Spaces:
Runtime error
Runtime error
File size: 51,330 Bytes
ac0d410 b18cfa0 87ac600 b18cfa0 a54c76c b18cfa0 aecf51b ac0d410 3d4922f d2f237b 3d4922f ac0d410 b7a9482 a1cee59 b7a9482 26cfee5 360448f e7217e1 2780791 b7a9482 a1cee59 b7a9482 360448f 26cfee5 360448f b7a9482 360448f 26cfee5 360448f 26cfee5 b7a9482 a1cee59 51b4bcc d3c3431 51b4bcc 63c87ea a1cee59 63c87ea a1cee59 51b4bcc d3c3431 a1cee59 b18cfa0 a54c76c b18cfa0 a54c76c b18cfa0 87ac600 a54c76c 9a65f4e b18cfa0 9a65f4e 53712e3 b18cfa0 9a65f4e b18cfa0 53712e3 b18cfa0 9a65f4e 53712e3 b18cfa0 a54c76c b18cfa0 a54c76c b18cfa0 a54c76c b18cfa0 291f90f 526a32d 291f90f e7217e1 291f90f e7217e1 47fd570 526a32d 47fd570 e921d38 526a32d e7217e1 526a32d e7217e1 47fd570 3d4922f 47fd570 526a32d 291f90f 47fd570 ac0d410 6394787 ac0d410 6394787 6b65aed 6394787 6b65aed 6394787 860c7cd 71f8c18 6394787 71f8c18 2780791 71f8c18 526a32d 291f90f a0082eb 526a32d e7217e1 b7a9482 a1cee59 b7a9482 a1cee59 b7a9482 4eda0f0 53f3a69 a2aa450 53f3a69 a2aa450 5ecdd8c a2aa450 53f3a69 b7a9482 e7217e1 291f90f e7217e1 291f90f e7217e1 b7a9482 b18cfa0 87ac600 b18cfa0 65e7b4e b18cfa0 4eda0f0 a1cee59 51b4bcc a1cee59 51b4bcc a1cee59 51b4bcc d3c3431 51b4bcc a1cee59 b7a9482 e7217e1 53f3a69 e7217e1 4eda0f0 a1cee59 53f3a69 e7217e1 b7a9482 53f3a69 e7217e1 4eda0f0 a1cee59 53f3a69 b7a9482 53f3a69 b7a9482 7ebefed |
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250 251 252 253 254 255 256 257 258 259 260 261 262 263 264 265 266 267 268 269 270 271 272 273 274 275 276 277 278 279 280 281 282 283 284 285 286 287 288 289 290 291 292 293 294 295 296 297 298 299 300 301 302 303 304 305 306 307 308 309 310 311 312 313 314 315 316 317 318 319 320 321 322 323 324 325 326 327 328 329 330 331 332 333 334 335 336 337 338 339 340 341 342 343 344 345 346 347 348 349 350 351 352 353 354 355 356 357 358 359 360 361 362 363 364 365 366 367 368 369 370 371 372 373 374 375 376 377 378 379 380 381 382 383 384 385 386 387 388 389 390 391 392 393 394 395 396 397 398 399 400 401 402 403 404 405 406 407 408 409 410 411 412 413 414 415 416 417 418 419 420 421 422 423 424 425 426 427 428 429 430 431 432 433 434 435 436 437 438 439 440 441 442 443 444 445 446 447 448 449 450 451 452 453 454 455 456 457 458 459 460 461 462 463 464 465 466 467 468 469 470 471 472 473 474 475 476 477 478 479 480 481 482 483 484 485 486 487 488 489 490 491 492 493 494 495 496 497 498 499 500 501 502 503 504 505 506 507 508 509 510 511 512 513 514 515 516 517 518 519 520 521 522 523 524 525 526 527 528 529 530 531 532 533 534 535 536 537 538 539 540 541 542 543 544 545 546 547 548 549 550 551 552 553 554 555 556 557 558 559 560 561 562 563 564 565 566 567 568 569 570 571 572 573 574 575 576 577 578 579 580 581 582 583 584 585 586 587 588 589 590 591 592 593 594 595 596 597 598 599 600 601 602 603 604 605 606 607 608 609 610 611 612 613 614 615 616 617 618 619 620 621 622 623 624 625 626 627 628 629 630 631 632 633 634 635 636 637 638 639 640 641 642 643 644 645 646 647 648 649 650 651 652 653 654 655 656 657 658 659 660 661 662 663 664 665 666 667 668 669 670 671 672 673 674 675 676 677 678 679 680 681 682 683 684 685 686 687 688 689 690 691 692 693 694 695 696 697 698 699 700 701 702 703 704 705 706 707 708 709 710 711 712 713 714 715 716 717 718 719 720 721 722 723 724 725 726 727 728 729 730 731 732 733 734 735 736 737 738 739 740 741 742 743 744 745 746 747 748 749 750 751 752 753 754 755 756 757 758 759 760 761 762 763 764 765 766 767 768 769 770 771 772 773 774 775 776 777 778 779 780 781 782 783 784 785 786 787 788 789 790 791 792 793 794 795 796 797 798 799 800 801 802 803 804 805 806 807 808 809 810 811 812 813 814 815 816 817 818 819 820 821 822 823 824 825 826 827 828 829 830 831 832 833 834 835 836 837 838 839 840 841 842 843 844 845 846 847 848 849 850 851 852 853 854 855 856 857 858 859 860 861 862 863 864 865 866 867 868 869 870 871 872 873 874 875 876 877 878 879 880 881 882 883 884 885 886 887 888 889 890 891 892 893 894 895 896 897 898 899 900 901 902 903 904 905 906 907 908 909 910 911 912 913 914 915 916 917 918 919 920 921 922 923 924 925 926 927 928 929 930 931 932 933 934 935 936 937 938 939 940 941 942 943 944 945 946 947 948 949 950 951 952 953 954 955 956 957 958 959 960 961 962 963 964 965 966 967 968 969 970 971 972 973 974 975 976 977 978 979 980 981 982 983 984 985 986 987 988 989 990 991 992 993 994 995 996 997 998 999 1000 1001 1002 1003 1004 1005 1006 1007 1008 1009 1010 1011 1012 1013 1014 1015 1016 1017 1018 1019 1020 1021 1022 1023 1024 1025 1026 1027 1028 1029 1030 1031 1032 1033 1034 1035 1036 1037 1038 1039 1040 1041 1042 1043 1044 1045 1046 1047 1048 1049 1050 1051 1052 1053 1054 1055 1056 1057 1058 1059 1060 1061 1062 1063 1064 1065 1066 1067 1068 1069 1070 1071 1072 1073 1074 1075 1076 1077 1078 1079 1080 1081 1082 1083 1084 1085 1086 1087 1088 1089 1090 1091 1092 1093 1094 1095 1096 1097 1098 1099 1100 1101 1102 1103 1104 1105 1106 1107 1108 1109 1110 1111 1112 1113 1114 1115 1116 1117 1118 1119 1120 1121 1122 1123 1124 1125 1126 1127 1128 1129 1130 1131 1132 1133 1134 1135 1136 1137 1138 1139 1140 1141 1142 1143 1144 1145 1146 1147 1148 1149 1150 1151 1152 1153 1154 1155 1156 1157 1158 1159 1160 1161 1162 1163 1164 1165 1166 1167 1168 1169 1170 1171 1172 1173 1174 1175 1176 1177 1178 1179 1180 