language
large_stringclasses
1 value
text
stringlengths
9
2.95M
C
#include<stdio.h> #include<windows.h> #include<stdlib.h> int main() { /*int n = 5; do printf("countdown %d !!!\n", n); while (n-- > 0); printf("ǡ̾~~\n");*/ //goto /*goto A; B: printf(" 1\n"); printf(" 2\n"); printf(" 3\n"); printf(" 4\n"); printf(" 5\n"); printf(" 6\n"); goto C; A: printf(" 7\n"); goto B; C:*/ //break /*int breakNumber = 0; int n = 0; printf("1~100 ȣ ߿ ϳ :"); scanf_s(" %d", &breakNumber); for (n = 1; n <= 100; n++) { if (n == breakNumber) break; printf("%d\n",n); }*/ //continue /*int checknumber = 0; int n = 0; int isOdd = 0; printf(" Էϼ : "); scanf_s(" %d", &checknumber); isOdd = checknumber % 2 == 1; for (n = 1; n < 100; n++) { if (n % 2 == isOdd) continue; printf("%d\n", n); }*/ // /*int start_num, final_num; printf(" ȣ Էϼ : "); scanf_s(" %d", &start_num); printf(" ȣ Էϼ : "); scanf_s(" %d", &final_num); while (++start_num < final_num) printf("%d\n", start_num);*/ //ݺ /*int loopnum,num,i,j,k; printf("ݺ Ƚ Էϼ : "); scanf_s(" %d", &loopnum); printf("ڸ Էϼ : "); scanf_s(" %d", &num); for (i = 0; i < loopnum; i++) { j = (num % 2) ? -i : i - loopnum+1; for (; j <= 0; j++) printf(""); printf("\n"); } for (i = 0; i < loopnum; i++) { if (num % 2) for (j = 0; j < i+1; j++) printf(""); else for(j=0;j<loopnum-i;j++) printf(""); putchar('\n'); } */ //迭 /*int n = 0; int numbers[10] = { 0,1,2,3,4,5,6,7,8 }; printf("numbers addr = %u\n", numbers); printf("numbers[0] addr = %u\n", &numbers[0]); for (n = 0; n < 10; n++) { printf("numbers[%d] addr = %u\n", n,&numbers[n]); printf("numbers[%d] = %d\n", n, numbers[n]); }*/ //迭 int numbers[10]; int n,m,number; printf("ڸ Է ϼ : "); scanf_s(" %d", &number); m = (number % 2)? 1:2; for (n = 0; n < 10; n++) { numbers[n] = n * 2 + m; printf("%d\n", numbers[n]); } rand(); system("pause"); return 0; }
C
#include "tests.h" int main() { setup(); Socket * sock = malloc(sizeof(Socket)); *sock = (Socket) {.data = NULL}; assert(netConnect(sock) == ENULL_POINTER && "Did not receive the expected value for null data"); free(sock); cleanup(); }
C
// // Created by Once on 2019/7/22. // #ifndef TREE_BTREE_H #define TREE_BTREE_H // 键值数组结构 typedef struct column{ int id; // 关键字 char title[70]; } Column; // B树结点 typedef struct bnode{ int size; // 当前关键字数目 Column **columns; // 键值数组 struct bnode **children; // 儿子指针数组 struct bnode *parent; //父指针 struct bnode *next; //横向顺序查找的链表指针 unsigned int leaf; // 是否为叶子 1是 0否 } BNode; // B树ADT对外接口 typedef struct btree{ unsigned int degree; // 度数 BNode *root; // 根结点 BNode *head; // 叶子链表的头结点 unsigned int size; // B树结点大小 } BTree; // B树算法操作声明 extern BTree *btree_init(unsigned int degree); //初始化 extern int btree_is_empty(BTree *btree); //空 extern int btree_add(BTree *btree, Column *column); //添加一个节点 extern int btree_delete_by_id(BTree *btree, int id); // 按id删除一个节点 extern Column *btree_max(BTree *btree); //最大值 extern Column *btree_min(BTree *btree); // 最小值 extern Column *btree_get_by_value(BTree *btree, Column * c); //按值获取一个节点 extern void btree_traverse(BTree *btree, void(*traverse)(BNode*));//遍历 extern int btree_clear(BTree *btree);//释放空间 extern void print_node_data(BNode *node); extern void print_node(BNode *node); extern int btree_node_count(BTree *btree); extern int btree_leaf_count(BTree *btree); extern void setDebug(int d); // 最小度数t>=2,度数就是子树个数 // 根结点的关键字数最小为1 // 非叶非根结点的度数:t <= T <= 2t-1 // 非根结点的关键字数:t <= K <= 2t-1 // 关键数K和度数的关系为:K = T。 // 所有叶子结点的深度相同 // 满关键字为2t-1,分裂为两个子树 #endif //TREE_BTREE_H
C
/* This program is a part of RW mudlib * See /doc/help/copyright for more info ----------------------------------------- * File : Lock.c * Author : * Date : 2003-05-02 * Note : O * Update : * o 2000-00-00 * ----------------------------------------- */ #include <map.h> #include <lock.h> #include <feature.h> #include <message.h> #include <daemon.h> #include <location.h> inherit COMMAND; string help = @HELP oOiAWݩAؿvA~HLkiXQAWC lock 'V' - NYӤVW (north, south, east, west, northeast, northwest, southeast, southwest, up, down) HELP; private void do_command(object me, string arg) { int locktype; string option; mapping exits; mapping a = ([ "west" : "east", "east" : "west", "north" : "south", "south" : "north", "northeast" : "southwest", "northwest" : "southeast", "southeast" : "northwest", "southwest" : "northeast", "up" : "down", "down" : "up" ]); object env, to; env = environment(me); if( !arg ) return tell(me, pnoun(2, me)+"QnN@ӤVWH\n"); sscanf(arg, "%s %s", arg, option); switch(option) { case "wiz": if( wizardp(me) ) locktype = WIZLOCKED; else locktype = LOCKED; break; default: locktype = LOCKED; } if( !env->is_maproom() ) { if( !wizardp(me) && query("owner", env) != me->query_id(1) ) return tell(me, "ǫäOAؿvALkWC\n"); if( !mapp(exits = query("exits", env)) ) return tell(me, "ǫèSXfAnWOH\n"); if( !exits[arg] ) return tell(me, "ǫèSoӤVALkoVWC\n"); if( arrayp(exits[arg]) ) { set("lock/"+arg, query("lock/"+arg, env) | locktype, env); CITY_D->set_coor_data(exits[arg], "lock", CITY_D->query_coor_data(exits[arg], "lock") | locktype); } else { to = load_object(exits[arg]); set("lock/"+arg, query("lock/"+arg, env) | locktype, env); set("lock/"+a[arg], query("lock/"+a[arg], to) | locktype, to); broadcast(to, "GH "+a[arg] +"VF_ӡC\n"); } tell(me, pnoun(2, me)+"⩹ "+capitalize(arg)+" VF_ӡC\n"); } else { int x, y, num; string city; array loc = query_temp("location", me); x = loc[X]; y = loc[Y]; city = loc[CITY]; num = loc[NUM]; if( !CITY_D->is_city_location(loc) ) return tell(me, "oSiH"+pnoun(2, me)+"WC\n"); switch(arg) { case "north": loc = arrange_city_location(x, --y, city, num); break; case "south": loc = arrange_city_location(x, ++y, city, num); break; case "east": loc = arrange_city_location(++x, y, city, num); break; case "west": loc = arrange_city_location(--x, y, city, num); break; case "northeast": loc = arrange_city_location(++x, --y, city, num); break; case "northwest": loc = arrange_city_location(--x, --y, city, num); break; case "southeast": loc = arrange_city_location(++x, ++y, city, num); break; case "southwest": loc = arrange_city_location(--x, ++y, city, num); break; default: return tell(me, pnoun(2, me)+"QnN@ӤVWH\n"); } if( !CITY_D->valid_coordinate(x, y, city, num) ) return tell(me, "ӤVOXzyСC\n"); if( !wizardp(me) && CITY_D->query_coor_data(loc, "owner") != me->query_id(1) ) return tell(me, "ǫäOAؿvALkWC\n"); if( CITY_D->query_coor_data(loc, TYPE) != DOOR ) return tell(me, "̨èSALkWC\n"); if( ESTATE_D->query_loc_estate(loc)["type"] == "land" ) return tell(me, "u@An֡H\n"); CITY_D->set_coor_data(loc, "lock", CITY_D->query_coor_data(loc, "lock") | locktype); tell(me, pnoun(2, me)+"⩹ "+capitalize(arg)+" VF_ӡC\n"); } }
C
#include<stdio.h> void main(){ const int first; int second; const int third; printf("enter value:\n"); scanf("%d\n",&first); scanf("%d\n",&second); scanf("%d\n",&third); printf("first value=%d\n",first); printf("second value=%d\n",second); printf("third value=%d\n",third); first=first+5; second=second+3; third=third+2; printf("first value=%d\n",first); printf("second value=%d\n",second); printf("third value=%d\n",third); }
C
#include<stdio.h> #define m 1000 int fun(int xx[], int n) { int cnt = 0; for(int i = 3; i < n; i++) { for(int j = 2; j < i; j++) if(i % j == 0) xx[cnt++] = i; } return cnt; } int main() { int xx[m]; for(int i = 0; i < m; i++) xx[i] = 0; int n = fun(xx, 17); printf("%d\n",n); for(int i = 0; xx[i] != 0; i++) printf("%d ",xx[i]); printf("\n"); return 0; }
C
#include <stdint.h> #include <sys/mman.h> #include <fcntl.h> #include <unistd.h> #include <limits.h> #include "test.h" #ifndef PAGE_SIZE #define PAGE_SIZE sysconf(_SC_PAGE_SIZE) #endif #ifndef MAP_ANONYMOUS #define MAP_ANONYMOUS 0 #endif /* max mmap size, *start is the largest power-of-2 size considered */ static size_t mmax(int fd, size_t *start) { size_t i, n; void *p; for (i=n=*start; i>=PAGE_SIZE; i/=2) { if ((p=mmap(0, n, PROT_NONE, MAP_PRIVATE|MAP_ANONYMOUS, fd, 0)) == MAP_FAILED) { n -= i/2; } else { munmap(p, n); if (n == i) *start = n; n += i/2; } } return n & -PAGE_SIZE; } /* fills the virtual memory with anonymous PROT_NONE mmaps, returns the mappings in *p and *n in decreasing size order, the return value is the number of mappings or -1 on failure. */ int t_vmfill(void **p, size_t *n, int len) { int fd = MAP_ANONYMOUS ? -1 : open("/dev/zero", O_RDWR); size_t start = SIZE_MAX/2 + 1; size_t m; void *q; int i; for (i=0;;i++) { m = mmax(fd, &start); if (!m) break; q = mmap(0, m, PROT_NONE, MAP_PRIVATE|MAP_ANONYMOUS, fd, 0); if (q == MAP_FAILED) return -1; if (i < len) { p[i] = q; n[i] = m; } } return i; }
C
#include <stdio.h> #include <stdlib.h> #include <string.h> #include <errno.h> #include "debug.h" #include "ss_data.h" // TODO: I should import the header file with the definition for the /* A view in the matrix allows to extract any subset of values from a matrix. */ struct matrix_view { int lb[3]; int ub[3]; }; /* Generic matrix representation. */ struct matrix { int dimx, dimy, dimz; size_t size_elem; enum storage_type mat_storage; struct matrix_view mat_view; void *pdata; }; /* Cache structure to "map" a bounding box to corresponding nodes in the space. */ struct sfc_hash_cache { struct list_head sh_entry; struct bbox sh_bb; struct dht_entry **sh_de_tab; int sh_nodes; }; static LIST_HEAD(sfc_hash_list); static int compute_bits(unsigned int n) { int nr_bits = 0; while(n) { n = n >> 1; nr_bits++; } return nr_bits; } int sh_add(const struct bbox *bb, struct dht_entry *de_tab[], int n) { struct sfc_hash_cache *shc; int i, err = -ENOMEM; shc = malloc(sizeof(*shc) + sizeof(de_tab[0]) * n); if(!shc) goto err_out; shc->sh_bb = *bb; shc->sh_nodes = n; shc->sh_de_tab = (struct dht_entry **) (shc + 1); for(i = 0; i < n; i++) shc->sh_de_tab[i] = de_tab[i]; list_add_tail(&shc->sh_entry, &sfc_hash_list); return 0; err_out: uloga("'%s()': failed with %d.\n", __func__, err); return err; } int sh_find(const struct bbox *bb, struct dht_entry *de_tab[]) { struct sfc_hash_cache *shc; int i; list_for_each_entry(shc, &sfc_hash_list, sh_entry) { if(bbox_equals(bb, &shc->sh_bb)) { for(i = 0; i < shc->sh_nodes; i++) de_tab[i] = shc->sh_de_tab[i]; return shc->sh_nodes; } } return -1; } void sh_free(void) { struct sfc_hash_cache *l, *t; int n = 0; list_for_each_entry_safe(l, t, &sfc_hash_list, sh_entry) { free(l); n++; } #ifdef DEBUG uloga("'%s()': SFC cached %d object descriptors, size = %zu.\n", __func__, n, sizeof(*l) * n); #endif } #if 0 /* DELETE this unused part. */ /* Allocate and initialize a matrix "view". It allows you to easily access the elements of sub-matrix described by bounding box bb_loc from the matrix described by bb_glb. When accessing the sub-matrix, the indices should be reversed, i.e., A(k, j, i). */ static struct matrix *matrix_alloc(struct bbox *bb_glb, struct bbox *bb_loc, void *data, size_t se) { struct matrix *mat; size_t size; int dimx, dimy, dimz; int shx, shy, shz; int i, j; dimx = bbox_dist(bb_glb, 0); dimy = bbox_dist(bb_glb, 1); dimz = bbox_dist(bb_glb, 2); size = sizeof(*mat) + sizeof(void ***) * dimz + sizeof(void **) * dimx * dimz; mat = malloc(size); if(!mat) return NULL; mat->data = data; mat->se = se; /* X is columns. */ mat->dimx = bbox_dist(bb_loc, 0); /* Y is rows. */ mat->dimy = bbox_dist(bb_loc, 1); /* Z is slices of 2d matrices of XxY. */ mat->dimz = bbox_dist(bb_loc, 2); mat->m = (void ***) (mat + 1); /* for (i = 0; i < mat->z_dim; i++) { mat->m[i] = (double **) (mat->m + mat->z_dim + i * mat->y_dim); for (j = 0; j < mat->y_dim; j++) mat->m[i][j] = data + (i + bb_loc->lb.c[2]) * x_dim * y_dim + (j + bb_loc->lb.c[1]) * x_dim + bb_loc->lb.c[0]; } */ /* Shift amounts from the initial matrix. */ shx = bb_loc->lb.c[0] - bb_glb->lb.c[0]; shy = bb_loc->lb.c[1] - bb_glb->lb.c[1]; shz = bb_loc->lb.c[2] - bb_glb->lb.c[2]; /* Column major matrix representation. */ for(i = 0; i < mat->dimz; i++) { mat->m[i] = (void **) (mat->m + dimz + i * dimx); for(j = 0; j < mat->dimx; j++) mat->m[i][j] = data + /* Skip 'i' 2d slices. */ ((i + shz) * dimx * dimy + /* Skip 'j' 1d columns. */ (j + shx) * dimy + /* Select the line. */ shy) * se; } return mat; } static void matrix_copy(struct matrix *mat_to, struct matrix *mat_from) { int i, j, k; size_t size; /* for (i = 0; i < mat_to->z_dim; i++) { for (j = 0; j < mat_to->y_dim; j++) memcpy(mat_to->m[i][j], mat_from->m[i][j], sizeof(double) * mat_to->x_dim); } */ size = mat_to->se * mat_to->dimy; for(i = 0; i < mat_to->dimz; i++) { for(j = 0; j < mat_to->dimx; j++) memcpy(mat_to->m[i][j], mat_from->m[i][j], size); } } static void matrix_free(struct matrix *mat) { free(mat); } #endif /* 0 */ static void matrix_init(struct matrix *mat, enum storage_type st, struct bbox *bb_glb, struct bbox *bb_loc, void *pdata, size_t se) { int i; mat->dimx = bbox_dist(bb_glb, bb_x); mat->dimy = bbox_dist(bb_glb, bb_y); mat->dimz = bbox_dist(bb_glb, bb_z); mat->mat_storage = st; for(i = bb_x; i <= bb_z; i++) { mat->mat_view.lb[i] = bb_loc->lb.c[i] - bb_glb->lb.c[i]; mat->mat_view.ub[i] = bb_loc->ub.c[i] - bb_glb->lb.c[i]; } mat->pdata = pdata; mat->size_elem = se; } static void matrix_copy(struct matrix *a, struct matrix *b) { /* typedef struct { char size_on_mem[a->size_elem]; } matrix_elem_generic_t; */ typedef char matrix_elem_generic_t[a->size_elem]; int ai, aj, ak, bi, bj, bk; int n; if(a->mat_storage == column_major && b->mat_storage == column_major) { matrix_elem_generic_t(*A)[a->dimz][a->dimx][a->dimy] = a->pdata; matrix_elem_generic_t(*B)[b->dimz][b->dimx][b->dimy] = b->pdata; /* Column major data representation (Fortran style) */ n = a->mat_view.ub[bb_y] - a->mat_view.lb[bb_y] + 1; ak = a->mat_view.lb[bb_y]; bk = b->mat_view.lb[bb_y]; for(ai = a->mat_view.lb[bb_z], bi = b->mat_view.lb[bb_z]; ai <= a->mat_view.ub[bb_z]; ai++, bi++) { for(aj = a->mat_view.lb[bb_x], bj = b->mat_view.lb[bb_x]; aj <= a->mat_view.ub[bb_x]; aj++, bj++) memcpy(&(*A)[ai][aj][ak], &(*B)[bi][bj][bk], a->size_elem * n); } } else if(a->mat_storage == column_major && b->mat_storage == row_major) { matrix_elem_generic_t(*A)[a->dimz][a->dimx][a->dimy] = a->pdata; matrix_elem_generic_t(*B)[b->dimz][b->dimy][b->dimx] = b->pdata; /* ... */ for(ai = a->mat_view.lb[bb_z], bi = b->mat_view.lb[bb_z]; ai <= a->mat_view.ub[bb_z]; ai++, bi++) { for(aj = a->mat_view.lb[bb_x], bj = b->mat_view.lb[bb_x]; aj <= a->mat_view.ub[bb_x]; aj++, bj++) { for(ak = a->mat_view.lb[bb_y], bk = b->mat_view.lb[bb_y]; ak <= a->mat_view.ub[bb_y]; ak++, bk++) memcpy(&(*A)[ai][aj][ak], &(*B)[bi][bk][bj], a->size_elem); // (*A)[ai][aj][ak] = (*B)[bi][bk][bj]; } } } else if(a->mat_storage == row_major && b->mat_storage == column_major) { matrix_elem_generic_t(*A)[a->dimz][a->dimy][a->dimx] = a->pdata; matrix_elem_generic_t(*B)[b->dimz][b->dimx][b->dimy] = b->pdata; /* ... */ for(ai = a->mat_view.lb[bb_z], bi = b->mat_view.lb[bb_z]; ai <= a->mat_view.ub[bb_z]; ai++, bi++) { for(aj = a->mat_view.lb[bb_y], bj = b->mat_view.lb[bb_y]; aj <= a->mat_view.ub[bb_y]; aj++, bj++) { for(ak = a->mat_view.lb[bb_x], bk = b->mat_view.lb[bb_x]; ak <= a->mat_view.ub[bb_x]; ak++, bk++) memcpy(&(*A)[ai][aj][ak], &(*B)[bi][bk][bj], a->size_elem); // (*A)[ai][aj][ak] = (*B)[bi][bk][bj]; } } } else if(a->mat_storage == row_major && b->mat_storage == row_major) { matrix_elem_generic_t(*A)[a->dimz][a->dimy][a->dimx] = a->pdata; matrix_elem_generic_t(*B)[b->dimz][b->dimy][b->dimx] = b->pdata; n = a->mat_view.ub[bb_x] - a->mat_view.lb[bb_x] + 1; ak = a->mat_view.lb[bb_x]; bk = b->mat_view.lb[bb_x]; for(ai = a->mat_view.lb[bb_z], bi = b->mat_view.lb[bb_z]; ai <= a->mat_view.ub[bb_z]; ai++, bi++) { for(aj = a->mat_view.lb[bb_y], bj = b->mat_view.lb[bb_y]; aj <= a->mat_view.ub[bb_y]; aj++, bj++) memcpy(&(*A)[ai][aj][ak], &(*B)[bi][bj][bk], a->size_elem * n); } } } /* a = destination, b = source. Destination uses iovec_t format. */ static void matrix_copyv(struct matrix *a, struct matrix *b) { /* typedef struct { char size_on_mem[a->size_elem]; } matrix_elem_generic_t; */ typedef char matrix_elem_generic_t[a->size_elem]; int ai, aj, bi, bj, bk; // , ak; int n; if(a->mat_storage == column_major && b->mat_storage == column_major) { // matrix_elem_generic_t (*A)[a->dimz][a->dimx][a->dimy] = a->pdata; matrix_elem_generic_t(*B)[b->dimz][b->dimx][b->dimy] = b->pdata; iovec_t *A = a->pdata; /* Column major data representation (Fortran style) */ n = a->mat_view.ub[bb_y] - a->mat_view.lb[bb_y] + 1; // ak = a->mat_view.lb[bb_y]; bk = b->mat_view.lb[bb_y]; for(ai = a->mat_view.lb[bb_z], bi = b->mat_view.lb[bb_z]; ai <= a->mat_view.ub[bb_z]; ai++, bi++) { for(aj = a->mat_view.lb[bb_x], bj = b->mat_view.lb[bb_x]; aj <= a->mat_view.ub[bb_x]; aj++, bj++) { A->iov_base = &(*B)[bi][bj][bk]; A->iov_len = a->size_elem * n; A++; } /* memcpy(&(*A)[ai][aj][ak], &(*B)[bi][bj][bk], a->size_elem * n); */ } } else if(a->mat_storage == row_major && b->mat_storage == row_major) { // matrix_elem_generic_t (*A)[a->dimz][a->dimy][a->dimx] = a->pdata; matrix_elem_generic_t(*B)[b->dimz][b->dimy][b->dimx] = b->pdata; iovec_t *A = a->pdata; n = a->mat_view.ub[bb_x] - a->mat_view.lb[bb_x] + 1; // ak = a->mat_view.lb[bb_x]; bk = b->mat_view.lb[bb_x]; for(ai = a->mat_view.lb[bb_z], bi = b->mat_view.lb[bb_z]; ai <= a->mat_view.ub[bb_z]; ai++, bi++) { for(aj = a->mat_view.lb[bb_y], bj = b->mat_view.lb[bb_y]; aj <= a->mat_view.ub[bb_y]; aj++, bj++) { A->iov_base = &(*B)[bi][bj][bk]; A->iov_len = a->size_elem * n; A++; } /* memcpy(&(*A)[ai][aj][ak], &(*B)[bi][bj][bk], a->size_elem * n); */ } } /* else if (a->mat_storage == column_major && b->mat_storage == row_major) { matrix_elem_generic_t (*A)[a->dimz][a->dimx][a->dimy] = a->pdata; matrix_elem_generic_t (*B)[b->dimz][b->dimy][b->dimx] = b->pdata; for (ai = a->mat_view.lb[bb_z], bi = b->mat_view.lb[bb_z]; ai <= a->mat_view.ub[bb_z]; ai++, bi++) { for (aj = a->mat_view.lb[bb_x], bj = b->mat_view.lb[bb_y]; aj <= a->mat_view.ub[bb_x]; aj++, bj++) { for (ak = a->mat_view.lb[bb_y], bk = b->mat_view.lb[bb_y]; ak <= a->mat_view.ub[bb_y]; ak++, bk++) memcpy(&(*A)[ai][aj][ak], &(*B)[bi][bk][bj], a->size_elem); // (*A)[ai][aj][ak] = (*B)[bi][bk][bj]; } } } else if (a->mat_storage == row_major && b->mat_storage == column_major) { matrix_elem_generic_t (*A)[a->dimz][a->dimy][a->dimx] = a->pdata; matrix_elem_generic_t (*B)[b->dimz][b->dimx][b->dimy] = b->pdata; for (ai = a->mat_view.lb[bb_z], bi = b->mat_view.lb[bb_z]; ai <= a->mat_view.ub[bb_z]; ai++, bi++) { for (aj = a->mat_view.lb[bb_y], bj = b->mat_view.lb[bb_y]; aj <= a->mat_view.ub[bb_y]; aj++, bj++) { for (ak = a->mat_view.lb[bb_x], bk = b->mat_view.lb[bb_x]; ak <= a->mat_view.ub[bb_x]; ak++, bk++) memcpy(&(*A)[ai][aj][ak], &(*B)[bi][bk][bj], a->size_elem); // (*A)[ai][aj][ak] = (*B)[bi][bk][bj]; } } } */ } static struct dht_entry *dht_entry_alloc(struct sspace *ssd, int size_hash) { struct dht_entry *de; int i; de = malloc(sizeof(*de) + sizeof(struct obj_desc_list) * (size_hash - 1)); if(!de) { errno = ENOMEM; return de; } memset(de, 0, sizeof(*de)); de->ss = ssd; de->odsc_size = size_hash; for(i = 0; i < size_hash; i++) INIT_LIST_HEAD(&de->odsc_hash[i]); return de; } static void dht_entry_free(struct dht_entry *de) { struct obj_desc_list *l, *t; int i; //TODO: free the *intv and other resources. free(de->i_tab); for(i = 0; i < de->odsc_size; i++) { list_for_each_entry_safe(l, t, &de->odsc_hash[i], odsc_entry) free(l); } free(de); } static struct dht *dht_alloc(struct sspace *ssd, struct bbox *bb_domain, int num_nodes, int size_hash) { struct dht *dht; int i; dht = malloc(sizeof(*dht) + sizeof(struct dht_entry) * (num_nodes - 1)); if(!dht) { errno = ENOMEM; return dht; } memset(dht, 0, sizeof(*dht)); dht->bb_glb_domain = *bb_domain; dht->num_entries = num_nodes; for(i = 0; i < num_nodes; i++) { dht->ent_tab[i] = dht_entry_alloc(ssd, size_hash); if(!dht->ent_tab[i]) break; } if(i != num_nodes) { errno = ENOMEM; while(--i > 0) free(dht->ent_tab[i]); free(dht); dht = 0; } return dht; } static void dht_free(struct dht *dht) { int i; for(i = 0; i < dht->num_entries; i++) free(dht->ent_tab[i]); free(dht); } static int dht_intersect(struct dht_entry *de, struct intv *itv) { int i; if(de->i_virt.lb > itv->ub || de->i_virt.ub < itv->lb) return 0; for(i = 0; i < de->num_intv; i++) if(intv_do_intersect(&de->i_tab[i], itv)) return 1; return 0; } /* Allocate and init the local storage structure. */ static struct ss_storage *ls_alloc(int max_versions) { struct ss_storage *ls = 0; int i; ls = malloc(sizeof(*ls) + sizeof(struct list_head) * max_versions); if(!ls) { errno = ENOMEM; return ls; } memset(ls, 0, sizeof(*ls)); for(i = 0; i < max_versions; i++) INIT_LIST_HEAD(&ls->obj_hash[i]); ls->size_hash = max_versions; return ls; } static int ssd_get_max_dim(struct sspace *ss) { return ss->max_dim; } static int ssd_get_bpd(struct sspace *ss) { return ss->bpd; } /* Hash the global geometric domain space to 1d index, and map a piece to each entry in the dht->ent_tab. */ static int dht_construct_hash(struct dht *dht, struct sspace *ssd) { const unsigned long sn = bbox_volume(&dht->bb_glb_domain) / dht->num_entries; struct intv *i_tab, intv; struct dht_entry *de; unsigned long len; int num_intv, i, j; int err = -ENOMEM; bbox_to_intv(&dht->bb_glb_domain, ssd->max_dim, ssd->bpd, &i_tab, &num_intv); /* printf("Global domain decomposes into: "); for (i = 0; i < num_intv; i++) printf("{%u,%u} ", i_tab[i].lb, i_tab[i].ub); printf("\n"); */ for(i = 0, j = 0; i < dht->num_entries; i++) { len = sn; de = dht->ent_tab[i]; de->rank = i; de->i_tab = malloc(sizeof(struct intv) * num_intv); if(!de->i_tab) break; // printf("Node rank %d interval cut: ", i); while(len > 0) { if(intv_size(&i_tab[j]) > len) { intv.lb = i_tab[j].lb; intv.ub = intv.lb + len - 1; i_tab[j].lb += len; } else { intv = i_tab[j++]; } len -= intv_size(&intv); de->i_tab[de->num_intv++] = intv; // printf("{%u,%u} ", intv.lb, intv.ub); } de->i_virt.lb = de->i_tab[0].lb; de->i_virt.ub = de->i_tab[de->num_intv - 1].ub; de->i_tab = realloc(de->i_tab, sizeof(intv) * de->num_intv); if(!de->i_tab) break; printf("\n"); } free(i_tab); if(i == dht->num_entries) return 0; uloga("'%s()': failed at entry %d.\n", __func__, i); return err; } /* Public API starts here. */ /* Allocate the shared space structure. */ struct sspace *ssd_alloc(struct bbox *bb_domain, int num_nodes, int max_versions) { struct sspace *ssd; // size_t size; int max_dim, err = -ENOMEM; // size = sizeof(*ssd); // + sizeof(struct dht_entry) * num_nodes; ssd = malloc(sizeof(*ssd)); if(!ssd) goto err_out; memset(ssd, 0, sizeof(*ssd)); ssd->storage = ls_alloc(max_versions); if(!ssd->storage) { free(ssd); goto err_out; } ssd->dht = dht_alloc(ssd, bb_domain, num_nodes, max_versions); if(!ssd->dht) { // TODO: free storage free(ssd->storage); free(ssd); goto err_out; } max_dim = max(bb_domain->ub.c[0], bb_domain->ub.c[1]); if(bb_domain->num_dims > 2) max_dim = max(max_dim, bb_domain->ub.c[2]); ssd->max_dim = next_pow_2(max_dim); ssd->bpd = compute_bits(ssd->max_dim); err = dht_construct_hash(ssd->dht, ssd); if(err < 0) { //TODO: do I need a ls_free() routine to clean up the // objects in the space ? dht_free(ssd->dht); free(ssd->storage); free(ssd); goto err_out; } return ssd; err_out: uloga("'%s()': failed with %d\n", __func__, err); return NULL; } void ssd_free(struct sspace *ssd) { // int i; dht_free(ssd->dht); //TODO: do I need a ls_free() routine ? free(ssd->storage); free(ssd); sh_free(); } /* Initialize the dht structure. */ int ssd_init(struct sspace *ssd, int rank) { // int err = -ENOMEM; ssd->rank = rank; ssd->ent_self = ssd->dht->ent_tab[rank]; return 0; } /* Add an object to the local storage. */ void ssd_add_obj(struct sspace *ss, struct obj_data *od) { int index; struct list_head *bin; struct obj_data *od_existing; od_existing = ls_find_no_version(ss->storage, &od->obj_desc); if(od_existing) { od_existing->f_free = 1; if(od_existing->refcnt == 0) { ssd_remove(ss, od_existing); obj_data_free(od_existing); } else { uloga("'%s()': object eviction delayed.\n", __func__); } } index = od->obj_desc.version % ss->storage->size_hash; bin = &ss->storage->obj_hash[index]; /* NOTE: new object comes first in the list. */ list_add(&od->obj_entry, bin); ss->storage->num_obj++; } /* */ int ssd_copy(struct obj_data *to_obj, struct obj_data *from_obj) { // struct matrix *to_mat, *from_mat; struct matrix to_mat, from_mat; struct bbox bbcom; // int err = -ENOMEM; bbox_intersect(&to_obj->obj_desc.bb, &from_obj->obj_desc.bb, &bbcom); matrix_init(&from_mat, from_obj->obj_desc.st, &from_obj->obj_desc.bb, &bbcom, from_obj->data, from_obj->obj_desc.size); /* from_mat = matrix_alloc(&from_obj->obj_desc.bb, &bbcom, from_obj->data, from_obj->obj_desc.size); if (!from_mat) goto err_out; */ matrix_init(&to_mat, to_obj->obj_desc.st, &to_obj->obj_desc.bb, &bbcom, to_obj->data, to_obj->obj_desc.size); /* to_mat = matrix_alloc(&to_obj->obj_desc.bb, &bbcom, to_obj->data, to_obj->obj_desc.size); if (!to_mat) { free(from_mat); goto err_out; } */ matrix_copy(&to_mat, &from_mat); /* matrix_free(to_mat); matrix_free(from_mat); */ return 0; /* err_out: uloga("'%s()': failed with %d.\n", __func__, err); return err; */ } int ssd_copyv(struct obj_data *obj_dest, struct obj_data *obj_src) { struct matrix mat_dest, mat_src; struct bbox bbcom; bbox_intersect(&obj_dest->obj_desc.bb, &obj_src->obj_desc.bb, &bbcom); matrix_init(&mat_dest, obj_dest->obj_desc.st, &obj_dest->obj_desc.bb, &bbcom, obj_dest->data, obj_dest->obj_desc.size); matrix_init(&mat_src, obj_src->obj_desc.st, &obj_src->obj_desc.bb, &bbcom, obj_src->data, obj_src->obj_desc.size); matrix_copyv(&mat_dest, &mat_src); return 0; } /* */ int ssd_copy_list(struct obj_data *to, struct list_head *od_list) { struct obj_data *from; // struct matrix *mto, *mfrom; struct matrix to_mat, from_mat; struct bbox bbcom; // int err = -ENOMEM; list_for_each_entry(from, od_list, obj_entry) { bbox_intersect(&to->obj_desc.bb, &from->obj_desc.bb, &bbcom); matrix_init(&from_mat, from->obj_desc.st, &from->obj_desc.bb, &bbcom, from->data, from->obj_desc.size); /* mfrom = matrix_alloc(&from->obj_desc.bb, &bbcom, from->data, from->obj_desc.size); if (!mfrom) { matrix_free(mto); goto err_out; } */ matrix_init(&to_mat, to->obj_desc.st, &to->obj_desc.bb, &bbcom, to->data, to->obj_desc.size); /* mto = matrix_alloc(&to->obj_desc.bb, &bbcom, to->data, to->obj_desc.size); if (!mto) goto err_out; */ matrix_copy(&to_mat, &from_mat); /* matrix_free(mto); matrix_free(mfrom); */ } return 0; /* err_out: uloga("'%s()': failed with %d.\n", __func__, err); return err; */ } int ssd_filter(struct obj_data *from, struct obj_descriptor *odsc, double *dval) { //TODO: search the matrix to find the min static int n = 1; *dval = 2.0 * n; n++; return 0; } struct obj_data *ssd_lookup(struct sspace *ss, char *name) { struct obj_data *od; struct list_head *list; int i; for(i = 0; i < ss->storage->size_hash; i++) { list = &ss->storage->obj_hash[i]; list_for_each_entry(od, list, obj_entry) { if(strcmp(od->obj_desc.name, name) == 0) return od; } } return NULL; } void ssd_remove(struct sspace *ss, struct obj_data *od) { list_del(&od->obj_entry); ss->storage->num_obj--; } void ssd_try_remove_free(struct sspace *ss, struct obj_data *od) { /* Note: we assume the object data is allocated with obj_data_alloc(), i.e., the data follows the structure. */ if(od->refcnt == 0) { ssd_remove(ss, od); if(od->data != od + 1) { uloga("'%s()': we are about to free an object " "with external allocation.\n", __func__); } obj_data_free(od); } } /* Hash a bounding box 'bb' to the hash entries in dht; fill in the entries in the de_tab and return the number of entries. */ int ssd_hash(struct sspace *ss, const struct bbox *bb, struct dht_entry *de_tab[]) { struct intv *i_tab; int i, k, n, num_nodes; num_nodes = sh_find(bb, de_tab); if(num_nodes > 0) /* This is great, I hit the cache. */ return num_nodes; num_nodes = 0; // bbox_to_intv(bb, ss->max_dim, ss->bpd, &i_tab, &n); bbox_to_intv2(bb, ss->max_dim, ss->bpd, &i_tab, &n); for(k = 0; k < ss->dht->num_entries; k++) { for(i = 0; i < n; i++) { if(dht_intersect(ss->dht->ent_tab[k], &i_tab[i])) { de_tab[num_nodes++] = ss->dht->ent_tab[k]; break; } } } /* Cache the results for later use. */ sh_add(bb, de_tab, num_nodes); /* for (i = 0, k = 0; i < n && k < NUM_NODES;) { if (node_intersect(&node_tab[k], &i_tab[i])) { n_tab[num_nodes++] = &node_tab[k]; k++; } // else if (node_tab[k].i_tab[node_tab[k].num_itv-1].ub < i_tab[i].lb) else if (node_tab[k].i_virt.ub < i_tab[i].lb || node_tab[k].i_virt.lb > i_tab[i].ub) k++; else i++; } */ free(i_tab); return num_nodes; } static inline void ls_inc_num_objects(struct ss_storage *ls) { ls->num_obj++; } /* Find an object in the local storage that has the same name and version with the object descriptor 'odsc'. */ struct obj_data *ls_find(struct ss_storage *ls, const struct obj_descriptor *odsc) { struct obj_data *od; struct list_head *list; int index; index = odsc->version % ls->size_hash; list = &ls->obj_hash[index]; list_for_each_entry(od, list, obj_entry) { if(obj_desc_equals_intersect(odsc, &od->obj_desc)) return od; } return NULL; } void print_bb(struct ss_storage *ls) { struct obj_data *od; struct list_head *list; int index; index = 0 % ls->size_hash; list = &ls->obj_hash[index]; list_for_each_entry(od, list, obj_entry) { printf("%s\n",bbox_sprint(&od->obj_desc.bb)); } return; } /* Search for an object in the local storage that is mapped to the same bin, and that has the same name and object descriptor, but may have different version. */ struct obj_data *ls_find_no_version(struct ss_storage *ls, struct obj_descriptor *odsc) { struct obj_data *od; struct list_head *list; int index; index = odsc->version % ls->size_hash; list = &ls->obj_hash[index]; list_for_each_entry(od, list, obj_entry) { if(obj_desc_by_name_intersect(odsc, &od->obj_desc)) return od; } return NULL; } /* Test if the 'odsc' matches any object descriptor in a DHT entry by name and coordinates, but not version, and return the matching index. */ static struct obj_desc_list *dht_find_match(const struct dht_entry *de, const struct obj_descriptor *odsc) { struct obj_desc_list *odscl; int n; // TODO: delete this (just an assertion for proper behaviour). if(odsc->version == (unsigned int) -1) { uloga("'%s()': version on object descriptor is not set!!!