repo
stringlengths
6
65
file_url
stringlengths
81
311
file_path
stringlengths
6
227
content
stringlengths
0
32.8k
language
stringclasses
1 value
license
stringclasses
7 values
commit_sha
stringlengths
40
40
retrieved_at
stringdate
2026-01-04 15:31:58
2026-01-04 20:25:31
truncated
bool
2 classes
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/html/element/inner_html.rs
tachys/src/html/element/inner_html.rs
use super::{ElementWithChildren, HtmlElement}; use crate::{ html::attribute::{ maybe_next_attr_erasure_macros::{ next_attr_combine, next_attr_output_type, }, Attribute, NamedAttributeKey, NextAttribute, }, renderer::Rndr, view::add_attr::AddAnyAttr, }; use std::{future::Future, sync::Arc}; /// Returns an [`Attribute`] that sets the inner HTML of an element. /// /// No children should be given to this element, as this HTML will be used instead. /// /// # Security /// Be very careful when using this method. Always remember to /// sanitize the input to avoid a cross-site scripting (XSS) /// vulnerability. #[inline(always)] pub fn inner_html<T>(value: T) -> InnerHtml<T> where T: InnerHtmlValue, { InnerHtml { value } } /// Sets the inner HTML of an element. #[derive(Debug)] pub struct InnerHtml<T> { value: T, } impl<T> Clone for InnerHtml<T> where T: Clone, { fn clone(&self) -> Self { Self { value: self.value.clone(), } } } impl<T> Attribute for InnerHtml<T> where T: InnerHtmlValue, { const MIN_LENGTH: usize = 0; type AsyncOutput = InnerHtml<T::AsyncOutput>; type State = T::State; type Cloneable = InnerHtml<T::Cloneable>; type CloneableOwned = InnerHtml<T::CloneableOwned>; fn html_len(&self) -> usize { self.value.html_len() } fn to_html( self, _buf: &mut String, _class: &mut String, _style: &mut String, inner_html: &mut String, ) { self.value.to_html(inner_html); } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { self.value.hydrate::<FROM_SERVER>(el) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { self.value.build(el) } fn rebuild(self, state: &mut Self::State) { self.value.rebuild(state); } fn into_cloneable(self) -> Self::Cloneable { InnerHtml { value: self.value.into_cloneable(), } } fn into_cloneable_owned(self) -> Self::CloneableOwned { InnerHtml { value: self.value.into_cloneable_owned(), } } fn dry_resolve(&mut self) { self.value.dry_resolve(); } async fn resolve(self) -> Self::AsyncOutput { InnerHtml { value: self.value.resolve().await, } } fn keys(&self) -> Vec<NamedAttributeKey> { vec![NamedAttributeKey::InnerHtml] } } impl<T> NextAttribute for InnerHtml<T> where T: InnerHtmlValue, { next_attr_output_type!(Self, NewAttr); fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { next_attr_combine!(self, new_attr) } } /// Sets the inner HTML of an element. pub trait InnerHtmlAttribute<T> where T: InnerHtmlValue, Self: Sized + AddAnyAttr, { /// Sets the inner HTML of this element. /// /// No children should be given to this element, as this HTML will be used instead. /// /// # Security /// Be very careful when using this method. Always remember to /// sanitize the input to avoid a cross-site scripting (XSS) /// vulnerability. fn inner_html( self, value: T, ) -> <Self as AddAnyAttr>::Output<InnerHtml<T>> { self.add_any_attr(inner_html(value)) } } impl<T, E, At> InnerHtmlAttribute<T> for HtmlElement<E, At, ()> where Self: AddAnyAttr, E: ElementWithChildren, At: Attribute, T: InnerHtmlValue, { fn inner_html( self, value: T, ) -> <Self as AddAnyAttr>::Output<InnerHtml<T>> { self.add_any_attr(inner_html(value)) } } /// A possible value for [`InnerHtml`]. pub trait InnerHtmlValue: Send { /// The type after all async data have resolved. type AsyncOutput: InnerHtmlValue; /// The view state retained between building and rebuilding. type State; /// An equivalent value that can be cloned. type Cloneable: InnerHtmlValue + Clone; /// An equivalent value that can be cloned and is `'static`. type CloneableOwned: InnerHtmlValue + Clone + 'static; /// The estimated length of the HTML. fn html_len(&self) -> usize; /// Renders the class to HTML. fn to_html(self, buf: &mut String); /// Renders the class to HTML for a `<template>`. fn to_template(buf: &mut String); /// Adds interactivity as necessary, given DOM nodes that were created from HTML that has /// either been rendered on the server, or cloned for a `<template>`. fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State; /// Adds this class to the element during client-side rendering. fn build(self, el: &crate::renderer::types::Element) -> Self::State; /// Updates the value. fn rebuild(self, state: &mut Self::State); /// Converts this to a cloneable type. fn into_cloneable(self) -> Self::Cloneable; /// Converts this to a cloneable, owned type. fn into_cloneable_owned(self) -> Self::CloneableOwned; /// “Runs” the attribute without other side effects. For primitive types, this is a no-op. For /// reactive types, this can be used to gather data about reactivity or about asynchronous data /// that needs to be loaded. fn dry_resolve(&mut self); /// “Resolves” this into a type that is not waiting for any asynchronous data. fn resolve(self) -> impl Future<Output = Self::AsyncOutput> + Send; } impl InnerHtmlValue for String { type AsyncOutput = Self; type State = (crate::renderer::types::Element, Self); type Cloneable = Arc<str>; type CloneableOwned = Arc<str>; fn html_len(&self) -> usize { self.len() } fn to_html(self, buf: &mut String) { buf.push_str(&self); } fn to_template(_buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { if !FROM_SERVER { Rndr::set_inner_html(el, &self); } (el.clone(), self) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { Rndr::set_inner_html(el, &self); (el.clone(), self) } fn rebuild(self, state: &mut Self::State) { if self != state.1 { Rndr::set_inner_html(&state.0, &self); state.1 = self; } } fn into_cloneable(self) -> Self::Cloneable { self.into() } fn into_cloneable_owned(self) -> Self::Cloneable { self.into() } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } impl InnerHtmlValue for Arc<str> { type AsyncOutput = Self; type State = (crate::renderer::types::Element, Self); type Cloneable = Self; type CloneableOwned = Self; fn html_len(&self) -> usize { self.len() } fn to_html(self, buf: &mut String) { buf.push_str(&self); } fn to_template(_buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { if !FROM_SERVER { Rndr::set_inner_html(el, &self); } (el.clone(), self) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { Rndr::set_inner_html(el, &self); (el.clone(), self) } fn rebuild(self, state: &mut Self::State) { if self != state.1 { Rndr::set_inner_html(&state.0, &self); state.1 = self; } } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::Cloneable { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } impl InnerHtmlValue for &str { type AsyncOutput = Self; type State = (crate::renderer::types::Element, Self); type Cloneable = Self; type CloneableOwned = Arc<str>; fn html_len(&self) -> usize { self.len() } fn to_html(self, buf: &mut String) { buf.push_str(self); } fn to_template(_buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { if !FROM_SERVER { Rndr::set_inner_html(el, self); } (el.clone(), self) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { Rndr::set_inner_html(el, self); (el.clone(), self) } fn rebuild(self, state: &mut Self::State) { if self != state.1 { Rndr::set_inner_html(&state.0, self); state.1 = self; } } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.into() } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } impl<T> InnerHtmlValue for Option<T> where T: InnerHtmlValue, { type AsyncOutput = Self; type State = (crate::renderer::types::Element, Option<T::State>); type Cloneable = Option<T::Cloneable>; type CloneableOwned = Option<T::CloneableOwned>; fn html_len(&self) -> usize { match self { Some(i) => i.html_len(), None => 0, } } fn to_html(self, buf: &mut String) { if let Some(value) = self { value.to_html(buf); } } fn to_template(_buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { (el.clone(), self.map(|n| n.hydrate::<FROM_SERVER>(el))) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { (el.clone(), self.map(|n| n.build(el))) } fn rebuild(self, state: &mut Self::State) { let new_state = match (self, &mut state.1) { (None, None) => None, (None, Some(_)) => { Rndr::set_inner_html(&state.0, ""); Some(None) } (Some(new), None) => Some(Some(new.build(&state.0))), (Some(new), Some(state)) => { new.rebuild(state); None } }; if let Some(new_state) = new_state { state.1 = new_state; } } fn into_cloneable(self) -> Self::Cloneable { self.map(|inner| inner.into_cloneable()) } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.map(|inner| inner.into_cloneable_owned()) } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/html/element/custom.rs
tachys/src/html/element/custom.rs
use super::ElementWithChildren; use crate::html::element::{ElementType, HtmlElement}; use std::fmt::Debug; /// Creates a custom element. #[track_caller] pub fn custom<E>(tag: E) -> HtmlElement<Custom<E>, (), ()> where E: AsRef<str>, { HtmlElement { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), tag: Custom(tag), attributes: (), children: (), } } /// A custom HTML element. #[derive(Debug, Copy, Clone, PartialEq, Eq)] pub struct Custom<E>(E); impl<E: 'static> ElementType for Custom<E> where E: AsRef<str> + Send, { type Output = web_sys::HtmlElement; const SELF_CLOSING: bool = false; const ESCAPE_CHILDREN: bool = true; const TAG: &'static str = ""; const NAMESPACE: Option<&'static str> = None; fn tag(&self) -> &str { self.0.as_ref() } } impl<E> ElementWithChildren for Custom<E> {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/html/attribute/key.rs
tachys/src/html/attribute/key.rs
use super::{Attr, AttributeValue}; use std::fmt::Debug; /// An HTML attribute key. pub trait AttributeKey: Clone + Send + 'static { /// The name of the attribute. const KEY: &'static str; } macro_rules! attributes { ($(#[$meta:meta] $key:ident $html:literal),* $(,)?) => { paste::paste! { $( #[$meta] #[track_caller] pub fn $key<V>(value: V) -> Attr<[<$key:camel>], V> where V: AttributeValue, { Attr([<$key:camel>], value) } #[$meta] #[derive(Debug, Copy, Clone, PartialEq, Eq, Hash)] pub struct [<$key:camel>]; impl AttributeKey for [<$key:camel>] { const KEY: &'static str = $html; } )* } } } attributes! { // HTML /// The `abbr` attribute specifies an abbreviated form of the element's content. abbr "abbr", /// The `accept-charset` attribute specifies the character encodings that are to be used for the form submission. accept_charset "accept-charset", /// The `accept` attribute specifies a list of types the server accepts, typically a file type. accept "accept", /// The `accesskey` attribute specifies a shortcut key to activate or focus an element. accesskey "accesskey", /// The `action` attribute defines the URL to which the form data will be sent. action "action", /// The `align` attribute specifies the alignment of an element. align "align", /// The `allow` attribute defines a feature policy for the content in an iframe. allow "allow", /// The `allowfullscreen` attribute allows the iframe to be displayed in fullscreen mode. allowfullscreen "allowfullscreen", /// The `allowpaymentrequest` attribute allows a cross-origin iframe to invoke the Payment Request API. allowpaymentrequest "allowpaymentrequest", /// The `alt` attribute provides alternative text for an image, if the image cannot be displayed. alt "alt", // ARIA /// The `aria-activedescendant` attribute identifies the currently active element when DOM focus is on a composite widget, textbox, group, or application. aria_activedescendant "aria-activedescendant", /// The `aria-atomic` attribute indicates whether assistive technologies will present all, or only parts of, the changed region based on the change notifications defined by the aria-relevant attribute. aria_atomic "aria-atomic", /// The `aria-autocomplete` attribute indicates whether user input completion suggestions are provided. aria_autocomplete "aria-autocomplete", /// The `aria-busy` attribute indicates whether an element, and its subtree, are currently being updated. aria_busy "aria-busy", /// The `aria-checked` attribute indicates the current "checked" state of checkboxes, radio buttons, and other widgets. aria_checked "aria-checked", /// The `aria-colcount` attribute defines the total number of columns in a table, grid, or treegrid. aria_colcount "aria-colcount", /// The `aria-colindex` attribute defines an element's column index or position with respect to the total number of columns within a table, grid, or treegrid. aria_colindex "aria-colindex", /// The `aria-colspan` attribute defines the number of columns spanned by a cell or gridcell within a table, grid, or treegrid. aria_colspan "aria-colspan", /// The `aria-controls` attribute identifies the element (or elements) whose contents or presence are controlled by the current element. aria_controls "aria-controls", /// The `aria-current` attribute indicates the element representing the current item within a container or set of related elements. aria_current "aria-current", /// The `aria-describedby` attribute identifies the element (or elements) that describes the object. aria_describedby "aria-describedby", /// The `aria-description` attribute provides a string value that describes or annotates the current element. aria_description "aria-description", /// The `aria-details` attribute identifies the element that provides a detailed, extended description for the object. aria_details "aria-details", /// The `aria-disabled` attribute indicates that the element is perceivable but disabled, so it is not editable or otherwise operable. aria_disabled "aria-disabled", /// The `aria-dropeffect` attribute indicates what functions can be performed when a dragged object is released on the drop target. aria_dropeffect "aria-dropeffect", /// The `aria-errormessage` attribute identifies the element that provides an error message for the object. aria_errormessage "aria-errormessage", /// The `aria-expanded` attribute indicates whether an element, or another grouping element it controls, is currently expanded or collapsed. aria_expanded "aria-expanded", /// The `aria-flowto` attribute identifies the next element (or elements) in an alternate reading order of content. aria_flowto "aria-flowto", /// The `aria-grabbed` attribute indicates an element's "grabbed" state in a drag-and-drop operation. aria_grabbed "aria-grabbed", /// The `aria-haspopup` attribute indicates the availability and type of interactive popup element, such as menu or dialog, that can be triggered by an element. aria_haspopup "aria-haspopup", /// The `aria-hidden` attribute indicates whether the element is exposed to an accessibility API. aria_hidden "aria-hidden", /// The `aria-invalid` attribute indicates the entered value does not conform to the format expected by the application. aria_invalid "aria-invalid", /// The `aria-keyshortcuts` attribute indicates keyboard shortcuts that an author has implemented to activate or give focus to an element. aria_keyshortcuts "aria-keyshortcuts", /// The `aria-label` attribute defines a string value that labels the current element. aria_label "aria-label", /// The `aria-labelledby` attribute identifies the element (or elements) that labels the current element. aria_labelledby "aria-labelledby", /// The `aria-live` attribute indicates that an element will be updated, and describes the types of updates the user agents, assistive technologies, and user can expect from the live region. aria_live "aria-live", /// The `aria-modal` attribute indicates whether an element is modal when displayed. aria_modal "aria-modal", /// The `aria-multiline` attribute indicates whether a text box accepts multiple lines of input or only a single line. aria_multiline "aria-multiline", /// The `aria-multiselectable` attribute indicates that the user may select more than one item from the current selectable descendants. aria_multiselectable "aria-multiselectable", /// The `aria-orientation` attribute indicates whether the element's orientation is horizontal, vertical, or unknown/ambiguous. aria_orientation "aria-orientation", /// The `aria-owns` attribute identifies an element (or elements) in order to define a relationship between the element with `aria-owns` and the target element. aria_owns "aria-owns", /// The `aria-placeholder` attribute defines a short hint (a word or short phrase) intended to aid the user with data entry when the control has no value. aria_placeholder "aria-placeholder", /// The `aria-posinset` attribute defines an element's position within a set or treegrid. aria_posinset "aria-posinset", /// The `aria-pressed` attribute indicates the current "pressed" state of toggle buttons. aria_pressed "aria-pressed", /// The `aria-readonly` attribute indicates that the element is not editable, but is otherwise operable. aria_readonly "aria-readonly", /// The `aria-relevant` attribute indicates what user agent changes to the accessibility tree should be monitored. aria_relevant "aria-relevant", /// The `aria-required` attribute indicates that user input is required on the element before a form may be submitted. aria_required "aria-required", /// The `aria-roledescription` attribute defines a human-readable, author-localized description for the role of an element. aria_roledescription "aria-roledescription", /// The `aria-rowcount` attribute defines the total number of rows in a table, grid, or treegrid. aria_rowcount "aria-rowcount", /// The `aria-rowindex` attribute defines an element's row index or position with respect to the total number of rows within a table, grid, or treegrid. aria_rowindex "aria-rowindex", /// The `aria-rowspan` attribute defines the number of rows spanned by a cell or gridcell within a table, grid, or treegrid. aria_rowspan "aria-rowspan", /// The `aria-selected` attribute indicates the current "selected" state of various widgets. aria_selected "aria-selected", /// The `aria-setsize` attribute defines the number of items in the current set of listitems or treeitems. aria_setsize "aria-setsize", /// The `aria-sort` attribute indicates if items in a table or grid are sorted in ascending or descending order. aria_sort "aria-sort", /// The `aria-valuemax` attribute defines the maximum allowed value for a range widget. aria_valuemax "aria-valuemax", /// The `aria-valuemin` attribute defines the minimum allowed value for a range widget. aria_valuemin "aria-valuemin", /// The `aria-valuenow` attribute defines the current value for a range widget. aria_valuenow "aria-valuenow", /// The `aria-valuetext` attribute defines the human-readable text alternative of aria-valuenow for a range widget. aria_valuetext "aria-valuetext", /// The `as` attribute specifies the type of destination for the content of the link. r#as "as", /// The `async` attribute indicates that the script should be executed asynchronously. r#async "async", /// The `attributionsrc` attribute indicates that you want the browser to send an `Attribution-Reporting-Eligible` header along with a request. attributionsrc "attributionsrc", /// The `autocapitalize` attribute controls whether and how text input is automatically capitalized as it is entered/edited by the user. autocapitalize "autocapitalize", /// The `autocomplete` attribute indicates whether an input field can have its value automatically completed by the browser. autocomplete "autocomplete", /// The `autofocus` attribute indicates that an element should be focused on page load. autofocus "autofocus", /// The `autoplay` attribute indicates that the media should start playing as soon as it is loaded. autoplay "autoplay", /// The `background` attribute sets the URL of the background image for the document. background "background", /// The `bgcolor` attribute sets the background color of an element. bgcolor "bgcolor", /// The `blocking` attribute indicates that the script will block the page loading until it is executed. blocking "blocking", /// The `border` attribute sets the width of an element's border. border "border", /// The `buffered` attribute contains the time ranges that the media has been buffered. buffered "buffered", /// The `capture` attribute indicates that the user must capture media using a camera or microphone instead of selecting a file from the file picker. capture "capture", /// The `challenge` attribute specifies the challenge string that is paired with the keygen element. challenge "challenge", /// The `charset` attribute specifies the character encoding of the HTML document. charset "charset", /// The `checked` attribute indicates whether an input element is checked or not. checked "checked", /// The `cite` attribute contains a URL that points to the source of the quotation or change. cite "cite", // class is handled in ../class.rs instead //class "class", /// The `code` attribute specifies the URL of the applet's class file to be loaded and executed. code "code", /// The `color` attribute specifies the color of an element's text. color "color", /// The `cols` attribute specifies the visible width of a text area. cols "cols", /// The `colspan` attribute defines the number of columns a cell should span. colspan "colspan", /// The `command` attribute defines the command to be invoked when user clicks the `<button>` element which has `commandfor` attribute specified. command "command", /// The `commandfor` attribute defines the id of the element which button is controlling. It is generic version of `popovertarget`. commandfor "commandfor", /// The `content` attribute gives the value associated with the http-equiv or name attribute. content "content", /// The `contenteditable` attribute indicates whether the element's content is editable. contenteditable "contenteditable", /// The `contextmenu` attribute specifies the ID of a `<menu>` element to open as a context menu. contextmenu "contextmenu", /// The `controls` attribute indicates whether the browser should display playback controls for the media. controls "controls", /// The `controlslist` attribute allows the control of which controls to show on the media element whenever the browser shows its native controls. controlslist "controlslist", /// The `coords` attribute specifies the coordinates of an area in an image map. coords "coords", /// The `crossorigin` attribute indicates whether the resource should be fetched with a CORS request. crossorigin "crossorigin", /// The `csp` attribute allows the embedding document to define the Content Security Policy that an embedded document must agree to enforce upon itself. csp "csp", /// The `data` attribute specifies the URL of the resource that is being embedded. data "data", /// The `datetime` attribute specifies the date and time. datetime "datetime", /// The `decoding` attribute indicates the preferred method for decoding images. decoding "decoding", /// The `default` attribute indicates that the track should be enabled unless the user's preferences indicate that another track is more appropriate. default "default", /// The `defer` attribute indicates that the script should be executed after the document has been parsed. defer "defer", /// The `dir` attribute specifies the text direction for the content in an element. dir "dir", /// The `dirname` attribute identifies the text directionality of an input element. dirname "dirname", /// The `disabled` attribute indicates whether the element is disabled. disabled "disabled", /// The `disablepictureinpicture` attribute indicates that the element is not allowed to be displayed in Picture-in-Picture mode. disablepictureinpicture "disablepictureinpicture", /// The `disableremoteplayback` attribute indicates that the element is not allowed to be displayed using remote playback. disableremoteplayback "disableremoteplayback", /// The `download` attribute indicates that the linked resource is intended to be downloaded rather than displayed in the browser. download "download", /// The `draggable` attribute indicates whether the element is draggable. draggable "draggable", /// The `elementtiming` attributes marks the element for observation by the `PerformanceElementTiming` API. elementtiming "elementtiming", /// The `enctype` attribute specifies the MIME type of the form submission. enctype "enctype", /// The `enterkeyhint` attribute allows authors to specify what kind of action label or icon will be presented to users in a virtual keyboard's enter key. enterkeyhint "enterkeyhint", /// The `exportparts` attribute enables the sharing of parts of an element's shadow DOM with a containing document. exportparts "exportparts", /// The `fetchpriority` attribute allows developers to specify the priority of a resource fetch request. fetchpriority "fetchpriority", /// The `for` attribute specifies which form element a label is bound to. r#for "for", /// The `form` attribute associates the element with a form element. form "form", /// The `formaction` attribute specifies the URL that processes the form submission. formaction "formaction", /// The `formenctype` attribute specifies how the form data should be encoded when submitted. formenctype "formenctype", /// The `formmethod` attribute specifies the HTTP method to use when submitting the form. formmethod "formmethod", /// The `formnovalidate` attribute indicates that the form should not be validated when submitted. formnovalidate "formnovalidate", /// The `formtarget` attribute specifies where to display the response after submitting the form. formtarget "formtarget", /// The `headers` attribute specifies the headers associated with the element. headers "headers", /// The `height` attribute specifies the height of an element. height "height", /// The `hidden` attribute indicates that the element is not yet, or is no longer, relevant. hidden "hidden", /// The `high` attribute specifies the range that is considered to be a high value. high "high", /// The `href` attribute specifies the URL of a linked resource. href "href", /// The `hreflang` attribute specifies the language of the linked resource. hreflang "hreflang", /// The `http-equiv` attribute provides an HTTP header for the information/value of the content attribute. http_equiv "http-equiv", /// The `icon` attribute specifies the URL of an image to be used as a graphical icon for the element. icon "icon", /// The `id` attribute specifies a unique id for an element. id "id", /// The `imagesizes` attribute specifies image sizes for different page layouts. imagesizes "imagesizes", /// The `imagesrcset` attribute specifies the URLs of multiple images to be used in different situations. imagesrcset "imagesrcset", /// The `importance` attribute specifies the relative importance of the element. importance "importance", /// The `inert` attribute indicates that the element is non-interactive and won't be accessible to user interactions or assistive technologies. inert "inert", /// The `inputmode` attribute specifies the type of data that the user will enter. inputmode "inputmode", /// The `integrity` attribute contains a hash value that the browser can use to verify that the resource hasn't been altered. integrity "integrity", /// The `intrinsicsize` attribute specifies the intrinsic size of an image or video. intrinsicsize "intrinsicsize", /// The `is` attribute allows you to specify the name of a custom element. is "is", /// The `ismap` attribute indicates that the image is part of a server-side image map. ismap "ismap", /// The `itemid` attribute assigns a unique identifier to an item. itemid "itemid", /// The `itemprop` attribute adds a property to an item. itemprop "itemprop", /// The `itemref` attribute provides a list of element IDs that have additional properties for the item. itemref "itemref", /// The `itemscope` attribute creates a new item and adds it to the page's items. itemscope "itemscope", /// The `itemtype` attribute specifies the type of an item. itemtype "itemtype", /// The `keytype` attribute specifies the type of key used by the `<keygen>` element. keytype "keytype", /// The `kind` attribute specifies the kind of text track. kind "kind", /// The `label` attribute provides a user-readable title for an element. label "label", /// The `lang` attribute specifies the language of the element's content. lang "lang", /// The `language` attribute specifies the scripting language used for the script. language "language", /// The `list` attribute identifies a `<datalist>` element that contains pre-defined options for an `<input>` element. list "list", /// The `loading` attribute indicates how the browser should load the image. loading "loading", /// The `loop` attribute indicates whether the media should start over again when it reaches the end. r#loop "loop", /// The `low` attribute specifies the range that is considered to be a low value. low "low", /// The `manifest` attribute specifies the URL of a document's cache manifest. manifest "manifest", /// The `max` attribute specifies the maximum value for an input element. max "max", /// The `maxlength` attribute specifies the maximum number of characters that an input element can accept. maxlength "maxlength", /// The `media` attribute specifies what media/device the linked resource is optimized for. media "media", /// The `method` attribute specifies the HTTP method to use when submitting the form. method "method", /// The `min` attribute specifies the minimum value for an input element. min "min", /// The `minlength` attribute specifies the minimum number of characters that an input element can accept. minlength "minlength", /// The `multiple` attribute indicates whether the user can enter more than one value. multiple "multiple", /// The `muted` attribute indicates whether the audio will be initially silenced on page load. muted "muted", /// The `name` attribute specifies the name of the element. name "name", /// The `nomodule` attribute indicates that the script should not be executed in browsers that support ES modules. nomodule "nomodule", /// The `nonce` attribute provides a cryptographic nonce to ensure that a script or style is approved for execution. nonce "nonce", /// The `novalidate` attribute indicates that the form should not be validated when submitted. novalidate "novalidate", /// The `open` attribute indicates whether the details element is open or closed. open "open", /// The `optimum` attribute specifies the range that is considered to be an optimum value. optimum "optimum", /// The `part` attribute identifies the element as a shadow DOM part. part "part", /// The `pattern` attribute specifies a regular expression that the input element's value is checked against. pattern "pattern", /// The `ping` attribute contains a space-separated list of URLs to be notified if the user follows the hyperlink. ping "ping", /// The `placeholder` attribute provides a short hint that describes the expected value of the input element. placeholder "placeholder", /// The `playsinline` attribute indicates that the video should play inline in the element's playback area. playsinline "playsinline", /// The `popover` attribute indicates that an element is a popover and specifies the event that causes the popover to be shown. popover "popover", /// The `popovertarget` attribute specifies the ID of an element to toggle a popover. popovertarget "popovertarget", /// The `popovertargetaction` attribute specifies the action that shows the popover. popovertargetaction "popovertargetaction", /// The `poster` attribute specifies an image to be shown while the video is downloading or until the user hits the play button. poster "poster", /// The `preload` attribute specifies if and how the author thinks that the media file should be loaded when the page loads. preload "preload", /// The `radiogroup` attribute specifies the name of the group to which the element belongs. radiogroup "radiogroup", /// The `readonly` attribute indicates that the user cannot modify the value of the input element. readonly "readonly", /// The `referrerpolicy` attribute specifies which referrer information to include with requests. referrerpolicy "referrerpolicy", /// The `rel` attribute specifies the relationship between the current document and the linked document. rel "rel", /// The `required` attribute indicates that the user must fill in the input element before submitting the form. required "required", /// The `reversed` attribute indicates that the list should be displayed in a descending order. reversed "reversed", /// The `role` attribute defines the role of an element in the context of a web application. role "role", /// The `rows` attribute specifies the number of visible text lines for a text area. rows "rows", /// The `rowspan` attribute defines the number of rows a cell should span. rowspan "rowspan", /// The `sandbox` attribute applies extra restrictions to the content in the `<iframe>`. sandbox "sandbox", /// The `scope` attribute specifies whether a header cell is a header for a column, row, or group of columns or rows. scope "scope", /// The `scoped` attribute indicates that the styles in a `<style>` element are scoped to the parent element. scoped "scoped", /// The `selected` attribute indicates that the option is selected. selected "selected", /// The `shape` attribute specifies the shape of the area. shape "shape", /// The `size` attribute specifies the width of the input element. size "size", /// The `sizes` attribute specifies the sizes of icons for visual media. sizes "sizes", /// The `slot` attribute assigns a slot to an element. slot "slot", /// The `span` attribute defines the number of columns in a `<colgroup>` or the number of rows in a `<rowgroup>`. span "span", /// The `spellcheck` attribute indicates whether spell checking is allowed for the element. spellcheck "spellcheck", /// The `src` attribute specifies the URL of the media resource. src "src", /// The `srcdoc` attribute specifies the HTML content of the page to show in the `<iframe>`. srcdoc "srcdoc", /// The `srclang` attribute specifies the language of the text track. srclang "srclang", /// The `srcset` attribute specifies the URLs of multiple images to be used in different situations. srcset "srcset", /// The `start` attribute specifies the start value of the list. start "start", /// The `step` attribute specifies the legal number intervals for an input element. step "step", // style is handled in ../style.rs instead // style "style", /// The `summary` attribute provides a summary of the content of the table. summary "summary", /// The `tabindex` attribute specifies the tab order of an element. tabindex "tabindex", /// The `target` attribute specifies where to open the linked document. target "target", /// The `title` attribute provides additional information about an element. title "title", /// The `translate` attribute specifies whether the content of an element should be translated or not. translate "translate", /// The `type` attribute specifies the type of the element. r#type "type", /// The `usemap` attribute specifies the image map to be used by an `<img>` element. usemap "usemap", /// The `value` attribute specifies the value of the element. value "value", /// The `virtualkeyboardpolicy` attribute controls the policy for virtual keyboards. virtualkeyboardpolicy "virtualkeyboardpolicy", /// The `width` attribute specifies the width of an element. width "width", /// The `wrap` attribute specifies how the text in a text area is to be wrapped when submitted in a form. wrap "wrap", // Event Handler Attributes /// The `onabort` attribute specifies the event handler for the abort event. onabort "onabort", /// The `onautocomplete` attribute specifies the event handler for the autocomplete event. onautocomplete "onautocomplete", /// The `onautocompleteerror` attribute specifies the event handler for the autocompleteerror event. onautocompleteerror "onautocompleteerror", /// The `onblur` attribute specifies the event handler for the blur event. onblur "onblur", /// The `oncancel` attribute specifies the event handler for the cancel event. oncancel "oncancel", /// The `oncanplay` attribute specifies the event handler for the canplay event. oncanplay "oncanplay", /// The `oncanplaythrough` attribute specifies the event handler for the canplaythrough event. oncanplaythrough "oncanplaythrough", /// The `onchange` attribute specifies the event handler for the change event. onchange "onchange", /// The `onclick` attribute specifies the event handler for the click event. onclick "onclick", /// The `onclose` attribute specifies the event handler for the close event. onclose "onclose", /// The `oncontextmenu` attribute specifies the event handler for the contextmenu event. oncontextmenu "oncontextmenu", /// The `oncuechange` attribute specifies the event handler for the cuechange event. oncuechange "oncuechange", /// The `ondblclick` attribute specifies the event handler for the double click event. ondblclick "ondblclick", /// The `ondrag` attribute specifies the event handler for the drag event. ondrag "ondrag", /// The `ondragend` attribute specifies the event handler for the dragend event. ondragend "ondragend", /// The `ondragenter` attribute specifies the event handler for the dragenter event. ondragenter "ondragenter", /// The `ondragleave` attribute specifies the event handler for the dragleave event. ondragleave "ondragleave", /// The `ondragover` attribute specifies the event handler for the dragover event. ondragover "ondragover", /// The `ondragstart` attribute specifies the event handler for the dragstart event. ondragstart "ondragstart", /// The `ondrop` attribute specifies the event handler for the drop event. ondrop "ondrop", /// The `ondurationchange` attribute specifies the event handler for the durationchange event. ondurationchange "ondurationchange", /// The `onemptied` attribute specifies the event handler for the emptied event. onemptied "onemptied", /// The `onended` attribute specifies the event handler for the ended event. onended "onended", /// The `onerror` attribute specifies the event handler for the error event. onerror "onerror", /// The `onfocus` attribute specifies the event handler for the focus event. onfocus "onfocus", /// The `onformdata` attribute specifies the event handler for the formdata event. onformdata "onformdata", /// The `oninput` attribute specifies the event handler for the input event. oninput "oninput", /// The `oninvalid` attribute specifies the event handler for the invalid event. oninvalid "oninvalid", /// The `onkeydown` attribute specifies the event handler for the keydown event. onkeydown "onkeydown", /// The `onkeypress` attribute specifies the event handler for the keypress event. onkeypress "onkeypress", /// The `onkeyup` attribute specifies the event handler for the keyup event. onkeyup "onkeyup", /// The `onlanguagechange` attribute specifies the event handler for the languagechange event. onlanguagechange "onlanguagechange", /// The `onload` attribute specifies the event handler for the load event. onload "onload", /// The `onloadeddata` attribute specifies the event handler for the loadeddata event. onloadeddata "onloadeddata", /// The `onloadedmetadata` attribute specifies the event handler for the loadedmetadata event. onloadedmetadata "onloadedmetadata", /// The `onloadstart` attribute specifies the event handler for the loadstart event. onloadstart "onloadstart", /// The `onmousedown` attribute specifies the event handler for the mousedown event. onmousedown "onmousedown", /// The `onmouseenter` attribute specifies the event handler for the mouseenter event. onmouseenter "onmouseenter", /// The `onmouseleave` attribute specifies the event handler for the mouseleave event. onmouseleave "onmouseleave", /// The `onmousemove` attribute specifies the event handler for the mousemove event. onmousemove "onmousemove", /// The `onmouseout` attribute specifies the event handler for the mouseout event. onmouseout "onmouseout", /// The `onmouseover` attribute specifies the event handler for the mouseover event. onmouseover "onmouseover", /// The `onmouseup` attribute specifies the event handler for the mouseup event. onmouseup "onmouseup",
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
true
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/html/attribute/global.rs
tachys/src/html/attribute/global.rs
use super::Lang; use crate::{ html::{ attribute::*, class::{class, Class, IntoClass}, element::{ElementType, HasElementType, HtmlElement}, event::{on, on_target, EventDescriptor, On, Targeted}, property::{prop, IntoProperty, Property}, style::{style, IntoStyle, Style}, }, prelude::RenderHtml, view::add_attr::AddAnyAttr, }; use core::convert::From; /// Adds an attribute that modifies the `class`. pub trait ClassAttribute<C> where C: IntoClass, { /// The type of the element with the new attribute added. type Output; /// Adds a CSS class to an element. fn class(self, value: C) -> Self::Output; } impl<E, At, Ch, C> ClassAttribute<C> for HtmlElement<E, At, Ch> where E: ElementType + Send, At: Attribute + Send, Ch: RenderHtml + Send, C: IntoClass, { type Output = <Self as AddAnyAttr>::Output<Class<C>>; fn class(self, value: C) -> Self::Output { self.add_any_attr(class(value)) } } /// Adds an attribute that modifies the DOM properties. pub trait PropAttribute<K, P> where P: IntoProperty, { /// The type of the element with the new attribute added. type Output; /// Adds a DOM property to an element. fn prop(self, key: K, value: P) -> Self::Output; } impl<E, At, Ch, K, P> PropAttribute<K, P> for HtmlElement<E, At, Ch> where E: ElementType + Send, At: Attribute + Send, Ch: RenderHtml + Send, K: AsRef<str> + Send, P: IntoProperty, { type Output = <Self as AddAnyAttr>::Output<Property<K, P>>; fn prop(self, key: K, value: P) -> Self::Output { self.add_any_attr(prop(key, value)) } } /// Adds an attribute that modifies the CSS styles. pub trait StyleAttribute<S> where S: IntoStyle, { /// The type of the element with the new attribute added. type Output; /// Adds a CSS style to an element. fn style(self, value: S) -> Self::Output; } impl<E, At, Ch, S> StyleAttribute<S> for HtmlElement<E, At, Ch> where E: ElementType + Send, At: Attribute + Send, Ch: RenderHtml + Send, S: IntoStyle, { type Output = <Self as AddAnyAttr>::Output<Style<S>>; fn style(self, value: S) -> Self::Output { self.add_any_attr(style(value)) } } /// Adds an event listener to an element definition. pub trait OnAttribute<E, F> { /// The type of the element with the event listener added. type Output; /// Adds an event listener to an element. fn on(self, event: E, cb: F) -> Self::Output; } impl<El, At, Ch, E, F> OnAttribute<E, F> for HtmlElement<El, At, Ch> where El: ElementType + Send, At: Attribute + Send, Ch: RenderHtml + Send, E: EventDescriptor + Send + 'static, E::EventType: 'static, E::EventType: From<crate::renderer::types::Event>, F: FnMut(E::EventType) + 'static, { type Output = <Self as AddAnyAttr>::Output<On<E, F>>; fn on(self, event: E, cb: F) -> Self::Output { self.add_any_attr(on(event, cb)) } } /// Adds an event listener with a typed target to an element definition. pub trait OnTargetAttribute<E, F, T> { /// The type of the element with the new attribute added. type Output; /// Adds an event listener with a typed target to an element definition. fn on_target(self, event: E, cb: F) -> Self::Output; } impl<El, At, Ch, E, F> OnTargetAttribute<E, F, Self> for HtmlElement<El, At, Ch> where El: ElementType + Send, At: Attribute + Send, Ch: RenderHtml + Send, E: EventDescriptor + Send + 'static, E::EventType: 'static, E::EventType: From<crate::renderer::types::Event>, F: FnMut(Targeted<E::EventType, <Self as HasElementType>::ElementType>) + 'static, { type Output = <Self as AddAnyAttr>::Output<On<E, Box<dyn FnMut(E::EventType)>>>; fn on_target(self, event: E, cb: F) -> Self::Output { self.add_any_attr(on_target::<E, HtmlElement<El, At, Ch>, F>(event, cb)) } } /// Global attributes can be added to any HTML element. pub trait GlobalAttributes<V> where Self: Sized + AddAnyAttr, V: AttributeValue, { /// The `accesskey` global attribute provides a hint for generating a keyboard shortcut for the current element. fn accesskey( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Accesskey, V>> { self.add_any_attr(accesskey(value)) } /// The `autocapitalize` global attribute controls whether and how text input is automatically capitalized as it is entered/edited by the user. fn autocapitalize( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Autocapitalize, V>> { self.add_any_attr(autocapitalize(value)) } /// The `autofocus` global attribute is a Boolean attribute indicating that an element should receive focus as soon as the page is loaded. fn autofocus( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Autofocus, V>> { self.add_any_attr(autofocus(value)) } /// The `contenteditable` global attribute is an enumerated attribute indicating if the element should be editable by the user. fn contenteditable( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Contenteditable, V>> { self.add_any_attr(contenteditable(value)) } /// The `dir` global attribute is an enumerated attribute indicating the directionality of the element's text. fn dir(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Dir, V>> { self.add_any_attr(dir(value)) } /// The `draggable` global attribute is an enumerated attribute indicating whether the element can be dragged. fn draggable( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Draggable, V>> { self.add_any_attr(draggable(value)) } /// The `enterkeyhint` global attribute is used to customize the enter key on virtual keyboards. fn enterkeyhint( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Enterkeyhint, V>> { self.add_any_attr(enterkeyhint(value)) } /// The `exportparts` attribute enables the sharing of parts of an element's shadow DOM with a containing document. fn exportparts( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Exportparts, V>> { self.add_any_attr(exportparts(value)) } /// The `hidden` global attribute is a Boolean attribute indicating that the element is not yet, or is no longer, relevant. fn hidden(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Hidden, V>> { self.add_any_attr(hidden(value)) } /// The `id` global attribute defines a unique identifier (ID) which must be unique in the whole document. fn id(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Id, V>> { self.add_any_attr(id(value)) } /// The `inert` global attribute is a Boolean attribute that makes an element behave inertly. fn inert(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Inert, V>> { self.add_any_attr(inert(value)) } /// The `inputmode` global attribute provides a hint to browsers for which virtual keyboard to display. fn inputmode( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Inputmode, V>> { self.add_any_attr(inputmode(value)) } /// The `is` global attribute allows you to specify that a standard HTML element should behave like a custom built-in element. fn is(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Is, V>> { self.add_any_attr(is(value)) } /// The `itemid` global attribute is used to specify the unique, global identifier of an item. fn itemid(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Itemid, V>> { self.add_any_attr(itemid(value)) } /// The `itemprop` global attribute is used to add properties to an item. fn itemprop( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Itemprop, V>> { self.add_any_attr(itemprop(value)) } /// The `itemref` global attribute is used to refer to other elements. fn itemref( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Itemref, V>> { self.add_any_attr(itemref(value)) } /// The `itemscope` global attribute is used to create a new item. fn itemscope( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Itemscope, V>> { self.add_any_attr(itemscope(value)) } /// The `itemtype` global attribute is used to specify the types of items. fn itemtype( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Itemtype, V>> { self.add_any_attr(itemtype(value)) } /// The `lang` global attribute helps define the language of an element. fn lang(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Lang, V>> { self.add_any_attr(lang(value)) } /// The `nonce` global attribute is used to specify a cryptographic nonce. fn nonce(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Nonce, V>> { self.add_any_attr(nonce(value)) } /// The `part` global attribute identifies the element as a part of a component. fn part(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Part, V>> { self.add_any_attr(part(value)) } /// The `popover` global attribute defines the popover's behavior. fn popover( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Popover, V>> { self.add_any_attr(popover(value)) } /// The `role` global attribute defines the role of an element in ARIA. fn role(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Role, V>> { self.add_any_attr(role(value)) } /// The `slot` global attribute assigns a slot in a shadow DOM. fn slot(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Slot, V>> { self.add_any_attr(slot(value)) } /// The `spellcheck` global attribute is an enumerated attribute that defines whether the element may be checked for spelling errors. fn spellcheck( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Spellcheck, V>> { self.add_any_attr(spellcheck(value)) } /// The `tabindex` global attribute indicates if the element can take input focus. fn tabindex( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Tabindex, V>> { self.add_any_attr(tabindex(value)) } /// The `title` global attribute contains text representing advisory information. fn title(self, value: V) -> <Self as AddAnyAttr>::Output<Attr<Title, V>> { self.add_any_attr(title(value)) } /// The `translate` global attribute is an enumerated attribute that specifies whether an element's attribute values and text content should be translated when the page is localized. fn translate( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Translate, V>> { self.add_any_attr(translate(value)) } /// The `virtualkeyboardpolicy` global attribute specifies the behavior of the virtual keyboard. fn virtualkeyboardpolicy( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<Virtualkeyboardpolicy, V>> { self.add_any_attr(virtualkeyboardpolicy(value)) } } impl<El, At, Ch, V> GlobalAttributes<V> for HtmlElement<El, At, Ch> where El: ElementType + Send, At: Attribute + Send, Ch: RenderHtml + Send, V: AttributeValue, { } macro_rules! on_definitions { ($(#[$meta:meta] $key:ident $html:literal),* $(,)?) => { paste::paste! { $( #[doc = concat!("Adds the HTML `", $html, "` attribute to the element.\n\n**Note**: This is the HTML attribute, which takes a JavaScript string, not an `on:` listener that takes application logic written in Rust.")] #[track_caller] fn $key( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<[<$key:camel>], V>> { self.add_any_attr($key(value)) } )* } } } /// Provides methods for HTML event listener attributes. pub trait GlobalOnAttributes<V> where Self: Sized + AddAnyAttr, V: AttributeValue, { on_definitions! { /// The `onabort` attribute specifies the event handler for the abort event. onabort "onabort", /// The `onautocomplete` attribute specifies the event handler for the autocomplete event. onautocomplete "onautocomplete", /// The `onautocompleteerror` attribute specifies the event handler for the autocompleteerror event. onautocompleteerror "onautocompleteerror", /// The `onblur` attribute specifies the event handler for the blur event. onblur "onblur", /// The `oncancel` attribute specifies the event handler for the cancel event. oncancel "oncancel", /// The `oncanplay` attribute specifies the event handler for the canplay event. oncanplay "oncanplay", /// The `oncanplaythrough` attribute specifies the event handler for the canplaythrough event. oncanplaythrough "oncanplaythrough", /// The `onchange` attribute specifies the event handler for the change event. onchange "onchange", /// The `onclick` attribute specifies the event handler for the click event. onclick "onclick", /// The `onclose` attribute specifies the event handler for the close event. onclose "onclose", /// The `oncontextmenu` attribute specifies the event handler for the contextmenu event. oncontextmenu "oncontextmenu", /// The `oncuechange` attribute specifies the event handler for the cuechange event. oncuechange "oncuechange", /// The `ondblclick` attribute specifies the event handler for the double click event. ondblclick "ondblclick", /// The `ondrag` attribute specifies the event handler for the drag event. ondrag "ondrag", /// The `ondragend` attribute specifies the event handler for the dragend event. ondragend "ondragend", /// The `ondragenter` attribute specifies the event handler for the dragenter event. ondragenter "ondragenter", /// The `ondragleave` attribute specifies the event handler for the dragleave event. ondragleave "ondragleave", /// The `ondragover` attribute specifies the event handler for the dragover event. ondragover "ondragover", /// The `ondragstart` attribute specifies the event handler for the dragstart event. ondragstart "ondragstart", /// The `ondrop` attribute specifies the event handler for the drop event. ondrop "ondrop", /// The `ondurationchange` attribute specifies the event handler for the durationchange event. ondurationchange "ondurationchange", /// The `onemptied` attribute specifies the event handler for the emptied event. onemptied "onemptied", /// The `onended` attribute specifies the event handler for the ended event. onended "onended", /// The `onerror` attribute specifies the event handler for the error event. onerror "onerror", /// The `onfocus` attribute specifies the event handler for the focus event. onfocus "onfocus", /// The `onformdata` attribute specifies the event handler for the formdata event. onformdata "onformdata", /// The `oninput` attribute specifies the event handler for the input event. oninput "oninput", /// The `oninvalid` attribute specifies the event handler for the invalid event. oninvalid "oninvalid", /// The `onkeydown` attribute specifies the event handler for the keydown event. onkeydown "onkeydown", /// The `onkeypress` attribute specifies the event handler for the keypress event. onkeypress "onkeypress", /// The `onkeyup` attribute specifies the event handler for the keyup event. onkeyup "onkeyup", /// The `onlanguagechange` attribute specifies the event handler for the languagechange event. onlanguagechange "onlanguagechange", /// The `onload` attribute specifies the event handler for the load event. onload "onload", /// The `onloadeddata` attribute specifies the event handler for the loadeddata event. onloadeddata "onloadeddata", /// The `onloadedmetadata` attribute specifies the event handler for the loadedmetadata event. onloadedmetadata "onloadedmetadata", /// The `onloadstart` attribute specifies the event handler for the loadstart event. onloadstart "onloadstart", /// The `onmousedown` attribute specifies the event handler for the mousedown event. onmousedown "onmousedown", /// The `onmouseenter` attribute specifies the event handler for the mouseenter event. onmouseenter "onmouseenter", /// The `onmouseleave` attribute specifies the event handler for the mouseleave event. onmouseleave "onmouseleave", /// The `onmousemove` attribute specifies the event handler for the mousemove event. onmousemove "onmousemove", /// The `onmouseout` attribute specifies the event handler for the mouseout event. onmouseout "onmouseout", /// The `onmouseover` attribute specifies the event handler for the mouseover event. onmouseover "onmouseover", /// The `onmouseup` attribute specifies the event handler for the mouseup event. onmouseup "onmouseup", /// The `onpause` attribute specifies the event handler for the pause event. onpause "onpause", /// The `onplay` attribute specifies the event handler for the play event. onplay "onplay", /// The `onplaying` attribute specifies the event handler for the playing event. onplaying "onplaying", /// The `onprogress` attribute specifies the event handler for the progress event. onprogress "onprogress", /// The `onratechange` attribute specifies the event handler for the ratechange event. onratechange "onratechange", /// The `onreset` attribute specifies the event handler for the reset event. onreset "onreset", /// The `onresize` attribute specifies the event handler for the resize event. onresize "onresize", /// The `onscroll` attribute specifies the event handler for the scroll event. onscroll "onscroll", /// The `onsecuritypolicyviolation` attribute specifies the event handler for the securitypolicyviolation event. onsecuritypolicyviolation "onsecuritypolicyviolation", /// The `onseeked` attribute specifies the event handler for the seeked event. onseeked "onseeked", /// The `onseeking` attribute specifies the event handler for the seeking event. onseeking "onseeking", /// The `onselect` attribute specifies the event handler for the select event. onselect "onselect", /// The `onslotchange` attribute specifies the event handler for the slotchange event. onslotchange "onslotchange", /// The `onstalled` attribute specifies the event handler for the stalled event. onstalled "onstalled", /// The `onsubmit` attribute specifies the event handler for the submit event. onsubmit "onsubmit", /// The `onsuspend` attribute specifies the event handler for the suspend event. onsuspend "onsuspend", /// The `ontimeupdate` attribute specifies the event handler for the timeupdate event. ontimeupdate "ontimeupdate", /// The `ontoggle` attribute specifies the event handler for the toggle event. ontoggle "ontoggle", /// The `onvolumechange` attribute specifies the event handler for the volumechange event. onvolumechange "onvolumechange", /// The `onwaiting` attribute specifies the event handler for the waiting event. onwaiting "onwaiting", /// The `onwebkitanimationend` attribute specifies the event handler for the webkitanimationend event. onwebkitanimationend "onwebkitanimationend", /// The `onwebkitanimationiteration` attribute specifies the event handler for the webkitanimationiteration event. onwebkitanimationiteration "onwebkitanimationiteration", /// The `onwebkitanimationstart` attribute specifies the event handler for the webkitanimationstart event. onwebkitanimationstart "onwebkitanimationstart", /// The `onwebkittransitionend` attribute specifies the event handler for the webkittransitionend event. onwebkittransitionend "onwebkittransitionend", /// The `onwheel` attribute specifies the event handler for the wheel event. onwheel "onwheel", } } impl<El, At, Ch, V> GlobalOnAttributes<V> for HtmlElement<El, At, Ch> where El: ElementType + Send, At: Attribute + Send, Ch: RenderHtml + Send, V: AttributeValue, { }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/html/attribute/aria.rs
tachys/src/html/attribute/aria.rs
use crate::{ html::{ attribute::{Attr, *}, element::{ElementType, HtmlElement}, }, renderer::Rndr, view::{add_attr::AddAnyAttr, RenderHtml}, }; /// Applies ARIA attributes to an HTML element. pub trait AriaAttributes<Rndr, V> where Self: Sized + AddAnyAttr, V: AttributeValue, { /// Identifies the currently active descendant of a composite widget. fn aria_activedescendant( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaActivedescendant, V>> { self.add_any_attr(aria_activedescendant(value)) } /// Indicates whether assistive technologies will present all, or only parts of, the changed region based on the change notifications defined by the `aria-relevant` attribute. fn aria_atomic( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaAtomic, V>> { self.add_any_attr(aria_atomic(value)) } /// Indicates whether user input completion suggestions are provided. fn aria_autocomplete( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaAutocomplete, V>> { self.add_any_attr(aria_autocomplete(value)) } /// Indicates whether an element, and its subtree, are currently being updated. fn aria_busy( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaBusy, V>> { self.add_any_attr(aria_busy(value)) } /// Indicates the current "checked" state of checkboxes, radio buttons, and other widgets. fn aria_checked( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaChecked, V>> { self.add_any_attr(aria_checked(value)) } /// Defines the number of columns in a table, grid, or treegrid. fn aria_colcount( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaColcount, V>> { self.add_any_attr(aria_colcount(value)) } /// Defines an element's column index or position with respect to the total number of columns within a table, grid, or treegrid. fn aria_colindex( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaColindex, V>> { self.add_any_attr(aria_colindex(value)) } /// Defines the number of columns spanned by a cell or gridcell within a table, grid, or treegrid. fn aria_colspan( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaColspan, V>> { self.add_any_attr(aria_colspan(value)) } /// Identifies the element (or elements) whose contents or presence are controlled by the current element. fn aria_controls( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaControls, V>> { self.add_any_attr(aria_controls(value)) } /// Indicates the element that represents the current item within a container or set of related elements. fn aria_current( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaCurrent, V>> { self.add_any_attr(aria_current(value)) } /// Identifies the element (or elements) that describes the object. fn aria_describedby( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaDescribedby, V>> { self.add_any_attr(aria_describedby(value)) } /// Defines a string value that describes or annotates the current element. fn aria_description( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaDescription, V>> { self.add_any_attr(aria_description(value)) } /// Identifies the element that provides additional information related to the object. fn aria_details( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaDetails, V>> { self.add_any_attr(aria_details(value)) } /// Indicates that the element is perceivable but disabled, so it is not editable or otherwise operable. fn aria_disabled( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaDisabled, V>> { self.add_any_attr(aria_disabled(value)) } /// Indicates what functions can be performed when a dragged object is released on the drop target. fn aria_dropeffect( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaDropeffect, V>> { self.add_any_attr(aria_dropeffect(value)) } /// Defines the element that provides an error message related to the object. fn aria_errormessage( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaErrormessage, V>> { self.add_any_attr(aria_errormessage(value)) } /// Indicates whether the element, or another grouping element it controls, is currently expanded or collapsed. fn aria_expanded( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaExpanded, V>> { self.add_any_attr(aria_expanded(value)) } /// Identifies the next element (or elements) in an alternate reading order of content. fn aria_flowto( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaFlowto, V>> { self.add_any_attr(aria_flowto(value)) } /// Indicates an element's "grabbed" state in a drag-and-drop operation. fn aria_grabbed( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaGrabbed, V>> { self.add_any_attr(aria_grabbed(value)) } /// Indicates the availability and type of interactive popup element, such as menu or dialog, that can be triggered by an element. fn aria_haspopup( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaHaspopup, V>> { self.add_any_attr(aria_haspopup(value)) } /// Indicates whether the element is exposed to an accessibility API. fn aria_hidden( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaHidden, V>> { self.add_any_attr(aria_hidden(value)) } /// Indicates the entered value does not conform to the format expected by the application. fn aria_invalid( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaInvalid, V>> { self.add_any_attr(aria_invalid(value)) } /// Indicates keyboard shortcuts that an author has implemented to activate or give focus to an element. fn aria_keyshortcuts( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaKeyshortcuts, V>> { self.add_any_attr(aria_keyshortcuts(value)) } /// Defines a string value that labels the current element. fn aria_label( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaLabel, V>> { self.add_any_attr(aria_label(value)) } /// Identifies the element (or elements) that labels the current element. fn aria_labelledby( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaLabelledby, V>> { self.add_any_attr(aria_labelledby(value)) } /// Indicates that an element will be updated, and describes the types of updates the user agents, assistive technologies, and user can expect from the live region. fn aria_live( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaLive, V>> { self.add_any_attr(aria_live(value)) } /// Indicates whether an element is modal when displayed. fn aria_modal( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaModal, V>> { self.add_any_attr(aria_modal(value)) } /// Indicates whether a text box accepts multiple lines of input or only a single line. fn aria_multiline( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaMultiline, V>> { self.add_any_attr(aria_multiline(value)) } /// Indicates that the user may select more than one item from the current selectable descendants. fn aria_multiselectable( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaMultiselectable, V>> { self.add_any_attr(aria_multiselectable(value)) } /// Indicates whether the element's orientation is horizontal, vertical, or undefined. fn aria_orientation( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaOrientation, V>> { self.add_any_attr(aria_orientation(value)) } /// Identifies an element (or elements) in order to define a visual, functional, or contextual parent/child relationship between DOM elements where the DOM hierarchy cannot be used to represent the relationship. fn aria_owns( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaOwns, V>> { self.add_any_attr(aria_owns(value)) } /// Defines a short hint (a word or short phrase) intended to help the user with data entry when the control has no value. fn aria_placeholder( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaPlaceholder, V>> { self.add_any_attr(aria_placeholder(value)) } /// Defines an element's number or position in the current set of listitems or treeitems. fn aria_posinset( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaPosinset, V>> { self.add_any_attr(aria_posinset(value)) } /// Indicates the current "pressed" state of toggle buttons. fn aria_pressed( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaPressed, V>> { self.add_any_attr(aria_pressed(value)) } /// Indicates that the element is not editable, but is otherwise operable. fn aria_readonly( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaReadonly, V>> { self.add_any_attr(aria_readonly(value)) } /// Indicates what notifications the user agent will trigger when the accessibility tree within a live region is modified. fn aria_relevant( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaRelevant, V>> { self.add_any_attr(aria_relevant(value)) } /// Indicates that user input is required on the element before a form may be submitted. fn aria_required( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaRequired, V>> { self.add_any_attr(aria_required(value)) } /// Defines a human-readable, author-localized description for the role of an element. fn aria_roledescription( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaRoledescription, V>> { self.add_any_attr(aria_roledescription(value)) } /// Defines the total number of rows in a table, grid, or treegrid. fn aria_rowcount( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaRowcount, V>> { self.add_any_attr(aria_rowcount(value)) } /// Defines an element's row index or position with respect to the total number of rows within a table, grid, or treegrid. fn aria_rowindex( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaRowindex, V>> { self.add_any_attr(aria_rowindex(value)) } /// Defines the number of rows spanned by a cell or gridcell within a table, grid, or treegrid. fn aria_rowspan( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaRowspan, V>> { self.add_any_attr(aria_rowspan(value)) } /// Indicates the current "selected" state of various widgets. fn aria_selected( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaSelected, V>> { self.add_any_attr(aria_selected(value)) } /// Defines the number of items in the current set of listitems or treeitems. fn aria_setsize( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaSetsize, V>> { self.add_any_attr(aria_setsize(value)) } /// Indicates if items in a table or grid are sorted in ascending or descending order. fn aria_sort( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaSort, V>> { self.add_any_attr(aria_sort(value)) } /// Defines the maximum allowed value for a range widget. fn aria_valuemax( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaValuemax, V>> { self.add_any_attr(aria_valuemax(value)) } /// Defines the minimum allowed value for a range widget. fn aria_valuemin( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaValuemin, V>> { self.add_any_attr(aria_valuemin(value)) } /// Defines the current value for a range widget. fn aria_valuenow( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaValuenow, V>> { self.add_any_attr(aria_valuenow(value)) } /// Defines the human-readable text alternative of `aria-valuenow` for a range widget. fn aria_valuetext( self, value: V, ) -> <Self as AddAnyAttr>::Output<Attr<AriaValuetext, V>> { self.add_any_attr(aria_valuetext(value)) } } impl<El, At, Ch, V> AriaAttributes<Rndr, V> for HtmlElement<El, At, Ch> where El: ElementType + Send, At: Attribute + Send, Ch: RenderHtml + Send, V: AttributeValue, { }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/html/attribute/any_attribute.rs
tachys/src/html/attribute/any_attribute.rs
use super::{Attribute, NextAttribute}; use crate::{ erased::{Erased, ErasedLocal}, html::attribute::NamedAttributeKey, renderer::{dom::Element, Rndr}, }; use std::{any::TypeId, fmt::Debug, mem}; #[cfg(feature = "ssr")] use std::{future::Future, pin::Pin}; /// A type-erased container for any [`Attribute`]. pub struct AnyAttribute { type_id: TypeId, html_len: usize, value: Erased, clone: fn(&Erased) -> AnyAttribute, #[cfg(feature = "ssr")] to_html: fn(Erased, &mut String, &mut String, &mut String, &mut String), build: fn(Erased, el: crate::renderer::types::Element) -> AnyAttributeState, rebuild: fn(Erased, &mut AnyAttributeState), #[cfg(feature = "hydrate")] hydrate_from_server: fn(Erased, crate::renderer::types::Element) -> AnyAttributeState, #[cfg(feature = "hydrate")] hydrate_from_template: fn(Erased, crate::renderer::types::Element) -> AnyAttributeState, #[cfg(feature = "ssr")] #[allow(clippy::type_complexity)] resolve: fn(Erased) -> Pin<Box<dyn Future<Output = AnyAttribute> + Send>>, #[cfg(feature = "ssr")] dry_resolve: fn(&mut Erased), keys: fn(&Erased) -> Vec<NamedAttributeKey>, } impl Clone for AnyAttribute { fn clone(&self) -> Self { (self.clone)(&self.value) } } impl Debug for AnyAttribute { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("AnyAttribute").finish_non_exhaustive() } } /// View state for [`AnyAttribute`]. pub struct AnyAttributeState { type_id: TypeId, state: ErasedLocal, el: crate::renderer::types::Element, keys: Vec<NamedAttributeKey>, } /// Converts an [`Attribute`] into [`AnyAttribute`]. pub trait IntoAnyAttribute { /// Wraps the given attribute. fn into_any_attr(self) -> AnyAttribute; } impl<T> IntoAnyAttribute for T where Self: Send, T: Attribute, crate::renderer::types::Element: Clone, { fn into_any_attr(self) -> AnyAttribute { fn clone<T: Attribute + Clone + 'static>( value: &Erased, ) -> AnyAttribute { value.get_ref::<T>().clone().into_any_attr() } #[cfg(feature = "ssr")] fn to_html<T: Attribute + 'static>( value: Erased, buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, ) { value .into_inner::<T>() .to_html(buf, class, style, inner_html); } fn build<T: Attribute + 'static>( value: Erased, el: crate::renderer::types::Element, ) -> AnyAttributeState { AnyAttributeState { type_id: TypeId::of::<T>(), keys: value.get_ref::<T>().keys(), state: ErasedLocal::new(value.into_inner::<T>().build(&el)), el, } } #[cfg(feature = "hydrate")] fn hydrate_from_server<T: Attribute + 'static>( value: Erased, el: crate::renderer::types::Element, ) -> AnyAttributeState { AnyAttributeState { type_id: TypeId::of::<T>(), keys: value.get_ref::<T>().keys(), state: ErasedLocal::new( value.into_inner::<T>().hydrate::<true>(&el), ), el, } } #[cfg(feature = "hydrate")] fn hydrate_from_template<T: Attribute + 'static>( value: Erased, el: crate::renderer::types::Element, ) -> AnyAttributeState { AnyAttributeState { type_id: TypeId::of::<T>(), keys: value.get_ref::<T>().keys(), state: ErasedLocal::new( value.into_inner::<T>().hydrate::<true>(&el), ), el, } } fn rebuild<T: Attribute + 'static>( value: Erased, state: &mut AnyAttributeState, ) { let value = value.into_inner::<T>(); let state = state.state.get_mut::<T::State>(); value.rebuild(state); } #[cfg(feature = "ssr")] fn dry_resolve<T: Attribute + 'static>(value: &mut Erased) { value.get_mut::<T>().dry_resolve(); } #[cfg(feature = "ssr")] fn resolve<T: Attribute + 'static>( value: Erased, ) -> Pin<Box<dyn Future<Output = AnyAttribute> + Send>> { use futures::FutureExt; async move {value.into_inner::<T>().resolve().await.into_any_attr()}.boxed() } fn keys<T: Attribute + 'static>( value: &Erased, ) -> Vec<NamedAttributeKey> { value.get_ref::<T>().keys() } let value = self.into_cloneable_owned(); AnyAttribute { type_id: TypeId::of::<T::CloneableOwned>(), html_len: value.html_len(), value: Erased::new(value), clone: clone::<T::CloneableOwned>, #[cfg(feature = "ssr")] to_html: to_html::<T::CloneableOwned>, build: build::<T::CloneableOwned>, rebuild: rebuild::<T::CloneableOwned>, #[cfg(feature = "hydrate")] hydrate_from_server: hydrate_from_server::<T::CloneableOwned>, #[cfg(feature = "hydrate")] hydrate_from_template: hydrate_from_template::<T::CloneableOwned>, #[cfg(feature = "ssr")] resolve: resolve::<T::CloneableOwned>, #[cfg(feature = "ssr")] dry_resolve: dry_resolve::<T::CloneableOwned>, keys: keys::<T::CloneableOwned>, } } } impl NextAttribute for AnyAttribute { type Output<NewAttr: Attribute> = Vec<AnyAttribute>; fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { vec![self, new_attr.into_any_attr()] } } impl Attribute for AnyAttribute { const MIN_LENGTH: usize = 0; type AsyncOutput = AnyAttribute; type State = AnyAttributeState; type Cloneable = AnyAttribute; type CloneableOwned = AnyAttribute; fn html_len(&self) -> usize { self.html_len } #[allow(unused)] // they are used in SSR fn to_html( self, buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, ) { #[cfg(feature = "ssr")] { (self.to_html)(self.value, buf, class, style, inner_html); } #[cfg(not(feature = "ssr"))] panic!( "You are rendering AnyAttribute to HTML without the `ssr` feature \ enabled." ); } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { #[cfg(feature = "hydrate")] if FROM_SERVER { (self.hydrate_from_server)(self.value, el.clone()) } else { (self.hydrate_from_template)(self.value, el.clone()) } #[cfg(not(feature = "hydrate"))] { _ = el; panic!( "You are trying to hydrate AnyAttribute without the `hydrate` \ feature enabled." ); } } fn build(self, el: &crate::renderer::types::Element) -> Self::State { (self.build)(self.value, el.clone()) } fn rebuild(self, state: &mut Self::State) { if self.type_id == state.type_id { (self.rebuild)(self.value, state) } else { let new = self.build(&state.el); *state = new; } } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) { #[cfg(feature = "ssr")] { (self.dry_resolve)(&mut self.value) } #[cfg(not(feature = "ssr"))] panic!( "You are rendering AnyAttribute to HTML without the `ssr` feature \ enabled." ); } async fn resolve(self) -> Self::AsyncOutput { #[cfg(feature = "ssr")] { (self.resolve)(self.value).await } #[cfg(not(feature = "ssr"))] panic!( "You are rendering AnyAttribute to HTML without the `ssr` feature \ enabled." ); } fn keys(&self) -> Vec<NamedAttributeKey> { (self.keys)(&self.value) } } impl NextAttribute for Vec<AnyAttribute> { type Output<NewAttr: Attribute> = Self; fn add_any_attr<NewAttr: Attribute>( mut self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { self.push(new_attr.into_any_attr()); self } } impl Attribute for Vec<AnyAttribute> { const MIN_LENGTH: usize = 0; type AsyncOutput = Vec<AnyAttribute>; type State = (Element, Vec<AnyAttributeState>); type Cloneable = Vec<AnyAttribute>; type CloneableOwned = Vec<AnyAttribute>; fn html_len(&self) -> usize { self.iter().map(|attr| attr.html_len()).sum() } #[allow(unused)] // they are used in SSR fn to_html( self, buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, ) { #[cfg(feature = "ssr")] { for mut attr in self { attr.to_html(buf, class, style, inner_html) } } #[cfg(not(feature = "ssr"))] panic!( "You are rendering AnyAttribute to HTML without the `ssr` feature \ enabled." ); } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { #[cfg(feature = "hydrate")] if FROM_SERVER { ( el.clone(), self.into_iter() .map(|attr| attr.hydrate::<true>(el)) .collect(), ) } else { ( el.clone(), self.into_iter() .map(|attr| attr.hydrate::<false>(el)) .collect(), ) } #[cfg(not(feature = "hydrate"))] { _ = el; panic!( "You are trying to hydrate AnyAttribute without the `hydrate` \ feature enabled." ); } } fn build(self, el: &crate::renderer::types::Element) -> Self::State { ( el.clone(), self.into_iter().map(|attr| attr.build(el)).collect(), ) } fn rebuild(self, state: &mut Self::State) { let (el, state) = state; for old in mem::take(state) { for key in old.keys { match key { NamedAttributeKey::InnerHtml => { Rndr::set_inner_html(&old.el, ""); } NamedAttributeKey::Property(prop_name) => { Rndr::set_property( &old.el, &prop_name, &wasm_bindgen::JsValue::UNDEFINED, ); } NamedAttributeKey::Attribute(key) => { Rndr::remove_attribute(&old.el, &key); } } } } *state = self.into_iter().map(|s| s.build(el)).collect(); } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) { #[cfg(feature = "ssr")] { for attr in self.iter_mut() { attr.dry_resolve() } } #[cfg(not(feature = "ssr"))] panic!( "You are rendering AnyAttribute to HTML without the `ssr` feature \ enabled." ); } async fn resolve(self) -> Self::AsyncOutput { #[cfg(feature = "ssr")] { futures::future::join_all( self.into_iter().map(|attr| attr.resolve()), ) .await } #[cfg(not(feature = "ssr"))] panic!( "You are rendering AnyAttribute to HTML without the `ssr` feature \ enabled." ); } fn keys(&self) -> Vec<NamedAttributeKey> { self.iter().flat_map(|s| s.keys()).collect() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/html/attribute/value.rs
tachys/src/html/attribute/value.rs
use crate::renderer::Rndr; use std::{ borrow::Cow, future::Future, net::{IpAddr, Ipv4Addr, Ipv6Addr, SocketAddr, SocketAddrV4, SocketAddrV6}, num::{ NonZeroI128, NonZeroI16, NonZeroI32, NonZeroI64, NonZeroI8, NonZeroIsize, NonZeroU128, NonZeroU16, NonZeroU32, NonZeroU64, NonZeroU8, NonZeroUsize, }, sync::Arc, }; /// Declares that this type can be converted into some other type, which is a valid attribute value. pub trait IntoAttributeValue { /// The attribute value into which this type can be converted. type Output; /// Consumes this value, transforming it into an attribute value. fn into_attribute_value(self) -> Self::Output; } impl<T> IntoAttributeValue for T where T: AttributeValue, { type Output = Self; fn into_attribute_value(self) -> Self::Output { self } } /// A possible value for an HTML attribute. pub trait AttributeValue: Send { /// The state that should be retained between building and rebuilding. type State; /// The type once all async data have loaded. type AsyncOutput: AttributeValue; /// A version of the value that can be cloned. This can be the same type, or a /// reference-counted type. Generally speaking, this does *not* need to refer to the same data, /// but should behave in the same way. So for example, making an event handler cloneable should /// probably make it reference-counted (so that a `FnMut()` continues mutating the same /// closure), but making a `String` cloneable does not necessarily need to make it an /// `Arc<str>`, as two different clones of a `String` will still have the same value. type Cloneable: AttributeValue + Clone; /// A cloneable type that is also `'static`. This is used for spreading across types when the /// spreadable attribute needs to be owned. In some cases (`&'a str` to `Arc<str>`, etc.) the owned /// cloneable type has worse performance than the cloneable type, so they are separate. type CloneableOwned: AttributeValue + Clone + 'static; /// An approximation of the actual length of this attribute in HTML. fn html_len(&self) -> usize; /// Renders the attribute value to HTML. fn to_html(self, key: &str, buf: &mut String); /// Renders the attribute value to HTML for a `<template>`. fn to_template(key: &str, buf: &mut String); /// Adds interactivity as necessary, given DOM nodes that were created from HTML that has /// either been rendered on the server, or cloned for a `<template>`. fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State; /// Adds this attribute to the element during client-side rendering. fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State; /// Applies a new value for the attribute. fn rebuild(self, key: &str, state: &mut Self::State); /// Converts this attribute into an equivalent that can be cloned. fn into_cloneable(self) -> Self::Cloneable; /// Converts this attributes into an equivalent that can be cloned and is `'static`. fn into_cloneable_owned(self) -> Self::CloneableOwned; /// “Runs” the attribute without other side effects. For primitive types, this is a no-op. For /// reactive types, this can be used to gather data about reactivity or about asynchronous data /// that needs to be loaded. fn dry_resolve(&mut self); /// “Resolves” this into a form that is not waiting for any asynchronous data. fn resolve(self) -> impl Future<Output = Self::AsyncOutput> + Send; } impl AttributeValue for () { type State = (); type AsyncOutput = (); type Cloneable = (); type CloneableOwned = (); fn html_len(&self) -> usize { 0 } fn to_html(self, _key: &str, _buf: &mut String) {} fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, _key: &str, _el: &crate::renderer::types::Element, ) { } fn build( self, _el: &crate::renderer::types::Element, _key: &str, ) -> Self::State { } fn rebuild(self, _key: &str, _state: &mut Self::State) {} fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) {} } impl<'a> AttributeValue for &'a str { type State = (crate::renderer::types::Element, &'a str); type AsyncOutput = &'a str; type Cloneable = &'a str; type CloneableOwned = Arc<str>; fn html_len(&self) -> usize { self.len() } fn to_html(self, key: &str, buf: &mut String) { buf.push(' '); buf.push_str(key); buf.push_str("=\""); buf.push_str(&escape_attr(self)); buf.push('"'); } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State { // if we're actually hydrating from SSRed HTML, we don't need to set the attribute // if we're hydrating from a CSR-cloned <template>, we do need to set non-StaticAttr attributes if !FROM_SERVER { Rndr::set_attribute(el, key, self); } (el.clone(), self) } fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { Rndr::set_attribute(el, key, self); (el.to_owned(), self) } fn rebuild(self, key: &str, state: &mut Self::State) { let (el, prev_value) = state; if self != *prev_value { Rndr::set_attribute(el, key, self); } *prev_value = self; } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.into() } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } impl<'a> AttributeValue for Cow<'a, str> { type State = (crate::renderer::types::Element, Self); type AsyncOutput = Self; type Cloneable = Arc<str>; type CloneableOwned = Arc<str>; fn html_len(&self) -> usize { self.len() } fn to_html(self, key: &str, buf: &mut String) { buf.push(' '); buf.push_str(key); buf.push_str("=\""); buf.push_str(&escape_attr(&self)); buf.push('"'); } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State { // if we're actually hydrating from SSRed HTML, we don't need to set the attribute // if we're hydrating from a CSR-cloned <template>, we do need to set non-StaticAttr attributes if !FROM_SERVER { Rndr::set_attribute(el, key, &self); } (el.clone(), self) } fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { Rndr::set_attribute(el, key, &self); (el.to_owned(), self) } fn rebuild(self, key: &str, state: &mut Self::State) { let (el, prev_value) = state; if self != *prev_value { Rndr::set_attribute(el, key, &self); } *prev_value = self; } fn into_cloneable(self) -> Self::Cloneable { self.into() } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.into() } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } #[cfg(all(feature = "nightly", rustc_nightly))] impl<const V: &'static str> AttributeValue for crate::view::static_types::Static<V> { type AsyncOutput = Self; type State = (); type Cloneable = Self; type CloneableOwned = Self; fn html_len(&self) -> usize { V.len() } fn to_html(self, key: &str, buf: &mut String) { <&str as AttributeValue>::to_html(V, key, buf); } fn to_template(key: &str, buf: &mut String) { buf.push(' '); buf.push_str(key); buf.push_str("=\""); buf.push_str(V); buf.push('"'); } fn hydrate<const FROM_SERVER: bool>( self, _key: &str, _el: &crate::renderer::types::Element, ) -> Self::State { } fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { <&str as AttributeValue>::build(V, el, key); } fn rebuild(self, _key: &str, _state: &mut Self::State) {} fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } impl<'a> AttributeValue for &'a String { type AsyncOutput = Self; type State = (crate::renderer::types::Element, &'a String); type Cloneable = Self; type CloneableOwned = Arc<str>; fn html_len(&self) -> usize { self.len() } fn to_html(self, key: &str, buf: &mut String) { <&str as AttributeValue>::to_html(self.as_str(), key, buf); } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State { let (el, _) = <&str as AttributeValue>::hydrate::<FROM_SERVER>( self.as_str(), key, el, ); (el, self) } fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { Rndr::set_attribute(el, key, self); (el.clone(), self) } fn rebuild(self, key: &str, state: &mut Self::State) { let (el, prev_value) = state; if self != *prev_value { Rndr::set_attribute(el, key, self); } *prev_value = self; } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.as_str().into() } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } impl AttributeValue for String { type AsyncOutput = Self; type State = (crate::renderer::types::Element, String); type Cloneable = Arc<str>; type CloneableOwned = Arc<str>; fn html_len(&self) -> usize { self.len() } fn to_html(self, key: &str, buf: &mut String) { <&str as AttributeValue>::to_html(self.as_str(), key, buf); } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State { let (el, _) = <&str as AttributeValue>::hydrate::<FROM_SERVER>( self.as_str(), key, el, ); (el, self) } fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { Rndr::set_attribute(el, key, &self); (el.clone(), self) } fn rebuild(self, key: &str, state: &mut Self::State) { let (el, prev_value) = state; if self != *prev_value { Rndr::set_attribute(el, key, &self); } *prev_value = self; } fn into_cloneable(self) -> Self::Cloneable { self.into() } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.into() } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } impl AttributeValue for Arc<str> { type AsyncOutput = Self; type State = (crate::renderer::types::Element, Arc<str>); type Cloneable = Arc<str>; type CloneableOwned = Arc<str>; fn html_len(&self) -> usize { self.len() } fn to_html(self, key: &str, buf: &mut String) { <&str as AttributeValue>::to_html(self.as_ref(), key, buf); } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State { let (el, _) = <&str as AttributeValue>::hydrate::<FROM_SERVER>( self.as_ref(), key, el, ); (el, self) } fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { Rndr::set_attribute(el, key, &self); (el.clone(), self) } fn rebuild(self, key: &str, state: &mut Self::State) { let (el, prev_value) = state; if self != *prev_value { Rndr::set_attribute(el, key, &self); } *prev_value = self; } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } // TODO impl AttributeValue for Rc<str> and Arc<str> too impl AttributeValue for bool { type AsyncOutput = Self; type State = (crate::renderer::types::Element, bool); type Cloneable = Self; type CloneableOwned = Self; fn html_len(&self) -> usize { 0 } fn to_html(self, key: &str, buf: &mut String) { if self { buf.push(' '); buf.push_str(key); } } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State { // if we're actually hydrating from SSRed HTML, we don't need to set the attribute // if we're hydrating from a CSR-cloned <template>, we do need to set non-StaticAttr attributes if !FROM_SERVER { Rndr::set_attribute(el, key, ""); } (el.clone(), self) } fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { if self { Rndr::set_attribute(el, key, ""); } (el.clone(), self) } fn rebuild(self, key: &str, state: &mut Self::State) { let (el, prev_value) = state; if self != *prev_value { if self { Rndr::set_attribute(el, key, ""); } else { Rndr::remove_attribute(el, key); } } *prev_value = self; } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } impl<V> AttributeValue for Option<V> where V: AttributeValue, { type AsyncOutput = Option<V::AsyncOutput>; type State = (crate::renderer::types::Element, Option<V::State>); type Cloneable = Option<V::Cloneable>; type CloneableOwned = Option<V::CloneableOwned>; fn html_len(&self) -> usize { match self { Some(i) => i.html_len(), None => 0, } } fn to_html(self, key: &str, buf: &mut String) { if let Some(v) = self { v.to_html(key, buf); } } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State { let state = self.map(|v| v.hydrate::<FROM_SERVER>(key, el)); (el.clone(), state) } fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { let el = el.clone(); let v = self.map(|v| v.build(&el, key)); (el, v) } fn rebuild(self, key: &str, state: &mut Self::State) { let (el, prev) = state; match (self, prev.as_mut()) { (None, None) => {} (None, Some(_)) => { Rndr::remove_attribute(el, key); *prev = None; } (Some(value), None) => { *prev = Some(value.build(el, key)); } (Some(new), Some(old)) => { new.rebuild(key, old); } } } fn into_cloneable(self) -> Self::Cloneable { self.map(|value| value.into_cloneable()) } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.map(|value| value.into_cloneable_owned()) } fn dry_resolve(&mut self) { if let Some(inner) = self.as_mut() { inner.dry_resolve(); } } async fn resolve(self) -> Self::AsyncOutput { match self { None => None, Some(inner) => Some(inner.resolve().await), } } } pub(crate) fn escape_attr(value: &str) -> Cow<'_, str> { html_escape::encode_double_quoted_attribute(value) } macro_rules! render_primitive { ($($child_type:ty),* $(,)?) => { $( impl AttributeValue for $child_type where { type AsyncOutput = $child_type; type State = (crate::renderer::types::Element, $child_type); type Cloneable = Self; type CloneableOwned = Self; fn html_len(&self) -> usize { 0 } fn to_html(self, key: &str, buf: &mut String) { <String as AttributeValue>::to_html(self.to_string(), key, buf); } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State { // if we're actually hydrating from SSRed HTML, we don't need to set the attribute // if we're hydrating from a CSR-cloned <template>, we do need to set non-StaticAttr attributes if !FROM_SERVER { Rndr::set_attribute(el, key, &self.to_string()); } (el.clone(), self) } fn build(self, el: &crate::renderer::types::Element, key: &str) -> Self::State { Rndr::set_attribute(el, key, &self.to_string()); (el.to_owned(), self) } fn rebuild(self, key: &str, state: &mut Self::State) { let (el, prev_value) = state; if self != *prev_value { Rndr::set_attribute(el, key, &self.to_string()); } *prev_value = self; } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) { } async fn resolve(self) -> Self::AsyncOutput { self } } )* } } render_primitive![ usize, u8, u16, u32, u64, u128, isize, i8, i16, i32, i64, i128, f32, f64, char, IpAddr, SocketAddr, SocketAddrV4, SocketAddrV6, Ipv4Addr, Ipv6Addr, NonZeroI8, NonZeroU8, NonZeroI16, NonZeroU16, NonZeroI32, NonZeroU32, NonZeroI64, NonZeroU64, NonZeroI128, NonZeroU128, NonZeroIsize, NonZeroUsize, ];
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/html/attribute/mod.rs
tachys/src/html/attribute/mod.rs
