molecules
dict
messages
listlengths
3
3
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging.", "role": "assistant" } ]
{ "smiles": [ "O=C(O)C1C(C(=O)O)C2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "When heated to decomposition it emits toxic fumes of hydrogen chloride.", "role": "assistant" } ]
{ "smiles": [ "NC(=O)c1nn(CC(=O)N2C(C(=O)NCC3CC3(Cl)Cl)CC3CC32)c2ccc(Cl)cc12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "It belongs to the complement pathway modulator class of molecules.", "role": "assistant" } ]
{ "smiles": [ "Cn1c(=O)[nH]c2c(ncn2CCCC(=O)O)c1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It belongs to the anti body class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(O)COP(=O)([O-])OCC[N+](C)(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It has an effect on ovarian cancer, and impacts alzheimer's disease, multiple sclerosis, and renal cell carcinoma. It has an effect on stomach cancer, and impacts renal failure, atherosclerosis, colorectal cancer, and diabetes mellitus.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, diabetic heart disease, and aging. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CN1CC(CNCCN)OC1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the anti bacterial class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CC1(C)OC2CC3C4CC(F)C5=CC(=O)C=CC5(C)C4(F)C(O)CC3(C)C2(C(=O)CO)O1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule has Odorless.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient that impacts both atherosclerosis and cardiovascular disease. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting both metabolic syndrome and pancreatitis.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, a energy source, a cholesterol translocation, and smooth. The molecule is a membrane stabilizer and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease. The molecule is a apoptosis and a energy storage, impacting both tangier disease and barth syndrome. The molecule is a food additive, surfactant, stabilizing mitochondrial structure, nutritional supplement, emulsifier.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a inflammatory, energy storage, nutrient that impacts pancreatitis, metabolic syndrome, and obesity. The molecule is a membrane stabilizer and thyroxine treatment, and it impacts cardiovascular disease. The molecule is a energy source and a fat storage, with effects on cancer and impacts on atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts non-alcoholic fatty liver disease and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts barth syndrome and tangier disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "O=C(Nc1ccccc1-c1ccccc1)OC1CCN(CCNCC(=O)c2ccc(CN3CCC(CO)CC3)s2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a muscarinic receptor antagonist.", "role": "assistant" } ]
{ "smiles": [ "N#Cc1cc2c(nc1Cl)C(Nc1ccc(N)c(C(=N)c3cnco3)c1)CCC2" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a lrrk2 inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC(O)C=CC=CC=CC(O)CC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and aging. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC1C(O)CC(=O)C1C=CC(O)CCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient that impacts cervical cancer, ulcerative colitis, breast cancer, and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CSc1ccc(C(=O)c2cc(F)cc(F)c2)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cox2 inhibitor and is anti inflammatory.", "role": "assistant" } ]
{ "smiles": [ "Cc1cc(-c2ccc(N3CCOCC3)cc2)c(C(=N)C(C)C)c(Nc2cccc(Br)c2)n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is both a cftr modulator and a cystic fibrosis treatment.", "role": "assistant" } ]
{ "smiles": [ "CCn1cc(-n2nnc3cc(OC(c4cc(F)cc(F)c4)C(C)NC(=O)C(C)(F)F)ccc32)cn1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It belongs to the anti inflammatory class of molecules.", "role": "assistant" } ]
{ "smiles": [ "C=C(C)c1cccc(S(=O)(=O)[O-])c1.[Na+]" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the anti fouling class of molecules.", "role": "assistant" } ]
{ "smiles": [ "Cc1cccc(N(C)C(=O)C2C(Cc3ccnc(N)c3)C(=O)N2C(=O)NC(C2CCCCC2)C(F)(F)F)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the anti coagulant class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts tangier disease, aging, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "Cn1ccc(-c2cnccn2)n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a anti bacterial member of the crf antagonist class.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CCC(O)CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a nutrient that affects breast cancer by impacting ulcerative colitis, atherosclerosis, and cervical cancer.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome. The molecule is a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CNC(C)C(=O)NC(C(=O)N1Cc2cc(CCc3ccc(C(=O)NC4CC(C(=O)NC5CCCc6ccccc65)N(C(=O)C(NC(=O)C(C)NC)C(C)(C)C)C4)cc3)ccc2CC1C(=O)NC1CCCc2ccccc21)C(C)(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a modulate member of the cancer treatment class.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts aging and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC(O)C(O)C=CC=CC=CC=CC(O)CCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impacts parkinson's disease, non-alcoholic fatty liver disease, alzheimer's disease, and diabetes mellitus type 2.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, aging, tangier disease, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCC(O)C(O)CCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a fat storage that impacts both metabolic syndrome and pancreatitis. The molecule is a nutrient and thyroxine treatment, impacting both cardiovascular disease and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC(=O)c1cc(C(C)(C)C)nn1CC(F)F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a rock inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCOC(C)=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule has Sweet ester odor. The molecule has Bittersweet taste suggestive of pear. When heated to decomposition it emits acrid smoke and fumes.", "role": "assistant" } ]
