molecules
dict
messages
listlengths
3
3
{ "smiles": [ "C=CC(C)(C)OCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti tumor and belongs to the anti tumor activity class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCC(=O)OCC(COC(=O)CCCC=CCC=CCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient that impacts both cardiovascular disease and metabolic syndrome. The molecule is a fat storage and thyroxine treatment, impacting both atherosclerosis and pancreatitis.", "role": "assistant" } ]
{ "smiles": [ "CCOC(=O)COC(=O)c1cccc2c1c1noc(C)c1c(=O)n2C1CCCC(CNC(=O)c2ccccc2)C1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "c1ccc(-c2nc(-c3cc(-c4ccc5sc6ccccc6c5c4)cc(-c4ccc5sc6ccccc6c5c4)c3)cc(-c3cccc(-c4ccc5ccc6cccnc6c5n4)c3)n2)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a electronic device and is electroluminescent.", "role": "assistant" } ]
{ "smiles": [ "CCc1nc2cccc3c2n1-c1ccc(-c2ccc(-c4nc5ccccc5s4)cc2)cc1S3(=O)=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is organic light-emitting and it impacts light emission.", "role": "assistant" } ]
{ "smiles": [ "CC(C)=CC1CC(C)(O)C2C3CCC4C5(C)CCC(OC6OCC(O)C(OC7OC(CO)C(O)C(O)C7O)C6OC6OC(C)C(O)C(O)C6O)C(C)(C)C5CCC4(C)C34COC2(C4)O1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a energy source, energy storage, surfactant, membrane stabilizer, nutrient, emulsifier.", "role": "assistant" } ]
{ "smiles": [ "NNC(=O)C(c1ccccn1)c1nccc(OCc2ccccc2)c1C(F)(F)F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is positive allosteric modulator.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(CC=CCCCC(=O)O1)C(=O)CC(O)C(C=CC(O)CCCCC)C(O)C2O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "It has an effect on breast cancer, and impacts cardiovascular disease, diabetes mellitus, and alzheimer's disease. It has an effect on colorectal cancer, and impacts stomach cancer, parkinson's disease, and seizure.", "role": "assistant" } ]
{ "smiles": [ "CN(CCCC(O)c1ccc[n+]([O-])c1)N=O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a carcinogenic agent.", "role": "assistant" } ]
{ "smiles": [ "C#CC1CN(C(=O)C(F)(F)F)CCc2cc(Cl)ccc21.c1cc2ncc1-2" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a 5ht2c receptor agonist.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy storage and inflammatory, belonging to the thyroxine treatment class of molecules, and impacts pancreatitis, metabolic syndrome, and obesity. The molecule is a fat storage that affects cancer by impacting cardiovascular disease. The molecule is a energy source, a membrane stabilizer, and a nutrient, and it impacts atherosclerosis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy storage and a membrane stabilizer, it impacts barth syndrome, and is smooth. The molecule is a apoptosis, energy source, proton trap for oxidative phosphorylation, food additive that impacts tangier disease. The molecule is a stabilizing cytochrome oxidase and a emulsifier, impacting both diabetic heart disease and aging. The molecule is a surfactant, cholesterol translocation, nutritional supplement, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts tangier disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease. The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease, aging, non-alcoholic fatty liver disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts tangier disease, barth syndrome, and aging. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCC=CC=CC(=O)CCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It has an effect on stomach cancer, and impacts seizure, alzheimer's disease, and diabetes mellitus. It impacts colorectal cancer, cardiovascular disease, parkinson's disease, and breast cancer.", "role": "assistant" } ]
{ "smiles": [ "COC(=O)c1[nH]c2c(-c3ccccc3)c(Cl)ccc2c(=O)c1CNC(=O)c1ccc(-c2csc(C)n2)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a jnk inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts aging and barth syndrome. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a nutritional supplement that impacts aging, barth syndrome, and tangier disease. The molecule is a stabilizing cytochrome oxidase, a proton trap for oxidative phosphorylation, and a surfactant, it impacts diabetic heart disease and is smooth. The molecule is a cholesterol translocation, a membrane stabilizer, and a apoptosis, and it impacts non-alcoholic fatty liver disease. The molecule is a energy source, emulsifier, energy storage, stabilizing mitochondrial structure, food additive.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging and tangier disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "C=C1C2CCC3(C(O)CC4C(C)(CC)CCCC4(COC(=O)N4CCOCC4)C3C2)C1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the anti tumor class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CC12CCC3C(CCC4CC(O)CCC43C)C1CCC2O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a membrane stabilizer, hormone, energy source, emulsifier. The molecule is a energy storage, signalling molecule, surfactant and belongs to the pharmaceutical class of molecules.", "role": "assistant" } ]