/// A type-erased `AnyAttribute`. pub mod any_attribute; /// Types for ARIA attributes. pub mod aria; /// Types for custom attributes. pub mod custom; /// Traits to define global attribute methods on all HTML elements. pub mod global; mod key; pub(crate) mod maybe_next_attr_erasure_macros; mod value; use crate::view::{Position, ToTemplate}; pub use key::*; use maybe_next_attr_erasure_macros::{ next_attr_combine, next_attr_output_type, }; use std::{borrow::Cow, fmt::Debug, future::Future}; pub use value::*; /// Defines an attribute: anything that can modify an element. pub trait Attribute: NextAttribute + Send { /// The minimum length of this attribute in HTML. const MIN_LENGTH: usize; /// The state that should be retained between building and rebuilding. type State; /// The type once all async data have loaded. type AsyncOutput: Attribute; /// An equivalent to this attribute that can be cloned to be shared across elements. type Cloneable: Attribute + Clone; /// An equivalent to this attribute that can be cloned to be shared across elements, and /// captures no references shorter than `'static`. type CloneableOwned: Attribute + Clone + 'static; /// An approximation of the actual length of this attribute in HTML. fn html_len(&self) -> usize; /// Renders the attribute to HTML. /// /// This separates a general buffer for attribute values from the `class` and `style` /// attributes, so that multiple classes or styles can be combined, and also allows for an /// `inner_html` attribute that sets the child HTML instead of an attribute. fn to_html( self, buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, ); /// Adds interactivity as necessary, given DOM nodes that were created from HTML that has /// either been rendered on the server, or cloned for a `<template>`. fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State; /// Adds this attribute to the element during client-side rendering. fn build(self, el: &crate::renderer::types::Element) -> Self::State; /// Applies a new value for the attribute. fn rebuild(self, state: &mut Self::State); /// Converts this attribute into an equivalent that can be cloned. fn into_cloneable(self) -> Self::Cloneable; /// Converts this attributes into an equivalent that can be cloned and is `'static`. fn into_cloneable_owned(self) -> Self::CloneableOwned; /// “Runs” the attribute without other side effects. For primitive types, this is a no-op. For /// reactive types, this can be used to gather data about reactivity or about asynchronous data /// that needs to be loaded. fn dry_resolve(&mut self); /// “Resolves” this into a type that is not waiting for any asynchronous data. fn resolve(self) -> impl Future<Output = Self::AsyncOutput> + Send; /// Returns a set of attribute keys, associated with this attribute, if any. /// /// This is only used to manage the removal of type-erased attributes, when needed. fn keys(&self) -> Vec<NamedAttributeKey> { // TODO: remove default implementation in 0.9, or fix this whole approach // by making it easier to remove attributes vec![] } } /// An attribute key can be used to remove an attribute from an element. pub enum NamedAttributeKey { /// An ordinary attribute. Attribute(Cow<'static, str>), /// A DOM property. Property(Cow<'static, str>), /// The `inner_html` pseudo-attribute. InnerHtml, } /// Adds another attribute to this one, returning a new attribute. /// /// This is typically achieved by creating or extending a tuple of attributes. pub trait NextAttribute { /// The type of the new, combined attribute. type Output<NewAttr: Attribute>: Attribute; /// Adds a new attribute. fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr>; } impl Attribute for () { const MIN_LENGTH: usize = 0; type State = (); type AsyncOutput = (); type Cloneable = (); type CloneableOwned = (); fn html_len(&self) -> usize { 0 } fn to_html( self, _buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, ) { } fn hydrate<const FROM_SERVER: bool>( self, _el: &crate::renderer::types::Element, ) -> Self::State { } fn build(self, _el: &crate::renderer::types::Element) -> Self::State {} fn rebuild(self, _state: &mut Self::State) {} fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::Cloneable { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput {} fn keys(&self) -> Vec<NamedAttributeKey> { vec![] } } impl NextAttribute for () { #[cfg(not(erase_components))] type Output<NewAttr: Attribute> = (NewAttr,); #[cfg(erase_components)] type Output<NewAttr: Attribute> = Vec<crate::html::attribute::any_attribute::AnyAttribute>; fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { #[cfg(not(erase_components))] { (new_attr,) } #[cfg(erase_components)] { use crate::html::attribute::any_attribute::IntoAnyAttribute; vec![new_attr.into_any_attr()] } } } /// An attribute with a key and value. #[derive(Debug)] pub struct Attr<K, V>(pub K, pub V) where K: AttributeKey, V: AttributeValue; impl<K, V> Clone for Attr<K, V> where K: AttributeKey, V: AttributeValue + Clone, { fn clone(&self) -> Self { Self(self.0.clone(), self.1.clone()) } } impl<K, V> ToTemplate for Attr<K, V> where K: AttributeKey, V: AttributeValue, { fn to_template( buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, _position: &mut Position, ) { V::to_template(K::KEY, buf); } } impl<K, V> Attribute for Attr<K, V> where K: AttributeKey + Send, V: AttributeValue + Send, { const MIN_LENGTH: usize = 0; type State = V::State; type AsyncOutput = Attr<K, V::AsyncOutput>; type Cloneable = Attr<K, V::Cloneable>; type CloneableOwned = Attr<K, V::CloneableOwned>; fn html_len(&self) -> usize { K::KEY.len() + 3 + self.1.html_len() } fn to_html( self, buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, ) { self.1.to_html(K::KEY, buf); } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { self.1.hydrate::<FROM_SERVER>(K::KEY, el) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { V::build(self.1, el, K::KEY) } fn rebuild(self, state: &mut Self::State) { V::rebuild(self.1, K::KEY, state); } fn into_cloneable(self) -> Self::Cloneable { Attr(self.0, self.1.into_cloneable()) } fn into_cloneable_owned(self) -> Self::CloneableOwned { Attr(self.0, self.1.into_cloneable_owned()) } fn dry_resolve(&mut self) { self.1.dry_resolve(); } async fn resolve(self) -> Self::AsyncOutput { Attr(self.0, self.1.resolve().await) } fn keys(&self) -> Vec<NamedAttributeKey> { vec![NamedAttributeKey::Attribute(K::KEY.into())] } } impl<K, V> NextAttribute for Attr<K, V> where K: AttributeKey, V: AttributeValue, { next_attr_output_type!(Self, NewAttr); fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { next_attr_combine!(self, new_attr) } } macro_rules! impl_attr_for_tuples { ($first:ident, $($ty:ident),* $(,)?) => { impl<$first, $($ty),*> Attribute for ($first, $($ty,)*) where $first: Attribute, $($ty: Attribute),*, { const MIN_LENGTH: usize = $first::MIN_LENGTH $(+ $ty::MIN_LENGTH)*; type AsyncOutput = ($first::AsyncOutput, $($ty::AsyncOutput,)*); type State = ($first::State, $($ty::State,)*); type Cloneable = ($first::Cloneable, $($ty::Cloneable,)*); type CloneableOwned = ($first::CloneableOwned, $($ty::CloneableOwned,)*); fn html_len(&self) -> usize { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; $first.html_len() $(+ $ty.html_len())* } fn to_html(self, buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String,) { #[allow(non_snake_case)] let ($first, $($ty,)* ) = self; $first.to_html(buf, class, style, inner_html); $($ty.to_html(buf, class, style, inner_html));* } fn hydrate<const FROM_SERVER: bool>(self, el: &crate::renderer::types::Element) -> Self::State { #[allow(non_snake_case)] let ($first, $($ty,)* ) = self; ( $first.hydrate::<FROM_SERVER>(el), $($ty.hydrate::<FROM_SERVER>(el)),* ) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; ( $first.build(el), $($ty.build(el)),* ) } fn rebuild(self, state: &mut Self::State) { paste::paste! { let ([<$first:lower>], $([<$ty:lower>],)*) = self; let ([<view_ $first:lower>], $([<view_ $ty:lower>],)*) = state; [<$first:lower>].rebuild([<view_ $first:lower>]); $([<$ty:lower>].rebuild([<view_ $ty:lower>]));* } } fn into_cloneable(self) -> Self::Cloneable { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; ( $first.into_cloneable(), $($ty.into_cloneable()),* ) } fn into_cloneable_owned(self) -> Self::CloneableOwned { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; ( $first.into_cloneable_owned(), $($ty.into_cloneable_owned()),* ) } fn dry_resolve(&mut self) { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; $first.dry_resolve(); $($ty.dry_resolve());* } async fn resolve(self) -> Self::AsyncOutput { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; futures::join!( $first.resolve(), $($ty.resolve()),* ) } fn keys(&self) -> Vec<NamedAttributeKey> { #[allow(non_snake_case)] let ($first, $($ty,)*) = &self; let mut buf = $first.keys(); $(buf.extend($ty.keys());)* buf } } impl<$first, $($ty),*> NextAttribute for ($first, $($ty,)*) where $first: Attribute, $($ty: Attribute),*, { type Output<NewAttr: Attribute> = ($first, $($ty,)* NewAttr); fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; ($first, $($ty,)* new_attr) } } }; } macro_rules! impl_attr_for_tuples_truncate_additional { ($first:ident, $($ty:ident),* $(,)?) => { impl<$first, $($ty),*> Attribute for ($first, $($ty,)*) where $first: Attribute, $($ty: Attribute),*, { const MIN_LENGTH: usize = $first::MIN_LENGTH $(+ $ty::MIN_LENGTH)*; type AsyncOutput = ($first::AsyncOutput, $($ty::AsyncOutput,)*); type State = ($first::State, $($ty::State,)*); type Cloneable = ($first::Cloneable, $($ty::Cloneable,)*); type CloneableOwned = ($first::CloneableOwned, $($ty::CloneableOwned,)*); fn html_len(&self) -> usize { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; $first.html_len() $(+ $ty.html_len())* } fn to_html(self, buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String,) { #[allow(non_snake_case)] let ($first, $($ty,)* ) = self; $first.to_html(buf, class, style, inner_html); $($ty.to_html(buf, class, style, inner_html));* } fn hydrate<const FROM_SERVER: bool>(self, el: &crate::renderer::types::Element) -> Self::State { #[allow(non_snake_case)] let ($first, $($ty,)* ) = self; ( $first.hydrate::<FROM_SERVER>(el), $($ty.hydrate::<FROM_SERVER>(el)),* ) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; ( $first.build(el), $($ty.build(el)),* ) } fn rebuild(self, state: &mut Self::State) { paste::paste! { let ([<$first:lower>], $([<$ty:lower>],)*) = self; let ([<view_ $first:lower>], $([<view_ $ty:lower>],)*) = state; [<$first:lower>].rebuild([<view_ $first:lower>]); $([<$ty:lower>].rebuild([<view_ $ty:lower>]));* } } fn into_cloneable(self) -> Self::Cloneable { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; ( $first.into_cloneable(), $($ty.into_cloneable()),* ) } fn into_cloneable_owned(self) -> Self::CloneableOwned { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; ( $first.into_cloneable_owned(), $($ty.into_cloneable_owned()),* ) } fn dry_resolve(&mut self) { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; $first.dry_resolve(); $($ty.dry_resolve());* } async fn resolve(self) -> Self::AsyncOutput { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; futures::join!( $first.resolve(), $($ty.resolve()),* ) } fn keys(&self) -> Vec<NamedAttributeKey> { #[allow(non_snake_case)] let ($first, $($ty,)*) = &self; let mut buf = $first.keys(); $(buf.extend($ty.keys());)* buf } } impl<$first, $($ty),*> NextAttribute for ($first, $($ty,)*) where $first: Attribute, $($ty: Attribute),*, { type Output<NewAttr: Attribute> = ($first, $($ty,)*); fn add_any_attr<NewAttr: Attribute>( self, _new_attr: NewAttr, ) -> Self::Output<NewAttr> { todo!("adding more than 26 attributes is not supported"); //($first, $($ty,)*) } } }; } impl<A> Attribute for (A,) where A: Attribute, { const MIN_LENGTH: usize = A::MIN_LENGTH; type AsyncOutput = (A::AsyncOutput,); type State = A::State; type Cloneable = (A::Cloneable,); type CloneableOwned = (A::CloneableOwned,); fn html_len(&self) -> usize { self.0.html_len() } fn to_html( self, buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, ) { self.0.to_html(buf, class, style, inner_html); } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { self.0.hydrate::<FROM_SERVER>(el) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { self.0.build(el) } fn rebuild(self, state: &mut Self::State) { self.0.rebuild(state); } fn into_cloneable(self) -> Self::Cloneable { (self.0.into_cloneable(),) } fn into_cloneable_owned(self) -> Self::CloneableOwned { (self.0.into_cloneable_owned(),) } fn dry_resolve(&mut self) { self.0.dry_resolve(); } async fn resolve(self) -> Self::AsyncOutput { (self.0.resolve().await,) } fn keys(&self) -> Vec<NamedAttributeKey> { self.0.keys() } } impl<A> NextAttribute for (A,) where A: Attribute, { next_attr_output_type!(A, NewAttr); fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { next_attr_combine!(self.0, new_attr) } } impl_attr_for_tuples!(A, B); impl_attr_for_tuples!(A, B, C); impl_attr_for_tuples!(A, B, C, D); impl_attr_for_tuples!(A, B, C, D, E); impl_attr_for_tuples!(A, B, C, D, E, F); impl_attr_for_tuples!(A, B, C, D, E, F, G); impl_attr_for_tuples!(A, B, C, D, E, F, G, H); impl_attr_for_tuples!(A, B, C, D, E, F, G, H, I); impl_attr_for_tuples!(A, B, C, D, E, F, G, H, I, J); impl_attr_for_tuples!(A, B, C, D, E, F, G, H, I, J, K); impl_attr_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L); impl_attr_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M); impl_attr_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N); impl_attr_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O); impl_attr_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P); impl_attr_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q); impl_attr_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R); impl_attr_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S); impl_attr_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T ); impl_attr_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U ); impl_attr_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V ); impl_attr_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W ); impl_attr_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X ); impl_attr_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X, Y ); impl_attr_for_tuples_truncate_additional!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X, Y, Z );
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/html/attribute/maybe_next_attr_erasure_macros.rs
tachys/src/html/attribute/maybe_next_attr_erasure_macros.rs
macro_rules! next_attr_output_type { ($current:ty, $next:ty) => { #[cfg(not(erase_components))] type Output<NewAttr: Attribute> = ($current, $next); #[cfg(erase_components)] type Output<NewAttr: Attribute> = Vec<$crate::html::attribute::any_attribute::AnyAttribute>; }; } macro_rules! next_attr_combine { ($self:expr, $next_attr:expr) => {{ #[cfg(not(erase_components))] { ($self, $next_attr) } #[cfg(erase_components)] { use $crate::html::attribute::any_attribute::IntoAnyAttribute; vec![$self.into_any_attr(), $next_attr.into_any_attr()] } }}; } pub(crate) use next_attr_combine; pub(crate) use next_attr_output_type;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/html/attribute/custom.rs
tachys/src/html/attribute/custom.rs
use super::{ maybe_next_attr_erasure_macros::next_attr_output_type, NextAttribute, }; use crate::{ html::attribute::{ maybe_next_attr_erasure_macros::next_attr_combine, Attribute, AttributeValue, NamedAttributeKey, }, view::{add_attr::AddAnyAttr, Position, ToTemplate}, }; use std::{borrow::Cow, sync::Arc}; /// Adds a custom attribute with any key-value combination. #[inline(always)] pub fn custom_attribute<K, V>(key: K, value: V) -> CustomAttr<K, V> where K: CustomAttributeKey, V: AttributeValue, { CustomAttr { key, value } } /// A custom attribute with any key-value combination. #[derive(Debug)] pub struct CustomAttr<K, V> where K: CustomAttributeKey, V: AttributeValue, { key: K, value: V, } impl<K, V> Clone for CustomAttr<K, V> where K: CustomAttributeKey, V: AttributeValue + Clone, { fn clone(&self) -> Self { Self { key: self.key.clone(), value: self.value.clone(), } } } impl<K, V> Attribute for CustomAttr<K, V> where K: CustomAttributeKey, V: AttributeValue, { const MIN_LENGTH: usize = 0; type AsyncOutput = CustomAttr<K, V::AsyncOutput>; type State = V::State; type Cloneable = CustomAttr<K, V::Cloneable>; type CloneableOwned = CustomAttr<K, V::CloneableOwned>; fn html_len(&self) -> usize { self.key.as_ref().len() + 3 + self.value.html_len() } fn to_html( self, buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, ) { self.value.to_html(self.key.as_ref(), buf); } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { if !K::KEY.is_empty() { self.value.hydrate::<FROM_SERVER>(self.key.as_ref(), el) } else { self.value.build(el, self.key.as_ref()) } } fn build(self, el: &crate::renderer::types::Element) -> Self::State { self.value.build(el, self.key.as_ref()) } fn rebuild(self, state: &mut Self::State) { self.value.rebuild(self.key.as_ref(), state); } fn into_cloneable(self) -> Self::Cloneable { CustomAttr { key: self.key, value: self.value.into_cloneable(), } } fn into_cloneable_owned(self) -> Self::CloneableOwned { CustomAttr { key: self.key, value: self.value.into_cloneable_owned(), } } fn dry_resolve(&mut self) { self.value.dry_resolve(); } async fn resolve(self) -> Self::AsyncOutput { CustomAttr { key: self.key, value: self.value.resolve().await, } } fn keys(&self) -> Vec<NamedAttributeKey> { vec![NamedAttributeKey::Attribute( self.key.as_ref().to_string().into(), )] } } impl<K, V> NextAttribute for CustomAttr<K, V> where K: CustomAttributeKey, V: AttributeValue, { next_attr_output_type!(Self, NewAttr); fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { next_attr_combine!(self, new_attr) } } impl<K, V> ToTemplate for CustomAttr<K, V> where K: CustomAttributeKey, V: AttributeValue, { fn to_template( buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, _position: &mut Position, ) { if !K::KEY.is_empty() { V::to_template(K::KEY, buf); } } } // TODO this needs to be a method, not a const /// Defines a custom attribute key. pub trait CustomAttributeKey: Clone + AsRef<str> + Send + 'static { /// The attribute name. const KEY: &'static str; } impl CustomAttributeKey for &'static str { const KEY: &'static str = ""; } impl CustomAttributeKey for Cow<'static, str> { const KEY: &'static str = ""; } impl CustomAttributeKey for String { const KEY: &'static str = ""; } impl CustomAttributeKey for Arc<str> { const KEY: &'static str = ""; } #[cfg(all(feature = "nightly", rustc_nightly))] impl<const K: &'static str> CustomAttributeKey for crate::view::static_types::Static<K> { const KEY: &'static str = K; } /// Adds a custom attribute to an element. pub trait CustomAttribute<K, V> where K: CustomAttributeKey, V: AttributeValue, Self: Sized + AddAnyAttr, { /// Adds an HTML attribute by key and value. fn attr( self, key: K, value: V, ) -> <Self as AddAnyAttr>::Output<CustomAttr<K, V>> { self.add_any_attr(custom_attribute(key, value)) } } impl<T, K, V> CustomAttribute<K, V> for T where T: AddAnyAttr, K: CustomAttributeKey, V: AttributeValue, { }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/reactive_graph/suspense.rs
tachys/src/reactive_graph/suspense.rs
use crate::{ html::attribute::{any_attribute::AnyAttribute, Attribute}, hydration::Cursor, ssr::StreamBuilder, view::{ add_attr::AddAnyAttr, iterators::OptionState, Mountable, Position, PositionState, Render, RenderHtml, }, }; use any_spawner::Executor; use futures::{ future::{AbortHandle, Abortable}, select, FutureExt, }; use or_poisoned::OrPoisoned; use reactive_graph::{ computed::{ suspense::{LocalResourceNotifier, SuspenseContext}, ScopedFuture, }, graph::{ AnySource, AnySubscriber, Observer, ReactiveNode, Source, Subscriber, ToAnySubscriber, WithObserver, }, owner::{on_cleanup, provide_context, use_context}, }; use std::{ cell::RefCell, fmt::Debug, future::{Future, IntoFuture}, mem, pin::Pin, rc::Rc, sync::{Arc, Mutex, Weak}, }; use throw_error::ErrorHook; /// A suspended `Future`, which can be used in the view. pub struct Suspend<T> { pub(crate) subscriber: SuspendSubscriber, pub(crate) inner: Pin<Box<dyn Future<Output = T> + Send>>, } #[derive(Debug, Clone)] pub(crate) struct SuspendSubscriber { inner: Arc<SuspendSubscriberInner>, } #[derive(Debug)] struct SuspendSubscriberInner { outer_subscriber: Option<AnySubscriber>, sources: Mutex<Vec<AnySource>>, } impl SuspendSubscriber { pub fn new() -> Self { let outer_subscriber = Observer::get(); Self { inner: Arc::new(SuspendSubscriberInner { outer_subscriber, sources: Default::default(), }), } } /// Re-links all reactive sources from this to another subscriber. /// /// This is used to collect reactive dependencies during the rendering phase, and only later /// connect them to any outer effect, to prevent the completion of async resources from /// triggering the render effect to run a second time. pub fn forward(&self) { if let Some(to) = &self.inner.outer_subscriber { let sources = mem::take(&mut *self.inner.sources.lock().or_poisoned()); for source in sources { source.add_subscriber(to.clone()); to.add_source(source); } } } } impl ReactiveNode for SuspendSubscriberInner { fn mark_dirty(&self) {} fn mark_check(&self) {} fn mark_subscribers_check(&self) {} fn update_if_necessary(&self) -> bool { false } } impl Subscriber for SuspendSubscriberInner { fn add_source(&self, source: AnySource) { self.sources.lock().or_poisoned().push(source); } fn clear_sources(&self, subscriber: &AnySubscriber) { for source in mem::take(&mut *self.sources.lock().or_poisoned()) { source.remove_subscriber(subscriber); } } } impl ToAnySubscriber for SuspendSubscriber { fn to_any_subscriber(&self) -> AnySubscriber { AnySubscriber( Arc::as_ptr(&self.inner) as usize, Arc::downgrade(&self.inner) as Weak<dyn Subscriber + Send + Sync>, ) } } impl<T> Suspend<T> { /// Creates a new suspended view. pub fn new<Fut>(fut: Fut) -> Self where Fut: IntoFuture<Output = T>, Fut::IntoFuture: Send + 'static, { let subscriber = SuspendSubscriber::new(); let any_subscriber = subscriber.to_any_subscriber(); let inner = any_subscriber .with_observer(|| Box::pin(ScopedFuture::new(fut.into_future()))); Self { subscriber, inner } } } impl<T> Debug for Suspend<T> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("Suspend").finish() } } /// Retained view state for [`Suspend`]. pub struct SuspendState<T> where T: Render, { inner: Rc<RefCell<OptionState<T>>>, } impl<T> Mountable for SuspendState<T> where T: Render, { fn unmount(&mut self) { self.inner.borrow_mut().unmount(); } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { self.inner.borrow_mut().mount(parent, marker); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.inner.borrow_mut().insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.inner.borrow().elements() } } impl<T> Render for Suspend<T> where T: Render + 'static, { type State = SuspendState<T>; fn build(self) -> Self::State { let Self { subscriber, inner } = self; // create a Future that will be aborted on on_cleanup // this prevents trying to access signals or other resources inside the Suspend, after the // await, if they have already been cleaned up let (abort_handle, abort_registration) = AbortHandle::new_pair(); let mut fut = Box::pin(Abortable::new(inner, abort_registration)); on_cleanup(move || abort_handle.abort()); // poll the future once immediately // if it's already available, start in the ready state // otherwise, start with the fallback let initial = fut.as_mut().now_or_never().and_then(Result::ok); let initially_pending = initial.is_none(); let inner = Rc::new(RefCell::new(initial.build())); // get a unique ID if there's a SuspenseContext let id = use_context::<SuspenseContext>().map(|sc| sc.task_id()); let error_hook = use_context::<Arc<dyn ErrorHook>>(); // if the initial state was pending, spawn a future to wait for it // spawning immediately means that our now_or_never poll result isn't lost // if it wasn't pending at first, we don't need to poll the Future again if initially_pending { reactive_graph::spawn_local_scoped({ let state = Rc::clone(&inner); async move { let _guard = error_hook.as_ref().map(|hook| { throw_error::set_error_hook(Arc::clone(hook)) }); let value = fut.as_mut().await; drop(id); if let Ok(value) = value { Some(value).rebuild(&mut *state.borrow_mut()); } subscriber.forward(); } }); } else { subscriber.forward(); } SuspendState { inner } } fn rebuild(self, state: &mut Self::State) { let Self { subscriber, inner } = self; // create a Future that will be aborted on on_cleanup // this prevents trying to access signals or other resources inside the Suspend, after the // await, if they have already been cleaned up let (abort_handle, abort_registration) = AbortHandle::new_pair(); let fut = Abortable::new(inner, abort_registration); on_cleanup(move || abort_handle.abort()); // get a unique ID if there's a SuspenseContext let id = use_context::<SuspenseContext>().map(|sc| sc.task_id()); let error_hook = use_context::<Arc<dyn ErrorHook>>(); // spawn the future, and rebuild the state when it resolves reactive_graph::spawn_local_scoped({ let state = Rc::clone(&state.inner); async move { let _guard = error_hook .as_ref() .map(|hook| throw_error::set_error_hook(Arc::clone(hook))); let value = fut.await; drop(id); // waiting a tick here allows Suspense to remount if necessary, which prevents some // edge cases in which a rebuild can't happen while unmounted because the DOM node // has no parent Executor::tick().await; if let Ok(value) = value { Some(value).rebuild(&mut *state.borrow_mut()); } subscriber.forward(); } }); } } impl<T> AddAnyAttr for Suspend<T> where T: Send + AddAnyAttr + 'static, { type Output<SomeNewAttr: Attribute> = Suspend<<T as AddAnyAttr>::Output<SomeNewAttr::CloneableOwned>>; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let attr = attr.into_cloneable_owned(); Suspend::new(async move { let this = self.inner.await; this.add_any_attr(attr) }) } } impl<T> RenderHtml for Suspend<T> where T: RenderHtml + Sized + 'static, { type AsyncOutput = Option<T>; type Owned = Self; const MIN_LENGTH: usize = T::MIN_LENGTH; fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { // TODO wrap this with a Suspense as needed // currently this is just used for Routes, which creates a Suspend but never actually needs // it (because we don't lazy-load routes on the server) if let Some(inner) = self.inner.now_or_never() { inner.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); } } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { let mut fut = Box::pin(self.inner); match fut.as_mut().now_or_never() { Some(inner) => inner.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ), None => { if use_context::<SuspenseContext>().is_none() { buf.next_id(); let (local_tx, mut local_rx) = futures::channel::oneshot::channel::<()>(); provide_context(LocalResourceNotifier::from(local_tx)); let mut fut = fut.fuse(); let fut = async move { select! { _ = local_rx => None, value = fut => Some(value) } }; let id = buf.clone_id(); // out-of-order streams immediately push fallback, // wrapped by suspense markers if OUT_OF_ORDER { let mut fallback_position = *position; buf.push_fallback::<()>( (), &mut fallback_position, mark_branches, extra_attrs.clone(), ); // TODO in 0.8: this should include a nonce // we do have access to nonces via context (because this is the `reactive_graph` module) // but unfortunately the Nonce type is defined in `leptos`, not in `tachys` // // missing it here only affects top-level Suspend, not Suspense components buf.push_async_out_of_order( fut, position, mark_branches, extra_attrs, ); } else { buf.push_async({ let mut position = *position; async move { let value = fut.await; let mut builder = StreamBuilder::new(id); value.to_html_async_with_buf::<OUT_OF_ORDER>( &mut builder, &mut position, escape, mark_branches, extra_attrs, ); builder.finish().take_chunks() } }); *position = Position::NextChild; } } } } } // TODO cancellation fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let Self { subscriber, inner } = self; // create a Future that will be aborted on on_cleanup // this prevents trying to access signals or other resources inside the Suspend, after the // await, if they have already been cleaned up let (abort_handle, abort_registration) = AbortHandle::new_pair(); let mut fut = Box::pin(Abortable::new(inner, abort_registration)); on_cleanup(move || abort_handle.abort()); // poll the future once immediately // if it's already available, start in the ready state // otherwise, start with the fallback let initial = fut.as_mut().now_or_never().and_then(Result::ok); let initially_pending = initial.is_none(); let inner = Rc::new(RefCell::new( initial.hydrate::<FROM_SERVER>(cursor, position), )); // get a unique ID if there's a SuspenseContext let id = use_context::<SuspenseContext>().map(|sc| sc.task_id()); let error_hook = use_context::<Arc<dyn ErrorHook>>(); // if the initial state was pending, spawn a future to wait for it // spawning immediately means that our now_or_never poll result isn't lost // if it wasn't pending at first, we don't need to poll the Future again if initially_pending { reactive_graph::spawn_local_scoped({ let state = Rc::clone(&inner); async move { let _guard = error_hook.as_ref().map(|hook| { throw_error::set_error_hook(Arc::clone(hook)) }); let value = fut.as_mut().await; drop(id); if let Ok(value) = value { Some(value).rebuild(&mut *state.borrow_mut()); } subscriber.forward(); } }); } else { subscriber.forward(); } SuspendState { inner } } async fn resolve(self) -> Self::AsyncOutput { Some(self.inner.await) } fn dry_resolve(&mut self) { // this is a little crazy, but if a Suspend is immediately available, we end up // with a situation where polling it multiple times (here in dry_resolve and then in // resolve) causes a runtime panic // (see https://github.com/leptos-rs/leptos/issues/3113) // // at the same time, we do need to dry_resolve Suspend so that we can register synchronous // resource reads that happen inside them // (see https://github.com/leptos-rs/leptos/issues/2917) // // fuse()-ing the Future doesn't work, because that will cause the subsequent resolve() // simply to be pending forever // // in this case, though, we can simply... discover that the data are already here, and then // stuff them back into a new Future, which can safely be polled after its completion if let Some(mut inner) = self.inner.as_mut().now_or_never() { inner.dry_resolve(); self.inner = Box::pin(async move { inner }) as Pin<Box<dyn Future<Output = T> + Send>>; } } fn into_owned(self) -> Self::Owned { self } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/reactive_graph/bind.rs
tachys/src/reactive_graph/bind.rs
use crate::{ dom::{event_target_checked, event_target_value}, html::{ attribute::{ maybe_next_attr_erasure_macros::{ next_attr_combine, next_attr_output_type, }, Attribute, AttributeKey, AttributeValue, NamedAttributeKey, NextAttribute, }, event::{change, input, on}, property::{prop, IntoProperty}, }, prelude::AddAnyAttr, renderer::{types::Element, RemoveEventHandler}, view::{Position, ToTemplate}, }; use reactive_graph::{ signal::{ReadSignal, RwSignal, WriteSignal}, traits::{Get, Set}, wrappers::read::Signal, }; use send_wrapper::SendWrapper; use wasm_bindgen::JsValue; #[cfg(feature = "reactive_stores")] use { reactive_graph::owner::Storage, reactive_stores::{ ArcField, AtIndex, AtKeyed, DerefedField, Field, KeyedSubfield, StoreField, Subfield, }, std::ops::{Deref, DerefMut, IndexMut}, }; /// `group` attribute used for radio inputs with `bind`. #[derive(Debug, Copy, Clone, PartialEq, Eq, Hash)] pub struct Group; impl AttributeKey for Group { const KEY: &'static str = "group"; } /// Adds a two-way binding to the element, which adds an attribute and an event listener to the /// element when the element is created or hydrated. pub trait BindAttribute<Key, Sig, T> where Key: AttributeKey, Sig: IntoSplitSignal<Value = T>, T: FromEventTarget + AttributeValue + 'static, { /// The type of the element with the two-way binding added. type Output; /// Adds a two-way binding to the element, which adds an attribute and an event listener to the /// element when the element is created or hydrated. /// /// Example: /// /// ```ignore /// // You can use `RwSignal`s /// let is_awesome = RwSignal::new(true); /// /// // And you can use split signals /// let (text, set_text) = signal("Hello world".to_string()); /// /// // Use `Checked` and a `bool` signal for a checkbox /// checkbox_element.bind(Checked, is_awesome); /// /// // Use `Group` and `String` for radio inputs /// radio_element.bind(Group, (text, set_text)); /// /// // Use `Value` and `String` for everything else /// input_element.bind(Value, (text, set_text)); /// ``` /// /// Depending on the input different events are listened to. /// - `<input type="checkbox">`, `<input type="radio">` and `<select>` use the `change` event; /// - `<input>` with the rest of the types and `<textarea>` elements use the `input` event; fn bind(self, key: Key, signal: Sig) -> Self::Output; } impl<V, Key, Sig, T> BindAttribute<Key, Sig, T> for V where V: AddAnyAttr, Key: AttributeKey, Sig: IntoSplitSignal<Value = T>, T: FromEventTarget + AttributeValue + PartialEq + Sync + 'static, Signal<BoolOrT<T>>: IntoProperty, <Sig as IntoSplitSignal>::Read: Get<Value = T> + Send + Sync + Clone + 'static, <Sig as IntoSplitSignal>::Write: Send + Clone + 'static, Element: GetValue<T>, { type Output = <Self as AddAnyAttr>::Output< Bind< Key, T, <Sig as IntoSplitSignal>::Read, <Sig as IntoSplitSignal>::Write, >, >; fn bind(self, key: Key, signal: Sig) -> Self::Output { self.add_any_attr(bind(key, signal)) } } /// Adds a two-way binding to the element, which adds an attribute and an event listener to the /// element when the element is created or hydrated. #[inline(always)] pub fn bind<Key, Sig, T>( key: Key, signal: Sig, ) -> Bind<Key, T, <Sig as IntoSplitSignal>::Read, <Sig as IntoSplitSignal>::Write> where Key: AttributeKey, Sig: IntoSplitSignal<Value = T>, T: FromEventTarget + AttributeValue + 'static, <Sig as IntoSplitSignal>::Read: Get<Value = T> + Clone + 'static, <Sig as IntoSplitSignal>::Write: Send + Clone + 'static, { let (read_signal, write_signal) = signal.into_split_signal(); Bind { key, read_signal, write_signal, } } /// Two-way binding of an attribute and an event listener #[derive(Debug)] pub struct Bind<Key, T, R, W> where Key: AttributeKey, T: FromEventTarget + AttributeValue + 'static, R: Get<Value = T> + Clone + 'static, W: Set<Value = T>, { key: Key, read_signal: R, write_signal: W, } impl<Key, T, R, W> Clone for Bind<Key, T, R, W> where Key: AttributeKey, T: FromEventTarget + AttributeValue + 'static, R: Get<Value = T> + Clone + 'static, W: Set<Value = T> + Clone, { fn clone(&self) -> Self { Self { key: self.key.clone(), read_signal: self.read_signal.clone(), write_signal: self.write_signal.clone(), } } } impl<Key, T, R, W> Bind<Key, T, R, W> where Key: AttributeKey, T: FromEventTarget + AttributeValue + PartialEq + Sync + 'static, R: Get<Value = T> + Clone + Send + Sync + 'static, W: Set<Value = T> + Clone + 'static, Element: ChangeEvent + GetValue<T>, { /// Attaches the event listener that updates the signal value to the element. pub fn attach(self, el: &Element) -> RemoveEventHandler<Element> { el.attach_change_event::<T, W>(Key::KEY, self.write_signal.clone()) } /// Creates the signal to update the value of the attribute. This signal is different /// when using a `"group"` attribute pub fn read_signal(&self, el: &Element) -> Signal<BoolOrT<T>> { let read_signal = self.read_signal.clone(); if Key::KEY == "group" { let el = SendWrapper::new(el.clone()); Signal::derive(move || { BoolOrT::Bool(el.get_value() == read_signal.get()) }) } else { Signal::derive(move || BoolOrT::T(read_signal.get())) } } /// Returns the key of the attribute. If the key is `"group"` it returns `"checked"`, otherwise /// the one which was provided originally. pub fn key(&self) -> &'static str { if Key::KEY == "group" { "checked" } else { Key::KEY } } } impl<Key, T, R, W> Attribute for Bind<Key, T, R, W> where Key: AttributeKey, T: FromEventTarget + AttributeValue + PartialEq + Sync + 'static, R: Get<Value = T> + Clone + Send + Sync + 'static, Signal<BoolOrT<T>>: IntoProperty, W: Set<Value = T> + Clone + Send + 'static, Element: ChangeEvent + GetValue<T>, { const MIN_LENGTH: usize = 0; type State = ( <Signal<BoolOrT<T>> as IntoProperty>::State, (Element, Option<RemoveEventHandler<Element>>), ); type AsyncOutput = Self; type Cloneable = Bind<Key, T, R, W>; type CloneableOwned = Bind<Key, T, R, W>; fn html_len(&self) -> usize { 0 } fn to_html( self, _buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, ) { } #[inline(always)] fn hydrate<const FROM_SERVER: bool>(self, el: &Element) -> Self::State { let signal = self.read_signal(el); let attr_state = prop(self.key(), signal).hydrate::<FROM_SERVER>(el); let cleanup = self.attach(el); (attr_state, (el.clone(), Some(cleanup))) } #[inline(always)] fn build(self, el: &Element) -> Self::State { let signal = self.read_signal(el); let attr_state = prop(self.key(), signal).build(el); let cleanup = self.attach(el); (attr_state, (el.clone(), Some(cleanup))) } #[inline(always)] fn rebuild(self, state: &mut Self::State) { let (attr_state, (el, prev_cleanup)) = state; let signal = self.read_signal(el); prop(self.key(), signal).rebuild(attr_state); if let Some(prev) = prev_cleanup.take() { if let Some(remove) = prev.into_inner() { remove(); } } *prev_cleanup = Some(self.attach(el)); } fn into_cloneable(self) -> Self::Cloneable { self.into_cloneable_owned() } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn keys(&self) -> Vec<NamedAttributeKey> { vec![] } } impl<Key, T, R, W> NextAttribute for Bind<Key, T, R, W> where Key: AttributeKey, T: FromEventTarget + AttributeValue + PartialEq + Sync + 'static, R: Get<Value = T> + Clone + Send + Sync + 'static, Signal<BoolOrT<T>>: IntoProperty, W: Set<Value = T> + Clone + Send + 'static, Element: ChangeEvent + GetValue<T>, { next_attr_output_type!(Self, NewAttr); fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { next_attr_combine!(self, new_attr) } } impl<Key, T, R, W> ToTemplate for Bind<Key, T, R, W> where Key: AttributeKey, T: FromEventTarget + AttributeValue + 'static, R: Get<Value = T> + Clone + 'static, W: Set<Value = T> + Clone, { #[inline(always)] fn to_template( _buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, _position: &mut Position, ) { } } /// Splits a combined signal into its read and write parts. /// /// This allows you to either provide a `RwSignal` or a tuple `(ReadSignal, WriteSignal)`. pub trait IntoSplitSignal { /// The actual contained value of the signal type Value; /// The read part of the signal type Read: Get<Value = Self::Value>; /// The write part of the signal type Write: Set<Value = Self::Value>; /// Splits a combined signal into its read and write parts. fn into_split_signal(self) -> (Self::Read, Self::Write); } impl<T> IntoSplitSignal for RwSignal<T> where T: Send + Sync + 'static, ReadSignal<T>: Get<Value = T>, { type Value = T; type Read = ReadSignal<T>; type Write = WriteSignal<T>; fn into_split_signal(self) -> (ReadSignal<T>, WriteSignal<T>) { self.split() } } impl<T, R, W> IntoSplitSignal for (R, W) where R: Get<Value = T>, W: Set<Value = T>, { type Value = T; type Read = R; type Write = W; fn into_split_signal(self) -> (Self::Read, Self::Write) { self } } #[cfg(feature = "reactive_stores")] impl<Inner, Prev, T> IntoSplitSignal for Subfield<Inner, Prev, T> where Self: Get<Value = T> + Set<Value = T> + Clone, { type Value = T; type Read = Self; type Write = Self; fn into_split_signal(self) -> (Self::Read, Self::Write) { (self.clone(), self.clone()) } } #[cfg(feature = "reactive_stores")] impl<T, S> IntoSplitSignal for Field<T, S> where Self: Get<Value = T> + Set<Value = T> + Clone, S: Storage<ArcField<T>>, { type Value = T; type Read = Self; type Write = Self; fn into_split_signal(self) -> (Self::Read, Self::Write) { (self, self) } } #[cfg(feature = "reactive_stores")] impl<Inner, Prev, K, T> IntoSplitSignal for KeyedSubfield<Inner, Prev, K, T> where Self: Get<Value = T> + Set<Value = T> + Clone, for<'a> &'a T: IntoIterator, { type Value = T; type Read = Self; type Write = Self; fn into_split_signal(self) -> (Self::Read, Self::Write) { (self.clone(), self.clone()) } } #[cfg(feature = "reactive_stores")] impl<Inner, Prev, K, T> IntoSplitSignal for AtKeyed<Inner, Prev, K, T> where Self: Get<Value = T> + Set<Value = T> + Clone, for<'a> &'a T: IntoIterator, { type Value = T; type Read = Self; type Write = Self; fn into_split_signal(self) -> (Self::Read, Self::Write) { (self.clone(), self.clone()) } } #[cfg(feature = "reactive_stores")] impl<Inner, Prev> IntoSplitSignal for AtIndex<Inner, Prev> where Prev: Send + Sync + IndexMut<usize> + 'static, Inner: Send + Sync + Clone + 'static, Self: Get<Value = Prev::Output> + Set<Value = Prev::Output> + Clone, Prev::Output: Sized, { type Value = Prev::Output; type Read = Self; type Write = Self; fn into_split_signal(self) -> (Self::Read, Self::Write) { (self.clone(), self.clone()) } } #[cfg(feature = "reactive_stores")] impl<S> IntoSplitSignal for DerefedField<S> where Self: Get<Value = <S::Value as Deref>::Target> + Set<Value = <S::Value as Deref>::Target> + Clone, S: Clone + StoreField + Send + Sync + 'static, <S as StoreField>::Value: Deref + DerefMut, <S::Value as Deref>::Target: Sized, { type Value = <S::Value as Deref>::Target; type Read = Self; type Write = Self; fn into_split_signal(self) -> (Self::Read, Self::Write) { (self.clone(), self.clone()) } } /// Returns self from an event target. pub trait FromEventTarget { /// Returns self from an event target. fn from_event_target(evt: &web_sys::Event) -> Self; } impl FromEventTarget for bool { fn from_event_target(evt: &web_sys::Event) -> Self { event_target_checked(evt) } } impl FromEventTarget for String { fn from_event_target(evt: &web_sys::Event) -> Self { event_target_value(evt) } } /// Attaches the appropriate change event listener to the element. /// - `<input>` with text types and `<textarea>` elements use the `input` event; /// - `<input type="checkbox">`, `<input type="radio">` and `<select>` use the `change` event; pub trait ChangeEvent { /// Attaches the appropriate change event listener to the element. fn attach_change_event<T, W>( &self, key: &str, write_signal: W, ) -> RemoveEventHandler<Self> where T: FromEventTarget + AttributeValue + 'static, W: Set<Value = T> + 'static, Self: Sized; } impl ChangeEvent for web_sys::Element { fn attach_change_event<T, W>( &self, key: &str, write_signal: W, ) -> RemoveEventHandler<Self> where T: FromEventTarget + AttributeValue + 'static, W: Set<Value = T> + 'static, { if key == "group" { let handler = move |evt| { let checked = event_target_checked(&evt); if checked { write_signal.try_set(T::from_event_target(&evt)); } }; on::<_, _>(change, handler).attach(self) } else { let handler = move |evt| { write_signal.try_set(T::from_event_target(&evt)); }; if key == "checked" || self.tag_name() == "SELECT" { on::<_, _>(change, handler).attach(self) } else { on::<_, _>(input, handler).attach(self) } } } } /// Get the value attribute of an element (input). /// Reads `value` if `T` is `String` and `checked` if `T` is `bool`. pub trait GetValue<T> { /// Get the value attribute of an element (input). fn get_value(&self) -> T; } impl GetValue<String> for web_sys::Element { fn get_value(&self) -> String { self.get_attribute("value").unwrap_or_default() } } impl GetValue<bool> for web_sys::Element { fn get_value(&self) -> bool { self.get_attribute("checked").unwrap_or_default() == "true" } } #[derive(Debug, Clone, PartialEq, Eq, Hash)] /// Bool or a type. Needed to make the `group` attribute work. It is decided at runtime /// if the derived signal value is a bool or a type `T`. pub enum BoolOrT<T> { /// We have definitely a boolean value for the `group` attribute Bool(bool), /// Standard case with some type `T` T(T), } impl<T> IntoProperty for BoolOrT<T> where T: IntoProperty<State = (Element, JsValue)> + Into<JsValue> + Clone + 'static, { type State = (Element, JsValue); type Cloneable = Self; type CloneableOwned = Self; fn hydrate<const FROM_SERVER: bool>( self, el: &Element, key: &str, ) -> Self::State { match self.clone() { Self::T(s) => { s.hydrate::<FROM_SERVER>(el, key); } Self::Bool(b) => { <bool as IntoProperty>::hydrate::<FROM_SERVER>(b, el, key); } }; (el.clone(), self.into()) } fn build(self, el: &Element, key: &str) -> Self::State { match self.clone() { Self::T(s) => { s.build(el, key); } Self::Bool(b) => { <bool as IntoProperty>::build(b, el, key); } } (el.clone(), self.into()) } fn rebuild(self, state: &mut Self::State, key: &str) { let (el, prev) = state; match self { Self::T(s) => s.rebuild(&mut (el.clone(), prev.clone()), key), Self::Bool(b) => <bool as IntoProperty>::rebuild( b, &mut (el.clone(), prev.clone()), key, ), } } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } } impl<T> From<BoolOrT<T>> for JsValue where T: Into<JsValue>, { fn from(value: BoolOrT<T>) -> Self { match value { BoolOrT::Bool(b) => b.into(), BoolOrT::T(t) => t.into(), } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/reactive_graph/class.rs
tachys/src/reactive_graph/class.rs
use super::{ReactiveFunction, SharedReactiveFunction}; use crate::{html::class::IntoClass, renderer::Rndr}; use reactive_graph::effect::RenderEffect; use std::borrow::Borrow; pub struct RenderEffectWithClassName<T> where T: 'static, { name: &'static str, effect: RenderEffect<T>, } impl<T> RenderEffectWithClassName<T> where T: 'static, { fn new(name: &'static str, effect: RenderEffect<T>) -> Self { Self { effect, name } } } impl<F, C> IntoClass for F where F: ReactiveFunction<Output = C>, C: IntoClass + 'static, C::State: 'static, { type AsyncOutput = C::AsyncOutput; type State = RenderEffect<C::State>; type Cloneable = SharedReactiveFunction<C>; type CloneableOwned = SharedReactiveFunction<C>; fn html_len(&self) -> usize { 0 } fn to_html(mut self, class: &mut String) { let value = self.invoke(); value.to_html(class); } fn hydrate<const FROM_SERVER: bool>( mut self, el: &crate::renderer::types::Element, ) -> Self::State { // TODO FROM_SERVER vs template let el = el.clone(); RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { value.hydrate::<FROM_SERVER>(&el) } }) } fn build(mut self, el: &crate::renderer::types::Element) -> Self::State { let el = el.to_owned(); RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { value.build(&el) } }) } fn rebuild(mut self, state: &mut Self::State) { let prev_value = state.take_value(); *state = RenderEffect::new_with_value( move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { unreachable!() } }, prev_value, ); } fn into_cloneable(self) -> Self::Cloneable { self.into_shared() } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.into_shared() } fn dry_resolve(&mut self) { self.invoke().dry_resolve(); } async fn resolve(mut self) -> Self::AsyncOutput { self.invoke().resolve().await } fn reset(state: &mut Self::State) { *state = RenderEffect::new_with_value( move |prev| { if let Some(mut state) = prev { C::reset(&mut state); state } else { unreachable!() } }, state.take_value(), ); } } impl<F, T> IntoClass for (&'static str, F) where F: ReactiveFunction<Output = T>, T: Borrow<bool> + Send + 'static, { type AsyncOutput = (&'static str, bool); type State = RenderEffectWithClassName<(crate::renderer::types::ClassList, bool)>; type Cloneable = (&'static str, SharedReactiveFunction<T>); type CloneableOwned = (&'static str, SharedReactiveFunction<T>); fn html_len(&self) -> usize { self.0.len() } fn to_html(self, class: &mut String) { let (name, mut f) = self; let include = *f.invoke().borrow(); if include { <&str as IntoClass>::to_html(name, class); } } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { // TODO FROM_SERVER vs template let (name, mut f) = self; let class_list = Rndr::class_list(el); let name = Rndr::intern(name); RenderEffectWithClassName::new( name, RenderEffect::new( move |prev: Option<( crate::renderer::types::ClassList, bool, )>| { let include = *f.invoke().borrow(); if let Some((class_list, prev)) = prev { if include { if !prev { Rndr::add_class(&class_list, name); } } else if prev { Rndr::remove_class(&class_list, name); } } (class_list.clone(), include) }, ), ) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { let (name, mut f) = self; let class_list = Rndr::class_list(el); let name = Rndr::intern(name); RenderEffectWithClassName::new( name, RenderEffect::new( move |prev: Option<( crate::renderer::types::ClassList, bool, )>| { let include = *f.invoke().borrow(); match prev { Some((class_list, prev)) => { if include { if !prev { Rndr::add_class(&class_list, name); } } else if prev { Rndr::remove_class(&class_list, name); } } None => { if include { Rndr::add_class(&class_list, name); } } } (class_list.clone(), include) }, ), ) } fn rebuild(self, state: &mut Self::State) { let (name, mut f) = self; let prev_name = state.name; let prev_state = state.effect.take_value(); if let Some((list, prev_include)) = &prev_state { if prev_name != name && *prev_include { Rndr::remove_class(list, prev_name); } } // Name might've updated: state.name = name; let mut first_run = true; state.effect = RenderEffect::new_with_value( move |prev| { let include = *f.invoke().borrow(); match prev { Some((class_list, prev)) => { if include { if !prev || first_run { Rndr::add_class(&class_list, name); } } else if prev { Rndr::remove_class(&class_list, name); } first_run = false; (class_list.clone(), include) } None => { unreachable!() } } }, prev_state, ); } fn into_cloneable(self) -> Self::Cloneable { (self.0, self.1.into_shared()) } fn into_cloneable_owned(self) -> Self::CloneableOwned { (self.0, self.1.into_shared()) } fn dry_resolve(&mut self) { self.1.invoke(); } async fn resolve(mut self) -> Self::AsyncOutput { (self.0, *self.1.invoke().borrow()) } fn reset(state: &mut Self::State) { let name = state.name; state.effect = RenderEffect::new_with_value( move |prev| { if let Some(mut state) = prev { let (class_list, prev) = &mut state; Rndr::remove_class(class_list, name); *prev = false; state } else { unreachable!() } }, state.effect.take_value(), ); } } // TODO this needs a non-reactive form too to be restored /* impl<F, T> IntoClass for (Vec<Cow<'static, str>>, F) where F: ReactiveFunction<Output = T>, T: Borrow<bool> + Send + 'static, { type AsyncOutput = (Vec<Cow<'static, str>>, bool); type State = RenderEffect<(crate::renderer::types::ClassList, bool)>; type Cloneable = (Vec<Cow<'static, str>>, SharedReactiveFunction<T>); type CloneableOwned = (Vec<Cow<'static, str>>, SharedReactiveFunction<T>); fn html_len(&self) -> usize { self.0.iter().map(|n| n.len()).sum() } fn to_html(self, class: &mut String) { let (names, mut f) = self; let include = *f.invoke().borrow(); if include { for name in names { <&str as IntoClass>::to_html(&name, class); } } } fn hydrate<const FROM_SERVER: bool>(self, el: &crate::renderer::types::Element) -> Self::State { // TODO FROM_SERVER vs template let (names, mut f) = self; let class_list = Rndr::class_list(el); RenderEffect::new(move |prev: Option<(crate::renderer::types::ClassList, bool)>| { let include = *f.invoke().borrow(); if let Some((class_list, prev)) = prev { if include { if !prev { for name in &names { // TODO multi-class optimizations here Rndr::add_class(&class_list, name); } } } else if prev { for name in &names { Rndr::remove_class(&class_list, name); } } } (class_list.clone(), include) }) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { let (names, mut f) = self; let class_list = Rndr::class_list(el); RenderEffect::new(move |prev: Option<(crate::renderer::types::ClassList, bool)>| { let include = *f.invoke().borrow(); match prev { Some((class_list, prev)) => { if include { for name in &names { if !prev { Rndr::add_class(&class_list, name); } } } else if prev { for name in &names { Rndr::remove_class(&class_list, name); } } } None => { if include { for name in &names { Rndr::add_class(&class_list, name); } } } } (class_list.clone(), include) }) } fn rebuild(self, state: &mut Self::State) { let (names, mut f) = self; let prev_value = state.take_value(); *state = RenderEffect::new_with_value( move |prev: Option<(crate::renderer::types::ClassList, bool)>| { let include = *f.invoke().borrow(); match prev { Some((class_list, prev)) => { if include { for name in &names { if !prev { Rndr::add_class(&class_list, name); } } } else if prev { for name in &names { Rndr::remove_class(&class_list, name); } } (class_list.clone(), include) } None => { unreachable!() } } }, prev_value, ); } fn into_cloneable(self) -> Self::Cloneable { (self.0.clone(), self.1.into_shared()) } fn into_cloneable_owned(self) -> Self::CloneableOwned { (self.0.clone(), self.1.into_shared()) } fn dry_resolve(&mut self) { self.1.invoke(); } async fn resolve(mut self) -> Self::AsyncOutput { (self.0, *self.1.invoke().borrow()) } } */ /* impl<G> IntoClass for ReadGuard<String, G> where G: Deref<Target = String> + Send, { type AsyncOutput = Self; type State = <String as IntoClass>::State; type Cloneable = Arc<str>; type CloneableOwned = Arc<str>; fn html_len(&self) -> usize { self.len() } fn to_html(self, class: &mut String) { <&str as IntoClass>::to_html(self.deref().as_str(), class); } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { <String as IntoClass>::hydrate::<FROM_SERVER>( self.deref().to_owned(), el, ) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { <String as IntoClass>::build(self.deref().to_owned(), el) } fn rebuild(self, state: &mut Self::State) { <String as IntoClass>::rebuild(self.deref().to_owned(), state) } fn into_cloneable(self) -> Self::Cloneable { self.as_str().into() } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.as_str().into() } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } impl<G> IntoClass for (&'static str, ReadGuard<bool, G>) where G: Deref<Target = bool> + Send, { type AsyncOutput = Self; type State = <(&'static str, bool) as IntoClass>::State; type Cloneable = (&'static str, bool); type CloneableOwned = (&'static str, bool); fn html_len(&self) -> usize { self.0.len() } fn to_html(self, class: &mut String) { <(&'static str, bool) as IntoClass>::to_html( (self.0, *self.1.deref()), class, ); } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { <(&'static str, bool) as IntoClass>::hydrate::<FROM_SERVER>( (self.0, *self.1.deref()), el, ) } fn build(self, el: &crate::renderer::types::Element) -> Self::State { <(&'static str, bool) as IntoClass>::build( (self.0, *self.1.deref()), el, ) } fn rebuild(self, state: &mut Self::State) { <(&'static str, bool) as IntoClass>::rebuild( (self.0, *self.1.deref()), state, ) } fn into_cloneable(self) -> Self::Cloneable { (self.0, *self.1) } fn into_cloneable_owned(self) -> Self::CloneableOwned { (self.0, *self.1) } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } */ macro_rules! tuple_class_reactive { ($name:ident, <$($impl_gen:ident),*>, <$($gen:ident),*> , $( $where_clause:tt )*) => { #[allow(deprecated)] impl<$($impl_gen),*> IntoClass for (&'static str, $name<$($gen),*>) where $($where_clause)* { type AsyncOutput = Self; type State = RenderEffectWithClassName<( crate::renderer::types::ClassList, bool, )>; type Cloneable = Self; type CloneableOwned = Self; fn html_len(&self) -> usize { self.0.len() } fn to_html(self, class: &mut String) { let (name, f) = self; let include = f.get(); if include { <&str as IntoClass>::to_html(name, class); } } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { IntoClass::hydrate::<FROM_SERVER>( (self.0, move || self.1.get()), el, ) } fn build( self, el: &crate::renderer::types::Element, ) -> Self::State { IntoClass::build((self.0, move || self.1.get()), el) } fn rebuild(self, state: &mut Self::State) { IntoClass::rebuild((self.0, move || self.1.get()), state) } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn reset(state: &mut Self::State) { let name = state.name; *state = RenderEffectWithClassName::new( state.name, RenderEffect::new_with_value( move |prev| { if let Some(mut state) = prev { let (class_list, prev) = &mut state; Rndr::remove_class(class_list, name); *prev = false; state } else { unreachable!() } }, state.effect.take_value(), ), ); } } }; } macro_rules! class_reactive { ($name:ident, <$($gen:ident),*>, $v:ty, $( $where_clause:tt )*) => { #[allow(deprecated)] impl<$($gen),*> IntoClass for $name<$($gen),*> where $v: IntoClass + Clone + Send + Sync + 'static, <$v as IntoClass>::State: 'static, $($where_clause)* { type AsyncOutput = Self; type State = RenderEffect<<$v as IntoClass>::State>; type Cloneable = Self; type CloneableOwned = Self; fn html_len(&self) -> usize { 0 } fn to_html(self, class: &mut String) { let value = self.get(); value.to_html(class); } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { (move || self.get()).hydrate::<FROM_SERVER>(el) } fn build( self, el: &crate::renderer::types::Element, ) -> Self::State { (move || self.get()).build(el) } fn rebuild(self, state: &mut Self::State) { (move || self.get()).rebuild(state) } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn reset(state: &mut Self::State) { *state = RenderEffect::new_with_value( move |prev| { if let Some(mut state) = prev { <$v>::reset(&mut state); state } else { unreachable!() } }, state.take_value(), ); } } }; } #[cfg(not(feature = "nightly"))] mod stable { use super::{RenderEffect, RenderEffectWithClassName}; use crate::{html::class::IntoClass, renderer::Rndr}; #[allow(deprecated)] use reactive_graph::wrappers::read::MaybeSignal; use reactive_graph::{ computed::{ArcMemo, Memo}, owner::Storage, signal::{ArcReadSignal, ArcRwSignal, ReadSignal, RwSignal}, traits::Get, wrappers::read::{ArcSignal, Signal}, }; class_reactive!( RwSignal, <V, S>, V, RwSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); class_reactive!( ReadSignal, <V, S>, V, ReadSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); class_reactive!( Memo, <V, S>, V, Memo<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); class_reactive!( Signal, <V, S>, V, Signal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); class_reactive!( MaybeSignal, <V, S>, V, MaybeSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); class_reactive!(ArcRwSignal, <V>, V, ArcRwSignal<V>: Get<Value = V>); class_reactive!(ArcReadSignal, <V>, V, ArcReadSignal<V>: Get<Value = V>); class_reactive!(ArcMemo, <V>, V, ArcMemo<V>: Get<Value = V>); class_reactive!(ArcSignal, <V>, V, ArcSignal<V>: Get<Value = V>); tuple_class_reactive!( RwSignal, <S>, <bool, S>, RwSignal<bool, S>: Get<Value = bool>, S: Storage<bool>, S: Send + 'static, ); tuple_class_reactive!( ReadSignal, <S>, <bool, S>, ReadSignal<bool, S>: Get<Value = bool>, S: Storage<bool>, S: Send + 'static, ); tuple_class_reactive!( Memo, <S>, <bool, S>, Memo<bool, S>: Get<Value = bool>, S: Storage<bool>, S: Send + 'static, ); tuple_class_reactive!( Signal, <S>, <bool, S>, Signal<bool, S>: Get<Value = bool>, S: Storage<bool>, S: Send + 'static, ); tuple_class_reactive!( MaybeSignal, <S>, <bool, S>, MaybeSignal<bool, S>: Get<Value = bool>, S: Storage<bool>, S: Send + 'static, ); tuple_class_reactive!(ArcRwSignal,<>, <bool>, ArcRwSignal<bool>: Get<Value = bool>); tuple_class_reactive!(ArcReadSignal,<>, <bool>, ArcReadSignal<bool>: Get<Value = bool>); tuple_class_reactive!(ArcMemo,<>, <bool>, ArcMemo<bool>: Get<Value = bool>); tuple_class_reactive!(ArcSignal,<>, <bool>, ArcSignal<bool>: Get<Value = bool>); } #[cfg(feature = "reactive_stores")] mod reactive_stores { use super::{RenderEffect, RenderEffectWithClassName}; use crate::{html::class::IntoClass, renderer::Rndr}; #[allow(deprecated)] use reactive_graph::{owner::Storage, traits::Get}; use reactive_stores::{ ArcField, ArcStore, AtIndex, AtKeyed, DerefedField, Field, KeyedSubfield, Store, StoreField, Subfield, }; use std::ops::{Deref, DerefMut, Index, IndexMut}; class_reactive!( Subfield, <Inner, Prev, V>, V, Subfield<Inner, Prev, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, ); class_reactive!( AtKeyed, <Inner, Prev, K, V>, V, AtKeyed<Inner, Prev, K, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a V: IntoIterator, ); class_reactive!( KeyedSubfield, <Inner, Prev, K, V>, V, KeyedSubfield<Inner, Prev, K, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a V: IntoIterator, ); class_reactive!( DerefedField, <S>, <S::Value as Deref>::Target, S: Clone + StoreField + Send + Sync + 'static, <S as StoreField>::Value: Deref + DerefMut ); class_reactive!( AtIndex, <Inner, Prev>, <Prev as Index<usize>>::Output, AtIndex<Inner, Prev>: Get<Value = Prev::Output>, Prev: Send + Sync + IndexMut<usize> + 'static, Inner: Send + Sync + Clone + 'static, ); class_reactive!( Store, <V, S>, V, Store<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); class_reactive!( Field, <V, S>, V, Field<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); class_reactive!(ArcStore, <V>, V, ArcStore<V>: Get<Value = V>); class_reactive!(ArcField, <V>, V, ArcField<V>: Get<Value = V>); tuple_class_reactive!( Subfield, <Inner, Prev>, <Inner, Prev, bool>, Subfield<Inner, Prev, bool>: Get<Value = bool>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, ); tuple_class_reactive!( AtKeyed, <Inner, Prev, K>, <Inner, Prev, K, bool>, AtKeyed<Inner, Prev, K, bool>: Get<Value = bool>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a bool: IntoIterator, ); tuple_class_reactive!( KeyedSubfield, <Inner, Prev, K>, <Inner, Prev, K, bool>, KeyedSubfield<Inner, Prev, K, bool>: Get<Value = bool>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a bool: IntoIterator, ); tuple_class_reactive!( DerefedField, <S>, <S>, S: Clone + StoreField + Send + Sync + 'static, <S as StoreField>::Value: Deref<Target = bool> + DerefMut ); tuple_class_reactive!( AtIndex, <Inner, Prev>, <Inner, Prev>, AtIndex<Inner, Prev>: Get<Value = Prev::Output>, Prev: Send + Sync + IndexMut<usize,Output = bool> + 'static, Inner: Send + Sync + Clone + 'static, ); tuple_class_reactive!( Store, <S>, <bool, S>, Store<bool, S>: Get<Value = bool>, S: Storage<bool>, S: Send + 'static, ); tuple_class_reactive!( Field, <S>, <bool, S>, Field<bool, S>: Get<Value = bool>, S: Storage<bool>, S: Send + 'static, ); tuple_class_reactive!(ArcStore,<>, <bool>, ArcStore<bool>: Get<Value = bool>); tuple_class_reactive!(ArcField,<>, <bool>, ArcField<bool>: Get<Value = bool>); } /* impl<Fut> IntoClass for Suspend<Fut> where Fut: Clone + Future + Send + 'static, Fut::Output: IntoClass, { type AsyncOutput = Fut::Output; type State = Rc<RefCell<Option<<Fut::Output as IntoClass>::State>>>; type Cloneable = Self; type CloneableOwned = Self; fn html_len(&self) -> usize { 0 } fn to_html(self, style: &mut String) { if let Some(inner) = self.inner.now_or_never() { inner.to_html(style); } else { panic!("You cannot use Suspend on an attribute outside Suspense"); } } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { let el = el.to_owned(); let state = Rc::new(RefCell::new(None)); reactive_graph::spawn_local_scoped({ let state = Rc::clone(&state); async move { *state.borrow_mut() = Some(self.inner.await.hydrate::<FROM_SERVER>(&el)); self.subscriber.forward(); } }); state } fn build(self, el: &crate::renderer::types::Element) -> Self::State { let el = el.to_owned(); let state = Rc::new(RefCell::new(None)); reactive_graph::spawn_local_scoped({ let state = Rc::clone(&state); async move { *state.borrow_mut() = Some(self.inner.await.build(&el)); self.subscriber.forward(); } }); state } fn rebuild(self, state: &mut Self::State) { reactive_graph::spawn_local_scoped({ let state = Rc::clone(state); async move { let value = self.inner.await; let mut state = state.borrow_mut(); if let Some(state) = state.as_mut() { value.rebuild(state); } self.subscriber.forward(); } }); } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self.inner.await } } */
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/reactive_graph/node_ref.rs
tachys/src/reactive_graph/node_ref.rs
use crate::html::{element::ElementType, node_ref::NodeRefContainer}; use reactive_graph::{ effect::Effect, graph::untrack, signal::{ guards::{Derefable, ReadGuard}, RwSignal, }, traits::{ DefinedAt, Get, IsDisposed, Notify, ReadUntracked, Set, Track, UntrackableGuard, Write, }, }; use send_wrapper::SendWrapper; use std::{cell::Cell, ops::DerefMut}; use wasm_bindgen::JsCast; /// A reactive reference to a DOM node that can be used with the `node_ref` attribute. #[derive(Debug)] pub struct NodeRef<E>(RwSignal<Option<SendWrapper<E::Output>>>) where E: ElementType, E::Output: 'static; impl<E> NodeRef<E> where E: ElementType, E::Output: 'static, { /// Creates a new node reference. #[track_caller] pub fn new() -> Self { Self(RwSignal::new(None)) } /// Runs the provided closure when the `NodeRef` has been connected /// with its element. #[inline(always)] pub fn on_load<F>(self, f: F) where E: 'static, F: FnOnce(E::Output) + 'static, E: ElementType, E::Output: JsCast + Clone + 'static, { let f = Cell::new(Some(f)); Effect::new(move |_| { if let Some(node_ref) = self.get() { let f = f.take().unwrap(); untrack(move || { f(node_ref); }); } }); } } impl<E> Default for NodeRef<E> where E: ElementType, E::Output: 'static, { fn default() -> Self { Self::new() } } impl<E> Clone for NodeRef<E> where E: ElementType, E::Output: 'static, { fn clone(&self) -> Self { *self } } impl<E> Copy for NodeRef<E> where E: ElementType, E::Output: 'static, { } impl<E> NodeRefContainer<E> for NodeRef<E> where E: ElementType, E::Output: JsCast + 'static, { fn load(self, el: &crate::renderer::types::Element) { // safe to construct SendWrapper here, because it will only run in the browser // so it will always be accessed or dropped from the main thread self.0 .set(Some(SendWrapper::new(el.clone().unchecked_into()))); } } impl<E> DefinedAt for NodeRef<E> where E: ElementType, E::Output: JsCast + 'static, { fn defined_at(&self) -> Option<&'static std::panic::Location<'static>> { self.0.defined_at() } } impl<E> Notify for NodeRef<E> where E: ElementType, E::Output: JsCast + Clone + 'static, { fn notify(&self) { self.0.notify(); } } impl<E> Write for NodeRef<E> where E: ElementType, E::Output: JsCast + Clone + 'static, { type Value = Option<SendWrapper<E::Output>>; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { self.0.try_write() } fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { self.0.try_write_untracked() } } impl<E> ReadUntracked for NodeRef<E> where E: ElementType, E::Output: JsCast + Clone + 'static, { type Value = ReadGuard<Option<E::Output>, Derefable<Option<E::Output>>>; fn try_read_untracked(&self) -> Option<Self::Value> { Some(ReadGuard::new(Derefable( self.0.try_read_untracked()?.as_deref().cloned(), ))) } } impl<E> Track for NodeRef<E> where E: ElementType, E::Output: JsCast + 'static, { fn track(&self) { self.0.track(); } } impl<E> IsDisposed for NodeRef<E> where E: ElementType, E::Output: 'static, { fn is_disposed(&self) -> bool { self.0.is_disposed() } } /// Create a [NodeRef]. #[inline(always)] #[track_caller] #[deprecated = "This function is being removed to conform to Rust idioms. \ Please use `NodeRef::new()` instead."] pub fn create_node_ref<E>() -> NodeRef<E> where E: ElementType, E::Output: 'static, { NodeRef::new() }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/reactive_graph/owned.rs
tachys/src/reactive_graph/owned.rs
use crate::{ html::attribute::{any_attribute::AnyAttribute, Attribute}, hydration::Cursor, prelude::Mountable, ssr::StreamBuilder, view::{add_attr::AddAnyAttr, Position, PositionState, Render, RenderHtml}, }; use reactive_graph::{computed::ScopedFuture, owner::Owner}; /// A view wrapper that sets the reactive [`Owner`] to a particular owner whenever it is rendered. #[derive(Debug, Clone)] pub struct OwnedView<T> { owner: Owner, view: T, } impl<T> OwnedView<T> { /// Wraps a view with the current owner. pub fn new(view: T) -> Self { let owner = Owner::current().expect("no reactive owner"); Self { owner, view } } /// Wraps a view with the given owner. pub fn new_with_owner(view: T, owner: Owner) -> Self { Self { owner, view } } } /// Retained view state for an [`OwnedView`]. #[derive(Debug, Clone)] pub struct OwnedViewState<T> where T: Mountable, { owner: Owner, state: T, } impl<T> OwnedViewState<T> where T: Mountable, { /// Wraps a state with the given owner. fn new(state: T, owner: Owner) -> Self { Self { owner, state } } } impl<T> Render for OwnedView<T> where T: Render, { type State = OwnedViewState<T::State>; fn build(self) -> Self::State { let state = self.owner.with(|| self.view.build()); OwnedViewState::new(state, self.owner) } fn rebuild(self, state: &mut Self::State) { let OwnedView { owner, view, .. } = self; owner.with(|| view.rebuild(&mut state.state)); state.owner = owner; } } impl<T> AddAnyAttr for OwnedView<T> where T: AddAnyAttr, { type Output<SomeNewAttr: Attribute> = OwnedView<T::Output<SomeNewAttr>>; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let OwnedView { owner, view } = self; OwnedView { owner, view: view.add_any_attr(attr), } } } impl<T> RenderHtml for OwnedView<T> where T: RenderHtml, { // TODO type AsyncOutput = OwnedView<T::AsyncOutput>; type Owned = OwnedView<T::Owned>; const MIN_LENGTH: usize = T::MIN_LENGTH; fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { self.owner.with(|| { self.view.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ) }); } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { self.owner.with(|| { self.view.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ) }); // if self.owner drops here, it can be disposed before the asynchronous rendering process // has actually happened // instead, we'll stuff it into the cleanups of its parent so that it will remain alive at // least as long as the parent does Owner::on_cleanup(move || drop(self.owner)); } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let state = self .owner .with(|| self.view.hydrate::<FROM_SERVER>(cursor, position)); OwnedViewState::new(state, self.owner) } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let state = self .owner .with(|| { ScopedFuture::new(self.view.hydrate_async(cursor, position)) }) .await; OwnedViewState::new(state, self.owner) } async fn resolve(self) -> Self::AsyncOutput { let OwnedView { owner, view } = self; let view = owner .with(|| ScopedFuture::new(async move { view.resolve().await })) .await; OwnedView { owner, view } } fn dry_resolve(&mut self) { self.owner.with(|| self.view.dry_resolve()); } fn into_owned(self) -> Self::Owned { OwnedView { owner: self.owner, view: self.view.into_owned(), } } } impl<T> Mountable for OwnedViewState<T> where T: Mountable, { fn unmount(&mut self) { self.state.unmount(); } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { self.state.mount(parent, marker); } fn try_mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) -> bool { self.state.try_mount(parent, marker) } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.state.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.state.elements() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/reactive_graph/mod.rs
tachys/src/reactive_graph/mod.rs
use crate::{ html::attribute::{any_attribute::AnyAttribute, Attribute, AttributeValue}, hydration::Cursor, renderer::Rndr, ssr::StreamBuilder, view::{ add_attr::AddAnyAttr, Mountable, Position, PositionState, Render, RenderHtml, ToTemplate, }, }; use reactive_graph::effect::RenderEffect; use std::{ cell::RefCell, rc::Rc, sync::{Arc, Mutex}, }; /// Types for two way data binding. pub mod bind; mod class; mod inner_html; /// Provides a reactive [`NodeRef`](node_ref::NodeRef) type. pub mod node_ref; mod owned; mod property; mod style; mod suspense; pub use owned::*; pub use suspense::*; impl<F, V> ToTemplate for F where F: ReactiveFunction<Output = V>, V: ToTemplate, { const TEMPLATE: &'static str = V::TEMPLATE; fn to_template( buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, position: &mut Position, ) { // FIXME this seems wrong V::to_template(buf, class, style, inner_html, position) } } impl<F, V> Render for F where F: ReactiveFunction<Output = V>, V: Render, V::State: 'static, { type State = RenderEffectState<V::State>; #[track_caller] fn build(mut self) -> Self::State { let hook = throw_error::get_error_hook(); RenderEffect::new(move |prev| { let _guard = hook .as_ref() .map(|h| throw_error::set_error_hook(Arc::clone(h))); let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { value.build() } }) .into() } #[track_caller] fn rebuild(self, state: &mut Self::State) { let new = self.build(); let mut old = std::mem::replace(state, new); old.insert_before_this(state); old.unmount(); } } /// Retained view state for a [`RenderEffect`]. pub struct RenderEffectState<T: 'static>(Option<RenderEffect<T>>); impl<T> From<RenderEffect<T>> for RenderEffectState<T> { fn from(value: RenderEffect<T>) -> Self { Self(Some(value)) } } impl<T> Mountable for RenderEffectState<T> where T: Mountable, { fn unmount(&mut self) { if let Some(ref mut inner) = self.0 { inner.unmount(); } } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { if let Some(ref mut inner) = self.0 { inner.mount(parent, marker); } } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { if let Some(inner) = &self.0 { inner.insert_before_this(child) } else { false } } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.0 .as_ref() .map(|inner| inner.elements()) .unwrap_or_default() } } impl<F, V> RenderHtml for F where F: ReactiveFunction<Output = V>, V: RenderHtml + 'static, V::State: 'static, { type AsyncOutput = V::AsyncOutput; type Owned = Self; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) { self.invoke().dry_resolve(); } async fn resolve(mut self) -> Self::AsyncOutput { self.invoke().resolve().await } fn html_len(&self) -> usize { V::MIN_LENGTH } fn to_html_with_buf( mut self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { let value = self.invoke(); value.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ) } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( mut self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { let value = self.invoke(); value.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); } fn hydrate<const FROM_SERVER: bool>( mut self, cursor: &Cursor, position: &PositionState, ) -> Self::State { /// codegen optimisation: fn prep( cursor: &Cursor, position: &PositionState, ) -> ( Cursor, PositionState, Option<Arc<dyn throw_error::ErrorHook>>, ) { let cursor = cursor.clone(); let position = position.clone(); let hook = throw_error::get_error_hook(); (cursor, position, hook) } let (cursor, position, hook) = prep(cursor, position); RenderEffect::new(move |prev| { /// codegen optimisation: fn get_guard( hook: &Option<Arc<dyn throw_error::ErrorHook>>, ) -> Option<throw_error::ResetErrorHookOnDrop> { hook.as_ref() .map(|h| throw_error::set_error_hook(Arc::clone(h))) } let _guard = get_guard(&hook); let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { value.hydrate::<FROM_SERVER>(&cursor, &position) } }) .into() } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { /// codegen optimisation: fn prep( cursor: &Cursor, position: &PositionState, ) -> ( Cursor, PositionState, Option<Arc<dyn throw_error::ErrorHook>>, ) { let cursor = cursor.clone(); let position = position.clone(); let hook = throw_error::get_error_hook(); (cursor, position, hook) } let (cursor, position, hook) = prep(cursor, position); let mut fun = self.into_shared(); RenderEffect::new_with_async_value( { let mut fun = fun.clone(); move |prev| { /// codegen optimisation: fn get_guard( hook: &Option<Arc<dyn throw_error::ErrorHook>>, ) -> Option<throw_error::ResetErrorHookOnDrop> { hook.as_ref() .map(|h| throw_error::set_error_hook(Arc::clone(h))) } let _guard = get_guard(&hook); let value = fun.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { unreachable!() } } }, async move { fun.invoke().hydrate_async(&cursor, &position).await }, ) .await .into() } fn into_owned(self) -> Self::Owned { self } } impl<F, V> AddAnyAttr for F where F: ReactiveFunction<Output = V>, V: RenderHtml + 'static, { type Output<SomeNewAttr: Attribute> = Box<dyn FnMut() -> V::Output<SomeNewAttr::CloneableOwned> + Send>; fn add_any_attr<NewAttr: Attribute>( mut self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let attr = attr.into_cloneable_owned(); Box::new(move || self.invoke().add_any_attr(attr.clone())) } } impl<M> Mountable for RenderEffect<M> where M: Mountable + 'static, { fn unmount(&mut self) { self.with_value_mut(|state| state.unmount()); } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { self.with_value_mut(|state| { state.mount(parent, marker); }); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.with_value_mut(|value| value.insert_before_this(child)) .unwrap_or(false) } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.with_value_mut(|inner| inner.elements()) .unwrap_or_default() } } impl<T> Drop for RenderEffectState<T> { fn drop(&mut self) { if let Some(effect) = self.0.take() { drop(effect.take_value()); drop(effect); } } } impl<M, E> Mountable for Result<M, E> where M: Mountable, { fn unmount(&mut self) { if let Ok(ref mut inner) = self { inner.unmount(); } } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { if let Ok(ref mut inner) = self { inner.mount(parent, marker); } } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { if let Ok(inner) = &self { inner.insert_before_this(child) } else { false } } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.as_ref() .map(|inner| inner.elements()) .unwrap_or_default() } } // Dynamic attributes impl<F, V> AttributeValue for F where F: ReactiveFunction<Output = V>, V: AttributeValue + 'static, V::State: 'static, { type AsyncOutput = V::AsyncOutput; type State = RenderEffect<V::State>; type Cloneable = SharedReactiveFunction<V>; type CloneableOwned = SharedReactiveFunction<V>; fn html_len(&self) -> usize { 0 } fn to_html(mut self, key: &str, buf: &mut String) { let value = self.invoke(); value.to_html(key, buf); } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( mut self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State { let key = Rndr::intern(key); let key = key.to_owned(); let el = el.to_owned(); RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&key, &mut state); state } else { value.hydrate::<FROM_SERVER>(&key, &el) } }) } fn build( mut self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { let key = Rndr::intern(key); let key = key.to_owned(); let el = el.to_owned(); RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&key, &mut state); state } else { value.build(&el, &key) } }) } fn rebuild(mut self, key: &str, state: &mut Self::State) { let key = Rndr::intern(key); let key = key.to_owned(); let prev_value = state.take_value(); *state = RenderEffect::new_with_value( move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&key, &mut state); state } else { unreachable!() } }, prev_value, ); } fn into_cloneable(self) -> Self::Cloneable { self.into_shared() } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.into_shared() } fn dry_resolve(&mut self) { self.invoke(); } async fn resolve(mut self) -> Self::AsyncOutput { self.invoke().resolve().await } } impl<V> AttributeValue for Suspend<V> where V: AttributeValue + 'static, V::State: 'static, { type State = Rc<RefCell<Option<V::State>>>; type AsyncOutput = V; type Cloneable = (); type CloneableOwned = (); fn html_len(&self) -> usize { 0 } fn to_html(self, _key: &str, _buf: &mut String) { #[cfg(feature = "tracing")] tracing::error!( "Suspended attributes cannot be used outside Suspense." ); } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State { let key = key.to_owned(); let el = el.to_owned(); let state = Rc::new(RefCell::new(None)); reactive_graph::spawn_local_scoped({ let state = Rc::clone(&state); async move { *state.borrow_mut() = Some(self.inner.await.hydrate::<FROM_SERVER>(&key, &el)); self.subscriber.forward(); } }); state } fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { let key = key.to_owned(); let el = el.to_owned(); let state = Rc::new(RefCell::new(None)); reactive_graph::spawn_local_scoped({ let state = Rc::clone(&state); async move { *state.borrow_mut() = Some(self.inner.await.build(&el, &key)); self.subscriber.forward(); } }); state } fn rebuild(self, key: &str, state: &mut Self::State) { let key = key.to_owned(); reactive_graph::spawn_local_scoped({ let state = Rc::clone(state); async move { let value = self.inner.await; let mut state = state.borrow_mut(); if let Some(state) = state.as_mut() { value.rebuild(&key, state); } self.subscriber.forward(); } }); } fn into_cloneable(self) -> Self::Cloneable { #[cfg(feature = "tracing")] tracing::error!("Suspended attributes cannot be spread"); } fn into_cloneable_owned(self) -> Self::CloneableOwned { #[cfg(feature = "tracing")] tracing::error!("Suspended attributes cannot be spread"); } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self.inner.await } } /// A reactive function that can be shared across multiple locations and across threads. pub type SharedReactiveFunction<T> = Arc<Mutex<dyn FnMut() -> T + Send>>; /// A reactive view function. pub trait ReactiveFunction: Send + 'static { /// The return type of the function. type Output; /// Call the function. fn invoke(&mut self) -> Self::Output; /// Converts the function into a cloneable, shared type. fn into_shared(self) -> Arc<Mutex<dyn FnMut() -> Self::Output + Send>>; } impl<T: 'static> ReactiveFunction for Arc<Mutex<dyn FnMut() -> T + Send>> { type Output = T; fn invoke(&mut self) -> Self::Output { let mut fun = self.lock().expect("lock poisoned"); fun() } fn into_shared(self) -> Arc<Mutex<dyn FnMut() -> Self::Output + Send>> { self } } impl<T: Send + Sync + 'static> ReactiveFunction for Arc<dyn Fn() -> T + Send + Sync> { type Output = T; fn invoke(&mut self) -> Self::Output { self() } fn into_shared(self) -> Arc<Mutex<dyn FnMut() -> Self::Output + Send>> { Arc::new(Mutex::new(move || self())) } } impl<F, T> ReactiveFunction for F where F: FnMut() -> T + Send + 'static, { type Output = T; fn invoke(&mut self) -> Self::Output { self() } fn into_shared(self) -> Arc<Mutex<dyn FnMut() -> Self::Output + Send>> { Arc::new(Mutex::new(self)) } } macro_rules! reactive_impl { ($name:ident, <$($gen:ident),*>, $v:ty, $dry_resolve:literal, $( $where_clause:tt )*) => { #[allow(deprecated)] impl<$($gen),*> Render for $name<$($gen),*> where $v: Render + Clone + Send + Sync + 'static, <$v as Render>::State: 'static, $($where_clause)* { type State = RenderEffectState<<$v as Render>::State>; #[track_caller] fn build(self) -> Self::State { (move || self.get()).build() } #[track_caller] fn rebuild(self, state: &mut Self::State) { let new = self.build(); let mut old = std::mem::replace(state, new); old.insert_before_this(state); old.unmount(); } } #[allow(deprecated)] impl<$($gen),*> AddAnyAttr for $name<$($gen),*> where $v: RenderHtml + Clone + Send + Sync + 'static, <$v as Render>::State: 'static, $($where_clause)* { type Output<SomeNewAttr: Attribute> = Self; fn add_any_attr<NewAttr: Attribute>( self, _attr: NewAttr, ) -> Self::Output<NewAttr> { todo!() } } #[allow(deprecated)] impl<$($gen),*> RenderHtml for $name<$($gen),*> where $v: RenderHtml + Clone + Send + Sync + 'static, <$v as Render>::State: 'static, $($where_clause)* { type AsyncOutput = Self; type Owned = Self; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) { if $dry_resolve { _ = self.get(); } } async fn resolve(self) -> Self::AsyncOutput { self } fn html_len(&self) -> usize { <$v>::MIN_LENGTH } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { let value = self.get(); value.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ) } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { let value = self.get(); value.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { (move || self.get()) .hydrate::<FROM_SERVER>(cursor, position) } fn into_owned(self) -> Self::Owned { self } } #[allow(deprecated)] impl<$($gen),*> AttributeValue for $name<$($gen),*> where $v: AttributeValue + Send + Sync + Clone + 'static, <$v as AttributeValue>::State: 'static, $($where_clause)* { type AsyncOutput = Self; type State = RenderEffect<<$v as AttributeValue>::State>; type Cloneable = Self; type CloneableOwned = Self; fn html_len(&self) -> usize { 0 } fn to_html(self, key: &str, buf: &mut String) { let value = self.get(); value.to_html(key, buf); } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &crate::renderer::types::Element, ) -> Self::State { (move || self.get()).hydrate::<FROM_SERVER>(key, el) } fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { (move || self.get()).build(el, key) } fn rebuild(self, key: &str, state: &mut Self::State) { (move || self.get()).rebuild(key, state) } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } }; } #[cfg(not(feature = "nightly"))] mod stable { use super::RenderEffectState; use crate::{ html::attribute::{ any_attribute::AnyAttribute, Attribute, AttributeValue, }, hydration::Cursor, ssr::StreamBuilder, view::{ add_attr::AddAnyAttr, Mountable, Position, PositionState, Render, RenderHtml, }, }; #[allow(deprecated)] use reactive_graph::wrappers::read::MaybeSignal; use reactive_graph::{ computed::{ArcMemo, Memo}, effect::RenderEffect, owner::Storage, signal::{ArcReadSignal, ArcRwSignal, ReadSignal, RwSignal}, traits::Get, wrappers::read::{ArcSignal, Signal}, }; reactive_impl!( RwSignal, <V, S>, V, false, RwSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); reactive_impl!( ReadSignal, <V, S>, V, false, ReadSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); reactive_impl!( Memo, <V, S>, V, true, Memo<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); reactive_impl!( Signal, <V, S>, V, true, Signal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); reactive_impl!( MaybeSignal, <V, S>, V, true, MaybeSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); reactive_impl!(ArcRwSignal, <V>, V, false, ArcRwSignal<V>: Get<Value = V>); reactive_impl!(ArcReadSignal, <V>, V, false, ArcReadSignal<V>: Get<Value = V>); reactive_impl!(ArcMemo, <V>, V, false, ArcMemo<V>: Get<Value = V>); reactive_impl!(ArcSignal, <V>, V, true, ArcSignal<V>: Get<Value = V>); } #[cfg(feature = "reactive_stores")] mod reactive_stores { use super::RenderEffectState; use crate::{ html::attribute::{ any_attribute::AnyAttribute, Attribute, AttributeValue, }, hydration::Cursor, ssr::StreamBuilder, view::{ add_attr::AddAnyAttr, Mountable, Position, PositionState, Render, RenderHtml, }, }; #[allow(deprecated)] use reactive_graph::{effect::RenderEffect, owner::Storage, traits::Get}; use reactive_stores::{ ArcField, ArcStore, AtIndex, AtKeyed, DerefedField, Field, KeyedSubfield, Store, StoreField, Subfield, }; use std::ops::{Deref, DerefMut, Index, IndexMut}; reactive_impl!( Subfield, <Inner, Prev, V>, V, false, Subfield<Inner, Prev, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, ); reactive_impl!( AtKeyed, <Inner, Prev, K, V>, V, false, AtKeyed<Inner, Prev, K, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a V: IntoIterator, ); reactive_impl!( KeyedSubfield, <Inner, Prev, K, V>, V, false, KeyedSubfield<Inner, Prev, K, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a V: IntoIterator, ); reactive_impl!( DerefedField, <S>, <S::Value as Deref>::Target, false, S: Clone + StoreField + Send + Sync + 'static, <S as StoreField>::Value: Deref + DerefMut ); reactive_impl!( AtIndex, <Inner, Prev>, <Prev as Index<usize>>::Output, false, AtIndex<Inner, Prev>: Get<Value = Prev::Output>, Prev: Send + Sync + IndexMut<usize> + 'static, Inner: Send + Sync + Clone + 'static, ); reactive_impl!( Store, <V, S>, V, false, Store<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); reactive_impl!( Field, <V, S>, V, false, Field<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); reactive_impl!(ArcStore, <V>, V, false, ArcStore<V>: Get<Value = V>); reactive_impl!(ArcField, <V>, V, false, ArcField<V>: Get<Value = V>); } /* #[cfg(test)] mod tests { use crate::{ html::element::{button, main, HtmlElement}, renderer::mock_dom::MockDom, view::Render, }; use leptos_reactive::{create_runtime, RwSignal, SignalGet, SignalSet}; #[test] fn create_dynamic_element() { let rt = create_runtime(); let count = RwSignal::new(0); let app: HtmlElement<_, _, _, MockDom> = button((), move || count.get().to_string()); let el = app.build(); assert_eq!(el.el.to_debug_html(), "<button>0</button>"); rt.dispose(); } #[test] fn update_dynamic_element() { let rt = create_runtime(); let count = RwSignal::new(0); let app: HtmlElement<_, _, _, MockDom> = button((), move || count.get().to_string()); let el = app.build(); assert_eq!(el.el.to_debug_html(), "<button>0</button>"); count.set(1); assert_eq!(el.el.to_debug_html(), "<button>1</button>"); rt.dispose(); } #[test] fn update_dynamic_element_among_siblings() { let rt = create_runtime(); let count = RwSignal::new(0); let app: HtmlElement<_, _, _, MockDom> = main( (), button( (), ("Hello, my ", move || count.get().to_string(), " friends."), ), ); let el = app.build(); assert_eq!( el.el.to_debug_html(), "<main><button>Hello, my 0 friends.</button></main>" ); count.set(42); assert_eq!( el.el.to_debug_html(), "<main><button>Hello, my 42 friends.</button></main>" ); rt.dispose(); } } */
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/reactive_graph/style.rs
tachys/src/reactive_graph/style.rs
