blob_id stringlengths 40 40 | directory_id stringlengths 40 40 | path stringlengths 3 264 | content_id stringlengths 40 40 | detected_licenses listlengths 0 85 | license_type stringclasses 2
values | repo_name stringlengths 5 140 | snapshot_id stringlengths 40 40 | revision_id stringlengths 40 40 | branch_name stringclasses 905
values | visit_date timestamp[us]date 2015-08-09 11:21:18 2023-09-06 10:45:07 | revision_date timestamp[us]date 1997-09-14 05:04:47 2023-09-17 19:19:19 | committer_date timestamp[us]date 1997-09-14 05:04:47 2023-09-06 06:22:19 | github_id int64 3.89k 681M ⌀ | star_events_count int64 0 209k | fork_events_count int64 0 110k | gha_license_id stringclasses 22
values | gha_event_created_at timestamp[us]date 2012-06-07 00:51:45 2023-09-14 21:58:39 ⌀ | gha_created_at timestamp[us]date 2008-03-27 23:40:48 2023-08-21 23:17:38 ⌀ | gha_language stringclasses 141
values | src_encoding stringclasses 34
values | language stringclasses 1
value | is_vendor bool 1
class | is_generated bool 2
classes | length_bytes int64 3 10.4M | extension stringclasses 115
values | content stringlengths 3 10.4M | authors listlengths 1 1 | author_id stringlengths 0 158 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
791a72e56e1d0a0539e9ba86dbf055f129241591 | 20049d88e2e8f0e1904efc561103c1d84d21507a | /naumov.andrei/A1/shape.hpp | 3f6a42ad2ba186035c0f123cffbdabd51a9b474f | [] | no_license | gogun/Labs-for-SPbSPU-C-course-during-2019 | 5442a69152add3e66f02a7541e8dc8dd817f38a1 | 16ade47b859517a48d0fdb2e9704464bce4cc355 | refs/heads/master | 2022-01-09T16:02:54.728830 | 2019-06-06T11:06:33 | 2019-06-06T11:06:33 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 489 | hpp | #ifndef SHAPE_HPP
#define SHAPE_HPP
#include "base-types.hpp"
class Shape
{
public:
Shape(const point_t& centre) :
centre_(centre)
{}
virtual ~Shape() = default;
virtual double getArea() const = 0;
virtual rectangle_t getFrameRect() const = 0;
virtual void move(const point_t & newCentre) = 0;
virtu... | [
"naumov.dron@gmail.com"
] | naumov.dron@gmail.com |
ecb8628028a0ce068f11eaa490eb1c78179d85bb | 90e85187e1ff2b2c6c0e4807c5089cbec8f91e1f | /H264MediaCodecDemo/app/src/main/cpp/native-lib.cpp | e48ead9f4df6b369004383b0ee825fa3fa6619ce | [] | no_license | leoliuliang/Audio-Video | f779199fc174695234eb0337c678becc5afc2978 | fb65790bf7c223847958b5c2afe2a4a98e9534d9 | refs/heads/main | 2023-08-02T13:48:34.288003 | 2021-09-21T04:09:09 | 2021-09-21T04:09:09 | 399,514,748 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,256 | cpp | #include <jni.h>
#include <string>
#include <android/log.h>
extern "C" JNIEXPORT void JNICALL
Java_com_mxkj_h264mediacodecdemo_MainActivity_nativeTojava(JNIEnv* env,jobject this_ ) {
//native反射，回调java方法
jclass activityClass = env->GetObjectClass(this_);
jmethodID jmethodId = env->GetMethodID(activityClass,... | [
"liuliang"
] | liuliang |
19a72b631b01a3bb344ea57b211b5394c425ba7a | 4cce61d8153989657f1ef86200907cb90e079b7a | /TopologyManager/tm_igraph.hpp | 85a5668cf379ac41a9560087f8fa402228b9eeb6 | [] | no_license | tefino/on_path_cache | c0a119351f6ebf3770e619ecbb86a01ee97cd2f3 | 3c21dc898b802bc21c34b8d23ae56121bd4d0db4 | refs/heads/master | 2021-01-10T21:28:15.710434 | 2012-09-18T08:13:07 | 2012-09-18T08:13:07 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 4,288 | hpp | /*
* Copyright (C) 2010-2011 George Parisis and Dirk Trossen
* All rights reserved.
*
* This program is free software; you can redistribute it and/or
* modify it under the terms of the GNU General Public License version
* 2 as published by the Free Software Foundation.
*
* Alternatively, this software may be d... | [
"tfwhatever@gmail.com"
] | tfwhatever@gmail.com |
42536d9cd9c441c560624e5294ad134ef0070979 | 25f461a73cb2117729a8a5c40e2797cf70bf0c3c | /src/Pong.h | 32130c195e9eacd0840f5082c296e75b19b155db | [
"MIT"
] | permissive | KenReneris/PacManClock | cb9b1ab544a3f894d7a20459486c89306d7a956f | 39a304bce1514dbd9770d4048748a2e5eaed3c23 | refs/heads/master | 2022-04-25T00:32:39.303133 | 2020-04-22T22:48:55 | 2020-04-22T22:48:55 | 258,032,202 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,290 | h | /*
* Pong.h
* Pong animation
*
* Author: Ken Reneris <https://github.com/KenReneris>
* MIT License
* ----------------------------------------------------------
*/
class Pong
: public IStoryboard
{
public:
Pong();
StartResult Start() override;
void Loop() override;
priv... | [
"kreneris@microsoft.com"
] | kreneris@microsoft.com |
64a8d8ae83aad32f5a509c1647ffd1f3ce9ad4ec | f43585e43137b50b92435e19ef90a8c915e2ff33 | /test/testgauge.cpp | 5c8f2a334c60f7d2f1f37b251a627f32e2885586 | [] | no_license | melfork/speedmeter | a12293b44d5ff6b73bbc263e83e8e36cd3bc35ad | a6a50cb0bec2493ea5f0782468b3471b3bce5177 | refs/heads/master | 2021-01-22T10:09:03.999852 | 2014-07-31T18:14:05 | 2014-07-31T18:14:05 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 516 | cpp | #include "gpx.h"
#include <iostream>
#include <math.h>
#include "gaugewidget.h"
using namespace SPEEDMETER;
/**
*
*
*/
int main(int argc, char *argv[])
{
std::map < std::string, std::string > conf;
CImg<unsigned char> img(320,200,1,3,1);
CImgDisplay disp(img, "GaugeTest");
GaugeWidget lcd(img,140,140,1,1);
l... | [
"pacopepe76@gmail.com"
] | pacopepe76@gmail.com |
9a9f1755b9ff0fa30b77ac8e91439d9ecefd6678 | d78c4f3b09962fd6c93282ac008ba4cb545e262b | /Thermodynamics/stdafx.cpp | a2bb8bd6e9ff20e854fdf5d6f3202c1041652643 | [] | no_license | giecli/WellMultiphase | 83507890f59ad41952ef86141f6b8bc61d6cdbdf | cea29911b61ac012d526fac96734dd7e2b3eb811 | refs/heads/master | 2022-04-03T14:25:58.432031 | 2020-02-15T19:58:40 | 2020-02-15T19:58:40 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 293 | cpp | // stdafx.cpp : source file that includes just the standard includes
// Thermodynamics.pch will be the pre-compiled header
// stdafx.obj will contain the pre-compiled type information
#include "stdafx.h"
// TODO: reference any additional headers you need in STDAFX.H
// and not in this file
| [
"hossein.barati72@gmail.com"
] | hossein.barati72@gmail.com |
a76ab9b7636f4470779298dc2407d53ddd4f652f | 413d28b0b3a2efd312b07153b905773f9872ebfe | /src/protocol.h | 56fa92ffb58a0cbcc52627f5aedc5ff0aee56779 | [
"MIT"
] | permissive | DeepCoin/coino | 1a0d3b4e758150b9668a05e7c20ceeb5501a6197 | 7b5cdca0400ce39287f378cb86abd472c964327b | refs/heads/master | 2021-01-21T04:13:22.238357 | 2014-01-14T02:37:05 | 2014-01-14T02:37:05 | 16,052,256 | 2 | 1 | null | null | null | null | UTF-8 | C++ | false | false | 3,463 | h | // Copyright (c) 2009-2010 Satoshi Nakamoto
// Copyright (c) 2009-2012 The Bitcoin developers
// Copyright (c) 2011-2012 Litecoin Developers
// Copyright (c) 2013 Coino Developers
// Distributed under the MIT/X11 software license, see the accompanying
// file COPYING or http://www.opensource.org/licenses/mit-license.ph... | [
"root@root.root"
] | root@root.root |
82adedc9cf761bba3e58395942a11239f3e4ccf7 | 72225cd57e4eb46cb2ef8aa2955ab3db2798118c | /题库/图/网络流/HDU_5383_最小费用最大流.cpp | f08a99a84023804f94f1975343159e2b1b7c19fb | [] | no_license | qingping95/ACM | 8bc58baffaf947f633792af96a2a554a59780451 | d7b02accf3289a7555c0b1410d4053d7e9d19053 | refs/heads/master | 2021-07-14T12:47:53.805723 | 2021-03-07T07:45:36 | 2021-03-07T07:45:36 | 57,396,610 | 5 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 4,491 | cpp | #include <iostream>
#include <cstdio>
#include <stack>
#include <cstring>
#include <queue>
#include <algorithm>
#include <cmath>
//#include <unordered_map>
#define N 1000
//#define lson x<<1
//#define rson x<<1|1
//#define mid ((lt[x].l+lt[x].r)/2)
//#define ID(x, y) ((x)*m+(y))
//#define CHECK(x, y) ((x)>=0 && (x)<n &... | [
"qingping95@gmail.com"
] | qingping95@gmail.com |
231b60e08ac58aaed422d96002f6153a0b0c1ce0 | 6cda201566a19a15862e661a8a544a269c4dad32 | /Duplicate Search/Duplicate Search/handlers.h | 4ef38a7527ed6da562274a6338eda45bd16d3efe | [] | no_license | alien43/misc | 2a20c78c3eefaf16b3da77fdd0b04eb3e0fe7f4e | 634f95c1e58bcfcebd595ed6f6a59ec66df54b57 | refs/heads/master | 2021-01-01T18:06:26.340836 | 2013-09-26T21:49:57 | 2013-09-26T21:49:57 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,224 | h | #ifndef HANDLERS_H_INCLUDED
#define HANDLERS_H_INCLUDED
#include "document_handler.h"
#include "random_projection_hash.h"
#include <boost/scoped_ptr.hpp>
#include <boost/ptr_container/ptr_map.hpp>
#include <vector>
#include <map>
struct DocumentTrait {
std::string title;
RPHash::ResultType hash;
};
class RPHash;... | [
"alien1543@gmail.com"
] | alien1543@gmail.com |
80f1041b8235ddbae6aca1d4a909358c24fad8f8 | 25a107f9cab4ddedf457c355299f0078697506ad | /AppData/Local/Autodesk/webdeploy/production/1f559bb8ae333199306b5c4f1fe680c6eb7ab9e0/CPP/include/Fusion/Components/OccurrenceList.h | ac1303e892516050adeb1a631d3864a24e89869d | [] | no_license | Park-Minjoo/HCI_TeamProject_GroupNo2 | 1b6cc7887173f717ba76068472174cc3a9109124 | 5ace0f0a9d81b39d6782300a14847b223d7ed90a | refs/heads/master | 2023-01-27T11:59:36.791453 | 2023-01-13T04:26:18 | 2023-01-13T04:26:18 | 273,715,196 | 1 | 0 | null | 2023-01-13T04:26:26 | 2020-06-20T13:39:33 | null | UTF-8 | C++ | false | false | 3,083 | h | //////////////////////////////////////////////////////////////////////////////
//
// Copyright 2016 Autodesk, Inc. All rights reserved.