\n", __func__); return 0; } n = odsc->version % de->odsc_size; list_for_each_entry(odscl, &de->odsc_hash[n], odsc_entry) { if(obj_desc_by_name_intersect(odsc, &odscl->odsc)) return odscl; } return 0; } #define array_resize(a, n) a = realloc(a, sizeof(*a) * (n)) int dht_add_entry(struct dht_entry *de, const struct obj_descriptor *odsc) { struct obj_desc_list *odscl; int n, err = -ENOMEM; odscl = dht_find_match(de, odsc); if(odscl) { /* There is allready a descriptor with a different version in the DHT, so I will overwrite it. */ memcpy(&odscl->odsc, odsc, sizeof(*odsc)); return 0; } n = odsc->version % de->odsc_size; odscl = malloc(sizeof(*odscl)); if(!odscl) return err; memcpy(&odscl->odsc, odsc, sizeof(*odsc)); list_add(&odscl->odsc_entry, &de->odsc_hash[n]); de->odsc_num++; return 0; } /* Search the dht entry 'de' for an object that intersects object descriptor 'odsc' and return a reference to it. */ const struct obj_descriptor *dht_find_entry(struct dht_entry *de, const struct obj_descriptor *odsc) // __attribute__((__unused__)) { /* int i; for (i = 0; i < de->size_objs; i++) { if (obj_desc_equals_intersect(&de->od_tab[i], odsc)) return &de->od_tab[i]; } */ return NULL; } /* Object descriptor 'q_odsc' can intersect multiple object descriptors from dht entry 'de'; find all descriptor from 'de' and return their number and references . */ int dht_find_entry_all(struct dht_entry *de, struct obj_descriptor *q_odsc, const struct obj_descriptor *odsc_tab[]) { int n, num_odsc = 0; struct obj_desc_list *odscl; n = q_odsc->version % de->odsc_size; list_for_each_entry(odscl, &de->odsc_hash[n], odsc_entry) { if(obj_desc_equals_intersect(&odscl->odsc, q_odsc)) odsc_tab[num_odsc++] = &odscl->odsc; } return num_odsc; } /* List the available versions of a data object. */ int dht_find_versions(struct dht_entry *de, struct obj_descriptor *q_odsc, int odsc_vers[]) { struct obj_desc_list *odscl; int i, n = 0; for(i = 0; i < de->odsc_size; i++) { list_for_each_entry(odscl, &de->odsc_hash[i], odsc_entry) if(obj_desc_by_name_intersect(&odscl->odsc, q_odsc)) { odsc_vers[n++] = odscl->odsc.version; break; /* Break the list_for_each_entry loop. */ } } return n; } #define ALIGN_ADDR_QUAD_BYTES(a) \ unsigned long _a = (unsigned long) (a); \ _a = (_a + 7) & ~7; \ (a) = (void *) _a; /* Allocate space for an obj_data structure and the data. */ struct obj_data *obj_data_alloc(struct obj_descriptor *odsc) { struct obj_data *od = 0; /* od = malloc(sizeof(*od) + obj_data_size(odsc) + 7); if (!od) return NULL; memset(od, 0, sizeof(*od)); od->data = od + 1; ALIGN_ADDR_QUAD_BYTES(od->data); od->obj_desc = *odsc; */ od = malloc(sizeof(*od)); if(!od){ return NULL; } memset(od, 0, sizeof(*od)); od->_data = od->data = malloc(obj_data_size(odsc) + 7); if(!od->_data) { free(od); return NULL; } ALIGN_ADDR_QUAD_BYTES(od->data); od->obj_desc = *odsc; return od; } /* Allocate space for obj_data structure and references for data. */ struct obj_data *obj_data_allocv(struct obj_descriptor *odsc) { struct obj_data *od; /* od = malloc(sizeof(*od) + obj_data_sizev(odsc) + 7); if (!od) return 0; memset(od, 0, sizeof(*od)); od->data = od + 1; ALIGN_ADDR_QUAD_BYTES(od->data); od->obj_desc = *odsc; */ od = malloc(sizeof(*od)); if(!od) return NULL; memset(od, 0, sizeof(*od)); od->_data = od->data = malloc(obj_data_sizev(odsc) + 7); if(!od->_data) { free(od); return NULL; } ALIGN_ADDR_QUAD_BYTES(od->data); od->obj_desc = *odsc; return od; } /* Allocate space for the obj_data struct only; space for data is externally allocated. */ struct obj_data *obj_data_alloc_no_data(struct obj_descriptor *odsc, void *data) { struct obj_data *od; od = malloc(sizeof(*od)); if(!od) return NULL; memset(od, 0, sizeof(*od)); od->obj_desc = *odsc; od->data = data; return od; } struct obj_data *obj_data_alloc_with_data(struct obj_descriptor *odsc, void *data) { struct obj_data *od = obj_data_alloc(odsc); if(!od) return NULL; memcpy(od->data, data, obj_data_size(odsc)); //TODO: what about the descriptor ? return od; } void obj_data_free_with_data(struct obj_data *od) { if(od->_data) { uloga("'%s()': explicit data free on descriptor %s.\n", __func__, od->obj_desc.name); free(od->_data); } else free(od->data); free(od); } void obj_data_free(struct obj_data *od) { if(od->_data) free(od->_data); /* else uloga("'%s()': implicit free for descriptor %s with external data\n", __func__, od->obj_desc.name); */ free(od); } // size_t obj_data_size(struct obj_data *od) size_t obj_data_size(struct obj_descriptor *obj_desc) { return obj_desc->size * bbox_volume(&obj_desc->bb); } size_t obj_data_sizev(struct obj_descriptor * odsc) { size_t size = 1; // sizeof(iovec_t); static int PTL_MAX_IOV = 65535; if(odsc->bb.num_dims == 2) { if(odsc->st == row_major) size = size * bbox_dist(&odsc->bb, bb_y); else size = size * bbox_dist(&odsc->bb, bb_x); } else if(odsc->bb.num_dims == 3) { size = size * bbox_dist(&odsc->bb, bb_z); if(odsc->st == row_major) size = size * bbox_dist(&odsc->bb, bb_y); else size = size * bbox_dist(&odsc->bb, bb_x); } /* If we exceed the IOVEC portals limit, should fall back on the copy method. */ if(size > PTL_MAX_IOV) return (size_t) - 1; return size; } int obj_desc_equals(const struct obj_descriptor *odsc1, const struct obj_descriptor *odsc2) { if(odsc1->owner == odsc2->owner && bbox_equals(&odsc1->bb, &odsc2->bb)) return 1; else return 0; } int obj_desc_equals_no_owner(const struct obj_descriptor *odsc1, const struct obj_descriptor *odsc2) { /* Note: object distribution should not change with version. */ if( // odsc1->version == odsc2->version && strcmp(odsc1->name, odsc2->name) == 0 && bbox_equals(&odsc1->bb, &odsc2->bb)) return 1; return 0; } /* Test if two object descriptors have the same name and versions and their bounding boxes intersect. */ inline int obj_desc_equals_intersect(const struct obj_descriptor *odsc1, const struct obj_descriptor *odsc2) { if(strcmp(odsc1->name, odsc2->name) == 0 && odsc1->version == odsc2->version && bbox_does_intersect(&odsc1->bb, &odsc2->bb)){ return 1; } return 0; } /* Test if two object descriptors have the same name and their bounding boxes intersect. */ inline int obj_desc_by_name_intersect(const struct obj_descriptor *odsc1, const struct obj_descriptor *odsc2) { if(strcmp(odsc1->name, odsc2->name) == 0 && bbox_does_intersect(&odsc1->bb, &odsc2->bb)) return 1; return 0; } /* int main(void) { double *d1 = malloc(sizeof(double) * 100 * 100); double *d2 = malloc(sizeof(double) * 10 * 10); struct bbox b1 = {.num_dims = 2, .lb.c = {0, 0, 0}, .ub.c = {99, 99, 0}}; struct bbox b2 = {.num_dims = 2, .lb.c = {3, 3, 0}, .ub.c = {9, 9, 0}}; struct bbox b3; struct matrix *mat, *matl; int i, j; mat = matrix_alloc(&b1, &b2, d1); matl = matrix_alloc(&b2, &b2, d2); for (i = 0; i < 100 * 100; i++) d1[i] = 1.0 * (i + 1); matrix_copy(matl, mat); for (i = 0; i < matl->y_dim; i++) { for (j = 0; j < matl->x_dim; j++) printf("%8.1f", matl->m[0][i][j]); printf("\n"); } return 0; } */
C
#include <stdio.h> #include <stdlib.h> #include <stdbool.h> #include <time.h> #define SIZE 10000 typedef struct node { int data; struct node* leftChild; struct node* rightChild; struct node* parent; int height; } node_t; // Define the AVL data structure typedef struct AVL { node_t* root; int size; } AVL_t; void traverse(node_t* node) { if (node == NULL) { printf("Node is null...\n"); return; } if (node->leftChild == NULL) { //most left end of tree printf("%d ", node->data); if (node->rightChild != NULL) { traverse(node->rightChild); } } else { //there is a left child traverse(node->leftChild); printf("%d ", node->data); if (node->rightChild != NULL) { traverse(node->rightChild); } } } void printTree(node_t* node){ printf("The AVL is: "); traverse(node); printf("\n"); } // Create a node node_t* makeNode(int data) { //reserve heap space for node node_t* newNode = (node_t*)malloc(sizeof(node_t)); if (newNode == NULL) { return NULL; } //initial values for the node newNode->data = data; newNode->leftChild = NULL; newNode->rightChild = NULL; newNode->parent = NULL; newNode->height = 1; return newNode; } //Create a tree AVL_t* makeAVL(){ //reserve space for the tree AVL_t* newTree = (AVL_t*)malloc(sizeof(AVL_t)); if (newTree == NULL) { return NULL; } //initial values for the AVL newTree->root = NULL; newTree->size = 0; return newTree; } // Return larger number int max(int a, int b) { return (a > b) ? a : b; } // Get the height of given node int height(node_t* node) { if (node == NULL) return 0; return node->height; } // Calculate the balance number int getBalance(node_t* node){ if (node == NULL) return 0; return height(node->leftChild) - height(node->rightChild); } // Update height of node and it's ancestors void heightUpdate(node_t* node){ node->height = max(height(node->leftChild), height(node->rightChild)) + 1; if (node->parent != NULL){ heightUpdate(node->parent); } } /* RIGHT ROTATION of a given node X Y / -> \ Y X 1. If old_child has a right subtree, assign node as the parent of the left subtree of old_child. 2. Make old_child as the parent of node. */ node_t* rightRotate(node_t* x){ node_t* y = x->leftChild; node_t* y_right = y->rightChild; // Make old as new parent of x y->rightChild = x; y->parent = x->parent; x->parent = y; // Assign old's right to x x->leftChild = y_right; if (y_right != NULL) y_right->parent = x; // Update height x->height = max(height(x->leftChild), height(x->rightChild)) + 1; y->height = max(height(y->leftChild), height(y->rightChild)) + 1; return y; } /* LEFT ROTATION of a given node X Y \ -> / Y X 1. If y has a left subtree, assign x as the parent of the left subtree of y. 2. Make y as the parent of node. */ node_t* leftRotate(node_t* x){ node_t* y = x->rightChild; node_t* y_left = y->leftChild; // Make old_child as the parent of node y->leftChild = x; y->parent = x->parent; x->parent = y; // Assign node as the parent to old_child's left x->rightChild = y_left; if (y_left != NULL) y_left->parent = x; // Update height of changed node x->height = max(height(x->leftChild), height(x->rightChild)) + 1; y->height = max(height(y->leftChild), height(y->rightChild)) + 1; return y; } // Get the balance index of a given node int balanceIndex(node_t* node){ if (node == NULL) return 0; return height(node->leftChild) - height(node->rightChild); } // Insert a node to a tree void insert(AVL_t* tree, int value){ if (tree == NULL ){ printf("No tree object"); return; } node_t* newNode = makeNode(value); // Insert a node without balancing if(tree->root == NULL){ tree->root = newNode; tree->size++; } else { bool inserted = false; node_t* temp = tree->root; while (inserted == false) { // If insert value is smaller than node if (value < temp->data) { // If node has no left child // Asign new node as left child if (temp->leftChild == NULL) { temp->leftChild = newNode; newNode->parent = temp; tree->size++; inserted = true; } else { // Update temp as the left child // until finds a node without left child temp = temp->leftChild; } } else if (value > temp->data){ // If node has no right child if (temp->rightChild == NULL){ temp->rightChild = newNode; newNode->parent = temp; tree->size++; inserted = true; } else { temp = temp->rightChild; } } else { printf("Value already exists."); return; } } // Update height heightUpdate(temp); // Balance check while(temp != NULL){ heightUpdate(temp); int balance = getBalance(temp); // printf("balance: %d\n", balance); // printf("temp: %d\n", temp->data); /* Situation 1: Z Y / / \ Y Z right rotate -> X Z / X Here, the balance for Z is 2, and new insert X is smaller than Y */ if (balance > 1 && value < temp->leftChild->data){ if (temp->parent != NULL){ node_t* temp_parent = temp->parent; if (temp_parent->data > temp->data){ temp_parent->leftChild = rightRotate(temp); } else { temp_parent->rightChild = rightRotate(temp); } } else { rightRotate(temp); } } /* Situation 2: Z Z Y / / / \ X X left rotate -> Y Z right rotate -> X Z \ / Y X Here, the balance for Z is 2, and new insert Y is larger than X */ else if (balance > 1 && value > temp->leftChild->data){ temp->leftChild = leftRotate(temp->leftChild); if (temp->parent != NULL){ node_t* temp_parent = temp->parent; if (temp_parent->data > temp->data){ temp_parent->leftChild = rightRotate(temp); } else { temp_parent->rightChild = rightRotate(temp); } } else { rightRotate(temp); } } /* Situation 3: Symatric to situation 1 Here, the balance for Z is -2, and new insert X is larger than Y */ else if (balance < -1 && value > temp->rightChild->data){ if (temp->parent != NULL){ node_t* temp_parent = temp->parent; if (temp_parent->data > temp->data){ // printf("temp data: %d\n", temp->data); // printf("temp parent data: %d\n", temp_parent->data); temp_parent->leftChild = leftRotate(temp); } else { temp_parent->rightChild = leftRotate(temp); } } else { leftRotate(temp); } } /* Situation 4: Symatric to situation 2 Here, the balance for Z is -2, and new insert X is smaller than Y */ else if (balance < -1 && value < temp->rightChild->data){ temp->rightChild = rightRotate(temp->rightChild); if (temp->parent != NULL){ node_t* temp_parent = temp->parent; if (temp_parent->data > temp->data){ temp_parent->leftChild = leftRotate(temp); } else { temp_parent->rightChild = leftRotate(temp); } } else { leftRotate(temp); } } if (temp->parent == NULL){ tree->root = temp; } // Continue to check parent node temp = temp->parent; } } } //to find a num in a avl tree node_t* find(AVL_t* tree, int num) { //return NULL if the tree does not exist or the tree does not have a root if (tree == NULL || tree->root == NULL) { return NULL; } //if tree is not NULL node_t* found = NULL; node_t* temp = tree->root; while (found == NULL) { //while the num looking for has not been found yet if (num == temp->data) { //if the num looking for equals to the the data of this node found = temp; //found the node! } else if (num < temp->data) { //num is smaller than the data in current node(temp) if (temp->leftChild != NULL) { temp = temp->leftChild; //move to the left child } else { //if there is no left child, reach the left end return found; //still found == NULL } } else { //num is bigger than the data in current node(temp) if (temp->rightChild != NULL) { temp = temp->rightChild; //move to the right child } else { //if there is no right child, react the right end return found; //still found == NULL } } } //return found: found = the node if it is found, otherwise found is NULL if (found == NULL) { printf("%d not found in this tree", num); } return found; } // // Delete a node to a tree void delete(AVL_t* tree, int num) { //if the num to be deleted is not in the avl tree if (find(tree, num) == NULL) { printf("Passed in data is not in the AVL Tree!"); return; } //if the num to be deleted is in the avl tree node_t* temp = find(tree, num); //if the node to be deleted has no child at all if (temp->leftChild == NULL && temp->rightChild == NULL) { if (temp->parent != NULL) { //if temp node has a parent //if the temp node is the left child of its parent: if (num < temp->parent->data) { temp->parent->leftChild = NULL; } else { //else if the temp node is the right child of its parent temp->parent->rightChild = NULL; } } // if the node to be deleted has a right child, but no left child. } else if (temp->leftChild == NULL && temp->rightChild != NULL) { if (temp->parent != NULL) { if (num < temp->parent->data) { //temp node is the left child of its parents temp->parent->leftChild = temp->rightChild; temp->rightChild->parent = temp->parent; } else { //temp node is the right child of its parents temp->parent->rightChild = temp->rightChild; temp->rightChild->parent = temp->parent; } } // if the node to be deleted has a left child, but no right child. } else if (temp->leftChild != NULL && temp->rightChild == NULL) { if (temp->parent != NULL) { if (num < temp->parent->data) { //temp node is the left child of its parents temp->parent->leftChild = temp->leftChild; temp->leftChild->parent = temp->parent; } else { //temp node is the right child of its parents temp->parent->rightChild = temp->leftChild; temp->leftChild->parent = temp->parent; } } //if the node to be deleted has both left child and a right child } else if (temp->leftChild != NULL && temp->rightChild != NULL) { if (temp->parent != NULL) { if (num < temp->parent->data) { //temp node is the left child of its parent node_t* leastBiggerNode = temp->rightChild; while (leastBiggerNode->leftChild != NULL) { leastBiggerNode = leastBiggerNode->leftChild; } delete(tree, leastBiggerNode->data); temp->data = leastBiggerNode->data; } else { //temp node is the right child of its parents node_t* leastSmallerNode = temp->leftChild; while (leastSmallerNode ->rightChild != NULL) { leastSmallerNode = leastSmallerNode->rightChild; } delete(tree, leastSmallerNode->data); temp->data = leastSmallerNode->data; } } else { //when the temp node is the root node_t* leastBiggerNode = temp->rightChild; while (leastBiggerNode->leftChild != NULL) { leastBiggerNode = leastBiggerNode->leftChild; } delete(tree, leastBiggerNode->data); temp->data = leastBiggerNode->data; } //tree->size--; } // Update height heightUpdate(temp); // Balance check while(temp != NULL){ heightUpdate(temp); int balance = getBalance(temp); /* Situation 1: Right Rotate Z Y / / \ Y Z right rotate -> X Z / X Here, the balance for Z is 2, and new insert X is smaller than Y */ if (balance > 1 && getBalance(temp->leftChild) >= 0){ if (temp->parent != NULL){ node_t* temp_parent = temp->parent; // temp_parent->leftChild = rightRotate(temp); if (temp_parent->data > temp->data){ temp_parent->leftChild = rightRotate(temp); } else { temp_parent->rightChild = rightRotate(temp); } } else { rightRotate(temp); } } /* Situation 2: Left - Right Rotate Z Z Y / / / \ X X left rotate -> Y Z right rotate -> X Z \ / Y X Here, the balance for Z is 2, and new insert Y is larger than X */ else if (balance > 1 && getBalance(temp->leftChild) < 0){ temp->leftChild = leftRotate(temp->leftChild); if (temp->parent != NULL){ node_t* temp_parent = temp->parent; if (temp_parent->data > temp->data){ temp_parent->leftChild = rightRotate(temp); } else { temp_parent->rightChild = rightRotate(temp); } } else { rightRotate(temp); } } /* Situation 3: Left Rotate Symatric to situation 1 Here, the balance for Z is -2, and new insert X is larger than Y */ else if (balance < -1 && getBalance(temp->rightChild) <= 0){ if (temp->parent != NULL){ node_t* temp_parent = temp->parent; if (temp_parent->data > temp->data){ temp_parent->leftChild = leftRotate(temp); } else { temp_parent->rightChild = leftRotate(temp); } } else { leftRotate(temp); } } /* Situation 4: Right - Left Rotate Symatric to situation 2 Here, the balance for Z is -2, and new insert X is smaller than Y */ else if (balance < -1 && getBalance(temp->rightChild) > 0){ temp->rightChild = rightRotate(temp->rightChild); if (temp->parent != NULL){ node_t* temp_parent = temp->parent; //temp_parent->rightChild = leftRotate(temp); if (temp_parent->data > temp->data){ temp_parent->leftChild = leftRotate(temp); } else { temp_parent->rightChild = leftRotate(temp); } } else { leftRotate(temp); } } if (temp->parent == NULL){ tree->root = temp; } // Continue to check parent node temp = temp->parent; } free(temp); } void freeTree(node_t* node) { if (node == NULL) { return; } freeTree(node->leftChild); freeTree(node->rightChild); free(node); } void freeAVL(AVL_t* tree){ free(tree); } //test test used to insert 10000 numbers (from 1 to 10000) int testInsert1() { AVL_t* avlTree1 = makeAVL(); clock_t start, end; double cpu_time_used; start = clock(); for (int i = 0; i < SIZE; i++) { insert(avlTree1, i); } printTree(avlTree1->root); end = clock(); cpu_time_used = ((double) (end - start)) / CLOCKS_PER_SEC; printf("Time used is: %f\n", cpu_time_used); freeTree(avlTree1->root); freeAVL(avlTree1); return 0; } //test test used to insert 10000 numbers (from 10000 to 1) int testInsert2() { AVL_t* avlTree2 = makeAVL(); clock_t start, end; double cpu_time_used; start = clock(); for (int i = SIZE; i > 0; i--) { insert(avlTree2, i); } printTree(avlTree2->root); end = clock(); cpu_time_used = ((double) (end - start)) / CLOCKS_PER_SEC; printf("Time used is: %f\n", cpu_time_used); freeTree(avlTree2->root); freeAVL(avlTree2); return 0; } //test test used to insert 10000 numbers (random permutation) int testInsert3() { //generate random permutation of 10000 numbers, within range of [0,10000] AVL_t* avlTree3 = makeAVL(); clock_t start, end; double cpu_time_used; int array[SIZE]; int i; for (i = 0; i < SIZE; i ++){ array[i] = i; } for (i = SIZE - 1; i > 1; i--) { int j = rand() % i; int tmp = array[j]; array[j] = array[i]; array[i] = tmp; } start = clock(); for (i = 0; i < SIZE; i ++){ insert(avlTree3, array[i]); } printTree(avlTree3->root); end = clock(); cpu_time_used = ((double) (end - start)) / CLOCKS_PER_SEC; printf("Time used is: %f\n", cpu_time_used); freeTree(avlTree3->root); freeAVL(avlTree3); return 0; } int testSearch() { AVL_t* avlTree4 = makeAVL(); clock_t start, end; double cpu_time_used; int array[SIZE]; int i; for (i = 0; i < SIZE; i ++){ array[i] = i; } for (i = SIZE - 1; i > 1; i--) { int j = rand() % i; int tmp = array[j]; array[j] = array[i]; array[i] = tmp; } for (i = 0; i < SIZE; i ++){ insert(avlTree4, array[i]); } start = clock(); for (int i = 0; i < SIZE; i++) { find(avlTree4, i); } end = clock(); cpu_time_used = ((double) (end - start)) / CLOCKS_PER_SEC; printf("Time used is: %f\n", cpu_time_used); freeTree(avlTree4->root); freeAVL(avlTree4); return 0; } int main(){ printf("\n<AVL Tree> sorting permutation of 1 to 100000...\n"); for (int i = 0; i < 10; i++) { testInsert1(); } printf("\n<AVL Tree> sorting permutation of 100000 to 1...\n"); for (int i = 0; i < 10; i++) { testInsert2(); } printf("\n<AVL Tree> sorting random permutations of 100000 integers...\n"); for (int i = 0; i < 10; i++) { testInsert3(); } printf("\n<AVL Tree> searching random elements for 100000 times...\n"); for (int i = 0; i < 10; i++) { testSearch(); } // AVL_t* tree = makeAVL(); // insert(tree, 1); // insert(tree, 2); // insert(tree, 3); // insert(tree, 4); // insert(tree, 5); // insert(tree, 6); // printTree(tree->root); }
C
#include <stdio.h> int main(int argc, const char * argv[]) { // insert code here... int banyakJenis, banyakPotong[5], i; char jenisPotong[5]; // int h_dada = 2500, h_paha = 2000, h_sayap = 1500; int h_satuan[5]; // int j_harga[5]; int j_bayar = 0; int pajak = 0; // table printf("GEROBAK FRIED CHICKEN\n"); printf("---------------------------------------\n"); printf("Kode Jenis Harga \n"); printf("---------------------------------------\n"); printf(" D Dada Rp. 2500\n"); printf(" P Paha Rp. 2000\n"); printf(" S Sayap Rp. 1500\n"); printf("---------------------------------------\n"); // input banyak jenis printf("\nBanyak Jenis : "); scanf("%d", &banyakJenis); printf("\n"); // optimalisasi banyak jenis while (!scanf("%d", &banyakJenis)) { printf("Input tidak valid!\n"); printf("ulangi : "); scanf("%d", &banyakJenis); // flush buffer while (getchar() != '\n'); } // input looping for (i = 0; i < banyakJenis; i++) { printf("Jenis ke - %d\n", i + 1); // flush buffer while (getchar() != '\n'); // input jenis potong printf("Jenis Potong [D/P/S] : "); scanf("%c", &jenisPotong[i]); // optimalisasi jenis potong while ((jenisPotong[i] != 'D') && (jenisPotong[i] != 'P') && (jenisPotong[i] != 'S') && (jenisPotong[i] != 'd') && (jenisPotong[i] != 'p') && (jenisPotong[i] != 's')) { // flush buffer while (getchar() != '\n'); printf("\n"); printf("Pilihan input diluar stok!\n"); jenisPotong[i] = '\0'; printf("Jenis Potong [D/P/S] : "); scanf("%c", &jenisPotong[i]); } } printf("\n\n"); return 0; }
C
// 6. Faça um algoritmo que determine se um número é divisível ou não por outro. #include <stdio.h> #include <stdlib.h> int main() { int firstNumber = 0, secondNumber = 0; printf("==*== DIVISÍVEL ==*==\n"); printf("Digite o primeiro número: "); scanf("%d", &firstNumber); printf("Digite o segundo número: "); scanf("%d", &secondNumber); if (firstNumber % secondNumber == 0) printf("%d é divisível por %d\n", firstNumber, secondNumber); else printf("%d não é divisível por %d\n", firstNumber, secondNumber); return 0; }
C
#include <assert.h> int main() { int i; int c; if(!(c==0 && i==0)) return 0; while(i<100) { c=c+i; i=i+1; if (i<=0) break; } assert(c>=0); return 0; }
C
#include "format.h" #include "string.h" static inline char digit_to_ascii (uint_fast8_t digit) { if (digit < 10) return digit + '0'; else return (digit - 10) + 'A'; } static inline void creverse (char* begin, char* end) { if (begin == end) return; --end; while (begin < end) { char tmp = *begin; *begin = *end; *end = tmp; ++begin; --end; } } static inline void divide_by_zero (void) { __asm__ ("int $0x00"::); } static inline void divmod (uint64_t (*quotient), uint64_t (*remainder), uint64_t numerator, uint64_t denominator) { if (denominator == 0) divide_by_zero (); uint64_t denscale = 1; while (denominator < numerator) { denominator <<= 1; denscale <<= 1; } uint64_t _quotient = 0; while (denscale != 0) { if (denominator <= numerator) { numerator -= denominator; _quotient += denscale; } denominator >>= 1; denscale >>= 1; } (*quotient) = _quotient; (*remainder) = numerator; } // Extern functions char* numsep (char* bufstr, char sep) { size_t n = strlen (bufstr); size_t m = n + (n - 1)/3; char* src = bufstr + n - 1; char* dst = bufstr + m - 1; for (int i = 0; src != dst;) { if (i == 3) { i = 0; *dst = sep; } else { i = i + 1; *dst = *src; --src; } --dst; } bufstr [m] = '\0'; return bufstr; } char* format_int (char* buffer, int64_t value, uint_fast8_t mincol, uint_fast8_t base) { if (value < 0) { char* numstring = format_uint (buffer + 1, -value, mincol, base); --numstring; numstring [0] = '-'; return numstring; } else return format_uint (buffer, value, mincol, base); } char* format_uint (char* buffer, uint64_t value, uint_fast8_t mincol, uint_fast8_t base) { char* cursor = buffer; do { uint64_t div, mod; divmod (&div, &mod, value, base); *cursor = digit_to_ascii (mod); value = div; ++cursor; } while (value != 0); while (cursor < buffer + mincol) *cursor++ = '0'; creverse (buffer, cursor); *cursor = '\0'; return buffer; }
C
