text
string
size
int64
token_count
int64
# This file is part of Pynguin. # # Pynguin is free software: you can redistribute it and/or modify # it under the terms of the GNU Lesser General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Pynguin is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public License # along with Pynguin. If not, see <https://www.gnu.org/licenses/>. """An executor that executes a test under the inspection of the MonkeyType tool.""" import contextlib import logging import os import sys from typing import Any, Dict, Iterable, List, Optional import astor from monkeytype.config import DefaultConfig from monkeytype.db.base import CallTraceStore, CallTraceThunk from monkeytype.encoding import CallTraceRow, serialize_traces from monkeytype.tracing import CallTrace, CallTraceLogger, CallTracer import pynguin.configuration as config import pynguin.testcase.execution.executioncontext as ctx import pynguin.testcase.testcase as tc class _MonkeyTypeCallTraceStore(CallTraceStore): def __init__(self): self._values: Dict[str, Any] = {} def add(self, traces: Iterable[CallTrace]) -> None: for row in serialize_traces(traces): self._values[row.module] = ( row.qualname, row.arg_types, row.return_type, row.yield_type, ) def filter( self, module: str, qualname_prefix: Optional[str] = None, limit: int = 2000 ) -> List[CallTraceThunk]: result: List[CallTraceThunk] = [] for stored_module, row in self._values.items(): is_qualname = qualname_prefix is not None and qualname_prefix in row[0] if stored_module == module or is_qualname: result.append( CallTraceRow( module=module, qualname=row[0], arg_types=row[1], return_type=row[2], yield_type=row[3], ) ) return result if len(result) < limit else result[:limit] @classmethod def make_store(cls, connection_string: str) -> "CallTraceStore": return cls() def list_modules(self) -> List[str]: return [k for k, _ in self._values.items()] class _MonkeyTypeCallTraceLogger(CallTraceLogger): def __init__(self) -> None: self._traces: List[CallTrace] = [] def log(self, trace: CallTrace) -> None: self._traces.append(trace) @property def traces(self) -> List[CallTrace]: """Provides the collected traces""" return self._traces class _MonkeyTypeConfig(DefaultConfig): def trace_store(self) -> CallTraceStore: return _MonkeyTypeCallTraceStore() def trace_logger(self) -> CallTraceLogger: return _MonkeyTypeCallTraceLogger() # pylint:disable=too-few-public-methods class MonkeyTypeExecutor: """An executor that executes a test under the inspection of the MonkeyType tool.""" _logger = logging.getLogger(__name__) def __init__(self): """""" self._config = _MonkeyTypeConfig() self._tracer = CallTracer( logger=self._config.trace_logger(), code_filter=self._config.code_filter(), sample_rate=self._config.sample_rate(), ) self._call_traces: List[CallTrace] = [] def execute(self, test_cases: List[tc.TestCase]) -> List[CallTrace]: """Execute the given test cases.""" with open(os.devnull, mode="w") as null_file: with contextlib.redirect_stdout(null_file): for test_case in test_cases: exec_ctx = ctx.ExecutionContext(test_case) self._execute_ast_nodes(exec_ctx) self._filter_and_append_call_traces() return self._call_traces def _execute_ast_nodes(self, exec_ctx: ctx.ExecutionContext): for node in exec_ctx.executable_nodes(): try: if self._logger.isEnabledFor(logging.DEBUG): self._logger.debug("Executing %s", astor.to_source(node)) code = compile(node, "<ast>", "exec") sys.setprofile(self._tracer) # pylint: disable=exec-used exec(code, exec_ctx.global_namespace, exec_ctx.local_namespace) # nosec except BaseException as err: # pylint: disable=broad-except failed_stmt = astor.to_source(node) self._logger.info( "Fatal! Failed to execute statement with MonkeyType\n%s%s", failed_stmt, err.args, ) break finally: sys.setprofile(None) def _filter_and_append_call_traces(self) -> None: assert isinstance(self._tracer.logger, _MonkeyTypeCallTraceLogger) module_name = config.INSTANCE.module_name for trace in self._tracer.logger.traces: func_name = trace.funcname if func_name.startswith(module_name): self._call_traces.append(trace)
5,434
1,564
"Test history entries for migrated, obsolete fields" from datetime import ( time, timedelta, ) from decimal import Decimal from typing import ( Any, Dict, ) from django.contrib.auth.models import User from django.db import models from wicked_historian.usersmuggler import usersmuggler from wicked_historian.utils import FieldDescription from testapp.factories import BookFactory from testapp.models import ( Author, Book, BookEditHistory, Language, OBSOLETE_BOOK_FIELD_CHOICES, ) from .base import FreezeTimeTestCase class GettingHistoryEntriesForChangedFieldsTestCase(FreezeTimeTestCase): UNKNOWN_FIELD_ID = 'unknown_field_id' def setUp(self): super().setUp() # test languages self.languages = { 'english': Language.objects.create(name='english'), 'polish': Language.objects.create(name='polish'), } # test authors self.authors = { 'william_shakespeare': Author.objects.create(name='William Shakespeare'), 'john_paul_ii': Author.objects.create(name='John Paul II'), 'nostradamus': Author.objects.create(name='Nostradamus'), } self.user = User.objects.create(username='john.smith') with usersmuggler.set_user(self.user): self.book = BookFactory( # type: Book title='Macbeth', issue_year=1603, language=self.languages['english'], has_pictures=False, literary_period=2, date_of_publication=(self.frozen_time + timedelta(days=1)).date(), moment_of_appearance_on_torrents=self.frozen_time + timedelta(hours=1), ebook_length=timedelta(days=1, hours=3, minutes=12, seconds=7), number_of_downloads_on_torrents=1223372036854775808, encrypted_book=b'some_data', cash_lost_because_of_piracy=Decimal('666666666.66'), plain_text='foo', first_download_hour=time(hour=1), ) self.book.authors.set([self.authors['william_shakespeare']]) self.book = Book.objects.get(pk=self.book.pk) # just to reset any instance attributes used for creating history self.field_choices_by_name = {description.name: description for description in BookEditHistory.FIELDS_DESCRIPTIONS} self.obsolete_field_by_name = {description.name: description for description in OBSOLETE_BOOK_FIELD_CHOICES} BookEditHistory.objects.all().delete() def test_unknown_field(self): self.create_fake_history_entry( self.UNKNOWN_FIELD_ID, old_value=1603, new_value=2018, ) with self.assertRaises(BookEditHistory.UnknownFieldException): BookEditHistory.get_for(self.book) def test_deleted_field_with_choices(self): self.create_fake_history_entry( self.obsolete_field_by_name['age'].id, old_value=1, new_value=2, ) history_entry = self.get_last_history_entry(self.book) self.assertDictEqual(history_entry, { 'change_date': self.frozen_time, 'user': self.user, 'field_verbose_name': 'age', 'old_value': 'XV', 'new_value': 'XIX', }) def test_deleted_char_field(self): self.create_fake_history_entry( self.obsolete_field_by_name['description'].id, old_value='abc', new_value='xyz', ) history_entry = self.get_last_history_entry(self.book) self.assertDictEqual(history_entry, { 'change_date': self.frozen_time, 'user': self.user, 'field_verbose_name': 'description', 'old_value': 'abc', 'new_value': 'xyz', }) def test_deleted_foreign_key_field(self): william_shakespeare = {'pk': self.authors['william_shakespeare'].pk, 'str': str(self.authors['william_shakespeare'])} john_paul_ii = {'pk': self.authors['john_paul_ii'].pk, 'str': str(self.authors['john_paul_ii'])} self.create_fake_history_entry( self.obsolete_field_by_name['author'].id, old_value=william_shakespeare, new_value=john_paul_ii, ) history_entry = self.get_last_history_entry(self.book) self.assertDictEqual(history_entry, { 'change_date': self.frozen_time, 'user': self.user, 'field_verbose_name': 'author', 'old_value': william_shakespeare, 'new_value': john_paul_ii, }) def test_deleted_many_to_many_field(self): english = {'pk': self.languages['english'].pk, 'str': str(self.languages['english'])} polish = {'pk': self.languages['polish'].pk, 'str': str(self.languages['polish'])} self.create_fake_history_entry( self.obsolete_field_by_name['languages'].id, old_value=[english], new_value=[english, polish] ) history_entry = self.get_last_history_entry(self.book) self.assertDictEqual(history_entry, { 'change_date': self.frozen_time, 'user': self.user, 'field_verbose_name': 'languages', 'old_value': [english], 'new_value': [english, polish] }) def test_different_id_for_different_type_with_the_same_name(self): first = FieldDescription('description', models.TextField()) second = FieldDescription('description', models.CharField()) third = FieldDescription('description', models.CharField(max_length=50)) self.assertNotEqual(first.id, second.id) self.assertEqual(second.id, third.id) def test_changed_from_string_to_int(self): self.create_fake_history_entry( self.field_choices_by_name['issue_year'].id, old_value='MDCIII', new_value='MMXVIII' ) history_entry = self.get_last_history_entry(self.book) self.assertDictEqual(history_entry, { 'change_date': self.frozen_time, 'user': self.user, 'field_verbose_name': 'issue year', 'old_value': 'MDCIII', 'new_value': 'MMXVIII' }) def test_presence_of_field_names_on_fields_descriptions_list(self): field_names = {description.name for description in BookEditHistory.FIELDS_DESCRIPTIONS} self.assertEqual(field_names, { 'age', 'author', 'authors', 'book_shelf_slot', 'cash_lost_because_of_piracy', 'date_of_publication', 'description', 'ebook_length', 'encrypted_book', 'first_download_hour', 'has_pictures', 'id', 'issue_number', 'issue_year', 'language', 'languages', 'literary_period', 'moment_of_appearance_on_torrents', 'number_of_downloads_on_torrents', 'number_of_pages', 'plain_text', 'text_as_pdf', 'title', 'pirates', 'printers', 'chapter_set', }) @staticmethod def get_last_history_entry(book: Book) -> Dict[str, Any]: return BookEditHistory.get_for(book)[0] def create_fake_history_entry(self, field: str, old_value: Any, new_value: Any) -> BookEditHistory: return BookEditHistory.objects.create(**{ 'model': self.book, 'user': self.user, 'change_date': self.frozen_time, 'field': field, 'old_value': old_value, 'new_value': new_value })
7,778
2,428
from UdonPie import UnityEngine from UdonPie.Undefined import * class HideFlags: def __new__(cls, arg1=None): ''' :returns: HideFlags :rtype: UnityEngine.HideFlags ''' pass
219
71
# Generated by Django 2.2.5 on 2019-11-01 06:22 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('solicitudes', '0005_auto_20191101_0115'), ] operations = [ migrations.RemoveField( model_name='solicitud', name='tipo_ejecucion', ), migrations.AddField( model_name='solicitud', name='tipo_ejecucion', field=models.ManyToManyField(to='solicitudes.TipoEjecucion'), ), ]
536
190
""" #################################################################################################### # Copyright Info : Copyright (c) Davar Lab @ Hikvision Research Institute. All rights reserved. # Filename : tp_head.py # Abstract : Text Perceptron head structure, mainly including losses for segmentation part and regression part # Current Version: 1.0.0 # Author : Liang Qiao # Date : 2020-05-31 # Modified Date : 2020-11-26 # Modified by : inusheng # Comments : Code and comment standardized ###################################################################################################### """ import numpy as np import torch import torch.nn as nn from mmdet.models.builder import build_loss from mmdet.models.registry import HEADS from mmdet.ops import ConvModule from mmdet.core import force_fp32, auto_fp16 def make_one_hot(input_tensor, num_classes): """ Description: convert a feature map of shape [N, 1, H, W] into its one-hot encoding version of shape [N, C, H, W], where C is the number of classes. Arguments: input_tensor: input tensor, [N, 1, *] num_classes : the number of classes of feature maps Returns: one-hot encoding of input tensor, [N, num_classes, *] """ input_tensor = input_tensor[:, np.newaxis, ::] shape = np.array(input_tensor.shape) shape[1] = num_classes shape = tuple(shape) result = torch.zeros(shape) result = result.scatter_(1, input_tensor.cpu(), 1).to(input_tensor.device) return result @HEADS.register_module class TPHead(nn.Module): """ Description: Text Perceptron head structure, this head is used for further feature extraction and generate loss wrt ground-truth labels. Arguments: in_channels : the number of channels of input feature maps conv_out_channels: the number of channels of output feature maps conv_cfg : configuration of conv filters norm_cfg : configuration of normalization loss_seg : segmentation loss loss_reg_head : regression loss of head area loss_reg_tail : regression loss of tail area loss_reg_bond : regression loss of center area """ def __init__(self, in_channels=256, conv_out_channels=256, conv_cfg=None, norm_cfg=None, loss_seg=None, loss_reg_head=None, loss_reg_bond=None, loss_reg_tail=None, ): super().__init__() self.in_channels = in_channels self.conv_out_channels = conv_out_channels self.conv_cfg = conv_cfg self.norm_cfg = norm_cfg assert loss_seg is not None self.loss_seg = build_loss(loss_seg) self.loss_reg_head = loss_reg_head self.loss_reg_bond = loss_reg_bond self.loss_reg_tail = loss_reg_tail if loss_reg_head is not None: self.loss_reg_head = build_loss(loss_reg_head) if loss_reg_tail is not None: self.loss_reg_tail = build_loss(loss_reg_tail) if loss_reg_bond is not None: self.loss_reg_bond = build_loss(loss_reg_bond) # define extra conv filters for long text feature extraction self.P4_conv = ConvModule(self.in_channels, self.conv_out_channels, kernel_size=3, stride=1, padding=1, conv_cfg=self.conv_cfg, norm_cfg=self.norm_cfg) self.P4_1x7_conv = ConvModule(self.conv_out_channels, self.conv_out_channels, kernel_size=(1, 7), stride=(1, 1), padding=(0, 3), conv_cfg=self.conv_cfg, norm_cfg=self.norm_cfg) self.channel4_1x7_conv = ConvModule(self.in_channels, self.conv_out_channels, kernel_size=(1, 7), stride=(1, 1), padding=(0, 3), conv_cfg=self.conv_cfg, norm_cfg=self.norm_cfg) self.rpn4 = ConvModule(self.conv_out_channels, self.conv_out_channels, 3, padding=1, conv_cfg=self.conv_cfg, norm_cfg=self.norm_cfg) self.seg_branch_conv = ConvModule(self.conv_out_channels, self.conv_out_channels, 3, padding=1, conv_cfg=self.conv_cfg, norm_cfg=self.norm_cfg) self.reg_branch_conv = ConvModule(self.conv_out_channels, self.conv_out_channels, 3, padding=1, conv_cfg=self.conv_cfg, norm_cfg=self.norm_cfg) self.conv_logits_text = nn.Conv2d(self.conv_out_channels, 1, 1) self.conv_logits_head = nn.Conv2d(self.conv_out_channels, 1, 1) self.conv_logits_tail = nn.Conv2d(self.conv_out_channels, 1, 1) self.conv_logits_bond = nn.Conv2d(self.conv_out_channels, 1, 1) self.conv_regress_head = nn.Conv2d(self.conv_out_channels, 4, 1) self.conv_regress_tail = nn.Conv2d(self.conv_out_channels, 4, 1) self.conv_regress_bond = nn.Conv2d(self.conv_out_channels, 4, 1) self.relu = nn.ReLU(inplace=True) def init_weights(self): """ Description: network parameters initialization """ for module in [self.conv_logits_text, self.conv_logits_head, self.conv_logits_tail, self.conv_logits_bond, self.conv_regress_bond,self.conv_regress_tail, self.conv_regress_head]: if module is None: continue nn.init.xavier_normal_(module.weight) nn.init.constant_(module.bias, 0) @auto_fp16() def forward(self, x): """ Description: network forward pass """ # compute loss from 4x feature maps only # you can add other supervisions on feature maps in terms of your compute resources x_4 = x[0] # extract long text feature x_p4 = self.P4_conv(x_4) x_4_1x7 = self.channel4_1x7_conv(x_4) x_p4_1x7 = self.P4_1x7_conv(x_p4) x_4 = x_p4_1x7 + x_p4 + x_4_1x7 x_4 = self.rpn4(x_4) # generate predicted segmentation map x_4_seg = self.seg_branch_conv(x_4) score_text_pred = self.conv_logits_text(x_4_seg) # segmentation map for center area [N, 1, H, W] score_head_pred = self.conv_logits_head(x_4_seg) # segmentation map for head area [N, 1, H, W] score_tail_pred = self.conv_logits_tail(x_4_seg) # segmentation map for tail area [N, 1, H, W] score_bond_pred = self.conv_logits_bond(x_4_seg) # segmentation map for top and bottom boundaries area [N, 1, H, W] # generate predicted regression map x4_reg = self.seg_branch_conv(x_4) reg_head_pred = self.conv_regress_head(x4_reg) # predicted regression map for head corner points [N, 4, H, W] reg_tail_pred = self.conv_regress_tail(x4_reg) # predicted regression map for tail corner points [N, 4, H, W] reg_bond_pred = self.conv_regress_bond(x4_reg) # predicted regression map for center area [N, 4, H, W] return score_text_pred, score_head_pred, score_tail_pred, score_bond_pred, reg_head_pred, reg_tail_pred, reg_bond_pred def get_target(self, gt_masks): """ Description: generate ground-truth labels Arguments: gt_masks : input ground-truth labels gt_mask:[:,0] : gt_score_map gt_mask:[:,1] : gt_score_map_mask, 1 Care / 0 Not Care gt_mask:[:,2:6] : gt_geo_map_head gt_mask:[:,6:10] : gt_geo_map_head_weight gt_mask:[:,10:14]: gt_geo_map_tail gt_mask:[:,14:18]: gt_geo_map_tail_weight gt_mask:[:,18:22]: gt_geo_map_bond gt_mask:[:,22:26]: gt_geo_map_bond_weight Returns: score_text_target : one-hot encoding of segmentation map ground-truth of center area of shape [N, 1, H, W] score_head_target : one-hot encoding of segmentation map ground-truth of head area of shape [N, 1, H, W] score_tail_target : one-hot encoding of segmentation map ground-truth of tail area of shape [N, 1, H, W] score_bond_target : one-hot encoding of segmentation map ground-truth of top and bottom boundaries, [N, 1, H, W] score_map_masks_target : mask of segmentation map ground-truth, [N, 1, H, W] geo_head_target : ground-truth of head corner points regression, [N, 4, H, W] geo_head_weights_target: weights of ground-truth of head regression, [N, 4, H, W] geo_tail_target : gound-truth of tail corner points regression, [N, 4, H, W] geo_tail_weights_target: weights of ground-truth of tail regression, [N, 4, H, W] geo_bond_target : ground-truth of top and bottom boundaries regression, [N, 4, H, W] geo_bond_weights_target: weights of ground-truth of top and bottom boundaries regression, [N, 4, H, W] """ assert len(gt_masks[0]) == 26 score_map_target = gt_masks[:, 0, :, :].long() score_map_masks_target = gt_masks[:, 1, :, :].float() geo_head_target = gt_masks[:, 2:6, :, :] geo_head_weights_target = gt_masks[:, 6:10, :, :] geo_tail_target = gt_masks[:, 10:14, :, :] geo_tail_weights_target = gt_masks[:, 14:18, :, :] geo_bond_target = gt_masks[:, 18:22, :, :] geo_bond_weights_target = gt_masks[:, 22:, :, :] # convert into one-hot encodings score_map_one_hot = make_one_hot(score_map_target, 5).float() score_text_target = score_map_one_hot[:, 1: 2, :, :] score_head_target = score_map_one_hot[:, 2: 3, :, :] score_tail_target = score_map_one_hot[:, 3: 4, :, :] score_bond_target = score_map_one_hot[:, 4: 5, :, :] return score_text_target, score_head_target, score_tail_target, score_bond_target, score_map_masks_target,\ geo_head_target, geo_head_weights_target, geo_tail_target, geo_tail_weights_target, geo_bond_target,\ geo_bond_weights_target @force_fp32(apply_to=('mask_pred',)) def loss(self, mask_pred, mask_targets): score_text_pred, score_head_pred, score_tail_pred, score_bond_pred, reg_head_pred, reg_tail_pred, reg_bond_pred = mask_pred score_text_target, score_head_target, score_tail_target, score_bond_target, score_map_masks_target, \ geo_head_target, geo_head_weights_target, geo_tail_target, geo_tail_weights_target, geo_bond_target, \ geo_bond_weights_target = mask_targets loss = dict() # compute segmentation loss loss["loss_seg_text"] = self.loss_seg(score_text_pred, score_text_target, weight=score_map_masks_target) loss["loss_seg_head"] = self.loss_seg(score_head_pred, score_head_target, weight=score_map_masks_target) loss["loss_seg_tail"] = self.loss_seg(score_tail_pred, score_tail_target, weight=score_map_masks_target) loss["loss_seg_bond"] = self.loss_seg(score_bond_pred, score_bond_target, weight=score_map_masks_target) # compute regression loss if self.loss_reg_head is not None: loss_reg_head = self.loss_reg_head(reg_head_pred, geo_head_target, weight=geo_head_weights_target) loss["loss_reg_head"] = loss_reg_head if self.loss_reg_tail is not None: loss_reg_tail = self.loss_reg_tail(reg_tail_pred, geo_tail_target, weight=geo_tail_weights_target) loss["loss_reg_tail"] = loss_reg_tail if self.loss_reg_bond is not None: loss_reg_bond = self.loss_reg_bond(reg_bond_pred, geo_bond_target, weight=geo_bond_weights_target) loss["loss_reg_bond"] = loss_reg_bond return loss
12,639
4,206
import wx, wx.lib.newevent import wx.lib.ogl as ogl from myhdl import Signal, always, intbv from MyHDLSim.sequential import ClkDriver # OGL object to draw a signal class SignalOGLShape(ogl.CompositeShape): """ This shape is used exclusively to contruct the SIGNAL main shape. The shape is initially based within an 80x80 square, centered """ def __init__(self, canvas, label): ogl.CompositeShape.__init__(self) self.SetCanvas(canvas) # Adds the 3 layed boxes to the Signal shape outterBox = ogl.RectangleShape(80, 80) self._innerBox = ogl.RectangleShape(60, 60) labelBox = ogl.RectangleShape(20,30) # Sets inital color brushes for boxes brush = wx.Brush("WHITE", wx.SOLID) outterBox.SetBrush(brush) self._innerBox.SetBrush(brush) labelBox.SetBrush(wx.Brush("MEDIUM TURQUOISE", wx.SOLID)) labelBox.AddText(label) self.AddChild(outterBox) self.AddChild(self._innerBox) self.AddChild(labelBox) constraint = ogl.Constraint(ogl.CONSTRAINT_MIDALIGNED_TOP, outterBox, [labelBox]) constraint2 = ogl.Constraint(ogl.CONSTRAINT_CENTRED_BOTH, outterBox, [self._innerBox]) self.AddConstraint(constraint) self.AddConstraint(constraint2) self.Recompute() # If we don't do this, the shapes will be able to move on their # own, instead of moving the composite outterBox.SetDraggable(False) self._innerBox.SetDraggable(False) labelBox.SetDraggable(False) # If we don't do this the shape will take all left-clicks for itself outterBox.SetSensitivityFilter(0) # Manual override for normal function: Allows us to easily change the inner box color def SetBrush(self, brush): self._innerBox.SetBrush(brush) class SignalWrapper: """ This class wraps a MyHDL.Signal object Handles wx event listening, toggling, and getting an object to draw """ def __init__(self, canvas, signal = None, width = 1, label = ''): """ @todo assert that width >= 1 """ self._label = label if (width == 1): self._signal = Signal(signal) else: self._signal = Signal(intbv(signal)[width:]) self._shape = ogl.RectangleShape(10,10) self._shape.AddText(str(self._signal.val)) def SetSwitch(self, canvas, label): """ Setting a label, need to recreate shape """ self._label = label self._shape = SignalOGLShape(canvas, label) self._shape.AddText(str(self._signal.val)) def SetProbe(self, canvas, a, label): """ Sets signal as a probe, need to recreate shape """ self._label = label self._signal = a._signal self._shape = SignalOGLShape(canvas, label) self._shape.AddText(str(self._signal.val)) canvas.ConnectWires(self._shape, a.GetShape()) def SetInputProbe(self, canvas, a, label): """ Sets signal as a probe, need to recreate shape @todo May be an output probe as well, name could change """ self._label = label self._signal = a._signal canvas.ConnectWires(self._shape, a.GetShape()) def SetClockDriver(self, canvas, label, period = 20): """ Setting as a clock, need to recreate shape """ self._label = label self._shape = SignalOGLShape(canvas, label) self._shape.AddText("Clock") self._inst = ClkDriver(self._signal, period) def GetSignal(self): """ Get the underlying object """ return self._signal def Toggle(self): """ Toggle the signal value If it was unitialized, just assert it """ if (len(self._signal) > 1): if (self._signal + 1 == self._signal.max): self._signal.next = 0 else: self._signal.next = self._signal + 1 elif (self._signal == None): self._signal.next = True else: self._signal.next = not self._signal def Update(self): """ This visually refreshes a Signal Caller must know when Signal has changed """ self._shape.ClearText() if self._shape.GetBrush() != wx.TRANSPARENT_BRUSH: # For now we are printing TEXT "True", "False", or "None" # Also setting inner box color (White: False; Black: True; Grey: None) if (self._signal.val == None): self._shape.AddText(str(self._signal.val)) self._shape.SetBrush(wx.Brush("GREY", wx.SOLID)) self._shape.SetTextColour("BLACK") elif (len(self._signal) > 1): self._shape.AddText(bin(self._signal.val)) self._shape.SetBrush(wx.Brush("WHITE", wx.SOLID)) self._shape.SetTextColour("BLACK") elif (bool(self._signal.val) == False): self._shape.AddText(str(bool(self._signal.val))) self._shape.SetBrush(wx.Brush("WHITE", wx.SOLID)) self._shape.SetTextColour("BLACK") else: self._shape.AddText(str(bool(self._signal.val))) self._shape.SetBrush(wx.Brush("BLACK", wx.SOLID)) self._shape.SetTextColour("WHITE") def SetX(self, x): self._x = x def SetY(self, y): self._y = y def GetShape(self): return self._shape def GetInstance(self): """ Get instance for simulator """ return self._inst
5,757
1,740
import json import sys from frankenbot.bot import Bot from frankenbot.console_chat_interface import ConsoleChatInterface from frankenbot.persistence.json.json_unserializer import JSONUnserializer bot_def = "bot_def/restaurantsearch.json" unserializer = JSONUnserializer() #simpleResponseGenerator object bot = unserializer.load_from_file(bot_def) chat = ConsoleChatInterface(bot) chat.start_chat() # 'show me chines restaurants in the north' # ________________________________ # from rasa_nlu.training_data import load_data # from rasa_nlu.config import RasaNLUModelConfig # from rasa_nlu.model import Trainer, Interpreter # from rasa_nlu import config # # train_data = load_data('../intent_categorization_example_rasa/rasa_dataset.json') # trainer = Trainer(config.load("../intent_categorization_example_rasa/config_spacy.yaml")) # # # train the model and save it to a folder # trainer.train(train_data) # model_directory = trainer.persist('../intent_categorization_example_rasa/projects/') # # # load the model in the interpreter # interpreter = Interpreter.load(model_directory) # # # # run two utterances through the interpreter # def nlu(utterance): # nlu_result = interpreter.parse(utterance) # print("utterance: " + utterance) # print("nlu resutl: " + str(nlu_result["intent"])) # # # nlu(u"i'm looking for a place in the north of town") # nlu(u"Good Morning World") # nlu(u"vegg")
1,403
460
#!/usr/bin/env python # # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # import ipaddress def set_bit_at_position(position, data): mask = 1 << position return data | mask def change_format_input_string(original_input): byte_array_str_list = str(original_input) byte_array_input_string = '' count = 0 for value in original_input: if(count != 0): byte_array_input_string += ':' append_str = value[2:] # if only one digit is present, add another 0 if(len(append_str) == 1): append_str = '0' + append_str byte_array_input_string += append_str count += 1 return byte_array_input_string def format_display_string(line): display_string = '' count = 0 for char in line: if(count % 2 == 0) and count != 0: display_string += ':' display_string += char count += 1 return display_string def convert_to_chan_num_list(line): values = line.split(':') total_num_channels = 129 hex_string = '' binary_string = '' count = 0 for v in values: if(' ' in v): v = v.split(' ')[0] # Step 2: Convert the string to a hex number hex_num = int(v, 16) # Step 3: Invert the binary values if needed (we do not use this feature) new_value_first = 0 new_value_last = 0 inverted_hex_num = hex_num # inverted_hex_num = hex_num ^ 0b11111111 new_value = inverted_hex_num # Step 4: Combine the inverted values hex_string += str(hex(new_value))[2:] string_to_reverse = str('{0:08b}'.format(new_value)) reversedstring=''.join(reversed(string_to_reverse)) binary_string += reversedstring channel_num = 0 channel_list = list() # 1110 1111 inverse is 0001 0000 # Step 5: Loop through binary string and add channels for c in (binary_string): if(channel_num == total_num_channels): break if(c == '1'): # add this channel channel_list.append(channel_num) channel_num+=1 channel_list_display_string = '' lst = channel_list result = str(lst[0]) end = None for index, num in enumerate(lst[1:]): if num - 1 == lst[index]: # the slice shifts the index by 1 for us end = str(num) else: if end: result += '-' + end end = None result += ':' + str(num) # Catch the last term if end: result += '-' + str(num) channel_list_display_string = result return channel_list_display_string def convert_to_bitmask(input_line='0-128'): included_ch_list = (input_line.split(':')) # 0-10, 15-20 etc real_channel_list = list() for each_entry in included_ch_list: start_channel = int(each_entry.split('-')[0]) # 0 try: end_channel = int(each_entry.split('-')[1]) # 10 except Exception: # in the case of no end channel specified, it means only one channel selected end_channel = start_channel pass for current_channel in range(start_channel, end_channel + 1): real_channel_list.append(current_channel) count = 0 channel_mask_byte = 0 channel_mask_byte_inverted = 0 eight_multiple = 8 # convert channel list from right to left while(count in range(0, len(real_channel_list))): if(count == 129): break channel_mask_byte = set_bit_at_position(real_channel_list[count], channel_mask_byte) if(count+1 == len(real_channel_list)): break if(int(real_channel_list[count+1]) >= eight_multiple): eight_multiple += 8 count += 1 final_channel = int(real_channel_list[-1]) mask = 0b1 channel_mask_byte_inverted = channel_mask_byte # increment by 1 to include the last channel final_channel += 1 while(final_channel % 8 != 0): # make sure you have an even number of bytes final_channel += 1 # invert every single bit """for bit in range(0, final_channel): channel_mask_byte_inverted ^= (mask) # shift the mask to the left by 1 mask = mask << 1""" value = (hex(channel_mask_byte_inverted)[2:].strip()) # make sure 17 byte pairs are used value = value.zfill(34) channel_mask_correct_endian = value if len(str(value)) > 34: # if length is greater than 34, only use the first 17 bytes value = value[0:34] channel_mask_inverted_hex = bytearray.fromhex(value) channel_mask_inverted_hex.reverse() channel_mask_correct_endian = channel_mask_inverted_hex.hex() return channel_mask_correct_endian, channel_mask_inverted_hex # Helper util function to parse received PROP_ROUTING_TABLE_UPDATE property info def parse_routingtable_property(propRoutingTableAddrInfo): """ Internal utility function to convert Routing Table Addr Info into structure Returns changed_type and dictionary entry """ routingTableEntry = {} update_type = -1 dst_ipv6_addr = "" try: # 2 bytes = length of structure; 1 byte = change type; 16 bytes Dest IPv6 address; # 1 byte = prefix len ; 16 bytes = next hop IPv6 address; 4 bytes = lifetime routingTableStruct = propRoutingTableAddrInfo[0:len(propRoutingTableAddrInfo)] changed_info = routingTableStruct[2:3] # C dst_addr = routingTableStruct[3:19] # 6 prefix_length = routingTableStruct[19:20] # C next_hop_addr = routingTableStruct[20:36] # 6 lifetime = routingTableStruct[36:40] # L update_type = int.from_bytes(changed_info, "little", signed=False) dst_ipv6_addr = ipaddress.IPv6Address(dst_addr) routingTableEntry["prefixLen"] = int.from_bytes(prefix_length, "little", signed=False) routingTableEntry["nextHopAddr"] = ipaddress.IPv6Address(next_hop_addr) routingTableEntry["lifetime"] = int.from_bytes(lifetime, "little", signed=False) except Exception as es: print("Exception raised during Parsing Routing Table") print(es) return(update_type, dst_ipv6_addr, routingTableEntry)
6,801
2,183
from typing import TYPE_CHECKING, Optional from ModularChess.movements.Movement import Movement, MovementData if TYPE_CHECKING: from ModularChess.pieces.Piece import Piece from ModularChess.utils.Position import Position class EnPassant(Movement): def __init__(self, piece: "Piece", new_position: "Position", captured_piece: "Piece", is_valid_move: Optional[bool] = None): moves = [MovementData(captured_piece, captured_piece.position, None), MovementData(piece, piece.position, new_position)] super().__init__(moves, piece=piece, destination=new_position, is_valid_move=is_valid_move) def __str__(self) -> str: if self.piece.board.dimensions == 2: move = self.piece.abbreviation() same_pieces = self.piece.board.pieces[self.player][type(self.piece)] if self.movements[-1].destination_position is not None and \ len([piece for piece in same_pieces if piece.check_piece_valid_move(self.movements[-1].destination_position)]) \ > 1: move += str(self.movements[-1].initial_position) if len(self) == 2: # Capture move += "x" return move + str(self.movements[-1].destination_position) + ("+" if self.is_check else "") return super().__str__()
1,383
422
# -*- coding: utf-8 -*- """ julabo.py Contains Julabo temperature control see documentation http://www.julabo.com/sites/default/files/downloads/manuals/french/19524837-V2.pdf at section 10.2. :copyright: (c) 2015 by Maxime DAUPHIN :license: MIT, see LICENSE for details """ import serial import time from .pytemperaturectrl import TemperatureControl class Julabo(TemperatureControl): """Julabo Temperature control implementation""" # see Julabo doc MIN_TIME_INTERVAL = 0.250 def __init__(self, *args, **kwargs): super(TemperatureControl, self).__init__() self.serial = None def checkIfOpen(self): """ Check if serial port is open """ if self.serial == None: raise Exception("Please call open function before all communication") def open(self, com_port, baudrate=4800): """ Open serial communication""" self.serial = serial.Serial(com_port, baudrate=baudrate, bytesize=serial.SEVENBITS, parity=serial.PARITY_EVEN, stopbits=serial.STOPBITS_ONE, timeout=1, xonxoff=False, rtscts=True, dsrdtr=False) def close(self): """ Close serial communication""" self.checkIfOpen() if self.serial != None : self.serial.close() def power(self, on): """set power to on or off""" self.checkIfOpen() time.sleep(self.MIN_TIME_INTERVAL) value = 1 if on else 0 self.serial.write(b'f"out_mode_05 {value}\r\n"') def getVersion(self): """retrieve engine version""" self.checkIfOpen() time.sleep(self.MIN_TIME_INTERVAL) self.serial.write(b'version\r\n') return self.serial.readline() def getStatus(self): """retrieve engine status""" self.checkIfOpen() time.sleep(self.MIN_TIME_INTERVAL) self.serial.write(b'status\r\n') return self.serial.readline() def setWorkTemperature(self, temperature_in_degree): """set setpoint temperature""" self.checkIfOpen() time.sleep(self.MIN_TIME_INTERVAL) self.serial.write(b'f"out_sp_00 {temperature_in_degree}\r\n"') def getWorkTemperature(self): """get setpoint temperature""" self.checkIfOpen() time.sleep(self.MIN_TIME_INTERVAL) self.serial.write(b'in_sp_00\r\n') return float(self.serial.readline()) def getCurrentTemperature(self): """get current tank temperature""" self.checkIfOpen() time.sleep(self.MIN_TIME_INTERVAL) self.serial.write(b'in_pv_00\r\n') return float(self.serial.readline())
2,387
