repo_name
stringlengths
6
100
path
stringlengths
4
294
copies
stringclasses
981 values
size
stringlengths
4
6
content
stringlengths
606
896k
license
stringclasses
15 values
rickerc/neutron_audit
neutron/openstack/common/rpc/impl_kombu.py
1
32063
# vim: tabstop=4 shiftwidth=4 softtabstop=4 # Copyright 2011 OpenStack Foundation # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import functools import itertools import socket import ssl import sys import time import uuid import eventlet import greenlet import kombu import kombu.connection import kombu.entity import kombu.messaging from oslo.config import cfg from neutron.openstack.common import excutils from neutron.openstack.common.gettextutils import _ from neutron.openstack.common import network_utils from neutron.openstack.common.rpc import amqp as rpc_amqp from neutron.openstack.common.rpc import common as rpc_common kombu_opts = [ cfg.StrOpt('kombu_ssl_version', default='', help='SSL version to use (valid only if SSL enabled)'), cfg.StrOpt('kombu_ssl_keyfile', default='', help='SSL key file (valid only if SSL enabled)'), cfg.StrOpt('kombu_ssl_certfile', default='', help='SSL cert file (valid only if SSL enabled)'), cfg.StrOpt('kombu_ssl_ca_certs', default='', help=('SSL certification authority file ' '(valid only if SSL enabled)')), cfg.StrOpt('rabbit_host', default='localhost', help='The RabbitMQ broker address where a single node is used'), cfg.IntOpt('rabbit_port', default=5672, help='The RabbitMQ broker port where a single node is used'), cfg.ListOpt('rabbit_hosts', default=['$rabbit_host:$rabbit_port'], help='RabbitMQ HA cluster host:port pairs'), cfg.BoolOpt('rabbit_use_ssl', default=False, help='connect over SSL for RabbitMQ'), cfg.StrOpt('rabbit_userid', default='guest', help='the RabbitMQ userid'), cfg.StrOpt('rabbit_password', default='guest', help='the RabbitMQ password', secret=True), cfg.StrOpt('rabbit_virtual_host', default='/', help='the RabbitMQ virtual host'), cfg.IntOpt('rabbit_retry_interval', default=1, help='how frequently to retry connecting with RabbitMQ'), cfg.IntOpt('rabbit_retry_backoff', default=2, help='how long to backoff for between retries when connecting ' 'to RabbitMQ'), cfg.IntOpt('rabbit_max_retries', default=0, help='maximum retries with trying to connect to RabbitMQ ' '(the default of 0 implies an infinite retry count)'), cfg.BoolOpt('rabbit_ha_queues', default=False, help='use H/A queues in RabbitMQ (x-ha-policy: all).' 'You need to wipe RabbitMQ database when ' 'changing this option.'), ] cfg.CONF.register_opts(kombu_opts) LOG = rpc_common.LOG def _get_queue_arguments(conf): """Construct the arguments for declaring a queue. If the rabbit_ha_queues option is set, we declare a mirrored queue as described here: http://www.rabbitmq.com/ha.html Setting x-ha-policy to all means that the queue will be mirrored to all nodes in the cluster. """ return {'x-ha-policy': 'all'} if conf.rabbit_ha_queues else {} class ConsumerBase(object): """Consumer base class.""" def __init__(self, channel, callback, tag, **kwargs): """Declare a queue on an amqp channel. 'channel' is the amqp channel to use 'callback' is the callback to call when messages are received 'tag' is a unique ID for the consumer on the channel queue name, exchange name, and other kombu options are passed in here as a dictionary. """ self.callback = callback self.tag = str(tag) self.kwargs = kwargs self.queue = None self.reconnect(channel) def reconnect(self, channel): """Re-declare the queue after a rabbit reconnect.""" self.channel = channel self.kwargs['channel'] = channel self.queue = kombu.entity.Queue(**self.kwargs) self.queue.declare() def consume(self, *args, **kwargs): """Actually declare the consumer on the amqp channel. This will start the flow of messages from the queue. Using the Connection.iterconsume() iterator will process the messages, calling the appropriate callback. If a callback is specified in kwargs, use that. Otherwise, use the callback passed during __init__() If kwargs['nowait'] is True, then this call will block until a message is read. Messages will automatically be acked if the callback doesn't raise an exception """ options = {'consumer_tag': self.tag} options['nowait'] = kwargs.get('nowait', False) callback = kwargs.get('callback', self.callback) if not callback: raise ValueError("No callback defined") def _callback(raw_message): message = self.channel.message_to_python(raw_message) try: msg = rpc_common.deserialize_msg(message.payload) callback(msg) except Exception: LOG.exception(_("Failed to process message... skipping it.")) finally: message.ack() self.queue.consume(*args, callback=_callback, **options) def cancel(self): """Cancel the consuming from the queue, if it has started.""" try: self.queue.cancel(self.tag) except KeyError as e: # NOTE(comstud): Kludge to get around a amqplib bug if str(e) != "u'%s'" % self.tag: raise self.queue = None class DirectConsumer(ConsumerBase): """Queue/consumer class for 'direct'.""" def __init__(self, conf, channel, msg_id, callback, tag, **kwargs): """Init a 'direct' queue. 'channel' is the amqp channel to use 'msg_id' is the msg_id to listen on 'callback' is the callback to call when messages are received 'tag' is a unique ID for the consumer on the channel Other kombu options may be passed """ # Default options options = {'durable': False, 'queue_arguments': _get_queue_arguments(conf), 'auto_delete': True, 'exclusive': False} options.update(kwargs) exchange = kombu.entity.Exchange(name=msg_id, type='direct', durable=options['durable'], auto_delete=options['auto_delete']) super(DirectConsumer, self).__init__(channel, callback, tag, name=msg_id, exchange=exchange, routing_key=msg_id, **options) class TopicConsumer(ConsumerBase): """Consumer class for 'topic'.""" def __init__(self, conf, channel, topic, callback, tag, name=None, exchange_name=None, **kwargs): """Init a 'topic' queue. :param channel: the amqp channel to use :param topic: the topic to listen on :paramtype topic: str :param callback: the callback to call when messages are received :param tag: a unique ID for the consumer on the channel :param name: optional queue name, defaults to topic :paramtype name: str Other kombu options may be passed as keyword arguments """ # Default options options = {'durable': conf.amqp_durable_queues, 'queue_arguments': _get_queue_arguments(conf), 'auto_delete': conf.amqp_auto_delete, 'exclusive': False} options.update(kwargs) exchange_name = exchange_name or rpc_amqp.get_control_exchange(conf) exchange = kombu.entity.Exchange(name=exchange_name, type='topic', durable=options['durable'], auto_delete=options['auto_delete']) super(TopicConsumer, self).__init__(channel, callback, tag, name=name or topic, exchange=exchange, routing_key=topic, **options) class FanoutConsumer(ConsumerBase): """Consumer class for 'fanout'.""" def __init__(self, conf, channel, topic, callback, tag, **kwargs): """Init a 'fanout' queue. 'channel' is the amqp channel to use 'topic' is the topic to listen on 'callback' is the callback to call when messages are received 'tag' is a unique ID for the consumer on the channel Other kombu options may be passed """ unique = uuid.uuid4().hex exchange_name = '%s_fanout' % topic queue_name = '%s_fanout_%s' % (topic, unique) # Default options options = {'durable': False, 'queue_arguments': _get_queue_arguments(conf), 'auto_delete': True, 'exclusive': False} options.update(kwargs) exchange = kombu.entity.Exchange(name=exchange_name, type='fanout', durable=options['durable'], auto_delete=options['auto_delete']) super(FanoutConsumer, self).__init__(channel, callback, tag, name=queue_name, exchange=exchange, routing_key=topic, **options) class Publisher(object): """Base Publisher class.""" def __init__(self, channel, exchange_name, routing_key, **kwargs): """Init the Publisher class with the exchange_name, routing_key, and other options """ self.exchange_name = exchange_name self.routing_key = routing_key self.kwargs = kwargs self.reconnect(channel) def reconnect(self, channel): """Re-establish the Producer after a rabbit reconnection.""" self.exchange = kombu.entity.Exchange(name=self.exchange_name, **self.kwargs) self.producer = kombu.messaging.Producer(exchange=self.exchange, channel=channel, routing_key=self.routing_key) def send(self, msg, timeout=None): """Send a message.""" if timeout: # # AMQP TTL is in milliseconds when set in the header. # self.producer.publish(msg, headers={'ttl': (timeout * 1000)}) else: self.producer.publish(msg) class DirectPublisher(Publisher): """Publisher class for 'direct'.""" def __init__(self, conf, channel, msg_id, **kwargs): """init a 'direct' publisher. Kombu options may be passed as keyword args to override defaults """ options = {'durable': False, 'auto_delete': True, 'exclusive': False} options.update(kwargs) super(DirectPublisher, self).__init__(channel, msg_id, msg_id, type='direct', **options) class TopicPublisher(Publisher): """Publisher class for 'topic'.""" def __init__(self, conf, channel, topic, **kwargs): """init a 'topic' publisher. Kombu options may be passed as keyword args to override defaults """ options = {'durable': conf.amqp_durable_queues, 'auto_delete': conf.amqp_auto_delete, 'exclusive': False} options.update(kwargs) exchange_name = rpc_amqp.get_control_exchange(conf) super(TopicPublisher, self).__init__(channel, exchange_name, topic, type='topic', **options) class FanoutPublisher(Publisher): """Publisher class for 'fanout'.""" def __init__(self, conf, channel, topic, **kwargs): """init a 'fanout' publisher. Kombu options may be passed as keyword args to override defaults """ options = {'durable': False, 'auto_delete': True, 'exclusive': False} options.update(kwargs) super(FanoutPublisher, self).__init__(channel, '%s_fanout' % topic, None, type='fanout', **options) class NotifyPublisher(TopicPublisher): """Publisher class for 'notify'.""" def __init__(self, conf, channel, topic, **kwargs): self.durable = kwargs.pop('durable', conf.amqp_durable_queues) self.queue_arguments = _get_queue_arguments(conf) super(NotifyPublisher, self).__init__(conf, channel, topic, **kwargs) def reconnect(self, channel): super(NotifyPublisher, self).reconnect(channel) # NOTE(jerdfelt): Normally the consumer would create the queue, but # we do this to ensure that messages don't get dropped if the # consumer is started after we do queue = kombu.entity.Queue(channel=channel, exchange=self.exchange, durable=self.durable, name=self.routing_key, routing_key=self.routing_key, queue_arguments=self.queue_arguments) queue.declare() class Connection(object): """Connection object.""" pool = None def __init__(self, conf, server_params=None): self.consumers = [] self.consumer_thread = None self.proxy_callbacks = [] self.conf = conf self.max_retries = self.conf.rabbit_max_retries # Try forever? if self.max_retries <= 0: self.max_retries = None self.interval_start = self.conf.rabbit_retry_interval self.interval_stepping = self.conf.rabbit_retry_backoff # max retry-interval = 30 seconds self.interval_max = 30 self.memory_transport = False if server_params is None: server_params = {} # Keys to translate from server_params to kombu params server_params_to_kombu_params = {'username': 'userid'} ssl_params = self._fetch_ssl_params() params_list = [] for adr in self.conf.rabbit_hosts: hostname, port = network_utils.parse_host_port( adr, default_port=self.conf.rabbit_port) params = { 'hostname': hostname, 'port': port, 'userid': self.conf.rabbit_userid, 'password': self.conf.rabbit_password, 'virtual_host': self.conf.rabbit_virtual_host, } for sp_key, value in server_params.iteritems(): p_key = server_params_to_kombu_params.get(sp_key, sp_key) params[p_key] = value if self.conf.fake_rabbit: params['transport'] = 'memory' if self.conf.rabbit_use_ssl: params['ssl'] = ssl_params params_list.append(params) self.params_list = params_list brokers_count = len(self.params_list) self.next_broker_indices = itertools.cycle(range(brokers_count)) self.memory_transport = self.conf.fake_rabbit self.connection = None self.reconnect() def _fetch_ssl_params(self): """Handles fetching what ssl params should be used for the connection (if any). """ ssl_params = dict() # http://docs.python.org/library/ssl.html - ssl.wrap_socket if self.conf.kombu_ssl_version: ssl_params['ssl_version'] = self.conf.kombu_ssl_version if self.conf.kombu_ssl_keyfile: ssl_params['keyfile'] = self.conf.kombu_ssl_keyfile if self.conf.kombu_ssl_certfile: ssl_params['certfile'] = self.conf.kombu_ssl_certfile if self.conf.kombu_ssl_ca_certs: ssl_params['ca_certs'] = self.conf.kombu_ssl_ca_certs # We might want to allow variations in the # future with this? ssl_params['cert_reqs'] = ssl.CERT_REQUIRED if not ssl_params: # Just have the default behavior return True else: # Return the extended behavior return ssl_params def _connect(self, params): """Connect to rabbit. Re-establish any queues that may have been declared before if we are reconnecting. Exceptions should be handled by the caller. """ if self.connection: LOG.info(_("Reconnecting to AMQP server on " "%(hostname)s:%(port)d") % params) try: self.connection.release() except self.connection_errors: pass # Setting this in case the next statement fails, though # it shouldn't be doing any network operations, yet. self.connection = None self.connection = kombu.connection.BrokerConnection(**params) self.connection_errors = self.connection.connection_errors if self.memory_transport: # Kludge to speed up tests. self.connection.transport.polling_interval = 0.0 self.consumer_num = itertools.count(1) self.connection.connect() self.channel = self.connection.channel() # work around 'memory' transport bug in 1.1.3 if self.memory_transport: self.channel._new_queue('ae.undeliver') for consumer in self.consumers: consumer.reconnect(self.channel) LOG.info(_('Connected to AMQP server on %(hostname)s:%(port)d') % params) def reconnect(self): """Handles reconnecting and re-establishing queues. Will retry up to self.max_retries number of times. self.max_retries = 0 means to retry forever. Sleep between tries, starting at self.interval_start seconds, backing off self.interval_stepping number of seconds each attempt. """ attempt = 0 while True: params = self.params_list[next(self.next_broker_indices)] attempt += 1 try: self._connect(params) return except (IOError, self.connection_errors) as e: pass except Exception as e: # NOTE(comstud): Unfortunately it's possible for amqplib # to return an error not covered by its transport # connection_errors in the case of a timeout waiting for # a protocol response. (See paste link in LP888621) # So, we check all exceptions for 'timeout' in them # and try to reconnect in this case. if 'timeout' not in str(e): raise log_info = {} log_info['err_str'] = str(e) log_info['max_retries'] = self.max_retries log_info.update(params) if self.max_retries and attempt == self.max_retries: LOG.error(_('Unable to connect to AMQP server on ' '%(hostname)s:%(port)d after %(max_retries)d ' 'tries: %(err_str)s') % log_info) # NOTE(comstud): Copied from original code. There's # really no better recourse because if this was a queue we # need to consume on, we have no way to consume anymore. sys.exit(1) if attempt == 1: sleep_time = self.interval_start or 1 elif attempt > 1: sleep_time += self.interval_stepping if self.interval_max: sleep_time = min(sleep_time, self.interval_max) log_info['sleep_time'] = sleep_time LOG.error(_('AMQP server on %(hostname)s:%(port)d is ' 'unreachable: %(err_str)s. Trying again in ' '%(sleep_time)d seconds.') % log_info) time.sleep(sleep_time) def ensure(self, error_callback, method, *args, **kwargs): while True: try: return method(*args, **kwargs) except (self.connection_errors, socket.timeout, IOError) as e: if error_callback: error_callback(e) except Exception as e: # NOTE(comstud): Unfortunately it's possible for amqplib # to return an error not covered by its transport # connection_errors in the case of a timeout waiting for # a protocol response. (See paste link in LP888621) # So, we check all exceptions for 'timeout' in them # and try to reconnect in this case. if 'timeout' not in str(e): raise if error_callback: error_callback(e) self.reconnect() def get_channel(self): """Convenience call for bin/clear_rabbit_queues.""" return self.channel def close(self): """Close/release this connection.""" self.cancel_consumer_thread() self.wait_on_proxy_callbacks() self.connection.release() self.connection = None def reset(self): """Reset a connection so it can be used again.""" self.cancel_consumer_thread() self.wait_on_proxy_callbacks() self.channel.close() self.channel = self.connection.channel() # work around 'memory' transport bug in 1.1.3 if self.memory_transport: self.channel._new_queue('ae.undeliver') self.consumers = [] def declare_consumer(self, consumer_cls, topic, callback): """Create a Consumer using the class that was passed in and add it to our list of consumers """ def _connect_error(exc): log_info = {'topic': topic, 'err_str': str(exc)} LOG.error(_("Failed to declare consumer for topic '%(topic)s': " "%(err_str)s") % log_info) def _declare_consumer(): consumer = consumer_cls(self.conf, self.channel, topic, callback, self.consumer_num.next()) self.consumers.append(consumer) return consumer return self.ensure(_connect_error, _declare_consumer) def iterconsume(self, limit=None, timeout=None): """Return an iterator that will consume from all queues/consumers.""" info = {'do_consume': True} def _error_callback(exc): if isinstance(exc, socket.timeout): LOG.debug(_('Timed out waiting for RPC response: %s') % str(exc)) raise rpc_common.Timeout() else: LOG.exception(_('Failed to consume message from queue: %s') % str(exc)) info['do_consume'] = True def _consume(): if info['do_consume']: queues_head = self.consumers[:-1] queues_tail = self.consumers[-1] for queue in queues_head: queue.consume(nowait=True) queues_tail.consume(nowait=False) info['do_consume'] = False return self.connection.drain_events(timeout=timeout) for iteration in itertools.count(0): if limit and iteration >= limit: raise StopIteration yield self.ensure(_error_callback, _consume) def cancel_consumer_thread(self): """Cancel a consumer thread.""" if self.consumer_thread is not None: self.consumer_thread.kill() try: self.consumer_thread.wait() except greenlet.GreenletExit: pass self.consumer_thread = None def wait_on_proxy_callbacks(self): """Wait for all proxy callback threads to exit.""" for proxy_cb in self.proxy_callbacks: proxy_cb.wait() def publisher_send(self, cls, topic, msg, timeout=None, **kwargs): """Send to a publisher based on the publisher class.""" def _error_callback(exc): log_info = {'topic': topic, 'err_str': str(exc)} LOG.exception(_("Failed to publish message to topic " "'%(topic)s': %(err_str)s") % log_info) def _publish(): publisher = cls(self.conf, self.channel, topic, **kwargs) publisher.send(msg, timeout) self.ensure(_error_callback, _publish) def declare_direct_consumer(self, topic, callback): """Create a 'direct' queue. In nova's use, this is generally a msg_id queue used for responses for call/multicall """ self.declare_consumer(DirectConsumer, topic, callback) def declare_topic_consumer(self, topic, callback=None, queue_name=None, exchange_name=None): """Create a 'topic' consumer.""" self.declare_consumer(functools.partial(TopicConsumer, name=queue_name, exchange_name=exchange_name, ), topic, callback) def declare_fanout_consumer(self, topic, callback): """Create a 'fanout' consumer.""" self.declare_consumer(FanoutConsumer, topic, callback) def direct_send(self, msg_id, msg): """Send a 'direct' message.""" self.publisher_send(DirectPublisher, msg_id, msg) def topic_send(self, topic, msg, timeout=None): """Send a 'topic' message.""" self.publisher_send(TopicPublisher, topic, msg, timeout) def fanout_send(self, topic, msg): """Send a 'fanout' message.""" self.publisher_send(FanoutPublisher, topic, msg) def notify_send(self, topic, msg, **kwargs): """Send a notify message on a topic.""" self.publisher_send(NotifyPublisher, topic, msg, None, **kwargs) def consume(self, limit=None): """Consume from all queues/consumers.""" it = self.iterconsume(limit=limit) while True: try: it.next() except StopIteration: return def consume_in_thread(self): """Consumer from all queues/consumers in a greenthread.""" @excutils.forever_retry_uncaught_exceptions def _consumer_thread(): try: self.consume() except greenlet.GreenletExit: return if self.consumer_thread is None: self.consumer_thread = eventlet.spawn(_consumer_thread) return self.consumer_thread def create_consumer(self, topic, proxy, fanout=False): """Create a consumer that calls a method in a proxy object.""" proxy_cb = rpc_amqp.ProxyCallback( self.conf, proxy, rpc_amqp.get_connection_pool(self.conf, Connection)) self.proxy_callbacks.append(proxy_cb) if fanout: self.declare_fanout_consumer(topic, proxy_cb) else: self.declare_topic_consumer(topic, proxy_cb) def create_worker(self, topic, proxy, pool_name): """Create a worker that calls a method in a proxy object.""" proxy_cb = rpc_amqp.ProxyCallback( self.conf, proxy, rpc_amqp.get_connection_pool(self.conf, Connection)) self.proxy_callbacks.append(proxy_cb) self.declare_topic_consumer(topic, proxy_cb, pool_name) def join_consumer_pool(self, callback, pool_name, topic, exchange_name=None): """Register as a member of a group of consumers for a given topic from the specified exchange. Exactly one member of a given pool will receive each message. A message will be delivered to multiple pools, if more than one is created. """ callback_wrapper = rpc_amqp.CallbackWrapper( conf=self.conf, callback=callback, connection_pool=rpc_amqp.get_connection_pool(self.conf, Connection), ) self.proxy_callbacks.append(callback_wrapper) self.declare_topic_consumer( queue_name=pool_name, topic=topic, exchange_name=exchange_name, callback=callback_wrapper, ) def create_connection(conf, new=True): """Create a connection.""" return rpc_amqp.create_connection( conf, new, rpc_amqp.get_connection_pool(conf, Connection)) def multicall(conf, context, topic, msg, timeout=None): """Make a call that returns multiple times.""" return rpc_amqp.multicall( conf, context, topic, msg, timeout, rpc_amqp.get_connection_pool(conf, Connection)) def call(conf, context, topic, msg, timeout=None): """Sends a message on a topic and wait for a response.""" return rpc_amqp.call( conf, context, topic, msg, timeout, rpc_amqp.get_connection_pool(conf, Connection)) def cast(conf, context, topic, msg): """Sends a message on a topic without waiting for a response.""" return rpc_amqp.cast( conf, context, topic, msg, rpc_amqp.get_connection_pool(conf, Connection)) def fanout_cast(conf, context, topic, msg): """Sends a message on a fanout exchange without waiting for a response.""" return rpc_amqp.fanout_cast( conf, context, topic, msg, rpc_amqp.get_connection_pool(conf, Connection)) def cast_to_server(conf, context, server_params, topic, msg): """Sends a message on a topic to a specific server.""" return rpc_amqp.cast_to_server( conf, context, server_params, topic, msg, rpc_amqp.get_connection_pool(conf, Connection)) def fanout_cast_to_server(conf, context, server_params, topic, msg): """Sends a message on a fanout exchange to a specific server.""" return rpc_amqp.fanout_cast_to_server( conf, context, server_params, topic, msg, rpc_amqp.get_connection_pool(conf, Connection)) def notify(conf, context, topic, msg, envelope): """Sends a notification event on a topic.""" return rpc_amqp.notify( conf, context, topic, msg, rpc_amqp.get_connection_pool(conf, Connection), envelope) def cleanup(): return rpc_amqp.cleanup(Connection.pool)
apache-2.0
abhishek070193/mapreduce
hadoop-2.6.0-src/hadoop-mapreduce-project/hadoop-mapreduce-examples/src/main/java/org/apache/hadoop/examples/terasort/job_history_summary.py
323
3444
#!/usr/bin/env python # # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import re import sys pat = re.compile('(?P<name>[^=]+)="(?P<value>[^"]*)" *') counterPat = re.compile('(?P<name>[^:]+):(?P<value>[^,]*),?') def parse(tail): result = {} for n,v in re.findall(pat, tail): result[n] = v return result mapStartTime = {} mapEndTime = {} reduceStartTime = {} reduceShuffleTime = {} reduceSortTime = {} reduceEndTime = {} reduceBytes = {} for line in sys.stdin: words = line.split(" ",1) event = words[0] attrs = parse(words[1]) if event == 'MapAttempt': if attrs.has_key("START_TIME"): mapStartTime[attrs["TASKID"]] = int(attrs["START_TIME"])/1000 elif attrs.has_key("FINISH_TIME"): mapEndTime[attrs["TASKID"]] = int(attrs["FINISH_TIME"])/1000 elif event == 'ReduceAttempt': if attrs.has_key("START_TIME"): reduceStartTime[attrs["TASKID"]] = int(attrs["START_TIME"]) / 1000 elif attrs.has_key("FINISH_TIME"): reduceShuffleTime[attrs["TASKID"]] = int(attrs["SHUFFLE_FINISHED"])/1000 reduceSortTime[attrs["TASKID"]] = int(attrs["SORT_FINISHED"])/1000 reduceEndTime[attrs["TASKID"]] = int(attrs["FINISH_TIME"])/1000 elif event == 'Task': if attrs["TASK_TYPE"] == "REDUCE" and attrs.has_key("COUNTERS"): for n,v in re.findall(counterPat, attrs["COUNTERS"]): if n == "File Systems.HDFS bytes written": reduceBytes[attrs["TASKID"]] = int(v) runningMaps = {} shufflingReduces = {} sortingReduces = {} runningReduces = {} startTime = min(reduce(min, mapStartTime.values()), reduce(min, reduceStartTime.values())) endTime = max(reduce(max, mapEndTime.values()), reduce(max, reduceEndTime.values())) reduces = reduceBytes.keys() reduces.sort() print "Name reduce-output-bytes shuffle-finish reduce-finish" for r in reduces: print r, reduceBytes[r], reduceShuffleTime[r] - startTime, print reduceEndTime[r] - startTime print for t in range(startTime, endTime): runningMaps[t] = 0 shufflingReduces[t] = 0 sortingReduces[t] = 0 runningReduces[t] = 0 for map in mapStartTime.keys(): for t in range(mapStartTime[map], mapEndTime[map]): runningMaps[t] += 1 for reduce in reduceStartTime.keys(): for t in range(reduceStartTime[reduce], reduceShuffleTime[reduce]): shufflingReduces[t] += 1 for t in range(reduceShuffleTime[reduce], reduceSortTime[reduce]): sortingReduces[t] += 1 for t in range(reduceSortTime[reduce], reduceEndTime[reduce]): runningReduces[t] += 1 print "time maps shuffle merge reduce" for t in range(startTime, endTime): print t - startTime, runningMaps[t], shufflingReduces[t], sortingReduces[t], print runningReduces[t]
mit
VirtueSecurity/aws-extender
BappModules/docutils/languages/cs.py
148
1928
# $Id: cs.py 4564 2006-05-21 20:44:42Z wiemann $ # Author: Marek Blaha <mb@dat.cz> # Copyright: This module has been placed in the public domain. # New language mappings are welcome. Before doing a new translation, please # read <http://docutils.sf.net/docs/howto/i18n.html>. Two files must be # translated for each language: one in docutils/languages, the other in # docutils/parsers/rst/languages. """ Czech-language mappings for language-dependent features of Docutils. """ __docformat__ = 'reStructuredText' labels = { # fixed: language-dependent 'author': u'Autor', 'authors': u'Auto\u0159i', 'organization': u'Organizace', 'address': u'Adresa', 'contact': u'Kontakt', 'version': u'Verze', 'revision': u'Revize', 'status': u'Stav', 'date': u'Datum', 'copyright': u'Copyright', 'dedication': u'V\u011Bnov\u00E1n\u00ED', 'abstract': u'Abstrakt', 'attention': u'Pozor!', 'caution': u'Opatrn\u011B!', 'danger': u'!NEBEZPE\u010C\u00CD!', 'error': u'Chyba', 'hint': u'Rada', 'important': u'D\u016Fle\u017Eit\u00E9', 'note': u'Pozn\u00E1mka', 'tip': u'Tip', 'warning': u'Varov\u00E1n\u00ED', 'contents': u'Obsah'} """Mapping of node class name to label text.""" bibliographic_fields = { # language-dependent: fixed u'autor': 'author', u'auto\u0159i': 'authors', u'organizace': 'organization', u'adresa': 'address', u'kontakt': 'contact', u'verze': 'version', u'revize': 'revision', u'stav': 'status', u'datum': 'date', u'copyright': 'copyright', u'v\u011Bnov\u00E1n\u00ED': 'dedication', u'abstrakt': 'abstract'} """Czech (lowcased) to canonical name mapping for bibliographic fields.""" author_separators = [';', ','] """List of separator strings for the 'Authors' bibliographic field. Tried in order."""
mit
AccelAI/accel.ai
flask-aws/lib/python2.7/site-packages/pip/_vendor/requests/packages/chardet/latin1prober.py
1778
5232
######################## BEGIN LICENSE BLOCK ######################## # The Original Code is Mozilla Universal charset detector code. # # The Initial Developer of the Original Code is # Netscape Communications Corporation. # Portions created by the Initial Developer are Copyright (C) 2001 # the Initial Developer. All Rights Reserved. # # Contributor(s): # Mark Pilgrim - port to Python # Shy Shalom - original C code # # This library is free software; you can redistribute it and/or # modify it under the terms of the GNU Lesser General Public # License as published by the Free Software Foundation; either # version 2.1 of the License, or (at your option) any later version. # # This library is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this library; if not, write to the Free Software # Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA # 02110-1301 USA ######################### END LICENSE BLOCK ######################### from .charsetprober import CharSetProber from .constants import eNotMe from .compat import wrap_ord FREQ_CAT_NUM = 4 UDF = 0 # undefined OTH = 1 # other ASC = 2 # ascii capital letter ASS = 3 # ascii small letter ACV = 4 # accent capital vowel ACO = 5 # accent capital other ASV = 6 # accent small vowel ASO = 7 # accent small other CLASS_NUM = 8 # total classes Latin1_CharToClass = ( OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # 00 - 07 OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # 08 - 0F OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # 10 - 17 OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # 18 - 1F OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # 20 - 27 OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # 28 - 2F OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # 30 - 37 OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # 38 - 3F OTH, ASC, ASC, ASC, ASC, ASC, ASC, ASC, # 40 - 47 ASC, ASC, ASC, ASC, ASC, ASC, ASC, ASC, # 48 - 4F ASC, ASC, ASC, ASC, ASC, ASC, ASC, ASC, # 50 - 57 ASC, ASC, ASC, OTH, OTH, OTH, OTH, OTH, # 58 - 5F OTH, ASS, ASS, ASS, ASS, ASS, ASS, ASS, # 60 - 67 ASS, ASS, ASS, ASS, ASS, ASS, ASS, ASS, # 68 - 6F ASS, ASS, ASS, ASS, ASS, ASS, ASS, ASS, # 70 - 77 ASS, ASS, ASS, OTH, OTH, OTH, OTH, OTH, # 78 - 7F OTH, UDF, OTH, ASO, OTH, OTH, OTH, OTH, # 80 - 87 OTH, OTH, ACO, OTH, ACO, UDF, ACO, UDF, # 88 - 8F UDF, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # 90 - 97 OTH, OTH, ASO, OTH, ASO, UDF, ASO, ACO, # 98 - 9F OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # A0 - A7 OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # A8 - AF OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # B0 - B7 OTH, OTH, OTH, OTH, OTH, OTH, OTH, OTH, # B8 - BF ACV, ACV, ACV, ACV, ACV, ACV, ACO, ACO, # C0 - C7 ACV, ACV, ACV, ACV, ACV, ACV, ACV, ACV, # C8 - CF ACO, ACO, ACV, ACV, ACV, ACV, ACV, OTH, # D0 - D7 ACV, ACV, ACV, ACV, ACV, ACO, ACO, ACO, # D8 - DF ASV, ASV, ASV, ASV, ASV, ASV, ASO, ASO, # E0 - E7 ASV, ASV, ASV, ASV, ASV, ASV, ASV, ASV, # E8 - EF ASO, ASO, ASV, ASV, ASV, ASV, ASV, OTH, # F0 - F7 ASV, ASV, ASV, ASV, ASV, ASO, ASO, ASO, # F8 - FF ) # 0 : illegal # 1 : very unlikely # 2 : normal # 3 : very likely Latin1ClassModel = ( # UDF OTH ASC ASS ACV ACO ASV ASO 0, 0, 0, 0, 0, 0, 0, 0, # UDF 0, 3, 3, 3, 3, 3, 3, 3, # OTH 0, 3, 3, 3, 3, 3, 3, 3, # ASC 0, 3, 3, 3, 1, 1, 3, 3, # ASS 0, 3, 3, 3, 1, 2, 1, 2, # ACV 0, 3, 3, 3, 3, 3, 3, 3, # ACO 0, 3, 1, 3, 1, 1, 1, 3, # ASV 0, 3, 1, 3, 1, 1, 3, 3, # ASO ) class Latin1Prober(CharSetProber): def __init__(self): CharSetProber.__init__(self) self.reset() def reset(self): self._mLastCharClass = OTH self._mFreqCounter = [0] * FREQ_CAT_NUM CharSetProber.reset(self) def get_charset_name(self): return "windows-1252" def feed(self, aBuf): aBuf = self.filter_with_english_letters(aBuf) for c in aBuf: charClass = Latin1_CharToClass[wrap_ord(c)] freq = Latin1ClassModel[(self._mLastCharClass * CLASS_NUM) + charClass] if freq == 0: self._mState = eNotMe break self._mFreqCounter[freq] += 1 self._mLastCharClass = charClass return self.get_state() def get_confidence(self): if self.get_state() == eNotMe: return 0.01 total = sum(self._mFreqCounter) if total < 0.01: confidence = 0.0 else: confidence = ((self._mFreqCounter[3] - self._mFreqCounter[1] * 20.0) / total) if confidence < 0.0: confidence = 0.0 # lower the confidence of latin1 so that other more accurate # detector can take priority. confidence = confidence * 0.73 return confidence
mit
Letractively/timeside
timeside/analyzer/aubio_specdesc.py
2
3126
# -*- coding: utf-8 -*- # # Copyright (c) 2013 Paul Brossier <piem@piem.org> # This file is part of TimeSide. # TimeSide is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 2 of the License, or # (at your option) any later version. # TimeSide is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # You should have received a copy of the GNU General Public License # along with TimeSide. If not, see <http://www.gnu.org/licenses/>. # Author: Paul Brossier <piem@piem.org> from timeside.core import Processor, implements, interfacedoc, FixedSizeInputAdapter from timeside.analyzer.core import Analyzer from timeside.api import IAnalyzer from preprocessors import downmix_to_mono, frames_adapter from aubio import specdesc, pvoc class AubioSpecdesc(Analyzer): implements(IAnalyzer) def __init__(self): super(AubioSpecdesc, self).__init__() self.input_blocksize = 1024 self.input_stepsize = self.input_blocksize / 4 @interfacedoc def setup(self, channels=None, samplerate=None, blocksize=None, totalframes=None): super( AubioSpecdesc, self).setup( channels, samplerate, blocksize, totalframes) self.block_read = 0 self.pvoc = pvoc(self.input_blocksize, self.input_stepsize) self.methods = [ 'default', 'energy', 'hfc', 'complex', 'phase', 'specdiff', 'kl', 'mkl', 'specflux', 'centroid', 'slope', 'rolloff', 'spread', 'skewness', 'kurtosis', 'decrease'] self.specdesc = {} self.specdesc_results = {} for method in self.methods: self.specdesc[method] = specdesc(method, self.input_blocksize) self.specdesc_results[method] = [] @staticmethod @interfacedoc def id(): return "aubio_specdesc" @staticmethod @interfacedoc def name(): return "Spectral Descriptor (aubio)" @staticmethod @interfacedoc def unit(): return "" @downmix_to_mono @frames_adapter def process(self, frames, eod=False): fftgrain = self.pvoc(frames) for method in self.methods: self.specdesc_results[method] += [ self.specdesc[method](fftgrain)[0]] return frames, eod def post_process(self): # For each method store results in container for method in self.methods: res_specdesc = self.new_result(data_mode='value', time_mode='framewise') # Set metadata res_specdesc.id_metadata.id += '.' + method res_specdesc.id_metadata.name = ' ' + method res_specdesc.data_object.value = self.specdesc_results[method] self.process_pipe.results.add(res_specdesc)
gpl-2.0
piffey/ansible
lib/ansible/modules/cloud/ovirt/ovirt_vmpools.py
75
7594
#!/usr/bin/python # -*- coding: utf-8 -*- # # Copyright (c) 2016 Red Hat, Inc. # # This file is part of Ansible # # Ansible is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Ansible is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Ansible. If not, see <http://www.gnu.org/licenses/>. # ANSIBLE_METADATA = {'metadata_version': '1.1', 'status': ['preview'], 'supported_by': 'community'} DOCUMENTATION = ''' --- module: ovirt_vmpools short_description: Module to manage VM pools in oVirt/RHV version_added: "2.3" author: "Ondra Machacek (@machacekondra)" description: - "Module to manage VM pools in oVirt/RHV." options: name: description: - "Name of the VM pool to manage." required: true state: description: - "Should the VM pool be present/absent." - "Note that when C(state) is I(absent) all VMs in VM pool are stopped and removed." choices: ['present', 'absent'] default: present template: description: - "Name of the template, which will be used to create VM pool." description: description: - "Description of the VM pool." cluster: description: - "Name of the cluster, where VM pool should be created." type: description: - "Type of the VM pool. Either manual or automatic." - "C(manual) - The administrator is responsible for explicitly returning the virtual machine to the pool. The virtual machine reverts to the original base image after the administrator returns it to the pool." - "C(Automatic) - When the virtual machine is shut down, it automatically reverts to its base image and is returned to the virtual machine pool." - "Default value is set by engine." choices: ['manual', 'automatic'] vm_per_user: description: - "Maximum number of VMs a single user can attach to from this pool." - "Default value is set by engine." prestarted: description: - "Number of pre-started VMs defines the number of VMs in run state, that are waiting to be attached to Users." - "Default value is set by engine." vm_count: description: - "Number of VMs in the pool." - "Default value is set by engine." extends_documentation_fragment: ovirt ''' EXAMPLES = ''' # Examples don't contain auth parameter for simplicity, # look at ovirt_auth module to see how to reuse authentication: # Create VM pool from template - ovirt_vmpools: cluster: mycluster name: myvmpool template: rhel7 vm_count: 2 prestarted: 2 vm_per_user: 1 # Remove vmpool, note that all VMs in pool will be stopped and removed: - ovirt_vmpools: state: absent name: myvmpool ''' RETURN = ''' id: description: ID of the VM pool which is managed returned: On success if VM pool is found. type: str sample: 7de90f31-222c-436c-a1ca-7e655bd5b60c vm_pool: description: "Dictionary of all the VM pool attributes. VM pool attributes can be found on your oVirt/RHV instance at following url: http://ovirt.github.io/ovirt-engine-api-model/master/#types/vm_pool." returned: On success if VM pool is found. type: dict ''' try: import ovirtsdk4.types as otypes except ImportError: pass import traceback from ansible.module_utils.basic import AnsibleModule from ansible.module_utils.ovirt import ( BaseModule, check_params, check_sdk, create_connection, equal, get_link_name, ovirt_full_argument_spec, wait, ) class VmPoolsModule(BaseModule): def build_entity(self): return otypes.VmPool( name=self._module.params['name'], description=self._module.params['description'], comment=self._module.params['comment'], cluster=otypes.Cluster( name=self._module.params['cluster'] ) if self._module.params['cluster'] else None, template=otypes.Template( name=self._module.params['template'] ) if self._module.params['template'] else None, max_user_vms=self._module.params['vm_per_user'], prestarted_vms=self._module.params['prestarted'], size=self._module.params['vm_count'], type=otypes.VmPoolType( self._module.params['type'] ) if self._module.params['type'] else None, ) def update_check(self, entity): return ( equal(self._module.params.get('cluster'), get_link_name(self._connection, entity.cluster)) and equal(self._module.params.get('description'), entity.description) and equal(self._module.params.get('comment'), entity.comment) and equal(self._module.params.get('vm_per_user'), entity.max_user_vms) and equal(self._module.params.get('prestarted'), entity.prestarted_vms) and equal(self._module.params.get('vm_count'), entity.size) ) def main(): argument_spec = ovirt_full_argument_spec( state=dict( choices=['present', 'absent'], default='present', ), name=dict(default=None, required=True), template=dict(default=None), cluster=dict(default=None), description=dict(default=None), comment=dict(default=None), vm_per_user=dict(default=None, type='int'), prestarted=dict(default=None, type='int'), vm_count=dict(default=None, type='int'), type=dict(default=None, choices=['automatic', 'manual']), ) module = AnsibleModule( argument_spec=argument_spec, supports_check_mode=True, ) check_sdk(module) check_params(module) try: auth = module.params.pop('auth') connection = create_connection(auth) vm_pools_service = connection.system_service().vm_pools_service() vm_pools_module = VmPoolsModule( connection=connection, module=module, service=vm_pools_service, ) state = module.params['state'] if state == 'present': ret = vm_pools_module.create() # Wait for all VM pool VMs to be created: if module.params['wait']: vms_service = connection.system_service().vms_service() for vm in vms_service.list(search='pool=%s' % module.params['name']): wait( service=vms_service.service(vm.id), condition=lambda vm: vm.status in [otypes.VmStatus.DOWN, otypes.VmStatus.UP], timeout=module.params['timeout'], ) elif state == 'absent': ret = vm_pools_module.remove() module.exit_json(**ret) except Exception as e: module.fail_json(msg=str(e), exception=traceback.format_exc()) finally: connection.close(logout=auth.get('token') is None) if __name__ == "__main__": main()
gpl-3.0
jakereps/qiime2
qiime2/core/testing/format.py
2
5025
# ---------------------------------------------------------------------------- # Copyright (c) 2016-2021, QIIME 2 development team. # # Distributed under the terms of the Modified BSD License. # # The full license is in the file LICENSE, distributed with this software. # ---------------------------------------------------------------------------- from qiime2.plugin import TextFileFormat, ValidationError import qiime2.plugin.model as model class IntSequenceFormat(TextFileFormat): """ A sequence of integers stored on new lines in a file. Since this is a sequence, the integers have an order and repetition of elements is allowed. Sequential values must have an inter-value distance other than 3 to be valid. """ def _validate_n_ints(self, n): with self.open() as fh: last_val = None for idx, line in enumerate(fh, 1): if n is not None and idx >= n: break try: val = int(line.rstrip('\n')) except (TypeError, ValueError): raise ValidationError("Line %d is not an integer." % idx) if last_val is not None and last_val + 3 == val: raise ValidationError("Line %d is 3 more than line %d" % (idx, idx-1)) last_val = val def _validate_(self, level): record_map = {'min': 5, 'max': None} self._validate_n_ints(record_map[level]) class IntSequenceFormatV2(IntSequenceFormat): """ Same as IntSequenceFormat, but has a header "VERSION 2" """ def _validate_(self, level): with self.open() as fh: if fh.readline() != 'VERSION 2\n': raise ValidationError("Missing header: VERSION 2") class MappingFormat(TextFileFormat): """ A mapping of keys to values stored in a TSV file. Since this is a mapping, key-value pairs do not have an order and duplicate keys are disallowed. """ def _validate_(self, level): with self.open() as fh: for line, idx in zip(fh, range(1, 6)): cells = line.rstrip('\n').split('\t') if len(cells) != 2: raise ValidationError("Line %d does not have exactly 2 " "elements seperated by a tab." % idx) class SingleIntFormat(TextFileFormat): """ Exactly one int on a single line in the file. """ def _validate_(self, level): with self.open() as fh: try: int(fh.readline().rstrip('\n')) except (TypeError, ValueError): raise ValidationError("File does not contain an integer") if fh.readline(): raise ValidationError("Too many lines in file.") IntSequenceDirectoryFormat = model.SingleFileDirectoryFormat( 'IntSequenceDirectoryFormat', 'ints.txt', IntSequenceFormat) IntSequenceV2DirectoryFormat = model.SingleFileDirectoryFormat( 'IntSequenceV2DirectoryFormat', 'integers.txt', IntSequenceFormatV2) class IntSequenceMultiFileDirectoryFormat(model.DirectoryFormat): pass # This could have been a `SingleFileDirectoryFormat`, but isn't for testing # purposes class MappingDirectoryFormat(model.DirectoryFormat): mapping = model.File('mapping.tsv', format=MappingFormat) class FourIntsDirectoryFormat(model.DirectoryFormat): """ A sequence of exactly four integers stored across multiple files, some of which are in a nested directory. Each file contains a single integer. Since this is a sequence, the integers have an order (corresponding to filename) and repetition of elements is allowed. """ single_ints = model.FileCollection( r'file[1-2]\.txt|nested/file[3-4]\.txt', format=SingleIntFormat) @single_ints.set_path_maker def single_ints_path_maker(self, num): if not 0 < num < 5: raise ValueError("`num` must be 1-4, not %r." % num) if num > 2: return 'nested/file%d.txt' % num else: return 'file%d.txt' % num class RedundantSingleIntDirectoryFormat(model.DirectoryFormat): """ Two files of SingleIntFormat which are exactly the same. """ int1 = model.File('file1.txt', format=SingleIntFormat) int2 = model.File('file2.txt', format=SingleIntFormat) def _validate_(self, level): if self.int1.view(int) != self.int2.view(int): raise ValidationError("file1.txt does not match file2.txt") class UnimportableFormat(TextFileFormat): """ Unimportable format used for testing. """ UnimportableDirectoryFormat = model.SingleFileDirectoryFormat( 'UnimportableDirectoryFormat', 'ints.txt', UnimportableFormat) class EchoFormat(TextFileFormat): def _validate_(self, level): pass # Anything is a valid echo file EchoDirectoryFormat = model.SingleFileDirectoryFormat( 'EchoDirectoryFormat', 'echo.txt', EchoFormat)
bsd-3-clause
jlcarmic/producthunt_simulator
venv/lib/python2.7/site-packages/scipy/integrate/odepack.py
62
9420
# Author: Travis Oliphant from __future__ import division, print_function, absolute_import __all__ = ['odeint'] from . import _odepack from copy import copy import warnings class ODEintWarning(Warning): pass _msgs = {2: "Integration successful.", 1: "Nothing was done; the integration time was 0.", -1: "Excess work done on this call (perhaps wrong Dfun type).", -2: "Excess accuracy requested (tolerances too small).", -3: "Illegal input detected (internal error).", -4: "Repeated error test failures (internal error).", -5: "Repeated convergence failures (perhaps bad Jacobian or tolerances).", -6: "Error weight became zero during problem.", -7: "Internal workspace insufficient to finish (internal error)." } def odeint(func, y0, t, args=(), Dfun=None, col_deriv=0, full_output=0, ml=None, mu=None, rtol=None, atol=None, tcrit=None, h0=0.0, hmax=0.0, hmin=0.0, ixpr=0, mxstep=0, mxhnil=0, mxordn=12, mxords=5, printmessg=0): """ Integrate a system of ordinary differential equations. Solve a system of ordinary differential equations using lsoda from the FORTRAN library odepack. Solves the initial value problem for stiff or non-stiff systems of first order ode-s:: dy/dt = func(y, t0, ...) where y can be a vector. *Note*: The first two arguments of ``func(y, t0, ...)`` are in the opposite order of the arguments in the system definition function used by the `scipy.integrate.ode` class. Parameters ---------- func : callable(y, t0, ...) Computes the derivative of y at t0. y0 : array Initial condition on y (can be a vector). t : array A sequence of time points for which to solve for y. The initial value point should be the first element of this sequence. args : tuple, optional Extra arguments to pass to function. Dfun : callable(y, t0, ...) Gradient (Jacobian) of `func`. col_deriv : bool, optional True if `Dfun` defines derivatives down columns (faster), otherwise `Dfun` should define derivatives across rows. full_output : bool, optional True if to return a dictionary of optional outputs as the second output printmessg : bool, optional Whether to print the convergence message Returns ------- y : array, shape (len(t), len(y0)) Array containing the value of y for each desired time in t, with the initial value `y0` in the first row. infodict : dict, only returned if full_output == True Dictionary containing additional output information ======= ============================================================ key meaning ======= ============================================================ 'hu' vector of step sizes successfully used for each time step. 'tcur' vector with the value of t reached for each time step. (will always be at least as large as the input times). 'tolsf' vector of tolerance scale factors, greater than 1.0, computed when a request for too much accuracy was detected. 'tsw' value of t at the time of the last method switch (given for each time step) 'nst' cumulative number of time steps 'nfe' cumulative number of function evaluations for each time step 'nje' cumulative number of jacobian evaluations for each time step 'nqu' a vector of method orders for each successful step. 'imxer' index of the component of largest magnitude in the weighted local error vector (e / ewt) on an error return, -1 otherwise. 'lenrw' the length of the double work array required. 'leniw' the length of integer work array required. 'mused' a vector of method indicators for each successful time step: 1: adams (nonstiff), 2: bdf (stiff) ======= ============================================================ Other Parameters ---------------- ml, mu : int, optional If either of these are not None or non-negative, then the Jacobian is assumed to be banded. These give the number of lower and upper non-zero diagonals in this banded matrix. For the banded case, `Dfun` should return a matrix whose rows contain the non-zero bands (starting with the lowest diagonal). Thus, the return matrix `jac` from `Dfun` should have shape ``(ml + mu + 1, len(y0))`` when ``ml >=0`` or ``mu >=0``. The data in `jac` must be stored such that ``jac[i - j + mu, j]`` holds the derivative of the `i`th equation with respect to the `j`th state variable. If `col_deriv` is True, the transpose of this `jac` must be returned. rtol, atol : float, optional The input parameters `rtol` and `atol` determine the error control performed by the solver. The solver will control the vector, e, of estimated local errors in y, according to an inequality of the form ``max-norm of (e / ewt) <= 1``, where ewt is a vector of positive error weights computed as ``ewt = rtol * abs(y) + atol``. rtol and atol can be either vectors the same length as y or scalars. Defaults to 1.49012e-8. tcrit : ndarray, optional Vector of critical points (e.g. singularities) where integration care should be taken. h0 : float, (0: solver-determined), optional The step size to be attempted on the first step. hmax : float, (0: solver-determined), optional The maximum absolute step size allowed. hmin : float, (0: solver-determined), optional The minimum absolute step size allowed. ixpr : bool, optional Whether to generate extra printing at method switches. mxstep : int, (0: solver-determined), optional Maximum number of (internally defined) steps allowed for each integration point in t. mxhnil : int, (0: solver-determined), optional Maximum number of messages printed. mxordn : int, (0: solver-determined), optional Maximum order to be allowed for the non-stiff (Adams) method. mxords : int, (0: solver-determined), optional Maximum order to be allowed for the stiff (BDF) method. See Also -------- ode : a more object-oriented integrator based on VODE. quad : for finding the area under a curve. Examples -------- The second order differential equation for the angle `theta` of a pendulum acted on by gravity with friction can be written:: theta''(t) + b*theta'(t) + c*sin(theta(t)) = 0 where `b` and `c` are positive constants, and a prime (') denotes a derivative. To solve this equation with `odeint`, we must first convert it to a system of first order equations. By defining the angular velocity ``omega(t) = theta'(t)``, we obtain the system:: theta'(t) = omega(t) omega'(t) = -b*omega(t) - c*sin(theta(t)) Let `y` be the vector [`theta`, `omega`]. We implement this system in python as: >>> def pend(y, t, b, c): ... theta, omega = y ... dydt = [omega, -b*omega - c*np.sin(theta)] ... return dydt ... We assume the constants are `b` = 0.25 and `c` = 5.0: >>> b = 0.25 >>> c = 5.0 For initial conditions, we assume the pendulum is nearly vertical with `theta(0)` = `pi` - 0.1, and it initially at rest, so `omega(0)` = 0. Then the vector of initial conditions is >>> y0 = [np.pi - 0.1, 0.0] We generate a solution 101 evenly spaced samples in the interval 0 <= `t` <= 10. So our array of times is: >>> t = np.linspace(0, 10, 101) Call `odeint` to generate the solution. To pass the parameters `b` and `c` to `pend`, we give them to `odeint` using the `args` argument. >>> from scipy.integrate import odeint >>> sol = odeint(pend, y0, t, args=(b, c)) The solution is an array with shape (101, 2). The first column is `theta(t)`, and the second is `omega(t)`. The following code plots both components. >>> import matplotlib.pyplot as plt >>> plt.plot(t, sol[:, 0], 'b', label='theta(t)') >>> plt.plot(t, sol[:, 1], 'g', label='omega(t)') >>> plt.legend(loc='best') >>> plt.xlabel('t') >>> plt.grid() >>> plt.show() """ if ml is None: ml = -1 # changed to zero inside function call if mu is None: mu = -1 # changed to zero inside function call t = copy(t) y0 = copy(y0) output = _odepack.odeint(func, y0, t, args, Dfun, col_deriv, ml, mu, full_output, rtol, atol, tcrit, h0, hmax, hmin, ixpr, mxstep, mxhnil, mxordn, mxords) if output[-1] < 0: warning_msg = _msgs[output[-1]] + " Run with full_output = 1 to get quantitative information." warnings.warn(warning_msg, ODEintWarning) elif printmessg: warning_msg = _msgs[output[-1]] warnings.warn(warning_msg, ODEintWarning) if full_output: output[1]['message'] = _msgs[output[-1]] output = output[:-1] if len(output) == 1: return output[0] else: return output
mit
qPCR4vir/orange
Orange/orng/orngABCN2.py
6
1113
""" This module implements argument based rule learning. The main learner class is ABCN2. The first few classes are some variants of ABCN2 with reasonable settings. """ from Orange.classification.rules import DefaultLearner from Orange.classification.rules import ABCN2 from Orange.classification.rules import ABCN2Ordered from Orange.classification.rules import ABCN2M from Orange.classification.rules import ABBeamFilter from Orange.classification.rules import CoversArguments from Orange.classification.rules import SelectorAdder from Orange.classification.rules import ArgFilter from Orange.classification.rules import SelectorArgConditions from Orange.classification.rules import CovererAndRemover_Prob from Orange.classification.rules import avg from Orange.classification.rules import var from Orange.classification.rules import perc from Orange.classification.rules import EVDFitter from Orange.classification.rules import CrossValidation from Orange.classification.rules import PILAR from Orange.classification.rules import CN2UnorderedClassifier from orngABML import * #print createDichotomousClass
gpl-3.0
raytung/Slice
account/hooks.py
1
2621
import hashlib import random from django.core.mail import send_mail from django.template.loader import render_to_string from account.conf import settings from django.contrib.auth.models import User from django.core.exceptions import ObjectDoesNotExist class AccountDefaultHookSet(object): def send_invitation_email(self, to, ctx): subject = render_to_string("account/email/invite_user_subject.txt", ctx) message = render_to_string("account/email/invite_user.txt", ctx) send_mail(subject, message, settings.DEFAULT_FROM_EMAIL, to) def send_confirmation_email(self, to, ctx): subject = render_to_string("account/email/email_confirmation_subject.txt", ctx) subject = "".join(subject.splitlines()) # remove superfluous line breaks message = render_to_string("account/email/email_confirmation_message.txt", ctx) send_mail(subject, message, settings.DEFAULT_FROM_EMAIL, to) def send_password_change_email(self, to, ctx): subject = render_to_string("account/email/password_change_subject.txt", ctx) subject = "".join(subject.splitlines()) message = render_to_string("account/email/password_change.txt", ctx) send_mail(subject, message, settings.DEFAULT_FROM_EMAIL, to) def send_password_reset_email(self, to, ctx): subject = render_to_string("account/email/password_reset_subject.txt", ctx) subject = "".join(subject.splitlines()) message = render_to_string("account/email/password_reset.txt", ctx) send_mail(subject, message, settings.DEFAULT_FROM_EMAIL, to) def generate_random_token(self, extra=None, hash_func=hashlib.sha256): if extra is None: extra = [] bits = extra + [str(random.SystemRandom().getrandbits(512))] return hash_func("".join(bits).encode("utf-8")).hexdigest() def generate_signup_code_token(self, email=None): return self.generate_random_token([email]) def generate_email_confirmation_token(self, email): return self.generate_random_token([email]) def get_user_credentials(self, form, identifier_field): try: username = User.objects.get(email=form.cleaned_data[identifier_field]) username = username.username except ObjectDoesNotExist: username = form.cleaned_data[identifier_field] return { "username": username, "password": form.cleaned_data["password"], } class HookProxy(object): def __getattr__(self, attr): return getattr(settings.ACCOUNT_HOOKSET, attr) hookset = HookProxy()
mit
AMOboxTV/AMOBox.LegoBuild
script.module.unidecode/lib/unidecode/x0ad.py
253
4766
data = ( 'gwan', # 0x00 'gwanj', # 0x01 'gwanh', # 0x02 'gwad', # 0x03 'gwal', # 0x04 'gwalg', # 0x05 'gwalm', # 0x06 'gwalb', # 0x07 'gwals', # 0x08 'gwalt', # 0x09 'gwalp', # 0x0a 'gwalh', # 0x0b 'gwam', # 0x0c 'gwab', # 0x0d 'gwabs', # 0x0e 'gwas', # 0x0f 'gwass', # 0x10 'gwang', # 0x11 'gwaj', # 0x12 'gwac', # 0x13 'gwak', # 0x14 'gwat', # 0x15 'gwap', # 0x16 'gwah', # 0x17 'gwae', # 0x18 'gwaeg', # 0x19 'gwaegg', # 0x1a 'gwaegs', # 0x1b 'gwaen', # 0x1c 'gwaenj', # 0x1d 'gwaenh', # 0x1e 'gwaed', # 0x1f 'gwael', # 0x20 'gwaelg', # 0x21 'gwaelm', # 0x22 'gwaelb', # 0x23 'gwaels', # 0x24 'gwaelt', # 0x25 'gwaelp', # 0x26 'gwaelh', # 0x27 'gwaem', # 0x28 'gwaeb', # 0x29 'gwaebs', # 0x2a 'gwaes', # 0x2b 'gwaess', # 0x2c 'gwaeng', # 0x2d 'gwaej', # 0x2e 'gwaec', # 0x2f 'gwaek', # 0x30 'gwaet', # 0x31 'gwaep', # 0x32 'gwaeh', # 0x33 'goe', # 0x34 'goeg', # 0x35 'goegg', # 0x36 'goegs', # 0x37 'goen', # 0x38 'goenj', # 0x39 'goenh', # 0x3a 'goed', # 0x3b 'goel', # 0x3c 'goelg', # 0x3d 'goelm', # 0x3e 'goelb', # 0x3f 'goels', # 0x40 'goelt', # 0x41 'goelp', # 0x42 'goelh', # 0x43 'goem', # 0x44 'goeb', # 0x45 'goebs', # 0x46 'goes', # 0x47 'goess', # 0x48 'goeng', # 0x49 'goej', # 0x4a 'goec', # 0x4b 'goek', # 0x4c 'goet', # 0x4d 'goep', # 0x4e 'goeh', # 0x4f 'gyo', # 0x50 'gyog', # 0x51 'gyogg', # 0x52 'gyogs', # 0x53 'gyon', # 0x54 'gyonj', # 0x55 'gyonh', # 0x56 'gyod', # 0x57 'gyol', # 0x58 'gyolg', # 0x59 'gyolm', # 0x5a 'gyolb', # 0x5b 'gyols', # 0x5c 'gyolt', # 0x5d 'gyolp', # 0x5e 'gyolh', # 0x5f 'gyom', # 0x60 'gyob', # 0x61 'gyobs', # 0x62 'gyos', # 0x63 'gyoss', # 0x64 'gyong', # 0x65 'gyoj', # 0x66 'gyoc', # 0x67 'gyok', # 0x68 'gyot', # 0x69 'gyop', # 0x6a 'gyoh', # 0x6b 'gu', # 0x6c 'gug', # 0x6d 'gugg', # 0x6e 'gugs', # 0x6f 'gun', # 0x70 'gunj', # 0x71 'gunh', # 0x72 'gud', # 0x73 'gul', # 0x74 'gulg', # 0x75 'gulm', # 0x76 'gulb', # 0x77 'guls', # 0x78 'gult', # 0x79 'gulp', # 0x7a 'gulh', # 0x7b 'gum', # 0x7c 'gub', # 0x7d 'gubs', # 0x7e 'gus', # 0x7f 'guss', # 0x80 'gung', # 0x81 'guj', # 0x82 'guc', # 0x83 'guk', # 0x84 'gut', # 0x85 'gup', # 0x86 'guh', # 0x87 'gweo', # 0x88 'gweog', # 0x89 'gweogg', # 0x8a 'gweogs', # 0x8b 'gweon', # 0x8c 'gweonj', # 0x8d 'gweonh', # 0x8e 'gweod', # 0x8f 'gweol', # 0x90 'gweolg', # 0x91 'gweolm', # 0x92 'gweolb', # 0x93 'gweols', # 0x94 'gweolt', # 0x95 'gweolp', # 0x96 'gweolh', # 0x97 'gweom', # 0x98 'gweob', # 0x99 'gweobs', # 0x9a 'gweos', # 0x9b 'gweoss', # 0x9c 'gweong', # 0x9d 'gweoj', # 0x9e 'gweoc', # 0x9f 'gweok', # 0xa0 'gweot', # 0xa1 'gweop', # 0xa2 'gweoh', # 0xa3 'gwe', # 0xa4 'gweg', # 0xa5 'gwegg', # 0xa6 'gwegs', # 0xa7 'gwen', # 0xa8 'gwenj', # 0xa9 'gwenh', # 0xaa 'gwed', # 0xab 'gwel', # 0xac 'gwelg', # 0xad 'gwelm', # 0xae 'gwelb', # 0xaf 'gwels', # 0xb0 'gwelt', # 0xb1 'gwelp', # 0xb2 'gwelh', # 0xb3 'gwem', # 0xb4 'gweb', # 0xb5 'gwebs', # 0xb6 'gwes', # 0xb7 'gwess', # 0xb8 'gweng', # 0xb9 'gwej', # 0xba 'gwec', # 0xbb 'gwek', # 0xbc 'gwet', # 0xbd 'gwep', # 0xbe 'gweh', # 0xbf 'gwi', # 0xc0 'gwig', # 0xc1 'gwigg', # 0xc2 'gwigs', # 0xc3 'gwin', # 0xc4 'gwinj', # 0xc5 'gwinh', # 0xc6 'gwid', # 0xc7 'gwil', # 0xc8 'gwilg', # 0xc9 'gwilm', # 0xca 'gwilb', # 0xcb 'gwils', # 0xcc 'gwilt', # 0xcd 'gwilp', # 0xce 'gwilh', # 0xcf 'gwim', # 0xd0 'gwib', # 0xd1 'gwibs', # 0xd2 'gwis', # 0xd3 'gwiss', # 0xd4 'gwing', # 0xd5 'gwij', # 0xd6 'gwic', # 0xd7 'gwik', # 0xd8 'gwit', # 0xd9 'gwip', # 0xda 'gwih', # 0xdb 'gyu', # 0xdc 'gyug', # 0xdd 'gyugg', # 0xde 'gyugs', # 0xdf 'gyun', # 0xe0 'gyunj', # 0xe1 'gyunh', # 0xe2 'gyud', # 0xe3 'gyul', # 0xe4 'gyulg', # 0xe5 'gyulm', # 0xe6 'gyulb', # 0xe7 'gyuls', # 0xe8 'gyult', # 0xe9 'gyulp', # 0xea 'gyulh', # 0xeb 'gyum', # 0xec 'gyub', # 0xed 'gyubs', # 0xee 'gyus', # 0xef 'gyuss', # 0xf0 'gyung', # 0xf1 'gyuj', # 0xf2 'gyuc', # 0xf3 'gyuk', # 0xf4 'gyut', # 0xf5 'gyup', # 0xf6 'gyuh', # 0xf7 'geu', # 0xf8 'geug', # 0xf9 'geugg', # 0xfa 'geugs', # 0xfb 'geun', # 0xfc 'geunj', # 0xfd 'geunh', # 0xfe 'geud', # 0xff )
gpl-2.0
UnrememberMe/pants
migrations/options/src/python/migrate_config.py
10
5076
# coding=utf-8 # Copyright 2014 Pants project contributors (see CONTRIBUTORS.md). # Licensed under the Apache License, Version 2.0 (see LICENSE). from __future__ import (absolute_import, division, generators, nested_scopes, print_function, unicode_literals, with_statement) import sys from colors import cyan, green, red, yellow from pants.option import custom_types from pants.option.config import Config from pants.option.errors import ParseError migrations = { # E.g.: #('backends', 'packages'): ('DEFAULT', 'backend_packages'), #('unknown-arguments', 'ignored'): None, ('gen', 'thrift'): ('gen', 'thrift-java'), } notes = { # E.g.: #('jvm', 'debug_port'): 'For now must be defined for each JvmTask subtask separately. Will soon ' # 'move to a subsystem, which will fix this requirement.', } def check_option(cp, src, dst): def has_explicit_option(section, key): # David tried to avoid poking into cp's guts in https://rbcommons.com/s/twitter/r/1451/ but # that approach fails for the important case of boolean options. Since this is a ~short term # tool and its highly likely its lifetime will be shorter than the time the private # ConfigParser_sections API we use here changes, it's worth the risk. if section == 'DEFAULT': # NB: The 'DEFAULT' section is not tracked via `has_section` or `_sections`, so we use a # different API to check for an explicit default. return key in cp.defaults() else: return cp.has_section(section) and (key in cp._sections[section]) def sect(s): return cyan('[{}]'.format(s)) src_section, src_key = src if has_explicit_option(src_section, src_key): if dst is not None: dst_section, dst_key = dst print('Found {src_key} in section {src_section}. Should be {dst_key} in section ' '{dst_section}.'.format(src_key=green(src_key), src_section=sect(src_section), dst_key=green(dst_key), dst_section=sect(dst_section)), file=sys.stderr) elif src not in notes: print('Found {src_key} in section {src_section} and there is no automated migration path' 'for this option. Please consult the ' 'codebase.'.format(src_key=red(src_key), src_section=red(src_section))) if (src_section, src_key) in notes: print(' Note for {src_key} in section {src_section}: {note}' .format(src_key=green(src_key), src_section=sect(src_section), note=yellow(notes[(src_section, src_key)]))) def check_config_file(path): cp = Config._create_parser() with open(path, 'r') as ini: cp.readfp(ini) print('Checking config file at {} for unmigrated keys.'.format(path), file=sys.stderr) def section(s): return cyan('[{}]'.format(s)) for src, dst in migrations.items(): check_option(cp, src, dst) # Special-case handling of per-task subsystem options, so we can sweep them up in all # sections easily. def check_task_subsystem_options(subsystem_sec, options_map, sections=None): sections = sections or cp.sections() for src_sec in ['DEFAULT'] + sections: dst_sec = subsystem_sec if src_sec == 'DEFAULT' else '{}.{}'.format(subsystem_sec, src_sec) for src_key, dst_key in options_map.items(): check_option(cp, (src_sec, src_key), (dst_sec, dst_key)) artifact_cache_options_map = { 'read_from_artifact_cache': 'read', 'write_to_artifact_cache': 'write', 'overwrite_cache_artifacts': 'overwrite', 'read_artifact_caches': 'read_from', 'write_artifact_caches': 'write_to', 'cache_compression': 'compression_level', } check_task_subsystem_options('cache', artifact_cache_options_map) jvm_options_map = { 'jvm_options': 'options', 'args': 'program_args', 'debug': 'debug', 'debug_port': 'debug_port', 'debug_args': 'debug_args', } jvm_options_sections = [ 'repl.scala', 'test.junit', 'run.jvm', 'bench', 'doc.javadoc', 'doc.scaladoc' ] check_task_subsystem_options('jvm', jvm_options_map, sections=jvm_options_sections) # Check that all values are parseable. for sec in ['DEFAULT'] + cp.sections(): for key, value in cp.items(sec): value = value.strip() if value.startswith('['): try: custom_types.list_option(value) except ParseError: print('Value of {key} in section {section} is not a valid ' 'JSON list.'.format(key=green(key), section=section(sec))) elif value.startswith('{'): try: custom_types.dict_option(value) except ParseError: print('Value of {key} in section {section} is not a valid ' 'JSON object.'.format(key=green(key), section=section(sec))) if __name__ == '__main__': if len(sys.argv) > 2: print('Usage: migrate_config.py [path to pants.ini file]', file=sys.stderr) sys.exit(1) elif len(sys.argv) > 1: path = sys.argv[1] else: path = './pants.ini' check_config_file(path)
apache-2.0
bocaaust/FreshLife
django_project/env/lib/python2.7/site-packages/django/contrib/auth/middleware.py
56
4526
from django.contrib import auth from django.contrib.auth import load_backend from django.contrib.auth.backends import RemoteUserBackend from django.core.exceptions import ImproperlyConfigured from django.utils.functional import SimpleLazyObject def get_user(request): if not hasattr(request, '_cached_user'): request._cached_user = auth.get_user(request) return request._cached_user class AuthenticationMiddleware(object): def process_request(self, request): assert hasattr(request, 'session'), "The Django authentication middleware requires session middleware to be installed. Edit your MIDDLEWARE_CLASSES setting to insert 'django.contrib.sessions.middleware.SessionMiddleware'." request.user = SimpleLazyObject(lambda: get_user(request)) class RemoteUserMiddleware(object): """ Middleware for utilizing Web-server-provided authentication. If request.user is not authenticated, then this middleware attempts to authenticate the username passed in the ``REMOTE_USER`` request header. If authentication is successful, the user is automatically logged in to persist the user in the session. The header used is configurable and defaults to ``REMOTE_USER``. Subclass this class and change the ``header`` attribute if you need to use a different header. """ # Name of request header to grab username from. This will be the key as # used in the request.META dictionary, i.e. the normalization of headers to # all uppercase and the addition of "HTTP_" prefix apply. header = "REMOTE_USER" def process_request(self, request): # AuthenticationMiddleware is required so that request.user exists. if not hasattr(request, 'user'): raise ImproperlyConfigured( "The Django remote user auth middleware requires the" " authentication middleware to be installed. Edit your" " MIDDLEWARE_CLASSES setting to insert" " 'django.contrib.auth.middleware.AuthenticationMiddleware'" " before the RemoteUserMiddleware class.") try: username = request.META[self.header] except KeyError: # If specified header doesn't exist then remove any existing # authenticated remote-user, or return (leaving request.user set to # AnonymousUser by the AuthenticationMiddleware). if request.user.is_authenticated(): self._remove_invalid_user(request) return # If the user is already authenticated and that user is the user we are # getting passed in the headers, then the correct user is already # persisted in the session and we don't need to continue. if request.user.is_authenticated(): if request.user.get_username() == self.clean_username(username, request): return else: # An authenticated user is associated with the request, but # it does not match the authorized user in the header. self._remove_invalid_user(request) # We are seeing this user for the first time in this session, attempt # to authenticate the user. user = auth.authenticate(remote_user=username) if user: # User is valid. Set request.user and persist user in the session # by logging the user in. request.user = user auth.login(request, user) def clean_username(self, username, request): """ Allows the backend to clean the username, if the backend defines a clean_username method. """ backend_str = request.session[auth.BACKEND_SESSION_KEY] backend = auth.load_backend(backend_str) try: username = backend.clean_username(username) except AttributeError: # Backend has no clean_username method. pass return username def _remove_invalid_user(self, request): """ Removes the current authenticated user in the request which is invalid but only if the user is authenticated via the RemoteUserBackend. """ try: stored_backend = load_backend(request.session.get(auth.BACKEND_SESSION_KEY, '')) except ImproperlyConfigured: # backend failed to load auth.logout(request) else: if isinstance(stored_backend, RemoteUserBackend): auth.logout(request)
apache-2.0
ericawright/bedrock
tests/pages/firefox/new/download.py
2
2137
# This Source Code Form is subject to the terms of the Mozilla Public # License, v. 2.0. If a copy of the MPL was not distributed with this # file, You can obtain one at http://mozilla.org/MPL/2.0/. from selenium.webdriver.common.by import By from pages.base import BasePage from pages.regions.download_button import DownloadButton from pages.regions.modal import ModalProtocol class DownloadPage(BasePage): URL_TEMPLATE = '/{locale}/firefox/new/{params}' _download_button_locator = (By.ID, 'download-button-desktop-release') _platforms_modal_link_locator = (By.CLASS_NAME, 'js-platform-modal-button') _platforms_modal_content_locator = (By.CLASS_NAME, 'mzp-u-modal-content') _legacy_platforms_modal_link_locator = (By.ID, 'other-platforms-modal-link') _legacy_platforms_modal_content_locator = (By.ID, 'other-platforms') _join_firefox_modal_content_locator = (By.CLASS_NAME, 'join-firefox-content') _yandex_download_button_locator = (By.CSS_SELECTOR, '.hero-yandex .mzp-c-button.mzp-t-product') @property def download_button(self): el = self.find_element(*self._download_button_locator) return DownloadButton(self, root=el) def download_firefox(self): self.download_button.click() from pages.firefox.new.thank_you import ThankYouPage return ThankYouPage(self.selenium, self.base_url).wait_for_page_to_load() def open_other_platforms_modal(self): modal = ModalProtocol(self) self.find_element(*self._platforms_modal_link_locator).click() self.wait.until(lambda s: modal.displays(self._platforms_modal_content_locator)) return modal def open_join_firefox_modal(self): modal = ModalProtocol(self) self.download_button.click() self.wait.until(lambda s: modal.displays(self._join_firefox_modal_content_locator)) return modal @property def is_yandex_download_button_displayed(self): button = self.find_element(*self._yandex_download_button_locator) return button.is_displayed() and 'https://yandex.ru/firefox/mozilla/' in button.get_attribute('href')
mpl-2.0
cchurch/ansible
lib/ansible/module_utils/network/vyos/argspec/l3_interfaces/l3_interfaces.py
23
2969
# # -*- coding: utf-8 -*- # Copyright 2019 Red Hat # GNU General Public License v3.0+ # (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt) ############################################# # WARNING # ############################################# # # This file is auto generated by the resource # module builder playbook. # # Do not edit this file manually. # # Changes to this file will be over written # by the resource module builder. # # Changes should be made in the model used to # generate this file or in the resource module # builder template. # ############################################# """ The arg spec for the vyos_l3_interfaces module """ from __future__ import absolute_import, division, print_function __metaclass__ = type class L3_interfacesArgs(object): # pylint: disable=R0903 """The arg spec for the vyos_l3_interfaces module """ def __init__(self, **kwargs): pass argument_spec = { 'config': { 'elements': 'dict', 'options': { 'ipv4': { 'elements': 'dict', 'options': { 'address': { 'type': 'str' } }, 'type': 'list' }, 'ipv6': { 'elements': 'dict', 'options': { 'address': { 'type': 'str' } }, 'type': 'list' }, 'name': { 'required': True, 'type': 'str' }, 'vifs': { 'elements': 'dict', 'options': { 'ipv4': { 'elements': 'dict', 'options': { 'address': { 'type': 'str' } }, 'type': 'list' }, 'ipv6': { 'elements': 'dict', 'options': { 'address': { 'type': 'str' } }, 'type': 'list' }, 'vlan_id': { 'type': 'int' } }, 'type': 'list' } }, 'type': 'list' }, 'state': { 'choices': ['merged', 'replaced', 'overridden', 'deleted'], 'default': 'merged', 'type': 'str' } } # pylint: disable=C0301
gpl-3.0
nopjmp/SickRage
lib/hachoir_metadata/misc.py
57
8595
from hachoir_metadata.metadata import RootMetadata, registerExtractor from hachoir_metadata.safe import fault_tolerant from hachoir_parser.container import SwfFile from hachoir_parser.misc import TorrentFile, TrueTypeFontFile, OLE2_File, PcfFile from hachoir_core.field import isString from hachoir_core.error import warning from hachoir_parser import guessParser from hachoir_metadata.setter import normalizeString class TorrentMetadata(RootMetadata): KEY_TO_ATTR = { u"announce": "url", u"comment": "comment", u"creation_date": "creation_date", } INFO_TO_ATTR = { u"length": "file_size", u"name": "filename", } def extract(self, torrent): for field in torrent[0]: self.processRoot(field) @fault_tolerant def processRoot(self, field): if field.name in self.KEY_TO_ATTR: key = self.KEY_TO_ATTR[field.name] value = field.value setattr(self, key, value) elif field.name == "info" and "value" in field: for field in field["value"]: self.processInfo(field) @fault_tolerant def processInfo(self, field): if field.name in self.INFO_TO_ATTR: key = self.INFO_TO_ATTR[field.name] value = field.value setattr(self, key, value) elif field.name == "piece_length": self.comment = "Piece length: %s" % field.display class TTF_Metadata(RootMetadata): NAMEID_TO_ATTR = { 0: "copyright", # Copyright notice 3: "title", # Unique font identifier 5: "version", # Version string 8: "author", # Manufacturer name 11: "url", # URL Vendor 14: "copyright", # License info URL } def extract(self, ttf): if "header" in ttf: self.extractHeader(ttf["header"]) if "names" in ttf: self.extractNames(ttf["names"]) @fault_tolerant def extractHeader(self, header): self.creation_date = header["created"].value self.last_modification = header["modified"].value self.comment = u"Smallest readable size in pixels: %s pixels" % header["lowest"].value self.comment = u"Font direction: %s" % header["font_dir"].display @fault_tolerant def extractNames(self, names): offset = names["offset"].value for header in names.array("header"): key = header["nameID"].value foffset = offset + header["offset"].value field = names.getFieldByAddress(foffset*8) if not field or not isString(field): continue value = field.value if key not in self.NAMEID_TO_ATTR: continue key = self.NAMEID_TO_ATTR[key] if key == "version" and value.startswith(u"Version "): # "Version 1.2" => "1.2" value = value[8:] setattr(self, key, value) class OLE2_Metadata(RootMetadata): SUMMARY_ID_TO_ATTR = { 2: "title", # Title 3: "title", # Subject 4: "author", 6: "comment", 8: "author", # Last saved by 12: "creation_date", 13: "last_modification", 14: "nb_page", 18: "producer", } IGNORE_SUMMARY = set(( 1, # Code page )) DOC_SUMMARY_ID_TO_ATTR = { 3: "title", # Subject 14: "author", # Manager } IGNORE_DOC_SUMMARY = set(( 1, # Code page )) def extract(self, ole2): self._extract(ole2) def _extract(self, fieldset): try: fieldset._feedAll() except StopIteration: pass if "root[0]" in fieldset: self._extract(self.getFragment(fieldset["root[0]"])) doc_summary = self.getField(fieldset, "doc_summary[0]") if doc_summary: self.useSummary(doc_summary, True) word_doc = self.getField(fieldset, "word_doc[0]") if word_doc: self.useWordDocument(word_doc) summary = self.getField(fieldset, "summary[0]") if summary: self.useSummary(summary, False) def getFragment(self, frag): stream = frag.getSubIStream() ministream = guessParser(stream) if not ministream: warning("Unable to create the OLE2 mini stream parser!") return frag return ministream def getField(self, fieldset, name): # _feedAll() is needed to make sure that we get all fragments # eg. summary[0], summary[1], ..., summary[n] try: fieldset._feedAll() except StopIteration: pass if name not in fieldset: return None field = fieldset[name] return self.getFragment(field) @fault_tolerant def useSummary(self, summary, is_doc_summary): if "os" in summary: self.os = summary["os"].display if "section[0]" not in summary: return summary = summary["section[0]"] for property in summary.array("property_index"): self.useProperty(summary, property, is_doc_summary) @fault_tolerant def useWordDocument(self, doc): self.comment = "Encrypted: %s" % doc["FIB/fEncrypted"].value @fault_tolerant def useProperty(self, summary, property, is_doc_summary): field = summary.getFieldByAddress(property["offset"].value*8) if not field \ or "value" not in field: return field = field["value"] if not field.hasValue(): return # Get value value = field.value if isinstance(value, (str, unicode)): value = normalizeString(value) if not value: return # Get property identifier prop_id = property["id"].value if is_doc_summary: id_to_attr = self.DOC_SUMMARY_ID_TO_ATTR ignore = self.IGNORE_DOC_SUMMARY else: id_to_attr = self.SUMMARY_ID_TO_ATTR ignore = self.IGNORE_SUMMARY if prop_id in ignore: return # Get Hachoir metadata key try: key = id_to_attr[prop_id] use_prefix = False except LookupError: key = "comment" use_prefix = True if use_prefix: prefix = property["id"].display if (prefix in ("TotalEditingTime", "LastPrinted")) \ and (not field): # Ignore null time delta return value = "%s: %s" % (prefix, value) else: if (key == "last_modification") and (not field): # Ignore null timestamp return setattr(self, key, value) class PcfMetadata(RootMetadata): PROP_TO_KEY = { 'CHARSET_REGISTRY': 'charset', 'COPYRIGHT': 'copyright', 'WEIGHT_NAME': 'font_weight', 'FOUNDRY': 'author', 'FONT': 'title', '_XMBDFED_INFO': 'producer', } def extract(self, pcf): if "properties" in pcf: self.useProperties(pcf["properties"]) def useProperties(self, properties): last = properties["total_str_length"] offset0 = last.address + last.size for index in properties.array("property"): # Search name and value value = properties.getFieldByAddress(offset0+index["value_offset"].value*8) if not value: continue value = value.value if not value: continue name = properties.getFieldByAddress(offset0+index["name_offset"].value*8) if not name: continue name = name.value if name not in self.PROP_TO_KEY: warning("Skip %s=%r" % (name, value)) continue key = self.PROP_TO_KEY[name] setattr(self, key, value) class SwfMetadata(RootMetadata): def extract(self, swf): self.height = swf["rect/ymax"].value # twips self.width = swf["rect/xmax"].value # twips self.format_version = "flash version %s" % swf["version"].value self.frame_rate = swf["frame_rate"].value self.comment = "Frame count: %s" % swf["frame_count"].value registerExtractor(TorrentFile, TorrentMetadata) registerExtractor(TrueTypeFontFile, TTF_Metadata) registerExtractor(OLE2_File, OLE2_Metadata) registerExtractor(PcfFile, PcfMetadata) registerExtractor(SwfFile, SwfMetadata)
gpl-3.0
anselal/antminer-monitor
antminermonitor/blueprints/user/models.py
1
1102
from flask_login.mixins import UserMixin from werkzeug.security import generate_password_hash, check_password_hash from sqlalchemy import Column, Integer, VARCHAR from antminermonitor.database import Base class User(UserMixin, Base): __tablename__ = 'user' id = Column(Integer, primary_key=True) username = Column(VARCHAR(64), index=True, unique=True) email = Column(VARCHAR(120), index=True, unique=True) password_hash = Column(VARCHAR(128)) surname = Column(VARCHAR(100)) firstname = Column(VARCHAR(100)) active = Column(Integer, default=1) @property def serialize(self): return { 'id': self.id, 'username': self.username, 'firstname': self.firstname, 'surname': self.surname, 'email': self.email } def __repr__(self): return '<User {}>'.format(self.username) def set_password(self, password): self.password_hash = generate_password_hash(password) def check_password(self, password): return check_password_hash(self.password_hash, password)
gpl-3.0
MarsZone/DreamLand
evennia/evennia/contrib/multidescer.py
4
9755
""" Evennia Mutltidescer Contrib - Griatch 2016 A "multidescer" is a concept from the MUSH world. It allows for creating, managing and switching between multiple character descriptions. This multidescer will not require any changes to the Character class, rather it will use the `multidescs` Attribute (a list) and create it if it does not exist. This contrib also works well together with the rpsystem contrib (which also adds the short descriptions and the `sdesc` command). Installation: Edit `mygame/commands/default_cmdsets.py` and add `from contrib.multidesc import CmdMultiDesc` to the top. Next, look up the `at_cmdset_create` method of the `CharacterCmdSet` class and add a line `self.add(CmdMultiDesc())` to the end of it. Reload the server and you should have the +desc command available (it will replace the default `desc` command). """ import re from evennia import default_cmds from evennia.utils.utils import crop from evennia.utils.eveditor import EvEditor # regex for the set functionality _RE_KEYS = re.compile(r"([\w\s]+)(?:\+*?)", re.U + re.I) # Helper functions for the Command class DescValidateError(ValueError): "Used for tracebacks from desc systems" pass def _update_store(caller, key=None, desc=None, delete=False, swapkey=None): """ Helper function for updating the database store. Args: caller (Object): The caller of the command. key (str): Description identifier desc (str): Description text. delete (bool): Delete given key. swapkey (str): Swap list positions of `key` and this key. """ if not caller.db.multidesc: # initialize the multidesc attribute caller.db.multidesc = [("caller", caller.db.desc or "")] if not key: return lokey = key.lower() match = [ind for ind, tup in enumerate(caller.db.multidesc) if tup[0] == lokey] if match: idesc = match[0] if delete: # delete entry del caller.db.multidesc[idesc] elif swapkey: # swap positions loswapkey = swapkey.lower() swapmatch = [ind for ind, tup in enumerate(caller.db.multidesc) if tup[0] == loswapkey] if swapmatch: iswap = swapmatch[0] if idesc == iswap: raise DescValidateError("Swapping a key with itself does nothing.") temp = caller.db.multidesc[idesc] caller.db.multidesc[idesc] = caller.db.multidesc[iswap] caller.db.multidesc[iswap] = temp else: raise DescValidateError("Description key '|w%s|n' not found." % swapkey) elif desc: # update in-place caller.db.multidesc[idesc] = (lokey, desc) else: raise DescValidateError("No description was set.") else: # no matching key if delete or swapkey: raise DescValidateError("Description key '|w%s|n' not found." % key) elif desc: # insert new at the top of the stack caller.db.multidesc.insert(0, (lokey, desc)) else: raise DescValidateError("No description was set.") # eveditor save/load/quit functions def _save_editor(caller, buffer): "Called when the editor saves its contents" key = caller.db._multidesc_editkey _update_store(caller, key, buffer) caller.msg("Saved description to key '%s'." % key) return True def _load_editor(caller): "Called when the editor loads contents" key = caller.db._multidesc_editkey match = [ind for ind, tup in enumerate(caller.db.multidesc) if tup[0] == key] if match: return caller.db.multidesc[match[0]][1] return "" def _quit_editor(caller): "Called when the editor quits" del caller.db._multidesc_editkey caller.msg("Exited editor.") # The actual command class class CmdMultiDesc(default_cmds.MuxCommand): """ Manage multiple descriptions Usage: +desc [key] - show current desc desc with <key> +desc <key> = <text> - add/replace desc with <key> +desc/list - list descriptions (abbreviated) +desc/list/full - list descriptions (full texts) +desc/edit <key> - add/edit desc <key> in line editor +desc/del <key> - delete desc <key> +desc/swap <key1>-<key2> - swap positions of <key1> and <key2> in list +desc/set <key> [+key+...] - set desc as default or combine multiple descs Notes: When combining multiple descs with +desc/set <key> + <key2> + ..., any keys not matching an actual description will be inserted as plain text. Use e.g. ansi line break ||/ to add a new paragraph and + + or ansi space ||_ to add extra whitespace. """ key = "+desc" aliases = ["desc"] locks = "cmd:all()" help_category = "General" def func(self): """ Implements the multidescer. We will use `db.desc` for the description in use and `db.multidesc` to store all descriptions. """ caller = self.caller args = self.args.strip() switches = self.switches try: if "list" in switches or "all" in switches: # list all stored descriptions, either in full or cropped. # Note that we list starting from 1, not from 0. _update_store(caller) do_crop = not "full" in switches if do_crop: outtext = ["|w%s:|n %s" % (key, crop(desc)) for key, desc in caller.db.multidesc] else: outtext = ["\n|w%s:|n|n\n%s\n%s" % (key, "-" * (len(key) + 1), desc) for key, desc in caller.db.multidesc] caller.msg("|wStored descs:|n\n" + "\n".join(outtext)) return elif "edit" in switches: # Use the eveditor to edit/create the named description if not args: caller.msg("Usage: %s/edit key" % self.key) return # this is used by the editor to know what to edit; it's deleted automatically caller.db._multidesc_editkey = args # start the editor EvEditor(caller, loadfunc=_load_editor, savefunc=_save_editor, quitfunc=_quit_editor, key="multidesc editor", persistent=True) elif "delete" in switches or "del" in switches: # delete a multidesc entry. if not args: caller.msg("Usage: %s/delete key" % self.key) return _update_store(caller, args, delete=True) caller.msg("Deleted description with key '%s'." % args) elif "swap" in switches or "switch" in switches or "reorder" in switches: # Reorder list by swapping two entries. We expect numbers starting from 1 keys = [arg for arg in args.split("-", 1)] if not len(keys) == 2: caller.msg("Usage: %s/swap key1-key2" % self.key) return key1, key2 = keys # perform the swap _update_store(caller, key1, swapkey=key2) caller.msg("Swapped descs '%s' and '%s'." % (key1, key2)) elif "set" in switches: # switches one (or more) of the multidescs to be the "active" description _update_store(caller) if not args: caller.msg("Usage: %s/set key [+ key2 + key3 + ...]" % self.key) return new_desc = [] multidesc = caller.db.multidesc for key in args.split("+"): notfound = True lokey = key.strip().lower() for mkey, desc in multidesc: if lokey == mkey: new_desc.append(desc) notfound = False continue if notfound: # if we get here, there is no desc match, we add it as a normal string new_desc.append(key) new_desc = "".join(new_desc) caller.db.desc = new_desc caller.msg("%s\n\n|wThe above was set as the current description.|n" % new_desc) elif self.rhs or "add" in switches: # add text directly to a new entry or an existing one. if not (self.lhs and self.rhs): caller.msg("Usage: %s/add key = description" % self.key) return key, desc = self.lhs, self.rhs _update_store(caller, key, desc) caller.msg("Stored description '%s': \"%s\"" % (key, crop(desc))) else: # display the current description or a numbered description _update_store(caller) if args: key = args.lower() multidesc = caller.db.multidesc for mkey, desc in multidesc: if key == mkey: caller.msg("|wDecsription %s:|n\n%s" % (key, desc)) return caller.msg("Description key '%s' not found." % key) else: caller.msg("|wCurrent desc:|n\n%s" % caller.db.desc) except DescValidateError, err: # This is triggered by _key_to_index caller.msg(err)
bsd-3-clause
stephane-martin/salt-debian-packaging
salt-2016.3.3/salt/modules/bigip.py
2
69757
