repo
stringlengths
6
65
file_url
stringlengths
81
311
file_path
stringlengths
6
227
content
stringlengths
0
32.8k
language
stringclasses
1 value
license
stringclasses
7 values
commit_sha
stringlengths
40
40
retrieved_at
stringdate
2026-01-04 15:31:58
2026-01-04 20:25:31
truncated
bool
2 classes
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/middleware/mod.rs
server_fn/src/middleware/mod.rs
use crate::error::ServerFnErrorErr; use bytes::Bytes; use std::{future::Future, pin::Pin}; /// An abstraction over a middleware layer, which can be used to add additional /// middleware layer to a [`Service`]. pub trait Layer<Req, Res>: Send + Sync + 'static { /// Adds this layer to the inner service. fn layer(&self, inner: BoxedService<Req, Res>) -> BoxedService<Req, Res>; } /// A type-erased service, which takes an HTTP request and returns a response. pub struct BoxedService<Req, Res> { /// A function that converts a [`ServerFnErrorErr`] into a string. pub ser: fn(ServerFnErrorErr) -> Bytes, /// The inner service. pub service: Box<dyn Service<Req, Res> + Send>, } impl<Req, Res> BoxedService<Req, Res> { /// Constructs a type-erased service from this service. pub fn new( ser: fn(ServerFnErrorErr) -> Bytes, service: impl Service<Req, Res> + Send + 'static, ) -> Self { Self { ser, service: Box::new(service), } } /// Converts a request into a response by running the inner service. pub fn run( &mut self, req: Req, ) -> Pin<Box<dyn Future<Output = Res> + Send>> { self.service.run(req, self.ser) } } /// A service converts an HTTP request into a response. pub trait Service<Request, Response> { /// Converts a request into a response. fn run( &mut self, req: Request, ser: fn(ServerFnErrorErr) -> Bytes, ) -> Pin<Box<dyn Future<Output = Response> + Send>>; } #[cfg(feature = "axum-no-default")] mod axum { use super::{BoxedService, Service}; use crate::{error::ServerFnErrorErr, response::Res, ServerFnError}; use axum::body::Body; use bytes::Bytes; use http::{Request, Response}; use std::{future::Future, pin::Pin}; impl<S> super::Service<Request<Body>, Response<Body>> for S where S: tower::Service<Request<Body>, Response = Response<Body>>, S::Future: Send + 'static, S::Error: std::fmt::Display + Send + 'static, { fn run( &mut self, req: Request<Body>, ser: fn(ServerFnErrorErr) -> Bytes, ) -> Pin<Box<dyn Future<Output = Response<Body>> + Send>> { let path = req.uri().path().to_string(); let inner = self.call(req); Box::pin(async move { inner.await.unwrap_or_else(|e| { // TODO: This does not set the Content-Type on the response. Doing so will // require a breaking change in order to get the correct encoding from the // error's `FromServerFnError::Encoder::CONTENT_TYPE` impl. // Note: This only applies to middleware errors. let err = ser(ServerFnErrorErr::MiddlewareError(e.to_string())); Response::<Body>::error_response(&path, err) }) }) } } impl tower::Service<Request<Body>> for BoxedService<Request<Body>, Response<Body>> { type Response = Response<Body>; type Error = ServerFnError; type Future = Pin< Box< dyn std::future::Future< Output = Result<Self::Response, Self::Error>, > + Send, >, >; fn poll_ready( &mut self, _cx: &mut std::task::Context<'_>, ) -> std::task::Poll<Result<(), Self::Error>> { Ok(()).into() } fn call(&mut self, req: Request<Body>) -> Self::Future { let inner = self.service.run(req, self.ser); Box::pin(async move { Ok(inner.await) }) } } impl<L> super::Layer<Request<Body>, Response<Body>> for L where L: tower_layer::Layer<BoxedService<Request<Body>, Response<Body>>> + Sync + Send + 'static, L::Service: Service<Request<Body>, Response<Body>> + Send + 'static, { fn layer( &self, inner: BoxedService<Request<Body>, Response<Body>>, ) -> BoxedService<Request<Body>, Response<Body>> { BoxedService::new(inner.ser, self.layer(inner)) } } } #[cfg(feature = "actix-no-default")] mod actix { use crate::{ error::ServerFnErrorErr, request::actix::ActixRequest, response::{actix::ActixResponse, Res}, }; use actix_web::{HttpRequest, HttpResponse}; use bytes::Bytes; use std::{future::Future, pin::Pin}; impl<S> super::Service<HttpRequest, HttpResponse> for S where S: actix_web::dev::Service<HttpRequest, Response = HttpResponse>, S::Future: Send + 'static, S::Error: std::fmt::Display + Send + 'static, { fn run( &mut self, req: HttpRequest, ser: fn(ServerFnErrorErr) -> Bytes, ) -> Pin<Box<dyn Future<Output = HttpResponse> + Send>> { let path = req.uri().path().to_string(); let inner = self.call(req); Box::pin(async move { inner.await.unwrap_or_else(|e| { // TODO: This does not set the Content-Type on the response. Doing so will // require a breaking change in order to get the correct encoding from the // error's `FromServerFnError::Encoder::CONTENT_TYPE` impl. // Note: This only applies to middleware errors. let err = ser(ServerFnErrorErr::MiddlewareError(e.to_string())); ActixResponse::error_response(&path, err).take() }) }) } } impl<S> super::Service<ActixRequest, ActixResponse> for S where S: actix_web::dev::Service<HttpRequest, Response = HttpResponse>, S::Future: Send + 'static, S::Error: std::fmt::Display + Send + 'static, { fn run( &mut self, req: ActixRequest, ser: fn(ServerFnErrorErr) -> Bytes, ) -> Pin<Box<dyn Future<Output = ActixResponse> + Send>> { let path = req.0 .0.uri().path().to_string(); let inner = self.call(req.0.take().0); Box::pin(async move { ActixResponse::from(inner.await.unwrap_or_else(|e| { let err = ser(ServerFnErrorErr::MiddlewareError(e.to_string())); ActixResponse::error_response(&path, err).take() })) }) } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/response/actix.rs
server_fn/src/response/actix.rs
use super::{Res, TryRes}; use crate::error::{ FromServerFnError, ServerFnErrorWrapper, SERVER_FN_ERROR_HEADER, }; use actix_web::{ http::{ header, header::{HeaderValue, CONTENT_TYPE, LOCATION}, StatusCode, }, HttpResponse, }; use bytes::Bytes; use futures::{Stream, StreamExt}; use send_wrapper::SendWrapper; /// A wrapped Actix response. /// /// This uses a [`SendWrapper`] that allows the Actix `HttpResponse` type to be `Send`, but panics /// if it it is ever sent to another thread. Actix pins request handling to a single thread, so this /// is necessary to be compatible with traits that require `Send` but should never panic in actual use. pub struct ActixResponse(pub(crate) SendWrapper<HttpResponse>); impl ActixResponse { /// Returns the raw Actix response. pub fn take(self) -> HttpResponse { self.0.take() } } impl From<HttpResponse> for ActixResponse { fn from(value: HttpResponse) -> Self { Self(SendWrapper::new(value)) } } impl<E> TryRes<E> for ActixResponse where E: FromServerFnError, { fn try_from_string(content_type: &str, data: String) -> Result<Self, E> { let mut builder = HttpResponse::build(StatusCode::OK); Ok(ActixResponse(SendWrapper::new( builder .insert_header((header::CONTENT_TYPE, content_type)) .body(data), ))) } fn try_from_bytes(content_type: &str, data: Bytes) -> Result<Self, E> { let mut builder = HttpResponse::build(StatusCode::OK); Ok(ActixResponse(SendWrapper::new( builder .insert_header((header::CONTENT_TYPE, content_type)) .body(data), ))) } fn try_from_stream( content_type: &str, data: impl Stream<Item = Result<Bytes, Bytes>> + 'static, ) -> Result<Self, E> { let mut builder = HttpResponse::build(StatusCode::OK); Ok(ActixResponse(SendWrapper::new( builder .insert_header((header::CONTENT_TYPE, content_type)) .streaming(data.map(|data| { data.map_err(|e| ServerFnErrorWrapper(E::de(e))) })), ))) } } impl Res for ActixResponse { fn error_response(path: &str, err: Bytes) -> Self { ActixResponse(SendWrapper::new( HttpResponse::build(StatusCode::INTERNAL_SERVER_ERROR) .append_header((SERVER_FN_ERROR_HEADER, path)) .body(err), )) } fn content_type(&mut self, content_type: &str) { if let Ok(content_type) = HeaderValue::from_str(content_type) { self.0.headers_mut().insert(CONTENT_TYPE, content_type); } } fn redirect(&mut self, path: &str) { if let Ok(path) = HeaderValue::from_str(path) { *self.0.status_mut() = StatusCode::FOUND; self.0.headers_mut().insert(LOCATION, path); } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/response/http.rs
server_fn/src/response/http.rs
use super::{Res, TryRes}; use crate::error::{ FromServerFnError, IntoAppError, ServerFnErrorErr, ServerFnErrorWrapper, SERVER_FN_ERROR_HEADER, }; use axum::body::Body; use bytes::Bytes; use futures::{Stream, TryStreamExt}; use http::{header, HeaderValue, Response, StatusCode}; impl<E> TryRes<E> for Response<Body> where E: Send + Sync + FromServerFnError, { fn try_from_string(content_type: &str, data: String) -> Result<Self, E> { let builder = http::Response::builder(); builder .status(200) .header(http::header::CONTENT_TYPE, content_type) .body(Body::from(data)) .map_err(|e| { ServerFnErrorErr::Response(e.to_string()).into_app_error() }) } fn try_from_bytes(content_type: &str, data: Bytes) -> Result<Self, E> { let builder = http::Response::builder(); builder .status(200) .header(http::header::CONTENT_TYPE, content_type) .body(Body::from(data)) .map_err(|e| { ServerFnErrorErr::Response(e.to_string()).into_app_error() }) } fn try_from_stream( content_type: &str, data: impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, ) -> Result<Self, E> { let body = Body::from_stream(data.map_err(|e| ServerFnErrorWrapper(E::de(e)))); let builder = http::Response::builder(); builder .status(200) .header(http::header::CONTENT_TYPE, content_type) .body(body) .map_err(|e| { ServerFnErrorErr::Response(e.to_string()).into_app_error() }) } } impl Res for Response<Body> { fn error_response(path: &str, err: Bytes) -> Self { Response::builder() .status(http::StatusCode::INTERNAL_SERVER_ERROR) .header(SERVER_FN_ERROR_HEADER, path) .body(err.into()) .unwrap() } fn content_type(&mut self, content_type: &str) { if let Ok(content_type) = HeaderValue::from_str(content_type) { self.headers_mut() .insert(header::CONTENT_TYPE, content_type); } } fn redirect(&mut self, path: &str) { if let Ok(path) = HeaderValue::from_str(path) { self.headers_mut().insert(header::LOCATION, path); *self.status_mut() = StatusCode::FOUND; } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/response/browser.rs
server_fn/src/response/browser.rs
use super::ClientRes; use crate::{ error::{FromServerFnError, IntoAppError, ServerFnErrorErr}, redirect::REDIRECT_HEADER, }; use bytes::Bytes; use futures::{Stream, StreamExt}; pub use gloo_net::http::Response; use http::{HeaderMap, HeaderName, HeaderValue}; use js_sys::Uint8Array; use send_wrapper::SendWrapper; use std::{future::Future, str::FromStr}; use wasm_bindgen::JsCast; use wasm_streams::ReadableStream; /// The response to a `fetch` request made in the browser. pub struct BrowserResponse(pub(crate) SendWrapper<Response>); impl BrowserResponse { /// Generate the headers from the internal [`Response`] object. /// This is a workaround for the fact that the `Response` object does not /// have a [`HeaderMap`] directly. This function will iterate over the /// headers and convert them to a [`HeaderMap`]. pub fn generate_headers(&self) -> HeaderMap { self.0 .headers() .entries() .filter_map(|(key, value)| { let key = HeaderName::from_str(&key).ok()?; let value = HeaderValue::from_str(&value).ok()?; Some((key, value)) }) .collect() } } impl<E: FromServerFnError> ClientRes<E> for BrowserResponse { fn try_into_string(self) -> impl Future<Output = Result<String, E>> + Send { // the browser won't send this async work between threads (because it's single-threaded) // so we can safely wrap this SendWrapper::new(async move { self.0.text().await.map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()) .into_app_error() }) }) } fn try_into_bytes(self) -> impl Future<Output = Result<Bytes, E>> + Send { // the browser won't send this async work between threads (because it's single-threaded) // so we can safely wrap this SendWrapper::new(async move { self.0.binary().await.map(Bytes::from).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()) .into_app_error() }) }) } fn try_into_stream( self, ) -> Result<impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, E> { let stream = ReadableStream::from_raw(self.0.body().unwrap()) .into_stream() .map(|data| match data { Err(e) => { web_sys::console::error_1(&e); Err(E::from_server_fn_error(ServerFnErrorErr::Request( format!("{e:?}"), )) .ser()) } Ok(data) => { let data = data.unchecked_into::<Uint8Array>(); let mut buf = Vec::new(); let length = data.length(); buf.resize(length as usize, 0); data.copy_to(&mut buf); Ok(Bytes::from(buf)) } }); Ok(SendWrapper::new(stream)) } fn status(&self) -> u16 { self.0.status() } fn status_text(&self) -> String { self.0.status_text() } fn location(&self) -> String { self.0 .headers() .get("Location") .unwrap_or_else(|| self.0.url()) } fn has_redirect(&self) -> bool { self.0.headers().get(REDIRECT_HEADER).is_some() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/response/reqwest.rs
server_fn/src/response/reqwest.rs
use super::ClientRes; use crate::error::{FromServerFnError, IntoAppError, ServerFnErrorErr}; use bytes::Bytes; use futures::{Stream, TryStreamExt}; use reqwest::Response; impl<E: FromServerFnError> ClientRes<E> for Response { async fn try_into_string(self) -> Result<String, E> { self.text().await.map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into_app_error() }) } async fn try_into_bytes(self) -> Result<Bytes, E> { self.bytes().await.map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into_app_error() }) } fn try_into_stream( self, ) -> Result<impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, E> { Ok(self.bytes_stream().map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Response(e.to_string())) .ser() })) } fn status(&self) -> u16 { self.status().as_u16() } fn status_text(&self) -> String { self.status().to_string() } fn location(&self) -> String { self.headers() .get("Location") .map(|value| String::from_utf8_lossy(value.as_bytes()).to_string()) .unwrap_or_else(|| self.url().to_string()) } fn has_redirect(&self) -> bool { self.headers().get("Location").is_some() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/response/mod.rs
server_fn/src/response/mod.rs
/// Response types for Actix. #[cfg(feature = "actix-no-default")] pub mod actix; /// Response types for the browser. #[cfg(feature = "browser")] pub mod browser; #[cfg(feature = "generic")] pub mod generic; /// Response types for Axum. #[cfg(feature = "axum-no-default")] pub mod http; /// Response types for [`reqwest`]. #[cfg(feature = "reqwest")] pub mod reqwest; use bytes::Bytes; use futures::Stream; use std::future::Future; /// Represents the response as created by the server; pub trait TryRes<E> where Self: Sized, { /// Attempts to convert a UTF-8 string into an HTTP response. fn try_from_string(content_type: &str, data: String) -> Result<Self, E>; /// Attempts to convert a binary blob represented as bytes into an HTTP response. fn try_from_bytes(content_type: &str, data: Bytes) -> Result<Self, E>; /// Attempts to convert a stream of bytes into an HTTP response. fn try_from_stream( content_type: &str, data: impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, ) -> Result<Self, E>; } /// Represents the response as created by the server; pub trait Res { /// Converts an error into a response, with a `500` status code and the error as its body. fn error_response(path: &str, err: Bytes) -> Self; /// Set the `Content-Type` header for the response. fn content_type(&mut self, #[allow(unused_variables)] content_type: &str) { // TODO 0.9: remove this method and default implementation. It is only included here // to allow setting the `Content-Type` header for error responses without requiring a // semver-incompatible change. } /// Redirect the response by setting a 302 code and Location header. fn redirect(&mut self, path: &str); } /// Represents the response as received by the client. pub trait ClientRes<E> { /// Attempts to extract a UTF-8 string from an HTTP response. fn try_into_string(self) -> impl Future<Output = Result<String, E>> + Send; /// Attempts to extract a binary blob from an HTTP response. fn try_into_bytes(self) -> impl Future<Output = Result<Bytes, E>> + Send; /// Attempts to extract a binary stream from an HTTP response. fn try_into_stream( self, ) -> Result< impl Stream<Item = Result<Bytes, Bytes>> + Send + Sync + 'static, E, >; /// HTTP status code of the response. fn status(&self) -> u16; /// Status text for the status code. fn status_text(&self) -> String; /// The `Location` header or (if none is set), the URL of the response. fn location(&self) -> String; /// Whether the response has the [`REDIRECT_HEADER`](crate::redirect::REDIRECT_HEADER) set. fn has_redirect(&self) -> bool; } /// A mocked response type that can be used in place of the actual server response, /// when compiling for the browser. /// /// ## Panics /// This always panics if its methods are called. It is used solely to stub out the /// server response type when compiling for the client. pub struct BrowserMockRes; impl<E> TryRes<E> for BrowserMockRes { fn try_from_string(_content_type: &str, _data: String) -> Result<Self, E> { unreachable!() } fn try_from_bytes(_content_type: &str, _data: Bytes) -> Result<Self, E> { unreachable!() } fn try_from_stream( _content_type: &str, _data: impl Stream<Item = Result<Bytes, Bytes>>, ) -> Result<Self, E> { unreachable!() } } impl Res for BrowserMockRes { fn error_response(_path: &str, _err: Bytes) -> Self { unreachable!() } fn content_type(&mut self, _content_type: &str) { unreachable!() } fn redirect(&mut self, _path: &str) { unreachable!() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/response/generic.rs
server_fn/src/response/generic.rs
//! This module uses platform-agnostic abstractions //! allowing users to run server functions on a wide range of //! platforms. //! //! The crates in use in this crate are: //! //! * `bytes`: platform-agnostic manipulation of bytes. //! * `http`: low-dependency HTTP abstractions' *front-end*. //! //! # Users //! //! * `wasm32-wasip*` integration crate `leptos_wasi` is using this //! crate under the hood. use super::{Res, TryRes}; use crate::error::{ FromServerFnError, IntoAppError, ServerFnErrorErr, ServerFnErrorWrapper, SERVER_FN_ERROR_HEADER, }; use bytes::Bytes; use futures::{Stream, TryStreamExt}; use http::{header, HeaderValue, Response, StatusCode}; use std::pin::Pin; use throw_error::Error; /// The Body of a Response whose *execution model* can be /// customised using the variants. pub enum Body { /// The response body will be written synchronously. Sync(Bytes), /// The response body will be written asynchronously, /// this execution model is also known as /// "streaming". Async(Pin<Box<dyn Stream<Item = Result<Bytes, Error>> + Send + 'static>>), } impl From<String> for Body { fn from(value: String) -> Self { Body::Sync(Bytes::from(value)) } } impl From<Bytes> for Body { fn from(value: Bytes) -> Self { Body::Sync(value) } } impl<E> TryRes<E> for Response<Body> where E: Send + Sync + FromServerFnError, { fn try_from_string(content_type: &str, data: String) -> Result<Self, E> { let builder = http::Response::builder(); builder .status(200) .header(http::header::CONTENT_TYPE, content_type) .body(data.into()) .map_err(|e| { ServerFnErrorErr::Response(e.to_string()).into_app_error() }) } fn try_from_bytes(content_type: &str, data: Bytes) -> Result<Self, E> { let builder = http::Response::builder(); builder .status(200) .header(http::header::CONTENT_TYPE, content_type) .body(Body::Sync(data)) .map_err(|e| { ServerFnErrorErr::Response(e.to_string()).into_app_error() }) } fn try_from_stream( content_type: &str, data: impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, ) -> Result<Self, E> { let builder = http::Response::builder(); builder .status(200) .header(http::header::CONTENT_TYPE, content_type) .body(Body::Async(Box::pin( data.map_err(|e| ServerFnErrorWrapper(E::de(e))) .map_err(Error::from), ))) .map_err(|e| { ServerFnErrorErr::Response(e.to_string()).into_app_error() }) } } impl Res for Response<Body> { fn error_response(path: &str, err: Bytes) -> Self { Response::builder() .status(http::StatusCode::INTERNAL_SERVER_ERROR) .header(SERVER_FN_ERROR_HEADER, path) .body(err.into()) .unwrap() } fn content_type(&mut self, content_type: &str) { if let Ok(content_type) = HeaderValue::from_str(content_type) { self.headers_mut() .insert(header::CONTENT_TYPE, content_type); } } fn redirect(&mut self, path: &str) { if let Ok(path) = HeaderValue::from_str(path) { self.headers_mut().insert(header::LOCATION, path); *self.status_mut() = StatusCode::FOUND; } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/request/actix.rs
server_fn/src/request/actix.rs
use crate::{ error::{FromServerFnError, IntoAppError, ServerFnErrorErr}, request::Req, response::actix::ActixResponse, }; use actix_web::{web::Payload, HttpRequest}; use actix_ws::Message; use bytes::Bytes; use futures::{FutureExt, Stream, StreamExt}; use send_wrapper::SendWrapper; use std::{borrow::Cow, future::Future}; /// A wrapped Actix request. /// /// This uses a [`SendWrapper`] that allows the Actix `HttpRequest` type to be `Send`, but panics /// if it it is ever sent to another thread. Actix pins request handling to a single thread, so this /// is necessary to be compatible with traits that require `Send` but should never panic in actual use. pub struct ActixRequest(pub(crate) SendWrapper<(HttpRequest, Payload)>); impl ActixRequest { /// Returns the raw Actix request, and its body. pub fn take(self) -> (HttpRequest, Payload) { self.0.take() } fn header(&self, name: &str) -> Option<Cow<'_, str>> { self.0 .0 .headers() .get(name) .map(|h| String::from_utf8_lossy(h.as_bytes())) } } impl From<(HttpRequest, Payload)> for ActixRequest { fn from(value: (HttpRequest, Payload)) -> Self { ActixRequest(SendWrapper::new(value)) } } impl<Error, InputStreamError, OutputStreamError> Req<Error, InputStreamError, OutputStreamError> for ActixRequest where Error: FromServerFnError + Send, InputStreamError: FromServerFnError + Send, OutputStreamError: FromServerFnError + Send, { type WebsocketResponse = ActixResponse; fn as_query(&self) -> Option<&str> { self.0 .0.uri().query() } fn to_content_type(&self) -> Option<Cow<'_, str>> { self.header("Content-Type") } fn accepts(&self) -> Option<Cow<'_, str>> { self.header("Accept") } fn referer(&self) -> Option<Cow<'_, str>> { self.header("Referer") } fn try_into_bytes( self, ) -> impl Future<Output = Result<Bytes, Error>> + Send { // Actix is going to keep this on a single thread anyway so it's fine to wrap it // with SendWrapper, which makes it `Send` but will panic if it moves to another thread SendWrapper::new(async move { let payload = self.0.take().1; payload.to_bytes().await.map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()) .into_app_error() }) }) } fn try_into_string( self, ) -> impl Future<Output = Result<String, Error>> + Send { // Actix is going to keep this on a single thread anyway so it's fine to wrap it // with SendWrapper, which makes it `Send` but will panic if it moves to another thread SendWrapper::new(async move { let payload = self.0.take().1; let bytes = payload.to_bytes().await.map_err(|e| { Error::from_server_fn_error(ServerFnErrorErr::Deserialization( e.to_string(), )) })?; String::from_utf8(bytes.into()).map_err(|e| { Error::from_server_fn_error(ServerFnErrorErr::Deserialization( e.to_string(), )) }) }) } fn try_into_stream( self, ) -> Result<impl Stream<Item = Result<Bytes, Bytes>> + Send, Error> { let payload = self.0.take().1; let stream = payload.map(|res| { res.map_err(|e| { Error::from_server_fn_error(ServerFnErrorErr::Deserialization( e.to_string(), )) .ser() }) }); Ok(SendWrapper::new(stream)) } async fn try_into_websocket( self, ) -> Result< ( impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, impl futures::Sink<Bytes> + Send + 'static, Self::WebsocketResponse, ), Error, > { let (request, payload) = self.0.take(); let (response, mut session, mut msg_stream) = actix_ws::handle(&request, payload).map_err(|e| { Error::from_server_fn_error(ServerFnErrorErr::Request( e.to_string(), )) })?; let (mut response_stream_tx, response_stream_rx) = futures::channel::mpsc::channel(2048); let (response_sink_tx, mut response_sink_rx) = futures::channel::mpsc::channel::<Bytes>(2048); actix_web::rt::spawn(async move { loop { futures::select! { incoming = response_sink_rx.next() => { let Some(incoming) = incoming else { break; }; if let Err(err) = session.binary(incoming).await { _ = response_stream_tx.start_send(Err(InputStreamError::from_server_fn_error(ServerFnErrorErr::Request(err.to_string())).ser())); } }, outgoing = msg_stream.next().fuse() => { let Some(outgoing) = outgoing else { break; }; match outgoing { Ok(Message::Ping(bytes)) => { if session.pong(&bytes).await.is_err() { break; } } Ok(Message::Binary(bytes)) => { _ = response_stream_tx .start_send( Ok(bytes), ); } Ok(Message::Text(text)) => { _ = response_stream_tx.start_send(Ok(text.into_bytes())); } Ok(Message::Close(_)) => { break; } Ok(_other) => { } Err(e) => { _ = response_stream_tx.start_send(Err(InputStreamError::from_server_fn_error(ServerFnErrorErr::Response(e.to_string())).ser())); } } } } } let _ = session.close(None).await; }); Ok(( response_stream_rx, response_sink_tx, ActixResponse::from(response), )) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/request/axum.rs
server_fn/src/request/axum.rs
use crate::{ error::{FromServerFnError, IntoAppError, ServerFnErrorErr}, request::Req, }; use axum::{ body::{Body, Bytes}, response::Response, }; use futures::{Sink, Stream, StreamExt}; use http::{ header::{ACCEPT, CONTENT_TYPE, REFERER}, Request, }; use http_body_util::BodyExt; use std::borrow::Cow; impl<Error, InputStreamError, OutputStreamError> Req<Error, InputStreamError, OutputStreamError> for Request<Body> where Error: FromServerFnError + Send, InputStreamError: FromServerFnError + Send, OutputStreamError: FromServerFnError + Send, { type WebsocketResponse = Response; fn as_query(&self) -> Option<&str> { self.uri().query() } fn to_content_type(&self) -> Option<Cow<'_, str>> { self.headers() .get(CONTENT_TYPE) .map(|h| String::from_utf8_lossy(h.as_bytes())) } fn accepts(&self) -> Option<Cow<'_, str>> { self.headers() .get(ACCEPT) .map(|h| String::from_utf8_lossy(h.as_bytes())) } fn referer(&self) -> Option<Cow<'_, str>> { self.headers() .get(REFERER) .map(|h| String::from_utf8_lossy(h.as_bytes())) } async fn try_into_bytes(self) -> Result<Bytes, Error> { let (_parts, body) = self.into_parts(); body.collect().await.map(|c| c.to_bytes()).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into_app_error() }) } async fn try_into_string(self) -> Result<String, Error> { let bytes = Req::<Error>::try_into_bytes(self).await?; String::from_utf8(bytes.to_vec()).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into_app_error() }) } fn try_into_stream( self, ) -> Result<impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, Error> { Ok(self.into_body().into_data_stream().map(|chunk| { chunk.map_err(|e| { Error::from_server_fn_error(ServerFnErrorErr::Deserialization( e.to_string(), )) .ser() }) })) } async fn try_into_websocket( self, ) -> Result< ( impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, impl Sink<Bytes> + Send + 'static, Self::WebsocketResponse, ), Error, > { #[cfg(not(feature = "axum"))] { Err::< ( futures::stream::Once< std::future::Ready<Result<Bytes, Bytes>>, >, futures::sink::Drain<Bytes>, Self::WebsocketResponse, ), Error, >(Error::from_server_fn_error( crate::ServerFnErrorErr::Response( "Websocket connections not supported for Axum when the \ `axum` feature is not enabled on the `server_fn` crate." .to_string(), ), )) } #[cfg(feature = "axum")] { use axum::extract::{ws::Message, FromRequest}; use futures::FutureExt; let upgrade = axum::extract::ws::WebSocketUpgrade::from_request(self, &()) .await .map_err(|err| { Error::from_server_fn_error(ServerFnErrorErr::Request( err.to_string(), )) })?; let (mut outgoing_tx, outgoing_rx) = futures::channel::mpsc::channel::<Result<Bytes, Bytes>>(2048); let (incoming_tx, mut incoming_rx) = futures::channel::mpsc::channel::<Bytes>(2048); let response = upgrade .on_failed_upgrade({ let mut outgoing_tx = outgoing_tx.clone(); move |err: axum::Error| { _ = outgoing_tx.start_send(Err(InputStreamError::from_server_fn_error(ServerFnErrorErr::Response(err.to_string())).ser())); } }) .on_upgrade(|mut session| async move { loop { futures::select! { incoming = incoming_rx.next() => { let Some(incoming) = incoming else { break; }; if let Err(err) = session.send(Message::Binary(incoming)).await { _ = outgoing_tx.start_send(Err(InputStreamError::from_server_fn_error(ServerFnErrorErr::Request(err.to_string())).ser())); } }, outgoing = session.recv().fuse() => { let Some(outgoing) = outgoing else { break; }; match outgoing { Ok(Message::Binary(bytes)) => { _ = outgoing_tx .start_send( Ok(bytes), ); } Ok(Message::Text(text)) => { _ = outgoing_tx.start_send(Ok(Bytes::from(text))); } Ok(Message::Ping(bytes)) => { if session.send(Message::Pong(bytes)).await.is_err() { break; } } Ok(_other) => {} Err(e) => { _ = outgoing_tx.start_send(Err(InputStreamError::from_server_fn_error(ServerFnErrorErr::Response(e.to_string())).ser())); } } } } } _ = session.send(Message::Close(None)).await; }); Ok((outgoing_rx, incoming_tx, response)) } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/request/browser.rs
server_fn/src/request/browser.rs
use super::ClientReq; use crate::{ client::get_server_url, error::{FromServerFnError, ServerFnErrorErr}, }; use bytes::Bytes; use futures::{Stream, StreamExt}; pub use gloo_net::http::Request; use http::Method; use js_sys::{Reflect, Uint8Array}; use send_wrapper::SendWrapper; use std::ops::{Deref, DerefMut}; use wasm_bindgen::JsValue; use wasm_streams::ReadableStream; use web_sys::{ AbortController, AbortSignal, FormData, Headers, RequestInit, UrlSearchParams, }; /// A `fetch` request made in the browser. #[derive(Debug)] pub struct BrowserRequest(pub(crate) SendWrapper<RequestInner>); #[derive(Debug)] pub(crate) struct RequestInner { pub(crate) request: Request, pub(crate) abort_ctrl: Option<AbortOnDrop>, } #[derive(Debug)] pub(crate) struct AbortOnDrop(Option<AbortController>); impl AbortOnDrop { /// Prevents the request from being aborted on drop. pub fn prevent_cancellation(&mut self) { self.0.take(); } } impl Drop for AbortOnDrop { fn drop(&mut self) { if let Some(inner) = self.0.take() { inner.abort(); } } } impl From<BrowserRequest> for Request { fn from(value: BrowserRequest) -> Self { value.0.take().request } } impl From<BrowserRequest> for web_sys::Request { fn from(value: BrowserRequest) -> Self { value.0.take().request.into() } } impl Deref for BrowserRequest { type Target = Request; fn deref(&self) -> &Self::Target { &self.0.deref().request } } impl DerefMut for BrowserRequest { fn deref_mut(&mut self) -> &mut Self::Target { &mut self.0.deref_mut().request } } /// The `FormData` type available in the browser. #[derive(Debug)] pub struct BrowserFormData(pub(crate) SendWrapper<FormData>); impl BrowserFormData { /// Returns the raw `web_sys::FormData` struct. pub fn take(self) -> FormData { self.0.take() } } impl From<FormData> for BrowserFormData { fn from(value: FormData) -> Self { Self(SendWrapper::new(value)) } } fn abort_signal() -> (Option<AbortOnDrop>, Option<AbortSignal>) { let ctrl = AbortController::new().ok(); let signal = ctrl.as_ref().map(|ctrl| ctrl.signal()); (ctrl.map(|ctrl| AbortOnDrop(Some(ctrl))), signal) } impl<E> ClientReq<E> for BrowserRequest where E: FromServerFnError, { type FormData = BrowserFormData; fn try_new_req_query( path: &str, content_type: &str, accepts: &str, query: &str, method: http::Method, ) -> Result<Self, E> { let (abort_ctrl, abort_signal) = abort_signal(); let server_url = get_server_url(); let mut url = String::with_capacity( server_url.len() + path.len() + 1 + query.len(), ); url.push_str(server_url); url.push_str(path); url.push('?'); url.push_str(query); Ok(Self(SendWrapper::new(RequestInner { request: match method { Method::GET => Request::get(&url), Method::DELETE => Request::delete(&url), Method::POST => Request::post(&url), Method::PUT => Request::put(&url), Method::PATCH => Request::patch(&url), m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod( m.to_string(), ), )) } } .header("Content-Type", content_type) .header("Accept", accepts) .abort_signal(abort_signal.as_ref()) .build() .map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Request( e.to_string(), )) })?, abort_ctrl, }))) } fn try_new_req_text( path: &str, content_type: &str, accepts: &str, body: String, method: Method, ) -> Result<Self, E> { let (abort_ctrl, abort_signal) = abort_signal(); let server_url = get_server_url(); let mut url = String::with_capacity(server_url.len() + path.len()); url.push_str(server_url); url.push_str(path); Ok(Self(SendWrapper::new(RequestInner { request: match method { Method::POST => Request::post(&url), Method::PATCH => Request::patch(&url), Method::PUT => Request::put(&url), m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod( m.to_string(), ), )) } } .header("Content-Type", content_type) .header("Accept", accepts) .abort_signal(abort_signal.as_ref()) .body(body) .map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Request( e.to_string(), )) })?, abort_ctrl, }))) } fn try_new_req_bytes( path: &str, content_type: &str, accepts: &str, body: Bytes, method: Method, ) -> Result<Self, E> { let (abort_ctrl, abort_signal) = abort_signal(); let server_url = get_server_url(); let mut url = String::with_capacity(server_url.len() + path.len()); url.push_str(server_url); url.push_str(path); let body: &[u8] = &body; let body = Uint8Array::from(body).buffer(); Ok(Self(SendWrapper::new(RequestInner { request: match method { Method::POST => Request::post(&url), Method::PATCH => Request::patch(&url), Method::PUT => Request::put(&url), m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod( m.to_string(), ), )) } } .header("Content-Type", content_type) .header("Accept", accepts) .abort_signal(abort_signal.as_ref()) .body(body) .map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Request( e.to_string(), )) })?, abort_ctrl, }))) } fn try_new_req_multipart( path: &str, accepts: &str, body: Self::FormData, method: Method, ) -> Result<Self, E> { let (abort_ctrl, abort_signal) = abort_signal(); let server_url = get_server_url(); let mut url = String::with_capacity(server_url.len() + path.len()); url.push_str(server_url); url.push_str(path); Ok(Self(SendWrapper::new(RequestInner { request: match method { Method::POST => Request::post(&url), Method::PATCH => Request::patch(&url), Method::PUT => Request::put(&url), m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod( m.to_string(), ), )) } } .header("Accept", accepts) .abort_signal(abort_signal.as_ref()) .body(body.0.take()) .map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Request( e.to_string(), )) })?, abort_ctrl, }))) } fn try_new_req_form_data( path: &str, accepts: &str, content_type: &str, body: Self::FormData, method: Method, ) -> Result<Self, E> { let (abort_ctrl, abort_signal) = abort_signal(); let form_data = body.0.take(); let url_params = UrlSearchParams::new_with_str_sequence_sequence(&form_data) .map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Serialization( e.as_string().unwrap_or_else(|| { "Could not serialize FormData to URLSearchParams" .to_string() }), )) })?; Ok(Self(SendWrapper::new(RequestInner { request: match method { Method::POST => Request::post(path), Method::PUT => Request::put(path), Method::PATCH => Request::patch(path), m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod( m.to_string(), ), )) } } .header("Content-Type", content_type) .header("Accept", accepts) .abort_signal(abort_signal.as_ref()) .body(url_params) .map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Request( e.to_string(), )) })?, abort_ctrl, }))) } fn try_new_req_streaming( path: &str, accepts: &str, content_type: &str, body: impl Stream<Item = Bytes> + 'static, method: Method, ) -> Result<Self, E> { // Only allow for methods with bodies match method { Method::POST | Method::PATCH | Method::PUT => {} m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod(m.to_string()), )) } } // TODO abort signal let (request, abort_ctrl) = streaming_request(path, accepts, content_type, body, method) .map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Request(format!( "{e:?}" ))) })?; Ok(Self(SendWrapper::new(RequestInner { request, abort_ctrl, }))) } } fn streaming_request( path: &str, accepts: &str, content_type: &str, body: impl Stream<Item = Bytes> + 'static, method: Method, ) -> Result<(Request, Option<AbortOnDrop>), JsValue> { let (abort_ctrl, abort_signal) = abort_signal(); let stream = ReadableStream::from_stream(body.map(|bytes| { let data = Uint8Array::from(bytes.as_ref()); let data = JsValue::from(data); Ok(data) as Result<JsValue, JsValue> })) .into_raw(); let headers = Headers::new()?; headers.append("Content-Type", content_type)?; headers.append("Accept", accepts)?; let init = RequestInit::new(); init.set_headers(&headers); init.set_method(method.as_str()); init.set_signal(abort_signal.as_ref()); init.set_body(&stream); // Chrome requires setting `duplex: "half"` on streaming requests Reflect::set( &init, &JsValue::from_str("duplex"), &JsValue::from_str("half"), )?; let req = web_sys::Request::new_with_str_and_init(path, &init)?; Ok((Request::from(req), abort_ctrl)) }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/request/reqwest.rs
server_fn/src/request/reqwest.rs
use super::ClientReq; use crate::{ client::get_server_url, error::{FromServerFnError, IntoAppError, ServerFnErrorErr}, }; use bytes::Bytes; use futures::{Stream, StreamExt}; use reqwest::{ header::{ACCEPT, CONTENT_TYPE}, Body, }; pub use reqwest::{multipart::Form, Client, Method, Request, Url}; use std::sync::LazyLock; pub(crate) static CLIENT: LazyLock<Client> = LazyLock::new(Client::new); impl<E> ClientReq<E> for Request where E: FromServerFnError, { type FormData = Form; fn try_new_req_query( path: &str, content_type: &str, accepts: &str, query: &str, method: Method, ) -> Result<Self, E> { let url = format!("{}{}", get_server_url(), path); let mut url = Url::try_from(url.as_str()).map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Request(e.to_string())) })?; url.set_query(Some(query)); let req = match method { Method::GET => CLIENT.get(url), Method::DELETE => CLIENT.delete(url), Method::HEAD => CLIENT.head(url), Method::POST => CLIENT.post(url), Method::PATCH => CLIENT.patch(url), Method::PUT => CLIENT.put(url), m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod(m.to_string()), )) } } .header(CONTENT_TYPE, content_type) .header(ACCEPT, accepts) .build() .map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Request(e.to_string())) })?; Ok(req) } fn try_new_req_text( path: &str, content_type: &str, accepts: &str, body: String, method: Method, ) -> Result<Self, E> { let url = format!("{}{}", get_server_url(), path); match method { Method::POST => CLIENT.post(url), Method::PUT => CLIENT.put(url), Method::PATCH => CLIENT.patch(url), m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod(m.to_string()), )) } } .header(CONTENT_TYPE, content_type) .header(ACCEPT, accepts) .body(body) .build() .map_err(|e| ServerFnErrorErr::Request(e.to_string()).into_app_error()) } fn try_new_req_bytes( path: &str, content_type: &str, accepts: &str, body: Bytes, method: Method, ) -> Result<Self, E> { let url = format!("{}{}", get_server_url(), path); match method { Method::POST => CLIENT.post(url), Method::PATCH => CLIENT.patch(url), Method::PUT => CLIENT.put(url), m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod(m.to_string()), )) } } .header(CONTENT_TYPE, content_type) .header(ACCEPT, accepts) .body(body) .build() .map_err(|e| ServerFnErrorErr::Request(e.to_string()).into_app_error()) } fn try_new_req_multipart( path: &str, accepts: &str, body: Self::FormData, method: Method, ) -> Result<Self, E> { match method { Method::POST => CLIENT.post(path), Method::PUT => CLIENT.put(path), Method::PATCH => CLIENT.patch(path), m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod(m.to_string()), )) } } .header(ACCEPT, accepts) .multipart(body) .build() .map_err(|e| ServerFnErrorErr::Request(e.to_string()).into_app_error()) } fn try_new_req_form_data( path: &str, accepts: &str, content_type: &str, body: Self::FormData, method: Method, ) -> Result<Self, E> { match method { Method::POST => CLIENT.post(path), Method::PATCH => CLIENT.patch(path), Method::PUT => CLIENT.put(path), m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod(m.to_string()), )) } } .header(CONTENT_TYPE, content_type) .header(ACCEPT, accepts) .multipart(body) .build() .map_err(|e| ServerFnErrorErr::Request(e.to_string()).into_app_error()) } fn try_new_req_streaming( path: &str, accepts: &str, content_type: &str, body: impl Stream<Item = Bytes> + Send + 'static, method: Method, ) -> Result<Self, E> { let url = format!("{}{}", get_server_url(), path); let body = Body::wrap_stream( body.map(|chunk| Ok(chunk) as Result<Bytes, ServerFnErrorErr>), ); match method { Method::POST => CLIENT.post(url), Method::PUT => CLIENT.put(url), Method::PATCH => CLIENT.patch(url), m => { return Err(E::from_server_fn_error( ServerFnErrorErr::UnsupportedRequestMethod(m.to_string()), )) } } .header(CONTENT_TYPE, content_type) .header(ACCEPT, accepts) .body(body) .build() .map_err(|e| ServerFnErrorErr::Request(e.to_string()).into_app_error()) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/request/mod.rs
server_fn/src/request/mod.rs
use bytes::Bytes; use futures::{Sink, Stream}; use http::Method; use std::{borrow::Cow, future::Future}; /// Request types for Actix. #[cfg(feature = "actix-no-default")] pub mod actix; /// Request types for Axum. #[cfg(feature = "axum-no-default")] pub mod axum; /// Request types for the browser. #[cfg(feature = "browser")] pub mod browser; #[cfg(feature = "generic")] pub mod generic; /// Request types for [`reqwest`]. #[cfg(feature = "reqwest")] pub mod reqwest; /// Represents a request as made by the client. pub trait ClientReq<E> where Self: Sized, { /// The type used for URL-encoded form data in this client. type FormData; /// Attempts to construct a new request with query parameters. fn try_new_req_query( path: &str, content_type: &str, accepts: &str, query: &str, method: Method, ) -> Result<Self, E>; /// Attempts to construct a new request with a text body. fn try_new_req_text( path: &str, content_type: &str, accepts: &str, body: String, method: Method, ) -> Result<Self, E>; /// Attempts to construct a new request with a binary body. fn try_new_req_bytes( path: &str, content_type: &str, accepts: &str, body: Bytes, method: Method, ) -> Result<Self, E>; /// Attempts to construct a new request with form data as the body. fn try_new_req_form_data( path: &str, accepts: &str, content_type: &str, body: Self::FormData, method: Method, ) -> Result<Self, E>; /// Attempts to construct a new request with a multipart body. fn try_new_req_multipart( path: &str, accepts: &str, body: Self::FormData, method: Method, ) -> Result<Self, E>; /// Attempts to construct a new request with a streaming body. fn try_new_req_streaming( path: &str, accepts: &str, content_type: &str, body: impl Stream<Item = Bytes> + Send + 'static, method: Method, ) -> Result<Self, E>; /// Attempts to construct a new `GET` request. fn try_new_get( path: &str, content_type: &str, accepts: &str, query: &str, ) -> Result<Self, E> { Self::try_new_req_query(path, content_type, accepts, query, Method::GET) } /// Attempts to construct a new `DELETE` request. /// **Note**: Browser support for `DELETE` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. fn try_new_delete( path: &str, content_type: &str, accepts: &str, query: &str, ) -> Result<Self, E> { Self::try_new_req_query( path, content_type, accepts, query, Method::DELETE, ) } /// Attempts to construct a new `POST` request with a text body. fn try_new_post( path: &str, content_type: &str, accepts: &str, body: String, ) -> Result<Self, E> { Self::try_new_req_text(path, content_type, accepts, body, Method::POST) } /// Attempts to construct a new `PATCH` request with a text body. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. fn try_new_patch( path: &str, content_type: &str, accepts: &str, body: String, ) -> Result<Self, E> { Self::try_new_req_text(path, content_type, accepts, body, Method::PATCH) } /// Attempts to construct a new `PUT` request with a text body. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. fn try_new_put( path: &str, content_type: &str, accepts: &str, body: String, ) -> Result<Self, E> { Self::try_new_req_text(path, content_type, accepts, body, Method::PUT) } /// Attempts to construct a new `POST` request with a binary body. fn try_new_post_bytes( path: &str, content_type: &str, accepts: &str, body: Bytes, ) -> Result<Self, E> { Self::try_new_req_bytes(path, content_type, accepts, body, Method::POST) } /// Attempts to construct a new `PATCH` request with a binary body. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. fn try_new_patch_bytes( path: &str, content_type: &str, accepts: &str, body: Bytes, ) -> Result<Self, E> { Self::try_new_req_bytes( path, content_type, accepts, body, Method::PATCH, ) } /// Attempts to construct a new `PUT` request with a binary body. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. fn try_new_put_bytes( path: &str, content_type: &str, accepts: &str, body: Bytes, ) -> Result<Self, E> { Self::try_new_req_bytes(path, content_type, accepts, body, Method::PUT) } /// Attempts to construct a new `POST` request with form data as the body. fn try_new_post_form_data( path: &str, accepts: &str, content_type: &str, body: Self::FormData, ) -> Result<Self, E> { Self::try_new_req_form_data( path, accepts, content_type, body, Method::POST, ) } /// Attempts to construct a new `PATCH` request with form data as the body. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. fn try_new_patch_form_data( path: &str, accepts: &str, content_type: &str, body: Self::FormData, ) -> Result<Self, E> { Self::try_new_req_form_data( path, accepts, content_type, body, Method::PATCH, ) } /// Attempts to construct a new `PUT` request with form data as the body. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. fn try_new_put_form_data( path: &str, accepts: &str, content_type: &str, body: Self::FormData, ) -> Result<Self, E> { Self::try_new_req_form_data( path, accepts, content_type, body, Method::PUT, ) } /// Attempts to construct a new `POST` request with a multipart body. fn try_new_post_multipart( path: &str, accepts: &str, body: Self::FormData, ) -> Result<Self, E> { Self::try_new_req_multipart(path, accepts, body, Method::POST) } /// Attempts to construct a new `PATCH` request with a multipart body. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. fn try_new_patch_multipart( path: &str, accepts: &str, body: Self::FormData, ) -> Result<Self, E> { Self::try_new_req_multipart(path, accepts, body, Method::PATCH) } /// Attempts to construct a new `PUT` request with a multipart body. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. fn try_new_put_multipart( path: &str, accepts: &str, body: Self::FormData, ) -> Result<Self, E> { Self::try_new_req_multipart(path, accepts, body, Method::PUT) } /// Attempts to construct a new `POST` request with a streaming body. fn try_new_post_streaming( path: &str, accepts: &str, content_type: &str, body: impl Stream<Item = Bytes> + Send + 'static, ) -> Result<Self, E> { Self::try_new_req_streaming( path, accepts, content_type, body, Method::POST, ) } /// Attempts to construct a new `PATCH` request with a streaming body. /// **Note**: Browser support for `PATCH` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. fn try_new_patch_streaming( path: &str, accepts: &str, content_type: &str, body: impl Stream<Item = Bytes> + Send + 'static, ) -> Result<Self, E> { Self::try_new_req_streaming( path, accepts, content_type, body, Method::PATCH, ) } /// Attempts to construct a new `PUT` request with a streaming body. /// **Note**: Browser support for `PUT` requests without JS/WASM may be poor. /// Consider using a `POST` request if functionality without JS/WASM is required. fn try_new_put_streaming( path: &str, accepts: &str, content_type: &str, body: impl Stream<Item = Bytes> + Send + 'static, ) -> Result<Self, E> { Self::try_new_req_streaming( path, accepts, content_type, body, Method::PUT, ) } } /// Represents the request as received by the server. pub trait Req<Error, InputStreamError = Error, OutputStreamError = Error> where Self: Sized, { /// The response type for websockets. type WebsocketResponse: Send; /// Returns the query string of the request’s URL, starting after the `?`. fn as_query(&self) -> Option<&str>; /// Returns the `Content-Type` header, if any. fn to_content_type(&self) -> Option<Cow<'_, str>>; /// Returns the `Accepts` header, if any. fn accepts(&self) -> Option<Cow<'_, str>>; /// Returns the `Referer` header, if any. fn referer(&self) -> Option<Cow<'_, str>>; /// Attempts to extract the body of the request into [`Bytes`]. fn try_into_bytes( self, ) -> impl Future<Output = Result<Bytes, Error>> + Send; /// Attempts to convert the body of the request into a string. fn try_into_string( self, ) -> impl Future<Output = Result<String, Error>> + Send; /// Attempts to convert the body of the request into a stream of bytes. fn try_into_stream( self, ) -> Result<impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, Error>; /// Attempts to convert the body of the request into a websocket handle. #[allow(clippy::type_complexity)] fn try_into_websocket( self, ) -> impl Future< Output = Result< ( impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, impl Sink<Bytes> + Send + 'static, Self::WebsocketResponse, ), Error, >, > + Send; } /// A mocked request type that can be used in place of the actual server request, /// when compiling for the browser. pub struct BrowserMockReq; impl<Error, InputStreamError, OutputStreamError> Req<Error, InputStreamError, OutputStreamError> for BrowserMockReq where Error: Send + 'static, InputStreamError: Send + 'static, OutputStreamError: Send + 'static, { type WebsocketResponse = crate::response::BrowserMockRes; fn as_query(&self) -> Option<&str> { unreachable!() } fn to_content_type(&self) -> Option<Cow<'_, str>> { unreachable!() } fn accepts(&self) -> Option<Cow<'_, str>> { unreachable!() } fn referer(&self) -> Option<Cow<'_, str>> { unreachable!() } async fn try_into_bytes(self) -> Result<Bytes, Error> { unreachable!() } async fn try_into_string(self) -> Result<String, Error> { unreachable!() } fn try_into_stream( self, ) -> Result<impl Stream<Item = Result<Bytes, Bytes>> + Send, Error> { Ok(futures::stream::once(async { unreachable!() })) } async fn try_into_websocket( self, ) -> Result< ( impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, impl Sink<Bytes> + Send + 'static, Self::WebsocketResponse, ), Error, > { #[allow(unreachable_code)] Err::< ( futures::stream::Once<std::future::Ready<Result<Bytes, Bytes>>>, futures::sink::Drain<Bytes>, Self::WebsocketResponse, ), _, >(unreachable!()) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/request/spin.rs
server_fn/src/request/spin.rs
use crate::{error::ServerFnError, request::Req}; use axum::body::{Body, Bytes}; use futures::{Stream, StreamExt}; use http::{ header::{ACCEPT, CONTENT_TYPE, REFERER}, Request, }; use http_body_util::BodyExt; use std::borrow::Cow; impl<E> Req<E> for IncomingRequest where CustErr: 'static, { fn as_query(&self) -> Option<&str> { self.uri().query() } fn to_content_type(&self) -> Option<Cow<'_, str>> { self.headers() .get(CONTENT_TYPE) .map(|h| String::from_utf8_lossy(h.as_bytes())) } fn accepts(&self) -> Option<Cow<'_, str>> { self.headers() .get(ACCEPT) .map(|h| String::from_utf8_lossy(h.as_bytes())) } fn referer(&self) -> Option<Cow<'_, str>> { self.headers() .get(REFERER) .map(|h| String::from_utf8_lossy(h.as_bytes())) } async fn try_into_bytes(self) -> Result<Bytes, E> { let (_parts, body) = self.into_parts(); body.collect().await.map(|c| c.to_bytes()).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into() }) } async fn try_into_string(self) -> Result<String, E> { let bytes = self.try_into_bytes().await?; String::from_utf8(bytes.to_vec()).map_err(|e| { ServerFnErrorErr::Deserialization(e.to_string()).into() }) } fn try_into_stream( self, ) -> Result<impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, E> { Ok(self.into_body().into_data_stream().map(|chunk| { chunk.map_err(|e| { E::from_server_fn_error(ServerFnErrorErr::Deserialization( e.to_string(), )) .ser() }) })) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/src/request/generic.rs
server_fn/src/request/generic.rs
//! This module uses platform-agnostic abstractions //! allowing users to run server functions on a wide range of //! platforms. //! //! The crates in use in this crate are: //! //! * `bytes`: platform-agnostic manipulation of bytes. //! * `http`: low-dependency HTTP abstractions' *front-end*. //! //! # Users //! //! * `wasm32-wasip*` integration crate `leptos_wasi` is using this //! crate under the hood. use crate::{ error::{FromServerFnError, IntoAppError, ServerFnErrorErr}, request::Req, }; use bytes::Bytes; use futures::{ stream::{self, Stream}, Sink, StreamExt, }; use http::{Request, Response}; use std::borrow::Cow; impl<Error, InputStreamError, OutputStreamError> Req<Error, InputStreamError, OutputStreamError> for Request<Bytes> where Error: FromServerFnError + Send, InputStreamError: FromServerFnError + Send, OutputStreamError: FromServerFnError + Send, { type WebsocketResponse = Response<Bytes>; async fn try_into_bytes(self) -> Result<Bytes, Error> { Ok(self.into_body()) } async fn try_into_string(self) -> Result<String, Error> { String::from_utf8(self.into_body().into()).map_err(|err| { ServerFnErrorErr::Deserialization(err.to_string()).into_app_error() }) } fn try_into_stream( self, ) -> Result<impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, Error> { Ok(stream::iter(self.into_body()) .ready_chunks(16) .map(|chunk| Ok(Bytes::from(chunk)))) } fn to_content_type(&self) -> Option<Cow<'_, str>> { self.headers() .get(http::header::CONTENT_TYPE) .map(|val| String::from_utf8_lossy(val.as_bytes())) } fn accepts(&self) -> Option<Cow<'_, str>> { self.headers() .get(http::header::ACCEPT) .map(|val| String::from_utf8_lossy(val.as_bytes())) } fn referer(&self) -> Option<Cow<'_, str>> { self.headers() .get(http::header::REFERER) .map(|val| String::from_utf8_lossy(val.as_bytes())) } fn as_query(&self) -> Option<&str> { self.uri().query() } async fn try_into_websocket( self, ) -> Result< ( impl Stream<Item = Result<Bytes, Bytes>> + Send + 'static, impl Sink<Bytes> + Send + 'static, Self::WebsocketResponse, ), Error, > { Err::< ( futures::stream::Once<std::future::Ready<Result<Bytes, Bytes>>>, futures::sink::Drain<Bytes>, Self::WebsocketResponse, ), _, >(Error::from_server_fn_error( crate::ServerFnErrorErr::Response( "Websockets are not supported on this platform.".to_string(), ), )) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/server_macro.rs
server_fn/tests/server_macro.rs
// The trybuild output has slightly different error message output for // different combinations of features. Since tests are run with `test-all-features` // multiple combinations of features are tested. This ensures this file is only // run when **only** the browser feature is enabled. #![cfg(all( rustc_nightly, feature = "browser", not(any( feature = "postcard", feature = "multipart", feature = "serde-lite", feature = "cbor", feature = "msgpack", feature = "bitcode", )) ))] #[test] fn aliased_results() { let t = trybuild::TestCases::new(); t.pass("tests/valid/*.rs"); t.compile_fail("tests/invalid/*.rs") }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/valid/aliased_return_full.rs
server_fn/tests/valid/aliased_return_full.rs
use server_fn_macro_default::server; use server_fn::error::ServerFnError; type FullAlias = Result<String, ServerFnError>; #[server] pub async fn full_alias_result() -> FullAlias { Ok("hello".to_string()) } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/valid/custom_error_aliased_return_part.rs
server_fn/tests/valid/custom_error_aliased_return_part.rs
use server_fn::{ codec::JsonEncoding, error::{FromServerFnError, ServerFnErrorErr}, }; use server_fn_macro_default::server; #[derive( Debug, thiserror::Error, Clone, serde::Serialize, serde::Deserialize, )] pub enum CustomError { #[error("error a")] ErrorA, #[error("error b")] ErrorB, } impl FromServerFnError for CustomError { type Encoder = JsonEncoding; fn from_server_fn_error(_: ServerFnErrorErr) -> Self { Self::ErrorA } } type PartAlias<T> = Result<T, CustomError>; #[server] pub async fn part_alias_result() -> PartAlias<String> { Ok("hello".to_string()) } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/valid/aliased_return_part.rs
server_fn/tests/valid/aliased_return_part.rs
use server_fn_macro_default::server; use server_fn::error::ServerFnError; type PartAlias<T> = Result<T, ServerFnError>; #[server] pub async fn part_alias_result() -> PartAlias<String> { Ok("hello".to_string()) } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/valid/aliased_return_none.rs
server_fn/tests/valid/aliased_return_none.rs
use server_fn_macro_default::server; use server_fn::error::ServerFnError; #[server] pub async fn no_alias_result() -> Result<String, ServerFnError> { Ok("hello".to_string()) } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/valid/custom_error_aliased_return_none.rs
server_fn/tests/valid/custom_error_aliased_return_none.rs
use server_fn::{ codec::JsonEncoding, error::{FromServerFnError, ServerFnErrorErr}, }; use server_fn_macro_default::server; #[derive( Debug, thiserror::Error, Clone, serde::Serialize, serde::Deserialize, )] pub enum CustomError { #[error("error a")] ErrorA, #[error("error b")] ErrorB, } impl FromServerFnError for CustomError { type Encoder = JsonEncoding; fn from_server_fn_error(_: ServerFnErrorErr) -> Self { Self::ErrorA } } #[server] pub async fn no_alias_result() -> Result<String, CustomError> { Ok("hello".to_string()) } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/valid/custom_error_aliased_return_full.rs
server_fn/tests/valid/custom_error_aliased_return_full.rs
use server_fn::{ codec::JsonEncoding, error::{FromServerFnError, ServerFnErrorErr}, }; use server_fn_macro_default::server; #[derive( Debug, thiserror::Error, Clone, serde::Serialize, serde::Deserialize, )] pub enum CustomError { #[error("error a")] ErrorA, #[error("error b")] ErrorB, } impl FromServerFnError for CustomError { type Encoder = JsonEncoding; fn from_server_fn_error(_: ServerFnErrorErr) -> Self { Self::ErrorA } } type FullAlias = Result<String, CustomError>; #[server] pub async fn full_alias_result() -> FullAlias { Ok("hello".to_string()) } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/invalid/aliased_return_full.rs
server_fn/tests/invalid/aliased_return_full.rs
use server_fn_macro_default::server; #[derive(Debug, thiserror::Error, Clone, serde::Serialize, serde::Deserialize)] pub enum InvalidError { #[error("error a")] A, } type FullAlias = Result<String, InvalidError>; #[server] pub async fn full_alias_result() -> FullAlias { Ok("hello".to_string()) } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/invalid/no_return.rs
server_fn/tests/invalid/no_return.rs
use server_fn_macro_default::server; #[server] pub async fn no_return() {} fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/invalid/not_async.rs
server_fn/tests/invalid/not_async.rs
use server_fn_macro_default::server; use server_fn::error::ServerFnError; #[server] pub fn not_async() -> Result<String, ServerFnError> { Ok("hello".to_string()) } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/invalid/aliased_return_part.rs
server_fn/tests/invalid/aliased_return_part.rs
use server_fn_macro_default::server; #[derive(Debug, thiserror::Error, Clone, serde::Serialize, serde::Deserialize)] pub enum InvalidError { #[error("error a")] A, } type PartAlias<T> = Result<T, InvalidError>; #[server] pub async fn part_alias_result() -> PartAlias<String> { Ok("hello".to_string()) } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/invalid/aliased_return_none.rs
server_fn/tests/invalid/aliased_return_none.rs
use server_fn_macro_default::server; #[derive(Debug, thiserror::Error, Clone, serde::Serialize, serde::Deserialize)] pub enum InvalidError { #[error("error a")] A, } #[server] pub async fn no_alias_result() -> Result<String, InvalidError> { Ok("hello".to_string()) } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/invalid/empty_return.rs
server_fn/tests/invalid/empty_return.rs
use server_fn_macro_default::server; #[server] pub async fn empty_return() -> () { () } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/tests/invalid/not_result.rs
server_fn/tests/invalid/not_result.rs
use server_fn::{ codec::JsonEncoding, error::{FromServerFnError, ServerFnErrorErr}, }; use server_fn_macro_default::server; #[derive( Debug, thiserror::Error, Clone, serde::Serialize, serde::Deserialize, )] pub enum CustomError { #[error("error a")] A, #[error("error b")] B, } impl FromServerFnError for CustomError { type Encoder = JsonEncoding; fn from_server_fn_error(_: ServerFnErrorErr) -> Self { Self::A } } #[server] pub async fn full_alias_result() -> CustomError { CustomError::A } fn main() {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/server_fn/server_fn_macro_default/src/lib.rs
server_fn/server_fn_macro_default/src/lib.rs
#![forbid(unsafe_code)] #![deny(missing_docs)] //! This crate contains the default implementation of the #[macro@crate::server] macro without additional context from the server. //! See the [server_fn_macro] crate for more information. use proc_macro::TokenStream; use server_fn_macro::server_macro_impl; use syn::__private::ToTokens; /// Declares that a function is a [server function](https://docs.rs/server_fn/). /// This means that its body will only run on the server, i.e., when the `ssr` /// feature is enabled on this crate. /// /// ## Usage /// ```rust,ignore /// #[server] /// pub async fn blog_posts( /// category: String, /// ) -> Result<Vec<BlogPost>, ServerFnError> { /// let posts = load_posts(&category).await?; /// // maybe do some other work /// Ok(posts) /// } /// ``` /// /// ## Named Arguments /// /// You can any combination of the following named arguments: /// - `name`: sets the identifier for the server function’s type, which is a struct created /// to hold the arguments (defaults to the function identifier in PascalCase) /// - `prefix`: a prefix at which the server function handler will be mounted (defaults to `/api`) /// - `endpoint`: specifies the exact path at which the server function handler will be mounted, /// relative to the prefix (defaults to the function name followed by unique hash) /// - `input`: the encoding for the arguments (defaults to `PostUrl`) /// - `input_derive`: a list of derives to be added on the generated input struct (defaults to `(Clone, serde::Serialize, serde::Deserialize)` if `input` is set to a custom struct, won't have an effect otherwise) /// - `output`: the encoding for the response (defaults to `Json`) /// - `client`: a custom `Client` implementation that will be used for this server fn /// - `encoding`: (legacy, may be deprecated in future) specifies the encoding, which may be one /// of the following (not case sensitive) /// - `"Url"`: `POST` request with URL-encoded arguments and JSON response /// - `"GetUrl"`: `GET` request with URL-encoded arguments and JSON response /// - `"Cbor"`: `POST` request with CBOR-encoded arguments and response /// - `"GetCbor"`: `GET` request with URL-encoded arguments and CBOR response /// - `req` and `res` specify the HTTP request and response types to be used on the server (these /// should usually only be necessary if you are integrating with a server other than Actix/Axum) /// ```rust,ignore /// #[server( /// name = SomeStructName, /// prefix = "/my_api", /// endpoint = "my_fn", /// input = Cbor, /// output = Json /// )] /// pub async fn my_wacky_server_fn(input: Vec<String>) -> Result<usize, ServerFnError> { /// todo!() /// } /// /// // expands to /// #[derive(Deserialize, Serialize)] /// struct SomeStructName { /// input: Vec<String> /// } /// /// impl ServerFn for SomeStructName { /// const PATH: &'static str = "/my_api/my_fn"; /// /// // etc. /// } /// ``` #[proc_macro_attribute] pub fn server(args: proc_macro::TokenStream, s: TokenStream) -> TokenStream { match server_macro_impl( args.into(), s.into(), Some(syn::parse_quote!(server_fn)), option_env!("SERVER_FN_PREFIX").unwrap_or("/api"), None, None, ) { Err(e) => e.to_compile_error().into(), Ok(s) => s.to_token_stream().into(), } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/build.rs
