prompt stringlengths 189 761 | answer stringclasses 2 values |
|---|---|
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1OC(OCC2OC(Oc3c(-c4ccc(O)c(O)c4)oc4cc(O)cc(O)c4c3=O)C(O)C(O)C2O)C(O)C(O)C1O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN(C)CCCCN1c2ccccc2Sc2ccc(N=[N+]=[N-])cc21.O=C(O)C(=O)O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1nc2nc(OC)nc3c(Br)cc(Br)c(n1)-n-2-3
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1(C)CCOC(=O)C(Cl)CC1Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN(C)CCSc1nnc(-c2cccs2)c2ccccc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCN(CCCC)C(=O)C(=O)C(C(=O)c1ccc(OC)cc1)c1ccc(OC)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(cc(OCC(=O)N5C(C)CCC5C)c4c3C2=O)NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=C(C)CCC(O)C(C)(O)C1C(O)CC2(C)C3CCc4c(cc(OC5OC(CO)C(O)C(O)C5O)c(O)c4C)C3(C)C(=O)CC12C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: S=c1[nH]c2ccc(Br)cc2c(=S)n1-c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=[N+]([O-])C(=C(c1ccccc1)c1ccccc1)[N+](=O)[O-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCn1cnc2c(SSc3ncnc4c3ncn4CCCC)ncnc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCCOCC(O)CO
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: c1ccc(-c2nc3n(n2)CCC(c2ccccc2)S3)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C2SC(=Cc3ccc(OC)cc3OC)C(=O)N2NC(=O)Cc2ccccc2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#Cc1c(N)c2c(c(-c3ccccc3)c1-c1ccccc1)C(=O)N(Nc1ccccc1)C2=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=C1SC(=Nc2cccc(OC)c2)N(c2nc(Cl)nc(Cl)n2)C1(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCc1nc(N)nc(C(=O)Nc2cccc(C(F)(F)F)c2)c1CC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cn(CC(=O)NCCO)c(=O)[nH]c1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C(=Cc1ccc(OC)cc1)C(C(=O)O)=C(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1c(C)[n+]([O-])c2cc(C=[N+]([O-])CCO)ccc2[n+]1[O-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN(C)Cc1cc(N=Nc2cccc(Cl)c2)ccc1O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Oc1cc(Cl)cc2cc(Br)cnc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cc(C(=O)N2CCc3c([nH]c4c([N+](=O)[O-])c(OC)ccc34)C2C)cc(OC)c1OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#CC(c1ccccn1)c1ncccc1[N+](=O)[O-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN(C)C1=CC(=O)c2ccccc2C12CO2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N=C1NC(=O)C(CC(=O)O)S1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC=C1C(C=c2[nH]c(=Cc3[nH]c(C=C4NC(=O)C(CC)=C4C)c(C)c3CCC(=O)O)c(CCC(=O)O)c2C)=NC(=O)C1C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)=C1CCC(C)CC1=NNC(N)=S
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CSc1nc2c(S)nc(S)nc2s1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cn1c(=O)sc2cc(C(=S)N3CCC(Cc4ccccc4)CC3)ccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)N1CC2(C=CC3(CC2)OCCO3)c2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1c2oc(=O)cc(-c3ccccc3)c2cc2c(=O)ccoc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)OCC(OC(C)=O)C(Cl)CCl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCC12C=CC(=S)N(CCSc3ccccc3)C1c1c(n(S(=O)(=O)c3ccc(OC)cc3)c3ccccc13)CC2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ccc(S(=O)(=O)OC2COCOC2C2OCOC3COCOC32)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(NC1C=Nc2ccc(Cl)cc2NC1=O)c1ccc2ccccc2c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(C=Cc1ccccc1Cl)c1ccc(Cl)cc1Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: [N-]=[N+]=NC1CC(n2cc(Cc3ccccc3)c(=O)[nH]c2=O)OC1CO
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(CCC(N)=O)(CCC(N)=O)[N+](=O)[O-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=C(C)C1Cc2c(cc3c(c2O)c(=O)c2ccccc2n3C)O1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cccc(C(=O)C#Cc2cnc(OC)nc2OC)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1=CC2C3=C(OC(C)(C)C2CC1)C(=O)c1c(cc(O)c(C)c1O)C3=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: OCc1ccc2[n+](c1)CCc1c-2[nH]c2ccccc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=C1c2[nH]c3ccccc3c2CC(C(=O)O)N1C(O)c1ccc(S(=O)(=O)O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C(CC(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)OCc1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)c1ccc(CON=C(c2ccccc2)c2ccncc2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)C(OP(=O)(OCC)OCC)C(F)(F)F
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN(C)Cc1cc(N=Nc2ccc(Cl)cc2)cc(CN(C)C)c1O.Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Br.CCOC(CN=c1nc(N(C)C)ss1)OCC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C(=Cc1cc(CCc2nc3ccccc3[nH]2)n[nH]1)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#Cc1c(N=Cc2ccccc2)c(C(=O)Nc2ccccc2)n2c1CCC2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C[n+]1c(COc2ccc(C=NNC(=O)CCC(=O)NN=Cc3ccc(OCc4cn5ccccc5[n+]4C)cc3)cc2)cn2ccccc21.Cc1ccc(S(=O)(=O)O)cc1
