779, 537, 934, 780, 535, 140, 109, 987, 943, 921, 115, 116, 183, 184, 121, 835, 827, 798, 783, 706, 100, 103, 104, 105, 711, 141, 143, 83, 86, 87, 88, 922, 527, 508, 751, 718, 149, 717, 139, 100, 711, 105, 203, 923, 141, 142, 205, 83, 85, 950, 782, 506, 507, 508, 922, 751, 193, 194, 523, 196, 118, 521, 522, 107, 204, 13, 785, 803, 84, 150, 933, 831, 193, 194, 523, 196, 118, 521, 522, 107, 204, 784, 803, 84, 150, 761, 933, 831, 545, 546, 547, 678, 486, 487, 520, 875, 876, 162, 755, 756, 189, 190, 608, 609, 610, 611, 612, 613, 188, 427, 962, 959, 186, 187, 604, 606, 607, 898, 899, 900, 901, 806, 795, 909, 958, 791, 409, 410, 411, 796, 794, 894, 960, 955, 790, 903, 959, 498, 598, 600, 601, 602, 603, 956, 605, 901, 955, 900, 901, 903, 909, 789, 598, 791, 600, 601, 602, 603, 956, 895, 896, 897, 898, 899, 900, 790, 909, 788, 598, 901, 409, 410, 411, 794, 894, 895, 387, 388, 389, 488, 489, 586, 877, 879, 496, 904, 851, 984, 905, 280, 793, 906, 548, 391, 392, 393, 586, 279, 905, 496, 488, 434, 851, 278, 489, 792, 280, 992, 897, 898, 795, 548, 806, 975, 899, 788, 791, 409, 410, 411, 796, 805, 806, 855, 720, 788, 406, 407, 856, 409, 410, 411, 796, 794, 958, 411, 741, 806, 855, 720, 721, 788, 406, 407, 856, 409, 410, 795, 794, 958, 805, 981, 549, 615, 206, 207, 208, 853, 854, 185, 186, 187, 188, 606, 607, 833, 514, 835, 987, 108, 779, 780, 781, 14, 109, 921, 115, 116, 537, 121, 538, 827, 800, 738, 740, 549, 742, 616, 889, 723, 726, 887, 728, 836, 732, 733, 734, 738, 836, 887, 889, 723, 726, 727, 728, 729, 735, 732, 733, 734, 799, 672, 673, 891, 526, 656, 658, 659, 862, 951, 666, 863, 892, 669, 670, 671, 576, 61, 359, 492, 811, 300, 493, 60, 124, 822, 313, 59, 540, 541, 350, 991, 194, 100, 105, 106, 204, 13, 717, 784, 785, 83, 84, 85, 118, 922, 149, 887, 836, 805, 855, 856, 728, 723, 725, 727, 408, 729, 730, 731, 732, 733, 734, 735, 731, 804, 741, 806, 855, 727, 856, 720, 721, 722, 724, 725, 406, 407, 408, 729, 730, 795, 796, 735, 736, 795, 724, 957, 855, 719, 720, 721, 722, 788, 805, 406, 407, 856, 409, 410, 411, 796, 794, 958, 741, 192, 809, 843, 845, 71, 681, 679, 45, 46, 47, 48, 947, 948, 381, 476, 349, 382, 768, 482, 483, 809, 842, 364, 397, 367, 374, 375, 345, 347, 377, 349, 382, 767, 482, 483, 807, 808, 364, 397, 367, 48, 947, 381, 374, 375, 345, 347, 349, 382, 767, 34, 35, 36, 260, 977, 268, 66, 78, 269, 273, 515, 558, 772, 826, 915, 509, 510, 576, 352, 802, 359, 492, 493, 494, 77, 979, 766, 822, 343, 353, 350, 351, 386, 868, 869, 870, 871, 936, 937, 813, 814, 815, 628, 629, 857, 858, 981, 386, 981, 868, 871, 936, 937, 812, 814, 815, 628, 629, 857, 858, 181, 386, 868, 869, 870, 871, 936, 937, 812, 813, 815, 628, 629, 857, 858, 981, 384, 385, 386, 981, 868, 871, 937, 812, 813, 814, 628, 181, 182, 185, 186, 858, 629, 224, 225, 642, 641, 873, 234, 685, 910, 687, 817, 211, 219, 668, 637, 223, 224, 225, 642, 646, 641, 668, 237, 686, 685, 816, 211, 910, 544, 632, 635, 636, 637, 229, 230, 232, 873, 234, 235, 562, 238, 240, 241, 242, 563, 564, 246, 567, 220, 874, 222, 223, 673, 667, 654, 669, 688, 689, 687, 862, 951, 666, 219, 892, 221, 670, 863, 232, 233, 235, 562, 239, 176, 242, 244, 245, 566, 567, 568, 564, 565, 354, 355, 356, 357, 60, 492, 502, 125, 760, 758, 759, 152, 59, 124, 61, 126, 991, 576, 354, 359, 300, 811, 492, 77, 494, 493, 979, 980, 802, 540, 541, 350, 991, 0, 577, 837, 518, 776, 274, 878, 368, 209, 210, 371, 691, 986, 477, 478, 496, 963, 774, 369, 904, 402, 366, 79, 80, 81, 82, 692, 825, 282, 881, 496, 963, 774, 881, 904, 402, 366, 79, 80, 81, 82, 692, 824, 282, 769, 35, 772, 101, 156, 810, 747, 748, 558, 977, 931, 510, 918, 26, 27, 28, 509, 62, 63, 514, 835, 872, 108, 713, 779, 140, 109, 14, 781, 921, 537, 121, 987, 924, 925, 798, 520, 876, 545, 678, 625, 552, 553, 554, 555, 556, 557, 709, 710, 465, 875, 620, 621, 622, 623, 753, 626, 627, 754, 875, 755, 486, 487, 520, 39, 620, 622, 623, 624, 465, 626, 627, 532, 533, 625, 756, 91, 765, 511, 831, 357, 990, 60, 778, 523, 777, 125, 886, 933, 885, 502, 521, 761, 314, 59, 124, 61, 126, 127, 521, 522, 523, 784, 785, 933, 60, 830, 193, 886, 990, 357, 502, 885, 758, 759, 760, 761, 124, 125, 126, 127, 385, 578, 579, 580, 582, 833, 116, 117, 982, 313, 538, 539, 540, 570, 542, 384, 385, 514, 835, 982, 832, 779, 781, 116, 181, 182, 537, 121, 538, 798, 117, 96, 97, 994, 771, 929, 264, 701, 928, 917, 89, 90, 699, 700, 698, 926, 927, 833, 514, 987, 202, 779, 108, 781, 14, 921, 116, 537, 121, 538, 827, 924, 925, 798, 799, 800, 804, 887, 889, 728, 723, 725, 726, 727, 408, 729, 731, 732, 733, 734, 735, 577, 98, 451, 452, 133, 518, 274, 368, 209, 210, 371, 372, 823, 378, 883, 380, 477, 591, 997, 262, 839, 360, 363, 590, 271, 270, 757, 695, 57, 122, 123, 95, 704, 705, 195, 196, 838, 200, 201, 271, 264, 693, 694, 695, 696, 57, 122, 123, 698, 757, 128, 129, 130, 259, 132, 37, 7, 8, 41, 42, 683, 978, 18, 861, 259, 132, 550, 167, 168, 169, 170, 44, 846, 559, 916, 53, 472, 473, 746, 768, 482, 379, 808, 364, 767, 398, 367, 483, 399, 375, 345, 346, 347, 348, 947, 377, 192, 93, 845, 71, 681, 362, 679, 844, 45, 46, 47, 49, 946, 807, 349, 354, 355, 356, 358, 359, 843, 493, 494, 947, 948, 152, 153, 349, 991, 192, 843, 93, 71, 681, 362, 679, 45, 46, 47, 49, 946, 807, 349, 67, 550, 167, 168, 169, 170, 44, 525, 916, 53, 470, 841, 852, 746, 469, 32, 33, 197, 198, 513, 160, 848, 849, 500, 983, 503, 988, 157, 158, 159, 32, 33, 197, 198, 513, 64, 160, 847, 849, 500, 983, 503, 988, 157, 158, 159, 64, 160, 197, 198, 513, 847, 848, 850, 62, 983, 26, 63, 156, 157, 158, 159, 64, 65, 770, 931, 101, 519, 156, 747, 748, 769, 849, 158, 918, 26, 27, 28, 157, 62, 63, 489, 548, 390, 391, 392, 393, 586, 905, 496, 488, 434, 435, 278, 279, 792, 793, 161, 267, 261, 167, 168, 169, 266, 263, 44, 551, 752, 466, 467, 468, 846, 265, 916, 154, 155, 485, 609, 549, 615, 206, 207, 208, 981, 854, 186, 187, 188, 797, 606, 607, 609, 612, 549, 615, 616, 206, 207, 208, 853, 187, 188, 797, 606, 607, 804, 805, 806, 728, 856, 721, 406, 407, 408, 729, 730, 795, 796, 735, 804, 805, 806, 855, 728, 721, 406, 407, 408, 729, 730, 795, 796, 735, 386, 868, 869, 870, 871, 936, 937, 938, 939, 812, 813, 814, 941, 944, 945, 940, 858, 386, 868, 869, 870, 871, 936, 937, 938, 812, 813, 814, 815, 944, 628, 941, 857, 99, 676, 262, 999, 745, 490, 749, 270, 52, 54, 919, 920, 58, 860, 99, 676, 262, 999, 745, 490, 749, 270, 52, 54, 919, 920, 58, 859, 128, 257, 130, 132, 6, 7, 8, 41, 683, 978, 840, 17, 18, 473, 254, 672, 801, 891, 673, 669, 656, 819, 951, 666, 667, 892, 221, 670, 863, 672, 673, 219, 801, 891, 669, 688, 689, 819, 670, 951, 666, 667, 892, 221, 862, 675, 231, 171, 39, 172, 464, 532, 533, 511, 217, 218, 91, 764, 765, 255, 352, 341, 329, 330, 972, 77, 974, 973, 337, 338, 339, 340, 766, 343, 575, 571, 574, 351, 323, 330, 396, 530, 398, 399, 336, 338, 867, 341, 536, 379, 882, 880, 866, 323, 324, 395, 396, 322, 398, 399, 336, 530, 536, 331, 379, 882, 386, 869, 870, 871, 936, 937, 812, 813, 814, 815, 628, 629, 182, 857, 858, 981, 940, 780, 942, 535, 934, 935, 936, 937, 938, 939, 812, 941, 814, 943, 182, 183, 184, 857, 858, 868, 870, 871, 115, 940, 780, 942, 535, 934, 935, 936, 937, 939, 812, 941, 814, 943, 182, 183, 184, 857, 858, 868, 869, 871, 115, 386, 868, 869, 870, 936, 937, 812, 813, 814, 815, 628, 629, 857, 858, 981, 715, 716, 987, 712, 713, 714, 139, 108, 109, 14, 144, 145, 146, 147, 148, 921, 827, 924, 925, 544, 641, 642, 230, 232, 234, 874, 816, 238, 563, 240, 241, 818, 211, 246, 220, 637, 222, 223, 229, 230, 232, 873, 234, 818, 238, 563, 240, 241, 562, 211, 564, 246, 220, 222, 223, 545, 547, 486, 487, 520, 876, 620, 786, 622, 623, 624, 465, 626, 627, 755, 625, 756, 828, 829, 511, 545, 546, 547, 678, 753, 520, 553, 554, 555, 556, 557, 622, 621, 552, 786, 875, 828, 189, 674, 387, 388, 389, 906, 907, 792, 879, 664, 984, 878, 662, 280, 665, 282, 478, 773, 0, 773, 518, 776, 877, 879, 986, 210, 691, 692, 823, 282, 477, 478, 387, 388, 389, 488, 489, 906, 907, 877, 792, 664, 984, 878, 280, 665, 282, 478, 773, 323, 330, 396, 530, 398, 399, 336, 338, 867, 341, 536, 379, 882, 496, 963, 774, 369, 904, 402, 366, 79, 80, 81, 82, 692, 824, 825, 282, 880, 866, 867, 330, 395, 396, 530, 398, 399, 336, 338, 323, 341, 536, 379, 577, 450, 451, 452, 133, 135, 75, 210, 368, 209, 274, 372, 373, 837, 376, 378, 380, 477, 383, 98, 452, 454, 38, 455, 137, 491, 524, 177, 178, 179, 529, 277, 534, 457, 831, 886, 990, 60, 778, 523, 777, 125, 933, 830, 502, 521, 543, 761, 314, 59, 124, 61, 126, 127, 521, 778, 523, 539, 542, 543, 933, 777, 313, 570, 59, 60, 61, 830, 831, 314, 990, 885, 502, 761, 125, 126, 127, 800, 836, 804, 889, 723, 735, 726, 727, 728, 729, 731, 732, 733, 734, 799, 960, 737, 738, 739, 740, 742, 614, 743, 616, 617, 618, 619, 744, 605, 800, 738, 836, 727, 723, 735, 725, 726, 887, 728, 729, 731, 732, 733, 734, 799, 736, 737, 738, 739, 740, 741, 743, 744, 727, 719, 720, 721, 722, 724, 725, 726, 407, 731, 957, 958, 672, 673, 801, 688, 654, 656, 670, 951, 666, 667, 892, 669, 862, 863, 672, 673, 891, 801, 221, 688, 819, 670, 951, 666, 667, 669, 862, 863, 647, 648, 649, 650, 663, 653, 495, 658, 660, 661, 630, 151, 952, 633, 911, 896, 417, 418, 899, 900, 901, 897, 585, 429, 430, 909, 788, 598, 791, 409, 411, 898, 895, 896, 417, 418, 899, 900, 790, 422, 897, 585, 429, 430, 909, 497, 898, 598, 791, 409, 602, 894, 901, 417, 418, 899, 900, 901, 897, 585, 429, 430, 909, 898, 598, 791, 409, 894, 895, 896, 898, 419, 421, 909, 425, 791, 429, 430, 975, 899, 585, 283, 794, 895, 894, 287, 896, 897, 899, 900, 421, 425, 585, 429, 430, 909, 788, 791, 409, 794, 411, 975, 894, 895, 896, 897, 898, 900, 421, 585, 909, 430, 788, 791, 901, 409, 794, 411, 894, 895, 896, 417, 898, 899, 790, 909, 791, 418, 429, 788, 598, 601, 901, 409, 602, 411, 894, 895, 896, 899, 900, 790, 791, 909, 788, 789, 