leptos/build.rs
use rustc_version::{version_meta, Channel}; fn main() { let target = std::env::var("TARGET").unwrap_or_default(); // Set cfg flags depending on release channel if matches!(version_meta().unwrap().channel, Channel::Nightly) { println!("cargo:rustc-cfg=rustc_nightly"); } // Set cfg flag for getrandom wasm_js if target == "wasm32-unknown-unknown" { // Set a custom cfg flag for wasm builds println!("cargo:rustc-cfg=getrandom_backend=\"wasm_js\""); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/subsecond.rs
leptos/src/subsecond.rs
use dioxus_devtools::DevserverMsg; use wasm_bindgen::{prelude::Closure, JsCast}; use web_sys::{js_sys::JsString, MessageEvent, WebSocket}; /// Sets up a websocket connect to the `dx` CLI, waiting for incoming hot-patching messages /// and patching the WASM binary appropriately. // // Note: This is a stripped-down version of Dioxus's `make_ws` from `dioxus_web` // It's essentially copy-pasted here because it's not pub there. // Would love to just take a dependency on that to be able to use it and deduplicate. // // https://github.com/DioxusLabs/dioxus/blob/main/packages/web/src/devtools.rs#L36 pub fn connect_to_hot_patch_messages() { // Get the location of the devserver, using the current location plus the /_dioxus path // The idea here being that the devserver is always located on the /_dioxus behind a proxy let location = web_sys::window().unwrap().location(); let url = format!( "{protocol}//{host}/_dioxus?build_id={build_id}", protocol = match location.protocol().unwrap() { prot if prot == "https:" => "wss:", _ => "ws:", }, host = location.host().unwrap(), build_id = dioxus_cli_config::build_id(), ); let ws = WebSocket::new(&url).unwrap(); ws.set_onmessage(Some( Closure::<dyn FnMut(MessageEvent)>::new(move |e: MessageEvent| { let Ok(text) = e.data().dyn_into::<JsString>() else { return; }; // The devserver messages have some &'static strs in them, so we need to leak the source string let string: String = text.into(); let string = Box::leak(string.into_boxed_str()); if let Ok(DevserverMsg::HotReload(msg)) = serde_json::from_str::<DevserverMsg>(string) { if let Some(jump_table) = msg.jump_table.as_ref().cloned() { if msg.for_build_id == Some(dioxus_cli_config::build_id()) { let our_pid = if cfg!(target_family = "wasm") { None } else { Some(std::process::id()) }; if msg.for_pid == our_pid { unsafe { subsecond::apply_patch(jump_table) } .unwrap(); } } } } }) .into_js_value() .as_ref() .unchecked_ref(), )); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/animated_show.rs
leptos/src/animated_show.rs
use crate::{children::ChildrenFn, component, control_flow::Show, IntoView}; use core::time::Duration; use leptos_dom::helpers::TimeoutHandle; use leptos_macro::view; use reactive_graph::{ effect::RenderEffect, owner::{on_cleanup, StoredValue}, signal::RwSignal, traits::{Get, GetUntracked, GetValue, Set, SetValue}, wrappers::read::Signal, }; use tachys::prelude::*; /// A component that will show its children when the `when` condition is `true`. /// Additionally, you need to specify a `hide_delay`. If the `when` condition changes to `false`, /// the unmounting of the children will be delayed by the specified Duration. /// If you provide the optional `show_class` and `hide_class`, you can create very easy mount / /// unmount animations. /// /// ```rust /// # use core::time::Duration; /// # use leptos::prelude::*; /// # #[component] /// # pub fn App() -> impl IntoView { /// let show = RwSignal::new(false); /// /// view! { /// <div /// class="hover-me" /// on:mouseenter=move |_| show.set(true) /// on:mouseleave=move |_| show.set(false) /// > /// "Hover Me" /// </div> /// /// <AnimatedShow /// when=show /// show_class="fade-in-1000" /// hide_class="fade-out-1000" /// hide_delay=Duration::from_millis(1000) /// > /// <div class="here-i-am"> /// "Here I Am!" /// </div> /// </AnimatedShow> /// } /// # } /// ``` #[cfg_attr(feature = "tracing", tracing::instrument(level = "trace", skip_all))] #[component] pub fn AnimatedShow( /// The components Show wraps children: ChildrenFn, /// If the component should show or not #[prop(into)] when: Signal<bool>, /// Optional CSS class to apply if `when == true` #[prop(optional)] show_class: &'static str, /// Optional CSS class to apply if `when == false` #[prop(optional)] hide_class: &'static str, /// The timeout after which the component will be unmounted if `when == false` hide_delay: Duration, ) -> impl IntoView { let handle: StoredValue<Option<TimeoutHandle>> = StoredValue::new(None); let cls = RwSignal::new(if when.get_untracked() { show_class } else { hide_class }); let show = RwSignal::new(when.get_untracked()); let eff = RenderEffect::new(move |_| { if when.get() { // clear any possibly active timer if let Some(h) = handle.get_value() { h.clear(); } cls.set(show_class); show.set(true); } else { cls.set(hide_class); let h = leptos_dom::helpers::set_timeout_with_handle( move || show.set(false), hide_delay, ) .expect("set timeout in AnimatedShow"); handle.set_value(Some(h)); } }); on_cleanup(move || { if let Some(Some(h)) = handle.try_get_value() { h.clear(); } drop(eff); }); view! { <Show when=move || show.get() fallback=|| ()> <div class=move || cls.get()>{children()}</div> </Show> } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/lib.rs
leptos/src/lib.rs
#![deny(missing_docs)] //! # About Leptos //! //! Leptos is a full-stack framework for building web applications in Rust. You can use it to build //! - single-page apps (SPAs) rendered entirely in the browser, using client-side routing and loading //! or mutating data via async requests to the server. //! - multi-page apps (MPAs) rendered on the server, managing navigation, data, and mutations via //! web-standard `<a>` and `<form>` tags. //! - progressively-enhanced single-page apps that are rendered on the server and then hydrated on the client, //! enhancing your `<a>` and `<form>` navigations and mutations seamlessly when WASM is available. //! //! And you can do all three of these **using the same Leptos code**. //! //! Take a look at the [Leptos Book](https://leptos-rs.github.io/leptos/) for a walkthrough of the framework. //! Join us on our [Discord Channel](https://discord.gg/v38Eef6sWG) to see what the community is building. //! Explore our [Examples](https://github.com/leptos-rs/leptos/tree/main/examples) to see Leptos in action. //! //! # Learning by Example //! //! If you want to see what Leptos is capable of, check out //! the [examples](https://github.com/leptos-rs/leptos/tree/main/examples): //! //! - **[`counter`]** is the classic counter example, showing the basics of client-side rendering and reactive DOM updates. //! - **[`counter_without_macros`]** adapts the counter example to use the builder pattern for the UI and avoids other macros, //! instead showing the code that Leptos generates. //! - **[`counters`]** introduces parent-child communication via contexts, and the [`<For/>`](leptos::prelude::For) component //! for efficient keyed list updates. //! - **[`error_boundary`]** shows how to use [`Result`] types to handle errors. //! - **[`parent_child`]** shows four different ways a parent component can communicate with a child, including passing a closure, //! context, and more. //! - **[`fetch`]** introduces [`Resource`](leptos::prelude::Resource)s, which allow you to integrate arbitrary `async` code like an //! HTTP request within your reactive code. //! - **[`router`]** shows how to use Leptos’s nested router to enable client-side navigation and route-specific, reactive data loading. //! - **[`slots`]** shows how to use slots on components. //! - **[`spread`]** shows how the spread syntax can be used to spread data and/or event handlers onto elements. //! - **[`counter_isomorphic`]** shows different methods of interaction with a stateful server, including server functions, //! server actions, forms, and server-sent events (SSE). //! - **[`todomvc`]** shows the basics of building an isomorphic web app. Both the server and the client import the same app code. //! The server renders the app directly to an HTML string, and the client hydrates that HTML to make it interactive. //! You might also want to see how we use [`Effect::new`](leptos::prelude::Effect) to //! [serialize JSON to `localStorage`](https://github.com/leptos-rs/leptos/blob/20af4928b2fffe017408d3f4e7330db22cf68277/examples/todomvc/src/lib.rs#L191-L209) //! and [reactively call DOM methods](https://github.com/leptos-rs/leptos/blob/16f084a71268ac325fbc4a5e50c260df185eadb6/examples/todomvc/src/lib.rs#L292-L296) //! on [references to elements](https://github.com/leptos-rs/leptos/blob/20af4928b2fffe017408d3f4e7330db22cf68277/examples/todomvc/src/lib.rs#L228). //! - **[`hackernews`]** and **[`hackernews_axum`]** integrate calls to a real external REST API, routing, server-side rendering and //! hydration to create a fully-functional application that works as intended even before WASM has loaded and begun to run. //! - **[`todo_app_sqlite`]** and **[`todo_app_sqlite_axum`]** show how to build a full-stack app using server functions and //! database connections. //! - **[`tailwind`]** shows how to integrate TailwindCSS with `trunk` for CSR. //! //! [`counter`]: https://github.com/leptos-rs/leptos/tree/main/examples/counter //! [`counter_without_macros`]: https://github.com/leptos-rs/leptos/tree/main/examples/counter_without_macros //! [`counters`]: https://github.com/leptos-rs/leptos/tree/main/examples/counters //! [`error_boundary`]: https://github.com/leptos-rs/leptos/tree/main/examples/error_boundary //! [`parent_child`]: https://github.com/leptos-rs/leptos/tree/main/examples/parent_child //! [`fetch`]: https://github.com/leptos-rs/leptos/tree/main/examples/fetch //! [`router`]: https://github.com/leptos-rs/leptos/tree/main/examples/router //! [`slots`]: https://github.com/leptos-rs/leptos/tree/main/examples/slots //! [`spread`]: https://github.com/leptos-rs/leptos/tree/main/examples/spread //! [`counter_isomorphic`]: https://github.com/leptos-rs/leptos/tree/main/examples/counter_isomorphic //! [`todomvc`]: https://github.com/leptos-rs/leptos/tree/main/examples/todomvc //! [`hackernews`]: https://github.com/leptos-rs/leptos/tree/main/examples/hackernews //! [`hackernews_axum`]: https://github.com/leptos-rs/leptos/tree/main/examples/hackernews_axum //! [`todo_app_sqlite`]: https://github.com/leptos-rs/leptos/tree/main/examples/todo_app_sqlite //! [`todo_app_sqlite_axum`]: https://github.com/leptos-rs/leptos/tree/main/examples/todo_app_sqlite_axum //! [`tailwind`]: https://github.com/leptos-rs/leptos/tree/main/examples/tailwind_csr //! //! Details on how to run each example can be found in its README. //! //! # Quick Links //! //! Here are links to the most important sections of the docs: //! - **Reactivity**: the [`reactive_graph`] overview, and more details in //! + signals: [`signal`](leptos::prelude::signal), [`ReadSignal`](leptos::prelude::ReadSignal), //! [`WriteSignal`](leptos::prelude::WriteSignal) and [`RwSignal`](leptos::prelude::RwSignal). //! + computations: [`Memo`](leptos::prelude::Memo). //! + `async` interop: [`Resource`](leptos::prelude::Resource) for loading data using `async` functions //! and [`Action`](leptos::prelude::Action) to mutate data or imperatively call `async` functions. //! + reactions: [`Effect`](leptos::prelude::Effect) and [`RenderEffect`](leptos::prelude::RenderEffect). //! - **Templating/Views**: the [`view`] macro and [`IntoView`] trait. //! - **Routing**: the [`leptos_router`](https://docs.rs/leptos_router/latest/leptos_router/) crate //! - **Server Functions**: the [`server`](macro@leptos::prelude::server) macro and [`ServerAction`](leptos::prelude::ServerAction). //! //! # Feature Flags //! //! - **`nightly`**: On `nightly` Rust, enables the function-call syntax for signal getters and setters. //! Also enables some experimental optimizations that improve the handling of static strings and //! the performance of the `template! {}` macro. //! - **`csr`** Client-side rendering: Generate DOM nodes in the browser. //! - **`ssr`** Server-side rendering: Generate an HTML string (typically on the server). //! - **`islands`** Activates “islands mode,” in which components are not made interactive on the //! client unless they use the `#[island]` macro. //! - **`hydrate`** Hydration: use this to add interactivity to an SSRed Leptos app. //! - **`nonce`** Adds support for nonces to be added as part of a Content Security Policy. //! - **`rkyv`** In SSR/hydrate mode, enables using [`rkyv`](https://docs.rs/rkyv/latest/rkyv/) to serialize resources. //! - **`tracing`** Adds support for [`tracing`](https://docs.rs/tracing/latest/tracing/). //! - **`trace-component-props`** Adds `tracing` support for component props. //! - **`delegation`** Uses event delegation rather than the browser’s native event handling //! system. (This improves the performance of creating large numbers of elements simultaneously, //! in exchange for occasional edge cases in which events behave differently from native browser //! events.) //! - **`rustls`** Use `rustls` for server functions. //! //! **Important Note:** You must enable one of `csr`, `hydrate`, or `ssr` to tell Leptos //! which mode your app is operating in. You should only enable one of these per build target, //! i.e., you should not have both `hydrate` and `ssr` enabled for your server binary, only `ssr`. //! //! # A Simple Counter //! //! ```rust //! use leptos::prelude::*; //! //! #[component] //! pub fn SimpleCounter(initial_value: i32) -> impl IntoView { //! // create a reactive signal with the initial value //! let (value, set_value) = signal(initial_value); //! //! // create event handlers for our buttons //! // note that `value` and `set_value` are `Copy`, so it's super easy to move them into closures //! let clear = move |_| set_value.set(0); //! let decrement = move |_| *set_value.write() -= 1; //! let increment = move |_| *set_value.write() += 1; //! //! view! { //! <div> //! <button on:click=clear>"Clear"</button> //! <button on:click=decrement>"-1"</button> //! <span>"Value: " {value} "!"</span> //! <button on:click=increment>"+1"</button> //! </div> //! } //! } //! ``` //! //! Leptos is easy to use with [Trunk](https://trunkrs.dev/) (or with a simple wasm-bindgen setup): //! //! ```rust //! use leptos::{mount::mount_to_body, prelude::*}; //! //! #[component] //! fn SimpleCounter(initial_value: i32) -> impl IntoView { //! // ... //! # _ = initial_value; //! } //! //! pub fn main() { //! # if false { // can't run in doctest //! mount_to_body(|| view! { <SimpleCounter initial_value=3 /> }) //! # } //! } //! ``` #![cfg_attr(all(feature = "nightly", rustc_nightly), feature(fn_traits))] #![cfg_attr(all(feature = "nightly", rustc_nightly), feature(unboxed_closures))] extern crate self as leptos; /// Exports all the core types of the library. pub mod prelude { // Traits // These should always be exported from the prelude pub use reactive_graph::prelude::*; pub use tachys::prelude::*; // Structs // In the future, maybe we should remove this blanket export // However, it is definitely useful relative to looking up every struct etc. mod export_types { #[cfg(feature = "nonce")] pub use crate::nonce::*; pub use crate::{ callback::*, children::*, component::*, control_flow::*, error::*, form::*, hydration::*, into_view::*, mount::*, suspense::*, text_prop::*, }; pub use leptos_config::*; pub use leptos_dom::helpers::*; pub use leptos_macro::*; pub use leptos_server::*; pub use oco_ref::*; pub use reactive_graph::{ actions::*, computed::*, effect::*, graph::untrack, owner::*, signal::*, wrappers::{read::*, write::*}, }; pub use server_fn::{ self, error::{FromServerFnError, ServerFnError, ServerFnErrorErr}, }; pub use tachys::{ reactive_graph::{bind::BindAttribute, node_ref::*, Suspend}, view::{fragment::Fragment, template::ViewTemplate}, }; } pub use export_types::*; } /// Components used for working with HTML forms, like `<ActionForm>`. pub mod form; /// A standard way to wrap functions and closures to pass them to components. pub use reactive_graph::callback; /// Types that can be passed as the `children` prop of a component. pub mod children; /// Wrapper for intercepting component attributes. pub mod attribute_interceptor; #[doc(hidden)] /// Traits used to implement component constructors. pub mod component; mod error_boundary; /// Tools for handling errors. pub mod error { pub use crate::error_boundary::*; pub use throw_error::*; } /// Control-flow components like `<Show>`, `<For>`, and `<Await>`. pub mod control_flow { pub use crate::{ animated_show::*, await_::*, for_loop::*, show::*, show_let::*, }; } mod animated_show; mod await_; mod for_loop; mod show; mod show_let; /// A component that allows rendering a component somewhere else. pub mod portal; /// Components to enable server-side rendering and client-side hydration. pub mod hydration; /// Utilities for exporting nonces to be used for a Content Security Policy. #[cfg(feature = "nonce")] pub mod nonce; /// Components to load asynchronous data. pub mod suspense { pub use crate::{suspense_component::*, transition::*}; } #[macro_use] mod suspense_component; /// Types for reactive string properties for components. pub mod text_prop; mod transition; pub use leptos_macro::*; #[doc(inline)] pub use server_fn; #[doc(hidden)] pub use typed_builder; #[doc(hidden)] pub use typed_builder_macro; mod into_view; pub use into_view::IntoView; #[doc(inline)] pub use leptos_dom; mod provider; #[doc(inline)] pub use tachys; /// Tools to mount an application to the DOM, or to hydrate it from server-rendered HTML. pub mod mount; #[doc(inline)] pub use leptos_config as config; #[doc(inline)] pub use oco_ref as oco; mod from_form_data; #[doc(inline)] pub use either_of as either; #[doc(inline)] pub use reactive_graph as reactive; /// Provide and access data along the reactive graph, sharing data without directly passing arguments. pub mod context { pub use crate::provider::*; pub use reactive_graph::owner::{provide_context, use_context}; } #[doc(inline)] pub use leptos_server as server; /// HTML attribute types. #[doc(inline)] pub use tachys::html::attribute as attr; /// HTML element types. #[doc(inline)] pub use tachys::html::element as html; /// HTML event types. #[doc(no_inline)] pub use tachys::html::event as ev; /// MathML element types. #[doc(inline)] pub use tachys::mathml as math; /// SVG element types. #[doc(inline)] pub use tachys::svg; #[cfg(feature = "subsecond")] /// Utilities for using binary hot-patching with [`subsecond`]. pub mod subsecond; /// Utilities for simple isomorphic logging to the console or terminal. pub mod logging { pub use leptos_dom::{ debug_error, debug_log, debug_warn, error, log, warn, }; } /// Utilities for working with asynchronous tasks. pub mod task { use any_spawner::Executor; use reactive_graph::computed::ScopedFuture; use std::future::Future; /// Spawns a thread-safe [`Future`]. /// /// This will be run with the current reactive owner and observer using a [`ScopedFuture`]. #[track_caller] #[inline(always)] pub fn spawn(fut: impl Future<Output = ()> + Send + 'static) { let fut = ScopedFuture::new(fut); #[cfg(not(target_family = "wasm"))] Executor::spawn(fut); #[cfg(target_family = "wasm")] Executor::spawn_local(fut); } /// Spawns a [`Future`] that cannot be sent across threads. #[track_caller] #[inline(always)] pub fn spawn_local(fut: impl Future<Output = ()> + 'static) { Executor::spawn_local(fut) } /// Waits until the next "tick" of the current async executor. pub async fn tick() { Executor::tick().await } pub use reactive_graph::{ spawn_local_scoped, spawn_local_scoped_with_cancellation, }; } // these reexports are used in islands #[cfg(feature = "islands")] #[doc(hidden)] pub use serde; #[doc(hidden)] pub use serde_json; #[cfg(feature = "tracing")] #[doc(hidden)] pub use tracing; #[doc(hidden)] pub use wasm_bindgen; #[doc(hidden)] pub use wasm_split_helpers as wasm_split; #[doc(hidden)] pub use web_sys; #[doc(hidden)] pub mod __reexports { pub use send_wrapper; pub use wasm_bindgen_futures; } #[doc(hidden)] #[derive(Clone, Debug, Default)] pub struct PrefetchLazyFn( pub reactive_graph::owner::ArcStoredValue< std::collections::HashSet<&'static str>, >, ); #[doc(hidden)] pub fn prefetch_lazy_fn_on_server(id: &'static str) { use crate::context::use_context; use reactive_graph::traits::WriteValue; if let Some(prefetches) = use_context::<PrefetchLazyFn>() { prefetches.0.write_value().insert(id); } } #[doc(hidden)] #[derive(Clone, Debug, Default)] pub struct WasmSplitManifest( pub reactive_graph::owner::ArcStoredValue<( String, // the pkg root std::collections::HashMap<String, Vec<String>>, // preloads String, // the name of the __wasm_split.js file )>, );
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/error_boundary.rs
leptos/src/error_boundary.rs
use crate::{children::TypedChildren, IntoView}; use futures::{channel::oneshot, future::join_all}; use hydration_context::{SerializedDataId, SharedContext}; use leptos_macro::component; use or_poisoned::OrPoisoned; use reactive_graph::{ computed::ArcMemo, effect::RenderEffect, owner::{provide_context, ArcStoredValue, Owner}, signal::ArcRwSignal, traits::{Get, Update, With, WithUntracked, WriteValue}, }; use rustc_hash::FxHashMap; use std::{ collections::VecDeque, fmt::Debug, mem, sync::{Arc, Mutex}, }; use tachys::{ html::attribute::{any_attribute::AnyAttribute, Attribute}, hydration::Cursor, reactive_graph::OwnedView, ssr::{StreamBuilder, StreamChunk}, view::{ add_attr::AddAnyAttr, Mountable, Position, PositionState, Render, RenderHtml, }, }; use throw_error::{Error, ErrorHook, ErrorId}; /// When you render a `Result<_, _>` in your view, in the `Err` case it will /// render nothing, and search up through the view tree for an `<ErrorBoundary/>`. /// This component lets you define a fallback that should be rendered in that /// error case, allowing you to handle errors within a section of the interface. /// /// ``` /// # use leptos::prelude::*; /// #[component] /// pub fn ErrorBoundaryExample() -> impl IntoView { /// let (value, set_value) = signal(Ok(0)); /// let on_input = /// move |ev| set_value.set(event_target_value(&ev).parse::<i32>()); /// /// view! { /// <input type="text" on:input=on_input/> /// <ErrorBoundary /// fallback=move |_| view! { <p class="error">"Enter a valid number."</p>} /// > /// <p>"Value is: " {move || value.get()}</p> /// </ErrorBoundary> /// } /// } /// ``` /// /// ## Beginner's Tip: ErrorBoundary Requires Your Error To Implement std::error::Error. /// `ErrorBoundary` requires your `Result<T,E>` to implement [IntoView](https://docs.rs/leptos/latest/leptos/trait.IntoView.html). /// `Result<T,E>` only implements `IntoView` if `E` implements [std::error::Error](https://doc.rust-lang.org/std/error/trait.Error.html). /// So, for instance, if you pass a `Result<T,String>` where `T` implements [IntoView](https://docs.rs/leptos/latest/leptos/trait.IntoView.html) /// and attempt to render the error for the purposes of `ErrorBoundary` you'll get a compiler error like this. /// /// ```rust,ignore /// error[E0599]: the method `into_view` exists for enum `Result<ViewableLoginFlow, String>`, but its trait bounds were not satisfied /// --> src/login.rs:229:32 /// | /// 229 | err => err.into_view(), /// | ^^^^^^^^^ method cannot be called on `Result<ViewableLoginFlow, String>` due to unsatisfied trait bounds /// | /// = note: the following trait bounds were not satisfied: /// `<&Result<ViewableLoginFlow, std::string::String> as FnOnce<()>>::Output = _` /// which is required by `&Result<ViewableLoginFlow, std::string::String>: leptos::IntoView` /// ... more notes here ... /// ``` /// /// For more information about how to easily implement `Error` see /// [thiserror](https://docs.rs/thiserror/latest/thiserror/) #[component] pub fn ErrorBoundary<FalFn, Fal, Chil>( /// The elements that will be rendered, which may include one or more `Result<_>` types. children: TypedChildren<Chil>, /// A fallback that will be shown if an error occurs. fallback: FalFn, ) -> impl IntoView where FalFn: FnMut(ArcRwSignal<Errors>) -> Fal + Send + 'static, Fal: IntoView + Send + 'static, Chil: IntoView + Send + 'static, { let sc = Owner::current_shared_context(); let boundary_id = sc.as_ref().map(|sc| sc.next_id()).unwrap_or_default(); let initial_errors = sc.map(|sc| sc.errors(&boundary_id)).unwrap_or_default(); let hook = Arc::new(ErrorBoundaryErrorHook::new( boundary_id.clone(), initial_errors, )); let errors = hook.errors.clone(); let errors_empty = ArcMemo::new({ let errors = errors.clone(); move |_| errors.with(|map| map.is_empty()) }); let hook = hook as Arc<dyn ErrorHook>; let _guard = throw_error::set_error_hook(Arc::clone(&hook)); let suspended_children = ErrorBoundarySuspendedChildren::default(); let owner = Owner::new(); let children = owner.with(|| { provide_context(Arc::clone(&hook)); provide_context(suspended_children.clone()); children.into_inner()() }); OwnedView::new_with_owner( ErrorBoundaryView { hook, boundary_id, errors_empty, children, errors, fallback, suspended_children, }, owner, ) } pub(crate) type ErrorBoundarySuspendedChildren = ArcStoredValue<Vec<oneshot::Receiver<()>>>; struct ErrorBoundaryView<Chil, FalFn> { hook: Arc<dyn ErrorHook>, boundary_id: SerializedDataId, errors_empty: ArcMemo<bool>, children: Chil, fallback: FalFn, errors: ArcRwSignal<Errors>, suspended_children: ErrorBoundarySuspendedChildren, } struct ErrorBoundaryViewState<Chil, Fal> { // the children are always present; we toggle between them and the fallback as needed children: Chil, fallback: Option<Fal>, } impl<Chil, Fal> Mountable for ErrorBoundaryViewState<Chil, Fal> where Chil: Mountable, Fal: Mountable, { fn unmount(&mut self) { if let Some(fallback) = &mut self.fallback { fallback.unmount(); } else { self.children.unmount(); } } fn mount( &mut self, parent: &tachys::renderer::types::Element, marker: Option<&tachys::renderer::types::Node>, ) { if let Some(fallback) = &mut self.fallback { fallback.mount(parent, marker); } else { self.children.mount(parent, marker); } } fn insert_before_this(&self, child: &mut dyn Mountable) -> bool { if let Some(fallback) = &self.fallback { fallback.insert_before_this(child) } else { self.children.insert_before_this(child) } } fn elements(&self) -> Vec<tachys::renderer::types::Element> { if let Some(fallback) = &self.fallback { fallback.elements() } else { self.children.elements() } } } impl<Chil, FalFn, Fal> Render for ErrorBoundaryView<Chil, FalFn> where Chil: Render + 'static, FalFn: FnMut(ArcRwSignal<Errors>) -> Fal + Send + 'static, Fal: Render + 'static, { type State = RenderEffect<ErrorBoundaryViewState<Chil::State, Fal::State>>; fn build(mut self) -> Self::State { let hook = Arc::clone(&self.hook); let _hook = throw_error::set_error_hook(Arc::clone(&hook)); let mut children = Some(self.children.build()); RenderEffect::new( move |prev: Option< ErrorBoundaryViewState<Chil::State, Fal::State>, >| { let _hook = throw_error::set_error_hook(Arc::clone(&hook)); if let Some(mut state) = prev { match (self.errors_empty.get(), &mut state.fallback) { // no errors, and was showing fallback (true, Some(fallback)) => { fallback.insert_before_this(&mut state.children); fallback.unmount(); state.fallback = None; } // yes errors, and was showing children (false, None) => { state.fallback = Some( (self.fallback)(self.errors.clone()).build(), ); state .children .insert_before_this(&mut state.fallback); state.children.unmount(); } // either there were no errors, and we were already showing the children // or there are errors, but we were already showing the fallback // in either case, rebuilding doesn't require us to do anything _ => {} } state } else { let fallback = (!self.errors_empty.get()) .then(|| (self.fallback)(self.errors.clone()).build()); ErrorBoundaryViewState { children: children.take().unwrap(), fallback, } } }, ) } fn rebuild(self, state: &mut Self::State) { let new = self.build(); let mut old = std::mem::replace(state, new); old.insert_before_this(state); old.unmount(); } } impl<Chil, FalFn, Fal> AddAnyAttr for ErrorBoundaryView<Chil, FalFn> where Chil: RenderHtml + 'static, FalFn: FnMut(ArcRwSignal<Errors>) -> Fal + Send + 'static, Fal: RenderHtml + Send + 'static, { type Output<SomeNewAttr: Attribute> = ErrorBoundaryView<Chil::Output<SomeNewAttr::CloneableOwned>, FalFn>; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let ErrorBoundaryView { hook, boundary_id, errors_empty, children, fallback, errors, suspended_children, } = self; ErrorBoundaryView { hook, boundary_id, errors_empty, children: children.add_any_attr(attr.into_cloneable_owned()), fallback, errors, suspended_children, } } } impl<Chil, FalFn, Fal> RenderHtml for ErrorBoundaryView<Chil, FalFn> where Chil: RenderHtml + Send + 'static, FalFn: FnMut(ArcRwSignal<Errors>) -> Fal + Send + 'static, Fal: RenderHtml + Send + 'static, { type AsyncOutput = ErrorBoundaryView<Chil::AsyncOutput, FalFn>; type Owned = Self; const MIN_LENGTH: usize = Chil::MIN_LENGTH; fn dry_resolve(&mut self) { self.children.dry_resolve(); } async fn resolve(self) -> Self::AsyncOutput { let ErrorBoundaryView { hook, boundary_id, errors_empty, children, fallback, errors, suspended_children, .. } = self; ErrorBoundaryView { hook, boundary_id, errors_empty, children: children.resolve().await, fallback, errors, suspended_children, } } fn to_html_with_buf( mut self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { // first, attempt to serialize the children to HTML, then check for errors let _hook = throw_error::set_error_hook(self.hook); let mut new_buf = String::with_capacity(Chil::MIN_LENGTH); let mut new_pos = *position; self.children.to_html_with_buf( &mut new_buf, &mut new_pos, escape, mark_branches, extra_attrs.clone(), ); // any thrown errors would've been caught here if self.errors.with_untracked(|map| map.is_empty()) { buf.push_str(&new_buf); } else { // otherwise, serialize the fallback instead (self.fallback)(self.errors).to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); } } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( mut self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { let _hook = throw_error::set_error_hook(Arc::clone(&self.hook)); // first, attempt to serialize the children to HTML, then check for errors let mut new_buf = StreamBuilder::new(buf.clone_id()); let mut new_pos = *position; self.children.to_html_async_with_buf::<OUT_OF_ORDER>( &mut new_buf, &mut new_pos, escape, mark_branches, extra_attrs.clone(), ); let suspense_children = mem::take(&mut *self.suspended_children.write_value()); // not waiting for any suspended children: just render if suspense_children.is_empty() { // any thrown errors would've been caught here if self.errors.with_untracked(|map| map.is_empty()) { buf.append(new_buf); } else { // otherwise, serialize the fallback instead let mut fallback = String::with_capacity(Fal::MIN_LENGTH); (self.fallback)(self.errors).to_html_with_buf( &mut fallback, position, escape, mark_branches, extra_attrs, ); buf.push_sync(&fallback); } } else { let mut position = *position; // if we're waiting for suspended children, we'll first wait for them to load // in this implementation, an ErrorBoundary that *contains* Suspense essentially acts // like a Suspense: it will wait for (all top-level) child Suspense to load before rendering anything let mut view_buf = StreamBuilder::new(new_buf.clone_id()); view_buf.next_id(); let hook = Arc::clone(&self.hook); view_buf.push_async(async move { let _hook = throw_error::set_error_hook(Arc::clone(&hook)); let _ = join_all(suspense_children).await; let mut my_chunks = VecDeque::new(); for chunk in new_buf.take_chunks() { match chunk { StreamChunk::Sync(data) => { my_chunks.push_back(StreamChunk::Sync(data)) } StreamChunk::Async { chunks } => { let chunks = chunks.await; my_chunks.extend(chunks); } StreamChunk::OutOfOrder { chunks } => { let chunks = chunks.await; my_chunks.push_back(StreamChunk::OutOfOrder { chunks: Box::pin(async move { chunks }), }); } } } if self.errors.with_untracked(|map| map.is_empty()) { // if no errors, just go ahead with the stream my_chunks } else { // otherwise, serialize the fallback instead let mut fallback = String::with_capacity(Fal::MIN_LENGTH); (self.fallback)(self.errors).to_html_with_buf( &mut fallback, &mut position, escape, mark_branches, extra_attrs, ); my_chunks.clear(); my_chunks.push_back(StreamChunk::Sync(fallback)); my_chunks } }); buf.append(view_buf); } } fn hydrate<const FROM_SERVER: bool>( mut self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let mut children = Some(self.children); let hook = Arc::clone(&self.hook); let cursor = cursor.to_owned(); let position = position.to_owned(); RenderEffect::new( move |prev: Option< ErrorBoundaryViewState<Chil::State, Fal::State>, >| { let _hook = throw_error::set_error_hook(Arc::clone(&hook)); if let Some(mut state) = prev { match (self.errors_empty.get(), &mut state.fallback) { // no errors, and was showing fallback (true, Some(fallback)) => { fallback.insert_before_this(&mut state.children); state.fallback.unmount(); state.fallback = None; } // yes errors, and was showing children (false, None) => { state.fallback = Some( (self.fallback)(self.errors.clone()).build(), ); state .children .insert_before_this(&mut state.fallback); state.children.unmount(); } // either there were no errors, and we were already showing the children // or there are errors, but we were already showing the fallback // in either case, rebuilding doesn't require us to do anything _ => {} } state } else { let children = children.take().unwrap(); let (children, fallback) = if self.errors_empty.get() { ( children.hydrate::<FROM_SERVER>(&cursor, &position), None, ) } else { ( children.build(), Some( (self.fallback)(self.errors.clone()) .hydrate::<FROM_SERVER>(&cursor, &position), ), ) }; ErrorBoundaryViewState { children, fallback } } }, ) } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let mut children = Some(self.children); let hook = Arc::clone(&self.hook); let cursor = cursor.to_owned(); let position = position.to_owned(); let fallback_fn = Arc::new(Mutex::new(self.fallback)); let initial = { let errors_empty = self.errors_empty.clone(); let errors = self.errors.clone(); let fallback_fn = Arc::clone(&fallback_fn); async move { let children = children.take().unwrap(); let (children, fallback) = if errors_empty.get() { (children.hydrate_async(&cursor, &position).await, None) } else { let children = children.build(); let fallback = (fallback_fn.lock().or_poisoned())(errors.clone()); let fallback = fallback.hydrate_async(&cursor, &position).await; (children, Some(fallback)) }; ErrorBoundaryViewState { children, fallback } } }; RenderEffect::new_with_async_value( move |prev: Option< ErrorBoundaryViewState<Chil::State, Fal::State>, >| { let _hook = throw_error::set_error_hook(Arc::clone(&hook)); if let Some(mut state) = prev { match (self.errors_empty.get(), &mut state.fallback) { // no errors, and was showing fallback (true, Some(fallback)) => { fallback.insert_before_this(&mut state.children); state.fallback.unmount(); state.fallback = None; } // yes errors, and was showing children (false, None) => { state.fallback = Some( (fallback_fn.lock().or_poisoned())( self.errors.clone(), ) .build(), ); state .children .insert_before_this(&mut state.fallback); state.children.unmount(); } // either there were no errors, and we were already showing the children // or there are errors, but we were already showing the fallback // in either case, rebuilding doesn't require us to do anything _ => {} } state } else { unreachable!() } }, initial, ) .await } fn into_owned(self) -> Self::Owned { self } } #[derive(Debug)] struct ErrorBoundaryErrorHook { errors: ArcRwSignal<Errors>, id: SerializedDataId, shared_context: Option<Arc<dyn SharedContext + Send + Sync>>, } impl ErrorBoundaryErrorHook { pub fn new( id: SerializedDataId, initial_errors: impl IntoIterator<Item = (ErrorId, Error)>, ) -> Self { Self { errors: ArcRwSignal::new(Errors( initial_errors.into_iter().collect(), )), id, shared_context: Owner::current_shared_context(), } } } impl ErrorHook for ErrorBoundaryErrorHook { fn throw(&self, error: Error) -> ErrorId { // generate a unique ID let key: ErrorId = Owner::current_shared_context() .map(|sc| sc.next_id()) .unwrap_or_default() .into(); // register it with the shared context, so that it can be serialized from server to client // as needed if let Some(sc) = &self.shared_context { sc.register_error(self.id.clone(), key.clone(), error.clone()); } // add it to the reactive map of errors self.errors.update(|map| { map.insert(key.clone(), error); }); // return the key, which will be owned by the Result being rendered and can be used to // unregister this error if it is rebuilt key } fn clear(&self, id: &throw_error::ErrorId) { self.errors.update(|map| { map.remove(id); }); } } /// A struct to hold all the possible errors that could be provided by child Views #[derive(Debug, Clone, Default)] #[repr(transparent)] pub struct Errors(FxHashMap<ErrorId, Error>); impl Errors { /// Returns `true` if there are no errors. #[inline(always)] pub fn is_empty(&self) -> bool { self.0.is_empty() } /// Add an error to Errors that will be processed by `<ErrorBoundary/>` pub fn insert<E>(&mut self, key: ErrorId, error: E) where E: Into<Error>, { self.0.insert(key, error.into()); } /// Add an error with the default key for errors outside the reactive system pub fn insert_with_default_key<E>(&mut self, error: E) where E: Into<Error>, { self.0.insert(Default::default(), error.into()); } /// Remove an error to Errors that will be processed by `<ErrorBoundary/>` pub fn remove(&mut self, key: &ErrorId) -> Option<Error> { self.0.remove(key) } /// An iterator over all the errors, in arbitrary order. #[inline(always)] pub fn iter(&self) -> Iter<'_> { Iter(self.0.iter()) } } impl IntoIterator for Errors { type Item = (ErrorId, Error); type IntoIter = IntoIter; #[inline(always)] fn into_iter(self) -> Self::IntoIter { IntoIter(self.0.into_iter()) } } /// An owning iterator over all the errors contained in the [`Errors`] struct. #[repr(transparent)] pub struct IntoIter(std::collections::hash_map::IntoIter<ErrorId, Error>); impl Iterator for IntoIter { type Item = (ErrorId, Error); #[inline(always)] fn next( &mut self, ) -> std::option::Option<<Self as std::iter::Iterator>::Item> { self.0.next() } } /// An iterator over all the errors contained in the [`Errors`] struct. #[repr(transparent)] pub struct Iter<'a>(std::collections::hash_map::Iter<'a, ErrorId, Error>); impl<'a> Iterator for Iter<'a> { type Item = (&'a ErrorId, &'a Error); #[inline(always)] fn next( &mut self, ) -> std::option::Option<<Self as std::iter::Iterator>::Item> { self.0.next() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/portal.rs
leptos/src/portal.rs
use crate::{children::TypedChildrenFn, mount, IntoView}; use leptos_dom::helpers::document; use leptos_macro::component; use reactive_graph::{effect::Effect, graph::untrack, owner::Owner}; use std::sync::Arc; /// Renders components somewhere else in the DOM. /// /// Useful for inserting modals and tooltips outside of a cropping layout. /// If no mount point is given, the portal is inserted in `document.body`; /// it is wrapped in a `<div>` unless `is_svg` is `true` in which case it's wrapped in a `<g>`. /// Setting `use_shadow` to `true` places the element in a shadow root to isolate styles. #[cfg_attr(feature = "tracing", tracing::instrument(level = "trace", skip_all))] #[component] pub fn Portal<V>( /// Target element where the children will be appended #[prop(into, optional)] mount: Option<web_sys::Element>, /// Whether to use a shadow DOM inside `mount`. Defaults to `false`. #[prop(optional)] use_shadow: bool, /// When using SVG this has to be set to `true`. Defaults to `false`. #[prop(optional)] is_svg: bool, /// The children to teleport into the `mount` element children: TypedChildrenFn<V>, ) -> impl IntoView where V: IntoView + 'static, { if cfg!(target_arch = "wasm32") && Owner::current_shared_context() .map(|sc| sc.is_browser()) .unwrap_or(true) { use send_wrapper::SendWrapper; use wasm_bindgen::JsCast; let mount = mount.unwrap_or_else(|| { document().body().expect("body to exist").unchecked_into() }); let children = children.into_inner(); Effect::new(move |_| { let container = if is_svg { document() .create_element_ns(Some("http://www.w3.org/2000/svg"), "g") .expect("SVG element creation to work") } else { document() .create_element("div") .expect("HTML element creation to work") }; let render_root = if use_shadow { container .attach_shadow(&web_sys::ShadowRootInit::new( web_sys::ShadowRootMode::Open, )) .map(|root| root.unchecked_into()) .unwrap_or(container.clone()) } else { container.clone() }; let _ = mount.append_child(&container); let handle = SendWrapper::new(( mount::mount_to(render_root.unchecked_into(), { let children = Arc::clone(&children); move || untrack(|| children()) }), mount.clone(), container, )); Owner::on_cleanup({ move || { let (handle, mount, container) = handle.take(); drop(handle); let _ = mount.remove_child(&container); } }) }); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/show_let.rs
leptos/src/show_let.rs
use crate::{children::ViewFn, IntoView}; use leptos_macro::component; use reactive_graph::traits::Get; use std::{marker::PhantomData, sync::Arc}; use tachys::either::Either; /// Like `<Show>` but for `Option`. This is a shortcut for /// /// ```ignore /// value.map(|value| { /// view! { ... } /// }) /// ``` /// /// If you specify a `fallback` it is equvalent to /// /// ```ignore /// value /// .map( /// |value| children(value), /// ) /// .unwrap_or_else(fallback) /// ``` /// /// ## Example /// /// ``` /// # use leptos::prelude::*; /// # /// # #[component] /// # pub fn Example() -> impl IntoView { /// let (opt_value, set_opt_value) = signal(None::<i32>); /// /// view! { /// <ShowLet some=opt_value let:value> /// "We have a value: " {value} /// </ShowLet> /// } /// # } /// ``` /// /// You can also specify a fallback: /// ``` /// # use leptos::prelude::*; /// # /// # #[component] /// # pub fn Example() -> impl IntoView { /// let (opt_value, set_opt_value) = signal(None::<i32>); /// /// view! { /// <ShowLet some=opt_value let:value fallback=|| "Got nothing"> /// "We have a value: " {value} /// </ShowLet> /// } /// # } /// ``` /// /// In addition to signals you can also use a closure that returns an `Option`: /// /// ``` /// # use leptos::prelude::*; /// # /// # #[component] /// # pub fn Example() -> impl IntoView { /// let (opt_value, set_opt_value) = signal(None::<i32>); /// /// view! { /// <ShowLet some=move || opt_value.get().map(|v| v * 2) let:value> /// "We have a value: " {value} /// </ShowLet> /// } /// # } /// ``` #[component] pub fn ShowLet<T, ChFn, V, M>( /// The children will be shown whenever `value` is `Some`. /// /// They take the inner value as an argument. Use `let:` to bind the value to a variable. children: ChFn, /// A signal of type `Option` or a closure that returns an `Option`. /// If the value is `Some`, the children will be shown. /// Otherwise the fallback will be shown, if present. some: impl IntoOptionGetter<T, M>, /// A closure that returns what gets rendered when the value is `None`. /// By default this is the empty view. /// /// You can think of it as the closure inside `.unwrap_or_else(|| fallback())`. #[prop(optional, into)] fallback: ViewFn, /// Marker for generic parameters. Ignore this. #[prop(optional)] _marker: PhantomData<(T, M)>, ) -> impl IntoView where ChFn: Fn(T) -> V + Send + Clone + 'static, V: IntoView + 'static, T: 'static, { let getter = some.into_option_getter(); move || { let children = children.clone(); let fallback = fallback.clone(); getter .run() .map(move |t| Either::Left(children(t))) .unwrap_or_else(move || Either::Right(fallback.run())) } } /// Servers as a wrapper for both, an `Option` signal or a closure that returns an `Option`. pub struct OptionGetter<T>(Arc<dyn Fn() -> Option<T> + Send + Sync + 'static>); impl<T> Clone for OptionGetter<T> { fn clone(&self) -> Self { Self(Arc::clone(&self.0)) } } impl<T> OptionGetter<T> { /// Runs the getter and returns the result. pub fn run(&self) -> Option<T> { (self.0)() } } /// Conversion trait for creating an `OptionGetter` from a closure or a signal. pub trait IntoOptionGetter<T, M> { /// Converts the given value into an `OptionGetter`. fn into_option_getter(self) -> OptionGetter<T>; } /// Marker type for creating an `OptionGetter` from a closure. /// Used so that the compiler doesn't complain about double implementations of the trait `IntoOptionGetter`. pub struct FunctionMarker; impl<T, F> IntoOptionGetter<T, FunctionMarker> for F where F: Fn() -> Option<T> + Send + Sync + 'static, { fn into_option_getter(self) -> OptionGetter<T> { OptionGetter(Arc::new(self)) } } /// Marker type for creating an `OptionGetter` from a signal. /// Used so that the compiler doesn't complain about double implementations of the trait `IntoOptionGetter`. pub struct SignalMarker; impl<T, S> IntoOptionGetter<T, SignalMarker> for S where S: Get<Value = Option<T>> + Clone + Send + Sync + 'static, { fn into_option_getter(self) -> OptionGetter<T> { let cloned = self.clone(); OptionGetter(Arc::new(move || cloned.get())) } } /// Marker type for creating an `OptionGetter` from a static value. /// Used so that the compiler doesn't complain about double implementations of the trait `IntoOptionGetter`. pub struct StaticMarker; impl<T> IntoOptionGetter<T, StaticMarker> for Option<T> where T: Clone + Send + Sync + 'static, { fn into_option_getter(self) -> OptionGetter<T> { OptionGetter(Arc::new(move || self.clone())) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/nonce.rs
leptos/src/nonce.rs
use crate::context::{provide_context, use_context}; use base64::{ alphabet, engine::{self, general_purpose}, Engine, }; use rand::{rng, RngCore}; use std::{fmt::Display, ops::Deref, sync::Arc}; use tachys::html::attribute::AttributeValue; /// A cryptographic nonce ("number used once") which can be /// used by Content Security Policy to determine whether or not a given /// resource will be allowed to load. /// /// When the `nonce` feature is enabled on one of the server integrations, /// a nonce is generated during server rendering and added to all inline /// scripts used for HTML streaming and resource loading. /// /// The nonce being used during the current server response can be /// accessed using [`use_nonce`]. /// /// ```rust,ignore /// #[component] /// pub fn App() -> impl IntoView { /// provide_meta_context; /// /// view! { /// // use `leptos_meta` to insert a <meta> tag with the CSP /// <Meta /// http_equiv="Content-Security-Policy" /// content=move || { /// // this will insert the CSP with nonce on the server, be empty on client /// use_nonce() /// .map(|nonce| { /// format!( /// "default-src 'self'; script-src 'strict-dynamic' 'nonce-{nonce}' \ /// 'wasm-unsafe-eval'; style-src 'nonce-{nonce}';" /// ) /// }) /// .unwrap_or_default() /// } /// /> /// // manually insert nonce during SSR on inline script /// <script nonce=use_nonce()>"console.log('Hello, world!');"</script> /// // leptos_meta <Style/> and <Script/> automatically insert the nonce /// <Style>"body { color: blue; }"</Style> /// <p>"Test"</p> /// } /// } /// ``` #[derive(Clone, Debug, PartialEq, Eq, Hash)] pub struct Nonce(pub(crate) Arc<str>); impl Nonce { /// Returns a reference to the inner reference-counted string slice representing the nonce. pub fn as_inner(&self) -> &Arc<str> { &self.0 } } impl Deref for Nonce { type Target = str; fn deref(&self) -> &Self::Target { &self.0 } } impl Display for Nonce { fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result { write!(f, "{}", self.0) } } impl AttributeValue for Nonce { type AsyncOutput = Self; type State = <Arc<str> as AttributeValue>::State; type Cloneable = Self; type CloneableOwned = Self; fn html_len(&self) -> usize { self.0.len() } fn to_html(self, key: &str, buf: &mut String) { <Arc<str> as AttributeValue>::to_html(self.0, key, buf) } fn to_template(_key: &str, _buf: &mut String) {} fn hydrate<const FROM_SERVER: bool>( self, key: &str, el: &tachys::renderer::types::Element, ) -> Self::State { <Arc<str> as AttributeValue>::hydrate::<FROM_SERVER>(self.0, key, el) } fn build( self, el: &tachys::renderer::types::Element, key: &str, ) -> Self::State { <Arc<str> as AttributeValue>::build(self.0, el, key) } fn rebuild(self, key: &str, state: &mut Self::State) { <Arc<str> as AttributeValue>::rebuild(self.0, key, state) } fn into_cloneable(self) -> Self::Cloneable { self } fn into_cloneable_owned(self) -> Self::CloneableOwned { self } fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } } /// Accesses the nonce that has been generated during the current /// server response. This can be added to inline `<script>` and /// `<style>` tags for compatibility with a Content Security Policy. /// /// ```rust,ignore /// #[component] /// pub fn App() -> impl IntoView { /// provide_meta_context; /// /// view! { /// // use `leptos_meta` to insert a <meta> tag with the CSP /// <Meta /// http_equiv="Content-Security-Policy" /// content=move || { /// // this will insert the CSP with nonce on the server, be empty on client /// use_nonce() /// .map(|nonce| { /// format!( /// "default-src 'self'; script-src 'strict-dynamic' 'nonce-{nonce}' \ /// 'wasm-unsafe-eval'; style-src 'nonce-{nonce}';" /// ) /// }) /// .unwrap_or_default() /// } /// /> /// // manually insert nonce during SSR on inline script /// <script nonce=use_nonce()>"console.log('Hello, world!');"</script> /// // leptos_meta <Style/> and <Script/> automatically insert the nonce /// <Style>"body { color: blue; }"</Style> /// <p>"Test"</p> /// } /// } /// ``` pub fn use_nonce() -> Option<Nonce> { use_context::<Nonce>() } /// Generates a nonce and provides it via context. pub fn provide_nonce() { provide_context(Nonce::new()) } const NONCE_ENGINE: engine::GeneralPurpose = engine::GeneralPurpose::new(&alphabet::URL_SAFE, general_purpose::NO_PAD); impl Nonce { /// Generates a new nonce from 16 bytes (128 bits) of random data. pub fn new() -> Self { let mut rng = rng(); let mut bytes = [0; 16]; rng.fill_bytes(&mut bytes); Nonce(NONCE_ENGINE.encode(bytes).into()) } } impl Default for Nonce { fn default() -> Self { Self::new() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/into_view.rs
leptos/src/into_view.rs
use std::borrow::Cow; use tachys::{ html::attribute::{any_attribute::AnyAttribute, Attribute}, hydration::Cursor, ssr::StreamBuilder, view::{ add_attr::AddAnyAttr, Position, PositionState, Render, RenderHtml, ToTemplate, }, }; /// A wrapper for any kind of view. #[derive(Debug, Clone, PartialEq, Eq, Hash, PartialOrd, Ord)] pub struct View<T> where T: Sized, { inner: T, #[cfg(debug_assertions)] view_marker: Option<Cow<'static, str>>, } impl<T> View<T> { /// Wraps the view. pub fn new(inner: T) -> Self { Self { inner, #[cfg(debug_assertions)] view_marker: None, } } /// Unwraps the view, returning the inner type. pub fn into_inner(self) -> T { self.inner } /// Adds a view marker, which is used for hot-reloading and debug purposes. #[inline(always)] pub fn with_view_marker( #[allow(unused_mut)] // used in debug mut self, #[allow(unused_variables)] // used in debug view_marker: impl Into<Cow<'static, str>>, ) -> Self { #[cfg(debug_assertions)] { self.view_marker = Some(view_marker.into()); } self } } /// A trait that is implemented for types that can be rendered. pub trait IntoView where Self: Sized + Render + RenderHtml + Send, { /// Wraps the inner type. fn into_view(self) -> View<Self>; } impl<T> IntoView for T where T: Sized + Render + RenderHtml + Send, //+ AddAnyAttr, { fn into_view(self) -> View<Self> { View { inner: self, #[cfg(debug_assertions)] view_marker: None, } } } impl<T: Render> Render for View<T> { type State = T::State; fn build(self) -> Self::State { self.inner.build() } fn rebuild(self, state: &mut Self::State) { self.inner.rebuild(state) } } impl<T: RenderHtml> RenderHtml for View<T> { type AsyncOutput = T::AsyncOutput; type Owned = View<T::Owned>; const MIN_LENGTH: usize = <T as RenderHtml>::MIN_LENGTH; const EXISTS: bool = <T as RenderHtml>::EXISTS; async fn resolve(self) -> Self::AsyncOutput { self.inner.resolve().await } fn dry_resolve(&mut self) { self.inner.dry_resolve(); } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { #[cfg(debug_assertions)] let vm = if option_env!("LEPTOS_WATCH").is_some() { self.view_marker.to_owned() } else { None }; #[cfg(debug_assertions)] if let Some(vm) = vm.as_ref() { buf.push_str(&format!("<!--hot-reload|{vm}|open-->")); } self.inner.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); #[cfg(debug_assertions)] if let Some(vm) = vm.as_ref() { buf.push_str(&format!("<!--hot-reload|{vm}|close-->")); } } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { #[cfg(debug_assertions)] let vm = if option_env!("LEPTOS_WATCH").is_some() { self.view_marker.to_owned() } else { None }; #[cfg(debug_assertions)] if let Some(vm) = vm.as_ref() { buf.push_sync(&format!("<!--hot-reload|{vm}|open-->")); } self.inner.to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); #[cfg(debug_assertions)] if let Some(vm) = vm.as_ref() { buf.push_sync(&format!("<!--hot-reload|{vm}|close-->")); } } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { self.inner.hydrate::<FROM_SERVER>(cursor, position) } async fn hydrate_async( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { self.inner.hydrate_async(cursor, position).await } fn into_owned(self) -> Self::Owned { View { inner: self.inner.into_owned(), #[cfg(debug_assertions)] view_marker: self.view_marker, } } } impl<T: ToTemplate> ToTemplate for View<T> { fn to_template( buf: &mut String, class: &mut String, style: &mut String, inner_html: &mut String, position: &mut Position, ) { T::to_template(buf, class, style, inner_html, position); } } impl<T: AddAnyAttr> AddAnyAttr for View<T> { type Output<SomeNewAttr: Attribute> = View<T::Output<SomeNewAttr>>; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let View { inner, #[cfg(debug_assertions)] view_marker, } = self; View { inner: inner.add_any_attr(attr), #[cfg(debug_assertions)] view_marker, } } } /// Collects some iterator of views into a list, so they can be rendered. /// /// This is a shorthand for `.collect::<Vec<_>>()`, and allows any iterator of renderable /// items to be collected into a renderable collection. pub trait CollectView { /// The inner view type. type View: IntoView; /// Collects the iterator into a list of views. fn collect_view(self) -> Vec<Self::View>; } impl<It, V> CollectView for It where It: IntoIterator<Item = V>, V: IntoView, { type View = V; fn collect_view(self) -> Vec<Self::View> { self.into_iter().collect() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/form.rs
leptos/src/form.rs
use crate::{children::Children, component, prelude::*, IntoView}; use leptos_dom::helpers::window; use leptos_server::{ServerAction, ServerMultiAction}; use serde::de::DeserializeOwned; use server_fn::{ client::Client, codec::PostUrl, error::{IntoAppError, ServerFnErrorErr}, request::ClientReq, Http, ServerFn, }; use tachys::{ either::Either, html::{ element::{form, Form}, event::submit, }, reactive_graph::node_ref::NodeRef, }; use thiserror::Error; use wasm_bindgen::{JsCast, JsValue, UnwrapThrowExt}; use web_sys::{ Event, FormData, HtmlButtonElement, HtmlFormElement, HtmlInputElement, SubmitEvent, }; /// Automatically turns a server [Action](leptos_server::Action) into an HTML /// [`form`](https://developer.mozilla.org/en-US/docs/Web/HTML/Element/form) /// progressively enhanced to use client-side routing. /// /// ## Encoding /// **Note:** `<ActionForm/>` only works with server functions that use the /// default `Url` encoding. This is to ensure that `<ActionForm/>` works correctly /// both before and after WASM has loaded. /// /// ## Complex Inputs /// Server function arguments that are structs with nested serializable fields /// should make use of indexing notation of `serde_qs`. /// /// ```rust /// # use leptos::prelude::*; /// use leptos::form::ActionForm; /// /// #[derive(serde::Serialize, serde::Deserialize, Debug, Clone)] /// struct HeftyData { /// first_name: String, /// last_name: String, /// } /// /// #[component] /// fn ComplexInput() -> impl IntoView { /// let submit = ServerAction::<VeryImportantFn>::new(); /// /// view! { /// <ActionForm action=submit> /// <input type="text" name="hefty_arg[first_name]" value="leptos"/> /// <input /// type="text" /// name="hefty_arg[last_name]" /// value="closures-everywhere" /// /> /// <input type="submit"/> /// </ActionForm> /// } /// } /// /// #[server] /// async fn very_important_fn( /// hefty_arg: HeftyData, /// ) -> Result<(), ServerFnError> { /// assert_eq!(hefty_arg.first_name.as_str(), "leptos"); /// assert_eq!(hefty_arg.last_name.as_str(), "closures-everywhere"); /// Ok(()) /// } /// ``` #[cfg_attr(feature = "tracing", tracing::instrument(level = "trace", skip_all))] #[component] pub fn ActionForm<ServFn, OutputProtocol>( /// The action from which to build the form. action: ServerAction<ServFn>, /// A [`NodeRef`] in which the `<form>` element should be stored. #[prop(optional)] node_ref: Option<NodeRef<Form>>, /// Component children; should include the HTML of the form elements. children: Children, ) -> impl IntoView where ServFn: DeserializeOwned + ServerFn<Protocol = Http<PostUrl, OutputProtocol>> + Clone + Send + Sync + 'static, <<ServFn::Client as Client<ServFn::Error>>::Request as ClientReq< ServFn::Error, >>::FormData: From<FormData>, ServFn: Send + Sync + 'static, ServFn::Output: Send + Sync + 'static, ServFn::Error: Send + Sync + 'static, <ServFn as ServerFn>::Client: Client<<ServFn as ServerFn>::Error>, { // if redirect hook has not yet been set (by a router), defaults to a browser redirect _ = server_fn::redirect::set_redirect_hook(|loc: &str| { if let Some(url) = resolve_redirect_url(loc) { _ = window().location().set_href(&url.href()); } }); let version = action.version(); let value = action.value(); let on_submit = { move |ev: SubmitEvent| { if ev.default_prevented() { return; } ev.prevent_default(); match ServFn::from_event(&ev) { Ok(new_input) => { action.dispatch(new_input); } Err(err) => { crate::logging::error!( "Error converting form field into server function \ arguments: {err:?}" ); value.set(Some(Err(ServerFnErrorErr::Serialization( err.to_string(), ) .into_app_error()))); version.update(|n| *n += 1); } } } }; let action_form = form() .action(ServFn::url()) .method("post") .on(submit, on_submit) .child(children()); if let Some(node_ref) = node_ref { Either::Left(action_form.node_ref(node_ref)) } else { Either::Right(action_form) } } /// Automatically turns a server [MultiAction](leptos_server::MultiAction) into an HTML /// [`form`](https://developer.mozilla.org/en-US/docs/Web/HTML/Element/form) /// progressively enhanced to use client-side routing. #[component] pub fn MultiActionForm<ServFn, OutputProtocol>( /// The action from which to build the form. action: ServerMultiAction<ServFn>, /// A [`NodeRef`] in which the `<form>` element should be stored. #[prop(optional)] node_ref: Option<NodeRef<Form>>, /// Component children; should include the HTML of the form elements. children: Children, ) -> impl IntoView where ServFn: Send + Sync + Clone + DeserializeOwned + ServerFn<Protocol = Http<PostUrl, OutputProtocol>> + 'static, ServFn::Output: Send + Sync + 'static, <<ServFn::Client as Client<ServFn::Error>>::Request as ClientReq< ServFn::Error, >>::FormData: From<FormData>, ServFn::Error: Send + Sync + 'static, <ServFn as ServerFn>::Client: Client<<ServFn as ServerFn>::Error>, { // if redirect hook has not yet been set (by a router), defaults to a browser redirect _ = server_fn::redirect::set_redirect_hook(|loc: &str| { if let Some(url) = resolve_redirect_url(loc) { _ = window().location().set_href(&url.href()); } }); let on_submit = move |ev: SubmitEvent| { if ev.default_prevented() { return; } ev.prevent_default(); match ServFn::from_event(&ev) { Ok(new_input) => { action.dispatch(new_input); } Err(err) => { action.dispatch_sync(Err(ServerFnErrorErr::Serialization( err.to_string(), ) .into_app_error())); } } }; let action_form = form() .action(ServFn::url()) .method("post") .attr("method", "post") .on(submit, on_submit) .child(children()); if let Some(node_ref) = node_ref { Either::Left(action_form.node_ref(node_ref)) } else { Either::Right(action_form) } } /// Resolves a redirect location to an (absolute) URL. pub(crate) fn resolve_redirect_url(loc: &str) -> Option<web_sys::Url> { let origin = match window().location().origin() { Ok(origin) => origin, Err(e) => { leptos::logging::error!("Failed to get origin: {:#?}", e); return None; } }; // TODO: Use server function's URL as base instead. let base = origin; match web_sys::Url::new_with_base(loc, &base) { Ok(url) => Some(url), Err(e) => { leptos::logging::error!( "Invalid redirect location: {}", e.as_string().unwrap_or_default(), ); None } } } /// Tries to deserialize a type from form data. This can be used for client-side /// validation during form submission. pub trait FromFormData where Self: Sized + serde::de::DeserializeOwned, { /// Tries to deserialize the data, given only the `submit` event. fn from_event(ev: &web_sys::Event) -> Result<Self, FromFormDataError>; /// Tries to deserialize the data, given the actual form data. fn from_form_data( form_data: &web_sys::FormData, ) -> Result<Self, serde_qs::Error>; } /// Errors that can arise when converting from an HTML event or form into a Rust data type. #[derive(Error, Debug)] pub enum FromFormDataError { /// Could not find a `<form>` connected to the event. #[error("Could not find <form> connected to event.")] MissingForm(Event), /// Could not create `FormData` from the form. #[error("Could not create FormData from <form>: {0:?}")] FormData(JsValue), /// Failed to deserialize this Rust type from the form data. #[error("Deserialization error: {0:?}")] Deserialization(serde_qs::Error), } impl<T> FromFormData for T where T: serde::de::DeserializeOwned, { fn from_event(ev: &Event) -> Result<Self, FromFormDataError> { let submit_ev = ev.unchecked_ref(); let form_data = form_data_from_event(submit_ev)?; Self::from_form_data(&form_data) .map_err(FromFormDataError::Deserialization) } fn from_form_data( form_data: &web_sys::FormData, ) -> Result<Self, serde_qs::Error> { let data = web_sys::UrlSearchParams::new_with_str_sequence_sequence(form_data) .unwrap_throw(); let data = data.to_string().as_string().unwrap_or_default(); serde_qs::Config::new(5, false).deserialize_str::<Self>(&data) } } fn form_data_from_event( ev: &SubmitEvent, ) -> Result<FormData, FromFormDataError> { let submitter = ev.submitter(); let mut submitter_name_value = None; let opt_form = match &submitter { Some(el) => { if let Some(form) = el.dyn_ref::<HtmlFormElement>() { Some(form.clone()) } else if let Some(input) = el.dyn_ref::<HtmlInputElement>() { submitter_name_value = Some((input.name(), input.value())); Some(ev.target().unwrap().unchecked_into()) } else if let Some(button) = el.dyn_ref::<HtmlButtonElement>() { submitter_name_value = Some((button.name(), button.value())); Some(ev.target().unwrap().unchecked_into()) } else { None } } None => ev.target().map(|form| form.unchecked_into()), }; match opt_form.as_ref().map(FormData::new_with_form) { None => Err(FromFormDataError::MissingForm(ev.clone().into())), Some(Err(e)) => Err(FromFormDataError::FormData(e)), Some(Ok(form_data)) => { if let Some((name, value)) = submitter_name_value { form_data .append_with_str(&name, &value) .map_err(FromFormDataError::FormData)?; } Ok(form_data) } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/transition.rs