#include "nemu.h" /* We use the POSIX regex functions to process regular expressions. * Type 'man regex' for more information about POSIX regex functions. */ #include <sys/types.h> #include <regex.h> enum { NOTYPE = 256,EQ,NEQ,REG,NUM,HEX,ADD,SUB,MUL,DIV,LP,RP,LSHIFT,RSHIFT,EITHER,BOTH,BIG,SMALL,BE,SE,OR,AND,DEREF,MINUS,MOD,XOR,NOT,NEITHER /* TODO: Add more token types */ }; static struct rule { char *regex; int token_type; } rules[] = { /* TODO: Add more rules. * Pay attention to the precedence level of different rules. */ {"-", SUB}, {"\\*", MUL}, {"/", DIV}, {"\\(", LP}, {"\\)", RP}, {"0x[0-9a-fA-F]{1,31}", HEX}, {"[0-9]{1,31}", NUM}, {">>", RSHIFT}, {"<<", LSHIFT}, {"\\|\\|", EITHER}, {"&&", BOTH}, {">=", BE}, {"<=", SE}, {">", BIG}, {"<", SMALL}, {"\\|", OR}, {"&", AND}, {"\\$[A-Za-z]{1,7}", REG}, {"!=", NEQ}, {"\\*", DEREF}, {"-", MINUS}, {"%", MOD}, {"\\^", XOR}, {"~", NOT}, {"!", NEITHER}, {" +", NOTYPE}, // spaces {"\\+",ADD}, // plus {"==",EQ}, // equal }; #define NR_REGEX (sizeof(rules) / sizeof(rules[0]) ) static regex_t re[NR_REGEX]; /* Rules are used for many times. * Therefore we compile them only once before any usage. */ void init_regex() { int i; char error_msg[128]; int ret; for(i = 0; i < NR_REGEX; i ++) { ret = regcomp(&re[i], rules[i].regex, REG_EXTENDED); if(ret != 0) { regerror(ret, &re[i], error_msg, 128); Assert(ret == 0, "regex compilation failed: %s\n%s", error_msg, rules[i].regex); } } } typedef struct token { int type; char str[32]; } Token; Token tokens[32]; int nr_token; static bool make_token(char *e) { int position = 0; int i,j; regmatch_t pmatch; nr_token = 0; while(e[position] != '\0') { /* Try all rules one by one. */ for(i = 0; i < NR_REGEX; i ++) { if(regexec(&re[i], e + position, 1, &pmatch, 0) == 0 && pmatch.rm_so == 0) { char *substr_start = e + position; int substr_len = pmatch.rm_eo; Log("match rules[%d] = \"%s\" at position %d with len %d: %.*s", i, rules[i].regex, position, substr_len, substr_len, substr_start); position += substr_len; /* TODO: Now a new token is recognized with rules[i]. Add codes * to record the token in the array ``tokens''. For certain * types of tokens, some extra actions should be performed. */ switch(rules[i].token_type) { case NOTYPE : break ; case NUM : nr_token++; tokens[nr_token].type=NUM; if(substr_len>32) { printf("TOO Much Number!\n"); assert(0); } for(j=0;j<31&&j<substr_len;j++) { tokens[nr_token].str[j]=substr_start[j]; } tokens[nr_token].str[substr_len]='\0'; break; case HEX : nr_token++; tokens[nr_token].type=HEX; if(substr_len>32) { printf("TOO Much Number!\n"); assert(0); } for(j=0;j<31&&j+2<substr_len;j++) { tokens[nr_token].str[j]=substr_start[j+2]; } tokens[nr_token].str[substr_len]='\0'; break; case REG : nr_token++; tokens[nr_token].type=REG; if(substr_len>7) assert(0); for(j=0;j<31&&j+1<substr_len;j++) { tokens[nr_token].str[j]=substr_start[j+1]; } tokens[nr_token].str[substr_len]='\0'; break; case ADD : nr_token++; tokens[nr_token].type=rules[i].token_type; break; case SUB : nr_token++; tokens[nr_token].type=rules[i].token_type; break; case MUL : nr_token++; tokens[nr_token].type=MUL; break; case DIV : nr_token++; tokens[nr_token].type=DIV; break; case LP : nr_token++; tokens[nr_token].type=LP; break; case RP : nr_token++; tokens[nr_token].type=RP; break; case RSHIFT : nr_token++; tokens[nr_token].type=RSHIFT; break; case LSHIFT : nr_token++; tokens[nr_token].type=LSHIFT; break; case EITHER : nr_token++; tokens[nr_token].type=EITHER; break; case BOTH : nr_token++; tokens[nr_token].type=BOTH; break; case BE : nr_token++; tokens[nr_token].type=BE; break; case SE : nr_token++; tokens[nr_token].type=SE; break; case BIG : nr_token++; tokens[nr_token].type=BIG; break; case SMALL : nr_token++; tokens[nr_token].type=SMALL; break; case EQ : nr_token++; tokens[nr_token].type=EQ; break; case NEQ : nr_token++; tokens[nr_token].type=NEQ; break; case OR : nr_token++; tokens[nr_token].type=OR; break; case AND : nr_token++; tokens[nr_token].type=AND; break; case MOD : nr_token++; tokens[nr_token].type=MOD; break; case XOR : nr_token++; tokens[nr_token].type=XOR; break; case NOT : nr_token++; tokens[nr_token].type=NOT; break; case NEITHER : nr_token++; tokens[nr_token].type=NEITHER; break; default: panic("please implement me"); } break; } } if(i == NR_REGEX) { printf("no match at position %d\n%s\n%*.s^\n", position, e, position, ""); return false; } } return true; } int check_parentheses(int p,int q) { int flag=1,i=p,fi=0; while(i<=q) { if(fi==0&&tokens[i].type!=NUM&&tokens[i].type!=HEX&&tokens[i].type!=LP&&tokens[i].type!=RP) flag=0; else if(fi<0) return -1; if(tokens[i].type==LP) fi++; else if(tokens[i].type==RP) fi--; i++; } if(fi!=0) return -1; else { if(flag==0) return 0; else if(flag==1) return 1; } assert(0); } uint32_t chtonum(int p) { int n=strlen(tokens[p].str),i=0,mo=10,sum=0; uint32_t res=0; if(tokens[p].type==NUM) { mo=10; for(;i<n;i++) res=res*mo+tokens[p].str[i]-'0'; } else if(tokens[p].type==HEX) { mo=16; for(;i<n;i++) { if(tokens[p].str[i]>='a'&&tokens[p].str[i]<='f') sum=tokens[p].str[i]-'a'+10; else if(tokens[p].str[i]>='A'&&tokens[p].str[i]<='F') sum=tokens[p].str[i]-'A'+10; else sum=tokens[p].str[i]-'0'; res=res*mo+sum; } } else if(tokens[p].type==REG) { if(strlen(tokens[p].str)==3) { for(i=0;i<8;i++) { if(strcmp(tokens[p].str,regsl[i])==0) return cpu.gpr[i]._32; } if(strcmp(tokens[p].str,"eip")==0) return cpu.eip; } } return res; } int op(int p,int q) { int fi=0,i,op=-1; int pos1=-1; // last || int pos2=-1; // last && int pos3=-1; // last | int pos4=-1; // last ^ int pos5=-1; // last & int pos6=-1; // last == or != int pos7=-1; // last <=, >=,< or > int pos8=-1; // last <<or >> int pos9=-1; // last + or - int pos10=-1; // last /,*,% for(i=p;i<=q;i++) { if(tokens[i].type==LP) fi++; else if(tokens[i].type==RP) fi--; if(fi==0) { if(tokens[i].type==EITHER) pos1=i; else if(tokens[i].type==BOTH) pos2=i; else if(tokens[i].type==OR) pos3=i; else if(tokens[i].type==XOR) pos4=i; else if(tokens[i].type==AND) pos5=i; else if(tokens[i].type==EQ||tokens[i].type==NEQ) pos6=i; else if(tokens[i].type==SE||tokens[i].type==BE||tokens[i].type ==SMALL||tokens[i].type==BIG) pos7=i; else if(tokens[i].type==LSHIFT||tokens[i].type==RSHIFT) pos8=i; else if(tokens[i].type ==ADD||tokens[i].type==SUB) pos9=i; else if(tokens[i].type==MUL||tokens[i].type==DIV||tokens[i].type==MOD) pos10=i; } else if(fi<0) return -2; } if(pos1!=-1) op=pos1 ; else if(pos2!=-1) op=pos2; else if(pos3!=-1) op=pos3; else if(pos4!=-1) op=pos4; else if(pos5!=-1) op=pos5; else if(pos6!=-1) op=pos6; else if(pos7!=-1) op=pos7; else if(pos8!=-1) op=pos8; else if(pos9!=-1) op=pos9; else if(pos10!=-1) op=pos10; return op; } uint32_t eval(int p,int q) { int opp; uint32_t end; if(p>q) { return 0; } else if(p==q) { return chtonum(p); } else if(check_parentheses(p,q)==1) { return eval(p+1,q-1); } else if(check_parentheses(p,q)==0) { opp=op(p,q); if(opp==-2) { printf("bad expression\n"); assert(0); } else if(opp==-1) { if(tokens[p].type==NOT) { sscanf(tokens[q].str,"%x",&end); return ~end; } if(tokens[p].type==NEITHER) { sscanf(tokens[q].str,"%x",&end); return !end; } if(tokens[p].type==MINUS) { sscanf(tokens[q].str,"%x",&end); return -end; } if(tokens[p].type==DEREF) { sscanf(tokens[q].str,"%x",&end); end=swaddr_read(end,4); return end; } } uint32_t val1=eval(p,opp-1); uint32_t val2=eval(opp+1,q); switch(tokens[opp].type) { case ADD : return val1+val2; case SUB : return val1-val2; case MUL : return val1*val2; case DIV : return val1/val2; case RSHIFT : return val1>>val2; case LSHIFT : return val1<<val2; case OR : return val1|val2; case AND : return val1&val2; case EITHER : return val1||val2; case BOTH : return val1&&val2; case BE : return val1>=val2; case SE : return val1<=val2; case BIG : return val1>val2; case SMALL : return val1<val2; case EQ : return val1==val2; case NEQ : return val1!=val2; case MOD : return val1%val2; case XOR : return val1^val2; default : assert(0); } } assert(0); } uint32_t expr(char *e, bool *success) { int i; if(!make_token(e)) { *success = false; return 0; } for(i=0;i<nr_token;i++) { if(tokens[i].type==SUB&&(i==0||tokens[i-1].type==ADD||tokens[i-1].type==SUB||tokens[i-1].type==MUL||tokens[i-1].type==DIV||tokens[i-1].type==LP)) tokens[i].type=MINUS; } for(i=0;i<nr_token;i++) { if(tokens[i].type==MUL&&(i==0||(tokens[i-1].type!=RP&&tokens[i-1].type!=HEX&&tokens[i-1].type!=NUM))) tokens[i].type=DEREF; } return eval(1,nr_token); /* TODO: Insert codes to evaluate the expression. */ //panic("please implement me"); //return 0; }
C
#include<stdio.h> #include<stdlib.h> #include<conio.h> #include<math.h> void binary(int b[],int x) { int i; for(i=0;i<4;i++) b[i]=0; i=3; while(x>0) { b[i]=x%2; x=x/2; i--; } } int add(int p[],int k[],int carry) { int x,j; for(j=3;j>=0;j--) { x=p[j]; p[j]=x^k[j]^carry; if(((x==1)&&(k[j]==1))||((k[j]==1)&&(carry==1))||((carry==1)&&(x==1))) { carry=1; } else carry=0; } return carry; } void rightshift(int x,int *y) { int i; for(i=3;i>0;i--) y[i]=y[i-1]; y[0]=x; } void main() { int M,Q,m[4],q[4],i,j,y,c=0,z=0,s=0; int a[4]={0,0,0,0}; int ans[8]; clrscr(); printf("\n Enter the Multiplicant: "); scanf("%d",&M); printf("\n Enter the Multiplier: "); scanf("%d",&Q); binary(m,M); printf("\n\n Binary conversion of Multiplicant %d is: ",M); for(i=0;i<4;i++) { printf("%d",m[i]); } binary(q,Q); printf("\n\n\ Binary conversion of Multiplier %d is: ",Q); for(i=0;i<4;i++) { printf("%d",q[i]); } printf("\n\n\n Operation\tCarry \t Accumulator Multiplier \n"); printf("\n INITIAL "); printf("\t %d",c); printf("\t\t"); for(i=0;i<4;i++) { printf("%d",a[i]); } printf("\t\t"); for(i=0;i<4;i++) { printf("%d",q[i]); } for(j=0;j<4;j++) { if(q[3]==1) { printf("\n a=a+m\t "); c=add(a,m,c) ; printf("\t %d",c); printf("\t\t"); for(i=0;i<4;i++) { printf("%d",a[i]); } printf("\t\t"); for(i=0;i<4;i++) { printf("%d",q[i]); } } printf("\n Shift \t"); y=a[3]; rightshift(c,a); rightshift(y,q); c=0; printf("\t %d",c); printf("\t\t"); for(i=0;i<4;i++) { printf("%d",a[i]); } printf("\t\t"); for(i=0;i<4;i++) { printf("%d",q[i]); } } printf("\n\n The answer in binary form is : "); for(i=0;i<4;i++) { ans[i]=a[i]; } for(i=0;i<4;i++) { ans[i+4]=q[i]; } for(i=0;i<8;i++) { printf("%d",ans[i]); } printf("\n\n Its decimal form is: "); for(i=7;i>=0;i--) { s=s+(pow (2,z)*ans[i]); z++; } printf("%d",s); getch(); }
C
#include <stdio.h> #include <stdlib.h> /* 使用两次二分查找找到第一个和最后一个K */ int getFirstK(int* data, int k, int start, int end) { if (start > end){ return -1; } int middleIndex = (start + end) / 2; int middleData = data[middleIndex]; if (middleData == k) { if ((middleIndex > 0 && data[middleIndex - 1] != k) || middleIndex == 0) { return middleIndex; } else if (middleIndex > 0 && data[middleIndex - 1] == k) { end = middleIndex - 1; } } else if (middleData > k) { end = middleIndex - 1; } else { start = middleIndex + 1; } return getFirstK(data, k, start, end); } int getLastK(int* data, int k, int start, int end) { if (start > end) { return -1; } int middleIndex = (start + end) / 2; int middleData = data[middleIndex]; if (middleData == k) { if ((middleIndex < end && data[middleIndex + 1] != k) || middleIndex == end) { return middleIndex; } else if (middleIndex < end && data[middleIndex + 1] == k) { start = middleIndex + 1; } } else if (middleData > k) { end = middleIndex - 1; } else { start = middleIndex + 1; } return getLastK(data, k, start, end); } int getNumberOfK(int* data, int k, int length) { int number = 0; if (data != NULL && length > 0) { int first = getFirstK(data, k, 0, length-1); int last = getLastK(data, k, 0, length-1); if (first != -1 && last != -1) { number = last - first + 1; } } return number; } int main() { int data[] = {1, 2, 3, 3, 3, 3, 4, 5}; int length = sizeof(data) / sizeof(int); int number = getNumberOfK(data, 3, length); printf("%d\n", number); return 0; }
C
/* ************************************************************************** */ /* */ /* ::: :::::::: */ /* printf.c :+: :+: :+: */ /* +:+ +:+ +:+ */ /* By: edelangh <edelangh@student.42.fr> +#+ +:+ +#+ */ /* +#+#+#+#+#+ +#+ */ /* Created: 2014/12/03 14:06:26 by edelangh #+# #+# */ /* Updated: 2016/03/25 14:52:16 by edelangh ### ########.fr */ /* */ /* ************************************************************************** */ #include "ft_printf.h" int ft_printf(char *format, ...) { va_list ap; int len; int res; int fd; char *tmp; ft_static(&fd, (fd = 1) == 2); va_start(ap, format); ft_va_get(ap, 0); if (!format) return (-1); tmp = ft_makecolor(&format); while (*format) { len = ft_len_untill(format, '%'); ft_fwrite(format, len); format += len; if (*format == '%' && (res = ft_action(format, ap)) == -1) return (*((int*)ft_static(0, 1))); else if (*format == '%') format += res; } va_end(ap); return (*((int*)ft_static(0, 1)) + ft_free(tmp)); } int ft_dprintf(int fd, char *format, ...) { va_list ap; int len; int res; char *tmp; ft_static(&fd, 0); va_start(ap, format); ft_va_get(ap, 0); if (!format) return (-1); tmp = ft_makecolor(&format); while (*format) { len = ft_len_untill(format, '%'); ft_fwrite(format, len); format += len; if (*format == '%' && (res = ft_action(format, ap)) == -1) return (*((int*)ft_static(0, 1))); else if (*format == '%') format += res; } va_end(ap); return (*((int*)ft_static(0, 1)) + ft_free(tmp)); } int ft_sprintf(char *str, char *format, ...) { va_list ap; int len; int res; char *tmp; if (!format) return (-1); ft_static(str, 3); va_start(ap, format); ft_va_get(ap, 0); tmp = ft_makecolor(&format); while (*format) { len = ft_len_untill(format, '%'); ft_fwrite(format, len); format += len; if (*format == '%') { if ((res = ft_action(format, ap)) == -1) return (*((int*)ft_static(0, 1))); format += res; } } va_end(ap); return (*((int*)ft_static(0, 1)) + ft_free(tmp)); } int ft_asprintf(char **ret, char *format, ...) { va_list ap; int len; int res; char *tmp; if (!format || !ret) return (-1); *ret = NULL; ft_static(ret, 8); va_start(ap, format); ft_va_get(ap, 0); tmp = ft_makecolor(&format); while (*format) { len = ft_len_untill(format, '%'); ft_fwrite(format, len); format += len; if (*format == '%' && (res = ft_action(format, ap)) == -1) return (*((int*)ft_static(0, 1))); else if (*format == '%') format += res; } va_end(ap); return (*((int*)ft_static(0, 1)) + ft_free(tmp)); } int ft_fprintf(FILE *file, char *format, ...) { va_list ap; int len; int res; char *tmp; ft_static(file, 4); va_start(ap, format); ft_va_get(ap, 0); if (!format || !file) return (-1); tmp = ft_makecolor(&format); while (*format) { len = ft_len_untill(format, '%'); ft_fwrite(format, len); format += len; if (*format == '%') { if ((res = ft_action(format, ap)) == -1) return (*((int*)ft_static(0, 1))); format += res; } } va_end(ap); return (*((int*)ft_static(0, 1)) + ft_free(tmp)); }
C
#include<stdio.h> #include<conio.h> #include<stdlib.h> #include<malloc.h> typedef struct node{ float val; struct node *next; }node; node *start=NULL; node *create(node *start){ float num; printf("\nEnter value: "); scanf("%f",&num); node *ptr,*new_node; while(num!=-1){ new_node=(node *)malloc(sizeof(node)); new_node->val=num; if(start==NULL){ new_node->next=NULL; start=new_node; } else{ ptr=start; while(ptr->next!=NULL) ptr=ptr->next; ptr->next=new_node; new_node->next=NULL; } printf("\nEnter value: "); scanf("%f",&num); } return start; } void display(node *start){ node *ptr; ptr=start; while(ptr->next!=NULL){ printf("%.2f\t",ptr->val); ptr=ptr->next; } printf("%.2f",ptr->val); } void sumnmean(node *start){ node *ptr; ptr=start; float sum=0; while(ptr->next!=NULL){ sum+=ptr->val; ptr=ptr->next; } sum+=ptr->val; printf("\nSum = %.2f",sum); int count=0; ptr=start; while(ptr->next!=NULL){ count++; ptr=ptr->next; } count++; float mean=sum/count; printf("\nMean = %.2f",mean); } int main(){ start=create(start); printf("\nlist is:\n"); display(start); sumnmean(start); return 0; }
C
#include "libft.h" int ft_strncmp(const char *s1, const char *s2, size_t n) { size_t i; if (s1 == NULL && s2 == NULL) return (0); i = 0; while (i < n && (i < ft_strlen(s1) || i < ft_strlen(s2))) { if (((unsigned char *)s1)[i] != ((unsigned char *)s2)[i]) return (((unsigned char *)s1)[i] - ((unsigned char *)s2)[i]); else i++; } return (0); }
C
ERROR: type should be string, got "https://www.codechef.com/CORU2019/problems/ROBRESC/\n\n/* AUTHOR:AKASH JAIN\n* USERNAME:akash19jain \n* DATE:16/03/2019 \n*/\n#include<stdio.h>\n#include<math.h>\n#include<string.h>\n#include<stdlib.h>\n#include<stdbool.h>\n#define mod 1000000007\nint cmp(const void * a,const void * b)\n{\n return (*(int*)b - *(int*)a);\n}\n\nint main()\n{\n long long t;\n scanf(\"%lld\",&t);\n while(t--)\n {\n long long n,p,q,l,r,x,j;\n scanf(\"%lld%lld%lld\",&n,&p,&q);\n long long arr[n],sum=0,i,coins[q],max=0;\n for(i=0;i<n;i++)\n {\n scanf(\"%lld\",&arr[i]);\n sum+=arr[i];\n }\n for(i=0;i<q;i++)\n {\n scanf(\"%lld%lld%lld\",&l,&r,&x);\n long long z=(r-l+1)*x;\n coins[i]=z;\n //printf(\"%lld \",coins[i]);\n }\n qsort(coins,q,sizeof(coins[0]),cmp);\n for(i=0;i<p;i++)\n {\n sum+=coins[i];\n }\n printf(\"%lld\\n\",sum);\n }\n return 0;\n}\n"
C
// Copyright (c) 2020 Raytheon BBN Technologies, Inc. All Rights Reserved. // // This document does not contain technology or Technical Data controlled under either // the U.S. International Traffic in Arms Regulations or the U.S. Export Administration // // Distribution A: Approved for Public Release, Distribution Unlimited #include "sockaddr.h" void inet6_to_long(const struct sockaddr_in6* addr, uint64_t* msb, uint64_t* lsb) { uint64_t m_lsb = 0; uint64_t m_msb = 0; for(int i = 0; i < 8; i++) { m_msb = m_msb << 8; m_msb |= addr->sin6_addr.s6_addr[i]; } for(int i = 8; i < 16; i++) { m_lsb = m_lsb << 8; m_lsb |= addr->sin6_addr.s6_addr[i]; } *msb = m_msb; *lsb = m_lsb; } int compare_inet6_sockaddrs(const struct sockaddr_in6* addr_a, const struct sockaddr_in6* addr_b) { in_port_t port_a = addr_a->sin6_port; in_port_t port_b = addr_b->sin6_port; // Check that the ports are equal. if(port_a != port_b) { return 0; } uint64_t addr_a_msb = 0; uint64_t addr_a_lsb = 0; inet6_to_long(addr_a, &addr_a_msb, &addr_a_lsb); uint64_t addr_b_msb = 0; uint64_t addr_b_lsb = 0; inet6_to_long(addr_b, &addr_b_msb, &addr_b_lsb); // Check if the addresses are equal. if(addr_a_msb == addr_b_msb && addr_a_lsb == addr_a_lsb) { return 1; } // Check if one of the addresses matches the other. // FIXME: This is currently hacked to assume null and loopback match everything. if(addr_a_msb == 0 && addr_a_lsb == 0) { return 1; } if(addr_a_msb == INET6_LOOPBACK_MSB && addr_a_lsb == INET6_LOOPBACK_LSB) { return 1; } if(addr_b_msb == 0 && addr_b_lsb == 0) { return 1; } if(addr_b_msb == INET6_LOOPBACK_MSB && addr_b_lsb == INET6_LOOPBACK_LSB) { return 1; } return 0; } int compare_inet_sockaddrs(const struct sockaddr_in* addr_a, const struct sockaddr_in* addr_b) { in_port_t port_a = addr_a->sin_port; in_port_t port_b = addr_b->sin_port; // Check that the ports are equal. if(port_a != port_b) { return 0; } uint32_t s_addr_a = addr_a->sin_addr.s_addr; uint32_t s_addr_b = addr_b->sin_addr.s_addr; // Check if the addresses are equal. if(s_addr_a == s_addr_b) { return 1; } // Check if one of the addresses matches the other. // FIXME: This is currently hacked to assume null and loopback match everything. if(s_addr_a == 0 || s_addr_a == INET_LOOPBACK) { return 1; } if(s_addr_b == 0 || s_addr_b == INET_LOOPBACK) { return 1; } return 0; } int compare_sockaddrs(const struct sockaddr* addr_a, const struct sockaddr* addr_b) { // Extract the family IDs. sa_family_t family_a = addr_a->sa_family; sa_family_t family_b = addr_b->sa_family; // Make sure the structs are compatible if(family_a != family_b) { fprintf(stderr, "ABORT: Tried comparing sockaddrs from different families: %d and %d\n", family_a, family_b); exit(1); } //Run the correct subroutine based on the family. switch(family_a) { case AF_INET: return compare_inet_sockaddrs((const struct sockaddr_in *)addr_a, (const struct sockaddr_in *)addr_b); case AF_INET6: return compare_inet6_sockaddrs((const struct sockaddr_in6 *)addr_a, (const struct sockaddr_in6 *)addr_b); default: fprintf(stderr, "ABORT: Unhandled family: %d\n", family_a); exit(1); } }
C
/* ************************************************************************** */ /* */ /* ::: :::::::: */ /* orientate_sprite.c :+: :+: :+: */ /* +:+ +:+ +:+ */ /* By: mribouch <mribouch@student.42.fr> +#+ +:+ +#+ */ /* +#+#+#+#+#+ +#+ */ /* Created: 2020/08/10 15:35:48 by mribouch #+# #+# */ /* Updated: 2020/08/10 17:36:36 by mribouch ### ########.fr */ /* */ /* ************************************************************************** */ #include "game/entities/monster_entity.h" static float diamond_angle(float x, float y) { if (y >= 0) return (x >= 0 ? y / (x + y) : 1 - x / (-x + y)); else return (x < 0 ? 2 - y / (-x - y) : 3 + x / (x - y)); } static float angle_gap(float p, float m) { float diff; diff = p - m; if (diff < 0) return (diff + 4); return (diff); } static float compute_angle_to_player(t_monster_entity *self) { t_vec3f player_pos; t_vec3f monster_pos; t_vec3f dir_to_player; float monster_angle; float player_angle; player_pos = self->player_ref->super.transform.position; monster_pos = self->super.super.transform.position; dir_to_player = ft_vec3f(player_pos.x - monster_pos.x, player_pos.y - monster_pos.y, 0); monster_angle = diamond_angle(self->super.super.transform.direction.x, self->super.super.transform.direction.y); player_angle = diamond_angle(dir_to_player.x, dir_to_player.y); return (angle_gap(player_angle, monster_angle)); } static int face4(float a) { if (a >= 3.5 || a <= 0.5) return (0); if (0.5 <= a && a <= 1.5) return (3); if (1.5 <= a && a <= 2.5) return (2); return (1); } int get_orientate_sprite(t_monster_entity *self) { float angle; int index; angle = compute_angle_to_player(self); index = face4(angle); return (index); }
C
/* Copyright: (c) 2005 ImmenStar Inc. All Rights Reserved. */ #include "iros_config.h" #include "plat_common.h" #include <stdio.h> #include <string.h> #include <time.h> #include <unistd.h> #include <cyg/infra/cyg_type.h> #include <stddef.h> #ifdef HAVE_ZTE_SIJIE extern cs_status epon_request_onu_reset_set(void); #endif /*END_HAVE_ZTE_SIJIE*/ int cmd_cmp(char *str, const char *mode) { if (strlen(str) != strlen(mode)) return 0; while (*mode) { if ((*str == '\0') || (*mode != *str)) return 0; mode++; str++; } return 1; } void dumpPkt(char *comment, int port, unsigned char *buffer, int len) { int i = 0, j = 0; if (!buffer || !len) return; if (comment) diag_printf("#%s port 0x%x len 0x%x\n", comment, port, len); diag_printf("%06x ", j); for (i = 0; i < len; i++) { if (i && (i % 16) == 0) { j += 0x10; diag_printf(" .\n"); diag_printf("%06x ", j); } diag_printf("%02x ", buffer[i]); } diag_printf(" .\n"); } #define SWITCH_GPIO 4 #define UP_LEVEL 1 #define DOWN_LEVEL 0 #define HOLD_TIME 100 //λ: extern void sdl_switch_hw_reset(void) { gpio_mode_t mode_original; cs_uint8 level_original; //ȡԭ cs_gpio_mode_get(SWITCH_GPIO, &mode_original); cs_gpio_read(SWITCH_GPIO, &level_original); //оƬ cs_gpio_mode_set(SWITCH_GPIO, GPIO_OUTPUT); cs_gpio_write(SWITCH_GPIO, DOWN_LEVEL); //ʱ cs_thread_delay(HOLD_TIME); //оƬϵ cs_gpio_write(SWITCH_GPIO, UP_LEVEL); //ָԭ cs_gpio_write(SWITCH_GPIO, level_original); cs_gpio_mode_set(SWITCH_GPIO, mode_original); } void iros_system_reset(RESET_TYPE_E reset_type) { if (reset_type >= RESET_TYPE_MAX) return; switch (reset_type) { case RESET_TYPE_FORCE: #ifdef HAVE_SWITCH_HW_RESET sdl_switch_hw_reset(); #endif #ifdef HAVE_ZTE_SIJIE epon_request_onu_reset_set(); #endif /*END_HAVE_ZTE_SIJIE*/ HAL_PLATFORM_RESET(); break; default: break; } } static int cs_char2int(char c) { int digit = 0; if(c <= '9' && c >= '0') digit = c - '0'; else if(c <= 'f' && c >= 'a') digit = c - 'a' + 10; else digit = c - 'A' + 10; return digit; } static char cs_int2char(int num) { char c = 0; if(num >= 0 && num <= 9) c = '0' + num; else c = 'a' + num - 10; return c; } int cs_str2mac(char *mac_str , char *mac_addr) { char *c = NULL; int index = 0; int parse_state = 0; int char_type = 0; /*0: decimal number 1: Hex Number,lower case 2: hex number, upper case 3:colon type 4:error type*/ int high_bits = 0, low_bits = 0; if(mac_str == NULL || mac_addr == NULL) return -1; c = mac_str; while(*c != '\0') { if(*c <= '9' && *c >= '0') char_type = 0; else if(*c <= 'f' && *c >= 'a') char_type = 1; else if(*c <= 'F' && *c >= 'A') char_type = 2; else if(*c == ':'||*c == '.') char_type = 3; else char_type = 4; switch(char_type) { case 0: case 1: case 2: if(parse_state == 0 || parse_state == 3) { high_bits = cs_char2int(*c); parse_state = 1; } else if(parse_state == 1) { low_bits = cs_char2int(*c); parse_state = 2; } else return -1; if(index >= 6) return -1; c++; if(*c == '\0') { if(parse_state == 1) { mac_addr[index++] = high_bits; } if(parse_state == 2) { mac_addr[index++] = (high_bits<<4)+low_bits; } } break; case 3: if(parse_state != 1 && parse_state != 2) return -1; if(parse_state == 1) { mac_addr[index++] = high_bits; } if(parse_state == 2) { mac_addr[index++] = (high_bits<<4)+low_bits; } parse_state = 3; c++; break; default: return -1; } } if(index != 6) return -1; return 0; } int cs_str2hex(char *oui_str , char *oui_value , int maxbytes) { char *c = NULL; int index = 0; int parse_state = 0; int char_type = 0; /*0: decimal number 1: Hex Number,lower case 2: hex number, upper case 3:colon type 4:error type*/ int high_bits = 0, low_bits = 0; if(oui_str == NULL || oui_value == NULL) return -1; c = oui_str; while(*c != '\0') { if(*c <= '9' && *c >= '0') char_type = 0; else if(*c <= 'f' && *c >= 'a') char_type = 1; else if(*c <= 'F' && *c >= 'A') char_type = 2; else if(*c == ':'||*c == '.') char_type = 3; else char_type = 4; switch(char_type) { case 0: case 1: case 2: if(parse_state == 0 || parse_state == 3) { high_bits = cs_char2int(*c); parse_state = 1; } else if(parse_state == 1) { low_bits = cs_char2int(*c); parse_state = 2; } else return -1; if(index >= maxbytes) return -1; c++; if(*c == '\0') { if(parse_state == 1) { oui_value[index++] = high_bits; } if(parse_state == 2) { oui_value[index++] = (high_bits<<4)+low_bits; } } break; case 3: if(parse_state != 1 && parse_state != 2) return -1; if(parse_state == 1) { oui_value[index++] = high_bits; } if(parse_state == 2) { oui_value[index++] = (high_bits<<4)+low_bits; } parse_state = 3; c++; break; default: return -1; } } if(index != maxbytes) return -1; return 0; } int cs_mac2str(char *mac_str , char *mac_addr) { char digit = 0; int i; int index = 0; if(mac_str == NULL || mac_addr == NULL) return -1; for(i = 0 ; i < 6 ; i++) { digit = mac_addr[i]; mac_str[index++] = cs_int2char((digit>>4)&0x0F); mac_str[index++] = cs_int2char(digit&0x0F); if(i < 5) mac_str[index++] = ':'; } mac_str[index] = '\0'; return 0; } int cs_str2ip(char *ip_str , unsigned int *ipaddr) { char *c = NULL; int parse_state = 0; int index = 0; int ip[4]; if(ip_str == NULL || ipaddr == NULL) return -1; c = ip_str; while(*c != '\0') { switch(*c) { case '0': if(parse_state == 0) return -1; case '1': case '2': case '3': case '4': case '5': case '6': case '7': case '8': case '9': if(parse_state == 0 || parse_state == 2) { ip[index++] = atoi(c); if(ip[index-1] > 255 || ip[index-1] < 0) return -1; } c++; parse_state = 1; break; case '.': if(parse_state != 1) return -1; c++; parse_state = 2; break; default: return -1; } } if(parse_state != 1) return -1; *ipaddr = (unsigned int)(((ip[0]<<24)&0xFF000000)|((ip[1]<<16)&0xFF0000)|((ip[2]<<8)&0xFF00)|((ip[3]<<0)&0xFF)); return 0; } int cs_ip2str(char *ip_str , unsigned int ipaddr) { if(ip_str == NULL) return -1; sprintf(ip_str , "%d.%d.%d.%d",(ipaddr>>24)&0xFF, (ipaddr>>16)&0xFF, (ipaddr>>8)&0xFF, (ipaddr>>0)&0xFF); return 0; } static int cs_str2dec(char *str , unsigned int *num) { char *c = str; int len = 0; int parse_status = 0; unsigned int temp_num = 0; /****************************************************************** PARSE_STATUS DESC ------------------------------------------------------ 0 init status 1 string length is 1, it must be a dec num. 2 a hex-string, header is '0x'. 3 a decimal-string,start with a digit '1-9' ------------------------------------------------------ ******************************************************************/ len = strlen(str); if(len == 0) { *num = 0; return -1; } if(len == 1) parse_status = 1; while(*c != '\0') { switch(*c) { case '0': if(parse_status == 0) { c++; if(*c != 'x') /*str = 01/02/0a/0b/0h/00, but not '0x'*/ { *num = 0; return -1; } else { parse_status = 2; if(len > 10)/*the max len of a hex-string must less than 10. Eg. '0x12345678'*/ { *num = 0; return -1; } } } else if(parse_status == 1) /*just one byte,and it is '0'.*/ { *num = 0; return 0; } else if(parse_status == 2) { temp_num = temp_num<<4; } else if(parse_status == 3) { temp_num = 10*temp_num; } else { *num = 0; return -1; } break; case '1': case '2': case '3': case '4': case '5': case '6': case '7': case '8': case '9': if(parse_status == 0) { temp_num = *c-'0'; parse_status = 3; } else if(parse_status == 1) { *num = atoi(str); return 0; } else if(parse_status == 2) { temp_num = (temp_num<<4) + *c - '0'; } else if(parse_status == 3) { temp_num = (temp_num*10) + *c - '0'; } else { *num = 0; return -1; } break; case 'a': case 'b': case 'c': case 'd': case 'e': case 'f': if(parse_status == 0 || parse_status == 1 || parse_status == 3) { *num = 0; return -1; } if(parse_status == 2) { temp_num = (temp_num<<4) + *c - 'a' + 10; } else { *num = 0; return -1; } break; case 'A': case 'B': case 'C': case 'D': case 'E': case 'F': if(parse_status == 0 || parse_status == 1 || parse_status == 3) { *num = 0; return -1; } if(parse_status == 2) { temp_num = (temp_num<<4) + *c - 'A' + 10; } else { *num = 0; return -1; } break; default: *num = 0; return -1; } c++; } *num = temp_num; return 0; } int cs_isdigit(char c) { if(('0' <= c) && (c <= '9')) return 1; return 0; } int cs_isdigit_str(char *str) { char *c = str; while(*c != '\0') { if(!cs_isdigit(*c)) return 0; } return 1; } int cs_isalpha(char c) { if((c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z')) return 1; return 0; } int cs_atoi(char *str) { unsigned int num=0; if(cs_str2dec(str, &num) != 0) return 0; return num; } void cs_str2lower(char *str) { int len = strlen(str); int i; for(i = 0 ; i < len ; i++) { if(!cs_isalpha(str[i])) continue; if(str[i] >= 'A' && str[i] <= 'Z') str[i] = str[i]-'A'+'a'; } return; } void cs_str2upper(char *str) { int len = strlen(str); int i; for(i = 0 ; i < len ; i++) { if(!cs_isalpha(str[i])) continue; if(str[i] >= 'a' && str[i] <= 'z') str[i] = str[i]-'a'+'A'; } return; } int cs_strxcmp(char *src , char *dst) { if(strlen(src) != strlen(dst)) return 1; return strcmp(src, dst); } int cs_strcmp(char *src , char *dst) { return strcmp(src, dst); }
C
#ifndef MY_ESCAPE_H #define MY_ESCAPE_H #include "myAbstractSyntax.h" /// /// \brief find and record escapes in the given expression. /// \param[in] exp the expression inside which to look for. /// \return this function has no return value. /// /// \remark after called, variable escape information is holded, /// call Escape_isVarEscape() to get an available one. void Escape_findEscape(myExp exp); /// /// \brief check if the given variable is escaped. /// \param[in] varName the name of a variable. /// \return a bool. /// /// \remark variables inside nested scopes can not be check any more!! bool Escape_isVarEscaped(mySymbol varName); /// /// \brief get escape environment which is actually a table. /// \param this function has no parameters. /// \return the environment. /// /// \remark it's a checked runtime error when calling this before /// any information is entered. // \note to make code testable, it is necessary. myTable Escape_getEscapeEnvironment(void); /// /// \brief set escape environment which is actually a table. /// \param escapeEnv the environmet to set. /// \return this function has no return value. /// /// \remark it's a checked runtime error to pass a NULL environment. // \note to make code testable, it is necessary. void Escape_setEscapeEnvironment(myTable escapeEnv); #endif
C
