molecules dict | messages listlengths 3 3 |
|---|---|
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OC(CO)COC(=O)CCCCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts insulin resistance.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient and thyroxine treatment, and it impacts atherosclerosis. The molecule is a fat storage that impacts metabolic syndrome, pancreatitis, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"C=CCCCOc1ccc(C2CCC(C=Cc3ccc(-c4ccc(OCCCC)cc4)c(F)c3F)CC2)cc1F"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is dielectric and it impacts negative dielectric anisotropy.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a fat storage and nutrient, and it impacts pancreatitis. The molecule is a thyroxine treatment that impacts metabolic syndrome, atherosclerosis, and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC)COC(=O)CCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a nutrient, inflammatory, energy source that impacts obesity, cardiovascular disease, and atherosclerosis. The molecule is a energy storage and membrane stabilizer, and it impacts pancreatitis. The molecule is a fat storage and thyroxine treatment, impacting both metabolic syndrome and cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCC=CC(O)C(CO)NC(=O)CCCC=CCC=CCC=CCC=CC=CC(O)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "It impacts diabetes mellitus, neurodegenerative disease, and insulin resistance.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis that impacts tangier disease, diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(CCN1CC=C(c2ccc(C#Cc3ccccc3)cc2)CC1)(C(=O)NO)S(C)(=O)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a lpxc inhibitor that is anti bacterial agent and anti bacterial.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a energy source, fat storage, nutrient, inflammatory, energy storage that impacts obesity. The molecule is a membrane stabilizer that impacts both atherosclerosis and cardiovascular disease. The molecule is thyroxine treatment and impacts cancer, pancreatitis, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both pancreatitis and cardiovascular disease. The molecule is a nutrient that impacts thyroxine treatment, atherosclerosis, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a energy source and a energy storage, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a surfactant, a cholesterol translocation, and a emulsifier, it impacts aging and is smooth. The molecule is a membrane stabilizer, a food additive, and a stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation, nutritional supplement, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"C1=CC(c2cccc3ccccc23)CC=C1c1ccc2c(c1)oc1cc3c4c(cccc4c12)Oc1cc(-c2cccc4ccccc24)ccc1-3"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is electroluminescent.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts aging and diabetic heart disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a inflammatory, membrane stabilizer, energy storage that impacts obesity, cardiovascular disease, and atherosclerosis. The molecule is a energy source, a nutrient, and a thyroxine treatment. The molecule is a fat storage that impacts pancreatitis, cancer, and metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(c1ccccc1)N1CCC(Nc2ccc3[nH]ncc3c2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)(C)OC(=O)N1CCN2C(=O)c3c(cccc3C(F)(F)F)C2C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a serotonin receptor modulator.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCNCC(O)COC1C(O)OC(CO)C(O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the anti bacterial class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(N)CCN1NNc2ccccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a anti bacterial and is anti biotic.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC(O)C=CC=CCC=CC=CC(O)C=CCCCC(=O)OC(COC=CCCCCCCC=CCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts cervical cancer, breast cancer, atherosclerosis, and ulcerative colitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a energy source and a emulsifier, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a surfactant, stabilizing mitochondrial structure, apoptosis, energy storage, and smooth. The molecule is a food additive, a membrane stabilizer, and a nutritional supplement, and it impacts aging. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCC=COCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC1C(O)CC(O)C1C=CC(O)CCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts diabetes mellitus type 2, parkinson's disease, non-alcoholic fatty liver disease, and alzheimer's disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)NC(CC1CC1)C(O)CNC1CC2(CCC2)Oc2ncc(CC(C)(C)C)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a alzheimer's disease treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CC1=NC2C(N)=C(C3=NCCN3)C=NC2=C1c1ccc(Cl)cc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a anti fungal and is anti bacterial.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a apoptosis, a surfactant, and a food additive, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, a energy storage, and a energy source, it impacts tangier disease and is smooth. The molecule is a membrane stabilizer that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, emulsifier, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, nutritional supplement.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, aging, and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCC=CCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both cardiovascular disease and metabolic syndrome. The molecule is a nutrient and thyroxine treatment, impacting both pancreatitis and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer, nutrient, inflammatory, energy source that impacts cardiovascular disease and obesity. It has an effect on cancer, impacting both pancreatitis and atherosclerosis. The molecule is a energy storage and fat storage, belonging to the thyroxine treatment class of molecules, and impacts metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a energy storage, nutrient, and membrane stabilizer that has an effect on cancer and impacts both metabolic syndrome and pancreatitis. The molecule is a fat storage and thyroxine treatment, and it impacts obesity. The molecule is a energy source and a inflammatory, impacting both atherosclerosis