978
""" Some basic matrix-related functionality. """ def cumulative2d(grid): """ >>> cumulative2d([[2, 5, 4], [3, 8, 1]]) [[0, 0, 0, 0], [0, 2, 7, 11], [0, 5, 18, 23]] """ rows = [] for row in grid: rrr = [0] last = 0 for col in row: last += col rrr.append(last) rows.append(rrr) blocks = [] last = [0]*len(rows[0]) blocks.append(last) for row in rows: last = list(map(sum, zip(last, row))) blocks.append(last) return blocks def transpose(grid): """ Switches rows and columns. >>> transpose([[1, 2, 3], [4, 5, 6]]) [[1, 4], [2, 5], [3, 6]] """ R = len(grid) C = len(grid[0]) inverted = [] for r in range(C): row = [c[r] for c in grid] inverted.append(row) return inverted def moment(array): """ >>> moment([5, 6, 7, 2, 4]) [0, 6, 14, 6, 16] """ return list(map(lambda i_v: i_v[0]*i_v[1], enumerate(array))) def moment2d(grid): """ >>> moment2d([[5, 6, 7, 2, 4]]) [[0, 6, 14, 6, 16]] """ return list(map(moment, grid))
1,143
492
from selenium import webdriver from selenium.webdriver.common.by import By from selenium.webdriver.support.ui import WebDriverWait from selenium.webdriver.support import expected_conditions as EC from lxml import etree import json class DouyuSpider: def __init__(self): """ 初始化 """ start_url = 'https://www.douyu.com/g_LOL' self.browser = webdriver.Chrome() self.browser.get(start_url) def get_one_page(self): self.browser.execute_script('window.scrollTo(0, document.body.scrollHeight)') path = '//*[@id="listAll"]/div[2]/ul/li[8]/div/a[1]/div[2]/div[2]/span' method = EC.presence_of_element_located((By.XPATH, path)) wait = WebDriverWait(self.browser, 10) # self.browser.refresh() wait.until(method, message='加载超时') self.browser.execute_script('window.scrollTo(0, document.body.scrollHeight)') html = etree.HTML(self.browser.page_source) li_list = html.xpath('//ul[@class="layout-Cover-list"]/li') li_num = len(li_list) # //*[@id="listAll"]/div[2]/ul/li[1]/div/a[1]/div[2]/div[1]/h3 title_path = '//*[@id="listAll"]/div[2]/ul/li[{}]/div/a[1]/div[2]/div[1]/h3/@title' # hot_path = '//*[@id="listAll"]/div[2]/ul/li[{}]/div/a[1]/div[2]/div[2]/h2' hot_path = '//*[@id="listAll"]/div[2]/ul/li[{}]/div/a[1]/div[2]/div[2]/span/text()' room_path = '//*[@id="listAll"]/div[2]/ul/li[{}]/div/a[1]/@href' user_path = '//*[@id="listAll"]/div[2]/ul/li[{}]/div/a[1]/div[2]/div[2]/h2/text()' items = [] item = {} for num in range(li_num): item['title'] = html.xpath(title_path.format(num+1)) # item['title'] = html.xpath(title_path.format(num+1)).get_attribute('title') item['hot'] = html.xpath(hot_path.format(num+1)) item['room_url'] = html.xpath(room_path.format(num+1)) item['user'] = html.xpath(user_path.format(num+1)) if num % 20 == 0: print(f'完成第{num+1}条数据') print(item) items.append(item) return items def fetch_one_page(self): path = '//*[@id="listAll"]/div[2]/ul/li[8]/div/a[1]/div[2]/div[2]/span' method = EC.presence_of_element_located((By.XPATH, path)) wait = WebDriverWait(self.browser, 10) # self.browser.refresh() wait.until(method, message='加载超时') self.browser.execute_script('window.scrollTo(0, document.body.scrollHeight)') self.browser.execute_script('window.scrollTo(0, document.body.scrollHeight)') li_list = self.browser.find_elements_by_xpath('//ul[@class="layout-Cover-list"]/li') li_num = len(li_list) # //*[@id="listAll"]/div[2]/ul/li[1]/div/a[1]/div[2]/div[1]/h3 title_path = '//*[@id="listAll"]/div[2]/ul/li[{}]/div/a[1]/div[2]/div[1]/h3' # hot_path = '//*[@id="listAll"]/div[2]/ul/li[{}]/div/a[1]/div[2]/div[2]/h2' hot_path = '//*[@id="listAll"]/div[2]/ul/li[{}]/div/a[1]/div[2]/div[2]/span' room_path = '//*[@id="listAll"]/div[2]/ul/li[{}]/div/a[1]' user_path = '//*[@id="listAll"]/div[2]/ul/li[{}]/div/a[1]/div[2]/div[2]/h2' items = [] for num in range(li_num): item = {} item['title'] = self.browser.find_element_by_xpath(title_path.format(num+1)).get_attribute('title') item['hot'] = self.browser.find_element_by_xpath(hot_path.format(num+1)).text item['room_url'] = self.browser.find_element_by_xpath(room_path.format(num+1)).get_attribute('href') item['user'] = self.browser.find_element_by_xpath(user_path.format(num+1)).text if num % 20 == 0: print(f'完成第{num+1}条数据') print(item) items.append(item) return items def save_content(self, items): with open('douyu.json', 'a+', encoding='utf-8') as f: for item in items: # print(item) json.dump(item, f, ensure_ascii=False) f.write('\n') def get_next_url(self, num): self.browser.execute_script('window.scrollTo(0, document.body.scrollHeight)') max_num = self.browser.find_element_by_xpath('//*[@id="listAll"]/div[2]/div/ul/li[last()-1]/a').text if num < int(max_num): self.browser.find_element_by_xpath('//*[@id="listAll"]/div[2]/div/span/span/input').clear() self.browser.find_element_by_xpath('//*[@id="listAll"]/div[2]/div/span/span/input').send_keys(num+1) self.browser.find_element_by_xpath('//*[@id="listAll"]/div[2]/div/span/span/span').click() next_flag = True if num >= int(max_num): next_flag = False return next_flag, max_num def run(self): next_flag = True num = 0 while next_flag: items = self.get_one_page() self.save_content(items) if num % 2 == 0: self.browser.implicitly_wait(5) num += 1 print('*'*10 + f'完成第{num}页' + '*'*10) next_flag, max_num = self.get_next_url(num) print(max_num) if __name__ == '__main__': dou_spider = DouyuSpider() dou_spider.run()
5,361
1,959
#!/usr/bin/env python from setuptools import setup, find_packages from codecs import open from os import path here = path.abspath(path.dirname(__file__)) # Get the long description from the README file with open(path.join(here, 'README.rst'), encoding='utf-8') as f: long_description = f.read() # Read version info from bitcoinscript/version.py version_vars = {} with open("bitcoinscript/version.py") as fp: exec(fp.read(), version_vars) version_string = version_vars['__version_string__'] setup( name='bitcoinscript', description='Bitcoin Script Debugger and Interactive Shell', long_description=long_description, version=version_string, author='fungibit', author_email='fungibit@yandex.com', url='https://github.com/fungibit/bitcoinscript', license='MIT', packages=find_packages(exclude=['tests*', 'bin']), platforms = ["POSIX", "Windows"], keywords='bitcoin, script, bitcoin-script, blockchain', )
960
314
# ___ ___ ___ ___ ___ ___ # /\ \ /\ \ /\ \ /\ \ /\ \ /\ \ # /::\ \ /::\ \ \:\ \ /::\ \ /::\ \ /::\ \ # /:/\:\ \ /:/\:\ \ \:\ \ /:/\:\ \ /:/\:\ \ /:/\:\ \ # /:/ \:\ \ /:/ \:\ \ /::\ \ /::\~\:\ \ /::\~\:\ \ /::\~\:\ \ # /:/__/ \:\__\/:/__/ \:\__\ /:/\:\__\/:/\:\ \:\__\/:/\:\ \:\__\/:/\:\ \:\__\ # \:\ \ /:/ /\:\ \ \/__//:/ \/__/\/_|::\/:/ /\:\~\:\ \/__/\:\~\:\ \/__/ # \:\ /:/ / \:\ \ /:/ / |:|::/ / \:\ \:\__\ \:\ \:\__\ # \:\/:/ / \:\ \ \/__/ |:|\/__/ \:\ \/__/ \:\ \/__/ # \::/ / \:\__\ |:| | \:\__\ \:\__\ # \/__/ \/__/ \|__| \/__/ \/__/ # # # # .----------------.----------------. # /| /| /| # / | / | / | # / | 6 / | 7 / | # / | / | / | # .----------------.----+-----------. | # /| . ---------/|----.----------/|----. # / | /| / | /| / | /| # / | / | 4 / | / | 5 / | / | # / | / | / | / | / | / | # . -------------- .----------------. |/ | # | . ---+------|----.----+------|----. | # | /| .______|___/|____.______|___/|____. # | / | / 2 | / | / 3 | / | / # | / | / | / | / | / | / # . ---+---------- . ---+---------- . | / # | |/ | |/ | |/ z # | . ----------|----.-----------|----. ^ y # | / 0 | / 1 | / | / # | / | / | / | / # | / | / | / o----> x # . -------------- . -------------- . # # # Face Refinement: # # 2_______________3 _______________ # | | | | | # ^ | | | 2 | 3 | # | | | | | | # | | x | ---> |-------+-------| # t1 | | | | | # | | | 0 | 1 | # |_______________| |_______|_______| # 0 t0--> 1 # # # Face and Edge naming conventions: # # fZp # | # 6 ------eX3------ 7 # /| | / | # /eZ2 . / eZ3 # eY2 | fYp eY3 | # / | / fXp| # 4 ------eX2----- 5 | # |fXm 2 -----eX1--|---- 3 z # eZ0 / | eY1 ^ y # | eY0 . fYm eZ1 / | / # | / | | / | / # 0 ------eX0------1 o----> x # | # fZm # # # fX fY # 2___________3 2___________3 # | e1 | | e1 | # | | | | # e0 | x | e2 z e0 | x | e2 z # | | ^ | | ^ # |___________| |___> y |___________| |___> x # 0 e3 1 0 e3 1 # fZ # 2___________3 # | e1 | # | | # e0 | x | e2 y # | | ^ # |___________| |___> x # 0 e3 1 from discretize.base import BaseTensorMesh from discretize.operators import InnerProducts, DiffOperators from discretize.mixins import InterfaceMixins, TreeMeshIO from discretize.utils import as_array_n_by_dim from discretize._extensions.tree_ext import _TreeMesh, TreeCell import numpy as np import scipy.sparse as sp import warnings from discretize.utils.code_utils import deprecate_property class TreeMesh( _TreeMesh, BaseTensorMesh, InnerProducts, DiffOperators, TreeMeshIO, InterfaceMixins ): """Class for QuadTree (2D) and OcTree (3D) meshes. Tree meshes are numerical grids where the dimensions of each cell are powers of 2 larger than some base cell dimension. Unlike the :class:`~discretize.TensorMesh` class, gridded locations and numerical operators for instances of ``TreeMesh`` cannot be simply constructed using tensor products. Furthermore, each cell is an instance of ``TreeMesh`` is an instance of the :class:`~discretize.tree_mesh.TreeCell` . Parameters ---------- h : (dim) iterable of int, numpy.ndarray, or tuple Defines the cell widths of the *underlying tensor mesh* along each axis. The length of the iterable object is equal to the dimension of the mesh (2 or 3). For a 3D mesh, the list would have the form *[hx, hy, hz]*. The number of cells along each axis **must be a power of 2** . Along each axis, the user has 3 choices for defining the cells widths for the underlying tensor mesh: - :class:`int` -> A unit interval is equally discretized into `N` cells. - :class:`numpy.ndarray` -> The widths are explicity given for each cell - the widths are defined as a :class:`list` of :class:`tuple` of the form *(dh, nc, [npad])* where *dh* is the cell width, *nc* is the number of cells, and *npad* (optional) is a padding factor denoting exponential increase/decrease in the cell width for each cell; e.g. *[(2., 10, -1.3), (2., 50), (2., 10, 1.3)]* origin : (dim) iterable, default: 0 Define the origin or 'anchor point' of the mesh; i.e. the bottom-left-frontmost corner. By default, the mesh is anchored such that its origin is at [0, 0, 0]. For each dimension (x, y or z), The user may set the origin 2 ways: - a ``scalar`` which explicitly defines origin along that dimension. - **{'0', 'C', 'N'}** a :class:`str` specifying whether the zero coordinate along each axis is the first node location ('0'), in the center ('C') or the last node location ('N') (see Examples). Examples -------- Here we generate a basic 2D tree mesh. >>> from discretize import TreeMesh >>> import numpy as np >>> import matplotlib.pyplot as plt Define base mesh (domain and finest discretization), >>> dh = 5 # minimum cell width (base mesh cell width) >>> nbc = 64 # number of base mesh cells >>> h = dh * np.ones(nbc) >>> mesh = TreeMesh([h, h]) Define corner points for a rectangular box, and subdived the mesh within the box to the maximum refinement level. >>> x0s = [120.0, 80.0] >>> x1s = [240.0, 160.0] >>> levels = [mesh.max_level] >>> mesh.refine_box(x0s, x1s, levels) >>> mesh.plot_grid() >>> plt.show() """ _meshType = "TREE" _aliases = { **BaseTensorMesh._aliases, **DiffOperators._aliases, **{ "ntN": "n_total_nodes", "ntEx": "n_total_edges_x", "ntEy": "n_total_edges_y", "ntEz": "n_total_edges_z", "ntE": "n_total_edges", "ntFx": "n_total_faces_x", "ntFy": "n_total_faces_y", "ntFz": "n_total_faces_z", "ntF": "n_total_faces", "nhN": "n_hanging_nodes", "nhEx": "n_hanging_edges_x", "nhEy": "n_hanging_edges_y", "nhEz": "n_hanging_edges_z", "nhE": "n_hanging_edges", "nhFx": "n_hanging_faces_x", "nhFy": "n_hanging_faces_y", "nhFz": "n_hanging_faces_z", "nhF": "n_hanging_faces", "gridhN": "hanging_nodes", "gridhFx": "hanging_faces_x", "gridhFy": "hanging_faces_y", "gridhFz": "hanging_faces_z", "gridhEx": "hanging_edges_x", "gridhEy": "hanging_edges_y", "gridhEz": "hanging_edges_z", }, } _items = {"h", "origin", "cell_state"} # inheriting stuff from BaseTensorMesh that isn't defined in _QuadTree def __init__(self, h=None, origin=None, **kwargs): if "x0" in kwargs: origin = kwargs.pop("x0") super().__init__(h=h, origin=origin) cell_state = kwargs.pop("cell_state", None) cell_indexes = kwargs.pop("cell_indexes", None) cell_levels = kwargs.pop("cell_levels", None) if cell_state is None: if cell_indexes is not None and cell_levels is not None: cell_state = {} cell_state["indexes"] = cell_indexes cell_state["levels"] = cell_levels if cell_state is not None: indexes = cell_state["indexes"] levels = cell_state["levels"] self.__setstate__((indexes, levels)) def __repr__(self): """Plain text representation.""" mesh_name = "{0!s}TreeMesh".format(("Oc" if self.dim == 3 else "Quad")) top = "\n" + mesh_name + ": {0:2.2f}% filled\n\n".format(self.fill * 100) # Number of cells per level level_count = self._count_cells_per_index() non_zero_levels = np.nonzero(level_count)[0] cell_display = ["Level : Number of cells"] cell_display.append("-----------------------") for level in non_zero_levels: cell_display.append("{:^5} : {:^15}".format(level, level_count[level])) cell_display.append("-----------------------") cell_display.append("Total : {:^15}".format(self.nC)) extent_display = [" Mesh Extent "] extent_display.append(" min , max ") extent_display.append(" ---------------------------") dim_label = {0: "x", 1: "y", 2: "z"} for dim in range(self.dim): n_vector = getattr(self, "nodes_" + dim_label[dim]) extent_display.append( "{}: {:^13},{:^13}".format(dim_label[dim], n_vector[0], n_vector[-1]) ) for i, line in enumerate(extent_display): if i == len(cell_display): cell_display.append(" " * (len(cell_display[0]) - 3 - len(line))) cell_display[i] += 3 * " " + line h_display = [" Cell Widths "] h_display.append(" min , max ") h_display.append("-" * (len(h_display[0]))) h_gridded = self.h_gridded mins = np.min(h_gridded, axis=0) maxs = np.max(h_gridded, axis=0) for dim in range(self.dim): h_display.append("{:^10}, {:^10}".format(mins[dim], maxs[dim])) for i, line in enumerate(h_display): if i == len(cell_display): cell_display.append(" " * len(cell_display[0])) cell_display[i] += 3 * " " + line return top + "\n".join(cell_display) def _repr_html_(self): """html representation""" mesh_name = "{0!s}TreeMesh".format(("Oc" if self.dim == 3 else "Quad")) level_count = self._count_cells_per_index() non_zero_levels = np.nonzero(level_count)[0] dim_label = {0: "x", 1: "y", 2: "z"} h_gridded = self.h_gridded mins = np.min(h_gridded, axis=0) maxs = np.max(h_gridded, axis=0) style = " style='padding: 5px 20px 5px 20px;'" # Cell level table: cel_tbl = "<table>\n" cel_tbl += "<tr>\n" cel_tbl += "<th" + style + ">Level</th>\n" cel_tbl += "<th" + style + ">Number of cells</th>\n" cel_tbl += "</tr>\n" for level in non_zero_levels: cel_tbl += "<tr>\n" cel_tbl += "<td" + style + ">{}</td>\n".format(level) cel_tbl += "<td" + style + ">{}</td>\n".format(level_count[level]) cel_tbl += "</tr>\n" cel_tbl += "<tr>\n" cel_tbl += ( "<td style='font-weight: bold; padding: 5px 20px 5px 20px;'> Total </td>\n" ) cel_tbl += "<td" + style + "> {} </td>\n".format(self.nC) cel_tbl += "</tr>\n" cel_tbl += "</table>\n" det_tbl = "<table>\n" det_tbl += "<tr>\n" det_tbl += "<th></th>\n" det_tbl += "<th" + style + " colspan='2'>Mesh extent</th>\n" det_tbl += "<th" + style + " colspan='2'>Cell widths</th>\n" det_tbl += "</tr>\n" det_tbl += "<tr>\n" det_tbl += "<th></th>\n" det_tbl += "<th" + style + ">min</th>\n" det_tbl += "<th" + style + ">max</th>\n" det_tbl += "<th" + style + ">min</th>\n" det_tbl += "<th" + style + ">max</th>\n" det_tbl += "</tr>\n" for dim in range(self.dim): n_vector = getattr(self, "nodes_" + dim_label[dim]) det_tbl += "<tr>\n" det_tbl += "<td" + style + ">{}</td>\n".format(dim_label[dim]) det_tbl += "<td" + style + ">{}</td>\n".format(n_vector[0]) det_tbl += "<td" + style + ">{}</td>\n".format(n_vector[-1]) det_tbl += "<td" + style + ">{}</td>\n".format(mins[dim]) det_tbl += "<td" + style + ">{}</td>\n".format(maxs[dim]) det_tbl += "</tr>\n" det_tbl += "</table>\n" full_tbl = "<table>\n" full_tbl += "<tr>\n" full_tbl += "<td style='font-weight: bold; font-size: 1.2em; text-align: center;'>{}</td>\n".format( mesh_name ) full_tbl += "<td style='font-size: 1.2em; text-align: center;' colspan='2'>{0:2.2f}% filled</td>\n".format( 100 * self.fill ) full_tbl += "</tr>\n" full_tbl += "<tr>\n" full_tbl += "<td>\n" full_tbl += cel_tbl full_tbl += "</td>\n" full_tbl += "<td>\n" full_tbl += det_tbl full_tbl += "</td>\n" full_tbl += "</tr>\n" full_tbl += "</table>\n" return full_tbl @BaseTensorMesh.origin.setter def origin(self, value): # first use the BaseTensorMesh to set the origin to handle "0, C, N" BaseTensorMesh.origin.fset(self, value) # then update the TreeMesh with the hidden value self._set_origin(self._origin) @property def vntF(self): """ Vector number of total faces along each axis This property returns the total number of hanging and non-hanging faces along each axis direction. The returned quantity is a list of integers of the form [nFx,nFy,nFz]. Returns ------- list of int Vector number of total faces along each axis """ return [self.ntFx, self.ntFy] + ([] if self.dim == 2 else [self.ntFz]) @property def vntE(self): """ Vector number of total edges along each axis This property returns the total number of hanging and non-hanging edges along each axis direction. The returned quantity is a list of integers of the form [nEx,nEy,nEz]. Returns ------- list of int Vector number of total edges along each axis """ return [self.ntEx, self.ntEy] + ([] if self.dim == 2 else [self.ntEz]) @property def stencil_cell_gradient(self): if getattr(self, "_stencil_cell_gradient", None) is None: self._stencil_cell_gradient = sp.vstack( [self.stencil_cell_gradient_x, self.stencil_cell_gradient_y] ) if self.dim == 3: self._stencil_cell_gradient = sp.vstack( [self._stencil_cell_gradient, self.stencil_cell_gradient_z] ) return self._stencil_cell_gradient @property def cell_gradient(self): if getattr(self, "_cell_gradient", None) is None: i_s = self.face_boundary_indices ix = np.ones(self.nFx) ix[i_s[0]] = 0.0 ix[i_s[1]] = 0.0 Pafx = sp.diags(ix) iy = np.ones(self.nFy) iy[i_s[2]] = 0.0 iy[i_s[3]] = 0.0 Pafy = sp.diags(iy) MfI = self.get_face_inner_product(invMat=True) if self.dim == 2: Pi = sp.block_diag([Pafx, Pafy]) elif self.dim == 3: iz = np.ones(self.nFz) iz[i_s[4]] = 0.0 iz[i_s[5]] = 0.0 Pafz = sp.diags(iz) Pi = sp.block_diag([Pafx, Pafy, Pafz]) self._cell_gradient = ( -Pi * MfI * self.face_divergence.T * sp.diags(self.cell_volumes) ) return self._cell_gradient @property def cell_gradient_x(self): if getattr(self, "_cell_gradient_x", None) is None: nFx = self.nFx i_s = self.face_boundary_indices ix = np.ones(self.nFx) ix[i_s[0]] = 0.0 ix[i_s[1]] = 0.0 Pafx = sp.diags(ix) MfI = self.get_face_inner_product(invMat=True) MfIx = sp.diags(MfI.diagonal()[:nFx]) self._cell_gradient_x = ( -Pafx * MfIx * self.face_x_divergence.T * sp.diags(self.cell_volumes) ) return self._cell_gradient_x @property def cell_gradient_y(self): if getattr(self, "_cell_gradient_y", None) is None: nFx = self.nFx nFy = self.nFy i_s = self.face_boundary_indices iy = np.ones(self.nFy) iy[i_s[2]] = 0.0 iy[i_s[3]] = 0.0 Pafy = sp.diags(iy) MfI = self.get_face_inner_product(invMat=True) MfIy = sp.diags(MfI.diagonal()[nFx : nFx + nFy]) self._cell_gradient_y = ( -Pafy * MfIy * self.face_y_divergence.T * sp.diags(self.cell_volumes) ) return self._cell_gradient_y @property def cell_gradient_z(self): if self.dim == 2: raise TypeError("z derivative not defined in 2D") if getattr(self, "_cell_gradient_z", None) is None: nFx = self.nFx nFy = self.nFy i_s = self.face_boundary_indices iz = np.ones(self.nFz) iz[i_s[4]] = 0.0 iz[i_s[5]] = 0.0 Pafz = sp.diags(iz) MfI = self.get_face_inner_product(invMat=True) MfIz = sp.diags(MfI.diagonal()[nFx + nFy :]) self._cell_gradient_z = ( -Pafz * MfIz * self.face_z_divergence.T * sp.diags(self.cell_volumes) ) return self._cell_gradient_z @property def face_x_divergence(self): if getattr(self, "_face_x_divergence", None) is None: self._face_x_divergence = self.face_divergence[:, : self.nFx] return self._face_x_divergence @property def face_y_divergence(self): if getattr(self, "_face_y_divergence", None) is None: self._face_y_divergence = self.face_divergence[ :, self.nFx : self.nFx + self.nFy ] return self._face_y_divergence @property def face_z_divergence(self): if getattr(self, "_face_z_divergence", None) is None: self._face_z_divergence = self.face_divergence[:, self.nFx + self.nFy :] return self._face_z_divergence def point2index(self, locs): """Finds cells that contain the given points. Returns an array of index values of the cells that contain the given points Parameters ---------- locs: (N, dim) array_like points to search for the location of Returns ------- (N) array_like of int Cell indices that contain the points """ locs = as_array_n_by_dim(locs, self.dim) inds = self._get_containing_cell_indexes(locs) return inds def cell_levels_by_index(self, indices): """Fast function to return a list of levels for the given cell indices Parameters ---------- index: (N) array_like Cell indexes to query Returns ------- (N) numpy.ndarray of int Levels for the cells. """ return self._cell_levels_by_indexes(indices) def get_interpolation_matrix( self, locs, location_type="CC", zeros_outside=False, **kwargs ): """Produces interpolation matrix Parameters ---------- loc : (N, dim) array_like Location of points to interpolate to location_type: str, optional What to interpolate location_type can be: - 'CC' -> scalar field defined on cell centers - 'Ex' -> x-component of field defined on edges - 'Ey' -> y-component of field defined on edges - 'Ez' -> z-component of field defined on edges - 'Fx' -> x-component of field defined on faces - 'Fy' -> y-component of field defined on faces - 'Fz' -> z-component of field defined on faces - 'N' -> scalar field defined on nodes Returns ------- (N, n_loc_type) scipy.sparse.csr_matrix the interpolation matrix """ if "locType" in kwargs: warnings.warn( "The locType keyword argument has been deprecated, please use location_type. " "This will be removed in discretize 1.0.0", DeprecationWarning, ) location_type = kwargs["locType"] if "zerosOutside" in kwargs: warnings.warn( "The zerosOutside keyword argument has been deprecated, please use zeros_outside. " "This will be removed in discretize 1.0.0", DeprecationWarning, ) zeros_outside = kwargs["zerosOutside"] locs = as_array_n_by_dim(locs, self.dim) if location_type not in ["N", "CC", "Ex", "Ey", "Ez", "Fx", "Fy", "Fz"]: raise Exception( "location_type must be one of N, CC, Ex, Ey, Ez, Fx, Fy, or Fz" ) if self.dim == 2 and location_type in ["Ez", "Fz"]: raise Exception("Unable to interpolate from Z edges/face in 2D") locs = np.require(np.atleast_2d(locs), dtype=np.float64, requirements="C") if location_type == "N": Av = self._getNodeIntMat(locs, zeros_outside) elif location_type in ["Ex", "Ey", "Ez"]: Av = self._getEdgeIntMat(locs, zeros_outside, location_type[1]) elif location_type in ["Fx", "Fy", "Fz"]: Av = self._getFaceIntMat(locs, zeros_outside, location_type[1]) elif location_type in ["CC"]: Av = self._getCellIntMat(locs, zeros_outside) return Av @property def permute_cells(self): """Permutation matrix re-ordering of cells sorted by x, then y, then z Returns ------- (n_cells, n_cells) scipy.sparse.csr_matrix """ # TODO: cache these? P = np.lexsort(self.gridCC.T) # sort by x, then y, then z return sp.identity(self.nC).tocsr()[P] @property def permute_faces(self): """Permutation matrix re-ordering of faces sorted by x, then y, then z Returns ------- (n_faces, n_faces) scipy.sparse.csr_matrix """ # TODO: cache these? Px = np.lexsort(self.gridFx.T) Py = np.lexsort(self.gridFy.T) + self.nFx if self.dim == 2: P = np.r_[Px, Py] else: Pz = np.lexsort(self.gridFz.T) + (self.nFx + self.nFy) P = np.r_[Px, Py, Pz] return sp.identity(self.nF).tocsr()[P] @property def permute_edges(self): """Permutation matrix re-ordering of edges sorted by x, then y, then z Returns ------- (n_edges, n_edges) scipy.sparse.csr_matrix """ # TODO: cache these? Px = np.lexsort(self.gridEx.T) Py = np.lexsort(self.gridEy.T) + self.nEx if self.dim == 2: P = np.r_[Px, Py] if self.dim == 3: Pz = np.lexsort(self.gridEz.T) + (self.nEx + self.nEy) P = np.r_[Px, Py, Pz] return sp.identity(self.nE).tocsr()[P] @property def cell_state(self): """ The current state of the cells on the mesh. This represents the x, y, z indices of the cells in the base tensor mesh, as well as their levels. It can be used to reconstruct the mesh. Returns ------- dict dictionary with two entries: - ``"indexes"``: the indexes of the cells - ``"levels"``: the levels of the cells """ indexes, levels = self.__getstate__() return {"indexes": indexes.tolist(), "levels": levels.tolist()} def validate(self): return self.finalized def equals(self, other): try: if self.finalized and other.finalized: return super().equals(other) except AttributeError: pass return False def __reduce__(self): return TreeMesh, (self.h, self.origin), self.__getstate__() cellGrad = deprecate_property("cell_gradient", "cellGrad", removal_version="1.0.0", future_warn=False) cellGradx = deprecate_property( "cell_gradient_x", "cellGradx", removal_version="1.0.0", future_warn=False ) cellGrady = deprecate_property( "cell_gradient_y", "cellGrady", removal_version="1.0.0", future_warn=False ) cellGradz = deprecate_property( "cell_gradient_z", "cellGradz", removal_version="1.0.0", future_warn=False ) cellGradStencil = deprecate_property( "cell_gradient_stencil", "cellGradStencil", removal_version="1.0.0", future_warn=False ) nodalGrad = deprecate_property( "nodal_gradient", "nodalGrad", removal_version="1.0.0", future_warn=False ) nodalLaplacian = deprecate_property( "nodal_laplacian", "nodalLaplacian", removal_version="1.0.0", future_warn=False ) faceDiv = deprecate_property("face_divergence", "faceDiv", removal_version="1.0.0", future_warn=False) faceDivx = deprecate_property( "face_x_divergence", "faceDivx", removal_version="1.0.0", future_warn=False ) faceDivy = deprecate_property( "face_y_divergence", "faceDivy", removal_version="1.0.0", future_warn=False ) faceDivz = deprecate_property( "face_z_divergence", "faceDivz", removal_version="1.0.0", future_warn=False ) edgeCurl = deprecate_property("edge_curl", "edgeCurl", removal_version="1.0.0", future_warn=False) maxLevel = deprecate_property("max_used_level", "maxLevel", removal_version="1.0.0", future_warn=False) vol = deprecate_property("cell_volumes", "vol", removal_version="1.0.0", future_warn=False) areaFx = deprecate_property("face_x_areas", "areaFx", removal_version="1.0.0", future_warn=False) areaFy = deprecate_property("face_y_areas", "areaFy", removal_version="1.0.0", future_warn=False) areaFz = deprecate_property("face_z_areas", "areaFz", removal_version="1.0.0", future_warn=False) area = deprecate_property("face_areas", "area", removal_version="1.0.0", future_warn=False) edgeEx = deprecate_property("edge_x_lengths", "edgeEx", removal_version="1.0.0", future_warn=False) edgeEy = deprecate_property("edge_y_lengths", "edgeEy", removal_version="1.0.0", future_warn=False) edgeEz = deprecate_property("edge_z_lengths", "edgeEz", removal_version="1.0.0", future_warn=False) edge = deprecate_property("edge_lengths", "edge", removal_version="1.0.0", future_warn=False) permuteCC = deprecate_property( "permute_cells", "permuteCC", removal_version="1.0.0", future_warn=False ) permuteF = deprecate_property("permute_faces", "permuteF", removal_version="1.0.0", future_warn=False) permuteE = deprecate_property("permute_edges", "permuteE", removal_version="1.0.0", future_warn=False) faceBoundaryInd = deprecate_property( "face_boundary_indices", "faceBoundaryInd", removal_version="1.0.0", future_warn=False ) cellBoundaryInd = deprecate_property( "cell_boundary_indices", "cellBoundaryInd", removal_version="1.0.0", future_warn=False ) _aveCC2FxStencil = deprecate_property( "average_cell_to_total_face_x", "_aveCC2FxStencil", removal_version="1.0.0", future_warn=False ) _aveCC2FyStencil = deprecate_property( "average_cell_to_total_face_y", "_aveCC2FyStencil", removal_version="1.0.0", future_warn=False ) _aveCC2FzStencil = deprecate_property( "average_cell_to_total_face_z", "_aveCC2FzStencil", removal_version="1.0.0", future_warn=False ) _cellGradStencil = deprecate_property( "stencil_cell_gradient", "_cellGradStencil", removal_version="1.0.0", future_warn=False ) _cellGradxStencil = deprecate_property( "stencil_cell_gradient_x", "_cellGradxStencil", removal_version="1.0.0", future_warn=False ) _cellGradyStencil = deprecate_property( "stencil_cell_gradient_y", "_cellGradyStencil", removal_version="1.0.0", future_warn=False ) _cellGradzStencil = deprecate_property( "stencil_cell_gradient_z", "_cellGradzStencil", removal_version="1.0.0", future_warn=False )
29,850
10,122
#!/usr/bin/env python3 # -*- coding: utf-8 -*- """ Copyright (c) 2019, Linear Labs Technology Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ import argparse from yahoo_finance_api2 import share import torch.tensor as tt import torch,random def get_targets(rows): """ This is where you can build your target. For the tutorial we're only concerned about whether we should buy or sell. So we'll create a rule for this, we'll need to set this up as regression ( on the open set (-1,1) ). Our rule is as follows: If the stock closes below the open, we should have sold (t-1 = sell at close, t = buy at close). If the stock closes above the open, we should have bought (t-1 = buy at close, t = sell at close). While under the constraint of maximizing our profit We can obviously make this more complex, even with the data we have, but for this tutorial, If you want to create your own targets, this is where you should do it. Below is the accessible data structure passed to this function. rows = { "timestamp": [ 1557149400000, ], "open": [ 126.38999938964844, ], "high": [ 128.55999755859375, ], "low": [ 126.11000061035156, ], "close": [ 128.14999389648438, ], "volume": [ 24239800, ] } """ # targets: sell = -1, buy = +1 # set to sell at beginning of the trading day # we assume that unless the it's going down, buy. # later we'll add some business logic to determine the actual action of purchasing # return [ tt([0.]) ] + [ tt([ 0 if (rows['close'][i-2] > rows['open'][i-2]) and (rows['close'][i] > rows['open'][i]) else (1 if random.random() > .7 else 2 )]) for i in range(2,len(rows['open'])) ] return [ tt( [ [ [ rows['high'][i] ] ] ] ) for i in range(1,len(rows['open'])) ] def get_inputs(rows): # you could also use a pandas DataFrame return [ tt( [ [ [ rows['open'][i],rows['close'][i],rows['volume'][i],rows['low'][i],rows['high'][i] ] ] ]) for i in range(len(rows['open'])-1 ) ] def main(args): # default grab the last 75 days import datetime if args.csv: import pandas as pd data = pd.read_csv(args.csv) else: today = datetime.date.today() ticker = share.Share(args.ticker) data = ticker.get_historical(share.PERIOD_TYPE_DAY,args.start,share.FREQUENCY_TYPE_MINUTE,int(60/args.frequency)) torch.save({ 'inputs':get_inputs(data), 'targets':get_targets(data) },args.output_file) if __name__ == '__main__': parser = argparse.ArgumentParser() parser.add_argument('-t','--ticker',help="enter the stock ticker symbol",required=True) parser.add_argument('-s','--start',help="start date of data to grab. default is 75 days ago",default=75,type=int) parser.add_argument('-o','--output_file',help="name of the output file to save the dataset",default='trader.ds') parser.add_argument('-f','--frequency',help='how frequent to sample each day of trading (in hourly fractions)',type=int,default=1) parser.add_argument('--csv',help='the csv file to load instead of downloading fresh data',default=None) main( parser.parse_args() )
4,053
1,281
import os from project import app, db class BaseConfig: """Base configuration""" TESTING = False SQLALCHEMY_TRACK_MODIFICATIONS = False print('Running through config') class DevelopmentConfig(BaseConfig): """Development configuration""" SQLALCHEMY_DATABASE_URI = os.environ.get('POSTGRES_URL') MASTER_STATION = os.environ.get('MASTER_STATION') MASTER_ELEVATOR = os.environ.get('MASTER_ELEVATOR') MONGO_URI = os.environ.get('MONGO_URI') MONGO_DBNAME = 'eva_dev' class TestingConfig(BaseConfig): """Testing configuration""" TESTING = True SQLALCHEMY_DATABASE_URI = os.environ.get('DATABASE_TEST_URL') class ProductionConfig(BaseConfig): """Production configuration""" SQLALCHEMY_DATABASE_URI = os.environ.get('DATABASE_URL')
790
278
from sqlalchemy import Column,Integer,String, Float from sqlalchemy.ext.declarative import declarative_base from sqlalchemy import create_engine from config.envvar import * Base = declarative_base() class Steps(Base): __tablename__ = "steps" id = Column(Integer, primary_key=True, autoincrement=True) recipe_id = Column(String(128),index=True) position = Column(Integer) items = Column(String(256)) engine = create_engine('mysql+pymysql://'+db_config["DB_USER"]+':'+db_config["DB_PASSWORD"]+'@'+db_config["DB_HOST"]+'/' + db_config["DB_NAME"]) Base.metadata.create_all(engine)
625
210
class ChoiceGenerator: ''' Generates (nonrecursively) all of the combinations of a choose b, where a, b are nonnegative integers and a >= b. The values of a and b are given in the constructor, and the sequence of choices is obtained by repeatedly calling the next() method. When the sequence is finished, null is returned. A valid combination for the sequence of combinations for a choose b generated by this class is an array x[] of b integers i, 0 <= i < a, such that x[j] < x[j + 1] for each j from 0 to b - 1. ''' def __init__(self, a, b): ''' Constructs a new choice generator for a choose b. Once this initialization has been performed, successive calls to next() will produce the series of combinations. To begin a new series at any time, call this init method again with new values for a and b. Parameters ---------- a: the number of objects being selected from. b: the number of objects in the desired selection. Returns ------- ChoiceGenerator : ChoiceGenerator instance ''' self.a = a self.b = b self.diff = a - b self.choiceLocal = [] for i in range(b - 1): self.choiceLocal.append(i) if b > 0: self.choiceLocal.append(b - 2) self.choiceReturned = [0 for i in range(b)] self.begun = False def fill(self, index): self.choiceLocal[index] += 1 for i in range(index + 1, self.b): self.choiceLocal[i] = self.choiceLocal[i - 1] + 1 def next(self): i = self.b while i > 0: i -= 1 if self.choiceLocal[i] < (i + self.diff): self.fill(i) self.begun = True for j in range(self.b): self.choiceReturned[j] = self.choiceLocal[j] return self.choiceReturned if self.begun: return None else: self.begun = True for j in range(self.b): self.choiceReturned[j] = self.choiceLocal[j] return self.choiceReturned