1181 1182 1183 1184 1185 1186 1187 1188 1189 1190 1191 1192 1193 1194 1195 1196 1197 1198 1199 1200 1201 1202 1203 1204 1205 1206 1207 1208 1209 1210 1211 1212 1213 1214 1215 1216 1217 1218 1219 1220 1221 1222 1223 1224 1225 1226 1227 1228 1229 1230 1231 1232 1233 1234 1235 1236 1237 1238 1239 1240 1241 1242 1243 1244 1245 1246 1247 1248 1249 1250 1251 1252 1253 1254 1255 1256 1257 1258 1259 1260 1261 1262 1263 1264 1265 1266 1267 1268 1269 1270 1271 1272 1273 1274 1275 1276 1277 1278 1279 1280 1281 1282 1283 1284 1285 1286 1287 1288 1289 1290 1291 1292 1293 1294 1295 1296 1297 1298 1299 1300 1301 1302 1303 1304 1305 1306 1307 1308 1309 1310 1311 1312 1313 1314 1315 1316 1317 1318 1319 1320 1321 1322 1323 1324 1325 1326 1327 1328 1329 1330 1331 1332 1333 1334 1335 1336 1337 1338 1339 1340 1341 1342 1343 1344 1345 1346 1347 1348 1349 1350 1351 1352 1353 1354 1355 1356 1357 1358 1359 1360 1361 1362 1363 1364 1365 1366 1367 1368 1369 1370 1371 1372 1373 1374 1375 1376 1377 1378 1379 1380 1381 1382 1383 1384 1385 1386 1387 1388 1389 1390 1391 1392 1393 1394 1395 1396 1397 1398 1399 1400 1401 1402 1403 1404 1405 1406 1407 1408 1409 1410 1411 1412 1413 1414 1415 1416 1417 1418 1419 1420 1421 1422 1423 1424 1425 1426 1427 1428 1429 1430 1431 1432 1433 1434 1435 1436 1437 1438 |
import plotly.graph_objects as go
import numpy as np
import json
import re
import urllib.parse
import urllib.request
import uuid
import chemiscope
from ase import Atoms
from gradio_client import utils as gradio_client_utils
def _patch_gradio_bool_schema():
"""Work around gradio_client expecting dict schemas by handling bools."""
original_get_type = getattr(gradio_client_utils, "get_type", None)
if original_get_type is None:
return
def safe_get_type(schema):
if isinstance(schema, bool):
# JSON Schema allows True/False to mean accept-all / accept-nothing.
return "boolean" if schema else {}
return original_get_type(schema)
gradio_client_utils.get_type = safe_get_type
_patch_gradio_bool_schema()
def parse_cube_file(cube_file):
"""Parse a cube file and return grid coordinates and values."""
try:
with open(cube_file, 'r') as f:
lines = f.readlines()
if len(lines) < 6:
raise ValueError("Cube file too short")
# Standard cube format:
# Line 0-1: comments
# Line 2: natoms, origin_x, origin_y, origin_z
# Line 3: nx, voxel_x, 0, 0
# Line 4: ny, 0, voxel_y, 0
# Line 5: nz, 0, 0, voxel_z
# Lines 6 to 6+natoms-1: atom data
# Remaining lines: volumetric data
# Parse line 2 (natoms and origin)
parts = lines[2].split()
natoms = abs(int(float(parts[0]))) # abs() handles negative natoms (sometimes used)
origin = np.array([float(parts[1]), float(parts[2]), float(parts[3])])
# Parse line 3 (nx and voxel spacing)
parts = lines[3].split()
nx = abs(int(float(parts[0])))
dx = float(parts[1])
# Parse line 4 (ny and voxel spacing)
parts = lines[4].split()
ny = abs(int(float(parts[0])))
dy = float(parts[2])
# Parse line 5 (nz and voxel spacing)
parts = lines[5].split()
nz = abs(int(float(parts[0])))
dz = float(parts[3])
# Data starts after atom lines
data_start = 6 + natoms
data = []
for line in lines[data_start:]:
data.extend([float(x) for x in line.split()])
if len(data) != nx * ny * nz:
raise ValueError(f"Data size mismatch: expected {nx*ny*nz}, got {len(data)}")
# Reshape data
values = np.array(data).reshape((nx, ny, nz))
# Create coordinate grids
x = origin[0] + np.arange(nx) * dx
y = origin[1] + np.arange(ny) * dy
z = origin[2] + np.arange(nz) * dz
return x, y, z, values
except Exception as e:
raise ValueError(f"Error parsing cube file: {e}")
import gradio as gr
from rdkit import Chem
from rdkit.Chem import Descriptors, Draw, AllChem
from rdkit.Chem import rdChemReactions
import cirpy
import pubchempy as pcp
from urllib.error import HTTPError, URLError
import os
import tempfile
from pathlib import Path
import matplotlib
matplotlib.use('Agg') # Use non-interactive backend
import matplotlib.pyplot as plt
from mpl_toolkits.mplot3d import Axes3D
from PIL import Image
import io
import base64
# RDKit API with multiple endpoints
def _mol_from_smiles(smiles: str):
mol = Chem.MolFromSmiles(smiles)
if mol is None:
raise gr.Error("Invalid SMILES string.")
return mol
def smiles_to_canonical(smiles: str) -> str:
mol = _mol_from_smiles(smiles)
return Chem.MolToSmiles(mol)
def molecular_weight(smiles: str) -> float:
mol = _mol_from_smiles(smiles)
return float(Descriptors.MolWt(mol))
def logp(smiles: str) -> float:
mol = _mol_from_smiles(smiles)
return float(Descriptors.MolLogP(mol))
def tpsa(smiles: str) -> float:
mol = _mol_from_smiles(smiles)
return float(Descriptors.TPSA(mol))
def mol_image(smiles: str):
mol = _mol_from_smiles(smiles)
return Draw.MolToImage(mol)
def name_to_smiles(name: str) -> str:
"""Convert chemical name to SMILES using Chemical Identifier Resolver (CIR)"""
try:
smiles = cirpy.resolve(name, 'smiles')
if smiles is None:
raise gr.Error(f"Could not find SMILES for chemical name: {name}")
return smiles
except (HTTPError, URLError) as e:
raise gr.Error(f"Unable to connect to chemical database service. Please try again later. Error: {str(e)}")
except Exception as e:
raise gr.Error(f"Error converting name to SMILES: {str(e)}")
def smiles_to_name(smiles: str) -> str:
"""Convert SMILES string to chemical name using Chemical Identifier Resolver (CIR)."""