#include <intrinsics.h> #include "indicator.h" unsigned char number[] = { 0x3f, //0 0x06, //1 0x5b, //2 0x4f, //3 0x66, //4 0x6d, //5 0x7d, //6 0x07, //7 0x7f, //8 0x6f //9 }; volatile unsigned char data[3]; volatile unsigned char LEDS[]; void IND_Init(void) { //, . PORT_IND = 0xff; DDR_IND = 0xff; //, . PORT_K &= ~((1<<KAT3)|(1<<KAT2)|(1<<KAT1)); DDR_K |= (1<<KAT3)|(1<<KAT2)|(1<<KAT1); PORT_PLUS = 0xff; DDR_PLUS = 0xff; PORT_BASE &= ~((1<<BASE5)|(1<<BASE4)|(1<<BASE3)|(1<<BASE2)|(1<<BASE1)); DDR_BASE |= ((1<<BASE5)|(1<<BASE4)|(1<<BASE3)|(1<<BASE2)|(1<<BASE1)); data[0] = 0; data[1] = 0; data[2] = 0; } void ioinit(void){ DDRA = 0x3f; PORTA = 0x00; } void output_led_state(unsigned char __led_state_col, unsigned char __led_state_row) { SH_CP_row_low(); ST_CP_row_low(); SH_CP_col_low(); ST_CP_col_low(); for(int i = 0; i < 16; i++){ if(bit_is_set(__led_state_row, i)) { DS_row_high(); DS_row_low(); } else DS_row_low(); SH_CP_row_high(); SH_CP_row_low(); if(bit_is_set(__led_state_col, i)) { DS_col_high(); DS_col_low(); } else DS_col_low(); SH_CP_col_high(); SH_CP_col_low(); } ST_CP_col_high(); ST_CP_row_high(); } void IND_Conv(unsigned int value) { // unsigned char tmp; tmp = value % 10; data[0] = number[tmp]; tmp = value / 10 % 10; data[1] = number[tmp]; tmp = value / 100; data[2] = number[tmp]; // unsigned int x; unsigned int y; x = value / 16; y = value % 16; output_led_state(_BV(x),_BV(y)); } void IND_Update(void) { // static unsigned char count = 0; PORT_K &= ~((1<<KAT3)|(1<<KAT2)|(1<<KAT1)); PORT_IND = data[count]; if (count == 0) PORT_K |= (1<<KAT1); if (count == 1) PORT_K |= (1<<KAT2); if (count == 2) PORT_K |= (1<<KAT3); count++; if (count == 3) count = 0; }
C
/* ID: wangbn11 LANG: C TASK: range */ /* * ===================================================================================== * * Filename: range.c * * Description: dp -- caculate the max length one square can make; do from the * right corner. * * Version: 1.0 * Created: 11/26/2012 01:48:58 PM * Revision: none * Compiler: gcc * * Author: wangbn (nan adair), wangbn15@gmail.com * Organization: * * ===================================================================================== */ #include <stdio.h> #include <stdlib.h> int area[251][251], length[251][251]; int min(int a, int b, int c); int main() { FILE *fin = fopen("range.in", "r"); FILE *fout = fopen("range.out", "w"); int i, j, number, count[251]; fscanf(fin, "%d", &number); for (i = 0; i < number; i++) { char buffer[252]; fscanf(fin, "%s", buffer); for (j = 0; j < number; j++) { if (buffer[j] == '0') area[i][j] = 0; else area[i][j] = 1; } } for (i = 0; i <= 251; i++) count[i] = 0; for (i = 0; i < number; i++) length[number-1][i] = length[i][number-1] = 1; for (i = number-2; i >= 0; i--) { for (j = number-2; j >= 0; j--) { if (area[i+1][j] == 1 && area[i][j+1] == 1 && area[i+1][j+1] == 1 && area[i][j] == 1) length[i][j] = min(length[i+1][j], length[i][j+1], length[i+1][j+1]) + 1; else length[i][j] = 1; int k; for (k = 2; k <= length[i][j]; k++) count[k]++; } } i = 2; while (count[i] > 0) { fprintf(fout, "%d %d\n", i, count[i]); i++; } fclose(fin); fclose(fout); } int min(int a, int b, int c) { int d; d = a > b ? b : a; d = d > c ? c : d; return d; }
C
#include<stdio.h> #define INCH 2.54 // 1 inch = 2.54cm int main(void) { float cm; printf("Enter a height in centimeters:"); scanf("%f",&cm); while(cm>0) { printf("%.1f cm = %d feet, %.1f inches\n",cm,(int)(cm/INCH/12),cm/INCH-(int)(cm/INCH/12)*12); printf("Enter a height in centimeters(<=0 to quit):"); scanf("%f",&cm); } printf("bye\n"); return(0); }
C
#include <stdio.h> int main(){ char txt; while(1){ scanf("%c",&txt); if(txt=='\\')break; else if(txt=='\''||txt=='\"'); else printf("%c",txt); } return 0; }
C
#include <stdio.h> #include <string.h> #include"darray_int.h" void testFunc() { darray *myDarr; int myInt; int res; int numOfItems; AdtStatus tmp; tmp = darrayCreate(&myDarr,100); printf("result of create is :%d\n",tmp); myDarr = darrayAdd(myDarr,8); myDarr = darrayAdd(myDarr,10); myDarr = darrayAdd(myDarr,81); myDarr = darrayAdd(myDarr,82); darrayDelete(myDarr,&myInt); print_AD(myDarr); //res = darrayItemsNum(myDarr,&numOfItems); //printf("there is numOfItems %d\n",res); myDarr = darrayAdd(myDarr,2); darraySort(myDarr, numOfItems); printf("result after sort \n"); print_AD(myDarr); darrayDestroy(myDarr); printf("result after destroy \n"); print_AD(myDarr); //darrayDelete(myDarr,&myInt); //printf("%d\n",myInt); } int main() { testFunc(); return 0; }
C
#include "PCA9632.h" /** * @brief I2C write * * ___________________________________________________________________ * | start | slave_addr + wr_bit + ack | write n bytes + ack | stop | * --------|---------------------------|----------------------|------| * * @param addr slave device adress * @param data_wr pointer to data buffer * @param size number of bytes to send * * @return * - ESP_OK Success * - ESP_ERR_INVALID_ARG Parameter error * - ESP_FAIL Sending command error, slave doesn't ACK the transfer. * - ESP_ERR_INVALID_STATE I2C driver not installed or not in master mode. * - ESP_ERR_TIMEOUT Operation timeout because the bus is busy. */ esp_err_t i2c_write(uint8_t addr, uint8_t *data_wr, size_t size) { i2c_cmd_handle_t cmd = i2c_cmd_link_create(); i2c_master_start(cmd); i2c_master_write_byte(cmd, (addr << 1) | I2C_MASTER_WRITE, I2C_ACK_CHECK_EN); i2c_master_write(cmd, data_wr, size, I2C_ACK_CHECK_EN); i2c_master_stop(cmd); esp_err_t ret = i2c_master_cmd_begin(I2C_MASTER_NUM, cmd, I2C_TIMEOUT); i2c_cmd_link_delete(cmd); return ret; } /** * @brief i2c master initialization */ esp_err_t i2c_master_init() { i2c_config_t conf; conf.mode = I2C_MODE_MASTER; conf.sda_io_num = I2C_MASTER_SDA_IO; conf.sda_pullup_en = GPIO_PULLUP_ENABLE; conf.scl_io_num = I2C_MASTER_SCL_IO; conf.scl_pullup_en = GPIO_PULLUP_ENABLE; conf.master.clk_speed = I2C_MASTER_FREQ_HZ; i2c_param_config(I2C_MASTER_NUM, &conf); return i2c_driver_install(I2C_MASTER_NUM, conf.mode, I2C_MASTER_RX_BUF_DISABLE, I2C_MASTER_TX_BUF_DISABLE, 0); } void PCA9632_init() { uint8_t i2c_tx_buffer[10]; i2c_tx_buffer[0] = 0b10000000; //auto-increment all from beginning i2c_tx_buffer[1] = 0b00000000; //MODE1 - enable normal mode (should wait 500 us) i2c_tx_buffer[2] = 0b00100001; //MODE2 - group control blinking i2c_tx_buffer[3] = 0b00000000; //PWM0 - R i2c_tx_buffer[4] = 0b00000000; //PWM1 - G i2c_tx_buffer[5] = 0b00000000; //PWM2 - B i2c_tx_buffer[6] = 0b00000000; //PWM3 - unused i2c_tx_buffer[7] = 0b10000000; //GRPPWM i2c_tx_buffer[8] = 0b00110111; //GRPFREQ - period = (GFRQ[7:0] + 1) / 24 seconds i2c_tx_buffer[9] = 0b00111111; //LEDOUT - individual mode ESP_ERROR_CHECK(i2c_write(PCA9632_ADDR, i2c_tx_buffer, sizeof(i2c_tx_buffer) / sizeof(i2c_tx_buffer[0]))); return; } /** * @brief Turn off status LED and put PCA9632 in sleep mode */ void PCA9632_off() { uint8_t i2c_tx_buffer[2]; i2c_tx_buffer[0] = 0b00001000; //auto-increment off - set LEDOUT i2c_tx_buffer[1] = 0b00000000; //LEDOUT - all LEDs off ESP_ERROR_CHECK(i2c_write(PCA9632_ADDR, i2c_tx_buffer, sizeof(i2c_tx_buffer) / sizeof(i2c_tx_buffer[0]))); i2c_tx_buffer[0] = 0b00000000; //auto-increment off - set MODE1 i2c_tx_buffer[1] = 0b00010000; //MODE1 - enter sleep mode ESP_ERROR_CHECK(i2c_write(PCA9632_ADDR, i2c_tx_buffer, sizeof(i2c_tx_buffer) / sizeof(i2c_tx_buffer[0]))); return; } void PCA9632_blink(float duty_cycle, float period) { uint8_t grppwm = 255 * duty_cycle; uint8_t grpfreq = period * 24 - 1; uint8_t i2c_tx_buffer[3]; i2c_tx_buffer[0] = 0b11000110; //auto-increment for global control registers only i2c_tx_buffer[1] = grppwm; //GRPPWM i2c_tx_buffer[2] = grpfreq; //GRPFREQ: period = (GFRQ[7:0] + 1) / 24 seconds ESP_ERROR_CHECK(i2c_write(PCA9632_ADDR, i2c_tx_buffer, sizeof(i2c_tx_buffer) / sizeof(i2c_tx_buffer[0]))); return; } /** * @brief Set RGB value for status led. * Values are scaled by the brightness argument * * @param r Red value 0-255 * @param g Green value 0-255 * @param b Blue value 0-255 * @param brightness scaling factor 0-1 * */ void PCA9632_RGB(uint8_t r, uint8_t g, uint8_t b, float brightness) { r *= brightness; g *= brightness; b *= brightness; uint8_t i2c_tx_buffer[4]; i2c_tx_buffer[0] = 0b10100010; //auto-increment for individual brightness registers only, start from PWM0 i2c_tx_buffer[1] = r; //PWM0 - R i2c_tx_buffer[2] = g; //PWM1 - G i2c_tx_buffer[3] = b; //PWM2 - B ESP_ERROR_CHECK(i2c_write(PCA9632_ADDR, i2c_tx_buffer, sizeof(i2c_tx_buffer) / sizeof(i2c_tx_buffer[0]))); return; }
C
#include "stdlib.h" #include "stdio.h" #include "pthread.h" #define amount_of_string 4 pthread_key_t global_key; void* thread(void* tmp); void add_global_var(); int main() { pthread_t id_first_thread, id_second_thread, id_third_thread, id_fourth_thread; pthread_attr_t attribute; int error_initial = pthread_attr_init(&attribute); if (error_initial != 0) { printf("error of pthread_attr_init()\n"); return EXIT_FAILURE; } pthread_key_create(&global_key,NULL); char* string_for_first_thread[] = {"1: hello, i'm first", "1: how are you?", "1: good job, man", "1: bye"}; int error_create_1 = pthread_create(&id_first_thread, &attribute, thread, string_for_first_thread); if(error_create_1 != 0) { int error_destroy = pthread_attr_destroy(&attribute); if(error_destroy != 0) { printf("error of pthread_create()\n"); printf("error of pthread_attr_destroy()\n"); return EXIT_FAILURE; } printf("error of pthread_create()\n"); return EXIT_FAILURE; } char* string_for_second_thread[] = {"2: hello, i'm second", "2: i'm fine, thanks", "2: thank you", "2: bye"}; int error_create_2 = pthread_create(&id_second_thread, &attribute, thread, string_for_second_thread); if(error_create_2 != 0) { int error_join_1 = pthread_join(id_first_thread, NULL); if(error_join_1 != 0) { int error_destroy = pthread_attr_destroy(&attribute); if(error_destroy != 0) { printf("error of pthread_create()\n"); printf("error of pthread_join()\n"); printf("error of pthread_attr_destroy()\n"); return EXIT_FAILURE; } printf("error of pthread_join()\n"); return EXIT_FAILURE; } printf("error of pthread_create()\n"); return EXIT_FAILURE; } char* string_for_third_thread[] = {"3: hello, i'm third", "3: heeeey", "3: o-la-la", "3: bye"}; int error_create_3 = pthread_create(&id_third_thread, &attribute, thread, string_for_third_thread); if(error_create_3 != 0) { int error_join_1 = pthread_join(id_first_thread, NULL); if(error_join_1 != 0) { int error_destroy = pthread_attr_destroy(&attribute); if(error_destroy != 0) { printf("error of pthread_create()\n"); printf("error of pthread_join()\n"); printf("error of pthread_attr_destroy()\n"); return EXIT_FAILURE; } printf("error of pthread_join()\n"); return EXIT_FAILURE; } int error_join_2 = pthread_join(id_second_thread, NULL); if(error_join_2 != 0) { int error_destroy = pthread_attr_destroy(&attribute); if(error_destroy != 0) { printf("error of pthread_create()\n"); printf("error of pthread_join()\n"); printf("error of pthread_attr_destroy()\n"); return EXIT_FAILURE; } printf("error of pthread_join()\n"); return EXIT_FAILURE; } printf("error of pthread_create()\n"); return EXIT_FAILURE; } char* string_for_fourth_thread[] = {"4: hello, i'm fourth", "4: I forgot everything!", "4: what should I do?", "4: bye"}; int error_create_4 = pthread_create(&id_fourth_thread, &attribute, thread, string_for_fourth_thread); if(error_create_4 != 0) { int error_join_1 = pthread_join(id_first_thread, NULL); if(error_join_1 != 0) { int error_destroy = pthread_attr_destroy(&attribute); if(error_destroy != 0) { printf("error of pthread_create()\n"); printf("error of pthread_join()\n"); printf("error of pthread_attr_destroy()\n"); return EXIT_FAILURE; } printf("error of pthread_join()\n"); return EXIT_FAILURE; } int error_join_2 = pthread_join(id_second_thread, NULL); if(error_join_2 != 0) { int error_destroy = pthread_attr_destroy(&attribute); if(error_destroy != 0) { printf("error of pthread_create()\n"); printf("error of pthread_join()\n"); printf("error of pthread_attr_destroy()\n"); return EXIT_FAILURE; } printf("error of pthread_join()\n"); return EXIT_FAILURE; } int error_join_3 = pthread_join(id_third_thread, NULL); if(error_join_3 != 0) { int error_destroy = pthread_attr_destroy(&attribute); if(error_destroy != 0) { printf("error of pthread_create()\n"); printf("error of pthread_join()\n"); printf("error of pthread_attr_destroy()\n"); return EXIT_FAILURE; } printf("error of pthread_join()\n"); return EXIT_FAILURE; } printf("error of pthread_create()\n"); return EXIT_FAILURE; } int error_join_1 = pthread_join(id_first_thread, NULL); int error_join_2 = pthread_join(id_second_thread, NULL); int error_join_3 = pthread_join(id_third_thread, NULL); int error_join_4 = pthread_join(id_fourth_thread, NULL); if(error_join_1 != 0 || error_join_2 != 0 || error_join_3 != 0 || error_join_4 != 0 ) { printf("error of pthread_join()\n"); int error_destroy = pthread_attr_destroy(&attribute); if(error_destroy != 0) { printf("error of pthread_attr_destroy()\n"); return EXIT_FAILURE; } return EXIT_FAILURE; } pthread_key_delete(global_key); int error_destroy = pthread_attr_destroy(&attribute); if(error_destroy != 0) { printf("error of pthread_attr_destroy()\n"); return EXIT_FAILURE; } return EXIT_SUCCESS; } void* thread(void* string_to_print) { if(NULL == string_to_print) { printf("error : get NULL pointer\n"); return NULL; } int *p = malloc(sizeof(int)); if(NULL == p) { printf("null pointer in thread()\n"); return NULL; } *p = 1; void * tmp = pthread_getspecific(global_key); if(NULL == tmp) { pthread_setspecific(global_key, p); add_global_var(); pthread_setspecific(global_key, NULL); free(p); } else { printf("pthread_getspecific returned not a NULL\n"); } for(int i = 0; i < amount_of_string; i++) { printf("%s\n", ((char**)string_to_print)[i]); } printf("\n"); return NULL; } void add_global_var() { int* global_var = pthread_getspecific(global_key); printf("before modification value is %d\n", *global_var); *global_var += 1; printf("after modification value is %d\n", *global_var); }
C
#include <math.h> #include <stdio.h> #include <string.h> #include <stdlib.h> #include <assert.h> #include <limits.h> #include <stdbool.h> int main(){ int n; scanf("%d",&n); int a[n]; for(int arr_i = 0; arr_i < n; arr_i++){ scanf("%d",&a[arr_i]); } int s,l,v,r; l=a[0]; for(int t=0;t<n;t++){ if(l<a[t]){l=a[t];} } for(int t=0;t<n;t++){ if(l==a[t]){v=t;} } a[v]=a[0]; a[0]=l; /*for(int t=0;t<n;t++){ printf("\t%d",a[t]); }*/ for(int k=0;a[0]!=0;k++){ r=0; s=l; for(int j=0;j<n;j++){ if(a[j]>0){ if(s>a[j]){s=a[j]; //printf("\nthis is small %d",s); } } } for(int i=0;i<n;i++){ //printf("\nthis is %d of %d",a[i],i); if(a[i]>0){ a[i]=a[i]-s; r=r+1; } //printf("\nthis is new %d of %d",a[i],i); } printf("\n%d",r); } return 0; }
C
# include <stdio.h> int main() { unsigned int a = 60; unsigned int b = 12; int c = 0; c = a&b; printf("c's value:%d\n",c); c = a|b; printf("c's value:%d\n",c); c = a^b; printf("c's value:%d\n",c); c = ~a; printf("c's value:%d\n",c); c = a<<2; printf("c's value:%d\n",c); c = a>>2; printf("c's value:%d\n",c); return 0; }
C
#include <stdio.h> int main(void) { int num; printf("整数を入力してください:"); scanf("%d", &num); switch(num % 3){ case 0 : puts("その数は3で割り切れます。"); break; case 1 : puts("その数を3で割った剰余は1です。"); break; case 2 : puts("その数を3で割った剰余は2です。"); break; } return 0; }
C
// strcopy1.c - copy using an array iterator. // compile with: gcc -o strcopy1 strcopy1.c #include <stdio.h> #include <stdlib.h> #include <string.h> #define BUF_SZ 200 int main(void) { char* str = "Be like a headland of rock on \ which the waves break incessantly but it \ stands fast and around it the seething \ of the waters sinks to rest."; char buffer[BUF_SZ] = ""; int i; // copy str to buffer, then print buffer for (i=0; i<strlen(str); i++) { buffer[i] = str[i]; } printf("%s\n", buffer); return EXIT_SUCCESS; }
C
#include <stdio.h> #include <stdlib.h> #include <string.h> typedef struct Archivo{ char nombre[128]; char tipo; char usuario[50]; int permiso; char ruta[1024]; }ARCHIVO; typedef struct nodo* NODO; typedef struct nodo* LISTA; struct nodo { char elemento; NODO sig; }; ARCHIVO arc1; NODO agregar_elemento (LISTA lista, char elemento); NODO crear_nodo(char elemento); void mostrar_lista (LISTA lista); NODO eliminar_elemento (LISTA lista, char elem); int main() { LISTA lista; strcpy(arc1.nombre,"Miguel"); arc1.tipo='R'; strcpy(arc1.usuario,"marh"); arc1.permiso=644; strcpy(arc1.ruta,"/home/miguel/"); printf("%s\n",arc1.nombre ); char letra = 'a'; int i=0; for (i = 0; i < 20; i++) { printf("Entra\n" ); lista = agregar_elemento (lista, letra + i); } mostrar_lista (lista); printf("================\n"); for (i = 0; i < 5; i++) { eliminar_elemento (lista, letra + i); } agregar_elemento (lista, 'z'); eliminar_elemento (lista, 'n'); mostrar_lista (lista); return 0; } NODO agregar_elemento (LISTA lista, char nuevo) { NODO tmp = lista; printf("Entra agregar_elemento\n" ); if (lista == NULL) { return crear_nodo (nuevo); } else { for (; lista != NULL; lista = lista->sig) { if (lista->sig == NULL) { lista->sig = crear_nodo (nuevo); break; } } lista = tmp; return lista; } } NODO crear_nodo (char elem) { NODO tmp; printf("Entra crear_nodo\n" ); tmp = (NODO ) malloc (sizeof(struct nodo)); tmp->elemento = elem; tmp->sig = NULL; return tmp; } void mostrar_lista (LISTA lista) { for (; lista != NULL; lista = lista->sig) { printf("%c\n", lista->elemento); } } /* Hay 3 casos: -> cuando el nodo es el inicial -> el nodo esta en medio -> el nodo es el último. Cuando hace free(lista) elimina el nodo, no toda la lista */ NODO eliminar_elemento (LISTA lista, char elem) { NODO respaldo = lista; NODO anterior = NULL, siguiente = NULL; for (; lista != NULL; lista = lista->sig) { siguiente = lista->sig; // Actualiza siguiente if (elem == lista->elemento) { // Si es el nodo, lo elimina y ajusta free (lista); if (anterior == NULL) { //Inicial lista = siguiente; return siguiente; } else if (siguiente == NULL) { // En medio anterior->sig = NULL; return respaldo; } else { //Al final anterior->sig = siguiente; return respaldo; } } anterior = lista; // Actualiza el anterior } }
C
/* * button.c * * Created on: Mar 17, 2021 * Author: Jeff */ #include "button.h" genericSensor_t button_init(GPIO_TypeDef *port, uint16_t pin) { button_t _btn = {0}; genericSensor_t gBTN = {0}; gBTN.sensorType = GPIO_BUTTON; gBTN.read = button_read; gBTN.sensor.button = _btn; gBTN.interface.PIN.port = port; gBTN.interface.PIN.pin = pin; //#ifndef HARDWARE_EMULATOR gBTN.state = HAL_OK; //#endif gBTN.hasUpdate = false; gBTN.lock = false; return gBTN; } uint8_t button_read(volatile genericSensor_t* sensor) { bool prevValue = _getBValue(sensor); bool value = prevValue; #ifndef HARDWARE_EMULATOR PIN_t pin = sensor->interface.PIN; value = HAL_GPIO_ReadPin(pin.port, pin.pin); if(_getBINV(sensor)) value = !value; #endif // Handle Change Flag if(value != prevValue) _setBChange(sensor); else _clrBChange(sensor); // Handle Value Flag; if(value) _setBValue(sensor); else _clrBValue(sensor); if((value != prevValue) && value) _doRToggle(sensor); if((value != prevValue) && !value) _doFToggle(sensor); return (uint8_t) value; } ButtonState_t button_GetState(volatile genericSensor_t* sensor) { volatile button_t* btn = &(sensor->sensor.button); switch(btn->status & _BUTTON_STATE_MASK) { case 0b00: return BUTTON_RESET; break; case 0b01: return BUTTON_SET; break; case 0b11: return BUTTON_RISING; break; case 0b10: return BUTTON_FALLING; break; default: return -1; } } void button_Invert(volatile genericSensor_t* sensor) { _getBINV(sensor) ? _clrBINV(sensor) : _setBINV(sensor); } bool button_OnSet(volatile genericSensor_t* sensor) { return _getBValue(sensor); } bool button_OnReset(volatile genericSensor_t* sensor) { return !_getBValue(sensor); } bool button_OnRising(volatile genericSensor_t* sensor) { return _getBValue(sensor) && _getBChange(sensor); } bool button_OnFalling(volatile genericSensor_t* sensor) { return !_getBValue(sensor) && _getBChange(sensor); } bool button_OnRToggle(volatile genericSensor_t* sensor) { return button_OnRising(sensor) && _getRToggle(sensor); } bool button_OnFToggle(volatile genericSensor_t* sensor) { return button_OnFalling(sensor) && _getFToggle(sensor); } // INV bool _getBINV(volatile genericSensor_t* sensor) { return EVAL(sensor->sensor.button.status & _BUTTON_INV_MASK); } void _setBINV(volatile genericSensor_t* sensor) { sensor->sensor.button.status |= _BUTTON_INV_MASK; } void _clrBINV(volatile genericSensor_t* sensor) { sensor->sensor.button.status &= INV(_BUTTON_INV_MASK); } // Button Rising Toggle bool _getRToggle(volatile genericSensor_t* sensor) { return EVAL(sensor->sensor.button.status & _BUTTON_RTOGGLE_MASK); } void _setRToggle(volatile genericSensor_t* sensor) { sensor->sensor.button.status |= _BUTTON_RTOGGLE_MASK; } void _clrRToggle(volatile genericSensor_t* sensor) { sensor->sensor.button.status &= INV(_BUTTON_RTOGGLE_MASK); } void _doRToggle(volatile genericSensor_t* sensor) { (_getRToggle(sensor)) ? (_clrRToggle(sensor)) : (_setRToggle(sensor)); } // Button Falling Toggle bool _getFToggle(volatile genericSensor_t* sensor) { return EVAL(sensor->sensor.button.status & _BUTTON_FTOGGLE_MASK); } void _setFToggle(volatile genericSensor_t* sensor) { sensor->sensor.button.status |= _BUTTON_FTOGGLE_MASK; } void _clrFToggle(volatile genericSensor_t* sensor) { sensor->sensor.button.status &= INV(_BUTTON_FTOGGLE_MASK); } void _doFToggle(volatile genericSensor_t* sensor) { (_getFToggle(sensor)) ? (_clrFToggle(sensor)) : (_setFToggle(sensor)); } // Button Change bool _getBChange(volatile genericSensor_t* sensor) { return EVAL(sensor->sensor.button.status & _BUTTON_CHANGE_MASK); } void _setBChange(volatile genericSensor_t* sensor) { sensor->sensor.button.status |= _BUTTON_CHANGE_MASK; } void _clrBChange(volatile genericSensor_t* sensor) { sensor->sensor.button.status &= INV(_BUTTON_CHANGE_MASK); } // Button Value bool _getBValue(volatile genericSensor_t* sensor) { return EVAL(sensor->sensor.button.status & _BUTTON_VALUE_MASK); } void _setBValue(volatile genericSensor_t* sensor) { sensor->sensor.button.status |= _BUTTON_VALUE_MASK; } void _clrBValue(volatile genericSensor_t* sensor) { sensor->sensor.button.status &= INV(_BUTTON_VALUE_MASK); } uint8_t _getBStatus(volatile genericSensor_t* sensor) { return sensor->sensor.button.status; }
C
#include <stdio.h> int main() { int k, j, p; for (k = 3; k < 100; k++) { p = 0; for (j = 2; j < k; j++) { if ((k % j) == 0) { p = 1; break; } } if (p == 0) { printf("%d\n", k); } } return 0; }
C
#include <stdio.h> #include <stdlib.h> #include <time.h> #include "Output.h" #include "RewriteElement.h" #include "AddElement.h" int main(int argc, char *argv[]) { int answer, N, indx; printf("Enter the size of array: "); scanf_s("%d", &N); int *dynarray = (int*)calloc(N,sizeof(int)); // Allocating memory for array with N number of integer values. // Block of writing randomized values to dynamic array. srand(time(0)); printf("Your array is:\n"); for (indx = 0; indx < N; indx++) { dynarray[indx] = (rand() % 10 + 1); printf("%d\t", dynarray[indx]); } // Block of rewriting elements. answer = 1; while (answer) { printf("\nDo you want to rewrite a value at index? (write 0 or 1)\t"); scanf_s("%d", &answer); if (answer == 0) break; RewriteElement(dynarray); Output(dynarray, N); } printf("As you wish :["); // Block of adding elements. answer = 1; while (answer) { printf("\nDo you want to add an element? (write 0 or 1)\t"); scanf_s("%d", &answer); if (answer == 0) break; Output(AddElement(dynarray, indx, N), ++N); } printf("As you wish :["); realloc(NULL, dynarray); // Using "realloc" function instead of "free" function. printf("\n"); system("pause"); return 0; }
C
/* * This file is part of the FDNPKG project * Copyright (C) Mateusz Viste 2013 * * Simple test program for the FDNPKG url parser. */ #include <stdio.h> #include "parseurl.h" int main(int argc, char **argv) { char host[1024]; char path[1024]; int port; int proto; if (argc != 2) { puts("usage: test-url url"); return(1); } proto = parseurl(argv[1], host, &port, path); printf("Prot: %d\n", proto); printf("Host: '%s'\n", host); printf("Port: %d\n", port); printf("Path: '%s'\n", path); return(0); }
C
#include <stdio.h> #include <sys/types.h> #include <sys/ipc.h> #include <sys/shm.h> #include <string.h> #include <stdlib.h> #include "semafory.h" #include "pamiec.h" #include "unistd.h" #include <sys/mman.h> #define SIZE 41 typedef struct Bufor_Cykliczny { int size; char bufor[SIZE]; } Bufor_Cykliczny; int rozmiar_pliku(FILE *f) //funkcja obslugujaca plik { fseek(f,0,SEEK_END); int size = ftell(f); rewind(f); return size; } // funkcja symulujaca opoznienie czasu void time_delay() { int i,j; for(i=0; i<5000; i++){ for(j=0; j<5000; j++);} } int main() { // utworzenie/dostep do pamieci dzielonej (odczyt/zapis) key_t key = ftok("plik",'A'); int shm_id = shmget(key,SIZE,IPC_CREAT|0666); // utworzenie semafora sem sem_id = sem_create("plik2",'B',1); set_val(sem_id,0,1); Bufor_Cykliczny wpd; // otwarcie plikow do odczytu/zapisu FILE *wejscie = fopen("input.txt","r"); FILE *wyjscie = fopen("output.txt","w"); int i=0;//iterator po rozmiarze pliku int size = rozmiar_pliku(wejscie)+40; //shmat() dołącza segment pamięci dzielonej Systemu V identyfikowany przez shmid do przestrzeni adresowej procesu, który ją wywołał. char *control = (char*)(shmat(shm_id, NULL, 0)); char *start = control; //procesy producenta i konsumenta obsluzone sa w funkcji switch dla argumentu fork() switch(fork()) { case -1: perror("Blad funkcji fork \n"); exit(1); case 0: while(i<size) { fgets(wpd.bufor,40,wejscie); get_down(sem_id,0); strcpy(control,wpd.bufor); //kopiuemy do bufora pamieci cyklicznej get_up(sem_id,0); printf("Pobrano z pliku 40 znakow, zachowano w pamieci dzielonej\n"); sleep(1); control =control+ 40; if(control - start >= SIZE) control = start; i =i+ 40; } fclose(wejscie); shmdt((void*)(start)); //shmdt odłącza segment pamięci dzielonej odwzorowany pod adresem podanym w shmaddr z przestrzeni adresowej procesu wywołującego tę funkcję. Przekazany funkcji w parametrze shmaddr adres musi być równy adresowi zwróconemu wcześniej przez wywołanie shmat(). exit(0); default: time_delay(); while(i<size) { get_down(sem_id,0); //opuszczenie semafora strcpy(wpd.bufor,control); //kopiujemy do bufora get_up(sem_id,0); //podniesienie semafora fputs(wpd.bufor,wyjscie); // z bufora do pliku printf("Odczytano z pamieci dzielonej 40 znakow, pisano do pliku\n"); sleep(1); //usypiamy control =control+ 40; //dodajemy do wskaznika 60 znakow if(control - start >= SIZE) control = start; i =i+ 40; } fclose(wyjscie); shmdt((void*)(start)); exit(0); } return 0; }
C
#include <stdio.h> #include <stdlib.h> #include "Artimatics.h" #include "Test.h" #include "Bitwise.h" #define SQR2(x) (x*x) inline int SQR(int x) { return x*x; } int main() { int Num1,Num2; printf("Enter the two numbers\n"); scanf("%d%d",&Num1,&Num2) ; printf("Result of Sum of %d and %d is %d\n",Num1,Num2,sum(Num1,Num2)); printf("Enter the two numbers\n"); scanf("%d%d",&Num1,&Num2) ; printf("Result of Sub of %d and %d is %d\n",Num1,Num2,sub(Num1,Num2)); printf("Enter the two numbers\n"); scanf("%d%d",&Num1,&Num2) ; printf("Result of Mul of %d and %d is %d\n",Num1,Num2,mul(Num1,Num2)); printf("Enter the two numbers\n"); scanf("%d%d",&Num1,&Num2) ; printf("Result of Div of %d and %d is %d\n",Num1,Num2,Div(Num1,Num2)); printf("Enter the Number to get Factorial\n"); scanf("%d",&Num1) ; printf("Factorial of %d = %d\n",Num1,Factorial(Num1)); printf("Result of SQR with Marco = %d\n",SQR(7+2)) ; printf("Result of SQR with Inline = %d\n",SQR2(7+2)) ; printf("Enter Byte and BitPosition\n"); scanf("%d%d",&Num1,&Num2) ; printf("Set of bit position %d in Byte %d is %d:\n",Num1,Num2,SetBit(Num1,Num2)); printf("Enter Byte and BitPosition\n"); scanf("%d%d",&Num1,&Num2) ; printf("Clear of bit position %d in Byte %d is %d:\n",Num1,Num2,ClearBit(Num1,Num2)); printf("Enter Byte and BitPosition\n"); scanf("%d%d",&Num1,&Num2) ; printf("Toggle of bit position %d in Byte %d is %d:\n",Num1,Num2,ToggleBit(Num1,Num2)); return 0; }
C
/* Author: Abdallah Mahran Ref: https://leetcode.com/problems/maximum-depth-of-binary-tree/description/ Date: 9/16/2017 */ // Includes #include "../common.h" // Types // Functions // solution 1 void dep(TreeNode* node, int *depth, int cd) { if(node == NULL) return; if(cd == *depth) *depth++; dep(node->left, depth, cd+1); dep(node->right, depth, cd+1); } int maxDepth(TreeNode* root) { if(root == NULL) return 0; int depth = 1; dep(root, &depth, 0); return depth; } // solution 2 int maxDepth(TreeNode* root) { if(root == NULL) return 0; if(root->left == NULL) return 1 + maxDepth(root->right); if(root->right == NULL) return 1 + maxDepth(root->left); return max(maxDepth(root->left), maxDepth(root->right)) + 1; }
C
/* * 问题:让逆波兰运算中支持%运算,注意考虑负数的情况 */ #include <stdio.h> #include <stdlib.h> #include <ctype.h> #include <math.h> //主要用于fmod 函数 #include <float.h> #define MAXOP 100 //最大输入 #define MAXVAL 100 //栈最大空间 #define MAXBUF 100 //存放当前字符 #define NUMBER '0' int op = 0, bufp = 0; double val[MAXVAL]; char buf[MAXBUF]; void push(double f); void ungetch(int c); double pop(void); int main(void) { int type; double op2; char s[MAXVAL]; while((type = getop(s)) != EOF){ switch(type){ case NUMBER: push(atof(s)); break; case '+': push(pop() + pop()); break; case '-': op2 = pop(); push(pop() - op2); break; case '*': push(pop() * pop()); break; case '/': op2 = pop(); if(op2 != 0.0) push(pop() / op2); else printf("被除数不能为空!\n"); case '%': op2 = pop(); if(op2 != 0.0) push(fmod(pop(), op2)); //注意,此时这里不能直接用%运算,因为%不能对double类型进行运算,否则编译失败,如果在gcc编译的时候提示未定义fmod函数,请在gcc编译的时候加-lm 参数 else printf("被求余不能为空!\n"); break; case '\n': printf("结果:%.8g\n", pop()); default: break; } } return 0; } //压栈 void push(double f) { if(op < MAXVAL) val[op++] = f; else printf("超出最大值!\n"); } //出栈 double pop(void) { if(op > 0) return val[--op]; else printf("栈空!\n"); } //判断字符类型 int getop(char s[]) { int i, c; //获取第一个非空字符 while((s[0] = c = getch()) == ' ' || c == '\t'); s[1] = '\0'; if(!isdigit(c) && c != '.') return c; //c不是数 //如果是数,获取整个数字 i = 0; if(isdigit(c)) while(isdigit(s[++i] = c = getch())); if(c == '.') while(isdigit(s[++i] = c = getch())); s[i] = '\0'; if(c != EOF) //将这个字符存起来,不然在使用getchar时,就获取不到这个字符了 ungetch(c); return NUMBER; } int getch(void) { return bufp > 0 ? buf[--bufp] : getchar(); } void ungetch(int c) { if(bufp > MAXBUF) printf("超出最大值!\n"); buf[bufp++] = c; }