{ "smiles": [ "COCCCn1c(C2CCCN(C(=O)CC(C)Cc3ccc(-c4ccc(C(=O)OC)nc4)cc3)C2)nc2ccccc21" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a renin inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCOC(=O)c1ccc[nH]1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is minty.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC(O)C(O)CC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a nutrient that affects breast cancer by impacting atherosclerosis, cervical cancer, and ulcerative colitis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts non-alcoholic fatty liver disease and aging. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy storage and smooth, impacting both tangier disease and aging. The molecule is a membrane stabilizer, stabilizing mitochondrial structure, nutritional supplement, apoptosis, proton trap for oxidative phosphorylation. The molecule is a food additive, a cholesterol translocation, and a stabilizing cytochrome oxidase, and it impacts diabetic heart disease. The molecule is a emulsifier, surfactant, energy source that impacts non-alcoholic fatty liver disease and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a emulsifier, a energy source, and a surfactant, and it impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure, energy storage, stabilizing cytochrome oxidase, apoptosis, cholesterol translocation. The molecule is a proton trap for oxidative phosphorylation, a nutritional supplement, and a membrane stabilizer, and it impacts non-alcoholic fatty liver disease. The molecule is a food additive and smooth, impacting barth syndrome, tangier disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a inflammatory, nutrient, membrane stabilizer, energy storage that belongs to the thyroxine treatment class of molecules and impacts metabolic syndrome. The molecule is a energy source that impacts both obesity and cardiovascular disease. The molecule is a fat storage that impacts atherosclerosis, pancreatitis, and cancer.", "role": "assistant" } ]
{ "smiles": [ "C1CS1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "Polymerizes gradually.", "role": "assistant" } ]
{ "smiles": [ "O=Cc1c(C(Cc2c(Cl)c[n+](O)cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)ccc(C(=O)[O-])c1OCc1ccccc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a pde4 inhibitor.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC(O)C=CC=CC=CC(O)CC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a nutrient that impacts alzheimer's disease, parkinson's disease, non-alcoholic fatty liver disease, and diabetes mellitus type 2.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is thyroxine treatment and it impacts both atherosclerosis and cardiovascular disease. The molecule is a fat storage and a nutrient, impacting both metabolic syndrome and pancreatitis.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OCCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It impacts pancreatitis, metabolic syndrome, and cardiovascular disease. The molecule is a fat storage and a nutrient, it impacts atherosclerosis, and is thyroxine treatment.", "role": "assistant" } ]
{ "smiles": [ "C=CCOc1cc2c(c(OC)c1OC)-c1ccc(SC)c(=O)cc1C(NC(=O)OC)CC2" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a anti inflammatory and is cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient, energy source, inflammatory that impacts cardiovascular disease, obesity, and pancreatitis. The molecule is a membrane stabilizer that affects cancer by impacting metabolic syndrome. The molecule is a energy storage and a fat storage, impacting both atherosclerosis and thyroxine treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a emulsifier, a energy source, and a stabilizing cytochrome oxidase, and it impacts tangier disease. The molecule is a membrane stabilizer, energy storage, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging. The molecule is a nutritional supplement and a apoptosis, it impacts diabetic heart disease, and is smooth. The molecule is a cholesterol translocation, food additive, surfactant, stabilizing mitochondrial structure that impacts barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts aging and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "COc1ccc2nccc(C(F)CCC3CCN(CCSc4ccc(C(F)(F)F)cc4)CC3CO)c2c1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a anti microbial and is anti bacterial.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a energy storage, fat storage, and membrane stabilizer that has an effect on cancer and impacts both atherosclerosis and cardiovascular disease. The molecule is a nutrient that impacts both obesity and pancreatitis. The molecule is a inflammatory and energy source, belonging to the thyroxine treatment class of molecules, and impacts metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a nutritional supplement, a energy source, and a membrane stabilizer, and it impacts aging. The molecule is a stabilizing cytochrome oxidase, energy storage, surfactant, emulsifier, and smooth. The molecule is a apoptosis, a stabilizing mitochondrial structure, and a food additive, and it impacts diabetic heart disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and aging. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, barth syndrome, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a apoptosis, a emulsifier, and a nutritional supplement, and it impacts tangier disease. The molecule is a stabilizing cytochrome oxidase and a membrane stabilizer, which impacts both non-alcoholic fatty liver disease and diabetic heart disease, and is characterized as smooth. The molecule is a stabilizing mitochondrial structure, surfactant, food additive, energy source. The molecule is a energy storage, cholesterol translocation, proton trap for oxidative phosphorylation that impacts aging and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCOC(OCC)c1cc(-c2ccc(NC(=O)OCc3ccccc3)cc2)nn1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the anti bacterial class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CC(CCNc1ncnc2c1ncn2C1OC(CO)C(O)C(O)C1O)COC1OC(CO)C(O)C(O)C1O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a phytohormonal.", "role": "assistant" } ]