//
// Use of this software is subject to the terms of the Autodesk license
// agreement provided at the time of installation or download, or which
// otherwise accompanies this softwar... | [
"21701015@handong.edu"
] | 21701015@handong.edu |
69722c1ba2cec14ea78d3e1dfd724fdde7cca61c | 94720257fe3bf4b89880e587f758f85c58c69722 | /aseprite_to_animation.h | dfb8adc2087786a9acfe92484ce3d3298d342a93 | [] | no_license | fanick1/aseprite_parser | cf717152ae513631495062dd8406f7f553089580 | 8f747ef2c2e84ef189a39217de3cbfae7e81c9b1 | refs/heads/master | 2021-08-25T09:27:12.710503 | 2021-08-08T16:41:27 | 2021-08-08T16:41:27 | 155,467,881 | 9 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 444 | h | /*
* Aseprite to animation transformation
* Version 0.1
* Copyright 2018, 2021 by Frantisek Veverka
*
*/
#ifndef ASEPRITE_TO_ANIMATION_H_
#define ASEPRITE_TO_ANIMATION_H_
#include "aseprite.h"
#include "animation.h"
animation::LoopType from(uint16_t type);
std::vector<uint8_t> from(const std::vector<aseprite::P... | [
"fanick1@users.noreply.github.com"
] | fanick1@users.noreply.github.com |
d9714ea69cddb4c41f1e4906c75650b665cf21b6 | 0eea0f8daa439850145aad2de9e51cbdd5e0135e | /d912pxy/d912pxy_swapchain.cpp | 5e2fbfe5e11c0c32cbdbbdb10ff349a2c1861d2a | [
"MIT"
] | permissive | boludoz/d912pxy | de95a08b988cb28e9a23f5993ccbc515b163048a | cc1c15666f31b5c3200dae9a3acfc4196aabb751 | refs/heads/master | 2020-05-14T13:10:39.628707 | 2019-04-14T14:32:47 | 2019-04-14T14:32:47 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 21,860 | cpp | /*
MIT License
Copyright(c) 2018-2019 megai2
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files(the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, dist... | [
"megai2@ya.ru"
] | megai2@ya.ru |
6d4255ed2fb22528c6e8ce6a2736cdc2b04161fb | 9f8a069f7d337a022cae89e3e5b75d161c832e2d | /Final_Case/Refined_Grid/Turbulent/250/uniform/functionObjects/functionObjectProperties | 051365af319e32ad6c0b25d7170147af6bacc1b5 | [] | no_license | Logan-Price/CFD | 453f6df21f90fd91a834ce98bc0b3970406f148d | 16e510ec882e65d5f7101e0aac91dbe8a035f65d | refs/heads/master | 2023-04-06T04:17:49.899812 | 2021-04-19T01:22:14 | 2021-04-19T01:22:14 | 359,291,399 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,999 | /*--------------------------------*- C++ -*----------------------------------*\
| ========= | |
| \\ / F ield | OpenFOAM: The Open Source CFD Toolbox |
| \\ / O peration | Version: v1912 |
... | [
"loganprice2369@gmail.com"
] | loganprice2369@gmail.com | |
8f646bbdb9597b9d405440f8c50dac37d9c80a7b | 4030a7debe997282bd4bf1410d7d3c49c4011e82 | /data_structure/DisjointSet/DisjointSet/main.cpp | edd3f779ead7ece278787a463e865df8748d8363 | [] | no_license | chris-hong/basic_algorithm | efae48176ffd3a8465e2186e05d0a75bfd66763b | 826d9b304d2e1820b404b910e7304a57f904c549 | refs/heads/master | 2022-09-24T18:57:37.831586 | 2022-09-16T15:49:27 | 2022-09-16T15:50:04 | 126,496,793 | 0 | 0 | null | null | null | null | UHC | C++ | false | false | 2,327 | cpp | #include <iostream>
#include <random>
using namespace std;
#define SET_SIZE 10
// DisjointSet Structure (분리집합 자료구조)
struct DisjointSet {
struct DisjointSet* pParent;
int data;
int rank;
};
void Dis_Union(struct DisjointSet* pSet1, struct DisjointSet* pSet2);
struct DisjointSet* Dis_Find(struct DisjointSet* pSet)... | [
"sayong.hong@hanwha.com"
] | sayong.hong@hanwha.com |
baf2ecd2cf93ba43d00d3b2976fc1905a24df9a6 | 0b472fce7b920d5b6e301dc1e26169ae6f08b070 | /208 Implement Trie (Prefix Tree)/ImplementTrie(PrefixTree).cpp | 0fbff32f1b4eafc1f1e586dc595a259329fc953e | [] | no_license | davidchai21/leetcode-solutions | 5cf9ff520910c8f28a300e3041e78c075c93e624 | 3b0b29e269214dd9c2660ddd81d73b4c96fdcb50 | refs/heads/master | 2021-01-19T09:04:49.975016 | 2018-02-06T06:14:16 | 2018-02-06T06:14:16 | 87,719,872 | 0 | 1 | null | null | null | null | UTF-8 | C++ | false | false | 1,546 | cpp | class TrieNode {
public:
char c;
TrieNode* children[26];
bool end;
TrieNode(): end(false) {memset(children,0,sizeof(children));}
TrieNode(char a): c(a), end(false) {memset(children,0,sizeof(children));};
};
class Trie {
public:
/** Initialize your data structure here. */
Trie() {
ro... | [
"rchai@email.wm.edu"
] | rchai@email.wm.edu |
39260bdeddcdd2c02355bc81d763d3f5a8f9aeab | 8a8744104d9d2b50d350239dbc8a9f09a8ecc03a | /Code/CPlusPlus/Shared/3DSMax/BoxPrimitive.cpp | 15841e3e05b5fdfb89afee5ea8e8f1d64391fa03 | [] | no_license | JonnyRivers/rorn | fadd039b13fd95de5033d25e4552c456ab2eaa13 | ea3dab1d42838917c29d81f7ff92c11fc312a62e | refs/heads/master | 2016-08-12T19:55:18.729619 | 2014-09-11T21:20:30 | 2014-09-11T21:20:30 | 52,677,620 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 534 | cpp | #pragma once
#include "BoxPrimitive.h"
using namespace Rorn::Max;
BoxPrimitive::BoxPrimitive(INode* node)
{
Object* object = node->GetObjectRef();
IParamArray* paramArray = object->GetParamBlock();
paramArray->GetValue( object->GetParamBlockIndex( BOXOBJ_LENGTH ), TimeValue(0), length_, Interval() );
... | [
"ca6jri@4fafbd65-2c19-2041-7f78-9da6aaec0f04"
] | ca6jri@4fafbd65-2c19-2041-7f78-9da6aaec0f04 |
dfa0d851ccb7622d9bee6e2f881bba46aafed2e6 | 8086c6c705bc1e7739e6dc1288ba5af5d70217ed | /DAY1/extratoffees.cpp | d008d91856261a28fa993248c17de8db4d1b8c4a | [] | no_license | kaushikvanshika/DS-A | c5e37b8e3ea3a77dd86868dcb2b1be0e9e9b351c | b4a1120dc5b6c9a7c9d83ecb32e98f3774efdc5a | refs/heads/main | 2023-06-01T02:02:54.790327 | 2021-07-13T18:19:54 | 2021-07-13T18:19:54 | 382,863,090 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 411 | cpp | class Solution{
public:
vector<bool>ExtraToffees(vector<int>&kids,int extraCandies){
vector<bool> res;
int max=*max_element(kids.begin(),kids.end());
for(int i=0;i<kids.size;i++){
if(kids[i]+extraCandies>=max){
res.push_back(true);
}
else{
... | [
"kaushikvanshika12@gmail.com"
] | kaushikvanshika12@gmail.com |
237fa9717dd53557a30e1007c1321cf27037e262 | 8b4c4546f92e1f185fc666e645a5f32926a81666 | /thirdparty/physx/APEXSDK/module/emitter/include/GroundEmitterAssetPreview.h | 782b75d2bdd72208e5fd2e1f459de78f846f0bcd | [
"MIT"
] | permissive | johndpope/echo | a5db22b07421f9c330c219cd5b0e841629c7543c | e9ce2f4037e8a5d49b74cc7a9d9ee09f296e7fa7 | refs/heads/master | 2020-04-03T03:52:59.454520 | 2018-11-22T20:55:32 | 2018-11-22T20:55:32 | 154,997,449 | 0 | 0 | MIT | 2018-11-22T20:55:33 | 2018-10-27T18:39:23 | C++ | UTF-8 | C++ | false | false | 2,727 | h | /*
* Copyright (c) 2008-2015, NVIDIA CORPORATION. All rights reserved.
*
* NVIDIA CORPORATION and its licensors retain all intellectual property
* and proprietary rights in and to this software, related documentation
* and any modifications thereto. Any use, reproduction, disclosure or
* distribution of this so... | [
"qq79402005@gmail.com"
] | qq79402005@gmail.com |
4ca10943f1c86d4d9b182460179c2ea9ce3dbea6 | 110044654f706e920380dad2779bb32a77f1f26f | /doc/generated/examples/tasks_ex1_main.cpp | 2a37cad9e6803e224f076c285795fc20179b6c59 | [
"MIT",
"LicenseRef-scancode-free-unknown",
"LicenseRef-scancode-unknown-license-reference"
] | permissive | SCons/scons | 89327bb9635cee6e7cc59249edca9cd859d7d1ff | b2a7d7066a2b854460a334a5fe737ea389655e6e | refs/heads/master | 2023-09-01T19:37:03.603772 | 2023-08-28T04:32:42 | 2023-08-28T04:32:42 | 104,670,160 | 1,827 | 342 | MIT | 2023-09-14T15:13:21 | 2017-09-24T19:23:46 | Python | UTF-8 | C++ | false | false | 20 | cpp |
#include "test.h"
| [
"dl9obn@darc.de"
] | dl9obn@darc.de |
51d6414baf7a3c9e5712abe8425d9cae9749895e | 87dceef774c99ccd518803fb20c008c897127051 | /binsearch.cpp | 97dc7abae202f516ce02b5ccb6e31646d7f1a991 | [] | no_license | abcastro/hello-world | f3f6e21c4e4123ee52494597253ab0fcbb175aa4 | ea557be85cc8e446b924dca00841d02754184330 | refs/heads/master | 2021-03-12T20:27:43.489005 | 2014-09-03T06:22:27 | 2014-09-03T06:22:27 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 747 | cpp | #include <iostream>
#include <sstream>
void binsearch(int *arr, int i, int j, int v) {
int m;
int a = i;
int b = j;
int res = -1;
while (b >= a) {
m = (a + b) / 2;
if (arr[m] < v) {
std::cout << "<" << std::endl;
a = m + 1;
} else if (arr[m] > v) {
... | [
"arthur.castro@gmail.com"
] | arthur.castro@gmail.com |
dec1261434e0a6e59dacb6e18a52430e7550ff14 | efb696b3e30042875f0208f5f203fbce05c49ab6 | /cmatrixablobL0fast.h | 6c0fea001a44d946272086f72540a3dd6ebce108 | [] | no_license | nfr16/Blob | b95b79139b05c61822a302d8b17421aafe472980 | 87fa3acf1e384ec1ec0a56a993fd8eaeecb3ecd7 | refs/heads/master | 2021-01-19T13:56:05.612355 | 2017-03-14T14:45:45 | 2017-03-14T14:45:45 | 82,325,689 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 9,856 | h | /*
ARPACK++ v1.0 8/1/1997
c++ interface to ARPACK code.
ARPACK Authors
Richard Lehoucq
Danny Sorensen
Chao Yang
Dept. of Computational & Applied Mathematics
Rice University
Houston, Texas
*/
#ifndef CMATRIXA_H
#define CMATRIXA_H
#include "arcomp.h"
#include "blas1c.h"... | [
"niall@niall-Inspiron-5547.(none)"
] | niall@niall-Inspiron-5547.(none) |
95f75945b85699d65e744831eb835466b5617484 | 10dd7a493737f7711134358845ffec879ab96e49 | /ipdata.cpp | d7182b67d2e65a68e35f621bfe674f54953b0795 | [] | no_license | klima7/IP-Analyser | 7cb3a33ee84b8bfd29f7d1799de13725a6634bb0 | 264fead808b42009ecb09cb2563d45120e217455 | refs/heads/master | 2023-04-07T20:39:37.841560 | 2021-04-18T16:19:50 | 2021-04-18T16:24:28 | 359,167,166 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,497 | cpp | #include <stdexcept>
#include "ipdata.h"
using namespace std;
IpData::IpData(uint32_t data) {
this->data.full = data;
}
IpData::IpData(const IpData &ipData) {
this->data = ipData.data;
}
uint8_t IpData::get_octet(unsigned int octet) const {
validate_octet(octet);
return data.octets[octet];
}
void I... | [
"ukasz.klimkiewicz2@wp.pl"
] | ukasz.klimkiewicz2@wp.pl |
f4d90be866d420088441037b0ef100c1c5b5db83 | af1d419ab26ed699557eda12adfabe79b1ef9c9f | /Final/OTHER/cvd/bgrx.h | 3fecc4fa893cc743947d03ba724b2aef409a1b50 | [] | no_license | smclemo/ARdroneUAV | a39704a5224f279cbae81c983106ce69afaef6be | a402f2d7f8c475b6806abdb2874eaa36f3314a34 | refs/heads/master | 2020-04-16T17:37:57.185940 | 2012-11-12T02:29:22 | 2012-11-12T02:29:22 | 3,686,507 | 4 | 2 | null | null | null | null | UTF-8 | C++ | false | false | 3,424 | h | /*
This file is part of the CVD Library.
Copyright (C) 2005 The Authors
This library is free software; you can redistribute it and/or
modify it under the terms of the GNU Lesser General Public
License as published by the Free Software Foundation; either
version 2.1 of the License, or (at ... | [
"smcle2@student.monash.edu"
] | smcle2@student.monash.edu |
551f05bb8b806a4b6935fff0f21d37ffbcb54ecf | 5693fa849849759bdc07857025b8d966b66f8c1f | /rcmod/rcmod.cpp | 1f168a7ec41435776c51472c3197fa0961b0b11c | [
"Unlicense"
] | permissive | quorten/Quacks-Core | 67bdca552861284b1139a274ee3fdd4999be1457 | dcea7e99ae5e30b3464e56f4c202c99ee6a05ac4 | refs/heads/master | 2020-12-26T22:27:03.091000 | 2020-02-01T17:30:17 | 2020-02-01T17:54:47 | 237,667,825 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 3,693 | cpp | //Bootstrapper for modifying resources
//NOTE: See common.cpp and common.h for explanation of how the binary data
// is stored and handled.
#define WIN32_LEAN_AND_MEAN
#include <windows.h>
#include <shellapi.h>
#include <string>
#include <vector>
#include <iostream>
#include <sstream>
#include "../... | [
"mako0042@umn.edu"
] | mako0042@umn.edu |
02d3ff40e2852d37bcb795f73f836ee5b401f962 | ce19837c9df65cba2c031eba5f02a52bf33cfe2e | /src/mongo/util/intrusive_counter.h | 31775c9df6a2bc987b655fe08b2c64b870fd532e | [
"Apache-2.0"
] | permissive | hwzhou/mongoclient-cmake | a469bb3ca94c3ee18ed1d63ff76b1cfc6f25947f | 6587a4365ecba79723c3e3329dc0f635fc5e615d | refs/heads/master | 2016-09-06T12:24:45.505204 | 2013-12-26T12:45:30 | 2013-12-26T12:45:30 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 5,513 | h | /**
* Copyright (c) 2011 10gen Inc.
