File size: 15,540 Bytes
4faab6a 7fdd79e 4faab6a 9938028 4faab6a 7fdd79e 4faab6a 7fdd79e 9938028 7fdd79e 4faab6a 9938028 4faab6a 9938028 4faab6a 9938028 4faab6a 9938028 4faab6a 9938028 4faab6a 9938028 4faab6a 7fdd79e 9938028 4faab6a 7fdd79e 4faab6a 7fdd79e 4faab6a 7fdd79e 4faab6a 7fdd79e 9938028 7fdd79e 9938028 7fdd79e 9938028 7fdd79e 4faab6a 7fdd79e 4faab6a 7fdd79e 4faab6a 9938028 |
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250 251 252 253 254 255 256 257 258 259 260 261 262 263 264 265 266 267 268 269 270 271 272 273 274 275 276 277 278 279 280 281 282 283 284 285 286 287 288 289 290 291 292 293 294 295 296 297 298 299 300 301 302 303 304 305 306 307 308 309 310 311 312 313 314 315 316 317 318 319 320 321 322 323 324 325 326 327 328 329 330 331 332 333 334 335 336 337 338 339 340 341 342 343 344 345 346 347 348 349 350 351 352 353 354 355 356 357 358 359 360 361 362 363 364 365 366 367 368 369 370 371 372 373 374 375 376 377 378 379 380 381 382 383 384 385 386 387 388 389 390 391 392 393 394 395 396 397 398 399 400 401 402 403 404 405 406 407 408 409 410 411 412 413 414 415 416 417 418 419 420 421 422 423 424 425 426 427 428 429 430 431 432 433 434 435 436 437 438 439 |
import streamlit as st
import sys
from fragment_embedder import FragmentEmbedder
from morgan_desc import *
from physchem_desc import *
from rdkit import Chem
import pandas as pd
import os
import random
import numpy as np
import joblib
from rdkit import Chem
from rdkit.Chem import Draw
from rdkit.Chem import Draw
from rdkit.Chem import AllChem
from rdkit import DataStructs
from rdkit.Chem import Descriptors
from scipy import stats
import textwrap
from datasets import load_dataset
import requests
from io import BytesIO
import urllib.request
# import miniautoml
import warnings
warnings.filterwarnings('ignore')
st.set_page_config(
page_title="Ligand Discovery 4: Fragment Predictions",
page_icon=":home:",
layout="wide", # "centered",
initial_sidebar_state="expanded"
)
st.markdown("""
<style>
.css-13sdm1b.e16nr0p33 {
margin-top: -75px;
}
</style>
""", unsafe_allow_html=True)
hide_streamlit_style = """
<style>
#MainMenu {visibility: hidden;}
footer {visibility: hidden;}
#header {visibility: hidden;}
</style>
"""
st.markdown(hide_streamlit_style, unsafe_allow_html=True)
dataset = load_dataset('ligdis/data', data_files={"predictions.csv"})
df_predictions = dataset['train'].to_pandas()
predictions_inchikeys = df_predictions["inchikey"].tolist()
df_predictions = df_predictions.rename(columns={"inchikey": "InChIKey"})
dataset = load_dataset('ligdis/data', data_files={"applicability.csv"})
df_applicability = dataset['train'].to_pandas()
df_predictions = pd.concat([df_predictions, df_applicability], axis=1)
dataset = load_dataset('ligdis/data', data_files={"cemm_smiles.csv"})
cemm_smiles = dataset['train'].to_pandas()
fid2smi = {}
for r in cemm_smiles.values:
fid2smi[r[0]] = r[1]
fe = FragmentEmbedder()
CRF_PATTERN = "CC1(CCC#C)N=N1"
CRF_PATTERN_0 = "C#CC"
CRF_PATTERN_1 = "N=N"
dataset = load_dataset('ligdis/data', data_files={"all_fff_enamine.csv"})
enamine_catalog = dataset['train'].to_pandas()
enamine_catalog_ids_set = set(enamine_catalog["catalog_id"])
enamine_catalog_dict = {}
catalog2inchikey = {}
smiles2catalog = {}
for i, r in enumerate(enamine_catalog.values):
enamine_catalog_dict[r[0]] = r[1]
catalog2inchikey[r[0]] = predictions_inchikeys[i]
smiles2catalog[r[1]] = r[0]
def is_enamine_catalog_id(identifier):
if identifier in enamine_catalog_ids_set:
return True
else:
return False
def is_enamine_smiles(identifier):
if identifier in smiles2catalog:
return True
else:
return False
def is_ligand_discovery_id(identifier):
if identifier in fid2smi:
return True
else:
return False
def is_valid_smiles(smiles):
try:
mol = Chem.MolFromSmiles(smiles)
except:
mol = None
if mol is None:
return False
else:
return True
def has_crf(mol):
pattern = CRF_PATTERN
has_pattern = mol.HasSubstructMatch(Chem.MolFromSmarts(pattern))
if not has_pattern:
if mol.HasSubstructMatch(
Chem.MolFromSmarts(CRF_PATTERN_0)
) and mol.HasSubstructMatch(Chem.MolFromSmarts(CRF_PATTERN_1)):
return True
else:
return False
return True
dataset = load_dataset('ligdis/data', data_files={"model_catalog.csv"})