598, 601, 600, 409, 602, 411, 894, 895, 0, 644, 179, 455, 456, 652, 653, 495, 177, 178, 275, 276, 277, 630, 986, 655, 477, 949, 962, 299, 420, 598, 427, 955, 498, 789, 790, 600, 601, 602, 603, 956, 954, 963, 388, 774, 81, 881, 488, 489, 82, 496, 824, 402, 692, 792, 825, 282, 387, 388, 389, 488, 489, 906, 907, 792, 657, 851, 793, 280, 548, 479, 674, 387, 388, 389, 792, 905, 664, 907, 877, 526, 879, 657, 984, 662, 280, 665, 479, 674, 387, 388, 389, 905, 664, 877, 879, 657, 773, 662, 280, 665, 984, 906, 479, 417, 418, 420, 422, 497, 328, 299, 428, 429, 302, 303, 424, 498, 596, 569, 896, 417, 898, 899, 900, 790, 897, 429, 430, 418, 788, 598, 791, 901, 409, 602, 411, 894, 895, 544, 641, 226, 668, 237, 686, 685, 816, 817, 211, 642, 635, 636, 637, 639, 674, 648, 526, 495, 657, 658, 659, 660, 661, 662, 663, 664, 665, 671, 893, 479, 258, 363, 516, 677, 9, 10, 11, 12, 173, 174, 50, 51, 55, 120, 94, 997, 256, 560, 675, 551, 680, 138, 171, 172, 464, 914, 468, 251, 217, 250, 763, 764, 682, 255, 256, 560, 763, 551, 680, 138, 171, 172, 464, 913, 468, 217, 250, 251, 764, 682, 255, 161, 34, 36, 261, 810, 268, 162, 558, 269, 272, 273, 78, 752, 190, 550, 167, 168, 169, 170, 551, 44, 846, 466, 467, 468, 53, 841, 852, 155, 746, 928, 929, 770, 771, 994, 747, 748, 834, 750, 131, 919, 930, 931, 927, 769, 35, 772, 101, 519, 156, 826, 558, 977, 850, 931, 26, 27, 28, 509, 62, 63, 66, 99, 676, 999, 72, 745, 490, 749, 270, 52, 917, 920, 859, 860, 66, 99, 260, 72, 745, 268, 749, 78, 515, 52, 750, 919, 859, 860, 514, 779, 716, 987, 712, 108, 714, 715, 140, 109, 14, 781, 872, 147, 148, 537, 835, 827, 924, 925, 798, 141, 142, 783, 149, 923, 803, 950, 782, 711, 203, 717, 718, 205, 83, 85, 143, 100, 105, 106, 751, 506, 507, 508, 783, 717, 139, 203, 141, 142, 205, 144, 147, 718, 950, 506, 507, 508, 922, 779, 716, 987, 712, 713, 714, 715, 108, 109, 14, 144, 145, 146, 147, 148, 872, 921, 121, 835, 827, 925, 835, 716, 987, 712, 713, 714, 715, 108, 109, 14, 144, 145, 146, 147, 148, 872, 921, 121, 827, 924, 96, 97, 834, 131, 927, 929, 481, 932, 930, 76, 994, 928, 771, 89, 90, 699, 700, 698, 703, 96, 97, 834, 131, 929, 76, 994, 928, 771, 917, 89, 90, 699, 700, 926, 930, 96, 929, 834, 771, 994, 930, 770, 131, 917, 89, 90, 700, 926, 927, 928, 96, 770, 771, 994, 930, 748, 834, 131, 917, 89, 700, 926, 927, 928, 769, 770, 131, 929, 747, 748, 994, 750, 771, 917, 931, 926, 927, 769, 770, 131, 28, 747, 748, 930, 750, 977, 850, 917, 918, 826, 26, 156, 157, 62, 63, 96, 97, 195, 103, 104, 697, 76, 527, 705, 481, 926, 86, 87, 88, 89, 90, 701, 702, 703, 193, 523, 886, 521, 202, 107, 204, 784, 785, 778, 885, 150, 777, 761, 522, 830, 831, 514, 939, 941, 869, 870, 935, 780, 183, 140, 781, 942, 109, 115, 535, 184, 940, 943, 939, 869, 870, 945, 936, 780, 183, 140, 941, 942, 943, 937, 115, 934, 182, 535, 184, 940, 386, 940, 941, 814, 935, 937, 939, 812, 813, 942, 181, 182, 183, 184, 857, 858, 868, 869, 870, 871, 628, 629, 386, 868, 869, 870, 871, 936, 941, 935, 812, 813, 814, 815, 628, 181, 182, 183, 857, 858, 629, 944, 869, 945, 939, 940, 941, 110, 111, 112, 113, 114, 942, 857, 858, 944, 869, 870, 935, 936, 938, 940, 941, 110, 111, 112, 113, 114, 942, 934, 857, 943, 945, 944, 869, 870, 935, 936, 938, 939, 941, 110, 111, 112, 113, 114, 115, 934, 942, 535, 857, 943, 945, 535, 934, 935, 936, 937, 938, 939, 940, 942, 943, 944, 945, 184, 857, 858, 869, 870, 110, 111, 112, 113, 114, 115, 140, 535, 934, 935, 936, 938, 939, 940, 941, 943, 944, 945, 183, 184, 780, 869, 870, 110, 111, 112, 113, 114, 115, 945, 514, 939, 869, 870, 935, 780, 535, 140, 941, 110, 781, 944, 113, 115, 934, 942, 183, 184, 940, 945, 938, 939, 940, 941, 110, 111, 112, 113, 114, 942, 857, 858, 943, 944, 935, 938, 939, 940, 941, 110, 111, 112, 113, 114, 942, 857, 943, 192, 843, 71, 681, 362, 679, 45, 46, 845, 49, 163, 25, 93, 199, 768, 358, 807, 809, 842, 844, 494, 948, 345, 153, 346, 347, 348, 349, 767, 353, 358, 71, 807, 844, 493, 494, 947, 345, 153, 346, 348, 349, 767, 640, 643, 644, 179, 902, 455, 456, 650, 652, 653, 495, 177, 178, 275, 276, 277, 630, 655, 638, 783, 923, 711, 203, 141, 142, 205, 83, 718, 506, 507, 508, 922, 751, 672, 673, 891, 801, 688, 654, 669, 656, 819, 862, 666, 667, 892, 221, 670, 863, 640, 643, 644, 645, 646, 456, 650, 151, 630, 631, 632, 633, 634, 635, 893, 638, 449, 962, 583, 427, 428, 954, 592, 599, 440, 441, 442, 443, 444, 445, 446, 962, 603, 420, 569, 903, 956, 427, 428, 953, 498, 599, 441, 442, 443, 444, 299, 962, 299, 420, 598, 903, 427, 497, 498, 789, 790, 569, 600, 601, 602, 603, 956, 962, 427, 420, 903, 443, 299, 955, 497, 498, 789, 790, 601, 600, 569, 602, 603, 444, 954, 736, 739, 741, 806, 743, 719, 720, 721, 722, 724, 406, 407, 410, 411, 890, 958, 736, 795, 741, 806, 724, 890, 719, 720, 721, 722, 788, 406, 407, 409, 410, 411, 796, 957, 608, 609, 610, 611, 612, 613, 614, 618, 619, 787, 789, 600, 601, 604, 605, 606, 960, 608, 609, 610, 611, 612, 613, 614, 744, 617, 618, 619, 888, 789, 600, 604, 605, 959, 3, 129, 130, 163, 516, 37, 128, 40, 9, 10, 43, 16, 19, 20, 41, 24, 25, 474, 42, 603, 443, 903, 444, 188, 427, 610, 954, 953, 787, 599, 955, 185, 186, 187, 604, 442, 956, 369, 904, 402, 366, 79, 80, 81, 370, 691, 692, 690, 824, 825, 282, 478, 881, 288, 774, 390, 967, 968, 969, 394, 333, 334, 365, 531, 401, 82, 403, 966, 281, 412, 286, 965, 288, 964, 774, 390, 967, 968, 969, 394, 333, 334, 365, 531, 401, 82, 403, 966, 281, 412, 286, 322, 323, 964, 965, 967, 968, 969, 332, 333, 334, 335, 401, 403, 404, 365, 412, 286, 319, 288, 964, 774, 390, 968, 969, 333, 334, 365, 401, 82, 403, 966, 281, 412, 286, 965, 320, 322, 323, 964, 965, 966, 967, 969, 332, 333, 334, 335, 403, 404, 405, 412, 286, 319, 288, 322, 964, 965, 966, 967, 968, 333, 334, 365, 531, 401, 403, 335, 412, 286, 288, 707, 708, 390, 284, 971, 333, 401, 434, 435, 436, 437, 438, 281, 412, 413, 286, 288, 992, 707, 708, 390, 391, 392, 393, 970, 439, 401, 434, 435, 436, 278, 279, 281, 284, 352, 353, 865, 973, 974, 337, 338, 339, 340, 341, 343, 344, 575, 571, 766, 351, 352, 353, 865, 972, 974, 337, 338, 339, 340, 341, 344, 575, 766, 351, 352, 353, 865, 972, 973, 337, 338, 339, 340, 341, 343, 344, 575, 766, 351, 992, 897, 898, 548, 421, 585, 430, 436, 437, 438, 439, 985, 794, 283, 284, 285, 287, 512, 491, 651, 136, 457, 459, 460, 461, 462, 463, 529, 212, 213, 214, 215, 750, 770, 35, 772, 101, 769, 28, 810, 747, 748, 78, 931, 558, 918, 826, 26, 156, 509, 510, 128, 129, 130, 4, 6, 7, 8, 41, 683, 840, 17, 18, 19, 40, 56, 473, 861, 576, 289, 310, 822, 297, 811, 300, 77, 301, 573, 980, 342, 343, 572, 541, 350, 576, 289, 310, 581, 588, 300, 77, 301, 822, 309, 342, 313, 762, 540, 541, 979, 384, 181, 386, 868, 385, 871, 812, 813, 814, 815, 628, 629, 185, 186, 797, 853, 384, 385, 579, 580, 832, 833, 629, 116, 117, 182, 183, 628, 538, 181, 32, 33, 197, 198, 513, 160, 847, 528, 849, 500, 503, 31, 848, 158, 159, 387, 388, 389, 488, 489, 906, 907, 877, 879, 792, 280, 665, 478, 773, 416, 992, 707, 708, 421, 425, 975, 436, 437, 438, 439, 283, 284, 285, 287, 0, 773, 518, 776, 878, 209, 210, 691, 276, 661, 902, 823, 692, 477, 478, 514, 779, 780, 781, 14, 147, 148, 537, 921, 924, 925, 798, 827, 835, 712, 140, 714, 715, 716, 872, 108, 109, 32, 33, 993, 996, 998, 102, 65, 64, 989, 847, 848, 995, 503, 504, 505, 159, 29, 30, 31, 32, 33, 995, 996, 197, 102, 993, 64, 998, 503, 504, 505, 988, 29, 30, 31, 831, 357, 60, 886, 125, 830, 502, 885, 760, 761, 314, 59, 124, 61, 126, 127, 354, 355, 356, 358, 359, 844, 492, 493, 821, 822, 152, 153, 802, 124, 350, 438, 421, 391, 971, 975, 985, 436, 437, 278, 439, 548, 794, 283, 284, 285, 287, 64, 65, 995, 996, 998, 102, 519, 989, 504, 505, 27, 988, 29, 30, 96, 97, 834, 131, 929, 76, 930, 928, 771, 917, 89, 90, 699, 700, 926, 927, 64, 65, 993, 996, 998, 102, 519, 989, 504, 505, 27, 988, 29, 30, 32, 993, 995, 998, 102, 33, 64, 989, 500, 503, 504, 505, 988, 29, 30, 31, 258, 363, 677, 838, 360, 361, 11, 12, 173, 590, 912, 50, 58, 95, 64, 993, 995, 996, 102, 65, 519, 989, 504, 505, 27, 988, 29, 30, 258, 99, 676, 677, 262, 745, 490, 919, 173, 270, 51, 52, 54, 55, 120, 58, 859, 860]
ncount = len(xadj) - 1
nparts = 10
print(ncount)
print(kaHIP.kaffpa_balance_NE(ncount, vwgt, xadj, adjcwgt, adjncy,
nparts, imbalance, suppress_output,
seed, mode))
print(kaHIP.kaffpa(ncount, vwgt, xadj, adjcwgt, adjncy, nparts,
imbalance, suppress_output, seed, mode))
print(kaHIP.node_separator(ncount, vwgt, xadj, adjcwgt, adjncy, nparts,
imbalance, suppress_output, seed, mode))
| 5,377.676471 | 94,910 | 0.625675 | 34,136 | 182,841 | 3.350832 | 0.124004 | 0.001049 | 0.001416 | 0.001259 | 0.205571 | 0.153658 | 0.111204 | 0.084758 | 0.057945 | 0.042314 | 0 | 0.767365 | 0.18766 | 182,841 | 33 | 94,911 | 5,540.636364 | 0.002747 | 0 | 0 | 0.08 | 0 | 0 | 0.000044 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.04 | 0 | 0.04 | 0.16 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
9b2b38933d2b35c35366ca21779d82a2703caaee | 128 | py | Python | tutorials/W0D4_Calculus/solutions/W0D4_Tutorial3_Solution_a4085ae8.py | eduardojdiniz/CompNeuro | 20269e66540dc4e802273735c97323020ee37406 | [
"CC-BY-4.0",
"BSD-3-Clause"
] | 2,294 | 2020-05-11T12:05:35.000Z | 2022-03-28T21:23:34.000Z | tutorials/W0D4_Calculus/solutions/W0D4_Tutorial3_Solution_a4085ae8.py | pellet/course-content | bb383857992469e0e7a9c36639ac0d05e842d9bd | [
"CC-BY-4.0",
"BSD-3-Clause"
] | 629 | 2020-05-11T15:42:26.000Z | 2022-03-29T12:23:35.000Z | tutorials/W0D4_Calculus/solutions/W0D4_Tutorial3_Solution_a4085ae8.py | pellet/course-content | bb383857992469e0e7a9c36639ac0d05e842d9bd | [
"CC-BY-4.0",
"BSD-3-Clause"
] | 917 | 2020-05-11T12:47:53.000Z | 2022-03-31T12:14:41.000Z |
"""
The larger the time-step $dt$, the worse job the formula of the slope of a
line does to approximate the derivative.