# -*- coding: utf-8 -*- ''' An execution module which can manipulate an f5 bigip via iControl REST :maturity: develop :platform: f5_bigip_11.6 ''' # Import python libs from __future__ import absolute_import import json import logging as logger # Import third party libs try: import requests import requests.exceptions HAS_LIBS = True except ImportError: HAS_LIBS = False # Import 3rd-party libs import salt.ext.six as six # Import salt libs import salt.utils import salt.output import salt.exceptions # Setup the logger log = logger.getLogger(__name__) # Define the module's virtual name __virtualname__ = 'bigip' def __virtual__(): ''' Only return if requests is installed ''' if HAS_LIBS: return __virtualname__ return (False, 'The bigip execution module cannot be loaded: ' 'python requests library not available.') BIG_IP_URL_BASE = 'https://{host}/mgmt/tm' def _build_session(username, password, trans_label=None): ''' Create a session to be used when connecting to iControl REST. ''' bigip = requests.session() bigip.auth = (username, password) bigip.verify = False bigip.headers.update({'Content-Type': 'application/json'}) if trans_label: #pull the trans id from the grain trans_id = __salt__['grains.get']('bigip_f5_trans:{label}'.format(label=trans_label)) if trans_id: bigip.headers.update({'X-F5-REST-Coordination-Id': trans_id}) else: bigip.headers.update({'X-F5-REST-Coordination-Id': None}) return bigip def _load_response(response): ''' Load the response from json data, return the dictionary or raw text ''' try: data = json.loads(response.text) except ValueError: data = response.text ret = {'code': response.status_code, 'content': data} return ret def _load_connection_error(hostname, error): ''' Format and Return a connection error ''' ret = {'code': None, 'content': 'Error: Unable to connect to the bigip device: {host}\n{error}'.format(host=hostname, error=error)} return ret def _loop_payload(params): ''' Pass in a dictionary of parameters, loop through them and build a payload containing, parameters who's values are not None. ''' #construct the payload payload = {} #set the payload for param, value in six.iteritems(params): if value is not None: payload[param] = value return payload def _build_list(option_value, item_kind): ''' pass in an option to check for a list of items, create a list of dictionary of items to set for this option ''' #specify profiles if provided if option_value is not None: items = [] #if user specified none, return an empty list if option_value == 'none': return items #was a list already passed in? if not isinstance(option_value, list): values = option_value.split(',') else: values = option_value for value in values: # sometimes the bigip just likes a plain ol list of items if item_kind is None: items.append(value) # other times it's picky and likes key value pairs... else: items.append({'kind': item_kind, 'name': value}) return items return None def _determine_toggles(payload, toggles): ''' BigIP can't make up its mind if it likes yes / no or true or false. Figure out what it likes to hear without confusing the user. ''' for toggle, definition in six.iteritems(toggles): #did the user specify anything? if definition['value'] is not None: #test for yes_no toggle if (definition['value'] is True or definition['value'] == 'yes') and definition['type'] == 'yes_no': payload[toggle] = 'yes' elif (definition['value'] is False or definition['value'] == 'no') and definition['type'] == 'yes_no': payload[toggle] = 'no' #test for true_false toggle if (definition['value'] is True or definition['value'] == 'yes') and definition['type'] == 'true_false': payload[toggle] = True elif (definition['value'] is False or definition['value'] == 'no') and definition['type'] == 'true_false': payload[toggle] = False return payload def _set_value(value): ''' A function to detect if user is trying to pass a dictionary or list. parse it and return a dictionary list or a string ''' logger.error(value) #don't continue if already an acceptable data-type if isinstance(value, bool) or isinstance(value, dict) or isinstance(value, list): return value #check if json if value.startswith('j{') and value.endswith('}j'): value = value.replace('j{', '{') value = value.replace('}j', '}') try: return json.loads(value) except Exception: raise salt.exceptions.CommandExecutionError #detect list of dictionaries if '|' in value and r'\|' not in value: values = value.split('|') items = [] for value in values: items.append(_set_value(value)) return items #parse out dictionary if detected if ':' in value and r'\:' not in value: options = {} #split out pairs key_pairs = value.split(',') for key_pair in key_pairs: k = key_pair.split(':')[0] v = key_pair.split(':')[1] options[k] = v return options #try making a list elif ',' in value and r'\,' not in value: value_items = value.split(',') return value_items #just return a string else: #remove escape chars if added if r'\|' in value: value = value.replace(r'\|', '|') if r'\:' in value: value = value.replace(r'\:', ':') if r'\,' in value: value = value.replace(r'\,', ',') return value def start_transaction(hostname, username, password, label): ''' A function to connect to a bigip device and start a new transaction. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password label The name / alias for this transaction. The actual transaction id will be stored within a grain called ``bigip_f5_trans:<label>`` CLI Example:: salt '*' bigip.start_transaction bigip admin admin my_transaction ''' #build the session bigip_session = _build_session(username, password) payload = {} #post to REST to get trans id try: response = bigip_session.post(BIG_IP_URL_BASE.format(host=hostname)+'/transaction', data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) #extract the trans_id data = _load_response(response) if data['code'] == 200: trans_id = data['content']['transId'] __salt__['grains.setval']('bigip_f5_trans', {label: trans_id}) return 'Transaction: {trans_id} - has successfully been stored in the grain: bigip_f5_trans:{label}'.format(trans_id=trans_id, label=label) else: return data def list_transaction(hostname, username, password, label): ''' A function to connect to a bigip device and list an existing transaction. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password label the label of this transaction stored within the grain: ``bigip_f5_trans:<label>`` CLI Example:: salt '*' bigip.list_transaction bigip admin admin my_transaction ''' #build the session bigip_session = _build_session(username, password) #pull the trans id from the grain trans_id = __salt__['grains.get']('bigip_f5_trans:{label}'.format(label=label)) if trans_id: #post to REST to get trans id try: response = bigip_session.get(BIG_IP_URL_BASE.format(host=hostname)+'/transaction/{trans_id}/commands'.format(trans_id=trans_id)) return _load_response(response) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) else: return 'Error: the label for this transaction was not defined as a grain. Begin a new transaction using the' \ ' bigip.start_transaction function' def commit_transaction(hostname, username, password, label): ''' A function to connect to a bigip device and commit an existing transaction. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password label the label of this transaction stored within the grain: ``bigip_f5_trans:<label>`` CLI Example:: salt '*' bigip.commit_transaction bigip admin admin my_transaction ''' #build the session bigip_session = _build_session(username, password) #pull the trans id from the grain trans_id = __salt__['grains.get']('bigip_f5_trans:{label}'.format(label=label)) if trans_id: payload = {} payload['state'] = 'VALIDATING' #patch to REST to get trans id try: response = bigip_session.patch(BIG_IP_URL_BASE.format(host=hostname)+'/transaction/{trans_id}'.format(trans_id=trans_id), data=json.dumps(payload)) return _load_response(response) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) else: return 'Error: the label for this transaction was not defined as a grain. Begin a new transaction using the' \ ' bigip.start_transaction function' def delete_transaction(hostname, username, password, label): ''' A function to connect to a bigip device and delete an existing transaction. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password label The label of this transaction stored within the grain: ``bigip_f5_trans:<label>`` CLI Example:: salt '*' bigip.delete_transaction bigip admin admin my_transaction ''' #build the session bigip_session = _build_session(username, password) #pull the trans id from the grain trans_id = __salt__['grains.get']('bigip_f5_trans:{label}'.format(label=label)) if trans_id: #patch to REST to get trans id try: response = bigip_session.delete(BIG_IP_URL_BASE.format(host=hostname)+'/transaction/{trans_id}'.format(trans_id=trans_id)) return _load_response(response) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) else: return 'Error: the label for this transaction was not defined as a grain. Begin a new transaction using the' \ ' bigip.start_transaction function' def list_node(hostname, username, password, name=None, trans_label=None): ''' A function to connect to a bigip device and list all nodes or a specific node. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the node to list. If no name is specified than all nodes will be listed. trans_label The label of the transaction stored within the grain: ``bigip_f5_trans:<label>`` CLI Example:: salt '*' bigip.list_node bigip admin admin my-node ''' #build sessions bigip_session = _build_session(username, password, trans_label) #get to REST try: if name: response = bigip_session.get(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/node/{name}'.format(name=name)) else: response = bigip_session.get(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/node') except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def create_node(hostname, username, password, name, address, trans_label=None): ''' A function to connect to a bigip device and create a node. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the node address The address of the node trans_label The label of the transaction stored within the grain: ``bigip_f5_trans:<label>`` CLI Example:: salt '*' bigip.create_node bigip admin admin 10.1.1.2 ''' #build session bigip_session = _build_session(username, password, trans_label) #construct the payload payload = {} payload['name'] = name payload['address'] = address #post to REST try: response = bigip_session.post(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/node', data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def modify_node(hostname, username, password, name, connection_limit=None, description=None, dynamic_ratio=None, logging=None, monitor=None, rate_limit=None, ratio=None, session=None, state=None, trans_label=None): ''' A function to connect to a bigip device and modify an existing node. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the node to modify connection_limit [integer] description [string] dynamic_ratio [integer] logging [enabled | disabled] monitor [[name] | none | default] rate_limit [integer] ratio [integer] session [user-enabled | user-disabled] state [user-down | user-up ] trans_label The label of the transaction stored within the grain: ``bigip_f5_trans:<label>`` CLI Example:: salt '*' bigip.modify_node bigip admin admin 10.1.1.2 ratio=2 logging=enabled ''' params = { 'connection-limit': connection_limit, 'description': description, 'dynamic-ratio': dynamic_ratio, 'logging': logging, 'monitor': monitor, 'rate-limit': rate_limit, 'ratio': ratio, 'session': session, 'state': state, } #build session bigip_session = _build_session(username, password, trans_label) #build payload payload = _loop_payload(params) payload['name'] = name #put to REST try: response = bigip_session.put(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/node/{name}'.format(name=name), data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def delete_node(hostname, username, password, name, trans_label=None): ''' A function to connect to a bigip device and delete a specific node. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the node which will be deleted. trans_label The label of the transaction stored within the grain: ``bigip_f5_trans:<label>`` CLI Example:: salt '*' bigip.delete_node bigip admin admin my-node ''' #build session bigip_session = _build_session(username, password, trans_label) #delete to REST try: response = bigip_session.delete(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/node/{name}'.format(name=name)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) if _load_response(response) == '': return True else: return _load_response(response) def list_pool(hostname, username, password, name=None): ''' A function to connect to a bigip device and list all pools or a specific pool. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the pool to list. If no name is specified then all pools will be listed. CLI Example:: salt '*' bigip.list_pool bigip admin admin my-pool ''' #build sessions bigip_session = _build_session(username, password) #get to REST try: if name: response = bigip_session.get(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/pool/{name}/?expandSubcollections=true'.format(name=name)) else: response = bigip_session.get(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/pool') except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def create_pool(hostname, username, password, name, members=None, allow_nat=None, allow_snat=None, description=None, gateway_failsafe_device=None, ignore_persisted_weight=None, ip_tos_to_client=None, ip_tos_to_server=None, link_qos_to_client=None, link_qos_to_server=None, load_balancing_mode=None, min_active_members=None, min_up_members=None, min_up_members_action=None, min_up_members_checking=None, monitor=None, profiles=None, queue_depth_limit=None, queue_on_connection_limit=None, queue_time_limit=None, reselect_tries=None, service_down_action=None, slow_ramp_time=None): ''' A function to connect to a bigip device and create a pool. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the pool to create. members List of comma delimited pool members to add to the pool. i.e. 10.1.1.1:80,10.1.1.2:80,10.1.1.3:80 allow_nat [yes | no] allow_snat [yes | no] description [string] gateway_failsafe_device [string] ignore_persisted_weight [enabled | disabled] ip_tos_to_client [pass-through | [integer]] ip_tos_to_server [pass-through | [integer]] link_qos_to_client [pass-through | [integer]] link_qos_to_server [pass-through | [integer]] load_balancing_mode [dynamic-ratio-member | dynamic-ratio-node | fastest-app-response | fastest-node | least-connections-members | least-connections-node | least-sessions | observed-member | observed-node | predictive-member | predictive-node | ratio-least-connections-member | ratio-least-connections-node | ratio-member | ratio-node | ratio-session | round-robin | weighted-least-connections-member | weighted-least-connections-node] min_active_members [integer] min_up_members [integer] min_up_members_action [failover | reboot | restart-all] min_up_members_checking [enabled | disabled] monitor [name] profiles [none | profile_name] queue_depth_limit [integer] queue_on_connection_limit [enabled | disabled] queue_time_limit [integer] reselect_tries [integer] service_down_action [drop | none | reselect | reset] slow_ramp_time [integer] CLI Example:: salt '*' bigip.create_pool bigip admin admin my-pool 10.1.1.1:80,10.1.1.2:80,10.1.1.3:80 monitor=http ''' params = { 'description': description, 'gateway-failsafe-device': gateway_failsafe_device, 'ignore-persisted-weight': ignore_persisted_weight, 'ip-tos-to-client': ip_tos_to_client, 'ip-tos-to-server': ip_tos_to_server, 'link-qos-to-client': link_qos_to_client, 'link-qos-to-server': link_qos_to_server, 'load-balancing-mode': load_balancing_mode, 'min-active-members': min_active_members, 'min-up-members': min_up_members, 'min-up-members-action': min_up_members_action, 'min-up-members-checking': min_up_members_checking, 'monitor': monitor, 'profiles': profiles, 'queue-on-connection-limit': queue_on_connection_limit, 'queue-depth-limit': queue_depth_limit, 'queue-time-limit': queue_time_limit, 'reselect-tries': reselect_tries, 'service-down-action': service_down_action, 'slow-ramp-time': slow_ramp_time } # some options take yes no others take true false. Figure out when to use which without # confusing the end user toggles = { 'allow-nat': {'type': 'yes_no', 'value': allow_nat}, 'allow-snat': {'type': 'yes_no', 'value': allow_snat} } #build payload payload = _loop_payload(params) payload['name'] = name #determine toggles payload = _determine_toggles(payload, toggles) #specify members if provided if members is not None: payload['members'] = _build_list(members, 'ltm:pool:members') #build session bigip_session = _build_session(username, password) #post to REST try: response = bigip_session.post(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/pool', data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def modify_pool(hostname, username, password, name, allow_nat=None, allow_snat=None, description=None, gateway_failsafe_device=None, ignore_persisted_weight=None, ip_tos_to_client=None, ip_tos_to_server=None, link_qos_to_client=None, link_qos_to_server=None, load_balancing_mode=None, min_active_members=None, min_up_members=None, min_up_members_action=None, min_up_members_checking=None, monitor=None, profiles=None, queue_depth_limit=None, queue_on_connection_limit=None, queue_time_limit=None, reselect_tries=None, service_down_action=None, slow_ramp_time=None): ''' A function to connect to a bigip device and modify an existing pool. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the pool to modify. allow_nat [yes | no] allow_snat [yes | no] description [string] gateway_failsafe_device [string] ignore_persisted_weight [yes | no] ip_tos_to_client [pass-through | [integer]] ip_tos_to_server [pass-through | [integer]] link_qos_to_client [pass-through | [integer]] link_qos_to_server [pass-through | [integer]] load_balancing_mode [dynamic-ratio-member | dynamic-ratio-node | fastest-app-response | fastest-node | least-connections-members | least-connections-node | least-sessions | observed-member | observed-node | predictive-member | predictive-node | ratio-least-connections-member | ratio-least-connections-node | ratio-member | ratio-node | ratio-session | round-robin | weighted-least-connections-member | weighted-least-connections-node] min_active_members [integer] min_up_members [integer] min_up_members_action [failover | reboot | restart-all] min_up_members_checking [enabled | disabled] monitor [name] profiles [none | profile_name] queue_on_connection_limit [enabled | disabled] queue_depth_limit [integer] queue_time_limit [integer] reselect_tries [integer] service_down_action [drop | none | reselect | reset] slow_ramp_time [integer] CLI Example:: salt '*' bigip.modify_pool bigip admin admin my-pool 10.1.1.1:80,10.1.1.2:80,10.1.1.3:80 min_active_members=1 ''' params = { 'description': description, 'gateway-failsafe-device': gateway_failsafe_device, 'ignore-persisted-weight': ignore_persisted_weight, 'ip-tos-to-client': ip_tos_to_client, 'ip-tos-to-server': ip_tos_to_server, 'link-qos-to-client': link_qos_to_client, 'link-qos-to-server': link_qos_to_server, 'load-balancing-mode': load_balancing_mode, 'min-active-members': min_active_members, 'min-up-members': min_up_members, 'min-up_members-action': min_up_members_action, 'min-up-members-checking': min_up_members_checking, 'monitor': monitor, 'profiles': profiles, 'queue-on-connection-limit': queue_on_connection_limit, 'queue-depth-limit': queue_depth_limit, 'queue-time-limit': queue_time_limit, 'reselect-tries': reselect_tries, 'service-down-action': service_down_action, 'slow-ramp-time': slow_ramp_time } # some options take yes no others take true false. Figure out when to use which without # confusing the end user toggles = { 'allow-nat': {'type': 'yes_no', 'value': allow_nat}, 'allow-snat': {'type': 'yes_no', 'value': allow_snat} } #build payload payload = _loop_payload(params) payload['name'] = name #determine toggles payload = _determine_toggles(payload, toggles) #build session bigip_session = _build_session(username, password) #post to REST try: response = bigip_session.put(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/pool/{name}'.format(name=name), data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def delete_pool(hostname, username, password, name): ''' A function to connect to a bigip device and delete a specific pool. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the pool which will be deleted CLI Example:: salt '*' bigip.delete_node bigip admin admin my-pool ''' #build session bigip_session = _build_session(username, password) #delete to REST try: response = bigip_session.delete(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/pool/{name}'.format(name=name)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) if _load_response(response) == '': return True else: return _load_response(response) def replace_pool_members(hostname, username, password, name, members): ''' A function to connect to a bigip device and replace members of an existing pool with new members. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the pool to modify members List of comma delimited pool members to replace existing members with. i.e. 10.1.1.1:80,10.1.1.2:80,10.1.1.3:80 CLI Example:: salt '*' bigip.replace_pool_members bigip admin admin my-pool 10.2.2.1:80,10.2.2.2:80,10.2.2.3:80 ''' payload = {} payload['name'] = name #specify members if provided if members is not None: if isinstance(members, str): members = members.split(',') pool_members = [] for member in members: #check to see if already a dictionary ( for states) if isinstance(member, dict): #check for state alternative name 'member_state', replace with state if 'member_state' in member.keys(): member['state'] = member.pop('member_state') #replace underscore with dash for key in member.keys(): new_key = key.replace('_', '-') member[new_key] = member.pop(key) pool_members.append(member) #parse string passed via execution command (for executions) else: pool_members.append({'name': member, 'address': member.split(':')[0]}) payload['members'] = pool_members #build session bigip_session = _build_session(username, password) #put to REST try: response = bigip_session.put(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/pool/{name}'.format(name=name), data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def add_pool_member(hostname, username, password, name, member): ''' A function to connect to a bigip device and add a new member to an existing pool. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the pool to modify member The name of the member to add i.e. 10.1.1.2:80 CLI Example: .. code-block:: bash salt '*' bigip.add_pool_members bigip admin admin my-pool 10.2.2.1:80 ''' # for states if isinstance(member, dict): #check for state alternative name 'member_state', replace with state if 'member_state' in member.keys(): member['state'] = member.pop('member_state') #replace underscore with dash for key in member.keys(): new_key = key.replace('_', '-') member[new_key] = member.pop(key) payload = member # for execution else: payload = {'name': member, 'address': member.split(':')[0]} #build session bigip_session = _build_session(username, password) #post to REST try: response = bigip_session.post(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/pool/{name}/members'.format(name=name), data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def modify_pool_member(hostname, username, password, name, member, connection_limit=None, description=None, dynamic_ratio=None, inherit_profile=None, logging=None, monitor=None, priority_group=None, profiles=None, rate_limit=None, ratio=None, session=None, state=None): ''' A function to connect to a bigip device and modify an existing member of a pool. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the pool to modify member The name of the member to modify i.e. 10.1.1.2:80 connection_limit [integer] description [string] dynamic_ratio [integer] inherit_profile [enabled | disabled] logging [enabled | disabled] monitor [name] priority_group [integer] profiles [none | profile_name] rate_limit [integer] ratio [integer] session [user-enabled | user-disabled] state [ user-up | user-down ] CLI Example:: salt '*' bigip.modify_pool_member bigip admin admin my-pool 10.2.2.1:80 state=use-down session=user-disabled ''' params = { 'connection-limit': connection_limit, 'description': description, 'dynamic-ratio': dynamic_ratio, 'inherit-profile': inherit_profile, 'logging': logging, 'monitor': monitor, 'priority-group': priority_group, 'profiles': profiles, 'rate-limit': rate_limit, 'ratio': ratio, 'session': session, 'state': state } #build session bigip_session = _build_session(username, password) #build payload payload = _loop_payload(params) #put to REST try: response = bigip_session.put(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/pool/{name}/members/{member}'.format(name=name, member=member), data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def delete_pool_member(hostname, username, password, name, member): ''' A function to connect to a bigip device and delete a specific pool. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the pool to modify member The name of the pool member to delete CLI Example:: salt '*' bigip.delete_node bigip admin admin my-pool 10.2.2.2:80 ''' #build session bigip_session = _build_session(username, password) #delete to REST try: response = bigip_session.delete(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/pool/{name}/members/{member}'.format(name=name, member=member)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) if _load_response(response) == '': return True else: return _load_response(response) def list_virtual(hostname, username, password, name=None): ''' A function to connect to a bigip device and list all virtuals or a specific virtual. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the virtual to list. If no name is specified than all virtuals will be listed. CLI Example:: salt '*' bigip.list_virtual bigip admin admin my-virtual ''' #build sessions bigip_session = _build_session(username, password) #get to REST try: if name: response = bigip_session.get(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/virtual/{name}/?expandSubcollections=true'.format(name=name)) else: response = bigip_session.get(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/virtual') except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def create_virtual(hostname, username, password, name, destination, pool=None, address_status=None, auto_lasthop=None, bwc_policy=None, cmp_enabled=None, connection_limit=None, dhcp_relay=None, description=None, fallback_persistence=None, flow_eviction_policy=None, gtm_score=None, ip_forward=None, ip_protocol=None, internal=None, twelve_forward=None, last_hop_pool=None, mask=None, mirror=None, nat64=None, persist=None, profiles=None, policies=None, rate_class=None, rate_limit=None, rate_limit_mode=None, rate_limit_dst=None, rate_limit_src=None, rules=None, related_rules=None, reject=None, source=None, source_address_translation=None, source_port=None, state=None, traffic_classes=None, translate_address=None, translate_port=None, vlans=None): r''' A function to connect to a bigip device and create a virtual server. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the virtual to create destination [ [virtual_address_name:port] | [ipv4:port] | [ipv6.port] ] pool [ [pool_name] | none] address_status [yes | no] auto_lasthop [default | enabled | disabled ] bwc_policy [none] | string] cmp_enabled [yes | no] dhcp_relay [yes | no] connection_limit [integer] description [string] state [disabled | enabled] fallback_persistence [none | [profile name] ] flow_eviction_policy [none | [eviction policy name] ] gtm_score [integer] ip_forward [yes | no] ip_protocol [any | protocol] internal [yes | no] twelve_forward (12-forward) [yes | no] last_hop-pool [ [pool_name] | none] mask { [ipv4] | [ipv6] } mirror { [disabled | enabled | none] } nat64 [enabled | disabled] persist [none | profile1,profile2,profile3 ... ] profiles [none | default | profile1,profile2,profile3 ... ] policies [none | default | policy1,policy2,policy3 ... ] rate_class [name] rate_limit [integer] rate_limit_mode [destination | object | object-destination | object-source | object-source-destination | source | source-destination] rate_limit_dst [integer] rate_limitçsrc [integer] rules [none | [rule_one,rule_two ...] ] related_rules [none | [rule_one,rule_two ...] ] reject [yes | no] source { [ipv4[/prefixlen]] | [ipv6[/prefixlen]] } source_address_translation [none | snat:pool_name | lsn | automap ] source_port [change | preserve | preserve-strict] state [enabled | disabled] traffic_classes [none | default | class_one,class_two ... ] translate_address [enabled | disabled] translate_port [enabled | disabled] vlans [none | default | [enabled|disabled]:vlan1,vlan2,vlan3 ... ] CLI Examples:: salt '*' bigip.create_virtual bigip admin admin my-virtual-3 26.2.2.5:80 \ pool=my-http-pool-http profiles=http,tcp salt '*' bigip.create_virtual bigip admin admin my-virtual-3 43.2.2.5:80 \ pool=test-http-pool-http profiles=http,websecurity persist=cookie,hash \ policies=asm_auto_l7_policy__http-virtual \ rules=_sys_APM_ExchangeSupport_helper,_sys_https_redirect \ related_rules=_sys_APM_activesync,_sys_APM_ExchangeSupport_helper \ source_address_translation=snat:my-snat-pool \ translate_address=enabled translate_port=enabled \ traffic_classes=my-class,other-class \ vlans=enabled:external,internal ''' params = { 'pool': pool, 'auto-lasthop': auto_lasthop, 'bwc-policy': bwc_policy, 'connection-limit': connection_limit, 'description': description, 'fallback-persistence': fallback_persistence, 'flow-eviction-policy': flow_eviction_policy, 'gtm-score': gtm_score, 'ip-protocol': ip_protocol, 'last-hop-pool': last_hop_pool, 'mask': mask, 'mirror': mirror, 'nat64': nat64, 'persist': persist, 'rate-class': rate_class, 'rate-limit': rate_limit, 'rate-limit-mode': rate_limit_mode, 'rate-limit-dst': rate_limit_dst, 'rate-limit-src': rate_limit_src, 'source': source, 'source-port': source_port, 'translate-address': translate_address, 'translate-port': translate_port } # some options take yes no others take true false. Figure out when to use which without # confusing the end user toggles = { 'address-status': {'type': 'yes_no', 'value': address_status}, 'cmp-enabled': {'type': 'yes_no', 'value': cmp_enabled}, 'dhcp-relay': {'type': 'true_false', 'value': dhcp_relay}, 'reject': {'type': 'true_false', 'value': reject}, '12-forward': {'type': 'true_false', 'value': twelve_forward}, 'internal': {'type': 'true_false', 'value': internal}, 'ip-forward': {'type': 'true_false', 'value': ip_forward} } #build session bigip_session = _build_session(username, password) #build payload payload = _loop_payload(params) payload['name'] = name payload['destination'] = destination #determine toggles payload = _determine_toggles(payload, toggles) #specify profiles if provided if profiles is not None: payload['profiles'] = _build_list(profiles, 'ltm:virtual:profile') #specify persist if provided if persist is not None: payload['persist'] = _build_list(persist, 'ltm:virtual:persist') #specify policies if provided if policies is not None: payload['policies'] = _build_list(policies, 'ltm:virtual:policy') #specify rules if provided if rules is not None: payload['rules'] = _build_list(rules, None) #specify related-rules if provided if related_rules is not None: payload['related-rules'] = _build_list(related_rules, None) #handle source-address-translation if source_address_translation is not None: #check to see if this is already a dictionary first if isinstance(source_address_translation, dict): payload['source-address-translation'] = source_address_translation elif source_address_translation == 'none': payload['source-address-translation'] = {'pool': 'none', 'type': 'none'} elif source_address_translation == 'automap': payload['source-address-translation'] = {'pool': 'none', 'type': 'automap'} elif source_address_translation == 'lsn': payload['source-address-translation'] = {'pool': 'none', 'type': 'lsn'} elif source_address_translation.startswith('snat'): snat_pool = source_address_translation.split(':')[1] payload['source-address-translation'] = {'pool': snat_pool, 'type': 'snat'} #specify related-rules if provided if traffic_classes is not None: payload['traffic-classes'] = _build_list(traffic_classes, None) #handle vlans if vlans is not None: #ceck to see if vlans is a dictionary (used when state makes use of function) if isinstance(vlans, dict): try: payload['vlans'] = vlans['vlan_ids'] if vlans['enabled']: payload['vlans-enabled'] = True elif vlans['disabled']: payload['vlans-disabled'] = True except Exception: return 'Error: Unable to Parse vlans dictionary: \n\tvlans={vlans}'.format(vlans=vlans) elif vlans == 'none': payload['vlans'] = 'none' elif vlans == 'default': payload['vlans'] = 'default' elif isinstance(vlans, str) and (vlans.startswith('enabled') or vlans.startswith('disabled')): try: vlans_setting = vlans.split(':')[0] payload['vlans'] = vlans.split(':')[1].split(',') if vlans_setting == 'disabled': payload['vlans-disabled'] = True elif vlans_setting == 'enabled': payload['vlans-enabled'] = True except Exception: return 'Error: Unable to Parse vlans option: \n\tvlans={vlans}'.format(vlans=vlans) else: return 'Error: vlans must be a dictionary or string.' #determine state if state is not None: if state == 'enabled': payload['enabled'] = True elif state == 'disabled': payload['disabled'] = True #post to REST try: response = bigip_session.post(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/virtual', data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def modify_virtual(hostname, username, password, name, destination=None, pool=None, address_status=None, auto_lasthop=None, bwc_policy=None, cmp_enabled=None, connection_limit=None, dhcp_relay=None, description=None, fallback_persistence=None, flow_eviction_policy=None, gtm_score=None, ip_forward=None, ip_protocol=None, internal=None, twelve_forward=None, last_hop_pool=None, mask=None, mirror=None, nat64=None, persist=None, profiles=None, policies=None, rate_class=None, rate_limit=None, rate_limit_mode=None, rate_limit_dst=None, rate_limit_src=None, rules=None, related_rules=None, reject=None, source=None, source_address_translation=None, source_port=None, state=None, traffic_classes=None, translate_address=None, translate_port=None, vlans=None): ''' A function to connect to a bigip device and modify an existing virtual server. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the virtual to modify destination [ [virtual_address_name:port] | [ipv4:port] | [ipv6.port] ] pool [ [pool_name] | none] address_status [yes | no] auto_lasthop [default | enabled | disabled ] bwc_policy [none] | string] cmp_enabled [yes | no] dhcp_relay [yes | no} connection_limit [integer] description [string] state [disabled | enabled] fallback_persistence [none | [profile name] ] flow_eviction_policy [none | [eviction policy name] ] gtm_score [integer] ip_forward [yes | no] ip_protocol [any | protocol] internal [yes | no] twelve_forward (12-forward) [yes | no] last_hop-pool [ [pool_name] | none] mask { [ipv4] | [ipv6] } mirror { [disabled | enabled | none] } nat64 [enabled | disabled] persist [none | profile1,profile2,profile3 ... ] profiles [none | default | profile1,profile2,profile3 ... ] policies [none | default | policy1,policy2,policy3 ... ] rate_class [name] rate_limit [integer] rate_limitr_mode [destination | object | object-destination | object-source | object-source-destination | source | source-destination] rate_limit_dst [integer] rate_limit_src [integer] rules [none | [rule_one,rule_two ...] ] related_rules [none | [rule_one,rule_two ...] ] reject [yes | no] source { [ipv4[/prefixlen]] | [ipv6[/prefixlen]] } source_address_translation [none | snat:pool_name | lsn | automap ] source_port [change | preserve | preserve-strict] state [enabled | disable] traffic_classes [none | default | class_one,class_two ... ] translate_address [enabled | disabled] translate_port [enabled | disabled] vlans [none | default | [enabled|disabled]:vlan1,vlan2,vlan3 ... ] CLI Example:: salt '*' bigip.modify_virtual bigip admin admin my-virtual source_address_translation=none salt '*' bigip.modify_virtual bigip admin admin my-virtual rules=my-rule,my-other-rule ''' params = { 'destination': destination, 'pool': pool, 'auto-lasthop': auto_lasthop, 'bwc-policy': bwc_policy, 'connection-limit': connection_limit, 'description': description, 'fallback-persistence': fallback_persistence, 'flow-eviction-policy': flow_eviction_policy, 'gtm-score': gtm_score, 'ip-protocol': ip_protocol, 'last-hop-pool': last_hop_pool, 'mask': mask, 'mirror': mirror, 'nat64': nat64, 'persist': persist, 'rate-class': rate_class, 'rate-limit': rate_limit, 'rate-limit-mode': rate_limit_mode, 'rate-limit-dst': rate_limit_dst, 'rate-limit-src': rate_limit_src, 'source': source, 'source-port': source_port, 'translate-address': translate_address, 'translate-port': translate_port } # some options take yes no others take true false. Figure out when to use which without # confusing the end user toggles = { 'address-status': {'type': 'yes_no', 'value': address_status}, 'cmp-enabled': {'type': 'yes_no', 'value': cmp_enabled}, 'dhcp-relay': {'type': 'true_false', 'value': dhcp_relay}, 'reject': {'type': 'true_false', 'value': reject}, '12-forward': {'type': 'true_false', 'value': twelve_forward}, 'internal': {'type': 'true_false', 'value': internal}, 'ip-forward': {'type': 'true_false', 'value': ip_forward} } #build session bigip_session = _build_session(username, password) #build payload payload = _loop_payload(params) payload['name'] = name #determine toggles payload = _determine_toggles(payload, toggles) #specify profiles if provided if profiles is not None: payload['profiles'] = _build_list(profiles, 'ltm:virtual:profile') #specify persist if provided if persist is not None: payload['persist'] = _build_list(persist, 'ltm:virtual:persist') #specify policies if provided if policies is not None: payload['policies'] = _build_list(policies, 'ltm:virtual:policy') #specify rules if provided if rules is not None: payload['rules'] = _build_list(rules, None) #specify related-rules if provided if related_rules is not None: payload['related-rules'] = _build_list(related_rules, None) #handle source-address-translation if source_address_translation is not None: if source_address_translation == 'none': payload['source-address-translation'] = {'pool': 'none', 'type': 'none'} elif source_address_translation == 'automap': payload['source-address-translation'] = {'pool': 'none', 'type': 'automap'} elif source_address_translation == 'lsn': payload['source-address-translation'] = {'pool': 'none', 'type': 'lsn'} elif source_address_translation.startswith('snat'): snat_pool = source_address_translation.split(':')[1] payload['source-address-translation'] = {'pool': snat_pool, 'type': 'snat'} #specify related-rules if provided if traffic_classes is not None: payload['traffic-classes'] = _build_list(traffic_classes, None) #handle vlans if vlans is not None: #ceck to see if vlans is a dictionary (used when state makes use of function) if isinstance(vlans, dict): try: payload['vlans'] = vlans['vlan_ids'] if vlans['enabled']: payload['vlans-enabled'] = True elif vlans['disabled']: payload['vlans-disabled'] = True except Exception: return 'Error: Unable to Parse vlans dictionary: \n\tvlans={vlans}'.format(vlans=vlans) elif vlans == 'none': payload['vlans'] = 'none' elif vlans == 'default': payload['vlans'] = 'default' elif vlans.startswith('enabled') or vlans.startswith('disabled'): try: vlans_setting = vlans.split(':')[0] payload['vlans'] = vlans.split(':')[1].split(',') if vlans_setting == 'disabled': payload['vlans-disabled'] = True elif vlans_setting == 'enabled': payload['vlans-enabled'] = True except Exception: return 'Error: Unable to Parse vlans option: \n\tvlans={vlans}'.format(vlans=vlans) #determine state if state is not None: if state == 'enabled': payload['enabled'] = True elif state == 'disabled': payload['disabled'] = True #put to REST try: response = bigip_session.put(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/virtual/{name}'.format(name=name), data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def delete_virtual(hostname, username, password, name): ''' A function to connect to a bigip device and delete a specific virtual. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password name The name of the virtual to delete CLI Example:: salt '*' bigip.delete_virtual bigip admin admin my-virtual ''' #build session bigip_session = _build_session(username, password) #delete to REST try: response = bigip_session.delete(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/virtual/{name}'.format(name=name)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) if _load_response(response) == '': return True else: return _load_response(response) def list_monitor(hostname, username, password, monitor_type, name=None, ): ''' A function to connect to a bigip device and list an existing monitor. If no name is provided than all monitors of the specified type will be listed. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password monitor_type The type of monitor(s) to list name The name of the monitor to list CLI Example:: salt '*' bigip.list_monitor bigip admin admin http my-http-monitor ''' #build sessions bigip_session = _build_session(username, password) #get to REST try: if name: response = bigip_session.get(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/monitor/{type}/{name}?expandSubcollections=true'.format(type=monitor_type, name=name)) else: response = bigip_session.get(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/monitor/{type}'.format(type=monitor_type)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def create_monitor(hostname, username, password, monitor_type, name, **kwargs): ''' A function to connect to a bigip device and create a monitor. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password monitor_type The type of monitor to create name The name of the monitor to create kwargs Consult F5 BIGIP user guide for specific options for each monitor type. Typically, tmsh arg names are used. CLI Example:: salt '*' bigip.create_monitor bigip admin admin http my-http-monitor timeout=10 interval=5 ''' #build session bigip_session = _build_session(username, password) #construct the payload payload = {} payload['name'] = name #there's a ton of different monitors and a ton of options for each type of monitor. #this logic relies that the end user knows which options are meant for which monitor types for key, value in six.iteritems(kwargs): if not key.startswith('__'): if key not in ['hostname', 'username', 'password', 'type']: key = key.replace('_', '-') payload[key] = value #post to REST try: response = bigip_session.post(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/monitor/{type}'.format(type=monitor_type), data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def modify_monitor(hostname, username, password, monitor_type, name, **kwargs): ''' A function to connect to a bigip device and modify an existing monitor. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password monitor_type The type of monitor to modify name The name of the monitor to modify kwargs Consult F5 BIGIP user guide for specific options for each monitor type. Typically, tmsh arg names are used. CLI Example:: salt '*' bigip.modify_monitor bigip admin admin http my-http-monitor timout=16 interval=6 ''' #build session bigip_session = _build_session(username, password) #construct the payload payload = {} #there's a ton of different monitors and a ton of options for each type of monitor. #this logic relies that the end user knows which options are meant for which monitor types for key, value in six.iteritems(kwargs): if not key.startswith('__'): if key not in ['hostname', 'username', 'password', 'type', 'name']: key = key.replace('_', '-') payload[key] = value #put to REST try: response = bigip_session.put(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/monitor/{type}/{name}'.format(type=monitor_type, name=name), data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def delete_monitor(hostname, username, password, monitor_type, name): ''' A function to connect to a bigip device and delete an existing monitor. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password monitor_type The type of monitor to delete name The name of the monitor to delete CLI Example:: salt '*' bigip.delete_monitor bigip admin admin http my-http-monitor ''' #build sessions bigip_session = _build_session(username, password) #delete to REST try: response = bigip_session.delete(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/monitor/{type}/{name}'.format(type=monitor_type, name=name)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) if _load_response(response) == '': return True else: return _load_response(response) def list_profile(hostname, username, password, profile_type, name=None, ): ''' A function to connect to a bigip device and list an existing profile. If no name is provided than all profiles of the specified type will be listed. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password profile_type The type of profile(s) to list name The name of the profile to list CLI Example:: salt '*' bigip.list_profile bigip admin admin http my-http-profile ''' #build sessions bigip_session = _build_session(username, password) #get to REST try: if name: response = bigip_session.get(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/profile/{type}/{name}?expandSubcollections=true'.format(type=profile_type, name=name)) else: response = bigip_session.get(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/profile/{type}'.format(type=profile_type)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def create_profile(hostname, username, password, profile_type, name, **kwargs): r''' A function to connect to a bigip device and create a profile. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password profile_type The type of profile to create name The name of the profile to create kwargs ``[ arg=val ] ... [arg=key1:val1,key2:val2] ...`` Consult F5 BIGIP user guide for specific options for each monitor type. Typically, tmsh arg names are used. Creating Complex Args Profiles can get pretty complicated in terms of the amount of possible config options. Use the following shorthand to create complex arguments such as lists, dictionaries, and lists of dictionaries. An option is also provided to pass raw json as well. lists ``[i,i,i]``: ``param='item1,item2,item3'`` Dictionary ``[k:v,k:v,k,v]``: ``param='key-1:val-1,key-2:val2,key-3:va-3'`` List of Dictionaries ``[k:v,k:v|k:v,k:v|k:v,k:v]``: ``param='key-1:val-1,key-2:val-2|key-1:val-1,key-2:val-2|key-1:val-1,key-2:val-2'`` JSON: ``'j{ ... }j'``: ``cert-key-chain='j{ "default": { "cert": "default.crt", "chain": "default.crt", "key": "default.key" } }j'`` Escaping Delimiters: Use ``\,`` or ``\:`` or ``\|`` to escape characters which shouldn't be treated as delimiters i.e. ``ciphers='DEFAULT\:!SSLv3'`` CLI Examples:: salt '*' bigip.create_profile bigip admin admin http my-http-profile defaultsFrom='/Common/http' salt '*' bigip.create_profile bigip admin admin http my-http-profile defaultsFrom='/Common/http' \ enforcement=maxHeaderCount:3200,maxRequests:10 ''' #build session bigip_session = _build_session(username, password) #construct the payload payload = {} payload['name'] = name #there's a ton of different profiles and a ton of options for each type of profile. #this logic relies that the end user knows which options are meant for which profile types for key, value in six.iteritems(kwargs): if not key.startswith('__'): if key not in ['hostname', 'username', 'password', 'profile_type']: key = key.replace('_', '-') try: payload[key] = _set_value(value) except salt.exceptions.CommandExecutionError: return 'Error: Unable to Parse JSON data for parameter: {key}\n{value}'.format(key=key, value=value) #post to REST try: response = bigip_session.post(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/profile/{type}'.format(type=profile_type), data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def modify_profile(hostname, username, password, profile_type, name, **kwargs): r''' A function to connect to a bigip device and create a profile. A function to connect to a bigip device and create a profile. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password profile_type The type of profile to create name The name of the profile to create kwargs ``[ arg=val ] ... [arg=key1:val1,key2:val2] ...`` Consult F5 BIGIP user guide for specific options for each monitor type. Typically, tmsh arg names are used. Creating Complex Args Profiles can get pretty complicated in terms of the amount of possible config options. Use the following shorthand to create complex arguments such as lists, dictionaries, and lists of dictionaries. An option is also provided to pass raw json as well. lists ``[i,i,i]``: ``param='item1,item2,item3'`` Dictionary ``[k:v,k:v,k,v]``: ``param='key-1:val-1,key-2:val2,key-3:va-3'`` List of Dictionaries ``[k:v,k:v|k:v,k:v|k:v,k:v]``: ``param='key-1:val-1,key-2:val-2|key-1:val-1,key-2:val-2|key-1:val-1,key-2:val-2'`` JSON: ``'j{ ... }j'``: ``cert-key-chain='j{ "default": { "cert": "default.crt", "chain": "default.crt", "key": "default.key" } }j'`` Escaping Delimiters: Use ``\,`` or ``\:`` or ``\|`` to escape characters which shouldn't be treated as delimiters i.e. ``ciphers='DEFAULT\:!SSLv3'`` CLI Examples:: salt '*' bigip.modify_profile bigip admin admin http my-http-profile defaultsFrom='/Common/http' salt '*' bigip.modify_profile bigip admin admin http my-http-profile defaultsFrom='/Common/http' \ enforcement=maxHeaderCount:3200,maxRequests:10 salt '*' bigip.modify_profile bigip admin admin client-ssl my-client-ssl-1 retainCertificate=false \ ciphers='DEFAULT\:!SSLv3' cert_key_chain='j{ "default": { "cert": "default.crt", "chain": "default.crt", "key": "default.key" } }j' ''' #build session bigip_session = _build_session(username, password) #construct the payload payload = {} payload['name'] = name #there's a ton of different profiles and a ton of options for each type of profile. #this logic relies that the end user knows which options are meant for which profile types for key, value in six.iteritems(kwargs): if not key.startswith('__'): if key not in ['hostname', 'username', 'password', 'profile_type']: key = key.replace('_', '-') try: payload[key] = _set_value(value) except salt.exceptions.CommandExecutionError: return 'Error: Unable to Parse JSON data for parameter: {key}\n{value}'.format(key=key, value=value) #put to REST try: response = bigip_session.put(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/profile/{type}/{name}'.format(type=profile_type, name=name), data=json.dumps(payload)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) return _load_response(response) def delete_profile(hostname, username, password, profile_type, name): ''' A function to connect to a bigip device and delete an existing profile. hostname The host/address of the bigip device username The iControl REST username password The iControl REST password profile_type The type of profile to delete name The name of the profile to delete CLI Example:: salt '*' bigip.delete_profile bigip admin admin http my-http-profile ''' #build sessions bigip_session = _build_session(username, password) #delete to REST try: response = bigip_session.delete(BIG_IP_URL_BASE.format(host=hostname)+'/ltm/profile/{type}/{name}'.format(type=profile_type, name=name)) except requests.exceptions.ConnectionError as e: return _load_connection_error(hostname, e) if _load_response(response) == '': return True else: return _load_response(response)
apache-2.0
wurstmineberg/alltheitems.wurstmineberg.de
alltheitems/cloud.py
1
67724
import alltheitems.__main__ as ati import bottle import collections import contextlib import datetime import itertools import json import pathlib import random import re import xml.sax.saxutils import alltheitems.item import alltheitems.util import alltheitems.world class FillLevel: def __init__(self, stack_size, total_items, max_slots, *, is_smart_chest=True): self.stack_size = stack_size self.total_items = total_items self.max_slots = max_slots self.is_smart_chest = is_smart_chest def __str__(self): if self.total_items == 0: return '{} is empty.'.format('SmartChest' if self.is_smart_chest else 'Chest') elif self.total_items == self.max_items: return '{} is full.'.format('SmartChest' if self.is_smart_chest else 'Chest') else: stacks, items = self.stacks return '{} is filled {}% ({} {stack}{}{} out of {} {stack}s).'.format('SmartChest' if self.is_smart_chest else 'Chest', int(100 * self.fraction), stacks, '' if stacks == 1 else 's', ' and {} item{}'.format(items, '' if items == 1 else 's') if items > 0 else '', self.max_slots, stack='item' if self.stack_size == 1 else 'stack') @property def fraction(self): return self.total_items / self.max_items def is_empty(self): return self.total_items == 0 def is_full(self): return self.total_items == self.max_items @property def max_items(self): return self.max_slots * self.stack_size @property def stacks(self): return divmod(self.total_items, self.stack_size) CONTAINERS = [ # layer coords of all counted container blocks in a SmartChest (3, -7, 3), (3, -7, 4), (4, -7, 4), (5, -7, 3), (5, -7, 4), (2, -6, 3), (3, -6, 2), (3, -6, 3), (2, -5, 2), (2, -5, 3), (3, -5, 3), (2, -4, 3), (3, -4, 2), (3, -4, 3), (3, -3, 2), (4, -3, 2), (5, -3, 2), (6, -3, 2), (5, -2, 2), (6, -2, 2), (5, 0, 2), (5, 0, 3) ] STONE_VARIANTS = { 0: 'stone', 1: 'granite', 2: 'polished granite', 3: 'diorite', 4: 'polished diorite', 5: 'andesite', 6: 'polished andesite' } HOPPER_FACINGS = { 0: 'down', 1: 'up', #for droppers 2: 'north', 3: 'south', 4: 'west', 5: 'east' } TORCH_FACINGS = { 1: 'to its west', 2: 'to its east', 3: 'to its north', 4: 'to its south', 5: 'below' } HTML_COLORS = { 'cyan': '#0ff', 'cyan2': '#0ff', 'gray': '#777', 'red': '#f00', 'orange': '#f70', 'yellow': '#ff0', 'white': '#fff', 'white2': '#fff', None: 'transparent' } def hopper_chain_connected(start_coords, end_coords, *, world=None, chunk_cache=None, block_at=None): if world is None: world = alltheitems.world.World() if chunk_cache is None: chunk_cache = {} if block_at is None: block_at=world.block_at visited_coords = set() x, y, z = start_coords while (x, y, z) != end_coords: if (x, y, z) in visited_coords: return False, 'hopper chain points into itself at {} {} {}'.format(x, y, z) visited_coords.add((x, y, z)) block = block_at(x, y, z, chunk_cache=chunk_cache) if block['id'] != 'minecraft:hopper': return False, 'block at {} {} {} is not a <a href="/block/minecraft/hopper">hopper</a>'.format(x, y, z, *end_coords) if block['damage'] & 0x7 == 0: y -= 1 # down elif block['damage'] & 0x7 == 2: z -= 1 # north elif block['damage'] & 0x7 == 3: z += 1 # south elif block['damage'] & 0x7 == 4: x -= 1 # west elif block['damage'] & 0x7 == 5: x += 1 # east else: raise ValueError('Unknown hopper facing {} at {}'.format(block['damage'] & 0x7, (x, y, z))) return True, None def smart_chest_schematic(document_root=ati.document_root): layers = {} with (document_root / 'static' / 'smartchest.txt').open() as smart_chest_layers: current_y = None current_layer = None for line in smart_chest_layers: if line == '\n': continue match = re.fullmatch('layer (-?[0-9]+)\n', line) if match: # new layer if current_y is not None: layers[current_y] = current_layer current_y = int(match.group(1)) current_layer = [] else: current_layer.append(line.rstrip('\r\n')) if current_y is not None: layers[current_y] = current_layer return sorted(layers.items()) def chest_iter(): """Returns an iterator yielding tuples (x, corridor, y, floor, z, chest).""" with (ati.assets_root / 'json' / 'cloud.json').open() as cloud_json: cloud_data = json.load(cloud_json) for y, floor in enumerate(cloud_data): for x, corridor in sorted(((int(x), corridor) for x, corridor in floor.items()), key=lambda tup: tup[0]): for z, chest in enumerate(corridor): yield x, corridor, y, floor, z, chest def chest_coords(item, *, include_meta=False): if not isinstance(item, alltheitems.item.Item): item = alltheitems.item.Item(item) for x, corridor, y, _, z, chest in chest_iter(): if item == chest: if include_meta: return (x, y, z), len(corridor), None if isinstance(chest, str) else chest.get('name'), None if isinstance(chest, str) else chest.get('sorter') else: return x, y, z if include_meta: return None, 0, None, None def global_error_checks(*, chunk_cache=None, block_at=alltheitems.world.World().block_at): cache_path = ati.cache_root / 'cloud-globals.json' max_age = datetime.timedelta(hours=1, minutes=random.randrange(0, 60)) # use a random value between 1 and 2 hours for the cache expiration if cache_path.exists() and datetime.datetime.utcfromtimestamp(cache_path.stat().st_mtime) > datetime.datetime.utcnow() - max_age: # cached check results are recent enough with cache_path.open() as cache_f: cache = json.load(cache_f) return cache # cached check results are too old, recheck if chunk_cache is None: chunk_cache = {} # error check: input hopper chain start = 14, 61, 32 # the first hopper after the buffer elevator end = -1, 25, 52 # the half of the uppermost overflow chest into which the hopper chain is pointing is_connected, message = hopper_chain_connected(start, end, chunk_cache=chunk_cache, block_at=block_at) if not is_connected: return 'Input hopper chain at {} is not connected to the unsorted overflow at {}: {}.'.format(start, end, message) if ati.cache_root.exists(): with cache_path.open('w') as cache_f: json.dump(message, cache_f, sort_keys=True, indent=4) def chest_error_checks(x, y, z, base_x, base_y, base_z, item, item_name, exists, stackable, durability, has_smart_chest, has_sorter, has_overflow, filler_item, sorting_hopper, missing_overflow_hoppers, north_half, south_half, corridor_length, pre_sorter, layer_coords, block_at, items_data, chunk_cache, document_root): if stackable and has_sorter: # error check: overflow exists if not has_overflow: if len(missing_overflow_hoppers) == 3: return 'Missing overflow hoppers.' elif len(missing_overflow_hoppers) > 1: return 'Overflow hoppers at x={} do not exist.'.format(missing_overflow_hoppers) elif len(missing_overflow_hoppers) == 1: return 'Overflow hopper at x={} does not exist, is {}.'.format(next(iter(missing_overflow_hoppers)), block_at(next(iter(missing_overflow_hoppers)), base_y - 7, base_z - 1)['id']) else: return 'Missing overflow.' # error check: pre-sorter for lower floors if y > 4: if pre_sorter is None: return 'Preliminary sorter coordinate missing from cloud.json.' pre_sorting_hopper = block_at(pre_sorter, 30, 52, chunk_cache=chunk_cache) if pre_sorting_hopper['id'] != 'minecraft:hopper': return 'Preliminary sorter is missing (should be at {} 30 52).'.format(pre_sorter) if pre_sorting_hopper['damage'] != 3: return 'Preliminary sorting hopper ({} 30 52) should be pointing south, but is facing {}.'.format(pre_sorter, HOPPER_FACINGS[pre_sorting_hopper['damage']]) empty_slots = set(range(5)) for slot in pre_sorting_hopper['tileEntity']['Items']: empty_slots.remove(slot['Slot']) if slot['Slot'] == 0: if not item.matches_slot(slot): return 'Preliminary sorting hopper is sorting the wrong item: {}.'.format(alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text()) else: if not filler_item.matches_slot(slot): return 'Preliminary sorting hopper has wrong filler item in slot {}: {} (should be {}).'.format(slot['Slot'], alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text(), filler_item.link_text()) if slot['Count'] > 1: return 'Preliminary sorting hopper: too much {} in slot {}.'.format(filler_item.link_text(), slot['Slot']) if len(empty_slots) > 0: if len(empty_slots) == 5: return 'Preliminary sorting hopper is empty.' elif len(empty_slots) == 1: return 'Slot {} of the preliminary sorting hopper is empty.'.format(next(iter(empty_slots))) else: return 'Some slots in the preliminary sorting hopper are empty: {}.'.format(alltheitems.util.join(empty_slots)) if has_sorter: # error check: sorting hopper if sorting_hopper['damage'] != 2: return 'Sorting hopper ({} {} {}) should be pointing north, but is facing {}.'.format(base_x - 2 if z % 2 == 0 else base_x + 2, base_y - 3, base_z, HOPPER_FACINGS[sorting_hopper['damage']]) empty_slots = set(range(5)) for slot in sorting_hopper['tileEntity']['Items']: empty_slots.remove(slot['Slot']) if slot['Slot'] == 0 and stackable: if not item.matches_slot(slot) and not filler_item.matches_slot(slot): return 'Sorting hopper is sorting the wrong item: {}.'.format(alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text()) else: if not filler_item.matches_slot(slot): return 'Sorting hopper has wrong filler item in slot {}: {} (should be {}).'.format(slot['Slot'], alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text(), filler_item.link_text()) if slot['Count'] > 1: return 'Sorting hopper: too much {} in slot {}.'.format(filler_item.link_text(), slot['Slot']) if len(empty_slots) > 0: if len(empty_slots) == 5: return 'Sorting hopper is empty.' elif len(empty_slots) == 1: return 'Slot {} of the sorting hopper is empty.'.format(next(iter(empty_slots))) else: return 'Some slots in the sorting hopper are empty: {}.'.format(alltheitems.util.join(empty_slots)) if exists: # error check: wrong items in access chest for slot in itertools.chain(north_half['tileEntity']['Items'], south_half['tileEntity']['Items']): if not item.matches_slot(slot): return 'Access chest contains items of the wrong kind: {}.'.format(alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text()) # error check: wrong name on sign sign = block_at(base_x - 1 if z % 2 == 0 else base_x + 1, base_y + 1, base_z + 1, chunk_cache=chunk_cache) if sign['id'] != 'minecraft:wall_sign': return 'Sign is missing.' text = [] for line in range(1, 5): line_text = json.loads(sign['tileEntity']['Text{}'.format(line)])['text'].translate(dict.fromkeys(range(0xf700, 0xf704), None)) if len(line_text) > 0: text.append(line_text) text = ' '.join(text) if text != item_name.translate({0x2161: 'II'}): return 'Sign has wrong text: should be {!r}, is {!r}.'.format(xml.sax.saxutils.escape(item_name), xml.sax.saxutils.escape(text)) if has_overflow: # error check: overflow hopper chain start = base_x + 5 if z % 2 == 0 else base_x - 5, base_y - 7, base_z - 1 end = -35, 6, 38 # position of the dropper leading into the Smelting Center's item elevator is_connected, message = hopper_chain_connected(start, end, chunk_cache=chunk_cache, block_at=block_at) if not is_connected: return 'Overflow hopper chain at {} is not connected to the Smelting Center item elevator at {}: {}.'.format(start, end, message) if exists and has_smart_chest: # error check: all blocks for layer_y, layer in smart_chest_schematic(document_root=document_root): for layer_x, row in enumerate(layer): for layer_z, block_symbol in enumerate(row): # determine the coordinate of the current block exact_x, exact_y, exact_z = layer_coords(layer_x, layer_y, layer_z) # determine current block block = block_at(exact_x, exact_y, exact_z, chunk_cache=chunk_cache) # check against schematic if block_symbol == ' ': # air if block['id'] != 'minecraft:air': return 'Block at {} {} {} should be air, is {}.'.format(exact_x, exact_y, exact_z, block['id']) elif block_symbol == '!': # sign if block['id'] != 'minecraft:wall_sign': return 'Block at {} {} {} should be a sign, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] != (4 if z % 2 == 0 else 5): return 'Sign at {} {} {} is facing the wrong way.'.format(exact_x, exact_y, exact_z) elif block_symbol == '#': # chest if block['id'] != 'minecraft:chest': return 'Block at {} {} {} should be a chest, is {}.'.format(exact_x, exact_y, exact_z, block['id']) for slot in block['tileEntity']['Items']: if not item.matches_slot(slot): return 'Storage chest at {} {} {} contains items of the wrong kind: {}.'.format(exact_x, exact_y, exact_z, alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text()) elif block_symbol == '<': # hopper facing south if block['id'] != 'minecraft:hopper': return 'Block at {} {} {} should be a hopper, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] & 0x7 != 3: # south return 'Hopper at {} {} {} should be pointing south, is {}.'.format(exact_x, exact_y, exact_z, HOPPER_FACINGS[block['damage']]) storage_hoppers = { (5, -7, 4), (6, -5, 4) } if (layer_x, layer_y, layer_z) in storage_hoppers: for slot in block['tileEntity']['Items']: if not item.matches_slot(slot): return 'Storage hopper at {} {} {} contains items of the wrong kind: {}.'.format(exact_x, exact_y, exact_z, alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text()) elif block_symbol == '>': # hopper facing north if layer_y == -7 and layer_x == 0 and z < 8: # the first few chests get ignored because their overflow points in the opposite direction pass #TODO introduce special checks for them else: if block['id'] != 'minecraft:hopper': return 'Block at {} {} {} should be a hopper, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] & 0x7 != 2: # north return 'Hopper at {} {} {} should be pointing north, is {}.'.format(exact_x, exact_y, exact_z, HOPPER_FACINGS[block['damage']]) storage_hoppers = { (3, -7, 3), (3, -4, 2) } if (layer_x, layer_y, layer_z) in storage_hoppers: for slot in block['tileEntity']['Items']: if not item.matches_slot(slot): return 'Storage hopper at {} {} {} contains items of the wrong kind: {}.'.format(exact_x, exact_y, exact_z, alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text()) elif block_symbol == '?': # any block pass elif block_symbol == 'C': # comparator if block['id'] != 'minecraft:unpowered_comparator': return 'Block at {} {} {} should be a comparator, is {}.'.format(exact_x, exact_y, exact_z, block['id']) known_facings = { (5, -7, 2): 0x2, # south (5, -5, 2): 0x2, # south (7, -3, 4): 0x0, # north (0, -1, 1): 0x0, # north (1, -1, 2): 0x0, # north (2, 0, 2): 0x1 if z % 2 == 0 else 0x3, # east / west (2, 0, 3): 0x2, # south (4, 0, 2): 0x1 if z % 2 == 0 else 0x3, # east / west (4, 0, 3): 0x2 # south } facing = block['damage'] & 0x3 if (layer_x, layer_y, layer_z) in known_facings: if known_facings[layer_x, layer_y, layer_z] != facing: return 'Comparator at {} {} {} is facing the wrong way.'.format(exact_x, exact_y, exact_z) else: return 'Direction check for comparator at {} {} {} (relative coords: {} {} {}) not yet implemented.'.format(exact_x, exact_y, exact_z, layer_x, layer_y, layer_z) known_modes = { (5, -7, 2): False, # compare (5, -5, 2): False, # compare (7, -3, 4): False, # compare (0, -1, 1): False, # compare (1, -1, 2): True, # subtract (2, 0, 2): True, # subtract (2, 0, 3): False, # compare (4, 0, 2): True, #subtract (4, 0, 3): False # compare } mode = (block['damage'] & 0x4) == 0x4 if (layer_x, layer_y, layer_z) in known_modes: if known_modes[layer_x, layer_y, layer_z] != mode: return 'Comparator at {} {} {} is in {} mode, should be in {} mode.'.format(exact_x, exact_y, exact_z, 'subtraction' if mode else 'comparison', 'subtraction' if known_modes[layer_x, layer_y, layer_z] else 'comparison') else: return 'Mode check for comparator at {} {} {} (relative coords: {} {} {}) not yet implemented.'.format(exact_x, exact_y, exact_z, layer_x, layer_y, layer_z) elif block_symbol == 'D': # dropper facing up if block['id'] != 'minecraft:dropper': return 'Block at {} {} {} should be a dropper, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] & 0x7 != 1: # up return 'Dropper at {} {} {} should be facing up, is {}.'.format(exact_x, exact_y, exact_z, HOPPER_FACINGS[block['damage']]) for slot in block['tileEntity']['Items']: if not item.matches_slot(slot): return 'Dropper at {} {} {} contains items of the wrong kind: {}.'.format(exact_x, exact_y, exact_z, alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text()) elif block_symbol == 'F': # furnace if layer_y == -6 and layer_x == 0 and z < 2: # the first few chests get ignored because their overflow points in the opposite direction pass #TODO introduce special checks for them elif layer_y == -1 and layer_x == 7 and layer_z == 1 and (z == corridor_length - 1 or z == corridor_length - 2 and z % 2 == 0): # the floor ends with a quartz slab instead of a furnace here if block['id'] != 'minecraft:stone_slab': return 'Block at {} {} {} should be a quartz slab, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] & 0x7 != 0x7: slab_variant = { 0: 'stone', 1: 'sandstone', 2: 'fake wood', 3: 'cobblestone', 4: 'brick', 5: 'stone brick', 6: 'Nether brick', 7: 'quartz' }[block['damage'] & 0x7] return 'Block at {} {} {} should be a <a href="/block/minecraft/stone_slab/7">quartz slab</a>, is a <a href="/block/minecraft/stone_slab/{}">{} slab</a>.'.format(exact_x, exact_y, exact_z, block['damage'] & 0x7, slab_variant) if block['damage'] & 0x8 != 0x8: return 'Quartz slab at {} {} {} should be a top slab, is a bottom slab.'.format(exact_x, exact_y, exact_z) elif x == 0 and y == 6 and layer_y == -1 and layer_x == 7: # the central corridor on the 6th floor uses stone bricks instead of furnaces for the floor if block['id'] != 'minecraft:stonebrick': return 'Block at {} {} {} should be stone bricks, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] != 0: stonebrick_variant = { 0: 'regular', 1: 'mossy', 2: 'cracked', 3: 'chiseled' }[block['damage']] return 'Block at {} {} {} should be <a href="/block/minecraft/stonebrick/0">regular stone bricks</a>, is <a href="/block/minecraft/stonebrick/{}">{} stone bricks</a>.'.format(exact_x, exact_y, exact_z, block['damage'], stonebrick_variant) else: if block['id'] != 'minecraft:furnace': return 'Block at {} {} {} should be a furnace, is {}.'.format(exact_x, exact_y, exact_z, block['id']) known_signals = { (0, -6, 4): 0, (0, -6, 5): 0, (0, -6, 6): 0, (0, -6, 7): 0, (0, -1, 0): 8, (7, -1, 1): 0, (7, -1, 2): 0, (7, -1, 3): 0, (7, -1, 4): 0, (2, 0, 4): 1, (4, 0, 4): 5 } signal = alltheitems.item.comparator_signal(block, items_data=items_data) if (layer_x, layer_y, layer_z) in known_signals: if known_signals[layer_x, layer_y, layer_z] != signal: return 'Furnace at {} {} {} has a fill level of {}, should be {}.'.format(exact_x, exact_y, exact_z, signal, known_signals[layer_x, layer_y, layer_z]) else: return 'Fill level check for furnace at {} {} {} (relative coords: {} {} {}) not yet implemented.'.format(exact_x, exact_y, exact_z, layer_x, layer_y, layer_z) elif block_symbol == 'G': # glowstone if block['id'] != 'minecraft:glowstone': return 'Block at {} {} {} should be glowstone, is {}.'.format(exact_x, exact_y, exact_z, block['id']) elif block_symbol == 'H': # hopper, any facing if block['id'] != 'minecraft:hopper': return 'Block at {} {} {} should be a hopper, is {}.'.format(exact_x, exact_y, exact_z, block['id']) elif block_symbol == 'N': # overflow hopper chain pointing north if y > 1 and (z == 0 or z == 1): if block['id'] == 'minecraft:hopper': if block['damage'] != 2: # north return 'Overflow hopper at {} {} {} should be pointing north, is {}.'.format(exact_x, exact_y, exact_z, HOPPER_FACINGS[block['damage']]) elif block['id'] == 'minecraft:air': pass # also allow air because some overflow hopper chains don't start on the first floor else: return 'Block at {} {} {} should be a hopper, is {}.'.format(exact_x, exact_y, exact_z, block['id']) else: if block['id'] != 'minecraft:air': return 'Block at {} {} {} should be air, is {}.'.format(exact_x, exact_y, exact_z, block['id']) elif block_symbol == 'P': # upside-down oak stairs if block['id'] != 'minecraft:oak_stairs': return 'Block at {} {} {} should be oak stairs, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] & 0x3 != (0x1 if z % 2 == 0 else 0x0): stairs_facings = { 0: 'west', 1: 'east', 2: 'south', 3: 'north' } return 'Stairs at {} {} {} should be facing {}, is {}.'.format(exact_x, exact_y, exact_z, stairs_facings[0x1 if z % 2 == 0 else 0x0], stairs_facings[block['damage'] & 0x3]) if block['damage'] & 0x4 != 0x4: return 'Stairs at {} {} {} should be upside-down.'.format(exact_x, exact_y, exact_z) elif block_symbol == 'Q': # quartz top slab if block['id'] != 'minecraft:stone_slab': return 'Block at {} {} {} should be a quartz slab, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] & 0x7 != 0x7: slab_variant = { 0: 'stone', 1: 'sandstone', 2: 'fake wood', 3: 'cobblestone', 4: 'brick', 5: 'stone brick', 6: 'Nether brick', 7: 'quartz' }[block['damage'] & 0x7] return 'Block at {} {} {} should be a <a href="/block/minecraft/stone_slab/7">quartz slab</a>, is a <a href="/block/minecraft/stone_slab/{}">{} slab</a>.'.format(exact_x, exact_y, exact_z, block['damage'] & 0x7, slab_variant) if block['damage'] & 0x8 != 0x8: return 'Quartz slab at {} {} {} should be a top slab, is a bottom slab.'.format(exact_x, exact_y, exact_z) elif block_symbol == 'R': # repeater if block['id'] not in ('minecraft:unpowered_repeater', 'minecraft:powered_repeater'): return 'Block at {} {} {} should be a repeater, is {}.'.format(exact_x, exact_y, exact_z, block['id']) known_facings = { (1, -8, 2): 0x0, # north (3, -8, 3): 0x3 if z % 2 == 0 else 0x1, # west / east (6, -6, 2): 0x0, # north (7, -5, 5): 0x2, # south (3, -3, 1): 0x1 if z % 2 == 0 else 0x3 # east / west } facing = block['damage'] & 0x3 if (layer_x, layer_y, layer_z) in known_facings: if known_facings[layer_x, layer_y, layer_z] != facing: return 'Repeater at {} {} {} is facing the wrong way.'.format(exact_x, exact_y, exact_z) else: return 'Direction check for repeater at {} {} {} (relative coords: {} {} {}) not yet implemented.'.format(exact_x, exact_y, exact_z, layer_x, layer_y, layer_z) known_delays = { # in game ticks (1, -8, 2): 4, (3, -8, 3): 2, (6, -6, 2): 2, (7, -5, 5): 2, (3, -3, 1): 2 } delay_ticks = 2 * (block['damage'] >> 2) + 2 if (layer_x, layer_y, layer_z) in known_delays: if known_delays[layer_x, layer_y, layer_z] != delay_ticks: return 'Repeater at {} {} {} has a delay of {} game tick{}, should be {}.'.format(exact_x, exact_y, exact_z, delay_ticks, '' if delay_ticks == 1 else 's', known_delays[layer_x, layer_y, layer_z]) else: return 'Delay check for repeater at {} {} {} (relative coords: {} {} {}) not yet implemented.'.format(exact_x, exact_y, exact_z, layer_x, layer_y, layer_z) elif block_symbol == 'S': # stone top slab if block['id'] != 'minecraft:stone_slab': return 'Block at {} {} {} should be a stone slab, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] & 0x7 != 0x0: slab_variant = { 0: 'stone', 1: 'sandstone', 2: 'fake wood', 3: 'cobblestone', 4: 'brick', 5: 'stone brick', 6: 'Nether brick', 7: 'quartz' }[block['damage'] & 0x7] return 'Block at {} {} {} should be a <a href="/block/minecraft/stone_slab/0">stone slab</a>, is a <a href="/block/minecraft/stone_slab/{}">{} slab</a>.'.format(exact_x, exact_y, exact_z, block['damage'] & 0x7, slab_variant) if block['damage'] & 0x8 != 0x8: return 'Quartz slab at {} {} {} should be a top slab.'.format(exact_x, exact_y, exact_z) elif block_symbol == 'T': # redstone torch attached to the side of a block if block['id'] not in ('minecraft:unlit_redstone_torch', 'minecraft:redstone_torch'): return 'Block at {} {} {} should be a redstone torch, is {}.'.format(exact_x, exact_y, exact_z, block['id']) known_facings = { (3, -8, 1): 1 if z % 2 == 0 else 2, # west / east (2, -7, 1): 3, # north (4, -6, 1): 2 if z % 2 == 0 else 1, # east / west (4, -6, 2): 3, # north (4, -5, 1): 1 if z % 2 == 0 else 2, # west / east (4, -5, 3): 4, # south (7, -5, 3): 3, # north (1, -4, 2): 4, # south (1, -3, 3): 3, # north (1, -1, 4): 4, # south (5, -1, 1): 2 if z % 2 == 0 else 1, # east / west (3, 0, 3): 4 # south } if (layer_x, layer_y, layer_z) in known_facings: if known_facings[layer_x, layer_y, layer_z] != block['damage']: return 'Redstone torch at {} {} {} attached to the block {}, should be attached to the block {}.'.format(exact_x, exact_y, exact_z, TORCH_FACINGS[block['damage']], TORCH_FACINGS[known_facings[layer_x, layer_y, layer_z]]) else: return 'Facing check for redstone torch at {} {} {} (relative coords: {} {} {}) not yet implemented.'.format(exact_x, exact_y, exact_z, layer_x, layer_y, layer_z) elif block_symbol == 'W': # back wall if z == corridor_length - 1 or z == corridor_length - 2 and z % 2 == 0: if block['id'] != 'minecraft:stone': return 'Block at {} {} {} should be stone, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] != 0: stone_variant = { 0: 'stone', 1: 'granite', 2: 'polished granite', 3: 'diorite', 4: 'polished diorite', 5: 'andesite', 6: 'polished andesite' }[block['damage']] return 'Block at {} {} {} should be <a href="/block/minecraft/stone/0">regular stone</a>, is <a href="/block/minecraft/stone/{}">{}</a>.'.format(exact_x, exact_y, exact_z, block['damage'], stone_variant) elif block_symbol == 'X': # overflow hopper chain pointing down if layer_y < -7 and y < 6 and (z == 4 or z == 5) or layer_y > -7 and y > 1 and (z == 0 or z == 1): if block['id'] == 'minecraft:hopper': if block['damage'] != 0: # down return 'Overflow hopper at {} {} {} should be pointing down, is {}.'.format(exact_x, exact_y, exact_z, HOPPER_FACINGS[block['damage']]) elif block['id'] == 'minecraft:air': pass # also allow air because some overflow hopper chains don't start on the first floor else: return 'Block at {} {} {} should be air or a hopper, is {}.'.format(exact_x, exact_y, exact_z, block['id']) else: if block['id'] != 'minecraft:air': return 'Block at {} {} {} should be air, is {}.'.format(exact_x, exact_y, exact_z, block['id']) elif block_symbol == '^': # hopper facing outward if block['id'] != 'minecraft:hopper': return 'Block at {} {} {} should be a hopper, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] & 0x7 != (5 if z % 2 == 0 else 4): # east / west return 'Hopper at {} {} {} should be pointing {}, is {}.'.format(exact_x, exact_y, exact_z, 'east' if z % 2 == 0 else 'west', HOPPER_FACINGS[block['damage']]) storage_hoppers = { (3, -5, 3), (6, -5, 3), (7, -4, 3), (5, -3, 2), (6, -3, 2) } if (layer_x, layer_y, layer_z) in storage_hoppers: for slot in block['tileEntity']['Items']: if not item.matches_slot(slot): return 'Storage hopper at {} {} {} contains items of the wrong kind: {}.'.format(exact_x, exact_y, exact_z, alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text()) elif block_symbol == 'c': # crafting table if layer_y == -7 and (y == 6 or z < 4 or z < 6 and layer_z > 1): if block['id'] != 'minecraft:stone': return 'Block at {} {} {} should be stone, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] != 0: stone_variant = STONE_VARIANTS[block['damage']] return 'Block at {} {} {} should be <a href="/block/minecraft/stone/0">regular stone</a>, is <a href="/block/minecraft/stone/{}">{}</a>.'.format(exact_x, exact_y, exact_z, block['damage'], stone_variant) else: if block['id'] != 'minecraft:crafting_table': return 'Block at {} {} {} should be a crafting table, is {}.'.format(exact_x, exact_y, exact_z, block['id']) elif block_symbol == 'i': # torch attached to the top of a block if block['id'] != 'minecraft:torch': return 'Block at {} {} {} should be a torch, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] != 5: # attached to the block below return 'Torch at {} {} {} should be attached to the block below, is attached to the block {}'.format(exact_x, exact_y, exact_z, TORCH_FACINGS[block['damage']]) elif block_symbol == 'p': # oak planks if layer_y == -8 and (y == 6 or z < 4 or z < 6 and layer_z > 1): if block['id'] != 'minecraft:stone': return 'Block at {} {} {} should be stone, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] != 0: stone_variant = STONE_VARIANTS[block['damage']] return 'Block at {} {} {} should be <a href="/block/minecraft/stone/0">regular stone</a>, is <a href="/block/minecraft/stone/{}">{}</a>.'.format(exact_x, exact_y, exact_z, block['damage'], stone_variant) else: if block['id'] != 'minecraft:planks': return 'Block at {} {} {} should be oak planks, is {}.'.format(exact_x, exact_y, exact_z, block['id']) pass #TODO check material elif block_symbol == 'r': # redstone dust if block['id'] != 'minecraft:redstone_wire': return 'Block at {} {} {} should be redstone, is {}.'.format(exact_x, exact_y, exact_z, block['id']) elif block_symbol == 's': # stone if block['id'] != 'minecraft:stone': if exact_y < 5: if block['id'] != 'minecraft:bedrock': return 'Block at {} {} {} should be stone or bedrock, is {}.'.format(exact_x, exact_y, exact_z, block['id']) else: return 'Block at {} {} {} should be stone, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] != 0: stone_variant = STONE_VARIANTS[block['damage']] return 'Block at {} {} {} should be <a href="/block/minecraft/stone/0">regular stone</a>, is <a href="/block/minecraft/stone/{}">{}</a>.'.format(exact_x, exact_y, exact_z, block['damage'], stone_variant) elif block_symbol == 't': # redstone torch attached to the top of a block if block['id'] not in ('minecraft:unlit_redstone_torch', 'minecraft:redstone_torch'): return 'Block at {} {} {} should be a redstone torch, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] != 5: # attached to the block below return 'Redstone torch at {} {} {} should be attached to the block below, is attached to the block {}'.format(exact_x, exact_y, exact_z, TORCH_FACINGS[block['damage']]) elif block_symbol == 'v': # hopper facing inwards if block['id'] != 'minecraft:hopper': return 'Block at {} {} {} should be a hopper, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] & 0x7 != (4 if z % 2 == 0 else 5): # west / east return 'Hopper at {} {} {} should be pointing {}, is {}.'.format(exact_x, exact_y, exact_z, 'west' if z % 2 == 0 else 'east', HOPPER_FACINGS[block['damage']]) storage_hoppers = { (3, -7, 4), (4, -7, 4), (2, -6, 3) } if (layer_x, layer_y, layer_z) in storage_hoppers: for slot in block['tileEntity']['Items']: if not item.matches_slot(slot): return 'Storage hopper at {} {} {} contains items of the wrong kind: {}.'.format(exact_x, exact_y, exact_z, alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text()) elif block_symbol == 'x': # hopper facing down if block['id'] != 'minecraft:hopper': return 'Block at {} {} {} should be a hopper, is {}.'.format(exact_x, exact_y, exact_z, block['id']) if block['damage'] & 0x7 != 0: # down return 'Hopper at {} {} {} should be pointing down, is {}.'.format(exact_x, exact_y, exact_z, HOPPER_FACINGS[block['damage']]) storage_hoppers = { (5, -1, 2) } if (layer_x, layer_y, layer_z) in storage_hoppers: for slot in block['tileEntity']['Items']: if not item.matches_slot(slot): return 'Storage hopper at {} {} {} contains items of the wrong kind: {}.'.format(exact_x, exact_y, exact_z, alltheitems.item.Item.from_slot(slot, items_data=items_data).link_text()) elif block_symbol == '~': # hopper chain if block['id'] == 'minecraft:hopper': pass #TODO check facing pass #TODO check alignment elif block['id'] == 'minecraft:air': pass #TODO check alignment else: return 'Block at {} {} {} should be a hopper or air, is {}.'.format(exact_x, exact_y, exact_z, block['id']) pass #TODO check hopper chain integrity else: return 'Not yet implemented: block at {} {} {} should be {}.'.format(exact_x, exact_y, exact_z, block_symbol) # error check: items in storage chests but not in access chest access_chest_fill_level = alltheitems.item.comparator_signal(north_half, south_half) bottom_dropper_fill_level = alltheitems.item.comparator_signal(block_at(*layer_coords(5, -7, 3), chunk_cache=chunk_cache)) if access_chest_fill_level < 2 and bottom_dropper_fill_level > 2: return 'Access chest is {}empty but there are items stuck in the storage dropper at {} {} {}.'.format('' if access_chest_fill_level == 0 else 'almost ', *layer_coords(5, -7, 3)) if durability and has_smart_chest: # error check: damaged or enchanted tools in storage chests storage_containers = set(CONTAINERS) - {(5, 0, 2), (5, 0, 3)} for container in storage_containers: for slot in block_at(*layer_coords(*container), chunk_cache=chunk_cache)['tileEntity']['Items']: if slot.get('Damage', 0) > 0: return 'Item in storage container at {} {} {} is damaged.'.format(*layer_coords(*container)) if len(slot.get('tag', {}).get('ench', [])) > 0: return 'Item in storage container at {} {} {} is enchanted.'.format(*layer_coords(*container)) def chest_state(coords, item_stub, corridor_length, item_name=None, pre_sorter=None, *, items_data=None, block_at=alltheitems.world.World().block_at, document_root=ati.document_root, chunk_cache=None, cache=None, allow_cache=True): if items_data is None: with (ati.assets_root / 'json' / 'items.json').open() as items_file: items_data = json.load(items_file) if chunk_cache is None: chunk_cache = {} if isinstance(item_stub, str): item_stub = {'id': item_stub} item = alltheitems.item.Item(item_stub, items_data=items_data) if item_name is None: item_name = item.info()['name'] state = None, 'This SmartChest is in perfect state.', None x, y, z = coords # determine the base coordinate, i.e. the position of the north half of the access chest if z % 2 == 0: # left wall base_x = 15 * x + 2 else: # right wall base_x = 15 * x - 3 base_y = 73 - 10 * y base_z = 28 + 10 * y + 4 * (z // 2) def layer_coords(layer_x, layer_y, layer_z): if z % 2 == 0: # left wall exact_x = base_x + 5 - layer_x else: # right wall exact_x = base_x - 5 + layer_x exact_y = base_y + layer_y exact_z = base_z + 3 - layer_z return exact_x, exact_y, exact_z # does the access chest exist? exists = False north_half = block_at(base_x, base_y, base_z, chunk_cache=chunk_cache) south_half = block_at(base_x, base_y, base_z + 1, chunk_cache=chunk_cache) if north_half['id'] != 'minecraft:chest' and south_half['id'] != 'minecraft:chest': state = 'gray', 'Access chest does not exist.', None elif north_half['id'] != 'minecraft:chest': state = 'gray', 'North half of access chest does not exist.', None elif south_half['id'] != 'minecraft:chest': state = 'gray', 'South half of access chest does not exist.', None else: exists = True # does it have a SmartChest? has_smart_chest = False missing_droppers = set() for dropper_y in range(base_y - 7, base_y): dropper = block_at(base_x, dropper_y, base_z, chunk_cache=chunk_cache) if dropper['id'] != 'minecraft:dropper': missing_droppers.add(dropper_y) if len(missing_droppers) == 7: if state[0] is None: state = 'orange', 'SmartChest droppers do not exist.', None elif len(missing_droppers) > 1: if state[0] is None: state = 'orange', 'SmartChest droppers at y={} do not exist.'.format(', y='.join(str(dropper) for dropper in missing_droppers)), None elif len(missing_droppers) == 1: if state[0] is None: state = 'orange', 'SmartChest dropper at y={} does not exist, is {}.'.format(next(iter(missing_droppers)), block_at(base_x, dropper_y, base_z)['id']), None else: has_smart_chest = True # is it stackable? stackable = item.info().get('stackable', True) if not stackable and state[0] is None: state = 'cyan', "This SmartChest is in perfect state (but the item is not stackable, so it can't be sorted).", None # does it have a durability bar? durability = 'durability' in item.info() # does it have a sorter? has_sorter = False if item == 'minecraft:crafting_table' or stackable and item.max_stack_size < 64: filler_item = alltheitems.item.Item('minecraft:crafting_table', items_data=items_data) else: filler_item = alltheitems.item.Item('minecraft:ender_pearl', items_data=items_data) sorting_hopper = block_at(base_x - 2 if z % 2 == 0 else base_x + 2, base_y - 3, base_z, chunk_cache=chunk_cache) if sorting_hopper['id'] != 'minecraft:hopper': if state[0] is None: state = 'yellow', 'Sorting hopper does not exist, is {}.'.format(sorting_hopper['id']), None else: for slot in sorting_hopper['tileEntity']['Items']: if slot['Slot'] == 0 and stackable and not item.matches_slot(slot) and filler_item.matches_slot(slot): if state[0] is None or state[0] == 'cyan': state = 'yellow', 'Sorting hopper is full of {}, but the sorted item is stackable, so the first slot should contain the item.'.format(filler_item.link_text()), None break else: has_sorter = True # does it have an overflow? has_overflow = False missing_overflow_hoppers = set() for overflow_x in range(base_x + 3 if z % 2 == 0 else base_x - 3, base_x + 6 if z % 2 == 0 else base_x - 6, 1 if z % 2 == 0 else -1): overflow_hopper = block_at(overflow_x, base_y - 7, base_z - 1, chunk_cache=chunk_cache) if overflow_hopper['id'] != 'minecraft:hopper': missing_overflow_hoppers.add(overflow_x) if len(missing_overflow_hoppers) == 0: has_overflow = True # state determined, check for errors if coords == (1, 1, 0): # Ender pearls message = global_error_checks(chunk_cache=chunk_cache, block_at=block_at) if message is not None: return 'red', message, None cache_path = ati.cache_root / 'cloud-chests.json' if cache is None: if cache_path.exists(): with cache_path.open() as cache_f: cache = json.load(cache_f) else: cache = {} max_age = datetime.timedelta(hours=1, minutes=random.randrange(0, 60)) # use a random value between 1 and 2 hours for the cache expiration if allow_cache and str(y) in cache and str(x) in cache[str(y)] and str(z) in cache[str(y)][str(x)] and cache[str(y)][str(x)][str(z)]['errorMessage'] is None and datetime.datetime.strptime(cache[str(y)][str(x)][str(z)]['timestamp'], '%Y-%m-%d %H:%M:%S') > datetime.datetime.utcnow() - max_age: message = cache[str(y)][str(x)][str(z)]['errorMessage'] pass # cached check results are recent enough else: # cached check results are too old, recheck message = chest_error_checks(x, y, z, base_x, base_y, base_z, item, item_name, exists, stackable, durability, has_smart_chest, has_sorter, has_overflow, filler_item, sorting_hopper, missing_overflow_hoppers, north_half, south_half, corridor_length, pre_sorter, layer_coords, block_at, items_data, chunk_cache, document_root) if ati.cache_root.exists(): if str(y) not in cache: cache[str(y)] = {} if str(x) not in cache[str(y)]: cache[str(y)][str(x)] = {} cache[str(y)][str(x)][str(z)] = { 'errorMessage': message, 'timestamp': datetime.datetime.utcnow().strftime('%Y-%m-%d %H:%M:%S') } with cache_path.open('w') as cache_f: json.dump(cache, cache_f, sort_keys=True, indent=4) if message is not None: return 'red', message, None # no errors, determine fill level if state[0] in (None, 'cyan', 'orange', 'yellow'): try: containers = CONTAINERS if state[0] in (None, 'cyan') else [ # layer coords of the access chest (5, 0, 2), (5, 0, 3) ] total_items = sum(max(0, sum(slot['Count'] for slot in block_at(*layer_coords(*container), chunk_cache=chunk_cache)['tileEntity']['Items'] if slot.get('Damage', 0) == 0 or not durability) - (4 * item.max_stack_size if container == (5, -7, 3) else 0)) for container in containers) # Don't count the 4 stacks of items that are stuck in the bottom dropper. Don't count damaged tools. max_slots = sum(alltheitems.item.NUM_SLOTS[block_at(*layer_coords(*container), chunk_cache=chunk_cache)['id']] for container in containers) - (0 if state[0] == 'orange' else 4) return state[0], state[1], FillLevel(item.max_stack_size, total_items, max_slots, is_smart_chest=state[0] in (None, 'cyan')) except: # something went wrong determining fill level, re-check errors message = chest_error_checks(x, y, z, base_x, base_y, base_z, item, item_name, exists, stackable, durability, has_smart_chest, has_sorter, has_overflow, filler_item, sorting_hopper, missing_overflow_hoppers, north_half, south_half, corridor_length, g, layer_coords, block_at, items_data, chunk_cache, document_root) if ati.cache_root.exists(): if str(y) not in cache: cache[str(y)] = {} if str(x) not in cache[str(y)]: cache[str(y)][str(x)] = {} cache[str(y)][str(x)][str(z)] = { 'errorMessage': message, 'timestamp': datetime.datetime.utcnow().strftime('%Y-%m-%d %H:%M:%S') } with cache_path.open('w') as cache_f: json.dump(cache, cache_f, sort_keys=True, indent=4) if message is None: raise else: return 'red', message, None return state def cell_from_chest(coords, item_stub, corridor_length, item_name=None, pre_sorter=None, *, chunk_cache=None, items_data=None, colors_to_explain=None, cache=None, allow_cache=True): color, state_message, fill_level = chest_state(coords, item_stub, corridor_length, item_name, pre_sorter, items_data=items_data, chunk_cache=chunk_cache, cache=cache, allow_cache=allow_cache) if colors_to_explain is not None: colors_to_explain.add(color) if fill_level is None or fill_level.is_full(): return '<td style="background-color: {};">{}</td>'.format(HTML_COLORS[color], alltheitems.item.Item(item_stub, items_data=items_data).image()) else: return '<td style="background-color: {};">{}<div class="durability"><div style="background-color: #f0f; width: {}px;"></div></div></td>'.format(HTML_COLORS[color], alltheitems.item.Item(item_stub, items_data=items_data).image(), 0 if fill_level.is_empty() else 2 + int(fill_level.fraction * 13) * 2) def index(allow_cache=True): yield ati.header(title='Cloud') def body(): yield '<p>The <a href="//wiki.{host}/Cloud">Cloud</a> is the public item storage on <a href="//{host}/">Wurstmineberg</a>, consisting of 6 underground floors with <a href="//wiki.{host}/SmartChest">SmartChests</a> in them.</p>'.format(host=ati.host) yield """<style type="text/css"> .item-table td { box-sizing: content-box; height: 32px; width: 32px; position: relative; } .item-table .left-sep { border-left: 1px solid gray; } .durability { z-index: 1; } </style>""" chunk_cache = {} with (ati.assets_root / 'json' / 'items.json').open() as items_file: items_data = json.load(items_file) cache_path = ati.cache_root / 'cloud-chests.json' if cache_path.exists(): try: with cache_path.open() as cache_f: cache = json.load(cache_f) except ValueError: # cache JSON is corrupted, probably because of a full disk, try without cache cache_path.unlink() cache = None else: cache = None colors_to_explain = set() floors = {} for x, corridor, y, floor, z, chest in chest_iter(): if y not in floors: floors[y] = floor for y, floor in sorted(floors.items(), key=lambda tup: tup[0]): def cell(coords, item_stub, corridor): if isinstance(item_stub, str): item_stub = {'id': item_stub} item_name = None pre_sorter = None else: item_stub = item_stub.copy() if 'name' in item_stub: item_name = item_stub['name'] del item_stub['name'] else: item_name = None if 'sorter' in item_stub: pre_sorter = item_stub['sorter'] del item_stub['sorter'] else: pre_sorter = None return cell_from_chest(coords, item_stub, len(corridor), item_name, pre_sorter, chunk_cache=chunk_cache, colors_to_explain=colors_to_explain, items_data=items_data, cache=cache, allow_cache=allow_cache) yield bottle.template(""" %import itertools <h2 id="floor{{y}}">{{y}}{{ordinal(y)}} floor (y={{73 - 10 * y}})</h2> <table class="item-table" style="margin-left: auto; margin-right: auto;"> %for x in range(-3, 4): %if x > -3: <colgroup class="left-sep"> <col /> <col /> </colgroup> %else: <colgroup> <col /> <col /> </colgroup> %end %end <tbody> %for z_left, z_right in zip(itertools.count(step=2), itertools.count(start=1, step=2)): %found = False <tr> %for x in range(-3, 4): %if str(x) not in floor: <td></td> <td></td> %continue %end %corridor = floor[str(x)] %if len(corridor) > z_right: {{!cell((x, y, z_right), corridor[z_right], corridor)}} %else: <td></td> %end %if len(corridor) > z_left: {{!cell((x, y, z_left), corridor[z_left], corridor)}} %found = True %else: <td></td> %end %end </tr> %if not found: %break %end %end </tbody> </table> """, ordinal=alltheitems.util.ordinal, cell=cell, floor=floor, y=y) color_explanations = collections.OrderedDict([ ('red', '<p>A red background means that there is something wrong with the chest. See the item info page for details.</p>'), ('gray', "<p>A gray background means that the chest hasn't been built yet or is still located somewhere else.</p>"), ('orange', "<p>An orange background means that the chest doesn't have a SmartChest yet. It can only store 54 stacks.</p>"), ('yellow', "<p>A yellow background means that the chest doesn't have a sorter yet.</p>"), ('cyan', '<p>A cyan background means that the chest has no sorter because it stores an unstackable item. These items should not be automatically <a href="//wiki.wurstmineberg.de/Soup#Cloud">sent</a> to the Cloud.</p>'), (None, '<p>A white background means that everything is okay: the chest has a SmartChest, a sorter, and overflow protection.</p>') ]) for chest_color in sorted(colors_to_explain, key=list(color_explanations.keys()).index): if chest_color is not None or len(colors_to_explain) > 1: yield color_explanations[chest_color] yield from ati.html_exceptions(body()) yield ati.footer(linkify_headers=True) def todo(): yield ati.header(title='Cloud by priority') def body(): yield """<style type="text/css"> .todo-table td { text-align: left; vertical-align: middle !important; } .todo-table .coord { width: 3em; text-align: right; } .todo-table .item-image { box-sizing: content-box; width: 32px; } .todo-table .item-name { width: 24em; } </style>""" headers = collections.OrderedDict([ ('red', 'Build errors'), ('gray', 'Missing chests'), ('orange', 'Missing SmartChests'), ('yellow', 'Missing sorters'), ('cyan', 'Empty SmartChests (unstackable)'), ('white', 'Empty SmartChests (stackable)'), ('cyan2', 'Missing items (unstackable)'), ('white2', 'Missing items (stackable)') ]) header_indexes = {color: i for i, color in enumerate(headers.keys())} def priority(pair): coords, state = pair x, y, z = coords color, _, fill_level, _ = state return header_indexes[color], None if fill_level is None else fill_level.fraction * (-1 if color == 'orange' else 1), y * (-1 if color == 'orange' else 1), x if y % 2 == 0 else -x, z chunk_cache = {} with (ati.assets_root / 'json' / 'items.json').open() as items_file: items_data = json.load(items_file) cache_path = ati.cache_root / 'cloud-chests.json' if cache_path.exists(): try: with cache_path.open() as cache_f: cache = json.load(cache_f) except ValueError: # cache JSON is corrupted, probably because of a full disk, try without cache cache_path.unlink() cache = None else: cache = None states = {} current_color = None for x, corridor, y, _, z, item_stub in chest_iter(): if isinstance(item_stub, str): item_stub = {'id': item_stub} item_name = None pre_sorter = None else: item_stub = item_stub.copy() if 'name' in item_stub: item_name = item_stub['name'] del item_stub['name'] else: item_name = None if 'sorter' in item_stub: pre_sorter = item_stub['sorter'] del item_stub['sorter'] else: pre_sorter = None color, state_message, fill_level = chest_state((x, y, z), item_stub, len(corridor), item_name, pre_sorter, items_data=items_data, chunk_cache=chunk_cache, cache=cache) if color is None: color = 'white' if color in ('cyan', 'white') and not fill_level.is_empty(): color += '2' if fill_level is None or not fill_level.is_full() or color not in ('cyan', 'white', 'cyan2', 'white2'): states[x, y, z] = color, state_message, fill_level, alltheitems.item.Item(item_stub, items_data=items_data) for coords, state in sorted(states.items(), key=priority): x, y, z = coords color, state_message, fill_level, item = state if color != current_color: if current_color is not None: yield '</tbody></table>' yield bottle.template('<h2 id="{{color}}">{{header}}</h2>', color=color, header=headers[color]) yield '<table class="todo-table table table-responsive"><thead><tr><th class="coord">X</th><th class="coord">Y</th><th class="coord">Z</th><th class="item-image">&nbsp;</th><th class="item-name">Item</th><th>{}</th></tr></thead><tbody>'.format('Fill Level' if color in ('cyan', 'white', 'cyan2', 'white2') else 'Info') current_color = color yield bottle.template(""" <tr> <td class="coord">{{x}}</td> <td class="coord">{{y}}</td> <td class="coord">{{z}}</td> <td class="item-image">{{!item.image()}}</td> <td class="item-name">{{!item.link_text()}}</td> <td style="background-color: {{color}}">{{!fill_level if color in ('#0ff', '#fff') else state_message}}</td> </tr> """, x=x, y=y, z=z, item=item, color=HTML_COLORS[color], fill_level=fill_level, state_message=state_message) yield '</tbody></table>' yield from ati.html_exceptions(body()) yield ati.footer(linkify_headers=True)