mol = _mol_from_smiles(smiles)
canonical_smiles = Chem.MolToSmiles(mol)
try:
name = cirpy.resolve(smiles, "name")
if name:
return name
except (HTTPError, URLError):
# Ignore network failures and fall back to other resolvers.
pass
except Exception:
# Ignore unexpected CIR errors and fall back to other resolvers.
pass
try:
# Try PubChem as a secondary resolver in case CIR fails.
compounds = pcp.get_compounds(canonical_smiles, namespace="smiles")
for compound in compounds:
if compound.iupac_name:
return compound.iupac_name
if compound.synonyms:
return compound.synonyms[0]
except Exception:
# Ignore PubChem issues and fall back to canonical SMILES output.
pass
return f"No name available. Canonical SMILES: {canonical_smiles}"
def reaction_smiles_to_svg(reaction_smiles: str) -> str:
"""Convert reaction SMILES to SVG image"""
try:
# Parse the reaction SMILES properly
if ">>" not in reaction_smiles:
raise gr.Error("Reaction SMILES must contain '>>' to separate reactants from products")
# Split by '>>' to get reactants and products
parts = reaction_smiles.split(">>")
if len(parts) != 2:
raise gr.Error("Reaction SMILES must have exactly one '>>' separator")
# Handle optional reagents/conditions (e.g., "reactants>reagents>products")
reactant_part = parts[0].strip()
product_part = parts[1].strip()
# Check if there are reagents (format: reactants>reagents>products)
if ">" in reactant_part:
reactant_smiles, reagent_smiles = reactant_part.split(">", 1)
reactant_smiles = reactant_smiles.strip()
reagent_smiles = reagent_smiles.strip()
else:
reactant_smiles = reactant_part
reagent_smiles = ""
product_smiles = product_part
# Create reaction from individual molecules using MolFromSmiles (not SMARTS)
reactant_mols = []
for smi in reactant_smiles.split('.'):
smi = smi.strip()
if smi:
mol = Chem.MolFromSmiles(smi)
if mol is None:
raise gr.Error(f"Invalid SMILES in reactants: {smi}")
reactant_mols.append(mol)
# Parse reagents/catalysts if present
reagent_mols = []
if reagent_smiles:
for smi in reagent_smiles.split('.'):
smi = smi.strip()
if smi:
mol = Chem.MolFromSmiles(smi)
if mol is None:
raise gr.Error(f"Invalid SMILES in reagents: {smi}")
reagent_mols.append(mol)
product_mols = []
for smi in product_smiles.split('.'):
smi = smi.strip()
if smi:
mol = Chem.MolFromSmiles(smi)
if mol is None:
raise gr.Error(f"Invalid SMILES in products: {smi}")
product_mols.append(mol)
# Build the reaction object
reaction = rdChemReactions.ChemicalReaction()
for mol in reactant_mols:
reaction.AddReactantTemplate(mol)
for mol in reagent_mols:
reaction.AddAgentTemplate(mol)
for mol in product_mols:
reaction.AddProductTemplate(mol)
# Draw the reaction as image with proper parameters
image = Draw.ReactionToImage(reaction, subImgSize=(200, 200), useSVG=False, drawOptions=None, returnPNG=False)
# Convert PIL image to base64 for HTML display
import io
import base64
buffer = io.BytesIO()
image.save(buffer, format='PNG')
img_str = base64.b64encode(buffer.getvalue()).decode()
# Return as HTML img tag
return f'<img src="data:image/png;base64,{img_str}" alt="Reaction" style="max-width:100%; height:auto;">'
# Convert PIL image to base64 for HTML display
import io
import base64
buffer = io.BytesIO()
image.save(buffer, format='PNG')
img_str = base64.b64encode(buffer.getvalue()).decode()
# Return as HTML img tag
return f'<img src="data:image/png;base64,{img_str}" alt="Reaction" style="max-width:100%; height:auto;">'
except gr.Error:
raise
except Exception as e:
raise gr.Error(f"Error generating reaction image: {str(e)}")
CHEMISCOPE_TEMPLATE_URL = "https://chemiscope.org/chemiscope_standalone.html"
CHEMISCOPE_TEMPLATE_CACHE = Path(tempfile.gettempdir()) / "chemiscope_standalone.html"
CHEMISCOPE_ASSET_DIR = Path("chemiscope_artifacts")
_CHEMISCOPE_TEMPLATE = None
_MAX_CHEMISCOPE_MOLECULES = 12
def _load_chemiscope_template():
"""Load (and cache) the standalone Chemiscope HTML shell."""
global _CHEMISCOPE_TEMPLATE
if _CHEMISCOPE_TEMPLATE:
return _CHEMISCOPE_TEMPLATE
if CHEMISCOPE_TEMPLATE_CACHE.exists():
try:
_CHEMISCOPE_TEMPLATE = CHEMISCOPE_TEMPLATE_CACHE.read_text(encoding="utf-8")
return _CHEMISCOPE_TEMPLATE
except OSError:
# Cache is best-effort; fall back to downloading a fresh copy.
pass
try:
with urllib.request.urlopen(CHEMISCOPE_TEMPLATE_URL, timeout=10) as response:
template = response.read().decode("utf-8")
except Exception as exc:
raise gr.Error(
"Unable to download the Chemiscope viewer. Please try again in a moment."
) from exc
try:
CHEMISCOPE_TEMPLATE_CACHE.write_text(template, encoding="utf-8")
except OSError:
# The temp directory might be read-only; ignore caching failures.
pass
_CHEMISCOPE_TEMPLATE = template
return template
def _artifact_path(name: str) -> Path:
"""Create (if needed) and return a path inside the chemiscope artifacts directory."""
CHEMISCOPE_ASSET_DIR.mkdir(parents=True, exist_ok=True)
return CHEMISCOPE_ASSET_DIR / name
def _smiles_list_from_block(smiles_block: str):
"""Split a block of SMILES lines/CSV text into a unique, validated list."""
tokens = re.split(r"[,\n;]+", smiles_block or "")
smiles_list = [token.strip() for token in tokens if token.strip()]
if not smiles_list:
raise gr.Error("Provide at least one SMILES string (one per line or comma separated).")
unique_smiles = []
for token in smiles_list:
canonical = Chem.MolToSmiles(_mol_from_smiles(token))
if canonical not in unique_smiles:
unique_smiles.append(canonical)
if len(unique_smiles) > _MAX_CHEMISCOPE_MOLECULES:
raise gr.Error(
f"Please limit Chemiscope batches to {_MAX_CHEMISCOPE_MOLECULES} molecules to keep the viewer responsive."
)
return unique_smiles
def _embed_smiles_in_3d(smiles: str, seed: int):
mole = Chem.AddHs(_mol_from_smiles(smiles))
params = AllChem.ETKDGv3()
params.randomSeed = seed + 1
status = AllChem.EmbedMolecule(mole, params)
if status == -1:
params.useRandomCoords = True
status = AllChem.EmbedMolecule(mole, params)
if status == -1:
raise gr.Error(f"Unable to generate a 3D conformer for {smiles}. Try a smaller molecule.")