use super::{ReactiveFunction, SharedReactiveFunction}; use crate::{ html::style::{IntoStyle, IntoStyleValue}, renderer::Rndr, }; use reactive_graph::effect::RenderEffect; use std::sync::Arc; impl<F, S> IntoStyleValue for F where F: ReactiveFunction<Output = S>, S: IntoStyleValue + 'static, { type AsyncOutput = Self; type State = (Arc<str>, RenderEffect<S::State>); type Cloneable = SharedReactiveFunction<S>; type CloneableOwned = SharedReactiveFunction<S>; fn to_html(self, name: &str, style: &mut String) { let mut f = self; let value = f.invoke(); value.to_html(name, style); } fn build( mut self, style: &crate::renderer::dom::CssStyleDeclaration, name: &str, ) -> Self::State { let name: Arc<str> = Rndr::intern(name).into(); let style = style.to_owned(); ( Arc::clone(&name), RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&style, &name, &mut state); state } else { value.build(&style, &name) } }), ) } fn rebuild( mut self, style: &crate::renderer::dom::CssStyleDeclaration, name: &str, state: &mut Self::State, ) { let (prev_name, prev_effect) = state; let mut prev_value = prev_effect.take_value(); if name != prev_name.as_ref() { Rndr::remove_css_property(style, prev_name.as_ref()); prev_value = None; } let name: Arc<str> = name.into(); let style = style.to_owned(); *state = ( Arc::clone(&name), RenderEffect::new_with_value( move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&style, &name, &mut state); state } else { value.build(&style, &name) } }, prev_value, ), ); } fn hydrate( mut self, style: &crate::renderer::dom::CssStyleDeclaration, name: &str, ) -> Self::State { let name: Arc<str> = Rndr::intern(name).into(); let style = style.to_owned(); ( Arc::clone(&name), RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&style, &name, &mut state); state } else { value.hydrate(&style, &name) } }), ) } fn into_cloneable(self) -> Self::Cloneable { self.into_shared() } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.into_shared() } fn dry_resolve(&mut self) { self.invoke(); } async fn resolve(self) -> Self::AsyncOutput { self } } impl<F, C> IntoStyle for F where F: ReactiveFunction<Output = C>, C: IntoStyle + 'static, C::State: 'static, { type AsyncOutput = C::AsyncOutput; type State = RenderEffect<C::State>; type Cloneable = SharedReactiveFunction<C>; type CloneableOwned = SharedReactiveFunction<C>; fn to_html(mut self, style: &mut String) { let value = self.invoke(); value.to_html(style); } fn hydrate<const FROM_SERVER: bool>( mut self, el: &crate::renderer::types::Element, ) -> Self::State { // TODO FROM_SERVER vs template let el = el.clone(); RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { value.hydrate::<FROM_SERVER>(&el) } }) } fn build(mut self, el: &crate::renderer::types::Element) -> Self::State { let el = el.clone(); RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { value.build(&el) } }) } fn rebuild(mut self, state: &mut Self::State) { let prev_value = state.take_value(); *state = RenderEffect::new_with_value( move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { unreachable!() } }, prev_value, ); } fn into_cloneable(self) -> Self::Cloneable { self.into_shared() } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.into_shared() } fn dry_resolve(&mut self) { self.invoke(); } async fn resolve(mut self) -> Self::AsyncOutput { self.invoke().resolve().await } fn reset(state: &mut Self::State) { *state = RenderEffect::new_with_value( move |prev| { if let Some(mut state) = prev { C::reset(&mut state); state } else { unreachable!() } }, state.take_value(), ); } } macro_rules! style_reactive { ($name:ident, <$($gen:ident),*>, $v:ty, $( $where_clause:tt )*) => { #[allow(deprecated)] impl<$($gen),*> IntoStyle for $name<$($gen),*> where $v: IntoStyle + Clone + Send + Sync + 'static, <$v as IntoStyle>::State: 'static, $($where_clause)* { type AsyncOutput = Self; type State = RenderEffect<<$v as IntoStyle>::State>; type Cloneable = Self; type CloneableOwned = Self; fn to_html(self, style: &mut String) { let value = self.get(); value.to_html(style); } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { (move || self.get()).hydrate::<FROM_SERVER>(el) } fn build( self, el: &crate::renderer::types::Element, ) -> Self::State { (move || self.get()).build(el) } fn rebuild(self, state: &mut Self::State) { (move || self.get()).rebuild(state) } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn reset(state: &mut Self::State) { *state = RenderEffect::new_with_value( move |prev| { if let Some(mut state) = prev { <$v>::reset(&mut state); state } else { unreachable!() } }, state.take_value(), ); } } #[allow(deprecated)] impl<$($gen),*> IntoStyleValue for $name<$($gen),*> where $v: IntoStyleValue + Send + Sync + Clone + 'static, $($where_clause)* { type AsyncOutput = Self; type State = (Arc<str>, RenderEffect<<$v as IntoStyleValue>::State>); type Cloneable = $name<$($gen),*>; type CloneableOwned = $name<$($gen),*>; fn to_html(self, name: &str, style: &mut String) { IntoStyleValue::to_html(move || self.get(), name, style) } fn build( self, style: &crate::renderer::dom::CssStyleDeclaration, name: &str, ) -> Self::State { IntoStyleValue::build(move || self.get(), style, name) } fn rebuild( self, style: &crate::renderer::dom::CssStyleDeclaration, name: &str, state: &mut Self::State, ) { IntoStyleValue::rebuild( move || self.get(), style, name, state, ) } fn hydrate( self, style: &crate::renderer::dom::CssStyleDeclaration, name: &str, ) -> Self::State { IntoStyleValue::hydrate(move || self.get(), style, name) } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } }; } #[cfg(not(feature = "nightly"))] mod stable { use super::RenderEffect; use crate::html::style::{IntoStyle, IntoStyleValue}; #[allow(deprecated)] use reactive_graph::wrappers::read::MaybeSignal; use reactive_graph::{ computed::{ArcMemo, Memo}, owner::Storage, signal::{ArcReadSignal, ArcRwSignal, ReadSignal, RwSignal}, traits::Get, wrappers::read::{ArcSignal, Signal}, }; use std::sync::Arc; style_reactive!( RwSignal, <V, S>, V, RwSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); style_reactive!( ReadSignal, <V, S>, V, ReadSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); style_reactive!( Memo, <V, S>, V, Memo<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); style_reactive!( Signal, <V, S>, V, Signal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); style_reactive!( MaybeSignal, <V, S>, V, MaybeSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); style_reactive!(ArcRwSignal, <V>, V, ArcRwSignal<V>: Get<Value = V>); style_reactive!(ArcReadSignal, <V>, V, ArcReadSignal<V>: Get<Value = V>); style_reactive!(ArcMemo, <V>, V, ArcMemo<V>: Get<Value = V>); style_reactive!(ArcSignal, <V>, V, ArcSignal<V>: Get<Value = V>); } #[cfg(feature = "reactive_stores")] mod reactive_stores { use super::RenderEffect; use crate::html::style::{IntoStyle, IntoStyleValue}; #[allow(deprecated)] use reactive_graph::{owner::Storage, traits::Get}; use reactive_stores::{ ArcField, ArcStore, AtIndex, AtKeyed, DerefedField, Field, KeyedSubfield, Store, StoreField, Subfield, }; use std::{ ops::{Deref, DerefMut, Index, IndexMut}, sync::Arc, }; style_reactive!( Subfield, <Inner, Prev, V>, V, Subfield<Inner, Prev, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, ); style_reactive!( AtKeyed, <Inner, Prev, K, V>, V, AtKeyed<Inner, Prev, K, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a V: IntoIterator, ); style_reactive!( KeyedSubfield, <Inner, Prev, K, V>, V, KeyedSubfield<Inner, Prev, K, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a V: IntoIterator, ); style_reactive!( DerefedField, <S>, <S::Value as Deref>::Target, S: Clone + StoreField + Send + Sync + 'static, <S as StoreField>::Value: Deref + DerefMut ); style_reactive!( AtIndex, <Inner, Prev>, <Prev as Index<usize>>::Output, AtIndex<Inner, Prev>: Get<Value = Prev::Output>, Prev: Send + Sync + IndexMut<usize> + 'static, Inner: Send + Sync + Clone + 'static, ); style_reactive!( Store, <V, S>, V, Store<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); style_reactive!( Field, <V, S>, V, Field<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); style_reactive!(ArcStore, <V>, V, ArcStore<V>: Get<Value = V>); style_reactive!(ArcField, <V>, V, ArcField<V>: Get<Value = V>); } /* impl<Fut> IntoStyle for Suspend<Fut> where Fut: Clone + Future + Send + 'static, Fut::Output: IntoStyle, { type AsyncOutput = Fut::Output; type State = Rc<RefCell<Option<<Fut::Output as IntoStyle>::State>>>; type Cloneable = Self; type CloneableOwned = Self; fn to_html(self, style: &mut String) { if let Some(inner) = self.inner.now_or_never() { inner.to_html(style); } else { panic!("You cannot use Suspend on an attribute outside Suspense"); } } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { let el = el.to_owned(); let state = Rc::new(RefCell::new(None)); reactive_graph::spawn_local_scoped({ let state = Rc::clone(&state); async move { *state.borrow_mut() = Some(self.inner.await.hydrate::<FROM_SERVER>(&el)); self.subscriber.forward(); } }); state } fn build(self, el: &crate::renderer::types::Element) -> Self::State { let el = el.to_owned(); let state = Rc::new(RefCell::new(None)); reactive_graph::spawn_local_scoped({ let state = Rc::clone(&state); async move { *state.borrow_mut() = Some(self.inner.await.build(&el)); self.subscriber.forward(); } }); state } fn rebuild(self, state: &mut Self::State) { reactive_graph::spawn_local_scoped({ let state = Rc::clone(state); async move { let value = self.inner.await; let mut state = state.borrow_mut(); if let Some(state) = state.as_mut() { value.rebuild(state); } self.subscriber.forward(); } }); } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self.inner.await } } */
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/reactive_graph/inner_html.rs
tachys/src/reactive_graph/inner_html.rs
use super::{ReactiveFunction, SharedReactiveFunction}; use crate::html::element::InnerHtmlValue; use reactive_graph::effect::RenderEffect; impl<F, V> InnerHtmlValue for F where F: ReactiveFunction<Output = V>, V: InnerHtmlValue + 'static, V::State: 'static, { type AsyncOutput = V::AsyncOutput; type State = RenderEffect<V::State>; type Cloneable = SharedReactiveFunction<V>; type CloneableOwned = SharedReactiveFunction<V>; fn html_len(&self) -> usize { 0 } fn to_html(mut self, buf: &mut String) { let value = self.invoke(); value.to_html(buf); } fn to_template(_buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( mut self, el: &crate::renderer::types::Element, ) -> Self::State { let el = el.to_owned(); RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { value.hydrate::<FROM_SERVER>(&el) } }) } fn build(mut self, el: &crate::renderer::types::Element) -> Self::State { let el = el.to_owned(); RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { value.build(&el) } }) } fn rebuild(mut self, state: &mut Self::State) { let prev_value = state.take_value(); *state = RenderEffect::new_with_value( move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state); state } else { unreachable!() } }, prev_value, ); } fn into_cloneable(self) -> Self::Cloneable { self.into_shared() } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.into_shared() } fn dry_resolve(&mut self) { self.invoke(); } async fn resolve(mut self) -> Self::AsyncOutput { self.invoke().resolve().await } } macro_rules! inner_html_reactive { ($name:ident, <$($gen:ident),*>, $v:ty, $( $where_clause:tt )*) => { #[allow(deprecated)] impl<$($gen),*> InnerHtmlValue for $name<$($gen),*> where $v: InnerHtmlValue + Clone + Send + Sync + 'static, <$v as InnerHtmlValue>::State: 'static, $($where_clause)* { type AsyncOutput = Self; type State = RenderEffect<<$v as InnerHtmlValue>::State>; type Cloneable = Self; type CloneableOwned = Self; fn html_len(&self) -> usize { 0 } fn to_html(self, buf: &mut String) { let value = self.get(); value.to_html(buf); } fn to_template(_buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { (move || self.get()).hydrate::<FROM_SERVER>(el) } fn build( self, el: &crate::renderer::types::Element, ) -> Self::State { (move || self.get()).build(el) } fn rebuild(self, state: &mut Self::State) { (move || self.get()).rebuild(state) } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } }; } #[cfg(not(feature = "nightly"))] mod stable { use crate::html::element::InnerHtmlValue; #[allow(deprecated)] use reactive_graph::wrappers::read::MaybeSignal; use reactive_graph::{ computed::{ArcMemo, Memo}, effect::RenderEffect, owner::Storage, signal::{ArcReadSignal, ArcRwSignal, ReadSignal, RwSignal}, traits::Get, wrappers::read::{ArcSignal, Signal}, }; inner_html_reactive!( RwSignal, <V, S>, V, RwSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); inner_html_reactive!( ReadSignal, <V, S>, V, ReadSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); inner_html_reactive!( Memo, <V, S>, V, Memo<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); inner_html_reactive!( Signal, <V, S>, V, Signal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); inner_html_reactive!( MaybeSignal, <V, S>, V, MaybeSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); inner_html_reactive!(ArcRwSignal, <V>, V, ArcRwSignal<V>: Get<Value = V>); inner_html_reactive!(ArcReadSignal, <V>, V, ArcReadSignal<V>: Get<Value = V>); inner_html_reactive!(ArcMemo, <V>, V, ArcMemo<V>: Get<Value = V>); inner_html_reactive!(ArcSignal, <V>, V, ArcSignal<V>: Get<Value = V>); } #[cfg(feature = "reactive_stores")] mod reactive_stores { use crate::html::element::InnerHtmlValue; #[allow(deprecated)] use reactive_graph::{effect::RenderEffect, owner::Storage, traits::Get}; use reactive_stores::{ ArcField, ArcStore, AtIndex, AtKeyed, DerefedField, Field, KeyedSubfield, Store, StoreField, Subfield, }; use std::ops::{Deref, DerefMut, Index, IndexMut}; inner_html_reactive!( Subfield, <Inner, Prev, V>, V, Subfield<Inner, Prev, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, ); inner_html_reactive!( AtKeyed, <Inner, Prev, K, V>, V, AtKeyed<Inner, Prev, K, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a V: IntoIterator, ); inner_html_reactive!( KeyedSubfield, <Inner, Prev, K, V>, V, KeyedSubfield<Inner, Prev, K, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a V: IntoIterator, ); inner_html_reactive!( DerefedField, <S>, <S::Value as Deref>::Target, S: Clone + StoreField + Send + Sync + 'static, <S as StoreField>::Value: Deref + DerefMut ); inner_html_reactive!( AtIndex, <Inner, Prev>, <Prev as Index<usize>>::Output, AtIndex<Inner, Prev>: Get<Value = Prev::Output>, Prev: Send + Sync + IndexMut<usize> + 'static, Inner: Send + Sync + Clone + 'static, ); inner_html_reactive!( Store, <V, S>, V, Store<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); inner_html_reactive!( Field, <V, S>, V, Field<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); inner_html_reactive!(ArcStore, <V>, V, ArcStore<V>: Get<Value = V>); inner_html_reactive!(ArcField, <V>, V, ArcField<V>: Get<Value = V>); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/reactive_graph/property.rs
tachys/src/reactive_graph/property.rs
use super::{ReactiveFunction, SharedReactiveFunction}; use crate::{html::property::IntoProperty, renderer::Rndr}; use reactive_graph::effect::RenderEffect; // These do update during hydration because properties don't exist in the DOM impl<F, V> IntoProperty for F where F: ReactiveFunction<Output = V>, V: IntoProperty + 'static, V::State: 'static, { type State = RenderEffect<V::State>; type Cloneable = SharedReactiveFunction<V>; type CloneableOwned = SharedReactiveFunction<V>; fn hydrate<const FROM_SERVER: bool>( mut self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { let key = Rndr::intern(key); let key = key.to_owned(); let el = el.to_owned(); RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state, &key); state } else { value.hydrate::<FROM_SERVER>(&el, &key) } }) } fn build( mut self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { let key = Rndr::intern(key); let key = key.to_owned(); let el = el.to_owned(); RenderEffect::new(move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state, &key); state } else { value.build(&el, &key) } }) } fn rebuild(mut self, state: &mut Self::State, key: &str) { let prev_value = state.take_value(); let key = key.to_owned(); *state = RenderEffect::new_with_value( move |prev| { let value = self.invoke(); if let Some(mut state) = prev { value.rebuild(&mut state, &key); state } else { unreachable!() } }, prev_value, ); } fn into_cloneable(self) -> Self::Cloneable { self.into_shared() } fn into_cloneable_owned(self) -> Self::CloneableOwned { self.into_shared() } } macro_rules! property_reactive { ($name:ident, <$($gen:ident),*>, $v:ty, $( $where_clause:tt )*) => { #[allow(deprecated)] impl<$($gen),*> IntoProperty for $name<$($gen),*> where $v: IntoProperty + Clone + Send + Sync + 'static, <$v as IntoProperty>::State: 'static, $($where_clause)* { type State = RenderEffect<<$v as IntoProperty>::State>; type Cloneable = Self; type CloneableOwned = Self; fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { (move || self.get()).hydrate::<FROM_SERVER>(el, key) } fn build( self, el: &crate::renderer::types::Element, key: &str, ) -> Self::State { (move || self.get()).build(el, key) } fn rebuild(self, state: &mut Self::State, key: &str) { (move || self.get()).rebuild(state, key) } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } } }; } #[cfg(not(feature = "nightly"))] mod stable { use crate::html::property::IntoProperty; #[allow(deprecated)] use reactive_graph::wrappers::read::MaybeSignal; use reactive_graph::{ computed::{ArcMemo, Memo}, effect::RenderEffect, owner::Storage, signal::{ArcReadSignal, ArcRwSignal, ReadSignal, RwSignal}, traits::Get, wrappers::read::{ArcSignal, Signal}, }; property_reactive!( RwSignal, <V, S>, V, RwSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); property_reactive!( ReadSignal, <V, S>, V, ReadSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); property_reactive!( Memo, <V, S>, V, Memo<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); property_reactive!( Signal, <V, S>, V, Signal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); property_reactive!( MaybeSignal, <V, S>, V, MaybeSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); property_reactive!(ArcRwSignal, <V>, V, ArcRwSignal<V>: Get<Value = V>); property_reactive!(ArcReadSignal, <V>, V, ArcReadSignal<V>: Get<Value = V>); property_reactive!(ArcMemo, <V>, V, ArcMemo<V>: Get<Value = V>); property_reactive!(ArcSignal, <V>, V, ArcSignal<V>: Get<Value = V>); } #[cfg(feature = "reactive_stores")] mod reactive_stores { use crate::html::property::IntoProperty; #[allow(deprecated)] use reactive_graph::{effect::RenderEffect, owner::Storage, traits::Get}; use reactive_stores::{ ArcField, ArcStore, AtIndex, AtKeyed, DerefedField, Field, KeyedSubfield, Store, StoreField, Subfield, }; use std::ops::{Deref, DerefMut, Index, IndexMut}; property_reactive!( Subfield, <Inner, Prev, V>, V, Subfield<Inner, Prev, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, ); property_reactive!( AtKeyed, <Inner, Prev, K, V>, V, AtKeyed<Inner, Prev, K, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a V: IntoIterator, ); property_reactive!( KeyedSubfield, <Inner, Prev, K, V>, V, KeyedSubfield<Inner, Prev, K, V>: Get<Value = V>, Prev: Send + Sync + 'static, Inner: Send + Sync + Clone + 'static, K: Send + Sync + std::fmt::Debug + Clone + 'static, for<'a> &'a V: IntoIterator, ); property_reactive!( DerefedField, <S>, <S::Value as Deref>::Target, S: Clone + StoreField + Send + Sync + 'static, <S as StoreField>::Value: Deref + DerefMut ); property_reactive!( AtIndex, <Inner, Prev>, <Prev as Index<usize>>::Output, AtIndex<Inner, Prev>: Get<Value = Prev::Output>, Prev: Send + Sync + IndexMut<usize> + 'static, Inner: Send + Sync + Clone + 'static, ); property_reactive!( Store, <V, S>, V, Store<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); property_reactive!( Field, <V, S>, V, Field<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); property_reactive!(ArcStore, <V>, V, ArcStore<V>: Get<Value = V>); property_reactive!(ArcField, <V>, V, ArcField<V>: Get<Value = V>); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/add_attr.rs
tachys/src/view/add_attr.rs
use super::RenderHtml; use crate::html::attribute::Attribute; /// Allows adding a new attribute to some type, before it is rendered. /// This takes place at compile time as part of the builder syntax for creating a statically typed /// view tree. /// /// Normally, this is used to add an attribute to an HTML element. But it is required to be /// implemented for all types that implement [`RenderHtml`], so that attributes can be spread onto /// other structures like the return type of a component. pub trait AddAnyAttr { /// The new type once the attribute has been added. type Output<SomeNewAttr: Attribute>: RenderHtml; /// Adds an attribute to the view. fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml; } /// Declares that spreading attributes onto a particular type has no effect. #[macro_export] macro_rules! no_attrs { ($ty_name:ty) => { impl<'a> $crate::view::add_attr::AddAnyAttr for $ty_name { type Output<SomeNewAttr: $crate::html::attribute::Attribute> = $ty_name; fn add_any_attr<NewAttr: $crate::html::attribute::Attribute>( self, _attr: NewAttr, ) -> Self::Output<NewAttr> { self } } }; }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/error_boundary.rs
tachys/src/view/error_boundary.rs
use super::{add_attr::AddAnyAttr, Position, PositionState, RenderHtml}; use crate::{ html::attribute::{any_attribute::AnyAttribute, Attribute}, hydration::Cursor, ssr::StreamBuilder, view::{iterators::OptionState, Mountable, Render}, }; use either_of::Either; use std::sync::Arc; use throw_error::{Error as AnyError, ErrorHook}; impl<T, E> Render for Result<T, E> where T: Render, E: Into<AnyError> + 'static, { type State = ResultState<T>; fn build(self) -> Self::State { let hook = throw_error::get_error_hook(); let (state, error) = match self { Ok(view) => (Either::Left(view.build()), None), Err(e) => ( Either::Right(Render::build(())), Some(throw_error::throw(e.into())), ), }; ResultState { state, error, hook } } fn rebuild(self, state: &mut Self::State) { let _guard = state.hook.clone().map(throw_error::set_error_hook); match (&mut state.state, self) { // both errors: throw the new error and replace (Either::Right(_), Err(new)) => { if let Some(old_error) = state.error.take() { throw_error::clear(&old_error); } state.error = Some(throw_error::throw(new.into())); } // both Ok: need to rebuild child (Either::Left(old), Ok(new)) => { T::rebuild(new, old); } // Ok => Err: unmount, replace with marker, and throw (Either::Left(old), Err(err)) => { let mut new_state = Render::build(()); old.insert_before_this(&mut new_state); old.unmount(); state.state = Either::Right(new_state); state.error = Some(throw_error::throw(err)); } // Err => Ok: clear error and build (Either::Right(old), Ok(new)) => { if let Some(err) = state.error.take() { throw_error::clear(&err); } let mut new_state = new.build(); old.insert_before_this(&mut new_state); old.unmount(); state.state = Either::Left(new_state); } } } } /// View state for a `Result<_, _>` view. pub struct ResultState<T> where T: Render, { /// The view state. state: OptionState<T>, error: Option<throw_error::ErrorId>, hook: Option<Arc<dyn ErrorHook>>, } impl<T> Drop for ResultState<T> where T: Render, { fn drop(&mut self) { // when the state is cleared, unregister this error; this item is being dropped and its // error should no longer be shown if let Some(e) = self.error.take() { throw_error::clear(&e); } } } impl<T> Mountable for ResultState<T> where T: Render, { fn unmount(&mut self) { self.state.unmount(); } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { self.state.mount(parent, marker); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.state.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.state.elements() } } impl<T, E> AddAnyAttr for Result<T, E> where T: AddAnyAttr, E: Into<AnyError> + Send + 'static, { type Output<SomeNewAttr: Attribute> = Result<<T as AddAnyAttr>::Output<SomeNewAttr>, E>; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { self.map(|inner| inner.add_any_attr(attr)) } } impl<T, E> RenderHtml for Result<T, E> where T: RenderHtml, E: Into<AnyError> + Send + 'static, { type AsyncOutput = Result<T::AsyncOutput, E>; type Owned = Result<T::Owned, E>; const MIN_LENGTH: usize = T::MIN_LENGTH; fn dry_resolve(&mut self) { if let Ok(inner) = self.as_mut() { inner.dry_resolve() } } async fn resolve(self) -> Self::AsyncOutput { match self { Ok(view) => Ok(view.resolve().await), Err(e) => Err(e), } } fn html_len(&self) -> usize { match self { Ok(i) => i.html_len() + 3, Err(_) => 0, } } fn to_html_with_buf( self, buf: &mut String, position: &mut super::Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { match self { Ok(inner) => { inner.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); } Err(e) => { buf.push_str("<!>"); throw_error::throw(e); } } } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { match self { Ok(inner) => inner.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ), Err(e) => { buf.push_sync("<!>"); throw_error::throw(e); } } } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let hook = throw_error::get_error_hook(); let (state, error) = match self { Ok(view) => ( Either::Left(view.hydrate::<FROM_SERVER>(cursor, position)), None, ), Err(e) => { let state = RenderHtml::hydrate::<FROM_SERVER>((), cursor, position); (Either::Right(state), Some(throw_error::throw(e.into()))) } }; ResultState { state, error, hook } } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let hook = throw_error::get_error_hook(); let (state, error) = match self { Ok(view) => ( Either::Left(view.hydrate_async(cursor, position).await), None, ), Err(e) => { let state = RenderHtml::hydrate_async((), cursor, position).await; (Either::Right(state), Some(throw_error::throw(e.into()))) } }; ResultState { state, error, hook } } fn into_owned(self) -> Self::Owned { match self { Ok(view) => Ok(view.into_owned()), Err(e) => Err(e), } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/fragment.rs
tachys/src/view/fragment.rs
use super::{ any_view::{AnyView, IntoAny}, iterators::StaticVec, }; use crate::html::element::HtmlElement; /// A typed-erased collection of different views. pub struct Fragment { /// The nodes contained in the fragment. pub nodes: StaticVec<AnyView>, } /// Converts some view into a type-erased collection of views. pub trait IntoFragment { /// Converts some view into a type-erased collection of views. fn into_fragment(self) -> Fragment; } impl FromIterator<AnyView> for Fragment { fn from_iter<T: IntoIterator<Item = AnyView>>(iter: T) -> Self { Fragment::new(iter.into_iter().collect()) } } impl From<AnyView> for Fragment { fn from(view: AnyView) -> Self { Fragment::new(vec![view]) } } impl From<Fragment> for AnyView { fn from(value: Fragment) -> Self { value.nodes.into_any() } } impl Fragment { /// Creates a new [`Fragment`]. #[inline(always)] pub fn new(nodes: Vec<AnyView>) -> Self { Self { nodes: nodes.into(), } } } impl<E, At, Ch> IntoFragment for HtmlElement<E, At, Ch> where HtmlElement<E, At, Ch>: IntoAny, { fn into_fragment(self) -> Fragment { Fragment::new(vec![self.into_any()]) } } impl IntoFragment for AnyView { fn into_fragment(self) -> Fragment { Fragment::new(vec![self]) } } impl<T> IntoFragment for Vec<T> where T: IntoAny, { fn into_fragment(self) -> Fragment { Fragment::new(self.into_iter().map(IntoAny::into_any).collect()) } } impl<T> IntoFragment for StaticVec<T> where T: IntoAny, { fn into_fragment(self) -> Fragment { Fragment::new(self.into_iter().map(IntoAny::into_any).collect()) } } impl<const N: usize, T> IntoFragment for [T; N] where T: IntoAny, { fn into_fragment(self) -> Fragment { Fragment::new(self.into_iter().map(IntoAny::into_any).collect()) } } macro_rules! tuples { ($($ty:ident),*) => { impl<$($ty),*> IntoFragment for ($($ty,)*) where $($ty: IntoAny),*, { fn into_fragment(self) -> Fragment { #[allow(non_snake_case)] let ($($ty,)*) = self; Fragment::new(vec![$($ty.into_any(),)*]) } } } } tuples!(A); tuples!(A, B); tuples!(A, B, C); tuples!(A, B, C, D); tuples!(A, B, C, D, E); tuples!(A, B, C, D, E, F); tuples!(A, B, C, D, E, F, G); tuples!(A, B, C, D, E, F, G, H); tuples!(A, B, C, D, E, F, G, H, I); tuples!(A, B, C, D, E, F, G, H, I, J); tuples!(A, B, C, D, E, F, G, H, I, J, K); tuples!(A, B, C, D, E, F, G, H, I, J, K, L); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W); tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X); tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X, Y ); tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X, Y, Z );
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/any_view.rs
tachys/src/view/any_view.rs
#![allow(clippy::type_complexity)] #[cfg(feature = "ssr")] use super::MarkBranch; use super::{ add_attr::AddAnyAttr, Mountable, Position, PositionState, Render, RenderHtml, }; use crate::{ erased::{Erased, ErasedLocal}, html::attribute::{ any_attribute::{AnyAttribute, AnyAttributeState, IntoAnyAttribute}, Attribute, }, hydration::Cursor, renderer::Rndr, ssr::StreamBuilder, }; use futures::future::{join, join_all}; use std::{any::TypeId, fmt::Debug}; #[cfg(any(feature = "ssr", feature = "hydrate"))] use std::{future::Future, pin::Pin}; /// A type-erased view. This can be used if control flow requires that multiple different types of /// view must be received, and it is either impossible or too cumbersome to use the `EitherOf___` /// enums. /// /// It can also be used to create recursive components, which otherwise cannot return themselves /// due to the static typing of the view tree. /// /// Generally speaking, using `AnyView` restricts the amount of information available to the /// compiler and should be limited to situations in which it is necessary to preserve the maximum /// amount of type information possible. pub struct AnyView { type_id: TypeId, value: Erased, build: fn(Erased) -> AnyViewState, rebuild: fn(Erased, &mut AnyViewState), // The fields below are cfg-gated so they will not be included in WASM bundles if not needed. // Ordinarily, the compiler can simply omit this dead code because the methods are not called. // With this type-erased wrapper, however, the compiler is not *always* able to correctly // eliminate that code. #[cfg(feature = "ssr")] html_len: usize, #[cfg(feature = "ssr")] to_html: fn(Erased, &mut String, &mut Position, bool, bool, Vec<AnyAttribute>), #[cfg(feature = "ssr")] to_html_async: fn( Erased, &mut StreamBuilder, &mut Position, bool, bool, Vec<AnyAttribute>, ), #[cfg(feature = "ssr")] to_html_async_ooo: fn( Erased, &mut StreamBuilder, &mut Position, bool, bool, Vec<AnyAttribute>, ), #[cfg(feature = "ssr")] #[allow(clippy::type_complexity)] resolve: fn(Erased) -> Pin<Box<dyn Future<Output = AnyView> + Send>>, #[cfg(feature = "ssr")] dry_resolve: fn(&mut Erased), #[cfg(feature = "hydrate")] #[allow(clippy::type_complexity)] hydrate_from_server: fn(Erased, &Cursor, &PositionState) -> AnyViewState, #[cfg(feature = "hydrate")] #[allow(clippy::type_complexity)] hydrate_async: fn( Erased, &Cursor, &PositionState, ) -> Pin<Box<dyn Future<Output = AnyViewState>>>, } impl AnyView { #[doc(hidden)] pub fn as_type_id(&self) -> TypeId { self.type_id } } impl Debug for AnyView { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("AnyView") .field("type_id", &self.type_id) .finish_non_exhaustive() } } /// Retained view state for [`AnyView`]. pub struct AnyViewState { type_id: TypeId, state: ErasedLocal, unmount: fn(&mut ErasedLocal), mount: fn( &mut ErasedLocal, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ), insert_before_this: fn(&ErasedLocal, child: &mut dyn Mountable) -> bool, elements: fn(&ErasedLocal) -> Vec<crate::renderer::types::Element>, placeholder: Option<crate::renderer::types::Placeholder>, } impl Debug for AnyViewState { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("AnyViewState") .field("type_id", &self.type_id) .field("state", &"") .field("unmount", &self.unmount) .field("mount", &self.mount) .field("insert_before_this", &self.insert_before_this) .finish() } } /// Allows converting some view into [`AnyView`]. pub trait IntoAny { /// Converts the view into a type-erased [`AnyView`]. fn into_any(self) -> AnyView; } /// A more general version of [`IntoAny`] that allows into [`AnyView`], /// but also erasing other types that don't implement [`RenderHtml`] like routing. pub trait IntoMaybeErased { /// The type of the output. type Output: IntoMaybeErased; /// Converts the view into a type-erased view if in erased mode. fn into_maybe_erased(self) -> Self::Output; } impl<T> IntoMaybeErased for T where T: RenderHtml, { #[cfg(not(erase_components))] type Output = Self; #[cfg(erase_components)] type Output = AnyView; fn into_maybe_erased(self) -> Self::Output { #[cfg(not(erase_components))] { self } #[cfg(erase_components)] { self.into_owned().into_any() } } } fn mount_any<T>( state: &mut ErasedLocal, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) where T: Render, T::State: 'static, { state.get_mut::<T::State>().mount(parent, marker) } fn unmount_any<T>(state: &mut ErasedLocal) where T: Render, T::State: 'static, { state.get_mut::<T::State>().unmount(); } fn insert_before_this<T>(state: &ErasedLocal, child: &mut dyn Mountable) -> bool where T: Render, T::State: 'static, { state.get_ref::<T::State>().insert_before_this(child) } fn elements<T>(state: &ErasedLocal) -> Vec<crate::renderer::types::Element> where T: Render, T::State: 'static, { state.get_ref::<T::State>().elements() } impl<T> IntoAny for T where T: Send, T: RenderHtml, { fn into_any(self) -> AnyView { #[cfg(feature = "ssr")] fn dry_resolve<T: RenderHtml + 'static>(value: &mut Erased) { value.get_mut::<T>().dry_resolve(); } #[cfg(feature = "ssr")] fn resolve<T: RenderHtml + 'static>( value: Erased, ) -> Pin<Box<dyn Future<Output = AnyView> + Send>> { use futures::FutureExt; async move { value.into_inner::<T>().resolve().await.into_any() } .boxed() } #[cfg(feature = "ssr")] fn to_html<T: RenderHtml + 'static>( value: Erased, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { value.into_inner::<T>().to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); if !T::EXISTS { buf.push_str("<!--<() />-->"); } } #[cfg(feature = "ssr")] fn to_html_async<T: RenderHtml + 'static>( value: Erased, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { value.into_inner::<T>().to_html_async_with_buf::<false>( buf, position, escape, mark_branches, extra_attrs, ); if !T::EXISTS { buf.push_sync("<!--<() />-->"); } } #[cfg(feature = "ssr")] fn to_html_async_ooo<T: RenderHtml + 'static>( value: Erased, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { value.into_inner::<T>().to_html_async_with_buf::<true>( buf, position, escape, mark_branches, extra_attrs, ); if !T::EXISTS { buf.push_sync("<!--<() />-->"); } } fn build<T: RenderHtml + 'static>(value: Erased) -> AnyViewState { let state = ErasedLocal::new(value.into_inner::<T>().build()); let placeholder = (!T::EXISTS).then(Rndr::create_placeholder); AnyViewState { type_id: TypeId::of::<T>(), state, mount: mount_any::<T>, unmount: unmount_any::<T>, insert_before_this: insert_before_this::<T>, elements: elements::<T>, placeholder, } } #[cfg(feature = "hydrate")] fn hydrate_from_server<T: RenderHtml + 'static>( value: Erased, cursor: &Cursor, position: &PositionState, ) -> AnyViewState { let state = ErasedLocal::new( value.into_inner::<T>().hydrate::<true>(cursor, position), ); let placeholder = (!T::EXISTS).then(|| cursor.next_placeholder(position)); AnyViewState { type_id: TypeId::of::<T>(), state, mount: mount_any::<T>, unmount: unmount_any::<T>, insert_before_this: insert_before_this::<T>, elements: elements::<T>, placeholder, } } #[cfg(feature = "hydrate")] fn hydrate_async<T: RenderHtml + 'static>( value: Erased, cursor: &Cursor, position: &PositionState, ) -> Pin<Box<dyn Future<Output = AnyViewState>>> { let cursor = cursor.clone(); let position = position.clone(); Box::pin(async move { let state = ErasedLocal::new( value .into_inner::<T>() .hydrate_async(&cursor, &position) .await, ); let placeholder = (!T::EXISTS).then(|| cursor.next_placeholder(&position)); AnyViewState { type_id: TypeId::of::<T>(), state, mount: mount_any::<T>, unmount: unmount_any::<T>, insert_before_this: insert_before_this::<T>, elements: elements::<T>, placeholder, } }) } fn rebuild<T: RenderHtml + 'static>( value: Erased, state: &mut AnyViewState, ) { let state = state.state.get_mut::<<T as Render>::State>(); value.into_inner::<T>().rebuild(state); } let value = self.into_owned(); AnyView { type_id: TypeId::of::<T::Owned>(), build: build::<T::Owned>, rebuild: rebuild::<T::Owned>, #[cfg(feature = "ssr")] resolve: resolve::<T::Owned>, #[cfg(feature = "ssr")] dry_resolve: dry_resolve::<T::Owned>, #[cfg(feature = "ssr")] html_len: value.html_len(), #[cfg(feature = "ssr")] to_html: to_html::<T::Owned>, #[cfg(feature = "ssr")] to_html_async: to_html_async::<T::Owned>, #[cfg(feature = "ssr")] to_html_async_ooo: to_html_async_ooo::<T::Owned>, #[cfg(feature = "hydrate")] hydrate_from_server: hydrate_from_server::<T::Owned>, #[cfg(feature = "hydrate")] hydrate_async: hydrate_async::<T::Owned>, value: Erased::new(value), } } } impl Render for AnyView { type State = AnyViewState; fn build(self) -> Self::State { (self.build)(self.value) } fn rebuild(self, state: &mut Self::State) { if self.type_id == state.type_id { (self.rebuild)(self.value, state) } else { let mut new = self.build(); if let Some(placeholder) = &mut state.placeholder { placeholder.insert_before_this(&mut new); placeholder.unmount(); } else { state.insert_before_this(&mut new); } state.unmount(); *state = new; } } } impl AddAnyAttr for AnyView { type Output<SomeNewAttr: Attribute> = AnyViewWithAttrs; #[allow(unused_variables)] fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { AnyViewWithAttrs { view: self, attrs: vec![attr.into_cloneable_owned().into_any_attr()], } } } impl RenderHtml for AnyView { type AsyncOutput = Self; type Owned = Self; fn dry_resolve(&mut self) { #[cfg(feature = "ssr")] { (self.dry_resolve)(&mut self.value) } #[cfg(not(feature = "ssr"))] panic!( "You are rendering AnyView to HTML without the `ssr` feature \ enabled." ); } async fn resolve(self) -> Self::AsyncOutput { #[cfg(feature = "ssr")] { (self.resolve)(self.value).await } #[cfg(not(feature = "ssr"))] panic!( "You are rendering AnyView to HTML without the `ssr` feature \ enabled." ); } const MIN_LENGTH: usize = 0; fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { #[cfg(feature = "ssr")] { let type_id = if mark_branches && escape { format!("{:?}", self.type_id) } else { Default::default() }; if mark_branches && escape { buf.open_branch(&type_id); } (self.to_html)( self.value, buf, position, escape, mark_branches, extra_attrs, ); if mark_branches && escape { buf.close_branch(&type_id); if *position == Position::NextChildAfterText { *position = Position::NextChild; } } } #[cfg(not(feature = "ssr"))] { _ = mark_branches; _ = buf; _ = position; _ = escape; _ = extra_attrs; panic!( "You are rendering AnyView to HTML without the `ssr` feature \ enabled." ); } } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { #[cfg(feature = "ssr")] if OUT_OF_ORDER { let type_id = if mark_branches && escape { format!("{:?}", self.type_id) } else { Default::default() }; if mark_branches && escape { buf.open_branch(&type_id); } (self.to_html_async_ooo)( self.value, buf, position, escape, mark_branches, extra_attrs, ); if mark_branches && escape { buf.close_branch(&type_id); if *position == Position::NextChildAfterText { *position = Position::NextChild; } } } else { let type_id = if mark_branches && escape { format!("{:?}", self.type_id) } else { Default::default() }; if mark_branches && escape { buf.open_branch(&type_id); } (self.to_html_async)( self.value, buf, position, escape, mark_branches, extra_attrs, ); if mark_branches && escape { buf.close_branch(&type_id); if *position == Position::NextChildAfterText { *position = Position::NextChild; } } } #[cfg(not(feature = "ssr"))] { _ = buf; _ = position; _ = escape; _ = mark_branches; _ = extra_attrs; panic!( "You are rendering AnyView to HTML without the `ssr` feature \ enabled." ); } } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { #[cfg(feature = "hydrate")] { if FROM_SERVER { (self.hydrate_from_server)(self.value, cursor, position) } else { panic!( "hydrating AnyView from inside a ViewTemplate is not \ supported." ); } } #[cfg(not(feature = "hydrate"))] { _ = cursor; _ = position; panic!( "You are trying to hydrate AnyView without the `hydrate` \ feature enabled." ); } } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { #[cfg(feature = "hydrate")] { let state = (self.hydrate_async)(self.value, cursor, position).await; state } #[cfg(not(feature = "hydrate"))] { _ = cursor; _ = position; panic!( "You are trying to hydrate AnyView without the `hydrate` \ feature enabled." ); } } fn html_len(&self) -> usize { #[cfg(feature = "ssr")] { self.html_len } #[cfg(not(feature = "ssr"))] { 0 } } fn into_owned(self) -> Self::Owned { self } } impl Mountable for AnyViewState { fn unmount(&mut self) { (self.unmount)(&mut self.state); if let Some(placeholder) = &mut self.placeholder { placeholder.unmount(); } } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { (self.mount)(&mut self.state, parent, marker); if let Some(placeholder) = &mut self.placeholder { placeholder.mount(parent, marker); } } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { let before_view = (self.insert_before_this)(&self.state, child); if before_view { return true; } if let Some(placeholder) = &self.placeholder { placeholder.insert_before_this(child) } else { false } } fn elements(&self) -> Vec<crate::renderer::types::Element> { (self.elements)(&self.state) } } /// wip pub struct AnyViewWithAttrs { view: AnyView, attrs: Vec<AnyAttribute>, } impl Render for AnyViewWithAttrs { type State = AnyViewWithAttrsState; fn build(self) -> Self::State { let view = self.view.build(); let elements = view.elements(); let mut attrs = Vec::with_capacity(elements.len() * self.attrs.len()); for attr in self.attrs { for el in &elements { attrs.push(attr.clone().build(el)) } } AnyViewWithAttrsState { view, attrs } } fn rebuild(self, state: &mut Self::State) { self.view.rebuild(&mut state.view); // at this point, we have rebuilt the inner view // now we need to update attributes that were spread onto this // this approach is not ideal, but it avoids two edge cases: // 1) merging attributes from two unrelated views (https://github.com/leptos-rs/leptos/issues/4268) // 2) failing to re-create attributes from the same view (https://github.com/leptos-rs/leptos/issues/4512) for element in state.elements() { // first, remove the previous set of attributes self.attrs .clone() .rebuild(&mut (element.clone(), Vec::new())); // then, add the new set of attributes self.attrs.clone().build(&element); } } } impl RenderHtml for AnyViewWithAttrs { type AsyncOutput = Self; type Owned = Self; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) { self.view.dry_resolve(); for attr in &mut self.attrs { attr.dry_resolve(); } } async fn resolve(self) -> Self::AsyncOutput { let resolve_view = self.view.resolve(); let resolve_attrs = join_all(self.attrs.into_iter().map(|attr| attr.resolve())); let (view, attrs) = join(resolve_view, resolve_attrs).await; Self { view, attrs } } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, mut extra_attrs: Vec<AnyAttribute>, ) { // `extra_attrs` will be empty here in most cases, but it will have // attributes in it already if this is, itself, receiving additional attrs extra_attrs.extend(self.attrs); self.view.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, mut extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { extra_attrs.extend(self.attrs); self.view.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let view = self.view.hydrate::<FROM_SERVER>(cursor, position); let elements = view.elements(); let mut attrs = Vec::with_capacity(elements.len() * self.attrs.len()); for attr in self.attrs { for el in &elements { attrs.push(attr.clone().hydrate::<FROM_SERVER>(el)); } } AnyViewWithAttrsState { view, attrs } } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let view = self.view.hydrate_async(cursor, position).await; let elements = view.elements(); let mut attrs = Vec::with_capacity(elements.len() * self.attrs.len()); for attr in self.attrs { for el in &elements { attrs.push(attr.clone().hydrate::<true>(el)); } } AnyViewWithAttrsState { view, attrs } } fn html_len(&self) -> usize { self.view.html_len() + self.attrs.iter().map(|attr| attr.html_len()).sum::<usize>() } fn into_owned(self) -> Self::Owned { self } } impl AddAnyAttr for AnyViewWithAttrs { type Output<SomeNewAttr: Attribute> = AnyViewWithAttrs; fn add_any_attr<NewAttr: Attribute>( mut self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { self.attrs.push(attr.into_cloneable_owned().into_any_attr()); self } } /// State for any view with attributes spread onto it. pub struct AnyViewWithAttrsState { view: AnyViewState, #[allow(dead_code)] // keeps attribute states alive until dropped attrs: Vec<AnyAttributeState>, } impl Mountable for AnyViewWithAttrsState { fn unmount(&mut self) { self.view.unmount(); } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { self.view.mount(parent, marker) } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.view.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.view.elements() } } /* #[cfg(test)] mod tests { use super::IntoAny; use crate::{ html::element::{p, span}, renderer::mock_dom::MockDom, view::{any_view::AnyView, RenderHtml}, }; #[test] fn should_handle_html_creation() { let x = 1; let mut buf = String::new(); let view: AnyView<MockDom> = if x == 0 { p((), "foo").into_any() } else { span((), "bar").into_any() }; view.to_html(&mut buf, &Default::default()); assert_eq!(buf, "<span>bar</span><!>"); } } */
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/template.rs
tachys/src/view/template.rs
use super::{ add_attr::AddAnyAttr, Mountable, Position, PositionState, Render, RenderHtml, ToTemplate, }; use crate::{ html::attribute::{any_attribute::AnyAttribute, Attribute}, hydration::Cursor, renderer::Rndr, }; /// A view wrapper that uses a `<template>` node to optimize DOM node creation. /// /// Rather than creating all of the DOM nodes each time it is built, this template will create a /// single `<template>` node once, then use `.cloneNode(true)` to clone that entire tree, and /// hydrate it to add event listeners and interactivity for this instance. pub struct ViewTemplate<V> { view: V, } impl<V> ViewTemplate<V> where V: Render + ToTemplate + 'static, { /// Creates a new view template. pub fn new(view: V) -> Self { Self { view } } fn to_template() -> crate::renderer::types::TemplateElement { Rndr::get_template::<V>() } } impl<V> Render for ViewTemplate<V> where V: Render + RenderHtml + ToTemplate + 'static, V::State: Mountable, { type State = V::State; // TODO try_build/try_rebuild() fn build(self) -> Self::State { let tpl = Self::to_template(); let contents = Rndr::clone_template(&tpl); self.view .hydrate::<false>(&Cursor::new(contents), &Default::default()) } fn rebuild(self, state: &mut Self::State) { self.view.rebuild(state) } } impl<V> AddAnyAttr for ViewTemplate<V> where V: RenderHtml + ToTemplate + 'static, V::State: Mountable, { type Output<SomeNewAttr: Attribute> = ViewTemplate<V>; fn add_any_attr<NewAttr: Attribute>( self, _attr: NewAttr, ) -> Self::Output<NewAttr> { panic!("AddAnyAttr not supported on ViewTemplate"); } } impl<V> RenderHtml for ViewTemplate<V> where V: RenderHtml + ToTemplate + 'static, V::State: Mountable, { type AsyncOutput = V::AsyncOutput; type Owned = V::Owned; const MIN_LENGTH: usize = V::MIN_LENGTH; fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { self.view.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ) } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { self.view.hydrate::<FROM_SERVER>(cursor, position) } fn dry_resolve(&mut self) { self.view.dry_resolve(); } async fn resolve(self) -> Self::AsyncOutput { self.view.resolve().await } fn into_owned(self) -> Self::Owned { self.view.into_owned() } } impl<V> ToTemplate for ViewTemplate<V> where V: RenderHtml + ToTemplate + 'static, V::State: Mountable, { const TEMPLATE: &'static str = V::TEMPLATE; fn to_template( buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, position: &mut Position, ) { V::to_template(buf, class, style, inner_html, position); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/primitives.rs
tachys/src/view/primitives.rs
use super::{Mountable, Position, PositionState, Render, RenderHtml}; use crate::{ html::attribute::any_attribute::AnyAttribute, hydration::Cursor, no_attrs, renderer::{CastFrom, Rndr}, view::ToTemplate, }; use std::{ fmt::Write, net::{IpAddr, Ipv4Addr, Ipv6Addr, SocketAddr, SocketAddrV4, SocketAddrV6}, num::{ NonZeroI128, NonZeroI16, NonZeroI32, NonZeroI64, NonZeroI8, NonZeroIsize, NonZeroU128, NonZeroU16, NonZeroU32, NonZeroU64, NonZeroU8, NonZeroUsize, }, }; // any changes here should also be made in src/reactive_graph/guards.rs macro_rules! render_primitive { ($($child_type:ty),* $(,)?) => { $( paste::paste! { pub struct [<$child_type:camel State>](crate::renderer::types::Text, $child_type); impl Mountable for [<$child_type:camel State>] { fn unmount(&mut self) { self.0.unmount() } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { Rndr::insert_node(parent, self.0.as_ref(), marker); } fn insert_before_this(&self, child: &mut dyn Mountable, ) -> bool { self.0.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { vec![] } } impl Render for $child_type { type State = [<$child_type:camel State>]; fn build(self) -> Self::State { let node = Rndr::create_text_node(&self.to_string()); [<$child_type:camel State>](node, self) } fn rebuild(self, state: &mut Self::State) { let [<$child_type:camel State>](node, this) = state; if &self != this { Rndr::set_text(node, &self.to_string()); *this = self; } } } no_attrs!($child_type); impl RenderHtml for $child_type { type AsyncOutput = Self; type Owned = Self; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn to_html_with_buf(self, buf: &mut String, position: &mut Position, _escape: bool, _mark_branches: bool, _extra_attrs: Vec<AnyAttribute>) { // add a comment node to separate from previous sibling, if any if matches!(position, Position::NextChildAfterText) { buf.push_str("<!>") } _ = write!(buf, "{}", self); *position = Position::NextChildAfterText; } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { if position.get() == Position::FirstChild { cursor.child(); } else { cursor.sibling(); } // separating placeholder marker comes before text node if matches!(position.get(), Position::NextChildAfterText) { cursor.sibling(); } let node = cursor.current(); let node = crate::renderer::types::Text::cast_from(node.clone()) .unwrap_or_else(|| crate::hydration::failed_to_cast_text_node(node)); if !FROM_SERVER { Rndr::set_text(&node, &self.to_string()); } position.set(Position::NextChildAfterText); [<$child_type:camel State>](node, self) } fn into_owned(self) -> Self::Owned { self } } impl<'a> ToTemplate for $child_type { const TEMPLATE: &'static str = " <!>"; fn to_template( buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, position: &mut Position, ) { if matches!(*position, Position::NextChildAfterText) { buf.push_str("<!>") } buf.push(' '); *position = Position::NextChildAfterText; } } } )* }; } render_primitive![ usize, u8, u16, u32, u64, u128, isize, i8, i16, i32, i64, i128, f32, f64, char, bool, IpAddr, SocketAddr, SocketAddrV4, SocketAddrV6, Ipv4Addr, Ipv6Addr, NonZeroI8, NonZeroU8, NonZeroI16, NonZeroU16, NonZeroI32, NonZeroU32, NonZeroI64, NonZeroU64, NonZeroI128, NonZeroU128, NonZeroIsize, NonZeroUsize, ];
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/either.rs
tachys/src/view/either.rs
use super::{ add_attr::AddAnyAttr, MarkBranch, Mountable, Position, PositionState, Render, RenderHtml, }; use crate::{ html::attribute::{ any_attribute::AnyAttribute, Attribute, NamedAttributeKey, NextAttribute, }, hydration::Cursor, ssr::StreamBuilder, }; use either_of::*; use futures::future::join; impl<A, B> Render for Either<A, B> where A: Render, B: Render, { type State = Either<A::State, B::State>; fn build(self) -> Self::State { match self { Either::Left(left) => Either::Left(left.build()), Either::Right(right) => Either::Right(right.build()), } } fn rebuild(self, state: &mut Self::State) { match (self, &mut *state) { (Either::Left(new), Either::Left(old)) => { new.rebuild(old); } (Either::Right(new), Either::Right(old)) => { new.rebuild(old); } (Either::Right(new), Either::Left(old)) => { let mut new_state = new.build(); old.insert_before_this(&mut new_state); old.unmount(); *state = Either::Right(new_state); } (Either::Left(new), Either::Right(old)) => { let mut new_state = new.build(); old.insert_before_this(&mut new_state); old.unmount(); *state = Either::Left(new_state); } } } } impl<A, B> Mountable for Either<A, B> where A: Mountable, B: Mountable, { fn unmount(&mut self) { match self { Either::Left(left) => left.unmount(), Either::Right(right) => right.unmount(), } } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { match self { Either::Left(left) => left.mount(parent, marker), Either::Right(right) => right.mount(parent, marker), } } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { match &self { Either::Left(left) => left.insert_before_this(child), Either::Right(right) => right.insert_before_this(child), } } fn elements(&self) -> Vec<crate::renderer::types::Element> { match &self { Either::Left(left) => left.elements(), Either::Right(right) => right.elements(), } } } impl<A, B> AddAnyAttr for Either<A, B> where A: RenderHtml, B: RenderHtml, { type Output<SomeNewAttr: Attribute> = Either< <A as AddAnyAttr>::Output<SomeNewAttr>, <B as AddAnyAttr>::Output<SomeNewAttr>, >; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { match self { Either::Left(i) => Either::Left(i.add_any_attr(attr)), Either::Right(i) => Either::Right(i.add_any_attr(attr)), } } } const fn max_usize(vals: &[usize]) -> usize { let mut max = 0; let len = vals.len(); let mut i = 0; while i < len { if vals[i] > max { max = vals[i]; } i += 1; } max } #[cfg(not(erase_components))] impl<A, B> NextAttribute for Either<A, B> where B: NextAttribute, A: NextAttribute, { type Output<NewAttr: Attribute> = Either< <A as NextAttribute>::Output<NewAttr>, <B as NextAttribute>::Output<NewAttr>, >; fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { match self { Either::Left(left) => Either::Left(left.add_any_attr(new_attr)), Either::Right(right) => Either::Right(right.add_any_attr(new_attr)), } } } #[cfg(erase_components)] impl<A, B> NextAttribute for Either<A, B> where B: crate::html::attribute::any_attribute::IntoAnyAttribute, A: crate::html::attribute::any_attribute::IntoAnyAttribute, { type Output<NewAttr: Attribute> = Vec<AnyAttribute>; fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { use crate::html::attribute::any_attribute::IntoAnyAttribute; vec![ match self { Either::Left(left) => left.into_any_attr(), Either::Right(right) => right.into_any_attr(), }, new_attr.into_any_attr(), ] } } impl<A, B> Attribute for Either<A, B> where B: Attribute, A: Attribute, { const MIN_LENGTH: usize = max_usize(&[A::MIN_LENGTH, B::MIN_LENGTH]); type AsyncOutput = Either<A::AsyncOutput, B::AsyncOutput>; type State = Either<A::State, B::State>; type Cloneable = Either<A::Cloneable, B::Cloneable>; type CloneableOwned = Either<A::CloneableOwned, B::CloneableOwned>; fn html_len(&self) -> usize { match self { Either::Left(left) => left.html_len(), Either::Right(right) => right.html_len(), } } fn to_html( self, buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, ) { match self { Either::Left(left) => left.to_html(buf, class, style, inner_html), Either::Right(right) => { right.to_html(buf, class, style, inner_html) } } } fn hydrate<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State { match self { Either::Left(left) => Either::Left(left.hydrate::<FROM_SERVER>(el)), Either::Right(right) => { Either::Right(right.hydrate::<FROM_SERVER>(el)) } } } fn build(self, el: &crate::renderer::types::Element) -> Self::State { match self { Either::Left(left) => Either::Left(left.build(el)), Either::Right(right) => Either::Right(right.build(el)), } } fn rebuild(self, state: &mut Self::State) { match self { Either::Left(left) => { if let Some(state) = state.as_left_mut() { left.rebuild(state) } } Either::Right(right) => { if let Some(state) = state.as_right_mut() { right.rebuild(state) } } } } fn into_cloneable(self) -> Self::Cloneable { match self { Either::Left(left) => Either::Left(left.into_cloneable()), Either::Right(right) => Either::Right(right.into_cloneable()), } } fn into_cloneable_owned(self) -> Self::CloneableOwned { match self { Either::Left(left) => Either::Left(left.into_cloneable_owned()), Either::Right(right) => Either::Right(right.into_cloneable_owned()), } } fn dry_resolve(&mut self) { match self { Either::Left(left) => left.dry_resolve(), Either::Right(right) => right.dry_resolve(), } } async fn resolve(self) -> Self::AsyncOutput { match self { Either::Left(left) => Either::Left(left.resolve().await), Either::Right(right) => Either::Right(right.resolve().await), } } fn keys(&self) -> Vec<NamedAttributeKey> { match self { Either::Left(left) => left.keys(), Either::Right(right) => right.keys(), } } } impl<A, B> RenderHtml for Either<A, B> where A: RenderHtml, B: RenderHtml, { type AsyncOutput = Either<A::AsyncOutput, B::AsyncOutput>; type Owned = Either<A::Owned, B::Owned>; fn dry_resolve(&mut self) { match self { Either::Left(left) => left.dry_resolve(), Either::Right(right) => right.dry_resolve(), } } async fn resolve(self) -> Self::AsyncOutput { match self { Either::Left(left) => Either::Left(left.resolve().await), Either::Right(right) => Either::Right(right.resolve().await), } } const MIN_LENGTH: usize = max_usize(&[A::MIN_LENGTH, B::MIN_LENGTH]); #[inline(always)] fn html_len(&self) -> usize { match self { Either::Left(i) => i.html_len(), Either::Right(i) => i.html_len(), } } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { match self { Either::Left(left) => { if mark_branches && escape { buf.open_branch("0"); } left.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); if mark_branches && escape { buf.close_branch("0"); if *position == Position::NextChildAfterText { *position = Position::NextChild; } } } Either::Right(right) => { if mark_branches && escape { buf.open_branch("1"); } right.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); if mark_branches && escape { buf.close_branch("1"); if *position == Position::NextChildAfterText { *position = Position::NextChild; } } } } } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { match self { Either::Left(left) => { if mark_branches && escape { buf.open_branch("0"); } left.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); if mark_branches && escape { buf.close_branch("0"); if *position == Position::NextChildAfterText { *position = Position::NextChild; } } } Either::Right(right) => { if mark_branches && escape { buf.open_branch("1"); } right.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); if mark_branches && escape { buf.close_branch("1"); if *position == Position::NextChildAfterText { *position = Position::NextChild; } } } } } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { match self { Either::Left(left) => { Either::Left(left.hydrate::<FROM_SERVER>(cursor, position)) } Either::Right(right) => { Either::Right(right.hydrate::<FROM_SERVER>(cursor, position)) } } } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { match self { Either::Left(left) => { Either::Left(left.hydrate_async(cursor, position).await) } Either::Right(right) => { Either::Right(right.hydrate_async(cursor, position).await) } } } fn into_owned(self) -> Self::Owned { match self { Either::Left(left) => Either::Left(left.into_owned()), Either::Right(right) => Either::Right(right.into_owned()), } } } /// Stores each value in the view state, overwriting it only if `Some(_)` is provided. pub struct EitherKeepAlive<A, B> { /// The first possibility. pub a: Option<A>, /// The second possibility. pub b: Option<B>, /// If `true`, then `b` will be shown. pub show_b: bool, } /// Retained view state for [`EitherKeepAlive`]. pub struct EitherKeepAliveState<A, B> { a: Option<A>, b: Option<B>, showing_b: bool, } impl<A, B> Render for EitherKeepAlive<A, B> where A: Render, B: Render, { type State = EitherKeepAliveState<A::State, B::State>; fn build(self) -> Self::State { let showing_b = self.show_b; let a = self.a.map(Render::build); let b = self.b.map(Render::build); EitherKeepAliveState { a, b, showing_b } } fn rebuild(self, state: &mut Self::State) { // set or update A -- `None` just means "no change" match (self.a, &mut state.a) { (Some(new), Some(old)) => new.rebuild(old), (Some(new), None) => state.a = Some(new.build()), _ => {} } // set or update B match (self.b, &mut state.b) { (Some(new), Some(old)) => new.rebuild(old), (Some(new), None) => state.b = Some(new.build()), _ => {} } match (self.show_b, state.showing_b) { // transition from A to B (true, false) => match (&mut state.a, &mut state.b) { (Some(a), Some(b)) => { a.insert_before_this(b); a.unmount(); } _ => unreachable!(), }, // transition from B to A (false, true) => match (&mut state.a, &mut state.b) { (Some(a), Some(b)) => { b.insert_before_this(a); b.unmount(); } _ => unreachable!(), }, _ => {} } state.showing_b = self.show_b; } } impl<A, B> AddAnyAttr for EitherKeepAlive<A, B> where A: RenderHtml, B: RenderHtml, { type Output<SomeNewAttr: Attribute> = EitherKeepAlive< <A as AddAnyAttr>::Output<SomeNewAttr::Cloneable>, <B as AddAnyAttr>::Output<SomeNewAttr::Cloneable>, >; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let EitherKeepAlive { a, b, show_b } = self; let attr = attr.into_cloneable(); EitherKeepAlive { a: a.map(|a| a.add_any_attr(attr.clone())), b: b.map(|b| b.add_any_attr(attr.clone())), show_b, } } } impl<A, B> RenderHtml for EitherKeepAlive<A, B> where A: RenderHtml, B: RenderHtml, { type AsyncOutput = EitherKeepAlive<A::AsyncOutput, B::AsyncOutput>; type Owned = EitherKeepAlive<A::Owned, B::Owned>; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) { if let Some(inner) = &mut self.a { inner.dry_resolve(); } if let Some(inner) = &mut self.b { inner.dry_resolve(); } } async fn resolve(self) -> Self::AsyncOutput { let EitherKeepAlive { a, b, show_b } = self; let (a, b) = join( async move { match a { Some(a) => Some(a.resolve().await), None => None, } }, async move { match b { Some(b) => Some(b.resolve().await), None => None, } }, ) .await; EitherKeepAlive { a, b, show_b } } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { if self.show_b { self.b .expect("rendering B to HTML without filling it") .to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); } else { self.a .expect("rendering A to HTML without filling it") .to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); } } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { if self.show_b { self.b .expect("rendering B to HTML without filling it") .to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); } else { self.a .expect("rendering A to HTML without filling it") .to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); } } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let showing_b = self.show_b; let a = self.a.map(|a| { if showing_b { a.build() } else { a.hydrate::<FROM_SERVER>(cursor, position) } }); let b = self.b.map(|b| { if showing_b { b.hydrate::<FROM_SERVER>(cursor, position) } else { b.build() } }); EitherKeepAliveState { showing_b, a, b } } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let showing_b = self.show_b; let a = if let Some(a) = self.a { Some(if showing_b { a.build() } else { a.hydrate_async(cursor, position).await }) } else { None }; let b = if let Some(b) = self.b { Some(if showing_b { b.hydrate_async(cursor, position).await } else { b.build() }) } else { None }; EitherKeepAliveState { showing_b, a, b } } fn into_owned(self) -> Self::Owned { EitherKeepAlive { a: self.a.map(|a| a.into_owned()), b: self.b.map(|b| b.into_owned()), show_b: self.show_b, } } } impl<A, B> Mountable for EitherKeepAliveState<A, B> where A: Mountable, B: Mountable, { fn unmount(&mut self) { if self.showing_b { self.b.as_mut().expect("B was not present").unmount(); } else { self.a.as_mut().expect("A was not present").unmount(); } } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { if self.showing_b { self.b .as_mut() .expect("B was not present") .mount(parent, marker); } else { self.a .as_mut() .expect("A was not present") .mount(parent, marker); } } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { if self.showing_b { self.b .as_ref() .expect("B was not present") .insert_before_this(child) } else { self.a .as_ref() .expect("A was not present") .insert_before_this(child) } } fn elements(&self) -> Vec<crate::renderer::types::Element> { if self.showing_b { self.b .as_ref() .map(|inner| inner.elements()) .unwrap_or_default() } else { self.a .as_ref() .map(|inner| inner.elements()) .unwrap_or_default() } } } macro_rules! tuples { ($num:literal => $($ty:ident),*) => { paste::paste! { #[doc = concat!("Retained view state for ", stringify!([<EitherOf $num>]), ".")] pub struct [<EitherOf $num State>]<$($ty,)*> where $($ty: Render,)* { /// Which child view state is being displayed. pub state: [<EitherOf $num>]<$($ty::State,)*>, } impl<$($ty,)*> Mountable for [<EitherOf $num State>]<$($ty,)*> where $($ty: Render,)* { fn unmount(&mut self) { match &mut self.state { $([<EitherOf $num>]::$ty(this) => [<EitherOf $num>]::$ty(this.unmount()),)* }; } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { match &mut self.state { $([<EitherOf $num>]::$ty(this) => [<EitherOf $num>]::$ty(this.mount(parent, marker)),)* }; } fn insert_before_this(&self, child: &mut dyn Mountable, ) -> bool { match &self.state { $([<EitherOf $num>]::$ty(this) =>this.insert_before_this(child),)* } } fn elements(&self) -> Vec<crate::renderer::types::Element> { match &self.state { $([<EitherOf $num>]::$ty(this) => this.elements(),)* } } } impl<$($ty,)*> Render for [<EitherOf $num>]<$($ty,)*> where $($ty: Render,)* { type State = [<EitherOf $num State>]<$($ty,)*>; fn build(self) -> Self::State { let state = match self { $([<EitherOf $num>]::$ty(this) => [<EitherOf $num>]::$ty(this.build()),)* }; Self::State { state } } fn rebuild(self, state: &mut Self::State) { let new_state = match (self, &mut state.state) { // rebuild same state and return early $(([<EitherOf $num>]::$ty(new), [<EitherOf $num>]::$ty(old)) => { return new.rebuild(old); },)* // or mount new state $(([<EitherOf $num>]::$ty(new), _) => { let mut new = new.build(); state.insert_before_this(&mut new); [<EitherOf $num>]::$ty(new) },)* }; // and then unmount old state match &mut state.state { $([<EitherOf $num>]::$ty(this) => this.unmount(),)* }; // and store the new state state.state = new_state; } } impl<$($ty,)*> AddAnyAttr for [<EitherOf $num>]<$($ty,)*> where $($ty: RenderHtml,)* { type Output<SomeNewAttr: Attribute> = [<EitherOf $num>]< $(<$ty as AddAnyAttr>::Output<SomeNewAttr>,)* >; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { match self { $([<EitherOf $num>]::$ty(this) => [<EitherOf $num>]::$ty(this.add_any_attr(attr)),)* } } } impl<$($ty,)*> RenderHtml for [<EitherOf $num>]<$($ty,)*> where $($ty: RenderHtml,)* { type AsyncOutput = [<EitherOf $num>]<$($ty::AsyncOutput,)*>; type Owned = [<EitherOf $num>]<$($ty::Owned,)*>; const MIN_LENGTH: usize = max_usize(&[$($ty ::MIN_LENGTH,)*]); fn dry_resolve(&mut self) { match self { $([<EitherOf $num>]::$ty(this) => { this.dry_resolve(); })* } } async fn resolve(self) -> Self::AsyncOutput { match self { $([<EitherOf $num>]::$ty(this) => [<EitherOf $num>]::$ty(this.resolve().await),)* } } #[inline(always)] fn html_len(&self) -> usize { match self { $([<EitherOf $num>]::$ty(i) => i.html_len(),)* } } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute> ) { match self { $([<EitherOf $num>]::$ty(this) => { if mark_branches && escape { buf.open_branch(stringify!($ty)); } this.to_html_with_buf(buf, position, escape, mark_branches, extra_attrs); if mark_branches && escape { buf.close_branch(stringify!($ty)); if *position == Position::NextChildAfterText { *position = Position::NextChild; } } })* } } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute> ) where Self: Sized, { match self { $([<EitherOf $num>]::$ty(this) => { if mark_branches && escape { buf.open_branch(stringify!($ty)); } this.to_html_async_with_buf::<OUT_OF_ORDER>(buf, position, escape, mark_branches, extra_attrs); if mark_branches && escape { buf.close_branch(stringify!($ty)); if *position == Position::NextChildAfterText { *position = Position::NextChild; } } })* } } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let state = match self { $([<EitherOf $num>]::$ty(this) => { [<EitherOf $num>]::$ty(this.hydrate::<FROM_SERVER>(cursor, position)) })* }; Self::State { state } } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let state = match self { $([<EitherOf $num>]::$ty(this) => { [<EitherOf $num>]::$ty(this.hydrate_async(cursor, position).await) })* }; Self::State { state } } fn into_owned(self) -> Self::Owned { match self { $([<EitherOf $num>]::$ty(this) => { [<EitherOf $num>]::$ty(this.into_owned()) })* } } } } } } tuples!(3 => A, B, C); tuples!(4 => A, B, C, D); tuples!(5 => A, B, C, D, E); tuples!(6 => A, B, C, D, E, F); tuples!(7 => A, B, C, D, E, F, G); tuples!(8 => A, B, C, D, E, F, G, H); tuples!(9 => A, B, C, D, E, F, G, H, I); tuples!(10 => A, B, C, D, E, F, G, H, I, J); tuples!(11 => A, B, C, D, E, F, G, H, I, J, K); tuples!(12 => A, B, C, D, E, F, G, H, I, J, K, L); tuples!(13 => A, B, C, D, E, F, G, H, I, J, K, L, M); tuples!(14 => A, B, C, D, E, F, G, H, I, J, K, L, M, N); tuples!(15 => A, B, C, D, E, F, G, H, I, J, K, L, M, N, O); tuples!(16 => A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P);
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/keyed.rs
tachys/src/view/keyed.rs
use super::{ add_attr::AddAnyAttr, MarkBranch, Mountable, Position, PositionState, Render, RenderHtml, }; use crate::{ html::attribute::{any_attribute::AnyAttribute, Attribute}, hydration::Cursor, renderer::{CastFrom, Rndr}, ssr::StreamBuilder, }; use drain_filter_polyfill::VecExt as VecDrainFilterExt; use indexmap::IndexSet; use rustc_hash::FxHasher; use std::hash::{BuildHasherDefault, Hash}; type FxIndexSet<T> = IndexSet<T, BuildHasherDefault<FxHasher>>; /// Creates a keyed list of views. pub fn keyed<T, I, K, KF, VF, VFS, V>( items: I, key_fn: KF, view_fn: VF, ) -> Keyed<T, I, K, KF, VF, VFS, V> where I: IntoIterator<Item = T>, K: Eq + Hash + SerializableKey + 'static, KF: Fn(&T) -> K, V: Render, VF: Fn(usize, T) -> (VFS, V), VFS: Fn(usize), { Keyed { #[cfg(not(feature = "ssr"))] items: Some(items), #[cfg(feature = "ssr")] items: None, #[cfg(feature = "ssr")] ssr_items: items .into_iter() .enumerate() .map(|(i, t)| { let key = if cfg!(feature = "islands") { let key = (key_fn)(&t); key.ser_key() } else { String::new() }; let (_, view) = (view_fn)(i, t); (key, view) }) .collect::<Vec<_>>(), key_fn, view_fn, } } /// A keyed list of views. pub struct Keyed<T, I, K, KF, VF, VFS, V> where I: IntoIterator<Item = T>, K: Eq + Hash + 'static, KF: Fn(&T) -> K, VF: Fn(usize, T) -> (VFS, V), VFS: Fn(usize), { items: Option<I>, #[cfg(feature = "ssr")] ssr_items: Vec<(String, V)>, key_fn: KF, view_fn: VF, } /// By default, keys used in for keyed iteration do not need to be serializable. /// /// However, for some scenarios (like the “islands routing” mode that mixes server-side /// rendering with client-side navigation) it is useful to have serializable keys. /// /// When the `islands` feature is not enabled, this trait is implemented by all types. /// /// When the `islands` features is enabled, this is automatically implemented for all types /// that implement [`Serialize`](serde::Serialize), and can be manually implemented otherwise. pub trait SerializableKey { /// Serializes the key to a unique string. /// /// The string can have any value, as long as it is idempotent (i.e., serializing the same key /// multiple times will give the same value). fn ser_key(&self) -> String; } #[cfg(not(feature = "islands"))] impl<T> SerializableKey for T { fn ser_key(&self) -> String { panic!( "SerializableKey called without the `islands` feature enabled. \ Something has gone wrong." ); } } #[cfg(feature = "islands")] impl<T: serde::Serialize> SerializableKey for T { fn ser_key(&self) -> String { serde_json::to_string(self).expect("failed to serialize key") } } /// Retained view state for a keyed list. pub struct KeyedState<K, VFS, V> where K: Eq + Hash + 'static, VFS: Fn(usize), V: Render, { parent: Option<crate::renderer::types::Element>, marker: crate::renderer::types::Placeholder, hashed_items: IndexSet<K, BuildHasherDefault<FxHasher>>, rendered_items: Vec<Option<(VFS, V::State)>>, } impl<T, I, K, KF, VF, VFS, V> Render for Keyed<T, I, K, KF, VF, VFS, V> where I: IntoIterator<Item = T>, K: Eq + Hash + SerializableKey + 'static, KF: Fn(&T) -> K, V: Render, VF: Fn(usize, T) -> (VFS, V), VFS: Fn(usize), { type State = KeyedState<K, VFS, V>; fn build(self) -> Self::State { let items = self.items.into_iter().flatten(); let (capacity, _) = items.size_hint(); let mut hashed_items = FxIndexSet::with_capacity_and_hasher(capacity, Default::default()); let mut rendered_items = Vec::with_capacity(capacity); for (index, item) in items.enumerate() { hashed_items.insert((self.key_fn)(&item)); let (set_index, view) = (self.view_fn)(index, item); rendered_items.push(Some((set_index, view.build()))); } KeyedState { parent: None, marker: Rndr::create_placeholder(), hashed_items, rendered_items, } } fn rebuild(self, state: &mut Self::State) { let KeyedState { parent, marker, hashed_items, ref mut rendered_items, } = state; let new_items = self.items.into_iter().flatten(); let (capacity, _) = new_items.size_hint(); let mut new_hashed_items = FxIndexSet::with_capacity_and_hasher(capacity, Default::default()); let mut items = Vec::new(); for item in new_items { new_hashed_items.insert((self.key_fn)(&item)); items.push(Some(item)); } let cmds = diff(hashed_items, &new_hashed_items); apply_diff( parent.as_ref(), marker, cmds, rendered_items, &self.view_fn, items, ); *hashed_items = new_hashed_items; } } impl<T, I, K, KF, VF, VFS, V> AddAnyAttr for Keyed<T, I, K, KF, VF, VFS, V> where I: IntoIterator<Item = T> + Send + 'static, K: Eq + Hash + SerializableKey + 'static, KF: Fn(&T) -> K + Send + 'static, V: RenderHtml, V: 'static, VF: Fn(usize, T) -> (VFS, V) + Send + 'static, VFS: Fn(usize) + 'static, T: 'static, { type Output<SomeNewAttr: Attribute> = Keyed< T, I, K, KF, Box< dyn Fn( usize, T, ) -> ( VFS, <V as AddAnyAttr>::Output<SomeNewAttr::CloneableOwned>, ) + Send, >, VFS, V::Output<SomeNewAttr::CloneableOwned>, >; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let Keyed { items, #[cfg(feature = "ssr")] ssr_items, key_fn, view_fn, } = self; let attr = attr.into_cloneable_owned(); Keyed { items, key_fn, #[cfg(feature = "ssr")] ssr_items: ssr_items .into_iter() .map(|(k, v)| (k, v.add_any_attr(attr.clone()))) .collect(), view_fn: Box::new(move |index, item| { let (index, view) = view_fn(index, item); (index, view.add_any_attr(attr.clone())) }), } } } impl<T, I, K, KF, VF, VFS, V> RenderHtml for Keyed<T, I, K, KF, VF, VFS, V> where I: IntoIterator<Item = T> + Send + 'static, K: Eq + Hash + SerializableKey + 'static, KF: Fn(&T) -> K + Send + 'static, V: RenderHtml + 'static, VF: Fn(usize, T) -> (VFS, V) + Send + 'static, VFS: Fn(usize) + 'static, T: 'static, { type AsyncOutput = Vec<V::AsyncOutput>; // TODO type Owned = Self; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) { #[cfg(feature = "ssr")] for view in &mut self.ssr_items { view.dry_resolve(); } } async fn resolve(self) -> Self::AsyncOutput { #[cfg(feature = "ssr")] { futures::future::join_all( self.ssr_items.into_iter().map(|(_, view)| view.resolve()), ) .await .into_iter() .collect::<Vec<_>>() } #[cfg(not(feature = "ssr"))] { futures::future::join_all( self.items.into_iter().flatten().enumerate().map( |(index, item)| { let (_, view) = (self.view_fn)(index, item); view.resolve() }, ), ) .await .into_iter() .collect::<Vec<_>>() } } #[allow(unused)] fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { if mark_branches && escape { buf.open_branch("for"); } #[cfg(feature = "ssr")] for item in self.ssr_items { if mark_branches && escape { buf.open_branch("item"); } item.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs.clone(), ); if mark_branches && escape { buf.close_branch("item"); } *position = Position::NextChild; } if mark_branches && escape { buf.close_branch("for"); } buf.push_str("<!>"); } #[allow(unused)] fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { if mark_branches && escape { buf.open_branch("for"); } #[cfg(feature = "ssr")] for (key, item) in self.ssr_items { let branch_name = mark_branches.then(|| format!("item-{key}")); if mark_branches && escape { buf.open_branch(branch_name.as_ref().unwrap()); } item.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs.clone(), ); if mark_branches && escape { buf.close_branch(branch_name.as_ref().unwrap()); } *position = Position::NextChild; } if mark_branches && escape { buf.close_branch("for"); } buf.push_sync("<!>"); } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { // get parent and position let current = cursor.current(); let parent = if position.get() == Position::FirstChild { current } else { Rndr::get_parent(&current) .expect("first child of keyed list has no parent") }; let parent = crate::renderer::types::Element::cast_from(parent) .expect("parent of keyed list should be an element"); // build list let items = self.items.into_iter().flatten(); let (capacity, _) = items.size_hint(); let mut hashed_items = FxIndexSet::with_capacity_and_hasher(capacity, Default::default()); let mut rendered_items = Vec::with_capacity(capacity); for (index, item) in items.enumerate() { hashed_items.insert((self.key_fn)(&item)); let (set_index, view) = (self.view_fn)(index, item); let item = view.hydrate::<FROM_SERVER>(cursor, position); rendered_items.push(Some((set_index, item))); } let marker = cursor.next_placeholder(position); position.set(Position::NextChild); KeyedState { parent: Some(parent), marker, hashed_items, rendered_items, } } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { // get parent and position let current = cursor.current(); let parent = if position.get() == Position::FirstChild { current } else { Rndr::get_parent(&current) .expect("first child of keyed list has no parent") }; let parent = crate::renderer::types::Element::cast_from(parent) .expect("parent of keyed list should be an element"); // build list let items = self.items.into_iter().flatten(); let (capacity, _) = items.size_hint(); let mut hashed_items = FxIndexSet::with_capacity_and_hasher(capacity, Default::default()); let mut rendered_items = Vec::with_capacity(capacity); for (index, item) in items.enumerate() { hashed_items.insert((self.key_fn)(&item)); let (set_index, view) = (self.view_fn)(index, item); let item = view.hydrate_async(cursor, position).await; rendered_items.push(Some((set_index, item))); } let marker = cursor.next_placeholder(position); position.set(Position::NextChild); KeyedState { parent: Some(parent), marker, hashed_items, rendered_items, } } fn into_owned(self) -> Self::Owned { self } } impl<K, VFS, V> Mountable for KeyedState<K, VFS, V> where K: Eq + Hash + 'static, VFS: Fn(usize), V: Render, { fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { self.parent = Some(parent.clone()); for (_, item) in self.rendered_items.iter_mut().flatten() { item.mount(parent, marker); } self.marker.mount(parent, marker); } fn unmount(&mut self) { for (_, item) in self.rendered_items.iter_mut().flatten() { item.unmount(); } self.marker.unmount(); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.rendered_items .first() .map(|item| { if let Some((_, item)) = item { item.insert_before_this(child) } else { false } }) .unwrap_or_else(|| self.marker.insert_before_this(child)) } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.rendered_items .iter() .flatten() .flat_map(|item| item.1.elements()) .collect() } } trait VecExt<T> { fn get_next_closest_mounted_sibling( &self, start_at: usize, ) -> Option<&Option<T>>; } impl<T> VecExt<T> for Vec<Option<T>> { fn get_next_closest_mounted_sibling( &self, start_at: usize, ) -> Option<&Option<T>> { self[start_at..].iter().find(|s| s.is_some()) } } /// Calculates the operations needed to get from `from` to `to`. fn diff<K: Eq + Hash>(from: &FxIndexSet<K>, to: &FxIndexSet<K>) -> Diff { if from.is_empty() && to.is_empty() { return Diff::default(); } else if to.is_empty() { return Diff { clear: true, ..Default::default() }; } else if from.is_empty() { return Diff { added: to .iter() .enumerate() .map(|(at, _)| DiffOpAdd { at, mode: DiffOpAddMode::Append, }) .collect(), ..Default::default() }; } let mut removed = vec![]; let mut moved = vec![]; let mut added = vec![]; let max_len = std::cmp::max(from.len(), to.len()); for index in 0..max_len { let from_item = from.get_index(index); let to_item = to.get_index(index); // if they're the same, do nothing if from_item != to_item { // if it's only in old, not new, remove it if from_item.is_some() && !to.contains(from_item.unwrap()) { let op = DiffOpRemove { at: index }; removed.push(op); } // if it's only in new, not old, add it if to_item.is_some() && !from.contains(to_item.unwrap()) { let op = DiffOpAdd { at: index, mode: DiffOpAddMode::Normal, }; added.push(op); } // if it's in both old and new, it can either // 1) be moved (and need to move in the DOM) // 2) be moved (but not need to move in the DOM) // * this would happen if, for example, 2 items // have been added before it, and it has moved by 2 if let Some(from_item) = from_item { if let Some(to_item) = to.get_full(from_item) { let moves_forward_by = (to_item.0 as i32) - (index as i32); let move_in_dom = moves_forward_by != (added.len() as i32) - (removed.len() as i32); let op = DiffOpMove { from: index, len: 1, to: to_item.0, move_in_dom, }; moved.push(op); } } } } moved = group_adjacent_moves(moved); Diff { removed, items_to_move: moved.iter().map(|m| m.len).sum(), moved, added, clear: false, } } /// Group adjacent items that are being moved as a group. /// For example from `[2, 3, 5, 6]` to `[1, 2, 3, 4, 5, 6]` should result /// in a move for `2,3` and `5,6` rather than 4 individual moves. fn group_adjacent_moves(moved: Vec<DiffOpMove>) -> Vec<DiffOpMove> { let mut prev: Option<DiffOpMove> = None; let mut new_moved = Vec::with_capacity(moved.len()); for m in moved { match prev { Some(mut p) => { if (m.from == p.from + p.len) && (m.to == p.to + p.len) { p.len += 1; prev = Some(p); } else { new_moved.push(prev.take().unwrap()); prev = Some(m); } } None => prev = Some(m), } } if let Some(prev) = prev { new_moved.push(prev) } new_moved } #[derive(Debug, Default, PartialEq, Eq)] struct Diff { removed: Vec<DiffOpRemove>, moved: Vec<DiffOpMove>, items_to_move: usize, added: Vec<DiffOpAdd>, clear: bool, } #[derive(Clone, Copy, Debug, PartialEq, Eq)] struct DiffOpMove { /// The index this range is starting relative to `from`. from: usize, /// The number of elements included in this range. len: usize, /// The starting index this range will be moved to relative to `to`. to: usize, /// Marks this move to be applied to the DOM, or just to the underlying /// storage move_in_dom: bool, } impl Default for DiffOpMove { fn default() -> Self { Self { from: 0, to: 0, len: 1, move_in_dom: true, } } } #[derive(Clone, Copy, Debug, Default, PartialEq, Eq)] struct DiffOpAdd { at: usize, mode: DiffOpAddMode, } #[derive(Debug, PartialEq, Eq)] struct DiffOpRemove { at: usize, } #[derive(Clone, Copy, Debug, PartialEq, Eq, Default)] enum DiffOpAddMode { #[default] Normal, Append, } fn apply_diff<T, VFS, V>( parent: Option<&crate::renderer::types::Element>, marker: &crate::renderer::types::Placeholder, diff: Diff, children: &mut Vec<Option<(VFS, V::State)>>, view_fn: impl Fn(usize, T) -> (VFS, V), mut items: Vec<Option<T>>, ) where VFS: Fn(usize), V: Render, { // The order of cmds needs to be: // 1. Clear // 2. Removals // 3. Move out // 4. Resize // 5. Move in // 6. Additions // 7. Removes holes if diff.clear { for (_, mut child) in children.drain(0..).flatten() { child.unmount(); } if diff.added.is_empty() { return; } } for DiffOpRemove { at } in &diff.removed { let (_, mut item_to_remove) = children[*at].take().unwrap(); item_to_remove.unmount(); } let (move_cmds, add_cmds) = unpack_moves(&diff); let mut moved_children = move_cmds .iter() .map(|move_| children[move_.from].take()) .collect::<Vec<_>>(); children.resize_with(children.len() + diff.added.len(), || None); for (i, DiffOpMove { to, .. }) in move_cmds .iter() .enumerate() .filter(|(_, move_)| !move_.move_in_dom) { children[*to] = moved_children[i] .take() .inspect(|(set_index, _)| set_index(*to)); } for (i, DiffOpMove { to, .. }) in move_cmds .into_iter() .enumerate() .filter(|(_, move_)| move_.move_in_dom) { let (set_index, mut each_item) = moved_children[i].take().unwrap(); if let Some(parent) = parent { if let Some(Some((_, state))) = children.get_next_closest_mounted_sibling(to) { state.insert_before_this_or_marker( parent, &mut each_item, Some(marker.as_ref()), ) } else { each_item.try_mount(parent, Some(marker.as_ref())); } } set_index(to); children[to] = Some((set_index, each_item)); } for DiffOpAdd { at, mode } in add_cmds { let item = items[at].take().unwrap(); let (set_index, item) = view_fn(at, item); let mut item = item.build(); if let Some(parent) = parent { match mode { DiffOpAddMode::Normal => { if let Some(Some((_, state))) = children.get_next_closest_mounted_sibling(at) { state.insert_before_this_or_marker( parent, &mut item, Some(marker.as_ref()), ) } else { item.try_mount(parent, Some(marker.as_ref())); } } DiffOpAddMode::Append => { item.try_mount(parent, Some(marker.as_ref())); } } } children[at] = Some((set_index, item)); } #[allow(unstable_name_collisions)] children.drain_filter(|c| c.is_none()); } fn unpack_moves(diff: &Diff) -> (Vec<DiffOpMove>, Vec<DiffOpAdd>) { let mut moves = Vec::with_capacity(diff.items_to_move); let mut adds = Vec::with_capacity(diff.added.len()); let mut removes_iter = diff.removed.iter(); let mut adds_iter = diff.added.iter(); let mut moves_iter = diff.moved.iter(); let mut removes_next = removes_iter.next(); let mut adds_next = adds_iter.next(); let mut moves_next = moves_iter.next().copied(); for i in 0..diff.items_to_move + diff.added.len() + diff.removed.len() { if let Some(DiffOpRemove { at, .. }) = removes_next { if i == *at { removes_next = removes_iter.next(); continue; } } match (adds_next, &mut moves_next) { (Some(add), Some(move_)) => { if add.at == i { adds.push(*add); adds_next = adds_iter.next(); } else { let mut single_move = *move_; single_move.len = 1; moves.push(single_move); move_.len -= 1; move_.from += 1; move_.to += 1; if move_.len == 0 { moves_next = moves_iter.next().copied(); } } } (Some(add), None) => { adds.push(*add); adds_next = adds_iter.next(); } (None, Some(move_)) => { let mut single_move = *move_; single_move.len = 1; moves.push(single_move); move_.len -= 1; move_.from += 1; move_.to += 1; if move_.len == 0 { moves_next = moves_iter.next().copied(); } } (None, None) => break, } } (moves, adds) } /* #[cfg(test)] mod tests { use crate::{ html::element::{li, ul, HtmlElement, Li}, renderer::mock_dom::MockDom, view::{keyed::keyed, Render}, }; fn item(key: usize) -> HtmlElement<Li, (), String, MockDom> { li((), key.to_string()) } #[test] fn keyed_creates_list() { let el = ul((), keyed(1..=3, |k| *k, item)); let el_state = el.build(); assert_eq!( el_state.el.to_debug_html(), "<ul><li>1</li><li>2</li><li>3</li></ul>" ); } #[test] fn adding_items_updates_list() { let el = ul((), keyed(1..=3, |k| *k, item)); let mut el_state = el.build(); let el = ul((), keyed(1..=5, |k| *k, item)); el.rebuild(&mut el_state); assert_eq!( el_state.el.to_debug_html(), "<ul><li>1</li><li>2</li><li>3</li><li>4</li><li>5</li></ul>" ); } #[test] fn removing_items_updates_list() { let el = ul((), keyed(1..=3, |k| *k, item)); let mut el_state = el.build(); let el = ul((), keyed(1..=2, |k| *k, item)); el.rebuild(&mut el_state); assert_eq!( el_state.el.to_debug_html(), "<ul><li>1</li><li>2</li></ul>" ); } #[test] fn swapping_items_updates_list() { let el = ul((), keyed([1, 2, 3, 4, 5], |k| *k, item)); let mut el_state = el.build(); let el = ul((), keyed([1, 4, 3, 2, 5], |k| *k, item)); el.rebuild(&mut el_state); assert_eq!( el_state.el.to_debug_html(), "<ul><li>1</li><li>4</li><li>3</li><li>2</li><li>5</li></ul>" ); } #[test] fn swapping_and_removing_orders_correctly() { let el = ul((), keyed([1, 2, 3, 4, 5], |k| *k, item)); let mut el_state = el.build(); let el = ul((), keyed([1, 4, 3, 5], |k| *k, item)); el.rebuild(&mut el_state); assert_eq!( el_state.el.to_debug_html(), "<ul><li>1</li><li>4</li><li>3</li><li>5</li></ul>" ); } #[test] fn arbitrarily_hard_adjustment() { let el = ul((), keyed([1, 2, 3, 4, 5], |k| *k, item)); let mut el_state = el.build(); let el = ul((), keyed([2, 4, 3], |k| *k, item)); el.rebuild(&mut el_state); assert_eq!( el_state.el.to_debug_html(), "<ul><li>2</li><li>4</li><li>3</li></ul>" ); } #[test] fn a_series_of_moves() { let el = ul((), keyed([1, 2, 3, 4, 5], |k| *k, item)); let mut el_state = el.build(); let el = ul((), keyed([2, 4, 3], |k| *k, item)); el.rebuild(&mut el_state); let el = ul((), keyed([1, 7, 5, 11, 13, 17], |k| *k, item)); el.rebuild(&mut el_state); let el = ul((), keyed([2, 6, 8, 7, 13], |k| *k, item)); el.rebuild(&mut el_state); let el = ul((), keyed([13, 4, 5, 3], |k| *k, item)); el.rebuild(&mut el_state); let el = ul((), keyed([1, 2, 3, 4], |k| *k, item)); el.rebuild(&mut el_state); assert_eq!( el_state.el.to_debug_html(), "<ul><li>1</li><li>2</li><li>3</li><li>4</li></ul>" ); } #[test] fn clearing_works() { let el = ul((), keyed([1, 2, 3, 4, 5], |k| *k, item)); let mut el_state = el.build(); let el = ul((), keyed([], |k| *k, item)); el.rebuild(&mut el_state); assert_eq!(el_state.el.to_debug_html(), "<ul></ul>"); } } */
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/iterators.rs
tachys/src/view/iterators.rs