leptos/src/transition.rs
use crate::{ children::{TypedChildren, ViewFnOnce}, error::ErrorBoundarySuspendedChildren, suspense_component::SuspenseBoundary, IntoView, }; use leptos_macro::component; use reactive_graph::{ computed::{suspense::SuspenseContext, ArcMemo}, effect::Effect, owner::{provide_context, use_context, Owner}, signal::ArcRwSignal, traits::{Get, Set, Track, With, WithUntracked}, wrappers::write::SignalSetter, }; use slotmap::{DefaultKey, SlotMap}; use std::sync::Arc; use tachys::reactive_graph::OwnedView; /// If any [`Resource`](crate::prelude::Resource) is read in the `children` of this /// component, it will show the `fallback` while they are loading. Once all are resolved, /// it will render the `children`. /// /// Unlike [`Suspense`](crate::prelude::Suspense), this will not fall /// back to the `fallback` state if there are further changes after the initial load. /// /// Note that the `children` will be rendered initially (in order to capture the fact that /// those resources are read under the suspense), so you cannot assume that resources read /// synchronously have /// `Some` value in `children`. However, you can read resources asynchronously by using /// [Suspend](crate::prelude::Suspend). /// /// ``` /// # use leptos::prelude::*; /// # if false { // don't run in doctests /// async fn fetch_cats(how_many: u32) -> Vec<String> { vec![] } /// /// let (cat_count, set_cat_count) = signal::<u32>(1); /// /// let cats = Resource::new(move || cat_count.get(), |count| fetch_cats(count)); /// /// view! { /// <div> /// <Transition fallback=move || view! { <p>"Loading (Suspense Fallback)..."</p> }> /// // you can access a resource synchronously /// {move || { /// cats.get().map(|data| { /// data /// .into_iter() /// .map(|src| { /// view! { /// <img src={src}/> /// } /// }) /// .collect_view() /// }) /// } /// } /// // or you can use `Suspend` to read resources asynchronously /// {move || Suspend::new(async move { /// cats.await /// .into_iter() /// .map(|src| { /// view! { /// <img src={src}/> /// } /// }) /// .collect_view() /// })} /// </Transition> /// </div> /// } /// # ;} /// ``` #[component] pub fn Transition<Chil>( /// Will be displayed while resources are pending. By default this is the empty view. #[prop(optional, into)] fallback: ViewFnOnce, /// A function that will be called when the component transitions into or out of /// the `pending` state, with its argument indicating whether it is pending (`true`) /// or not pending (`false`). #[prop(optional, into)] set_pending: Option<SignalSetter<bool>>, children: TypedChildren<Chil>, ) -> impl IntoView where Chil: IntoView + Send + 'static, { let error_boundary_parent = use_context::<ErrorBoundarySuspendedChildren>(); let owner = Owner::new(); owner.with(|| { let (starts_local, id) = { Owner::current_shared_context() .map(|sc| { let id = sc.next_id(); (sc.get_incomplete_chunk(&id), id) }) .unwrap_or_else(|| (false, Default::default())) }; let fallback = fallback.run(); let children = children.into_inner()(); let tasks = ArcRwSignal::new(SlotMap::<DefaultKey, ()>::new()); provide_context(SuspenseContext { tasks: tasks.clone(), }); let none_pending = ArcMemo::new({ let tasks = tasks.clone(); move |prev: Option<&bool>| { tasks.track(); if prev.is_none() && starts_local { false } else { tasks.with(SlotMap::is_empty) } } }); let has_tasks = Arc::new(move || !tasks.with_untracked(SlotMap::is_empty)); if let Some(set_pending) = set_pending { Effect::new_isomorphic({ let none_pending = none_pending.clone(); move |_| { set_pending.set(!none_pending.get()); } }); } OwnedView::new(SuspenseBoundary::<true, _, _> { id, none_pending, fallback, children, error_boundary_parent, has_tasks, }) }) }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/for_loop.rs
leptos/src/for_loop.rs
use crate::into_view::IntoView; use leptos_macro::component; use reactive_graph::{ owner::Owner, signal::{ArcRwSignal, ReadSignal}, traits::Set, }; use std::hash::Hash; use tachys::{ reactive_graph::OwnedView, view::keyed::{keyed, SerializableKey}, }; /// Iterates over children and displays them, keyed by the `key` function given. /// /// This is much more efficient than naively iterating over nodes with `.iter().map(|n| view! { ... })...`, /// as it avoids re-creating DOM nodes that are not being changed. /// /// ``` /// # use leptos::prelude::*; /// /// #[derive(Copy, Clone, Debug, PartialEq, Eq)] /// struct Counter { /// id: usize, /// count: RwSignal<i32> /// } /// /// #[component] /// fn Counters() -> impl IntoView { /// let (counters, set_counters) = create_signal::<Vec<Counter>>(vec![]); /// /// view! { /// <div> /// <For /// // a function that returns the items we're iterating over; a signal is fine /// each=move || counters.get() /// // a unique key for each item /// key=|counter| counter.id /// // renders each item to a view /// children=move |counter: Counter| { /// view! { /// <button>"Value: " {move || counter.count.get()}</button> /// } /// } /// /> /// </div> /// } /// } /// ``` /// /// For convenience, you can also choose to write template code directly in the `<For>` /// component, using the `let` syntax: /// /// ``` /// # use leptos::prelude::*; /// /// # #[derive(Copy, Clone, Debug, PartialEq, Eq)] /// # struct Counter { /// # id: usize, /// # count: RwSignal<i32> /// # } /// # /// # #[component] /// # fn Counters() -> impl IntoView { /// # let (counters, set_counters) = create_signal::<Vec<Counter>>(vec![]); /// # /// view! { /// <div> /// <For /// each=move || counters.get() /// key=|counter| counter.id /// let(counter) /// > /// <button>"Value: " {move || counter.count.get()}</button> /// </For> /// </div> /// } /// # } /// ``` /// /// The `let` syntax also supports destructuring the pattern of your data. /// `let((one, two))` in the case of tuples, and `let(Struct { field_one, field_two })` /// in the case of structs. /// /// ``` /// # use leptos::prelude::*; /// /// # #[derive(Copy, Clone, Debug, PartialEq, Eq)] /// # struct Counter { /// # id: usize, /// # count: RwSignal<i32> /// # } /// # /// # #[component] /// # fn Counters() -> impl IntoView { /// # let (counters, set_counters) = create_signal::<Vec<Counter>>(vec![]); /// # /// view! { /// <div> /// <For /// each=move || counters.get() /// key=|counter| counter.id /// let(Counter { id, count }) /// > /// <button>"Value: " {move || count.get()}</button> /// </For> /// </div> /// } /// # } /// ``` #[cfg_attr(feature = "tracing", tracing::instrument(level = "trace", skip_all))] #[component] pub fn For<IF, I, T, EF, N, KF, K>( /// Items over which the component should iterate. each: IF, /// A key function that will be applied to each item. key: KF, /// A function that takes the item, and returns the view that will be displayed for each item. children: EF, ) -> impl IntoView where IF: Fn() -> I + Send + 'static, I: IntoIterator<Item = T> + Send + 'static, EF: Fn(T) -> N + Send + Clone + 'static, N: IntoView + 'static, KF: Fn(&T) -> K + Send + Clone + 'static, K: Eq + Hash + SerializableKey + 'static, T: Send + 'static, { // this takes the owner of the For itself // this will end up with N + 1 children // 1) the effect for the `move || keyed(...)` updates // 2) an owner for each child // // this means // a) the reactive owner for each row will not be cleared when the whole list updates // b) context provided in each row will not wipe out the others let parent = Owner::current().expect("no reactive owner"); let children = move |_, child| { let owner = parent.with(Owner::new); let view = owner.with(|| children(child)); (|_| {}, OwnedView::new_with_owner(view, owner)) }; move || keyed(each(), key.clone(), children.clone()) } /// Iterates over children and displays them, keyed by the `key` function given. /// /// Compared with For, it has an additional index parameter, which can be used to obtain the current index in real time. /// /// This is much more efficient than naively iterating over nodes with `.iter().map(|n| view! { ... })...`, /// as it avoids re-creating DOM nodes that are not being changed. /// /// ``` /// # use leptos::prelude::*; /// /// #[derive(Copy, Clone, Debug, PartialEq, Eq)] /// struct Counter { /// id: usize, /// count: RwSignal<i32> /// } /// /// #[component] /// fn Counters() -> impl IntoView { /// let (counters, set_counters) = create_signal::<Vec<Counter>>(vec![]); /// /// view! { /// <div> /// <ForEnumerate /// // a function that returns the items we're iterating over; a signal is fine /// each=move || counters.get() /// // a unique key for each item /// key=|counter| counter.id /// // renders each item to a view /// children={move |index: ReadSignal<usize>, counter: Counter| { /// view! { /// <button>{move || index.get()} ". Value: " {move || counter.count.get()}</button> /// } /// }} /// /> /// </div> /// } /// } /// ``` #[cfg_attr(feature = "tracing", tracing::instrument(level = "trace", skip_all))] #[component] pub fn ForEnumerate<IF, I, T, EF, N, KF, K>( /// Items over which the component should iterate. each: IF, /// A key function that will be applied to each item. key: KF, /// A function that takes the index and the item, and returns the view that will be displayed for each item. children: EF, ) -> impl IntoView where IF: Fn() -> I + Send + 'static, I: IntoIterator<Item = T> + Send + 'static, EF: Fn(ReadSignal<usize>, T) -> N + Send + Clone + 'static, N: IntoView + 'static, KF: Fn(&T) -> K + Send + Clone + 'static, K: Eq + Hash + SerializableKey + 'static, T: Send + 'static, { // this takes the owner of the For itself // this will end up with N + 1 children // 1) the effect for the `move || keyed(...)` updates // 2) an owner for each child // // this means // a) the reactive owner for each row will not be cleared when the whole list updates // b) context provided in each row will not wipe out the others let parent = Owner::current().expect("no reactive owner"); let children = move |index, child| { let owner = parent.with(Owner::new); let (index, set_index) = ArcRwSignal::new(index).split(); let view = owner.with(|| children(index.into(), child)); ( move |index| set_index.set(index), OwnedView::new_with_owner(view, owner), ) }; move || keyed(each(), key.clone(), children.clone()) } /* #[cfg(test)] mod tests { use crate::prelude::*; use leptos_macro::view; use tachys::{html::element::HtmlElement, prelude::ElementChild}; #[test] fn creates_list() { Owner::new().with(|| { let values = RwSignal::new(vec![1, 2, 3, 4, 5]); let list: View<HtmlElement<_, _, _>> = view! { <ol> <For each=move || values.get() key=|i| *i let:i> <li>{i}</li> </For> </ol> }; assert_eq!( list.to_html(), "<ol><li>1</li><li>2</li><li>3</li><li>4</li><li>5</li><!></\ ol>" ); }); } #[test] fn creates_list_enumerate() { Owner::new().with(|| { let values = RwSignal::new(vec![1, 2, 3, 4, 5]); let list: View<HtmlElement<_, _, _>> = view! { <ol> <ForEnumerate each=move || values.get() key=|i| *i let(index, i)> <li>{move || index.get()}"-"{i}</li> </ForEnumerate> </ol> }; assert_eq!( list.to_html(), "<ol><li>0<!>-<!>1</li><li>1<!>-<!>2</li><li>2<!>-<!>3</li><li>3\ <!>-<!>4</li><li>4<!>-<!>5</li><!></ol>" ); let list: View<HtmlElement<_, _, _>> = view! { <ol> <ForEnumerate each=move || values.get() key=|i| *i let(index, i)> <li>{move || index.get()}"-"{i}</li> </ForEnumerate> </ol> }; values.set(vec![5, 4, 1, 2, 3]); assert_eq!( list.to_html(), "<ol><li>0<!>-<!>5</li><li>1<!>-<!>4</li><li>2<!>-<!>1</li><li>3\ <!>-<!>2</li><li>4<!>-<!>3</li><!></ol>" ); }); } } */
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/from_form_data.rs
leptos/src/from_form_data.rs
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/await_.rs
leptos/src/await_.rs
use crate::{prelude::Suspend, suspense_component::Suspense, IntoView}; use leptos_macro::{component, view}; use leptos_server::ArcOnceResource; use reactive_graph::prelude::ReadUntracked; use serde::{de::DeserializeOwned, Serialize}; #[component] /// Allows you to inline the data loading for an `async` block or /// server function directly into your view. This is the equivalent of combining a /// [`create_resource`] that only loads once (i.e., with a source signal `|| ()`) with /// a [`Suspense`] with no `fallback`. /// /// Adding `let:{variable name}` to the props makes the data available in the children /// that variable name, when resolved. /// ``` /// # use leptos::prelude::*; /// # if false { /// async fn fetch_monkeys(monkey: i32) -> i32 { /// // do some expensive work /// 3 /// } /// /// view! { /// <Await /// future=fetch_monkeys(3) /// let:data /// > /// <p>{*data} " little monkeys, jumping on the bed."</p> /// </Await> /// } /// # ; /// # } /// ``` pub fn Await<T, Fut, Chil, V>( /// A [`Future`](std::future::Future) that will the component will `.await` /// before rendering. future: Fut, /// If `true`, the component will create a blocking resource, preventing /// the HTML stream from returning anything before `future` has resolved. #[prop(optional)] blocking: bool, /// A function that takes a reference to the resolved data from the `future` /// renders a view. /// /// ## Syntax /// This can be passed in the `view` children of the `<Await/>` by using the /// `let:` syntax to specify the name for the data variable. /// /// ```rust /// # use leptos::prelude::*; /// # if false { /// # async fn fetch_monkeys(monkey: i32) -> i32 { /// # 3 /// # } /// view! { /// <Await /// future=fetch_monkeys(3) /// let:data /// > /// <p>{*data} " little monkeys, jumping on the bed."</p> /// </Await> /// } /// # ; /// # } /// ``` /// is the same as /// ```rust /// # use leptos::prelude::*; /// # if false { /// # async fn fetch_monkeys(monkey: i32) -> i32 { /// # 3 /// # } /// view! { /// <Await /// future=fetch_monkeys(3) /// children=|data| view! { /// <p>{*data} " little monkeys, jumping on the bed."</p> /// } /// /> /// } /// # ; /// # } /// ``` children: Chil, ) -> impl IntoView where T: Send + Sync + Serialize + DeserializeOwned + 'static, Fut: std::future::Future<Output = T> + Send + 'static, Chil: FnOnce(&T) -> V + Send + 'static, V: IntoView + 'static, { let res = ArcOnceResource::<T>::new_with_options(future, blocking); let ready = res.ready(); view! { <Suspense fallback=|| ()> {Suspend::new(async move { ready.await; children(res.read_untracked().as_ref().unwrap()) })} </Suspense> } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/children.rs
leptos/src/children.rs
use crate::into_view::{IntoView, View}; use std::{ fmt::{self, Debug}, sync::Arc, }; use tachys::view::{ any_view::{AnyView, IntoAny}, fragment::{Fragment, IntoFragment}, RenderHtml, }; /// The most common type for the `children` property on components, /// which can only be called once. /// /// This does not support iterating over individual nodes within the children. /// To iterate over children, use [`ChildrenFragment`]. pub type Children = Box<dyn FnOnce() -> AnyView + Send>; /// A type for the `children` property on components that can be called only once, /// and provides a collection of all the children passed to this component. pub type ChildrenFragment = Box<dyn FnOnce() -> Fragment + Send>; /// A type for the `children` property on components that can be called /// more than once. pub type ChildrenFn = Arc<dyn Fn() -> AnyView + Send + Sync>; /// A type for the `children` property on components that can be called more than once, /// and provides a collection of all the children passed to this component. pub type ChildrenFragmentFn = Arc<dyn Fn() -> Fragment + Send>; /// A type for the `children` property on components that can be called /// more than once, but may mutate the children. pub type ChildrenFnMut = Box<dyn FnMut() -> AnyView + Send>; /// A type for the `children` property on components that can be called more than once, /// but may mutate the children, and provides a collection of all the children /// passed to this component. pub type ChildrenFragmentMut = Box<dyn FnMut() -> Fragment + Send>; // This is to still support components that accept `Box<dyn Fn() -> AnyView>` as a children. type BoxedChildrenFn = Box<dyn Fn() -> AnyView + Send>; /// This trait can be used when constructing a component that takes children without needing /// to know exactly what children type the component expects. This is used internally by the /// `view!` macro implementation, and can also be used explicitly when using the builder syntax. /// /// /// Different component types take different types for their `children` prop, some of which cannot /// be directly constructed. Using `ToChildren` allows the component user to pass children without /// explicitly constructing the correct type. /// /// ## Examples /// /// ``` /// # use leptos::prelude::*; /// # use leptos::html::p; /// # use leptos::IntoView; /// # use leptos_macro::component; /// # use leptos::children::ToChildren; /// use leptos::context::{Provider, ProviderProps}; /// use leptos::control_flow::{Show, ShowProps}; /// /// #[component] /// fn App() -> impl IntoView { /// ( /// Provider( /// ProviderProps::builder() /// .children(ToChildren::to_children(|| { /// p().child("Foo") /// })) /// // ... /// .value("Foo") /// .build(), /// ), /// Show( /// ShowProps::builder() /// .children(ToChildren::to_children(|| { /// p().child("Foo") /// })) /// // ... /// .when(|| true) /// .fallback(|| p().child("foo")) /// .build(), /// ) /// ) /// } pub trait ToChildren<F> { /// Convert the provided type (generally a closure) to Self (generally a "children" type, /// e.g., [Children]). See the implementations to see exactly which input types are supported /// and which "children" type they are converted to. fn to_children(f: F) -> Self; } /// Compiler optimisation, can be used with certain type to avoid unique closures in the view!{} macro. pub struct ChildrenOptContainer<T>(pub T); impl<F, C> ToChildren<F> for Children where F: FnOnce() -> C + Send + 'static, C: RenderHtml + Send + 'static, { #[inline] fn to_children(f: F) -> Self { Box::new(move || f().into_any()) } } impl<T> ToChildren<ChildrenOptContainer<T>> for Children where T: IntoAny + Send + 'static, { #[inline] fn to_children(t: ChildrenOptContainer<T>) -> Self { Box::new(move || t.0.into_any()) } } impl<F, C> ToChildren<F> for ChildrenFn where F: Fn() -> C + Send + Sync + 'static, C: RenderHtml + Send + 'static, { #[inline] fn to_children(f: F) -> Self { Arc::new(move || f().into_any()) } } impl<T> ToChildren<ChildrenOptContainer<T>> for ChildrenFn where T: IntoAny + Clone + Send + Sync + 'static, { #[inline] fn to_children(t: ChildrenOptContainer<T>) -> Self { Arc::new(move || t.0.clone().into_any()) } } impl<F, C> ToChildren<F> for ChildrenFnMut where F: Fn() -> C + Send + 'static, C: RenderHtml + Send + 'static, { #[inline] fn to_children(f: F) -> Self { Box::new(move || f().into_any()) } } impl<T> ToChildren<ChildrenOptContainer<T>> for ChildrenFnMut where T: IntoAny + Clone + Send + 'static, { #[inline] fn to_children(t: ChildrenOptContainer<T>) -> Self { Box::new(move || t.0.clone().into_any()) } } impl<F, C> ToChildren<F> for BoxedChildrenFn where F: Fn() -> C + Send + 'static, C: RenderHtml + Send + 'static, { #[inline] fn to_children(f: F) -> Self { Box::new(move || f().into_any()) } } impl<T> ToChildren<ChildrenOptContainer<T>> for BoxedChildrenFn where T: IntoAny + Clone + Send + 'static, { #[inline] fn to_children(t: ChildrenOptContainer<T>) -> Self { Box::new(move || t.0.clone().into_any()) } } impl<F, C> ToChildren<F> for ChildrenFragment where F: FnOnce() -> C + Send + 'static, C: IntoFragment, { #[inline] fn to_children(f: F) -> Self { Box::new(move || f().into_fragment()) } } impl<T> ToChildren<ChildrenOptContainer<T>> for ChildrenFragment where T: IntoAny + Send + 'static, { #[inline] fn to_children(t: ChildrenOptContainer<T>) -> Self { Box::new(move || Fragment::new(vec![t.0.into_any()])) } } impl<F, C> ToChildren<F> for ChildrenFragmentFn where F: Fn() -> C + Send + 'static, C: IntoFragment, { #[inline] fn to_children(f: F) -> Self { Arc::new(move || f().into_fragment()) } } impl<T> ToChildren<ChildrenOptContainer<T>> for ChildrenFragmentFn where T: IntoAny + Clone + Send + 'static, { #[inline] fn to_children(t: ChildrenOptContainer<T>) -> Self { Arc::new(move || Fragment::new(vec![t.0.clone().into_any()])) } } impl<F, C> ToChildren<F> for ChildrenFragmentMut where F: FnMut() -> C + Send + 'static, C: IntoFragment, { #[inline] fn to_children(mut f: F) -> Self { Box::new(move || f().into_fragment()) } } impl<T> ToChildren<ChildrenOptContainer<T>> for ChildrenFragmentMut where T: IntoAny + Clone + Send + 'static, { #[inline] fn to_children(t: ChildrenOptContainer<T>) -> Self { Box::new(move || Fragment::new(vec![t.0.clone().into_any()])) } } /// New-type wrapper for a function that returns a view with `From` and `Default` traits implemented /// to enable optional props in for example `<Show>` and `<Suspense>`. #[derive(Clone)] pub struct ViewFn(Arc<dyn Fn() -> AnyView + Send + Sync + 'static>); impl Default for ViewFn { fn default() -> Self { Self(Arc::new(|| ().into_any())) } } impl<F, C> From<F> for ViewFn where F: Fn() -> C + Send + Sync + 'static, C: RenderHtml + Send + 'static, { fn from(value: F) -> Self { Self(Arc::new(move || value().into_any())) } } impl<C> From<View<C>> for ViewFn where C: Clone + Send + Sync + 'static, View<C>: IntoAny, { fn from(value: View<C>) -> Self { Self(Arc::new(move || value.clone().into_any())) } } impl ViewFn { /// Execute the wrapped function pub fn run(&self) -> AnyView { (self.0)() } } /// New-type wrapper for a function, which will only be called once and returns a view with `From` and /// `Default` traits implemented to enable optional props in for example `<Show>` and `<Suspense>`. pub struct ViewFnOnce(Box<dyn FnOnce() -> AnyView + Send + 'static>); impl Default for ViewFnOnce { fn default() -> Self { Self(Box::new(|| ().into_any())) } } impl<F, C> From<F> for ViewFnOnce where F: FnOnce() -> C + Send + 'static, C: RenderHtml + Send + 'static, { fn from(value: F) -> Self { Self(Box::new(move || value().into_any())) } } impl<C> From<View<C>> for ViewFnOnce where C: Send + Sync + 'static, View<C>: IntoAny, { fn from(value: View<C>) -> Self { Self(Box::new(move || value.into_any())) } } impl ViewFnOnce { /// Execute the wrapped function pub fn run(self) -> AnyView { (self.0)() } } /// A typed equivalent to [`Children`], which takes a generic but preserves type information to /// allow the compiler to optimize the view more effectively. pub struct TypedChildren<T>(Box<dyn FnOnce() -> View<T> + Send>); impl<T> TypedChildren<T> { /// Extracts the inner `children` function. pub fn into_inner(self) -> impl FnOnce() -> View<T> + Send { self.0 } } impl<F, C> ToChildren<F> for TypedChildren<C> where F: FnOnce() -> C + Send + 'static, C: IntoView, C::AsyncOutput: Send, { #[inline] fn to_children(f: F) -> Self { TypedChildren(Box::new(move || f().into_view())) } } impl<T> ToChildren<ChildrenOptContainer<T>> for TypedChildren<T> where T: IntoView + 'static, { #[inline] fn to_children(t: ChildrenOptContainer<T>) -> Self { TypedChildren(Box::new(move || t.0.into_view())) } } /// A typed equivalent to [`ChildrenFnMut`], which takes a generic but preserves type information to /// allow the compiler to optimize the view more effectively. pub struct TypedChildrenMut<T>(Box<dyn FnMut() -> View<T> + Send>); impl<T> Debug for TypedChildrenMut<T> { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { f.debug_tuple("TypedChildrenMut").finish() } } impl<T> TypedChildrenMut<T> { /// Extracts the inner `children` function. pub fn into_inner(self) -> impl FnMut() -> View<T> + Send { self.0 } } impl<F, C> ToChildren<F> for TypedChildrenMut<C> where F: FnMut() -> C + Send + 'static, C: IntoView, C::AsyncOutput: Send, { #[inline] fn to_children(mut f: F) -> Self { TypedChildrenMut(Box::new(move || f().into_view())) } } impl<T> ToChildren<ChildrenOptContainer<T>> for TypedChildrenMut<T> where T: IntoView + Clone + 'static, { #[inline] fn to_children(t: ChildrenOptContainer<T>) -> Self { TypedChildrenMut(Box::new(move || t.0.clone().into_view())) } } /// A typed equivalent to [`ChildrenFn`], which takes a generic but preserves type information to /// allow the compiler to optimize the view more effectively. pub struct TypedChildrenFn<T>(Arc<dyn Fn() -> View<T> + Send + Sync>); impl<T> Debug for TypedChildrenFn<T> { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { f.debug_tuple("TypedChildrenFn").finish() } } impl<T> Clone for TypedChildrenFn<T> { // Manual implementation to avoid the `T: Clone` bound. fn clone(&self) -> Self { Self(self.0.clone()) } } impl<T> TypedChildrenFn<T> { /// Extracts the inner `children` function. pub fn into_inner(self) -> Arc<dyn Fn() -> View<T> + Send + Sync> { self.0 } } impl<F, C> ToChildren<F> for TypedChildrenFn<C> where F: Fn() -> C + Send + Sync + 'static, C: IntoView, C::AsyncOutput: Send, { #[inline] fn to_children(f: F) -> Self { TypedChildrenFn(Arc::new(move || f().into_view())) } } impl<T> ToChildren<ChildrenOptContainer<T>> for TypedChildrenFn<T> where T: IntoView + Clone + Sync + 'static, { #[inline] fn to_children(t: ChildrenOptContainer<T>) -> Self { TypedChildrenFn(Arc::new(move || t.0.clone().into_view())) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/attribute_interceptor.rs
leptos/src/attribute_interceptor.rs
use crate::attr::{ any_attribute::{AnyAttribute, IntoAnyAttribute}, Attribute, NextAttribute, }; use leptos::prelude::*; /// Function stored to build/rebuild the wrapped children when attributes are added. type ChildBuilder<T> = dyn Fn(AnyAttribute) -> T + Send + Sync + 'static; /// Intercepts attributes passed to your component, allowing passing them to any element. /// /// By default, Leptos passes any attributes passed to your component (e.g. `<MyComponent /// attr:class="some-class"/>`) to the top-level element in the view returned by your component. /// [`AttributeInterceptor`] allows you to intercept this behavior and pass it onto any element in /// your component instead. /// /// Must be the top level element in your component's view. /// /// ## Example /// /// Any attributes passed to MyComponent will be passed to the #inner element. /// /// ``` /// # use leptos::prelude::*; /// use leptos::attribute_interceptor::AttributeInterceptor; /// /// #[component] /// pub fn MyComponent() -> impl IntoView { /// view! { /// <AttributeInterceptor let:attrs> /// <div id="wrapper"> /// <div id="inner" {..attrs} /> /// </div> /// </AttributeInterceptor> /// } /// } /// ``` #[component(transparent)] pub fn AttributeInterceptor<Chil, T>( /// The elements that will be rendered, with the attributes this component received as a /// parameter. children: Chil, ) -> impl IntoView where Chil: Fn(AnyAttribute) -> T + Send + Sync + 'static, T: IntoView + 'static, { AttributeInterceptorInner::new(children) } /// Wrapper to intercept attributes passed to a component so you can apply them to a different /// element. struct AttributeInterceptorInner<T: IntoView, A> { children_builder: Box<ChildBuilder<T>>, children: T, attributes: A, } impl<T: IntoView> AttributeInterceptorInner<T, ()> { /// Use this as the returned view from your component to collect the attributes that are passed /// to your component so you can manually handle them. pub fn new<F>(children: F) -> Self where F: Fn(AnyAttribute) -> T + Send + Sync + 'static, { let children_builder = Box::new(children); let children = children_builder(().into_any_attr()); Self { children_builder, children, attributes: (), } } } impl<T: IntoView, A: Attribute> Render for AttributeInterceptorInner<T, A> { type State = <T as Render>::State; fn build(self) -> Self::State { self.children.build() } fn rebuild(self, state: &mut Self::State) { self.children.rebuild(state); } } impl<T: IntoView + 'static, A> AddAnyAttr for AttributeInterceptorInner<T, A> where A: Attribute, { type Output<SomeNewAttr: leptos::attr::Attribute> = AttributeInterceptorInner<T, <<A as NextAttribute>::Output<SomeNewAttr> as Attribute>::CloneableOwned>; fn add_any_attr<NewAttr: leptos::attr::Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let attributes = self.attributes.add_any_attr(attr).into_cloneable_owned(); let children = (self.children_builder)(attributes.clone().into_any_attr()); AttributeInterceptorInner { children_builder: self.children_builder, children, attributes, } } } impl<T: IntoView + 'static, A: Attribute> RenderHtml for AttributeInterceptorInner<T, A> { type AsyncOutput = T::AsyncOutput; type Owned = AttributeInterceptorInner<T, A::CloneableOwned>; const MIN_LENGTH: usize = T::MIN_LENGTH; fn dry_resolve(&mut self) { self.children.dry_resolve() } fn resolve( self, ) -> impl std::future::Future<Output = Self::AsyncOutput> + Send { self.children.resolve() } fn to_html_with_buf( self, buf: &mut String, position: &mut leptos::tachys::view::Position, escape: bool, mark_branches: bool, _extra_attrs: Vec<AnyAttribute>, ) { self.children.to_html_with_buf( buf, position, escape, mark_branches, vec![], ) } fn hydrate<const FROM_SERVER: bool>( self, cursor: &leptos::tachys::hydration::Cursor, position: &leptos::tachys::view::PositionState, ) -> Self::State { self.children.hydrate::<FROM_SERVER>(cursor, position) } async fn hydrate_async( self, cursor: &leptos::tachys::hydration::Cursor, position: &leptos::tachys::view::PositionState, ) -> Self::State { self.children.hydrate_async(cursor, position).await } fn into_owned(self) -> Self::Owned { AttributeInterceptorInner { children_builder: self.children_builder, children: self.children, attributes: self.attributes.into_cloneable_owned(), } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/show.rs
leptos/src/show.rs
use crate::{ children::{TypedChildrenFn, ViewFn}, IntoView, }; use leptos_macro::component; use reactive_graph::{computed::ArcMemo, traits::Get}; use tachys::either::Either; #[component] pub fn Show<W, C>( /// The children will be shown whenever the condition in the `when` closure returns `true`. children: TypedChildrenFn<C>, /// A closure that returns a bool that determines whether this thing runs when: W, /// A closure that returns what gets rendered if the when statement is false. By default this is the empty view. #[prop(optional, into)] fallback: ViewFn, ) -> impl IntoView where W: Fn() -> bool + Send + Sync + 'static, C: IntoView + 'static, { let memoized_when = ArcMemo::new(move |_| when()); let children = children.into_inner(); move || match memoized_when.get() { true => Either::Left(children()), false => Either::Right(fallback.run()), } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/logging.rs
leptos/src/logging.rs
//! Utilities for simple isomorphic logging to the console or terminal. use wasm_bindgen::JsValue; /// Uses `println!()`-style formatting to log something to the console (in the browser) /// or via `println!()` (if not in the browser). #[macro_export] macro_rules! log { ($($t:tt)*) => ($crate::logging::console_log(&format_args!($($t)*).to_string())) } /// Uses `println!()`-style formatting to log warnings to the console (in the browser) /// or via `eprintln!()` (if not in the browser). #[macro_export] macro_rules! warn { ($($t:tt)*) => ($crate::logging::console_warn(&format_args!($($t)*).to_string())) } /// Uses `println!()`-style formatting to log errors to the console (in the browser) /// or via `eprintln!()` (if not in the browser). #[macro_export] macro_rules! error { ($($t:tt)*) => ($crate::logging::console_error(&format_args!($($t)*).to_string())) } /// Uses `println!()`-style formatting to log warnings to the console (in the browser) /// or via `eprintln!()` (if not in the browser), but only if it's a debug build. #[macro_export] macro_rules! debug_warn { ($($x:tt)*) => { { #[cfg(debug_assertions)] { $crate::warn!($($x)*) } #[cfg(not(debug_assertions))] { ($($x)*) } } } } const fn log_to_stdout() -> bool { cfg!(not(all( target_arch = "wasm32", not(any(target_os = "emscripten", target_os = "wasi")) ))) } /// Log a string to the console (in the browser) /// or via `println!()` (if not in the browser). pub fn console_log(s: &str) { #[allow(clippy::print_stdout)] if log_to_stdout() { println!("{s}"); } else { web_sys::console::log_1(&JsValue::from_str(s)); } } /// Log a warning to the console (in the browser) /// or via `println!()` (if not in the browser). pub fn console_warn(s: &str) { if log_to_stdout() { eprintln!("{s}"); } else { web_sys::console::warn_1(&JsValue::from_str(s)); } } /// Log an error to the console (in the browser) /// or via `println!()` (if not in the browser). #[inline(always)] pub fn console_error(s: &str) { if log_to_stdout() { eprintln!("{s}"); } else { web_sys::console::error_1(&JsValue::from_str(s)); } } /// Log an error to the console (in the browser) /// or via `println!()` (if not in the browser), but only in a debug build. #[inline(always)] pub fn console_debug_warn(s: &str) { #[cfg(debug_assertions)] { if log_to_stdout() { eprintln!("{s}"); } else { web_sys::console::warn_1(&JsValue::from_str(s)); } } #[cfg(not(debug_assertions))] { let _ = s; } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/suspense_component.rs
leptos/src/suspense_component.rs
use crate::{ children::{TypedChildren, ViewFnOnce}, error::ErrorBoundarySuspendedChildren, IntoView, }; use futures::{channel::oneshot, select, FutureExt}; use hydration_context::SerializedDataId; use leptos_macro::component; use or_poisoned::OrPoisoned; use reactive_graph::{ computed::{ suspense::{LocalResourceNotifier, SuspenseContext}, ArcMemo, ScopedFuture, }, effect::RenderEffect, owner::{provide_context, use_context, Owner}, signal::ArcRwSignal, traits::{ Dispose, Get, Read, ReadUntracked, Track, With, WithUntracked, WriteValue, }, }; use slotmap::{DefaultKey, SlotMap}; use std::sync::{Arc, Mutex}; use tachys::{ either::Either, html::attribute::{any_attribute::AnyAttribute, Attribute}, hydration::Cursor, reactive_graph::{OwnedView, OwnedViewState}, ssr::StreamBuilder, view::{ add_attr::AddAnyAttr, either::{EitherKeepAlive, EitherKeepAliveState}, Mountable, Position, PositionState, Render, RenderHtml, }, }; use throw_error::ErrorHookFuture; /// If any [`Resource`](crate::prelude::Resource) is read in the `children` of this /// component, it will show the `fallback` while they are loading. Once all are resolved, /// it will render the `children`. /// /// Each time one of the resources is loading again, it will fall back. To keep the current /// children instead, use [Transition](crate::prelude::Transition). /// /// Note that the `children` will be rendered initially (in order to capture the fact that /// those resources are read under the suspense), so you cannot assume that resources read /// synchronously have /// `Some` value in `children`. However, you can read resources asynchronously by using /// [Suspend](crate::prelude::Suspend). /// /// ``` /// # use leptos::prelude::*; /// # if false { // don't run in doctests /// async fn fetch_cats(how_many: u32) -> Vec<String> { vec![] } /// /// let (cat_count, set_cat_count) = signal::<u32>(1); /// /// let cats = Resource::new(move || cat_count.get(), |count| fetch_cats(count)); /// /// view! { /// <div> /// <Suspense fallback=move || view! { <p>"Loading (Suspense Fallback)..."</p> }> /// // you can access a resource synchronously /// {move || { /// cats.get().map(|data| { /// data /// .into_iter() /// .map(|src| { /// view! { /// <img src={src}/> /// } /// }) /// .collect_view() /// }) /// } /// } /// // or you can use `Suspend` to read resources asynchronously /// {move || Suspend::new(async move { /// cats.await /// .into_iter() /// .map(|src| { /// view! { /// <img src={src}/> /// } /// }) /// .collect_view() /// })} /// </Suspense> /// </div> /// } /// # ;} /// ``` #[component] pub fn Suspense<Chil>( /// A function that returns a fallback that will be shown while resources are still loading. /// By default this is an empty view. #[prop(optional, into)] fallback: ViewFnOnce, /// Children will be rendered once initially to catch any resource reads, then hidden until all /// data have loaded. children: TypedChildren<Chil>, ) -> impl IntoView where Chil: IntoView + Send + 'static, { let error_boundary_parent = use_context::<ErrorBoundarySuspendedChildren>(); let owner = Owner::new(); owner.with(|| { let (starts_local, id) = { Owner::current_shared_context() .map(|sc| { let id = sc.next_id(); (sc.get_incomplete_chunk(&id), id) }) .unwrap_or_else(|| (false, Default::default())) }; let fallback = fallback.run(); let children = children.into_inner()(); let tasks = ArcRwSignal::new(SlotMap::<DefaultKey, ()>::new()); provide_context(SuspenseContext { tasks: tasks.clone(), }); let none_pending = ArcMemo::new({ let tasks = tasks.clone(); move |prev: Option<&bool>| { tasks.track(); if prev.is_none() && starts_local { false } else { tasks.with(SlotMap::is_empty) } } }); let has_tasks = Arc::new(move || !tasks.with_untracked(SlotMap::is_empty)); OwnedView::new(SuspenseBoundary::<false, _, _> { id, none_pending, fallback, children, error_boundary_parent, has_tasks, }) }) } fn nonce_or_not() -> Option<Arc<str>> { #[cfg(feature = "nonce")] { use crate::nonce::Nonce; use_context::<Nonce>().map(|n| n.0) } #[cfg(not(feature = "nonce"))] { None } } pub(crate) struct SuspenseBoundary<const TRANSITION: bool, Fal, Chil> { pub id: SerializedDataId, pub none_pending: ArcMemo<bool>, pub fallback: Fal, pub children: Chil, pub error_boundary_parent: Option<ErrorBoundarySuspendedChildren>, pub has_tasks: Arc<dyn Fn() -> bool + Send + Sync>, } impl<const TRANSITION: bool, Fal, Chil> Render for SuspenseBoundary<TRANSITION, Fal, Chil> where Fal: Render + Send + 'static, Chil: Render + Send + 'static, { type State = RenderEffect< OwnedViewState<EitherKeepAliveState<Chil::State, Fal::State>>, >; fn build(self) -> Self::State { let mut children = Some(self.children); let mut fallback = Some(self.fallback); let none_pending = self.none_pending; let mut nth_run = 0; let outer_owner = Owner::new(); RenderEffect::new(move |prev| { // show the fallback if // 1) there are pending futures, and // 2) we are either in a Suspense (not Transition), or it's the first fallback // (because we initially render the children to register Futures, the "first // fallback" is probably the 2nd run let show_b = !none_pending.get() && (!TRANSITION || nth_run < 2); nth_run += 1; let this = OwnedView::new_with_owner( EitherKeepAlive { a: children.take(), b: fallback.take(), show_b, }, outer_owner.clone(), ); let state = if let Some(mut state) = prev { this.rebuild(&mut state); state } else { this.build() }; if nth_run == 1 && !(self.has_tasks)() { // if this is the first run, and there are no pending resources at this point, // it means that there were no actually-async resources read while rendering the children // this means that we're effectively on the settled second run: none_pending // won't change false => true and cause this to rerender (and therefore increment nth_run) // // we increment it manually here so that future resource changes won't cause the transition fallback // to be displayed for the first time // see https://github.com/leptos-rs/leptos/issues/3868, https://github.com/leptos-rs/leptos/issues/4492 nth_run += 1; } state }) } fn rebuild(self, state: &mut Self::State) { let new = self.build(); let mut old = std::mem::replace(state, new); old.insert_before_this(state); old.unmount(); } } impl<const TRANSITION: bool, Fal, Chil> AddAnyAttr for SuspenseBoundary<TRANSITION, Fal, Chil> where Fal: RenderHtml + Send + 'static, Chil: RenderHtml + Send + 'static, { type Output<SomeNewAttr: Attribute> = SuspenseBoundary< TRANSITION, Fal, Chil::Output<SomeNewAttr::CloneableOwned>, >; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let attr = attr.into_cloneable_owned(); let SuspenseBoundary { id, none_pending, fallback, children, error_boundary_parent, has_tasks, } = self; SuspenseBoundary { id, none_pending, fallback, children: children.add_any_attr(attr), error_boundary_parent, has_tasks, } } } impl<const TRANSITION: bool, Fal, Chil> RenderHtml for SuspenseBoundary<TRANSITION, Fal, Chil> where Fal: RenderHtml + Send + 'static, Chil: RenderHtml + Send + 'static, { // i.e., if this is the child of another Suspense during SSR, don't wait for it: it will handle // itself type AsyncOutput = Self; type Owned = Self; const MIN_LENGTH: usize = Chil::MIN_LENGTH; fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { self.fallback.to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( mut self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { buf.next_id(); let suspense_context = use_context::<SuspenseContext>().unwrap(); let owner = Owner::current().unwrap(); let mut notify_error_boundary = self.error_boundary_parent.map(|children| { let (tx, rx) = oneshot::channel(); children.write_value().push(rx); tx }); // we need to wait for one of two things: either // 1. all tasks are finished loading, or // 2. we read from a local resource, meaning this Suspense can never resolve on the server // first, create listener for tasks let tasks = suspense_context.tasks.clone(); let (tasks_tx, mut tasks_rx) = futures::channel::oneshot::channel::<()>(); let mut tasks_tx = Some(tasks_tx); // now, create listener for local resources let (local_tx, mut local_rx) = futures::channel::oneshot::channel::<()>(); provide_context(LocalResourceNotifier::from(local_tx)); // walk over the tree of children once to make sure that all resource loads are registered self.children.dry_resolve(); let children = Arc::new(Mutex::new(Some(self.children))); // check the set of tasks to see if it is empty, now or later let eff = reactive_graph::effect::Effect::new_isomorphic({ let children = Arc::clone(&children); move |double_checking: Option<bool>| { // on the first run, always track the tasks if double_checking.is_none() { tasks.track(); } if let Some(curr_tasks) = tasks.try_read_untracked() { if curr_tasks.is_empty() { if double_checking == Some(true) { // we have finished loading, and checking the children again told us there are // no more pending tasks. so we can render both the children and the error boundary if let Some(tx) = tasks_tx.take() { // If the receiver has dropped, it means the ScopedFuture has already // dropped, so it doesn't matter if we manage to send this. _ = tx.send(()); } if let Some(tx) = notify_error_boundary.take() { _ = tx.send(()); } } else { // release the read guard on tasks, as we'll be updating it again drop(curr_tasks); // check the children for additional pending tasks // the will catch additional resource reads nested inside a conditional depending on initial resource reads if let Some(children) = children.lock().or_poisoned().as_mut() { children.dry_resolve(); } if tasks .try_read() .map(|n| n.is_empty()) .unwrap_or(false) { // there are no additional pending tasks, and we can simply return if let Some(tx) = tasks_tx.take() { // If the receiver has dropped, it means the ScopedFuture has already // dropped, so it doesn't matter if we manage to send this. _ = tx.send(()); } if let Some(tx) = notify_error_boundary.take() { _ = tx.send(()); } } // tell ourselves that we're just double-checking return true; } } else { tasks.track(); } } false } }); let mut fut = Box::pin(ScopedFuture::new(ErrorHookFuture::new( async move { // race the local resource notifier against the set of tasks // // if there are local resources, we just return the fallback immediately // // otherwise, we want to wait for resources to load before trying to resolve the body // // this is *less efficient* than just resolving the body // however, it means that you can use reactive accesses to resources/async derived // inside component props, at any level, and have those picked up by Suspense, and // that it will wait for those to resolve select! { // if there are local resources, bail // this will only have fired by this point for local resources accessed // *synchronously* _ = local_rx => { let sc = Owner::current_shared_context().expect("no shared context"); sc.set_incomplete_chunk(self.id); None } _ = tasks_rx => { let children = { let mut children_lock = children.lock().or_poisoned(); children_lock.take().expect("children should not be removed until we render here") }; // if we ran this earlier, reactive reads would always be registered as None // this is fine in the case where we want to use Suspend and .await on some future // but in situations like a <For each=|| some_resource.snapshot()/> we actually // want to be able to 1) synchronously read a resource's value, but still 2) wait // for it to load before we render everything let mut children = Box::pin(children.resolve().fuse()); // we continue racing the children against the "do we have any local // resources?" Future select! { _ = local_rx => { let sc = Owner::current_shared_context().expect("no shared context"); sc.set_incomplete_chunk(self.id); None } children = children => { // clean up the (now useless) effect eff.dispose(); Some(OwnedView::new_with_owner(children, owner)) } } } } }, ))); match fut.as_mut().now_or_never() { Some(Some(resolved)) => { Either::<Fal, _>::Right(resolved) .to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); } Some(None) => { Either::<_, Chil>::Left(self.fallback) .to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); } None => { let id = buf.clone_id(); // out-of-order streams immediately push fallback, // wrapped by suspense markers if OUT_OF_ORDER { let mut fallback_position = *position; buf.push_fallback( self.fallback, &mut fallback_position, mark_branches, extra_attrs.clone(), ); buf.push_async_out_of_order_with_nonce( fut, position, mark_branches, nonce_or_not(), extra_attrs, ); } else { // calling this will walk over the tree, removing all event listeners // and other single-threaded values from the view tree. this needs to be // done because the fallback can be shifted to another thread in push_async below. self.fallback.dry_resolve(); buf.push_async({ let mut position = *position; async move { let value = match fut.await { None => Either::Left(self.fallback), Some(value) => Either::Right(value), }; let mut builder = StreamBuilder::new(id); value.to_html_async_with_buf::<OUT_OF_ORDER>( &mut builder, &mut position, escape, mark_branches, extra_attrs, ); builder.finish().take_chunks() } }); *position = Position::NextChild; } } }; } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { let cursor = cursor.to_owned(); let position = position.to_owned(); let mut children = Some(self.children); let mut fallback = Some(self.fallback); let none_pending = self.none_pending; let mut nth_run = 0; let outer_owner = Owner::new(); RenderEffect::new(move |prev| { // show the fallback if // 1) there are pending futures, and // 2) we are either in a Suspense (not Transition), or it's the first fallback // (because we initially render the children to register Futures, the "first // fallback" is probably the 2nd run let show_b = !none_pending.get() && (!TRANSITION || nth_run < 1); nth_run += 1; let this = OwnedView::new_with_owner( EitherKeepAlive { a: children.take(), b: fallback.take(), show_b, }, outer_owner.clone(), ); if let Some(mut state) = prev { this.rebuild(&mut state); state } else { this.hydrate::<FROM_SERVER>(&cursor, &position) } }) } fn into_owned(self) -> Self::Owned { self } } /// A wrapper that prevents [`Suspense`] from waiting for any resource reads that happen inside /// `Unsuspend`. pub struct Unsuspend<T>(Box<dyn FnOnce() -> T + Send>); impl<T> Unsuspend<T> { /// Wraps the given function, such that it is not called until all resources are ready. pub fn new(fun: impl FnOnce() -> T + Send + 'static) -> Self { Self(Box::new(fun)) } } impl<T> Render for Unsuspend<T> where T: Render, { type State = T::State; fn build(self) -> Self::State { (self.0)().build() } fn rebuild(self, state: &mut Self::State) { (self.0)().rebuild(state); } } impl<T> AddAnyAttr for Unsuspend<T> where T: AddAnyAttr + 'static, { type Output<SomeNewAttr: Attribute> = Unsuspend<T::Output<SomeNewAttr::CloneableOwned>>; fn add_any_attr<NewAttr: Attribute>( self, attr: NewAttr, ) -> Self::Output<NewAttr> where Self::Output<NewAttr>: RenderHtml, { let attr = attr.into_cloneable_owned(); Unsuspend::new(move || (self.0)().add_any_attr(attr)) } } impl<T> RenderHtml for Unsuspend<T> where T: RenderHtml + 'static, { type AsyncOutput = Self; type Owned = Self; const MIN_LENGTH: usize = T::MIN_LENGTH; fn dry_resolve(&mut self) {} async fn resolve(self) -> Self::AsyncOutput { self } fn to_html_with_buf( self, buf: &mut String, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) { (self.0)().to_html_with_buf( buf, position, escape, mark_branches, extra_attrs, ); } fn to_html_async_with_buf<const OUT_OF_ORDER: bool>( self, buf: &mut StreamBuilder, position: &mut Position, escape: bool, mark_branches: bool, extra_attrs: Vec<AnyAttribute>, ) where Self: Sized, { (self.0)().to_html_async_with_buf::<OUT_OF_ORDER>( buf, position, escape, mark_branches, extra_attrs, ); } fn hydrate<const FROM_SERVER: bool>( self, cursor: &Cursor, position: &PositionState, ) -> Self::State { (self.0)().hydrate::<FROM_SERVER>(cursor, position) } fn into_owned(self) -> Self::Owned { self } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/provider.rs
leptos/src/provider.rs
use crate::{children::TypedChildren, component, IntoView}; use reactive_graph::owner::{provide_context, Owner}; use tachys::reactive_graph::OwnedView; #[component] /// Uses the context API to [`provide_context`] to its children and descendants, /// without overwriting any contexts of the same type in its own reactive scope. /// /// This prevents issues related to “context shadowing.” /// /// ```rust /// use leptos::{context::Provider, prelude::*}; /// /// #[component] /// pub fn App() -> impl IntoView { /// // each Provider will only provide the value to its children /// view! { /// <Provider value=1u8> /// // correctly gets 1 from context /// {use_context::<u8>().unwrap_or(0)} /// </Provider> /// <Provider value=2u8> /// // correctly gets 2 from context /// {use_context::<u8>().unwrap_or(0)} /// </Provider> /// // does not find any u8 in context /// {use_context::<u8>().unwrap_or(0)} /// } /// } /// ``` pub fn Provider<T, Chil>( /// The value to be provided via context. value: T, children: TypedChildren<Chil>, ) -> impl IntoView where T: Send + Sync + 'static, Chil: IntoView + 'static, { let owner = Owner::current() .expect("no current reactive Owner found") .child(); let children = children.into_inner(); let children = owner.with(|| { provide_context(value); children() }); OwnedView::new_with_owner(children, owner) }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/text_prop.rs
leptos/src/text_prop.rs
use oco_ref::Oco; use std::sync::Arc; use tachys::prelude::IntoAttributeValue; /// Describes a value that is either a static or a reactive string, i.e., /// a [`String`], a [`&str`], a `Signal` or a reactive `Fn() -> String`. #[derive(Clone)] pub struct TextProp(Arc<dyn Fn() -> Oco<'static, str> + Send + Sync>); impl TextProp { /// Accesses the current value of the property. #[inline(always)] pub fn get(&self) -> Oco<'static, str> { (self.0)() } } impl core::fmt::Debug for TextProp { fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result { f.debug_tuple("TextProp").finish() } } impl From<String> for TextProp { fn from(s: String) -> Self { let s: Oco<'_, str> = Oco::Counted(Arc::from(s)); TextProp(Arc::new(move || s.clone())) } } impl From<&'static str> for TextProp { fn from(s: &'static str) -> Self { let s: Oco<'_, str> = s.into(); TextProp(Arc::new(move || s.clone())) } } impl From<Arc<str>> for TextProp { fn from(s: Arc<str>) -> Self { let s: Oco<'_, str> = s.into(); TextProp(Arc::new(move || s.clone())) } } impl From<Oco<'static, str>> for TextProp { fn from(s: Oco<'static, str>) -> Self { TextProp(Arc::new(move || s.clone())) } } // TODO /*impl<T> From<T> for MaybeProp<TextProp> where T: Into<Oco<'static, str>>, { fn from(s: T) -> Self { Self(Some(MaybeSignal::from(Some(s.into().into())))) } }*/ impl<F, S> From<F> for TextProp where F: Fn() -> S + 'static + Send + Sync, S: Into<Oco<'static, str>>, { #[inline(always)] fn from(s: F) -> Self { TextProp(Arc::new(move || s().into())) } } impl Default for TextProp { fn default() -> Self { Self(Arc::new(|| Oco::Borrowed(""))) } } impl IntoAttributeValue for TextProp { type Output = Arc<dyn Fn() -> Oco<'static, str> + Send + Sync>; fn into_attribute_value(self) -> Self::Output { self.0 } } macro_rules! textprop_reactive { ($name:ident, <$($gen:ident),*>, $v:ty, $( $where_clause:tt )*) => { #[allow(deprecated)] impl<$($gen),*> From<$name<$($gen),*>> for TextProp where $v: Into<Oco<'static, str>> + Clone + Send + Sync + 'static, $($where_clause)* { #[inline(always)] fn from(s: $name<$($gen),*>) -> Self { TextProp(Arc::new(move || s.get().into())) } } }; } #[cfg(not(feature = "nightly"))] mod stable { use super::TextProp; use oco_ref::Oco; #[allow(deprecated)] use reactive_graph::wrappers::read::MaybeSignal; use reactive_graph::{ computed::{ArcMemo, Memo}, owner::Storage, signal::{ArcReadSignal, ArcRwSignal, ReadSignal, RwSignal}, traits::Get, wrappers::read::{ArcSignal, Signal}, }; use std::sync::Arc; textprop_reactive!( RwSignal, <V, S>, V, RwSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); textprop_reactive!( ReadSignal, <V, S>, V, ReadSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); textprop_reactive!( Memo, <V, S>, V, Memo<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); textprop_reactive!( Signal, <V, S>, V, Signal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); textprop_reactive!( MaybeSignal, <V, S>, V, MaybeSignal<V, S>: Get<Value = V>, S: Storage<V> + Storage<Option<V>>, S: Send + Sync + 'static, ); textprop_reactive!(ArcRwSignal, <V>, V, ArcRwSignal<V>: Get<Value = V>); textprop_reactive!(ArcReadSignal, <V>, V, ArcReadSignal<V>: Get<Value = V>); textprop_reactive!(ArcMemo, <V>, V, ArcMemo<V>: Get<Value = V>); textprop_reactive!(ArcSignal, <V>, V, ArcSignal<V>: Get<Value = V>); } /// Extension trait for `Option<TextProp>` pub trait OptionTextPropExt { /// Accesses the current value of the `Option<TextProp>` as an `Option<Oco<'static, str>>`. fn get(&self) -> Option<Oco<'static, str>>; } impl OptionTextPropExt for Option<TextProp> { fn get(&self) -> Option<Oco<'static, str>> { self.as_ref().map(|text_prop| text_prop.get()) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/mount.rs
leptos/src/mount.rs
#[cfg(debug_assertions)] use crate::logging; use crate::IntoView; use any_spawner::Executor; use reactive_graph::owner::Owner; #[cfg(debug_assertions)] use std::cell::Cell; use tachys::{ dom::body, view::{Mountable, Render}, }; #[cfg(feature = "hydrate")] use tachys::{ hydration::Cursor, view::{PositionState, RenderHtml}, }; #[cfg(feature = "hydrate")] use wasm_bindgen::JsCast; use web_sys::HtmlElement; #[cfg(feature = "hydrate")] /// Hydrates the app described by the provided function, starting at `<body>`. pub fn hydrate_body<F, N>(f: F) where F: FnOnce() -> N + 'static, N: IntoView, { let owner = hydrate_from(body(), f); owner.forget(); } #[cfg(feature = "hydrate")] /// Hydrates the app described by the provided function, starting at `<body>`, with support /// for lazy-loaded routes and components. pub fn hydrate_lazy<F, N>(f: F) where F: FnOnce() -> N + 'static, N: IntoView, { // use wasm-bindgen-futures to drive the reactive system // we ignore the return value because an Err here just means the wasm-bindgen executor is // already initialized, which is not an issue _ = Executor::init_wasm_bindgen(); crate::task::spawn_local(async move { let owner = hydrate_from_async(body(), f).await; owner.forget(); }) } #[cfg(debug_assertions)] thread_local! { static FIRST_CALL: Cell<bool> = const { Cell::new(true) }; } #[cfg(feature = "hydrate")] /// Runs the provided closure and mounts the result to the provided element. pub fn hydrate_from<F, N>(parent: HtmlElement, f: F) -> UnmountHandle<N::State> where F: FnOnce() -> N + 'static, N: IntoView, { use hydration_context::HydrateSharedContext; use std::sync::Arc; // use wasm-bindgen-futures to drive the reactive system // we ignore the return value because an Err here just means the wasm-bindgen executor is // already initialized, which is not an issue _ = Executor::init_wasm_bindgen(); #[cfg(debug_assertions)] { if !cfg!(feature = "hydrate") && FIRST_CALL.get() { logging::warn!( "It seems like you're trying to use Leptos in hydration mode, \ but the `hydrate` feature is not enabled on the `leptos` \ crate. Add `features = [\"hydrate\"]` to your Cargo.toml for \ the crate to work properly.\n\nNote that hydration and \ client-side rendering now use separate functions from \ leptos::mount: you are calling a hydration function." ); } FIRST_CALL.set(false); } // create a new reactive owner and use it as the root node to run the app let owner = Owner::new_root(Some(Arc::new(HydrateSharedContext::new()))); let mountable = owner.with(move || { let view = f().into_view(); view.hydrate::<true>( &Cursor::new(parent.unchecked_into()), &PositionState::default(), ) }); if let Some(sc) = Owner::current_shared_context() { sc.hydration_complete(); } // returns a handle that owns the owner // when this is dropped, it will clean up the reactive system and unmount the view UnmountHandle { owner, mountable } } #[cfg(feature = "hydrate")] /// Runs the provided closure and mounts the result to the provided element. pub async fn hydrate_from_async<F, N>( parent: HtmlElement, f: F, ) -> UnmountHandle<N::State> where F: FnOnce() -> N + 'static, N: IntoView, { use hydration_context::HydrateSharedContext; use std::sync::Arc; // use wasm-bindgen-futures to drive the reactive system // we ignore the return value because an Err here just means the wasm-bindgen executor is // already initialized, which is not an issue _ = Executor::init_wasm_bindgen(); #[cfg(debug_assertions)] { if !cfg!(feature = "hydrate") && FIRST_CALL.get() { logging::warn!( "It seems like you're trying to use Leptos in hydration mode, \ but the `hydrate` feature is not enabled on the `leptos` \ crate. Add `features = [\"hydrate\"]` to your Cargo.toml for \ the crate to work properly.\n\nNote that hydration and \ client-side rendering now use separate functions from \ leptos::mount: you are calling a hydration function." ); } FIRST_CALL.set(false); } // create a new reactive owner and use it as the root node to run the app let owner = Owner::new_root(Some(Arc::new(HydrateSharedContext::new()))); let mountable = owner .with(move || { use reactive_graph::computed::ScopedFuture; ScopedFuture::new(async move { let view = f().into_view(); view.hydrate_async( &Cursor::new(parent.unchecked_into()), &PositionState::default(), ) .await }) }) .await; if let Some(sc) = Owner::current_shared_context() { sc.hydration_complete(); } // returns a handle that owns the owner // when this is dropped, it will clean up the reactive system and unmount the view UnmountHandle { owner, mountable } } /// Runs the provided closure and mounts the result to the `<body>`. pub fn mount_to_body<F, N>(f: F) where F: FnOnce() -> N + 'static, N: IntoView, { let owner = mount_to(body(), f); owner.forget(); } /// Runs the provided closure and mounts the result to the provided element. pub fn mount_to<F, N>(parent: HtmlElement, f: F) -> UnmountHandle<N::State> where F: FnOnce() -> N + 'static, N: IntoView, { // use wasm-bindgen-futures to drive the reactive system // we ignore the return value because an Err here just means the wasm-bindgen executor is // already initialized, which is not an issue _ = Executor::init_wasm_bindgen(); #[cfg(debug_assertions)] { if !cfg!(feature = "csr") && FIRST_CALL.get() { logging::warn!( "It seems like you're trying to use Leptos in client-side \ rendering mode, but the `csr` feature is not enabled on the \ `leptos` crate. Add `features = [\"csr\"]` to your \ Cargo.toml for the crate to work properly.\n\nNote that \ hydration and client-side rendering now use different \ functions from leptos::mount. You are using a client-side \ rendering mount function." ); } FIRST_CALL.set(false); } // create a new reactive owner and use it as the root node to run the app let owner = Owner::new(); let mountable = owner.with(move || { let view = f().into_view(); let mut mountable = view.build(); mountable.mount(&parent, None); mountable }); // returns a handle that owns the owner // when this is dropped, it will clean up the reactive system and unmount the view UnmountHandle { owner, mountable } } /// Runs the provided closure and mounts the result to the provided element. pub fn mount_to_renderer<F, N>( parent: &tachys::renderer::types::Element, f: F, ) -> UnmountHandle<N::State> where F: FnOnce() -> N + 'static, N: Render, { // use wasm-bindgen-futures to drive the reactive system // we ignore the return value because an Err here just means the wasm-bindgen executor is // already initialized, which is not an issue _ = Executor::init_wasm_bindgen(); // create a new reactive owner and use it as the root node to run the app let owner = Owner::new(); let mountable = owner.with(move || { let view = f(); let mut mountable = view.build(); mountable.mount(parent, None); mountable }); // returns a handle that owns the owner // when this is dropped, it will clean up the reactive system and unmount the view UnmountHandle { owner, mountable } } /// Hydrates any islands that are currently present on the page. #[cfg(feature = "hydrate")] pub fn hydrate_islands() { use hydration_context::{HydrateSharedContext, SharedContext}; use std::sync::Arc; // use wasm-bindgen-futures to drive the reactive system // we ignore the return value because an Err here just means the wasm-bindgen executor is // already initialized, which is not an issue _ = Executor::init_wasm_bindgen(); #[cfg(debug_assertions)] FIRST_CALL.set(false); // create a new reactive owner and use it as the root node to run the app let sc = HydrateSharedContext::new(); sc.set_is_hydrating(false); // islands mode starts in "not hydrating" let owner = Owner::new_root(Some(Arc::new(sc))); owner.set(); std::mem::forget(owner); } /// On drop, this will clean up the reactive [`Owner`] and unmount the view created by /// [`mount_to`]. /// /// If you are using it to create the root of an application, you should use /// [`UnmountHandle::forget`] to leak it. #[must_use = "Dropping an `UnmountHandle` will unmount the view and cancel the \ reactive system. You should either call `.forget()` to keep the \ view permanently mounted, or store the `UnmountHandle` somewhere \ and drop it when you'd like to unmount the view."] pub struct UnmountHandle<M> where M: Mountable, { #[allow(dead_code)] owner: Owner, mountable: M, } impl<M> UnmountHandle<M> where M: Mountable, { /// Leaks the handle, preventing the reactive system from being cleaned up and the view from /// being unmounted. This should always be called when [`mount_to`] is used for the root of an /// application that should live for the long term. pub fn forget(self) { std::mem::forget(self); } } impl<M> Drop for UnmountHandle<M> where M: Mountable, { fn drop(&mut self) { self.mountable.unmount(); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/component.rs