C
#include <stdio.h> // as of c11 we are including void since we are not returning anything // as argument int main(void) { printf("Hey nerds\n"); return 0; }
C
//Copyright 2011-2017 Tyler Gilbert; All Rights Reserved #include "son_local.h" static int edit_raw_data(son_t * h, const char * key, const void * data, son_size_t size, son_value_t new_data_marker); int son_edit_float(son_t * h, const char * key, float v){ return edit_raw_data(h, key, &v, sizeof(v), SON_FLOAT); } int son_edit_unum(son_t * h, const char * key, u32 v){ return edit_raw_data(h, key, &v, sizeof(v), SON_NUMBER_U32); } int son_edit_num(son_t * h, const char * key, s32 v){ return edit_raw_data(h, key, &v, sizeof(v), SON_NUMBER_S32); } int son_edit_str(son_t * h, const char * key, const char * v){ return edit_raw_data(h, key, v, strlen(v)+1, SON_STRING); } int son_edit_data(son_t * h, const char * key, const void * data, son_size_t size){ return edit_raw_data(h, key, data, size, SON_DATA); } int son_edit_bool(son_t * h, const char * key, int v){ size_t pos; son_store_t store; son_value_t type; int read_length; char buffer[SON_BUFFER_SIZE]; int ret = 0; if( son_local_verify_checksum(h) < 0 ){ return -1; } read_length = son_local_read_raw_data(h, key, buffer, SON_BUFFER_SIZE, &store); if(read_length < 0){ ret = -1; } else { if (v == 0){ type = SON_FALSE; } else { type = SON_TRUE; } son_local_store_set_type(&store, type); pos = son_local_phy_lseek_current(h, -1*(s32)sizeof(store)); son_local_store_set_next(&store, pos+sizeof(son_store_t)); ret = son_local_store_write(h, &store); } son_local_assign_checksum(h); return ret; } int edit_raw_data(son_t * h, const char * key, const void * data, son_size_t size, son_value_t new_data_marker){ son_size_t data_size; son_store_t son; int ret; if( son_local_verify_checksum(h) < 0 ){ return -1; } if( son_local_store_seek(h, key, &son, &data_size) < 0 ){ ret = -1; } else { if( son_local_store_type(&son) != new_data_marker ){ h->err = SON_ERR_EDIT_TYPE_MISMATCH; ret = -1; } else { if( size > data_size ){ size = data_size; } ret = son_phy_write(&(h->phy), data, size); } } son_local_assign_checksum(h); return ret; }
C
// Task2: // Write the swap16, swap32, swap64 functions that swap bytes in // uint16_t, uint32_t, and uint64_t (endianness conversions) #include "ProCamp_Task_2_swap.h" void task2_main_swap() { printf("Task 2: swap \n"); printf("Start \n\n"); uint16_t a16_old = 0xA1B2; uint16_t a16_new = swap16(a16_old); uint32_t a32_old = 0xA1B2C3D4; uint32_t a32_new = swap32(a32_old); uint64_t a64_old = 0xA1B2C3D4E5F60102ULL; uint64_t a64_new = swap64(a64_old); printf("uint16_t a16_old = 0x%04X \n", a16_old); printf("uint16_t a16_new = 0x%04X \n\n", a16_new); printf("uint32_t a32_old = 0x%08X \n", a32_old); printf("uint32_t a32_new = 0x%08X \n\n", a32_new); printf("uint64_t a64_old = 0x%016jX \n", a64_old); printf("uint64_t a64_new = 0x%016jX \n\n", a64_new); printf("Task 2: swap \n"); printf("Stop \n\n"); } uint16_t swap16(uint16_t val) { return ((val << 8) | (val >> 8)); } uint32_t swap32(uint32_t val) { val = ((val << 8) & MASK32H8) | ((val >> 8) & MASK32L8); return (val << 16) | (val >> 16); } uint64_t swap64(uint64_t val) { val = ((val << 8) & MASK64H8) | ((val >> 8) & MASK64L8); val = ((val << 16) & MASK64H16) | ((val >> 16) & MASK64L16); return (val << 32) | (val >> 32); }
C
/** Autor: Gabriel Dias **/ /** * Faa um algoritmo que realize a leitura do saldo de uma conta. Em seguida, o algoritmo * dever apresentar um menu ao usurio com as seguintes opes: * * 1. Exibir saldo; * 2. Realizar saque; * 3. Realizar depsito; * * -> A opo 1 dever apresentar o saldo digitado pelo usurio; * * -> A opo 2 dever simular uma operao de saque da conta. Caso o valor do saque seja * maior ao saldo do cliente, o programa no dever permitir a realizao da operao; * * -> A opo 3 dever simular uma operao de depsito na conta. * **/ // Bibliotecas padro #include <stdio.h> #include <stdlib.h> #include <locale.h> int main(){ // Configura o idioma de acordo com a localizao setlocale(LC_ALL, "portuguese"); // Variveis int opcao; float saldo, deposito, saque, resto, novo_saldo; // Processamento printf("Informe o saldo: "); scanf("%f", &saldo); printf("\nEscolha uma opo: \n"); printf("\n1 - Exibir saldo\n"); printf("2 - Realizar saque\n"); printf("3 - Realizar depsito\n"); scanf("%d", &opcao); switch(opcao){ case 1: printf("O saldo informado de %.2f: \n", saldo); break; case 2: printf("Informe o valor que deseja sacar: "); scanf("%f", &saque); if(saque > saldo){ printf("No possvel realizar essa operao! Seu saldo insuficiente.\n"); }else{ resto = saldo - saque; printf("Seu saldo atual : %.2f\n", resto); } break; case 3: printf("Informe o valor que deseja depositar: "); scanf("%f", &deposito); novo_saldo = saldo + deposito; printf("Seu saldo atual : %.2f\n", novo_saldo); break; } system("pause"); }
C
#ifndef UNIFORMS_H #define UNIFORMS_H #include "math/mat4.h" #include <vulkan/vulkan.h> #include "graphics/texture.h" #include <stdint.h> #define CS_WHOLE_SIZE -1 typedef struct { mat4 model; mat4 view; mat4 proj; } TransformType; typedef struct DescriptorPool DescriptorPool; // A struct containing an entire descriptor set and data of where it is from // Contains descriptor sets for all possible frames in flight typedef struct { // The index of the pool uint32_t pool_index; // The sum of uniform_count and sampler_count describes the 'size' of the pool it takes // Represents how many uniform types is allocated uint32_t uniform_count; // Represents how many sampler types is allocated uint32_t sampler_count; // How many descriptor set it holds uint32_t count; VkDescriptorSet sets[3]; } DescriptorPack; typedef struct UniformBuffer UniformBuffer; // Creates a descriptor set layout from the specified bindings // Used when creating descriptors and during pipeline creation int descriptorlayout_create(VkDescriptorSetLayoutBinding* bindings, uint32_t binding_count, VkDescriptorSetLayout* dst_layout); // Creates multiple descriptors, one for each frame in flight (swapchain_image_count) // Writes the buffers and samplers to each frame's descriptor as specified in bindings // The number of uniformbuffers should match the bindings // The number of textures should match the bindings // dst_descriptors should be an array of swapchain_image_count length. Arrays data will be overwritten int descriptorpack_create(VkDescriptorSetLayout layout, VkDescriptorSetLayoutBinding* bindings, uint32_t binding_count, UniformBuffer** uniformbuffers, Texture** textures, DescriptorPack* dst_pack); // Destroys a descriptor pack, and if necessary, destroy the pool void descriptorpack_destroy(DescriptorPack* pack); // Creates and allocates memory for a uniform buffer // Internally holds one buffer per frame in flight to avoid simultaneous read and writes // Uniform buffer is completely agnostic to the shader layout and binding // To bind a uniform buffer you need to create a descriptor layout and set UniformBuffer* ub_create(uint32_t size, uint32_t binding); // Maps the uniform buffer data for specified frame and returns a pointer to it // Note: you can not map the same frame simulataneously void* ub_map(UniformBuffer* ub, uint32_t offset, uint32_t size, uint32_t frame); // Unmaps a uniform buffer void ub_unmap(UniformBuffer* ub, uint32_t frame); // Updates a uniform buffer // Maps memory from the GPU to the CPU // If size is -1 or CS_WHOLE_SIZE, the rest of the buffer will be written after offset // Writes size amount of bytes from data after offset // The frame specifies which of the internal buffers to map // If frame is -1, the current frame to render will be used (result of renderer_get_frame) // NOTE: offset + size should be less than or equal to size of the uniform buffer void ub_update(UniformBuffer* ub, void* data, uint32_t offset, uint32_t size, uint32_t frame); void ub_destroy(UniformBuffer* ub); // Destroys all UniformBuffer pools in the end of the programs // The pools were first created implicitly when a UniformBuffer was created void ub_pools_destroy(); #endif
C
/****************************************************************************** * LibGHT, software to manage point clouds. * LibGHT is free and open source software provided by the Government of Canada * Copyright (c) 2012 Natural Resources Canada * * Nouri Sabo <nsabo@NRCan.gc.ca>, Natural Resources Canada * Paul Ramsey <pramsey@opengeo.org>, OpenGeo * ******************************************************************************/ #include "ght_internal.h" #include "ght_mem.h" struct GhtContext_t { GhtAllocator alloc; GhtReallocator realloc; GhtDeallocator free; GhtMessageHandler err; GhtMessageHandler warn; GhtMessageHandler info; }; static struct GhtContext_t ght_context; static void * default_allocator(size_t size) { return malloc(size); } static void default_freeor(void *mem) { free(mem); } static char * default_strdup(const char *str) { return strdup(str); } static void * default_reallocator(void *mem, size_t size) { return realloc(mem, size); } static void default_msg_handler(const char *label, const char *fmt, va_list ap) { char newfmt[1024]; memset(newfmt, 0, 1024); snprintf(newfmt, 1024, "%s%s\n", label, fmt); newfmt[1023] = '\0'; vfprintf(stderr, newfmt, ap); } static void default_info_handler(const char *fmt, va_list ap) { default_msg_handler("INFO: ", fmt, ap); } static void default_warn_handler(const char *fmt, va_list ap) { default_msg_handler("WARNING: ", fmt, ap); } static void default_error_handler(const char *fmt, va_list ap) { default_msg_handler("ERROR: ", fmt, ap); va_end(ap); exit(1); } void ght_init(void) { ght_context.alloc = default_allocator; ght_context.realloc = default_reallocator; ght_context.free = default_freeor; ght_context.err = default_error_handler; ght_context.warn = default_warn_handler; ght_context.info = default_info_handler; xmlGcMemSetup( (xmlFreeFunc) ght_free, (xmlMallocFunc) ght_malloc, (xmlMallocFunc) ght_malloc, (xmlReallocFunc) ght_realloc, (xmlStrdupFunc) ght_strdup ); } void ght_set_handlers(GhtAllocator allocator, GhtReallocator reallocator, GhtDeallocator deallocator, GhtMessageHandler error_handler, GhtMessageHandler info_handler, GhtMessageHandler warn_handler) { ght_context.alloc = allocator; ght_context.realloc = reallocator; ght_context.free = deallocator; ght_context.err = error_handler; ght_context.warn = warn_handler; ght_context.info = info_handler; xmlGcMemSetup( (xmlFreeFunc) ght_free, (xmlMallocFunc) ght_malloc, (xmlMallocFunc) ght_malloc, (xmlReallocFunc) ght_realloc, (xmlStrdupFunc) ght_strdup ); } void ght_set_allocator(GhtAllocator allocator) { ght_context.alloc = allocator; } void ght_set_deallocator(GhtDeallocator deallocator) { ght_context.free = deallocator; } void * ght_malloc(size_t size) { void *mem = ght_context.alloc(size); if ( ! mem ) { ght_error("%s: unable to allocate %zu bytes", __func__, size); return NULL; } memset(mem, 0, size); /* Always clean memory */ return mem; } char * ght_strdup(const char *str) { size_t len = strlen(str) + 1; char *newstr = ght_malloc(len); if ( ! newstr ) { ght_error("%s: memory allocation failed", __func__); return NULL; } memcpy(newstr, str, len); return newstr; } void * ght_realloc(void * mem, size_t size) { void *newmem = ght_context.realloc(mem, size); if ( ! newmem ) { ght_error("%s: unable to reallocate %zu bytes", __func__, size); return NULL; } return newmem; } void ght_free(void * mem) { ght_context.free(mem); } void ght_error(const char *fmt, ...) { va_list ap; va_start(ap, fmt); (*ght_context.err)(fmt, ap); va_end(ap); } void ght_info(const char *fmt, ...) { va_list ap; va_start(ap, fmt); (*ght_context.info)(fmt, ap); va_end(ap); } void ght_warn(const char *fmt, ...) { va_list ap; va_start(ap, fmt); (*ght_context.warn)(fmt, ap); va_end(ap); }
C
/* SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note */ /* Copyright (c) 2020 * * This program is free software; you can redistribute it and/or * modify it under the terms of version 2 of the GNU General Public * License as published by the Free Software Foundation. */ #ifndef _PROCESS_H_ #define _PROCESS_H_ // TTY_NAME_LEN is the maximum length of the TTY name #define TTY_NAME_LEN 16 // process_ctx_t Contains all the process context collected for a file system event struct process_ctx_t { // Process data u64 timestamp; u32 pid; u32 tid; u32 uid; u32 gid; char tty_name[TTY_NAME_LEN]; char comm[TASK_COMM_LEN]; }; // fill_process_data fills the provided process_ctx_t with the process context available from eBPF __attribute__((always_inline)) static u64 fill_process_data(struct process_ctx_t *data) { // Process data struct task_struct *task = (struct task_struct *)bpf_get_current_task(); // TTY struct signal_struct *signal; bpf_probe_read(&signal, sizeof(signal), &task->signal); struct tty_struct *tty; bpf_probe_read(&tty, sizeof(tty), &signal->tty); bpf_probe_read_str(data->tty_name, TTY_NAME_LEN, tty->name); // Comm bpf_get_current_comm(&data->comm, sizeof(data->comm)); // Pid & Tid u64 id = bpf_get_current_pid_tgid(); data->pid = id >> 32; data->tid = id; // UID & GID u64 userid = bpf_get_current_uid_gid(); data->uid = userid >> 32; data->gid = userid; return id; } #endif
C
/*File name: message.c *Type: C source file *Date: 2017/04/24 */ #include <unistd.h> #include <stdlib.h> #include <stdio.h> #include <errno.h> #include <sys/msg.h> #include <string.h> #include "msgdata.h" void msgreceive(int msginfo_fd) { int msgid = -1; struct message_info_struct msginfo; long int msgtype = 0; //Creat the message list msgid = msgget((key_t)msginfo_fd, 0666|IPC_CREAT); if(msgid == -1) { perror("msgget failed"); printf("PID:%d, Failed to creat the message queue\n", getpid()); exit(EXIT_FAILURE); } else printf("PID:%d, Success to Creat the message queue\n", getpid()); while(1) { if(msgrcv(msgid, (void*)&msginfo, MSG_SZ, msgtype, 0) == -1) { perror("msgrcv failed"); printf("PID:%d, Failed to receive the message from %d\n", getpid(), msgid); exit(EXIT_FAILURE); } else printf("PID:%d, Received the message from %d:%s\n", getpid(),msgid, msginfo.text); sleep(1); } if(msgctl(msgid, IPC_RMID, 0) == -1) { printf("PID:%d, Failed to delete the message queue %d\n", getpid(), msgid); exit(EXIT_FAILURE); } else printf("PID:%d, Success to delete the message queue %d\n", getpid(),msgid); } void msgsend(int msginfo_fd) { int msgid = -1; struct message_info_struct msginfo; msginfo.msg_type = 1; static char Data_WR[MSG_SZ] = {"This is test for message queue"}; //Creat the message list msgid = msgget((key_t)msginfo_fd, 0666|IPC_CREAT); if(msgid == -1) { perror("msgget failed"); printf("PID:%d, Failed to creat the message queue\n", getpid()); exit(EXIT_FAILURE); } else printf("PID:%d, Success to Creat the message queue\n", getpid()); while(1) { printf("PID:%d, Send the date:\n", getpid()); strncpy(msginfo.text, Data_WR, MSG_SZ); printf("PID:%d, Send the data into msginfo.text:%s\n", getpid(), msginfo.text); if(msgsnd(msgid, (void*)&msginfo, MSG_SZ, 0) == -1) { perror("msgsnd failed"); printf("PID:%d, Failed to send the message to %d\n", getpid(), msgid); exit(EXIT_FAILURE); } else printf("PID:%d, Success to send the message to %d:%s\n", getpid(),msgid, msginfo.text); sleep(1); } if(msgctl(msgid, IPC_RMID, 0) == -1) { printf("PID:%d, Failed to delete the message queue %d\n", getpid(), msgid); exit(EXIT_FAILURE); } else printf("PID:%d, Success to delete the message queue %d\n", getpid(),msgid); }
C
#include <stdio.h> #include <string.h> #include <stdlib.h> #include <stdbool.h> #include <curl/curl.h> #include "get_url.c" #define maxitem 100 //max item digits #define MAX_TITLE 1000 #define MAX_LINK 10000 #define MAX_DATE 100 #define MAX_DES 100000 #define MAX_CAT 1000 #define MAXN_CAT 20 #define maxchar 1000000 typedef struct NewsStruct News; struct NewsStruct { char title[MAX_TITLE]; char link[MAX_LINK]; char pubDate[MAX_DATE]; char description[MAX_DES]; char category[MAXN_CAT][MAX_CAT]; int catNum; }; void News_to_Trie(News* object, int request); void JsonFormatPoster(News* object); void postNews(char jsonstr[]); void write_category(News* object, int catName); //*************************************** bool cmp(char* str1, char* str2, int a) //str1 from a to b ?= str2 { int i; int len = strlen(str2); for (i = 0; i < len; i++) if (str1[i + a] != str2[i]) return false; return true; } void copy(char* str1, char* str2, int a, int b) //copy str1 from str1[a] to str1[b] to str2 { int i; for (i = a; i < b; i++) { if(str1[i] == '\n' || str1[i] == '\t') str2[i - a] = ' '; else str2[i - a] = str1[i]; } str2[i] = '\0'; } FILE* get_item(FILE * item, int request) { News* news; news = (News*)calloc(1, sizeof(News)); int step = 1; char str[maxchar] = {'\0'}; char tempstr[maxchar] = {'\0'}; news -> catNum = 0; while(step < 5) { fgets(str, maxchar, item); //strcpy(tempstr, "\0"); char tempstr[maxchar] = {'\0'}; int i, len = strlen(str); for(i = 0; i < len; i++) { if (str[i] == '<') { if (step == 1 && cmp(str, "title", i + 1)) { int j = i + 1; while (str[j] != '<') j++; copy(str, news -> title, i + 7, j); //printf("title : %s\n", news -> title); step++; break; } else if (step == 2 && cmp(str, "link", i + 1)) { int j = i + 6; if(str[j] == '\0' || str[j + 1] == '\0') { fgets(tempstr, maxchar, item); for(i = 0; i < strlen(tempstr); i++) { if(tempstr[i] == 'h') { break; } } copy(tempstr, news -> link, i, strlen(tempstr)); } else { while (str[j] != '<' && str[j] != '\0') j++; copy(str, news -> link, i + 6, j); } step++; //printf("link : %s\n", news -> link); break; } else if (step == 3 && cmp(str, "pubDate", i + 1)) { int j = i + 1; while (str[j] != '<') j++; copy(str, news -> pubDate, i + 9, j); //printf("pubDate : %s\n", news -> pubDate); step++; break; } else if (step == 4 && cmp(str, "category>", i + 1)) { int j = i + 10; if(str[j] == '\0' || str[j + 1] == '\0' || str[j + 2] == '\0') { fgets(tempstr, maxchar, item); for(i = 0; i < strlen(tempstr); i++) { if(tempstr[i] == 'T') { break; } } copy(tempstr, news -> category[news -> catNum], i + 4, strlen(tempstr) - 5); } else { while (str[j] != ']') j++; copy(str, news -> category[news -> catNum], i + 19, j); } //printf("category : %s\n", news -> category[news -> catNum]); news -> catNum++; break; } else if (step == 4 && cmp(str, "description>", i + 1)) { int j = i + 13; if(str[j] == '\0' || str[j + 1] == '\0' || str[j + 2] == '\0') { fgets(tempstr, maxchar, item); fgets(tempstr, maxchar, item); i = 0; while ((tempstr[i] < 'a' || tempstr[i] > 'z') && (tempstr[i] < 'A' || tempstr[i] > 'Z') && (tempstr[i] < '0' || tempstr[i] > '9')) i++; copy(tempstr, news -> description, i, strlen(tempstr)); if(news -> description[strlen(news -> description) - 1] == '\n') news -> description[strlen(news -> description) - 1] = '\0'; } else { while (str[j] != ']') j++; //MODIFY DESCRIPTION int k; //counter -> 0 to len int c = 0; //counter : news -> description length bool inTag = false; int len = strlen(str); for (k = 24; k < len - 2; k++) { if (str[k] == '<') { inTag = true; continue; } if (str[k] == '>') { inTag = false; continue; } if (!inTag && str[k] != ']') { news -> description[c] = str[k]; c++; } } news -> description[c] = '\0'; } //printf("description : %s\n", news -> description); step++; break; } } } } if(request == 1) { //struct to JSON format JsonFormatPoster(news); } else if(request == 2 || request == 3 || request == 4) { //if(request == 3) //printf("request sent!\n"); News_to_Trie(news, request); } // else if(request == 4) // { // f(news); // } free(news); return item; } void RSS_Processor(char fileName[], int request) { //printf("RSS_Processor\n"); FILE * rss; rss = fopen(fileName, "r"); char str[maxchar]; printf("FILE NAME %s\n", fileName); while (fgets(str, maxchar, rss) != NULL) { int i, len = strlen(str); for (i = 0; i < len; i++) { if (str[i] == '<') if (cmp(str, "item", i + 1)) { rss = get_item(rss, request); break; } } } fclose(rss); } void postNews(char jsonstr[]) { curl_global_init( CURL_GLOBAL_ALL ); CURL *myHandle; CURLcode result; myHandle = curl_easy_init ( ) ; struct curl_slist *headers = NULL; //headers headers = curl_slist_append(headers, "X-Requested-With: XMLHttpRequest"); headers = curl_slist_append(headers, "Content-Type: application/json"); headers = curl_slist_append(headers, "charsets: utf-8"); //posting curl_easy_setopt(myHandle, CURLOPT_HTTPHEADER, headers); curl_easy_setopt(myHandle, CURLOPT_URL, "http://team46:pkz1376hmd1377@www.fop-project.ir/news"); curl_easy_setopt(myHandle, CURLOPT_POSTFIELDS, jsonstr); result = curl_easy_perform( myHandle ); printf("sent\n"); curl_easy_cleanup( myHandle ); } void JsonFormatPoster(News* object) { char jsonstr[maxchar]; int i = 0; strcpy(jsonstr, "{"); strcat(jsonstr, "\"title\":\""); strcat(jsonstr, object -> title); strcat(jsonstr, "\","); strcat(jsonstr, "\"date\":\""); strcat(jsonstr, object -> pubDate); strcat(jsonstr, "\","); strcat(jsonstr, "\"description\":\""); strcat(jsonstr, object -> description); strcat(jsonstr, "\","); strcat(jsonstr, "\"categorized\":"); strcat(jsonstr, "false,"); strcat(jsonstr, "\"categories\":["); for(i = 0; i < object -> catNum; i++) { strcat(jsonstr, "\""); strcat(jsonstr, object -> category[i]); strcat(jsonstr,"\""); if(i < (object -> catNum - 1) ) strcat(jsonstr, ", "); } strcat(jsonstr, "]"); strcat(jsonstr, "}"); printf("%s\n", jsonstr); // int c = 1, d = 1; // for ( c = 1 ; c <= 32767 ; c++ ) // for ( d = 1 ; d <= 32767 ; d++ ) // {} // curl_global_init( CURL_GLOBAL_ALL ); // printf("sent299\n"); // CURL *myHandle; // printf("sent301\n"); // CURLcode result; // printf("sent303\n"); // myHandle = curl_easy_init ( ) ; // printf("sent305\n"); // struct curl_slist *headers = NULL; // printf("sent307\n"); // //headers // headers = curl_slist_append(headers, "X-Requested-With: XMLHttpRequest"); // printf("sent310\n"); // headers = curl_slist_append(headers, "Content-Type: application/json"); // printf("sent312\n"); // headers = curl_slist_append(headers, "charsets: utf-8"); // printf("sent314\n"); // //posting // curl_easy_setopt(myHandle, CURLOPT_HTTPHEADER, headers); // printf("sent317\n"); // curl_easy_setopt(myHandle, CURLOPT_URL, "http://team46:pkz1376hmd1377@www.fop-project.ir/news"); // printf("sent319\n"); // curl_easy_setopt(myHandle, CURLOPT_POSTFIELDS, jsonstr); // printf("sent321\n"); // result = curl_easy_perform( myHandle ); // printf("sent324\n"); // curl_easy_cleanup( myHandle ); // printf("sent326\n"); //postNews(jsonstr); } void write_category(News* object, int cat) { strcpy(object -> category[0], "\0"); if(cat == 1) strcpy(object -> category[0], "sport"); if(cat == 2) strcpy(object -> category[0], "business"); if(cat == 3) strcpy(object -> category[0], "entertainment"); if(cat == 4) strcpy(object -> category[0], "us"); if(cat == 5) strcpy(object -> category[0], "world"); if(cat == 6) strcpy(object -> category[0], "health"); if(cat == 7) strcpy(object -> category[0], "sci_tech"); object -> catNum = 1; JsonFormatPoster(object); }
C
#include <stdio.h> #include <string.h> int main() { int test; scanf("%d", &test); while (test--) { int input[85][2] = { 0, }, check[85] = { 0, }, result[85] = { 0, }; char a[85] = { 0, }, b[85] = { 0, }; scanf("%s %s", &a, &b); for (int i = 0; i < strlen(a); i++) { input[i][0] = a[(strlen(a) - 1) - i] - '0'; } for (int i = 0; i < strlen(b); i++) { input[i][1] = b[(strlen(b) - 1) - i] - '0'; } int len = strlen(a) > strlen(b) ? strlen(a) : strlen(b); for (int i = 0; i <= len; i++) { int sum = input[i][0] + input[i][1] + check[i]; if (sum == 0) result[i] = 0; else if (sum == 1) result[i] = 1; else if (sum == 2) result[i] = 0, check[i + 1] = 1; else if (sum == 3) result[i] = 1, check[i + 1] = 1; } int cnt = 0; for (int i = len; i >= 0; i--) { if (result[i] == 0) cnt++; else break; } if (cnt - 1 == len) { printf("0\n"); } else { for (int i = len - cnt; i >= 0; i--) { printf("%d", result[i]); } printf("\n"); } } }
C
#include <stdio.h> int main(void) { // pointers to a character array to define simple strings char * name = "John Smith"; /** * This method creates a string which we can only use for reading. * If we wish to define a string which can be manipulated, we will * need to define it as a local character array */ char name[] = "John Smith"; /** * This notation is different because it allocates an array variable * so we can manipulate it. The empty brackets notation [] tells the * compiler to calculate the size of the array automatically. This is * in fact the same as allocating it explicitly, adding one to the * length of the string: */ char name[] = "John Smith"; /* is the same as */ char name[11] = "John Smith"; // string formatting char * name = "John Smith"; int age = 27; /* prints out 'John Smith is 27 years old.' */ printf("%s is %d years old.\n", name, age); // function to return string length strlen(stringName); // string concatenation char dest[20]="Hello"; char src[20]="World"; strncat(dest,src,3); printf("%s\n",dest); strncat(dest,src,20); printf("%s\n",dest); }
C
#include<stdio.h> void main() { int arr[100],n, ch, pos=-1, i; printf("Enter the size of array: "); scanf("%d", &n); printf("Enter the elements of the array\n"); for(i=0; i<n; i++) { printf("\nNum %d:", i+1); scanf("%d", &arr[i]); } printf("Enter the element you want to find: "); scanf("%d", &ch); for(i=0; i<n; i++) { if (arr[i]==ch) {pos=i; break;} } if(pos==-1) printf("Element not found\n"); else printf("Element found at index %d\n", i); }
C
#include<stdio.h> #include<stdlib.h> #include<string.h> int main() { char line[10], *ptr; int len, i, result=1, total=0; while(scanf("%s", line)!=EOF){ len=strlen(line); ptr=line; while(*ptr!='\0'){ result=1; for(i=0; i<len-1; i++){ result*=26; } total+=(*ptr-64)*result; ptr++; len--; result=0; } printf("%d\n", total); total=result=0; } return 0; }
C
#include "drivers/mouse/mouse.h" #include <stdint.h> #include "drivers/gpio/gpio.h" #include "lib/printk.h" int32_t usleep(uint32_t usecs) { int i; for (i = 0; i < usecs*8e3; i++); } static const int gpio_clock = 23; static const int gpio_data = 24; static int mouse_x = 0, mouse_y = 0; // TODO Syscalls and init code all works. // Interrupts are not firing though.. int mouse_init(void) { int status; // Request the clock and data pins. status = gpio_request(gpio_clock, "mouse_clock"); if (status < 0) return -1; status = gpio_request(gpio_data, "mouse_data"); if (status < 0) return -1; // Those are inputs. gpio_direction_input(gpio_clock); gpio_direction_input(gpio_data); // Get the IRQ number for the clock, // since that's what we'll be watching. int irq = gpio_to_irq(gpio_clock); if (irq < 0) return -1; // Watch the falling edge and enable. gpio_set_falling(gpio_clock); irq_enable(irq); // TODO Send the "Enable Data Reporting" command. // See the README for details on this whole process. // TODO Init code. gpio_set_value(gpio_clock, 0); usleep(100); gpio_set_value(gpio_data, 0); gpio_set_value(gpio_clock, 1); printk("mouse_init successful.\n"); return 0; } void mouse_cleanup(void) { // Release the GPIO pins. gpio_free(gpio_data); gpio_free(gpio_clock); } static void mouse_update(unsigned char bytes[4]) { // Refer to the table in the README. // Mouse movement delta signs. const int sy = (bytes[0] >> 7) & 1 ? -1 : 1, sx = (bytes[0] >> 6) & 1 ? -1 : 1; // Deltas. const int dx = bytes[1] * sy, dy = bytes[2] * sx; mouse_x += dx; mouse_y += dy; // Print the mouse coordinates. //printk("x: %03d, y: %03d\n", mouse_x, mouse_y); } int mouse_interrupt_handler(void) { static int byte_counter = 0, bit_counter = 0, parity = 0; static unsigned char bytes[4] = { 0, 0, 0, 0 }; int bit; printk("Oh my god an interrupt\n"); return 0; bit = gpio_get_value(gpio_data); switch (bit_counter) { case 0: // Start bit. if (bit != 0) { printk("Invalid start bit %x.\n", bit); goto mouse_interrupt_handler_failure; } break; case 9: // Parity bit. parity += bit; if (parity & 1 == 0) { // It's even (should be odd!). printk("Invalid parity %x.\n", parity); goto mouse_interrupt_handler_failure; } parity = 0; break; case 10: // Stop bit. if (bit != 1) { printk("Invalid stop bit %x.\n", bit); goto mouse_interrupt_handler_failure; } byte_counter = (byte_counter + 1) % 3; // TODO Set to 4 if scroll wheel. if (byte_counter == 0) { // We just finished reading the final byte. mouse_update(bytes); } break; default: // Data bits. // Put the bit into the byte and add to parity. bytes[byte_counter] |= bit << (bit_counter-1); parity += bit; break; } // Increment bit_counter. bit_counter = (bit_counter + 1) % 11; return 0; mouse_interrupt_handler_failure: bit_counter = 0; parity = 0; byte_counter = 0; bytes[0] = 0; bytes[1] = 0; bytes[2] = 0; bytes[3] = 0; return -1; } int mouse_get(int *x, int *y) { *x = mouse_x; *y = mouse_y; }
C
/* copyright xu(xusiwei1236@163.com), all right reserved. Valid Anagram ============== Given two strings s and t, write a function to determine if t is an anagram of s. For example, s = "anagram", t = "nagaram", return true. s = "rat", t = "car", return false. Note: You may assume the string contains only lowercase alphabets. Follow up: What if the inputs contain unicode characters? How would you adapt your solution to such case? */ #include <stdio.h> #include <string.h> #include <stdbool.h> bool isAnagram(const char* s, const char* t) { char cs[256] = {0}, ct[256] = {0}; while (*s) cs[*s++]++; while (*t) ct[*t++]++; return !memcmp(cs, ct, sizeof(cs)); } int main(int argc, char* argv[]) { const char* s = "anagram"; const char* t = "nagaram"; if (argc > 2) { s = argv[1]; t = argv[2]; } printf("isAnagram(%s, %s): %s\n", s, t, isAnagram(s, t) ? "true" : "false"); return 0; }