2,184
617
# -*- coding: utf-8 -*- """ Created on Thu Jun 11 11:17:21 2020 @author: eilxaix """ import pandas as pd import re def remove_hashtag(t): t=re.sub('-',' ', t) t=' '.join(t.split()) return t def read_csv_data(df): title = [remove_hashtag(i) for i in df['Document Title']] abstract = [remove_hashtag(i) for i in df['Abstract']] doc = [title[i] + '. ' + abstract[i] for i in range(len(df))] inspec_controlled = [remove_hashtag(i) for i in df['INSPEC Controlled Terms']] inspec_uncontrolled = [remove_hashtag(i) for i in df['INSPEC Non-Controlled Terms']] for i in range(len(inspec_uncontrolled)): inspec_uncontrolled[i] = [k.lower() for k in inspec_uncontrolled[i].split(';')] for i in range(len(inspec_controlled)): inspec_controlled[i] = [k.lower() for k in inspec_controlled[i].split(';')] data = {'title': title, 'abstract': abstract, 'title+abs': doc, 'inspec_controlled': inspec_controlled,'inspec_uncontrolled':inspec_uncontrolled} return data # ============================================================================= # data = read_csv_data(pd.read_csv('../../dataset/ieee_xai/ieee_xai.csv')) # =============================================================================
1,259
450
# Generated from Scicopia.g4 by ANTLR 4.9.2 # encoding: utf-8 from antlr4 import * from io import StringIO import sys if sys.version_info[1] > 5: from typing import TextIO else: from typing.io import TextIO def serializedATN(): with StringIO() as buf: buf.write("\3\u608b\ua72a\u8133\ub9ed\u417c\u3be7\u7786\u5964\3\23") buf.write("<\4\2\t\2\4\3\t\3\4\4\t\4\4\5\t\5\4\6\t\6\4\7\t\7\3\2") buf.write("\6\2\20\n\2\r\2\16\2\21\3\3\3\3\3\3\3\3\5\3\30\n\3\3\4") buf.write("\3\4\3\4\3\4\3\4\3\4\5\4 \n\4\3\5\3\5\7\5$\n\5\f\5\16") buf.write("\5\'\13\5\3\5\3\5\3\5\7\5,\n\5\f\5\16\5/\13\5\3\5\5\5") buf.write("\62\n\5\3\6\3\6\3\6\3\6\5\68\n\6\3\7\3\7\3\7\4%-\2\b\2") buf.write("\4\6\b\n\f\2\3\4\2\6\t\13\20\2?\2\17\3\2\2\2\4\27\3\2") buf.write("\2\2\6\37\3\2\2\2\b\61\3\2\2\2\n\63\3\2\2\2\f9\3\2\2\2") buf.write("\16\20\5\4\3\2\17\16\3\2\2\2\20\21\3\2\2\2\21\17\3\2\2") buf.write("\2\21\22\3\2\2\2\22\3\3\2\2\2\23\30\5\6\4\2\24\30\5\b") buf.write("\5\2\25\30\5\f\7\2\26\30\5\n\6\2\27\23\3\2\2\2\27\24\3") buf.write("\2\2\2\27\25\3\2\2\2\27\26\3\2\2\2\30\5\3\2\2\2\31\32") buf.write("\7\n\2\2\32 \5\b\5\2\33\34\7\n\2\2\34 \5\n\6\2\35\36\7") buf.write("\n\2\2\36 \5\f\7\2\37\31\3\2\2\2\37\33\3\2\2\2\37\35\3") buf.write("\2\2\2 \7\3\2\2\2!%\7\3\2\2\"$\13\2\2\2#\"\3\2\2\2$\'") buf.write("\3\2\2\2%&\3\2\2\2%#\3\2\2\2&(\3\2\2\2\'%\3\2\2\2(\62") buf.write("\7\3\2\2)-\7\4\2\2*,\13\2\2\2+*\3\2\2\2,/\3\2\2\2-.\3") buf.write("\2\2\2-+\3\2\2\2.\60\3\2\2\2/-\3\2\2\2\60\62\7\4\2\2\61") buf.write("!\3\2\2\2\61)\3\2\2\2\62\t\3\2\2\2\63\64\7\13\2\2\64\67") buf.write("\7\5\2\2\658\5\b\5\2\668\5\f\7\2\67\65\3\2\2\2\67\66\3") buf.write("\2\2\28\13\3\2\2\29:\t\2\2\2:\r\3\2\2\2\t\21\27\37%-\61") buf.write("\67") return buf.getvalue() class ScicopiaParser ( Parser ): grammarFileName = "Scicopia.g4" atn = ATNDeserializer().deserialize(serializedATN()) decisionsToDFA = [ DFA(ds, i) for i, ds in enumerate(atn.decisionToState) ] sharedContextCache = PredictionContextCache() literalNames = [ "<INVALID>", "'\"'", "'''", "':'", "<INVALID>", "<INVALID>", "<INVALID>", "<INVALID>", "'-'", "<INVALID>", "<INVALID>", "<INVALID>", "<INVALID>", "<INVALID>", "<INVALID>", "'('", "')'" ] symbolicNames = [ "<INVALID>", "<INVALID>", "<INVALID>", "<INVALID>", "DASH", "NUM", "COMPOUND", "APOSTROPHE", "NOT", "ALPHA", "DIGITS", "ABBREV", "CHARGED", "ALPHANUM", "STRING", "LPAR", "RPAR", "WHITESPACE" ] RULE_query = 0 RULE_part = 1 RULE_exclude = 2 RULE_quotes = 3 RULE_prefixed = 4 RULE_term = 5 ruleNames = [ "query", "part", "exclude", "quotes", "prefixed", "term" ] EOF = Token.EOF T__0=1 T__1=2 T__2=3 DASH=4 NUM=5 COMPOUND=6 APOSTROPHE=7 NOT=8 ALPHA=9 DIGITS=10 ABBREV=11 CHARGED=12 ALPHANUM=13 STRING=14 LPAR=15 RPAR=16 WHITESPACE=17 def __init__(self, input:TokenStream, output:TextIO = sys.stdout): super().__init__(input, output) self.checkVersion("4.9.2") self._interp = ParserATNSimulator(self, self.atn, self.decisionsToDFA, self.sharedContextCache) self._predicates = None class QueryContext(ParserRuleContext): __slots__ = 'parser' def __init__(self, parser, parent:ParserRuleContext=None, invokingState:int=-1): super().__init__(parent, invokingState) self.parser = parser def part(self, i:int=None): if i is None: return self.getTypedRuleContexts(ScicopiaParser.PartContext) else: return self.getTypedRuleContext(ScicopiaParser.PartContext,i) def getRuleIndex(self): return ScicopiaParser.RULE_query def enterRule(self, listener:ParseTreeListener): if hasattr( listener, "enterQuery" ): listener.enterQuery(self) def exitRule(self, listener:ParseTreeListener): if hasattr( listener, "exitQuery" ): listener.exitQuery(self) def query(self): localctx = ScicopiaParser.QueryContext(self, self._ctx, self.state) self.enterRule(localctx, 0, self.RULE_query) self._la = 0 # Token type try: self.enterOuterAlt(localctx, 1) self.state = 13 self._errHandler.sync(self) _la = self._input.LA(1) while True: self.state = 12 self.part() self.state = 15 self._errHandler.sync(self) _la = self._input.LA(1) if not ((((_la) & ~0x3f) == 0 and ((1 << _la) & ((1 << ScicopiaParser.T__0) | (1 << ScicopiaParser.T__1) | (1 << ScicopiaParser.DASH) | (1 << ScicopiaParser.NUM) | (1 << ScicopiaParser.COMPOUND) | (1 << ScicopiaParser.APOSTROPHE) | (1 << ScicopiaParser.NOT) | (1 << ScicopiaParser.ALPHA) | (1 << ScicopiaParser.DIGITS) | (1 << ScicopiaParser.ABBREV) | (1 << ScicopiaParser.CHARGED) | (1 << ScicopiaParser.ALPHANUM) | (1 << ScicopiaParser.STRING))) != 0)): break except RecognitionException as re: localctx.exception = re self._errHandler.reportError(self, re) self._errHandler.recover(self, re) finally: self.exitRule() return localctx class PartContext(ParserRuleContext): __slots__ = 'parser' def __init__(self, parser, parent:ParserRuleContext=None, invokingState:int=-1): super().__init__(parent, invokingState) self.parser = parser def exclude(self): return self.getTypedRuleContext(ScicopiaParser.ExcludeContext,0) def quotes(self): return self.getTypedRuleContext(ScicopiaParser.QuotesContext,0) def term(self): return self.getTypedRuleContext(ScicopiaParser.TermContext,0) def prefixed(self): return self.getTypedRuleContext(ScicopiaParser.PrefixedContext,0) def getRuleIndex(self): return ScicopiaParser.RULE_part def enterRule(self, listener:ParseTreeListener): if hasattr( listener, "enterPart" ): listener.enterPart(self) def exitRule(self, listener:ParseTreeListener): if hasattr( listener, "exitPart" ): listener.exitPart(self) def part(self): localctx = ScicopiaParser.PartContext(self, self._ctx, self.state) self.enterRule(localctx, 2, self.RULE_part) try: self.state = 21 self._errHandler.sync(self) la_ = self._interp.adaptivePredict(self._input,1,self._ctx) if la_ == 1: self.enterOuterAlt(localctx, 1) self.state = 17 self.exclude() pass elif la_ == 2: self.enterOuterAlt(localctx, 2) self.state = 18 self.quotes() pass elif la_ == 3: self.enterOuterAlt(localctx, 3) self.state = 19 self.term() pass elif la_ == 4: self.enterOuterAlt(localctx, 4) self.state = 20 self.prefixed() pass except RecognitionException as re: localctx.exception = re self._errHandler.reportError(self, re) self._errHandler.recover(self, re) finally: self.exitRule() return localctx class ExcludeContext(ParserRuleContext): __slots__ = 'parser' def __init__(self, parser, parent:ParserRuleContext=None, invokingState:int=-1): super().__init__(parent, invokingState) self.parser = parser def NOT(self): return self.getToken(ScicopiaParser.NOT, 0) def quotes(self): return self.getTypedRuleContext(ScicopiaParser.QuotesContext,0) def prefixed(self): return self.getTypedRuleContext(ScicopiaParser.PrefixedContext,0) def term(self): return self.getTypedRuleContext(ScicopiaParser.TermContext,0) def getRuleIndex(self): return ScicopiaParser.RULE_exclude def enterRule(self, listener:ParseTreeListener): if hasattr( listener, "enterExclude" ): listener.enterExclude(self) def exitRule(self, listener:ParseTreeListener): if hasattr( listener, "exitExclude" ): listener.exitExclude(self) def exclude(self): localctx = ScicopiaParser.ExcludeContext(self, self._ctx, self.state) self.enterRule(localctx, 4, self.RULE_exclude) try: self.state = 29 self._errHandler.sync(self) la_ = self._interp.adaptivePredict(self._input,2,self._ctx) if la_ == 1: self.enterOuterAlt(localctx, 1) self.state = 23 self.match(ScicopiaParser.NOT) self.state = 24 self.quotes() pass elif la_ == 2: self.enterOuterAlt(localctx, 2) self.state = 25 self.match(ScicopiaParser.NOT) self.state = 26 self.prefixed() pass elif la_ == 3: self.enterOuterAlt(localctx, 3) self.state = 27 self.match(ScicopiaParser.NOT) self.state = 28 self.term() pass except RecognitionException as re: localctx.exception = re self._errHandler.reportError(self, re) self._errHandler.recover(self, re) finally: self.exitRule() return localctx class QuotesContext(ParserRuleContext): __slots__ = 'parser' def __init__(self, parser, parent:ParserRuleContext=None, invokingState:int=-1): super().__init__(parent, invokingState) self.parser = parser def getRuleIndex(self): return ScicopiaParser.RULE_quotes def enterRule(self, listener:ParseTreeListener): if hasattr( listener, "enterQuotes" ): listener.enterQuotes(self) def exitRule(self, listener:ParseTreeListener): if hasattr( listener, "exitQuotes" ): listener.exitQuotes(self) def quotes(self): localctx = ScicopiaParser.QuotesContext(self, self._ctx, self.state) self.enterRule(localctx, 6, self.RULE_quotes) try: self.state = 47 self._errHandler.sync(self) token = self._input.LA(1) if token in [ScicopiaParser.T__0]: self.enterOuterAlt(localctx, 1) self.state = 31 self.match(ScicopiaParser.T__0) self.state = 35 self._errHandler.sync(self) _alt = self._interp.adaptivePredict(self._input,3,self._ctx) while _alt!=1 and _alt!=ATN.INVALID_ALT_NUMBER: if _alt==1+1: self.state = 32 self.matchWildcard() self.state = 37 self._errHandler.sync(self) _alt = self._interp.adaptivePredict(self._input,3,self._ctx) self.state = 38 self.match(ScicopiaParser.T__0) pass elif token in [ScicopiaParser.T__1]: self.enterOuterAlt(localctx, 2) self.state = 39 self.match(ScicopiaParser.T__1) self.state = 43 self._errHandler.sync(self) _alt = self._interp.adaptivePredict(self._input,4,self._ctx) while _alt!=1 and _alt!=ATN.INVALID_ALT_NUMBER: if _alt==1+1: self.state = 40 self.matchWildcard() self.state = 45 self._errHandler.sync(self) _alt = self._interp.adaptivePredict(self._input,4,self._ctx) self.state = 46 self.match(ScicopiaParser.T__1) pass else: raise NoViableAltException(self) except RecognitionException as re: localctx.exception = re self._errHandler.reportError(self, re) self._errHandler.recover(self, re) finally: self.exitRule() return localctx class PrefixedContext(ParserRuleContext): __slots__ = 'parser' def __init__(self, parser, parent:ParserRuleContext=None, invokingState:int=-1): super().__init__(parent, invokingState) self.parser = parser def ALPHA(self): return self.getToken(ScicopiaParser.ALPHA, 0) def quotes(self): return self.getTypedRuleContext(ScicopiaParser.QuotesContext,0) def term(self): return self.getTypedRuleContext(ScicopiaParser.TermContext,0) def getRuleIndex(self): return ScicopiaParser.RULE_prefixed def enterRule(self, listener:ParseTreeListener): if hasattr( listener, "enterPrefixed" ): listener.enterPrefixed(self) def exitRule(self, listener:ParseTreeListener): if hasattr( listener, "exitPrefixed" ): listener.exitPrefixed(self) def prefixed(self): localctx = ScicopiaParser.PrefixedContext(self, self._ctx, self.state) self.enterRule(localctx, 8, self.RULE_prefixed) try: self.enterOuterAlt(localctx, 1) self.state = 49 self.match(ScicopiaParser.ALPHA) self.state = 50 self.match(ScicopiaParser.T__2) self.state = 53 self._errHandler.sync(self) token = self._input.LA(1) if token in [ScicopiaParser.T__0, ScicopiaParser.T__1]: self.state = 51 self.quotes() pass elif token in [ScicopiaParser.DASH, ScicopiaParser.NUM, ScicopiaParser.COMPOUND, ScicopiaParser.APOSTROPHE, ScicopiaParser.ALPHA, ScicopiaParser.DIGITS, ScicopiaParser.ABBREV, ScicopiaParser.CHARGED, ScicopiaParser.ALPHANUM, ScicopiaParser.STRING]: self.state = 52 self.term() pass else: raise NoViableAltException(self) except RecognitionException as re: localctx.exception = re self._errHandler.reportError(self, re) self._errHandler.recover(self, re) finally: self.exitRule() return localctx class TermContext(ParserRuleContext): __slots__ = 'parser' def __init__(self, parser, parent:ParserRuleContext=None, invokingState:int=-1): super().__init__(parent, invokingState) self.parser = parser def CHARGED(self): return self.getToken(ScicopiaParser.CHARGED, 0) def DASH(self): return self.getToken(ScicopiaParser.DASH, 0) def NUM(self): return self.getToken(ScicopiaParser.NUM, 0) def COMPOUND(self): return self.getToken(ScicopiaParser.COMPOUND, 0) def ALPHA(self): return self.getToken(ScicopiaParser.ALPHA, 0) def ABBREV(self): return self.getToken(ScicopiaParser.ABBREV, 0) def ALPHANUM(self): return self.getToken(ScicopiaParser.ALPHANUM, 0) def APOSTROPHE(self): return self.getToken(ScicopiaParser.APOSTROPHE, 0) def DIGITS(self): return self.getToken(ScicopiaParser.DIGITS, 0) def STRING(self): return self.getToken(ScicopiaParser.STRING, 0) def getRuleIndex(self): return ScicopiaParser.RULE_term def enterRule(self, listener:ParseTreeListener): if hasattr( listener, "enterTerm" ): listener.enterTerm(self) def exitRule(self, listener:ParseTreeListener): if hasattr( listener, "exitTerm" ): listener.exitTerm(self) def term(self): localctx = ScicopiaParser.TermContext(self, self._ctx, self.state) self.enterRule(localctx, 10, self.RULE_term) self._la = 0 # Token type try: self.enterOuterAlt(localctx, 1) self.state = 55 _la = self._input.LA(1) if not((((_la) & ~0x3f) == 0 and ((1 << _la) & ((1 << ScicopiaParser.DASH) | (1 << ScicopiaParser.NUM) | (1 << ScicopiaParser.COMPOUND) | (1 << ScicopiaParser.APOSTROPHE) | (1 << ScicopiaParser.ALPHA) | (1 << ScicopiaParser.DIGITS) | (1 << ScicopiaParser.ABBREV) | (1 << ScicopiaParser.CHARGED) | (1 << ScicopiaParser.ALPHANUM) | (1 << ScicopiaParser.STRING))) != 0)): self._errHandler.recoverInline(self) else: self._errHandler.reportMatch(self) self.consume() except RecognitionException as re: localctx.exception = re self._errHandler.reportError(self, re) self._errHandler.recover(self, re) finally: self.exitRule() return localctx
17,705
6,291
from pathlib import Path import sys sys.path.append(str(Path(__file__).resolve().parents[1])) from werewolf import create_app from werewolf.database import db app = create_app('db') with app.app_context(): db.drop_all() db.create_all()
259
95
import numpy as np import pytest from sklego.common import flatten from sklego.linear_model import ProbWeightRegression from tests.conftest import nonmeta_checks, regressor_checks, general_checks @pytest.mark.parametrize("test_fn", flatten([ nonmeta_checks, general_checks, regressor_checks ])) def test_estimator_checks(test_fn): regr_min_zero = ProbWeightRegression(non_negative=True) test_fn(ProbWeightRegression.__name__ + '_min_zero_true', regr_min_zero) regr_not_min_zero = ProbWeightRegression(non_negative=False) test_fn(ProbWeightRegression.__name__ + '_min_zero_true_false', regr_not_min_zero) def test_shape_trained_model(random_xy_dataset_regr): X, y = random_xy_dataset_regr mod_no_intercept = ProbWeightRegression() assert mod_no_intercept.fit(X, y).coefs_.shape == (X.shape[1], ) np.testing.assert_approx_equal(mod_no_intercept.fit(X, y).coefs_.sum(), 1.0, significant=4)
936
349
# -*- coding: utf-8 -*- """ Created on Sat Jun 29 19:44:28 2019 @author: Administrator """ class Solution: def canWin(self, s: str) -> bool: ans = self.generatePossibleNextMoves(s) print(ans) count = 0 for state in ans: # print(state) for k in range(len(state)-1): if state[k:k+2] == '++': count += 1 break # return True if count == len(ans): return False else: return True def generatePossibleNextMoves(self, s): res = [] for i in range(len(s) - 1): if s[i:i+2] == "++": res.append(s[:i] + "--" + s[i+2:]) #用到了字符串拼接 return res solu = Solution() s = "++++" s = "+++++" s = "++++++" print(solu.canWin(s))
854
306
"""The CSDMS Web Modeling Tool (WMT) execution server.""" __version__ = '0.3'
79
30
import matplotlib import matplotlib.pyplot as plt import numpy as np import pandas as pd save_results = False def plot_stored_GEM_reults(interval_x=None, interval_y=None): if interval_x is None: #interval_list_x = [0.499, 0.506] # 1 interval_list_x = [0, 1] #interval_list_x = [0.299, 0.305] # 2 #interval_list_x = [0.949, 0.953] # 3 #interval_list_x = [0.049, 0.052] else: interval_list_x = interval_x if interval_y is None: interval_list_y = [80, 345] else: interval_list_y = interval_y folder_name = 'GEM/data' df_DDPG = pd.read_pickle('GEM/data/DDPG_data') df_DDPG_I = pd.read_pickle('GEM/data/SEC_DDPG_data') df_PI = pd.read_pickle('GEM/data/GEM_PI_a4.pkl') ts = 1e-4 t_test = np.arange(0, len(df_DDPG['i_d_mess'][0]) * ts, ts).tolist() t_PI_2 = np.arange(-ts, len(df_PI['i_d_mess']) * ts-ts, ts).tolist() t_reward = np.arange(-ts-ts, round((len(df_DDPG['v_d_mess'][0])) * ts - ts -ts, 4), ts).tolist() reward_sec = df_DDPG_I['Reward_test'].tolist()[0] reward = df_DDPG['Reward_test'].tolist()[0] reward_PI = df_PI['Reward'].tolist() if save_results: params = {'backend': 'ps', 'text.latex.preamble': [r'\usepackage{gensymb}' r'\usepackage{amsmath,amssymb,mathtools}' r'\newcommand{\mlutil}{\ensuremath{\operatorname{ml-util}}}' r'\newcommand{\mlacc}{\ensuremath{\operatorname{ml-acc}}}'], 'axes.labelsize': 12.5, # fontsize for x and y labels (was 10) 'axes.titlesize': 12.5, 'font.size': 12.5, # was 10 'legend.fontsize': 12.5, # was 10 'xtick.labelsize': 12, 'ytick.labelsize': 12, 'text.usetex': True, 'figure.figsize': [5.2, 5.625],#[4.5, 7.5], 'font.family': 'serif', 'lines.linewidth': 1.2 } matplotlib.rcParams.update(params) fig, axs = plt.subplots(3, 1) axs[1].plot(t_test, [i * 160 * 1.41 for i in df_DDPG_I['i_q_mess'].tolist()[0]], 'r', label='$\mathrm{SEC}$') axs[1].plot(t_test, [i * 160 * 1.41 for i in df_DDPG['i_q_mess'].tolist()[0]], '-.r', label='$\mathrm{DDPG}_\mathrm{}$') axs[1].plot(t_test, [i * 160 * 1.41 for i in df_PI['i_q_mess'].tolist()], '--r', label='$\mathrm{PI}_\mathrm{}$') axs[1].plot(t_test, [i * 160 * 1.41 for i in df_DDPG_I['i_q_ref'].tolist()[0]], ':', color='gray', label='$\mathrm{i}_\mathrm{q}^*$', linewidth=2) axs[1].plot(t_test, [i * 160 * 1.41 for i in df_PI['i_q_ref'].tolist()], ':', color='gray', label='$\mathrm{i}_\mathrm{q}^*$', linewidth=2) axs[1].grid() # axs[1].legend() axs[1].set_xlim(interval_list_x) axs[1].set_ylim([-0.5 * 160 * 1.41, 0.55 * 160 * 1.41]) # 1 #axs[1].set_ylim([-0 * 160 * 1.41, 0.4 * 160 * 1.41]) # 2 #axs[1].set_ylim([0.37 * 160 * 1.41, 0.52 * 160 * 1.41]) # 3 # axs[0].set_xlabel(r'$t\,/\,\mathrm{s}$') axs[1].tick_params(axis='x', colors='w') axs[1].set_ylabel("$i_{\mathrm{q}}\,/\,{\mathrm{A}}$") axs[1].tick_params(direction='in') axs[0].plot(t_test, [i * 160 * 1.41 for i in df_DDPG_I['i_d_mess'].tolist()[0]], 'b', label='$\mathrm{SEC}_\mathrm{}$') axs[0].plot(t_test, [i * 160 * 1.41 for i in df_DDPG['i_d_mess'].tolist()[0]], '-.b', label='$\mathrm{DDPG}_\mathrm{}$') axs[0].plot(t_test, [i * 160 * 1.41 for i in df_PI['i_d_mess'].tolist()], '--b', label='$\mathrm{PI}_\mathrm{}$') axs[0].plot(t_test, [i * 160 * 1.41 for i in df_DDPG_I['i_d_ref'].tolist()[0]], ':', color='gray', label='$i_\mathrm{}^*$', linewidth=2) axs[0].grid() axs[0].legend(bbox_to_anchor = (0, 1.02, 1, 0.2), loc="lower left",mode="expand", borderaxespad=0, ncol=4) axs[0].set_xlim(interval_list_x) axs[0].set_ylim([-0.78 * 160 * 1.41, 0.05 * 160 * 1.41]) # axs[0].set_ylim([-0.78 * 160 * 1.41, 0.05 * 160 * 1.41]) # 1 #axs[0].set_ylim([-0.9 * 160 * 1.41, 0.005 * 160 * 1.41]) # 2 #axs[0].set_ylim([-1 * 160 * 1.41, -0.2 * 160 * 1.41]) # 3 axs[0].tick_params(axis='x', colors='w') axs[0].set_ylabel("$i_{\mathrm{d}}\,/\,{\mathrm{A}}$") axs[0].tick_params(direction='in') fig.subplots_adjust(wspace=0, hspace=0.05) axs[2].plot(t_reward, [i * 200 for i in df_DDPG_I['v_q_mess'].tolist()[0]], 'r', label='$\mathrm{SEC}$') axs[2].plot(t_reward, [i * 200 for i in df_DDPG['v_q_mess'].tolist()[0]], '-.r', label='$\mathrm{DDPG}_\mathrm{}$') axs[2].plot(t_PI_2, [i * 200 for i in df_PI['v_q_mess'].tolist()], '--r', label='$\mathrm{PI}_\mathrm{}$') axs[2].plot(t_reward, [i * 200 for i in df_DDPG_I['v_d_mess'].tolist()[0]], 'b', label='$\mathrm{SEC}$') axs[2].plot(t_reward, [i * 200 for i in df_DDPG['v_d_mess'].tolist()[0]], '-.b', label='$\mathrm{DDPG}_\mathrm{}$') axs[2].plot(t_PI_2, [i * 200 for i in df_PI['v_d_mess'].tolist()], '--b', label='$\mathrm{PI}_\mathrm{}$') #axs[2].plot(t_reward, df_DDPG_I['v_q_mess'].tolist()[0], 'r', label='$\mathrm{SEC}$') #axs[2].plot(t_reward, df_DDPG['v_q_mess'].tolist()[0], '-.r', # label='$\mathrm{DDPG}_\mathrm{}$') #axs[2].plot(t_reward, df_PI['v_q_mess'].tolist(), '--r', # label='$\mathrm{PI}_\mathrm{}$') # axs[2].plot(t_reward, df_DDPG_I['v_d_mess'].tolist()[0], 'b', label='$\mathrm{SEC}$') # axs[2].plot(t_reward, df_DDPG['v_d_mess'].tolist()[0], '--b', label='$\mathrm{DDPG}_\mathrm{}$') # axs[2].plot(t_PI_3, df_PI['v_d_mess'].tolist(), '--b', label='$\mathrm{PI}_\mathrm{}$') axs[2].grid() # axs[1].legend() axs[2].set_xlim(interval_list_x) #axs[2].set_ylim([-100, 100]) # axs[0].set_xlabel(r'$t\,/\,\mathrm{s}$') #axs[2].set_xlabel(r'$t\,/\,\mathrm{s}$') #axs[2].tick_params(axis='x', colors='w') axs[2].set_xlabel(r'$t\,/\,\mathrm{s}$') axs[2].set_ylabel("$v_{\mathrm{dq}}\,/\,{\mathrm{V}}$") #axs[2].set_ylabel("$u_{\mathrm{dq}}\,/\, v_\mathrm{DC}\,/\,2$") axs[2].tick_params(direction='in') """ axs[3].plot(t_test, reward_sec, 'b', label=f' SEC-DDPG: ' f'{round(sum(reward_sec[int(interval_list_x[0] / ts):int(interval_list_x[1] / ts)]) / ((interval_list_x[1] - interval_list_x[0]) / ts), 4)}') axs[3].plot(t_test, reward, 'r', label=f'DDPG: ' f'{round(sum(reward[int(interval_list_x[0] / ts):int(interval_list_x[1] / ts)]) / ((interval_list_x[1] - interval_list_x[0]) / ts), 4)}') axs[3].plot(t_PI_2, reward_PI, '--r', label=f'PI: ' f'{round(sum(reward_PI[int(interval_list_x[0] / ts):int(interval_list_x[1] / ts)]) / ((interval_list_x[1] - interval_list_x[0]) / ts), 4)}') axs[3].grid() axs[3].set_xlim(interval_list_x) #axs[3].legend() axs[3].set_ylabel("Reward") plt.show() """ plt.show() if save_results: fig.savefig(f'{folder_name}/GEM_DDPG_I_noI_idq1.pgf') fig.savefig(f'{folder_name}/GEM_DDPG_I_noI_idq1.png') fig.savefig(f'{folder_name}/GEM_DDPG_I_noI_idq1.pdf') plt.plot(t_test, reward_sec, 'b', label=f' SEC-DDPG: ' f'{round(sum(reward_sec[int(interval_list_x[0] / ts):int(interval_list_x[1] / ts)]) / ((interval_list_x[1] - interval_list_x[0]) / ts), 4)}') plt.plot(t_test, reward, 'r', label=f'DDPG: ' f'{round(sum(reward[int(interval_list_x[0] / ts):int(interval_list_x[1] / ts)]) / ((interval_list_x[1] - interval_list_x[0]) / ts), 4)}') plt.plot(t_test, reward_PI, '--r', label=f'PI: ' f'{round(sum(reward_PI[int(interval_list_x[0] / ts):int(interval_list_x[1] / ts)]) / ((interval_list_x[1] - interval_list_x[0]) / ts), 4)}') plt.grid() plt.xlim(interval_list_x) plt.legend() plt.ylabel("Reward") plt.show() plot_stored_GEM_reults()
8,284
3,730
# # Copyright 2020 Antoine Sanner # 2020 Lars Pastewka # # ### MIT license # # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included in # all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE # AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE # SOFTWARE. # import numpy as np from NuMPI import MPI from Adhesion.Interactions import Potential, SoftWall class PowerLaw(Potential): r""" Polynomial interaction wiches value, first and second derivatives are 0 at the cutoff radius :math:`r_c` .. math :: (r < r_c) \ (1 - r / r_c)^p With the exponent :math:`p >= 3` """ name = "PowerLaw" def __init__(self, work_of_adhesion, cutoff_radius, exponent=3, communicator=MPI.COMM_WORLD): """ Parameters: ----------- work_of_adhesion: float or ndarray surface energy at perfect contact cutoff_radius: float or ndarray distance :math:`r_c` at which the potential has decayed to 0 """ self.cutoff_radius = self.rho = cutoff_radius self.work_of_adhesion = work_of_adhesion self.exponent = exponent SoftWall.__init__(self, communicator=communicator) def __repr__(self, ): return ( "Potential '{0.name}': " "work_of_adhesion = {0.work_of_adhesion}," "cutoff_radius = {0.cutoff_radius}, exponent = {0.exponent}" ).format(self) def __getstate__(self): state = super().__getstate__(), \ self.exponent, self.rho, self.work_of_adhesion return state def __setstate__(self, state): superstate, self.exponent, self.rho, self.work_of_adhesion = state super().__setstate__(superstate) @property def has_cutoff(self): return True @property def r_min(self): return None @property def r_infl(self): return None @property def max_tensile(self): return - self.work_of_adhesion / self.rho * self.exponent def evaluate(self, gap, potential=True, gradient=False, curvature=False, mask=None): r = np.asarray(gap) if mask is None: mask = (slice(None), ) * len(r.shape) w = self.work_of_adhesion if np.isscalar(self.work_of_adhesion) \ else self.work_of_adhesion[mask] rc = self.rho if np.isscalar(self.rho) else self.rho[mask] p = self.exponent g = (1 - r / rc) V = dV = ddV = None gpm2 = g ** (p - 2) gpm1 = gpm2 * g if potential: V = np.where(g > 0, - w * gpm1 * g, 0) if gradient: dV = np.where(g > 0, p * w / rc * gpm1, 0) if curvature: ddV = np.where(g > 0, - p * (p - 1) * w / rc ** 2 * gpm2, 0) return V, dV, ddV
3,725
1,261
import os import glob from ast import literal_eval import numpy as np import sympy from sympy import pi, sin, cos, var from sympy.printing import ccode from compmech.conecyl.sympytools import mprint_as_sparse, pow2mult var('x1t, x1r, x2t, x2r') var('y1t, y1r, y2t, y2r') var('xi1, xi2') var('c0, c1') subs = { } def List(*e): return list(e) header_c = """ #include <stdlib.h> #include <math.h> #if defined(_WIN32) || defined(__WIN32__) #define EXPORTIT __declspec(dllexport) #else #define EXPORTIT #endif """ printstr_full = header_c printstr_12 = header_c printstr_c0c1 = header_c header_h = """ #if defined(_WIN32) || defined(__WIN32__) #define IMPORTIT __declspec(dllimport) #else #define IMPORTIT #endif """ printstr_full_h = header_h printstr_12_h = header_h printstr_c0c1_h = header_h for i, filepath in enumerate( glob.glob(r'.\bardell_integrals_mathematica\fortran_*.txt')): print(filepath) with open(filepath) as f: filename = os.path.basename(filepath) names = filename[:-4].split('_') lines = [line.strip() for line in f.readlines()] string = ''.join(lines) string = string.replace('\\','') tmp = eval(string) print '\tfinished eval' printstr = '' if '_12' in filepath: name = '_'.join(names[1:3]) printstr += 'EXPORTIT double integral_%s(double xi1, double xi2, int i, int j,\n' % name printstr += ' double x1t, double x1r, double x2t, double x2r,\n' printstr += ' double y1t, double y1r, double y2t, double y2r) {\n' elif '_c0c1' in filepath: name = '_'.join(names[1:3]) printstr += 'EXPORTIT double integral_%s(double c0, double c1, int i, int j,\n' % name printstr += ' double x1t, double x1r, double x2t, double x2r,\n' printstr += ' double y1t, double y1r, double y2t, double y2r) {\n' else: name = names[1] printstr += 'EXPORTIT double integral_%s(int i, int j,\n' % name printstr += ' double x1t, double x1r, double x2t, double x2r,\n' printstr += ' double y1t, double y1r, double y2t, double y2r) {\n' printstr_h = '\n' printstr_h += '#ifndef BARDELL_%s_H\n' % name.upper() printstr_h += '#define BARDELL_%s_H\n' % name.upper() printstr_h += printstr.replace(' {', ';').replace('EXPORTIT', 'IMPORTIT') printstr_h += '#endif /** BARDELL_%s_H */\n' % name.upper() printstr_h += '\n' matrix = sympy.Matrix(np.atleast_2d(tmp)) for i in range(matrix.shape[0]): activerow = False for j in range(matrix.shape[1]): if matrix[i, j] == 0: continue if not activerow: activerow = True if i == 0: printstr += ' switch(i) {\n' else: printstr += ' default:\n' printstr += ' return 0.;\n' printstr += ' }\n' printstr += ' case %d:\n' % i printstr += ' switch(j) {\n' printstr += ' case %d:\n' % j printstr += ' return %s;\n' % ccode(matrix[i, j].evalf()) printstr += ' default:\n' printstr += ' return 0.;\n' printstr += ' }\n' printstr += ' default:\n' printstr += ' return 0.;\n' printstr += ' }\n' printstr += '}\n' if '_12' in filepath: printstr_12_h += printstr_h filepath = r'..\..\..\compmech\lib\src\bardell_integral_%s_12.c' % name[:-3] with open(filepath, 'w') as g: g.write(printstr_12 + printstr) elif '_c0c1' in filepath: printstr_c0c1_h += printstr_h filepath = r'..\..\..\compmech\lib\src\bardell_integral_%s_c0c1.c' % name[:-5] with open(filepath, 'w') as g: g.write(printstr_c0c1 + printstr) else: printstr_full += printstr printstr_full_h += printstr_h with open(r'..\..\..\compmech\include\bardell.h', 'w') as g: g.write(printstr_full_h) with open(r'..\..\..\compmech\lib\src\bardell.c', 'w') as g: g.write(printstr_full) with open(r'..\..\..\compmech\include\bardell_12.h', 'w') as g: g.write(printstr_12_h) with open(r'..\..\..\compmech\include\bardell_c0c1.h', 'w') as g: g.write(printstr_c0c1_h)
4,687
1,688
import time import numpy as np from sparsecoding import sparse_encode_omp from sparsecoding import sparse_encode_nnmp from distributedpowermethod import distri_powermethod def cloud_ksvd(X, AtomN, dict_init, s, NodeN, networkGraph, vec_init, max_iter, powerIterations, consensusIterations): sigdim = X[0].shape[0] D = np.zeros([sigdim, AtomN, max_iter+1, NodeN]) for i in range(NodeN): D[:,:,0,i] = dict_init theta = [[] for i in range(NodeN)] for iters in range(max_iter): t0 = time.time() for nodes in range(NodeN): D[:,:,iters+1,nodes] = np.copy(D[:,:,iters,nodes]) theta[nodes] = sparse_encode_omp(X[nodes], D[:,:,iters+1,nodes], s) for k in range(AtomN): multipliedMat = np.zeros([sigdim,sigdim,NodeN]) index_temp = [[] for i in range(NodeN)] ER_temp = [[] for i in range(NodeN)] for nodes in range(NodeN): indexes = np.nonzero(theta[nodes][k,:]!=0)[0] index_temp[nodes] = indexes if len(indexes)>0: tempcoef = theta[nodes][:,indexes] tempcoef[k,:] = 0 ER = X[nodes][:,indexes] - np.dot(D[:,:,iters+1,nodes], tempcoef) ER_temp[nodes] = ER multipliedMat[:,:,nodes] = np.dot(ER, ER.T) if np.max(np.abs(multipliedMat))>0: newatom = distri_powermethod(vec_init, multipliedMat, NodeN, networkGraph, powerIterations, consensusIterations) for nodes in range(NodeN): D[:,k,iters+1,nodes] = newatom[nodes,:] if len(index_temp[nodes])>0: theta[nodes][k,index_temp[nodes]] = np.dot(ER_temp[nodes].T, newatom[nodes,:]) dt = time.time() - t0 print('the %dth iteration takes %f seconds' %(iters,dt)) return D def cloud_nnksvd(X, AtomN, dict_init, s, NodeN, networkGraph, vec_init, max_iter, updatec_iter, powerIterations, consensusIterations): alteritern = 10 sigdim = X[0].shape[0] D = np.zeros([sigdim, AtomN, max_iter+1, NodeN]) for i in range(NodeN): D[:,:,0,i] = dict_init theta = [[] for i in range(NodeN)] for iters in range(max_iter): t0 = time.time() for nodes in range(NodeN): D[:,:,iters+1,nodes] = np.copy(D[:,:,iters,nodes]) theta[nodes] = sparse_encode_nnmp(X[nodes], D[:,:,iters+1,nodes], s, updatec_iter) for k in range(AtomN): multipliedMat = np.zeros([sigdim,sigdim,NodeN]) index_temp = [[] for i in range(NodeN)] ER_temp = [[] for i in range(NodeN)] v_temp = [[] for i in range(NodeN)] for nodes in range(NodeN): indexes = np.nonzero(theta[nodes][k,:]!=0)[0] index_temp[nodes] = indexes if len(indexes)>0: tempcoef = theta[nodes][:,indexes] tempcoef[k,:] = 0 ER = X[nodes][:,indexes] - np.dot(D[:,:,iters+1,nodes], tempcoef) ER_temp[nodes] = ER multipliedMat[:,:,nodes] = np.dot(ER, ER.T) if np.max(np.abs(multipliedMat))>0: newatom = distri_powermethod(vec_init, multipliedMat, NodeN, networkGraph, powerIterations, consensusIterations) flag = 0 for nodes in range(NodeN): if len(index_temp[nodes])>0: v_temp[nodes] = np.dot(ER_temp[nodes].T, newatom[nodes,:]) if np.all(v_temp[nodes]<0)==True: flag = 1 break if flag==1: newatom = -newatom for nodes in range(NodeN): if len(index_temp[nodes])>0: v_temp[nodes] = np.dot(ER_temp[nodes].T, newatom[nodes,:]) newatom = (newatom>0)*newatom for nodes in range(NodeN): if len(index_temp[nodes])>0: v_temp[nodes] = (v_temp[nodes]>0)*v_temp[nodes] for subiters in range(alteritern): sumUpper = np.zeros([NodeN,sigdim]) sumLower = np.zeros(NodeN) for nodes in range(NodeN): sumUpper[nodes,:] = np.dot(ER_temp[nodes], v_temp[nodes]) sumLower[nodes] = np.dot(v_temp[nodes], v_temp[nodes]) for consiter in range(consensusIterations): sumUpper = np.dot(networkGraph, sumUpper) sumLower = np.dot(networkGraph, sumLower) division = np.tile(sumLower, (sigdim, 1)).T newu = sumUpper/division newu = (newu>0)*newu for nodes in range(NodeN): if len(index_temp[nodes])>0: v_temp[nodes] = np.dot(newu[nodes,:], ER_temp[nodes])/np.dot(newu[nodes,:], newu[nodes,:]) v_temp[nodes] = (v_temp[nodes]>0)*v_temp[nodes] del newatom newatom = np.copy(newu) for nodes in range(NodeN): if len(index_temp[nodes])>0: normu = np.linalg.norm(newatom[nodes,:]) D[:,k,iters+1,nodes] = newatom[nodes,:]/normu theta[nodes][k,index_temp[nodes]] = v_temp[nodes]*normu dt = time.time() - t0 print('the %dth iteration takes %f seconds' %(iters,dt)) return D
6,277
2,034
# Simple Game # Demonstrates importing modules import games, random print("Welcome to the world's simplest game!\n") again = None while again != "n": players = [] num = games.ask_number(question = "How many players? (2 - 5): ", low = 2, high = 5) for i in range(num): name = input("Player name: ") score = random.randrange(100) + 1 player = games.Player(name, score) players.append(player) print("\nHere are the game results:") for player in players: print(player) again = games.ask_yes_no("\nDo you want to play again? (y/n): ") input("\n\nPress the enter key to exit.")