leptos/src/component.rs
//! Utility traits and functions that allow building components, //! as either functions of their props or functions with no arguments, //! without knowing the name of the props struct. pub trait Component<P> {} pub trait Props { type Builder; fn builder() -> Self::Builder; } #[doc(hidden)] pub trait PropsOrNoPropsBuilder { type Builder; fn builder_or_not() -> Self::Builder; } #[doc(hidden)] #[derive(Copy, Clone, Debug, Default)] pub struct EmptyPropsBuilder {} impl EmptyPropsBuilder { pub fn build(self) {} } impl<P: Props> PropsOrNoPropsBuilder for P { type Builder = <P as Props>::Builder; fn builder_or_not() -> Self::Builder { Self::builder() } } impl PropsOrNoPropsBuilder for EmptyPropsBuilder { type Builder = EmptyPropsBuilder; fn builder_or_not() -> Self::Builder { EmptyPropsBuilder {} } } impl<F, R> Component<EmptyPropsBuilder> for F where F: FnOnce() -> R {} impl<P, F, R> Component<P> for F where F: FnOnce(P) -> R, P: Props, { } pub fn component_props_builder<P: PropsOrNoPropsBuilder>( _f: &impl Component<P>, ) -> <P as PropsOrNoPropsBuilder>::Builder { <P as PropsOrNoPropsBuilder>::builder_or_not() } pub fn component_view<P, T>(f: impl ComponentConstructor<P, T>, props: P) -> T { f.construct(props) } pub trait ComponentConstructor<P, T> { fn construct(self, props: P) -> T; } impl<Func, T> ComponentConstructor<(), T> for Func where Func: FnOnce() -> T, { fn construct(self, (): ()) -> T { (self)() } } impl<Func, T, P> ComponentConstructor<P, T> for Func where Func: FnOnce(P) -> T, P: PropsOrNoPropsBuilder, { fn construct(self, props: P) -> T { (self)(props) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/src/hydration/mod.rs
leptos/src/hydration/mod.rs
#![allow(clippy::needless_lifetimes)] use crate::{prelude::*, WasmSplitManifest}; use leptos_config::LeptosOptions; use leptos_macro::{component, view}; use std::{path::PathBuf, sync::OnceLock}; /// Inserts auto-reloading code used in `cargo-leptos`. /// /// This should be included in the `<head>` of your application shell during development. #[component] pub fn AutoReload( /// Whether the file-watching feature should be disabled. #[prop(optional)] disable_watch: bool, /// Configuration options for this project. options: LeptosOptions, ) -> impl IntoView { (!disable_watch && std::env::var("LEPTOS_WATCH").is_ok()).then(|| { #[cfg(feature = "nonce")] let nonce = crate::nonce::use_nonce(); #[cfg(not(feature = "nonce"))] let nonce = None::<()>; let reload_port = match options.reload_external_port { Some(val) => val, None => options.reload_port, }; let protocol = match options.reload_ws_protocol { leptos_config::ReloadWSProtocol::WS => "'ws://'", leptos_config::ReloadWSProtocol::WSS => "'wss://'", }; let script = format!( "(function (reload_port, protocol) {{ {} {} }})({reload_port:?}, \ {protocol})", leptos_hot_reload::HOT_RELOAD_JS, include_str!("reload_script.js") ); view! { <script nonce=nonce>{script}</script> } }) } /// Inserts hydration scripts that add interactivity to your server-rendered HTML. /// /// This should be included in the `<head>` of your application shell. #[component] pub fn HydrationScripts( /// Configuration options for this project. options: LeptosOptions, /// Should be `true` to hydrate in `islands` mode. #[prop(optional)] islands: bool, /// Should be `true` to add the “islands router,” which enables limited client-side routing /// when running in islands mode. #[prop(optional)] islands_router: bool, /// A base url, not including a trailing slash #[prop(optional, into)] root: Option<String>, ) -> impl IntoView { static SPLIT_MANIFEST: OnceLock<Option<WasmSplitManifest>> = OnceLock::new(); if let Some(splits) = SPLIT_MANIFEST.get_or_init(|| { let root = root.clone().unwrap_or_default(); let (wasm_split_js, wasm_split_manifest) = if options.hash_files { let hash_path = std::env::current_exe() .map(|path| { path.parent().map(|p| p.to_path_buf()).unwrap_or_default() }) .unwrap_or_default() .join(options.hash_file.as_ref()); let hashes = std::fs::read_to_string(&hash_path) .expect("failed to read hash file"); let mut split = "__wasm_split.______________________.js".to_string(); let mut manifest = "__wasm_split_manifest.json".to_string(); for line in hashes.lines() { let line = line.trim(); if !line.is_empty() { if let Some((file, hash)) = line.split_once(':') { if file == "manifest" { manifest.clear(); manifest.push_str("__wasm_split_manifest."); manifest.push_str(hash.trim()); manifest.push_str(".json"); } if file == "split" { split.clear(); split.push_str("__wasm_split."); split.push_str(hash.trim()); split.push_str(".js"); } } } } (split, manifest) } else { ( "__wasm_split.______________________.js".to_string(), "__wasm_split_manifest.json".to_string(), ) }; let site_dir = &options.site_root; let pkg_dir = &options.site_pkg_dir; let path = PathBuf::from(site_dir.to_string()); let path = path.join(pkg_dir.to_string()).join(wasm_split_manifest); let file = std::fs::read_to_string(path).ok()?; let manifest = WasmSplitManifest(ArcStoredValue::new(( format!("{root}/{pkg_dir}"), serde_json::from_str(&file).expect("could not read manifest file"), wasm_split_js, ))); Some(manifest) }) { provide_context(splits.clone()); } let mut js_file_name = options.output_name.to_string(); let mut wasm_file_name = options.output_name.to_string(); if options.hash_files { let hash_path = std::env::current_exe() .map(|path| { path.parent().map(|p| p.to_path_buf()).unwrap_or_default() }) .unwrap_or_default() .join(options.hash_file.as_ref()); if hash_path.exists() { let hashes = std::fs::read_to_string(&hash_path) .expect("failed to read hash file"); for line in hashes.lines() { let line = line.trim(); if !line.is_empty() { if let Some((file, hash)) = line.split_once(':') { if file == "js" { js_file_name.push_str(&format!(".{}", hash.trim())); } else if file == "wasm" { wasm_file_name .push_str(&format!(".{}", hash.trim())); } } } } } else { leptos::logging::error!( "File hashing is active but no hash file was found" ); } } else if std::option_env!("LEPTOS_OUTPUT_NAME").is_none() { wasm_file_name.push_str("_bg"); } let pkg_path = &options.site_pkg_dir; #[cfg(feature = "nonce")] let nonce = crate::nonce::use_nonce(); #[cfg(not(feature = "nonce"))] let nonce = None::<String>; let script = if islands { if let Some(sc) = Owner::current_shared_context() { sc.set_is_hydrating(false); } include_str!("./island_script.js") } else { include_str!("./hydration_script.js") }; let islands_router = islands_router .then_some(include_str!("./islands_routing.js")) .unwrap_or_default(); let root = root.unwrap_or_default(); view! { <link rel="modulepreload" href=format!("{root}/{pkg_path}/{js_file_name}.js") crossorigin=nonce.clone()/> <link rel="preload" href=format!("{root}/{pkg_path}/{wasm_file_name}.wasm") r#as="fetch" r#type="application/wasm" crossorigin=nonce.clone().unwrap_or_default() /> <script type="module" nonce=nonce> {format!("{script}({root:?}, {pkg_path:?}, {js_file_name:?}, {wasm_file_name:?});{islands_router}")} </script> } } /// If this is provided via context, it means that you are using the islands router and /// this is a subsequent navigation, made from the client. /// /// This should be provided automatically by a server integration if it detects that the /// header `Islands-Router` is present in the request. /// /// This is used to determine how much of the hydration script to include in the page. /// If it is present, then the contents of the `<HydrationScripts>` component will not be /// included, as they only need to be sent to the client once. #[derive(Debug, Clone, PartialEq, Eq)] pub struct IslandsRouterNavigation;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/tests/pr_4061.rs
leptos/tests/pr_4061.rs
#[cfg(feature = "ssr")] mod imports { pub use any_spawner::Executor; pub use futures::StreamExt; pub use leptos::prelude::*; } #[cfg(feature = "ssr")] #[tokio::test] async fn chain_await_resource() { use imports::*; _ = Executor::init_tokio(); let owner = Owner::new(); owner.set(); let (rs, ws) = signal(0); let source = Resource::new( || (), move |_| async move { #[cfg(feature = "ssr")] tokio::time::sleep(std::time::Duration::from_millis(1)).await; 1 }, ); let consuming = Resource::new( || (), move |_| async move { let result = source.await; ws.update(|s| *s += 1); result }, ); let app = view! { <Suspense>{ move || { Suspend::new(async move { consuming.await; rs.get() }) } }</Suspense> }; assert_eq!(app.to_html_stream_in_order().collect::<String>().await, "1"); } #[cfg(feature = "ssr")] #[tokio::test] async fn chain_no_await_resource() { use imports::*; _ = Executor::init_tokio(); let owner = Owner::new(); owner.set(); let (rs, ws) = signal(0); let source = Resource::new(|| (), move |_| async move { 1 }); let consuming = Resource::new( || (), move |_| async move { let result = source.await; ws.update(|s| *s += 1); result }, ); let app = view! { <Suspense>{ move || { Suspend::new(async move { consuming.await; rs.get() }) } }</Suspense> }; assert_eq!(app.to_html_stream_in_order().collect::<String>().await, "1"); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/leptos/tests/ssr.rs
leptos/tests/ssr.rs
#[cfg(feature = "ssr")] use leptos::html::HtmlElement; #[cfg(feature = "ssr")] #[test] fn simple_ssr_test() { use leptos::prelude::*; let (value, set_value) = signal(0); let rendered: View<HtmlElement<_, _, _>> = view! { <div> <button on:click=move |_| set_value.update(|value| *value -= 1)>"-1"</button> <span>"Value: " {move || value.get().to_string()} "!"</span> <button on:click=move |_| set_value.update(|value| *value += 1)>"+1"</button> </div> }; assert_eq!( rendered.to_html(), "<div><button>-1</button><span>Value: \ <!>0<!>!</span><button>+1</button></div>" ); } #[cfg(feature = "ssr")] #[test] fn ssr_test_with_components() { use leptos::prelude::*; #[component] fn Counter(initial_value: i32) -> impl IntoView { let (value, set_value) = signal(initial_value); view! { <div> <button on:click=move |_| set_value.update(|value| *value -= 1)>"-1"</button> <span>"Value: " {move || value.get().to_string()} "!"</span> <button on:click=move |_| set_value.update(|value| *value += 1)>"+1"</button> </div> } } let rendered: View<HtmlElement<_, _, _>> = view! { <div class="counters"> <Counter initial_value=1/> <Counter initial_value=2/> </div> }; assert_eq!( rendered.to_html(), "<div class=\"counters\"><div><button>-1</button><span>Value: \ <!>1<!>!</span><button>+1</button></div><div><button>-1</\ button><span>Value: <!>2<!>!</span><button>+1</button></div></div>" ); } #[cfg(feature = "ssr")] #[test] fn ssr_test_with_snake_case_components() { use leptos::prelude::*; #[component] fn snake_case_counter(initial_value: i32) -> impl IntoView { let (value, set_value) = signal(initial_value); view! { <div> <button on:click=move |_| set_value.update(|value| *value -= 1)>"-1"</button> <span>"Value: " {move || value.get().to_string()} "!"</span> <button on:click=move |_| set_value.update(|value| *value += 1)>"+1"</button> </div> } } let rendered: View<HtmlElement<_, _, _>> = view! { <div class="counters"> <SnakeCaseCounter initial_value=1/> <SnakeCaseCounter initial_value=2/> </div> }; assert_eq!( rendered.to_html(), "<div class=\"counters\"><div><button>-1</button><span>Value: \ <!>1<!>!</span><button>+1</button></div><div><button>-1</\ button><span>Value: <!>2<!>!</span><button>+1</button></div></div>" ); } #[cfg(feature = "ssr")] #[test] fn test_classes() { use leptos::prelude::*; let (value, _set_value) = signal(5); let rendered: View<HtmlElement<_, _, _>> = view! { <div class="my big" class:a=move || { value.get() > 10 } class:red=true class:car=move || { value.get() > 1 } ></div> }; assert_eq!(rendered.to_html(), "<div class=\"my big red car\"></div>"); } #[cfg(feature = "ssr")] #[test] fn test_class_with_class_directive_merge() { use leptos::prelude::*; // class= followed by class: should merge let rendered: View<HtmlElement<_, _, _>> = view! { <div class="foo" class:bar=true></div> }; assert_eq!(rendered.to_html(), "<div class=\"foo bar\"></div>"); } #[cfg(feature = "ssr")] #[test] fn test_solo_class_directive() { use leptos::prelude::*; // Solo class: directive should work without class attribute let rendered: View<HtmlElement<_, _, _>> = view! { <div class:foo=true></div> }; assert_eq!(rendered.to_html(), "<div class=\"foo\"></div>"); } #[cfg(feature = "ssr")] #[test] fn test_class_directive_with_static_class() { use leptos::prelude::*; // class:foo comes after class= due to macro sorting // The class= clears buffer, then class:foo appends let rendered: View<HtmlElement<_, _, _>> = view! { <div class:foo=true class="bar"></div> }; // After macro sorting: class="bar" class:foo=true // Expected: "bar foo" assert_eq!(rendered.to_html(), "<div class=\"bar foo\"></div>"); } #[cfg(feature = "ssr")] #[test] fn test_global_class_applied() { use leptos::prelude::*; // Test that a global class is properly applied let rendered: View<HtmlElement<_, _, _>> = view! { class="global", <div></div> }; assert_eq!(rendered.to_html(), "<div class=\"global\"></div>"); } #[cfg(feature = "ssr")] #[test] fn test_multiple_class_attributes_overwrite() { use leptos::prelude::*; // When multiple class attributes are applied, the last one should win (browser behavior) // This simulates what happens when attributes are combined programmatically let el = leptos::html::div().class("first").class("second"); let html = el.to_html(); // The second class attribute should overwrite the first assert_eq!(html, "<div class=\"second\"></div>"); } #[cfg(feature = "ssr")] #[test] fn ssr_with_styles() { use leptos::prelude::*; let (_, set_value) = signal(0); let styles = "myclass"; let rendered: View<HtmlElement<_, _, _>> = view! { class=styles, <div> <button class="btn" on:click=move |_| set_value.update(|value| *value -= 1)> "-1" </button> </div> }; assert_eq!( rendered.to_html(), "<div class=\"myclass\"><button class=\"btn \ myclass\">-1</button></div>" ); } #[cfg(feature = "ssr")] #[test] fn ssr_option() { use leptos::prelude::*; let (_, _) = signal(0); let rendered: View<HtmlElement<_, _, _>> = view! { <option></option> }; assert_eq!(rendered.to_html(), "<option></option>"); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/build.rs
reactive_graph/build.rs
use rustc_version::{version_meta, Channel}; fn main() { // Set cfg flags depending on release channel if matches!(version_meta().unwrap().channel, Channel::Nightly) { println!("cargo:rustc-cfg=rustc_nightly"); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/effect.rs
reactive_graph/src/effect.rs
//! Side effects that run in response to changes in the reactive values they read from. #[allow(clippy::module_inception)] mod effect; mod effect_function; mod immediate; mod inner; mod render_effect; pub use effect::*; pub use effect_function::*; pub use immediate::*; pub use render_effect::*; /// Creates a new render effect, which immediately runs `fun`. #[inline(always)] #[track_caller] #[deprecated = "This function is being removed to conform to Rust idioms. \ Please use `RenderEffect::new()` instead."] pub fn create_render_effect<T>( fun: impl FnMut(Option<T>) -> T + 'static, ) -> RenderEffect<T> where T: 'static, { RenderEffect::new(fun) }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/serde.rs
reactive_graph/src/serde.rs
#[allow(deprecated)] use crate::wrappers::read::{MaybeProp, MaybeSignal}; use crate::{ computed::{ArcMemo, Memo}, owner::Storage, signal::{ArcReadSignal, ArcRwSignal, ReadSignal, RwSignal}, traits::With, wrappers::read::{Signal, SignalTypes}, }; use serde::{Deserialize, Serialize}; impl<T, St> Serialize for ReadSignal<T, St> where T: Serialize + 'static, St: Storage<ArcReadSignal<T>>, { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: serde::Serializer, { self.with(|value| value.serialize(serializer)) } } impl<T, St> Serialize for RwSignal<T, St> where T: Serialize + 'static, St: Storage<ArcRwSignal<T>>, { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: serde::Serializer, { self.with(|value| value.serialize(serializer)) } } impl<T, St> Serialize for Memo<T, St> where T: Serialize + 'static, St: Storage<ArcMemo<T, St>> + Storage<T>, { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: serde::Serializer, { self.with(|value| value.serialize(serializer)) } } impl<T: Serialize + 'static> Serialize for ArcReadSignal<T> { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: serde::Serializer, { self.with(|value| value.serialize(serializer)) } } impl<T: Serialize + 'static> Serialize for ArcRwSignal<T> { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: serde::Serializer, { self.with(|value| value.serialize(serializer)) } } impl<T: Serialize + 'static, St: Storage<T>> Serialize for ArcMemo<T, St> { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: serde::Serializer, { self.with(|value| value.serialize(serializer)) } } #[allow(deprecated)] impl<T, St> Serialize for MaybeSignal<T, St> where T: Clone + Send + Sync + Serialize, St: Storage<SignalTypes<T, St>> + Storage<T>, { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: serde::Serializer, { self.with(|value| value.serialize(serializer)) } } impl<T, St> Serialize for MaybeProp<T, St> where T: Send + Sync + Serialize, St: Storage<SignalTypes<Option<T>, St>> + Storage<Option<T>>, { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: serde::Serializer, { match &self.0 { None => None::<T>.serialize(serializer), Some(signal) => signal.with(|value| value.serialize(serializer)), } } } impl<T, St> Serialize for Signal<T, St> where T: Send + Sync + Serialize + 'static, St: Storage<SignalTypes<T, St>> + Storage<T>, { fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error> where S: serde::Serializer, { self.with(|value| value.serialize(serializer)) } } /* Deserialization for signal types */ impl<'de, T, S> Deserialize<'de> for RwSignal<T, S> where T: Send + Sync + Deserialize<'de> + 'static, S: Storage<ArcRwSignal<T>>, { fn deserialize<D>(deserializer: D) -> Result<Self, D::Error> where D: serde::Deserializer<'de>, { T::deserialize(deserializer).map(RwSignal::new_with_storage) } } impl<'de, T: Deserialize<'de>> Deserialize<'de> for ArcRwSignal<T> { fn deserialize<D>(deserializer: D) -> Result<Self, D::Error> where D: serde::Deserializer<'de>, { T::deserialize(deserializer).map(ArcRwSignal::new) } } #[allow(deprecated)] impl<'de, T: Deserialize<'de>, St> Deserialize<'de> for MaybeSignal<T, St> where St: Storage<T>, { fn deserialize<D>(deserializer: D) -> Result<Self, D::Error> where D: serde::Deserializer<'de>, { T::deserialize(deserializer).map(MaybeSignal::Static) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/wrappers.rs
reactive_graph/src/wrappers.rs
//! Types to abstract over different kinds of readable or writable reactive values. /// Types that abstract over signals with values that can be read. pub mod read { use crate::{ computed::{ArcMemo, Memo}, graph::untrack, owner::{ ArcStoredValue, ArenaItem, FromLocal, LocalStorage, Storage, SyncStorage, }, signal::{ guards::{Mapped, Plain, ReadGuard}, ArcMappedSignal, ArcReadSignal, ArcRwSignal, MappedSignal, ReadSignal, RwSignal, }, traits::{ DefinedAt, Dispose, Get, Read, ReadUntracked, ReadValue, Track, }, unwrap_signal, }; use send_wrapper::SendWrapper; use std::{ borrow::Borrow, fmt::Display, ops::Deref, panic::Location, sync::{Arc, RwLock}, }; /// Possibilities for the inner type of a [`Signal`]. pub enum SignalTypes<T, S = SyncStorage> where S: Storage<T>, { /// A readable signal. ReadSignal(ArcReadSignal<T>), /// A memo. Memo(ArcMemo<T, S>), /// A derived signal. DerivedSignal(Arc<dyn Fn() -> T + Send + Sync>), /// A static, stored value. Stored(ArcStoredValue<T>), } impl<T, S> Clone for SignalTypes<T, S> where S: Storage<T>, { fn clone(&self) -> Self { match self { Self::ReadSignal(arg0) => Self::ReadSignal(arg0.clone()), Self::Memo(arg0) => Self::Memo(arg0.clone()), Self::DerivedSignal(arg0) => Self::DerivedSignal(arg0.clone()), Self::Stored(arg0) => Self::Stored(arg0.clone()), } } } impl<T, S> core::fmt::Debug for SignalTypes<T, S> where S: Storage<T>, { fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result { match self { Self::ReadSignal(arg0) => { f.debug_tuple("ReadSignal").field(arg0).finish() } Self::Memo(arg0) => f.debug_tuple("Memo").field(arg0).finish(), Self::DerivedSignal(_) => { f.debug_tuple("DerivedSignal").finish() } Self::Stored(arg0) => { f.debug_tuple("Static").field(arg0).finish() } } } } impl<T, S> PartialEq for SignalTypes<T, S> where S: Storage<T>, { fn eq(&self, other: &Self) -> bool { match (self, other) { (Self::ReadSignal(l0), Self::ReadSignal(r0)) => l0 == r0, (Self::Memo(l0), Self::Memo(r0)) => l0 == r0, (Self::DerivedSignal(l0), Self::DerivedSignal(r0)) => { std::ptr::eq(l0, r0) } _ => false, } } } /// A wrapper for any kind of reference-counted reactive signal: /// an [`ArcReadSignal`], [`ArcMemo`], [`ArcRwSignal`], or derived signal closure, /// or a plain value of the same type /// /// This allows you to create APIs that take `T` or any reactive value that returns `T` /// as an argument, rather than adding a generic `F: Fn() -> T`. /// /// Values can be accessed with the same function call, `read()`, `with()`, and `get()` /// APIs as other signals. /// /// ## Important Notes about Derived Signals /// /// `Signal::derive()` is simply a way to box and type-erase a “derived signal,” which /// is a plain closure that accesses one or more signals. It does *not* cache the value /// of that computation. Accessing the value of a `Signal<_>` that is created using `Signal::derive()` /// will run the closure again every time you call `.read()`, `.with()`, or `.get()`. /// /// If you want the closure to run the minimal number of times necessary to update its state, /// and then to cache its value, you should use a [`Memo`] (and convert it into a `Signal<_>`) /// rather than using `Signal::derive()`. /// /// Note that for many computations, it is nevertheless less expensive to use a derived signal /// than to create a separate memo and to cache the value: creating a new reactive node and /// taking the lock on that cached value whenever you access the signal is *more* expensive than /// simply re-running the calculation in many cases. pub struct ArcSignal<T: 'static, S = SyncStorage> where S: Storage<T>, { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, inner: SignalTypes<T, S>, } impl<T, S> Clone for ArcSignal<T, S> where S: Storage<T>, { fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, inner: self.inner.clone(), } } } impl<T, S> core::fmt::Debug for ArcSignal<T, S> where S: Storage<T>, { fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result { let mut s = f.debug_struct("ArcSignal"); s.field("inner", &self.inner); #[cfg(any(debug_assertions, leptos_debuginfo))] s.field("defined_at", &self.defined_at); s.finish() } } impl<T, S> Eq for ArcSignal<T, S> where S: Storage<T> {} impl<T, S> PartialEq for ArcSignal<T, S> where S: Storage<T>, { fn eq(&self, other: &Self) -> bool { self.inner == other.inner } } impl<T> ArcSignal<T, SyncStorage> where SyncStorage: Storage<T>, { /// Wraps a derived signal, i.e., any computation that accesses one or more /// reactive signals. /// ```rust /// # use reactive_graph::signal::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # use reactive_graph::wrappers::read::ArcSignal; /// # use reactive_graph::prelude::*; /// let (count, set_count) = arc_signal(2); /// let double_count = ArcSignal::derive({ /// let count = count.clone(); /// move || count.get() * 2 /// }); /// /// // this function takes any kind of wrapped signal /// fn above_3(arg: &ArcSignal<i32>) -> bool { /// arg.get() > 3 /// } /// /// assert_eq!(above_3(&count.into()), false); /// assert_eq!(above_3(&double_count), true); /// ``` #[track_caller] pub fn derive( derived_signal: impl Fn() -> T + Send + Sync + 'static, ) -> Self { #[cfg(feature = "tracing")] let span = ::tracing::Span::current(); let derived_signal = move || { #[cfg(feature = "tracing")] let _guard = span.enter(); derived_signal() }; Self { inner: SignalTypes::DerivedSignal(Arc::new(derived_signal)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } /// Moves a static, nonreactive value into a signal, backed by [`ArcStoredValue`]. #[track_caller] pub fn stored(value: T) -> Self { Self { inner: SignalTypes::Stored(ArcStoredValue::new(value)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> ArcSignal<T, LocalStorage> where T: 'static, { /// Wraps a derived signal. Works like [`Signal::derive`] but uses [`LocalStorage`]. #[track_caller] pub fn derive_local(derived_signal: impl Fn() -> T + 'static) -> Self { Signal::derive_local(derived_signal).into() } /// Moves a static, nonreactive value into a signal, backed by [`ArcStoredValue`]. /// Works like [`Signal::stored`] but uses [`LocalStorage`]. #[track_caller] pub fn stored_local(value: T) -> Self { Signal::stored_local(value).into() } } impl<T> Default for ArcSignal<T, SyncStorage> where T: Default + Send + Sync + 'static, { fn default() -> Self { Self::stored(Default::default()) } } impl<T: Send + Sync> From<ArcReadSignal<T>> for ArcSignal<T, SyncStorage> { #[track_caller] fn from(value: ArcReadSignal<T>) -> Self { Self { inner: SignalTypes::ReadSignal(value), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T, S> From<ReadSignal<T, S>> for ArcSignal<T, S> where S: Storage<ArcReadSignal<T>> + Storage<T>, { #[track_caller] fn from(value: ReadSignal<T, S>) -> Self { Self { inner: SignalTypes::ReadSignal(value.into()), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T: Send + Sync> From<ArcRwSignal<T>> for ArcSignal<T, SyncStorage> { #[track_caller] fn from(value: ArcRwSignal<T>) -> Self { Self { inner: SignalTypes::ReadSignal(value.read_only()), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T, S> From<RwSignal<T, S>> for ArcSignal<T, S> where S: Storage<ArcRwSignal<T>> + Storage<ArcReadSignal<T>> + Storage<T>, { #[track_caller] fn from(value: RwSignal<T, S>) -> Self { Self { inner: SignalTypes::ReadSignal(value.read_only().into()), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T, S> From<ArcMemo<T, S>> for ArcSignal<T, S> where S: Storage<T>, { #[track_caller] fn from(value: ArcMemo<T, S>) -> Self { Self { inner: SignalTypes::Memo(value), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T, S> From<Memo<T, S>> for ArcSignal<T, S> where S: Storage<ArcMemo<T, S>> + Storage<T>, { #[track_caller] fn from(value: Memo<T, S>) -> Self { Self { inner: SignalTypes::Memo(value.into()), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<S> From<&'static str> for ArcSignal<String, S> where S: Storage<&'static str> + Storage<String>, { #[track_caller] fn from(value: &'static str) -> Self { Self { inner: SignalTypes::Stored(ArcStoredValue::new( value.to_string(), )), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T, S> DefinedAt for ArcSignal<T, S> where S: Storage<T>, { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T, S> Track for ArcSignal<T, S> where S: Storage<T>, { fn track(&self) { match &self.inner { SignalTypes::ReadSignal(i) => { i.track(); } SignalTypes::Memo(i) => { i.track(); } SignalTypes::DerivedSignal(i) => { i(); } // Doesn't change. SignalTypes::Stored(_) => {} } } } impl<T, S> ReadUntracked for ArcSignal<T, S> where S: Storage<T>, { type Value = ReadGuard<T, SignalReadGuard<T, S>>; fn try_read_untracked(&self) -> Option<Self::Value> { match &self.inner { SignalTypes::ReadSignal(i) => { i.try_read_untracked().map(SignalReadGuard::Read) } SignalTypes::Memo(i) => { i.try_read_untracked().map(SignalReadGuard::Memo) } SignalTypes::DerivedSignal(i) => { Some(SignalReadGuard::Owned(untrack(|| i()))) } SignalTypes::Stored(i) => { i.try_read_value().map(SignalReadGuard::Read) } } .map(ReadGuard::new) } /// Overriding the default auto implemented [`Read::try_read`] to combine read and track, /// to avoid 2 clones and just have 1 in the [`SignalTypes::DerivedSignal`]. fn custom_try_read(&self) -> Option<Option<Self::Value>> { Some( match &self.inner { SignalTypes::ReadSignal(i) => { i.try_read().map(SignalReadGuard::Read) } SignalTypes::Memo(i) => { i.try_read().map(SignalReadGuard::Memo) } SignalTypes::DerivedSignal(i) => { Some(SignalReadGuard::Owned(i())) } SignalTypes::Stored(i) => { i.try_read_value().map(SignalReadGuard::Read) } } .map(ReadGuard::new), ) } } /// A wrapper for any kind of arena-allocated reactive signal: /// a [`ReadSignal`], [`Memo`], [`RwSignal`], or derived signal closure, /// or a plain value of the same type /// /// This allows you to create APIs that take `T` or any reactive value that returns `T` /// as an argument, rather than adding a generic `F: Fn() -> T`. /// /// Values can be accessed with the same function call, `read()`, `with()`, and `get()` /// APIs as other signals. /// /// ## Important Notes about Derived Signals /// /// `Signal::derive()` is simply a way to box and type-erase a “derived signal,” which /// is a plain closure that accesses one or more signals. It does *not* cache the value /// of that computation. Accessing the value of a `Signal<_>` that is created using `Signal::derive()` /// will run the closure again every time you call `.read()`, `.with()`, or `.get()`. /// /// If you want the closure to run the minimal number of times necessary to update its state, /// and then to cache its value, you should use a [`Memo`] (and convert it into a `Signal<_>`) /// rather than using `Signal::derive()`. /// /// Note that for many computations, it is nevertheless less expensive to use a derived signal /// than to create a separate memo and to cache the value: creating a new reactive node and /// taking the lock on that cached value whenever you access the signal is *more* expensive than /// simply re-running the calculation in many cases. pub struct Signal<T, S = SyncStorage> where S: Storage<T>, { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, inner: ArenaItem<SignalTypes<T, S>, S>, } impl<T, S> Dispose for Signal<T, S> where S: Storage<T>, { fn dispose(self) { self.inner.dispose() } } impl<T, S> Clone for Signal<T, S> where S: Storage<T>, { fn clone(&self) -> Self { *self } } impl<T, S> Copy for Signal<T, S> where S: Storage<T> {} impl<T, S> core::fmt::Debug for Signal<T, S> where S: std::fmt::Debug + Storage<T>, { fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result { let mut s = f.debug_struct("Signal"); s.field("inner", &self.inner); #[cfg(any(debug_assertions, leptos_debuginfo))] s.field("defined_at", &self.defined_at); s.finish() } } impl<T, S> Eq for Signal<T, S> where S: Storage<T> {} impl<T, S> PartialEq for Signal<T, S> where S: Storage<T>, { fn eq(&self, other: &Self) -> bool { self.inner == other.inner } } impl<T, S> DefinedAt for Signal<T, S> where S: Storage<T>, { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T, S> Track for Signal<T, S> where T: 'static, S: Storage<T> + Storage<SignalTypes<T, S>>, { fn track(&self) { let inner = self .inner // clone the inner Arc type and release the lock // prevents deadlocking if the derived value includes taking a lock on the arena .try_with_value(Clone::clone) .unwrap_or_else(unwrap_signal!(self)); match inner { SignalTypes::ReadSignal(i) => { i.track(); } SignalTypes::Memo(i) => { i.track(); } SignalTypes::DerivedSignal(i) => { i(); } // Doesn't change. SignalTypes::Stored(_) => {} } } } impl<T, S> ReadUntracked for Signal<T, S> where T: 'static, S: Storage<SignalTypes<T, S>> + Storage<T>, { type Value = ReadGuard<T, SignalReadGuard<T, S>>; fn try_read_untracked(&self) -> Option<Self::Value> { self.inner // clone the inner Arc type and release the lock // prevents deadlocking if the derived value includes taking a lock on the arena .try_with_value(Clone::clone) .and_then(|inner| { match &inner { SignalTypes::ReadSignal(i) => { i.try_read_untracked().map(SignalReadGuard::Read) } SignalTypes::Memo(i) => { i.try_read_untracked().map(SignalReadGuard::Memo) } SignalTypes::DerivedSignal(i) => { Some(SignalReadGuard::Owned(untrack(|| i()))) } SignalTypes::Stored(i) => { i.try_read_value().map(SignalReadGuard::Read) } } .map(ReadGuard::new) }) } /// Overriding the default auto implemented [`Read::try_read`] to combine read and track, /// to avoid 2 clones and just have 1 in the [`SignalTypes::DerivedSignal`]. fn custom_try_read(&self) -> Option<Option<Self::Value>> { Some( self.inner // clone the inner Arc type and release the lock // prevents deadlocking if the derived value includes taking a lock on the arena .try_with_value(Clone::clone) .and_then(|inner| { match &inner { SignalTypes::ReadSignal(i) => { i.try_read().map(SignalReadGuard::Read) } SignalTypes::Memo(i) => { i.try_read().map(SignalReadGuard::Memo) } SignalTypes::DerivedSignal(i) => { Some(SignalReadGuard::Owned(i())) } SignalTypes::Stored(i) => { i.try_read_value().map(SignalReadGuard::Read) } } .map(ReadGuard::new) }), ) } } impl<T> Signal<T> where T: Send + Sync + 'static, { /// Wraps a derived signal, i.e., any computation that accesses one or more /// reactive signals. /// ```rust /// # use reactive_graph::signal::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # use reactive_graph::wrappers::read::Signal; /// # use reactive_graph::prelude::*; /// let (count, set_count) = signal(2); /// let double_count = Signal::derive(move || count.get() * 2); /// /// // this function takes any kind of wrapped signal /// fn above_3(arg: &Signal<i32>) -> bool { /// arg.get() > 3 /// } /// /// assert_eq!(above_3(&count.into()), false); /// assert_eq!(above_3(&double_count), true); /// ``` #[track_caller] pub fn derive( derived_signal: impl Fn() -> T + Send + Sync + 'static, ) -> Self { #[cfg(feature = "tracing")] let span = ::tracing::Span::current(); let derived_signal = move || { #[cfg(feature = "tracing")] let _guard = span.enter(); derived_signal() }; Self { inner: ArenaItem::new_with_storage(SignalTypes::DerivedSignal( Arc::new(derived_signal), )), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } /// Moves a static, nonreactive value into a signal, backed by [`ArcStoredValue`]. #[track_caller] pub fn stored(value: T) -> Self { Self { inner: ArenaItem::new_with_storage(SignalTypes::Stored( ArcStoredValue::new(value), )), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> Signal<T, LocalStorage> where T: 'static, { /// Wraps a derived signal. Works like [`Signal::derive`] but uses [`LocalStorage`]. #[track_caller] pub fn derive_local(derived_signal: impl Fn() -> T + 'static) -> Self { let derived_signal = SendWrapper::new(derived_signal); #[cfg(feature = "tracing")] let span = ::tracing::Span::current(); let derived_signal = move || { #[cfg(feature = "tracing")] let _guard = span.enter(); derived_signal() }; Self { inner: ArenaItem::new_local(SignalTypes::DerivedSignal( Arc::new(derived_signal), )), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } /// Moves a static, nonreactive value into a signal, backed by [`ArcStoredValue`]. /// Works like [`Signal::stored`] but uses [`LocalStorage`]. #[track_caller] pub fn stored_local(value: T) -> Self { Self { inner: ArenaItem::new_local(SignalTypes::Stored( ArcStoredValue::new(value), )), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> Default for Signal<T> where T: Send + Sync + Default + 'static, { fn default() -> Self { Self::stored(Default::default()) } } impl<T> Default for Signal<T, LocalStorage> where T: Default + 'static, { fn default() -> Self { Self::stored_local(Default::default()) } } impl<T: Send + Sync + 'static> From<T> for ArcSignal<T, SyncStorage> { #[track_caller] fn from(value: T) -> Self { ArcSignal::stored(value) } } impl<T> From<T> for Signal<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: T) -> Self { Self::stored(value) } } impl<T> From<T> for Signal<T, LocalStorage> where T: 'static, { #[track_caller] fn from(value: T) -> Self { Self::stored_local(value) } } impl<T> From<ArcSignal<T, SyncStorage>> for Signal<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ArcSignal<T, SyncStorage>) -> Self { Signal { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new(value.inner), } } } impl<T> FromLocal<ArcSignal<T, LocalStorage>> for Signal<T, LocalStorage> where T: 'static, { #[track_caller] fn from_local(value: ArcSignal<T, LocalStorage>) -> Self { Signal { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_local(value.inner), } } } impl<T, S> From<Signal<T, S>> for ArcSignal<T, S> where S: Storage<SignalTypes<T, S>> + Storage<T>, { #[track_caller] fn from(value: Signal<T, S>) -> Self { ArcSignal { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: value .inner .try_get_value() .unwrap_or_else(unwrap_signal!(value)), } } } impl<T> From<ReadSignal<T>> for Signal<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ReadSignal<T>) -> Self { Self { inner: ArenaItem::new(SignalTypes::ReadSignal(value.into())), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<ReadSignal<T, LocalStorage>> for Signal<T, LocalStorage> where T: 'static, { #[track_caller] fn from(value: ReadSignal<T, LocalStorage>) -> Self { Self { inner: ArenaItem::new_local(SignalTypes::ReadSignal( value.into(), )), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<ArcReadSignal<T>> for Signal<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ArcReadSignal<T>) -> Self { Self { inner: ArenaItem::new(SignalTypes::ReadSignal(value)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<ArcReadSignal<T>> for Signal<T, LocalStorage> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ArcReadSignal<T>) -> Self { Self { inner: ArenaItem::new_local(SignalTypes::ReadSignal(value)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<RwSignal<T>> for Signal<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: RwSignal<T>) -> Self { Self { inner: ArenaItem::new(SignalTypes::ReadSignal( value.read_only().into(), )), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<MappedSignal<T>> for Signal<T> where T: Clone + Send + Sync + 'static, { #[track_caller] fn from(value: MappedSignal<T>) -> Self { Self::derive(move || value.get()) } } impl<T> From<RwSignal<T, LocalStorage>> for Signal<T, LocalStorage> where T: 'static, { #[track_caller] fn from(value: RwSignal<T, LocalStorage>) -> Self { Self { inner: ArenaItem::new_local(SignalTypes::ReadSignal( value.read_only().into(), )), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<ArcRwSignal<T>> for Signal<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ArcRwSignal<T>) -> Self { Self { inner: ArenaItem::new(SignalTypes::ReadSignal( value.read_only(), )), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<ArcMappedSignal<T>> for Signal<T> where T: Clone + Send + Sync + 'static, { #[track_caller] fn from(value: ArcMappedSignal<T>) -> Self { MappedSignal::from(value).into() } } impl<T> From<ArcRwSignal<T>> for Signal<T, LocalStorage> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ArcRwSignal<T>) -> Self { Self { inner: ArenaItem::new_local(SignalTypes::ReadSignal( value.read_only(), )), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<Memo<T>> for Signal<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: Memo<T>) -> Self { Self { inner: ArenaItem::new(SignalTypes::Memo(value.into())), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<Memo<T, LocalStorage>> for Signal<T, LocalStorage> where T: 'static, { #[track_caller] fn from(value: Memo<T, LocalStorage>) -> Self { Self { inner: ArenaItem::new_local(SignalTypes::Memo(value.into())), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<ArcMemo<T>> for Signal<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ArcMemo<T>) -> Self { Self { inner: ArenaItem::new(SignalTypes::Memo(value)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<ArcMemo<T, LocalStorage>> for Signal<T, LocalStorage> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ArcMemo<T, LocalStorage>) -> Self { Self { inner: ArenaItem::new_local(SignalTypes::Memo(value)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: std::panic::Location::caller(), } } } impl<T> From<T> for Signal<Option<T>> where T: Send + Sync + 'static, { #[track_caller]
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
true
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/diagnostics.rs
reactive_graph/src/diagnostics.rs
//! By default, attempting to [`Track`](crate::traits::Track) a signal when you are not in a //! reactive tracking context will cause a warning when you are in debug mode. //! //! In some cases, this warning is a false positive. For example, inside an event listener in a //! user interface, you never want to read from a signal reactively; the event listener should run //! when the event fires, not when a signal read in the event listener changes. //! //! This module provides utilities to suppress those warnings by entering a //! [`SpecialNonReactiveZone`]. /// Marks an execution block that is known not to be reactive, and suppresses warnings. #[derive(Debug)] pub struct SpecialNonReactiveZone; /// Exits the "special non-reactive zone" when dropped. #[derive(Debug)] pub struct SpecialNonReactiveZoneGuard(bool); use pin_project_lite::pin_project; use std::{ cell::Cell, future::Future, pin::Pin, task::{Context, Poll}, }; thread_local! { static IS_SPECIAL_ZONE: Cell<bool> = const { Cell::new(false) }; } impl SpecialNonReactiveZone { /// Suppresses warnings about non-reactive accesses until the guard is dropped. pub fn enter() -> SpecialNonReactiveZoneGuard { let prev = IS_SPECIAL_ZONE.replace(true); SpecialNonReactiveZoneGuard(prev) } #[cfg(all(debug_assertions, feature = "effects"))] #[inline(always)] pub(crate) fn is_inside() -> bool { if cfg!(debug_assertions) { IS_SPECIAL_ZONE.get() } else { false } } } impl Drop for SpecialNonReactiveZoneGuard { fn drop(&mut self) { IS_SPECIAL_ZONE.set(self.0); } } pin_project! { #[doc(hidden)] pub struct SpecialNonReactiveFuture<Fut> { #[pin] inner: Fut } } impl<Fut> SpecialNonReactiveFuture<Fut> { pub fn new(inner: Fut) -> Self { Self { inner } } } impl<Fut> Future for SpecialNonReactiveFuture<Fut> where Fut: Future, { type Output = Fut::Output; fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> { #[cfg(debug_assertions)] let _rw = SpecialNonReactiveZone::enter(); let this = self.project(); this.inner.poll(cx) } } thread_local! { static SUPPRESS_RESOURCE_LOAD: Cell<bool> = const { Cell::new(false) }; } #[doc(hidden)] pub fn suppress_resource_load(suppress: bool) { SUPPRESS_RESOURCE_LOAD.with(|w| w.set(suppress)); } #[doc(hidden)] pub fn is_suppressing_resource_load() -> bool { SUPPRESS_RESOURCE_LOAD.with(|w| w.get()) }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/lib.rs
reactive_graph/src/lib.rs
//! An implementation of a fine-grained reactive system. //! //! Fine-grained reactivity is an approach to modeling the flow of data through an interactive //! application by composing together three categories of reactive primitives: //! 1. **Signals**: atomic units of state, which can be directly mutated. //! 2. **Computations**: derived values, which cannot be mutated directly but update whenever the signals //! they depend on change. These include both synchronous and asynchronous derived values. //! 3. **Effects**: side effects that synchronize the reactive system with the non-reactive world //! outside it. //! //! Signals and computations are "source" nodes in the reactive graph, because an observer can //! subscribe to them to respond to changes in their values. Effects and computations are "subscriber" //! nodes, because they can listen to changes in other values. //! //! ```rust //! # any_spawner::Executor::init_futures_executor(); //! # let owner = reactive_graph::owner::Owner::new(); owner.set(); //! use reactive_graph::{ //! computed::ArcMemo, //! effect::Effect, //! prelude::{Read, Set}, //! signal::ArcRwSignal, //! }; //! //! let count = ArcRwSignal::new(1); //! let double_count = ArcMemo::new({ //! let count = count.clone(); //! move |_| *count.read() * 2 //! }); //! //! // the effect will run once initially //! Effect::new(move |_| { //! println!("double_count = {}", *double_count.read()); //! }); //! //! // updating `count` will propagate changes to the dependencies, //! // causing the effect to run again //! count.set(2); //! ``` //! //! This reactivity is called "fine grained" because updating the value of a signal only affects //! the effects and computations that depend on its value, without requiring any diffing or update //! calculations for other values. //! //! This model is especially suitable for building user interfaces, i.e., long-lived systems in //! which changes can begin from many different entry points. It is not particularly useful in //! "run-once" programs like a CLI. //! //! ## Design Principles and Assumptions //! - **Effects are expensive.** The library is built on the assumption that the side effects //! (making a network request, rendering something to the DOM, writing to disk) are orders of //! magnitude more expensive than propagating signal updates. As a result, the algorithm is //! designed to avoid re-running side effects unnecessarily, and is willing to sacrifice a small //! amount of raw update speed to that goal. //! - **Automatic dependency tracking.** Dependencies are not specified as a compile-time list, but //! tracked at runtime. This in turn enables **dynamic dependency tracking**: subscribers //! unsubscribe from their sources between runs, which means that a subscriber that contains a //! condition branch will not re-run when dependencies update that are only used in the inactive //! branch. //! - **Asynchronous effect scheduling.** Effects are spawned as asynchronous tasks. This means //! that while updating a signal will immediately update its value, effects that depend on it //! will not run until the next "tick" of the async runtime. (This in turn means that the //! reactive system is *async runtime agnostic*: it can be used in the browser with //! `wasm-bindgen-futures`, in a native binary with `tokio`, in a GTK application with `glib`, //! etc.) //! //! The reactive-graph algorithm used in this crate is based on that of //! [Reactively](https://github.com/modderme123/reactively), as described //! [in this article](https://dev.to/modderme123/super-charging-fine-grained-reactive-performance-47ph). #![cfg_attr(all(feature = "nightly", rustc_nightly), feature(unboxed_closures))] #![cfg_attr(all(feature = "nightly", rustc_nightly), feature(fn_traits))] #![deny(missing_docs)] use std::{fmt::Arguments, future::Future}; pub mod actions; pub(crate) mod channel; pub mod computed; pub mod diagnostics; pub mod effect; pub mod graph; pub mod owner; pub mod send_wrapper_ext; #[cfg(feature = "serde")] mod serde; pub mod signal; mod trait_options; pub mod traits; pub mod transition; pub mod wrappers; mod into_reactive_value; pub use into_reactive_value::*; /// A standard way to wrap functions and closures to pass them to components. pub mod callback; use computed::ScopedFuture; #[cfg(all(feature = "nightly", rustc_nightly))] mod nightly; /// Reexports frequently-used traits. pub mod prelude { pub use crate::{ into_reactive_value::IntoReactiveValue, owner::FromLocal, traits::*, }; } // TODO remove this, it's just useful while developing #[allow(unused)] #[doc(hidden)] pub fn log_warning(text: Arguments) { #[cfg(all(target_arch = "wasm32", target_os = "unknown"))] { web_sys::console::warn_1(&text.to_string().into()); } #[cfg(all( not(feature = "tracing"), not(all(target_arch = "wasm32", target_os = "unknown")) ))] { eprintln!("{text}"); } } /// Calls [`Executor::spawn`](any_spawner::Executor::spawn) on non-wasm targets and [`Executor::spawn_local`](any_spawner::Executor::spawn_local) on wasm targets, but ensures that the task also runs in the current arena, if /// multithreaded arena sandboxing is enabled. pub fn spawn(task: impl Future<Output = ()> + Send + 'static) { #[cfg(feature = "sandboxed-arenas")] let task = owner::Sandboxed::new(task); #[cfg(not(target_family = "wasm"))] any_spawner::Executor::spawn(task); #[cfg(target_family = "wasm")] any_spawner::Executor::spawn_local(task); } /// Calls [`Executor::spawn_local`](any_spawner::Executor::spawn_local), but ensures that the task also runs in the current arena, if /// multithreaded arena sandboxing is enabled. pub fn spawn_local(task: impl Future<Output = ()> + 'static) { #[cfg(feature = "sandboxed-arenas")] let task = owner::Sandboxed::new(task); any_spawner::Executor::spawn_local(task); } /// Calls [`Executor::spawn_local`](any_spawner::Executor), but ensures that the task runs under the current reactive [`Owner`](crate::owner::Owner) and observer. /// /// Does not cancel the task if the owner is cleaned up. pub fn spawn_local_scoped(task: impl Future<Output = ()> + 'static) { let task = ScopedFuture::new(task); #[cfg(feature = "sandboxed-arenas")] let task = owner::Sandboxed::new(task); any_spawner::Executor::spawn_local(task); } /// Calls [`Executor::spawn_local`](any_spawner::Executor), but ensures that the task runs under the current reactive [`Owner`](crate::owner::Owner) and observer. /// /// Cancels the task if the owner is cleaned up. pub fn spawn_local_scoped_with_cancellation( task: impl Future<Output = ()> + 'static, ) { use crate::owner::on_cleanup; use futures::future::{AbortHandle, Abortable}; let (abort_handle, abort_registration) = AbortHandle::new_pair(); on_cleanup(move || abort_handle.abort()); let task = Abortable::new(task, abort_registration); let task = ScopedFuture::new(task); #[cfg(feature = "sandboxed-arenas")] let task = owner::Sandboxed::new(task); any_spawner::Executor::spawn_local(async move { _ = task.await; }); }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/trait_options.rs
reactive_graph/src/trait_options.rs
use crate::{ traits::{ DefinedAt, Get, GetUntracked, Read, ReadUntracked, Track, With, WithUntracked, }, unwrap_signal, }; use std::panic::Location; impl<T> DefinedAt for Option<T> where T: DefinedAt, { fn defined_at(&self) -> Option<&'static Location<'static>> { self.as_ref().map(DefinedAt::defined_at).unwrap_or(None) } } impl<T> Track for Option<T> where T: Track, { fn track(&self) { if let Some(signal) = self { signal.track(); } } } /// An alternative [`ReadUntracked`](crate) trait that works with `Option<Readable>` types. pub trait ReadUntrackedOptional: Sized + DefinedAt { /// The guard type that will be returned, which can be dereferenced to the value. type Value; /// Returns the guard, or `None` if the signal has already been disposed. #[track_caller] fn try_read_untracked(&self) -> Option<Self::Value>; /// Returns the guard. /// /// # Panics /// Panics if you try to access a signal that has been disposed. #[track_caller] fn read_untracked(&self) -> Self::Value { self.try_read_untracked() .unwrap_or_else(unwrap_signal!(self)) } } impl<T> ReadUntrackedOptional for Option<T> where Self: DefinedAt, T: ReadUntracked, { type Value = Option<<T as ReadUntracked>::Value>; fn try_read_untracked(&self) -> Option<Self::Value> { Some(if let Some(signal) = self { Some(signal.try_read_untracked()?) } else { None }) } } /// An alternative [`Read`](crate) trait that works with `Option<Readable>` types. pub trait ReadOptional: DefinedAt { /// The guard type that will be returned, which can be dereferenced to the value. type Value; /// Subscribes to the signal, and returns the guard, or `None` if the signal has already been disposed. #[track_caller] fn try_read(&self) -> Option<Self::Value>; /// Subscribes to the signal, and returns the guard. /// /// # Panics /// Panics if you try to access a signal that has been disposed. #[track_caller] fn read(&self) -> Self::Value { self.try_read().unwrap_or_else(unwrap_signal!(self)) } } impl<T> ReadOptional for Option<T> where Self: DefinedAt, T: Read, { type Value = Option<<T as Read>::Value>; fn try_read(&self) -> Option<Self::Value> { Some(if let Some(readable) = self { Some(readable.try_read()?) } else { None }) } } /// An alternative [`WithUntracked`](crate) trait that works with `Option<Withable>` types. pub trait WithUntrackedOptional: DefinedAt { /// The type of the value contained in the signal. type Value: ?Sized; /// Applies the closure to the value, and returns the result, /// or `None` if the signal has already been disposed. #[track_caller] fn try_with_untracked<U>( &self, fun: impl FnOnce(Option<&Self::Value>) -> U, ) -> Option<U>; /// Applies the closure to the value, and returns the result. /// /// # Panics /// Panics if you try to access a signal that has been disposed. #[track_caller] fn with_untracked<U>( &self, fun: impl FnOnce(Option<&Self::Value>) -> U, ) -> U { self.try_with_untracked(fun) .unwrap_or_else(unwrap_signal!(self)) } } impl<T> WithUntrackedOptional for Option<T> where Self: DefinedAt, T: WithUntracked, <T as WithUntracked>::Value: Sized, { type Value = <T as WithUntracked>::Value; fn try_with_untracked<U>( &self, fun: impl FnOnce(Option<&Self::Value>) -> U, ) -> Option<U> { if let Some(signal) = self { Some(signal.try_with_untracked(|val| fun(Some(val)))?) } else { Some(fun(None)) } } } /// An alternative [`With`](crate) trait that works with `Option<Withable>` types. pub trait WithOptional: DefinedAt { /// The type of the value contained in the signal. type Value: ?Sized; /// Subscribes to the signal, applies the closure to the value, and returns the result, /// or `None` if the signal has already been disposed. #[track_caller] fn try_with<U>( &self, fun: impl FnOnce(Option<&Self::Value>) -> U, ) -> Option<U>; /// Subscribes to the signal, applies the closure to the value, and returns the result. /// /// # Panics /// Panics if you try to access a signal that has been disposed. #[track_caller] fn with<U>(&self, fun: impl FnOnce(Option<&Self::Value>) -> U) -> U { self.try_with(fun).unwrap_or_else(unwrap_signal!(self)) } } impl<T> WithOptional for Option<T> where Self: DefinedAt, T: With, <T as With>::Value: Sized, { type Value = <T as With>::Value; fn try_with<U>( &self, fun: impl FnOnce(Option<&Self::Value>) -> U, ) -> Option<U> { if let Some(signal) = self { Some(signal.try_with(|val| fun(Some(val)))?) } else { Some(fun(None)) } } } impl<T> GetUntracked for Option<T> where Self: DefinedAt, T: GetUntracked, { type Value = Option<<T as GetUntracked>::Value>; fn try_get_untracked(&self) -> Option<Self::Value> { Some(if let Some(signal) = self { Some(signal.try_get_untracked()?) } else { None }) } } impl<T> Get for Option<T> where Self: DefinedAt, T: Get, { type Value = Option<<T as Get>::Value>; fn try_get(&self) -> Option<Self::Value> { Some(if let Some(signal) = self { Some(signal.try_get()?) } else { None }) } } /// Helper trait to implement flatten() on `Option<&Option<T>>`. pub trait FlattenOptionRefOption { /// The type of the value contained in the double option. type Value; /// Converts from `Option<&Option<T>>` to `Option<&T>`. fn flatten(&self) -> Option<&Self::Value>; } impl<'a, T> FlattenOptionRefOption for Option<&'a Option<T>> { type Value = T; fn flatten(&self) -> Option<&'a T> { self.map(Option::as_ref).flatten() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/signal.rs
reactive_graph/src/signal.rs
//! Reactive primitives for root values that can be changed, notifying other nodes in the reactive //! graph. mod arc_read; mod arc_rw; mod arc_trigger; mod arc_write; pub mod guards; mod mapped; mod read; mod rw; mod subscriber_traits; mod trigger; mod write; use crate::owner::LocalStorage; pub use arc_read::*; pub use arc_rw::*; pub use arc_trigger::*; pub use arc_write::*; pub use mapped::*; pub use read::*; pub use rw::*; pub use trigger::*; pub use write::*; /// Creates a reference-counted signal. /// /// A signal is a piece of data that may change over time, and notifies other /// code when it has changed. This is the atomic unit of reactivity, which begins all other /// processes of updating. /// /// Takes the initial value as an argument, and returns a tuple containing an /// [`ArcReadSignal`] and an [`ArcWriteSignal`]. /// /// This returns reference-counted signals, which are `Clone` but not `Copy`. For arena-allocated /// `Copy` signals, use [`signal`]. /// /// ``` /// # use reactive_graph::prelude::*; /// # use reactive_graph::signal::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// let (count, set_count) = arc_signal(0); /// /// // ✅ calling the getter clones and returns the value /// // this can be `count()` on nightly /// assert_eq!(count.get(), 0); /// /// // ✅ calling the setter sets the value /// // this can be `set_count(1)` on nightly /// set_count.set(1); /// assert_eq!(count.get(), 1); /// /// // ❌ you could call the getter within the setter /// // set_count.set(count.get() + 1); /// /// // ✅ however it's more efficient to use .update() and mutate the value in place /// set_count.update(|count: &mut i32| *count += 1); /// assert_eq!(count.get(), 2); /// /// // ✅ you can create "derived signals" with a Fn() -> T interface /// let double_count = move || count.get() * 2; /// set_count.set(0); /// assert_eq!(double_count(), 0); /// set_count.set(1); /// assert_eq!(double_count(), 2); /// ``` #[inline(always)] #[track_caller] pub fn arc_signal<T>(value: T) -> (ArcReadSignal<T>, ArcWriteSignal<T>) { ArcRwSignal::new(value).split() } /// Creates an arena-allocated signal, the basic reactive primitive. /// /// A signal is a piece of data that may change over time, and notifies other /// code when it has changed. This is the atomic unit of reactivity, which begins all other /// processes of updating. /// /// Takes the initial value as an argument, and returns a tuple containing a /// [`ReadSignal`] and a [`WriteSignal`]. /// /// This returns an arena-allocated signal, which is `Copy` and is disposed when its reactive /// [`Owner`](crate::owner::Owner) cleans up. For a reference-counted signal that lives /// as long as a reference to it is alive, see [`arc_signal`]. /// ``` /// # use reactive_graph::prelude::*; /// # use reactive_graph::signal::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// let (count, set_count) = signal(0); /// /// // ✅ calling the getter clones and returns the value /// // this can be `count()` on nightly /// assert_eq!(count.get(), 0); /// /// // ✅ calling the setter sets the value /// // this can be `set_count(1)` on nightly /// set_count.set(1); /// assert_eq!(count.get(), 1); /// /// // ❌ you could call the getter within the setter /// // set_count.set(count.get() + 1); /// /// // ✅ however it's more efficient to use .update() and mutate the value in place /// set_count.update(|count: &mut i32| *count += 1); /// assert_eq!(count.get(), 2); /// /// // ✅ you can create "derived signals" with a Fn() -> T interface /// let double_count = move || count.get() * 2; // signals are `Copy` so you can `move` them anywhere /// set_count.set(0); /// assert_eq!(double_count(), 0); /// set_count.set(1); /// assert_eq!(double_count(), 2); /// ``` #[inline(always)] #[track_caller] pub fn signal<T: Send + Sync + 'static>( value: T, ) -> (ReadSignal<T>, WriteSignal<T>) { let (r, w) = arc_signal(value); (r.into(), w.into()) } /// Creates an arena-allocated signal. /// /// Unlike [`signal`], this does not require the value to be `Send + Sync`. Instead, it is stored /// on a local arena. Accessing either of the returned signals from another thread will panic. #[inline(always)] #[track_caller] pub fn signal_local<T: 'static>( value: T, ) -> (ReadSignal<T, LocalStorage>, WriteSignal<T, LocalStorage>) { RwSignal::new_local(value).split() } /// Creates an arena-allocated signal, the basic reactive primitive. /// /// A signal is a piece of data that may change over time, and notifies other /// code when it has changed. This is the atomic unit of reactivity, which begins all other /// processes of updating. /// /// Takes the initial value as an argument, and returns a tuple containing a /// [`ReadSignal`] and a [`WriteSignal`]. /// /// This returns an arena-allocated signal, which is `Copy` and is disposed when its reactive /// [`Owner`](crate::owner::Owner) cleans up. For a reference-counted signal that lives /// as long as a reference to it is alive, see [`arc_signal`]. /// ``` /// # use reactive_graph::prelude::*; /// # use reactive_graph::signal::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// let (count, set_count) = create_signal(0); /// /// // ✅ calling the getter clones and returns the value /// // this can be `count()` on nightly /// assert_eq!(count.get(), 0); /// /// // ✅ calling the setter sets the value /// // this can be `set_count(1)` on nightly /// set_count.set(1); /// assert_eq!(count.get(), 1); /// /// // ❌ you could call the getter within the setter /// // set_count.set(count.get() + 1); /// /// // ✅ however it's more efficient to use .update() and mutate the value in place /// set_count.update(|count: &mut i32| *count += 1); /// assert_eq!(count.get(), 2); /// /// // ✅ you can create "derived signals" with a Fn() -> T interface /// let double_count = move || count.get() * 2; // signals are `Copy` so you can `move` them anywhere /// set_count.set(0); /// assert_eq!(double_count(), 0); /// set_count.set(1); /// assert_eq!(double_count(), 2); /// ``` #[inline(always)] #[track_caller] #[deprecated = "This function is being renamed to `signal()` to conform to \ Rust idioms."] pub fn create_signal<T: Send + Sync + 'static>( value: T, ) -> (ReadSignal<T>, WriteSignal<T>) { signal(value) } /// Creates a reactive signal with the getter and setter unified in one value. #[inline(always)] #[track_caller] #[deprecated = "This function is being removed to conform to Rust idioms. \ Please use `RwSignal::new()` instead."] pub fn create_rw_signal<T: Send + Sync + 'static>(value: T) -> RwSignal<T> { RwSignal::new(value) } /// A trigger is a data-less signal with the sole purpose of notifying other reactive code of a change. #[inline(always)] #[track_caller] #[deprecated = "This function is being removed to conform to Rust idioms. \ Please use `ArcTrigger::new()` instead."] pub fn create_trigger() -> ArcTrigger { ArcTrigger::new() }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/callback.rs
reactive_graph/src/callback.rs