use super::{ add_attr::AddAnyAttr, Mountable, Position, PositionState, Render, RenderHtml, }; use crate::{ html::attribute::{any_attribute::AnyAttribute, Attribute}, hydration::Cursor, renderer::Rndr, ssr::StreamBuilder, }; use either_of::Either; use itertools::Itertools; /// Retained view state for an `Option`. pub type OptionState<T> = Either<<T as Render>::State, <() as Render>::State>; impl<T> Render for Option<T> where T: Render, { type State = OptionState<T>; fn build(self) -> Self::State { match self { Some(value) => Either::Left(value), None => Either::Right(()), } .build() } fn rebuild(self, state: &mut Self::State) { match self { Some(value) => Either::Left(value), None => Either::Right(()), } .rebuild(state) } } impl<T> AddAnyAttr for Option<T> where T: AddAnyAttr, { type Output<SomeNewAttr: Attribute> = Option<<T as AddAnyAttr>::Output<SomeNewAttr>>; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { self.map(|n| n.add_any_attr(attr)) } } impl<T> RenderHtml for Option<T> where T: RenderHtml, { type AsyncOutput = Option<T::AsyncOutput>; type Owned = Option<T::Owned>; const MIN_LENGTH: usize = T::MIN_LENGTH; fn dry_resolve(&mut self) { if let Some(inner) = self.as_mut() { inner.dry_resolve(); } } async fn resolve(self) -> Self::AsyncOutput { match self { None => None, Some(value) => Some(value.resolve().await), } } fn html_len(&self) -> usize { match self { Some(i) => i.html_len() + 3, None => 3, } } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { match self { Some(value) => Either::Left(value), None => Either::Right(()), } .to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ) } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { match self { Some(value) => Either::Left(value), None => Either::Right(()), } .to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ) } #[track_caller] fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { match self { Some(value) => Either::Left(value), None => Either::Right(()), } .hydrate::<FROM_SERVER>(cursor, position) } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { match self { Some(value) => Either::Left(value), None => Either::Right(()), } .hydrate_async(cursor, position) .await } fn into_owned(self) -> Self::Owned { self.map(RenderHtml::into_owned) } } impl<T> Render for Vec<T> where T: Render, { type State = VecState<T::State>; fn build(self) -> Self::State { let marker = Rndr::create_placeholder(); VecState { states: self.into_iter().map(T::build).collect(), marker, } } fn rebuild(self, state: &mut Self::State) { let VecState { states, marker } = state; let old = states; // this is an unkeyed diff if old.is_empty() { let mut new = self.build().states; for item in new.iter_mut() { Rndr::try_mount_before(item, marker.as_ref()); } *old = new; } else if self.is_empty() { // TODO fast path for clearing for item in old.iter_mut() { item.unmount(); } old.clear(); } else { let mut adds = vec![]; let mut removes_at_end = 0; for item in self.into_iter().zip_longest(old.iter_mut()) { match item { itertools::EitherOrBoth::Both(new, old) => { T::rebuild(new, old) } itertools::EitherOrBoth::Left(new) => { let mut new_state = new.build(); Rndr::try_mount_before(&mut new_state, marker.as_ref()); adds.push(new_state); } itertools::EitherOrBoth::Right(old) => { removes_at_end += 1; old.unmount() } } } old.truncate(old.len() - removes_at_end); old.append(&mut adds); } } } /// Retained view state for a `Vec<_>`. pub struct VecState<T> where T: Mountable, { states: Vec<T>, // Vecs keep a placeholder because they have the potential to add additional items, // after their own items but before the next neighbor. It is much easier to add an // item before a known placeholder than to add it after the last known item, so we // just leave a placeholder here unlike zero-or-one iterators (Option, Result, etc.) marker: crate::renderer::types::Placeholder, } impl<T> Mountable for VecState<T> where T: Mountable, { fn unmount(&mut self) { for state in self.states.iter_mut() { state.unmount(); } self.marker.unmount(); } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { for state in self.states.iter_mut() { state.mount(parent, marker); } self.marker.mount(parent, marker); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { for state in &self.states { if state.insert_before_this(child) { return true; } } self.marker.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.states .iter() .flat_map(|item| item.elements()) .collect() } } impl<T> AddAnyAttr for Vec<T> where T: AddAnyAttr, { type Output<SomeNewAttr: Attribute> = Vec<<T as AddAnyAttr>::Output<SomeNewAttr::Cloneable>>; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let attr = attr.into_cloneable(); self.into_iter() .map(|n| n.add_any_attr(attr.clone())) .collect() } } impl<T> RenderHtml for Vec<T> where T: RenderHtml, { type AsyncOutput = Vec<T::AsyncOutput>; type Owned = Vec<T::Owned>; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) { for inner in self.iter_mut() { inner.dry_resolve(); } } async fn resolve(self) -> Self::AsyncOutput { futures::future::join_all(self.into_iter().map(T::resolve)) .await .into_iter() .collect() } fn html_len(&self) -> usize { self.iter().map(|n| n.html_len()).sum::<usize>() + 3 } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { let mut children = self.into_iter(); if let Some(first) = children.next() { first.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs.clone(), ); } for child in children { child.to_html_with_buf( buf, position, escape, mark_branches, // each child will have the extra attributes applied extra_attrs.clone(), ); } if escape { buf.push_str("<!>"); *position = Position::NextChild; } } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { let mut children = self.into_iter(); if let Some(first) = children.next() { first.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs.clone(), ); } for child in children { child.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs.clone(), ); } if escape { buf.push_sync("<!>"); *position = Position::NextChild; } } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let states = self .into_iter() .map(|child| child.hydrate::<FROM_SERVER>(cursor, position)) .collect(); let marker = cursor.next_placeholder(position); position.set(Position::NextChild); VecState { states, marker } } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let mut states = Vec::with_capacity(self.len()); for child in self { states.push(child.hydrate_async(cursor, position).await); } let marker = cursor.next_placeholder(position); position.set(Position::NextChild); VecState { states, marker } } fn into_owned(self) -> Self::Owned { self.into_iter() .map(RenderHtml::into_owned) .collect::<Vec<_>>() } } /// A container used for ErasedMode. It's slightly better than a raw Vec<> because the rendering traits don't have to worry about the length of the Vec changing, therefore no marker traits etc. pub struct StaticVec<T>(pub(crate) Vec<T>); impl<T: Clone> Clone for StaticVec<T> { fn clone(&self) -> Self { Self(self.0.clone()) } } impl<T> IntoIterator for StaticVec<T> { type Item = T; type IntoIter = std::vec::IntoIter<T>; fn into_iter(self) -> Self::IntoIter { self.0.into_iter() } } impl<T> StaticVec<T> { /// Iterates over the items. pub fn iter(&self) -> std::slice::Iter<'_, T> { self.0.iter() } } impl<T> From<Vec<T>> for StaticVec<T> { fn from(vec: Vec<T>) -> Self { Self(vec) } } impl<T> From<StaticVec<T>> for Vec<T> { fn from(static_vec: StaticVec<T>) -> Self { static_vec.0 } } /// Retained view state for a `StaticVec<Vec<_>>`. pub struct StaticVecState<T> where T: Mountable, { states: Vec<T>, marker: crate::renderer::types::Placeholder, } impl<T> Mountable for StaticVecState<T> where T: Mountable, { fn unmount(&mut self) { for state in self.states.iter_mut() { state.unmount(); } self.marker.unmount(); } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { for state in self.states.iter_mut() { state.mount(parent, marker); } self.marker.mount(parent, marker); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { for state in &self.states { if state.insert_before_this(child) { return true; } } self.marker.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.states .iter() .flat_map(|item| item.elements()) .collect() } } impl<T> Render for StaticVec<T> where T: Render, { type State = StaticVecState<T::State>; fn build(self) -> Self::State { let marker = Rndr::create_placeholder(); Self::State { states: self.0.into_iter().map(T::build).collect(), marker, } } fn rebuild(self, state: &mut Self::State) { let StaticVecState { states, marker } = state; let old = states; // reuses the Vec impl if old.is_empty() { let mut new = self.build().states; for item in new.iter_mut() { Rndr::mount_before(item, marker.as_ref()); } *old = new; } else if self.0.is_empty() { // TODO fast path for clearing for item in old.iter_mut() { item.unmount(); } old.clear(); } else { let mut adds = vec![]; let mut removes_at_end = 0; for item in self.0.into_iter().zip_longest(old.iter_mut()) { match item { itertools::EitherOrBoth::Both(new, old) => { T::rebuild(new, old) } itertools::EitherOrBoth::Left(new) => { let mut new_state = new.build(); Rndr::mount_before(&mut new_state, marker.as_ref()); adds.push(new_state); } itertools::EitherOrBoth::Right(old) => { removes_at_end += 1; old.unmount() } } } old.truncate(old.len() - removes_at_end); old.append(&mut adds); } } } impl<T> AddAnyAttr for StaticVec<T> where T: AddAnyAttr, { type Output<SomeNewAttr: Attribute> = StaticVec<<T as AddAnyAttr>::Output<SomeNewAttr::Cloneable>>; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let attr = attr.into_cloneable(); self.0 .into_iter() .map(|n| n.add_any_attr(attr.clone())) .collect::<Vec<_>>() .into() } } impl<T> RenderHtml for StaticVec<T> where T: RenderHtml, { type AsyncOutput = StaticVec<T::AsyncOutput>; type Owned = StaticVec<T::Owned>; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) { for inner in self.0.iter_mut() { inner.dry_resolve(); } } async fn resolve(self) -> Self::AsyncOutput { futures::future::join_all(self.0.into_iter().map(T::resolve)) .await .into_iter() .collect::<Vec<_>>() .into() } fn html_len(&self) -> usize { self.0.iter().map(RenderHtml::html_len).sum::<usize>() + 3 } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { for child in self.0.into_iter() { child.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs.clone(), ); } if escape { buf.push_str("<!>"); *position = Position::NextChild; } } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { for child in self.0.into_iter() { child.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs.clone(), ); } if escape { buf.push_sync("<!>"); *position = Position::NextChild; } } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let states = self .0 .into_iter() .map(|child| child.hydrate::<FROM_SERVER>(cursor, position)) .collect(); let marker = cursor.next_placeholder(position); position.set(Position::NextChild); Self::State { states, marker } } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let mut states = Vec::with_capacity(self.0.len()); for child in self.0 { states.push(child.hydrate_async(cursor, position).await); } let marker = cursor.next_placeholder(position); position.set(Position::NextChild); Self::State { states, marker } } fn into_owned(self) -> Self::Owned { self.0 .into_iter() .map(RenderHtml::into_owned) .collect::<Vec<_>>() .into() } } impl<T, const N: usize> Render for [T; N] where T: Render, { type State = ArrayState<T::State, N>; fn build(self) -> Self::State { Self::State { states: self.map(T::build), } } fn rebuild(self, state: &mut Self::State) { let Self::State { states } = state; let old = states; // this is an unkeyed diff self.into_iter() .zip(old.iter_mut()) .for_each(|(new, old)| T::rebuild(new, old)); } } /// Retained view state for a `Vec<_>`. pub struct ArrayState<T, const N: usize> where T: Mountable, { states: [T; N], } impl<T, const N: usize> Mountable for ArrayState<T, N> where T: Mountable, { fn unmount(&mut self) { self.states.iter_mut().for_each(Mountable::unmount); } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { for state in self.states.iter_mut() { state.mount(parent, marker); } } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { for state in &self.states { if state.insert_before_this(child) { return true; } } false } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.states .iter() .flat_map(|item| item.elements()) .collect() } } impl<T, const N: usize> AddAnyAttr for [T; N] where T: AddAnyAttr, { type Output<SomeNewAttr: Attribute> = [<T as AddAnyAttr>::Output<SomeNewAttr::Cloneable>; N]; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let attr = attr.into_cloneable(); self.map(|n| n.add_any_attr(attr.clone())) } } impl<T, const N: usize> RenderHtml for [T; N] where T: RenderHtml, { type AsyncOutput = [T::AsyncOutput; N]; type Owned = [T::Owned; N]; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) { for inner in self.iter_mut() { inner.dry_resolve(); } } async fn resolve(self) -> Self::AsyncOutput { futures::future::join_all(self.into_iter().map(T::resolve)) .await .into_iter() .collect::<Vec<_>>() .try_into() .unwrap_or_else(|_| unreachable!()) } fn html_len(&self) -> usize { self.iter().map(RenderHtml::html_len).sum::<usize>() } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { for child in self.into_iter() { child.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs.clone(), ); } } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { for child in self.into_iter() { child.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs.clone(), ); } } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let states = self.map(|child| child.hydrate::<FROM_SERVER>(cursor, position)); ArrayState { states } } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let mut states = Vec::with_capacity(self.len()); for child in self { states.push(child.hydrate_async(cursor, position).await); } let Ok(states) = <[<T as Render>::State; N]>::try_from(states) else { unreachable!() }; ArrayState { states } } fn into_owned(self) -> Self::Owned { self.into_iter() .map(RenderHtml::into_owned) .collect::<Vec<_>>() .try_into() .unwrap_or_else(|_| unreachable!()) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/mod.rs
tachys/src/view/mod.rs
use self::add_attr::AddAnyAttr; use crate::{ html::attribute::any_attribute::AnyAttribute, hydration::Cursor, ssr::StreamBuilder, }; use parking_lot::RwLock; use std::{cell::RefCell, future::Future, rc::Rc, sync::Arc}; /// Add attributes to typed views. pub mod add_attr; /// A typed-erased view type. pub mod any_view; /// Allows choosing between one of several views. pub mod either; /// View rendering for `Result<_, _>` types. pub mod error_boundary; /// A type-erased view collection. pub mod fragment; /// View implementations for several iterable types. pub mod iterators; /// Keyed list iteration. pub mod keyed; mod primitives; /// Optimized types for static strings known at compile time. #[cfg(all(feature = "nightly", rustc_nightly))] pub mod static_types; /// View implementation for string types. pub mod strings; /// Optimizations for creating views via HTML `<template>` nodes. pub mod template; /// View implementations for tuples. pub mod tuples; /// The `Render` trait allows rendering something as part of the user interface. pub trait Render: Sized { /// The “view state” for this type, which can be retained between updates. /// /// For example, for a text node, `State` might be the actual DOM text node /// and the previous string, to allow for diffing between updates. type State: Mountable; /// Creates the view for the first time, without hydrating from existing HTML. fn build(self) -> Self::State; /// Updates the view with new data. fn rebuild(self, state: &mut Self::State); } #[doc(hidden)] pub trait MarkBranch { fn open_branch(&mut self, branch_id: &str); fn close_branch(&mut self, branch_id: &str); } impl MarkBranch for String { fn open_branch(&mut self, branch_id: &str) { self.push_str("<!--bo-"); self.push_str(branch_id); self.push_str("-->"); } fn close_branch(&mut self, branch_id: &str) { self.push_str("<!--bc-"); self.push_str(branch_id); self.push_str("-->"); } } impl MarkBranch for StreamBuilder { fn open_branch(&mut self, branch_id: &str) { self.sync_buf.push_str("<!--bo-"); self.sync_buf.push_str(branch_id); self.sync_buf.push_str("-->"); } fn close_branch(&mut self, branch_id: &str) { self.sync_buf.push_str("<!--bc-"); self.sync_buf.push_str(branch_id); self.sync_buf.push_str("-->"); } } /// The `RenderHtml` trait allows rendering something to HTML, and transforming /// that HTML into an interactive interface. /// /// This process is traditionally called “server rendering” and “hydration.” As a /// metaphor, this means that the structure of the view is created on the server, then /// “dehydrated” to HTML, sent across the network, and “rehydrated” with interactivity /// in the browser. /// /// However, the same process can be done entirely in the browser: for example, a view /// can be transformed into some HTML that is used to create a `<template>` node, which /// can be cloned many times and “hydrated,” which is more efficient than creating the /// whole view piece by piece. pub trait RenderHtml where Self: Render + AddAnyAttr + Send, { /// The type of the view after waiting for all asynchronous data to load. type AsyncOutput: RenderHtml; /// An equivalent value that is `'static`. type Owned: RenderHtml + 'static; /// The minimum length of HTML created when this view is rendered. const MIN_LENGTH: usize; /// Whether this should actually exist in the DOM, if it is the child of an element. const EXISTS: bool = true; /// “Runs” the view without other side effects. For primitive types, this is a no-op. For /// reactive types, this can be used to gather data about reactivity or about asynchronous data /// that needs to be loaded. fn dry_resolve(&mut self); /// Waits for any asynchronous sections of the view to load and returns the output. fn resolve(self) -> impl Future<Output = Self::AsyncOutput> + Send; /// An estimated length for this view, when rendered to HTML. /// /// This is used for calculating the string buffer size when rendering HTML. It does not need /// to be precise, but should be an appropriate estimate. The more accurate, the fewer /// reallocations will be required and the faster server-side rendering will be. fn html_len(&self) -> usize { Self::MIN_LENGTH } /// Renders a view to an HTML string. fn to_html(self) -> String where Self: Sized, { let mut buf = String::with_capacity(self.html_len()); self.to_html_with_buf( &mut buf, &mut Position::FirstChild, true, false, vec![], ); buf } /// Renders a view to HTML with branch markers. This can be used to support libraries that diff /// HTML pages against one another, by marking sections of the view that branch to different /// types with marker comments. fn to_html_branching(self) -> String where Self: Sized, { let mut buf = String::with_capacity(self.html_len()); self.to_html_with_buf( &mut buf, &mut Position::FirstChild, true, true, vec![], ); buf } /// Renders a view to an in-order stream of HTML. fn to_html_stream_in_order(self) -> StreamBuilder where Self: Sized, { let mut builder = StreamBuilder::with_capacity(self.html_len(), None); self.to_html_async_with_buf::<false>( &mut builder, &mut Position::FirstChild, true, false, vec![], ); builder.finish() } /// Renders a view to an in-order stream of HTML with branch markers. This can be used to support libraries that diff /// HTML pages against one another, by marking sections of the view that branch to different /// types with marker comments. fn to_html_stream_in_order_branching(self) -> StreamBuilder where Self: Sized, { let mut builder = StreamBuilder::with_capacity(self.html_len(), None); self.to_html_async_with_buf::<false>( &mut builder, &mut Position::FirstChild, true, true, vec![], ); builder.finish() } /// Renders a view to an out-of-order stream of HTML. fn to_html_stream_out_of_order(self) -> StreamBuilder where Self: Sized, { //let capacity = self.html_len(); let mut builder = StreamBuilder::with_capacity(self.html_len(), Some(vec![0])); self.to_html_async_with_buf::<true>( &mut builder, &mut Position::FirstChild, true, false, vec![], ); builder.finish() } /// Renders a view to an out-of-order stream of HTML with branch markers. This can be used to support libraries that diff /// HTML pages against one another, by marking sections of the view that branch to different /// types with marker comments. fn to_html_stream_out_of_order_branching(self) -> StreamBuilder where Self: Sized, { let mut builder = StreamBuilder::with_capacity(self.html_len(), Some(vec![0])); self.to_html_async_with_buf::<true>( &mut builder, &mut Position::FirstChild, true, true, vec![], ); builder.finish() } /// Renders a view to HTML, writing it into the given buffer. fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ); /// Renders a view into a buffer of (synchronous or asynchronous) HTML chunks. fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { buf.with_buf(|buf| { self.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ) }); } /// Makes a set of DOM nodes rendered from HTML interactive. /// /// If `FROM_SERVER` is `true`, this HTML was rendered using [`RenderHtml::to_html`] /// (e.g., during server-side rendering ). /// /// If `FROM_SERVER` is `false`, the HTML was rendered using [`ToTemplate::to_template`] /// (e.g., into a `<template>` element). fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State; /// Asynchronously makes a set of DOM nodes rendered from HTML interactive. /// /// Async hydration is useful for types that may need to wait before being hydrated: /// for example, lazily-loaded routes need async hydration, because the client code /// may be loading asynchronously, while the server HTML was already rendered. fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> impl Future<Output = Self::State> { async { self.hydrate::<true>(cursor, position) } } /// Hydrates using [`RenderHtml::hydrate`], beginning at the given element. fn hydrate_from<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, ) -> Self::State where Self: Sized, { self.hydrate_from_position::<FROM_SERVER>(el, Position::default()) } /// Hydrates using [`RenderHtml::hydrate`], beginning at the given element and position. fn hydrate_from_position<const FROM_SERVER: bool>( self, el: &crate::renderer::types::Element, position: Position, ) -> Self::State where Self: Sized, { let cursor = Cursor::new(el.clone()); let position = PositionState::new(position); self.hydrate::<FROM_SERVER>(&cursor, &position) } /// Convert into the equivalent value that is `'static`. fn into_owned(self) -> Self::Owned; } /// Allows a type to be mounted to the DOM. pub trait Mountable { /// Detaches the view from the DOM. fn unmount(&mut self); /// Mounts a node to the interface. fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ); /// Mounts a node to the interface. Returns `false` if it could not be mounted. fn try_mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) -> bool { self.mount(parent, marker); true } /// Inserts another `Mountable` type before this one. Returns `false` if /// this does not actually exist in the UI (for example, `()`). fn insert_before_this(&self, child: &mut dyn Mountable) -> bool; /// Inserts another `Mountable` type before this one, or before the marker /// if this one doesn't exist in the UI (for example, `()`). fn insert_before_this_or_marker( &self, parent: &crate::renderer::types::Element, child: &mut dyn Mountable, marker: Option<&crate::renderer::types::Node>, ) { if !self.insert_before_this(child) { child.mount(parent, marker); } } /// wip fn elements(&self) -> Vec<crate::renderer::types::Element>; } /// Indicates where a node should be mounted to its parent. pub enum MountKind { /// Node should be mounted before this marker node. Before(crate::renderer::types::Node), /// Node should be appended to the parent’s children. Append, } impl<T> Mountable for Option<T> where T: Mountable, { fn unmount(&mut self) { if let Some(ref mut mounted) = self { mounted.unmount() } } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { if let Some(ref mut inner) = self { inner.mount(parent, marker); } } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.as_ref() .map(|inner| inner.insert_before_this(child)) .unwrap_or(false) } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.as_ref() .map(|inner| inner.elements()) .unwrap_or_default() } } impl<T> Mountable for Rc<RefCell<T>> where T: Mountable, { fn unmount(&mut self) { self.borrow_mut().unmount() } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { self.borrow_mut().mount(parent, marker); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.borrow().insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { self.borrow().elements() } } /// Allows data to be added to a static template. pub trait ToTemplate { /// The HTML content of the static template. const TEMPLATE: &'static str = ""; /// The `class` attribute content known at compile time. const CLASS: &'static str = ""; /// The `style` attribute content known at compile time. const STYLE: &'static str = ""; /// The length of the template. const LEN: usize = Self::TEMPLATE.len(); /// Renders a view type to a template. This does not take actual view data, /// but can be used for constructing part of an HTML `<template>` that corresponds /// to a view of a particular type. fn to_template( buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, position: &mut Position, ); /// Renders a view type to a template in attribute position. fn to_template_attribute( buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, position: &mut Position, ) { Self::to_template(buf, class, style, inner_html, position); } } /// Keeps track of what position the item currently being hydrated is in, relative to its siblings /// and parents. #[derive(Debug, Default, Clone)] pub struct PositionState(Arc<RwLock<Position>>); impl PositionState { /// Creates a new position tracker. pub fn new(position: Position) -> Self { Self(Arc::new(RwLock::new(position))) } /// Sets the current position. pub fn set(&self, position: Position) { *self.0.write() = position; } /// Gets the current position. pub fn get(&self) -> Position { *self.0.read() } /// Creates a new [`PositionState`], which starts with the same [`Position`], but no longer /// shares data with this `PositionState`. pub fn deep_clone(&self) -> Self { let current = self.get(); Self(Arc::new(RwLock::new(current))) } } /// The position of this element, relative to others. #[derive(Debug, Copy, Clone, PartialEq, Eq, Default)] pub enum Position { /// This is the current node. Current, /// This is the first child of its parent. #[default] FirstChild, /// This is the next child after another child. NextChild, /// This is the next child after a text node. NextChildAfterText, /// This is the only child of its parent. OnlyChild, /// This is the last child of its parent. LastChild, } /// Declares that this type can be converted into some other type, which can be rendered. pub trait IntoRender { /// The renderable type into which this type can be converted. type Output; /// Consumes this value, transforming it into the renderable type. fn into_render(self) -> Self::Output; } impl<T> IntoRender for T where T: Render, { type Output = Self; fn into_render(self) -> Self::Output { self } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/strings.rs
tachys/src/view/strings.rs
use super::{ Mountable, Position, PositionState, Render, RenderHtml, ToTemplate, }; use crate::{ html::attribute::any_attribute::AnyAttribute, hydration::Cursor, no_attrs, renderer::{CastFrom, Rndr}, }; use std::{borrow::Cow, rc::Rc, sync::Arc}; no_attrs!(&'a str); no_attrs!(String); no_attrs!(Arc<str>); no_attrs!(Cow<'a, str>); /// Retained view state for `&str`. pub struct StrState<'a> { pub(crate) node: crate::renderer::types::Text, str: &'a str, } impl<'a> Render for &'a str { type State = StrState<'a>; fn build(self) -> Self::State { let node = Rndr::create_text_node(self); StrState { node, str: self } } fn rebuild(self, state: &mut Self::State) { let StrState { node, str } = state; if &self != str { Rndr::set_text(node, self); *str = self; } } } impl RenderHtml for &str { type AsyncOutput = Self; type Owned = String; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn html_len(&self) -> usize { self.len() } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, _mark_branches: bool, _extra_attrs: Vec<AnyAttribute>, ) { // add a comment node to separate from previous sibling, if any if matches!(position, Position::NextChildAfterText) { buf.push_str("<!>") } if self.is_empty() && escape { buf.push(' '); } else if escape { let escaped = html_escape::encode_text(self); buf.push_str(&escaped); } else { buf.push_str(self); } *position = Position::NextChildAfterText; } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { if position.get() == Position::FirstChild { cursor.child(); } else { cursor.sibling(); } // separating placeholder marker comes before text node if matches!(position.get(), Position::NextChildAfterText) { cursor.sibling(); } let node = cursor.current(); let node = crate::renderer::types::Text::cast_from(node.clone()) .unwrap_or_else(|| { crate::hydration::failed_to_cast_text_node(node) }); if !FROM_SERVER { Rndr::set_text(&node, self); } position.set(Position::NextChildAfterText); StrState { node, str: self } } fn into_owned(self) -> Self::Owned { self.to_string() } } impl ToTemplate for &str { const TEMPLATE: &'static str = " <!>"; fn to_template( buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, position: &mut Position, ) { if matches!(*position, Position::NextChildAfterText) { buf.push_str("<!>") } buf.push(' '); *position = Position::NextChildAfterText; } } impl Mountable for StrState<'_> { fn unmount(&mut self) { self.node.unmount() } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { Rndr::insert_node(parent, self.node.as_ref(), marker); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.node.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { vec![] } } /// Retained view state for `String`. pub struct StringState { node: crate::renderer::types::Text, str: String, } impl Render for String { type State = StringState; fn build(self) -> Self::State { let node = Rndr::create_text_node(&self); StringState { node, str: self } } fn rebuild(self, state: &mut Self::State) { let StringState { node, str } = state; if &self != str { Rndr::set_text(node, &self); *str = self; } } } impl RenderHtml for String { const MIN_LENGTH: usize = 0; type AsyncOutput = Self; type Owned = Self; fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn html_len(&self) -> usize { self.len() } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { <&str as RenderHtml>::to_html_with_buf( self.as_str(), buf, position, escape, mark_branches, extra_attrs, ) } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let StrState { node, .. } = self.as_str().hydrate::<FROM_SERVER>(cursor, position); StringState { node, str: self } } fn into_owned(self) -> Self::Owned { self } } impl ToTemplate for String { const TEMPLATE: &'static str = <&str as ToTemplate>::TEMPLATE; fn to_template( buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, position: &mut Position, ) { <&str as ToTemplate>::to_template( buf, class, style, inner_html, position, ) } } impl Mountable for StringState { fn unmount(&mut self) { self.node.unmount() } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { Rndr::insert_node(parent, self.node.as_ref(), marker); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.node.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { vec![] } } /// Retained view state for `Rc<str>`. pub struct RcStrState { node: crate::renderer::types::Text, str: Rc<str>, } impl Render for Rc<str> { type State = RcStrState; fn build(self) -> Self::State { let node = Rndr::create_text_node(&self); RcStrState { node, str: self } } fn rebuild(self, state: &mut Self::State) { let RcStrState { node, str } = state; if !Rc::ptr_eq(&self, str) { Rndr::set_text(node, &self); *str = self; } } } // can't Send an Rc<str> between threads, so can't implement async HTML rendering that might need // to send it /* impl RenderHtml for Rc<str> where { type AsyncOutput = Self; const MIN_LENGTH: usize = 0; async fn resolve(self) -> Self::AsyncOutput { self } fn html_len(&self) -> usize { self.len() } fn to_html_with_buf(self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool) { <&str as RenderHtml>::to_html_with_buf(&self, buf, position) } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let this: &str = self.as_ref(); let StrState { node, .. } = this.hydrate::<FROM_SERVER>(cursor, position); RcStrState { node, str: self } } }*/ impl ToTemplate for Rc<str> { const TEMPLATE: &'static str = <&str as ToTemplate>::TEMPLATE; fn to_template( buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, position: &mut Position, ) { <&str as ToTemplate>::to_template( buf, class, style, inner_html, position, ) } } impl Mountable for RcStrState { fn unmount(&mut self) { self.node.unmount() } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { Rndr::insert_node(parent, self.node.as_ref(), marker); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.node.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { vec![] } } /// Retained view state for `Arc<str>`. pub struct ArcStrState { node: crate::renderer::types::Text, str: Arc<str>, } impl Render for Arc<str> { type State = ArcStrState; fn build(self) -> Self::State { let node = Rndr::create_text_node(&self); ArcStrState { node, str: self } } fn rebuild(self, state: &mut Self::State) { let ArcStrState { node, str } = state; if self != *str { Rndr::set_text(node, &self); *str = self; } } } impl RenderHtml for Arc<str> { type AsyncOutput = Self; type Owned = Self; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn html_len(&self) -> usize { self.len() } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { <&str as RenderHtml>::to_html_with_buf( &self, buf, position, escape, mark_branches, extra_attrs, ) } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let this: &str = self.as_ref(); let StrState { node, .. } = this.hydrate::<FROM_SERVER>(cursor, position); ArcStrState { node, str: self } } fn into_owned(self) -> Self::Owned { self } } impl ToTemplate for Arc<str> { const TEMPLATE: &'static str = <&str as ToTemplate>::TEMPLATE; fn to_template( buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, position: &mut Position, ) { <&str as ToTemplate>::to_template( buf, class, style, inner_html, position, ) } } impl Mountable for ArcStrState { fn unmount(&mut self) { self.node.unmount() } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { Rndr::insert_node(parent, self.node.as_ref(), marker); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.node.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { vec![] } } /// Retained view state for `Cow<'_, str>`. pub struct CowStrState<'a> { node: crate::renderer::types::Text, str: Cow<'a, str>, } impl<'a> Render for Cow<'a, str> { type State = CowStrState<'a>; fn build(self) -> Self::State { let node = Rndr::create_text_node(&self); CowStrState { node, str: self } } fn rebuild(self, state: &mut Self::State) { let CowStrState { node, str } = state; if self != *str { Rndr::set_text(node, &self); *str = self; } } } impl RenderHtml for Cow<'_, str> { type AsyncOutput = Self; type Owned = String; const MIN_LENGTH: usize = 0; fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn html_len(&self) -> usize { self.len() } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { <&str as RenderHtml>::to_html_with_buf( &self, buf, position, escape, mark_branches, extra_attrs, ) } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let this: &str = self.as_ref(); let StrState { node, .. } = this.hydrate::<FROM_SERVER>(cursor, position); CowStrState { node, str: self } } fn into_owned(self) -> <Self as RenderHtml>::Owned { self.into_owned() } } impl ToTemplate for Cow<'_, str> { const TEMPLATE: &'static str = <&str as ToTemplate>::TEMPLATE; fn to_template( buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, position: &mut Position, ) { <&str as ToTemplate>::to_template( buf, class, style, inner_html, position, ) } } impl Mountable for CowStrState<'_> { fn unmount(&mut self) { self.node.unmount() } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { Rndr::insert_node(parent, self.node.as_ref(), marker); } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.node.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { vec![] } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/tuples.rs
tachys/src/view/tuples.rs
use super::{ Mountable, Position, PositionState, Render, RenderHtml, ToTemplate, }; use crate::{ html::attribute::{any_attribute::AnyAttribute, Attribute}, hydration::Cursor, renderer::Rndr, view::{add_attr::AddAnyAttr, StreamBuilder}, }; use const_str_slice_concat::{ const_concat, const_concat_with_separator, str_from_buffer, }; impl Render for () { type State = crate::renderer::types::Placeholder; fn build(self) -> Self::State { Rndr::create_placeholder() } fn rebuild(self, _state: &mut Self::State) {} } impl RenderHtml for () { type AsyncOutput = (); type Owned = (); const MIN_LENGTH: usize = 3; const EXISTS: bool = false; fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, _mark_branches: bool, _extra_attrs: Vec<AnyAttribute>, ) { if escape { buf.push_str("<!>"); *position = Position::NextChild; } } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let marker = cursor.next_placeholder(position); position.set(Position::NextChild); marker } async fn resolve(self) -> Self::AsyncOutput {} fn dry_resolve(&mut self) {} fn into_owned(self) -> Self::Owned {} } impl AddAnyAttr for () { type Output<SomeNewAttr: Attribute> = (); fn add_any_attr<NewAttr: Attribute>( self, _attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { } } impl Mountable for () { fn unmount(&mut self) {} fn mount( &mut self, _parent: &crate::renderer::types::Element, _marker: Option<&crate::renderer::types::Node>, ) { } fn insert_before_this(&self, _child: &mut dyn Mountable) -> bool { false } fn elements(&self) -> Vec<crate::renderer::types::Element> { vec![] } } impl ToTemplate for () { const TEMPLATE: &'static str = "<!>"; fn to_template( buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, _position: &mut Position, ) { buf.push_str("<!>"); } fn to_template_attribute( _buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, _position: &mut Position, ) { } } impl<A: Render> Render for (A,) { type State = A::State; fn build(self) -> Self::State { self.0.build() } fn rebuild(self, state: &mut Self::State) { self.0.rebuild(state) } } impl<A> RenderHtml for (A,) where A: RenderHtml, { type AsyncOutput = (A::AsyncOutput,); type Owned = (A::Owned,); const MIN_LENGTH: usize = A::MIN_LENGTH; const EXISTS: bool = A::EXISTS; fn html_len(&self) -> usize { self.0.html_len() } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { self.0.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { self.0.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { self.0.hydrate::<FROM_SERVER>(cursor, position) } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { self.0.hydrate_async(cursor, position).await } async fn resolve(self) -> Self::AsyncOutput { (self.0.resolve().await,) } fn dry_resolve(&mut self) { self.0.dry_resolve(); } fn into_owned(self) -> Self::Owned { (self.0.into_owned(),) } } impl<A: ToTemplate> ToTemplate for (A,) { const TEMPLATE: &'static str = A::TEMPLATE; const CLASS: &'static str = A::CLASS; const STYLE: &'static str = A::STYLE; fn to_template( buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, position: &mut Position, ) { A::to_template(buf, class, style, inner_html, position) } } impl<A> AddAnyAttr for (A,) where A: AddAnyAttr, { type Output<SomeNewAttr: Attribute> = (A::Output<SomeNewAttr>,); fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { (self.0.add_any_attr(attr),) } } macro_rules! impl_view_for_tuples { ($first:ident, $($ty:ident),* $(,)?) => { impl<$first, $($ty),*> Render for ($first, $($ty,)*) where $first: Render, $($ty: Render),*, { type State = ($first::State, $($ty::State,)*); fn build(self) -> Self::State { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; ( $first.build(), $($ty.build()),* ) } fn rebuild(self, state: &mut Self::State) { paste::paste! { let ([<$first:lower>], $([<$ty:lower>],)*) = self; let ([<view_ $first:lower>], $([<view_ $ty:lower>],)*) = state; [<$first:lower>].rebuild([<view_ $first:lower>]); $([<$ty:lower>].rebuild([<view_ $ty:lower>]));* } } } impl<$first, $($ty),*> RenderHtml for ($first, $($ty,)*) where $first: RenderHtml, $($ty: RenderHtml),*, { type AsyncOutput = ($first::AsyncOutput, $($ty::AsyncOutput,)*); type Owned = ($first::Owned, $($ty::Owned,)*); const EXISTS: bool = $first::EXISTS || $($ty::EXISTS || )* false; const MIN_LENGTH: usize = $first::MIN_LENGTH $(+ $ty::MIN_LENGTH)*; #[inline(always)] fn html_len(&self) -> usize { #[allow(non_snake_case)] let ($first, $($ty,)* ) = self; $($ty.html_len() +)* $first.html_len() } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute> ) { #[allow(non_snake_case)] let ($first, $($ty,)* ) = self; $first.to_html_with_buf(buf, position, escape, mark_branches, extra_attrs.clone()); $($ty.to_html_with_buf(buf, position, escape, mark_branches, extra_attrs.clone()));* } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute> ) where Self: Sized, { #[allow(non_snake_case)] let ($first, $($ty,)* ) = self; $first.to_html_async_with_buf::<OUT_OF_ORDER>(buf, position, escape, mark_branches, extra_attrs.clone()); $($ty.to_html_async_with_buf::<OUT_OF_ORDER>(buf, position, escape, mark_branches, extra_attrs.clone()));* } fn hydrate<const FROM_SERVER: bool>(self, cursor: &Cursor, position: &PositionState) -> Self::State { #[allow(non_snake_case)] let ($first, $($ty,)* ) = self; ( $first.hydrate::<FROM_SERVER>(cursor, position), $($ty.hydrate::<FROM_SERVER>(cursor, position)),* ) } async fn hydrate_async(self, cursor: &Cursor, position: &PositionState) -> Self::State { #[allow(non_snake_case)] let ($first, $($ty,)* ) = self; ( $first.hydrate_async(cursor, position).await, $($ty.hydrate_async(cursor, position).await),* ) } async fn resolve(self) -> Self::AsyncOutput { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; futures::join!( $first.resolve(), $($ty.resolve()),* ) } fn dry_resolve(&mut self) { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; $first.dry_resolve(); $($ty.dry_resolve());* } fn into_owned(self) -> Self::Owned { #[allow(non_snake_case)] let ($first, $($ty,)*) = self; ( $first.into_owned(), $($ty.into_owned()),* ) } } impl<$first, $($ty),*> ToTemplate for ($first, $($ty,)*) where $first: ToTemplate, $($ty: ToTemplate),* { const TEMPLATE: &'static str = str_from_buffer(&const_concat(&[ $first::TEMPLATE, $($ty::TEMPLATE),* ])); const CLASS: &'static str = str_from_buffer(&const_concat_with_separator(&[ $first::CLASS, $($ty::CLASS),* ], " ")); const STYLE: &'static str = str_from_buffer(&const_concat_with_separator(&[ $first::STYLE, $($ty::STYLE),* ], ";")); fn to_template(buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, position: &mut Position) { $first ::to_template(buf, class, style, inner_html, position); $($ty::to_template(buf, class, style, inner_html, position));*; } } impl<$first, $($ty),*> Mountable for ($first, $($ty,)*) where $first: Mountable, $($ty: Mountable),*, { fn unmount(&mut self) { #[allow(non_snake_case)] // better macro performance let ($first, $($ty,)*) = self; $first.unmount(); $($ty.unmount());* } fn mount( &mut self, parent: &crate::renderer::types::Element, marker: Option<&crate::renderer::types::Node>, ) { #[allow(non_snake_case)] // better macro performance let ($first, $($ty,)*) = self; $first.mount(parent, marker); $($ty.mount(parent, marker));* } fn insert_before_this(&self, child: &mut dyn Mountable, ) -> bool { #[allow(non_snake_case)] // better macro performance let ($first, $($ty,)*) = self; $first.insert_before_this(child) $(|| $ty.insert_before_this(child))* } fn elements(&self) -> Vec<crate::renderer::types::Element> { #[allow(non_snake_case)] // better macro performance let ($first, $($ty,)*) = self; $first.elements().into_iter() $(.chain($ty.elements()))* .collect() } } impl<$first, $($ty,)*> AddAnyAttr for ($first, $($ty,)*) where $first: AddAnyAttr, $($ty: AddAnyAttr),*, { type Output<SomeNewAttr: Attribute> = ($first::Output<SomeNewAttr::Cloneable>, $($ty::Output<SomeNewAttr::Cloneable>,)*); fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let shared = attr.into_cloneable(); #[allow(non_snake_case)] // better macro performance let ($first, $($ty,)*) = self; ($first.add_any_attr(shared.clone()), $($ty.add_any_attr(shared.clone()),)*) } } }; } impl_view_for_tuples!(A, B); impl_view_for_tuples!(A, B, C); impl_view_for_tuples!(A, B, C, D); impl_view_for_tuples!(A, B, C, D, E); impl_view_for_tuples!(A, B, C, D, E, F); impl_view_for_tuples!(A, B, C, D, E, F, G); impl_view_for_tuples!(A, B, C, D, E, F, G, H); impl_view_for_tuples!(A, B, C, D, E, F, G, H, I); impl_view_for_tuples!(A, B, C, D, E, F, G, H, I, J); impl_view_for_tuples!(A, B, C, D, E, F, G, H, I, J, K); impl_view_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L); impl_view_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M); impl_view_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N); impl_view_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O); impl_view_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P); impl_view_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q); impl_view_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R); impl_view_for_tuples!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S); impl_view_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T ); impl_view_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U ); impl_view_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V ); impl_view_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W ); impl_view_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X ); impl_view_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X, Y ); impl_view_for_tuples!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X, Y, Z );
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/view/static_types.rs
tachys/src/view/static_types.rs
use super::{ add_attr::AddAnyAttr, Mountable, Position, PositionState, Render, RenderHtml, ToTemplate, }; use crate::{ html::attribute::{ any_attribute::AnyAttribute, maybe_next_attr_erasure_macros::{ next_attr_combine, next_attr_output_type, }, Attribute, AttributeKey, AttributeValue, NamedAttributeKey, NextAttribute, }, hydration::Cursor, renderer::{CastFrom, Rndr}, }; use std::marker::PhantomData; /// An attribute for which both the key and the value are known at compile time, /// i.e., as `&'static str`s. #[derive(Debug)] pub struct StaticAttr<K: AttributeKey, const V: &'static str> { ty: PhantomData<K>, } impl<K: AttributeKey, const V: &'static str> Clone for StaticAttr<K, V> { fn clone(&self) -> Self { Self { ty: PhantomData } } } impl<K: AttributeKey, const V: &'static str> PartialEq for StaticAttr<K, V> { fn eq(&self, _other: &Self) -> bool { // by definition, two static attrs with same key and same const V are same true } } /// Creates an [`Attribute`] whose key and value are both known at compile time. pub fn static_attr<K: AttributeKey, const V: &'static str>() -> StaticAttr<K, V> { StaticAttr { ty: PhantomData } } impl<K, const V: &'static str> ToTemplate for StaticAttr<K, V> where K: AttributeKey, { fn to_template( buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, _position: &mut Position, ) { buf.push(' '); buf.push_str(K::KEY); buf.push_str("=\""); buf.push_str(V); buf.push('"'); } } impl<K, const V: &'static str> Attribute for StaticAttr<K, V> where K: AttributeKey, { const MIN_LENGTH: usize = K::KEY.len() + 3 + V.len(); // K::KEY + ="..." + V type AsyncOutput = Self; type State = (); type Cloneable = Self; type CloneableOwned = Self; #[inline(always)] fn html_len(&self) -> usize { K::KEY.len() + 3 + V.len() } fn to_html( self, buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, ) { AttributeValue::to_html(V, K::KEY, buf) } fn hydrate<const FROM_SERVER: bool>( self, _el: &crate::renderer::types::Element, ) -> Self::State { } fn build(self, el: &crate::renderer::types::Element) -> Self::State { Rndr::set_attribute(el, K::KEY, V); } fn rebuild(self, _state: &mut Self::State) {} fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn keys(&self) -> Vec<NamedAttributeKey> { vec![NamedAttributeKey::Attribute(K::KEY.into())] } } impl<K, const V: &'static str> NextAttribute for StaticAttr<K, V> where K: AttributeKey, { next_attr_output_type!(Self, NewAttr); fn add_any_attr<NewAttr: Attribute>( self, new_attr: NewAttr, ) -> Self::Output<NewAttr> { next_attr_combine!(StaticAttr::<K, V> { ty: PhantomData }, new_attr) } } /// A static string that is known at compile time and can be optimized by including its type in the /// view tree. #[derive(Debug, Clone, Copy)] pub struct Static<const V: &'static str>; impl<const V: &'static str> PartialEq for Static<V> { fn eq(&self, _other: &Self) -> bool { // by definition, two static values of same const V are same true } } impl<const V: &'static str> AsRef<str> for Static<V> { fn as_ref(&self) -> &str { V } } impl<const V: &'static str> Render for Static<V> where crate::renderer::types::Text: Mountable, { type State = Option<crate::renderer::types::Text>; fn build(self) -> Self::State { // a view state has to be returned so it can be mounted Some(Rndr::create_text_node(V)) } // This type is specified as static, so no rebuilding is done. fn rebuild(self, _state: &mut Self::State) {} } impl<const V: &'static str> RenderHtml for Static<V> { type AsyncOutput = Self; type Owned = Self; const MIN_LENGTH: usize = V.len(); fn dry_resolve(&mut self) {} // this won't actually compile because if a weird interaction because the const &'static str and // the RPITIT, so we just refine it to a concrete future type; this will never change in any // case #[allow(refining_impl_trait)] fn resolve(self) -> std::future::Ready<Self> { std::future::ready(self) } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, _mark_branches: bool, _extra_attrs: Vec<AnyAttribute>, ) { // add a comment node to separate from previous sibling, if any if matches!(position, Position::NextChildAfterText) { buf.push_str("<!>") } if V.is_empty() && escape { buf.push(' '); } else if escape { let escaped = html_escape::encode_text(V); buf.push_str(&escaped); } else { buf.push_str(V); } *position = Position::NextChildAfterText; } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { if position.get() == Position::FirstChild { cursor.child(); } else { cursor.sibling(); } // separating placeholder marker comes before text node if matches!(position.get(), Position::NextChildAfterText) { cursor.sibling(); } let node = cursor.current(); let node = crate::renderer::types::Text::cast_from(node.clone()) .unwrap_or_else(|| { crate::hydration::failed_to_cast_text_node(node) }); position.set(Position::NextChildAfterText); Some(node) } fn into_owned(self) -> Self::Owned { self } } impl<const V: &'static str> AddAnyAttr for Static<V> { type Output<NewAttr: Attribute> = Static<V>; fn add_any_attr<NewAttr: Attribute>( self, _attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { // inline helper function to assist the compiler with type inference #[inline(always)] const fn create_static<const S: &'static str, A: Attribute>( ) -> <Static<S> as AddAnyAttr>::Output<A> { Static } // call the helper function with the current const value and new attribute type create_static::<V, NewAttr>() } } impl<const V: &'static str> ToTemplate for Static<V> { const TEMPLATE: &'static str = V; fn to_template( buf: &mut String, _class: &mut String, _style: &mut String, _inner_html: &mut String, position: &mut Position, ) { if matches!(*position, Position::NextChildAfterText) { buf.push_str("<!>") } buf.push_str(V); *position = Position::NextChildAfterText; } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/tachys/src/svg/mod.rs
tachys/src/svg/mod.rs
use crate::{ html::{ attribute::{any_attribute::AnyAttribute, Attribute}, element::{ElementType, ElementWithChildren, HtmlElement}, }, hydration::Cursor, prelude::{AddAnyAttr, Mountable}, renderer::{ dom::{Element, Node}, CastFrom, Rndr, }, view::{Position, PositionState, Render, RenderHtml}, }; use std::{borrow::Cow, fmt::Debug}; macro_rules! svg_elements { ($($tag:ident [$($attr:ty),*]),* $(,)?) => { paste::paste! { $( /// An SVG element. // `tag()` function #[allow(non_snake_case)] #[track_caller] pub fn $tag() -> HtmlElement<[<$tag:camel>], (), ()> where { HtmlElement { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), tag: [<$tag:camel>], attributes: (), children: (), } } /// An SVG element. #[derive(Debug, Copy, Clone, PartialEq, Eq)] pub struct [<$tag:camel>]; impl<At, Ch> HtmlElement<[<$tag:camel>], At, Ch> where At: Attribute, Ch: Render, { $( pub fn $attr<V>(self, value: V) -> HtmlElement < [<$tag:camel>], <At as $crate::html::attribute::NextAttribute<Attr<$crate::html::attribute::[<$attr:camel>], V>>>::Output, Ch > where V: AttributeValue, At: $crate::html::attribute::NextAttribute<Attr<$crate::html::attribute::[<$attr:camel>], V>>, <At as $crate::html::attribute::NextAttribute<Attr<$crate::html::attribute::[<$attr:camel>], V>>>::Output: Attribute, { let HtmlElement { tag, children, attributes, #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at } = self; HtmlElement { tag, children, attributes: attributes.add_any_attr($crate::html::attribute::$attr(value)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at } } )* } impl ElementType for [<$tag:camel>] { type Output = web_sys::SvgElement; const TAG: &'static str = stringify!($tag); const SELF_CLOSING: bool = false; const ESCAPE_CHILDREN: bool = true; const NAMESPACE: Option<&'static str> = Some("http://www.w3.org/2000/svg"); #[inline(always)] fn tag(&self) -> &str { Self::TAG } } impl ElementWithChildren for [<$tag:camel>] {} )* } } } svg_elements![ a [], animate [], animateMotion [], animateTransform [], circle [], clipPath [], defs [], desc [], discard [], ellipse [], feBlend [], feColorMatrix [], feComponentTransfer [], feComposite [], feConvolveMatrix [], feDiffuseLighting [], feDisplacementMap [], feDistantLight [], feDropShadow [], feFlood [], feFuncA [], feFuncB [], feFuncG [], feFuncR [], feGaussianBlur [], feImage [], feMerge [], feMergeNode [], feMorphology [], feOffset [], fePointLight [], feSpecularLighting [], feSpotLight [], feTile [], feTurbulence [], filter [], foreignObject [], g [], hatch [], hatchpath [], image [], line [], linearGradient [], marker [], mask [], metadata [], mpath [], path [], pattern [], polygon [], polyline [], radialGradient [], rect [], script [], set [], stop [], style [], svg [], switch [], symbol [], text [], textPath [], title [], tspan [], view [], ]; /// An SVG element. #[allow(non_snake_case)] #[track_caller] pub fn r#use() -> HtmlElement<Use, (), ()> where { HtmlElement { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), tag: Use, attributes: (), children: (), } } /// An SVG element. #[derive(Debug, Copy, Clone, PartialEq, Eq)] pub struct Use; impl ElementType for Use { type Output = web_sys::SvgElement; const TAG: &'static str = "use"; const SELF_CLOSING: bool = false; const ESCAPE_CHILDREN: bool = true; const NAMESPACE: Option<&'static str> = Some("http://www.w3.org/2000/svg"); #[inline(always)] fn tag(&self) -> &str { Self::TAG } } impl ElementWithChildren for Use {} /// An element that contains no interactivity, and whose contents can be known at compile time. pub struct InertElement { html: Cow<'static, str>, } impl InertElement { /// Creates a new inert svg element. pub fn new(html: impl Into<Cow<'static, str>>) -> Self { Self { html: html.into() } } } /// Retained view state for [`InertElement`]. pub struct InertElementState(Cow<'static, str>, Element); impl Mountable for InertElementState { fn unmount(&mut self) { self.1.unmount(); } fn mount(&mut self, parent: &Element, marker: Option<&Node>) { self.1.mount(parent, marker) } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { self.1.insert_before_this(child) } fn elements(&self) -> Vec<crate::renderer::types::Element> { vec![self.1.clone()] } } impl Render for InertElement { type State = InertElementState; fn build(self) -> Self::State { let el = Rndr::create_svg_element_from_html(self.html.clone()); InertElementState(self.html, el) } fn rebuild(self, state: &mut Self::State) { let InertElementState(prev, el) = state; if &self.html != prev { let mut new_el = Rndr::create_svg_element_from_html(self.html.clone()); el.insert_before_this(&mut new_el); el.unmount(); *el = new_el; *prev = self.html; } } } impl AddAnyAttr for InertElement { type Output<SomeNewAttr: Attribute> = Self; fn add_any_attr<NewAttr: Attribute>( self, _attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { panic!( "InertElement does not support adding attributes. It should only \ be used as a child, and not returned at the top level." ) } } impl RenderHtml for InertElement { type AsyncOutput = Self; type Owned = Self; const MIN_LENGTH: usize = 0; fn html_len(&self) -> usize { self.html.len() } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self { self } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, _escape: bool, _mark_branches: bool, _extra_attrs: Vec<AnyAttribute>, ) { buf.push_str(&self.html); *position = Position::NextChild; } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let curr_position = position.get(); if curr_position == Position::FirstChild { cursor.child(); } else if curr_position != Position::Current { cursor.sibling(); } let el = crate::renderer::types::Element::cast_from(cursor.current()) .unwrap(); position.set(Position::NextChild); InertElementState(self.html, el) } fn into_owned(self) -> Self::Owned { self } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/router_macro/src/lib.rs
router_macro/src/lib.rs
//! A macro to make path definitions easier with [`leptos_router`]. //! //! [`leptos_router`]: https://docs.rs/leptos_router/latest/leptos_router/components/fn.Route.html #![deny(missing_docs)] use proc_macro::{TokenStream, TokenTree}; use proc_macro2::Span; use proc_macro_error2::{abort, proc_macro_error, set_dummy}; use quote::{format_ident, quote, ToTokens}; use syn::{ spanned::Spanned, FnArg, Ident, ImplItem, ItemImpl, Path, Type, TypePath, }; const RFC3986_UNRESERVED: [char; 4] = ['-', '.', '_', '~']; const RFC3986_PCHAR_OTHER: [char; 1] = ['@']; /// Constructs a path for use in a [`Route`] definition. /// /// Note that this is an optional convenience. Manually defining route segments /// is equivalent. /// /// # Examples /// /// ```rust /// use leptos_router::{ /// path, OptionalParamSegment, ParamSegment, StaticSegment, /// WildcardSegment, /// }; /// /// let path = path!("/foo/:bar/:baz?/*any"); /// let output = ( /// StaticSegment("foo"), /// ParamSegment("bar"), /// OptionalParamSegment("baz"), /// WildcardSegment("any"), /// ); /// /// assert_eq!(path, output); /// ``` /// [`Route`]: https://docs.rs/leptos_router/latest/leptos_router/components/fn.Route.html #[proc_macro_error2::proc_macro_error] #[proc_macro] pub fn path(tokens: TokenStream) -> TokenStream { let mut parser = SegmentParser::new(tokens); parser.parse_all(); let segments = Segments(parser.segments); segments.into_token_stream().into() } #[derive(Debug, PartialEq)] struct Segments(pub Vec<Segment>); #[derive(Debug, PartialEq)] enum Segment { Static(String), Param(String), OptionalParam(String), Wildcard(String), } struct SegmentParser { input: proc_macro::token_stream::IntoIter, segments: Vec<Segment>, } impl SegmentParser { pub fn new(input: TokenStream) -> Self { Self { input: input.into_iter(), segments: Vec::new(), } } } impl SegmentParser { pub fn parse_all(&mut self) { for input in self.input.by_ref() { match input { TokenTree::Literal(lit) => { let lit = lit.to_string(); if lit.contains("//") { abort!( proc_macro2::Span::call_site(), "Consecutive '/' is not allowed" ); } Self::parse_str( &mut self.segments, lit.trim_start_matches(['"', '/']) .trim_end_matches(['"', '/']), ); if lit.ends_with(r#"/""#) && lit != r#""/""# { self.segments.push(Segment::Static("/".to_string())); } } TokenTree::Group(_) => unimplemented!(), TokenTree::Ident(_) => unimplemented!(), TokenTree::Punct(_) => unimplemented!(), } } } pub fn parse_str(segments: &mut Vec<Segment>, current_str: &str) { if ["", "*"].contains(&current_str) { return; } for segment in current_str.split('/') { if let Some(segment) = segment.strip_prefix(':') { if let Some(segment) = segment.strip_suffix('?') { segments.push(Segment::OptionalParam(segment.to_string())); } else { segments.push(Segment::Param(segment.to_string())); } } else if let Some(segment) = segment.strip_prefix('*') { segments.push(Segment::Wildcard(segment.to_string())); } else { segments.push(Segment::Static(segment.to_string())); } } } } impl Segment { fn is_valid(segment: &str) -> bool { segment == "/" || segment.chars().all(|c| { c.is_ascii_digit() || c.is_ascii_lowercase() || c.is_ascii_uppercase() || RFC3986_UNRESERVED.contains(&c) || RFC3986_PCHAR_OTHER.contains(&c) }) } fn ensure_valid(&self) { match self { Self::Wildcard(s) if !Self::is_valid(s) => { abort!(Span::call_site(), "Invalid wildcard segment: {}", s) } Self::Static(s) if !Self::is_valid(s) => { abort!(Span::call_site(), "Invalid static segment: {}", s) } Self::Param(s) if !Self::is_valid(s) => { abort!(Span::call_site(), "Invalid param segment: {}", s) } _ => (), } } } impl Segments { fn ensure_valid(&self) { if let Some((_last, segments)) = self.0.split_last() { if let Some(Segment::Wildcard(s)) = segments.iter().find(|s| matches!(s, Segment::Wildcard(_))) { abort!(Span::call_site(), "Wildcard must be at end: {}", s) } } } } impl ToTokens for Segment { fn to_tokens(&self, tokens: &mut proc_macro2::TokenStream) { self.ensure_valid(); match self { Segment::Wildcard(s) => { tokens.extend(quote! { leptos_router::WildcardSegment(#s) }); } Segment::Static(s) => { tokens.extend(quote! { leptos_router::StaticSegment(#s) }); } Segment::Param(p) => { tokens.extend(quote! { leptos_router::ParamSegment(#p) }); } Segment::OptionalParam(p) => { tokens .extend(quote! { leptos_router::OptionalParamSegment(#p) }); } } } } impl ToTokens for Segments { fn to_tokens(&self, tokens: &mut proc_macro2::TokenStream) { self.ensure_valid(); match self.0.as_slice() { [] => tokens.extend(quote! { () }), [segment] => tokens.extend(quote! { (#segment,) }), segments => tokens.extend(quote! { (#(#segments),*) }), } } } /// When added to an [`impl LazyRoute`] implementation block, this will automatically /// add a [`lazy`] annotation to the `view` method, which will cause the code for the view /// to lazy-load concurrently with the `data` being loaded for the route. /// /// ```rust /// use leptos::prelude::*; /// use leptos_router::{lazy_route, LazyRoute}; /// /// // the route definition /// #[derive(Debug)] /// struct BlogListingRoute { /// titles: Resource<Vec<String>> /// } /// /// #[lazy_route] /// impl LazyRoute for BlogListingRoute { /// fn data() -> Self { /// Self { /// titles: Resource::new(|| (), |_| async { /// vec![/* todo: load blog posts */] /// }) /// } /// } /// /// // this function will be lazy-loaded, concurrently with data() /// fn view(this: Self) -> AnyView { /// let BlogListingRoute { titles } = this; /// /// // ... now you can use the `posts` resource with Suspense, etc., /// // and return AnyView by calling .into_any() on a view /// # ().into_any() /// } /// } /// ``` /// /// [`impl LazyRoute`]: https://docs.rs/leptos_router/latest/leptos_router/trait.LazyRoute.html /// [`lazy`]: https://docs.rs/leptos_macro/latest/leptos_macro/macro.lazy.html #[proc_macro_attribute] #[proc_macro_error] pub fn lazy_route( args: proc_macro::TokenStream, s: TokenStream, ) -> TokenStream { lazy_route_impl(args, s) } fn lazy_route_impl( _args: proc_macro::TokenStream, s: TokenStream, ) -> TokenStream { set_dummy(s.clone().into()); let mut im = syn::parse::<ItemImpl>(s.clone()).unwrap_or_else(|e| { abort!(e.span(), "`lazy_route` can only be used on an `impl` block") }); if im.trait_.is_none() { abort!( im.span(), "`lazy_route` can only be used on an `impl LazyRoute for ...` \ block" ) } let self_ty = im.self_ty.clone(); let ty_name_to_snake = match &*self_ty { Type::Path(TypePath { path: Path { segments, .. }, .. }) => segments.last().unwrap().ident.to_string(), _ => abort!(self_ty.span(), "only path types are supported"), }; let lazy_view_ident = Ident::new(&format!("__{ty_name_to_snake}_View"), im.self_ty.span()); let preload_ident = format_ident!("__preload_{lazy_view_ident}"); im.items.push( syn::parse::<ImplItem>( quote! { async fn preload() { // TODO for 0.9 this is not precise // we don't split routes for wasm32 ssr // but we don't require a `hydrate`/`csr` feature on leptos_router #[cfg(target_arch = "wasm32")] #preload_ident().await; } } .into(), ) .unwrap_or_else(|e| { abort!(e.span(), "could not parse preload item impl") }), ); let item = im.items.iter_mut().find_map(|item| match item { ImplItem::Fn(inner) => { if inner.sig.ident.to_string().as_str() == "view" { Some(inner) } else { None } } _ => None, }); match item { None => s, Some(fun) => { if let Some(a) = fun.sig.asyncness { abort!(a.span(), "`view` method should not be async") } fun.sig.asyncness = Some(Default::default()); let first_arg = fun.sig.inputs.first().unwrap_or_else(|| { abort!(fun.sig.span(), "must have an argument") }); let FnArg::Typed(first_arg) = first_arg else { abort!( first_arg.span(), "this must be a typed argument like `this: Self`" ) }; let first_arg_pat = &*first_arg.pat; let body = std::mem::replace( &mut fun.block, syn::parse( quote! { { #lazy_view_ident(#first_arg_pat).await } } .into(), ) .unwrap(), ); quote! { #[allow(non_snake_case)] #[::leptos::lazy] fn #lazy_view_ident(#first_arg_pat: #self_ty) -> ::leptos::prelude::AnyView { #body } #im }.into() } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/router_macro/tests/path.rs
router_macro/tests/path.rs
use leptos_router::{ OptionalParamSegment, ParamSegment, StaticSegment, WildcardSegment, }; use leptos_router_macro::path; #[test] fn parses_empty_string() { let output = path!(""); assert!(output.eq(&())); } #[test] fn parses_single_slash() { let output = path!("/"); assert!(output.eq(&())); } #[test] fn parses_single_asterisk() { let output = path!("*"); assert!(output.eq(&())); } #[test] fn parses_slash_asterisk() { let output = path!("/*"); assert!(output.eq(&())); } #[test] fn parses_asterisk_any() { let output = path!("/foo/:bar/*any"); assert_eq!( output, ( StaticSegment("foo"), ParamSegment("bar"), WildcardSegment("any") ) ); } #[test] fn parses_hyphen() { let output = path!("/foo/bar-baz"); assert_eq!(output, (StaticSegment("foo"), StaticSegment("bar-baz"))); } #[test] fn parses_rfc3976_unreserved() { let output = path!("/-._~"); assert_eq!(output, (StaticSegment("-._~"),)); } #[test] fn parses_rfc3976_pchar_other() { let output = path!("/@"); assert_eq!(output, (StaticSegment("@"),)); } #[test] fn parses_no_slashes() { let output = path!("home"); assert_eq!(output, (StaticSegment("home"),)); } #[test] fn parses_no_leading_slash() { let output = path!("home"); assert_eq!(output, (StaticSegment("home"),)); } #[test] fn parses_trailing_slash() { let output = path!("/home/"); assert_eq!(output, (StaticSegment("home"), StaticSegment("/"))); } #[test] fn parses_single_static() { let output = path!("/home"); assert_eq!(output, (StaticSegment("home"),)); } #[test] fn parses_single_param() { let output = path!("/:id"); assert_eq!(output, (ParamSegment("id"),)); } #[test] fn parses_optional_param() { let output = path!("/:id?"); assert_eq!(output, (OptionalParamSegment("id"),)); } #[test] fn parses_static_and_param() { let output = path!("/home/:id"); assert_eq!(output, (StaticSegment("home"), ParamSegment("id"),)); } #[test] fn parses_mixed_segment_types() { let output = path!("/foo/:bar/*baz"); assert_eq!( output, ( StaticSegment("foo"), ParamSegment("bar"), WildcardSegment("baz") ) ); } #[test] fn parses_trailing_slash_after_param() { let output = path!("/foo/:bar/"); assert_eq!( output, ( StaticSegment("foo"), ParamSegment("bar"), StaticSegment("/") ) ); } #[test] fn parses_consecutive_static() { let output = path!("/foo/bar/baz"); assert_eq!( output, ( StaticSegment("foo"), StaticSegment("bar"), StaticSegment("baz") ) ); } #[test] fn parses_consecutive_param() { let output = path!("/:foo/:bar/:baz"); assert_eq!( output, ( ParamSegment("foo"), ParamSegment("bar"), ParamSegment("baz") ) ); } #[test] fn parses_consecutive_optional_param() { let output = path!("/:foo?/:bar?/:baz?"); assert_eq!( output, ( OptionalParamSegment("foo"), OptionalParamSegment("bar"), OptionalParamSegment("baz") ) ); } #[test] fn parses_complex() { let output = path!("/home/:id/foo/:bar/:baz?/*any"); assert_eq!( output, ( StaticSegment("home"), ParamSegment("id"), StaticSegment("foo"), ParamSegment("bar"), OptionalParamSegment("baz"), WildcardSegment("any"), ) ); } // #[test] // fn deny_consecutive_slashes() { // let _ = path!("/////foo///bar/////baz/"); // } // // #[test] // fn deny_invalid_segment() { // let _ = path!("/foo/^/"); // } // // #[test] // fn deny_non_trailing_wildcard_segment() { // let _ = path!("/home/*any/end"); // } // // #[test] // fn deny_invalid_wildcard() { // let _ = path!("/home/any*"); // }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/hydration_context/src/lib.rs
hydration_context/src/lib.rs
//! Isomorphic web applications that run on the server to render HTML, then add interactivity in //! the client, need to accomplish two tasks: //! 1. Send HTML from the server, so that the client can "hydrate" it in the browser by adding //! event listeners and setting up other interactivity. //! 2. Send data that was loaded on the server to the client, so that the client "hydrates" with //! the same data with which the server rendered HTML. //! //! This crate helps with the second part of this process. It provides a [`SharedContext`] type //! that allows you to store data on the server, and then extract the same data in the client. #![deny(missing_docs)] #![forbid(unsafe_code)] #![cfg_attr(docsrs, feature(doc_cfg))] #[cfg(feature = "browser")] #[cfg_attr(docsrs, doc(cfg(feature = "browser")))] mod csr; #[cfg(feature = "browser")] #[cfg_attr(docsrs, doc(cfg(feature = "browser")))] mod hydrate; mod ssr; #[cfg(feature = "browser")] pub use csr::*; use futures::Stream; #[cfg(feature = "browser")] pub use hydrate::*; use serde::{Deserialize, Serialize}; pub use ssr::*; use std::{fmt::Debug, future::Future, pin::Pin}; use throw_error::{Error, ErrorId}; /// Type alias for a boxed [`Future`]. pub type PinnedFuture<T> = Pin<Box<dyn Future<Output = T> + Send + Sync>>; /// Type alias for a boxed [`Future`] that is `!Send`. pub type PinnedLocalFuture<T> = Pin<Box<dyn Future<Output = T>>>; /// Type alias for a boxed [`Stream`]. pub type PinnedStream<T> = Pin<Box<dyn Stream<Item = T> + Send + Sync>>; #[derive( Clone, Debug, PartialEq, Eq, Hash, Default, Deserialize, Serialize, )] #[serde(transparent)] /// A unique identifier for a piece of data that will be serialized /// from the server to the client. pub struct SerializedDataId(usize); impl SerializedDataId { /// Create a new instance of [`SerializedDataId`]. pub fn new(id: usize) -> Self { SerializedDataId(id) } /// Consume into the inner usize identifier. pub fn into_inner(self) -> usize { self.0 } } impl From<SerializedDataId> for ErrorId { fn from(value: SerializedDataId) -> Self { value.0.into() } } /// Information that will be shared between the server and the client. pub trait SharedContext: Debug { /// Whether the application is running in the browser. fn is_browser(&self) -> bool; /// Returns the next in a series of IDs that is unique to a particular request and response. /// /// This should not be used as a global unique ID mechanism. It is specific to the process /// of serializing and deserializing data from the server to the browser as part of an HTTP /// response. fn next_id(&self) -> SerializedDataId; /// The given [`Future`] should resolve with some data that can be serialized /// from the server to the client. This will be polled as part of the process of /// building the HTTP response, *not* when it is first created. /// /// In browser implementations, this should be a no-op. fn write_async(&self, id: SerializedDataId, fut: PinnedFuture<String>); /// Reads the current value of some data from the shared context, if it has been /// sent from the server. This returns the serialized data as a `String` that should /// be deserialized. /// /// On the server and in client-side rendered implementations, this should /// always return [`None`]. fn read_data(&self, id: &SerializedDataId) -> Option<String>; /// Returns a [`Future`] that resolves with a `String` that should /// be deserialized once the given piece of server data has resolved. /// /// On the server and in client-side rendered implementations, this should /// return a [`Future`] that is immediately ready with [`None`]. fn await_data(&self, id: &SerializedDataId) -> Option<String>; /// Returns some [`Stream`] of HTML that contains JavaScript `<script>` tags defining /// all values being serialized from the server to the client, with their serialized values /// and any boilerplate needed to notify a running application that they exist; or `None`. /// /// In browser implementations, this return `None`. fn pending_data(&self) -> Option<PinnedStream<String>>; /// Whether the page is currently being hydrated. /// /// Should always be `false` on the server or when client-rendering, including after the /// initial hydration in the client. fn during_hydration(&self) -> bool; /// Tells the shared context that the hydration process is complete. fn hydration_complete(&self); /// Returns `true` if you are currently in a part of the application tree that should be /// hydrated. /// /// For example, in an app with "islands," this should be `true` inside islands and /// false elsewhere. fn get_is_hydrating(&self) -> bool; /// Sets whether you are currently in a part of the application tree that should be hydrated. /// /// For example, in an app with "islands," this should be `true` inside islands and /// false elsewhere. fn set_is_hydrating(&self, is_hydrating: bool); /// Returns all errors that have been registered, removing them from the list. fn take_errors(&self) -> Vec<(SerializedDataId, ErrorId, Error)>; /// Returns the set of errors that have been registered with a particular boundary. fn errors(&self, boundary_id: &SerializedDataId) -> Vec<(ErrorId, Error)>; /// "Seals" an error boundary, preventing further errors from being registered for it. /// /// This can be used in streaming SSR scenarios in which the final state of the error boundary /// can only be known after the initial state is hydrated. fn seal_errors(&self, boundary_id: &SerializedDataId); /// Registers an error with the context to be shared from server to client. fn register_error( &self, error_boundary: SerializedDataId, error_id: ErrorId, error: Error, ); /// Adds a `Future` to the set of “blocking resources” that should prevent the server’s /// response stream from beginning until all are resolved. The `Future` returned by /// blocking resources will not resolve until every `Future` added by this method /// has resolved. /// /// In browser implementations, this should be a no-op. fn defer_stream(&self, wait_for: PinnedFuture<()>); /// Returns a `Future` that will resolve when every `Future` added via /// [`defer_stream`](Self::defer_stream) has resolved. /// /// In browser implementations, this should be a no-op. fn await_deferred(&self) -> Option<PinnedFuture<()>>; /// Tells the client that this chunk is being sent from the server before all its data have /// loaded, and it may be in a fallback state. fn set_incomplete_chunk(&self, id: SerializedDataId); /// Checks whether this chunk is being sent from the server before all its data have loaded. fn get_incomplete_chunk(&self, id: &SerializedDataId) -> bool; }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/hydration_context/src/hydrate.rs
hydration_context/src/hydrate.rs
// #[wasm_bindgen(thread_local)] is deprecated in wasm-bindgen 0.2.96 // but the replacement is also only shipped in that version // as a result, we'll just allow deprecated for now #![allow(deprecated)] use super::{SerializedDataId, SharedContext}; use crate::{PinnedFuture, PinnedStream}; use core::fmt::Debug; use js_sys::Array; use std::{ fmt::Display, sync::{ atomic::{AtomicBool, AtomicUsize, Ordering}, LazyLock, }, }; use throw_error::{Error, ErrorId}; use wasm_bindgen::{prelude::wasm_bindgen, JsCast}; #[wasm_bindgen] extern "C" { #[wasm_bindgen(thread_local)] static __RESOLVED_RESOURCES: Array; #[wasm_bindgen(thread_local)] static __SERIALIZED_ERRORS: Array; #[wasm_bindgen(thread_local)] static __INCOMPLETE_CHUNKS: Array; } fn serialized_errors() -> Vec<(SerializedDataId, ErrorId, Error)> { __SERIALIZED_ERRORS.with(|s| { s.iter() .flat_map(|value| { value.dyn_ref::<Array>().map(|value| { let error_boundary_id = value.get(0).as_f64().unwrap() as usize; let error_id = value.get(1).as_f64().unwrap() as usize; let value = value .get(2) .as_string() .expect("Expected a [number, string] tuple"); ( SerializedDataId(error_boundary_id), ErrorId::from(error_id), Error::from(SerializedError(value)), ) }) }) .collect() }) } fn incomplete_chunks() -> Vec<SerializedDataId> { __INCOMPLETE_CHUNKS.with(|i| { i.iter() .map(|value| { let id = value.as_f64().unwrap() as usize; SerializedDataId(id) }) .collect() }) } /// An error that has been serialized across the network boundary. #[derive(Debug, Clone)] struct SerializedError(String); impl Display for SerializedError { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { Display::fmt(&self.0, f) } } impl std::error::Error for SerializedError {} #[derive(Default)] /// The shared context that should be used in the browser while hydrating. pub struct HydrateSharedContext { id: AtomicUsize, is_hydrating: AtomicBool, during_hydration: AtomicBool, errors: LazyLock<Vec<(SerializedDataId, ErrorId, Error)>>, incomplete: LazyLock<Vec<SerializedDataId>>, } impl HydrateSharedContext { /// Creates a new shared context for hydration in the browser. pub fn new() -> Self { Self { id: AtomicUsize::new(0), is_hydrating: AtomicBool::new(true), during_hydration: AtomicBool::new(true), errors: LazyLock::new(serialized_errors), incomplete: LazyLock::new(incomplete_chunks), } } /// Creates a new shared context for hydration in the browser. /// /// This defaults to a mode in which the app is not hydrated, but allows you to opt into /// hydration for certain portions using [`SharedContext::set_is_hydrating`]. pub fn new_islands() -> Self { Self { id: AtomicUsize::new(0), is_hydrating: AtomicBool::new(false), during_hydration: AtomicBool::new(true), errors: LazyLock::new(serialized_errors), incomplete: LazyLock::new(incomplete_chunks), } } } impl Debug for HydrateSharedContext { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("HydrateSharedContext").finish() } } impl SharedContext for HydrateSharedContext { fn is_browser(&self) -> bool { true } fn next_id(&self) -> SerializedDataId { let id = self.id.fetch_add(1, Ordering::Relaxed); SerializedDataId(id) } fn write_async(&self, _id: SerializedDataId, _fut: PinnedFuture<String>) {} fn read_data(&self, id: &SerializedDataId) -> Option<String> { __RESOLVED_RESOURCES.with(|r| r.get(id.0 as u32).as_string()) } fn await_data(&self, _id: &SerializedDataId) -> Option<String> { todo!() } fn pending_data(&self) -> Option<PinnedStream<String>> { None } fn during_hydration(&self) -> bool { self.during_hydration.load(Ordering::Relaxed) } fn hydration_complete(&self) { self.during_hydration.store(false, Ordering::Relaxed) } fn get_is_hydrating(&self) -> bool { self.is_hydrating.load(Ordering::Relaxed) } fn set_is_hydrating(&self, is_hydrating: bool) { self.is_hydrating.store(is_hydrating, Ordering::Relaxed) } fn errors(&self, boundary_id: &SerializedDataId) -> Vec<(ErrorId, Error)> { self.errors .iter() .filter_map(|(boundary, id, error)| { if boundary == boundary_id { Some((id.clone(), error.clone())) } else { None } }) .collect() } #[inline(always)] fn register_error( &self, _error_boundary: SerializedDataId, _error_id: ErrorId, _error: Error, ) { } #[inline(always)] fn seal_errors(&self, _boundary_id: &SerializedDataId) {} fn take_errors(&self) -> Vec<(SerializedDataId, ErrorId, Error)> { self.errors.clone() } #[inline(always)] fn defer_stream(&self, _wait_for: PinnedFuture<()>) {} #[inline(always)] fn await_deferred(&self) -> Option<PinnedFuture<()>> { None } #[inline(always)] fn set_incomplete_chunk(&self, _id: SerializedDataId) {} fn get_incomplete_chunk(&self, id: &SerializedDataId) -> bool { self.incomplete.iter().any(|entry| entry == id) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/hydration_context/src/ssr.rs
hydration_context/src/ssr.rs
use super::{SerializedDataId, SharedContext}; use crate::{PinnedFuture, PinnedStream}; use futures::{ future::join_all, stream::{self, once}, Stream, StreamExt, }; use or_poisoned::OrPoisoned; use std::{ collections::HashSet, fmt::{Debug, Write}, mem, pin::Pin, sync::{ atomic::{AtomicBool, AtomicUsize, Ordering}, Arc, Mutex, RwLock, }, task::{Context, Poll}, }; use throw_error::{Error, ErrorId}; type AsyncDataBuf = Arc<RwLock<Vec<(SerializedDataId, PinnedFuture<String>)>>>; type ErrorBuf = Arc<RwLock<Vec<(SerializedDataId, ErrorId, Error)>>>; type SealedErrors = Arc<RwLock<HashSet<SerializedDataId>>>; #[derive(Default)] /// The shared context that should be used on the server side. pub struct SsrSharedContext { id: AtomicUsize, non_hydration_id: AtomicUsize, is_hydrating: AtomicBool, sync_buf: RwLock<Vec<ResolvedData>>, async_buf: AsyncDataBuf, errors: ErrorBuf, sealed_error_boundaries: SealedErrors, deferred: Mutex<Vec<PinnedFuture<()>>>, incomplete: Arc<Mutex<Vec<SerializedDataId>>>, } impl SsrSharedContext { /// Creates a new shared context for rendering HTML on the server. pub fn new() -> Self { Self { is_hydrating: AtomicBool::new(true), non_hydration_id: AtomicUsize::new(usize::MAX), ..Default::default() } } /// Creates a new shared context for rendering HTML on the server in "islands" mode. /// /// This defaults to a mode in which the app is not hydrated, but allows you to opt into /// hydration for certain portions using [`SharedContext::set_is_hydrating`]. pub fn new_islands() -> Self { Self { is_hydrating: AtomicBool::new(false), non_hydration_id: AtomicUsize::new(usize::MAX), ..Default::default() } } /// Consume the data buffers, awaiting all async resources, /// returning both sync and async buffers. /// Useful to implement custom hydration contexts. /// /// WARNING: this will clear the internal buffers, it should only be called once. /// A second call would return an empty `vec![]`. pub async fn consume_buffers(&self) -> Vec<(SerializedDataId, String)> { let sync_data = mem::take(&mut *self.sync_buf.write().or_poisoned()); let async_data = mem::take(&mut *self.async_buf.write().or_poisoned()); let mut all_data = Vec::new(); for resolved in sync_data { all_data.push((resolved.0, resolved.1)); } for (id, fut) in async_data { let data = fut.await; all_data.push((id, data)); } all_data } } impl Debug for SsrSharedContext { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("SsrSharedContext") .field("id", &self.id) .field("is_hydrating", &self.is_hydrating) .field("sync_buf", &self.sync_buf) .field("async_buf", &self.async_buf.read().or_poisoned().len()) .finish() } } impl SharedContext for SsrSharedContext { fn is_browser(&self) -> bool { false } #[track_caller] fn next_id(&self) -> SerializedDataId { let id = if self.get_is_hydrating() { self.id.fetch_add(1, Ordering::Relaxed) } else { self.non_hydration_id.fetch_sub(1, Ordering::Relaxed) }; SerializedDataId(id) } fn write_async(&self, id: SerializedDataId, fut: PinnedFuture<String>) { self.async_buf.write().or_poisoned().push((id, fut)) } fn read_data(&self, _id: &SerializedDataId) -> Option<String> { None } fn await_data(&self, _id: &SerializedDataId) -> Option<String> { None } fn get_is_hydrating(&self) -> bool { self.is_hydrating.load(Ordering::SeqCst) } fn set_is_hydrating(&self, is_hydrating: bool) { self.is_hydrating.store(is_hydrating, Ordering::SeqCst) } fn errors(&self, boundary_id: &SerializedDataId) -> Vec<(ErrorId, Error)> { self.errors .read() .or_poisoned() .iter() .filter_map(|(boundary, id, error)| { if boundary == boundary_id { Some((id.clone(), error.clone())) } else { None } }) .collect() } fn register_error( &self, error_boundary_id: SerializedDataId, error_id: ErrorId, error: Error, ) { self.errors.write().or_poisoned().push(( error_boundary_id, error_id, error, )); } fn take_errors(&self) -> Vec<(SerializedDataId, ErrorId, Error)> { mem::take(&mut *self.errors.write().or_poisoned()) } fn seal_errors(&self, boundary_id: &SerializedDataId) { self.sealed_error_boundaries .write() .or_poisoned() .insert(boundary_id.clone()); } fn pending_data(&self) -> Option<PinnedStream<String>> { let sync_data = mem::take(&mut *self.sync_buf.write().or_poisoned()); let async_data = self.async_buf.read().or_poisoned(); // 1) initial, synchronous setup chunk let mut initial_chunk = String::new(); // resolved synchronous resources and errors initial_chunk.push_str("__RESOLVED_RESOURCES=["); for resolved in sync_data { resolved.write_to_buf(&mut initial_chunk); initial_chunk.push(','); } initial_chunk.push_str("];"); initial_chunk.push_str("__SERIALIZED_ERRORS=["); for error in mem::take(&mut *self.errors.write().or_poisoned()) { _ = write!( initial_chunk, "[{}, {}, {:?}],", error.0 .0, error.1, error.2.to_string() ); } initial_chunk.push_str("];"); // pending async resources initial_chunk.push_str("__PENDING_RESOURCES=["); for (id, _) in async_data.iter() { _ = write!(&mut initial_chunk, "{},", id.0); } initial_chunk.push_str("];"); // resolvers initial_chunk.push_str("__RESOURCE_RESOLVERS=[];"); let async_data = AsyncDataStream { async_buf: Arc::clone(&self.async_buf), errors: Arc::clone(&self.errors), sealed_error_boundaries: Arc::clone(&self.sealed_error_boundaries), }; let incomplete = Arc::clone(&self.incomplete); let stream = stream::once(async move { initial_chunk }) .chain(async_data) .chain(once(async move { let mut script = String::new(); script.push_str("__INCOMPLETE_CHUNKS=["); for chunk in mem::take(&mut *incomplete.lock().or_poisoned()) { _ = write!(script, "{},", chunk.0); } script.push_str("];"); script })); Some(Box::pin(stream)) } fn during_hydration(&self) -> bool { false } fn hydration_complete(&self) {} fn defer_stream(&self, wait_for: PinnedFuture<()>) { self.deferred.lock().or_poisoned().push(wait_for); } fn await_deferred(&self) -> Option<PinnedFuture<()>> { let deferred = mem::take(&mut *self.deferred.lock().or_poisoned()); if deferred.is_empty() { None } else { Some(Box::pin(async move { join_all(deferred).await; })) } } fn set_incomplete_chunk(&self, id: SerializedDataId) { self.incomplete.lock().or_poisoned().push(id); } fn get_incomplete_chunk(&self, id: &SerializedDataId) -> bool { self.incomplete .lock() .or_poisoned() .iter() .any(|entry| entry == id) } } struct AsyncDataStream { async_buf: AsyncDataBuf, errors: ErrorBuf, sealed_error_boundaries: SealedErrors, } impl Stream for AsyncDataStream { type Item = String; fn poll_next( self: Pin<&mut Self>, cx: &mut Context<'_>, ) -> Poll<Option<Self::Item>> { let mut resolved = String::new(); let mut async_buf = self.async_buf.write().or_poisoned(); let data = mem::take(&mut *async_buf); for (id, mut fut) in data { match fut.as_mut().poll(cx) { // if it's not ready, put it back into the queue Poll::Pending => { async_buf.push((id, fut)); } Poll::Ready(data) => { let data = data.replace('<', "\\u003c"); _ = write!( resolved, "__RESOLVED_RESOURCES[{}] = {:?};", id.0, data ); } } } let sealed = self.sealed_error_boundaries.read().or_poisoned(); for error in mem::take(&mut *self.errors.write().or_poisoned()) { if !sealed.contains(&error.0) { _ = write!( resolved, "__SERIALIZED_ERRORS.push([{}, {}, {:?}]);", error.0 .0, error.1, error.2.to_string() ); } } if async_buf.is_empty() && resolved.is_empty() { return Poll::Ready(None); } if resolved.is_empty() { return Poll::Pending; } Poll::Ready(Some(resolved)) } } #[derive(Debug)] struct ResolvedData(SerializedDataId, String); impl ResolvedData { pub fn write_to_buf(&self, buf: &mut String) { let ResolvedData(id, ser) = self; // escapes < to prevent it being interpreted as another opening HTML tag let ser = ser.replace('<', "\\u003c"); write!(buf, "{}: {:?}", id.0, ser).unwrap(); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/hydration_context/src/csr.rs
hydration_context/src/csr.rs
use super::{SerializedDataId, SharedContext}; use crate::{PinnedFuture, PinnedStream}; #[derive(Debug, Default)] /// The shared context that should be used in the browser while hydrating. pub struct CsrSharedContext; impl SharedContext for CsrSharedContext { #[inline(always)] fn is_browser(&self) -> bool { true } #[inline(always)] fn next_id(&self) -> SerializedDataId { SerializedDataId(0) } #[inline(always)] fn write_async(&self, _id: SerializedDataId, _fut: PinnedFuture<String>) {} #[inline(always)] fn read_data(&self, _id: &SerializedDataId) -> Option<String> { None } #[inline(always)] fn await_data(&self, _id: &SerializedDataId) -> Option<String> { todo!() } #[inline(always)] fn pending_data(&self) -> Option<PinnedStream<String>> { None } #[inline(always)] fn get_is_hydrating(&self) -> bool { false } #[inline(always)] fn set_is_hydrating(&self, _is_hydrating: bool) {} #[inline(always)] fn errors( &self, _boundary_id: &SerializedDataId, ) -> Vec<(throw_error::ErrorId, throw_error::Error)> { Vec::new() } #[inline(always)] fn take_errors( &self, ) -> Vec<(SerializedDataId, throw_error::ErrorId, throw_error::Error)> { Vec::new() } #[inline(always)] fn register_error( &self, _error_boundary: SerializedDataId, _error_id: throw_error::ErrorId, _error: throw_error::Error, ) { } #[inline(always)] fn seal_errors(&self, _boundary_id: &SerializedDataId) {} #[inline(always)] fn during_hydration(&self) -> bool { false } #[inline(always)] fn hydration_complete(&self) {} #[inline(always)] fn defer_stream(&self, _wait_for: PinnedFuture<()>) {} #[inline(always)] fn await_deferred(&self) -> Option<PinnedFuture<()>> { None } #[inline(always)] fn set_incomplete_chunk(&self, _id: SerializedDataId) {} #[inline(always)] fn get_incomplete_chunk(&self, _id: &SerializedDataId) -> bool { false } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/benchmarks/src/reactive.rs
benchmarks/src/reactive.rs
use std::{cell::Cell, rc::Rc}; use test::Bencher; #[bench] fn leptos_deep_creation(b: &mut Bencher) { use leptos::*; let runtime = create_runtime(); b.iter(|| { let signal = create_rw_signal(0); let mut memos = Vec::<Memo<usize>>::new(); for _ in 0..1000usize { let prev = memos.last().copied(); if let Some(prev) = prev { memos.push(create_memo(move |_| prev.get() + 1)); } else { memos.push(create_memo(move |_| signal.get() + 1)); } } }); runtime.dispose(); } #[bench] fn leptos_deep_update(b: &mut Bencher) { use leptos::*; let runtime = create_runtime(); b.iter(|| { let signal = create_rw_signal(0); let mut memos = Vec::<Memo<usize>>::new(); for _ in 0..1000usize { if let Some(prev) = memos.last().copied() { memos.push(create_memo(move |_| prev.get() + 1)); } else { memos.push(create_memo(move |_| signal.get() + 1)); } } signal.set(1); assert_eq!(memos[999].get(), 1001); }); runtime.dispose(); } #[bench] fn leptos_narrowing_down(b: &mut Bencher) { use leptos::*; let runtime = create_runtime(); b.iter(|| { let sigs = (0..1000).map(|n| create_signal(n)).collect::<Vec<_>>(); let reads = sigs.iter().map(|(r, _)| *r).collect::<Vec<_>>(); let writes = sigs.iter().map(|(_, w)| *w).collect::<Vec<_>>(); let memo = create_memo(move |_| reads.iter().map(|r| r.get()).sum::<i32>()); assert_eq!(memo(), 499500); }); runtime.dispose(); } #[bench] fn leptos_fanning_out(b: &mut Bencher) { use leptos::*; let runtime = create_runtime(); b.iter(|| { let sig = create_rw_signal(0); let memos = (0..1000) .map(|_| create_memo(move |_| sig.get())) .collect::<Vec<_>>(); assert_eq!(memos.iter().map(|m| m.get()).sum::<i32>(), 0); sig.set(1); assert_eq!(memos.iter().map(|m| m.get()).sum::<i32>(), 1000); }); runtime.dispose(); } #[bench] fn leptos_narrowing_update(b: &mut Bencher) { use leptos::*; let runtime = create_runtime(); b.iter(|| { let acc = Rc::new(Cell::new(0)); let sigs = (0..1000).map(|n| create_signal(n)).collect::<Vec<_>>(); let reads = sigs.iter().map(|(r, _)| *r).collect::<Vec<_>>(); let writes = sigs.iter().map(|(_, w)| *w).collect::<Vec<_>>(); let memo = create_memo(move |_| reads.iter().map(|r| r.get()).sum::<i32>()); assert_eq!(memo(), 499500); create_isomorphic_effect({ let acc = Rc::clone(&acc); move |_| { acc.set(memo()); } }); assert_eq!(acc.get(), 499500); writes[1].update(|n| *n += 1); writes[10].update(|n| *n += 1); writes[100].update(|n| *n += 1); assert_eq!(acc.get(), 499503); assert_eq!(memo(), 499503); }); runtime.dispose(); } #[bench] fn l0410_deep_creation(b: &mut Bencher) { use l0410::*; let runtime = create_runtime(); b.iter(|| { create_scope(runtime, |cx| { let signal = create_rw_signal(cx, 0); let mut memos = Vec::<Memo<usize>>::new(); for _ in 0..1000usize { if let Some(prev) = memos.last().copied() { memos.push(create_memo(cx, move |_| prev.get() + 1)); } else { memos.push(create_memo(cx, move |_| signal.get() + 1)); } } }) .dispose() }); runtime.dispose(); } #[bench] fn l0410_deep_update(b: &mut Bencher) { use l0410::*; let runtime = create_runtime(); b.iter(|| { create_scope(runtime, |cx| { let signal = create_rw_signal(cx, 0); let mut memos = Vec::<Memo<usize>>::new(); for _ in 0..1000usize { if let Some(prev) = memos.last().copied() { memos.push(create_memo(cx, move |_| prev.get() + 1)); } else { memos.push(create_memo(cx, move |_| signal.get() + 1)); } } signal.set(1); assert_eq!(memos[999].get(), 1001); }) .dispose() }); runtime.dispose(); } #[bench] fn l0410_narrowing_down(b: &mut Bencher) { use l0410::*; let runtime = create_runtime(); b.iter(|| { create_scope(runtime, |cx| { let acc = Rc::new(Cell::new(0)); let sigs = (0..1000).map(|n| create_signal(cx, n)).collect::<Vec<_>>(); let reads = sigs.iter().map(|(r, _)| *r).collect::<Vec<_>>(); let writes = sigs.iter().map(|(_, w)| *w).collect::<Vec<_>>(); let memo = create_memo(cx, move |_| { reads.iter().map(|r| r.get()).sum::<i32>() }); assert_eq!(memo(), 499500); }) .dispose() }); runtime.dispose(); } #[bench] fn l0410_fanning_out(b: &mut Bencher) { use l0410::*; let runtime = create_runtime(); b.iter(|| { create_scope(runtime, |cx| { let sig = create_rw_signal(cx, 0); let memos = (0..1000) .map(|_| create_memo(cx, move |_| sig.get())) .collect::<Vec<_>>(); assert_eq!(memos.iter().map(|m| m.get()).sum::<i32>(), 0); sig.set(1); assert_eq!(memos.iter().map(|m| m.get()).sum::<i32>(), 1000); }) .dispose() }); runtime.dispose(); } #[bench] fn l0410_narrowing_update(b: &mut Bencher) { use l0410::*; let runtime = create_runtime(); b.iter(|| { create_scope(runtime, |cx| { let acc = Rc::new(Cell::new(0)); let sigs = (0..1000).map(|n| create_signal(cx, n)).collect::<Vec<_>>(); let reads = sigs.iter().map(|(r, _)| *r).collect::<Vec<_>>(); let writes = sigs.iter().map(|(_, w)| *w).collect::<Vec<_>>(); let memo = create_memo(cx, move |_| { reads.iter().map(|r| r.get()).sum::<i32>() }); assert_eq!(memo.get(), 499500); create_isomorphic_effect(cx, { let acc = Rc::clone(&acc); move |_| { acc.set(memo.get()); } }); assert_eq!(acc.get(), 499500); writes[1].update(|n| *n += 1); writes[10].update(|n| *n += 1); writes[100].update(|n| *n += 1); assert_eq!(acc.get(), 499503); assert_eq!(memo.get(), 499503); }) .dispose() }); runtime.dispose(); } #[bench] fn l0410_scope_creation_and_disposal(b: &mut Bencher) { use l0410::*; let runtime = create_runtime(); b.iter(|| { let acc = Rc::new(Cell::new(0)); let disposers = (0..1000) .map(|_| { create_scope(runtime, { let acc = Rc::clone(&acc); move |cx| { let (r, w) = create_signal(cx, 0); create_isomorphic_effect(cx, { move |_| { acc.set(r.get()); } }); w.update(|n| *n += 1); } }) }) .collect::<Vec<_>>(); for disposer in disposers { disposer.dispose(); } }); runtime.dispose(); } #[bench] fn sycamore_narrowing_down(b: &mut Bencher) { use sycamore::reactive::{ create_effect, create_memo, create_scope, create_signal, }; b.iter(|| { let d = create_scope(|cx| { let acc = Rc::new(Cell::new(0)); let sigs = Rc::new( (0..1000).map(|n| create_signal(cx, n)).collect::<Vec<_>>(), ); let memo = create_memo(cx, { let sigs = Rc::clone(&sigs); move || sigs.iter().map(|r| *r.get()).sum::<i32>() }); assert_eq!(*memo.get(), 499500); }); unsafe { d.dispose() }; }); } #[bench] fn sycamore_fanning_out(b: &mut Bencher) { use sycamore::reactive::{ create_effect, create_memo, create_scope, create_signal, }; b.iter(|| { let d = create_scope(|cx| { let sig = create_signal(cx, 0); let memos = (0..1000) .map(|_| create_memo(cx, move || sig.get())) .collect::<Vec<_>>(); assert_eq!(memos.iter().map(|m| *(*m.get())).sum::<i32>(), 0); sig.set(1); assert_eq!(memos.iter().map(|m| *(*m.get())).sum::<i32>(), 1000); }); unsafe { d.dispose() }; }); } #[bench] fn sycamore_deep_creation(b: &mut Bencher) { use sycamore::reactive::*; b.iter(|| { let d = create_scope(|cx| { let signal = create_signal(cx, 0); let mut memos = Vec::<&ReadSignal<usize>>::new(); for _ in 0..1000usize { if let Some(prev) = memos.last().copied() { memos.push(create_memo(cx, move || *prev.get() + 1)); } else { memos.push(create_memo(cx, move || *signal.get() + 1)); } } }); unsafe { d.dispose() }; }); } #[bench] fn sycamore_deep_update(b: &mut Bencher) { use sycamore::reactive::*; b.iter(|| { let d = create_scope(|cx| { let signal = create_signal(cx, 0); let mut memos = Vec::<&ReadSignal<usize>>::new(); for _ in 0..1000usize { if let Some(prev) = memos.last().copied() { memos.push(create_memo(cx, move || *prev.get() + 1)); } else { memos.push(create_memo(cx, move || *signal.get() + 1)); } } signal.set(1); assert_eq!(*memos[999].get(), 1001); }); unsafe { d.dispose() }; }); } #[bench] fn sycamore_narrowing_update(b: &mut Bencher) { use sycamore::reactive::{ create_effect, create_memo, create_scope, create_signal, }; b.iter(|| { let d = create_scope(|cx| { let acc = Rc::new(Cell::new(0)); let sigs = Rc::new( (0..1000).map(|n| create_signal(cx, n)).collect::<Vec<_>>(), ); let memo = create_memo(cx, { let sigs = Rc::clone(&sigs); move || sigs.iter().map(|r| *r.get()).sum::<i32>() }); assert_eq!(*memo.get(), 499500); create_effect(cx, { let acc = Rc::clone(&acc); move || { acc.set(*memo.get()); } }); assert_eq!(acc.get(), 499500); sigs[1].set(*sigs[1].get() + 1); sigs[10].set(*sigs[10].get() + 1); sigs[100].set(*sigs[100].get() + 1); assert_eq!(acc.get(), 499503); assert_eq!(*memo.get(), 499503); }); unsafe { d.dispose() }; }); } #[bench] fn sycamore_scope_creation_and_disposal(b: &mut Bencher) { use sycamore::reactive::{create_effect, create_scope, create_signal}; b.iter(|| { let acc = Rc::new(Cell::new(0)); let disposers = (0..1000) .map(|_| { create_scope({ let acc = Rc::clone(&acc); move |cx| { let s = create_signal(cx, 0); create_effect(cx, { move || { acc.set(*s.get()); } }); s.set(*s.get() + 1); } }) }) .collect::<Vec<_>>(); for disposer in disposers { unsafe { disposer.dispose(); } } }); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/benchmarks/src/lib.rs
benchmarks/src/lib.rs
#![feature(test)] extern crate test; mod reactive; mod ssr; mod todomvc;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/benchmarks/src/ssr.rs
benchmarks/src/ssr.rs