dm = dataset['train'].to_pandas()
all_models = dm["model_name"].tolist()
dataset = load_dataset('ligdis/data', data_files={"models_performance.tsv"})
dp = dataset['train'].to_pandas()
model_display = {}
model_description = {}
for r in dm.values:
model_display[r[0]] = r[1]
model_description[r[0]] = r[2]
model_auroc = {}
for r in dp.values:
model_auroc[r[0]] = r[1]
prom_models = [x for x in dm["model_name"].tolist() if x.startswith("promiscuity")]
sign_models = [x for x in dm["model_name"].tolist() if x.startswith("signature")]
global_promiscuity_models = ["promiscuity_pxf0", "promiscuity_pxf1", "promiscuity_pxf2"]
specific_promiscuity_models = ["promiscuity_fxp0_pxf0", "promiscuity_fxp1_pxf0","promiscuity_fxp2_pxf0", "promiscuity_fxp0_pxf1", "promiscuity_fxp1_pxf1", "promiscuity_fxp2_pxf1", "promiscuity_fxp0_pxf2", "promiscuity_fxp1_pxf2", "promiscuity_fxp2_pxf2"]
def model_to_markdown(model_names):
items = []
for mn in model_names:
items += [
"{0} ({1:.3f}): {2}".format(
model_display[mn].ljust(8), model_auroc[mn], model_description[mn]
)
]
markdown_list = "\n".join(items)
return markdown_list
st.sidebar.title("Ligand Discovery 4: Fragment Predictions")
placeholder_text = []
keys = random.sample(sorted(enamine_catalog_ids_set), 5)
for k in keys:
placeholder_text += [random.choice([k, enamine_catalog_dict[k]])]
placeholder_text = "\n".join(placeholder_text)
text_input = st.sidebar.text_area(label="Input your fully functionalized fragments:")
inputs = [x.strip(" ") for x in text_input.split("\n")]
inputs = [x for x in inputs if x != ""]
if len(inputs) > 999:
st.sidebar.error("Please limit the number of input fragments to 999.")
st.sidebar.info("This tool expects fully functionalized fragments (FFF) as input, including the diazirine+alkyne probe (CRF). We have tailored the chemical space of the predictions to FFFs; the app will through an error if any of the input molecules does not contain a CRF region. Enamine provides a good [catalog](https://enamine.net/compound-libraries/fragment-libraries/fully-functionalized-probe-library) of FFFs. For a quick test input, use any of the options below")
example_0 = ["Z5645472552", "Z5645472643", "Z5645472785"]
st.sidebar.markdown("**Input Enamine FFF identifiers...**")
st.sidebar.text("\n".join(example_0))
example_1 = ["C#CCCC1(CCCNC(=O)C(Cc2c[nH]c3ncccc23)NC(=O)OC(C)(C)C)N=N1", "C#CCCC1(CCCNC(=O)[C@H]2CCC(=O)NC2)N=N1", "C#CCCC1(CCCNC(=O)CSc2ncc(C(=O)OCC)c(N)n2)N=N1"]
st.sidebar.markdown("**Input FFF SMILES strings...**")
st.sidebar.text("\n".join(example_1))
example_2 = ["C310", "C045", "C391"]
st.sidebar.markdown("**Input Ligand Discovery identifiers...**")
st.sidebar.text("\n".join(example_2))
example_3 = ["Z5645486561", "C#CCCCC1(CCCC(=O)N2CCC(C(C(=O)O)c3ccc(C)cc3)CC2)N=N1", "C279"]
st.sidebar.markdown("**Input a mix of the above identifiers**")
st.sidebar.text("\n".join(example_3))
R = []
all_inputs_are_valid = True
for i, inp in enumerate(inputs):
input_id = "input-{0}".format(str(i).zfill(3))
if is_enamine_catalog_id(inp):
smiles = enamine_catalog_dict[inp]
inchikey = catalog2inchikey[inp]
r = [inp, smiles, inchikey]
elif is_ligand_discovery_id(inp):
smiles = fid2smi[inp]
inchikey = Chem.MolToInchiKey(Chem.MolFromSmiles(smiles))
r = [inp, smiles, inchikey]
elif is_enamine_smiles(inp):
smiles = inp
inp = smiles2catalog[smiles]
inchikey = catalog2inchikey[inp]
r = [inp, smiles, inchikey]
elif is_valid_smiles(inp):
mol = Chem.MolFromSmiles(inp)
if has_crf(mol):
inchikey = Chem.rdinchi.InchiToInchiKey(Chem.MolToInchi(mol))
r = [inchikey, inp, inchikey]
else:
st.error(
"Input SMILES {0} does not have the CRF. The CRF pattern is {1}.".format(
inp, CRF_PATTERN
)
)
all_inputs_are_valid = False
else:
st.error(
"Input {0} is not valid. Please enter a valid fully-functionalized fragment SMILES string or an Enamine catalog identifier of a fully-functionalized fragment".format(
inp
)
)
all_inputs_are_valid = False
R += [r]
def get_fragment_image(smiles):
m = Chem.MolFromSmiles(smiles)
AllChem.Compute2DCoords(m)
im = Draw.MolToImage(m, size=(200, 200))
return im
st.markdown(
"""
Explanation for Output: The results are displayed in 4 Columns.