//! Callbacks define a standard way to store functions and closures. They are useful //! for component properties, because they can be used to define optional callback functions, //! which generic props don’t support. //! //! The callback types implement [`Copy`], so they can easily be moved into and out of other closures, just like signals. //! //! # Types //! This modules implements 2 callback types: //! - [`Callback`](reactive_graph::callback::Callback) //! - [`UnsyncCallback`](reactive_graph::callback::UnsyncCallback) //! //! Use `SyncCallback` if the function is not `Sync` and `Send`. use crate::{ owner::{LocalStorage, StoredValue}, traits::{Dispose, WithValue}, IntoReactiveValue, }; use std::{fmt, rc::Rc, sync::Arc}; /// A wrapper trait for calling callbacks. pub trait Callable<In: 'static, Out: 'static = ()> { /// calls the callback with the specified argument. /// /// Returns None if the callback has been disposed fn try_run(&self, input: In) -> Option<Out>; /// calls the callback with the specified argument. /// /// # Panics /// Panics if you try to run a callback that has been disposed fn run(&self, input: In) -> Out; } /// A callback type that is not required to be [`Send`] or [`Sync`]. /// /// # Example /// ``` /// # use reactive_graph::prelude::*; use reactive_graph::callback::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// let _: UnsyncCallback<()> = UnsyncCallback::new(|_| {}); /// let _: UnsyncCallback<(i32, i32)> = (|_x: i32, _y: i32| {}).into(); /// let cb: UnsyncCallback<i32, String> = UnsyncCallback::new(|x: i32| x.to_string()); /// assert_eq!(cb.run(42), "42".to_string()); /// ``` pub struct UnsyncCallback<In: 'static, Out: 'static = ()>( StoredValue<Rc<dyn Fn(In) -> Out>, LocalStorage>, ); impl<In> fmt::Debug for UnsyncCallback<In> { fn fmt(&self, fmt: &mut fmt::Formatter<'_>) -> Result<(), fmt::Error> { fmt.write_str("Callback") } } impl<In, Out> Copy for UnsyncCallback<In, Out> {} impl<In, Out> Clone for UnsyncCallback<In, Out> { fn clone(&self) -> Self { *self } } impl<In, Out> Dispose for UnsyncCallback<In, Out> { fn dispose(self) { self.0.dispose(); } } impl<In, Out> UnsyncCallback<In, Out> { /// Creates a new callback from the given function. pub fn new<F>(f: F) -> UnsyncCallback<In, Out> where F: Fn(In) -> Out + 'static, { Self(StoredValue::new_local(Rc::new(f))) } /// Returns `true` if both callbacks wrap the same underlying function pointer. #[inline] pub fn matches(&self, other: &Self) -> bool { self.0.with_value(|self_value| { other .0 .with_value(|other_value| Rc::ptr_eq(self_value, other_value)) }) } } impl<In: 'static, Out: 'static> Callable<In, Out> for UnsyncCallback<In, Out> { fn try_run(&self, input: In) -> Option<Out> { self.0.try_with_value(|fun| fun(input)) } fn run(&self, input: In) -> Out { self.0.with_value(|fun| fun(input)) } } macro_rules! impl_unsync_callable_from_fn { ($($arg:ident),*) => { impl<F, $($arg,)* T, Out> From<F> for UnsyncCallback<($($arg,)*), Out> where F: Fn($($arg),*) -> T + 'static, T: Into<Out> + 'static, $($arg: 'static,)* { fn from(f: F) -> Self { paste::paste!( Self::new(move |($([<$arg:lower>],)*)| f($([<$arg:lower>]),*).into()) ) } } }; } impl_unsync_callable_from_fn!(); impl_unsync_callable_from_fn!(P1); impl_unsync_callable_from_fn!(P1, P2); impl_unsync_callable_from_fn!(P1, P2, P3); impl_unsync_callable_from_fn!(P1, P2, P3, P4); impl_unsync_callable_from_fn!(P1, P2, P3, P4, P5); impl_unsync_callable_from_fn!(P1, P2, P3, P4, P5, P6); impl_unsync_callable_from_fn!(P1, P2, P3, P4, P5, P6, P7); impl_unsync_callable_from_fn!(P1, P2, P3, P4, P5, P6, P7, P8); impl_unsync_callable_from_fn!(P1, P2, P3, P4, P5, P6, P7, P8, P9); impl_unsync_callable_from_fn!(P1, P2, P3, P4, P5, P6, P7, P8, P9, P10); impl_unsync_callable_from_fn!(P1, P2, P3, P4, P5, P6, P7, P8, P9, P10, P11); impl_unsync_callable_from_fn!( P1, P2, P3, P4, P5, P6, P7, P8, P9, P10, P11, P12 ); /// A callback type that is [`Send`] + [`Sync`]. /// /// # Example /// ``` /// # use reactive_graph::prelude::*; use reactive_graph::callback::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// let _: Callback<()> = Callback::new(|_| {}); /// let _: Callback<(i32, i32)> = (|_x: i32, _y: i32| {}).into(); /// let cb: Callback<i32, String> = Callback::new(|x: i32| x.to_string()); /// assert_eq!(cb.run(42), "42".to_string()); /// ``` pub struct Callback<In, Out = ()>( StoredValue<Arc<dyn Fn(In) -> Out + Send + Sync>>, ) where In: 'static, Out: 'static; impl<In, Out> fmt::Debug for Callback<In, Out> { fn fmt(&self, fmt: &mut fmt::Formatter<'_>) -> Result<(), fmt::Error> { fmt.write_str("SyncCallback") } } impl<In, Out> Callable<In, Out> for Callback<In, Out> { fn try_run(&self, input: In) -> Option<Out> { self.0.try_with_value(|fun| fun(input)) } fn run(&self, input: In) -> Out { self.0.with_value(|f| f(input)) } } impl<In, Out> Clone for Callback<In, Out> { fn clone(&self) -> Self { *self } } impl<In, Out> Dispose for Callback<In, Out> { fn dispose(self) { self.0.dispose(); } } impl<In, Out> Copy for Callback<In, Out> {} macro_rules! impl_callable_from_fn { ($($arg:ident),*) => { impl<F, $($arg,)* T, Out> From<F> for Callback<($($arg,)*), Out> where F: Fn($($arg),*) -> T + Send + Sync + 'static, T: Into<Out> + 'static, $($arg: Send + Sync + 'static,)* { fn from(f: F) -> Self { paste::paste!( Self::new(move |($([<$arg:lower>],)*)| f($([<$arg:lower>]),*).into()) ) } } }; } impl_callable_from_fn!(); impl_callable_from_fn!(P1); impl_callable_from_fn!(P1, P2); impl_callable_from_fn!(P1, P2, P3); impl_callable_from_fn!(P1, P2, P3, P4); impl_callable_from_fn!(P1, P2, P3, P4, P5); impl_callable_from_fn!(P1, P2, P3, P4, P5, P6); impl_callable_from_fn!(P1, P2, P3, P4, P5, P6, P7); impl_callable_from_fn!(P1, P2, P3, P4, P5, P6, P7, P8); impl_callable_from_fn!(P1, P2, P3, P4, P5, P6, P7, P8, P9); impl_callable_from_fn!(P1, P2, P3, P4, P5, P6, P7, P8, P9, P10); impl_callable_from_fn!(P1, P2, P3, P4, P5, P6, P7, P8, P9, P10, P11); impl_callable_from_fn!(P1, P2, P3, P4, P5, P6, P7, P8, P9, P10, P11, P12); impl<In: 'static, Out: 'static> Callback<In, Out> { /// Creates a new callback from the given function. #[track_caller] pub fn new<F>(fun: F) -> Self where F: Fn(In) -> Out + Send + Sync + 'static, { Self(StoredValue::new(Arc::new(fun))) } /// Returns `true` if both callbacks wrap the same underlying function pointer. #[inline] pub fn matches(&self, other: &Self) -> bool { self.0 .try_with_value(|self_value| { other.0.try_with_value(|other_value| { Arc::ptr_eq(self_value, other_value) }) }) .flatten() .unwrap_or(false) } } #[doc(hidden)] pub struct __IntoReactiveValueMarkerCallbackSingleParam; #[doc(hidden)] pub struct __IntoReactiveValueMarkerCallbackStrOutputToString; impl<I, O, F> IntoReactiveValue< Callback<I, O>, __IntoReactiveValueMarkerCallbackSingleParam, > for F where F: Fn(I) -> O + Send + Sync + 'static, { #[track_caller] fn into_reactive_value(self) -> Callback<I, O> { Callback::new(self) } } impl<I, O, F> IntoReactiveValue< UnsyncCallback<I, O>, __IntoReactiveValueMarkerCallbackSingleParam, > for F where F: Fn(I) -> O + 'static, { #[track_caller] fn into_reactive_value(self) -> UnsyncCallback<I, O> { UnsyncCallback::new(self) } } impl<I, F> IntoReactiveValue< Callback<I, String>, __IntoReactiveValueMarkerCallbackStrOutputToString, > for F where F: Fn(I) -> &'static str + Send + Sync + 'static, { #[track_caller] fn into_reactive_value(self) -> Callback<I, String> { Callback::new(move |i| self(i).to_string()) } } impl<I, F> IntoReactiveValue< UnsyncCallback<I, String>, __IntoReactiveValueMarkerCallbackStrOutputToString, > for F where F: Fn(I) -> &'static str + 'static, { #[track_caller] fn into_reactive_value(self) -> UnsyncCallback<I, String> { UnsyncCallback::new(move |i| self(i).to_string()) } } #[cfg(test)] mod tests { use super::Callable; use crate::{ callback::{Callback, UnsyncCallback}, owner::Owner, traits::Dispose, IntoReactiveValue, }; struct NoClone {} #[test] fn clone_callback() { let owner = Owner::new(); owner.set(); let callback = Callback::new(move |_no_clone: NoClone| NoClone {}); let _cloned = callback; } #[test] fn clone_unsync_callback() { let owner = Owner::new(); owner.set(); let callback = UnsyncCallback::new(move |_no_clone: NoClone| NoClone {}); let _cloned = callback; } #[test] fn runback_from() { let owner = Owner::new(); owner.set(); let _callback: Callback<(), String> = (|| "test").into(); let _callback: Callback<(i32, String), String> = (|num, s| format!("{num} {s}")).into(); // Single params should work without needing the (foo,) tuple using IntoReactiveValue: let _callback: Callback<usize, &'static str> = (|_usize| "test").into_reactive_value(); let _callback: Callback<usize, String> = (|_usize| "test").into_reactive_value(); } #[test] fn sync_callback_from() { let owner = Owner::new(); owner.set(); let _callback: UnsyncCallback<(), String> = (|| "test").into(); let _callback: UnsyncCallback<(i32, String), String> = (|num, s| format!("{num} {s}")).into(); // Single params should work without needing the (foo,) tuple using IntoReactiveValue: let _callback: UnsyncCallback<usize, &'static str> = (|_usize| "test").into_reactive_value(); let _callback: UnsyncCallback<usize, String> = (|_usize| "test").into_reactive_value(); } #[test] fn sync_callback_try_run() { let owner = Owner::new(); owner.set(); let callback = Callback::new(move |arg| arg); assert_eq!(callback.try_run((0,)), Some((0,))); callback.dispose(); assert_eq!(callback.try_run((0,)), None); } #[test] fn unsync_callback_try_run() { let owner = Owner::new(); owner.set(); let callback = UnsyncCallback::new(move |arg| arg); assert_eq!(callback.try_run((0,)), Some((0,))); callback.dispose(); assert_eq!(callback.try_run((0,)), None); } #[test] fn callback_matches_same() { let owner = Owner::new(); owner.set(); let callback1 = Callback::new(|x: i32| x * 2); let callback2 = callback1; assert!(callback1.matches(&callback2)); } #[test] fn callback_matches_different() { let owner = Owner::new(); owner.set(); let callback1 = Callback::new(|x: i32| x * 2); let callback2 = Callback::new(|x: i32| x + 1); assert!(!callback1.matches(&callback2)); } #[test] fn unsync_callback_matches_same() { let owner = Owner::new(); owner.set(); let callback1 = UnsyncCallback::new(|x: i32| x * 2); let callback2 = callback1; assert!(callback1.matches(&callback2)); } #[test] fn unsync_callback_matches_different() { let owner = Owner::new(); owner.set(); let callback1 = UnsyncCallback::new(|x: i32| x * 2); let callback2 = UnsyncCallback::new(|x: i32| x + 1); assert!(!callback1.matches(&callback2)); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/transition.rs
reactive_graph/src/transition.rs
//! Utilities to wait for asynchronous primitives to resolve. use futures::{channel::oneshot, future::join_all}; use or_poisoned::OrPoisoned; use std::{ future::Future, sync::{mpsc, OnceLock, RwLock}, }; static TRANSITION: OnceLock<RwLock<Option<TransitionInner>>> = OnceLock::new(); fn global_transition() -> &'static RwLock<Option<TransitionInner>> { TRANSITION.get_or_init(|| RwLock::new(None)) } #[derive(Debug, Clone)] struct TransitionInner { tx: mpsc::Sender<oneshot::Receiver<()>>, } /// Transitions allow you to wait for all asynchronous resources created during them to resolve. #[derive(Debug)] pub struct AsyncTransition; impl AsyncTransition { /// Calls the `action` function, and returns a `Future` that resolves when any /// [`AsyncDerived`](crate::computed::AsyncDerived) or /// or [`ArcAsyncDerived`](crate::computed::ArcAsyncDerived) that is read during the action /// has resolved. /// /// This allows for an inversion of control: the caller does not need to know when all the /// resources created inside the `action` will resolve, but can wait for them to notify it. pub async fn run<T, U>(action: impl FnOnce() -> T) -> U where T: Future<Output = U>, { let (tx, rx) = mpsc::channel(); let global_transition = global_transition(); let inner = TransitionInner { tx }; let prev = Option::replace( &mut *global_transition.write().or_poisoned(), inner.clone(), ); let value = action().await; _ = std::mem::replace( &mut *global_transition.write().or_poisoned(), prev, ); let mut pending = Vec::new(); while let Ok(tx) = rx.try_recv() { pending.push(tx); } join_all(pending).await; value } pub(crate) fn register(rx: oneshot::Receiver<()>) { if let Some(tx) = global_transition() .read() .or_poisoned() .as_ref() .map(|n| &n.tx) { // if it's an Err, that just means the Receiver was dropped // i.e., the transition is no longer listening, in which case it doesn't matter if we // successfully register with it or not _ = tx.send(rx); } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/computed.rs
reactive_graph/src/computed.rs
//! Computed reactive values that derive from other reactive values. mod arc_memo; mod async_derived; mod inner; mod memo; mod selector; use crate::{ prelude::*, signal::RwSignal, wrappers::{ read::Signal, write::{IntoSignalSetter, SignalSetter}, }, }; pub use arc_memo::*; pub use async_derived::*; pub use memo::*; pub use selector::*; /// Derives a reactive slice of an [`RwSignal`]. /// /// Slices have the same guarantees as [`Memo`s](crate::computed::Memo): /// they only emit their value when it has actually been changed. /// /// Slices need a getter and a setter, and you must make sure that /// the setter and getter only touch their respective field and nothing else. /// They optimally should not have any side effects. /// /// You can use slices whenever you want to react to only parts /// of a bigger signal. The prime example would be state management, /// where you want all state variables grouped together, but also need /// fine-grained signals for each or some of these variables. /// In the example below, setting an auth token will only trigger /// the token signal, but none of the other derived signals. /// ``` /// # use reactive_graph::prelude::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # use reactive_graph::effect::Effect; /// # use reactive_graph::signal::RwSignal; /// # use reactive_graph::computed::*; /// /// // some global state with independent fields /// #[derive(Default, Clone, Debug)] /// struct GlobalState { /// count: u32, /// name: String, /// } /// /// let state = RwSignal::new(GlobalState::default()); /// /// // `create_slice` lets us create a "lens" into the data /// let (count, set_count) = create_slice( /// // we take a slice *from* `state` /// state, /// // our getter returns a "slice" of the data /// |state| state.count, /// // our setter describes how to mutate that slice, given a new value /// |state, n| state.count = n, /// ); /// /// // this slice is completely independent of the `count` slice /// // neither of them will cause the other to rerun /// let (name, set_name) = create_slice( /// // we take a slice *from* `state` /// state, /// // our getter returns a "slice" of the data /// |state| state.name.clone(), /// // our setter describes how to mutate that slice, given a new value /// |state, n| state.name = n, /// ); /// /// # if false { // don't run effects in doctest /// Effect::new(move |_| { /// println!("name is {}", name.get()); /// }); /// Effect::new(move |_| { /// println!("count is {}", count.get()); /// }); /// # } /// /// // setting count only causes count to log, not name /// set_count.set(42); /// /// // setting name only causes name to log, not count /// set_name.set("Bob".into()); /// ``` #[track_caller] pub fn create_slice<T, O, S>( signal: RwSignal<T>, getter: impl Fn(&T) -> O + Copy + Send + Sync + 'static, setter: impl Fn(&mut T, S) + Copy + Send + Sync + 'static, ) -> (Signal<O>, SignalSetter<S>) where T: Send + Sync + 'static, O: PartialEq + Send + Sync + 'static, { ( create_read_slice(signal, getter), create_write_slice(signal, setter), ) } /// Takes a memoized, read-only slice of a signal. This is equivalent to the /// read-only half of [`create_slice`]. #[track_caller] pub fn create_read_slice<T, O>( signal: RwSignal<T>, getter: impl Fn(&T) -> O + Copy + Send + Sync + 'static, ) -> Signal<O> where T: Send + Sync + 'static, O: PartialEq + Send + Sync + 'static, { Memo::new(move |_| signal.with(getter)).into() } /// Creates a setter to access one slice of a signal. This is equivalent to the /// write-only half of [`create_slice`]. #[track_caller] pub fn create_write_slice<T, O>( signal: RwSignal<T>, setter: impl Fn(&mut T, O) + Copy + Send + Sync + 'static, ) -> SignalSetter<O> where T: Send + Sync + 'static, { let setter = move |value| signal.update(|x| setter(x, value)); setter.into_signal_setter() } /// Creates a new memoized, computed reactive value. #[inline(always)] #[track_caller] #[deprecated = "This function is being removed to conform to Rust idioms. \ Please use `Memo::new()` instead."] pub fn create_memo<T>( fun: impl Fn(Option<&T>) -> T + Send + Sync + 'static, ) -> Memo<T> where T: PartialEq + Send + Sync + 'static, { Memo::new(fun) } /// Creates a new memo by passing a function that computes the value. #[inline(always)] #[track_caller] #[deprecated = "This function is being removed to conform to Rust idioms. \ Please use `Memo::new_owning()` instead."] pub fn create_owning_memo<T>( fun: impl Fn(Option<T>) -> (T, bool) + Send + Sync + 'static, ) -> Memo<T> where T: PartialEq + Send + Sync + 'static, { Memo::new_owning(fun) } /// A conditional signal that only notifies subscribers when a change /// in the source signal’s value changes whether the given function is true. #[inline(always)] #[track_caller] #[deprecated = "This function is being removed to conform to Rust idioms. \ Please use `Selector::new()` instead."] pub fn create_selector<T>( source: impl Fn() -> T + Clone + Send + Sync + 'static, ) -> Selector<T> where T: PartialEq + Eq + Send + Sync + Clone + std::hash::Hash + 'static, { Selector::new(source) } /// Creates a conditional signal that only notifies subscribers when a change /// in the source signal’s value changes whether the given function is true. #[inline(always)] #[track_caller] #[deprecated = "This function is being removed to conform to Rust idioms. \ Please use `Selector::new_with_fn()` instead."] pub fn create_selector_with_fn<T>( source: impl Fn() -> T + Clone + Send + Sync + 'static, f: impl Fn(&T, &T) -> bool + Send + Sync + Clone + 'static, ) -> Selector<T> where T: PartialEq + Eq + Send + Sync + Clone + std::hash::Hash + 'static, { Selector::new_with_fn(source, f) }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/into_reactive_value.rs
reactive_graph/src/into_reactive_value.rs
#[doc(hidden)] pub struct __IntoReactiveValueMarkerBaseCase; /// A helper trait that works like `Into<T>` but uses a marker generic /// to allow more `From` implementations than would be allowed with just `Into<T>`. pub trait IntoReactiveValue<T, M> { /// Converts `self` into a `T`. fn into_reactive_value(self) -> T; } // The base case, which allows anything which implements .into() to work: impl<T, I> IntoReactiveValue<T, __IntoReactiveValueMarkerBaseCase> for I where I: Into<T>, { fn into_reactive_value(self) -> T { self.into() } } #[cfg(test)] mod tests { use crate::{ into_reactive_value::IntoReactiveValue, owner::{LocalStorage, Owner}, traits::GetUntracked, wrappers::read::Signal, }; use typed_builder::TypedBuilder; #[test] fn test_into_signal_compiles() { let owner = Owner::new(); owner.set(); #[cfg(not(feature = "nightly"))] let _: Signal<usize> = (|| 2).into_reactive_value(); let _: Signal<usize, LocalStorage> = 2.into_reactive_value(); #[cfg(not(feature = "nightly"))] let _: Signal<usize, LocalStorage> = (|| 2).into_reactive_value(); let _: Signal<String> = "str".into_reactive_value(); let _: Signal<String, LocalStorage> = "str".into_reactive_value(); #[derive(TypedBuilder)] struct Foo { #[builder(setter( fn transform<M>(value: impl IntoReactiveValue<Signal<usize>, M>) { value.into_reactive_value() } ))] sig: Signal<usize>, } assert_eq!(Foo::builder().sig(2).build().sig.get_untracked(), 2); #[cfg(not(feature = "nightly"))] assert_eq!(Foo::builder().sig(|| 2).build().sig.get_untracked(), 2); assert_eq!( Foo::builder() .sig(Signal::stored(2)) .build() .sig .get_untracked(), 2 ); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/nightly.rs
reactive_graph/src/nightly.rs
#[allow(deprecated)] use crate::wrappers::read::{MaybeProp, MaybeSignal}; use crate::{ computed::{ArcMemo, Memo}, owner::Storage, signal::{ ArcReadSignal, ArcRwSignal, ArcWriteSignal, ReadSignal, RwSignal, WriteSignal, }, traits::{Get, Set}, wrappers::{ read::{ArcSignal, Signal, SignalTypes}, write::SignalSetter, }, }; macro_rules! impl_set_fn_traits { ($($ty:ident),*) => { $( #[cfg(feature = "nightly")] impl<T> FnOnce<(T,)> for $ty<T> where $ty<T>: Set<Value = T> { type Output = (); #[inline(always)] extern "rust-call" fn call_once(self, args: (T,)) -> Self::Output { self.set(args.0); } } #[cfg(feature = "nightly")] impl<T> FnMut<(T,)> for $ty<T> where $ty<T>: Set<Value = T> { #[inline(always)] extern "rust-call" fn call_mut(&mut self, args: (T,)) -> Self::Output { self.set(args.0); } } #[cfg(feature = "nightly")] impl<T> Fn<(T,)> for $ty<T> where $ty<T>: Set<Value = T> { #[inline(always)] extern "rust-call" fn call(&self, args: (T,)) -> Self::Output { self.set(args.0); } } )* }; } macro_rules! impl_set_fn_traits_arena { ($($ty:ident),*) => { $( #[cfg(feature = "nightly")] impl<T, S> FnOnce<(T,)> for $ty<T, S> where $ty<T, S>: Set<Value = T> { type Output = (); #[inline(always)] extern "rust-call" fn call_once(self, args: (T,)) -> Self::Output { self.set(args.0); } } #[cfg(feature = "nightly")] impl<T, S> FnMut<(T,)> for $ty<T, S> where $ty<T, S>: Set<Value = T> { #[inline(always)] extern "rust-call" fn call_mut(&mut self, args: (T,)) -> Self::Output { self.set(args.0); } } #[cfg(feature = "nightly")] impl<T, S> Fn<(T,)> for $ty<T, S> where $ty<T, S>: Set<Value = T> { #[inline(always)] extern "rust-call" fn call(&self, args: (T,)) -> Self::Output { self.set(args.0); } } )* }; } macro_rules! impl_get_fn_traits_get { ($($ty:ident),*) => { $( #[cfg(feature = "nightly")] impl<T> FnOnce<()> for $ty<T> where $ty<T>: Get { type Output = <Self as Get>::Value; #[inline(always)] extern "rust-call" fn call_once(self, _args: ()) -> Self::Output { self.get() } } #[cfg(feature = "nightly")] impl<T> FnMut<()> for $ty<T> where $ty<T>: Get { #[inline(always)] extern "rust-call" fn call_mut(&mut self, _args: ()) -> Self::Output { self.get() } } #[cfg(feature = "nightly")] impl<T> Fn<()> for $ty<T> where $ty<T>: Get { #[inline(always)] extern "rust-call" fn call(&self, _args: ()) -> Self::Output { self.get() } } )* }; } macro_rules! impl_get_fn_traits_get_arena { ($($ty:ident),*) => { $( #[cfg(feature = "nightly")] #[allow(deprecated)] impl<T, S> FnOnce<()> for $ty<T, S> where $ty<T, S>: Get, S: Storage<T> + Storage<Option<T>> + Storage<SignalTypes<Option<T>, S>> { type Output = <Self as Get>::Value; #[inline(always)] extern "rust-call" fn call_once(self, _args: ()) -> Self::Output { self.get() } } #[cfg(feature = "nightly")] #[allow(deprecated)] impl<T, S> FnMut<()> for $ty<T, S> where $ty<T, S>: Get, S: Storage<T> + Storage<Option<T>> + Storage<SignalTypes<Option<T>, S>> { #[inline(always)] extern "rust-call" fn call_mut(&mut self, _args: ()) -> Self::Output { self.get() } } #[cfg(feature = "nightly")] #[allow(deprecated)] impl<T, S> Fn<()> for $ty<T, S> where $ty<T, S>: Get, S: Storage<T> + Storage<Option<T>> + Storage<SignalTypes<Option<T>, S>> { #[inline(always)] extern "rust-call" fn call(&self, _args: ()) -> Self::Output { self.get() } } )* }; } impl_get_fn_traits_get![ArcReadSignal, ArcRwSignal]; impl_get_fn_traits_get_arena![ ReadSignal, RwSignal, ArcMemo, ArcSignal, Signal, MaybeSignal, Memo, MaybeProp ]; impl_set_fn_traits![ArcRwSignal, ArcWriteSignal]; impl_set_fn_traits_arena![RwSignal, WriteSignal, SignalSetter];
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/owner.rs
reactive_graph/src/owner.rs
//! The reactive ownership model, which manages effect cancellation, cleanups, and arena allocation. #[cfg(feature = "hydration")] use hydration_context::SharedContext; use or_poisoned::OrPoisoned; use rustc_hash::FxHashMap; use std::{ any::{Any, TypeId}, cell::RefCell, fmt::Debug, mem, sync::{Arc, RwLock, Weak}, }; mod arc_stored_value; mod arena; mod arena_item; mod context; mod storage; mod stored_value; use self::arena::Arena; pub use arc_stored_value::ArcStoredValue; #[cfg(feature = "sandboxed-arenas")] pub use arena::sandboxed::Sandboxed; #[cfg(feature = "sandboxed-arenas")] use arena::ArenaMap; use arena::NodeId; pub use arena_item::*; pub use context::*; pub use storage::*; #[allow(deprecated)] // allow exporting deprecated fn pub use stored_value::{store_value, FromLocal, StoredValue}; /// A reactive owner, which manages /// 1) the cancellation of [`Effect`](crate::effect::Effect)s, /// 2) providing and accessing environment data via [`provide_context`] and [`use_context`], /// 3) running cleanup functions defined via [`Owner::on_cleanup`], and /// 4) an arena storage system to provide `Copy` handles via [`ArenaItem`], which is what allows /// types like [`RwSignal`](crate::signal::RwSignal), [`Memo`](crate::computed::Memo), and so on to be `Copy`. /// /// Every effect and computed reactive value has an associated `Owner`. While it is running, this /// is marked as the current `Owner`. Whenever it re-runs, this `Owner` is cleared by calling /// [`Owner::with_cleanup`]. This runs cleanup functions, cancels any [`Effect`](crate::effect::Effect)s created during the /// last run, drops signals stored in the arena, and so on, because those effects and signals will /// be re-created as needed during the next run. /// /// When the owner is ultimately dropped, it will clean up its owned resources in the same way. /// /// The "current owner" is set on the thread-local basis: whenever one of these reactive nodes is /// running, it will set the current owner on its thread with [`Owner::with`] or [`Owner::set`], /// allowing other reactive nodes implicitly to access the fact that it is currently the owner. /// /// For a longer discussion of the ownership model, [see /// here](https://book.leptos.dev/appendix_life_cycle.html). #[derive(Debug, Clone, Default)] #[must_use] pub struct Owner { pub(crate) inner: Arc<RwLock<OwnerInner>>, #[cfg(feature = "hydration")] pub(crate) shared_context: Option<Arc<dyn SharedContext + Send + Sync>>, } impl Owner { fn downgrade(&self) -> WeakOwner { WeakOwner { inner: Arc::downgrade(&self.inner), #[cfg(feature = "hydration")] shared_context: self.shared_context.as_ref().map(Arc::downgrade), } } } #[derive(Clone)] struct WeakOwner { inner: Weak<RwLock<OwnerInner>>, #[cfg(feature = "hydration")] shared_context: Option<Weak<dyn SharedContext + Send + Sync>>, } impl WeakOwner { fn upgrade(&self) -> Option<Owner> { self.inner.upgrade().map(|inner| { #[cfg(feature = "hydration")] let shared_context = self.shared_context.as_ref().and_then(|sc| sc.upgrade()); Owner { inner, #[cfg(feature = "hydration")] shared_context, } }) } } impl PartialEq for Owner { fn eq(&self, other: &Self) -> bool { Arc::ptr_eq(&self.inner, &other.inner) } } thread_local! { static OWNER: RefCell<Option<WeakOwner>> = Default::default(); } impl Owner { /// Returns a unique identifier for this owner, which can be used to identify it for debugging /// purposes. /// /// Intended for debugging only; this is not guaranteed to be stable between runs. pub fn debug_id(&self) -> usize { Arc::as_ptr(&self.inner) as usize } /// Returns the list of parents, grandparents, and ancestors, with values corresponding to /// [`Owner::debug_id`] for each. /// /// Intended for debugging only; this is not guaranteed to be stable between runs. pub fn ancestry(&self) -> Vec<usize> { let mut ancestors = Vec::new(); let mut curr_parent = self .inner .read() .or_poisoned() .parent .as_ref() .and_then(|n| n.upgrade()); while let Some(parent) = curr_parent { ancestors.push(Arc::as_ptr(&parent) as usize); curr_parent = parent .read() .or_poisoned() .parent .as_ref() .and_then(|n| n.upgrade()); } ancestors } /// Creates a new `Owner` and registers it as a child of the current `Owner`, if there is one. pub fn new() -> Self { #[cfg(not(feature = "hydration"))] let parent = OWNER.with(|o| { o.borrow() .as_ref() .and_then(|o| o.upgrade()) .map(|o| Arc::downgrade(&o.inner)) }); #[cfg(feature = "hydration")] let (parent, shared_context) = OWNER .with(|o| { o.borrow().as_ref().and_then(|o| o.upgrade()).map(|o| { (Some(Arc::downgrade(&o.inner)), o.shared_context.clone()) }) }) .unwrap_or((None, None)); let this = Self { inner: Arc::new(RwLock::new(OwnerInner { parent: parent.clone(), nodes: Default::default(), contexts: Default::default(), cleanups: Default::default(), children: Default::default(), #[cfg(feature = "sandboxed-arenas")] arena: parent .as_ref() .and_then(|parent| parent.upgrade()) .map(|parent| parent.read().or_poisoned().arena.clone()) .unwrap_or_default(), paused: false, })), #[cfg(feature = "hydration")] shared_context, }; if let Some(parent) = parent.and_then(|n| n.upgrade()) { parent .write() .or_poisoned() .children .push(Arc::downgrade(&this.inner)); } this } /// Creates a new "root" context with the given [`SharedContext`], which allows sharing data /// between the server and client. /// /// Only one `SharedContext` needs to be created per request, and will be automatically shared /// by any other `Owner`s created under this one. #[cfg(feature = "hydration")] #[track_caller] pub fn new_root( shared_context: Option<Arc<dyn SharedContext + Send + Sync>>, ) -> Self { let this = Self { inner: Arc::new(RwLock::new(OwnerInner { parent: None, nodes: Default::default(), contexts: Default::default(), cleanups: Default::default(), children: Default::default(), #[cfg(feature = "sandboxed-arenas")] arena: Default::default(), paused: false, })), #[cfg(feature = "hydration")] shared_context, }; this.set(); this } /// Returns the parent of this `Owner`, if any. /// /// None when: /// - This is a root owner /// - The parent has been dropped pub fn parent(&self) -> Option<Owner> { self.inner .read() .or_poisoned() .parent .as_ref() .and_then(|p| p.upgrade()) .map(|inner| Owner { inner, #[cfg(feature = "hydration")] shared_context: self.shared_context.clone(), }) } /// Creates a new `Owner` that is the child of the current `Owner`, if any. pub fn child(&self) -> Self { let parent = Some(Arc::downgrade(&self.inner)); let mut inner = self.inner.write().or_poisoned(); #[cfg(feature = "sandboxed-arenas")] let arena = inner.arena.clone(); let paused = inner.paused; let child = Self { inner: Arc::new(RwLock::new(OwnerInner { parent, nodes: Default::default(), contexts: Default::default(), cleanups: Default::default(), children: Default::default(), #[cfg(feature = "sandboxed-arenas")] arena, paused, })), #[cfg(feature = "hydration")] shared_context: self.shared_context.clone(), }; inner.children.push(Arc::downgrade(&child.inner)); child } /// Sets this as the current `Owner`. pub fn set(&self) { OWNER.with_borrow_mut(|owner| *owner = Some(self.downgrade())); #[cfg(feature = "sandboxed-arenas")] Arena::set(&self.inner.read().or_poisoned().arena); } /// Runs the given function with this as the current `Owner`. pub fn with<T>(&self, fun: impl FnOnce() -> T) -> T { // codegen optimisation: fn inner_1(self_: &Owner) -> Option<WeakOwner> { let prev = { OWNER.with(|o| (*o.borrow_mut()).replace(self_.downgrade())) }; #[cfg(feature = "sandboxed-arenas")] Arena::set(&self_.inner.read().or_poisoned().arena); prev } let prev = inner_1(self); let val = fun(); // monomorphisation optimisation: fn inner_2(prev: Option<WeakOwner>) { OWNER.with(|o| { *o.borrow_mut() = prev; }); } inner_2(prev); val } /// Cleans up this owner, the given function with this as the current `Owner`. pub fn with_cleanup<T>(&self, fun: impl FnOnce() -> T) -> T { self.cleanup(); self.with(fun) } /// Cleans up this owner in the following order: /// 1) Runs `cleanup` on all children, /// 2) Runs all cleanup functions registered with [`Owner::on_cleanup`], /// 3) Drops the values of any arena-allocated [`ArenaItem`]s. pub fn cleanup(&self) { self.inner.cleanup(); } /// Registers a function to be run the next time the current owner is cleaned up. /// /// Because the ownership model is associated with reactive nodes, each "decision point" in an /// application tends to have a separate `Owner`: as a result, these cleanup functions often /// fill the same need as an "on unmount" function in other UI approaches, etc. pub fn on_cleanup(fun: impl FnOnce() + Send + Sync + 'static) { if let Some(owner) = Owner::current() { let mut inner = owner.inner.write().or_poisoned(); #[cfg(feature = "sandboxed-arenas")] let fun = { let arena = Arc::clone(&inner.arena); move || { Arena::set(&arena); fun() } }; inner.cleanups.push(Box::new(fun)); } } fn register(&self, node: NodeId) { self.inner.write().or_poisoned().nodes.push(node); } /// Returns the current `Owner`, if any. pub fn current() -> Option<Owner> { OWNER.with(|o| o.borrow().as_ref().and_then(|n| n.upgrade())) } /// Returns the [`SharedContext`] associated with this owner, if any. #[cfg(feature = "hydration")] pub fn shared_context( &self, ) -> Option<Arc<dyn SharedContext + Send + Sync>> { self.shared_context.clone() } /// Removes this from its state as the thread-local owner and drops it. /// If there are other holders of this owner, it may not cleanup, if always cleaning up is required, /// see [`Owner::unset_with_forced_cleanup`]. pub fn unset(self) { OWNER.with_borrow_mut(|owner| { if owner.as_ref().and_then(|n| n.upgrade()) == Some(self) { mem::take(owner); } }) } /// Removes this from its state as the thread-local owner and drops it. /// Unlike [`Owner::unset`], this will always run cleanup on this owner, /// even if there are other holders of this owner. pub fn unset_with_forced_cleanup(self) { OWNER.with_borrow_mut(|owner| { if owner .as_ref() .and_then(|n| n.upgrade()) .map(|o| o == self) .unwrap_or(false) { mem::take(owner); } }); self.cleanup(); } /// Returns the current [`SharedContext`], if any. #[cfg(feature = "hydration")] pub fn current_shared_context( ) -> Option<Arc<dyn SharedContext + Send + Sync>> { OWNER.with(|o| { o.borrow() .as_ref() .and_then(|o| o.upgrade()) .and_then(|current| current.shared_context.clone()) }) } /// Runs the given function, after indicating that the current [`SharedContext`] should be /// prepared to handle any data created in the function. #[cfg(feature = "hydration")] pub fn with_hydration<T>(fun: impl FnOnce() -> T + 'static) -> T { fn inner<T>(fun: Box<dyn FnOnce() -> T>) -> T { provide_context(IsHydrating(true)); let sc = OWNER.with_borrow(|o| { o.as_ref() .and_then(|o| o.upgrade()) .and_then(|current| current.shared_context.clone()) }); match sc { None => fun(), Some(sc) => { let prev = sc.get_is_hydrating(); sc.set_is_hydrating(true); let value = fun(); sc.set_is_hydrating(prev); value } } } inner(Box::new(fun)) } /// Runs the given function, after indicating that the current [`SharedContext`] should /// not handle data created in this function. #[cfg(feature = "hydration")] pub fn with_no_hydration<T>(fun: impl FnOnce() -> T + 'static) -> T { fn inner<T>(fun: Box<dyn FnOnce() -> T>) -> T { provide_context(IsHydrating(false)); let sc = OWNER.with_borrow(|o| { o.as_ref() .and_then(|o| o.upgrade()) .and_then(|current| current.shared_context.clone()) }); match sc { None => fun(), Some(sc) => { let prev = sc.get_is_hydrating(); sc.set_is_hydrating(false); let value = fun(); sc.set_is_hydrating(prev); value } } } inner(Box::new(fun)) } /// Pauses the execution of side effects for this owner, and any of its descendants. /// /// If this owner is the owner for an [`Effect`](crate::effect::Effect) or [`RenderEffect`](crate::effect::RenderEffect), this effect will not run until [`Owner::resume`] is called. All children of this effects are also paused. /// /// Any notifications will be ignored; effects that are notified will paused will not run when /// resumed, until they are notified again by a source after being resumed. pub fn pause(&self) { let mut stack = Vec::with_capacity(16); stack.push(Arc::downgrade(&self.inner)); while let Some(curr) = stack.pop() { if let Some(curr) = curr.upgrade() { let mut curr = curr.write().or_poisoned(); curr.paused = true; stack.extend(curr.children.iter().map(Weak::clone)); } } } /// Whether this owner has been paused by [`Owner::pause`]. pub fn paused(&self) -> bool { self.inner.read().or_poisoned().paused } /// Resumes side effects that have been paused by [`Owner::pause`]. /// /// All children will also be resumed. /// /// This will *not* cause side effects that were notified while paused to run, until they are /// notified again by a source after being resumed. pub fn resume(&self) { let mut stack = Vec::with_capacity(16); stack.push(Arc::downgrade(&self.inner)); while let Some(curr) = stack.pop() { if let Some(curr) = curr.upgrade() { let mut curr = curr.write().or_poisoned(); curr.paused = false; stack.extend(curr.children.iter().map(Weak::clone)); } } } } #[doc(hidden)] #[derive(Copy, Clone, Debug, PartialEq, Eq, Hash)] pub struct IsHydrating(pub bool); /// Registers a function to be run the next time the current owner is cleaned up. /// /// Because the ownership model is associated with reactive nodes, each "decision point" in an /// application tends to have a separate `Owner`: as a result, these cleanup functions often /// fill the same need as an "on unmount" function in other UI approaches, etc. /// /// This is an alias for [`Owner::on_cleanup`]. pub fn on_cleanup(fun: impl FnOnce() + Send + Sync + 'static) { Owner::on_cleanup(fun) } #[derive(Default)] pub(crate) struct OwnerInner { pub parent: Option<Weak<RwLock<OwnerInner>>>, nodes: Vec<NodeId>, pub contexts: FxHashMap<TypeId, Box<dyn Any + Send + Sync>>, pub cleanups: Vec<Box<dyn FnOnce() + Send + Sync>>, pub children: Vec<Weak<RwLock<OwnerInner>>>, #[cfg(feature = "sandboxed-arenas")] arena: Arc<RwLock<ArenaMap>>, paused: bool, } impl Debug for OwnerInner { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("OwnerInner") .field("parent", &self.parent) .field("nodes", &self.nodes) .field("contexts", &self.contexts) .field("cleanups", &self.cleanups.len()) .finish() } } impl Drop for OwnerInner { fn drop(&mut self) { for child in std::mem::take(&mut self.children) { if let Some(child) = child.upgrade() { child.cleanup(); } } for cleanup in mem::take(&mut self.cleanups) { cleanup(); } let nodes = mem::take(&mut self.nodes); if !nodes.is_empty() { #[cfg(not(feature = "sandboxed-arenas"))] Arena::with_mut(|arena| { for node in nodes { _ = arena.remove(node); } }); #[cfg(feature = "sandboxed-arenas")] { let mut arena = self.arena.write().or_poisoned(); for node in nodes { _ = arena.remove(node); } } } } } trait Cleanup { fn cleanup(&self); } impl Cleanup for RwLock<OwnerInner> { fn cleanup(&self) { let (cleanups, nodes, children) = { let mut lock = self.write().or_poisoned(); ( mem::take(&mut lock.cleanups), mem::take(&mut lock.nodes), mem::take(&mut lock.children), ) }; for child in children { if let Some(child) = child.upgrade() { child.cleanup(); } } for cleanup in cleanups { cleanup(); } if !nodes.is_empty() { #[cfg(not(feature = "sandboxed-arenas"))] Arena::with_mut(|arena| { for node in nodes { _ = arena.remove(node); } }); #[cfg(feature = "sandboxed-arenas")] { let arena = self.read().or_poisoned().arena.clone(); let mut arena = arena.write().or_poisoned(); for node in nodes { _ = arena.remove(node); } } } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/send_wrapper_ext.rs
reactive_graph/src/send_wrapper_ext.rs
//! Additional wrapper utilities for [`send_wrapper::SendWrapper`]. use send_wrapper::SendWrapper; use std::{ fmt::{Debug, Formatter}, hash, ops::{Deref, DerefMut}, }; /// An optional value that can always be sent between threads, even if its inner value /// in the `Some(_)` case would not be threadsafe. /// /// This struct can be dereferenced to `Option<T>`. /// /// If it has been given a local (`!Send`) value, that value is wrapped in a [`SendWrapper`], which /// allows sending it between threads but will panic if it is accessed or updated from a /// thread other than the one on which it was created. /// /// If it is created with `None` for a local (`!Send`) type, no `SendWrapper` is created until a /// value is provided via [`DerefMut`] or [`update`](SendOption::update). /// /// ### Use Case /// This is useful for cases like browser-only types, which are `!Send` but cannot be constructed /// on the server anyway, and are only created in a single-threaded browser environment. The local /// `SendOption` can be created with its `None` variant and sent between threads without causing issues /// when it is dropped. /// /// ### Panics /// Dereferencing or dropping `SendOption` panics under the following conditions: /// 1) It is created via [`new_local`](SendOption::new_local) (signifying a `!Send` inner type), /// 2) It has `Some(_)` value, and /// 3) It has been sent to a thread other than the one on which it was created. pub struct SendOption<T> { inner: Inner<T>, } // SAFETY: `SendOption` can *only* be given a T in four ways // 1) via new(), which requires T: Send + Sync // 2) via new_local(), which wraps T in a SendWrapper if given Some(T) // 3) via deref_mut(), which creates a SendWrapper<Option<T>> as needed // 4) via update(), which either dereferences an existing SendWrapper // or creates a new SendWrapper as needed unsafe impl<T> Send for SendOption<T> {} unsafe impl<T> Sync for SendOption<T> {} impl<T> PartialEq for SendOption<T> where T: PartialEq, { fn eq(&self, other: &Self) -> bool { self.deref() == other.deref() } } impl<T> Eq for SendOption<T> where T: Eq {} impl<T> PartialOrd for SendOption<T> where T: PartialOrd, { fn partial_cmp(&self, other: &Self) -> Option<std::cmp::Ordering> { self.deref().partial_cmp(other.deref()) } } impl<T> hash::Hash for SendOption<T> where T: hash::Hash, { fn hash<H: hash::Hasher>(&self, state: &mut H) { self.deref().hash(state); } } enum Inner<T> { /// A threadsafe value. Threadsafe(Option<T>), /// A non-threadsafe value. If accessed/dropped from a different thread in the Some() variant, it will panic. Local(Option<SendWrapper<Option<T>>>), } impl<T> SendOption<T> where T: Send + Sync, { /// Create a new threadsafe value. pub fn new(value: Option<T>) -> Self { Self { inner: Inner::Threadsafe(value), } } } impl<T> From<Option<T>> for SendOption<T> where T: Send + Sync, { fn from(value: Option<T>) -> Self { Self::new(value) } } impl<T> SendOption<T> { /// Create a new non-threadsafe value. pub fn new_local(value: Option<T>) -> Self { Self { inner: if let Some(value) = value { Inner::Local(Some(SendWrapper::new(Some(value)))) } else { Inner::Local(None) }, } } /// Update a value in place with a callback. /// /// # Panics /// If the value is [`Inner::Local`] and it is called from a different thread than the one the instance has been created with, it will panic. pub fn update(&mut self, cb: impl FnOnce(&mut Option<T>)) { match &mut self.inner { Inner::Threadsafe(value) => cb(value), Inner::Local(value) => match value { Some(sw) => { cb(sw.deref_mut()); if sw.is_none() { *value = None; } } None => { let mut inner = None; cb(&mut inner); if let Some(inner) = inner { *value = Some(SendWrapper::new(Some(inner))); } } }, } } /// Consume the value. /// /// # Panics /// Panics if the [`Inner::Local`] variant and it is called from a different thread than the one the instance has been created with. pub fn take(self) -> Option<T> { match self.inner { Inner::Threadsafe(value) => value, Inner::Local(value) => value.and_then(|value| value.take()), } } } impl<T> Deref for SendOption<T> { type Target = Option<T>; fn deref(&self) -> &Self::Target { match &self.inner { Inner::Threadsafe(value) => value, Inner::Local(value) => match value { Some(value) => value.deref(), None => &None, }, } } } impl<T> DerefMut for SendOption<T> { fn deref_mut(&mut self) -> &mut Self::Target { match &mut self.inner { Inner::Threadsafe(value) => value, Inner::Local(value) => match value { Some(value) => value.deref_mut(), None => { *value = Some(SendWrapper::new(None)); value.as_mut().unwrap().deref_mut() } }, } } } impl<T: Debug> Debug for SendOption<T> { fn fmt(&self, f: &mut Formatter<'_>) -> std::fmt::Result { match &self.inner { Inner::Threadsafe(value) => { write!(f, "SendOption::Threadsafe({value:?})") } Inner::Local(value) => { write!(f, "SendOption::Local({value:?})") } } } } impl<T: Clone> Clone for SendOption<T> { fn clone(&self) -> Self { Self { inner: match &self.inner { Inner::Threadsafe(value) => Inner::Threadsafe(value.clone()), Inner::Local(value) => Inner::Local(value.clone()), }, } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/traits.rs
reactive_graph/src/traits.rs
//! A series of traits to implement the behavior of reactive primitive, especially signals. //! //! ## Principles //! 1. **Composition**: Most of the traits are implemented as combinations of more primitive base traits, //! and blanket implemented for all types that implement those traits. //! 2. **Fallibility**: Most traits includes a `try_` variant, which returns `None` if the method //! fails (e.g., if signals are arena allocated and this can't be found, or if an `RwLock` is //! poisoned). //! //! ## Metadata Traits //! - [`DefinedAt`] is used for debugging in the case of errors and should be implemented for all //! signal types. //! - [`IsDisposed`] checks whether a signal is currently accessible. //! //! ## Base Traits //! | Trait | Mode | Description | //! |-------------------|-------|---------------------------------------------------------------------------------------| //! | [`Track`] | — | Tracks changes to this value, adding it as a source of the current reactive observer. | //! | [`Notify`] | — | Notifies subscribers that this value has changed. | //! | [`ReadUntracked`] | Guard | Gives immutable access to the value of this signal. | //! | [`Write`] | Guard | Gives mutable access to the value of this signal. //! //! ## Derived Traits //! //! ### Access //! | Trait | Mode | Composition | Description //! |-------------------|---------------|-------------------------------|------------ //! | [`WithUntracked`] | `fn(&T) -> U` | [`ReadUntracked`] | Applies closure to the current value of the signal and returns result. //! | [`With`] | `fn(&T) -> U` | [`ReadUntracked`] + [`Track`] | Applies closure to the current value of the signal and returns result, with reactive tracking. //! | [`GetUntracked`] | `T` | [`WithUntracked`] + [`Clone`] | Clones the current value of the signal. //! | [`Get`] | `T` | [`GetUntracked`] + [`Track`] | Clones the current value of the signal, with reactive tracking. //! //! ### Update //! | Trait | Mode | Composition | Description //! |---------------------|---------------|-----------------------------------|------------ //! | [`UpdateUntracked`] | `fn(&mut T)` | [`Write`] | Applies closure to the current value to update it, but doesn't notify subscribers. //! | [`Update`] | `fn(&mut T)` | [`UpdateUntracked`] + [`Notify`] | Applies closure to the current value to update it, and notifies subscribers. //! | [`Set`] | `T` | [`Update`] | Sets the value to a new value, and notifies subscribers. //! //! ## Using the Traits //! //! These traits are designed so that you can implement as few as possible, and the rest will be //! implemented automatically. //! //! For example, if you have a struct for which you can implement [`ReadUntracked`] and [`Track`], then //! [`WithUntracked`] and [`With`] will be implemented automatically (as will [`GetUntracked`] and //! [`Get`] for `Clone` types). But if you cannot implement [`ReadUntracked`] (because, for example, //! there isn't an `RwLock` so you can't wrap in a [`ReadGuard`](crate::signal::guards::ReadGuard), //! but you can still implement [`WithUntracked`] and [`Track`], the same traits will still be implemented. pub use crate::trait_options::*; use crate::{ effect::Effect, graph::{Observer, Source, Subscriber, ToAnySource}, owner::Owner, signal::{arc_signal, guards::UntrackedWriteGuard, ArcReadSignal}, }; use any_spawner::Executor; use futures::{Stream, StreamExt}; use std::{ ops::{Deref, DerefMut}, panic::Location, }; #[doc(hidden)] /// Provides a sensible panic message for accessing disposed signals. #[macro_export] macro_rules! unwrap_signal { ($signal:ident) => {{ #[cfg(any(debug_assertions, leptos_debuginfo))] let location = std::panic::Location::caller(); || { #[cfg(any(debug_assertions, leptos_debuginfo))] { panic!( "{}", $crate::traits::panic_getting_disposed_signal( $signal.defined_at(), location ) ); } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { panic!( "Tried to access a reactive value that has already been \ disposed." ); } } }}; } /// Allows disposing an arena-allocated signal before its owner has been disposed. pub trait Dispose { /// Disposes of the signal. This: /// 1. Detaches the signal from the reactive graph, preventing it from triggering /// further updates; and /// 2. Drops the value contained in the signal. fn dispose(self); } /// Allows tracking the value of some reactive data. pub trait Track { /// Subscribes to this signal in the current reactive scope without doing anything with its value. #[track_caller] fn track(&self); } impl<T: Source + ToAnySource + DefinedAt> Track for T { #[track_caller] fn track(&self) { if self.is_disposed() { return; } if let Some(subscriber) = Observer::get() { subscriber.add_source(self.to_any_source()); self.add_subscriber(subscriber); } else { #[cfg(all(debug_assertions, feature = "effects"))] { use crate::diagnostics::SpecialNonReactiveZone; if !SpecialNonReactiveZone::is_inside() { let called_at = Location::caller(); let ty = std::any::type_name::<T>(); let defined_at = self .defined_at() .map(ToString::to_string) .unwrap_or_else(|| String::from("{unknown}")); crate::log_warning(format_args!( "At {called_at}, you access a {ty} (defined at \ {defined_at}) outside a reactive tracking context. \ This might mean your app is not responding to \ changes in signal values in the way you \ expect.\n\nHere’s how to fix it:\n\n1. If this is \ inside a `view!` macro, make sure you are passing a \ function, not a value.\n ❌ NO <p>{{x.get() * \ 2}}</p>\n ✅ YES <p>{{move || x.get() * \ 2}}</p>\n\n2. If it’s in the body of a component, \ try wrapping this access in a closure: \n ❌ NO \ let y = x.get() * 2\n ✅ YES let y = move || \ x.get() * 2.\n\n3. If you’re *trying* to access the \ value without tracking, use `.get_untracked()` or \ `.with_untracked()` instead." )); } } } } } /// Give read-only access to a signal's value by reference through a guard type, /// without tracking the value reactively. pub trait ReadUntracked: Sized + DefinedAt { /// The guard type that will be returned, which can be dereferenced to the value. type Value: Deref; /// Returns the guard, or `None` if the signal has already been disposed. #[track_caller] fn try_read_untracked(&self) -> Option<Self::Value>; /// Returns the guard. /// /// # Panics /// Panics if you try to access a signal that has been disposed. #[track_caller] fn read_untracked(&self) -> Self::Value { self.try_read_untracked() .unwrap_or_else(unwrap_signal!(self)) } /// This is a backdoor to allow overriding the [`Read::try_read`] implementation despite it being auto implemented. /// /// If your type contains a [`Signal`](crate::wrappers::read::Signal), /// call it's [`ReadUntracked::custom_try_read`] here, else return `None`. #[track_caller] fn custom_try_read(&self) -> Option<Option<Self::Value>> { None } } /// Give read-only access to a signal's value by reference through a guard type, /// and subscribes the active reactive observer (an effect or computed) to changes in its value. pub trait Read: DefinedAt { /// The guard type that will be returned, which can be dereferenced to the value. type Value: Deref; /// Subscribes to the signal, and returns the guard, or `None` if the signal has already been disposed. #[track_caller] fn try_read(&self) -> Option<Self::Value>; /// Subscribes to the signal, and returns the guard. /// /// # Panics /// Panics if you try to access a signal that has been disposed. #[track_caller] fn read(&self) -> Self::Value { self.try_read().unwrap_or_else(unwrap_signal!(self)) } } impl<T> Read for T where T: Track + ReadUntracked, { type Value = T::Value; fn try_read(&self) -> Option<Self::Value> { // The [`Read`] trait is auto implemented for types that implement [`ReadUntracked`] + [`Track`]. The [`Read`] trait then auto implements the [`With`] and [`Get`] traits too. // // This is a problem for e.g. the [`Signal`](crate::wrappers::read::Signal) type, // this type must use a custom [`Read::try_read`] implementation to avoid an unnecessary clone. // // This is a backdoor to allow overriding the [`Read::try_read`] implementation despite it being auto implemented. if let Some(custom) = self.custom_try_read() { custom } else { self.track(); self.try_read_untracked() } } } /// A reactive, mutable guard that can be untracked to prevent it from notifying subscribers when /// it is dropped. pub trait UntrackableGuard: DerefMut { /// Removes the notifier from the guard, such that it will no longer notify subscribers when it is dropped. fn untrack(&mut self); } impl<T> UntrackableGuard for Box<dyn UntrackableGuard<Target = T>> { fn untrack(&mut self) { (**self).untrack(); } } /// Gives mutable access to a signal's value through a guard type. When the guard is dropped, the /// signal's subscribers will be notified. pub trait Write: Sized + DefinedAt + Notify { /// The type of the signal's value. type Value: Sized + 'static; /// Returns the guard, or `None` if the signal has already been disposed. fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>>; // Returns a guard that will not notify subscribers when dropped, /// or `None` if the signal has already been disposed. fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>>; /// Returns the guard. /// /// # Panics /// Panics if you try to access a signal that has been disposed. fn write(&self) -> impl UntrackableGuard<Target = Self::Value> { self.try_write().unwrap_or_else(unwrap_signal!(self)) } /// Returns a guard that will not notify subscribers when dropped. /// /// # Panics /// Panics if you try to access a signal that has been disposed. fn write_untracked(&self) -> impl DerefMut<Target = Self::Value> { self.try_write_untracked() .unwrap_or_else(unwrap_signal!(self)) } } /// Give read-only access to a signal's value by reference inside a closure, /// without tracking the value reactively. pub trait WithUntracked: DefinedAt { /// The type of the value contained in the signal. type Value: ?Sized; /// Applies the closure to the value, and returns the result, /// or `None` if the signal has already been disposed. #[track_caller] fn try_with_untracked<U>( &self, fun: impl FnOnce(&Self::Value) -> U, ) -> Option<U>; /// Applies the closure to the value, and returns the result. /// /// # Panics /// Panics if you try to access a signal that has been disposed. #[track_caller] fn with_untracked<U>(&self, fun: impl FnOnce(&Self::Value) -> U) -> U { self.try_with_untracked(fun) .unwrap_or_else(unwrap_signal!(self)) } } impl<T> WithUntracked for T where T: DefinedAt + ReadUntracked, { type Value = <<Self as ReadUntracked>::Value as Deref>::Target; fn try_with_untracked<U>( &self, fun: impl FnOnce(&Self::Value) -> U, ) -> Option<U> { self.try_read_untracked().map(|value| fun(&value)) } } /// Give read-only access to a signal's value by reference inside a closure, /// and subscribes the active reactive observer (an effect or computed) to changes in its value. pub trait With: DefinedAt { /// The type of the value contained in the signal. type Value: ?Sized; /// Subscribes to the signal, applies the closure to the value, and returns the result, /// or `None` if the signal has already been disposed. #[track_caller] fn try_with<U>(&self, fun: impl FnOnce(&Self::Value) -> U) -> Option<U>; /// Subscribes to the signal, applies the closure to the value, and returns the result. /// /// # Panics /// Panics if you try to access a signal that has been disposed. #[track_caller] fn with<U>(&self, fun: impl FnOnce(&Self::Value) -> U) -> U { self.try_with(fun).unwrap_or_else(unwrap_signal!(self)) } } impl<T> With for T where T: Read, { type Value = <<T as Read>::Value as Deref>::Target; #[track_caller] fn try_with<U>(&self, fun: impl FnOnce(&Self::Value) -> U) -> Option<U> { self.try_read().map(|val| fun(&val)) } } /// Clones the value of the signal, without tracking the value reactively. pub trait GetUntracked: DefinedAt { /// The type of the value contained in the signal. type Value; /// Clones and returns the value of the signal, /// or `None` if the signal has already been disposed. #[track_caller] fn try_get_untracked(&self) -> Option<Self::Value>; /// Clones and returns the value of the signal, /// /// # Panics /// Panics if you try to access a signal that has been disposed. #[track_caller] fn get_untracked(&self) -> Self::Value { self.try_get_untracked() .unwrap_or_else(unwrap_signal!(self)) } } impl<T> GetUntracked for T where T: WithUntracked, T::Value: Clone, { type Value = <Self as WithUntracked>::Value; fn try_get_untracked(&self) -> Option<Self::Value> { self.try_with_untracked(Self::Value::clone) } } /// Clones the value of the signal, without tracking the value reactively. /// and subscribes the active reactive observer (an effect or computed) to changes in its value. pub trait Get: DefinedAt { /// The type of the value contained in the signal. type Value: Clone; /// Subscribes to the signal, then clones and returns the value of the signal, /// or `None` if the signal has already been disposed. #[track_caller] fn try_get(&self) -> Option<Self::Value>; /// Subscribes to the signal, then clones and returns the value of the signal. /// /// # Panics /// Panics if you try to access a signal that has been disposed. #[track_caller] fn get(&self) -> Self::Value { self.try_get().unwrap_or_else(unwrap_signal!(self)) } } impl<T> Get for T where T: With, T::Value: Clone, { type Value = <T as With>::Value; #[track_caller] fn try_get(&self) -> Option<Self::Value> { self.try_with(Self::Value::clone) } } /// Notifies subscribers of a change in this signal. pub trait Notify { /// Notifies subscribers of a change in this signal. #[track_caller] fn notify(&self); } /// Updates the value of a signal by applying a function that updates it in place, /// without notifying subscribers. pub trait UpdateUntracked: DefinedAt { /// The type of the value contained in the signal. type Value; /// Updates the value by applying a function, returning the value returned by that function. /// Does not notify subscribers that the signal has changed. /// /// # Panics /// Panics if you try to update a signal that has been disposed. #[track_caller] fn update_untracked<U>( &self, fun: impl FnOnce(&mut Self::Value) -> U, ) -> U { self.try_update_untracked(fun) .unwrap_or_else(unwrap_signal!(self)) } /// Updates the value by applying a function, returning the value returned by that function, /// or `None` if the signal has already been disposed. /// Does not notify subscribers that the signal has changed. fn try_update_untracked<U>( &self, fun: impl FnOnce(&mut Self::Value) -> U, ) -> Option<U>; } impl<T> UpdateUntracked for T where T: Write, { type Value = <Self as Write>::Value; #[track_caller] fn try_update_untracked<U>( &self, fun: impl FnOnce(&mut Self::Value) -> U, ) -> Option<U> { let mut guard = self.try_write_untracked()?; Some(fun(&mut *guard)) } } /// Updates the value of a signal by applying a function that updates it in place, /// notifying its subscribers that the value has changed. pub trait Update { /// The type of the value contained in the signal. type Value; /// Updates the value of the signal and notifies subscribers. #[track_caller] fn update(&self, fun: impl FnOnce(&mut Self::Value)) { self.try_update(fun); } /// Updates the value of the signal, but only notifies subscribers if the function /// returns `true`. #[track_caller] fn maybe_update(&self, fun: impl FnOnce(&mut Self::Value) -> bool) { self.try_maybe_update(|val| { let did_update = fun(val); (did_update, ()) }); } /// Updates the value of the signal and notifies subscribers, returning the value that is /// returned by the update function, or `None` if the signal has already been disposed. #[track_caller] fn try_update<U>( &self, fun: impl FnOnce(&mut Self::Value) -> U, ) -> Option<U> { self.try_maybe_update(|val| (true, fun(val))) } /// Updates the value of the signal, notifying subscribers if the update function returns /// `(true, _)`, and returns the value returned by the update function, /// or `None` if the signal has already been disposed. fn try_maybe_update<U>( &self, fun: impl FnOnce(&mut Self::Value) -> (bool, U), ) -> Option<U>; } impl<T> Update for T where T: Write, { type Value = <Self as Write>::Value; #[track_caller] fn try_maybe_update<U>( &self, fun: impl FnOnce(&mut Self::Value) -> (bool, U), ) -> Option<U> { let mut lock = self.try_write()?; let (did_update, val) = fun(&mut *lock); if !did_update { lock.untrack(); } drop(lock); Some(val) } } /// Updates the value of the signal by replacing it. pub trait Set { /// The type of the value contained in the signal. type Value; /// Updates the value by replacing it, and notifies subscribers that it has changed. fn set(&self, value: Self::Value); /// Updates the value by replacing it, and notifies subscribers that it has changed. /// /// If the signal has already been disposed, returns `Some(value)` with the value that was /// passed in. Otherwise, returns `None`. fn try_set(&self, value: Self::Value) -> Option<Self::Value>; } impl<T> Set for T where T: Update + IsDisposed, { type Value = <Self as Update>::Value; #[track_caller] fn set(&self, value: Self::Value) { self.try_update(|n| *n = value); } #[track_caller] fn try_set(&self, value: Self::Value) -> Option<Self::Value> { if self.is_disposed() { Some(value) } else { self.set(value); None } } } /// Allows converting a signal into an async [`Stream`]. pub trait ToStream<T> { /// Generates a [`Stream`] that emits the new value of the signal /// whenever it changes. /// /// # Panics /// Panics if you try to access a signal that is owned by a reactive node that has been disposed. #[track_caller] fn to_stream(&self) -> impl Stream<Item = T> + Send; } impl<S> ToStream<S::Value> for S where S: Clone + Get + Send + Sync + 'static, S::Value: Send + 'static, { fn to_stream(&self) -> impl Stream<Item = S::Value> + Send { let (tx, rx) = futures::channel::mpsc::unbounded(); let close_channel = tx.clone(); Owner::on_cleanup(move || close_channel.close_channel()); Effect::new_isomorphic({ let this = self.clone(); move |_| { let _ = tx.unbounded_send(this.get()); } }); rx } } /// Allows creating a signal from an async [`Stream`]. pub trait FromStream<T> { /// Creates a signal that contains the latest value of the stream. #[track_caller] fn from_stream(stream: impl Stream<Item = T> + Send + 'static) -> Self; /// Creates a signal that contains the latest value of the stream. #[track_caller] fn from_stream_unsync(stream: impl Stream<Item = T> + 'static) -> Self; } impl<S, T> FromStream<T> for S where S: From<ArcReadSignal<Option<T>>> + Send + Sync, T: Send + Sync + 'static, { fn from_stream(stream: impl Stream<Item = T> + Send + 'static) -> Self { let (read, write) = arc_signal(None); let mut stream = Box::pin(stream); crate::spawn(async move { while let Some(value) = stream.next().await { write.set(Some(value)); } }); read.into() } fn from_stream_unsync(stream: impl Stream<Item = T> + 'static) -> Self { let (read, write) = arc_signal(None); let mut stream = Box::pin(stream); Executor::spawn_local(async move { while let Some(value) = stream.next().await { write.set(Some(value)); } }); read.into() } } /// Checks whether a signal has already been disposed. pub trait IsDisposed { /// If `true`, the signal cannot be accessed without a panic. fn is_disposed(&self) -> bool; } /// Turns a signal back into a raw value. pub trait IntoInner { /// The type of the value contained in the signal. type Value; /// Returns the inner value if this is the only reference to the signal. /// Otherwise, returns `None` and drops this reference. /// # Panics /// Panics if the inner lock is poisoned. fn into_inner(self) -> Option<Self::Value>; } /// Describes where the signal was defined. This is used for diagnostic warnings and is purely a /// debug-mode tool. pub trait DefinedAt { /// Returns the location at which the signal was defined. This is usually simply `None` in /// release mode. fn defined_at(&self) -> Option<&'static Location<'static>>; } #[doc(hidden)] pub fn panic_getting_disposed_signal( defined_at: Option<&'static Location<'static>>, location: &'static Location<'static>, ) -> String { if let Some(defined_at) = defined_at { format!( "At {location}, you tried to access a reactive value which was \ defined at {defined_at}, but it has already been disposed." ) } else { format!( "At {location}, you tried to access a reactive value, but it has \ already been disposed." ) } } /// A variation of the [`Read`] trait that provides a signposted "always-non-reactive" API. /// E.g. for [`StoredValue`](`crate::owner::StoredValue`). pub trait ReadValue: Sized + DefinedAt { /// The guard type that will be returned, which can be dereferenced to the value. type Value: Deref; /// Returns the non-reactive guard, or `None` if the value has already been disposed. #[track_caller] fn try_read_value(&self) -> Option<Self::Value>; /// Returns the non-reactive guard. /// /// # Panics /// Panics if you try to access a value that has been disposed. #[track_caller] fn read_value(&self) -> Self::Value { self.try_read_value().unwrap_or_else(unwrap_signal!(self)) } } /// A variation of the [`With`] trait that provides a signposted "always-non-reactive" API. /// E.g. for [`StoredValue`](`crate::owner::StoredValue`). pub trait WithValue: DefinedAt { /// The type of the value contained in the value. type Value: ?Sized; /// Applies the closure to the value, non-reactively, and returns the result, /// or `None` if the value has already been disposed. #[track_caller] fn try_with_value<U>( &self, fun: impl FnOnce(&Self::Value) -> U, ) -> Option<U>; /// Applies the closure to the value, non-reactively, and returns the result. /// /// # Panics /// Panics if you try to access a value that has been disposed. #[track_caller] fn with_value<U>(&self, fun: impl FnOnce(&Self::Value) -> U) -> U { self.try_with_value(fun) .unwrap_or_else(unwrap_signal!(self)) } } impl<T> WithValue for T where T: DefinedAt + ReadValue, { type Value = <<Self as ReadValue>::Value as Deref>::Target; fn try_with_value<U>( &self, fun: impl FnOnce(&Self::Value) -> U, ) -> Option<U> { self.try_read_value().map(|value| fun(&value)) } } /// A variation of the [`Get`] trait that provides a signposted "always-non-reactive" API. /// E.g. for [`StoredValue`](`crate::owner::StoredValue`). pub trait GetValue: DefinedAt { /// The type of the value contained in the value. type Value: Clone; /// Clones and returns the value of the value, non-reactively, /// or `None` if the value has already been disposed. #[track_caller] fn try_get_value(&self) -> Option<Self::Value>; /// Clones and returns the value of the value, non-reactively. /// /// # Panics /// Panics if you try to access a value that has been disposed. #[track_caller] fn get_value(&self) -> Self::Value { self.try_get_value().unwrap_or_else(unwrap_signal!(self)) } } impl<T> GetValue for T where T: WithValue, T::Value: Clone, { type Value = <Self as WithValue>::Value; fn try_get_value(&self) -> Option<Self::Value> { self.try_with_value(Self::Value::clone) } } /// A variation of the [`Write`] trait that provides a signposted "always-non-reactive" API. /// E.g. for [`StoredValue`](`crate::owner::StoredValue`). pub trait WriteValue: Sized + DefinedAt { /// The type of the value's value. type Value: Sized + 'static; /// Returns a non-reactive write guard, or `None` if the value has already been disposed. #[track_caller] fn try_write_value(&self) -> Option<UntrackedWriteGuard<Self::Value>>; /// Returns a non-reactive write guard. /// /// # Panics /// Panics if you try to access a value that has been disposed. #[track_caller] fn write_value(&self) -> UntrackedWriteGuard<Self::Value> { self.try_write_value().unwrap_or_else(unwrap_signal!(self)) } } /// A variation of the [`Update`] trait that provides a signposted "always-non-reactive" API. /// E.g. for [`StoredValue`](`crate::owner::StoredValue`). pub trait UpdateValue: DefinedAt { /// The type of the value contained in the value. type Value; /// Updates the value, returning the value that is /// returned by the update function, or `None` if the value has already been disposed. #[track_caller] fn try_update_value<U>( &self, fun: impl FnOnce(&mut Self::Value) -> U, ) -> Option<U>; /// Updates the value. #[track_caller] fn update_value(&self, fun: impl FnOnce(&mut Self::Value)) { self.try_update_value(fun); } } impl<T> UpdateValue for T where T: WriteValue, { type Value = <Self as WriteValue>::Value; #[track_caller] fn try_update_value<U>( &self, fun: impl FnOnce(&mut Self::Value) -> U, ) -> Option<U> { let mut guard = self.try_write_value()?; Some(fun(&mut *guard)) } } /// A variation of the [`Set`] trait that provides a signposted "always-non-reactive" API. /// E.g. for [`StoredValue`](`crate::owner::StoredValue`). pub trait SetValue: DefinedAt { /// The type of the value contained in the value. type Value; /// Updates the value by replacing it, non-reactively. /// /// If the value has already been disposed, returns `Some(value)` with the value that was /// passed in. Otherwise, returns `None`. #[track_caller] fn try_set_value(&self, value: Self::Value) -> Option<Self::Value>; /// Updates the value by replacing it, non-reactively. #[track_caller] fn set_value(&self, value: Self::Value) { self.try_set_value(value); } } impl<T> SetValue for T where T: WriteValue, { type Value = <Self as WriteValue>::Value; fn try_set_value(&self, value: Self::Value) -> Option<Self::Value> { // Unlike most other traits, for these None actually means success: if let Some(mut guard) = self.try_write_value() { *guard = value; None } else { Some(value) } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/channel.rs