mit
magicrub/MissionPlanner
Lib/site-packages/numpy/core/tests/test_npy_arraytypes.py
54
5864
import sys import warnings import numpy as np from numpy.testing import * warnings.filterwarnings('ignore', 'Casting complex values to real discards the imaginary part') types = [np.bool_, np.byte, np.ubyte, np.short, np.ushort, np.intc, np.uintc, np.int_, np.uint, np.longlong, np.ulonglong, np.single, np.double, np.longdouble, np.csingle, np.cdouble, np.clongdouble] alltypes = list( types ) alltypes.append( np.datetime64 ) alltypes.append( np.timedelta64 ) class TestArrayTypes(TestCase): def test_argmax( self ): x = np.array( [False, False, True, False], dtype=np.bool ) assert x.argmax() == 2, "Broken array.argmax on np.bool" a = np.array( [u'aaa', u'aa', u'bbb'] ) # u'aaa' > u'aa' and u'bbb' > u'aaa' Hence, argmax == 2. assert a.argmax() == 2, "Broken array.argmax on unicode data." a = np.array( [ 'aaa', 'aa', 'bbb'] ) # 'aaa' > 'aa' and 'bbb' > 'aaa' Hence, argmax == 2. assert a.argmax() == 2, "Broken array.argmax on string data." def test_argmax_numeric( self ): # Skip the np.bool_ type as it lacks a fill function, hence can't use # arange(). for k,t in enumerate( alltypes[1:] ): a = np.arange( 5, dtype=t ) assert a.argmax() == 4, "Broken array.argmax on type: " + t def test_nonzero_numeric_types( self ): for k,t in enumerate(alltypes): a = np.array( [ t(1) ] ) assert a, "Broken array.nonzero on type: " + t def test_nonzero_string_types( self ): a = np.array( [ 'aaa' ] ) assert a, "Broken array.nonzero on string elements." a = np.array( [ u'aaa' ] ) assert a, "Broken array.nonzero on Unicode elements." def test_compare( self ): # Light bulb! argmax doesn't call compare() for numeric/logical # types. It only does that for string types. Duh. pass def test_copyswap( self ): # Skip np.bool_. for k,t in enumerate( types[1:] ): x = np.arange( 10, dtype=t ) # This should exeercise <typoe>_copyswap x[::2].fill( t(2) ) assert_equal( x, [2,1,2,3,2,5,2,7,2,9] ) def test_copyswap_misc( self ): x = np.array( [ u'a', u'b', u'c' ] ) x[::2].fill( u'd' ) assert_equal( x, [u'd', u'b', u'd'] ) def test_copyswapn( self ): # bool lacks arange support. for k,t in enumerate( alltypes[1:] ): x = np.arange( 10, dtype=t ) y = x.byteswap() z = y.byteswap() assert_equal( z, x ) def test_copyswapn_misc( self ): x = np.array( [ u'a', u'b', u'c' ] ) y = x.byteswap() z = y.byteswap() assert_equal( z, x ) def test_compare( self ): for k,t in enumerate( alltypes[1:] ): try: a = np.arange( 10, dtype=t ) keys = a[::2] b = a.searchsorted( keys ) c = a.copy() np.insert( c, b, b.astype( t ) ) c.sort() assert_equal( c, a ) except TypeError, e: print "Trouble with type %d:" % k, e def test_compare_bool( self ): # bool can't handle numpy.arange(), so has to be coded separately. a = np.array( [False, True], dtype=np.bool_ ) keys = a b = a.searchsorted( keys ) c = a.copy() np.insert( c, b, keys ) c.sort() assert_equal( c, a ) def test_dot( self ): # Do something to test dot on bool... for k,t in enumerate( alltypes[1:] ): a = np.arange( 3, dtype=t ) + 1 assert a.dot(a) == t(14), \ "Problem with dot product with array of type %s" % k def test_clip( self ): for k,t in enumerate( alltypes[1:] ): a = np.arange( 5, dtype=t ) b = a.clip( 2, 3 ) x = np.array( [2,2,2,3,3], dtype=t ) assert_equal( b, x ) def test_clip_bool( self ): a = np.array( [False, True], np.bool ) assert_equal( a.clip(False,False), [False, False] ) def test_array_casting( self ): for k,t in enumerate( alltypes ): a = np.array( [ t(1) ] ) for k2, t2 in enumerate( alltypes ): b = a.astype( t2 ) if k2 < len(types): assert b[0] == 1, \ "Busted array type casting: k=%d k2=%d" % (k,k2) else: # Casting to datetime64 yields a 1/1/1970+... result, # which isn't so hot for checking against "1". So, in # these cases, just cast back to the starting time, and # make sure we got back what we started with. c = b.astype( t ) assert_equal( c, a ) def test_take( self ): # Test all types, but skipp np.bool_ for now, as it lacks a fill # function. Grrr. for k,t in enumerate( alltypes[1:] ): a = np.arange( 10, dtype=t ) idx = np.arange(5) * 2 c = np.take( a, idx ) assert_equal( c, a[::2] ) def test_putmask( self ): for k,t in enumerate( alltypes[1:] ): a = np.arange( 5, dtype=t ) mask = np.zeros( 5, dtype=np.bool ) mask[::2] = True np.putmask( a, mask, t(8) ) x = np.array( [8,1,8,3,8], dtype=t ) assert_equal( a, x ) def test_fillwithscalar( self ): a = np.empty( 2, dtype=np.datetime64 ) a.fill( np.datetime64( 3 ) ) x = np.zeros( 2, dtype=np.datetime64 ) + 3 assert_equal( a, x ) if __name__ == "__main__": run_module_suite()
gpl-3.0
leiferikb/bitpop
build/third_party/requests_1_2_3/requests/packages/urllib3/request.py
154
5874
# urllib3/request.py # Copyright 2008-2013 Andrey Petrov and contributors (see CONTRIBUTORS.txt) # # This module is part of urllib3 and is released under # the MIT License: http://www.opensource.org/licenses/mit-license.php try: from urllib.parse import urlencode except ImportError: from urllib import urlencode from .filepost import encode_multipart_formdata __all__ = ['RequestMethods'] class RequestMethods(object): """ Convenience mixin for classes who implement a :meth:`urlopen` method, such as :class:`~urllib3.connectionpool.HTTPConnectionPool` and :class:`~urllib3.poolmanager.PoolManager`. Provides behavior for making common types of HTTP request methods and decides which type of request field encoding to use. Specifically, :meth:`.request_encode_url` is for sending requests whose fields are encoded in the URL (such as GET, HEAD, DELETE). :meth:`.request_encode_body` is for sending requests whose fields are encoded in the *body* of the request using multipart or www-form-urlencoded (such as for POST, PUT, PATCH). :meth:`.request` is for making any kind of request, it will look up the appropriate encoding format and use one of the above two methods to make the request. Initializer parameters: :param headers: Headers to include with all requests, unless other headers are given explicitly. """ _encode_url_methods = set(['DELETE', 'GET', 'HEAD', 'OPTIONS']) _encode_body_methods = set(['PATCH', 'POST', 'PUT', 'TRACE']) def __init__(self, headers=None): self.headers = headers or {} def urlopen(self, method, url, body=None, headers=None, encode_multipart=True, multipart_boundary=None, **kw): # Abstract raise NotImplemented("Classes extending RequestMethods must implement " "their own ``urlopen`` method.") def request(self, method, url, fields=None, headers=None, **urlopen_kw): """ Make a request using :meth:`urlopen` with the appropriate encoding of ``fields`` based on the ``method`` used. This is a convenience method that requires the least amount of manual effort. It can be used in most situations, while still having the option to drop down to more specific methods when necessary, such as :meth:`request_encode_url`, :meth:`request_encode_body`, or even the lowest level :meth:`urlopen`. """ method = method.upper() if method in self._encode_url_methods: return self.request_encode_url(method, url, fields=fields, headers=headers, **urlopen_kw) else: return self.request_encode_body(method, url, fields=fields, headers=headers, **urlopen_kw) def request_encode_url(self, method, url, fields=None, **urlopen_kw): """ Make a request using :meth:`urlopen` with the ``fields`` encoded in the url. This is useful for request methods like GET, HEAD, DELETE, etc. """ if fields: url += '?' + urlencode(fields) return self.urlopen(method, url, **urlopen_kw) def request_encode_body(self, method, url, fields=None, headers=None, encode_multipart=True, multipart_boundary=None, **urlopen_kw): """ Make a request using :meth:`urlopen` with the ``fields`` encoded in the body. This is useful for request methods like POST, PUT, PATCH, etc. When ``encode_multipart=True`` (default), then :meth:`urllib3.filepost.encode_multipart_formdata` is used to encode the payload with the appropriate content type. Otherwise :meth:`urllib.urlencode` is used with the 'application/x-www-form-urlencoded' content type. Multipart encoding must be used when posting files, and it's reasonably safe to use it in other times too. However, it may break request signing, such as with OAuth. Supports an optional ``fields`` parameter of key/value strings AND key/filetuple. A filetuple is a (filename, data, MIME type) tuple where the MIME type is optional. For example: :: fields = { 'foo': 'bar', 'fakefile': ('foofile.txt', 'contents of foofile'), 'realfile': ('barfile.txt', open('realfile').read()), 'typedfile': ('bazfile.bin', open('bazfile').read(), 'image/jpeg'), 'nonamefile': 'contents of nonamefile field', } When uploading a file, providing a filename (the first parameter of the tuple) is optional but recommended to best mimick behavior of browsers. Note that if ``headers`` are supplied, the 'Content-Type' header will be overwritten because it depends on the dynamic random boundary string which is used to compose the body of the request. The random boundary string can be explicitly set with the ``multipart_boundary`` parameter. """ if encode_multipart: body, content_type = encode_multipart_formdata(fields or {}, boundary=multipart_boundary) else: body, content_type = (urlencode(fields or {}), 'application/x-www-form-urlencoded') if headers is None: headers = self.headers headers_ = {'Content-Type': content_type} headers_.update(headers) return self.urlopen(method, url, body=body, headers=headers_, **urlopen_kw)
gpl-3.0
apache/airflow
tests/models/test_xcom_arg.py
9
5985
# Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. from datetime import datetime, timedelta import pytest from airflow import DAG from airflow.models.xcom_arg import XComArg from airflow.operators.bash import BashOperator from airflow.operators.python import PythonOperator from tests.test_utils.config import conf_vars DEFAULT_ARGS = { "owner": "test", "depends_on_past": True, "start_date": datetime.today(), "retries": 1, "retry_delay": timedelta(minutes=1), } VALUE = 42 def assert_is_value(num: int): if num != VALUE: raise Exception("The test has failed") def build_python_op(): def f(task_id): return f"OP:{task_id}" with DAG(dag_id="test_xcom_dag", default_args=DEFAULT_ARGS): operator = PythonOperator( python_callable=f, task_id="test_xcom_op", do_xcom_push=True, ) return operator class TestXComArgBuild: def test_xcom_ctor(self): python_op = build_python_op() actual = XComArg(python_op, "test_key") assert actual assert actual.operator == python_op assert actual.key == "test_key" # Asserting the overridden __eq__ method assert actual == XComArg(python_op, "test_key") expected_str = ( "{{ task_instance.xcom_pull(task_ids='test_xcom_op', " "dag_id='test_xcom_dag', key='test_key') }}" ) assert str(actual) == expected_str assert ( f"echo {actual}" == "echo {{ task_instance.xcom_pull(task_ids='test_xcom_op', " "dag_id='test_xcom_dag', key='test_key') }}" ) def test_xcom_key_is_empty_str(self): python_op = build_python_op() actual = XComArg(python_op, key="") assert actual.key == "" assert ( str(actual) == "{{ task_instance.xcom_pull(task_ids='test_xcom_op', " "dag_id='test_xcom_dag', key='') }}" ) def test_set_downstream(self): with DAG("test_set_downstream", default_args=DEFAULT_ARGS): op_a = BashOperator(task_id="a", bash_command="echo a") op_b = BashOperator(task_id="b", bash_command="echo b") bash_op1 = BashOperator(task_id="c", bash_command="echo c") bash_op2 = BashOperator(task_id="d", bash_command="echo c") xcom_args_a = XComArg(op_a) xcom_args_b = XComArg(op_b) bash_op1 >> xcom_args_a >> xcom_args_b >> bash_op2 assert op_a in bash_op1.downstream_list assert op_b in op_a.downstream_list assert bash_op2 in op_b.downstream_list def test_set_upstream(self): with DAG("test_set_upstream", default_args=DEFAULT_ARGS): op_a = BashOperator(task_id="a", bash_command="echo a") op_b = BashOperator(task_id="b", bash_command="echo b") bash_op1 = BashOperator(task_id="c", bash_command="echo c") bash_op2 = BashOperator(task_id="d", bash_command="echo c") xcom_args_a = XComArg(op_a) xcom_args_b = XComArg(op_b) bash_op1 << xcom_args_a << xcom_args_b << bash_op2 assert op_a in bash_op1.upstream_list assert op_b in op_a.upstream_list assert bash_op2 in op_b.upstream_list def test_xcom_arg_property_of_base_operator(self): with DAG("test_xcom_arg_property_of_base_operator", default_args=DEFAULT_ARGS): op_a = BashOperator(task_id="a", bash_command="echo a") assert op_a.output == XComArg(op_a) def test_xcom_key_getitem(self): python_op = build_python_op() actual = XComArg(python_op, key="another_key") assert actual.key == "another_key" actual_new_key = actual["another_key_2"] assert actual_new_key.key == "another_key_2" @pytest.mark.system("core") class TestXComArgRuntime: @conf_vars({("core", "executor"): "DebugExecutor"}) def test_xcom_pass_to_op(self): with DAG(dag_id="test_xcom_pass_to_op", default_args=DEFAULT_ARGS) as dag: operator = PythonOperator( python_callable=lambda: VALUE, task_id="return_value_1", do_xcom_push=True, ) xarg = XComArg(operator) operator2 = PythonOperator( python_callable=assert_is_value, op_args=[xarg], task_id="assert_is_value_1", ) operator >> operator2 dag.run() @conf_vars({("core", "executor"): "DebugExecutor"}) def test_xcom_push_and_pass(self): def push_xcom_value(key, value, **context): ti = context["task_instance"] ti.xcom_push(key, value) with DAG(dag_id="test_xcom_push_and_pass", default_args=DEFAULT_ARGS) as dag: op1 = PythonOperator( python_callable=push_xcom_value, task_id="push_xcom_value", op_args=["my_key", VALUE], ) xarg = XComArg(op1, key="my_key") op2 = PythonOperator( python_callable=assert_is_value, task_id="assert_is_value_1", op_args=[xarg], ) op1 >> op2 dag.run()
apache-2.0
srickardti/openthread
tools/harness-automation/cases_R140/leader_5_6_4.py
18
1877
#!/usr/bin/env python # # Copyright (c) 2016, The OpenThread Authors. # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are met: # 1. Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # 2. Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution. # 3. Neither the name of the copyright holder nor the # names of its contributors may be used to endorse or promote products # derived from this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" # AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE # IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE # ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE # LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR # CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF # SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS # INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN # CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) # ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE # POSSIBILITY OF SUCH DAMAGE. # import unittest from autothreadharness.harness_case import HarnessCase class Leader_5_6_4(HarnessCase): role = HarnessCase.ROLE_LEADER case = '5 6 4' golden_devices_required = 3 def on_dialog(self, dialog, title): pass if __name__ == '__main__': unittest.main()
bsd-3-clause
amirgeva/coide
mainwindow.py
1
54237
from PyQt4 import QtCore from PyQt4 import QtGui import os import re import stat import qutepart from workspace import WorkSpace import output from consts import FileRole from gdbwrapper import GDBWrapper from watchestree import WatchesTree from breakpoints import BreakpointsDB, BreakpointDialog from properties import Properties from functools import partial from globals import is_src_ext import utils import genmake import uis import plugins import dwarf class MainWindow(QtGui.QMainWindow): """ Main IDE Window Contains the main code view, along with docking panes for: source files, watches, call stack, and output """ LIBRARY_SCAN = "Scanning Libraries" def __init__(self,rootDir,parent=None): """ Initialize. rootDir indicates where data files are located """ super(MainWindow,self).__init__(parent) s=QtCore.QSettings() self.recent_ws=[d for d in s.value('recent_ws','').toString().split(':') if d] self.symbolScan=s.value('symbol_scan',True).toBool() self.setMinimumSize(QtCore.QSize(1024,768)) self.currentLine=0 self.currentFile='' self.rootDir=rootDir utils.setIconsDir(os.path.join(rootDir,"icons")) self.debugger=None self.breakpoints=BreakpointsDB() self.findDetails=None self.scm_mods=[] self.setWindowIcon(utils.loadIcon('coide')) self.setWindowTitle("Coide") self.generateQueue=set() self.editors={} self.file_times={} self.central=QtGui.QTabWidget() self.setCentralWidget(self.central) self.central.setTabsClosable(True) self.central.tabCloseRequested.connect(self.closeTab) self.central.currentChanged.connect(self.tabChanged) self.tabOrder=[] self.plugins=plugins.PluginsManager() self.setupMenu() self.setupContextMenuItems() self.setupToolbar(rootDir) self.showWorkspacePane() self.showOutputPane() self.showWatchesPane() self.showLocalsPane() self.showCallStackPane() self.buildProcess=None self.timerCall=None self.config=s.value("config").toString() if self.config=='': self.config="Debug" self.configCombo.setCurrentIndex(0 if self.config=='Debug' else 1) self.workspaceTree.setConfig(self.config) self.setAllFonts() self.loadWindowSettings() # Debugger timer that is supposed to periodically check # if the program has stopped at a breakpoint self.timer=QtCore.QTimer(self) self.timer.timeout.connect(self.update) self.runningWidget=None self.asyncPollTimer=QtCore.QTimer(self) self.asyncPollTimer.timeout.connect(self.pollAsync) self.generateTimer=QtCore.QTimer() self.generateTimer.timeout.connect(self.timer1000) self.generateTimer.start(1000) self.lowFreqTimer=QtCore.QTimer() self.lowFreqTimer.timeout.connect(self.timer5000) self.lowFreqTimer.start(5000) #self.showStatus("Generating All Makefiles") #self.timerCall=self.generateAllInThread self.timerCall=None self.paneWatches.hide() self.paneLocals.hide() self.paneStack.hide() #self.sc=QtGui.QShortcut("Ctrl+F8",self) #self.sc.activated.connect(self.prtsc) def closeEvent(self, event): """ Called before the application window closes Informs sub-windows to prepare and saves window settings to allow future sessions to look the same """ self.workspaceTree.onClose() self.workspaceTree.saveTabs(self.central) while self.central.count()>0: if not self.closeFile(): event.ignore() return self.timer.stop() self.generateTimer.stop() if self.debugger: self.debugger.closingApp() settings = QtCore.QSettings() settings.setValue("geometry", self.saveGeometry()) settings.setValue("windowState", self.saveState()) settings.sync() self.removeTempScripts() super(MainWindow,self).closeEvent(event) def saveDebugWindowState(self): """ Save the state of the tool docks, like watches and call stack """ settings = QtCore.QSettings() settings.setValue("debugWindowState", self.saveState()) settings.sync() def loadDebugWindowState(self): """ Restore previous debug windows layout """ settings = QtCore.QSettings() self.restoreState(settings.value("debugWindowState").toByteArray()) def loadWindowSettings(self): """ Restore the window size settings from the previous session """ settings = QtCore.QSettings() self.restoreGeometry(settings.value("geometry").toByteArray()) self.restoreState(settings.value("windowState").toByteArray()) self.loadTabs() def loadTabs(self): self.closeAllTabs() ws=self.workspaceTree.settings() opentabs=ws.value('opentabs','').toString() opentabs=opentabs.split(',') for path in opentabs: self.openSourceFile(path) curtab=ws.value('curtab','').toString() if curtab: self.setActiveSourceFile(curtab) def setupMenu(self): """ Creates the application main menu The action handlers are also mapped from the toolbar icons """ bar=self.menuBar() m=bar.addMenu('&File') m.addAction(QtGui.QAction('&Initialize Workspace',self,triggered=self.initWorkspace)) m.addAction(QtGui.QAction('Open &Workspace',self,triggered=self.openWorkspace)) self.recents_menu=m.addMenu('&Recent Workspaces') m.addAction(QtGui.QAction('&Save',self,shortcut='Ctrl+S',triggered=self.saveFile)) m.addAction(QtGui.QAction('Save &As',self,triggered=self.saveAsFile)) m.addAction(QtGui.QAction('&Close File',self,shortcut='Ctrl+F4',triggered=self.closeFile)) m.addAction(QtGui.QAction('E&xit',self,shortcut='Ctrl+Q',triggered=self.exitApp)) m=bar.addMenu('&Edit') m.addAction(QtGui.QAction('&Copy',self,shortcut='Ctrl+C',triggered=self.onCopy)) m.addAction(QtGui.QAction('C&ut',self,shortcut='Ctrl+X',triggered=self.onCut)) m.addAction(QtGui.QAction('&Paste',self,shortcut='Ctrl+V',triggered=self.onPaste)) m.addSeparator() m.addAction(QtGui.QAction('&Find/Replace',self,shortcut='Ctrl+F',triggered=self.onFindReplace)) m.addAction(QtGui.QAction('Find/Replace &Next',self,shortcut='F3',triggered=self.onFindNext)) m=bar.addMenu('&View') panes=m.addMenu('Panes') panes.addAction(QtGui.QAction('&Workspace',self,triggered=self.onViewPaneWorkspace)) panes.addAction(QtGui.QAction('&Output',self,triggered=self.onViewPaneOutput)) m.addAction(QtGui.QAction('&Next Tab',self,shortcut='Ctrl+F6',triggered=self.onViewNextTab)) m=bar.addMenu('&Build') m.addAction(QtGui.QAction('&Build',self,shortcut='F7',triggered=self.build)) m.addAction(QtGui.QAction('&Clean',self,triggered=self.clean)) m.addAction(QtGui.QAction('&Rebuild',self,shortcut='Shift+F7',triggered=self.rebuild)) m.addAction(QtGui.QAction('&Settings',self,shortcut='Ctrl+F7',triggered=self.buildSettings)) m.addAction(QtGui.QAction('&Next Error',self,shortcut='F4',triggered=self.nextError)) m=bar.addMenu('&Debug') m.addAction(QtGui.QAction('&Run',self,shortcut='Ctrl+F5',triggered=self.runProject)) m.addAction(QtGui.QAction('&Start/Continue Debugger',self,shortcut='F5',triggered=self.startDebug)) ma=m.addMenu('Actions') ma.addAction(QtGui.QAction('&Step',self,shortcut='F11',triggered=self.actStep)) ma.addAction(QtGui.QAction('&Next',self,shortcut='F10',triggered=self.actNext)) ma.addAction(QtGui.QAction('Step &Out',self,shortcut='Shift+F11',triggered=self.actOut)) ma.addAction(QtGui.QAction('&Break',self,shortcut='Ctrl+C',triggered=self.actBreak)) ma.addAction(QtGui.QAction('Sto&p',self,shortcut='Shift+F5',triggered=self.actStop)) ma=m.addMenu('&Breakpoints') ma.addAction(QtGui.QAction('&Clear',self,triggered=self.clearBreakpoints)) m=bar.addMenu('&Settings') m.addAction(QtGui.QAction('&General',self,triggered=self.settingsGeneral)) m.addAction(QtGui.QAction('&Fonts',self,triggered=self.settingsFonts)) m.addAction(QtGui.QAction('&Editor',self,triggered=self.settingsEditor)) m.addAction(QtGui.QAction('&Templates',self,triggered=self.settingsTemplates)) m.addAction(QtGui.QAction('&Plugins',self,triggered=self.settingsPlugins)) m=bar.addMenu('&Tools') pm=m.addMenu('&Plugins') self.plugins.addToMenu(pm) def onViewPaneWorkspace(self): self.paneWorkspace.show() def onViewPaneOutput(self): self.paneOutput.show() def onViewNextTab(self): count=self.central.count() if count>0: if len(self.tabOrder)!=count: self.tabOrder=range(0,self.central.count()) if self.central.currentIndex() == self.tabOrder[0]: self.tabOrder=self.tabOrder[1:]+self.tabOrder[:1] self.central.setCurrentIndex(self.tabOrder[0]) def setupContextMenuItems(self): self.contextMenuItems={ 'all':[ QtGui.QAction('Toggle Breakpoint',self,triggered=self.contextToggleBreakpoint) ], 'files':[ QtGui.QAction('Open Header',self,triggered=self.contextOpenHeader) ], 'breakpoints':[ QtGui.QAction('Edit Breakpoint',self,triggered=self.contextEditBreakpoint), QtGui.QAction('Dis/Enable Breakpoint',self,triggered=self.contextAbleBreakpoint) ], 'symbols':[ QtGui.QAction('Goto Definition',self,triggered=self.contextGotoDefinition) ] } def insertContextMenuItems(self,editor,menu): first=None acts=menu.actions() if len(acts)>0: first=acts[0] actions=list(self.contextMenuItems.get('all')) path=editor.path line=editor.contextMenuLine word=editor.contextMenuWord self.context=(path,line,word) if len(word)>0: actions.extend(self.contextMenuItems.get('symbols')) if self.breakpoints.hasBreakpoint(path,line): actions.extend(self.contextMenuItems.get('breakpoints')) if self.workspaceTree.exists(editor.contextFilename): actions.extend(self.contextMenuItems.get('files')) menu.insertActions(first,actions) menu.insertSeparator(first) def contextGotoDefinition(self): src=os.path.join(self.workspaceTree.root,'src') intr=os.path.join(self.workspaceTree.root,'.intr') srcpath=self.context[0] objpath='' if srcpath.startswith(src) and is_src_ext(srcpath): rel=srcpath[len(src):] rel=rel[1:-4]+'.o' objpath=os.path.join(intr,rel) (dir,name)=os.path.split(objpath) objpath=os.path.join(dir,'Debug',name) if srcpath.startswith(self.workspaceTree.root) and srcpath.endswith('.h'): dir=self.workspaceTree.mainPath() mkPath=os.path.join(dir,'Makefile') objpath=utils.objForHeader(mkPath,srcpath) if len(objpath)>0: try: s=dwarf.DwarfSymbols(objpath) (path,line)=s.find(self.context[2]) if len(path)>0: self.goToSource(path,line,1) except IOError: utils.message('Project must first be compiled in Debug') def contextToggleBreakpoint(self): e=self.central.currentWidget() self.breakpoints.toggleBreakpoint(e) e.update() def contextEditBreakpoint(self): e=self.central.currentWidget() path=e.path line=e.contextMenuLine bp=self.breakpoints.getBreakpoint(path,line) if bp: d=BreakpointDialog() d.condition.setText(bp.condition()) utils.setCheckbox(d.enabled,bp.isEnabled()) if d.exec_(): bp.setCondition(d.condition.text()) bp.able(utils.getCheckbox(d.enabled)) self.breakpoints.update() e.update() def contextAbleBreakpoint(self): e=self.central.currentWidget() path=e.path line=e.contextMenuLine bp=self.breakpoints.getBreakpoint(path,line) if bp: if bp.isEnabled(): bp.disable() else: bp.enable() self.breakpoints.update() e.update() def contextOpenHeader(self): e=self.central.currentWidget() filename=self.workspaceTree.exists(e.contextFilename) if filename: self.workspaceTree.openFile(filename) def markToggleBreakpoint(self,line): e=self.central.currentWidget() #path=e.path self.breakpoints.toggleBreakpoint(e) e.update() def createPluginCuror(self): from pcursor import PluginCursor e=self.central.currentWidget() if e: return PluginCursor(e.textCursor()) return None def setupToolbar(self,rootDir): """ Creates the application main toolbar """ tb=self.addToolBar('Actions') tb.setObjectName("Toolbar") tb.addAction(utils.loadIcon('gear'),'Generate Makefiles').triggered.connect(self.generate) self.configCombo=self.createConfigCombo(tb) tb.addWidget(self.configCombo) tb.addAction(utils.loadIcon('step.png'),'Step').triggered.connect(self.actStep) tb.addAction(utils.loadIcon('next.png'),'Next').triggered.connect(self.actNext) tb.addAction(utils.loadIcon('out.png'),'Out').triggered.connect(self.actOut) tb.addAction(utils.loadIcon('cont.png'),'Continue').triggered.connect(self.actCont) tb.addAction(utils.loadIcon('break.png'),'Break').triggered.connect(self.actBreak) tb.addAction(utils.loadIcon('stop.png'),'Stop').triggered.connect(self.actStop) self.createTemplatesCombo(tb) tb.addWidget(self.tmplCombo) def exitApp(self): self.close() def nextError(self): e=self.outputEdit.getNextError() if e: self.showStatus(e[3]) self.goToSource(e[0],e[1],e[2],'#ff8080') self.outputEdit.highlightLine(e[4]) def onCopy(self): (e,p)=self.currentEditor() if e: e.copy() def onCut(self): (e,p)=self.currentEditor() if e: e.cut() def onPaste(self): (e,p)=self.currentEditor() if e: e.paste() def onFindReplace(self): (e,p)=self.currentEditor() if e: from finddlg import FindDialog d=FindDialog(self) c=e.textCursor() if c.hasSelection: d.setFindText(c.selectedText()) if d.exec_(): self.findDetails=d.details self.onFindNext() def onFindNext(self): (e,p)=self.currentEditor() if e and self.findDetails: flags=QtGui.QTextDocument.FindFlags() if not self.findDetails.get('find_case'): flags = flags | QtGui.QTextDocument.FindCaseSensitively if self.findDetails.get('find_words'): flags = flags | QtGui.QTextDocument.FindWholeWords if self.findDetails.get('find_back'): flags = flags | QtGui.QTextDocument.FindBackward text=self.findDetails.get('find_text') replaceText=self.findDetails.get('find_replace_text') replace=self.findDetails.get('find_replace') all=self.findDetails.get('find_all') if all and replace: while e.find(text,flags): e.textCursor().insertText(replaceText) elif e.find(text,flags): if replace: e.textCursor().insertText(replaceText) def settingsTemplates(self): """ Show the code templates editing dialog """ from settings import TemplatesDialog d=TemplatesDialog() if d.exec_(): d.save() self.updateTemplates() def settingsPlugins(self): """ Show the python plugins settings dialog """ from plugins import PluginsDialog d=PluginsDialog() if d.exec_(): d.save() def settingsGeneral(self): """ Show the general settings """ from settings import GeneralSettingsDialog d=GeneralSettingsDialog() if d.exec_(): d.save() self.updateGeneralSettings() def settingsEditor(self): """ Show the editor settings """ from settings import EditorSettingsDialog d=EditorSettingsDialog() if d.exec_(): d.save() self.updateEditorsSettings() def settingsFonts(self): """ Edit the font settings for the code window and various panes """ from settings import FontSettingsDialog d=FontSettingsDialog() if d.exec_(): self.setAllFonts() def loadFont(self,name,target): """ Load previously saved font settings """ settings=QtCore.QSettings() if settings.contains(name): fb=settings.value(name).toByteArray() buf=QtCore.QBuffer(fb) buf.open(QtCore.QIODevice.ReadOnly) font=QtGui.QFont() QtCore.QDataStream(fb) >> font target.setFont(font) else: target.setFont(QtGui.QFont('Monospace',14)) def setAllFonts(self): """ Apply fonts to the various sub-windows """ for e in self.editors: self.loadFont('codefont',self.editors.get(e)) #self.loadFont('watchesfont',self.watchesTree) #self.loadFont('watchesfont',self.stackList) self.loadFont('watchesfont',self.outputEdit) self.loadFont('sourcesfont',self.workspaceTree) def updateGeneralSettings(self): """ Apply general settings """ s=QtCore.QSettings() sortFiles=s.value('sortFiles',True).toBool() self.workspaceTree.setSorting(sortFiles) def updateEditorsSettings(self): """ Apply editor settings to all open tabs """ s=QtCore.QSettings() indent=(s.value('indent',2).toInt())[0] clang=s.value('clangCompletion',True).toBool() for e in self.editors: self.editors.get(e).indentWidth=indent self.editors.get(e).clangCompletion=clang def updateTemplates(self): self.tmplCombo.clear() self.tmplCombo.addItem("= Templates =") d=QtCore.QSettings().value('tmplDir','').toString() if d: templates=os.listdir(d) templates=[os.path.splitext(t)[0] for t in templates if t.endswith('.template')] for t in templates: self.tmplCombo.addItem(t) def showStatus(self,status): self.statusBar().showMessage(status) def findUndefinedReferences(self,output): """ Search the linker output to find undefined reference errors, and collect the missing symbol names """ undefined=set() base='undefined reference to ' if output: for line in output: p=line.find(base) if p>0: name=line[(p+len(base)):] if name.startswith('symbol '): name=name[8:] else: name=name[1:] p=name.find('(') if p>0: name=name[0:p] else: name=name[0:len(name)-1] p=name.find('@') if p>0: name=name[0:p] undefined.add(name) return undefined def toggleAdded(self,item): if item.checkState(): self.added.add(item.text()) else: self.added.remove(item.text()) def attemptUndefResolution(self,undefs): if not self.symbolScan: return from system import getLibrarySymbols, getWorkspaceSymbols suggested={} syms=getLibrarySymbols() wsSyms=getWorkspaceSymbols() for sym in undefs: words=sym.split(':') words=[w for w in words if w] words.append(sym) for word in words: if word in syms: s=syms.get(word) for l in s: if not l in suggested: suggested[l]=1 else: n=suggested.get(l)+1 suggested[l]=n if word in wsSyms: s=wsSyms.get(word) for l in s: if not l in suggested: suggested[l]=1 else: n=suggested.get(l)+1 suggested[l]=n self.added=set() if len(suggested)>0: d=uis.loadDialog('libsuggest') model = QtGui.QStandardItemModel(d.libsList) for s in suggested: item=QtGui.QStandardItem(s) item.setCheckable(True) model.appendRow(item) d.libsList.setModel(model) model.itemChanged.connect(lambda item : self.toggleAdded(item)) if d.exec_(): self.workspaceTree.addLibrariesToProject(self.added) def buildSettings(self,path=''): from buildsettings import BuildSettingsDialog if not path: path=self.workspaceTree.mainPath() if not path: path=self.workspaceTree.root d=BuildSettingsDialog(self,path) d.exec_() self.generateQueue.add(path) def checkBuildOutput(self): if self.buildProcess: self.processBuildOutput(self.buildProcess.text) self.buildProcess=None def pollAsync(self): rcs=utils.pollAsync() if len(rcs)>0: if rcs[0]==0: utils.appendColorLine(self.outputEdit,"Success...",'#008020') else: utils.appendColorLine(self.outputEdit,"= Failed ({}) =".format(rcs[0]),'#ff0000') self.checkBuildOutput() self.asyncPollTimer.stop() self.showStatus("Done") def execute(self,path,cmd,*args): if utils.pendingAsync(): self.showStatus('Busy') return None self.outputEdit.clearAll() p=utils.execute(self.outputEdit,path,cmd,*args) if not self.asyncPollTimer.isActive(): self.asyncPollTimer.start(10) return p def buildSpecific(self,path): self.saveAll() self.autoGenerate() if len(path)>0: self.showStatus("Building "+os.path.basename(path)) s=QtCore.QSettings() if s.value('parallel_make',False).toBool(): self.buildProcess=self.execute(path,'/usr/bin/make','-j','3',self.config) else: self.buildProcess=self.execute(path,'/usr/bin/make',self.config) def processBuildOutput(self,output): undefs=self.findUndefinedReferences(output) if len(undefs)>0: self.attemptUndefResolution(undefs) def build(self): self.buildSpecific(self.workspaceTree.mainPath()) def cleanSpecific(self,path): if len(path)>0: self.execute(path,'/usr/bin/make','clean_{}'.format(self.config)) def clean(self): self.cleanSpecific(self.workspaceTree.mainPath()) def rebuildSpecific(self,path): if len(path)>0: cfg=self.config self.showStatus("Rebuilding "+os.path.basename(path)) self.buildProcess=self.execute(path,'/usr/bin/make','clean_'+cfg,cfg) def rebuild(self): self.rebuildSpecific(self.workspaceTree.mainPath()) def autoGenerateRun(self): for path in self.generateQueue: genmake.generateDirectory(self.workspaceTree.root,path) self.generateQueue.clear() self.showStatus('Ready') def autoGenerate(self): if len(self.generateQueue)>0: self.showStatus('Generating Makefiles') self.timerCall=self.autoGenerateRun else: if genmake.genThreadDone(): self.showStatus("Makefile Generate Done") def waitForScanner(self): if self.symbolScan: import system import time while not system.isScannerDone(): time.sleep(1) def timer1000(self): e=self.central.currentWidget() if e: updates=self.breakpoints.updateLineNumbers(e.path) for path in updates: e=self.editors.get(path) if e: e.update() if self.timerCall: f=self.timerCall self.timerCall=None f() self.autoGenerate() #if self.statusBar().currentMessage() == MainWindow.LIBRARY_SCAN: if self.symbolScan: import system if system.isScannerDone(): #if system.scanq and not system.scanq.empty(): if self.statusBar().currentMessage() == MainWindow.LIBRARY_SCAN: self.showStatus('Ready') system.getLibrarySymbols() def timer5000(self): import scm res=scm.scan(self.workspaceTree.root) if res: new_scm_mods=[] for (name,status) in res: path=os.path.join(self.workspaceTree.root,name) if path in self.workspaceTree.fileItems: item=self.workspaceTree.fileItems.get(path) if status=='Modified': item.setForeground(0,QtGui.QBrush(QtGui.QColor(255,0,0))) elif status=='Staged': item.setForeground(0,QtGui.QBrush(QtGui.QColor(0,255,0))) new_scm_mods.append(item) for item in self.scm_mods: if not item in new_scm_mods: item.setForeground(0,QtGui.QBrush(QtGui.QColor(0,0,0))) self.scm_mods=new_scm_mods for path in self.editors: last=self.file_times.get(path) cur=os.path.getmtime(path) if cur!=last: self.file_times[path]=cur res=QtGui.QMessageBox.question(self,'File changed','Reload {}'.format(path),QtGui.QMessageBox.Yes,QtGui.QMessageBox.No) if res==QtGui.QMessageBox.Yes: text=''.join(open(path,'r').readlines()) self.editors.get(path).text=text def generateAllInThread(self): genmake.generateTree(self.workspaceTree.root,False) def generateAll(self): genmake.generateTree(self.workspaceTree.root,True) def generate(self): mb=QtGui.QMessageBox() mb.setText("Generate make files") mb.setInformativeText("Overwrite all make files?") mb.setStandardButtons(QtGui.QMessageBox.Yes|QtGui.QMessageBox.No) mb.setDefaultButton(QtGui.QMessageBox.Yes) rc=mb.exec_() if rc==QtGui.QMessageBox.Yes: self.generateAll() utils.message("Done") def createHelloWorldProject(self,dir): try: os.makedirs(dir) except OSError: pass mainpath=os.path.join(dir,'main.cpp') f=open(mainpath,"w") f.write('#include <iostream>\n\n\nint main(int argc, char* argv[])\n') f.write('{\n std::cout << "Hello World" << std::endl;\n return 0;\n}\n') f.close() self.workspaceTree.update() genmake.generateDirectory(self.workspaceTree.root,dir) self.workspaceTree.setMainPath(dir) def initWorkspace(self): d=QtGui.QFileDialog() d.setFileMode(QtGui.QFileDialog.Directory) d.setOption(QtGui.QFileDialog.ShowDirsOnly) if d.exec_(): ws=(d.selectedFiles())[0] os.makedirs(os.path.join(ws,'include')) dir=os.path.join(ws,'src','hello') self.workspaceTree.setWorkspacePath(ws) self.createHelloWorldProject(dir) self.workspaceTree.saveSettings() self.generateAll() def updateRecents(self): ws=self.workspaceTree.root if ws in self.recent_ws: del self.recent_ws[self.recent_ws.index(ws)] self.recent_ws.insert(0,ws) while len(self.recent_ws)>4: del self.recent_ws[-1] s=QtCore.QSettings() s.setValue('recent_ws',':'.join(self.recent_ws)) s.sync() self.recents_menu.clear() handlers=[partial(self.openRecent,w) for w in self.recent_ws] for ws,h in zip(self.recent_ws,handlers): self.recents_menu.addAction(QtGui.QAction(ws,self,triggered=h)) def openRecent(self,ws): self.workspaceTree.saveTabs(self.central) self.closeAllTabs() self.workspaceTree.setWorkspacePath(ws) #self.generateAll() self.loadTabs() self.waitForScanner() import symbolscanner symbolscanner.setWorkspacePath(ws) self.updateRecents() def openWorkspace(self): d=QtGui.QFileDialog() d.setFileMode(QtGui.QFileDialog.Directory) d.setOption(QtGui.QFileDialog.ShowDirsOnly) if d.exec_(): ws=(d.selectedFiles())[0] self.openRecent(ws) def saveTabFile(self,index): n=self.central.tabBar().count() if index>=0 and index<n: path=self.central.tabToolTip(index) editor=self.editors.get(path) if editor: doc=editor.document() if doc.isModified(): f=open(path,'w') if not f: utils.errorMessage('Cannot write file: {}'.format(path)) return f.write(doc.toPlainText()) f.close() doc.setModified(False) self.file_times[path]=os.path.getmtime(path) #dir=os.path.dirname(path) #self.generateQueue.add(dir) if self.symbolScan: from system import getLibrarySymbols getLibrarySymbols() from symbolscanner import rescanOnFileSave rescanOnFileSave(path) def saveFile(self): n=self.central.tabBar().count() if n>0: self.saveTabFile(self.central.currentIndex()) def saveAll(self): n=self.central.tabBar().count() for i in xrange(0,n): self.saveTabFile(i) def saveAsFile(self): pass def closeAllTabs(self): while self.central.count()>0: if not self.closeTab(0): return False return True def tabChanged(self,index): for i in xrange(0,len(self.tabOrder)): if self.tabOrder[i]==index: self.tabOrder=self.tabOrder[i:]+self.tabOrder[:i] break def closeTab(self,index): path=self.central.tabToolTip(index) editor=self.editors.get(path) if editor: doc=editor.document() if doc.isModified(): mb = QtGui.QMessageBox() mb.setText("{} has been modified.".format(os.path.basename(path))) mb.setInformativeText("Do you want to save your changes?") mb.setStandardButtons(QtGui.QMessageBox.Save | QtGui.QMessageBox.Discard | QtGui.QMessageBox.Cancel) mb.setDefaultButton(QtGui.QMessageBox.Save) rc = mb.exec_() if rc == QtGui.QMessageBox.Save: f=open(path,'w') if not f: utils.errorMessage('Cannot write file: {}'.format(path)) return False f.write(doc.toPlainText()) f.close() elif rc == QtGui.QMessageBox.Cancel: return False del self.editors[path] del self.file_times[path] self.central.removeTab(index) return True def closeFile(self): n=self.central.tabBar().count() if n>0: index=self.central.currentIndex() return self.closeTab(index) return False def currentEditor(self): if self.central.count()>0: cur=self.central.currentIndex() path=self.central.tabToolTip(cur) if path in self.editors: return (self.editors.get(path),path) return (None,None) def templateSelected(self,index): (editor,path)=self.currentEditor() if index>0 and editor: template=self.tmplCombo.itemText(index) d=QtCore.QSettings().value('tmplDir','').toString() if d: tpath=os.path.join(d,template+".template") try: f=open(tpath,'r') code=f.read() if code: cursor=editor.textCursor() props=Properties() props.assign('PATH',path) base=os.path.basename(path) props.assign('FILENAME',base) p=base.find('.') if (p>0): props.assign('FILEBASE',base[0:p]) props.assign('SELECTION',cursor.selectedText()) cursor.removeSelectedText() import templates text=templates.generateCode(code,props) cursor.insertText(text) except IOError: utils.errorMessage("Cannot read file: {}".format(path)) self.tmplCombo.setCurrentIndex(0) def showWorkspacePane(self): """ Creates a docking pane that shows a list of source files """ self.paneWorkspace=QtGui.QDockWidget("Workspace",self) self.paneWorkspace.setObjectName("Workspace") self.paneWorkspace.setAllowedAreas(QtCore.Qt.LeftDockWidgetArea|QtCore.Qt.RightDockWidgetArea) self.workspaceTree=WorkSpace(self.paneWorkspace,self) self.workspaceTree.depsChanged.connect(lambda path: self.generateQueue.add(path)) self.paneWorkspace.setWidget(self.workspaceTree) self.addDockWidget(QtCore.Qt.LeftDockWidgetArea,self.paneWorkspace) self.updateWorkspace() self.workspaceTree.doubleClicked.connect(self.docDoubleClicked) self.showStatus(MainWindow.LIBRARY_SCAN) if self.symbolScan: from system import startSymbolScan startSymbolScan(self.workspaceTree.root) else: from system import disableSymbolScan disableSymbolScan() self.updateRecents() def updateWorkspace(self): self.workspaceTree.update() def setActiveSourceFile(self,path): if path in self.editors: editor=self.editors.get(path) n=self.central.tabBar().count() for i in xrange(0,n): if self.central.widget(i) == editor: self.central.tabBar().setCurrentIndex(i) return True return False def fixPath(self,path): if path.startswith(self.rootDir): path=os.path.relpath(path,self.rootDir) return path ''' Makes the path given the active source file in the editor. If the file is already open, it is made active. If not, it is opened and made active. Function returns true if the file is found and opened ''' def openSourceFile(self,path): path=self.fixPath(path) if self.setActiveSourceFile(path): return True else: try: f=open(path,"r") if not f: return False lines=f.readlines() if lines: firstLine=lines[0] s=QtCore.QSettings() editor=qutepart.Qutepart() editor.setPath(path) editor.detectSyntax(sourceFilePath=path, firstLine=firstLine) editor.lineLengthEdge = 1024 editor.drawIncorrectIndentation = True editor.drawAnyWhitespace = False editor.indentUseTabs = False editor.indentWidth = (s.value('indent',2).toInt())[0] editor.text="".join(lines) editor.setLineWrapMode(QtGui.QPlainTextEdit.NoWrap) editor.setWorkspace(self.workspaceTree) editor.setMainWindow(self) index=self.central.addTab(editor,os.path.basename(path)) self.central.setTabToolTip(index,path) self.editors[path]=editor self.file_times[path]=os.path.getmtime(path) self.loadFont('codefont',editor) self.central.tabBar().setCurrentIndex(index) bps=self.breakpoints.pathBreakpoints(path) editor.bpMarks=bps editor._markArea.blockDoubleClicked.connect(self.markToggleBreakpoint) return True except IOError: return False return False def docDoubleClicked(self,index): item=self.workspaceTree.currentItem() path=item.data(0,FileRole).toString() if len(path)>0: self.openSourceFile(path) if path in self.editors: self.editors.get(path).setFocus(QtCore.Qt.MouseFocusReason) def goToSource(self,path,row,col,color=''): """ Given a file path, and a position within, open a tab or switch to an already open tab, and scroll to that position. Usually useful to find references or compiler error positions """ path=self.fixPath(path) if self.openSourceFile(path): editor=self.editors.get(path) if editor: self.setActiveSourceFile(path) c=editor.textCursor() c.movePosition(QtGui.QTextCursor.Start) c.movePosition(QtGui.QTextCursor.Down,n=row-1) c.movePosition(QtGui.QTextCursor.Right,n=col-1) editor.setTextCursor(c) editor.ensureCursorVisible() if len(color)>0: editor.colorLine(row,color) def showCallStackPane(self): self.paneStack=QtGui.QDockWidget("Call Stack",self) self.paneStack.setObjectName("CallStack") self.paneStack.setAllowedAreas(QtCore.Qt.BottomDockWidgetArea) self.stackList=QtGui.QListWidget(self.paneStack) self.paneStack.setWidget(self.stackList) self.addDockWidget(QtCore.Qt.BottomDockWidgetArea,self.paneStack) self.loadFont('watchesfont',self.stackList) self.stackList.itemDoubleClicked.connect(self.stackItemDoubleClicked) def showLocalsPane(self): self.paneLocals=QtGui.QDockWidget("Locals",self) self.paneLocals.setObjectName("Locals") self.paneLocals.setAllowedAreas(QtCore.Qt.BottomDockWidgetArea) self.localsTree=WatchesTree(self.paneLocals) self.localsTree.setColumnCount(2) self.localsTree.setHeaderLabels(['Name','Value']) self.paneLocals.setWidget(self.localsTree) self.addDockWidget(QtCore.Qt.BottomDockWidgetArea,self.paneLocals) self.loadFont('watchesfont',self.watchesTree) def showWatchesPane(self): self.paneWatches=QtGui.QDockWidget("Watches",self) self.paneWatches.setObjectName("Watches") self.paneWatches.setAllowedAreas(QtCore.Qt.BottomDockWidgetArea) self.watchesTree=WatchesTree(self.paneWatches) self.watchesTree.setColumnCount(2) self.watchesTree.setHeaderLabels(['Name','Value']) self.paneWatches.setWidget(self.watchesTree) self.addDockWidget(QtCore.Qt.BottomDockWidgetArea,self.paneWatches) self.loadFont('watchesfont',self.watchesTree) self.watchesTree.addTopLevelItem(QtGui.QTreeWidgetItem(['* Double-Click for new watch'])) self.watchesTree.resizeColumnToContents(0) self.watchesTree.itemDoubleClicked.connect(lambda item,column : self.watchDoubleClicked(item,column)) def showOutputPane(self): self.paneOutput=QtGui.QDockWidget("Output",self) self.paneOutput.setObjectName("Output") self.paneOutput.setAllowedAreas(QtCore.Qt.BottomDockWidgetArea) self.outputEdit=output.OutputWidget(self.paneOutput,self) self.outputEdit.setReadOnly(True) self.paneOutput.setWidget(self.outputEdit) self.addDockWidget(QtCore.Qt.BottomDockWidgetArea,self.paneOutput) def stackItemDoubleClicked(self,item): pat='at (.+):(\d+)' m=re.search(pat,item.text()) if m: g=m.groups() path=g[0] line=int(g[1]) self.goToSource(path,line,1) else: row=self.stackList.row(item) if row<(self.stackList.count()-1): self.stackItemDoubleClicked(self.stackList.item(row+1)) def watchDoubleClicked(self,item,column): """ Edits existing watches, or adds a new watch """ changed=False index=self.watchesTree.indexOfTopLevelItem(item) if item.text(column)=='* Double-Click for new watch': res=QtGui.QInputDialog.getText(self,'New Watch','Expression') expr=res[0] if len(expr)>0 and res[1]: self.watchesTree.insertTopLevelItem(index,QtGui.QTreeWidgetItem([expr])) changed=True self.updateWatches() else: watch=item.text(0) res=QtGui.QInputDialog.getText(self,"Edit Watch",'Expression',text=watch) watch=res[0] if res[1]: changed=True if len(watch)>0: item.setText(0,watch) self.updateWatches() else: self.watchesTree.takeTopLevelItem(index) if changed: self.saveWatches() def createConfigCombo(self,parent): configCombo=QtGui.QComboBox(parent) configCombo.addItem("Debug") configCombo.addItem("Release") configCombo.currentIndexChanged.connect(self.configChanged) return configCombo def createTemplatesCombo(self,parent): self.tmplCombo=QtGui.QComboBox(parent) self.tmplCombo.currentIndexChanged.connect(self.templateSelected) self.updateTemplates() def configChanged(self,index): configs=['Debug','Release'] self.config=configs[index] s=QtCore.QSettings() s.setValue("config",self.config) s.sync() self.workspaceTree.setConfig(self.config) def addOutputText(self,added): """ Append the new text captured Text is appended to the end of existing text and the widget is scrolled to show the end """ text=self.outputEdit.toPlainText() self.outputEdit.setPlainText(text+added) c=self.outputEdit.textCursor() c.movePosition(QtGui.QTextCursor.End) self.outputEdit.setTextCursor(c) self.outputEdit.ensureCursorVisible() def tempScriptPath(self): """ Generate a temporary script name. Used for running programs with an additional wait for key at the end. """ from time import time t=int(time()*10) return '/tmp/coide_{}.sh'.format(t) def removeTempScripts(self): """ Remove all temporary script files. Called before program exit """ files=os.listdir('/tmp') files=[f for f in files if f.startswith('coide_')] for f in files: os.remove('/tmp/{}'.format(f)) def runProject(self): if not utils.checkFor('xterm'): utils.message("xterm not installed") return path=self.tempScriptPath() f=open(path,'w') dir=self.workspaceTree.getDebugDirectory() cmd=self.workspaceTree.getExecutablePath() params=self.workspaceTree.getDebugParams() if len(params)>0: cmd=cmd+" "+params f.write('#!/bin/sh\ncd {}\n{}\nread -r -p "Press any key..." key\n'.format(dir,cmd)) f.close() os.chmod(path,stat.S_IRUSR|stat.S_IWUSR|stat.S_IXUSR) utils.run('/tmp','xterm','-fn','10x20','-e',path) def getCurrentFile(self): if self.central.count()==0: return '' return self.central.tabToolTip(self.central.currentIndex()) def getCurrentEditor(self): path=self.getCurrentFile() if len(path)>0: return self.editors.get(path) def updatePosition(self): """ Query current position and update the code view """ changed=False poslist=self.debugger.getCurrentPos() if poslist and len(poslist)>0: for (path,line) in poslist: if self.getCurrentFile()==path: if self.currentLine!=line: changed=True break if self.openSourceFile(path): changed=True break e=self.editors.get(path) if changed and e: e.colorLine(line,'#0080ff') e.cursorPosition=(line-1,1) self.currentLine=line e.ensureCursorVisible() def saveWatches(self): """ Save all watches to settings, for future sessions """ res=[] n=self.watchesTree.topLevelItemCount()-1 for i in xrange(0,n): item=self.watchesTree.topLevelItem(i) if len(res)>0: res.append(';') res.append(item.text(0)) settings=QtCore.QSettings() key='watches:{}'.format(self.debugger.debugged) settings.setValue(key,''.join(res)) def loadWatches(self): """ Load all previous session watches from settings """ while self.watchesTree.topLevelItemCount()>1: self.watchesTree.takeTopLevelItem(0) settings=QtCore.QSettings() key='watches:{}'.format(self.debugger.debugged) val=settings.value(key,'').toString() if len(val)>0: arr=val.split(';') if len(arr)>0: res=[] for watch in arr: res.append(QtGui.QTreeWidgetItem([watch])) self.watchesTree.insertTopLevelItems(0,res) def updateLocals(self): locals=self.debugger.getLocals() self.localsTree.clear() for var in locals.keys(): item=QtGui.QTreeWidgetItem([var]) self.localsTree.addTopLevelItem(item) res=locals.get(var) if res: self.updateWatchItem(item,res) def updateWatches(self): """ Re-evaluate the value of each watch and update view """ n=self.watchesTree.topLevelItemCount()-1 for i in xrange(0,n): item=self.watchesTree.topLevelItem(i) item.takeChildren() expr=item.text(0) res=self.debugger.evaluate(expr) if res: self.updateWatchItem(item,res) def updateWatchItem(self,item,root): item.setText(1,root.value) def addChildren(item,node): for c in node.children: subitem=QtGui.QTreeWidgetItem([c.name]) subitem.setText(1,c.value) item.addChild(subitem) addChildren(subitem,c) addChildren(item,root) def updateCallstack(self): bt=self.debugger.getBackTrace() self.stackList.clear() for line in bt: self.stackList.addItem(line) def startDebug(self): if self.debugger: self.actCont() return self.outputEdit.setPlainText('') cmd=[self.workspaceTree.getExecutablePath()] args=self.workspaceTree.getDebugParams().split() cwd=self.workspaceTree.getDebugDirectory() if len(cwd)<1: cwd=self.workspaceTree.mainPath() for a in args: cmd.append(a) self.debugger=GDBWrapper(self.breakpoints,cmd,cwd) #self.showWatchesPane() #self.showCallStackPane() #self.loadDebugWindowState() self.showDebugPanes() self.loadWatches() self.timer.start(50) qutepart.evaluator=self.debugger.evaluateAsText def stopDebugger(self): if self.debugger: qutepart.evaluator=None for path in self.editors: e=self.editors.get(path) e.colorLine(0,'') self.saveDebugWindowState() self.debugger.quitDebugger() self.debugger=None #self.paneWatches.close() #self.paneWatches=None #self.paneStack.close() #self.paneStack=None self.hideDebugPanes() self.timer.stop() def hideDebugPanes(self): self.paneWatches.hide() self.paneLocals.hide() self.paneStack.hide() def showDebugPanes(self): self.paneWatches.show() self.paneLocals.show() self.paneStack.show() def clearBreakpoints(self): self.breakpoints.clear() n=self.central.count() for i in xrange(0,n): self.central.widget(i).bpMarks={} if self.debugger: self.debugger.clearBreakpoints() def actStep(self): if self.debugger: self.debugger.actStep() if not self.debugger.running: self.stopDebugger() def actNext(self): if self.debugger: self.debugger.actNext() if not self.debugger.running: self.stopDebugger() def actOut(self): if self.debugger: self.debugger.actOut() if not self.debugger.running: self.stopDebugger() def actCont(self): if self.debugger: e=self.getCurrentEditor() if e: e.colorLine(0,'') self.currentLine=-1 self.debugger.actCont() def actBreak(self): if self.debugger: self.debugger.actBreak() def actStop(self): if self.debugger: self.debugger.actStop() def update(self): """ Called every 50ms to check if a change in debugger state occurred Basically this is waiting for a change of state, indicated by: * self.debugger.changed If a change is detected, everything is re-evaluated and drawn """ if self.debugger: self.debugger.update() #if len(text)>0: # self.addOutputText(text) if self.debugger.hasOutput(): self.addOutputText(self.debugger.getOutput()) if self.debugger.changed: self.updatePosition() self.updateWatches() self.updateLocals() self.updateCallstack() self.debugger.changed=False if not self.debugger.running: self.stopDebugger() # If the debugger is active running the program, # create an indication using an animation in the top left # corner of the application window if self.debugger and self.debugger.active: if self.runningWidget is None: from running import RunningWidget self.runningWidget=RunningWidget(self) self.runningWidget.show() self.outputEdit.setBlinkingCursor(True) s=self.outputEdit.getInput() if len(s)>0: text=''.join(s) self.debugger.sendInput(text) self.addOutputText(text) else: self.outputEdit.clearInput() self.outputEdit.setBlinkingCursor(False) if not self.runningWidget is None: self.runningWidget.close() self.runningWidget=None
gpl-2.0
kenshay/ImageScripter
ProgramData/SystemFiles/Python/Lib/site-packages/pip-9.0.1-py2.7.egg/pip/_vendor/html5lib/treeadapters/sax.py
1835
1661
from __future__ import absolute_import, division, unicode_literals from xml.sax.xmlreader import AttributesNSImpl from ..constants import adjustForeignAttributes, unadjustForeignAttributes prefix_mapping = {} for prefix, localName, namespace in adjustForeignAttributes.values(): if prefix is not None: prefix_mapping[prefix] = namespace def to_sax(walker, handler): """Call SAX-like content handler based on treewalker walker""" handler.startDocument() for prefix, namespace in prefix_mapping.items(): handler.startPrefixMapping(prefix, namespace) for token in walker: type = token["type"] if type == "Doctype": continue elif type in ("StartTag", "EmptyTag"): attrs = AttributesNSImpl(token["data"], unadjustForeignAttributes) handler.startElementNS((token["namespace"], token["name"]), token["name"], attrs) if type == "EmptyTag": handler.endElementNS((token["namespace"], token["name"]), token["name"]) elif type == "EndTag": handler.endElementNS((token["namespace"], token["name"]), token["name"]) elif type in ("Characters", "SpaceCharacters"): handler.characters(token["data"]) elif type == "Comment": pass else: assert False, "Unknown token type" for prefix, namespace in prefix_mapping.items(): handler.endPrefixMapping(prefix) handler.endDocument()
gpl-3.0
DelazJ/QGIS
python/plugins/processing/algs/gdal/pct2rgb.py
15
3807
# -*- coding: utf-8 -*- """ *************************************************************************** pct2rgb.py --------------------- Date : August 2012 Copyright : (C) 2012 by Victor Olaya Email : volayaf at gmail dot com *************************************************************************** * * * This program is free software; you can redistribute it and/or modify * * it under the terms of the GNU General Public License as published by * * the Free Software Foundation; either version 2 of the License, or * * (at your option) any later version. * * * *************************************************************************** """ __author__ = 'Victor Olaya' __date__ = 'August 2012' __copyright__ = '(C) 2012, Victor Olaya' import os from qgis.PyQt.QtGui import QIcon from qgis.core import (QgsRasterFileWriter, QgsProcessingException, QgsProcessingParameterRasterLayer, QgsProcessingParameterBand, QgsProcessingParameterBoolean, QgsProcessingParameterRasterDestination) from processing.algs.gdal.GdalAlgorithm import GdalAlgorithm from processing.tools.system import isWindows from processing.algs.gdal.GdalUtils import GdalUtils pluginPath = os.path.split(os.path.split(os.path.dirname(__file__))[0])[0] class pct2rgb(GdalAlgorithm): INPUT = 'INPUT' BAND = 'BAND' RGBA = 'RGBA' OUTPUT = 'OUTPUT' def __init__(self): super().__init__() def initAlgorithm(self, config=None): self.addParameter(QgsProcessingParameterRasterLayer(self.INPUT, self.tr('Input layer'))) self.addParameter(QgsProcessingParameterBand(self.BAND, self.tr('Band number'), 1, parentLayerParameterName=self.INPUT)) self.addParameter(QgsProcessingParameterBoolean(self.RGBA, self.tr('Generate a RGBA file'), defaultValue=False)) self.addParameter(QgsProcessingParameterRasterDestination(self.OUTPUT, self.tr('PCT to RGB'))) def name(self): return 'pcttorgb' def displayName(self): return self.tr('PCT to RGB') def group(self): return self.tr('Raster conversion') def groupId(self): return 'rasterconversion' def icon(self): return QIcon(os.path.join(pluginPath, 'images', 'gdaltools', '8-to-24-bits.png')) def commandName(self): return 'pct2rgb' def getConsoleCommands(self, parameters, context, feedback, executing=True): inLayer = self.parameterAsRasterLayer(parameters, self.INPUT, context) if inLayer is None: raise QgsProcessingException(self.invalidRasterError(parameters, self.INPUT)) out = self.parameterAsOutputLayer(parameters, self.OUTPUT, context) self.setOutputValue(self.OUTPUT, out) arguments = [ inLayer.source(), out, '-of', QgsRasterFileWriter.driverForExtension(os.path.splitext(out)[1]), '-b', str(self.parameterAsInt(parameters, self.BAND, context)), ] if self.parameterAsBoolean(parameters, self.RGBA, context): arguments.append('-rgba') return [self.commandName() + ('.bat' if isWindows() else '.py'), GdalUtils.escapeAndJoin(arguments)]
gpl-2.0
olefb/android_kernel_sony_msm8974
tools/perf/scripts/python/futex-contention.py
11261
1486
# futex contention # (c) 2010, Arnaldo Carvalho de Melo <acme@redhat.com> # Licensed under the terms of the GNU GPL License version 2 # # Translation of: # # http://sourceware.org/systemtap/wiki/WSFutexContention # # to perf python scripting. # # Measures futex contention import os, sys sys.path.append(os.environ['PERF_EXEC_PATH'] + '/scripts/python/Perf-Trace-Util/lib/Perf/Trace') from Util import * process_names = {} thread_thislock = {} thread_blocktime = {} lock_waits = {} # long-lived stats on (tid,lock) blockage elapsed time process_names = {} # long-lived pid-to-execname mapping def syscalls__sys_enter_futex(event, ctxt, cpu, s, ns, tid, comm, nr, uaddr, op, val, utime, uaddr2, val3): cmd = op & FUTEX_CMD_MASK if cmd != FUTEX_WAIT: return # we don't care about originators of WAKE events process_names[tid] = comm thread_thislock[tid] = uaddr thread_blocktime[tid] = nsecs(s, ns) def syscalls__sys_exit_futex(event, ctxt, cpu, s, ns, tid, comm, nr, ret): if thread_blocktime.has_key(tid): elapsed = nsecs(s, ns) - thread_blocktime[tid] add_stats(lock_waits, (tid, thread_thislock[tid]), elapsed) del thread_blocktime[tid] del thread_thislock[tid] def trace_begin(): print "Press control+C to stop and show the summary" def trace_end(): for (tid, lock) in lock_waits: min, max, avg, count = lock_waits[tid, lock] print "%s[%d] lock %x contended %d times, %d avg ns" % \ (process_names[tid], tid, lock, count, avg)
gpl-2.0
manjunaths/tensorflow
tensorflow/python/kernel_tests/atrous_conv2d_test.py
139
9770
# Copyright 2015 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Tests for convolution related functionality in tensorflow.ops.nn.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import numpy as np from tensorflow.python.framework import constant_op from tensorflow.python.framework import dtypes from tensorflow.python.ops import array_ops from tensorflow.python.ops import gradient_checker from tensorflow.python.ops import nn_impl from tensorflow.python.ops import nn_ops import tensorflow.python.ops.nn_grad # pylint: disable=unused-import from tensorflow.python.platform import test def _upsample_filters(filters, rate): """Upsamples the filters by a factor of rate along the spatial dimensions. Args: filters: [h, w, in_depth, out_depth]. Original filters. rate: An int, specifying the upsampling rate. Returns: filters_up: [h_up, w_up, in_depth, out_depth]. Upsampled filters with h_up = h + (h - 1) * (rate - 1) w_up = w + (w - 1) * (rate - 1) containing (rate - 1) zeros between consecutive filter values along the filters' spatial dimensions. """ if rate == 1: return filters # [h, w, in_depth, out_depth] -> [in_depth, out_depth, h, w] filters_up = np.transpose(filters, [2, 3, 0, 1]) ker = np.zeros([rate, rate], dtype=np.float32) ker[0, 0] = 1 filters_up = np.kron(filters_up, ker)[:, :, :-(rate - 1), :-(rate - 1)] # [in_depth, out_depth, h_up, w_up] -> [h_up, w_up, in_depth, out_depth] filters_up = np.transpose(filters_up, [2, 3, 0, 1]) return filters_up class AtrousConv2DTest(test.TestCase): def testAtrousConv2DForward(self): with self.test_session(use_gpu=True): # Input: [batch, height, width, input_depth] height = 9 for width in [9, 10]: # Test both odd and even width. x_shape = [2, height, width, 2] x = np.arange(np.prod(x_shape), dtype=np.float32).reshape(x_shape) # Filter: [kernel_height, kernel_width, input_depth, output_depth] for kernel_height in range(1, 4): for kernel_width in range(1, 4): f_shape = [kernel_height, kernel_width, 2, 2] f = np.arange(np.prod(f_shape), dtype=np.float32).reshape(f_shape) for rate in range(1, 4): f_up = _upsample_filters(f, rate) for padding in ["SAME", "VALID"]: y1 = nn_ops.atrous_conv2d(x, f, rate, padding=padding) y2 = nn_ops.conv2d( x, f_up, strides=[1, 1, 1, 1], padding=padding) self.assertAllClose(y1.eval(), y2.eval(), rtol=1e-3, atol=1e-3) def testAtrousSequence(self): """Tests optimization of sequence of atrous convolutions. Verifies that a sequence of `atrous_conv2d` operations with identical `rate` parameters, 'SAME' `padding`, and `filters` with odd heights/ widths: net = atrous_conv2d(net, filters1, rate, padding="SAME") net = atrous_conv2d(net, filters2, rate, padding="SAME") ... net = atrous_conv2d(net, filtersK, rate, padding="SAME") is equivalent to: pad = ... # padding so that the input dims are multiples of rate net = space_to_batch(net, paddings=pad, block_size=rate) net = conv2d(net, filters1, strides=[1, 1, 1, 1], padding="SAME") net = conv2d(net, filters2, strides=[1, 1, 1, 1], padding="SAME") ... net = conv2d(net, filtersK, strides=[1, 1, 1, 1], padding="SAME") net = batch_to_space(net, crops=pad, block_size=rate) """ padding = "SAME" # The padding needs to be "SAME" np.random.seed(1) # Make it reproducible. with self.test_session(use_gpu=True): # Input: [batch, height, width, input_depth] for height in range(15, 17): for width in range(15, 17): x_shape = [3, height, width, 2] x = np.random.random_sample(x_shape).astype(np.float32) for kernel in [1, 3, 5]: # The kernel size needs to be odd. # Filter: [kernel_height, kernel_width, input_depth, output_depth] f_shape = [kernel, kernel, 2, 2] f = 1e-2 * np.random.random_sample(f_shape).astype(np.float32) for rate in range(2, 4): # y1: three atrous_conv2d in a row. y1 = nn_ops.atrous_conv2d(x, f, rate, padding=padding) y1 = nn_ops.atrous_conv2d(y1, f, rate, padding=padding) y1 = nn_ops.atrous_conv2d(y1, f, rate, padding=padding) # y2: space_to_batch, three conv2d in a row, batch_to_space pad_bottom = 0 if height % rate == 0 else rate - height % rate pad_right = 0 if width % rate == 0 else rate - width % rate pad = [[0, pad_bottom], [0, pad_right]] y2 = array_ops.space_to_batch(x, paddings=pad, block_size=rate) y2 = nn_ops.conv2d(y2, f, strides=[1, 1, 1, 1], padding=padding) y2 = nn_ops.conv2d(y2, f, strides=[1, 1, 1, 1], padding=padding) y2 = nn_ops.conv2d(y2, f, strides=[1, 1, 1, 1], padding=padding) y2 = array_ops.batch_to_space(y2, crops=pad, block_size=rate) self.assertAllClose(y1.eval(), y2.eval(), rtol=1e-2, atol=1e-2) def testGradient(self): with self.test_session(use_gpu=True): # Input: [batch, height, width, input_depth] x_shape = [2, 5, 6, 2] # Filter: [kernel_height, kernel_width, input_depth, output_depth] f_shape = [3, 3, 2, 2] # Output: [batch, height, width, output_depth] y_shape = [2, 5, 6, 2] np.random.seed(1) # Make it reproducible. x_val = np.random.random_sample(x_shape).astype(np.float32) f_val = np.random.random_sample(f_shape).astype(np.float32) x = constant_op.constant(x_val, name="x", dtype=dtypes.float32) f = constant_op.constant(f_val, name="f", dtype=dtypes.float32) for rate in range(1, 4): output = nn_ops.atrous_conv2d(x, f, rate=rate, padding="SAME") err = gradient_checker.compute_gradient_error([x, f], [x_shape, f_shape], output, y_shape) print("atrous_conv2d gradient err = %g " % err) err_tolerance = 1e-3 self.assertLess(err, err_tolerance) class AtrousConv2DTransposeTest(test.TestCase): def testAtrousConv2DTransposeForward(self): with self.test_session(use_gpu=True): # Input: [batch, height, width, input_depth] height = 9 for width in [9, 10]: # Test both odd and even width. x_shape = [2, height, width, 2] x = np.arange(np.prod(x_shape), dtype=np.float32).reshape(x_shape) # Filter: [kernel_height, kernel_width, input_depth, output_depth] for kernel_height in range(1, 4): for kernel_width in range(1, 4): f_shape = [kernel_height, kernel_width, 2, 2] f = np.arange(np.prod(f_shape), dtype=np.float32).reshape(f_shape) for rate in range(1, 4): f_up = _upsample_filters(f, rate) kernel_height_up = (kernel_height + (kernel_height - 1) * (rate - 1)) kernel_width_up = kernel_width + (kernel_width - 1) * (rate - 1) for padding in ["SAME", "VALID"]: if padding == "SAME": y_shape = [2, height, width, 2] else: y_shape = [ 2, height + kernel_height_up - 1, width + kernel_width_up - 1, 2 ] y1 = nn_ops.atrous_conv2d_transpose(x, f, y_shape, rate, padding) y2 = nn_ops.conv2d_transpose( x, f_up, y_shape, strides=[1, 1, 1, 1], padding=padding) self.assertAllClose(y1.eval(), y2.eval(), rtol=1e-3, atol=1e-3) class AtrousDepthwiseConv2DTest(test.TestCase): def testAtrousDepthwiseConv2DForward(self): strides = [1, 1, 1, 1] with self.test_session(use_gpu=True): # Input: [batch, height, width, input_depth] height = 9 for width in [9, 10]: # Test both odd and even width. x_shape = [2, height, width, 2] x = np.arange(np.prod(x_shape), dtype=np.float32).reshape(x_shape) # Filter: [kernel_height, kernel_width, input_depth, output_depth] for kernel_height in range(1, 4): for kernel_width in range(1, 4): f_shape = [kernel_height, kernel_width, 2, 2] f = np.arange(np.prod(f_shape), dtype=np.float32).reshape(f_shape) for rate in range(1, 4): f_up = _upsample_filters(f, rate) for padding in ["SAME", "VALID"]: y1 = nn_impl.depthwise_conv2d( x, f, strides, padding, rate=[rate, rate]) y2 = nn_impl.depthwise_conv2d(x, f_up, strides, padding) self.assertAllClose(y1.eval(), y2.eval(), rtol=1e-3, atol=1e-3) if __name__ == "__main__": test.main()
apache-2.0
mbauskar/tele-frappe
frappe/core/page/user_permissions/user_permissions.py
32
3613
# Copyright (c) 2015, Frappe Technologies Pvt. Ltd. and Contributors # MIT License. See license.txt from __future__ import unicode_literals import frappe from frappe import _ import frappe.defaults import frappe.permissions from frappe.core.doctype.user.user import get_system_users from frappe.utils.csvutils import UnicodeWriter, read_csv_content_from_uploaded_file from frappe.defaults import clear_default @frappe.whitelist() def get_users_and_links(): return { "users": get_system_users(), "link_fields": get_doctypes_for_user_permissions() } @frappe.whitelist() def get_permissions(parent=None, defkey=None, defvalue=None): if defkey and not frappe.permissions.can_set_user_permissions(defkey, defvalue): raise frappe.PermissionError conditions, values = _build_conditions(locals()) permissions = frappe.db.sql("""select name, parent, defkey, defvalue from tabDefaultValue where parent not in ('__default', '__global') and substr(defkey,1,1)!='_' and parenttype='User Permission' {conditions} order by parent, defkey""".format(conditions=conditions), values, as_dict=True) if not defkey: out = [] doctypes = get_doctypes_for_user_permissions() for p in permissions: if p.defkey in doctypes: out.append(p) permissions = out return permissions def _build_conditions(filters): conditions = [] values = {} for key, value in filters.items(): if filters.get(key): conditions.append("and `{key}`=%({key})s".format(key=key)) values[key] = value return "\n".join(conditions), values @frappe.whitelist() def remove(user, name, defkey, defvalue): if not frappe.permissions.can_set_user_permissions(defkey, defvalue): frappe.throw(_("Cannot remove permission for DocType: {0} and Name: {1}").format( defkey, defvalue), frappe.PermissionError) frappe.permissions.remove_user_permission(defkey, defvalue, user, name) @frappe.whitelist() def add(user, defkey, defvalue): if not frappe.permissions.can_set_user_permissions(defkey, defvalue): frappe.throw(_("Cannot set permission for DocType: {0} and Name: {1}").format( defkey, defvalue), frappe.PermissionError) frappe.permissions.add_user_permission(defkey, defvalue, user, with_message=True) def get_doctypes_for_user_permissions(): user_roles = frappe.get_roles() condition = "" values = [] if "System Manager" not in user_roles: condition = """and exists(select `tabDocPerm`.name from `tabDocPerm` where `tabDocPerm`.parent=`tabDocType`.name and `tabDocPerm`.`set_user_permissions`=1 and `tabDocPerm`.role in ({roles}))""".format(roles=", ".join(["%s"]*len(user_roles))) values = user_roles return frappe.db.sql_list("""select name from tabDocType where ifnull(issingle,0)=0 and ifnull(istable,0)=0 {condition}""".format(condition=condition), tuple(values)) @frappe.whitelist() def get_user_permissions_csv(): out = [["User Permissions"], ["User", "Document Type", "Value"]] out += [[a.parent, a.defkey, a.defvalue] for a in get_permissions()] csv = UnicodeWriter() for row in out: csv.writerow(row) frappe.response['result'] = str(csv.getvalue()) frappe.response['type'] = 'csv' frappe.response['doctype'] = "User Permissions" @frappe.whitelist() def import_user_permissions(): frappe.only_for("System Manager") rows = read_csv_content_from_uploaded_file(ignore_encoding=True) clear_default(parenttype="User Permission") if rows[0][0]!="User Permissions" and rows[1][0] != "User": frappe.throw(frappe._("Please upload using the same template as download.")) for row in rows[2:]: frappe.permissions.add_user_permission(row[1], row[2], row[0])
mit
thinkopensolutions/odoo-brazil-banking
l10n_br_cnab400_import/models/account_bank_statement.py
3
2484
# -*- coding: utf-8 -*- ############################################################################## # # This module copyright (C) 2016 KMEE INFORMATICA LTDA # (<http://kmee.com.br>). # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## from decimal import Decimal from openerp import models, api, _ from openerp.tools.float_utils import float_repr from openerp.exceptions import Warning as UserError class AccountBankStatementLine(models.Model): _inherit = 'account.bank.statement.line' @api.model def get_reconcile_lines_from_cnab_move(self, this, excluded_ids=None): """return move.line to reconcile with statement line""" move_lines = self.env['account.move.line'].search( [('transaction_ref', '=', this.name), ('name', '=', this.ref) ]) try: assert len(move_lines) <= 1 except: raise UserError(_( "Erro!\n " "Nosso numero duplicado" )) return self.env['account.move.line']\ .prepare_move_lines_for_reconciliation_widget(move_lines) @api.model def get_reconciliation_proposition(self, this, excluded_ids=None): """See if we find a set payment order that matches our line. If yes, return all unreconciled lines from there""" reconcile_lines = self.get_reconcile_lines_from_cnab_move( this, excluded_ids=None) if reconcile_lines: return reconcile_lines elif this.bank_account_id.state == "cnab": return [] else: return super(AccountBankStatementLine, self)\ .get_reconciliation_proposition(this, excluded_ids=excluded_ids)
agpl-3.0
zifeishan/deepdive
src/test/python/test_ddext/output-1.py
15
2549
DROP TYPE IF EXISTS ret_func_ext_has_spouse_candidates CASCADE; CREATE TYPE ret_func_ext_has_spouse_candidates AS (person1_id text, person2_id text, sentence_id text, description text, is_true boolean, relation_id text); CREATE OR REPLACE FUNCTION func_ext_has_spouse_candidates( sentence_id text, p1_id text, p1_text text, p2_id text, p2_text text) RETURNS SETOF ret_func_ext_has_spouse_candidates AS $$ if 'csv' in SD: csv = SD['csv'] else: import csv SD['csv'] = csv if 'os' in SD: os = SD['os'] else: import os SD['os'] = os if 'defaultdict' in SD: defaultdict = SD['defaultdict'] else: from collections import defaultdict SD['defaultdict'] = defaultdict ####### NOTICE: SHARED MEMORY ######## # If you really need shared memory / global dir, do "from ddext import SD." # Use SD as the global shared dict. # Load the spouse dictionary for distant supervision spouses = defaultdict(lambda: None) if 'spouses' in SD: spouses = SD['spouses'] else: # Read data from file once, and share it SD['spouses'] = spouses # Read dict from file: MAKE SURE YOUR DATABASE SERVER # HAVE THE ACCESS TO FILE! # Please use absolute path! with open ("/dfs/rulk/0/deepdive/shared/spouses.csv") as csvfile: reader = csv.reader(csvfile) for line in reader: spouses[line[0].strip().lower()] = line[1].strip().lower() if 'non_spouses' in SD: non_spouses = SD['non_spouses'] else: non_spouses = set() SD['non_spouses'] = non_spouses lines = open('/dfs/rulk/0/deepdive/shared/non-spouses.tsv').readlines() for line in lines: name1, name2, relation = line.strip().split('\t') non_spouses.add((name1, name2)) # Add a non-spouse relation pair # NOTICE: PLPY DOES NOT ALLOW overwritting input arguments!!! # will return "UnboundLocalError". p1_t = p1_text.strip() p2_t = p2_text.strip() p1_text_lower = p1_t.lower() p2_text_lower = p2_t.lower() is_true = None if spouses[p1_text_lower] == p2_text_lower: is_true = True elif spouses[p2_text_lower] == p1_text_lower: is_true = True # same person elif (p1_t == p2_t) or (p1_t in p2_t) or (p2_t in p1_t): is_true = False elif (p1_text_lower, p2_text_lower) in non_spouses: is_true = False elif (p2_text_lower, p1_text_lower) in non_spouses: is_true = False # Must return a tuple of arrays. yield [p1_id, p2_id, sentence_id, "%s-%s" % (p1_t, p2_t), is_true, "%s_%s" % (p1_id, p2_id)] # return [[p1_id, p2_id, sentence_id, "%s-%s" % (p1_t, p2_t), is_true]] $$ LANGUAGE plpythonu ;
apache-2.0
Jonekee/chromium.src
third_party/typ/typ/fakes/tests/test_result_server_fake_test.py
81
1298
# Copyright 2014 Google Inc. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import unittest from typ.fakes import test_result_server_fake from typ import Host class TestResultServerFakeTest(unittest.TestCase): def test_basic_upload(self): host = Host() server = None posts = [] try: server = test_result_server_fake.start() url = 'http://%s:%d/testfile/upload' % server.server_address if server: resp = host.fetch(url, 'foo=bar') finally: if server: posts = server.stop() self.assertEqual(posts, [('post', '/testfile/upload', 'foo=bar'.encode('utf8'))]) self.assertNotEqual(server.log.getvalue(), '')
bsd-3-clause
phihag/youtube-dl
youtube_dl/extractor/gfycat.py
11
3695
# coding: utf-8 from __future__ import unicode_literals from .common import InfoExtractor from ..utils import ( int_or_none, float_or_none, qualities, ExtractorError, ) class GfycatIE(InfoExtractor): _VALID_URL = r'https?://(?:www\.)?gfycat\.com/(?:ifr/|gifs/detail/)?(?P<id>[^/?#]+)' _TESTS = [{ 'url': 'http://gfycat.com/DeadlyDecisiveGermanpinscher', 'info_dict': { 'id': 'DeadlyDecisiveGermanpinscher', 'ext': 'mp4', 'title': 'Ghost in the Shell', 'timestamp': 1410656006, 'upload_date': '20140914', 'uploader': 'anonymous', 'duration': 10.4, 'view_count': int, 'like_count': int, 'dislike_count': int, 'categories': list, 'age_limit': 0, } }, { 'url': 'http://gfycat.com/ifr/JauntyTimelyAmazontreeboa', 'info_dict': { 'id': 'JauntyTimelyAmazontreeboa', 'ext': 'mp4', 'title': 'JauntyTimelyAmazontreeboa', 'timestamp': 1411720126, 'upload_date': '20140926', 'uploader': 'anonymous', 'duration': 3.52, 'view_count': int, 'like_count': int, 'dislike_count': int, 'categories': list, 'age_limit': 0, } }, { 'url': 'https://gfycat.com/gifs/detail/UnconsciousLankyIvorygull', 'only_matching': True }] def _real_extract(self, url): video_id = self._match_id(url) gfy = self._download_json( 'http://gfycat.com/cajax/get/%s' % video_id, video_id, 'Downloading video info') if 'error' in gfy: raise ExtractorError('Gfycat said: ' + gfy['error'], expected=True) gfy = gfy['gfyItem'] title = gfy.get('title') or gfy['gfyName'] description = gfy.get('description') timestamp = int_or_none(gfy.get('createDate')) uploader = gfy.get('userName') view_count = int_or_none(gfy.get('views')) like_count = int_or_none(gfy.get('likes')) dislike_count = int_or_none(gfy.get('dislikes')) age_limit = 18 if gfy.get('nsfw') == '1' else 0 width = int_or_none(gfy.get('width')) height = int_or_none(gfy.get('height')) fps = int_or_none(gfy.get('frameRate')) num_frames = int_or_none(gfy.get('numFrames')) duration = float_or_none(num_frames, fps) if num_frames and fps else None categories = gfy.get('tags') or gfy.get('extraLemmas') or [] FORMATS = ('gif', 'webm', 'mp4') quality = qualities(FORMATS) formats = [] for format_id in FORMATS: video_url = gfy.get('%sUrl' % format_id) if not video_url: continue filesize = int_or_none(gfy.get('%sSize' % format_id)) formats.append({ 'url': video_url, 'format_id': format_id, 'width': width, 'height': height, 'fps': fps, 'filesize': filesize, 'quality': quality(format_id), }) self._sort_formats(formats) return { 'id': video_id, 'title': title, 'description': description, 'timestamp': timestamp, 'uploader': uploader, 'duration': duration, 'view_count': view_count, 'like_count': like_count, 'dislike_count': dislike_count, 'categories': categories, 'age_limit': age_limit, 'formats': formats, }
unlicense
defionscode/ansible
lib/ansible/modules/windows/win_whoami.py
52
5530
#!/usr/bin/python # -*- coding: utf-8 -*- # Copyright: (c) 2017, Ansible Project # GNU General Public License v3.0+ (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt) # this is a windows documentation stub. actual code lives in the .ps1 # file of the same name ANSIBLE_METADATA = {'metadata_version': '1.1', 'status': ['preview'], 'supported_by': 'community'} DOCUMENTATION = r''' --- module: win_whoami version_added: "2.5" short_description: Get information about the current user and process description: - Designed to return the same information as the C(whoami /all) command. - Also includes information missing from C(whoami) such as logon metadata like logon rights, id, type. notes: - If running this module with a non admin user, the logon rights will be an empty list as Administrator rights are required to query LSA for the information. author: - Jordan Borean (@jborean93) ''' EXAMPLES = r''' - name: get whoami information win_whoami: ''' RETURN = r''' authentication_package: description: The name of the authentication package used to authenticate the user in the session. returned: success type: str sample: Negotiate user_flags: description: The user flags for the logon session, see UserFlags in U(https://msdn.microsoft.com/en-us/library/windows/desktop/aa380128). returned: success type: str sample: Winlogon upn: description: The user principal name of the current user. returned: success type: str sample: Administrator@DOMAIN.COM logon_type: description: The logon type that identifies the logon method, see U(https://msdn.microsoft.com/en-us/library/windows/desktop/aa380129.aspx). returned: success type: str sample: Network privileges: description: A dictionary of privileges and their state on the logon token. returned: success type: dict sample: { "SeChangeNotifyPrivileges": "enabled-by-default", "SeRemoteShutdownPrivilege": "disabled", "SeDebugPrivilege": "enabled" } label: description: The mandatory label set to the logon session. returned: success type: complex contains: domain_name: description: The domain name of the label SID. returned: success type: str sample: Mandatory Label sid: description: The SID in string form. returned: success type: str sample: S-1-16-12288 account_name: description: The account name of the label SID. returned: success type: str sample: High Mandatory Level type: description: The type of SID. returned: success type: str sample: Label impersonation_level: description: The impersonation level of the token, only valid if C(token_type) is C(TokenImpersonation), see U(https://msdn.microsoft.com/en-us/library/windows/desktop/aa379572.aspx). returned: success type: str sample: SecurityAnonymous login_time: description: The logon time in ISO 8601 format returned: success type: str sample: '2017-11-27T06:24:14.3321665+10:00' groups: description: A list of groups and attributes that the user is a member of. returned: success type: list sample: [ { "account_name": "Domain Users", "domain_name": "DOMAIN", "attributes": [ "Mandatory", "Enabled by default", "Enabled" ], "sid": "S-1-5-21-1654078763-769949647-2968445802-513", "type": "Group" }, { "account_name": "Administrators", "domain_name": "BUILTIN", "attributes": [ "Mandatory", "Enabled by default", "Enabled", "Owner" ], "sid": "S-1-5-32-544", "type": "Alias" } ] account: description: The running account SID details. returned: success type: complex contains: domain_name: description: The domain name of the account SID. returned: success type: str sample: DOMAIN sid: description: The SID in string form. returned: success type: str sample: S-1-5-21-1654078763-769949647-2968445802-500 account_name: description: The account name of the account SID. returned: success type: str sample: Administrator type: description: The type of SID. returned: success type: str sample: User login_domain: description: The name of the domain used to authenticate the owner of the session. returned: success type: str sample: DOMAIN rights: description: A list of logon rights assigned to the logon. returned: success and running user is a member of the local Administrators group type: list sample: [ "SeNetworkLogonRight", "SeInteractiveLogonRight", "SeBatchLogonRight", "SeRemoteInteractiveLogonRight" ] logon_server: description: The name of the server used to authentcate the owner of the logon session. returned: success type: str sample: DC01 logon_id: description: The unique identifier of the logon session. returned: success type: int sample: 20470143 dns_domain_name: description: The DNS name of the logon session, this is an empty string if this is not set. returned: success type: str sample: DOMAIN.COM token_type: description: The token type to indicate whether it is a primary or impersonation token. returned: success type: str sample: TokenPrimary '''
gpl-3.0
avanzosc/odoo-addons
contacts_school/models/res_partner.py
2
13803