C
#include <stdlib.h> #include "basic_operation.h" #include "utils.h" bool * add(bool * a, bool * b, int length, bool carry_in) { // use one additional bit to store the most significant bit // useful in some cases bool * sum = (bool *)malloc(sizeof(bool) * (length + 1)); bool carry_out; for (int i = 0; i < length; ++i) { full_adder(a[i], b[i], carry_in, sum + i, &carry_out); carry_in = carry_out; } sum[length] = carry_out; return sum; } bool * sub(bool * a, bool * b, int length) { bool * b_inverse = (bool *)malloc(sizeof(bool) * length); for (int i = 0; i < length; ++i) b_inverse[i] = !b[i]; bool * diff = add(a, b_inverse, length, true); return diff; } bool * mul(bool * a, bool * b, int length) { // initialization int product_length = length * 2; bool * product = (bool *)malloc(sizeof(bool) * product_length); bool * temp = (bool *)malloc(sizeof(bool) * product_length); for (int i = 0; i < product_length; ++i) { product[i] = false; temp[i] = false; } // perform add and left shift for (int i = 0; i < length; ++i) { for (int j = 0; j < length; ++j) { temp[j] = a[j] & b[i]; temp[length + j] = false; } left_shift(temp, i, product_length); product = add(product, temp, product_length, false); } return product; } bool * divide(bool * a, bool * b, int length) { // initialize int double_length = 2 * length; bool * quotient = (bool *)malloc(sizeof(bool) * double_length); bool * remainer = (bool *)malloc(sizeof(bool) * double_length); for (int i = 0; i < double_length; ++i) { quotient[i] = false; remainer[i] = false; } bool * extended_b = (bool *)malloc(sizeof(bool) * double_length); for (int i = 0; i < length; ++i) { extended_b[i] = b[i]; extended_b[length + i] = false; } // compute bool * temp = NULL; // compute the integer part of the quotient for (int shift = length - 1; shift >= 0; --shift) { left_shift(remainer, 1, double_length); remainer[0] = a[shift]; temp = sub(remainer, extended_b, double_length); // remainer >= b if (temp[double_length - 1] == false) { for (int i = 0; i < double_length; ++i) remainer[i] = temp[i]; quotient[length + shift] = true; } } // compute the decimal part of the quotient for (int shift = length - 1; shift >= 0; --shift) { left_shift(remainer, 1, double_length); temp = sub(remainer, extended_b, double_length); // remainer >= b if (temp[double_length - 1] == false) { for (int i = 0; i < double_length; ++i) remainer[i] = temp[i]; quotient[shift] = true; } } return quotient; }
C
#include <stdio.h> #include <unistd.h> #include <sys/types.h> #include <sys/wait.h> #include <sys/stat.h> #include <string.h> #include <stdlib.h> #include <fcntl.h> /* Function which checks for the < symbol Takes a list of arguements and size of list as paramaters Returns the location of the special character or -1 if not found*/ int redirectStdout(char** arg_list, int size){ for(int i = 0; i < size; i++){ if(arg_list[i][0] == '<') return i; } return -1; } /* Function which checks for the > symbol T akes a list of arguements and size of list as paramaters Returns the location of the special character or -1 if not found*/ int redirectStdin(char** arg_list, int size){ for(int i = 0; i < size; i++){ if(arg_list[i][0] == '>') return i; } return -1; } /* Function which checks for the | symbol Takes a list of arguements and size of list as paramaters Returns the location of the special character or -1 if not found*/ int pipeChecker(char** arg_list, int size){ for(int i = 0; i < size; i++){ if(arg_list[i][0] == '|') return i; } return -1; } int parseReverseArray(char *buffer, char **arg_list){ //strip the newline from the end of the buffer strtok(buffer, "\n"); /*-----------Parsing section---------------*/ /* This section is responsible for parsing the commands into an array and reversing the order of the arguements*/ char *commands[50]; char* token = strtok(buffer, " "); int arg_list_size = 0; while (token != NULL){ commands[arg_list_size] = token; arg_list_size++; token = strtok(NULL, " "); } arg_list[arg_list_size] = NULL; int count = 0; for(int i = arg_list_size-1; i>=0; i--){ arg_list[count] = commands[i]; count++; } return arg_list_size; /*-----------Parsing section---------------*/ } //Work in progress functions // void execFg(char **arg_list) { // // } // // void execBg(char **arg_list) { // // } int main(){ const int BUFFER_SIZE = 1000; char buffer[BUFFER_SIZE]; //buffer array pid_t bg_process = 0; //pid of the background process. 0 if doesnt exist //inital prompt message printf("Welcome to the Funny Shell created by Seth Tummillo. Type 'exit' to exit.\n" ); do{ // make sure the buffer is zeroed out bzero(buffer, BUFFER_SIZE); //clean up any running backgroun processes pid_t temp; while((temp = waitpid(-1, NULL, WNOHANG)) > 0) { printf("Done pid: %d\n", temp); bg_process = 0; } //initial prompt and input from user printf("tummillo> "); fgets(buffer, 150, stdin); //if loop which will run if user enters something other than exit if((strcmp(buffer, "exit\n")) != 0 && buffer[0] != '\n'){ char* arg_list[50]; int arg_list_size = parseReverseArray(buffer, arg_list); int spChPos = 0; //varible to store the location of the special character if one is encountered /* This series of if statements will look through the array of arguements and determine if any special operators exist within the array. These operations include redirection of stdout '<' and stdin '>', the pipe function '|', and the background operator '&' */ if ((spChPos = redirectStdout(arg_list, arg_list_size)) >= 0) { if(spChPos == (arg_list_size - 1)){ printf("No output destination specified\n"); } else { int pid = fork(); if(pid == -1) { //error occured printf("Error creating child\n"); } else if (pid == 0) { //child process int fd; //file descriptor char *filename = arg_list[spChPos + 1]; //destination file char *arg_list2[spChPos+1]; //updated arg_list for (int i = 0; i < spChPos; i++) { arg_list2[i] = arg_list[i]; } arg_list2[spChPos] = NULL; if((fd = open(filename, O_CREAT | O_WRONLY, 0666)) < 0){ printf("Error opening specified destination\n"); } if(dup2(fd, 1) < 0) { printf("Error redirecting stdout\n" ); } if(execvp(arg_list2[0], arg_list2) == -1){ printf("An error has occured\n"); close(fd); exit(0); } close(fd); } else { wait(NULL); } } } else if ((spChPos = redirectStdin(arg_list, arg_list_size)) >= 0) { //printf("contains > found at position: %d\n", spChPos); if(spChPos == (arg_list_size - 1)){ printf("No input destination specified\n"); } else { int pid = fork(); if(pid == -1) { //error occured printf("Error creating child\n"); } else if (pid == 0) { //child process int fd; //file descriptor char *filename = arg_list[spChPos + 1]; //destination file char *arg_list2[spChPos+1]; //updated arg_list for (int i = 0; i < spChPos; i++) { arg_list2[i] = arg_list[i]; } arg_list2[spChPos] = NULL; if((fd = open(filename, O_RDONLY, 0666)) < 0){ printf("File does not exit\n"); } if(dup2(fd, 0) < 0) { printf("Error redirecting stdin\n" ); } if(execvp(arg_list2[0], arg_list2) == -1){ printf("An error has occured"); close(fd); exit(0); } close(fd); } else { wait(NULL); } } } else if ((spChPos = pipeChecker(arg_list, arg_list_size)) >= 0) { /* This section is responsible for splitting up the arguements before and after the pipe so that they can be called in seperate processes */ int par_arg_size = arg_list_size - spChPos; int chld_arg_size = spChPos + 1; char *arg_list_parent[par_arg_size], *arg_list_child[chld_arg_size]; for(int i = 0; i < par_arg_size-1; i++){ arg_list_parent[i] = arg_list[spChPos+1]; } arg_list_parent[par_arg_size - 1] = NULL; for(int i = 0; i < chld_arg_size-1; i++){ arg_list_child[i] = arg_list[i]; } arg_list_child[chld_arg_size-1] = NULL; int pid = fork(); if(pid == -1) { //error occured printf("Error creating child"); } else if (pid == 0) { int fd[2]; pipe(fd); int pid = fork(); if(pid == -1) { //error occured printf("Error creating child"); } else if (pid == 0) { close(fd[0]); dup2(fd[1], 1); if(execvp(arg_list_child[0], arg_list_child) == -1){ printf("An error has occured"); exit(0); } } else { close(fd[1]); dup2(fd[0], 0); if(execvp(arg_list_parent[0], arg_list_parent) == -1){ printf("An error has occured"); exit(0); } } } else { wait(NULL); } } else if (arg_list[arg_list_size-1][0] == '&') { //if statement checks if process should be created in background arg_list[arg_list_size-1] = NULL; if(bg_process == 0) { pid_t pid = fork(); if(pid == -1) { //error occured printf("Error creating child"); } else if (pid == 0) { if(execvp(arg_list[0], arg_list) == -1){ printf("An error has occured"); exit(0); } //child process } else { bg_process = pid; printf("Running (Pid: %d) &", pid); for(int i = arg_list_size-2; i >= 0; i--) { printf(" %s", arg_list[i]); } printf("\n"); } } else { printf("Background process already running.\n"); } } else if (strcmp(arg_list[0], "fg") == 0) { if(bg_process != 0){ waitpid(bg_process, NULL, 0); bg_process = 0; } else { printf("No background processes exist\n"); } } else { int pid = fork(); if(pid == -1) { //error occured printf("Error creating child"); } else if (pid == 0) { //child process if(execvp(arg_list[0], arg_list) == -1){ printf("An error has occured"); exit(0); } } else { wait(NULL); } } } }while(strcmp(buffer, "exit\n") != 0); }
C
#include <stdio.h> #include <stdlib.h> #include <string.h> typedef struct line { char op, type; unsigned addr; unsigned size; int unit; } LINE; typedef struct random_access_memory { unsigned memory_size; unsigned cache_size; unsigned block_size; unsigned block_count; unsigned **cache; } RAM; int main(int argc, char **argv) { RAM ram; ram.memory_size = strtol(argv[1], NULL, 10); ram.cache_size = strtol(argv[2], NULL, 10); ram.block_size = strtol(argv[3], NULL, 10); ram.block_count = ram.cache_size / ram.block_size; ram.cache = calloc(ram.block_count, sizeof(*ram.cache)); for (int i = 0; i < ram.block_count; ++i) { ram.cache[i] = calloc(2, sizeof(**ram.cache)); } unsigned cache_block_num, memory_block_num; unsigned long long misses = 0; LINE cur; memset(&cur, 0, sizeof(cur)); while (scanf("%c%c%x%u%d\n", &cur.op, &cur.type, &cur.addr, &cur.size, &cur.unit) > 4) { if (cur.addr >= ram.memory_size) { ++misses; continue; } memory_block_num = cur.addr / ram.block_size; cache_block_num = memory_block_num % ram.block_count; if (ram.cache[cache_block_num][0] == 0) { ++ram.cache[cache_block_num][0]; } else { if (ram.cache[cache_block_num][1] != memory_block_num) { ++misses; } } ram.cache[cache_block_num][1] = memory_block_num; } for (int i = 0; i < ram.block_count; ++i) { free(ram.cache[i]); } free(ram.cache); printf("%llu\n", misses); return 0; }
C
#define NULL ((void*)0) typedef unsigned long size_t; // Customize by platform. typedef long intptr_t; typedef unsigned long uintptr_t; typedef long scalar_t__; // Either arithmetic or pointer type. /* By default, we understand bool (as a convenience). */ typedef int bool; #define false 0 #define true 1 /* Forward declarations */ typedef struct TYPE_3__ TYPE_1__ ; /* Type definitions */ struct TYPE_3__ {int /*<<< orphan*/ path; int /*<<< orphan*/ fd; int /*<<< orphan*/ * inf; } ; typedef TYPE_1__ FILEDESC ; /* Variables and functions */ int /*<<< orphan*/ exit (int) ; int /*<<< orphan*/ * fdopen (int /*<<< orphan*/ ,char*) ; int /*<<< orphan*/ perror (int /*<<< orphan*/ ) ; __attribute__((used)) static void open_fp(FILEDESC *fp) { if (fp->inf == NULL && (fp->inf = fdopen(fp->fd, "r")) == NULL) { perror(fp->path); exit(1); } }
C
#include "command.h" char peekchar() { char c = getchar(); ungetc(c, stdin); return c; } void consume_whitespace() { while (1) { char c = peekchar(); if (isalnum(c)) { break; } else { getchar(); } } } void read_command_name(struct command *command) { char buffer[8] = {0}; int offset = 0; while (1) { char c = peekchar(); if (isalpha(c)) { buffer[offset++] = c; getchar(); } else { break; } } if (strcmp(buffer, "save") == 0) { command->name = SAVE; } else if (strcmp(buffer, "load") == 0) { command->name = LOAD; } else { perror("unexpected command name\n"); } } int read_command_int() { int result = 0; while (1) { char c = peekchar(); if (isnumber(c)) { getchar(); result = 10 * result + c - '0'; } else { break; } } return result; } void read_command_index(struct command *command) { command->index = read_command_int(); } void read_command_value(struct command *command) { command->value = read_command_int(); } struct command read_command() { struct command command; read_command_name(&command); consume_whitespace(); read_command_index(&command); if (command.name == SAVE) { consume_whitespace(); read_command_value(&command); } return command; }
C
//average of the numbers #include<stdio.h> int main() { int num,a[100],avg=0,i,N; printf("Enter the total numbers"); scanf("%d",&N); printf("\nEnter the numbers"); for(i=1;i<=N;i++) { scanf("%d",&a[i]); printf("\t%d",a[i]); avg=avg+a[i]; } printf("\nThe average value is %d",avg); return 0; }
C
// getchar_function.c #include <stdio.h> int main(void) { int c; printf(" ϳ Է: _\b"); c = getchar(); printf("Է : %c\n", c); return 0; }
C
#include <stdio.h> #include <stdlib.h> #include <string.h> #include "aula0804.h" #define NUMERO_ARGUMENTOS COMPRIMENTO_PIS_PASEP + 1 #define ARGUMENTO_INVALIDO 1 #define NUMERO_ARGUMENTOS_INVALIDO 2 #define OK 0 int main (int argc, char *argv[]) { unsigned indice; char pisPasep[COMPRIMENTO_PIS_PASEP]; if (argc != NUMERO_ARGUMENTOS) { printf("Uso: <nome_do_programa> <numeroPisPasep> \n"); exit(NUMERO_ARGUMENTOS_INVALIDO); } for (indice = 1; indice < COMPRIMENTO_PIS_PASEP + 1; indice++) { if ((strlen(argv[indice]) != 1) || ((argv[indice][0] < '0') || (argv[indice][0] > '9'))) { printf("Argumento \"%s\" invalido, entrar com numeros entre \"0\" e \"9\"\n", argv[indice]); exit(ARGUMENTO_INVALIDO); } } strcpy(pisPasep, argv[1]); for (indice = 1; indice < COMPRIMENTO_PIS_PASEP; indice++) strcat(pisPasep, argv[indice + 1]); printf("%c\n", GerarDigitoVerificadorPisPasep(pisPasep)); return OK; }
C
#include <stdio.h> #include <stdlib.h> #include <string.h> #define BUFFER_SIZE 50 //Write a function that reverses the digits of a given floating-point //number. The function should receive a double number and a pointer to // an integer variable. In case of format error, it should set error to // 1 and in case of success to 0. Declare a function prototype before //defining the function. double reverse(char* number, int *error); int main() { char input[BUFFER_SIZE]; fgets(input, BUFFER_SIZE, stdin); int error; double reversed = reverse(input, &error); if (error != 1) { printf("%.3lf", reversed); } else { printf("Invalid format"); } return 0; } double reverse(char* number, int *error) { *error = 0; int a, b, length = strlen(number); char reversed[length]; for (a = 0, b = length - 2; a < length; a++, b--) { reversed[a] = number[b]; } char* remainder; double reversedNum = strtod(reversed, &remainder); if (*remainder != '\0') { *error = 1; return 0; } return reversedNum; }
C
/* Exercise 1-14. Write a program to print a histogram of the frequencies of different characters in its input. */ #include "stdio.h" #define MAX 1000 main(){ char c; int counts[MAX]; int i, j; i = j = 0; //initialize counts for (i=0; i < MAX; i++){ counts[i] = 0; } while((c = getchar()) != EOF){ if (c != '\t' && c != '\n' && c != '\r' && c != ' '){ // \r is needed for windows files ++counts[c]; } } for (i=0; i < MAX; i++){ if(counts[i] > 0){ printf("%2c |", i); for (j=0; j < counts[i]; j++){ putchar('*'); } putchar('\n'); } } }
C
/****************************************************************************** Напишите программу, которая запрашивает имя и фамилию, а затем выводит их в формате фамилия, имя. *******************************************************************************/ #include <stdio.h> int main() { char name[20]; char soname[20]; printf("Input name & so-name"); scanf("%s", name); scanf("%s", soname); printf("%s %s", soname, name); return 0; }
C
#pragma once enum { QUEUE_SIZE = 5 }; typedef struct { char array[QUEUE_SIZE]; int front, rear; } QUEUE; void initQueue(QUEUE* pq); void enQueue(QUEUE* pq, char data); char deQueue(QUEUE* pq); int isEmpty(QUEUE* pq);
C
/* Q5) Escreva uma função que receba, como entrada, uma cadeia de caracteres s e um inteiro n, e, em seguida, retire o "sufixo" da cadeia s de tamanho n (isto é, retire os n últimos caracteres). Se a cadeia não tiver pelo menos n caracteres, deve ser impressa a mensagem "erro". Por exemplo, se s = "abcdefghi" e n = 3, então a cadeia "abcdef" deve ser impressa; com a mesma cadeia s e n = 17, deve ser impresso "erro". O protótipo desta função é o seguinte: void retira_fim_n (char *str, int n). */ #include <string.h> #include <stdio.h> #include <stdlib.h> void retira_fim_n (char *str, int n); int main(void){ char* cadeia; int n; printf("Informe a cadeia: "); cadeia = (char*) malloc(sizeof(char) * 16); scanf(" %15[^\n]", cadeia); printf("Informe n: "); scanf("%d", &n); retira_fim_n(cadeia, n); printf("\n"); } void retira_fim_n(char *str, int n){ int i,j; for(i = 0; str[i] != '\0'; i++); if (i < n){ printf("erro"); } else{ for(j = 0; j < i-n; j++){ printf("%c", str[j]); } } }
C
#include <stdlib.h> #include "two-sum.h" int main(){ int nums[] = { 2, 7, 11, 15}; int target = 9; int *result = twoSum(nums, 4, target); if(result != NULL && (nums[result[0]]+nums[result[1]] == target)){ printf("WORKS!!\n"); } else { printf(":(\n"); } }
C
// Uses ptrace to overwrite the vdso of a running process. #include <stdio.h> #include <stdlib.h> #include <string.h> #include <sys/user.h> #include <sys/ptrace.h> #include "kernel/elf.h" #include "tools/ptutil.h" #include "misc.h" static addr_t aux_addr(int pid, unsigned type) { struct user_regs_struct regs; trycall(ptrace(PTRACE_GETREGS, pid, NULL, &regs), "ptrace get sp for aux"); dword_t sp = (dword_t) regs.rsp; // skip argc sp += 4; // skip argv while (pt_read(pid, sp) != 0) sp += 4; sp += 4; // skip envp while (pt_read(pid, sp) != 0) sp += 4; sp += 4; // dig through auxv dword_t aux_type; while ((aux_type = pt_read(pid, sp)) != 0) { sp += 4; if (aux_type == type) { return sp; } sp += 4; } return 0; } static void aux_write(int pid, int type, dword_t value) { return pt_write(pid, aux_addr(pid, type), value); } void transplant_vdso(int pid, const void *new_vdso, size_t new_vdso_size) { // get the vdso address and size from /proc/pid/maps char maps_file[32]; sprintf(maps_file, "/proc/%d/maps", pid); FILE *maps = fopen(maps_file, "r"); char line[256]; dword_t start, end; while (fgets(line, sizeof(line), maps) != NULL) { char *map_type = NULL; sscanf(line, "%8x-%8x %*s %*s %*s %*s %ms\n", &start, &end, &map_type); if (map_type) { if (strcmp(map_type, "[vdso]") == 0) { free(map_type); break; } free(map_type); } } fclose(maps); // copy the new vdso in for (dword_t addr = start; addr < end; addr += sizeof(unsigned long)) { unsigned long new_vdso_data = 0; if (addr - start < new_vdso_size) { new_vdso_data = *(unsigned long *) ((char *) new_vdso + addr - start); } if (ptrace(PTRACE_POKEDATA, pid, addr, new_vdso_data) < 0) { perror("ptrace vdso poke"); exit(1); } } // find the entry point dword_t entry = *(dword_t *) ((char *) new_vdso + 24) + start; aux_write(pid, AX_SYSINFO, entry); aux_write(pid, AX_SYSINFO_EHDR, start); }
C
/* * TraceBuffer.c * * * Created by Michael Weingert on 11-11-14. * Copyright 2011 __MyCompanyName__. All rights reserved. * */ #include "TraceBuffer.h" #include "Constants.h" #include "Structures.h" #include <stdio.h> #include <string.h> void InitializeTraceBufferSEND() { int i; TraceBuffer* temp; TraceBuffer* tempPrev; temp = (TraceBuffer *)malloc(sizeof(TraceBuffer)); headSEND = temp; temp->previous = NULL; tempPrev = temp; for (i = 1; i < TRACE_BUFFER_NUM; i++) { temp->S_ID = -1; // for sanity checks temp->next = (TraceBuffer *)malloc(sizeof(TraceBuffer)); tempPrev = temp; temp = temp->next; temp->previous = tempPrev; } tailSEND = tempPrev; } void InitializeTraceBufferRECEIVE() { int i; TraceBuffer* temp; TraceBuffer* tempPrev; temp = (TraceBuffer *)malloc(sizeof(TraceBuffer)); headRECEIVE = temp; temp->previous = NULL; tempPrev = temp; for (i = 1; i < TRACE_BUFFER_NUM; i++) { temp->S_ID = -1; // for sanity checks temp->next = (TraceBuffer *)malloc(sizeof(TraceBuffer)); tempPrev = temp; temp = temp->next; temp->previous = tempPrev; } tailRECEIVE = tempPrev; } void DeallocateTraceBufferSEND() { TraceBuffer* temp = headSEND; while (temp->next != NULL) { temp = temp->next; free(temp->previous); } free(temp); headSEND = NULL; tailSEND = NULL; } void DeallocateTraceBufferRECEIVE() { TraceBuffer* temp = headRECEIVE; while (temp->next != NULL) { temp = temp->next; free(temp->previous); } free(temp); headRECEIVE = NULL; tailRECEIVE = NULL; } void Add_TraceBufferSEND(int S_ID, int R_ID, int TimeStampSec, int TimeStampMin, int TimeStampHr, int Message_Type) { tailSEND->S_ID = S_ID; tailSEND->R_ID = R_ID; tailSEND->TimeStampSec = TimeStampSec; tailSEND->TimeStampMin = TimeStampMin; tailSEND->TimeStampHr = TimeStampHr; tailSEND->Message_Type = Message_Type; tailSEND->next = headSEND; headSEND->previous = tailSEND; tailSEND->previous->next = NULL; headSEND = tailSEND; tailSEND = headSEND->previous; headSEND->previous = NULL; } void Add_TraceBufferRECEIVE(int S_ID, int R_ID, int TimeStampSec, int TimeStampMin, int TimeStampHr, int Message_Type) { tailRECEIVE->S_ID = S_ID; tailRECEIVE->R_ID = R_ID; tailRECEIVE->TimeStampSec = TimeStampSec; tailRECEIVE->TimeStampMin = TimeStampMin; tailRECEIVE->TimeStampHr = TimeStampHr; tailRECEIVE->Message_Type = Message_Type; tailRECEIVE->next = headRECEIVE; headRECEIVE->previous = tailRECEIVE; tailRECEIVE->previous->next = NULL; headRECEIVE = tailRECEIVE; tailRECEIVE = headRECEIVE->previous; headRECEIVE->previous = NULL; } void PrintTraceBufferSEND(MsgEnv* message) { int i; char tempMessage[MAXCHAR]; // to do later TraceBuffer * temp; temp = headSEND; snprintf(message->message, MAXCHAR, "%c[33mSEND TRACE BUFFER\n%c[0m", 0x1B, 0x1B); //strcat(message->message, "SEND TRACE BUFFER\n"); if (temp->S_ID == -1 ) { snprintf(message->message, MAXCHAR, "NULL SEND TRACE BUFFER"); return; } //message->message = ""; //NOTE NEED TO CHECK STRCAT OPERATION for (i = 1; i < TRACE_BUFFER_NUM; i++) { if (temp->S_ID == -1) break; snprintf(tempMessage, MAXCHAR, "S_ID %i R_ID %i MessageType %i Time %i : %i : %i\n", temp->S_ID, temp->R_ID, temp->Message_Type, temp->TimeStampHr, temp->TimeStampMin, temp->TimeStampSec); strcat(message->message, tempMessage); //message->message += temp->S_ID + temp->R_ID + temp->Message_Type + temp->TimeStampHr + ":" + temp->TimeStampMin + ":" + temp->TimeStampSec;// etc etc if (temp->next == NULL) break; temp = temp->next; } char command[40]; snprintf(command, 40, "%c[37mRECEIVE TRACE BUFFER\n%c[0m", 0x1B, 0x1B); strcat(message->message, command); temp = headRECEIVE; if (temp->S_ID == -1 ) { snprintf(message->message, MAXCHAR, "NULL RECEIVE TRACE BUFFER"); return; } //msg->message = "" for (i = 1; i < TRACE_BUFFER_NUM; i++) { if (temp->S_ID == -1) break; snprintf(tempMessage, MAXCHAR, "S_ID %i R_ID %i MessageType %i Time %i : %i : %i\n", temp->S_ID, temp->R_ID, temp->Message_Type, temp->TimeStampHr, temp->TimeStampMin, temp->TimeStampSec); strcat(message->message, tempMessage); //msg->message += temp->S_ID + temp->R_ID + temp->Message_Type + temp->TimeStampHr + ":" + temp->TimeStampMin + ":" + temp->TimeStampSec;// etc etc if (temp->next == NULL) break; temp = temp->next; } } void PrintTraceBufferRECEIVE(MsgEnv* msg) { int i; // to do later char * tempMessage = (char *)malloc(MAXCHAR * sizeof(char)); TraceBuffer * temp; temp = headRECEIVE; if (temp->S_ID == -1 ) { snprintf(msg->message, sizeof(msg->message), "NULL TRACE BUFFER"); return; } //msg->message = "" for (i = 1; i < TRACE_BUFFER_NUM; i++) { if (temp->S_ID == -1) break; snprintf(tempMessage, MAXCHAR, "S_ID %i R_ID %i MessageType %i Time %i : %i : %i\n", temp->S_ID, temp->R_ID, temp->Message_Type, temp->TimeStampHr, temp->TimeStampMin, temp->TimeStampSec); strcat(msg->message, tempMessage); //msg->message += temp->S_ID + temp->R_ID + temp->Message_Type + temp->TimeStampHr + ":" + temp->TimeStampMin + ":" + temp->TimeStampSec;// etc etc if (temp->next == NULL) break; temp = temp->next; } }
C
#include <stdio.h> #include <math.h> #include <assert.h> #include "util.h" #include "cudd.h" //Function wrappers around macros DdNode *wrappedRegular(DdNode *f){ assert(f); return Cudd_Regular(f); } void wrappedCuddRef(DdNode *f){ assert(f); Cudd_Ref(f); } int wrappedCuddIsComplement(DdNode *f){ return Cudd_IsComplement(f); } //Garbage collection hooks int preGCHook_sample(DdManager *dd, const char *str, void *data){ printf("Performing %s garbage collection...", str); return 1; } int postGCHook_sample(DdManager *dd, const char *str, void *data){ printf("%s GC done\n", str); return 1; } int **allSat(DdManager *m, DdNode *n, int *nterms, int *nvars){ CUDD_VALUE_TYPE value; DdGen *gen; int *cube; int size = Cudd_ReadSize(m); int num = ceil(Cudd_CountPathsToNonZero(n)); int i=0; *nterms = num; *nvars = size; int **result = malloc(sizeof(int *)*num); assert(result); Cudd_ForeachCube(m, n, gen, cube, value){ result[i] = malloc(sizeof(int *)*size); assert(result[i]); int j; for(j=0; j<size; j++){ result[i][j] = cube[j]; } i++; } return result; } int *oneSat(DdManager *m, DdNode *n, int *nvars){ CUDD_VALUE_TYPE value; DdGen *gen; int *cube; int size = Cudd_ReadSize(m); int j; *nvars = size; gen = Cudd_FirstCube (m, n, &cube, &value); if (Cudd_IsGenEmpty(gen)) { Cudd_GenFree (gen); return NULL; } int *result = malloc(sizeof(int) * size); assert(result); for(j=0; j<size; j++){ result[j] = cube[j]; } Cudd_GenFree (gen); return result; } int *onePrime(DdManager *m, DdNode *l, DdNode *u, int *nvars){ DdGen *gen; int *cube; int size = Cudd_ReadSize(m); int j; *nvars = size; gen = Cudd_FirstPrime(m, l, u, &cube); if (Cudd_IsGenEmpty(gen)) { Cudd_GenFree (gen); return NULL; } int *result = malloc(sizeof(int) * size); assert(result); for(j=0; j<size; j++){ result[j] = cube[j]; } Cudd_GenFree (gen); return result; }
C