reactive_graph/src/channel.rs
use core::sync::atomic::Ordering::Relaxed; use futures::{task::AtomicWaker, Stream}; use std::{ fmt::Debug, hash::Hash, pin::Pin, sync::{atomic::AtomicBool, Arc, Weak}, task::{Context, Poll}, }; #[derive(Debug)] pub(crate) struct Sender(Arc<Inner>); #[derive(Debug)] pub(crate) struct Receiver(Weak<Inner>); #[derive(Debug, Default)] struct Inner { waker: AtomicWaker, set: AtomicBool, } impl Drop for Inner { fn drop(&mut self) { // Sender holds a strong reference to Inner, and Receiver holds a weak reference to Inner, // so this will run when the Sender is dropped. // // The Receiver is usually owned by a spawned async task that is always waiting on the next // value from its Stream. While it's waiting, it continues owning all the data it has // captured. That data will not be dropped until the the stream ends. // // If we don't wake the waker a final time here, the spawned task will continue waiting for // a final message from the Receiver that never arrives, because the waker never wakes it // up again. So we wake the waker a final time, which tries to upgrade the Receiver, which // fails, which causes the stream to yield Poll::Ready(None), ending the stream, and // therefore ending the task, and therefore dropping all data that the stream has // captured, avoiding a memory leak. self.waker.wake(); } } pub fn channel() -> (Sender, Receiver) { let inner = Arc::new(Inner { waker: AtomicWaker::new(), set: AtomicBool::new(false), }); let rx = Arc::downgrade(&inner); (Sender(inner), Receiver(rx)) } impl Sender { pub fn notify(&mut self) { self.0.set.store(true, Relaxed); self.0.waker.wake(); } } impl Stream for Receiver { type Item = (); fn poll_next( self: Pin<&mut Self>, cx: &mut Context<'_>, ) -> Poll<Option<Self::Item>> { if let Some(inner) = self.0.upgrade() { inner.waker.register(cx.waker()); if inner.set.swap(false, Relaxed) { Poll::Ready(Some(())) } else { Poll::Pending } } else { Poll::Ready(None) } } } impl Hash for Sender { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { Arc::as_ptr(&self.0).hash(state) } } impl PartialEq for Sender { fn eq(&self, other: &Self) -> bool { Arc::ptr_eq(&self.0, &other.0) } } impl Eq for Sender {} impl Hash for Receiver { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { Weak::as_ptr(&self.0).hash(state) } } impl PartialEq for Receiver { fn eq(&self, other: &Self) -> bool { Weak::ptr_eq(&self.0, &other.0) } } impl Eq for Receiver {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/graph.rs
reactive_graph/src/graph.rs
//! Types that define the reactive graph itself. These are mostly internal, but can be used to //! create custom reactive primitives. mod node; mod sets; mod source; mod subscriber; pub use node::*; pub(crate) use sets::*; pub use source::*; pub use subscriber::*;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/effect/effect.rs
reactive_graph/src/effect/effect.rs
use crate::{ channel::{channel, Receiver}, effect::{inner::EffectInner, EffectFunction}, graph::{ AnySubscriber, ReactiveNode, SourceSet, Subscriber, ToAnySubscriber, WithObserver, }, owner::{ArenaItem, LocalStorage, Owner, Storage, SyncStorage}, traits::Dispose, }; use any_spawner::Executor; use futures::StreamExt; use or_poisoned::OrPoisoned; use std::{ mem, sync::{atomic::AtomicBool, Arc, RwLock}, }; /// Effects run a certain chunk of code whenever the signals they depend on change. /// /// Creating an effect runs the given function once after any current synchronous work is done. /// This tracks its reactive values read within it, and reruns the function whenever the value /// of a dependency changes. /// /// Effects are intended to run *side-effects* of the system, not to synchronize state /// *within* the system. In other words: In most cases, you usually should not write to /// signals inside effects. (If you need to define a signal that depends on the value of /// other signals, use a derived signal or a [`Memo`](crate::computed::Memo)). /// /// You can provide an effect function without parameters or one with one parameter. /// If you provide such a parameter, the effect function is called with an argument containing /// whatever value it returned the last time it ran. On the initial run, this is `None`. /// /// Effects stop running when their reactive [`Owner`] is disposed. /// /// /// ## Example /// /// ``` /// # use reactive_graph::computed::*; /// # use reactive_graph::signal::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # use reactive_graph::prelude::*; /// # use reactive_graph::effect::Effect; /// # use reactive_graph::owner::ArenaItem; /// # tokio_test::block_on(async move { /// # tokio::task::LocalSet::new().run_until(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// let a = RwSignal::new(0); /// let b = RwSignal::new(0); /// /// // ✅ use effects to interact between reactive state and the outside world /// Effect::new(move || { /// // on the next “tick” prints "Value: 0" and subscribes to `a` /// println!("Value: {}", a.get()); /// }); /// /// # assert_eq!(a.get(), 0); /// a.set(1); /// # assert_eq!(a.get(), 1); /// // ✅ because it's subscribed to `a`, the effect reruns and prints "Value: 1" /// /// // ❌ don't use effects to synchronize state within the reactive system /// Effect::new(move || { /// // this technically works but can cause unnecessary re-renders /// // and easily lead to problems like infinite loops /// b.set(a.get() + 1); /// }); /// # }).await; /// # }); /// ``` /// ## Web-Specific Notes /// /// 1. **Scheduling**: Effects run after synchronous work, on the next “tick” of the reactive /// system. This makes them suitable for “on mount” actions: they will fire immediately after /// DOM rendering. /// 2. By default, effects do not run unless the `effects` feature is enabled. If you are using /// this with a web framework, this generally means that effects **do not run on the server**. /// and you can call browser-specific APIs within the effect function without causing issues. /// If you need an effect to run on the server, use [`Effect::new_isomorphic`]. #[derive(Debug, Clone, Copy)] pub struct Effect<S> { inner: Option<ArenaItem<StoredEffect, S>>, } type StoredEffect = Option<Arc<RwLock<EffectInner>>>; impl<S> Dispose for Effect<S> { fn dispose(self) { if let Some(inner) = self.inner { inner.dispose() } } } fn effect_base() -> (Receiver, Owner, Arc<RwLock<EffectInner>>) { let (mut observer, rx) = channel(); // spawn the effect asynchronously // we'll notify once so it runs on the next tick, // to register observed values observer.notify(); let owner = Owner::new(); let inner = Arc::new(RwLock::new(EffectInner { dirty: true, observer, sources: SourceSet::new(), })); (rx, owner, inner) } #[cfg(debug_assertions)] thread_local! { static EFFECT_SCOPE_ACTIVE: AtomicBool = const { AtomicBool::new(false) }; } #[cfg(debug_assertions)] /// Returns whether the current thread is currently running an effect. pub fn in_effect_scope() -> bool { EFFECT_SCOPE_ACTIVE .with(|scope| scope.load(std::sync::atomic::Ordering::Relaxed)) } /// Set a static to true whilst running the given function. /// [`is_in_effect_scope`] will return true whilst the function is running. fn run_in_effect_scope<T>(fun: impl FnOnce() -> T) -> T { #[cfg(debug_assertions)] { // For the theoretical nested case, set back to initial value rather than false: let initial = EFFECT_SCOPE_ACTIVE.with(|scope| { scope.swap(true, std::sync::atomic::Ordering::Relaxed) }); let result = fun(); EFFECT_SCOPE_ACTIVE.with(|scope| { scope.store(initial, std::sync::atomic::Ordering::Relaxed) }); result } #[cfg(not(debug_assertions))] { fun() } } impl<S> Effect<S> where S: Storage<StoredEffect>, { /// Stops this effect before it is disposed. pub fn stop(self) { if let Some(inner) = self .inner .and_then(|this| this.try_update_value(|inner| inner.take())) { drop(inner); } } } impl Effect<LocalStorage> { /// Creates a new effect, which runs once on the next “tick”, and then runs again when reactive values /// that are read inside it change. /// /// This spawns a task on the local thread using /// [`spawn_local`](any_spawner::Executor::spawn_local). For an effect that can be spawned on /// any thread, use [`new_sync`](Effect::new_sync). pub fn new<T, M>(mut fun: impl EffectFunction<T, M> + 'static) -> Self where T: 'static, { let inner = cfg!(feature = "effects").then(|| { let (mut rx, owner, inner) = effect_base(); let value = Arc::new(RwLock::new(None::<T>)); let mut first_run = true; Executor::spawn_local({ let value = Arc::clone(&value); let subscriber = inner.to_any_subscriber(); async move { while rx.next().await.is_some() { if !owner.paused() && (subscriber.with_observer(|| { subscriber.update_if_necessary() }) || first_run) { first_run = false; subscriber.clear_sources(&subscriber); let old_value = mem::take(&mut *value.write().or_poisoned()); let new_value = owner.with_cleanup(|| { subscriber.with_observer(|| { run_in_effect_scope(|| fun.run(old_value)) }) }); *value.write().or_poisoned() = Some(new_value); } } } }); ArenaItem::new_with_storage(Some(inner)) }); Self { inner } } /// A version of [`Effect::new`] that only listens to any dependency /// that is accessed inside `dependency_fn`. /// /// The return value of `dependency_fn` is passed into `handler` as an argument together with the previous value. /// Additionally, the last return value of `handler` is provided as a third argument, as is done in [`Effect::new`]. /// /// ## Usage /// /// ``` /// # use reactive_graph::effect::Effect; /// # use reactive_graph::traits::*; /// # use reactive_graph::signal::signal; /// # tokio_test::block_on(async move { /// # tokio::task::LocalSet::new().run_until(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # /// let (num, set_num) = signal(0); /// /// let effect = Effect::watch( /// move || num.get(), /// move |num, prev_num, _| { /// // log::debug!("Number: {}; Prev: {:?}", num, prev_num); /// }, /// false, /// ); /// # assert_eq!(num.get(), 0); /// /// set_num.set(1); // > "Number: 1; Prev: Some(0)" /// # assert_eq!(num.get(), 1); /// /// effect.stop(); // stop watching /// /// set_num.set(2); // (nothing happens) /// # assert_eq!(num.get(), 2); /// # }).await; /// # }); /// ``` /// /// The callback itself doesn't track any signal that is accessed within it. /// /// ``` /// # use reactive_graph::effect::Effect; /// # use reactive_graph::traits::*; /// # use reactive_graph::signal::signal; /// # tokio_test::block_on(async move { /// # tokio::task::LocalSet::new().run_until(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # /// let (num, set_num) = signal(0); /// let (cb_num, set_cb_num) = signal(0); /// /// Effect::watch( /// move || num.get(), /// move |num, _, _| { /// // log::debug!("Number: {}; Cb: {}", num, cb_num.get()); /// }, /// false, /// ); /// /// # assert_eq!(num.get(), 0); /// set_num.set(1); // > "Number: 1; Cb: 0" /// # assert_eq!(num.get(), 1); /// /// # assert_eq!(cb_num.get(), 0); /// set_cb_num.set(1); // (nothing happens) /// # assert_eq!(cb_num.get(), 1); /// /// set_num.set(2); // > "Number: 2; Cb: 1" /// # assert_eq!(num.get(), 2); /// # }).await; /// # }); /// ``` /// /// ## Immediate /// /// If the final parameter `immediate` is true, the `handler` will run immediately. /// If it's `false`, the `handler` will run only after /// the first change is detected of any signal that is accessed in `dependency_fn`. /// /// ``` /// # use reactive_graph::effect::Effect; /// # use reactive_graph::traits::*; /// # use reactive_graph::signal::signal; /// # tokio_test::block_on(async move { /// # tokio::task::LocalSet::new().run_until(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # /// let (num, set_num) = signal(0); /// /// Effect::watch( /// move || num.get(), /// move |num, prev_num, _| { /// // log::debug!("Number: {}; Prev: {:?}", num, prev_num); /// }, /// true, /// ); // > "Number: 0; Prev: None" /// /// # assert_eq!(num.get(), 0); /// set_num.set(1); // > "Number: 1; Prev: Some(0)" /// # assert_eq!(num.get(), 1); /// # }).await; /// # }); /// ``` pub fn watch<D, T>( mut dependency_fn: impl FnMut() -> D + 'static, mut handler: impl FnMut(&D, Option<&D>, Option<T>) -> T + 'static, immediate: bool, ) -> Self where D: 'static, T: 'static, { let inner = cfg!(feature = "effects").then(|| { let (mut rx, owner, inner) = effect_base(); let mut first_run = true; let dep_value = Arc::new(RwLock::new(None::<D>)); let watch_value = Arc::new(RwLock::new(None::<T>)); Executor::spawn_local({ let dep_value = Arc::clone(&dep_value); let watch_value = Arc::clone(&watch_value); let subscriber = inner.to_any_subscriber(); async move { while rx.next().await.is_some() { if !owner.paused() && (subscriber.with_observer(|| { subscriber.update_if_necessary() }) || first_run) { subscriber.clear_sources(&subscriber); let old_dep_value = mem::take( &mut *dep_value.write().or_poisoned(), ); let new_dep_value = owner.with_cleanup(|| { subscriber.with_observer(&mut dependency_fn) }); let old_watch_value = mem::take( &mut *watch_value.write().or_poisoned(), ); if immediate || !first_run { let new_watch_value = handler( &new_dep_value, old_dep_value.as_ref(), old_watch_value, ); *watch_value.write().or_poisoned() = Some(new_watch_value); } *dep_value.write().or_poisoned() = Some(new_dep_value); first_run = false; } } } }); ArenaItem::new_with_storage(Some(inner)) }); Self { inner } } } impl Effect<SyncStorage> { /// Creates a new effect, which runs once on the next “tick”, and then runs again when reactive values /// that are read inside it change. /// /// This spawns a task that can be run on any thread. For an effect that will be spawned on /// the current thread, use [`new`](Effect::new). pub fn new_sync<T, M>( fun: impl EffectFunction<T, M> + Send + Sync + 'static, ) -> Self where T: Send + Sync + 'static, { if !cfg!(feature = "effects") { return Self { inner: None }; } Self::new_isomorphic(fun) } /// Creates a new effect, which runs once on the next “tick”, and then runs again when reactive values /// that are read inside it change. /// /// This will run whether the `effects` feature is enabled or not. pub fn new_isomorphic<T, M>( mut fun: impl EffectFunction<T, M> + Send + Sync + 'static, ) -> Self where T: Send + Sync + 'static, { let (mut rx, owner, inner) = effect_base(); let mut first_run = true; let value = Arc::new(RwLock::new(None::<T>)); let task = { let value = Arc::clone(&value); let subscriber = inner.to_any_subscriber(); async move { while rx.next().await.is_some() { if !owner.paused() && (subscriber .with_observer(|| subscriber.update_if_necessary()) || first_run) { first_run = false; subscriber.clear_sources(&subscriber); let old_value = mem::take(&mut *value.write().or_poisoned()); let new_value = owner.with_cleanup(|| { subscriber.with_observer(|| { run_in_effect_scope(|| fun.run(old_value)) }) }); *value.write().or_poisoned() = Some(new_value); } } } }; crate::spawn(task); Self { inner: Some(ArenaItem::new_with_storage(Some(inner))), } } /// This is to [`Effect::watch`] what [`Effect::new_sync`] is to [`Effect::new`]. pub fn watch_sync<D, T>( mut dependency_fn: impl FnMut() -> D + Send + Sync + 'static, mut handler: impl FnMut(&D, Option<&D>, Option<T>) -> T + Send + Sync + 'static, immediate: bool, ) -> Self where D: Send + Sync + 'static, T: Send + Sync + 'static, { let (mut rx, owner, inner) = effect_base(); let mut first_run = true; let dep_value = Arc::new(RwLock::new(None::<D>)); let watch_value = Arc::new(RwLock::new(None::<T>)); let inner = cfg!(feature = "effects").then(|| { crate::spawn({ let dep_value = Arc::clone(&dep_value); let watch_value = Arc::clone(&watch_value); let subscriber = inner.to_any_subscriber(); async move { while rx.next().await.is_some() { if !owner.paused() && (subscriber.with_observer(|| { subscriber.update_if_necessary() }) || first_run) { subscriber.clear_sources(&subscriber); let old_dep_value = mem::take( &mut *dep_value.write().or_poisoned(), ); let new_dep_value = owner.with_cleanup(|| { subscriber.with_observer(&mut dependency_fn) }); let old_watch_value = mem::take( &mut *watch_value.write().or_poisoned(), ); if immediate || !first_run { let new_watch_value = handler( &new_dep_value, old_dep_value.as_ref(), old_watch_value, ); *watch_value.write().or_poisoned() = Some(new_watch_value); } *dep_value.write().or_poisoned() = Some(new_dep_value); first_run = false; } } } }); ArenaItem::new_with_storage(Some(inner)) }); Self { inner } } } impl<S> ToAnySubscriber for Effect<S> where S: Storage<StoredEffect>, { fn to_any_subscriber(&self) -> AnySubscriber { self.inner .and_then(|inner| { inner .try_with_value(|inner| { inner.as_ref().map(|inner| inner.to_any_subscriber()) }) .flatten() }) .expect("tried to set effect that has been stopped") } } /// Creates an [`Effect`]. #[inline(always)] #[track_caller] #[deprecated = "This function is being removed to conform to Rust idioms. \ Please use `Effect::new()` instead."] pub fn create_effect<T>( fun: impl FnMut(Option<T>) -> T + 'static, ) -> Effect<LocalStorage> where T: 'static, { Effect::new(fun) } /// Creates an [`Effect`], equivalent to [Effect::watch]. #[inline(always)] #[track_caller] #[deprecated = "This function is being removed to conform to Rust idioms. \ Please use `Effect::watch()` instead."] pub fn watch<W, T>( deps: impl Fn() -> W + 'static, callback: impl Fn(&W, Option<&W>, Option<T>) -> T + Clone + 'static, immediate: bool, ) -> impl Fn() + Clone where W: Clone + 'static, T: 'static, { let watch = Effect::watch(deps, callback, immediate); move || watch.stop() }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/effect/inner.rs
reactive_graph/src/effect/inner.rs
use crate::{ channel::Sender, graph::{ AnySource, AnySubscriber, ReactiveNode, SourceSet, Subscriber, ToAnySubscriber, }, }; use or_poisoned::OrPoisoned; use std::sync::{Arc, RwLock, Weak}; /// Handles internal subscription logic for effects. #[derive(Debug)] pub struct EffectInner { pub(crate) dirty: bool, pub(crate) observer: Sender, pub(crate) sources: SourceSet, } impl ToAnySubscriber for Arc<RwLock<EffectInner>> { fn to_any_subscriber(&self) -> AnySubscriber { AnySubscriber( Arc::as_ptr(self) as usize, Arc::downgrade(self) as Weak<dyn Subscriber + Send + Sync>, ) } } impl ReactiveNode for RwLock<EffectInner> { fn mark_subscribers_check(&self) {} fn update_if_necessary(&self) -> bool { let mut guard = self.write().or_poisoned(); if guard.dirty { guard.dirty = false; return true; } let sources = guard.sources.clone(); drop(guard); sources .into_iter() .any(|source| source.update_if_necessary()) } fn mark_check(&self) { self.write().or_poisoned().observer.notify() } fn mark_dirty(&self) { let mut lock = self.write().or_poisoned(); lock.dirty = true; lock.observer.notify() } } impl Subscriber for RwLock<EffectInner> { fn add_source(&self, source: AnySource) { self.write().or_poisoned().sources.insert(source); } fn clear_sources(&self, subscriber: &AnySubscriber) { self.write().or_poisoned().sources.clear_sources(subscriber); } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/effect/render_effect.rs
reactive_graph/src/effect/render_effect.rs
use crate::{ channel::channel, effect::inner::EffectInner, graph::{ AnySubscriber, ReactiveNode, SourceSet, Subscriber, ToAnySubscriber, WithObserver, }, owner::Owner, }; use futures::StreamExt; use or_poisoned::OrPoisoned; #[cfg(feature = "subsecond")] use std::sync::Mutex; use std::{ fmt::Debug, future::{Future, IntoFuture}, mem, pin::Pin, sync::{Arc, RwLock, Weak}, }; /// A render effect is similar to an [`Effect`](super::Effect), but with two key differences: /// 1. Its first run takes place immediately and synchronously: for example, if it is being used to /// drive a user interface, it will run during rendering, not on the next tick after rendering. /// (Hence “render effect.”) /// 2. It is canceled when the `RenderEffect` itself is dropped, rather than being stored in the /// reactive system and canceled when the `Owner` cleans up. /// /// Unless you are implementing a rendering framework, or require one of these two characteristics, /// it is unlikely you will use render effects directly. /// /// Like an [`Effect`](super::Effect), a render effect runs only with the `effects` feature /// enabled. #[must_use = "A RenderEffect will be canceled when it is dropped. Creating a \ RenderEffect that is not stored in some other data structure or \ leaked will drop it immediately, and it will not react to \ changes in signals it reads."] pub struct RenderEffect<T> where T: 'static, { value: Arc<RwLock<Option<T>>>, inner: Arc<RwLock<EffectInner>>, } impl<T> Debug for RenderEffect<T> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("RenderEffect") .field("inner", &Arc::as_ptr(&self.inner)) .finish() } } #[cfg(feature = "subsecond")] type CurrentHotPtr = Box<dyn Fn() -> Option<subsecond::HotFnPtr> + Send + Sync>; impl<T> RenderEffect<T> where T: 'static, { /// Creates a new render effect, which immediately runs `fun`. pub fn new(fun: impl FnMut(Option<T>) -> T + 'static) -> Self { #[cfg(feature = "subsecond")] let (hot_fn_ptr, fun) = { let fun = Arc::new(Mutex::new(subsecond::HotFn::current(fun))); ( { let fun = Arc::downgrade(&fun); let wrapped = send_wrapper::SendWrapper::new(move || { fun.upgrade() .map(|n| n.lock().or_poisoned().ptr_address()) }); // it's not redundant, it's due to the SendWrapper deref #[allow(clippy::redundant_closure)] Box::new(move || wrapped()) }, move |prev| fun.lock().or_poisoned().call((prev,)), ) }; Self::new_with_value_erased( Box::new(fun), None, #[cfg(feature = "subsecond")] hot_fn_ptr, ) } /// Creates a new render effect with an initial value. pub fn new_with_value( fun: impl FnMut(Option<T>) -> T + 'static, initial_value: Option<T>, ) -> Self { #[cfg(feature = "subsecond")] let (hot_fn_ptr, fun) = { let fun = Arc::new(Mutex::new(subsecond::HotFn::current(fun))); ( { let fun = Arc::downgrade(&fun); let wrapped = send_wrapper::SendWrapper::new(move || { fun.upgrade() .map(|n| n.lock().or_poisoned().ptr_address()) }); // it's not redundant, it's due to the SendWrapper deref #[allow(clippy::redundant_closure)] Box::new(move || wrapped()) }, move |prev| fun.lock().or_poisoned().call((prev,)), ) }; Self::new_with_value_erased( Box::new(fun), initial_value, #[cfg(feature = "subsecond")] hot_fn_ptr, ) } /// Creates a new render effect, which immediately runs `fun`. pub async fn new_with_async_value( fun: impl FnMut(Option<T>) -> T + 'static, value: impl IntoFuture<Output = T> + 'static, ) -> Self { #[cfg(feature = "subsecond")] let mut fun = subsecond::HotFn::current(fun); #[cfg(feature = "subsecond")] let fun = move |prev| fun.call((prev,)); Self::new_with_async_value_erased( Box::new(fun), Box::pin(value.into_future()), ) .await } fn new_with_value_erased( #[allow(unused_mut)] mut fun: Box<dyn FnMut(Option<T>) -> T + 'static>, initial_value: Option<T>, // this argument can be used to invalidate individual effects in the future // in present experiments, I have found that it is not actually granular enough to make a difference #[allow(unused)] #[cfg(feature = "subsecond")] hot_fn_ptr: CurrentHotPtr, ) -> Self { // codegen optimisation: fn prep() -> (Owner, Arc<RwLock<EffectInner>>, crate::channel::Receiver) { let (observer, rx) = channel(); let owner = Owner::new(); let inner = Arc::new(RwLock::new(EffectInner { dirty: false, observer, sources: SourceSet::new(), })); (owner, inner, rx) } let (owner, inner, mut rx) = prep(); let value = Arc::new(RwLock::new(None::<T>)); #[cfg(not(feature = "effects"))] { let _ = initial_value; let _ = owner; let _ = &mut rx; let _ = fun; } #[cfg(feature = "effects")] { let subscriber = inner.to_any_subscriber(); #[cfg(all(feature = "subsecond", debug_assertions))] let mut fun = { use crate::graph::ReactiveNode; use rustc_hash::FxHashMap; use std::sync::{Arc, LazyLock, Mutex}; use subsecond::HotFnPtr; static HOT_RELOAD_SUBSCRIBERS: LazyLock< Mutex<FxHashMap<AnySubscriber, (HotFnPtr, CurrentHotPtr)>>, > = LazyLock::new(|| { subsecond::register_handler(Arc::new(|| { HOT_RELOAD_SUBSCRIBERS.lock().or_poisoned().retain( |subscriber, (prev_ptr, hot_fn_ptr)| { match hot_fn_ptr() { None => false, Some(curr_hot_ptr) => { if curr_hot_ptr != *prev_ptr { crate::log_warning(format_args!( "{prev_ptr:?} <> \ {curr_hot_ptr:?}", )); *prev_ptr = curr_hot_ptr; subscriber.mark_dirty(); } true } } }, ); })); Default::default() }); let mut fun = subsecond::HotFn::current(fun); let initial_ptr = hot_fn_ptr().unwrap(); HOT_RELOAD_SUBSCRIBERS .lock() .or_poisoned() .insert(subscriber.clone(), (initial_ptr, hot_fn_ptr)); move |prev| fun.call((prev,)) }; *value.write().or_poisoned() = Some( owner.with(|| subscriber.with_observer(|| fun(initial_value))), ); any_spawner::Executor::spawn_local({ let value = Arc::clone(&value); async move { while rx.next().await.is_some() { if !owner.paused() && subscriber.with_observer(|| { subscriber.update_if_necessary() }) { subscriber.clear_sources(&subscriber); let old_value = mem::take(&mut *value.write().or_poisoned()); let new_value = owner.with_cleanup(|| { subscriber.with_observer(|| fun(old_value)) }); *value.write().or_poisoned() = Some(new_value); } } } }); } RenderEffect { value, inner } } async fn new_with_async_value_erased( mut fun: Box<dyn FnMut(Option<T>) -> T + 'static>, initial_value: Pin<Box<dyn Future<Output = T>>>, ) -> Self { // codegen optimisation: fn prep() -> (Owner, Arc<RwLock<EffectInner>>, crate::channel::Receiver) { let (observer, rx) = channel(); let owner = Owner::new(); let inner = Arc::new(RwLock::new(EffectInner { dirty: false, observer, sources: SourceSet::new(), })); (owner, inner, rx) } let (owner, inner, mut rx) = prep(); let value = Arc::new(RwLock::new(None::<T>)); #[cfg(not(feature = "effects"))] { drop(initial_value); let _ = owner; let _ = &mut rx; let _ = &mut fun; } #[cfg(feature = "effects")] { use crate::computed::ScopedFuture; let subscriber = inner.to_any_subscriber(); let initial = subscriber .with_observer(|| ScopedFuture::new(initial_value)) .await; *value.write().or_poisoned() = Some(initial); any_spawner::Executor::spawn_local({ let value = Arc::clone(&value); async move { while rx.next().await.is_some() { if !owner.paused() && subscriber.with_observer(|| { subscriber.update_if_necessary() }) { subscriber.clear_sources(&subscriber); let old_value = mem::take(&mut *value.write().or_poisoned()); let new_value = owner.with_cleanup(|| { subscriber.with_observer(|| fun(old_value)) }); *value.write().or_poisoned() = Some(new_value); } } } }); } RenderEffect { value, inner } } /// Mutably accesses the current value. pub fn with_value_mut<U>( &self, fun: impl FnOnce(&mut T) -> U, ) -> Option<U> { self.value.write().or_poisoned().as_mut().map(fun) } /// Takes the current value, replacing it with `None`. pub fn take_value(&self) -> Option<T> { self.value.write().or_poisoned().take() } } impl<T> RenderEffect<T> where T: Send + Sync + 'static, { /// Creates a render effect that will run whether the `effects` feature is enabled or not. pub fn new_isomorphic( fun: impl FnMut(Option<T>) -> T + Send + Sync + 'static, ) -> Self { #[cfg(feature = "subsecond")] let mut fun = subsecond::HotFn::current(fun); #[cfg(feature = "subsecond")] let fun = move |prev| fun.call((prev,)); fn erased<T: Send + Sync + 'static>( mut fun: Box<dyn FnMut(Option<T>) -> T + Send + Sync + 'static>, ) -> RenderEffect<T> { let (observer, mut rx) = channel(); let value = Arc::new(RwLock::new(None::<T>)); let owner = Owner::new(); let inner = Arc::new(RwLock::new(EffectInner { dirty: false, observer, sources: SourceSet::new(), })); let initial_value = owner .with(|| inner.to_any_subscriber().with_observer(|| fun(None))); *value.write().or_poisoned() = Some(initial_value); crate::spawn({ let value = Arc::clone(&value); let subscriber = inner.to_any_subscriber(); async move { while rx.next().await.is_some() { if !owner.paused() && subscriber.with_observer(|| { subscriber.update_if_necessary() }) { subscriber.clear_sources(&subscriber); let old_value = mem::take(&mut *value.write().or_poisoned()); let new_value = owner.with_cleanup(|| { subscriber.with_observer(|| fun(old_value)) }); *value.write().or_poisoned() = Some(new_value); } } } }); RenderEffect { value, inner } } erased(Box::new(fun)) } } impl<T> ToAnySubscriber for RenderEffect<T> { fn to_any_subscriber(&self) -> AnySubscriber { AnySubscriber( Arc::as_ptr(&self.inner) as usize, Arc::downgrade(&self.inner) as Weak<dyn Subscriber + Send + Sync>, ) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/effect/effect_function.rs
reactive_graph/src/effect/effect_function.rs
/// Trait to enable effect functions that have zero or one parameter pub trait EffectFunction<T, M> { /// Call this to execute the function. In case the actual function has no parameters /// the parameter `p` will simply be ignored. fn run(&mut self, p: Option<T>) -> T; } /// Marker for single parameter functions pub struct SingleParam; /// Marker for no parameter functions pub struct NoParam; impl<Func, T> EffectFunction<T, SingleParam> for Func where Func: FnMut(Option<T>) -> T, { #[inline(always)] fn run(&mut self, p: Option<T>) -> T { (self)(p) } } impl<Func> EffectFunction<(), NoParam> for Func where Func: FnMut(), { #[inline(always)] fn run(&mut self, _: Option<()>) { self() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/effect/immediate.rs
reactive_graph/src/effect/immediate.rs
use crate::{ graph::{AnySubscriber, ReactiveNode, ToAnySubscriber}, owner::on_cleanup, traits::{DefinedAt, Dispose}, }; use or_poisoned::OrPoisoned; use std::{ panic::Location, sync::{Arc, Mutex, RwLock}, }; /// Effects run a certain chunk of code whenever the signals they depend on change. /// /// The effect runs on creation and again as soon as any tracked signal changes. /// /// NOTE: you probably want use [`Effect`](super::Effect) instead. /// This is for the few cases where it's important to execute effects immediately and in order. /// /// [ImmediateEffect]s stop running when dropped. /// /// NOTE: since effects are executed immediately, they might recurse. /// Under recursion or parallelism only the last run to start is tracked. /// /// ## Example /// /// ``` /// # use reactive_graph::computed::*; /// # use reactive_graph::signal::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # use reactive_graph::prelude::*; /// # use reactive_graph::effect::ImmediateEffect; /// # use reactive_graph::owner::ArenaItem; /// # let owner = reactive_graph::owner::Owner::new(); owner.set(); /// let a = RwSignal::new(0); /// let b = RwSignal::new(0); /// /// // ✅ use effects to interact between reactive state and the outside world /// let _drop_guard = ImmediateEffect::new(move || { /// // on the next “tick” prints "Value: 0" and subscribes to `a` /// println!("Value: {}", a.get()); /// }); /// /// // The effect runs immediately and subscribes to `a`, in the process it prints "Value: 0" /// # assert_eq!(a.get(), 0); /// a.set(1); /// # assert_eq!(a.get(), 1); /// // ✅ because it's subscribed to `a`, the effect reruns and prints "Value: 1" /// ``` /// ## Notes /// /// 1. **Scheduling**: Effects run immediately, as soon as any tracked signal changes. /// 2. By default, effects do not run unless the `effects` feature is enabled. If you are using /// this with a web framework, this generally means that effects **do not run on the server**. /// and you can call browser-specific APIs within the effect function without causing issues. /// If you need an effect to run on the server, use [`ImmediateEffect::new_isomorphic`]. #[derive(Debug, Clone)] pub struct ImmediateEffect { inner: StoredEffect, } type StoredEffect = Option<Arc<RwLock<inner::EffectInner>>>; impl Dispose for ImmediateEffect { fn dispose(self) {} } impl ImmediateEffect { /// Creates a new effect which runs immediately, then again as soon as any tracked signal changes. /// (Unless [batch] is used.) /// /// NOTE: this requires a `Fn` function because it might recurse. /// Use [Self::new_mut] to pass a `FnMut` function, it'll panic on recursion. #[track_caller] #[must_use] pub fn new(fun: impl Fn() + Send + Sync + 'static) -> Self { if !cfg!(feature = "effects") { return Self { inner: None }; } let inner = inner::EffectInner::new(fun); inner.update_if_necessary(); Self { inner: Some(inner) } } /// Creates a new effect which runs immediately, then again as soon as any tracked signal changes. /// (Unless [batch] is used.) /// /// # Panics /// Panics on recursion or if triggered in parallel. Also see [Self::new] #[track_caller] #[must_use] pub fn new_mut(fun: impl FnMut() + Send + Sync + 'static) -> Self { const MSG: &str = "The effect recursed or its function panicked."; let fun = Mutex::new(fun); Self::new(move || fun.try_lock().expect(MSG)()) } /// Creates a new effect which runs immediately, then again as soon as any tracked signal changes. /// (Unless [batch] is used.) /// /// NOTE: this requires a `Fn` function because it might recurse. /// Use [Self::new_mut_scoped] to pass a `FnMut` function, it'll panic on recursion. /// NOTE: this effect is automatically cleaned up when the current owner is cleared or disposed. #[track_caller] pub fn new_scoped(fun: impl Fn() + Send + Sync + 'static) { let effect = Self::new(fun); on_cleanup(move || effect.dispose()); } /// Creates a new effect which runs immediately, then again as soon as any tracked signal changes. /// (Unless [batch] is used.) /// /// NOTE: this effect is automatically cleaned up when the current owner is cleared or disposed. /// /// # Panics /// Panics on recursion or if triggered in parallel. Also see [Self::new_scoped] #[track_caller] pub fn new_mut_scoped(fun: impl FnMut() + Send + Sync + 'static) { let effect = Self::new_mut(fun); on_cleanup(move || effect.dispose()); } /// Creates a new effect which runs immediately, then again as soon as any tracked signal changes. /// /// This will run whether the `effects` feature is enabled or not. #[track_caller] #[must_use] pub fn new_isomorphic(fun: impl Fn() + Send + Sync + 'static) -> Self { let inner = inner::EffectInner::new(fun); inner.update_if_necessary(); Self { inner: Some(inner) } } } impl ToAnySubscriber for ImmediateEffect { fn to_any_subscriber(&self) -> AnySubscriber { const MSG: &str = "tried to set effect that has been stopped"; self.inner.as_ref().expect(MSG).to_any_subscriber() } } impl DefinedAt for ImmediateEffect { fn defined_at(&self) -> Option<&'static Location<'static>> { self.inner.as_ref()?.read().or_poisoned().defined_at() } } /// Defers any [ImmediateEffect]s from running until the end of the function. /// /// NOTE: this affects only [ImmediateEffect]s, not other effects. /// /// NOTE: this is rarely needed, but it is useful for example when multiple signals /// need to be updated atomically (for example a double-bound signal tree). pub fn batch<T>(f: impl FnOnce() -> T) -> T { struct ExecuteOnDrop; impl Drop for ExecuteOnDrop { fn drop(&mut self) { let effects = { let mut batch = inner::BATCH.write().or_poisoned(); batch.take().unwrap().into_inner().expect("lock poisoned") }; // TODO: Should we skip the effects if it's panicking? for effect in effects { effect.update_if_necessary(); } } } let mut execute_on_drop = None; { let mut batch = inner::BATCH.write().or_poisoned(); if batch.is_none() { execute_on_drop = Some(ExecuteOnDrop); } else { // Nested batching has no effect. } *batch = Some(batch.take().unwrap_or_default()); } let ret = f(); drop(execute_on_drop); ret } mod inner { use crate::{ graph::{ AnySource, AnySubscriber, ReactiveNode, ReactiveNodeState, SourceSet, Subscriber, ToAnySubscriber, WithObserver, }, log_warning, owner::Owner, traits::DefinedAt, }; use indexmap::IndexSet; use or_poisoned::OrPoisoned; use std::{ panic::Location, sync::{Arc, RwLock, Weak}, thread::{self, ThreadId}, }; /// Only the [super::batch] function ever writes to the outer RwLock. /// While the effects will write to the inner one. pub(super) static BATCH: RwLock<Option<RwLock<IndexSet<AnySubscriber>>>> = RwLock::new(None); /// Handles subscription logic for effects. /// /// To handle parallelism and recursion we assign ordered (1..) ids to each run. /// We only keep the sources tracked by the run with the highest id (the last one). /// /// We do this by: /// - Clearing the sources before every run, so the last one clears anything before it. /// - We stop tracking sources after the last run has completed. /// (A parent run will start before and end after a recursive child run.) /// - To handle parallelism with the last run, we only allow sources to be added by its thread. pub(super) struct EffectInner { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, owner: Owner, state: ReactiveNodeState, /// The number of effect runs in this 'batch'. /// Cleared when no runs are *ongoing* anymore. /// Used to assign ordered ids to each run, and to know when we can clear these values. run_count_start: usize, /// The number of effect runs that have completed in the current 'batch'. /// Cleared when no runs are *ongoing* anymore. /// Used to know when we can clear these values. run_done_count: usize, /// Given ordered ids (1..), the run with the highest id that has completed in this 'batch'. /// Cleared when no runs are *ongoing* anymore. /// Used to know whether the current run is the latest one. run_done_max: usize, /// The [ThreadId] of the run with the highest id. /// Used to prevent over-subscribing during parallel execution with the last run. /// /// ```text /// Thread 1: /// ------------------------- /// --- --- ======= /// /// Thread 2: /// ------------------------- /// ----------- /// ``` /// /// In the parallel example above, we can see why we need this. /// The last run is marked using `=`, but another run in the other thread might /// also be gathering sources. So we only allow the run from the correct [ThreadId] to push sources. last_run_thread_id: ThreadId, fun: Arc<dyn Fn() + Send + Sync>, sources: SourceSet, any_subscriber: AnySubscriber, } impl EffectInner { #[track_caller] pub fn new( fun: impl Fn() + Send + Sync + 'static, ) -> Arc<RwLock<EffectInner>> { let owner = Owner::new(); #[cfg(any(debug_assertions, leptos_debuginfo))] let defined_at = Location::caller(); Arc::new_cyclic(|weak| { let any_subscriber = AnySubscriber( weak.as_ptr() as usize, Weak::clone(weak) as Weak<dyn Subscriber + Send + Sync>, ); RwLock::new(EffectInner { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at, owner, state: ReactiveNodeState::Dirty, run_count_start: 0, run_done_count: 0, run_done_max: 0, last_run_thread_id: thread::current().id(), fun: Arc::new(fun), sources: SourceSet::new(), any_subscriber, }) }) } } impl ToAnySubscriber for Arc<RwLock<EffectInner>> { fn to_any_subscriber(&self) -> AnySubscriber { AnySubscriber( Arc::as_ptr(self) as usize, Arc::downgrade(self) as Weak<dyn Subscriber + Send + Sync>, ) } } impl ReactiveNode for RwLock<EffectInner> { fn mark_subscribers_check(&self) {} fn update_if_necessary(&self) -> bool { let state = { let guard = self.read().or_poisoned(); if guard.owner.paused() { return false; } guard.state }; let needs_update = match state { ReactiveNodeState::Clean => false, ReactiveNodeState::Check => { let sources = self.read().or_poisoned().sources.clone(); sources .into_iter() .any(|source| source.update_if_necessary()) } ReactiveNodeState::Dirty => true, }; { if let Some(batch) = &*BATCH.read().or_poisoned() { let mut batch = batch.write().or_poisoned(); let subscriber = self.read().or_poisoned().any_subscriber.clone(); batch.insert(subscriber); return needs_update; } } if needs_update { let mut guard = self.write().or_poisoned(); let owner = guard.owner.clone(); let any_subscriber = guard.any_subscriber.clone(); let fun = guard.fun.clone(); // New run has started. guard.run_count_start += 1; // We get a value for this run, the highest value will be what we keep the sources from. let recursion_count = guard.run_count_start; // We clear the sources before running the effect. // Note that this is tied to the ordering of the initial write lock acquisition // to ensure the last run is also the last to clear them. guard.sources.clear_sources(&any_subscriber); // Only this thread will be able to subscribe. guard.last_run_thread_id = thread::current().id(); if recursion_count > 2 { warn_excessive_recursion(&guard); } drop(guard); // We execute the effect. // Note that *this could happen in parallel across threads*. owner.with_cleanup(|| any_subscriber.with_observer(|| fun())); let mut guard = self.write().or_poisoned(); // This run has completed. guard.run_done_count += 1; // We update the done count. // Sources will only be added if recursion_done_max < recursion_count_start. // (Meaning the last run is not done yet.) guard.run_done_max = Ord::max(recursion_count, guard.run_done_max); // The same amount of runs has started and completed, // so we can clear everything up for next time. if guard.run_count_start == guard.run_done_count { guard.run_count_start = 0; guard.run_done_count = 0; guard.run_done_max = 0; // Can be left unchanged, it'll be set again next time. // guard.last_run_thread_id = thread::current().id(); } guard.state = ReactiveNodeState::Clean; } needs_update } fn mark_check(&self) { self.write().or_poisoned().state = ReactiveNodeState::Check; self.update_if_necessary(); } fn mark_dirty(&self) { self.write().or_poisoned().state = ReactiveNodeState::Dirty; self.update_if_necessary(); } } impl Subscriber for RwLock<EffectInner> { fn add_source(&self, source: AnySource) { let mut guard = self.write().or_poisoned(); if guard.run_done_max < guard.run_count_start && guard.last_run_thread_id == thread::current().id() { guard.sources.insert(source); } } fn clear_sources(&self, subscriber: &AnySubscriber) { self.write().or_poisoned().sources.clear_sources(subscriber); } } impl DefinedAt for EffectInner { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl std::fmt::Debug for EffectInner { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("EffectInner") .field("owner", &self.owner) .field("state", &self.state) .field("sources", &self.sources) .field("any_subscriber", &self.any_subscriber) .finish() } } fn warn_excessive_recursion(effect: &EffectInner) { const MSG: &str = "ImmediateEffect recursed more than once."; match effect.defined_at() { Some(defined_at) => { log_warning(format_args!("{MSG} Defined at: {defined_at}")); } None => { log_warning(format_args!("{MSG}")); } } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/graph/node.rs
reactive_graph/src/graph/node.rs
/// A node in the reactive graph. pub trait ReactiveNode { /// Notifies the source's dependencies that it has changed. fn mark_dirty(&self); /// Notifies the source's dependencies that it may have changed. fn mark_check(&self); /// Marks that all subscribers need to be checked. fn mark_subscribers_check(&self); /// Regenerates the value for this node, if needed, and returns whether /// it has actually changed or not. fn update_if_necessary(&self) -> bool; } /// The current state of a reactive node. #[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord)] pub enum ReactiveNodeState { /// The node is known to be clean: i.e., either none of its sources have changed, or its /// sources have changed but its value is unchanged and its dependencies do not need to change. Clean, /// The node may have changed, but it is not yet known whether it has actually changed. Check, /// The node's value has definitely changed, and subscribers will need to update. Dirty, }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/graph/source.rs
reactive_graph/src/graph/source.rs
use super::{node::ReactiveNode, AnySubscriber}; use crate::traits::{DefinedAt, IsDisposed}; use core::{fmt::Debug, hash::Hash}; use std::{panic::Location, sync::Weak}; /// Abstracts over the type of any reactive source. pub trait ToAnySource: IsDisposed { /// Converts this type to its type-erased equivalent. fn to_any_source(&self) -> AnySource; } /// Describes the behavior of any source of reactivity (like a signal, trigger, or memo.) pub trait Source: ReactiveNode { /// Adds a subscriber to this source's list of dependencies. fn add_subscriber(&self, subscriber: AnySubscriber); /// Removes a subscriber from this source's list of dependencies. fn remove_subscriber(&self, subscriber: &AnySubscriber); /// Remove all subscribers from this source's list of dependencies. fn clear_subscribers(&self); } /// A weak reference to any reactive source node. #[derive(Clone)] pub struct AnySource( pub(crate) usize, pub(crate) Weak<dyn Source + Send + Sync>, #[cfg(any(debug_assertions, leptos_debuginfo))] pub(crate) &'static Location<'static>, ); impl DefinedAt for AnySource { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.2) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl Debug for AnySource { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_tuple("AnySource").field(&self.0).finish() } } impl Hash for AnySource { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { self.0.hash(state); } } impl PartialEq for AnySource { fn eq(&self, other: &Self) -> bool { self.0 == other.0 } } impl Eq for AnySource {} impl IsDisposed for AnySource { #[inline(always)] fn is_disposed(&self) -> bool { false } } impl ToAnySource for AnySource { fn to_any_source(&self) -> AnySource { self.clone() } } impl Source for AnySource { fn add_subscriber(&self, subscriber: AnySubscriber) { if let Some(inner) = self.1.upgrade() { inner.add_subscriber(subscriber) } } fn remove_subscriber(&self, subscriber: &AnySubscriber) { if let Some(inner) = self.1.upgrade() { inner.remove_subscriber(subscriber) } } fn clear_subscribers(&self) { if let Some(inner) = self.1.upgrade() { inner.clear_subscribers(); } } } impl ReactiveNode for AnySource { fn mark_dirty(&self) { if let Some(inner) = self.1.upgrade() { inner.mark_dirty() } } fn mark_subscribers_check(&self) { if let Some(inner) = self.1.upgrade() { inner.mark_subscribers_check() } } fn update_if_necessary(&self) -> bool { if let Some(inner) = self.1.upgrade() { inner.update_if_necessary() } else { false } } fn mark_check(&self) { if let Some(inner) = self.1.upgrade() { inner.mark_check() } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/graph/subscriber.rs
reactive_graph/src/graph/subscriber.rs
use super::{node::ReactiveNode, AnySource}; #[cfg(debug_assertions)] use crate::diagnostics::SpecialNonReactiveZone; use core::{fmt::Debug, hash::Hash}; use std::{cell::RefCell, mem, sync::Weak}; thread_local! { static OBSERVER: RefCell<Option<ObserverState>> = const { RefCell::new(None) }; } #[derive(Debug)] struct ObserverState { subscriber: AnySubscriber, untracked: bool, } /// The current reactive observer. /// /// The observer is whatever reactive node is currently listening for signals that need to be /// tracked. For example, if an effect is running, that effect is the observer, which means it will /// subscribe to changes in any signals that are read. pub struct Observer; #[derive(Debug)] struct SetObserverOnDrop(Option<AnySubscriber>); impl Drop for SetObserverOnDrop { fn drop(&mut self) { Observer::set(self.0.take()); } } impl Observer { /// Returns the current observer, if any. pub fn get() -> Option<AnySubscriber> { OBSERVER.with_borrow(|obs| { obs.as_ref().and_then(|obs| { if obs.untracked { None } else { Some(obs.subscriber.clone()) } }) }) } pub(crate) fn is(observer: &AnySubscriber) -> bool { OBSERVER.with_borrow(|o| { o.as_ref().map(|o| &o.subscriber) == Some(observer) }) } fn take() -> SetObserverOnDrop { SetObserverOnDrop( OBSERVER.with_borrow_mut(Option::take).map(|o| o.subscriber), ) } fn set(observer: Option<AnySubscriber>) { OBSERVER.with_borrow_mut(|o| { *o = observer.map(|subscriber| ObserverState { subscriber, untracked: false, }) }); } fn replace(observer: Option<AnySubscriber>) -> SetObserverOnDrop { SetObserverOnDrop( OBSERVER .with(|o| { mem::replace( &mut *o.borrow_mut(), observer.map(|subscriber| ObserverState { subscriber, untracked: false, }), ) }) .map(|o| o.subscriber), ) } fn replace_untracked(observer: Option<AnySubscriber>) -> SetObserverOnDrop { SetObserverOnDrop( OBSERVER .with(|o| { mem::replace( &mut *o.borrow_mut(), observer.map(|subscriber| ObserverState { subscriber, untracked: true, }), ) }) .map(|o| o.subscriber), ) } } /// Suspends reactive tracking while running the given function. /// /// This can be used to isolate parts of the reactive graph from one another. /// /// ```rust /// # use reactive_graph::computed::*; /// # use reactive_graph::signal::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # use reactive_graph::prelude::*; /// # use reactive_graph::graph::untrack; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// let (a, set_a) = signal(0); /// let (b, set_b) = signal(0); /// let c = Memo::new(move |_| { /// // this memo will *only* update when `a` changes /// a.get() + untrack(move || b.get()) /// }); /// /// assert_eq!(c.get(), 0); /// set_a.set(1); /// assert_eq!(c.get(), 1); /// set_b.set(1); /// // hasn't updated, because we untracked before reading b /// assert_eq!(c.get(), 1); /// set_a.set(2); /// assert_eq!(c.get(), 3); /// # }); /// ``` #[track_caller] pub fn untrack<T>(fun: impl FnOnce() -> T) -> T { #[cfg(debug_assertions)] let _warning_guard = crate::diagnostics::SpecialNonReactiveZone::enter(); let _prev = Observer::take(); fun() } #[doc(hidden)] #[track_caller] pub fn untrack_with_diagnostics<T>(fun: impl FnOnce() -> T) -> T { let _prev = Observer::take(); fun() } /// Converts a [`Subscriber`] to a type-erased [`AnySubscriber`]. pub trait ToAnySubscriber { /// Converts this type to its type-erased equivalent. fn to_any_subscriber(&self) -> AnySubscriber; } /// Any type that can track reactive values (like an effect or a memo). pub trait Subscriber: ReactiveNode { /// Adds a subscriber to this subscriber's list of dependencies. fn add_source(&self, source: AnySource); /// Clears the set of sources for this subscriber. fn clear_sources(&self, subscriber: &AnySubscriber); } /// A type-erased subscriber. #[derive(Clone)] pub struct AnySubscriber(pub usize, pub Weak<dyn Subscriber + Send + Sync>); impl ToAnySubscriber for AnySubscriber { fn to_any_subscriber(&self) -> AnySubscriber { self.clone() } } impl Subscriber for AnySubscriber { fn add_source(&self, source: AnySource) { if let Some(inner) = self.1.upgrade() { inner.add_source(source); } } fn clear_sources(&self, subscriber: &AnySubscriber) { if let Some(inner) = self.1.upgrade() { inner.clear_sources(subscriber); } } } impl ReactiveNode for AnySubscriber { fn mark_dirty(&self) { if let Some(inner) = self.1.upgrade() { inner.mark_dirty() } } fn mark_subscribers_check(&self) { if let Some(inner) = self.1.upgrade() { inner.mark_subscribers_check() } } fn update_if_necessary(&self) -> bool { if let Some(inner) = self.1.upgrade() { inner.update_if_necessary() } else { false } } fn mark_check(&self) { if let Some(inner) = self.1.upgrade() { inner.mark_check() } } } /// Runs code with some subscriber as the thread-local [`Observer`]. pub trait WithObserver { /// Runs the given function with this subscriber as the thread-local [`Observer`]. fn with_observer<T>(&self, fun: impl FnOnce() -> T) -> T; /// Runs the given function with this subscriber as the thread-local [`Observer`], /// but without tracking dependencies. fn with_observer_untracked<T>(&self, fun: impl FnOnce() -> T) -> T; } impl WithObserver for AnySubscriber { fn with_observer<T>(&self, fun: impl FnOnce() -> T) -> T { let _prev = Observer::replace(Some(self.clone())); fun() } fn with_observer_untracked<T>(&self, fun: impl FnOnce() -> T) -> T { #[cfg(debug_assertions)] let _guard = SpecialNonReactiveZone::enter(); let _prev = Observer::replace_untracked(Some(self.clone())); fun() } } impl WithObserver for Option<AnySubscriber> { fn with_observer<T>(&self, fun: impl FnOnce() -> T) -> T { let _prev = Observer::replace(self.clone()); fun() } fn with_observer_untracked<T>(&self, fun: impl FnOnce() -> T) -> T { #[cfg(debug_assertions)] let _guard = SpecialNonReactiveZone::enter(); let _prev = Observer::replace_untracked(self.clone()); fun() } } impl Debug for AnySubscriber { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_tuple("AnySubscriber").field(&self.0).finish() } } impl Hash for AnySubscriber { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { self.0.hash(state); } } impl PartialEq for AnySubscriber { fn eq(&self, other: &Self) -> bool { self.0 == other.0 } } impl Eq for AnySubscriber {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/graph/sets.rs
reactive_graph/src/graph/sets.rs
//! Types that hold the set of sources or subscribers affiliated with a reactive node. //! //! At the moment, these are implemented as linear maps built on a `Vec<_>`. This is for the sake //! of minimizing binary size as much as possible, and on the assumption that the M:N relationship //! between sources and subscribers usually consists of fairly small numbers, such that the cost of //! a linear search is not significantly more expensive than a hash and lookup. use super::{AnySource, AnySubscriber, Source}; use indexmap::IndexSet; use rustc_hash::FxHasher; use std::{hash::BuildHasherDefault, mem}; type FxIndexSet<T> = IndexSet<T, BuildHasherDefault<FxHasher>>; #[derive(Default, Clone, Debug)] pub struct SourceSet(FxIndexSet<AnySource>); impl SourceSet { pub fn new() -> Self { Self(Default::default()) } pub fn insert(&mut self, source: AnySource) { self.0.insert(source); } pub fn remove(&mut self, source: &AnySource) { self.0.shift_remove(source); } pub fn take(&mut self) -> FxIndexSet<AnySource> { mem::take(&mut self.0) } pub fn len(&self) -> usize { self.0.len() } pub fn clear_sources(&mut self, subscriber: &AnySubscriber) { for source in self.take() { source.remove_subscriber(subscriber); } } } impl IntoIterator for SourceSet { type Item = AnySource; type IntoIter = <FxIndexSet<AnySource> as IntoIterator>::IntoIter; fn into_iter(self) -> Self::IntoIter { self.0.into_iter() } } impl<'a> IntoIterator for &'a SourceSet { type Item = &'a AnySource; type IntoIter = <&'a FxIndexSet<AnySource> as IntoIterator>::IntoIter; fn into_iter(self) -> Self::IntoIter { self.0.iter() } } #[derive(Debug, Default, Clone)] pub struct SubscriberSet(FxIndexSet<AnySubscriber>); impl SubscriberSet { pub fn new() -> Self { Self(FxIndexSet::with_capacity_and_hasher(2, Default::default())) } pub fn subscribe(&mut self, subscriber: AnySubscriber) { self.0.insert(subscriber); } pub fn unsubscribe(&mut self, subscriber: &AnySubscriber) { // note: do not use `.swap_remove()` here. // using `.remove()` is slower because it shifts other items // but it maintains the order of the subscribers, which is important // to correctness when you're using this to drive something like a UI, // which can have nested effects, where the inner one assumes the outer // has already run (for example, an outer effect that checks .is_some(), // and an inner effect that unwraps) self.0.shift_remove(subscriber); } pub fn take(&mut self) -> FxIndexSet<AnySubscriber> { mem::take(&mut self.0) } pub fn len(&self) -> usize { self.0.len() } } impl IntoIterator for SubscriberSet { type Item = AnySubscriber; type IntoIter = <FxIndexSet<AnySubscriber> as IntoIterator>::IntoIter; fn into_iter(self) -> Self::IntoIter { self.0.into_iter() } } impl<'a> IntoIterator for &'a SubscriberSet { type Item = &'a AnySubscriber; type IntoIter = <&'a FxIndexSet<AnySubscriber> as IntoIterator>::IntoIter; fn into_iter(self) -> Self::IntoIter { self.0.iter() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/actions/multi_action.rs
reactive_graph/src/actions/multi_action.rs