# Copyright 2019 Alfredo de la fuente - AvanzOSC # License AGPL-3 - See http://www.gnu.org/licenses/agpl-3.0.html from odoo import _, api, fields, models from odoo.exceptions import ValidationError EDU_CATEGORIES = [('federation', 'Federation'), ('association', 'Association'), ('school', 'School'), ('family', 'Family'), ('student', 'Student'), ('progenitor', 'Progenitor'), ('guardian', 'legal guardian'), ('otherchild', 'Other children'), ('pedagogical', 'Pedagogical company'), ('related', 'Related partner'), ('otherrelative', 'Other relative'), ('other', 'Other')] class ResPartner(models.Model): _inherit = 'res.partner' educational_category = fields.Selection( string='Educational category', selection=EDU_CATEGORIES, default='other') assoc_fede_ids = fields.One2many( comodel_name='res.partner.association.federation', inverse_name='parent_partner_id', string='Association/Federation') child2_ids = fields.One2many( comodel_name='res.partner.family', inverse_name='child2_id', string='Child Families') responsible_ids = fields.One2many( comodel_name='res.partner.family', inverse_name='responsible_id', string='Responsible Families') family_ids = fields.One2many( comodel_name='res.partner.family', inverse_name='family_id', string='Relatives') family = fields.Char(string='Family', readonly="1") old_student = fields.Boolean(string='Old student', default=False) employee_id = fields.Many2one( string='Related Employee', comodel_name='hr.employee', compute='_compute_employee', store=True) employee = fields.Boolean(compute='_compute_employee', store=True) student_characteristic_ids = fields.One2many( comodel_name='res.partner.student.characteristic', inverse_name='student_id', string='Student Characteristics') family_progenitor_ids = fields.Many2many( comodel_name='res.partner', relation='rel_family_progenitor', column1='family_id', column2='progenitor_id', compute='_compute_family_progenitor_ids', store=True, copy=False) student_progenitor_ids = fields.Many2many( comodel_name='res.partner', relation='rel_student_progenitor', column1='student_id', column2='progenitor_id', compute='_compute_student_progenitor_ids', store=True, copy=False, string="Responsible Relatives") progenitor_child_ids = fields.Many2many( comodel_name='res.partner', relation='rel_student_progenitor', column1='progenitor_id', column2='student_id', readonly=True, copy=False, string="Relative Students") bus_passenger = fields.Selection( selection=[("yes", "Yes"), ("no", "No")], string="Uses Bus") dinning_hall = fields.Selection( selection=[("school", "School Meal"), ("home", "Packed Lunch"), ("no", "No")], string="Uses School Dinning Hall") has_insurance = fields.Boolean(string="Has Insurance?") insured_partner_ids = fields.Many2many( comodel_name="res.partner", string="Insured Progenitors", relation="rel_student_insured", column1="student_id", column2="progenitor_id") insured_partner_count = fields.Integer( string="# Insured Progenitor", compute="_compute_insured_partner_count", store=True, compute_sudo=True, group_operator="max") @api.multi def name_get(self): """ name_get() -> [(id, name), ...] Returns a textual representation for the records in ``self``. By default this is the value of the ``display_name`` field. :return: list of pairs ``(id, text_repr)`` for each records :rtype: list(tuple) """ result = [] if not self.env.context.get('hide_progenitors', True): for record in self: name = record.name if record.family_progenitor_ids: progenitors = ', '.join( record.mapped('family_progenitor_ids.name')) name = '{} [{}]'.format(name, progenitors) result.append((record.id, name)) else: result = super(ResPartner, self).name_get() return result @api.model def create(self, vals): if vals.get('educational_category') == 'family': vals.update({ 'family': (self.env['ir.sequence'].next_by_code( 'res.partner.family') or _('New')) }) return super(ResPartner, self).create(vals) @api.depends('user_ids', 'user_ids.employee_ids') def _compute_employee(self): for record in self.filtered('user_ids'): record.employee_id = record.mapped('user_ids.employee_ids')[:1] record.employee = bool(record.employee_id) @api.depends('family_ids', 'family_ids.relation', 'family_ids.responsible_id', 'educational_category') def _compute_family_progenitor_ids(self): for family in self.filtered( lambda p: p.educational_category == 'family'): family.family_progenitor_ids = family.family_ids.filtered( lambda f: f.relation == 'progenitor').mapped('responsible_id') @api.depends('child2_ids', 'child2_ids.relation', 'child2_ids.responsible_id', 'educational_category') def _compute_student_progenitor_ids(self): for student in self.filtered( lambda p: p.educational_category == 'student'): student.student_progenitor_ids = student.child2_ids.filtered( lambda f: f.relation in ['progenitor', 'guardian'] ).mapped('responsible_id') @api.depends("insured_partner_ids") def _compute_insured_partner_count(self): for student in self.filtered( lambda p: p.educational_category == "student" and p.has_insurance): student.insured_partner_count = len(student.insured_partner_ids) @api.constrains('child2_ids') def _check_payers_percentage(self): for record in self.filtered('child2_ids'): if (any(record.child2_ids.filtered('payer')) and sum( record.child2_ids.filtered('payer').mapped( 'payment_percentage')) != 100.0): raise ValidationError( _('The sum of payers percentage must be 100.0')) @api.multi def check_payer_is_company(self): for record in self.filtered(lambda l: l.educational_category in ( 'progenitor', 'guardian', 'otherrelative')): record.is_company = any(record.mapped('responsible_ids.payer')) @api.multi def _get_notify_partners(self): self.ensure_one() if self.educational_category in ("student", "other_child"): contact_list = self.student_progenitor_ids elif self.educational_category in ("family"): contact_list = self.family_progenitor_ids else: contact_list = self return contact_list.filtered("email") or contact_list @api.multi def get_notify_email(self): self.ensure_one() contacts = self._get_notify_partners() return ",".join(contact.email for contact in contacts) @api.multi def get_notify_partner_ids(self): self.ensure_one() contacts = self._get_notify_partners() return ",".join(str(contact.id) for contact in contacts) class ResPartnerAssociationFederation(models.Model): _name = 'res.partner.association.federation' _description = 'Partner associations, and federations.' parent_partner_id = fields.Many2one( string='Partner parent', comodel_name='res.partner', required=True) partner_id = fields.Many2one( string='Association/Federation', comodel_name='res.partner', required=True) education_category = fields.Selection( string='Educational category', store=True, related='partner_id.educational_category') start_date = fields.Date(string='Start date') end_date = fields.Date(string='End date') notes = fields.Text(string="Notes") class ResPartnerFamily(models.Model): _name = 'res.partner.family' _description = 'Partner Family' _rec_name = 'child2_id' child2_id = fields.Many2one( string='Student', comodel_name='res.partner', required=True, domain=[('educational_category', 'in', ('student', 'other'))]) child2_educational_category = fields.Selection( string='Student Educational Category', related='child2_id.educational_category', store=True) responsible_id = fields.Many2one( string='Responsible', comodel_name='res.partner', required=True, domain=[('educational_category', 'in', ('progenitor', 'guardian', 'otherrelative'))]) is_company = fields.Boolean( string='Is a Company', related='responsible_id.is_company', store=True) responsible_educational_category = fields.Selection( string='Responsible educational category', related='responsible_id.educational_category', store=True) responsible_old_student = fields.Boolean( string='Responsible old student', related='responsible_id.old_student', store=True, readonly=False) relation = fields.Selection( string='Relation', selection=[('progenitor', 'Progenitor'), ('guardian', 'Legal Guardian'), ('otherrelative', 'Other relative')]) family_id = fields.Many2one( string='Family', comodel_name='res.partner', required=True, domain=[('educational_category', '=', 'family')]) family_educational_category = fields.Selection( string='Family educational category', related='family_id.educational_category', store=True) family_old_student = fields.Boolean( string='Family old student', related='family_id.old_student', store=True) payer = fields.Boolean(string='Is Payer?') payment_percentage = fields.Float(string='Percentage', default=100.0) payment_mode_id = fields.Many2one( string='Payment Mode', comodel_name='account.payment.mode', compute="compute_payment_mode", store=True) bank_id = fields.Many2one( string='Bank', comodel_name='res.partner.bank', domain="[('partner_id', '=', responsible_id)]") _sql_constraints = [ ('relation_unique', 'unique(child2_id,responsible_id,family_id)', 'Only one type of relation per student, relative and family!'), ] @api.model def create(self, values): result = super(ResPartnerFamily, self).create(values) if result.responsible_id: result.responsible_id.check_payer_is_company() return result @api.multi def write(self, values): result = super(ResPartnerFamily, self).write(values) if 'payer' in values or 'responsible_id' in values: self.mapped('responsible_id').check_payer_is_company() return result @api.constrains('payment_percentage') def _check_payment_percentage(self): for record in self.filtered('payer'): if (record.payment_percentage <= 0.0 or record.payment_percentage > 100.0): raise ValidationError( _("Percentage should be between 0.0 and 100.0")) @api.onchange('responsible_id', 'payer') def onchange_responsible_id(self): if self.responsible_id.bank_ids: self.bank_id = (self.responsible_id.bank_ids.filtered( lambda c: c.use_default)[:1] or self.responsible_id.bank_ids[:1]) @api.multi @api.depends("child2_id", "child2_id.company_id", "responsible_id", "responsible_id.customer_payment_mode_id") def compute_payment_mode(self): for record in self: record.payment_mode_id = record.responsible_id.with_context( force_company=record.child2_id.company_id.id ).customer_payment_mode_id class ResPartnerInformationType(models.Model): _name = 'res.partner.information.type' _description = 'Partner information type.' name = fields.Char( string='Description', required=True) class ResPartnerInformation(models.Model): _name = 'res.partner.information' _description = 'Partner information.' name = fields.Char( string='Description', required=True) type_id = fields.Many2one( string='Information type', comodel_name='res.partner.information.type') class ResPartnerStudentCharacteristic(models.Model): _name = 'res.partner.student.characteristic' _description = 'Student characteristic.' _rec_name = 'information_id' student_id = fields.Many2one( string='Student', comodel_name='res.partner', required=True, domain=[('educational_category', '=', 'student')]) information_id = fields.Many2one( string='Information', comodel_name='res.partner.information') type_id = fields.Many2one( string='Information type', comodel_name='res.partner.information.type', related='information_id.type_id', store=True) observations = fields.Text(string='Observations') dop_id = fields.Many2one( string='DOP', comodel_name='res.partner', domain=[('employee', '=', True)]) class ResPartnerBank(models.Model): _inherit = 'res.partner.bank' use_default = fields.Boolean(string='Use by default', default=False)
agpl-3.0
rossasa/server-tools
server_environment/__openerp__.py
17
3367
# -*- coding: utf-8 -*- ############################################################################## # # Adapted by Nicolas Bessi. Copyright Camptocamp SA # Based on Florent Xicluna original code. Copyright Wingo SA # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## { "name": "server configuration environment files", "version": "8.0.1.1.0", "depends": ["base", "server_environment_files"], "author": "Camptocamp,Odoo Community Association (OCA)", "description": """\ Environment file pattern for OpenERP ==================================== This module provides a classical configuration by environnement file pattern into OpenERP. Based on code written by WinGo and Camptocamp. This module allows you to use the classical environment file pattern by reading a directive call `running_env` in the OpenERP configuration file:: [options] running_env=dev / prod / etc. We intended to add a server command line but there is no correct way to do it. This method allows you to keep your settings into a module instead of using config files that might be mixed with openerprc or altered. It is an alternative way to the base config file for such configuration needs . All your configurations will be read only and accessible under the admin menu. If you are not in the 'dev' environment you will not be able to see the values contained in keys named 'passw'. At the current time, the module does not allow to set low level attributes such as database server, etc. . The first goal of the module is to ensure that OpenERP will never mess up the external system. Once installed, profile is mandatory. We do not want to launch an instance in the dev environment on a production server. The configuration files are stored in the `server_environment_files` module, and user config parser module syntax. Look at the module to get some examples. The `default` configuration are stored in the `default/` directory. You can add one directory for each environment you want to define, named after the environment. All config defined in non-default environments will override or complement the default config. If your attibutes contain `passw`, it will only be shown in the `dev` environment. Example usage ------------- :: from server_environment import serv_config for key, value in serv_config.items('external_service.ftp'): print (key, value) serv_config.get('external_service.ftp', 'tls') """, "website": "http://www.camptocamp.com", "license": "GPL-3 or any later version", "category": "Tools", "data": [ 'serv_config.xml', ], "installable": True, "active": False, }
agpl-3.0
boutiques/schema
tools/python/boutiques/tests/test_logger.py
1
2801
#!/usr/bin/env python import os import pytest import json import boutiques as bosh import boutiques.creator as bc from boutiques import __file__ as bfile from boutiques.localExec import ExecutorError from argparse import ArgumentParser from unittest import TestCase import mock from boutiques_mocks import mock_zenodo_search, MockZenodoRecord def mock_get(*args, **kwargs): query = args[0].split("=")[1] query = query[:query.find("&")] query = query.replace("*", '') mock_records = [] # Return an arbitrary list of results for i in range(0, 10): mock_records.append(MockZenodoRecord(i, "Example Tool %s" % i)) return mock_zenodo_search(mock_records) class TestLogger(TestCase): def get_examples_dir(self): return os.path.join(os.path.dirname(bfile), "schema", "examples") def test_raise_error(self): example1_dir = os.path.join(self.get_examples_dir(), "example1") invocationStr = open(os.path.join(example1_dir, "invocation_invalid.json")).read() with pytest.raises(ExecutorError) as e: bosh.execute("launch", os.path.join(example1_dir, "example1_docker.json"), invocationStr) assert("[ ERROR ]" in str(e)) @mock.patch('requests.get', side_effect=mock_get) def test_print_info(self, mock_get): bosh.search("-v") out, err = self.capfd.readouterr() assert("[ INFO ]" in out) assert("[ INFO (200) " in out) def test_print_warning(self): parser = ArgumentParser(description="my tool description") parser.add_argument("--myarg", "-m", action="store", help="my help", dest="==SUPPRESS==") creatorObj = bc.CreateDescriptor(parser, execname='/path/to/myscript.py', verbose=True, tags={"purpose": "testing-creator", "foo": "bar"}) out, err = self.capfd.readouterr() assert("[ WARNING ]" in out) def test_evaloutput(self): example1_dir = os.path.join(self.get_examples_dir(), "example1") desc = os.path.join(example1_dir, "example1_docker.json") invo = os.path.join(example1_dir, "invocation.json") query = bosh.evaluate(desc, invo, "invalid-query") out, err = self.capfd.readouterr() assert("[ ERROR ]" in out) # Captures the stdout and stderr during test execution # and returns them as a tuple in readouterr() @pytest.fixture(autouse=True) def capfd(self, capfd): self.capfd = capfd
gpl-2.0
jgeskens/django
django/contrib/gis/tests/geoadmin/tests.py
5
2490
from __future__ import absolute_import from django.test import TestCase from django.contrib.gis.geos import HAS_GEOS from django.contrib.gis.tests.utils import HAS_SPATIAL_DB from django.utils.unittest import skipUnless if HAS_GEOS and HAS_SPATIAL_DB: from django.contrib.gis import admin from django.contrib.gis.geos import Point from .models import City @skipUnless(HAS_GEOS and HAS_SPATIAL_DB, "Geos and spatial db are required.") class GeoAdminTest(TestCase): urls = 'django.contrib.gis.tests.geoadmin.urls' def test_ensure_geographic_media(self): geoadmin = admin.site._registry[City] admin_js = geoadmin.media.render_js() self.assertTrue(any([geoadmin.openlayers_url in js for js in admin_js])) def test_olmap_OSM_rendering(self): geoadmin = admin.site._registry[City] result = geoadmin.get_map_widget(City._meta.get_field('point'))( ).render('point', Point(-79.460734, 40.18476)) self.assertIn( """geodjango_point.layers.base = new OpenLayers.Layer.OSM("OpenStreetMap (Mapnik)");""", result) def test_olmap_WMS_rendering(self): geoadmin = admin.GeoModelAdmin(City, admin.site) result = geoadmin.get_map_widget(City._meta.get_field('point'))( ).render('point', Point(-79.460734, 40.18476)) self.assertIn( """geodjango_point.layers.base = new OpenLayers.Layer.WMS("OpenLayers WMS", "http://vmap0.tiles.osgeo.org/wms/vmap0", {layers: \'basic\', format: 'image/jpeg'});""", result) def test_olwidget_has_changed(self): """ Check that changes are accurately noticed by OpenLayersWidget. """ geoadmin = admin.site._registry[City] form = geoadmin.get_changelist_form(None)() has_changed = form.fields['point']._has_changed initial = Point(13.4197458572965953, 52.5194108501149799, srid=4326) data_same = "SRID=3857;POINT(1493879.2754093995 6894592.019687599)" data_almost_same = "SRID=3857;POINT(1493879.2754093990 6894592.019687590)" data_changed = "SRID=3857;POINT(1493884.0527237 6894593.8111804)" self.assertTrue(has_changed(None, data_changed)) self.assertTrue(has_changed(initial, "")) self.assertFalse(has_changed(None, "")) self.assertFalse(has_changed(initial, data_same)) self.assertFalse(has_changed(initial, data_almost_same)) self.assertTrue(has_changed(initial, data_changed))
bsd-3-clause
pradyunsg/dotfiles
lib/checker.py
1
5820
import os import sys import shutil import platform from .logging import Logger, log from .utils import run_output import click import yaml class SystemChecker(object): """A super-fancy helper for checking the system configuration """ def __init__(self, verbose): super().__init__() self._logger = Logger() self.verbose = verbose def _log_happy(self, msg): self._logger.spaced_status("pass", msg, fit_width=4) def _log_angry(self, msg, is_warning): if is_warning: self._logger.spaced_status("warn", msg, fit_width=4) else: self._logger.spaced_status("fail", msg, fit_width=4) def platform(self): return platform.system() def equal(self, expected, *, should_warn=False, **kwargs): """Check if a given value for something is equal to the expected value. checker.equal(value, name=from_system) """ assert len(kwargs) == 1, "expected 1 keyword argument" name, value = next(iter(kwargs.items())) if value == expected: self._log_happy(name + " is correct") else: self._log_angry( f"{name} is not {expected!r}, it is {value!r}", is_warning=should_warn, ) # The actual logic is below def run(self, fname): data = self._load_yaml(fname) self._check_username(data["identity"]["username"]) self._check_ssh(data["identity"]["ssh-key"]) self._check_gpg(data["identity"]["gpg-key"]) for category, contents in data["things"].items(): self._check_category(category, contents, data) def _load_yaml(self, fname): with open(fname) as f: try: return yaml.safe_load(f) except Exception as e: click.secho("ERROR: Could not parse file.", fg="red") click.secho(str(e), fg="red") sys.exit(1) def _check_username(self, expected): self.equal(expected, Username=os.environ["USER"]) def _check_ssh(self, expected): # FIXME: Is this fragile? output = run_output("ssh-keygen -E md5 -lf {}".format( os.path.expanduser("~/.ssh/id_rsa.pub") )) if output is None: ssh_key = "not found" else: ssh_key = output.split()[1] if ssh_key.startswith("MD5:"): ssh_key = ssh_key[4:] self.equal(expected, **{"SSH key": ssh_key}) def _check_gpg(self, expected): # This checks that the GPG key exists in the dB output = run_output("gpg --list-keys {}".format(expected)) if output is not None: self.equal(expected, **{"GPG key": expected}) else: self.equal(expected, **{"GPG key": "not found"}) def _check_category(self, category, contents, data): if "if" in contents: if list(contents["if"]) != ["platform"]: raise ValueError( "Needed condition of category {} to be 'platform'" .format(category) ) if contents["if"]["platform"] != self.platform(): log.spaced_status("skip", category) return log.spaced_status("topic", category, fit_width=5) with log: self._check_executables( category, contents.get("executables", None) ) self._check_run_items( category, contents.get("run_check", None), data ) def _check_executables(self, category, executables): if not executables: return # Convert the string to a list. executables = list(map(lambda x: x.strip(), executables.split(","))) missing = set() for fname in executables: if shutil.which(fname) is None: missing.add(fname) verb = lambda x: "executable" if len(x) == 1 else "executables" if missing: desc = "missing {}: {}".format( verb(missing), ", ".join(map(repr, missing)) ) log.spaced_status("fail", desc, fit_width=4) else: log.spaced_status( "pass", "{} {} available".format(len(executables), verb(executables)), fit_width=4, ) def _check_run_items(self, category, run_items, data): if not run_items: return for name, cmd_dict in run_items.items(): if not isinstance(cmd_dict, dict) or "cmd" not in cmd_dict: log.spaced_status( "warn", f"!!! invalid !!! {category} {name}", fit_width=4 ) continue got = run_output(cmd_dict["cmd"]) if got is None: # Did not exit cleanly ok = False reason = "command did not succeed" elif "equal" in cmd_dict: # Match the output against an expected value... expected = cmd_dict["equal"] # Perform substitution (from values earlier in the dict) if expected.startswith("$"): expected = _dotted_access(data, expected[1:]) ok = expected == got.rstrip() reason = f"{expected!r} != {got!r}" if ok: log.spaced_status("pass", name, fit_width=4) else: log.spaced_status("fail", name, fit_width=4) if self.verbose: with log: log.info(reason) def _dotted_access(data, spec): item = data for part in spec.split("."): item = item[part] return item
mit
loveyoupeng/rt
modules/web/src/main/native/Tools/Scripts/webkitpy/common/checksvnconfigfile.py
135
2718
# Copyright (C) 2012 Balazs Ankes (bank@inf.u-szeged.hu) University of Szeged # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions # are met: # 1. Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # 2. Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. # This file is used by: # webkitpy/tool/steps/addsvnmimetypeforpng.py # webkitpy/style/checkers/png.py import os import re def check(host, fs): """ check the svn config file return with three logical value: is svn config file missing, is auto-props missing, is the svn:mime-type for png missing """ cfg_file_path = config_file_path(host, fs) try: config_file = fs.read_text_file(cfg_file_path) except IOError: return (True, True, True) errorcode_autoprop = not re.search("^\s*enable-auto-props\s*=\s*yes", config_file, re.MULTILINE) errorcode_png = not re.search("^\s*\*\.png\s*=\s*svn:mime-type=image/png", config_file, re.MULTILINE) return (False, errorcode_autoprop, errorcode_png) def config_file_path(host, fs): if host.platform.is_win(): config_file_path = fs.join(os.environ['APPDATA'], "Subversion", "config") else: config_file_path = fs.join(fs.expanduser("~"), ".subversion", "config") return config_file_path def errorstr_autoprop(config_file_path): return 'Have to enable auto props in the subversion config file (%s "enable-auto-props = yes"). ' % config_file_path def errorstr_png(config_file_path): return 'Have to set the svn:mime-type in the subversion config file (%s "*.png = svn:mime-type=image/png").' % config_file_path
gpl-2.0
tuhangdi/django
tests/runtests.py
44
16943
#!/usr/bin/env python import atexit import copy import logging import os import shutil import subprocess import sys import tempfile import warnings from argparse import ArgumentParser import django from django.apps import apps from django.conf import settings from django.db import connection, connections from django.test import TestCase, TransactionTestCase from django.test.runner import default_test_processes from django.test.utils import get_runner from django.utils import six from django.utils._os import upath from django.utils.deprecation import RemovedInDjango20Warning from django.utils.log import DEFAULT_LOGGING warnings.simplefilter("error", RemovedInDjango20Warning) RUNTESTS_DIR = os.path.abspath(os.path.dirname(upath(__file__))) TEMPLATE_DIR = os.path.join(RUNTESTS_DIR, 'templates') # Create a specific subdirectory for the duration of the test suite. TMPDIR = tempfile.mkdtemp(prefix='django_') # Set the TMPDIR environment variable in addition to tempfile.tempdir # so that children processes inherit it. tempfile.tempdir = os.environ['TMPDIR'] = TMPDIR # Removing the temporary TMPDIR. Ensure we pass in unicode so that it will # successfully remove temp trees containing non-ASCII filenames on Windows. # (We're assuming the temp dir name itself only contains ASCII characters.) atexit.register(shutil.rmtree, six.text_type(TMPDIR)) SUBDIRS_TO_SKIP = [ 'data', 'import_error_package', 'test_discovery_sample', 'test_discovery_sample2', 'test_runner_deprecation_app', ] ALWAYS_INSTALLED_APPS = [ 'django.contrib.contenttypes', 'django.contrib.auth', 'django.contrib.sites', 'django.contrib.sessions', 'django.contrib.messages', 'django.contrib.admin.apps.SimpleAdminConfig', 'django.contrib.staticfiles', ] ALWAYS_MIDDLEWARE_CLASSES = [ 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.common.CommonMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware', ] # Need to add the associated contrib app to INSTALLED_APPS in some cases to # avoid "RuntimeError: Model class X doesn't declare an explicit app_label # and either isn't in an application in INSTALLED_APPS or else was imported # before its application was loaded." CONTRIB_TESTS_TO_APPS = { 'flatpages_tests': 'django.contrib.flatpages', 'redirects_tests': 'django.contrib.redirects', } def get_test_modules(): modules = [] discovery_paths = [ (None, RUNTESTS_DIR), # GIS tests are in nested apps ('gis_tests', os.path.join(RUNTESTS_DIR, 'gis_tests')), ] for modpath, dirpath in discovery_paths: for f in os.listdir(dirpath): if ('.' in f or os.path.basename(f) in SUBDIRS_TO_SKIP or os.path.isfile(f) or not os.path.exists(os.path.join(dirpath, f, '__init__.py'))): continue modules.append((modpath, f)) return modules def get_installed(): return [app_config.name for app_config in apps.get_app_configs()] def setup(verbosity, test_labels, parallel): if verbosity >= 1: msg = "Testing against Django installed in '%s'" % os.path.dirname(django.__file__) max_parallel = default_test_processes() if parallel == 0 else parallel if max_parallel > 1: msg += " with up to %d processes" % max_parallel print(msg) # Force declaring available_apps in TransactionTestCase for faster tests. def no_available_apps(self): raise Exception("Please define available_apps in TransactionTestCase " "and its subclasses.") TransactionTestCase.available_apps = property(no_available_apps) TestCase.available_apps = None state = { 'INSTALLED_APPS': settings.INSTALLED_APPS, 'ROOT_URLCONF': getattr(settings, "ROOT_URLCONF", ""), 'TEMPLATES': settings.TEMPLATES, 'LANGUAGE_CODE': settings.LANGUAGE_CODE, 'STATIC_URL': settings.STATIC_URL, 'STATIC_ROOT': settings.STATIC_ROOT, 'MIDDLEWARE_CLASSES': settings.MIDDLEWARE_CLASSES, } # Redirect some settings for the duration of these tests. settings.INSTALLED_APPS = ALWAYS_INSTALLED_APPS settings.ROOT_URLCONF = 'urls' settings.STATIC_URL = '/static/' settings.STATIC_ROOT = os.path.join(TMPDIR, 'static') settings.TEMPLATES = [{ 'BACKEND': 'django.template.backends.django.DjangoTemplates', 'DIRS': [TEMPLATE_DIR], 'APP_DIRS': True, 'OPTIONS': { 'context_processors': [ 'django.template.context_processors.debug', 'django.template.context_processors.request', 'django.contrib.auth.context_processors.auth', 'django.contrib.messages.context_processors.messages', ], }, }] settings.LANGUAGE_CODE = 'en' settings.SITE_ID = 1 settings.MIDDLEWARE_CLASSES = ALWAYS_MIDDLEWARE_CLASSES settings.MIGRATION_MODULES = { # these 'tests.migrations' modules don't actually exist, but this lets # us skip creating migrations for the test models. 'auth': 'django.contrib.auth.tests.migrations', 'contenttypes': 'contenttypes_tests.migrations', 'sessions': 'sessions_tests.migrations', } log_config = copy.deepcopy(DEFAULT_LOGGING) # Filter out non-error logging so we don't have to capture it in lots of # tests. log_config['loggers']['django']['level'] = 'ERROR' settings.LOGGING = log_config if verbosity > 0: # Ensure any warnings captured to logging are piped through a verbose # logging handler. If any -W options were passed explicitly on command # line, warnings are not captured, and this has no effect. logger = logging.getLogger('py.warnings') handler = logging.StreamHandler() logger.addHandler(handler) warnings.filterwarnings( 'ignore', 'The GeoManager class is deprecated.', RemovedInDjango20Warning ) # Load all the ALWAYS_INSTALLED_APPS. django.setup() # Load all the test model apps. test_modules = get_test_modules() # Reduce given test labels to just the app module path test_labels_set = set() for label in test_labels: bits = label.split('.')[:1] test_labels_set.add('.'.join(bits)) installed_app_names = set(get_installed()) for modpath, module_name in test_modules: if modpath: module_label = '.'.join([modpath, module_name]) else: module_label = module_name # if the module (or an ancestor) was named on the command line, or # no modules were named (i.e., run all), import # this module and add it to INSTALLED_APPS. if not test_labels: module_found_in_labels = True else: module_found_in_labels = any( # exact match or ancestor match module_label == label or module_label.startswith(label + '.') for label in test_labels_set) if module_name in CONTRIB_TESTS_TO_APPS and module_found_in_labels: settings.INSTALLED_APPS.append(CONTRIB_TESTS_TO_APPS[module_name]) if module_found_in_labels and module_label not in installed_app_names: if verbosity >= 2: print("Importing application %s" % module_name) settings.INSTALLED_APPS.append(module_label) # Add contrib.gis to INSTALLED_APPS if needed (rather than requiring # @override_settings(INSTALLED_APPS=...) on all test cases. gis = 'django.contrib.gis' if connection.features.gis_enabled and gis not in settings.INSTALLED_APPS: if verbosity >= 2: print("Importing application %s" % gis) settings.INSTALLED_APPS.append(gis) apps.set_installed_apps(settings.INSTALLED_APPS) return state def teardown(state): # Restore the old settings. for key, value in state.items(): setattr(settings, key, value) def actual_test_processes(parallel): if parallel == 0: # This doesn't work before django.setup() on some databases. if all(conn.features.can_clone_databases for conn in connections.all()): return default_test_processes() else: return 1 else: return parallel def django_tests(verbosity, interactive, failfast, keepdb, reverse, test_labels, debug_sql, parallel): state = setup(verbosity, test_labels, parallel) extra_tests = [] # Run the test suite, including the extra validation tests. if not hasattr(settings, 'TEST_RUNNER'): settings.TEST_RUNNER = 'django.test.runner.DiscoverRunner' TestRunner = get_runner(settings) test_runner = TestRunner( verbosity=verbosity, interactive=interactive, failfast=failfast, keepdb=keepdb, reverse=reverse, debug_sql=debug_sql, parallel=actual_test_processes(parallel), ) failures = test_runner.run_tests( test_labels or get_installed(), extra_tests=extra_tests, ) teardown(state) return failures def bisect_tests(bisection_label, options, test_labels): state = setup(options.verbosity, test_labels) test_labels = test_labels or get_installed() print('***** Bisecting test suite: %s' % ' '.join(test_labels)) # Make sure the bisection point isn't in the test list # Also remove tests that need to be run in specific combinations for label in [bisection_label, 'model_inheritance_same_model_name']: try: test_labels.remove(label) except ValueError: pass subprocess_args = [ sys.executable, upath(__file__), '--settings=%s' % options.settings] if options.failfast: subprocess_args.append('--failfast') if options.verbosity: subprocess_args.append('--verbosity=%s' % options.verbosity) if not options.interactive: subprocess_args.append('--noinput') iteration = 1 while len(test_labels) > 1: midpoint = len(test_labels) // 2 test_labels_a = test_labels[:midpoint] + [bisection_label] test_labels_b = test_labels[midpoint:] + [bisection_label] print('***** Pass %da: Running the first half of the test suite' % iteration) print('***** Test labels: %s' % ' '.join(test_labels_a)) failures_a = subprocess.call(subprocess_args + test_labels_a) print('***** Pass %db: Running the second half of the test suite' % iteration) print('***** Test labels: %s' % ' '.join(test_labels_b)) print('') failures_b = subprocess.call(subprocess_args + test_labels_b) if failures_a and not failures_b: print("***** Problem found in first half. Bisecting again...") iteration = iteration + 1 test_labels = test_labels_a[:-1] elif failures_b and not failures_a: print("***** Problem found in second half. Bisecting again...") iteration = iteration + 1 test_labels = test_labels_b[:-1] elif failures_a and failures_b: print("***** Multiple sources of failure found") break else: print("***** No source of failure found... try pair execution (--pair)") break if len(test_labels) == 1: print("***** Source of error: %s" % test_labels[0]) teardown(state) def paired_tests(paired_test, options, test_labels): state = setup(options.verbosity, test_labels) test_labels = test_labels or get_installed() print('***** Trying paired execution') # Make sure the constant member of the pair isn't in the test list # Also remove tests that need to be run in specific combinations for label in [paired_test, 'model_inheritance_same_model_name']: try: test_labels.remove(label) except ValueError: pass subprocess_args = [ sys.executable, upath(__file__), '--settings=%s' % options.settings] if options.failfast: subprocess_args.append('--failfast') if options.verbosity: subprocess_args.append('--verbosity=%s' % options.verbosity) if not options.interactive: subprocess_args.append('--noinput') for i, label in enumerate(test_labels): print('***** %d of %d: Check test pairing with %s' % ( i + 1, len(test_labels), label)) failures = subprocess.call(subprocess_args + [label, paired_test]) if failures: print('***** Found problem pair with %s' % label) return print('***** No problem pair found') teardown(state) if __name__ == "__main__": parser = ArgumentParser(description="Run the Django test suite.") parser.add_argument('modules', nargs='*', metavar='module', help='Optional path(s) to test modules; e.g. "i18n" or ' '"i18n.tests.TranslationTests.test_lazy_objects".') parser.add_argument( '-v', '--verbosity', default=1, type=int, choices=[0, 1, 2, 3], help='Verbosity level; 0=minimal output, 1=normal output, 2=all output') parser.add_argument( '--noinput', action='store_false', dest='interactive', default=True, help='Tells Django to NOT prompt the user for input of any kind.') parser.add_argument( '--failfast', action='store_true', dest='failfast', default=False, help='Tells Django to stop running the test suite after first failed ' 'test.') parser.add_argument( '-k', '--keepdb', action='store_true', dest='keepdb', default=False, help='Tells Django to preserve the test database between runs.') parser.add_argument( '--settings', help='Python path to settings module, e.g. "myproject.settings". If ' 'this isn\'t provided, either the DJANGO_SETTINGS_MODULE ' 'environment variable or "test_sqlite" will be used.') parser.add_argument('--bisect', help='Bisect the test suite to discover a test that causes a test ' 'failure when combined with the named test.') parser.add_argument('--pair', help='Run the test suite in pairs with the named test to find problem ' 'pairs.') parser.add_argument('--reverse', action='store_true', default=False, help='Sort test suites and test cases in opposite order to debug ' 'test side effects not apparent with normal execution lineup.') parser.add_argument('--liveserver', help='Overrides the default address where the live server (used with ' 'LiveServerTestCase) is expected to run from. The default value ' 'is localhost:8081-8179.') parser.add_argument( '--selenium', action='store_true', dest='selenium', default=False, help='Run the Selenium tests as well (if Selenium is installed).') parser.add_argument( '--debug-sql', action='store_true', dest='debug_sql', default=False, help='Turn on the SQL query logger within tests.') parser.add_argument( '--parallel', dest='parallel', nargs='?', default=0, type=int, const=default_test_processes(), help='Run tests in parallel processes.') options = parser.parse_args() # mock is a required dependency try: from django.test import mock # NOQA except ImportError: print( "Please install test dependencies first: \n" "$ pip install -r requirements/py%s.txt" % sys.version_info.major ) sys.exit(1) # Allow including a trailing slash on app_labels for tab completion convenience options.modules = [os.path.normpath(labels) for labels in options.modules] if options.settings: os.environ['DJANGO_SETTINGS_MODULE'] = options.settings else: if "DJANGO_SETTINGS_MODULE" not in os.environ: os.environ['DJANGO_SETTINGS_MODULE'] = 'test_sqlite' options.settings = os.environ['DJANGO_SETTINGS_MODULE'] if options.liveserver is not None: os.environ['DJANGO_LIVE_TEST_SERVER_ADDRESS'] = options.liveserver if options.selenium: os.environ['DJANGO_SELENIUM_TESTS'] = '1' if options.bisect: bisect_tests(options.bisect, options, options.modules) elif options.pair: paired_tests(options.pair, options, options.modules) else: failures = django_tests(options.verbosity, options.interactive, options.failfast, options.keepdb, options.reverse, options.modules, options.debug_sql, options.parallel) if failures: sys.exit(bool(failures))
bsd-3-clause
vvv1559/intellij-community
python/helpers/pydev/_pydev_bundle/_pydev_calltip_util.py
33
4916
''' License: Apache 2.0 Author: Yuli Fitterman ''' # noinspection PyBroadException import types from _pydevd_bundle.pydevd_constants import IS_JYTHON, IS_PY3K try: import inspect except: try: from _pydev_imps import _pydev_inspect as inspect except: import traceback; traceback.print_exc() # Ok, no inspect available (search will not work)from _pydevd_bundle.pydevd_constants import IS_JYTHON, IS_PY3K from _pydev_bundle._pydev_imports_tipper import signature_from_docstring def is_bound_method(obj): if isinstance(obj, types.MethodType): return getattr(obj, '__self__', getattr(obj, 'im_self', None)) is not None else: return False def get_class_name(instance): return getattr(getattr(instance, "__class__", None), "__name__", None) def get_bound_class_name(obj): my_self = getattr(obj, '__self__', getattr(obj, 'im_self', None)) if my_self is None: return None return get_class_name(my_self) def get_description(obj): try: ob_call = obj.__call__ except: ob_call = None if isinstance(obj, type) or type(obj).__name__ == 'classobj': fob = getattr(obj, '__init__', lambda: None) if not isinstance(fob, (types.FunctionType, types.MethodType)): fob = obj elif is_bound_method(ob_call): fob = ob_call else: fob = obj argspec = "" fn_name = None fn_class = None if isinstance(fob, (types.FunctionType, types.MethodType)): spec_info = inspect.getfullargspec(fob) if IS_PY3K else inspect.getargspec(fob) argspec = inspect.formatargspec(*spec_info) fn_name = getattr(fob, '__name__', None) if isinstance(obj, type) or type(obj).__name__ == 'classobj': fn_name = "__init__" fn_class = getattr(obj, "__name__", "UnknownClass") elif is_bound_method(obj) or is_bound_method(ob_call): fn_class = get_bound_class_name(obj) or "UnknownClass" else: fn_name = getattr(fob, '__name__', None) fn_self = getattr(fob, '__self__', None) if fn_self is not None and not isinstance(fn_self, types.ModuleType): fn_class = get_class_name(fn_self) doc_string = get_docstring(ob_call) if is_bound_method(ob_call) else get_docstring(obj) return create_method_stub(fn_name, fn_class, argspec, doc_string) def create_method_stub(fn_name, fn_class, argspec, doc_string): if fn_name and argspec: doc_string = "" if doc_string is None else doc_string fn_stub = create_function_stub(fn_name, argspec, doc_string, indent=1 if fn_class else 0) if fn_class: expr = fn_class if fn_name == '__init__' else fn_class + '().' + fn_name return create_class_stub(fn_class, fn_stub) + "\n" + expr else: expr = fn_name return fn_stub + "\n" + expr elif doc_string: if fn_name: restored_signature, _ = signature_from_docstring(doc_string, fn_name) if restored_signature: return create_method_stub(fn_name, fn_class, restored_signature, doc_string) return create_function_stub('unknown', '(*args, **kwargs)', doc_string) + '\nunknown' else: return '' def get_docstring(obj): if obj is not None: try: if IS_JYTHON: # Jython doc = obj.__doc__ if doc is not None: return doc from _pydev_bundle import _pydev_jy_imports_tipper is_method, infos = _pydev_jy_imports_tipper.ismethod(obj) ret = '' if is_method: for info in infos: ret += info.get_as_doc() return ret else: doc = inspect.getdoc(obj) if doc is not None: return doc except: pass else: return '' try: # if no attempt succeeded, try to return repr()... return repr(obj) except: try: # otherwise the class return str(obj.__class__) except: # if all fails, go to an empty string return '' def create_class_stub(class_name, contents): return "class %s(object):\n%s" % (class_name, contents) def create_function_stub(fn_name, fn_argspec, fn_docstring, indent=0): def shift_right(string, prefix): return ''.join(prefix + line for line in string.splitlines(True)) fn_docstring = shift_right(inspect.cleandoc(fn_docstring), " " * (indent + 1)) ret = ''' def %s%s: """%s""" pass ''' % (fn_name, fn_argspec, fn_docstring) ret = ret[1:] # remove first /n ret = ret.replace('\t', " ") if indent: prefix = " " * indent ret = shift_right(ret, prefix) return ret
apache-2.0
Jgarcia-IAS/ReporsitorioVacioOdoo
openerp/addons/point_of_sale/wizard/__init__.py
382
1200
# -*- coding: utf-8 -*- ############################################################################## # # OpenERP, Open Source Management Solution # Copyright (C) 2004-2010 Tiny SPRL (<http://tiny.be>). # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## import pos_box import pos_confirm import pos_details import pos_discount import pos_open_statement import pos_payment import pos_session_opening # vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
agpl-3.0
Djabbz/wakatime
wakatime/packages/requests/packages/chardet/utf8prober.py
2919
2652
######################## BEGIN LICENSE BLOCK ######################## # The Original Code is mozilla.org code. # # The Initial Developer of the Original Code is # Netscape Communications Corporation. # Portions created by the Initial Developer are Copyright (C) 1998 # the Initial Developer. All Rights Reserved. # # Contributor(s): # Mark Pilgrim - port to Python # # This library is free software; you can redistribute it and/or # modify it under the terms of the GNU Lesser General Public # License as published by the Free Software Foundation; either # version 2.1 of the License, or (at your option) any later version. # # This library is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this library; if not, write to the Free Software # Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA # 02110-1301 USA ######################### END LICENSE BLOCK ######################### from . import constants from .charsetprober import CharSetProber from .codingstatemachine import CodingStateMachine from .mbcssm import UTF8SMModel ONE_CHAR_PROB = 0.5 class UTF8Prober(CharSetProber): def __init__(self): CharSetProber.__init__(self) self._mCodingSM = CodingStateMachine(UTF8SMModel) self.reset() def reset(self): CharSetProber.reset(self) self._mCodingSM.reset() self._mNumOfMBChar = 0 def get_charset_name(self): return "utf-8" def feed(self, aBuf): for c in aBuf: codingState = self._mCodingSM.next_state(c) if codingState == constants.eError: self._mState = constants.eNotMe break elif codingState == constants.eItsMe: self._mState = constants.eFoundIt break elif codingState == constants.eStart: if self._mCodingSM.get_current_charlen() >= 2: self._mNumOfMBChar += 1 if self.get_state() == constants.eDetecting: if self.get_confidence() > constants.SHORTCUT_THRESHOLD: self._mState = constants.eFoundIt return self.get_state() def get_confidence(self): unlike = 0.99 if self._mNumOfMBChar < 6: for i in range(0, self._mNumOfMBChar): unlike = unlike * ONE_CHAR_PROB return 1.0 - unlike else: return unlike
bsd-3-clause
monash-merc/cvl-fabric-launcher
IconPys/MASSIVElogoTransparent144x144.py
4
27769
#---------------------------------------------------------------------- # This file was generated by /usr/local/bin/img2py # from wx.lib.embeddedimage import PyEmbeddedImage MASSIVElogoTransparent144x144 = PyEmbeddedImage( "iVBORw0KGgoAAAANSUhEUgAAAJAAAACQCAYAAADnRuK4AAAD9GlDQ1BJQ0MgUHJvZmlsZQAA" "eNqNlM9vFGUYxz+7886sCTgHUwGLwYk/gJBCtmCQBkF3u8u2UMtm22LbmJjt7NvdsdPZ8Z3Z" "8iM9cdEbqH+Aihw8mHgywV8RLsBBAwlBQ2xITDiU+CNEEi6G1MNMdwdoxff0zPN+n+/3+zzv" "k4HM51Xfd9MWzHqhqpTy1vjEpJW5QZpnWEM3a6p24OfK5SGAqu+7PHLu/UwK4Nr2le//86yp" "ycCG1BNAsxbYs5A6Brpr+yoE4xaw52joh5B5FuhS4xOTkMkCXfUoLgBdU1E8DnSp0Uo/ZFzA" "tBvVGmTmgZ6pRL6eiCMPAHSVpCeVY1uVUt4qq+a048qE3cdc/88z67aW9TYBa4OZkUPAVkgd" "a6iBShx/YleLI8CLkLrsh/kKsBlSf7RmxnLANkg/Na0OjEX49KsnGqNvAusgXXPCwdE4f8Kb" "Gj4c1abPzDQPVWLMZTvonwSeh/TNhhwcivxo1GShCPSAtqnRGoj5tYPB3EhxmedEo3844tHU" "O9WDZaAbtPdVs3I48qydkW6pEvFrF/2wHHvQFj13eCjiFKYMiiPL+bAxOhDVit2hGo1rxeS0" "c2Awxs/7bnko8ibOqlZlLMZcrapiKeIRf0tvLObUN9SqhUPADtD3cyRVRdJkComNx30sKpTI" "Y+GjaDKNg0sJiYdE4aSeZAZnFVwZiYrjDqKOxGMRhYO9CiZSuB1jmmK9yIpdIiv2iiGxT+wR" "fVjiNfG62C8KIiv6xN52bTmhb1HndpvnXVpILCocIX+6u7W1o3dSve3YV07deaC6+Yhnuewn" "OQECZtrI7cn+L81/t6HDcV2ce+va2kvzHH7cfPVb+qJ+Xb+l39AXOgj9V31BX9BvkMPFpY5k" "FomDhyRIOEj2cAGXkCouv+HRTOAeUJz2Tnd3buwrp+7I94bvDXOyp5PN/pL9M3s9+2n2bPb3" "h6a84pS0j7SvtO+1r7VvtB+xtPPaBe0H7aL2pfZt4q1W34/225NLdCvxVpy1xDXz5kbzBbNg" "Pme+ZA51+Mz1Zq85YG4xC+bG9rsl9ZK9OEzgtqe6slaEG8PD4SgSRUAVF4/jD+1/XC02iV4x" "+NDW7hF7RdulUTQKRg7L2Gb0Gb3GQSPX8WdsMQpGn7HFKD6wdfYqHcgEKtnndqaQBMygcJhD" "4hIgQ3ksBOhv+seVU2+E1s5s9hUr5/uutAY9e0ePVXVdSzn1RhhYSgZSzcnaDsYnJq3oF323" "QgpIrbvSyYVvwL6/QLvayU224IsA1r/cyW3thqc/hnO77Zaai//5qdRPEEzv2hl9rc2DfnNp" "6e5myHwI9z9YWvrnzNLS/c9AW4Dz7r9ZAHF41VQqcQAAAAZiS0dEAP8A/wD/oL2nkwAAAAlw" "SFlzAAALEwAACxMBAJqcGAAAAAd0SU1FB9wGEwIqFBLxtx4AACAASURBVHja7L15lGTXXef5" "+d1733sRkWvti1RaS5Il76oyxtiyq7CNWzbYgB0J2AwwwJFp94EZuqGhZ1NqgNP0NAw9BzAt" "DdBNNzTtyMa0sZHB0K7yvlVZsi3JlquspbRUqbaszIyMiPfevfc3f9wXmSXDzGH6YFe1nO+c" "dzIzMjLiRd7v+63f3/eKqrJxbBz/tYf7xrysCKiKiBxi3h7kzvDgvGS3/CBXfOkrXD+9k5lq" "krwsCSEHcgrjiaWnnBpedHEd/HCRPGvDYJXz2/by+Suv1PMAc4jtQYSNO+BSHvL3b4FEFhYw" "3S4CcBRkv+BVueHpL/Nzw5rbKdiRZWSmokQwGDIBFLAXXY4HogAZw+OPcbYv/OpbXsOfnDzJ" "yq6PU0pXo6Y/exZwN5b1m3eYb8SLznU1ChpkQfX0cYwqW4ZP8sLRgJdNFuyYMGRFwIujEEum" "koCiAtGsn07wLmOwXGKqFhPPDPiRjwdeO9rFlHRVNpbvOQggEdBkBlS7hNv3Mo3nxgef4vXq" "2GQMggVV1Ck+U7xrTnvR1RjFA0TFrnoKdUxt28SeE5/kjbthAu6Kf5vb3FjS/8YB1OthjiMF" "iHvnOyVjxMTSeV5ZZLzE5kyWEEIEFWRsQiw4B84G/Bg4tUVDRrxQUlwIEAqyfILd4nnZH36G" "V957fn7yGJKvv/MGeJ4TQXS3q0FEIoAewWHZ+dQz/NDMLC9VBRvxwYFEXHWx/Uj2xKlSGiUQ" "CMsQz9fkMeBdlv6m3WbH6Dz/6PkzDDvwSeDpjWV8TrkwEUVRZYJ97Dn2GC9zFdMdwKZYx2U1" "XjzYgLcBn4XkwjLFtyxFbilMRmc5MtmPgMVpwHmDlwkkn+WKTxzl9ilobSzhcwxAqlhJr7sZ" "eOXqWd420WGmjCkoVgulxdX5+gVEwAuucriRgQoYRFhdTsF0BXVtwCouFzqzk1xZ9bntL+7j" "VSDbQCYEkYMHxTUgtqx7yCY+EgeSgThpjo3lvxwtEAp6WAD3yBe5tVOwIxpyFNRD5vEdoKiT" "NRJFpQmobQ2mpoyGqt9PV2eV2jQXqibl7BFoTTJ76jQ/vAj7n4bNxyA/dIgAoPT+JnyEAFqD" "em2OjeW/DGMgRbKVp+gQuSGUvHp2huuiIwsRxOCkqe+IBRPwMUMUXAgQLKhBlgKyGKE0EAxi" "DE4jPihYwTmBjmMiTvL8D9/H97z1pTwgol4VbSyLqMJjSKuxiuWzg+wxvDZAdNlZoFMwabdz" "9dGnuV1bbI8Z4pvlihbqCCGCj2AUl9U45/FS4VukWtDKgKxq/KAFTMRbSWBXxUfFG0c2McW2" "lQu85s8f5ttVZfoxpHXHHThVwsIC5hp0dA06WgfK2HWpboDnMgXQTpiSFQ7mcJtrM1WDCxGi" "UEcFManGYxXvM8pVB5XgYgtXCuXqEFlJ7o1kSnAK+EA9dl+arlyMI2t12HTiGD/6DLy0AzN3" "340/Cm6uO69/M9bZcF2XPYCo2X7yMd6ydYabO5GOq8EpOCGLHgLUKVYC47E2gqbwtl5V7IWa" "LLr0WGnwtVKHiIqQOcE5xWWKcxEXPbXLyCZneN4nP8+bp6ENqvtA7z0+nyU782zXdbQJpJ8d" "ZG8cl00MdPxBbi1hV17QlpAsjm0sR7BgIIsCMRUTSytoHcnqAKs1rg7gLHgPxuKCWXdfTa2I" "2MDeGDITmAqeZZOzeiFZQEQIqurHTmtsexrn5RvPuHFcjgD6s5N0hoFsa0UZI9EJYiTVa6JL" "EbRY0ADBY3JLRsRbyKRD2ckgj5jMIEScM+vXqAYI4BUvBhdral9zdrDC0de9gg91YBlBej3M" "GG6q2JT/jb8npIxsIwq6LAF07XfyZ5/6C15bLTHdceTWMWFyqGpQjxdweDwRJwIxpMdyhbxP" "kc9SWktG6o/VBPCQWQcxgLXgwKFgDLK4Srn7Gt5zZYujHzxO/UZAu8TGyoT1rEt1HUji1n+3" "cVxWMdDzC85fs5/3rJzlRKWsqqEOHlr5WlBcW0N0Bqwjk5g8ljQd+dUBBUItisOSAVnuQHTt" "imuAULN6YYmzU7N87I0v4isfPE59+14tQRBZtzrPBtHasQGeyxVAN8Lo5Vfwl5Xwx/1FLnil" "RvC1x2cWZwSxQm6bN3fjGEmpvVKvDPCjmkwF7yMYBxLAhrXKTeYjVIHB8iIP3/Qi7g1Dlm+/" "CCSq6p+drj87bW8KixvHZZmFHac+Cmdvezt/rpYnfU2lhmhtSscBJOBVUzw09jNxbBYcbmUV" "asGJhagQEyENZxpLJPjBgNXpWd7/AsunTrS5wF4tQVVTpPR1UElnk4HJRiX6cgbQXqqTC8hB" "OLPzBbz3/GkeHw54ZlTRR6kaK+IQvCQ6oRdwKgiCqEC/hpVhAlTwCTQKoHgN1N5TKTz+hpdz" "6CicugldWYNMcpTytwDEzqzXJtmwQZcrgFC9s6vVIgxecyPvryP3livYzFAYIRdwYWxtDAi4" "CDibAvqYwl/fH8LIQ3RUNbjUDMP5ktWlRR654nrunfCc2YfWBw+KkzUL8+xruej0e9ESknvb" "gM9lCiDhLiMichP0t8Dp7/4B7nWWFefIxhRClzVgSOUe7xqbYC1OTfpaevzqELwQg4JK6oWV" "Jf1ywF++agvva7dZFBE5fFhVUd0vRFUNyWH9rd14B+I2GhmXMYD06Lw9oilF/5xo/Q8cD7a3" "8buPH+MrfsQTGqhCpBJZa6qmUoJfa1FUvoY8x61UMBjhjGOgilODH3n6N7+UvzxZ8DjHqVWx" "qhIbYMR126O6DqJxCq++6cpvQOiytUD71D+yQOz1MHNKfOgM9Vv38QHn+fDgHN4KQw3kYlNa" "zziAFrwEvI2YaPBVpDYCy0PcasQOYXFxkaemt3Dva3bztWugbAJnfxFAdAyei78+26ltAOey" "LiQiwlzCBKrC0W2UGTyx980snPgIt/nI1pBzuh6RZQ4JFWKSjYijJjQS2yRcES2gVY2wEfqj" "VR54w238ObCMqEE36jnPPRemWEWNogZRs1/wLz6q1cxWvlzsoPfMUzxTrzJlDJtCZHYUmBhF" "Zkplkxe2emHrakV7taI1UmaHQuvUItmTpxnaG/jDz8CDPw9DuchdbRyX7vhGDBY6Ur8JEjda" "Dx4U1z6E/ek+07/6r3jhrivo5B3yPF9valYVobLga+LAEywwPUlryqDThmz1aRZf/GY+uunj" "lABzc8QNd3QZHCl/+fs7jyiZKi09RjEGaK+HBewnn6B9RMnSz2qbmoygKqiK6hqgm+9xD86T" "03RB5nvkqjjAKmr/vq994/z/f34jXlBQlV4Pe0TJEqAaUKC2h1pFizGA5g/h7j1Gca9S3HuM" "4sCBBJAe2AZEsu9uMlCLqkPVceRINgbnxvlcA9BFC0tPbbIsiiry4Dy59rBKz15sZcZAo7FA" "x5TimFI8OE/eA4uqdHtY9IDr9bjoNTfO5xyAej3sGEjovFm3SvOm18P2esnqrD1nHIeN3Rj6" "LDc2fh1UBZAeans97KED6TU2zucYgL7JFy/ovLl7zVXieuO4as0SXgzQBoiKjC0ZqtK41WQZ" "VU3jKjNVBG0AjMqhA+P4q2fH7riHWh3fNGuxXHONfF1ct/Ye6To2AHSpz7WFX4utrDK2VNix" "NVPFjRdy/cTdqxSHFIeq0NO1gP7uBEYZL/rYhY5dK9pro5qh+7IjF4H3iJJ1lfVYTedN8xpy" "iENuzaKOwbQBoEt+8Y4jR7LblWL+EK4JtKXXwzYLuWYRxgsHyHjBxyDsXQTCMYiSK6b14Dz5" "RWB144Ufu+MUu6mMLdxafNfEetolf3Ce/FiTJDTWJ08WbgNAl/4DXBQrNUBwadGT1Rkvcu9i" "N9NrMrpjx4pubz3bWz8vLiV8XWKAitKzhzjkLi5BrD2/t+5C1y2RZuP3VVXuuCNZuA0AXeLz" "7ubuv7gG9ajSuvcYhSoJKD21XcXe27ifY0qhx5rzSALWMaX4sUO0EhB0PUtsvh5Tivke+dp7" "dcmbOMj1mudrD3vgQIrBxm513VUheuDZ8dlGDHQZxUCHDuDSXb0eXHcvCpKbRbPPij8uCoJp" "gt2xhRg/73alQPdlz8oWDzQW5ciRrNu4yrE7uzj2GZcolN5FWamuudnnShb2DWhlfPOOo0i2" "H/WIoKr6b+eltec6Jl77I+jD99HadjU2RsITT1DXNbG8KvX+qpD6aP4EuskiXAHbjxGuPcgK" "pBbJO98p2T13z6dmrdwpqgThLqPH5zPupIMlW30e8lRBOPY1wlVAsQN7RYY1V+LUo589Qdy+" "h8ov4q67OrFVVl7F6q5dVM3smm70wi7h8Uak+CWI+xaIdNn7+Nf4iZUBb56aZEcOs1aBkBTP" "Guajj4mD4MYfW4Vy6BmdPc+Xvv1Wfp7Hue/oXuI+8EjPLNClqwQRrCKW32PfV47z6zun2GvB" "mECsDJ6AOoO1YDTxuGNlUI1oC0Qrlh4+Rby2wx9tuYPfl1s49VwAkLm84Z3UEJCFZ02SLiyI" "BXH3QrwScl7P1OpJrlk9z+s2t7hGlNmQxoS8t7hoG/aj4IJrplxD4h9hKEYZM08OuOXff5yD" "7GVrBrmIAt3YHfcMu2IHv8fWxz/OazO4LrNsM5EtatmWWXZlGbvFsiM6tvmcbcGyI4OdLcsu" "b9lpC27aY7j5/of5af9urtN5sgbYMhZ9EBHbsG3l6xmeFz+2AaC/c6c3qSGg3cQTao5uV0PD" "LvQ7/hrHBNcde4TXuYwZIc3biwff8J3GvA/TfNqQLIQDCJ76/ADcBHjP9312ke9+0Yht2hPT" "8PyjgOMX2NLJec3pSeZabVoKdWyByZLqSHTNadNjtgAyMEKdRWq/wsAvsTQxpDr8aX6AVTZz" "VDqJrasWVYtqTFQY9HAjlqXcGcc8qzReItJMDmwA6L+COfA3x3Fex/Swz2uznNdmOduj4KxZ" "V3kF0Lj+QSWsz9h7i654GA3BFUzNzHLLY1/kbYuG6TERFjC9BVH20D75Fb5v+zRXTbTIoyGL" "jU8cq4asKVanyVtEoK7J8kC5eoFO9LjdHWIxSdef4O08QksEiyyoJoavFb1LAQ4cUj+eR1KF" "QwewiYebsocNAP2dCY5/+wzFwoJYPYKjZtvjJ3j91DQ35DmTF38oDc0krK6nYWMh8yDUA6E+" "NyDTHMSQtdoUVeS6P/0Erxt22Q1M6jy2e4qJ6l9x62nPq7dvpkOgrTXe1tTGU2tMwNQGODGi" "0VPHCG1hMLxA4VfBOPLOBFuu28HOIyu8q/4ENyj3GD0yZzgoTpGAzOsYOOmS75Kj4A4cIjRm" "yIqIJDf+XKS0fgOszhhI458XFsS+tssEsPnxr/AdEa41hkkx65qLY1k8IrHh76dhZwFjIRiy" "lZqs34BLBF8rrphmdmWRH3xglcWXTfDXFPR5AVd94WF+cNsmDCFRcF2GI6ahNtOg1giOiI8C" "GklXXBOXz5IVFbUaqITJttAXz+ZPfp4ffdlvvvOJzmdYlsOsKqpr82oLmB6i3S4KWouIqIIg" "DZFO4oYF+jtYn4t/7vUwCwtiu13iZpgMcOuZRV7Xzpkc37IhgoaUbWmkliQO67DrN0s0MAj4" "lSFIjveCD4AVvDW0Nk1x1Vfv442P1WzhbUzET/DdbcetMx3aMQ3IJnkaTTJ96Lr7EoNTIbMG" "V0T80jKTJqzP9huhHI7Q3RkX8HxP9te8kTfiUM0EnKrqMSQ/1hXX7TYgTLP+rLnVBbFymXix" "/2ZiIFXodondLvFospxbzz3Bd0612Gcsk8ZRNtOriZRv0UwQZ3G1JKvUZGVUCv0hrqwv2mgj" "MR3Jc+z0BFt0yEu++ln2UXHTw5Gf2L2La13OZJPd1VIz0IgntUyIIQXn48DFCJhVtFpJ/+WQ" "pawrgjWOvJ0xe+MMnfvO8c7qt7lSj4rqwZR27oVQ3TVGTLI6aeZWWVjA0NXw7D1CNgD0/+m+" "jiJZAxoL2JXD2NEiM2dP8m1Tk2yzGZMohQR8YZMVigGxFlc3daAaai+4APVqoF4pG70iwCnO" "NisSA0UANm1ilwo/98Bj/HpRcO1EGqtGFaKShZyO5riQJREtGZN0E4a8rRn2F5G4nH4XkngE" "VlGXU2iLTe0pxDv2fOZzdPkAM/wauaJWhPD8eeqFBfQIOPRQytLApgw0pfcbAEIkbYuwnqWO" "ax4CLu38I3a/EPcLkaMIMHvgADc+9DDf7TpsDUKR1WB9Ss0rUgYm4Mq4PrhoIcvTAmcrNdlQ" "8FaAmFySlYROZyGLOGspXItrVlu8WKdh4CCYNB2bWTA+iQZbj9fUH8FoUhGRAFWJW1nFGYeX" "GjIly4RMLFktUAl139LauQ1GI95e3cd38Z8oYEGblojtzmncL3jlIIrQWxAd14PW0vtvZQCJ" "wA2yJrigSWMaOHo0CUBJz3TnFCAeOoAc3QfA7PAkByeFV7YN07kmbaHGkngb8I10jDcxma0s" "qXrUw0h9ocYvDvExg0rwWCiVuhR8bdBKYGQoS4uvW7SYYqCbGS6CM5YoTb4dMxrmUZrCRaAO" "SfyqpbjqLFkeIQfnaryrqagZUTPKFApDlkXcRKBz4y6231fzsyi7j+ucU8Q+eJeYhZ6YpokW" "BA3XdTFpfxBxXCZZ2CVtZazfTZKk5y5y670FGYMnbQC0RvCS6x54gF+bcNyWO2bGhUI163nJ" "WOBFLqr/+IiPBfHkCvlSSEW+MV7Hf2eaAHv8mBf8dI2bXKXKTpDPnIYtMQ30ExMwIUkXY1IQ" "bjyxOgurZ8lFmmtoPpYP1KKQK6IGF4VaAzrhWfnKM4ymhvzmzUv8Di9lRI8IuOOgN6SCREj/" "BvRy0rm+pGm8XlRQXVjAaJe1inNXiWhyb0cg7IPWeZg9+RCvmVKeN5EzI2mXuloNmWgjXh7X" "MyJj06hrqRBy6v6A9qhMGx5UTUqP4J3BSWyAGKjVJJkZo7jSgrTJp7YAS+BXwGbJZdXN+0fI" "MoFMQAf40QodKakzAyak3Dw5TzIJeASHp1YlqsGOcqY370AeHvLjN/wYn3H7+KIc1RX2HfZw" "IIzvNlVBUGk+oFwOgbS71C4MnRe4M2j32f+MRl+sXFjAdK/DsI9ic82uP/4qL9+8nalJbfSC" "m+eaFPsQI94YXIx4Y3FRoZIU4JYBtMAjBKdYjbg1DBuoA7U1iAhOFe+VulVSbTpLPbyf2fAM" "+Aoi1B4yo9RRyIxQl0o2qHEmgtR4TDJSWAg1pTFYIgSLCwpGyCzUWaCyA/rHzlFftcSvubs4" "unCWAUhsAmfgLtFx9blhHgh3Cdz5LV5IVF1rAAhIb0FMt5voFOv1Z4UjAHedv3s0zxcm+Jh5" "kldv28mkhQlJzijVd9It6cYhkTHJ3TgLRmnPdmDrJBRKQWyyo4gTk4AnBjGSQBDT1lP1xDLn" "W3+BO/knTG6awK/0CVrhnRK0oCXgMUQfKaMSZAozdRXBzlJEJarFaotCNello42bDNRljR9F" "QowUmyf40s3v4K/4KfoPLZBpFwEJItDrIXzdDXa5BNGX2oWNA8EAqgvNDwcPJg2flHUJ7MMv" "iJo57lx8SuW//M6fcTAu84b2FCHPmQ4CXqkzyIJSWSFvWhnetnChSeUHJQxaBKu4HGr1DfhS" "rOSsWV9gCTCh+OI87XNfYesLZ1mJBmMyQrS0TKAqKyqrBE39U4MhlBnZ0JN3SoZYJAaiGRLx" "1D6knT1DjouC2BGjYWT45RXMd+3k366s0p+6i2x+Xus7dSzKtmCl2x232rTxh+Nb65K7sEub" "hTEfFxbQJm+X7pwiohw+3Gg57+9FPpD+WQvJ9ccSqre+iT81Q05Q4tUnywNkVcATyUMKWNOW" "mXXaJoqICrjVFQrrGHjIaov3Fj/KqUc59aiAUQarBi+BcttZllc+y9bRfdT511iqn2Q0PE0o" "T7G8fI6oEWpw4sjEkUUhz5RQn8O4ZbQQ8laLTUWbLe1Jdram2Z5Ps73dYcdUwfbZSXbXwra9" "U7w/fz0fnjrAQG7RkIqHdxkBJ9qN42GOtebqgphDBzeyMBCsIPGI4o4C76Qr0AMhNDEAPHZh" "hl/56++k2DKL3+LJlwy7H3c88z9u+6lXnXvbdbu4xVW01ELMUxHRGtAabxQVQTy4sQpaVsPm" "FmyeoLQVlhLX9uD82O9B6aGzyuJVJ/jSY5/hpuklJqcCuc/JcpMCc1dS+1OEegAhJO3GEFEL" "0mpRnBty4dFlPvWRc9lj9/H8/mPsiiOSQLUjlwxjakp/gtLEV7zpJPtv61PFnLYVxCiP36+0" "Zj/Kf/j+x1EigqEHdImIGLg8xCUubQx0RIw+khqZippNQDfFQzEF17R4X/VaNk3/FlNXd1J1" "pyMMNylb//kjn7xwx0Nbp9neKpjJlJZU4JQsKthG4V4jtWuipDLgy2bjupkVyuvO4FoncJ0B" "dJpmq0kuzEfDJhN59S0vhODS46pNNiSg5ylXvoCtTmBzUBGKwmBNJLhVyvsf5+RP8JYH/bv+" "8Xdx9a7nUcwo1iVuSRimjdWMSamoR1gtDUY0ZRYBlmYyvvbIn3CEnwKUI0c9+/6F3M6Cu5ee" "h4csrFNWvjUBtA8v+2G+R8Z1ot1HiIffjeiv4QTNWKmu4oGPfS+zu54kKoQ6gHfkuaNs6Rcf" "vVW3Fp///P4d3Lp9kinjKZs9yJyCx+JiTWZTw9NlDqcBP6zx5YhCzhI7fWgZfHQ4L3gnKCHF" "FiVQ2FQgFIUsgglgalYXzzLpcgadGUJ1hrwY0A8GVj3VCOxZOOFf+bKr2LqlxergMYYjpSxS" "3dr4JmrKHdQGX0dsVlMYwdeR88PAM2ETF1bexC9+7W28+fr39H5mX5xjIX5QFdHDFu68LJph" "lziNV5PI6ocjhw9yCzB3mMB+NSgtfjd/A2Z6H+1ty9TlFLkDskgZIvWNAXnX3g8/9scPXD/7" "X57Z2WYnQhGTjge1R7PUHV878pDaFKaGbBnVPkXeaFGHOvGmBWpRcgnghNqPyKwFk6ySyyJV" "fQGp+1DkZPk01aCmHQ21ROzqEoufPcPSR3nhY1x7/a1MTM5SMiDGSEvyBMWoqBcYpgtr5YYY" "c+JihnaWWHpqC3a0hT0v8Jzv/Qr9f/bZOeVhFbUpgj4YemAuB5nHSxpEa1M0RA6G+YOEhqoK" "RzAcZjuPfuj72LE7TXLiKgwWIxmZZBSbcuwrphh9956Hz/FYv6RfpzKNDwFvBIlhvZgoDjx4" "U+F3D2DnKlknpuW0Me3VYTR11GsFn4N3ZORNwXDsEkeE/gqdwuMlpltwJmdZHK2WUp8Y4d9T" "P/++9+1/xzYmrgpcGJ1ndbVkOPTUZcCPlLJWKo1EG/ExUgYh2IDsHjHMJhiFHYSpgM1HwATv" "/SfvBNpyhLyhhaR46Fu+maoS53tkmgb+8satOfbR4o8+/L1YuZbNs4a2maaIHTRWlL5kFEcM" "CGi7oty++aPHbh588hyfWBpxxqVAlqyhZ4TGffkmYCgCbucy7FyE6ZLajPAEKoTaGRAhM1Bq" "SIxCq9CKYIYMi5rVlSHtutmvPBoyOkzELYhsRsMk08ue4YevfNUFvuM1NzM7PUsmjk6WM5sV" "dDQn8zkdWhTGEMVA26PBEL1QjUacfXSW/qCkqofU/TYze84j0/8dPzh8E/tQhHBEMdd12ejG" "Lyxg7uxSg45uEPw9SMYRpjjCQfLzb6e1+WnO9gcMZUg9NaRSgyAUrZzJLMPVhuJKi7zzxr94" "7LanT63wJInX7mLTyogpEyPz0I64yQq/uQ/TAzCWLLRxdY7xhiyM91ywFCpkavGlglo8oMNV" "zMrZhkQWCKFm6GtW8XgTePJLT/Ho55Z33s/LX/4Srr5ihqnJCbBQx8BKrBnFGu8qKi3xQcm8" "JQsF7ZaBPHDmmSnOL7bIDbRMgbMR56bZtjfjmbv/N36DXfQwjywQHxE2uvFzNPopR8lQjZsW" "iNC3fOiL30Nn+ybyyXbqUQwDcl6wplFlLRVGhoyCfHeGfd0sgzddfzqwKA2T2LokTu4cWeFS" "ljUzgs0lrlNBW9LkhiRWoZMAxlEb8LaCtkJW4/KEKedAw3lsqwIRnDqKrEXb5EyYCSbPdNCP" "lXz6X3Ptk2zd6hiNPKHy2GDJbU4rK2DCoPl4304lWiWqUMuIykeWTm9GRfHG4wFvI7ULMHmB" "UXUF7/nVH6NLa+6Uuu5l4sMubSV6jnj4gNipQ7D/+LF8rquG/3PwMk6dPMCel64yXM7wIWCN" "QcfsLyPJrlil1BKiJZusGe2c/cDnr/7CaO/jh3dMMduxtK3iCeSawe6a9ov6TG4Z0ilrpkYG" "L42bkyY195EM0wThCplLxPzc4ldHFCsDXMs0hUu7VkInN2QTLSau38OOHee//NATOpygmM6o" "Sk9VBUxI5U6JAmLJxGKbhkvQSKkl50/NEvqTOLNKlSmx6X3YIERfsGnPeZYe+Wn+cXUfv5B/" "iJ1zftxivaiuJjQ7V3+zakSXuJAoFhRJpdYChpv44ff+M7bvuo3NV0M5SooqFoPaxGwWZ9Aq" "mW+rQogQshErI+XJY3sY1hVUFdErWhuyPDKRtXmw98zv7X3fibfcxK12mi1iaItppjR03CdI" "/GZvceO+lYtgKvqLZ5gMFyCrGGpGWyI+GJxRhnUg+BF1XdK/9xE+9T9c/y9KXv49+2lJms33" "RKJNdZ/xAJCGBNvQGnBhOfD0166njpE66NqWesELajwSHdiacnGCcvlL/MzP/RBwasxe+Jv/" "1vUBhOd4K0OjpCqrAgW/X7yN2dnvYnLzgNFAMU7IrMNYg3WW2gUqW6NG8SZQuZrKemgr5WAT" "ddUmGgcz08TNU+jmjHOV4YuP9osv3v9XL76C7a1ZrjSCI+BNSHU9bZpK3qTJ1WjAW/CJG1SP" "RhR1P31f2fT7qGAqKqmIIrRaLTpbZtly825u4NC/PMbxTz3FucVFBnZInVUEUyfLGZLVkSxg" "WhUqltWzu4jRoS5R4DIEKrcmOKMkVexi5yKjGCFkzgAAIABJREFU+hZ+6V++g+so5CjZ/xt4" "vjXS+CPier8hrX0qhgfYwf1/9Ra231jSsjO0nWDEEIhIFKRSpAQGig8BCZCFgjyvWDmvnH5y" "mmiGSA3xnCdbqWmHAk4FHv3tL955++NbN21iazCAkGVCkEhl0uQGArjYMBqblN4YEI+OzpKN" "d5+2jswkeoirM6TKyMlwmcNUAXYUbLrnhrP7d/6HX/gES08r061NTBYTFNJCg1CbimgjA6D0" "hv6K48LSBCVDfG0wMaJV0+K1SowtjFFEc2w1weY9yxTLP8cf8B1cSf71gNGLjud+Gr+/F+de" "rf4o2uL3jr4Ol19DZ5OlnCoZFTWSR5wDlwmSCy1ryayQWQETqW1JqZGzp7bha4cXj3dgpgxM" "5NhJ6J8M/+jGk+XbnseLptrs8BEqB6WlKDPy0iWOci3JAnnTcIQSv3m0uoJUAzA+7d8qdbNZ" "HmBtaqJaEjfJW9zsJFO37eFl/+x5Z/fy+GNfYzUssTJYZRD71HaAmEiGpWMh5gMWz2yirgVR" "EK8YSel9zDxGDFleo9FipSaWSp5ZZq9tcf+7f5EdZJd6DS9tJVq7Bpjiw+E1LD30D9n6olOc" "PjWBs4nWPC64GCJiBect0QhBI2oMJg8M+9P4pWlCrDEjS6CicpHKB55ZyXj0i59+63/PjTuv" "Zh8+jdtEw5pUgei6aoFJM8reeIJUlMMhZnWFlrgEEBEyq9QB1tpaNuANOFEya6gj5LZFvqXD" "Tp78ylc4f3JAy7bJXYG1Bg1Z2l3GlawMZ1g938EERVSQDFQt4iIh2DQmUhnEVPjKEghI9NSl" "MjH7NN/qjMQ73incc7cO+Vh9hiOHdtA+vgXbEUQdYgKmdjRaPihpG96oEc0giuKsRTKlM11i" "ioDJLUYcUSDUy6xeGF25XNbVp7D9x6mIeI2YvEiDhkHWl0Di2siOi8lbFZmDAjBFcnuSaK6Z" "pDS8DgGxBo2mabaGNLB44Wm++rkHGNJ5/DV8/mO7EQmo2KSjYHzD5LEUHUs+vYwzBg05ViLR" "pNFIbAMqQGKOWLBWqVcdo8f7vOVXf6sxfPFbFkD33IPnHvGofprfyf8p8eHfZep5x5ipdmON" "4LOQekYxrXCMijEWlzuiUYbBY11BngeKLGJyMGIQD/nELFufnz359MkXfOGzp4eb8xNPTE3S" "LjJaZcBYJURHRiRKJBIIZCnRDgVZLMjp0N42yzm/jQ4FbUjpvYnUXlCT/r6mxuNwonB+wDO/" "/TBf/sPqhlvZs3szo6UMyAgSsWqIaki76hniyIFxZNPgOkqIMTH8vUGMEm0kWkMK7IQs96w8" "MgN7/2dezQMcXWP1NknJN58nfYkZicrhA2KvROwNH9L/yPf/7PeRrRzAzQyQOkdXI0YVKQST" "ZThnEIlEL2m58gJrYHCuQ+A87cmAzVrYLHGvvPVs397+88VtZzvVM4+/oiivnZxkUnJMEDJX" "4VUwYskCqAlE01i8AkZ1SVge0OkEogbqkEbCfMjIFMgCtReymKeJi1iQnVPqj6zs2Fxtv3UG" "N1tRmwqDwToB78msJXjFUuO9Mlrq0OmUaC1YdamIaBIf0SoYFFGHWk95dgbJ7ueun3wv+2Wo" "jV7xRb3Fb7pLu7RpvOIOHpqP/9McyosZsesXf4kLjwbK5ZqogpsQzKTFGofRiK885VDR6Ale" "Ea8En1JjvzqBiiGIZxQCg2rAaGnE9I7io1e8aft/5LsWHznLeVF89ESpUyQVA4onWs9YZMMA" "eEWMQaoKW63ibMXIpC17lQjOUwclywKl67Mqy6yY8xz/8qMsfi2/+nqueuEEk9s24XIHVql9" "BJNyP+MyyDKsAeNblP2C4Cu8ScVBZwyZAeNt4ttaIcaS8ydG7H3Hu3kJywcOcFkwEi8pgHoi" "Ee7UhZ56lJyP7fgS7Z2/zLkntrFizuAVxAZMtBBNk1srPipBY9q/ufYshwH9yuCHOQZFNWLU" "0JaCPTNb+Y4XPu8Tu3bseaJunTnXZ1TW+DoCETURDQHVQLTj0eOmCCxJwiUMz2NlBW89q0HJ" "RPFiyRB8FGyWEfuBlXuPs/iHj7RbTGx2xKpCR0N0OMIMSmwdcMFho0WkQr3FikGDMlrJGPUN" "MaRqshWLCRbVAAi2qBk+swVx7+UPdryfHZR3cnkclxRAXSUiQm9BpCdUiAz5d+/+XbbvfojJ" "6ipCNWS4rARKECUK1OIJCMGENCeK0hKHrYVysUO9olgCYjOCU0bWU+bLzO7p3MurwidPbX9w" "pWLQTgVDE2TcAGjqiV9XhstqRqxQD5dYC+i1UTcjw0WH8xlTTw1Y/fOH2//8c7Pfv4q94SZO" "T0/Tn9iJ37yDanYXZmYboe3xsaSqDV4HVHWgpiSUUK9OYkOaoY1BCTENEKrx+FKIK0Ne/b/e" "AwzvkHvkwLsuD3GFSxoDHTyI7fXQbleDIBZ6hvsYUPz4z/HkL3+ALVdXWDdB0JpaPM5ZHA4j" "Qir2N3Fjo8hTDwwmK8g6I2xu8EYhjwQVtMrPcfyru7acLpbg266oqUzTnWqoGSIWqxFvgCjN" "RuMghWdUDulIn9i2rJSOqRjxGnDGUq1Avu35bP/P/8fw6t///B899PQzZEWbejRCR9BfUgZ/" "+mFGT5/qvpnipYrxgVhZVBXrJdXES0u1asmlJpiAyYFgMYxYfnwrW7/t1/l1jnPwoL2Hw/6e" "uctj2+BLPdo8BnDa2XtcVVW17Or+Mp2JX6B1/QnauglByIJFbcBXAWKjgWoTi9k4iDGS546p" "3UPyaY9VQaxBYs7D/+mRf/fShae+dxM3PXOU3XKWmF+UAo9jnyjJjTVBqYhFbE1dFbTjNG7L" "ZlbqKToxo0UELeCshZtfy5nVFzHRn6TTyVKnP8tgGPGLBv34Qzz047+47Rn8W24j29xHbZHe" "3SqapazMOaWzaYV8FpzNyQSWn7acP/kAP/krP8y7OAuMOHjYcugj8XKYDbvUMZAiEnS/uAUR" "qwr01Ch4vvf//tcU9mk6o20YrahDRRkrVqsK75UoEcnAZpbcOUxIGVodlOFKQTUMrIxqzpw5" "x8OfPjn55fd/8MV72JVt44orn8egP8t0yNJIdMIsEUVtnYjqRpODNIHoDS5TalYJwyVy56ml" "xhMpLwRwt0C4kXKUJ2rs6iqslrDYh+USd2qJrJim/fofPPMU8pESf8ES84hptrJPFUzFDxxV" "vw2VaXpgIwZnDZ2X/l+8nFPcRUCEAxxk3z3zG0F0V9P24PwCMU3zKMwtcFBw/OTsU/i5n+Hk" "422GqwNs7TACeWYpipy8sIgVYoTa1tR5THRXB1J2kHqC2emC+GR762O/8fnf/6HR87dm7FDL" "RHYl2baboGoxEWP6H4igEghoCqxRxAgqBuMMIjUhG1JVK5hRhRWHRkthp+CK/Sz3Z9leeTqF" "hdyCKrVCOaypV4Z4Y9nyI9/Ozf/glcfuZ/i1FiGriSYiQXAxw0XBCfhRG8oMDSMunJ7GXfVB" "Pv62v+ztJ+qdScnkXe9Cj9xx6ScyLn0rYyHpaGiX0F1r0Hfj4fETvvqGP+PKP3g3o6UfJb/2" "LH6QoVVFRURH6dqlNsRcUFFKUaiUulyitapcYWuWHun//CvIX7GH623OTFVALNi07Qr6o6eZ" "9J6WDZQ2orXF2EAQg9VAcFBW4KJDtEWOIjEnkwFZ3mHljCO79iWct7OwEsmdw+OhsjifBKeK" "pZVkYCYdW8wMM6/9Pj7zF599/H4GT7wYv+UUiEGjTUWNILiQs3JaMcMl+qeFN/zv9wAyp/sN" "cjSqqs4hzDF/WYgrXGKlehERpQdmG4flIAdDczmWVIJ2fM/Tezn6v3yCMLuZLE+6ukbTuEWe" "QWdyRI5NEpfGpaqOj5QD8OW54qu9hY/87GMvv2k3L9fE8VMb0FafleGj6PEH2Tqp1NmAocaU" "g4kBN4LFp0xrs4uj6NDSY5yXMmC0nAiF3ESreCPZntdxankbk8OMycwmqTtNxcb6tKe92Icq" "NTF8FXHnS77w79/Lpw6/Z+8PUb5kBt2T9MysZIS6JIrBFJFwvmD783+GL//Mv0EY9hC6RzA8" "kiInuUx2rb5Mgui7Ym9hXlI21iTSMm5UCdz4Iy/j/JkdXMiHhRdTbldpnT7hX84Tnc3F2Vff" "sI0rtnQo1BAVxCpMt2i1NjH74qvhymu4Pp9gZ6PeAQ5affqrj1KUp8ioQEqqoNTe41cr4mSb" "M7uu5NETba6XSbZnbVrGJM2fGGGlgC0HIbuGQQl5olKneTQvuFWDf2wZ510j50Kamq1qTp9Z" "5PgDD/LAb/8u/5nyH8LSBUfmAloLVSeyuFw5f87t5ic/e4J3XOiBmYN4iEP2IAeTYAx3yeUQ" "RF9iAKUNBY6C25fQklQIpYGPCgsLmJd2cceOQ/8GfJce0uuy8mrZMvlJbn/4c/yTbdNc2crZ" "JA2bvqkOYSwMy5TiYcBBHSMiSqz7mMWncO0+K7SZiklgwYeKKpSMBjvw1/4kX3hsiuunW2y1" "lukY1gScvbFoDEiVigtoM4sfXHJfpwew5GFYQdFKU68h7alRlTUx1HziLfv4p+97Hw/ONdZE" "LtLSOizz9iDzQekZ0YcUoMu89NAgC1i6YzGSb+Eg+hjkR8HtWyA27DuDYEXvEhDmmuu7QbRq" "36BhrqfM6RyHtkmWf4kdj3yUd8zCNZlholYY1fi+h5WIXw5woQQilU3CU76CLCpRhujqaVwW" "gJwpTxKNMorL23TMDJuL7WyvlFtnMq6yMB3LpGKnkaqscaOSrA7r4BFwNukR1cs19WqdaCPG" "QfAQBJzBWei0WrTKihf8m0O8tdvlWlUmFwR7xztxHDxoReAgh+kq5qjOGXi/7S3My4IQRbDM" "SVRZuCzGei4TiTuSeORaGUifRQy/mHWnx8g5z+TZ9/HWZyJ37tnMbuPXemu1mtQhlxTLSFRc" "jIywSLAUHaWuTsHKabK88ZCVxwtEo5hhC3e+Bc97PWd4AXbJMh1i0kE0sp75iMWNhRwMycJY" "B0MYnRjiliqIFmdMUsQTTWKe40nZsuTsmdM88ZKXc/e3beKDHORpmuryQw9hb7mTevype6ih" "JyTJvwXQbkh62Rq+pS3QeFPko0jWWxAzpmIeRwpVijnEysJduTbCBndwt+MME5S85Fifd8y0" "KZoqcg14tWTGQHBk3pF5i4sObE4rGorMwmgA586RNUyaOlbUNhI0kDvBlwE23Qyd66GvbFaL" "syYpjgHYRvVVA95ZfO0bdQ4HI6DvcaMaR5bGoX1ErUla0mMSGoB1zOzYznXH7+ft1GzjEI6H" "sAtzcHp+PjbOzCTXRWQOUJGjOmfkg79ZzHVVNixQysGMaDc+G1jpTpxDbA+iSLoLu2D4tOwY" "foiffnSVt++cYbNzdALrMnfRJ3cUGrk7qwRVCheoc6jOnWZCz4CpKWOaD8XU1OqJKpgzM2RX" "/xAro6soYiTXxK1HbRJmWLM+Po0MqoVayLShxZ7uw2KAaPEaURcQl4DjogOSdJ5DkprshSWe" "7kd+65W38Z4TcKG/wOpcV8f9uYjAHXeIu/sOWHiEOI6XECzKt7YFSgjupgRGBBWMStrO4CL9" "aAtKlwUemhfhy+z9WskP7NnCTluQaWID1iZQo0nfx8SkkpBZHJbCOMgcsR6QlReS23EG6wK4" "irqO4AvsmYJs9wtYybdT1UpuwWdJ4ttpoq6m1yRtWWAklQKLNIvPhZqq3+zSkxucg4w8MR+D" "NOAeE/YjqoprTzDJCm8vl3jD7STV2XuPi1WVmBTJhLvv1pp9Wne72uxyKA6VDYk7gO6CmC4o" "PYzMSVR65qVd3F4IC0k9Os4fFsuL6Nzi2frJO5m7YppWUeJKoNE6zIKnkdtJrEExEJrbwwSo" "S+r+IpNZksNDM5zx1F7JcsEPHK7eBe0XEy7AdASGglOfrAwpSK6JSe7FOgof8NbiqoD3Eb86" "Iq99osDWPomXx5j2LXNZIx1MIu1HyAgQaiqb0W/PsPwoVHNzRNAKxBxLelTshfJZcaDqZVGF" "vvQA6qlZ6B6WHgf8OCgSiMdSbBt6gunSk8NsAw4M2SxnLzhO9zNMZ5KnqjYdb2mTpbUKFcEI" "AUshqUPqtSJkkWqpoN3awqA92VBW02464oQ6BkINbmTg/pPkxyvicocqJvdnMFSi5GLSHJbG" "BFbX6GZGcJniZ6eglSWdagM0G995axr317gutTitU5lh1GfQ6vBHN8PHzsKg18N0uwQR4l60" "HKv5qxKa/YYuq+OSxkCHEXcQgkrPQJeFnrC2F8RFd1yvh2EOuj9GVi1yw8e/yAeudmzPR/R9" "jeaatmoiUeoJOUUGkYAtBF8q7v9p71xj7LqqO/5b+3HOvfP0xM7L5GES552GJKYkbSHYPAIO" "aRuoxnzgoX5oicqX0vYDqqhk+xsSSJS2ICUfSqs2bbkX2tAiAgrETiAlFWNong7xQF52/PZ4" "Hnfm3nP2Pqsf9rljJwRKm7oZJ3dLRyN57mN0vM7aa6291u9fNPBuAh0dp1OO0NScpk10ViIQ" "czjahd5ldHZfixw4g8yBMzFt9CLQTVta33MhpNhHheAq3OoRGG9Suoi4WoTFKKihp0puWB6h" "RisWu4Gl7hIP3nQjn1yX6ZMiYuEEpfZEVb4f6/T/s8S126kN5nW/hbXaGNFJWQ6fTzKcb+wh" "u289bhKiKD0VLTM+/Ozbxu76s3+u+OKGNXR8zqoqTVA5p8QyID6mQ0eEqnSIWiQXuosL5F4w" "jQaxMklPVTTxpN0S5bpA9cw+hs+4iLIcxRUeehnEAmwGvn+/HN4GSpO0NlCBzMHcLLhInMhr" "Xbta+EVSj2GaBxKCChqUzvEjPHPNDXx9XUYnaYVopS9WI7S1obxUMy1MTg48UK2DBSeyiXSD" "2m1MSlPfLDCqsLGCrYpgdIOYvdcy+oO72drI+b3rM+YWc8asQSUhd50EytSTkYJyHwmlYm0T" "E0YYGjqLRZo4Z8msSSRXUqZVHm7i974Bepey+MLZDC2MJAiDlmlrUggOnNoUGGvK/IKzOCIM" "GzhrhLJp8VqlWKyKYAy9osI4lyDjRw+xv6f87Ud+jb/u5BxcLczvUbI907B5vfZePN9+8vTp" "ylJ6XjENZf26UK2XYWEnsPFFjWaa3LnANi1Gtl3+nTHuuy4nVyhLyIwHrQi9MkFStB6eyQSr" "gjMeKXMajMP4GAtlg4ZYXBVR8WRVRVjKcIuecvY8uj+5nnhwjFWumarJ/b+2zqiCjyfor0UJ" "pkFJgV89DBPDlK5KY9B9zyMVLhNCCNCZ5fH1N/KHB/by0N2fobrzToJqeqBESLoYuqyLYafB" "roe4C2TDMlxTX99HGS8tKu4Cp7vE6S4RbW/SVlvMFlKjmbYwKIgS3nzHNsmGefodc2z93iHs" "fGCuMnRjTOT5xjC5G2akMc6QZIyGgEYolgpi1aVbLeDtfKIBFx5fDJMFTxkdbqjLbPU8c+tm" "ua/p+NaBBZ6bCxzvJeYmWkKmdTqfQwdCaaH0hG5EJIOZeUK3l0YITQCxSatMHXQiCwdn2dM8" "i7uvaPDMLfdtqO68QwOqbKnrX60WRpMUUP/RCSmgJm5AS1AVGXigX+q09WSFYhGRWhcKflfy" "pSnO/NZhPrvK857LPDEIEgWDI3OWKhaEKhAqhxVBMBhbV5PDEM3hN7Cow3hN6jtBImG2YGF6" "npnNn2JrcTPmT/+GPzn7XC4bHmG8iKA+4YJrV4hXXFkfcfRbBDOHcxWcPUI3V6wYvAqhsriF" "OfYfOcb9H9jMF9bCI6BzLy2vrrRt6rTwQD/Pfn6GPpGOq5V1VE9/mZlbJ/ji7AKaLdAxBZGI" "ushisUQkEF1Es5p1KD3KqkehS/TMEt2lRTLpETXHB0uzYSgPHcesh88Tuf843G/O4/MHjnJw" "LjDbcxQhQhNcI0lwUEmKiYyiMdWOXTdA0YOipFFJSv2tJjpsXGDu8stoD8FjLGNa+4ZzsvGI" "DAzolW5rL8GUvKiB6kriVVfRcU9+6EebF/n09xdZXUDHQgwB65XSWKw0yTXHi8fZYYbE4SuL" "xJKyd5DIIebsLPM+MH+kxGRDPHnJbXybW1rHzkYPvfVdfDes4aH5RRalZMkGeqVS9mrlHbVp" "axKPx+NDlmiwhYcDHYo5YS5aKCKdmeM8Yxt8+/wzefzeNvNpQzw5OD7Z85weXui0Ed392RK2" "xh3ssHsn7yr1t/nq/DjffcEzLhbjcpCMXDwek3aWGKmkS09ATSC6QGz2iEtdJowSioKZ6X0c" "exN8gYMcRSfjDtlub4Du9Tfz9aXDHJQu5JbcCd76RC+0AUwBtkxyCaYf6StlFLJOjzFNJ/66" "uMiB62/ku5eNMr9lUiteA8udzn/8YTbqRoicx74PDPG5u/fTvrTB/qJBXjbJQ0FPDIaKKg9g" "LM5Hqp6hqiJKREKFH/LEg1A2LV/NbuZ+NiVowUa26hPbt83GrXxndojx3nE+cc4wiwaaJmIt" "dKR+CquIRIvGiCFpthoRrHRxc55Od459psFdQ5bvMc1RfoRh8tU/DH1dG9AkbaRNyR0bVP9u" "17+/u2P+/OGOfGItfnSIRIqrUAKJg+JS3Y+QVMRcXQfkhZ90e/kFPHXNDXyFMXqMk/ptlGob" "0BZm9yvf/kybyXKOtY0GI5XU+iz1sQUCsUyNZQpBJPX/LFVwuKRp4ImbN/L983Zx6JYNmG17" "+0qrp0/AfPplYb/oDxcRRW0bdJI2MMnihXLWlztsuMgRz3AIHTSP0Mnrsu44bmQhNaWHRare" "eWTlDN19s/jVwt5f/xI/np5MZ1D9VhOmtpgnvo5cuRX/0Qc46/BOLh1bn7i/uccbi3YrKhtg" "1COmSE1ywYI0iHoEKQvkgvN59nceYs/j24iTfdWd0yjW+UWB6oq9QOXn/r7WTFZatn4I7KRi" "Wy0seuJ9CeqkLl3bTL/JkVrloMZYCiCtFjUESmVK8XuUXBVhSj2qLj1wCLrNMDXl+58zpfhJ" "xWqrDn+0fjB1m6m/O6OlVlVpoRZN37GS7/0ve522HujlPNIrSA6ql830fv53GICPfewXf89T" "T6Ua1sdPAiFMTp5MFDv9b/5rxoBexoj+W07y//T1L33Pqfj8gQEN1utqmcEtGKyBAQ3WwIAG" "a2BAgzUwoMEarIEBrfTEdzm1TyK/200/3ZdldoMIm8QhbSv1OvFecSBOkIQHJf2+LWL7ny2b" "djo5Ieaw/J5BGv8aNKbaNIwqcmQ3Z84t4scuJBx9HvaflR7wZv3qfvOQr6jWHIELO7jGEuGx" "MeI5F7P48TUsttvKCR2x1F90KvXDBgb0KpqOKkxDth586HHjk0/yl+PDXG6o1aa1ni+rR6rL" "eipWqqSqWClloRw/tMBMBfe+9U38hQh7tIWRZWTMTgf3V7A1sScHW9hryIjYYddDBqx9bIq3" "2Aqbm6QWrTU55OSuIVNfXglZAFvhvWVEHRftPcjm3ZFLZpWJOx9P0AlBpNXepK32NlHklLSO" "DDzQq2tBFpW18Rjv3v1jPjq6ijf5nFXLkUuZ+pKiwVdQszrSxGv9/qXjJe5AFz+zyMGjc9x/" "y3v5q2F4eLXo/MkTZqcKRjXwQK/i2pIILRPPHOR9oxNcLZ5VWqVma1NQ5uBz8JkScgOZEDIh" "mATwpGcwC2XquW4MkQ8N85ZHd3PrGbDqYy/p9ToRVA8M6LTNuk5e90xL3oIzZn/M5VWXK51j" "tXMUQaBQKDP8koOOh57DFUCMOA1AIESlPFaRHwqEXg7Gs2p8NesOH+Y3HzjM1Xeo5IrkrbaY" "5X79gQGdjutnpyxERC5fzyrguqePc5sYRrWiNAXSqAiulg1ypBk0p+AjwemyDIOLQjW/WAOv" "CiCm1zUdY7unuG225NLj0OgjYU5VJ8DAgF5ZDJNqNIK0BYtg66JNTcTbXl8IbQy7xLNLvE7h" "3gjjB5/npobnqszSyBxeBbE2eZmGARdBIkFDAlxVDlc6XOVhvkveq0BdwtioSzP6fojhzHHj" "g49xyyoYvWc6cZZSzej/frmBFbySDCTBr1L1TqKSmNcj0+LOWk+1IfVGG9imolqxC8MGdDNi" "74Kzjx3nPUOjXJPZNP1cpjEhAokaYhLIw1mXIA0AlaU3WxGP9BhSn0aunSEYqMqSrJmxyp/N" "qmOz2B/MMbV5PTP3TAubVXsDD7TSNqeUGkfYXqWxLoEW3HIJxU/btTQULVokyEPrp1LtOSZD" "34B1R/6TmzLh7LweZ62qmidUEPKYgmYczkHwQLOilIIgii51GSpqEpo1BFVcDGSSPqdnHKVU" "jP7we9xawLrfWM9wuy321DxEgzT+f73abbGTAJOJ4/hyYU8LDK1+K6vq0pKc3yzY/NijfGRi" "NZf7nDVlrGfJXErdK8FjIdRzG1VVq00LLETK5+bxlUuGg1IieDHpNTECFkJg5tB+9l+wnr99" "z8X8o8jkQdVWMTCgFRUCJTTx8i0UNW1gC1JDopbxNX3z8oqc/9RuPmVL3pU1WeUgO3kbSApQ" "hBARY6iqCuMMJhh8tJSH5vCzBVQ1SBQL9eQSqnVIopSq+Eoo52d46rob+IOlBg9teNEk7GAL" "WzFJVrtd30clbkGqBNvHkCSkqlZb9PARaSoyNjPNr1YdbhweYa0RhirBhfrqSdLsUWhIRS49" "vFdyL/hK4dgScqyCMiMECyScDZpoaI7a+dTOrzQGwTD+4P3c9itw2SAGWnkxkFWELVuo2m3M" "i91RTXwUYXILhjWMApfuP8o7G0OMOg8NC7lJ15CFUZd+5lDmhjCc4xoWqnQVcyWujISouBAo" "q5JuVEoRQv+KAjHgEbwqbngUHyM3TsMVgyxs5a3YV7dgkjiJ2BYifRiUoLEW7i7XIDxyiKsf" "O8a1Y0LWLECVYAyuhEIrjDU4rQmuNplg0uG1EA1aGBCHayYymg8G39ekWdbxEILLksCLKGFh" "hs7wEP9wJTw4MKCVFgMJTCkOJPQZh4CPNHmvAAAEW0lEQVS5BClIku66pS18EvzFsNgd5zsP" "HOKioSW2rD6TEYG8FiQSUVyVdsTCCZlEqLKaCFtBLuRrJ+gOQSP0xWMqQldxmT8RQNfah04r" "yhAp1fH8229gJ+gLgy1sha1JxfTTdcCg20WQqtXCtNpi7kR8azLVg+5tM//BnOeu/BD/4iJz" "3lB5ITQ8NATJPeQecovxSVU+GE2/NzaxFmfnaUShlyLmRLz3hhAKCD2CSKKoIYRYMX/0EE++" "4Y185YKMuZ2yfdBQtnKzsGUsb2IcohGwisRNm7A7diQZKxHsDpWJHz7C7x94gtsnzqHhLGdY" "xQtgPIQSjFCqQjSId7iooBFcSVgzhhtrJu+jBmeqZEjWQOhB1qAoI9nxo+wrI1/+8Dv50iLs" "XYUeH3igFZmEJYpq33hSYbEuTqPs3EldmRGHbpJzoXfN5dxdFHxzaRFsA2998jCmRmoahxeD" "d+CqsiaQWhCPm5lP6kJqcDFQVrXxAIiHIiDGgsL8VVfwzQye/v70ySS0gQGtzFw+UeSTYB7b" "abVFYbvU9SAVISo7+SkUuzP2XfxWvrLUYSYupS0pkGiuIjX4vF8XkloZyEC0UChhYQlXViz1" "tcm1qoNoB2LoHnuBpycm+NoNa3l2GsItl1DIKToLG2xhp2pr40QTV1/7LJ2ztozqZPwBcv49" "O7l9/hAfHD+TUe8Y66OGjOt3FCbDsBZCJFRAA5ypYM04DFt6piJXk2QUVKG7xMGjh5l6/618" "dggeGUOPgcj2Nn7rpBYDD7Ri87H+9EMynD7fWoSTjAdUJyPAkWPMvn0jX4s9prSHsY6mdeTi" "yJezKU6QX4kJWBWUshSY7UBRYaiNB9Khamee4+dcwN8Dj49BMY3k05BtfREVZGBAK8Vw6nGZ" "PiCzL4aSDKr+12X1xVYLswWxCMIxehfCo+dfwT9151kwUGoJHhClp5EQI0FcrYZoCdbWX+Bh" "sQe9Al9VScClqlhc6HC42WTX+69h6lzhCOjCerR3iVAkePlgC3vNbXXPIefe9U0+Nb/Ab42u" "Ris4I7cMiyEYTYVFtUkVsfZuSC1l6BRdPYFOOPJykeNH9/Ho297BF/wIOy9CZxSKl26nAw/0" "Wlq7drklKK59L/+62OWZostQ1kTwSW+1FEIJIZSUfeC6A7zgreCjJ+ssIUsQOj06+Tj/dsEI" "//FG6Ewhes+05HuQTBE7aOd4ja4//pw03/1H+Afu5316gE+vOYcLok2wzr7PiCZlWq72QMu+" "xBC0xK0dJxQLPLzpJm6/GB5Om57UpxyndrBwcJTxKq7bbxf/1FOUe8+jeNd7ufeHd7NucT9X" "+AYOh4lKJYIxDmMEEwOqSrQGj1JVBSGr6B59luzq6/jamfA0aNi5SdymVH86IYV9Cgthg+tV" "g4iegHtu24FbBnjWSit31PBOdJsBFVpql3+qus1KvlnJefzKbFKxGzfiEpgUAf5fYJ6DLWyw" "BkH0YA0MaLBO0/Vfxn1mvuTe8FMAAAAASUVORK5CYII=") getMASSIVElogoTransparent144x144Data = MASSIVElogoTransparent144x144.GetData getMASSIVElogoTransparent144x144Image = MASSIVElogoTransparent144x144.GetImage getMASSIVElogoTransparent144x144Bitmap = MASSIVElogoTransparent144x144.GetBitmap
gpl-3.0
kyroskoh/phantomjs
src/qt/qtwebkit/Tools/Scripts/webkitpy/tool/steps/haslanded_unittest.py
124
8125
# Copyright (C) 2009 Google Inc. All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: # # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above # copyright notice, this list of conditions and the following disclaimer # in the documentation and/or other materials provided with the # distribution. # * Neither the name of Google Inc. nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. import unittest2 as unittest import subprocess from webkitpy.tool.steps.haslanded import HasLanded class HasLandedTest(unittest.TestCase): maxDiff = None @unittest.skipUnless(subprocess.call('which interdiff', shell=True, stdout=subprocess.PIPE, stderr=subprocess.PIPE) == 0, "requires interdiff") def test_run(self): # These patches require trailing whitespace to remain valid patches. diff1 = """\ Index: a.py =================================================================== --- a.py +++ a.py @@ -1,3 +1,5 @@ A B C +D +E Index: b.py =================================================================== --- b.py 2013-01-21 15:20:59.693887185 +1100 +++ b.py 2013-01-21 15:22:24.382555711 +1100 @@ -1,3 +1,5 @@ 1 2 3 +4 +5 """ diff1_add_line = """\ Index: a.py =================================================================== --- a.py +++ a.py @@ -1,3 +1,6 @@ A B C +D +E +F Index: b.py =================================================================== --- b.py +++ b.py @@ -1,3 +1,5 @@ 1 2 3 +4 +5 """ diff1_remove_line = """\ Index: a.py =================================================================== --- a.py +++ a.py @@ -1,3 +1,4 @@ A B C +D Index: b.py =================================================================== --- b.py +++ b.py @@ -1,3 +1,5 @@ 1 2 3 +4 +5 """ diff1_add_file = diff1 + """\ Index: c.py =================================================================== --- c.py +++ c.py @@ -1,3 +1,5 @@ 1 2 3 +4 +5 """ diff1_remove_file = """\ Index: a.py =================================================================== --- a.py +++ a.py @@ -1,3 +1,5 @@ A B C +D +E """ self.assertMultiLineEqual( HasLanded.diff_diff(diff1, diff1_add_line, '', 'add-line'), """\ diff -u a.py a.py --- a.py +++ a.py @@ -5,0 +6 @@ +F """) self.assertMultiLineEqual( HasLanded.diff_diff(diff1, diff1_remove_line, '', 'remove-line'), """\ diff -u a.py a.py --- a.py +++ a.py @@ -5 +4,0 @@ -E """) self.assertMultiLineEqual( HasLanded.diff_diff(diff1, diff1_add_file, '', 'add-file'), """\ only in patch2: unchanged: --- c.py +++ c.py @@ -1,3 +1,5 @@ 1 2 3 +4 +5 """) self.assertMultiLineEqual( HasLanded.diff_diff(diff1, diff1_remove_file, '', 'remove-file'), """\ reverted: --- b.py 2013-01-21 15:22:24.382555711 +1100 +++ b.py 2013-01-21 15:20:59.693887185 +1100 @@ -1,5 +1,3 @@ 1 2 3 -4 -5 """) def test_convert_to_svn_and_strip_change_log(self): # These patches require trailing whitespace to remain valid patches. testbefore1 = HasLanded.convert_to_svn("""\ diff --git a/Tools/ChangeLog b/Tools/ChangeLog index 219ba72..0390b73 100644 --- a/Tools/ChangeLog +++ b/Tools/ChangeLog @@ -1,3 +1,32 @@ +2013-01-17 Tim 'mithro' Ansell <mithro@mithis.com> + + Adding "has-landed" command to webkit-patch which allows a person to + Reviewed by NOBODY (OOPS!). + 2013-01-20 Tim 'mithro' Ansell <mithro@mithis.com> Extend diff_parser to support the --full-index output. diff --git a/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py b/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py index 4bf8ec6..3a128cb 100644 --- a/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py +++ b/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py @@ -28,6 +28,8 @@ +import re + from .attachment import Attachment """) testafter1 = HasLanded.convert_to_svn("""\ diff --git a/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py b/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py index 4bf8ec6..3a128cb 100644 --- a/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py +++ b/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py @@ -28,6 +28,8 @@ +import re + from .attachment import Attachment diff --git a/Tools/ChangeLog b/Tools/ChangeLog index 219ba72..0390b73 100644 --- a/Tools/ChangeLog +++ b/Tools/ChangeLog @@ -1,3 +1,32 @@ +2013-01-17 Tim 'mithro' Ansell <mithro@mithis.com> + + Adding "has-landed" command to webkit-patch which allows a person to + Reviewed by NOBODY (OOPS!). + 2013-01-20 Tim 'mithro' Ansell <mithro@mithis.com> Extend diff_parser to support the --full-index output. """) testexpected1 = """\ Index: Tools/Scripts/webkitpy/common/net/bugzilla/bug.py =================================================================== --- Tools/Scripts/webkitpy/common/net/bugzilla/bug.py +++ Tools/Scripts/webkitpy/common/net/bugzilla/bug.py @@ -28,6 +28,8 @@ +import re + from .attachment import Attachment """ testmiddle1 = HasLanded.convert_to_svn("""\ diff --git a/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py b/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py index 4bf8ec6..3a128cb 100644 --- a/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py +++ b/Tools/Scripts/webkitpy/common/net/bugzilla/bug.py @@ -28,6 +28,8 @@ +import re + from .attachment import Attachment diff --git a/ChangeLog b/ChangeLog index 219ba72..0390b73 100644 --- a/ChangeLog +++ b/ChangeLog @@ -1,3 +1,32 @@ +2013-01-17 Tim 'mithro' Ansell <mithro@mithis.com> + + Adding "has-landed" command to webkit-patch which allows a person to + Reviewed by NOBODY (OOPS!). + 2013-01-20 Tim 'mithro' Ansell <mithro@mithis.com> Extend diff_parser to support the --full-index output. diff --git a/Tools/Scripts/webkitpy/common/other.py b/Tools/Scripts/webkitpy/common/other.py index 4bf8ec6..3a128cb 100644 --- a/Tools/Scripts/webkitpy/common/other.py +++ b/Tools/Scripts/webkitpy/common/other.py @@ -28,6 +28,8 @@ +import re + from .attachment import Attachment """) testexpected2 = """\ Index: Tools/Scripts/webkitpy/common/net/bugzilla/bug.py =================================================================== --- Tools/Scripts/webkitpy/common/net/bugzilla/bug.py +++ Tools/Scripts/webkitpy/common/net/bugzilla/bug.py @@ -28,6 +28,8 @@ +import re + from .attachment import Attachment Index: Tools/Scripts/webkitpy/common/other.py =================================================================== --- Tools/Scripts/webkitpy/common/other.py +++ Tools/Scripts/webkitpy/common/other.py @@ -28,6 +28,8 @@ +import re + from .attachment import Attachment """ self.assertMultiLineEqual(testexpected1, HasLanded.strip_change_log(testbefore1)) self.assertMultiLineEqual(testexpected1, HasLanded.strip_change_log(testafter1)) self.assertMultiLineEqual(testexpected2, HasLanded.strip_change_log(testmiddle1))
bsd-3-clause
alex/sqlalchemy
test/dialect/postgresql/test_reflection.py
2
18054
# coding: utf-8 from sqlalchemy.testing.assertions import eq_, assert_raises, \ assert_raises_message, is_, AssertsExecutionResults, \ AssertsCompiledSQL, ComparesTables from sqlalchemy.testing import engines, fixtures from sqlalchemy import testing from sqlalchemy import Table, Column, select, MetaData, text, Integer, \ String, Sequence, ForeignKey, join, Numeric, \ PrimaryKeyConstraint, DateTime, tuple_, Float, BigInteger, \ func, literal_column, literal, bindparam, cast, extract, \ SmallInteger, Enum, REAL, update, insert, Index, delete, \ and_, Date, TypeDecorator, Time, Unicode, Interval, or_, Text from sqlalchemy import exc from sqlalchemy.dialects.postgresql import base as postgresql import logging class DomainReflectionTest(fixtures.TestBase, AssertsExecutionResults): """Test PostgreSQL domains""" __only_on__ = 'postgresql' @classmethod def setup_class(cls): con = testing.db.connect() for ddl in \ 'CREATE DOMAIN testdomain INTEGER NOT NULL DEFAULT 42', \ 'CREATE DOMAIN test_schema.testdomain INTEGER DEFAULT 0', \ "CREATE TYPE testtype AS ENUM ('test')", \ 'CREATE DOMAIN enumdomain AS testtype'\ : try: con.execute(ddl) except exc.DBAPIError as e: if not 'already exists' in str(e): raise e con.execute('CREATE TABLE testtable (question integer, answer ' 'testdomain)') con.execute('CREATE TABLE test_schema.testtable(question ' 'integer, answer test_schema.testdomain, anything ' 'integer)') con.execute('CREATE TABLE crosschema (question integer, answer ' 'test_schema.testdomain)') con.execute('CREATE TABLE enum_test (id integer, data enumdomain)') @classmethod def teardown_class(cls): con = testing.db.connect() con.execute('DROP TABLE testtable') con.execute('DROP TABLE test_schema.testtable') con.execute('DROP TABLE crosschema') con.execute('DROP DOMAIN testdomain') con.execute('DROP DOMAIN test_schema.testdomain') con.execute("DROP TABLE enum_test") con.execute("DROP DOMAIN enumdomain") con.execute("DROP TYPE testtype") def test_table_is_reflected(self): metadata = MetaData(testing.db) table = Table('testtable', metadata, autoload=True) eq_(set(table.columns.keys()), set(['question', 'answer']), "Columns of reflected table didn't equal expected columns") assert isinstance(table.c.answer.type, Integer) def test_domain_is_reflected(self): metadata = MetaData(testing.db) table = Table('testtable', metadata, autoload=True) eq_(str(table.columns.answer.server_default.arg), '42', "Reflected default value didn't equal expected value") assert not table.columns.answer.nullable, \ 'Expected reflected column to not be nullable.' def test_enum_domain_is_reflected(self): metadata = MetaData(testing.db) table = Table('enum_test', metadata, autoload=True) eq_( table.c.data.type.enums, ('test', ) ) def test_table_is_reflected_test_schema(self): metadata = MetaData(testing.db) table = Table('testtable', metadata, autoload=True, schema='test_schema') eq_(set(table.columns.keys()), set(['question', 'answer', 'anything']), "Columns of reflected table didn't equal expected columns") assert isinstance(table.c.anything.type, Integer) def test_schema_domain_is_reflected(self): metadata = MetaData(testing.db) table = Table('testtable', metadata, autoload=True, schema='test_schema') eq_(str(table.columns.answer.server_default.arg), '0', "Reflected default value didn't equal expected value") assert table.columns.answer.nullable, \ 'Expected reflected column to be nullable.' def test_crosschema_domain_is_reflected(self): metadata = MetaData(testing.db) table = Table('crosschema', metadata, autoload=True) eq_(str(table.columns.answer.server_default.arg), '0', "Reflected default value didn't equal expected value") assert table.columns.answer.nullable, \ 'Expected reflected column to be nullable.' def test_unknown_types(self): from sqlalchemy.databases import postgresql ischema_names = postgresql.PGDialect.ischema_names postgresql.PGDialect.ischema_names = {} try: m2 = MetaData(testing.db) assert_raises(exc.SAWarning, Table, 'testtable', m2, autoload=True) @testing.emits_warning('Did not recognize type') def warns(): m3 = MetaData(testing.db) t3 = Table('testtable', m3, autoload=True) assert t3.c.answer.type.__class__ == sa.types.NullType finally: postgresql.PGDialect.ischema_names = ischema_names class ReflectionTest(fixtures.TestBase): __only_on__ = 'postgresql' @testing.fails_if(('postgresql', '<', (8, 4)), "newer query is bypassed due to unsupported SQL functions") @testing.provide_metadata def test_reflected_primary_key_order(self): meta1 = self.metadata subject = Table('subject', meta1, Column('p1', Integer, primary_key=True), Column('p2', Integer, primary_key=True), PrimaryKeyConstraint('p2', 'p1') ) meta1.create_all() meta2 = MetaData(testing.db) subject = Table('subject', meta2, autoload=True) eq_(subject.primary_key.columns.keys(), ['p2', 'p1']) @testing.provide_metadata def test_pg_weirdchar_reflection(self): meta1 = self.metadata subject = Table('subject', meta1, Column('id$', Integer, primary_key=True)) referer = Table('referer', meta1, Column('id', Integer, primary_key=True), Column('ref', Integer, ForeignKey('subject.id$'))) meta1.create_all() meta2 = MetaData(testing.db) subject = Table('subject', meta2, autoload=True) referer = Table('referer', meta2, autoload=True) self.assert_((subject.c['id$'] == referer.c.ref).compare( subject.join(referer).onclause)) @testing.provide_metadata def test_renamed_sequence_reflection(self): metadata = self.metadata t = Table('t', metadata, Column('id', Integer, primary_key=True)) metadata.create_all() m2 = MetaData(testing.db) t2 = Table('t', m2, autoload=True, implicit_returning=False) eq_(t2.c.id.server_default.arg.text, "nextval('t_id_seq'::regclass)") r = t2.insert().execute() eq_(r.inserted_primary_key, [1]) testing.db.connect().execution_options(autocommit=True).\ execute('alter table t_id_seq rename to foobar_id_seq' ) m3 = MetaData(testing.db) t3 = Table('t', m3, autoload=True, implicit_returning=False) eq_(t3.c.id.server_default.arg.text, "nextval('foobar_id_seq'::regclass)") r = t3.insert().execute() eq_(r.inserted_primary_key, [2]) @testing.provide_metadata def test_renamed_pk_reflection(self): metadata = self.metadata t = Table('t', metadata, Column('id', Integer, primary_key=True)) metadata.create_all() testing.db.connect().execution_options(autocommit=True).\ execute('alter table t rename id to t_id') m2 = MetaData(testing.db) t2 = Table('t', m2, autoload=True) eq_([c.name for c in t2.primary_key], ['t_id']) @testing.provide_metadata def test_schema_reflection(self): """note: this test requires that the 'test_schema' schema be separate and accessible by the test user""" meta1 = self.metadata users = Table('users', meta1, Column('user_id', Integer, primary_key=True), Column('user_name', String(30), nullable=False), schema='test_schema') addresses = Table( 'email_addresses', meta1, Column('address_id', Integer, primary_key=True), Column('remote_user_id', Integer, ForeignKey(users.c.user_id)), Column('email_address', String(20)), schema='test_schema', ) meta1.create_all() meta2 = MetaData(testing.db) addresses = Table('email_addresses', meta2, autoload=True, schema='test_schema') users = Table('users', meta2, mustexist=True, schema='test_schema') j = join(users, addresses) self.assert_((users.c.user_id == addresses.c.remote_user_id).compare(j.onclause)) @testing.provide_metadata def test_schema_reflection_2(self): meta1 = self.metadata subject = Table('subject', meta1, Column('id', Integer, primary_key=True)) referer = Table('referer', meta1, Column('id', Integer, primary_key=True), Column('ref', Integer, ForeignKey('subject.id')), schema='test_schema') meta1.create_all() meta2 = MetaData(testing.db) subject = Table('subject', meta2, autoload=True) referer = Table('referer', meta2, schema='test_schema', autoload=True) self.assert_((subject.c.id == referer.c.ref).compare( subject.join(referer).onclause)) @testing.provide_metadata def test_schema_reflection_3(self): meta1 = self.metadata subject = Table('subject', meta1, Column('id', Integer, primary_key=True), schema='test_schema_2') referer = Table('referer', meta1, Column('id', Integer, primary_key=True), Column('ref', Integer, ForeignKey('test_schema_2.subject.id')), schema='test_schema') meta1.create_all() meta2 = MetaData(testing.db) subject = Table('subject', meta2, autoload=True, schema='test_schema_2') referer = Table('referer', meta2, schema='test_schema', autoload=True) self.assert_((subject.c.id == referer.c.ref).compare( subject.join(referer).onclause)) @testing.provide_metadata def test_uppercase_lowercase_table(self): metadata = self.metadata a_table = Table('a', metadata, Column('x', Integer)) A_table = Table('A', metadata, Column('x', Integer)) a_table.create() assert testing.db.has_table("a") assert not testing.db.has_table("A") A_table.create(checkfirst=True) assert testing.db.has_table("A") def test_uppercase_lowercase_sequence(self): a_seq = Sequence('a') A_seq = Sequence('A') a_seq.create(testing.db) assert testing.db.dialect.has_sequence(testing.db, "a") assert not testing.db.dialect.has_sequence(testing.db, "A") A_seq.create(testing.db, checkfirst=True) assert testing.db.dialect.has_sequence(testing.db, "A") a_seq.drop(testing.db) A_seq.drop(testing.db) def test_schema_reflection_multi_search_path(self): """test the 'set the same schema' rule when multiple schemas/search paths are in effect.""" db = engines.testing_engine() conn = db.connect() trans = conn.begin() try: conn.execute("set search_path to test_schema_2, " "test_schema, public") conn.dialect.default_schema_name = "test_schema_2" conn.execute(""" CREATE TABLE test_schema.some_table ( id SERIAL not null primary key ) """) conn.execute(""" CREATE TABLE test_schema_2.some_other_table ( id SERIAL not null primary key, sid INTEGER REFERENCES test_schema.some_table(id) ) """) m1 = MetaData() t2_schema = Table('some_other_table', m1, schema="test_schema_2", autoload=True, autoload_with=conn) t1_schema = Table('some_table', m1, schema="test_schema", autoload=True, autoload_with=conn) t2_no_schema = Table('some_other_table', m1, autoload=True, autoload_with=conn) t1_no_schema = Table('some_table', m1, autoload=True, autoload_with=conn) # OK, this because, "test_schema" is # in the search path, and might as well be # the default too. why would we assign # a "schema" to the Table ? assert t2_schema.c.sid.references( t1_no_schema.c.id) assert t2_no_schema.c.sid.references( t1_no_schema.c.id) finally: trans.rollback() conn.close() db.dispose() @testing.provide_metadata def test_index_reflection(self): """ Reflecting partial & expression-based indexes should warn """ metadata = self.metadata t1 = Table('party', metadata, Column('id', String(10), nullable=False), Column('name', String(20), index=True), Column('aname', String(20))) metadata.create_all() testing.db.execute(""" create index idx1 on party ((id || name)) """) testing.db.execute(""" create unique index idx2 on party (id) where name = 'test' """) testing.db.execute(""" create index idx3 on party using btree (lower(name::text), lower(aname::text)) """) def go(): m2 = MetaData(testing.db) t2 = Table('party', m2, autoload=True) assert len(t2.indexes) == 2 # Make sure indexes are in the order we expect them in tmp = [(idx.name, idx) for idx in t2.indexes] tmp.sort() r1, r2 = [idx[1] for idx in tmp] assert r1.name == 'idx2' assert r1.unique == True assert r2.unique == False assert [t2.c.id] == r1.columns assert [t2.c.name] == r2.columns testing.assert_warnings(go, [ 'Skipped unsupported reflection of ' 'expression-based index idx1', 'Predicate of partial index idx2 ignored during ' 'reflection', 'Skipped unsupported reflection of ' 'expression-based index idx3' ]) @testing.provide_metadata def test_index_reflection_modified(self): """reflect indexes when a column name has changed - PG 9 does not update the name of the column in the index def. [ticket:2141] """ metadata = self.metadata t1 = Table('t', metadata, Column('id', Integer, primary_key=True), Column('x', Integer) ) metadata.create_all() conn = testing.db.connect().execution_options(autocommit=True) conn.execute("CREATE INDEX idx1 ON t (x)") conn.execute("ALTER TABLE t RENAME COLUMN x to y") ind = testing.db.dialect.get_indexes(conn, "t", None) eq_(ind, [{'unique': False, 'column_names': ['y'], 'name': 'idx1'}]) conn.close() class CustomTypeReflectionTest(fixtures.TestBase): class CustomType(object): def __init__(self, arg1=None, arg2=None): self.arg1 = arg1 self.arg2 = arg2 ischema_names = None def setup(self): ischema_names = postgresql.PGDialect.ischema_names postgresql.PGDialect.ischema_names = ischema_names.copy() self.ischema_names = ischema_names def teardown(self): postgresql.PGDialect.ischema_names = self.ischema_names self.ischema_names = None def _assert_reflected(self, dialect): for sch, args in [ ('my_custom_type', (None, None)), ('my_custom_type()', (None, None)), ('my_custom_type(ARG1)', ('ARG1', None)), ('my_custom_type(ARG1, ARG2)', ('ARG1', 'ARG2')), ]: column_info = dialect._get_column_info( 'colname', sch, None, False, {}, {}, 'public') assert isinstance(column_info['type'], self.CustomType) eq_(column_info['type'].arg1, args[0]) eq_(column_info['type'].arg2, args[1]) def test_clslevel(self): postgresql.PGDialect.ischema_names['my_custom_type'] = self.CustomType dialect = postgresql.PGDialect() self._assert_reflected(dialect) def test_instancelevel(self): dialect = postgresql.PGDialect() dialect.ischema_names = dialect.ischema_names.copy() dialect.ischema_names['my_custom_type'] = self.CustomType self._assert_reflected(dialect)
mit
peterrenshaw/socsim
setup.py
1
1400
#!/usr/bin/env python # ~*~ encoding: utf-8 ~*~ """ This file is part of SOCSIM. SOCSIM is free software: you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. SOCSIM is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with SOCSIM. If not, see <http://www.gnu.org/licenses/>. """ import os from setuptools import setup from setuptools import find_packages from socsim import __version__ def read(fname): return open(os.path.join(os.path.dirname(__file__), fname)).read() setup(name = "socsim", version = __version__, description = 'social media simulation tools', long_description=read('README'), license = 'GNU GPL 3.0', author = "Peter Renshaw", author_email = "goonmail@netspace.net.au", url = 'https://github.com/peterrenshaw/socsim', packages = find_packages(), keywords = ['message','testing','human','response'], zip_safe = True) # vim: ff=unix:ts=4:sw=4:tw=78:noai:expandtab
gpl-3.0
yashu-seth/BinPy
BinPy/analog/source.py
5
2824