#define thisprog "xe-oversample1" #define TITLE_STRING thisprog" v 1: 17.March.2019 [JRH]" #define MAXLINELEN 1000 #include <math.h> #include <stdio.h> #include <stdlib.h> #include <string.h> /* <TAGS> signal_processing filter </TAGS> v 1: 17.March.2019 [JRH] */ /* external functions start */ char *xf_lineread1(char *line, long *maxlinelen, FILE *fpin); long *xf_lineparse2(char *line,char *delimiters, long *nwords); int xf_filter_bworth1_f(float *X, size_t nn, float sample_freq, float low_freq, float high_freq, float res, char *message); long xf_interp3_f(float *data, long ndata); float *xf_expand1_f(float *data , long nn, long setn, char *message); /* external functions end */ int main (int argc, char *argv[]) { /* general variables */ char *line=NULL,message[MAXLINELEN]; long ii,jj,kk,nn,nbad,maxlinelen=0; int w,x,y,z; float a,b,c,d,result_f[64]; double aa,bb,cc,dd,ee, result_d[64]; FILE *fpin,*fpout; /* program-specific variables */ long sizeofd1,n2; float *data1=NULL; double sr2,divisor=2.0; /* arguments */ char *infile; int setverb=0; long setcolx=1,setcoly=2; double setsr=1000.0,setmul=4.0; float setres=pow(2.0,0.5),setlow=0.0,sethigh=-1.0; /******************************************************************************** PRINT INSTRUCTIONS IF THERE IS NO FILENAME SPECIFIED ********************************************************************************/ if(argc<2) { fprintf(stderr,"\n"); fprintf(stderr,"----------------------------------------------------------------------\n"); fprintf(stderr,"%s\n",TITLE_STRING); fprintf(stderr,"----------------------------------------------------------------------\n"); fprintf(stderr,"Resample an input, adding points and smoothing (Butterworth filter)\n"); fprintf(stderr,"- assumes one valid numeric value per input line\n"); fprintf(stderr,"- non-numeric values will be interpolated\n"); fprintf(stderr,"USAGE: %s [infile] [options]\n",thisprog); fprintf(stderr," [input]: file name or \"stdin\"\n"); fprintf(stderr,"VALID OPTIONS: defaults in []\n"); fprintf(stderr," -sr: sample-rate (Hz) of input [%g]\n",setsr); fprintf(stderr," -mul: multiplier for sample-rate [%g]\n",setmul); fprintf(stderr," -low: low-cut filter (Hz, 0=NONE) [%g]\n",setlow); fprintf(stderr," -high: high-cut filter (Hz, -1=AUTO, 0=NONE) [%g]\n",sethigh); fprintf(stderr," AUTO= sr/%g\n",divisor); fprintf(stderr," -verb: verbose output (0=NO 1=YES 999=DEBUG) [%d]\n",setverb); fprintf(stderr,"EXAMPLES:\n"); fprintf(stderr," %s data.txt -sr 1000 -mul 4 -low 10 1\n",thisprog); fprintf(stderr," cat temp.txt | %s stdin -sr 1000 -mul 2\n",thisprog); fprintf(stderr,"OUTPUT:\n"); fprintf(stderr," higher-resolution, filtered values\n"); fprintf(stderr,"----------------------------------------------------------------------\n"); fprintf(stderr,"\n"); exit(0); } /******************************************************************************** READ THE FILENAME AND OPTIONAL ARGUMENTS - including comma-separated list item ********************************************************************************/ infile= argv[1]; for(ii=2;ii<argc;ii++) { if( *(argv[ii]+0) == '-') { if((ii+1)>=argc) {fprintf(stderr,"\n--- Error[%s]: missing value for argument \"%s\"\n\n",thisprog,argv[ii]); exit(1);} else if(strcmp(argv[ii],"-sr")==0) setsr= atof(argv[++ii]); else if(strcmp(argv[ii],"-mul")==0) setmul= atof(argv[++ii]); else if(strcmp(argv[ii],"-low")==0) setlow= atof(argv[++ii]); else if(strcmp(argv[ii],"-high")==0) sethigh= atof(argv[++ii]); else if(strcmp(argv[ii],"-verb")==0) setverb= atoi(argv[++ii]); else {fprintf(stderr,"\n--- Error [%s]: invalid command line argument [%s]\n\n",thisprog,argv[ii]); exit(1);} }} if(setverb!=0 && setverb!=1 && setverb != 999) { fprintf(stderr,"\n--- Error [%s]: invalid -verb [%d] must be 0,1, or 999\n\n",thisprog,setverb);exit(1);} if(setmul<1.0) { fprintf(stderr,"\n--- Error [%s]: invalid -mul [%g] must be >=1\n\n",thisprog,setmul);exit(1);} if(setmul==1) divisor=2.1; /******************************************************************************** STORE DATA - ASSUME WE DON'T KNOW THE LENGTH OF EACH INPUT LINE ********************************************************************************/ sizeofd1= sizeof(*data1); if(strcmp(infile,"stdin")==0) fpin=stdin; else if((fpin=fopen(infile,"r"))==0) {fprintf(stderr,"\n--- Error[%s]: file \"%s\" not found\n\n",thisprog,infile);exit(1);} nn= nbad= 0; if(setverb==1) fprintf(stderr,"\tstoring data from %s\n",infile); while((line=xf_lineread1(line,&maxlinelen,fpin))!=NULL) { if(maxlinelen==-1) {fprintf(stderr,"\n--- Error[%s]: readline function encountered insufficient memory\n\n",thisprog);exit(1);} if(sscanf(line,"%f",&a)!=1 || !isfinite(a)) {a=NAN; nbad++;} data1= realloc(data1,((nn+1)*sizeofd1)); if(data1==NULL) {fprintf(stderr,"\n--- Error[%s]: insufficient memory\n\n",thisprog);exit(1);}; data1[nn]= a; nn++; } if(strcmp(infile,"stdin")!=0) fclose(fpin); if(setverb==1) fprintf(stderr,"\t%ld data points read - %ld invalid\n",nn,nbad); //TEST: for(ii=0;ii<nn;ii++) printf("%g\n",data1[ii]); goto END; /********************************************************************************/ /* INTERPOLATE IF THERE ARE INVALID DATAPOINTS */ /********************************************************************************/ if(nbad>0) { if(setverb==1) fprintf(stderr,"\tinterpolating...\n"); kk= xf_interp3_f(data1,(off_t)nn); if(kk<0) { fprintf(stderr,"\n\t --- Error [%s]: input \"%s\" contains no valid numbers\n\n",thisprog,infile);free(data1);exit(1);} } /********************************************************************************/ /* EXPAND THE DATA BY DUPLICATING POINTS */ /********************************************************************************/ n2= (long)nn*setmul; sr2= setsr*setmul; if(setverb==1) fprintf(stderr,"\texpanding to %ld points, samplerate= %g Hz...\n",n2,sr2); if(setmul>1.0) { data1= xf_expand1_f(data1,nn,n2,message); if(data1==NULL) { fprintf(stderr,"\n\t--- %s/%s\n\n",thisprog,message); exit(1); } } /********************************************************************************/ /* APPLY THE BUTTERWORTH FILTER */ /********************************************************************************/ if(sethigh==-1) sethigh= (float)(setsr/divisor); if(setverb==1) fprintf(stderr,"\tfiltering (%g-%g Hz) ...\n",setlow,sethigh); z= xf_filter_bworth1_f(data1,n2,(float)sr2,setlow,sethigh,setres,message); /********************************************************************************/ /* OUTPUT */ /********************************************************************************/ for(ii=0;ii<n2;ii++) printf("%g\n",data1[ii]); goto END; /********************************************************************************/ /* CLEANUP AND EXIT */ /********************************************************************************/ END: if(data1!=NULL) free(data1); exit(0); }
C
#include <stdio.h> #include <string.h> #include <unistd.h> #include <sys/socket.h> #include <netinet/in.h> #include <arpa/inet.h> #include "macro.h" int main(int argc, char *argv[]) { char recvbuf[BUF_LEN]; ssize_t recvbytes; int serverfd; int clientfd; struct sockaddr_in serveraddr; struct sockaddr_in clientaddr; socklen_t clientlen; /* 面向连接的字节流, 套接字描述符一般值为3 */ if ((serverfd = socket(AF_INET, SOCK_STREAM, 0)) == - 1) { perror("socket error"); return 1; } /* 初始化客户端套接字地址 */ memset(&clientaddr, 0, sizeof(struct sockaddr)); /* 初始化服务器套接字地址 */ memset(&serveraddr, 0, sizeof(struct sockaddr)); serveraddr.sin_family = AF_INET; serveraddr.sin_port = htons(SERVER_PORT); // 主机字节序转换为网络字节序 serveraddr.sin_addr.s_addr = INADDR_ANY; // 套接字端点可以被绑定到所有的系统网络接口上 printf("server: serveraddr = %u\n", serveraddr.sin_addr.s_addr); /* 套接字绑定地址 */ if (bind(serverfd, (struct sockaddr *)&serveraddr, sizeof(struct sockaddr)) == - 1) { perror("bind error"); return 1; } /* 接收套接字连接请求 */ if (listen(serverfd, CONNECT_NUM) == - 1) { perror("listen error"); return 1; } while (1) { clientlen = sizeof(struct sockaddr_in); /* 获得连接请求并建立连接, 阻塞模式 */ printf("server: ready to accept\n"); if ((clientfd = accept(serverfd, (struct sockaddr *)&clientaddr, &clientlen)) == - 1) { perror ("accept error"); continue; } printf("server: got connection from %s\n", inet_ntoa(clientaddr.sin_addr)); /* 接收 */ printf("server: ready to receive\n"); if ((recvbytes = recv(clientfd, recvbuf, BUF_LEN, 0) ) == -1) { perror ("recv error"); return 1; } printf("server: recvbytes = %zd\n", recvbytes); if (recvbytes) { recvbuf[recvbytes] = '\0'; printf("server: receive: %s\n", recvbuf); sleep(3); } /* 发送 */ printf("server: ready to send\n"); if (send(clientfd, "Hi, I am server", 16, 0) == -1) { perror("send error"); return 1; } close(clientfd); } return 0; }
C
#include <stdio.h> #include "mkl.h" #include <math.h> #include "functions.h" int main(void) { int i; int size = 1000; int s_e_point = 50; int fl_par = 50; double *x; //Allocate memmory x = (double *) malloc(sizeof (double) * size); if (x == NULL) exit(99); x[0] = 0; for( i = 1; i < size; i++) { x[i] = x[i-1] + 0.1; } sigmoid(x, size, s_e_point, fl_par); return (0); }
C
// // Created by Linus Bein Fahlander on 2018-03-05. // #include <stdint.h> /* Declarations of uint_32 and the like */ #include <pic32mx.h> /* Declarations of system-specific addresses etc */ #include "flow_control.h" #include "../drivers/display/display_functions.h" #include "../controllers/fingerprint_sensor.h" #include "../state.h" uint8_t last_state = 0xFF; void main_flow(){ switch (CURRENT_STATE){ case DEFAULT_STATE: default_flow(); break; case CONFIG_MODE: config_flow(); break; case ALARM_ARMED: armed_flow(); break; case ALARM_TRIGGERED: triggered_flow(); break; case SCAN_NEXT: scan_next_flow(); break; case ERROR_STATE: error_flow(); break; } } void default_flow(){ display_string(0, "Ready to"); display_string(1, "be armed!"); display_string(2, ""); display_string(3, ""); display_update(); } void config_flow(){ display_string(0, "Configure"); display_string(1, "Mode"); display_string(2, ""); display_string(3, ""); display_update(); } void armed_flow(){ display_string(0, "Alarm is"); display_string(1, "Active!"); display_string(2, ""); display_string(3, ""); display_update(); } void triggered_flow(){ display_string(0, "ALARM ALARM"); display_string(1, "ALARM ALARM"); display_string(2, "ALARM ALARM"); display_string(3, "PRESS FINGER!"); display_update(); } void scan_next_flow(){ display_string(0, "Please scan"); display_string(1, "Your finger"); display_string(2, "Again"); display_string(3, ""); display_update(); } void error_flow(){ display_string(0, "AN ERROR"); display_string(1, "HAS OCCURRED"); display_string(2, "PLEASE"); display_string(3, "RESTART"); display_update(); }
C
/* * Create a named stream pipe. */ #include <sys/types.h> #include <sys/stat.h> int /* return 0 if OK, -1 on error */ ns_pipe(name, fd) char *name; /* user-specified name to assign to the stream pipe */ int fd[2]; /* two file descriptors returned through here */ { int omask; struct stat statbuff; /* * First create an unnamed stream pipe. */ if (s_pipe(fd) < 0) return(-1); /* * Now assign the name to one end (the first descriptor, fd[0]). * To do this we first find its major/minor device numbers using * fstat(2), then use these in a call to mknod(2) to create the * filesystem entry. Beware that mknod(2) is restricted to root * (for everything other than FIFOs). * Under System VR3.2, the major value for the unnamed stream pipe * corresponds to the major for "/dev/spx" and the minor value is * whatever the "/dev/spx" clone driver assigned to make the * major/minor unique. */ if (fstat(fd[0], &statbuff) < 0) { close(fd[0]); close(fd[1]); return(-1); } unlink(name); /* in case it already exists */ omask = umask(0); /* assure mode is 0666 */ if (mknod(name, S_IFCHR | 0666, statbuff.st_rdev) < 0) { close(fd[0]); close(fd[1]); umask(omask); return(-1); } umask(omask); /* restore old umask value */ return(0); /* all OK */ }
C
/* This code is public domain Authors: Nicolas Gast, 2013 nicolas.gast@epfl.ch Jean-Yves Le Boudec, 2019 jean-yves.leboudec@epfl.ch */ #include <stdio.h> /* for printf() and fprintf() */ #include <sys/socket.h> /* for socket(), bind(), and connect() */ #include <arpa/inet.h> /* for sockaddr_in and inet_ntoa() */ #include <stdlib.h> /* for atoi() and exit() */ #include <string.h> /* for memset() */ #include <unistd.h> /* for close() */ #include <netdb.h> #include <stdlib.h> // atoi, atof #include <sys/time.h> // gettimeofday #include<signal.h> #include<errno.h> #define TEN_TO_6 1000000 #define MAX_PACKET_SIZE 1000 #define KILO 1000.0 #define SMALL_PACKET 125 #define LARGE_PACKET 1000 #define DEFAULT_RATE 100.0 #define SMALL_RATE 50.0 int continue_sending = 1; static void catch_function(int signal){ (void)signal; // to suppress the warning about unused variable continue_sending = 0; } double get_time() { struct timeval t; gettimeofday(&t, 0); return t.tv_sec + (double) t.tv_usec / TEN_TO_6; } int main(int argc, char **argv) { signal(SIGINT, catch_function); struct hostent *dst_ptr; struct sockaddr_in dst_addr; int sockfd, i, slen=sizeof(dst_addr); char * dst_name; short port; char data_buf[MAX_PACKET_SIZE]; for (i=0;i<MAX_PACKET_SIZE;i++) data_buf[i]=1; // We will try to send packets of size "packet_size" every "waiting_time" milliseconds double rate = DEFAULT_RATE; // default int packet_size; // in Bytes double waiting_time; // in milliseconds if (argc < 3) { fprintf(stderr, "Usage: %s <dst ip> <port> [rate kb/s]\n", argv[0]); exit(1); } else { dst_name = argv[1]; port = atoi(argv[2]); if (argc >= 4){ rate = atof(argv[3]); } } // We now set the packet_size and the waiting_time time as a function of the rate. // if the rate<SMALL_RATE, we use packets of size SMALL_PACKET // otherwise, packets of size LARGE_PACKET if (rate < SMALL_RATE) { packet_size = SMALL_PACKET; } else { packet_size = LARGE_PACKET; } waiting_time = 8*packet_size/(KILO*rate); /* create socket */ if ((sockfd = socket(AF_INET, SOCK_DGRAM, IPPROTO_UDP)) < 0) { perror ("socket"); exit(1); } if ((dst_ptr = gethostbyname(dst_name)) == 0) { perror ("gethostbyname"); exit(1); } bcopy(dst_ptr->h_addr, (char *)&dst_addr.sin_addr, dst_ptr->h_length); dst_addr.sin_family = AF_INET ; dst_addr.sin_port = htons(port) ; double start_time = get_time(); double last_print_time = start_time; double next_time = start_time+waiting_time; int nb_packets = 0, bytes_sent=0; int sent_len, recv_len; /* Now, we try to send one packet every "waiting_time" */ while(continue_sending) { // First, we send a packet sprintf(data_buf,"%d\n",nb_packets+1); // we send the packet number in the data if( (sent_len = sendto(sockfd,data_buf,packet_size,0, (const struct sockaddr*) &dst_addr, slen)) == -1) { perror("sendto"); exit(1); } bytes_sent += sent_len; nb_packets ++; // Every second, we print how many packets were sent if (get_time() >= last_print_time+1){ printf("%5.1fs - sent:%6d pkts, %6.1f kb/s\n", get_time()-start_time, nb_packets, bytes_sent*8/ (get_time()-last_print_time) / KILO); bytes_sent= 0; last_print_time = get_time(); } // Then, we add a wait to send a packet every x ms. double time_to_wait = next_time-get_time(); if (time_to_wait > 0 ) usleep(TEN_TO_6 *time_to_wait); next_time +=waiting_time; } /* When we receive ^C, we stop sending at full rate. We send messages that start with 0 every 0.1s to notify the server. until we receive an ack from the server (or another ^C) */ // First, we set the timeout to 0.1 second. struct timeval tv; tv.tv_sec=0; tv.tv_usec = 0.1*TEN_TO_6; setsockopt(sockfd, SOL_SOCKET, SO_RCVTIMEO, (char*)&tv, sizeof(tv) ); // Now, we keep sending until we receive an ack or another ^C continue_sending = 1; while( continue_sending) { data_buf[0]=0; if( sendto(sockfd,data_buf,packet_size,0,(const struct sockaddr*) &dst_addr, slen) == -1) { perror("sendto"); exit(1); } if ( (recv_len = continue_sending = recv(sockfd,data_buf,MAX_PACKET_SIZE,0)) < 0 ){ if (!(errno == EWOULDBLOCK) ) { // if error is not caused by TIMEOUT, we die. perror("recv"); exit(1); } } else { // if we received an ack, we stop sending continue_sending = 0; } } printf("packets sent = %d, avg rate=%6.1fkb/s\n", nb_packets, 8*packet_size*nb_packets/(get_time()-start_time)/KILO); close (sockfd); return 0; }
C
// // RingList.c // Lab2 // // Created by on 4/7/16. // Copyright 2016 Sergey fedorenko. All rights reserved. // // #include "RingList.h" #include "Node.h" #include <stdlib.h> // Constants const int kListError = -1; //Create/delete a list RingList *CreateList() { RingList *theList = (RingList *)malloc(sizeof(RingList)); theList->head = NULL; theList->tail = theList->head; theList->count = 0; return theList; } RingList *doList() { printf("Start to create a Ring list \n"); IntNode *theNode0 = CreateNode(10); IntNode *theNode1 = CreateNode(2); IntNode *theNode2 = CreateNode(3); IntNode *theNode4 = CreateNode(5); IntNode *theNode5 = CreateNode(30); IntNode *theNode6 = CreateNode(4); RingList *theList = CreateList(); AddNode(theList, theNode0); AddNode(theList, theNode1); AddNode(theList, theNode2); AddNode(theList, theNode4); AddNode(theList, theNode5); AddNode(theList, theNode6); printf("number of elements: %d\n", CountList(theList)); return theList; } void FreeList(RingList *aList) { // Check the input parameter if (NULL == aList) { return; } //1. Remove all elements IntNode *theNode = aList->head; while (NULL != theNode) { IntNode *theNodeFree = theNode; theNode = theNode->nextNode; free(theNodeFree); } //2. Free memory for the List structure free(aList); } IntNode *AddNode(RingList *aList, IntNode *aNewNode) { // Check the input parameter if (NULL == aList || NULL == aNewNode) { return NULL; } if (NULL == aList->head && NULL == aList->tail) { aList->head = aList->tail = aNewNode; } else { IntNode *theTail = aList->tail; aList->tail = aNewNode; if (NULL != theTail) { theTail->nextNode = aList->tail; } } aList->count += 1; return aNewNode; } int CountList(const RingList *aList) { int theResult = kListError; if (NULL != aList) { theResult = aList->count; } return theResult; } IntNode *NodeAtIndex(const RingList *aList, int anIndex) { IntNode *theResult = NULL; if (NULL != aList && anIndex < aList->count) { int i = 0; IntNode *theNode = aList->head; do { if (i == anIndex) { theResult = theNode; break; } i++; theNode = theNode->nextNode; } while (NULL != theNode); } return theResult; } IntNode *InsertNodeAtIndex(RingList *aList, IntNode *aNewNode, int anIndex) { if (NULL == aList || NULL == aNewNode || anIndex>aList->count + 1) { return NULL; } else { if (0 == anIndex) { aNewNode->nextNode = aList->head; aList->head = aNewNode; aList->count++; return(aNewNode); } else { IntNode *theNode = NodeAtIndex(aList, anIndex); IntNode *PreviosNode = NodeAtIndex(aList, anIndex - 1); aNewNode->nextNode = PreviosNode->nextNode; PreviosNode->nextNode = aNewNode; aList->count++; return aNewNode; } } } IntNode *RemovedNodeAtIndex(RingList *aList, int anIndex) { if (anIndex < aList->count) { if ((NULL == aList) || (anIndex>aList->count)) { return NULL; } else { if (anIndex == 0) { IntNode *theNode = NodeAtIndex(aList, anIndex); aList->head = NodeAtIndex(aList, anIndex + 1); aList->count -= 1; return theNode; } else { IntNode *theNode = NodeAtIndex(aList, anIndex); IntNode *PreviosNode = NodeAtIndex(aList, anIndex - 1); if (anIndex == aList->count) aList->tail = PreviosNode; PreviosNode->nextNode = theNode->nextNode; aList->count -= 1; return theNode; } } } } /*IntNode *findMinNode(const RingList *inputList) { IntNode *currentNode = inputList->head; IntNode *minNode = currentNode; do { if (currentNode->value <= minNode->value) { minNode = currentNode; } currentNode = currentNode->nextNode; } while (NULL != currentNode); return minNode; } IntNode *findMaxNode(const RingList *aList) { IntNode *currentNode = aList->head; IntNode *maxNode = currentNode; do { if (currentNode->value >= maxNode->value) { maxNode = currentNode; } currentNode = currentNode->nextNode; } while (NULL != currentNode); return maxNode; } RingList *swapNodeAtList(RingList *inputList) { IntNode *minNode = findMinNode(inputList); IntNode *maxNode = findMaxNode(inputList); int minvalue = minNode->value; minNode->value = maxNode->value; maxNode->value = minvalue; return inputList; } void doSortingValue(IntNode *theList) { int a, min; int j = 0; int InMin = 0; int InMax = 0; int RemovedAtIndex = 0; a = CountList(theList); for (int j = 0; j < a; j++) { IntNode *TheMinNode = NodeAtIndex(theList, InMin); min = NodeAtIndex(theList, InMin)->value; for (int k = InMin; k < a; k++) { if (min >= TheMinNode->value) { min = TheMinNode->value; RemovedAtIndex = k; } TheMinNode = TheMinNode->nextNode; } InsertNodeAtIndex(theList, RemovedNodeAtIndex(theList, RemovedAtIndex), InMin); InMin++; } } */ //Homework3 void theSelectionSorting(RingList*theList, int Count) { int j = 0; int min; int IndexMinimum = 0; int IndexRemoved = 0; for (int j = 0; j < Count; j++) { IntNode *MinNode = NodeAtIndex(theList, IndexMinimum); min = NodeAtIndex(theList, IndexMinimum)->value; for (int k = IndexMinimum; k < Count; k++) { if (min >= MinNode->value) { min = MinNode->value; IndexRemoved = k; } MinNode = MinNode->nextNode; } InsertNodeAtIndex(theList, RemovedNodeAtIndex(theList, IndexRemoved), IndexMinimum); IndexMinimum++; } printf("\nselectionSort\n"); }
C
/* ************************************************************************ * * This file implements the json parser. * * Working example and terminology * ================================ * We use following json to depict * how it works: * [1, 2, {"key": 3.4}] * * We call [...] as *array*, and {...} as *hashtab*. Array and hashtab are * *composite objects*, and number/string/boolean/null are *primitive objects*. * * This json snippet has two composite objects: * - O2: is a hash-table having only one element with key being "key", and * value being 3.4. * - O1: is a array containing three elements, i.e. 1, 2 and O2. * * O2 is *nested* in O1, and O1 is O2's *immediate nesting* composite object. * * How it works * ============= * The parser walks the input json from left to right, calling scaner to get a * token at a time. The scaner recognizes following tokens in order: * * token type value * --------------------------- * char '[' * number 1 * char ',' * number 2 * char ',' * cahr '{' * string "key" * .... * * At the heart of the parser is a *parsing-stack*, which push a level when * seeing the starting delimiter of a composite object (e.g. seeing '[' of * an array), and pop until the closing delimiter of the same composite object * is seen). So, the parse-stack is in essence mimicking the nesting * relationship. Actually in our implementation, the stack element contains * a data structure keeping track of the current composite object being * processed. * * The result of the parser is organized in reverse-nesting order linked * in a singly-linked list. See the comment to jp_parse() in ljson_parser.h * for details. * * ************************************************************************ */ #include <stdio.h> #include <stdlib.h> #include <stdarg.h> #include <inttypes.h> #include <ctype.h> #include "util.h" #include "mempool.h" #include "scaner.h" #include "parser.h" #ifdef DEBUG static int verfiy_reverse_nesting_order(obj_t* parse_result); #endif /* ************************************************************************** * * About parse-stack. * * ************************************************************************** */ static inline void init_obj(obj_t* obj, obj_ty_t ty) { obj->next = 0; obj->obj_ty = ty; obj->elmt_num = 0; } static inline void init_composite_obj(obj_composite_t* obj, obj_ty_t ty, uint32_t id) { init_obj(&obj->common, ty); obj->subobjs = 0; obj->id = id; } static inline composite_state_t* alloc_composite_state(parser_t* parser) { composite_state_t* cs; cs = MEMPOOL_ALLOC_TYPE(parser->mempool, composite_state_t); return cs; } static void pstack_init(parser_t* parser) { composite_state_t* cs = &parser->parse_stack; init_composite_obj(&cs->obj, OT_ROOT, 0); cs->next = 0; cs->prev = cs; /* this is *top* */ } int pstack_push(parser_t* parser, obj_ty_t obj_ty, int init_state) { /* Step 1: Allocate an stack element */ composite_state_t* cs = alloc_composite_state(parser); if (unlikely(!cs)) return 0; /* Step 2: Initialize the corresponding composite object. */ obj_composite_t* cobj = &cs->obj; init_composite_obj(cobj, obj_ty, parser->next_cobj_id++); /* link the composite objects in reverse-nesting order */ cobj->reverse_nesting_order = (obj_composite_t*)(void*)parser->result; parser->result = &cobj->common; /* Step 3: Push one level */ cs->parse_state = init_state; cs->next = 0; composite_state_t* root = &parser->parse_stack; composite_state_t* top = root->prev; cs->prev = top; root->prev = cs; /* update the "top" */ return 1; } composite_state_t* pstack_pop(parser_t* parser) { composite_state_t* ps = &parser->parse_stack; composite_state_t* top = ps->prev; composite_state_t* new_top = top->prev; new_top->next = 0; ps->prev = new_top; return new_top; } /*************************************************************************** * * Emit Objects * *************************************************************************** */ /* Convert the primitive token to primitive object */ static inline obj_t* cvt_primitive_tk(mempool_t* mp, token_t* tk) { ASSERT(tk_is_primitive(tk)); obj_primitive_t* obj = MEMPOOL_ALLOC_TYPE(mp, obj_primitive_t); if (unlikely(!obj)) return 0; ASSERT((((int)TT_INT64 == (int)OT_INT64) && ((int)TT_FP == (int)OT_FP) && ((int)TT_STR == (int)OT_STR) && ((int)TT_BOOL == (int)OT_BOOL) && ((int)TT_NULL == (int)OT_NULL))); obj->common.obj_ty = tk->type; obj->common.str_len = tk->str_len; obj->int_val = tk->int_val; return &obj->common; } void insert_subobj(obj_composite_t* nesting, obj_t* nested) { nested->next = nesting->subobjs; nesting->subobjs = nested; nesting->common.elmt_num ++; } int emit_primitive_tk(mempool_t* mp, token_t* tk, obj_composite_t* nesting_cobj) { obj_t* obj = cvt_primitive_tk(mp, tk); if (obj) { insert_subobj(nesting_cobj, obj); return 1; } return 0; } /*************************************************************************** * * Parser driver * *************************************************************************** */ obj_t* parse(parser_t* parser, const char* json, uint32_t json_len) { scaner_t* scaner = &parser->scaner; const char* json_end = scaner->json_end; pstack_init(parser); token_t* tk = sc_get_token(scaner, json_end); token_ty_t tk_ty = tk->type; /* case 1: The input json starts with delimiter of composite objects * (i.e. array/hashtab). */ if (tk_ty == TT_CHAR) { int succ = 0; char c = tk->char_val; if (c == '{') { succ = start_parsing_hashtab(parser); } else if (c == '[') { succ = start_parsing_array(parser); } else { set_parser_err_fmt(parser, "Unknow object starting with '%c'", c); return 0; } while (succ) { composite_state_t* top = pstack_top(parser); obj_ty_t ot = top->obj.common.obj_ty; if (ot == OT_HASHTAB) { succ = parse_hashtab(parser); } else if (ot == OT_ARRAY) { succ = parse_array(parser); } else { ASSERT(ot == OT_ROOT); break; } } if (unlikely(!succ)) return 0; token_t* end_tk = sc_get_token(scaner, json_end); if (end_tk->type != TT_END) { goto trailing_junk; } return parser->result; } /* case 2: The input jason is empty */ if (unlikely(tk_ty == TT_END)) { parser->err_msg = "Input json is empty"; return 0; } /* case 3: The input starts with a primitive object. I don't know if it * conforms to spec or not. */ if (tk_is_primitive(tk)) { parser->result = cvt_primitive_tk(parser->mempool, tk); if (sc_get_token(scaner, json_end)->type == TT_END) { return parser->result; } } trailing_junk: parser->result = 0; set_parser_err(parser, "Extraneous stuff"); return 0; } static void reset_parser(parser_t* parser, const char* json, uint32_t json_len) { mempool_t* mp = parser->mempool; mp_free_all(mp); pstack_init(parser); sc_init_scaner(&parser->scaner, mp, json, json_len); parser->result = 0; parser->err_msg = 0; parser->next_cobj_id = 1; } /**************************************************************************** * * Implementation of the exported functions * *************************************************************************** */ struct json_parser* jp_create(void) { parser_t* p = (parser_t*)malloc(sizeof(parser_t)); if (unlikely(!p)) return 0; mempool_t* mp = mp_create(); if (unlikely(!mp)) return 0; p->mempool = mp; p->result = 0; p->err_msg = "Out of Memory"; /* default error message :-)*/ pstack_init(p); return (struct json_parser*)(void*)p; } obj_t* jp_parse(struct json_parser* jp, const char* json, uint32_t len) { parser_t* parser = (parser_t*)(void*)jp; reset_parser(parser, json, len); obj_t* obj = parse(parser, json, len); ASSERT(verfiy_reverse_nesting_order(obj)); return obj; } void jp_destroy(struct json_parser* p) { parser_t* parser = (parser_t*)(void*)p; mp_destroy(parser->mempool); free((void*)p); } /* ***************************************************************************** * * Debugging, error handling and other cold code * * ***************************************************************************** */ void __attribute__((format(printf, 2, 3), cold)) set_parser_err_fmt(parser_t* parser, const char* fmt, ...) { if (parser->err_msg) return; int buf_len = 250; char* buf = MEMPOOL_ALLOC_TYPE_N(parser->mempool, char, buf_len); if (!buf) { parser->err_msg = "OOM"; return; } parser->err_msg = buf; scaner_t* scaner = &parser->scaner; /* In case error take place in scaner, we should go for scaner's * error message. */ if (scaner->err_msg) { snprintf(buf, buf_len, "%s", scaner->err_msg); return; } int loc_info_len = snprintf(buf, buf_len, "(line:%d,col:%d) ", scaner->line_num, scaner->col_num); buf += loc_info_len; buf_len -= loc_info_len; va_list vl; va_start(vl, fmt); vsnprintf(buf, buf_len, fmt, vl); va_end(vl); } void __attribute__((cold)) set_parser_err(parser_t* parser, const char* str) { if (!parser->err_msg) set_parser_err_fmt(parser, "%s", str); } static void __attribute__((cold)) dump_primitive_obj (FILE* f, obj_t* the_obj) { obj_primitive_t* obj = (obj_primitive_t*)(void*)the_obj; switch (the_obj->obj_ty) { case OT_INT64: fprintf(f, "%" PRIi64, obj->int_val); break; case OT_FP: fprintf(f, "%.16f", obj->db_val); break; case OT_STR: { int idx = 0; int len = the_obj->str_len; fputc('"', f); for (; idx < len; idx++) { char c = obj->str_val[idx]; if (isprint(c)) { fputc(c, f); } else { fprintf(f, "\\%#02x", c); } } fputc('"', f); } break; case OT_BOOL: fputs(obj->int_val ? "true" : "false", f); break; case OT_NULL: fputs("null", f); break; default: ASSERT(0 && "NOT Primitive"); break; } } void __attribute__((cold)) dump_composite_obj(FILE* f, obj_composite_t* cobj) { obj_ty_t type = cobj->common.obj_ty; if (type != OT_ARRAY && type != OT_HASHTAB) { fprintf(f, "unknown composite type %d\n", (int)type); return; } obj_t* elmt_slist = cobj->subobjs; int elmt_num = cobj->common.elmt_num; obj_t** elmt_vect = (obj_t**)malloc(sizeof(obj_t*) * elmt_num); int i = elmt_num - 1; while (elmt_slist) { elmt_vect[i] = elmt_slist; elmt_slist = elmt_slist->next; i--; } if (i != -1) { free(elmt_vect); fprintf(f, "the numbers of elements disagree\n"); return; } if (type == OT_ARRAY) { fprintf (f, "[ (id:%d) ", cobj->id); int i; for(i = 0; i < elmt_num; i++) { obj_t* elmt = elmt_vect[i]; if (elmt->obj_ty <= OT_LAST_PRIMITIVE) { dump_primitive_obj(f, elmt); } else { int id = ((obj_composite_t*)(void*)elmt)->id; fprintf(f, "obj-%d", id); } if (i != elmt_num - 1) fputs(", ", f); } fputs("]\n", f); } else { ASSERT(type == OT_HASHTAB); ASSERT((elmt_num & 1) == 0); fprintf(f, "{ (id:%d) ", cobj->id); int i; for(i = 0; i < elmt_num; i+=2) { obj_t* key = elmt_vect[i]; obj_t* val = elmt_vect[i+1]; dump_primitive_obj(f, key); fputc(':', f); if (val->obj_ty <= OT_LAST_PRIMITIVE) { dump_primitive_obj(f, val); } else { int id = ((obj_composite_t*)(void*)val)->id; fprintf(f, "obj-%d", id); } if (i != elmt_num - 2) fputs(", ", f); } fputs("}\n", f); } free(elmt_vect); } void __attribute__((cold)) dump_obj(FILE* f, obj_t* obj) { if (!obj) { fprintf(f, "null\n"); return; } obj_ty_t type = obj->obj_ty; if (type <= OT_LAST_PRIMITIVE) { dump_primitive_obj(f, obj); fputc('\n', f); } else { obj_composite_t* cobj = (obj_composite_t*)(void*)obj; for (; cobj; cobj = cobj->reverse_nesting_order) { dump_composite_obj(f, cobj); } } } const char* __attribute__((cold)) jp_get_err(struct json_parser* p) { parser_t* parser = (parser_t*)(void*)p; return parser->err_msg; } #ifdef DEBUG static int verfiy_reverse_nesting_order(obj_t* parse_result) { if (!parse_result) return 1; obj_ty_t type = parse_result->obj_ty; if (type <= OT_LAST_PRIMITIVE) return 0; obj_composite_t* cobj = (obj_composite_t*)(void*)parse_result; int obj_cnt = 1; int first_id, last_id; first_id = last_id = cobj->id; /* loop over all composite-object in the the reverse-nesting order */ for (cobj = cobj->reverse_nesting_order; cobj != 0; cobj = cobj->reverse_nesting_order) { if (cobj->id != last_id - 1) return 0; last_id = cobj->id; obj_cnt++; } if (last_id != 1 || obj_cnt != first_id) return 0; return 1; } #endif