""" | 25.6 | 76 | 0.703125 | 22 | 128 | 4.090909 | 0.727273 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.210938 | 128 | 5 | 77 | 25.6 | 0.891089 | 0.898438 | 0 | null | 0 | null | 0 | 0 | null | 0 | 0 | 0 | null | 1 | null | true | 0 | 0 | null | null | null | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
9b757e78f7bea551a3dcf14fc40d9de589094411 | 27,534 | py | Python | tests/test_08_fragment_combination_graph.py | mpimp-comas/npfc | 316156a8826759d767ef16833cd4f0670868693e | [
"MIT"
] | null | null | null | tests/test_08_fragment_combination_graph.py | mpimp-comas/npfc | 316156a8826759d767ef16833cd4f0670868693e | [
"MIT"
] | null | null | null | tests/test_08_fragment_combination_graph.py | mpimp-comas/npfc | 316156a8826759d767ef16833cd4f0670868693e | [
"MIT"
] | null | null | null | """
tests.test_fragment_combination_graph
=======================================
Tests for the npfc.fragment_combination_graph module.
"""
# data handling
from pandas import DataFrame
# chemoinformatics
from rdkit import Chem
# tests
import pytest
# dev
from npfc import fragment_combination_graph
# debug
import logging
logging.basicConfig(level=logging.INFO)
# ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ FIXTURES ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ #
# fragments for testing normal fgraphs
mol_qa = Chem.MolFromSmiles('C1CCNC1')
mol_qb = Chem.MolFromSmiles('C1CCNC1')
mol_qc = Chem.MolFromSmiles('C1CCNC1')
mol_qd = Chem.MolFromSmiles('C1CCNC1')
# fragments for testing overlaps
mol_o1 = Chem.MolFromSmiles('NC1CCCCC1')
mol_o2 = Chem.MolFromSmiles('OC1CCCCC1')
mol_o3 = Chem.MolFromSmiles('SC1CCCCC1')
mol_o4 = Chem.MolFromSmiles('OC1CCCC1')
mol_o5 = Chem.MolFromSmiles('NC1CCCC1')
mol_o6 = Chem.MolFromSmiles('C1CCC1')
mol_o7 = Chem.MolFromSmiles('C1CC1')
mol_o8 = Chem.MolFromSmiles('NC1CCC1')
mol_o9 = Chem.MolFromSmiles('OC1CCC1')
@pytest.fixture
def df_fc_simple():
"""Simplest scenario case with a fcg of 3 fragments."""
mol = Chem.MolFromSmiles('C(C1CCSCC1)C1CCC(CN1)C1CCCOC1')
return DataFrame([
['mol_cm', 'XXX', 'QA', 0, 'QA:0', 'QB', 0, 'QB:0', 'cm', 'connection', 'monopodal', '', [8, 9, 10, 11, 12, 7], [14, 13, 18, 17, 16, 15], 11, mol, mol_qa, mol_qb, 'QA:0@2[cm]QB:0@1'],
['mol_cm', 'XXX', 'QA', 0, 'QA:0', 'QC', 0, 'QC:0', 'cm', 'connection', 'monopodal', '', [8, 9, 10, 11, 12, 7], [1, 2, 3, 4, 5, 6], 11, mol, mol_qa, mol_qc, 'QA:0@5[cm]QC:0@0'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_redundant():
"""Scenario case with a fcg of 2 redundant fragments ."""
mol = Chem.MolFromSmiles('C1CCC(NC1)C1CCCNC1')
return DataFrame([
['mol_fc_redundant', 'XXX', 'QA', 0, 'QA:0', 'QA', 1, 'QA:1', 'cm', 'connection', 'monopodal', '', [0, 1, 2, 3, 4, 5], [6, 7, 8, 9, 10, 11], 10, mol, mol_qa, mol_qa, 'QA:0@3[cm]QA:1@0'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_circular():
"""Scenario case with a circular fcg."""
mol = Chem.MolFromSmiles('C1COCC(C1)C(C1CCNCC1)C1CCCSC1')
return DataFrame([
['mol_fc_circular', 'XXX', 'QA', 0, 'QA:0', 'QB', 0, 'QB:0', 'cm', 'connection', 'monopodal', '', (8, 7, 12, 11, 10, 9), (5, 4, 3, 2, 1, 0), 20, mol, mol_qa, mol_qb, 'QA:0@1[cm]QB:0@1'],
['mol_fc_circular', 'XXX', 'QA', 0, 'QA:0', 'QC', 0, 'QC:0', 'cm', 'connection', 'monopodal', '', (8, 7, 12, 11, 10, 9), (14, 13, 18, 17, 16, 15), 20, mol, mol_qa, mol_qc, 'QA:0@1[cm]QC:0@1'],
['mol_fc_circular', 'XXX', 'QB', 0, 'QA:0', 'QC', 0, 'QC:0', 'cm', 'connection', 'monopodal', '', (5, 4, 3, 2, 1, 0), (14, 13, 18, 17, 16, 15), 20, mol, mol_qb, mol_qc, 'QB:0@1[cm]QC:0@1'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_independant():
"""Scenario case with 2 independant subfcgs."""
mol = Chem.MolFromSmiles('C(CCC1CSC2CCCCC2C1)CC1COCC(CC2CCCNC2)C1')
return DataFrame([
['mol_fc_independant', 'XXX', 'QA', 0, 'QA:0', 'QB', 0, 'QB:0', 'cm', 'connection', 'monopodal', '', (20, 21, 22, 23, 24, 25), (26, 18, 17, 16, 15, 14), 26, mol, mol_qa, mol_qb, 'QA:0@0[cm]QB:0@1'],
['mol_fc_independant', 'XXX', 'QC', 0, 'QC:0', 'QD', 0, 'QD:0', 'fe', 'fusion', 'edge', '', (12, 11, 6, 5, 4, 3), (6, 7, 8, 9, 10, 11), 26, mol, mol_qc, mol_qd, 'QC:0@1,2[fe]QD:0@0,5'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_overlap_1():
"""Scenario case with 2 fragments overlapping."""
mol = Chem.MolFromSmiles('NC1CCCCC1O')
return DataFrame([
['mol_fc_overlap_1', 'XXX', 'O1', 0, 'O1:0', 'O2', 0, 'O2:0', 'ffo', 'fusion', 'false_positive', 'overlap', (7, 6, 5, 4, 3, 2, 1), (0, 1, 2, 3, 4, 5, 6), 8, mol, mol_o1, mol_o2, 'O1:0@1,2,3,4,5,6[ffo]O2:0@1,2,3,4,5,6'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_overlap_2():
"""Scenario case with 2 fragments overlapping, bound to a common fragment."""
mol = Chem.MolFromSmiles('NC1CC(CCC1O)C1CCC1')
return DataFrame([
['mol_fc_overlap_2', 'XXX', 'O1', 0, 'O1:0', 'O2', 0, 'O2:0', 'ffo', 'fusion', 'false_positive', 'overlap', (7, 6, 5, 4, 3, 2, 1), (0, 1, 2, 3, 4, 5, 6), 12, mol, mol_o1, mol_o2, 'O1:0@1,2,3,4,5,6[ffo]O2:0@1,2,3,4,5,6'],
['mol_fc_overlap_2', 'XXX', 'O1', 0, 'O1:0', 'O3', 0, 'O3:0', 'cm', 'connection', 'monopodal', '', (7, 6, 5, 4, 3, 2, 1), (8, 9, 10, 11), 12, mol, mol_o1, mol_o3, 'O1:0@4[cm]O3:0@0'],
['mol_fc_overlap_2', 'XXX', 'O2', 0, 'O2:0', 'O3', 0, 'O3:0', 'cm', 'connection', 'monopodal', '', (0, 1, 2, 3, 4, 5, 6), (8, 9, 10, 11), 12, mol, mol_o2, mol_o3, 'O2:0@3[cm]O3:0@0'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_overlap_3():
"""Scenario case with 2 fragments overlapping, bound to a common fragment, itself bound to another fragment."""
mol = Chem.MolFromSmiles('NC1CC(CCC1O)C1CC(CC2CC2)C1')
return DataFrame([
['mol_fc_overlap_3', 'XXX', 'O1', 0, 'O1:0', 'O2', 0, 'O2:0', 'ffo', 'fusion', 'false_positive', 'overlap', (7, 6, 5, 4, 3, 2, 1), (0, 1, 2, 3, 4, 5, 6), 16, mol, mol_o1, mol_o2, 'O1:0@1,2,3,4,5,6[ffo]O2:0@1,2,3,4,5,6'],
['mol_fc_overlap_3', 'XXX', 'O1', 0, 'O1:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'monopodal', '', (7, 6, 5, 4, 3, 2, 1), (8, 9, 10, 15), 16, mol, mol_o1, mol_o3, 'O1:0@4[cm]O6:0@0'],
['mol_fc_overlap_3', 'XXX', 'O2', 0, 'O2:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'monopodal', '', (0, 1, 2, 3, 4, 5, 6), (8, 9, 10, 15), 16, mol, mol_o2, mol_o3, 'O2:0@3[cm]O6:0@0'],
['mol_fc_overlap_3', 'XXX', 'O6', 0, 'O6:0', 'O7', 0, 'O7:0', 'cm', 'connection', 'monopodal', '', (8, 9, 10, 15), (12, 13, 14), 16, mol, mol_o3, mol_o4, 'O6:0@2[cm]O7:0@0'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_overlap_4():
"""Scenario case with 2 independant sets of 2 fragments overlapping."""
mol = Chem.MolFromSmiles('NC1CC(CCCCC2CCC(O)C(N)C2)CC1O')
return DataFrame([
['mol_fc_overlap_4', 'XXX', 'O1', 0, 'O1:0', 'O2', 0, 'O2:0', 'ffo', 'fusion', 'false_positive', 'overlap', (12, 11, 10, 9, 8, 15, 13), (14, 13, 11, 10, 9, 8, 15), 19, mol, mol_o1, mol_o2, 'O1:0@1,2,3,4,5,6[ffo]O2:0@1,2,3,4,5,6'],
['mol_fc_overlap_4', 'XXX', 'O5', 0, 'O4:0', 'O5', 0, 'O5:0', 'ffo', 'fusion', 'false_positive', 'overlap', (18, 17, 16, 3, 2, 1), (0, 1, 2, 3, 16, 17), 19, mol, mol_o4, mol_o5, 'O4:0@1,2,3,4,5[ffo]O5:0@1,2,3,4,5'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_overlap_5():
"""Scenario case with 2 sets of 2 fragments overlapping."""
