molecules dict | messages listlengths 3 3 |
|---|---|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts aging, barth syndrome, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, non-alcoholic fatty liver disease, aging, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis, cholesterol translocation that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(CCc2cc(-c3cc(CN(C)CC4CCCO4)ccc3C(N)=O)n[nH]2)cc(OC)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fgfr inhibitor and belongs to the cancer treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC=CCC=CCC=CCC=CCC(O)CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(CCC(=O)c1ccoc1)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a surfactant, emulsifier, membrane stabilizer, energy source, nutrient, energy storage.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1ccc(-c2noc(C3COCCN3S(C)(=O)=O)n2)cc1NC(=O)C1CN=C2C=CC=CN21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"COC(=O)C1CC(O)CN1CC=C1CN(C(C(=O)C2CC2)c2ccccc2F)CCC1S"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the anti thrombotic class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)c1cccc(N2CCCCC2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "It belongs to both the anti bacterial and anti biotic classes of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)C1NC(=O)C2CCCN2C(=O)C(CC(C)(C)O)OC(=O)CCNC(=O)C(C)N(C)C(=O)C(C(C)CC)N(C)C1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is both a nutrient and a waste product.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts diabetic heart disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage, energy storage, inflammatory, energy source that impacts pancreatitis and cardiovascular disease. It has an effect on cancer, impacting both atherosclerosis and obesity. The molecule is a nutrient and membrane stabilizer, belonging to the thyroxine treatment class of molecules, and impacts metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a energy source and thyroxine treatment, which has an effect on cancer and impacts obesity, pancreatitis, and atherosclerosis. The molecule is a inflammatory, a nutrient, and a membrane stabilizer. The molecule is a fat storage and a energy storage, impacting both cardiovascular disease and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis that impacts aging, diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, energy storage, nutrient that impacts pancreatitis, metabolic syndrome, and obesity. The molecule is a fat storage that affects cancer by impacting thyroxine treatment. The molecule is a inflammatory and a energy source, impacting both atherosclerosis and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage, energy source, and thyroxine treatment that has an effect on cancer and impacts both atherosclerosis and obesity. The molecule is a energy storage and membrane stabilizer, and it impacts metabolic syndrome. The molecule is a inflammatory and a nutrient, impacting both cardiovascular disease and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1ccc(-c2cc(NCC(N)c3cc(C(F)(F)F)ccc3F)ncn2)cc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a faah inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(CC=CCCCC(=O)O1)C(O)CC(O)C(C=CC(O)CCCCC)C(O)C2O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "It impacts diabetes mellitus, stomach cancer, colorectal cancer, and parkinson's disease. It has an effect on breast cancer, and impacts seizure, alzheimer's disease, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, a food additive, and a apoptosis, and it impacts barth syndrome. The molecule is a membrane stabilizer, surfactant, emulsifier that impacts tangier disease and aging. The molecule is a stabilizing mitochondrial structure, a nutritional supplement, a energy source, and smooth. The molecule is a energy storage, proton trap for oxidative phosphorylation, cholesterol translocation that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a inflammatory and nutrient, belonging to the thyroxine treatment class of molecules, and impacts atherosclerosis, cardiovascular disease, and metabolic syndrome. The molecule is a energy source, a energy storage, and a fat storage. The molecule is a membrane stabilizer that impacts cancer, obesity, and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a energy source, fat storage, energy storage that impacts pancreatitis, obesity, and metabolic syndrome. The molecule is a nutrient that impacts both cardiovascular disease and cancer. The molecule is a inflammatory and membrane stabilizer, belonging to the thyroxine treatment class of molecules, and impacts atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, aging, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, a energy source, and a surfactant, and it impacts diabetic heart disease. The molecule is a emulsifier, cholesterol translocation, nutritional supplement, membrane stabilizer that impacts aging. The molecule is a stabilizing cytochrome oxidase, a stabilizing mitochondrial structure, and a food additive, and it impacts tangier disease. The molecule is a apoptosis and a energy storage, which impacts both non-alcoholic fatty liver disease and barth syndrome, and is characterized as smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome and diabetic heart disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts aging, tangier disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(Nc1ncnc2nc[nH]c12)c1nc2ccc(F)c(Cl)c2c(=O)n1-c1cc(F)cc(F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is both a pi3 kinase inhibitor and a kinase modulator.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a inflammatory, energy storage, membrane stabilizer that impacts pancreatitis, metabolic syndrome, and cardiovascular disease. The molecule is a energy source and nutrient, and it impacts obesity. The molecule is a fat storage belonging to the thyroxine treatment class, known to affect cancer and impact atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"S=C(Cl)Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "Decomposes above 200 °c to carbon disulfide (very flammable) and carbon tetrachloride. The molecule has Malodorous.