C
#ifndef ESTRUTURAS #define ESTRUTURAS typedef struct NoArvore { char temValor; unsigned char letra; unsigned int quantidade; struct NoArvore *esq; struct NoArvore *dir; } NoArvore; typedef struct NoFila { NoArvore *dado; struct NoFila *prox; } NoFila; typedef struct { char *codigo; char qtosBits; }CodLetra; /*a partir de dois nós, faz uma raiz com o primeiro na esquerda e o segundo na direita*/ NoArvore* juntarNos(NoArvore *noUm, NoArvore *noDois) { NoArvore *raiz = (NoArvore*)malloc(sizeof(NoArvore)); raiz->quantidade = (noUm->quantidade)+(noDois->quantidade); raiz->temValor = 0; raiz->esq = noUm; raiz->dir = noDois; return raiz; } /*tira o primeiro elemento da fila*/ NoFila* desenfileirar(NoFila *inicio) { NoFila *noAuxiliar = (NoFila*)malloc(sizeof(NoFila)); *noAuxiliar = *inicio; noAuxiliar->prox = NULL; *inicio = *(inicio->prox); return noAuxiliar; } /*insere um elemento na fila sempre antes do que é maior que ele, e caso não houver, no fim*/ void inserirNaFila(NoArvore *novoNo, NoFila *inicio) { NoFila *novoNoFila; novoNoFila = (NoFila*)malloc(sizeof(NoFila)); novoNoFila->dado = novoNo; novoNoFila->prox = NULL; if(inicio->dado == NULL) { inicio->dado = novoNo; } else { if((inicio->dado)->quantidade >= (novoNoFila->dado)->quantidade) { NoFila noAuxiliar = *inicio; /*um n� fila recebe o conte�do do ponteiro inicio*/ *inicio = *novoNoFila; /*o conteudo do inicio passa a ser o que � novoNoFila*/ inicio->prox = (NoFila*)malloc(sizeof(NoFila)); /*o prox de inicio recebe um malloc*/ *(inicio->prox) = noAuxiliar; /*o conteudo do prox de inicio recebe o noAuxiliar*/ } else { NoFila *noAtual = inicio; /*Ponteiro que caminha pela fila*/ char achou = 0; while(achou == 0) { if((noAtual->dado)->quantidade <= (novoNoFila->dado)->quantidade) { if(noAtual->prox == NULL) { achou = 1; noAtual->prox = novoNoFila; /*Conte�do do ponteiro passa a ser o novo n� fila*/ } else if(((noAtual->prox)->dado)->quantidade > (novoNoFila->dado)->quantidade) { achou = 1; NoFila noAuxiliar = *(noAtual->prox); /*noAuxiliar recebe conteudo de prox de noAtual*/ *(noAtual->prox) = *novoNoFila; /*conteudo de prox passa a ser novoNoFila*/ noAtual->prox->prox = (NoFila*)malloc(sizeof(NoFila)); /*aloca prox de novoNoFila*/ *(noAtual->prox->prox) = noAuxiliar; /*guarda noAuxiliar no prox*/ } } noAtual = noAtual->prox; } } } } /*vetor de códigos das letras*/ CodLetra codigosLetras[256]; /*percorre arvore recursivamente para formar os códigos das letras*/ void codificarLetras(NoArvore* atual, char cod, char indice, char codigo[]) { codigo[indice] = cod; if(atual->temValor == 0) { codificarLetras(atual->esq, 0, indice+1, codigo); codificarLetras(atual->dir, 1, indice+1, codigo); } else { char i; codigosLetras[atual->letra].codigo = (char*)malloc((indice+1)*sizeof(char)); for(i=0; i<=indice; i++) codigosLetras[atual->letra].codigo[i] = codigo[i]; codigosLetras[atual->letra].qtosBits = indice+1; } } /*converte a fila de prioridades numa arvore*/ void converterParaArvore(NoFila *inicio) { while(inicio->prox!= NULL) { if(inicio->prox->prox == NULL) { NoFila *dir = (NoFila*)malloc(sizeof(NoFila)); NoFila *esq = desenfileirar(inicio); *dir = *inicio; dir->dado = (NoArvore*)malloc(sizeof(NoArvore)); *(dir->dado) = *(inicio->dado); inicio->dado->temValor = 0; inicio->dado->quantidade = (dir->dado->quantidade) + (esq->dado->quantidade); inicio->dado->esq = esq->dado; inicio->dado->dir = dir->dado; inicio->prox = NULL; } else { NoFila *esq = desenfileirar(inicio); NoFila *dir = desenfileirar(inicio); inserirNaFila(juntarNos(esq->dado, dir->dado), inicio); } } } /*desaloca todos os ponteiros da arvore*/ void limparArvore(NoArvore *atual) { if(atual != NULL) { NoArvore *esq = atual->esq; NoArvore *dir = atual->dir; free(atual); limparArvore(esq); limparArvore(dir); } } #endif
C
#include <stdio.h> int main(){ int a = 1; int b = 2; int c = 3; unsigned int d = 3; printf("---------------------------------------------\n"); printf("and or xor \n\n"); printf("0x%08x | 0x%08x = 0x%08x\n",a,b, a|b); printf("0x%08x & 0x%08x = 0x%08x\n",a,b, a&b); printf("0x%08x ^ 0x%08x = 0x%08x\n",a,b, a^b); printf("~0x%08x = 0x%08x\n",a,~a); printf("---------------------------------------------\n"); printf("signed Ʈ \n\n"); printf("signed int : 0x%08x >> 1 = 0x%08x\n",c,c >> 1); printf("signed int : 0x%08x << 1 = 0x%08x\n",c,c << 1); printf("signed int : 0x%08x >> 1 = 0x%08x\n",~c,~c >> 1); printf("---------------------------------------------\n"); printf("unsigned Ʈ \n\n"); printf("unsigned int : 0x%08x >> 1 = 0x%08x\n",d,d >> 1); printf("unsigned int : 0x%08x << 1 = 0x%08x\n",d,d << 1); printf("unsigned int : 0x%08x >> 1 = 0x%08x\n",~d,~d >> 1); return 0; }
C
#include <stdlib.h> #include "binary_heap_pro.h" #define ROOT_IDX 0u #define LEFT_CHILD(x) (2u * x) + 1u #define RIGHT_CHILD(x) 2u * (x + 1u) #define PARENT(x) (x - 1u) / 2u /* I'm assuming a decent compiler will inline the next two functions; if not they can be made #define macros. */ void exch(unsigned int j, unsigned int k, Item arr[], unsigned int lookup[]) { int priority = arr[j].priority; int data = arr[j].data; unsigned int key1 = arr[j].key; unsigned int key2 = arr[k].key; arr[j].priority = arr[k].priority; arr[j].data = arr[k].data; arr[j].key = key2; lookup[key2] = j; arr[k].priority = priority; arr[k].data = data; arr[k].key = key1; lookup[key1] = k; } unsigned int pq_size(PQ *pq) { return pq->first_available; } unsigned int capacity(PQ *pq) { return pq->capacity; } int less(unsigned int j, unsigned int k, Item arr[]) { return (arr[j].priority <= arr[k].priority); } void swim(unsigned int k, Item arr[], unsigned int lookup[]) { while (k > ROOT_IDX && less (k, PARENT(k), arr)) { exch(k, PARENT(k), arr, lookup); k = PARENT(k); } } void sink (unsigned int k, Item arr[], unsigned int first_available, unsigned int lookup[]) { while (LEFT_CHILD(k) < first_available) { /* Requirement that capacity <= MAX_SIZE be of reasonable size */ unsigned j = LEFT_CHILD(k); if (j+1 < first_available && less(j+1, j, arr)) j++; /* careful with j+1 overflow? */ if (less(k, j, arr)) break; exch(k, j, arr, lookup); k = j; } } unsigned int pq_insert_nc(PQ *pq, int priority, int data) { unsigned int fa = pq->first_available; Item* cells = pq->heap_cells; unsigned int key = cells[fa].key; cells[fa].priority = priority; cells[fa].data = data; swim(fa, cells, pq->key_table); pq->first_available = fa + 1; return key; } void pq_edit_priority(PQ *pq, int key, int newpri) { unsigned int* table = pq->key_table; Item* cells = pq->heap_cells; unsigned int target = table[key]; // if (target >= pq_size(pq)) return; // I will now know that this key refers to a valid member of the heap int oldpri = cells[target].priority; cells[target].priority = newpri; if (newpri <= oldpri) swim(target, cells, table); // potentially unnecessary swimming in case of equality else sink (target, cells, pq->first_available, table); } // post condition: either the key was in the heap and we did all this stuff, // or we did nothing void pq_remove_min_nc(PQ *pq, Item* item) { /* unsigned int fa = pq->first_available - 1; Item* cells = pq->heap_cells; unsigned* lookup = pq->key_table; exch(ROOT_IDX, fa, cells, lookup); item->priority = cells[fa].priority; item->data = cells[fa].data; item->key = cells[fa].key; sink(ROOT_IDX, cells, fa, lookup); pq->first_available = fa; */ pq->first_available--; exch(ROOT_IDX, pq->first_available, pq->heap_cells, pq->key_table); item->priority = pq->heap_cells[pq->first_available].priority; item->data = pq->heap_cells[pq->first_available].data; item->key = pq->heap_cells[pq->first_available].key; sink(ROOT_IDX, pq->heap_cells, pq->first_available, pq->key_table); } unsigned int pq_insert(PQ *pq, int priority, int data) { if (pq->first_available == pq->capacity) return 0; /* Hrm, maybe should signal error or grow heap or whatever... */ return pq_insert_nc(pq, priority, data); } Item* pq_remove_min(PQ *pq) { if (pq->first_available == ROOT_IDX) return 0; Item* item = (Item*) malloc(sizeof(Item)); pq_remove_min_nc(pq, item); return item; } PQ* pq_make(unsigned int size) { /* could take a size parameter I suppose... */ PQ *pq = (PQ*) mallocN(sizeof(PQ)); unsigned int* table = (unsigned int*) mallocN(sizeof(unsigned int) * size); Item* arr = (Item*) mallocN(sizeof(Item) * size); int i; for (i = 0; i < size; i++) { arr[i].key = i; arr[i].priority = 0; arr[i].data = 0; table[i] = i; } pq->capacity = size; pq->first_available = 0; pq->heap_cells = arr; pq->key_table = table; return pq; } void pq_free (PQ *pq) { freeN(pq->key_table); freeN(pq->heap_cells); freeN(pq); } /* could imagine adding some additonal functions: heapify ? */
C
/* * Say ip * Written by Chun-Hsiang Chao * Date:20191002 */ #include <unistd.h> #include <stdlib.h> #include <stdio.h> #include <string.h> void say_char(char c){ FILE *in,*out; char filename[100]; if(c=='.'){ sprintf(filename,"/home/pi/Music/voice/dot.pcm",c); } else{ sprintf(filename,"/home/pi/Music/voice/%c.pcm",c); } in=fopen(filename,"rb"); out=fopen("/dev/dsp","wb"); while(fscanf(in,"%c",&c)!=EOF){ fprintf(out,"%c",c); } fclose(in); sleep(1); fclose(out); } int main(int argc, char *argv[ ]){ FILE *read_fp; char buffer[1000]; int chars_read; char pattern[]="inet"; char *point; char ip[20]; int i=5; int j=0; read_fp = popen("ifconfig wlan0", "r"); if (read_fp != NULL) { chars_read = fread(buffer, sizeof(char), sizeof(buffer)-1, read_fp); if (chars_read > 0) { buffer[chars_read] = '\0'; //printf("Output was:-\n%s\n", buffer); point=strstr(buffer,pattern); if(point!=NULL){ //printf("%s\n",point); while(1){ if(point[i]!=' '){ ip[j]=point[i]; i++; j++; } else{ ip[j]='\0'; break; } } } } pclose(read_fp); for(i=0;i<strlen(ip);i++){ say_char(ip[i]); } printf("%s\n",ip); } exit(0); }
C
#include "debug.h" #include <stdio.h> #include <string.h> #include "array.h" static const size_t string_buffer_size = 1 * 1024 * 1024; // 1 MB // static char string_buffer[string_buffer_size]; static array g_string_buffer; static const size_t error_message_count = 32; static const char *error_messages[error_message_count]; // ring buffer static int next_error_message_id = 0; void debug_init() { array_init(&g_string_buffer, 1, string_buffer_size); char *p = g_string_buffer.ptr; p[0] = '\0'; } void debug_clear_all() { next_error_message_id = 0; g_string_buffer.size = 0; } void log_error(const char *msg) { size_t len = strlen(msg); if (g_string_buffer.size + len + 1 >= g_string_buffer.capacity) { puts("[DEBUG] string buffer is full\n"); return; } char *p = g_string_buffer.ptr + g_string_buffer.size; memcpy(p, msg, len); p[len] = '\0'; g_string_buffer.size += len + 1; error_messages[next_error_message_id] = p; next_error_message_id++; next_error_message_id %= error_message_count; assert(strcmp(p, msg) == 0); puts(msg); } bool debug_has_error() { return next_error_message_id != 0; } int debug_get_error_message_count() { return next_error_message_id; } const char *debug_get_error_message_at(int idx) { return error_messages[idx]; }
C
// Description----------------------------------------------------------------| /* * Initialises a struct with Name and Age data. Displays results on LEDs and * LCD. */ // DEFINES AND INCLUDES-------------------------------------------------------| #define STM32F051 //>>> Uncomment line 10 if using System Workbench (SW4STM32) or STM32CubeIDE //#define SW4STM32 #ifndef SW4STM32 #define TRUESTUDIO #endif #include "stm32f0xx.h" #include "lcd_stm32f0-1.h" // GLOBAL VARIABLES ----------------------------------------------------------| uint8_t = ADC_value; //adc value after conversation unsigned char buffer[16]; // FUNCTION DECLARATIONS -----------------------------------------------------| void main(void); //COMPULSORY void init_ADC(void); void display_on_LCD(); void init_LEDS(void); void display_on_LEDs(); void init_external_interupts(void); void init_buttons(void); #ifdef TRUESTUDIO //COMPULSORY void reset_clock_to_48Mhz(void); //COMPULSORY #endif //COMPULSORY // MAIN FUNCTION -------------------------------------------------------------| void main(void) { #ifdef TRUESTUDIO //COMPULSORY reset_clock_to_48Mhz(); //COMPULSORY #endif //COMPULSORY void init_ADC(); void display_on_LCD(); void init_LEDS(); void display_on_LEDs(); void display_on_LEDs(); void init_external_interupts(); void init_buttons(); while(1); } // OTHER FUNCTIONS -----------------------------------------------------------| void init_ADC(void) { RCC -> APB2ENR |= RCC_APB2ENR_ADCEN; // enable clock for ADC RCC -> AHBENR |= RCC_AHBENR_GPIOAEN; // enable clock PORT A GPIOA -> MODER |= GPIO_MODER_MODER5; // set PA5, analogue mode ADC1 -> CFGR1 |= ADC_CFGR1_RES_1; // 8 bit resolution ADC1 -> CFGR1 &= ~ADC_CFGR1_CONT; //Cont = 0: single shot mode ADC1->CR |= ADC_CR_ADEN; //set ADEN=1 while((ADC1->ISR & ADC_ISR_ADRDY)==0); //wait until ADRDY==1 ADC1->CR |= ADC_CR_ADSTART; //start the ADC } void display_on_LCD() { sprintf(buffer,"%f",ADC_value); init_LCD(); lcd_command(CLEAR); lcd_putstring(buffer); } void init_LEDS(void) { RCC->AHBENR |= RCC_AHBENR_GPIOBEN; // Enable GPIOB clock GPIOB->MODER |= GPIO_MODER_MODER0_0; GPIOB->MODER |= GPIO_MODER_MODER1_0; GPIOB->MODER |= GPIO_MODER_MODER2_0; GPIOB->MODER |= GPIO_MODER_MODER3_0; GPIOB->MODER |= GPIO_MODER_MODER4_0; GPIOB->MODER |= GPIO_MODER_MODER5_0; GPIOB->MODER |= GPIO_MODER_MODER6_0; GPIOB->MODER |= GPIO_MODER_MODER7_0; } void display_on_LEDs(void) { GPIOB -> ODR = ADC_value; } void init_buttons(void) { RCC -> AHBENR |= RCC_AHBENR_GPIOAEN; //enable clock for push buttons GPIOA -> MODER &= ~GPIO_MODER_MODER3; // configure PA0 to input mode GPIOA -> PUPDR |= GPIO_PUPDR_PUPDR3_0; // pull up '01' } #ifdef TRUESTUDIO //COMPULSORY /* Description: * This function resets the STM32 Clocks to 48 MHz */ void reset_clock_to_48Mhz(void) //COMPULSORY { //COMPULSORY if ((RCC->CFGR & RCC_CFGR_SWS) == RCC_CFGR_SWS_PLL) //COMPULSORY { //COMPULSORY RCC->CFGR &= (uint32_t) (~RCC_CFGR_SW); //COMPULSORY while ((RCC->CFGR & RCC_CFGR_SWS) != RCC_CFGR_SWS_HSI); //COMPULSORY } //COMPULSORY RCC->CR &= (uint32_t)(~RCC_CR_PLLON); //COMPULSORY while ((RCC->CR & RCC_CR_PLLRDY) != 0); //COMPULSORY RCC->CFGR = ((RCC->CFGR & (~0x003C0000)) | 0x00280000); //COMPULSORY RCC->CR |= RCC_CR_PLLON; //COMPULSORY while ((RCC->CR & RCC_CR_PLLRDY) == 0); //COMPULSORY RCC->CFGR |= (uint32_t) (RCC_CFGR_SW_PLL); //COMPULSORY while ((RCC->CFGR & RCC_CFGR_SWS) != RCC_CFGR_SWS_PLL); //COMPULSORY } //COMPULSORY #endif //COMPULSORY // INTERRUPT HANDLERS --------------------------------------------------------| void init_external_interupts(void) { RCC->APB2ENR |= RCC_APB2ENR_SYSCFGOMPEN; SYSCFG->EXTICR[0] |= SYSCFG_EXTICR1_EXTI0_PA; SYSCFG->EXTICR[0] |= SYSCFG_EXTICR1_EXTI1_PA; EXTI->IMR |= EXTI_IMR_MR3 | EXTI_IMR_MR1; EXTI->FTSR |= EXTI_FTSR_TR3 | EXTI_FTSR_MR1; NVIC_EnableIRQ(EXTI0_1_IRQn); } void EXTI0_1_IRQHandler(void) { if (EXTI-> PR &= EXTI_PR_PR3 )// IF BUTTON IS PUSHED WAS A3 { GPIOB->ODR = ADC_values; } else { GPIOB -> ODR = 0x00; } EXTI->PR |= EXTI_PR_PR3; }
C
#include <stdio.h> #include <stdlib.h> int main() { int char nama[30]; char alamat[40]; char nomer[20]; char jurusan[20]; char universitas[30]; printf("===================================\n"); printf("----Masukkan Data Diri Anda----\n"); printf("===================================\n"); printf("\n\n Masukkan nama anda \t\t: "); gets(nama); printf(" Masukkan alamat anda \t\t: "); gets(alamat); printf(" Masukkan nomor anda \t\t: "); scanf("%s",&nomer); printf(" Masukkan jurusan anda \t\t: "); scanf("%s", &jurusan); printf(" Masukkan Universitas anda \t: "); scanf("%s", &universitas); printf("\n ----Data Diri Anda---- \n"); printf(" Nama \t\t : %s\n",nama); printf(" Alamat \t : %s\n",alamat); printf(" Nomor Telp \t : %s\n",nomer); printf(" Jurusan \t : %s\n",jurusan); printf(" Universitas \t : %s\n",universitas); return 0; }
C
#include <stdio.h> #define TAILLE 10 int main(){ int i; int tab[TAILLE]={1, 2, 3, 4, 5, 6, 7, 8, 9, 10}, tab_copy[TAILLE]; for (i=0; i<TAILLE; i++){ tab_copy[i]=tab[i]; printf("tab[%d]=%d\n", i, tab[i]); printf("tab_copy[%d]=%d\n", i, tab_copy[i]); } return 0; }
C
#include "monteCarlo.h" #include "world.h" #include "spgrid.h" #include <string.h> #define DIAMETER 1 /* Particles have diameter 1 */ static bool collidesHelper(Particle *p1, Particle *p2) { /* Returns TRUE if there is NO collision! */ return nearestImageDistance2(p1->pos, p2->pos) >= SQUARE(DIAMETER); } static bool collides(Particle *p) { return !forEveryNeighbourOf(p, &collidesHelper); } static void fillWorld(void) { double ws = world.worldSize; for (int i = 0; i < world.numParticles; i++) { Particle *p = &world.particles[i]; p->pos = (Vec3) {0, 0, 0}; addToGrid(p); do { p->pos.x = ws * (rand01() - 1/2.0); p->pos.y = ws * (rand01() - 1/2.0); if (!world.twoDimensional) p->pos.z = ws * (rand01() - 1/2.0); reboxParticle(p); } while (collides(p)); } } typedef struct { MonteCarloConfig conf; long attempted; /* Attempted number of MC moves */ long accepted; /* Number of accepted MC moves */ } MonteCarloState; static void *monteCarloTaskStart(void *initialData) { assert(initialData != NULL); MonteCarloConfig *mcc = (MonteCarloConfig*) initialData; int nb = floor(world.worldSize / mcc->boxSize); if (nb < 0) die("World so small (or boxSize so big) that I can't fit a " "single box in there!\n"); /* adjust boxsize to get the correct world size! */ double trueBoxSize = world.worldSize / nb; printf("Requested boxsize %f, actual box size %f\n", mcc->boxSize, trueBoxSize); if (world.twoDimensional) { printf("Allocating grid for 2D world, %d boxes/dim.\n", nb); allocGrid(nb, nb, 1, trueBoxSize); } else { printf("Allocating grid for 3D world, %d boxes/dim.\n", nb); allocGrid(nb, nb, nb, trueBoxSize); } fillWorld(); MonteCarloState *state = malloc(sizeof(*state)); state->conf = *mcc; state->attempted = 0; state->accepted = 0; free(mcc); return state; } /* Perform a Monte Carlo sweep */ static TaskSignal monteCarloTaskTick(void *state) { assert(state != NULL); MonteCarloState *mcs = (MonteCarloState*) state; MonteCarloConfig *mcc = &mcs->conf; assert(mcc->delta > 0); for (int i = 0; i < world.numParticles; i++) { Particle *p = &world.particles[randIndex(world.numParticles)]; Vec3 oldPos = p->pos; p->pos.x += mcc->delta * (rand01() - 1/2.0); p->pos.y += mcc->delta * (rand01() - 1/2.0); if (!world.twoDimensional) p->pos.z += mcc->delta * (rand01() - 1/2.0); reboxParticle(p); if (collides(p)) { /* Back to old position! */ p->pos = oldPos; reboxParticle(p); } else { mcs->accepted++; } } mcs->attempted += world.numParticles; return TASK_OK; } static void monteCarloTaskStop(void *state) { MonteCarloState *mcs = (MonteCarloState*) state; printf("Acceptance ratio: %f\n", ((double) mcs->accepted) / mcs->attempted); freeGrid(); free(mcs); } Task makeMonteCarloTask(MonteCarloConfig *mcc) { if (mcc->boxSize <= 0) die("Box size is zero (or negative)!\n"); if (mcc->delta <= 0) die("MC delta is zero (or negative)!\n"); MonteCarloConfig *mccCopy = malloc(sizeof(*mccCopy)); memcpy(mccCopy, mcc, sizeof(*mccCopy)); Task ret = { .initialData = mccCopy, .start = &monteCarloTaskStart, .tick = &monteCarloTaskTick, .stop = &monteCarloTaskStop, }; return ret; }
C
#include <stdio.h> struct numbers { int num1; int num2; }; int main() { //struct numbers s1 = {.num2 = 22, .num1 = 11}; struct numbers s1 = { 22, 11 }; // struct numbers s2 = {.num2 = 30}; struct numbers s2 = { 2 }; printf("num1: %d, num2: %d\n", s1.num1, s1.num2); printf("s2.num1: %d s2.num2: %d", s2.num1, s2.num2); return 0; }
C
#include<stdio.h> int main() { int i, x, y, sum=0; scanf("%d %d", &x, &y); if(x<y) { for(i=x+1; i<y; i++) if(i%2==1 || i%2==-1) sum=sum+i; } else { for(i=y+1; i<x; i++) if(i%2==1 || i%2==-1) sum=sum+i; } printf("%d\n",sum); return 0; }
C
#include<stdio.h> #include<stdlib.h> typedef struct node{ int Val; struct node* Prev; struct node* Next; }listNode; listNode* receive(listNode* ptr,int n){ for (int i=0;i<n;i++){ listNode* node=(listNode*)malloc(sizeof(listNode)); scanf("%d", &node->Val); node->Next = ptr; node->Prev = NULL; if (ptr!=NULL) ptr->Prev = node; ptr = node; } return ptr; } int function(listNode* ptr,int n){ int flag = 0; listNode* tail = ptr; listNode* head = ptr; while(tail->Next!=NULL) tail = tail->Next; printf("%d",tail->Val); for (;head!=tail&&head->Next!=tail;){ if (head->Val!=tail->Val){ flag = 1; break; } head=head->Next; tail=tail->Prev; } if (flag){ return 0; } return 1; } int main(){ int n = 0; scanf("%d",&n); listNode* ptr = NULL; ptr = receive(ptr,n); int adjust = function(ptr,n); if (adjust){ printf("true"); } else { printf("false"); } return 0; }
C
# include "util.h" /*# include "efsManagement.h" */ # include "pManagement.h" # include "hmac.h" unsigned char * master_encdec_key ; unsigned char * master_hmac_key ; unsigned char * master_iv = "PURDUECS526CLASSFALL2015WLINUSA0"; unsigned char * password_file ; unsigned char * master_filelist ="master.filelist";; // FILL THE BODY OF THE FOLLOWING FUNCTIONS int create_file(unsigned char *username, unsigned char* password, unsigned char * fileName){ printf("DEBUG: CALLED CREATE_FILE FUNCTION\n"); return OKAY ; } int delete_file(unsigned char *username, unsigned char* password, unsigned char * fileName){ printf("DEBUG: CALLED DELETE_FILE FUNCTION\n"); return OKAY ; } int encrypt_file(unsigned char *username, unsigned char* password, unsigned char * fileName){ printf("DEBUG: CALLED ENCRYPT_FILE FUNCTION\n"); return OKAY ; } int decrypt_file(unsigned char *username, unsigned char* password, unsigned char * fileName){ printf("DEBUG: CALLED DECRYPT_FILE FUNCTION\n"); return OKAY ; } char* read_from_file(unsigned char *username, unsigned char* password, unsigned char * fileName, int offset, int length){ printf("DEBUG: CALLED READ_FROM_FILE FUNCTION\n"); return NULL ; } int write_to_file(unsigned char *username, unsigned char* password, unsigned char * fileName, int offset, unsigned char * nContent){ printf("DEBUG: CALLED WRITE_TO_FILE FUNCTION\n"); return OKAY ; } int file_size(unsigned char *username, unsigned char* password, unsigned char * fileName){ printf("DEBUG: CALLED FILE_SIZE FUNCTION\n"); return ERROR ; } int file_integrity_check(unsigned char *username, unsigned char* password, unsigned char * fileName){ printf("DEBUG: CALLED FILE_INTEGRITY_CHECK FUNCTION\n"); return OKAY ; } int system_health_check(){ printf("DEBUG: CALLED SYSTEM_HEALTH_CHECK FUNCTION\n"); return OKAY ; } int main(int argc, char* argv[]){ if(argc != 4){ printf("ERROR: Missing command line arguments\nUsage: ./efsmanager master_password user_password_file date_and_time_of_last_change\n"); return 1 ; } printf("Found master password: %s\n",argv[1]); printf("Found user password file: %s\n",argv[2]); printf("Found date of last change: %s\n",argv[3]); printf("Found master_iv: %s\n",master_iv); //copy argv[2] to password_file /* use the master password and master IV to generate the master encryption decryption key and master hmace key. Store the master encryption decryption key in master_encdec_key and store the master hmac key in master_hmac_key */ unsigned char command[1024]; int operation_status ; while(1){ printf("Available commands:\n(1) create_file\n(2) delete_file\n(3) encrypt_file\n(4) decrypt_file\n(5) read_from_file\n(6) write_to_file\n(7) file_size\n(8) file_integrity_check\n(9) system_health_check\n(10) quit\n\n\n"); printf("enter a command: "); scanf("%s",command) ; // printf("\n") ; operation_status = OKAY ; if(!strcmp(command,"create_file")){ printf("username: "); unsigned char username[1024]; scanf("%s",username) ; printf("password: "); unsigned char password[1024] ; scanf("%s",password) ; printf("file name: "); unsigned char pFile[1024] ; scanf("%s",pFile); operation_status = create_file(username,password,pFile) ; } else if(!strcmp(command,"delete_file")){ printf("username: "); unsigned char username[1024]; scanf("%s",username) ; printf("password: "); unsigned char password[1024] ; scanf("%s",password) ; printf("file name: "); unsigned char pFile[1024] ; scanf("%s",pFile); operation_status = delete_file(username,password,pFile) ; } else if(!strcmp(command,"encrypt_file")){ printf("username: "); unsigned char username[1024]; scanf("%s",username) ; printf("password: "); unsigned char password[1024] ; scanf("%s",password) ; printf("file name to encrypt: "); unsigned char pFile[1024] ; scanf("%s",pFile); operation_status = encrypt_file(username,password,pFile) ; } else if(!strcmp(command,"decrypt_file")){ printf("username: "); unsigned char username[1024]; scanf("%s",username) ; printf("password: "); unsigned char password[1024] ; scanf("%s",password) ; printf("file name to decrypt: "); unsigned char pFile[1024] ; scanf("%s",pFile); operation_status = decrypt_file(username,password,pFile) ; } else if(!strcmp(command,"file_size")){ printf("username: "); unsigned char username[1024]; scanf("%s",username) ; printf("password: "); unsigned char password[1024] ; scanf("%s",password) ; printf("file name: "); unsigned char pFile[1024] ; scanf("%s",pFile); operation_status = file_size(username,password,pFile) ; } else if(!strcmp(command,"file_integrity_check")){ printf("username: "); unsigned char username[1024]; scanf("%s",username) ; printf("password: "); unsigned char password[1024] ; scanf("%s",password) ; printf("file name: "); unsigned char pFile[1024] ; scanf("%s",pFile); operation_status = file_integrity_check(username,password,pFile) ; } else if(!strcmp(command,"system_health_check")){ operation_status = system_health_check(); } else if(!strcmp(command,"read_from_file")){ printf("username: "); unsigned char username[1024]; scanf("%s",username) ; printf("password: "); unsigned char password[1024] ; scanf("%s",password) ; printf("file name: "); unsigned char pFile[1024] ; scanf("%s",pFile); printf("position to read from: "); int offset ; scanf("%d",&offset); printf("how many characters to read: "); int len; scanf("%d",&len); unsigned char *content = read_from_file(username,password,pFile,offset,len) ; if(content == NULL){ printf("ERROR: Reading from file\n"); continue; } else{ printf("CONTENT:\n%s\n",content); } } else if(!strcmp(command,"write_to_file")){ printf("username: "); unsigned char username[1024]; scanf("%s",username) ; printf("password: "); unsigned char password[1024] ; scanf("%s",password) ; printf("file name: "); unsigned char pFile[1024] ; scanf("%s",pFile); printf("position to write to: "); int offset ; scanf("%d",&offset); printf("Content to write:\n "); char content[8192] ; int i = 0 ; while(1){ char ch = getchar(); if(ch == EOF) break ; content[i] = ch ; ++i ; } operation_status = write_to_file(username,password,pFile,offset,content) ; } else if(!strcmp(command,"quit")){ printf("INFO: Got the quit command\n"); printf("Program terminating\n"); break; } else{ printf("ERROR: Unknown command %s\n",command); printf("INFO: Ignoring command\n") ; } if(operation_status == ERROR) printf("Operation %s failed\n",command) ; } return 0; }
C
#include<stdio.h> #include<string.h> union per { int a; char buf[32]; char c; }; int main(void) { //联合体大小 printf("sizeof(union) = %ld\n", sizeof(union per)); union per a; a.a = 44; strcpy(a.buf, "CHINA"); //a.c = 'Y'; printf("%d\n", a.a); printf("%s\n", a.buf); //printf("%c\n", a.c); return 0; }
C
/* ************************************************************************** */ /* */ /* ::: :::::::: */ /* ft_options.c :+: :+: :+: */ /* +:+ +:+ +:+ */ /* By: luccasim <marvin@42.fr> +#+ +:+ +#+ */ /* +#+#+#+#+#+ +#+ */ /* Created: 2016/09/12 17:01:02 by luccasim #+# #+# */ /* Updated: 2016/09/12 17:01:05 by luccasim ### ########.fr */ /* */ /* ************************************************************************** */ #include "ft_unix.h" #include "libft.h" static char *handle_sglt(char c, uint32_t act) { static uint32_t flag = 0; static uint32_t off = 0; static char sglt[OPT_BUF_SIZE]; if (act == 0) { flag = 0; off = 0; ft_bzero(sglt, OPT_BUF_SIZE); } if (act == 1) { if (off == OPT_BUF_SIZE) { ft_error("Option SGLT", "Buffer_size is full"); return (sglt); } sglt[off++] = c; flag = 1; } if (act == 3) return ((flag) ? sglt : NULL); return (sglt); } static int options_loop(char *str, char *option, char *buf, uint32_t *flag) { if (*str != '-' || !option) return (SUCCESS); while (*str) { if (*str == '-') str++; if (!*str || !ft_strchr(option, *str) || *flag) return (ft_error(str, "illegal option")); else { if (ft_strchr(buf, *str) == NULL) handle_sglt(*str, 1); } ++str; } return (-1); } static int number_arg(int32_t nbre_arg, int32_t size) { if (size == 0) return (nbre_arg); if (size < 0) { if (nbre_arg > ABS(size)) return (PERROR("Too much arguments")); } else { if (nbre_arg != size) { ft_fprintf(2, "You have [{r:%i}/{g:%i}] args\n", nbre_arg, size); return (FAIL); } } return (nbre_arg); } char *ft_options_sglt(void) { return (handle_sglt(0, 3)); } int ft_options(char ***arg, char *opt, int32_t size) { char **av; uint32_t nbre_arg; int32_t res; handle_sglt(0, 0); av = *arg; nbre_arg = 0; av++; while (*av) { res = options_loop(*av, opt, handle_sglt(0, 4), &nbre_arg); if (res == FAIL) return (FAIL); else if (res < 0) ++av; else { if (!nbre_arg) *arg = av; ++nbre_arg; ++av; } } return (number_arg(++nbre_arg, size)); }
C
#include <stdio.h> #include <conio.h> #define n 10 int main() { int i, j, b[n+1][n+1]; for(i=1;i<=n;i++) { b[1][i]=i; } for(i=2;i<=n;i++) { for(j=2;j<=n;j++) { b[i][j]=b[i-1][j-1]; } b[i][1]=b[i-1][n]; } for(i=1;i<=n;i++) { for(j=1;j<=n;j++) { gotoxy(j*3+15,i*2+3); printf("%d", b[i][j]); } } return 0; }