677
214
import engine class Player: def talk(self, message: str) -> None: engine_version = engine.get_version() engine.print_log(message=f"Engine version = {engine_version}")
189
56
import argparse import yomikatawa as yomi def create_parser(): parser = argparse.ArgumentParser(description="A command line interface for https://yomikatawa.com.") parser.add_argument("-c", "--category", type=str, default="kanji", help="print possible choices on error") parser.add_argument("-r", "--romaji", action="store_true", dest="print_romaji", help="output romaji") parser.add_argument("-s", "--same-reading", action="store_true", dest="print_same_reading_words", help="output words with same reading") parser.add_argument("input_word", type=str) return parser def main(): args = create_parser().parse_args() result = yomi.search(args.input_word, category=args.category) print("Hiragana: " + result.hiragana) if args.print_romaji: print("Romaji: " + result.romaji) if args.print_same_reading_words: print("Same reading: " + str(result.same_reading_words)) if __name__ == "__main__": main()
964
311
""" A module hosting all algorithms devised by Izzo """ import time import numpy as np from numpy import cross, pi from numpy.linalg import norm from scipy.special import hyp2f1 def izzo2015( mu, r1, r2, tof, M=0, prograde=True, low_path=True, maxiter=35, atol=1e-5, rtol=1e-7, full_output=False, ): r""" Solves Lambert problem using Izzo's devised algorithm. Parameters ---------- mu: float Gravitational parameter, equivalent to :math:`GM` of attractor body. r1: numpy.array Initial position vector. r2: numpy.array Final position vector. M: int Number of revolutions. Must be equal or greater than 0 value. prograde: bool If `True`, specifies prograde motion. Otherwise, retrograde motion is imposed. low_path: bool If two solutions are available, it selects between high or low path. maxiter: int Maximum number of iterations. atol: float Absolute tolerance. rtol: float Relative tolerance. full_output: bool If True, the number of iterations is also returned. Returns ------- v1: numpy.array Initial velocity vector. v2: numpy.array Final velocity vector. numiter: list Number of iterations. Notes ----- This is the algorithm devised by Dario Izzo[1] in 2015. It inherits from the one developed by Lancaster[2] during the 60s, following the universal formulae approach. It is one of the most modern solvers, being a complete Lambert's problem solver (zero and Multiple-revolution solutions). It shows high performance and robustness while requiring no more than four iterations to reach a solution. All credits of the implementation go to Juan Luis Cano Rodríguez and the poliastro development team, from which this routine inherits. Some changes were made to adapt it to `lamberthub` API. In addition, the hypergeometric function is the one from SciPy. Copyright (c) 2012-2021 Juan Luis Cano Rodríguez and the poliastro development team References ---------- [1] Izzo, D. (2015). Revisiting Lambert’s problem. Celestial Mechanics and Dynamical Astronomy, 121(1), 1-15. [2] Lancaster, E. R., & Blanchard, R. C. (1969). A unified form of Lambert's theorem (Vol. 5368). National Aeronautics and Space Administration. """ # Check that input parameters are safe #assert_parameters_are_valid(mu, r1, r2, tof, M) # Chord c = r2 - r1 c_norm, r1_norm, r2_norm = norm(c), norm(r1), norm(r2) # Semiperimeter s = (r1_norm + r2_norm + c_norm) * 0.5 # Versors i_r1, i_r2 = r1 / r1_norm, r2 / r2_norm i_h = cross(i_r1, i_r2) i_h = i_h / norm(i_h) # Geometry of the problem ll = np.sqrt(1 - min(1.0, c_norm / s)) # Compute the fundamental tangential directions if i_h[2] < 0: ll = -ll i_t1, i_t2 = cross(i_r1, i_h), cross(i_r2, i_h) else: i_t1, i_t2 = cross(i_h, i_r1), cross(i_h, i_r2) # Correct transfer angle parameter and tangential vectors regarding orbit's # inclination ll, i_t1, i_t2 = (-ll, -i_t1, -i_t2) if prograde is False else (ll, i_t1, i_t2) # Non dimensional time of flight T = np.sqrt(2 * mu / s ** 3) * tof # Find solutions and filter them x, y, numiter, tpi = _find_xy(ll, T, M, maxiter, atol, rtol, low_path) # Reconstruct gamma = np.sqrt(mu * s / 2) rho = (r1_norm - r2_norm) / c_norm sigma = np.sqrt(1 - rho ** 2) # Compute the radial and tangential components at initial and final # position vectors V_r1, V_r2, V_t1, V_t2 = _reconstruct(x, y, r1_norm, r2_norm, ll, gamma, rho, sigma) # Solve for the initial and final velocity v1 = V_r1 * (r1 / r1_norm) + V_t1 * i_t1 v2 = V_r2 * (r2 / r2_norm) + V_t2 * i_t2 return (v1, v2, numiter, tpi) if full_output is True else (v1, v2) def _reconstruct(x, y, r1, r2, ll, gamma, rho, sigma): """Reconstruct solution velocity vectors.""" V_r1 = gamma * ((ll * y - x) - rho * (ll * y + x)) / r1 V_r2 = -gamma * ((ll * y - x) + rho * (ll * y + x)) / r2 V_t1 = gamma * sigma * (y + ll * x) / r1 V_t2 = gamma * sigma * (y + ll * x) / r2 return [V_r1, V_r2, V_t1, V_t2] def _find_xy(ll, T, M, maxiter, atol, rtol, low_path): """Computes all x, y for given number of revolutions.""" # For abs(ll) == 1 the derivative is not continuous assert abs(ll) < 1 M_max = np.floor(T / pi) T_00 = np.arccos(ll) + ll * np.sqrt(1 - ll ** 2) # T_xM # Refine maximum number of revolutions if necessary if T < T_00 + M_max * pi and M_max > 0: _, T_min = _compute_T_min(ll, M_max, maxiter, atol, rtol) if T < T_min: M_max -= 1 # Check if a feasible solution exist for the given number of revolutions # This departs from the original paper in that we do not compute all solutions if M > M_max: raise ValueError("No feasible solution, try lower M!") # Initial guess x_0 = _initial_guess(T, ll, M, low_path) # Start Householder iterations from x_0 and find x, y x, numiter, tpi = _householder(x_0, T, ll, M, atol, rtol, maxiter) y = _compute_y(x, ll) return x, y, numiter, tpi def _compute_y(x, ll): """Computes y.""" return np.sqrt(1 - ll ** 2 * (1 - x ** 2)) def _compute_psi(x, y, ll): """Computes psi. "The auxiliary angle psi is computed using Eq.(17) by the appropriate inverse function" """ if -1 <= x < 1: # Elliptic motion # Use arc cosine to avoid numerical errors return np.arccos(x * y + ll * (1 - x ** 2)) elif x > 1: # Hyperbolic motion # The hyperbolic sine is bijective return np.arcsinh((y - x * ll) * np.sqrt(x ** 2 - 1)) else: # Parabolic motion return 0.0 def _tof_equation(x, T0, ll, M): """Time of flight equation.""" return _tof_equation_y(x, _compute_y(x, ll), T0, ll, M) def _tof_equation_y(x, y, T0, ll, M): """Time of flight equation with externally computated y.""" if M == 0 and np.sqrt(0.6) < x < np.sqrt(1.4): eta = y - ll * x S_1 = (1 - ll - x * eta) * 0.5 Q = 4 / 3 * hyp2f1(3, 1, 5 / 2, S_1) T_ = (eta ** 3 * Q + 4 * ll * eta) * 0.5 else: psi = _compute_psi(x, y, ll) T_ = np.divide( np.divide(psi + M * pi, np.sqrt(np.abs(1 - x ** 2))) - x + ll * y, (1 - x ** 2), ) return T_ - T0 def _tof_equation_p(x, y, T, ll): # TODO: What about derivatives when x approaches 1? return (3 * T * x - 2 + 2 * ll ** 3 * x / y) / (1 - x ** 2) def _tof_equation_p2(x, y, T, dT, ll): return (3 * T + 5 * x * dT + 2 * (1 - ll ** 2) * ll ** 3 / y ** 3) / (1 - x ** 2) def _tof_equation_p3(x, y, _, dT, ddT, ll): return (7 * x * ddT + 8 * dT - 6 * (1 - ll ** 2) * ll ** 5 * x / y ** 5) / ( 1 - x ** 2 ) def _compute_T_min(ll, M, maxiter, atol, rtol): """Compute minimum T.""" if ll == 1: x_T_min = 0.0 T_min = _tof_equation(x_T_min, 0.0, ll, M) else: if M == 0: x_T_min = np.inf T_min = 0.0 else: # Set x_i > 0 to avoid problems at ll = -1 x_i = 0.1 T_i = _tof_equation(x_i, 0.0, ll, M) x_T_min = _halley(x_i, T_i, ll, atol, rtol, maxiter) T_min = _tof_equation(x_T_min, 0.0, ll, M) return [x_T_min, T_min] def _initial_guess(T, ll, M, low_path): """Initial guess.""" if M == 0: # Single revolution T_0 = np.arccos(ll) + ll * np.sqrt(1 - ll ** 2) + M * pi # Equation 19 T_1 = 2 * (1 - ll ** 3) / 3 # Equation 21 if T >= T_0: x_0 = (T_0 / T) ** (2 / 3) - 1 elif T < T_1: x_0 = 5 / 2 * T_1 / T * (T_1 - T) / (1 - ll ** 5) + 1 else: # This is the real condition, which is not exactly equivalent # elif T_1 < T < T_0 x_0 = (T_0 / T) ** (np.log2(T_1 / T_0)) - 1 return x_0 else: # Multiple revolution x_0l = (((M * pi + pi) / (8 * T)) ** (2 / 3) - 1) / ( ((M * pi + pi) / (8 * T)) ** (2 / 3) + 1 ) x_0r = (((8 * T) / (M * pi)) ** (2 / 3) - 1) / ( ((8 * T) / (M * pi)) ** (2 / 3) + 1 ) # Filter out the solution x_0 = np.max([x_0l, x_0r]) if low_path is True else np.min([x_0l, x_0r]) return x_0 def _halley(p0, T0, ll, atol, rtol, maxiter): """Find a minimum of time of flight equation using the Halley method. Note ---- This function is private because it assumes a calling convention specific to this module and is not really reusable. """ for ii in range(1, maxiter + 1): y = _compute_y(p0, ll) fder = _tof_equation_p(p0, y, T0, ll) fder2 = _tof_equation_p2(p0, y, T0, fder, ll) if fder2 == 0: raise RuntimeError("Derivative was zero") fder3 = _tof_equation_p3(p0, y, T0, fder, fder2, ll) # Halley step (cubic) p = p0 - 2 * fder * fder2 / (2 * fder2 ** 2 - fder * fder3) if abs(p - p0) < rtol * np.abs(p0) + atol: return p p0 = p raise RuntimeError("Failed to converge") def _householder(p0, T0, ll, M, atol, rtol, maxiter): """Find a zero of time of flight equation using the Householder method. Note ---- This function is private because it assumes a calling convention specific to this module and is not really reusable. """ # The clock starts together with the iteration tic = time.perf_counter() for numiter in range(1, maxiter + 1): y = _compute_y(p0, ll) fval = _tof_equation_y(p0, y, T0, ll, M) T = fval + T0 fder = _tof_equation_p(p0, y, T, ll) fder2 = _tof_equation_p2(p0, y, T, fder, ll) fder3 = _tof_equation_p3(p0, y, T, fder, fder2, ll) # Householder step (quartic) p = p0 - fval * ( (fder ** 2 - fval * fder2 / 2) / (fder * (fder ** 2 - fval * fder2) + fder3 * fval ** 2 / 6) ) if abs(p - p0) < rtol * np.abs(p0) + atol: # Stop the clock and compute the time per iteration tac = time.perf_counter() tpi = (tac - tic) / numiter return p, numiter, tpi p0 = p raise RuntimeError("Failed to converge")
10,873
4,352
''' Test deleting SG with 2 attached NICs. @author: Youyk ''' import zstackwoodpecker.test_util as test_util import zstackwoodpecker.test_lib as test_lib import zstackwoodpecker.test_state as test_state import zstackwoodpecker.zstack_test.zstack_test_security_group as test_sg_header import zstackwoodpecker.zstack_test.zstack_test_sg_vm as test_sg_vm_header import apibinding.inventory as inventory test_stub = test_lib.lib_get_test_stub() test_obj_dict = test_state.TestStateDict() Port = test_state.Port def test(): ''' Test image requirements: 1. have nc to check the network port 2. have "nc" to open any port 3. it doesn't include a default firewall VR image is a good candiate to be the guest image. ''' test_util.test_dsc("Create 3 VMs with vlan VR L3 network and using VR image.") vm1 = test_stub.create_sg_vm() test_obj_dict.add_vm(vm1) vm2 = test_stub.create_sg_vm() test_obj_dict.add_vm(vm2) vm1.check() vm2.check() test_util.test_dsc("Create security groups.") sg1 = test_stub.create_sg() sg_vm = test_sg_vm_header.ZstackTestSgVm() test_obj_dict.set_sg_vm(sg_vm) l3_uuid = vm1.vm.vmNics[0].l3NetworkUuid vr_vm = test_lib.lib_find_vr_by_vm(vm1.vm)[0] vm2_ip = test_lib.lib_get_vm_nic_by_l3(vm2.vm, l3_uuid).ip rule1 = test_lib.lib_gen_sg_rule(Port.rule1_ports, inventory.TCP, inventory.INGRESS, vm2_ip) rule2 = test_lib.lib_gen_sg_rule(Port.rule2_ports, inventory.TCP, inventory.INGRESS, vm2_ip) rule3 = test_lib.lib_gen_sg_rule(Port.rule3_ports, inventory.TCP, inventory.INGRESS, vm2_ip) sg1.add_rule([rule1]) sg1.add_rule([rule2]) sg1.add_rule([rule3]) sg_vm.check() nic_uuid1 = vm1.vm.vmNics[0].uuid nic_uuid2 = vm2.vm.vmNics[0].uuid # nic_uuid3 = vm2.vm.vmNics[0].uuid vm1_nics = (nic_uuid1, vm1) vm2_nics = (nic_uuid2, vm2) # vm3_nics = (nic_uuid3, vm3) #test_stub.lib_add_sg_rules(sg1.uuid, [rule0, rule1]) test_util.test_dsc("Add nic to security group 1.") test_util.test_dsc("Allowed ingress ports: %s" % test_stub.rule1_ports) #sg_vm.attach(sg1, [vm1_nics, vm2_nics, vm3_nics]) sg_vm.attach(sg1, [vm1_nics, vm2_nics]) sg_vm.check() sg_vm.delete_sg(sg1) sg_vm.check() vm1.destroy() test_obj_dict.rm_vm(vm1) vm2.destroy() test_obj_dict.rm_vm(vm2) test_util.test_pass('Delete Security Group with 2 attached NICs Success') #Will be called only if exception happens in test(). def error_cleanup(): test_lib.lib_error_cleanup(test_obj_dict)
2,688
1,128
# Figure 5 in https://arxiv.org/pdf/1909.13404.pdf (towards modular and programmable architecture search) import sane_tikz.core as stz import sane_tikz.formatting as fmt frame_height = 9.5 frame_width = 10.0 frame_spacing = 0.2 frame_roundness = 0.6 frame_line_width = 4.5 * fmt.standard_line_width module_height = 1.6 module_width = 2.8 io_height = 0.40 io_long_side = 0.9 io_short_side = 1.0 * io_long_side io_spacing = 0.12 p_height = 1.2 * io_height p_width = 1.2 p_spacing = io_spacing / 2.0 h_width = 1 * p_width h_height = 1.3 * p_height h_spacing = io_spacing / 2.0 io_corner_roundness = 0.0 module_roundness = 0.0 line_width = 2.0 * fmt.standard_line_width module_inner_vertical_spacing = 0.1 delta_increment = 0.0 horizontal_module_spacing = 0.2 vertical_module_spacing = 0.2 spacing_between_module_and_hyperp = 0.8 spacing_between_hyperp_and_hyperp = 0.4 arrow_length = vertical_module_spacing name2color = fmt.google_slides_named_colors() connect_s_fmt = fmt.combine_tikz_strs( [fmt.arrow_heads("end"), fmt.line_width(line_width)]) input_s_fmt = fmt.combine_tikz_strs([ fmt.line_width(line_width), ]) output_s_fmt = fmt.combine_tikz_strs([ fmt.line_width(line_width), ]) property_s_fmt = fmt.combine_tikz_strs([ fmt.line_width(line_width), ]) module_s_fmt = fmt.combine_tikz_strs([ fmt.line_width(line_width), ]) hyperp_s_fmt = fmt.combine_tikz_strs([ fmt.line_width(line_width), ]) frame_s_fmt = fmt.combine_tikz_strs([ fmt.rounded_corners(frame_roundness), fmt.line_width(frame_line_width), ]) unassigned_h_s_fmt = fmt.combine_tikz_strs([ fmt.anchor("left_center"), ]) assigned_h_s_fmt = fmt.combine_tikz_strs([ fmt.anchor("left_center"), ]) def input(name): x1 = io_short_side / 2.0 x2 = io_long_side / 2.0 r = stz.closed_path([[-x1, io_height], [x1, io_height], [x2, 0], [-x2, 0]], input_s_fmt) l = stz.latex(stz.center_coords(r), name) return [r, l] def output(name): x1 = io_long_side / 2.0 x2 = io_short_side / 2.0 r = stz.closed_path([[-x1, io_height], [x1, io_height], [x2, 0], [-x2, 0]], output_s_fmt) l = stz.latex(stz.center_coords(r), name) return [r, l] def property(name, width_scale=1.0, height_scale=1.0): e = stz.ellipse([0, 0], width_scale * p_width / 2.0, height_scale * p_height / 2.0, property_s_fmt) l = stz.latex(stz.center_coords(e), name) return [e, l] def module(module_name, input_names, output_names, hyperp_names, p_width_scale=1.0): i_lst = [input(s) for s in input_names] o_lst = [output(s) for s in output_names] m = stz.rectangle([0, 0], [module_width, -module_height], module_s_fmt) l = stz.latex(stz.center_coords(m), "\\textbf{%s}" % module_name) stz.distribute_horizontally_with_spacing(i_lst, io_spacing) stz.translate_bbox_top_left_to_coords( i_lst, [module_inner_vertical_spacing, -module_inner_vertical_spacing]) stz.distribute_horizontally_with_spacing(o_lst, io_spacing) stz.translate_bbox_bottom_left_to_coords(o_lst, [ module_inner_vertical_spacing, -module_height + module_inner_vertical_spacing ]) if len(hyperp_names) > 0: h_lst = [property(s, p_width_scale) for s in hyperp_names] stz.distribute_vertically_with_spacing(h_lst, p_spacing) stz.translate_bbox_top_right_to_coords(h_lst, [ module_width - module_inner_vertical_spacing, -module_inner_vertical_spacing - delta_increment ]) return [[m, l], i_lst, o_lst, h_lst] else: return [[m, l], i_lst, o_lst] def independent_hyperparameter(name, values_expr, value=None): e = stz.ellipse([0, 0], h_width / 2.0, h_height / 2.0, hyperp_s_fmt) l = stz.latex(stz.center_coords(e), "\\textbf{%s}" % name) fn_cs = stz.coords_from_bbox_with_fn(e, stz.right_center_coords) if value is None: l_vs = stz.latex(fn_cs, "\\textbf{[%s]}" % (values_expr,), unassigned_h_s_fmt) return [e, l, l_vs] else: v_cs = stz.coords_from_bbox_with_fn(e, stz.right_center_coords) l_v = stz.latex(v_cs, "\\textbf{%s}" % value, assigned_h_s_fmt) return [e, l, l_v] def dependent_hyperparameter(name, hyperp_names, fn_expr, value=None): e = stz.ellipse([0, 0], h_width / 2.0, h_height / 2.0, hyperp_s_fmt) if value is None: e["horizontal_radius"] *= 2.1 * e["horizontal_radius"] l_cs = stz.center_coords(e) if value is None: l_cs = stz.translate_coords_horizontally(l_cs, 0.1) l = stz.latex(l_cs, "\\textbf{%s}" % name) if value is None: fn_cs = stz.coords_from_bbox_with_fn(e, stz.right_center_coords) l_fn = stz.latex(fn_cs, "\\textbf{fn: %s}" % (fn_expr,), unassigned_h_s_fmt) p = property("x", 0.25, 0.7) p_cs = stz.translate_coords_horizontally( stz.coords_from_bbox_with_fn(e, stz.left_center_coords), 0.1) stz.translate_bbox_left_center_to_coords(p, p_cs) return [e, l, l_fn, p] else: v_cs = stz.coords_from_bbox_with_fn(e, stz.right_center_coords) l_v = stz.latex(v_cs, "\\textbf{%s}" % value, assigned_h_s_fmt) return [e, l, l_v] def dense(idx): return module("Dense-%d" % idx, ["in"], ["out"], ["units"]) def conv2d(idx): return module("Conv2D-%d" % idx, ["in"], ["out"], ["filters"], 1.1) def dropout(idx): return module("Dropout-%d" % idx, ["in"], ["out"], ["prob"], 0.9) def optional(idx): return module("Optional-%d" % idx, ["in"], ["out"], ["opt"]) def concat(idx): return module("Concat-%d" % idx, ["in0", "in1"], ["out"], []) def repeat(idx): return module("Repeat-%d" % idx, ["in"], ["out"], ["k"], 0.5) def connect_modules(m_from, m_to, output_idx, input_idx): return stz.line_segment( stz.coords_from_bbox_with_fn(m_from[2][output_idx], stz.bottom_center_coords), stz.coords_from_bbox_with_fn(m_to[1][input_idx], stz.top_center_coords), connect_s_fmt) def connect_hyperp_to_module(h, m, property_idx): return stz.line_segment( stz.coords_from_bbox_with_fn(h[:2], stz.left_center_coords), stz.coords_from_bbox_with_fn(m[3][property_idx], stz.right_center_coords), connect_s_fmt) def connect_hyperp_to_hyperp(h_from, h_to): return stz.line_segment( stz.coords_from_bbox_with_fn(h_from[:2], stz.right_center_coords), stz.coords_from_bbox_with_fn(h_to[3], stz.top_center_coords), connect_s_fmt) def frame(frame_idx): assert frame_idx >= 0 and frame_idx <= 3 c1 = conv2d(1) o = optional(1) r1 = repeat(1) r2 = repeat(2) cc = concat(1) c2 = conv2d(2) c3 = conv2d(3) c4 = conv2d(4) d = dropout(1) stz.distribute_horizontally_with_spacing([r1, r2], horizontal_module_spacing) stz.distribute_horizontally_with_spacing([c2, [c3, c4]], horizontal_module_spacing) modules = [] if frame_idx == 0: stz.distribute_vertically_with_spacing([cc, [r1, r2], o, c1], vertical_module_spacing) stz.align_centers_horizontally([cc, [r1, r2], o, c1], 0) modules.extend([c1, o, r1, r2, cc]) else: stz.distribute_vertically_with_spacing([c4, c3], vertical_module_spacing) stz.distribute_horizontally_with_spacing([c2, [c3, c4]], horizontal_module_spacing) stz.align_centers_vertically([[c3, c4], c2], 0) if frame_idx == 1: stz.distribute_vertically_with_spacing([cc, [c2, c3, c4], o, c1], vertical_module_spacing) stz.align_centers_horizontally([cc, [c2, c3, c4], o, c1], 0) modules.extend([c1, o, c2, c3, c4, cc]) else: stz.distribute_vertically_with_spacing([cc, [c2, c3, c4], d, c1], vertical_module_spacing) stz.align_centers_horizontally([cc, [c2, c3, c4], d, c1], 0) modules.extend([c1, d, c2, c3, c4, cc]) module_connections = [] if frame_idx == 0: module_connections.extend([ connect_modules(c1, o, 0, 0), connect_modules(o, r1, 0, 0), connect_modules(o, r2, 0, 0), connect_modules(r1, cc, 0, 0), connect_modules(r2, cc, 0, 1), ]) else: if frame_idx == 1: module_connections.extend([ connect_modules(c1, o, 0, 0), connect_modules(o, c2, 0, 0), connect_modules(o, c3, 0, 0), ]) else: module_connections.extend([ connect_modules(c1, d, 0, 0), connect_modules(d, c2, 0, 0), connect_modules(d, c3, 0, 0), ]) module_connections.extend([ connect_modules(c3, c4, 0, 0), connect_modules(c2, cc, 0, 0), connect_modules(c4, cc, 0, 1), ]) # # hyperparameters if frame_idx <= 1: h_o = independent_hyperparameter("IH-2", "0, 1") else: h_o = independent_hyperparameter("IH-2", "0, 1", "1") if frame_idx <= 0: h_r1 = dependent_hyperparameter("DH-1", ["x"], "2*x") h_r2 = independent_hyperparameter("IH-3", "1, 2, 4") else: h_r1 = dependent_hyperparameter("DH-1", ["x"], "2*x", "2") h_r2 = independent_hyperparameter("IH-3", "1, 2, 4", "1") if frame_idx <= 2: h_c1 = independent_hyperparameter("IH-1", "64, 128") h_c2 = independent_hyperparameter("IH-4", "64, 128") h_c3 = independent_hyperparameter("IH-5", "64, 128") h_c4 = independent_hyperparameter("IH-6", "64, 128") h_d = independent_hyperparameter("IH-7", "0.25, 0.5") else: h_c1 = independent_hyperparameter("IH-1", "64, 128", "64") h_c2 = independent_hyperparameter("IH-4", "64, 128", "128") h_c3 = independent_hyperparameter("IH-5", "64, 128", "128") h_c4 = independent_hyperparameter("IH-6", "64, 128", "64") h_d = independent_hyperparameter("IH-7", "0.25, 0.5", "0.5") def place_hyperp_right_of(h, m): y_p = stz.center_coords(m[3])[1] stz.align_centers_vertically([h], y_p) stz.place_to_the_right(h, m, spacing_between_module_and_hyperp) hyperparameters = [] place_hyperp_right_of(h_c1, c1) if frame_idx in [0, 1]: place_hyperp_right_of(h_o, o) hyperparameters.append(h_o) if frame_idx == 0: place_hyperp_right_of(h_r1, r2) stz.place_above_and_align_to_the_right(h_r2, h_r1, 0.8) hyperparameters.extend([h_r1, h_r2, h_c1]) else: place_hyperp_right_of(h_c1, c1) place_hyperp_right_of(h_c3, c3) place_hyperp_right_of(h_c4, c4) stz.place_below(h_c2, h_c1, 3.0) hyperparameters.extend([h_c1, h_c2, h_c3, h_c4]) if frame_idx in [2, 3]: place_hyperp_right_of(h_d, d) hyperparameters.extend([h_d]) unreachable_hyperps = [] if frame_idx == 1: stz.distribute_vertically_with_spacing([h_r1, h_r2], 0.2) unreachable_hyperps.extend([h_r1, h_r2]) if frame_idx >= 2: stz.distribute_vertically_with_spacing([h_o, h_r1, h_r2], 0.2) unreachable_hyperps.extend([h_r1, h_r2, h_o]) hyperparameters.extend(unreachable_hyperps) cs_fn = lambda e: stz.coords_from_bbox_with_fn(e, stz.left_center_coords) if frame_idx == 0: stz.translate_bbox_left_center_to_coords(h_r2, cs_fn([h_o, h_r1])) elif frame_idx == 1: stz.translate_bbox_left_center_to_coords(h_c2, cs_fn([h_o, h_c3])) else: stz.translate_bbox_left_center_to_coords(h_c2, cs_fn([h_d, h_c3])) hyperp_connections = [ connect_hyperp_to_module(h_c1, c1, 0), ] if frame_idx in [0, 1]: hyperp_connections.extend([connect_hyperp_to_module(h_o, o, 0)]) if frame_idx == 0: hyperp_connections.extend([ connect_hyperp_to_module(h_r1, r2, 0), connect_hyperp_to_module(h_r2, r1, 0), connect_hyperp_to_hyperp(h_r2, h_r1) ]) else: hyperp_connections.extend([ connect_hyperp_to_module(h_c2, c2, 0), connect_hyperp_to_module(h_c3, c3, 0), connect_hyperp_to_module(h_c4, c4, 0), ]) if frame_idx in [2, 3]: hyperp_connections.append(connect_hyperp_to_module(h_d, d, 0)) f = stz.rectangle_from_width_and_height([0, 0], frame_height, frame_width, frame_s_fmt) e = [modules, module_connections, hyperparameters, hyperp_connections] stz.translate_bbox_center_to_coords( f, stz.translate_coords_horizontally(stz.center_coords(e), 0.8)) if len(unreachable_hyperps) > 0: stz.translate_bbox_bottom_right_to_coords(unreachable_hyperps, stz.bbox(e)[1]) # frame id s = ["a", "b", "c", "d"][frame_idx] label = [stz.latex([0, 0], "\\Huge \\textbf %s" % s)] stz.translate_bbox_top_left_to_coords( label, stz.translate_coords_antidiagonally( stz.coords_from_bbox_with_fn(f, stz.top_left_coords), 0.6)) return e + [f, label] def search_space_transition(): e0 = frame(0) e1 = frame(1) e2 = frame(2) e3 = frame(3) e = [e0, e1, e2, e3] def get_idx(e_frame, indices): e = e_frame for idx in indices: e = e[idx] return e def highlight(e_frame, indices, idx, color): e = get_idx(e_frame, indices) s_fmt = fmt.combine_tikz_strs([e["tikz_str"], fmt.fill_color(color)]) e['tikz_str'] = s_fmt # highlight new modules highlight(e1, [0, 2, 0, 0], 0, "light_green_2") highlight(e1, [0, 3, 0, 0], 0, "light_green_2") highlight(e1, [0, 4, 0, 0], 0, "light_green_2") highlight(e2, [0, 1, 0, 0], 0, "light_green_2") # highlight new hyperparameters highlight(e1, [2, 2, 0], 0, "light_green_2") highlight(e1, [2, 3, 0], 0, "light_green_2") highlight(e1, [2, 4, 0], 0, "light_green_2") highlight(e2, [2, 4, 0], 0, "light_green_2") # highlight assigned hyperparameters highlight(e1, [2, 5, 0], 0, "light_red_2") highlight(e1, [2, 6, 0], 0, "light_red_2") highlight(e2, [2, 7, 0], 0, "light_red_2") highlight(e3, [2, 0, 0], 0, "light_red_2") highlight(e3, [2, 1, 0], 0, "light_red_2") highlight(e3, [2, 2, 0], 0, "light_red_2") highlight(e3, [2, 3, 0], 0, "light_red_2") highlight(e3, [2, 4, 0], 0, "light_red_2") # arrange the four frames stz.align_tops(e, 0.0) stz.distribute_horizontally_with_spacing([e0, e1], frame_spacing) stz.distribute_horizontally_with_spacing([e2, e3], frame_spacing) stz.distribute_vertically_with_spacing([[e2, e3], [e0, e1]], frame_spacing) stz.draw_to_tikz_standalone(e, "deep_architect.tex", name2color) search_space_transition()
15,365
6,307
import time import json from basetestcase import BaseTestCase from couchbase_helper.documentgenerator import doc_generator from couchbase_helper.durability_helper import DurabilityHelper, \ DurableExceptions from couchbase_helper.tuq_generators import JsonGenerator from membase.api.rest_client import RestConnection from mc_bin_client import MemcachedClient, MemcachedError from remote.remote_util import RemoteMachineShellConnection from table_view import TableView """ Capture basic get, set operations, also the meta operations. This is based on some 4.1.1 test which had separate bugs with incr and delete with meta and I didn't see an obvious home for them. This is small now but we will reactively add things These may be parameterized by: - full and value eviction - DGM and non-DGM """ class basic_ops(BaseTestCase): def setUp(self): super(basic_ops, self).setUp() self.key = 'test_docs'.rjust(self.key_size, '0') nodes_init = self.cluster.servers[1:self.nodes_init] \ if self.nodes_init != 1 else [] self.task.rebalance([self.cluster.master], nodes_init, []) self.cluster.nodes_in_cluster.extend([self.cluster.master]+nodes_init) self.bucket_util.create_default_bucket( replica=self.num_replicas, compression_mode=self.compression_mode, bucket_type=self.bucket_type) self.bucket_util.add_rbac_user() self.src_bucket = self.bucket_util.get_all_buckets() self.durability_helper = DurabilityHelper( self.log, len(self.cluster.nodes_in_cluster), durability=self.durability_level, replicate_to=self.replicate_to, persist_to=self.persist_to) # Reset active_resident_threshold to avoid further data load as DGM self.active_resident_threshold = 0 self.cluster_util.print_cluster_stats() self.bucket_util.print_bucket_stats() self.log.info("==========Finished Basic_ops base setup========") def tearDown(self): super(basic_ops, self).tearDown() def do_basic_ops(self): KEY_NAME = 'key1' KEY_NAME2 = 'key2' self.log.info('Starting basic ops') rest = RestConnection(self.cluster.master) default_bucket = self.bucket_util.get_all_buckets()[0] smart_client = VBucketAwareMemcached(rest, default_bucket) sdk_client = smart_client.get_client() # mcd = client.memcached(KEY_NAME) # MB-17231 - incr with full eviction rc = sdk_client.incr(KEY_NAME, delta=1) self.log.info('rc for incr: {0}'.format(rc)) # MB-17289 del with meta rc = sdk_client.set(KEY_NAME, 0, 0, json.dumps({'value': 'value2'})) self.log.info('set is: {0}'.format(rc)) # cas = rc[1] # wait for it to persist persisted = 0 while persisted == 0: opaque, rep_time, persist_time, persisted, cas = sdk_client.observe(KEY_NAME) try: rc = sdk_client.evict_key(KEY_NAME) except MemcachedError as exp: self.fail("Exception with evict meta - {0}".format(exp)) CAS = 0xabcd try: # key, exp, flags, seqno, cas rc = mcd.del_with_meta(KEY_NAME2, 0, 0, 2, CAS) except MemcachedError as exp: self.fail("Exception with del_with meta - {0}".format(exp)) # Reproduce test case for MB-28078 def do_setWithMeta_twice(self): mc = MemcachedClient(self.cluster.master.ip, 11210) mc.sasl_auth_plain(self.cluster.master.rest_username, self.cluster.master.rest_password) mc.bucket_select('default') try: mc.setWithMeta('1', '{"Hello":"World"}', 3600, 0, 1, 0x1512a3186faa0000) except MemcachedError as error: self.log.info("<MemcachedError #%d ``%s''>" % (error.status, error.message)) self.fail("Error on First setWithMeta()") stats = mc.stats() self.log.info('curr_items: {0} and curr_temp_items:{1}' .format(stats['curr_items'], stats['curr_temp_items'])) self.log.info("Sleeping for 5 and checking stats again") time.sleep(5) stats = mc.stats() self.log.info('curr_items: {0} and curr_temp_items:{1}' .format(stats['curr_items'], stats['curr_temp_items'])) try: mc.setWithMeta('1', '{"Hello":"World"}', 3600, 0, 1, 0x1512a3186faa0000) except MemcachedError as error: stats = mc.stats() self.log.info('After 2nd setWithMeta(), curr_items: {} and curr_temp_items:{}' .format(stats['curr_items'], stats['curr_temp_items'])) if int(stats['curr_temp_items']) == 1: self.fail("Error on second setWithMeta(), expected curr_temp_items to be 0") else: self.log.info("<MemcachedError #%d ``%s''>" % (error.status, error.message)) def generate_docs_bigdata(self, docs_per_day, start=0, document_size=1024000): json_generator = JsonGenerator() return json_generator.generate_docs_bigdata( start=start, end=docs_per_day, value_size=document_size) def test_doc_size(self): def check_durability_failures(): self.log.error(task.sdk_acked_curd_failed.keys()) self.log.error(task.sdk_exception_crud_succeed.keys()) self.assertTrue( len(task.sdk_acked_curd_failed) == 0, "Durability failed for docs: %s" % task.sdk_acked_curd_failed.keys()) self.assertTrue( len(task.sdk_exception_crud_succeed) == 0, "Durability failed for docs: %s" % task.sdk_acked_curd_failed.keys()) """ Basic tests for document CRUD operations using JSON docs """ doc_op = self.input.param("doc_op", None) def_bucket = self.bucket_util.buckets[0] ignore_exceptions = list() retry_exceptions = list() # Stat validation reference variables verification_dict = dict() ref_val = dict() ref_val["ops_create"] = 0 ref_val["ops_update"] = 0 ref_val["ops_delete"] = 0 ref_val["rollback_item_count"] = 0 ref_val["sync_write_aborted_count"] = 0 ref_val["sync_write_committed_count"] = 0 one_less_node = self.nodes_init == self.num_replicas if self.durability_level: pass #ignore_exceptions.append( # "com.couchbase.client.core.error.RequestTimeoutException") if self.target_vbucket and type(self.target_vbucket) is not list: self.target_vbucket = [self.target_vbucket] self.log.info("Creating doc_generator..") # Load basic docs into bucket doc_create = doc_generator( self.key, 0, self.num_items, doc_size=self.doc_size, doc_type=self.doc_type, target_vbucket=self.target_vbucket, vbuckets=self.vbuckets) self.log.info("Loading {0} docs into the bucket: {1}" .format(self.num_items, def_bucket)) task = self.task.async_load_gen_docs( self.cluster, def_bucket, doc_create, "create", 0, batch_size=self.batch_size, process_concurrency=self.process_concurrency, replicate_to=self.replicate_to, persist_to=self.persist_to, durability=self.durability_level, timeout_secs=self.sdk_timeout, ryow=self.ryow, check_persistence=self.check_persistence) self.task.jython_task_manager.get_task_result(task) if self.ryow: check_durability_failures() # Retry doc_exception code self.log.info("Validating failed doc's (if any) exceptions") doc_op_info_dict = dict() doc_op_info_dict[task] = self.bucket_util.get_doc_op_info_dict( def_bucket, "create", exp=0, replicate_to=self.replicate_to, persist_to=self.persist_to, durability=self.durability_level, timeout=self.sdk_timeout, time_unit="seconds", ignore_exceptions=ignore_exceptions, retry_exceptions=retry_exceptions) self.bucket_util.verify_doc_op_task_exceptions(doc_op_info_dict, self.cluster) if len(doc_op_info_dict[task]["unwanted"]["fail"].keys()) != 0: self.fail("Failures in retry doc CRUDs: {0}" .format(doc_op_info_dict[task]["unwanted"]["fail"])) self.log.info("Wait for ep_all_items_remaining to become '0'") self.bucket_util._wait_for_stats_all_buckets() # Update ref_val ref_val["ops_create"] = self.num_items + len(task.fail.keys()) ref_val["sync_write_committed_count"] = self.num_items # Validate vbucket stats verification_dict["ops_create"] = ref_val["ops_create"] verification_dict["rollback_item_count"] = \ ref_val["rollback_item_count"] if self.durability_level: verification_dict["sync_write_aborted_count"] = \ ref_val["sync_write_aborted_count"] verification_dict["sync_write_committed_count"] = \ ref_val["sync_write_committed_count"] failed = self.durability_helper.verify_vbucket_details_stats( def_bucket, self.cluster_util.get_kv_nodes(), vbuckets=self.vbuckets, expected_val=verification_dict, one_less_node=one_less_node) if failed: self.fail("Cbstat vbucket-details verification failed") # Verify initial doc load count self.log.info("Validating doc_count in buckets") self.bucket_util.verify_stats_all_buckets(self.num_items) self.log.info("Creating doc_generator for doc_op") num_item_start_for_crud = int(self.num_items / 2) doc_update = doc_generator( self.key, 0, num_item_start_for_crud, doc_size=self.doc_size, doc_type=self.doc_type, target_vbucket=self.target_vbucket, vbuckets=self.vbuckets) expected_num_items = self.num_items num_of_mutations = 1 if doc_op == "update": self.log.info("Performing 'update' mutation over the docs") task = self.task.async_load_gen_docs( self.cluster, def_bucket, doc_update, "update", 0, batch_size=self.batch_size, process_concurrency=self.process_concurrency, replicate_to=self.replicate_to, persist_to=self.persist_to, durability=self.durability_level, timeout_secs=self.sdk_timeout, ryow=self.ryow, check_persistence=self.check_persistence) self.task.jython_task_manager.get_task_result(task) ref_val["ops_update"] = (doc_update.end - doc_update.start + len(task.fail.keys())) if self.durability_level: ref_val["sync_write_committed_count"] += \ (doc_update.end - doc_update.start) if self.ryow: check_durability_failures() # Read all the values to validate update operation task = self.task.async_load_gen_docs( self.cluster, def_bucket, doc_update, "read", 0, batch_size=self.batch_size, process_concurrency=self.process_concurrency, timeout_secs=self.sdk_timeout) self.task.jython_task_manager.get_task_result(task) op_failed_tbl = TableView(self.log.error) op_failed_tbl.set_headers(["Update failed key", "CAS", "Value"]) for key, value in task.success.items(): if json.loads(str(value["value"]))["mutated"] != 1: op_failed_tbl.add_row([key, value["cas"], value["value"]]) op_failed_tbl.display("Update failed for keys:") if len(op_failed_tbl.rows) != 0: self.fail("Update failed for few keys") elif doc_op == "delete": self.log.info("Performing 'delete' mutation over the docs") task = self.task.async_load_gen_docs( self.cluster, def_bucket, doc_update, "delete", 0, batch_size=self.batch_size, process_concurrency=self.process_concurrency, replicate_to=self.replicate_to, persist_to=self.persist_to, durability=self.durability_level, timeout_secs=self.sdk_timeout, ryow=self.ryow, check_persistence=self.check_persistence) self.task.jython_task_manager.get_task_result(task) expected_num_items = self.num_items \ - (self.num_items - num_item_start_for_crud) ref_val["ops_delete"] = (doc_update.end - doc_update.start + len(task.fail.keys())) if self.durability_level: ref_val["sync_write_committed_count"] += \ (doc_update.end - doc_update.start) if self.ryow: check_durability_failures() # Read all the values to validate update operation task = self.task.async_load_gen_docs( self.cluster, def_bucket, doc_update, "read", 0, batch_size=10, process_concurrency=8, timeout_secs=self.sdk_timeout) self.task.jython_task_manager.get_task_result(task) op_failed_tbl = TableView(self.log.error) op_failed_tbl.set_headers(["Delete failed key", "CAS", "Value"]) for key, value in task.success.items(): op_failed_tbl.add_row([key, value["cas"], value["value"]]) op_failed_tbl.display("Delete failed for keys:") if len(op_failed_tbl.rows) != 0: self.fail("Delete failed for few keys") else: self.log.warning("Unsupported doc_operation") self.log.info("Wait for ep_all_items_remaining to become '0'") self.bucket_util._wait_for_stats_all_buckets() # Validate vbucket stats verification_dict["ops_create"] = ref_val["ops_create"] verification_dict["ops_update"] = ref_val["ops_update"] verification_dict["ops_delete"] = ref_val["ops_delete"] verification_dict["rollback_item_count"] = \ ref_val["rollback_item_count"] if self.durability_level: verification_dict["sync_write_aborted_count"] = \ ref_val["sync_write_aborted_count"] verification_dict["sync_write_committed_count"] = \ ref_val["sync_write_committed_count"] failed = self.durability_helper.verify_vbucket_details_stats( def_bucket, self.cluster_util.get_kv_nodes(), vbuckets=self.vbuckets, expected_val=verification_dict, one_less_node=one_less_node) if failed: self.fail("Cbstat vbucket-details verification failed") self.log.info("Validating doc_count") self.bucket_util.verify_stats_all_buckets(expected_num_items) def test_large_doc_size(self): # bucket size=256MB, when Bucket gets filled 236MB then test starts failing # document size=2MB, No of docs = 221 , load 250 docs # generate docs with size >= 1MB , See MB-29333 self.doc_size *= 1024000 gens_load = self.generate_docs_bigdata( docs_per_day=self.num_items, document_size=self.doc_size) for bucket in self.bucket_util.buckets: task = self.task.async_load_gen_docs( self.cluster, bucket, gens_load, "create", 0, batch_size=10, process_concurrency=8, replicate_to=self.replicate_to, persist_to=self.persist_to, durability=self.durability_level, timeout_secs=self.sdk_timeout) self.task.jython_task_manager.get_task_result(task) # check if all the documents(250) are loaded with default timeout self.bucket_util.verify_stats_all_buckets(self.num_items) def test_large_doc_20MB(self): # test reproducer for MB-29258, # Load a doc which is greater than 20MB # with compression enabled and check if it fails # check with compression_mode as active, passive and off val_error = DurableExceptions.ValueTooLargeException gens_load = self.generate_docs_bigdata( docs_per_day=1, document_size=(self.doc_size * 1024000)) for bucket in self.bucket_util.buckets: task = self.task.async_load_gen_docs( self.cluster, bucket, gens_load, "create", 0, batch_size=10, process_concurrency=8, replicate_to=self.replicate_to, persist_to=self.persist_to, durability=self.durability_level, timeout_secs=self.sdk_timeout) self.task.jython_task_manager.get_task_result(task) if self.doc_size > 20: if len(task.fail.keys()) == 0: self.log_failure("No failures during large doc insert") for doc_id, doc_result in task.fail.items(): if val_error not in str(doc_result["error"]): self.log_failure("Invalid exception for key %s: %s" % (doc_id, doc_result)) else: if len(task.success.keys()) == 0: self.log_failure("Failures during large doc insert") for bucket in self.bucket_util.buckets: if self.doc_size > 20: # failed with error "Data Too Big" when document size > 20MB self.bucket_util.verify_stats_all_buckets(0) else: self.bucket_util.verify_stats_all_buckets(1) gens_update = self.generate_docs_bigdata( docs_per_day=1, document_size=(21 * 1024000)) task = self.task.async_load_gen_docs( self.cluster, bucket, gens_update, "create", 0, batch_size=10, process_concurrency=8, replicate_to=self.replicate_to, persist_to=self.persist_to, durability=self.durability_level, timeout_secs=self.sdk_timeout) self.task.jython_task_manager.get_task_result(task) if len(task.success.keys()) != 0: self.log_failure("Large docs inserted for keys: %s" % task.success.keys()) if len(task.fail.keys()) == 0: self.log_failure("No failures during large doc insert") for doc_id, doc_result in task.fail.items(): if val_error not in str(doc_result["error"]): self.log_failure("Invalid exception for key %s: %s" % (doc_id, doc_result)) self.bucket_util.verify_stats_all_buckets(1) self.validate_test_failure() def test_diag_eval_curl(self): # Check if diag/eval can be done only by local host self.disable_diag_eval_on_non_local_host = \ self.input.param("disable_diag_eval_non_local", False) port = self.cluster.master.port # check if local host can work fine cmd = [] cmd_base = 'curl http://{0}:{1}@localhost:{2}/diag/eval ' \ .format(self.cluster.master.rest_username, self.cluster.master.rest_password, port) command = cmd_base + '-X POST -d \'os:cmd("env")\'' cmd.append(command) command = cmd_base + '-X POST -d \'case file:read_file("/etc/passwd") of {ok, B} -> io:format("~p~n", [binary_to_term(B)]) end.