use test::Bencher; #[bench] fn leptos_ssr_bench(b: &mut Bencher) { use leptos::*; let r = create_runtime(); b.iter(|| { leptos::leptos_dom::HydrationCtx::reset_id(); #[component] fn Counter(initial: i32) -> impl IntoView { let (value, set_value) = create_signal(initial); view! { <div> <button on:click=move |_| set_value.update(|value| *value -= 1)>"-1"</button> <span>"Value: " {move || value().to_string()} "!"</span> <button on:click=move |_| set_value.update(|value| *value += 1)>"+1"</button> </div> } } let rendered = view! { <main> <h1>"Welcome to our benchmark page."</h1> <p>"Here's some introductory text."</p> <Counter initial=1/> <Counter initial=2/> <Counter initial=3/> </main> }.into_view().render_to_string(); assert_eq!( rendered, "<main data-hk=\"0-0-0-1\"><h1 data-hk=\"0-0-0-2\">Welcome to our benchmark page.</h1><p data-hk=\"0-0-0-3\">Here&#x27;s some introductory text.</p><div data-hk=\"0-0-0-5\"><button data-hk=\"0-0-0-6\">-1</button><span data-hk=\"0-0-0-7\">Value: <!>1<!--hk=0-0-0-8-->!</span><button data-hk=\"0-0-0-9\">+1</button></div><!--hk=0-0-0-4--><div data-hk=\"0-0-0-11\"><button data-hk=\"0-0-0-12\">-1</button><span data-hk=\"0-0-0-13\">Value: <!>2<!--hk=0-0-0-14-->!</span><button data-hk=\"0-0-0-15\">+1</button></div><!--hk=0-0-0-10--><div data-hk=\"0-0-0-17\"><button data-hk=\"0-0-0-18\">-1</button><span data-hk=\"0-0-0-19\">Value: <!>3<!--hk=0-0-0-20-->!</span><button data-hk=\"0-0-0-21\">+1</button></div><!--hk=0-0-0-16--></main>" ); }); r.dispose(); } #[bench] fn tachys_ssr_bench(b: &mut Bencher) { use leptos::{create_runtime, create_signal, SignalGet, SignalUpdate}; use tachy_maccy::view; use tachydom::view::{Render, RenderHtml}; use tachydom::html::element::ElementChild; use tachydom::html::attribute::global::ClassAttribute; use tachydom::html::attribute::global::GlobalAttributes; use tachydom::html::attribute::global::OnAttribute; use tachydom::renderer::dom::Dom; let rt = create_runtime(); b.iter(|| { fn counter(initial: i32) -> impl Render<Dom> + RenderHtml<Dom> { let (value, set_value) = create_signal(initial); view! { <div> <button on:click=move |_| set_value.update(|value| *value -= 1)>"-1"</button> <span>"Value: " {move || value().to_string()} "!"</span> <button on:click=move |_| set_value.update(|value| *value += 1)>"+1"</button> </div> } } let rendered = view! { <main> <h1>"Welcome to our benchmark page."</h1> <p>"Here's some introductory text."</p> {counter(1)} {counter(2)} {counter(3)} </main> }.to_html(); assert_eq!( rendered, "<main><h1>Welcome to our benchmark page.</h1><p>Here's some introductory text.</p><div><button>-1</button><span>Value: <!>1<!>!</span><button>+1</button></div><div><button>-1</button><span>Value: <!>2<!>!</span><button>+1</button></div><div><button>-1</button><span>Value: <!>3<!>!</span><button>+1</button></div></main>" ); }); rt.dispose(); } #[bench] fn tera_ssr_bench(b: &mut Bencher) { use serde::{Deserialize, Serialize}; use tera::*; static TEMPLATE: &str = r#"<main> <h1>Welcome to our benchmark page.</h1> <p>Here's some introductory text.</p> {% for counter in counters %} <div> <button>-1</button> <span>Value: {{ counter.value }}!</span> <button>+1</button> </div> {% endfor %} </main>"#; static LazyCell<TERA>: Tera = LazyLock::new(|| { let mut tera = Tera::default(); tera.add_raw_templates(vec![("template.html", TEMPLATE)]).unwrap(); tera }); #[derive(Serialize, Deserialize)] struct Counter { value: i32, } b.iter(|| { let mut ctx = Context::new(); ctx.insert( "counters", &vec![ Counter { value: 0 }, Counter { value: 1 }, Counter { value: 2 }, ], ); let _ = TERA.render("template.html", &ctx).unwrap(); }); } #[bench] fn sycamore_ssr_bench(b: &mut Bencher) { use sycamore::prelude::*; use sycamore::*; b.iter(|| { _ = create_scope(|cx| { #[derive(Prop)] struct CounterProps { initial: i32 } #[component] fn Counter<G: Html>(cx: Scope, props: CounterProps) -> View<G> { let value = create_signal(cx, props.initial); view! { cx, div { button(on:click=|_| value.set(*value.get() - 1)) { "-1" } span { "Value: " (value.get().to_string()) "!" } button(on:click=|_| value.set(*value.get() + 1)) { "+1" } } } } let rendered = render_to_string(|cx| view! { cx, main { h1 { "Welcome to our benchmark page." } p { "Here's some introductory text." } Counter(initial = 1) Counter(initial = 2) Counter(initial = 3) } }); assert_eq!( rendered, "<main data-hk=\"0.0\"><h1 data-hk=\"0.1\">Welcome to our benchmark page.</h1><p data-hk=\"0.2\">Here's some introductory text.</p><!--#--><div data-hk=\"1.0\"><button data-hk=\"1.1\">-1</button><span data-hk=\"1.2\">Value: <!--#-->1<!--/-->!</span><button data-hk=\"1.3\">+1</button></div><!--/--><!----><!--#--><div data-hk=\"2.0\"><button data-hk=\"2.1\">-1</button><span data-hk=\"2.2\">Value: <!--#-->2<!--/-->!</span><button data-hk=\"2.3\">+1</button></div><!--/--><!----><!--#--><div data-hk=\"3.0\"><button data-hk=\"3.1\">-1</button><span data-hk=\"3.2\">Value: <!--#-->3<!--/-->!</span><button data-hk=\"3.3\">+1</button></div><!--/--></main>" ); }); }); } #[bench] fn yew_ssr_bench(b: &mut Bencher) { use yew::prelude::*; use yew::ServerRenderer; b.iter(|| { #[derive(Properties, PartialEq, Eq, Debug)] struct CounterProps { initial: i32 } #[function_component(Counter)] fn counter(props: &CounterProps) -> Html { let state = use_state(|| props.initial); let incr_counter = { let state = state.clone(); Callback::from(move |_| state.set(&*state + 1)) }; let decr_counter = { let state = state.clone(); Callback::from(move |_| state.set(&*state - 1)) }; html! { <div> <h1>{"Welcome to our benchmark page."}</h1> <p>{"Here's some introductory text."}</p> <button onclick={decr_counter}> {"-1"} </button> <p> {"Value: "} {*state} {"!"} </p> <button onclick={incr_counter}> {"+1"} </button> </div> } } #[function_component] fn App() -> Html { html! { <main> <Counter initial=1/> <Counter initial=2/> <Counter initial=3/> </main> } } tokio_test::block_on(async { let renderer = ServerRenderer::<App>::new(); let rendered = renderer.render().await; assert_eq!( rendered, "<!--<[]>--><main><!--<[]>--><div><h1>Welcome to our benchmark page.</h1><p>Here's some introductory text.</p><button>-1</button><p>Value: 1!</p><button>+1</button></div><!--</[]>--><!--<[]>--><div><h1>Welcome to our benchmark page.</h1><p>Here's some introductory text.</p><button>-1</button><p>Value: 2!</p><button>+1</button></div><!--</[]>--><!--<[]>--><div><h1>Welcome to our benchmark page.</h1><p>Here's some introductory text.</p><button>-1</button><p>Value: 3!</p><button>+1</button></div><!--</[]>--></main><!--</[]>-->" ); }); }); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/benchmarks/src/todomvc/leptos.rs
benchmarks/src/todomvc/leptos.rs
pub use leptos::*; use miniserde::*; use wasm_bindgen::JsCast; use web_sys::HtmlInputElement; #[derive(Debug, Clone, PartialEq, Eq)] pub struct Todos(pub Vec<Todo>); const STORAGE_KEY: &str = "todos-leptos"; impl Todos { pub fn new() -> Self { Self(vec![]) } pub fn new_with_1000() -> Self { let todos = (0..1000) .map(|id| Todo::new(id, format!("Todo #{id}"))) .collect(); Self(todos) } pub fn is_empty(&self) -> bool { self.0.is_empty() } pub fn add(&mut self, todo: Todo) { self.0.push(todo); } pub fn remove(&mut self, id: usize) { self.0.retain(|todo| todo.id != id); } pub fn remaining(&self) -> usize { self.0.iter().filter(|todo| !(todo.completed)()).count() } pub fn completed(&self) -> usize { self.0.iter().filter(|todo| (todo.completed)()).count() } pub fn toggle_all(&self) { // if all are complete, mark them all active instead if self.remaining() == 0 { for todo in &self.0 { if todo.completed.get() { (todo.set_completed)(false); } } } // otherwise, mark them all complete else { for todo in &self.0 { (todo.set_completed)(true); } } } fn clear_completed(&mut self) { self.0.retain(|todo| !todo.completed.get()); } } #[derive(Debug, PartialEq, Eq, Clone)] pub struct Todo { pub id: usize, pub title: ReadSignal<String>, pub set_title: WriteSignal<String>, pub completed: ReadSignal<bool>, pub set_completed: WriteSignal<bool>, } impl Todo { pub fn new(id: usize, title: String) -> Self { Self::new_with_completed(id, title, false) } pub fn new_with_completed( id: usize, title: String, completed: bool, ) -> Self { let (title, set_title) = create_signal(title); let (completed, set_completed) = create_signal(completed); Self { id, title, set_title, completed, set_completed, } } pub fn toggle(&self) { self.set_completed .update(|completed| *completed = !*completed); } } const ESCAPE_KEY: u32 = 27; const ENTER_KEY: u32 = 13; #[component] pub fn TodoMVC(todos: Todos) -> impl IntoView { let mut next_id = todos .0 .iter() .map(|todo| todo.id) .max() .map(|last| last + 1) .unwrap_or(0); let (todos, set_todos) = create_signal(todos); provide_context(set_todos); let (mode, set_mode) = create_signal(Mode::All); let add_todo = move |ev: web_sys::KeyboardEvent| { let target = event_target::<HtmlInputElement>(&ev); ev.stop_propagation(); let key_code = ev.unchecked_ref::<web_sys::KeyboardEvent>().key_code(); if key_code == ENTER_KEY { let title = event_target_value(&ev); let title = title.trim(); if !title.is_empty() { let new = Todo::new(next_id, title.to_string()); set_todos.update(|t| t.add(new)); next_id += 1; target.set_value(""); } } }; let filtered_todos = create_memo::<Vec<Todo>>(move |_| { todos.with(|todos| match mode.get() { Mode::All => todos.0.to_vec(), Mode::Active => todos .0 .iter() .filter(|todo| !todo.completed.get()) .cloned() .collect(), Mode::Completed => todos .0 .iter() .filter(|todo| todo.completed.get()) .cloned() .collect(), }) }); // effect to serialize to JSON // this does reactive reads, so it will automatically serialize on any relevant change create_effect(move |_| { if let Ok(Some(storage)) = window().local_storage() { let objs = todos .get() .0 .iter() .map(TodoSerialized::from) .collect::<Vec<_>>(); let json = json::to_string(&objs); if storage.set_item(STORAGE_KEY, &json).is_err() { log::error!("error while trying to set item in localStorage"); } } }); view! { <main> <section class="todoapp"> <header class="header"> <h1>"todos"</h1> <input class="new-todo" placeholder="What needs to be done?" autofocus="" on:keydown=add_todo /> </header> <section class="main" class:hidden=move || todos.with(|t| t.is_empty())> <input id="toggle-all" class="toggle-all" type="checkbox" prop:checked=move || todos.with(|t| t.remaining() > 0) on:input=move |_| set_todos.update(|t| t.toggle_all()) /> <label for="toggle-all">"Mark all as complete"</label> <ul class="todo-list"> <For each=filtered_todos key=|todo| todo.id children=move |todo: Todo| { view! { <Todo todo=todo.clone()/> } } /> </ul> </section> <footer class="footer" class:hidden=move || todos.with(|t| t.is_empty())> <span class="todo-count"> <strong>{move || todos.with(|t| t.remaining().to_string())}</strong> {move || if todos.with(|t| t.remaining()) == 1 { " item" } else { " items" }} " left" </span> <ul class="filters"> <li> <a href="#/" class="selected" class:selected=move || mode() == Mode::All > "All" </a> </li> <li> <a href="#/active" class:selected=move || mode() == Mode::Active> "Active" </a> </li> <li> <a href="#/completed" class:selected=move || mode() == Mode::Completed> "Completed" </a> </li> </ul> <button class="clear-completed hidden" class:hidden=move || todos.with(|t| t.completed() == 0) on:click=move |_| set_todos.update(|t| t.clear_completed()) > "Clear completed" </button> </footer> </section> <footer class="info"> <p>"Double-click to edit a todo"</p> <p>"Created by " <a href="http://todomvc.com">"Greg Johnston"</a></p> <p>"Part of " <a href="http://todomvc.com">"TodoMVC"</a></p> </footer> </main> }.into_view() } #[component] pub fn Todo(todo: Todo) -> impl IntoView { let (editing, set_editing) = create_signal(false); let set_todos = use_context::<WriteSignal<Todos>>().unwrap(); //let input = NodeRef::new(); let save = move |value: &str| { let value = value.trim(); if value.is_empty() { set_todos.update(|t| t.remove(todo.id)); } else { (todo.set_title)(value.to_string()); } set_editing(false); }; view! { <li class="todo" class:editing=editing class:completed=move || (todo.completed)()> <div class="view"> <input class="toggle" type="checkbox" prop:checked=move || (todo.completed)()/> <label on:dblclick=move |_| set_editing(true)>{move || todo.title.get()}</label> <button class="destroy" on:click=move |_| set_todos.update(|t| t.remove(todo.id)) ></button> </div> {move || { editing() .then(|| { view! { <input class="edit" class:hidden=move || !(editing)() prop:value=move || todo.title.get() on:focusout=move |ev| save(&event_target_value(&ev)) on:keyup=move |ev| { let key_code = ev.unchecked_ref::<web_sys::KeyboardEvent>().key_code(); if key_code == ENTER_KEY { save(&event_target_value(&ev)); } else if key_code == ESCAPE_KEY { set_editing(false); } } /> } }) }} </li> } } #[derive(Debug, Clone, Copy, PartialEq, Eq)] pub enum Mode { Active, Completed, All, } impl Default for Mode { fn default() -> Self { Mode::All } } pub fn route(hash: &str) -> Mode { match hash { "/active" => Mode::Active, "/completed" => Mode::Completed, _ => Mode::All, } } #[derive(Serialize, Deserialize)] pub struct TodoSerialized { pub id: usize, pub title: String, pub completed: bool, } impl TodoSerialized { pub fn into_todo(self, ) -> Todo { Todo::new_with_completed(self.id, self.title, self.completed) } } impl From<&Todo> for TodoSerialized { fn from(todo: &Todo) -> Self { Self { id: todo.id, title: todo.title.get(), completed: (todo.completed)(), } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/benchmarks/src/todomvc/yew.rs
benchmarks/src/todomvc/yew.rs
use gloo::storage::{LocalStorage, Storage}; use strum::IntoEnumIterator; use web_sys::HtmlInputElement as InputElement; use yew::events::{FocusEvent, KeyboardEvent}; use yew::html::Scope; use yew::{classes, html, Classes, Component, Context, Html, NodeRef, TargetCast}; const KEY: &str = "yew.todomvc.self"; pub enum Msg { Add(String), Edit((usize, String)), Remove(usize), SetFilter(Filter), ToggleAll, ToggleEdit(usize), Toggle(usize), ClearCompleted, Focus, } pub struct App { state: State, focus_ref: NodeRef, } impl Component for App { type Message = Msg; type Properties = (); fn create(_ctx: &Context<Self>) -> Self { let entries = vec![]; //LocalStorage::get(KEY).unwrap_or_else(|_| Vec::new()); let state = State { entries, filter: Filter::All, edit_value: "".into(), }; let focus_ref = NodeRef::default(); Self { state, focus_ref } } fn update(&mut self, _ctx: &Context<Self>, msg: Self::Message) -> bool { match msg { Msg::Add(description) => { if !description.is_empty() { let entry = Entry { description: description.trim().to_string(), completed: false, editing: false, }; self.state.entries.push(entry); } } Msg::Edit((idx, edit_value)) => { self.state.complete_edit(idx, edit_value.trim().to_string()); self.state.edit_value = "".to_string(); } Msg::Remove(idx) => { self.state.remove(idx); } Msg::SetFilter(filter) => { self.state.filter = filter; } Msg::ToggleEdit(idx) => { let entry = self .state .entries .iter() .filter(|e| self.state.filter.fits(e)) .nth(idx) .unwrap(); self.state.edit_value = entry.description.clone(); self.state.clear_all_edit(); self.state.toggle_edit(idx); } Msg::ToggleAll => { let status = !self.state.is_all_completed(); self.state.toggle_all(status); } Msg::Toggle(idx) => { self.state.toggle(idx); } Msg::ClearCompleted => { self.state.clear_completed(); } Msg::Focus => { if let Some(input) = self.focus_ref.cast::<InputElement>() { input.focus().unwrap(); } } } LocalStorage::set(KEY, &self.state.entries).expect("failed to set"); true } fn view(&self, ctx: &Context<Self>) -> Html { let hidden_class = if self.state.entries.is_empty() { "hidden" } else { "" }; html! { <div class="todomvc-wrapper"> <section class="todoapp"> <header class="header"> <h1>{ "todos" }</h1> { self.view_input(ctx.link()) } </header> <section class={classes!("main", hidden_class)}> <input type="checkbox" class="toggle-all" id="toggle-all" checked={self.state.is_all_completed()} onclick={ctx.link().callback(|_| Msg::ToggleAll)} /> <label for="toggle-all" /> <ul class="todo-list"> { for self.state.entries.iter().filter(|e| self.state.filter.fits(e)).enumerate().map(|e| self.view_entry(e, ctx.link())) } </ul> </section> <footer class={classes!("footer", hidden_class)}> <span class="todo-count"> <strong>{ self.state.total() }</strong> { " item(s) left" } </span> <ul class="filters"> { for Filter::iter().map(|flt| self.view_filter(flt, ctx.link())) } </ul> <button class="clear-completed" onclick={ctx.link().callback(|_| Msg::ClearCompleted)}> { format!("Clear completed ({})", self.state.total_completed()) } </button> </footer> </section> <footer class="info"> <p>{ "Double-click to edit a todo" }</p> <p>{ "Written by " }<a href="https://github.com/DenisKolodin/" target="_blank">{ "Denis Kolodin" }</a></p> <p>{ "Part of " }<a href="http://todomvc.com/" target="_blank">{ "TodoMVC" }</a></p> </footer> </div> } } } impl App { fn view_filter(&self, filter: Filter, link: &Scope<Self>) -> Html { let cls = if self.state.filter == filter { "selected" } else { "not-selected" }; html! { <li> <a class={cls} href={filter.as_href()} onclick={link.callback(move |_| Msg::SetFilter(filter))} > { filter } </a> </li> } } fn view_input(&self, link: &Scope<Self>) -> Html { let onkeypress = link.batch_callback(|e: KeyboardEvent| { if e.key() == "Enter" { let input: InputElement = e.target_unchecked_into(); let value = input.value(); input.set_value(""); Some(Msg::Add(value)) } else { None } }); html! { // You can use standard Rust comments. One line: // <li></li> <input class="new-todo" placeholder="What needs to be done?" {onkeypress} /> /* Or multiline: <ul> <li></li> </ul> */ } } fn view_entry(&self, (idx, entry): (usize, &Entry), link: &Scope<Self>) -> Html { let mut class = Classes::from("todo"); if entry.editing { class.push(" editing"); } if entry.completed { class.push(" completed"); } html! { <li {class}> <div class="view"> <input type="checkbox" class="toggle" checked={entry.completed} onclick={link.callback(move |_| Msg::Toggle(idx))} /> <label ondblclick={link.callback(move |_| Msg::ToggleEdit(idx))}>{ &entry.description }</label> <button class="destroy" onclick={link.callback(move |_| Msg::Remove(idx))} /> </div> { self.view_entry_edit_input((idx, entry), link) } </li> } } fn view_entry_edit_input(&self, (idx, entry): (usize, &Entry), link: &Scope<Self>) -> Html { let edit = move |input: InputElement| { let value = input.value(); input.set_value(""); Msg::Edit((idx, value)) }; let onblur = link.callback(move |e: FocusEvent| edit(e.target_unchecked_into())); let onkeypress = link.batch_callback(move |e: KeyboardEvent| { (e.key() == "Enter").then(|| edit(e.target_unchecked_into())) }); if entry.editing { html! { <input class="edit" type="text" ref={self.focus_ref.clone()} value={self.state.edit_value.clone()} onmouseover={link.callback(|_| Msg::Focus)} {onblur} {onkeypress} /> } } else { html! { <input type="hidden" /> } } } } pub struct AppWith1000 { state: State, focus_ref: NodeRef, } impl Component for AppWith1000 { type Message = Msg; type Properties = (); fn create(_ctx: &Context<Self>) -> Self { let entries = (0..1000) .map(|id| Entry { description: format!("Todo #{id}"), completed: false, editing: false, }) .collect(); let state = State { entries, filter: Filter::All, edit_value: "".into(), }; let focus_ref = NodeRef::default(); Self { state, focus_ref } } fn update(&mut self, _ctx: &Context<Self>, msg: Self::Message) -> bool { match msg { Msg::Add(description) => { if !description.is_empty() { let entry = Entry { description: description.trim().to_string(), completed: false, editing: false, }; self.state.entries.push(entry); } } Msg::Edit((idx, edit_value)) => { self.state.complete_edit(idx, edit_value.trim().to_string()); self.state.edit_value = "".to_string(); } Msg::Remove(idx) => { self.state.remove(idx); } Msg::SetFilter(filter) => { self.state.filter = filter; } Msg::ToggleEdit(idx) => { let entry = self .state .entries .iter() .filter(|e| self.state.filter.fits(e)) .nth(idx) .unwrap(); self.state.edit_value = entry.description.clone(); self.state.clear_all_edit(); self.state.toggle_edit(idx); } Msg::ToggleAll => { let status = !self.state.is_all_completed(); self.state.toggle_all(status); } Msg::Toggle(idx) => { self.state.toggle(idx); } Msg::ClearCompleted => { self.state.clear_completed(); } Msg::Focus => { if let Some(input) = self.focus_ref.cast::<InputElement>() { input.focus().unwrap(); } } } LocalStorage::set(KEY, &self.state.entries).expect("failed to set"); true } fn view(&self, ctx: &Context<Self>) -> Html { let hidden_class = if self.state.entries.is_empty() { "hidden" } else { "" }; html! { <div class="todomvc-wrapper"> <section class="todoapp"> <header class="header"> <h1>{ "todos" }</h1> { self.view_input(ctx.link()) } </header> <section class={classes!("main", hidden_class)}> <input type="checkbox" class="toggle-all" id="toggle-all" checked={self.state.is_all_completed()} onclick={ctx.link().callback(|_| Msg::ToggleAll)} /> <label for="toggle-all" /> <ul class="todo-list"> { for self.state.entries.iter().filter(|e| self.state.filter.fits(e)).enumerate().map(|e| self.view_entry(e, ctx.link())) } </ul> </section> <footer class={classes!("footer", hidden_class)}> <span class="todo-count"> <strong>{ self.state.total() }</strong> { " item(s) left" } </span> <ul class="filters"> { for Filter::iter().map(|flt| self.view_filter(flt, ctx.link())) } </ul> <button class="clear-completed" onclick={ctx.link().callback(|_| Msg::ClearCompleted)}> { format!("Clear completed ({})", self.state.total_completed()) } </button> </footer> </section> <footer class="info"> <p>{ "Double-click to edit a todo" }</p> <p>{ "Written by " }<a href="https://github.com/DenisKolodin/" target="_blank">{ "Denis Kolodin" }</a></p> <p>{ "Part of " }<a href="http://todomvc.com/" target="_blank">{ "TodoMVC" }</a></p> </footer> </div> } } } impl AppWith1000 { fn view_filter(&self, filter: Filter, link: &Scope<Self>) -> Html { let cls = if self.state.filter == filter { "selected" } else { "not-selected" }; html! { <li> <a class={cls} href={filter.as_href()} onclick={link.callback(move |_| Msg::SetFilter(filter))} > { filter } </a> </li> } } fn view_input(&self, link: &Scope<Self>) -> Html { let onkeypress = link.batch_callback(|e: KeyboardEvent| { if e.key() == "Enter" { let input: InputElement = e.target_unchecked_into(); let value = input.value(); input.set_value(""); Some(Msg::Add(value)) } else { None } }); html! { // You can use standard Rust comments. One line: // <li></li> <input class="new-todo" placeholder="What needs to be done?" {onkeypress} /> /* Or multiline: <ul> <li></li> </ul> */ } } fn view_entry(&self, (idx, entry): (usize, &Entry), link: &Scope<Self>) -> Html { let mut class = Classes::from("todo"); if entry.editing { class.push(" editing"); } if entry.completed { class.push(" completed"); } html! { <li {class}> <div class="view"> <input type="checkbox" class="toggle" checked={entry.completed} onclick={link.callback(move |_| Msg::Toggle(idx))} /> <label ondblclick={link.callback(move |_| Msg::ToggleEdit(idx))}>{ &entry.description }</label> <button class="destroy" onclick={link.callback(move |_| Msg::Remove(idx))} /> </div> { self.view_entry_edit_input((idx, entry), link) } </li> } } fn view_entry_edit_input(&self, (idx, entry): (usize, &Entry), link: &Scope<Self>) -> Html { let edit = move |input: InputElement| { let value = input.value(); input.set_value(""); Msg::Edit((idx, value)) }; let onblur = link.callback(move |e: FocusEvent| edit(e.target_unchecked_into())); let onkeypress = link.batch_callback(move |e: KeyboardEvent| { (e.key() == "Enter").then(|| edit(e.target_unchecked_into())) }); if entry.editing { html! { <input class="edit" type="text" ref={self.focus_ref.clone()} value={self.state.edit_value.clone()} onmouseover={link.callback(|_| Msg::Focus)} {onblur} {onkeypress} /> } } else { html! { <input type="hidden" /> } } } } use serde::{Deserialize, Serialize}; use strum_macros::{Display, EnumIter}; #[derive(Debug, Serialize, Deserialize)] pub struct State { pub entries: Vec<Entry>, pub filter: Filter, pub edit_value: String, } impl State { pub fn total(&self) -> usize { self.entries.len() } pub fn total_completed(&self) -> usize { self.entries .iter() .filter(|e| Filter::Completed.fits(e)) .count() } pub fn is_all_completed(&self) -> bool { let mut filtered_iter = self .entries .iter() .filter(|e| self.filter.fits(e)) .peekable(); if filtered_iter.peek().is_none() { return false; } filtered_iter.all(|e| e.completed) } pub fn clear_completed(&mut self) { let entries = self .entries .drain(..) .filter(|e| Filter::Active.fits(e)) .collect(); self.entries = entries; } pub fn toggle(&mut self, idx: usize) { let filter = self.filter; let entry = self .entries .iter_mut() .filter(|e| filter.fits(e)) .nth(idx) .unwrap(); entry.completed = !entry.completed; } pub fn toggle_all(&mut self, value: bool) { for entry in &mut self.entries { if self.filter.fits(entry) { entry.completed = value; } } } pub fn toggle_edit(&mut self, idx: usize) { let filter = self.filter; let entry = self .entries .iter_mut() .filter(|e| filter.fits(e)) .nth(idx) .unwrap(); entry.editing = !entry.editing; } pub fn clear_all_edit(&mut self) { for entry in &mut self.entries { entry.editing = false; } } pub fn complete_edit(&mut self, idx: usize, val: String) { if val.is_empty() { self.remove(idx); } else { let filter = self.filter; let entry = self .entries .iter_mut() .filter(|e| filter.fits(e)) .nth(idx) .unwrap(); entry.description = val; entry.editing = !entry.editing; } } pub fn remove(&mut self, idx: usize) { let idx = { let entries = self .entries .iter() .enumerate() .filter(|&(_, e)| self.filter.fits(e)) .collect::<Vec<_>>(); let &(idx, _) = entries.get(idx).unwrap(); idx }; self.entries.remove(idx); } } #[derive(Debug, Serialize, Deserialize)] pub struct Entry { pub description: String, pub completed: bool, pub editing: bool, } #[derive(Clone, Copy, Debug, EnumIter, Display, PartialEq, Serialize, Deserialize, Eq)] pub enum Filter { All, Active, Completed, } impl Filter { pub fn fits(&self, entry: &Entry) -> bool { match *self { Filter::All => true, Filter::Active => !entry.completed, Filter::Completed => entry.completed, } } pub fn as_href(&self) -> &'static str { match self { Filter::All => "#/", Filter::Active => "#/active", Filter::Completed => "#/completed", } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/benchmarks/src/todomvc/sycamore.rs
benchmarks/src/todomvc/sycamore.rs
use serde::{Deserialize, Serialize}; use sycamore::prelude::*; use uuid::Uuid; use wasm_bindgen::JsCast; use web_sys::{Event, HtmlInputElement, KeyboardEvent}; #[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq, Hash)] pub struct Todo { title: String, completed: bool, id: usize, } #[derive(Debug, Clone, Copy, PartialEq, Eq)] pub enum Filter { All, Active, Completed, } impl Default for Filter { fn default() -> Self { Self::All } } impl Filter { fn url(self) -> &'static str { match self { Filter::All => "#", Filter::Active => "#/active", Filter::Completed => "#/completed", } } fn get_filter_from_hash() -> Self { let hash = web_sys::window().unwrap().location().hash().unwrap(); match hash.as_str() { "#/active" => Filter::Active, "#/completed" => Filter::Completed, _ => Filter::All, } } } #[derive(Debug, Default, Clone)] pub struct AppState { pub todos: RcSignal<Vec<RcSignal<Todo>>>, pub filter: RcSignal<Filter>, } impl AppState { fn add_todo(&self, title: String, id: usize) { self.todos.modify().push(create_rc_signal(Todo { title, completed: false, id, })) } fn remove_todo(&self, id: usize) { self.todos.modify().retain(|todo| todo.get().id != id); } fn todos_left(&self) -> usize { self.todos.get().iter().fold( 0, |acc, todo| if todo.get().completed { acc } else { acc + 1 }, ) } fn toggle_complete_all(&self) { if self.todos_left() == 0 { // make all todos active for todo in self.todos.get().iter() { if todo.get().completed { todo.set(Todo { completed: false, ..todo.get().as_ref().clone() }) } } } else { // make all todos completed for todo in self.todos.get().iter() { if !todo.get().completed { todo.set(Todo { completed: true, ..todo.get().as_ref().clone() }) } } } } fn clear_completed(&self) { self.todos.modify().retain(|todo| !todo.get().completed); } } const KEY: &str = "todos-sycamore"; #[component] pub fn App<G: Html>(cx: Scope) -> View<G> { // Initialize application state let todos = create_rc_signal(Vec::new()); let app_state = AppState { todos, filter: create_rc_signal(Filter::All), }; provide_context(cx, app_state); view! { cx, div(class="todomvc-wrapper") { section(class="todoapp") { Header {} List {} Footer {} } Copyright {} } } } #[component] pub fn AppWith1000<G: Html>(cx: Scope) -> View<G> { // Initialize application state let todos = (0..1000) .map(|id| { create_rc_signal(Todo { title: format!("Todo #{id}"), completed: false, id, }) }) .collect(); let todos = create_rc_signal(todos); let app_state = AppState { todos, filter: create_rc_signal(Filter::All), }; provide_context(cx, app_state); view! { cx, div(class="todomvc-wrapper") { section(class="todoapp") { Header {} List {} Footer {} } Copyright {} } } } #[component] pub fn Copyright<G: Html>(cx: Scope) -> View<G> { view! { cx, footer(class="info") { p { "Double click to edit a todo" } p { "Created by " a(href="https://github.com/lukechu10", target="_blank") { "lukechu10" } } p { "Part of " a(href="http://todomvc.com") { "TodoMVC" } } } } } #[component] pub fn Header<G: Html>(cx: Scope) -> View<G> { let app_state = use_context::<AppState>(cx); let value = create_signal(cx, String::new()); let input_ref = create_node_ref(cx); let handle_submit = |event: Event| { let event: KeyboardEvent = event.unchecked_into(); if event.key() == "Enter" { let mut task = value.get().as_ref().clone(); task = task.trim().to_string(); if !task.is_empty() { app_state.add_todo(task, 0); value.set("".to_string()); input_ref .get::<DomNode>() .unchecked_into::<HtmlInputElement>() .set_value(""); } } }; view! { cx, header(class="header") { h1 { "todos" } input(ref=input_ref, class="new-todo", placeholder="What needs to be done?", bind:value=value, on:keyup=handle_submit, ) } } } #[component(inline_props)] pub fn Item<G: Html>(cx: Scope, todo: RcSignal<Todo>) -> View<G> { let app_state = use_context::<AppState>(cx); // Make `todo` live as long as the scope. let todo = create_ref(cx, todo); let title = || todo.get().title.clone(); let completed = create_selector(cx, || todo.get().completed); let id = todo.get().id; let editing = create_signal(cx, false); let input_ref = create_node_ref(cx); let value = create_signal(cx, "".to_string()); let handle_input = |event: Event| { let target: HtmlInputElement = event.target().unwrap().unchecked_into(); value.set(target.value()); }; let toggle_completed = |_| { todo.set(Todo { completed: !todo.get().completed, ..todo.get().as_ref().clone() }); }; let handle_dblclick = move |_| { editing.set(true); input_ref .get::<DomNode>() .unchecked_into::<HtmlInputElement>() .focus() .unwrap(); value.set(title()); }; let handle_blur = move || { editing.set(false); let mut value = value.get().as_ref().clone(); value = value.trim().to_string(); if value.is_empty() { app_state.remove_todo(id); } else { todo.set(Todo { title: value, ..todo.get().as_ref().clone() }) } }; let handle_submit = move |event: Event| { let event: KeyboardEvent = event.unchecked_into(); match event.key().as_str() { "Enter" => handle_blur(), "Escape" => { input_ref .get::<DomNode>() .unchecked_into::<HtmlInputElement>() .set_value(&title()); editing.set(false); } _ => {} } }; let handle_destroy = move |_| { app_state.remove_todo(id); }; // We need a separate signal for checked because clicking the checkbox will detach the binding // between the attribute and the view. let checked = create_signal(cx, false); create_effect(cx, || { // Calling checked.set will also update the `checked` property on the input element. checked.set(*completed.get()) }); let class = || { format!( "{} {}", if *completed.get() { "completed" } else { "" }, if *editing.get() { "editing" } else { "" } ) }; view! { cx, li(class=class()) { div(class="view") { input( class="toggle", type="checkbox", on:input=toggle_completed, bind:checked=checked ) label(on:dblclick=handle_dblclick) { (title()) } button(class="destroy", on:click=handle_destroy) } (if *editing.get() { view! { cx, input(ref=input_ref, class="edit", prop:value=&todo.get().title, on:blur=move |_| handle_blur(), on:keyup=handle_submit, on:input=handle_input, ) } } else { View::empty() }) } } } #[component] pub fn List<G: Html>(cx: Scope) -> View<G> { let app_state = use_context::<AppState>(cx); let todos_left = create_selector(cx, || app_state.todos_left()); let filtered_todos = create_memo(cx, || { app_state .todos .get() .iter() .filter(|todo| match *app_state.filter.get() { Filter::All => true, Filter::Active => !todo.get().completed, Filter::Completed => todo.get().completed, }) .cloned() .collect::<Vec<_>>() }); // We need a separate signal for checked because clicking the checkbox will detach the binding // between the attribute and the view. let checked = create_signal(cx, false); create_effect(cx, || { // Calling checked.set will also update the `checked` property on the input element. checked.set(*todos_left.get() == 0) }); view! { cx, section(class="main") { input( id="toggle-all", class="toggle-all", type="checkbox", readonly=true, bind:checked=checked, on:input=|_| app_state.toggle_complete_all() ) label(for="toggle-all") ul(class="todo-list") { Keyed( iterable=filtered_todos, view=|cx, todo| view! { cx, Item(todo=todo) }, key=|todo| todo.get().id, ) } } } } #[component(inline_props)] pub fn TodoFilter<G: Html>(cx: Scope, filter: Filter) -> View<G> { let app_state = use_context::<AppState>(cx); let selected = move || filter == *app_state.filter.get(); let set_filter = |filter| app_state.filter.set(filter); view! { cx, li { a( class=if selected() { "selected" } else { "" }, href=filter.url(), on:click=move |_| set_filter(filter), ) { (format!("{filter:?}")) } } } } #[component] pub fn Footer<G: Html>(cx: Scope) -> View<G> { let app_state = use_context::<AppState>(cx); let items_text = || match app_state.todos_left() { 1 => "item", _ => "items", }; let has_completed_todos = create_selector(cx, || app_state.todos_left() < app_state.todos.get().len()); let handle_clear_completed = |_| app_state.clear_completed(); view! { cx, footer(class="footer") { span(class="todo-count") { strong { (app_state.todos_left()) } span { " " (items_text()) " left" } } ul(class="filters") { TodoFilter(filter=Filter::All) TodoFilter(filter=Filter::Active) TodoFilter(filter=Filter::Completed) } (if *has_completed_todos.get() { view! { cx, button(class="clear-completed", on:click=handle_clear_completed) { "Clear completed" } } } else { view! { cx, } }) } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/benchmarks/src/todomvc/tera.rs
benchmarks/src/todomvc/tera.rs
use test::Bencher; static TEMPLATE: &str = r#"<main> <section class="todoapp"> <header class="header"> <h1>"todos"</h1> <input class="new-todo" placeholder="What needs to be done? /> </header> <section class="main" class={{ main_class }}> <input id="toggle-all" class="toggle-all" type="checkbox" checked={{ toggle_checked }} /> <label for="toggle-all">"Mark all as complete"</label> <ul class="todo-list"> {% for todo in todos %} <li class={{ todo.class }} > <div class="view"> <input class="toggle" type="checkbox" checked={{ todo.completed }} /> <label> {{ todo.label }} </label> <button class="destroy"/> </div> {% if todo.editing %} <input class="edit" value={{ todo.label }} /> {% endif %} </li> {% endfor %} </ul> </section> {% if todos_empty %} {% else %} <footer class="footer"> <span class="todo-count"> <strong>{{ todos_remaining }}</strong> {% if todos_remaining == 1 %} item {% else %} items {% endif %} left </span> <ul class="filters"> {% if mode_all %} <li><a href="/" class="selected">All</a></li> {% else %} <li><a href="/">All</a></li> {% endif %} {% if mode_active %} <li><a href="/active" class="selected">Active</a></li> {% else %} <li><a href="/active">Active</a></li> {% endif %} {% if mode_completed %} <li><a href="/completed" class="selected">Completed</a></li> {% else %} <li><a href="/completed">Completed</a></li> {% endif %} </ul> {% if todos_completed > 0 %} <button class="clear-completed hidden" > Clear completed </button> {% endif %} </footer> {% endif %} </section> <footer class="info"> <p>"Double-click to edit a todo"</p> <p>"Created by "<a href="http://todomvc.com">"Greg Johnston"</a></p> <p>"Part of "<a href="http://todomvc.com">"TodoMVC"</a></p> </footer> </main>"#; #[bench] fn tera_todomvc_ssr(b: &mut Bencher) { use serde::{Deserialize, Serialize}; use tera::*; static LazyLock<TERA>: Tera = LazyLock( || { let mut tera = Tera::default(); tera.add_raw_templates(vec![("template.html", TEMPLATE)]).unwrap(); tera }); #[derive(Serialize, Deserialize)] struct Todo { label: String, completed: bool, editing: bool, class: String, } b.iter(|| { let mut ctx = Context::new(); let todos = Vec::<Todo>::new(); let remaining = todos.iter().filter(|todo| !todo.completed).count(); let completed = todos.iter().filter(|todo| todo.completed).count(); ctx.insert("todos", &todos); ctx.insert("main_class", &if todos.is_empty() { "hidden" } else { "" }); ctx.insert("toggle_checked", &(remaining > 0)); ctx.insert("todos_remaining", &remaining); ctx.insert("todos_completed", &completed); ctx.insert("todos_empty", &todos.is_empty()); ctx.insert("mode_all", &true); ctx.insert("mode_active", &false); ctx.insert("mode_selected", &false); let _ = TERA.render("template.html", &ctx).unwrap(); }); } #[bench] fn tera_todomvc_ssr_1000(b: &mut Bencher) { use serde::{Deserialize, Serialize}; use tera::*; static TERA: LazyLock<Tera> = LazyLock::new(|| { let mut tera = Tera::default(); tera.add_raw_templates(vec![("template.html", TEMPLATE)]).unwrap(); tera }); #[derive(Serialize, Deserialize)] struct Todo { id: usize, label: String, completed: bool, editing: bool, class: String, } b.iter(|| { let mut ctx = Context::new(); let todos = (0..1000) .map(|id| Todo { id, label: format!("Todo #{id}"), completed: false, editing: false, class: "todo".to_string(), }) .collect::<Vec<_>>(); let remaining = todos.iter().filter(|todo| !todo.completed).count(); let completed = todos.iter().filter(|todo| todo.completed).count(); ctx.insert("todos", &todos); ctx.insert("main_class", &if todos.is_empty() { "hidden" } else { "" }); ctx.insert("toggle_checked", &(remaining > 0)); ctx.insert("todos_remaining", &remaining); ctx.insert("todos_completed", &completed); ctx.insert("todos_empty", &todos.is_empty()); ctx.insert("mode_all", &true); ctx.insert("mode_active", &false); ctx.insert("mode_selected", &false); let _ = TERA.render("template.html", &ctx).unwrap(); }); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/benchmarks/src/todomvc/mod.rs
benchmarks/src/todomvc/mod.rs
use test::Bencher; mod leptos; mod sycamore; mod tachys; mod tera; mod yew; #[bench] fn leptos_todomvc_ssr(b: &mut Bencher) { use ::leptos::*; let runtime = create_runtime(); b.iter(|| { use crate::todomvc::leptos::*; let html = ::leptos::ssr::render_to_string(|| { view! { <TodoMVC todos=Todos::new()/> } }); assert!(html.len() > 1); }); runtime.dispose(); } #[bench] fn tachys_todomvc_ssr(b: &mut Bencher) { use ::leptos::*; let runtime = create_runtime(); b.iter(|| { use crate::todomvc::tachys::*; use tachydom::view::{Render, RenderHtml}; let rendered = TodoMVC(Todos::new()).to_html(); assert_eq!( rendered, "<main><section class=\"todoapp\"><header class=\"header\"><h1>todos</h1><input placeholder=\"What needs to be done?\" autofocus class=\"new-todo\"></header><section class=\"main hidden\"><input id=\"toggle-all\" type=\"checkbox\" class=\"toggle-all\"><label for=\"toggle-all\">Mark all as complete</label><ul class=\"todo-list\"></ul></section><footer class=\"footer hidden\"><span class=\"todo-count\"><strong>0</strong><!> items<!> left</span><ul class=\"filters\"><li><a href=\"#/\" class=\"selected selected\">All</a></li><li><a href=\"#/active\" class=\"\">Active</a></li><li><a href=\"#/completed\" class=\"\">Completed</a></li></ul><button class=\"clear-completed hidden hidden\">Clear completed</button></footer></section><footer class=\"info\"><p>Double-click to edit a todo</p><p>Created by <a href=\"http://todomvc.com\">Greg Johnston</a></p><p>Part of <a href=\"http://todomvc.com\">TodoMVC</a></p></footer></main>" ); }); runtime.dispose(); } #[bench] fn sycamore_todomvc_ssr(b: &mut Bencher) { use self::sycamore::*; use ::sycamore::{prelude::*, *}; b.iter(|| { _ = create_scope(|cx| { let rendered = render_to_string(|cx| { view! { cx, App() } }); assert!(rendered.len() > 1); }); }); } #[bench] fn yew_todomvc_ssr(b: &mut Bencher) { use self::yew::*; use ::yew::{prelude::*, ServerRenderer}; b.iter(|| { tokio_test::block_on(async { let renderer = ServerRenderer::<App>::new(); let rendered = renderer.render().await; assert!(rendered.len() > 1); }); }); } #[bench] fn leptos_todomvc_ssr_with_1000(b: &mut Bencher) { b.iter(|| { use self::leptos::*; use ::leptos::*; let html = ::leptos::ssr::render_to_string(|| { view! { <TodoMVC todos=Todos::new_with_1000()/> } }); assert!(html.len() > 1); }); } #[bench] fn tachys_todomvc_ssr_with_1000(b: &mut Bencher) { use ::leptos::*; let runtime = create_runtime(); b.iter(|| { use crate::todomvc::tachys::*; use tachydom::view::{Render, RenderHtml}; let rendered = TodoMVC(Todos::new_with_1000()).to_html(); assert!(rendered.len() > 20_000) }); runtime.dispose(); } #[bench] fn sycamore_todomvc_ssr_with_1000(b: &mut Bencher) { use self::sycamore::*; use ::sycamore::{prelude::*, *}; b.iter(|| { _ = create_scope(|cx| { let rendered = render_to_string(|cx| { view! { cx, AppWith1000() } }); assert!(rendered.len() > 1); }); }); } #[bench] fn yew_todomvc_ssr_with_1000(b: &mut Bencher) { use self::yew::*; use ::yew::{prelude::*, ServerRenderer}; b.iter(|| { tokio_test::block_on(async { let renderer = ServerRenderer::<AppWith1000>::new(); let rendered = renderer.render().await; assert!(rendered.len() > 1); }); }); } #[bench] fn tera_todomvc_ssr(b: &mut Bencher) { use ::leptos::*; let runtime = create_runtime(); b.iter(|| { use crate::todomvc::leptos::*; let html = ::leptos::ssr::render_to_string(|| { view! { <TodoMVC todos=Todos::new()/> } }); assert!(html.len() > 1); }); runtime.dispose(); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/benchmarks/src/todomvc/tachys.rs
benchmarks/src/todomvc/tachys.rs
pub use leptos_reactive::*; use miniserde::*; use tachy_maccy::view; use tachydom::{ html::{ attribute::global::{ClassAttribute, GlobalAttributes, OnAttribute}, element::ElementChild, }, renderer::dom::Dom, view::{keyed::keyed, Render, RenderHtml}, }; use wasm_bindgen::JsCast; use web_sys::HtmlInputElement; #[derive(Debug, Clone, PartialEq, Eq)] pub struct Todos(pub Vec<Todo>); const STORAGE_KEY: &str = "todos-leptos"; impl Todos { pub fn new() -> Self { Self(vec![]) } pub fn new_with_1000() -> Self { let todos = (0..1000) .map(|id| Todo::new(id, format!("Todo #{id}"))) .collect(); Self(todos) } pub fn is_empty(&self) -> bool { self.0.is_empty() } pub fn add(&mut self, todo: Todo) { self.0.push(todo); } pub fn remove(&mut self, id: usize) { self.0.retain(|todo| todo.id != id); } pub fn remaining(&self) -> usize { self.0.iter().filter(|todo| !(todo.completed)()).count() } pub fn completed(&self) -> usize { self.0.iter().filter(|todo| (todo.completed)()).count() } pub fn toggle_all(&self) { // if all are complete, mark them all active instead if self.remaining() == 0 { for todo in &self.0 { if todo.completed.get() { (todo.set_completed)(false); } } } // otherwise, mark them all complete else { for todo in &self.0 { (todo.set_completed)(true); } } } fn clear_completed(&mut self) { self.0.retain(|todo| !todo.completed.get()); } } #[derive(Debug, PartialEq, Eq, Clone)] pub struct Todo { pub id: usize, pub title: ReadSignal<String>, pub set_title: WriteSignal<String>, pub completed: ReadSignal<bool>, pub set_completed: WriteSignal<bool>, } impl Todo { pub fn new(id: usize, title: String) -> Self { Self::new_with_completed(id, title, false) } pub fn new_with_completed( id: usize, title: String, completed: bool, ) -> Self { let (title, set_title) = create_signal(title); let (completed, set_completed) = create_signal(completed); Self { id, title, set_title, completed, set_completed, } } pub fn toggle(&self) { self.set_completed .update(|completed| *completed = !*completed); } } const ESCAPE_KEY: u32 = 27; const ENTER_KEY: u32 = 13; pub fn TodoMVC(todos: Todos) -> impl Render<Dom> + RenderHtml<Dom> { let mut next_id = todos .0 .iter() .map(|todo| todo.id) .max() .map(|last| last + 1) .unwrap_or(0); let (todos, set_todos) = create_signal(todos); provide_context(set_todos); let (mode, set_mode) = create_signal(Mode::All); let add_todo = move |ev: web_sys::KeyboardEvent| { todo!() /* let target = event_target::<HtmlInputElement>(&ev); ev.stop_propagation(); let key_code = ev.unchecked_ref::<web_sys::KeyboardEvent>().key_code(); if key_code == ENTER_KEY { let title = event_target_value(&ev); let title = title.trim(); if !title.is_empty() { let new = Todo::new(next_id, title.to_string()); set_todos.update(|t| t.add(new)); next_id += 1; target.set_value(""); } } */ }; let filtered_todos = create_memo::<Vec<Todo>>(move |_| { todos.with(|todos| match mode.get() { Mode::All => todos.0.to_vec(), Mode::Active => todos .0 .iter() .filter(|todo| !todo.completed.get()) .cloned() .collect(), Mode::Completed => todos .0 .iter() .filter(|todo| todo.completed.get()) .cloned() .collect(), }) }); // effect to serialize to JSON // this does reactive reads, so it will automatically serialize on any relevant change create_effect(move |_| { () /* if let Ok(Some(storage)) = window().local_storage() { let objs = todos .get() .0 .iter() .map(TodoSerialized::from) .collect::<Vec<_>>(); let json = json::to_string(&objs); if storage.set_item(STORAGE_KEY, &json).is_err() { log::error!("error while trying to set item in localStorage"); } } */ }); view! { <main> <section class="todoapp"> <header class="header"> <h1>"todos"</h1> <input class="new-todo" placeholder="What needs to be done?" autofocus /> </header> <section class="main" class:hidden=move || todos.with(|t| t.is_empty())> <input id="toggle-all" class="toggle-all" r#type="checkbox" //prop:checked=move || todos.with(|t| t.remaining() > 0) on:input=move |_| set_todos.update(|t| t.toggle_all()) /> <label r#for="toggle-all">"Mark all as complete"</label> <ul class="todo-list"> {move || { keyed(filtered_todos.get(), |todo| todo.id, Todo) }} </ul> </section> <footer class="footer" class:hidden=move || todos.with(|t| t.is_empty())> <span class="todo-count"> <strong>{move || todos.with(|t| t.remaining().to_string())}</strong> {move || if todos.with(|t| t.remaining()) == 1 { " item" } else { " items" }} " left" </span> <ul class="filters"> <li> <a href="#/" class="selected" class:selected=move || mode() == Mode::All > "All" </a> </li> <li> <a href="#/active" class:selected=move || mode() == Mode::Active> "Active" </a> </li> <li> <a href="#/completed" class:selected=move || mode() == Mode::Completed> "Completed" </a> </li> </ul> <button class="clear-completed hidden" class:hidden=move || todos.with(|t| t.completed() == 0) on:click=move |_| set_todos.update(|t| t.clear_completed()) > "Clear completed" </button> </footer> </section> <footer class="info"> <p>"Double-click to edit a todo"</p> <p>"Created by " <a href="http://todomvc.com">"Greg Johnston"</a></p> <p>"Part of " <a href="http://todomvc.com">"TodoMVC"</a></p> </footer> </main> } } pub fn Todo(todo: Todo) -> impl Render<Dom> + RenderHtml<Dom> { let (editing, set_editing) = create_signal(false); let set_todos = use_context::<WriteSignal<Todos>>().unwrap(); //let input = NodeRef::new(); let save = move |value: &str| { let value = value.trim(); if value.is_empty() { set_todos.update(|t| t.remove(todo.id)); } else { (todo.set_title)(value.to_string()); } set_editing(false); }; view! { <li class="todo" class:editing=editing class:completed=move || (todo.completed)()> /* <div class="view"> <input class="toggle" r#type="checkbox"/> <label on:dblclick=move |_| set_editing(true)>{move || todo.title.get()}</label> <button class="destroy" on:click=move |_| set_todos.update(|t| t.remove(todo.id)) ></button> </div> {move || { editing() .then(|| { view! { <input class="edit" class:hidden=move || !(editing)() /> } }) }} */ </li> } } #[derive(Debug, Clone, Copy, PartialEq, Eq)] pub enum Mode { Active, Completed, All, } impl Default for Mode { fn default() -> Self { Mode::All } } pub fn route(hash: &str) -> Mode { match hash { "/active" => Mode::Active, "/completed" => Mode::Completed, _ => Mode::All, } } #[derive(Serialize, Deserialize)] pub struct TodoSerialized { pub id: usize, pub title: String, pub completed: bool, } impl TodoSerialized { pub fn into_todo(self) -> Todo { Todo::new_with_completed(self.id, self.title, self.completed) } } impl From<&Todo> for TodoSerialized { fn from(todo: &Todo) -> Self { Self { id: todo.id, title: todo.title.get(), completed: (todo.completed)(), } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/field.rs
reactive_stores/src/field.rs
use crate::{ arc_field::{StoreFieldReader, StoreFieldWriter}, path::{StorePath, StorePathSegment}, ArcField, ArcStore, AtIndex, AtKeyed, DerefedField, KeyMap, KeyedSubfield, Store, StoreField, StoreFieldTrigger, Subfield, }; use reactive_graph::{ owner::{ArenaItem, Storage, SyncStorage}, traits::{ DefinedAt, IsDisposed, Notify, ReadUntracked, Track, UntrackableGuard, Write, }, }; use std::{ fmt::Debug, hash::Hash, ops::{Deref, DerefMut, IndexMut}, panic::Location, }; /// Wraps access to a single field of type `T`. /// /// This can be used to erase the chain of field-accessors, to make it easier to pass this into /// another component or function without needing to specify the full type signature. pub struct Field<T, S = SyncStorage> where T: 'static, { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, inner: ArenaItem<ArcField<T>, S>, } impl<T, S> Debug for Field<T, S> where T: 'static, S: Debug, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { let mut f = f.debug_struct("Field"); #[cfg(any(debug_assertions, leptos_debuginfo))] let f = f.field("defined_at", &self.defined_at); f.field("inner", &self.inner).finish() } } impl<T, S> StoreField for Field<T, S> where S: Storage<ArcField<T>>, { type Value = T; type Reader = StoreFieldReader<T>; type Writer = StoreFieldWriter<T>; fn get_trigger(&self, path: StorePath) -> StoreFieldTrigger { self.inner .try_get_value() .map(|inner| inner.get_trigger(path)) .unwrap_or_default() } fn get_trigger_unkeyed(&self, path: StorePath) -> StoreFieldTrigger { self.inner .try_get_value() .map(|inner| inner.get_trigger_unkeyed(path)) .unwrap_or_default() } fn path(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner .try_get_value() .map(|inner| inner.path().into_iter().collect::<Vec<_>>()) .unwrap_or_default() } fn path_unkeyed(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner .try_get_value() .map(|inner| inner.path_unkeyed().into_iter().collect::<Vec<_>>()) .unwrap_or_default() } fn reader(&self) -> Option<Self::Reader> { self.inner.try_get_value().and_then(|inner| inner.reader()) } fn writer(&self) -> Option<Self::Writer> { self.inner.try_get_value().and_then(|inner| inner.writer()) } fn keys(&self) -> Option<KeyMap> { self.inner.try_get_value().and_then(|n| n.keys()) } } impl<T, S> From<Store<T, S>> for Field<T, S> where T: 'static, S: Storage<ArcStore<T>> + Storage<ArcField<T>>, { #[track_caller] fn from(value: Store<T, S>) -> Self { Field { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(value.into()), } } } impl<T, S> From<ArcField<T>> for Field<T, S> where T: 'static, S: Storage<ArcField<T>>, { #[track_caller] fn from(value: ArcField<T>) -> Self { Field { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(value), } } } impl<T, S> From<ArcStore<T>> for Field<T, S> where T: Send + Sync + 'static, S: Storage<ArcStore<T>> + Storage<ArcField<T>>, { #[track_caller] fn from(value: ArcStore<T>) -> Self { Field { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(value.into()), } } } impl<Inner, Prev, T, S> From<Subfield<Inner, Prev, T>> for Field<T, S> where T: Send + Sync, S: Storage<ArcField<T>>, Subfield<Inner, Prev, T>: Clone, Inner: StoreField<Value = Prev> + Send + Sync + 'static, Prev: 'static, { #[track_caller] fn from(value: Subfield<Inner, Prev, T>) -> Self { Field { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(value.into()), } } } impl<Inner, T> From<DerefedField<Inner>> for Field<T> where Inner: Clone + StoreField + Send + Sync + 'static, Inner::Value: Deref<Target = T> + DerefMut, T: Sized + 'static, { #[track_caller] fn from(value: DerefedField<Inner>) -> Self { Field { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(value.into()), } } } impl<Inner, Prev, S> From<AtIndex<Inner, Prev>> for Field<Prev::Output, S> where AtIndex<Inner, Prev>: Clone, S: Storage<ArcField<Prev::Output>>, Inner: StoreField<Value = Prev> + Send + Sync + 'static, Prev: IndexMut<usize> + Send + Sync + 'static, Prev::Output: Sized + Send + Sync, { #[track_caller] fn from(value: AtIndex<Inner, Prev>) -> Self { Field { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(value.into()), } } } impl<Inner, Prev, K, T, S> From<AtKeyed<Inner, Prev, K, T>> for Field<T::Output, S> where S: Storage<ArcField<T::Output>>, AtKeyed<Inner, Prev, K, T>: Clone, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev> + Send + Sync + 'static, Prev: 'static, T: IndexMut<usize> + 'static, T::Output: Sized, { #[track_caller] fn from(value: AtKeyed<Inner, Prev, K, T>) -> Self { Field { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(value.into()), } } } impl<T, S> Clone for Field<T, S> { fn clone(&self) -> Self { *self } } impl<T, S> Copy for Field<T, S> {} impl<T, S> DefinedAt for Field<T, S> { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T, S> Notify for Field<T, S> where S: Storage<ArcField<T>>, { fn notify(&self) { if let Some(inner) = self.inner.try_get_value() { inner.notify(); } } } impl<T, S> Track for Field<T, S> where S: Storage<ArcField<T>>, { fn track(&self) { if let Some(inner) = self.inner.try_get_value() { inner.track(); } } } impl<T, S> ReadUntracked for Field<T, S> where S: Storage<ArcField<T>>, { type Value = StoreFieldReader<T>; fn try_read_untracked(&self) -> Option<Self::Value> { self.inner .try_get_value() .and_then(|inner| inner.try_read_untracked()) } } impl<T> Write for Field<T> { type Value = T; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { self.inner.try_get_value().and_then(|inner| (inner.write)()) } fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { self.inner.try_get_value().and_then(|inner| { let mut guard = (inner.write)()?; guard.untrack(); Some(guard) }) } } impl<T, S> IsDisposed for Field<T, S> { fn is_disposed(&self) -> bool { self.inner.is_disposed() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/subfield.rs
reactive_stores/src/subfield.rs
use crate::{ path::{StorePath, StorePathSegment}, store_field::StoreField, KeyMap, StoreFieldTrigger, }; use reactive_graph::{ signal::{ guards::{Mapped, MappedMut, WriteGuard}, ArcTrigger, }, traits::{ DefinedAt, Get as _, IsDisposed, Notify, ReadUntracked, Track, UntrackableGuard, Write, }, wrappers::read::Signal, }; use std::{iter, marker::PhantomData, ops::DerefMut, panic::Location}; /// Accesses a single field of a reactive structure. #[derive(Debug)] pub struct Subfield<Inner, Prev, T> { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, path_segment: StorePathSegment, inner: Inner, read: fn(&Prev) -> &T, write: fn(&mut Prev) -> &mut T, ty: PhantomData<T>, } impl<Inner, Prev, T> Clone for Subfield<Inner, Prev, T> where Inner: Clone, { fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, path_segment: self.path_segment, inner: self.inner.clone(), read: self.read, write: self.write, ty: self.ty, } } } impl<Inner, Prev, T> Copy for Subfield<Inner, Prev, T> where Inner: Copy {} impl<Inner, Prev, T> Subfield<Inner, Prev, T> { /// Creates an accessor for a single field of the inner structure. #[track_caller] pub fn new( inner: Inner, path_segment: StorePathSegment, read: fn(&Prev) -> &T, write: fn(&mut Prev) -> &mut T, ) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner, path_segment, read, write, ty: PhantomData, } } } impl<Inner, Prev, T> StoreField for Subfield<Inner, Prev, T> where Inner: StoreField<Value = Prev>, Prev: 'static, { type Value = T; type Reader = Mapped<Inner::Reader, T>; type Writer = MappedMut<WriteGuard<Vec<ArcTrigger>, Inner::Writer>, T>; fn path(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner .path() .into_iter() .chain(iter::once(self.path_segment)) } fn path_unkeyed(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner .path_unkeyed() .into_iter() .chain(iter::once(self.path_segment)) } fn get_trigger(&self, path: StorePath) -> StoreFieldTrigger { self.inner.get_trigger(path) } fn get_trigger_unkeyed(&self, path: StorePath) -> StoreFieldTrigger { self.inner.get_trigger_unkeyed(path) } fn reader(&self) -> Option<Self::Reader> { let inner = self.inner.reader()?; Some(Mapped::new_with_guard(inner, self.read)) } fn writer(&self) -> Option<Self::Writer> { let mut parent = self.inner.writer()?; // we will manually include all the parent and ancestor `children` triggers // in triggers_for_current_path() below. we want to untrack the parent writer // so that it doesn't notify on the parent's `this` trigger, which would notify our // siblings too parent.untrack(); let triggers = self.triggers_for_current_path(); let guard = WriteGuard::new(triggers, parent); Some(MappedMut::new(guard, self.read, self.write)) } #[inline(always)] fn keys(&self) -> Option<KeyMap> { self.inner.keys() } #[track_caller] fn track_field(&self) { let mut full_path = self.path().into_iter().collect::<StorePath>(); let trigger = self.get_trigger(self.path().into_iter().collect()); trigger.this.track(); trigger.children.track(); // tracks `this` for all ancestors: i.e., it will track any change that is made // directly to one of its ancestors, but not a change made to a *child* of an ancestor // (which would end up with every subfield tracking its own siblings, because they are // children of its parent) while !full_path.is_empty() { full_path.pop(); let inner = self.get_trigger(full_path.clone()); inner.this.track(); } } } impl<Inner, Prev, T> DefinedAt for Subfield<Inner, Prev, T> where Inner: StoreField<Value = Prev>, { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<Inner, Prev, T> IsDisposed for Subfield<Inner, Prev, T> where Inner: IsDisposed, { fn is_disposed(&self) -> bool { self.inner.is_disposed() } } impl<Inner, Prev, T> Notify for Subfield<Inner, Prev, T> where Inner: StoreField<Value = Prev>, Prev: 'static, { #[track_caller] fn notify(&self) { let trigger = self.get_trigger(self.path().into_iter().collect()); trigger.this.notify(); trigger.children.notify(); } } impl<Inner, Prev, T> Track for Subfield<Inner, Prev, T> where Inner: StoreField<Value = Prev> + Track + 'static, Prev: 'static, T: 'static, { #[track_caller] fn track(&self) { self.track_field(); } } impl<Inner, Prev, T> ReadUntracked for Subfield<Inner, Prev, T> where Inner: StoreField<Value = Prev>, Prev: 'static, { type Value = <Self as StoreField>::Reader; fn try_read_untracked(&self) -> Option<Self::Value> { self.reader() } } impl<Inner, Prev, T> Write for Subfield<Inner, Prev, T> where T: 'static, Inner: StoreField<Value = Prev>, Prev: 'static, { type Value = T; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { self.writer() } fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { self.writer().map(|mut writer| { writer.untrack(); writer }) } } impl<Inner, Prev, T> From<Subfield<Inner, Prev, T>> for Signal<T> where Inner: StoreField<Value = Prev> + Track + Send + Sync + 'static, Prev: 'static, T: Send + Sync + Clone + 'static, { fn from(subfield: Subfield<Inner, Prev, T>) -> Self { Signal::derive(move || subfield.get()) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/path.rs
reactive_stores/src/path.rs
/// The path of a field within some store. #[derive(Clone, Debug, Default, PartialEq, Eq, Hash)] pub struct StorePath(Vec<StorePathSegment>); impl IntoIterator for StorePath { type Item = StorePathSegment; type IntoIter = std::vec::IntoIter<StorePathSegment>; fn into_iter(self) -> Self::IntoIter { self.0.into_iter() } } impl<'a> IntoIterator for &'a StorePath { type Item = &'a StorePathSegment; type IntoIter = std::slice::Iter<'a, StorePathSegment>; fn into_iter(self) -> Self::IntoIter { self.0.iter() } } impl From<Vec<StorePathSegment>> for StorePath { fn from(value: Vec<StorePathSegment>) -> Self { Self(value) } } impl StorePath { /// Creates a new path. pub fn new() -> Self { Self(Vec::new()) } /// Creates a new path with storage capacity for `capacity` segments. pub fn with_capacity(capacity: usize) -> Self { Self(Vec::with_capacity(capacity)) } /// Adds a new segment to the path. pub fn push(&mut self, segment: impl Into<StorePathSegment>) { self.0.push(segment.into()); } /// Removes a segment from the path and returns it. pub fn pop(&mut self) -> Option<StorePathSegment> { self.0.pop() } /// Updates the last segment in the place in place. pub fn replace_last(&mut self, segment: impl Into<StorePathSegment>) { if let Some(last) = self.0.last_mut() { *last = segment.into(); } } /// Returns `true` if the path contains no elements. pub fn is_empty(&self) -> bool { self.0.is_empty() } /// Returns the number of elements in the path. pub fn len(&self) -> usize { self.0.len() } } /// One segment of a [`StorePath`]. #[derive(Copy, Clone, Debug, PartialEq, Eq, Hash)] pub struct StorePathSegment(pub(crate) usize); impl From<usize> for StorePathSegment { fn from(value: usize) -> Self { Self(value) } } impl From<&usize> for StorePathSegment { fn from(value: &usize) -> Self { Self(*value) } } impl FromIterator<StorePathSegment> for StorePath { fn from_iter<T: IntoIterator<Item = StorePathSegment>>(iter: T) -> Self { Self(Vec::from_iter(iter)) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/lib.rs
reactive_stores/src/lib.rs
#![forbid(unsafe_code)] #![deny(missing_docs)] //! Stores are a primitive for creating deeply-nested reactive state, based on [`reactive_graph`]. //! //! Reactive signals allow you to define atomic units of reactive state. However, signals are //! imperfect as a mechanism for tracking reactive change in structs or collections, because //! they do not allow you to track access to individual struct fields or individual items in a //! collection, rather than the struct as a whole or the collection as a whole. Reactivity for //! individual fields can be achieved by creating a struct of signals, but this has issues; it //! means that a struct is no longer a plain data structure, but requires wrappers on each field. //! //! Stores attempt to solve this problem by allowing arbitrarily-deep access to the fields of some //! data structure, while still maintaining fine-grained reactivity. //! //! The [`Store`](macro@Store) macro adds getters and setters for the fields of a struct. Call those getters or //! setters on a reactive [`Store`](struct@Store) or [`ArcStore`], or to a subfield, gives you //! access to a reactive subfield. This value of this field can be accessed via the ordinary signal //! traits (`Get`, `Set`, and so on). //! //! The [`Patch`](macro@Patch) macro allows you to annotate a struct such that stores and fields have a //! [`.patch()`](Patch::patch) method, which allows you to provide an entirely new value, but only //! notify fields that have changed. //! //! Updating a field will notify its parents and children, but not its siblings. //! //! Stores can therefore //! 1) work with plain Rust data types, and //! 2) provide reactive access to individual fields //! //! ### Example //! //! ```rust //! use reactive_graph::{ //! effect::Effect, //! traits::{Read, Write}, //! }; //! use reactive_stores::{Patch, Store}; //! //! #[derive(Debug, Store, Patch, Default)] //! struct Todos { //! user: String, //! todos: Vec<Todo>, //! } //! //! #[derive(Debug, Store, Patch, Default)] //! struct Todo { //! label: String, //! completed: bool, //! } //! //! let store = Store::new(Todos { //! user: "Alice".to_string(), //! todos: Vec::new(), //! }); //! //! # if false { // don't run effect in doctests //! Effect::new(move |_| { //! // you can access individual store fields with a getter //! println!("user: {:?}", &*store.user().read()); //! }); //! # } //! //! // won't notify the effect that listens to `user` //! store.todos().write().push(Todo { //! label: "Test".to_string(), //! completed: false, //! }); //! ``` //! ### Generated traits //! The [`Store`](macro@Store) macro generates traits for each `struct` to which it is applied. When working //! within a single file or module, this is not an issue. However, when working with multiple modules //! or files, one needs to `use` the generated traits. The general pattern is that for each `struct` //! named `Foo`, the macro generates a trait named `FooStoreFields`. For example: //! ```rust //! pub mod foo { //! use reactive_stores::Store; //! #[derive(Store)] //! pub struct Foo { //! field: i32, //! } //! } //! //! pub mod user { //! use leptos::prelude::*; //! use reactive_stores::Field; //! // Using FooStore fields here. //! use crate::foo::{ Foo, FooStoreFields }; //! //! #[component] //! pub fn UseFoo(foo: Field<Foo>) { //! // Without FooStoreFields, foo.field() would fail to compile. //! println!("field: {}", foo.field().read()); //! } //! } //! //! # fn main() { //! # } //! ``` //! ### Additional field types //! //! Most of the time, your structs will have fields as in the example above: the struct is comprised //! of primitive types, builtin types like [String], or other structs that implement [Store](struct@Store) or [Field]. //! However, there are some special cases that require some additional understanding. //! //! #### Option //! [`Option<T>`](std::option::Option) behaves pretty much as you would expect, utilizing [.is_some()](std::option::Option::is_some) //! and [.is_none()](std::option::Option::is_none) to check the value and [.unwrap()](OptionStoreExt::unwrap) method to access the inner value. The [OptionStoreExt] //! trait is required to use the [.unwrap()](OptionStoreExt::unwrap) method. Here is a quick example: //! ```rust //! // Including the trait OptionStoreExt here is required to use unwrap() //! use reactive_stores::{OptionStoreExt, Store}; //! use reactive_graph::traits::{Get, Read}; //! //! #[derive(Store)] //! struct StructWithOption { //! opt_field: Option<i32>, //! } //! //! fn describe(store: &Store<StructWithOption>) -> String { //! if store.opt_field().read().is_some() { //! // Note here we need to use OptionStoreExt or unwrap() would not compile //! format!("store has a value {}", store.opt_field().unwrap().get()) //! } else { //! format!("store has no value") //! } //! } //! let none_store = Store::new(StructWithOption { opt_field: None }); //! let some_store = Store::new(StructWithOption { opt_field: Some(42)}); //! //! assert_eq!(describe(&none_store), "store has no value"); //! assert_eq!(describe(&some_store), "store has a value 42"); //! ``` //! #### Vec //! [`Vec<T>`](std::vec::Vec) requires some special treatment when trying to access //! elements of the vector directly. Use the [StoreFieldIterator::at_unkeyed()] method to //! access a particular value in a [struct@Store] or [Field] for a [std::vec::Vec]. For example: //! ```rust //! # use reactive_stores::Store; //! // Needed to use at_unkeyed() on Vec //! use reactive_stores::StoreFieldIter; //! use reactive_stores::StoreFieldIterator; //! use reactive_graph::traits::Read; //! use reactive_graph::traits::Get; //! //! #[derive(Store)] //! struct StructWithVec { //! vec_field: Vec<i32>, //! } //! //! let store = Store::new(StructWithVec { vec_field: vec![1, 2, 3] }); //! //! assert_eq!(store.vec_field().at_unkeyed(0).get(), 1); //! assert_eq!(store.vec_field().at_unkeyed(1).get(), 2); //! assert_eq!(store.vec_field().at_unkeyed(2).get(), 3); //! ``` //! #### Enum //! Enumerated types behave a bit differently as the [`Store`](macro@Store) macro builds underlying traits instead of alternate //! enumerated structures. Each element in an `Enum` generates methods to access it in the store: a //! method with the name of the field gives a boolean if the `Enum` is that variant, and possible accessor //! methods for anonymous fields of that variant. For example: //! ```rust //! use reactive_stores::Store; //! use reactive_graph::traits::{Read, Get}; //! //! #[derive(Store)] //! enum Choices { //! First, //! Second(String), //! } //! //! let choice_one = Store::new(Choices::First); //! let choice_two = Store::new(Choices::Second("hello".to_string())); //! //! assert!(choice_one.first()); //! assert!(!choice_one.second()); //! // Note the use of the accessor method here .second_0() //! assert_eq!(choice_two.second_0().unwrap().get(), "hello"); //! ``` //! #### Box //! [`Box<T>`](std::boxed::Box) also requires some special treatment in how you dereference elements of the Box, especially //! when trying to build a recursive data structure. [DerefField](trait@DerefField) provides a [.deref_value()](DerefField::deref_field) method to access //! the inner value. For example: //! ```rust //! // Note here we need to use DerefField to use deref_field() and OptionStoreExt to use unwrap() //! use reactive_stores::{Store, DerefField, OptionStoreExt}; //! use reactive_graph::traits::{ Read, Get }; //! //! #[derive(Store)] //! struct List { //! value: i32, //! #[store] //! child: Option<Box<List>>, //! } //! //! let tree = Store::new(List { //! value: 1, //! child: Some(Box::new(List { value: 2, child: None })), //! }); //! //! assert_eq!(tree.child().unwrap().deref_field().value().get(), 2); //! ``` //! ### Implementation Notes //! //! Every struct field can be understood as an index. For example, given the following definition //! ```rust //! # use reactive_stores::{Store, Patch}; //! #[derive(Debug, Store, Patch, Default)] //! struct Name { //! first: String, //! last: String, //! } //! ``` //! We can think of `first` as `0` and `last` as `1`. This means that any deeply-nested field of a //! struct can be described as a path of indices. So, for example: //! ```rust //! # use reactive_stores::{Store, Patch}; //! #[derive(Debug, Store, Patch, Default)] //! struct User { //! user: Name, //! } //! //! #[derive(Debug, Store, Patch, Default)] //! struct Name { //! first: String, //! last: String, //! } //! ``` //! Here, given a `User`, `first` can be understood as [`0`, `0`] and `last` is [`0`, `1`]. //! //! This means we can implement a store as the combination of two things: //! 1) An `Arc<RwLock<T>>` that holds the actual value //! 2) A map from field paths to reactive "triggers," which are signals that have no value but //! track reactivity //! //! Accessing a field via its getters returns an iterator-like data structure that describes how to //! get to that subfield. Calling `.read()` returns a guard that dereferences to the value of that //! field in the signal inner `Arc<RwLock<_>>`, and tracks the trigger that corresponds with its //! path; calling `.write()` returns a writeable guard, and notifies that same trigger. use reactive_graph::{ owner::{ArenaItem, LocalStorage, Storage, SyncStorage}, signal::{ guards::{Plain, ReadGuard, WriteGuard}, ArcTrigger, }, traits::{ DefinedAt, Dispose, IsDisposed, Notify, ReadUntracked, Track, UntrackableGuard, Write, }, }; pub use reactive_stores_macro::{Patch, Store}; use rustc_hash::FxHashMap; use std::{ any::Any, fmt::Debug, hash::Hash, ops::DerefMut, panic::Location, sync::{Arc, RwLock}, }; mod arc_field; mod deref; mod field; mod iter; mod keyed; mod len; mod option; mod patch; mod path; mod store_field; mod subfield; pub use arc_field::ArcField; pub use deref::*; pub use field::Field; pub use iter::*; pub use keyed::*; pub use len::Len; pub use option::*; pub use patch::*; pub use path::{StorePath, StorePathSegment}; pub use store_field::StoreField; pub use subfield::Subfield; #[derive(Debug, Default)] struct TriggerMap(FxHashMap<StorePath, StoreFieldTrigger>); /// The reactive trigger that can be used to track updates to a store field. #[derive(Debug, Clone, Default)] pub struct StoreFieldTrigger { pub(crate) this: ArcTrigger, pub(crate) children: ArcTrigger, } impl StoreFieldTrigger { /// Creates a new trigger. pub fn new() -> Self { Self::default() } } impl TriggerMap { fn get_or_insert(&mut self, key: StorePath) -> StoreFieldTrigger { if let Some(trigger) = self.0.get(&key) { trigger.clone() } else { let new = StoreFieldTrigger::new(); self.0.insert(key, new.clone()); new } } #[allow(unused)] fn remove(&mut self, key: &StorePath) -> Option<StoreFieldTrigger> { self.0.remove(key) } } /// Manages the keys for a keyed field, including the ability to remove and reuse keys. pub(crate) struct FieldKeys<K> { spare_keys: Vec<StorePathSegment>, current_key: usize, keys: FxHashMap<K, (StorePathSegment, usize)>, } impl<K> FieldKeys<K> where K: Debug + Hash + PartialEq + Eq, { /// Creates a new set of keys. pub fn new(from_keys: Vec<K>) -> Self { let mut keys = FxHashMap::with_capacity_and_hasher( from_keys.len(), Default::default(), ); for (idx, key) in from_keys.into_iter().enumerate() { let segment = idx.into(); keys.insert(key, (segment, idx)); } Self { spare_keys: Vec::new(), current_key: keys.len().saturating_sub(1), keys, } } } impl<K> FieldKeys<K> where K: Hash + PartialEq + Eq, { fn get(&self, key: &K) -> Option<(StorePathSegment, usize)> { self.keys.get(key).copied() } fn next_key(&mut self) -> StorePathSegment { self.spare_keys.pop().unwrap_or_else(|| { self.current_key += 1; self.current_key.into() }) } fn update( &mut self, iter: impl IntoIterator<Item = K>, ) -> Vec<(usize, StorePathSegment)> { let new_keys = iter .into_iter() .enumerate() .map(|(idx, key)| (key, idx)) .collect::<FxHashMap<K, usize>>(); let mut index_keys = Vec::with_capacity(new_keys.len()); // remove old keys and recycle the slots self.keys.retain(|key, old_entry| match new_keys.get(key) { Some(idx) => { old_entry.1 = *idx; true } None => { self.spare_keys.push(old_entry.0); false } }); // add new keys for (key, idx) in new_keys { match self.keys.get(&key) { Some((segment, idx)) => index_keys.push((*idx, *segment)), None => { let path = self.next_key(); self.keys.insert(key, (path, idx)); index_keys.push((idx, path)); } } } index_keys } } impl<K> Default for FieldKeys<K> { fn default() -> Self { Self { spare_keys: Default::default(), current_key: Default::default(), keys: Default::default(), } } } #[cfg(not(target_arch = "wasm32"))] type HashMap<K, V> = Arc<dashmap::DashMap<K, V>>; #[cfg(target_arch = "wasm32")] type HashMap<K, V> = send_wrapper::SendWrapper< std::rc::Rc<std::cell::RefCell<std::collections::HashMap<K, V>>>, >; /// A map of the keys for a keyed subfield. #[derive(Clone)] pub struct KeyMap( HashMap<StorePath, Box<dyn Any + Send + Sync>>, HashMap<(StorePath, usize), StorePathSegment>, ); impl Default for KeyMap { fn default() -> Self { #[cfg(not(target_arch = "wasm32"))] return Self(Default::default(), Default::default()); #[cfg(target_arch = "wasm32")] return Self( send_wrapper::SendWrapper::new(Default::default()), send_wrapper::SendWrapper::new(Default::default()), ); } } impl KeyMap { fn with_field_keys<K, T>( &self, path: StorePath, fun: impl FnOnce(&mut FieldKeys<K>) -> (T, Vec<(usize, StorePathSegment)>), initialize: impl FnOnce() -> Vec<K>, ) -> Option<T> where K: Debug + Hash + PartialEq + Eq + Send + Sync + 'static, { let initial_keys = initialize(); #[cfg(not(target_arch = "wasm32"))] let mut entry = self .0 .entry(path.clone()) .or_insert_with(|| Box::new(FieldKeys::new(initial_keys))); #[cfg(target_arch = "wasm32")] let entry = if !self.0.borrow().contains_key(&path) { Some(Box::new(FieldKeys::new(initial_keys))) } else { None }; #[cfg(target_arch = "wasm32")] let mut map = self.0.borrow_mut(); #[cfg(target_arch = "wasm32")] let entry = map.entry(path.clone()).or_insert_with(|| entry.unwrap()); let entry = entry.downcast_mut::<FieldKeys<K>>()?; let (result, new_keys) = fun(entry); if !new_keys.is_empty() { for (idx, segment) in new_keys { #[cfg(not(target_arch = "wasm32"))] self.1.insert((path.clone(), idx), segment); #[cfg(target_arch = "wasm32")] self.1.borrow_mut().insert((path.clone(), idx), segment); } } Some(result) } fn contains_key(&self, key: &StorePath) -> bool { #[cfg(not(target_arch = "wasm32"))] { self.0.contains_key(key) } #[cfg(target_arch = "wasm32")] { self.0.borrow_mut().contains_key(key) } } fn get_key_for_index( &self, key: &(StorePath, usize), ) -> Option<StorePathSegment> { #[cfg(not(target_arch = "wasm32"))] { self.1.get(key).as_deref().copied() } #[cfg(target_arch = "wasm32")] { self.1.borrow().get(key).as_deref().copied() } } } /// A reference-counted container for a reactive store. /// /// The type `T` should be a struct that has been annotated with `#[derive(Store)]`. /// /// This adds a getter method for each field to `Store<T>`, which allow accessing reactive versions /// of each individual field of the struct. pub struct ArcStore<T> { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, pub(crate) value: Arc<RwLock<T>>, signals: Arc<RwLock<TriggerMap>>, keys: KeyMap, } impl<T> ArcStore<T> { /// Creates a new store from the initial value. pub fn new(value: T) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), value: Arc::new(RwLock::new(value)), signals: Default::default(), keys: Default::default(), } } } impl<T: Default> Default for ArcStore<T> { fn default() -> Self { Self::new(T::default()) } } impl<T: Debug> Debug for ArcStore<T> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { let mut f = f.debug_struct("ArcStore"); #[cfg(any(debug_assertions, leptos_debuginfo))] let f = f.field("defined_at", &self.defined_at); f.field("value", &self.value) .field("signals", &self.signals) .finish() } } impl<T> Clone for ArcStore<T> { fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, value: Arc::clone(&self.value), signals: Arc::clone(&self.signals), keys: self.keys.clone(), } } } impl<T> DefinedAt for ArcStore<T> { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T> IsDisposed for ArcStore<T> { #[inline(always)] fn is_disposed(&self) -> bool { false } } impl<T> ReadUntracked for ArcStore<T> where T: 'static, { type Value = ReadGuard<T, Plain<T>>; fn try_read_untracked(&self) -> Option<Self::Value> { Plain::try_new(Arc::clone(&self.value)).map(ReadGuard::new) } } impl<T> Write for ArcStore<T> where T: 'static, { type Value = T; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { self.writer() .map(|writer| WriteGuard::new(self.clone(), writer)) } fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { let mut writer = self.writer()?; writer.untrack(); Some(writer) } } impl<T: 'static> Track for ArcStore<T> { fn track(&self) { self.track_field(); } } impl<T: 'static> Notify for ArcStore<T> { fn notify(&self) { let trigger = self.get_trigger(self.path().into_iter().collect()); trigger.this.notify(); trigger.children.notify(); } } /// An arena-allocated container for a reactive store. /// /// The type `T` should be a struct that has been annotated with `#[derive(Store)]`. /// /// This adds a getter method for each field to `Store<T>`, which allow accessing reactive versions /// of each individual field of the struct. /// /// This follows the same ownership rules as arena-allocated types like /// [`RwSignal`](reactive_graph::signal::RwSignal). pub struct Store<T, S = SyncStorage> { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, inner: ArenaItem<ArcStore<T>, S>, } impl<T> Store<T> where T: Send + Sync + 'static, { /// Creates a new store with the initial value. pub fn new(value: T) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(ArcStore::new(value)), } } } impl<T, S> PartialEq for Store<T, S> { fn eq(&self, other: &Self) -> bool { self.inner == other.inner } } impl<T, S> Eq for Store<T, S> {} impl<T> Store<T, LocalStorage> where T: 'static, { /// Creates a new store for a type that is `!Send`. /// /// This pins the value to the current thread. Accessing it from any other thread will panic. pub fn new_local(value: T) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(ArcStore::new(value)), } } } impl<T> Default for Store<T> where T: Default + Send + Sync + 'static, { fn default() -> Self { Self::new(T::default()) } } impl<T> Default for Store<T, LocalStorage> where T: Default + 'static, { fn default() -> Self { Self::new_local(T::default()) } } impl<T: Debug, S> Debug for Store<T, S> where S: Debug, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { let mut f = f.debug_struct("Store"); #[cfg(any(debug_assertions, leptos_debuginfo))] let f = f.field("defined_at", &self.defined_at); f.field("inner", &self.inner).finish() } } impl<T, S> Clone for Store<T, S> { fn clone(&self) -> Self { *self } } impl<T, S> Copy for Store<T, S> {} impl<T, S> DefinedAt for Store<T, S> { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T, S> IsDisposed for Store<T, S> where T: 'static, { #[inline(always)] fn is_disposed(&self) -> bool { self.inner.is_disposed() } } impl<T, S> Dispose for Store<T, S> where T: 'static, { fn dispose(self) { self.inner.dispose(); } } impl<T, S> ReadUntracked for Store<T, S> where T: 'static, S: Storage<ArcStore<T>>, { type Value = ReadGuard<T, Plain<T>>; fn try_read_untracked(&self) -> Option<Self::Value> { self.inner .try_get_value() .and_then(|inner| inner.try_read_untracked()) } } impl<T, S> Write for Store<T, S> where T: 'static, S: Storage<ArcStore<T>>, { type Value = T; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { self.writer().map(|writer| WriteGuard::new(*self, writer)) } fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { let mut writer = self.writer()?; writer.untrack(); Some(writer) } } impl<T, S> Track for Store<T, S> where T: 'static, S: Storage<ArcStore<T>>, { fn track(&self) { if let Some(inner) = self.inner.try_get_value() { inner.track(); } } } impl<T, S> Notify for Store<T, S> where T: 'static, S: Storage<ArcStore<T>>, { fn notify(&self) { if let Some(inner) = self.inner.try_get_value() { inner.notify(); } } } impl<T, S> From<ArcStore<T>> for Store<T, S> where T: 'static, S: Storage<ArcStore<T>>, { fn from(value: ArcStore<T>) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: value.defined_at, inner: ArenaItem::new_with_storage(value), } } } #[cfg(test)] mod tests { use crate::{self as reactive_stores, Patch, Store, StoreFieldIterator}; use reactive_graph::{ effect::Effect, owner::StoredValue, traits::{Read, ReadUntracked, Set, Track, Update, Write}, }; use std::sync::{ atomic::{AtomicUsize, Ordering}, Arc, }; pub async fn tick() { tokio::time::sleep(std::time::Duration::from_micros(1)).await; } #[derive(Debug, Store, Patch, Default)] struct Todos { user: String, todos: Vec<Todo>, } #[derive(Debug, Store, Patch, Default)] struct Todo { label: String, completed: bool, } impl Todo { pub fn new(label: impl ToString) -> Self { Self { label: label.to_string(), completed: false, } } } fn data() -> Todos { Todos { user: "Bob".to_string(), todos: vec![ Todo { label: "Create reactive store".to_string(), completed: true, }, Todo { label: "???".to_string(), completed: false, }, Todo { label: "Profit".to_string(), completed: false, }, ], } } #[derive(Debug, Clone, Store, Patch, Default)] struct Foo { id: i32, bar: Bar, } #[derive(Debug, Clone, Store, Patch, Default)] struct Bar { bar_signature: i32, baz: Baz, } #[derive(Debug, Clone, Store, Patch, Default)] struct Baz { more_data: i32, baw: Baw, } #[derive(Debug, Clone, Store, Patch, Default)] struct Baw { more_data: i32, end: i32, } #[tokio::test] async fn mutating_field_triggers_effect() { _ = any_spawner::Executor::init_tokio(); let combined_count = Arc::new(AtomicUsize::new(0)); let store = Store::new(data()); assert_eq!(store.read_untracked().todos.len(), 3); assert_eq!(store.user().read_untracked().as_str(), "Bob"); Effect::new_sync({ let combined_count = Arc::clone(&combined_count); move |prev: Option<()>| { if prev.is_none() { println!("first run"); } else { println!("next run"); } println!("{:?}", *store.user().read()); combined_count.fetch_add(1, Ordering::Relaxed); } }); tick().await; tick().await; store.user().set("Greg".into()); tick().await; store.user().set("Carol".into()); tick().await; store.user().update(|name| name.push_str("!!!")); tick().await; // the effect reads from `user`, so it should trigger every time assert_eq!(combined_count.load(Ordering::Relaxed), 4); } #[tokio::test] async fn other_field_does_not_notify() { _ = any_spawner::Executor::init_tokio(); let combined_count = Arc::new(AtomicUsize::new(0)); let store = Store::new(data()); Effect::new_sync({ let combined_count = Arc::clone(&combined_count); move |prev: Option<()>| { if prev.is_none() { println!("first run"); } else { println!("next run"); } println!("{:?}", *store.todos().read()); combined_count.fetch_add(1, Ordering::Relaxed); } }); tick().await; store.user().set("Greg".into()); tick().await; store.user().set("Carol".into()); tick().await; store.user().update(|name| name.push_str("!!!")); tick().await; // the effect reads from `todos`, so it shouldn't trigger every time assert_eq!(combined_count.load(Ordering::Relaxed), 1); } #[tokio::test] async fn parent_does_notify() { _ = any_spawner::Executor::init_tokio(); let combined_count = Arc::new(AtomicUsize::new(0)); let store = Store::new(data()); Effect::new_sync({ let combined_count = Arc::clone(&combined_count); move |prev: Option<()>| { if prev.is_none() { println!("first run"); } else { println!("next run"); } println!("{:?}", *store.todos().read()); combined_count.fetch_add(1, Ordering::Relaxed); } }); tick().await; tick().await; store.set(Todos::default()); tick().await; store.set(data()); tick().await; assert_eq!(combined_count.load(Ordering::Relaxed), 3); } #[tokio::test] async fn changes_do_notify_parent() { _ = any_spawner::Executor::init_tokio(); let combined_count = Arc::new(AtomicUsize::new(0)); let store = Store::new(data()); Effect::new_sync({ let combined_count = Arc::clone(&combined_count); move |prev: Option<()>| { if prev.is_none() { println!("first run"); } else { println!("next run"); } println!("{:?}", *store.read()); combined_count.fetch_add(1, Ordering::Relaxed); } }); tick().await; tick().await; store.user().set("Greg".into()); tick().await; store.user().set("Carol".into()); tick().await; store.user().update(|name| name.push_str("!!!")); tick().await; store.todos().write().clear(); tick().await; assert_eq!(combined_count.load(Ordering::Relaxed), 5); } #[tokio::test] async fn iterator_tracks_the_field() { _ = any_spawner::Executor::init_tokio(); let combined_count = Arc::new(AtomicUsize::new(0)); let store = Store::new(data()); Effect::new_sync({ let combined_count = Arc::clone(&combined_count); move |prev: Option<()>| { if prev.is_none() { println!("first run"); } else { println!("next run"); } println!( "{:?}", store.todos().iter_unkeyed().collect::<Vec<_>>() ); combined_count.store(1, Ordering::Relaxed); } }); tick().await; store .todos() .write() .push(Todo::new("Create reactive store?")); tick().await; store.todos().write().push(Todo::new("???")); tick().await; store.todos().write().push(Todo::new("Profit!")); // the effect only reads from `todos`, so it should trigger only the first time assert_eq!(combined_count.load(Ordering::Relaxed), 1); } #[tokio::test] async fn patching_only_notifies_changed_field() { _ = any_spawner::Executor::init_tokio(); let combined_count = Arc::new(AtomicUsize::new(0)); let store = Store::new(Todos { user: "Alice".into(), todos: vec![], }); Effect::new_sync({ let combined_count = Arc::clone(&combined_count); move |prev: Option<()>| { if prev.is_none() { println!("first run"); } else { println!("next run"); } println!("{:?}", *store.todos().read()); combined_count.fetch_add(1, Ordering::Relaxed); } }); tick().await; tick().await; store.patch(Todos { user: "Bob".into(), todos: vec![], }); tick().await; store.patch(Todos { user: "Carol".into(), todos: vec![], }); tick().await; assert_eq!(combined_count.load(Ordering::Relaxed), 1); store.patch(Todos { user: "Carol".into(), todos: vec![Todo { label: "First Todo".into(), completed: false, }], }); tick().await; assert_eq!(combined_count.load(Ordering::Relaxed), 2); } #[tokio::test] async fn patching_only_notifies_changed_field_with_custom_patch() { _ = any_spawner::Executor::init_tokio();
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
true
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/keyed.rs
reactive_stores/src/keyed.rs