use crate::{ diagnostics::is_suppressing_resource_load, owner::{ArenaItem, FromLocal, LocalStorage, Storage, SyncStorage}, signal::{ArcReadSignal, ArcRwSignal, ReadSignal, RwSignal}, traits::{DefinedAt, Dispose, GetUntracked, Set, Update}, unwrap_signal, }; use std::{fmt::Debug, future::Future, panic::Location, pin::Pin, sync::Arc}; /// An action that synchronizes multiple imperative `async` calls to the reactive system, /// tracking the progress of each one. /// /// Where an [`Action`](super::Action) fires a single call, a `MultiAction` allows you to /// keep track of multiple in-flight actions. /// /// If you’re trying to load data by running an `async` function reactively, you probably /// want to use an [`AsyncDerived`](crate::computed::AsyncDerived) instead. /// If you’re trying to occasionally run an `async` function in response to something /// like a user adding a task to a todo list, you’re in the right place. /// /// The reference-counted, `Clone` (but not `Copy` version of a `MultiAction` is an [`ArcMultiAction`]. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let add_todo = MultiAction::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// add_todo.dispatch("Buy milk".to_string()); /// add_todo.dispatch("???".to_string()); /// add_todo.dispatch("Profit!!!".to_string()); /// /// let submissions = add_todo.submissions(); /// assert_eq!(submissions.with(Vec::len), 3); /// # }); /// ``` pub struct MultiAction<I, O, S = SyncStorage> { inner: ArenaItem<ArcMultiAction<I, O>, S>, #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, } impl<I, O, S> Dispose for MultiAction<I, O, S> { fn dispose(self) { self.inner.dispose() } } impl<I, O, S> DefinedAt for MultiAction<I, O, S> where I: 'static, O: 'static, { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<I, O, S> Copy for MultiAction<I, O, S> where I: 'static, O: 'static, { } impl<I, O, S> Clone for MultiAction<I, O, S> where I: 'static, O: 'static, { fn clone(&self) -> Self { *self } } impl<I, O> MultiAction<I, O> where I: Send + Sync + 'static, O: Send + Sync + 'static, { /// Creates a new multi-action. /// /// The input to the `async` function should always be a single value, /// but it can be of any type. The argument is always passed by reference to the /// function, because it is stored in [Submission::input] as well. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// // if there's a single argument, just use that /// let action1 = MultiAction::new(|input: &String| { /// let input = input.clone(); /// async move { todo!() } /// }); /// /// // if there are no arguments, use the unit type `()` /// let action2 = MultiAction::new(|input: &()| async { todo!() }); /// /// // if there are multiple arguments, use a tuple /// let action3 = /// MultiAction::new(|input: &(usize, String)| async { todo!() }); /// # }); /// ``` #[track_caller] pub fn new<Fut>( action_fn: impl Fn(&I) -> Fut + Send + Sync + 'static, ) -> Self where Fut: Future<Output = O> + Send + 'static, { Self { inner: ArenaItem::new_with_storage(ArcMultiAction::new(action_fn)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), } } } impl<I, O, S> MultiAction<I, O, S> where I: Send + Sync + 'static, O: Send + Sync + 'static, S: Storage<ArcMultiAction<I, O>>, { /// Calls the `async` function with a reference to the input type as its argument. /// /// This can be called any number of times: each submission will be dispatched, running /// concurrently, and its status can be checked via the /// [`submissions()`](MultiAction::submissions) signal. /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let add_todo = MultiAction::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// let submissions = add_todo.submissions(); /// let pending_submissions = move || { /// submissions.with(|subs| subs.iter().filter(|sub| sub.pending().get()).count()) /// }; /// /// add_todo.dispatch("Buy milk".to_string()); /// assert_eq!(submissions.with(Vec::len), 1); /// assert_eq!(pending_submissions(), 1); /// /// add_todo.dispatch("???".to_string()); /// add_todo.dispatch("Profit!!!".to_string()); /// /// assert_eq!(submissions.with(Vec::len), 3); /// assert_eq!(pending_submissions(), 3); /// /// // when submissions resolve, they are not removed from the set /// // however, their `pending` signal is now `false`, and this can be used to filter them /// # any_spawner::Executor::tick().await; /// assert_eq!(submissions.with(Vec::len), 3); /// assert_eq!(pending_submissions(), 0); /// # }); /// ``` pub fn dispatch(&self, input: I) { if !is_suppressing_resource_load() { self.inner.try_with_value(|inner| inner.dispatch(input)); } } /// Synchronously adds a submission with the given value. /// /// This takes the output value, rather than the input, because it is adding a result, not an /// input. /// /// This can be useful for use cases like handling errors, where the error can already be known /// on the client side. /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let add_todo = MultiAction::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// let submissions = add_todo.submissions(); /// let pending_submissions = move || { /// submissions.with(|subs| subs.iter().filter(|sub| sub.pending().get()).count()) /// }; /// /// add_todo.dispatch("Buy milk".to_string()); /// assert_eq!(submissions.with(Vec::len), 1); /// assert_eq!(pending_submissions(), 1); /// /// add_todo.dispatch_sync(42); /// /// assert_eq!(submissions.with(Vec::len), 2); /// assert_eq!(pending_submissions(), 1); /// # }); /// ``` pub fn dispatch_sync(&self, value: O) { self.inner .try_with_value(|inner| inner.dispatch_sync(value)); } } impl<I, O> MultiAction<I, O> where I: Send + Sync + 'static, O: Send + Sync + 'static, { /// The set of all submissions to this multi-action. /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let add_todo = MultiAction::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// let submissions = add_todo.submissions(); /// /// add_todo.dispatch("Buy milk".to_string()); /// add_todo.dispatch("???".to_string()); /// add_todo.dispatch("Profit!!!".to_string()); /// /// assert_eq!(submissions.with(Vec::len), 3); /// # }); /// ``` pub fn submissions(&self) -> ReadSignal<Vec<ArcSubmission<I, O>>> { self.inner .try_with_value(|inner| inner.submissions()) .unwrap_or_else(unwrap_signal!(self)) .into() } } impl<I, O, S> MultiAction<I, O, S> where I: 'static, O: 'static, S: Storage<ArcMultiAction<I, O>> + Storage<ArcReadSignal<Vec<ArcSubmission<I, O>>>>, { /// How many times an action has successfully resolved. /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let add_todo = MultiAction::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// let version = add_todo.version(); /// /// add_todo.dispatch("Buy milk".to_string()); /// add_todo.dispatch("???".to_string()); /// add_todo.dispatch("Profit!!!".to_string()); /// /// assert_eq!(version.get(), 0); /// # any_spawner::Executor::tick().await; /// /// // when they've all resolved /// assert_eq!(version.get(), 3); /// # }); /// ``` pub fn version(&self) -> RwSignal<usize> { self.inner .try_with_value(|inner| inner.version()) .unwrap_or_else(unwrap_signal!(self)) .into() } } /// An action that synchronizes multiple imperative `async` calls to the reactive system, /// tracking the progress of each one. /// /// Where an [`Action`](super::Action) fires a single call, a `MultiAction` allows you to /// keep track of multiple in-flight actions. /// /// If you’re trying to load data by running an `async` function reactively, you probably /// want to use an [`AsyncDerived`](crate::computed::AsyncDerived) instead. /// If you’re trying to occasionally run an `async` function in response to something /// like a user adding a task to a todo list, you’re in the right place. /// /// The arena-allocated, `Copy` version of an `ArcMultiAction` is a [`MultiAction`]. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let add_todo = ArcMultiAction::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// add_todo.dispatch("Buy milk".to_string()); /// add_todo.dispatch("???".to_string()); /// add_todo.dispatch("Profit!!!".to_string()); /// /// let submissions = add_todo.submissions(); /// assert_eq!(submissions.with(Vec::len), 3); /// # }); /// ``` pub struct ArcMultiAction<I, O> { version: ArcRwSignal<usize>, submissions: ArcRwSignal<Vec<ArcSubmission<I, O>>>, #[allow(clippy::complexity)] action_fn: Arc< dyn Fn(&I) -> Pin<Box<dyn Future<Output = O> + Send>> + Send + Sync, >, } impl<I, O> Debug for ArcMultiAction<I, O> where I: 'static, O: 'static, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("ArcMultiAction") .field("version", &self.version) .field("submissions", &self.submissions) .finish() } } impl<I, O> Clone for ArcMultiAction<I, O> where I: 'static, O: 'static, { fn clone(&self) -> Self { Self { version: self.version.clone(), submissions: self.submissions.clone(), action_fn: Arc::clone(&self.action_fn), } } } impl<I, O> ArcMultiAction<I, O> { /// Creates a new multi-action. /// /// The input to the `async` function should always be a single value, /// but it can be of any type. The argument is always passed by reference to the /// function, because it is stored in [Submission::input] as well. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// // if there's a single argument, just use that /// let action1 = ArcMultiAction::new(|input: &String| { /// let input = input.clone(); /// async move { todo!() } /// }); /// /// // if there are no arguments, use the unit type `()` /// let action2 = ArcMultiAction::new(|input: &()| async { todo!() }); /// /// // if there are multiple arguments, use a tuple /// let action3 = /// ArcMultiAction::new(|input: &(usize, String)| async { todo!() }); /// # }); /// ``` #[track_caller] pub fn new<Fut>( action_fn: impl Fn(&I) -> Fut + Send + Sync + 'static, ) -> Self where Fut: Future<Output = O> + Send + 'static, { let action_fn = Arc::new(move |input: &I| { let fut = action_fn(input); Box::pin(fut) as Pin<Box<dyn Future<Output = O> + Send>> }); Self { version: ArcRwSignal::new(0), submissions: ArcRwSignal::new(Vec::new()), action_fn, } } } impl<I, O> ArcMultiAction<I, O> where I: Send + Sync + 'static, O: Send + Sync + 'static, { /// Calls the `async` function with a reference to the input type as its argument. /// /// This can be called any number of times: each submission will be dispatched, running /// concurrently, and its status can be checked via the /// [`submissions()`](MultiAction::submissions) signal. /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let add_todo = ArcMultiAction::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// let submissions = add_todo.submissions(); /// let pending_submissions = { /// let submissions = submissions.clone(); /// move || { /// submissions.with(|subs| subs.iter().filter(|sub| sub.pending().get()).count()) /// } /// }; /// /// add_todo.dispatch("Buy milk".to_string()); /// assert_eq!(submissions.with(Vec::len), 1); /// assert_eq!(pending_submissions(), 1); /// /// add_todo.dispatch("???".to_string()); /// add_todo.dispatch("Profit!!!".to_string()); /// /// assert_eq!(submissions.with(Vec::len), 3); /// assert_eq!(pending_submissions(), 3); /// /// // when submissions resolve, they are not removed from the set /// // however, their `pending` signal is now `false`, and this can be used to filter them /// # any_spawner::Executor::tick().await; /// assert_eq!(submissions.with(Vec::len), 3); /// assert_eq!(pending_submissions(), 0); /// # }); /// ``` pub fn dispatch(&self, input: I) { if !is_suppressing_resource_load() { let fut = (self.action_fn)(&input); let submission = ArcSubmission { input: ArcRwSignal::new(Some(input)), value: ArcRwSignal::new(None), pending: ArcRwSignal::new(true), canceled: ArcRwSignal::new(false), }; self.submissions .try_update(|subs| subs.push(submission.clone())); let version = self.version.clone(); crate::spawn(async move { let new_value = fut.await; let canceled = submission.canceled.get_untracked(); if !canceled { submission.value.try_set(Some(new_value)); } submission.input.try_set(None); submission.pending.try_set(false); version.try_update(|n| *n += 1); }) } } /// Synchronously adds a submission with the given value. /// /// This takes the output value, rather than the input, because it is adding a result, not an /// input. /// /// This can be useful for use cases like handling errors, where the error can already be known /// on the client side. /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let add_todo = ArcMultiAction::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// let submissions = add_todo.submissions(); /// let pending_submissions = { /// let submissions = submissions.clone(); /// move || { /// submissions.with(|subs| subs.iter().filter(|sub| sub.pending().get()).count()) /// } /// }; /// /// add_todo.dispatch("Buy milk".to_string()); /// assert_eq!(submissions.with(Vec::len), 1); /// assert_eq!(pending_submissions(), 1); /// /// add_todo.dispatch_sync(42); /// /// assert_eq!(submissions.with(Vec::len), 2); /// assert_eq!(pending_submissions(), 1); /// # }); /// ``` pub fn dispatch_sync(&self, value: O) { let submission = ArcSubmission { input: ArcRwSignal::new(None), value: ArcRwSignal::new(Some(value)), pending: ArcRwSignal::new(false), canceled: ArcRwSignal::new(false), }; self.submissions .try_update(|subs| subs.push(submission.clone())); self.version.try_update(|n| *n += 1); } } impl<I, O> ArcMultiAction<I, O> { /// The set of all submissions to this multi-action. /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let add_todo = ArcMultiAction::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// let submissions = add_todo.submissions(); /// /// add_todo.dispatch("Buy milk".to_string()); /// add_todo.dispatch("???".to_string()); /// add_todo.dispatch("Profit!!!".to_string()); /// /// assert_eq!(submissions.with(Vec::len), 3); /// # }); /// ``` pub fn submissions(&self) -> ArcReadSignal<Vec<ArcSubmission<I, O>>> { self.submissions.read_only() } /// How many times an action has successfully resolved. /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let add_todo = ArcMultiAction::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// let version = add_todo.version(); /// /// add_todo.dispatch("Buy milk".to_string()); /// add_todo.dispatch("???".to_string()); /// add_todo.dispatch("Profit!!!".to_string()); /// /// assert_eq!(version.get(), 0); /// # any_spawner::Executor::tick().await; /// /// // when they've all resolved /// assert_eq!(version.get(), 3); /// # }); /// ``` pub fn version(&self) -> ArcRwSignal<usize> { self.version.clone() } } /// An action that has been submitted by dispatching it to a [`MultiAction`]. #[derive(Debug, PartialEq, Eq, Hash)] pub struct ArcSubmission<I, O> { /// The current argument that was dispatched to the `async` function. /// `Some` while we are waiting for it to resolve, `None` if it has resolved. input: ArcRwSignal<Option<I>>, /// The most recent return value of the `async` function. value: ArcRwSignal<Option<O>>, pending: ArcRwSignal<bool>, /// Controls this submission has been canceled. canceled: ArcRwSignal<bool>, } impl<I, O> ArcSubmission<I, O> where I: 'static, O: 'static, { /// The current argument that was dispatched to the `async` function. /// `Some` while we are waiting for it to resolve, `None` if it has resolved. #[track_caller] pub fn input(&self) -> ArcReadSignal<Option<I>> { self.input.read_only() } /// The most recent return value of the `async` function. #[track_caller] pub fn value(&self) -> ArcReadSignal<Option<O>> { self.value.read_only() } /// Whether this submision is still waiting to resolve. #[track_caller] pub fn pending(&self) -> ArcReadSignal<bool> { self.pending.read_only() } /// Whether this submission has been canceled. #[track_caller] pub fn canceled(&self) -> ArcReadSignal<bool> { self.canceled.read_only() } /// Cancels the submission. This will not necessarily prevent the `Future` /// from continuing to run, but it will update the returned value. #[track_caller] pub fn cancel(&self) { // TODO if we set these up to race against a cancel signal, we could actually drop the // futures self.canceled.try_set(true); } } impl<I, O> Clone for ArcSubmission<I, O> { fn clone(&self) -> Self { Self { input: self.input.clone(), value: self.value.clone(), pending: self.pending.clone(), canceled: self.canceled.clone(), } } } /// An action that has been submitted by dispatching it to a [`MultiAction`]. #[derive(Debug, PartialEq, Eq, Hash)] pub struct Submission<I, O, S = SyncStorage> where I: 'static, O: 'static, { /// The current argument that was dispatched to the `async` function. /// `Some` while we are waiting for it to resolve, `None` if it has resolved. input: RwSignal<Option<I>, S>, /// The most recent return value of the `async` function. value: RwSignal<Option<O>, S>, pending: RwSignal<bool>, /// Controls this submission has been canceled. canceled: RwSignal<bool>, } impl<I, O> From<ArcSubmission<I, O>> for Submission<I, O> where I: Send + Sync + 'static, O: Send + Sync + 'static, { fn from(value: ArcSubmission<I, O>) -> Self { let ArcSubmission { input, value, pending, canceled, } = value; Self { input: input.into(), value: value.into(), pending: pending.into(), canceled: canceled.into(), } } } impl<I, O> FromLocal<ArcSubmission<I, O>> for Submission<I, O, LocalStorage> where I: 'static, O: 'static, { fn from_local(value: ArcSubmission<I, O>) -> Self { let ArcSubmission { input, value, pending, canceled, } = value; Self { input: RwSignal::from_local(input), value: RwSignal::from_local(value), pending: pending.into(), canceled: canceled.into(), } } } impl<I, O, S> Submission<I, O, S> where S: Storage<ArcRwSignal<Option<I>>> + Storage<ArcReadSignal<Option<I>>>, { /// The current argument that was dispatched to the `async` function. /// `Some` while we are waiting for it to resolve, `None` if it has resolved. #[track_caller] pub fn input(&self) -> ReadSignal<Option<I>, S> { self.input.read_only() } } impl<I, O, S> Submission<I, O, S> where S: Storage<ArcRwSignal<Option<O>>> + Storage<ArcReadSignal<Option<O>>>, { /// The most recent return value of the `async` function. #[track_caller] pub fn value(&self) -> ReadSignal<Option<O>, S> { self.value.read_only() } } impl<I, O, S> Submission<I, O, S> { /// Whether this submision is still waiting to resolve. #[track_caller] pub fn pending(&self) -> ReadSignal<bool> { self.pending.read_only() } /// Whether this submission has been canceled. #[track_caller] pub fn canceled(&self) -> ReadSignal<bool> { self.canceled.read_only() } /// Cancels the submission. This will not necessarily prevent the `Future` /// from continuing to run, but it will update the returned value. #[track_caller] pub fn cancel(&self) { self.canceled.try_set(true); } } impl<I, O, S> Clone for Submission<I, O, S> { fn clone(&self) -> Self { *self } } impl<I, O, S> Copy for Submission<I, O, S> {}
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/actions/mod.rs
reactive_graph/src/actions/mod.rs
//! Reactive primitives to asynchronously update some value. mod action; mod multi_action; pub use action::*; pub use multi_action::*;
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/actions/action.rs
reactive_graph/src/actions/action.rs
use crate::{ computed::{ArcMemo, Memo, ScopedFuture}, diagnostics::is_suppressing_resource_load, graph::untrack, owner::{ArcStoredValue, ArenaItem, Owner}, send_wrapper_ext::SendOption, signal::{ArcMappedSignal, ArcRwSignal, MappedSignal, RwSignal}, traits::{DefinedAt, Dispose, Get, GetUntracked, GetValue, Update, Write}, unwrap_signal, }; use any_spawner::Executor; use futures::{channel::oneshot, select, FutureExt}; use send_wrapper::SendWrapper; use std::{ future::Future, ops::{Deref, DerefMut}, panic::Location, pin::Pin, sync::Arc, }; /// An action runs some asynchronous code when you dispatch a new value to it, and gives you /// reactive access to the result. /// /// Actions are intended for mutating or updating data, not for loading data. If you find yourself /// creating an action and immediately dispatching a value to it, this is probably the wrong /// primitive. /// /// The arena-allocated, `Copy` version of an `ArcAction` is an [`Action`]. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let save_data = ArcAction::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// // the argument currently running /// let input = save_data.input(); /// // the most recent returned result /// let result_of_call = save_data.value(); /// // whether the call is pending /// let pending = save_data.pending(); /// // how many times the action has run /// // useful for reactively updating something else in response to a `dispatch` and response /// let version = save_data.version(); /// /// // before we do anything /// assert_eq!(input.get(), None); // no argument yet /// assert_eq!(pending.get(), false); // isn't pending a response /// assert_eq!(result_of_call.get(), None); // there's no "last value" /// assert_eq!(version.get(), 0); /// /// // dispatch the action /// save_data.dispatch("My todo".to_string()); /// /// // when we're making the call /// assert_eq!(input.get(), Some("My todo".to_string())); /// assert_eq!(pending.get(), true); // is pending /// assert_eq!(result_of_call.get(), None); // has not yet gotten a response /// /// # any_spawner::Executor::tick().await; /// /// // after call has resolved /// assert_eq!(input.get(), None); // input clears out after resolved /// assert_eq!(pending.get(), false); // no longer pending /// assert_eq!(result_of_call.get(), Some(42)); /// assert_eq!(version.get(), 1); /// # }); /// ``` /// /// The input to the `async` function should always be a single value, /// but it can be of any type. The argument is always passed by reference to the /// function, because it is stored in [Action::input] as well. /// /// ```rust /// # use reactive_graph::actions::*; /// // if there's a single argument, just use that /// let action1 = ArcAction::new(|input: &String| { /// let input = input.clone(); /// async move { todo!() } /// }); /// /// // if there are no arguments, use the unit type `()` /// let action2 = ArcAction::new(|input: &()| async { todo!() }); /// /// // if there are multiple arguments, use a tuple /// let action3 = ArcAction::new(|input: &(usize, String)| async { todo!() }); /// ``` pub struct ArcAction<I, O> { in_flight: ArcRwSignal<usize>, input: ArcRwSignal<SendOption<I>>, value: ArcRwSignal<SendOption<O>>, version: ArcRwSignal<usize>, dispatched: ArcStoredValue<usize>, #[allow(clippy::complexity)] action_fn: Arc< dyn Fn(&I) -> Pin<Box<dyn Future<Output = O> + Send>> + Send + Sync, >, #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, } impl<I, O> Clone for ArcAction<I, O> { fn clone(&self) -> Self { Self { in_flight: self.in_flight.clone(), input: self.input.clone(), value: self.value.clone(), version: self.version.clone(), dispatched: self.dispatched.clone(), action_fn: self.action_fn.clone(), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, } } } impl<I, O> ArcAction<I, O> where I: 'static, O: 'static, { /// Creates a new action. This is lazy: it does not run the action function until some value /// is dispatched. /// /// The constructor takes a function which will create a new `Future` from some input data. /// When the action is dispatched, this `action_fn` will run, and the `Future` it returns will /// be spawned. /// /// The `action_fn` must be `Send + Sync` so that the `ArcAction` is `Send + Sync`. The /// `Future` must be `Send` so that it can be moved across threads by the async executor as /// needed. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// let act = ArcAction::new(|n: &u8| { /// let n = n.to_owned(); /// async move { n * 2 } /// }); /// /// act.dispatch(3); /// assert_eq!(act.input().get(), Some(3)); /// /// // Remember that async functions already return a future if they are /// // not `await`ed. You can save keystrokes by leaving out the `async move` /// /// let act2 = Action::new(|n: &String| yell(n.to_owned())); /// act2.dispatch(String::from("i'm in a doctest")); /// # tokio::time::sleep(std::time::Duration::from_millis(10)).await; /// /// // after it resolves /// assert_eq!(act2.value().get(), Some("I'M IN A DOCTEST".to_string())); /// /// async fn yell(n: String) -> String { /// n.to_uppercase() /// } /// # }); /// ``` #[track_caller] pub fn new<F, Fu>(action_fn: F) -> Self where F: Fn(&I) -> Fu + Send + Sync + 'static, Fu: Future<Output = O> + Send + 'static, I: Send + Sync, O: Send + Sync, { Self::new_with_value(None, action_fn) } /// Creates a new action, initializing it with the given value. /// /// This is lazy: it does not run the action function until some value is dispatched. /// /// The constructor takes a function which will create a new `Future` from some input data. /// When the action is dispatched, this `action_fn` will run, and the `Future` it returns will /// be spawned. /// /// The `action_fn` must be `Send + Sync` so that the `ArcAction` is `Send + Sync`. The /// `Future` must be `Send` so that it can be moved across threads by the async executor as /// needed. #[track_caller] pub fn new_with_value<F, Fu>(value: Option<O>, action_fn: F) -> Self where F: Fn(&I) -> Fu + Send + Sync + 'static, Fu: Future<Output = O> + Send + 'static, I: Send + Sync, O: Send + Sync, { let owner = Owner::current().unwrap_or_default(); ArcAction { in_flight: ArcRwSignal::new(0), input: ArcRwSignal::new(SendOption::new(None)), value: ArcRwSignal::new(SendOption::new(value)), version: Default::default(), dispatched: Default::default(), action_fn: Arc::new(move |input| { Box::pin(owner.with(|| { ScopedFuture::new_untracked(untrack(|| action_fn(input))) })) }), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), } } /// Clears the value of the action, setting its current value to `None`. /// /// This has no other effect: i.e., it will not cancel in-flight actions, set the /// input, etc. #[track_caller] pub fn clear(&self) { if let Some(mut guard) = self.value.try_write() { **guard = None; } } } /// A handle that allows aborting an in-flight action. It is returned from [`Action::dispatch`] or /// [`ArcAction::dispatch`]. #[derive(Debug)] pub struct ActionAbortHandle(oneshot::Sender<()>); impl ActionAbortHandle { /// Aborts the action. /// /// This will cause the dispatched task to complete, without updating the action's value. The /// dispatched action's `Future` will no longer be polled. This does not guarantee that side /// effects created by that `Future` no longer run: for example, if the action dispatches an /// HTTP request, whether that request is actually canceled or not depends on whether the /// request library actually cancels a request when its `Future` is dropped. pub fn abort(self) { let _ = self.0.send(()); } } impl<I, O> ArcAction<I, O> where I: Send + Sync + 'static, O: Send + Sync + 'static, { /// Calls the `async` function with a reference to the input type as its argument. #[track_caller] pub fn dispatch(&self, input: I) -> ActionAbortHandle { let (abort_tx, mut abort_rx) = oneshot::channel(); if !is_suppressing_resource_load() { let mut fut = (self.action_fn)(&input).fuse(); // Update the state before loading self.in_flight.update(|n| *n += 1); let current_version = self.dispatched.get_value(); self.input.try_update(|inp| **inp = Some(input)); // Spawn the task crate::spawn({ let input = self.input.clone(); let version = self.version.clone(); let dispatched = self.dispatched.clone(); let value = self.value.clone(); let in_flight = self.in_flight.clone(); async move { select! { // if the abort message has been sent, bail and do nothing _ = abort_rx => { in_flight.update(|n| *n = n.saturating_sub(1)); }, // otherwise, update the value result = fut => { in_flight.update(|n| *n = n.saturating_sub(1)); let is_latest = dispatched.get_value() <= current_version; if is_latest { version.update(|n| *n += 1); value.update(|n| **n = Some(result)); } } } if in_flight.get_untracked() == 0 { input.update(|inp| **inp = None); } } }); } ActionAbortHandle(abort_tx) } } impl<I, O> ArcAction<I, O> where I: 'static, O: 'static, { /// Calls the `async` function with a reference to the input type as its argument, /// ensuring that it is spawned on the current thread. #[track_caller] pub fn dispatch_local(&self, input: I) -> ActionAbortHandle { let (abort_tx, mut abort_rx) = oneshot::channel(); if !is_suppressing_resource_load() { let mut fut = (self.action_fn)(&input).fuse(); // Update the state before loading self.in_flight.update(|n| *n += 1); let current_version = self.dispatched.get_value(); self.input.try_update(|inp| **inp = Some(input)); // Spawn the task Executor::spawn_local({ let input = self.input.clone(); let version = self.version.clone(); let value = self.value.clone(); let dispatched = self.dispatched.clone(); let in_flight = self.in_flight.clone(); async move { select! { // if the abort message has been sent, bail and do nothing _ = abort_rx => { in_flight.update(|n| *n = n.saturating_sub(1)); }, // otherwise, update the value result = fut => { in_flight.update(|n| *n = n.saturating_sub(1)); let is_latest = dispatched.get_value() <= current_version; if is_latest { version.update(|n| *n += 1); value.update(|n| **n = Some(result)); } } } if in_flight.get_untracked() == 0 { input.update(|inp| **inp = None); } } }); } ActionAbortHandle(abort_tx) } } impl<I, O> ArcAction<I, O> where I: 'static, O: 'static, { /// Creates a new action, which will only be run on the thread in which it is created. /// /// In all other ways, this is identical to [`ArcAction::new`]. #[track_caller] pub fn new_unsync<F, Fu>(action_fn: F) -> Self where F: Fn(&I) -> Fu + 'static, Fu: Future<Output = O> + 'static, { let action_fn = move |inp: &I| SendWrapper::new(action_fn(inp)); Self::new_unsync_with_value(None, action_fn) } /// Creates a new action that will only run on the current thread, initializing it with the given value. /// /// In all other ways, this is identical to [`ArcAction::new_with_value`]. #[track_caller] pub fn new_unsync_with_value<F, Fu>(value: Option<O>, action_fn: F) -> Self where F: Fn(&I) -> Fu + 'static, Fu: Future<Output = O> + 'static, { let owner = Owner::current().unwrap_or_default(); let action_fn = SendWrapper::new(action_fn); ArcAction { in_flight: ArcRwSignal::new(0), input: ArcRwSignal::new(SendOption::new_local(None)), value: ArcRwSignal::new(SendOption::new_local(value)), version: Default::default(), dispatched: Default::default(), action_fn: Arc::new(move |input| { Box::pin(SendWrapper::new(owner.with(|| { ScopedFuture::new_untracked(untrack(|| action_fn(input))) }))) }), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), } } } impl<I, O> ArcAction<I, O> where I: 'static, O: 'static, { /// The number of times the action has successfully completed. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// let act = ArcAction::new(|n: &u8| { /// let n = n.to_owned(); /// async move { n * 2 } /// }); /// /// let version = act.version(); /// act.dispatch(3); /// assert_eq!(version.get(), 0); /// /// # tokio::time::sleep(std::time::Duration::from_millis(10)).await; /// // after it resolves /// assert_eq!(version.get(), 1); /// # }); /// ``` #[track_caller] pub fn version(&self) -> ArcRwSignal<usize> { self.version.clone() } /// The current argument that was dispatched to the async function. This value will /// be `Some` while we are waiting for it to resolve, and `None` after it has resolved. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// let act = ArcAction::new(|n: &u8| { /// let n = n.to_owned(); /// async move { n * 2 } /// }); /// /// let input = act.input(); /// assert_eq!(input.get(), None); /// act.dispatch(3); /// assert_eq!(input.get(), Some(3)); /// /// # tokio::time::sleep(std::time::Duration::from_millis(10)).await; /// // after it resolves /// assert_eq!(input.get(), None); /// # }); /// ``` #[track_caller] pub fn input(&self) -> ArcMappedSignal<Option<I>> { ArcMappedSignal::new( self.input.clone(), |n| n.deref(), |n| n.deref_mut(), ) } /// The most recent return value of the `async` function. This will be `None` before /// the action has ever run successfully, and subsequently will always be `Some(_)`, /// holding the old value until a new value has been received. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// let act = ArcAction::new(|n: &u8| { /// let n = n.to_owned(); /// async move { n * 2 } /// }); /// /// let value = act.value(); /// assert_eq!(value.get(), None); /// act.dispatch(3); /// assert_eq!(value.get(), None); /// /// # tokio::time::sleep(std::time::Duration::from_millis(10)).await; /// // after it resolves /// assert_eq!(value.get(), Some(6)); /// // dispatch another value, and it still holds the old value /// act.dispatch(3); /// assert_eq!(value.get(), Some(6)); /// # }); /// ``` #[track_caller] pub fn value(&self) -> ArcMappedSignal<Option<O>> { ArcMappedSignal::new( self.value.clone(), |n| n.deref(), |n| n.deref_mut(), ) } /// Whether the action has been dispatched and is currently waiting to resolve. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// let act = ArcAction::new(|n: &u8| { /// let n = n.to_owned(); /// async move { n * 2 } /// }); /// /// let pending = act.pending(); /// assert_eq!(pending.get(), false); /// act.dispatch(3); /// assert_eq!(pending.get(), true); /// /// # tokio::time::sleep(std::time::Duration::from_millis(10)).await; /// // after it resolves /// assert_eq!(pending.get(), false); /// # }); /// ``` #[track_caller] pub fn pending(&self) -> ArcMemo<bool> { let in_flight = self.in_flight.clone(); ArcMemo::new(move |_| in_flight.get() > 0) } } impl<I, O> DefinedAt for ArcAction<I, O> where I: 'static, O: 'static, { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } /// An action runs some asynchronous code when you dispatch a new value to it, and gives you /// reactive access to the result. /// /// Actions are intended for mutating or updating data, not for loading data. If you find yourself /// creating an action and immediately dispatching a value to it, this is probably the wrong /// primitive. /// /// The reference-counted, `Clone` (but not `Copy` version of an `Action` is an [`ArcAction`]. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// async fn send_new_todo_to_api(task: String) -> usize { /// // do something... /// // return a task id /// 42 /// } /// let save_data = Action::new(|task: &String| { /// // `task` is given as `&String` because its value is available in `input` /// send_new_todo_to_api(task.clone()) /// }); /// /// // the argument currently running /// let input = save_data.input(); /// // the most recent returned result /// let result_of_call = save_data.value(); /// // whether the call is pending /// let pending = save_data.pending(); /// // how many times the action has run /// // useful for reactively updating something else in response to a `dispatch` and response /// let version = save_data.version(); /// /// // before we do anything /// assert_eq!(input.get(), None); // no argument yet /// assert_eq!(pending.get(), false); // isn't pending a response /// assert_eq!(result_of_call.get(), None); // there's no "last value" /// assert_eq!(version.get(), 0); /// /// // dispatch the action /// save_data.dispatch("My todo".to_string()); /// /// // when we're making the call /// assert_eq!(input.get(), Some("My todo".to_string())); /// assert_eq!(pending.get(), true); // is pending /// assert_eq!(result_of_call.get(), None); // has not yet gotten a response /// /// # any_spawner::Executor::tick().await; /// /// // after call has resolved /// assert_eq!(input.get(), None); // input clears out after resolved /// assert_eq!(pending.get(), false); // no longer pending /// assert_eq!(result_of_call.get(), Some(42)); /// assert_eq!(version.get(), 1); /// # }); /// ``` /// /// The input to the `async` function should always be a single value, /// but it can be of any type. The argument is always passed by reference to the /// function, because it is stored in [Action::input] as well. /// /// ```rust /// # use reactive_graph::actions::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// // if there's a single argument, just use that /// let action1 = Action::new(|input: &String| { /// let input = input.clone(); /// async move { todo!() } /// }); /// /// // if there are no arguments, use the unit type `()` /// let action2 = Action::new(|input: &()| async { todo!() }); /// /// // if there are multiple arguments, use a tuple /// let action3 = Action::new(|input: &(usize, String)| async { todo!() }); /// ``` pub struct Action<I, O> { inner: ArenaItem<ArcAction<I, O>>, #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, } impl<I, O> Dispose for Action<I, O> { fn dispose(self) { self.inner.dispose() } } impl<I, O> Action<I, O> where I: Send + Sync + 'static, O: Send + Sync + 'static, { /// Creates a new action. This is lazy: it does not run the action function until some value /// is dispatched. /// /// The constructor takes a function which will create a new `Future` from some input data. /// When the action is dispatched, this `action_fn` will run, and the `Future` it returns will /// be spawned. /// /// The `action_fn` must be `Send + Sync` so that the `ArcAction` is `Send + Sync`. The /// `Future` must be `Send` so that it can be moved across threads by the async executor as /// needed. In order to be stored in the `Copy` arena, the input and output types should also /// be `Send + Sync`. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// let act = Action::new(|n: &u8| { /// let n = n.to_owned(); /// async move { n * 2 } /// }); /// /// act.dispatch(3); /// assert_eq!(act.input().get(), Some(3)); /// /// // Remember that async functions already return a future if they are /// // not `await`ed. You can save keystrokes by leaving out the `async move` /// /// let act2 = Action::new(|n: &String| yell(n.to_owned())); /// act2.dispatch(String::from("i'm in a doctest")); /// # tokio::time::sleep(std::time::Duration::from_millis(10)).await; /// /// // after it resolves /// assert_eq!(act2.value().get(), Some("I'M IN A DOCTEST".to_string())); /// /// async fn yell(n: String) -> String { /// n.to_uppercase() /// } /// # }); /// ``` #[track_caller] pub fn new<F, Fu>(action_fn: F) -> Self where F: Fn(&I) -> Fu + Send + Sync + 'static, Fu: Future<Output = O> + Send + 'static, { Self { inner: ArenaItem::new(ArcAction::new(action_fn)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), } } /// Creates a new action, initializing it with the given value. /// /// This is lazy: it does not run the action function until some value is dispatched. /// /// The constructor takes a function which will create a new `Future` from some input data. /// When the action is dispatched, this `action_fn` will run, and the `Future` it returns will /// be spawned. /// /// The `action_fn` must be `Send + Sync` so that the `ArcAction` is `Send + Sync`. The /// `Future` must be `Send` so that it can be moved across threads by the async executor as /// needed. In order to be stored in the `Copy` arena, the input and output types should also /// be `Send + Sync`. #[track_caller] pub fn new_with_value<F, Fu>(value: Option<O>, action_fn: F) -> Self where F: Fn(&I) -> Fu + Send + Sync + 'static, Fu: Future<Output = O> + Send + 'static, { Self { inner: ArenaItem::new(ArcAction::new_with_value(value, action_fn)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), } } } impl<I, O> Action<I, O> where I: 'static, O: 'static, { /// Clears the value of the action, setting its current value to `None`. /// /// This has no other effect: i.e., it will not cancel in-flight actions, set the /// input, etc. #[track_caller] pub fn clear(&self) { self.inner.try_with_value(|inner| inner.clear()); } } impl<I, O> Action<I, O> where I: 'static, O: 'static, { /// Creates a new action, which does not require its inputs or outputs to be `Send`. In all other /// ways, this is the same as [`Action::new`]. If this action is accessed from outside the /// thread on which it was created, it panics. #[track_caller] pub fn new_local<F, Fu>(action_fn: F) -> Self where F: Fn(&I) -> Fu + 'static, Fu: Future<Output = O> + 'static, { Self { inner: ArenaItem::new(ArcAction::new_unsync(action_fn)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), } } /// Creates a new action with the initial value, which does not require its inputs or outputs to be `Send`. In all other /// ways, this is the same as [`Action::new_with_value`]. If this action is accessed from outside the /// thread on which it was created, it panics. #[track_caller] pub fn new_local_with_value<F, Fu>(value: Option<O>, action_fn: F) -> Self where F: Fn(&I) -> Fu + 'static, Fu: Future<Output = O> + Send + 'static, { Self { inner: ArenaItem::new(ArcAction::new_unsync_with_value( value, action_fn, )), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), } } } impl<I, O> Action<I, O> where I: 'static, O: 'static, { /// The number of times the action has successfully completed. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// let act = Action::new(|n: &u8| { /// let n = n.to_owned(); /// async move { n * 2 } /// }); /// /// let version = act.version(); /// act.dispatch(3); /// assert_eq!(version.get(), 0); /// /// # tokio::time::sleep(std::time::Duration::from_millis(10)).await; /// // after it resolves /// assert_eq!(version.get(), 1); /// # }); /// ``` #[track_caller] pub fn version(&self) -> RwSignal<usize> { let inner = self .inner .try_with_value(|inner| inner.version()) .unwrap_or_else(unwrap_signal!(self)); inner.into() } /// Whether the action has been dispatched and is currently waiting to resolve. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// let act = Action::new(|n: &u8| { /// let n = n.to_owned(); /// async move { n * 2 } /// }); /// /// let pending = act.pending(); /// assert_eq!(pending.get(), false); /// act.dispatch(3); /// assert_eq!(pending.get(), true); /// /// # tokio::time::sleep(std::time::Duration::from_millis(10)).await; /// // after it resolves /// assert_eq!(pending.get(), false); /// # }); /// ``` #[track_caller] pub fn pending(&self) -> Memo<bool> { let inner = self .inner .try_with_value(|inner| inner.pending()) .unwrap_or_else(unwrap_signal!(self)); inner.into() } } impl<I, O> Action<I, O> where I: 'static, O: 'static, { /// The current argument that was dispatched to the async function. This value will /// be `Some` while we are waiting for it to resolve, and `None` after it has resolved. /// /// ```rust /// # use reactive_graph::actions::*; /// # use reactive_graph::prelude::*; /// # tokio_test::block_on(async move { /// # any_spawner::Executor::init_tokio(); let owner = reactive_graph::owner::Owner::new(); owner.set(); /// # let _guard = reactive_graph::diagnostics::SpecialNonReactiveZone::enter(); /// let act = Action::new(|n: &u8| { /// let n = n.to_owned(); /// async move { n * 2 } /// }); /// /// let input = act.input(); /// assert_eq!(input.get(), None); /// act.dispatch(3); /// assert_eq!(input.get(), Some(3)); /// /// # tokio::time::sleep(std::time::Duration::from_millis(10)).await; /// // after it resolves /// assert_eq!(input.get(), None); /// # }); /// ``` #[track_caller] pub fn input(&self) -> MappedSignal<Option<I>> { self.inner .try_with_value(|inner| inner.input()) .unwrap_or_else(unwrap_signal!(self)) .into() } /// The current argument that was dispatched to the async function. This value will /// be `Some` while we are waiting for it to resolve, and `None` after it has resolved. /// /// Returns a thread-local signal using [`LocalStorage`]. #[track_caller] #[deprecated = "You can now use .input() for any value, whether it's \ thread-safe or not."] pub fn input_local(&self) -> MappedSignal<Option<I>> { self.inner .try_with_value(|inner| inner.input()) .unwrap_or_else(unwrap_signal!(self)) .into() } } impl<I, O> Action<I, O> where I: 'static, O: 'static, { /// The most recent return value of the `async` function. This will be `None` before
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
true
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/owner/arc_stored_value.rs
reactive_graph/src/owner/arc_stored_value.rs
use crate::{ signal::guards::{Plain, ReadGuard, UntrackedWriteGuard}, traits::{DefinedAt, IntoInner, IsDisposed, ReadValue, WriteValue}, }; use std::{ fmt::{Debug, Formatter}, hash::Hash, panic::Location, sync::{Arc, RwLock}, }; /// A reference-counted getter for any value non-reactively. /// /// This is a reference-counted value, which is `Clone` but not `Copy`. /// For arena-allocated `Copy` values, use [`StoredValue`](super::StoredValue). /// /// This allows you to create a stable reference for any value by storing it within /// the reactive system. Unlike e.g. [`ArcRwSignal`](crate::signal::ArcRwSignal), it is not reactive; /// accessing it does not cause effects to subscribe, and /// updating it does not notify anything else. pub struct ArcStoredValue<T> { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, value: Arc<RwLock<T>>, } impl<T> Clone for ArcStoredValue<T> { fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, value: Arc::clone(&self.value), } } } impl<T> Debug for ArcStoredValue<T> { fn fmt(&self, f: &mut Formatter<'_>) -> core::fmt::Result { f.debug_struct("ArcStoredValue") .field("type", &std::any::type_name::<T>()) .field("value", &Arc::as_ptr(&self.value)) .finish() } } impl<T: Default> Default for ArcStoredValue<T> { #[track_caller] fn default() -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), value: Arc::new(RwLock::new(T::default())), } } } impl<T> PartialEq for ArcStoredValue<T> { fn eq(&self, other: &Self) -> bool { Arc::ptr_eq(&self.value, &other.value) } } impl<T> Eq for ArcStoredValue<T> {} impl<T> Hash for ArcStoredValue<T> { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { std::ptr::hash(&Arc::as_ptr(&self.value), state); } } impl<T> DefinedAt for ArcStoredValue<T> { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T> ArcStoredValue<T> { /// Creates a new stored value, taking the initial value as its argument. #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", skip_all) )] #[track_caller] pub fn new(value: T) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), value: Arc::new(RwLock::new(value)), } } } impl<T> ReadValue for ArcStoredValue<T> where T: 'static, { type Value = ReadGuard<T, Plain<T>>; fn try_read_value(&self) -> Option<ReadGuard<T, Plain<T>>> { Plain::try_new(Arc::clone(&self.value)).map(ReadGuard::new) } } impl<T> WriteValue for ArcStoredValue<T> where T: 'static, { type Value = T; fn try_write_value(&self) -> Option<UntrackedWriteGuard<T>> { UntrackedWriteGuard::try_new(self.value.clone()) } } impl<T> IsDisposed for ArcStoredValue<T> { fn is_disposed(&self) -> bool { false } } impl<T> IntoInner for ArcStoredValue<T> { type Value = T; #[inline(always)] fn into_inner(self) -> Option<Self::Value> { Some(Arc::into_inner(self.value)?.into_inner().unwrap()) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/owner/arena.rs
reactive_graph/src/owner/arena.rs
use or_poisoned::OrPoisoned; use slotmap::{new_key_type, SlotMap}; #[cfg(feature = "sandboxed-arenas")] use std::cell::RefCell; #[cfg(not(feature = "sandboxed-arenas"))] use std::sync::OnceLock; #[cfg(feature = "sandboxed-arenas")] use std::sync::Weak; use std::{ any::Any, hash::Hash, sync::{Arc, RwLock}, }; new_key_type! { /// Unique identifier for an item stored in the arena. pub struct NodeId; } pub struct Arena; pub type ArenaMap = SlotMap<NodeId, Box<dyn Any + Send + Sync>>; #[cfg(not(feature = "sandboxed-arenas"))] static MAP: OnceLock<RwLock<ArenaMap>> = OnceLock::new(); #[cfg(feature = "sandboxed-arenas")] thread_local! { pub(crate) static MAP: RefCell<Option<Weak<RwLock<ArenaMap>>>> = RefCell::new(Some(Default::default())); } impl Arena { #[inline(always)] #[allow(unused)] pub fn set(arena: &Arc<RwLock<ArenaMap>>) { #[cfg(feature = "sandboxed-arenas")] { let new_arena = Arc::downgrade(arena); MAP.with_borrow_mut(|arena| { *arena = Some(new_arena); }) } } #[track_caller] pub fn with<U>(fun: impl FnOnce(&ArenaMap) -> U) -> U { #[cfg(not(feature = "sandboxed-arenas"))] { fun(&MAP.get_or_init(Default::default).read().or_poisoned()) } #[cfg(feature = "sandboxed-arenas")] { Arena::try_with(fun).unwrap_or_else(|| { panic!( "at {}, the `sandboxed-arenas` feature is active, but no \ Arena is active", std::panic::Location::caller() ) }) } } #[track_caller] pub fn try_with<U>(fun: impl FnOnce(&ArenaMap) -> U) -> Option<U> { #[cfg(not(feature = "sandboxed-arenas"))] { Some(fun(&MAP.get_or_init(Default::default).read().or_poisoned())) } #[cfg(feature = "sandboxed-arenas")] { MAP.with_borrow(|arena| { arena .as_ref() .and_then(Weak::upgrade) .map(|n| fun(&n.read().or_poisoned())) }) } } #[track_caller] pub fn with_mut<U>(fun: impl FnOnce(&mut ArenaMap) -> U) -> U { #[cfg(not(feature = "sandboxed-arenas"))] { fun(&mut MAP.get_or_init(Default::default).write().or_poisoned()) } #[cfg(feature = "sandboxed-arenas")] { Arena::try_with_mut(fun).unwrap_or_else(|| { panic!( "at {}, the `sandboxed-arenas` feature is active, but no \ Arena is active", std::panic::Location::caller() ) }) } } #[track_caller] pub fn try_with_mut<U>(fun: impl FnOnce(&mut ArenaMap) -> U) -> Option<U> { #[cfg(not(feature = "sandboxed-arenas"))] { Some(fun(&mut MAP .get_or_init(Default::default) .write() .or_poisoned())) } #[cfg(feature = "sandboxed-arenas")] { MAP.with_borrow(|arena| { arena .as_ref() .and_then(Weak::upgrade) .map(|n| fun(&mut n.write().or_poisoned())) }) } } } #[cfg(feature = "sandboxed-arenas")] pub mod sandboxed { use super::{Arena, ArenaMap, MAP}; use futures::Stream; use pin_project_lite::pin_project; use std::{ future::Future, pin::Pin, sync::{Arc, RwLock, Weak}, task::{Context, Poll}, }; pin_project! { /// A [`Future`] that restores its associated arena as the current arena whenever it is /// polled. /// /// Sandboxed arenas are used to ensure that data created in response to e.g., different /// HTTP requests can be handled separately, while providing stable identifiers for their /// stored values. Wrapping a `Future` in `Sandboxed` ensures that it will always use the /// same arena that it was created under. pub struct Sandboxed<T> { arena: Option<Arc<RwLock<ArenaMap>>>, #[pin] inner: T, } } impl<T> Sandboxed<T> { /// Wraps the given [`Future`], ensuring that any [`ArenaItem`][item] created while it is /// being polled will be associated with the same arena that was active when this was /// called. /// /// [item]:[crate::owner::ArenaItem] #[track_caller] pub fn new(inner: T) -> Self { let arena = MAP.with_borrow(|n| n.as_ref().and_then(Weak::upgrade)); Self { arena, inner } } } impl<Fut> Future for Sandboxed<Fut> where Fut: Future, { type Output = Fut::Output; fn poll( self: Pin<&mut Self>, cx: &mut Context<'_>, ) -> Poll<Self::Output> { if let Some(arena) = self.arena.as_ref() { Arena::set(arena); } let this = self.project(); this.inner.poll(cx) } } impl<T> Stream for Sandboxed<T> where T: Stream, { type Item = T::Item; fn poll_next( self: Pin<&mut Self>, cx: &mut Context<'_>, ) -> Poll<Option<Self::Item>> { if let Some(arena) = self.arena.as_ref() { Arena::set(arena); } let this = self.project(); this.inner.poll_next(cx) } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/owner/storage.rs
reactive_graph/src/owner/storage.rs
use super::arena::{Arena, NodeId}; use send_wrapper::SendWrapper; /// A trait for borrowing and taking data. pub trait StorageAccess<T> { /// Borrows the value. fn as_borrowed(&self) -> &T; /// Takes the value. fn into_taken(self) -> T; } impl<T> StorageAccess<T> for T { fn as_borrowed(&self) -> &T { self } fn into_taken(self) -> T { self } } impl<T> StorageAccess<T> for SendWrapper<T> { fn as_borrowed(&self) -> &T { self } fn into_taken(self) -> T { self.take() } } /// A way of storing an [`ArenaItem`](super::arena_item::ArenaItem), either as itself or with a wrapper to make it threadsafe. /// /// This exists because all items stored in the arena must be `Send + Sync`, but in single-threaded /// environments you might want or need to use thread-unsafe types. pub trait Storage<T>: Send + Sync + 'static { /// The type being stored, once it has been wrapped. type Wrapped: StorageAccess<T> + Send + Sync + 'static; /// Adds any needed wrapper to the type. fn wrap(value: T) -> Self::Wrapped; /// Applies the given function to the stored value, if it exists and can be accessed from this /// thread. fn try_with<U>(node: NodeId, fun: impl FnOnce(&T) -> U) -> Option<U>; /// Applies the given function to a mutable reference to the stored value, if it exists and can be accessed from this /// thread. fn try_with_mut<U>( node: NodeId, fun: impl FnOnce(&mut T) -> U, ) -> Option<U>; /// Sets a new value for the stored value. If it has been disposed, returns `Some(T)`. fn try_set(node: NodeId, value: T) -> Option<T>; /// Takes an item from the arena if it exists and can be accessed from this thread. /// If it cannot be casted, it will still be removed from the arena. fn take(node: NodeId) -> Option<T>; } /// A form of [`Storage`] that stores the type as itself, with no wrapper. #[derive(Debug, Copy, Clone)] pub struct SyncStorage; impl<T> Storage<T> for SyncStorage where T: Send + Sync + 'static, { type Wrapped = T; #[inline(always)] fn wrap(value: T) -> Self::Wrapped { value } fn try_with<U>(node: NodeId, fun: impl FnOnce(&T) -> U) -> Option<U> { Arena::try_with(|arena| { let m = arena.get(node); m.and_then(|n| n.downcast_ref::<T>()).map(fun) }) .flatten() } fn try_with_mut<U>( node: NodeId, fun: impl FnOnce(&mut T) -> U, ) -> Option<U> { Arena::try_with_mut(|arena| { let m = arena.get_mut(node); m.and_then(|n| n.downcast_mut::<T>()).map(fun) }) .flatten() } fn try_set(node: NodeId, value: T) -> Option<T> { Arena::try_with_mut(|arena| { let m = arena.get_mut(node); match m.and_then(|n| n.downcast_mut::<T>()) { Some(inner) => { *inner = value; None } None => Some(value), } }) .flatten() } fn take(node: NodeId) -> Option<T> { Arena::with_mut(|arena| { let m = arena.remove(node)?; match m.downcast::<T>() { Ok(inner) => Some(*inner), Err(_) => None, } }) } } /// A form of [`Storage`] that stores the type with a wrapper that makes it `Send + Sync`, but only /// allows it to be accessed from the thread on which it was created. #[derive(Debug, Copy, Clone)] pub struct LocalStorage; impl<T> Storage<T> for LocalStorage where T: 'static, { type Wrapped = SendWrapper<T>; fn wrap(value: T) -> Self::Wrapped { SendWrapper::new(value) } fn try_with<U>(node: NodeId, fun: impl FnOnce(&T) -> U) -> Option<U> { Arena::with(|arena| { let m = arena.get(node); m.and_then(|n| n.downcast_ref::<SendWrapper<T>>()) .map(|inner| fun(inner)) }) } fn try_with_mut<U>( node: NodeId, fun: impl FnOnce(&mut T) -> U, ) -> Option<U> { Arena::with_mut(|arena| { let m = arena.get_mut(node); m.and_then(|n| n.downcast_mut::<SendWrapper<T>>()) .map(|inner| fun(&mut *inner)) }) } fn try_set(node: NodeId, value: T) -> Option<T> { Arena::with_mut(|arena| { let m = arena.get_mut(node); match m.and_then(|n| n.downcast_mut::<SendWrapper<T>>()) { Some(inner) => { *inner = SendWrapper::new(value); None } None => Some(value), } }) } fn take(node: NodeId) -> Option<T> { Arena::with_mut(|arena| { let m = arena.remove(node)?; match m.downcast::<SendWrapper<T>>() { Ok(inner) => Some(inner.take()), Err(_) => None, } }) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/owner/stored_value.rs
reactive_graph/src/owner/stored_value.rs
use super::{ arc_stored_value::ArcStoredValue, ArenaItem, LocalStorage, Storage, SyncStorage, }; use crate::{ signal::guards::{Plain, ReadGuard, UntrackedWriteGuard}, traits::{ DefinedAt, Dispose, IntoInner, IsDisposed, ReadValue, WriteValue, }, unwrap_signal, }; use std::{ fmt::{Debug, Formatter}, hash::Hash, panic::Location, }; /// A **non-reactive**, `Copy` handle for any value. /// /// This allows you to create a stable reference for any value by storing it within /// the reactive system. Like the signal types (e.g., [`ReadSignal`](crate::signal::ReadSignal) /// and [`RwSignal`](crate::signal::RwSignal)), it is `Copy` and `'static`. Unlike the signal /// types, it is not reactive; accessing it does not cause effects to subscribe, and /// updating it does not notify anything else. pub struct StoredValue<T, S = SyncStorage> { value: ArenaItem<ArcStoredValue<T>, S>, #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, } impl<T, S> Copy for StoredValue<T, S> {} impl<T, S> Clone for StoredValue<T, S> { fn clone(&self) -> Self { *self } } impl<T, S> Debug for StoredValue<T, S> where S: Debug, { fn fmt(&self, f: &mut Formatter<'_>) -> core::fmt::Result { f.debug_struct("StoredValue") .field("type", &std::any::type_name::<T>()) .field("value", &self.value) .finish() } } impl<T, S> PartialEq for StoredValue<T, S> { fn eq(&self, other: &Self) -> bool { self.value == other.value } } impl<T, S> Eq for StoredValue<T, S> {} impl<T, S> Hash for StoredValue<T, S> { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { self.value.hash(state); } } impl<T, S> DefinedAt for StoredValue<T, S> { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T, S> StoredValue<T, S> where T: 'static, S: Storage<ArcStoredValue<T>>, { /// Stores the given value in the arena allocator. #[track_caller] pub fn new_with_storage(value: T) -> Self { Self { value: ArenaItem::new_with_storage(ArcStoredValue::new(value)), #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), } } } impl<T, S> Default for StoredValue<T, S> where T: Default + 'static, S: Storage<ArcStoredValue<T>>, { #[track_caller] // Default trait is not annotated with #[track_caller] fn default() -> Self { Self::new_with_storage(Default::default()) } } impl<T> StoredValue<T> where T: Send + Sync + 'static, { /// Stores the given value in the arena allocator. #[track_caller] pub fn new(value: T) -> Self { StoredValue::new_with_storage(value) } } impl<T> StoredValue<T, LocalStorage> where T: 'static, { /// Stores the given value in the arena allocator. #[track_caller] pub fn new_local(value: T) -> Self { StoredValue::new_with_storage(value) } } impl<T, S> ReadValue for StoredValue<T, S> where T: 'static, S: Storage<ArcStoredValue<T>>, { type Value = ReadGuard<T, Plain<T>>; fn try_read_value(&self) -> Option<ReadGuard<T, Plain<T>>> { self.value .try_get_value() .and_then(|inner| inner.try_read_value()) } } impl<T, S> WriteValue for StoredValue<T, S> where T: 'static, S: Storage<ArcStoredValue<T>>, { type Value = T; fn try_write_value(&self) -> Option<UntrackedWriteGuard<T>> { self.value .try_get_value() .and_then(|inner| inner.try_write_value()) } } impl<T, S> IsDisposed for StoredValue<T, S> { fn is_disposed(&self) -> bool { self.value.is_disposed() } } impl<T, S> Dispose for StoredValue<T, S> { fn dispose(self) { self.value.dispose(); } } impl<T, S> IntoInner for StoredValue<T, S> where T: 'static, S: Storage<ArcStoredValue<T>>, { type Value = T; #[inline(always)] fn into_inner(self) -> Option<Self::Value> { self.value.into_inner()?.into_inner() } } impl<T> From<ArcStoredValue<T>> for StoredValue<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ArcStoredValue<T>) -> Self { StoredValue { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), value: ArenaItem::new(value), } } } impl<T, S> From<StoredValue<T, S>> for ArcStoredValue<T> where S: Storage<ArcStoredValue<T>>, { #[track_caller] fn from(value: StoredValue<T, S>) -> Self { value .value .try_get_value() .unwrap_or_else(unwrap_signal!(value)) } } /// Creates a new [`StoredValue`]. #[inline(always)] #[track_caller] #[deprecated( since = "0.7.0-beta5", note = "This function is being removed to conform to Rust idioms. Please \ use `StoredValue::new()` or `StoredValue::new_local()` instead." )] pub fn store_value<T>(value: T) -> StoredValue<T> where T: Send + Sync + 'static, { StoredValue::new(value) } /// Converts some value into a locally-stored type, using [`LocalStorage`]. /// /// This is modeled on [`From`] but special-cased for this thread-local storage method, which /// allows for better type inference for the default case. pub trait FromLocal<T> { /// Converts between the types. fn from_local(value: T) -> Self; }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/owner/arena_item.rs
reactive_graph/src/owner/arena_item.rs
use super::{ arena::{Arena, NodeId}, LocalStorage, Storage, SyncStorage, OWNER, }; use crate::traits::{Dispose, IntoInner, IsDisposed}; use send_wrapper::SendWrapper; use std::{any::Any, hash::Hash, marker::PhantomData}; /// A copyable, stable reference for any value, stored on the arena whose ownership is managed by the /// reactive ownership tree. #[derive(Debug)] pub struct ArenaItem<T, S = SyncStorage> { node: NodeId, #[allow(clippy::type_complexity)] ty: PhantomData<fn() -> (SendWrapper<T>, S)>, } impl<T, S> Copy for ArenaItem<T, S> {} impl<T, S> Clone for ArenaItem<T, S> { fn clone(&self) -> Self { *self } } impl<T, S> PartialEq for ArenaItem<T, S> { fn eq(&self, other: &Self) -> bool { self.node == other.node } } impl<T, S> Eq for ArenaItem<T, S> {} impl<T, S> Hash for ArenaItem<T, S> { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { self.node.hash(state); } } impl<T, S> ArenaItem<T, S> where T: 'static, S: Storage<T>, { /// Stores the given value in the arena allocator. #[track_caller] pub fn new_with_storage(value: T) -> Self { let node = { Arena::with_mut(|arena| { arena.insert( Box::new(S::wrap(value)) as Box<dyn Any + Send + Sync> ) }) }; OWNER.with(|o| { if let Some(owner) = o.borrow().as_ref().and_then(|o| o.upgrade()) { owner.register(node); } }); Self { node, ty: PhantomData, } } } impl<T, S> Default for ArenaItem<T, S> where T: Default + 'static, S: Storage<T>, { #[track_caller] // Default trait is not annotated with #[track_caller] fn default() -> Self { Self::new_with_storage(Default::default()) } } impl<T> ArenaItem<T> where T: Send + Sync + 'static, { /// Stores the given value in the arena allocator. #[track_caller] pub fn new(value: T) -> Self { ArenaItem::new_with_storage(value) } } impl<T> ArenaItem<T, LocalStorage> where T: 'static, { /// Stores the given value in the arena allocator. #[track_caller] pub fn new_local(value: T) -> Self { ArenaItem::new_with_storage(value) } } impl<T, S: Storage<T>> ArenaItem<T, S> { /// Applies a function to a reference to the stored value and returns the result, or `None` if it has already been disposed. #[track_caller] pub fn try_with_value<U>(&self, fun: impl FnOnce(&T) -> U) -> Option<U> { S::try_with(self.node, fun) } /// Applies a function to a mutable reference to the stored value and returns the result, or `None` if it has already been disposed. #[track_caller] pub fn try_update_value<U>( &self, fun: impl FnOnce(&mut T) -> U, ) -> Option<U> { S::try_with_mut(self.node, fun) } } impl<T: Clone, S: Storage<T>> ArenaItem<T, S> { /// Returns a clone of the stored value, or `None` if it has already been disposed. #[track_caller] pub fn try_get_value(&self) -> Option<T> { S::try_with(self.node, Clone::clone) } } impl<T, S> IsDisposed for ArenaItem<T, S> { fn is_disposed(&self) -> bool { Arena::with(|arena| !arena.contains_key(self.node)) } } impl<T, S> Dispose for ArenaItem<T, S> { fn dispose(self) { Arena::with_mut(|arena| arena.remove(self.node)); } } impl<T, S: Storage<T>> IntoInner for ArenaItem<T, S> { type Value = T; #[inline(always)] fn into_inner(self) -> Option<Self::Value> { S::take(self.node) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/owner/context.rs
reactive_graph/src/owner/context.rs