1. **Structure** of the FFF, InChi, Enamine ID
2. **Chemical space**: Displays the Molecular Weight (*MW*), Walden-Crippen *LogP* and Tanimoto Similarity to the most similar fragment (*Sim-1*) and third most similar fragment (*Sim-3*) in the training set
3. **Promiscuity Predictions** based on 12 Model: 3 Global (section **A**) and 9 Specific (section **B**)
4. **Ontology Predictions** based on 9 _Signature_ Models derived from protein annotations of multiple scopes - from domains and families to molecular functions and cellular localization
"""
)
myCol = st.columns(3)
with myCol[0]:
st.subheader("Promiscuity Predictions")
st.markdown("**A. Global models**")
st.text(model_to_markdown(global_promiscuity_models))
st.markdown("**C. Aggregated score**")
st.text("Sum : Sum of individual promiscuity predictors")
with myCol[1]:
st.text("")
st.text("")
st.markdown("**B. Specific models**")
st.text(model_to_markdown(specific_promiscuity_models))
with myCol[2]:
st.subheader("Ontology Predictions")
signature_models = ["signature_{0}".format(i) for i in range(10)]
st.text(model_to_markdown(signature_models))
st.markdown(
"""
- Model score (range 0 -> 1) corresponds to the mean AUROC in 10 train-test splits
- Percentages in parenthesis denote the percentile of the score across the Enamine collection of FFFs (>250k compounds). for example, in "Sign-4: 0.02 (35.7%)", **35.7** is the percentile of score.
- The exclamation sign (!) next to the prediction output indicates that the corresponding model has an AUROC accuracy below 0.7 (*! is a warning sign*)
"""
)
st.divider()
if all_inputs_are_valid and len(R) > 0:
sum_of_promiscuities = np.sum(
df_predictions[global_promiscuity_models + specific_promiscuity_models], axis=1
)
df = pd.DataFrame(R, columns=["Identifier", "SMILES", "InChIKey"])
my_inchikeys = df["InChIKey"].tolist()
df_done = df[df["InChIKey"].isin(predictions_inchikeys)]
df_todo = df[~df["InChIKey"].isin(predictions_inchikeys)]
if df_done.shape[0] > 0:
df_done = df_done.merge(
df_predictions, on="InChIKey", how="left"
).drop_duplicates()
if df_todo.shape[0] > 0:
X = fe.transform(df_todo["SMILES"].tolist())
st.info("Making predictions... this make take a few seconds. Please be patient. We may experience high traffic. If something goes wrong, please try again later.")