mol = Chem.MolFromSmiles('NC1C(O)CCC1C1CCC(O)C(N)C1')
return DataFrame([
['mol_fc_overlap_5', 'XXX', 'O1', 0, 'O1:0', 'O2', 0, 'O2:0', 'ffo', 'fusion', 'false_positive', 'overlap', (11, 10, 9, 8, 7, 14, 12), (13, 12, 10, 9, 8, 7, 14), 15, mol, mol_o1, mol_o2, 'O1:0@1,2,3,4,5,6[ffo]O2:0@1,2,3,4,5,6'],
['mol_fc_overlap_5', 'XXX', 'O1', 0, 'O1:0', 'O5', 0, 'O4:0', 'cm', 'connection', 'monopodal', '', (11, 10, 9, 8, 7, 14, 12), (3, 2, 1, 6, 5, 4), 15, mol, mol_o1, mol_o4, 'O1:0@4[cm]O4:0@3'],
['mol_fc_overlap_5', 'XXX', 'O1', 0, 'O1:0', 'O5', 0, 'O5:0', 'cm', 'connection', 'monopodal', '', (11, 10, 9, 8, 7, 14, 12), (0, 1, 2, 4, 5, 6), 15, mol, mol_o1, mol_o5, 'O1:0@4[cm]O5:0@5'],
['mol_fc_overlap_5', 'XXX', 'O2', 0, 'O2:0', 'O5', 0, 'O4:0', 'cm', 'connection', 'monopodal', '', (13, 12, 10, 9, 8, 7, 14), (3, 2, 1, 6, 5, 4), 15, mol, mol_o2, mol_o4, 'O2:0@5[cm]O4:0@3'],
['mol_fc_overlap_5', 'XXX', 'O2', 0, 'O2:0', 'O5', 0, 'O5:0', 'cm', 'connection', 'monopodal', '', (13, 12, 10, 9, 8, 7, 14), (0, 1, 2, 4, 5, 6), 15, mol, mol_o2, mol_o5, 'O2:0@5[cm]O5:0@5'],
['mol_fc_overlap_5', 'XXX', 'O5', 0, 'O4:0', 'O5', 0, 'O5:0', 'ffo', 'fusion', 'false_positive', 'overlap', (3, 2, 1, 6, 5, 4), (0, 1, 2, 4, 5, 6), 15, mol, mol_o4, mol_o5, 'O4:0@1,2,3,4,5[ffo]O5:0@1,2,3,4,5'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_overlap_6():
"""Scenario case with 2 sets of 2 overlapping fragments, 1 set being bound to another fragment."""
mol = Chem.MolFromSmiles('NC1C(O)CCC1C1CC(N)C(O)CC1CCC1CC(CCC2CC2)C1')
return DataFrame([
['mol_fc_overlap_6', 'XXX', 'O1', 0, 'O1:0', 'O2', 0, 'O2:0', 'ffo', 'fusion', 'false_positive', 'overlap', (12, 11, 9, 8, 7, 14, 13), (10, 9, 8, 7, 14, 13, 11), 26, mol, mol_o1, mol_o2, 'O1:0@4[cm]O4:0@3'],
['mol_fc_overlap_6', 'XXX', 'O1', 0, 'O1:0', 'O5', 0, 'O4:0', 'cm', 'connection', 'monopodal', '', (12, 11, 9, 8, 7, 14, 13), (3, 2, 1, 6, 5, 4), 26, mol, mol_o1, mol_o4, 'O1:0@4[cm]O5:0@5'],
['mol_fc_overlap_6', 'XXX', 'O1', 0, 'O1:0', 'O5', 0, 'O5:0', 'cm', 'connection', 'monopodal', '', (12, 11, 9, 8, 7, 14, 13), (0, 1, 2, 4, 5, 6), 26, mol, mol_o1, mol_o5, 'O1:0@5[cm]O6:0@0'],
['mol_fc_overlap_6', 'XXX', 'O1', 0, 'O1:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'monopodal', '', (12, 11, 9, 8, 7, 14, 13), (17, 18, 19, 25), 26, mol, mol_o1, mol_o6, 'O2:0@3[cm]O4:0@3'],
['mol_fc_overlap_6', 'XXX', 'O2', 0, 'O2:0', 'O5', 0, 'O4:0', 'cm', 'connection', 'monopodal', '', (10, 9, 8, 7, 14, 13, 11), (3, 2, 1, 6, 5, 4), 26, mol, mol_o2, mol_o4, 'O2:0@3[cm]O5:0@5'],
['mol_fc_overlap_6', 'XXX', 'O2', 0, 'O2:0', 'O5', 0, 'O5:0', 'cm', 'connection', 'monopodal', '', (10, 9, 8, 7, 14, 13, 11), (0, 1, 2, 4, 5, 6), 26, mol, mol_o2, mol_o5, 'O2:0@4[cm]O6:0@0'],
['mol_fc_overlap_6', 'XXX', 'O2', 0, 'O2:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'false_positive', '', (10, 9, 8, 7, 14, 13, 11), (17, 18, 19, 25), 26, mol, mol_o2, mol_o6, 'O2:0@4[cm]O6:0@0'],
['mol_fc_overlap_6', 'XXX', 'O5', 0, 'O4:0', 'O5', 0, 'O5:0', 'ffo', 'fusion', 'false_positive', 'false_positive', (3, 2, 1, 6, 5, 4), (0, 1, 2, 4, 5, 6), 26, mol, mol_o4, mol_o5, 'O4:0@1,2,3,4,5[ffo]O5:0@1,2,3,4,5'],
['mol_fc_overlap_6', 'XXX', 'O6', 0, 'O6:0', 'O7', 0, 'O7:0', 'cm', 'connection', 'monopodal', '', (17, 18, 19, 25), (22, 23, 24), 26, mol, mol_o6, mol_o7, 'O6:0@2[cm]O7:0@0'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_overlap_7():
"""Scenario case with 3 overlapping fragments, bound to another fragment."""
mol = Chem.MolFromSmiles('NC1CC(CC(S)C1O)C1CCC1')
return DataFrame([
['mol_fc_overlap_7', 'XXX', 'O1', 0, 'O1:0', 'O2', 0, 'O2:0', 'ffo', 'fusion', 'false_positive', 'overlap', (8, 7, 5, 4, 3, 2, 1), (0, 1, 2, 3, 4, 5, 7), 13, mol, mol_o1, mol_o2, 'O1:0@1,2,3,4,5,6[ffo]O2:0@1,2,3,4,5,6'],
['mol_fc_overlap_7', 'XXX', 'O1', 0, 'O1:0', 'O3', 0, 'O3:0', 'ffo', 'fusion', 'false_positive', 'overlap', (8, 7, 5, 4, 3, 2, 1), (6, 5, 4, 3, 2, 1, 7), 13, mol, mol_o1, mol_o3, 'O1:0@1,2,3,4,5,6[ffo]O3:0@1,2,3,4,5,6'],
['mol_fc_overlap_7', 'XXX', 'O1', 0, 'O1:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'monopodal', '', (8, 7, 5, 4, 3, 2, 1), (9, 10, 11, 12), 13, mol, mol_o1, mol_o6, 'O1:0@4[cm]O6:0@0'],
['mol_fc_overlap_7', 'XXX', 'O2', 0, 'O2:0', 'O3', 0, 'O3:0', 'ffo', 'fusion', 'false_positive', 'overlap', (0, 1, 2, 3, 4, 5, 7), (6, 5, 4, 3, 2, 1, 7), 13, mol, mol_o3, mol_o3, 'O2:0@1,2,3,4,5,6[ffo]O3:0@1,2,3,4,5,6'],
['mol_fc_overlap_7', 'XXX', 'O2', 0, 'O2:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'monopodal', '', (0, 1, 2, 3, 4, 5, 7), (9, 10, 11, 12), 13, mol, mol_o2, mol_o6, 'O2:0@3[cm]O6:0@0'],
['mol_fc_overlap_7', 'XXX', 'O3', 0, 'O3:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'monopodal', '', (6, 5, 4, 3, 2, 1, 7), (9, 10, 11, 12), 13, mol, mol_o3, mol_o6, 'O3:0@3[cm]O6:0@0'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_overlap_8():
"""Scenario case with 3 overlapping fragments, bound to a common combination of 2 fragments."""
mol = Chem.MolFromSmiles('NC1CC(CC(S)C1O)C1CC(CCC2CC2)C1')
return DataFrame([
['mol_fc_overlap_8', 'XXX', 'O1', 0, 'O1:0', 'O2', 0, 'O2:0', 'ffo', 'fusion', 'false_positive', 'overlap', (8, 7, 5, 4, 3, 2, 1), (0, 1, 2, 3, 4, 5, 7), 18, mol, mol_o1, mol_o2, 'O1:0@1,2,3,4,5,6[ffo]O2:0@1,2,3,4,5,6'],
['mol_fc_overlap_8', 'XXX', 'O1', 0, 'O1:0', 'O3', 0, 'O3:0', 'ffo', 'fusion', 'false_positive', 'overlap', (8, 7, 5, 4, 3, 2, 1), (6, 5, 4, 3, 2, 1, 7), 18, mol, mol_o1, mol_o3, 'O1:0@1,2,3,4,5,6[ffo]O3:0@1,2,3,4,5,6'],
['mol_fc_overlap_8', 'XXX', 'O1', 0, 'O1:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'monopodal', '', (8, 7, 5, 4, 3, 2, 1), (9, 10, 11, 17), 18, mol, mol_o1, mol_o6, 'O1:0@4[cm]O6:0@0'],
['mol_fc_overlap_8', 'XXX', 'O2', 0, 'O2:0', 'O3', 0, 'O3:0', 'ffo', 'fusion', 'false_positive', 'overlap', (0, 1, 2, 3, 4, 5, 7), (6, 5, 4, 3, 2, 1, 7), 18, mol, mol_o2, mol_o3, 'O2:0@1,2,3,4,5,6[ffo]O3:0@1,2,3,4,5,6'],
['mol_fc_overlap_8', 'XXX', 'O2', 0, 'O2:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'monopodal', '', (0, 1, 2, 3, 4, 5, 7), (9, 10, 11, 17), 18, mol, mol_o2, mol_o6, 'O2:0@3[cm]O6:0@0'],
['mol_fc_overlap_8', 'XXX', 'O3', 0, 'O3:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'monopodal', '', (6, 5, 4, 3, 2, 1, 7), (9, 10, 11, 17), 18, mol, mol_o3, mol_o6, 'O3:0@3[cm]O6:0@0'],
['mol_fc_overlap_8', 'XXX', 'O6', 0, 'O6:0', 'O7', 0, 'O7:0', 'cm', 'connection', 'monopodal', '', (9, 10, 11, 17), (14, 15, 16), 18, mol, mol_o6, mol_o7, 'O6:0@2[cm]O7:0@0'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
@pytest.fixture
def df_fc_overlap_9():
"""Scenario case with 3 sets of 2 overlapping fragments, bound to a common combination of 2 redundant fragments."""