from math import * from BinPy import * class Source: "This class represents a base class for the signal source" def __init__(self, equation, params): self.params = params self.equation = equation def setParam(self, param, value): if not isinstance(self.params[param], type(value)): raise Exception("Invalid Value") self.params[param] = value self.trigger() def setParams(self, params): for i in params: self.setParam(i, params[i]) def getParams(self): self.trigger() return self.params def setEquation(self, equation): self.equation = equation self.trigger() def evaluate(self): for i in self.params: exec("%s=%f" % (i, self.params[i])) self.val = eval(self.equation) return self.val def setoutput(self, param, value): if not isinstance(value, Connector): raise Exception("Expecting a Connector Class Object") self.params[param] = value class VoltageSource(Source): def __init__(self, equation, params): Source.__init__(self, equation, params) self.params.update({'H': Connector(0), 'L': Connector(0)}) self.trigger() def trigger(self): self.params['H'].state = self.evaluate() + self.params['L'].state class CurrentSource(Source): def __init__(self, equation, params): Source.__init__(self, equation, params) self.params.update({'H': Connector(0), 'L': Connector(0)}) self.trigger() def trigger(self): self.params['i'] = self.evaluate() class SinWaveVoltageSource(VoltageSource): def __init__(self, amplitude=0, frequency=0, time=0, epoch=0): equation = 'V*round(sin(radians((w*t)+e)), 2)' params = {'V': amplitude, 'w': frequency, 't': time, 'e': epoch} VoltageSource.__init__(self, equation, params) class CosWaveVoltageSource(VoltageSource): def __init__(self, amplitude=0, frequency=0, time=0, epoch=0): equation = 'V*round(cos(radians((w*t)+e)), 2)' params = {'V': amplitude, 'w': frequency, 't': time, 'e': epoch} VoltageSource.__init__(self, equation, params) class SinWaveCurrentSource(CurrentSource): def __init__(self, amplitude=0, frequency=0, time=0, epoch=0): equation = 'I*round(sin(radians((w*t)+e)), 2)' params = {'I': amplitude, 'w': frequency, 't': time, 'e': epoch} CurrentSource.__init__(self, equation, params) class CosWaveCurrentSource(CurrentSource): def __init__(self, amplitude=0, frequency=0, time=0, epoch=0): equation = 'I*round(cos(radians((w*t)+e)), 2)' params = {'I': amplitude, 'w': frequency, 't': time, 'e': epoch} CurrentSource.__init__(self, equation, params)
bsd-3-clause
judaba13/GenrePredictor
hdf5_utils.py
1
28730
""" Thierry Bertin-Mahieux (2010) Columbia University tb2332@columbia.edu This code contains a set of routines to create HDF5 files containing features and metadata of a song. This is part of the Million Song Dataset project from LabROSA (Columbia University) and The Echo Nest. Copyright 2010, Thierry Bertin-Mahieux This program is free software: you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with this program. If not, see <http://www.gnu.org/licenses/>. """ import os import sys import numpy as np # code relies on pytables, see http://www.pytables.org import tables import hdf5_descriptors as DESC from hdf5_getters import * # musicbrainz related stuff try: from MBrainzDB import query as QUERYMB except ImportError: print 'need pg module and MBrainzDB folder of Python source code if you' print 'want to use musicbrainz related functions, e.g. fill_hdf5_from_musicbrainz' # description of the different arrays in the song file ARRAY_DESC_SIMILAR_ARTISTS = 'array of similar artists Echo Nest id' ARRAY_DESC_ARTIST_TERMS = 'array of terms (Echo Nest tags) for an artist' ARRAY_DESC_ARTIST_TERMS_FREQ = 'array of term (Echo Nest tags) frequencies for an artist' ARRAY_DESC_ARTIST_TERMS_WEIGHT = 'array of term (Echo Nest tags) weights for an artist' ARRAY_DESC_SEGMENTS_START = 'array of start times of segments' ARRAY_DESC_SEGMENTS_CONFIDENCE = 'array of confidence of segments' ARRAY_DESC_SEGMENTS_PITCHES = 'array of pitches of segments (chromas)' ARRAY_DESC_SEGMENTS_TIMBRE = 'array of timbre of segments (MFCC-like)' ARRAY_DESC_SEGMENTS_LOUDNESS_MAX = 'array of max loudness of segments' ARRAY_DESC_SEGMENTS_LOUDNESS_MAX_TIME = 'array of max loudness time of segments' ARRAY_DESC_SEGMENTS_LOUDNESS_START = 'array of loudness of segments at start time' ARRAY_DESC_SECTIONS_START = 'array of start times of sections' ARRAY_DESC_SECTIONS_CONFIDENCE = 'array of confidence of sections' ARRAY_DESC_BEATS_START = 'array of start times of beats' ARRAY_DESC_BEATS_CONFIDENCE = 'array of confidence of sections' ARRAY_DESC_BARS_START = 'array of start times of bars' ARRAY_DESC_BARS_CONFIDENCE = 'array of confidence of bars' ARRAY_DESC_TATUMS_START = 'array of start times of tatums' ARRAY_DESC_TATUMS_CONFIDENCE = 'array of confidence of tatums' ARRAY_DESC_ARTIST_MBTAGS = 'array of tags from MusicBrainz for an artist' ARRAY_DESC_ARTIST_MBTAGS_COUNT = 'array of tag counts from MusicBrainz for an artist' def fill_hdf5_from_artist(h5,artist): """ Fill an open hdf5 using all content in a artist object from the Echo Nest python API There could be overlap with fill_from_song and fill_from_track, we assume the data is consistent! """ # get the metadata table, fill it metadata = h5.root.metadata.songs metadata.cols.artist_id[0] = artist.id idsplitter = lambda x,y: x.split(':')[2] if x else y metadata.cols.artist_mbid[0] = idsplitter(artist.get_foreign_id(idspace='musicbrainz'),'') metadata.cols.artist_playmeid[0] = int(idsplitter(artist.get_foreign_id(idspace='playme'),-1)) metadata.cols.artist_7digitalid[0] = int(idsplitter(artist.get_foreign_id(idspace='7digital'),-1)) # fill the metadata arrays group = h5.root.metadata metadata.cols.idx_similar_artists[0] = 0 group.similar_artists.append( np.array(map(lambda x : x.id,artist.get_similar(results=100)),dtype='string') ) metadata.cols.idx_artist_terms[0] = 0 group.artist_terms.append( np.array(map(lambda x : x.name,artist.get_terms()),dtype='string') ) group.artist_terms_freq.append( np.array(map(lambda x : x.frequency,artist.get_terms()),dtype='float64') ) group.artist_terms_weight.append( np.array(map(lambda x : x.weight,artist.get_terms()),dtype='float64') ) # done, flush metadata.flush() def fill_hdf5_from_song(h5,song): """ Fill an open hdf5 using all the content in a song object from the Echo Nest python API. Usually, fill_hdf5_from_track() will have been called first. """ # get the metadata table, fill it metadata = h5.root.metadata.songs metadata.cols.artist_familiarity[0] = song.get_artist_familiarity() metadata.cols.artist_hotttnesss[0] = song.get_artist_hotttnesss() metadata.cols.artist_id[0] = song.artist_id metadata.cols.artist_latitude[0] = song.get_artist_location().latitude metadata.cols.artist_location[0] = song.get_artist_location().location.encode('utf-8') if song.get_artist_location().location else '' metadata.cols.artist_longitude[0] = song.get_artist_location().longitude metadata.cols.artist_name[0] = song.artist_name.encode('utf-8') if song.artist_name else '' metadata.cols.song_id[0] = song.id metadata.cols.song_hotttnesss[0] = song.get_song_hotttnesss() metadata.cols.title[0] = song.title.encode('utf-8') if song.title else '' metadata.flush() # get the analysis table analysis = h5.root.analysis.songs analysis.danceability = song.get_audio_summary().danceability analysis.energy = song.get_audio_summary().energy analysis.flush() def fill_hdf5_from_track(h5,track): """ Fill an open hdf5 using all the content in a track object from the Echo Nest python API """ # get the metadata table, fill it metadata = h5.root.metadata.songs #metadata.cols.analyzer_version[0] = track.analyzer_version metadata.cols.artist_name[0] = getattr(track, 'artist', u'').encode('utf-8') metadata.cols.release[0] = getattr(track, 'release', u'').encode('utf-8') metadata.cols.title[0] = getattr(track, 'title', u'').encode('utf-8') idsplitter_7digital = lambda x: int(x.split(':')[2]) if x and x.split(':')[0]=='7digital' else -1 metadata.cols.release_7digitalid[0] = idsplitter_7digital(track.foreign_release_id) metadata.cols.track_7digitalid[0] = idsplitter_7digital(track.foreign_id) metadata.flush() # get the analysis table, fill it analysis = h5.root.analysis.songs analysis.cols.analysis_sample_rate[0] = track.analysis_sample_rate analysis.cols.audio_md5[0] = track.audio_md5 analysis.cols.duration[0] = track.duration analysis.cols.end_of_fade_in[0] = track.end_of_fade_in analysis.cols.key[0] = track.key analysis.cols.key_confidence[0] = track.key_confidence analysis.cols.loudness[0] = track.loudness analysis.cols.mode[0] = track.mode analysis.cols.mode_confidence[0] = track.mode_confidence analysis.cols.start_of_fade_out[0] = track.start_of_fade_out analysis.cols.tempo[0] = track.tempo analysis.cols.time_signature[0] = track.time_signature analysis.cols.time_signature_confidence[0] = track.time_signature_confidence analysis.cols.track_id[0] = track.id analysis.flush() group = h5.root.analysis # analysis arrays (segments) analysis.cols.idx_segments_start[0] = 0 group.segments_start.append( np.array(map(lambda x : x['start'],track.segments),dtype='float64') ) analysis.cols.idx_segments_confidence[0] = 0 group.segments_confidence.append( np.array(map(lambda x : x['confidence'],track.segments),dtype='float64') ) analysis.cols.idx_segments_pitches[0] = 0 group.segments_pitches.append( np.array(map(lambda x : x['pitches'],track.segments),dtype='float64') ) analysis.cols.idx_segments_timbre[0] = 0 group.segments_timbre.append( np.array(map(lambda x : x['timbre'],track.segments),dtype='float64') ) analysis.cols.idx_segments_loudness_max[0] = 0 group.segments_loudness_max.append( np.array(map(lambda x : x['loudness_max'],track.segments),dtype='float64') ) analysis.cols.idx_segments_loudness_max_time[0] = 0 group.segments_loudness_max_time.append( np.array(map(lambda x : x['loudness_max_time'],track.segments),dtype='float64') ) analysis.cols.idx_segments_loudness_start[0] = 0 group.segments_loudness_start.append( np.array(map(lambda x : x['loudness_start'],track.segments),dtype='float64') ) # analysis arrays (sections) analysis.cols.idx_sections_start[0] = 0 group.sections_start.append( np.array(map(lambda x : x['start'],track.sections),dtype='float64') ) analysis.cols.idx_sections_confidence[0] = 0 group.sections_confidence.append( np.array(map(lambda x : x['confidence'],track.sections),dtype='float64') ) # analysis arrays (beats analysis.cols.idx_beats_start[0] = 0 group.beats_start.append( np.array(map(lambda x : x['start'],track.beats),dtype='float64') ) analysis.cols.idx_beats_confidence[0] = 0 group.beats_confidence.append( np.array(map(lambda x : x['confidence'],track.beats),dtype='float64') ) # analysis arrays (bars) analysis.cols.idx_bars_start[0] = 0 group.bars_start.append( np.array(map(lambda x : x['start'],track.bars),dtype='float64') ) analysis.cols.idx_bars_confidence[0] = 0 group.bars_confidence.append( np.array(map(lambda x : x['confidence'],track.bars),dtype='float64') ) # analysis arrays (tatums) analysis.cols.idx_tatums_start[0] = 0 group.tatums_start.append( np.array(map(lambda x : x['start'],track.tatums),dtype='float64') ) analysis.cols.idx_tatums_confidence[0] = 0 group.tatums_confidence.append( np.array(map(lambda x : x['confidence'],track.tatums),dtype='float64') ) analysis.flush() # DONE def fill_hdf5_from_musicbrainz(h5,connect): """ Fill an open hdf5 using the musicbrainz server and data. We assume this code is run after fill_hdf5_from_artist/song because we need artist_mbid, artist_name, release and title INPUT h5 - open song file (append mode) connect - open pg connection to musicbrainz_db """ # get info from h5 song file ambid = h5.root.metadata.songs.cols.artist_mbid[0] artist_name = h5.root.metadata.songs.cols.artist_name[0] release = h5.root.metadata.songs.cols.release[0] title = h5.root.metadata.songs.cols.title[0] # get the musicbrainz table, fill it musicbrainz = h5.root.musicbrainz.songs musicbrainz.cols.year[0] = QUERYMB.find_year_safemode(connect,ambid,title,release,artist_name) # fill the musicbrainz arrays group = h5.root.musicbrainz musicbrainz.cols.idx_artist_mbtags[0] = 0 tags,tagcount = QUERYMB.get_artist_tags(connect, ambid, maxtags=20) group.artist_mbtags.append( np.array(tags,dtype='string') ) group.artist_mbtags_count.append( np.array(tagcount,dtype='float64') ) # done, flush musicbrainz.flush() def fill_hdf5_aggregate_file(h5,h5_filenames,summaryfile=False): """ Fill an open hdf5 aggregate file using all the content from all the HDF5 files listed as filenames. These HDF5 files are supposed to be filled already. Usefull to create one big HDF5 file from many, thus improving IO speed. For most of the info, we simply use one row per song. For the arrays (e.g. segment_start) we need the indecies (e.g. idx_segment_start) to know which part of the array belongs to one particular song. If summaryfile=True, we skip arrays (indices all 0) """ # counter counter = 0 # iterate over filenames for h5idx,h5filename in enumerate(h5_filenames): # open h5 file h5tocopy = open_h5_file_read(h5filename) # get number of songs in new file nSongs = get_num_songs(h5tocopy) # iterate over songs in one HDF5 (1 if regular file, more if aggregate file) for songidx in xrange(nSongs): # METADATA row = h5.root.metadata.songs.row row["artist_familiarity"] = get_artist_familiarity(h5tocopy,songidx) row["artist_hotttnesss"] = get_artist_hotttnesss(h5tocopy,songidx) row["artist_id"] = get_artist_id(h5tocopy,songidx) row["artist_mbid"] = get_artist_mbid(h5tocopy,songidx) row["artist_playmeid"] = get_artist_playmeid(h5tocopy,songidx) row["artist_7digitalid"] = get_artist_7digitalid(h5tocopy,songidx) row["artist_latitude"] = get_artist_latitude(h5tocopy,songidx) row["artist_location"] = get_artist_location(h5tocopy,songidx) row["artist_longitude"] = get_artist_longitude(h5tocopy,songidx) row["artist_name"] = get_artist_name(h5tocopy,songidx) row["release"] = get_release(h5tocopy,songidx) row["release_7digitalid"] = get_release_7digitalid(h5tocopy,songidx) row["song_id"] = get_song_id(h5tocopy,songidx) row["song_hotttnesss"] = get_song_hotttnesss(h5tocopy,songidx) row["title"] = get_title(h5tocopy,songidx) row["track_7digitalid"] = get_track_7digitalid(h5tocopy,songidx) # INDICES if not summaryfile: if counter == 0 : # we're first row row["idx_similar_artists"] = 0 row["idx_artist_terms"] = 0 else: row["idx_similar_artists"] = h5.root.metadata.similar_artists.shape[0] row["idx_artist_terms"] = h5.root.metadata.artist_terms.shape[0] row.append() h5.root.metadata.songs.flush() # ARRAYS if not summaryfile: h5.root.metadata.similar_artists.append( get_similar_artists(h5tocopy,songidx) ) h5.root.metadata.artist_terms.append( get_artist_terms(h5tocopy,songidx) ) h5.root.metadata.artist_terms_freq.append( get_artist_terms_freq(h5tocopy,songidx) ) h5.root.metadata.artist_terms_weight.append( get_artist_terms_weight(h5tocopy,songidx) ) # ANALYSIS row = h5.root.analysis.songs.row row["analysis_sample_rate"] = get_analysis_sample_rate(h5tocopy,songidx) row["audio_md5"] = get_audio_md5(h5tocopy,songidx) row["danceability"] = get_danceability(h5tocopy,songidx) row["duration"] = get_duration(h5tocopy,songidx) row["end_of_fade_in"] = get_end_of_fade_in(h5tocopy,songidx) row["energy"] = get_energy(h5tocopy,songidx) row["key"] = get_key(h5tocopy,songidx) row["key_confidence"] = get_key_confidence(h5tocopy,songidx) row["loudness"] = get_loudness(h5tocopy,songidx) row["mode"] = get_mode(h5tocopy,songidx) row["mode_confidence"] = get_mode_confidence(h5tocopy,songidx) row["start_of_fade_out"] = get_start_of_fade_out(h5tocopy,songidx) row["tempo"] = get_tempo(h5tocopy,songidx) row["time_signature"] = get_time_signature(h5tocopy,songidx) row["time_signature_confidence"] = get_time_signature_confidence(h5tocopy,songidx) row["track_id"] = get_track_id(h5tocopy,songidx) # INDICES if not summaryfile: if counter == 0 : # we're first row row["idx_segments_start"] = 0 row["idx_segments_confidence"] = 0 row["idx_segments_pitches"] = 0 row["idx_segments_timbre"] = 0 row["idx_segments_loudness_max"] = 0 row["idx_segments_loudness_max_time"] = 0 row["idx_segments_loudness_start"] = 0 row["idx_sections_start"] = 0 row["idx_sections_confidence"] = 0 row["idx_beats_start"] = 0 row["idx_beats_confidence"] = 0 row["idx_bars_start"] = 0 row["idx_bars_confidence"] = 0 row["idx_tatums_start"] = 0 row["idx_tatums_confidence"] = 0 else : # check the current shape of the arrays row["idx_segments_start"] = h5.root.analysis.segments_start.shape[0] row["idx_segments_confidence"] = h5.root.analysis.segments_confidence.shape[0] row["idx_segments_pitches"] = h5.root.analysis.segments_pitches.shape[0] row["idx_segments_timbre"] = h5.root.analysis.segments_timbre.shape[0] row["idx_segments_loudness_max"] = h5.root.analysis.segments_loudness_max.shape[0] row["idx_segments_loudness_max_time"] = h5.root.analysis.segments_loudness_max_time.shape[0] row["idx_segments_loudness_start"] = h5.root.analysis.segments_loudness_start.shape[0] row["idx_sections_start"] = h5.root.analysis.sections_start.shape[0] row["idx_sections_confidence"] = h5.root.analysis.sections_confidence.shape[0] row["idx_beats_start"] = h5.root.analysis.beats_start.shape[0] row["idx_beats_confidence"] = h5.root.analysis.beats_confidence.shape[0] row["idx_bars_start"] = h5.root.analysis.bars_start.shape[0] row["idx_bars_confidence"] = h5.root.analysis.bars_confidence.shape[0] row["idx_tatums_start"] = h5.root.analysis.tatums_start.shape[0] row["idx_tatums_confidence"] = h5.root.analysis.tatums_confidence.shape[0] row.append() h5.root.analysis.songs.flush() # ARRAYS if not summaryfile: h5.root.analysis.segments_start.append( get_segments_start(h5tocopy,songidx) ) h5.root.analysis.segments_confidence.append( get_segments_confidence(h5tocopy,songidx) ) h5.root.analysis.segments_pitches.append( get_segments_pitches(h5tocopy,songidx) ) h5.root.analysis.segments_timbre.append( get_segments_timbre(h5tocopy,songidx) ) h5.root.analysis.segments_loudness_max.append( get_segments_loudness_max(h5tocopy,songidx) ) h5.root.analysis.segments_loudness_max_time.append( get_segments_loudness_max_time(h5tocopy,songidx) ) h5.root.analysis.segments_loudness_start.append( get_segments_loudness_start(h5tocopy,songidx) ) h5.root.analysis.sections_start.append( get_sections_start(h5tocopy,songidx) ) h5.root.analysis.sections_confidence.append( get_sections_confidence(h5tocopy,songidx) ) h5.root.analysis.beats_start.append( get_beats_start(h5tocopy,songidx) ) h5.root.analysis.beats_confidence.append( get_beats_confidence(h5tocopy,songidx) ) h5.root.analysis.bars_start.append( get_bars_start(h5tocopy,songidx) ) h5.root.analysis.bars_confidence.append( get_bars_confidence(h5tocopy,songidx) ) h5.root.analysis.tatums_start.append( get_tatums_start(h5tocopy,songidx) ) h5.root.analysis.tatums_confidence.append( get_tatums_confidence(h5tocopy,songidx) ) # MUSICBRAINZ row = h5.root.musicbrainz.songs.row row["year"] = get_year(h5tocopy,songidx) # INDICES if not summaryfile: if counter == 0 : # we're first row row["idx_artist_mbtags"] = 0 else: row["idx_artist_mbtags"] = h5.root.musicbrainz.artist_mbtags.shape[0] row.append() h5.root.musicbrainz.songs.flush() # ARRAYS if not summaryfile: h5.root.musicbrainz.artist_mbtags.append( get_artist_mbtags(h5tocopy,songidx) ) h5.root.musicbrainz.artist_mbtags_count.append( get_artist_mbtags_count(h5tocopy,songidx) ) # counter counter += 1 # close h5 file h5tocopy.close() def create_song_file(h5filename,title='H5 Song File',force=False,complevel=1): """ Create a new HDF5 file for a new song. If force=False, refuse to overwrite an existing file Raise a ValueError if it's the case. Other optional param is the H5 file. Setups the groups, each containing a table 'songs' with one row: - metadata - analysis DETAIL - we set the compression level to 1 by default, it uses the ZLIB library to disable compression, set it to 0 """ # check if file exists if not force: if os.path.exists(h5filename): raise ValueError('file exists, can not create HDF5 song file') # create the H5 file h5 = tables.openFile(h5filename, mode='w', title='H5 Song File') # set filter level h5.filters = tables.Filters(complevel=complevel,complib='zlib') # setup the groups and tables # group metadata group = h5.createGroup("/",'metadata','metadata about the song') table = h5.createTable(group,'songs',DESC.SongMetaData,'table of metadata for one song') r = table.row r.append() # filled with default values 0 or '' (depending on type) table.flush() # group analysis group = h5.createGroup("/",'analysis','Echo Nest analysis of the song') table = h5.createTable(group,'songs',DESC.SongAnalysis,'table of Echo Nest analysis for one song') r = table.row r.append() # filled with default values 0 or '' (depending on type) table.flush() # group musicbrainz group = h5.createGroup("/",'musicbrainz','data about the song coming from MusicBrainz') table = h5.createTable(group,'songs',DESC.SongMusicBrainz,'table of data coming from MusicBrainz') r = table.row r.append() # filled with default values 0 or '' (depending on type) table.flush() # create arrays create_all_arrays(h5,expectedrows=3) # close it, done h5.close() def create_aggregate_file(h5filename,title='H5 Aggregate File',force=False,expectedrows=1000,complevel=1, summaryfile=False): """ Create a new HDF5 file for all songs. It will contains everything that are in regular song files. Tables created empty. If force=False, refuse to overwrite an existing file Raise a ValueError if it's the case. If summaryfile=True, creates a sumary file, i.e. no arrays Other optional param is the H5 file. DETAILS - if you create a very large file, try to approximate correctly the number of data points (songs), it speeds things up with arrays (by setting the chunking correctly). - we set the compression level to 1 by default, it uses the ZLIB library to disable compression, set it to 0 Setups the groups, each containing a table 'songs' with one row: - metadata - analysis """ # check if file exists if not force: if os.path.exists(h5filename): raise ValueError('file exists, can not create HDF5 song file') # summary file? change title if summaryfile: title = 'H5 Summary File' # create the H5 file h5 = tables.openFile(h5filename, mode='w', title='H5 Song File') # set filter level h5.filters = tables.Filters(complevel=complevel,complib='zlib') # setup the groups and tables # group metadata group = h5.createGroup("/",'metadata','metadata about the song') table = h5.createTable(group,'songs',DESC.SongMetaData,'table of metadata for one song', expectedrows=expectedrows) # group analysis group = h5.createGroup("/",'analysis','Echo Nest analysis of the song') table = h5.createTable(group,'songs',DESC.SongAnalysis,'table of Echo Nest analysis for one song', expectedrows=expectedrows) # group musicbrainz group = h5.createGroup("/",'musicbrainz','data about the song coming from MusicBrainz') table = h5.createTable(group,'songs',DESC.SongMusicBrainz,'table of data coming from MusicBrainz', expectedrows=expectedrows) # create arrays if not summaryfile: create_all_arrays(h5,expectedrows=expectedrows) # close it, done h5.close() def create_all_arrays(h5,expectedrows=1000): """ Utility functions used by both create_song_file and create_aggregate_files, creates all the EArrays (empty). INPUT h5 - hdf5 file, open with write or append permissions metadata and analysis groups already exist! """ # group metadata arrays group = h5.root.metadata h5.createEArray(where=group,name='similar_artists',atom=tables.StringAtom(20,shape=()),shape=(0,),title=ARRAY_DESC_SIMILAR_ARTISTS) h5.createEArray(group,'artist_terms',tables.StringAtom(256,shape=()),(0,),ARRAY_DESC_ARTIST_TERMS, expectedrows=expectedrows*40) h5.createEArray(group,'artist_terms_freq',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_ARTIST_TERMS_FREQ, expectedrows=expectedrows*40) h5.createEArray(group,'artist_terms_weight',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_ARTIST_TERMS_WEIGHT, expectedrows=expectedrows*40) # group analysis arrays group = h5.root.analysis h5.createEArray(where=group,name='segments_start',atom=tables.Float64Atom(shape=()),shape=(0,),title=ARRAY_DESC_SEGMENTS_START) h5.createEArray(group,'segments_confidence',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_SEGMENTS_CONFIDENCE, expectedrows=expectedrows*300) h5.createEArray(group,'segments_pitches',tables.Float64Atom(shape=()),(0,12),ARRAY_DESC_SEGMENTS_PITCHES, expectedrows=expectedrows*300) h5.createEArray(group,'segments_timbre',tables.Float64Atom(shape=()),(0,12),ARRAY_DESC_SEGMENTS_TIMBRE, expectedrows=expectedrows*300) h5.createEArray(group,'segments_loudness_max',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_SEGMENTS_LOUDNESS_MAX, expectedrows=expectedrows*300) h5.createEArray(group,'segments_loudness_max_time',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_SEGMENTS_LOUDNESS_MAX_TIME, expectedrows=expectedrows*300) h5.createEArray(group,'segments_loudness_start',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_SEGMENTS_LOUDNESS_START, expectedrows=expectedrows*300) h5.createEArray(group,'sections_start',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_SECTIONS_START, expectedrows=expectedrows*300) h5.createEArray(group,'sections_confidence',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_SECTIONS_CONFIDENCE, expectedrows=expectedrows*300) h5.createEArray(group,'beats_start',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_BEATS_START, expectedrows=expectedrows*300) h5.createEArray(group,'beats_confidence',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_BEATS_CONFIDENCE, expectedrows=expectedrows*300) h5.createEArray(group,'bars_start',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_BARS_START, expectedrows=expectedrows*300) h5.createEArray(group,'bars_confidence',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_BARS_CONFIDENCE, expectedrows=expectedrows*300) h5.createEArray(group,'tatums_start',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_TATUMS_START, expectedrows=expectedrows*300) h5.createEArray(group,'tatums_confidence',tables.Float64Atom(shape=()),(0,),ARRAY_DESC_TATUMS_CONFIDENCE, expectedrows=expectedrows*300) # group musicbrainz arrays group = h5.root.musicbrainz h5.createEArray(where=group,name='artist_mbtags',atom=tables.StringAtom(256,shape=()),shape=(0,),title=ARRAY_DESC_ARTIST_MBTAGS, expectedrows=expectedrows*5) h5.createEArray(group,'artist_mbtags_count',tables.IntAtom(shape=()),(0,),ARRAY_DESC_ARTIST_MBTAGS_COUNT, expectedrows=expectedrows*5) def open_h5_file_read(h5filename): """ Open an existing H5 in read mode. """ return tables.openFile(h5filename, mode='r') def open_h5_file_append(h5filename): """ Open an existing H5 in append mode. """ return tables.openFile(h5filename, mode='a') ################################################ MAIN ##################################### def die_with_usage(): """ HELP MENU """ print 'hdf5_utils.py' print 'by T. Bertin-Mahieux (2010) Columbia University' print '' print 'should be used as a library, contains functions to create' print 'HDF5 files for the Million Song Dataset project' sys.exit(0) if __name__ == '__main__': # help menu die_with_usage()
apache-2.0
asedunov/intellij-community
python/lib/Lib/codecs.py
116
33297
""" codecs -- Python Codec Registry, API and helpers. Written by Marc-Andre Lemburg (mal@lemburg.com). (c) Copyright CNRI, All Rights Reserved. NO WARRANTY. """#" import __builtin__, sys ### Registry and builtin stateless codec functions try: from _codecs import * except ImportError, why: raise SystemError('Failed to load the builtin codecs: %s' % why) __all__ = ["register", "lookup", "open", "EncodedFile", "BOM", "BOM_BE", "BOM_LE", "BOM32_BE", "BOM32_LE", "BOM64_BE", "BOM64_LE", "BOM_UTF8", "BOM_UTF16", "BOM_UTF16_LE", "BOM_UTF16_BE", "BOM_UTF32", "BOM_UTF32_LE", "BOM_UTF32_BE", "strict_errors", "ignore_errors", "replace_errors", "xmlcharrefreplace_errors", "register_error", "lookup_error"] ### Constants # # Byte Order Mark (BOM = ZERO WIDTH NO-BREAK SPACE = U+FEFF) # and its possible byte string values # for UTF8/UTF16/UTF32 output and little/big endian machines # # UTF-8 BOM_UTF8 = '\xef\xbb\xbf' # UTF-16, little endian BOM_LE = BOM_UTF16_LE = '\xff\xfe' # UTF-16, big endian BOM_BE = BOM_UTF16_BE = '\xfe\xff' # UTF-32, little endian BOM_UTF32_LE = '\xff\xfe\x00\x00' # UTF-32, big endian BOM_UTF32_BE = '\x00\x00\xfe\xff' if sys.byteorder == 'little': # UTF-16, native endianness BOM = BOM_UTF16 = BOM_UTF16_LE # UTF-32, native endianness BOM_UTF32 = BOM_UTF32_LE else: # UTF-16, native endianness BOM = BOM_UTF16 = BOM_UTF16_BE # UTF-32, native endianness BOM_UTF32 = BOM_UTF32_BE # Old broken names (don't use in new code) BOM32_LE = BOM_UTF16_LE BOM32_BE = BOM_UTF16_BE BOM64_LE = BOM_UTF32_LE BOM64_BE = BOM_UTF32_BE ### Codec base classes (defining the API) class CodecInfo(tuple): def __new__(cls, encode, decode, streamreader=None, streamwriter=None, incrementalencoder=None, incrementaldecoder=None, name=None): self = tuple.__new__(cls, (encode, decode, streamreader, streamwriter)) self.name = name self.encode = encode self.decode = decode self.incrementalencoder = incrementalencoder self.incrementaldecoder = incrementaldecoder self.streamwriter = streamwriter self.streamreader = streamreader return self def __repr__(self): return "<%s.%s object for encoding %s at 0x%x>" % (self.__class__.__module__, self.__class__.__name__, self.name, id(self)) class Codec: """ Defines the interface for stateless encoders/decoders. The .encode()/.decode() methods may use different error handling schemes by providing the errors argument. These string values are predefined: 'strict' - raise a ValueError error (or a subclass) 'ignore' - ignore the character and continue with the next 'replace' - replace with a suitable replacement character; Python will use the official U+FFFD REPLACEMENT CHARACTER for the builtin Unicode codecs on decoding and '?' on encoding. 'xmlcharrefreplace' - Replace with the appropriate XML character reference (only for encoding). 'backslashreplace' - Replace with backslashed escape sequences (only for encoding). The set of allowed values can be extended via register_error. """ def encode(self, input, errors='strict'): """ Encodes the object input and returns a tuple (output object, length consumed). errors defines the error handling to apply. It defaults to 'strict' handling. The method may not store state in the Codec instance. Use StreamCodec for codecs which have to keep state in order to make encoding/decoding efficient. The encoder must be able to handle zero length input and return an empty object of the output object type in this situation. """ raise NotImplementedError def decode(self, input, errors='strict'): """ Decodes the object input and returns a tuple (output object, length consumed). input must be an object which provides the bf_getreadbuf buffer slot. Python strings, buffer objects and memory mapped files are examples of objects providing this slot. errors defines the error handling to apply. It defaults to 'strict' handling. The method may not store state in the Codec instance. Use StreamCodec for codecs which have to keep state in order to make encoding/decoding efficient. The decoder must be able to handle zero length input and return an empty object of the output object type in this situation. """ raise NotImplementedError class IncrementalEncoder(object): """ An IncrementalEncoder encodes an input in multiple steps. The input can be passed piece by piece to the encode() method. The IncrementalEncoder remembers the state of the Encoding process between calls to encode(). """ def __init__(self, errors='strict'): """ Creates an IncrementalEncoder instance. The IncrementalEncoder may use different error handling schemes by providing the errors keyword argument. See the module docstring for a list of possible values. """ self.errors = errors self.buffer = "" def encode(self, input, final=False): """ Encodes input and returns the resulting object. """ raise NotImplementedError def reset(self): """ Resets the encoder to the initial state. """ class BufferedIncrementalEncoder(IncrementalEncoder): """ This subclass of IncrementalEncoder can be used as the baseclass for an incremental encoder if the encoder must keep some of the output in a buffer between calls to encode(). """ def __init__(self, errors='strict'): IncrementalEncoder.__init__(self, errors) self.buffer = "" # unencoded input that is kept between calls to encode() def _buffer_encode(self, input, errors, final): # Overwrite this method in subclasses: It must encode input # and return an (output, length consumed) tuple raise NotImplementedError def encode(self, input, final=False): # encode input (taking the buffer into account) data = self.buffer + input (result, consumed) = self._buffer_encode(data, self.errors, final) # keep unencoded input until the next call self.buffer = data[consumed:] return result def reset(self): IncrementalEncoder.reset(self) self.buffer = "" class IncrementalDecoder(object): """ An IncrementalDecoder decodes an input in multiple steps. The input can be passed piece by piece to the decode() method. The IncrementalDecoder remembers the state of the decoding process between calls to decode(). """ def __init__(self, errors='strict'): """ Creates a IncrementalDecoder instance. The IncrementalDecoder may use different error handling schemes by providing the errors keyword argument. See the module docstring for a list of possible values. """ self.errors = errors def decode(self, input, final=False): """ Decodes input and returns the resulting object. """ raise NotImplementedError def reset(self): """ Resets the decoder to the initial state. """ class BufferedIncrementalDecoder(IncrementalDecoder): """ This subclass of IncrementalDecoder can be used as the baseclass for an incremental decoder if the decoder must be able to handle incomplete byte sequences. """ def __init__(self, errors='strict'): IncrementalDecoder.__init__(self, errors) self.buffer = "" # undecoded input that is kept between calls to decode() def _buffer_decode(self, input, errors, final): # Overwrite this method in subclasses: It must decode input # and return an (output, length consumed) tuple raise NotImplementedError def decode(self, input, final=False): # decode input (taking the buffer into account) data = self.buffer + input (result, consumed) = self._buffer_decode(data, self.errors, final) # keep undecoded input until the next call self.buffer = data[consumed:] return result def reset(self): IncrementalDecoder.reset(self) self.buffer = "" # # The StreamWriter and StreamReader class provide generic working # interfaces which can be used to implement new encoding submodules # very easily. See encodings/utf_8.py for an example on how this is # done. # class StreamWriter(Codec): def __init__(self, stream, errors='strict'): """ Creates a StreamWriter instance. stream must be a file-like object open for writing (binary) data. The StreamWriter may use different error handling schemes by providing the errors keyword argument. These parameters are predefined: 'strict' - raise a ValueError (or a subclass) 'ignore' - ignore the character and continue with the next 'replace'- replace with a suitable replacement character 'xmlcharrefreplace' - Replace with the appropriate XML character reference. 'backslashreplace' - Replace with backslashed escape sequences (only for encoding). The set of allowed parameter values can be extended via register_error. """ self.stream = stream self.errors = errors def write(self, object): """ Writes the object's contents encoded to self.stream. """ data, consumed = self.encode(object, self.errors) self.stream.write(data) def writelines(self, list): """ Writes the concatenated list of strings to the stream using .write(). """ self.write(''.join(list)) def reset(self): """ Flushes and resets the codec buffers used for keeping state. Calling this method should ensure that the data on the output is put into a clean state, that allows appending of new fresh data without having to rescan the whole stream to recover state. """ pass def __getattr__(self, name, getattr=getattr): """ Inherit all other methods from the underlying stream. """ return getattr(self.stream, name) def __enter__(self): return self def __exit__(self, type, value, tb): self.stream.close() ### class StreamReader(Codec): def __init__(self, stream, errors='strict'): """ Creates a StreamReader instance. stream must be a file-like object open for reading (binary) data. The StreamReader may use different error handling schemes by providing the errors keyword argument. These parameters are predefined: 'strict' - raise a ValueError (or a subclass) 'ignore' - ignore the character and continue with the next 'replace'- replace with a suitable replacement character; The set of allowed parameter values can be extended via register_error. """ self.stream = stream self.errors = errors self.bytebuffer = "" # For str->str decoding this will stay a str # For str->unicode decoding the first read will promote it to unicode self.charbuffer = "" self.linebuffer = None def decode(self, input, errors='strict'): raise NotImplementedError def read(self, size=-1, chars=-1, firstline=False): """ Decodes data from the stream self.stream and returns the resulting object. chars indicates the number of characters to read from the stream. read() will never return more than chars characters, but it might return less, if there are not enough characters available. size indicates the approximate maximum number of bytes to read from the stream for decoding purposes. The decoder can modify this setting as appropriate. The default value -1 indicates to read and decode as much as possible. size is intended to prevent having to decode huge files in one step. If firstline is true, and a UnicodeDecodeError happens after the first line terminator in the input only the first line will be returned, the rest of the input will be kept until the next call to read(). The method should use a greedy read strategy meaning that it should read as much data as is allowed within the definition of the encoding and the given size, e.g. if optional encoding endings or state markers are available on the stream, these should be read too. """ # If we have lines cached, first merge them back into characters if self.linebuffer: self.charbuffer = "".join(self.linebuffer) self.linebuffer = None # read until we get the required number of characters (if available) while True: # can the request can be satisfied from the character buffer? if chars < 0: if size < 0: if self.charbuffer: break elif len(self.charbuffer) >= size: break else: if len(self.charbuffer) >= chars: break # we need more data if size < 0: newdata = self.stream.read() else: newdata = self.stream.read(size) # decode bytes (those remaining from the last call included) data = self.bytebuffer + newdata try: newchars, decodedbytes = self.decode(data, self.errors) except UnicodeDecodeError, exc: if firstline: newchars, decodedbytes = self.decode(data[:exc.start], self.errors) lines = newchars.splitlines(True) if len(lines)<=1: raise else: raise # keep undecoded bytes until the next call self.bytebuffer = data[decodedbytes:] # put new characters in the character buffer self.charbuffer += newchars # there was no data available if not newdata: break if chars < 0: # Return everything we've got result = self.charbuffer self.charbuffer = "" else: # Return the first chars characters result = self.charbuffer[:chars] self.charbuffer = self.charbuffer[chars:] return result def readline(self, size=None, keepends=True): """ Read one line from the input stream and return the decoded data. size, if given, is passed as size argument to the read() method. """ # If we have lines cached from an earlier read, return # them unconditionally if self.linebuffer: line = self.linebuffer[0] del self.linebuffer[0] if len(self.linebuffer) == 1: # revert to charbuffer mode; we might need more data # next time self.charbuffer = self.linebuffer[0] self.linebuffer = None if not keepends: line = line.splitlines(False)[0] return line readsize = size or 72 line = "" # If size is given, we call read() only once while True: data = self.read(readsize, firstline=True) if data: # If we're at a "\r" read one extra character (which might # be a "\n") to get a proper line ending. If the stream is # temporarily exhausted we return the wrong line ending. if data.endswith("\r"): data += self.read(size=1, chars=1) line += data lines = line.splitlines(True) if lines: if len(lines) > 1: # More than one line result; the first line is a full line # to return line = lines[0] del lines[0] if len(lines) > 1: # cache the remaining lines lines[-1] += self.charbuffer self.linebuffer = lines self.charbuffer = None else: # only one remaining line, put it back into charbuffer self.charbuffer = lines[0] + self.charbuffer if not keepends: line = line.splitlines(False)[0] break line0withend = lines[0] line0withoutend = lines[0].splitlines(False)[0] if line0withend != line0withoutend: # We really have a line end # Put the rest back together and keep it until the next call self.charbuffer = "".join(lines[1:]) + self.charbuffer if keepends: line = line0withend else: line = line0withoutend break # we didn't get anything or this was our only try if not data or size is not None: if line and not keepends: line = line.splitlines(False)[0] break if readsize<8000: readsize *= 2 return line def readlines(self, sizehint=None, keepends=True): """ Read all lines available on the input stream and return them as list of lines. Line breaks are implemented using the codec's decoder method and are included in the list entries. sizehint, if given, is ignored since there is no efficient way to finding the true end-of-line. """ data = self.read() return data.splitlines(keepends) def reset(self): """ Resets the codec buffers used for keeping state. Note that no stream repositioning should take place. This method is primarily intended to be able to recover from decoding errors. """ self.bytebuffer = "" self.charbuffer = u"" self.linebuffer = None def seek(self, offset, whence=0): """ Set the input stream's current position. Resets the codec buffers used for keeping state. """ self.reset() self.stream.seek(offset, whence) def next(self): """ Return the next decoded line from the input stream.""" line = self.readline() if line: return line raise StopIteration def __iter__(self): return self def __getattr__(self, name, getattr=getattr): """ Inherit all other methods from the underlying stream. """ return getattr(self.stream, name) def __enter__(self): return self def __exit__(self, type, value, tb): self.stream.close() ### class StreamReaderWriter: """ StreamReaderWriter instances allow wrapping streams which work in both read and write modes. The design is such that one can use the factory functions returned by the codec.lookup() function to construct the instance. """ # Optional attributes set by the file wrappers below encoding = 'unknown' def __init__(self, stream, Reader, Writer, errors='strict'): """ Creates a StreamReaderWriter instance. stream must be a Stream-like object. Reader, Writer must be factory functions or classes providing the StreamReader, StreamWriter interface resp. Error handling is done in the same way as defined for the StreamWriter/Readers. """ self.stream = stream self.reader = Reader(stream, errors) self.writer = Writer(stream, errors) self.errors = errors def read(self, size=-1): return self.reader.read(size) def readline(self, size=None): return self.reader.readline(size) def readlines(self, sizehint=None): return self.reader.readlines(sizehint) def next(self): """ Return the next decoded line from the input stream.""" return self.reader.next() def __iter__(self): return self def write(self, data): return self.writer.write(data) def writelines(self, list): return self.writer.writelines(list) def reset(self): self.reader.reset() self.writer.reset() def __getattr__(self, name, getattr=getattr): """ Inherit all other methods from the underlying stream. """ return getattr(self.stream, name) # these are needed to make "with codecs.open(...)" work properly def __enter__(self): return self def __exit__(self, type, value, tb): self.stream.close() ### class StreamRecoder: """ StreamRecoder instances provide a frontend - backend view of encoding data. They use the complete set of APIs returned by the codecs.lookup() function to implement their task. Data written to the stream is first decoded into an intermediate format (which is dependent on the given codec combination) and then written to the stream using an instance of the provided Writer class. In the other direction, data is read from the stream using a Reader instance and then return encoded data to the caller. """ # Optional attributes set by the file wrappers below data_encoding = 'unknown' file_encoding = 'unknown' def __init__(self, stream, encode, decode, Reader, Writer, errors='strict'): """ Creates a StreamRecoder instance which implements a two-way conversion: encode and decode work on the frontend (the input to .read() and output of .write()) while Reader and Writer work on the backend (reading and writing to the stream). You can use these objects to do transparent direct recodings from e.g. latin-1 to utf-8 and back. stream must be a file-like object. encode, decode must adhere to the Codec interface, Reader, Writer must be factory functions or classes providing the StreamReader, StreamWriter interface resp. encode and decode are needed for the frontend translation, Reader and Writer for the backend translation. Unicode is used as intermediate encoding. Error handling is done in the same way as defined for the StreamWriter/Readers. """ self.stream = stream self.encode = encode self.decode = decode self.reader = Reader(stream, errors) self.writer = Writer(stream, errors) self.errors = errors def read(self, size=-1): data = self.reader.read(size) data, bytesencoded = self.encode(data, self.errors) return data def readline(self, size=None): if size is None: data = self.reader.readline() else: data = self.reader.readline(size) data, bytesencoded = self.encode(data, self.errors) return data def readlines(self, sizehint=None): data = self.reader.read() data, bytesencoded = self.encode(data, self.errors) return data.splitlines(1) def next(self): """ Return the next decoded line from the input stream.""" data = self.reader.next() data, bytesencoded = self.encode(data, self.errors) return data def __iter__(self): return self def write(self, data): data, bytesdecoded = self.decode(data, self.errors) return self.writer.write(data) def writelines(self, list): data = ''.join(list) data, bytesdecoded = self.decode(data, self.errors) return self.writer.write(data) def reset(self): self.reader.reset() self.writer.reset() def __getattr__(self, name, getattr=getattr): """ Inherit all other methods from the underlying stream. """ return getattr(self.stream, name) def __enter__(self): return self def __exit__(self, type, value, tb): self.stream.close() ### Shortcuts def open(filename, mode='rb', encoding=None, errors='strict', buffering=1): """ Open an encoded file using the given mode and return a wrapped version providing transparent encoding/decoding. Note: The wrapped version will only accept the object format defined by the codecs, i.e. Unicode objects for most builtin codecs. Output is also codec dependent and will usually be Unicode as well. Files are always opened in binary mode, even if no binary mode was specified. This is done to avoid data loss due to encodings using 8-bit values. The default file mode is 'rb' meaning to open the file in binary read mode. encoding specifies the encoding which is to be used for the file. errors may be given to define the error handling. It defaults to 'strict' which causes ValueErrors to be raised in case an encoding error occurs. buffering has the same meaning as for the builtin open() API. It defaults to line buffered. The returned wrapped file object provides an extra attribute .encoding which allows querying the used encoding. This attribute is only available if an encoding was specified as parameter. """ if encoding is not None and \ 'b' not in mode: # Force opening of the file in binary mode mode = mode + 'b' file = __builtin__.open(filename, mode, buffering) if encoding is None: return file info = lookup(encoding) srw = StreamReaderWriter(file, info.streamreader, info.streamwriter, errors) # Add attributes to simplify introspection srw.encoding = encoding return srw def EncodedFile(file, data_encoding, file_encoding=None, errors='strict'): """ Return a wrapped version of file which provides transparent encoding translation. Strings written to the wrapped file are interpreted according to the given data_encoding and then written to the original file as string using file_encoding. The intermediate encoding will usually be Unicode but depends on the specified codecs. Strings are read from the file using file_encoding and then passed back to the caller as string using data_encoding. If file_encoding is not given, it defaults to data_encoding. errors may be given to define the error handling. It defaults to 'strict' which causes ValueErrors to be raised in case an encoding error occurs. The returned wrapped file object provides two extra attributes .data_encoding and .file_encoding which reflect the given parameters of the same name. The attributes can be used for introspection by Python programs. """ if file_encoding is None: file_encoding = data_encoding data_info = lookup(data_encoding) file_info = lookup(file_encoding) sr = StreamRecoder(file, data_info.encode, data_info.decode, file_info.streamreader, file_info.streamwriter, errors) # Add attributes to simplify introspection sr.data_encoding = data_encoding sr.file_encoding = file_encoding return sr ### Helpers for codec lookup def getencoder(encoding): """ Lookup up the codec for the given encoding and return its encoder function. Raises a LookupError in case the encoding cannot be found. """ return lookup(encoding).encode def getdecoder(encoding): """ Lookup up the codec for the given encoding and return its decoder function. Raises a LookupError in case the encoding cannot be found. """ return lookup(encoding).decode def getincrementalencoder(encoding): """ Lookup up the codec for the given encoding and return its IncrementalEncoder class or factory function. Raises a LookupError in case the encoding cannot be found or the codecs doesn't provide an incremental encoder. """ encoder = lookup(encoding).incrementalencoder if encoder is None: raise LookupError(encoding) return encoder def getincrementaldecoder(encoding): """ Lookup up the codec for the given encoding and return its IncrementalDecoder class or factory function. Raises a LookupError in case the encoding cannot be found or the codecs doesn't provide an incremental decoder. """ decoder = lookup(encoding).incrementaldecoder if decoder is None: raise LookupError(encoding) return decoder def getreader(encoding): """ Lookup up the codec for the given encoding and return its StreamReader class or factory function. Raises a LookupError in case the encoding cannot be found. """ return lookup(encoding).streamreader def getwriter(encoding): """ Lookup up the codec for the given encoding and return its StreamWriter class or factory function. Raises a LookupError in case the encoding cannot be found. """ return lookup(encoding).streamwriter def iterencode(iterator, encoding, errors='strict', **kwargs): """ Encoding iterator. Encodes the input strings from the iterator using a IncrementalEncoder. errors and kwargs are passed through to the IncrementalEncoder constructor. """ encoder = getincrementalencoder(encoding)(errors, **kwargs) for input in iterator: output = encoder.encode(input) if output: yield output output = encoder.encode("", True) if output: yield output def iterdecode(iterator, encoding, errors='strict', **kwargs): """ Decoding iterator. Decodes the input strings from the iterator using a IncrementalDecoder. errors and kwargs are passed through to the IncrementalDecoder constructor. """ decoder = getincrementaldecoder(encoding)(errors, **kwargs) for input in iterator: output = decoder.decode(input) if output: yield output output = decoder.decode("", True) if output: yield output ### Helpers for charmap-based codecs def make_identity_dict(rng): """ make_identity_dict(rng) -> dict Return a dictionary where elements of the rng sequence are mapped to themselves. """ res = {} for i in rng: res[i]=i return res def make_encoding_map(decoding_map): """ Creates an encoding map from a decoding map. If a target mapping in the decoding map occurs multiple times, then that target is mapped to None (undefined mapping), causing an exception when encountered by the charmap codec during translation. One example where this happens is cp875.py which decodes multiple character to \u001a. """ m = {} for k,v in decoding_map.items(): if not v in m: m[v] = k else: m[v] = None return m ### error handlers try: strict_errors = lookup_error("strict") ignore_errors = lookup_error("ignore") replace_errors = lookup_error("replace") xmlcharrefreplace_errors = lookup_error("xmlcharrefreplace") backslashreplace_errors = lookup_error("backslashreplace") except LookupError: # In --disable-unicode builds, these error handler are missing strict_errors = None ignore_errors = None replace_errors = None xmlcharrefreplace_errors = None backslashreplace_errors = None # Tell modulefinder that using codecs probably needs the encodings # package _false = 0 if _false: import encodings ### Tests if __name__ == '__main__': # Make stdout translate Latin-1 output into UTF-8 output sys.stdout = EncodedFile(sys.stdout, 'latin-1', 'utf-8') # Have stdin translate Latin-1 input into UTF-8 input sys.stdin = EncodedFile(sys.stdin, 'utf-8', 'latin-1')
apache-2.0
popazerty/dvbapp2-gui
lib/python/Tools/NumericalTextInput.py
3
3523
# -*- coding: UTF-8 -*- from enigma import eTimer from Components.Language import language # Dict languageCode -> array of strings MAP_SEARCH = ( u"%_0", u" 1", u"abc2", u"def3", u"ghi4", u"jkl5", u"mno6", u"pqrs7", u"tuv8", u"wxyz9", ) MAP_SEARCH_UPCASE = ( U"0%_", U"1 ", U"ABC2", U"DEF3", U"GHI4", U"JKL5", U"MNO6", U"PQRS7", U"TUV8", U"WXYZ9", ) MAP_DEFAULT = ( u"0,?!&@=*'+\"()$~%#", u" 1.:;/-_", u"abc2ABC", u"def3DEF", u"ghi4GHI", u"jkl5JKL", u"mno6MNO", u"pqrs7PQRS", u"tuv8TUV", u"wxyz9WXYZ", ) MAP_DE = ( u"0,?!&@=*'+\"()$~%#", u" 1.:;/-_", u"abcä2ABCÄ", u"def3DEF", u"ghi4GHI", u"jkl5JKL", u"mnoö6MNOÖ", u"pqrsß7PQRSß", u"tuvü8TUVÜ", u"wxyz9WXYZ", ) MAP_ES = ( u"0,?!&@=*'+\"()$~%#", u" 1.:;/-_", u"abcáà2ABCÁÀ", u"deéèf3DEFÉÈ", u"ghiíì4GHIÍÌ", u"jkl5JKL", u"mnñoóò6MNÑOÓÒ", u"pqrs7PQRS", u"tuvúù8TUVÚÙ", u"wxyz9WXYZ", ) MAP_SE = ( u"0,?!&@=*'+\"()$~%#", u" 1.:;/-_", u"abcåä2ABCÅÄ", u"defé3DEFÉ", u"ghi4GHI", u"jkl5JKL", u"mnoö6MNOÖ", u"pqrs7PQRS", u"tuv8TUV", u"wxyz9WXYZ", ) MAP_CZ = ( u"0,?'+\"()@$!=&*%#", u" 1.:;/-_", u"abc2áäčABCÁÄČ", u"def3ďéěDEFĎÉĚ", u"ghi4íGHIÍ", u"jkl5ľĺJKLĽĹ", u"mno6ňóöôMNOŇÓÖÔ", u"pqrs7řŕšPQRSŘŔŠ", u"tuv8ťúůüTUVŤÚŮÜ", u"wxyz9ýžWXYZÝŽ", ) MAP_PL = ( u"0,?'+\"()@$!=&*%#", u" 1.:;/-_", u"abcąć2ABCĄĆ", u"defę3DEFĘ", u"ghi4GHI", u"jklł5JKLŁ", u"mnońó6MNOŃÓ", u"pqrsś7PQRSŚ", u"tuv8TUV", u"wxyzźż9WXYZŹŻ", ) MAP_RU = ( u"0,?'+\"()@$!=&*%#", u" 1.:;/-_", u"abcабвг2ABCАБВГ", u"defдежз3DEFДЕЖЗ", u"ghiийкл4GHIИЙКЛ", u"jklмноп5JKLМНОП", u"mnoрсту6MNOРСТУ", u"pqrsфхцч7PQRSФХЦЧ", u"tuvшщь8TUVШЩЬ", u"wxyzъэюя9WXYZЪЭЮЯ", ) MAP_NL = ( u"0,?!&@=*'+\"()$~%#", u" 1.:;/-_", u"abc2ABC", u"deëf3DEËF", u"ghiï4GHIÏ", u"jkl5JKL", u"mno6MNO", u"pqrs7PQRS", u"tuv8TUV", u"wxyz9WXYZ", ) MAPPINGS = { 'de_DE': MAP_DE, 'es_ES': MAP_ES, 'sv_SE': MAP_SE, 'fi_FI': MAP_SE, 'cs_CZ': MAP_CZ, 'sk_SK': MAP_CZ, 'pl_PL': MAP_PL, 'ru_RU': MAP_RU, 'nl_NL': MAP_NL, } class NumericalTextInput: def __init__(self, nextFunc=None, handleTimeout = True, search = False, mapping = None): self.useableChars=None self.nextFunction=nextFunc if handleTimeout: self.timer = eTimer() self.timer.callback.append(self.timeout) else: self.timer = None self.lastKey = -1 self.pos = -1 if mapping is not None: self.mapping = mapping elif search: self.mapping = MAP_SEARCH else: self.mapping = MAPPINGS.get(language.getLanguage(), MAP_DEFAULT) def setUseableChars(self, useable): self.useableChars = unicode(useable) def getKey(self, num): cnt=0 if self.lastKey != num: if self.lastKey != -1: self.nextChar() self.lastKey = num self.pos = -1 if self.timer is not None: self.timer.start(1000, True) while True: self.pos += 1 if len(self.mapping[num]) <= self.pos: self.pos = 0 if self.useableChars: pos = self.useableChars.find(self.mapping[num][self.pos]) if pos == -1: cnt += 1 if cnt < len(self.mapping[num]): continue else: return None break return self.mapping[num][self.pos] def nextKey(self): if self.timer is not None: self.timer.stop() self.lastKey = -1 def nextChar(self): self.nextKey() if self.nextFunction: self.nextFunction() def timeout(self): if self.lastKey != -1: self.nextChar()
gpl-2.0
ibrahimgunduz34/SpiffWorkflow
SpiffWorkflow/specs/SubWorkflow.py
2
5660
# -*- coding: utf-8 -*- from __future__ import division # Copyright (C) 2007 Samuel Abels # # This library is free software; you can redistribute it and/or # modify it under the terms of the GNU Lesser General Public # License as published by the Free Software Foundation; either # version 2.1 of the License, or (at your option) any later version. # # This library is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this library; if not, write to the Free Software # Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA import os from SpiffWorkflow.Task import Task from SpiffWorkflow.exceptions import WorkflowException from SpiffWorkflow.operators import valueof from SpiffWorkflow.specs.TaskSpec import TaskSpec import SpiffWorkflow class SubWorkflow(TaskSpec): """ A SubWorkflow is a task that wraps a WorkflowSpec, such that you can re-use it in multiple places as if it were a task. If more than one input is connected, the task performs an implicit multi merge. If more than one output is connected, the task performs an implicit parallel split. """ def __init__(self, parent, name, file, in_assign = None, out_assign = None, **kwargs): """ Constructor. :type parent: TaskSpec :param parent: A reference to the parent task spec. :type name: str :param name: The name of the task spec. :type file: str :param file: The name of a file containing a workflow. :type in_assign: list(str) :param in_assign: The names of data fields to carry over. :type out_assign: list(str) :param out_assign: The names of data fields to carry back. :type kwargs: dict :param kwargs: See L{SpiffWorkflow.specs.TaskSpec}. """ assert parent is not None assert name is not None super(SubWorkflow, self).__init__(parent, name, **kwargs) self.file = None self.in_assign = in_assign is not None and in_assign or [] self.out_assign = out_assign is not None and out_assign or [] if file is not None: dirname = os.path.dirname(parent.file) self.file = os.path.join(dirname, file) def test(self): TaskSpec.test(self) if self.file is not None and not os.path.exists(self.file): raise WorkflowException(self, 'File does not exist: %s' % self.file) def _predict_hook(self, my_task): outputs = [task.task_spec for task in my_task.children] for output in self.outputs: if output not in outputs: outputs.insert(0, output) if my_task._is_definite(): my_task._sync_children(outputs, Task.FUTURE) else: my_task._sync_children(outputs, my_task.state) def _create_subworkflow(self, my_task): from SpiffWorkflow.storage import XmlSerializer from SpiffWorkflow.specs import WorkflowSpec file = valueof(my_task, self.file) serializer = XmlSerializer() xml = open(file).read() wf_spec = WorkflowSpec.deserialize(serializer, xml, filename = file) outer_workflow = my_task.workflow.outer_workflow return SpiffWorkflow.Workflow(wf_spec, parent = outer_workflow) def _on_ready_before_hook(self, my_task): subworkflow = self._create_subworkflow(my_task) subworkflow.completed_event.connect(self._on_subworkflow_completed, my_task) # Integrate the tree of the subworkflow into the tree of this workflow. my_task._sync_children(self.outputs, Task.FUTURE) for child in my_task.children: child.task_spec._update_state(child) child._inherit_data() for child in subworkflow.task_tree.children: my_task.children.insert(0, child) child.parent = my_task my_task._set_internal_data(subworkflow = subworkflow) def _on_ready_hook(self, my_task): # Assign variables, if so requested. subworkflow = my_task._get_internal_data('subworkflow') for child in subworkflow.task_tree.children: for assignment in self.in_assign: assignment.assign(my_task, child) self._predict(my_task) for child in subworkflow.task_tree.children: child.task_spec._update_state(child) def _on_subworkflow_completed(self, subworkflow, my_task): # Assign variables, if so requested. for child in my_task.children: if child.task_spec in self.outputs: for assignment in self.out_assign: assignment.assign(subworkflow, child) # Alright, abusing that hook is just evil but it works. child.task_spec._update_state_hook(child) def _on_complete_hook(self, my_task): for child in my_task.children: if child.task_spec in self.outputs: continue child.task_spec._update_state(child) def serialize(self, serializer): return serializer._serialize_sub_workflow(self) @classmethod def deserialize(self, serializer, wf_spec, s_state): return serializer._deserialize_sub_workflow(wf_spec, s_state)
lgpl-3.0
openstack/python-magnumclient
magnumclient/tests/osc/unit/v1/test_clusters.py
1
17895
# Copyright 2016 Easystack. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. # import copy import os import sys import tempfile from unittest import mock from contextlib import contextmanager try: from StringIO import StringIO except ImportError: from io import StringIO from unittest.mock import call from magnumclient import exceptions from magnumclient.osc.v1 import clusters as osc_clusters from magnumclient.tests.osc.unit.v1 import fakes as magnum_fakes class TestCluster(magnum_fakes.TestMagnumClientOSCV1): def setUp(self): super(TestCluster, self).setUp() self.clusters_mock = self.app.client_manager.container_infra.clusters self.certificates_mock = \ self.app.client_manager.container_infra.certificates class TestClusterCreate(TestCluster): def setUp(self): super(TestClusterCreate, self).setUp() attr = dict() attr['name'] = 'fake-cluster-1' self._cluster = magnum_fakes.FakeCluster.create_one_cluster(attr) self._default_args = { 'cluster_template_id': 'fake-ct', 'create_timeout': 60, 'discovery_url': None, 'keypair': None, 'master_count': 1, 'name': 'fake-cluster-1', 'node_count': 1, } self.clusters_mock.create = mock.Mock() self.clusters_mock.create.return_value = self._cluster self.clusters_mock.get = mock.Mock() self.clusters_mock.get.return_value = copy.deepcopy(self._cluster) self.clusters_mock.update = mock.Mock() self.clusters_mock.update.return_value = self._cluster # Get the command object to test self.cmd = osc_clusters.CreateCluster(self.app, None) self.data = tuple(map(lambda x: getattr(self._cluster, x), osc_clusters.CLUSTER_ATTRIBUTES)) def test_cluster_create_required_args_pass(self): """Verifies required arguments.""" arglist = [ '--cluster-template', self._cluster.cluster_template_id, self._cluster.name ] verifylist = [ ('cluster_template', self._cluster.cluster_template_id), ('name', self._cluster.name) ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) self.cmd.take_action(parsed_args) self.clusters_mock.create.assert_called_with(**self._default_args) def test_cluster_create_missing_required_arg(self): """Verifies missing required arguments.""" arglist = [ self._cluster.name ] verifylist = [ ('name', self._cluster.name) ] self.assertRaises(magnum_fakes.MagnumParseException, self.check_parser, self.cmd, arglist, verifylist) def test_cluster_create_with_labels(self): """Verifies labels are properly parsed when given as argument.""" expected_args = self._default_args expected_args['labels'] = { 'arg1': 'value1', 'arg2': 'value2' } arglist = [ '--cluster-template', self._cluster.cluster_template_id, '--labels', 'arg1=value1', '--labels', 'arg2=value2', self._cluster.name ] verifylist = [ ('cluster_template', self._cluster.cluster_template_id), ('labels', ['arg1=value1', 'arg2=value2']), ('name', self._cluster.name) ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) self.cmd.take_action(parsed_args) self.clusters_mock.create.assert_called_with(**expected_args) def test_cluster_create_with_lb_disabled(self): """Verifies master lb disabled properly parsed.""" expected_args = self._default_args expected_args['master_lb_enabled'] = False arglist = [ '--cluster-template', self._cluster.cluster_template_id, '--master-lb-disabled', self._cluster.name ] verifylist = [ ('cluster_template', self._cluster.cluster_template_id), ('master_lb_enabled', [False]), ('name', self._cluster.name) ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) self.cmd.take_action(parsed_args) self.clusters_mock.create.assert_called_with(**expected_args) class TestClusterDelete(TestCluster): def setUp(self): super(TestClusterDelete, self).setUp() self.clusters_mock.delete = mock.Mock() self.clusters_mock.delete.return_value = None # Get the command object to test self.cmd = osc_clusters.DeleteCluster(self.app, None) def test_cluster_delete_one(self): arglist = ['foo'] verifylist = [('cluster', ['foo'])] parsed_args = self.check_parser(self.cmd, arglist, verifylist) self.cmd.take_action(parsed_args) self.clusters_mock.delete.assert_called_with('foo') def test_cluster_delete_multiple(self): arglist = ['foo', 'bar'] verifylist = [('cluster', ['foo', 'bar'])] parsed_args = self.check_parser(self.cmd, arglist, verifylist) self.cmd.take_action(parsed_args) self.clusters_mock.delete.assert_has_calls([call('foo'), call('bar')]) def test_cluster_delete_bad_uuid(self): arglist = ['foo'] verifylist = [('cluster', ['foo'])] parsed_args = self.check_parser(self.cmd, arglist, verifylist) returns = self.cmd.take_action(parsed_args) self.assertEqual(returns, None) def test_cluster_delete_no_uuid(self): arglist = [] verifylist = [('cluster', [])] self.assertRaises(magnum_fakes.MagnumParseException, self.check_parser, self.cmd, arglist, verifylist) class TestClusterList(TestCluster): attr = dict() attr['name'] = 'fake-cluster-1' _cluster = magnum_fakes.FakeCluster.create_one_cluster(attr) columns = [ 'uuid', 'name', 'keypair', 'node_count', 'master_count', 'status', 'health_status' ] datalist = ( ( _cluster.uuid, _cluster.name, _cluster.keypair, _cluster.node_count, _cluster.master_count, _cluster.status, _cluster.health_status, ), ) def setUp(self): super(TestClusterList, self).setUp() self.clusters_mock.list = mock.Mock() self.clusters_mock.list.return_value = [self._cluster] # Get the command object to test self.cmd = osc_clusters.ListCluster(self.app, None) def test_cluster_list_no_options(self): arglist = [] verifylist = [ ('limit', None), ('sort_key', None), ('sort_dir', None), ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) columns, data = self.cmd.take_action(parsed_args) self.clusters_mock.list.assert_called_with( limit=None, sort_dir=None, sort_key=None, ) self.assertEqual(self.columns, columns) self.assertEqual(self.datalist, tuple(data)) def test_cluster_list_options(self): arglist = [ '--limit', '1', '--sort-key', 'key', '--sort-dir', 'asc' ] verifylist = [ ('limit', 1), ('sort_key', 'key'), ('sort_dir', 'asc') ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) self.cmd.take_action(parsed_args) self.clusters_mock.list.assert_called_with( limit=1, sort_dir='asc', sort_key='key', ) def test_cluster_list_bad_sort_dir_fail(self): arglist = [ '--sort-dir', 'foo' ] verifylist = [ ('limit', None), ('sort_key', None), ('sort_dir', 'foo'), ('fields', None), ] self.assertRaises(magnum_fakes.MagnumParseException, self.check_parser, self.cmd, arglist, verifylist) class TestClusterUpdate(TestCluster): def setUp(self): super(TestClusterUpdate, self).setUp() self.clusters_mock.update = mock.Mock() self.clusters_mock.update.return_value = None # Get the command object to test self.cmd = osc_clusters.UpdateCluster(self.app, None) def test_cluster_update_pass(self): arglist = ['foo', 'remove', 'bar'] verifylist = [ ('cluster', 'foo'), ('op', 'remove'), ('attributes', [['bar']]), ('rollback', False) ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) self.cmd.take_action(parsed_args) self.clusters_mock.update.assert_called_with( 'foo', [{'op': 'remove', 'path': '/bar'}] ) def test_cluster_update_bad_op(self): arglist = ['foo', 'bar', 'snafu'] verifylist = [ ('cluster', 'foo'), ('op', 'bar'), ('attributes', ['snafu']), ('rollback', False) ] self.assertRaises(magnum_fakes.MagnumParseException, self.check_parser, self.cmd, arglist, verifylist) class TestClusterShow(TestCluster): def setUp(self): super(TestClusterShow, self).setUp() attr = dict() attr['name'] = 'fake-cluster-1' self._cluster = magnum_fakes.FakeCluster.create_one_cluster(attr) self.clusters_mock.get = mock.Mock() self.clusters_mock.get.return_value = self._cluster # Get the command object to test self.cmd = osc_clusters.ShowCluster(self.app, None) self.data = tuple(map(lambda x: getattr(self._cluster, x), osc_clusters.CLUSTER_ATTRIBUTES)) def test_cluster_show_pass(self): arglist = ['fake-cluster'] verifylist = [ ('cluster', 'fake-cluster') ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) columns, data = self.cmd.take_action(parsed_args) self.clusters_mock.get.assert_called_with('fake-cluster') self.assertEqual(osc_clusters.CLUSTER_ATTRIBUTES, columns) self.assertEqual(self.data, data) def test_cluster_show_no_cluster_fail(self): arglist = [] verifylist = [] self.assertRaises(magnum_fakes.MagnumParseException, self.check_parser, self.cmd, arglist, verifylist) @contextmanager def capture(command, *args, **kwargs): out, sys.stdout = sys.stdout, StringIO() try: command(*args, **kwargs) sys.stdout.seek(0) yield sys.stdout.read() finally: sys.stdout = out class TestClusterConfig(TestCluster): def setUp(self): super(TestClusterConfig, self).setUp() attr = dict() attr['name'] = 'fake-cluster-1' attr['status'] = 'CREATE_COMPLETE' self._cluster = magnum_fakes.FakeCluster.create_one_cluster(attr) self.clusters_mock.get = mock.Mock() self.clusters_mock.get.return_value = self._cluster cert = magnum_fakes.FakeCert(pem='foo bar') self.certificates_mock.create = mock.Mock() self.certificates_mock.create.return_value = cert self.certificates_mock.get = mock.Mock() self.certificates_mock.get.return_value = cert # Fake the cluster_template attr = dict() attr['name'] = 'fake-ct' self._cluster_template = \ magnum_fakes.FakeClusterTemplate.create_one_cluster_template(attr) self.cluster_templates_mock = \ self.app.client_manager.container_infra.cluster_templates self.cluster_templates_mock.get = mock.Mock() self.cluster_templates_mock.get.return_value = self._cluster_template # Get the command object to test self.cmd = osc_clusters.ConfigCluster(self.app, None) def test_cluster_config_no_cluster_fail(self): arglist = [] verifylist = [] self.assertRaises(magnum_fakes.MagnumParseException, self.check_parser, self.cmd, arglist, verifylist) @mock.patch.dict(os.environ, {'SHELL': '/bin/bash'}) def test_cluster_config_custom_dir_with_config_only_works_if_force(self): tmp_dir = tempfile.mkdtemp() open(os.path.join(tmp_dir, 'config'), 'a').close() # touch config arglist = ['fake-cluster', '--dir', tmp_dir] verifylist = [ ('cluster', 'fake-cluster'), ('force', False), ('dir', tmp_dir), ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) self.assertRaises(exceptions.CommandError, self.cmd.take_action, parsed_args) self.clusters_mock.get.assert_called_with('fake-cluster') arglist = ['fake-cluster', '--force', '--dir', tmp_dir] verifylist = [ ('cluster', 'fake-cluster'), ('force', True), ('dir', tmp_dir), ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) expected_value = '''\ export KUBECONFIG={}/config '''.format(tmp_dir) with capture(self.cmd.take_action, parsed_args) as output: self.assertEqual(expected_value, output) self.clusters_mock.get.assert_called_with('fake-cluster') @mock.patch.dict(os.environ, {'SHELL': '/bin/bash'}) def test_cluster_config_with_custom_dir(self): tmp_dir = tempfile.mkdtemp() arglist = ['fake-cluster', '--dir', tmp_dir] verifylist = [ ('cluster', 'fake-cluster'), ('dir', tmp_dir), ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) expected_value = '''\ export KUBECONFIG={}/config '''.format(tmp_dir) with capture(self.cmd.take_action, parsed_args) as output: self.assertEqual(expected_value, output) self.clusters_mock.get.assert_called_with('fake-cluster') @mock.patch.dict(os.environ, {'SHELL': '/bin/bash'}) def test_cluster_config_creates_config_in_cwd_if_not_dir_specified(self): tmp_dir = tempfile.mkdtemp() os.chdir(tmp_dir) arglist = ['fake-cluster'] verifylist = [ ('cluster', 'fake-cluster'), ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) expected_value = '''\ export KUBECONFIG={}/config '''.format(os.getcwd()) with capture(self.cmd.take_action, parsed_args) as output: self.assertEqual(expected_value, output) self.clusters_mock.get.assert_called_with('fake-cluster') class TestClusterResize(TestCluster): def setUp(self): super(TestClusterResize, self).setUp() self.cluster = mock.Mock() self.cluster.uuid = "UUID1" self.clusters_mock.resize = mock.Mock() self.clusters_mock.resize.return_value = None self.clusters_mock.get = mock.Mock() self.clusters_mock.get.return_value = self.cluster # Get the command object to test self.cmd = osc_clusters.ResizeCluster(self.app, None) def test_cluster_resize_pass(self): arglist = ['foo', '2'] verifylist = [ ('cluster', 'foo'), ('node_count', 2), ('nodes_to_remove', None), ('nodegroup', None) ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) self.cmd.take_action(parsed_args) self.clusters_mock.resize.assert_called_with( "UUID1", 2, None, None ) def test_cluster_resize_to_zero_pass(self): arglist = ['foo', '0'] verifylist = [ ('cluster', 'foo'), ('node_count', 0), ('nodes_to_remove', None), ('nodegroup', None) ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) self.cmd.take_action(parsed_args) self.clusters_mock.resize.assert_called_with( "UUID1", 0, None, None ) class TestClusterUpgrade(TestCluster): def setUp(self): super(TestClusterUpgrade, self).setUp() self.cluster = mock.Mock() self.cluster.uuid = "UUID1" self.clusters_mock.upgrade = mock.Mock() self.clusters_mock.upgrade.return_value = None self.clusters_mock.get = mock.Mock() self.clusters_mock.get.return_value = self.cluster # Get the command object to test self.cmd = osc_clusters.UpgradeCluster(self.app, None) def test_cluster_upgrade_pass(self): cluster_template_id = 'TEMPLATE_ID' arglist = ['foo', cluster_template_id] verifylist = [ ('cluster', 'foo'), ('cluster_template', cluster_template_id), ('max_batch_size', 1), ('nodegroup', None) ] parsed_args = self.check_parser(self.cmd, arglist, verifylist) self.cmd.take_action(parsed_args) self.clusters_mock.upgrade.assert_called_with( "UUID1", cluster_template_id, 1, None )
apache-2.0
leekchan/django_test
django/core/mail/backends/console.py
696
1477
""" Email backend that writes messages to console instead of sending them. """ import sys import threading from django.core.mail.backends.base import BaseEmailBackend from django.utils import six class EmailBackend(BaseEmailBackend): def __init__(self, *args, **kwargs): self.stream = kwargs.pop('stream', sys.stdout) self._lock = threading.RLock() super(EmailBackend, self).__init__(*args, **kwargs) def write_message(self, message): msg = message.message() msg_data = msg.as_bytes() if six.PY3: charset = msg.get_charset().get_output_charset() if msg.get_charset() else 'utf-8' msg_data = msg_data.decode(charset) self.stream.write('%s\n' % msg_data) self.stream.write('-' * 79) self.stream.write('\n') def send_messages(self, email_messages): """Write all messages to the stream in a thread-safe way.""" if not email_messages: return msg_count = 0 with self._lock: try: stream_created = self.open() for message in email_messages: self.write_message(message) self.stream.flush() # flush after each message msg_count += 1 if stream_created: self.close() except Exception: if not self.fail_silently: raise return msg_count
bsd-3-clause
blab/antibody-response-pulse
bcell-array/code/Virus_Bcell_IgM_IgG_Infection_OAS_new.py
1
13195
# coding: utf-8 # # Antibody Response Pulse # https://github.com/blab/antibody-response-pulse # # ### B-cells evolution --- cross-reactive antibody response after influenza virus infection or vaccination # ### Adaptive immune response for repeated infection # In[3]: ''' author: Alvason Zhenhua Li date: 04/09/2015 ''' get_ipython().magic(u'matplotlib inline') import numpy as np import matplotlib.pyplot as plt import os from matplotlib.ticker import FuncFormatter import alva_machinery_event_OAS_new as alva AlvaFontSize = 23 AlvaFigSize = (15, 5) numberingFig = 0 # plotting dir_path = '/Users/al/Desktop/GitHub/antibody-response-pulse/bcell-array/figure' file_name = 'Virus-Bcell-IgM-IgG' figure_name = '-equation' file_suffix = '.png' save_figure = os.path.join(dir_path, file_name + figure_name + file_suffix) numberingFig = numberingFig + 1 plt.figure(numberingFig, figsize=(12, 5)) plt.axis('off') plt.title(r'$ Virus-Bcell-IgM-IgG \ equations \ (antibody-response \ for \ repeated-infection) $' , fontsize = AlvaFontSize) plt.text(0, 7.0/9, r'$ \frac{\partial V_n(t)}{\partial t} = +\mu_{v}V_{n}(t)(1 - \frac{V_n(t)}{V_{max}}) - \phi_{m} M_{n}(t) V_{n}(t) - \phi_{g} G_{n}(t) V_{n}(t) $' , fontsize = 1.2*AlvaFontSize) plt.text(0, 5.0/9, r'$ \frac{\partial B_n(t)}{\partial t} = +\mu_{b}V_{n}(t)(1 - \frac{V_n(t)}{V_{max}}) + (\beta_{m} + \beta_{g}) V_{n}(t) B_{n}(t) - \mu_{b} B_{n}(t) + m_b V_{n}(t)\frac{B_{i-1}(t) - 2B_i(t) + B_{i+1}(t)}{(\Delta i)^2} $' , fontsize = 1.2*AlvaFontSize) plt.text(0, 3.0/9,r'$ \frac{\partial M_n(t)}{\partial t} = +\xi_{m} B_{n}(t) - \phi_{m} M_{n}(t) V_{n}(t) - \mu_{m} M_{n}(t) $' , fontsize = 1.2*AlvaFontSize) plt.text(0, 1.0/9,r'$ \frac{\partial G_n(t)}{\partial t} = +\xi_{g} B_{n}(t) - \phi_{g} G_{n}(t) V_{n}(t) - \mu_{g} G_{n}(t) + m_a V_{n}(t)\frac{G_{i-1}(t) - 2G_i(t) + G_{i+1}(t)}{(\Delta i)^2} $' , fontsize = 1.2*AlvaFontSize) plt.savefig(save_figure, dpi = 100) plt.show() # define the V-M-G partial differential equations def dVdt_array(VBMGxt = [], *args): # naming V = VBMGxt[0] B = VBMGxt[1] M = VBMGxt[2] G = VBMGxt[3] x_totalPoint = VBMGxt.shape[1] # there are n dSdt dV_dt_array = np.zeros(x_totalPoint) # each dSdt with the same equation form dV_dt_array[:] = +inRateV*V[:]*(1 - V[:]/maxV) - killRateVm*M[:]*V[:] - killRateVg*G[:]*V[:] return(dV_dt_array) def dBdt_array(VBMGxt = [], *args): # naming V = VBMGxt[0] B = VBMGxt[1] M = VBMGxt[2] G = VBMGxt[3] x_totalPoint = VBMGxt.shape[1] # there are n dSdt dB_dt_array = np.zeros(x_totalPoint) # each dSdt with the same equation form Bcopy = np.copy(B) centerX = Bcopy[:] leftX = np.roll(Bcopy[:], 1) rightX = np.roll(Bcopy[:], -1) leftX[0] = centerX[0] rightX[-1] = centerX[-1] dB_dt_array[:] = +inRateB*V[:]*(1 - V[:]/maxV) + (actRateBm + alva.event_active + alva.event_OAS_B)*V[:]*B[:] - outRateB*B[:] + mutatRateB*V[:]*(leftX[:] - 2*centerX[:] + rightX[:])/(dx**2) return(dB_dt_array) def dMdt_array(VBMGxt = [], *args): # naming V = VBMGxt[0] B = VBMGxt[1] M = VBMGxt[2] G = VBMGxt[3] x_totalPoint = VBMGxt.shape[1] # there are n dSdt dM_dt_array = np.zeros(x_totalPoint) # each dSdt with the same equation form dM_dt_array[:] = +inRateM*B[:] - consumeRateM*M[:]*V[:] - outRateM*M[:] return(dM_dt_array) def dGdt_array(VBMGxt = [], *args): # naming V = VBMGxt[0] B = VBMGxt[1] M = VBMGxt[2] G = VBMGxt[3] x_totalPoint = VBMGxt.shape[1] # there are n dSdt dG_dt_array = np.zeros(x_totalPoint) # each dSdt with the same equation form Gcopy = np.copy(G) centerX = Gcopy[:] leftX = np.roll(Gcopy[:], 1) rightX = np.roll(Gcopy[:], -1) leftX[0] = centerX[0] rightX[-1] = centerX[-1] dG_dt_array[:] = +(inRateG + alva.event_OAS)*B[:] - consumeRateG*G[:]*V[:] - outRateG*G[:] + mutatRateA*(leftX[:] - 2*centerX[:] + rightX[:])/(dx**2) return(dG_dt_array) # In[7]: # setting parameter timeUnit = 'day' if timeUnit == 'hour': hour = float(1) day = float(24) elif timeUnit == 'day': day = float(1) hour = float(1)/24 elif timeUnit == 'year': year = float(1) day = float(1)/365 hour = float(1)/24/365 maxV = float(50) # max virus/micro-liter inRateV = 0.2/hour # in-rate of virus killRateVm = 0.0003/hour # kill-rate of virus by antibody-IgM killRateVg = killRateVm # kill-rate of virus by antibody-IgG inRateB = 0.06/hour # in-rate of B-cell outRateB = inRateB/8 # out-rate of B-cell actRateBm = killRateVm # activation rate of naive B-cell inRateM = 0.16/hour # in-rate of antibody-IgM from naive B-cell outRateM = inRateM/1 # out-rate of antibody-IgM from naive B-cell consumeRateM = killRateVm # consume-rate of antibody-IgM by cleaning virus inRateG = inRateM/10 # in-rate of antibody-IgG from memory B-cell outRateG = outRateM/250 # out-rate of antibody-IgG from memory B-cell consumeRateG = killRateVg # consume-rate of antibody-IgG by cleaning virus mutatRateB = 0.00003/hour # B-cell mutation rate mutatRateA = 0.0001/hour # antibody mutation rate mutatRateB = 0.0000/hour # B-cell mutation rate mutatRateA = 0.000/hour # antibody mutation rate # time boundary and griding condition minT = float(0) maxT = float(6*28*day) totalPoint_T = int(1*10**3 + 1) gT = np.linspace(minT, maxT, totalPoint_T) spacingT = np.linspace(minT, maxT, num = totalPoint_T, retstep = True) gT = spacingT[0] dt = spacingT[1] # space boundary and griding condition minX = float(0) maxX = float(3) totalPoint_X = int(maxX - minX + 1) gX = np.linspace(minX, maxX, totalPoint_X) gridingX = np.linspace(minX, maxX, num = totalPoint_X, retstep = True) gX = gridingX[0] dx = gridingX[1] gV_array = np.zeros([totalPoint_X, totalPoint_T]) gB_array = np.zeros([totalPoint_X, totalPoint_T]) gM_array = np.zeros([totalPoint_X, totalPoint_T]) gG_array = np.zeros([totalPoint_X, totalPoint_T]) # initial output condition #gV_array[1, 0] = float(2) #[pre-parameter, post-parameter, recovered-day, OAS+, OSA-] actRateBg_1st = 0.0002/hour # activation rate of memory B-cell at 1st time (pre-) actRateBg_2nd = actRateBg_1st*10 # activation rate of memory B-cell at 2nd time (post-) origin_virus = int(1) current_virus = int(2) event_parameter = np.array([[actRateBg_1st, actRateBg_2nd, 14*day, +5/hour, -actRateBm - actRateBg_1st + (actRateBm + actRateBg_1st)/3, origin_virus, current_virus]]) # [viral population, starting time, first] # [viral population, starting time] ---first infection_period = 1*28*day viral_population = np.zeros(int(maxX + 1)) viral_population[origin_virus:current_virus + 1] = 3 infection_starting_time = np.arange(int(maxX + 1))*infection_period event_1st = np.zeros([int(maxX + 1), 2]) event_1st[:, 0] = viral_population event_1st[:, 1] = infection_starting_time print ('event_1st = {:}'.format(event_1st)) # [viral population, starting time] ---2nd] viral_population = np.zeros(int(maxX + 1)) viral_population[origin_virus:current_virus + 1] = 0 infection_starting_time = np.arange(int(maxX + 1))*0 event_2nd = np.zeros([int(maxX + 1), 2]) event_2nd[:, 0] = viral_population event_2nd[:, 1] = infection_starting_time print ('event_2nd = {:}'.format(event_2nd)) event_table = np.array([event_parameter, event_1st, event_2nd]) # Runge Kutta numerical solution pde_array = np.array([dVdt_array, dBdt_array, dMdt_array, dGdt_array]) initial_Out = np.array([gV_array, gB_array, gM_array, gG_array]) gOut_array = alva.AlvaRungeKutta4XT(pde_array, initial_Out, minX, maxX, totalPoint_X, minT, maxT, totalPoint_T, event_table) # plotting gV = gOut_array[0] gB = gOut_array[1] gM = gOut_array[2] gG = gOut_array[3] numberingFig = numberingFig + 1 for i in range(totalPoint_X): figure_name = '-response-%i'%(i) figure_suffix = '.png' save_figure = os.path.join(dir_path, file_name + figure_name + file_suffix) plt.figure(numberingFig, figsize = AlvaFigSize) plt.plot(gT, gV[i], color = 'red', label = r'$ V_{%i}(t) $'%(i), linewidth = 3.0, alpha = 0.5) plt.plot(gT, gM[i], color = 'blue', label = r'$ IgM_{%i}(t) $'%(i), linewidth = 3.0, alpha = 0.5) plt.plot(gT, gG[i], color = 'green', label = r'$ IgG_{%i}(t) $'%(i), linewidth = 3.0, alpha = 0.5) plt.plot(gT, gM[i] + gG[i], color = 'gray', linewidth = 5.0, alpha = 0.5, linestyle = 'dashed' , label = r'$ IgM_{%i}(t) + IgG_{%i}(t) $'%(i, i)) plt.grid(True, which = 'both') plt.title(r'$ Antibody \ from \ Virus-{%i} $'%(i), fontsize = AlvaFontSize) plt.xlabel(r'$time \ (%s)$'%(timeUnit), fontsize = AlvaFontSize) plt.ylabel(r'$ Neutralization \ \ titer $', fontsize = AlvaFontSize) plt.xlim([minT, maxT]) plt.xticks(fontsize = AlvaFontSize*0.6) plt.yticks(fontsize = AlvaFontSize*0.6) plt.ylim([2**0, 2**14]) plt.yscale('log', basey = 2) plt.legend(loc = (1,0), fontsize = AlvaFontSize) plt.savefig(save_figure, dpi = 100) plt.show() # In[5]: # Experimental lab data from OAS paper gT_lab = np.array([28, 28 + 7, 28 + 14, 28 + 28]) + 28 gPR8_lab = np.array([2**(9 + 1.0/10), 2**(13 - 1.0/5), 2**(13 + 1.0/3), 2**(13 - 1.0/4)]) standard_PR8 = gPR8_lab**(3.0/4) gFM1_lab = np.array([0, 2**(6 - 1.0/5), 2**(7 - 1.0/4), 2**(8 + 1.0/4)]) standard_FM1 = gFM1_lab**(3.0/4) bar_width = 2.0 # Sequential immunization graph numberingFig = numberingFig + 1 plt.figure(numberingFig, figsize = (12, 6)) plt.subplot(111) plt.plot(gT, (gM[origin_virus] + gG[origin_virus]), linewidth = 5.0, alpha = 0.5, color = 'gray' , label = r'$ Origin-virus $') plt.plot(gT, (gM[origin_virus + 1] + gG[origin_virus + 1]), linewidth = 5.0, alpha = 0.5, color = 'red' , label = r'$ Subsequence-virus $') plt.bar(gT_lab - bar_width/2, gPR8_lab, bar_width, alpha = 0.6, color = 'gray', yerr = standard_PR8 , error_kw = dict(elinewidth = 1, ecolor = 'black'), label = r'$ PR8-virus $') plt.bar(gT_lab + bar_width/2, gFM1_lab, bar_width, alpha = 0.6, color = 'red', yerr = standard_FM1 , error_kw = dict(elinewidth = 1, ecolor = 'black'), label = r'$ FM1-virus $') plt.grid(True, which = 'both') plt.title(r'$ Original \ Antigenic \ Sin \ (sequential-infection)$', fontsize = AlvaFontSize) plt.xlabel(r'$time \ (%s)$'%(timeUnit), fontsize = AlvaFontSize) plt.ylabel(r'$ Neutralization \ \ titer $', fontsize = AlvaFontSize) plt.xticks(fontsize = AlvaFontSize*0.6) plt.yticks(fontsize = AlvaFontSize*0.6) plt.xlim([minT, 6*30*day]) plt.ylim([2**5, 2**14]) plt.yscale('log', basey = 2) # gca()---GetCurrentAxis and Format the ticklabel to be 2**x plt.gca().yaxis.set_major_formatter(FuncFormatter(lambda x, pos: int(2**(np.log(x)/np.log(2))))) #plt.gca().xaxis.set_major_locator(plt.MultipleLocator(7)) plt.legend(loc = (1, 0), fontsize = AlvaFontSize) plt.show() # In[6]: # Experimental lab data from OAS paper gT_lab = np.array([28, 28 + 7, 28 + 14, 28 + 28]) + 28 gPR8_lab = np.array([2**(9 + 1.0/10), 2**(13 - 1.0/5), 2**(13 + 1.0/3), 2**(13 - 1.0/4)]) standard_PR8 = gPR8_lab**(3.0/4) gFM1_lab = np.array([0, 2**(6 - 1.0/5), 2**(7 - 1.0/4), 2**(8 + 1.0/4)]) standard_FM1 = gFM1_lab**(3.0/4) bar_width = 1.0 # Sequential immunization graph figure_name = '-Original-Antigenic-Sin-infection' figure_suffix = '.png' save_figure = os.path.join(dir_path, file_name + figure_name + file_suffix) numberingFig = numberingFig + 1 plt.figure(numberingFig, figsize = (12, 6)) plt.subplot(111) plt.plot(gT, (gM[origin_virus] + gG[origin_virus]), linewidth = 5.0, alpha = 0.5, color = 'gray' , label = r'$ Origin-virus $') plt.plot(gT, (gM[origin_virus + 1] + gG[origin_virus + 1]), linewidth = 5.0, alpha = 0.5, color = 'red' , label = r'$ Subsequence-virus $') plt.bar(gT_lab - bar_width/2, gPR8_lab, bar_width, alpha = 0.6, color = 'gray', yerr = standard_PR8 , error_kw = dict(elinewidth = 1, ecolor = 'black'), label = r'$ PR8-virus $') plt.bar(gT_lab + bar_width/2, gFM1_lab, bar_width, alpha = 0.6, color = 'red', yerr = standard_FM1 , error_kw = dict(elinewidth = 1, ecolor = 'black'), label = r'$ FM1-virus $') plt.grid(True, which = 'both') plt.title(r'$ Original \ Antigenic \ Sin \ (sequential-infection)$', fontsize = AlvaFontSize) plt.xlabel(r'$time \ (%s)$'%(timeUnit), fontsize = AlvaFontSize) plt.ylabel(r'$ Neutralization \ \ titer $', fontsize = AlvaFontSize) plt.xticks(fontsize = AlvaFontSize*0.6) plt.yticks(fontsize = AlvaFontSize*0.6) plt.xlim([minT, 3*30*day]) plt.ylim([2**5, 2**14]) plt.yscale('log', basey = 2) # gca()---GetCurrentAxis and Format the ticklabel to be 2**x plt.gca().yaxis.set_major_formatter(FuncFormatter(lambda x, pos: int(2**(np.log(x)/np.log(2))))) plt.gca().xaxis.set_major_locator(plt.MultipleLocator(7)) plt.legend(loc = (1, 0), fontsize = AlvaFontSize) plt.savefig(save_figure, dpi = 100, bbox_inches='tight') plt.show() # In[ ]:
gpl-2.0
cloudera/hue
desktop/core/ext-py/eventlet-0.24.1/eventlet/websocket.py
5
32462