\'' cmd.append(command) shell = RemoteMachineShellConnection(self.cluster.master) for command in cmd: output, error = shell.execute_command(command) self.assertNotEquals("API is accessible from localhost only", output[0]) # Disable allow_nonlocal_eval if not self.disable_diag_eval_on_non_local_host: command = cmd_base + '-X POST -d \'ns_config:set(allow_nonlocal_eval, true).\'' _, _ = shell.execute_command(command) # Check ip address on diag/eval will not work fine when allow_nonlocal_eval is disabled cmd = [] cmd_base = 'curl http://{0}:{1}@{2}:{3}/diag/eval ' \ .format(self.cluster.master.rest_username, self.cluster.master.rest_password, self.cluster.master.ip, port) command = cmd_base + '-X POST -d \'os:cmd("env")\'' cmd.append(command) command = cmd_base + '-X POST -d \'case file:read_file("/etc/passwd") of {ok, B} -> io:format("~p~n", [binary_to_term(B)]) end.\'' cmd.append(command) for command in cmd: output, error = shell.execute_command(command) if self.disable_diag_eval_on_non_local_host: self.assertEquals("API is accessible from localhost only", output[0]) else: self.assertNotEquals("API is accessible from localhost only", output[0]) def verify_stat(self, items, value="active"): mc = MemcachedClient(self.cluster.master.ip, 11210) mc.sasl_auth_plain(self.cluster.master.rest_username, self.cluster.master.rest_password) mc.bucket_select('default') stats = mc.stats() self.assertEquals(stats['ep_compression_mode'], value) self.assertEquals(int(stats['ep_item_compressor_num_compressed']), items) self.assertNotEquals(int(stats['vb_active_itm_memory']), int(stats['vb_active_itm_memory_uncompressed'])) def test_compression_active_and_off(self): """ test reproducer for MB-29272, Load some documents with compression mode set to active get the cbstats change compression mode to off and wait for minimum 250ms Load some more documents and check the compression is not done epengine.basic_ops.basic_ops.test_compression_active_and_off,items=10000,compression_mode=active :return: """ # Load some documents with compression mode as active gen_create = doc_generator("eviction1_", start=0, end=self.num_items, doc_size=self.doc_size) gen_create2 = doc_generator("eviction2_", start=0, end=self.num_items, doc_size=self.doc_size) def_bucket = self.bucket_util.get_all_buckets()[0] task = self.task.async_load_gen_docs( self.cluster, def_bucket, gen_create, "create", 0, batch_size=10, process_concurrency=8, replicate_to=self.replicate_to, persist_to=self.persist_to, durability=self.durability_level, timeout_secs=self.sdk_timeout) self.task.jython_task_manager.get_task_result(task) self.bucket_util._wait_for_stats_all_buckets() self.bucket_util.verify_stats_all_buckets(self.num_items) remote = RemoteMachineShellConnection(self.cluster.master) for bucket in self.bucket_util.buckets: # change compression mode to off output, _ = remote.execute_couchbase_cli( cli_command='bucket-edit', cluster_host="localhost:8091", user=self.cluster.master.rest_username, password=self.cluster.master.rest_password, options='--bucket=%s --compression-mode off' % bucket.name) self.assertTrue(' '.join(output).find('SUCCESS') != -1, 'compression mode set to off') # sleep for 10 sec (minimum 250sec) time.sleep(10) # Load data and check stats to see compression # is not done for newly added data task = self.task.async_load_gen_docs( self.cluster, def_bucket, gen_create2, "create", 0, batch_size=10, process_concurrency=8, replicate_to=self.replicate_to, persist_to=self.persist_to, durability=self.durability_level, timeout_secs=self.sdk_timeout) self.task.jython_task_manager.get_task_result(task) self.bucket_util._wait_for_stats_all_buckets() self.bucket_util.verify_stats_all_buckets(self.num_items*2) def do_get_random_key(self): # MB-31548, get_Random key gets hung sometimes. mc = MemcachedClient(self.cluster.master.ip, 11210) mc.sasl_auth_plain(self.cluster.master.rest_username, self.cluster.master.rest_password) mc.bucket_select('default') count = 0 while count < 1000000: count += 1 try: mc.get_random_key() except MemcachedError as error: self.fail("<MemcachedError #%d ``%s''>" % (error.status, error.message)) if count % 1000 == 0: self.log.info('The number of iteration is {}'.format(count))
25,801
7,836
import matplotlib.pyplot as plt import yaml import os workspace = "/workspace/mnt/storage/guangcongzheng/zju_zgc/guided-diffusion" num_samples = 192 log = os.path.join(workspace, 'log/imagenet1000_classifier256x256_channel128_upperbound/predict/model500000_imagenet1000_stepsddim25_sample{}_selectedClass'.format(num_samples)) legends = [] plt.figure() for class_id in range(3): fid = [] for scale in range(1,21): result_name = 'result_scale{}.0_class{}_stepsddim25_sample{}.yaml'.format(scale, class_id, num_samples) result_path = os.path.join(log,result_name) with open(result_path, "r") as stream: try: result_dict = yaml.safe_load(stream) except yaml.YAMLError as exc: print(exc) fid.append(result_dict['fid']) print(result_dict) plt.plot(fid) plt.xlabel('classifier scale') plt.ylabel(fid) legends.append('sample{}_class{}'.format(num_samples, class_id)) plt.legend(legends) plt.show()
1,025
386
from bs4 import BeautifulSoup import requests import urllib.request from datetime import datetime import time from PIL import Image, ImageDraw, ImageFont import ctypes import os import shutil import socket import sys def is_connected(hostname): try: # see if we can resolve the host name -- tells us if there is # a DNS listening host = socket.gethostbyname(hostname) # connect to the host -- tells us if the host is actually # reachable s = socket.create_connection((host, 80), 2) return True except: pass return False if __name__ == "__main__": # check internet connection while True: # if not is_connected("www.google.com"): print("@author: Swapnil Mali \nPlease check your internet connection, will try again after 30 seconds..") time.sleep(30) continue # move shortcut to main.exe to startup folder try: # get user name user = os.getlogin() path = r'C:\Users\{}\AppData\Roaming\Microsoft\Windows\Start Menu\Programs\Startup\main - Shortcut.lnk'.format(user) # print(path) shutil.move(r'main - Shortcut.lnk', path) except FileNotFoundError: pass # just credit and copyright stuff print('@author: Swapnil Mali \n\n(Note: New wallpaper is available everyday after 2.00 pm)') print("Downloading Today's Wallpaper...please wait!!") # get image link from the website page res = requests.get('https://bing.wallpaper.pics/') soup = BeautifulSoup(res.text, 'lxml') image_box = soup.find('a', {'class': 'cursor_zoom'}) image = image_box.find('img') link = image['src'] # download and save the image filename = datetime.now().strftime('%d-%m-%y') urllib.request.urlretrieve(link, '{}.jpg'.format(filename)) # for copyright overlaying text over the image image = Image.open('{}.jpg'.format(filename)) font_type = ImageFont.truetype('fonts/Quicksand-Bold.otf', 44) draw = ImageDraw.Draw(image) draw.text(xy=(800, 1000), text='© Swapnil Mali', fill=(0, 0, 0), font=font_type) # image.show() image.save('{}.jpg'.format(filename)) print("\n\n-------------------------------------------\nDone..New wallpaper saved as '{}.jpg'\n-------------------------------------------".format(filename)) time.sleep(1) # set new image as desktop background directory = os.getcwd() image_path = '{}\{}.jpg'.format(directory, filename) print("\nSetting new Wallpaper..".format(filename)) ctypes.windll.user32.SystemParametersInfoW(20, 0, image_path, 3) time.sleep(2) print("Done..Closing this window") time.sleep(2) sys.exit()
2,882
846
# coding=utf-8 # @Author : zhzhx2008 # @Time : 18-10-9 import os import warnings import jieba import numpy as np from keras import Input from keras import Model from keras import backend as K from keras import initializers, regularizers, constraints from keras.callbacks import EarlyStopping, ModelCheckpoint from keras.engine.topology import Layer from keras.layers import Dropout, Bidirectional from keras.layers import Embedding, Dense from keras.layers import LSTM, SpatialDropout1D from keras.preprocessing.sequence import pad_sequences from keras.preprocessing.text import Tokenizer from keras.utils import to_categorical from sklearn.model_selection import train_test_split warnings.filterwarnings("ignore") seed = 2019 np.random.seed(seed) def get_labels_datas(input_dir): datas_word = [] datas_char = [] labels = [] label_dirs = os.listdir(input_dir) for label_dir in label_dirs: txt_names = os.listdir(os.path.join(input_dir, label_dir)) for txt_name in txt_names: with open(os.path.join(input_dir, label_dir, txt_name), 'r') as fin: content = fin.readline() # 只取第一行 content = content.strip().replace(' ', '') datas_word.append(' '.join(jieba.cut(content))) datas_char.append(' '.join(list(content))) labels.append(label_dir) return labels, datas_word, datas_char def get_label_id_map(labels): labels = set(labels) id_label_map = {} label_id_map = {} for index, label in enumerate(labels): id_label_map[index] = label label_id_map[label] = index return id_label_map, label_id_map # 《Feed-Forward Networks with Attention Can Solve Some Long-Term Memory Problems》 # [https://arxiv.org/abs/1512.08756] # https://www.kaggle.com/qqgeogor/keras-lstm-attention-glove840b-lb-0-043 class Attention(Layer): def __init__(self, step_dim, W_regularizer=None, b_regularizer=None, W_constraint=None, b_constraint=None, bias=True, **kwargs): """ Keras Layer that implements an Attention mechanism for temporal data. Supports Masking. Follows the work of Raffel et al. [https://arxiv.org/abs/1512.08756] # Input shape 3D tensor with shape: `(samples, steps, features)`. # Output shape 2D tensor with shape: `(samples, features)`. :param kwargs: Just put it on top of an RNN Layer (GRU/LSTM/SimpleRNN) with return_sequences=True. The dimensions are inferred based on the output shape of the RNN. Example: model.add(LSTM(64, return_sequences=True)) model.add(Attention()) """ self.supports_masking = True # self.init = initializations.get('glorot_uniform') self.init = initializers.get('glorot_uniform') self.W_regularizer = regularizers.get(W_regularizer) self.b_regularizer = regularizers.get(b_regularizer) self.W_constraint = constraints.get(W_constraint) self.b_constraint = constraints.get(b_constraint) self.bias = bias self.step_dim = step_dim self.features_dim = 0 super(Attention, self).__init__(**kwargs) def build(self, input_shape): assert len(input_shape) == 3 self.W = self.add_weight((input_shape[-1],), initializer=self.init, name='{}_W'.format(self.name), regularizer=self.W_regularizer, constraint=self.W_constraint) self.features_dim = input_shape[-1] if self.bias: self.b = self.add_weight((input_shape[1],), initializer='zero', name='{}_b'.format(self.name), regularizer=self.b_regularizer, constraint=self.b_constraint) else: self.b = None self.built = True def compute_mask(self, input, input_mask=None): # do not pass the mask to the next layers return None def call(self, x, mask=None): # eij = K.dot(x, self.W) TF backend doesn't support it # features_dim = self.W.shape[0] # step_dim = x._keras_shape[1] features_dim = self.features_dim step_dim = self.step_dim eij = K.reshape(K.dot(K.reshape(x, (-1, features_dim)), K.reshape(self.W, (features_dim, 1))), (-1, step_dim)) if self.bias: eij += self.b eij = K.tanh(eij) a = K.exp(eij) # apply mask after the exp. will be re-normalized next if mask is not None: # Cast the mask to floatX to avoid float64 upcasting in theano a *= K.cast(mask, K.floatx()) # in some cases especially in the early stages of training the sum may be almost zero a /= K.cast(K.sum(a, axis=1, keepdims=True) + K.epsilon(), K.floatx()) a = K.expand_dims(a) weighted_input = x * a # print(weighted_input.shape) # return weighted_input return K.sum(weighted_input, axis=1) def compute_output_shape(self, input_shape): # return input_shape[0], input_shape[1], self.features_dim return input_shape[0], self.features_dim input_dir = './data/THUCNews' labels, datas_word, datas_char = get_labels_datas(input_dir) id_label_map, label_id_map = get_label_id_map(labels) labels, labels_test, datas_word, datas_word_test, datas_char, datas_char_test = train_test_split(labels, datas_word, datas_char, test_size=0.3, shuffle=True, stratify=labels) labels_train, labels_dev, datas_word_train, datas_word_dev, datas_char_train, datas_char_dev = train_test_split(labels, datas_word, datas_char, test_size=0.1, shuffle=True, stratify=labels) y_train = [label_id_map.get(x) for x in labels_train] y_dev = [label_id_map.get(x) for x in labels_dev] y_test = [label_id_map.get(x) for x in labels_test] num_classes = len(set(y_train)) y_train_index = to_categorical(y_train, num_classes) y_dev_index = to_categorical(y_dev, num_classes) y_test_index = to_categorical(y_test, num_classes) # keras extract feature tokenizer = Tokenizer() tokenizer.fit_on_texts(datas_word_train) # feature5: word index for deep learning x_train_word_index = tokenizer.texts_to_sequences(datas_word_train) x_dev_word_index = tokenizer.texts_to_sequences(datas_word_dev) x_test_word_index = tokenizer.texts_to_sequences(datas_word_test) max_word_length = max([len(x) for x in x_train_word_index]) x_train_word_index = pad_sequences(x_train_word_index, maxlen=max_word_length) x_dev_word_index = pad_sequences(x_dev_word_index, maxlen=max_word_length) x_test_word_index = pad_sequences(x_test_word_index, maxlen=max_word_length) input = Input(shape=(max_word_length,)) embedding = Embedding(len(tokenizer.word_index) + 1, 128)(input) embedding = SpatialDropout1D(0.2)(embedding) # rnn = SimpleRNN(100, return_sequences=True)(embedding) # rnn = Attention(max_word_length)(rnn) # rnn = Bidirectional(SimpleRNN(100, return_sequences=True))(embedding) # rnn = Attention(max_word_length)(rnn) # rnn = GRU(100, return_sequences=True)(embedding) # rnn = Attention(max_word_length)(rnn) # rnn = Bidirectional(GRU(100, return_sequences=True))(embedding) # rnn = Attention(max_word_length)(rnn) # rnn = CuDNNGRU(100, return_sequences=True)(embedding) # rnn = Attention(max_word_length)(rnn) # rnn = Bidirectional(CuDNNGRU(100, return_sequences=True))(embedding) # rnn = Attention(max_word_length)(rnn) # rnn = LSTM(100, return_sequences=True)(embedding) # rnn = Attention(max_word_length)(rnn) rnn = Bidirectional(LSTM(100, return_sequences=True))(embedding) rnn = Attention(max_word_length)(rnn) # metrics value=0.38647342980771826 # rnn = GlobalMaxPool1D()(rnn)# 0.33816425149567464 # rnn = GlobalAvgPool1D()(rnn)# 0.20772946881499268 # rnn = Flatten()(rnn) # 0.3140096618357488 # rnn = concatenate([GlobalMaxPool1D()(rnn), GlobalAvgPool1D()(rnn)])# 0.24396135280097742 # rnn = CuDNNLSTM(100, return_sequences=True)(embedding) # rnn = Attention(max_word_length)(rnn) # rnn = Bidirectional(CuDNNLSTM(100, return_sequences=True))(embedding) # rnn = Attention(max_word_length)(rnn) drop = Dropout(0.2)(rnn) output = Dense(num_classes, activation='softmax')(drop) model = Model(inputs=input, outputs=output) model.compile(loss='categorical_crossentropy', optimizer='adam', metrics=['accuracy']) print(model.summary()) model_weight_file = './model_rnn_attention.h5' model_file = './model_rnn_attention.model' early_stopping = EarlyStopping(monitor='val_loss', patience=5) model_checkpoint = ModelCheckpoint(model_weight_file, save_best_only=True, save_weights_only=True) model.fit(x_train_word_index, y_train_index, batch_size=32, epochs=1000, verbose=2, callbacks=[early_stopping, model_checkpoint], validation_data=(x_dev_word_index, y_dev_index), shuffle=True) model.load_weights(model_weight_file) model.save(model_file) evaluate = model.evaluate(x_test_word_index, y_test_index, batch_size=32, verbose=2) print('loss value=' + str(evaluate[0])) print('metrics value=' + str(evaluate[1])) # loss value=1.562715420647273 # metrics value=0.2936507960160573
9,401
3,351
# coding: utf8 vpc_cidr = "192.168.0.0/16" http_cidr = "192.168.1.0/24"
73
53
import torch import torch.nn as nn import torch.nn.functional as F from einops import rearrange from fastfold.model.fastnn.kernel import scale_mask_softmax, scale_mask_bias_softmax from fastfold.model.fastnn.kernel import LayerNorm from .initializer import glorot_uniform_af from fastfold.model.fastnn.kernel import bias_sigmod_ele from fastfold.distributed import gather, scatter from fastfold.distributed.comm_async import gather_async, gather_async_opp class DropoutRowwise(nn.Module): def __init__(self, p): super(DropoutRowwise, self).__init__() self.p = p self.dropout = nn.Dropout(p=p) def forward(self, x): dropout_mask = torch.ones_like(x[:, 0:1, :, :]) dropout_mask = self.dropout(dropout_mask) return dropout_mask * x class DropoutColumnwise(nn.Module): def __init__(self, p): super(DropoutColumnwise, self).__init__() self.p = p self.dropout = nn.Dropout(p=p) def forward(self, x): dropout_mask = torch.ones_like(x[:, :, 0:1, :]) dropout_mask = self.dropout(dropout_mask) return dropout_mask * x class Transition(nn.Module): def __init__(self, d, n=4): super(Transition, self).__init__() self.norm = LayerNorm(d) self.linear1 = Linear(d, n * d, initializer='relu') self.linear2 = Linear(n * d, d, initializer='zeros') def forward(self, src): x = self.norm(src) x = self.linear2(F.relu(self.linear1(x))) return src + x class OutProductMean(nn.Module): def __init__(self, n_feat=64, n_feat_out=128, n_feat_proj=32): super(OutProductMean, self).__init__() self.layernormM = LayerNorm(n_feat) self.linear_a = Linear(n_feat, n_feat_proj) self.linear_b = Linear(n_feat, n_feat_proj) self.o_linear = Linear(n_feat_proj * n_feat_proj, n_feat_out, initializer='zero', use_bias=True) def forward(self, M, M_mask): M = self.layernormM(M) right_act = self.linear_b(M) right_act_all, work = gather_async(right_act, dim=2) # right_act_all = gather(right_act, dim=2) left_act = self.linear_a(M) M_mask = M_mask.unsqueeze(-1) M_mask_col = scatter(M_mask, dim=2) left_act = M_mask_col * left_act norm = torch.einsum('bsid,bsjd->bijd', M_mask_col, M_mask) right_act_all = gather_async_opp(right_act_all, work, dim=2) right_act_all = M_mask * right_act_all O = torch.einsum('bsid,bsje->bijde', left_act, right_act_all) O = rearrange(O, 'b i j d e -> b i j (d e)') Z = self.o_linear(O) Z /= (1e-3 + norm) return Z class Linear(nn.Linear): """ A Linear layer with built-in nonstandard initializations. Called just like torch.nn.Linear. Implements the initializers in 1.11.4, plus some additional ones found in the code. """ def __init__( self, feature_in: int, feature_out: int, initializer: str = 'linear', use_bias: bool = True, bias_init: float = 0., ): super(Linear, self).__init__(feature_in, feature_out, bias=use_bias) self.use_bias = use_bias if initializer == 'linear': glorot_uniform_af(self.weight, gain=1.0) elif initializer == 'relu': glorot_uniform_af(self.weight, gain=2.0) elif initializer == 'zeros': nn.init.zeros_(self.weight) if self.use_bias: with torch.no_grad(): self.bias.fill_(bias_init) class SelfAttention(nn.Module): """ Multi-Head SelfAttention dealing with [batch_size1, batch_size2, len, dim] tensors """ def __init__(self, qkv_dim, c, n_head, out_dim, gating=True, last_bias_fuse=False): super(SelfAttention, self).__init__() self.qkv_dim = qkv_dim self.c = c self.n_head = n_head self.out_dim = out_dim self.gating = gating self.last_bias_fuse = last_bias_fuse self.scaling = self.c**(-0.5) self.to_qkv = Linear(qkv_dim, 3 * n_head * c, initializer='linear', use_bias=False) # self.to_q = Linear(qkv_dim, n_head * c, initializer='linear', use_bias=False) # self.to_k = Linear(qkv_dim, n_head * c, initializer='linear', use_bias=False) # self.to_v = Linear(qkv_dim, n_head * c, initializer='linear', use_bias=False) if gating: self.gating_bias = nn.parameter.Parameter(data=torch.ones((n_head * c,))) self.gating_linear = Linear(qkv_dim, n_head * c, initializer='zero', use_bias=False) self.o_linear = Linear(n_head * c, out_dim, initializer='zero', use_bias=(not last_bias_fuse)) def forward(self, in_data, mask, nonbatched_bias=None): """ :param in_data: [batch_size1, batch_size2, len_qkv, qkv_dim] :param bias: None or [batch_size1, batch_size2, n_head, len_q, len_kv] :param nonbatched_bias: None or [batch_size1, n_head, len_q, len_kv] """ qkv = self.to_qkv(in_data).chunk(3, dim=-1) q, k, v = map(lambda t: rearrange(t, 'b1 b2 n (h d) -> b1 b2 h n d', h=self.n_head), qkv) # q = self.to_q(in_data) # k = self.to_k(in_data) # v = self.to_k(in_data) # q, k, v = map(lambda t: rearrange(t, 'b1 b2 n (h d) -> b1 b2 h n d', h=self.n_head), [q, k, v]) # q = q * self.scaling logits = torch.matmul(q, k.transpose(-1, -2)) # logits += mask if nonbatched_bias is not None: # logits += nonbatched_bias.unsqueeze(1) bias = gather_async_opp(*nonbatched_bias, dim=1) bias = rearrange(bias, 'b q k h -> b h q k') weights = scale_mask_bias_softmax(logits, mask, bias.unsqueeze(1), self.scaling) else: weights = scale_mask_softmax(logits, mask, self.scaling) # weights = torch.softmax(logits, dim=-1) # weights = softmax(logits) weighted_avg = torch.matmul(weights, v) weighted_avg = rearrange(weighted_avg, 'b1 b2 h n d -> b1 b2 n (h d)') if self.gating: gate_values = self.gating_linear(in_data) weighted_avg = bias_sigmod_ele(gate_values, self.gating_bias, weighted_avg) output = self.o_linear(weighted_avg) return output
6,731
2,518
# -*- coding:utf-8 -*- """ __init__.py ~~~~~~~~ 数据收集插件 input :author: Fufu, 2021/6/7 """ from abc import abstractmethod from asyncio import create_task, sleep from typing import Any from loguru import logger from ..libs.plugin import BasePlugin class InputPlugin(BasePlugin): """数据采集插件基类""" module = 'input' async def run(self): """定时执行收集""" logger.debug(f'{self.module}.{self.name} is working') while not self.is_closed(): create_task(self.gather()) await sleep(self.get_interval(60)) logger.debug(f'{self.module}.{self.name} is closed') @abstractmethod async def gather(self) -> Any: """获取数据""" pass def is_closed(self): """检查当前插件是否该关闭 (名称不在开启的插件中)""" if self.name in self.conf.plugins_open: return False # 发送插件关闭信号 (特殊 Metric) self.out_queue.put_nowait(self.metric(None, tag='__CLOSE_SIGNAL__')) self.conf.plugins_working.discard(self.name) logger.info(f'Plugin {self.name} is closed') return True
1,093
426
import yaml import re from .SummonableBot import SummonableBot class Librarian(SummonableBot): def __init__(self, bot_name, event): self.help_command = 'help' self.help_preamble = "Here are my available responses" self.event = event with open('./responses.yml') as file: response_list = yaml.load(file, Loader=yaml.FullLoader) available_responses = response_list.get('responses').keys() regex_for_responses = "\\s*|".join(available_responses) self.summoning_regex = r'(@' + bot_name + r')\s*' + f'({regex_for_responses}\\s*|{self.help_command})' def __prepare_new_issue_text(self, top_message, links): s = top_message + """\n\n- """ s += "\n- ".join('['+ l.get('title') + '](' + l.get('url') +')' for l in links) return s def __prepare_help_response(self, top_message, responses): s = top_message + """:\n\n- """ s += "\n- ".join(response for response in responses) return s def has_been_summoned(self, comment_body): return re.search(self.summoning_regex, comment_body, re.MULTILINE) async def check_library(self, user_help_match): message = None with open('./responses.yml') as file: response_list = yaml.load(file, Loader=yaml.FullLoader) response_to_fetch = user_help_match.group(2).strip() if response_to_fetch == self.help_command: message = self.__prepare_help_response( self.help_preamble, response_list.get('responses').keys()) else: requested_response = response_list.get('responses').get(response_to_fetch, '') message = self.__prepare_new_issue_text( requested_response.get('message', ''), requested_response.get('helpful_links', [])) if message: await self.event.add_comment(message)
1,933
598
import pprint import statistics from contextlib import suppress from dataclasses import dataclass from enum import Enum from typing import Optional @dataclass class ValidCharacter: definite_locations: set[int] definite_not_locations: set[int] class CharacterStatus(Enum): GRAY = "gray" GREEN = "green" YELLOW = "yellow" @dataclass class CharacterGuess: character: str status: CharacterStatus @dataclass class GroupStats: answer: str is_potential_solution: bool number_of_groups: int average_group_size: float largest_group: int class WordGameHelper: _eliminated_characters: set[str] _included_characters: dict[str, ValidCharacter] _original_possible_common_words: set[str] possible_words: set[str] possible_common_words: set[str] def __init__( self, possible_words: Optional[set[str]], possible_common_words: Optional[set[str]], used_words: Optional[set[str]], ): self._eliminated_characters = set() self._included_characters = {} self.possible_words = possible_words or set() self.possible_common_words = possible_common_words or set() self._original_possible_common_words = possible_common_words.copy() if used_words: self.possible_words = self.possible_words - used_words self.possible_common_words = self.possible_common_words - used_words def make_guess(self, guess: list[CharacterGuess]): for index, character_guess in enumerate(guess): self._update_characters(index, character_guess) self._update_possible_words() def print_possible_answers(self): if len(self.possible_words) == 1: print(f"The answer is {self.possible_words.pop().upper()}.") return # possible_answers: list[str] = list(self.possible_words) # possible_answers.sort() # print(f"There are {len(possible_answers)} possible answers.") # print("\n".join(possible_answers)) # print() if len(self.possible_common_words) == 1: print(f"The answer is probably {self.possible_common_words.pop().upper()}.") return possible_common_answers: list[str] = list(self.possible_common_words) possible_common_answers.sort() print(f"There are {len(possible_common_answers)} common possible answers.") if len(possible_common_answers) < 5: print("\n".join(possible_common_answers)) if len(possible_common_answers) > 2: self._get_best_guess() def _get_best_guess(self): answer_groups = {} statuses = [CharacterStatus.GRAY, CharacterStatus.GREEN, CharacterStatus.YELLOW] stats: list[GroupStats] = [] for index, answer in enumerate(self._original_possible_common_words): answer_groups[answer] = [] group_lengths = [] for status1 in statuses: for status2 in statuses: for status3 in statuses: for status4 in statuses: for status5 in statuses: helper = WordGameHelper( self.possible_common_words, self.possible_common_words, set(), ) helper.make_guess( [ CharacterGuess(answer[0], status1), CharacterGuess(answer[1], status2), CharacterGuess(answer[2], status3), CharacterGuess(answer[3], status4), CharacterGuess(answer[4], status5), ] ) if len(helper.possible_words) > 0: group = helper.possible_common_words answer_groups[answer].append(group) group_lengths.append(len(group)) average_length = statistics.mean(group_lengths) group_stats = GroupStats( answer=answer, is_potential_solution=answer in self.possible_common_words, number_of_groups=len(group_lengths), average_group_size=average_length, largest_group=max(group_lengths), ) # pprint.pprint(group_stats) stats.append(group_stats) stats.sort(key=lambda x: x.average_group_size) print(f" The best guesses statistically are:") count: int = 0 for stat in stats: if stat.average_group_size > stats[0].average_group_size: continue if count > 10: break print( f" {stat.answer}, " f"is_potential_solution = {stat.is_potential_solution}, " f"number_of_groups = {stat.number_of_groups}, " f"average_group_size = {stat.average_group_size}, " f"largest_group = {stat.largest_group}" ) count += 1 print(f" The best, possibly-correct guesses statistically are:") potential_solution_stats = [ stat for stat in stats if stat.is_potential_solution ] for stat in potential_solution_stats[:10]: # if stat.average_group_size > potential_solution_stats[0].average_group_size: # continue print( f" {stat.answer}, " f"is_potential_solution = {stat.is_potential_solution}, " f"number_of_groups = {stat.number_of_groups}, " f"average_group_size = {stat.average_group_size}, " f"largest_group = {stat.largest_group}" ) def _update_characters(self, position: int, guess: CharacterGuess): value = self._included_characters.get( guess.character, ValidCharacter(set(), set()) ) if ( guess.status == CharacterStatus.GRAY and guess.character not in self._included_characters ): value.definite_not_locations.add(position) self._eliminated_characters.add(guess.character) return with suppress(KeyError): self._eliminated_characters.remove(guess.character) if guess.status in (CharacterStatus.YELLOW, CharacterStatus.GRAY): value.definite_not_locations.add(position) else: value.definite_locations.add(position) self._included_characters[guess.character] = value def _update_possible_words(self): updated_possible_words: set[str] = set() updated_possible_common_words: set[str] = set() for word in self.possible_words: if len(set(word).intersection(self._eliminated_characters)) > 0: continue is_valid: bool = True for character, valid_character in self._included_characters.items(): if not is_valid: break if character not in word: is_valid = False break for invalid_location in valid_character.definite_not_locations: if word[invalid_location] == character: is_valid = False break for valid_location in valid_character.definite_locations: if word[valid_location] != character: is_valid = False break if not is_valid: continue updated_possible_words.add(word) if word in self.possible_common_words: updated_possible_common_words.add(word) self.possible_words = updated_possible_words self.possible_common_words = updated_possible_common_words
8,201
2,195
# coding=utf-8 # # @lc app=leetcode id=876 lang=python # # [876] Middle of the Linked List # # https://leetcode.com/problems/middle-of-the-linked-list/description/ # # algorithms # Easy (64.97%) # Likes: 593 # Dislikes: 42 # Total Accepted: 76.4K # Total Submissions: 117.5K # Testcase Example: '[1,2,3,4,5]' # # Given a non-empty, singly linked list with head node head, return a middle # node of linked list. # # If there are two middle nodes, return the second middle node. # # # # # Example 1: # # # Input: [1,2,3,4,5] # Output: Node 3 from this list (Serialization: [3,4,5]) # The returned node has value 3. (The judge's serialization of this node is # [3,4,5]). # Note that we returned a ListNode object ans, such that: # ans.val = 3, ans.next.val = 4, ans.next.next.val = 5, and ans.next.next.next # = NULL. # # # # Example 2: # # # Input: [1,2,3,4,5,6] # Output: Node 4 from this list (Serialization: [4,5,6]) # Since the list has two middle nodes with values 3 and 4, we return the second # one. # # # # # Note: # # # The number of nodes in the given list will be between 1 and 100. # # # # # # Definition for singly-linked list. class ListNode(object): def __init__(self, x): self.val = x self.next = None def __str__(self): return "<ListNode %s -> %s>" % (self.val, self.next) class Solution(object): def middleNode(self, head): """ :type head: ListNode :rtype: ListNode """ if not head: return elif not head.next: return head fast = low = head while fast: if fast and fast.next and fast.next.next: fast = fast.next.next else: break low = low.next return low if not fast.next else low.next # if __name__ == '__main__': # s = Solution() # print s.middleNode(None) # head = ListNode(1) # print s.middleNode(head) # head.next = ListNode(2) # print s.middleNode(head) # head.next.next = ListNode(3) # print s.middleNode(head) # head.next.next.next = ListNode(4) # print s.middleNode(head) # head.next.next.next.next = ListNode(5) # print s.middleNode(head)
2,249
847
# New BSD License # # Copyright (c) 2007-2019 The scikit-learn developers. # All rights reserved. # # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are met: # # a. Redistributions of source code must retain the above copyright notice, # this list of conditions and the following disclaimer. # b. Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution. # c. Neither the name of the Scikit-learn Developers nor the names of # its contributors may be used to endorse or promote products # derived from this software without specific prior written # permission. # # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" # AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE # IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE # ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR # ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL # DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR # SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER # CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT # LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY # OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH # DAMAGE. import matplotlib.pyplot as plt import numpy as np from sklearn.metrics import confusion_matrix def plot_confusion_matrix(y_true, y_pred, classes, normalize=False, title=None, cmap=plt.cm.Blues, dpi=70): """ This function prints and plots the confusion matrix. Normalization can be applied by setting `normalize=True`. """ np.set_printoptions(precision=2) if not title: if normalize: title = 'Normalized confusion matrix' else: title = 'Confusion matrix, without normalization' # Compute confusion matrix cm = confusion_matrix(y_true, y_pred) # Only use the labels that appear in the data # classes = classes[unique_labels(y_true, y_pred)] if normalize: cm = cm.astype('float') / cm.sum(axis=1)[:, np.newaxis] fig, ax = plt.subplots() fig.set_dpi(dpi) im = ax.imshow(cm, interpolation='nearest', cmap=cmap) ax.figure.colorbar(im, ax=ax) # We want to show all ticks... ax.set(xticks=np.arange(cm.shape[1]), yticks=np.arange(cm.shape[0]), # ... and label them with the respective list entries xticklabels=classes, yticklabels=classes, title=title, ylabel='True label', xlabel='Predicted label') # Rotate the tick labels and set their alignment. plt.setp(ax.get_xticklabels(), rotation=45, ha="right", rotation_mode="anchor") # Loop over data dimensions and create text annotations. fmt = '.2f' if normalize else 'd' thresh = cm.max() / 2. for i in range(cm.shape[0]): for j in range(cm.shape[1]): ax.text(j, i, format(cm[i, j], fmt), ha="center", va="center", color="white" if cm[i, j] > thresh else "black") fig.tight_layout() return ax
3,442