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU Affero General Public License, version 3,
* as published by the Free Software Foundation.
*
* This program is distributed in the hope that it will be useful,
* but WITHOU... | [
"earthdog@126.com"
] | earthdog@126.com |
3288a24a15ba607ecc3ef71fcdf09d0cd4fa8594 | 1de7feb9cf0a84ba0e9214f4b52eb2fa0b3eb70d | /5G K-SimSys/Simulator/Simulation Top/Network Element/SystemMS_NRLAA.h | c0ee459addc89066c861da1cf7fc74582d8bca2b | [] | no_license | 5GKSimSys/5G-K-SimSys | 110d6a6d9dad6027a6d21247937bd20bb97c5482 | f5e9011f89e5bb64f87c375ca5de4a0e3b2b90cf | refs/heads/main | 2023-06-07T17:46:25.707451 | 2021-06-28T04:57:46 | 2021-06-28T04:57:46 | 380,894,996 | 1 | 3 | null | null | null | null | UTF-8 | C++ | false | false | 2,330 | h | /****************************************************************************
Network Element Mobile Station header (NR eMBB)
PROJECT NAME : System Level Simulator
FILE NAME : MS_simple.h
DATE : 2017.02.01
VERSION : 0.0
ORGANIZATION : Korea University, Dongguk University
Copyright (C) 2016, by Kore... | [
"lijrew@korea.ac.kr"
] | lijrew@korea.ac.kr |
a2c6b9f11a9a841c3bb411af0215acb6da6b8d9a | 13435b095ee02a85adbb4eabf9201f84a85fc265 | /target/quarkus/bootstrap/deployment.cp | 8ee10e2bec326c242feba987b7b838b3f1d000a7 | [] | no_license | ashu-mehra/quarkus-test | 582e6551cb9a983dafbee1cfefb33c20ea99dee8 | 2f5d09e52909414a055d09bdb4fe64efde0ee278 | refs/heads/master | 2020-07-11T19:42:03.339051 | 2019-08-28T13:29:46 | 2019-08-28T13:29:46 | 204,629,252 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 2,264 | cp | 1
-1887229157
file:/root/.m2/repository/commons-logging/commons-logging/1.2/commons-logging-1.2.jar
file:/root/.m2/repository/commons-collections/commons-collections/3.2.2/commons-collections-3.2.2.jar
file:/root/.m2/repository/commons-beanutils/commons-beanutils/1.9.3/commons-beanutils-1.9.3.jar
file:/root/.m2/reposit... | [
"asmehra1@in.ibm.com"
] | asmehra1@in.ibm.com |
2eb97f89daee29229d583d2a9b568c89b6080cf2 | 6666ffc7221de85cccacbcbef3c68bd4629aea54 | /src/fmc-gyre.cc | 1406dcda8f85a46698ca2145f588035ce3a73b70 | [] | no_license | dluchten/fmc | c3253004b56527176739af78a221361c0125d8be | 4b31a89068a02b9c4191a17e62da1300a4064e57 | refs/heads/master | 2020-05-18T05:29:47.046744 | 2013-01-19T19:34:45 | 2013-01-19T19:34:45 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 2,641 | cc | #include <iostream>
#include <string>
#include <stdio.h>
#include <stdlib.h>
#include "grid2d.h"
#include "array1d.h"
#include "doublegyre.h"
#include "integrator.h"
#include "heun.h"
#include "runge-kutta.h"
#include "flowmap2d.h"
#include "stopwatch.h"
using std::string;
/**
* \brief Main program
*
* Only 2D sup... | [
"dluchten@biscayne.princeton.edu"
] | dluchten@biscayne.princeton.edu |
b54503516af3a54c84b5d0d778b6468ba79b8961 | 385ea3093e448ae2702f12764b2535ecd25edd4b | /oop345/m3/i-test.cpp | dc037bbd868690c62471e75b232e05f2f541a015 | [] | no_license | shann-s/past-assignments | 989b2d3320116115a036bd136f6c1cd00f98cd54 | 1ba0261f0375b709d365b382c2800dbdcbb73c6b | refs/heads/master | 2023-03-10T04:49:06.244056 | 2019-08-11T15:07:32 | 2019-08-11T15:07:32 | 175,495,387 | 0 | 0 | null | 2023-03-03T05:54:59 | 2019-03-13T20:38:40 | JavaScript | UTF-8 | C++ | false | false | 621 | cpp | #include <iostream>
#include <fstream>
#include <vector>
#include <string>
#include <iterator>
#include "i.h"
#include "util.h"
using namespace std;
int main(int argc, char* argv[])
{
try {
if (argc != 3) {
throw string("usage: ") + argv[0] + " file.cv delimiter-char";
}
string filename = argv[1]; //1st ar... | [
"39142859+shann-s@users.noreply.github.com"
] | 39142859+shann-s@users.noreply.github.com |
30e7bd8cb5224c4607744924501e2664e540cffa | 64f0bac5c5cf42312efd5b46708d8a3b14a4bbf2 | /InnerBox/handler.h | 3092da36fd6eb4c938db3b6a905ea76d7a8545e7 | [] | no_license | lwgboy/SmartVision | 1bd3ab879a96a8eb397415c04d1e810f50919d23 | 17e36746fea87ca23df80d9e7d2a3ef58075aee7 | refs/heads/master | 2022-01-30T17:03:52.919327 | 2019-05-29T10:02:48 | 2019-05-29T10:02:48 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 357 | h | //
// Created by bin zhang on 2019/1/6.
//
#ifndef INNERPROC_HANDLER_H
#define INNERPROC_HANDLER_H
//struct MessageHandler{
// void onMessage(const std::shared_ptr<Message>& message) = 0;
//};
//
//struct HttpHandler{
// void onRequest(const std::shared_ptr<HttpRequest>& req,std::shared_ptr<HttpResponse>& resp) = 0;... | [
"24509826@qq.com"
] | 24509826@qq.com |
da62fddb64fe4f4b0a99bdd0190134f644813217 | 0489c33e654f24df2f3a096f2ff24f43dee17832 | /include/tridiag.h | 14b2a46d1a20355aacf6ac7e279cdc92538b6b5a | [] | no_license | YonatanKoral/CochlearModel | 9d94a9e419d56ebc2f6e2e9406d2af2ea4dde92d | 47697250ad2118ba431f95a7e7c6806d1111fa58 | refs/heads/master | 2020-05-24T15:56:14.321748 | 2019-05-18T12:34:46 | 2019-05-18T12:34:46 | 187,344,417 | 3 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,183 | h | /******************************************************************\
File Name : tridiag.h
===========
Classes Defined : CTriDiag
=================
Description : Solve a tri-diagonal matrix
=============
\******************************************************************/
#pragma once
#ifnd... | [
"yonatan.koral83@gmail.com"
] | yonatan.koral83@gmail.com |
8597a8769e59e01508fdeec06e31260ee6916dbd | 0b256256d523cef9bbe55be85810c4fdcacae35f | /test/widget_test.cpp | 980368f5de7cf91ce8f0227b0744026b98039fd1 | [
"LicenseRef-scancode-unknown-license-reference",
"BSL-1.0"
] | permissive | zhangderuguo/ui | 7dd790f4867311380e3c658bd931d71e5a558777 | 2d625c5593dd6de324efcb92d0ba84de064620da | refs/heads/master | 2022-09-30T12:46:46.256384 | 2020-06-03T05:16:06 | 2020-06-03T05:16:06 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 14,184 | cpp | // Copyright (c) 2017 Kolya Kosenko
// Distributed under the Boost Software License, Version 1.0.
// See http://www.boost.org/LICENSE_1_0.txt
#include <boost/ui.hpp>
#include <boost/optional/optional_io.hpp>
#include <boost/core/lightweight_test.hpp>
#include <boost/detail/lightweight_main.hpp>
#include <vector>
#i... | [
"kolya.kosenko@gmail.com"
] | kolya.kosenko@gmail.com |
b01aef562ea2cc214fa401de5df62663315f3b85 | 096da7346c14b9a84c8c7e2438f2ac2103995343 | /two-sum-ii-input-array-is-sorted.cpp | 7421e99f16988c36e50b140217187908ffb98fb9 | [] | no_license | pradhumangoyal/leetcode | cca1c7093ef0f30820651e3e83daa73ff3ebba89 | 0ff8f1e2b2e301cc7b04e63aa3891045c5120fc3 | refs/heads/master | 2020-03-22T04:04:43.837928 | 2018-07-04T20:28:05 | 2018-07-04T20:28:05 | 139,471,567 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 407 | cpp | class Solution {
public:
vector<int> twoSum(vector<int>& numbers, int target) {
for (int i = 0, j = numbers.size() - 1; i < numbers.size() && j >=0; ) {
if (numbers[i] + numbers[j] == target)
return {i + 1, j + 1};
else if (numbers[i] + numbers[j] > target)
... | [
"goyalpradhuman21@gmail.com"
] | goyalpradhuman21@gmail.com |
ca4b0029bf84dfd9be39ded36e734b5b25c237f0 | f5cca1b5d90b851e66ab1a6bb2c3684bf7e624ee | /.node-gyp/.node-gyp/iojs-1.3.6/src/stream_base-inl.h | c9b4392ca85b93e5fd2250deabab276a46b79b33 | [] | no_license | EvsWorld/atom_configuration | a9b728deec7faeab6de1a04b5ede562f2a2f2321 | 39e840bfbffa123be2c2e62ea4f9384b652434f5 | refs/heads/master | 2021-04-03T06:12:13.680120 | 2018-04-18T17:52:41 | 2018-04-18T17:52:41 | 125,024,809 | 1 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 5,757 | h | #ifndef SRC_STREAM_BASE_INL_H_
#define SRC_STREAM_BASE_INL_H_
#if defined(NODE_WANT_INTERNALS) && NODE_WANT_INTERNALS
#include "stream_base.h"
#include "node.h"
#include "env.h"
#include "env-inl.h"
#include "v8.h"
namespace node {
using v8::External;
using v8::FunctionCallbackInfo;
using v8::Funct... | [
"evanlhendrix@gmail.com"
] | evanlhendrix@gmail.com |
997f6c822c7bcb1d8478043b8f2d2def88968d85 | f7f09782d15ee7bdd14e637bd717dfb8327bc57c | /OTHER/Multi/5/1006_2.cpp | 885fe786985cc1e421703b4f0ba3eb5c21b78e5c | [] | no_license | whywhyzhang/ACM-ICPC-Code | 14f3f6b0532c18da9694d7f70914a97e0983913f | d15bd475774ff104ebfe9504f8ea0acffdb5ddb0 | refs/heads/master | 2022-12-09T06:27:14.893967 | 2017-03-09T14:31:49 | 2017-03-09T14:31:49 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 2,327 | cpp | // ━━━━━━神兽出没━━━━━━
// ┏┓ ┏┓
// ┏┛┻━━━━━━━┛┻┓
// ┃ ┃
// ┃ ━ ┃
// ████━████ ┃
// ┃ ┃
// ┃ ┻ ┃
// ┃ ┃
// ┗━┓ ┏━┛
// ┃ ┃
// ┃ ┃
// ┃ ┗━━━┓
// ┃ ┣┓
// ┃ ┏┛
// ┗┓┓┏━━━━━┳┓┏┛
// ┃┫┫ ... | [
"daxiaonewwhy@163.com"
] | daxiaonewwhy@163.com |
9e3ea5e6d41ab87bf361d95daedb7256522c3f12 | 860d313f73a0a27b6b977de2da5409737cd04a6c | /Moebius Samples/PruebaPropiedades/PruebaPropiedades/PruebaPropiedades.h | 64e6acebddf1adee80106ff23dd43d58783448da | [] | no_license | GTSKA/Moebius | ec60bab25bffc574e4f8ff7337c3f24d97ab8b97 | cfb67fbf59cab5399b98153d613fb495aaceab4f | refs/heads/master | 2020-03-17T10:59:19.686735 | 2018-08-24T04:06:11 | 2018-08-24T04:06:11 | 133,532,826 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 807 | h | // PruebaPropiedades.h : main header file for the PruebaPropiedades application
//
#pragma once
#ifndef __AFXWIN_H__
#error include 'stdafx.h' before including this file for PCH
#endif
#include "resource.h" // main symbols
// CPruebaPropiedadesApp:
// See PruebaPropiedades.cpp for the implementation of this... | [
"gtskatalites@gmail.com"
] | gtskatalites@gmail.com |
5c6893099fe36f83166d18d1d02fde6649632793 | cf8ddfc720bf6451c4ef4fa01684327431db1919 | /SDK/ARKSurvivalEvolved_SpiderS_Character_BP_Aggressive_Med_parameters.hpp | d191f27b4624b026f6f170a7c988494657f84922 | [
"MIT"
] | permissive | git-Charlie/ARK-SDK | 75337684b11e7b9f668da1f15e8054052a3b600f | c38ca9925309516b2093ad8c3a70ed9489e1d573 | refs/heads/master | 2023-06-20T06:30:33.550123 | 2021-07-11T13:41:45 | 2021-07-11T13:41:45 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,003 | hpp | #pragma once
// ARKSurvivalEvolved (329.9) SDK
#ifdef _MSC_VER
#pragma pack(push, 0x8)
#endif
#include "ARKSurvivalEvolved_SpiderS_Character_BP_Aggressive_Med_classes.hpp"
namespace sdk
{
//---------------------------------------------------------------------------
//Parameters
//----------------------------------... | [
"sergey.2bite@gmail.com"
] | sergey.2bite@gmail.com |
6068daa3a0db98493f74519873ef9509ab13e364 | 9d36fcaa53f56132ebf1f9fe129c275865c52e4c | /2100/源.cpp | df1046e5095d85f6553e8fbaa26ab5374124bdaa | [] | no_license | zhangtufei/HDOJ | d7d4c2cb3e97506dfe42506169caa34afd71abcd | 3703b66ea67bd624e85db6c8d0de62d9b1d83840 | refs/heads/master | 2021-01-10T19:31:23.277767 | 2015-06-29T06:11:55 | 2015-06-29T06:11:55 | 38,360,994 | 4 | 1 | null | null | null | null | UTF-8 | C++ | false | false | 1,066 | cpp | #include <iostream>
#include <streambuf>
#include <fstream>
#include <string>
#include <algorithm>
using namespace std;
int main()
{
//streambuf *bk;
//bk = cin.rdbuf();
//fstream fin;
//fin.open("data.txt");
//cin.rdbuf(fin.rdbuf());
string a, b;
while (cin >> a >> b)
{
int t1, t2,t3;
int i = a.size() - 1,... | [
"412710370@qq.com"
] | 412710370@qq.com |
08edb21e2d367e187763f957d8053f21687312c5 | 1574b1aaa83c279ac6a5fde7d7edaa197e85bdf4 | /wifi/document/svc/Source_SVC/Source_SVC/SVC/SVCConnectedClient.cpp | 639e17258861a57062e7c64d07ba76b468166aab | [] | no_license | thongxuan/stage5A.monitor | 27dc5227cbb81c2d8b7eb687818624f5e76b8988 | d0a24bf815c7afa25d9f6241a8ea114e2a13552f | refs/heads/master | 2023-01-22T04:30:23.682044 | 2016-08-26T16:26:03 | 2016-08-26T16:26:03 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 7,289 | cpp | //
// SVCConnectedClient.cpp
// SVC
//
// Created by Romain CYRILLE on 15/05/2016.