use crate::{ path::{StorePath, StorePathSegment}, store_field::StoreField, KeyMap, StoreFieldTrigger, }; use reactive_graph::{ signal::{ guards::{Mapped, MappedMut, MappedMutArc, WriteGuard}, ArcTrigger, }, traits::{ DefinedAt, IsDisposed, Notify, ReadUntracked, Track, UntrackableGuard, Write, }, }; use std::{ collections::VecDeque, fmt::Debug, hash::Hash, iter, ops::{Deref, DerefMut, IndexMut}, panic::Location, }; /// Provides access to a subfield that contains some kind of keyed collection. #[derive(Debug)] pub struct KeyedSubfield<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, path_segment: StorePathSegment, inner: Inner, read: fn(&Prev) -> &T, write: fn(&mut Prev) -> &mut T, key_fn: fn(<&T as IntoIterator>::Item) -> K, } impl<Inner, Prev, K, T> Clone for KeyedSubfield<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, Inner: Clone, { fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, path_segment: self.path_segment, inner: self.inner.clone(), read: self.read, write: self.write, key_fn: self.key_fn, } } } impl<Inner, Prev, K, T> Copy for KeyedSubfield<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, Inner: Copy, { } impl<Inner, Prev, K, T> KeyedSubfield<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, { /// Creates a keyed subfield of the inner data type with the given key function. #[track_caller] pub fn new( inner: Inner, path_segment: StorePathSegment, key_fn: fn(<&T as IntoIterator>::Item) -> K, read: fn(&Prev) -> &T, write: fn(&mut Prev) -> &mut T, ) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner, path_segment, read, write, key_fn, } } } impl<Inner, Prev, K, T> StoreField for KeyedSubfield<Inner, Prev, K, T> where Self: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { type Value = T; type Reader = Mapped<Inner::Reader, T>; type Writer = MappedMut<WriteGuard<Vec<ArcTrigger>, Inner::Writer>, T>; fn path(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner .path() .into_iter() .chain(iter::once(self.path_segment)) } fn path_unkeyed(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner .path_unkeyed() .into_iter() .chain(iter::once(self.path_segment)) } fn get_trigger(&self, path: StorePath) -> StoreFieldTrigger { self.inner.get_trigger(path) } fn get_trigger_unkeyed(&self, path: StorePath) -> StoreFieldTrigger { self.inner.get_trigger_unkeyed(path) } fn reader(&self) -> Option<Self::Reader> { let inner = self.inner.reader()?; Some(Mapped::new_with_guard(inner, self.read)) } fn writer(&self) -> Option<Self::Writer> { let mut parent = self.inner.writer()?; parent.untrack(); let triggers = self.triggers_for_current_path(); let guard = WriteGuard::new(triggers, parent); Some(MappedMut::new(guard, self.read, self.write)) } #[inline(always)] fn keys(&self) -> Option<KeyMap> { self.inner.keys() } fn track_field(&self) { let mut full_path = self.path().into_iter().collect::<StorePath>(); let trigger = self.get_trigger(self.path().into_iter().collect()); trigger.this.track(); trigger.children.track(); // tracks `this` for all ancestors: i.e., it will track any change that is made // directly to one of its ancestors, but not a change made to a *child* of an ancestor // (which would end up with every subfield tracking its own siblings, because they are // children of its parent) while !full_path.is_empty() { full_path.pop(); let inner = self.get_trigger(full_path.clone()); inner.this.track(); } } } impl<Inner, Prev, K, T> KeyedSubfield<Inner, Prev, K, T> where Self: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { fn latest_keys(&self) -> Vec<K> { self.reader() .map(|r| r.deref().into_iter().map(|n| (self.key_fn)(n)).collect()) .unwrap_or_default() } } /// Gives keyed write access to a value in some collection. pub struct KeyedSubfieldWriteGuard<Inner, Prev, K, T, Guard> where KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { inner: KeyedSubfield<Inner, Prev, K, T>, guard: Option<Guard>, untracked: bool, } impl<Inner, Prev, K, T, Guard> Deref for KeyedSubfieldWriteGuard<Inner, Prev, K, T, Guard> where Guard: Deref, KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { type Target = Guard::Target; fn deref(&self) -> &Self::Target { self.guard .as_ref() .expect("should be Some(_) until dropped") .deref() } } impl<Inner, Prev, K, T, Guard> DerefMut for KeyedSubfieldWriteGuard<Inner, Prev, K, T, Guard> where Guard: DerefMut, KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { fn deref_mut(&mut self) -> &mut Self::Target { self.guard .as_mut() .expect("should be Some(_) until dropped") .deref_mut() } } impl<Inner, Prev, K, T, Guard> UntrackableGuard for KeyedSubfieldWriteGuard<Inner, Prev, K, T, Guard> where Guard: UntrackableGuard, KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { fn untrack(&mut self) { self.untracked = true; if let Some(inner) = self.guard.as_mut() { inner.untrack(); } } } impl<Inner, Prev, K, T, Guard> Drop for KeyedSubfieldWriteGuard<Inner, Prev, K, T, Guard> where KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { fn drop(&mut self) { // dropping the inner guard will // 1) synchronously release its write lock on the store's value // 2) trigger an (asynchronous) reactive update drop(self.guard.take()); // now that the write lock is release, we can get a read lock to refresh this keyed field // based on the new value self.inner.update_keys(); if !self.untracked { self.inner.notify(); } // reactive updates happen on the next tick } } impl<Inner, Prev, K, T> DefinedAt for KeyedSubfield<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<Inner, Prev, K, T> IsDisposed for KeyedSubfield<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, Inner: IsDisposed, { fn is_disposed(&self) -> bool { self.inner.is_disposed() } } impl<Inner, Prev, K, T> Notify for KeyedSubfield<Inner, Prev, K, T> where Self: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { fn notify(&self) { let trigger = self.get_trigger(self.path().into_iter().collect()); trigger.this.notify(); trigger.children.notify(); } } impl<Inner, Prev, K, T> Track for KeyedSubfield<Inner, Prev, K, T> where Self: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev> + Track + 'static, Prev: 'static, T: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { fn track(&self) { self.track_field(); } } impl<Inner, Prev, K, T> ReadUntracked for KeyedSubfield<Inner, Prev, K, T> where Self: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { type Value = <Self as StoreField>::Reader; fn try_read_untracked(&self) -> Option<Self::Value> { self.reader() } } impl<Inner, Prev, K, T> Write for KeyedSubfield<Inner, Prev, K, T> where Self: Clone, for<'a> &'a T: IntoIterator, T: 'static, Inner: StoreField<Value = Prev>, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { type Value = T; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { let guard = self.writer()?; Some(KeyedSubfieldWriteGuard { inner: self.clone(), guard: Some(guard), untracked: false, }) } fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { let mut guard = self.writer()?; guard.untrack(); Some(KeyedSubfieldWriteGuard { inner: self.clone(), guard: Some(guard), untracked: true, }) } } /// Gives access to the value in a collection based on some key. #[derive(Debug)] pub struct AtKeyed<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, inner: KeyedSubfield<Inner, Prev, K, T>, key: K, } impl<Inner, Prev, K, T> Clone for AtKeyed<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, KeyedSubfield<Inner, Prev, K, T>: Clone, K: Debug + Clone, { fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, inner: self.inner.clone(), key: self.key.clone(), } } } impl<Inner, Prev, K, T> Copy for AtKeyed<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, KeyedSubfield<Inner, Prev, K, T>: Copy, K: Debug + Copy, { } impl<Inner, Prev, K, T> AtKeyed<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, { /// Provides access to the item in the inner collection at this key. #[track_caller] pub fn new(inner: KeyedSubfield<Inner, Prev, K, T>, key: K) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner, key, } } } impl<Inner, Prev, K, T> StoreField for AtKeyed<Inner, Prev, K, T> where K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, T: IndexMut<usize>, T::Output: Sized, { type Value = T::Output; type Reader = MappedMutArc< <KeyedSubfield<Inner, Prev, K, T> as StoreField>::Reader, T::Output, >; type Writer = WriteGuard< Vec<ArcTrigger>, MappedMutArc< <KeyedSubfield<Inner, Prev, K, T> as StoreField>::Writer, T::Output, >, >; fn path(&self) -> impl IntoIterator<Item = StorePathSegment> { let inner = self.inner.path().into_iter().collect::<StorePath>(); let keys = self .inner .keys() .expect("using keys on a store with no keys"); let this = keys .with_field_keys( inner.clone(), |keys| (keys.get(&self.key), vec![]), || self.inner.latest_keys(), ) .flatten() .map(|(path, _)| path); inner.into_iter().chain(this) } fn path_unkeyed(&self) -> impl IntoIterator<Item = StorePathSegment> { let inner = self.inner.path_unkeyed().into_iter().collect::<StorePath>(); let keys = self .inner .keys() .expect("using keys on a store with no keys"); let this = keys .with_field_keys( inner.clone(), |keys| (keys.get(&self.key), vec![]), || self.inner.latest_keys(), ) .flatten() .map(|(_, idx)| StorePathSegment(idx)); inner.into_iter().chain(this) } fn get_trigger(&self, path: StorePath) -> StoreFieldTrigger { self.inner.get_trigger(path) } fn get_trigger_unkeyed(&self, path: StorePath) -> StoreFieldTrigger { self.inner.get_trigger_unkeyed(path) } fn reader(&self) -> Option<Self::Reader> { let inner = self.inner.reader()?; let inner_path = self.inner.path().into_iter().collect(); let keys = self.inner.keys()?; let index = keys .with_field_keys( inner_path, |keys| (keys.get(&self.key), vec![]), || self.inner.latest_keys(), ) .flatten() .map(|(_, idx)| idx)?; Some(MappedMutArc::new( inner, move |n| &n[index], move |n| &mut n[index], )) } fn writer(&self) -> Option<Self::Writer> { let mut inner = self.inner.writer()?; inner.untrack(); let inner_path = self.inner.path().into_iter().collect::<StorePath>(); let keys = self .inner .keys() .expect("using keys on a store with no keys"); let index = keys .with_field_keys( inner_path.clone(), |keys| (keys.get(&self.key), vec![]), || self.inner.latest_keys(), ) .flatten() .map(|(_, idx)| idx)?; let triggers = self.triggers_for_current_path(); Some(WriteGuard::new( triggers, MappedMutArc::new( inner, move |n| &n[index], move |n| &mut n[index], ), )) } #[inline(always)] fn keys(&self) -> Option<KeyMap> { self.inner.keys() } } impl<Inner, Prev, K, T> DefinedAt for AtKeyed<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<Inner, Prev, K, T> IsDisposed for AtKeyed<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, Inner: IsDisposed, { fn is_disposed(&self) -> bool { self.inner.is_disposed() } } impl<Inner, Prev, K, T> Notify for AtKeyed<Inner, Prev, K, T> where K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, T: IndexMut<usize>, T::Output: Sized, { fn notify(&self) { let trigger = self.get_trigger(self.path().into_iter().collect()); trigger.this.notify(); trigger.children.notify(); } } impl<Inner, Prev, K, T> Track for AtKeyed<Inner, Prev, K, T> where K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, T: IndexMut<usize>, T::Output: Sized, { fn track(&self) { self.track_field(); } } impl<Inner, Prev, K, T> ReadUntracked for AtKeyed<Inner, Prev, K, T> where K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, T: IndexMut<usize>, T::Output: Sized, { type Value = <Self as StoreField>::Reader; fn try_read_untracked(&self) -> Option<Self::Value> { self.reader() } } impl<Inner, Prev, K, T> Write for AtKeyed<Inner, Prev, K, T> where K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, T: IndexMut<usize>, T::Output: Sized + 'static, { type Value = T::Output; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { self.writer() } fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { self.writer().map(|mut writer| { writer.untrack(); writer }) } } impl<Inner, Prev, K, T> KeyedSubfield<Inner, Prev, K, T> where Self: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev>, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, { /// Generates a new set of keys and registers those keys with the parent store. pub fn update_keys(&self) { let inner_path = self.path().into_iter().collect(); let keys = self .inner .keys() .expect("updating keys on a store with no keys"); // generating the latest keys out here means that if we have // nested keyed fields, the second field will not try to take a // read-lock on the key map to get the field while the first field // is still holding the write-lock in the closure below let latest = self.latest_keys(); keys.with_field_keys( inner_path, |keys| ((), keys.update(latest)), || self.latest_keys(), ); } } impl<Inner, Prev, K, T> IntoIterator for KeyedSubfield<Inner, Prev, K, T> where Self: Clone, for<'a> &'a T: IntoIterator, Inner: Clone + StoreField<Value = Prev> + 'static, Prev: 'static, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, T: IndexMut<usize> + 'static, T::Output: Sized, { type Item = AtKeyed<Inner, Prev, K, T>; type IntoIter = StoreFieldKeyedIter<Inner, Prev, K, T>; #[track_caller] fn into_iter(self) -> StoreFieldKeyedIter<Inner, Prev, K, T> { // reactively track changes to this field self.update_keys(); self.track_field(); // get the current length of the field by accessing slice let reader = self.reader(); let keys = reader .map(|r| { r.into_iter() .map(|item| (self.key_fn)(item)) .collect::<VecDeque<_>>() }) .unwrap_or_default(); // return the iterator StoreFieldKeyedIter { inner: self, keys } } } /// An iterator over a [`KeyedSubfield`]. pub struct StoreFieldKeyedIter<Inner, Prev, K, T> where for<'a> &'a T: IntoIterator, T: IndexMut<usize>, { inner: KeyedSubfield<Inner, Prev, K, T>, keys: VecDeque<K>, } impl<Inner, Prev, K, T> Iterator for StoreFieldKeyedIter<Inner, Prev, K, T> where Inner: StoreField<Value = Prev> + Clone + 'static, T: IndexMut<usize> + 'static, T::Output: Sized + 'static, for<'a> &'a T: IntoIterator, { type Item = AtKeyed<Inner, Prev, K, T>; fn next(&mut self) -> Option<Self::Item> { self.keys .pop_front() .map(|key| AtKeyed::new(self.inner.clone(), key)) } } impl<Inner, Prev, K, T> DoubleEndedIterator for StoreFieldKeyedIter<Inner, Prev, K, T> where Inner: StoreField<Value = Prev> + Clone + 'static, T: IndexMut<usize> + 'static, T::Output: Sized + 'static, for<'a> &'a T: IntoIterator, { fn next_back(&mut self) -> Option<Self::Item> { self.keys .pop_back() .map(|key| AtKeyed::new(self.inner.clone(), key)) } } #[cfg(test)] mod tests { use crate::{self as reactive_stores, tests::tick, AtKeyed, Store}; use reactive_graph::{ effect::Effect, traits::{GetUntracked, ReadUntracked, Set, Track, Write}, }; use reactive_stores::Patch; use std::sync::{ atomic::{AtomicUsize, Ordering}, Arc, }; #[derive(Debug, Store, Default, Patch)] struct Todos { #[store(key: usize = |todo| todo.id)] todos: Vec<Todo>, } #[derive(Debug, Store, Default, Clone, PartialEq, Eq, Patch)] struct Todo { id: usize, label: String, } impl Todo { pub fn new(id: usize, label: impl ToString) -> Self { Self { id, label: label.to_string(), } } } fn data() -> Todos { Todos { todos: vec![ Todo { id: 10, label: "A".to_string(), }, Todo { id: 11, label: "B".to_string(), }, Todo { id: 12, label: "C".to_string(), }, ], } } #[tokio::test] async fn keyed_fields_can_be_moved() { _ = any_spawner::Executor::init_tokio(); let store = Store::new(data()); assert_eq!(store.read_untracked().todos.len(), 3); // create an effect to read from each keyed field let a_count = Arc::new(AtomicUsize::new(0)); let b_count = Arc::new(AtomicUsize::new(0)); let c_count = Arc::new(AtomicUsize::new(0)); let a = AtKeyed::new(store.todos(), 10); let b = AtKeyed::new(store.todos(), 11); let c = AtKeyed::new(store.todos(), 12); Effect::new_sync({ let a_count = Arc::clone(&a_count); move || { a.track(); a_count.fetch_add(1, Ordering::Relaxed); } }); Effect::new_sync({ let b_count = Arc::clone(&b_count); move || { b.track(); b_count.fetch_add(1, Ordering::Relaxed); } }); Effect::new_sync({ let c_count = Arc::clone(&c_count); move || { c.track(); c_count.fetch_add(1, Ordering::Relaxed); } }); tick().await; assert_eq!(a_count.load(Ordering::Relaxed), 1); assert_eq!(b_count.load(Ordering::Relaxed), 1); assert_eq!(c_count.load(Ordering::Relaxed), 1); // writing at a key doesn't notify siblings *a.label().write() = "Foo".into(); tick().await; assert_eq!(a_count.load(Ordering::Relaxed), 2); assert_eq!(b_count.load(Ordering::Relaxed), 1); assert_eq!(c_count.load(Ordering::Relaxed), 1); // the keys can be reorganized store.todos().write().swap(0, 2); let after = store.todos().get_untracked(); assert_eq!( after, vec![Todo::new(12, "C"), Todo::new(11, "B"), Todo::new(10, "Foo")] ); tick().await; assert_eq!(a_count.load(Ordering::Relaxed), 2); assert_eq!(b_count.load(Ordering::Relaxed), 1); assert_eq!(c_count.load(Ordering::Relaxed), 1); // and after we move the keys around, they still update the moved items a.label().set("Bar".into()); let after = store.todos().get_untracked(); assert_eq!( after, vec![Todo::new(12, "C"), Todo::new(11, "B"), Todo::new(10, "Bar")] ); tick().await; assert_eq!(a_count.load(Ordering::Relaxed), 3); assert_eq!(b_count.load(Ordering::Relaxed), 1); assert_eq!(c_count.load(Ordering::Relaxed), 1); // we can remove a key and add a new one store.todos().write().pop(); store.todos().write().push(Todo::new(13, "New")); let after = store.todos().get_untracked(); assert_eq!( after, vec![Todo::new(12, "C"), Todo::new(11, "B"), Todo::new(13, "New")] ); tick().await; assert_eq!(a_count.load(Ordering::Relaxed), 3); assert_eq!(b_count.load(Ordering::Relaxed), 1); assert_eq!(c_count.load(Ordering::Relaxed), 1); } #[tokio::test] async fn untracked_write_on_keyed_subfield_shouldnt_notify() { _ = any_spawner::Executor::init_tokio(); let store = Store::new(data()); assert_eq!(store.read_untracked().todos.len(), 3); // create an effect to read from the keyed subfield let todos_count = Arc::new(AtomicUsize::new(0)); Effect::new_sync({ let todos_count = Arc::clone(&todos_count); move || { store.todos().track(); todos_count.fetch_add(1, Ordering::Relaxed); } }); tick().await; assert_eq!(todos_count.load(Ordering::Relaxed), 1); // writing to keyed subfield notifies the iterator store.todos().write().push(Todo { id: 13, label: "D".into(), }); tick().await; assert_eq!(todos_count.load(Ordering::Relaxed), 2); // but an untracked write doesn't store.todos().write_untracked().push(Todo { id: 14, label: "E".into(), }); tick().await; assert_eq!(todos_count.load(Ordering::Relaxed), 2); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/store_field.rs
reactive_stores/src/store_field.rs
use crate::{ path::{StorePath, StorePathSegment}, ArcStore, KeyMap, Store, StoreFieldTrigger, }; use or_poisoned::OrPoisoned; use reactive_graph::{ owner::Storage, signal::{ guards::{Plain, UntrackedWriteGuard, WriteGuard}, ArcTrigger, }, traits::{Track, UntrackableGuard}, }; use std::{iter, ops::Deref, sync::Arc}; /// Describes a type that can be accessed as a reactive store field. pub trait StoreField: Sized { /// The value this field contains. type Value; /// A read guard to access this field. type Reader: Deref<Target = Self::Value>; /// A write guard to update this field. type Writer: UntrackableGuard<Target = Self::Value>; /// Returns the trigger that tracks access and updates for this field. #[track_caller] fn get_trigger(&self, path: StorePath) -> StoreFieldTrigger; /// Returns the trigger that tracks access and updates for this field. /// /// This uses *unkeyed* paths: i.e., if any field in the path is keyed, it will /// try to look up the key for the item at the index given in the path, rather than /// the keyed item. #[track_caller] fn get_trigger_unkeyed(&self, path: StorePath) -> StoreFieldTrigger; /// The path of this field (see [`StorePath`]). #[track_caller] fn path(&self) -> impl IntoIterator<Item = StorePathSegment>; /// The path of this field (see [`StorePath`]). Uses unkeyed indices for any keyed fields. #[track_caller] fn path_unkeyed(&self) -> impl IntoIterator<Item = StorePathSegment> { // TODO remove default impl next time we do a breaking release self.path() } /// Reactively tracks this field. #[track_caller] fn track_field(&self) { let path = self.path().into_iter().collect(); let trigger = self.get_trigger(path); trigger.this.track(); trigger.children.track(); } /// Returns a read guard to access this field. #[track_caller] fn reader(&self) -> Option<Self::Reader>; /// Returns a write guard to update this field. #[track_caller] fn writer(&self) -> Option<Self::Writer>; /// The keys for this field, if it is a keyed field. #[track_caller] fn keys(&self) -> Option<KeyMap>; /// Returns triggers for this field, and all parent fields. fn triggers_for_current_path(&self) -> Vec<ArcTrigger> { self.triggers_for_path(self.path().into_iter().collect()) } /// Returns triggers for the field at the given path, and all parent fields fn triggers_for_path(&self, path: StorePath) -> Vec<ArcTrigger> { let trigger = self.get_trigger(path.clone()); let mut full_path = path; // build a list of triggers, starting with the full path to this node and ending with the root // this will mean that the root is the final item, and this path is first let mut triggers = Vec::with_capacity(full_path.len() + 2); triggers.push(trigger.this.clone()); triggers.push(trigger.children.clone()); while !full_path.is_empty() { full_path.pop(); let inner = self.get_trigger(full_path.clone()); triggers.push(inner.children.clone()); } // when the WriteGuard is dropped, each trigger will be notified, in order // reversing the list will cause the triggers to be notified starting from the root, // then to each child down to this one // // notifying from the root down is important for things like OptionStoreExt::map()/unwrap(), // where it's really important that any effects that subscribe to .is_some() run before effects // that subscribe to the inner value, so that the inner effect can be canceled if the outer switches to `None` // (see https://github.com/leptos-rs/leptos/issues/3704) triggers.reverse(); triggers } /// Returns triggers for the field at the given path, and all parent fields fn triggers_for_path_unkeyed(&self, path: StorePath) -> Vec<ArcTrigger> { // see notes on triggers_for_path() for additional comments on implementation let trigger = self.get_trigger_unkeyed(path.clone()); let mut full_path = path; let mut triggers = Vec::with_capacity(full_path.len() + 2); triggers.push(trigger.this.clone()); triggers.push(trigger.children.clone()); while !full_path.is_empty() { full_path.pop(); let inner = self.get_trigger_unkeyed(full_path.clone()); triggers.push(inner.children.clone()); } triggers.reverse(); triggers } } impl<T> StoreField for ArcStore<T> where T: 'static, { type Value = T; type Reader = Plain<T>; type Writer = WriteGuard<ArcTrigger, UntrackedWriteGuard<T>>; #[track_caller] fn get_trigger(&self, path: StorePath) -> StoreFieldTrigger { let triggers = &self.signals; let trigger = triggers.write().or_poisoned().get_or_insert(path); trigger } #[track_caller] fn get_trigger_unkeyed(&self, path: StorePath) -> StoreFieldTrigger { let caller = std::panic::Location::caller(); let orig_path = path.clone(); let mut path = StorePath::with_capacity(orig_path.len()); for segment in &orig_path { let parent_is_keyed = self.keys.contains_key(&path); if parent_is_keyed { let key = self .keys .get_key_for_index(&(path.clone(), segment.0)) .unwrap_or_else(|| { panic!( "could not find key for index {:?} at {}", &(path.clone(), segment.0), caller ) }); path.push(key); } else { path.push(*segment); } } self.get_trigger(path) } #[track_caller] fn path(&self) -> impl IntoIterator<Item = StorePathSegment> { iter::empty() } #[track_caller] fn path_unkeyed(&self) -> impl IntoIterator<Item = StorePathSegment> { iter::empty() } #[track_caller] fn reader(&self) -> Option<Self::Reader> { Plain::try_new(Arc::clone(&self.value)) } #[track_caller] fn writer(&self) -> Option<Self::Writer> { let trigger = self.get_trigger(Default::default()); let guard = UntrackedWriteGuard::try_new(Arc::clone(&self.value))?; Some(WriteGuard::new(trigger.children, guard)) } #[track_caller] fn keys(&self) -> Option<KeyMap> { Some(self.keys.clone()) } } impl<T, S> StoreField for Store<T, S> where T: 'static, S: Storage<ArcStore<T>>, { type Value = T; type Reader = Plain<T>; type Writer = WriteGuard<ArcTrigger, UntrackedWriteGuard<T>>; #[track_caller] fn get_trigger(&self, path: StorePath) -> StoreFieldTrigger { self.inner .try_get_value() .map(|n| n.get_trigger(path)) .unwrap_or_default() } #[track_caller] fn get_trigger_unkeyed(&self, path: StorePath) -> StoreFieldTrigger { self.inner .try_get_value() .map(|n| n.get_trigger_unkeyed(path)) .unwrap_or_default() } #[track_caller] fn path(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner .try_get_value() .map(|n| n.path().into_iter().collect::<Vec<_>>()) .unwrap_or_default() } #[track_caller] fn path_unkeyed(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner .try_get_value() .map(|n| n.path_unkeyed().into_iter().collect::<Vec<_>>()) .unwrap_or_default() } #[track_caller] fn reader(&self) -> Option<Self::Reader> { self.inner.try_get_value().and_then(|n| n.reader()) } #[track_caller] fn writer(&self) -> Option<Self::Writer> { self.inner.try_get_value().and_then(|n| n.writer()) } #[track_caller] fn keys(&self) -> Option<KeyMap> { self.inner.try_get_value().and_then(|inner| inner.keys()) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/option.rs
reactive_stores/src/option.rs
use crate::{StoreField, Subfield}; use reactive_graph::traits::{FlattenOptionRefOption, Read, ReadUntracked}; use std::ops::Deref; /// Extends optional store fields, with the ability to unwrap or map over them. pub trait OptionStoreExt where Self: StoreField<Value = Option<Self::Output>>, { /// The inner type of the `Option<_>` this field holds. type Output; /// Provides access to the inner value, as a subfield, unwrapping the outer value. fn unwrap(self) -> Subfield<Self, Option<Self::Output>, Self::Output>; /// Inverts a subfield of an `Option` to an `Option` of a subfield. fn invert( self, ) -> Option<Subfield<Self, Option<Self::Output>, Self::Output>> { self.map(|f| f) } /// Reactively maps over the field. /// /// This returns `None` if the subfield is currently `None`, /// and a new store subfield with the inner value if it is `Some`. This can be used in some /// other reactive context, which will cause it to re-run if the field toggles between `None` /// and `Some(_)`. fn map<U>( self, map_fn: impl FnOnce(Subfield<Self, Option<Self::Output>, Self::Output>) -> U, ) -> Option<U>; /// Unreactively maps over the field. /// /// This returns `None` if the subfield is currently `None`, /// and a new store subfield with the inner value if it is `Some`. This is an unreactive variant of /// `[OptionStoreExt::map]`, and will not cause the reactive context to re-run if the field changes. fn map_untracked<U>( self, map_fn: impl FnOnce(Subfield<Self, Option<Self::Output>, Self::Output>) -> U, ) -> Option<U>; } impl<T, S> OptionStoreExt for S where S: StoreField<Value = Option<T>> + Read + ReadUntracked, <S as Read>::Value: Deref<Target = Option<T>>, <S as ReadUntracked>::Value: Deref<Target = Option<T>>, { type Output = T; fn unwrap(self) -> Subfield<Self, Option<Self::Output>, Self::Output> { Subfield::new( self, 0.into(), |t| t.as_ref().unwrap(), |t| t.as_mut().unwrap(), ) } fn map<U>( self, map_fn: impl FnOnce(Subfield<S, Option<T>, T>) -> U, ) -> Option<U> { if self.try_read().as_deref().flatten().is_some() { Some(map_fn(self.unwrap())) } else { None } } fn map_untracked<U>( self, map_fn: impl FnOnce(Subfield<S, Option<T>, T>) -> U, ) -> Option<U> { if self.try_read_untracked().as_deref().flatten().is_some() { Some(map_fn(self.unwrap())) } else { None } } } #[cfg(test)] mod tests { use crate::{self as reactive_stores, Patch as _, Store}; use any_spawner::Executor; use reactive_graph::{ effect::Effect, traits::{Get, Read, ReadUntracked, Set, Write}, }; use reactive_stores_macro::Patch; use std::sync::{ atomic::{AtomicUsize, Ordering}, Arc, }; pub async fn tick() { Executor::tick().await; } #[derive(Debug, Clone, Store)] pub struct User { pub name: Option<Name>, } #[derive(Debug, Clone, Store)] pub struct Name { pub first_name: Option<String>, } #[tokio::test] async fn substores_reachable_through_option() { use crate::OptionStoreExt; _ = any_spawner::Executor::init_tokio(); let combined_count = Arc::new(AtomicUsize::new(0)); let store = Store::new(User { name: None }); Effect::new_sync({ let combined_count = Arc::clone(&combined_count); move |prev: Option<()>| { if prev.is_none() { println!("first run"); } else { println!("next run"); } if store.name().read().is_some() { println!( "inner value = {:?}", *store.name().unwrap().first_name().read() ); } else { println!("no inner value"); } combined_count.fetch_add(1, Ordering::Relaxed); } }); tick().await; store.name().set(Some(Name { first_name: Some("Greg".into()), })); tick().await; store.name().set(None); tick().await; store.name().set(Some(Name { first_name: Some("Bob".into()), })); tick().await; store .name() .unwrap() .first_name() .write() .as_mut() .unwrap() .push_str("!!!"); tick().await; assert_eq!(combined_count.load(Ordering::Relaxed), 5); assert_eq!( store .name() .read_untracked() .as_ref() .unwrap() .first_name .as_ref() .unwrap(), "Bob!!!" ); } #[tokio::test] async fn mapping_over_optional_store_field() { use crate::OptionStoreExt; _ = any_spawner::Executor::init_tokio(); let parent_count = Arc::new(AtomicUsize::new(0)); let inner_count = Arc::new(AtomicUsize::new(0)); let store = Store::new(User { name: None }); Effect::new_sync({ let parent_count = Arc::clone(&parent_count); move |prev: Option<()>| { if prev.is_none() { println!("parent: first run"); } else { println!("parent: next run"); } println!(" is_some = {}", store.name().read().is_some()); parent_count.fetch_add(1, Ordering::Relaxed); } }); Effect::new_sync({ let inner_count = Arc::clone(&inner_count); move |prev: Option<()>| { if prev.is_none() { println!("inner: first run"); } else { println!("inner: next run"); } println!( "store inner value length = {:?}", store.name().map(|inner| inner .first_name() .get() .unwrap_or_default() .len()) ); inner_count.fetch_add(1, Ordering::Relaxed); } }); tick().await; assert_eq!(parent_count.load(Ordering::Relaxed), 1); assert_eq!(inner_count.load(Ordering::Relaxed), 1); store.name().set(Some(Name { first_name: Some("Greg".into()), })); tick().await; assert_eq!(parent_count.load(Ordering::Relaxed), 2); assert_eq!(inner_count.load(Ordering::Relaxed), 2); println!("\nUpdating first name only"); store .name() .unwrap() .first_name() .write() .as_mut() .unwrap() .push_str("!!!"); tick().await; assert_eq!(parent_count.load(Ordering::Relaxed), 3); assert_eq!(inner_count.load(Ordering::Relaxed), 3); } #[tokio::test] async fn patch() { use crate::OptionStoreExt; _ = any_spawner::Executor::init_tokio(); #[derive(Debug, Clone, Store, Patch)] struct Outer { inner: Option<Inner>, } #[derive(Debug, Clone, Store, Patch)] struct Inner { first: String, second: String, } let store = Store::new(Outer { inner: Some(Inner { first: "A".to_owned(), second: "B".to_owned(), }), }); let parent_count = Arc::new(AtomicUsize::new(0)); let inner_first_count = Arc::new(AtomicUsize::new(0)); let inner_second_count = Arc::new(AtomicUsize::new(0)); Effect::new_sync({ let parent_count = Arc::clone(&parent_count); move |prev: Option<()>| { if prev.is_none() { println!("parent: first run"); } else { println!("parent: next run"); } println!(" value = {:?}", store.inner().get()); parent_count.fetch_add(1, Ordering::Relaxed); } }); Effect::new_sync({ let inner_first_count = Arc::clone(&inner_first_count); move |prev: Option<()>| { if prev.is_none() { println!("inner_first: first run"); } else { println!("inner_first: next run"); } // note: we specifically want to test whether using `.patch()` // correctly limits notifications on the first field when only the second // field has changed // // `.map()` would also track the parent field (to track when it changed from Some // to None), which would mean the notification numbers were always the same // // so here, we'll do `.map_untracked()`, but in general in a real case you'd want // to use `.map()` so that if the parent switches to None you do track that println!( " value = {:?}", store.inner().map_untracked(|inner| inner.first().get()) ); inner_first_count.fetch_add(1, Ordering::Relaxed); } }); Effect::new_sync({ let inner_second_count = Arc::clone(&inner_second_count); move |prev: Option<()>| { if prev.is_none() { println!("inner_second: first run"); } else { println!("inner_second: next run"); } println!( " value = {:?}", store.inner().map(|inner| inner.second().get()) ); inner_second_count.fetch_add(1, Ordering::Relaxed); } }); tick().await; assert_eq!(parent_count.load(Ordering::Relaxed), 1); assert_eq!(inner_first_count.load(Ordering::Relaxed), 1); assert_eq!(inner_second_count.load(Ordering::Relaxed), 1); println!("\npatching with A/C"); store.patch(Outer { inner: Some(Inner { first: "A".to_string(), second: "C".to_string(), }), }); tick().await; assert_eq!(parent_count.load(Ordering::Relaxed), 2); assert_eq!(inner_first_count.load(Ordering::Relaxed), 1); assert_eq!(inner_second_count.load(Ordering::Relaxed), 2); store.patch(Outer { inner: None }); tick().await; assert_eq!(parent_count.load(Ordering::Relaxed), 3); assert_eq!(inner_first_count.load(Ordering::Relaxed), 2); assert_eq!(inner_second_count.load(Ordering::Relaxed), 3); println!("\npatching with A/B"); store.patch(Outer { inner: Some(Inner { first: "A".to_string(), second: "B".to_string(), }), }); tick().await; assert_eq!(parent_count.load(Ordering::Relaxed), 4); assert_eq!(inner_first_count.load(Ordering::Relaxed), 2); assert_eq!(inner_second_count.load(Ordering::Relaxed), 4); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/deref.rs
reactive_stores/src/deref.rs
use crate::{ path::{StorePath, StorePathSegment}, store_field::StoreField, KeyMap, StoreFieldTrigger, }; use reactive_graph::{ signal::guards::{Mapped, MappedMut}, traits::{ DefinedAt, IsDisposed, Notify, ReadUntracked, Track, UntrackableGuard, Write, }, }; use std::{ ops::{Deref, DerefMut}, panic::Location, }; /// Maps a store field that is a smart pointer to a subfield of the dereferenced inner type. pub trait DerefField where Self: StoreField, Self::Value: Deref + DerefMut, <Self::Value as Deref>::Target: Sized + 'static, { /// Returns a new store field with the value mapped to the target type of dereferencing this /// field /// /// For example, if you have a store field with a `Box<T>`, `.deref_field()` will return a /// new store field containing a `T`. fn deref_field(self) -> DerefedField<Self>; } impl<S> DerefField for S where S: StoreField, S::Value: Deref + DerefMut, <S::Value as Deref>::Target: Sized + 'static, { #[track_caller] fn deref_field(self) -> DerefedField<Self> { DerefedField { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: self, } } } /// A wrapper from a store field containing a smart pointer to a store field containing the /// dereferenced target type of that smart pointer. #[derive(Debug, Copy, Clone)] pub struct DerefedField<S> { inner: S, #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, } impl<S> StoreField for DerefedField<S> where S: StoreField, S::Value: Deref + DerefMut, <S::Value as Deref>::Target: Sized + 'static, { type Value = <S::Value as Deref>::Target; type Reader = Mapped<S::Reader, Self::Value>; type Writer = MappedMut<S::Writer, Self::Value>; fn get_trigger(&self, path: StorePath) -> StoreFieldTrigger { self.inner.get_trigger(path) } fn get_trigger_unkeyed(&self, path: StorePath) -> StoreFieldTrigger { self.inner.get_trigger_unkeyed(path) } fn path(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner.path() } fn path_unkeyed(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner.path_unkeyed() } fn reader(&self) -> Option<Self::Reader> { let inner = self.inner.reader()?; Some(Mapped::new_with_guard(inner, |n| n.deref())) } fn writer(&self) -> Option<Self::Writer> { let inner = self.inner.writer()?; Some(MappedMut::new(inner, |n| n.deref(), |n| n.deref_mut())) } #[inline(always)] fn keys(&self) -> Option<KeyMap> { self.inner.keys() } } impl<S> DefinedAt for DerefedField<S> where S: StoreField, S::Value: Deref + DerefMut, <S::Value as Deref>::Target: Sized + 'static, { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<S> IsDisposed for DerefedField<S> where S: IsDisposed, { fn is_disposed(&self) -> bool { self.inner.is_disposed() } } impl<S> Notify for DerefedField<S> where S: StoreField, S::Value: Deref + DerefMut, <S::Value as Deref>::Target: Sized + 'static, { fn notify(&self) { let trigger = self.get_trigger(self.path().into_iter().collect()); trigger.this.notify(); trigger.children.notify(); } } impl<S> Track for DerefedField<S> where S: StoreField, S::Value: Deref + DerefMut, <S::Value as Deref>::Target: Sized + 'static, { fn track(&self) { self.track_field(); } } impl<S> ReadUntracked for DerefedField<S> where S: StoreField, S::Value: Deref + DerefMut, <S::Value as Deref>::Target: Sized + 'static, { type Value = <Self as StoreField>::Reader; fn try_read_untracked(&self) -> Option<Self::Value> { self.reader() } } impl<S> Write for DerefedField<S> where S: StoreField, S::Value: Deref + DerefMut, <S::Value as Deref>::Target: Sized + 'static, { type Value = <S::Value as Deref>::Target; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { self.writer() } fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { self.writer().map(|mut writer| { writer.untrack(); writer }) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/arc_field.rs
reactive_stores/src/arc_field.rs
use crate::{ path::{StorePath, StorePathSegment}, ArcStore, AtIndex, AtKeyed, DerefedField, KeyMap, KeyedSubfield, Store, StoreField, StoreFieldTrigger, Subfield, }; use reactive_graph::{ owner::Storage, traits::{ DefinedAt, IsDisposed, Notify, ReadUntracked, Track, UntrackableGuard, Write, }, }; use std::{ fmt::Debug, hash::Hash, ops::{Deref, DerefMut, IndexMut}, panic::Location, sync::Arc, }; /// Reference-counted access to a single field of type `T`. /// /// This can be used to erase the chain of field-accessors, to make it easier to pass this into /// another component or function without needing to specify the full type signature. pub struct ArcField<T> where T: 'static, { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, path: Arc<dyn Fn() -> StorePath + Send + Sync>, path_unkeyed: Arc<dyn Fn() -> StorePath + Send + Sync>, get_trigger: Arc<dyn Fn(StorePath) -> StoreFieldTrigger + Send + Sync>, get_trigger_unkeyed: Arc<dyn Fn(StorePath) -> StoreFieldTrigger + Send + Sync>, read: Arc<dyn Fn() -> Option<StoreFieldReader<T>> + Send + Sync>, pub(crate) write: Arc<dyn Fn() -> Option<StoreFieldWriter<T>> + Send + Sync>, keys: Arc<dyn Fn() -> Option<KeyMap> + Send + Sync>, track_field: Arc<dyn Fn() + Send + Sync>, notify: Arc<dyn Fn() + Send + Sync>, } impl<T> Debug for ArcField<T> where T: 'static, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { let mut f = f.debug_struct("ArcField"); #[cfg(any(debug_assertions, leptos_debuginfo))] let f = f.field("defined_at", &self.defined_at); f.finish_non_exhaustive() } } pub struct StoreFieldReader<T>(Box<dyn Deref<Target = T>>); impl<T> StoreFieldReader<T> { pub fn new(inner: impl Deref<Target = T> + 'static) -> Self { Self(Box::new(inner)) } } impl<T> Deref for StoreFieldReader<T> { type Target = T; fn deref(&self) -> &Self::Target { self.0.deref() } } pub struct StoreFieldWriter<T>(Box<dyn UntrackableGuard<Target = T>>); impl<T> StoreFieldWriter<T> { pub fn new(inner: impl UntrackableGuard<Target = T> + 'static) -> Self { Self(Box::new(inner)) } } impl<T> Deref for StoreFieldWriter<T> { type Target = T; fn deref(&self) -> &Self::Target { self.0.deref() } } impl<T> DerefMut for StoreFieldWriter<T> { fn deref_mut(&mut self) -> &mut Self::Target { self.0.deref_mut() } } impl<T> UntrackableGuard for StoreFieldWriter<T> { fn untrack(&mut self) { self.0.untrack(); } } impl<T> StoreField for ArcField<T> { type Value = T; type Reader = StoreFieldReader<T>; type Writer = StoreFieldWriter<T>; fn get_trigger(&self, path: StorePath) -> StoreFieldTrigger { (self.get_trigger)(path) } fn get_trigger_unkeyed(&self, path: StorePath) -> StoreFieldTrigger { (self.get_trigger_unkeyed)(path) } fn path(&self) -> impl IntoIterator<Item = StorePathSegment> { (self.path)() } fn path_unkeyed(&self) -> impl IntoIterator<Item = StorePathSegment> { (self.path_unkeyed)() } fn reader(&self) -> Option<Self::Reader> { (self.read)().map(StoreFieldReader::new) } fn writer(&self) -> Option<Self::Writer> { (self.write)().map(StoreFieldWriter::new) } fn keys(&self) -> Option<KeyMap> { (self.keys)() } } impl<T, S> From<Store<T, S>> for ArcField<T> where T: 'static, S: Storage<ArcStore<T>>, { #[track_caller] fn from(value: Store<T, S>) -> Self { ArcField { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), path: Arc::new(move || value.path().into_iter().collect()), path_unkeyed: Arc::new(move || { value.path_unkeyed().into_iter().collect() }), get_trigger: Arc::new(move |path| value.get_trigger(path)), get_trigger_unkeyed: Arc::new(move |path| { value.get_trigger_unkeyed(path) }), read: Arc::new(move || value.reader().map(StoreFieldReader::new)), write: Arc::new(move || value.writer().map(StoreFieldWriter::new)), keys: Arc::new(move || value.keys()), track_field: Arc::new(move || value.track_field()), notify: Arc::new(move || value.notify()), } } } impl<T> From<ArcStore<T>> for ArcField<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ArcStore<T>) -> Self { ArcField { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), path: Arc::new({ let value = value.clone(); move || value.path().into_iter().collect() }), path_unkeyed: Arc::new({ let value = value.clone(); move || value.path_unkeyed().into_iter().collect() }), get_trigger: Arc::new({ let value = value.clone(); move |path| value.get_trigger(path) }), get_trigger_unkeyed: Arc::new({ let value = value.clone(); move |path| value.get_trigger_unkeyed(path) }), read: Arc::new({ let value = value.clone(); move || value.reader().map(StoreFieldReader::new) }), write: Arc::new({ let value = value.clone(); move || value.writer().map(StoreFieldWriter::new) }), keys: Arc::new({ let value = value.clone(); move || value.keys() }), track_field: Arc::new({ let value = value.clone(); move || value.track_field() }), notify: Arc::new({ let value = value.clone(); move || value.notify() }), } } } impl<Inner, Prev, T> From<Subfield<Inner, Prev, T>> for ArcField<T> where T: Send + Sync, Subfield<Inner, Prev, T>: Clone, Inner: StoreField<Value = Prev> + Send + Sync + 'static, Prev: 'static, { #[track_caller] fn from(value: Subfield<Inner, Prev, T>) -> Self { ArcField { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), path: Arc::new({ let value = value.clone(); move || value.path().into_iter().collect() }), path_unkeyed: Arc::new({ let value = value.clone(); move || value.path_unkeyed().into_iter().collect() }), get_trigger: Arc::new({ let value = value.clone(); move |path| value.get_trigger(path) }), get_trigger_unkeyed: Arc::new({ let value = value.clone(); move |path| value.get_trigger_unkeyed(path) }), read: Arc::new({ let value = value.clone(); move || value.reader().map(StoreFieldReader::new) }), write: Arc::new({ let value = value.clone(); move || value.writer().map(StoreFieldWriter::new) }), keys: Arc::new({ let value = value.clone(); move || value.keys() }), track_field: Arc::new({ let value = value.clone(); move || value.track_field() }), notify: Arc::new({ let value = value.clone(); move || value.notify() }), } } } impl<Inner, T> From<DerefedField<Inner>> for ArcField<T> where Inner: Clone + StoreField + Send + Sync + 'static, Inner::Value: Deref<Target = T> + DerefMut, T: Sized + 'static, { #[track_caller] fn from(value: DerefedField<Inner>) -> Self { ArcField { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), path: Arc::new({ let value = value.clone(); move || value.path().into_iter().collect() }), path_unkeyed: Arc::new({ let value = value.clone(); move || value.path_unkeyed().into_iter().collect() }), get_trigger: Arc::new({ let value = value.clone(); move |path| value.get_trigger(path) }), get_trigger_unkeyed: Arc::new({ let value = value.clone(); move |path| value.get_trigger_unkeyed(path) }), read: Arc::new({ let value = value.clone(); move || value.reader().map(StoreFieldReader::new) }), write: Arc::new({ let value = value.clone(); move || value.writer().map(StoreFieldWriter::new) }), keys: Arc::new({ let value = value.clone(); move || value.keys() }), track_field: Arc::new({ let value = value.clone(); move || value.track_field() }), notify: Arc::new({ let value = value.clone(); move || value.notify() }), } } } impl<Inner, Prev> From<AtIndex<Inner, Prev>> for ArcField<Prev::Output> where AtIndex<Inner, Prev>: Clone, Inner: StoreField<Value = Prev> + Send + Sync + 'static, Prev: IndexMut<usize> + Send + Sync + 'static, Prev::Output: Sized + Send + Sync, { #[track_caller] fn from(value: AtIndex<Inner, Prev>) -> Self { ArcField { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), path: Arc::new({ let value = value.clone(); move || value.path().into_iter().collect() }), path_unkeyed: Arc::new({ let value = value.clone(); move || value.path_unkeyed().into_iter().collect() }), get_trigger: Arc::new({ let value = value.clone(); move |path| value.get_trigger(path) }), get_trigger_unkeyed: Arc::new({ let value = value.clone(); move |path| value.get_trigger_unkeyed(path) }), read: Arc::new({ let value = value.clone(); move || value.reader().map(StoreFieldReader::new) }), write: Arc::new({ let value = value.clone(); move || value.writer().map(StoreFieldWriter::new) }), keys: Arc::new({ let value = value.clone(); move || value.keys() }), track_field: Arc::new({ let value = value.clone(); move || value.track_field() }), notify: Arc::new({ let value = value.clone(); move || value.notify() }), } } } impl<Inner, Prev, K, T> From<AtKeyed<Inner, Prev, K, T>> for ArcField<T::Output> where AtKeyed<Inner, Prev, K, T>: Clone, K: Debug + Send + Sync + PartialEq + Eq + Hash + 'static, KeyedSubfield<Inner, Prev, K, T>: Clone, for<'a> &'a T: IntoIterator, Inner: StoreField<Value = Prev> + Send + Sync + 'static, Prev: 'static, T: IndexMut<usize> + 'static, T::Output: Sized, { #[track_caller] fn from(value: AtKeyed<Inner, Prev, K, T>) -> Self { ArcField { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), path: Arc::new({ let value = value.clone(); move || value.path().into_iter().collect() }), path_unkeyed: Arc::new({ let value = value.clone(); move || value.path_unkeyed().into_iter().collect() }), get_trigger: Arc::new({ let value = value.clone(); move |path| value.get_trigger(path) }), get_trigger_unkeyed: Arc::new({ let value = value.clone(); move |path| value.get_trigger_unkeyed(path) }), read: Arc::new({ let value = value.clone(); move || value.reader().map(StoreFieldReader::new) }), write: Arc::new({ let value = value.clone(); move || value.writer().map(StoreFieldWriter::new) }), keys: Arc::new({ let value = value.clone(); move || value.keys() }), track_field: Arc::new({ let value = value.clone(); move || value.track_field() }), notify: Arc::new({ let value = value.clone(); move || value.notify() }), } } } impl<T> Clone for ArcField<T> { fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, path: self.path.clone(), path_unkeyed: self.path_unkeyed.clone(), get_trigger: Arc::clone(&self.get_trigger), get_trigger_unkeyed: Arc::clone(&self.get_trigger_unkeyed), read: Arc::clone(&self.read), write: Arc::clone(&self.write), keys: Arc::clone(&self.keys), track_field: Arc::clone(&self.track_field), notify: Arc::clone(&self.notify), } } } impl<T> DefinedAt for ArcField<T> { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T> Notify for ArcField<T> { fn notify(&self) { (self.notify)() } } impl<T> Track for ArcField<T> { fn track(&self) { (self.track_field)(); } } impl<T> ReadUntracked for ArcField<T> { type Value = StoreFieldReader<T>; fn try_read_untracked(&self) -> Option<Self::Value> { (self.read)() } } impl<T> Write for ArcField<T> { type Value = T; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { (self.write)() } fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { let mut guard = (self.write)()?; guard.untrack(); Some(guard) } } impl<T> IsDisposed for ArcField<T> { fn is_disposed(&self) -> bool { false } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/iter.rs
reactive_stores/src/iter.rs
use crate::{ len::Len, path::{StorePath, StorePathSegment}, store_field::StoreField, KeyMap, StoreFieldTrigger, }; use reactive_graph::{ signal::{ guards::{MappedMutArc, WriteGuard}, ArcTrigger, }, traits::{ DefinedAt, IsDisposed, Notify, ReadUntracked, Track, UntrackableGuard, Write, }, }; use std::{ iter, marker::PhantomData, ops::{DerefMut, IndexMut}, panic::Location, }; /// Provides access to the data at some index in another collection. #[derive(Debug)] pub struct AtIndex<Inner, Prev> { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, inner: Inner, index: usize, ty: PhantomData<Prev>, } impl<Inner, Prev> Clone for AtIndex<Inner, Prev> where Inner: Clone, { fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, inner: self.inner.clone(), index: self.index, ty: self.ty, } } } impl<Inner, Prev> Copy for AtIndex<Inner, Prev> where Inner: Copy {} impl<Inner, Prev> AtIndex<Inner, Prev> { /// Creates a new accessor for the inner collection at the given index. #[track_caller] pub fn new(inner: Inner, index: usize) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner, index, ty: PhantomData, } } } impl<Inner, Prev> StoreField for AtIndex<Inner, Prev> where Inner: StoreField<Value = Prev>, Prev: IndexMut<usize> + 'static, Prev::Output: Sized, { type Value = Prev::Output; type Reader = MappedMutArc<Inner::Reader, Prev::Output>; type Writer = MappedMutArc<WriteGuard<ArcTrigger, Inner::Writer>, Prev::Output>; fn path(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner .path() .into_iter() .chain(iter::once(self.index.into())) } fn path_unkeyed(&self) -> impl IntoIterator<Item = StorePathSegment> { self.inner .path_unkeyed() .into_iter() .chain(iter::once(self.index.into())) } fn get_trigger(&self, path: StorePath) -> StoreFieldTrigger { self.inner.get_trigger(path) } fn get_trigger_unkeyed(&self, path: StorePath) -> StoreFieldTrigger { self.inner.get_trigger_unkeyed(path) } fn reader(&self) -> Option<Self::Reader> { let inner = self.inner.reader()?; let index = self.index; Some(MappedMutArc::new( inner, move |n| &n[index], move |n| &mut n[index], )) } fn writer(&self) -> Option<Self::Writer> { let trigger = self.get_trigger(self.path().into_iter().collect()); let inner = WriteGuard::new(trigger.children, self.inner.writer()?); let index = self.index; Some(MappedMutArc::new( inner, move |n| &n[index], move |n| &mut n[index], )) } #[inline(always)] fn keys(&self) -> Option<KeyMap> { self.inner.keys() } fn track_field(&self) { let mut full_path = self.path().into_iter().collect::<StorePath>(); let trigger = self.get_trigger(self.path().into_iter().collect()); trigger.this.track(); trigger.children.track(); // tracks `this` for all ancestors: i.e., it will track any change that is made // directly to one of its ancestors, but not a change made to a *child* of an ancestor // (which would end up with every subfield tracking its own siblings, because they are // children of its parent) while !full_path.is_empty() { full_path.pop(); let inner = self.get_trigger(full_path.clone()); inner.this.track(); } } } impl<Inner, Prev> DefinedAt for AtIndex<Inner, Prev> where Inner: StoreField<Value = Prev>, { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<Inner, Prev> IsDisposed for AtIndex<Inner, Prev> where Inner: StoreField<Value = Prev> + IsDisposed, { fn is_disposed(&self) -> bool { self.inner.is_disposed() } } impl<Inner, Prev> Notify for AtIndex<Inner, Prev> where Inner: StoreField<Value = Prev>, Prev: IndexMut<usize> + 'static, Prev::Output: Sized, { fn notify(&self) { let trigger = self.get_trigger(self.path().into_iter().collect()); trigger.this.notify(); } } impl<Inner, Prev> Track for AtIndex<Inner, Prev> where Inner: StoreField<Value = Prev> + Send + Sync + Clone + 'static, Prev: IndexMut<usize> + 'static, Prev::Output: Sized + 'static, { fn track(&self) { self.track_field(); } } impl<Inner, Prev> ReadUntracked for AtIndex<Inner, Prev> where Inner: StoreField<Value = Prev>, Prev: IndexMut<usize> + 'static, Prev::Output: Sized, { type Value = <Self as StoreField>::Reader; fn try_read_untracked(&self) -> Option<Self::Value> { self.reader() } } impl<Inner, Prev> Write for AtIndex<Inner, Prev> where Inner: StoreField<Value = Prev>, Prev: IndexMut<usize> + 'static, Prev::Output: Sized + 'static, { type Value = Prev::Output; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { self.writer() } fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { self.writer().map(|mut writer| { writer.untrack(); writer }) } } /// Provides unkeyed reactive access to the fields of some collection. pub trait StoreFieldIterator<Prev> where Self: StoreField<Value = Prev>, { /// Reactive access to the value at some index. fn at_unkeyed(self, index: usize) -> AtIndex<Self, Prev>; /// An iterator over the values in the collection. fn iter_unkeyed(self) -> StoreFieldIter<Self, Prev>; } impl<Inner, Prev> StoreFieldIterator<Prev> for Inner where Inner: StoreField<Value = Prev> + Clone, Prev::Output: Sized, Prev: IndexMut<usize> + Len, { #[track_caller] fn at_unkeyed(self, index: usize) -> AtIndex<Inner, Prev> { AtIndex::new(self.clone(), index) } #[track_caller] fn iter_unkeyed(self) -> StoreFieldIter<Inner, Prev> { // reactively track changes to this field let trigger = self.get_trigger(self.path().into_iter().collect()); trigger.this.track(); trigger.children.track(); // get the current length of the field by accessing slice let len = self.reader().map(|n| n.len()).unwrap_or(0); // return the iterator StoreFieldIter { inner: self, idx: 0, len, prev: PhantomData, } } } /// An iterator over the values in a collection, as reactive fields. pub struct StoreFieldIter<Inner, Prev> { inner: Inner, idx: usize, len: usize, prev: PhantomData<Prev>, } impl<Inner, Prev> Iterator for StoreFieldIter<Inner, Prev> where Inner: StoreField<Value = Prev> + Clone + 'static, Prev: IndexMut<usize> + 'static, Prev::Output: Sized + 'static, { type Item = AtIndex<Inner, Prev>; fn next(&mut self) -> Option<Self::Item> { if self.idx < self.len { let field = AtIndex::new(self.inner.clone(), self.idx); self.idx += 1; Some(field) } else { None } } } impl<Inner, Prev> DoubleEndedIterator for StoreFieldIter<Inner, Prev> where Inner: StoreField<Value = Prev> + Clone + 'static, Prev: IndexMut<usize> + 'static, Prev::Output: Sized + 'static, { fn next_back(&mut self) -> Option<Self::Item> { if self.len > self.idx { self.len -= 1; let field = AtIndex::new(self.inner.clone(), self.len); Some(field) } else { None } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/len.rs
reactive_stores/src/len.rs
use std::{ borrow::Cow, collections::{LinkedList, VecDeque}, }; /// A trait for getting the length of a collection. pub trait Len { /// Returns the length of the collection. fn len(&self) -> usize; /// Returns true if the collection is empty #[inline(always)] fn is_empty(&self) -> bool { self.len() == 0 } } macro_rules! delegate_impl_len { (<$($lt: lifetime,)*$($generics: ident,)*> $ty:ty) => { impl<$($lt,)*$($generics,)*> Len for $ty { #[inline(always)] fn len(&self) -> usize { <$ty>::len(self) } #[inline(always)] fn is_empty(&self) -> bool { <$ty>::is_empty(self) } } impl<$($lt,)*$($generics,)*> Len for &$ty { #[inline(always)] fn len(&self) -> usize { Len::len(*self) } #[inline(always)] fn is_empty(&self) -> bool { Len::is_empty(*self) } } impl<$($lt,)*$($generics,)*> Len for &mut $ty { #[inline(always)] fn len(&self) -> usize { Len::len(*self) } #[inline(always)] fn is_empty(&self) -> bool { Len::is_empty(*self) } } }; ($ty:ty) => { delegate_impl_len!(<> $ty); }; } delegate_impl_len!(<T,> [T]); delegate_impl_len!(<T,> Vec<T>); delegate_impl_len!(str); delegate_impl_len!(String); impl Len for Cow<'_, str> { #[inline(always)] fn len(&self) -> usize { <str>::len(self) } #[inline(always)] fn is_empty(&self) -> bool { <str>::is_empty(self) } } impl Len for &Cow<'_, str> { #[inline(always)] fn len(&self) -> usize { Len::len(*self) } #[inline(always)] fn is_empty(&self) -> bool { Len::is_empty(*self) } } impl Len for &mut Cow<'_, str> { #[inline(always)] fn len(&self) -> usize { Len::len(*self) } #[inline(always)] fn is_empty(&self) -> bool { Len::is_empty(*self) } } impl<T> Len for Cow<'_, [T]> where [T]: ToOwned, { #[inline(always)] fn len(&self) -> usize { <[T]>::len(self) } #[inline(always)] fn is_empty(&self) -> bool { <[T]>::is_empty(self) } } impl<T> Len for &Cow<'_, [T]> where [T]: ToOwned, { #[inline(always)] fn len(&self) -> usize { Len::len(*self) } #[inline(always)] fn is_empty(&self) -> bool { Len::is_empty(*self) } } impl<T> Len for &mut Cow<'_, [T]> where [T]: ToOwned, { #[inline(always)] fn len(&self) -> usize { Len::len(*self) } #[inline(always)] fn is_empty(&self) -> bool { Len::is_empty(*self) } } impl<T> Len for VecDeque<T> { #[inline(always)] fn len(&self) -> usize { <VecDeque<T>>::len(self) } #[inline(always)] fn is_empty(&self) -> bool { <VecDeque<T>>::is_empty(self) } } impl<T> Len for &VecDeque<T> { #[inline(always)] fn len(&self) -> usize { Len::len(*self) } #[inline(always)] fn is_empty(&self) -> bool { Len::is_empty(*self) } } impl<T> Len for &mut VecDeque<T> { #[inline(always)] fn len(&self) -> usize { Len::len(&**self) } #[inline(always)] fn is_empty(&self) -> bool { Len::is_empty(*self) } } impl<T> Len for LinkedList<T> { #[inline(always)] fn len(&self) -> usize { <LinkedList<T>>::len(self) } #[inline(always)] fn is_empty(&self) -> bool { <LinkedList<T>>::is_empty(self) } } impl<T> Len for &LinkedList<T> { #[inline(always)] fn len(&self) -> usize { Len::len(*self) } #[inline(always)] fn is_empty(&self) -> bool { Len::is_empty(*self) } } impl<T> Len for &mut LinkedList<T> { #[inline(always)] fn len(&self) -> usize { Len::len(&**self) } #[inline(always)] fn is_empty(&self) -> bool { Len::is_empty(*self) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_stores/src/patch.rs
reactive_stores/src/patch.rs
use crate::{path::StorePath, StoreField}; use itertools::{EitherOrBoth, Itertools}; use reactive_graph::traits::{Notify, UntrackableGuard}; use std::{ borrow::Cow, net::{IpAddr, Ipv4Addr, Ipv6Addr, SocketAddr, SocketAddrV4, SocketAddrV6}, num::{ NonZeroI128, NonZeroI16, NonZeroI32, NonZeroI64, NonZeroI8, NonZeroIsize, NonZeroU128, NonZeroU16, NonZeroU32, NonZeroU64, NonZeroU8, NonZeroUsize, }, rc::Rc, sync::Arc, }; /// Allows updating a store or field in place with a new value. pub trait Patch { /// The type of the new value. type Value; /// Patches a store or field with a new value, only notifying fields that have changed. fn patch(&self, new: Self::Value); } impl<T> Patch for T where T: StoreField, T::Value: PatchField, { type Value = T::Value; fn patch(&self, new: Self::Value) { let path = self.path_unkeyed().into_iter().collect::<StorePath>(); if let Some(mut writer) = self.writer() { // don't track the writer for the whole store writer.untrack(); let mut notify = |path: &StorePath| { self.triggers_for_path_unkeyed(path.to_owned()).notify(); }; writer.patch_field(new, &path, &mut notify); } } } /// Allows patching a store field with some new value. pub trait PatchField { /// Patches the field with some new value, only notifying if the value has changed. fn patch_field( &mut self, new: Self, path: &StorePath, notify: &mut dyn FnMut(&StorePath), ); } macro_rules! patch_primitives { ($($ty:ty),*) => { $(impl PatchField for $ty { fn patch_field( &mut self, new: Self, path: &StorePath, notify: &mut dyn FnMut(&StorePath), ) { if new != *self { *self = new; notify(path); } } })* }; } patch_primitives! { &str, String, Arc<str>, Rc<str>, Cow<'_, str>, usize, u8, u16, u32, u64, u128, isize, i8, i16, i32, i64, i128, f32, f64, char, bool, IpAddr, SocketAddr, SocketAddrV4, SocketAddrV6, Ipv4Addr, Ipv6Addr, NonZeroI8, NonZeroU8, NonZeroI16, NonZeroU16, NonZeroI32, NonZeroU32, NonZeroI64, NonZeroU64, NonZeroI128, NonZeroU128, NonZeroIsize, NonZeroUsize } impl<T> PatchField for Option<T> where T: PatchField, { fn patch_field( &mut self, new: Self, path: &StorePath, notify: &mut dyn FnMut(&StorePath), ) { match (self, new) { (None, None) => {} (old @ Some(_), None) => { old.take(); notify(path); } (old @ None, new @ Some(_)) => { *old = new; notify(path); } (Some(old), Some(new)) => { let mut new_path = path.to_owned(); new_path.push(0); old.patch_field(new, &new_path, notify); } } } } impl<T> PatchField for Vec<T> where T: PatchField, { fn patch_field( &mut self, new: Self, path: &StorePath, notify: &mut dyn FnMut(&StorePath), ) { if self.is_empty() && new.is_empty() { return; } if new.is_empty() { self.clear(); notify(path); } else if self.is_empty() { self.extend(new); notify(path); } else { let mut adds = vec![]; let mut removes_at_end = 0; let mut new_path = path.to_owned(); new_path.push(0); for (idx, item) in new.into_iter().zip_longest(self.iter_mut()).enumerate() { match item { EitherOrBoth::Both(new, old) => { old.patch_field(new, &new_path, notify); } EitherOrBoth::Left(new) => { adds.push(new); } EitherOrBoth::Right(_) => { removes_at_end += 1; } } new_path.replace_last(idx + 1); } let length_changed = removes_at_end > 0 || !adds.is_empty(); self.truncate(self.len() - removes_at_end); self.append(&mut adds); if length_changed { notify(path); } } } } macro_rules! patch_tuple { ($($ty:ident),*) => { impl<$($ty),*> PatchField for ($($ty,)*) where $($ty: PatchField),*, { fn patch_field( &mut self, new: Self, path: &StorePath, notify: &mut dyn FnMut(&StorePath), ) { let mut idx = 0; let mut new_path = path.to_owned(); new_path.push(0); paste::paste! { #[allow(non_snake_case)] let ($($ty,)*) = self; let ($([<new_ $ty:lower>],)*) = new; $( $ty.patch_field([<new_ $ty:lower>], &new_path, notify); idx += 1; new_path.replace_last(idx); )* } } } } } impl PatchField for () { fn patch_field( &mut self, _new: Self, _path: &StorePath, _notify: &mut dyn FnMut(&StorePath), ) { } } patch_tuple!(A); patch_tuple!(A, B); patch_tuple!(A, B, C); patch_tuple!(A, B, C, D); patch_tuple!(A, B, C, D, E); patch_tuple!(A, B, C, D, E, F); patch_tuple!(A, B, C, D, E, F, G); patch_tuple!(A, B, C, D, E, F, G, H); patch_tuple!(A, B, C, D, E, F, G, H, I); patch_tuple!(A, B, C, D, E, F, G, H, I, J); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K, L); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K, L, M); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K, L, M, N); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U); patch_tuple!(A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V); patch_tuple!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W ); patch_tuple!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X ); patch_tuple!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X, Y ); patch_tuple!( A, B, C, D, E, F, G, H, I, J, K, L, M, N, O, P, Q, R, S, T, U, V, W, X, Y, Z );
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/integrations/axum/src/lib.rs
integrations/axum/src/lib.rs
#![forbid(unsafe_code)] #![deny(missing_docs)] #![allow(clippy::type_complexity)] //! Provides functions to easily integrate Leptos with Axum. //! //! ## JS Fetch Integration //! The `leptos_axum` integration supports running in JavaScript-hosted WebAssembly //! runtimes, e.g., running inside Deno, Cloudflare Workers, or other JS environments. //! To run in this environment, you need to disable the default feature set and enable //! the `wasm` feature on `leptos_axum` in your `Cargo.toml`. //! ```toml //! leptos_axum = { version = "0.6.0", default-features = false, features = ["wasm"] } //! ``` //! //! ## Features //! - `default`: supports running in a typical native Tokio/Axum environment //! - `wasm`: with `default-features = false`, supports running in a JS Fetch-based //! environment //! //! ### Important Note //! Prior to 0.5, using `default-features = false` on `leptos_axum` simply did nothing. Now, it actively //! disables features necessary to support the normal native/Tokio runtime environment we create. This can //! generate errors like the following, which don’t point to an obvious culprit: //! ` //! `spawn_local` called from outside of a `task::LocalSet` //! ` //! If you are not using the `wasm` feature, do not set `default-features = false` on this package. //! //! //! ## More information //! //! For more details on how to use the integrations, see the //! [`examples`](https://github.com/leptos-rs/leptos/tree/main/examples) //! directory in the Leptos repository. #[cfg(feature = "default")] use axum::http::Uri; use axum::{ body::{Body, Bytes}, extract::{FromRef, FromRequestParts, MatchedPath, State}, http::{ header::{self, HeaderName, HeaderValue, ACCEPT, LOCATION, REFERER}, request::Parts, HeaderMap, Method, Request, Response, StatusCode, }, response::IntoResponse, routing::{delete, get, patch, post, put}, }; #[cfg(feature = "default")] use dashmap::DashMap; use futures::{stream::once, Future, Stream, StreamExt}; use hydration_context::SsrSharedContext; use leptos::{ config::LeptosOptions, context::{provide_context, use_context}, prelude::*, reactive::{computed::ScopedFuture, owner::Owner}, IntoView, }; use leptos_integration_utils::{ BoxedFnOnce, ExtendResponse, PinnedFuture, PinnedStream, }; use leptos_meta::ServerMetaContext; #[cfg(feature = "default")] use leptos_router::static_routes::ResolvedStaticPath; use leptos_router::{ components::provide_server_redirect, location::RequestUrl, static_routes::RegenerationFn, ExpandOptionals, PathSegment, RouteList, RouteListing, SsrMode, }; use parking_lot::RwLock; use server_fn::{error::ServerFnErrorErr, redirect::REDIRECT_HEADER}; #[cfg(feature = "default")] use std::path::Path; #[cfg(feature = "default")] use std::sync::LazyLock; use std::{collections::HashSet, fmt::Debug, io, pin::Pin, sync::Arc}; #[cfg(feature = "default")] use tower::util::ServiceExt; #[cfg(feature = "default")] use tower_http::services::ServeDir; // use tracing::Instrument; // TODO check tracing span -- was this used in 0.6 for a missing link? /// This struct lets you define headers and override the status of the Response from an Element or a Server Function /// Typically contained inside of a ResponseOptions. Setting this is useful for cookies and custom responses. #[derive(Debug, Clone, Default)] pub struct ResponseParts { /// If provided, this will overwrite any other status code for this response. pub status: Option<StatusCode>, /// The map of headers that should be added to the response. pub headers: HeaderMap, } impl ResponseParts { /// Insert a header, overwriting any previous value with the same key pub fn insert_header(&mut self, key: HeaderName, value: HeaderValue) { self.headers.insert(key, value); } /// Append a header, leaving any header with the same key intact pub fn append_header(&mut self, key: HeaderName, value: HeaderValue) { self.headers.append(key, value); } } /// Allows you to override details of the HTTP response like the status code and add Headers/Cookies. /// /// `ResponseOptions` is provided via context when you use most of the handlers provided in this /// crate, including [`.leptos_routes`](LeptosRoutes::leptos_routes), /// [`.leptos_routes_with_context`](LeptosRoutes::leptos_routes_with_context), [`handle_server_fns`], etc. /// You can find the full set of provided context types in each handler function. /// /// If you provide your own handler, you will need to provide `ResponseOptions` via context /// yourself if you want to access it via context. /// ``` /// use leptos::prelude::*; /// /// #[server] /// pub async fn get_opts() -> Result<(), ServerFnError> { /// let opts = expect_context::<leptos_axum::ResponseOptions>(); /// Ok(()) /// } #[derive(Debug, Clone, Default)] pub struct ResponseOptions(pub Arc<RwLock<ResponseParts>>); impl ResponseOptions { /// A simpler way to overwrite the contents of `ResponseOptions` with a new `ResponseParts`. pub fn overwrite(&self, parts: ResponseParts) { let mut writable = self.0.write(); *writable = parts } /// Set the status of the returned Response. pub fn set_status(&self, status: StatusCode) { let mut writeable = self.0.write(); let res_parts = &mut *writeable; res_parts.status = Some(status); } /// Insert a header, overwriting any previous value with the same key. pub fn insert_header(&self, key: HeaderName, value: HeaderValue) { let mut writeable = self.0.write(); let res_parts = &mut *writeable; res_parts.headers.insert(key, value); } /// Append a header, leaving any header with the same key intact. pub fn append_header(&self, key: HeaderName, value: HeaderValue) { let mut writeable = self.0.write(); let res_parts = &mut *writeable; res_parts.headers.append(key, value); } } struct AxumResponse(Response<Body>); impl ExtendResponse for AxumResponse { type ResponseOptions = ResponseOptions; fn from_stream( stream: impl Stream<Item = String> + Send + 'static, ) -> Self { AxumResponse( Body::from_stream( stream.map(|chunk| Ok(chunk) as Result<String, std::io::Error>), ) .into_response(), ) } fn extend_response(&mut self, res_options: &Self::ResponseOptions) { let mut res_options = res_options.0.write(); if let Some(status) = res_options.status { *self.0.status_mut() = status; } self.0 .headers_mut() .extend(std::mem::take(&mut res_options.headers)); } fn set_default_content_type(&mut self, content_type: &str) { let headers = self.0.headers_mut(); if !headers.contains_key(header::CONTENT_TYPE) { // Set the Content Type headers on all responses. This makes Firefox show the page source // without complaining headers.insert( header::CONTENT_TYPE, HeaderValue::from_str(content_type).unwrap(), ); } } } /// Provides an easy way to redirect the user from within a server function. /// /// Calling `redirect` in a server function will redirect the browser in three /// situations: /// 1. A server function that is calling in a [blocking /// resource](leptos::server::Resource::new_blocking). /// 2. A server function that is called from WASM running in the client (e.g., a dispatched action /// or a spawned `Future`). /// 3. A `<form>` submitted to the server function endpoint using default browser APIs (often due /// to using [`ActionForm`] without JS/WASM present.) /// /// Using it with a non-blocking [`Resource`] will not work if you are using streaming rendering, /// as the response's headers will already have been sent by the time the server function calls `redirect()`. /// /// ### Implementation /// /// This sets the `Location` header to the URL given. /// /// If the route or server function in which this is called is being accessed /// by an ordinary `GET` request or an HTML `<form>` without any enhancement, it also sets a /// status code of `302` for a temporary redirect. (This is determined by whether the `Accept` /// header contains `text/html` as it does for an ordinary navigation.) /// /// Otherwise, it sets a custom header that indicates to the client that it should redirect, /// without actually setting the status code. This means that the client will not follow the /// redirect, and can therefore return the value of the server function and then handle /// the redirect with client-side routing. pub fn redirect(path: &str) { if let (Some(req), Some(res)) = (use_context::<Parts>(), use_context::<ResponseOptions>()) { // insert the Location header in any case res.insert_header( header::LOCATION, header::HeaderValue::from_str(path) .expect("Failed to create HeaderValue"), ); let accepts_html = req .headers .get(ACCEPT) .and_then(|v| v.to_str().ok()) .map(|v| v.contains("text/html")) .unwrap_or(false); if accepts_html { // if the request accepts text/html, it's a plain form request and needs // to have the 302 code set res.set_status(StatusCode::FOUND); } else { // otherwise, we sent it from the server fn client and actually don't want // to set a real redirect, as this will break the ability to return data // instead, set the REDIRECT_HEADER to indicate that the client should redirect res.insert_header( HeaderName::from_static(REDIRECT_HEADER), HeaderValue::from_str("").unwrap(), ); } } else { #[cfg(feature = "tracing")] { tracing::warn!( "Couldn't retrieve either Parts or ResponseOptions while \ trying to redirect()." ); } #[cfg(not(feature = "tracing"))] { eprintln!( "Couldn't retrieve either Parts or ResponseOptions while \ trying to redirect()." ); } } } /// Decomposes an HTTP request into its parts, allowing you to read its headers /// and other data without consuming the body. Creates a new Request from the /// original parts for further processing pub fn generate_request_and_parts( req: Request<Body>, ) -> (Request<Body>, Parts) { let (parts, body) = req.into_parts(); let parts2 = parts.clone(); (Request::from_parts(parts, body), parts2) } /// An Axum handlers to listens for a request with Leptos server function arguments in the body, /// run the server function if found, and return the resulting [`Response`]. /// /// This can then be set up at an appropriate route in your application: /// /// ```no_run /// use axum::{handler::Handler, routing::post, Router}; /// use leptos::prelude::*; /// use std::net::SocketAddr; /// /// #[cfg(feature = "default")] /// #[tokio::main] /// async fn main() { /// let addr = SocketAddr::from(([127, 0, 0, 1], 8082)); /// /// // build our application with a route /// let app = Router::new() /// .route("/api/*fn_name", post(leptos_axum::handle_server_fns)); /// /// // run our app with hyper /// let listener = tokio::net::TcpListener::bind(&addr).await.unwrap(); /// axum::serve(listener, app.into_make_service()) /// .await /// .unwrap(); /// } /// /// # #[cfg(not(feature = "default"))] /// # fn main() { } /// ``` /// Leptos provides a generic implementation of `handle_server_fns`. If access to more specific parts of the Request is desired, /// you can specify your own server fn handler based on this one and give it it's own route in the server macro. /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [`Parts`] /// - [`ResponseOptions`] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub async fn handle_server_fns(req: Request<Body>) -> impl IntoResponse { handle_server_fns_inner(|| {}, req).await } fn init_executor() { #[cfg(feature = "wasm")] let _ = any_spawner::Executor::init_wasm_bindgen(); #[cfg(all(not(feature = "wasm"), feature = "default"))] let _ = any_spawner::Executor::init_tokio(); #[cfg(all(not(feature = "wasm"), not(feature = "default")))] { eprintln!( "It appears you have set 'default-features = false' on \ 'leptos_axum', but are not using the 'wasm' feature. Either \ remove 'default-features = false' or, if you are running in a \ JS-hosted WASM server environment, add the 'wasm' feature." ); } } /// An Axum handlers to listens for a request with Leptos server function arguments in the body, /// run the server function if found, and return the resulting [`Response`]. /// /// This can then be set up at an appropriate route in your application: /// /// This version allows you to pass in a closure to capture additional data from the layers above leptos /// and store it in context. To use it, you'll need to define your own route, and a handler function /// that takes in the data you'd like. See the [render_app_to_stream_with_context] docs for an example /// of one that should work much like this one. /// /// **NOTE**: If your server functions expect a context, make sure to provide it both in /// [`handle_server_fns_with_context`] **and** in /// [`leptos_routes_with_context`](LeptosRoutes::leptos_routes_with_context) (or whatever /// rendering method you are using). During SSR, server functions are called by the rendering /// method, while subsequent calls from the client are handled by the server function handler. /// The same context needs to be provided to both handlers. /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [`Parts`] /// - [`ResponseOptions`] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub async fn handle_server_fns_with_context( additional_context: impl Fn() + 'static + Clone + Send, req: Request<Body>, ) -> impl IntoResponse { handle_server_fns_inner(additional_context, req).await } async fn handle_server_fns_inner( additional_context: impl Fn() + 'static + Clone + Send, req: Request<Body>, ) -> impl IntoResponse { let method = req.method().clone(); let path = req.uri().path().to_string(); let (req, parts) = generate_request_and_parts(req); if let Some(mut service) = server_fn::axum::get_server_fn_service(&path, method) { let owner = Owner::new(); owner .with(|| { ScopedFuture::new(async move { provide_context(parts); let res_options = ResponseOptions::default(); provide_context(res_options.clone()); additional_context(); // store Accepts and Referer in case we need them for redirect (below) let accepts_html = req .headers() .get(ACCEPT) .and_then(|v| v.to_str().ok()) .map(|v| v.contains("text/html")) .unwrap_or(false); let referrer = req.headers().get(REFERER).cloned(); // actually run the server fn let mut res = AxumResponse(service.run(req).await); // if it accepts text/html (i.e., is a plain form post) and doesn't already have a // Location set, then redirect to the Referer if accepts_html { if let Some(referrer) = referrer { let has_location = res.0.headers().get(LOCATION).is_some(); if !has_location { *res.0.status_mut() = StatusCode::FOUND; res.0.headers_mut().insert(LOCATION, referrer); } } } // apply status code and headers if user changed them res.extend_response(&res_options); Ok(res.0) }) }) .await } else { Response::builder() .status(StatusCode::BAD_REQUEST) .body(Body::from(format!( "Could not find a server function at the route {path}. \ \n\nIt's likely that either 1. The API prefix you specify in the `#[server]` \ macro doesn't match the prefix at which your server function \ handler is mounted, or \n2. You are on a platform that \ doesn't support automatic server function registration and \ you need to call ServerFn::register_explicit() on the server \ function type, somewhere in your `main` function.", ))) } .expect("could not build Response") } /// A stream of bytes of HTML. pub type PinnedHtmlStream = Pin<Box<dyn Stream<Item = io::Result<Bytes>> + Send>>; /// Returns an Axum [Handler](axum::handler::Handler) that listens for a `GET` request and tries /// to route it using [leptos_router], serving an HTML stream of your application. /// /// This can then be set up at an appropriate route in your application: /// ```no_run /// use axum::{handler::Handler, Router}; /// use leptos::{config::get_configuration, prelude::*}; /// use std::{env, net::SocketAddr}; /// /// #[component] /// fn MyApp() -> impl IntoView { /// view! { <main>"Hello, world!"</main> } /// } /// /// #[cfg(feature = "default")] /// #[tokio::main] /// async fn main() { /// let conf = get_configuration(Some("Cargo.toml")).unwrap(); /// let leptos_options = conf.leptos_options; /// let addr = leptos_options.site_addr.clone(); /// /// // build our application with a route /// let app = Router::new().fallback(leptos_axum::render_app_to_stream( /// || { /* your application here */ }, /// )); /// /// // run our app with hyper /// let listener = tokio::net::TcpListener::bind(&addr).await.unwrap(); /// axum::serve(listener, app.into_make_service()) /// .await /// .unwrap(); /// } /// /// # #[cfg(not(feature = "default"))] /// # fn main() { } /// ``` /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [`Parts`] /// - [`ResponseOptions`] /// - [`ServerMetaContext`] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_to_stream<IV>( app_fn: impl Fn() -> IV + Clone + Send + Sync + 'static, ) -> impl Fn( Request<Body>, ) -> Pin<Box<dyn Future<Output = Response<Body>> + Send + 'static>> + Clone + Send + 'static where IV: IntoView + 'static, { render_app_to_stream_with_context(|| {}, app_fn) } /// Returns an Axum [Handler](axum::handler::Handler) that listens for a `GET` request and tries /// to route it using [leptos_router], serving an HTML stream of your application. /// The difference between calling this and `render_app_to_stream_with_context()` is that this /// one respects the `SsrMode` on each Route and thus requires `Vec<AxumRouteListing>` for route checking. /// This is useful if you are using `.leptos_routes_with_handler()` #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_route<S, IV>( paths: Vec<AxumRouteListing>, app_fn: impl Fn() -> IV + Clone + Send + Sync + 'static, ) -> impl Fn( State<S>, Request<Body>, ) -> Pin<Box<dyn Future<Output = Response<Body>> + Send + 'static>> + Clone + Send + 'static where IV: IntoView + 'static, LeptosOptions: FromRef<S>, S: Send + 'static, { render_route_with_context(paths, || {}, app_fn) } /// Returns an Axum [Handler](axum::handler::Handler) that listens for a `GET` request and tries /// to route it using [leptos_router], serving an in-order HTML stream of your application. /// This stream will pause at each `<Suspense/>` node and wait for it to resolve before /// sending down its HTML. The app will become interactive once it has fully loaded. /// /// This can then be set up at an appropriate route in your application: /// ```no_run /// use axum::{handler::Handler, Router}; /// use leptos::{config::get_configuration, prelude::*}; /// use std::{env, net::SocketAddr}; /// /// #[component] /// fn MyApp() -> impl IntoView { /// view! { <main>"Hello, world!"</main> } /// } /// /// #[cfg(feature = "default")] /// #[tokio::main] /// async fn main() { /// let conf = get_configuration(Some("Cargo.toml")).unwrap(); /// let leptos_options = conf.leptos_options; /// let addr = leptos_options.site_addr.clone(); /// /// // build our application with a route /// let app = Router::new().fallback( /// leptos_axum::render_app_to_stream_in_order(|| view! { <MyApp/> }), /// ); /// /// // run our app with hyper /// let listener = tokio::net::TcpListener::bind(&addr).await.unwrap(); /// axum::serve(listener, app.into_make_service()) /// .await /// .unwrap(); /// } /// /// # #[cfg(not(feature = "default"))] /// # fn main() { } /// ``` /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [`Parts`] /// - [`ResponseOptions`] /// - [`ServerMetaContext`] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_to_stream_in_order<IV>( app_fn: impl Fn() -> IV + Clone + Send + Sync + 'static, ) -> impl Fn( Request<Body>, ) -> Pin<Box<dyn Future<Output = Response<Body>> + Send + 'static>> + Clone + Send + 'static where IV: IntoView + 'static, { render_app_to_stream_in_order_with_context(|| {}, app_fn) } /// Returns an Axum [Handler](axum::handler::Handler) that listens for a `GET` request and tries /// to route it using [leptos_router], serving an HTML stream of your application. /// /// This version allows us to pass Axum State/Extension/Extractor or other info from Axum or network /// layers above Leptos itself. To use it, you'll need to write your own handler function that provides /// the data to leptos in a closure. An example is below /// ``` /// use axum::{ /// body::Body, /// extract::Path, /// http::Request, /// response::{IntoResponse, Response}, /// }; /// use leptos::{config::LeptosOptions, context::provide_context, prelude::*}; /// /// async fn custom_handler( /// Path(id): Path<String>, /// req: Request<Body>, /// ) -> Response { /// let handler = leptos_axum::render_app_to_stream_with_context( /// move || { /// provide_context(id.clone()); /// }, /// || { /* your app here */ }, /// ); /// handler(req).await.into_response() /// } /// ``` /// Otherwise, this function is identical to [render_app_to_stream]. /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [`Parts`] /// - [`ResponseOptions`] /// - [`ServerMetaContext`] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_to_stream_with_context<IV>( additional_context: impl Fn() + 'static + Clone + Send + Sync, app_fn: impl Fn() -> IV + Clone + Send + Sync + 'static, ) -> impl Fn( Request<Body>, ) -> Pin<Box<dyn Future<Output = Response<Body>> + Send + 'static>> + Clone + Send + Sync + 'static where IV: IntoView + 'static, { render_app_to_stream_with_context_and_replace_blocks( additional_context, app_fn, false, ) } /// Returns an Axum [Handler](axum::handler::Handler) that listens for a `GET` request and tries /// to route it using [leptos_router], serving an HTML stream of your application. It allows you /// to pass in a context function with additional info to be made available to the app /// The difference between calling this and `render_app_to_stream_with_context()` is that this /// one respects the `SsrMode` on each Route, and thus requires `Vec<AxumRouteListing>` for route checking. /// This is useful if you are using `.leptos_routes_with_handler()`. #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_route_with_context<S, IV>( paths: Vec<AxumRouteListing>, additional_context: impl Fn() + 'static + Clone + Send + Sync, app_fn: impl Fn() -> IV + Clone + Send + Sync + 'static, ) -> impl Fn( State<S>, Request<Body>, ) -> Pin<Box<dyn Future<Output = Response<Body>> + Send + 'static>> + Clone + Send + 'static where IV: IntoView + 'static, LeptosOptions: FromRef<S>, S: Send + 'static, { let ooo = render_app_to_stream_with_context( additional_context.clone(), app_fn.clone(), ); let pb = render_app_to_stream_with_context_and_replace_blocks( additional_context.clone(), app_fn.clone(), true, ); let io = render_app_to_stream_in_order_with_context( additional_context.clone(), app_fn.clone(), ); let asyn = render_app_async_stream_with_context( additional_context.clone(), app_fn.clone(), ); move |state, req| { // 1. Process route to match the values in routeListing let path = req .extensions() .get::<MatchedPath>() .expect("Failed to get Axum router rule") .as_str(); // 2. Find RouteListing in paths. This should probably be optimized, we probably don't want to // search for this every time let listing: &AxumRouteListing = paths.iter().find(|r| r.path() == path).unwrap_or_else(|| { panic!( "Failed to find the route {path} requested by the user. \ This suggests that the routing rules in the Router that \ call this handler needs to be edited!" ) }); // 3. Match listing mode against known, and choose function match listing.mode() { SsrMode::OutOfOrder => ooo(req), SsrMode::PartiallyBlocked => pb(req), SsrMode::InOrder => io(req), SsrMode::Async => asyn(req), SsrMode::Static(_) => { #[cfg(feature = "default")] { let regenerate = listing.regenerate.clone(); handle_static_route( additional_context.clone(), app_fn.clone(), regenerate, )(state, req) } #[cfg(not(feature = "default"))] { _ = state; panic!( "Static routes are not currently supported on WASM32 \ server targets." ); } } } } } /// Returns an Axum [Handler](axum::handler::Handler) that listens for a `GET` request and tries /// to route it using [leptos_router], serving an HTML stream of your application. /// /// This version allows us to pass Axum State/Extension/Extractor or other info from Axum or network /// layers above Leptos itself. To use it, you'll need to write your own handler function that provides /// the data to leptos in a closure. /// /// `replace_blocks` additionally lets you specify whether `<Suspense/>` fragments that read /// from blocking resources should be retrojected into the HTML that's initially served, rather /// than dynamically inserting them with JavaScript on the client. This means you will have /// better support if JavaScript is not enabled, in exchange for a marginally slower response time. /// /// Otherwise, this function is identical to [render_app_to_stream_with_context]. /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [`Parts`] /// - [`ResponseOptions`] /// - [`ServerMetaContext`] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_to_stream_with_context_and_replace_blocks<IV>( additional_context: impl Fn() + 'static + Clone + Send + Sync, app_fn: impl Fn() -> IV + Clone + Send + Sync + 'static, replace_blocks: bool, ) -> impl Fn( Request<Body>, ) -> Pin<Box<dyn Future<Output = Response<Body>> + Send + 'static>> + Clone + Send + Sync + 'static where IV: IntoView + 'static, { _ = replace_blocks; // TODO handle_response(additional_context, app_fn, |app, chunks, supports_ooo| { Box::pin(async move { let app = if cfg!(feature = "islands-router") { if supports_ooo { app.to_html_stream_out_of_order_branching() } else { app.to_html_stream_in_order_branching() } } else if supports_ooo { app.to_html_stream_out_of_order() } else { app.to_html_stream_in_order() }; Box::pin(app.chain(chunks())) as PinnedStream<String> }) }) } /// Returns an Axum [Handler](axum::handler::Handler) that listens for a `GET` request and tries /// to route it using [leptos_router], serving an in-order HTML stream of your application. /// This stream will pause at each `<Suspense/>` node and wait for it to resolve before /// sending down its HTML. The app will become interactive once it has fully loaded. /// /// This version allows us to pass Axum State/Extension/Extractor or other info from Axum or network /// layers above Leptos itself. To use it, you'll need to write your own handler function that provides /// the data to leptos in a closure. An example is below /// ``` /// use axum::{ /// body::Body, /// extract::Path, /// http::Request, /// response::{IntoResponse, Response}, /// }; /// use leptos::context::provide_context; /// /// async fn custom_handler( /// Path(id): Path<String>, /// req: Request<Body>, /// ) -> Response { /// let handler = leptos_axum::render_app_to_stream_in_order_with_context( /// move || { /// provide_context(id.clone()); /// }, /// || { /* your application here */ }, /// ); /// handler(req).await.into_response() /// } /// ``` /// Otherwise, this function is identical to [render_app_to_stream]. /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [`Parts`] /// - [`ResponseOptions`] /// - [`ServerMetaContext`] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_to_stream_in_order_with_context<IV>( additional_context: impl Fn() + 'static + Clone + Send + Sync, app_fn: impl Fn() -> IV + Clone + Send + Sync + 'static, ) -> impl Fn( Request<Body>, ) -> Pin<Box<dyn Future<Output = Response<Body>> + Send + 'static>> + Clone + Send + 'static where IV: IntoView + 'static, { handle_response(additional_context, app_fn, |app, chunks, _supports_ooo| { let app = if cfg!(feature = "islands-router") { app.to_html_stream_in_order_branching() } else { app.to_html_stream_in_order() }; Box::pin(async move { Box::pin(app.chain(chunks())) as PinnedStream<String> }) }) } fn handle_response<IV>( additional_context: impl Fn() + 'static + Clone + Send + Sync, app_fn: impl Fn() -> IV + Clone + Send + Sync + 'static, stream_builder: fn( IV, BoxedFnOnce<PinnedStream<String>>, bool, ) -> PinnedFuture<PinnedStream<String>>, ) -> impl Fn(Request<Body>) -> PinnedFuture<Response<Body>> + Clone + Send + Sync + 'static where
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
true
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/integrations/utils/src/lib.rs
integrations/utils/src/lib.rs
#![allow(clippy::type_complexity)] use futures::{stream::once, Stream, StreamExt}; use hydration_context::{SharedContext, SsrSharedContext}; use leptos::{ context::provide_context, nonce::use_nonce, prelude::ReadValue, reactive::owner::{Owner, Sandboxed}, IntoView, PrefetchLazyFn, WasmSplitManifest, }; use leptos_config::LeptosOptions; use leptos_meta::{Link, ServerMetaContextOutput}; use std::{future::Future, pin::Pin, sync::Arc}; pub type PinnedStream<T> = Pin<Box<dyn Stream<Item = T> + Send>>; pub type PinnedFuture<T> = Pin<Box<dyn Future<Output = T> + Send>>; pub type BoxedFnOnce<T> = Box<dyn FnOnce() -> T + Send>; pub trait ExtendResponse: Sized { type ResponseOptions: Send; fn from_stream(stream: impl Stream<Item = String> + Send + 'static) -> Self; fn extend_response(&mut self, opt: &Self::ResponseOptions); fn set_default_content_type(&mut self, content_type: &str); fn from_app<IV>( app_fn: impl FnOnce() -> IV + Send + 'static, meta_context: ServerMetaContextOutput, additional_context: impl FnOnce() + Send + 'static, res_options: Self::ResponseOptions, stream_builder: fn( IV, BoxedFnOnce<PinnedStream<String>>, bool, ) -> PinnedFuture<PinnedStream<String>>, supports_ooo: bool, ) -> impl Future<Output = Self> + Send where IV: IntoView + 'static, { async move { let prefetches = PrefetchLazyFn::default(); let (owner, stream) = build_response( app_fn, additional_context, stream_builder, supports_ooo, ); owner.with(|| provide_context(prefetches.clone())); let sc = owner.shared_context().unwrap(); let stream = stream.await.ready_chunks(32).map(|n| n.join("")); while let Some(pending) = sc.await_deferred() { pending.await; } if !prefetches.0.read_value().is_empty() { use leptos::prelude::*; let nonce = use_nonce().map(|n| n.to_string()).unwrap_or_default(); if let Some(manifest) = use_context::<WasmSplitManifest>() { let (pkg_path, manifest, wasm_split_file) = &*manifest.0.read_value(); let prefetches = prefetches.0.read_value(); let all_prefetches = prefetches.iter().flat_map(|key| { manifest.get(*key).into_iter().flatten() }); for module in all_prefetches { // to_html() on leptos_meta components registers them with the meta context, // rather than returning HTML directly _ = view! { <Link rel="preload" href=format!("{pkg_path}/{module}.wasm") as_="fetch" type_="application/wasm" crossorigin=nonce.clone() /> } .to_html(); } _ = view! { <Link rel="modulepreload" href=format!("{pkg_path}/{wasm_split_file}") crossorigin=nonce/> } .to_html(); } } let mut stream = Box::pin( meta_context.inject_meta_context(stream).await.then({ let sc = Arc::clone(&sc); move |chunk| { let sc = Arc::clone(&sc); async move { while let Some(pending) = sc.await_deferred() { pending.await; } chunk } } }), ); // wait for the first chunk of the stream, then set the status and headers let first_chunk = stream.next().await.unwrap_or_default(); let mut res = Self::from_stream(Sandboxed::new( once(async move { first_chunk }) .chain(stream) // drop the owner, cleaning up the reactive runtime, // once the stream is over .chain(once(async move { owner.unset_with_forced_cleanup(); Default::default() })), )); res.extend_response(&res_options); // Set the Content Type headers on all responses. This makes Firefox show the page source // without complaining res.set_default_content_type("text/html; charset=utf-8"); res } } } pub fn build_response<IV>( app_fn: impl FnOnce() -> IV + Send + 'static, additional_context: impl FnOnce() + Send + 'static, stream_builder: fn( IV, BoxedFnOnce<PinnedStream<String>>, // this argument indicates whether a request wants to support out-of-order streaming // responses bool, ) -> PinnedFuture<PinnedStream<String>>, is_islands_router_navigation: bool, ) -> (Owner, PinnedFuture<PinnedStream<String>>) where IV: IntoView + 'static, { let shared_context = Arc::new(SsrSharedContext::new()) as Arc<dyn SharedContext + Send + Sync>; let owner = Owner::new_root(Some(Arc::clone(&shared_context))); let stream = Box::pin(Sandboxed::new({ let owner = owner.clone(); async move { let stream = owner.with(|| { additional_context(); // run app let app = app_fn(); let nonce = use_nonce() .as_ref() .map(|nonce| format!(" nonce=\"{nonce}\"")) .unwrap_or_default(); let shared_context = Owner::current_shared_context().unwrap(); let chunks = Box::new({ let shared_context = shared_context.clone(); move || { Box::pin(shared_context.pending_data().unwrap().map( move |chunk| { format!("<script{nonce}>{chunk}</script>") }, )) as Pin<Box<dyn Stream<Item = String> + Send>> } }); // convert app to appropriate response type // and chain the app stream, followed by chunks // in theory, we could select here, and intersperse them // the problem is that during the DOM walk, that would be mean random <script> tags // interspersed where we expect other children // // we also don't actually start hydrating until after the whole stream is complete, // so it's not useful to send those scripts down earlier. stream_builder(app, chunks, is_islands_router_navigation) }); stream.await } })); (owner, stream) } pub fn static_file_path(options: &LeptosOptions, path: &str) -> String { let trimmed_path = path.trim_start_matches('/'); let path = if trimmed_path.is_empty() { "index" } else { trimmed_path }; format!("{}/{}.html", options.site_root, path) }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/integrations/actix/src/lib.rs
integrations/actix/src/lib.rs