mol = Chem.MolFromSmiles('NC1C(O)C(CCCC2CC2CCC2CC2)C1CCC1CC(C(N)C1O)C1CCC(O)C(N)C1')
return DataFrame([
['mol_fc_overlap_9', 'XXX', 'O1', 0, 'O1:0', 'O2', 0, 'O2:0', 'ffo', 'fusion', 'false_positive', 'overlap', (30, 29, 28, 27, 26, 33, 31), (32, 31, 29, 28, 27, 26, 33), 34, mol, mol_o1, mol_o2, 'O1:0@1,2,3,4,5,6[ffo]O2:0@1,2,3,4,5,6'],
['mol_fc_overlap_9', 'XXX', 'O1', 0, 'O1:0', 'O5', 0, 'O4:0', 'cm', 'connection', 'monopodal', '', (30, 29, 28, 27, 26, 33, 31), (25, 24, 22, 21, 20, 19), 34, mol, mol_o1, mol_o4, 'O1:0@4[cm]O4:0@3'],
['mol_fc_overlap_9', 'XXX', 'O1', 0, 'O1:0', 'O5', 0, 'O5:0', 'cm', 'connection', 'monopodal', '', (30, 29, 28, 27, 26, 33, 31), (23, 22, 21, 20, 19, 24), 34, mol, mol_o1, mol_o5, 'O1:0@4[cm]O5:0@2'],
['mol_fc_overlap_9', 'XXX', 'O2', 0, 'O2:0', 'O5', 0, 'O4:0', 'cm', 'connection', 'monopodal', '', (32, 31, 29, 28, 27, 26, 33), (25, 24, 22, 21, 20, 19), 34, mol, mol_o2, mol_o4, 'O2:0@5[cm]O4:0@3'],
['mol_fc_overlap_9', 'XXX', 'O2', 0, 'O2:0', 'O5', 0, 'O5:0', 'cm', 'connection', 'monopodal', '', (32, 31, 29, 28, 27, 26, 33), (23, 22, 21, 20, 19, 24), 34, mol, mol_o2, mol_o5, 'O2:0@5[cm]O5:0@2'],
['mol_fc_overlap_9', 'XXX', 'O5', 0, 'O4:0', 'O5', 0, 'O5:0', 'ffo', 'fusion', 'false_positive', 'overlap', (25, 24, 22, 21, 20, 19), (23, 22, 21, 20, 19, 24), 34, mol, mol_o4, mol_o5, 'O4:0@1,2,3,4,5[ffo]O5:0@1,2,3,4,5'],
['mol_fc_overlap_9', 'XXX', 'O5', 0, 'O4:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'monopodal', '', (25, 24, 22, 21, 20, 19), (1, 2, 4, 16), 34, mol, mol_o4, mol_o6, 'O4:0@5[cm]O6:0@3'],
['mol_fc_overlap_9', 'XXX', 'O5', 0, 'O4:0', 'O8', 0, 'O8:0', 'cm', 'connection', 'monopodal', '', (25, 24, 22, 21, 20, 19), (0, 1, 2, 4, 16), 34, mol, mol_o4, mol_o8, 'O4:0@5[cm]O8:0@4'],
['mol_fc_overlap_9', 'XXX', 'O5', 0, 'O4:0', 'O9', 0, 'O9:0', 'cm', 'connection', 'monopodal', '', (25, 24, 22, 21, 20, 19), (3, 2, 1, 16, 4), 34, mol, mol_o4, mol_o9, 'O4:0@5[cm]O9:0@3'],
['mol_fc_overlap_9', 'XXX', 'O5', 0, 'O5:0', 'O6', 0, 'O6:0', 'cm', 'connection', 'monopodal', '', (23, 22, 21, 20, 19, 24), (1, 2, 4, 16), 34, mol, mol_o5, mol_o6, 'O5:0@4[cm]O6:0@3'],
['mol_fc_overlap_9', 'XXX', 'O5', 0, 'O5:0', 'O8', 0, 'O8:0', 'cm', 'connection', 'monopodal', '', (23, 22, 21, 20, 19, 24), (0, 1, 2, 4, 16), 34, mol, mol_o5, mol_o8, 'O5:0@4[cm]O8:0@4'],
['mol_fc_overlap_9', 'XXX', 'O5', 0, 'O5:0', 'O9', 0, 'O9:0', 'cm', 'connection', 'monopodal', '', (23, 22, 21, 20, 19, 24), (3, 2, 1, 16, 4), 34, mol, mol_o5, mol_o9, 'O5:0@4[cm]O9:0@3'],
['mol_fc_overlap_9', 'XXX', 'O6', 0, 'O6:0', 'O7', 0, 'O7:0', 'cm', 'connection', 'monopodal', '', (1, 2, 4, 16), (8, 9, 10), 34, mol, mol_o6, mol_o7, 'O6:0@2[cm]O7:0@0'],
['mol_fc_overlap_9', 'XXX', 'O6', 0, 'O6:0', 'O8', 0, 'O8:0', 'ffs', 'fusion', 'false_positive', 'substructure', (1, 2, 4, 16), (0, 1, 2, 4, 16), 34, mol, mol_o6, mol_o8, 'O6:0@0,1,2,3[ffs]O8:0@1,2,3,4'],
['mol_fc_overlap_9', 'XXX', 'O6', 0, 'O6:0', 'O9', 0, 'O9:0', 'ffs', 'fusion', 'false_positive', 'substructure', (1, 2, 4, 16), (3, 2, 1, 16, 4), 34, mol, mol_o6, mol_o9, 'O6:0@0,1,2,3[ffs]O9:0@1,2,3,4'],
['mol_fc_overlap_9', 'XXX', 'O7', 0, 'O7:0', 'O7', 1, 'O7:1', 'cm', 'connection', 'monopodal', '', (8, 9, 10), (13, 14, 15), 34, mol, mol_o7, mol_o7, 'O7:0@2[cm]O7:1@0'],
['mol_fc_overlap_9', 'XXX', 'O7', 0, 'O7:0', 'O8', 0, 'O8:0', 'cm', 'connection', 'monopodal', '', (8, 9, 10), (0, 1, 2, 4, 16), 34, mol, mol_o7, mol_o8, 'O7:0@0[cm]O8:0@3'],
['mol_fc_overlap_9', 'XXX', 'O7', 0, 'O7:0', 'O9', 0, 'O9:0', 'cm', 'connection', 'monopodal', '', (8, 9, 10), (3, 2, 1, 16, 4), 34, mol, mol_o7, mol_o9, 'O7:0@0[cm]O9:0@4'],
['mol_fc_overlap_9', 'XXX', 'O8', 0, 'O8:0', 'O9', 0, 'O9:0', 'ffo', 'fusion', 'false_positive', 'overlap', (0, 1, 2, 4, 16), (3, 2, 1, 16, 4), 34, mol, mol_o8, mol_o9, 'O8:0@1,2,3,4[ffo]O9:0@1,2,3,4'],
], columns=['idm', 'inchikey', 'idf1', 'idxf1', 'fid1', 'idf2', 'idxf2', 'fid2', 'fcc', 'category', 'type', 'subtype', '_aidxf1', '_aidxf2', 'hac', 'mol', 'mol_frag_1', 'mol_frag_2', 'fc'])
# ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ TESTS ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ #
def test_fcg_fc_simple(df_fc_simple):
"""Compute a fragment graph from fragment combinations"""
# default: 3 <= n <= 5
df_fcg = fragment_combination_graph.generate(df_fc_simple)
result = df_fcg.iloc[0]
assert result['fcg_str'] == 'QA:0@2[cm]QB:0@1-QA:0@5[cm]QC:0@0' and result['nfrags_u'] == 3
# when n > max (2)
df_fcg = fragment_combination_graph.generate(df_fc_simple, max_frags=2)
assert len(df_fcg.index) == 0
# when n < min (4)
df_fcg = fragment_combination_graph.generate(df_fc_simple, min_frags=4)
assert len(df_fcg.index) == 0
def test_fcg_fc_redundant(df_fc_redundant):
"""Compute a fragment graph from fragment combinations with multiple occurrences from a same fragment"""
df_fcg = fragment_combination_graph.generate(df_fc_redundant)
result = df_fcg.iloc[0]
assert result['fcg_str'] == 'QA:0@3[cm]QA:1@0' and result['nfrags'] == 2 and result['nfrags_u'] == 1
def test_fcg_fc_circular(df_fc_circular):
"""Compute a circular fragment graph from fragment combination"""
df_fcg = fragment_combination_graph.generate(df_fc_circular)
result = df_fcg.iloc[0]
assert result['fcg_str'] == 'QA:0@1[cm]QB:0@1-QA:0@1[cm]QC:0@1-QB:0@1[cm]QC:0@1' and result['nfrags'] == 3 and result['nfrags_u'] == 3
def test_fcg_fc_independant(df_fc_independant):
"""Compute 2 fragment graphs from 2 independent fragment combinations """
df_fcg = fragment_combination_graph.generate(df_fc_independant)
assert len(df_fcg.index) == 2
result1 = df_fcg.iloc[0]
assert result1['fcg_str'] == 'QA:0@0[cm]QB:0@1' and result1['nfrags'] == 2 and result1['nfrags_u'] == 2
result2 = df_fcg.iloc[1]
assert result2['fcg_str'] == 'QC:0@1,2[fe]QD:0@0,5' and result2['nfrags'] == 2 and result2['nfrags_u'] == 2
def test_fcg_fc_overlap_1(df_fc_overlap_1):
"""Split 2 overlapping fragments that result in no fragment graphs"""
df_fcg = fragment_combination_graph.generate(df_fc_overlap_1)
assert len(df_fcg.index) == 0
def test_fcg_fc_overlap_2(df_fc_overlap_2):
"""Split 2 overlapping fragments that result in 2 fragment graphs"""
df_fcg = fragment_combination_graph.generate(df_fc_overlap_2)
assert len(df_fcg.index) == 2
assert sorted(list(df_fcg['fcg_str'].values)) == ['O1:0@4[cm]O3:0@0',
'O2:0@3[cm]O3:0@0'
]
def test_fcg_fc_overlap_3(df_fc_overlap_3):
"""Split 2 overlapping fragments that result in longer 2 fragment graphs"""
df_fcg = fragment_combination_graph.generate(df_fc_overlap_3)
assert len(df_fcg.index) == 2
assert sorted(list(df_fcg['fcg_str'].values)) == ['O6:0@2[cm]O7:0@0-O1:0@4[cm]O6:0@0',
'O6:0@2[cm]O7:0@0-O2:0@3[cm]O6:0@0'
]
def test_fcg_fc_overlap_4(df_fc_overlap_4):
"""Split 2x2 overlapping fragments that result in 0 fragment graphs"""
df_fcg = fragment_combination_graph.generate(df_fc_overlap_4)
assert len(df_fcg.index) == 0
def test_fcg_fc_overlap_5(df_fc_overlap_5):
"""Split 2x2 overlapping fragments that result in 4 fragment graphs"""
df_fcg = fragment_combination_graph.generate(df_fc_overlap_5)
assert len(df_fcg.index) == 4
# test each of the fgraphs
# for i in range(len(df_fcg.index)):
# print(df_fcg.iloc[i]['fcg_str'])
assert sorted(list(df_fcg['fcg_str'].values)) == ['O1:0@4[cm]O4:0@3',
'O1:0@4[cm]O5:0@5',
'O2:0@5[cm]O4:0@3',
'O2:0@5[cm]O5:0@5',
]
def test_fcg_fc_overlap_6(df_fc_overlap_6):
"""Split 2x2 overlapping fragments that result in 4 fragment graphs"""
df_fcg = fragment_combination_graph.generate(df_fc_overlap_6)
assert len(df_fcg.index) == 4
assert sorted(list(df_fcg['fcg_str'].values)) == ['O6:0@2[cm]O7:0@0-O1:0@4[cm]O5:0@5-O2:0@3[cm]O4:0@3',
'O6:0@2[cm]O7:0@0-O1:0@5[cm]O6:0@0-O2:0@3[cm]O4:0@3',
'O6:0@2[cm]O7:0@0-O2:0@3[cm]O5:0@5-O2:0@4[cm]O6:0@0',
'O6:0@2[cm]O7:0@0-O2:0@4[cm]O6:0@0-O2:0@4[cm]O6:0@0',
]
def test_fcg_fc_overlap_7(df_fc_overlap_7):
"""Split 3x2 overlapping fragments that result in 3 fragment graphs"""
df_fcg = fragment_combination_graph.generate(df_fc_overlap_7)
assert len(df_fcg.index) == 3
assert sorted(list(df_fcg['fcg_str'].values)) == ['O1:0@4[cm]O6:0@0',
'O2:0@3[cm]O6:0@0',
'O3:0@3[cm]O6:0@0',
]
def test_fcg_fc_overlap_8(df_fc_overlap_8):
"""Split 3x2 overlapping fragments that result in 3 longer fragment graphs"""
df_fcg = fragment_combination_graph.generate(df_fc_overlap_8)
assert len(df_fcg.index) == 3
assert sorted(list(df_fcg['fcg_str'].values)) == ['O6:0@2[cm]O7:0@0-O1:0@4[cm]O6:0@0',
'O6:0@2[cm]O7:0@0-O2:0@3[cm]O6:0@0',
'O6:0@2[cm]O7:0@0-O3:0@3[cm]O6:0@0',
]
def test_fcg_fc_overlap_9(df_fc_overlap_9):
"""Split 2x2x2 overlapping fragments that result in 8 fragment graphs"""
df_fcg = fragment_combination_graph.generate(df_fc_overlap_9)
assert len(df_fcg.index) == 8
assert sorted(list(df_fcg['fcg_str'].values)) == ['O7:0@2[cm]O7:1@0-O1:0@4[cm]O4:0@3-O4:0@5[cm]O8:0@4-O7:0@0[cm]O8:0@3',
'O7:0@2[cm]O7:1@0-O1:0@4[cm]O4:0@3-O4:0@5[cm]O9:0@3-O7:0@0[cm]O9:0@4',
'O7:0@2[cm]O7:1@0-O1:0@4[cm]O5:0@2-O5:0@4[cm]O8:0@4-O7:0@0[cm]O8:0@3',
'O7:0@2[cm]O7:1@0-O1:0@4[cm]O5:0@2-O5:0@4[cm]O9:0@3-O7:0@0[cm]O9:0@4',
'O7:0@2[cm]O7:1@0-O2:0@5[cm]O4:0@3-O4:0@5[cm]O8:0@4-O7:0@0[cm]O8:0@3',
'O7:0@2[cm]O7:1@0-O2:0@5[cm]O4:0@3-O4:0@5[cm]O9:0@3-O7:0@0[cm]O9:0@4',
'O7:0@2[cm]O7:1@0-O2:0@5[cm]O5:0@2-O5:0@4[cm]O8:0@4-O7:0@0[cm]O8:0@3',
'O7:0@2[cm]O7:1@0-O2:0@5[cm]O5:0@2-O5:0@4[cm]O9:0@3-O7:0@0[cm]O9:0@4',
]
| 81.221239 | 254 | 0.520121 | 4,789 | 27,534 | 2.847776 | 0.045939 | 0.061373 | 0.014078 | 0.014958 | 0.838466 | 0.80503 | 0.77526 | 0.698563 | 0.648189 | 0.571345 | 0 | 0.149896 | 0.232658 | 27,534 | 338 | 255 | 81.461538 | 0.495598 | 0.084078 | 0 | 0.237069 | 0 | 0.168103 | 0.321803 | 0.078715 | 0 | 0 | 0 | 0 | 0.103448 | 1 | 0.112069 | false | 0 | 0.021552 | 0 | 0.189655 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 1 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
9b97c64518cdbc6b159e03d9f53cd04e76f69545 | 89 | py | Python | apps/cabinet/apps.py | dselifonov/eduProj | b191cea14852913da0a7aba66a78fb7a8d70194e | [
"MIT"
] | 3 | 2020-06-11T10:57:22.000Z | 2021-03-25T02:45:05.000Z | apps/cabinet/apps.py | dselifonov/eduProj | b191cea14852913da0a7aba66a78fb7a8d70194e | [
"MIT"
] | 6 | 2020-06-05T17:18:41.000Z | 2022-03-11T23:14:47.000Z | apps/cabinet/apps.py | sunfan666/cmdb | 71722a8dddf5e337d7658328cfcac0c9108b067c | [
"MIT"
] | null | null | null | from django.apps import AppConfig