AllChem.UFFOptimizeMolecule(mole, maxIters=200)
Chem.rdPartialCharges.ComputeGasteigerCharges(mole)
return mole
def _rdkit_to_ase_atoms(mol: Chem.Mol, label: str) -> Atoms:
"""Convert an RDKit molecule with coordinates into an ASE Atoms object."""
conf = mol.GetConformer()
coords = []
for atom_idx in range(mol.GetNumAtoms()):
pos = conf.GetAtomPosition(atom_idx)
coords.append((float(pos.x), float(pos.y), float(pos.z)))
symbols = [atom.GetSymbol() for atom in mol.GetAtoms()]
ase_atoms = Atoms(symbols=symbols, positions=coords)
ase_atoms.info["name"] = label
return ase_atoms
def _extract_gasteiger_charges(mol: Chem.Mol):
charges = []
for atom in mol.GetAtoms():
if atom.HasProp("_GasteigerCharge"):
try:
charges.append(float(atom.GetProp("_GasteigerCharge")))
except ValueError:
charges.append(0.0)
else:
charges.append(0.0)
return charges
def _infer_space_origin():
"""Best-effort detection of the public Space base URL."""
for key in ("SPACE_HTTP_URL", "SPACE_URL"):
candidate = os.environ.get(key)
if candidate:
return candidate.rstrip("/")
space_id = os.environ.get("SPACE_ID")
if space_id and "/" in space_id:
owner, space = space_id.split("/", 1)
safe_space = space.replace("_", "-")
return f"https://{owner}-{safe_space}.hf.space"
return ""
def _build_chemiscope_embed(dataset_payload: dict, dataset_path: str | Path) -> str:
"""Create HTML content for Chemiscope visualization served locally from the Space."""
template_html = _load_chemiscope_template()
dataset_json = json.dumps(dataset_payload, ensure_ascii=False, separators=(",", ":"))
combined = template_html + dataset_json
dataset_file = Path(dataset_path)
viewer_name = dataset_file.name.replace(".json.gz", "_viewer.html")
viewer_path = dataset_file.parent / viewer_name
viewer_path.write_text(combined, encoding="utf-8")
space_origin = _infer_space_origin()
if space_origin:
dataset_url = f"{space_origin}/file={dataset_file.as_posix()}"
load_param = urllib.parse.quote(dataset_url, safe=":/?=&%")
iframe_src = f"https://chemiscope.org/?load={load_param}"
link = iframe_src
else:
encoded = base64.b64encode(combined.encode("utf-8")).decode("ascii")
iframe_src = f"data:text/html;base64,{encoded}"
link = iframe_src
return (
"<div style='width:100%;'>"
"<iframe "
"title='Chemiscope explorer' "
"style='width:100%;height:620px;border:none;border-radius:8px;' "
f"src='{iframe_src}'></iframe>"
"<p style='font-size:0.9em;margin-top:0.5rem;'>"
"Open in a new tab if the viewer looks blank: "
f"<a href='{link}' target='_blank' rel='noopener'>Chemiscope standalone</a>"
"</p>"
"</div>"
)
def smiles_to_chemiscope_dataset(smiles_block: str):
"""Generate a Chemiscope dataset and embed it alongside a downloadable artifact."""
smiles_list = _smiles_list_from_block(smiles_block)
frames = []
smiles_labels = []
atom_counts = []
mw_values = []
logp_values = []
tpsa_values = []
hbd_values = []
hba_values = []
rotatable_values = []
atomic_charges = []
for idx, smiles in enumerate(smiles_list):
mol3d = _embed_smiles_in_3d(smiles, idx)
canonical = Chem.MolToSmiles(Chem.RemoveHs(mol3d))
frames.append(_rdkit_to_ase_atoms(mol3d, canonical))
smiles_labels.append(canonical)
atom_counts.append(int(mol3d.GetNumAtoms()))
atomic_charges.extend(_extract_gasteiger_charges(mol3d))
descriptor_mol = Chem.RemoveHs(mol3d)
mw_values.append(float(Descriptors.MolWt(mol3d)))
logp_values.append(float(Descriptors.MolLogP(descriptor_mol)))
tpsa_values.append(float(Descriptors.TPSA(descriptor_mol)))
hbd_values.append(float(Descriptors.NumHDonors(descriptor_mol)))
hba_values.append(float(Descriptors.NumHAcceptors(descriptor_mol)))
rotatable_values.append(float(Descriptors.NumRotatableBonds(descriptor_mol)))
properties = {
"SMILES": {"target": "structure", "values": smiles_labels},
"Atom count": {"target": "structure", "values": atom_counts, "units": "atoms"},
"Molecular weight (g/mol)": {
"target": "structure",
"values": mw_values,
"units": "g/mol",
},
"logP": {"target": "structure", "values": logp_values},
"TPSA (Γ
Β²)": {"target": "structure", "values": tpsa_values, "units": "Γ
Β²"},
"H-bond donors": {"target": "structure", "values": hbd_values},
"H-bond acceptors": {"target": "structure", "values": hba_values},
"Rotatable bonds": {"target": "structure", "values": rotatable_values},
"Gasteiger charge (e)": {
"target": "atom",
"values": atomic_charges,
"units": "e",
},
}
settings = {
"map": {
"x": {"property": "Molecular weight (g/mol)"},
"y": {"property": "logP"},
"color": {"property": "TPSA (Γ
Β²)"},
"size": {"property": "Atom count"},
}
}
meta = {
"name": "RDKit Chemiscope Explorer",
"description": (
"Interactive Chemiscope session generated directly inside the RDKit Hugging Face Space."
),
"references": [
"https://chemiscope.org/docs/python/index.html",
"https://chemiscope.org/docs/index.html",
],
}
dataset = chemiscope.create_input(
frames=frames,
properties=properties,
meta=meta,
settings=settings,
)
dataset_path = _artifact_path(f"dataset_{uuid.uuid4().hex}.json.gz")
chemiscope.write_input(
str(dataset_path),
frames=frames,
properties=properties,
meta=meta,
settings=settings,
)
viewer_html = _build_chemiscope_embed(dataset, dataset_path)
return viewer_html, str(dataset_path)
def smiles_to_molecular_orbitals(smiles_input: str, name_input: str) -> str:
"""Generate HOMO/LUMO isosurfaces using Psikit, when available."""
smiles = smiles_input.strip()
name = name_input.strip()
if not smiles and not name:
raise gr.Error("Enter a SMILES string or a chemical name to compute orbitals.")
if name:
try:
resolved = cirpy.resolve(name, "smiles")
except Exception as exc:
return f"<p>Could not resolve '{name}' to SMILES: {exc}</p>"
if not resolved:
return f"<p>No SMILES found for '{name}'. Try a different name or supply a SMILES directly.</p>"
smiles = resolved
if not smiles:
raise gr.Error("Unable to determine SMILES for orbital calculation.")
mol = _mol_from_smiles(smiles)
canonical_smiles = Chem.MolToSmiles(mol)
if mol.GetNumAtoms() > 30:
raise gr.Error("Please provide a molecule with 30 atoms or fewer for orbital visualization.")