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)OC(=O)NC1Cc2c(n(Cc3cccc(F)n3)c3ccc(C#N)cc23)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a androgen receptor modulator.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts diabetic heart disease. The molecule is a apoptosis that impacts tangier disease, barth syndrome, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cn1c(=O)c(N(C=Cc2cc(O)c(O)c(O)c2)C(=O)O)c(N)n(-c2ccccc2)c1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a anti inflammatory and is anti allergic.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "It impacts cardiovascular disease, pancreatitis, and atherosclerosis. The molecule is a nutrient and fat storage, belonging to the thyroxine treatment class of molecules, and impacts metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts tangier disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, aging, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(N2CCOCC2)ccc1Nc1ncc(C(F)(F)F)c(NCc2ccccc2C(=O)C(=O)N(C)C)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "It belongs to the cancer treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a surfactant, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis. The molecule is a emulsifier, proton trap for oxidative phosphorylation, energy source that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a cholesterol translocation, a membrane stabilizer, and a energy storage, and it impacts aging. The molecule is a nutritional supplement and a food additive, which impacts both diabetic heart disease and barth syndrome, and is characterized as smooth.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a inflammatory, energy source, energy storage, nutrient that impacts cardiovascular disease and cancer. The molecule is a fat storage and thyroxine treatment, and it impacts pancreatitis. The molecule is a membrane stabilizer that impacts metabolic syndrome, obesity, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts tangier disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a thyroxine treatment and fat storage, and it impacts atherosclerosis. The molecule is a nutrient that impacts pancreatitis, cardiovascular disease, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts tangier disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC(O)C=CC=CCCCCC)COP(=O)(O)OCCN"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts parkinson's disease, non-alcoholic fatty liver disease, diabetes mellitus type 2, and alzheimer's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOC(=O)COc1ccc(CCBr)cc1C#N"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It impacts obesity treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CCn1c(=O)c2cnc(Nc3cc4c(c(OCC(C)C)c3)CCN(C)C4)nc2n1-c1cccc(N=S(C)(C)=O)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a wee1 inhibitor and belongs to the anti tumor class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(Cl)c1cccc2c1SCC2=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a hepatitis b treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease, aging, barth syndrome, and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a cholesterol translocation, apoptosis, stabilizing cytochrome oxidase that impacts aging and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and tangier disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(CCC(F)(F)F)c(-c3ccc(OC)c(C=O)c3)cc12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a hepatitis c treatment, anti viral activity, and anti viral compound.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient and thyroxine treatment, and it impacts cardiovascular disease. The molecule is a fat storage that impacts pancreatitis, metabolic syndrome, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts non-alcoholic fatty liver disease, barth syndrome, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)OC(=N)Cc1cn(C)c2cc(F)ccc12.Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a member of the anti proliferative class and affects cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCc1oc(CCCCCCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C)c(C)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a energy source that impacts heart failure, diabetes mellitus type 2, and inflammatory bowel disease. It has an effect on breast cancer, and impacts cardiovascular disease, celiac disease, and renal cell carcinoma.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCCC(O)C=CC=CC=CC(O)CC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts alzheimer's disease, parkinson's disease, breast cancer, and diabetes mellitus. It impacts colorectal cancer, stomach cancer, seizure, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts tangier disease, barth syndrome, and aging. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a emulsifier, stabilizing mitochondrial structure, membrane stabilizer, stabilizing cytochrome oxidase. The molecule is a nutritional supplement, a energy storage, and a proton trap for oxidative phosphorylation, it impacts non-alcoholic fatty liver disease and is smooth. The molecule is a energy source that impacts barth syndrome, tangier disease, and aging. The molecule is a surfactant, food additive, cholesterol translocation, apoptosis that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, and tangier disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and tangier disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1(C)C2=CC(c3nc(Cl)nc4c3ccc3ccccc34)=CCC2c2ccccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a organic electroluminescent compound and is electroluminescent.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts aging. The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(Nc1ccc(Oc2ccnc3c2C2NCCCN2C(=O)N3)cc1)c1cccc(Br)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a protein kinase inhibitor, kinase inhibitor, aurora kinase inhibitor that belongs to the cancer treatment class of molecules and impacts hyperproliferative disease treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts barth syndrome, aging, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1ccc2c(c1)C1CCC2(C)OOC1(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient, surfactant, membrane stabilizer, energy source, energy storage, emulsifier.