import base64 import codecs import collections import errno from random import Random from socket import error as SocketError import string import struct import sys import time import zlib try: from hashlib import md5, sha1 except ImportError: # pragma NO COVER from md5 import md5 from sha import sha as sha1 from eventlet import semaphore from eventlet import wsgi from eventlet.green import socket from eventlet.support import get_errno import six # Python 2's utf8 decoding is more lenient than we'd like # In order to pass autobahn's testsuite we need stricter validation # if available... for _mod in ('wsaccel.utf8validator', 'autobahn.utf8validator'): # autobahn has it's own python-based validator. in newest versions # this prefers to use wsaccel, a cython based implementation, if available. # wsaccel may also be installed w/out autobahn, or with a earlier version. try: utf8validator = __import__(_mod, {}, {}, ['']) except ImportError: utf8validator = None else: break ACCEPTABLE_CLIENT_ERRORS = set((errno.ECONNRESET, errno.EPIPE)) __all__ = ["WebSocketWSGI", "WebSocket"] PROTOCOL_GUID = b'258EAFA5-E914-47DA-95CA-C5AB0DC85B11' VALID_CLOSE_STATUS = set( list(range(1000, 1004)) + list(range(1007, 1012)) + # 3000-3999: reserved for use by libraries, frameworks, # and applications list(range(3000, 4000)) + # 4000-4999: reserved for private use and thus can't # be registered list(range(4000, 5000)) ) class BadRequest(Exception): def __init__(self, status='400 Bad Request', body=None, headers=None): super(Exception, self).__init__() self.status = status self.body = body self.headers = headers class WebSocketWSGI(object): """Wraps a websocket handler function in a WSGI application. Use it like this:: @websocket.WebSocketWSGI def my_handler(ws): from_browser = ws.wait() ws.send("from server") The single argument to the function will be an instance of :class:`WebSocket`. To close the socket, simply return from the function. Note that the server will log the websocket request at the time of closure. """ def __init__(self, handler): self.handler = handler self.protocol_version = None self.support_legacy_versions = True self.supported_protocols = [] self.origin_checker = None @classmethod def configured(cls, handler=None, supported_protocols=None, origin_checker=None, support_legacy_versions=False): def decorator(handler): inst = cls(handler) inst.support_legacy_versions = support_legacy_versions inst.origin_checker = origin_checker if supported_protocols: inst.supported_protocols = supported_protocols return inst if handler is None: return decorator return decorator(handler) def __call__(self, environ, start_response): http_connection_parts = [ part.strip() for part in environ.get('HTTP_CONNECTION', '').lower().split(',')] if not ('upgrade' in http_connection_parts and environ.get('HTTP_UPGRADE', '').lower() == 'websocket'): # need to check a few more things here for true compliance start_response('400 Bad Request', [('Connection', 'close')]) return [] try: if 'HTTP_SEC_WEBSOCKET_VERSION' in environ: ws = self._handle_hybi_request(environ) elif self.support_legacy_versions: ws = self._handle_legacy_request(environ) else: raise BadRequest() except BadRequest as e: status = e.status body = e.body or b'' headers = e.headers or [] start_response(status, [('Connection', 'close'), ] + headers) return [body] try: self.handler(ws) except socket.error as e: if get_errno(e) not in ACCEPTABLE_CLIENT_ERRORS: raise # Make sure we send the closing frame ws._send_closing_frame(True) # use this undocumented feature of eventlet.wsgi to ensure that it # doesn't barf on the fact that we didn't call start_response return wsgi.ALREADY_HANDLED def _handle_legacy_request(self, environ): if 'eventlet.input' in environ: sock = environ['eventlet.input'].get_socket() elif 'gunicorn.socket' in environ: sock = environ['gunicorn.socket'] else: raise Exception('No eventlet.input or gunicorn.socket present in environ.') if 'HTTP_SEC_WEBSOCKET_KEY1' in environ: self.protocol_version = 76 if 'HTTP_SEC_WEBSOCKET_KEY2' not in environ: raise BadRequest() else: self.protocol_version = 75 if self.protocol_version == 76: key1 = self._extract_number(environ['HTTP_SEC_WEBSOCKET_KEY1']) key2 = self._extract_number(environ['HTTP_SEC_WEBSOCKET_KEY2']) # There's no content-length header in the request, but it has 8 # bytes of data. environ['wsgi.input'].content_length = 8 key3 = environ['wsgi.input'].read(8) key = struct.pack(">II", key1, key2) + key3 response = md5(key).digest() # Start building the response scheme = 'ws' if environ.get('wsgi.url_scheme') == 'https': scheme = 'wss' location = '%s://%s%s%s' % ( scheme, environ.get('HTTP_HOST'), environ.get('SCRIPT_NAME'), environ.get('PATH_INFO') ) qs = environ.get('QUERY_STRING') if qs is not None: location += '?' + qs if self.protocol_version == 75: handshake_reply = ( b"HTTP/1.1 101 Web Socket Protocol Handshake\r\n" b"Upgrade: WebSocket\r\n" b"Connection: Upgrade\r\n" b"WebSocket-Origin: " + six.b(environ.get('HTTP_ORIGIN')) + b"\r\n" b"WebSocket-Location: " + six.b(location) + b"\r\n\r\n" ) elif self.protocol_version == 76: handshake_reply = ( b"HTTP/1.1 101 WebSocket Protocol Handshake\r\n" b"Upgrade: WebSocket\r\n" b"Connection: Upgrade\r\n" b"Sec-WebSocket-Origin: " + six.b(environ.get('HTTP_ORIGIN')) + b"\r\n" b"Sec-WebSocket-Protocol: " + six.b(environ.get('HTTP_SEC_WEBSOCKET_PROTOCOL', 'default')) + b"\r\n" b"Sec-WebSocket-Location: " + six.b(location) + b"\r\n" b"\r\n" + response ) else: # pragma NO COVER raise ValueError("Unknown WebSocket protocol version.") sock.sendall(handshake_reply) return WebSocket(sock, environ, self.protocol_version) def _parse_extension_header(self, header): if header is None: return None res = {} for ext in header.split(","): parts = ext.split(";") config = {} for part in parts[1:]: key_val = part.split("=") if len(key_val) == 1: config[key_val[0].strip().lower()] = True else: config[key_val[0].strip().lower()] = key_val[1].strip().strip('"').lower() res.setdefault(parts[0].strip().lower(), []).append(config) return res def _negotiate_permessage_deflate(self, extensions): if not extensions: return None deflate = extensions.get("permessage-deflate") if deflate is None: return None for config in deflate: # We'll evaluate each config in the client's preferred order and pick # the first that we can support. want_config = { # These are bool options, we can support both "server_no_context_takeover": config.get("server_no_context_takeover", False), "client_no_context_takeover": config.get("client_no_context_takeover", False) } # These are either bool OR int options. True means the client can accept a value # for the option, a number means the client wants that specific value. max_wbits = min(zlib.MAX_WBITS, 15) mwb = config.get("server_max_window_bits") if mwb is not None: if mwb is True: want_config["server_max_window_bits"] = max_wbits else: want_config["server_max_window_bits"] = \ int(config.get("server_max_window_bits", max_wbits)) if not (8 <= want_config["server_max_window_bits"] <= 15): continue mwb = config.get("client_max_window_bits") if mwb is not None: if mwb is True: want_config["client_max_window_bits"] = max_wbits else: want_config["client_max_window_bits"] = \ int(config.get("client_max_window_bits", max_wbits)) if not (8 <= want_config["client_max_window_bits"] <= 15): continue return want_config return None def _format_extension_header(self, parsed_extensions): if not parsed_extensions: return None parts = [] for name, config in parsed_extensions.items(): ext_parts = [six.b(name)] for key, value in config.items(): if value is False: pass elif value is True: ext_parts.append(six.b(key)) else: ext_parts.append(six.b("%s=%s" % (key, str(value)))) parts.append(b"; ".join(ext_parts)) return b", ".join(parts) def _handle_hybi_request(self, environ): if 'eventlet.input' in environ: sock = environ['eventlet.input'].get_socket() elif 'gunicorn.socket' in environ: sock = environ['gunicorn.socket'] else: raise Exception('No eventlet.input or gunicorn.socket present in environ.') hybi_version = environ['HTTP_SEC_WEBSOCKET_VERSION'] if hybi_version not in ('8', '13', ): raise BadRequest(status='426 Upgrade Required', headers=[('Sec-WebSocket-Version', '8, 13')]) self.protocol_version = int(hybi_version) if 'HTTP_SEC_WEBSOCKET_KEY' not in environ: # That's bad. raise BadRequest() origin = environ.get( 'HTTP_ORIGIN', (environ.get('HTTP_SEC_WEBSOCKET_ORIGIN', '') if self.protocol_version <= 8 else '')) if self.origin_checker is not None: if not self.origin_checker(environ.get('HTTP_HOST'), origin): raise BadRequest(status='403 Forbidden') protocols = environ.get('HTTP_SEC_WEBSOCKET_PROTOCOL', None) negotiated_protocol = None if protocols: for p in (i.strip() for i in protocols.split(',')): if p in self.supported_protocols: negotiated_protocol = p break key = environ['HTTP_SEC_WEBSOCKET_KEY'] response = base64.b64encode(sha1(six.b(key) + PROTOCOL_GUID).digest()) handshake_reply = [b"HTTP/1.1 101 Switching Protocols", b"Upgrade: websocket", b"Connection: Upgrade", b"Sec-WebSocket-Accept: " + response] if negotiated_protocol: handshake_reply.append(b"Sec-WebSocket-Protocol: " + six.b(negotiated_protocol)) parsed_extensions = {} extensions = self._parse_extension_header(environ.get("HTTP_SEC_WEBSOCKET_EXTENSIONS")) deflate = self._negotiate_permessage_deflate(extensions) if deflate is not None: parsed_extensions["permessage-deflate"] = deflate formatted_ext = self._format_extension_header(parsed_extensions) if formatted_ext is not None: handshake_reply.append(b"Sec-WebSocket-Extensions: " + formatted_ext) sock.sendall(b'\r\n'.join(handshake_reply) + b'\r\n\r\n') return RFC6455WebSocket(sock, environ, self.protocol_version, protocol=negotiated_protocol, extensions=parsed_extensions) def _extract_number(self, value): """ Utility function which, given a string like 'g98sd 5[]221@1', will return 9852211. Used to parse the Sec-WebSocket-Key headers. """ out = "" spaces = 0 for char in value: if char in string.digits: out += char elif char == " ": spaces += 1 return int(out) // spaces class WebSocket(object): """A websocket object that handles the details of serialization/deserialization to the socket. The primary way to interact with a :class:`WebSocket` object is to call :meth:`send` and :meth:`wait` in order to pass messages back and forth with the browser. Also available are the following properties: path The path value of the request. This is the same as the WSGI PATH_INFO variable, but more convenient. protocol The value of the Websocket-Protocol header. origin The value of the 'Origin' header. environ The full WSGI environment for this request. """ def __init__(self, sock, environ, version=76): """ :param socket: The eventlet socket :type socket: :class:`eventlet.greenio.GreenSocket` :param environ: The wsgi environment :param version: The WebSocket spec version to follow (default is 76) """ self.log = environ.get('wsgi.errors', sys.stderr) self.log_context = 'server={shost}/{spath} client={caddr}:{cport}'.format( shost=environ.get('HTTP_HOST'), spath=environ.get('SCRIPT_NAME', '') + environ.get('PATH_INFO', ''), caddr=environ.get('REMOTE_ADDR'), cport=environ.get('REMOTE_PORT'), ) self.socket = sock self.origin = environ.get('HTTP_ORIGIN') self.protocol = environ.get('HTTP_WEBSOCKET_PROTOCOL') self.path = environ.get('PATH_INFO') self.environ = environ self.version = version self.websocket_closed = False self._buf = b"" self._msgs = collections.deque() self._sendlock = semaphore.Semaphore() def _pack_message(self, message): """Pack the message inside ``00`` and ``FF`` As per the dataframing section (5.3) for the websocket spec """ if isinstance(message, six.text_type): message = message.encode('utf-8') elif not isinstance(message, six.binary_type): message = six.b(str(message)) packed = b"\x00" + message + b"\xFF" return packed def _parse_messages(self): """ Parses for messages in the buffer *buf*. It is assumed that the buffer contains the start character for a message, but that it may contain only part of the rest of the message. Returns an array of messages, and the buffer remainder that didn't contain any full messages.""" msgs = [] end_idx = 0 buf = self._buf while buf: frame_type = six.indexbytes(buf, 0) if frame_type == 0: # Normal message. end_idx = buf.find(b"\xFF") if end_idx == -1: # pragma NO COVER break msgs.append(buf[1:end_idx].decode('utf-8', 'replace')) buf = buf[end_idx + 1:] elif frame_type == 255: # Closing handshake. assert six.indexbytes(buf, 1) == 0, "Unexpected closing handshake: %r" % buf self.websocket_closed = True break else: raise ValueError("Don't understand how to parse this type of message: %r" % buf) self._buf = buf return msgs def send(self, message): """Send a message to the browser. *message* should be convertable to a string; unicode objects should be encodable as utf-8. Raises socket.error with errno of 32 (broken pipe) if the socket has already been closed by the client.""" packed = self._pack_message(message) # if two greenthreads are trying to send at the same time # on the same socket, sendlock prevents interleaving and corruption self._sendlock.acquire() try: self.socket.sendall(packed) finally: self._sendlock.release() def wait(self): """Waits for and deserializes messages. Returns a single message; the oldest not yet processed. If the client has already closed the connection, returns None. This is different from normal socket behavior because the empty string is a valid websocket message.""" while not self._msgs: # Websocket might be closed already. if self.websocket_closed: return None # no parsed messages, must mean buf needs more data delta = self.socket.recv(8096) if delta == b'': return None self._buf += delta msgs = self._parse_messages() self._msgs.extend(msgs) return self._msgs.popleft() def _send_closing_frame(self, ignore_send_errors=False): """Sends the closing frame to the client, if required.""" if self.version == 76 and not self.websocket_closed: try: self.socket.sendall(b"\xff\x00") except SocketError: # Sometimes, like when the remote side cuts off the connection, # we don't care about this. if not ignore_send_errors: # pragma NO COVER raise self.websocket_closed = True def close(self): """Forcibly close the websocket; generally it is preferable to return from the handler method.""" try: self._send_closing_frame(True) self.socket.shutdown(True) except SocketError as e: if e.errno != errno.ENOTCONN: self.log.write('{ctx} socket shutdown error: {e}'.format(ctx=self.log_context, e=e)) finally: self.socket.close() class ConnectionClosedError(Exception): pass class FailedConnectionError(Exception): def __init__(self, status, message): super(FailedConnectionError, self).__init__(status, message) self.message = message self.status = status class ProtocolError(ValueError): pass class RFC6455WebSocket(WebSocket): def __init__(self, sock, environ, version=13, protocol=None, client=False, extensions=None): super(RFC6455WebSocket, self).__init__(sock, environ, version) self.iterator = self._iter_frames() self.client = client self.protocol = protocol self.extensions = extensions or {} self._deflate_enc = None self._deflate_dec = None class UTF8Decoder(object): def __init__(self): if utf8validator: self.validator = utf8validator.Utf8Validator() else: self.validator = None decoderclass = codecs.getincrementaldecoder('utf8') self.decoder = decoderclass() def reset(self): if self.validator: self.validator.reset() self.decoder.reset() def decode(self, data, final=False): if self.validator: valid, eocp, c_i, t_i = self.validator.validate(data) if not valid: raise ValueError('Data is not valid unicode') return self.decoder.decode(data, final) def _get_permessage_deflate_enc(self): options = self.extensions.get("permessage-deflate") if options is None: return None def _make(): return zlib.compressobj(zlib.Z_DEFAULT_COMPRESSION, zlib.DEFLATED, -options.get("client_max_window_bits" if self.client else "server_max_window_bits", zlib.MAX_WBITS)) if options.get("client_no_context_takeover" if self.client else "server_no_context_takeover"): # This option means we have to make a new one every time return _make() else: if self._deflate_enc is None: self._deflate_enc = _make() return self._deflate_enc def _get_permessage_deflate_dec(self, rsv1): options = self.extensions.get("permessage-deflate") if options is None or not rsv1: return None def _make(): return zlib.decompressobj(-options.get("server_max_window_bits" if self.client else "client_max_window_bits", zlib.MAX_WBITS)) if options.get("server_no_context_takeover" if self.client else "client_no_context_takeover"): # This option means we have to make a new one every time return _make() else: if self._deflate_dec is None: self._deflate_dec = _make() return self._deflate_dec def _get_bytes(self, numbytes): data = b'' while len(data) < numbytes: d = self.socket.recv(numbytes - len(data)) if not d: raise ConnectionClosedError() data = data + d return data class Message(object): def __init__(self, opcode, decoder=None, decompressor=None): self.decoder = decoder self.data = [] self.finished = False self.opcode = opcode self.decompressor = decompressor def push(self, data, final=False): self.finished = final self.data.append(data) def getvalue(self): data = b"".join(self.data) if not self.opcode & 8 and self.decompressor: data = self.decompressor.decompress(data + b'\x00\x00\xff\xff') if self.decoder: data = self.decoder.decode(data, self.finished) return data @staticmethod def _apply_mask(data, mask, length=None, offset=0): if length is None: length = len(data) cnt = range(length) return b''.join(six.int2byte(six.indexbytes(data, i) ^ mask[(offset + i) % 4]) for i in cnt) def _handle_control_frame(self, opcode, data): if opcode == 8: # connection close if not data: status = 1000 elif len(data) > 1: status = struct.unpack_from('!H', data)[0] if not status or status not in VALID_CLOSE_STATUS: raise FailedConnectionError( 1002, "Unexpected close status code.") try: data = self.UTF8Decoder().decode(data[2:], True) except (UnicodeDecodeError, ValueError): raise FailedConnectionError( 1002, "Close message data should be valid UTF-8.") else: status = 1002 self.close(close_data=(status, '')) raise ConnectionClosedError() elif opcode == 9: # ping self.send(data, control_code=0xA) elif opcode == 0xA: # pong pass else: raise FailedConnectionError( 1002, "Unknown control frame received.") def _iter_frames(self): fragmented_message = None try: while True: message = self._recv_frame(message=fragmented_message) if message.opcode & 8: self._handle_control_frame( message.opcode, message.getvalue()) continue if fragmented_message and message is not fragmented_message: raise RuntimeError('Unexpected message change.') fragmented_message = message if message.finished: data = fragmented_message.getvalue() fragmented_message = None yield data except FailedConnectionError: exc_typ, exc_val, exc_tb = sys.exc_info() self.close(close_data=(exc_val.status, exc_val.message)) except ConnectionClosedError: return except Exception: self.close(close_data=(1011, 'Internal Server Error')) raise def _recv_frame(self, message=None): recv = self._get_bytes # Unpacking the frame described in Section 5.2 of RFC6455 # (https://tools.ietf.org/html/rfc6455#section-5.2) header = recv(2) a, b = struct.unpack('!BB', header) finished = a >> 7 == 1 rsv123 = a >> 4 & 7 rsv1 = rsv123 & 4 if rsv123: if rsv1 and "permessage-deflate" not in self.extensions: # must be zero - unless it's compressed then rsv1 is true raise FailedConnectionError( 1002, "RSV1, RSV2, RSV3: MUST be 0 unless an extension is" " negotiated that defines meanings for non-zero values.") opcode = a & 15 if opcode not in (0, 1, 2, 8, 9, 0xA): raise FailedConnectionError(1002, "Unknown opcode received.") masked = b & 128 == 128 if not masked and not self.client: raise FailedConnectionError(1002, "A client MUST mask all frames" " that it sends to the server") length = b & 127 if opcode & 8: if not finished: raise FailedConnectionError(1002, "Control frames must not" " be fragmented.") if length > 125: raise FailedConnectionError( 1002, "All control frames MUST have a payload length of 125" " bytes or less") elif opcode and message: raise FailedConnectionError( 1002, "Received a non-continuation opcode within" " fragmented message.") elif not opcode and not message: raise FailedConnectionError( 1002, "Received continuation opcode with no previous" " fragments received.") if length == 126: length = struct.unpack('!H', recv(2))[0] elif length == 127: length = struct.unpack('!Q', recv(8))[0] if masked: mask = struct.unpack('!BBBB', recv(4)) received = 0 if not message or opcode & 8: decoder = self.UTF8Decoder() if opcode == 1 else None decompressor = self._get_permessage_deflate_dec(rsv1) message = self.Message(opcode, decoder=decoder, decompressor=decompressor) if not length: message.push(b'', final=finished) else: while received < length: d = self.socket.recv(length - received) if not d: raise ConnectionClosedError() dlen = len(d) if masked: d = self._apply_mask(d, mask, length=dlen, offset=received) received = received + dlen try: message.push(d, final=finished) except (UnicodeDecodeError, ValueError): raise FailedConnectionError( 1007, "Text data must be valid utf-8") return message def _pack_message(self, message, masked=False, continuation=False, final=True, control_code=None): is_text = False if isinstance(message, six.text_type): message = message.encode('utf-8') is_text = True compress_bit = 0 compressor = self._get_permessage_deflate_enc() if message and compressor: message = compressor.compress(message) message += compressor.flush(zlib.Z_SYNC_FLUSH) assert message[-4:] == b"\x00\x00\xff\xff" message = message[:-4] compress_bit = 1 << 6 length = len(message) if not length: # no point masking empty data masked = False if control_code: if control_code not in (8, 9, 0xA): raise ProtocolError('Unknown control opcode.') if continuation or not final: raise ProtocolError('Control frame cannot be a fragment.') if length > 125: raise ProtocolError('Control frame data too large (>125).') header = struct.pack('!B', control_code | 1 << 7) else: opcode = 0 if continuation else ((1 if is_text else 2) | compress_bit) header = struct.pack('!B', opcode | (1 << 7 if final else 0)) lengthdata = 1 << 7 if masked else 0 if length > 65535: lengthdata = struct.pack('!BQ', lengthdata | 127, length) elif length > 125: lengthdata = struct.pack('!BH', lengthdata | 126, length) else: lengthdata = struct.pack('!B', lengthdata | length) if masked: # NOTE: RFC6455 states: # A server MUST NOT mask any frames that it sends to the client rand = Random(time.time()) mask = [rand.getrandbits(8) for _ in six.moves.xrange(4)] message = RFC6455WebSocket._apply_mask(message, mask, length) maskdata = struct.pack('!BBBB', *mask) else: maskdata = b'' return b''.join((header, lengthdata, maskdata, message)) def wait(self): for i in self.iterator: return i def _send(self, frame): self._sendlock.acquire() try: self.socket.sendall(frame) finally: self._sendlock.release() def send(self, message, **kw): kw['masked'] = self.client payload = self._pack_message(message, **kw) self._send(payload) def _send_closing_frame(self, ignore_send_errors=False, close_data=None): if self.version in (8, 13) and not self.websocket_closed: if close_data is not None: status, msg = close_data if isinstance(msg, six.text_type): msg = msg.encode('utf-8') data = struct.pack('!H', status) + msg else: data = '' try: self.send(data, control_code=8) except SocketError: # Sometimes, like when the remote side cuts off the connection, # we don't care about this. if not ignore_send_errors: # pragma NO COVER raise self.websocket_closed = True def close(self, close_data=None): """Forcibly close the websocket; generally it is preferable to return from the handler method.""" try: self._send_closing_frame(close_data=close_data, ignore_send_errors=True) self.socket.shutdown(socket.SHUT_WR) except SocketError as e: if e.errno != errno.ENOTCONN: self.log.write('{ctx} socket shutdown error: {e}'.format(ctx=self.log_context, e=e)) finally: self.socket.close()
apache-2.0
lucifurtun/myquotes
apps/search/bible/management/commands/zefania_xml_generator.py
1
2231
import json from itertools import groupby import xmltodict from django.core.management.base import BaseCommand class Command(BaseCommand): help = 'Generates zefania xml from different formats' def handle(self, *args, **options): with open('NTR.json') as f: data = json.load(f) current_b_number = 0 for item in data: if item['chapter'] == 1 and item['verse'] == 1: current_b_number += 1 item['b_number'] = current_b_number grouped_books = groupby(data, lambda item: item['b_number']) books_list = [] for book_grouper, chapters in grouped_books: chapters_list = [] grouped_chapters = groupby(chapters, lambda item: item['chapter']) for chapter_grouper, verses in grouped_chapters: chapters_list.append({ 'number': chapter_grouper, 'items': list(verses) }) books_list.append({ 'title': chapters_list[0]['items'][0]['long_name'], 'number': int(book_grouper), 'items': chapters_list }) with open('NTR.xml', 'w+') as f: d = { 'XMLBIBLE': { 'BIBLEBOOK': [ { '@bnumber': book['number'], '@bname': book['title'], 'CHAPTER': [ { '@cnumber': chapter['number'], 'VERS': [ { '@vnumber': verse['verse'], '#text': verse['text'] } for verse in chapter['items'] ] } for chapter in book['items'] ] } for book in books_list ] } } f.write(xmltodict.unparse(d, pretty=True)) self.stdout.write(self.style.SUCCESS('Imported!'))
bsd-3-clause
miguelinux/vbox
src/VBox/Additions/common/crOpenGL/cr_gl.py
5
1632
print """ /** @file * VBox OpenGL chromium functions header */ /* * Copyright (C) 2008-2015 Oracle Corporation * * This file is part of VirtualBox Open Source Edition (OSE), as * available from http://www.virtualbox.org. This file is free software; * you can redistribute it and/or modify it under the terms of the GNU * General Public License (GPL) as published by the Free Software * Foundation, in version 2 as it comes in the "COPYING" file of the * VirtualBox OSE distribution. VirtualBox OSE is distributed in the * hope that it will be useful, but WITHOUT ANY WARRANTY of any kind. */ """ # Copyright (c) 2001, Stanford University # All rights reserved. # # See the file LICENSE.txt for information on redistributing this software. import sys import apiutil apiutil.CopyrightC() print """ /* DO NOT EDIT - THIS FILE GENERATED BY THE cr_gl.py SCRIPT */ #ifndef __CR_GL_H__ #define __CR_GL_H__ #include "chromium.h" #include "cr_string.h" #include "cr_version.h" #include "stub.h" #ifdef WINDOWS #pragma warning( disable: 4055 ) #endif """ # Extern-like declarations keys = apiutil.GetAllFunctions(sys.argv[1]+"/APIspec.txt") for func_name in keys: if "Chromium" == apiutil.Category(func_name): continue if "VBox" == apiutil.Category(func_name): continue if func_name == "BoundsInfoCR": continue if "GL_chromium" == apiutil.Category(func_name): pass #continue return_type = apiutil.ReturnType(func_name) params = apiutil.Parameters(func_name) print "extern %s cr_gl%s( %s );" % (return_type, func_name, apiutil.MakeDeclarationString( params )) print "#endif /* __CR_GL_H__ */"
gpl-2.0
IRI-Research/django
django/contrib/gis/maps/google/zoom.py
12
6683
from __future__ import unicode_literals from django.contrib.gis.geos import GEOSGeometry, LinearRing, Polygon, Point from django.contrib.gis.maps.google.gmap import GoogleMapException from django.utils.six.moves import xrange from math import pi, sin, log, exp, atan # Constants used for degree to radian conversion, and vice-versa. DTOR = pi / 180. RTOD = 180. / pi class GoogleZoom(object): """ GoogleZoom is a utility for performing operations related to the zoom levels on Google Maps. This class is inspired by the OpenStreetMap Mapnik tile generation routine `generate_tiles.py`, and the article "How Big Is the World" (Hack #16) in "Google Maps Hacks" by Rich Gibson and Schuyler Erle. `generate_tiles.py` may be found at: http://trac.openstreetmap.org/browser/applications/rendering/mapnik/generate_tiles.py "Google Maps Hacks" may be found at http://safari.oreilly.com/0596101619 """ def __init__(self, num_zoom=19, tilesize=256): "Initializes the Google Zoom object." # Google's tilesize is 256x256, square tiles are assumed. self._tilesize = tilesize # The number of zoom levels self._nzoom = num_zoom # Initializing arrays to hold the parameters for each one of the # zoom levels. self._degpp = [] # Degrees per pixel self._radpp = [] # Radians per pixel self._npix = [] # 1/2 the number of pixels for a tile at the given zoom level # Incrementing through the zoom levels and populating the parameter arrays. z = tilesize # The number of pixels per zoom level. for i in xrange(num_zoom): # Getting the degrees and radians per pixel, and the 1/2 the number of # for every zoom level. self._degpp.append(z / 360.) # degrees per pixel self._radpp.append(z / (2 * pi)) # radians per pixel self._npix.append(z / 2) # number of pixels to center of tile # Multiplying `z` by 2 for the next iteration. z *= 2 def __len__(self): "Returns the number of zoom levels." return self._nzoom def get_lon_lat(self, lonlat): "Unpacks longitude, latitude from GEOS Points and 2-tuples." if isinstance(lonlat, Point): lon, lat = lonlat.coords else: lon, lat = lonlat return lon, lat def lonlat_to_pixel(self, lonlat, zoom): "Converts a longitude, latitude coordinate pair for the given zoom level." # Setting up, unpacking the longitude, latitude values and getting the # number of pixels for the given zoom level. lon, lat = self.get_lon_lat(lonlat) npix = self._npix[zoom] # Calculating the pixel x coordinate by multiplying the longitude value # with with the number of degrees/pixel at the given zoom level. px_x = round(npix + (lon * self._degpp[zoom])) # Creating the factor, and ensuring that 1 or -1 is not passed in as the # base to the logarithm. Here's why: # if fac = -1, we'll get log(0) which is undefined; # if fac = 1, our logarithm base will be divided by 0, also undefined. fac = min(max(sin(DTOR * lat), -0.9999), 0.9999) # Calculating the pixel y coordinate. px_y = round(npix + (0.5 * log((1 + fac) / (1 - fac)) * (-1.0 * self._radpp[zoom]))) # Returning the pixel x, y to the caller of the function. return (px_x, px_y) def pixel_to_lonlat(self, px, zoom): "Converts a pixel to a longitude, latitude pair at the given zoom level." if len(px) != 2: raise TypeError('Pixel should be a sequence of two elements.') # Getting the number of pixels for the given zoom level. npix = self._npix[zoom] # Calculating the longitude value, using the degrees per pixel. lon = (px[0] - npix) / self._degpp[zoom] # Calculating the latitude value. lat = RTOD * (2 * atan(exp((px[1] - npix) / (-1.0 * self._radpp[zoom]))) - 0.5 * pi) # Returning the longitude, latitude coordinate pair. return (lon, lat) def tile(self, lonlat, zoom): """ Returns a Polygon corresponding to the region represented by a fictional Google Tile for the given longitude/latitude pair and zoom level. This tile is used to determine the size of a tile at the given point. """ # The given lonlat is the center of the tile. delta = self._tilesize / 2 # Getting the pixel coordinates corresponding to the # the longitude/latitude. px = self.lonlat_to_pixel(lonlat, zoom) # Getting the lower-left and upper-right lat/lon coordinates # for the bounding box of the tile. ll = self.pixel_to_lonlat((px[0] - delta, px[1] - delta), zoom) ur = self.pixel_to_lonlat((px[0] + delta, px[1] + delta), zoom) # Constructing the Polygon, representing the tile and returning. return Polygon(LinearRing(ll, (ll[0], ur[1]), ur, (ur[0], ll[1]), ll), srid=4326) def get_zoom(self, geom): "Returns the optimal Zoom level for the given geometry." # Checking the input type. if not isinstance(geom, GEOSGeometry) or geom.srid != 4326: raise TypeError('get_zoom() expects a GEOS Geometry with an SRID of 4326.') # Getting the envelope for the geometry, and its associated width, height # and centroid. env = geom.envelope env_w, env_h = self.get_width_height(env.extent) center = env.centroid for z in xrange(self._nzoom): # Getting the tile at the zoom level. tile_w, tile_h = self.get_width_height(self.tile(center, z).extent) # When we span more than one tile, this is an approximately good # zoom level. if (env_w > tile_w) or (env_h > tile_h): if z == 0: raise GoogleMapException('Geometry width and height should not exceed that of the Earth.') return z - 1 # Otherwise, we've zoomed in to the max. return self._nzoom - 1 def get_width_height(self, extent): """ Returns the width and height for the given extent. """ # Getting the lower-left, upper-left, and upper-right # coordinates from the extent. ll = Point(extent[:2]) ul = Point(extent[0], extent[3]) ur = Point(extent[2:]) # Calculating the width and height. height = ll.distance(ul) width = ul.distance(ur) return width, height
bsd-3-clause
winndows/cinder
cinder/zonemanager/drivers/brocade/brcd_fabric_opts.py
13
2224
# (c) Copyright 2014 Brocade Communications Systems Inc. # All Rights Reserved. # # Copyright 2014 OpenStack Foundation # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. # from oslo_config import cfg from oslo_log import log as logging from cinder.volume import configuration brcd_zone_opts = [ cfg.StrOpt('fc_fabric_address', default='', help='Management IP of fabric'), cfg.StrOpt('fc_fabric_user', default='', help='Fabric user ID'), cfg.StrOpt('fc_fabric_password', default='', help='Password for user', secret=True), cfg.IntOpt('fc_fabric_port', default=22, min=1, max=65535, help='Connecting port'), cfg.StrOpt('zoning_policy', default='initiator-target', help='overridden zoning policy'), cfg.BoolOpt('zone_activate', default=True, help='overridden zoning activation state'), cfg.StrOpt('zone_name_prefix', default=None, help='overridden zone name prefix'), cfg.StrOpt('principal_switch_wwn', default=None, help='Principal switch WWN of the fabric'), ] CONF = cfg.CONF CONF.register_opts(brcd_zone_opts, 'BRCD_FABRIC_EXAMPLE') LOG = logging.getLogger(__name__) def load_fabric_configurations(fabric_names): fabric_configs = {} for fabric_name in fabric_names: config = configuration.Configuration(brcd_zone_opts, fabric_name) LOG.debug("Loaded FC fabric config %s", fabric_name) fabric_configs[fabric_name] = config return fabric_configs
apache-2.0
yuanzhao/gpdb
gpMgmt/sbin/gppersistent_backup.py
7
5737
#!/usr/bin/env python # # Copyright (c) 2014-Present Pivotal Software, Inc. # """ Internal Use Function. """ from gppylib.mainUtils import simple_main, addStandardLoggingAndHelpOptions, addMasterDirectoryOptionForSingleClusterProgram import base64 import os import pickle from gppylib import gplog from gppylib.operations.persistent_rebuild import BackupPersistentTableFiles, ValidatePersistentBackup, DEFAULT_BATCH_SIZE from gppylib.gpparseopts import OptParser, OptChecker, OptionGroup logger = gplog.get_default_logger() class PersistentBackupRestore: def __init__(self, options, args): self.backup = options.backup self.restore = options.restore self.validate_backups = options.validate_backups self.validate_backup_dir = options.validate_backup_dir self.timestamp = options.timestamp self.batch_size = options.batch_size self.backup_dir = options.backup_dir self.perdbpt = options.perdbpt self.globalpt = options.globalpt self.validate_source_file_only = options.validate_source_file_only def run(self): if not self.perdbpt or not self.globalpt: raise Exception('Please specify perdbpt filenames and globalpt filenames') if not self.batch_size: self.batch_size = DEFAULT_BATCH_SIZE if not self.timestamp: raise Exception('Please specify --timestamp option') if (self.backup and self.restore) or (self.validate_backups and self.backup) or (self.restore and self.validate_backups): raise Exception('Please specify either --backup or --restore or --validate') if self.backup: dbid_info = pickle.loads(base64.urlsafe_b64decode(self.backup)) perdb_pt_filenames = pickle.loads(base64.urlsafe_b64decode(self.perdbpt)) global_pt_filenames = pickle.loads(base64.urlsafe_b64decode(self.globalpt)) BackupPersistentTableFiles(dbid_info, self.timestamp, perdb_pt_filenames, global_pt_filenames, self.batch_size, self.backup_dir, self.validate_source_file_only).backup() elif self.restore: dbid_info = pickle.loads(base64.urlsafe_b64decode(self.restore)) perdb_pt_filenames = pickle.loads(base64.urlsafe_b64decode(self.perdbpt)) global_pt_filenames = pickle.loads(base64.urlsafe_b64decode(self.globalpt)) BackupPersistentTableFiles(dbid_info, self.timestamp, perdb_pt_filenames, global_pt_filenames, self.batch_size, self.backup_dir, self.validate_source_file_only).restore() elif self.validate_backups: dbid_info = pickle.loads(base64.urlsafe_b64decode(self.validate_backups)) ValidatePersistentBackup(dbid_info, self.timestamp, self.batch_size, self.backup_dir).validate_backups() elif self.validate_backup_dir: dbid_info = pickle.loads(base64.urlsafe_b64decode(self.validate_backup_dir)) ValidatePersistentBackup(dbid_info, self.timestamp, self.batch_size, self.backup_dir).validate_backup_dir() return 0 def cleanup(self): pass def create_parser(): parser = OptParser(option_class=OptChecker, version='%prog version $Revision: #1 $', description='Persistent tables backp and restore') addStandardLoggingAndHelpOptions(parser, includeNonInteractiveOption=True) addTo = OptionGroup(parser, 'Connection opts') parser.add_option_group(addTo) addMasterDirectoryOptionForSingleClusterProgram(addTo) addTo = OptionGroup(parser, 'Persistent tables backup and restore options') addTo.add_option('--backup', metavar="<pickled dbid info>", type="string", help="A list of dbid info where backups need to be done in pickled format") addTo.add_option('--restore', metavar="<pickled dbid info>", type="string", help="A list of dbid info where restore needs to be done in pickled format") addTo.add_option('--validate-backups', metavar="<pickled dbid info>", type="string", help="A list of dbid info where validation needs to be done in pickled format") addTo.add_option('--validate-backup-dir', metavar="<pickled dbid info>", type="string", help="A list of dbid info where validation needs to be done in pickled format") addTo.add_option('--timestamp', metavar="<timestamp of backup>", type="string", help="A timestamp for the backup that needs to be validated") addTo.add_option('--batch-size', metavar="<batch size for the worker pool>", type="int", help="Batch size for parallelism in worker pool") addTo.add_option('--backup-dir', metavar="<backup directory>", type="string", help="Backup directory for persistent tables and transaction logs") addTo.add_option('--perdbpt', metavar="<per database pt filename>", type="string", help="Filenames for per database persistent files") addTo.add_option('--globalpt', metavar="<global pt filenames>", type="string", help="Filenames for global persistent files") addTo.add_option('--validate-source-file-only', action='store_true', default=False, help="validate that required source files existed for backup and restore") parser.setHelp([ """ This tool is used to backup persistent table files. """ ]) return parser #------------------------------------------------------------------------- if __name__ == '__main__': mainOptions = { 'setNonuserOnToolLogger':True, 'suppressStartupLogMessage': True} simple_main(create_parser, PersistentBackupRestore, mainOptions )
apache-2.0
adhix11/pmtk3
python/demos/linregDemo1.py
26
1104
#!/usr/bin/python2.4 import numpy import scipy.stats import matplotlib.pyplot as plt def main(): # true parameters w = 2 w0 = 3 sigma = 2 # make data numpy.random.seed(1) Ntrain = 20 xtrain = numpy.linspace(0,10,Ntrain) ytrain = w*xtrain + w0 + numpy.random.random(Ntrain)*sigma Ntest = 100 xtest = numpy.linspace(0,10,Ntest) ytest = w*xtest + w0 + numpy.random.random(Ntest)*sigma # from http://www2.warwick.ac.uk/fac/sci/moac/students/peter_cock/python/lin_reg/ # fit west, w0est, r_value, p_value, std_err = scipy.stats.linregress(xtrain, ytrain) # display print "Param \t True \t Est" print "w0 \t %5.3f \t %5.3f" % (w0, w0est) print "w \t %5.3f \t %5.3f" % (w, west) # plot plt.close() plt.plot(xtrain, ytrain, 'ro') plt.hold(True) #plt.plot(xtest, ytest, 'ka-') ytestPred = west*xtest + w0est #ndx = range(0, Ntest, 10) #h = plt.plot(xtest[ndx], ytestPred[ndx], 'b*') h = plt.plot(xtest, ytestPred, 'b-') plt.setp(h, 'markersize', 12) if __name__ == '__main__': main()
mit
yank555-lu/N3-CM11
tools/perf/scripts/python/futex-contention.py
11261
1486
# futex contention # (c) 2010, Arnaldo Carvalho de Melo <acme@redhat.com> # Licensed under the terms of the GNU GPL License version 2 # # Translation of: # # http://sourceware.org/systemtap/wiki/WSFutexContention # # to perf python scripting. # # Measures futex contention import os, sys sys.path.append(os.environ['PERF_EXEC_PATH'] + '/scripts/python/Perf-Trace-Util/lib/Perf/Trace') from Util import * process_names = {} thread_thislock = {} thread_blocktime = {} lock_waits = {} # long-lived stats on (tid,lock) blockage elapsed time process_names = {} # long-lived pid-to-execname mapping def syscalls__sys_enter_futex(event, ctxt, cpu, s, ns, tid, comm, nr, uaddr, op, val, utime, uaddr2, val3): cmd = op & FUTEX_CMD_MASK if cmd != FUTEX_WAIT: return # we don't care about originators of WAKE events process_names[tid] = comm thread_thislock[tid] = uaddr thread_blocktime[tid] = nsecs(s, ns) def syscalls__sys_exit_futex(event, ctxt, cpu, s, ns, tid, comm, nr, ret): if thread_blocktime.has_key(tid): elapsed = nsecs(s, ns) - thread_blocktime[tid] add_stats(lock_waits, (tid, thread_thislock[tid]), elapsed) del thread_blocktime[tid] del thread_thislock[tid] def trace_begin(): print "Press control+C to stop and show the summary" def trace_end(): for (tid, lock) in lock_waits: min, max, avg, count = lock_waits[tid, lock] print "%s[%d] lock %x contended %d times, %d avg ns" % \ (process_names[tid], tid, lock, count, avg)
gpl-2.0
rushiagr/keystone
keystone/contrib/federation/routers.py
2
9192
# Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import functools from keystone.common import json_home from keystone.common import wsgi from keystone.contrib.federation import controllers build_resource_relation = functools.partial( json_home.build_v3_extension_resource_relation, extension_name='OS-FEDERATION', extension_version='1.0') build_parameter_relation = functools.partial( json_home.build_v3_extension_parameter_relation, extension_name='OS-FEDERATION', extension_version='1.0') IDP_ID_PARAMETER_RELATION = build_parameter_relation(parameter_name='idp_id') PROTOCOL_ID_PARAMETER_RELATION = build_parameter_relation( parameter_name='protocol_id') SP_ID_PARAMETER_RELATION = build_parameter_relation(parameter_name='sp_id') class FederationExtension(wsgi.V3ExtensionRouter): """API Endpoints for the Federation extension. The API looks like:: PUT /OS-FEDERATION/identity_providers/$identity_provider GET /OS-FEDERATION/identity_providers GET /OS-FEDERATION/identity_providers/$identity_provider DELETE /OS-FEDERATION/identity_providers/$identity_provider PATCH /OS-FEDERATION/identity_providers/$identity_provider PUT /OS-FEDERATION/identity_providers/ $identity_provider/protocols/$protocol GET /OS-FEDERATION/identity_providers/ $identity_provider/protocols GET /OS-FEDERATION/identity_providers/ $identity_provider/protocols/$protocol PATCH /OS-FEDERATION/identity_providers/ $identity_provider/protocols/$protocol DELETE /OS-FEDERATION/identity_providers/ $identity_provider/protocols/$protocol PUT /OS-FEDERATION/mappings GET /OS-FEDERATION/mappings PATCH /OS-FEDERATION/mappings/$mapping_id GET /OS-FEDERATION/mappings/$mapping_id DELETE /OS-FEDERATION/mappings/$mapping_id GET /OS-FEDERATION/projects GET /OS-FEDERATION/domains PUT /OS-FEDERATION/service_providers/$service_provider GET /OS-FEDERATION/service_providers GET /OS-FEDERATION/service_providers/$service_provider DELETE /OS-FEDERATION/service_providers/$service_provider PATCH /OS-FEDERATION/service_providers/$service_provider GET /OS-FEDERATION/identity_providers/$identity_provider/ protocols/$protocol/auth POST /OS-FEDERATION/identity_providers/$identity_provider/ protocols/$protocol/auth POST /auth/OS-FEDERATION/saml2 GET /OS-FEDERATION/saml2/metadata GET /auth/OS-FEDERATION/websso/{protocol_id} ?origin=https%3A//horizon.example.com POST /auth/OS-FEDERATION/websso/{protocol_id} ?origin=https%3A//horizon.example.com """ def _construct_url(self, suffix): return "/OS-FEDERATION/%s" % suffix def add_routes(self, mapper): auth_controller = controllers.Auth() idp_controller = controllers.IdentityProvider() protocol_controller = controllers.FederationProtocol() mapping_controller = controllers.MappingController() project_controller = controllers.ProjectAssignmentV3() domain_controller = controllers.DomainV3() saml_metadata_controller = controllers.SAMLMetadataV3() sp_controller = controllers.ServiceProvider() # Identity Provider CRUD operations self._add_resource( mapper, idp_controller, path=self._construct_url('identity_providers/{idp_id}'), get_action='get_identity_provider', put_action='create_identity_provider', patch_action='update_identity_provider', delete_action='delete_identity_provider', rel=build_resource_relation(resource_name='identity_provider'), path_vars={ 'idp_id': IDP_ID_PARAMETER_RELATION, }) self._add_resource( mapper, idp_controller, path=self._construct_url('identity_providers'), get_action='list_identity_providers', rel=build_resource_relation(resource_name='identity_providers')) # Protocol CRUD operations self._add_resource( mapper, protocol_controller, path=self._construct_url('identity_providers/{idp_id}/protocols/' '{protocol_id}'), get_action='get_protocol', put_action='create_protocol', patch_action='update_protocol', delete_action='delete_protocol', rel=build_resource_relation( resource_name='identity_provider_protocol'), path_vars={ 'idp_id': IDP_ID_PARAMETER_RELATION, 'protocol_id': PROTOCOL_ID_PARAMETER_RELATION, }) self._add_resource( mapper, protocol_controller, path=self._construct_url('identity_providers/{idp_id}/protocols'), get_action='list_protocols', rel=build_resource_relation( resource_name='identity_provider_protocols'), path_vars={ 'idp_id': IDP_ID_PARAMETER_RELATION, }) # Mapping CRUD operations self._add_resource( mapper, mapping_controller, path=self._construct_url('mappings/{mapping_id}'), get_action='get_mapping', put_action='create_mapping', patch_action='update_mapping', delete_action='delete_mapping', rel=build_resource_relation(resource_name='mapping'), path_vars={ 'mapping_id': build_parameter_relation( parameter_name='mapping_id'), }) self._add_resource( mapper, mapping_controller, path=self._construct_url('mappings'), get_action='list_mappings', rel=build_resource_relation(resource_name='mappings')) # Service Providers CRUD operations self._add_resource( mapper, sp_controller, path=self._construct_url('service_providers/{sp_id}'), get_action='get_service_provider', put_action='create_service_provider', patch_action='update_service_provider', delete_action='delete_service_provider', rel=build_resource_relation(resource_name='service_provider'), path_vars={ 'sp_id': SP_ID_PARAMETER_RELATION, }) self._add_resource( mapper, sp_controller, path=self._construct_url('service_providers'), get_action='list_service_providers', rel=build_resource_relation(resource_name='service_providers')) self._add_resource( mapper, domain_controller, path=self._construct_url('domains'), get_action='list_domains_for_groups', rel=build_resource_relation(resource_name='domains')) self._add_resource( mapper, project_controller, path=self._construct_url('projects'), get_action='list_projects_for_groups', rel=build_resource_relation(resource_name='projects')) self._add_resource( mapper, auth_controller, path=self._construct_url('identity_providers/{identity_provider}/' 'protocols/{protocol}/auth'), get_post_action='federated_authentication', rel=build_resource_relation( resource_name='identity_provider_protocol_auth'), path_vars={ 'identity_provider': IDP_ID_PARAMETER_RELATION, 'protocol': PROTOCOL_ID_PARAMETER_RELATION, }) # Auth operations self._add_resource( mapper, auth_controller, path='/auth' + self._construct_url('saml2'), post_action='create_saml_assertion', rel=build_resource_relation(resource_name='saml2')) self._add_resource( mapper, auth_controller, path='/auth' + self._construct_url('websso/{protocol_id}'), get_post_action='federated_sso_auth', rel=build_resource_relation(resource_name='websso'), path_vars={ 'protocol_id': PROTOCOL_ID_PARAMETER_RELATION, }) # Keystone-Identity-Provider metadata endpoint self._add_resource( mapper, saml_metadata_controller, path=self._construct_url('saml2/metadata'), get_action='get_metadata', rel=build_resource_relation(resource_name='metadata'))
apache-2.0
lthurlow/Network-Grapher
proj/external/numpy-1.7.0/numpy/core/tests/test_arrayprint.py
8
6757
#!/usr/bin/python # -*- coding: utf-8 -*- import sys import numpy as np from numpy.testing import * class TestArrayRepr(object): def test_nan_inf(self): x = np.array([np.nan, np.inf]) assert_equal(repr(x), 'array([ nan, inf])') class TestComplexArray(TestCase): def test_str(self): rvals = [0, 1, -1, np.inf, -np.inf, np.nan] cvals = [complex(rp, ip) for rp in rvals for ip in rvals] dtypes = [np.complex64, np.cdouble, np.clongdouble] actual = [str(np.array([c], dt)) for c in cvals for dt in dtypes] wanted = [ '[ 0.+0.j]', '[ 0.+0.j]', '[ 0.0+0.0j]', '[ 0.+1.j]', '[ 0.+1.j]', '[ 0.0+1.0j]', '[ 0.-1.j]', '[ 0.-1.j]', '[ 0.0-1.0j]', '[ 0.+infj]', '[ 0.+infj]', '[ 0.0+infj]', '[ 0.-infj]', '[ 0.-infj]', '[ 0.0-infj]', '[ 0.+nanj]', '[ 0.+nanj]', '[ 0.0+nanj]', '[ 1.+0.j]', '[ 1.+0.j]', '[ 1.0+0.0j]', '[ 1.+1.j]', '[ 1.+1.j]', '[ 1.0+1.0j]', '[ 1.-1.j]', '[ 1.-1.j]', '[ 1.0-1.0j]', '[ 1.+infj]', '[ 1.+infj]', '[ 1.0+infj]', '[ 1.-infj]', '[ 1.-infj]', '[ 1.0-infj]', '[ 1.+nanj]', '[ 1.+nanj]', '[ 1.0+nanj]', '[-1.+0.j]', '[-1.+0.j]', '[-1.0+0.0j]', '[-1.+1.j]', '[-1.+1.j]', '[-1.0+1.0j]', '[-1.-1.j]', '[-1.-1.j]', '[-1.0-1.0j]', '[-1.+infj]', '[-1.+infj]', '[-1.0+infj]', '[-1.-infj]', '[-1.-infj]', '[-1.0-infj]', '[-1.+nanj]', '[-1.+nanj]', '[-1.0+nanj]', '[ inf+0.j]', '[ inf+0.j]', '[ inf+0.0j]', '[ inf+1.j]', '[ inf+1.j]', '[ inf+1.0j]', '[ inf-1.j]', '[ inf-1.j]', '[ inf-1.0j]', '[ inf+infj]', '[ inf+infj]', '[ inf+infj]', '[ inf-infj]', '[ inf-infj]', '[ inf-infj]', '[ inf+nanj]', '[ inf+nanj]', '[ inf+nanj]', '[-inf+0.j]', '[-inf+0.j]', '[-inf+0.0j]', '[-inf+1.j]', '[-inf+1.j]', '[-inf+1.0j]', '[-inf-1.j]', '[-inf-1.j]', '[-inf-1.0j]', '[-inf+infj]', '[-inf+infj]', '[-inf+infj]', '[-inf-infj]', '[-inf-infj]', '[-inf-infj]', '[-inf+nanj]', '[-inf+nanj]', '[-inf+nanj]', '[ nan+0.j]', '[ nan+0.j]', '[ nan+0.0j]', '[ nan+1.j]', '[ nan+1.j]', '[ nan+1.0j]', '[ nan-1.j]', '[ nan-1.j]', '[ nan-1.0j]', '[ nan+infj]', '[ nan+infj]', '[ nan+infj]', '[ nan-infj]', '[ nan-infj]', '[ nan-infj]', '[ nan+nanj]', '[ nan+nanj]', '[ nan+nanj]'] for res, val in zip(actual, wanted): assert_(res == val) class TestArray2String(TestCase): def test_basic(self): """Basic test of array2string.""" a = np.arange(3) assert_(np.array2string(a) == '[0 1 2]') assert_(np.array2string(a, max_line_width=4) == '[0 1\n 2]') def test_style_keyword(self): """This should only apply to 0-D arrays. See #1218.""" stylestr = np.array2string(np.array(1.5), style=lambda x: "Value in 0-D array: " + str(x)) assert_(stylestr == 'Value in 0-D array: 1.5') def test_format_function(self): """Test custom format function for each element in array.""" def _format_function(x): if np.abs(x) < 1: return '.' elif np.abs(x) < 2: return 'o' else: return 'O' x = np.arange(3) if sys.version_info[0] >= 3: x_hex = "[0x0 0x1 0x2]" x_oct = "[0o0 0o1 0o2]" else: x_hex = "[0x0L 0x1L 0x2L]" x_oct = "[0L 01L 02L]" assert_(np.array2string(x, formatter={'all':_format_function}) == \ "[. o O]") assert_(np.array2string(x, formatter={'int_kind':_format_function}) ==\ "[. o O]") assert_(np.array2string(x, formatter={'all':lambda x: "%.4f" % x}) == \ "[0.0000 1.0000 2.0000]") assert_equal(np.array2string(x, formatter={'int':lambda x: hex(x)}), \ x_hex) assert_equal(np.array2string(x, formatter={'int':lambda x: oct(x)}), \ x_oct) x = np.arange(3.) assert_(np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x}) == \ "[0.00 1.00 2.00]") assert_(np.array2string(x, formatter={'float':lambda x: "%.2f" % x}) == \ "[0.00 1.00 2.00]") s = np.array(['abc', 'def']) assert_(np.array2string(s, formatter={'numpystr':lambda s: s*2}) == \ '[abcabc defdef]') class TestPrintOptions: """Test getting and setting global print options.""" def setUp(self): self.oldopts = np.get_printoptions() def tearDown(self): np.set_printoptions(**self.oldopts) def test_basic(self): x = np.array([1.5, 0, 1.234567890]) assert_equal(repr(x), "array([ 1.5 , 0. , 1.23456789])") np.set_printoptions(precision=4) assert_equal(repr(x), "array([ 1.5 , 0. , 1.2346])") def test_formatter(self): x = np.arange(3) np.set_printoptions(formatter={'all':lambda x: str(x-1)}) assert_equal(repr(x), "array([-1, 0, 1])") def test_formatter_reset(self): x = np.arange(3) np.set_printoptions(formatter={'all':lambda x: str(x-1)}) assert_equal(repr(x), "array([-1, 0, 1])") np.set_printoptions(formatter={'int':None}) assert_equal(repr(x), "array([0, 1, 2])") np.set_printoptions(formatter={'all':lambda x: str(x-1)}) assert_equal(repr(x), "array([-1, 0, 1])") np.set_printoptions(formatter={'all':None}) assert_equal(repr(x), "array([0, 1, 2])") np.set_printoptions(formatter={'int':lambda x: str(x-1)}) assert_equal(repr(x), "array([-1, 0, 1])") np.set_printoptions(formatter={'int_kind':None}) assert_equal(repr(x), "array([0, 1, 2])") x = np.arange(3.) np.set_printoptions(formatter={'float':lambda x: str(x-1)}) assert_equal(repr(x), "array([-1.0, 0.0, 1.0])") np.set_printoptions(formatter={'float_kind':None}) assert_equal(repr(x), "array([ 0., 1., 2.])") def test_unicode_object_array(): import sys if sys.version_info[0] >= 3: expected = "array(['é'], dtype=object)" else: expected = "array([u'\\xe9'], dtype=object)" x = np.array([u'\xe9'], dtype=object) assert_equal(repr(x), expected) if __name__ == "__main__": run_module_suite()
mit
arank/mxnet
tests/python/unittest/test_model_parallel.py
13
1545
import numpy as np import mxnet as mx def reldiff(a, b): diff = np.sum(np.abs(a - b)) norm = np.sum(np.abs(a)) if diff == 0: return 0 reldiff = diff / norm return reldiff def test_chain(): n = 2 data1 = mx.sym.Variable('data1') data2 = mx.sym.Variable('data2') with mx.AttrScope(ctx_group='dev1'): net = data1 + data2 net = net * 3 with mx.AttrScope(ctx_group='dev2'): net = net + data1 with mx.Context(mx.cpu(0)): shape = (4, 5) arr = [mx.nd.empty(shape) for i in range(n)] arr_grad = [mx.nd.empty(shape) for i in range(n)] exec1 = net.bind(mx.cpu(), args=arr, args_grad=arr_grad, group2ctx={'dev1': mx.cpu(0), 'dev2': mx.cpu(1)}) arr[0][:] = 1.0 arr[1][:] = 2.0 arr2 = [a.copyto(mx.cpu()) for a in arr] arr_grad2 = [a.copyto(mx.cpu()) for a in arr_grad] exec2 = net.bind(mx.cpu(), args=arr2, args_grad=arr_grad2) # Show the execution plan that involves copynode print(exec1.debug_str()) exec1.forward() exec2.forward() assert reldiff(exec1.outputs[0].asnumpy(), exec2.outputs[0].asnumpy()) < 1e-6 out_grad = mx.nd.empty(shape, mx.cpu(1)) out_grad[:] = 1.0 exec1.backward([out_grad]) exec2.backward([out_grad.copyto(mx.cpu())]) for a, b in zip(arr_grad, arr_grad2): assert reldiff(a.asnumpy(), b.asnumpy()) < 1e-6 if __name__ == '__main__': test_chain()
apache-2.0
rlizana/l10n-spain
l10n_es_aeat_mod349/models/account_invoice.py
6
7275
# -*- coding: utf-8 -*- ############################################################################## # For copyright and license notices, see __openerp__.py file in root directory ############################################################################## from openerp import models, fields, api, exceptions, _ from datetime import datetime, date import calendar OPERATION_KEYS = [ ('E', 'E - Intra-Community supplies'), ('A', 'A - Intra-Community acquisition'), ('T', 'T - Triangular operations'), ('S', 'S - Intra-Community services'), ('I', 'I - Intra-Community services acquisitions'), ('M', 'M - Intra-Community supplies without taxes'), ('H', 'H - Intra-Community supplies without taxes ' 'delivered by legal representative') ] class AccountInvoice(models.Model): """Inheritance of account invoce to add some fields: - operation_key: Operation key of invoice """ _inherit = 'account.invoice' def _get_operation_key(self, fp, invoice_type): if not fp.intracommunity_operations: return False else: # TODO: Ver cómo discernir si son prestación de servicios if invoice_type in ('out_invoice', 'out_refund'): # Establecer a entrega si es de venta return 'E' else: # Establecer a adquisición si es de compra return 'A' def _get_year_from_fy_month(self, fy, month): fy_start = fields.Date.from_string(fy.date_start) fy_stop = fields.Date.from_string(fy.date_stop) if fy_start.month < month: year = fy_start.year elif fy_stop.month > month: year = fy_stop.year else: raise exceptions.Warning( _('Cannot get invoices.\nProvided month is not included on ' 'selected fiscal year')) return year @api.model def _get_invoices_by_type( self, partner, operation_key, fiscalyear=None, period_id=None, month=None, period_selection=None): """ Returns invoices ids by type (supplier/customer) for a fiscal year, period or month. """ assert period_selection, 'There is no period selected' # Set type of invoice invoice_type = ('in_invoice', 'out_invoice', 'in_refund', 'out_refund') domain = [('partner_id', 'child_of', partner.id), ('state', 'in', ['open', 'paid']), ('type', 'in', invoice_type), ('operation_key', '=', operation_key)] # Invoices by fiscalyear (Annual) if period_selection == '0A': if not fiscalyear: raise exceptions.Warning( _('Cannot get invoices.\nThere is no fiscal year ' 'selected')) domain.append(('period_id', 'in', [period.id for period in fiscalyear.period_ids if not period.special])) # Invoices by period elif period_selection in ['1T', '2T', '3T', '4T']: if not period_id: raise exceptions.Warning( _('Cannot get invoices.\nThere is no period selected')) domain.append(('period_id', 'in', period_id)) # Invoices by month else: if not month and not fiscalyear: raise exceptions.Warning( _('Cannot get invoices.\nThere is no month and/or fiscal ' 'year selected')) month = int(month) year = self._get_year_from_fy_month(fiscalyear, month) month_last_day = calendar.monthrange(year, month)[1] date_start = datetime(year=year, month=month, day=1) date_stop = datetime(year=year, month=month, day=month_last_day) domain.append( ('date_invoice', '>=', fields.Date.to_string(date_start))) domain.append( ('date_invoice', '<=', fields.Date.to_string(date_stop))) return self.search(domain) @api.multi def clean_refund_invoices( self, partner, fiscalyear=None, periods=None, month=None, period_selection=None): """Separate refunds from invoices""" invoices = self.env['account.invoice'] refunds = self.env['account.invoice'] for inv in self: if inv.type in ('in_refund', 'out_refund'): if not inv.origin_invoices_ids: invoices += inv continue for origin_line in inv.origin_invoices_ids: if (origin_line.state in ('open', 'paid') and origin_line.partner_id.commercial_partner_id == partner): if period_selection == '0A': if (origin_line.period_id.id not in [period.id for period in fiscalyear.period_ids if not period.special]): refunds += inv else: invoices += inv elif period_selection in ['1T', '2T', '3T', '4T']: if origin_line.period_id not in periods: refunds += inv else: invoices += inv else: month = int(month) year = self._get_year_from_fy_month(fiscalyear, month) if (fields.Date.from_string( origin_line.date_invoice) < date(year=year, month=month, day=1)): refunds += inv else: invoices += inv break else: invoices += inv return invoices, refunds @api.multi def on_change_fiscal_position(self, fiscal_position, invoice_type): """Suggest an operation key when fiscal position changes.""" res = {'operation_key': False} if fiscal_position and invoice_type: fp = self.env['account.fiscal.position'].browse(fiscal_position) res['operation_key'] = self._get_operation_key(fp, invoice_type) return {'value': res} @api.model def create(self, vals): """Writes operation key value, if invoice is created in backgroud with intracommunity fiscal position defined""" if vals.get('fiscal_position') and \ vals.get('type') and not vals.get('operation_key'): fp_obj = self.env['account.fiscal.position'] fp = fp_obj.browse(vals['fiscal_position']) vals['operation_key'] = self._get_operation_key(fp, vals['type']) return super(AccountInvoice, self).create(vals) operation_key = fields.Selection(selection=OPERATION_KEYS, string='Operation key')
agpl-3.0
TobbeTripitaka/bruges
bruges/attribute/test/similarity_test.py
3
2688
import unittest import numpy from bruges.attribute import similarity class SimilarityTest( unittest.TestCase ): def test_same_data( self ): """ Simple test to check if the algorithm works for the trivial case. """ data = numpy.zeros( [100, 100] ) check_data = data + 1.0 data +=10. window_size = 20 output = similarity( data, window_size ) same = numpy.allclose( check_data[:,1:], output[:,1:], .001 ) self.assertTrue( same ) def test_stepout( self ): data = numpy.zeros( [ 100,100 ] ) check_data = data + 1.0 # Make adjacent traces dissimilar, next nearest trace # similar data += 11. data[ :,::2] = -11.0 window_size = 20 step_out = 2 # Check with a step out of 2 output = similarity( data, window_size, step_out = step_out ) same = numpy.allclose( check_data[:,step_out:], output[:,step_out:], .001 ) self.assertTrue( same ) # Check with a step out of 1 step_out = 1 output = similarity( data, window_size, step_out = step_out ) # Everything should be zero check_data -= 1 same = numpy.allclose( check_data[:,step_out:], output[:,step_out:], .001 ) self.assertTrue( same ) def test_lag( self ): data = numpy.zeros( [ 100,100 ] ) check_data = data + 1.0 # Make an off by 1 similarity that can be corrected # with lag data+=11 data[::2,::2] = -11. data[1::2,1::2]=-11 lag = 2 window_size = 20 output = similarity( data, window_size, lag=lag ) same = numpy.allclose( check_data[window_size/2 :,1:], output[window_size/2 :,1:], atol=.01 ) self.assertTrue( same ) # Should be zero with no lag lag = 0 window_size = 20 output = similarity( data, window_size, lag=lag ) check_data[:,1:] -= 1. same = numpy.allclose( check_data[:,1:], output[:,1:], .001 ) self.assertTrue( same ) if __name__ == '__main__': suite = \ unittest.TestLoader().loadTestsFromTestCase(SimilarityTest) unittest.TextTestRunner(verbosity=2).run(suite)
apache-2.0
bclau/nova
nova/tests/api/openstack/compute/test_urlmap.py
7
5225
# Copyright 2011 OpenStack Foundation # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import webob from nova.openstack.common import jsonutils from nova import test from nova.tests.api.openstack import fakes import nova.tests.image.fake class UrlmapTest(test.NoDBTestCase): def setUp(self): super(UrlmapTest, self).setUp() fakes.stub_out_rate_limiting(self.stubs) nova.tests.image.fake.stub_out_image_service(self.stubs) def tearDown(self): super(UrlmapTest, self).tearDown() nova.tests.image.fake.FakeImageService_reset() def test_path_version_v1_1(self): # Test URL path specifying v1.1 returns v2 content. req = webob.Request.blank('/v1.1/') req.accept = "application/json" res = req.get_response(fakes.wsgi_app(init_only=('versions',))) self.assertEqual(res.status_int, 200) self.assertEqual(res.content_type, "application/json") body = jsonutils.loads(res.body) self.assertEqual(body['version']['id'], 'v2.0') def test_content_type_version_v1_1(self): # Test Content-Type specifying v1.1 returns v2 content. req = webob.Request.blank('/') req.content_type = "application/json;version=1.1" req.accept = "application/json" res = req.get_response(fakes.wsgi_app(init_only=('versions',))) self.assertEqual(res.status_int, 200) self.assertEqual(res.content_type, "application/json") body = jsonutils.loads(res.body) self.assertEqual(body['version']['id'], 'v2.0') def test_accept_version_v1_1(self): # Test Accept header specifying v1.1 returns v2 content. req = webob.Request.blank('/') req.accept = "application/json;version=1.1" res = req.get_response(fakes.wsgi_app(init_only=('versions',))) self.assertEqual(res.status_int, 200) self.assertEqual(res.content_type, "application/json") body = jsonutils.loads(res.body) self.assertEqual(body['version']['id'], 'v2.0') def test_path_version_v2(self): # Test URL path specifying v2 returns v2 content. req = webob.Request.blank('/v2/') req.accept = "application/json" res = req.get_response(fakes.wsgi_app(init_only=('versions',))) self.assertEqual(res.status_int, 200) self.assertEqual(res.content_type, "application/json") body = jsonutils.loads(res.body) self.assertEqual(body['version']['id'], 'v2.0') def test_content_type_version_v2(self): # Test Content-Type specifying v2 returns v2 content. req = webob.Request.blank('/') req.content_type = "application/json;version=2" req.accept = "application/json" res = req.get_response(fakes.wsgi_app(init_only=('versions',))) self.assertEqual(res.status_int, 200) self.assertEqual(res.content_type, "application/json") body = jsonutils.loads(res.body) self.assertEqual(body['version']['id'], 'v2.0') def test_accept_version_v2(self): # Test Accept header specifying v2 returns v2 content. req = webob.Request.blank('/') req.accept = "application/json;version=2" res = req.get_response(fakes.wsgi_app(init_only=('versions',))) self.assertEqual(res.status_int, 200) self.assertEqual(res.content_type, "application/json") body = jsonutils.loads(res.body) self.assertEqual(body['version']['id'], 'v2.0') def test_path_content_type(self): # Test URL path specifying JSON returns JSON content. url = '/v2/fake/images/cedef40a-ed67-4d10-800e-17455edce175.json' req = webob.Request.blank(url) req.accept = "application/xml" res = req.get_response(fakes.wsgi_app(init_only=('images',))) self.assertEqual(res.status_int, 200) self.assertEqual(res.content_type, "application/json") body = jsonutils.loads(res.body) self.assertEqual(body['image']['id'], 'cedef40a-ed67-4d10-800e-17455edce175') def test_accept_content_type(self): # Test Accept header specifying JSON returns JSON content. url = '/v2/fake/images/cedef40a-ed67-4d10-800e-17455edce175' req = webob.Request.blank(url) req.accept = "application/xml;q=0.8, application/json" res = req.get_response(fakes.wsgi_app(init_only=('images',))) self.assertEqual(res.status_int, 200) self.assertEqual(res.content_type, "application/json") body = jsonutils.loads(res.body) self.assertEqual(body['image']['id'], 'cedef40a-ed67-4d10-800e-17455edce175')
apache-2.0
40223201/40223201
wsgi.py
2
47682
#@+leo-ver=5-thin #@+node:2014fall.20141212095015.1775: * @file wsgi.py # coding=utf-8 # 上面的程式內容編碼必須在程式的第一或者第二行才會有作用 ################# (1) 模組導入區 # 導入 cherrypy 模組, 為了在 OpenShift 平台上使用 cherrypy 模組, 必須透過 setup.py 安裝 #@@language python #@@tabwidth -4 #@+<<declarations>> #@+node:2014fall.20141212095015.1776: ** <<declarations>> (wsgi) import cherrypy # 導入 Python 內建的 os 模組, 因為 os 模組為 Python 內建, 所以無需透過 setup.py 安裝 import os # 導入 random 模組 import random # 導入 gear 模組 import gear import man ################# (2) 廣域變數設定區 # 確定程式檔案所在目錄, 在 Windows 下有最後的反斜線 _curdir = os.path.join(os.getcwd(), os.path.dirname(__file__)) # 設定在雲端與近端的資料儲存目錄 if 'OPENSHIFT_REPO_DIR' in os.environ.keys(): # 表示程式在雲端執行 download_root_dir = os.environ['OPENSHIFT_DATA_DIR'] data_dir = os.environ['OPENSHIFT_DATA_DIR'] else: # 表示程式在近端執行 download_root_dir = _curdir + "/local_data/" data_dir = _curdir + "/local_data/" '''以下為近端 input() 與 for 迴圈應用的程式碼, 若要將程式送到 OpenShift 執行, 除了採用 CherryPy 網際框架外, 還要轉為 html 列印 # 利用 input() 取得的資料型別為字串 toprint = input("要印甚麼內容?") # 若要將 input() 取得的字串轉為整數使用, 必須利用 int() 轉換 repeat_no = int(input("重複列印幾次?")) for i in range(repeat_no): print(toprint) ''' #@-<<declarations>> #@+others #@+node:2014fall.20141212095015.1777: ** class Hello ################# (3) 程式類別定義區 # 以下改用 CherryPy 網際框架程式架構 # 以下為 Hello 類別的設計內容, 其中的 object 使用, 表示 Hello 類別繼承 object 的所有特性, 包括方法與屬性設計 class Hello(object): # Hello 類別的啟動設定 _cp_config = { 'tools.encode.encoding': 'utf-8', 'tools.sessions.on' : True, 'tools.sessions.storage_type' : 'file', #'tools.sessions.locking' : 'explicit', # session 以檔案儲存, 而且位於 data_dir 下的 tmp 目錄 'tools.sessions.storage_path' : data_dir+'/tmp', # session 有效時間設為 60 分鐘 'tools.sessions.timeout' : 60 } #@+others #@+node:2014fall.20141212095015.2004: *3* __init__ def __init__(self): # 配合透過案例啟始建立所需的目錄 if not os.path.isdir(data_dir+'/tmp'): os.mkdir(data_dir+'/tmp') if not os.path.isdir(data_dir+"/downloads"): os.mkdir(data_dir+"/downloads") if not os.path.isdir(data_dir+"/images"): os.mkdir(data_dir+"/images") #@+node:2014fall.20141212095015.1778: *3* index_orig # 以 @ 開頭的 cherrypy.expose 為 decorator, 用來表示隨後的成員方法, 可以直接讓使用者以 URL 連結執行 @cherrypy.expose # index 方法為 CherryPy 各類別成員方法中的內建(default)方法, 當使用者執行時未指定方法, 系統將會優先執行 index 方法 # 有 self 的方法為類別中的成員方法, Python 程式透過此一 self 在各成員方法間傳遞物件內容 def index_orig(self, toprint="Hello World!"): return toprint #@+node:2014fall.20141212095015.1779: *3* hello @cherrypy.expose def hello(self, toprint="Hello World!"): return toprint #@+node:2014fall.20141215194146.1791: *3* index @cherrypy.expose def index(self): outstring = ''' <!DOCTYPE html> <html> <head> <h1>期末考練習1<br /> <br />40223201<br /> <br />吳佩盈<br /> <a href="drawspur">期末2nd個人齒輪嚙合</a> <br /> <a href="drawspur2">期末2nd協同齒輪嚙合</a> <br /> ''' return outstring #@+node:2015.20150330144929.1713: *3* twoDgear @cherrypy.expose # N 為齒數, M 為模數, P 為壓力角 def twoDgear(self, N=20, M=5, P=15): outstring = ''' <!DOCTYPE html> <html> <head> <meta http-equiv="content-type" content="text/html;charset=utf-8"> <!-- 載入 brython.js --> <script type="text/javascript" src="/static/Brython3.1.1-20150328-091302/brython.js"></script> <script src="/static/Cango2D.js" type="text/javascript"></script> <script src="/static/gearUtils-04.js" type="text/javascript"></script> </head> <!-- 啟動 brython() --> <body onload="brython()"> <form method=POST action=do2Dgear> 齒數:<input type=text name=N><br /> 模數:<input type=text name=M><br /> 壓力角:<input type=text name=P><br /> <input type=submit value=send> </form> </body> </html> ''' return outstring #@+node:2015.20150331094055.1733: *3* threeDgear @cherrypy.expose # N 為齒數, M 為模數, P 為壓力角 def threeDgear(self, N=20, M=5, P=15): outstring = ''' <!DOCTYPE html> <html> <head> <meta http-equiv="content-type" content="text/html;charset=utf-8"> <!-- 載入 brython.js --> <script type="text/javascript" src="/static/Brython3.1.1-20150328-091302/brython.js"></script> <script src="/static/Cango2D.js" type="text/javascript"></script> <script src="/static/gearUtils-04.js" type="text/javascript"></script> </head> <!-- 啟動 brython() --> <body onload="brython()"> <form method=POST action=do3Dgear> 齒數:<input type=text name=N><br /> 模數:<input type=text name=M><br /> 壓力角:<input type=text name=P><br /> <input type=submit value=send> </form> </body> </html> ''' return outstring #@+node:2015.20150330144929.1762: *3* do2Dgear @cherrypy.expose # N 為齒數, M 為模數, P 為壓力角 def do2Dgear(self, N=20, M=5, P=15): outstring = ''' <!DOCTYPE html> <html> <head> <meta http-equiv="content-type" content="text/html;charset=utf-8"> <!-- 載入 brython.js --> <script type="text/javascript" src="/static/Brython3.1.1-20150328-091302/brython.js"></script> <script src="/static/Cango2D.js" type="text/javascript"></script> <script src="/static/gearUtils-04.js" type="text/javascript"></script> </head> <!-- 啟動 brython() --> <body onload="brython()"> <!-- 以下為 canvas 畫圖程式 --> <script type="text/python"> # 從 browser 導入 document from browser import document import math # 畫布指定在名稱為 plotarea 的 canvas 上 canvas = document["plotarea"] ctx = canvas.getContext("2d") # 用紅色畫一條直線 ctx.beginPath() ctx.lineWidth = 3 ''' outstring += ''' ctx.moveTo('''+str(N)+","+str(M)+")" outstring += ''' ctx.lineTo(0, 500) ctx.strokeStyle = "red" ctx.stroke() # 用藍色再畫一條直線 ctx.beginPath() ctx.lineWidth = 3 ctx.moveTo(0, 0) ctx.lineTo(500, 0) ctx.strokeStyle = "blue" ctx.stroke() # 用綠色再畫一條直線 ctx.beginPath() ctx.lineWidth = 3 ctx.moveTo(0, 0) ctx.lineTo(500, 500) ctx.strokeStyle = "green" ctx.stroke() # 用黑色畫一個圓 ctx.beginPath() ctx.lineWidth = 3 ctx.strokeStyle = "black" ctx.arc(250,250,50,0,2*math.pi) ctx.stroke() </script> <canvas id="plotarea" width="800" height="600"></canvas> </body> </html> ''' return outstring #@+node:2015.20150331094055.1735: *3* do3Dgear @cherrypy.expose # N 為齒數, M 為模數, P 為壓力角 def do3Dgear(self, N=20, M=5, P=15): outstring = ''' <!DOCTYPE html> <html> <head> <meta http-equiv="content-type" content="text/html;charset=utf-8"> <!-- 載入 brython.js --> <script type="text/javascript" src="/static/Brython3.1.1-20150328-091302/brython.js"></script> <script type="text/javascript" src="/static/weblink/pfcUtils.js"></script> <script type="text/javascript" src="/static/weblink/wl_header.js"></script> <script src="/static/Cango2D.js" type="text/javascript"></script> <script src="/static/gearUtils-04.js" type="text/javascript"></script> </head> <!-- 啟動 brython() --> <body onload="brython()"> <!-- 以下為 canvas 畫圖程式 --> <script type="text/python"> # 從 browser 導入 document from browser import document # 從 javascript 導入 JSConstructor from javascript import JSConstructor import math cango = JSConstructor(window.Cango2D) if (!JSConstructor(window.pfcIsWindows())): netscape.security.PrivilegeManager.enablePrivilege("UniversalXPConnect"); session = JSConstructor(window.pfcGetProESession()) # 設定 config option session.SetConfigOption("comp_placement_assumptions","no") # 建立擺放零件的位置矩陣 identityMatrix = JSConstructor(window.pfcCreate ("pfcMatrix3D")) for x in range(4): for y in range(4): if (x == y): JSConstructor(window.identityMatrix.Set (x, y, 1.0)) else: JSConstructor(window.identityMatrix.Set (x, y, 0.0)) transf = JSConstructor(window.pfcCreate ("pfcTransform3D").Create (identityMatrix)) # 取得目前的工作目錄 currentDir = session.getCurrentDirectory() # 以目前已開檔, 作為 model model = session.CurrentModel # 查驗有無 model, 或 model 類別是否為組立件 if (model == None or model.Type != JSConstructor(window.pfcCreate("pfcModelType").MDL_ASSEMBLY)): raise ValueError("Current model is not an assembly.") assembly = model '''----------------------------------------------- link0 -------------------------------------------------------------''' # 檔案目錄,建議將圖檔放置工作目錄下較方便使用 descr = rJSConstructor(window.pfcCreate ("pfcModelDescriptor").CreateFromFileName ("v:/home/fourbar/link0.prt")) #若 link1.prt 在 session 則直接取用 componentModel = session.GetModelFromDescr (descr) # 若 link1.prt 不在 session 則從工作目錄中載入 session componentModel = session.RetrieveModel(descr) # 若 link1.prt 已經在 session 則放入組立檔中 if (componentModel != None): # 注意這個 asmcomp 即為設定約束條件的本體 # asmcomp 為特徵物件,直接將零件, 以 transf 座標轉換放入組立檔案中 asmcomp = assembly.AssembleComponent (componentModel, transf) # 建立約束條件變數 constrs = JSConstructor(window.pfcCreate ("pfcComponentConstraints")) # 設定組立檔中的三個定位面, 注意內定名稱與 Pro/E WF 中的 ASM_D_FRONT 不同, 而是 ASM_FRONT asmDatums = ["ASM_FRONT", "ASM_TOP", "ASM_RIGHT"] # 設定零件檔中的三個定位面, 名稱與 Pro/E WF 中相同 compDatums = ["FRONT", "TOP", "RIGHT"] # 建立 ids 變數, intseq 為 sequence of integers 為資料類別, 使用者可以經由整數索引擷取此資料類別的元件, 第一個索引為 0 ids = JSConstructor(window.pfcCreate ("intseq")) # 建立路徑變數 path = JSConstructor(window.pfcCreate ("MpfcAssembly").CreateComponentPath (assembly, ids)) # 採用互動式設定相關的變數 MpfcSelect = JSConstructor(window.pfcCreate ("MpfcSelect")) # 利用迴圈分別約束組立與零件檔中的三個定位平面 for i in range(3): # 設定組立參考面 asmItem = assembly.GetItemByName (JSConstructor(window.pfcCreate ("pfcModelItemType").ITEM_SURFACE, asmDatums [i])) # 若無對應的組立參考面, 則啟用互動式平面選擇表單 flag if (asmItem == None): interactFlag = true continue # 設定零件參考面 compItem = componentModel.GetItemByName (JSConstructor(window.pfcCreate ("pfcModelItemType").ITEM_SURFACE, compDatums [i]) # 若無對應的零件參考面, 則啟用互動式平面選擇表單 flag if (compItem == None): interactFlag = true continue; asmSel = JSConstructor(window.MpfcSelect.CreateModelItemSelection (asmItem, path)) compSel = JSConstructor(window.MpfcSelect.CreateModelItemSelection (compItem, None)) constr = JSConstructor(window.pfcCreate ("pfcComponentConstraint").Create (JSConstructor(window.pfcCreate ("pfcComponentConstraintType").ASM_CONSTRAINT_ALIGN)) constr.AssemblyReference = asmSel constr.ComponentReference = compSel constr.Attributes = JSConstructor(window.pfcCreate ("pfcConstraintAttributes")).Create (false, false) # 將互動選擇相關資料, 附加在程式約束變數之後 constrs.Append (constr) # 設定組立約束條件 asmcomp.SetConstraints (constrs, None) '''-------------------------------------------------------------------------------------------------------------------''' '''----------------------------------------------- link1 -------------------------------------------------------------''' descr = JSConstructor(window.pfcCreate ("pfcModelDescriptor")).CreateFromFileName ("v:/home/fourbar/link1.prt") componentModel = session.GetModelFromDescr (descr) componentModel = session.RetrieveModel(descr) if (componentModel != None): asmcomp = JSConstructor(window.assembly.AssembleComponent (componentModel, transf) components = assembly.ListFeaturesByType(true, JSConstructor(window.pfcCreate ("pfcFeatureType")).FEATTYPE_COMPONENT); featID = components.Item(0).Id ids.append(featID) subPath = JSConstructor(window.pfcCreate ("MpfcAssembly")).CreateComponentPath( assembly, ids ) subassembly = subPath.Leaf asmDatums = ["A_1", "TOP", "ASM_TOP"] compDatums = ["A_1", "TOP", "TOP"] relation = (JSConstructor(window.pfcCreate ("pfcComponentConstraintType").ASM_CONSTRAINT_ALIGN), JSConstructor(window.pfcCreate ("pfcComponentConstraintType").ASM_CONSTRAINT_MATE); relationItem = JSConstructor(window.pfcCreate("pfcModelItemType").ITEM_AXIS,pfcCreate("pfcModelItemType").ITEM_SURFACE)) constrs = JSConstructor(window.pfcCreate ("pfcComponentConstraints")) for i in range(2): asmItem = subassembly.GetItemByName (relationItem[i], asmDatums [i]) if (asmItem == None): interactFlag = True continue JSConstructor(window.compItem = componentModel.GetItemByName (relationItem[i], compDatums [i]); if (compItem == None): interactFlag = true continue MpfcSelect = JSConstructor(window.pfcCreate ("MpfcSelect")) asmSel = JSConstructor(window.MpfcSelect.CreateModelItemSelection (asmItem, subPath)) compSel = JSConstructor(window.MpfcSelect.CreateModelItemSelection (compItem, None)) constr = JSConstructor(window.pfcCreate("pfcComponentConstraint").Create (relation[i])) constr.AssemblyReference = asmSel constr.ComponentReference = compSel constr.Attributes = JSConstructor(window.pfcCreate ("pfcConstraintAttributes").Create (true, false)) constrs.append (constr): asmcomp.SetConstraints (constrs, None) /**-------------------------------------------------------------------------------------------------------------------**/ /**----------------------------------------------- link2 -------------------------------------------------------------**/ var descr = pfcCreate ("pfcModelDescriptor").CreateFromFileName ("v:/home/fourbar/link2.prt"); var componentModel = session.GetModelFromDescr (descr); var componentModel = session.RetrieveModel(descr); if (componentModel != void null) { var asmcomp = assembly.AssembleComponent (componentModel, transf); } var ids = pfcCreate ("intseq"); ids.Append(featID+1); var subPath = pfcCreate ("MpfcAssembly").CreateComponentPath( assembly, ids ); subassembly = subPath.Leaf; var asmDatums = new Array ("A_2", "TOP", "ASM_TOP"); var compDatums = new Array ("A_1", "TOP", "TOP"); var relation = new Array (pfcCreate ("pfcComponentConstraintType").ASM_CONSTRAINT_ALIGN, pfcCreate ("pfcComponentConstraintType").ASM_CONSTRAINT_MATE); var relationItem = new Array(pfcCreate("pfcModelItemType").ITEM_AXIS,pfcCreate("pfcModelItemType").ITEM_SURFACE); var constrs = pfcCreate ("pfcComponentConstraints"); for (var i = 0; i < 2; i++) { var asmItem = subassembly.GetItemByName (relationItem[i], asmDatums [i]); if (asmItem == void null) { interactFlag = true; continue; } var compItem = componentModel.GetItemByName (relationItem[i], compDatums [i]); if (compItem == void null) { interactFlag = true; continue; } var MpfcSelect = pfcCreate ("MpfcSelect"); var asmSel = MpfcSelect.CreateModelItemSelection (asmItem, subPath); var compSel = MpfcSelect.CreateModelItemSelection (compItem, void null); var constr = pfcCreate ("pfcComponentConstraint").Create (relation[i]); constr.AssemblyReference = asmSel; constr.ComponentReference = compSel; constr.Attributes = pfcCreate ("pfcConstraintAttributes").Create (true, false); constrs.Append (constr); } asmcomp.SetConstraints (constrs, void null); /**-------------------------------------------------------------------------------------------------------------------**/ /**----------------------------------------------- link3 -------------------------------------------------------------**/ var descr = pfcCreate ("pfcModelDescriptor").CreateFromFileName ("v:/home/fourbar/link3.prt"); var componentModel = session.GetModelFromDescr (descr); var componentModel = session.RetrieveModel(descr); if (componentModel != void null) { var asmcomp = assembly.AssembleComponent (componentModel, transf); } var relation = new Array (pfcCreate ("pfcComponentConstraintType").ASM_CONSTRAINT_ALIGN, pfcCreate ("pfcComponentConstraintType").ASM_CONSTRAINT_MATE); var relationItem = new Array(pfcCreate("pfcModelItemType").ITEM_AXIS,pfcCreate("pfcModelItemType").ITEM_SURFACE); var constrs = pfcCreate ("pfcComponentConstraints"); var ids = pfcCreate ("intseq"); ids.Append(featID+2); var subPath = pfcCreate ("MpfcAssembly").CreateComponentPath( assembly, ids ); subassembly = subPath.Leaf; var asmDatums = new Array ("A_2"); var compDatums = new Array ("A_1"); for (var i = 0; i < 1; i++) { var asmItem = subassembly.GetItemByName (relationItem[i], asmDatums [i]); if (asmItem == void null) { interactFlag = true; continue; } var compItem = componentModel.GetItemByName (relationItem[i], compDatums [i]); if (compItem == void null) { interactFlag = true; continue; } var MpfcSelect = pfcCreate ("MpfcSelect"); var asmSel = MpfcSelect.CreateModelItemSelection (asmItem, subPath); var compSel = MpfcSelect.CreateModelItemSelection (compItem, void null); var constr = pfcCreate ("pfcComponentConstraint").Create (relation[i]); constr.AssemblyReference = asmSel; constr.ComponentReference = compSel; constr.Attributes = pfcCreate ("pfcConstraintAttributes").Create (true, false); constrs.Append (constr); } asmcomp.SetConstraints (constrs, void null); var ids = pfcCreate ("intseq"); ids.Append(featID); var subPath = pfcCreate ("MpfcAssembly").CreateComponentPath( assembly, ids ); subassembly = subPath.Leaf; var asmDatums = new Array ("A_2", "TOP"); var compDatums = new Array ("A_2", "BOTTON"); for (var i = 0; i < 2; i++) { var asmItem = subassembly.GetItemByName (relationItem[i], asmDatums [i]); if (asmItem == void null) { interactFlag = true; continue; } var compItem = componentModel.GetItemByName (relationItem[i], compDatums [i]); if (compItem == void null) { interactFlag = true; continue; } var MpfcSelect = pfcCreate ("MpfcSelect"); var asmSel = MpfcSelect.CreateModelItemSelection (asmItem, subPath); var compSel = MpfcSelect.CreateModelItemSelection (compItem, void null); var constr = pfcCreate ("pfcComponentConstraint").Create (relation[i]); constr.AssemblyReference = asmSel; constr.ComponentReference = compSel; constr.Attributes = pfcCreate ("pfcConstraintAttributes").Create (true, true); constrs.Append (constr); } asmcomp.SetConstraints (constrs, void null); /**-------------------------------------------------------------------------------------------------------------------**/ var session = pfcGetProESession (); var solid = session.CurrentModel; properties = solid.GetMassProperty(void null); var COG = properties.GravityCenter; document.write("MassProperty:<br />"); document.write("Mass:"+(properties.Mass.toFixed(2))+" pound<br />"); document.write("Average Density:"+(properties.Density.toFixed(2))+" pound/inch^3<br />"); document.write("Surface area:"+(properties.SurfaceArea.toFixed(2))+" inch^2<br />"); document.write("Volume:"+(properties.Volume.toFixed(2))+" inch^3<br />"); document.write("COG_X:"+COG.Item(0).toFixed(2)+"<br />"); document.write("COG_Y:"+COG.Item(1).toFixed(2)+"<br />"); document.write("COG_Z:"+COG.Item(2).toFixed(2)+"<br />"); try { document.write("Current Directory:<br />"+currentDir); } catch (err) { alert ("Exception occurred: "+pfcGetExceptionType (err)); } assembly.Regenerate (void null); session.GetModelWindow (assembly).Repaint(); </script> <canvas id="plotarea" width="800" height="600"></canvas> </body> </html> ''' return outstring #@+node:2015.20150330144929.1765: *3* mygeartest @cherrypy.expose # N 為齒數, M 為模數, P 為壓力角 def mygeartest(self, N=20, M=5, P=15): outstring = ''' <!DOCTYPE html> <html> <head> <meta http-equiv="content-type" content="text/html;charset=utf-8"> <!-- 載入 brython.js --> <script type="text/javascript" src="/static/Brython3.1.1-20150328-091302/brython.js"></script> <script src="/static/Cango2D.js" type="text/javascript"></script> <script src="/static/gearUtils-04.js" type="text/javascript"></script> </head> <!-- 啟動 brython() --> <body onload="brython()"> <!-- 以下為 canvas 畫圖程式 --> <script type="text/python"> # 從 browser 導入 document from browser import document from math import * # 準備在 id="plotarea" 的 canvas 中繪圖 canvas = document["plotarea"] ctx = canvas.getContext("2d") def create_line(x1, y1, x2, y2, width=3, fill="red"): ctx.beginPath() ctx.lineWidth = width ctx.moveTo(x1, y1) ctx.lineTo(x2, y2) ctx.strokeStyle = fill ctx.stroke() # 導入數學函式後, 圓周率為 pi # deg 為角度轉為徑度的轉換因子 deg = pi/180. # # 以下分別為正齒輪繪圖與主 tkinter 畫布繪圖 # # 定義一個繪正齒輪的繪圖函式 # midx 為齒輪圓心 x 座標 # midy 為齒輪圓心 y 座標 # rp 為節圓半徑, n 為齒數 def 齒輪(midx, midy, rp, n, 顏色): # 將角度轉換因子設為全域變數 global deg # 齒輪漸開線分成 15 線段繪製 imax = 15 # 在輸入的畫布上繪製直線, 由圓心到節圓 y 軸頂點畫一直線 create_line(midx, midy, midx, midy-rp) # 畫出 rp 圓, 畫圓函式尚未定義 #create_oval(midx-rp, midy-rp, midx+rp, midy+rp, width=2) # a 為模數 (代表公制中齒的大小), 模數為節圓直徑(稱為節徑)除以齒數 # 模數也就是齒冠大小 a=2*rp/n # d 為齒根大小, 為模數的 1.157 或 1.25倍, 這裡採 1.25 倍 d=2.5*rp/n # ra 為齒輪的外圍半徑 ra=rp+a print("ra:", ra) # 畫出 ra 圓, 畫圓函式尚未定義 #create_oval(midx-ra, midy-ra, midx+ra, midy+ra, width=1) # rb 則為齒輪的基圓半徑 # 基圓為漸開線長齒之基準圓 rb=rp*cos(20*deg) print("rp:", rp) print("rb:", rb) # 畫出 rb 圓 (基圓), 畫圓函式尚未定義 #create_oval(midx-rb, midy-rb, midx+rb, midy+rb, width=1) # rd 為齒根圓半徑 rd=rp-d # 當 rd 大於 rb 時 print("rd:", rd) # 畫出 rd 圓 (齒根圓), 畫圓函式尚未定義 #create_oval(midx-rd, midy-rd, midx+rd, midy+rd, width=1) # dr 則為基圓到齒頂圓半徑分成 imax 段後的每段半徑增量大小 # 將圓弧分成 imax 段來繪製漸開線 dr=(ra-rb)/imax # tan(20*deg)-20*deg 為漸開線函數 sigma=pi/(2*n)+tan(20*deg)-20*deg for j in range(n): ang=-2.*j*pi/n+sigma ang2=2.*j*pi/n+sigma lxd=midx+rd*sin(ang2-2.*pi/n) lyd=midy-rd*cos(ang2-2.*pi/n) #for(i=0;i<=imax;i++): for i in range(imax+1): r=rb+i*dr theta=sqrt((r*r)/(rb*rb)-1.) alpha=theta-atan(theta) xpt=r*sin(alpha-ang) ypt=r*cos(alpha-ang) xd=rd*sin(-ang) yd=rd*cos(-ang) # i=0 時, 繪線起點由齒根圓上的點, 作為起點 if(i==0): last_x = midx+xd last_y = midy-yd # 由左側齒根圓作為起點, 除第一點 (xd,yd) 齒根圓上的起點外, 其餘的 (xpt,ypt)則為漸開線上的分段點 create_line((midx+xpt),(midy-ypt),(last_x),(last_y),fill=顏色) # 最後一點, 則為齒頂圓 if(i==imax): lfx=midx+xpt lfy=midy-ypt last_x = midx+xpt last_y = midy-ypt # the line from last end of dedendum point to the recent # end of dedendum point # lxd 為齒根圓上的左側 x 座標, lyd 則為 y 座標 # 下列為齒根圓上用來近似圓弧的直線 create_line((lxd),(lyd),(midx+xd),(midy-yd),fill=顏色) #for(i=0;i<=imax;i++): for i in range(imax+1): r=rb+i*dr theta=sqrt((r*r)/(rb*rb)-1.) alpha=theta-atan(theta) xpt=r*sin(ang2-alpha) ypt=r*cos(ang2-alpha) xd=rd*sin(ang2) yd=rd*cos(ang2) # i=0 時, 繪線起點由齒根圓上的點, 作為起點 if(i==0): last_x = midx+xd last_y = midy-yd # 由右側齒根圓作為起點, 除第一點 (xd,yd) 齒根圓上的起點外, 其餘的 (xpt,ypt)則為漸開線上的分段點 create_line((midx+xpt),(midy-ypt),(last_x),(last_y),fill=顏色) # 最後一點, 則為齒頂圓 if(i==imax): rfx=midx+xpt rfy=midy-ypt last_x = midx+xpt last_y = midy-ypt # lfx 為齒頂圓上的左側 x 座標, lfy 則為 y 座標 # 下列為齒頂圓上用來近似圓弧的直線 create_line(lfx,lfy,rfx,rfy,fill=顏色) 齒輪(400,400,300,41,"blue") </script> <canvas id="plotarea" width="800" height="800"></canvas> </body> </html> ''' return outstring #@+node:2015.20150621222226.1: *3* drawspur @cherrypy.expose # N 為齒數, M 為模數, P 為壓力角 def drawspur(self, N=15,O=24, M=10, P=20): outstring = ''' <!DOCTYPE html> <html> <head> <meta http-equiv="content-type" content="text/html;charset=utf-8"> </head> <body> <form method=POST action=mygeartest> <p>齒數1: <select name=N1> <option>15 <option>16 <option>17 <option>18 <option>19 <option>20 <option>21 <option>22 <option>23 <option>24 <option>25 <option>26 <option>27 <option>28 <option>29 <option>30 <option>31 <option>32 <option>33 <option>34 <option>35 <option>36 <option>37 <option>38 <option>39 <option>40 <option>41 <option>42 <option>43 <option>44 <option>45 <option>46 <option>47 <option>48 <option>49 <option>50 <option>51 <option>52 <option>53 <option>54 <option>55 <option>56 <option>57 <option>58 <option>59 <option>60 <option>61 <option>62 <option>63 <option>64 <option>65 <option>66 <option>67 <option>68 <option>69 <option>70 <option>71 <option>72 <option>73 <option>74 <option>75 <option>76 <option>77 <option>78 <option>79 <option>80 </select> <p>齒數2: <select name=N2> <option>24 <option>15 <option>16 <option>17 <option>18 <option>19 <option>20 <option>21 <option>22 <option>23 <option>25 <option>26 <option>27 <option>28 <option>29 <option>30 <option>31 <option>32 <option>33 <option>34 <option>35 <option>36 <option>37 <option>38 <option>39 <option>40 <option>41 <option>42 <option>43 <option>44 <option>45 <option>46 <option>47 <option>48 <option>49 <option>50 <option>51 <option>52 <option>53 <option>54 <option>55 <option>56 <option>57 <option>58 <option>59 <option>60 <option>61 <option>62 <option>63 <option>64 <option>65 <option>66 <option>67 <option>68 <option>69 <option>70 <option>71 <option>72 <option>73 <option>74 <option>75 <option>76 <option>77 <option>78 <option>79 <option>80 </select> <br /> <br /> <input type=submit value=畫出正齒輪輪廓> </form> <br /><a href="index">返回</a><br /> <!-- 載入 brython.js --> <script type="text/javascript" src="/static/Brython3.1.1-20150328-091302/brython.js"></script> <script> window.onload=function(){ brython(); } </script> </body> </html> ''' return outstring #@+node:2015.20150628195251.1: *3* drawspur2 @cherrypy.expose # N 為齒數, M 為模數, P 為壓力角 def drawspur2(self, N=15,O=24, M=10, P=20): outstring = ''' <!DOCTYPE html> <html> <head> <meta http-equiv="content-type" content="text/html;charset=utf-8"> </head> <body> <form method=POST action=mygeartest2> <p>齒數1: <select name=N1> <option>15 <option>16 <option>17 <option>18 <option>19 <option>20 <option>21 <option>22 <option>23 <option>24 <option>25 <option>26 <option>27 <option>28 <option>29 <option>30 <option>31 <option>32 <option>33 <option>34 <option>35 <option>36 <option>37 <option>38 <option>39 <option>40 <option>41 <option>42 <option>43 <option>44 <option>45 <option>46 <option>47 <option>48 <option>49 <option>50 <option>51 <option>52 <option>53 <option>54 <option>55 <option>56 <option>57 <option>58 <option>59 <option>60 <option>61 <option>62 <option>63 <option>64 <option>65 <option>66 <option>67 <option>68 <option>69 <option>70 <option>71 <option>72 <option>73 <option>74 <option>75 <option>76 <option>77 <option>78 <option>79 <option>80 </select> <p>齒數2: <select name=N2> <option>24 <option>15 <option>16 <option>17 <option>18 <option>19 <option>20 <option>21 <option>22 <option>23 <option>25 <option>26 <option>27 <option>28 <option>29 <option>30 <option>31 <option>32 <option>33 <option>34 <option>35 <option>36 <option>37 <option>38 <option>39 <option>40 <option>41 <option>42 <option>43 <option>44 <option>45 <option>46 <option>47 <option>48 <option>49 <option>50 <option>51 <option>52 <option>53 <option>54 <option>55 <option>56 <option>57 <option>58 <option>59 <option>60 <option>61 <option>62 <option>63 <option>64 <option>65 <option>66 <option>67 <option>68 <option>69 <option>70 <option>71 <option>72 <option>73 <option>74 <option>75 <option>76 <option>77 <option>78 <option>79 <option>80 </select> <br /> <br /> <input type=submit value=畫出正齒輪輪廓> </form> <br /><a href="index">返回</a><br /> <!-- 載入 brython.js --> <script type="text/javascript" src="/static/Brython3.1.1-20150328-091302/brython.js"></script> <script> window.onload=function(){ brython(); } </script> </body> </html> ''' return outstring #@+node:amd.20150415215023.1: *3* mygeartest @cherrypy.expose # N 為齒數, M 為模數, P 為壓力角 def mygeartest(self, N1=15,N2=24 ,M=10, P=20): outstring = ''' <!DOCTYPE html> <html> <head> <meta http-equiv="content-type" content="text/html;charset=utf-8"> </head> <body> <a href="index">返回</a><br /> <!-- 以下為 canvas 畫圖程式 --> <script type="text/python"> # 從 browser 導入 document from browser import document from math import * # 請注意, 這裡導入位於 Lib/site-packages 目錄下的 spur.py 檔案 import spur # 準備在 id="plotarea" 的 canvas 中繪圖 canvas = document["plotarea"] ctx = canvas.getContext("2d") # 以下利用 spur.py 程式進行繪圖 # N 為齒數 # 第1齒輪齒數 n_g1 = '''+str(N1)+''' # 第2齒輪齒數 n_g2='''+str(N2)+''' # M 為模數 m = 10 # 壓力角 P 單位為角度 pa = 20 # 計算兩齒輪的節圓半徑 rp_g1 = m*n_g1/2 rp_g2 = m*n_g2/2 # 繪圖第1齒輪的圓心座標 x_g1 = 450 y_g1 = 400 # 第2齒輪的圓心座標, 假設排列成水平, 表示各齒輪圓心 y 座標相同 x_g2 = x_g1 y_g2 = y_g1 + rp_g1 + rp_g2 tran1 = pi tran2 = -pi/n_g2 # 將第1齒輪順時鐘轉 180 度 # 使用 ctx.save() 與 ctx.restore() 以確保各齒輪以相對座標進行旋轉繪圖 ctx.save() # translate to the origin of second gear ctx.translate(x_g1, y_g1) # rotate to engage ctx.rotate(tran1) # put it back ctx.translate(-x_g1, -y_g1) spur.Spur(ctx).Gear(x_g1, y_g1, rp_g1, n_g1, pa, "blue") ctx.restore() ctx.font = "20px Verdana"; # 將第2齒輪逆時鐘多轉一齒, 以便與第1齒輪進行囓合 ctx.save() # translate to the origin of second gear ctx.translate(x_g2, y_g2) # rotate to engage ctx.rotate(tran2) # put it back ctx.translate(-x_g2, -y_g2) spur.Spur(ctx).Gear(x_g2, y_g2, rp_g2, n_g2, pa, "black") ctx.restore() ctx.font = "20px Verdana"; </script> <canvas id="plotarea" width="3500" height="3500"></canvas> <!-- 載入 brython.js --> <script type="text/javascript" src="/static/Brython3.1.1-20150328-091302/brython.js"></script> <script> window.onload=function(){ brython(); } </script> </body> </html> ''' return outstring #@+node:2015.20150628193459.1: *3* mygeartest2 @cherrypy.expose # N 為齒數, M 為模數, P 為壓力角 def mygeartest2(self, N1=15,N2=24 ,M=10, P=20): outstring = ''' <!DOCTYPE html> <html> <head> <meta http-equiv="content-type" content="text/html;charset=utf-8"> </head> <body> <a href="index">index</a><br /> <!-- 以下為 canvas 畫圖程式 --> <script type="text/python"> # 從 browser 導入 document from browser import document from math import * # 請注意, 這裡導入位於 Lib/site-packages 目錄下的 spur.py 檔案 import spur # 準備在 id="plotarea" 的 canvas 中繪圖 canvas = document["plotarea"] ctx = canvas.getContext("2d") # 以下利用 spur.py 程式進行繪圖 # N 為齒數 # 第1齒輪齒數 n_g1 = '''+str(N1)+''' # 第2齒輪齒數 n_g2='''+str(N2)+''' # 第3齒輪齒數 n_g3 = '''+str(N1)+''' # 第4齒輪齒數 n_g4='''+str(N2)+''' # M 為模數 m = 10 # 壓力角 P 單位為角度 pa = 20 # 計算兩齒輪的節圓半徑 rp_g1 = m*n_g1/2 rp_g2 = m*n_g2/2 rp_g3 = m*n_g3/2 rp_g4 = m*n_g4/2 # 繪圖第1齒輪的圓心座標 x_g1 = 400 y_g1 = 400 # 第2齒輪的圓心座標, 假設排列成水平, 表示各齒輪圓心 y 座標相同 x_g2 = x_g1 y_g2 = y_g1 + rp_g1 + rp_g2 # 第3齒輪的圓心座標 x_g3 = x_g2 + rp_g2+ rp_g3 y_g3 = y_g2 # 第4齒輪的圓心座標 x_g4 = x_g3 y_g4 = y_g3+ rp_g3+ rp_g4 tran1 = pi tran2 = -pi/n_g2 tran3 = -pi/2-pi/n_g3+(pi/2+pi/n_g2)*n_g2/n_g3 tran4 = -pi/n_g4+(-pi/2+pi/n_g3)*n_g3/n_g4-(pi/2+pi/n_g2)*n_g2/n_g4 # 將第1齒輪順時鐘轉 180 度 # 使用 ctx.save() 與 ctx.restore() 以確保各齒輪以相對座標進行旋轉繪圖 ctx.save() # translate to the origin of second gear ctx.translate(x_g1, y_g1) # rotate to engage ctx.rotate(tran1) # put it back ctx.translate(-x_g1, -y_g1) spur.Spur(ctx).Gear(x_g1, y_g1, rp_g1, n_g1, pa, "blue") ctx.restore() # 將第2齒輪逆時鐘多轉一齒, 以便與第1齒輪進行囓合 ctx.save() # translate to the origin of second gear ctx.translate(x_g2, y_g2) # rotate to engage ctx.rotate(tran2) # put it back ctx.translate(-x_g2, -y_g2) spur.Spur(ctx).Gear(x_g2, y_g2, rp_g2, n_g2, pa, "red") ctx.restore() # 將第3齒輪 ctx.save() # translate to the origin of second gear ctx.translate(x_g3, y_g3) # rotate to engage ctx.rotate(tran3) # put it back ctx.translate(-x_g3, -y_g3) spur.Spur(ctx).Gear(x_g3, y_g3, rp_g3, n_g3, pa, "blue") ctx.restore() # 將第4齒輪 ctx.save() # translate to the origin of second gear ctx.translate(x_g4, y_g4) # rotate to engage ctx.rotate(tran4) # put it back ctx.translate(-x_g4, -y_g4) spur.Spur(ctx).Gear(x_g4, y_g4, rp_g4, n_g4, pa, "red") ctx.restore() </script> <canvas id="plotarea" width="3000" height="3000"></canvas> <!-- 載入 brython.js --> <script type="text/javascript" src="/static/Brython3.1.1-20150328-091302/brython.js"></script> <script> window.onload=function(){ brython(); } </script> </body> </html> ''' return outstring #@+node:2015.20150331094055.1737: *3* my3Dgeartest @cherrypy.expose # N 為齒數, M 為模數, P 為壓力角 def my3Dgeartest(self, N=20, M=5, P=15): outstring = ''' <!DOCTYPE html> <html> <head> <meta http-equiv="content-type" content="text/html;charset=utf-8"> <!-- 載入 brython.js --> <script type="text/javascript" src="/static/Brython3.1.1-20150328-091302/brython.js"></script> <script src="/static/Cango2D.js" type="text/javascript"></script> <script src="/static/gearUtils-04.js" type="text/javascript"></script> </head> <!-- 啟動 brython() --> <body onload="brython()"> <!-- 以下為 canvas 畫圖程式 --> <script type="text/python"> # 從 browser 導入 document from browser import document from math import * # 準備在 id="plotarea" 的 canvas 中繪圖 canvas = document["plotarea"] ctx = canvas.getContext("2d") def create_line(x1, y1, x2, y2, width=3, fill="red"): ctx.beginPath() ctx.lineWidth = width ctx.moveTo(x1, y1) ctx.lineTo(x2, y2) ctx.strokeStyle = fill ctx.stroke() # 導入數學函式後, 圓周率為 pi # deg 為角度轉為徑度的轉換因子 deg = pi/180. # # 以下分別為正齒輪繪圖與主 tkinter 畫布繪圖 # # 定義一個繪正齒輪的繪圖函式 # midx 為齒輪圓心 x 座標 # midy 為齒輪圓心 y 座標 # rp 為節圓半徑, n 為齒數 def gear(midx, midy, rp, n, 顏色): # 將角度轉換因子設為全域變數 global deg # 齒輪漸開線分成 15 線段繪製 imax = 15 # 在輸入的畫布上繪製直線, 由圓心到節圓 y 軸頂點畫一直線 create_line(midx, midy, midx, midy-rp) # 畫出 rp 圓, 畫圓函式尚未定義 #create_oval(midx-rp, midy-rp, midx+rp, midy+rp, width=2) # a 為模數 (代表公制中齒的大小), 模數為節圓直徑(稱為節徑)除以齒數 # 模數也就是齒冠大小 a=2*rp/n # d 為齒根大小, 為模數的 1.157 或 1.25倍, 這裡採 1.25 倍 d=2.5*rp/n # ra 為齒輪的外圍半徑 ra=rp+a print("ra:", ra) # 畫出 ra 圓, 畫圓函式尚未定義 #create_oval(midx-ra, midy-ra, midx+ra, midy+ra, width=1) # rb 則為齒輪的基圓半徑 # 基圓為漸開線長齒之基準圓 rb=rp*cos(20*deg) print("rp:", rp) print("rb:", rb) # 畫出 rb 圓 (基圓), 畫圓函式尚未定義 #create_oval(midx-rb, midy-rb, midx+rb, midy+rb, width=1) # rd 為齒根圓半徑 rd=rp-d # 當 rd 大於 rb 時 print("rd:", rd) # 畫出 rd 圓 (齒根圓), 畫圓函式尚未定義 #create_oval(midx-rd, midy-rd, midx+rd, midy+rd, width=1) # dr 則為基圓到齒頂圓半徑分成 imax 段後的每段半徑增量大小 # 將圓弧分成 imax 段來繪製漸開線 dr=(ra-rb)/imax # tan(20*deg)-20*deg 為漸開線函數 sigma=pi/(2*n)+tan(20*deg)-20*deg for j in range(n): ang=-2.*j*pi/n+sigma ang2=2.*j*pi/n+sigma lxd=midx+rd*sin(ang2-2.*pi/n) lyd=midy-rd*cos(ang2-2.*pi/n) #for(i=0;i<=imax;i++): for i in range(imax+1): r=rb+i*dr theta=sqrt((r*r)/(rb*rb)-1.) alpha=theta-atan(theta) xpt=r*sin(alpha-ang) ypt=r*cos(alpha-ang) xd=rd*sin(-ang) yd=rd*cos(-ang) # i=0 時, 繪線起點由齒根圓上的點, 作為起點 if(i==0): last_x = midx+xd last_y = midy-yd # 由左側齒根圓作為起點, 除第一點 (xd,yd) 齒根圓上的起點外, 其餘的 (xpt,ypt)則為漸開線上的分段點 create_line((midx+xpt),(midy-ypt),(last_x),(last_y),fill=顏色) # 最後一點, 則為齒頂圓 if(i==imax): lfx=midx+xpt lfy=midy-ypt last_x = midx+xpt last_y = midy-ypt # the line from last end of dedendum point to the recent # end of dedendum point # lxd 為齒根圓上的左側 x 座標, lyd 則為 y 座標 # 下列為齒根圓上用來近似圓弧的直線 create_line((lxd),(lyd),(midx+xd),(midy-yd),fill=顏色) #for(i=0;i<=imax;i++): for i in range(imax+1): r=rb+i*dr theta=sqrt((r*r)/(rb*rb)-1.) alpha=theta-atan(theta) xpt=r*sin(ang2-alpha) ypt=r*cos(ang2-alpha) xd=rd*sin(ang2) yd=rd*cos(ang2) # i=0 時, 繪線起點由齒根圓上的點, 作為起點 if(i==0): last_x = midx+xd last_y = midy-yd # 由右側齒根圓作為起點, 除第一點 (xd,yd) 齒根圓上的起點外, 其餘的 (xpt,ypt)則為漸開線上的分段點 create_line((midx+xpt),(midy-ypt),(last_x),(last_y),fill=顏色) # 最後一點, 則為齒頂圓 if(i==imax): rfx=midx+xpt rfy=midy-ypt last_x = midx+xpt last_y = midy-ypt # lfx 為齒頂圓上的左側 x 座標, lfy 則為 y 座標 # 下列為齒頂圓上用來近似圓弧的直線 create_line(lfx,lfy,rfx,rfy,fill=顏色) gear(400,400,300,41,"blue") </script> <canvas id="plotarea" width="800" height="800"></canvas> </body> </html> ''' return outstring #@+node:2014fall.20141215194146.1793: *3* doCheck @cherrypy.expose def doCheck(self, guess=None): # 假如使用者直接執行 doCheck, 則設法轉回根方法 if guess is None: raise cherrypy.HTTPRedirect("/") # 從 session 取出 answer 對應資料, 且處理直接執行 doCheck 時無法取 session 值情況 try: theanswer = int(cherrypy.session.get('answer')) except: raise cherrypy.HTTPRedirect("/") # 經由表單所取得的 guess 資料型別為 string try: theguess = int(guess) except: return "error " + self.guessform() # 每執行 doCheck 一次,次數增量一次 cherrypy.session['count'] += 1 # 答案與所猜數字進行比對 if theanswer < theguess: return "big " + self.guessform() elif theanswer > theguess: return "small " + self.guessform() else: # 已經猜對, 從 session 取出累計猜測次數 thecount = cherrypy.session.get('count') return "exact: <a href=''>再猜</a>" #@+node:2014fall.20141215194146.1789: *3* guessform def guessform(self): # 印出讓使用者輸入的超文件表單 outstring = str(cherrypy.session.get('answer')) + "/" + str(cherrypy.session.get('count')) + '''<form method=POST action=doCheck> 請輸入您所猜的整數:<input type=text name=guess><br /> <input type=submit value=send> </form>''' return outstring #@-others #@-others ################# (4) 程式啟動區 # 配合程式檔案所在目錄設定靜態目錄或靜態檔案 application_conf = {'/static':{ 'tools.staticdir.on': True, # 程式執行目錄下, 必須自行建立 static 目錄 'tools.staticdir.dir': _curdir+"/static"}, '/downloads':{ 'tools.staticdir.on': True, 'tools.staticdir.dir': data_dir+"/downloads"}, '/images':{ 'tools.staticdir.on': True, 'tools.staticdir.dir': data_dir+"/images"} } root = Hello() root.gear = gear.Gear() root.man = man.MAN() cherrypy.server.socket_port = 8088 cherrypy.server.socket_host = '127.0.0.1' if 'OPENSHIFT_REPO_DIR' in os.environ.keys(): # 表示在 OpenSfhit 執行 application = cherrypy.Application(root, config=application_conf) else: # 表示在近端執行 cherrypy.quickstart(root, config=application_conf) #@-leo