try:
import pyscf # type: ignore[import]
except ImportError:
return (
"<p><strong>PySCF is not available.</strong> "
"Install it with <code>pip install pyscf</code> "
"for molecular orbital calculations.</p>"
"<p><strong>Alternative online tools:</strong></p>"
"<ul>"
"<li><a href='https://www.webmo.net/' target='_blank'>WebMO</a> - Web-based molecular modeling</li>"
"<li><a href='https://gaussian.com/' target='_blank'>Gaussian</a> - Quantum chemistry software</li>"
"<li><a href='https://www.chemcraftprog.com/' target='_blank'>ChemCraft</a> - Molecular visualization</li>"
"</ul>"
f"<p>You can copy this SMILES to these tools: <code>{canonical_smiles}</code></p>"
)
with tempfile.TemporaryDirectory() as tmpdir:
original_cwd = os.getcwd()
os.chdir(tmpdir)
try:
# Generate 3D coordinates with RDKit
mol_3d = Chem.AddHs(mol)
AllChem.EmbedMolecule(mol_3d, randomSeed=42)
AllChem.MMFFOptimizeMolecule(mol_3d)
# Extract coordinates and atomic numbers
coords = []
atoms = []
for atom in mol_3d.GetAtoms():
pos = mol_3d.GetConformer().GetAtomPosition(atom.GetIdx())
coords.append([pos.x, pos.y, pos.z])
atoms.append(atom.GetSymbol())
# Set up PySCF molecule
mol_pyscf = pyscf.gto.Mole()
mol_pyscf.atom = list(zip(atoms, coords))
mol_pyscf.basis = 'sto-3g' # Small basis set for speed
mol_pyscf.build()
# Run Hartree-Fock calculation
mf = pyscf.scf.RHF(mol_pyscf)
energy = mf.kernel()
if not mf.converged:
return "<p>Hartree-Fock calculation did not converge. Try a smaller molecule or different geometry.</p>"
# Get HOMO and LUMO indices
nocc = mol_pyscf.nelectron // 2
homo_idx = nocc - 1
lumo_idx = nocc
# Generate cube files for HOMO and LUMO
from pyscf.tools import cubegen
cube_files = []
for idx, label in [(homo_idx, 'HOMO'), (lumo_idx, 'LUMO')]:
cube_file = f'{label.lower()}.cube'
cubegen.orbital(mol_pyscf, cube_file, mf.mo_coeff[:, idx])
cube_files.append((cube_file, label))
mol_block = Chem.MolToMolBlock(mol_3d)
html_sections: list[str] = []
if name_input.strip():
html_sections.append(
f"<p><strong>Resolved '{name_input.strip()}' to SMILES:</strong> {canonical_smiles}</p>"
)
for cube_file, label in cube_files:
if not Path(cube_file).exists():
continue
# Read cube file content
cube_data = Path(cube_file).read_text()
# Get molecular structure
mol_block = Chem.MolToMolBlock(mol_3d)
# Escape the data for JavaScript
cube_data_escaped = cube_data.replace('`', '\\`').replace('${', '\\${')
mol_block_escaped = mol_block.replace('`', '\\`').replace('${', '\\${')
# Create standalone HTML file with 3Dmol.js
html_content = f"""
<!DOCTYPE html>
<html>
<head>
<meta charset="utf-8">
<title>{label} Orbital - Interactive 3D</title>
<script src="https://3dmol.csb.pitt.edu/build/3Dmol-min.js"></script>
<style>
body {{
margin: 0;
padding: 20px;
font-family: Arial, sans-serif;
background: #f5f5f5;
}}
.container {{
max-width: 1200px;
margin: 0 auto;
background: white;
padding: 20px;
border-radius: 10px;
box-shadow: 0 2px 10px rgba(0,0,0,0.1);
}}
h1 {{
color: #333;
margin-top: 0;
}}
#viewer {{
width: 100%;
height: 600px;
position: relative;
border: 2px solid #ddd;
border-radius: 5px;
}}
.info {{
margin-top: 20px;
padding: 15px;
background: #e8f4f8;
border-left: 4px solid #2196F3;
border-radius: 4px;
}}
.controls {{
margin: 20px 0;
padding: 15px;
background: #f9f9f9;
border-radius: 4px;
}}
button {{
margin: 5px;
padding: 10px 20px;
background: #2196F3;
color: white;
border: none;
border-radius: 4px;
cursor: pointer;
font-size: 14px;
}}
button:hover {{
background: #1976D2;
}}
</style>
</head>
<body>
<div class="container">
<h1>{label} Orbital - Interactive 3D Visualization</h1>
<div class="info">
<strong>Molecule:</strong> {canonical_smiles}<br>
<strong>Blue surface:</strong> Positive phase of molecular orbital<br>
<strong>Red surface:</strong> Negative phase of molecular orbital<br>
<strong>Controls:</strong> Left-click drag to rotate, Right-click drag to pan, Scroll to zoom
</div>
<div class="controls">
<button onclick="viewer.zoomTo(); viewer.render();">Reset View</button>
<button onclick="viewer.rotate(90, 'y'); viewer.render();">Rotate Y</button>
<button onclick="viewer.rotate(90, 'x'); viewer.render();">Rotate X</button>
<button onclick="viewer.zoom(1.2); viewer.render();">Zoom In</button>
<button onclick="viewer.zoom(0.8); viewer.render();">Zoom Out</button>
</div>
<div id="viewer"></div>
</div>
<script>
var viewer = $3Dmol.createViewer("viewer", {{backgroundColor: 'white'}});
// Add molecular structure
var molData = `{mol_block_escaped}`;
viewer.addModel(molData, "sdf");
viewer.setStyle({{}}, {{stick: {{radius: 0.15, color: 'gray'}}, sphere: {{scale: 0.25}}}});
// Add orbital isosurfaces
var cubeData = `{cube_data_escaped}`;
viewer.addVolumetricData(cubeData, "cube", {{isoval: 0.02, color: "blue", alpha: 0.75}});
viewer.addVolumetricData(cubeData, "cube", {{isoval: -0.02, color: "red", alpha: 0.75}});
viewer.zoomTo();
viewer.render();
</script>
</body>
</html>
"""
# Save HTML file to a location accessible by Gradio
html_filename = f"{label.lower()}_orbital_{hash(canonical_smiles)}.html"
# Move back to original directory to save in a persistent location
os.chdir(original_cwd)
output_dir = Path("orbital_outputs")
output_dir.mkdir(exist_ok=True)
html_path = output_dir / html_filename
html_path.write_text(html_content)
os.chdir(tmpdir)
# Create iframe to embed the HTML directly
iframe_html = f"""
<div style='margin: 20px 0; padding: 15px; background: white; border: 2px solid #2196F3; border-radius: 8px;'>
<h3 style='color: #1976D2; margin-top: 0;'>{label} Orbital - Interactive 3D</h3>
<p style='margin: 10px 0; color: #666;'><small>
<strong>Blue:</strong> Positive orbital lobe | <strong>Red:</strong> Negative orbital lobe<br>
<strong>Controls:</strong> Left-click drag to rotate, Scroll to zoom, Right-click drag to pan
</small></p>
<iframe srcdoc="{html_content.replace('"', '"')}"
style="width: 100%; height: 650px; border: 1px solid #ddd; border-radius: 4px;"
sandbox="allow-scripts allow-same-origin">
</iframe>
</div>
"""
html_sections.append(iframe_html)
if not html_sections:
return "<p>Could not prepare HOMO/LUMO visualizations.</p>"
# Wrap in a container div with proper styling
result_html = "<div style='width: 100%; max-width: 1200px;'>" + "".join(html_sections) + "</div>"