// Copyright © 2016 Polytech Marseille. All rights reserved.
//
#include "SVCConnectedClient.hpp"
SVCConnectedClient::SVCConnectedClient(SVCAuthInterface * auth,TCPSocket * csock)throw(SVCException){
_diff = new DiffieHellman()... | [
"dangxuanthong@gmail.com"
] | dangxuanthong@gmail.com |
56e1a8f068e8dc0458497a70257ea14b7dee3f97 | 166f36c17015d21f95fa694b495c911af755357d | /Date.h | 923b71cca81298de16798bfc9d31238df98fa9b4 | [] | no_license | okandemirel/Cpp-DVDList-Term-Project- | 369e766dce4790541fc6d825cb8326c32b4fde8a | 46598ff73cc299e94f93a50784de1266655da581 | refs/heads/master | 2020-12-25T03:31:46.871802 | 2016-05-14T15:48:48 | 2016-05-14T15:48:48 | 58,814,839 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 237 | h | #include <iostream>
using namespace std;
class Date {
int day, month, year;
public:
Date();
Date(string);
void setDate(string);
bool operator> (Date&) const;
friend ostream& operator<< (ostream&, const Date&);
};
#pragma once
| [
"okn.118dmrl@gmail.com"
] | okn.118dmrl@gmail.com |
e6f049a873a0d829866b2c2769634b6ef1d8b815 | 52db54268323b7f086ed837bea247a6e52ee263b | /pp4/main.cc | ebd6e0cfbb7643b51c14284ab6df4e0dd5d0b045 | [] | no_license | 772148702/cs143_2012 | f7d38b4b77a582e728652505905b2264cf31f490 | e27772de4f2c58c0e79992672d7bd2ad5c09ba27 | refs/heads/master | 2022-11-28T08:31:11.084701 | 2020-08-11T09:34:16 | 2020-08-11T09:34:16 | 286,702,965 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 858 | cc | /* File: main.cc
* -------------
* This file defines the main() routine for the program and not much else.
* You should not need to modify this file.
*/
#include <string.h>
#include <stdio.h>
#include "utility.h"
#include "errors.h"
#include "parser.h"
/* Function: main()
* ----------------
* Entry point to t... | [
"Shinelon@DESKTOP-KH6P7LG"
] | Shinelon@DESKTOP-KH6P7LG |
c20a09ff5b45a8acfd6c82119369518225d556d0 | 53b4267f097b7b780d45ada1e1d81c9b9a3bcf12 | /can-sat_2019/led_final/led_final.ino | baf2804e9344835085a729c1dd7fd4728a42f28f | [] | no_license | sansrit/Robotics_Contents | 590af79d869af42b328259285cf5246f29f67c6c | 96fd4e7d893387bc3116ffce03b88944b2633112 | refs/heads/master | 2023-01-10T14:44:58.246596 | 2020-11-18T09:58:01 | 2020-11-18T09:58:01 | 313,888,397 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 378 | ino | int button = 5;
int buttonstate;
void setup() {
Serial.begin(9600);
pinMode(5,INPUT);
pinMode(7,OUTPUT);
}
void loop() {
buttonstate = digitalRead(5);
if(buttonstate == 1){
delta1();
}
else {
digitalWrite(7,LOW);
}
Serial.println(buttonstate);
}
void delta1(){
digitalWrite(7,H... | [
"happysansrit@gmail.com"
] | happysansrit@gmail.com |
be373712b731df3b039498e11392b15836b9639a | 700b010192cea7d308cfbc1c34ba6d9a0b164757 | /pixel.hpp | b9bface4111f0901c3d757bc94aff07c9a3d76c4 | [] | no_license | hugobelman/oopProject | 2b10771ea61da52e6ba78b7e69a2e7c8a4715603 | e8eaa3bbd5dafad9e765e7917ab58571c7ed6120 | refs/heads/master | 2022-01-24T16:45:58.354858 | 2018-12-03T06:16:45 | 2018-12-03T06:16:45 | 158,744,320 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 581 | hpp | #ifndef PIXEL_HPP
#define PIXEL_HPP
enum Color { CLEAR, WHITE, SILVER, GRAY, BLACK, RED, MAROON, YELLOW, OLIVE,
LIME, GREEN, AQUA, CYAN, TEAL, BLUE, NAVY, FUCHSIA, MAGENTA,
PURPLE };
struct Pixel {
unsigned short r, g, b, a;
Pixel(Color colorName);
Pixel(unsig... | [
"hugobelman@outlook.com"
] | hugobelman@outlook.com |
fb06ff871648791992e2fc7965ebd125618c26d2 | 94300763dcf9467e99e7cd3a5a32a83f8823cb01 | /Chapt_04/Diver/Proxy.cpp | 0ca569ee3c4fa1ed573b0b0e9f8c544e78ef7eb6 | [] | no_license | loociano/windows-graphics-programming-src | b09ff48400c818bd705eec0ec77dd3567f04ce74 | 774eae01c647d8c76102aa30e007c29cba8b546e | refs/heads/master | 2020-04-19T14:21:24.393022 | 2019-01-29T22:53:53 | 2019-01-29T22:53:53 | 168,242,252 | 1 | 0 | null | 2019-01-29T22:51:09 | 2019-01-29T22:51:09 | null | UTF-8 | C++ | false | false | 6,282 | cpp | //-----------------------------------------------------------------------------------//
// Windows Graphics Programming: Win32 GDI and DirectDraw //
// ISBN 0-13-086985-6 //
// ... | [
"trent@trent.me"
] | trent@trent.me |
ad0206bd068fa77cc2407a9608f00ab7c4267685 | c21ff7fc862eb0f75aeffb537706070833c34ecf | /player.cpp | 2b4c6379edfe3facfeb621114e4f66f521f456a4 | [] | no_license | 2acholsk1/OrdinaryGame | 53b95d56b355999d5f1c148042218fd3d6f81ecd | ee24a8c5c32f50d7549b389f94c5c95312b7f820 | refs/heads/master | 2023-08-27T17:50:00.942064 | 2021-11-06T19:31:52 | 2021-11-06T19:31:52 | 369,763,643 | 1 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 11,766 | cpp | #include "player.h"
Player::Player(const sf::Vector2f& position,
CustomTexture* ctextures,
const PartType& cparttype,
const MyTexture& ctexture,
const sf::Vector2u& canimationMaxSize,
const float& canimationTime,
const float& cpu... | [
"p.zacholski@wp.pl"
] | p.zacholski@wp.pl |
1bc131ea28aab1d1adc790369d40c0d3dc146300 | 786ec4f3a4127395404e07a898c1fd7f32e13500 | /Snake/wall.h | 1190ce003bb3e46aee82dc30740a3bc518a4c9e6 | [] | no_license | RickyLiu0w0/Snake | a01e424264bfe8ee5295e1e42d6eadce6be768b8 | a81a5aee8d6e59582f7e3a6d40df7a7754696d05 | refs/heads/master | 2020-07-09T08:48:59.460694 | 2019-09-05T02:05:38 | 2019-09-05T02:05:38 | 203,932,360 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 284 | h | #ifndef WALL_H
#define WALL_H
#include <QList>
#include "wallunit.h"
//墙单元的集合
class Wall
{
public:
Wall(int height, int width);
int getSize();
WallUnit * getWallUnit(int i);
private:
QList<WallUnit * > wall ;
};
#endif // WALL_H
| [
"ctrickyliu@mail.scut.edu.cn"
] | ctrickyliu@mail.scut.edu.cn |
c328df244ef4e1d36cf814a086389acd8ef86dca | dd1e8c0c9afcfa519046f7a240a65b6e3d3d55c3 | /search/分治法/UVA11129.cpp | 1c6823c812a4584ca50358bfc8165298b5385149 | [] | no_license | LYoGA/ACM | 654db40e5d15b442777b097dbac1260d77444849 | b5bccef4b61648471c533671b520fdb83eeff7d6 | refs/heads/master | 2021-01-23T12:05:31.973037 | 2014-12-14T12:25:19 | 2014-12-14T12:25:19 | 12,356,200 | 1 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 749 | cpp | #include <iostream>
#include <cstdio>
#include <cstring>
#define N 10005
int arr[N], answer[N];
int n;
void init(int n) {
for (int i = 0; i < n; i++)
arr[i] = i;
}
void solve(int l, int h) {
int t = l;
if (l == h) return;
for (int i = l; i <= h; i += 2)
answer[t++] = arr[i];
for ... | [
"lyj265546@gmail.com"
] | lyj265546@gmail.com |
7e326757dfa7523fbf62e5e40d0f0598e2986910 | 8aad3e8e66e2431d703ef1d8a9c800767f69ecea | /Watch.Driver/MPU6050-Driver/MPU6050/MPU6050.ino | 818cf70f58af95e7945fa0bcfda9c8db80cffe31 | [] | no_license | StevenHouben/WatchConnect | b25a49d962b76df57593e87789163b0255f06c8f | af67ce95386ed2befc4e366766d00600a22ab239 | refs/heads/master | 2020-04-07T18:57:08.429505 | 2014-08-11T10:43:46 | 2014-08-11T10:43:46 | 20,017,971 | 1 | 1 | null | null | null | null | UTF-8 | C++ | false | false | 14,472 | ino | #include "I2Cdev.h"
#include "MPU6050_6Axis_MotionApps20.h"
#if I2CDEV_IMPLEMENTATION == I2CDEV_ARDUINO_WIRE
#include "Wire.h"
#endif
// class default I2C address is 0x68
// specific I2C addresses may be passed as a parameter here
// AD0 low = 0x68 (default for SparkFun breakout and InvenSense evaluation board)
/... | [
"shou@itu.dk"
] | shou@itu.dk |
50131d07e3978dcc3612f34076c42c4717b5bdb5 | 5838cf8f133a62df151ed12a5f928a43c11772ed | /NT/shell/lib/cnctnpt.cpp | a08c89dab043d2a4af8156929cf2f675bf65a2a3 | [] | no_license | proaholic/Win2K3 | e5e17b2262f8a2e9590d3fd7a201da19771eb132 | 572f0250d5825e7b80920b6610c22c5b9baaa3aa | refs/heads/master | 2023-07-09T06:15:54.474432 | 2021-08-11T09:09:14 | 2021-08-11T09:09:14 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 10,503 | cpp | //
// CConnectionPoint
//
// Common implementation for CConnectionPoint.
//
//
// Since EnumConnections is called so much, we have a custom
// enumerator for it which is faster than CStandardEnum and which
// performs fewer memory allocations.
//
#include "stock.h"
#pragma hdrstop
#include <olectl.h>
#include "... | [
"blindtiger@foxmail.com"
] | blindtiger@foxmail.com |
cc93da90e73f9647ce70ec23076d8b27f73d852a | 919f67c909fa1907f8d58cb83197ace54a2062c9 | /IPlug/Extras/ADSREnvelope.h | 0651a04014c7c9b686ef15b0b6d30f7da82f45f8 | [
"LicenseRef-scancode-other-permissive",
"LicenseRef-scancode-unknown-license-reference"
] | permissive | talaviram/iPlug2 | 7a986ac07d1900cacd642707f73f86c7232bb588 | 0a3ac46ebca6f03a4181b23353799e16febb28a9 | refs/heads/master | 2020-05-20T13:31:33.215256 | 2019-08-18T16:10:16 | 2019-08-18T16:10:16 | 185,599,220 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 6,517 | h | /*
==============================================================================
This file is part of the iPlug 2 library. Copyright (C) the iPlug 2 developers.
See LICENSE.txt for more info.