1,141
import pytest import sys sys.path.append('.') from turingmachine import Transition, Direction, State def test_create_transition(): q0 = State() q1 = State() #In q0 upon reading a move to q1, output b, and move the tape 1 right q0.create_transition('a', q1, 'b', Direction.RIGHT) assert q0.transitions['a'].new_state == q1 assert q0.transitions['a'].output_letter == 'b' assert q0.transitions['a'].movement_direction == Direction.RIGHT def test_create_multiple_transitions(): q0 = State() q1 = State() q2 = State() q0.create_transition('a', q1, 'b', Direction.RIGHT) q1.create_transition('c', q2, 'd', Direction.LEFT) with pytest.raises(KeyError): q0.transitions['b'] is None assert q0.transitions['a'].new_state.transitions['c'].new_state == q2 assert q1.transitions['c'].new_state == q2 assert q0.transitions['a'].new_state.transitions['c'].output_letter == 'd' assert q1.transitions['c'].output_letter == 'd' assert q0.transitions['a'].new_state.transitions['c'].movement_direction == Direction.LEFT assert q1.transitions['c'].movement_direction == Direction.LEFT def test_add_transition(): q0 = State() q1 = State() t = Transition(q1, 'b', Direction.RIGHT) q0.add_transition('a', t) assert q0.transitions['a'] == t def test_create_with_transitions(): q0 = State() t1 = Transition(q0, 'c', Direction.LEFT) t2 = Transition(q0, 'd', Direction.RIGHT) q1 = State({'a': t1, 'b' : t2}) assert q1.transitions['a'] == t1 assert q1.transitions['b'] == t2 def test_calc(): q0 = State() t1 = Transition(q0, 'a', Direction.RIGHT) q1 = State() q1.add_transition('b', t1) res = q1.calc('b') assert res == t1
1,757
646
class Solution: def firstMissingPositive(self, nums): """ :type nums: List[int] :rtype: int """ # constant space # [1, len(nums) + 1] n = len(nums) for i, num in enumerate(nums): if num < 0 or num > n: nums[i] = 0 n += 1 for i, num in enumerate(nums): idx = num % n if idx: nums[idx - 1] += n for i, num in enumerate(nums, 1): if num // n == 0: return i return n
558
180
import os def returnText(): cwd = os.getcwd().replace(os.environ['HOME'],'~') lstCwd = str.split(cwd, '/') if len(lstCwd) > 3: lstCwd.reverse() lstCwd = lstCwd[0:3] lstCwd.append('+') lstCwd.reverse() strCwd = '/'.join(lstCwd) return strCwd
294
120
from unittest import mock from django.contrib.auth import get_user_model from django.core import mail from django.template import TemplateDoesNotExist from django.test import TestCase from django.urls import reverse from ..accounts.adapter import EmailAdapter from .utils import TestOrganizationMixin User = get_user_model() class TestEmailAdapter(TestOrganizationMixin, TestCase): def test_template_not_present(self): email = "test@tester.com" template_prefix = "some_random_name" with self.assertRaises(TemplateDoesNotExist): EmailAdapter.send_mail(self, template_prefix, email, {}) @mock.patch('openwisp_users.accounts.adapter.send_email') def test_assertion_not_raised_when_html_template_missing(self, mail_func): self._create_user() queryset = User.objects.filter(username='tester') self.assertEqual(queryset.count(), 1) params = {'email': 'test@tester.com'} self.client.post(reverse('account_reset_password'), params, follow=True) send_mail_calls = mail_func.call_args_list send_mail_arguments = send_mail_calls[0][0] self.assertEqual(send_mail_arguments[0], '[example.com] Password Reset E-mail') self.assertEqual(send_mail_arguments[2], '') def test_password_reset_email_sent(self): self._create_user() queryset = User.objects.filter(username='tester') self.assertEqual(queryset.count(), 1) params = {'email': 'test@tester.com'} self.client.post(reverse('account_reset_password'), params, follow=True) self.assertEqual(len(mail.outbox), 1) email = mail.outbox.pop() self.assertFalse(email.alternatives) self.assertIn('Password Reset E-mail', email.subject) self.assertIn('Click the link below to reset your password', email.body)
1,850
555
from setuptools import setup setup( name='vuln_toolkit', version='0.1', description='Transfer Learning Toolkit', url='https://para.cs.umd.edu/purtilo/vulnerability-detection-tool-set/tree/master', author='Ashton Webster', author_email='ashton.webster@gmail.com', license='MIT', packages=['vuln_toolkit', 'vuln_toolkit.common'], zip_safe=False )
382
141
# # Copyright (c) European Synchrotron Radiation Facility (ESRF) # # Permission is hereby granted, free of charge, to any person obtaining a copy of # this software and associated documentation files (the "Software"), to deal in # the Software without restriction, including without limitation the rights to # use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of # the Software, and to permit persons to whom the Software is furnished to do so, # subject to the following conditions: # # The above copyright notice and this permission notice shall be included in all # copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR # IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS # FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR # COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER # IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN # CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. # __authors__ = ["O. Svensson"] __license__ = "MIT" __date__ = "10/05/2019" import json import shutil import pprint from edna2.tasks.AbstractTask import AbstractTask from edna2.tasks.ISPyBTasks import GetListAutoprocessingResults class FindHklAsciiForMerge(AbstractTask): """ This task receives a list of data collection IDs and returns a json schema for EXI2 """ def getInDataSchema(self): return { "type": "object", "properties": { "token": {"type": "string"}, "proposal": {"type": "string"}, "dataCollectionId": { "type": "array", "items": { "type": "integer", } } } } # def getOutDataSchema(self): # return { # "type": "object", # "required": ["dataForMerge"], # "properties": { # "dataForMerge": { # "type": "object", # "items": { # "type": "object", # "properties": { # "spaceGroup": {"type": "string"} # } # } # } # } # } def run(self, inData): urlError = None token = inData['token'] proposal = inData['proposal'] listDataCollectionId = inData['dataCollectionId'] inDataGetListAutoprocessingResults = { 'token': token, 'proposal': proposal, 'dataCollectionId': listDataCollectionId } getListAutoprocessingResults = GetListAutoprocessingResults( inData=inDataGetListAutoprocessingResults ) getListAutoprocessingResults.execute() outDataAutoprocessing = getListAutoprocessingResults.outData if 'error' in outDataAutoprocessing: urlError = outDataAutoprocessing['error'] else: index = 1 properties = {} listOrder = [] for dataCollection in outDataAutoprocessing['dataCollection']: dataCollectionId = dataCollection['dataCollectionId'] dictEntry = {} listEnumNames = [] listEnumValues = [] proteinAcronym = None blSampleName = None if 'error' in dataCollection['autoprocIntegration']: urlError = dataCollection['autoprocIntegration']['error'] else: for autoProcResult in dataCollection['autoprocIntegration']: if proteinAcronym is None: proteinAcronym = autoProcResult['Protein_acronym'] blSampleName = autoProcResult['BLSample_name'] for autoProcAttachment in autoProcResult['autoprocAttachment']: if 'XDS_ASCII' in autoProcAttachment['fileName']: fileName = autoProcAttachment['fileName'] program = autoProcResult['v_datacollection_processingPrograms'] attachmentId = autoProcAttachment['autoProcProgramAttachmentId'] enumName = '{0:30s} {1}'.format(program, fileName) listEnumNames.append(enumName) enumValue = attachmentId listEnumValues.append(enumValue) if urlError is None: entryKey = 'hkl_' + str(dataCollectionId) if entryKey not in properties: dictEntry['title'] = 'Select HKL for data Collection #{0} {2} {1}-{2}'.format( index, proteinAcronym, blSampleName ) dictEntry['enum'] = listEnumValues dictEntry['enumNames'] = listEnumNames properties[entryKey] = dictEntry listOrder.append(entryKey) entryKey = 'minimum_I/SIGMA_' + str(dataCollectionId) if entryKey not in properties: # Minimum sigma dictEntry = { 'integer': 'string', 'type': 'string', 'title': 'minimum_I/SIGMA for data Collection #{0} {2} {1}-{2}'.format( index, proteinAcronym, blSampleName ) } properties[entryKey] = dictEntry listOrder.append(entryKey) index += 1 if urlError is None: schema = { 'properties': properties, 'type': 'object', 'title': 'User input needed' } uiSchema = { 'ui:order': listOrder } outData = { "schema": schema, "uiSchema": uiSchema } else: outData = { 'error': urlError } return outData class FindPipelineForMerge(AbstractTask): """ This task receives a list of data collection IDs and returns a json schema for EXI2 """ def getInDataSchema(self): return { "type": "object", "properties": { "token": {"type": "string"}, "proposal": {"type": "string"}, "dataCollectionId": { "type": "array", "items": { "type": "integer", } } } } # def getOutDataSchema(self): # return { # "type": "object", # "required": ["dataForMerge"], # "properties": { # "dataForMerge": { # "type": "object", # "items": { # "type": "object", # "properties": { # "spaceGroup": {"type": "string"} # } # } # } # } # } def run(self, inData): urlError = None token = inData['token'] proposal = inData['proposal'] listDataCollectionId = inData['dataCollectionId'] inDataGetListAutoprocessingResults = { 'token': token, 'proposal': proposal, 'dataCollectionId': listDataCollectionId } getListAutoprocessingResults = GetListAutoprocessingResults( inData=inDataGetListAutoprocessingResults ) getListAutoprocessingResults.execute() outDataAutoprocessing = getListAutoprocessingResults.outData if 'error' in outDataAutoprocessing: urlError = outDataAutoprocessing['error'] else: index = 1 properties = {} listOrder = [] dictEntry = {} for dataCollection in outDataAutoprocessing['dataCollection']: dataCollectionId = dataCollection['dataCollectionId'] listEnumValues = [] proteinAcronym = None blSampleName = None if 'error' in dataCollection['autoprocIntegration']: urlError = dataCollection['autoprocIntegration']['error'] else: for autoProcResult in dataCollection['autoprocIntegration']: if len(autoProcResult['autoprocAttachment']) > 0: if proteinAcronym is None: proteinAcronym = autoProcResult['Protein_acronym'] blSampleName = autoProcResult['BLSample_name'] if '1' in autoProcResult['anomalous']: anom = True else: anom = False for autoProcAttachment in autoProcResult['autoprocAttachment']: if 'XDS_ASCII' in autoProcAttachment['fileName']: fileName = autoProcAttachment['fileName'] program = autoProcResult['v_datacollection_processingPrograms'] attachmentId = autoProcAttachment['autoProcProgramAttachmentId'] if anom: entryKey = program + '_anom' else: entryKey = program + '_noanom' if entryKey not in dictEntry: dictEntry[entryKey] = [] dictEntry[entryKey].append({'id': attachmentId, 'fileName': fileName}) if urlError is None: listEnumNames = [] dictInput = {} for entryKey, listAttachment in dictEntry.items(): if len(listAttachment) == len(outDataAutoprocessing['dataCollection']): listEnumNames.append(entryKey) dictInput[entryKey] = listAttachment index += 1 if len(listEnumNames) > 0: dictSchema = { 'title': 'Select processing pipeline for data Collection {0}-{1}'.format( proteinAcronym, blSampleName ), 'type': 'string', 'enum': listEnumNames, 'enumNames': listEnumNames } key = "pipeline" properties[key] = dictSchema listOrder.append(key) # Minimum sigma dictSchema = { 'integer': 'string', 'type': 'string', 'title': 'minimum_I/SIGMA for data Collection {0}-{1}'.format( proteinAcronym, blSampleName ) } key = 'minimum_I/SIGMA' properties[key] = dictSchema listOrder.append(key) if urlError is None: schema = { 'properties': properties, 'type': 'object', 'title': 'User input needed' } uiSchema = { 'ui:order': listOrder } outData = { 'schema': { "schema": schema, "uiSchema": uiSchema }, 'input': dictInput } else: outData = { 'error': urlError } return outData class MergeUtls(AbstractTask): """ This task will run the Merge_utls.py program written by Shibom Basu """ def run(self, inData): listHklLp = inData['listHklLp'] workingDir = self.getWorkingDirectory() index = 1 for hklLp in listHklLp: dataDir = workingDir / "data{0}".format(index) dataDir.mkdir(exist_ok=True) shutil.copy(hklLp['hkl'], str(dataDir / 'XDS_ASCII.HKL')) index += 1 commandLine = 'Merge_utls.py --root {0} --expt serial-xtal'.format(str(workingDir)) self.runCommandLine(commandLine, logPath=None) # Find Mergeing_results.json resultPath = self.getWorkingDirectory() / 'adm_serial-xtal' / 'adm_3' / 'Mergeing_results.json' if resultPath.exists(): with open(str(resultPath)) as f: mergeResult = json.loads(f.read()) outData = {'mergeResult': mergeResult} return outData
13,255
3,303
import numpy as np from tqdm import * from utils import DataLoaderX from dataset import collate from math import * def prediction(data, model, batch_size, cuda): data_loader = DataLoaderX(data, batch_size=batch_size, collate_fn=collate, num_workers=0) model.training = False iterator = tqdm(data_loader) out = [] for sample in iterator: sample['data'] = sample['data'].float() if cuda: out += model(sample['data']).cpu() else: out += model(sample['data']) return out def recovery(ori_shape, output, size): if size[0] >= ori_shape[1] or size[1] >= ori_shape[2]: # de-padding output = output[0].detach().numpy() diff_x = size[0] - ori_shape[1] diff_y = size[1] - ori_shape[2] return output[:, diff_x // 2:-(diff_x - diff_x // 2), diff_y // 2:-(diff_y - diff_y // 2)] h, w = size[0], size[1] cols = ceil(ori_shape[2] / w) rows = ceil(ori_shape[1] / h) assert rows * cols == len(output) results = np.zeros((ori_shape[0], rows * size[0], cols * size[1])) for i, out in enumerate(output): out = out.detach().numpy() out = out[:, 8:-8, 8:-8] end_col = (i + 1) % cols * size[1] if (i + 1) % cols > 0 else cols * size[1] results[:, i // cols * size[0]:(i // cols + 1) * size[0], i % cols * size[1]:end_col] = out return results[:, 0:ori_shape[1], 0:ori_shape[2]] if __name__ == '__main__': a = np.zeros((4, 3, 3)) print(a[:, 0:-1, 0:-1].shape)
1,556
586
import torch from torch import nn from tqdm import tqdm from entmax import entmax_bisect import torch.nn.functional as F # helper function def eval_decorator(fn): def inner(model, *args, **kwargs): was_training = model.training model.eval() out = fn(model, *args, **kwargs) model.train(was_training) return out return inner # top k filtering def top_p(logits, thres = 0.9): sorted_logits, sorted_indices = torch.sort(logits, descending=True) cum_probs = torch.cumsum(F.softmax(sorted_logits, dim=-1), dim=-1) sorted_indices_to_remove = cum_probs > (1 - thres) sorted_indices_to_remove[:, 1:] = sorted_indices_to_remove[:, :-1].clone() sorted_indices_to_remove[:, 0] = 0 sorted_logits[sorted_indices_to_remove] = float('-inf') return sorted_logits.scatter(1, sorted_indices, sorted_logits) # topk def top_k(logits, thres = 0.9): k = ceil((1 - thres) * logits.shape[-1]) val, ind = torch.topk(logits, k) probs = torch.full_like(logits, float('-inf')) probs.scatter_(1, ind, val) return probs # top_a def top_a(logits, min_p_pow=2.0, min_p_ratio=0.02): probs = F.softmax(logits, dim=-1) limit = torch.pow(torch.max(probs), min_p_pow) * min_p_ratio logits[probs < limit] = -float("Inf") logits[probs >= limit] = 1 return logits ENTMAX_ALPHA = 1.3 entmax = entmax_bisect class AutoregressiveWrapper(nn.Module): def __init__(self, net, ignore_index = -100, pad_value = 0): super().__init__() self.pad_value = pad_value self.ignore_index = ignore_index self.net = net self.max_seq_len = net.seq_len @torch.no_grad() @eval_decorator def generate(self, start_tokens, seq_len, eos_token = None, temperature = 1., filter_logits_fn = top_k, filter_thres = 0.9, min_p_pow=2.0, min_p_ratio=0.02, **kwargs): device = start_tokens.device num_dims = len(start_tokens.shape) if num_dims == 1: start_tokens = start_tokens[None, :] b, t = start_tokens.shape out = start_tokens for _ in tqdm(range(seq_len)): x = out[:, -self.max_seq_len:] logits = self.net(x, **kwargs)[:, -1, :] if filter_logits_fn in {top_k, top_p}: filtered_logits = filter_logits_fn(logits, thres = filter_thres) probs = F.softmax(filtered_logits / temperature, dim=-1) elif filter_logits_fn is top_a: filtered_logits = filter_logits_fn(logits, min_p_pow = min_p_pow, min_p_ratio= min_p_ratio) probs = F.softmax(filtered_logits / temperature, dim=-1) elif filter_logits_fn is entmax: probs = entmax(logits / temperature, alpha = ENTMAX_ALPHA, dim=-1) sample = torch.multinomial(probs, 1) out = torch.cat((out, sample), dim=-1) if eos_token is not None and (sample == eos_token).all(): break out = out[:, t:] if num_dims == 1: out = out.squeeze(0) return out def forward(self, x, **kwargs): xi, xo = x[:, :-1], x[:, 1:] out = self.net(xi, **kwargs) loss = F.cross_entropy(out.transpose(1, 2), xo, ignore_index = self.ignore_index) return loss
3,318
1,243
# 1478. Allocate Mailboxes # User Accepted:342 # User Tried:594 # Total Accepted:364 # Total Submissions:1061 # Difficulty:Hard # Given the array houses and an integer k. where houses[i] is the location of the ith house along a street, your task is to allocate k mailboxes in the street. # Return the minimum total distance between each house and its nearest mailbox. # The answer is guaranteed to fit in a 32-bit signed integer. # Example 1: # Input: houses = [1,4,8,10,20], k = 3 # Output: 5 # Explanation: Allocate mailboxes in position 3, 9 and 20. # Minimum total distance from each houses to nearest mailboxes is |3-1| + |4-3| + |9-8| + |10-9| + |20-20| = 5 # Example 2: # Input: houses = [2,3,5,12,18], k = 2 # Output: 9 # Explanation: Allocate mailboxes in position 3 and 14. # Minimum total distance from each houses to nearest mailboxes is |2-3| + |3-3| + |5-3| + |12-14| + |18-14| = 9. # Example 3: # Input: houses = [7,4,6,1], k = 1 # Output: 8 # Example 4: # Input: houses = [3,6,14,10], k = 4 # Output: 0 # Constraints: # n == houses.length # 1 <= n <= 100 # 1 <= houses[i] <= 10^4 # 1 <= k <= n # Array houses contain unique integers. class Solution: def minDistance(self, houses: List[int], k: int) -> int: # if k >= len(houses): # return 0 # houses.sort() # res = 0 # num = 0 # tmp = houses[1:] + [houses[1]] # diff = [tmp[i] - houses[i] for i in range(len(houses)-1)] # diff.sort() # for i in range(len(diff)): # res += diff[i] # num += 2 # k -= 1 # if num + k == len(houses): # return res pass
1,686
661
""" Operadores lógicos Para agrupar operações com lógica booleana, utilizaremos operadores lógicos. Python suporta três operadores básicos: not (não), and (e), or (ou). Esses operadores podem ser traduzidos como não (¬ negação), e (Λ conjunção) e ou (V disjunção). """ # Operador not """ >>> not True False >>> not False True """ # Operador and """ O operador and (e) tem sua tabela verdade representada na tabela 3.5. O operador and (e) resulta verdadeiro apenas quando seus dois operadores forem verdadeiros. >>> True and True True >>> True and False False >>> False and True False >>> False and False False """ # Operador or """ O operador or (ou) é que ele resulta em falso apenas se seus dois operadores também forem falsos. Se apenas um de seus operadores for verdadeiro, ou se os dois forem, o resultado da operação será verdadeiro. >>> True or True True >>> True or False True >>> False or True True >>> False or False False """ """ isso é um comentário """ """ comen """
990
353
# # Copyright (c) 2015-2016 Wind River Systems, Inc. # # SPDX-License-Identifier: Apache-2.0 # from nfv_common.alarm import * # noqa: F401,F403 from nfv_vim.alarm._general import clear_general_alarm # noqa: F401 from nfv_vim.alarm._general import raise_general_alarm # noqa: F401 from nfv_vim.alarm._host import host_clear_alarm # noqa: F401 from nfv_vim.alarm._host import host_raise_alarm # noqa: F401 from nfv_vim.alarm._instance import instance_clear_alarm # noqa: F401 from nfv_vim.alarm._instance import instance_manage_alarms # noqa: F401 from nfv_vim.alarm._instance import instance_raise_alarm # noqa: F401 from nfv_vim.alarm._instance_group import clear_instance_group_alarm # noqa: F401 from nfv_vim.alarm._instance_group import raise_instance_group_policy_alarm # noqa: F401 from nfv_vim.alarm._sw_update import clear_sw_update_alarm # noqa: F401 from nfv_vim.alarm._sw_update import raise_sw_update_alarm # noqa: F401
944
402
"""~#SHORTDESCRIPTION#~""" __version__ = "1.0.0" __release__ = "1" __program_name__ = "~#PROJECT#~"
101
51
from typing import Optional from torch import nn from rl_multi_agent.experiments.furnmove_grid_marginal_nocl_base_config import ( FurnMoveExperimentConfig, ) from rl_multi_agent.models import A3CLSTMNStepComCoordinatedActionsEgoGridsEmbedCNN class FurnMoveGridExperimentConfig(FurnMoveExperimentConfig): # Increasing the params of marginal to match mixture final_cnn_channels = 288 @classmethod def get_init_train_params(cls): init_train_params = FurnMoveExperimentConfig.get_init_train_params() init_train_params["environment_args"] = {"min_steps_between_agents": 2} return init_train_params @property def saved_model_path(self) -> Optional[str]: return None @classmethod def create_model(cls, **kwargs) -> nn.Module: def _create_model(**kwargs): return A3CLSTMNStepComCoordinatedActionsEgoGridsEmbedCNN( **{ **dict( num_inputs=9, action_groups=cls.episode_class.class_available_action_groups( include_move_obj_actions=cls.include_move_obj_actions ), num_agents=cls.num_agents, state_repr_length=cls.state_repr_length, occupancy_embed_length=8, talk_embed_length=cls.talk_embed_length, agent_num_embed_length=cls.agent_num_embed_length, reply_embed_length=cls.reply_embed_length, turn_off_communication=cls.turn_off_communication, coordinate_actions=cls.coordinate_actions, coordinate_actions_dim=13 if cls.coordinate_actions else None, separate_actor_weights=False, num_talk_symbols=cls.num_talk_symbols, num_reply_symbols=cls.num_reply_symbols, final_cnn_channels=cls.final_cnn_channels, ), **kwargs, } ) return _create_model(**kwargs) def get_experiment(): return FurnMoveGridExperimentConfig()
2,225
643
""" Request controllers for the external links service. These may be used handle requests originating from the :mod:`.routes.api` and/or the :mod:`.routes.ui`. If the behavior of these controllers diverges along the UI/API lines, then we can split this into ``controllers/api.py`` and ``controllers/ui.py``. """ from typing import Tuple, Any, Dict from http import HTTPStatus from werkzeug.datastructures import MultiDict Response = Tuple[Dict[str, Any], HTTPStatus, Dict[str, str]] def service_status(params: MultiDict) -> Response: """ Handle requests for the service status endpoint. Returns ``200 OK`` if the service is up and ready to handle requests. """ return {'iam': 'ok'}, HTTPStatus.OK, {}
728
212
from __future__ import division from __future__ import unicode_literals import re from django.http import HttpResponse from django.shortcuts import redirect from django.template import RequestContext from django.template import loader from models import * from apps.core.views import get_bg_color def list_students(request, classroom_slug): if not request.user.is_staff: return redirect('show_page', classroom_slug) try: classroom = Classroom.objects.get(slug=classroom_slug) except: return redirect('core_index') context = { 'classroom': classroom, 'bg_color': get_bg_color(request), } template = 'roster/list_students.html' c = RequestContext(request, context) t = loader.get_template(template) return HttpResponse(t.render(c)) def edit_student_list(request, classroom_slug): if not request.user.is_staff: return redirect('show_page', classroom_slug) try: classroom = Classroom.objects.get(slug=classroom_slug) except: return redirect('core_index') students = Student.objects.filter(classroom=classroom) student_list_csv = '' for student in students: student_csv = ','.join([student.last_name,student.first_name,'']) student_list_csv += student_csv + '\n' context = { 'student_list_csv': student_list_csv, 'classroom': classroom, 'bg_color': get_bg_color(request), } template = 'roster/edit_student_list.html' c = RequestContext(request, context) t = loader.get_template(template) return HttpResponse(t.render(c)) def post_student_list(request, classroom_slug): if not request.user.is_staff: return redirect('show_page', classroom_slug) try: classroom = Classroom.objects.get(slug=classroom_slug) except: return redirect('core_index') students = Student.objects.filter(classroom=classroom) if 'submit' in request.POST: for student in students: # really should only delete those not in POST... student.delete() student_list = request.POST['student_list_csv'].splitlines() for line in student_list: [last_name, first_name, password] = [x.strip() for x in line.split(',')] username = first_name[0].lower() username += re.sub(r'[^a-z]', '', last_name.lower())[:7] try: student_user = User.objects.get(username=username) except: student_user = User() student_user.username = username student_user.last_name = last_name student_user.first_name = first_name student_user.set_password(password) student_user.save() student = Student() student.classroom = classroom student.user = student_user student.save() student_user.first_name = first_name student_user.last_name = last_name student_user.save() return redirect('list_students', classroom_slug)
3,101
896
from __future__ import unicode_literals from subprocess import call from re import search from random import sample, choice from csv import reader from os import popen from prompt_toolkit import prompt from prompt_toolkit.completion import WordCompleter ''' The strings, input and output of this program is in lowercase. => case-insensitive List of standard OUI: http://standards-oui.ieee.org/oui/oui.txt http://standards-oui.ieee.org/oui/oui.csv ''' # Validating mac address def mac_validation(mac): if search(string=mac, pattern=r"^([0-9a-f]{2}:){5}[0-9a-f]{2}$"): return "Valid mac" else: print("Invalid mac. Check it and try again") quit() # Validating Interface def interface_validation(interface): if search(string=interface, pattern=r"^(eth|wlan)\d{1}$"): return "Valid interface" else: print("Invalid Interface. Check it and try again") quit() hex_characters = ["0", "1", "2", "3", "4", "5", "6", "7", "8", "9", "a", "b", "c", "d", "e", "f"] # Checking if user wants to choose new mac address randomly or not random_or_not = prompt("Do you want your mac address to change randomly? [(Y)es or (N)o]\nOr\nDo you want to choose first part of your mac address based on other manufacturers mac address? [(O)UI]\nOr\nDo you want your mac address back to original one? [(R)everse]\nYour answer: ").lower() interface = prompt("Please insert name of the interface you want to change its mac: [wlan* or eth*] ").lower() interface_validation(interface) if random_or_not == "y" or random_or_not == "yes": # random mac random_mac = [] for i in range(6): random_mac.append("".join(sample(hex_characters, 2))) random_mac = ":".join(random_mac) print("Your new mac address will be {0}".format(random_mac)) elif random_or_not == "n" or random_or_not == "no": # user's new mac mac = prompt("Please insert your new mac: ").lower() mac_validation(mac) elif random_or_not == "r" or random_or_not == "reverse": # back to normal if search(string=interface, pattern=r"^eth\d{1}$"): with open(file="/tmp/eth-old-mac.txt", mode="r", encoding="utf-8") as old_mac: mac = old_mac.readline() elif search(string=interface, pattern=r"^wlan\d{1}$"): with open(file="/tmp/wlan-old-mac.txt", mode="r", encoding="utf-8") as old_mac: mac = old_mac.readline() elif random_or_not == "o" or random_or_not == "oui": oui = {} # Creating Template of our dictionary (OUI) with open(file="oui.csv", mode="r", encoding="utf-8") as csvfile: csvreader = reader(csvfile) next(csvreader) # ignore first row of csv which is header for row in csvreader: oui[str(row[2]).replace(" ", " ")] = [] # Fill values of dictionary (OUI) with open(file="oui.csv", mode="r", encoding="utf-8") as csvfile: csvreader = reader(csvfile) next(csvreader) # ignore first row of csv which is header for row in csvreader: value = oui[str(row[2]).replace(" ", " ")] if len(str(row[1])) > 6: continue else: value.append(str(row[1])) oui[str(row[2])] = value # Deleting keys with empty values [] # 273 keys were deleted from list. for key, value in list(oui.items()): if value == []: del oui[key] random_organization = prompt("Do you want to choose your mac address from specific manufacturer? [(Y)es or (N)o] ").lower() if random_organization == "y" or random_organization == "yes": organizations = WordCompleter(list(oui.keys()), ignore_case=True) organization = prompt("Please select an organization name: ", completer=organizations) print("You will be using mac address of '{0}' organization.".format(organization)) random_oui = choice(oui.get("{0}".format(organization))) character_need = 12 - len(random_oui) mac_without_colon = random_oui + str("".join(sample(hex_characters, character_need))) mac = mac_without_colon[0:2] + ":" + mac_without_colon[2:4] + ":" + mac_without_colon[4:6] + ":" + mac_without_colon[6:8] + ":" + mac_without_colon[8:10] + ":" + mac_without_colon[10:12] mac = mac.lower() print("Your new mac address will be {0}".format(mac)) elif random_organization == "n" or random_organization == "no": organization = choice(list(oui.keys())) print("You will be using mac address of '{0}' organization.".format(organization)) random_oui = choice(oui.get("{0}".format(organization))) character_need = 12 - len(random_oui) mac_without_colon = random_oui + str("".join(sample(hex_characters, character_need))) mac = mac_without_colon[0:2] + ":" + mac_without_colon[2:4] + ":" + mac_without_colon[4:6] + ":" + mac_without_colon[6:8] + ":" + mac_without_colon[8:10] + ":" + mac_without_colon[10:12] mac = mac.lower() print("Your new mac address will be {0}".format(mac)) else: print("Please choose your answer correctly!") quit() else: print("Please check your answer!") quit() # Saving old mac addresses | delete text files in reverse mode if random_or_not == "r" or random_or_not == "reverse": delete = prompt("Do you want to delete files related to your old mac address? [(Y)es or (N)o] ").lower() if delete == "y" or delete =="yes": call("rm /tmp/eth-old-mac.txt /tmp/wlan-old-mac.txt", shell=True) elif delete == "n" or delete =="no": pass else: print("Please check your answer! What do you want to do with old mac address text files?!") quit() else: call("ip addr | grep -E 'ether' | cut --delimiter=' ' -f 6 | sed -n '1p' > /tmp/eth-old-mac.txt", shell=True) call("ip addr | grep -E 'ether' | cut --delimiter=' ' -f 6 | sed -n '2p' > /tmp/wlan-old-mac.txt", shell=True) # Checking kernel version to call different commands kernel_version = popen("uname -r").read() if float(".".join(kernel_version.split(".")[:2])) < 4.15: # Start changing mac address for kernel versions lower than 4.15 call("ifconfig {0} down".format(interface), shell=True) call("ifconfig {0} hw ether {1}".format(interface, mac), shell=True) call("ifconfig {0} up".format(interface), shell=True) else: # Start changing mac address for kernel versions higher than 4.15 call("ip link set {0} down".format(interface), shell=True) call("ip link set {0} address {1}".format(interface, mac), shell=True) call("ip link set {0} up".format(interface), shell=True) print("Done :)")
6,635
2,171
#!/usr/bin/env python3 # -*- coding: utf-8 -*- # pylint: disable=wrong-import-position # pylint: disable=protected-access import concurrent.futures import io import os import sys import tempfile import threading sys.path.insert(0, os.path.abspath(os.path.join(os.path.dirname(__file__), '..'))) from ratarmountcore import StenciledFile # noqa: E402 testData = b"1234567890" tmpFile = tempfile.TemporaryFile() tmpFile.write(testData) randomTestData = os.urandom(128 * 1024) randomTmpFile = tempfile.TemporaryFile() randomTmpFile.write(randomTestData) class TestStenciledFile: @staticmethod def test_empty_file(): assert StenciledFile(tmpFile, [(0, 0)]).read() == b"" @staticmethod def test_findStencil(): stenciledFile = StenciledFile(tmpFile, [(1, 2), (2, 2), (0, 2), (4, 4), (1, 8), (0, 1)]) expectedResults = [0, 0, 1, 1, 2, 2, 3, 3, 3, 3, 4, 4, 4, 4, 4, 4, 4, 4, 5] for offset, iExpectedStencil in enumerate(expectedResults): assert stenciledFile._findStencil(offset) == iExpectedStencil @staticmethod def test_single_stencil(): assert StenciledFile(tmpFile, [(0, 1)]).read() == b"1" assert StenciledFile(tmpFile, [(0, 2)]).read() == b"12" assert StenciledFile(tmpFile, [(0, 3)]).read() == b"123" assert StenciledFile(tmpFile, [(0, len(testData))]).read() == testData @staticmethod def test_1B_stencils(): assert StenciledFile(tmpFile, [(0, 1), (1, 1)]).read() == b"12" assert StenciledFile(tmpFile, [(0, 1), (2, 1)]).read() == b"13" assert StenciledFile(tmpFile, [(1, 1), (0, 1)]).read() == b"21" assert StenciledFile(tmpFile, [(0, 1), (1, 1), (2, 1)]).read() == b"123" assert StenciledFile(tmpFile, [(1, 1), (2, 1), (0, 1)]).read() == b"231" @staticmethod def test_2B_stencils(): assert StenciledFile(tmpFile, [(0, 2), (1, 2)]).read() == b"1223" assert StenciledFile(tmpFile, [(0, 2), (2, 2)]).read() == b"1234" assert StenciledFile(tmpFile, [(1, 2), (0, 2)]).read() == b"2312" assert StenciledFile(tmpFile, [(0, 2), (1, 2), (2, 2)]).read() == b"122334" assert StenciledFile(tmpFile, [(1, 2), (2, 2), (0, 2)]).read() == b"233412" @staticmethod def test_read_with_size(): assert StenciledFile(tmpFile, [(1, 2), (2, 2), (0, 2)]).read(0) == b"" assert StenciledFile(tmpFile, [(1, 2), (2, 2), (0, 2)]).read(1) == b"2" assert StenciledFile(tmpFile, [(1, 2), (2, 2), (0, 2)]).read(2) == b"23" assert StenciledFile(tmpFile, [(1, 2), (2, 2), (0, 2)]).read(3) == b"233" assert StenciledFile(tmpFile, [(1, 2), (2, 2), (0, 2)]).read(4) == b"2334" assert StenciledFile(tmpFile, [(1, 2), (2, 2), (0, 2)]).read(5) == b"23341" assert StenciledFile(tmpFile, [(1, 2), (2, 2), (0, 2)]).read(6) == b"233412" assert StenciledFile(tmpFile, [(1, 2), (2, 2), (0, 2)]).read(7) == b"233412" @staticmethod def test_seek_and_tell(): stenciledFile = StenciledFile(tmpFile, [(1, 2), (2, 2), (0, 2)]) for i in range(7): assert stenciledFile.tell() == i stenciledFile.read(1) for i in reversed(range(6)): assert stenciledFile.seek(-1, io.SEEK_CUR) == i assert stenciledFile.tell() == i assert stenciledFile.seek(0, io.SEEK_END) == 6 assert stenciledFile.tell() == 6 assert stenciledFile.seek(20, io.SEEK_END) == 26 assert stenciledFile.tell() == 26 assert stenciledFile.read(1) == b"" assert stenciledFile.seek(-6, io.SEEK_END) == 0 assert stenciledFile.read(1) == b"2" @staticmethod def test_reading_from_shared_file(): stenciledFile1 = StenciledFile(tmpFile, [(0, len(testData))]) stenciledFile2 = StenciledFile(tmpFile, [(0, len(testData))]) for i in range(len(testData)): assert stenciledFile1.read(1) == testData[i : i + 1] assert stenciledFile2.read(1) == testData[i : i + 1] @staticmethod def test_successive_reads(lock=None): stenciledFile = StenciledFile(randomTmpFile, [(0, len(randomTestData))], lock) batchSize = 1024 for i in range(len(randomTestData) // batchSize): assert stenciledFile.read(batchSize) == randomTestData[i * batchSize : (i + 1) * batchSize] @staticmethod def test_multithreaded_reading(): parallelism = 24 with concurrent.futures.ThreadPoolExecutor(24) as pool: lock = threading.Lock() results = [] for _ in range(parallelism): results.append(pool.submit(TestStenciledFile.test_successive_reads, lock)) for result in results: result.result()
4,775
1,911