gpl-3.0
ericvandenbergfb/spark
python/pyspark/daemon.py
79
6127
# # Licensed to the Apache Software Foundation (ASF) under one or more # contributor license agreements. See the NOTICE file distributed with # this work for additional information regarding copyright ownership. # The ASF licenses this file to You under the Apache License, Version 2.0 # (the "License"); you may not use this file except in compliance with # the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # import numbers import os import signal import select import socket import sys import traceback import time import gc from errno import EINTR, EAGAIN from socket import AF_INET, SOCK_STREAM, SOMAXCONN from signal import SIGHUP, SIGTERM, SIGCHLD, SIG_DFL, SIG_IGN, SIGINT from pyspark.worker import main as worker_main from pyspark.serializers import read_int, write_int def compute_real_exit_code(exit_code): # SystemExit's code can be integer or string, but os._exit only accepts integers if isinstance(exit_code, numbers.Integral): return exit_code else: return 1 def worker(sock): """ Called by a worker process after the fork(). """ signal.signal(SIGHUP, SIG_DFL) signal.signal(SIGCHLD, SIG_DFL) signal.signal(SIGTERM, SIG_DFL) # restore the handler for SIGINT, # it's useful for debugging (show the stacktrace before exit) signal.signal(SIGINT, signal.default_int_handler) # Read the socket using fdopen instead of socket.makefile() because the latter # seems to be very slow; note that we need to dup() the file descriptor because # otherwise writes also cause a seek that makes us miss data on the read side. infile = os.fdopen(os.dup(sock.fileno()), "rb", 65536) outfile = os.fdopen(os.dup(sock.fileno()), "wb", 65536) exit_code = 0 try: worker_main(infile, outfile) except SystemExit as exc: exit_code = compute_real_exit_code(exc.code) finally: try: outfile.flush() except Exception: pass return exit_code def manager(): # Create a new process group to corral our children os.setpgid(0, 0) # Create a listening socket on the AF_INET loopback interface listen_sock = socket.socket(AF_INET, SOCK_STREAM) listen_sock.bind(('127.0.0.1', 0)) listen_sock.listen(max(1024, SOMAXCONN)) listen_host, listen_port = listen_sock.getsockname() # re-open stdin/stdout in 'wb' mode stdin_bin = os.fdopen(sys.stdin.fileno(), 'rb', 4) stdout_bin = os.fdopen(sys.stdout.fileno(), 'wb', 4) write_int(listen_port, stdout_bin) stdout_bin.flush() def shutdown(code): signal.signal(SIGTERM, SIG_DFL) # Send SIGHUP to notify workers of shutdown os.kill(0, SIGHUP) exit(code) def handle_sigterm(*args): shutdown(1) signal.signal(SIGTERM, handle_sigterm) # Gracefully exit on SIGTERM signal.signal(SIGHUP, SIG_IGN) # Don't die on SIGHUP signal.signal(SIGCHLD, SIG_IGN) reuse = os.environ.get("SPARK_REUSE_WORKER") # Initialization complete try: while True: try: ready_fds = select.select([0, listen_sock], [], [], 1)[0] except select.error as ex: if ex[0] == EINTR: continue else: raise if 0 in ready_fds: try: worker_pid = read_int(stdin_bin) except EOFError: # Spark told us to exit by closing stdin shutdown(0) try: os.kill(worker_pid, signal.SIGKILL) except OSError: pass # process already died if listen_sock in ready_fds: try: sock, _ = listen_sock.accept() except OSError as e: if e.errno == EINTR: continue raise # Launch a worker process try: pid = os.fork() except OSError as e: if e.errno in (EAGAIN, EINTR): time.sleep(1) pid = os.fork() # error here will shutdown daemon else: outfile = sock.makefile(mode='wb') write_int(e.errno, outfile) # Signal that the fork failed outfile.flush() outfile.close() sock.close() continue if pid == 0: # in child process listen_sock.close() try: # Acknowledge that the fork was successful outfile = sock.makefile(mode="wb") write_int(os.getpid(), outfile) outfile.flush() outfile.close() while True: code = worker(sock) if not reuse or code: # wait for closing try: while sock.recv(1024): pass except Exception: pass break gc.collect() except: traceback.print_exc() os._exit(1) else: os._exit(0) else: sock.close() finally: shutdown(1) if __name__ == '__main__': manager()
apache-2.0
polarise/BioClasses
LeafCounter.py
2
1218
# -*- encoding: utf-8 -*- from __future__ import division import sys class LeafCounter( object ): def __init__( self ): self.state_count = 0 self.zero_count = 0 self.one_count = 0 self.two_count = 0 self.branch_count = 0 def add_node( self, node ): if self.state_count == 0: if node.name == 0: self.zero_count = 0 self.one_count = 1 self.two_count = 1 elif node.name == 1: self.zero_count = 1 self.one_count = 0 self.two_count = 1 elif node.name == 2: self.zero_count = 1 self.one_count = 1 self.two_count = 0 self.branch_count = 0 else: if node.name == 0: self.branch_count = self.zero_count self.zero_count = 0 self.one_count += self.branch_count self.two_count += self.branch_count elif node.name == 1: self.branch_count = self.one_count self.zero_count += self.branch_count self.one_count = 0 self.two_count += self.branch_count elif node.name == 2: self.branch_count = self.two_count self.zero_count += self.branch_count self.one_count += self.branch_count self.two_count = 0 self.state_count += 1 def leaf_count( self ): return self.zero_count + self.one_count + self.two_count
gpl-2.0
cesarmarinhorj/ansible
test/units/vars/test_variable_manager.py
70
5534
# (c) 2012-2014, Michael DeHaan <michael.dehaan@gmail.com> # # This file is part of Ansible # # Ansible is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Ansible is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Ansible. If not, see <http://www.gnu.org/licenses/>. # Make coding more python3-ish from __future__ import (absolute_import, division, print_function) __metaclass__ = type from ansible.compat.tests import unittest from ansible.compat.tests.mock import patch, MagicMock from ansible.vars import VariableManager from units.mock.loader import DictDataLoader class TestVariableManager(unittest.TestCase): def setUp(self): pass def tearDown(self): pass def test_basic_manager(self): fake_loader = DictDataLoader({}) v = VariableManager() vars = v.get_vars(loader=fake_loader, use_cache=False) if 'omit' in vars: del vars['omit'] if 'vars' in vars: del vars['vars'] if 'ansible_version' in vars: del vars['ansible_version'] self.assertEqual(vars, dict(playbook_dir='.')) self.assertEqual( v._merge_dicts( dict(a=1), dict(b=2) ), dict(a=1, b=2) ) self.assertEqual( v._merge_dicts( dict(a=1, c=dict(foo='bar')), dict(b=2, c=dict(baz='bam')) ), dict(a=1, b=2, c=dict(foo='bar', baz='bam')) ) def test_variable_manager_extra_vars(self): fake_loader = DictDataLoader({}) extra_vars = dict(a=1, b=2, c=3) v = VariableManager() v.extra_vars = extra_vars vars = v.get_vars(loader=fake_loader, use_cache=False) for (key, val) in extra_vars.iteritems(): self.assertEqual(vars.get(key), val) self.assertIsNot(v.extra_vars, extra_vars) def test_variable_manager_host_vars_file(self): fake_loader = DictDataLoader({ "host_vars/hostname1.yml": """ foo: bar """ }) v = VariableManager() v.add_host_vars_file("host_vars/hostname1.yml", loader=fake_loader) self.assertIn("hostname1", v._host_vars_files) self.assertEqual(v._host_vars_files["hostname1"], dict(foo="bar")) mock_host = MagicMock() mock_host.get_name.return_value = "hostname1" mock_host.get_vars.return_value = dict() mock_host.get_groups.return_value = () self.assertEqual(v.get_vars(loader=fake_loader, host=mock_host, use_cache=False).get("foo"), "bar") def test_variable_manager_group_vars_file(self): fake_loader = DictDataLoader({ "group_vars/all.yml": """ foo: bar """, "group_vars/somegroup.yml": """ bam: baz """ }) v = VariableManager() v.add_group_vars_file("group_vars/all.yml", loader=fake_loader) v.add_group_vars_file("group_vars/somegroup.yml", loader=fake_loader) self.assertIn("somegroup", v._group_vars_files) self.assertEqual(v._group_vars_files["all"], dict(foo="bar")) self.assertEqual(v._group_vars_files["somegroup"], dict(bam="baz")) mock_group = MagicMock() mock_group.name = "somegroup" mock_group.get_ancestors.return_value = () mock_group.get_vars.return_value = dict() mock_host = MagicMock() mock_host.get_name.return_value = "hostname1" mock_host.get_vars.return_value = dict() mock_host.get_groups.return_value = (mock_group,) vars = v.get_vars(loader=fake_loader, host=mock_host, use_cache=False) self.assertEqual(vars.get("foo"), "bar") self.assertEqual(vars.get("bam"), "baz") def test_variable_manager_play_vars(self): fake_loader = DictDataLoader({}) mock_play = MagicMock() mock_play.get_vars.return_value = dict(foo="bar") mock_play.get_roles.return_value = [] mock_play.get_vars_files.return_value = [] v = VariableManager() self.assertEqual(v.get_vars(loader=fake_loader, play=mock_play, use_cache=False).get("foo"), "bar") def test_variable_manager_play_vars_files(self): fake_loader = DictDataLoader({ "/path/to/somefile.yml": """ foo: bar """ }) mock_play = MagicMock() mock_play.get_vars.return_value = dict() mock_play.get_roles.return_value = [] mock_play.get_vars_files.return_value = ['/path/to/somefile.yml'] v = VariableManager() self.assertEqual(v.get_vars(loader=fake_loader, play=mock_play, use_cache=False).get("foo"), "bar") def test_variable_manager_task_vars(self): fake_loader = DictDataLoader({}) mock_task = MagicMock() mock_task._role = None mock_task.get_vars.return_value = dict(foo="bar") v = VariableManager() self.assertEqual(v.get_vars(loader=fake_loader, task=mock_task, use_cache=False).get("foo"), "bar")
gpl-3.0
sorenk/ansible
test/units/modules/network/fortimanager/fortimanager_module.py
111
2107
# (c) 2016 Red Hat Inc. # # This file is part of Ansible # # Ansible is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Ansible is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Ansible. If not, see <http://www.gnu.org/licenses/>. # Make coding more python3-ish from __future__ import (absolute_import, division, print_function) __metaclass__ = type from units.modules.utils import AnsibleExitJson, AnsibleFailJson, ModuleTestCase class TestFortimanagerModule(ModuleTestCase): def execute_module(self, failed=False, changed=False, commands=None, sort=True, defaults=False): self.load_fixtures(commands) if failed: result = self.failed() self.assertTrue(result['failed'], result) else: result = self.changed(changed) self.assertEqual(result['changed'], changed, result) if commands is not None: if sort: self.assertEqual(sorted(commands), sorted(result['commands']), result['commands']) else: self.assertEqual(commands, result['commands'], result['commands']) return result def failed(self): with self.assertRaises(AnsibleFailJson) as exc: self.module.main() result = exc.exception.args[0] self.assertTrue(result['failed'], result) return result def changed(self, changed=False): with self.assertRaises(AnsibleExitJson) as exc: self.module.main() result = exc.exception.args[0] self.assertEqual(result['changed'], changed, result) return result def load_fixtures(self, commands=None): pass
gpl-3.0
HybridF5/tempest
tempest/tests/lib/common/test_api_version_request.py
4
6634
# Copyright 2014 IBM Corp. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from tempest.lib.common import api_version_request from tempest.lib import exceptions from tempest.tests.lib import base class APIVersionRequestTests(base.TestCase): def test_valid_version_strings(self): def _test_string(version, exp_major, exp_minor): v = api_version_request.APIVersionRequest(version) self.assertEqual(v.ver_major, exp_major) self.assertEqual(v.ver_minor, exp_minor) _test_string("1.1", 1, 1) _test_string("2.10", 2, 10) _test_string("5.234", 5, 234) _test_string("12.5", 12, 5) _test_string("2.0", 2, 0) _test_string("2.200", 2, 200) def test_null_version(self): v = api_version_request.APIVersionRequest() self.assertTrue(v.is_null()) def test_invalid_version_strings(self): self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, "2") self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, "200") self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, "2.1.4") self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, "200.23.66.3") self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, "5 .3") self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, "5. 3") self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, "5.03") self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, "02.1") self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, "2.001") self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, "") self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, " 2.1") self.assertRaises(exceptions.InvalidAPIVersionString, api_version_request.APIVersionRequest, "2.1 ") def test_version_comparisons(self): vers2_0 = api_version_request.APIVersionRequest("2.0") vers2_5 = api_version_request.APIVersionRequest("2.5") vers5_23 = api_version_request.APIVersionRequest("5.23") v_null = api_version_request.APIVersionRequest() v_latest = api_version_request.APIVersionRequest('latest') self.assertTrue(v_null < vers2_5) self.assertTrue(vers2_0 < vers2_5) self.assertTrue(vers2_0 <= vers2_5) self.assertTrue(vers2_0 <= vers2_0) self.assertTrue(vers2_5 > v_null) self.assertTrue(vers5_23 > vers2_5) self.assertTrue(vers2_0 >= vers2_0) self.assertTrue(vers5_23 >= vers2_5) self.assertTrue(vers2_0 != vers2_5) self.assertTrue(vers2_0 == vers2_0) self.assertTrue(vers2_0 != v_null) self.assertTrue(v_null == v_null) self.assertTrue(vers2_0 <= v_latest) self.assertTrue(vers2_0 != v_latest) self.assertTrue(v_latest == v_latest) self.assertRaises(TypeError, vers2_0.__lt__, "2.1") def test_version_matches(self): vers2_0 = api_version_request.APIVersionRequest("2.0") vers2_5 = api_version_request.APIVersionRequest("2.5") vers2_45 = api_version_request.APIVersionRequest("2.45") vers3_3 = api_version_request.APIVersionRequest("3.3") vers3_23 = api_version_request.APIVersionRequest("3.23") vers4_0 = api_version_request.APIVersionRequest("4.0") v_null = api_version_request.APIVersionRequest() v_latest = api_version_request.APIVersionRequest('latest') def _check_version_matches(version, version1, version2, check=True): if check: msg = "Version %s does not matches with [%s - %s] range" self.assertTrue(version.matches(version1, version2), msg % (version.get_string(), version1.get_string(), version2.get_string())) else: msg = "Version %s matches with [%s - %s] range" self.assertFalse(version.matches(version1, version2), msg % (version.get_string(), version1.get_string(), version2.get_string())) _check_version_matches(vers2_5, vers2_0, vers2_45) _check_version_matches(vers2_5, vers2_0, v_null) _check_version_matches(vers2_0, vers2_0, vers2_5) _check_version_matches(vers3_3, vers2_5, vers3_3) _check_version_matches(vers3_3, v_null, vers3_3) _check_version_matches(vers3_3, v_null, vers4_0) _check_version_matches(vers2_0, vers2_5, vers2_45, False) _check_version_matches(vers3_23, vers2_5, vers3_3, False) _check_version_matches(vers2_5, vers2_45, vers2_0, False) _check_version_matches(vers2_5, vers2_0, v_latest) _check_version_matches(v_latest, v_latest, v_latest) _check_version_matches(vers2_5, v_latest, v_latest, False) _check_version_matches(v_latest, vers2_0, vers4_0, False) self.assertRaises(ValueError, v_null.matches, vers2_0, vers2_45) def test_get_string(self): vers_string = ["3.23", "latest"] for ver in vers_string: ver_obj = api_version_request.APIVersionRequest(ver) self.assertEqual(ver, ver_obj.get_string()) self.assertIsNotNone( api_version_request.APIVersionRequest().get_string)
apache-2.0
tangkun75/docker-registry
depends/docker-registry-core/docker_registry/core/boto.py
27
4825
# -*- coding: utf-8 -*- # Copyright (c) 2014 Docker. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or # implied. # See the License for the specific language governing permissions and # limitations under the License. """ docker_registry.core.boto ~~~~~~~~~~~~~~~~~~~~~~~~~~ Might be useful for * Amazon Simple Storage Service (S3) * Google Cloud Storage * Amazon Glacier * Amazon Elastic Block Store (EBS) """ import gevent.monkey gevent.monkey.patch_all() import logging import os from . import driver from . import lru from .exceptions import FileNotFoundError logger = logging.getLogger(__name__) class Base(driver.Base): supports_bytes_range = True def __init__(self, path=None, config=None): self._config = config self._root_path = path or '/test' self._boto_conn = self.makeConnection() self._boto_bucket = self._boto_conn.get_bucket( self._config.boto_bucket) logger.info("Boto based storage initialized") def _build_connection_params(self): kwargs = {'is_secure': (self._config.s3_secure is True)} config_args = [ 'host', 'port', 'debug', 'proxy', 'proxy_port', 'proxy_user', 'proxy_pass', 'calling_format' ] for arg in config_args: confkey = 'boto_' + arg if getattr(self._config, confkey, None) is not None: kwargs[arg] = getattr(self._config, confkey) return kwargs def _debug_key(self, key): """Used for debugging only.""" orig_meth = key.bucket.connection.make_request def new_meth(*args, **kwargs): print('#' * 16) print(args) print(kwargs) print('#' * 16) return orig_meth(*args, **kwargs) key.bucket.connection.make_request = new_meth def _init_path(self, path=None): path = os.path.join(self._root_path, path) if path else self._root_path if path and path[0] == '/': return path[1:] return path def stream_read(self, path, bytes_range=None): path = self._init_path(path) headers = None if bytes_range: headers = {'Range': 'bytes={0}-{1}'.format(*bytes_range)} key = self._boto_bucket.lookup(path, headers=headers) if not key: raise FileNotFoundError('%s is not there' % path) while True: buf = key.read(self.buffer_size) if not buf: break yield buf def list_directory(self, path=None): path = self._init_path(path) if not path.endswith('/'): path += '/' ln = 0 if self._root_path != '/': ln = len(self._root_path) exists = False for key in self._boto_bucket.list(prefix=path, delimiter='/'): if '%s/' % key.name == path: continue exists = True name = key.name if name.endswith('/'): yield name[ln:-1] else: yield name[ln:] if not exists: raise FileNotFoundError('%s is not there' % path) def get_size(self, path): path = self._init_path(path) # Lookup does a HEAD HTTP Request on the object key = self._boto_bucket.lookup(path) if not key: raise FileNotFoundError('%s is not there' % path) return key.size @lru.get def get_content(self, path): path = self._init_path(path) key = self.makeKey(path) if not key.exists(): raise FileNotFoundError('%s is not there' % path) return key.get_contents_as_string() def exists(self, path): path = self._init_path(path) key = self.makeKey(path) return key.exists() @lru.remove def remove(self, path): path = self._init_path(path) key = self.makeKey(path) if key.exists(): # It's a file key.delete() return # We assume it's a directory if not path.endswith('/'): path += '/' exists = False for key in self._boto_bucket.list(prefix=path, delimiter='/'): if '%s/' % key.name == path: continue exists = True key.delete() if not exists: raise FileNotFoundError('%s is not there' % path)
apache-2.0
amchoukir/ycmd
build.py
1
6445
#!/usr/bin/env python import os import os.path as p import sys major, minor = sys.version_info[ 0 : 2 ] if major != 2 or minor < 6: sys.exit( 'The build script requires Python version >= 2.6 and < 3.0; ' 'your version of Python is ' + sys.version ) DIR_OF_THIS_SCRIPT = p.dirname( p.abspath( __file__ ) ) DIR_OF_THIRD_PARTY = p.join( DIR_OF_THIS_SCRIPT, 'third_party' ) for folder in os.listdir( DIR_OF_THIRD_PARTY ): abs_folder_path = p.join( DIR_OF_THIRD_PARTY, folder ) if p.isdir( abs_folder_path ) and not os.listdir( abs_folder_path ): sys.exit( 'Some folders in ' + DIR_OF_THIRD_PARTY + ' are empty; ' 'you probably forgot to run:' '\n\tgit submodule update --init --recursive\n\n' ) sys.path.insert( 0, p.abspath( p.join( DIR_OF_THIRD_PARTY, 'sh' ) ) ) sys.path.insert( 0, p.abspath( p.join( DIR_OF_THIRD_PARTY, 'argparse' ) ) ) import sh import platform import argparse import multiprocessing from distutils.spawn import find_executable def OnMac(): return platform.system() == 'Darwin' def PathToFirstExistingExecutable( executable_name_list ): for executable_name in executable_name_list: path = find_executable( executable_name ) if path: return path return None def NumCores(): ycm_cores = os.environ.get( 'YCM_CORES' ) if ycm_cores: return int( ycm_cores ) try: return multiprocessing.cpu_count() except NotImplementedError: return 1 def CheckDeps(): if not PathToFirstExistingExecutable( [ 'cmake' ] ): sys.exit( 'Please install CMake and retry.') def CustomPythonCmakeArgs(): # The CMake 'FindPythonLibs' Module does not work properly. # So we are forced to do its job for it. python_prefix = sh.python_config( '--prefix' ).strip() if p.isfile( p.join( python_prefix, '/Python' ) ): python_library = p.join( python_prefix, '/Python' ) python_include = p.join( python_prefix, '/Headers' ) else: which_python = sh.python( '-c', 'import sys;i=sys.version_info;print "python%d.%d" % (i[0], i[1])' ).strip() lib_python = '{0}/lib/lib{1}'.format( python_prefix, which_python ).strip() if p.isfile( '{0}.a'.format( lib_python ) ): python_library = '{0}.a'.format( lib_python ) # This check is for CYGWIN elif p.isfile( '{0}.dll.a'.format( lib_python ) ): python_library = '{0}.dll.a'.format( lib_python ) else: python_library = '{0}.dylib'.format( lib_python ) python_include = '{0}/include/{1}'.format( python_prefix, which_python ) python_executable = '{0}/bin/python'.format( python_prefix ) return [ '-DPYTHON_LIBRARY={0}'.format( python_library ), '-DPYTHON_INCLUDE_DIR={0}'.format( python_include ), '-DPYTHON_EXECUTABLE={0}'.format( python_executable ) ] def ParseArguments(): parser = argparse.ArgumentParser() parser.add_argument( '--clang-completer', action = 'store_true', help = 'Build C-family semantic completion engine.') parser.add_argument( '--system-libclang', action = 'store_true', help = 'Use system libclang instead of downloading one ' 'from llvm.org. NOT RECOMMENDED OR SUPPORTED!' ) parser.add_argument( '--omnisharp-completer', action = 'store_true', help = 'Build C# semantic completion engine.' ) parser.add_argument( '--gocode-completer', action = 'store_true', help = 'Build Go semantic completion engine.' ) parser.add_argument( '--system-boost', action = 'store_true', help = 'Use the system boost instead of bundled one. ' 'NOT RECOMMENDED OR SUPPORTED!') args = parser.parse_args() if args.system_libclang and not args.clang_completer: sys.exit( "You can't pass --system-libclang without also passing " "--clang-completer as well." ) return args def GetCmakeArgs( parsed_args ): cmake_args = [] if parsed_args.clang_completer: cmake_args.append( '-DUSE_CLANG_COMPLETER=ON' ) if parsed_args.system_libclang: cmake_args.append( '-DUSE_SYSTEM_LIBCLANG=ON' ) if parsed_args.system_boost: cmake_args.append( '-DUSE_SYSTEM_BOOST=ON' ) extra_cmake_args = os.environ.get( 'EXTRA_CMAKE_ARGS', '' ) cmake_args.extend( extra_cmake_args.split() ) return cmake_args def RunYcmdTests( build_dir ): tests_dir = p.join( build_dir, 'ycm/tests' ) sh.cd( tests_dir ) new_env = os.environ.copy() new_env[ 'LD_LIBRARY_PATH' ] = DIR_OF_THIS_SCRIPT sh.Command( p.join( tests_dir, 'ycm_core_tests' ) )( _env = new_env, _out = sys.stdout ) def BuildYcmdLibs( cmake_args ): build_dir = unicode( sh.mktemp( '-d', '-t', 'ycm_build.XXXXXX' ) ).strip() try: full_cmake_args = [ '-G', 'Unix Makefiles' ] if OnMac(): full_cmake_args.extend( CustomPythonCmakeArgs() ) full_cmake_args.extend( cmake_args ) full_cmake_args.append( p.join( DIR_OF_THIS_SCRIPT, 'cpp' ) ) sh.cd( build_dir ) sh.cmake( *full_cmake_args, _out = sys.stdout ) build_target = ( 'ycm_support_libs' if 'YCM_TESTRUN' not in os.environ else 'ycm_core_tests' ) sh.make( '-j', NumCores(), build_target, _out = sys.stdout, _err = sys.stderr ) if 'YCM_TESTRUN' in os.environ: RunYcmdTests( build_dir ) finally: sh.cd( DIR_OF_THIS_SCRIPT ) sh.rm( '-rf', build_dir ) def BuildOmniSharp(): build_command = PathToFirstExistingExecutable( [ 'msbuild', 'msbuild.exe', 'xbuild' ] ) if not build_command: sys.exit( 'msbuild or xbuild is required to build Omnisharp' ) sh.cd( p.join( DIR_OF_THIS_SCRIPT, 'third_party/OmniSharpServer' ) ) sh.Command( build_command )( "/property:Configuration=Release", _out = sys.stdout ) def BuildGoCode(): if not find_executable( 'go' ): sys.exit( 'go is required to build gocode' ) sh.cd( p.join( DIR_OF_THIS_SCRIPT, 'third_party/gocode' ) ) sh.Command( 'go' )( 'build', _out = sys.stdout ) def ApplyWorkarounds(): # Some OSs define a 'make' ENV VAR and this confuses sh when we try to do # sh.make. See https://github.com/Valloric/YouCompleteMe/issues/1401 os.environ.pop('make', None) def Main(): ApplyWorkarounds() CheckDeps() args = ParseArguments() BuildYcmdLibs( GetCmakeArgs( args ) ) if args.omnisharp_completer: BuildOmniSharp() if args.gocode_completer: BuildGoCode() if __name__ == "__main__": Main()
gpl-3.0
malev/pomodoro-indicator
pomodoro/tests/pomodoro_state.py
2
1080
import unittest from pomodoro-indicator.pomodoro_state import PomodoroState class TestPomodoroState(unittest.TestCase): def setUp(self): self.state = PomodoroState() def test_has_all_the_methods(self): """There a list of methods it has to have but do nothing""" methods_list = ["enabled_buttons", "start", "next_state", "pause", "resume"] for method in methods_list: assert hasattr(self.state, method) def test_should_not_be_on_any_state(self): """The super class should not be on any singular state""" states = ["working", "resting", "paused", "waiting"] for state in states: method = getattr(self.state, state) self.assertFalse(method()) def test_current_state(self): """Every state should have a name and this method provides it""" self.state.name = "name" self.assertEqual("name", self.state.current_state()) def test_wont_work(self): self.assertFalse(True) if __name__ == '__main__': unittest.main()
gpl-3.0
snehasi/servo
components/style/properties/data.py
1
11812
# This Source Code Form is subject to the terms of the Mozilla Public # License, v. 2.0. If a copy of the MPL was not distributed with this # file, You can obtain one at http://mozilla.org/MPL/2.0/. import re PHYSICAL_SIDES = ["top", "left", "bottom", "right"] LOGICAL_SIDES = ["block-start", "block-end", "inline-start", "inline-end"] PHYSICAL_SIZES = ["width", "height"] LOGICAL_SIZES = ["block-size", "inline-size"] # bool is True when logical ALL_SIDES = [(side, False) for side in PHYSICAL_SIDES] + [(side, True) for side in LOGICAL_SIDES] ALL_SIZES = [(size, False) for size in PHYSICAL_SIZES] + [(size, True) for size in LOGICAL_SIZES] def maybe_moz_logical_alias(product, side, prop): if product == "gecko" and side[1]: axis, dir = side[0].split("-") if axis == "inline": return prop % dir return None def to_rust_ident(name): name = name.replace("-", "_") if name in ["static", "super", "box", "move"]: # Rust keywords name += "_" return name def to_camel_case(ident): return re.sub("(^|_|-)([a-z])", lambda m: m.group(2).upper(), ident.strip("_").strip("-")) class Keyword(object): def __init__(self, name, values, gecko_constant_prefix=None, gecko_enum_prefix=None, custom_consts=None, extra_gecko_values=None, extra_servo_values=None, gecko_strip_moz_prefix=True, gecko_inexhaustive=None): self.name = name self.values = values.split() if gecko_constant_prefix and gecko_enum_prefix: raise TypeError("Only one of gecko_constant_prefix and gecko_enum_prefix can be specified") self.gecko_constant_prefix = gecko_constant_prefix or \ "NS_STYLE_" + self.name.upper().replace("-", "_") self.gecko_enum_prefix = gecko_enum_prefix self.extra_gecko_values = (extra_gecko_values or "").split() self.extra_servo_values = (extra_servo_values or "").split() self.consts_map = {} if custom_consts is None else custom_consts self.gecko_strip_moz_prefix = gecko_strip_moz_prefix self.gecko_inexhaustive = gecko_inexhaustive or (gecko_enum_prefix is None) def gecko_values(self): return self.values + self.extra_gecko_values def servo_values(self): return self.values + self.extra_servo_values def values_for(self, product): if product == "gecko": return self.gecko_values() elif product == "servo": return self.servo_values() else: raise Exception("Bad product: " + product) def gecko_constant(self, value): moz_stripped = value.replace("-moz-", '') if self.gecko_strip_moz_prefix else value.replace("-moz-", 'moz-') mapped = self.consts_map.get(value) if self.gecko_enum_prefix: parts = moz_stripped.replace('-', '_').split('_') parts = mapped if mapped else [p.title() for p in parts] return self.gecko_enum_prefix + "::" + "".join(parts) else: suffix = mapped if mapped else moz_stripped.replace("-", "_") return self.gecko_constant_prefix + "_" + suffix.upper() def needs_cast(self): return self.gecko_enum_prefix is None def maybe_cast(self, type_str): return "as " + type_str if self.needs_cast() else "" def arg_to_bool(arg): if isinstance(arg, bool): return arg assert arg in ["True", "False"] return arg == "True" class Longhand(object): def __init__(self, style_struct, name, spec=None, animation_type=None, derived_from=None, keyword=None, predefined_type=None, custom_cascade=False, experimental=False, internal=False, need_clone=False, need_index=False, gecko_ffi_name=None, depend_on_viewport_size=False, allowed_in_keyframe_block=True, complex_color=False, cast_type='u8', has_uncacheable_values=False, logical=False, alias=None, extra_prefixes=None, boxed=False, creates_stacking_context=False, fixpos_cb=False, abspos_cb=False): self.name = name if not spec: raise TypeError("Spec should be specified for %s" % name) self.spec = spec self.keyword = keyword self.predefined_type = predefined_type self.ident = to_rust_ident(name) self.camel_case = to_camel_case(self.ident) self.style_struct = style_struct self.experimental = ("layout.%s.enabled" % name) if experimental else None self.custom_cascade = custom_cascade self.internal = internal self.need_index = need_index self.has_uncacheable_values = has_uncacheable_values self.gecko_ffi_name = gecko_ffi_name or "m" + self.camel_case self.depend_on_viewport_size = depend_on_viewport_size self.derived_from = (derived_from or "").split() self.complex_color = complex_color self.cast_type = cast_type self.logical = arg_to_bool(logical) self.alias = alias.split() if alias else [] self.extra_prefixes = extra_prefixes.split() if extra_prefixes else [] self.boxed = arg_to_bool(boxed) self.creates_stacking_context = arg_to_bool(creates_stacking_context) self.fixpos_cb = arg_to_bool(fixpos_cb) self.abspos_cb = arg_to_bool(abspos_cb) # https://drafts.csswg.org/css-animations/#keyframes # > The <declaration-list> inside of <keyframe-block> accepts any CSS property # > except those defined in this specification, # > but does accept the `animation-play-state` property and interprets it specially. self.allowed_in_keyframe_block = allowed_in_keyframe_block \ and allowed_in_keyframe_block != "False" # This is done like this since just a plain bool argument seemed like # really random. if animation_type is None: raise TypeError("animation_type should be specified for (" + name + ")") animation_types = ["none", "normal", "discrete"] if animation_type not in animation_types: raise TypeError("animation_type should be one of (" + str(animation_types) + ")") self.animation_type = animation_type self.animatable = animation_type != "none" if self.logical: # Logical properties don't animate separately self.animatable = False # NB: Animatable implies clone because a property animation requires a # copy of the computed value. # # See components/style/helpers/animated_properties.mako.rs. self.need_clone = need_clone or self.animatable class Shorthand(object): def __init__(self, name, sub_properties, spec=None, experimental=False, internal=False, allowed_in_keyframe_block=True, alias=None, extra_prefixes=None): self.name = name if not spec: raise TypeError("Spec should be specified for %s" % name) self.spec = spec self.ident = to_rust_ident(name) self.camel_case = to_camel_case(self.ident) self.derived_from = None self.experimental = ("layout.%s.enabled" % name) if experimental else None self.sub_properties = sub_properties self.internal = internal self.alias = alias.split() if alias else [] self.extra_prefixes = extra_prefixes.split() if extra_prefixes else [] # https://drafts.csswg.org/css-animations/#keyframes # > The <declaration-list> inside of <keyframe-block> accepts any CSS property # > except those defined in this specification, # > but does accept the `animation-play-state` property and interprets it specially. self.allowed_in_keyframe_block = allowed_in_keyframe_block \ and allowed_in_keyframe_block != "False" class Method(object): def __init__(self, name, return_type=None, arg_types=None, is_mut=False): self.name = name self.return_type = return_type self.arg_types = arg_types or [] self.is_mut = is_mut def arg_list(self): args = ["_: " + x for x in self.arg_types] args = ["&mut self" if self.is_mut else "&self"] + args return ", ".join(args) def signature(self): sig = "fn %s(%s)" % (self.name, self.arg_list()) if self.return_type: sig = sig + " -> " + self.return_type return sig def declare(self): return self.signature() + ";" def stub(self): return self.signature() + "{ unimplemented!() }" class StyleStruct(object): def __init__(self, name, inherited, gecko_name=None, additional_methods=None): self.gecko_struct_name = "Gecko" + name self.name = name self.name_lower = name.lower() self.ident = to_rust_ident(self.name_lower) self.longhands = [] self.inherited = inherited self.gecko_name = gecko_name or name self.gecko_ffi_name = "nsStyle" + self.gecko_name self.additional_methods = additional_methods or [] class PropertiesData(object): """ The `testing` parameter means that we're running tests. In this situation, the `product` value is ignored while choosing which shorthands and longhands to generate; and instead all properties for which code exists for either servo or stylo are generated. Note that we skip this behavior when the style crate is being built in gecko mode, because we need manual glue for such properties and we don't have it. """ def __init__(self, product, testing): self.product = product self.testing = testing and product != "gecko" self.style_structs = [] self.current_style_struct = None self.longhands = [] self.longhands_by_name = {} self.derived_longhands = {} self.shorthands = [] def new_style_struct(self, *args, **kwargs): style_struct = StyleStruct(*args, **kwargs) self.style_structs.append(style_struct) self.current_style_struct = style_struct def active_style_structs(self): return [s for s in self.style_structs if s.additional_methods or s.longhands] def add_prefixed_aliases(self, property): # FIXME Servo's DOM architecture doesn't support vendor-prefixed properties. # See servo/servo#14941. if self.product == "gecko": for prefix in property.extra_prefixes: property.alias.append('-%s-%s' % (prefix, property.name)) def declare_longhand(self, name, products="gecko servo", disable_when_testing=False, **kwargs): products = products.split() if self.product not in products and not (self.testing and not disable_when_testing): return longhand = Longhand(self.current_style_struct, name, **kwargs) self.add_prefixed_aliases(longhand) self.current_style_struct.longhands.append(longhand) self.longhands.append(longhand) self.longhands_by_name[name] = longhand for name in longhand.derived_from: self.derived_longhands.setdefault(name, []).append(longhand) return longhand def declare_shorthand(self, name, sub_properties, products="gecko servo", disable_when_testing=False, *args, **kwargs): products = products.split() if self.product not in products and not (self.testing and not disable_when_testing): return sub_properties = [self.longhands_by_name[s] for s in sub_properties] shorthand = Shorthand(name, sub_properties, *args, **kwargs) self.add_prefixed_aliases(shorthand) self.shorthands.append(shorthand) return shorthand
mpl-2.0
meiavy/python-weixin
lib/python2.7/site-packages/pip/commands/search.py
84
4717
import sys import textwrap import pkg_resources import pip.download from pip.basecommand import Command, SUCCESS from pip.util import get_terminal_size from pip.log import logger from pip.backwardcompat import xmlrpclib, reduce, cmp from pip.exceptions import CommandError from pip.status_codes import NO_MATCHES_FOUND from distutils.version import StrictVersion, LooseVersion class SearchCommand(Command): """Search for PyPI packages whose name or summary contains <query>.""" name = 'search' usage = """ %prog [options] <query>""" summary = 'Search PyPI for packages.' def __init__(self, *args, **kw): super(SearchCommand, self).__init__(*args, **kw) self.cmd_opts.add_option( '--index', dest='index', metavar='URL', default='https://pypi.python.org/pypi', help='Base URL of Python Package Index (default %default)') self.parser.insert_option_group(0, self.cmd_opts) def run(self, options, args): if not args: raise CommandError('Missing required argument (search query).') query = args index_url = options.index pypi_hits = self.search(query, index_url) hits = transform_hits(pypi_hits) terminal_width = None if sys.stdout.isatty(): terminal_width = get_terminal_size()[0] print_results(hits, terminal_width=terminal_width) if pypi_hits: return SUCCESS return NO_MATCHES_FOUND def search(self, query, index_url): pypi = xmlrpclib.ServerProxy(index_url) hits = pypi.search({'name': query, 'summary': query}, 'or') return hits def transform_hits(hits): """ The list from pypi is really a list of versions. We want a list of packages with the list of versions stored inline. This converts the list from pypi into one we can use. """ packages = {} for hit in hits: name = hit['name'] summary = hit['summary'] version = hit['version'] score = hit['_pypi_ordering'] if score is None: score = 0 if name not in packages.keys(): packages[name] = {'name': name, 'summary': summary, 'versions': [version], 'score': score} else: packages[name]['versions'].append(version) # if this is the highest version, replace summary and score if version == highest_version(packages[name]['versions']): packages[name]['summary'] = summary packages[name]['score'] = score # each record has a unique name now, so we will convert the dict into a list sorted by score package_list = sorted(packages.values(), key=lambda x: x['score'], reverse=True) return package_list def print_results(hits, name_column_width=25, terminal_width=None): installed_packages = [p.project_name for p in pkg_resources.working_set] for hit in hits: name = hit['name'] summary = hit['summary'] or '' if terminal_width is not None: # wrap and indent summary to fit terminal summary = textwrap.wrap(summary, terminal_width - name_column_width - 5) summary = ('\n' + ' ' * (name_column_width + 3)).join(summary) line = '%s - %s' % (name.ljust(name_column_width), summary) try: logger.notify(line) if name in installed_packages: dist = pkg_resources.get_distribution(name) logger.indent += 2 try: latest = highest_version(hit['versions']) if dist.version == latest: logger.notify('INSTALLED: %s (latest)' % dist.version) else: logger.notify('INSTALLED: %s' % dist.version) logger.notify('LATEST: %s' % latest) finally: logger.indent -= 2 except UnicodeEncodeError: pass def compare_versions(version1, version2): try: return cmp(StrictVersion(version1), StrictVersion(version2)) # in case of abnormal version number, fall back to LooseVersion except ValueError: pass try: return cmp(LooseVersion(version1), LooseVersion(version2)) except TypeError: # certain LooseVersion comparions raise due to unorderable types, # fallback to string comparison return cmp([str(v) for v in LooseVersion(version1).version], [str(v) for v in LooseVersion(version2).version]) def highest_version(versions): return reduce((lambda v1, v2: compare_versions(v1, v2) == 1 and v1 or v2), versions)
apache-2.0
babywolfh/iris-panel
iris/core/migrations/0006_copy_bak_back_to_nn.py
7
15478
# -*- coding: utf-8 -*- # This file is part of IRIS: Infrastructure and Release Information System # # Copyright (C) 2013-2015 Intel Corporation # # IRIS is free software; you can redistribute it and/or # modify it under the terms of the GNU General Public License # version 2.0 as published by the Free Software Foundation. #pylint: skip-file from south.utils import datetime_utils as datetime from south.db import db from south.v2 import DataMigration from django.db import models class Migration(DataMigration): def forwards(self, orm): "Write your forwards methods here." # Note: Don't use "from appname.models import ModelName". # Use orm.ModelName to refer to models in this application, # and orm['appname.ModelName'] for models in other applications. Package = orm['core.Package'] Backup = orm['core.PackageBackup'] for bak in Backup.objects.order_by('pid').all(): pack = Package.objects.get(name=bak.name) pack.gittree_set.add(bak.tid) def backwards(self, orm): "Write your backwards methods here." for pack in orm['core.Package'].objects.all(): pack.gittree_set.clean() models = { u'auth.group': { 'Meta': {'object_name': 'Group'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '80'}), 'permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': u"orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}) }, u'auth.permission': { 'Meta': {'ordering': "(u'content_type__app_label', u'content_type__model', u'codename')", 'unique_together': "((u'content_type', u'codename'),)", 'object_name': 'Permission'}, 'codename': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'content_type': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['contenttypes.ContentType']"}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '50'}) }, u'auth.user': { 'Meta': {'object_name': 'User'}, 'date_joined': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}), 'first_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'groups': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'related_name': "u'user_set'", 'blank': 'True', 'to': u"orm['auth.Group']"}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'is_staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'is_superuser': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'last_login': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'last_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'password': ('django.db.models.fields.CharField', [], {'max_length': '128'}), 'user_permissions': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'related_name': "u'user_set'", 'blank': 'True', 'to': u"orm['auth.Permission']"}), 'username': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '225'}) }, u'contenttypes.contenttype': { 'Meta': {'ordering': "('name',)", 'unique_together': "(('app_label', 'model'),)", 'object_name': 'ContentType', 'db_table': "'django_content_type'"}, 'app_label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'model': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}) }, 'core.domain': { 'Meta': {'object_name': 'Domain'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '255'}) }, 'core.domainrole': { 'Meta': {'object_name': 'DomainRole', '_ormbases': [u'auth.Group']}, 'domain': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'role_set'", 'to': "orm['core.Domain']"}), u'group_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': u"orm['auth.Group']", 'unique': 'True', 'primary_key': 'True'}), 'role': ('django.db.models.fields.CharField', [], {'max_length': '15', 'db_index': 'True'}) }, 'core.gittree': { 'Meta': {'object_name': 'GitTree'}, 'gitpath': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '255'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'licenses': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['core.License']", 'symmetrical': 'False'}), 'packages': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['core.Package']", 'symmetrical': 'False'}), 'subdomain': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['core.SubDomain']"}) }, 'core.gittreerole': { 'Meta': {'object_name': 'GitTreeRole', '_ormbases': [u'auth.Group']}, 'gittree': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'role_set'", 'to': "orm['core.GitTree']"}), u'group_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': u"orm['auth.Group']", 'unique': 'True', 'primary_key': 'True'}), 'role': ('django.db.models.fields.CharField', [], {'max_length': '15', 'db_index': 'True'}) }, 'core.image': { 'Meta': {'object_name': 'Image'}, 'arch': ('django.db.models.fields.TextField', [], {}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.TextField', [], {}), 'product': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['core.Product']"}), 'target': ('django.db.models.fields.TextField', [], {}) }, 'core.imagebuild': { 'Meta': {'object_name': 'ImageBuild'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'image': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['core.Image']"}), 'log': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['core.Log']", 'unique': 'True', 'null': 'True', 'on_delete': 'models.SET_NULL', 'blank': 'True'}), 'name': ('django.db.models.fields.TextField', [], {}), 'status': ('django.db.models.fields.CharField', [], {'max_length': '8'}) }, 'core.license': { 'Meta': {'object_name': 'License'}, 'fullname': ('django.db.models.fields.CharField', [], {'max_length': '255', 'db_index': 'True'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'shortname': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '255'}), 'text': ('django.db.models.fields.TextField', [], {}) }, 'core.log': { 'Meta': {'object_name': 'Log'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'url': ('django.db.models.fields.URLField', [], {'max_length': '200'}) }, 'core.package': { 'Meta': {'object_name': 'Package'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '255'}) }, 'core.packagebackup': { 'Meta': {'object_name': 'PackageBackup'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'isdel': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '255', 'db_index': 'True'}), 'pid': ('django.db.models.fields.IntegerField', [], {}), 'tid': ('django.db.models.fields.IntegerField', [], {}) }, 'core.packagebuild': { 'Meta': {'object_name': 'PackageBuild'}, 'arch': ('django.db.models.fields.TextField', [], {}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'log': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['core.Log']", 'unique': 'True', 'null': 'True', 'on_delete': 'models.SET_NULL', 'blank': 'True'}), 'package': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['core.Package']"}), 'status': ('django.db.models.fields.CharField', [], {'max_length': '8'}), 'target': ('django.db.models.fields.TextField', [], {}) }, 'core.product': { 'Meta': {'object_name': 'Product'}, 'description': ('django.db.models.fields.TextField', [], {}), 'gittrees': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['core.GitTree']", 'symmetrical': 'False'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '255', 'db_index': 'True'}) }, 'core.productrole': { 'Meta': {'object_name': 'ProductRole', '_ormbases': [u'auth.Group']}, u'group_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': u"orm['auth.Group']", 'unique': 'True', 'primary_key': 'True'}), 'product': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['core.Product']"}), 'role': ('django.db.models.fields.CharField', [], {'max_length': '15', 'db_index': 'True'}) }, 'core.subdomain': { 'Meta': {'unique_together': "(('name', 'domain'),)", 'object_name': 'SubDomain'}, 'domain': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['core.Domain']"}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '255', 'db_index': 'True'}) }, 'core.subdomainrole': { 'Meta': {'object_name': 'SubDomainRole', '_ormbases': [u'auth.Group']}, u'group_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': u"orm['auth.Group']", 'unique': 'True', 'primary_key': 'True'}), 'role': ('django.db.models.fields.CharField', [], {'max_length': '15', 'db_index': 'True'}), 'subdomain': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['core.SubDomain']"}) }, 'core.submission': { 'Meta': {'object_name': 'Submission'}, 'comment': ('django.db.models.fields.TextField', [], {'blank': 'True'}), 'commit': ('django.db.models.fields.CharField', [], {'max_length': '40'}), 'created': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'blank': 'True'}), 'gittree': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['core.GitTree']", 'symmetrical': 'False', 'blank': 'True'}), 'ibuilds': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['core.ImageBuild']", 'symmetrical': 'False', 'blank': 'True'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '80', 'db_index': 'True'}), 'pbuilds': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['core.PackageBuild']", 'symmetrical': 'False', 'blank': 'True'}), 'product': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['core.Product']", 'null': 'True', 'on_delete': 'models.SET_NULL', 'blank': 'True'}), 'status': ('django.db.models.fields.CharField', [], {'max_length': '16', 'db_index': 'True'}), 'submitters': ('django.db.models.fields.related.ManyToManyField', [], {'to': u"orm['auth.User']", 'symmetrical': 'False'}), 'testresults': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['core.TestResult']", 'symmetrical': 'False', 'blank': 'True'}), 'updated': ('django.db.models.fields.DateTimeField', [], {'auto_now': 'True', 'blank': 'True'}) }, 'core.submissiongroup': { 'Meta': {'object_name': 'SubmissionGroup'}, 'author': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['auth.User']"}), 'created': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'blank': 'True'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '80', 'db_index': 'True'}), 'product': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['core.Product']", 'null': 'True', 'on_delete': 'models.SET_NULL', 'blank': 'True'}), 'status': ('django.db.models.fields.CharField', [], {'max_length': '16'}), 'submissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['core.Submission']", 'symmetrical': 'False'}), 'updated': ('django.db.models.fields.DateTimeField', [], {'auto_now': 'True', 'blank': 'True'}) }, 'core.testresult': { 'Meta': {'object_name': 'TestResult'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'log': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['core.Log']", 'unique': 'True', 'null': 'True', 'on_delete': 'models.SET_NULL', 'blank': 'True'}), 'name': ('django.db.models.fields.TextField', [], {}), 'status': ('django.db.models.fields.CharField', [], {'max_length': '16'}) }, 'core.userparty': { 'Meta': {'object_name': 'UserParty', '_ormbases': [u'auth.Group']}, u'group_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': u"orm['auth.Group']", 'unique': 'True', 'primary_key': 'True'}), 'party': ('django.db.models.fields.CharField', [], {'max_length': '15'}) }, 'core.userprofile': { 'Meta': {'object_name': 'UserProfile'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'user': ('django.db.models.fields.related.OneToOneField', [], {'to': u"orm['auth.User']", 'unique': 'True'}) } } complete_apps = ['core'] symmetrical = True
gpl-2.0
lovesnow/flexx
flexx/webruntime/chromeapp.py
12
2788
""" Web runtime based on a chrome app In contrast to running in the chrome browser, this makes the app have more the look and feel of a desktop app. """ import os import sys from .common import DesktopRuntime # todo: icon, sizing, etc. def get_chrome_exe(): """ Get the path of the Chrome executable If the path could not be found, returns None. """ paths = [] # Collect possible locations if sys.platform.startswith('win'): paths.append("C:\\Program Files\\Google\\Chrome\\Application\\chrome.exe") paths.append("C:\\Program Files (x86)\\Google\\Chrome\\Application\\chrome.exe") paths.append(os.path.expanduser("~\\AppData\\Local\\Google\\Chrome\\chrome.exe")) paths.append(os.path.expanduser("~\\Local Settings\\Application Data\\Google\\Chrome\\chrome.exe")) # xp elif sys.platform.startswith('linux'): paths.append('/usr/bin/google-chrome-stable') paths.append('/usr/bin/google-chrome-beta') paths.append('/usr/bin/google-chrome-dev') elif sys.platform.startswith('darwin'): paths.append('/Applications/Chrome.app') # Try location until we find one that exists for path in paths: if os.path.isfile(path): return path else: return None def get_chromium_exe(): """ Get the path of the Chromium executable If the path could not be found, returns None. """ paths = [] # Collect possible locations if sys.platform.startswith('win'): paths.append("C:\\Program Files\\Chromium\\Application\\chrome.exe") paths.append("C:\\Program Files (x86)\\Chromium\\Application\\chrome.exe") paths.append(os.path.expanduser("~\\AppData\\Local\\Chromium\\chrome.exe")) paths.append(os.path.expanduser("~\\Local Settings\\Application Data\\Chromium\\chrome.exe")) # xp elif sys.platform.startswith('linux'): paths.append('/usr/bin/chromium') elif sys.platform.startswith('darwin'): paths.append('/Applications/Chromium.app') # Try location until we find one that exists for path in paths: if os.path.isfile(path): return path else: return None class ChromeAppRuntime(DesktopRuntime): """ Desktop runtime based on chrome app. Requires the Chrome or Chromium browser to be installed. Note: icon, sizing and title is not yet supported. """ def _launch(self): # Get chrome executable exe = get_chrome_exe() or get_chromium_exe() if exe is None: raise RuntimeError('Chrome or Chromium browser was not detected.') # Launch url url = self._kwargs['url'] self._start_subprocess([exe, '--incognito', '--app=%s' % url])
bsd-2-clause
vcatechnology/cmake-boilerplate
cmake/pygh/__init__.py
1
25114
#!/usr/bin/env python # -*- coding: utf-8 -*- import re import os import sys import json import errno import platform import fileinput import subprocess from datetime import datetime, timezone try: import requests except ImportError: raise ImportError( 'Failed to import \'requests\', run \'pip install requests\'') try: import pystache except ImportError: raise ImportError( 'Failed to import \'pystache\', run \'pip install pystache\'') class ReleaseError(Exception): def __init__(self, message): self.message = message def __str__(self): return self.message class ExecuteCommandError(Exception): def __init__(self, message, cmd, code, out, err): self.message = message self.cmd = cmd self.code = code self.out = out self.err = err def __str__(self): return self.message class EmptyLogger(object): '''Provides an implementation of an empty logging function''' def debug(self, *k, **kw): pass def info(self, *k, **kw): pass def warn(self, *k, **kw): pass def error(self, *k, **kw): pass def critical(self, *k, **kw): pass def setLevel(self, *k, **kw): pass class Version(object): '''Represents a version number''' def __init__(self, *k, **kw): ''' A version number can be instantiate with: - a dot-separated string - Version('1.2.3') - an iterable - Version([1, 2, 3]) - seperate arguments - `Version(1, 2, 3)` - another version class - `Version(Version(1, 2, 3))` - a dictionary - `Version({'minor':2,'major':1,'patch':3})` - keywords - `Version(minor = 2,major = 1, patch = 3)` ''' try: version = (k[0].major, k[0].minor, k[0].patch) except (AttributeError, TypeError): try: version = (kw['major'], kw['minor'], kw['patch']) except (KeyError, TypeError): try: version = (k[0]['major'], k[0]['minor'], k[0]['patch']) except (KeyError, TypeError): if isinstance(k[0], str): version = k[0].split('.') else: try: version = (k[0][0], k[0][1], k[0][2]) except (IndexError, TypeError): version = k self.major = int(version[0]) self.minor = int(version[1]) self.patch = int(version[2]) def bump(self, category): ''' Bumps the version number depending on the category ''' setattr(self, category, getattr(self, category) + 1) if category == 'major': self.minor = 0 self.patch = 0 elif category == 'minor': self.patch = 0 def __gt__(self, other): return tuple(self) > tuple(other) def __ge__(self, other): return tuple(self) >= tuple(other) def __lt__(self, other): return tuple(self) < tuple(other) def __le__(self, other): return tuple(self) <= tuple(other) def __eq__(self, other): return tuple(self) == tuple(other) def __ne__(self, other): return tuple(self) != tuple(other) def __getitem__(self, index): ''' Allows iteration of the version number ''' if index == 0: return self.major elif index == 1: return self.minor elif index == 2: return self.patch else: raise IndexError('version index out of range') def __repr__(self): ''' Provides a dot-separated string representation of the version number ''' return '%i.%i.%i' % (self.major, self.minor, self.patch) class GitVersion(Version): '''A git repository version number''' def __init__(self, *k, **kw): ''' A git version number can be instantiate with: - a dot-separated string - Version('1.2.3.ef3aa43d-dirty') - an iterable - Version([1, 2, 3, 'ef3aa43d', True]) - seperate arguments - `Version(1, 2, 3, 'ef3aa43d', True)` - another version class - `Version(Version(1, 2, 3, 'ef3aa43d', True))` - a dictionary - `Version({'minor':2,'major':1,'patch':3, 'commit': 'ef3aa43d', 'dirty', True})` - keywords - `Version(minor = 2,major = 1, patch = 3, commit ='ef3aa43d', dirty =True)` ''' super(GitVersion, self).__init__(*k, **kw) try: version = (k[0].commit, k[0].dirty) except (AttributeError, TypeError): try: version = (kw['commit'], kw['dirty']) except (KeyError, TypeError): try: version = (k[0]['commit'], k[0]['dirty']) except (KeyError, TypeError): if isinstance(k[0], str): version = k[0].split('.')[3] else: try: version = (k[0][3], k[0][4]) except (IndexError, TypeError): version = k[3:] self.commit = str(version[0]) try: self.dirty = bool(version[1]) except: try: split = self.commit.split('-') self.dirty = (split[1] == 'dirty') self.commit = split[0] except: self.dirty = False try: int(self.commit, 16) except ValueError: raise ValueError('The git commit string is not hexidecimal: %s' % self.commit) def __repr__(self): ''' Provides a dot-separated string representation of the version number ''' string = '%s.%s' % (super(GitVersion, self).__repr__(), self.commit[:8]) if self.dirty: string += '-dirty' return string def find_exe_in_path(filename, path=None): ''' Finds an executable in the PATH environment variable ''' if platform.system() == 'Windows': filename += '.exe' if path is None: path = os.environ.get('PATH', '') if type(path) is type(''): pathlist = path.split(os.pathsep) return list(filter(os.path.exists, map(lambda dir, filename=filename: os.path.join(dir, filename), pathlist))) def execute_command(cmd, error_message='Failed to run external program', expected=0, cwd=os.getcwd()): p = subprocess.Popen(cmd, stdout=subprocess.PIPE, stderr=subprocess.PIPE, universal_newlines=True, cwd=cwd) (out, err) = p.communicate() if expected != None and p.returncode != expected: raise ExecuteCommandError(error_message, cmd, p.returncode, out, err) return (p.returncode, out, err) def close_milestone(number, repo, token, logger=EmptyLogger()): logger.debug('Closing milestone #%d for %s' % (number, repo)) number = int(number) r = requests.patch('https://api.github.com/repos/%s/milestones/%d' % (repo, number), params={ 'access_token': token, }, json={ 'state': 'closed', }) if r.status_code != 200: json = r.json() message = json['message'] errors = json.get('errors', []) for e in errors: message += '\n - %s: %s: %s' % (e.get('resource', 'unknown'), e.get('field', 'unknown'), e.get('code', 'unknown')) raise ReleaseError('Failed to close github milestone #%d: %s' % (number, message)) logger.info('Closed milestone #%d' % number) return r.json() def get_milestones(repo, token, logger=EmptyLogger()): logger.debug('Retrieving milestones for %s' % repo) r = requests.get('https://api.github.com/repos/%s/milestones' % repo, params={ 'access_token': token, }) if r.status_code != 200: raise ReleaseError('Failed to retrieve github milestones from %s: %s' % (repo, r.json()['message'])) return r.json() def get_git_tag_version(path, git_executable=find_exe_in_path('git'), logger=EmptyLogger()): if isinstance(git_executable, list): git_executable = git_executable[0] logger.debug('Getting latest git tag version') # Get the head commit cmd = [git_executable, 'rev-parse', 'HEAD'] _, out, _ = execute_command(cmd, 'Failed to get HEAD revision of repository', cwd=path) commit = out.split('\n')[0].strip() if commit == 'HEAD' or not commit: commit = '0000000000000000000000000000000000000000' # Check if dirty dirty = False cmd = [git_executable, 'diff-index', '--name-only', 'HEAD'] if execute_command( cmd, 'Failed to check if the project had local modifications', cwd=path)[1]: dirty = True cmd = [git_executable, 'status', '--porcelain'] if '?? ' in execute_command( cmd, 'Failed to check if the project had local modifications', cwd=path)[1]: dirty = True # Find the latest tag cmd = [git_executable, 'describe', '--match=v[0-9]*', 'HEAD'] code, out, _ = execute_command(cmd, expected=None, cwd=path) if code: return GitVersion(0, 0, 0, commit, dirty) # Parse the tag re_tag = re.compile('^v([0-9]+)\.([0-9]+)\.([0-9]+)(-[0-9]+-g[a-f0-9]+)?') matches = re_tag.match(out) major = int(matches.group(1)) minor = int(matches.group(2)) revision = int(matches.group(3)) version = GitVersion(major, minor, revision, commit, dirty) logger.info('Latest git tag version %s' % version) return version re_remote_fetch_url = re.compile( r'Fetch URL: (?:(?:(git)(?:@))|(?:(https)(?:://)))([^:/]+)[:/]([^/]+/[^.]+)(?:\.git)?') def get_repo(path=os.getcwd(), git_executable=find_exe_in_path('git')): if isinstance(git_executable, list): git_executable = git_executable[0] cmd = [git_executable, 'remote', 'show', '-n', 'origin'] code, out, err = execute_command( cmd, 'Failed to get repository remote information', cwd=path) match = re_remote_fetch_url.search(out) if not match: raise ExecuteCommandError('Failed to match fetch url', cmd, code, out, err) protocol = match.group(1) or match.group(2) server = match.group(3) if server != 'github.com': raise ExecuteCommandError('Repository is not from github', cmd, code, out, err) repo = match.group(4) return repo def get_git_version(git_executable=find_exe_in_path('git'), logger=EmptyLogger()): if isinstance(git_executable, list): git_executable = git_executable[0] logger.debug('Getting git version') _, out, _ = execute_command([git_executable, '--version']) git_version = Version(out.replace('git version ', '')) logger.debug('Using git %s' % git_version) return git_version changelog_template = \ '## [v{{version.to}}](https://github.com/{{repo}}/tree/v{{version.to}}) ({{date}})\n' \ '{{#version.from}}' \ '[Full Changelog](https://github.com/{{repo}}/compare/v{{version.from}}...v{{version.to}})' \ '{{/version.from}}' \ '{{#milestone}}' \ '{{#version.from}} {{/version.from}}' \ '[Milestone]({{html_url}})' \ '{{/milestone}}\n' \ '\n' \ '{{description}}\n' \ '\n' \ '**Closed issues:**\n' \ '{{#issues}}\n' \ '\n' \ ' - {{title}} [\#{{number}}]({{html_url}})\n' \ '{{/issues}}\n' \ '{{^issues}}\n' \ '\n' \ '_None_\n' \ '{{/issues}}\n' \ '\n' \ '**Merged pull requests:**\n' \ '{{#pullrequests}}\n' \ '\n' \ ' - {{title}} [\#{{number}}]({{pull_request.html_url}})\n' \ '{{/pullrequests}}\n' \ '{{^pullrequests}}\n' \ '\n' \ '_None_\n' \ '{{/pullrequests}}\n' def get_closed_issues(repo, token=os.environ.get('GITHUB_TOKEN', None), since=None, logger=EmptyLogger()): logger.debug('Getting issues for %s' % (repo)) if not token: raise ReleaseError('Must provide a valid GitHub API token') issues = [] params = {'state': 'closed', 'sort': 'asc', 'access_token': token, } if since: since = since.astimezone(timezone.utc) params['since'] = since.isoformat()[:19] + 'Z' r = requests.get('https://api.github.com/repos/%s/issues' % repo, params=params) if r.status_code != 200: raise ReleaseError('Failed to retrieve github issues from %s: %s' % (repo, r.json()['message'])) issues = r.json() logger.debug('Retrieved %i closed issues for %s' % (len(issues), repo)) return issues def create_changelog(current_version, previous_version, repo, milestone=None, token=os.environ.get('GITHUB_TOKEN', None), description=None, since=None, date=datetime.utcnow(), template=changelog_template, logger=EmptyLogger()): logger.debug('Creating changelog for %s from %s' % (current_version, repo)) description = description or 'The v%s release of %s' % (current_version, repo.split('/')[1]) issues = get_closed_issues(repo=repo, token=token, since=since, logger=logger) if milestone: milestone[ 'html_url'] = 'https://github.com/%s/issues?q=milestone%%3Av%s+is%%3Aall' % ( repo, current_version) data = { 'version': { 'from': str(previous_version) if previous_version > (0, 0, 0) else None, 'to': str(current_version), }, 'milestone': milestone, 'date': date.isoformat()[:10], 'repo': repo, 'description': description, 'issues': [i for i in issues if not i.get('pull_request', None)], 'pullrequests': [i for i in issues if i.get('pull_request', None)], } renderer = pystache.Renderer() parsed = pystache.parse(template) changelog = renderer.render(parsed, data) logger.info('Rendered changelog') return changelog def write_version(path, version, logger=EmptyLogger()): if not isinstance(version, Version): raise ValueError('must provide a version class') version = Version(version) with open(path, 'w') as f: f.write('%s' % version) logger.info('Wrote %s' % os.path.basename(path)) def write_changelog(path, changelog, logger=EmptyLogger()): try: for line in fileinput.input(path, inplace=True): sys.stdout.write(line) if line.startswith('# Changelog'): print() sys.stdout.write(changelog) logger.info('Updated %s' % os.path.basename(path)) except EnvironmentError as e: if e.errno == errno.ENOENT: with open(path, 'w') as f: f.write('# Changelog\n\n') f.write(changelog) logger.info('Created %s' % os.path.basename(path)) else: raise def get_git_root(path, git_executable=find_exe_in_path('git')): abspath = os.path.abspath(path) if os.path.isfile(abspath): abspath = os.path.dirname(abspath) cmd = [git_executable, 'rev-parse', '--show-toplevel'] _, out, _ = execute_command(cmd, 'Failed to find root of repository', cwd=abspath) return out.strip() def commit_file(path, message, git_executable=find_exe_in_path('git'), logger=EmptyLogger()): if isinstance(git_executable, list): git_executable = git_executable[0] logger.debug('Commiting %s' % path) cwd = get_git_root(path, git_executable=git_executable) path = os.path.relpath(path, cwd) cmd = [git_executable, 'add', path] execute_command(cmd, 'Failed to add file %s' % path, cwd=cwd) cmd = [git_executable, 'commit', '-m', message] execute_command(cmd, 'Failed to commit file %s' % path, cwd=cwd) logger.info('Committed %s' % path) def get_tag_date(tag, path=os.getcwd(), git_executable=find_exe_in_path('git')): if isinstance(git_executable, list): git_executable = git_executable[0] cwd = get_git_root(path, git_executable=git_executable) cmd = [git_executable, 'log', '-1', '--format=%ai', tag] _, out, _ = execute_command(cmd, 'Failed to get tag date: %s' % tag, cwd=cwd) out = out.strip() return datetime.strptime(out, '%Y-%m-%d %H:%M:%S %z') def create_git_version_tag(version, message=None, path=os.getcwd(), git_executable=find_exe_in_path('git'), logger=EmptyLogger()): if isinstance(git_executable, list): git_executable = git_executable[0] if not isinstance(version, Version): raise ValueError('must provide a version class') version = Version(version) logger.debug('Tagging %s' % version) message = message or 'The v%s release of the project' % version cwd = get_git_root(path, git_executable=git_executable) cmd = [git_executable, 'tag', '-a', 'v%s' % version, '-m', message] execute_command(cmd, 'Failed to create version tag %s' % version, cwd=cwd) logger.info('Tagged %s' % version) def create_release(repo, version, description, token=os.environ.get('GITHUB_TOKEN', None), files=[], path=os.getcwd(), git_executable=find_exe_in_path('git'), logger=EmptyLogger()): if isinstance(git_executable, list): git_executable = git_executable[0] if not isinstance(version, Version): raise ValueError('must provide a version class') logger.debug('Creating github release %s' % version) r = requests.post('https://api.github.com/repos/%s/releases' % repo, params={ 'access_token': token, }, json={ 'tag_name': 'v%s' % version, 'name': str(version), 'body': description, }) if r.status_code != 201: json = r.json() message = json['message'] errors = json.get('errors', []) for e in errors: message += '\n - %s: %s: %s' % (e.get('resource', 'unknown'), e.get('field', 'unknown'), e.get('code', 'unknown')) raise ReleaseError('Failed to create github release %s: %s' % (repo, message)) logger.info('Created GitHub release') def release(category='patch', path=os.getcwd(), git_executable=find_exe_in_path('git'), token=os.environ.get('GITHUB_TOKEN', None), repo=None, date=datetime.utcnow(), description=None, changelog='CHANGELOG.md', version='VERSION', template=changelog_template, logger=EmptyLogger(), hooks={}): ''' Performs the release of a repository on GitHub. ''' if isinstance(git_executable, list): git_executable = git_executable[0] logger.debug('Starting %r release' % category) git_version = get_git_version(git_executable=git_executable, logger=logger) if git_version < (1, 0, 0): raise ReleaseError('The version of git is too old %s' % git_version) previous_version = get_git_tag_version(path=path, git_executable=git_executable, logger=logger) if previous_version.dirty: raise ReleaseError( 'Cannot release a dirty repository. Make sure all files are committed') current_version = Version(previous_version) previous_version = Version(current_version) current_version.bump(category) logger.debug('Previous version %r' % previous_version) logger.debug('Bumped version %r' % current_version) repo = repo or get_repo(path=path, git_executable=git_executable) description = description or 'The v%s release of %s' % (current_version, repo.split('/')[1]) milestones = get_milestones(repo=repo, token=token, logger=logger) try: milestone = [ m for m in milestones if m['title'] == ('v%s' % current_version) and m['state'] == 'open' ][0] open_issues = milestone['open_issues'] if open_issues: raise ReleaseError('The v%s milestone has %d open issues' % (current_version, open_issues)) except IndexError: milestone = None try: previous_date = get_tag_date('v%s' % previous_version, path=path, git_executable=git_executable) except ExecuteCommandError: previous_date = None changelog_data = create_changelog(description=description, repo=repo, date=date, token=token, current_version=current_version, previous_version=previous_version, template=template, since=previous_date, logger=logger, milestone=milestone) changelog_data = hooks.get('changelog', lambda d: d)(changelog_data) write_changelog(path=os.path.join(path, changelog), changelog=changelog_data, logger=logger) commit_file(changelog, 'Updated changelog for v%s' % current_version, git_executable=git_executable, logger=logger) write_version(path=os.path.join(path, version), version=current_version, logger=logger) commit_file(version, 'Updated version to v%s' % current_version, git_executable=git_executable, logger=logger) create_git_version_tag(current_version, message=description, path=path, git_executable=git_executable, logger=logger) logger.debug('Pushing branch to remote') cwd = get_git_root(path, git_executable=git_executable) cmd = [git_executable, 'push'] execute_command(cmd, 'Failed to push to remote', cwd=cwd) logger.info('Pushed branch to remote') logger.debug('Pushing tags to remote') cwd = get_git_root(path, git_executable=git_executable) cmd = [git_executable, 'push', '--tags'] execute_command(cmd, 'Failed to push tags to remote', cwd=cwd) logger.info('Pushed tags to remote') files = [] create_release(path=path, version=current_version, description=changelog_data, git_executable=git_executable, repo=repo, logger=logger, files=files, token=token) if milestone: close_milestone(number=milestone['number'], repo=repo, token=token, logger=logger) logger.info('Released %s' % current_version)
bsd-3-clause
rynomad/SFCCW2
server/express/node_modules/npm/node_modules/node-gyp/gyp/test/lib/TestGyp.py
46
37947