return result_html
except Exception as exc: # pragma: no cover - runtime heavy
return f"<p>Unable to compute molecular orbitals: {exc}</p>"
finally:
os.chdir(original_cwd)
def name_to_3d_molecule(name: str) -> str:
"""Convert chemical name to 3D molecule visualization"""
try:
# Convert name to SMILES with better error handling
try:
smiles = cirpy.resolve(name, 'smiles')
if smiles is None:
raise gr.Error(f"Could not find SMILES for chemical name: {name}")
except (HTTPError, URLError) as e:
raise gr.Error(f"Unable to connect to chemical database service. Please try again later or use SMILES directly. Error: {str(e)}")
except Exception as e:
raise gr.Error(f"Error resolving chemical name '{name}': {str(e)}")
# Create molecule from SMILES
mol = Chem.MolFromSmiles(smiles)
if mol is None:
raise gr.Error(f"Could not create molecule from SMILES: {smiles}")
# Add hydrogens for better 3D structure
mol = Chem.AddHs(mol)
# Generate 3D coordinates
success = AllChem.EmbedMolecule(mol, AllChem.ETKDG())
if success == -1:
raise gr.Error(f"Could not generate 3D coordinates for: {name}")
# Optimize geometry
AllChem.MMFFOptimizeMolecule(mol)
# Convert to SDF format (contains 3D coordinates)
sdf_string = Chem.SDWriter.GetText(mol)
# Create HTML with embedded 3D viewer using 3Dmol.js
html_content = f"""
<!DOCTYPE html>
<html>
<head>
<script src="https://3dmol.csb.pitt.edu/build/3Dmol-min.js"></script>
</head>
<body>
<div id="container" style="width: 400px; height: 400px; position: relative;"></div>
<script>
let viewer = $3Dmol.createViewer($("#container"));
let sdf = `{sdf_string}`;
viewer.addModel(sdf, "sdf");
viewer.setStyle({{'stick': {{}}}});
viewer.zoomTo();
viewer.render();
</script>
</body>
</html>
"""
return html_content
except gr.Error:
# Re-raise Gradio errors as-is
raise
except Exception as e:
raise gr.Error(f"Error creating 3D molecule: {str(e)}")
def calculate_properties_batch(smiles_list: str) -> str:
"""Calculate physicochemical properties for multiple molecules"""
from rdkit.Chem import Lipinski
lines = [line.strip() for line in smiles_list.strip().split('\n') if line.strip()]
if not lines:
return "Please enter at least one SMILES string (one per line)"
results = []
results.append("SMILES\tMW\tLogP\tTPSA\tHBD\tHBA\tRotBonds\tRings\tAromRings")
for smiles in lines[:50]: # Limit to 50 molecules
try:
mol = Chem.MolFromSmiles(smiles)
if mol is None:
results.append(f"{smiles}\tInvalid SMILES")
continue
mw = Descriptors.MolWt(mol)
logp = Descriptors.MolLogP(mol)
tpsa = Descriptors.TPSA(mol)
hbd = Lipinski.NumHDonors(mol)
hba = Lipinski.NumHAcceptors(mol)
rotbonds = Lipinski.NumRotatableBonds(mol)
rings = Lipinski.RingCount(mol)
arom_rings = Lipinski.NumAromaticRings(mol)
results.append(f"{smiles}\t{mw:.2f}\t{logp:.2f}\t{tpsa:.2f}\t{hbd}\t{hba}\t{rotbonds}\t{rings}\t{arom_rings}")
except Exception as e:
results.append(f"{smiles}\tError: {str(e)}")
return "\n".join(results)
def cluster_molecules(smiles_list: str, n_clusters: int = 5) -> str:
"""Cluster molecules based on structural similarity using Morgan fingerprints"""
from rdkit.Chem import AllChem
from sklearn.cluster import KMeans
import pandas as pd
lines = [line.strip() for line in smiles_list.strip().split('\n') if line.strip()]
if not lines:
return "Please enter at least one SMILES string (one per line)"
if len(lines) < 2:
return "Please enter at least 2 SMILES strings for clustering"
# Generate fingerprints
mols = []
valid_smiles = []
fps = []
for smiles in lines[:100]: # Limit to 100 molecules
mol = Chem.MolFromSmiles(smiles)
if mol is not None:
fp = AllChem.GetMorganFingerprintAsBitVect(mol, 2, nBits=1024)
mols.append(mol)
valid_smiles.append(smiles)
fps.append(fp)
if len(fps) < 2:
return "Need at least 2 valid SMILES for clustering"
# Convert fingerprints to numpy array
fp_array = np.array([list(fp) for fp in fps])
# Perform clustering
n_clusters = min(n_clusters, len(fps))
kmeans = KMeans(n_clusters=n_clusters, random_state=42, n_init=10)
clusters = kmeans.fit_predict(fp_array)
# Create results
results = []
results.append(f"Clustered {len(valid_smiles)} molecules into {n_clusters} groups\n")
results.append("Cluster\tSMILES\tMW\tLogP")
for i, (smiles, cluster_id) in enumerate(zip(valid_smiles, clusters)):
mol = mols[i]
mw = Descriptors.MolWt(mol)
logp = Descriptors.MolLogP(mol)
results.append(f"{cluster_id + 1}\t{smiles}\t{mw:.2f}\t{logp:.2f}")
return "\n".join(results)
def analyze_scaffolds(smiles_list: str) -> str:
"""Extract and analyze molecular scaffolds (Bemis-Murcko scaffolds)"""
from rdkit.Chem.Scaffolds import MurckoScaffold
from collections import Counter
lines = [line.strip() for line in smiles_list.strip().split('\n') if line.strip()]
if not lines:
return "Please enter at least one SMILES string (one per line)"
scaffolds = []
mol_to_scaffold = []
for smiles in lines[:100]: # Limit to 100 molecules
try:
mol = Chem.MolFromSmiles(smiles)
if mol is not None:
scaffold = MurckoScaffold.GetScaffoldForMol(mol)
scaffold_smiles = Chem.MolToSmiles(scaffold)
scaffolds.append(scaffold_smiles)
mol_to_scaffold.append((smiles, scaffold_smiles))
except:
continue
if not scaffolds:
return "No valid scaffolds could be extracted"
# Count scaffold frequencies
scaffold_counts = Counter(scaffolds)
results = []
results.append(f"Analyzed {len(mol_to_scaffold)} molecules")
results.append(f"Found {len(scaffold_counts)} unique scaffolds\n")
results.append("=== Most Common Scaffolds ===")
for scaffold, count in scaffold_counts.most_common(10):
results.append(f"\nScaffold: {scaffold}")
results.append(f"Frequency: {count} molecules ({100*count/len(scaffolds):.1f}%)")
# Show examples
examples = [smiles for smiles, scaf in mol_to_scaffold if scaf == scaffold][:3]
results.append("Examples:")
for ex in examples:
results.append(f" - {ex}")
return "\n".join(results)
def interactive_molecule_explorer(input_text: str, input_type: str):
"""Interactive molecule explorer - input name or SMILES, get structure and properties"""
try:
from rdkit.Chem import Lipinski, Crippen, Descriptors
if not input_text or not input_text.strip():
return None, None, "Please enter a molecule name or SMILES", None
# Parse input
if input_type == "Name":
try:
smiles = cirpy.resolve(input_text.strip(), 'smiles')
if smiles is None:
return None, None, f"β Could not resolve '{input_text}'. Try a different name or use SMILES.", None
name = input_text.strip()
except Exception as e:
return None, None, f"β Error resolving chemical name: {str(e)}", None
else: # SMILES
smiles = input_text.strip()
# Try to get name
try:
name = cirpy.resolve(smiles, 'name')
if name is None:
name = smiles
except:
name = smiles
# Create molecule
mol = Chem.MolFromSmiles(smiles)
if mol is None:
return None, None, f"β Invalid SMILES: {smiles}", None
# Generate 2D structure image
try:
mol_2d = Draw.MolToImage(mol, size=(400, 400))
except Exception as e:
return None, None, f"β Error generating 2D image: {str(e)}", None
# Calculate comprehensive properties
properties = {
"Molecular Formula": Chem.rdMolDescriptors.CalcMolFormula(mol),
"Molecular Weight": f"{Descriptors.MolWt(mol):.2f} g/mol",
"LogP (Lipophilicity)": f"{Descriptors.MolLogP(mol):.2f}",
"TPSA (Polar Surface Area)": f"{Descriptors.TPSA(mol):.2f} Ε²",
"H-Bond Donors": Lipinski.NumHDonors(mol),
"H-Bond Acceptors": Lipinski.NumHAcceptors(mol),
"Rotatable Bonds": Lipinski.NumRotatableBonds(mol),
"Aromatic Rings": Lipinski.NumAromaticRings(mol),
"Fraction Csp3": f"{Lipinski.FractionCSP3(mol):.2f}",
"Molar Refractivity": f"{Crippen.MolMR(mol):.2f}",
"Heavy Atoms": Lipinski.HeavyAtomCount(mol),
}
# Create properties visualization
fig = go.Figure()
# Create a radar chart for key properties
categories = ['MW/100', 'LogP+5', 'TPSA/20', 'HBD*10', 'HBA*5', 'RotBonds*5']
values = [
min(Descriptors.MolWt(mol) / 100, 15),
min(max(Descriptors.MolLogP(mol) + 5, 0), 15),
min(Descriptors.TPSA(mol) / 20, 15),
min(Lipinski.NumHDonors(mol) * 2, 15),
min(Lipinski.NumHAcceptors(mol) * 1.5, 15),
min(Lipinski.NumRotatableBonds(mol) * 2, 15)
]
fig.add_trace(go.Scatterpolar(
r=values,
theta=categories,
fill='toself',
name='Properties',
line_color='rgb(30, 144, 255)',
fillcolor='rgba(30, 144, 255, 0.3)'
))
fig.update_layout(
polar=dict(
radialaxis=dict(
visible=True,
range=[0, 15]
)
),
showlegend=False,
title=f"Property Profile: {name[:50]}",
height=400,
margin=dict(l=80, r=80, t=100, b=80)
)
# Create properties text
props_text = f"## **{name}**\n\n"
props_text += f"**SMILES:** `{smiles}`\n\n"
props_text += "### **Molecular Properties:**\n\n"
for key, value in properties.items():
props_text += f"- **{key}:** {value}\n"
# Check Lipinski's Rule of 5
lipinski_violations = 0
lipinski_text = "\n### **Lipinski's Rule of 5 (Drug-Likeness):**\n\n"
mw = Descriptors.MolWt(mol)
logp = Descriptors.MolLogP(mol)
hbd = Lipinski.NumHDonors(mol)
hba = Lipinski.NumHAcceptors(mol)
if mw > 500:
lipinski_violations += 1
lipinski_text += "β Molecular Weight > 500 Da\n"
else:
lipinski_text += "β
Molecular Weight β€ 500 Da\n"
if logp > 5:
lipinski_violations += 1
lipinski_text += "β LogP > 5\n"
else:
lipinski_text += "β
LogP β€ 5\n"
if hbd > 5:
lipinski_violations += 1
lipinski_text += "β H-Bond Donors > 5\n"
else:
lipinski_text += "β
H-Bond Donors β€ 5\n"
if hba > 10:
lipinski_violations += 1
lipinski_text += "β H-Bond Acceptors > 10\n"
else:
lipinski_text += "β
H-Bond Acceptors β€ 10\n"
if lipinski_violations <= 1:
lipinski_text += f"\n### β
**DRUG-LIKE** (Violations: {lipinski_violations}/4)"
else:
lipinski_text += f"\n### β οΈ **NOT DRUG-LIKE** (Violations: {lipinski_violations}/4)"
props_text += lipinski_text
return mol_2d, fig, props_text, smiles
except Exception as e:
import traceback
error_msg = f"β **Error:** {str(e)}\n\n```\n{traceback.format_exc()}\n```"
return None, None, error_msg, None
def generate_3d_interactive(smiles: str):
"""Generate interactive 3D molecule viewer"""
if not smiles or smiles == "None":
return "<p>Please enter a molecule first</p>"
try:
mol = Chem.MolFromSmiles(smiles)
if mol is None:
return "<p>Invalid SMILES</p>"
# Add hydrogens and generate 3D coordinates
mol_3d = Chem.AddHs(mol)
AllChem.EmbedMolecule(mol_3d, randomSeed=42)
AllChem.MMFFOptimizeMolecule(mol_3d)
# Get molecular structure
mol_block = Chem.MolToMolBlock(mol_3d)
# Escape for JavaScript
mol_block_escaped = mol_block.replace('`', '\\`').replace('${', '\\${')
# Create standalone HTML with 3Dmol.js
html_content = f"""
<!DOCTYPE html>
<html>
<head>
<script src="https://3dmol.csb.pitt.edu/build/3Dmol-min.js"></script>
<style>
body {{ margin: 0; padding: 0; }}
#viewer {{ width: 100%; height: 500px; }}
</style>
</head>
<body>
<div id="viewer"></div>
<script>
var viewer = $3Dmol.createViewer("viewer", {{backgroundColor: 'white'}});
var molData = `{mol_block_escaped}`;
viewer.addModel(molData, "sdf");
viewer.setStyle({{}}, {{stick: {{radius: 0.15}}, sphere: {{scale: 0.3}}}});
viewer.zoomTo();
viewer.render();
</script>
</body>
</html>
"""
iframe_html = f"""
<iframe srcdoc="{html_content.replace('"', '"')}"
style="width: 100%; height: 520px; border: 2px solid #2196F3; border-radius: 8px;"
sandbox="allow-scripts allow-same-origin">
</iframe>
"""
return iframe_html
except Exception as e:
return f"<p>Error generating 3D structure: {str(e)}</p>"
# Interactive Molecule Explorer - Main Feature
with gr.Blocks(theme=gr.themes.Soft()) as interactive_explorer:
gr.Markdown("# π¬ Interactive Molecule Explorer")
gr.Markdown("Enter a molecule name or SMILES to explore its structure and properties")
with gr.Row():
with gr.Column(scale=1):
input_text = gr.Textbox(
label="Enter Molecule",
placeholder="e.g., aspirin, caffeine, or CCO",
lines=1
)
input_type = gr.Radio(
choices=["Name", "SMILES"],
value="Name",
label="Input Type"
)
analyze_btn = gr.Button("π Analyze Molecule", variant="primary", size="lg")
gr.Markdown("### Quick Examples:")
gr.Examples(
examples=[
["aspirin", "Name"],
["caffeine", "Name"],
["glucose", "Name"],
["c1ccccc1", "SMILES"],
["CCO", "SMILES"],
],
inputs=[input_text, input_type],
)
with gr.Column(scale=1):
structure_2d = gr.Image(label="2D Structure", type="pil")
with gr.Row():
properties_plot = gr.Plot(label="Property Radar Chart")
with gr.Row():
properties_text = gr.Markdown(label="Detailed Properties")
gr.Markdown("---")
gr.Markdown("## π§ Interactive 3D Viewer")
gr.Markdown("Click below to generate the interactive 3D molecular structure")
smiles_state = gr.State(value=None)