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts tangier disease, barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC(O)C=CC=CC=CC(O)CC=CCC=CCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)C=CCCC=CCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts cardiovascular disease, insulin resistance, and pick's disease. The molecule is a nutrient that impacts diabetes mellitus type 1, diabetes mellitus type 2, and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"O=CO"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The slow decomposition in storage of 98-100% formic acid with liberation of carbon monoxide led to rupture of the sealed glass containers. in absence of gas leakage, a full 2.5 l bottle would develop a pressure of over 7 bar during 1 yr at 25 °c. explosive decomposition of formic acid on a clean nickel ... surface was studied, using deuteroformic acid. a full 1 l bottle of 96% formic acid burst when the ambient temp fell to -6 °c overnight and the contents froze and expanded. gas pressure from previous partial decomposition may also have contributed. The molecule has both a Pungent, penetrating odor and a Sour.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage, energy source, inflammatory that impacts thyroxine treatment, pancreatitis, and cancer. The molecule is a energy storage and membrane stabilizer, and it impacts atherosclerosis. The molecule is a nutrient that impacts cardiovascular disease, obesity, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(CO)COC(=O)CCCCCCCC=CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "It impacts insulin resistance.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CCCc1ccc2c(c1F)Oc1c(cc(OCC3CCC(C=C)CO3)c(F)c1F)C2"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a dielectric, liquid crystal display device, liquid crystal compound that has an effect on liquid crystal display and impacts negative dielectric anisotropy.",
"role": "assistant"
}
] |
{
"smiles": [
"O=[Cr](=O)([O-])O[Cr](=O)(=O)[O-].[K+].[K+]"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule has Odorless, no distinctive odor. When heated to decomposition it emits toxic fumes of potassium oxide. The molecule has Bitter, metallic taste.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a inflammatory, nutrient, energy storage that impacts pancreatitis, metabolic syndrome, and obesity. The molecule is a membrane stabilizer that impacts both cardiovascular disease and cancer. The molecule is a energy source, a fat storage, and a thyroxine treatment, and it impacts atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)CCCCCCCC=CC=CC(=O)CCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It has an effect on breast cancer, and impacts diabetes mellitus, stomach cancer, and parkinson's disease. It impacts cardiovascular disease, colorectal cancer, seizure, and alzheimer's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(CC2C(=O)OC(C)C(NC(=O)C(CC(C)C)N(C)C(=O)C3CCCN3C(=O)C(C)O)C(=O)NC(C(C)C)C(O)CC(=O)OC(C(C)C)C(=O)NC(CC(C)C)C(=O)NC(C)C(=O)N2C)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is anti cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer and a nutrient that impacts metabolic syndrome, cardiovascular disease, pancreatitis, and obesity. The molecule is a inflammatory and energy source, and it impacts atherosclerosis. The molecule is a fat storage and a energy storage, impacting both cancer and thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CN1CCN(C(=O)c2cnc3ccc(N4CCCC4c4cc(F)ccc4F)cn23)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a pain treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts non-alcoholic fatty liver disease, barth syndrome, and tangier disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis, stabilizing mitochondrial structure that impacts aging. The molecule is a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, tangier disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC(O)C=CC=CCC=CCCCCCCCC)COP(=O)(O)OCCN"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts parkinson's disease, alzheimer's disease, diabetes mellitus type 2, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCC(CC)COc1cc(C)c(-c2ccc(N(c3ccc(C4C(O)C(c5ccc(N(c6ccc(-c7c(C)cc(OCC(CC)CCCC)cc7C)cc6C)c6ccc(-c7c(C)cc(OCC(CC)CCCC)cc7C)cc6C)cc5O)C4O)c(O)c3)c3ccc(-c4c(C)cc(OCC(CC)CCCC)cc4C)cc3C)c(C)c2)c(C)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The luminescent molecule has an effect on light emission.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(-n2nc(C(=O)O)c3c2C(=O)N(c2ccc(N4CCCCC4=O)cc2)CC3c2nc3ccccc3s2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a anti coagulant.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, aging, tangier disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts barth syndrome, aging, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCc1oc(CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCc2oc(CCCCC)c(C)c2C)COP(=O)(O)OCC(N)C(=O)O)c(C)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a emulsifier, a membrane stabilizer, a food additive, and smooth. The molecule is a energy storage, energy source, nutritional supplement, surfactant, nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease. The molecule is a cholesterol translocation that impacts tangier disease, barth syndrome, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CC(O)CC=CC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It has an effect on colorectal cancer, and impacts alzheimer's disease, breast cancer, and diabetes mellitus. It impacts stomach cancer, cardiovascular disease, seizure, and parkinson's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCC=CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both cardiovascular disease and metabolic syndrome. The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting both pancreatitis and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(O)c2c(=O)c(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)c(-c3ccc(O)c(OC)c3)oc2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a emulsifier, nutrient, membrane stabilizer, energy source, energy storage, surfactant.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts tangier disease and aging. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.