==============================================================================
*/
#include "IPlugPlatform.h"
BEGI... | [
"olilarkin@googlemail.com"
] | olilarkin@googlemail.com |
29fcf23c136670a7531c7c23219b9c5d471d2835 | f8b56b711317fcaeb0fb606fb716f6e1fe5e75df | /Internal/SDK/HairClothingCategory_classes.h | 196eba8c8b174bd4f61450161654b8c48b877064 | [] | no_license | zanzo420/SoT-SDK-CG | a5bba7c49a98fee71f35ce69a92b6966742106b4 | 2284b0680dcb86207d197e0fab6a76e9db573a48 | refs/heads/main | 2023-06-18T09:20:47.505777 | 2021-07-13T12:35:51 | 2021-07-13T12:35:51 | 385,600,112 | 0 | 0 | null | 2021-07-13T12:42:45 | 2021-07-13T12:42:44 | null | UTF-8 | C++ | false | false | 756 | h | #pragma once
// Name: Sea of Thieves, Version: 2.2.0.2
/*!!DEFINE!!*/
/*!!HELPER_DEF!!*/
/*!!HELPER_INC!!*/
#ifdef _MSC_VER
#pragma pack(push, 0x01)
#endif
namespace CG
{
//---------------------------------------------------------------------------
// Classes
//-------------------------------------------------... | [
"zp2kshield@gmail.com"
] | zp2kshield@gmail.com |
6c01f000dad4b79c8923e0c9f53438840352297a | da0a62a0d42dfb8ff003e64b12f240f23d9658f6 | /arpscan.cpp | 80cc08745c458cd3647ef85c50947a7ac4c10413 | [
"MIT"
] | permissive | kramelec/arpscan | 24139b279f71f3ee9ad477ecd5edec0f3b4e0ede | 389345da4df4ee892853a20827eff2a80fcaf80e | refs/heads/master | 2020-09-03T08:57:45.224000 | 2019-08-07T02:03:07 | 2019-08-07T02:03:07 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 12,143 | cpp | #include <iostream>
#include <vector>
#include <chrono>
#include <thread>
#include <cassert>
#include <cstring>
#include <csignal>
#include <unistd.h>
#include <sys/types.h>
#include <sys/epoll.h>
#include <sys/socket.h>
#include <arpa/inet.h>
#include <netinet/ether.h>
#include <linux/if_packet.h>
#include <net/if.h>
... | [
"afpacket@gmail.com"
] | afpacket@gmail.com |
523ec89fab0088fd57873a349a29b0a40cb460f5 | 01c288194a82b8400d9a69d9642353a5b990f0cd | /Arrays/977. Squares of a Sorted Array.cpp | 0ab960167720a68c91e317432b9f3b6e92545d6b | [] | no_license | pandakkkk/DataStructures-Algorithms | c01376e416ebb2568f18310d9d21ca37b3e2681f | 3fa81cac282e75b8f1d2aeaf0278ec045a04f6c7 | refs/heads/main | 2023-08-03T02:41:43.224264 | 2021-10-03T04:55:31 | 2021-10-08T11:24:54 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,140 | cpp | // ____ _ _ _ _ __ __ _ _ _
// | _ \(_)___| |__ __ _| |__ | |__ | \/ | __ _| | |__ ___ | |_ _ __ __ _
// | |_) | / __| '_ \ / _` | '_ \| '_ \ | |\/| |/ _` | | '_ \ / _ \| __| '__/ _` |
// | _ <| \__ \ | | | (_| | |_) | | | | | | | | (_| | | | | | (_) | |_| | | (_| ... | [
"Rishabhmalhotraa01@gmail.com"
] | Rishabhmalhotraa01@gmail.com |
27c1c48b027c1d7c672fc663740542f401b623e1 | 4b36157a209921f349ab2f97416904c0de42fe63 | /TJE2020_2D/src/Camera.h | d4074358a16a4698efb19f3aae0e93d26d16b619 | [] | no_license | leoli51/UPF-Electronic-Games | 70e710704295334f09f0ad1129580f33b7a18476 | 09ec5d7ce61593025f38a1839102b085ef1038f8 | refs/heads/main | 2023-04-15T00:13:51.241783 | 2021-04-27T20:20:07 | 2021-04-27T20:20:07 | 360,529,874 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 597 | h | #ifndef CAMERA_H
#define CAMERA_H
#include "framework.h"
#include "image.h"
class Camera : public Image {
public:
Area world_viewport;
public:
void renderSprite(Sprite* sprite){
Area sprite_area(sprite->position.x, sprite->position.y, sprite->size.x, sprite->size.y);
... | [
"laura@ciutadella-131-213.eduroamcc.upf.edu"
] | laura@ciutadella-131-213.eduroamcc.upf.edu |
fc5d58442f0ca4f47ec11e7419a51f23d1732f68 | b6a8e7dc5179bfc51075b3d378de0d653665286a | /DTCS_Master/getreport.cpp | 604b7d764e9723a58421194d51f4aa7153ecc2d0 | [] | no_license | sigmarising/DTCS | f3bd26046c34167212400e754375d1d6b0dea31c | 9712bba1d1f0d9e530dfd738432a4a3582f2fc49 | refs/heads/master | 2020-03-19T23:37:31.479683 | 2018-06-19T15:46:24 | 2018-06-19T15:46:24 | 137,012,895 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 5,729 | cpp | #include "getreport.h"
#include "ui_getreport.h"
#include <QStandardItemModel>
GetReport::GetReport(QWidget *parent) :
QWidget(parent),
ui(new Ui::GetReport)
{
ui->setupUi(this);
setWindowFlags(Qt::FramelessWindowHint);//无边框
setAttribute(Qt::WA_TranslucentBackground);//北京透明
m_areaMovable = ge... | [
"sigmarising@hotmail.com"
] | sigmarising@hotmail.com |
284b24cbeb31ddb2a24afdf92962fa42be3e9c32 | 19fa6b928bacab449d253b48cfbdb63be581e871 | /assignment2/EuclideanVector.cpp | 8950860dd2105c439cbc809c0250488a58733311 | [] | no_license | andrewkaploun/comp6771 | f4ddd4a557447521de4c9d336bfa35a72641eceb | 6a50bef6bdeea9f47de90fc5526274fac1f5d275 | refs/heads/main | 2023-04-25T17:43:41.149727 | 2021-06-03T15:59:23 | 2021-06-03T15:59:23 | 367,782,187 | 1 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 14,305 | cpp | /*********************************************
*
* COMP6771 Assignment 2
* Chunnan Sheng
* z5100764
*
*********************************************/
#include "EuclideanVector.h"
#include <stdexcept>
#include <cmath>
#include <iostream>
evec::EuclideanVector::EuclideanVector(lint dim... | [
"chunnansheng83@gmail.com"
] | chunnansheng83@gmail.com |
3a836f39dd7b6998831ad58a5259e10393f80fa1 | db89a7989fec99a70977d25a0c0cd923c6225ff1 | /chapter11/main_code/mytime1.h | d948b7f70849201590800e815f494c30d69ad7d9 | [] | no_license | LinRayx/C-prime | b1c690b8daec8d24fb6bc324a6873cdbddad2f48 | a00f49a9645cc2c2e301dd94e90793be2b536bd1 | refs/heads/master | 2020-08-07T10:59:51.503022 | 2019-10-11T07:10:23 | 2019-10-11T07:10:23 | 213,423,623 | 1 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 561 | h | /*************************************************************************
> File Name: mytime1.h
> Author: kyrie
> Mail: linkyrie2016@gmail.com
> Created Time: 二 10/ 8 16:22:04 2019
************************************************************************/
#ifndef MYTIME1_H_
#define MYTIME1_H_
class... | [
"kyrie@linkairuideMacBook-Pro.local"
] | kyrie@linkairuideMacBook-Pro.local |
eeb38d2eb164c24145c4ff0c8723c0cf10f98ca8 | 2f874d5907ad0e95a2285ffc3592b8f75ecca7cd | /src/rocksdb2/db/table_properties_collector.cc | ee589c99907bac06a206b7c8fec8b5d43c22e20a | [
"MIT-Wu",
"MIT",
"ISC",
"BSL-1.0",
"BSD-3-Clause"
] | permissive | dzcoin/DzCoinService | fb93809a37fad0a26bf26189266b44cf4c797865 | b0056717d6bcc1741f4fb3f3f166cd8ce78393f9 | refs/heads/master | 2021-01-20T20:28:41.639585 | 2016-08-15T06:21:51 | 2016-08-15T06:21:51 | 65,678,478 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 2,213 | cc | // copyright (c) 2013, facebook, inc. all rights reserved.
// this source code is licensed under the bsd-style license found in the
// license file in the root directory of this source tree. an additional grant
// of patent rights can be found in the patents file in the same directory.
#include "db/table_propert... | [
"dzgrouphelp@foxmail.com"
] | dzgrouphelp@foxmail.com |
d133ef272e630755a4b1d5d6ad4f6b660d226f62 | c983a7d121aab6765033b92a05b902f6dc210c5b | /src/datamining/wekadiscretizer.cpp | 8513a0f73944d63a6e626387fe233cb7ed503120 | [] | no_license | AlvioSim/kentosim | d77ba87a1f6d3effe8790a30124ca8e0471f9955 | faf73a743438052d5d429af30119b8a4f8d5f66f | refs/heads/master | 2016-09-02T04:09:23.509625 | 2015-01-08T13:55:26 | 2015-01-08T13:55:26 | 28,967,899 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 2,808 | cpp | #include <datamining/wekadiscretizer.h>
#include <stdlib.h>
#include <utils/utilities.h>
#include <assert.h>
namespace Datamining {
/**
* @param Log A reference to the logging engine
* @param DirOutputFiles Indicates the dir we the temporary files will be output
*/
WekaDiscretizer::WekaDiscretizer(Log* log,strin... | [
"francesc.guim@gmail.com"
] | francesc.guim@gmail.com |
c2cd12580f66290226056d1056c9daad12abf4f6 | 17c5982b29c3a7c8294d5a25ddf9bb179f570d08 | /Classes/GalacticaUtils.h | 238909c965f49fffacdb66fac6afb60aad03d61e | [] | no_license | fozolo/galactica-anno-dominari-3 | 89e1881c9312b8c5d51fb9ba05f13838eaf2fdd6 | c17049494120e8a2ad68309c4dda7ca37fd89e43 | refs/heads/master | 2020-09-11T20:09:28.562762 | 2016-01-12T19:06:04 | 2016-01-12T19:06:04 | null | 0 | 0 | null | null | null | null | IBM866 | C++ | false | false | 18,023 | h | // GalacticaUtils.h
// ===========================================================================
// Copyright (c) 1996-2002, Sacred Tree Software
// All rights reserved
// ===========================================================================
// 5/6/96 ERZ
#ifndef GALACTICA_UTILS_H_INCLUDED
#define GALACTICA_UT... | [
"ed.zavada@gmail.com"
] | ed.zavada@gmail.com |
35e76a7d2108ab79f2fc7c7e412e01b3eadab657 | 311525f7de84975434f55c00b545ccf7fe3dcce6 | /online/cses/math/expo_1.cpp | d00cb004439bc8c9147b4f6a2dc79415df6355db | [] | no_license | fishy15/competitive_programming | 60f485bc4022e41efb0b7d2e12d094213d074f07 | d9bca2e6bea704f2bfe5a30e08aa0788be6a8022 | refs/heads/master | 2023-08-16T02:05:08.270992 | 2023-08-06T01:00:21 | 2023-08-06T01:00:21 | 171,861,737 | 29 | 5 | null | null | null | null | UTF-8 | C++ | false | false | 1,568 | cpp | // :pray: :arrayman:
// :pray: :summit:
// :pray: :pusheen:
// :pray: :prodakcin:
// :pray: :spacewalker:
// :pray: :duk:
// :pray: :gustav:
// :pray: :tmw:
// :pray: :eed:
// :pray: :chicubed:
// :pray: :arceus:
// :pray: :gamegame:
// :pray: :sinx:
// :pray: :eyg:
// :pray: :evan:
// :pray: :cj:
// :pray: :steph:
// ... | [
"aaryan.prakash3.14@gmail.com"
] | aaryan.prakash3.14@gmail.com |
a9b88ae4c93f549f8656d13f8b5ff4e759a5fd11 | dab15851969a442e353888cc65aa7b8837044aa4 | /src/hobbits-plugins/displays/HilbertPlot/hilbertplot.cpp | 1117c7cca4f3f9faa41d2b75e8a981c44da0d5d5 | [
"MIT"
] | permissive | Mahlet-Inc/hobbits | 6c3cd050570ff40bd0928af725ddf2e9f1c52086 | 1a6d569ad2309fed6d4ec7e74b45f73b076ecf86 | refs/heads/master | 2023-07-07T03:31:32.822766 | 2023-02-17T01:34:29 | 2023-02-17T01:34:29 | 238,995,181 | 428 | 38 | MIT | 2023-07-03T19:04:07 | 2020-02-07T18:17:53 | Python | UTF-8 | C++ | false | false | 6,440 | cpp | #include "hilbertplot.h"
#include "hilbertplotform.h"
#include "displayresult.h"
#include <QPainter>
HilbertPlot::HilbertPlot() :
m_renderConfig(new DisplayRenderConfig())
{
m_renderConfig->setFullRedrawTriggers(DisplayRenderConfig::NewFrameOffset);
m_renderConfig->setAsynchronous(true);
m_renderConfig... | [
"adam@mahletconsulting.com"
] | adam@mahletconsulting.com |