use crate::owner::Owner; use or_poisoned::OrPoisoned; use std::{ any::{Any, TypeId}, collections::VecDeque, }; impl Owner { fn provide_context<T: Send + Sync + 'static>(&self, value: T) { self.inner .write() .or_poisoned() .contexts .insert(value.type_id(), Box::new(value)); } fn use_context<T: Clone + 'static>(&self) -> Option<T> { self.with_context(Clone::clone) } fn take_context<T: 'static>(&self) -> Option<T> { let ty = TypeId::of::<T>(); let mut inner = self.inner.write().or_poisoned(); let contexts = &mut inner.contexts; if let Some(context) = contexts.remove(&ty) { context.downcast::<T>().ok().map(|n| *n) } else { let mut parent = inner.parent.as_ref().and_then(|p| p.upgrade()); while let Some(ref this_parent) = parent.clone() { let mut this_parent = this_parent.write().or_poisoned(); let contexts = &mut this_parent.contexts; let value = contexts.remove(&ty); let downcast = value.and_then(|context| context.downcast::<T>().ok()); if let Some(value) = downcast { return Some(*value); } else { parent = this_parent.parent.as_ref().and_then(|p| p.upgrade()); } } None } } fn with_context<T: 'static, R>( &self, cb: impl FnOnce(&T) -> R, ) -> Option<R> { let ty = TypeId::of::<T>(); let inner = self.inner.read().or_poisoned(); let contexts = &inner.contexts; let reference = if let Some(context) = contexts.get(&ty) { context.downcast_ref::<T>() } else { let mut parent = inner.parent.as_ref().and_then(|p| p.upgrade()); while let Some(ref this_parent) = parent.clone() { let this_parent = this_parent.read().or_poisoned(); let contexts = &this_parent.contexts; let value = contexts.get(&ty); let downcast = value.and_then(|context| context.downcast_ref::<T>()); if let Some(value) = downcast { return Some(cb(value)); } else { parent = this_parent.parent.as_ref().and_then(|p| p.upgrade()); } } None }; reference.map(cb) } fn update_context<T: 'static, R>( &self, cb: impl FnOnce(&mut T) -> R, ) -> Option<R> { let ty = TypeId::of::<T>(); let mut inner = self.inner.write().or_poisoned(); let contexts = &mut inner.contexts; let reference = if let Some(context) = contexts.get_mut(&ty) { context.downcast_mut::<T>() } else { let mut parent = inner.parent.as_ref().and_then(|p| p.upgrade()); while let Some(ref this_parent) = parent.clone() { let mut this_parent = this_parent.write().or_poisoned(); let contexts = &mut this_parent.contexts; let value = contexts.get_mut(&ty); let downcast = value.and_then(|context| context.downcast_mut::<T>()); if let Some(value) = downcast { return Some(cb(value)); } else { parent = this_parent.parent.as_ref().and_then(|p| p.upgrade()); } } None }; reference.map(cb) } /// Searches for items stored in context in either direction, either among parents or among /// descendants. pub fn use_context_bidirectional<T: Clone + 'static>(&self) -> Option<T> { self.use_context() .unwrap_or_else(|| self.find_context_in_children()) } fn find_context_in_children<T: Clone + 'static>(&self) -> Option<T> { let ty = TypeId::of::<T>(); let inner = self.inner.read().or_poisoned(); let mut to_search = VecDeque::new(); to_search.extend(inner.children.clone()); drop(inner); while let Some(next) = to_search.pop_front() { if let Some(child) = next.upgrade() { let child = child.read().or_poisoned(); let contexts = &child.contexts; if let Some(context) = contexts.get(&ty) { return context.downcast_ref::<T>().cloned(); } to_search.extend(child.children.clone()); } } None } } /// Provides a context value of type `T` to the current reactive [`Owner`] /// and all of its descendants. This can be accessed using [`use_context`]. /// /// This is useful for passing values down to components or functions lower in a /// hierarchy without needs to “prop drill” by passing them through each layer as /// arguments to a function or properties of a component. /// /// Context works similarly to variable scope: a context that is provided higher in /// the reactive graph can be used lower down, but a context that is provided lower /// down cannot be used higher up. /// /// ```rust /// # use reactive_graph::prelude::*; /// # use reactive_graph::owner::*; /// # let owner = Owner::new(); owner.set(); /// # use reactive_graph::effect::Effect; /// # futures::executor::block_on(async move { /// # any_spawner::Executor::init_futures_executor(); /// Effect::new(move |_| { /// println!("Provider"); /// provide_context(42i32); // provide an i32 /// /// Effect::new(move |_| { /// println!("intermediate node"); /// /// Effect::new(move |_| { /// let value = use_context::<i32>() /// .expect("could not find i32 in context"); /// assert_eq!(value, 42); /// }); /// }); /// }); /// # }); /// ``` /// /// ## Context Shadowing /// /// Only a single value of any type can be provided via context. If you need to provide multiple /// values of the same type, wrap each one in a "newtype" struct wrapper so that each one is a /// distinct type. /// /// Providing a second value of the same type "lower" in the ownership tree will shadow the value, /// just as a second `let` declaration with the same variable name will shadow that variable. /// /// ```rust /// # use reactive_graph::prelude::*; /// # use reactive_graph::owner::*; /// # let owner = Owner::new(); owner.set(); /// # use reactive_graph::effect::Effect; /// # futures::executor::block_on(async move { /// # any_spawner::Executor::init_futures_executor(); /// Effect::new(move |_| { /// println!("Provider"); /// provide_context("foo"); // provide a &'static str /// /// Effect::new(move |_| { /// // before we provide another value of the same type, we can access the old one /// assert_eq!(use_context::<&'static str>(), Some("foo")); /// // but providing another value of the same type shadows it /// provide_context("bar"); /// /// Effect::new(move |_| { /// assert_eq!(use_context::<&'static str>(), Some("bar")); /// }); /// }); /// }); /// # }); /// ``` pub fn provide_context<T: Send + Sync + 'static>(value: T) { if let Some(owner) = Owner::current() { owner.provide_context(value); } } /// Extracts a context value of type `T` from the reactive system. /// /// This traverses the reactive ownership graph, beginning from the current reactive /// [`Owner`] and iterating through its parents, if any. When the value is found, it is cloned. /// /// The context value should have been provided elsewhere using /// [`provide_context`](provide_context). /// /// This is useful for passing values down to components or functions lower in a /// hierarchy without needs to “prop drill” by passing them through each layer as /// arguments to a function or properties of a component. /// /// Context works similarly to variable scope: a context that is provided higher in /// the reactive graph can be used lower down, but a context that is provided lower /// in the tree cannot be used higher up. /// /// While the term “consume” is sometimes used, note that [`use_context`] clones the value, rather /// than removing it; it is still accessible to other users. /// /// ```rust /// # use reactive_graph::prelude::*; /// # use reactive_graph::owner::*; /// # let owner = Owner::new(); owner.set(); /// # use reactive_graph::effect::Effect; /// # futures::executor::block_on(async move { /// # any_spawner::Executor::init_futures_executor(); /// Effect::new(move |_| { /// provide_context(String::from("foo")); /// /// Effect::new(move |_| { /// // each use_context clones the value /// let value = use_context::<String>() /// .expect("could not find String in context"); /// assert_eq!(value, "foo"); /// let value2 = use_context::<String>() /// .expect("could not find String in context"); /// assert_eq!(value2, "foo"); /// }); /// }); /// # }); /// ``` pub fn use_context<T: Clone + 'static>() -> Option<T> { Owner::current().and_then(|owner| owner.use_context()) } /// Extracts a context value of type `T` from the reactive system, and /// panics if it can't be found. /// /// This traverses the reactive ownership graph, beginning from the current reactive /// [`Owner`] and iterating through its parents, if any. When the value is found, it is cloned. /// /// Panics if no value is found. /// /// The context value should have been provided elsewhere using /// [`provide_context`](provide_context). /// /// This is useful for passing values down to components or functions lower in a /// hierarchy without needs to “prop drill” by passing them through each layer as /// arguments to a function or properties of a component. /// /// Context works similarly to variable scope: a context that is provided higher in /// the reactive graph can be used lower down, but a context that is provided lower /// in the tree cannot be used higher up. /// /// While the term “consume” is sometimes used, note that [`use_context`] clones the value, rather /// than removing it; it is still accessible to other users. /// /// ```rust /// # use reactive_graph::prelude::*; /// # use reactive_graph::owner::*; /// # let owner = Owner::new(); owner.set(); /// # use reactive_graph::effect::Effect; /// # futures::executor::block_on(async move { /// # any_spawner::Executor::init_futures_executor(); /// Effect::new(move |_| { /// provide_context(String::from("foo")); /// /// Effect::new(move |_| { /// // each use_context clones the value /// let value = use_context::<String>() /// .expect("could not find String in context"); /// assert_eq!(value, "foo"); /// let value2 = use_context::<String>() /// .expect("could not find String in context"); /// assert_eq!(value2, "foo"); /// }); /// }); /// # }); /// ``` /// ## Panics /// Panics if a context of this type is not found in the current reactive /// owner or its ancestors. #[track_caller] pub fn expect_context<T: Clone + 'static>() -> T { let location = std::panic::Location::caller(); use_context().unwrap_or_else(|| { panic!( "{:?} expected context of type {:?} to be present", location, std::any::type_name::<T>() ) }) } /// Extracts a context value of type `T` from the reactive system, and takes ownership, /// removing it from the context system. /// /// This traverses the reactive ownership graph, beginning from the current reactive /// [`Owner`] and iterating through its parents, if any. When the value is found, it is removed, /// and is not available to any other [`use_context`] or [`take_context`] calls. /// /// If the value is `Clone`, use [`use_context`] instead. /// /// The context value should have been provided elsewhere using /// [`provide_context`](provide_context). /// /// This is useful for passing values down to components or functions lower in a /// hierarchy without needs to “prop drill” by passing them through each layer as /// arguments to a function or properties of a component. /// /// Context works similarly to variable scope: a context that is provided higher in /// the reactive graph can be used lower down, but a context that is provided lower /// in the tree cannot be used higher up. /// ```rust /// # use reactive_graph::prelude::*; /// # use reactive_graph::owner::*; /// # let owner = Owner::new(); owner.set(); /// # use reactive_graph::effect::Effect; /// # futures::executor::block_on(async move { /// # any_spawner::Executor::init_futures_executor(); /// /// #[derive(Debug, PartialEq)] /// struct NotClone(String); /// /// Effect::new(move |_| { /// provide_context(NotClone(String::from("foo"))); /// /// Effect::new(move |_| { /// // take_context removes the value from context without needing to clone /// let value = take_context::<NotClone>(); /// assert_eq!(value, Some(NotClone(String::from("foo")))); /// let value2 = take_context::<NotClone>(); /// assert_eq!(value2, None); /// }); /// }); /// # }); /// ``` pub fn take_context<T: 'static>() -> Option<T> { Owner::current().and_then(|owner| owner.take_context()) } /// Access a reference to a context value of type `T` in the reactive system. /// /// This traverses the reactive ownership graph, beginning from the current reactive /// [`Owner`] and iterating through its parents, if any. When the value is found, /// the function that you pass is applied to an immutable reference to it. /// /// The context value should have been provided elsewhere using /// [`provide_context`](provide_context). /// /// This is useful for passing values down to components or functions lower in a /// hierarchy without needs to “prop drill” by passing them through each layer as /// arguments to a function or properties of a component. /// /// Context works similarly to variable scope: a context that is provided higher in /// the reactive graph can be used lower down, but a context that is provided lower /// in the tree cannot be used higher up. /// /// ```rust /// # use reactive_graph::prelude::*; /// # use reactive_graph::owner::*; /// # let owner = Owner::new(); owner.set(); /// # use reactive_graph::effect::Effect; /// # futures::executor::block_on(async move { /// # any_spawner::Executor::init_futures_executor(); /// Effect::new(move |_| { /// provide_context(String::from("foo")); /// /// Effect::new(move |_| { /// let value = with_context::<String, _>(|val| val.to_string()) /// .expect("could not find String in context"); /// assert_eq!(value, "foo"); /// }); /// }); /// # }); /// ``` pub fn with_context<T: 'static, R>(cb: impl FnOnce(&T) -> R) -> Option<R> { Owner::current().and_then(|owner| owner.with_context(cb)) } /// Update a context value of type `T` in the reactive system. /// /// This traverses the reactive ownership graph, beginning from the current reactive /// [`Owner`] and iterating through its parents, if any. When the value is found, /// the function that you pass is applied to a mutable reference to it. /// /// The context value should have been provided elsewhere using /// [`provide_context`](provide_context). /// /// This is useful for passing values down to components or functions lower in a /// hierarchy without needs to “prop drill” by passing them through each layer as /// arguments to a function or properties of a component. /// /// Context works similarly to variable scope: a context that is provided higher in /// the reactive graph can be used lower down, but a context that is provided lower /// in the tree cannot be used higher up. /// /// ```rust /// # use reactive_graph::prelude::*; /// # use reactive_graph::owner::*; /// # let owner = Owner::new(); owner.set(); /// # use reactive_graph::effect::Effect; /// # futures::executor::block_on(async move { /// # any_spawner::Executor::init_futures_executor(); /// Effect::new(move |_| { /// provide_context(String::from("foo")); /// /// Effect::new(move |_| { /// let value = update_context::<String, _>(|val| { /// std::mem::replace(val, "bar".to_string()) /// }) /// .expect("could not find String in context"); /// assert_eq!(value, "foo"); /// assert_eq!(expect_context::<String>(), "bar"); /// }); /// }); /// # }); /// ``` pub fn update_context<T: 'static, R>( cb: impl FnOnce(&mut T) -> R, ) -> Option<R> { Owner::current().and_then(|owner| owner.update_context(cb)) }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/signal/subscriber_traits.rs
reactive_graph/src/signal/subscriber_traits.rs
//! Traits to reduce the boilerplate when implementing the [`ReactiveNode`], [`Source`], and //! [`ToAnySource`] traits for signal types. //! //! These traits can be automatically derived for any type that //! 1) is a root node in the reactive graph, with no sources (i.e., a signal, not a memo) //! 2) contains an `Arc<RwLock<SubscriberSet>>` //! //! This makes it easy to implement a variety of different signal primitives, as long as they share //! these characteristics. use crate::{ graph::{ AnySource, AnySubscriber, ReactiveNode, Source, SubscriberSet, ToAnySource, }, traits::{DefinedAt, IsDisposed}, unwrap_signal, }; use or_poisoned::OrPoisoned; use std::{ borrow::Borrow, sync::{Arc, RwLock, Weak}, }; pub(crate) trait AsSubscriberSet { type Output: Borrow<RwLock<SubscriberSet>>; fn as_subscriber_set(&self) -> Option<Self::Output>; } impl<'a> AsSubscriberSet for &'a RwLock<SubscriberSet> { type Output = &'a RwLock<SubscriberSet>; #[inline(always)] fn as_subscriber_set(&self) -> Option<Self::Output> { Some(self) } } impl DefinedAt for RwLock<SubscriberSet> { fn defined_at(&self) -> Option<&'static std::panic::Location<'static>> { None } } // Implement reactive types for RwLock<SubscriberSet> // This is used so that Weak<RwLock<SubscriberSet>> is a Weak<dyn ReactiveNode> and Weak<dyn // Source> impl<T: AsSubscriberSet + DefinedAt> ReactiveNode for T { fn mark_dirty(&self) { self.mark_subscribers_check(); } fn mark_check(&self) {} fn mark_subscribers_check(&self) { if let Some(inner) = self.as_subscriber_set() { let subs = inner.borrow().read().unwrap().clone(); for sub in subs { sub.mark_dirty(); } } } fn update_if_necessary(&self) -> bool { // a signal will always mark its dependents Dirty when it runs, so they know // that they may have changed and need to check themselves at least // // however, it's always possible that *another* signal or memo has triggered any // given effect/memo, and so this signal should *not* say that it is dirty, as it // may also be checked but has not changed false } } impl<T: AsSubscriberSet + DefinedAt> Source for T { fn clear_subscribers(&self) { if let Some(inner) = self.as_subscriber_set() { inner.borrow().write().unwrap().take(); } } fn add_subscriber(&self, subscriber: AnySubscriber) { if let Some(inner) = self.as_subscriber_set() { inner.borrow().write().unwrap().subscribe(subscriber) } } fn remove_subscriber(&self, subscriber: &AnySubscriber) { if let Some(inner) = self.as_subscriber_set() { inner.borrow().write().unwrap().unsubscribe(subscriber) } } } impl<T: AsSubscriberSet + DefinedAt + IsDisposed> ToAnySource for T where T::Output: Borrow<Arc<RwLock<SubscriberSet>>>, { #[track_caller] fn to_any_source(&self) -> AnySource { self.as_subscriber_set() .map(|subs| { let subs = subs.borrow(); AnySource( Arc::as_ptr(subs) as usize, Arc::downgrade(subs) as Weak<dyn Source + Send + Sync>, #[cfg(any(debug_assertions, leptos_debuginfo))] self.defined_at().expect("no DefinedAt in debug mode"), ) }) .unwrap_or_else(unwrap_signal!(self)) } } impl ReactiveNode for RwLock<SubscriberSet> { fn mark_dirty(&self) { self.mark_subscribers_check(); } fn mark_check(&self) {} fn mark_subscribers_check(&self) { let subs = self.write().unwrap().take(); for sub in subs { sub.mark_dirty(); } } fn update_if_necessary(&self) -> bool { // a signal will always mark its dependents Dirty when it runs, so they know // that they may have changed and need to check themselves at least // // however, it's always possible that *another* signal or memo has triggered any // given effect/memo, and so this signal should *not* say that it is dirty, as it // may also be checked but has not changed false } } impl Source for RwLock<SubscriberSet> { fn clear_subscribers(&self) { self.write().or_poisoned().take(); } fn add_subscriber(&self, subscriber: AnySubscriber) { self.write().or_poisoned().subscribe(subscriber) } fn remove_subscriber(&self, subscriber: &AnySubscriber) { self.write().or_poisoned().unsubscribe(subscriber) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/signal/trigger.rs
reactive_graph/src/signal/trigger.rs
use super::{subscriber_traits::AsSubscriberSet, ArcTrigger}; use crate::{ graph::{ReactiveNode, SubscriberSet}, owner::ArenaItem, traits::{DefinedAt, Dispose, IsDisposed, Notify}, }; use std::{ fmt::{Debug, Formatter, Result}, panic::Location, sync::{Arc, RwLock}, }; /// A trigger is a data-less signal with the sole purpose of notifying other reactive code of a change. /// /// This can be useful for when using external data not stored in signals, for example. /// /// This is an arena-allocated Trigger, which is `Copy` and is disposed when its reactive /// [`Owner`](crate::owner::Owner) cleans up. For a reference-counted trigger that lives /// as long as a reference to it is alive, see [`ArcTrigger`]. pub struct Trigger { #[cfg(any(debug_assertions, leptos_debuginfo))] pub(crate) defined_at: &'static Location<'static>, pub(crate) inner: ArenaItem<ArcTrigger>, } impl Trigger { /// Creates a new trigger. #[track_caller] pub fn new() -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new(ArcTrigger::new()), } } } impl Default for Trigger { fn default() -> Self { Self::new() } } impl Clone for Trigger { #[track_caller] fn clone(&self) -> Self { *self } } impl Copy for Trigger {} impl Debug for Trigger { fn fmt(&self, f: &mut Formatter<'_>) -> Result { f.debug_struct("Trigger").finish() } } impl Dispose for Trigger { fn dispose(self) { self.inner.dispose() } } impl IsDisposed for Trigger { #[inline(always)] fn is_disposed(&self) -> bool { self.inner.is_disposed() } } impl AsSubscriberSet for Trigger { type Output = Arc<RwLock<SubscriberSet>>; #[inline(always)] fn as_subscriber_set(&self) -> Option<Self::Output> { self.inner .try_get_value() .and_then(|arc_trigger| arc_trigger.as_subscriber_set()) } } impl DefinedAt for Trigger { #[inline(always)] fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl Notify for Trigger { fn notify(&self) { if let Some(inner) = self.inner.try_get_value() { inner.mark_dirty(); } } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/signal/guards.rs
reactive_graph/src/signal/guards.rs
//! Guards that integrate with the reactive system, wrapping references to the values of signals. use crate::{ computed::BlockingLock, traits::{Notify, UntrackableGuard}, }; use core::fmt::Debug; use guardian::{ArcRwLockReadGuardian, ArcRwLockWriteGuardian}; use std::{ borrow::Borrow, fmt::Display, marker::PhantomData, ops::{Deref, DerefMut}, sync::{Arc, RwLock}, }; /// A wrapper type for any kind of guard returned by [`Read`](crate::traits::Read). /// /// If `Inner` implements `Deref`, so does `ReadGuard<_, Inner>`. #[derive(Debug)] pub struct ReadGuard<T, Inner> { ty: PhantomData<T>, inner: Inner, } impl<T, Inner> ReadGuard<T, Inner> { /// Creates a new wrapper around another guard type. pub fn new(inner: Inner) -> Self { Self { inner, ty: PhantomData, } } /// Returns the inner guard type. pub fn into_inner(self) -> Inner { self.inner } } impl<T, Inner> Clone for ReadGuard<T, Inner> where Inner: Clone, { fn clone(&self) -> Self { Self { ty: self.ty, inner: self.inner.clone(), } } } impl<T, Inner> Deref for ReadGuard<T, Inner> where Inner: Deref<Target = T>, { type Target = T; fn deref(&self) -> &Self::Target { self.inner.deref() } } impl<T, Inner> Borrow<T> for ReadGuard<T, Inner> where Inner: Deref<Target = T>, { fn borrow(&self) -> &T { self.deref() } } impl<T, Inner> PartialEq<T> for ReadGuard<T, Inner> where Inner: Deref<Target = T>, T: PartialEq, { fn eq(&self, other: &Inner::Target) -> bool { self.deref() == other } } impl<T, Inner> Display for ReadGuard<T, Inner> where Inner: Deref<Target = T>, T: Display, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { Display::fmt(&**self, f) } } /// A guard that provides access to a signal's inner value. pub struct Plain<T: 'static> { guard: ArcRwLockReadGuardian<T>, } impl<T: 'static> Debug for Plain<T> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("Plain").finish() } } impl<T: 'static> Plain<T> { /// Takes a reference-counted read guard on the given lock. pub fn try_new(inner: Arc<RwLock<T>>) -> Option<Self> { ArcRwLockReadGuardian::try_take(inner)? .ok() .map(|guard| Plain { guard }) } } impl<T> Deref for Plain<T> { type Target = T; fn deref(&self) -> &Self::Target { self.guard.deref() } } impl<T: PartialEq> PartialEq for Plain<T> { fn eq(&self, other: &Self) -> bool { **self == **other } } impl<T: PartialEq> PartialEq<T> for Plain<T> { fn eq(&self, other: &T) -> bool { **self == *other } } impl<T: Display> Display for Plain<T> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { Display::fmt(&**self, f) } } /// A guard that provides access to an async signal's value. pub struct AsyncPlain<T: 'static> { pub(crate) guard: async_lock::RwLockReadGuardArc<T>, } impl<T: 'static> Debug for AsyncPlain<T> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("AsyncPlain").finish() } } impl<T: 'static> AsyncPlain<T> { /// Takes a reference-counted async read guard on the given lock. pub fn try_new(inner: &Arc<async_lock::RwLock<T>>) -> Option<Self> { Some(Self { guard: inner.blocking_read_arc(), }) } } impl<T> Deref for AsyncPlain<T> { type Target = T; fn deref(&self) -> &Self::Target { self.guard.deref() } } impl<T: PartialEq> PartialEq for AsyncPlain<T> { fn eq(&self, other: &Self) -> bool { **self == **other } } impl<T: PartialEq> PartialEq<T> for AsyncPlain<T> { fn eq(&self, other: &T) -> bool { **self == *other } } impl<T: Display> Display for AsyncPlain<T> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { Display::fmt(&**self, f) } } /// A guard that maps over another guard. #[derive(Debug)] pub struct Mapped<Inner, U> where Inner: Deref, { inner: Inner, map_fn: fn(&Inner::Target) -> &U, } impl<T: 'static, U> Mapped<Plain<T>, U> { /// Creates a mapped read guard from the inner lock. pub fn try_new( inner: Arc<RwLock<T>>, map_fn: fn(&T) -> &U, ) -> Option<Self> { let inner = Plain::try_new(inner)?; Some(Self { inner, map_fn }) } } impl<Inner, U> Mapped<Inner, U> where Inner: Deref, { /// Creates a mapped read guard from the inner guard. pub fn new_with_guard( inner: Inner, map_fn: fn(&Inner::Target) -> &U, ) -> Self { Self { inner, map_fn } } } impl<Inner, U> Deref for Mapped<Inner, U> where Inner: Deref, { type Target = U; fn deref(&self) -> &Self::Target { (self.map_fn)(self.inner.deref()) } } impl<Inner, U: PartialEq> PartialEq for Mapped<Inner, U> where Inner: Deref, { fn eq(&self, other: &Self) -> bool { **self == **other } } impl<Inner, U: PartialEq> PartialEq<U> for Mapped<Inner, U> where Inner: Deref, { fn eq(&self, other: &U) -> bool { **self == *other } } impl<Inner, U: Display> Display for Mapped<Inner, U> where Inner: Deref, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { Display::fmt(&**self, f) } } /// A guard that provides mutable access to a signal's value, triggering some reactive change /// when it is dropped. #[derive(Debug)] pub struct WriteGuard<S, G> where S: Notify, { pub(crate) triggerable: Option<S>, pub(crate) guard: Option<G>, } impl<S, G> WriteGuard<S, G> where S: Notify, { /// Creates a new guard from the inner mutable guard type, and the signal that should be /// triggered on drop. pub fn new(triggerable: S, guard: G) -> Self { Self { triggerable: Some(triggerable), guard: Some(guard), } } } impl<S, G> UntrackableGuard for WriteGuard<S, G> where S: Notify, G: DerefMut, { /// Removes the triggerable type, so that it is no longer notifies when dropped. fn untrack(&mut self) { self.triggerable.take(); } } impl<S, G> Deref for WriteGuard<S, G> where S: Notify, G: Deref, { type Target = G::Target; fn deref(&self) -> &Self::Target { self.guard .as_ref() .expect( "the guard should always be in place until the Drop \ implementation", ) .deref() } } impl<S, G> DerefMut for WriteGuard<S, G> where S: Notify, G: DerefMut, { fn deref_mut(&mut self) -> &mut Self::Target { self.guard .as_mut() .expect( "the guard should always be in place until the Drop \ implementation", ) .deref_mut() } } /// A guard that provides mutable access to a signal's inner value, but does not notify of any /// changes. pub struct UntrackedWriteGuard<T: 'static>(ArcRwLockWriteGuardian<T>); impl<T: 'static> UntrackedWriteGuard<T> { /// Creates a write guard from the given lock. pub fn try_new(inner: Arc<RwLock<T>>) -> Option<Self> { ArcRwLockWriteGuardian::try_take(inner)? .ok() .map(UntrackedWriteGuard) } } impl<T> Deref for UntrackedWriteGuard<T> { type Target = T; fn deref(&self) -> &Self::Target { self.0.deref() } } impl<T> DerefMut for UntrackedWriteGuard<T> { fn deref_mut(&mut self) -> &mut Self::Target { self.0.deref_mut() } } // Dropping the write guard will notify dependencies. impl<S, T> Drop for WriteGuard<S, T> where S: Notify, { fn drop(&mut self) { // first, drop the inner guard drop(self.guard.take()); // then, notify about a change if let Some(triggerable) = self.triggerable.as_ref() { triggerable.notify(); } } } /// A mutable guard that maps over an inner mutable guard. #[derive(Debug)] pub struct MappedMut<Inner, U> where Inner: Deref, { inner: Inner, map_fn: fn(&Inner::Target) -> &U, map_fn_mut: fn(&mut Inner::Target) -> &mut U, } impl<Inner, U> UntrackableGuard for MappedMut<Inner, U> where Inner: UntrackableGuard, { fn untrack(&mut self) { self.inner.untrack(); } } impl<Inner, U> MappedMut<Inner, U> where Inner: DerefMut, { /// Creates a new writable guard from the inner guard. pub fn new( inner: Inner, map_fn: fn(&Inner::Target) -> &U, map_fn_mut: fn(&mut Inner::Target) -> &mut U, ) -> Self { Self { inner, map_fn, map_fn_mut, } } } impl<Inner, U> Deref for MappedMut<Inner, U> where Inner: Deref, { type Target = U; fn deref(&self) -> &Self::Target { (self.map_fn)(self.inner.deref()) } } impl<Inner, U> DerefMut for MappedMut<Inner, U> where Inner: DerefMut, { fn deref_mut(&mut self) -> &mut Self::Target { (self.map_fn_mut)(self.inner.deref_mut()) } } impl<Inner, U: PartialEq> PartialEq for MappedMut<Inner, U> where Inner: Deref, { fn eq(&self, other: &Self) -> bool { **self == **other } } impl<Inner, U: Display> Display for MappedMut<Inner, U> where Inner: Deref, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { Display::fmt(&**self, f) } } /// A mapped read guard in which the mapping function is a closure. If the mapping function is a /// function pointer, use [`Mapped`]. pub struct MappedArc<Inner, U> where Inner: Deref, { inner: Inner, #[allow(clippy::type_complexity)] map_fn: Arc<dyn Fn(&Inner::Target) -> &U>, } impl<Inner, U> Clone for MappedArc<Inner, U> where Inner: Clone + Deref, { fn clone(&self) -> Self { Self { inner: self.inner.clone(), map_fn: self.map_fn.clone(), } } } impl<Inner, U> Debug for MappedArc<Inner, U> where Inner: Debug + Deref, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("MappedArc") .field("inner", &self.inner) .finish_non_exhaustive() } } impl<Inner, U> MappedArc<Inner, U> where Inner: Deref, { /// Creates a new mapped guard from the inner guard and the map function. pub fn new( inner: Inner, map_fn: impl Fn(&Inner::Target) -> &U + 'static, ) -> Self { Self { inner, map_fn: Arc::new(map_fn), } } } impl<Inner, U> Deref for MappedArc<Inner, U> where Inner: Deref, { type Target = U; fn deref(&self) -> &Self::Target { (self.map_fn)(self.inner.deref()) } } impl<Inner, U: PartialEq> PartialEq for MappedArc<Inner, U> where Inner: Deref, { fn eq(&self, other: &Self) -> bool { **self == **other } } impl<Inner, U: Display> Display for MappedArc<Inner, U> where Inner: Deref, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { Display::fmt(&**self, f) } } /// A mapped write guard in which the mapping function is a closure. If the mapping function is a /// function pointer, use [`MappedMut`]. pub struct MappedMutArc<Inner, U> where Inner: Deref, { inner: Inner, #[allow(clippy::type_complexity)] map_fn: Arc<dyn Fn(&Inner::Target) -> &U>, #[allow(clippy::type_complexity)] map_fn_mut: Arc<dyn Fn(&mut Inner::Target) -> &mut U>, } impl<Inner, U> Clone for MappedMutArc<Inner, U> where Inner: Clone + Deref, { fn clone(&self) -> Self { Self { inner: self.inner.clone(), map_fn: self.map_fn.clone(), map_fn_mut: self.map_fn_mut.clone(), } } } impl<Inner, U> Debug for MappedMutArc<Inner, U> where Inner: Debug + Deref, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("MappedMutArc") .field("inner", &self.inner) .finish_non_exhaustive() } } impl<Inner, U> UntrackableGuard for MappedMutArc<Inner, U> where Inner: UntrackableGuard, { fn untrack(&mut self) { self.inner.untrack(); } } impl<Inner, U> MappedMutArc<Inner, U> where Inner: Deref, { /// Creates the new mapped mutable guard from the inner guard and mapping functions. pub fn new( inner: Inner, map_fn: impl Fn(&Inner::Target) -> &U + 'static, map_fn_mut: impl Fn(&mut Inner::Target) -> &mut U + 'static, ) -> Self { Self { inner, map_fn: Arc::new(map_fn), map_fn_mut: Arc::new(map_fn_mut), } } } impl<Inner, U> Deref for MappedMutArc<Inner, U> where Inner: Deref, { type Target = U; fn deref(&self) -> &Self::Target { (self.map_fn)(self.inner.deref()) } } impl<Inner, U> DerefMut for MappedMutArc<Inner, U> where Inner: DerefMut, { fn deref_mut(&mut self) -> &mut Self::Target { (self.map_fn_mut)(self.inner.deref_mut()) } } impl<Inner, U: PartialEq> PartialEq for MappedMutArc<Inner, U> where Inner: Deref, { fn eq(&self, other: &Self) -> bool { **self == **other } } impl<Inner, U: Display> Display for MappedMutArc<Inner, U> where Inner: Deref, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { Display::fmt(&**self, f) } } /// A wrapper that implements [`Deref`] and [`Borrow`] for itself. pub struct Derefable<T>(pub T); impl<T> Clone for Derefable<T> where T: Clone, { fn clone(&self) -> Self { Derefable(self.0.clone()) } } impl<T> std::ops::Deref for Derefable<T> { type Target = T; fn deref(&self) -> &Self::Target { &self.0 } } impl<T> Borrow<T> for Derefable<T> { fn borrow(&self) -> &T { self.deref() } } impl<T> PartialEq<T> for Derefable<T> where T: PartialEq, { fn eq(&self, other: &T) -> bool { self.deref() == other } } impl<T> Display for Derefable<T> where T: Display, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { Display::fmt(&**self, f) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/signal/write.rs
reactive_graph/src/signal/write.rs
use super::{guards::WriteGuard, ArcWriteSignal}; use crate::{ owner::{ArenaItem, FromLocal, LocalStorage, Storage, SyncStorage}, traits::{ DefinedAt, Dispose, IntoInner, IsDisposed, Notify, UntrackableGuard, Write, }, }; use core::fmt::Debug; use guardian::ArcRwLockWriteGuardian; use std::{hash::Hash, ops::DerefMut, panic::Location, sync::Arc}; /// An arena-allocated setter for a reactive signal. /// /// A signal is a piece of data that may change over time, /// and notifies other code when it has changed. /// /// This is an arena-allocated signal, which is `Copy` and is disposed when its reactive /// [`Owner`](crate::owner::Owner) cleans up. For a reference-counted signal that lives /// as long as a reference to it is alive, see [`ArcWriteSignal`]. /// /// ## Core Trait Implementations /// - [`.set()`](crate::traits::Set) sets the signal to a new value. /// - [`.update()`](crate::traits::Update) updates the value of the signal by /// applying a closure that takes a mutable reference. /// - [`.write()`](crate::traits::Write) returns a guard through which the signal /// can be mutated, and which notifies subscribers when it is dropped. /// /// > Each of these has a related `_untracked()` method, which updates the signal /// > without notifying subscribers. Untracked updates are not desirable in most /// > cases, as they cause “tearing” between the signal’s value and its observed /// > value. If you want a non-reactive container, use [`ArenaItem`] instead. /// /// ## Examples /// ``` /// # use reactive_graph::prelude::*; use reactive_graph::signal::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// let (count, set_count) = signal(0); /// /// // ✅ calling the setter sets the value /// // `set_count(1)` on nightly /// set_count.set(1); /// assert_eq!(count.get(), 1); /// /// // ❌ you could call the getter within the setter /// // set_count.set(count.get() + 1); /// /// // ✅ however it's more efficient to use .update() and mutate the value in place /// set_count.update(|count: &mut i32| *count += 1); /// assert_eq!(count.get(), 2); /// /// // ✅ `.write()` returns a guard that implements `DerefMut` and will notify when dropped /// *set_count.write() += 1; /// assert_eq!(count.get(), 3); /// ``` pub struct WriteSignal<T, S = SyncStorage> { #[cfg(any(debug_assertions, leptos_debuginfo))] pub(crate) defined_at: &'static Location<'static>, pub(crate) inner: ArenaItem<ArcWriteSignal<T>, S>, } impl<T, S> Dispose for WriteSignal<T, S> { fn dispose(self) { self.inner.dispose() } } impl<T, S> Copy for WriteSignal<T, S> {} impl<T, S> Clone for WriteSignal<T, S> { fn clone(&self) -> Self { *self } } impl<T, S> Debug for WriteSignal<T, S> where S: Debug, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("WriteSignal") .field("type", &std::any::type_name::<T>()) .field("store", &self.inner) .finish() } } impl<T, S> PartialEq for WriteSignal<T, S> { fn eq(&self, other: &Self) -> bool { self.inner == other.inner } } impl<T, S> Eq for WriteSignal<T, S> {} impl<T, S> Hash for WriteSignal<T, S> { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { self.inner.hash(state); } } impl<T, S> DefinedAt for WriteSignal<T, S> { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T> From<ArcWriteSignal<T>> for WriteSignal<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ArcWriteSignal<T>) -> Self { WriteSignal { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(value), } } } impl<T> FromLocal<ArcWriteSignal<T>> for WriteSignal<T, LocalStorage> where T: 'static, { #[track_caller] fn from_local(value: ArcWriteSignal<T>) -> Self { WriteSignal { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(value), } } } impl<T, S> IsDisposed for WriteSignal<T, S> { fn is_disposed(&self) -> bool { self.inner.is_disposed() } } impl<T, S> IntoInner for WriteSignal<T, S> where S: Storage<ArcWriteSignal<T>>, { type Value = T; #[inline(always)] fn into_inner(self) -> Option<Self::Value> { self.inner.into_inner()?.into_inner() } } impl<T, S> Notify for WriteSignal<T, S> where T: 'static, S: Storage<ArcWriteSignal<T>>, { fn notify(&self) { if let Some(inner) = self.inner.try_get_value() { inner.notify(); } } } impl<T, S> Write for WriteSignal<T, S> where T: 'static, S: Storage<ArcWriteSignal<T>>, { type Value = T; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { let guard = self.inner.try_with_value(|n| { ArcRwLockWriteGuardian::take(Arc::clone(&n.value)).ok() })??; Some(WriteGuard::new(*self, guard)) } fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { self.inner .try_with_value(|n| n.try_write_untracked()) .flatten() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/signal/mapped.rs
reactive_graph/src/signal/mapped.rs
use super::{ guards::{Mapped, MappedMutArc}, ArcRwSignal, RwSignal, }; use crate::{ owner::{StoredValue, SyncStorage}, signal::guards::WriteGuard, traits::{ DefinedAt, GetValue, IsDisposed, Notify, ReadUntracked, Track, UntrackableGuard, Write, }, }; use guardian::ArcRwLockWriteGuardian; use std::{ fmt::Debug, ops::{Deref, DerefMut}, panic::Location, sync::Arc, }; /// A derived signal type that wraps an [`ArcRwSignal`] with a mapping function, /// allowing you to read or write directly to one of its field. /// /// Tracking the mapped signal tracks changes to *any* part of the signal, and updating the signal notifies /// and notifies *all* dependencies of the signal. This is not a mechanism for fine-grained reactive updates /// to more complex data structures. Instead, it allows you to provide a signal-like API for wrapped types /// without exposing the original type directly to users. pub struct ArcMappedSignal<T> { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, #[allow(clippy::type_complexity)] try_read_untracked: Arc< dyn Fn() -> Option<DoubleDeref<Box<dyn Deref<Target = T>>>> + Send + Sync, >, try_write: Arc< dyn Fn() -> Option<Box<dyn UntrackableGuard<Target = T>>> + Send + Sync, >, notify: Arc<dyn Fn() + Send + Sync>, track: Arc<dyn Fn() + Send + Sync>, } impl<T> Clone for ArcMappedSignal<T> { fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, try_read_untracked: self.try_read_untracked.clone(), try_write: self.try_write.clone(), notify: self.notify.clone(), track: self.track.clone(), } } } impl<T> ArcMappedSignal<T> { /// Wraps a signal with the given mapping functions for shared and exclusive references. #[track_caller] pub fn new<U>( inner: ArcRwSignal<U>, map: fn(&U) -> &T, map_mut: fn(&mut U) -> &mut T, ) -> Self where T: 'static, U: Send + Sync + 'static, { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), try_read_untracked: { let this = inner.clone(); Arc::new(move || { this.try_read_untracked().map(|guard| DoubleDeref { inner: Box::new(Mapped::new_with_guard(guard, map)) as Box<dyn Deref<Target = T>>, }) }) }, try_write: { let this = inner.clone(); Arc::new(move || { let guard = ArcRwLockWriteGuardian::try_take(Arc::clone( &this.value, ))? .ok()?; let mapped = WriteGuard::new( this.clone(), MappedMutArc::new(guard, map, map_mut), ); Some(Box::new(mapped)) }) }, notify: { let this = inner.clone(); Arc::new(move || { this.notify(); }) }, track: { Arc::new(move || { inner.track(); }) }, } } } impl<T> Debug for ArcMappedSignal<T> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { let mut partial = f.debug_struct("ArcMappedSignal"); #[cfg(any(debug_assertions, leptos_debuginfo))] partial.field("defined_at", &self.defined_at); partial.finish() } } impl<T> DefinedAt for ArcMappedSignal<T> { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T> Notify for ArcMappedSignal<T> { fn notify(&self) { (self.notify)() } } impl<T> Track for ArcMappedSignal<T> { fn track(&self) { (self.track)() } } impl<T> ReadUntracked for ArcMappedSignal<T> { type Value = DoubleDeref<Box<dyn Deref<Target = T>>>; fn try_read_untracked(&self) -> Option<Self::Value> { (self.try_read_untracked)() } } impl<T> IsDisposed for ArcMappedSignal<T> { fn is_disposed(&self) -> bool { false } } impl<T> Write for ArcMappedSignal<T> where T: 'static, { type Value = T; fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { let mut guard = self.try_write()?; guard.untrack(); Some(guard) } fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { let inner = (self.try_write)()?; let inner = DoubleDeref { inner }; Some(inner) } } /// A wrapper for a smart pointer that implements [`Deref`] and [`DerefMut`] /// by dereferencing the type *inside* the smart pointer. /// /// This is quite obscure and mostly useful for situations in which we want /// a wrapper for `Box<dyn Deref<Target = T>>` that dereferences to `T` rather /// than dereferencing to `dyn Deref<Target = T>`. /// /// This is used internally in [`MappedSignal`] and [`ArcMappedSignal`]. pub struct DoubleDeref<T> { inner: T, } impl<T> Deref for DoubleDeref<T> where T: Deref, T::Target: Deref, { type Target = <T::Target as Deref>::Target; fn deref(&self) -> &Self::Target { self.inner.deref().deref() } } impl<T> DerefMut for DoubleDeref<T> where T: DerefMut, T::Target: DerefMut, { fn deref_mut(&mut self) -> &mut Self::Target { self.inner.deref_mut().deref_mut() } } impl<T> UntrackableGuard for DoubleDeref<T> where T: UntrackableGuard, T::Target: DerefMut, { fn untrack(&mut self) { self.inner.untrack(); } } /// A derived signal type that wraps an [`RwSignal`] with a mapping function, /// allowing you to read or write directly to one of its field. /// /// Tracking the mapped signal tracks changes to *any* part of the signal, and updating the signal notifies /// and notifies *all* dependencies of the signal. This is not a mechanism for fine-grained reactive updates /// to more complex data structures. Instead, it allows you to provide a signal-like API for wrapped types /// without exposing the original type directly to users. pub struct MappedSignal<T, S = SyncStorage> { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: &'static Location<'static>, inner: StoredValue<ArcMappedSignal<T>, S>, } impl<T> MappedSignal<T> { /// Wraps a signal with the given mapping functions for shared and exclusive references. #[track_caller] pub fn new<U>( inner: RwSignal<U>, map: fn(&U) -> &T, map_mut: fn(&mut U) -> &mut T, ) -> Self where T: Send + Sync + 'static, U: Send + Sync + 'static, { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: { let this = ArcRwSignal::from(inner); StoredValue::new_with_storage(ArcMappedSignal::new( this, map, map_mut, )) }, } } } impl<T> Copy for MappedSignal<T> {} impl<T> Clone for MappedSignal<T> { fn clone(&self) -> Self { *self } } impl<T> Debug for MappedSignal<T> { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { let mut partial = f.debug_struct("MappedSignal"); #[cfg(any(debug_assertions, leptos_debuginfo))] partial.field("defined_at", &self.defined_at); partial.finish() } } impl<T> DefinedAt for MappedSignal<T> { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T> Notify for MappedSignal<T> where T: 'static, { fn notify(&self) { if let Some(inner) = self.inner.try_get_value() { inner.notify(); } } } impl<T> Track for MappedSignal<T> where T: 'static, { fn track(&self) { if let Some(inner) = self.inner.try_get_value() { inner.track(); } } } impl<T> ReadUntracked for MappedSignal<T> where T: 'static, { type Value = DoubleDeref<Box<dyn Deref<Target = T>>>; fn try_read_untracked(&self) -> Option<Self::Value> { self.inner .try_get_value() .and_then(|inner| inner.try_read_untracked()) } } impl<T> Write for MappedSignal<T> where T: 'static, { type Value = T; fn try_write_untracked( &self, ) -> Option<impl DerefMut<Target = Self::Value>> { let mut guard = self.try_write()?; guard.untrack(); Some(guard) } fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { let inner = self.inner.try_get_value()?; let inner = (inner.try_write)()?; let inner = DoubleDeref { inner }; Some(inner) } } impl<T> From<ArcMappedSignal<T>> for MappedSignal<T> where T: 'static, { #[track_caller] fn from(value: ArcMappedSignal<T>) -> Self { MappedSignal { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: StoredValue::new(value), } } } impl<T> IsDisposed for MappedSignal<T> { fn is_disposed(&self) -> bool { self.inner.is_disposed() } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/signal/arc_rw.rs
reactive_graph/src/signal/arc_rw.rs
use super::{ guards::{Plain, ReadGuard, UntrackedWriteGuard, WriteGuard}, subscriber_traits::AsSubscriberSet, ArcReadSignal, ArcWriteSignal, }; use crate::{ graph::{ReactiveNode, SubscriberSet}, prelude::{IsDisposed, Notify}, traits::{DefinedAt, IntoInner, ReadUntracked, UntrackableGuard, Write}, }; use core::fmt::{Debug, Formatter, Result}; use std::{ hash::Hash, panic::Location, sync::{Arc, RwLock}, }; /// A reference-counted signal that can be read from or written to. /// /// A signal is a piece of data that may change over time, and notifies other /// code when it has changed. This is the atomic unit of reactivity, which begins all other /// processes of reactive updates. /// /// This is a reference-counted signal, which is `Clone` but not `Copy`. /// For arena-allocated `Copy` signals, use [`RwSignal`](super::RwSignal). /// /// ## Core Trait Implementations /// /// ### Reading the Value /// - [`.get()`](crate::traits::Get) clones the current value of the signal. /// If you call it within an effect, it will cause that effect to subscribe /// to the signal, and to re-run whenever the value of the signal changes. /// - [`.get_untracked()`](crate::traits::GetUntracked) clones the value of /// the signal without reactively tracking it. /// - [`.read()`](crate::traits::Read) returns a guard that allows accessing the /// value of the signal by reference. If you call it within an effect, it will /// cause that effect to subscribe to the signal, and to re-run whenever the /// value of the signal changes. /// - [`.read_untracked()`](crate::traits::ReadUntracked) gives access to the /// current value of the signal without reactively tracking it. /// - [`.with()`](crate::traits::With) allows you to reactively access the signal’s /// value without cloning by applying a callback function. /// - [`.with_untracked()`](crate::traits::WithUntracked) allows you to access /// the signal’s value by applying a callback function without reactively /// tracking it. /// - [`.to_stream()`](crate::traits::ToStream) converts the signal to an `async` /// stream of values. /// /// ### Updating the Value /// - [`.set()`](crate::traits::Set) sets the signal to a new value. /// - [`.update()`](crate::traits::Update) updates the value of the signal by /// applying a closure that takes a mutable reference. /// - [`.write()`](crate::traits::Write) returns a guard through which the signal /// can be mutated, and which notifies subscribers when it is dropped. /// /// > Each of these has a related `_untracked()` method, which updates the signal /// > without notifying subscribers. Untracked updates are not desirable in most /// > cases, as they cause “tearing” between the signal’s value and its observed /// > value. If you want a non-reactive container, used [`ArenaItem`](crate::owner::ArenaItem) /// > instead. /// /// ## Examples /// /// ``` /// # use reactive_graph::prelude::*; /// # use reactive_graph::signal::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// let count = ArcRwSignal::new(0); /// /// // ✅ calling the getter clones and returns the value /// // this can be `count()` on nightly /// assert_eq!(count.get(), 0); /// /// // ✅ calling the setter sets the value /// // this can be `set_count(1)` on nightly /// count.set(1); /// assert_eq!(count.get(), 1); /// /// // ❌ you could call the getter within the setter /// // set_count.set(count.get() + 1); /// /// // ✅ however it's more efficient to use .update() and mutate the value in place /// count.update(|count: &mut i32| *count += 1); /// assert_eq!(count.get(), 2); /// /// // ✅ you can create "derived signals" with a Fn() -> T interface /// let double_count = { /// // clone before moving into the closure because we use it below /// let count = count.clone(); /// move || count.get() * 2 /// }; /// count.set(0); /// assert_eq!(double_count(), 0); /// count.set(1); /// assert_eq!(double_count(), 2); /// ``` pub struct ArcRwSignal<T> { #[cfg(any(debug_assertions, leptos_debuginfo))] pub(crate) defined_at: &'static Location<'static>, pub(crate) value: Arc<RwLock<T>>, pub(crate) inner: Arc<RwLock<SubscriberSet>>, } impl<T> Clone for ArcRwSignal<T> { #[track_caller] fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, value: Arc::clone(&self.value), inner: Arc::clone(&self.inner), } } } impl<T> Debug for ArcRwSignal<T> { fn fmt(&self, f: &mut Formatter<'_>) -> Result { f.debug_struct("ArcRwSignal") .field("type", &std::any::type_name::<T>()) .field("value", &Arc::as_ptr(&self.value)) .finish() } } impl<T> PartialEq for ArcRwSignal<T> { fn eq(&self, other: &Self) -> bool { Arc::ptr_eq(&self.value, &other.value) } } impl<T> Eq for ArcRwSignal<T> {} impl<T> Hash for ArcRwSignal<T> { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { std::ptr::hash(&Arc::as_ptr(&self.value), state); } } impl<T> Default for ArcRwSignal<T> where T: Default, { #[track_caller] fn default() -> Self { Self::new(T::default()) } } impl<T> ArcRwSignal<T> { /// Creates a new signal, taking the initial value as its argument. #[cfg_attr( feature = "tracing", tracing::instrument(level = "trace", skip_all) )] #[track_caller] pub fn new(value: T) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), value: Arc::new(RwLock::new(value)), inner: Arc::new(RwLock::new(SubscriberSet::new())), } } /// Returns a read-only handle to the signal. #[track_caller] pub fn read_only(&self) -> ArcReadSignal<T> { ArcReadSignal { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), value: Arc::clone(&self.value), inner: Arc::clone(&self.inner), } } /// Returns a write-only handle to the signal. #[track_caller] pub fn write_only(&self) -> ArcWriteSignal<T> { ArcWriteSignal { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), value: Arc::clone(&self.value), inner: Arc::clone(&self.inner), } } /// Splits the signal into its readable and writable halves. #[track_caller] pub fn split(&self) -> (ArcReadSignal<T>, ArcWriteSignal<T>) { (self.read_only(), self.write_only()) } /// Reunites the two halves of a signal. Returns `None` if the two signals /// provided were not created from the same signal. #[track_caller] pub fn unite( read: ArcReadSignal<T>, write: ArcWriteSignal<T>, ) -> Option<Self> { if Arc::ptr_eq(&read.inner, &write.inner) { Some(Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), value: read.value, inner: read.inner, }) } else { None } } } impl<T> DefinedAt for ArcRwSignal<T> { #[inline(always)] fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T> IsDisposed for ArcRwSignal<T> { #[inline(always)] fn is_disposed(&self) -> bool { false } } impl<T> IntoInner for ArcRwSignal<T> { type Value = T; #[inline(always)] fn into_inner(self) -> Option<Self::Value> { Some(Arc::into_inner(self.value)?.into_inner().unwrap()) } } impl<T> AsSubscriberSet for ArcRwSignal<T> { type Output = Arc<RwLock<SubscriberSet>>; #[inline(always)] fn as_subscriber_set(&self) -> Option<Self::Output> { Some(Arc::clone(&self.inner)) } } impl<T: 'static> ReadUntracked for ArcRwSignal<T> { type Value = ReadGuard<T, Plain<T>>; fn try_read_untracked(&self) -> Option<Self::Value> { Plain::try_new(Arc::clone(&self.value)).map(ReadGuard::new) } } impl<T> Notify for ArcRwSignal<T> { fn notify(&self) { self.mark_dirty(); } } impl<T: 'static> Write for ArcRwSignal<T> { type Value = T; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { self.value .write() .ok() .map(|guard| WriteGuard::new(self.clone(), guard)) } #[allow(refining_impl_trait)] fn try_write_untracked(&self) -> Option<UntrackedWriteGuard<Self::Value>> { UntrackedWriteGuard::try_new(Arc::clone(&self.value)) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/signal/arc_write.rs
reactive_graph/src/signal/arc_write.rs
use super::guards::{UntrackedWriteGuard, WriteGuard}; use crate::{ graph::{ReactiveNode, SubscriberSet}, prelude::{IsDisposed, Notify}, traits::{DefinedAt, IntoInner, UntrackableGuard, Write}, }; use core::fmt::{Debug, Formatter, Result}; use std::{ hash::Hash, panic::Location, sync::{Arc, RwLock}, }; /// A reference-counted setter for a reactive signal. /// /// A signal is a piece of data that may change over time, /// and notifies other code when it has changed. /// /// This is a reference-counted signal, which is `Clone` but not `Copy`. /// For arena-allocated `Copy` signals, use [`WriteSignal`](super::WriteSignal). /// /// ## Core Trait Implementations /// - [`.set()`](crate::traits::Set) sets the signal to a new value. /// - [`.update()`](crate::traits::Update) updates the value of the signal by /// applying a closure that takes a mutable reference. /// - [`.write()`](crate::traits::Write) returns a guard through which the signal /// can be mutated, and which notifies subscribers when it is dropped. /// /// > Each of these has a related `_untracked()` method, which updates the signal /// > without notifying subscribers. Untracked updates are not desirable in most /// > cases, as they cause “tearing” between the signal’s value and its observed /// > value. If you want a non-reactive container, used [`ArenaItem`](crate::owner::ArenaItem) /// > instead. /// /// ## Examples /// ``` /// # use reactive_graph::prelude::*; use reactive_graph::signal::*; /// let (count, set_count) = arc_signal(0); /// /// // ✅ calling the setter sets the value /// // `set_count(1)` on nightly /// set_count.set(1); /// assert_eq!(count.get(), 1); /// /// // ❌ you could call the getter within the setter /// // set_count.set(count.get() + 1); /// /// // ✅ however it's more efficient to use .update() and mutate the value in place /// set_count.update(|count: &mut i32| *count += 1); /// assert_eq!(count.get(), 2); /// /// // ✅ `.write()` returns a guard that implements `DerefMut` and will notify when dropped /// *set_count.write() += 1; /// assert_eq!(count.get(), 3); /// ``` pub struct ArcWriteSignal<T> { #[cfg(any(debug_assertions, leptos_debuginfo))] pub(crate) defined_at: &'static Location<'static>, pub(crate) value: Arc<RwLock<T>>, pub(crate) inner: Arc<RwLock<SubscriberSet>>, } impl<T> Clone for ArcWriteSignal<T> { #[track_caller] fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, value: Arc::clone(&self.value), inner: Arc::clone(&self.inner), } } } impl<T> Debug for ArcWriteSignal<T> { fn fmt(&self, f: &mut Formatter<'_>) -> Result { f.debug_struct("ArcWriteSignal") .field("type", &std::any::type_name::<T>()) .field("value", &Arc::as_ptr(&self.value)) .finish() } } impl<T> PartialEq for ArcWriteSignal<T> { fn eq(&self, other: &Self) -> bool { Arc::ptr_eq(&self.value, &other.value) } } impl<T> Eq for ArcWriteSignal<T> {} impl<T> Hash for ArcWriteSignal<T> { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { std::ptr::hash(&Arc::as_ptr(&self.value), state); } } impl<T> DefinedAt for ArcWriteSignal<T> { #[inline(always)] fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T> IsDisposed for ArcWriteSignal<T> { #[inline(always)] fn is_disposed(&self) -> bool { false } } impl<T> IntoInner for ArcWriteSignal<T> { type Value = T; #[inline(always)] fn into_inner(self) -> Option<Self::Value> { Some(Arc::into_inner(self.value)?.into_inner().unwrap()) } } impl<T> Notify for ArcWriteSignal<T> { fn notify(&self) { self.inner.mark_dirty(); } } impl<T: 'static> Write for ArcWriteSignal<T> { type Value = T; fn try_write(&self) -> Option<impl UntrackableGuard<Target = Self::Value>> { self.value .write() .ok() .map(|guard| WriteGuard::new(self.clone(), guard)) } #[allow(refining_impl_trait)] fn try_write_untracked(&self) -> Option<UntrackedWriteGuard<Self::Value>> { UntrackedWriteGuard::try_new(Arc::clone(&self.value)) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/signal/arc_read.rs
reactive_graph/src/signal/arc_read.rs
use super::{ guards::{Plain, ReadGuard}, subscriber_traits::AsSubscriberSet, }; use crate::{ graph::SubscriberSet, traits::{DefinedAt, IntoInner, IsDisposed, ReadUntracked}, }; use core::fmt::{Debug, Formatter, Result}; use std::{ hash::Hash, panic::Location, sync::{Arc, RwLock}, }; /// A reference-counted getter for a reactive signal. /// /// A signal is a piece of data that may change over time, /// and notifies other code when it has changed. /// /// This is a reference-counted signal, which is `Clone` but not `Copy`. /// For arena-allocated `Copy` signals, use [`ReadSignal`](super::ReadSignal). /// /// ## Core Trait Implementations /// - [`.get()`](crate::traits::Get) clones the current value of the signal. /// If you call it within an effect, it will cause that effect to subscribe /// to the signal, and to re-run whenever the value of the signal changes. /// - [`.get_untracked()`](crate::traits::GetUntracked) clones the value of /// the signal without reactively tracking it. /// - [`.read()`](crate::traits::Read) returns a guard that allows accessing the /// value of the signal by reference. If you call it within an effect, it will /// cause that effect to subscribe to the signal, and to re-run whenever the /// value of the signal changes. /// - [`.read_untracked()`](crate::traits::ReadUntracked) gives access to the /// current value of the signal without reactively tracking it. /// - [`.with()`](crate::traits::With) allows you to reactively access the signal’s /// value without cloning by applying a callback function. /// - [`.with_untracked()`](crate::traits::WithUntracked) allows you to access /// the signal’s value by applying a callback function without reactively /// tracking it. /// - [`.to_stream()`](crate::traits::ToStream) converts the signal to an `async` /// stream of values. /// - [`::from_stream()`](crate::traits::FromStream) converts an `async` stream /// of values into a signal containing the latest value. /// /// ## Examples /// ``` /// # use reactive_graph::prelude::*; use reactive_graph::signal::*; /// let (count, set_count) = arc_signal(0); /// /// // calling .get() clones and returns the value /// assert_eq!(count.get(), 0); /// // calling .read() accesses the value by reference /// assert_eq!(count.read(), 0); /// ``` pub struct ArcReadSignal<T> { #[cfg(any(debug_assertions, leptos_debuginfo))] pub(crate) defined_at: &'static Location<'static>, pub(crate) value: Arc<RwLock<T>>, pub(crate) inner: Arc<RwLock<SubscriberSet>>, } impl<T> Clone for ArcReadSignal<T> { #[track_caller] fn clone(&self) -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: self.defined_at, value: Arc::clone(&self.value), inner: Arc::clone(&self.inner), } } } impl<T> Debug for ArcReadSignal<T> { fn fmt(&self, f: &mut Formatter<'_>) -> Result { f.debug_struct("ArcReadSignal") .field("type", &std::any::type_name::<T>()) .field("value", &Arc::as_ptr(&self.value)) .finish() } } impl<T: Default> Default for ArcReadSignal<T> { #[track_caller] fn default() -> Self { Self { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), value: Arc::new(RwLock::new(T::default())), inner: Arc::new(RwLock::new(SubscriberSet::new())), } } } impl<T> PartialEq for ArcReadSignal<T> { fn eq(&self, other: &Self) -> bool { Arc::ptr_eq(&self.value, &other.value) } } impl<T> Eq for ArcReadSignal<T> {} impl<T> Hash for ArcReadSignal<T> { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { std::ptr::hash(&Arc::as_ptr(&self.value), state); } } impl<T> DefinedAt for ArcReadSignal<T> { #[inline(always)] fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T> IsDisposed for ArcReadSignal<T> { #[inline(always)] fn is_disposed(&self) -> bool { false } } impl<T> IntoInner for ArcReadSignal<T> { type Value = T; #[inline(always)] fn into_inner(self) -> Option<Self::Value> { Some(Arc::into_inner(self.value)?.into_inner().unwrap()) } } impl<T> AsSubscriberSet for ArcReadSignal<T> { type Output = Arc<RwLock<SubscriberSet>>; #[inline(always)] fn as_subscriber_set(&self) -> Option<Self::Output> { Some(Arc::clone(&self.inner)) } } impl<T: 'static> ReadUntracked for ArcReadSignal<T> { type Value = ReadGuard<T, Plain<T>>; #[track_caller] fn try_read_untracked(&self) -> Option<Self::Value> { Plain::try_new(Arc::clone(&self.value)).map(ReadGuard::new) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false
leptos-rs/leptos
https://github.com/leptos-rs/leptos/blob/dd507168fa47b5eead64339431b0bd654bd1c951/reactive_graph/src/signal/read.rs
reactive_graph/src/signal/read.rs
use super::{ guards::{Plain, ReadGuard}, subscriber_traits::AsSubscriberSet, ArcReadSignal, }; use crate::{ graph::SubscriberSet, owner::{ArenaItem, FromLocal, LocalStorage, Storage, SyncStorage}, traits::{DefinedAt, Dispose, IntoInner, IsDisposed, ReadUntracked}, unwrap_signal, }; use core::fmt::Debug; use std::{ hash::Hash, panic::Location, sync::{Arc, RwLock}, }; /// An arena-allocated getter for a reactive signal. /// /// A signal is a piece of data that may change over time, /// and notifies other code when it has changed. /// /// This is an arena-allocated signal, which is `Copy` and is disposed when its reactive /// [`Owner`](crate::owner::Owner) cleans up. For a reference-counted signal that lives /// as long as a reference to it is alive, see [`ArcReadSignal`]. /// /// ## Core Trait Implementations /// - [`.get()`](crate::traits::Get) clones the current value of the signal. /// If you call it within an effect, it will cause that effect to subscribe /// to the signal, and to re-run whenever the value of the signal changes. /// - [`.get_untracked()`](crate::traits::GetUntracked) clones the value of /// the signal without reactively tracking it. /// - [`.read()`](crate::traits::Read) returns a guard that allows accessing the /// value of the signal by reference. If you call it within an effect, it will /// cause that effect to subscribe to the signal, and to re-run whenever the /// value of the signal changes. /// - [`.read_untracked()`](crate::traits::ReadUntracked) gives access to the /// current value of the signal without reactively tracking it. /// - [`.with()`](crate::traits::With) allows you to reactively access the signal’s /// value without cloning by applying a callback function. /// - [`.with_untracked()`](crate::traits::WithUntracked) allows you to access /// the signal’s value by applying a callback function without reactively /// tracking it. /// - [`.to_stream()`](crate::traits::ToStream) converts the signal to an `async` /// stream of values. /// - [`::from_stream()`](crate::traits::FromStream) converts an `async` stream /// of values into a signal containing the latest value. /// /// ## Examples /// ``` /// # use reactive_graph::prelude::*; use reactive_graph::signal::*; let owner = reactive_graph::owner::Owner::new(); owner.set(); /// let (count, set_count) = signal(0); /// /// // calling .get() clones and returns the value /// assert_eq!(count.get(), 0); /// // calling .read() accesses the value by reference /// assert_eq!(count.read(), 0); /// ``` pub struct ReadSignal<T, S = SyncStorage> { #[cfg(any(debug_assertions, leptos_debuginfo))] pub(crate) defined_at: &'static Location<'static>, pub(crate) inner: ArenaItem<ArcReadSignal<T>, S>, } impl<T, S> Dispose for ReadSignal<T, S> { fn dispose(self) { self.inner.dispose() } } impl<T, S> Copy for ReadSignal<T, S> {} impl<T, S> Clone for ReadSignal<T, S> { fn clone(&self) -> Self { *self } } impl<T, S> Debug for ReadSignal<T, S> where S: Debug, { fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result { f.debug_struct("ReadSignal") .field("type", &std::any::type_name::<T>()) .field("store", &self.inner) .finish() } } impl<T, S> PartialEq for ReadSignal<T, S> { fn eq(&self, other: &Self) -> bool { self.inner == other.inner } } impl<T, S> Eq for ReadSignal<T, S> {} impl<T, S> Hash for ReadSignal<T, S> { fn hash<H: std::hash::Hasher>(&self, state: &mut H) { self.inner.hash(state); } } impl<T, S> DefinedAt for ReadSignal<T, S> { fn defined_at(&self) -> Option<&'static Location<'static>> { #[cfg(any(debug_assertions, leptos_debuginfo))] { Some(self.defined_at) } #[cfg(not(any(debug_assertions, leptos_debuginfo)))] { None } } } impl<T, S> IsDisposed for ReadSignal<T, S> { fn is_disposed(&self) -> bool { self.inner.is_disposed() } } impl<T, S> IntoInner for ReadSignal<T, S> where S: Storage<ArcReadSignal<T>>, { type Value = T; #[inline(always)] fn into_inner(self) -> Option<Self::Value> { self.inner.into_inner()?.into_inner() } } impl<T, S> AsSubscriberSet for ReadSignal<T, S> where S: Storage<ArcReadSignal<T>>, { type Output = Arc<RwLock<SubscriberSet>>; fn as_subscriber_set(&self) -> Option<Self::Output> { self.inner .try_with_value(|inner| inner.as_subscriber_set()) .flatten() } } impl<T, S> ReadUntracked for ReadSignal<T, S> where T: 'static, S: Storage<ArcReadSignal<T>>, { type Value = ReadGuard<T, Plain<T>>; fn try_read_untracked(&self) -> Option<Self::Value> { self.inner .try_get_value() .map(|inner| inner.read_untracked()) } } impl<T> From<ArcReadSignal<T>> for ReadSignal<T> where T: Send + Sync + 'static, { #[track_caller] fn from(value: ArcReadSignal<T>) -> Self { ReadSignal { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(value), } } } impl<T> FromLocal<ArcReadSignal<T>> for ReadSignal<T, LocalStorage> where T: 'static, { #[track_caller] fn from_local(value: ArcReadSignal<T>) -> Self { ReadSignal { #[cfg(any(debug_assertions, leptos_debuginfo))] defined_at: Location::caller(), inner: ArenaItem::new_with_storage(value), } } } impl<T, S> From<ReadSignal<T, S>> for ArcReadSignal<T> where T: 'static, S: Storage<ArcReadSignal<T>>, { #[track_caller] fn from(value: ReadSignal<T, S>) -> Self { value .inner .try_get_value() .unwrap_or_else(unwrap_signal!(value)) } }
rust
MIT
dd507168fa47b5eead64339431b0bd654bd1c951
2026-01-04T15:41:20.302544Z
false