class CabinetConfig(AppConfig):
name = 'cabinet'
| 14.833333 | 33 | 0.752809 | 10 | 89 | 6.7 | 0.9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.168539 | 89 | 5 | 34 | 17.8 | 0.905405 | 0 | 0 | 0 | 0 | 0 | 0.078652 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.333333 | 0 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
32eb9c31eed2097b0963d5bef6f75c933daa2c59 | 52 | py | Python | opmodaq/opmodaq/signal.py | MenloSystems/opMoDAQ | 8e35eeb028ae8001fdbebeeeb95a15b98f0fd4ba | [
"MIT"
] | null | null | null | opmodaq/opmodaq/signal.py | MenloSystems/opMoDAQ | 8e35eeb028ae8001fdbebeeeb95a15b98f0fd4ba | [
"MIT"
] | null | null | null | opmodaq/opmodaq/signal.py | MenloSystems/opMoDAQ | 8e35eeb028ae8001fdbebeeeb95a15b98f0fd4ba | [
"MIT"
] | null | null | null |
import types
import opmodaq.parameters as params
| 8.666667 | 35 | 0.807692 | 7 | 52 | 6 | 0.857143 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.173077 | 52 | 5 | 36 | 10.4 | 0.976744 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
fd068b5db65a735e2c553343c102b89872b54980 | 145 | py | Python | snake/__main__.py | dotKuro/vorsemesterWISE19-20 | 436c6d1846b6c1bfb087652e8ca179bd1b12c28e | [
"CC0-1.0"
] | 1 | 2019-09-27T13:47:20.000Z | 2019-09-27T13:47:20.000Z | snake/__main__.py | dotKuro/vorsemesterWISE19-20 | 436c6d1846b6c1bfb087652e8ca179bd1b12c28e | [
"CC0-1.0"
] | null | null | null | snake/__main__.py | dotKuro/vorsemesterWISE19-20 | 436c6d1846b6c1bfb087652e8ca179bd1b12c28e | [
"CC0-1.0"
] | null | null | null | from game import Game, simple_apple_ai
if __name__ == '__main__':
game = Game(ai=simple_apple_ai)
game.init_game()
game.game_loop()
| 20.714286 | 38 | 0.703448 | 22 | 145 | 4 | 0.5 | 0.272727 | 0.295455 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.186207 | 145 | 6 | 39 | 24.166667 | 0.745763 | 0 | 0 | 0 | 0 | 0 | 0.055172 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.2 | 0 | 0.2 | 0 | 1 | 0 | 0 | null | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
fd40cc503eafa533a5fbcb5cf7f42adf30266ea5 | 84 | py | Python | conftest.py | quarckster/pypeln | f4160d0f4d4718b67f79a0707d7261d249459a4b | [
"MIT"
] | 1,281 | 2018-09-20T05:35:27.000Z | 2022-03-30T01:29:48.000Z | conftest.py | webclinic017/pypeln | 5231806f2cac9d2019dacbbcf913484fd268b8c1 | [
"MIT"
] | 78 | 2018-09-18T20:38:12.000Z | 2022-03-30T20:16:02.000Z | conftest.py | webclinic017/pypeln | 5231806f2cac9d2019dacbbcf913484fd268b8c1 | [
"MIT"
] | 88 | 2018-09-24T10:46:14.000Z | 2022-03-28T09:34:50.000Z | from hypothesis import settings
settings.register_profile("pypeln", deadline=1000)
| 21 | 50 | 0.833333 | 10 | 84 | 6.9 | 0.9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.051948 | 0.083333 | 84 | 3 | 51 | 28 | 0.844156 | 0 | 0 | 0 | 0 | 0 | 0.071429 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 0.5 | 0 | 0.5 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
fd449ced563ec630914fb8c960aabcc24ef343de | 93 | py | Python | quizesApp/apps.py | i3dprogrammer/Django-GraduationProject | 2445b9f773638a344be8625f0d9ef6c149e68015 | [
"MIT"
] | null | null | null | quizesApp/apps.py | i3dprogrammer/Django-GraduationProject | 2445b9f773638a344be8625f0d9ef6c149e68015 | [
"MIT"
] | null | null | null | quizesApp/apps.py | i3dprogrammer/Django-GraduationProject | 2445b9f773638a344be8625f0d9ef6c149e68015 | [
"MIT"
] | null | null | null | from django.apps import AppConfig
class QuizesappConfig(AppConfig):
name = 'quizesApp'
| 15.5 | 33 | 0.763441 | 10 | 93 | 7.1 | 0.9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.16129 | 93 | 5 | 34 | 18.6 | 0.910256 | 0 | 0 | 0 | 0 | 0 | 0.096774 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.333333 | 0 | 1 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
b5bc06940db3e4f1e37a328feaf06fa38e96d64a | 64 | py | Python | tests/__init__.py | hiroaki-yamamoto/WTF-OTP | e7c87839cbe8683dd1f691912156ac348dc98e67 | [
"Unlicense",
"MIT"
] | 1 | 2019-06-27T06:47:25.000Z | 2019-06-27T06:47:25.000Z | tests/__init__.py | hiroaki-yamamoto/WTF-OTP | e7c87839cbe8683dd1f691912156ac348dc98e67 | [
"Unlicense",
"MIT"
] | 2 | 2021-08-25T05:11:22.000Z | 2022-01-29T02:51:57.000Z | tests/__init__.py | hiroaki-yamamoto/WTF-OTP | e7c87839cbe8683dd1f691912156ac348dc98e67 | [
"Unlicense",
"MIT"
] | null | null | null | #!/usr/bin/env python
# coding=utf-8
"""WTF-OTP Unit tests."""
| 12.8 | 25 | 0.625 | 11 | 64 | 3.636364 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.017857 | 0.125 | 64 | 4 | 26 | 16 | 0.696429 | 0.828125 | 0 | null | 0 | null | 0 | 0 | null | 0 | 0 | 0 | null | 1 | null | true | 0 | 0 | null | null | null | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
b5d5d83080afc85ce20ec8db045d08a7f05a93fd | 263 | py | Python | slackborg/utils.py | josefdlange/slackborg | d27c312342e15248353c23c07bec45b043ce2718 | [
"MIT"
] | 14 | 2016-08-14T06:10:45.000Z | 2018-06-28T19:44:00.000Z | slackborg/utils.py | josefdlange/slackborg | d27c312342e15248353c23c07bec45b043ce2718 | [
"MIT"
] | 1 | 2016-09-14T14:01:52.000Z | 2016-09-14T14:01:52.000Z | slackborg/utils.py | josefdlange/slackborg | d27c312342e15248353c23c07bec45b043ce2718 | [
"MIT"
] | null | null | null | def at_bot(bot_id, message_text):
at_bot_string = "<@{}>:".format(bot_id)
return at_bot_string in message_text
def split_at_bot(bot_id, message_text):
at_bot_string = "<@{}>:".format(bot_id)
return message_text.replace(at_bot_string, "").strip()
| 32.875 | 58 | 0.707224 | 42 | 263 | 3.97619 | 0.309524 | 0.179641 | 0.263473 | 0.11976 | 0.586826 | 0.586826 | 0.586826 | 0.586826 | 0.586826 | 0.586826 | 0 | 0 | 0.136882 | 263 | 7 | 59 | 37.571429 | 0.735683 | 0 | 0 | 0.333333 | 0 | 0 | 0.045627 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.333333 | false | 0 | 0 | 0 | 0.666667 | 0 | 0 | 0 | 0 | null | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 4 |
b5e4b1e589642c1357d44ddb121e010faded27a5 | 21 | py | Python | aliyun-python-sdk-ons/aliyunsdkons/__init__.py | leafcoder/aliyun-openapi-python-sdk | 26b441ab37a5cda804de475fd5284bab699443f1 | [
"Apache-2.0"
] | 1,001 | 2015-07-24T01:32:41.000Z | 2022-03-25T01:28:18.000Z | aliyun-python-sdk-ons/aliyunsdkons/__init__.py | leafcoder/aliyun-openapi-python-sdk | 26b441ab37a5cda804de475fd5284bab699443f1 | [
"Apache-2.0"
] | 363 | 2015-10-20T03:15:00.000Z | 2022-03-08T12:26:19.000Z | aliyun-python-sdk-ons/aliyunsdkons/__init__.py | leafcoder/aliyun-openapi-python-sdk | 26b441ab37a5cda804de475fd5284bab699443f1 | [
"Apache-2.0"
] | 682 | 2015-09-22T07:19:02.000Z | 2022-03-22T09:51:46.000Z | __version__ = '3.1.7' | 21 | 21 | 0.666667 | 4 | 21 | 2.5 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.157895 | 0.095238 | 21 | 1 | 21 | 21 | 0.368421 | 0 | 0 | 0 | 0 | 0 | 0.227273 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
bd0bf05169e97de7079bcaddd895c0af252a28fe | 680 | py | Python | 2022/Design-Patterns-1/discounts.py | Muramatsu2602/python-study | c81eb5d2c343817bc29b2763dcdcabed0f6a42c6 | [
"MIT"
] | null | null | null | 2022/Design-Patterns-1/discounts.py | Muramatsu2602/python-study | c81eb5d2c343817bc29b2763dcdcabed0f6a42c6 | [
"MIT"
] | null | null | null | 2022/Design-Patterns-1/discounts.py | Muramatsu2602/python-study | c81eb5d2c343817bc29b2763dcdcabed0f6a42c6 | [
"MIT"
] | null | null | null | class Discount_for_five_items(object):
def __init__(self, next_discount):
self.__next_discount = next_discount
def calc(self, budget):
if budget.num_items > 5:
return budget.value * 0.1
else:
return self.__next_discount.calc(budget)
class Discount_for_more_than_five_hundred_dollars(object):
def __init__(self, next_discount):
self.__next_discount = next_discount
def calc(self, budget):
if budget.value > 500:
return budget.value * 0.07
else:
return self.__next_discount.calc(budget)
class No_discount(object):
def calc(self, budget):
return 0
| 21.935484 | 58 | 0.645588 | 86 | 680 | 4.697674 | 0.313953 | 0.237624 | 0.237624 | 0.126238 | 0.608911 | 0.608911 | 0.608911 | 0.608911 | 0.405941 | 0.405941 | 0 | 0.020243 | 0.273529 | 680 | 30 | 59 | 22.666667 | 0.797571 | 0 | 0 | 0.578947 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.263158 | false | 0 | 0 | 0.052632 | 0.684211 | 0 | 0 | 0 | 0 | null | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 4 |
bd116e1dc36bbf7938430896445014bb96ea2037 | 73 | py | Python | python-starter/project/mysite/__init__.py | foosinn/slides | b0269dd2ef5df454ec5c475cff8968630cffc96a | [
"Apache-2.0"
] | 2 | 2019-07-23T18:35:10.000Z | 2019-08-23T06:02:04.000Z | python-starter/project/mysite/__init__.py | foosinn/slides | b0269dd2ef5df454ec5c475cff8968630cffc96a | [
"Apache-2.0"
] | null | null | null | python-starter/project/mysite/__init__.py | foosinn/slides | b0269dd2ef5df454ec5c475cff8968630cffc96a | [
"Apache-2.0"
] | 1 | 2019-08-06T18:43:24.000Z | 2019-08-06T18:43:24.000Z | from flask import Flask
app = Flask(__name__)
from mysite import routes
| 14.6 | 25 | 0.794521 | 11 | 73 | 4.909091 | 0.636364 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.164384 | 73 | 4 | 26 | 18.25 | 0.885246 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.666667 | 0 | 0.666667 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
bd1800d1f68fde7f293295cea724fea6ad111a00 | 181 | py | Python | .py_env/bin/django-admin.py | gigiljacob/recipe-app-api | 98a73bb1c175aad4ca1bcc4c26df7da6a93c9367 | [
"MIT"
] | null | null | null | .py_env/bin/django-admin.py | gigiljacob/recipe-app-api | 98a73bb1c175aad4ca1bcc4c26df7da6a93c9367 | [
"MIT"
] | null | null | null | .py_env/bin/django-admin.py | gigiljacob/recipe-app-api | 98a73bb1c175aad4ca1bcc4c26df7da6a93c9367 | [
"MIT"
] | null | null | null | #!/home/whitecarbon/Projects/recipe-app/recipe-app-api/.py_env/bin/python3
from django.core import management
if __name__ == "__main__":
management.execute_from_command_line()
| 30.166667 | 74 | 0.790055 | 25 | 181 | 5.24 | 0.84 | 0.137405 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.006024 | 0.082873 | 181 | 5 | 75 | 36.2 | 0.783133 | 0.403315 | 0 | 0 | 0 | 0 | 0.074766 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 0.333333 | 0 | 0.333333 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | 4 |
bd3803e0bf35218046a7e505d8a1a8fa5527c215 | 10,100 | py | Python | optimization/pre_optimization/just_sdeta_2.5_mg_cut/ma_files/Output/Histos/MadAnalysis5job_0/selection_9.py | sheride/axion_pheno | 7d3fc08f5ae5b17a3500eba19a2e43f87f076ce5 | [