and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both cardiovascular disease and metabolic syndrome. The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting both atherosclerosis and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CNc1cc(F)c2c3c1[nH]c1nc(Oc4cnc(C)nc4)nc(c13)N1CC(N)CC1C2"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the anti bacterial class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCOC(=O)c1ccc(NC(=O)NC(Cc2ccc(O)cc2)C(=O)NC2CC[N+](C)(Cc3ccc(O)c(O)c3)C2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It belongs to the muscarinic antagonist class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and diabetic heart disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts aging, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It impacts pancreatitis, cardiovascular disease, and atherosclerosis. The molecule is a fat storage and a nutrient, it impacts metabolic syndrome, and is thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a cholesterol translocation that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts atherosclerosis, cardiovascular disease, and metabolic syndrome. The molecule is a nutrient and a fat storage, it impacts pancreatitis, and is thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, barth syndrome, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts diabetic heart disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts diabetic heart disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, aging, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC(O)C(O)C=CC=CC=CC=CC(O)CC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a membrane stabilizer that impacts thyroxine treatment, pancreatitis, atherosclerosis, cardiovascular disease, and obesity. The molecule is a energy source and nutrient, and it impacts cancer. The molecule is a energy storage, a fat storage, and a inflammatory, and it impacts metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CC=CC(=O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that affects cervical cancer by impacting atherosclerosis, ulcerative colitis, and breast cancer.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts aging and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage and is part of the thyroxine treatment class, affecting atherosclerosis, obesity, pancreatitis, and cancer. The molecule is a nutrient and inflammatory, and it impacts cardiovascular disease. The molecule is a membrane stabilizer, a energy source, and a energy storage, and it impacts metabolic syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a energy source and nutrient, belonging to the thyroxine treatment class of molecules, with effects on cancer and impacts on both obesity and cardiovascular disease. The molecule is a membrane stabilizer that impacts both pancreatitis and metabolic syndrome. The molecule is a energy storage, a fat storage, and a inflammatory, and it impacts atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a apoptosis, a emulsifier, a cholesterol translocation, and smooth. The molecule is a nutritional supplement, membrane stabilizer, surfactant that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, food additive, energy storage, energy source. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts aging, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts tangier disease, aging, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a fat storage that impacts both pancreatitis and metabolic syndrome. The molecule is a nutrient and thyroxine treatment, impacting both atherosclerosis and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, and tangier disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, tangier disease, and diabetic heart disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)(CCOC(=O)Oc1ccc(N)cc1)OCCC(C)(C)OCCOC(=O)Oc1ccc(N)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a member of the autoimmune disease treatment class and affects cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease. The molecule is a apoptosis that impacts barth syndrome, diabetic heart disease, non-alcoholic fatty liver disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts diabetic heart disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(O)c1cc(C(=O)N(CCC(O)C(=O)O)Cc2ccc(-c3ccccc3)cc2)nn1Cc1cc(F)cc(Cl)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a heart failure treatment and belongs to the hypertension treatment class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"Ic1nc2ccccc2n1-c1ccc2c(c1)c1ccccc1n2-c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "This molecule is a member of the electroluminescent class and influences electroluminescent device.",
"role": "assistant"
}
] |
{
"smiles": [
"NC=CC(=CN)NC(=O)c1cc2ccc(N3CCC(Nc4ccc5[nH]ncc5c4)C3)cc2[nH]1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a rock inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CN1c2ccccc2NC1c1ccc(-c2cccc(-c3nc4c(nc5ccccn54)c4ccccc34)c2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the organic light-emitting class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "It impacts atherosclerosis, pancreatitis, and cardiovascular disease. The molecule is a nutrient and a fat storage, impacting both metabolic syndrome and thyroxine treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts aging, tangier disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts parkinson's disease, diabetes mellitus type 2, alzheimer's disease, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and aging. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts diabetic heart disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC(O)C(O)C=CC=CC=CC=CC(O)CCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a energy storage, a nutrient, and a inflammatory that impacts both atherosclerosis and cancer, and is thyroxine treatment. The molecule is a membrane stabilizer that impacts both obesity and pancreatitis. The molecule is a energy source and a fat storage, impacting both metabolic syndrome and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a fat storage, a energy storage, and a membrane stabilizer that impacts both cardiovascular disease and obesity, and is thyroxine treatment. The molecule is a energy source that impacts both metabolic syndrome and atherosclerosis. The molecule is a nutrient and a inflammatory, with effects on cancer and impacts on pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts diabetic heart disease and aging. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a nutrient, a membrane stabilizer, and a energy storage that impacts both obesity and metabolic syndrome, and is thyroxine treatment. The molecule is a inflammatory that impacts both cardiovascular disease and atherosclerosis. The molecule is a fat storage and a energy source, impacting both cancer and pancreatitis.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, tangier disease, and aging. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCc1cc(C(F)(F)F)ccc1Oc1ccc2c(c1)CCC2C1OC(=O)NC1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to both the gpr40 agonist and anti diabetic classes of molecules and impacts obesity treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CN(C)c1ccccc1C1SC(CC(=O)N2CCC(n3c(=O)[nH]c4ccccc43)CC2)C(=O)N1CCC(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a cgrp receptor antagonist.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC1COC(=O)CCCC=CCC2C=CC(=O)C(C=CC(O)CCCCC)C(O)C(O)C(OP(=O)(O)OC1)C(O)C(O)C2O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "It impacts alzheimer's disease, breast cancer, parkinson's disease, and cardiovascular disease. It impacts colorectal cancer, stomach cancer, diabetes mellitus, and seizure.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, and tangier disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, non-alcoholic fatty liver disease, and aging.",
"role": "assistant"
}
] |
{
"smiles": [
"CN(C)CCN(Cc1ccc(O)c(N(C)C)c1)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a anti allergic and belongs to the anti inflammatory class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(Nc2cc(Oc3ccc(NC(=O)Nc4cc(C(C)(C)C)cc(OCCO)c4OC)c4ccccc34)ccn2)cc(C(N)=O)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a brief overview of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a p38 map kinase inhibitor, anti inflammatory agent, kinase inhibitor and belongs to the anti inflammatory class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase that impacts barth syndrome, aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a nutritional supplement, a stabilizing cytochrome oxidase, a cholesterol translocation, and smooth. The molecule is a proton trap for oxidative phosphorylation, apoptosis, energy storage that impacts non-alcoholic fatty liver disease and aging. The molecule is a emulsifier, a stabilizing mitochondrial structure, and a food additive, and it impacts barth syndrome. The molecule is a surfactant, energy source, membrane stabilizer that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC1CCCC1OC(O)NC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(CC(NS(=O)(=O)c1ccc2ccccc2c1)c1ccc2occc2c1)NC1CCOc2cc(CN3CCCCC3)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is pain treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and tangier disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)(C#N)OC1OC(CO)C(O)C(O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a nutrient.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts diabetic heart disease and tangier disease.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(NCCCn1ccnc1)c1ccc(CCC2C=CC=N2)c(CCc2ccccc2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me a brief overview of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "It impacts cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me some details about this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a energy source, nutrient, inflammatory, membrane stabilizer that impacts metabolic syndrome and cancer. The molecule is a energy storage and a fat storage, belonging to the thyroxine treatment class of molecules. It impacts atherosclerosis, pancreatitis, cardiovascular disease, and obesity.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a inflammatory, membrane stabilizer, fat storage that impacts pancreatitis, cardiovascular disease, and thyroxine treatment. The molecule is a energy storage and energy source, and it impacts metabolic syndrome. The molecule is a nutrient that affects cancer by impacting both obesity and atherosclerosis.",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(O)CC(NC(=O)c1csc(-c2ccccc2Cl)n1)c1cccc(Cl)c1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, what can you tell me about it?",
"role": "user"
},
{
"content": "The molecule is a protease inhibitor and is atherosclerosis treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease. The molecule is a stabilizing mitochondrial structure that impacts aging, barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CCNc1cccc(C(=O)NC)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is both a anti cancer agent and a kinase inhibitor.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide a description of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and non-alcoholic fatty liver disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CNC(=O)COC1CCN(c2nc(Nc3cc(C(C)(C)C)ccc3C)c3c(ncn3C)n2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "It belongs to the gamma secretase modulator class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CCCc1ccc(COc2ccc(-c3ccc(N4C(=O)C=CC4=O)cc3)cc2)c(F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What do you know about the molecule?",
"role": "user"
},
{
"content": "It belongs to the liquid crystal class of molecules.",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)N1CCN(c2ccc(C(=C(CCCO)c3ccccc3)c3ccc([N+](=O)[O-])cc3)cc2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Describe this molecule: <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is diabetes treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide a description of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "The molecule is a nutrient that impacts both atherosclerosis and metabolic syndrome. The molecule is a thyroxine treatment and a fat storage, impacting both pancreatitis and cardiovascular disease.",
"role": "assistant"
}
] |
{
"smiles": [
"CNC=C(Cl)NNCC(C)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me something about this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "It impacts cancer treatment.",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me something about it?",
"role": "user"
},
{
"content": "The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis that impacts tangier disease and aging. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease.",
"role": "assistant"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.