progress_bar = st.progress(0)
for i, model_name in enumerate(all_models):
url = ''.join(('https://huggingface.co/ligdis/fpred/resolve/main/', model_name, '.joblib')) # The URL of the file you want to load
with urllib.request.urlopen(url) as response: # Download the file
model = joblib.load(BytesIO(response.read()))
vals = model.predict(X)
del model
progress_bar.progress((i + 1) / len(all_models))
df_todo[model_name] = vals
url = 'https://huggingface.co/ligdis/fpred/resolve/main/cemm_ecfp_2_1024.joblib' # The URL of the file you want to load
with urllib.request.urlopen(url) as response: # Download the file
dataset_fps = joblib.load(BytesIO(response.read()))
all_query_smiles = df_todo["SMILES"].tolist()
sims_1 = []
sims_3 = []
logps = []
mwts = []
for query_smiles in all_query_smiles:
query_mol = Chem.MolFromSmiles(query_smiles)
query_fp = AllChem.GetMorganFingerprintAsBitVect(query_mol, 2, nBits=1024)
similarity_scores = [
DataStructs.TanimotoSimilarity(query_fp, dataset_fp)
for dataset_fp in dataset_fps
]
sorted_scores_indices = sorted(
enumerate(similarity_scores), key=lambda x: x[1], reverse=True
)
top_n = 3
sims_1 += [sorted_scores_indices[0][1]]
sims_3 += [sorted_scores_indices[2][1]]
logps += [Descriptors.MolLogP(query_mol)]
mwts += [Descriptors.MolWt(query_mol)]
results = {"sims-1": sims_1, "sims-3": sims_3, "logp": logps, "mw": mwts}
for k in ["sims-1", "sims-3", "logp", "mw"]:
df_todo[k] = results[k]
if df_done.shape[0] > 0 and df_todo.shape[0] > 0:
df_ = pd.concat([df_done, df_todo])
else:
if df_done.shape[0] > 0:
df_ = df_done
else:
df_ = df_todo
df_ = df_.drop(columns=["Identifier", "SMILES"])
df = df.merge(df_, on="InChIKey", how="left")
df.drop_duplicates(subset=['InChIKey'], keep='first', inplace=True, ignore_index=True)
df = df.rename(columns=model_display)
applicability_display = {
"mw": "MW",
"logp": "LogP",
"sims-1": "Sim-1",
"sims-3": "Sim-3",
}
df = df.rename(columns=applicability_display)
df_predictions = df_predictions.rename(columns=model_display)
df_predictions = df_predictions.rename(columns=applicability_display)
prom_columns = []
for i in range(3):
prom_columns += ["Prom-{0}".format(i)]
for j in range(3):
prom_columns += ["Prom-{0}-{0}".format(i, j)]
def identifiers_text(ik, smi, ident):
s = ["{0}".format(ik), "{0}".format(smi)]
if ik != ident:
s += ["{0}".format(ident)]
return "\n".join(s)
def score_text(v, c):
all_scores = np.array(df_predictions[c])
perc = stats.percentileofscore(all_scores, v)
t = "{0}: {1:.2f} ({2:.1f}%)".format(c.ljust(8), v, perc).ljust(22)
if c == "Sign-4" or c == "Sign-7" or c == "Sign-3":
t += " (!)"
return t
def score_texts(vs, cs):
all_texts = []
for v, c in zip(vs, cs):
all_texts += [score_text(v, c)]
return "\n".join(all_texts)
dorig = pd.DataFrame({"InChIKey": my_inchikeys})
df = dorig.merge(df, on="InChIKey", how="left")
df = df.reset_index(inplace=False, drop=True)
for i, r in enumerate(df.iterrows()):
v = r[1]
st.markdown("#### Input {0}: `{1}`".format(i+1, inputs[r[0]]))
cols = st.columns(4)
cols[0].markdown("**Fragment**")
cols[0].image(get_fragment_image(v["SMILES"]))
cols[0].text(identifiers_text(v["InChIKey"], v["SMILES"], v["Identifier"]))
cols[1].markdown("**Chemical space**")
my_cols = ["MW", "LogP", "Sim-1", "Sim-3"]
cols[1].text(score_texts(v[my_cols], my_cols))
cols[2].markdown("**Promiscuity**")
sum_prom = np.sum(v[prom_columns])
perc_prom = stats.percentileofscore(sum_of_promiscuities, sum_prom)
my_cols = ["Prom-0", "Prom-1", "Prom-2"]
cols[2].text(score_texts(v[my_cols], my_cols))
my_cols = [
"Prom-0-0",
"Prom-0-1",
"Prom-0-2",
"Prom-1-0",
"Prom-1-1",
"Prom-1-2",
"Prom-2-0",
"Prom-2-1",
"Prom-2-2",
]
cols[2].text(score_texts(v[my_cols], my_cols))
cols[2].text("Sum : {0:.2f} ({1:.1f}%)".format(sum_prom, perc_prom))
cols[3].markdown("**Signatures**")
my_cols = ["Sign-{0}".format(i) for i in range(10)]
cols[3].text(score_texts(v[my_cols], my_cols))
st.divider()
def convert_df(df):
return df.to_csv(index=False).encode("utf-8")
csv = convert_df(df)
st.download_button(
"Download as CSV", csv, "predictions.csv", "text/csv", key="download-csv"
)
|