"MIT"
] | null | null | null | optimization/pre_optimization/just_sdeta_2.5_mg_cut/ma_files/Output/Histos/MadAnalysis5job_0/selection_9.py | sheride/axion_pheno | 7d3fc08f5ae5b17a3500eba19a2e43f87f076ce5 | [
"MIT"
] | null | null | null | optimization/pre_optimization/just_sdeta_2.5_mg_cut/ma_files/Output/Histos/MadAnalysis5job_0/selection_9.py | sheride/axion_pheno | 7d3fc08f5ae5b17a3500eba19a2e43f87f076ce5 | [
"MIT"
] | null | null | null | def selection_9():
# Library import
import numpy
import matplotlib
import matplotlib.pyplot as plt
import matplotlib.gridspec as gridspec
# Library version
matplotlib_version = matplotlib.__version__
numpy_version = numpy.__version__
# Histo binning
xBinning = numpy.linspace(0.0,4000.0,401,endpoint=True)
# Creating data sequence: middle of each bin
xData = numpy.array([5.0,15.0,25.0,35.0,45.0,55.0,65.0,75.0,85.0,95.0,105.0,115.0,125.0,135.0,145.0,155.0,165.0,175.0,185.0,195.0,205.0,215.0,225.0,235.0,245.0,255.0,265.0,275.0,285.0,295.0,305.0,315.0,325.0,335.0,345.0,355.0,365.0,375.0,385.0,395.0,405.0,415.0,425.0,435.0,445.0,455.0,465.0,475.0,485.0,495.0,505.0,515.0,525.0,535.0,545.0,555.0,565.0,575.0,585.0,595.0,605.0,615.0,625.0,635.0,645.0,655.0,665.0,675.0,685.0,695.0,705.0,715.0,725.0,735.0,745.0,755.0,765.0,775.0,785.0,795.0,805.0,815.0,825.0,835.0,845.0,855.0,865.0,875.0,885.0,895.0,905.0,915.0,925.0,935.0,945.0,955.0,965.0,975.0,985.0,995.0,1005.0,1015.0,1025.0,1035.0,1045.0,1055.0,1065.0,1075.0,1085.0,1095.0,1105.0,1115.0,1125.0,1135.0,1145.0,1155.0,1165.0,1175.0,1185.0,1195.0,1205.0,1215.0,1225.0,1235.0,1245.0,1255.0,1265.0,1275.0,1285.0,1295.0,1305.0,1315.0,1325.0,1335.0,1345.0,1355.0,1365.0,1375.0,1385.0,1395.0,1405.0,1415.0,1425.0,1435.0,1445.0,1455.0,1465.0,1475.0,1485.0,1495.0,1505.0,1515.0,1525.0,1535.0,1545.0,1555.0,1565.0,1575.0,1585.0,1595.0,1605.0,1615.0,1625.0,1635.0,1645.0,1655.0,1665.0,1675.0,1685.0,1695.0,1705.0,1715.0,1725.0,1735.0,1745.0,1755.0,1765.0,1775.0,1785.0,1795.0,1805.0,1815.0,1825.0,1835.0,1845.0,1855.0,1865.0,1875.0,1885.0,1895.0,1905.0,1915.0,1925.0,1935.0,1945.0,1955.0,1965.0,1975.0,1985.0,1995.0,2005.0,2015.0,2025.0,2035.0,2045.0,2055.0,2065.0,2075.0,2085.0,2095.0,2105.0,2115.0,2125.0,2135.0,2145.0,2155.0,2165.0,2175.0,2185.0,2195.0,2205.0,2215.0,2225.0,2235.0,2245.0,2255.0,2265.0,2275.0,2285.0,2295.0,2305.0,2315.0,2325.0,2335.0,2345.0,2355.0,2365.0,2375.0,2385.0,2395.0,2405.0,2415.0,2425.0,2435.0,2445.0,2455.0,2465.0,2475.0,2485.0,2495.0,2505.0,2515.0,2525.0,2535.0,2545.0,2555.0,2565.0,2575.0,2585.0,2595.0,2605.0,2615.0,2625.0,2635.0,2645.0,2655.0,2665.0,2675.0,2685.0,2695.0,2705.0,2715.0,2725.0,2735.0,2745.0,2755.0,2765.0,2775.0,2785.0,2795.0,2805.0,2815.0,2825.0,2835.0,2845.0,2855.0,2865.0,2875.0,2885.0,2895.0,2905.0,2915.0,2925.0,2935.0,2945.0,2955.0,2965.0,2975.0,2985.0,2995.0,3005.0,3015.0,3025.0,3035.0,3045.0,3055.0,3065.0,3075.0,3085.0,3095.0,3105.0,3115.0,3125.0,3135.0,3145.0,3155.0,3165.0,3175.0,3185.0,3195.0,3205.0,3215.0,3225.0,3235.0,3245.0,3255.0,3265.0,3275.0,3285.0,3295.0,3305.0,3315.0,3325.0,3335.0,3345.0,3355.0,3365.0,3375.0,3385.0,3395.0,3405.0,3415.0,3425.0,3435.0,3445.0,3455.0,3465.0,3475.0,3485.0,3495.0,3505.0,3515.0,3525.0,3535.0,3545.0,3555.0,3565.0,3575.0,3585.0,3595.0,3605.0,3615.0,3625.0,3635.0,3645.0,3655.0,3665.0,3675.0,3685.0,3695.0,3705.0,3715.0,3725.0,3735.0,3745.0,3755.0,3765.0,3775.0,3785.0,3795.0,3805.0,3815.0,3825.0,3835.0,3845.0,3855.0,3865.0,3875.0,3885.0,3895.0,3905.0,3915.0,3925.0,3935.0,3945.0,3955.0,3965.0,3975.0,3985.0,3995.0])
# Creating weights for histo: y10_M_0
y10_M_0_weights = numpy.array([1.48657969593,3.34480381584,5.20302833575,5.94631638372,6.3179644077,15.2374409833,11.5209927435,14.1225049113,17.0956651032,10.4060566715,20.068825295,16.7240210792,22.2986934389,21.183757367,21.183757367,23.7852735349,19.6971772711,20.440469319,24.9002056068,24.5285615828,26.3867857028,21.927049415,25.2718536308,28.2450098227,33.0763941344,32.3331060865,21.555401391,36.4211983503,28.2450098227,32.3331060865,28.6166538466,31.2181700145,20.812113343,29.3599458946,34.1913302064,26.0151416788,31.5898140385,30.4748819666,22.2986934389,31.9614580625,32.7047501105,27.5017217747,28.2450098227,25.6434976548,28.6166538466,28.2450098227,31.9614580625,26.3867857028,29.3599458946,27.8733657987,33.0763941344,26.7584297267,22.2986934389,31.2181700145,30.4748819666,36.7928423743,28.6166538466,24.5285615828,32.7047501105,26.3867857028,31.9614580625,27.1300777507,31.2181700145,27.5017217747,28.2450098227,30.4748819666,21.183757367,26.0151416788,24.5285615828,26.0151416788,27.1300777507,24.1569175589,25.2718536308,26.7584297267,21.555401391,18.5822451991,23.4136255109,22.6703374629,19.6971772711,23.0419814869,25.2718536308,22.2986934389,24.5285615828,17.4673091272,23.0419814869,22.6703374629,23.7852735349,20.440469319,19.3255332471,24.9002056068,18.5822451991,16.7240210792,17.4673091272,15.9807290312,21.555401391,17.0956651032,21.927049415,13.7508608873,14.8657969593,21.927049415,17.0956651032,20.440469319,14.4941489353,18.2105971751,15.6090850073,22.2986934389,19.3255332471,18.5822451991,20.812113343,21.183757367,13.7508608873,18.5822451991,17.0956651032,15.9807290312,18.2105971751,12.6359248154,14.8657969593,13.7508608873,14.1225049113,16.3523730552,11.5209927435,19.6971772711,15.6090850073,15.2374409833,15.2374409833,10.0344126475,12.2642807914,15.6090850073,10.0344126475,14.8657969593,15.9807290312,16.3523730552,13.7508608873,10.4060566715,10.4060566715,11.5209927435,14.8657969593,10.7777006955,7.43289647965,14.4941489353,11.8926367674,8.17618852761,10.0344126475,10.0344126475,6.3179644077,8.5478325516,10.4060566715,8.5478325516,11.1493447195,8.5478325516,6.3179644077,7.80454050363,8.5478325516,8.5478325516,10.4060566715,6.68960843168,8.5478325516,5.20302833575,7.43289647965,10.0344126475,8.5478325516,8.17618852761,8.17618852761,10.7777006955,7.43289647965,7.06125245567,8.17618852761,7.80454050363,8.17618852761,7.43289647965,5.57467235974,6.3179644077,9.66276862354,6.3179644077,7.80454050363,5.94631638372,6.3179644077,6.3179644077,7.80454050363,4.08809226381,6.68960843168,5.20302833575,3.71644863982,7.43289647965,5.57467235974,5.57467235974,5.57467235974,2.22986934389,5.20302833575,3.34480381584,3.34480381584,5.20302833575,5.20302833575,6.68960843168,5.57467235974,4.45974028779,2.60151416788,3.34480381584,4.45974028779,3.71644863982,6.3179644077,4.83138431177,4.08809226381,3.71644863982,4.08809226381,5.94631638372,1.85822451991,4.83138431177,3.71644863982,4.08809226381,4.45974028779,4.83138431177,2.97315899186,4.08809226381,3.34480381584,5.94631638372,2.97315899186,5.20302833575,4.83138431177,3.34480381584,2.60151416788,4.45974028779,1.85822451991,1.85822451991,2.60151416788,3.71644863982,3.71644863982,2.22986934389,0.743289647965,2.60151416788,3.71644863982,2.22986934389,2.97315899186,1.11493447195,3.71644863982,2.97315899186,4.45974028779,1.85822451991,2.97315899186,3.71644863982,0.743289647965,2.22986934389,2.22986934389,1.85822451991,2.97315899186,4.08809226381,1.85822451991,2.22986934389,2.22986934389,1.11493447195,2.22986934389,3.71644863982,3.34480381584,1.48657969593,2.22986934389,2.22986934389,3.34480381584,3.34480381584,0.743289647965,2.60151416788,1.48657969593,2.22986934389,1.11493447195,1.11493447195,1.11493447195,2.60151416788,3.71644863982,1.11493447195,2.60151416788,0.743289647965,1.85822451991,1.85822451991,0.743289647965,0.743289647965,2.60151416788,0.743289647965,1.48657969593,2.22986934389,1.11493447195,1.85822451991,0.743289647965,1.85822451991,2.60151416788,1.85822451991,1.85822451991,0.743289647965,0.743289647965,1.85822451991,1.11493447195,1.11493447195,0.743289647965,0.743289647965,1.11493447195,0.0,1.48657969593,1.48657969593,0.743289647965,1.11493447195,2.22986934389,1.48657969593,1.48657969593,1.48657969593,0.743289647965,1.11493447195,1.48657969593,1.11493447195,1.11493447195,0.743289647965,2.22986934389,1.11493447195,0.743289647965,0.743289647965,1.11493447195,0.743289647965,0.371644863982,1.48657969593,0.743289647965,0.371644863982,1.48657969593,0.371644863982,0.0,0.743289647965,0.371644863982,1.85822451991,0.743289647965,0.371644863982,1.11493447195,1.85822451991,0.743289647965,0.743289647965,0.371644863982,0.743289647965,0.371644863982,0.743289647965,0.0,1.48657969593,0.743289647965,1.48657969593,0.0,0.371644863982,0.371644863982,0.371644863982,0.371644863982,0.743289647965,1.11493447195,0.743289647965,0.371644863982,1.11493447195,1.11493447195,0.743289647965,0.0,0.371644863982,0.371644863982,0.371644863982,0.743289647965,0.0,0.371644863982,0.0,0.743289647965,1.11493447195,0.371644863982,0.743289647965,1.11493447195,0.371644863982,0.371644863982,0.0,0.0,0.743289647965,0.371644863982,0.0,0.0,0.371644863982,0.0,0.743289647965,0.371644863982,0.743289647965,0.0,1.48657969593,0.371644863982,0.0,0.371644863982,0.0,0.743289647965,0.371644863982,0.371644863982,0.371644863982,0.371644863982,0.371644863982,0.0,0.743289647965,0.0,0.371644863982,0.371644863982,0.371644863982,0.0,0.0,0.743289647965,0.0,0.371644863982,0.743289647965])
# Creating a new Canvas
fig = plt.figure(figsize=(8,6),dpi=80)
frame = gridspec.GridSpec(1,1)
pad = fig.add_subplot(frame[0])
# Creating a new Stack
pad.hist(x=xData, bins=xBinning, weights=y10_M_0_weights,\
label="$signal$", histtype="stepfilled", rwidth=1.0,\
color="#5954d8", edgecolor="#5954d8", linewidth=1, linestyle="solid",\
bottom=None, cumulative=False, normed=False, align="mid", orientation="vertical")
# Axis
plt.rc('text',usetex=False)
plt.xlabel(r"M [ a_{1} , a_{2} ] ( GeV ) ",\
fontsize=16,color="black")
plt.ylabel(r"$\mathrm{Events}$ $(\mathcal{L}_{\mathrm{int}} = 40.0\ \mathrm{fb}^{-1})$ ",\
fontsize=16,color="black")
# Boundary of y-axis
ymax=(y10_M_0_weights).max()*1.1
ymin=0 # linear scale
#ymin=min([x for x in (y10_M_0_weights) if x])/100. # log scale
plt.gca().set_ylim(ymin,ymax)
# Log/Linear scale for X-axis
plt.gca().set_xscale("linear")
#plt.gca().set_xscale("log",nonposx="clip")
# Log/Linear scale for Y-axis
plt.gca().set_yscale("linear")
#plt.gca().set_yscale("log",nonposy="clip")
# Saving the image
plt.savefig('../../HTML/MadAnalysis5job_0/selection_9.png')
plt.savefig('../../PDF/MadAnalysis5job_0/selection_9.png')
plt.savefig('../../DVI/MadAnalysis5job_0/selection_9.eps')