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C[n+]1cn(-c2ccc([N+](=O)[O-])cn2)c2ccccc21.[I-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCc1oc2ccc(OC)c3ccccc1c23
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)(C)[Si](C)(C)OCC1OC(n2ccc(=O)[nH]c2=O)CC1=NO
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1CP([O-])([O-])=[O+][Ga-3]23([O+]=P([O-])([O-])CC(=O)[OH+]2)([O+]=P([O-])([O-])CC(=O)[OH+]3)[OH+]1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOP(=O)(OCC)C(Cc1ccccc1)N=C(c1ccccc1)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cl.O=C(OCCN1CCCCC1)c1cc2ccccc2n1-c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#CC(c1nc2ccccc2s1)c1ncccc1[N+](=O)[O-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(-c2coc3cc(O)cc(O)c3c2=O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: FC1OC2OC1C(OCc1ccccc1)C(OCc1ccccc1)C2OCc1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)C1C(=O)C(=O)N(c2ccc(Br)cc2)C1=O.[NaH]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)c1sc2[n+](c1C)C(=O)C(=Cc1ccccc1Cl)S2
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=NNC(=S)N1CCN(c2ccccn2)CC1)c1nccs1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cccc(C)c1C1(Cl)C(=O)c2ccccc2C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CNP(=O)(NC)NC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#CC1(Cc2ccccc2[N+](=O)[O-])c2ccccc2C2C(N1C(=O)c1ccccc1)C2(Cl)Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)Oc1ccc2c(c1)OCC1Cc3ccccc3OC21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1oc(C(=O)NC2CCCCC2)c(-c2ccc(Cl)cc2)c1S(=O)(=O)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cnc(NCCCN(C)C)c2c1[nH]c1ccc3ccccc3c12.O=C(O)C=CC(=O)O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=S(=O)(OC1CC12CCCCC2c1ccccc1)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CNC(=N)NN=C1C(=O)Nc2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ccc(NC2=NCCS2)c(C)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1Oc2cc3c(c4cccc1c24)OC(c1ccccc1)C(c1ccccc1)C3c1ccc(Cl)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)N1CCC2(CC1)CC(C)(C(C)=O)C(C)O2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COP1(=O)OCc2cnccc2O1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1CC(C)(C)OC(c2ccco2)O1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cl.O=C(C=Cc1cc2ccccc2o1)N1CCN(c2ccccn2)CC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cn1ccc(=NN=c2ccn(C)c3ccccc23)c2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C[PH]1(c2ccccc2)CCC(N)=C(C#N)C1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1nc2c(-c3ccccc3)[nH]c(C)c2c(=O)o1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cn1c(=O)c2c(c3cc(O)ccc31)OC(C(C)(C)O)C2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C=C2SC(c3c(O)ccc4ccccc34)N(NC(=O)CCCCCCCCC(=O)NN3C(=O)C(=Cc4ccc(OC)c(OC)c4)SC3c3c(O)ccc4ccccc34)C2=O)cc1OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)Nc1ccccc1S(=O)(=O)c1c(-c2c(C)c(Cl)c(C)c(Cl)c2C)noc1C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Oc1ncnc2[nH]ncc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C=CC(=O)OCCc2ccccc2)cc1OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Clc1cc(OC23CC4CC(CC(C4)C2)C3)nc(Cl)n1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN(C)c1ncnc2c1ncn2C1C=CC(COS(N)(=O)=O)C1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cl.Cn1cc(N)cc1C(=O)Nc1cc(C(=O)Nc2cc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3c2)n(C)c1.[NaH]
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Nc1ccc2c(O)c(N=Nc3ccc(-c4ccc(N=Nc5c(S(=O)(=O)O)cc6cc(S(=O)(=O)O)c(N=Nc7cc(Cl)ccc7Cl)c(N)c6c5O)cc4)cc3)c(S(=O)(=O)O)cc2c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(c1ccccc1)n1[nH]c(=O)n(-c2ccc(Cl)cc2)c1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=C(Cc1ccc2c(c1)OCO2)C(=C)Cc1ccc(O)cc1O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCCCCCCCC(c1cc(Cl)c(OC)c(C(=O)OC)c1)c1cc(Cl)c(OC)c(C(=O)OC)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: BC(=O)NC(CC(C)C)C(=O)NC1c2ccsc2C(=O)C1O.CN(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1CSC(c2ccccc2)C1C(=O)c1ccc(NCc2nc3ccccc3[nH]2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1OCC2C(O)CCCCCN12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cccc(CCn2c(N)c(-c3ccccc3)c3ccc([N+](=O)[O-])cc3c2=O)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC1OC2COc3ccccc3OC2C2NC(=N)SC12
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(NS(=O)(=O)c2ccc(NO)cc2)no1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(O)c1ccc(CSc2ccc(Cl)cc2)cc1
| Yes |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.