prompt stringlengths 189 761 | answer stringclasses 2 values |
|---|---|
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(OC)c(NC(=O)CCCC(CC(=O)c2ccc(O)c(OC)c2)=NNC(=O)C[N+](C)(C)C)c1.[Cl-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#CCCN(CCC#N)c1ccc(C=C2N=C(c3cc([N+](=O)[O-])ccc3Cl)OC2=O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=P1(O)C=CC2(CCCC2)O1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=[N+]([O-])c1ccc(C2=NOC(c3ccc(Cl)cc3)N2C23CC4CC(CC(C4)C2)C3)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)Nc1ccc2c(c1)Cc1cc(N(CCO)CCO)ccc1-2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: S=C1NNC2(C(=S)N1)c1ccccc1-c1ccccc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C(=O)C(C(=O)C(=O)Nc1ccccc1C(=O)OC)c1nc2ccc(C(=O)c3ccccc3)cc2nc1O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(S(=O)(=O)Nc2cc(=N)[nH][nH]2)c(SCc2nc(N)nc(N(C)C)n2)cc1Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=CCOc1ccc(N)c([N+](=O)[O-])c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cn1cc(S(=O)(=O)NC(=O)Nc2ccc(Cl)cc2)c(=O)c2ccc(F)cc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1=Nc2cc(=N)[nH]n2C(=O)C1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C1(C(=O)OC)N=C(C)OC1C(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: NNC1=Nc2ccc(Cl)cc2C(=S)N2CSCC12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1CCCN(CC(O)CN2CCN(CC(O)CN3CCCC(C)C3)C(C)C2)C1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1(C)OC2C(=O)OC(CO)C2O1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C(C#N)=C(N)c1c(C)c2ccccc2oc1=N
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCC(=O)Oc1ccc2c(C)cc(=O)oc2c1OC(=O)CCC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cccc(Cl)c1NC=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: NCCSSCC(N)C(=O)O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC#CC(O)(C(=O)OC1C2CCN(CC2)C1C)C1=CCCC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOCCN(CCOCC)C(=O)c1ccc2c(c1)no[n+]2[O-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CSC(=NS(=O)(=O)c1ccc(Cl)cc1)NCCN=C(NS(=O)(=O)c1ccc(Cl)cc1)SC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(O)CCC1CCc2cccc(O)c2C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1N=NC(Cl)c2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1NC(=O)C2C(=O)NC(=O)C1C2(c1ccccc1)c1ccc(Cl)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)NNC(=S)NC=C1C(=O)C=C(C)OC1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C[N+](C)(C)CC(=O)NN=C(Cc1nc2ccc([N+](=O)[O-])cc2nc1O)C(=O)Nc1cc(C(F)(F)F)ccc1Cl.[Cl-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1CCC(S(=O)(=O)c2ccccc2)C(C=Cc2ccccc2)O1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc2c(c(C)c1O)C(C)(C)CN2C(=O)C(C)(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1C=CC(Sc2ccccc2)CCC1(C)O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)CC1NC(=O)C1C(C)(OC)OC
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1Oc2ccccc2C(=O)C1=CNC(=S)NCc1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)CCN1c2ccccc2Sc2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCOC(C(=O)OC1CCC2CCC1N2C)(c1ccccc1)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C([OH+][Mo+2]1234(C#[O+])(C#[O+])(C#[O+])C5=C1[C-]2C3=C54)C(F)(F)F
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CNC(=O)NC1ON=C(c2ccccc2)C1C(=O)NC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCC(=O)NC(Nc1cc(C)on1)(C(F)(F)F)C(F)(F)F
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C#CC1(O)CCC2C3CCC4=CCCCC4C3CCC21C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN1CCN(C(=S)N2CCN(C)CC2)CC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: c1cc(CSSCc2ccncc2)ccn1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1=C(N2CC2)C(=O)c2nc3n(c2C1=O)CCC3O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ccccc1C=NC12CC3CC(CC(C3)C1)C2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)C(NNc1ccccc1)C(c1ccccc1)[PH](c1ccccc1)(c1ccccc1)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN1C2CCC1C(C(=O)O)C(O)C2.Cc1ccc(S(=O)(=O)O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC1(c2ccccc2)OC(=O)c2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C=Cc2n[nH]c(=S)[nH]2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=NNC(=N)N)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Nc1ccc(S(=O)(=O)C(=O)O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Oc1cc2ccccc2cc1OC(F)(F)c1nc2ccccc2o1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC=CC=Cc1cc2cc3c(c(O)c2c(O)n1)C1(CC3)C(=O)c2c(O)c3c(c(O)c2C1=O)C(=O)C(OC)=CC3=O.