{ "smiles": [ "CC(C)CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a fat storage, energy storage, energy source that impacts metabolic syndrome, obesity, and pancreatitis. The molecule is a nutrient that impacts both atherosclerosis and cardiovascular disease. The molecule is a inflammatory, a thyroxine treatment, and a membrane stabilizer, and it impacts cancer.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC(O)C=CC=CC=CC=CC(O)C(O)CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a nutrient that affects breast cancer by impacting cervical cancer, ulcerative colitis, and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "Oc1ccc(C(Br)Oc2ccc(COCc3ccc(OC(Br)c4ccc(O)cc4)cc3)cc2)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is breast cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC(O)C=CC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a energy storage, membrane stabilizer, energy source, inflammatory that has an effect on lipotoxicity and impacts metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCc1nc(CC)c(C)s1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "COC1=CC(=O)C(OC)=CC1=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a energy source, nutrient, signalling molecule, energy storage, membrane stabilizer.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts aging, diabetic heart disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts barth syndrome and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCC(C)Oc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)cc2)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a anti fungal.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a thyroxine treatment that impacts both metabolic syndrome and atherosclerosis. The molecule is a fat storage and a nutrient, impacting both cardiovascular disease and pancreatitis.", "role": "assistant" } ]
{ "smiles": [ "CC(C)(C=C(C#N)C(=O)N1CCCC(c2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)nccn23)C1)N1CCN2C(=O)OCC2C1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a btk inhibitor and tyrosine kinase inhibitor, and it impacts cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "C=CC(=O)OCCCCOc1ccc(C=Cc2cc(OC)c(C=Cc3ccc(OC(=O)c4ccc(OCCCCOC(=O)C=C)cc4)cc3)cc2OC)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a liquid crystal.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, aging, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "N#Cc1cncc(COc2[nH]c(=O)c(Cl)cc2CNC(CO)C(=O)O)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts tangier disease and aging.", "role": "assistant" } ]
{ "smiles": [ "COC(=O)c1cc2c(OC)c(CN(CC(OC)OC)S(=O)(=O)c3ccc(C)cc3)cc(OC)c2o1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is anti tumor.", "role": "assistant" } ]
{ "smiles": [ "CCn1nccc1Nc1nc(-c2ccc(F)cc2)c(C=CC(O)CC(O)CC(=O)O)c(C(C)C)n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a hmgcoa reductase inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC(O)C=CC=CCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCC(O)C(O)C=CC=CC=CC=CC(O)CCCCC)COP(=O)(O)OCC(N)C(=O)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a emulsifier and a proton trap for oxidative phosphorylation, it impacts diabetic heart disease, and is smooth. The molecule is a stabilizing cytochrome oxidase, membrane stabilizer, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a energy source, a energy storage, and a nutritional supplement, and it impacts aging. The molecule is a food additive, apoptosis, stabilizing mitochondrial structure, surfactant that impacts barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, aging, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CC(O)C(C)Sc1nc(Nc2ccc(S(C)(=N)=O)cc2)ncc1Br" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a cdk inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a nutrient and membrane stabilizer, affecting cancer, and impacting obesity, pancreatitis, and cardiovascular disease. The molecule is a fat storage that impacts both atherosclerosis and thyroxine treatment. The molecule is a energy source, a inflammatory, and a energy storage, and it impacts metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCOC(=O)C(CC(F)(F)C1OC(CC)C(C)C(OCc2ccccc2)C1OCOC)NC(=O)OCc1ccccc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is anti cancer.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts barth syndrome and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease and aging. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CC1CN(CCNc2ccc3c(c2)COC3=C2C(=O)Nc3ccc(F)cc32)CC(C)O1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a kinase inhibitor and is modulate.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and tangier disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "It impacts breast cancer, cardiovascular disease, diabetes mellitus, and parkinson's disease. It has an effect on stomach cancer, and impacts seizure, colorectal cancer, and alzheimer's disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, aging, and barth syndrome. The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts tangier disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "NC(CC1CCCCC1)C(O)C(=O)Nc1ccc(Cl)c(Cl)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a angiogenesis inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts diabetic heart disease and aging. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts aging, barth syndrome, and tangier disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a nutrient and thyroxine treatment, and it impacts cardiovascular disease. The molecule is a fat storage that impacts pancreatitis, metabolic syndrome, and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts aging and barth syndrome. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CC1CCCC(C)(O)C1(C)C.Cl.Cl" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a monoamine reuptake inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a nutrient that impacts atherosclerosis, ulcerative colitis, cervical cancer, and breast cancer.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCOC(=O)c1[nH]cc2c1NC1=C(C(=O)CNC1)C2c1ccc(Sc2nc3c(F)cc(F)cc3[nH]2)o1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a aurora kinase inhibitor and belongs to the anti cancer class of molecules, with the characteristic of being kinase modulator.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient, energy source, and membrane stabilizer that has an effect on cancer and impacts both cardiovascular disease and metabolic syndrome. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting atherosclerosis. The molecule is a inflammatory and a energy storage, impacting both obesity and pancreatitis.", "role": "assistant" } ]
{ "smiles": [ "CC(C)CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, a membrane stabilizer, and a nutritional supplement, and it impacts non-alcoholic fatty liver disease. The molecule is a energy source, cholesterol translocation, energy storage, apoptosis that impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation and a emulsifier, it impacts barth syndrome, and is smooth. The molecule is a food additive, surfactant, stabilizing mitochondrial structure that impacts diabetic heart disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a inflammatory that impacts metabolic syndrome, obesity, atherosclerosis, pancreatitis, and cardiovascular disease. The molecule is a membrane stabilizer and belongs to the thyroxine treatment class of molecules, known to have an effect on cancer. The molecule is a energy storage, fat storage, nutrient, energy source.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a surfactant and a apoptosis, impacting both tangier disease and diabetic heart disease. The molecule is a cholesterol translocation, energy source, membrane stabilizer, nutritional supplement that impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, a energy storage, and a proton trap for oxidative phosphorylation, and it impacts aging. The molecule is a food additive, a emulsifier, and a stabilizing mitochondrial structure, it impacts barth syndrome and is smooth.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease and tangier disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting pancreatitis. The molecule is a fat storage that impacts cardiovascular disease, metabolic syndrome, and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a inflammatory, membrane stabilizer, energy storage that impacts cardiovascular disease, pancreatitis, and obesity. The molecule is a energy source and nutrient, and it impacts atherosclerosis. The molecule is a fat storage and thyroxine treatment, impacting both cancer and metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "Cc1ncnc2c1ncn2C1OC(CO)C(O)C1(C)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti viral and is anti neoplastic.", "role": "assistant" } ]
{ "smiles": [ "CCOc1ccc(C(=O)CCc2c(O)cc(OC)cc2OC)cc1OCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti infective, a anti cancer, and a anti inflammatory, belonging to the anti microbial class of molecules and is anti neoplastic.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and barth syndrome. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CN(C)c1ccc(-c2cn3nc(-c4ccco4)nc3c(N)n2)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the parkinson's treatment class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a inflammatory, energy source, energy storage that impacts metabolic syndrome, cardiovascular disease, and pancreatitis. The fat storage molecule is thyroxine treatment and has an effect on cancer. The molecule is a membrane stabilizer and a nutrient, impacting both obesity and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CC1(C)C(NC(=O)c2ccc(N3CCC(N4CCc5cc6c(cc5C4)C(=O)N(C4CCC(O)NC4=O)C6=O)CC3)cc2)CC1Oc1ccc(C#N)c(Cl)c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a fat storage that impacts both metabolic syndrome and atherosclerosis. The molecule is a nutrient that impacts pancreatitis, thyroxine treatment, and cardiovascular disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and aging. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CS(=O)(=O)c1ncc(-c2cnc3n[nH]c(-c4cc5cccnc5[nH]4)c3c2)n1S(C)(=O)=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a wnt pathway inhibitor.", "role": "assistant" } ]
{ "smiles": [ "O=P(O)(Oc1ccc(CSCc2ccccc2Br)cc1Br)C(F)F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a diabetes treatment.", "role": "assistant" } ]
{ "smiles": [ "CC(C)(C)S(=O)(=O)NC1CCC(C(=O)Nc2ccc(C(=O)c3ccccc3)cc2)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is both a anti obesity and a npy y5 antagonist.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a fat storage that impacts both cardiovascular disease and pancreatitis. The molecule is a nutrient that impacts metabolic syndrome, thyroxine treatment, and atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts aging and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "O=NC12CCC(=C(O)c3ccncc3)C3Oc4c(O)ccc5c4C31CCN(CC1CC1)C2C5" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "It impacts addiction treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, tangier disease, and aging.", "role": "assistant" } ]