# Running!
if __name__ == '__main__':
selection_9()
| 160.31746 | 5,477 | 0.770099 | 1,870 | 10,100 | 4.133155 | 0.338503 | 0.065597 | 0.050718 | 0.040367 | 0.20339 | 0.179195 | 0.168198 | 0.11942 | 0.083064 | 0.04399 | 0 | 0.681391 | 0.040693 | 10,100 | 62 | 5,478 | 162.903226 | 0.116317 | 0.042574 | 0 | 0.0625 | 0 | 0.03125 | 0.032743 | 0.016371 | 0 | 0 | 0 | 0 | 0 | 1 | 0.03125 | false | 0 | 0.125 | 0 | 0.15625 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 1 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
1faade36535ebf56d5b8d229ec4e7f25036a3dc2 | 529 | py | Python | solutions/2015/adventCoins.py | IronhandedLayman/AdventOfCode | cb30cc08f6af9d54d4673609bc5ac7f58311d12f | [
"MIT"
] | null | null | null | solutions/2015/adventCoins.py | IronhandedLayman/AdventOfCode | cb30cc08f6af9d54d4673609bc5ac7f58311d12f | [
"MIT"
] | null | null | null | solutions/2015/adventCoins.py | IronhandedLayman/AdventOfCode | cb30cc08f6af9d54d4673609bc5ac7f58311d12f | [
"MIT"
] | null | null | null | #!/usr/bin/env python3
import hashlib
def part1(inp):
return adventCoinNonce(inp,"00000")
def part2(inp):
return adventCoinNonce(inp,"000000")
def adventCoinNonce(inp, difficulty):
ans = 0
while (ans < 4000000000000):
ans = ans + 1
m = hashlib.md5()
key = inp+str(ans)
m.update(key.encode())
if m.hexdigest().startswith(difficulty):
return ans
return -1
def fromFile(fn,func):
with open(fn,'r') as f:
cin = f.read()
return func(cin)
| 21.16 | 48 | 0.589792 | 68 | 529 | 4.588235 | 0.573529 | 0.173077 | 0.153846 | 0.173077 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.081152 | 0.277883 | 529 | 24 | 49 | 22.041667 | 0.735602 | 0.039698 | 0 | 0 | 0 | 0 | 0.023669 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.210526 | false | 0 | 0.052632 | 0.105263 | 0.526316 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 4 |
1fb3249ad338ca7bb18fb51b49988f6fcfbcb86a | 30 | py | Python | tests/__init__.py | anlcnydn/graceful | d4678cb6349a5c843a5e58002fc80140821609e4 | [
"BSD-3-Clause"
] | 83 | 2015-06-18T18:08:50.000Z | 2021-05-21T06:12:46.000Z | tests/__init__.py | anlcnydn/graceful | d4678cb6349a5c843a5e58002fc80140821609e4 | [
"BSD-3-Clause"
] | 59 | 2015-07-02T12:28:50.000Z | 2019-01-21T18:32:47.000Z | tests/__init__.py | anlcnydn/graceful | d4678cb6349a5c843a5e58002fc80140821609e4 | [
"BSD-3-Clause"
] | 14 | 2015-08-26T22:43:47.000Z | 2020-04-17T11:00:37.000Z | """Graceful tests package."""
| 15 | 29 | 0.666667 | 3 | 30 | 6.666667 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.1 | 30 | 1 | 30 | 30 | 0.740741 | 0.766667 | 0 | null | 0 | null | 0 | 0 | null | 0 | 0 | 0 | null | 1 | null | true | 0 | 0 | null | null | null | 1 | 1 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 4 |
1fb5596e7b3207ac563f1bb3654013c9e3baf9e7 | 246 | py | Python | models/modules/__init__.py | WenmuZhou/crnn.gluon | cef44837e052d1934289f0f9e3fb57972e28cc6b | [
"Apache-2.0"
] | 29 | 2018-03-04T07:16:16.000Z | 2021-01-25T08:09:26.000Z | models/modules/__init__.py | WenmuZhou/crnn.gluon | cef44837e052d1934289f0f9e3fb57972e28cc6b | [
"Apache-2.0"
] | 9 | 2018-04-23T03:51:42.000Z | 2020-04-24T12:45:34.000Z | models/modules/__init__.py | WenmuZhou/crnn.gluon | cef44837e052d1934289f0f9e3fb57972e28cc6b | [
"Apache-2.0"
] | 7 | 2018-11-23T01:15:46.000Z | 2020-03-30T06:24:53.000Z | # -*- coding: utf-8 -*-
# @Time : 2019/7/11 10:05
# @Author : zhoujun
from .seg import UNet, ResNetFPN
from .feature_extraction import *
from .sequence_modeling import RNNDecoder as RNN, CNNDecoder as CNN
from .prediction import CTC,CTC_CNN
| 27.333333 | 67 | 0.727642 | 36 | 246 | 4.888889 | 0.75 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.058537 | 0.166667 | 246 | 8 | 68 | 30.75 | 0.8 | 0.272358 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
1fbc1404fe6861c6db5d878c667f4290cf47f691 | 87 | py | Python | txxlz/__main__.py | ignertic/txxlz | 22f60618220e8793f53bd877ff0cc17850e4b3c7 | [
"MIT"
] | 3 | 2018-12-17T11:56:43.000Z | 2018-12-17T11:56:46.000Z | txxlz/__main__.py | ignertic/txxlz | 22f60618220e8793f53bd877ff0cc17850e4b3c7 | [
"MIT"
] | null | null | null | txxlz/__main__.py | ignertic/txxlz | 22f60618220e8793f53bd877ff0cc17850e4b3c7 | [
"MIT"
] | null | null | null | #__main__.py
def main():
"""Execute any function"""
print("Hello There!")
| 5.8 | 27 | 0.574713 | 10 | 87 | 4.6 | 0.9 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.241379 | 87 | 14 | 28 | 6.214286 | 0.69697 | 0.367816 | 0 | 0 | 0 | 0 | 0.244898 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.5 | true | 0 | 0 | 0 | 0.5 | 0.5 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 1 | 0 | 4 |
1fe5f526240125f29763d6876ec83f167c0b26f8 | 3,199 | py | Python | tspec_cmd_impl/lmt_cdr.py | jeremyko/let-me-test | c227d8522c25108eb0b21f8aa36798ac0611eaaf | [
"MIT"
] | null | null | null | tspec_cmd_impl/lmt_cdr.py | jeremyko/let-me-test | c227d8522c25108eb0b21f8aa36798ac0611eaaf | [
"MIT"
] | null | null | null | tspec_cmd_impl/lmt_cdr.py | jeremyko/let-me-test | c227d8522c25108eb0b21f8aa36798ac0611eaaf | [
"MIT"
] | null | null | null | #-*- coding: utf-8 -*-
#import os
#import subprocess
#import glob
from module_core import lmt_exception
from module_core import lmt_util
#TODO
# assert_cdr_fld_len |(필드명, 자리수)|
# assert_cdr_fld_eq |(필드명)|
# save_cdr_fld_value |(cdr형식, 필드명, cdr경로)|
"""
first = []
for file in glob.glob(monthDir +"/"+day+"*.txt"):
if fileContains(file, 'Algeria|Bahrain') and fileContains(file, 'Protest|protesters'):
file.append(first)
"""
"""
#///////////////////////////////////////////////////////////////////////////////
# CDR 특정 항목 값들을 로깅한다. (근거 자료 준비 등에 사용)
#///////////////////////////////////////////////////////////////////////////////
def grep_ov_result (runner_ctx, ov_cmd, to_find_str, head_n):
ov_cmd = lmt_util.replace_all_symbols(runner_ctx,ov_cmd)
runner_ctx.logger.debug("{}ov cmd : {}".format(runner_ctx.cur_indent,ov_cmd))
#================================================ using check_output
ov_cmd_full = "{} | grep '{}' | head -n {} ".format( ov_cmd, to_find_str, head_n)
runner_ctx.logger.info("{}ov cmd full : {}".format(runner_ctx.cur_indent,ov_cmd_full))
output = subprocess.check_output(ov_cmd_full, shell=True)
if(output):
out_list = output.split("\n")
if(out_list):
for outval in out_list:
if(len(outval)>0):
runner_ctx.logger.info("{}grep ov : {}".format(runner_ctx.cur_indent,outval))
#================================================ using Popen
return True
#///////////////////////////////////////////////////////////////////////////////
def ov_grep_assert_eq (runner_ctx, ov_cmd, expect_num):
ov_cmd = lmt_util.replace_all_symbols(runner_ctx,ov_cmd)
runner_ctx.logger.info("{}ov cmd : {}".format(runner_ctx.cur_indent,ov_cmd))
runner_ctx.logger.info("{}expected : {}".format(runner_ctx.cur_indent,expect_num))
output = subprocess.check_output(ov_cmd, shell=True)
if(output):
found_cnt = int(output)
runner_ctx.logger.debug("{}ov cmd returns : {}".format(runner_ctx.cur_indent,found_cnt))
if(expect_num != found_cnt):
err_msg = "ov grep assert failed : actual({}) != expected({})".format(found_cnt,expect_num)
runner_ctx.logger.error("{}".format(runner_ctx.cur_indent,err_msg))
raise lmt_exception.LmtException(err_msg)
else:
return False
return True
"""
"""
#cmd_list = ov_cmd.split(" ")
#p1 = subprocess.Popen(cmd_list,stdout=subprocess.PIPE) # 파일 명시하면 ok ,* 사용시 에러
p1 = subprocess.Popen(ov_cmd, shell=True, stdout=subprocess.PIPE) # shell=True -> for "*"
p2 = subprocess.Popen(["grep", to_find_str], stdin=p1.stdout, stdout=subprocess.PIPE)
p3 = subprocess.Popen(["head", "-n", str(head_n)], stdin=p2.stdout, stdout=subprocess.PIPE)
p1.stdout.close()
p2.stdout.close()
output = p3.communicate()[0]
#output = p3.stdout.read()
if(output):
out_list = output.split("\n")
if(out_list):
for outval in out_list:
if(len(outval)>0):
runner_ctx.logger.info("{}grep ov : {}".format(runner_ctx.cur_indent,outval))
"""
#================================================
| 38.542169 | 103 | 0.571429 | 403 | 3,199 | 4.282878 | 0.280397 | 0.104287 | 0.069525 | 0.08343 | 0.449594 | 0.367323 | 0.285632 | 0.246813 | 0.246813 | 0.207416 | 0 | 0.005301 | 0.17443 | 3,199 | 82 | 104 | 39.012195 | 0.648239 | 0.077837 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.012195 | 0 | 1 | 0 | true | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
1ff5814782054d8e9ea5d4ffe835825e4f6db296 | 397 | py | Python | assay_interchange/routes.py | whereskenneth/AssayInterchange | 051ba962f78b5522d9a9c3a07da1285c065b2f76 | [
"MIT"
] | null | null | null | assay_interchange/routes.py | whereskenneth/AssayInterchange | 051ba962f78b5522d9a9c3a07da1285c065b2f76 | [
"MIT"
] | null | null | null | assay_interchange/routes.py | whereskenneth/AssayInterchange | 051ba962f78b5522d9a9c3a07da1285c065b2f76 | [
"MIT"
] | null | null | null | from assay_interchange import app
from flask import request
from assay_interchange.lib import convert_data, validate_data
@app.route('/', methods=['GET'])
def index():
return app.send_static_file('index.html')
@app.route('/', methods=['POST'])
def index_post():
return convert_data(request)
@app.route('/validate', methods=['POST'])
def validate():
return validate_data(request)
| 20.894737 | 61 | 0.725441 | 53 | 397 | 5.264151 | 0.415094 | 0.086022 | 0.143369 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.123426 | 397 | 18 | 62 | 22.055556 | 0.801724 | 0 | 0 | 0 | 0 | 0 | 0.080605 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.25 | true | 0 | 0.25 | 0.25 | 0.75 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 1 | 0 | 0 | 1 | 1 | 0 | 0 | 4 |
95001304cbec794a90b345bc586a0d3084b04a54 | 171 | py | Python | commands/help.py | irishpatrick/arduino-dep-tracker | ec12cd3fcbb05c701380a142a2cfea9a3c607554 | [
"MIT"
] | null | null | null | commands/help.py | irishpatrick/arduino-dep-tracker | ec12cd3fcbb05c701380a142a2cfea9a3c607554 | [
"MIT"
] | null | null | null | commands/help.py | irishpatrick/arduino-dep-tracker | ec12cd3fcbb05c701380a142a2cfea9a3c607554 | [
"MIT"
] | null | null | null | from .command import *
from .registry import *
class Help(Command):
def call(self, flags=[], opts=[]):
print("help window")
Registry.insert("help", Help())
| 17.1 | 38 | 0.631579 | 21 | 171 | 5.142857 | 0.666667 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.192982 | 171 | 9 | 39 | 19 | 0.782609 | 0 | 0 | 0 | 0 | 0 | 0.087719 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.166667 | false | 0 | 0.333333 | 0 | 0.666667 | 0.166667 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 | 0 | 0 | 4 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.