#![forbid(unsafe_code)] #![deny(missing_docs)] //! Provides functions to easily integrate Leptos with Actix. //! //! For more details on how to use the integrations, see the //! [`examples`](https://github.com/leptos-rs/leptos/tree/main/examples) //! directory in the Leptos repository. use actix_files::NamedFile; use actix_http::header::{HeaderName, HeaderValue, ACCEPT, LOCATION, REFERER}; use actix_web::{ dev::{ServiceFactory, ServiceRequest}, http::header, test, web::{Data, Payload, ServiceConfig}, *, }; use dashmap::DashMap; use futures::{stream::once, Stream, StreamExt}; use http::StatusCode; use hydration_context::SsrSharedContext; use leptos::{ config::LeptosOptions, context::{provide_context, use_context}, hydration::IslandsRouterNavigation, prelude::expect_context, reactive::{computed::ScopedFuture, owner::Owner}, IntoView, }; use leptos_integration_utils::{ BoxedFnOnce, ExtendResponse, PinnedFuture, PinnedStream, }; use leptos_meta::ServerMetaContext; use leptos_router::{ components::provide_server_redirect, location::RequestUrl, static_routes::{RegenerationFn, ResolvedStaticPath}, ExpandOptionals, Method, PathSegment, RouteList, RouteListing, SsrMode, }; use parking_lot::RwLock; use send_wrapper::SendWrapper; use server_fn::{ error::ServerFnErrorErr, redirect::REDIRECT_HEADER, request::actix::ActixRequest, }; use std::{ collections::HashSet, fmt::{Debug, Display}, future::Future, ops::{Deref, DerefMut}, path::Path, sync::{Arc, LazyLock}, }; /// This struct lets you define headers and override the status of the Response from an Element or a Server Function /// Typically contained inside of a ResponseOptions. Setting this is useful for cookies and custom responses. #[derive(Debug, Clone, Default)] pub struct ResponseParts { /// If provided, this will overwrite any other status code for this response. pub status: Option<StatusCode>, /// The map of headers that should be added to the response. pub headers: header::HeaderMap, } impl ResponseParts { /// Insert a header, overwriting any previous value with the same key pub fn insert_header( &mut self, key: header::HeaderName, value: header::HeaderValue, ) { self.headers.insert(key, value); } /// Append a header, leaving any header with the same key intact pub fn append_header( &mut self, key: header::HeaderName, value: header::HeaderValue, ) { self.headers.append(key, value); } } /// A wrapper for an Actix [`HttpRequest`] that allows it to be used in an /// `Send`/`Sync` setting like Leptos's Context API. #[derive(Debug, Clone)] pub struct Request(SendWrapper<HttpRequest>); impl Request { /// Wraps an existing Actix request. pub fn new(req: &HttpRequest) -> Self { Self(SendWrapper::new(req.clone())) } /// Consumes the wrapper and returns the inner Actix request. pub fn into_inner(self) -> HttpRequest { self.0.take() } } impl Deref for Request { type Target = HttpRequest; fn deref(&self) -> &Self::Target { &self.0 } } impl DerefMut for Request { fn deref_mut(&mut self) -> &mut Self::Target { &mut self.0 } } /// Allows you to override details of the HTTP response like the status code and add Headers/Cookies. #[derive(Debug, Clone, Default)] pub struct ResponseOptions(pub Arc<RwLock<ResponseParts>>); impl ResponseOptions { /// A simpler way to overwrite the contents of `ResponseOptions` with a new `ResponseParts`. pub fn overwrite(&self, parts: ResponseParts) { let mut writable = self.0.write(); *writable = parts } /// Set the status of the returned Response. pub fn set_status(&self, status: StatusCode) { let mut writeable = self.0.write(); let res_parts = &mut *writeable; res_parts.status = Some(status); } /// Insert a header, overwriting any previous value with the same key. pub fn insert_header( &self, key: header::HeaderName, value: header::HeaderValue, ) { let mut writeable = self.0.write(); let res_parts = &mut *writeable; res_parts.headers.insert(key, value); } /// Append a header, leaving any header with the same key intact. pub fn append_header( &self, key: header::HeaderName, value: header::HeaderValue, ) { let mut writeable = self.0.write(); let res_parts = &mut *writeable; res_parts.headers.append(key, value); } } struct ActixResponse(HttpResponse); impl ExtendResponse for ActixResponse { type ResponseOptions = ResponseOptions; fn from_stream( stream: impl Stream<Item = String> + Send + 'static, ) -> Self { ActixResponse( HttpResponse::Ok() .content_type("text/html") .streaming(stream.map(|chunk| { Ok(web::Bytes::from(chunk)) as Result<web::Bytes> })), ) } fn extend_response(&mut self, res_options: &Self::ResponseOptions) { let mut res_options = res_options.0.write(); let headers = self.0.headers_mut(); for (key, value) in std::mem::take(&mut res_options.headers) { headers.append(key, value); } // Set status to what is returned in the function if let Some(status) = res_options.status { *self.0.status_mut() = status; } } fn set_default_content_type(&mut self, content_type: &str) { let headers = self.0.headers_mut(); if !headers.contains_key(header::CONTENT_TYPE) { // Set the Content Type headers on all responses. This makes Firefox show the page source // without complaining headers.insert( header::CONTENT_TYPE, HeaderValue::from_str(content_type).unwrap(), ); } } } /// Provides an easy way to redirect the user from within a server function. /// /// Calling `redirect` in a server function will redirect the browser in three /// situations: /// 1. A server function that is calling in a [blocking /// resource](leptos::server::Resource::new_blocking). /// 2. A server function that is called from WASM running in the client (e.g., a dispatched action /// or a spawned `Future`). /// 3. A `<form>` submitted to the server function endpoint using default browser APIs (often due /// to using [`ActionForm`](leptos::form::ActionForm) without JS/WASM present.) /// /// Using it with a non-blocking [`Resource`](leptos::server::Resource) will not work if you are using streaming rendering, /// as the response's headers will already have been sent by the time the server function calls `redirect()`. /// /// ### Implementation /// /// This sets the `Location` header to the URL given. /// /// If the route or server function in which this is called is being accessed /// by an ordinary `GET` request or an HTML `<form>` without any enhancement, it also sets a /// status code of `302` for a temporary redirect. (This is determined by whether the `Accept` /// header contains `text/html` as it does for an ordinary navigation.) /// /// Otherwise, it sets a custom header that indicates to the client that it should redirect, /// without actually setting the status code. This means that the client will not follow the /// redirect, and can therefore return the value of the server function and then handle /// the redirect with client-side routing. #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn redirect(path: &str) { if let (Some(req), Some(res)) = (use_context::<Request>(), use_context::<ResponseOptions>()) { // insert the Location header in any case res.insert_header( header::LOCATION, header::HeaderValue::from_str(path) .expect("Failed to create HeaderValue"), ); let accepts_html = req .headers() .get(ACCEPT) .and_then(|v| v.to_str().ok()) .map(|v| v.contains("text/html")) .unwrap_or(false); if accepts_html { // if the request accepts text/html, it's a plain form request and needs // to have the 302 code set res.set_status(StatusCode::FOUND); } else { // otherwise, we sent it from the server fn client and actually don't want // to set a real redirect, as this will break the ability to return data // instead, set the REDIRECT_HEADER to indicate that the client should redirect res.insert_header( HeaderName::from_static(REDIRECT_HEADER), HeaderValue::from_str("").unwrap(), ); } } else { let msg = "Couldn't retrieve either Parts or ResponseOptions while \ trying to redirect()."; #[cfg(feature = "tracing")] tracing::warn!("{}", &msg); #[cfg(not(feature = "tracing"))] eprintln!("{}", &msg); } } /// An Actix [struct@Route](actix_web::Route) that listens for a `POST` request with /// Leptos server function arguments in the body, runs the server function if found, /// and returns the resulting [HttpResponse]. /// /// This can then be set up at an appropriate route in your application: /// /// ```no_run /// use actix_web::*; /// /// fn register_server_functions() { /// // call ServerFn::register() for each of the server functions you've defined /// } /// /// # #[cfg(feature = "default")] /// #[actix_web::main] /// async fn main() -> std::io::Result<()> { /// // make sure you actually register your server functions /// register_server_functions(); /// /// HttpServer::new(|| { /// App::new() /// // "/api" should match the prefix, if any, declared when defining server functions /// // {tail:.*} passes the remainder of the URL as the server function name /// .route("/api/{tail:.*}", leptos_actix::handle_server_fns()) /// }) /// .bind(("127.0.0.1", 8080))? /// .run() /// .await /// } /// # #[cfg(not(feature = "default"))] /// # fn main() {} /// ``` /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [ResponseOptions] /// - [Request] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn handle_server_fns() -> Route { handle_server_fns_with_context(|| {}) } /// An Actix [struct@Route](actix_web::Route) that listens for `GET` or `POST` requests with /// Leptos server function arguments in the URL (`GET`) or body (`POST`), /// runs the server function if found, and returns the resulting [HttpResponse]. /// /// This can then be set up at an appropriate route in your application: /// /// This version allows you to pass in a closure that adds additional route data to the /// context, allowing you to pass in info about the route or user from Actix, or other info. /// /// **NOTE**: If your server functions expect a context, make sure to provide it both in /// [`handle_server_fns_with_context`] **and** in [`LeptosRoutes::leptos_routes_with_context`] (or whatever /// rendering method you are using). During SSR, server functions are called by the rendering /// method, while subsequent calls from the client are handled by the server function handler. /// The same context needs to be provided to both handlers. /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [ResponseOptions] /// - [Request] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn handle_server_fns_with_context( additional_context: impl Fn() + 'static + Clone + Send, ) -> Route { web::to(move |req: HttpRequest, payload: Payload| { let additional_context = additional_context.clone(); async move { let additional_context = additional_context.clone(); let path = req.path(); let method = req.method(); if let Some(mut service) = server_fn::actix::get_server_fn_service(path, method) { let owner = Owner::new(); owner .with(|| { ScopedFuture::new(async move { provide_context(Request::new(&req)); let res_options = ResponseOptions::default(); provide_context(res_options.clone()); additional_context(); // store Accepts and Referer in case we need them for redirect (below) let accepts_html = req .headers() .get(ACCEPT) .and_then(|v| v.to_str().ok()) .map(|v| v.contains("text/html")) .unwrap_or(false); let referrer = req.headers().get(REFERER).cloned(); // actually run the server fn let mut res = ActixResponse( service .run(ActixRequest::from((req, payload))) .await .take(), ); // if it accepts text/html (i.e., is a plain form post) and doesn't already have a // Location set, then redirect to the Referer if accepts_html { if let Some(referrer) = referrer { let has_location = res.0.headers().get(LOCATION).is_some(); if !has_location { *res.0.status_mut() = StatusCode::FOUND; res.0 .headers_mut() .insert(LOCATION, referrer); } } } // the Location header may have been set to Referer, so any redirection by the // user must overwrite it { let mut res_options = res_options.0.write(); let headers = res.0.headers_mut(); for location in res_options.headers.remove(header::LOCATION) { headers.insert(header::LOCATION, location); } } // apply status code and headers if user changed them res.extend_response(&res_options); res.0 }) }) .await } else { HttpResponse::BadRequest().body(format!( "Could not find a server function at the route {:?}. \ \n\nIt's likely that either 1. The API prefix you specify in the `#[server]` \ macro doesn't match the prefix at which your server \ function handler is mounted, or \n2. You are on a \ platform that doesn't support automatic server function \ registration and you need to call \ ServerFn::register_explicit() on the server function \ type, somewhere in your `main` function.", req.path() )) } } }) } /// Returns an Actix [struct@Route](actix_web::Route) that listens for a `GET` request and tries /// to route it using [leptos_router], serving an HTML stream of your application. The stream /// will include fallback content for any `<Suspense/>` nodes, and be immediately interactive, /// but requires some client-side JavaScript. /// /// This can then be set up at an appropriate route in your application: /// ```no_run /// use actix_web::{App, HttpServer}; /// use leptos::prelude::*; /// use leptos_router::Method; /// use std::{env, net::SocketAddr}; /// /// #[component] /// fn MyApp() -> impl IntoView { /// view! { <main>"Hello, world!"</main> } /// } /// /// # #[cfg(feature = "default")] /// #[actix_web::main] /// async fn main() -> std::io::Result<()> { /// let conf = get_configuration(Some("Cargo.toml")).unwrap(); /// let addr = conf.leptos_options.site_addr.clone(); /// HttpServer::new(move || { /// let leptos_options = &conf.leptos_options; /// /// App::new() /// // {tail:.*} passes the remainder of the URL as the route /// // the actual routing will be handled by `leptos_router` /// .route( /// "/{tail:.*}", /// leptos_actix::render_app_to_stream(MyApp, Method::Get), /// ) /// }) /// .bind(&addr)? /// .run() /// .await /// } /// # #[cfg(not(feature = "default"))] /// # fn main() {} /// ``` /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [ResponseOptions] /// - [Request] /// - [MetaContext](leptos_meta::MetaContext) #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_to_stream<IV>( app_fn: impl Fn() -> IV + Clone + Send + 'static, method: Method, ) -> Route where IV: IntoView + 'static, { render_app_to_stream_with_context(|| {}, app_fn, method) } /// Returns an Actix [struct@Route](actix_web::Route) that listens for a `GET` request and tries /// to route it using [leptos_router], serving an in-order HTML stream of your application. /// This stream will pause at each `<Suspense/>` node and wait for it to resolve before /// sending down its HTML. The app will become interactive once it has fully loaded. /// /// This can then be set up at an appropriate route in your application: /// ```no_run /// use actix_web::{App, HttpServer}; /// use leptos::prelude::*; /// use leptos_router::Method; /// use std::{env, net::SocketAddr}; /// /// #[component] /// fn MyApp() -> impl IntoView { /// view! { <main>"Hello, world!"</main> } /// } /// /// # #[cfg(feature = "default")] /// #[actix_web::main] /// async fn main() -> std::io::Result<()> { /// let conf = get_configuration(Some("Cargo.toml")).unwrap(); /// let addr = conf.leptos_options.site_addr.clone(); /// HttpServer::new(move || { /// let leptos_options = &conf.leptos_options; /// /// App::new() /// // {tail:.*} passes the remainder of the URL as the route /// // the actual routing will be handled by `leptos_router` /// .route( /// "/{tail:.*}", /// leptos_actix::render_app_to_stream_in_order( /// MyApp, /// Method::Get, /// ), /// ) /// }) /// .bind(&addr)? /// .run() /// .await /// } /// /// # #[cfg(not(feature = "default"))] /// # fn main() {} /// ``` /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [ResponseOptions] /// - [Request] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_to_stream_in_order<IV>( app_fn: impl Fn() -> IV + Clone + Send + 'static, method: Method, ) -> Route where IV: IntoView + 'static, { render_app_to_stream_in_order_with_context(|| {}, app_fn, method) } /// Returns an Actix [struct@Route](actix_web::Route) that listens for a `GET` request and tries /// to route it using [leptos_router], asynchronously rendering an HTML page after all /// `async` resources have loaded. /// /// This can then be set up at an appropriate route in your application: /// ```no_run /// use actix_web::{App, HttpServer}; /// use leptos::prelude::*; /// use leptos_router::Method; /// use std::{env, net::SocketAddr}; /// /// #[component] /// fn MyApp() -> impl IntoView { /// view! { <main>"Hello, world!"</main> } /// } /// /// # #[cfg(feature = "default")] /// #[actix_web::main] /// async fn main() -> std::io::Result<()> { /// let conf = get_configuration(Some("Cargo.toml")).unwrap(); /// let addr = conf.leptos_options.site_addr.clone(); /// HttpServer::new(move || { /// let leptos_options = &conf.leptos_options; /// /// App::new() /// // {tail:.*} passes the remainder of the URL as the route /// // the actual routing will be handled by `leptos_router` /// .route( /// "/{tail:.*}", /// leptos_actix::render_app_async(MyApp, Method::Get), /// ) /// }) /// .bind(&addr)? /// .run() /// .await /// } /// # #[cfg(not(feature = "default"))] /// # fn main() {} /// ``` /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [ResponseOptions] /// - [Request] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_async<IV>( app_fn: impl Fn() -> IV + Clone + Send + 'static, method: Method, ) -> Route where IV: IntoView + 'static, { render_app_async_with_context(|| {}, app_fn, method) } /// Returns an Actix [struct@Route] that listens for a `GET` request and tries /// to route it using [leptos_router], serving an HTML stream of your application. /// /// This function allows you to provide additional information to Leptos for your route. /// It could be used to pass in Path Info, Connection Info, or anything your heart desires. /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [ResponseOptions] /// - [Request] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_to_stream_with_context<IV>( additional_context: impl Fn() + 'static + Clone + Send, app_fn: impl Fn() -> IV + Clone + Send + 'static, method: Method, ) -> Route where IV: IntoView + 'static, { render_app_to_stream_with_context_and_replace_blocks( additional_context, app_fn, method, false, ) } /// Returns an Actix [struct@Route](actix_web::Route) that listens for a `GET` request and tries /// to route it using [leptos_router], serving an HTML stream of your application. /// /// This function allows you to provide additional information to Leptos for your route. /// It could be used to pass in Path Info, Connection Info, or anything your heart desires. /// /// `replace_blocks` additionally lets you specify whether `<Suspense/>` fragments that read /// from blocking resources should be retrojected into the HTML that's initially served, rather /// than dynamically inserting them with JavaScript on the client. This means you will have /// better support if JavaScript is not enabled, in exchange for a marginally slower response time. /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [ResponseOptions] /// - [Request] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_to_stream_with_context_and_replace_blocks<IV>( additional_context: impl Fn() + 'static + Clone + Send, app_fn: impl Fn() -> IV + Clone + Send + 'static, method: Method, replace_blocks: bool, ) -> Route where IV: IntoView + 'static, { _ = replace_blocks; // TODO handle_response( method, additional_context, app_fn, |app, chunks, supports_ooo| { Box::pin(async move { let app = if cfg!(feature = "islands-router") { if supports_ooo { app.to_html_stream_out_of_order_branching() } else { app.to_html_stream_in_order_branching() } } else if supports_ooo { app.to_html_stream_out_of_order() } else { app.to_html_stream_in_order() }; Box::pin(app.chain(chunks())) as PinnedStream<String> }) }, ) } /// Returns an Actix [struct@Route](actix_web::Route) that listens for a `GET` request and tries /// to route it using [leptos_router], serving an in-order HTML stream of your application. /// /// This function allows you to provide additional information to Leptos for your route. /// It could be used to pass in Path Info, Connection Info, or anything your heart desires. /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [ResponseOptions] /// - [Request] /// - [MetaContext](leptos_meta::MetaContext) #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_to_stream_in_order_with_context<IV>( additional_context: impl Fn() + 'static + Clone + Send, app_fn: impl Fn() -> IV + Clone + Send + 'static, method: Method, ) -> Route where IV: IntoView + 'static, { handle_response( method, additional_context, app_fn, |app, chunks, _supports_ooo| { Box::pin(async move { let app = if cfg!(feature = "islands-router") { app.to_html_stream_in_order_branching() } else { app.to_html_stream_in_order() }; Box::pin(app.chain(chunks())) as PinnedStream<String> }) }, ) } /// Returns an Actix [struct@Route](actix_web::Route) that listens for a `GET` request and tries /// to route it using [leptos_router], asynchronously serving the page once all `async` /// resources have loaded. /// /// This function allows you to provide additional information to Leptos for your route. /// It could be used to pass in Path Info, Connection Info, or anything your heart desires. /// /// ## Provided Context Types /// This function always provides context values including the following types: /// - [ResponseOptions] /// - [Request] #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] pub fn render_app_async_with_context<IV>( additional_context: impl Fn() + 'static + Clone + Send, app_fn: impl Fn() -> IV + Clone + Send + 'static, method: Method, ) -> Route where IV: IntoView + 'static, { handle_response(method, additional_context, app_fn, async_stream_builder) } fn async_stream_builder<IV>( app: IV, chunks: BoxedFnOnce<PinnedStream<String>>, _supports_ooo: bool, ) -> PinnedFuture<PinnedStream<String>> where IV: IntoView + 'static, { Box::pin(async move { let app = if cfg!(feature = "islands-router") { app.to_html_stream_in_order_branching() } else { app.to_html_stream_in_order() }; let app = app.collect::<String>().await; let chunks = chunks(); Box::pin(once(async move { app }).chain(chunks)) as PinnedStream<String> }) } #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", fields(error), skip_all) )] fn provide_contexts( req: Request, meta_context: &ServerMetaContext, res_options: &ResponseOptions, ) { let path = leptos_corrected_path(&req); provide_context(RequestUrl::new(&path)); provide_context(meta_context.clone()); provide_context(res_options.clone()); provide_context(req); provide_server_redirect(redirect); leptos::nonce::provide_nonce(); } fn leptos_corrected_path(req: &HttpRequest) -> String { let path = req.path(); let query = req.query_string(); if query.is_empty() { "http://leptos".to_string() + path } else { "http://leptos".to_string() + path + "?" + query } } #[allow(clippy::type_complexity)] fn handle_response<IV>( method: Method, additional_context: impl Fn() + 'static + Clone + Send, app_fn: impl Fn() -> IV + Clone + Send + 'static, stream_builder: fn( IV, BoxedFnOnce<PinnedStream<String>>, bool, ) -> PinnedFuture<PinnedStream<String>>, ) -> Route where IV: IntoView + 'static, { let handler = move |req: HttpRequest| { let app_fn = app_fn.clone(); let add_context = additional_context.clone(); async move { let is_island_router_navigation = cfg!(feature = "islands-router") && req.headers().get("Islands-Router").is_some(); let res_options = ResponseOptions::default(); let (meta_context, meta_output) = ServerMetaContext::new(); let additional_context = { let meta_context = meta_context.clone(); let res_options = res_options.clone(); let req = Request::new(&req); move || { provide_contexts(req, &meta_context, &res_options); add_context(); if is_island_router_navigation { provide_context(IslandsRouterNavigation); } } }; let res = ActixResponse::from_app( app_fn, meta_output, additional_context, res_options, stream_builder, !is_island_router_navigation, ) .await; res.0 } }; match method { Method::Get => web::get().to(handler), Method::Post => web::post().to(handler), Method::Put => web::put().to(handler), Method::Delete => web::delete().to(handler), Method::Patch => web::patch().to(handler), } } /// Generates a list of all routes defined in Leptos's Router in your app. We can then use this to automatically /// create routes in Actix's App without having to use wildcard matching or fallbacks. Takes in your root app Element /// as an argument so it can walk you app tree. This version is tailored to generated Actix compatible paths. pub fn generate_route_list<IV>( app_fn: impl Fn() -> IV + 'static + Send + Clone, ) -> Vec<ActixRouteListing> where IV: IntoView + 'static, { generate_route_list_with_exclusions_and_ssg(app_fn, None).0 } /// Generates a list of all routes defined in Leptos's Router in your app. We can then use this to automatically /// create routes in Actix's App without having to use wildcard matching or fallbacks. Takes in your root app Element /// as an argument so it can walk you app tree. This version is tailored to generated Actix compatible paths. pub fn generate_route_list_with_ssg<IV>( app_fn: impl Fn() -> IV + 'static + Send + Clone, ) -> (Vec<ActixRouteListing>, StaticRouteGenerator) where IV: IntoView + 'static, { generate_route_list_with_exclusions_and_ssg(app_fn, None) } /// Generates a list of all routes defined in Leptos's Router in your app. We can then use this to automatically /// create routes in Actix's App without having to use wildcard matching or fallbacks. Takes in your root app Element /// as an argument so it can walk you app tree. This version is tailored to generated Actix compatible paths. Adding excluded_routes /// to this function will stop `.leptos_routes()` from generating a route for it, allowing a custom handler. These need to be in Actix path format pub fn generate_route_list_with_exclusions<IV>( app_fn: impl Fn() -> IV + 'static + Send + Clone, excluded_routes: Option<Vec<String>>, ) -> Vec<ActixRouteListing> where IV: IntoView + 'static, { generate_route_list_with_exclusions_and_ssg(app_fn, excluded_routes).0 } /// Generates a list of all routes defined in Leptos's Router in your app. We can then use this to automatically
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
true
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/integrations/actix/tests/extract_routes.rs
integrations/actix/tests/extract_routes.rs
// TODO these tests relate to trailing-slash logic, which is still TBD for 0.7 // use leptos::*; // use leptos_actix::generate_route_list; // use leptos_router::{ // components::{Route, Router, Routes}, // path, // }; // // #[component] // fn DefaultApp() -> impl IntoView { // let view = || view! { "" }; // view! { // <Router> // <Routes> // <Route path=path!("/foo") view/> // <Route path=path!("/bar/") view/> // <Route path=path!("/baz/:id") view/> // <Route path=path!("/baz/:name/") view/> // <Route path=path!("/baz/*any") view/> // </Routes> // </Router> // } // } // // #[test] // fn test_default_app() { // let routes = generate_route_list(DefaultApp); // // // We still have access to the original (albeit normalized) Leptos paths: // assert_same( // &routes, // |r| r.leptos_path(), // &["/bar", "/baz/*any", "/baz/:id", "/baz/:name", "/foo"], // ); // // // ... But leptos-actix has also reformatted "paths" to work for Actix. // assert_same( // &routes, // |r| r.path(), // &["/bar", "/baz/{id}", "/baz/{name}", "/baz/{tail:.*}", "/foo"], // ); // } // // #[component] // fn ExactApp() -> impl IntoView { // let view = || view! { "" }; // //let trailing_slash = TrailingSlash::Exact; // view! { // <Router> // <Routes> // <Route path=path!("/foo") view/> // <Route path=path!("/bar/") view/> // <Route path=path!("/baz/:id") view/> // <Route path=path!("/baz/:name/") view/> // <Route path=path!("/baz/*any") view/> // </Routes> // </Router> // } // } // // #[test] // fn test_exact_app() { // let routes = generate_route_list(ExactApp); // // // In Exact mode, the Leptos paths no longer have their trailing slashes stripped: // assert_same( // &routes, // |r| r.leptos_path(), // &["/bar/", "/baz/*any", "/baz/:id", "/baz/:name/", "/foo"], // ); // // // Actix paths also have trailing slashes as a result: // assert_same( // &routes, // |r| r.path(), // &[ // "/bar/", // "/baz/{id}", // "/baz/{name}/", // "/baz/{tail:.*}", // "/foo", // ], // ); // } // // #[component] // fn RedirectApp() -> impl IntoView { // let view = || view! { "" }; // //let trailing_slash = TrailingSlash::Redirect; // view! { // <Router> // <Routes> // <Route path=path!("/foo") view/> // <Route path=path!("/bar/") view/> // <Route path=path!("/baz/:id") view/> // <Route path=path!("/baz/:name/") view/> // <Route path=path!("/baz/*any") view/> // </Routes> // </Router> // } // } // // #[test] // fn test_redirect_app() { // let routes = generate_route_list(RedirectApp); // // assert_same( // &routes, // |r| r.leptos_path(), // &[ // "/bar", // "/bar/", // "/baz/*any", // "/baz/:id", // "/baz/:id/", // "/baz/:name", // "/baz/:name/", // "/foo", // "/foo/", // ], // ); // // // ... But leptos-actix has also reformatted "paths" to work for Actix. // assert_same( // &routes, // |r| r.path(), // &[ // "/bar", // "/bar/", // "/baz/{id}", // "/baz/{id}/", // "/baz/{name}", // "/baz/{name}/", // "/baz/{tail:.*}", // "/foo", // "/foo/", // ], // ); // } // // fn assert_same<'t, T, F, U>( // input: &'t Vec<T>, // mapper: F, // expected_sorted_values: &[U], // ) where // F: Fn(&'t T) -> U + 't, // U: Ord + std::fmt::Debug, // { // let mut values: Vec<U> = input.iter().map(mapper).collect(); // values.sort(); // assert_eq!(values, expected_sorted_values); // }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/src/lib.rs
any_spawner/src/lib.rs
//! This crate makes it easier to write asynchronous code that is executor-agnostic, by providing a //! utility that can be used to spawn tasks in a variety of executors. //! //! It only supports single executor per program, but that executor can be set at runtime, anywhere //! in your crate (or an application that depends on it). //! //! This can be extended to support any executor or runtime that supports spawning [`Future`]s. //! //! This is a least common denominator implementation in many ways. Limitations include: //! - setting an executor is a one-time, global action //! - no "join handle" or other result is returned from the spawn //! - the `Future` must output `()` //! //! ```no_run //! use any_spawner::Executor; //! //! // make sure an Executor has been initialized with one of the init_ functions //! //! // spawn a thread-safe Future //! Executor::spawn(async { /* ... */ }); //! //! // spawn a Future that is !Send //! Executor::spawn_local(async { /* ... */ }); //! ``` #![forbid(unsafe_code)] #![deny(missing_docs)] #![cfg_attr(docsrs, feature(doc_cfg))] use std::{future::Future, pin::Pin, sync::OnceLock}; use thiserror::Error; /// A future that has been pinned. pub type PinnedFuture<T> = Pin<Box<dyn Future<Output = T> + Send>>; /// A future that has been pinned. pub type PinnedLocalFuture<T> = Pin<Box<dyn Future<Output = T>>>; // Type alias for the spawn function pointer. type SpawnFn = fn(PinnedFuture<()>); // Type alias for the spawn_local function pointer. type SpawnLocalFn = fn(PinnedLocalFuture<()>); // Type alias for the poll_local function pointer. type PollLocalFn = fn(); /// Holds the function pointers for the current global executor. #[derive(Clone, Copy)] struct ExecutorFns { spawn: SpawnFn, spawn_local: SpawnLocalFn, poll_local: PollLocalFn, } // Use a single OnceLock to ensure atomic initialization of all functions. static EXECUTOR_FNS: OnceLock<ExecutorFns> = OnceLock::new(); // No-op functions to use when an executor doesn't support a specific operation. #[cfg(any(feature = "tokio", feature = "wasm-bindgen", feature = "glib"))] #[cold] #[inline(never)] fn no_op_poll() {} #[cfg(all(not(feature = "wasm-bindgen"), not(debug_assertions)))] #[cold] #[inline(never)] fn no_op_spawn(_: PinnedFuture<()>) { #[cfg(debug_assertions)] eprintln!( "Warning: Executor::spawn called, but no global 'spawn' function is \ configured (perhaps only spawn_local is supported, e.g., on wasm \ without threading?)." ); } // Wasm panics if you spawn without an executor #[cfg(feature = "wasm-bindgen")] #[cold] #[inline(never)] fn no_op_spawn(_: PinnedFuture<()>) { panic!( "Executor::spawn called, but no global 'spawn' function is configured." ); } #[cfg(not(debug_assertions))] #[cold] #[inline(never)] fn no_op_spawn_local(_: PinnedLocalFuture<()>) { panic!( "Executor::spawn_local called, but no global 'spawn_local' function \ is configured." ); } /// Errors that can occur when using the executor. #[derive(Error, Debug)] pub enum ExecutorError { /// The executor has already been set. #[error("Global executor has already been set.")] AlreadySet, } /// A global async executor that can spawn tasks. pub struct Executor; impl Executor { /// Spawns a thread-safe [`Future`]. /// /// Uses the globally configured executor. /// Panics if no global executor has been initialized. #[inline(always)] #[track_caller] pub fn spawn(fut: impl Future<Output = ()> + Send + 'static) { let pinned_fut = Box::pin(fut); if let Some(fns) = EXECUTOR_FNS.get() { (fns.spawn)(pinned_fut) } else { // No global executor set. handle_uninitialized_spawn(pinned_fut); } } /// Spawns a [`Future`] that cannot be sent across threads. /// /// Uses the globally configured executor. /// Panics if no global executor has been initialized. #[inline(always)] #[track_caller] pub fn spawn_local(fut: impl Future<Output = ()> + 'static) { let pinned_fut = Box::pin(fut); if let Some(fns) = EXECUTOR_FNS.get() { (fns.spawn_local)(pinned_fut) } else { // No global executor set. handle_uninitialized_spawn_local(pinned_fut); } } /// Waits until the next "tick" of the current async executor. /// Respects the global executor. #[inline(always)] pub async fn tick() { let (tx, rx) = futures::channel::oneshot::channel(); #[cfg(not(all(feature = "wasm-bindgen", target_family = "wasm")))] Executor::spawn(async move { _ = tx.send(()); }); #[cfg(all(feature = "wasm-bindgen", target_family = "wasm"))] Executor::spawn_local(async move { _ = tx.send(()); }); _ = rx.await; } /// Polls the global async executor. /// /// Uses the globally configured executor. /// Does nothing if the global executor does not support polling. #[inline(always)] pub fn poll_local() { if let Some(fns) = EXECUTOR_FNS.get() { (fns.poll_local)() } // If not initialized or doesn't support polling, do nothing gracefully. } } impl Executor { /// Globally sets the [`tokio`] runtime as the executor used to spawn tasks. /// /// Returns `Err(_)` if a global executor has already been set. /// /// Requires the `tokio` feature to be activated on this crate. #[cfg(feature = "tokio")] #[cfg_attr(docsrs, doc(cfg(feature = "tokio")))] pub fn init_tokio() -> Result<(), ExecutorError> { let executor_impl = ExecutorFns { spawn: |fut| { tokio::spawn(fut); }, spawn_local: |fut| { tokio::task::spawn_local(fut); }, // Tokio doesn't have an explicit global poll function like LocalPool::run_until_stalled poll_local: no_op_poll, }; EXECUTOR_FNS .set(executor_impl) .map_err(|_| ExecutorError::AlreadySet) } /// Globally sets the [`wasm-bindgen-futures`] runtime as the executor used to spawn tasks. /// /// Returns `Err(_)` if a global executor has already been set. /// /// Requires the `wasm-bindgen` feature to be activated on this crate. #[cfg(feature = "wasm-bindgen")] #[cfg_attr(docsrs, doc(cfg(feature = "wasm-bindgen")))] pub fn init_wasm_bindgen() -> Result<(), ExecutorError> { let executor_impl = ExecutorFns { // wasm-bindgen-futures only supports spawn_local spawn: no_op_spawn, spawn_local: |fut| { wasm_bindgen_futures::spawn_local(fut); }, poll_local: no_op_poll, }; EXECUTOR_FNS .set(executor_impl) .map_err(|_| ExecutorError::AlreadySet) } /// Globally sets the [`glib`] runtime as the executor used to spawn tasks. /// /// Returns `Err(_)` if a global executor has already been set. /// /// Requires the `glib` feature to be activated on this crate. #[cfg(feature = "glib")] #[cfg_attr(docsrs, doc(cfg(feature = "glib")))] pub fn init_glib() -> Result<(), ExecutorError> { let executor_impl = ExecutorFns { spawn: |fut| { let main_context = glib::MainContext::default(); main_context.spawn(fut); }, spawn_local: |fut| { let main_context = glib::MainContext::default(); main_context.spawn_local(fut); }, // Glib needs event loop integration, explicit polling isn't the standard model here. poll_local: no_op_poll, }; EXECUTOR_FNS .set(executor_impl) .map_err(|_| ExecutorError::AlreadySet) } /// Globally sets the [`futures`] executor as the executor used to spawn tasks, /// lazily creating a thread pool to spawn tasks into. /// /// Returns `Err(_)` if a global executor has already been set. /// /// Requires the `futures-executor` feature to be activated on this crate. #[cfg(feature = "futures-executor")] #[cfg_attr(docsrs, doc(cfg(feature = "futures-executor")))] pub fn init_futures_executor() -> Result<(), ExecutorError> { use futures::{ executor::{LocalPool, LocalSpawner, ThreadPool}, task::{LocalSpawnExt, SpawnExt}, }; use std::cell::RefCell; // Keep the lazy-init ThreadPool and thread-local LocalPool for spawn_local impl static THREAD_POOL: OnceLock<ThreadPool> = OnceLock::new(); thread_local! { static LOCAL_POOL: RefCell<LocalPool> = RefCell::new(LocalPool::new()); // SPAWNER is derived from LOCAL_POOL, keep it for efficiency inside the closure static SPAWNER: LocalSpawner = LOCAL_POOL.with(|pool| pool.borrow().spawner()); } fn get_thread_pool() -> &'static ThreadPool { THREAD_POOL.get_or_init(|| { ThreadPool::new() .expect("could not create futures executor ThreadPool") }) } let executor_impl = ExecutorFns { spawn: |fut| { get_thread_pool() .spawn(fut) .expect("failed to spawn future on ThreadPool"); }, spawn_local: |fut| { // Use the thread_local SPAWNER derived from LOCAL_POOL SPAWNER.with(|spawner| { spawner .spawn_local(fut) .expect("failed to spawn local future"); }); }, poll_local: || { // Use the thread_local LOCAL_POOL LOCAL_POOL.with(|pool| { // Use try_borrow_mut to prevent panic during re-entrant calls if let Ok(mut pool) = pool.try_borrow_mut() { pool.run_until_stalled(); } // If already borrowed, we're likely in a nested poll, so do nothing. }); }, }; EXECUTOR_FNS .set(executor_impl) .map_err(|_| ExecutorError::AlreadySet) } /// Globally sets the [`async_executor`] executor as the executor used to spawn tasks, /// lazily creating a thread pool to spawn tasks into. /// /// Returns `Err(_)` if a global executor has already been set. /// /// Requires the `async-executor` feature to be activated on this crate. #[cfg(feature = "async-executor")] #[cfg_attr(docsrs, doc(cfg(feature = "async-executor")))] pub fn init_async_executor() -> Result<(), ExecutorError> { use async_executor::{Executor as AsyncExecutor, LocalExecutor}; // Keep the lazy-init global Executor and thread-local LocalExecutor for spawn_local impl static ASYNC_EXECUTOR: OnceLock<AsyncExecutor<'static>> = OnceLock::new(); thread_local! { static LOCAL_EXECUTOR_POOL: LocalExecutor<'static> = const { LocalExecutor::new() }; } fn get_async_executor() -> &'static AsyncExecutor<'static> { ASYNC_EXECUTOR.get_or_init(AsyncExecutor::new) } let executor_impl = ExecutorFns { spawn: |fut| { get_async_executor().spawn(fut).detach(); }, spawn_local: |fut| { LOCAL_EXECUTOR_POOL.with(|pool| pool.spawn(fut).detach()); }, poll_local: || { LOCAL_EXECUTOR_POOL.with(|pool| { // try_tick polls the local executor without blocking // This prevents issues if called recursively or from within a task. pool.try_tick(); }); }, }; EXECUTOR_FNS .set(executor_impl) .map_err(|_| ExecutorError::AlreadySet) } /// Globally sets a custom executor as the executor used to spawn tasks. /// /// Requires the custom executor to be `Send + Sync` as it will be stored statically. /// /// Returns `Err(_)` if a global executor has already been set. pub fn init_custom_executor( custom_executor: impl CustomExecutor + Send + Sync + 'static, ) -> Result<(), ExecutorError> { // Store the custom executor instance itself to call its methods. // Use Box for dynamic dispatch. static CUSTOM_EXECUTOR_INSTANCE: OnceLock< Box<dyn CustomExecutor + Send + Sync>, > = OnceLock::new(); CUSTOM_EXECUTOR_INSTANCE .set(Box::new(custom_executor)) .map_err(|_| ExecutorError::AlreadySet)?; // Now set the ExecutorFns using the stored instance let executor_impl = ExecutorFns { spawn: |fut| { // Unwrap is safe because we just set it successfully or returned Err. CUSTOM_EXECUTOR_INSTANCE.get().unwrap().spawn(fut); }, spawn_local: |fut| { CUSTOM_EXECUTOR_INSTANCE.get().unwrap().spawn_local(fut); }, poll_local: || { CUSTOM_EXECUTOR_INSTANCE.get().unwrap().poll_local(); }, }; EXECUTOR_FNS .set(executor_impl) .map_err(|_| ExecutorError::AlreadySet) // If setting EXECUTOR_FNS fails (extremely unlikely race if called *concurrently* // with another init_* after CUSTOM_EXECUTOR_INSTANCE was set), we technically // leave CUSTOM_EXECUTOR_INSTANCE set but EXECUTOR_FNS not. This is an edge case, // but the primary race condition is solved. } /// Sets a custom executor *for the current thread only*. /// /// This overrides the global executor for calls to `spawn`, `spawn_local`, and `poll_local` /// made *from the current thread*. It does not affect other threads or the global state. /// /// The provided `custom_executor` must implement [`CustomExecutor`] and `'static`, but does /// **not** need to be `Send` or `Sync`. /// /// Returns `Err(ExecutorError::AlreadySet)` if a *local* executor has already been set /// *for this thread*. pub fn init_local_custom_executor( custom_executor: impl CustomExecutor + 'static, ) -> Result<(), ExecutorError> { // Store the custom executor instance itself to call its methods. // Use Box for dynamic dispatch. thread_local! { static CUSTOM_EXECUTOR_INSTANCE: OnceLock< Box<dyn CustomExecutor>, > = OnceLock::new(); }; CUSTOM_EXECUTOR_INSTANCE.with(|this| { this.set(Box::new(custom_executor)) .map_err(|_| ExecutorError::AlreadySet) })?; // Now set the ExecutorFns using the stored instance let executor_impl = ExecutorFns { spawn: |fut| { // Unwrap is safe because we just set it successfully or returned Err. CUSTOM_EXECUTOR_INSTANCE .with(|this| this.get().unwrap().spawn(fut)); }, spawn_local: |fut| { CUSTOM_EXECUTOR_INSTANCE .with(|this| this.get().unwrap().spawn_local(fut)); }, poll_local: || { CUSTOM_EXECUTOR_INSTANCE .with(|this| this.get().unwrap().poll_local()); }, }; EXECUTOR_FNS .set(executor_impl) .map_err(|_| ExecutorError::AlreadySet) } } /// A trait for custom executors. /// Custom executors can be used to integrate with any executor that supports spawning futures. /// /// If used with `init_custom_executor`, the implementation must be `Send + Sync + 'static`. /// /// All methods can be called recursively. Implementors should be mindful of potential /// deadlocks or excessive resource consumption if recursive calls are not handled carefully /// (e.g., using `try_borrow_mut` or non-blocking polls within implementations). pub trait CustomExecutor { /// Spawns a future, usually on a thread pool. fn spawn(&self, fut: PinnedFuture<()>); /// Spawns a local future. May require calling `poll_local` to make progress. fn spawn_local(&self, fut: PinnedLocalFuture<()>); /// Polls the executor, if it supports polling. Implementations should ideally be /// non-blocking or use mechanisms like `try_tick` or `try_borrow_mut` to handle /// re-entrant calls safely. fn poll_local(&self); } // Ensure CustomExecutor is object-safe #[allow(dead_code)] fn test_object_safety(_: Box<dyn CustomExecutor + Send + Sync>) {} // Added Send + Sync constraint here for global usage /// Handles the case where `Executor::spawn` is called without an initialized executor. #[cold] // Less likely path #[inline(never)] #[track_caller] fn handle_uninitialized_spawn(_fut: PinnedFuture<()>) { let caller = std::panic::Location::caller(); #[cfg(all(debug_assertions, feature = "tracing"))] { tracing::error!( target: "any_spawner", spawn_caller=%caller, "Executor::spawn called before a global executor was initialized. Task dropped." ); // Drop the future implicitly after logging drop(_fut); } #[cfg(all(debug_assertions, not(feature = "tracing")))] { panic!( "At {caller}, tried to spawn a Future with Executor::spawn() \ before a global executor was initialized." ); } // In release builds (without tracing), call the specific no-op function. #[cfg(not(debug_assertions))] { no_op_spawn(_fut); } } /// Handles the case where `Executor::spawn_local` is called without an initialized executor. #[cold] // Less likely path #[inline(never)] #[track_caller] fn handle_uninitialized_spawn_local(_fut: PinnedLocalFuture<()>) { let caller = std::panic::Location::caller(); #[cfg(all(debug_assertions, feature = "tracing"))] { tracing::error!( target: "any_spawner", spawn_caller=%caller, "Executor::spawn_local called before a global executor was initialized. \ Task likely dropped or panicked." ); // Fall through to panic or no-op depending on build/target } #[cfg(all(debug_assertions, not(feature = "tracing")))] { panic!( "At {caller}, tried to spawn a Future with \ Executor::spawn_local() before a global executor was initialized." ); } // In release builds (without tracing), call the specific no-op function (which usually panics). #[cfg(not(debug_assertions))] { no_op_spawn_local(_fut); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/futures_runtime.rs
any_spawner/tests/futures_runtime.rs
#![cfg(feature = "futures-executor")] use any_spawner::Executor; // All tests in this file use the same executor. #[test] fn can_spawn_local_future() { use std::rc::Rc; let _ = Executor::init_futures_executor(); let rc = Rc::new(()); Executor::spawn_local(async { _ = rc; }); Executor::spawn(async {}); } #[test] fn can_make_local_progress() { use std::sync::{ atomic::{AtomicUsize, Ordering}, Arc, }; let _ = Executor::init_futures_executor(); let counter = Arc::new(AtomicUsize::new(0)); Executor::spawn_local({ let counter = Arc::clone(&counter); async move { assert_eq!(counter.fetch_add(1, Ordering::AcqRel), 0); Executor::spawn_local(async { // Should not crash }); } }); Executor::poll_local(); assert_eq!(counter.load(Ordering::Acquire), 1); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/already_set_error.rs
any_spawner/tests/already_set_error.rs
use any_spawner::{Executor, ExecutorError}; #[test] fn test_already_set_error() { struct SimpleExecutor; impl any_spawner::CustomExecutor for SimpleExecutor { fn spawn(&self, _fut: any_spawner::PinnedFuture<()>) {} fn spawn_local(&self, _fut: any_spawner::PinnedLocalFuture<()>) {} fn poll_local(&self) {} } // First initialization should succeed Executor::init_custom_executor(SimpleExecutor) .expect("First initialization failed"); // Second initialization should fail with AlreadySet error let result = Executor::init_custom_executor(SimpleExecutor); assert!(matches!(result, Err(ExecutorError::AlreadySet))); // First local initialization should fail let result = Executor::init_local_custom_executor(SimpleExecutor); assert!(matches!(result, Err(ExecutorError::AlreadySet))); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/futures_executor.rs
any_spawner/tests/futures_executor.rs
#![cfg(feature = "futures-executor")] use any_spawner::Executor; use futures::channel::oneshot; use std::{ sync::{Arc, Mutex}, time::Duration, }; #[test] fn test_futures_executor() { // Initialize the futures executor Executor::init_futures_executor() .expect("Failed to initialize futures executor"); let (tx, rx) = oneshot::channel(); let result = Arc::new(Mutex::new(None)); let result_clone = result.clone(); // Spawn a task Executor::spawn(async move { tx.send(84).expect("Failed to send value"); }); // Spawn a task that waits for the result Executor::spawn(async move { match rx.await { Ok(val) => *result_clone.lock().unwrap() = Some(val), Err(_) => panic!("Failed to receive value"), } }); // Poll a few times to ensure the task completes for _ in 0..10 { Executor::poll_local(); std::thread::sleep(Duration::from_millis(10)); if result.lock().unwrap().is_some() { break; } } assert_eq!(*result.lock().unwrap(), Some(84)); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/wasm_bindgen_tests.rs
any_spawner/tests/wasm_bindgen_tests.rs
#![cfg(all(feature = "wasm-bindgen", target_family = "wasm"))] use any_spawner::Executor; use futures::channel::oneshot; use std::sync::{ atomic::{AtomicBool, Ordering}, Arc, }; use wasm_bindgen_test::*; wasm_bindgen_test_configure!(run_in_browser); #[wasm_bindgen_test] async fn test_wasm_bindgen_spawn_local() { // Initialize the wasm-bindgen executor let _ = Executor::init_wasm_bindgen(); // Create a channel to verify the task completes let (tx, rx) = oneshot::channel(); // Spawn a local task (wasm doesn't support sending futures between threads) Executor::spawn_local(async move { // Simulate some async work Executor::tick().await; tx.send(42).expect("Failed to send result"); }); // Wait for the task to complete let result = rx.await.expect("Failed to receive result"); assert_eq!(result, 42); } #[wasm_bindgen_test] async fn test_wasm_bindgen_tick() { // Initialize the wasm-bindgen executor if not already initialized let _ = Executor::init_wasm_bindgen(); let flag = Arc::new(AtomicBool::new(false)); let flag_clone = flag.clone(); // Spawn a task that will set the flag Executor::spawn_local(async move { flag_clone.store(true, Ordering::SeqCst); }); // Wait for a tick, which should allow the spawned task to run Executor::tick().await; // Verify the flag was set assert!(flag.load(Ordering::SeqCst)); } #[wasm_bindgen_test] async fn test_multiple_wasm_bindgen_tasks() { // Initialize once for all tests let _ = Executor::init_wasm_bindgen(); // Create channels for multiple tasks let (tx1, rx1) = oneshot::channel(); let (tx2, rx2) = oneshot::channel(); // Spawn multiple tasks Executor::spawn_local(async move { tx1.send("task1").expect("Failed to send from task1"); }); Executor::spawn_local(async move { tx2.send("task2").expect("Failed to send from task2"); }); // Wait for both tasks to complete let (result1, result2) = futures::join!(rx1, rx2); assert_eq!(result1.unwrap(), "task1"); assert_eq!(result2.unwrap(), "task2"); } // This test verifies that spawn (not local) fails on wasm as expected #[wasm_bindgen_test] #[should_panic] fn test_wasm_bindgen_spawn_errors() { let _ = Executor::init_wasm_bindgen(); // Using should_panic to test that Executor::spawn panics in wasm Executor::spawn(async { // This should panic since wasm-bindgen doesn't support Send futures }); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/local_custom_executor.rs
any_spawner/tests/local_custom_executor.rs
use any_spawner::Executor; use std::sync::{ atomic::{AtomicBool, Ordering}, Arc, }; #[test] fn test_local_custom_executor() { // Define a thread-local custom executor struct LocalTestExecutor { spawn_called: Arc<AtomicBool>, spawn_local_called: Arc<AtomicBool>, } impl any_spawner::CustomExecutor for LocalTestExecutor { fn spawn(&self, fut: any_spawner::PinnedFuture<()>) { self.spawn_called.store(true, Ordering::SeqCst); futures::executor::block_on(fut); } fn spawn_local(&self, fut: any_spawner::PinnedLocalFuture<()>) { self.spawn_local_called.store(true, Ordering::SeqCst); futures::executor::block_on(fut); } fn poll_local(&self) { // No-op for this test } } let local_spawn_called = Arc::new(AtomicBool::new(false)); let local_spawn_local_called = Arc::new(AtomicBool::new(false)); let local_executor = LocalTestExecutor { spawn_called: local_spawn_called.clone(), spawn_local_called: local_spawn_local_called.clone(), }; // Initialize a thread-local executor Executor::init_local_custom_executor(local_executor) .expect("Failed to initialize local custom executor"); // Test spawn - should use the thread-local executor Executor::spawn(async { // Simple task }); assert!(local_spawn_called.load(Ordering::SeqCst)); // Test spawn_local - should use the thread-local executor Executor::spawn_local(async { // Simple local task }); assert!(local_spawn_local_called.load(Ordering::SeqCst)); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/async_executor.rs
any_spawner/tests/async_executor.rs
#![cfg(feature = "async-executor")] use std::{ future::Future, pin::Pin, sync::{Arc, Mutex}, }; // A simple async executor for testing struct TestExecutor { tasks: Mutex<Vec<Pin<Box<dyn Future<Output = ()> + Send + 'static>>>>, } impl TestExecutor { fn new() -> Self { TestExecutor { tasks: Mutex::new(Vec::new()), } } fn spawn<F>(&self, future: F) where F: Future<Output = ()> + Send + 'static, { self.tasks.lock().unwrap().push(Box::pin(future)); } fn run_all(&self) { // Take all tasks out to process them let tasks = self.tasks.lock().unwrap().drain(..).collect::<Vec<_>>(); // Use a basic future executor to run each task to completion for mut task in tasks { // Use futures-lite's block_on to complete the future futures::executor::block_on(async { unsafe { let task_mut = Pin::new_unchecked(&mut task); let _ = std::future::Future::poll( task_mut, &mut std::task::Context::from_waker( futures::task::noop_waker_ref(), ), ); } }); } } } #[test] fn test_async_executor() { let executor = Arc::new(TestExecutor::new()); let executor_clone = executor.clone(); // Create a spawner function that will use our test executor let spawner = move |future| { executor_clone.spawn(future); }; // Prepare test data let counter = Arc::new(Mutex::new(0)); let counter_clone = counter.clone(); // Use the spawner to spawn a task spawner(async move { *counter_clone.lock().unwrap() += 1; }); // Run all tasks executor.run_all(); // Check if the task completed correctly assert_eq!(*counter.lock().unwrap(), 1); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/executor_tick.rs
any_spawner/tests/executor_tick.rs
#![cfg(feature = "tokio")] use any_spawner::Executor; use std::{ sync::{Arc, Mutex}, time::Duration, }; #[tokio::test] async fn test_executor_tick() { // Initialize the tokio executor Executor::init_tokio().expect("Failed to initialize tokio executor"); let value = Arc::new(Mutex::new(false)); let value_clone = value.clone(); // Spawn a task that sets the value after a tick Executor::spawn(async move { Executor::tick().await; *value_clone.lock().unwrap() = true; }); // Allow some time for the task to complete tokio::time::sleep(Duration::from_millis(50)).await; // Check that the value was set assert!(*value.lock().unwrap()); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/tokio_executor.rs
any_spawner/tests/tokio_executor.rs
#![cfg(feature = "tokio")] use any_spawner::Executor; use futures::channel::oneshot; #[tokio::test] async fn test_tokio_executor() { // Initialize the tokio executor Executor::init_tokio().expect("Failed to initialize tokio executor"); let (tx, rx) = oneshot::channel(); // Spawn a task that sends a value Executor::spawn(async move { tx.send(42).expect("Failed to send value"); }); // Wait for the spawned task to complete assert_eq!(rx.await.unwrap(), 42); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/multiple_tasks.rs
any_spawner/tests/multiple_tasks.rs
#![cfg(feature = "tokio")] use any_spawner::Executor; use futures::channel::oneshot; use std::sync::{Arc, Mutex}; #[tokio::test] async fn test_multiple_tasks() { Executor::init_tokio().expect("Failed to initialize tokio executor"); let counter = Arc::new(Mutex::new(0)); let tasks = 10; let mut handles = Vec::new(); // Spawn multiple tasks that increment the counter for _ in 0..tasks { let counter_clone = counter.clone(); let (tx, rx) = oneshot::channel(); Executor::spawn(async move { *counter_clone.lock().unwrap() += 1; tx.send(()).expect("Failed to send completion signal"); }); handles.push(rx); } // Wait for all tasks to complete for handle in handles { handle.await.expect("Task failed"); } // Verify that all tasks incremented the counter assert_eq!(*counter.lock().unwrap(), tasks); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/glib.rs
any_spawner/tests/glib.rs
#![cfg(feature = "glib")] use any_spawner::Executor; use glib::{MainContext, MainLoop}; use serial_test::serial; use std::{ cell::Cell, future::Future, rc::Rc, sync::{ atomic::{AtomicBool, Ordering}, Arc, Mutex, }, time::Duration, }; // Helper to run a future to completion on a dedicated glib MainContext. // Returns true if the future completed within the timeout, false otherwise. fn run_on_glib_context<F>(fut: F) where F: Future<Output = ()> + Send + 'static, { let _ = Executor::init_glib(); let context = MainContext::default(); let main_loop = MainLoop::new(Some(&context), false); let main_loop_clone = main_loop.clone(); Executor::spawn(async move { fut.await; main_loop_clone.quit(); }); main_loop.run(); } // Helper to run a local (!Send) future on the glib context. fn run_local_on_glib_context<F>(fut: F) where F: Future<Output = ()> + 'static, { let _ = Executor::init_glib(); let context = MainContext::default(); let main_loop = MainLoop::new(Some(&context), false); let main_loop_clone = main_loop.clone(); Executor::spawn_local(async move { fut.await; main_loop_clone.quit(); }); main_loop.run(); } // This test must run after a test that successfully initializes glib, // or within its own process. #[test] #[serial] fn test_glib_spawn() { let success_flag = Arc::new(AtomicBool::new(false)); let flag_clone = success_flag.clone(); run_on_glib_context(async move { // Simulate async work futures_lite::future::yield_now().await; flag_clone.store(true, Ordering::SeqCst); // We need to give the spawned task time to run. // The run_on_glib_context handles the main loop. // We just need to ensure spawn happened correctly. // Let's wait a tiny bit within the driving future to ensure spawn gets processed. glib::timeout_future(Duration::from_millis(10)).await; }); assert!( success_flag.load(Ordering::SeqCst), "Spawned future did not complete successfully" ); } // Similar conditions as test_glib_spawn regarding initialization state. #[test] #[serial] fn test_glib_spawn_local() { let success_flag = Rc::new(Cell::new(false)); let flag_clone = success_flag.clone(); run_local_on_glib_context(async move { // Use Rc to make the future !Send let non_send_data = Rc::new(Cell::new(10)); let data = non_send_data.get(); assert_eq!(data, 10, "Rc data should be accessible"); non_send_data.set(20); // Modify non-Send data // Simulate async work futures_lite::future::yield_now().await; assert_eq!( non_send_data.get(), 20, "Rc data should persist modification" ); flag_clone.set(true); // Wait a tiny bit glib::timeout_future(Duration::from_millis(10)).await; }); assert!( success_flag.get(), "Spawned local future did not complete successfully" ); } // Test Executor::tick with glib backend #[test] #[serial] fn test_glib_tick() { run_on_glib_context(async { let value = Arc::new(Mutex::new(false)); let value_clone = value.clone(); // Spawn a task that sets the value after a tick Executor::spawn(async move { Executor::tick().await; *value_clone.lock().unwrap() = true; }); // Allow some time for the task to complete glib::timeout_future(Duration::from_millis(10)).await; // Check that the value was set assert!(*value.lock().unwrap()); }); } // Test Executor::poll_local with glib backend (should be a no-op) #[test] #[serial] fn test_glib_poll_local_is_no_op() { // Ensure glib executor is initialized let _ = Executor::init_glib(); // poll_local for glib is configured as a no-op // Calling it should not panic or cause issues. Executor::poll_local(); Executor::poll_local(); println!("Executor::poll_local called successfully (expected no-op)."); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/custom_executor.rs
any_spawner/tests/custom_executor.rs
use any_spawner::Executor; use std::sync::{ atomic::{AtomicBool, Ordering}, Arc, }; #[test] fn test_custom_executor() { // Define a simple custom executor struct TestExecutor { spawn_called: Arc<AtomicBool>, spawn_local_called: Arc<AtomicBool>, poll_local_called: Arc<AtomicBool>, } impl any_spawner::CustomExecutor for TestExecutor { fn spawn(&self, fut: any_spawner::PinnedFuture<()>) { self.spawn_called.store(true, Ordering::SeqCst); // Execute the future immediately (this works for simple test futures) futures::executor::block_on(fut); } fn spawn_local(&self, fut: any_spawner::PinnedLocalFuture<()>) { self.spawn_local_called.store(true, Ordering::SeqCst); // Execute the future immediately futures::executor::block_on(fut); } fn poll_local(&self) { self.poll_local_called.store(true, Ordering::SeqCst); } } let spawn_called = Arc::new(AtomicBool::new(false)); let spawn_local_called = Arc::new(AtomicBool::new(false)); let poll_local_called = Arc::new(AtomicBool::new(false)); let executor = TestExecutor { spawn_called: spawn_called.clone(), spawn_local_called: spawn_local_called.clone(), poll_local_called: poll_local_called.clone(), }; // Initialize with our custom executor Executor::init_custom_executor(executor) .expect("Failed to initialize custom executor"); // Test spawn Executor::spawn(async { // Simple task }); assert!(spawn_called.load(Ordering::SeqCst)); // Test spawn_local Executor::spawn_local(async { // Simple local task }); assert!(spawn_local_called.load(Ordering::SeqCst)); // Test poll_local Executor::poll_local(); assert!(poll_local_called.load(Ordering::SeqCst)); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_spawner/tests/custom_runtime.rs
any_spawner/tests/custom_runtime.rs
#![cfg(feature = "futures-executor")] use any_spawner::{CustomExecutor, Executor, PinnedFuture, PinnedLocalFuture}; #[test] fn can_create_custom_executor() { use futures::{ executor::{LocalPool, LocalSpawner}, task::LocalSpawnExt, }; use std::{ cell::RefCell, sync::{ atomic::{AtomicUsize, Ordering}, Arc, }, }; thread_local! { static LOCAL_POOL: RefCell<LocalPool> = RefCell::new(LocalPool::new()); static SPAWNER: LocalSpawner = LOCAL_POOL.with(|pool| pool.borrow().spawner()); } struct CustomFutureExecutor; impl CustomExecutor for CustomFutureExecutor { fn spawn(&self, _fut: PinnedFuture<()>) { panic!("not supported in this test"); } fn spawn_local(&self, fut: PinnedLocalFuture<()>) { SPAWNER.with(|spawner| { spawner.spawn_local(fut).expect("failed to spawn future"); }); } fn poll_local(&self) { LOCAL_POOL.with(|pool| { if let Ok(mut pool) = pool.try_borrow_mut() { pool.run_until_stalled(); } // If we couldn't borrow_mut, we're in a nested call to poll, so we don't need to do anything. }); } } Executor::init_custom_executor(CustomFutureExecutor) .expect("couldn't set executor"); let counter = Arc::new(AtomicUsize::new(0)); let counter_clone = Arc::clone(&counter); Executor::spawn_local(async move { counter_clone.store(1, Ordering::Release); }); Executor::poll_local(); assert_eq!(counter.load(Ordering::Acquire), 1); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/any_error/src/lib.rs
any_error/src/lib.rs
#![forbid(unsafe_code)] #![deny(missing_docs)] //! A utility library for wrapping arbitrary errors, and for “throwing” errors in a way //! that can be caught by user-defined error hooks. use std::{ cell::RefCell, error, fmt::{self, Display}, future::Future, ops, pin::Pin, sync::Arc, task::{Context, Poll}, }; /* Wrapper Types */ /// A generic wrapper for any error. #[derive(Debug, Clone)] #[repr(transparent)] pub struct Error(Arc<dyn error::Error + Send + Sync>); impl Error { /// Converts the wrapper into the inner reference-counted error. pub fn into_inner(self) -> Arc<dyn error::Error + Send + Sync> { Arc::clone(&self.0) } } impl ops::Deref for Error { type Target = Arc<dyn error::Error + Send + Sync>; fn deref(&self) -> &Self::Target { &self.0 } } impl fmt::Display for Error { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { write!(f, "{}", self.0) } } impl<T> From<T> for Error where T: Into<Box<dyn error::Error + Send + Sync + 'static>>, { fn from(value: T) -> Self { Error(Arc::from(value.into())) } } /// Implements behavior that allows for global or scoped error handling. /// /// This allows for both "throwing" errors to register them, and "clearing" errors when they are no /// longer valid. This is useful for something like a user interface, in which an error can be /// "thrown" on some invalid user input, and later "cleared" if the user corrects the input. /// Keeping a unique identifier for each error allows the UI to be updated accordingly. pub trait ErrorHook: Send + Sync { /// Handles the given error, returning a unique identifier. fn throw(&self, error: Error) -> ErrorId; /// Clears the error associated with the given identifier. fn clear(&self, id: &ErrorId); } /// A unique identifier for an error. This is returned when you call [`throw`], which calls a /// global error handler. #[derive(Debug, PartialEq, Eq, Hash, Clone, Default)] pub struct ErrorId(usize); impl Display for ErrorId { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { Display::fmt(&self.0, f) } } impl From<usize> for ErrorId { fn from(value: usize) -> Self { Self(value) } } thread_local! { static ERROR_HOOK: RefCell<Option<Arc<dyn ErrorHook>>> = RefCell::new(None); } /// Resets the error hook to its previous state when dropped. pub struct ResetErrorHookOnDrop(Option<Arc<dyn ErrorHook>>); impl Drop for ResetErrorHookOnDrop { fn drop(&mut self) { ERROR_HOOK.with_borrow_mut(|this| *this = self.0.take()) } } /// Returns the current error hook. pub fn get_error_hook() -> Option<Arc<dyn ErrorHook>> { ERROR_HOOK.with_borrow(Clone::clone) } /// Sets the current thread-local error hook, which will be invoked when [`throw`] is called. pub fn set_error_hook(hook: Arc<dyn ErrorHook>) -> ResetErrorHookOnDrop { ResetErrorHookOnDrop( ERROR_HOOK.with_borrow_mut(|this| Option::replace(this, hook)), ) } /// Invokes the error hook set by [`set_error_hook`] with the given error. pub fn throw(error: impl Into<Error>) -> ErrorId { ERROR_HOOK .with_borrow(|hook| hook.as_ref().map(|hook| hook.throw(error.into()))) .unwrap_or_default() } /// Clears the given error from the current error hook. pub fn clear(id: &ErrorId) { ERROR_HOOK .with_borrow(|hook| hook.as_ref().map(|hook| hook.clear(id))) .unwrap_or_default() } pin_project_lite::pin_project! { /// A [`Future`] that reads the error hook that is set when it is created, and sets this as the /// current error hook whenever it is polled. pub struct ErrorHookFuture<Fut> { hook: Option<Arc<dyn ErrorHook>>, #[pin] inner: Fut } } impl<Fut> ErrorHookFuture<Fut> { /// Reads the current hook and wraps the given [`Future`], returning a new `Future` that will /// set the error hook whenever it is polled. pub fn new(inner: Fut) -> Self { Self { hook: ERROR_HOOK.with_borrow(Clone::clone), inner, } } } impl<Fut> Future for ErrorHookFuture<Fut> where Fut: Future, { type Output = Fut::Output; fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> { let this = self.project(); let _hook = this .hook .as_ref() .map(|hook| set_error_hook(Arc::clone(hook))); this.inner.poll(cx) } } #[cfg(test)] mod tests { use super::*; use std::error::Error as StdError; #[derive(Debug)] struct MyError; impl Display for MyError { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { write!(f, "MyError") } } impl StdError for MyError {} #[test] fn test_from() { let e = MyError; let _le = Error::from(e); let e = "some error".to_string(); let _le = Error::from(e); let e = anyhow::anyhow!("anyhow error"); let _le = Error::from(e); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn_macro/build.rs
server_fn_macro/build.rs
use rustc_version::{version_meta, Channel}; fn main() { // Set cfg flags depending on release channel if matches!(version_meta().unwrap().channel, Channel::Nightly) { println!("cargo:rustc-cfg=rustc_nightly"); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn_macro/src/lib.rs
server_fn_macro/src/lib.rs
#![cfg_attr(all(feature = "nightly", rustc_nightly), feature(proc_macro_span))] #![forbid(unsafe_code)] #![deny(missing_docs)] //! Implementation of the `server_fn` macro. //! //! This crate contains the implementation of the `server_fn` macro. [`server_macro_impl`] can be used to implement custom versions of the macro for different frameworks that allow users to pass a custom context from the server to the server function. use convert_case::{Case, Converter}; use proc_macro2::{Span, TokenStream as TokenStream2}; use quote::{format_ident, quote, quote_spanned, ToTokens}; use syn::{ parse::{Parse, ParseStream}, punctuated::Punctuated, spanned::Spanned, *, }; /// A parsed server function call. pub struct ServerFnCall { args: ServerFnArgs, body: ServerFnBody, default_path: String, server_fn_path: Option<Path>, preset_server: Option<Type>, default_protocol: Option<Type>, default_input_encoding: Option<Type>, default_output_encoding: Option<Type>, } impl ServerFnCall { /// Parse the arguments of a server function call. /// /// ```ignore /// #[proc_macro_attribute] /// pub fn server(args: proc_macro::TokenStream, s: TokenStream) -> TokenStream { /// match ServerFnCall::parse( /// "/api", /// args.into(), /// s.into(), /// ) { /// Err(e) => e.to_compile_error().into(), /// Ok(s) => s.to_token_stream().into(), /// } /// } /// ``` pub fn parse( default_path: &str, args: TokenStream2, body: TokenStream2, ) -> Result<Self> { let args = syn::parse2(args)?; let body = syn::parse2(body)?; let mut myself = ServerFnCall { default_path: default_path.into(), args, body, server_fn_path: None, preset_server: None, default_protocol: None, default_input_encoding: None, default_output_encoding: None, }; // We need to make the server function body send if actix is enabled. To // do that, we wrap the body in a SendWrapper, which is an async fn that // asserts that the future is always polled from the same thread. if cfg!(feature = "actix") { let server_fn_path = myself.server_fn_path(); let block = myself.body.block.to_token_stream(); myself.body.block = quote! { { #server_fn_path::actix::SendWrapper::new(async move { #block }) .await } }; } Ok(myself) } /// Get a reference to the server function arguments. pub fn get_args(&self) -> &ServerFnArgs { &self.args } /// Get a mutable reference to the server function arguments. pub fn get_args_mut(&mut self) -> &mut ServerFnArgs { &mut self.args } /// Get a reference to the server function body. pub fn get_body(&self) -> &ServerFnBody { &self.body } /// Get a mutable reference to the server function body. pub fn get_body_mut(&mut self) -> &mut ServerFnBody { &mut self.body } /// Set the path to the server function crate. pub fn default_server_fn_path(mut self, path: Option<Path>) -> Self { self.server_fn_path = path; self } /// Set the default server implementation. pub fn default_server_type(mut self, server: Option<Type>) -> Self { self.preset_server = server; self } /// Set the default protocol. pub fn default_protocol(mut self, protocol: Option<Type>) -> Self { self.default_protocol = protocol; self } /// Set the default input http encoding. This will be used by [`Self::protocol`] /// if no protocol or default protocol is set or if only the output encoding is set /// /// Defaults to `PostUrl` pub fn default_input_encoding(mut self, protocol: Option<Type>) -> Self { self.default_input_encoding = protocol; self } /// Set the default output http encoding. This will be used by [`Self::protocol`] /// if no protocol or default protocol is set or if only the input encoding is set /// /// Defaults to `Json` pub fn default_output_encoding(mut self, protocol: Option<Type>) -> Self { self.default_output_encoding = protocol; self } /// Get the client type to use for the server function. pub fn client_type(&self) -> Type { let server_fn_path = self.server_fn_path(); if let Some(client) = self.args.client.clone() { client } else if cfg!(feature = "reqwest") { parse_quote! { #server_fn_path::client::reqwest::ReqwestClient } } else { parse_quote! { #server_fn_path::client::browser::BrowserClient } } } /// Get the server type to use for the server function. pub fn server_type(&self) -> Type { let server_fn_path = self.server_fn_path(); if !cfg!(feature = "ssr") { parse_quote! { #server_fn_path::mock::BrowserMockServer } } else if cfg!(feature = "axum") { parse_quote! { #server_fn_path::axum::AxumServerFnBackend } } else if cfg!(feature = "actix") { parse_quote! { #server_fn_path::actix::ActixServerFnBackend } } else if cfg!(feature = "generic") { parse_quote! { #server_fn_path::axum::AxumServerFnBackend } } else if let Some(server) = &self.args.server { server.clone() } else if let Some(server) = &self.preset_server { server.clone() } else { // fall back to the browser version, to avoid erroring out // in things like doctests // in reality, one of the above needs to be set parse_quote! { #server_fn_path::mock::BrowserMockServer } } } /// Get the path to the server_fn crate. pub fn server_fn_path(&self) -> Path { self.server_fn_path .clone() .unwrap_or_else(|| parse_quote! { server_fn }) } /// Get the input http encoding if no protocol is set fn input_http_encoding(&self) -> Type { let server_fn_path = self.server_fn_path(); self.args .input .as_ref() .map(|n| { if self.args.builtin_encoding { parse_quote! { #server_fn_path::codec::#n } } else { n.clone() } }) .unwrap_or_else(|| { self.default_input_encoding.clone().unwrap_or_else( || parse_quote!(#server_fn_path::codec::PostUrl), ) }) } /// Get the output http encoding if no protocol is set fn output_http_encoding(&self) -> Type { let server_fn_path = self.server_fn_path(); self.args .output .as_ref() .map(|n| { if self.args.builtin_encoding { parse_quote! { #server_fn_path::codec::#n } } else { n.clone() } }) .unwrap_or_else(|| { self.default_output_encoding.clone().unwrap_or_else( || parse_quote!(#server_fn_path::codec::Json), ) }) } /// Get the http input and output encodings for the server function /// if no protocol is set pub fn http_encodings(&self) -> Option<(Type, Type)> { self.args .protocol .is_none() .then(|| (self.input_http_encoding(), self.output_http_encoding())) } /// Get the protocol to use for the server function. pub fn protocol(&self) -> Type { let server_fn_path = self.server_fn_path(); let default_protocol = &self.default_protocol; self.args.protocol.clone().unwrap_or_else(|| { // If both the input and output encodings are none, // use the default protocol if self.args.input.is_none() && self.args.output.is_none() { default_protocol.clone().unwrap_or_else(|| { parse_quote! { #server_fn_path::Http<#server_fn_path::codec::PostUrl, #server_fn_path::codec::Json> } }) } else { // Otherwise use the input and output encodings, filling in // defaults if necessary let input = self.input_http_encoding(); let output = self.output_http_encoding(); parse_quote! { #server_fn_path::Http<#input, #output> } } }) } fn input_ident(&self) -> Option<String> { match &self.args.input { Some(Type::Path(path)) => { path.path.segments.last().map(|seg| seg.ident.to_string()) } None => Some("PostUrl".to_string()), _ => None, } } fn websocket_protocol(&self) -> bool { if let Type::Path(path) = self.protocol() { path.path .segments .iter() .any(|segment| segment.ident == "Websocket") } else { false } } fn serde_path(&self) -> String { let path = self .server_fn_path() .segments .iter() .map(|segment| segment.ident.to_string()) .collect::<Vec<_>>(); let path = path.join("::"); format!("{path}::serde") } /// Get the docs for the server function. pub fn docs(&self) -> TokenStream2 { // pass through docs from the function body self.body .docs .iter() .map(|(doc, span)| quote_spanned!(*span=> #[doc = #doc])) .collect::<TokenStream2>() } /// Get the lint attributes for the server function. pub fn lint_attrs(&self) -> TokenStream2 { // pass through lint attributes from the function body self.body .lint_attrs .iter() .map(|lint_attr| quote!(#lint_attr)) .collect::<TokenStream2>() } fn fn_name_as_str(&self) -> String { self.body.ident.to_string() } fn struct_tokens(&self) -> TokenStream2 { let server_fn_path = self.server_fn_path(); let fn_name_as_str = self.fn_name_as_str(); let link_to_server_fn = format!( "Serialized arguments for the [`{fn_name_as_str}`] server \ function.\n\n" ); let args_docs = quote! { #[doc = #link_to_server_fn] }; let docs = self.docs(); let input_ident = self.input_ident(); enum PathInfo { Serde, Rkyv, Bitcode, None, } let (path, derives) = match input_ident.as_deref() { Some("Rkyv") => ( PathInfo::Rkyv, quote! { Clone, #server_fn_path::rkyv::Archive, #server_fn_path::rkyv::Serialize, #server_fn_path::rkyv::Deserialize }, ), Some("Bitcode") => ( PathInfo::Bitcode, quote! { Clone, #server_fn_path::bitcode::Encode, #server_fn_path::bitcode::Decode }, ), Some("MultipartFormData") | Some("Streaming") | Some("StreamingText") => (PathInfo::None, quote! {}), Some("SerdeLite") => ( PathInfo::Serde, quote! { Clone, #server_fn_path::serde_lite::Serialize, #server_fn_path::serde_lite::Deserialize }, ), _ => match &self.args.input_derive { Some(derives) => { let d = &derives.elems; (PathInfo::None, quote! { #d }) } None => { if self.websocket_protocol() { (PathInfo::None, quote! {}) } else { ( PathInfo::Serde, quote! { Clone, #server_fn_path::serde::Serialize, #server_fn_path::serde::Deserialize }, ) } } }, }; let addl_path = match path { PathInfo::Serde => { let serde_path = self.serde_path(); quote! { #[serde(crate = #serde_path)] } } PathInfo::Bitcode => quote! {}, PathInfo::Rkyv => quote! {}, PathInfo::None => quote! {}, }; let lint_attrs = self.lint_attrs(); let vis = &self.body.vis; let struct_name = self.struct_name(); let fields = self .body .inputs .iter() .map(|server_fn_arg| { let mut typed_arg = server_fn_arg.arg.clone(); // strip `mut`, which is allowed in fn args but not in struct fields if let Pat::Ident(ident) = &mut *typed_arg.pat { ident.mutability = None; } let attrs = &server_fn_arg.server_fn_attributes; quote! { #(#attrs ) * #vis #typed_arg } }) .collect::<Vec<_>>(); quote! { #args_docs #docs #[derive(Debug, #derives)] #addl_path #lint_attrs #vis struct #struct_name { #(#fields),* } } } /// Get the name of the server function struct that will be submitted to inventory. /// /// This will either be the name specified in the macro arguments or the PascalCase /// version of the function name. pub fn struct_name(&self) -> Ident { // default to PascalCase version of function name if no struct name given self.args.struct_name.clone().unwrap_or_else(|| { let upper_camel_case_name = Converter::new() .from_case(Case::Snake) .to_case(Case::UpperCamel) .convert(self.body.ident.to_string()); Ident::new(&upper_camel_case_name, self.body.ident.span()) }) } /// Wrap the struct name in any custom wrapper specified in the macro arguments /// and return it as a type fn wrapped_struct_name(&self) -> TokenStream2 { let struct_name = self.struct_name(); if let Some(wrapper) = self.args.custom_wrapper.as_ref() { quote! { #wrapper<#struct_name> } } else { quote! { #struct_name } } } /// Wrap the struct name in any custom wrapper specified in the macro arguments /// and return it as a type with turbofish fn wrapped_struct_name_turbofish(&self) -> TokenStream2 { let struct_name = self.struct_name(); if let Some(wrapper) = self.args.custom_wrapper.as_ref() { quote! { #wrapper::<#struct_name> } } else { quote! { #struct_name } } } /// Generate the code to submit the server function type to inventory. pub fn submit_to_inventory(&self) -> TokenStream2 { // auto-registration with inventory if cfg!(feature = "ssr") { let server_fn_path = self.server_fn_path(); let wrapped_struct_name = self.wrapped_struct_name(); let wrapped_struct_name_turbofish = self.wrapped_struct_name_turbofish(); quote! { #server_fn_path::inventory::submit! {{ use #server_fn_path::{ServerFn, codec::Encoding}; #server_fn_path::ServerFnTraitObj::new::<#wrapped_struct_name>( |req| Box::pin(#wrapped_struct_name_turbofish::run_on_server(req)), ) }} } } else { quote! {} } } /// Generate the server function's URL. This will be the prefix path, then by the /// module path if `SERVER_FN_MOD_PATH` is set, then the function name, and finally /// a hash of the function name and location in the source code. pub fn server_fn_url(&self) -> TokenStream2 { let default_path = &self.default_path; let prefix = self.args.prefix.clone().unwrap_or_else(|| { LitStr::new(default_path, Span::call_site()) }); let server_fn_path = self.server_fn_path(); let fn_path = self.args.fn_path.clone().map(|fn_path| { let fn_path = fn_path.value(); // Remove any leading slashes, then add one slash back let fn_path = "/".to_string() + fn_path.trim_start_matches('/'); fn_path }); let enable_server_fn_mod_path = option_env!("SERVER_FN_MOD_PATH").is_some(); let mod_path = if enable_server_fn_mod_path { quote! { #server_fn_path::const_format::concatcp!( #server_fn_path::const_str::replace!(module_path!(), "::", "/"), "/" ) } } else { quote! { "" } }; let enable_hash = option_env!("DISABLE_SERVER_FN_HASH").is_none(); let key_env_var = match option_env!("SERVER_FN_OVERRIDE_KEY") { Some(_) => "SERVER_FN_OVERRIDE_KEY", None => "CARGO_MANIFEST_DIR", }; let hash = if enable_hash { quote! { #server_fn_path::xxhash_rust::const_xxh64::xxh64( concat!(env!(#key_env_var), ":", module_path!()).as_bytes(), 0 ) } } else { quote! { "" } }; let fn_name_as_str = self.fn_name_as_str(); if let Some(fn_path) = fn_path { quote! { #server_fn_path::const_format::concatcp!( #prefix, #mod_path, #fn_path ) } } else { quote! { #server_fn_path::const_format::concatcp!( #prefix, "/", #mod_path, #fn_name_as_str, #hash ) } } } /// Get the names of the fields the server function takes as inputs. fn field_names(&self) -> Vec<&std::boxed::Box<syn::Pat>> { self.body .inputs .iter() .map(|f| &f.arg.pat) .collect::<Vec<_>>() } /// Generate the implementation for the server function trait. fn server_fn_impl(&self) -> TokenStream2 { let server_fn_path = self.server_fn_path(); let struct_name = self.struct_name(); let protocol = self.protocol(); let middlewares = &self.body.middlewares; let return_ty = &self.body.return_ty; let output_ty = self.body.output_ty .as_ref() .map_or_else(|| { quote! { <#return_ty as #server_fn_path::error::ServerFnMustReturnResult>::Ok } }, ToTokens::to_token_stream, ); let error_ty = &self.body.error_ty; let error_ty = error_ty .as_ref() .map_or_else(|| { quote! { <#return_ty as #server_fn_path::error::ServerFnMustReturnResult>::Err } }, ToTokens::to_token_stream, ); let error_ws_in_ty = if self.websocket_protocol() { self.body .error_ws_in_ty .as_ref() .map(ToTokens::to_token_stream) .unwrap_or(error_ty.clone()) } else { error_ty.clone() }; let error_ws_out_ty = if self.websocket_protocol() { self.body .error_ws_out_ty .as_ref() .map(ToTokens::to_token_stream) .unwrap_or(error_ty.clone()) } else { error_ty.clone() }; let field_names = self.field_names(); // run_body in the trait implementation let run_body = if cfg!(feature = "ssr") { let destructure = if let Some(wrapper) = self.args.custom_wrapper.as_ref() { quote! { let #wrapper(#struct_name { #(#field_names),* }) = self; } } else { quote! { let #struct_name { #(#field_names),* } = self; } }; let dummy_name = self.body.to_dummy_ident(); // using the impl Future syntax here is thanks to Actix // // if we use Actix types inside the function, here, it becomes !Send // so we need to add SendWrapper, because Actix won't actually send it anywhere // but if we used SendWrapper in an async fn, the types don't work out because it // becomes impl Future<Output = SendWrapper<_>> // // however, SendWrapper<Future<Output = T>> impls Future<Output = T> let body = quote! { async move { #destructure #dummy_name(#(#field_names),*).await } }; quote! { // we need this for Actix, for the SendWrapper to count as impl Future // but non-Actix will have a clippy warning otherwise #[allow(clippy::manual_async_fn)] fn run_body(self) -> impl std::future::Future<Output = #return_ty> + Send { #body } } } else { quote! { #[allow(unused_variables)] async fn run_body(self) -> #return_ty { unreachable!() } } }; let client = self.client_type(); let server = self.server_type(); // generate the url of the server function let path = self.server_fn_url(); let middlewares = if cfg!(feature = "ssr") { quote! { vec![ #( std::sync::Arc::new(#middlewares) ),* ] } } else { quote! { vec![] } }; let wrapped_struct_name = self.wrapped_struct_name(); quote! { impl #server_fn_path::ServerFn for #wrapped_struct_name { const PATH: &'static str = #path; type Client = #client; type Server = #server; type Protocol = #protocol; type Output = #output_ty; type Error = #error_ty; type InputStreamError = #error_ws_in_ty; type OutputStreamError = #error_ws_out_ty; fn middlewares() -> Vec<std::sync::Arc<dyn #server_fn_path::middleware::Layer<<Self::Server as #server_fn_path::server::Server<Self::Error>>::Request, <Self::Server as #server_fn_path::server::Server<Self::Error>>::Response>>> { #middlewares } #run_body } } } /// Return the name and type of the first field if there is only one field. fn single_field(&self) -> Option<(&Pat, &Type)> { self.body .inputs .first() .filter(|_| self.body.inputs.len() == 1) .map(|field| (&*field.arg.pat, &*field.arg.ty)) } fn deref_impl(&self) -> TokenStream2 { let impl_deref = self .args .impl_deref .as_ref() .map(|v| v.value) .unwrap_or(true) || self.websocket_protocol(); if !impl_deref { return quote! {}; } // if there's exactly one field, impl Deref<T> for the struct let Some(single_field) = self.single_field() else { return quote! {}; }; let struct_name = self.struct_name(); let (name, ty) = single_field; quote! { impl std::ops::Deref for #struct_name { type Target = #ty; fn deref(&self) -> &Self::Target { &self.#name } } } } fn impl_from(&self) -> TokenStream2 { let impl_from = self .args .impl_from .as_ref() .map(|v| v.value) .unwrap_or(true) || self.websocket_protocol(); if !impl_from { return quote! {}; } // if there's exactly one field, impl From<T> for the struct let Some(single_field) = self.single_field() else { return quote! {}; }; let struct_name = self.struct_name(); let (name, ty) = single_field; quote! { impl From<#struct_name> for #ty { fn from(value: #struct_name) -> Self { let #struct_name { #name } = value; #name } } impl From<#ty> for #struct_name { fn from(#name: #ty) -> Self { #struct_name { #name } } } } } fn func_tokens(&self) -> TokenStream2 { let body = &self.body; // default values for args let struct_name = self.struct_name(); // build struct for type let fn_name = &body.ident; let attrs = &body.attrs; let fn_args = body.inputs.iter().map(|f| &f.arg).collect::<Vec<_>>(); let field_names = self.field_names(); // check output type let output_arrow = body.output_arrow; let return_ty = &body.return_ty; let vis = &body.vis; // Forward the docs from the function let docs = self.docs(); // the actual function definition if cfg!(feature = "ssr") { let dummy_name = body.to_dummy_ident(); quote! { #docs #(#attrs)* #vis async fn #fn_name(#(#fn_args),*) #output_arrow #return_ty { #dummy_name(#(#field_names),*).await } } } else { let restructure = if let Some(custom_wrapper) = self.args.custom_wrapper.as_ref() { quote! { let data = #custom_wrapper(#struct_name { #(#field_names),* }); } } else { quote! { let data = #struct_name { #(#field_names),* }; } }; let server_fn_path = self.server_fn_path(); quote! { #docs #(#attrs)* #[allow(unused_variables)] #vis async fn #fn_name(#(#fn_args),*) #output_arrow #return_ty { use #server_fn_path::ServerFn; #restructure data.run_on_client().await } } } } } impl ToTokens for ServerFnCall { fn to_tokens(&self, tokens: &mut TokenStream2) { let body = &self.body; // only emit the dummy (unmodified server-only body) for the server build let dummy = cfg!(feature = "ssr").then(|| body.to_dummy_output()); let impl_from = self.impl_from(); let deref_impl = self.deref_impl(); let inventory = self.submit_to_inventory(); let func = self.func_tokens(); let server_fn_impl = self.server_fn_impl(); let struct_tokens = self.struct_tokens(); tokens.extend(quote! { #struct_tokens #impl_from #deref_impl #server_fn_impl #inventory #func #dummy }); } } /// The implementation of the `server` macro. /// ```ignore /// #[proc_macro_attribute] /// pub fn server(args: proc_macro::TokenStream, s: TokenStream) -> TokenStream { /// match server_macro_impl( /// args.into(), /// s.into(), /// Some(syn::parse_quote!(my_crate::exports::server_fn)), /// ) { /// Err(e) => e.to_compile_error().into(), /// Ok(s) => s.to_token_stream().into(), /// } /// } /// ``` pub fn server_macro_impl( args: TokenStream2, body: TokenStream2, server_fn_path: Option<Path>, default_path: &str, preset_server: Option<Type>, default_protocol: Option<Type>, ) -> Result<TokenStream2> { let body = ServerFnCall::parse(default_path, args, body)? .default_server_fn_path(server_fn_path) .default_server_type(preset_server) .default_protocol(default_protocol); Ok(body.to_token_stream()) } fn type_from_ident(ident: Ident) -> Type { let mut segments = Punctuated::new(); segments.push(PathSegment { ident, arguments: PathArguments::None, }); Type::Path(TypePath { qself: None, path: Path { leading_colon: None, segments, }, }) } /// Middleware for a server function. #[derive(Debug, Clone)] pub struct Middleware { expr: syn::Expr, } impl ToTokens for Middleware { fn to_tokens(&self, tokens: &mut TokenStream2) { let expr = &self.expr; tokens.extend(quote::quote! { #expr }); } } impl Parse for Middleware { fn parse(input: syn::parse::ParseStream) -> syn::Result<Self> { let arg: syn::Expr = input.parse()?; Ok(Middleware { expr: arg }) } } fn output_type(return_ty: &Type) -> Option<&Type> { if let syn::Type::Path(pat) = &return_ty { if pat.path.segments[0].ident == "Result" { if pat.path.segments.is_empty() { panic!("{:#?}", pat.path); } else if let PathArguments::AngleBracketed(args) = &pat.path.segments[0].arguments { if let GenericArgument::Type(ty) = &args.args[0] { return Some(ty); } } } }; None } fn err_type(return_ty: &Type) -> Option<&Type> { if let syn::Type::Path(pat) = &return_ty { if pat.path.segments[0].ident == "Result" { if let PathArguments::AngleBracketed(args) = &pat.path.segments[0].arguments { // Result<T> if args.args.len() == 1 { return None; } // Result<T, _> else if let GenericArgument::Type(ty) = &args.args[1] { return Some(ty); } } } }; None } fn err_ws_in_type( inputs: &Punctuated<ServerFnArg, syn::token::Comma>, ) -> Option<Type> { inputs.into_iter().find_map(|pat| { if let syn::Type::Path(ref pat) = *pat.arg.ty { if pat.path.segments[0].ident != "BoxedStream" { return None; } if let PathArguments::AngleBracketed(args) = &pat.path.segments[0].arguments { // BoxedStream<T> if args.args.len() == 1 { return None; } // BoxedStream<T, E> else if let GenericArgument::Type(ty) = &args.args[1] { return Some(ty.clone()); } }; }; None }) } fn err_ws_out_type(output_ty: &Option<Type>) -> Result<Option<Type>> { if let Some(syn::Type::Path(ref pat)) = output_ty { if pat.path.segments[0].ident == "BoxedStream" { if let PathArguments::AngleBracketed(args) = &pat.path.segments[0].arguments { // BoxedStream<T> if args.args.len() == 1 { return Ok(None); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
true
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/build.rs
server_fn/build.rs
use rustc_version::{version_meta, Channel}; fn main() { // Set cfg flags depending on release channel if matches!(version_meta().unwrap().channel, Channel::Nightly) { println!("cargo:rustc-cfg=rustc_nightly"); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/lib.rs
server_fn/src/lib.rs