fb20fa913b8b0e76f4cc25e2d6408b87a6770760 | e5292428482181499e59886ad2ee50c83a504f6e | /URI/Fusoes.cpp | 88de1204365a8f8f2f569b524a3984815e1f5ddd | [] | no_license | pedrohenriqueos/maratona | fa01ebfe747d647cf4f88c486e1a798b3bcdbb3d | 5c9bffa2ec6a321a35c854d4800b4fe7931c1baf | refs/heads/master | 2020-03-22T06:35:23.879463 | 2020-02-27T20:15:53 | 2020-02-27T20:15:53 | 139,644,788 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 378 | cpp | #include<bits/stdc++.h>
using namespace std;
int N,K,p[100002],a,b;
int find(int u){
return (u==p[u])?u:p[u]=find(p[u]);
}
int join(int u,int v){
u=find(u);
v=find(v);
p[u]=v;
}
int main(){
cin >> N >> K;
for(int i =1;i<N;i++)
p[i]=i;
char c;
while(K--){
cin >> c >> a >> b;
if(c=='C'){
cout << ((f... | [
"pedro986@gmail.com"
] | pedro986@gmail.com |
da632faacab40acc33a51b7d2e86531717817835 | 932ec41a5c82d5cab9191bcba88a80fb8a0f04b0 | /vendor/IndustrialSystemFramework/ICUtility/iccommonappsettings.cpp | 55f871542caae1e70ad6265fd5c95cfbfa44bdf9 | [] | no_license | resilencelyn/3-5AxisRobot | 55c146aa6604c897df3bba8d0861829404eb4868 | cfbbb42cf706a4844813b0bcf22225107a6a8710 | refs/heads/master | 2022-05-22T06:31:39.198064 | 2017-12-15T09:15:29 | 2017-12-15T09:15:29 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 497 | cpp | #include "iccommonappsettings.h"
#include <QDir>
const char* ICCommonAppSettings::SystemConfigGroup = "CommonSystemConfig";
const char* ICCommonAppSettings::SessionGroup = "CommonSession";
const char* ICCommonAppSettings::LocaleGroup = "CommonLocale";
#ifdef Q_WS_X11
const char* ICCommonAppSettings::UsbPath = QDir::ho... | [
"GaussCheng@gmail.com"
] | GaussCheng@gmail.com |
ea3371f5b9cf84efd7554cd3671835360208b4fe | 84503e96473f0f8737d9b40d3040181380ba2989 | /color_ring/particles/particle_effects.cpp | b0171fcf80b293507d8407a6b02f4294718aa62a | [
"MIT"
] | permissive | amecky/ds_sandbox | 919fdaf04f4ab122775b922f41b84bb3f87265ca | f31e69f72a76c40aeb0fa3e3fbe9b651660df770 | refs/heads/master | 2021-01-02T23:45:34.103348 | 2019-02-01T13:38:19 | 2019-02-01T13:38:19 | 99,505,901 | 1 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 2,408 | cpp | #include "particle_effects.h"
#include "..\common\common.h"
#include "ParticleManager.h"
const static ds::vec4 STAR_TEXTURE = ds::vec4(40, 50, 16, 16);
const static ds::vec4 TEXTURE = ds::vec4(0, 75, 26, 26);
// -------------------------------------------------------
// emitt partciles for filled segment
// ----------... | [
"a.mecky@verband.creditreform.de"
] | a.mecky@verband.creditreform.de |
3db1dccd145687b43e4480b76aa6ec8291cb11f6 | c53eb8bca022c20dbdf4194c9c4eccfbf3e6ae89 | /firmware/libraries/lava_patterns/PatternHourglass.cpp | 9675c48480ed7cb308566e6d2bc7c466ed1a2270 | [
"MIT"
] | permissive | lavallc/ion | d0fca39f602356e942377106eb06a21eaaee4724 | c9292e832309a14f0725ab8794be75c0a9f10cef | refs/heads/master | 2020-04-06T03:32:28.861124 | 2015-07-22T01:11:32 | 2015-07-22T01:11:32 | 39,477,562 | 5 | 1 | null | null | null | null | UTF-8 | C++ | false | false | 5,686 | cpp |
/*
* PatternHourglas.cpp
*
* Created on: Feb 6, 2014
* Author: Salemancer
*/
#include "PatternHelpers.h"
#include "PatternHourglass.h"
#include "sun_board.h"
#include <cmath>
CPatternHourglass PatternHourglass;
void CPatternHourglass::start(LumenMoodConfig * configs, bool restore_to_defaults) {
is_r... | [
"ericb@ericbarch.com"
] | ericb@ericbarch.com |
f767af166730aac96e73a04350b651476de4b28f | 69aab86a56c78cdfb51ab19b8f6a71274fb69fba | /Code/inc/Engine/BasicMesh.h | 1c0a5cbdae9677c24dde5b0527271a790ecc7dee | [
"BSD-3-Clause"
] | permissive | zc5872061/wonderland | 89882b6062b4a2d467553fc9d6da790f4df59a18 | b6e0153eaa65a53abdee2b97e1289a3252b966f1 | refs/heads/master | 2021-01-25T10:44:13.871783 | 2011-08-11T20:12:36 | 2011-08-11T20:12:36 | 38,088,714 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,352 | h | /*
* BasicMesh.h
*
* Created on: 2011-02-13
* Author: Artur
*/
#ifndef BASICMESH_H_
#define BASICMESH_H_
#include "pi.h"
#include "CollisionShapes.h"
#include "Material.h"
#include <string>
#include <memory>
class BasicMesh
{
public:
friend class MeshManager;
BasicMesh();
const... | [
"Artur.S.Mazurek@gmail.com"
] | Artur.S.Mazurek@gmail.com |
f01f4649c3f771d2364706c2026e1a6fab45c5e8 | 29ba7eebb5f721aac9c8299cee90a009ea9b4cf2 | /Commander/CommandQ.cpp | 494edfadc53404edbeace4f3692eec8b10c78fb8 | [] | no_license | mmazinani2/Robocup | 4c25c08bf8c65bc355503ffa5026e469e3c501d0 | 26e625bb2bf502dc65564134305113848e32cc8a | refs/heads/master | 2020-05-25T14:04:47.454122 | 2019-05-21T12:48:44 | 2019-05-21T12:48:44 | 187,835,617 | 2 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,564 | cpp | /************************************
Create by
Mohammad Mazinani
Mohammad Ali Kamkar
Mehdi Torshani
*************************************/
#include "CommandQ.h"
#include "../Util/Timer.h"
CommandQ::CommandQ ( )
{
clearCommandQ ( );
SeeFlag = false;
SendFlag = false;
}
CommandQ::CommandQ ( CMD cmd)
{
clearCommandQ... | [
"mohammad@Mohammads-MacBook-Air.local"
] | mohammad@Mohammads-MacBook-Air.local |
820dfdd4daf8239ea1c295130233f6b147c90a13 | e5f0d739d821b8cd5dcc125d7170063fd4e4eee3 | /source/JagolyGUI/Container.cpp | 42c6ce0a778125c13416a9f1270705265241cf3e | [] | no_license | jagoly/JagolyGUI | d62f415291efcb7bef377b07981f4ac2c47b97ba | 5985d7959e7227175b42b00091331ca0a59f9131 | refs/heads/master | 2021-01-10T10:31:16.387322 | 2015-11-24T12:52:07 | 2015-11-24T12:52:07 | 46,709,330 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 302 | cpp | #include <JagolyGUI/Container.hpp>
using namespace jagolygui;
void Container::propogate_func(std::function<void(Widget*)> _func) {
for (auto widget : get_children()) { _func(widget);
if (auto container = dynamic_cast<Container*>(widget))
container->propogate_func(_func); }
}
| [
"james.gangur@gmail.com"
] | james.gangur@gmail.com |
3f3df56cda3eb1e748adad981d3df535afb0d226 | f7c4e5232430f792a401ea77e30f23cd3d0488e1 | /Assignment 5/RefactoredBoilerplate/ShaderTools.h | 4ed1a9c7f48fbde85c925d64f87dc3c0277fb239 | [] | no_license | jasminecronin/intro-computer-graphics | 0416f845722e21f24a56a34536f8f6063ea8d5de | 48d7ac148b8eea329d3c44701931c63940170cc3 | refs/heads/master | 2022-10-14T04:14:05.807816 | 2020-06-09T00:32:04 | 2020-06-09T00:32:04 | 270,711,347 | 1 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 796 | h | /*
* ShaderTools.cpp
* Tools for parsing, compiling and linking shaders
* Created on: Sep 10, 2018
* Author: John Hall
*/
#ifndef SHADERTOOLS_H_
#define SHADERTOOLS_H_
#include <string>
//**Must include glad and GLFW in this order or it breaks**
#include "glad/glad.h"
#include <GLFW/glfw3.h>
//Shader associate... | [
"roebuckj3@gmail.com"
] | roebuckj3@gmail.com |
d7a9607a3816f4c99485a4f1c61cc3c9566e4d63 | 9454f6d9d2ab54d206e62eb94da521553958a1c7 | /最小权顶点覆盖问题.cpp | 7b219bca1d150fa09dff4c3238784bb726a88c50 | [] | no_license | tedqin/rsa- | 6272a35d97656628d2be4b05b05e40cdf4e405db | 607d0a8ebdd5871b80eebd254427d112b6afcefa | refs/heads/master | 2020-06-15T00:08:32.121336 | 2016-11-30T13:12:24 | 2016-11-30T13:12:24 | 75,186,645 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 809 | cpp | #include<stdio.h>
#define MIN 100000
int m,n,u,v,bestw;
int e[100][100],w[100],c[100];
int cover()
{
int i,j,t;
i=1;
while(i<=n)
{
t=0;
if(c[i]==0)
{
j=1;
while(j<i)
{
if(e[j][i]==1&&c[j]==1)
t=1;
j++;
}
j++;
while(j<=n)
{
if(e[i][j]==1&&c[j]==1)
t=1;
j++;
... | [
"694324099@qq.com"
] | 694324099@qq.com |
82c64c3ef0cac807638fa67da17f744d4c3c8783 | 97af29a46e5f9279b76af89b41c56d8d7e790808 | /Miner.cpp | 4a0e9150292c4008f22327207215617254170fc4 | [] | no_license | alexjwong/candy-mine | ce9afa2cbc689fd26daec4ca40d51c40f8f77d84 | 8c8c95f20d1d6d0bf205d759722032f355c8d85c | refs/heads/master | 2021-01-19T19:40:00.529745 | 2014-05-20T17:25:35 | 2014-05-20T17:25:35 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 2,474 | cpp | #include <iostream>
#include <math.h>
#include "Miner.h"
// ***Constructors***
Miner::Miner() : Person('M'){
amount = 0;
mine = NULL;
home = NULL;
std::cout << "Miner default constructed." << std::endl;
}
Miner::Miner(int in_id, C_Point in_loc) : Person('M',in_id,in_loc){
amount = 0;
mine = NULL;
home = NUL... | [
"alexw@alexs-mbp.cumulusnetworks.com"
] | alexw@alexs-mbp.cumulusnetworks.com |
d3102448505521b020097cdf3a34ef6e6700bdbd | ec6903659ea79ceb1c04a69bdb99babbf6ade402 | /OpenGL/Material.h | 72c62849630911ecfb718ba79ffca8a28d0ed66a | [] | no_license | kwsephiroth/OpenGL | ea5e9b02f578f132e3c79b0fc5a41e5bebecf658 | b3374c77d547ea9ed6c65e6d79ebb74282a4bb34 | refs/heads/master | 2023-07-10T08:41:49.899855 | 2023-06-22T22:54:21 | 2023-06-22T22:54:21 | 189,761,590 | 1 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,005 | h | #pragma once
#include <glm\glm.hpp>
#include <string>
struct MaterialProperties
{
glm::vec3 ambientColor;
glm::vec3 diffuseColor;
glm::vec3 specularColor;
double specularExponent;
};
struct SpecularComponent
{
glm::vec3 specularColor;
float specularExponent;
};
class Material
{
private:
std::string m_name;
M... | [
"kwalkerdev@gmail.com"
] | kwalkerdev@gmail.com |
1cca75595940f3afba4c0ed66b643c7e6cc1c23c | de0db5963117b8ffe1e46be8e413e18b1773127f | /binary.cpp | cb264dace415e37ba39b78ef6f6ed771eeca6ef1 | [] | no_license | hukuda222/competitive-library | a75ef0774342ab5433e1e3721aa5a94cf7c17011 | 2830db4fb3e8430f9466c782ed84a65b1ec4d4db | refs/heads/master | 2020-05-02T14:15:53.441486 | 2019-07-12T00:26:38 | 2019-07-12T00:26:38 | 178,005,512 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 239 | cpp | ll binary_search(ll key) {
ll left = -1;
ll right = (ll)a.size();
while (abs(right - left) > 1) {
ll mid = left + (right - left) / 2;
if (isOK(mid, key))
right = mid;
else
left = mid;
}
return right;
}
| [
"zionbanzai3@gmail.com"
] | zionbanzai3@gmail.com |
164ad370cc836b0d0263effee695921610691bc8 | 44c6115ccafd29838dd6294b0e78023ba9d90e41 | /Main_Series_Proc_Minmax/Proc_Solve.h | cb13addcd33bf894e6072284bcfafb8e4b0da781 | [] | no_license | TitusVesp/Series_Proc_Minmax | 0b9b93e6b6b7dfbf3071d951cfb59836ed7f3a41 | 0263b2015c4a046b046f8dc8086f5e8b7be89399 | refs/heads/master | 2020-08-02T22:50:22.672567 | 2019-09-30T11:04:46 | 2019-09-30T11:04:46 | 211,533,389 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 155 | h | #pragma once
#include <iostream>
#include <time.h>
#include <stdlib.h>
using namespace std;
void Proc13();
void Proc26();
void Proc36();
void Proc56();
| [
"kiril2906@hmail.com"
] | kiril2906@hmail.com |