# Copyright (c) 2012 Google Inc. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. """ TestGyp.py: a testing framework for GYP integration tests. """ import os import re import shutil import stat import subprocess import sys import tempfile import TestCommon from TestCommon import __all__ __all__.extend([ 'TestGyp', ]) def remove_debug_line_numbers(contents): """Function to remove the line numbers from the debug output of gyp and thus remove the exremem fragility of the stdout comparison tests. """ lines = contents.splitlines() # split each line on ":" lines = [l.split(":", 3) for l in lines] # join each line back together while ignoring the # 3rd column which is the line number lines = [len(l) > 3 and ":".join(l[3:]) or l for l in lines] return "\n".join(lines) def match_modulo_line_numbers(contents_a, contents_b): """File contents matcher that ignores line numbers.""" contents_a = remove_debug_line_numbers(contents_a) contents_b = remove_debug_line_numbers(contents_b) return TestCommon.match_exact(contents_a, contents_b) class TestGypBase(TestCommon.TestCommon): """ Class for controlling end-to-end tests of gyp generators. Instantiating this class will create a temporary directory and arrange for its destruction (via the TestCmd superclass) and copy all of the non-gyptest files in the directory hierarchy of the executing script. The default behavior is to test the 'gyp' or 'gyp.bat' file in the current directory. An alternative may be specified explicitly on instantiation, or by setting the TESTGYP_GYP environment variable. This class should be subclassed for each supported gyp generator (format). Various abstract methods below define calling signatures used by the test scripts to invoke builds on the generated build configuration and to run executables generated by those builds. """ build_tool = None build_tool_list = [] _exe = TestCommon.exe_suffix _obj = TestCommon.obj_suffix shobj_ = TestCommon.shobj_prefix _shobj = TestCommon.shobj_suffix lib_ = TestCommon.lib_prefix _lib = TestCommon.lib_suffix dll_ = TestCommon.dll_prefix _dll = TestCommon.dll_suffix # Constants to represent different targets. ALL = '__all__' DEFAULT = '__default__' # Constants for different target types. EXECUTABLE = '__executable__' STATIC_LIB = '__static_lib__' SHARED_LIB = '__shared_lib__' def __init__(self, gyp=None, *args, **kw): self.origin_cwd = os.path.abspath(os.path.dirname(sys.argv[0])) self.extra_args = sys.argv[1:] if not gyp: gyp = os.environ.get('TESTGYP_GYP') if not gyp: if sys.platform == 'win32': gyp = 'gyp.bat' else: gyp = 'gyp' self.gyp = os.path.abspath(gyp) self.initialize_build_tool() kw.setdefault('match', TestCommon.match_exact) # Put test output in out/testworkarea by default. # Use temporary names so there are no collisions. workdir = os.path.join('out', kw.get('workdir', 'testworkarea')) # Create work area if it doesn't already exist. if not os.path.isdir(workdir): os.makedirs(workdir) kw['workdir'] = tempfile.mktemp(prefix='testgyp.', dir=workdir) formats = kw.pop('formats', []) super(TestGypBase, self).__init__(*args, **kw) excluded_formats = set([f for f in formats if f[0] == '!']) included_formats = set(formats) - excluded_formats if ('!'+self.format in excluded_formats or included_formats and self.format not in included_formats): msg = 'Invalid test for %r format; skipping test.\n' self.skip_test(msg % self.format) self.copy_test_configuration(self.origin_cwd, self.workdir) self.set_configuration(None) # Set $HOME so that gyp doesn't read the user's actual # ~/.gyp/include.gypi file, which may contain variables # and other settings that would change the output. os.environ['HOME'] = self.workpath() # Clear $GYP_DEFINES for the same reason. if 'GYP_DEFINES' in os.environ: del os.environ['GYP_DEFINES'] def built_file_must_exist(self, name, type=None, **kw): """ Fails the test if the specified built file name does not exist. """ return self.must_exist(self.built_file_path(name, type, **kw)) def built_file_must_not_exist(self, name, type=None, **kw): """ Fails the test if the specified built file name exists. """ return self.must_not_exist(self.built_file_path(name, type, **kw)) def built_file_must_match(self, name, contents, **kw): """ Fails the test if the contents of the specified built file name do not match the specified contents. """ return self.must_match(self.built_file_path(name, **kw), contents) def built_file_must_not_match(self, name, contents, **kw): """ Fails the test if the contents of the specified built file name match the specified contents. """ return self.must_not_match(self.built_file_path(name, **kw), contents) def copy_test_configuration(self, source_dir, dest_dir): """ Copies the test configuration from the specified source_dir (the directory in which the test script lives) to the specified dest_dir (a temporary working directory). This ignores all files and directories that begin with the string 'gyptest', and all '.svn' subdirectories. """ for root, dirs, files in os.walk(source_dir): if '.svn' in dirs: dirs.remove('.svn') dirs = [ d for d in dirs if not d.startswith('gyptest') ] files = [ f for f in files if not f.startswith('gyptest') ] for dirname in dirs: source = os.path.join(root, dirname) destination = source.replace(source_dir, dest_dir) os.mkdir(destination) if sys.platform != 'win32': shutil.copystat(source, destination) for filename in files: source = os.path.join(root, filename) destination = source.replace(source_dir, dest_dir) shutil.copy2(source, destination) def initialize_build_tool(self): """ Initializes the .build_tool attribute. Searches the .build_tool_list for an executable name on the user's $PATH. The first tool on the list is used as-is if nothing is found on the current $PATH. """ for build_tool in self.build_tool_list: if not build_tool: continue if os.path.isabs(build_tool): self.build_tool = build_tool return build_tool = self.where_is(build_tool) if build_tool: self.build_tool = build_tool return if self.build_tool_list: self.build_tool = self.build_tool_list[0] def relocate(self, source, destination): """ Renames (relocates) the specified source (usually a directory) to the specified destination, creating the destination directory first if necessary. Note: Don't use this as a generic "rename" operation. In the future, "relocating" parts of a GYP tree may affect the state of the test to modify the behavior of later method calls. """ destination_dir = os.path.dirname(destination) if not os.path.exists(destination_dir): self.subdir(destination_dir) os.rename(source, destination) def report_not_up_to_date(self): """ Reports that a build is not up-to-date. This provides common reporting for formats that have complicated conditions for checking whether a build is up-to-date. Formats that expect exact output from the command (make, scons) can just set stdout= when they call the run_build() method. """ print "Build is not up-to-date:" print self.banner('STDOUT ') print self.stdout() stderr = self.stderr() if stderr: print self.banner('STDERR ') print stderr def run_gyp(self, gyp_file, *args, **kw): """ Runs gyp against the specified gyp_file with the specified args. """ # When running gyp, and comparing its output we use a comparitor # that ignores the line numbers that gyp logs in its debug output. if kw.pop('ignore_line_numbers', False): kw.setdefault('match', match_modulo_line_numbers) # TODO: --depth=. works around Chromium-specific tree climbing. depth = kw.pop('depth', '.') run_args = ['--depth='+depth, '--format='+self.format, gyp_file] run_args.extend(self.extra_args) run_args.extend(args) return self.run(program=self.gyp, arguments=run_args, **kw) def run(self, *args, **kw): """ Executes a program by calling the superclass .run() method. This exists to provide a common place to filter out keyword arguments implemented in this layer, without having to update the tool-specific subclasses or clutter the tests themselves with platform-specific code. """ if kw.has_key('SYMROOT'): del kw['SYMROOT'] super(TestGypBase, self).run(*args, **kw) def set_configuration(self, configuration): """ Sets the configuration, to be used for invoking the build tool and testing potential built output. """ self.configuration = configuration def configuration_dirname(self): if self.configuration: return self.configuration.split('|')[0] else: return 'Default' def configuration_buildname(self): if self.configuration: return self.configuration else: return 'Default' # # Abstract methods to be defined by format-specific subclasses. # def build(self, gyp_file, target=None, **kw): """ Runs a build of the specified target against the configuration generated from the specified gyp_file. A 'target' argument of None or the special value TestGyp.DEFAULT specifies the default argument for the underlying build tool. A 'target' argument of TestGyp.ALL specifies the 'all' target (if any) of the underlying build tool. """ raise NotImplementedError def built_file_path(self, name, type=None, **kw): """ Returns a path to the specified file name, of the specified type. """ raise NotImplementedError def built_file_basename(self, name, type=None, **kw): """ Returns the base name of the specified file name, of the specified type. A bare=True keyword argument specifies that prefixes and suffixes shouldn't be applied. """ if not kw.get('bare'): if type == self.EXECUTABLE: name = name + self._exe elif type == self.STATIC_LIB: name = self.lib_ + name + self._lib elif type == self.SHARED_LIB: name = self.dll_ + name + self._dll return name def run_built_executable(self, name, *args, **kw): """ Runs an executable program built from a gyp-generated configuration. The specified name should be independent of any particular generator. Subclasses should find the output executable in the appropriate output build directory, tack on any necessary executable suffix, etc. """ raise NotImplementedError def up_to_date(self, gyp_file, target=None, **kw): """ Verifies that a build of the specified target is up to date. The subclass should implement this by calling build() (or a reasonable equivalent), checking whatever conditions will tell it the build was an "up to date" null build, and failing if it isn't. """ raise NotImplementedError class TestGypGypd(TestGypBase): """ Subclass for testing the GYP 'gypd' generator (spit out the internal data structure as pretty-printed Python). """ format = 'gypd' class TestGypCustom(TestGypBase): """ Subclass for testing the GYP with custom generator """ def __init__(self, gyp=None, *args, **kw): self.format = kw.pop("format") super(TestGypCustom, self).__init__(*args, **kw) class TestGypAndroid(TestGypBase): """ Subclass for testing the GYP Android makefile generator. Note that build/envsetup.sh and lunch must have been run before running tests. TODO: This is currently an incomplete implementation. We do not support run_built_executable(), so we pass only tests which do not use this. As a result, support for host targets is not properly tested. """ format = 'android' # Note that we can't use mmm as the build tool because ... # - it builds all targets, whereas we need to pass a target # - it is a function, whereas the test runner assumes the build tool is a file # Instead we use make and duplicate the logic from mmm. build_tool_list = ['make'] # We use our custom target 'gyp_all_modules', as opposed to the 'all_modules' # target used by mmm, to build only those targets which are part of the gyp # target 'all'. ALL = 'gyp_all_modules' def __init__(self, gyp=None, *args, **kw): # Android requires build and test output to be outside its source tree. # We use the following working directory for the test's source, but the # test's build output still goes to $ANDROID_PRODUCT_OUT. # Note that some tests explicitly set format='gypd' to invoke the gypd # backend. This writes to the source tree, but there's no way around this. kw['workdir'] = os.path.join('/tmp', 'gyptest', kw.get('workdir', 'testworkarea')) # We need to remove all gyp outputs from out/. Ths is because some tests # don't have rules to regenerate output, so they will simply re-use stale # output if present. Since the test working directory gets regenerated for # each test run, this can confuse things. # We don't have a list of build outputs because we don't know which # dependent targets were built. Instead we delete all gyp-generated output. # This may be excessive, but should be safe. out_dir = os.environ['ANDROID_PRODUCT_OUT'] obj_dir = os.path.join(out_dir, 'obj') shutil.rmtree(os.path.join(obj_dir, 'GYP'), ignore_errors = True) for x in ['EXECUTABLES', 'STATIC_LIBRARIES', 'SHARED_LIBRARIES']: for d in os.listdir(os.path.join(obj_dir, x)): if d.endswith('_gyp_intermediates'): shutil.rmtree(os.path.join(obj_dir, x, d), ignore_errors = True) for x in [os.path.join('obj', 'lib'), os.path.join('system', 'lib')]: for d in os.listdir(os.path.join(out_dir, x)): if d.endswith('_gyp.so'): os.remove(os.path.join(out_dir, x, d)) super(TestGypAndroid, self).__init__(*args, **kw) def target_name(self, target): if target == self.ALL: return self.ALL # The default target is 'droid'. However, we want to use our special target # to build only the gyp target 'all'. if target in (None, self.DEFAULT): return self.ALL return target def build(self, gyp_file, target=None, **kw): """ Runs a build using the Android makefiles generated from the specified gyp_file. This logic is taken from Android's mmm. """ arguments = kw.get('arguments', [])[:] arguments.append(self.target_name(target)) arguments.append('-C') arguments.append(os.environ['ANDROID_BUILD_TOP']) kw['arguments'] = arguments chdir = kw.get('chdir', '') makefile = os.path.join(self.workdir, chdir, 'GypAndroid.mk') os.environ['ONE_SHOT_MAKEFILE'] = makefile result = self.run(program=self.build_tool, **kw) del os.environ['ONE_SHOT_MAKEFILE'] return result def android_module(self, group, name, subdir): if subdir: name = '%s_%s' % (subdir, name) if group == 'SHARED_LIBRARIES': name = 'lib_%s' % name return '%s_gyp' % name def intermediates_dir(self, group, module_name): return os.path.join(os.environ['ANDROID_PRODUCT_OUT'], 'obj', group, '%s_intermediates' % module_name) def built_file_path(self, name, type=None, **kw): """ Returns a path to the specified file name, of the specified type, as built by Android. Note that we don't support the configuration parameter. """ # Built files are in $ANDROID_PRODUCT_OUT. This requires copying logic from # the Android build system. if type == None: return os.path.join(os.environ['ANDROID_PRODUCT_OUT'], 'obj', 'GYP', 'shared_intermediates', name) subdir = kw.get('subdir') if type == self.EXECUTABLE: # We don't install executables group = 'EXECUTABLES' module_name = self.android_module(group, name, subdir) return os.path.join(self.intermediates_dir(group, module_name), name) if type == self.STATIC_LIB: group = 'STATIC_LIBRARIES' module_name = self.android_module(group, name, subdir) return os.path.join(self.intermediates_dir(group, module_name), '%s.a' % module_name) if type == self.SHARED_LIB: group = 'SHARED_LIBRARIES' module_name = self.android_module(group, name, subdir) return os.path.join(self.intermediates_dir(group, module_name), 'LINKED', '%s.so' % module_name) assert False, 'Unhandled type' def run_built_executable(self, name, *args, **kw): """ Runs an executable program built from a gyp-generated configuration. This is not correctly implemented for Android. For now, we simply check that the executable file exists. """ # Running executables requires a device. Even if we build for target x86, # the binary is not built with the correct toolchain options to actually # run on the host. # Copied from TestCommon.run() match = kw.pop('match', self.match) status = None if os.path.exists(self.built_file_path(name)): status = 1 self._complete(None, None, None, None, status, self.match) def match_single_line(self, lines = None, expected_line = None): """ Checks that specified line appears in the text. """ for line in lines.split('\n'): if line == expected_line: return 1 return def up_to_date(self, gyp_file, target=None, **kw): """ Verifies that a build of the specified target is up to date. """ kw['stdout'] = ("make: Nothing to be done for `%s'." % self.target_name(target)) # We need to supply a custom matcher, since we don't want to depend on the # exact stdout string. kw['match'] = self.match_single_line return self.build(gyp_file, target, **kw) class TestGypMake(TestGypBase): """ Subclass for testing the GYP Make generator. """ format = 'make' build_tool_list = ['make'] ALL = 'all' def build(self, gyp_file, target=None, **kw): """ Runs a Make build using the Makefiles generated from the specified gyp_file. """ arguments = kw.get('arguments', [])[:] if self.configuration: arguments.append('BUILDTYPE=' + self.configuration) if target not in (None, self.DEFAULT): arguments.append(target) # Sub-directory builds provide per-gyp Makefiles (i.e. # Makefile.gyp_filename), so use that if there is no Makefile. chdir = kw.get('chdir', '') if not os.path.exists(os.path.join(chdir, 'Makefile')): print "NO Makefile in " + os.path.join(chdir, 'Makefile') arguments.insert(0, '-f') arguments.insert(1, os.path.splitext(gyp_file)[0] + '.Makefile') kw['arguments'] = arguments return self.run(program=self.build_tool, **kw) def up_to_date(self, gyp_file, target=None, **kw): """ Verifies that a build of the specified Make target is up to date. """ if target in (None, self.DEFAULT): message_target = 'all' else: message_target = target kw['stdout'] = "make: Nothing to be done for `%s'.\n" % message_target return self.build(gyp_file, target, **kw) def run_built_executable(self, name, *args, **kw): """ Runs an executable built by Make. """ configuration = self.configuration_dirname() libdir = os.path.join('out', configuration, 'lib') # TODO(piman): when everything is cross-compile safe, remove lib.target if sys.platform == 'darwin': # Mac puts target shared libraries right in the product directory. configuration = self.configuration_dirname() os.environ['DYLD_LIBRARY_PATH'] = ( libdir + '.host:' + os.path.join('out', configuration)) else: os.environ['LD_LIBRARY_PATH'] = libdir + '.host:' + libdir + '.target' # Enclosing the name in a list avoids prepending the original dir. program = [self.built_file_path(name, type=self.EXECUTABLE, **kw)] return self.run(program=program, *args, **kw) def built_file_path(self, name, type=None, **kw): """ Returns a path to the specified file name, of the specified type, as built by Make. Built files are in the subdirectory 'out/{configuration}'. The default is 'out/Default'. A chdir= keyword argument specifies the source directory relative to which the output subdirectory can be found. "type" values of STATIC_LIB or SHARED_LIB append the necessary prefixes and suffixes to a platform-independent library base name. A subdir= keyword argument specifies a library subdirectory within the default 'obj.target'. """ result = [] chdir = kw.get('chdir') if chdir: result.append(chdir) configuration = self.configuration_dirname() result.extend(['out', configuration]) if type == self.STATIC_LIB and sys.platform != 'darwin': result.append('obj.target') elif type == self.SHARED_LIB and sys.platform != 'darwin': result.append('lib.target') subdir = kw.get('subdir') if subdir and type != self.SHARED_LIB: result.append(subdir) result.append(self.built_file_basename(name, type, **kw)) return self.workpath(*result) def ConvertToCygpath(path): """Convert to cygwin path if we are using cygwin.""" if sys.platform == 'cygwin': p = subprocess.Popen(['cygpath', path], stdout=subprocess.PIPE) path = p.communicate()[0].strip() return path def FindVisualStudioInstallation(): """Returns appropriate values for .build_tool and .uses_msbuild fields of TestGypBase for Visual Studio. We use the value specified by GYP_MSVS_VERSION. If not specified, we search %PATH% and %PATHEXT% for a devenv.{exe,bat,...} executable. Failing that, we search for likely deployment paths. """ possible_roots = ['%s:\\Program Files%s' % (chr(drive), suffix) for drive in range(ord('C'), ord('Z') + 1) for suffix in ['', ' (x86)']] possible_paths = { '2012': r'Microsoft Visual Studio 11.0\Common7\IDE\devenv.com', '2010': r'Microsoft Visual Studio 10.0\Common7\IDE\devenv.com', '2008': r'Microsoft Visual Studio 9.0\Common7\IDE\devenv.com', '2005': r'Microsoft Visual Studio 8\Common7\IDE\devenv.com'} possible_roots = [ConvertToCygpath(r) for r in possible_roots] msvs_version = 'auto' for flag in (f for f in sys.argv if f.startswith('msvs_version=')): msvs_version = flag.split('=')[-1] msvs_version = os.environ.get('GYP_MSVS_VERSION', msvs_version) build_tool = None if msvs_version in possible_paths: # Check that the path to the specified GYP_MSVS_VERSION exists. path = possible_paths[msvs_version] for r in possible_roots: bt = os.path.join(r, path) if os.path.exists(bt): build_tool = bt uses_msbuild = msvs_version >= '2010' return build_tool, uses_msbuild else: print ('Warning: Environment variable GYP_MSVS_VERSION specifies "%s" ' 'but corresponding "%s" was not found.' % (msvs_version, path)) if build_tool: # We found 'devenv' on the path, use that and try to guess the version. for version, path in possible_paths.iteritems(): if build_tool.find(path) >= 0: uses_msbuild = version >= '2010' return build_tool, uses_msbuild else: # If not, assume not MSBuild. uses_msbuild = False return build_tool, uses_msbuild # Neither GYP_MSVS_VERSION nor the path help us out. Iterate through # the choices looking for a match. for version in sorted(possible_paths, reverse=True): path = possible_paths[version] for r in possible_roots: bt = os.path.join(r, path) if os.path.exists(bt): build_tool = bt uses_msbuild = msvs_version >= '2010' return build_tool, uses_msbuild print 'Error: could not find devenv' sys.exit(1) class TestGypOnMSToolchain(TestGypBase): """ Common subclass for testing generators that target the Microsoft Visual Studio toolchain (cl, link, dumpbin, etc.) """ @staticmethod def _ComputeVsvarsPath(devenv_path): devenv_dir = os.path.split(devenv_path)[0] vsvars_path = os.path.join(devenv_path, '../../Tools/vsvars32.bat') return vsvars_path def initialize_build_tool(self): super(TestGypOnMSToolchain, self).initialize_build_tool() if sys.platform in ('win32', 'cygwin'): self.devenv_path, self.uses_msbuild = FindVisualStudioInstallation() self.vsvars_path = TestGypOnMSToolchain._ComputeVsvarsPath( self.devenv_path) def run_dumpbin(self, *dumpbin_args): """Run the dumpbin tool with the specified arguments, and capturing and returning stdout.""" assert sys.platform in ('win32', 'cygwin') cmd = os.environ.get('COMSPEC', 'cmd.exe') arguments = [cmd, '/c', self.vsvars_path, '&&', 'dumpbin'] arguments.extend(dumpbin_args) proc = subprocess.Popen(arguments, stdout=subprocess.PIPE) output = proc.communicate()[0] assert not proc.returncode return output class TestGypNinja(TestGypOnMSToolchain): """ Subclass for testing the GYP Ninja generator. """ format = 'ninja' build_tool_list = ['ninja'] ALL = 'all' DEFAULT = 'all' def run_gyp(self, gyp_file, *args, **kw): TestGypBase.run_gyp(self, gyp_file, *args, **kw) def build(self, gyp_file, target=None, **kw): arguments = kw.get('arguments', [])[:] # Add a -C output/path to the command line. arguments.append('-C') arguments.append(os.path.join('out', self.configuration_dirname())) if target is None: target = 'all' arguments.append(target) kw['arguments'] = arguments return self.run(program=self.build_tool, **kw) def run_built_executable(self, name, *args, **kw): # Enclosing the name in a list avoids prepending the original dir. program = [self.built_file_path(name, type=self.EXECUTABLE, **kw)] if sys.platform == 'darwin': configuration = self.configuration_dirname() os.environ['DYLD_LIBRARY_PATH'] = os.path.join('out', configuration) return self.run(program=program, *args, **kw) def built_file_path(self, name, type=None, **kw): result = [] chdir = kw.get('chdir') if chdir: result.append(chdir) result.append('out') result.append(self.configuration_dirname()) if type == self.STATIC_LIB: if sys.platform != 'darwin': result.append('obj') elif type == self.SHARED_LIB: if sys.platform != 'darwin' and sys.platform != 'win32': result.append('lib') subdir = kw.get('subdir') if subdir and type != self.SHARED_LIB: result.append(subdir) result.append(self.built_file_basename(name, type, **kw)) return self.workpath(*result) def up_to_date(self, gyp_file, target=None, **kw): result = self.build(gyp_file, target, **kw) if not result: stdout = self.stdout() if 'ninja: no work to do' not in stdout: self.report_not_up_to_date() self.fail_test() return result class TestGypMSVS(TestGypOnMSToolchain): """ Subclass for testing the GYP Visual Studio generator. """ format = 'msvs' u = r'=== Build: 0 succeeded, 0 failed, (\d+) up-to-date, 0 skipped ===' up_to_date_re = re.compile(u, re.M) # Initial None element will indicate to our .initialize_build_tool() # method below that 'devenv' was not found on %PATH%. # # Note: we must use devenv.com to be able to capture build output. # Directly executing devenv.exe only sends output to BuildLog.htm. build_tool_list = [None, 'devenv.com'] def initialize_build_tool(self): super(TestGypMSVS, self).initialize_build_tool() self.build_tool = self.devenv_path def build(self, gyp_file, target=None, rebuild=False, **kw): """ Runs a Visual Studio build using the configuration generated from the specified gyp_file. """ configuration = self.configuration_buildname() if rebuild: build = '/Rebuild' else: build = '/Build' arguments = kw.get('arguments', [])[:] arguments.extend([gyp_file.replace('.gyp', '.sln'), build, configuration]) # Note: the Visual Studio generator doesn't add an explicit 'all' # target, so we just treat it the same as the default. if target not in (None, self.ALL, self.DEFAULT): arguments.extend(['/Project', target]) if self.configuration: arguments.extend(['/ProjectConfig', self.configuration]) kw['arguments'] = arguments return self.run(program=self.build_tool, **kw) def up_to_date(self, gyp_file, target=None, **kw): """ Verifies that a build of the specified Visual Studio target is up to date. Beware that VS2010 will behave strangely if you build under C:\USERS\yourname\AppData\Local. It will cause needless work. The ouptut will be "1 succeeded and 0 up to date". MSBuild tracing reveals that: "Project 'C:\Users\...\AppData\Local\...vcxproj' not up to date because 'C:\PROGRAM FILES (X86)\MICROSOFT VISUAL STUDIO 10.0\VC\BIN\1033\CLUI.DLL' was modified at 02/21/2011 17:03:30, which is newer than '' which was modified at 01/01/0001 00:00:00. The workaround is to specify a workdir when instantiating the test, e.g. test = TestGyp.TestGyp(workdir='workarea') """ result = self.build(gyp_file, target, **kw) if not result: stdout = self.stdout() m = self.up_to_date_re.search(stdout) up_to_date = m and int(m.group(1)) > 0 if not up_to_date: self.report_not_up_to_date() self.fail_test() return result def run_built_executable(self, name, *args, **kw): """ Runs an executable built by Visual Studio. """ configuration = self.configuration_dirname() # Enclosing the name in a list avoids prepending the original dir. program = [self.built_file_path(name, type=self.EXECUTABLE, **kw)] return self.run(program=program, *args, **kw) def built_file_path(self, name, type=None, **kw): """ Returns a path to the specified file name, of the specified type, as built by Visual Studio. Built files are in a subdirectory that matches the configuration name. The default is 'Default'. A chdir= keyword argument specifies the source directory relative to which the output subdirectory can be found. "type" values of STATIC_LIB or SHARED_LIB append the necessary prefixes and suffixes to a platform-independent library base name. """ result = [] chdir = kw.get('chdir') if chdir: result.append(chdir) result.append(self.configuration_dirname()) if type == self.STATIC_LIB: result.append('lib') result.append(self.built_file_basename(name, type, **kw)) return self.workpath(*result) class TestGypSCons(TestGypBase): """ Subclass for testing the GYP SCons generator. """ format = 'scons' build_tool_list = ['scons', 'scons.py'] ALL = 'all' def build(self, gyp_file, target=None, **kw): """ Runs a scons build using the SCons configuration generated from the specified gyp_file. """ arguments = kw.get('arguments', [])[:] dirname = os.path.dirname(gyp_file) if dirname: arguments.extend(['-C', dirname]) if self.configuration: arguments.append('--mode=' + self.configuration) if target not in (None, self.DEFAULT): arguments.append(target) kw['arguments'] = arguments return self.run(program=self.build_tool, **kw) def up_to_date(self, gyp_file, target=None, **kw): """ Verifies that a build of the specified SCons target is up to date. """ if target in (None, self.DEFAULT): up_to_date_targets = 'all' else: up_to_date_targets = target up_to_date_lines = [] for arg in up_to_date_targets.split(): up_to_date_lines.append("scons: `%s' is up to date.\n" % arg) kw['stdout'] = ''.join(up_to_date_lines) arguments = kw.get('arguments', [])[:] arguments.append('-Q') kw['arguments'] = arguments return self.build(gyp_file, target, **kw) def run_built_executable(self, name, *args, **kw): """ Runs an executable built by scons. """ configuration = self.configuration_dirname() os.environ['LD_LIBRARY_PATH'] = os.path.join(configuration, 'lib') # Enclosing the name in a list avoids prepending the original dir. program = [self.built_file_path(name, type=self.EXECUTABLE, **kw)] return self.run(program=program, *args, **kw) def built_file_path(self, name, type=None, **kw): """ Returns a path to the specified file name, of the specified type, as built by Scons. Built files are in a subdirectory that matches the configuration name. The default is 'Default'. A chdir= keyword argument specifies the source directory relative to which the output subdirectory can be found. "type" values of STATIC_LIB or SHARED_LIB append the necessary prefixes and suffixes to a platform-independent library base name. """ result = [] chdir = kw.get('chdir') if chdir: result.append(chdir) result.append(self.configuration_dirname()) if type in (self.STATIC_LIB, self.SHARED_LIB): result.append('lib') result.append(self.built_file_basename(name, type, **kw)) return self.workpath(*result) class TestGypXcode(TestGypBase): """ Subclass for testing the GYP Xcode generator. """ format = 'xcode' build_tool_list = ['xcodebuild'] phase_script_execution = ("\n" "PhaseScriptExecution /\\S+/Script-[0-9A-F]+\\.sh\n" " cd /\\S+\n" " /bin/sh -c /\\S+/Script-[0-9A-F]+\\.sh\n" "(make: Nothing to be done for `all'\\.\n)?") strip_up_to_date_expressions = [ # Various actions or rules can run even when the overall build target # is up to date. Strip those phases' GYP-generated output. re.compile(phase_script_execution, re.S), # The message from distcc_pump can trail the "BUILD SUCCEEDED" # message, so strip that, too. re.compile('__________Shutting down distcc-pump include server\n', re.S), ] up_to_date_endings = ( 'Checking Dependencies...\n** BUILD SUCCEEDED **\n', # Xcode 3.0/3.1 'Check dependencies\n** BUILD SUCCEEDED **\n\n', # Xcode 3.2 ) def build(self, gyp_file, target=None, **kw): """ Runs an xcodebuild using the .xcodeproj generated from the specified gyp_file. """ # Be sure we're working with a copy of 'arguments' since we modify it. # The caller may not be expecting it to be modified. arguments = kw.get('arguments', [])[:] arguments.extend(['-project', gyp_file.replace('.gyp', '.xcodeproj')]) if target == self.ALL: arguments.append('-alltargets',) elif target not in (None, self.DEFAULT): arguments.extend(['-target', target]) if self.configuration: arguments.extend(['-configuration', self.configuration]) symroot = kw.get('SYMROOT', '$SRCROOT/build') if symroot: arguments.append('SYMROOT='+symroot) kw['arguments'] = arguments return self.run(program=self.build_tool, **kw) def up_to_date(self, gyp_file, target=None, **kw): """ Verifies that a build of the specified Xcode target is up to date. """ result = self.build(gyp_file, target, **kw) if not result: output = self.stdout() for expression in self.strip_up_to_date_expressions: output = expression.sub('', output) if not output.endswith(self.up_to_date_endings): self.report_not_up_to_date() self.fail_test() return result def run_built_executable(self, name, *args, **kw): """ Runs an executable built by xcodebuild. """ configuration = self.configuration_dirname() os.environ['DYLD_LIBRARY_PATH'] = os.path.join('build', configuration) # Enclosing the name in a list avoids prepending the original dir. program = [self.built_file_path(name, type=self.EXECUTABLE, **kw)] return self.run(program=program, *args, **kw) def built_file_path(self, name, type=None, **kw): """ Returns a path to the specified file name, of the specified type, as built by Xcode. Built files are in the subdirectory 'build/{configuration}'. The default is 'build/Default'. A chdir= keyword argument specifies the source directory relative to which the output subdirectory can be found. "type" values of STATIC_LIB or SHARED_LIB append the necessary prefixes and suffixes to a platform-independent library base name. """ result = [] chdir = kw.get('chdir') if chdir: result.append(chdir) configuration = self.configuration_dirname() result.extend(['build', configuration]) result.append(self.built_file_basename(name, type, **kw)) return self.workpath(*result) format_class_list = [ TestGypGypd, TestGypAndroid, TestGypMake, TestGypMSVS, TestGypNinja, TestGypSCons, TestGypXcode, ] def TestGyp(*args, **kw): """ Returns an appropriate TestGyp* instance for a specified GYP format. """ format = kw.pop('format', os.environ.get('TESTGYP_FORMAT')) for format_class in format_class_list: if format == format_class.format: return format_class(*args, **kw) raise Exception, "unknown format %r" % format
mit
marcusmueller/gnuradio
gr-filter/examples/fft_filter_ccc.py
7
4367
#!/usr/bin/env python # # Copyright 2013 Free Software Foundation, Inc. # # This file is part of GNU Radio # # GNU Radio is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 3, or (at your option) # any later version. # # GNU Radio is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with GNU Radio; see the file COPYING. If not, write to # the Free Software Foundation, Inc., 51 Franklin Street, # Boston, MA 02110-1301, USA. # from __future__ import print_function from __future__ import division from __future__ import unicode_literals from gnuradio import gr, filter from gnuradio import analog from gnuradio import blocks from gnuradio import eng_notation from gnuradio.eng_arg import eng_float, intx from argparse import ArgumentParser import sys import numpy try: from matplotlib import pyplot except ImportError: print("Error: could not from matplotlib import pyplot (http://matplotlib.sourceforge.net/)") sys.exit(1) class example_fft_filter_ccc(gr.top_block): def __init__(self, N, fs, bw0, bw1, tw, atten, D): gr.top_block.__init__(self) self._nsamps = N self._fs = fs self._bw0 = bw0 self._bw1 = bw1 self._tw = tw self._at = atten self._decim = D taps = filter.firdes.complex_band_pass_2(1, self._fs, self._bw0, self._bw1, self._tw, self._at) print("Num. Taps: ", len(taps)) self.src = analog.noise_source_c(analog.GR_GAUSSIAN, 1) self.head = blocks.head(gr.sizeof_gr_complex, self._nsamps) self.filt0 = filter.fft_filter_ccc(self._decim, taps) self.vsnk_src = blocks.vector_sink_c() self.vsnk_out = blocks.vector_sink_c() self.connect(self.src, self.head, self.vsnk_src) self.connect(self.head, self.filt0, self.vsnk_out) def main(): parser = ArgumentParser(conflict_handler="resolve") parser.add_argument("-N", "--nsamples", type=int, default=10000, help="Number of samples to process [default=%(default)r]") parser.add_argument("-s", "--samplerate", type=eng_float, default=8000, help="System sample rate [default=%(default)r]") parser.add_argument("-S", "--start-pass", type=eng_float, default=1000, help="Start of Passband [default=%(default)r]") parser.add_argument("-E", "--end-pass", type=eng_float, default=2000, help="End of Passband [default=%(default)r]") parser.add_argument("-T", "--transition", type=eng_float, default=100, help="Transition band [default=%(default)r]") parser.add_argument("-A", "--attenuation", type=eng_float, default=80, help="Stopband attenuation [default=%(default)r]") parser.add_argument("-D", "--decimation", type=int, default=1, help="Decmation factor [default=%(default)r]") args = parser.parse_args() put = example_fft_filter_ccc(args.nsamples, args.samplerate, args.start_pass, args.end_pass, args.transition, args.attenuation, args.decimation) put.run() data_src = numpy.array(put.vsnk_src.data()) data_snk = numpy.array(put.vsnk_out.data()) # Plot the signals PSDs nfft = 1024 f1 = pyplot.figure(1, figsize=(12,10)) s1 = f1.add_subplot(1,1,1) s1.psd(data_src, NFFT=nfft, noverlap=nfft / 4, Fs=args.samplerate) s1.psd(data_snk, NFFT=nfft, noverlap=nfft / 4, Fs=args.samplerate) f2 = pyplot.figure(2, figsize=(12,10)) s2 = f2.add_subplot(1,1,1) s2.plot(data_src) s2.plot(data_snk.real, 'g') pyplot.show() if __name__ == "__main__": try: main() except KeyboardInterrupt: pass
gpl-3.0
BeATz-UnKNoWN/python-for-android
python3-alpha/python3-src/Lib/random.py
45
25557
"""Random variable generators. integers -------- uniform within range sequences --------- pick random element pick random sample generate random permutation distributions on the real line: ------------------------------ uniform triangular normal (Gaussian) lognormal negative exponential gamma beta pareto Weibull distributions on the circle (angles 0 to 2pi) --------------------------------------------- circular uniform von Mises General notes on the underlying Mersenne Twister core generator: * The period is 2**19937-1. * It is one of the most extensively tested generators in existence. * The random() method is implemented in C, executes in a single Python step, and is, therefore, threadsafe. """ from __future__ import division from warnings import warn as _warn from types import MethodType as _MethodType, BuiltinMethodType as _BuiltinMethodType from math import log as _log, exp as _exp, pi as _pi, e as _e, ceil as _ceil from math import sqrt as _sqrt, acos as _acos, cos as _cos, sin as _sin from os import urandom as _urandom from collections import Set as _Set, Sequence as _Sequence from hashlib import sha512 as _sha512 __all__ = ["Random","seed","random","uniform","randint","choice","sample", "randrange","shuffle","normalvariate","lognormvariate", "expovariate","vonmisesvariate","gammavariate","triangular", "gauss","betavariate","paretovariate","weibullvariate", "getstate","setstate", "getrandbits", "SystemRandom"] NV_MAGICCONST = 4 * _exp(-0.5)/_sqrt(2.0) TWOPI = 2.0*_pi LOG4 = _log(4.0) SG_MAGICCONST = 1.0 + _log(4.5) BPF = 53 # Number of bits in a float RECIP_BPF = 2**-BPF # Translated by Guido van Rossum from C source provided by # Adrian Baddeley. Adapted by Raymond Hettinger for use with # the Mersenne Twister and os.urandom() core generators. import _random class Random(_random.Random): """Random number generator base class used by bound module functions. Used to instantiate instances of Random to get generators that don't share state. Class Random can also be subclassed if you want to use a different basic generator of your own devising: in that case, override the following methods: random(), seed(), getstate(), and setstate(). Optionally, implement a getrandbits() method so that randrange() can cover arbitrarily large ranges. """ VERSION = 3 # used by getstate/setstate def __init__(self, x=None): """Initialize an instance. Optional argument x controls seeding, as for Random.seed(). """ self.seed(x) self.gauss_next = None def seed(self, a=None, version=2): """Initialize internal state from hashable object. None or no argument seeds from current time or from an operating system specific randomness source if available. For version 2 (the default), all of the bits are used if *a *is a str, bytes, or bytearray. For version 1, the hash() of *a* is used instead. If *a* is an int, all bits are used. """ if a is None: try: a = int.from_bytes(_urandom(32), 'big') except NotImplementedError: import time a = int(time.time() * 256) # use fractional seconds if version == 2: if isinstance(a, (str, bytes, bytearray)): if isinstance(a, str): a = a.encode() a += _sha512(a).digest() a = int.from_bytes(a, 'big') super().seed(a) self.gauss_next = None def getstate(self): """Return internal state; can be passed to setstate() later.""" return self.VERSION, super().getstate(), self.gauss_next def setstate(self, state): """Restore internal state from object returned by getstate().""" version = state[0] if version == 3: version, internalstate, self.gauss_next = state super().setstate(internalstate) elif version == 2: version, internalstate, self.gauss_next = state # In version 2, the state was saved as signed ints, which causes # inconsistencies between 32/64-bit systems. The state is # really unsigned 32-bit ints, so we convert negative ints from # version 2 to positive longs for version 3. try: internalstate = tuple(x % (2**32) for x in internalstate) except ValueError as e: raise TypeError from e super().setstate(internalstate) else: raise ValueError("state with version %s passed to " "Random.setstate() of version %s" % (version, self.VERSION)) ## ---- Methods below this point do not need to be overridden when ## ---- subclassing for the purpose of using a different core generator. ## -------------------- pickle support ------------------- def __getstate__(self): # for pickle return self.getstate() def __setstate__(self, state): # for pickle self.setstate(state) def __reduce__(self): return self.__class__, (), self.getstate() ## -------------------- integer methods ------------------- def randrange(self, start, stop=None, step=1, int=int): """Choose a random item from range(start, stop[, step]). This fixes the problem with randint() which includes the endpoint; in Python this is usually not what you want. Do not supply the 'int' argument. """ # This code is a bit messy to make it fast for the # common case while still doing adequate error checking. istart = int(start) if istart != start: raise ValueError("non-integer arg 1 for randrange()") if stop is None: if istart > 0: return self._randbelow(istart) raise ValueError("empty range for randrange()") # stop argument supplied. istop = int(stop) if istop != stop: raise ValueError("non-integer stop for randrange()") width = istop - istart if step == 1 and width > 0: return istart + self._randbelow(width) if step == 1: raise ValueError("empty range for randrange() (%d,%d, %d)" % (istart, istop, width)) # Non-unit step argument supplied. istep = int(step) if istep != step: raise ValueError("non-integer step for randrange()") if istep > 0: n = (width + istep - 1) // istep elif istep < 0: n = (width + istep + 1) // istep else: raise ValueError("zero step for randrange()") if n <= 0: raise ValueError("empty range for randrange()") return istart + istep*self._randbelow(n) def randint(self, a, b): """Return random integer in range [a, b], including both end points. """ return self.randrange(a, b+1) def _randbelow(self, n, int=int, maxsize=1<<BPF, type=type, Method=_MethodType, BuiltinMethod=_BuiltinMethodType): "Return a random int in the range [0,n). Raises ValueError if n==0." getrandbits = self.getrandbits # Only call self.getrandbits if the original random() builtin method # has not been overridden or if a new getrandbits() was supplied. if type(self.random) is BuiltinMethod or type(getrandbits) is Method: k = n.bit_length() # don't use (n-1) here because n can be 1 r = getrandbits(k) # 0 <= r < 2**k while r >= n: r = getrandbits(k) return r # There's an overriden random() method but no new getrandbits() method, # so we can only use random() from here. random = self.random if n >= maxsize: _warn("Underlying random() generator does not supply \n" "enough bits to choose from a population range this large.\n" "To remove the range limitation, add a getrandbits() method.") return int(random() * n) rem = maxsize % n limit = (maxsize - rem) / maxsize # int(limit * maxsize) % n == 0 r = random() while r >= limit: r = random() return int(r*maxsize) % n ## -------------------- sequence methods ------------------- def choice(self, seq): """Choose a random element from a non-empty sequence.""" try: i = self._randbelow(len(seq)) except ValueError: raise IndexError('Cannot choose from an empty sequence') return seq[i] def shuffle(self, x, random=None, int=int): """x, random=random.random -> shuffle list x in place; return None. Optional arg random is a 0-argument function returning a random float in [0.0, 1.0); by default, the standard random.random. """ randbelow = self._randbelow for i in reversed(range(1, len(x))): # pick an element in x[:i+1] with which to exchange x[i] j = randbelow(i+1) if random is None else int(random() * (i+1)) x[i], x[j] = x[j], x[i] def sample(self, population, k): """Chooses k unique random elements from a population sequence or set. Returns a new list containing elements from the population while leaving the original population unchanged. The resulting list is in selection order so that all sub-slices will also be valid random samples. This allows raffle winners (the sample) to be partitioned into grand prize and second place winners (the subslices). Members of the population need not be hashable or unique. If the population contains repeats, then each occurrence is a possible selection in the sample. To choose a sample in a range of integers, use range as an argument. This is especially fast and space efficient for sampling from a large population: sample(range(10000000), 60) """ # Sampling without replacement entails tracking either potential # selections (the pool) in a list or previous selections in a set. # When the number of selections is small compared to the # population, then tracking selections is efficient, requiring # only a small set and an occasional reselection. For # a larger number of selections, the pool tracking method is # preferred since the list takes less space than the # set and it doesn't suffer from frequent reselections. if isinstance(population, _Set): population = tuple(population) if not isinstance(population, _Sequence): raise TypeError("Population must be a sequence or set. For dicts, use list(d).") randbelow = self._randbelow n = len(population) if not 0 <= k <= n: raise ValueError("Sample larger than population") result = [None] * k setsize = 21 # size of a small set minus size of an empty list if k > 5: setsize += 4 ** _ceil(_log(k * 3, 4)) # table size for big sets if n <= setsize: # An n-length list is smaller than a k-length set pool = list(population) for i in range(k): # invariant: non-selected at [0,n-i) j = randbelow(n-i) result[i] = pool[j] pool[j] = pool[n-i-1] # move non-selected item into vacancy else: selected = set() selected_add = selected.add for i in range(k): j = randbelow(n) while j in selected: j = randbelow(n) selected_add(j) result[i] = population[j] return result ## -------------------- real-valued distributions ------------------- ## -------------------- uniform distribution ------------------- def uniform(self, a, b): "Get a random number in the range [a, b) or [a, b] depending on rounding." return a + (b-a) * self.random() ## -------------------- triangular -------------------- def triangular(self, low=0.0, high=1.0, mode=None): """Triangular distribution. Continuous distribution bounded by given lower and upper limits, and having a given mode value in-between. http://en.wikipedia.org/wiki/Triangular_distribution """ u = self.random() c = 0.5 if mode is None else (mode - low) / (high - low) if u > c: u = 1.0 - u c = 1.0 - c low, high = high, low return low + (high - low) * (u * c) ** 0.5 ## -------------------- normal distribution -------------------- def normalvariate(self, mu, sigma): """Normal distribution. mu is the mean, and sigma is the standard deviation. """ # mu = mean, sigma = standard deviation # Uses Kinderman and Monahan method. Reference: Kinderman, # A.J. and Monahan, J.F., "Computer generation of random # variables using the ratio of uniform deviates", ACM Trans # Math Software, 3, (1977), pp257-260. random = self.random while 1: u1 = random() u2 = 1.0 - random() z = NV_MAGICCONST*(u1-0.5)/u2 zz = z*z/4.0 if zz <= -_log(u2): break return mu + z*sigma ## -------------------- lognormal distribution -------------------- def lognormvariate(self, mu, sigma): """Log normal distribution. If you take the natural logarithm of this distribution, you'll get a normal distribution with mean mu and standard deviation sigma. mu can have any value, and sigma must be greater than zero. """ return _exp(self.normalvariate(mu, sigma)) ## -------------------- exponential distribution -------------------- def expovariate(self, lambd): """Exponential distribution. lambd is 1.0 divided by the desired mean. It should be nonzero. (The parameter would be called "lambda", but that is a reserved word in Python.) Returned values range from 0 to positive infinity if lambd is positive, and from negative infinity to 0 if lambd is negative. """ # lambd: rate lambd = 1/mean # ('lambda' is a Python reserved word) # we use 1-random() instead of random() to preclude the # possibility of taking the log of zero. return -_log(1.0 - self.random())/lambd ## -------------------- von Mises distribution -------------------- def vonmisesvariate(self, mu, kappa): """Circular data distribution. mu is the mean angle, expressed in radians between 0 and 2*pi, and kappa is the concentration parameter, which must be greater than or equal to zero. If kappa is equal to zero, this distribution reduces to a uniform random angle over the range 0 to 2*pi. """ # mu: mean angle (in radians between 0 and 2*pi) # kappa: concentration parameter kappa (>= 0) # if kappa = 0 generate uniform random angle # Based upon an algorithm published in: Fisher, N.I., # "Statistical Analysis of Circular Data", Cambridge # University Press, 1993. # Thanks to Magnus Kessler for a correction to the # implementation of step 4. random = self.random if kappa <= 1e-6: return TWOPI * random() a = 1.0 + _sqrt(1.0 + 4.0 * kappa * kappa) b = (a - _sqrt(2.0 * a))/(2.0 * kappa) r = (1.0 + b * b)/(2.0 * b) while 1: u1 = random() z = _cos(_pi * u1) f = (1.0 + r * z)/(r + z) c = kappa * (r - f) u2 = random() if u2 < c * (2.0 - c) or u2 <= c * _exp(1.0 - c): break u3 = random() if u3 > 0.5: theta = (mu % TWOPI) + _acos(f) else: theta = (mu % TWOPI) - _acos(f) return theta ## -------------------- gamma distribution -------------------- def gammavariate(self, alpha, beta): """Gamma distribution. Not the gamma function! Conditions on the parameters are alpha > 0 and beta > 0. The probability distribution function is: x ** (alpha - 1) * math.exp(-x / beta) pdf(x) = -------------------------------------- math.gamma(alpha) * beta ** alpha """ # alpha > 0, beta > 0, mean is alpha*beta, variance is alpha*beta**2 # Warning: a few older sources define the gamma distribution in terms # of alpha > -1.0 if alpha <= 0.0 or beta <= 0.0: raise ValueError('gammavariate: alpha and beta must be > 0.0') random = self.random if alpha > 1.0: # Uses R.C.H. Cheng, "The generation of Gamma # variables with non-integral shape parameters", # Applied Statistics, (1977), 26, No. 1, p71-74 ainv = _sqrt(2.0 * alpha - 1.0) bbb = alpha - LOG4 ccc = alpha + ainv while 1: u1 = random() if not 1e-7 < u1 < .9999999: continue u2 = 1.0 - random() v = _log(u1/(1.0-u1))/ainv x = alpha*_exp(v) z = u1*u1*u2 r = bbb+ccc*v-x if r + SG_MAGICCONST - 4.5*z >= 0.0 or r >= _log(z): return x * beta elif alpha == 1.0: # expovariate(1) u = random() while u <= 1e-7: u = random() return -_log(u) * beta else: # alpha is between 0 and 1 (exclusive) # Uses ALGORITHM GS of Statistical Computing - Kennedy & Gentle while 1: u = random() b = (_e + alpha)/_e p = b*u if p <= 1.0: x = p ** (1.0/alpha) else: x = -_log((b-p)/alpha) u1 = random() if p > 1.0: if u1 <= x ** (alpha - 1.0): break elif u1 <= _exp(-x): break return x * beta ## -------------------- Gauss (faster alternative) -------------------- def gauss(self, mu, sigma): """Gaussian distribution. mu is the mean, and sigma is the standard deviation. This is slightly faster than the normalvariate() function. Not thread-safe without a lock around calls. """ # When x and y are two variables from [0, 1), uniformly # distributed, then # # cos(2*pi*x)*sqrt(-2*log(1-y)) # sin(2*pi*x)*sqrt(-2*log(1-y)) # # are two *independent* variables with normal distribution # (mu = 0, sigma = 1). # (Lambert Meertens) # (corrected version; bug discovered by Mike Miller, fixed by LM) # Multithreading note: When two threads call this function # simultaneously, it is possible that they will receive the # same return value. The window is very small though. To # avoid this, you have to use a lock around all calls. (I # didn't want to slow this down in the serial case by using a # lock here.) random = self.random z = self.gauss_next self.gauss_next = None if z is None: x2pi = random() * TWOPI g2rad = _sqrt(-2.0 * _log(1.0 - random())) z = _cos(x2pi) * g2rad self.gauss_next = _sin(x2pi) * g2rad return mu + z*sigma ## -------------------- beta -------------------- ## See ## http://mail.python.org/pipermail/python-bugs-list/2001-January/003752.html ## for Ivan Frohne's insightful analysis of why the original implementation: ## ## def betavariate(self, alpha, beta): ## # Discrete Event Simulation in C, pp 87-88. ## ## y = self.expovariate(alpha) ## z = self.expovariate(1.0/beta) ## return z/(y+z) ## ## was dead wrong, and how it probably got that way. def betavariate(self, alpha, beta): """Beta distribution. Conditions on the parameters are alpha > 0 and beta > 0. Returned values range between 0 and 1. """ # This version due to Janne Sinkkonen, and matches all the std # texts (e.g., Knuth Vol 2 Ed 3 pg 134 "the beta distribution"). y = self.gammavariate(alpha, 1.) if y == 0: return 0.0 else: return y / (y + self.gammavariate(beta, 1.)) ## -------------------- Pareto -------------------- def paretovariate(self, alpha): """Pareto distribution. alpha is the shape parameter.""" # Jain, pg. 495 u = 1.0 - self.random() return 1.0 / u ** (1.0/alpha) ## -------------------- Weibull -------------------- def weibullvariate(self, alpha, beta): """Weibull distribution. alpha is the scale parameter and beta is the shape parameter. """ # Jain, pg. 499; bug fix courtesy Bill Arms u = 1.0 - self.random() return alpha * (-_log(u)) ** (1.0/beta) ## --------------- Operating System Random Source ------------------ class SystemRandom(Random): """Alternate random number generator using sources provided by the operating system (such as /dev/urandom on Unix or CryptGenRandom on Windows). Not available on all systems (see os.urandom() for details). """ def random(self): """Get the next random number in the range [0.0, 1.0).""" return (int.from_bytes(_urandom(7), 'big') >> 3) * RECIP_BPF def getrandbits(self, k): """getrandbits(k) -> x. Generates a long int with k random bits.""" if k <= 0: raise ValueError('number of bits must be greater than zero') if k != int(k): raise TypeError('number of bits should be an integer') numbytes = (k + 7) // 8 # bits / 8 and rounded up x = int.from_bytes(_urandom(numbytes), 'big') return x >> (numbytes * 8 - k) # trim excess bits def seed(self, *args, **kwds): "Stub method. Not used for a system random number generator." return None def _notimplemented(self, *args, **kwds): "Method should not be called for a system random number generator." raise NotImplementedError('System entropy source does not have state.') getstate = setstate = _notimplemented ## -------------------- test program -------------------- def _test_generator(n, func, args): import time print(n, 'times', func.__name__) total = 0.0 sqsum = 0.0 smallest = 1e10 largest = -1e10 t0 = time.time() for i in range(n): x = func(*args) total += x sqsum = sqsum + x*x smallest = min(x, smallest) largest = max(x, largest) t1 = time.time() print(round(t1-t0, 3), 'sec,', end=' ') avg = total/n stddev = _sqrt(sqsum/n - avg*avg) print('avg %g, stddev %g, min %g, max %g' % \ (avg, stddev, smallest, largest)) def _test(N=2000): _test_generator(N, random, ()) _test_generator(N, normalvariate, (0.0, 1.0)) _test_generator(N, lognormvariate, (0.0, 1.0)) _test_generator(N, vonmisesvariate, (0.0, 1.0)) _test_generator(N, gammavariate, (0.01, 1.0)) _test_generator(N, gammavariate, (0.1, 1.0)) _test_generator(N, gammavariate, (0.1, 2.0)) _test_generator(N, gammavariate, (0.5, 1.0)) _test_generator(N, gammavariate, (0.9, 1.0)) _test_generator(N, gammavariate, (1.0, 1.0)) _test_generator(N, gammavariate, (2.0, 1.0)) _test_generator(N, gammavariate, (20.0, 1.0)) _test_generator(N, gammavariate, (200.0, 1.0)) _test_generator(N, gauss, (0.0, 1.0)) _test_generator(N, betavariate, (3.0, 3.0)) _test_generator(N, triangular, (0.0, 1.0, 1.0/3.0)) # Create one instance, seeded from current time, and export its methods # as module-level functions. The functions share state across all uses #(both in the user's code and in the Python libraries), but that's fine # for most programs and is easier for the casual user than making them # instantiate their own Random() instance. _inst = Random() seed = _inst.seed random = _inst.random uniform = _inst.uniform triangular = _inst.triangular randint = _inst.randint choice = _inst.choice randrange = _inst.randrange sample = _inst.sample shuffle = _inst.shuffle normalvariate = _inst.normalvariate lognormvariate = _inst.lognormvariate expovariate = _inst.expovariate vonmisesvariate = _inst.vonmisesvariate gammavariate = _inst.gammavariate gauss = _inst.gauss betavariate = _inst.betavariate paretovariate = _inst.paretovariate weibullvariate = _inst.weibullvariate getstate = _inst.getstate setstate = _inst.setstate getrandbits = _inst.getrandbits if __name__ == '__main__': _test()
apache-2.0
yongtang/tensorflow
tensorflow/python/ops/signal/spectral_ops.py
6
20175
# Copyright 2017 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Spectral operations (e.g. Short-time Fourier Transform).""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import numpy as np from tensorflow.python.framework import constant_op from tensorflow.python.framework import dtypes from tensorflow.python.framework import ops from tensorflow.python.framework import tensor_util from tensorflow.python.ops import array_ops from tensorflow.python.ops import math_ops from tensorflow.python.ops.signal import dct_ops from tensorflow.python.ops.signal import fft_ops from tensorflow.python.ops.signal import reconstruction_ops from tensorflow.python.ops.signal import shape_ops from tensorflow.python.ops.signal import window_ops from tensorflow.python.util import dispatch from tensorflow.python.util.tf_export import tf_export @tf_export('signal.stft') @dispatch.add_dispatch_support def stft(signals, frame_length, frame_step, fft_length=None, window_fn=window_ops.hann_window, pad_end=False, name=None): """Computes the [Short-time Fourier Transform][stft] of `signals`. Implemented with TPU/GPU-compatible ops and supports gradients. Args: signals: A `[..., samples]` `float32`/`float64` `Tensor` of real-valued signals. frame_length: An integer scalar `Tensor`. The window length in samples. frame_step: An integer scalar `Tensor`. The number of samples to step. fft_length: An integer scalar `Tensor`. The size of the FFT to apply. If not provided, uses the smallest power of 2 enclosing `frame_length`. window_fn: A callable that takes a window length and a `dtype` keyword argument and returns a `[window_length]` `Tensor` of samples in the provided datatype. If set to `None`, no windowing is used. pad_end: Whether to pad the end of `signals` with zeros when the provided frame length and step produces a frame that lies partially past its end. name: An optional name for the operation. Returns: A `[..., frames, fft_unique_bins]` `Tensor` of `complex64`/`complex128` STFT values where `fft_unique_bins` is `fft_length // 2 + 1` (the unique components of the FFT). Raises: ValueError: If `signals` is not at least rank 1, `frame_length` is not scalar, or `frame_step` is not scalar. [stft]: https://en.wikipedia.org/wiki/Short-time_Fourier_transform """ with ops.name_scope(name, 'stft', [signals, frame_length, frame_step]): signals = ops.convert_to_tensor(signals, name='signals') signals.shape.with_rank_at_least(1) frame_length = ops.convert_to_tensor(frame_length, name='frame_length') frame_length.shape.assert_has_rank(0) frame_step = ops.convert_to_tensor(frame_step, name='frame_step') frame_step.shape.assert_has_rank(0) if fft_length is None: fft_length = _enclosing_power_of_two(frame_length) else: fft_length = ops.convert_to_tensor(fft_length, name='fft_length') framed_signals = shape_ops.frame( signals, frame_length, frame_step, pad_end=pad_end) # Optionally window the framed signals. if window_fn is not None: window = window_fn(frame_length, dtype=framed_signals.dtype) framed_signals *= window # fft_ops.rfft produces the (fft_length/2 + 1) unique components of the # FFT of the real windowed signals in framed_signals. return fft_ops.rfft(framed_signals, [fft_length]) @tf_export('signal.inverse_stft_window_fn') @dispatch.add_dispatch_support def inverse_stft_window_fn(frame_step, forward_window_fn=window_ops.hann_window, name=None): """Generates a window function that can be used in `inverse_stft`. Constructs a window that is equal to the forward window with a further pointwise amplitude correction. `inverse_stft_window_fn` is equivalent to `forward_window_fn` in the case where it would produce an exact inverse. See examples in `inverse_stft` documentation for usage. Args: frame_step: An integer scalar `Tensor`. The number of samples to step. forward_window_fn: window_fn used in the forward transform, `stft`. name: An optional name for the operation. Returns: A callable that takes a window length and a `dtype` keyword argument and returns a `[window_length]` `Tensor` of samples in the provided datatype. The returned window is suitable for reconstructing original waveform in inverse_stft. """ def inverse_stft_window_fn_inner(frame_length, dtype): """Computes a window that can be used in `inverse_stft`. Args: frame_length: An integer scalar `Tensor`. The window length in samples. dtype: Data type of waveform passed to `stft`. Returns: A window suitable for reconstructing original waveform in `inverse_stft`. Raises: ValueError: If `frame_length` is not scalar, `forward_window_fn` is not a callable that takes a window length and a `dtype` keyword argument and returns a `[window_length]` `Tensor` of samples in the provided datatype `frame_step` is not scalar, or `frame_step` is not scalar. """ with ops.name_scope(name, 'inverse_stft_window_fn', [forward_window_fn]): frame_step_ = ops.convert_to_tensor(frame_step, name='frame_step') frame_step_.shape.assert_has_rank(0) frame_length = ops.convert_to_tensor(frame_length, name='frame_length') frame_length.shape.assert_has_rank(0) # Use equation 7 from Griffin + Lim. forward_window = forward_window_fn(frame_length, dtype=dtype) denom = math_ops.square(forward_window) overlaps = -(-frame_length // frame_step_) # Ceiling division. # pylint: disable=invalid-unary-operand-type denom = array_ops.pad(denom, [(0, overlaps * frame_step_ - frame_length)]) denom = array_ops.reshape(denom, [overlaps, frame_step_]) denom = math_ops.reduce_sum(denom, 0, keepdims=True) denom = array_ops.tile(denom, [overlaps, 1]) denom = array_ops.reshape(denom, [overlaps * frame_step_]) return forward_window / denom[:frame_length] return inverse_stft_window_fn_inner @tf_export('signal.inverse_stft') @dispatch.add_dispatch_support def inverse_stft(stfts, frame_length, frame_step, fft_length=None, window_fn=window_ops.hann_window, name=None): """Computes the inverse [Short-time Fourier Transform][stft] of `stfts`. To reconstruct an original waveform, a complementary window function should be used with `inverse_stft`. Such a window function can be constructed with `tf.signal.inverse_stft_window_fn`. Example: ```python frame_length = 400 frame_step = 160 waveform = tf.random.normal(dtype=tf.float32, shape=[1000]) stft = tf.signal.stft(waveform, frame_length, frame_step) inverse_stft = tf.signal.inverse_stft( stft, frame_length, frame_step, window_fn=tf.signal.inverse_stft_window_fn(frame_step)) ``` If a custom `window_fn` is used with `tf.signal.stft`, it must be passed to `tf.signal.inverse_stft_window_fn`: ```python frame_length = 400 frame_step = 160 window_fn = tf.signal.hamming_window waveform = tf.random.normal(dtype=tf.float32, shape=[1000]) stft = tf.signal.stft( waveform, frame_length, frame_step, window_fn=window_fn) inverse_stft = tf.signal.inverse_stft( stft, frame_length, frame_step, window_fn=tf.signal.inverse_stft_window_fn( frame_step, forward_window_fn=window_fn)) ``` Implemented with TPU/GPU-compatible ops and supports gradients. Args: stfts: A `complex64`/`complex128` `[..., frames, fft_unique_bins]` `Tensor` of STFT bins representing a batch of `fft_length`-point STFTs where `fft_unique_bins` is `fft_length // 2 + 1` frame_length: An integer scalar `Tensor`. The window length in samples. frame_step: An integer scalar `Tensor`. The number of samples to step. fft_length: An integer scalar `Tensor`. The size of the FFT that produced `stfts`. If not provided, uses the smallest power of 2 enclosing `frame_length`. window_fn: A callable that takes a window length and a `dtype` keyword argument and returns a `[window_length]` `Tensor` of samples in the provided datatype. If set to `None`, no windowing is used. name: An optional name for the operation. Returns: A `[..., samples]` `Tensor` of `float32`/`float64` signals representing the inverse STFT for each input STFT in `stfts`. Raises: ValueError: If `stfts` is not at least rank 2, `frame_length` is not scalar, `frame_step` is not scalar, or `fft_length` is not scalar. [stft]: https://en.wikipedia.org/wiki/Short-time_Fourier_transform """ with ops.name_scope(name, 'inverse_stft', [stfts]): stfts = ops.convert_to_tensor(stfts, name='stfts') stfts.shape.with_rank_at_least(2) frame_length = ops.convert_to_tensor(frame_length, name='frame_length') frame_length.shape.assert_has_rank(0) frame_step = ops.convert_to_tensor(frame_step, name='frame_step') frame_step.shape.assert_has_rank(0) if fft_length is None: fft_length = _enclosing_power_of_two(frame_length) else: fft_length = ops.convert_to_tensor(fft_length, name='fft_length') fft_length.shape.assert_has_rank(0) real_frames = fft_ops.irfft(stfts, [fft_length]) # frame_length may be larger or smaller than fft_length, so we pad or # truncate real_frames to frame_length. frame_length_static = tensor_util.constant_value(frame_length) # If we don't know the shape of real_frames's inner dimension, pad and # truncate to frame_length. if (frame_length_static is None or real_frames.shape.ndims is None or real_frames.shape.as_list()[-1] is None): real_frames = real_frames[..., :frame_length] real_frames_rank = array_ops.rank(real_frames) real_frames_shape = array_ops.shape(real_frames) paddings = array_ops.concat( [array_ops.zeros([real_frames_rank - 1, 2], dtype=frame_length.dtype), [[0, math_ops.maximum(0, frame_length - real_frames_shape[-1])]]], 0) real_frames = array_ops.pad(real_frames, paddings) # We know real_frames's last dimension and frame_length statically. If they # are different, then pad or truncate real_frames to frame_length. elif real_frames.shape.as_list()[-1] > frame_length_static: real_frames = real_frames[..., :frame_length_static] elif real_frames.shape.as_list()[-1] < frame_length_static: pad_amount = frame_length_static - real_frames.shape.as_list()[-1] real_frames = array_ops.pad(real_frames, [[0, 0]] * (real_frames.shape.ndims - 1) + [[0, pad_amount]]) # The above code pads the inner dimension of real_frames to frame_length, # but it does so in a way that may not be shape-inference friendly. # Restore shape information if we are able to. if frame_length_static is not None and real_frames.shape.ndims is not None: real_frames.set_shape([None] * (real_frames.shape.ndims - 1) + [frame_length_static]) # Optionally window and overlap-add the inner 2 dimensions of real_frames # into a single [samples] dimension. if window_fn is not None: window = window_fn(frame_length, dtype=stfts.dtype.real_dtype) real_frames *= window return reconstruction_ops.overlap_and_add(real_frames, frame_step) def _enclosing_power_of_two(value): """Return 2**N for integer N such that 2**N >= value.""" value_static = tensor_util.constant_value(value) if value_static is not None: return constant_op.constant( int(2**np.ceil(np.log(value_static) / np.log(2.0))), value.dtype) return math_ops.cast( math_ops.pow( 2.0, math_ops.ceil( math_ops.log(math_ops.cast(value, dtypes.float32)) / math_ops.log(2.0))), value.dtype) @tf_export('signal.mdct') @dispatch.add_dispatch_support def mdct(signals, frame_length, window_fn=window_ops.vorbis_window, pad_end=False, norm=None, name=None): """Computes the [Modified Discrete Cosine Transform][mdct] of `signals`. Implemented with TPU/GPU-compatible ops and supports gradients. Args: signals: A `[..., samples]` `float32`/`float64` `Tensor` of real-valued signals. frame_length: An integer scalar `Tensor`. The window length in samples which must be divisible by 4. window_fn: A callable that takes a frame_length and a `dtype` keyword argument and returns a `[frame_length]` `Tensor` of samples in the provided datatype. If set to `None`, a rectangular window with a scale of 1/sqrt(2) is used. For perfect reconstruction of a signal from `mdct` followed by `inverse_mdct`, please use `tf.signal.vorbis_window`, `tf.signal.kaiser_bessel_derived_window` or `None`. If using another window function, make sure that w[n]^2 + w[n + frame_length // 2]^2 = 1 and w[n] = w[frame_length - n - 1] for n = 0,...,frame_length // 2 - 1 to achieve perfect reconstruction. pad_end: Whether to pad the end of `signals` with zeros when the provided frame length and step produces a frame that lies partially past its end. norm: If it is None, unnormalized dct4 is used, if it is "ortho" orthonormal dct4 is used. name: An optional name for the operation. Returns: A `[..., frames, frame_length // 2]` `Tensor` of `float32`/`float64` MDCT values where `frames` is roughly `samples // (frame_length // 2)` when `pad_end=False`. Raises: ValueError: If `signals` is not at least rank 1, `frame_length` is not scalar, or `frame_length` is not a multiple of `4`. [mdct]: https://en.wikipedia.org/wiki/Modified_discrete_cosine_transform """ with ops.name_scope(name, 'mdct', [signals, frame_length]): signals = ops.convert_to_tensor(signals, name='signals') signals.shape.with_rank_at_least(1) frame_length = ops.convert_to_tensor(frame_length, name='frame_length') frame_length.shape.assert_has_rank(0) # Assert that frame_length is divisible by 4. frame_length_static = tensor_util.constant_value(frame_length) if frame_length_static is not None: if frame_length_static % 4 != 0: raise ValueError('The frame length must be a multiple of 4.') frame_step = ops.convert_to_tensor(frame_length_static // 2, dtype=frame_length.dtype) else: frame_step = frame_length // 2 framed_signals = shape_ops.frame( signals, frame_length, frame_step, pad_end=pad_end) # Optionally window the framed signals. if window_fn is not None: window = window_fn(frame_length, dtype=framed_signals.dtype) framed_signals *= window else: framed_signals *= 1.0 / np.sqrt(2) split_frames = array_ops.split(framed_signals, 4, axis=-1) frame_firsthalf = -array_ops.reverse(split_frames[2], [-1]) - split_frames[3] frame_secondhalf = split_frames[0] - array_ops.reverse(split_frames[1], [-1]) frames_rearranged = array_ops.concat((frame_firsthalf, frame_secondhalf), axis=-1) # Below call produces the (frame_length // 2) unique components of the # type 4 orthonormal DCT of the real windowed signals in frames_rearranged. return dct_ops.dct(frames_rearranged, type=4, norm=norm) @tf_export('signal.inverse_mdct') @dispatch.add_dispatch_support def inverse_mdct(mdcts, window_fn=window_ops.vorbis_window, norm=None, name=None): """Computes the inverse modified DCT of `mdcts`. To reconstruct an original waveform, the same window function should be used with `mdct` and `inverse_mdct`. Example usage: >>> @tf.function ... def compare_round_trip(): ... samples = 1000 ... frame_length = 400 ... halflen = frame_length // 2 ... waveform = tf.random.normal(dtype=tf.float32, shape=[samples]) ... waveform_pad = tf.pad(waveform, [[halflen, 0],]) ... mdct = tf.signal.mdct(waveform_pad, frame_length, pad_end=True, ... window_fn=tf.signal.vorbis_window) ... inverse_mdct = tf.signal.inverse_mdct(mdct, ... window_fn=tf.signal.vorbis_window) ... inverse_mdct = inverse_mdct[halflen: halflen + samples] ... return waveform, inverse_mdct >>> waveform, inverse_mdct = compare_round_trip() >>> np.allclose(waveform.numpy(), inverse_mdct.numpy(), rtol=1e-3, atol=1e-4) True Implemented with TPU/GPU-compatible ops and supports gradients. Args: mdcts: A `float32`/`float64` `[..., frames, frame_length // 2]` `Tensor` of MDCT bins representing a batch of `frame_length // 2`-point MDCTs. window_fn: A callable that takes a frame_length and a `dtype` keyword argument and returns a `[frame_length]` `Tensor` of samples in the provided datatype. If set to `None`, a rectangular window with a scale of 1/sqrt(2) is used. For perfect reconstruction of a signal from `mdct` followed by `inverse_mdct`, please use `tf.signal.vorbis_window`, `tf.signal.kaiser_bessel_derived_window` or `None`. If using another window function, make sure that w[n]^2 + w[n + frame_length // 2]^2 = 1 and w[n] = w[frame_length - n - 1] for n = 0,...,frame_length // 2 - 1 to achieve perfect reconstruction. norm: If "ortho", orthonormal inverse DCT4 is performed, if it is None, a regular dct4 followed by scaling of `1/frame_length` is performed. name: An optional name for the operation. Returns: A `[..., samples]` `Tensor` of `float32`/`float64` signals representing the inverse MDCT for each input MDCT in `mdcts` where `samples` is `(frames - 1) * (frame_length // 2) + frame_length`. Raises: ValueError: If `mdcts` is not at least rank 2. [mdct]: https://en.wikipedia.org/wiki/Modified_discrete_cosine_transform """ with ops.name_scope(name, 'inverse_mdct', [mdcts]): mdcts = ops.convert_to_tensor(mdcts, name='mdcts') mdcts.shape.with_rank_at_least(2) half_len = math_ops.cast(mdcts.shape[-1], dtype=dtypes.int32) if norm is None: half_len_float = math_ops.cast(half_len, dtype=mdcts.dtype) result_idct4 = (0.5 / half_len_float) * dct_ops.dct(mdcts, type=4) elif norm == 'ortho': result_idct4 = dct_ops.dct(mdcts, type=4, norm='ortho') split_result = array_ops.split(result_idct4, 2, axis=-1) real_frames = array_ops.concat((split_result[1], -array_ops.reverse(split_result[1], [-1]), -array_ops.reverse(split_result[0], [-1]), -split_result[0]), axis=-1) # Optionally window and overlap-add the inner 2 dimensions of real_frames # into a single [samples] dimension. if window_fn is not None: window = window_fn(2 * half_len, dtype=mdcts.dtype) real_frames *= window else: real_frames *= 1.0 / np.sqrt(2) return reconstruction_ops.overlap_and_add(real_frames, half_len)
apache-2.0
kenshay/ImageScript
ProgramData/SystemFiles/Python/Lib/site-packages/OpenGL/GL/MESA/resize_buffers.py
9
1565
'''OpenGL extension MESA.resize_buffers This module customises the behaviour of the OpenGL.raw.GL.MESA.resize_buffers to provide a more Python-friendly API Overview (from the spec) Mesa is often used as a client library with no integration with the computer's window system (an X server, for example). And since Mesa does not have an event loop nor window system callbacks, it cannot properly respond to window system events. In particular, Mesa cannot automatically detect when a window has been resized. Mesa's glViewport command queries the current window size and updates its internal data structors accordingly. This normally works fine since most applications call glViewport in responce to window size changes. In some situations, however, the application may not call glViewport when a window size changes but would still like Mesa to adjust to the new window size. This extension exports a new function to solve this problem. The official definition of this extension is available here: http://www.opengl.org/registry/specs/MESA/resize_buffers.txt ''' from OpenGL import platform, constant, arrays from OpenGL import extensions, wrapper import ctypes from OpenGL.raw.GL import _types, _glgets from OpenGL.raw.GL.MESA.resize_buffers import * from OpenGL.raw.GL.MESA.resize_buffers import _EXTENSION_NAME def glInitResizeBuffersMESA(): '''Return boolean indicating whether this extension is available''' from OpenGL import extensions return extensions.hasGLExtension( _EXTENSION_NAME ) ### END AUTOGENERATED SECTION
gpl-3.0
nin042/phantomjs
src/qt/qtwebkit/Tools/Scripts/webkitpy/common/system/urlfetcher_mock.py
165
2053
# Copyright (C) 2011 Google Inc. All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: # # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above # copyright notice, this list of conditions and the following disclaimer # in the documentation and/or other materials provided with the # distribution. # * Neither the name of Google Inc. nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. def make_fetcher_cls(urls): """UrlFetcher factory routine that simulates network access using a dict of URLs -> contents.""" class MockFetcher(object): def __init__(self, filesystem): self._filesystem = filesystem def fetch(self, url): return urls[url] def fetch_into_file(self, url): f, fn = self._filesystem.open_binary_tempfile('mockfetcher') f.write(self.fetch(url)) f.close() return fn return MockFetcher
bsd-3-clause
pmarques/ansible
test/integration/targets/dict_transformations/library/convert_snake_case.py
29
1432
#!/usr/bin/python # -*- coding: utf-8 -*- # GNU General Public License v3.0+ (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt) from __future__ import absolute_import, division, print_function __metaclass__ = type DOCUMENTATION = ''' --- module: convert_snake_case short_description: test converting data to snake_case description: test converting data to snake_case options: data: description: Data to modify type: dict required: True reversible: description: - Make the snake_case conversion in a way that can be converted back to the original value - For example, convert IAMUser to i_a_m_user instead of iam_user default: False ignore_list: description: list of top level keys that should not have their contents converted type: list default: [] ''' from ansible.module_utils.basic import AnsibleModule from ansible.module_utils.common.dict_transformations import camel_dict_to_snake_dict def main(): module = AnsibleModule( argument_spec=dict( data=dict(type='dict', required=True), reversible=dict(type='bool', default=False), ignore_list=dict(type='list', default=[]), ), ) result = camel_dict_to_snake_dict( module.params['data'], module.params['reversible'], module.params['ignore_list'] ) module.exit_json(data=result) if __name__ == '__main__': main()
gpl-3.0
stephen144/odoo
addons/account_budget/wizard/account_budget_analytic.py
47
1099
# -*- coding: utf-8 -*- # Part of Odoo. See LICENSE file for full copyright and licensing details. import time from openerp.osv import fields, osv class account_budget_analytic(osv.osv_memory): _name = 'account.budget.analytic' _description = 'Account Budget report for analytic account' _columns = { 'date_from': fields.date('Start of period', required=True), 'date_to': fields.date('End of period', required=True), } _defaults = { 'date_from': lambda *a: time.strftime('%Y-01-01'), 'date_to': lambda *a: time.strftime('%Y-%m-%d'), } def check_report(self, cr, uid, ids, context=None): if context is None: context = {} data = self.read(cr, uid, ids, context=context)[0] datas = { 'ids': context.get('active_ids', []), 'model': 'account.analytic.account', 'form': data } datas['form']['ids'] = datas['ids'] return self.pool['report'].get_action(cr, uid, [], 'account_budget.report_analyticaccountbudget', data=datas, context=context)
agpl-3.0
Adel-Magebinary/odoo
addons/crm_claim/report/__init__.py
446
1080
# -*- coding: utf-8 -*- ############################################################################## # # OpenERP, Open Source Management Solution # Copyright (C) 2004-2010 Tiny SPRL (<http://tiny.be>). # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## import crm_claim_report # vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
agpl-3.0
jelugbo/ddi
common/djangoapps/user_api/tests/test_profile_api.py
8
4688
# -*- coding: utf-8 -*- """ Tests for the profile API. """ from django.test import TestCase import ddt from nose.tools import raises from dateutil.parser import parse as parse_datetime from user_api.api import account as account_api from user_api.api import profile as profile_api from user_api.models import UserProfile @ddt.ddt class ProfileApiTest(TestCase): USERNAME = u'frank-underwood' PASSWORD = u'ṕáśśẃőŕd' EMAIL = u'frank+underwood@example.com' def test_create_profile(self): # Create a new account, which should have an empty profile by default. account_api.create_account(self.USERNAME, self.PASSWORD, self.EMAIL) # Retrieve the profile, expecting default values profile = profile_api.profile_info(username=self.USERNAME) self.assertEqual(profile, { 'username': self.USERNAME, 'email': self.EMAIL, 'full_name': u'', }) def test_update_full_name(self): account_api.create_account(self.USERNAME, self.PASSWORD, self.EMAIL) profile_api.update_profile(self.USERNAME, full_name=u'ȻħȺɍłɇs') profile = profile_api.profile_info(self.USERNAME) self.assertEqual(profile['full_name'], u'ȻħȺɍłɇs') @raises(profile_api.ProfileInvalidField) @ddt.data('', 'a' * profile_api.FULL_NAME_MAX_LENGTH + 'a') def test_update_full_name_invalid(self, invalid_name): account_api.create_account(self.USERNAME, self.PASSWORD, self.EMAIL) profile_api.update_profile(self.USERNAME, full_name=invalid_name) @raises(profile_api.ProfileUserNotFound) def test_update_profile_no_user(self): profile_api.update_profile(self.USERNAME, full_name='test') def test_retrieve_profile_no_user(self): profile = profile_api.profile_info('does not exist') self.assertIs(profile, None) def test_record_name_change_history(self): account_api.create_account(self.USERNAME, self.PASSWORD, self.EMAIL) # Change the name once # Since the original name was an empty string, expect that the list # of old names is empty profile_api.update_profile(self.USERNAME, full_name='new name') meta = UserProfile.objects.get(user__username=self.USERNAME).get_meta() self.assertEqual(meta, {}) # Change the name again and expect the new name is stored in the history profile_api.update_profile(self.USERNAME, full_name='another new name') meta = UserProfile.objects.get(user__username=self.USERNAME).get_meta() self.assertEqual(len(meta['old_names']), 1) name, rationale, timestamp = meta['old_names'][0] self.assertEqual(name, 'new name') self.assertEqual(rationale, u'') self._assert_is_datetime(timestamp) # Change the name a third time and expect both names are stored in the history profile_api.update_profile(self.USERNAME, full_name='yet another new name') meta = UserProfile.objects.get(user__username=self.USERNAME).get_meta() self.assertEqual(len(meta['old_names']), 2) name, rationale, timestamp = meta['old_names'][1] self.assertEqual(name, 'another new name') self.assertEqual(rationale, u'') self._assert_is_datetime(timestamp) def test_update_and_retrieve_preference_info(self): account_api.create_account(self.USERNAME, self.PASSWORD, self.EMAIL) profile_api.update_preferences(self.USERNAME, preference_key='preference_value') preferences = profile_api.preference_info(self.USERNAME) self.assertEqual(preferences['preference_key'], 'preference_value') @raises(profile_api.ProfileUserNotFound) def test_retrieve_and_update_preference_info_no_user(self): preferences = profile_api.preference_info(self.USERNAME) self.assertEqual(preferences, {}) profile_api.update_preferences(self.USERNAME, preference_key='preference_value') def test_update_and_retrieve_preference_info_unicode(self): account_api.create_account(self.USERNAME, self.PASSWORD, self.EMAIL) profile_api.update_preferences(self.USERNAME, **{u'ⓟⓡⓔⓕⓔⓡⓔⓝⓒⓔ_ⓚⓔⓨ': u'ǝnןɐʌ_ǝɔuǝɹǝɟǝɹd'}) preferences = profile_api.preference_info(self.USERNAME) self.assertEqual(preferences[u'ⓟⓡⓔⓕⓔⓡⓔⓝⓒⓔ_ⓚⓔⓨ'], u'ǝnןɐʌ_ǝɔuǝɹǝɟǝɹd') def _assert_is_datetime(self, timestamp): if not timestamp: return False try: parse_datetime(timestamp) except ValueError: return False else: return True
agpl-3.0
BT-fgarbely/bank-statement-reconcile
__unported__/account_statement_cancel_line/wizard/cancel_statement_line.py
36
2098
# -*- coding: utf-8 -*- ############################################################################### # # # Author: Leonardo Pistone # Copyright 2014 Camptocamp SA # # # This program is free software: you can redistribute it and/or modify # # it under the terms of the GNU Affero General Public License as # # published by the Free Software Foundation, either version 3 of the # # License, or (at your option) any later version. # # # # This program is distributed in the hope that it will be useful, # # but WITHOUT ANY WARRANTY; without even the implied warranty of # # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # # GNU Affero General Public License for more details. # # # # You should have received a copy of the GNU Affero General Public License # # along with this program. If not, see <http://www.gnu.org/licenses/>. # # # ############################################################################### """Wizard to Cancel a Statement Line.""" from openerp.osv import orm class wizard_cancel_statement_line(orm.TransientModel): """Wizard to Cancel a Statement Line.""" _name = "wizard.cancel.statement.line" _description = "Cancel Statement Line" _columns = { } def unreconcile(self, cr, uid, ids, context=None): """Proceed and cancel the statement line, return Action. This will delete the move.line and the reconciliation. """ return self.pool['account.bank.statement.line'].cancel( cr, uid, context['active_ids'], context=context )
agpl-3.0
anetasie/sherpa
sherpa/image/pyds9_backend.py
3
5786
# # Copyright (C) 2007 Smithsonian Astrophysical Observatory # # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License along # with this program; if not, write to the Free Software Foundation, Inc., # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. # from itertools import izip import numpy import time import ds9 from sherpa.utils import get_keyword_defaults, SherpaFloat from sherpa.utils.err import DS9Err _target = 'sherpa' def _get_win(): return ds9.ds9(_target) def doOpen(): _get_win() def isOpen(): targets = ds9.ds9_targets() if targets is None: return False if type(targets) in (list,): for target in targets: if _target in target: return True return False def close(): if isOpen(): imager = _get_win() imager.set("quit") def delete_frames(): if not isOpen(): raise DS9Err('open') imager = _get_win() try: imager.set("frame delete all") return imager.set("frame new") except: raise DS9Err('delframe') def get_region(coord): if not isOpen(): raise DS9Err('open') imager = _get_win() try: regionstr = "regions -format saoimage -strip yes" if (coord != ''): if (coord != 'image'): regionstr = "regions -format ciao -strip yes -system " + str(coord) else: regionstr = "regions -format saoimage -strip yes -system image" reg = imager.get(regionstr) reg = reg.replace(';','') return reg except: raise DS9Err('retreg') def image(arr, newframe=False, tile=False): if not isOpen(): doOpen() imager = _get_win() if newframe is True: try: imager.set("frame new") imager.set("frame last") except: raise DS9Err('newframe') try: if tile is True: imager.set("tile yes") else: imager.set("tile no") except: raise DS9Err('settile') time.sleep(1) try: # pyds9 expects shape[::-1] compared to DS9.py # therefore transpose the image before sending arr = numpy.asarray(arr, dtype=SherpaFloat) imager.set_np2arr(arr.T) except: raise # DS9Err('noimage') def _set_wcs(keys): eqpos, sky, name = keys phys = '' wcs = "OBJECT = '%s'\n" % name if eqpos is not None: wcrpix = eqpos.crpix wcrval = eqpos.crval wcdelt = eqpos.cdelt if sky is not None: pcrpix = sky.crpix pcrval = sky.crval pcdelt = sky.cdelt # join together all strings with a '\n' between each phys = '\n'.join(["WCSNAMEP = 'PHYSICAL'", "CTYPE1P = 'x '", 'CRVAL1P = %.14E' % pcrval[0], 'CRPIX1P = %.14E' % pcrpix[0], 'CDELT1P = %.14E' % pcdelt[0], "CTYPE2P = 'y '", 'CRVAL2P = %.14E' % pcrval[1], 'CRPIX2P = %.14E' % pcrpix[1], 'CDELT2P = %.14E' % pcdelt[1]]) if eqpos is not None: wcdelt = wcdelt * pcdelt wcrpix = ((wcrpix - pcrval) / pcdelt + pcrpix ) if eqpos is not None: # join together all strings with a '\n' between each wcs = wcs + '\n'.join(["RADECSYS = 'ICRS '", "CTYPE1 = 'RA---TAN'", 'CRVAL1 = %.14E' % wcrval[0], 'CRPIX1 = %.14E' % wcrpix[0], 'CDELT1 = %.14E' % wcdelt[0], "CTYPE2 = 'DEC--TAN'", 'CRVAL2 = %.14E' % wcrval[1], 'CRPIX2 = %.14E' % wcrpix[1], 'CDELT2 = %.14E' % wcdelt[1]]) # join the wcs and physical with '\n' between them and at the end return ('\n'.join([wcs,phys]) + '\n') def wcs(keys): if not isOpen(): raise DS9Err('open') imager = _get_win() info = _set_wcs( keys ) try: # use stdin to pass the WCS info imager.set('wcs replace', info) except: raise DS9Err('setwcs') def open(): doOpen() def set_region(reg, coord): if not isOpen(): raise DS9Err('open') imager = _get_win() try: if (access(reg, R_OK) is True): imager.set("regions load " + "'" + reg + "'") else: # Assume region string has to be in CIAO format regions = reg.split(";") for region in regions: if (region != ''): if (coord != ''): imager.set("regions", str(coord) + ";" + region) else: imager.set("regions", region) except: raise DS9Err('badreg', str(reg)) def xpaget(arg): if not isOpen(): raise DS9Err('open') imager = _get_win() return imager.get(arg) def xpaset(arg, data=None): if not isOpen(): raise DS9Err('open') imager = _get_win() return imager.set(arg, data)
gpl-3.0
dlazz/ansible
lib/ansible/modules/cloud/amazon/ec2_vpc_peer.py
13
14169
#!/usr/bin/python # Copyright: Ansible Project # GNU General Public License v3.0+ (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt) from __future__ import absolute_import, division, print_function __metaclass__ = type ANSIBLE_METADATA = {'metadata_version': '1.1', 'status': ['stableinterface'], 'supported_by': 'community'} DOCUMENTATION = ''' module: ec2_vpc_peer short_description: create, delete, accept, and reject VPC peering connections between two VPCs. description: - Read the AWS documentation for VPC Peering Connections U(https://docs.aws.amazon.com/AmazonVPC/latest/UserGuide/vpc-peering.html). version_added: "2.2" options: vpc_id: description: - VPC id of the requesting VPC. required: false peering_id: description: - Peering connection id. required: false peer_region: description: - Region of the accepting VPC. required: false version_added: '2.5' peer_vpc_id: description: - VPC id of the accepting VPC. required: false peer_owner_id: description: - The AWS account number for cross account peering. required: false tags: description: - Dictionary of tags to look for and apply when creating a Peering Connection. required: false state: description: - Create, delete, accept, reject a peering connection. required: false default: present choices: ['present', 'absent', 'accept', 'reject'] author: Mike Mochan (@mmochan) extends_documentation_fragment: - aws - ec2 requirements: [ botocore, boto3, json ] ''' EXAMPLES = ''' # Complete example to create and accept a local peering connection. - name: Create local account VPC peering Connection ec2_vpc_peer: region: ap-southeast-2 vpc_id: vpc-12345678 peer_vpc_id: vpc-87654321 state: present tags: Name: Peering connection for VPC 21 to VPC 22 CostCode: CC1234 Project: phoenix register: vpc_peer - name: Accept local VPC peering request ec2_vpc_peer: region: ap-southeast-2 peering_id: "{{ vpc_peer.peering_id }}" state: accept register: action_peer # Complete example to delete a local peering connection. - name: Create local account VPC peering Connection ec2_vpc_peer: region: ap-southeast-2 vpc_id: vpc-12345678 peer_vpc_id: vpc-87654321 state: present tags: Name: Peering connection for VPC 21 to VPC 22 CostCode: CC1234 Project: phoenix register: vpc_peer - name: delete a local VPC peering Connection ec2_vpc_peer: region: ap-southeast-2 peering_id: "{{ vpc_peer.peering_id }}" state: absent register: vpc_peer # Complete example to create and accept a cross account peering connection. - name: Create cross account VPC peering Connection ec2_vpc_peer: region: ap-southeast-2 vpc_id: vpc-12345678 peer_vpc_id: vpc-12345678 peer_owner_id: 123456789102 state: present tags: Name: Peering connection for VPC 21 to VPC 22 CostCode: CC1234 Project: phoenix register: vpc_peer - name: Accept peering connection from remote account ec2_vpc_peer: region: ap-southeast-2 peering_id: "{{ vpc_peer.peering_id }}" profile: bot03_profile_for_cross_account state: accept register: vpc_peer # Complete example to create and accept an intra-region peering connection. - name: Create intra-region VPC peering Connection ec2_vpc_peer: region: us-east-1 vpc_id: vpc-12345678 peer_vpc_id: vpc-87654321 peer_region: us-west-2 state: present tags: Name: Peering connection for us-east-1 VPC to us-west-2 VPC CostCode: CC1234 Project: phoenix register: vpc_peer - name: Accept peering connection from peer region ec2_vpc_peer: region: us-west-2 peering_id: "{{ vpc_peer.peering_id }}" state: accept register: vpc_peer # Complete example to create and reject a local peering connection. - name: Create local account VPC peering Connection ec2_vpc_peer: region: ap-southeast-2 vpc_id: vpc-12345678 peer_vpc_id: vpc-87654321 state: present tags: Name: Peering connection for VPC 21 to VPC 22 CostCode: CC1234 Project: phoenix register: vpc_peer - name: Reject a local VPC peering Connection ec2_vpc_peer: region: ap-southeast-2 peering_id: "{{ vpc_peer.peering_id }}" state: reject # Complete example to create and accept a cross account peering connection. - name: Create cross account VPC peering Connection ec2_vpc_peer: region: ap-southeast-2 vpc_id: vpc-12345678 peer_vpc_id: vpc-12345678 peer_owner_id: 123456789102 state: present tags: Name: Peering connection for VPC 21 to VPC 22 CostCode: CC1234 Project: phoenix register: vpc_peer - name: Accept a cross account VPC peering connection request ec2_vpc_peer: region: ap-southeast-2 peering_id: "{{ vpc_peer.peering_id }}" profile: bot03_profile_for_cross_account state: accept tags: Name: Peering connection for VPC 21 to VPC 22 CostCode: CC1234 Project: phoenix # Complete example to create and reject a cross account peering connection. - name: Create cross account VPC peering Connection ec2_vpc_peer: region: ap-southeast-2 vpc_id: vpc-12345678 peer_vpc_id: vpc-12345678 peer_owner_id: 123456789102 state: present tags: Name: Peering connection for VPC 21 to VPC 22 CostCode: CC1234 Project: phoenix register: vpc_peer - name: Reject a cross account VPC peering Connection ec2_vpc_peer: region: ap-southeast-2 peering_id: "{{ vpc_peer.peering_id }}" profile: bot03_profile_for_cross_account state: reject ''' RETURN = ''' task: description: The result of the create, accept, reject or delete action. returned: success type: dict ''' try: import botocore except ImportError: pass # caught by imported HAS_BOTO3 import distutils.version import traceback from ansible.module_utils.basic import AnsibleModule from ansible.module_utils.ec2 import boto3_conn, ec2_argument_spec, get_aws_connection_info, HAS_BOTO3 from ansible.module_utils.aws.core import is_boto3_error_code def tags_changed(pcx_id, client, module): changed = False tags = dict() if module.params.get('tags'): tags = module.params.get('tags') pcx = find_pcx_by_id(pcx_id, client, module) if pcx['VpcPeeringConnections']: pcx_values = [t.values() for t in pcx['VpcPeeringConnections'][0]['Tags']] pcx_tags = [item for sublist in pcx_values for item in sublist] tag_values = [[key, str(value)] for key, value in tags.items()] tags = [item for sublist in tag_values for item in sublist] if sorted(pcx_tags) == sorted(tags): changed = False elif tags: delete_tags(pcx_id, client, module) create_tags(pcx_id, client, module) changed = True return changed def describe_peering_connections(params, client): result = client.describe_vpc_peering_connections( Filters=[ {'Name': 'requester-vpc-info.vpc-id', 'Values': [params['VpcId']]}, {'Name': 'accepter-vpc-info.vpc-id', 'Values': [params['PeerVpcId']]} ] ) if result['VpcPeeringConnections'] == []: result = client.describe_vpc_peering_connections( Filters=[ {'Name': 'requester-vpc-info.vpc-id', 'Values': [params['PeerVpcId']]}, {'Name': 'accepter-vpc-info.vpc-id', 'Values': [params['VpcId']]} ] ) return result def is_active(peering_conn): return peering_conn['Status']['Code'] == 'active' def is_pending(peering_conn): return peering_conn['Status']['Code'] == 'pending-acceptance' def create_peer_connection(client, module): changed = False params = dict() params['VpcId'] = module.params.get('vpc_id') params['PeerVpcId'] = module.params.get('peer_vpc_id') if module.params.get('peer_region'): if distutils.version.StrictVersion(botocore.__version__) < distutils.version.StrictVersion('1.8.6'): module.fail_json(msg="specifying peer_region parameter requires botocore >= 1.8.6") params['PeerRegion'] = module.params.get('peer_region') if module.params.get('peer_owner_id'): params['PeerOwnerId'] = str(module.params.get('peer_owner_id')) peering_conns = describe_peering_connections(params, client) for peering_conn in peering_conns['VpcPeeringConnections']: pcx_id = peering_conn['VpcPeeringConnectionId'] if tags_changed(pcx_id, client, module): changed = True if is_active(peering_conn): return (changed, peering_conn['VpcPeeringConnectionId']) if is_pending(peering_conn): return (changed, peering_conn['VpcPeeringConnectionId']) try: peering_conn = client.create_vpc_peering_connection(**params) pcx_id = peering_conn['VpcPeeringConnection']['VpcPeeringConnectionId'] if module.params.get('tags'): create_tags(pcx_id, client, module) changed = True return (changed, peering_conn['VpcPeeringConnection']['VpcPeeringConnectionId']) except botocore.exceptions.ClientError as e: module.fail_json(msg=str(e)) def remove_peer_connection(client, module): pcx_id = module.params.get('peering_id') if not pcx_id: params = dict() params['VpcId'] = module.params.get('vpc_id') params['PeerVpcId'] = module.params.get('peer_vpc_id') params['PeerRegion'] = module.params.get('peer_region') if module.params.get('peer_owner_id'): params['PeerOwnerId'] = str(module.params.get('peer_owner_id')) peering_conns = describe_peering_connections(params, client) if not peering_conns: module.exit_json(changed=False) else: pcx_id = peering_conns['VpcPeeringConnections'][0]['VpcPeeringConnectionId'] try: params = dict() params['VpcPeeringConnectionId'] = pcx_id client.delete_vpc_peering_connection(**params) module.exit_json(changed=True) except botocore.exceptions.ClientError as e: module.fail_json(msg=str(e)) def peer_status(client, module): params = dict() params['VpcPeeringConnectionIds'] = [module.params.get('peering_id')] try: vpc_peering_connection = client.describe_vpc_peering_connections(**params) return vpc_peering_connection['VpcPeeringConnections'][0]['Status']['Code'] except is_boto3_error_code('InvalidVpcPeeringConnectionId.Malformed') as e: # pylint: disable=duplicate-except module.fail_json(msg='Malformed connection ID: {0}'.format(e), traceback=traceback.format_exc()) except botocore.exceptions.ClientError as e: # pylint: disable=duplicate-except module.fail_json(msg='Error while describing peering connection by peering_id: {0}'.format(e), traceback=traceback.format_exc()) def accept_reject(state, client, module): changed = False params = dict() params['VpcPeeringConnectionId'] = module.params.get('peering_id') if peer_status(client, module) != 'active': try: if state == 'accept': client.accept_vpc_peering_connection(**params) else: client.reject_vpc_peering_connection(**params) if module.params.get('tags'): create_tags(params['VpcPeeringConnectionId'], client, module) changed = True except botocore.exceptions.ClientError as e: module.fail_json(msg=str(e)) if tags_changed(params['VpcPeeringConnectionId'], client, module): changed = True return changed, params['VpcPeeringConnectionId'] def load_tags(module): tags = [] if module.params.get('tags'): for name, value in module.params.get('tags').items(): tags.append({'Key': name, 'Value': str(value)}) return tags def create_tags(pcx_id, client, module): try: delete_tags(pcx_id, client, module) client.create_tags(Resources=[pcx_id], Tags=load_tags(module)) except botocore.exceptions.ClientError as e: module.fail_json(msg=str(e)) def delete_tags(pcx_id, client, module): try: client.delete_tags(Resources=[pcx_id]) except botocore.exceptions.ClientError as e: module.fail_json(msg=str(e)) def find_pcx_by_id(pcx_id, client, module): try: return client.describe_vpc_peering_connections(VpcPeeringConnectionIds=[pcx_id]) except botocore.exceptions.ClientError as e: module.fail_json(msg=str(e)) def main(): argument_spec = ec2_argument_spec() argument_spec.update( dict( vpc_id=dict(), peer_vpc_id=dict(), peer_region=dict(), peering_id=dict(), peer_owner_id=dict(), tags=dict(required=False, type='dict'), profile=dict(), state=dict(default='present', choices=['present', 'absent', 'accept', 'reject']) ) ) module = AnsibleModule(argument_spec=argument_spec) if not HAS_BOTO3: module.fail_json(msg='json, botocore and boto3 are required.') state = module.params.get('state') try: region, ec2_url, aws_connect_kwargs = get_aws_connection_info(module, boto3=True) client = boto3_conn(module, conn_type='client', resource='ec2', region=region, endpoint=ec2_url, **aws_connect_kwargs) except botocore.exceptions.NoCredentialsError as e: module.fail_json(msg="Can't authorize connection - " + str(e)) if state == 'present': (changed, results) = create_peer_connection(client, module) module.exit_json(changed=changed, peering_id=results) elif state == 'absent': remove_peer_connection(client, module) else: (changed, results) = accept_reject(state, client, module) module.exit_json(changed=changed, peering_id=results) if __name__ == '__main__': main()
gpl-3.0
miguelparaiso/PracticaOdoo
addons/auth_oauth/__openerp__.py
300
1654
# -*- coding: utf-8 -*- ############################################################################## # # OpenERP, Open Source Management Solution # Copyright (C) 2010-2012 OpenERP s.a. (<http://openerp.com>). # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## { 'name': 'OAuth2 Authentication', 'version': '1.0', 'category': 'Tools', 'description': """ Allow users to login through OAuth2 Provider. ============================================= """, 'author': 'OpenERP s.a.', 'maintainer': 'OpenERP s.a.', 'website': 'https://www.odoo.com', 'depends': ['base', 'web', 'base_setup', 'auth_signup'], 'data': [ 'res_users.xml', 'auth_oauth_data.xml', 'auth_oauth_data.yml', 'auth_oauth_view.xml', 'security/ir.model.access.csv', 'res_config.xml', 'views/auth_oauth_login.xml', ], 'installable': True, 'auto_install': False, }
agpl-3.0
PixNDom/android_kernel_lenovo_Tab2A710F
tools/perf/util/setup.py
2079
1438
#!/usr/bin/python2 from distutils.core import setup, Extension from os import getenv from distutils.command.build_ext import build_ext as _build_ext from distutils.command.install_lib import install_lib as _install_lib class build_ext(_build_ext): def finalize_options(self): _build_ext.finalize_options(self) self.build_lib = build_lib self.build_temp = build_tmp class install_lib(_install_lib): def finalize_options(self): _install_lib.finalize_options(self) self.build_dir = build_lib cflags = ['-fno-strict-aliasing', '-Wno-write-strings'] cflags += getenv('CFLAGS', '').split() build_lib = getenv('PYTHON_EXTBUILD_LIB') build_tmp = getenv('PYTHON_EXTBUILD_TMP') libtraceevent = getenv('LIBTRACEEVENT') liblk = getenv('LIBLK') ext_sources = [f.strip() for f in file('util/python-ext-sources') if len(f.strip()) > 0 and f[0] != '#'] perf = Extension('perf', sources = ext_sources, include_dirs = ['util/include'], extra_compile_args = cflags, extra_objects = [libtraceevent, liblk], ) setup(name='perf', version='0.1', description='Interface with the Linux profiling infrastructure', author='Arnaldo Carvalho de Melo', author_email='acme@redhat.com', license='GPLv2', url='http://perf.wiki.kernel.org', ext_modules=[perf], cmdclass={'build_ext': build_ext, 'install_lib': install_lib})
gpl-2.0