#![forbid(unsafe_code)] #![deny(missing_docs)] //! # Server Functions //! //! This package is based on a simple idea: sometimes it’s useful to write functions //! that will only run on the server, and call them from the client. //! //! If you’re creating anything beyond a toy app, you’ll need to do this all the time: //! reading from or writing to a database that only runs on the server, running expensive //! computations using libraries you don’t want to ship down to the client, accessing //! APIs that need to be called from the server rather than the client for CORS reasons //! or because you need a secret API key that’s stored on the server and definitely //! shouldn’t be shipped down to a user’s browser. //! //! Traditionally, this is done by separating your server and client code, and by setting //! up something like a REST API or GraphQL API to allow your client to fetch and mutate //! data on the server. This is fine, but it requires you to write and maintain your code //! in multiple separate places (client-side code for fetching, server-side functions to run), //! as well as creating a third thing to manage, which is the API contract between the two. //! //! This package provides two simple primitives that allow you instead to write co-located, //! isomorphic server functions. (*Co-located* means you can write them in your app code so //! that they are “located alongside” the client code that calls them, rather than separating //! the client and server sides. *Isomorphic* means you can call them from the client as if //! you were simply calling a function; the function call has the “same shape” on the client //! as it does on the server.) //! //! ### `#[server]` //! //! The [`#[server]`](../leptos/attr.server.html) macro allows you to annotate a function to //! indicate that it should only run on the server (i.e., when you have an `ssr` feature in your //! crate that is enabled). //! //! **Important**: Before calling a server function on a non-web platform, you must set the server URL by calling //! [`set_server_url`](crate::client::set_server_url). //! //! ```rust,ignore //! #[server] //! async fn read_posts(how_many: usize, query: String) -> Result<Vec<Posts>, ServerFnError> { //! // do some server-only work here to access the database //! let posts = ...; //! Ok(posts) //! } //! //! // call the function //! # #[tokio::main] //! # async fn main() { //! async { //! let posts = read_posts(3, "my search".to_string()).await; //! log::debug!("posts = {posts:#?}"); //! } //! # } //! ``` //! //! If you call this function from the client, it will serialize the function arguments and `POST` //! them to the server as if they were the URL-encoded inputs in `<form method="post">`. //! //! Here’s what you need to remember: //! - **Server functions must be `async`.** Even if the work being done inside the function body //! can run synchronously on the server, from the client’s perspective it involves an asynchronous //! function call. //! - **Server functions must return `Result<T, ServerFnError>`.** Even if the work being done //! inside the function body can’t fail, the processes of serialization/deserialization and the //! network call are fallible. [`ServerFnError`] can receive generic errors. //! - **Server functions are part of the public API of your application.** A server function is an //! ad hoc HTTP API endpoint, not a magic formula. Any server function can be accessed by any HTTP //! client. You should take care to sanitize any data being returned from the function to ensure it //! does not leak data that should exist only on the server. //! - **Server functions can’t be generic.** Because each server function creates a separate API endpoint, //! it is difficult to monomorphize. As a result, server functions cannot be generic (for now?) If you need to use //! a generic function, you can define a generic inner function called by multiple concrete server functions. //! - **Arguments and return types must be serializable.** We support a variety of different encodings, //! but one way or another arguments need to be serialized to be sent to the server and deserialized //! on the server, and the return type must be serialized on the server and deserialized on the client. //! This means that the set of valid server function argument and return types is a subset of all //! possible Rust argument and return types. (i.e., server functions are strictly more limited than //! ordinary functions.) //! //! ## Server Function Encodings //! //! Server functions are designed to allow a flexible combination of input and output encodings, the set //! of which can be found in the [`codec`] module. //! //! Calling and handling server functions is done through the [`Protocol`] trait, which is implemented //! for the [`Http`] and [`Websocket`] protocols. Most server functions will use the [`Http`] protocol. //! //! When using the [`Http`] protocol, the serialization/deserialization process for server functions //! consists of a series of steps, each of which is represented by a different trait: //! 1. [`IntoReq`]: The client serializes the [`ServerFn`] argument type into an HTTP request. //! 2. The [`Client`] sends the request to the server. //! 3. [`FromReq`]: The server deserializes the HTTP request back into the [`ServerFn`] type. //! 4. The server calls calls [`ServerFn::run_body`] on the data. //! 5. [`IntoRes`]: The server serializes the [`ServerFn::Output`] type into an HTTP response. //! 6. The server integration applies any middleware from [`ServerFn::middlewares`] and responds to the request. //! 7. [`FromRes`]: The client deserializes the response back into the [`ServerFn::Output`] type. //! //! [server]: ../leptos/attr.server.html //! [`serde_qs`]: <https://docs.rs/serde_qs/latest/serde_qs/> //! [`cbor`]: <https://docs.rs/cbor/latest/cbor/> /// Implementations of the client side of the server function call. pub mod client; /// Implementations of the server side of the server function call. pub mod server; /// Encodings for arguments and results. pub mod codec; #[macro_use] /// Error types and utilities. pub mod error; /// Types to add server middleware to a server function. pub mod middleware; /// Utilities to allow client-side redirects. pub mod redirect; /// Types and traits for for HTTP requests. pub mod request; /// Types and traits for HTTP responses. pub mod response; #[cfg(feature = "actix-no-default")] #[doc(hidden)] pub use ::actix_web as actix_export; #[cfg(feature = "axum-no-default")] #[doc(hidden)] pub use ::axum as axum_export; #[cfg(feature = "generic")] #[doc(hidden)] pub use ::bytes as bytes_export; #[cfg(feature = "generic")] #[doc(hidden)] pub use ::http as http_export; use base64::{engine::general_purpose::STANDARD_NO_PAD, DecodeError, Engine}; #[cfg(feature = "bitcode")] pub use bitcode; // re-exported to make it possible to implement a custom Client without adding a separate // dependency on `bytes` pub use bytes::Bytes; use bytes::{BufMut, BytesMut}; use client::Client; use codec::{Encoding, FromReq, FromRes, IntoReq, IntoRes}; #[doc(hidden)] pub use const_format; #[doc(hidden)] pub use const_str; use dashmap::DashMap; pub use error::ServerFnError; #[cfg(feature = "form-redirects")] use error::ServerFnUrlError; use error::{FromServerFnError, ServerFnErrorErr}; use futures::{pin_mut, SinkExt, Stream, StreamExt}; use http::Method; use middleware::{BoxedService, Layer, Service}; use redirect::call_redirect_hook; use request::Req; use response::{ClientRes, Res, TryRes}; #[cfg(feature = "rkyv")] pub use rkyv; #[doc(hidden)] pub use serde; #[doc(hidden)] #[cfg(feature = "serde-lite")] pub use serde_lite; use server::Server; use std::{ fmt::{Debug, Display}, future::Future, marker::PhantomData, ops::{Deref, DerefMut}, pin::Pin, sync::{Arc, LazyLock}, }; #[doc(hidden)] pub use xxhash_rust; type ServerFnServerRequest<Fn> = <<Fn as ServerFn>::Server as crate::Server< <Fn as ServerFn>::Error, <Fn as ServerFn>::InputStreamError, <Fn as ServerFn>::OutputStreamError, >>::Request; type ServerFnServerResponse<Fn> = <<Fn as ServerFn>::Server as crate::Server< <Fn as ServerFn>::Error, <Fn as ServerFn>::InputStreamError, <Fn as ServerFn>::OutputStreamError, >>::Response; /// Defines a function that runs only on the server, but can be called from the server or the client. /// /// The type for which `ServerFn` is implemented is actually the type of the arguments to the function, /// while the function body itself is implemented in [`run_body`](ServerFn::run_body). /// /// This means that `Self` here is usually a struct, in which each field is an argument to the function. /// In other words, /// ```rust,ignore /// #[server] /// pub async fn my_function(foo: String, bar: usize) -> Result<usize, ServerFnError> { /// Ok(foo.len() + bar) /// } /// ``` /// should expand to /// ```rust,ignore /// #[derive(Serialize, Deserialize)] /// pub struct MyFunction { /// foo: String, /// bar: usize /// } /// /// impl ServerFn for MyFunction { /// async fn run_body() -> Result<usize, ServerFnError> { /// Ok(foo.len() + bar) /// } /// /// // etc. /// } /// ``` pub trait ServerFn: Send + Sized { /// A unique path for the server function’s API endpoint, relative to the host, including its prefix. const PATH: &'static str; /// The type of the HTTP client that will send the request from the client side. /// /// For example, this might be `gloo-net` in the browser, or `reqwest` for a desktop app. type Client: Client< Self::Error, Self::InputStreamError, Self::OutputStreamError, >; /// The type of the HTTP server that will send the response from the server side. /// /// For example, this might be `axum` or `actix-web`. type Server: Server< Self::Error, Self::InputStreamError, Self::OutputStreamError, >; /// The protocol the server function uses to communicate with the client. type Protocol: Protocol< Self, Self::Output, Self::Client, Self::Server, Self::Error, Self::InputStreamError, Self::OutputStreamError, >; /// The return type of the server function. /// /// This needs to be converted into `ServerResponse` on the server side, and converted /// *from* `ClientResponse` when received by the client. type Output: Send; /// The type of error in the server function return. /// Typically [`ServerFnError`], but allowed to be any type that implements [`FromServerFnError`]. type Error: FromServerFnError + Send + Sync; /// The type of error in the server function for stream items sent from the client to the server. /// Typically [`ServerFnError`], but allowed to be any type that implements [`FromServerFnError`]. type InputStreamError: FromServerFnError + Send + Sync; /// The type of error in the server function for stream items sent from the server to the client. /// Typically [`ServerFnError`], but allowed to be any type that implements [`FromServerFnError`]. type OutputStreamError: FromServerFnError + Send + Sync; /// Returns [`Self::PATH`]. fn url() -> &'static str { Self::PATH } /// Middleware that should be applied to this server function. fn middlewares() -> Vec< Arc< dyn Layer< ServerFnServerRequest<Self>, ServerFnServerResponse<Self>, >, >, > { Vec::new() } /// The body of the server function. This will only run on the server. fn run_body( self, ) -> impl Future<Output = Result<Self::Output, Self::Error>> + Send; #[doc(hidden)] fn run_on_server( req: ServerFnServerRequest<Self>, ) -> impl Future<Output = ServerFnServerResponse<Self>> + Send { // Server functions can either be called by a real Client, // or directly by an HTML <form>. If they're accessed by a <form>, default to // redirecting back to the Referer. #[cfg(feature = "form-redirects")] let accepts_html = req .accepts() .map(|n| n.contains("text/html")) .unwrap_or(false); #[cfg(feature = "form-redirects")] let mut referer = req.referer().as_deref().map(ToOwned::to_owned); async move { #[allow(unused_variables, unused_mut)] // used in form redirects feature let (mut res, err) = Self::Protocol::run_server(req, Self::run_body) .await .map(|res| (res, None)) .unwrap_or_else(|e| { let mut response = <<Self as ServerFn>::Server as crate::Server< Self::Error, Self::InputStreamError, Self::OutputStreamError, >>::Response::error_response( Self::PATH, e.ser() ); let content_type = <Self::Error as FromServerFnError>::Encoder::CONTENT_TYPE; response.content_type(content_type); (response, Some(e)) }); // if it accepts HTML, we'll redirect to the Referer #[cfg(feature = "form-redirects")] if accepts_html { // if it had an error, encode that error in the URL if let Some(err) = err { if let Ok(url) = ServerFnUrlError::new(Self::PATH, err) .to_url(referer.as_deref().unwrap_or("/")) { referer = Some(url.to_string()); } } // otherwise, strip error info from referer URL, as that means it's from a previous // call else if let Some(referer) = referer.as_mut() { ServerFnUrlError::<Self::Error>::strip_error_info(referer) } // set the status code and Location header res.redirect(referer.as_deref().unwrap_or("/")); } res } } #[doc(hidden)] fn run_on_client( self, ) -> impl Future<Output = Result<Self::Output, Self::Error>> + Send { async move { Self::Protocol::run_client(Self::PATH, self).await } } } /// The protocol that a server function uses to communicate with the client. This trait handles /// the server and client side of running a server function. It is implemented for the [`Http`] and /// [`Websocket`] protocols and can be used to implement custom protocols. pub trait Protocol< Input, Output, Client, Server, Error, InputStreamError = Error, OutputStreamError = Error, > where Server: crate::Server<Error, InputStreamError, OutputStreamError>, Client: crate::Client<Error, InputStreamError, OutputStreamError>, { /// The HTTP method used for requests. const METHOD: Method; /// Run the server function on the server. The implementation should handle deserializing the /// input, running the server function, and serializing the output. fn run_server<F, Fut>( request: Server::Request, server_fn: F, ) -> impl Future<Output = Result<Server::Response, Error>> + Send where F: Fn(Input) -> Fut + Send, Fut: Future<Output = Result<Output, Error>> + Send; /// Run the server function on the client. The implementation should handle serializing the /// input, sending the request, and deserializing the output. fn run_client( path: &str, input: Input, ) -> impl Future<Output = Result<Output, Error>> + Send; } /// The http protocol with specific input and output encodings for the request and response. This is /// the default protocol server functions use if no override is set in the server function macro /// /// The http protocol accepts two generic argument that define how the input and output for a server /// function are turned into HTTP requests and responses. For example, [`Http<GetUrl, Json>`] will /// accept a Url encoded Get request and return a JSON post response. /// /// # Example /// /// ```rust, no_run /// # use server_fn_macro_default::server; /// use serde::{Serialize, Deserialize}; /// use server_fn::{Http, ServerFnError, codec::{Json, GetUrl}}; /// /// #[derive(Debug, Clone, Serialize, Deserialize)] /// pub struct Message { /// user: String, /// message: String, /// } /// /// // The http protocol can be used on any server function that accepts and returns arguments that implement /// // the [`IntoReq`] and [`FromRes`] traits. /// // /// // In this case, the input and output encodings are [`GetUrl`] and [`Json`], respectively which requires /// // the items to implement [`IntoReq<GetUrl, ...>`] and [`FromRes<Json, ...>`]. Both of those implementations /// // require the items to implement [`Serialize`] and [`Deserialize`]. /// # #[cfg(feature = "browser")] { /// #[server(protocol = Http<GetUrl, Json>)] /// async fn echo_http( /// input: Message, /// ) -> Result<Message, ServerFnError> { /// Ok(input) /// } /// # } /// ``` pub struct Http<InputProtocol, OutputProtocol>( PhantomData<(InputProtocol, OutputProtocol)>, ); impl<InputProtocol, OutputProtocol, Input, Output, Client, Server, E> Protocol<Input, Output, Client, Server, E> for Http<InputProtocol, OutputProtocol> where Input: IntoReq<InputProtocol, Client::Request, E> + FromReq<InputProtocol, Server::Request, E> + Send, Output: IntoRes<OutputProtocol, Server::Response, E> + FromRes<OutputProtocol, Client::Response, E> + Send, E: FromServerFnError, InputProtocol: Encoding, OutputProtocol: Encoding, Client: crate::Client<E>, Server: crate::Server<E>, { const METHOD: Method = InputProtocol::METHOD; async fn run_server<F, Fut>( request: Server::Request, server_fn: F, ) -> Result<Server::Response, E> where F: Fn(Input) -> Fut + Send, Fut: Future<Output = Result<Output, E>> + Send, { let input = Input::from_req(request).await?; let output = server_fn(input).await?; let response = Output::into_res(output).await?; Ok(response) } async fn run_client(path: &str, input: Input) -> Result<Output, E> where Client: crate::Client<E>, { // create and send request on client let req = input.into_req(path, OutputProtocol::CONTENT_TYPE)?; let res = Client::send(req).await?; let status = res.status(); let location = res.location(); let has_redirect_header = res.has_redirect(); // if it returns an error status, deserialize the error using the error's decoder. let res = if (400..=599).contains(&status) { Err(E::de(res.try_into_bytes().await?)) } else { // otherwise, deserialize the body as is let output = Output::from_res(res).await?; Ok(output) }?; // if redirected, call the redirect hook (if that's been set) if (300..=399).contains(&status) || has_redirect_header { call_redirect_hook(&location); } Ok(res) } } /// The websocket protocol that encodes the input and output streams using a websocket connection. /// /// The websocket protocol accepts two generic argument that define the input and output serialization /// formats. For example, [`Websocket<CborEncoding, JsonEncoding>`] would accept a stream of Cbor-encoded messages /// and return a stream of JSON-encoded messages. /// /// # Example /// /// ```rust, no_run /// # use server_fn_macro_default::server; /// # #[cfg(feature = "browser")] { /// use server_fn::{ServerFnError, BoxedStream, Websocket, codec::JsonEncoding}; /// use serde::{Serialize, Deserialize}; /// /// #[derive(Clone, Serialize, Deserialize)] /// pub struct Message { /// user: String, /// message: String, /// } /// // The websocket protocol can be used on any server function that accepts and returns a [`BoxedStream`] /// // with items that can be encoded by the input and output encoding generics. /// // /// // In this case, the input and output encodings are [`Json`] and [`Json`], respectively which requires /// // the items to implement [`Serialize`] and [`Deserialize`]. /// #[server(protocol = Websocket<JsonEncoding, JsonEncoding>)] /// async fn echo_websocket( /// input: BoxedStream<Message, ServerFnError>, /// ) -> Result<BoxedStream<Message, ServerFnError>, ServerFnError> { /// Ok(input.into()) /// } /// # } /// ``` pub struct Websocket<InputEncoding, OutputEncoding>( PhantomData<(InputEncoding, OutputEncoding)>, ); /// A boxed stream type that can be used with the websocket protocol. /// /// You can easily convert any static type that implement [`futures::Stream`] into a [`BoxedStream`] /// with the [`From`] trait. /// /// # Example /// /// ```rust, no_run /// use futures::StreamExt; /// use server_fn::{BoxedStream, ServerFnError}; /// /// let stream: BoxedStream<_, ServerFnError> = /// futures::stream::iter(0..10).map(Result::Ok).into(); /// ``` pub struct BoxedStream<T, E> { stream: Pin<Box<dyn Stream<Item = Result<T, E>> + Send>>, } impl<T, E> From<BoxedStream<T, E>> for Pin<Box<dyn Stream<Item = Result<T, E>> + Send>> { fn from(val: BoxedStream<T, E>) -> Self { val.stream } } impl<T, E> Deref for BoxedStream<T, E> { type Target = Pin<Box<dyn Stream<Item = Result<T, E>> + Send>>; fn deref(&self) -> &Self::Target { &self.stream } } impl<T, E> DerefMut for BoxedStream<T, E> { fn deref_mut(&mut self) -> &mut Self::Target { &mut self.stream } } impl<T, E> Debug for BoxedStream<T, E> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("BoxedStream").finish() } } impl<T, E, S> From<S> for BoxedStream<T, E> where S: Stream<Item = Result<T, E>> + Send + 'static, { fn from(stream: S) -> Self { BoxedStream { stream: Box::pin(stream), } } } impl< Input, InputItem, OutputItem, InputEncoding, OutputEncoding, Client, Server, Error, InputStreamError, OutputStreamError, > Protocol< Input, BoxedStream<OutputItem, OutputStreamError>, Client, Server, Error, InputStreamError, OutputStreamError, > for Websocket<InputEncoding, OutputEncoding> where Input: Deref<Target = BoxedStream<InputItem, InputStreamError>> + Into<BoxedStream<InputItem, InputStreamError>> + From<BoxedStream<InputItem, InputStreamError>>, InputEncoding: Encodes<InputItem> + Decodes<InputItem>, OutputEncoding: Encodes<OutputItem> + Decodes<OutputItem>, InputStreamError: FromServerFnError + Send, OutputStreamError: FromServerFnError + Send, Error: FromServerFnError + Send, Server: crate::Server<Error, InputStreamError, OutputStreamError>, Client: crate::Client<Error, InputStreamError, OutputStreamError>, OutputItem: Send + 'static, InputItem: Send + 'static, { const METHOD: Method = Method::GET; async fn run_server<F, Fut>( request: Server::Request, server_fn: F, ) -> Result<Server::Response, Error> where F: Fn(Input) -> Fut + Send, Fut: Future< Output = Result< BoxedStream<OutputItem, OutputStreamError>, Error, >, > + Send, { let (request_bytes, response_stream, response) = request.try_into_websocket().await?; let input = request_bytes.map(|request_bytes| { let request_bytes = request_bytes .map(|bytes| deserialize_result::<InputStreamError>(bytes)) .unwrap_or_else(Err); match request_bytes { Ok(request_bytes) => InputEncoding::decode(request_bytes) .map_err(|e| { InputStreamError::from_server_fn_error( ServerFnErrorErr::Deserialization(e.to_string()), ) }), Err(err) => Err(InputStreamError::de(err)), } }); let boxed = Box::pin(input) as Pin< Box< dyn Stream<Item = Result<InputItem, InputStreamError>> + Send, >, >; let input = BoxedStream { stream: boxed }; let output = server_fn(input.into()).await?; let output = output.stream.map(|output| { let result = match output { Ok(output) => OutputEncoding::encode(&output).map_err(|e| { OutputStreamError::from_server_fn_error( ServerFnErrorErr::Serialization(e.to_string()), ) .ser() }), Err(err) => Err(err.ser()), }; serialize_result(result) }); Server::spawn(async move { pin_mut!(response_stream); pin_mut!(output); while let Some(output) = output.next().await { if response_stream.send(output).await.is_err() { break; } } })?; Ok(response) } fn run_client( path: &str, input: Input, ) -> impl Future< Output = Result<BoxedStream<OutputItem, OutputStreamError>, Error>, > + Send { let input = input.into(); async move { let (stream, sink) = Client::open_websocket(path).await?; // Forward the input stream to the websocket Client::spawn(async move { pin_mut!(input); pin_mut!(sink); while let Some(input) = input.stream.next().await { let result = match input { Ok(input) => { InputEncoding::encode(&input).map_err(|e| { InputStreamError::from_server_fn_error( ServerFnErrorErr::Serialization( e.to_string(), ), ) .ser() }) } Err(err) => Err(err.ser()), }; let result = serialize_result(result); if sink.send(result).await.is_err() { break; } } }); // Return the output stream let stream = stream.map(|request_bytes| { let request_bytes = request_bytes .map(|bytes| deserialize_result::<OutputStreamError>(bytes)) .unwrap_or_else(Err); match request_bytes { Ok(request_bytes) => OutputEncoding::decode(request_bytes) .map_err(|e| { OutputStreamError::from_server_fn_error( ServerFnErrorErr::Deserialization( e.to_string(), ), ) }), Err(err) => Err(OutputStreamError::de(err)), } }); let boxed = Box::pin(stream) as Pin< Box< dyn Stream<Item = Result<OutputItem, OutputStreamError>> + Send, >, >; let output = BoxedStream { stream: boxed }; Ok(output) } } } // Serializes a Result<Bytes, Bytes> into a single Bytes instance. // Format: [tag: u8][content: Bytes] // - Tag 0: Ok variant // - Tag 1: Err variant fn serialize_result(result: Result<Bytes, Bytes>) -> Bytes { match result { Ok(bytes) => { let mut buf = BytesMut::with_capacity(1 + bytes.len()); buf.put_u8(0); // Tag for Ok variant buf.extend_from_slice(&bytes); buf.freeze() } Err(bytes) => { let mut buf = BytesMut::with_capacity(1 + bytes.len()); buf.put_u8(1); // Tag for Err variant buf.extend_from_slice(&bytes); buf.freeze() } } } // Deserializes a Bytes instance back into a Result<Bytes, Bytes>. fn deserialize_result<E: FromServerFnError>( bytes: Bytes, ) -> Result<Bytes, Bytes> { if bytes.is_empty() { return Err(E::from_server_fn_error( ServerFnErrorErr::Deserialization("Data is empty".into()), ) .ser()); } let tag = bytes[0]; let content = bytes.slice(1..); match tag { 0 => Ok(content), 1 => Err(content), _ => Err(E::from_server_fn_error(ServerFnErrorErr::Deserialization( "Invalid data tag".into(), )) .ser()), // Invalid tag } } /// Encode format type pub enum Format { /// Binary representation Binary, /// utf-8 compatible text representation Text, } /// A trait for types with an associated content type. pub trait ContentType { /// The MIME type of the data. const CONTENT_TYPE: &'static str; } /// Data format representation pub trait FormatType { /// The representation type const FORMAT_TYPE: Format; /// Encodes data into a string. fn into_encoded_string(bytes: Bytes) -> String { match Self::FORMAT_TYPE { Format::Binary => STANDARD_NO_PAD.encode(bytes), Format::Text => String::from_utf8(bytes.into()) .expect("Valid text format type with utf-8 comptabile string"), } } /// Decodes string to bytes fn from_encoded_string(data: &str) -> Result<Bytes, DecodeError> { match Self::FORMAT_TYPE { Format::Binary => { STANDARD_NO_PAD.decode(data).map(|data| data.into()) } Format::Text => Ok(Bytes::copy_from_slice(data.as_bytes())), } } } /// A trait for types that can be encoded into a bytes for a request body. pub trait Encodes<T>: ContentType + FormatType { /// The error type that can be returned if the encoding fails. type Error: Display + Debug; /// Encodes the given value into a bytes. fn encode(output: &T) -> Result<Bytes, Self::Error>; } /// A trait for types that can be decoded from a bytes for a response body. pub trait Decodes<T> { /// The error type that can be returned if the decoding fails. type Error: Display; /// Decodes the given bytes into a value. fn decode(bytes: Bytes) -> Result<T, Self::Error>; } #[cfg(feature = "ssr")] #[doc(hidden)] pub use inventory; /// Uses the `inventory` crate to initialize a map between paths and server functions. #[macro_export] macro_rules! initialize_server_fn_map { ($req:ty, $res:ty) => { std::sync::LazyLock::new(|| { $crate::inventory::iter::<ServerFnTraitObj<$req, $res>> .into_iter() .map(|obj| { ((obj.path().to_string(), obj.method()), obj.clone()) }) .collect() }) }; } /// A list of middlewares that can be applied to a server function. pub type MiddlewareSet<Req, Res> = Vec<Arc<dyn Layer<Req, Res>>>; /// A trait object that allows multiple server functions that take the same /// request type and return the same response type to be gathered into a single /// collection. pub struct ServerFnTraitObj<Req, Res> { path: &'static str, method: Method, handler: fn(Req) -> Pin<Box<dyn Future<Output = Res> + Send>>, middleware: fn() -> MiddlewareSet<Req, Res>, ser: fn(ServerFnErrorErr) -> Bytes, } impl<Req, Res> ServerFnTraitObj<Req, Res> { /// Converts the relevant parts of a server function into a trait object. pub const fn new< S: ServerFn< Server: crate::Server< S::Error, S::InputStreamError, S::OutputStreamError,
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
true
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/redirect.rs
server_fn/src/redirect.rs
use std::sync::OnceLock; /// A custom header that can be set with any value to indicate /// that the server function client should redirect to a new route. /// /// This is useful because it allows returning a value from the request, /// while also indicating that a redirect should follow. This cannot be /// done with an HTTP `3xx` status code, because the browser will follow /// that redirect rather than returning the desired data. pub const REDIRECT_HEADER: &str = "serverfnredirect"; /// A function that will be called if a server function returns a `3xx` status /// or the [`REDIRECT_HEADER`]. pub type RedirectHook = Box<dyn Fn(&str) + Send + Sync>; // allowed: not in a public API, and pretty straightforward #[allow(clippy::type_complexity)] pub(crate) static REDIRECT_HOOK: OnceLock<RedirectHook> = OnceLock::new(); /// Sets a function that will be called if a server function returns a `3xx` status /// or the [`REDIRECT_HEADER`]. Returns `Err(_)` if the hook has already been set. pub fn set_redirect_hook( hook: impl Fn(&str) + Send + Sync + 'static, ) -> Result<(), RedirectHook> { REDIRECT_HOOK.set(Box::new(hook)) } /// Calls the hook that has been set by [`set_redirect_hook`] to redirect to `loc`. pub fn call_redirect_hook(loc: &str) { if let Some(hook) = REDIRECT_HOOK.get() { hook(loc) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/client.rs
server_fn/src/client.rs
use crate::{request::ClientReq, response::ClientRes}; use bytes::Bytes; use futures::{Sink, Stream}; use std::{future::Future, sync::OnceLock}; static ROOT_URL: OnceLock<&'static str> = OnceLock::new(); /// Set the root server URL that all server function paths are relative to for the client. /// /// If this is not set, it defaults to the origin. pub fn set_server_url(url: &'static str) { ROOT_URL.set(url).unwrap(); } /// Returns the root server URL for all server functions. pub fn get_server_url() -> &'static str { ROOT_URL.get().copied().unwrap_or("") } /// A client defines a pair of request/response types and the logic to send /// and receive them. /// /// This trait is implemented for things like a browser `fetch` request or for /// the `reqwest` trait. It should almost never be necessary to implement it /// yourself, unless you’re trying to use an alternative HTTP crate on the client side. pub trait Client<Error, InputStreamError = Error, OutputStreamError = Error> { /// The type of a request sent by this client. type Request: ClientReq<Error> + Send + 'static; /// The type of a response received by this client. type Response: ClientRes<Error> + Send + 'static; /// Sends the request and receives a response. fn send( req: Self::Request, ) -> impl Future<Output = Result<Self::Response, Error>> + Send; /// Opens a websocket connection to the server. #[allow(clippy::type_complexity)] fn open_websocket( path: &str, ) -> impl Future< Output = Result< ( impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, impl Sink<Bytes> + Send + 'static, ), Error, >, > + Send; /// Spawn a future that runs in the background. fn spawn(future: impl Future<Output = ()> + Send + 'static); } #[cfg(feature = "browser")] /// Implements [`Client`] for a `fetch` request in the browser. pub mod browser { use super::Client; use crate::{ error::{FromServerFnError, IntoAppError, ServerFnErrorErr}, request::browser::{BrowserRequest, RequestInner}, response::browser::BrowserResponse, }; use bytes::Bytes; use futures::{Sink, SinkExt, StreamExt}; use gloo_net::websocket::{Message, WebSocketError}; use send_wrapper::SendWrapper; use std::future::Future; /// Implements [`Client`] for a `fetch` request in the browser. pub struct BrowserClient; impl< Error: FromServerFnError, InputStreamError: FromServerFnError, OutputStreamError: FromServerFnError, > Client<Error, InputStreamError, OutputStreamError> for BrowserClient { type Request = BrowserRequest; type Response = BrowserResponse; fn send( req: Self::Request, ) -> impl Future<Output = Result<Self::Response, Error>> + Send { SendWrapper::new(async move { let req = req.0.take(); let RequestInner { request, mut abort_ctrl, } = req; let res = request .send() .await .map(|res| BrowserResponse(SendWrapper::new(res))) .map_err(|e| { ServerFnErrorErr::Request(e.to_string()) .into_app_error() }); // at this point, the future has successfully resolved without being dropped, so we // can prevent the `AbortController` from firing if let Some(ctrl) = abort_ctrl.as_mut() { ctrl.prevent_cancellation(); } res }) } fn open_websocket( url: &str, ) -> impl Future< Output = Result< ( impl futures::Stream<Item = Result<Bytes, Bytes>> + Send + 'static, impl futures::Sink<Bytes> + Send + 'static, ), Error, >, > + Send { SendWrapper::new(async move { let websocket = gloo_net::websocket::futures::WebSocket::open(url) .map_err(|err| { web_sys::console::error_1(&err.to_string().into()); Error::from_server_fn_error( ServerFnErrorErr::Request(err.to_string()), ) })?; let (sink, stream) = websocket.split(); let stream = stream.map(|message| match message { Ok(message) => Ok(match message { Message::Text(text) => Bytes::from(text), Message::Bytes(bytes) => Bytes::from(bytes), }), Err(err) => { web_sys::console::error_1(&err.to_string().into()); Err(OutputStreamError::from_server_fn_error( ServerFnErrorErr::Request(err.to_string()), ) .ser()) } }); let stream = SendWrapper::new(stream); struct SendWrapperSink<S> { sink: SendWrapper<S>, } impl<S> SendWrapperSink<S> { fn new(sink: S) -> Self { Self { sink: SendWrapper::new(sink), } } } impl<S, Item> Sink<Item> for SendWrapperSink<S> where S: Sink<Item> + Unpin, { type Error = S::Error; fn poll_ready( self: std::pin::Pin<&mut Self>, cx: &mut std::task::Context<'_>, ) -> std::task::Poll<Result<(), Self::Error>> { self.get_mut().sink.poll_ready_unpin(cx) } fn start_send( self: std::pin::Pin<&mut Self>, item: Item, ) -> Result<(), Self::Error> { self.get_mut().sink.start_send_unpin(item) } fn poll_flush( self: std::pin::Pin<&mut Self>, cx: &mut std::task::Context<'_>, ) -> std::task::Poll<Result<(), Self::Error>> { self.get_mut().sink.poll_flush_unpin(cx) } fn poll_close( self: std::pin::Pin<&mut Self>, cx: &mut std::task::Context<'_>, ) -> std::task::Poll<Result<(), Self::Error>> { self.get_mut().sink.poll_close_unpin(cx) } } let sink = sink.with(|message: Bytes| async move { Ok::<Message, WebSocketError>(Message::Bytes( message.into(), )) }); let sink = SendWrapperSink::new(Box::pin(sink)); Ok((stream, sink)) }) } fn spawn(future: impl Future<Output = ()> + Send + 'static) { wasm_bindgen_futures::spawn_local(future); } } } #[cfg(feature = "reqwest")] /// Implements [`Client`] for a request made by [`reqwest`]. pub mod reqwest { use super::{get_server_url, Client}; use crate::{ error::{FromServerFnError, IntoAppError, ServerFnErrorErr}, request::reqwest::CLIENT, }; use bytes::Bytes; use futures::{SinkExt, StreamExt, TryFutureExt}; use reqwest::{Request, Response}; use std::future::Future; /// Implements [`Client`] for a request made by [`reqwest`]. pub struct ReqwestClient; impl< Error: FromServerFnError, InputStreamError: FromServerFnError, OutputStreamError: FromServerFnError, > Client<Error, InputStreamError, OutputStreamError> for ReqwestClient { type Request = Request; type Response = Response; fn send( req: Self::Request, ) -> impl Future<Output = Result<Self::Response, Error>> + Send { CLIENT.execute(req).map_err(|e| { ServerFnErrorErr::Request(e.to_string()).into_app_error() }) } async fn open_websocket( path: &str, ) -> Result< ( impl futures::Stream<Item = Result<Bytes, Bytes>> + Send + 'static, impl futures::Sink<Bytes> + Send + 'static, ), Error, > { let mut websocket_server_url = get_server_url().to_string(); if let Some(postfix) = websocket_server_url.strip_prefix("http://") { websocket_server_url = format!("ws://{postfix}"); } else if let Some(postfix) = websocket_server_url.strip_prefix("https://") { websocket_server_url = format!("wss://{postfix}"); } let url = format!("{websocket_server_url}{path}"); let (ws_stream, _) = tokio_tungstenite::connect_async(url).await.map_err(|e| { Error::from_server_fn_error(ServerFnErrorErr::Request( e.to_string(), )) })?; let (write, read) = ws_stream.split(); Ok(( read.map(|msg| match msg { Ok(msg) => Ok(msg.into_data()), Err(e) => Err(OutputStreamError::from_server_fn_error( ServerFnErrorErr::Request(e.to_string()), ) .ser()), }), write.with(|msg: Bytes| async move { Ok::< tokio_tungstenite::tungstenite::Message, tokio_tungstenite::tungstenite::Error, >( tokio_tungstenite::tungstenite::Message::Binary(msg) ) }), )) } fn spawn(future: impl Future<Output = ()> + Send + 'static) { tokio::spawn(future); } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/error.rs
server_fn/src/error.rs
#![allow(deprecated)] use crate::{ContentType, Decodes, Encodes, Format, FormatType}; use base64::{engine::general_purpose::URL_SAFE, Engine as _}; use bytes::Bytes; use serde::{Deserialize, Serialize}; use std::{ fmt::{self, Display, Write}, str::FromStr, }; use throw_error::Error; use url::Url; /// A custom header that can be used to indicate a server function returned an error. pub const SERVER_FN_ERROR_HEADER: &str = "serverfnerror"; impl From<ServerFnError> for Error { fn from(e: ServerFnError) -> Self { Error::from(ServerFnErrorWrapper(e)) } } /// An empty value indicating that there is no custom error type associated /// with this server function. #[derive( Debug, Deserialize, Serialize, PartialEq, Eq, Hash, PartialOrd, Ord, Clone, Copy, )] #[cfg_attr( feature = "rkyv", derive(rkyv::Archive, rkyv::Serialize, rkyv::Deserialize) )] #[deprecated( since = "0.8.0", note = "Now server_fn can return any error type other than ServerFnError, \ so the WrappedServerError variant will be removed in 0.9.0" )] pub struct NoCustomError; // Implement `Display` for `NoCustomError` impl fmt::Display for NoCustomError { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { write!(f, "Unit Type Displayed") } } impl FromStr for NoCustomError { type Err = (); fn from_str(_s: &str) -> Result<Self, Self::Err> { Ok(NoCustomError) } } /// Wraps some error type, which may implement any of [`Error`](trait@std::error::Error), [`Clone`], or /// [`Display`]. #[derive(Debug)] #[deprecated( since = "0.8.0", note = "Now server_fn can return any error type other than ServerFnError, \ so the WrappedServerError variant will be removed in 0.9.0" )] pub struct WrapError<T>(pub T); /// A helper macro to convert a variety of different types into `ServerFnError`. /// This should mostly be used if you are implementing `From<ServerFnError>` for `YourError`. #[macro_export] #[deprecated( since = "0.8.0", note = "Now server_fn can return any error type other than ServerFnError, \ so the WrappedServerError variant will be removed in 0.9.0" )] macro_rules! server_fn_error { () => {{ use $crate::{ViaError, WrapError}; (&&&&&WrapError(())).to_server_error() }}; ($err:expr) => {{ use $crate::error::{ViaError, WrapError}; match $err { error => (&&&&&WrapError(error)).to_server_error(), } }}; } /// This trait serves as the conversion method between a variety of types /// and [`ServerFnError`]. #[deprecated( since = "0.8.0", note = "Now server_fn can return any error type other than ServerFnError, \ so users should place their custom error type instead of \ ServerFnError" )] pub trait ViaError<E> { /// Converts something into an error. fn to_server_error(&self) -> ServerFnError<E>; } // This impl should catch if you fed it a [`ServerFnError`] already. impl<E: ServerFnErrorKind + std::error::Error + Clone> ViaError<E> for &&&&WrapError<ServerFnError<E>> { fn to_server_error(&self) -> ServerFnError<E> { self.0.clone() } } // A type tag for ServerFnError so we can special case it #[deprecated] pub(crate) trait ServerFnErrorKind {} impl ServerFnErrorKind for ServerFnError {} // This impl should catch passing () or nothing to server_fn_error impl ViaError<NoCustomError> for &&&WrapError<()> { fn to_server_error(&self) -> ServerFnError { ServerFnError::WrappedServerError(NoCustomError) } } // This impl will catch any type that implements any type that impls // Error and Clone, so that it can be wrapped into ServerFnError impl<E: std::error::Error + Clone> ViaError<E> for &&WrapError<E> { fn to_server_error(&self) -> ServerFnError<E> { ServerFnError::WrappedServerError(self.0.clone()) } } // If it doesn't impl Error, but does impl Display and Clone, // we can still wrap it in String form impl<E: Display + Clone> ViaError<E> for &WrapError<E> { fn to_server_error(&self) -> ServerFnError<E> { ServerFnError::ServerError(self.0.to_string()) } } // This is what happens if someone tries to pass in something that does // not meet the above criteria impl<E> ViaError<E> for WrapError<E> { #[track_caller] fn to_server_error(&self) -> ServerFnError<E> { panic!( "At {}, you call `to_server_error()` or use `server_fn_error!` \ with a value that does not implement `Clone` and either `Error` \ or `Display`.", std::panic::Location::caller() ); } } /// A type that can be used as the return type of the server function for easy error conversion with `?` operator. /// This type can be replaced with any other error type that implements `FromServerFnError`. /// /// Unlike [`ServerFnErrorErr`], this does not implement [`Error`](trait@std::error::Error). /// This means that other error types can easily be converted into it using the /// `?` operator. #[derive(Debug, Clone, PartialEq, Eq, Serialize, Deserialize)] #[cfg_attr( feature = "rkyv", derive(rkyv::Archive, rkyv::Serialize, rkyv::Deserialize) )] pub enum ServerFnError<E = NoCustomError> { #[deprecated( since = "0.8.0", note = "Now server_fn can return any error type other than \ ServerFnError, so users should place their custom error type \ instead of ServerFnError" )] /// A user-defined custom error type, which defaults to [`NoCustomError`]. WrappedServerError(E), /// Error while trying to register the server function (only occurs in case of poisoned RwLock). Registration(String), /// Occurs on the client if there is a network error while trying to run function on server. Request(String), /// Occurs on the server if there is an error creating an HTTP response. Response(String), /// Occurs when there is an error while actually running the function on the server. ServerError(String), /// Occurs when there is an error while actually running the middleware on the server. MiddlewareError(String), /// Occurs on the client if there is an error deserializing the server's response. Deserialization(String), /// Occurs on the client if there is an error serializing the server function arguments. Serialization(String), /// Occurs on the server if there is an error deserializing one of the arguments that's been sent. Args(String), /// Occurs on the server if there's a missing argument. MissingArg(String), } impl ServerFnError<NoCustomError> { /// Constructs a new [`ServerFnError::ServerError`] from some other type. pub fn new(msg: impl ToString) -> Self { Self::ServerError(msg.to_string()) } } impl<CustErr> From<CustErr> for ServerFnError<CustErr> { fn from(value: CustErr) -> Self { ServerFnError::WrappedServerError(value) } } impl<E: std::error::Error> From<E> for ServerFnError { fn from(value: E) -> Self { ServerFnError::ServerError(value.to_string()) } } impl<CustErr> Display for ServerFnError<CustErr> where CustErr: Display, { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { write!( f, "{}", match self { ServerFnError::Registration(s) => format!( "error while trying to register the server function: {s}" ), ServerFnError::Request(s) => format!( "error reaching server to call server function: {s}" ), ServerFnError::ServerError(s) => format!("error running server function: {s}"), ServerFnError::MiddlewareError(s) => format!("error running middleware: {s}"), ServerFnError::Deserialization(s) => format!("error deserializing server function results: {s}"), ServerFnError::Serialization(s) => format!("error serializing server function arguments: {s}"), ServerFnError::Args(s) => format!( "error deserializing server function arguments: {s}" ), ServerFnError::MissingArg(s) => format!("missing argument {s}"), ServerFnError::Response(s) => format!("error generating HTTP response: {s}"), ServerFnError::WrappedServerError(e) => format!("{e}"), } ) } } /// Serializes and deserializes JSON with [`serde_json`]. pub struct ServerFnErrorEncoding; impl ContentType for ServerFnErrorEncoding { const CONTENT_TYPE: &'static str = "text/plain"; } impl FormatType for ServerFnErrorEncoding { const FORMAT_TYPE: Format = Format::Text; } impl<CustErr> Encodes<ServerFnError<CustErr>> for ServerFnErrorEncoding where CustErr: Display, { type Error = std::fmt::Error; fn encode(output: &ServerFnError<CustErr>) -> Result<Bytes, Self::Error> { let mut buf = String::new(); let result = match output { ServerFnError::WrappedServerError(e) => { write!(&mut buf, "WrappedServerFn|{e}") } ServerFnError::Registration(e) => { write!(&mut buf, "Registration|{e}") } ServerFnError::Request(e) => write!(&mut buf, "Request|{e}"), ServerFnError::Response(e) => write!(&mut buf, "Response|{e}"), ServerFnError::ServerError(e) => { write!(&mut buf, "ServerError|{e}") } ServerFnError::MiddlewareError(e) => { write!(&mut buf, "MiddlewareError|{e}") } ServerFnError::Deserialization(e) => { write!(&mut buf, "Deserialization|{e}") } ServerFnError::Serialization(e) => { write!(&mut buf, "Serialization|{e}") } ServerFnError::Args(e) => write!(&mut buf, "Args|{e}"), ServerFnError::MissingArg(e) => { write!(&mut buf, "MissingArg|{e}") } }; match result { Ok(()) => Ok(Bytes::from(buf)), Err(e) => Err(e), } } } impl<CustErr> Decodes<ServerFnError<CustErr>> for ServerFnErrorEncoding where CustErr: FromStr, { type Error = String; fn decode(bytes: Bytes) -> Result<ServerFnError<CustErr>, Self::Error> { let data = String::from_utf8(bytes.to_vec()) .map_err(|err| format!("UTF-8 conversion error: {err}"))?; data.split_once('|') .ok_or_else(|| { format!("Invalid format: missing delimiter in {data:?}") }) .and_then(|(ty, data)| match ty { "WrappedServerFn" => CustErr::from_str(data) .map(ServerFnError::WrappedServerError) .map_err(|_| { format!("Failed to parse CustErr from {data:?}") }), "Registration" => { Ok(ServerFnError::Registration(data.to_string())) } "Request" => Ok(ServerFnError::Request(data.to_string())), "Response" => Ok(ServerFnError::Response(data.to_string())), "ServerError" => { Ok(ServerFnError::ServerError(data.to_string())) } "MiddlewareError" => { Ok(ServerFnError::MiddlewareError(data.to_string())) } "Deserialization" => { Ok(ServerFnError::Deserialization(data.to_string())) } "Serialization" => { Ok(ServerFnError::Serialization(data.to_string())) } "Args" => Ok(ServerFnError::Args(data.to_string())), "MissingArg" => Ok(ServerFnError::MissingArg(data.to_string())), _ => Err(format!("Unknown error type: {ty}")), }) } } impl<CustErr> FromServerFnError for ServerFnError<CustErr> where CustErr: std::fmt::Debug + Display + FromStr + 'static, { type Encoder = ServerFnErrorEncoding; fn from_server_fn_error(value: ServerFnErrorErr) -> Self { match value { ServerFnErrorErr::Registration(value) => { ServerFnError::Registration(value) } ServerFnErrorErr::Request(value) => ServerFnError::Request(value), ServerFnErrorErr::ServerError(value) => { ServerFnError::ServerError(value) } ServerFnErrorErr::MiddlewareError(value) => { ServerFnError::MiddlewareError(value) } ServerFnErrorErr::Deserialization(value) => { ServerFnError::Deserialization(value) } ServerFnErrorErr::Serialization(value) => { ServerFnError::Serialization(value) } ServerFnErrorErr::Args(value) => ServerFnError::Args(value), ServerFnErrorErr::MissingArg(value) => { ServerFnError::MissingArg(value) } ServerFnErrorErr::Response(value) => ServerFnError::Response(value), ServerFnErrorErr::UnsupportedRequestMethod(value) => { ServerFnError::Request(value) } } } } impl<E> std::error::Error for ServerFnError<E> where E: std::error::Error + 'static, ServerFnError<E>: std::fmt::Display, { fn source(&self) -> Option<&(dyn std::error::Error + 'static)> { match self { ServerFnError::WrappedServerError(e) => Some(e), _ => None, } } } /// Type for errors that can occur when using server functions. If you need to return a custom error type from a server function, implement `FromServerFnError` for your custom error type. #[derive( thiserror::Error, Debug, Clone, PartialEq, Eq, Serialize, Deserialize, )] #[cfg_attr( feature = "rkyv", derive(rkyv::Archive, rkyv::Serialize, rkyv::Deserialize) )] pub enum ServerFnErrorErr { /// Error while trying to register the server function (only occurs in case of poisoned RwLock). #[error("error while trying to register the server function: {0}")] Registration(String), /// Occurs on the client if trying to use an unsupported `HTTP` method when building a request. #[error("error trying to build `HTTP` method request: {0}")] UnsupportedRequestMethod(String), /// Occurs on the client if there is a network error while trying to run function on server. #[error("error reaching server to call server function: {0}")] Request(String), /// Occurs when there is an error while actually running the function on the server. #[error("error running server function: {0}")] ServerError(String), /// Occurs when there is an error while actually running the middleware on the server. #[error("error running middleware: {0}")] MiddlewareError(String), /// Occurs on the client if there is an error deserializing the server's response. #[error("error deserializing server function results: {0}")] Deserialization(String), /// Occurs on the client if there is an error serializing the server function arguments. #[error("error serializing server function arguments: {0}")] Serialization(String), /// Occurs on the server if there is an error deserializing one of the arguments that's been sent. #[error("error deserializing server function arguments: {0}")] Args(String), /// Occurs on the server if there's a missing argument. #[error("missing argument {0}")] MissingArg(String), /// Occurs on the server if there is an error creating an HTTP response. #[error("error creating response {0}")] Response(String), } /// Associates a particular server function error with the server function /// found at a particular path. /// /// This can be used to pass an error from the server back to the client /// without JavaScript/WASM supported, by encoding it in the URL as a query string. /// This is useful for progressive enhancement. #[derive(Debug)] pub struct ServerFnUrlError<E> { path: String, error: E, } impl<E: FromServerFnError> ServerFnUrlError<E> { /// Creates a new structure associating the server function at some path /// with a particular error. pub fn new(path: impl Display, error: E) -> Self { Self { path: path.to_string(), error, } } /// The error itself. pub fn error(&self) -> &E { &self.error } /// The path of the server function that generated this error. pub fn path(&self) -> &str { &self.path } /// Adds an encoded form of this server function error to the given base URL. pub fn to_url(&self, base: &str) -> Result<Url, url::ParseError> { let mut url = Url::parse(base)?; url.query_pairs_mut() .append_pair("__path", &self.path) .append_pair("__err", &URL_SAFE.encode(self.error.ser())); Ok(url) } /// Replaces any ServerFnUrlError info from the URL in the given string /// with the serialized success value given. pub fn strip_error_info(path: &mut String) { if let Ok(mut url) = Url::parse(&*path) { // NOTE: This is gross, but the Serializer you get from // .query_pairs_mut() isn't an Iterator so you can't just .retain(). let pairs_previously = url .query_pairs() .map(|(k, v)| (k.to_string(), v.to_string())) .collect::<Vec<_>>(); let mut pairs = url.query_pairs_mut(); pairs.clear(); for (key, value) in pairs_previously .into_iter() .filter(|(key, _)| key != "__path" && key != "__err") { pairs.append_pair(&key, &value); } drop(pairs); *path = url.to_string(); } } /// Decodes an error from a URL. pub fn decode_err(err: &str) -> E { let decoded = match URL_SAFE.decode(err) { Ok(decoded) => decoded, Err(err) => { return ServerFnErrorErr::Deserialization(err.to_string()) .into_app_error(); } }; E::de(decoded.into()) } } impl<E> From<ServerFnUrlError<E>> for ServerFnError<E> { fn from(error: ServerFnUrlError<E>) -> Self { error.error.into() } } impl<E> From<ServerFnUrlError<ServerFnError<E>>> for ServerFnError<E> { fn from(error: ServerFnUrlError<ServerFnError<E>>) -> Self { error.error } } #[derive(Debug, thiserror::Error)] #[doc(hidden)] /// Only used instantly only when a framework needs E: Error. pub struct ServerFnErrorWrapper<E: FromServerFnError>(pub E); impl<E: FromServerFnError> Display for ServerFnErrorWrapper<E> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { write!( f, "{}", <E::Encoder as FormatType>::into_encoded_string(self.0.ser()) ) } } impl<E: FromServerFnError> FromStr for ServerFnErrorWrapper<E> { type Err = base64::DecodeError; fn from_str(s: &str) -> Result<Self, Self::Err> { let bytes = <E::Encoder as FormatType>::from_encoded_string(s).map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Deserialization( e.to_string(), )) }); let bytes = match bytes { Ok(bytes) => bytes, Err(err) => return Ok(Self(err)), }; let err = E::de(bytes); Ok(Self(err)) } } /// A trait for types that can be returned from a server function. pub trait FromServerFnError: std::fmt::Debug + Sized + 'static { /// The encoding strategy used to serialize and deserialize this error type. Must implement the [`Encodes`](server_fn::Encodes) trait for references to the error type. type Encoder: Encodes<Self> + Decodes<Self>; /// Converts a [`ServerFnErrorErr`] into the application-specific custom error type. fn from_server_fn_error(value: ServerFnErrorErr) -> Self; /// Serializes the custom error type to bytes, according to the encoding given by `Self::Encoding`. fn ser(&self) -> Bytes { Self::Encoder::encode(self).unwrap_or_else(|e| { Self::Encoder::encode(&Self::from_server_fn_error( ServerFnErrorErr::Serialization(e.to_string()), )) .expect( "error serializing should success at least with the \ Serialization error", ) }) } /// Deserializes the custom error type, according to the encoding given by `Self::Encoding`. fn de(data: Bytes) -> Self { Self::Encoder::decode(data).unwrap_or_else(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into_app_error() }) } } /// A helper trait for converting a [`ServerFnErrorErr`] into an application-specific custom error type that implements [`FromServerFnError`]. pub trait IntoAppError<E> { /// Converts a [`ServerFnErrorErr`] into the application-specific custom error type. fn into_app_error(self) -> E; } impl<E> IntoAppError<E> for ServerFnErrorErr where E: FromServerFnError, { fn into_app_error(self) -> E { E::from_server_fn_error(self) } } #[doc(hidden)] #[rustversion::attr( since(1.78), diagnostic::on_unimplemented( message = "{Self} is not a `Result` or aliased `Result`. Server \ functions must return a `Result` or aliased `Result`.", label = "Must return a `Result` or aliased `Result`.", note = "If you are trying to return an alias of `Result`, you must \ also implement `FromServerFnError` for the error type." ) )] /// A trait for extracting the error and ok types from a [`Result`]. This is used to allow alias types to be returned from server functions. pub trait ServerFnMustReturnResult { /// The error type of the [`Result`]. type Err; /// The ok type of the [`Result`]. type Ok; } #[doc(hidden)] impl<T, E> ServerFnMustReturnResult for Result<T, E> { type Err = E; type Ok = T; } #[test] fn assert_from_server_fn_error_impl() { fn assert_impl<T: FromServerFnError>() {} assert_impl::<ServerFnError>(); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/server.rs
server_fn/src/server.rs
use crate::{ request::Req, response::{Res, TryRes}, }; use std::future::Future; /// A server defines a pair of request/response types and the logic to spawn /// an async task. /// /// This trait is implemented for any server backend for server functions including /// `axum` and `actix-web`. It should almost never be necessary to implement it /// yourself, unless you’re trying to use an alternative HTTP server. pub trait Server<Error, InputStreamError = Error, OutputStreamError = Error> { /// The type of the HTTP request when received by the server function on the server side. type Request: Req< Error, InputStreamError, OutputStreamError, WebsocketResponse = Self::Response, > + Send + 'static; /// The type of the HTTP response returned by the server function on the server side. type Response: Res + TryRes<Error> + Send + 'static; /// Spawn an async task on the server. fn spawn( future: impl Future<Output = ()> + Send + 'static, ) -> Result<(), Error>; }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/stream.rs
server_fn/src/codec/stream.rs
use super::{Encoding, FromReq, FromRes, IntoReq}; use crate::{ error::{FromServerFnError, ServerFnErrorErr}, request::{ClientReq, Req}, response::{ClientRes, TryRes}, ContentType, IntoRes, ServerFnError, }; use bytes::Bytes; use futures::{Stream, StreamExt, TryStreamExt}; use http::Method; use std::{fmt::Debug, pin::Pin}; /// An encoding that represents a stream of bytes. /// /// A server function that uses this as its output encoding should return [`ByteStream`]. /// /// ## Browser Support for Streaming Input /// /// Browser fetch requests do not currently support full request duplexing, which /// means that that they do begin handling responses until the full request has been sent. /// This means that if you use a streaming input encoding, the input stream needs to /// end before the output will begin. /// /// Streaming requests are only allowed over HTTP2 or HTTP3. pub struct Streaming; impl ContentType for Streaming { const CONTENT_TYPE: &'static str = "application/octet-stream"; } impl Encoding for Streaming { const METHOD: Method = Method::POST; } impl<E, T, Request> IntoReq<Streaming, Request, E> for T where Request: ClientReq<E>, T: Stream<Item = Bytes> + Send + 'static, E: FromServerFnError, { fn into_req(self, path: &str, accepts: &str) -> Result<Request, E> { Request::try_new_post_streaming( path, accepts, Streaming::CONTENT_TYPE, self, ) } } impl<E, T, Request> FromReq<Streaming, Request, E> for T where Request: Req<E> + Send + 'static, T: From<ByteStream<E>> + 'static, E: FromServerFnError, { async fn from_req(req: Request) -> Result<Self, E> { let data = req.try_into_stream()?; let s = ByteStream::new(data.map_err(|e| E::de(e))); Ok(s.into()) } } /// A stream of bytes. /// /// A server function can return this type if its output encoding is [`Streaming`]. /// /// ## Browser Support for Streaming Input /// /// Browser fetch requests do not currently support full request duplexing, which /// means that that they do begin handling responses until the full request has been sent. /// This means that if you use a streaming input encoding, the input stream needs to /// end before the output will begin. /// /// Streaming requests are only allowed over HTTP2 or HTTP3. pub struct ByteStream<E = ServerFnError>( Pin<Box<dyn Stream<Item = Result<Bytes, E>> + Send>>, ); impl<E> ByteStream<E> { /// Consumes the wrapper, returning a stream of bytes. pub fn into_inner(self) -> impl Stream<Item = Result<Bytes, E>> + Send { self.0 } } impl<E> Debug for ByteStream<E> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_tuple("ByteStream").finish() } } impl<E> ByteStream<E> { /// Creates a new `ByteStream` from the given stream. pub fn new<T>( value: impl Stream<Item = Result<T, E>> + Send + 'static, ) -> Self where T: Into<Bytes>, { Self(Box::pin(value.map(|value| value.map(Into::into)))) } } impl<E, S, T> From<S> for ByteStream<E> where S: Stream<Item = T> + Send + 'static, T: Into<Bytes>, { fn from(value: S) -> Self { Self(Box::pin(value.map(|data| Ok(data.into())))) } } impl<E, Response> IntoRes<Streaming, Response, E> for ByteStream<E> where Response: TryRes<E>, E: FromServerFnError, { async fn into_res(self) -> Result<Response, E> { Response::try_from_stream( Streaming::CONTENT_TYPE, self.into_inner().map_err(|e| e.ser()), ) } } impl<E, Response> FromRes<Streaming, Response, E> for ByteStream<E> where Response: ClientRes<E> + Send, E: FromServerFnError, { async fn from_res(res: Response) -> Result<Self, E> { let stream = res.try_into_stream()?; Ok(ByteStream::new(stream.map_err(|e| E::de(e)))) } } /// An encoding that represents a stream of text. /// /// A server function that uses this as its output encoding should return [`TextStream`]. /// /// ## Browser Support for Streaming Input /// /// Browser fetch requests do not currently support full request duplexing, which /// means that that they do begin handling responses until the full request has been sent. /// This means that if you use a streaming input encoding, the input stream needs to /// end before the output will begin. /// /// Streaming requests are only allowed over HTTP2 or HTTP3. pub struct StreamingText; impl ContentType for StreamingText { const CONTENT_TYPE: &'static str = "text/plain"; } impl Encoding for StreamingText { const METHOD: Method = Method::POST; } /// A stream of text. /// /// A server function can return this type if its output encoding is [`StreamingText`]. /// /// ## Browser Support for Streaming Input /// /// Browser fetch requests do not currently support full request duplexing, which /// means that that they do begin handling responses until the full request has been sent. /// This means that if you use a streaming input encoding, the input stream needs to /// end before the output will begin. /// /// Streaming requests are only allowed over HTTP2 or HTTP3. pub struct TextStream<E = ServerFnError>( Pin<Box<dyn Stream<Item = Result<String, E>> + Send>>, ); impl<E> Debug for TextStream<E> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_tuple("TextStream").finish() } } impl<E> TextStream<E> { /// Creates a new `TextStream` from the given stream. pub fn new( value: impl Stream<Item = Result<String, E>> + Send + 'static, ) -> Self { Self(Box::pin(value.map(|value| value))) } } impl<E> TextStream<E> { /// Consumes the wrapper, returning a stream of text. pub fn into_inner(self) -> impl Stream<Item = Result<String, E>> + Send { self.0 } } impl<E, S, T> From<S> for TextStream<E> where S: Stream<Item = T> + Send + 'static, T: Into<String>, { fn from(value: S) -> Self { Self(Box::pin(value.map(|data| Ok(data.into())))) } } impl<E, T, Request> IntoReq<StreamingText, Request, E> for T where Request: ClientReq<E>, T: Into<TextStream<E>>, E: FromServerFnError, { fn into_req(self, path: &str, accepts: &str) -> Result<Request, E> { let data = self.into(); Request::try_new_post_streaming( path, accepts, Streaming::CONTENT_TYPE, data.0.map(|chunk| chunk.unwrap_or_default().into()), ) } } impl<E, T, Request> FromReq<StreamingText, Request, E> for T where Request: Req<E> + Send + 'static, T: From<TextStream<E>> + 'static, E: FromServerFnError, { async fn from_req(req: Request) -> Result<Self, E> { let data = req.try_into_stream()?; let s = TextStream::new(data.map(|chunk| match chunk { Ok(bytes) => { let de = String::from_utf8(bytes.to_vec()).map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Deserialization( e.to_string(), )) })?; Ok(de) } Err(bytes) => Err(E::de(bytes)), })); Ok(s.into()) } } impl<E, Response> IntoRes<StreamingText, Response, E> for TextStream<E> where Response: TryRes<E>, E: FromServerFnError, { async fn into_res(self) -> Result<Response, E> { Response::try_from_stream( Streaming::CONTENT_TYPE, self.into_inner() .map(|stream| stream.map(Into::into).map_err(|e| e.ser())), ) } } impl<E, Response> FromRes<StreamingText, Response, E> for TextStream<E> where Response: ClientRes<E> + Send, E: FromServerFnError, { async fn from_res(res: Response) -> Result<Self, E> { let stream = res.try_into_stream()?; Ok(TextStream(Box::pin(stream.map(|chunk| match chunk { Ok(bytes) => { let de = String::from_utf8(bytes.into()).map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Deserialization( e.to_string(), )) })?; Ok(de) } Err(bytes) => Err(E::de(bytes)), })))) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/msgpack.rs
server_fn/src/codec/msgpack.rs
use crate::{ codec::{Patch, Post, Put}, ContentType, Decodes, Encodes, Format, FormatType, }; use bytes::Bytes; use serde::{de::DeserializeOwned, Serialize}; /// Serializes and deserializes MessagePack with [`rmp_serde`]. pub struct MsgPackEncoding; impl ContentType for MsgPackEncoding { const CONTENT_TYPE: &'static str = "application/msgpack"; } impl FormatType for MsgPackEncoding { const FORMAT_TYPE: Format = Format::Binary; } impl<T> Encodes<T> for MsgPackEncoding where T: Serialize, { type Error = rmp_serde::encode::Error; fn encode(value: &T) -> Result<Bytes, Self::Error> { rmp_serde::to_vec(value).map(Bytes::from) } } impl<T> Decodes<T> for MsgPackEncoding where T: DeserializeOwned, { type Error = rmp_serde::decode::Error; fn decode(bytes: Bytes) -> Result<T, Self::Error> { rmp_serde::from_slice(&bytes) } } /// Pass arguments and receive responses as MessagePack in a `POST` request. pub type MsgPack = Post<MsgPackEncoding>; /// Pass arguments and receive responses as MessagePack in the body of a `PATCH` request. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PatchMsgPack = Patch<MsgPackEncoding>; /// Pass arguments and receive responses as MessagePack in the body of a `PUT` request. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PutMsgPack = Put<MsgPackEncoding>;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/put.rs
server_fn/src/codec/put.rs
use super::{Encoding, FromReq, FromRes, IntoReq, IntoRes}; use crate::{ error::{FromServerFnError, IntoAppError, ServerFnErrorErr}, request::{ClientReq, Req}, response::{ClientRes, TryRes}, ContentType, Decodes, Encodes, }; use std::marker::PhantomData; /// A codec that encodes the data in the put body pub struct Put<Codec>(PhantomData<Codec>); impl<Codec: ContentType> ContentType for Put<Codec> { const CONTENT_TYPE: &'static str = Codec::CONTENT_TYPE; } impl<Codec: ContentType> Encoding for Put<Codec> { const METHOD: http::Method = http::Method::PUT; } impl<E, T, Encoding, Request> IntoReq<Put<Encoding>, Request, E> for T where Request: ClientReq<E>, Encoding: Encodes<T>, E: FromServerFnError, { fn into_req(self, path: &str, accepts: &str) -> Result<Request, E> { let data = Encoding::encode(&self).map_err(|e| { ServerFnErrorErr::Serialization(e.to_string()).into_app_error() })?; Request::try_new_put_bytes(path, Encoding::CONTENT_TYPE, accepts, data) } } impl<E, T, Request, Encoding> FromReq<Put<Encoding>, Request, E> for T where Request: Req<E> + Send + 'static, Encoding: Decodes<T>, E: FromServerFnError, { async fn from_req(req: Request) -> Result<Self, E> { let data = req.try_into_bytes().await?; let s = Encoding::decode(data).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into_app_error() })?; Ok(s) } } impl<E, Response, Encoding, T> IntoRes<Put<Encoding>, Response, E> for T where Response: TryRes<E>, Encoding: Encodes<T>, E: FromServerFnError + Send, T: Send, { async fn into_res(self) -> Result<Response, E> { let data = Encoding::encode(&self).map_err(|e| { ServerFnErrorErr::Serialization(e.to_string()).into_app_error() })?; Response::try_from_bytes(Encoding::CONTENT_TYPE, data) } } impl<E, Encoding, Response, T> FromRes<Put<Encoding>, Response, E> for T where Response: ClientRes<E> + Send, Encoding: Decodes<T>, E: FromServerFnError, { async fn from_res(res: Response) -> Result<Self, E> { let data = res.try_into_bytes().await?; let s = Encoding::decode(data).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into_app_error() })?; Ok(s) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/multipart.rs
server_fn/src/codec/multipart.rs
use super::{Encoding, FromReq}; use crate::{ error::{FromServerFnError, ServerFnErrorWrapper}, request::{browser::BrowserFormData, ClientReq, Req}, ContentType, IntoReq, }; use futures::StreamExt; use http::Method; use multer::Multipart; use web_sys::FormData; /// Encodes multipart form data. /// /// You should primarily use this if you are trying to handle file uploads. pub struct MultipartFormData; impl ContentType for MultipartFormData { const CONTENT_TYPE: &'static str = "multipart/form-data"; } impl Encoding for MultipartFormData { const METHOD: Method = Method::POST; } /// Describes whether the multipart data is on the client side or the server side. #[derive(Debug)] pub enum MultipartData { /// `FormData` from the browser. Client(BrowserFormData), /// Generic multipart form using [`multer`]. This implements [`Stream`](futures::Stream). Server(multer::Multipart<'static>), } impl MultipartData { /// Extracts the inner data to handle as a stream. /// /// On the server side, this always returns `Some(_)`. On the client side, always returns `None`. pub fn into_inner(self) -> Option<Multipart<'static>> { match self { MultipartData::Client(_) => None, MultipartData::Server(data) => Some(data), } } /// Extracts the inner form data on the client side. /// /// On the server side, this always returns `None`. On the client side, always returns `Some(_)`. pub fn into_client_data(self) -> Option<BrowserFormData> { match self { MultipartData::Client(data) => Some(data), MultipartData::Server(_) => None, } } } impl From<FormData> for MultipartData { fn from(value: FormData) -> Self { MultipartData::Client(value.into()) } } impl<E: FromServerFnError, T, Request> IntoReq<MultipartFormData, Request, E> for T where Request: ClientReq<E, FormData = BrowserFormData>, T: Into<MultipartData>, { fn into_req(self, path: &str, accepts: &str) -> Result<Request, E> { let multi = self.into(); Request::try_new_post_multipart( path, accepts, multi.into_client_data().unwrap(), ) } } impl<E, T, Request> FromReq<MultipartFormData, Request, E> for T where Request: Req<E> + Send + 'static, T: From<MultipartData>, E: FromServerFnError + Send + Sync, { async fn from_req(req: Request) -> Result<Self, E> { let boundary = req .to_content_type() .and_then(|ct| multer::parse_boundary(ct).ok()) .expect("couldn't parse boundary"); let stream = req.try_into_stream()?; let data = multer::Multipart::new( stream.map(|data| data.map_err(|e| ServerFnErrorWrapper(E::de(e)))), boundary, ); Ok(MultipartData::Server(data).into()) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/json.rs
server_fn/src/codec/json.rs
use super::{Patch, Post, Put}; use crate::{ContentType, Decodes, Encodes, Format, FormatType}; use bytes::Bytes; use serde::{de::DeserializeOwned, Serialize}; /// Serializes and deserializes JSON with [`serde_json`]. pub struct JsonEncoding; impl ContentType for JsonEncoding { const CONTENT_TYPE: &'static str = "application/json"; } impl FormatType for JsonEncoding { const FORMAT_TYPE: Format = Format::Text; } impl<T> Encodes<T> for JsonEncoding where T: Serialize, { type Error = serde_json::Error; fn encode(output: &T) -> Result<Bytes, Self::Error> { serde_json::to_vec(output).map(Bytes::from) } } impl<T> Decodes<T> for JsonEncoding where T: DeserializeOwned, { type Error = serde_json::Error; fn decode(bytes: Bytes) -> Result<T, Self::Error> { serde_json::from_slice(&bytes) } } /// Pass arguments and receive responses as JSON in the body of a `POST` request. pub type Json = Post<JsonEncoding>; /// Pass arguments and receive responses as JSON in the body of a `PATCH` request. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PatchJson = Patch<JsonEncoding>; /// Pass arguments and receive responses as JSON in the body of a `PUT` request. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PutJson = Put<JsonEncoding>;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/url.rs
server_fn/src/codec/url.rs
use super::{Encoding, FromReq, IntoReq}; use crate::{ error::{FromServerFnError, IntoAppError, ServerFnErrorErr}, request::{ClientReq, Req}, ContentType, }; use http::Method; use serde::{de::DeserializeOwned, Serialize}; /// Pass arguments as a URL-encoded query string of a `GET` request. pub struct GetUrl; /// Pass arguments as the URL-encoded body of a `POST` request. pub struct PostUrl; /// Pass arguments as the URL-encoded query string of a `DELETE` request. /// **Note**: Browser support for `DELETE` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub struct DeleteUrl; /// Pass arguments as the URL-encoded body of a `PATCH` request. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub struct PatchUrl; /// Pass arguments as the URL-encoded body of a `PUT` request. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub struct PutUrl; impl ContentType for GetUrl { const CONTENT_TYPE: &'static str = "application/x-www-form-urlencoded"; } impl Encoding for GetUrl { const METHOD: Method = Method::GET; } impl<E, T, Request> IntoReq<GetUrl, Request, E> for T where Request: ClientReq<E>, T: Serialize + Send, E: FromServerFnError, { fn into_req(self, path: &str, accepts: &str) -> Result<Request, E> { let data = serde_qs::to_string(&self).map_err(|e| { ServerFnErrorErr::Serialization(e.to_string()).into_app_error() })?; Request::try_new_get(path, GetUrl::CONTENT_TYPE, accepts, &data) } } impl<E, T, Request> FromReq<GetUrl, Request, E> for T where Request: Req<E> + Send + 'static, T: DeserializeOwned, E: FromServerFnError, { async fn from_req(req: Request) -> Result<Self, E> { let string_data = req.as_query().unwrap_or_default(); let args = serde_qs::Config::new(5, false) .deserialize_str::<Self>(string_data) .map_err(|e| { ServerFnErrorErr::Args(e.to_string()).into_app_error() })?; Ok(args) } } impl ContentType for PostUrl { const CONTENT_TYPE: &'static str = "application/x-www-form-urlencoded"; } impl Encoding for PostUrl { const METHOD: Method = Method::POST; } impl<E, T, Request> IntoReq<PostUrl, Request, E> for T where Request: ClientReq<E>, T: Serialize + Send, E: FromServerFnError, { fn into_req(self, path: &str, accepts: &str) -> Result<Request, E> { let qs = serde_qs::to_string(&self).map_err(|e| { ServerFnErrorErr::Serialization(e.to_string()).into_app_error() })?; Request::try_new_post(path, PostUrl::CONTENT_TYPE, accepts, qs) } } impl<E, T, Request> FromReq<PostUrl, Request, E> for T where Request: Req<E> + Send + 'static, T: DeserializeOwned, E: FromServerFnError, { async fn from_req(req: Request) -> Result<Self, E> { let string_data = req.try_into_string().await?; let args = serde_qs::Config::new(5, false) .deserialize_str::<Self>(&string_data) .map_err(|e| { ServerFnErrorErr::Args(e.to_string()).into_app_error() })?; Ok(args) } } impl ContentType for DeleteUrl { const CONTENT_TYPE: &'static str = "application/x-www-form-urlencoded"; } impl Encoding for DeleteUrl { const METHOD: Method = Method::DELETE; } impl<E, T, Request> IntoReq<DeleteUrl, Request, E> for T where Request: ClientReq<E>, T: Serialize + Send, E: FromServerFnError, { fn into_req(self, path: &str, accepts: &str) -> Result<Request, E> { let data = serde_qs::to_string(&self).map_err(|e| { ServerFnErrorErr::Serialization(e.to_string()).into_app_error() })?; Request::try_new_delete(path, DeleteUrl::CONTENT_TYPE, accepts, &data) } } impl<E, T, Request> FromReq<DeleteUrl, Request, E> for T where Request: Req<E> + Send + 'static, T: DeserializeOwned, E: FromServerFnError, { async fn from_req(req: Request) -> Result<Self, E> { let string_data = req.as_query().unwrap_or_default(); let args = serde_qs::Config::new(5, false) .deserialize_str::<Self>(string_data) .map_err(|e| { ServerFnErrorErr::Args(e.to_string()).into_app_error() })?; Ok(args) } } impl ContentType for PatchUrl { const CONTENT_TYPE: &'static str = "application/x-www-form-urlencoded"; } impl Encoding for PatchUrl { const METHOD: Method = Method::PATCH; } impl<E, T, Request> IntoReq<PatchUrl, Request, E> for T where Request: ClientReq<E>, T: Serialize + Send, E: FromServerFnError, { fn into_req(self, path: &str, accepts: &str) -> Result<Request, E> { let data = serde_qs::to_string(&self).map_err(|e| { ServerFnErrorErr::Serialization(e.to_string()).into_app_error() })?; Request::try_new_patch(path, PatchUrl::CONTENT_TYPE, accepts, data) } } impl<E, T, Request> FromReq<PatchUrl, Request, E> for T where Request: Req<E> + Send + 'static, T: DeserializeOwned, E: FromServerFnError, { async fn from_req(req: Request) -> Result<Self, E> { let string_data = req.try_into_string().await?; let args = serde_qs::Config::new(5, false) .deserialize_str::<Self>(&string_data) .map_err(|e| { ServerFnErrorErr::Args(e.to_string()).into_app_error() })?; Ok(args) } } impl ContentType for PutUrl { const CONTENT_TYPE: &'static str = "application/x-www-form-urlencoded"; } impl Encoding for PutUrl { const METHOD: Method = Method::PUT; } impl<E, T, Request> IntoReq<PutUrl, Request, E> for T where Request: ClientReq<E>, T: Serialize + Send, E: FromServerFnError, { fn into_req(self, path: &str, accepts: &str) -> Result<Request, E> { let data = serde_qs::to_string(&self).map_err(|e| { ServerFnErrorErr::Serialization(e.to_string()).into_app_error() })?; Request::try_new_put(path, PutUrl::CONTENT_TYPE, accepts, data) } } impl<E, T, Request> FromReq<PutUrl, Request, E> for T where Request: Req<E> + Send + 'static, T: DeserializeOwned, E: FromServerFnError, { async fn from_req(req: Request) -> Result<Self, E> { let string_data = req.try_into_string().await?; let args = serde_qs::Config::new(5, false) .deserialize_str::<Self>(&string_data) .map_err(|e| { ServerFnErrorErr::Args(e.to_string()).into_app_error() })?; Ok(args) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/cbor.rs
server_fn/src/codec/cbor.rs
use super::{Patch, Post, Put}; use crate::{ContentType, Decodes, Encodes, Format, FormatType}; use bytes::Bytes; use serde::{de::DeserializeOwned, Serialize}; /// Serializes and deserializes CBOR with [`ciborium`]. pub struct CborEncoding; impl ContentType for CborEncoding { const CONTENT_TYPE: &'static str = "application/cbor"; } impl FormatType for CborEncoding { const FORMAT_TYPE: Format = Format::Binary; } impl<T> Encodes<T> for CborEncoding where T: Serialize, { type Error = ciborium::ser::Error<std::io::Error>; fn encode(value: &T) -> Result<Bytes, Self::Error> { let mut buffer: Vec<u8> = Vec::new(); ciborium::ser::into_writer(value, &mut buffer)?; Ok(Bytes::from(buffer)) } } impl<T> Decodes<T> for CborEncoding where T: DeserializeOwned, { type Error = ciborium::de::Error<std::io::Error>; fn decode(bytes: Bytes) -> Result<T, Self::Error> { ciborium::de::from_reader(bytes.as_ref()) } } /// Pass arguments and receive responses using `cbor` in a `POST` request. pub type Cbor = Post<CborEncoding>; /// Pass arguments and receive responses using `cbor` in the body of a `PATCH` request. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PatchCbor = Patch<CborEncoding>; /// Pass arguments and receive responses using `cbor` in the body of a `PUT` request. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PutCbor = Put<CborEncoding>;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/serde_lite.rs
server_fn/src/codec/serde_lite.rs
use crate::{ codec::{Patch, Post, Put}, error::ServerFnErrorErr, ContentType, Decodes, Encodes, Format, FormatType, }; use bytes::Bytes; use serde_lite::{Deserialize, Serialize}; /// Pass arguments and receive responses as JSON in the body of a `POST` request. pub struct SerdeLiteEncoding; impl ContentType for SerdeLiteEncoding { const CONTENT_TYPE: &'static str = "application/json"; } impl FormatType for SerdeLiteEncoding { const FORMAT_TYPE: Format = Format::Text; } impl<T> Encodes<T> for SerdeLiteEncoding where T: Serialize, { type Error = ServerFnErrorErr; fn encode(value: &T) -> Result<Bytes, Self::Error> { serde_json::to_vec( &value .serialize() .map_err(|e| ServerFnErrorErr::Serialization(e.to_string()))?, ) .map_err(|e| ServerFnErrorErr::Serialization(e.to_string())) .map(Bytes::from) } } impl<T> Decodes<T> for SerdeLiteEncoding where T: Deserialize, { type Error = ServerFnErrorErr; fn decode(bytes: Bytes) -> Result<T, Self::Error> { T::deserialize( &serde_json::from_slice(&bytes).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()) })?, ) .map_err(|e| ServerFnErrorErr::Deserialization(e.to_string())) } } /// Pass arguments and receive responses as JSON in the body of a `POST` request. pub type SerdeLite = Post<SerdeLiteEncoding>; /// Pass arguments and receive responses as JSON in the body of a `PATCH` request. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PatchSerdeLite = Patch<SerdeLiteEncoding>; /// Pass arguments and receive responses as JSON in the body of a `PUT` request. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PutSerdeLite = Put<SerdeLiteEncoding>;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/mod.rs
server_fn/src/codec/mod.rs
//! The serialization/deserialization process for server functions consists of a series of steps, //! each of which is represented by a different trait: //! 1. [`IntoReq`]: The client serializes the [`ServerFn`] argument type into an HTTP request. //! 2. The [`Client`] sends the request to the server. //! 3. [`FromReq`]: The server deserializes the HTTP request back into the [`ServerFn`] type. //! 4. The server calls [`ServerFn::run_body`] on the data. //! 5. [`IntoRes`]: The server serializes the [`ServerFn::Output`] type into an HTTP response. //! 6. The server integration applies any middleware from [`ServerFn::middlewares`] and responds to the request. //! 7. [`FromRes`]: The client deserializes the response back into the [`ServerFn::Output`] type. //! //! Rather than a limited number of encodings, this crate allows you to define server functions that //! mix and match the input encoding and output encoding. To define a new encoding, you simply implement //! an input combination ([`IntoReq`] and [`FromReq`]) and/or an output encoding ([`IntoRes`] and [`FromRes`]). //! This genuinely is an and/or: while some encodings can be used for both input and output (`Json`, `Cbor`, `Rkyv`), //! others can only be used for input (`GetUrl`, `MultipartData`). #[cfg(feature = "cbor")] mod cbor; #[cfg(feature = "cbor")] pub use cbor::*; mod json; pub use json::*; #[cfg(feature = "serde-lite")] mod serde_lite; #[cfg(feature = "serde-lite")] pub use serde_lite::*; #[cfg(feature = "rkyv")] mod rkyv; #[cfg(feature = "rkyv")] pub use rkyv::*; mod url; pub use url::*; #[cfg(feature = "multipart")] mod multipart; #[cfg(feature = "multipart")] pub use multipart::*; #[cfg(feature = "msgpack")] mod msgpack; #[cfg(feature = "msgpack")] pub use msgpack::*; #[cfg(feature = "postcard")] mod postcard; #[cfg(feature = "postcard")] pub use postcard::*; #[cfg(feature = "bitcode")] mod bitcode; #[cfg(feature = "bitcode")] pub use bitcode::*; mod patch; pub use patch::*; mod post; pub use post::*; mod put; pub use put::*; mod stream; use crate::ContentType; use futures::Future; use http::Method; pub use stream::*; /// Serializes a data type into an HTTP request, on the client. /// /// Implementations use the methods of the [`ClientReq`](crate::request::ClientReq) trait to /// convert data into a request body. They are often quite short, usually consisting /// of just two steps: /// 1. Serializing the data into some [`String`], [`Bytes`](bytes::Bytes), or [`Stream`](futures::Stream). /// 2. Creating a request with a body of that type. /// /// For example, here’s the implementation for [`Json`]. /// /// ```rust,ignore /// impl<E, T, Request> IntoReq<Json, Request, E> for T /// where /// Request: ClientReq<E>, /// T: Serialize + Send, /// { /// fn into_req( /// self, /// path: &str, /// accepts: &str, /// ) -> Result<Request, E> { /// // try to serialize the data /// let data = serde_json::to_string(&self) /// .map_err(|e| ServerFnErrorErr::Serialization(e.to_string()).into_app_error())?; /// // and use it as the body of a POST request /// Request::try_new_post(path, accepts, Json::CONTENT_TYPE, data) /// } /// } /// ``` pub trait IntoReq<Encoding, Request, E> { /// Attempts to serialize the arguments into an HTTP request. fn into_req(self, path: &str, accepts: &str) -> Result<Request, E>; } /// Deserializes an HTTP request into the data type, on the server. /// /// Implementations use the methods of the [`Req`](crate::Req) trait to access whatever is /// needed from the request. They are often quite short, usually consisting /// of just two steps: /// 1. Extracting the request body into some [`String`], [`Bytes`](bytes::Bytes), or [`Stream`](futures::Stream). /// 2. Deserializing that data into the data type. /// /// For example, here’s the implementation for [`Json`]. /// /// ```rust,ignore /// impl<E, T, Request> FromReq<Json, Request, E> for T /// where /// // require the Request implement `Req` /// Request: Req<E> + Send + 'static, /// // require that the type can be deserialized with `serde` /// T: DeserializeOwned, /// E: FromServerFnError, /// { /// async fn from_req( /// req: Request, /// ) -> Result<Self, E> { /// // try to convert the body of the request into a `String` /// let string_data = req.try_into_string().await?; /// // deserialize the data /// serde_json::from_str(&string_data) /// .map_err(|e| ServerFnErrorErr::Args(e.to_string()).into_app_error()) /// } /// } /// ``` pub trait FromReq<Encoding, Request, E> where Self: Sized, { /// Attempts to deserialize the arguments from a request. fn from_req(req: Request) -> impl Future<Output = Result<Self, E>> + Send; } /// Serializes the data type into an HTTP response. /// /// Implementations use the methods of the [`Res`](crate::Res) trait to create a /// response. They are often quite short, usually consisting /// of just two steps: /// 1. Serializing the data type to a [`String`], [`Bytes`](bytes::Bytes), or a [`Stream`](futures::Stream). /// 2. Creating a response with that serialized value as its body. /// /// For example, here’s the implementation for [`Json`]. /// /// ```rust,ignore /// impl<E, T, Response> IntoRes<Json, Response, E> for T /// where /// Response: Res<E>, /// T: Serialize + Send, /// E: FromServerFnError, /// { /// async fn into_res(self) -> Result<Response, E> { /// // try to serialize the data /// let data = serde_json::to_string(&self) /// .map_err(|e| ServerFnErrorErr::Serialization(e.to_string()).into())?; /// // and use it as the body of a response /// Response::try_from_string(Json::CONTENT_TYPE, data) /// } /// } /// ``` pub trait IntoRes<Encoding, Response, E> { /// Attempts to serialize the output into an HTTP response. fn into_res(self) -> impl Future<Output = Result<Response, E>> + Send; } /// Deserializes the data type from an HTTP response. /// /// Implementations use the methods of the [`ClientRes`](crate::ClientRes) trait to extract /// data from a response. They are often quite short, usually consisting /// of just two steps: /// 1. Extracting a [`String`], [`Bytes`](bytes::Bytes), or a [`Stream`](futures::Stream) /// from the response body. /// 2. Deserializing the data type from that value. /// /// For example, here’s the implementation for [`Json`]. /// /// ```rust,ignore /// impl<E, T, Response> FromRes<Json, Response, E> for T /// where /// Response: ClientRes<E> + Send, /// T: DeserializeOwned + Send, /// E: FromServerFnError, /// { /// async fn from_res( /// res: Response, /// ) -> Result<Self, E> { /// // extracts the request body /// let data = res.try_into_string().await?; /// // and tries to deserialize it as JSON /// serde_json::from_str(&data) /// .map_err(|e| ServerFnErrorErr::Deserialization(e.to_string()).into_app_error()) /// } /// } /// ``` pub trait FromRes<Encoding, Response, E> where Self: Sized, { /// Attempts to deserialize the outputs from a response. fn from_res(res: Response) -> impl Future<Output = Result<Self, E>> + Send; } /// Defines a particular encoding format, which can be used for serializing or deserializing data. pub trait Encoding: ContentType { /// The HTTP method used for requests. /// /// This should be `POST` in most cases. const METHOD: Method; }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/post.rs
server_fn/src/codec/post.rs
use super::{Encoding, FromReq, FromRes, IntoReq, IntoRes}; use crate::{ error::{FromServerFnError, IntoAppError, ServerFnErrorErr}, request::{ClientReq, Req}, response::{ClientRes, TryRes}, ContentType, Decodes, Encodes, }; use std::marker::PhantomData; /// A codec that encodes the data in the post body pub struct Post<Codec>(PhantomData<Codec>); impl<Codec: ContentType> ContentType for Post<Codec> { const CONTENT_TYPE: &'static str = Codec::CONTENT_TYPE; } impl<Codec: ContentType> Encoding for Post<Codec> { const METHOD: http::Method = http::Method::POST; } impl<E, T, Encoding, Request> IntoReq<Post<Encoding>, Request, E> for T where Request: ClientReq<E>, Encoding: Encodes<T>, E: FromServerFnError, { fn into_req(self, path: &str, accepts: &str) -> Result<Request, E> { let data = Encoding::encode(&self).map_err(|e| { ServerFnErrorErr::Serialization(e.to_string()).into_app_error() })?; Request::try_new_post_bytes(path, Encoding::CONTENT_TYPE, accepts, data) } } impl<E, T, Request, Encoding> FromReq<Post<Encoding>, Request, E> for T where Request: Req<E> + Send + 'static, Encoding: Decodes<T>, E: FromServerFnError, { async fn from_req(req: Request) -> Result<Self, E> { let data = req.try_into_bytes().await?; let s = Encoding::decode(data).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into_app_error() })?; Ok(s) } } impl<E, Response, Encoding, T> IntoRes<Post<Encoding>, Response, E> for T where Response: TryRes<E>, Encoding: Encodes<T>, E: FromServerFnError + Send, T: Send, { async fn into_res(self) -> Result<Response, E> { let data = Encoding::encode(&self).map_err(|e| { ServerFnErrorErr::Serialization(e.to_string()).into_app_error() })?; Response::try_from_bytes(Encoding::CONTENT_TYPE, data) } } impl<E, Encoding, Response, T> FromRes<Post<Encoding>, Response, E> for T where Response: ClientRes<E> + Send, Encoding: Decodes<T>, E: FromServerFnError, { async fn from_res(res: Response) -> Result<Self, E> { let data = res.try_into_bytes().await?; let s = Encoding::decode(data).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into_app_error() })?; Ok(s) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/postcard.rs
server_fn/src/codec/postcard.rs
use crate::{ codec::{Patch, Post, Put}, ContentType, Decodes, Encodes, Format, FormatType, }; use bytes::Bytes; use serde::{de::DeserializeOwned, Serialize}; /// A codec for Postcard. pub struct PostcardEncoding; impl ContentType for PostcardEncoding { const CONTENT_TYPE: &'static str = "application/x-postcard"; } impl FormatType for PostcardEncoding { const FORMAT_TYPE: Format = Format::Binary; } impl<T> Encodes<T> for PostcardEncoding where T: Serialize, { type Error = postcard::Error; fn encode(value: &T) -> Result<Bytes, Self::Error> { postcard::to_allocvec(value).map(Bytes::from) } } impl<T> Decodes<T> for PostcardEncoding where T: DeserializeOwned, { type Error = postcard::Error; fn decode(bytes: Bytes) -> Result<T, Self::Error> { postcard::from_bytes(&bytes) } } /// Pass arguments and receive responses with postcard in a `POST` request. pub type Postcard = Post<PostcardEncoding>; /// Pass arguments and receive responses with postcard in a `PATCH` request. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PatchPostcard = Patch<PostcardEncoding>; /// Pass arguments and receive responses with postcard in a `PUT` request. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PutPostcard = Put<PostcardEncoding>;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/rkyv.rs
server_fn/src/codec/rkyv.rs
use crate::{ codec::{Patch, Post, Put}, ContentType, Decodes, Encodes, Format, FormatType, }; use bytes::Bytes; use rkyv::{ api::high::{HighDeserializer, HighSerializer, HighValidator}, bytecheck::CheckBytes, rancor, ser::allocator::ArenaHandle, util::AlignedVec, Archive, Deserialize, Serialize, }; type RkyvSerializer<'a> = HighSerializer<AlignedVec, ArenaHandle<'a>, rancor::Error>; type RkyvDeserializer = HighDeserializer<rancor::Error>; type RkyvValidator<'a> = HighValidator<'a, rancor::Error>; /// Pass arguments and receive responses using `rkyv` in a `POST` request. pub struct RkyvEncoding; impl ContentType for RkyvEncoding { const CONTENT_TYPE: &'static str = "application/rkyv"; } impl FormatType for RkyvEncoding { const FORMAT_TYPE: Format = Format::Binary; } impl<T> Encodes<T> for RkyvEncoding where T: Archive + for<'a> Serialize<RkyvSerializer<'a>>, T::Archived: Deserialize<T, RkyvDeserializer> + for<'a> CheckBytes<RkyvValidator<'a>>, { type Error = rancor::Error; fn encode(value: &T) -> Result<Bytes, Self::Error> { let encoded = rkyv::to_bytes::<rancor::Error>(value)?; Ok(Bytes::copy_from_slice(encoded.as_ref())) } } impl<T> Decodes<T> for RkyvEncoding where T: Archive + for<'a> Serialize<RkyvSerializer<'a>>, T::Archived: Deserialize<T, RkyvDeserializer> + for<'a> CheckBytes<RkyvValidator<'a>>, { type Error = rancor::Error; fn decode(bytes: Bytes) -> Result<T, Self::Error> { let mut aligned = AlignedVec::<1024>::new(); aligned.extend_from_slice(bytes.as_ref()); rkyv::from_bytes::<T, rancor::Error>(aligned.as_ref()) } } /// Pass arguments and receive responses as `rkyv` in a `POST` request. pub type Rkyv = Post<RkyvEncoding>; /// Pass arguments and receive responses as `rkyv` in a `PATCH` request. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PatchRkyv = Patch<RkyvEncoding>; /// Pass arguments and receive responses as `rkyv` in a `PUT` request. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PutRkyv = Put<RkyvEncoding>;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/patch.rs
server_fn/src/codec/patch.rs
use super::{Encoding, FromReq, FromRes, IntoReq, IntoRes}; use crate::{ error::{FromServerFnError, IntoAppError, ServerFnErrorErr}, request::{ClientReq, Req}, response::{ClientRes, TryRes}, ContentType, Decodes, Encodes, }; use std::marker::PhantomData; /// A codec that encodes the data in the patch body pub struct Patch<Codec>(PhantomData<Codec>); impl<Codec: ContentType> ContentType for Patch<Codec> { const CONTENT_TYPE: &'static str = Codec::CONTENT_TYPE; } impl<Codec: ContentType> Encoding for Patch<Codec> { const METHOD: http::Method = http::Method::PATCH; } impl<E, T, Encoding, Request> IntoReq<Patch<Encoding>, Request, E> for T where Request: ClientReq<E>, Encoding: Encodes<T>, E: FromServerFnError, { fn into_req(self, path: &str, accepts: &str) -> Result<Request, E> { let data = Encoding::encode(&self).map_err(|e| { ServerFnErrorErr::Serialization(e.to_string()).into_app_error() })?; Request::try_new_patch_bytes( path, Encoding::CONTENT_TYPE, accepts, data, ) } } impl<E, T, Request, Encoding> FromReq<Patch<Encoding>, Request, E> for T where Request: Req<E> + Send + 'static, Encoding: Decodes<T>, E: FromServerFnError, { async fn from_req(req: Request) -> Result<Self, E> { let data = req.try_into_bytes().await?; let s = Encoding::decode(data).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into_app_error() })?; Ok(s) } } impl<E, Response, Encoding, T> IntoRes<Patch<Encoding>, Response, E> for T where Response: TryRes<E>, Encoding: Encodes<T>, E: FromServerFnError + Send, T: Send, { async fn into_res(self) -> Result<Response, E> { let data = Encoding::encode(&self).map_err(|e| { ServerFnErrorErr::Serialization(e.to_string()).into_app_error() })?; Response::try_from_bytes(Encoding::CONTENT_TYPE, data) } } impl<E, Encoding, Response, T> FromRes<Patch<Encoding>, Response, E> for T where Response: ClientRes<E> + Send, Encoding: Decodes<T>, E: FromServerFnError, { async fn from_res(res: Response) -> Result<Self, E> { let data = res.try_into_bytes().await?; let s = Encoding::decode(data).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into_app_error() })?; Ok(s) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/codec/bitcode.rs
server_fn/src/codec/bitcode.rs
use super::{Patch, Post, Put}; use crate::{ContentType, Decodes, Encodes, Format, FormatType}; use bytes::Bytes; /// Serializes and deserializes with [`bitcode`]. pub struct BitcodeEncoding; impl ContentType for BitcodeEncoding { const CONTENT_TYPE: &'static str = "application/bitcode"; } impl FormatType for BitcodeEncoding { const FORMAT_TYPE: Format = Format::Binary; } impl<T> Encodes<T> for BitcodeEncoding where T: bitcode::Encode, { type Error = std::convert::Infallible; fn encode(value: &T) -> Result<Bytes, Self::Error> { Ok(Bytes::from(bitcode::encode(value))) } } impl<T> Decodes<T> for BitcodeEncoding where T: bitcode::DecodeOwned, { type Error = bitcode::Error; fn decode(bytes: Bytes) -> Result<T, Self::Error> { bitcode::decode(bytes.as_ref()) } } /// Pass arguments and receive responses using `bitcode` in a `POST` request. pub type Bitcode = Post<BitcodeEncoding>; /// Pass arguments and receive responses using `bitcode` in the body of a `PATCH` request. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PatchBitcode = Patch<BitcodeEncoding>; /// Pass arguments and receive responses using `bitcode` in the body of a `PUT` request. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. pub type PutBitcode = Put<BitcodeEncoding>;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false