02ba1beb3c23d5f9f1b53648fc8b374c755695f8 | fa1cd2f39f9121e3a0b0cc9ad168856c4b2a3c98 | /AlgorithmeGenetique.cpp | 86c8e9aebc9368abd35f9b27b6743ca7a9d76944 | [] | no_license | GaelReinaudi/very_old_RB2_experiment | daceb43635adfd7044badf43b823b907dfa26f4a | d8bac09c37e28ddc5ccedc0b81365817a536429d | refs/heads/master | 2021-01-20T18:27:49.732690 | 2017-11-14T00:34:42 | 2017-11-14T00:34:42 | 62,858,309 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 405 | cpp | #include "StdAfx.h"
#include "AlgorithmeGenetique.h"
CAlgorithmeGenetique::CAlgorithmeGenetique(void)
: m_pEditXPSResult(NULL), m_pEditXPSEvent(NULL), m_pEditXPSAction(NULL), m_pComboPVT(NULL)
{
}
CAlgorithmeGenetique::CAlgorithmeGenetique(CString NewIp)
: m_pEditXPSResult(NULL), m_pEditXPSEvent(NULL), m_pEditXPSActio... | [
"gael.reinaudi@gmail.com"
] | gael.reinaudi@gmail.com |
5c6375f47c3c0ba2cb65541128dae25f6dfc0eac | 79ca585c438393c3c76d8442470f6fb625085b5d | /libs/libvtrutil/src/vtr_linear_map.h | 7ae6c9a703a72dee397d30a4b380c3980474ff7e | [
"MIT"
] | permissive | tangxifan/libOpenFPGA | 5408e632d07b300559a825234bc538657939fa6b | fc08c2b13d15046601919f1f1e696efce1607eb5 | refs/heads/master | 2022-10-28T01:48:18.373726 | 2019-04-22T03:27:08 | 2019-04-22T03:27:08 | 181,151,626 | 4 | 0 | MIT | 2022-09-30T20:17:31 | 2019-04-13T09:54:33 | C++ | UTF-8 | C++ | false | false | 10,101 | h | #ifndef VTR_LINEAR_MAP_H
#define VTR_LINEAR_MAP_H
#include <vector>
#include <stdexcept>
#include "vtr_sentinels.h"
namespace vtr {
//A std::map-like container which is indexed by K
//
//The main use of this container is to behave like a std::map which is optimized to hold
//mappings between a dense linear range of ... | [
"tangxifan@gmail.com"
] | tangxifan@gmail.com |
d63d4414685fac22deb2dbea39941071d8b42842 | 94fc041dda3cfc0c1b5d2b5559ac2c36798d1ae2 | /mycar/mycar.ino | 6b7469d61ae756acd315e8afb956185472cb0c4b | [] | no_license | RexTSLO/ArduinoMobileVehicle | 7493ed799d8c18f87f5915e79cf3a5dec09f77d6 | 2211aaf29481294710ac830dd80e335457009096 | refs/heads/master | 2020-04-10T16:37:32.442614 | 2016-02-07T13:06:56 | 2016-02-07T13:06:56 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 2,489 | ino | #define trigPin 9
#define echoPin 3
int BackLeftmotorPin = 7;
int ForthLeftmotorPin = 8;
int BackRightmotorPin = 2;
int ForthRightmotorPin = 4;
void setup() {
Serial.begin(9600);
pinMode(trigPin,OUTPUT);
pinMode(echoPin,INPUT);
pinMode(BackLeftmotorPin, OUTPUT);
pinMode(BackRightmotorPin, OUTPUT);
pinMode... | [
"adslaids12@hotmail.com"
] | adslaids12@hotmail.com |
25057ae57809cae3f716d47aa7179a5d928eafb9 | 0cb85cd0c88a9b9f0cca4472742c2bf9febef2d8 | /AVP32/fpirun/collect.cpp | 0d497208e66f4cd6a8a6fe8cd2590a0ebf07c19c | [] | no_license | seth1002/antivirus-1 | 9dfbadc68e16e51f141ac8b3bb283c1d25792572 | 3752a3b20e1a8390f0889f6192ee6b851e99e8a4 | refs/heads/master | 2020-07-15T00:30:19.131934 | 2016-07-21T13:59:11 | 2016-07-21T13:59:11 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 4,177 | cpp | // collect.cpp -- code for copying virus samples to a collection directory
#include <stdlib.h>
#include <stdio.h>
#include <string.h>
#include <memory.h>
extern "C"
{
#include "fpiapi.h"
#include "fpirun.h"
}
#ifdef USE_FM
#if defined(_MSC_VER) && _MSC_VER < 900
#pragma pack(8)
#else
#pragma pack(pu... | [
"idrez.mochamad@gmail.com"
] | idrez.mochamad@gmail.com |
653b52c04566fc8a931c1176a5a437d832c8e3b9 | 46d4705d311387e0bc7b614271353bd445b9a776 | /src/test/sighash_tests.cpp | 40baee8d91c2ceef6b98ce3e6484173de2421a14 | [
"MIT"
] | permissive | VersusCoin/versus-dev | 12e2fd8f2ba730e59e7e4b454787afb7b4a79ec3 | 333a57584886de67d2dd261fb5672714e9dd20a0 | refs/heads/master | 2021-05-05T05:48:30.359486 | 2018-01-24T11:55:56 | 2018-01-24T11:55:56 | 118,751,174 | 0 | 1 | null | null | null | null | UTF-8 | C++ | false | false | 7,138 | cpp | // Copyright (c) 2013-2015 The Bitcoin Core developers
// Distributed under the MIT software license, see the accompanying
// file COPYING or http://www.opensource.org/licenses/mit-license.php.
#include "consensus/validation.h"
#include "data/sighash.json.h"
#include "hash.h"
#include "main.h" // For CheckTransaction
... | [
"versuscrypto@gmail.com"
] | versuscrypto@gmail.com |
af8c57893b4a83d248510c6a8a9483de90417fc0 | a9127dab5f4322989ecdb4e4e5e97d29cea5ebe4 | /include/co2/shared_task.hpp | 283d249fb12da23eff850db5c3af5fc87f47d7bc | [
"BSL-1.0"
] | permissive | respu/co2 | e7cadd098c2df697494b9a6f8f67a082d189053d | ea435550783b1eaf97aa307dbffaf10a241a9171 | refs/heads/master | 2021-01-18T05:43:29.459164 | 2015-03-06T14:37:00 | 2015-03-06T14:37:00 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 2,228 | hpp | /*//////////////////////////////////////////////////////////////////////////////
Copyright (c) 2015 Jamboree
Distributed under the Boost Software License, Version 1.0. (See accompanying
file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
///////////////////////////////////////////////////... | [
"tongari95@gmail.com"
] | tongari95@gmail.com |
4c2d8cce7bed878666ac7b1328dffb460a145d26 | 3e751cfe04ea8b2c2727a9730daaef4f93de73db | /include/detector/ensemble/EnsembleClassifier.hpp | 9b5ab9edc712e0b67ba8894e71b406d588bead80 | [] | no_license | shockzort/tld | 0a2a51b9f46cbb6d6d8583c83da05696308b0402 | 54e9178e7ccac4ce6c87d190d2e3b0f78b607e41 | refs/heads/master | 2020-03-23T19:42:53.783216 | 2017-05-04T19:57:21 | 2017-05-04T19:57:21 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 2,487 | hpp | #ifndef ENSEMBLE_CLASSIFIER_H
#define ENSEMBLE_CLASSIFIER_H
#include <string>
#include <vector>
#include "common/Random.hpp"
#include "core/Frame.hpp"
#include "core/ScoredBox.hpp"
#include "detector/training/BoxHull.hpp"
#include "detector/training/TrainingSet.hpp"
#include "detector/ensemble/CodeVector.hpp"
#incl... | [
"mehmetcemgunturkun@gmail.com"
] | mehmetcemgunturkun@gmail.com |
d353322fb38a1dfe630036794807df97a1a7c54c | 083100943aa21e05d2eb0ad745349331dd35239a | /aws-cpp-sdk-rds/source/RDSErrorMarshaller.cpp | bf868168d1c3b9ae46effe3ef7cdc496f7432617 | [
"JSON",
"MIT",
"Apache-2.0"
] | permissive | bmildner/aws-sdk-cpp | d853faf39ab001b2878de57aa7ba132579d1dcd2 | 983be395fdff4ec944b3bcfcd6ead6b4510b2991 | refs/heads/master | 2021-01-15T16:52:31.496867 | 2015-09-10T06:57:18 | 2015-09-10T06:57:18 | 41,954,994 | 1 | 0 | null | 2015-09-05T08:57:22 | 2015-09-05T08:57:22 | null | UTF-8 | C++ | false | false | 1,036 | cpp | /*
* Copyright 2010-2015 Amazon.com, Inc. or its affiliates. All Rights Reserved.
*
* Licensed under the Apache License, Version 2.0 (the "License").
* You may not use this file except in compliance with the License.
* A copy of the License is located at
*
* http://aws.amazon.com/apache2.0
*
* or in the "license" file... | [
"henso@amazon.com"
] | henso@amazon.com |
598537b4e3eb5abc367e883794bd44fa0dc62134 | b06de55af9667423a72593748570571f886517b6 | /interface/IIHEModuleSuperCluster.h | 526149aabc762aaf19ed59e6a16ddc86c29d9550 | [] | no_license | rgoldouz/miniAOD_IIHE | 4530441444667ba6f099ce6fcde888b60fb724a4 | 193677f41143423b383272cad36b2a02f026019c | refs/heads/master | 2021-01-22T10:32:29.144030 | 2016-05-04T10:12:01 | 2016-05-04T10:12:01 | 51,377,166 | 0 | 4 | null | null | null | null | UTF-8 | C++ | false | false | 1,068 | h | #ifndef UserCode_IIHETree_IIHEModuleSuperCluster_h
#define UserCode_IIHETree_IIHEModuleSuperCluster_h
#include "UserCode/IIHETree/interface/IIHEModule.h"
// class decleration
class IIHEModuleSuperCluster : public IIHEModule {
private:
inline float etacorr(float eta, float pvz, float scz){ return asinh(sinh(eta)*(1.... | [
"reza.goldouzian@cern.ch"
] | reza.goldouzian@cern.ch |
ef22209cac71d36acd99afa4a5f76734a4691a8e | 35ef15922b1f74702998cc77223627faecca5094 | /Codeforces/659A.cpp | ae4f0176c125ba0b7ade0e605d63ae8872a517ec | [] | no_license | neelchoudhury/cp | 4409fffc0db05ce1246cc8e537f8aea10dff8980 | 29eb993fb1931d8608a860ab16e016e16eed1aad | refs/heads/main | 2023-01-23T15:03:54.708059 | 2023-01-21T18:09:55 | 2023-01-21T18:09:55 | 293,884,505 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 353 | cpp | #include <bits/stdc++.h>
#define ll long long int
#define MOD 1000000007
#define sc(n) scanf("%lld",&n)
#define mem(a) memset(a,0,sizeof(a))
#define pb push_back
#define ff first
#define ss second
#define pr(n) printf("%lld\n", n)
using namespace std;
int main()
{
ll n,a,b,ans;
cin>>n>>a>>b;
ans= ((a-1+b)%n+n)%n+1... | [
"neelchoudhury@users.noreply.github.com"
] | neelchoudhury@users.noreply.github.com |
7e78a8b8a40697c75f6afd9b226baf329badf470 | 67ced4267ecfe04e494db99c45840eede4511c0a | /src/pgg_gpg.cc | 328fdd997e95347e0b246aed5e72a4347934d847 | [
"MIT"
] | permissive | diorahman/pgg | 8c67572cdf6673a6cd88ff019595446662b79476 | bf40f44fb231ef6f2cd64b4c33844a53cb1a008f | refs/heads/master | 2020-05-18T05:49:46.829257 | 2015-01-14T05:37:52 | 2015-01-14T05:37:52 | 28,954,369 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 633 | cc | #include "pgg_gpg.h"
#include <nan.h>
#include <locale.h>
void PggGpg::Init(const gpgme_protocol_t& proto) {
gpgme_error_t err;
gpgme_check_version(NULL);
setlocale(LC_ALL, "");
gpgme_set_locale(NULL, LC_CTYPE, setlocale (LC_CTYPE, NULL));
err = gpgme_engine_check_version(proto);
ThrowError(err);
}
void ... | [
"diorahman@rockybars.com"
] | diorahman@rockybars.com |
ede1629a0cbffd522658ceeaff51d8083ee7e3d6 | 215750938b1dd4354eab9b8581eec76881502afb | /src/test/TestReverb.h | ceac1978e41e64c865e461d4b10d623abd8eca18 | [
"WTFPL"
] | permissive | EleonoreMizo/pedalevite | c28fd19578506bce127b4f451c709914ff374189 | 3e324801e3a1c5f19a4f764176cc89e724055a2b | refs/heads/master | 2023-05-30T12:13:26.159826 | 2023-05-01T06:53:31 | 2023-05-01T06:53:31 | 77,694,808 | 103 | 8 | null | null | null | null | UTF-8 | C++ | false | false | 2,156 | h | /*****************************************************************************
TestReverb.h
Author: Laurent de Soras, 2020
--- Legal stuff ---
This program is free software. It comes without any warranty, to
the extent permitted by applicable law. You can redistribute it
and/or modify it under the te... | [
"fuck@fuck.fuck"
] | fuck@fuck.fuck |
438874ead50dedce95481cdbbef3af9f2ca76c4f | e1806fcc56ed2fe170aae5a6baa1cc542c2da1d0 | /Module_04/ex03/inc/Ice.hpp | d7b223d67d21109cfa8ed03d0789d0049abdd980 | [] | no_license | gvenet/CPP | 53e17b43be40c097132f609a89247cf90d2fdabd | ea8909581701f4267d71d269d605334d400d14ad | refs/heads/master | 2023-06-23T16:30:55.088550 | 2021-07-14T17:50:26 | 2021-07-14T17:50:26 | 368,485,243 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 742 | hpp | #ifndef ICE_HPP
#define ICE_HPP
#include <iostream>
#include <string>
#include "AMateria.hpp"
class Ice : public AMateria
{
public:
//============================================================COPLIAN============================================================