{ "smiles": [ "Fc1cccc(-c2cc(-n3c4ccccc4c4ccc(-c5ccccc5)cc43)c(C(F)(F)F)c(-n3c4ccccc4c4ccc(-c5ccccc5)cc43)c2)c1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "It belongs to the optoelectronic class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a energy source, membrane stabilizer, fat storage that impacts metabolic syndrome, atherosclerosis, and thyroxine treatment. It impacts obesity, pancreatitis, and cardiovascular disease. The molecule is a energy storage, a inflammatory, and a nutrient, and it impacts cancer.", "role": "assistant" } ]
{ "smiles": [ "CC1(CP(=O)(O)O)COC(=O)N1Cl" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It belongs to the anti microbial class of molecules.", "role": "assistant" } ]
{ "smiles": [ "N#Cc1cc(C(ON)=C2CCN(C(=O)Cc3ccc(F)cc3)CC2)ccc1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is pain treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting pancreatitis. The molecule is a fat storage that impacts atherosclerosis, cardiovascular disease, and metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts diabetic heart disease. The molecule is a apoptosis that impacts aging, barth syndrome, tangier disease, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "N=C(N)NCC(O)CC(N)C(=O)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a membrane stabilizer, a energy storage, and a surfactant. The molecule is a nutrient, signalling molecule, emulsifier, energy source.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCC=CCC1OC1CC=CCC=CCCCCC)COP(=O)(O)OCC(N)C(=O)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CC=CC(O)CCC(=O)OC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(N)C(=O)O" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a nutrient.", "role": "assistant" } ]
{ "smiles": [ "CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccc4nc(CN5CCC5(C)C)n5c6cccc(F)c6cc5c4n3)cc12" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a hcv ns5b inhibitor and belongs to the anti viral class of molecules, impacting both hepatitis c treatment and hcv treatment.", "role": "assistant" } ]
{ "smiles": [ "CC(C)CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> The above is a compound. Could you please tell me something about it?", "role": "user" }, { "content": "The molecule is a fat storage and a energy storage that impacts metabolic syndrome, obesity, atherosclerosis, and pancreatitis. The molecule is a nutrient that impacts both cancer and cardiovascular disease. The molecule is a energy source, membrane stabilizer, inflammatory and belongs to the thyroxine treatment class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CNC(=S)C1=C(N2CCOCC2)CCN(C)C1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "It impacts pain treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a inflammatory, energy source, energy storage that belongs to the thyroxine treatment class of molecules and impacts both pancreatitis and metabolic syndrome. The molecule is a nutrient and membrane stabilizer, and it impacts atherosclerosis. The molecule is a fat storage that affects cancer by impacting both obesity and cardiovascular disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC(O)C=CC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a nutrient that impacts non-alcoholic fatty liver disease, parkinson's disease, diabetes mellitus type 2, and alzheimer's disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts aging and tangier disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, aging, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, tangier disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts aging and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "Cc1nc(-n2cncn2)ccc1Nc1ncnc2c1OCCCN2C1CCN(C(=O)OC(C)(C)C)CC1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a diabetes treatment and belongs to the gpr119 agonist class of molecules.", "role": "assistant" } ]
{ "smiles": [ "CC(=CCN1C(C)CCCC1C)c1ccccc1-c1ccccc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a anti inflammatory.", "role": "assistant" } ]
{ "smiles": [ "CCCC(NC(=O)C(CC(C)C)NC(=O)C(NC(=O)CC(C)C(C)CC(=O)O)C1CCCCC1)C(=O)C(=O)NCC(=O)NC(C(=O)O)c1ccccc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a hcv protease inhibitor and is hepatitis c treatment.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a food additive and a energy storage, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a emulsifier and a cholesterol translocation that impacts aging, diabetic heart disease, and tangier disease. The molecule is a nutritional supplement, stabilizing mitochondrial structure, energy source, surfactant. The molecule is a apoptosis, stabilizing cytochrome oxidase, membrane stabilizer, proton trap for oxidative phosphorylation, and smooth.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "COc1ccc2ncc(F)c(CCN3CCC4CN(C5=COC=C(C6=CC=CCC6)O5)C(=O)OC4C3)c2n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a anti bacterial that is both anti biotic and anti microbial.