generate_3d_btn = gr.Button("π― Generate 3D Structure", variant="secondary", size="lg")
viewer_3d = gr.HTML(label="3D Molecular Viewer")
# Connect the analyze button
analyze_btn.click(
fn=interactive_molecule_explorer,
inputs=[input_text, input_type],
outputs=[structure_2d, properties_plot, properties_text, smiles_state]
)
# Connect the 3D button
generate_3d_btn.click(
fn=generate_3d_interactive,
inputs=[smiles_state],
outputs=[viewer_3d]
)
smiles_interface = gr.Interface(
fn=smiles_to_canonical,
inputs=gr.Textbox(label="SMILES"),
outputs=gr.Textbox(label="Canonical SMILES"),
api_name="smiles_to_mol",
description="Convert an input SMILES string to its canonical form.",
)
smiles_to_name_interface = gr.Interface(
fn=smiles_to_name,
inputs=gr.Textbox(label="SMILES", placeholder="e.g., CC(=O)Oc1ccccc1C(=O)O"),
outputs=gr.Textbox(label="Chemical Name"),
api_name="smiles_to_name",
description="Convert a SMILES string to a chemical name.",
)
orbital_interface = gr.Interface(
fn=smiles_to_molecular_orbitals,
inputs=[
gr.Textbox(label="SMILES", placeholder="e.g., CC(=O)O"),
gr.Textbox(label="Chemical Name", placeholder="Optional, e.g., benzene"),
],
outputs=gr.HTML(label="Molecular Orbitals"),
api_name="smiles_to_mo",
description="Generate HOMO/LUMO isosurfaces using Psikit (CPU-intensive). Provide SMILES or a name.",
)
name_interface = gr.Interface(
fn=name_to_smiles,
inputs=gr.Textbox(label="Chemical Name", placeholder="e.g., aspirin, caffeine, benzene"),
outputs=gr.Textbox(label="SMILES"),
api_name="name_to_smiles",
description="Convert a chemical name to SMILES notation.",
examples=[["aspirin"], ["caffeine"], ["benzene"], ["ethanol"]],
)
mw_interface = gr.Interface(
fn=molecular_weight,
inputs=gr.Textbox(label="SMILES"),
outputs=gr.Number(label="Molecular Weight (g/mol)"),
api_name="molecular_weight",
description="Compute the molecular weight from a SMILES string.",
)
logp_interface = gr.Interface(
fn=logp,
inputs=gr.Textbox(label="SMILES"),
outputs=gr.Number(label="logP"),
api_name="logp",
description="Calculate the octanol/water partition coefficient (logP).",
)
tpsa_interface = gr.Interface(
fn=tpsa,
inputs=gr.Textbox(label="SMILES"),
outputs=gr.Number(label="TPSA"),
api_name="tpsa",
description="Calculate the topological polar surface area (TPSA).",
)
molecule_3d_interface = gr.Interface(
fn=name_to_3d_molecule,
inputs=gr.Textbox(label="Chemical Name", placeholder="e.g., benzene, aspirin, caffeine"),
outputs=gr.HTML(label="3D Molecule Viewer"),
api_name="name_to_3d_molecule",
description="Convert a chemical name to an interactive 3D molecule visualization.",
examples=[["benzene"], ["aspirin"], ["caffeine"], ["ethanol"]],
)
chemiscope_interface = gr.Interface(
fn=smiles_to_chemiscope_dataset,
inputs=gr.Textbox(
label="SMILES batch",
lines=6,
placeholder="One SMILES per line or comma separated (max 12 molecules).",
),
outputs=[
gr.HTML(label="Chemiscope Viewer"),
gr.File(label="Chemiscope Dataset (.json.gz)"),
],
api_name="chemiscope_explorer",
description=(
"Generate a Chemiscope dataset using RDKit + ASE + Chemiscope tooling, then explore it "
"directly inside the Space or download the JSON for chemiscope.org."
),
examples=[["CCO\nc1ccccc1"]],
cache_examples=False,
)
# Property calculation interface
properties_interface = gr.Interface(
fn=calculate_properties_batch,
inputs=gr.Textbox(
label="SMILES List (one per line)",
placeholder="CCO\nc1ccccc1\nCC(=O)O\nCCN",
lines=10
),
outputs=gr.Textbox(label="Properties (Tab-separated)", lines=15),
title="Batch Property Calculator",
description="Calculate physicochemical properties for multiple molecules. Enter one SMILES per line (max 50).",
examples=[["CCO\nc1ccccc1\nCC(=O)O\nCN1C=NC2=C1C(=O)N(C(=O)N2C)C"]],
)
# Clustering interface
clustering_interface = gr.Interface(
fn=cluster_molecules,
inputs=[
gr.Textbox(
label="SMILES List (one per line)",
placeholder="CCO\nc1ccccc1\nCC(=O)O\nCCN",
lines=10
),
gr.Slider(minimum=2, maximum=10, value=5, step=1, label="Number of Clusters")
],
outputs=gr.Textbox(label="Clustering Results (Tab-separated)", lines=15),
title="Molecular Clustering",
description="Cluster molecules based on structural similarity using Morgan fingerprints and K-means (max 100 molecules).",
examples=[["CCO\nCCCO\nCCCCO\nc1ccccc1\nc1ccc(O)cc1\nc1ccc(N)cc1\nCC(=O)O\nCCC(=O)O\nCCCC(=O)O", 3]],
)
# Scaffold analysis interface
scaffold_interface = gr.Interface(
fn=analyze_scaffolds,
inputs=gr.Textbox(
label="SMILES List (one per line)",
placeholder="c1ccc(CCN)cc1\nc1ccc(CCO)cc1\nc1ccc(CCC)cc1",
lines=10
),
outputs=gr.Textbox(label="Scaffold Analysis", lines=15),
title="Scaffold Analysis",
description="Extract and analyze Bemis-Murcko scaffolds from molecules (max 100).",
examples=[["c1ccc(CCN)cc1\nc1ccc(CCO)cc1\nc1ccc(CCC)cc1\nCCOc1ccc(CCN)cc1\nCCc1ccc(O)cc1"]],
)
# Reaction visualization interface
reaction_interface = gr.Interface(
fn=reaction_smiles_to_svg,
inputs=gr.Textbox(
label="Reaction SMILES",
placeholder="CC=O.CC=O>[OH-]>CC(O)CC=O (Aldol condensation)",
info="Format: reactants>reagents>products or reactants>>products"
),
outputs=gr.HTML(label="Reaction Visualization"),
title="Reaction Visualizer",
description="Visualize chemical reactions from SMILES notation. Use 'reactants>reagents>products' or 'reactants>>products' format.",
api_name="reaction_visualizer",
examples=[
["CC=O.CC=O>[OH-]>CC(O)CC=O"],
["CC(=O)O.CO>>CC(=O)OC.O"],
["c1ccccc1.ClCl>>c1ccccc1Cl.Cl"]
],
)
demo = gr.TabbedInterface(
[
interactive_explorer,
orbital_interface,
properties_interface,
clustering_interface,
scaffold_interface,
reaction_interface,
name_interface,
molecule_3d_interface,
chemiscope_interface,
smiles_interface,
smiles_to_name_interface,
mw_interface,
logp_interface,
tpsa_interface,
],
[
"π¬ Interactive Explorer",
"Molecular Orbitals",
"Property Calculator",
"Molecular Clustering",
"Scaffold Analysis",
"Reaction Visualizer",
"Name to SMILES",
"3D Molecule Viewer",
"Chemiscope Explorer",
"SMILES to Canonical",
"SMILES to Name",
"Molecular Weight",
"LogP",
"TPSA",
],
title="RDKit API - Interactive Molecular Analysis",
css=".gradio-container {max-width: 1200px; margin: auto;}",
)
if __name__ == "__main__":
demo.queue().launch(server_name="0.0.0.0", server_port=7860, show_api=False)
|