Ice();
Ice(Ice const &cpy);
Ice &operator=(Ice const... | [
"gvenet@z3r6p3.42lyon.fr"
] | gvenet@z3r6p3.42lyon.fr |
1cd12d6542bd6024677d4b7535a4c42c4e33e7f2 | 94206d6679ad21549d65b4b9609eb838f40ff59c | /GObject.h | 96fb790a64a055c9d3ecaabbf230ae444254deb2 | [] | no_license | viktorpts/rtstar | aac83e0bdbe42277e31abc825f090ae6ad629897 | 5547738e571328cd6a622c8b0e39972e5015566d | refs/heads/master | 2021-01-10T01:26:48.331137 | 2016-03-08T18:24:17 | 2016-03-08T18:24:17 | 53,434,549 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,376 | h | #include "data.h"
#pragma once
class CGObject
{
double ID;
int magnitude;
double position;
double mod;
CGComposition composition; // *** Subject to change! ***
// Object brightness and apparent color; will later be replaced
// by a set of parameters, defining mass and composition
... | [
"viktor.pts@abv.bg"
] | viktor.pts@abv.bg |
e6b2c9c8bd34369808389342e3279dbbc5b5c314 | b0fd70bbc2dbf78b22d5fc759012aef23745daa2 | /libraries/Arduino-FOC-drivers-1.0.2/src/voltage/VoltageSense.h | 08ebfece1ef521fedc7650b85deac2866e3b36d5 | [
"Apache-2.0",
"CC-BY-4.0",
"LicenseRef-scancode-unknown-license-reference",
"MIT"
] | permissive | jeichenlaub/fidgetknob | cbb5563db3c49ab5cc55a47a3ae071547b450052 | 3c3796c6b13117956b0a13ebe3658689df101dc6 | refs/heads/main | 2023-04-18T13:47:52.475853 | 2023-03-14T10:08:03 | 2023-03-14T10:08:03 | 604,096,061 | 1 | 0 | NOASSERTION | 2023-03-14T09:29:12 | 2023-02-20T10:24:12 | C++ | UTF-8 | C++ | false | false | 395 | h | #ifndef __VOLTAGESENSE_H__
#define __VOLTAGESENSE_H__
#include "common/lowpass_filter.h"
class VoltageSense {
public:
VoltageSense(float gain = 1.0f, float offset = 0.0f, float Tf = 0.1f);
float getVoltage();
virtual void update();
LowPassFilter filter;
float gain;
float offset;
protecte... | [
"johnaeichenlaub@gmail.com"
] | johnaeichenlaub@gmail.com |
0677a05fad83247e0f1bd87484f318d07ec45d4f | 602bc10bd3f5acc5dbdca22bcc92f4c72b771778 | /Online judges/UVA/11747.cpp | e009494c7eeddd305620591589e4bc94cb6245fe | [] | no_license | AdolfoAiresSchneider/Competitive-Programming | 472cfadc813510c86369f637873be959d2e96c7d | 0a5f5c627e462fd29708058b28995dae73d379b8 | refs/heads/master | 2020-05-15T23:28:10.771026 | 2019-05-29T12:56:40 | 2019-05-29T12:56:40 | 182,553,866 | 2 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 1,107 | cpp | #include <bits/stdc++.h>
using namespace std;
typedef pair<long int,long int> ii;
typedef pair<long long int,ii> edge;
vector<edge> edges;
int p[1009];
set<long long int> pesos;
int find(int a)
{
if(p[a]==a) return a;
return p[a] = find(p[a]);
}
bool isUnion(int a, int b)
{
return find(a) == find(b);
}
void unio... | [
"adolfo.aires@gmail.com"
] | adolfo.aires@gmail.com |
3aad057f4848bf0e0a0ddc0bbc584b6598a836c3 | a25365b72009f028f41773d83dd947a38ef2b1eb | /Untitled1.cpp | f125ead487a5e472882fccfd1885b30e0a89b473 | [] | no_license | Malhar99/Post-Investment | bbc05ab1fdabba88eda77af93d8c423bfc5c753a | 3fbbbd57c0705dd36b080edcf790f7f61d4b072e | refs/heads/master | 2021-05-23T09:07:04.160035 | 2020-04-05T10:57:21 | 2020-04-05T10:57:21 | 253,213,391 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 939 | cpp | #include <fstream>
#include <iostream>
using namespace std;
int main () {
char data[100];
// open a file in write mode.
ofstream outfile;
outfile.open("afile.txt",ios::app | ios::binary);
cout << "Writing to the file" << endl;
cout << "Enter your name: ";
cin.getline(data, 100);
// write inp... | [
"malhartrivedi99@gmail.com"
] | malhartrivedi99@gmail.com |
540a4a548e7da2bcff8cd53a849c6caa3c975028 | b6ba50ae455c0a9f97dad6ce0b2bfb3a254c9cf2 | /seckill/logic/src/RedisPoolConnection.cpp | 5165649fbc56ea62dee14e1f2c69d410fdfd8a88 | [] | no_license | jingjingfengfeng/simple_seckill | d215cc1512f225b0756bb10ce8b1e1429437aabc | be6627d4151542831cb1fbc54d34953fab0dcb61 | refs/heads/master | 2020-05-02T04:59:24.452440 | 2019-03-26T17:52:53 | 2019-03-26T17:52:53 | 177,762,221 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 2,720 | cpp | /*
* ==============================================
* Filename: RedisPoolConnectioin.cpp
* Description:
* ==============================================
*/
#include "RedisPoolConnection.h"
RedisPool* RedisPool::m_pRedisPool = NULL;
std::mutex RedisPool::m_pollLock;
std::mutex RedisPool::m_geneLock;... | [
"767543437@qq.com"
] | 767543437@qq.com |
e02910813e120909c1af9d999cb95327bdbd9a85 | e9d3bd92027e63033929ab9dc97f38473f8ef0ef | /GTE/Graphics/ParticleController.h | 532570345929b62e34c99fa6fa3fc78c01d8b18d | [
"BSL-1.0"
] | permissive | cbullo/GeometricTools | 77107de654a012649d05ea248caefe581cc7fde4 | 53d82425c3d27a4301f7390754c7fc440734d53f | refs/heads/master | 2023-08-27T22:05:04.268917 | 2021-10-19T20:48:34 | 2021-10-19T20:48:34 | null | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 3,158 | h | // David Eberly, Geometric Tools, Redmond WA 98052
// Copyright (c) 1998-2021
// Distributed under the Boost Software License, Version 1.0.
// https://www.boost.org/LICENSE_1_0.txt
// https://www.geometrictools.com/License/Boost/LICENSE_1_0.txt
// Version: 4.0.2019.08.13
#pragma once
#include <Mathematics/Vector3.h>
... | [
"deberly@geometrictools.com"
] | deberly@geometrictools.com |
11eebc81628d2776fd879fdd02ef19b401f5c836 | 189f52bf5454e724d5acc97a2fa000ea54d0e102 | /ras/floatingObject/1.1/p | d6f34ccc8aaac3e1c4a7fac4f5cbbef9d9e0f7c9 | [] | no_license | pyotr777/openfoam_samples | 5399721dd2ef57545ffce68215d09c49ebfe749d | 79c70ac5795decff086dd16637d2d063fde6ed0d | refs/heads/master | 2021-01-12T16:52:18.126648 | 2016-11-05T08:30:29 | 2016-11-05T08:30:29 | 71,456,654 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 217,685 | /*--------------------------------*- C++ -*----------------------------------*\
| ========= | |
| \\ / F ield | OpenFOAM: The Open Source CFD Toolbox |
| \\ / O peration | Version: v1606+ |
... | [
"peterbryz@yahoo.com"
] | peterbryz@yahoo.com | |
b0ef9b895235542ac31dac0cd23e03f0d31916c5 | cccfb7be281ca89f8682c144eac0d5d5559b2deb | /chromecast/cast_core/cast_runtime_content_browser_client_simple.cc | 34695dc6372aa8a1497345a1ac2bd7186c9d9512 | [
"BSD-3-Clause"
] | permissive | SREERAGI18/chromium | 172b23d07568a4e3873983bf49b37adc92453dd0 | fd8a8914ca0183f0add65ae55f04e287543c7d4a | refs/heads/master | 2023-08-27T17:45:48.928019 | 2021-11-11T22:24:28 | 2021-11-11T22:24:28 | 428,659,250 | 1 | 0 | BSD-3-Clause | 2021-11-16T13:08:14 | 2021-11-16T13:08:14 | null | UTF-8 | C++ | false | false | 532 | cc | // Copyright 2021 The Chromium Authors. All rights reserved.
// Use of this source code is governed by a BSD-style license that can be
// found in the LICENSE file.
#include "chromecast/cast_core/cast_runtime_content_browser_client.h"
namespace chromecast {
// static
std::unique_ptr<CastRuntimeContentBrowserClient>
... | [
"chromium-scoped@luci-project-accounts.iam.gserviceaccount.com"
] | chromium-scoped@luci-project-accounts.iam.gserviceaccount.com |
2b9e1b27db6fff96015e0be306a2f16f027a99bf | 20ce8839f51d9f0a489df5e176b6c11df57d1126 | /vi_sensor_save_stereo_image/src/vi_sensor_interface.cpp | 7175e7be28be872fdecc6d709a803874a0046151 | [] | no_license | PyojinKim/visensor_sample_applications | 4a8a5efe5aed96d4ae25dd39e05476953a389d58 | 1fcbd295f2adb77981e891b8ad72265f785f9ee4 | refs/heads/master | 2021-01-22T13:13:46.690825 | 2016-05-16T07:37:09 | 2016-05-16T07:37:09 | 58,507,733 | 1 | 1 | null | 2016-05-11T02:23:53 | 2016-05-11T02:23:53 | null | UTF-8 | C++ | false | false | 6,732 | cpp | /*
* Copyright (c) 2014, Skybotix AG, Switzerland (info@skybotix.com)
*
* All rights reserved.
*
* Redistribution and non-commercial use in source and binary forms, with or without
* modification, are permitted provided that the following conditions are met:
*
* Redistributions of source code must retain the ab... | [
"pjinkim1215@gmail.com"
] | pjinkim1215@gmail.com |
50317d51cefdebbb90a076632896bac0f4b681dd | 385e3414ccb7458bbd3cec326320f11819decc7b | /frameworks/av/media/libstagefright/timedtext/DvbClut.h | 4fd7b75334ea0352ce9fbec2e414acd94fc438c4 | [
"LicenseRef-scancode-unicode",
"Apache-2.0"
] | permissive | carlos22211/Tango_AL813 | 14de7f2693c3045b9d3c0cb52017ba2bb6e6b28f | b50b1b7491dc9c5e6b92c2d94503635c43e93200 | refs/heads/master | 2020-03-28T08:09:11.127995 | 2017-06-26T05:05:29 | 2017-06-26T05:05:29 | 147,947,860 | 1 | 0 | null | 2018-09-08T15:55:46 | 2018-09-08T15:55:45 | null | UTF-8 | C++ | false | false | 5,896 | h | /*
* Copyright (C) 2012 The Android Open Source Project
*
* Licensed under the Apache License, Version 2.0 (the "License");
* you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
*
* http://www.apache.org/licenses/LICENSE-2.0
*
* Unless required by app... | [
"zhangjinqiang@huaqin.com"
] | zhangjinqiang@huaqin.com |
34682431762c280859867e105cdbb41db2704d6d | 6816ba5151b04140acf76ad5faea21164005abd9 | /Spelunky/keyManager.cpp | 628ce37959f694cadef21bf3bb2af92bca92a585 | [] | no_license | Cesea/Spelunky | 038f25286942ecbad8f999534fab4688fd0c1f06 | ae3f28dbb0c152bda2fcdc5130b72dfec5d7080f | refs/heads/master | 2021-03-24T03:02:33.307217 | 2017-07-28T07:29:25 | 2017-07-28T07:29:25 | 96,779,844 | 2 | 1 | null | null | null | null | UHC | C++ | false | false | 1,081 | cpp | #include "stdafx.h"
#include "keyManager.h"
keyManager::keyManager()
{
}
keyManager::~keyManager()
{
}
HRESULT keyManager::Init(void)
{
for (int i = 0; i < KEYMAX; i++)
{
this->setKeyUp(i, false);
this->setKeyDown(i, false);
}
return S_OK;
}
void keyManager::Release(void)
{
}
//키가 한번 눌렸는지 체크...
bool key... | [
"cltnmm@naver.com"
] | cltnmm@naver.com |
130836385d08b47a9a9d57a93a5b168ecdcef1c1 | 8355c0f1d96cdf4b2e067877da0e859536e0b213 | /src/click.cpp | b028f4fcf25ebd63bc305893a536501719f6bf97 | [] | no_license | fopeczek/universal-button-operator-by-mik | 6e0a388ce93c34e04029af9c0f8a3f4962fd4cda | 53333f165a537cf8f561f67af9d078d9cabd776c | refs/heads/main | 2023-04-04T19:56:38.552095 | 2021-04-17T10:39:50 | 2021-04-17T10:39:50 | 358,855,693 | 0 | 0 | null | null | null | null | UTF-8 | C++ | false | false | 4,774 | cpp | #include "Arduino.h"
#include "click.h"
#define CZAS_TRZYMANIA 1000
#define GRACE_PERIOD 75 //Time after letting the push button go, to prevent re-bounce effects.
void Guzik::update(bool debug) {
bool read;
if(m_analog_pin) {
int i_read=analogRead(m_pin);
read=i_read>511;
} else {
read=digitalRead(m_pin);
... | [
"mikolaj@statystyka.net"
] | mikolaj@statystyka.net |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.