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, aging, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC1C(O)CC(O)C1C=CC(O)CCCCC)COP(=O)(O)OCCN" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "<molecule_2d> What do you know about the molecule?", "role": "user" }, { "content": "The molecule is a nutrient that impacts alzheimer's disease, parkinson's disease, diabetes mellitus type 2, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)COC(=O)CCCCCCCCCCCCC(C)CC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a energy storage and a energy source that impacts metabolic syndrome, pancreatitis, obesity, and cardiovascular disease. The molecule is a inflammatory and nutrient, and it impacts atherosclerosis. The molecule is a membrane stabilizer and a fat storage, impacting both cancer and thyroxine treatment.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts aging. The molecule is a apoptosis that impacts diabetic heart disease, barth syndrome, tangier disease, and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "COc1cnc2c(-c3nc4cc(F)c(OC(C)COC(=O)Nc5cnc(OC)nc5)cc4s3)cc(C)cc2n1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a par4 inhibitor.", "role": "assistant" } ]
{ "smiles": [ "C=CC(COC(c1ccccc1)(c1ccccc1)c1ccccc1)OCC(=NO)c1cc(Br)ccc1F" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a bace inhibitor and is anti body.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts aging and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts barth syndrome and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a fat storage, inflammatory, thyroxine treatment that impacts atherosclerosis, cancer, and obesity. The molecule is a nutrient, a membrane stabilizer, and a energy storage. The molecule is a energy source that impacts cardiovascular disease, pancreatitis, and metabolic syndrome.", "role": "assistant" } ]
{ "smiles": [ "O=C1COC(=O)N1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is both a synthetic auxin and a defoliant.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and tangier disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease and non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you provide a description of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts non-alcoholic fatty liver disease, barth syndrome, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease. The molecule is a apoptosis that impacts tangier disease, aging, non-alcoholic fatty liver disease, and barth syndrome.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a brief overview of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts aging and diabetic heart disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, barth syndrome, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, aging, and barth syndrome. The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "Cc1nc(-c2ccc(CC(NC(=O)c3c(F)cc(N4CCOCC4C(F)(F)F)cc3F)C(=O)O)c3c2OCCC3)c(=O)n(C)c1C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is inflammatory disease treatment.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Tell me something about this molecule: <molecule_2d>", "role": "user" }, { "content": "The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and tangier disease. The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease. The molecule is a apoptosis that impacts tangier disease, barth syndrome, diabetic heart disease, and aging.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Provide a description of this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and tangier disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "I'd like a short overview about this molecule <molecule_2d>. Can you do that?", "role": "user" }, { "content": "The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, aging, barth syndrome, and tangier disease. The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease.", "role": "assistant" } ]
{ "smiles": [ "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Could you give me a brief overview of this molecule <molecule_2d> ?", "role": "user" }, { "content": "The molecule is a emulsifier, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure, and it impacts tangier disease. The molecule is a food additive, a surfactant, and a membrane stabilizer, it impacts barth syndrome and is smooth. The molecule is a energy storage and a apoptosis, impacting both aging and non-alcoholic fatty liver disease. The molecule is a nutritional supplement, stabilizing cytochrome oxidase, energy source, cholesterol translocation that impacts diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Describe this molecule: <molecule_2d> .", "role": "user" }, { "content": "The molecule is a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, aging, and tangier disease. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease.", "role": "assistant" } ]
{ "smiles": [ "O=C1CCC(N2Cc3c(CCCOCCNC(=O)c4ccc(NC(=O)C5NC(C6CCCCC6)C6(C(=O)Nc7cc(Cl)ccc76)C5c5cccc(Cl)c5F)cc4)cccc3C2=O)C(=O)N1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Given the molecule <molecule_2d>, what can you tell me about it?", "role": "user" }, { "content": "The molecule is cancer treatment.", "role": "assistant" } ]
{ "smiles": [ "O=CCNCc1ccc(F)cc1" ] }
[ { "content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.", "role": "system" }, { "content": "Please give me some details about this molecule <molecule_2d> .", "role": "user" }, { "content": "The molecule is a hiv integrase inhibitor, a anti viral, and anti viral activity.", "role": "assistant" } ]