[KH]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C1=[N+]2[N-]C(N3CC4CCC(CC4)C3)=[S+][Cu-2]2[n+]2ncccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ccc(CN2CC(=O)N3Cc4ccccc4CN3C(=O)C2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1Cc2c([nH]c3cc(Br)ccc23)-c2ccccc2N1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ccc(S(=O)(=O)Sc2nnnn2C)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1CC(=O)CC2CCC3C4CCC(OC(=O)c5cccc6c(=O)c7ccccc7[nH]c56)C4(C)CCC3C12C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOc1ccc(N=Cc2cccc3cccnc23)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)N(C)CCc1c[nH]c2ccccc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: NC(Cc1c[nH]cn1)C(=O)NC(Cc1ccc(O)c(O)c1)C(=O)NCC(=O)NC=Cc1c[nH]c2cc(Br)ccc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: NCCCCNCCCNC(=O)c1csc(-c2nc(CCN)sc2Cl)n1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=CC=CC(C)C)C1CCC(C)(NC=O)CC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1c2ccccc2C(=O)N1CCCSCC(CO)SCCCN1C(=O)c2ccccc2C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cn(CC2=NC3CCCCC3N2)c(=O)[nH]c1=O.Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)c1cc(Cl)cc2c(=O)c3c(O)c4[nH]c5c(C(=O)OCC)cc(Cl)cc5c(=O)c4c(O)c3[nH]c12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC=C(CCCCOC1CCCCO1)[Si](C)(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC1=CC(=Nc2c(Cl)cc(Cl)cc2OC(=O)c2ccc([N+](=O)[O-])cc2)C=C(OC)C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)N(C(C)=O)c1c(C)cc(-c2ccccc2)oc1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN1C(=S)Nc2ncn(C)c2S1(=O)=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ccccc1NC(=O)C(=O)CC(=O)c1sc(-n2nc(-c3ccccc3)cc2-c2ccccc2)nc1C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=c1n(N=S(=O)(c2ccccc2)c2ccccc2)c(=O)n2n1C1C=CC2CC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccccc1CNCCCCCNCCCCCCCCCCNCCCCCNCc1ccccc1OC.Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)C1=NN(c2ccccc2)C(=O)C1=CN1C(=O)C(=Cc2cccc(OC)c2O)SC1=S
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCNC(=O)C(C)(Cl)C(=O)c1ccccc1O
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1Nc2ccccc2Oc2ccccc21
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cnc2sn(-c3ccc(Oc4ccccc4)cc3)c(=O)c2c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ccc(C=C2CN(C)CC3C(c4ccc(C)cc4)=C(C#N)C(=O)NC23)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(CCn1[nH]c(=O)ccc1=O)=NOCCCc1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cc2ccc3c4cc(OC)c(OC)cc4c[n+](C)c3c2cc1O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC1(c2ccccc2)OC2OCCC2C1c1ccc(Cl)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc2c(cc1C)C(=O)C1(C2)Cc2c(C)ccc(C)c2C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)c1ccc(NC(=O)Nc2ncccc2C)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc2[nH]c3c(c2c1)CCc1c(OC)cccc1-3
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOc1ccc(-c2coc3cc(C)c(OCC)c(C)c3c2=O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOc1ccc(NCc2cc(OC)c(OC)c(OC)c2)cc1.Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(OC)c2c(Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)cc(C)nc12.[NaH]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCN(CC)C(=O)N1CN(c2ccccc2)C2(CCN(CCCSc3ccc(F)cc3)CC2)C1=O.Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=CCOC(C)n1c(C)cc(=O)n(C(C)OCC=C)c1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=C(C)C(=O)OC1CC23OC2CCC(=CC2OC(=O)C(=C)C21)COC3O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOP(=O)(OCC)C1C(CO)OC(n2ccc(=O)[nH]c2=O)C1O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1NC(=O)C(CCC(=O)c2cccc3ccccc23)C(=O)N1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: c1ccc(-c2cc(N3CCOCC3)c3ccccc3n2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1nc2ccccc2c(-n2cccn2)c1CCn1cccn1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(NCCN1CCCC1)c1cn2c(ccc3sc4ccccc4c(=O)c32)n1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C12Oc3ccc(-c4ccc5c(c4O)C(=O)C4=CCC(C)C(O)C4(C(=O)OC)O5)c(O)c3C(=O)C1=CCC(C)C2O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ccc(S(=O)(=O)NN=C2CC3C4C=CC3C2C4)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C2SC(=Cc3cccc([N+](=O)[O-])c3)C(=O)N2NC(=O)Cc2ccccc2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)C1(Cc2ccc3c(c2)CCC3)Cc2cc3c(cc2C1)CCC3
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1CC2(CCc3ccccc32)C(=O)N1CN1CCN(c2ccccn2)CC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(C=Cc1ccc(O)c(O)c1)OCc1ccccc1
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: OCC=Cc1ccc(O)c(O)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCCCOC(=O)c1[nH]c(=O)n(CCCCCC)c(=O)c1N
| Yes |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.