import datetime import json import os import requests import smtplib import ssl def check_status(config): new_state = get_current_state() last_known_state = get_last_known_state() activated = get_activated(new_state, last_known_state) deactivated = get_deactivated(new_state, last_known_state) save_state(new_state) if len(activated) == 0 and len(deactivated) == 0: print("No change in the state, will not send any email.") return send_email(config, create_msg(activated, deactivated)) def send_email(config, msg): context = ssl.create_default_context() with smtplib.SMTP_SSL(config["host"], config["port"], context=context) as server: server.login(config["sender_email"], config["password"]) server.sendmail(config["sender_email"], config["recipients"], msg) server.quit() print("Email sent.") def create_msg(activated_sensors, deactivated_sensors): msg = ["Subject: Sensors have changed state", ""] if len(deactivated_sensors) > 0: msg.append( "I am sorry to inform you that one or more sensors might not be" " active anymore. I have failed to receive status from:" ) [msg.append("* " + sensor) for sensor in deactivated_sensors] msg.append("") if len(activated_sensors) > 0: msg.append("Some sensors have been activated again:") [msg.append("* " + sensor) for sensor in activated_sensors] msg.append("") msg.append("This message was generated {}".format(datetime.datetime.utcnow())) msg.append("") msg.append("Yours sincerely,") msg.append("Walter") return "\r\n".join(msg) def get_activated(new_state, old_state): result = [] for sensor, value in new_state.items(): if value is True and sensor in old_state and old_state[sensor] is False: result.append(sensor) return result def get_deactivated(new_state, old_state): result = [] for sensor, value in new_state.items(): if value is False and sensor in old_state and old_state[sensor] is True: result.append(sensor) return result def get_last_known_state(): state_file_path = os.path.join("scripts", "check_status_state.json") if not os.path.exists(state_file_path): return {} with open(state_file_path, "r") as f: data = f.read() if data == "": return {} return json.loads(data) def save_state(state): state_file_path = os.path.join("scripts", "check_status_state.json") with open(state_file_path, "w+") as f: json.dump(state, f, ensure_ascii=False, indent=4) def get_current_state(): return {sensor["name"]: sensor["is_active"] for sensor in get_sensors()} def get_sensors(): return requests.get("http://localhost:5000/api/sensors").json() if __name__ == "__main__": with open(os.path.join("scripts", "check_status_config.json"), "r") as f: data = f.read() config = json.loads(data) check_status(config)
3,029
972
# Settings Manager # guidanoli DEFAULT_STGS = { "commas": "true", "comments": "true", "tknlistpath": "tknlist.tk", "tokenpath": "token.tk" } SETTINGS_PATH = "fibonacci.cfg" TYPE_STR = type("") TYPE_LIST = type([]) def _validateFilename( filename , extension = "" ): from re import match return match("[^<>:\"\\/|?*]+"+extension,filename).groups() != None def _validateEdit( label , new_value ): if label == "commas": return new_value in ["true","false"] elif label == "comment": return new_value in ["true", "false"] elif label == "tknlistpath": return _validateFilename(new_value,".tk") elif label == "tokenpath": return _validateFilename(new_value,".tk") def _validateString( s ): # returns True if OK, False if invalid assert(type(s)==TYPE_STR) return not( True in [ (c in ['=','\n']) for c in s ] ) def _writeSettings( settings_list ): assert(type(settings_list)==TYPE_LIST) try: f = open(SETTINGS_PATH,"w") f.write( "\n".join([ "=".join(s) for s in settings_list ]) ) f.close() except IOError: print("Could not write cfg file.") return False return True def _getSettingsList(): # returns settings as # <dict> "ok":boolean # if ok == True , TYPE_LIST:list try: f = open(SETTINGS_PATH,"r") l = [ p.strip().split('=') for p in f ] f.close() except FileNotFoundError: print("Could not find cfg file. Creating default cfg file...") if _generateSettingsFile(): print("The default cfg file was created successfully. Re-run me.") return None except IOError: print("Could not read cfg file.") return None return l def _generateSettingsFile(): # generates cfg file according to default settings # returns True if successful and False if error occurred on I/O return _writeSettings([ [k,v] for k,v in DEFAULT_STGS.items() ]) def _validateSettingFormat( s ): if type(s) != TYPE_LIST: print("Setting isn't table.") return False if len(s) != 2: print("Setting table size is wrong.") return False if True in [ type(x) != TYPE_STR for x in s]: print("Settings variables aren't string.") return False if False in [ _validateString(x) for x in s]: print("Settings variables are invalid.") return False return True def _getSettingLabel( s ): assert(_validateSettingFormat(s)) return s[0] def _getSettingValue( s ): assert(_validateSettingFormat(s)) return s[1] def _formatSetting( label, new_value ): return [label,new_value] def _getSettingValueFromLabel( settings_list , label ): assert(type(settings_list)==TYPE_LIST) assert(type(label)==TYPE_STR) for s in settings_list: if _getSettingLabel(s) == label: return _getSettingValue(s) return None def _printSettings( settings_list ): assert(type(settings_list)==TYPE_LIST) print("{:<20}{:<20}".format("Label","Value")) print("-"*40) for s in settings_list: if not _validateSettingFormat(s): return print("{:<20}{:<20}".format(_getSettingLabel(s),_getSettingValue(s))) if len(settings_list) == 0: print("No settings found.") def _editSetting( settings_list , label , new_value ): # saves the new value in the cfg file assert(type(settings_list)==TYPE_LIST) assert(type(label)==TYPE_STR) assert(type(new_value)==TYPE_STR) if len(new_value) == 0 or not _validateString(new_value): print("\nInvalid string for new value.") return False lbl_list = [ _getSettingLabel(s) for s in settings_list ] if not label in lbl_list: print("\nUnexpected error occurred. Label not in list.") return False if not _validateEdit(label,new_value): print("\nNew value does not meet label requirementes. Check README.") return False idx = lbl_list.index(label) settings_list[idx] = _formatSetting(label,new_value) return _writeSettings(settings_list) def getSetting( label ): # returns setting value through label # returns None if error occurrs assert(type(label)==TYPE_STR) slist = _getSettingsList() if slist == None: return None return _getSettingValueFromLabel(slist,label) def launch( cmd ): assert(type(cmd)==TYPE_STR) if cmd == 'sd': #resets settings to default if _generateSettingsFile(): print("Settings were set to default.") elif cmd in ['se','sv']: #print settings list slist = _getSettingsList() if slist == None: print("Could not print settings list.\n") return _printSettings(slist) if cmd == 'se': print() lbl = input("Label: ") curr_value = _getSettingValueFromLabel(slist,lbl) if curr_value == None: print("Label not recognized.\n") return print("Current value for '"+lbl+"': "+curr_value) new_value = input("Setting new value: ") if _editSetting(slist,lbl,new_value): print("New value set successfully.") else: print("Command '"+cmd+"' not recognized.") print()
5,340
1,627
#!/usr/bin/env python # -*- coding: utf-8 -*- # Copyright SquirrelNetwork from core import decorators from telegram.utils.helpers import mention_markdown @decorators.public.init @decorators.delete.init def init(update,context): bot = context.bot administrators = update.effective_chat.get_administrators() chat = update.effective_chat.id string = "Group Staff:\n" for admin in administrators: user = admin.user user_first = user.first_name string += "👮 {}\n".format(mention_markdown(user.id, user_first, version=2)) bot.send_message(chat,string,parse_mode='MarkdownV2')
632
204
from ..utils import Object class Users(Object): """ Represents a list of users Attributes: ID (:obj:`str`): ``Users`` Args: total_count (:obj:`int`): Approximate total count of users found user_ids (List of :obj:`int`): A list of user identifiers Returns: Users Raises: :class:`telegram.Error` """ ID = "users" def __init__(self, total_count, user_ids, **kwargs): self.total_count = total_count # int self.user_ids = user_ids # list of int @staticmethod def read(q: dict, *args) -> "Users": total_count = q.get('total_count') user_ids = q.get('user_ids') return Users(total_count, user_ids)
762
249
# -*- coding: utf-8 -*- ####################################################### ''' input 路徑 圖片數量 MOD值 嵌密率 處理內容 輸入一張圖片的資料,包含: 1.資料夾名稱 2.檔案名稱(圖片),單純用來記錄在xlsx檔案中 3.輸出路徑-xlsx 4.嵌密mod值 5.嵌密率 output 產生輸入圖片的xlsx檔(依序將所有圖片的資料寫入xlsx檔中) 包含執行時間 ''' ####################################################### from skimage import io from openpyxl import Workbook import openpyxl import os import math import time def cal_capacity(in_dir, num_image, num_mod, embed_ratio): wb = Workbook() ws = wb.active ws.append(["無LM","mod="+str(num_mod),str(embed_ratio)+"%","256*256"]) ws.append(["檔名","嵌密量","bpp"]) a=[] #儲存各項平均值 for i in range(2): a.append(0) for i in range(num_image): f_code= open(in_dir+"/output{:08d}".format(i)+"/output{:08d}_code.txt".format(i),'r') #打開location map.txt來計算capacity words = f_code.read() num_words = len(words) num_words*=math.log(num_mod,2) #capacity bpp=num_words/(256*256) #嵌入率(%)(txt和png相同) ws.append(["output{:08d}".format(i), float('%.2f'%round(num_words,2)), #四捨五入到指定小數位 float('%.2f'%round(bpp,2))]) a[0]+=num_words a[1]+=bpp if i % 250 == 0 : print(i) for i in range(2): a[i]/=num_image ws.append(["檔名","嵌密量","bpp"]) ws.append([ "", float('%.2f'%round(a[0],2)), float('%.2f'%round(a[1],2)), ]) wb.save(in_dir+"/NLM-mod{:d}_capacity".format(num_mod)+"({:d}%).xlsx".format(embed_ratio)) #寫檔後存檔 #---------------------------------------------------------------------------設定區 in_dir="D:\\108resercher\\====######RESEARCH######====\\GAN-research\\12.8\\無LM嵌密結果\\100%MOD3" num_image = 5000 num_mod = 3 embed_ratio= 100 #---------------------------------------------------------------------------設定區 tStart = time.time() #計時開始 cal_capacity(in_dir,num_image,num_mod,embed_ratio) #執行程式 tEnd = time.time() #計時結束 wb = openpyxl.load_workbook(in_dir+"/NLM-mod{:d}_capacity".format(num_mod)+"({:d}%).xlsx".format(embed_ratio)) ws = wb['Sheet'] ws.append(["total time",str(round(tEnd-tStart,2))+" s"]) wb.save(in_dir+"/NLM-mod{:d}_capacity".format(num_mod)+"({:d}%).xlsx".format(embed_ratio)) #寫檔後存檔
2,937
1,156
from collections import OrderedDict my_dict = OrderedDict() def populate(data: dict): my_dict.update(data) return True if __name__ == "__main__": print(populate({}))
183
63
# -*- coding: utf-8 -*- # Copyright (c) 2021 Brian Scholer (@briantist) # GNU General Public License v3.0+ (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt) from __future__ import (absolute_import, division, print_function) __metaclass__ = type import os import pytest from ansible_collections.community.hashi_vault.tests.unit.compat import mock from ansible_collections.community.hashi_vault.plugins.module_utils._hashi_vault_common import ( HashiVaultOptionGroupBase, HashiVaultOptionAdapter, ) PREREAD_OPTIONS = { 'opt1': 'val1', 'opt2': None, 'opt3': 'val3', 'opt4': None, # no opt5 'opt6': None, } LOW_PREF_DEF = { 'opt1': dict(env=['_ENV_1A'], default='never'), 'opt2': dict(env=['_ENV_2A', '_ENV_2B']), 'opt4': dict(env=['_ENV_4A', '_ENV_4B', '_ENV_4C']), 'opt5': dict(env=['_ENV_5A']), 'opt6': dict(env=['_ENV_6A'], default='mosdefault'), } @pytest.fixture def preread_options(): return PREREAD_OPTIONS.copy() @pytest.fixture def adapter(preread_options): return HashiVaultOptionAdapter.from_dict(preread_options) @pytest.fixture def option_group_base(adapter): return HashiVaultOptionGroupBase(adapter) @pytest.fixture(params=[ # first dict is used to patch the environment vars # second dict is used to patch the current options to get them to the expected state # # envpatch, expatch ({}, {'opt6': 'mosdefault'}), ({'_ENV_1A': 'alt1a'}, {'opt6': 'mosdefault'}), ({'_ENV_3X': 'noop3x'}, {'opt6': 'mosdefault'}), ({'_ENV_2B': 'alt2b'}, {'opt2': 'alt2b', 'opt6': 'mosdefault'}), ({'_ENV_2A': 'alt2a', '_ENV_2B': 'alt2b'}, {'opt2': 'alt2a', 'opt6': 'mosdefault'}), ({'_ENV_4B': 'alt4b', '_ENV_6A': 'defnot', '_ENV_4C': 'alt4c'}, {'opt4': 'alt4b', 'opt6': 'defnot'}), ({'_ENV_1A': 'alt1a', '_ENV_4A': 'alt4a', '_ENV_1B': 'noop1b', '_ENV_4C': 'alt4c'}, {'opt4': 'alt4a', 'opt6': 'mosdefault'}), ({'_ENV_5A': 'noop5a', '_ENV_4C': 'alt4c', '_ENV_2A': 'alt2a'}, {'opt2': 'alt2a', 'opt4': 'alt4c', 'opt6': 'mosdefault'}), ]) def with_env(request, preread_options): envpatch, expatch = request.param expected = preread_options.copy() expected.update(expatch) with mock.patch.dict(os.environ, envpatch): yield expected class TestHashiVaultOptionGroupBase(object): def test_process_late_binding_env_vars(self, option_group_base, with_env, preread_options): option_group_base.process_late_binding_env_vars(LOW_PREF_DEF) assert preread_options == with_env, "Expected: %r\nGot: %r" % (with_env, preread_options)
2,592
1,038
def crescente_e_decrescente(): while True: n1, n2 = entrada() if n1 > n2: print('Decrescente') elif n1 < n2: print('Crescente') else: break def entrada(): numeros = list(map(int, input().split(' '))) numero1 = numeros[0] numero2 = numeros[1] return numero1, numero2 crescente_e_decrescente()
384
134
from kivy.lang import Builder import array import scipy import os import syft as sy import tensorflow as tf import numpy import time import scipy import sys from dataset import get_dataset from cluster import get_cluster from PIL import Image import leargist from skimage import transform from imageio import imsave from kivy.app import App from kivy.uix.screenmanager import ScreenManager, Screen from kivy.core.window import Window from kivy.uix.label import Label # from kivy.uix.label import Label from kivy.uix.screenmanager import CardTransition THRESHOLD = 0 MAX_PATH_SIZE = 22 def read_file(filepath): with open(filepath, 'rb') as f: ln = os.path.getsize(filepath) width = 256 rem = ln % width a = array.array("B") a.fromfile(f, ln-rem) g = numpy.reshape(a, (int(len(a) / width), width)) g = numpy.uint8(g) print(g) imsave('/tmp/tmp.png', g) pilimg = Image.open('/tmp/tmp.png') img_resized = pilimg.resize((64, 64)) desc = leargist.color_gist(img_resized) data = desc[0:1024] data = numpy.resize(data, 1024) data = data.reshape(32, 32, 1) return data def run(filepath): hook = sy.KerasHook(tf.keras) client = sy.TFEWorker() cluster = get_cluster() client.connect_to_model((1, 32, 32, 1), ((1, 25)), cluster) _, test_X, _, test_Y = get_dataset() # time.sleep(5) data = read_file(filepath) result = client.query_model(numpy.array([data])) result = numpy.mean(result) print("result:", result) return result > THRESHOLD class MainScreen(Screen): pass class SubScreen(Screen): def __init__(self, title, img, **kwargs): self.img = img self.title = title super(SubScreen, self).__init__(**kwargs) class AntivirusApp(App): def build(self): self.main = MainScreen(name='main') self.sm = ScreenManager() self.sm.switch_to(self.main) # self.sm.add_widget() # self.sm.add_widget() Window.bind(on_dropfile=self._on_file_drop) return self.sm def _on_file_drop(self, window, file_path): result = run(file_path) file_path = file_path.decode() if len(file_path) > MAX_PATH_SIZE: file_path = file_path[:MAX_PATH_SIZE] + "..." if result: title = f"Danger! \"{file_path}\" is malware :(" img = "malware" else: title = f"Safe! \"{file_path}\" is not malware :)" img = "doc2" self.sub = SubScreen(title, f"assets/img/{img}.png", name='sub') self.sm.switch_to(self.sub) # Builder.load_file('assets/main.kv') AntivirusApp().run()
2,695
969
from network.network import Network import tensorflow as tf import numpy as np class VGG16(Network): def __init__(self, input_shape, class_number, x, y, train=False, learning_rate=0.001): super().__init__() self.loss = None self.accuracy = None self._build_network(input_shape, class_number, train, learning_rate, x, y) def _build_network(self, network_input_shape, class_number, train, starter_learning_rate, x, y): self.x = x if train: self.keep_prob = 0.5 self.y_ = y self.y = tf.one_hot(self.y_, class_number, 1.0, 0.0) self.conv1_1 = self.conv_layer('conv1_1', layer_input=self.x, shape=[3, 3, self.x.get_shape()[3].value, 64]) self.conv1_2 = self.conv_layer('conv1_2', layer_input=self.conv1_1, shape=[3, 3, 64, 64]) self.max_pool1 = self.max_pool(self.conv1_2) self.conv2_1 = self.conv_layer('conv2_1', layer_input=self.max_pool1, shape=[3, 3, 64, 128]) self.conv2_2 = self.conv_layer('conv2_2', layer_input=self.conv2_1, shape=[3, 3, 128, 128]) self.max_pool2 = self.max_pool(self.conv2_2) self.conv3_1 = self.conv_layer('conv3_1', layer_input=self.max_pool2, shape=[3, 3, 128, 256]) self.conv3_2 = self.conv_layer('conv3_2', layer_input=self.conv3_1, shape=[3, 3, 256, 256]) self.conv3_3 = self.conv_layer('conv3_3', layer_input=self.conv3_2, shape=[3, 3, 256, 256]) self.max_pool3 = self.max_pool(self.conv3_3) self.conv4_1 = self.conv_layer('conv4_1', layer_input=self.max_pool3, shape=[3, 3, 256, 512]) self.conv4_2 = self.conv_layer('conv4_2', layer_input=self.conv4_1, shape=[3, 3, 512, 512]) self.conv4_3 = self.conv_layer('conv4_3', layer_input=self.conv4_2, shape=[3, 3, 512, 512]) self.max_pool4 = self.max_pool(self.conv4_3) self.conv5_1 = self.conv_layer('conv5_1', layer_input=self.max_pool4, shape=[3, 3, 512, 512]) self.conv5_2 = self.conv_layer('conv5_2', layer_input=self.conv5_1, shape=[3, 3, 512, 512]) self.conv5_3 = self.conv_layer('conv5_3', layer_input=self.conv5_2, shape=[3, 3, 512, 512]) self.max_pool5 = self.max_pool(self.conv5_3) self.flat_max_pool5 = tf.reshape(self.max_pool5, shape=[-1, 7*7*512]) self.fc6 = self.fully_connected('fc6', self.flat_max_pool5, 4096) self.fc6 = tf.nn.relu(self.fc6) self.fc6 = tf.nn.dropout(self.fc6, keep_prob=self.keep_prob) self.fc7 = self.fully_connected('fc7', self.fc6, 4096) self.fc7 = tf.nn.relu(self.fc7) self.fc7 = tf.nn.dropout(self.fc7, keep_prob=self.keep_prob) self.fc8 = self.fully_connected('fc8', self.fc7, class_number) if train: self.global_step = tf.Variable(0, trainable=False) learning_rate = tf.train.exponential_decay(starter_learning_rate, self.global_step, decay_steps=100000, decay_rate=0.1, staircase=True) self.loss = tf.reduce_mean(tf.nn.softmax_cross_entropy_with_logits(labels=self.y, logits=self.fc8)) self.train_step = tf.train.GradientDescentOptimizer(learning_rate).minimize(self.loss) correct_prediction = tf.equal(tf.argmax(self.fc8,1), tf.argmax(self.y,1)) self.accuracy = tf.reduce_mean(tf.cast(correct_prediction, tf.float32)) def train(self, session): if self.loss is None: raise RuntimeError('Training a testing network!!') _, loss_value, accuracy_value = session.run([self.train_step, self.loss, self.accuracy]) print('Loss {:.2f} Accuracy {:.2f}'.format(loss_value, accuracy_value)) def test(self, session, batch, labels): if self.accuracy is None: raise RuntimeError('Cannot compute accuracy!!') accuracy = np.mean([session.run(self.accuracy, feed_dict={self.x: [batch[i]], self.y_: [labels[i]], self.keep_prob: 1.0}) for i in range(len(batch))]) print('Accuracy: {:.2f}'.format(accuracy)) def _restore_state(self, session): self.conv1_1 = self._restore_conv(session, 'conv1_1', layer_input=self.x) self.conv1_2 = self._restore_conv(session, 'conv1_2', layer_input=self.conv1_1) self.conv2_1 = self._restore_conv(session, 'conv2_1', layer_input=self.max_pool1) self.conv2_2 = self._restore_conv(session, 'conv2_2', layer_input=self.conv2_1) self.conv3_1 = self._restore_conv(session, 'conv3_1', layer_input=self.max_pool2) self.conv3_2 = self._restore_conv(session, 'conv3_2', layer_input=self.conv3_1) self.conv3_3 = self._restore_conv(session, 'conv3_3', layer_input=self.conv3_2) self.conv4_1 = self._restore_conv(session, 'conv4_1', layer_input=self.max_pool3) self.conv4_2 = self._restore_conv(session, 'conv4_2', layer_input=self.conv4_1) self.conv4_3 = self._restore_conv(session, 'conv4_3', layer_input=self.conv4_2) self.conv5_1 = self._restore_conv(session, 'conv5_1', layer_input=self.max_pool4) self.conv5_2 = self._restore_conv(session, 'conv5_2', layer_input=self.conv5_1) self.conv5_3 = self._restore_conv(session, 'conv5_3', layer_input=self.conv5_2) self.fc6 = self._restore_fully_connected(session, 'fc6', self.flat_max_pool5) self.fc6 = tf.nn.relu(self.fc6) self.fc6 = tf.nn.dropout(self.fc6, keep_prob=self.keep_prob) self.fc7 = self._restore_fully_connected(session,'fc7', self.fc6) self.fc7 = tf.nn.relu(self.fc7) self.fc7 = tf.nn.dropout(self.fc7, keep_prob=self.keep_prob) self.fc8 = self._restore_fully_connected(session,'fc8', self.fc7)
5,910
2,270
from google.protobuf import descriptor from google.protobuf import message from google.protobuf import reflection from google.protobuf import descriptor_pb2 DESCRIPTOR = descriptor.FileDescriptor(name='ResourceKey.proto', package='EA.Sims4.Network', serialized_pb='\n\x11ResourceKey.proto\x12\x10EA.Sims4.Network"<\n\x0bResourceKey\x12\x0c\n\x04type\x18\x01 \x02(\r\x12\r\n\x05group\x18\x02 \x02(\r\x12\x10\n\x08instance\x18\x03 \x02(\x04"G\n\x0fResourceKeyList\x124\n\rresource_keys\x18\x01 \x03(\x0b2\x1d.EA.Sims4.Network.ResourceKeyB\x0eB\x0cResourceKeys') _RESOURCEKEY = descriptor.Descriptor(name='ResourceKey', full_name='EA.Sims4.Network.ResourceKey', filename=None, file=DESCRIPTOR, containing_type=None, fields=[descriptor.FieldDescriptor(name='type', full_name='EA.Sims4.Network.ResourceKey.type', index=0, number=1, type=13, cpp_type=3, label=2, has_default_value=False, default_value=0, message_type=None, enum_type=None, containing_type=None, is_extension=False, extension_scope=None, options=None), descriptor.FieldDescriptor(name='group', full_name='EA.Sims4.Network.ResourceKey.group', index=1, number=2, type=13, cpp_type=3, label=2, has_default_value=False, default_value=0, message_type=None, enum_type=None, containing_type=None, is_extension=False, extension_scope=None, options=None), descriptor.FieldDescriptor(name='instance', full_name='EA.Sims4.Network.ResourceKey.instance', index=2, number=3, type=4, cpp_type=4, label=2, has_default_value=False, default_value=0, message_type=None, enum_type=None, containing_type=None, is_extension=False, extension_scope=None, options=None)], extensions=[], nested_types=[], enum_types=[], options=None, is_extendable=False, extension_ranges=[], serialized_start=39, serialized_end=99) _RESOURCEKEYLIST = descriptor.Descriptor(name='ResourceKeyList', full_name='EA.Sims4.Network.ResourceKeyList', filename=None, file=DESCRIPTOR, containing_type=None, fields=[descriptor.FieldDescriptor(name='resource_keys', full_name='EA.Sims4.Network.ResourceKeyList.resource_keys', index=0, number=1, type=11, cpp_type=10, label=3, has_default_value=False, default_value=[], message_type=None, enum_type=None, containing_type=None, is_extension=False, extension_scope=None, options=None)], extensions=[], nested_types=[], enum_types=[], options=None, is_extendable=False, extension_ranges=[], serialized_start=101, serialized_end=172) _RESOURCEKEYLIST.fields_by_name['resource_keys'].message_type = _RESOURCEKEY DESCRIPTOR.message_types_by_name['ResourceKey'] = _RESOURCEKEY DESCRIPTOR.message_types_by_name['ResourceKeyList'] = _RESOURCEKEYLIST class ResourceKey(message.Message, metaclass=reflection.GeneratedProtocolMessageType): DESCRIPTOR = _RESOURCEKEY class ResourceKeyList(message.Message, metaclass=reflection.GeneratedProtocolMessageType): DESCRIPTOR = _RESOURCEKEYLIST
2,840
1,014
import math import numpy as np import matplotlib.pyplot as plt from matplotlib.patches import Polygon # from matplotlib.ticker import MaxNLocator # Rafael Redondo (c) Eurecat 2020 colors = np.array([ [[247, 197, 188],[242, 151, 136],[242, 120, 99],[237, 85, 59]], [[255, 242, 196], [247, 232, 176], [250, 225, 135], [246, 213, 93]], [[180, 224, 220],[123, 209, 201],[83, 194, 183],[60, 174, 163]], [[159, 189, 214],[118, 160, 194],[72, 125, 168],[32, 99, 155]] ]) / 255.0 class_colors = np.array([ [[184, 184, 184],[125, 125, 125],[71, 71, 71], [000, 000, 000]], [[196, 255, 196],[178, 255, 178],[126, 255, 126],[000, 255, 000]], [[252, 189, 189],[255, 133, 133],[255, 77, 77], [255, 000, 000]], [[207, 255, 255],[176, 255, 245],[144, 255, 255],[000, 255, 255]], [[212, 212, 255],[149, 149, 255],[94, 94, 255],[000, 000, 255]], [[255, 209, 255],[255, 156, 255],[255, 101, 255],[255, 000, 255]] ]) / 255.0 def draw(row, axis, data, method, labels, colors, xlim, hsep, radius): augment = data.shape[0] labels = list(labels) num_elements = len(labels) # labels.insert(0,'') titles = ['Sunglasses Augmentation', 'Hands Augmentation', 'Sunglasses+Hands Aug.'] for c in range(len(axis[row])): axis[row,c].set_aspect(1) axis[row,c].set_xlim(-1, xlim) # axis[row,c].set_ylim(-0.4, num_elements*0.5-0.1) axis[row, c].set_ylim(-0.4, num_elements * hsep - 0.1) axis[row, c].set_yticklabels(labels) axis[row, c].set_yticks(np.arange(num_elements) * hsep) # axis[row, c].yaxis.set_major_locator(MaxNLocator(integer=True)) if c == 0: axis[row, c].set_ylabel(method, fontsize=fontsizeLarge) else: axis[row, c].get_yaxis().set_visible(False) if row == 0: axis[row, c].set_title(titles[c], fontsize=fontsizeMedium) if row == axis.shape[0] - 1: axis[row, c].set_xlabel('Gain', fontsize=fontsizeMedium) else: axis[row, c].get_xaxis().set_visible(False) axis[row, c].add_patch(Polygon([[-1, -1], [0, -1], [0, 10], [-1, 10]], closed=True, fill=True, facecolor=[0.92,0.9,0.9])) for m in range(num_elements): for s in reversed(range(augment)): sigma = s / float(augment-1) r = math.sqrt(1 + sigma) * radius t = m + c * num_elements circle = plt.Circle((data[s,t] - data[0,t], m * hsep), r, color=colors[m,augment-s-1], edgecolor=None) axis[row,c].add_artist(circle) # ---------------------------------------------------------------------------------------------- fcn = np.array([ [94.86221, 89.94708, 78.54365, 90.62491, 94.86221, 89.94708, 78.54365, 90.62491, 94.86221, 89.94708, 78.54365, 90.62491], [94.87768, 89.34935, 78.5738, 90.65072, 94.91543, 90.04007, 78.89132, 90.71592, 94.87198, 90.01351, 79.12107, 90.64796], [94.82212, 89.07311, 78.57936, 90.55048, 95.01015, 89.30039, 79.2808, 90.85555, 94.92132, 89.81723, 79.51949, 90.71459], [94.91106, 88.96342, 79.1459, 90.67938, 94.94046, 89.36422, 79.07776, 90.75119, 94.9023, 90.05563, 79.41762, 90.69509] ]) fcn_classes = np.array([ [94.75722, 86.38252, 71.85863, 61.34205, 72.44731, 84.47418, 94.75722, 86.38252, 71.85863, 61.34205, 72.44731, 84.47418, 94.75722, 86.38252, 71.85863, 61.34205, 72.44731, 84.47418], [94.74529, 86.52661, 71.92953, 60.08587, 73.81507, 84.34044, 94.78213, 86.77009, 71.78261, 61.24385, 74.51008, 84.25919, 94.74461, 86.72296, 71.41357, 63.01671, 74.86192, 83.96667], [94.70561, 86.4855, 71.23186, 60.26997, 74.76319, 84.02004, 94.91729, 86.89263, 72.04419, 62.55301, 75.33231, 83.94535, 94.789, 86.70316, 71.52878, 63.19029, 75.79578, 85.10994], [94.74795, 86.68139, 71.68878, 62.33461, 74.78171, 84.64096, 94.79637, 86.70211, 71.9773, 61.76077, 73.98104, 85.249, 94.72738, 86.72993, 71.767, 62.76649, 75.47534, 85.03957] ]) deeplab = np.array([ [94.6848, 89.71417, 77.94909, 90.37054, 94.6848, 89.71417, 77.94909, 90.37054, 94.6848, 89.71417, 77.94909, 90.37054], [94.78537, 89.59541, 78.56921, 90.51187, 94.86725, 89.7494, 78.62243, 90.63049, 94.81017, 89.91979, 78.41131, 90.55676], [94.82899, 90.35099, 79.05202, 90.57593, 94.86047, 90.18027, 78.72145, 90.63608, 94.90303, 90.12334, 79.14438, 90.70572], [94.89329, 90.06537, 79.38813, 90.67735, 94.9435, 90.07861, 78.87746, 90.75484, 94.89794, 90.37945, 79.37854, 90.70328] ]) deeplab_classes = np.array([ [94.51156, 86.31067, 71.33108, 60.57315, 71.34837, 83.61973, 94.51156, 86.31067, 71.33108, 60.57315, 71.34837, 83.61973, 94.51156, 86.31067, 71.33108, 60.57315, 71.34837, 83.61973], [94.63511, 86.41761, 71.65853, 61.14348, 74.20494, 83.35558, 94.77132, 86.44033, 71.84831, 62.07319, 72.95129, 83.65015, 94.66345, 86.50839, 71.66187, 59.54201, 74.23029, 83.86187], [94.66677, 86.3675, 71.90078, 61.5994, 75.30071, 84.47695, 94.73285, 86.59962, 71.78432, 62.6076, 72.75062, 83.8537, 94.75528, 86.66354, 71.85329, 61.44883, 74.97043, 85.17492], [94.75281, 86.6263, 71.72533, 63.26911, 75.43251, 84.52274, 94.81422, 86.6394, 72.28983, 61.98376, 73.2231, 84.31447, 94.72211, 86.83926, 71.83235, 63.31498, 75.25782, 84.30474] ]) fontsizeSmall = 12 fontsizeMedium = 16 fontsizeLarge = 18 font = {'family':'normal', 'weight':'normal', 'size': fontsizeSmall} plt.rc('font', **font) metrics_fig, metrics_axis = plt.subplots(2, 3, sharey=True, sharex=True) draw(0, metrics_axis, fcn, 'FCN', ('Pixel Acc.', 'Mean Acc.', 'Mean IU', 'Freq.W. IU'), colors, 1.8, 0.4, 0.1) draw(1, metrics_axis, deeplab, 'DeepLabV3', ('Pixel Acc.', 'Mean Acc.', 'Mean IU', 'Freq.W. IU'), colors, 1.8, 0.4, 0.1) # class_fig, class_axis = plt.subplots(2, 3, sharey=True) # draw(0, class_axis, fcn_classes, 'FCN', ('Bkgnd', 'Skin', 'Hair', 'Beard', 'Snglss', 'Wear'), class_colors, 4.5, 0.5, 0.15) # draw(1, class_axis, deeplab_classes,'DeepLabV3',('Bkgnd', 'Skin', 'Hair', 'Beard', 'Snglss', 'Wear'), class_colors, 4.5, 0.5, 0.15) plt.show()
5,787
4,217
import yaml import os import sys import yaml import numpy as np from tqdm import tqdm import matplotlib.pyplot as plt from utils import load_poses, load_calib, load_files, load_vertex from preprocessing.utils import * from example.laserscan import * from PC_cluster.ScanLineRun_cluster.build import ScanLineRun_Cluster # data_path = '../data/sequences/08/velodyne/000030.bin' # label_path = '../data/sequences/08/labels/000030.label' CFG = yaml.safe_load(open('../config/semantic-kitti-mos.yaml', 'r')) config_filename = '../config/mask_preparing.yaml' if len(sys.argv) > 1: config_filename = sys.argv[1] if yaml.__version__ >= '5.1': config = yaml.load(open(config_filename), Loader=yaml.FullLoader) else: config = yaml.load(open(config_filename)) # ground truth info color_dict = CFG["color_map"] label_transfer_dict = CFG["learning_map"] nclasses = len(color_dict) # mask config data_folder = config['data_folder'] debug = config['debug'] visualize = config['visualize'] range_image_params = config['range_image'] sequences = config['sequences'] sem_scan = LaserScan(project=True, flip_sign=False, H=range_image_params['height'], W=range_image_params['width'], fov_up=range_image_params['fov_up'], fov_down=range_image_params['fov_down']) cluster=ScanLineRun_Cluster.ScanLineRun_Cluster(0.5, 1) # create mask folder for sequence in sequences: sequence_folder = os.path.join(data_folder, sequence) visualization_folder = config['visualization_folder'] scan_folder = config['scan_folder'] label_folder = config['label_folder'] mask_image_folder = config['mask_image_folder'] visualization_folder = os.path.join(sequence_folder, visualization_folder) scan_folder = os.path.join(sequence_folder, scan_folder) label_folder = os.path.join(sequence_folder, label_folder) mask_image_folder = os.path.join(sequence_folder, mask_image_folder) # if not os.path.exists(mask_image_folder): # os.makedirs(mask_image_folder) # # # create mask image visualization folder # if visualize: # if not os.path.exists(visualization_folder): # os.makedirs(visualization_folder) # load labels scan_paths = load_files(scan_folder) # label_paths = load_files(label_folder) # create scan object # index_range = list(range(0,len(scan_paths))) print('Clustering:', sequence, 'Frames: ', str(len(scan_paths))) for frame_idx in tqdm(range(len(scan_paths))): cluster_file_name = os.path.join(mask_image_folder, str(frame_idx).zfill(6)) sem_scan.open_scan(scan_paths[frame_idx]) # x_img = sem_scan.proj_xyz[:,:,0]*sem_scan.proj_mask # y_img = sem_scan.proj_xyz[:,:,0]*sem_scan.proj_mask # z_img = sem_scan.proj_xyz[:,:,0]*sem_scan.proj_mask instance_label = cluster.ScanLineRun_cluster(sem_scan.proj_xyz[:,:,0], sem_scan.proj_xyz[:,:,1], sem_scan.proj_xyz[:,:,2], sem_scan.proj_mask, range_image_params['height'], range_image_params['width'] ) instance_label = np.array(instance_label) # ground removal # clustering # if visualize: # fig = plt.figure(frameon=False, figsize=(16, 10)) # fig.set_size_inches(20.48, 0.64) # ax = plt.Axes(fig, [0., 0., 1., 1.]) # ax.set_axis_off() # fig.add_axes(ax) # img = label_new.copy() # img[img<2]=0 # ax.imshow(img, vmin=0, vmax=1) # image_name = os.path.join(visualization_folder, str(frame_idx).zfill(6)) # plt.savefig(image_name) # plt.close() # # # save to npy file # label_new_one_hot = depth_onehot(matrix=label_new, category=[0, 1, 2], on_value=1, off_value=0, channel_first=True) # # np.save(mask_file_name, [label_new, label_new_one_hot, sem_scan.proj_idx])
4,299
1,435
class Solution: def nextGreatestLetter(self, letters, target): """ :type letters: List[str] :type target: str :rtype: str """ for l in letters: if l > target: return l return letters[0] if __name__ == '__main__': solution = Solution() print(solution.nextGreatestLetter(["c", "f", "j"], "a")) print(solution.nextGreatestLetter(["c", "f", "j"], "c")) print(solution.nextGreatestLetter(["c", "f", "j"], "k")) else: pass
529
182
from math import sqrt def factorial(n): """Computes factorial of n.""" if n == 0: return 1 else: recurse = factorial(n-1) result = n * recurse return result def estimate_pi(): factor = (sqrt(2) * 2) / 9801 k = 0 total = 0 while True: num = factorial(4*k) * (1103 + 26390*k) den = (factorial(k)**4) * (396**(4*k)) term = factor * num / den total += term if abs(term) < 1e-15: break k = k + 1 return 1 / total pi = estimate_pi() print pi
592
247
# WARNING: Please don't edit this file. It was generated by Python/WinRT v1.0.0-beta.4 import enum import winsdk _ns_module = winsdk._import_ns_module("Windows.Graphics.Printing.PrintTicket") try: import winsdk.windows.data.xml.dom except Exception: pass try: import winsdk.windows.foundation except Exception: pass try: import winsdk.windows.foundation.collections except Exception: pass class PrintTicketFeatureSelectionType(enum.IntEnum): PICK_ONE = 0 PICK_MANY = 1 class PrintTicketParameterDataType(enum.IntEnum): INTEGER = 0 NUMERIC_STRING = 1 STRING = 2 class PrintTicketValueType(enum.IntEnum): INTEGER = 0 STRING = 1 UNKNOWN = 2 PrintTicketCapabilities = _ns_module.PrintTicketCapabilities PrintTicketFeature = _ns_module.PrintTicketFeature PrintTicketOption = _ns_module.PrintTicketOption PrintTicketParameterDefinition = _ns_module.PrintTicketParameterDefinition PrintTicketParameterInitializer = _ns_module.PrintTicketParameterInitializer PrintTicketValue = _ns_module.PrintTicketValue WorkflowPrintTicket = _ns_module.WorkflowPrintTicket WorkflowPrintTicketValidationResult = _ns_module.WorkflowPrintTicketValidationResult
1,202
387
import threading import sys class ReturnValueThread(threading.Thread): def __init__(self, *args, **kwargs): super().__init__(*args, **kwargs) self.result = None def run(self): if self._target is None: return # could alternatively raise an exception, depends on the use case try: self.result = self._target(*self._args, **self._kwargs) except Exception as exc: print(f'{type(exc).__name__}: {exc}', file=sys.stderr) # properly handle the exception def join(self, *args, **kwargs): super().join(*args, **kwargs) return self.result
638
183
class Other: def __init__(self, name21): self.name21 = name21 def get_name21(self): return self.name21 @staticmethod def decode(data): f_name21 = data["name21"] if not isinstance(f_name21, unicode): raise Exception("not a string") return Other(f_name21) def encode(self): data = dict() if self.name21 is None: raise Exception("name21: is a required field") data["name21"] = self.name21 return data def __repr__(self): return "<Other name21:{!r}>".format(self.name21)
540
203
import asyncio class EchoClient(asyncio.Protocol): def __init__(self, message, loop): self.mesage = message self.loop = loop def connection_made(self, transport): transport.write(self.mesage.encode("utf-8")) self.transport = transport def data_received(self, data): print(data.decode("utf-8")) self.transport.close() def connection_lost(self, exc): self.loop.stop() loop = asyncio.get_event_loop() coro = loop.create_connection(lambda: EchoClient("こんにちわ", loop), "127.0.0.1", 8192) loop.run_until_complete(coro) loop.run_forever() loop.close()
623
217
# -*- coding: utf-8 -*- from __future__ import absolute_import, division, print_function, unicode_literals class ResultMeta(object): def __init__(self, meta): self._meta = meta @property def width(self): return int(self._meta['Image-Width']) @property def height(self): return int(self._meta['Image-Height']) @property def location(self): return self._meta['Location'] def __len__(self): return self.size
482
146
# -*- coding: UTF-8 -*- from spider import * def main_view(): print '-------------------------------------------------------' print 'l.列出项目\ts.查找项目\tc.更新项目\tq.退出' print '|---0.顺序 \t|---0.关键字' print '|---1.收藏↑\t|---1.收藏>=' print '|---2.收藏↓\t|---2.收藏<' print '|---3.评论↑\t|---3.评论>=' print '|---4.评论↓\t|---4.评论<' print '|---5.评分↑\t|---5.评分>=' print '|---6.评分↓\t|---6.评分<' print '-------------------------------------------------------' app = OSCPspider() while True: main_view() op = raw_input("请输入:") if not op: continue elif op[0] == 'l': flag = app.list_p(op) elif op[0] == 's': flag = app.search_p(op) elif op == 'c': flag = app.catch_p() elif op == 'q': exit() else: flag = 'no_op' if flag == 'no_op': print "没有该操作!"
855
403
import pandas as pd from matplotlib import pyplot as plt import numpy as np import math from matplotlib import pyplot as plt from sklearn.preprocessing import LabelEncoder feature_dict = {i:label for i,label in zip( range(4), ('sepal length in cm', 'sepal width in cm', 'petal length in cm', 'petal width in cm', ))} df = pd.io.parsers.read_csv( filepath_or_buffer='https://archive.ics.uci.edu/ml/machine-learning-databases/iris/iris.data', header=None, sep=',' ) print (feature_dict.items()) df.columns = [l for i,l in sorted(feature_dict.items())] + ['class label'] df.dropna(how="all", inplace=True) # to drop the empty line at file-end df.tail() X = df[['sepal length in cm','sepal width in cm', 'petal length in cm', 'petal width in cm']].values y = df['class label'].values enc = LabelEncoder() label_encoder = enc.fit(y) y = label_encoder.transform(y) + 1 label_dict = {1: 'Setosa', 2: 'Versicolor', 3:'Virginica'} fig, axes = plt.subplots(nrows=2, ncols=2, figsize=(12,6)) for ax,cnt in zip(axes.ravel(), range(4)): # set bin sizes min_b = math.floor(np.min(X[:,cnt])) max_b = math.ceil(np.max(X[:,cnt])) bins = np.linspace(min_b, max_b, 25) # plottling the histograms for lab,col in zip(range(1,4), ('blue', 'red', 'green')): ax.hist(X[y==lab, cnt], color=col, label='class %s' %label_dict[lab], bins=bins, alpha=0.5,) ylims = ax.get_ylim() # plot annotation leg = ax.legend(loc='upper right', fancybox=True, fontsize=8) leg.get_frame().set_alpha(0.5) ax.set_ylim([0, max(ylims)+2]) ax.set_xlabel(feature_dict[cnt]) ax.set_title('Iris histogram #%s' %str(cnt+1)) # hide axis ticks ax.tick_params(axis="both", which="both", bottom="off", top="off", labelbottom="on", left="off", right="off", labelleft="on") # remove axis spines ax.spines["top"].set_visible(False) ax.spines["right"].set_visible(False) ax.spines["bottom"].set_visible(False) ax.spines["left"].set_visible(False) axes[0][0].set_ylabel('count') axes[1][0].set_ylabel('count') fig.tight_layout() plt.show() np.set_printoptions(precision=4) mean_vectors = [] for cl in range(1,4): mean_vectors.append(np.mean(X[y==cl], axis=0)) print('Mean Vector class %s: %s\n' %(cl, mean_vectors[cl-1])) S_W = np.zeros((4,4)) for cl,mv in zip(range(1,4), mean_vectors): class_sc_mat = np.zeros((4,4)) # scatter matrix for every class for row in X[y == cl]: row, mv = row.reshape(4,1), mv.reshape(4,1) # make column vectors class_sc_mat += (row-mv).dot((row-mv).T) S_W += class_sc_mat # sum class scatter matrices print('within-class Scatter Matrix:\n', S_W) overall_mean = np.mean(X, axis=0) S_B = np.zeros((4,4)) for i,mean_vec in enumerate(mean_vectors): n = X[y==i+1,:].shape[0] mean_vec = mean_vec.reshape(4,1) # make column vector overall_mean = overall_mean.reshape(4,1) # make column vector S_B += n * (mean_vec - overall_mean).dot((mean_vec - overall_mean).T) print('between-class Scatter Matrix:\n', S_B) eig_vals, eig_vecs = np.linalg.eig(np.linalg.inv(S_W).dot(S_B)) for i in range(len(eig_vals)): eigvec_sc = eig_vecs[:,i].reshape(4,1) print('\nEigenvector {}: \n{}'.format(i+1, eigvec_sc.real)) print('Eigenvalue {:}: {:.2e}'.format(i+1, eig_vals[i].real)) for i in range(len(eig_vals)): eigv = eig_vecs[:,i].reshape(4,1) np.testing.assert_array_almost_equal(np.linalg.inv(S_W).dot(S_B).dot(eigv), eig_vals[i] * eigv, decimal=6, err_msg='', verbose=True) print('ok') # Make a list of (eigenvalue, eigenvector) tuples eig_pairs = [(np.abs(eig_vals[i]), eig_vecs[:,i]) for i in range(len(eig_vals))] # Sort the (eigenvalue, eigenvector) tuples from high to low eig_pairs = sorted(eig_pairs, key=lambda k: k[0], reverse=True) # Visually confirm that the list is correctly sorted by decreasing eigenvalues print('Eigenvalues in decreasing order:\n') for i in eig_pairs: print(i[0]) print('Variance explained:\n') eigv_sum = sum(eig_vals) for i,j in enumerate(eig_pairs): print('eigenvalue {0:}: {1:.2%}'.format(i+1, (j[0]/eigv_sum).real)) W = np.hstack((eig_pairs[0][1].reshape(4,1), eig_pairs[1][1].reshape(4,1))) print('Matrix W:\n', W.real) X_lda = X.dot(W) assert X_lda.shape == (150,2), "The matrix is not 150x2 dimensional." def plot_step_lda(): ax = plt.subplot(111) for label,marker,color in zip( range(1,4),('^', 's', 'o'),('blue', 'red', 'green')): plt.scatter(x=X_lda[:,0].real[y == label], y=X_lda[:,1].real[y == label], marker=marker, color=color, alpha=0.5, label=label_dict[label] ) plt.xlabel('LD1') plt.ylabel('LD2') leg = plt.legend(loc='upper right', fancybox=True) leg.get_frame().set_alpha(0.5) plt.title('LDA: Iris projection onto the first 2 linear discriminants') # hide axis ticks plt.tick_params(axis="both", which="both", bottom="off", top="off", labelbottom="on", left="off", right="off", labelleft="on") # remove axis spines ax.spines["top"].set_visible(False) ax.spines["right"].set_visible(False) ax.spines["bottom"].set_visible(False) ax.spines["left"].set_visible(False) plt.grid() plt.tight_layout plt.show() plot_step_lda()
5,653
2,175
# -*- coding: utf-8 -*- # Generated by Django 1.11.22 on 2019-07-09 23:15 from __future__ import unicode_literals from django.db import migrations, models import js_color_picker.fields class Migration(migrations.Migration): dependencies = [ ('js_services', '0012_auto_20190430_0804'), ] operations = [ migrations.AddField( model_name='service', name='nofollow', field=models.BooleanField(default=False, verbose_name='nofollow'), ), migrations.AddField( model_name='service', name='noindex', field=models.BooleanField(default=False, verbose_name='noindex'), ), migrations.AddField( model_name='service', name='show_on_sitemap', field=models.BooleanField(default=True, verbose_name='Show on sitemap'), ), migrations.AddField( model_name='service', name='show_on_xml_sitemap', field=models.BooleanField(default=True, verbose_name='Show on xml sitemap'), ), migrations.AlterField( model_name='relatedservicesplugin', name='background_color', field=js_color_picker.fields.RGBColorField(blank=True, colors={'#2B3B46': 'dark', '#323B50': 'grey', '#919FA6': 'cool grey', '#CBCBCB': 'medium-grey', '#FBDB4C': 'maize', '#f5f5f5': 'light-grey', '#ffffff': 'white'}, mode='choice', null=True, verbose_name='Background Color'), ), ]
1,509
484
""" gentex.texmeas package """ import numpy as np class Texmeas: """Class texmeas for generating texture measures from co-occurrence matrix Parameters ---------- comat: ndarray Non-normalized co-occurrence matrix - chi-squared conditional distribution comparisons require the actual number of counts so don't normalize this before sending in measure: string Texture measure (default = 'Statistical Complexity'). Choice of: * 'CM Entropy' * 'EM Entropy' * 'Statistical Complexity' * 'Energy Uniformity' * 'Maximum Probability' * 'Contrast' * 'Inverse Difference Moment' * 'Correlation' * 'Probability of Run Length' * 'Epsilon Machine Run Length' * 'Run Length Asymmetry' * 'Homogeneity' * 'Cluster Tendency' * 'Multifractal Spectrum Energy Range' * 'Multifractal Spectrum Entropy Range' coordmo: int Moment of coordinate differences in co-occurrence matrix needed for calculating 'Contrast' and 'Inverse Difference Moment' (default=0) probmom: int Moment of individual cooccurence probabilities needed for calculating 'Contrast' and 'Inverse Difference Moment' (default=0) rllen: int Length of run length used for generating probability of a run length (the higher this probability the larger the constant patches on the scale used for generating the co-occurence matrix) or the epsilon machine run length (default=0) clusmom: int Moment used for generating cooccurence cluster tendency (default=0) samelev: bool Whether to treat the rows and columns in the cooccurence matrix as identical 'states' (the methods are very general so this needn't be the case, e.g. different template shapes from different images with different quantization levels could be used to generate the cooccurence matrix which could be of arbitrary shape) default = True assumes the cooccurrence matrix is square and the rows and columns correspond to the same 'state' betas: array An array of 3 values, the lower limit, the upper limit and the number of steps to use as the 'inverse temperature' range for estimating the multifractal spectrum from an epsilon machine - getting the range right for an 'arbitrary' epsilon machine is tricky and is expected to be reset over a number of trials before getting a full spectrum estimate. For details on the rationale and algorithm see: K. Young and J. P. Crutchfield, 'Fluctuation Spectroscopy', Chaos, Solitons, and Fractals 4 (1993) 5-39. Attributes ---------- emclus: int Number of clusters ('states') found when estimating an epsilon machine from the co-occurrence matrix. emest: bool Whether or not an epsilon machine has been estimated yet emmat: float The estimated epsilon machine as a standard Markov process transition matrix. condo: 2d-array Co-occurrence matrix renormalized as a rowise matrix of conditional probabilites - built as part of epsilon machine estimation emclasses: list List of which of the values in emclus each row in condo (and hence the cooccurence matrix) belongs to clusp: float Chisquared p value to use for clustering epsilon machine rows val: float Value of most recently calculated texture measure mfsspec: array Array containing the multifractal spectral estimates obtained over the range of 'inverse temperatures' provided in betas currval: string One of the listed measures method which constitutes the current value in val """ def __init__(self, comat, measure="Statistical Complexity", coordmom=0, probmom=0, rllen=0, clusmom=0, clusp=0.001, samelev=True, betas=[-20, 20, 40]): self.comat = comat self.totcount = np.sum(comat) # to get back histo after norm self.measure = measure self.coordmom = coordmom self.probmom = probmom self.rllen = rllen self.clusmom = clusmom self.clusp = clusp # chisquared p value to use for conditional # distribution similarity self.emclus = 0 # record the actual number of clusters # found for the epsilon machine self.emest = False # whether or not epsilon machine has been # estimated self.mfsest = False # whether or not multifractal spectrum has # been estimated self.emmat = np.array([]) # epsilon machine pre-array self.condo = np.array([]) # raw em transition matrix (i..e # array of conditional distributions self.emclasses = np.array([]) # list of which class each row # of self.emmat belongs to self.samelev = samelev # Boolean for whether pre and post # epsilon machine states should be # treated as the same if self.comat.shape[0] != self.comat.shape[1]: self.samelev = False # - should automatically be set here # to false if # rows != #cols in # co-occurence matrix self.betas = betas # "inverse temperature" range and # step for estimating multifractal # spectrum from epsilon machine self.val = 0.0 self.currval = "" self.cme = np.nan # CM Entropy self.eme = np.nan # EM Entropy self.stc = np.nan # Statistical Complexity self.enu = np.nan # Energy Uniformity self.map = np.nan # Maximum Probability self.con = np.nan # Contrast self.idm = np.nan # Inverse Difference Moment self.cor = np.nan # Correlation self.prl = np.nan # Probability of Run Length self.erl = np.nan # Epsilon Machine Run Length self.rla = np.nan # Run Length Asymmetry self.hom = np.nan # Homogeneity self.clt = np.nan # Cluster Tendency self.mfu = np.nan # Multifractal max,min energy diff. self.mfs = np.nan # Multifractal max,min entropy diff. # initial empty array for the multifractal spectrum # with size equla to the number of steps specified in self.betas self.mfsspec = np.array([]) # Normalize cooccurence matrix in case it's not if np.sum(self.comat) != 1.0: self.comat = np.float_(self.comat) / np.sum(self.comat) # Actually normalize row vectors... -- NO !! -- # if np.sum(self.comat) != self.comat.shape[0]: # self.comat = np.transpose(np.transpose(np.float_(self.comat))/np.float_(np.sum(self.comat,axis=1))) # Calculate an initial texture measure self.calc_measure(self.measure) def calc_measure(self, measure='Statistical Complexity', coordmom=0, probmom=0, rllen=0, clusmom=0, samelev=True): """Calculates the appropriate texture measure and puts the value in the class variable val and updates the class variable currval with the passed string For a discussion of Haralick co-occurrence style texture measures see: R. M. Haralick, 'Statistical and structural approaches to texture'. Proceedings of the IEEE May 1979, 67(5). 786-804. Parameters ---------- measure: string One of the following measure methods (default = 'Statistical Complexity'): - 'CM Entropy' - 'EM Entropy' - 'Statistical Complexity' - 'Energy Uniformity' - 'Maximum Probability' - 'Contrast' - 'Inverse Difference Moment' - 'Correlation' - 'Probability of Run Length' - 'Epsilon Machine Run Length' - 'Run Length Asymmetry' - 'Homogeneity' - 'Cluster Tendency' - 'Multifractal Spectrum Energy Range' - 'Multifractal Spectrum Entropy Range' """ self.measure = measure # Allow for changed values of the following class variables # to be passed to calc measure if coordmom != 0: self.coordmom = coordmom if probmom != 0: self.probmom = probmom if rllen != 0: self.rllen = rllen if clusmom != 0: self.clusmom = clusmom if samelev == False: self.samelev = False if self.measure == "CM Entropy": if np.isnan(self.cme): self.cme = np.sum( -np.where(self.comat > 0.0, self.comat, 1.0) * np.where(self.comat > 0.0, np.log2(self.comat), 0.0)) self.val = self.cme self.currval = "CM Entropy" elif self.measure == "EM Entropy": if np.isnan(self.eme): import scipy.linalg as L if not self.emest: self.est_em() # get left eigenvector associated with lambda = 1 # (largest eignevalue) [e, v] = L.eig(np.nan_to_num(self.emmat), left=True, right=False) # Node probabilities are elements of normalized left eigenvector # associated with eigenvale 1 (assumes Scipy convention of # returning sorted eignevalues so eignevalue 1 in this case is # the first element of the returned eigenvalue array) # nodep = v[:,0]/sum(v[:,0]) # ---- no longer make the above assumption # found it was wrong - now specifically ask for eigenvector # associated with eigenvalue 1 (greatest real part) maxind = np.where(np.real(e) == np.max(np.real(e)))[0][0] nodep = v[:, maxind] / sum(v[:, maxind]) self.eme = -np.sum( np.transpose(nodep * np.ones(self.emmat.shape)) * (self.emmat * np.nan_to_num(np.log2(self.emmat)))) self.val = self.eme self.currval = "EM Entropy" elif self.measure == "Statistical Complexity": if np.isnan(self.stc): import scipy.linalg as L # estimate epsilon machine if it hasn't been made if not self.emest: self.est_em() # get left eigenvector associated with lambda = 1 # (largest eignevalue) [e, v] = L.eig(np.nan_to_num(self.emmat), left=True, right=False) # Node probabilities are elements of normalized left eigenvector # associated with eigenvale 1 (assumes Scipy convention of # returning sorted eignevalues so eignevalue 1 in this case is # the first element of the returned eigenvalue array) # nodep = v[:,0]/sum(v[:,0]) # ---- no longer make the above assumption # found it was wrong - now specifically ask for eigenvector # associated with eigenvalue 1 (greatest real part) maxind = np.where(np.real(e) == np.max(np.real(e)))[0][0] nodep = v[:, maxind] / sum(v[:, maxind]) self.stc = -np.sum(nodep * np.log2(nodep)) self.val = self.stc self.currval = "Statistical Complexity" elif self.measure == "Energy Uniformity": if np.isnan(self.enu): self.enu = np.sum(np.where(self.comat > 0.0, self.comat * self.comat, 0.0)) self.val = self.enu self.currval = "Energy Uniformity" elif self.measure == "Maximum Probability": if self.map is np.nan: self.map = np.max(self.comat) self.val = self.map self.currval = "Maximum Probability" elif self.measure == "Contrast": if np.isnan(self.con): if self.coordmom == 0 or self.probmom == 0: if self.coordmom == 0: print("Nonzero coordinate moment is required for calculating Contrast") if self.probmom == 0: print("Nonzero probability moment is required for calculating Contrast") else: crows = np.zeros(self.comat.shape) ccols = np.zeros(self.comat.shape) for i in range(self.comat.shape[0]): crows[i, :] = i ccols[:, i] = i self.con = np.sum((np.abs(crows - ccols) ** self.coordmom) * (self.comat ** self.probmom)) self.val = self.con self.currval = "Contrast" elif self.measure == "Inverse Difference Moment": if np.isnan(self.idm): if self.coordmom == 0 or self.probmom == 0: if self.coordmom == 0: print("Nonzero coordinate moment is required for calculating Inverse Difference Moment") if self.probmom == 0: print("Nonzero probability moment is required for calculating Inverse Difference Moment") else: crows = np.zeros(self.comat.shape) ccols = np.zeros(self.comat.shape) for i in range(self.comat.shape[0]): crows[i, :] = i ccols[:, i] = i codiffs = np.abs(crows - ccols) ** self.coordmom # Set minimum coordinate difference for which you allow # probability to be calculated codiff_eps = 0.0000001 # Do following so test divides don't blow up and # generte a warning codiffs_ok = np.where(codiffs > codiff_eps, codiffs, 1.0) self.idm = np.sum(np.where(codiffs > codiff_eps, (self.comat ** self.probmom) / codiffs_ok, 0.0)) self.val = self.idm self.currval = "Inverse Difference Moment" elif self.measure == "Correlation": if np.isnan(self.cor): import scipy.stats as ss crows = np.zeros(self.comat.shape) ccols = np.zeros(self.comat.shape) for i in range(self.comat.shape[0]): crows[i, :] = i + 1 # need to start at 1 for Correlation calcs. ccols[:, i] = i + 1 rowmom = np.sum(crows * self.comat) colmom = np.sum(ccols * self.comat) comatvar = np.var(np.ravel(self.comat * crows)) self.cor = np.sum((crows - rowmom) * (ccols - colmom) * self.comat) / comatvar self.val = self.cor self.currval = "Correlation" elif self.measure == "Probability of Run Length": if np.isnan(self.prl): if self.rllen == 0: print("Nonzero run length is required for calculating Probability of Run Length") else: colprobs = np.zeros(self.comat.shape[0]) for i in range(self.comat.shape[0]): colprobs[i] = np.sum(self.comat[i, :]) self.prl = 0.0 for i in range(self.comat.shape[0]): if colprobs[i] != 0.0: self.prl += ((colprobs[i] - self.comat[i, i]) ** 2 * ( self.comat[i, i] ** (self.rllen - 1))) / (colprobs[i] ** self.rllen) self.val = self.prl self.currval = "Probability of Run Length" elif self.measure == "Epsilon Machine Run Length": if np.isnan(self.erl): if self.rllen == 0: print("Nonzero run length is required for calculating Epsilon Machine Run Length") else: if not self.emest: self.est_em() self.erl = 0.0 colprobs = np.zeros(self.emmat.shape[0]) for i in range(self.emmat.shape[0]): colprobs[i] = np.sum(self.emmat[i, :]) for i in range(self.emmat.shape[0]): self.erl += ((colprobs[i] - self.emmat[i, i]) ** 2 * (self.emmat[i, i] ** (self.rllen - 1))) / ( colprobs[i] ** self.rllen) self.val = self.erl self.currval = "Epsilon Machine Run Length" elif self.measure == "Run Length Asymmetry": if np.isnan(self.rla): if self.rllen == 0: print("Nonzero run length is required for calculating Run Length Asymmetry") else: colprobs = np.zeros(self.comat.shape[0]) rowprobs = np.zeros(self.comat.shape[0]) for i in range(self.comat.shape[0]): colprobs[i] = np.sum(self.comat[i, :]) rowprobs[i] = np.sum(self.comat[:, i]) colval = 0.0 rowval = 0.0 for i in range(self.comat.shape[0]): if colprobs[i] != 0.0: colval += ((colprobs[i] - self.comat[i, i]) ** 2 * ( self.comat[i, i] ** (self.rllen - 1))) / (colprobs[i] ** self.rllen) if rowprobs[i] != 0.0: rowval += ((rowprobs[i] - self.comat[i, i]) ** 2 * ( self.comat[i, i] ** (self.rllen - 1))) / (rowprobs[i] ** self.rllen) self.rla = np.abs(colval - rowval) self.val = self.rla self.currval = "Run Length Asymmetry" elif self.measure == "Homogeneity": if np.isnan(self.hom): crows = np.zeros(self.comat.shape) ccols = np.zeros(self.comat.shape) for i in range(self.comat.shape[0]): crows[i, :] = i ccols[:, i] = i self.hom = np.sum((self.comat) / (1 + np.abs(crows - ccols))) self.val = self.hom self.currval = "Homogeneity" elif self.measure == "Cluster Tendency": if np.isnan(self.clt): if self.clusmom == 0: print("Nonzero cluster moment is required for calculating Cluster Tendency") else: crows = np.zeros(self.comat.shape) ccols = np.zeros(self.comat.shape) for i in range(self.comat.shape[0]): crows[i, :] = i + 1 # need to start at 1 for Correlation calcs. ccols[:, i] = i + 1 rowmom = np.sum(crows * self.comat) colmom = np.sum(ccols * self.comat) self.clt = np.sum(((crows + ccols - rowmom - colmom) ** self.clusmom) * self.comat) self.val = self.clt self.currval = "Cluster Tendency" elif self.measure == "Multifractal Spectrum Energy Range": if not self.emest: # estimate epsilon machine self.est_em() if not self.mfsest: # estimate multifractal spectrum self.est_multi_frac_spec() if self.mfsspec.size != 0: self.mfu = np.max(self.mfsspec[:, 0]) - np.min(self.mfsspec[:, 0]) else: self.mfu = 0.0 self.val = self.mfu self.currval = "Multifractal Spectrum Energy Range" elif self.measure == "Multifractal Spectrum Entropy Range": if not self.emest: # estimate epsilon machine self.est_em() if not self.mfsest: # estimate multifractal spectrum self.est_multi_frac_spec() if self.mfsspec.size != 0: self.mfs = np.max(self.mfsspec[:, 1]) - np.min(self.mfsspec[:, 1]) else: self.mfs = 0.0 self.val = self.mfs self.currval = "Multifractal Spectrum Entropy Range" else: "Sorry don't know about texture measure ", self.measure def est_multi_frac_spec(self): """TODO""" import scipy.linalg as L self.mfsspec = [] if not self.emest: self.est_em() # print "Epsilon machine",self.emmat if self.betas[2] == 1: print( "Only 1 step asked for re. calculating multifractal spectrum, using lower limit specified, i.e. betas[0]") step = 0 else: step = (np.float(self.betas[1]) - np.float(self.betas[0])) / (np.float(self.betas[2]) - 1) for i in range(self.betas[2]): if i == 0: # in case self.betas[2] = 1 => step = 0 cb = np.float(self.betas[0]) else: cb = np.float(self.betas[0] + i * step) if cb == 1.0: # in this case just do standard metric entrop calc. # ( e.g. see above EM Entropy calculation for comments) # as both u and s(u) are equal to the metric entropy # in this case [e, v] = L.eig(np.nan_to_num(self.emmat), left=True, right=False) maxind = np.where(np.real(e) == np.max(np.real(e)))[0][0] nodep = v[:, maxind] / sum(v[:, maxind]) su = -np.sum( np.transpose(nodep * np.ones(self.emmat.shape)) * (self.emmat * np.nan_to_num(np.log2(self.emmat)))) self.mfsspec.append([su, su]) # print i,cb,su,su elif cb == 0.0: # skip it for now - need to re-figure out beta -> 0 limit # need placeholder though splat = 0 else: # cb != 0,1 # get betafied epsilon machine a = np.where(self.emmat > 0.0, np.exp(cb * np.log(self.emmat)), 0.0) # get maximum eignvalue and take the log # ("inv. temp." times "free energy") [eb, vb] = L.eig(np.nan_to_num(a), left=False, right=True) maxind = np.where(np.real(eb) == np.max(np.real(eb)))[0][0] fe = np.log2(np.real(eb[maxind])) # stochastisize betafied epsilon machine b = np.dot((1 / eb[maxind]) * np.diag((1 / vb[:, maxind])), np.dot(a, (np.diag(vb[:, maxind])))) # get metric entropy of stochasticized machine # - same as "entropy" s(u) as func. of "energy" u # - i.e. multifractal spectrum is analogue of # - thermodynamic spectrum s(u) vs. u [e, v] = L.eig(np.nan_to_num(b), left=True, right=False) maxind = np.where(np.real(e) == np.max(np.real(e)))[0][0] nodep = v[:, maxind] / sum(v[:, maxind]) # make sure they're real - sometimes linalg spits # out complex values with 0 imaginary part su = abs(-np.sum(np.transpose(nodep * np.ones(b.shape)) * (b * np.nan_to_num(np.log2(b))))) # then get energy - i.e. "temperature" normalized # difference between "entropy" and "free energy" u = abs((su - fe) / cb) self.mfsspec.append([u, su]) # print i,cb,u,su self.mfsspec = np.array(np.real(self.mfsspec)) # waste the nan's - e.g. when the range wasn't quite right self.mfsspec = np.delete(self.mfsspec, np.where(np.isnan(self.mfsspec))[0], 0) self.mfsest = True def est_em(self): """Estimate an epsilon machine from a co-occurrence matrix with #rows = #cols, done implicitly whenever one of the related complexity/entropy measures (EM Entropy, Statistical Complexity, Epsilon Machine Run Length) are calculated. For info on epsilon machines and the related measures see: - K. Young, Y. Chen, J. Kornak, G. B. Matson, N. Schuff, 'Summarizing complexity in high dimensions', \ Phys Rev Lett. (2005) Mar 11;94(9):098701. - C. R. Shalizi and J. P. Crutchfield, 'Computational Mechanics: Pattern and Prediction, Structure and \ Simplicity', Journal of Statistical Physics 104 (2001) 819--881. - K. Young and J. P. Crutchfield, 'Fluctuation Spectroscopy', Chaos, Solitons, and Fractals 4 (1993) 5-39. - J. P. Crutchfield and K. Young, 'Computation at the Onset of Chaos', in Entropy, Complexity, and Physics \ of Information, W. Zurek, editor, SFI Studies in the Sciences of Complexity, VIII, Addison-Wesley, Reading,\ Massachusetts (1990) 223-269. - C. R. Shalizi and J. P. Crutchfield, 'Computational Mechanics: Pattern and Prediction, Structure and \ Simplicity', Journal of Statistical Physics 104 (2001) 819--881. """ import scipy.stats as ss # Make conditional distribution matrix, i.e. epsilon machine # (row probabilities) self.condo = np.transpose(np.transpose(self.comat) / np.sum(self.comat, axis=1)) # the following is n^2 - need to figure a better way found = [] self.emclasses = np.zeros(self.condo.shape[0], int) onclass = 0 for i in range(self.condo.shape[0]): if i not in found: found.append(i) # if it's dinky just tack it on to class 0 # code below will just combine it in if np.sum(self.condo[i, :]) < 0.00000001: self.emclasses[i] = 0 else: # it's a new one self.emclasses[i] = onclass for j in range(i + 1, self.condo.shape[0]): if j not in found: # check if rows ("distributions") are "close" # i.e. p value in chi squred test < self.clusp tester = ss.chisquare(self.totcount * self.condo[i, :], self.totcount * self.condo[j, :])[1] if tester < self.clusp: # they're different found.append(j) onclass += 1 self.emclasses[j] = onclass else: # they're not found.append(j) self.emclasses[j] = onclass self.emclus = onclass + 1 for i in range(self.emclus): rowinds = tuple(np.where(self.emclasses == i)[0]) if i == 0: a = np.add.reduce(self.comat[rowinds, :], axis=0) else: a = np.vstack((a, np.add.reduce(self.comat[rowinds, :], axis=0))) # If initial/final states are the same need to also combine columns if self.samelev: if len(a.shape) > 1: for i in range(self.emclus): colinds = tuple(np.where(self.emclasses == i)[0]) # seems like it has to be done rowise first... if i == 0: b = np.add.reduce(a[:, colinds], axis=1) else: b = np.vstack((b, np.add.reduce(a[:, colinds], axis=1))) # ... then transposed else: for i in range(a.shape[0]): if i == 0: b = a else: b = np.vstack([b, a]) self.emmat = np.transpose(b) else: # do it all over again for columns found = [] self.emclasses = np.zeros(self.condo.shape[1], int) onclass = 0 for i in range(self.condo.shape[1]): if i not in found: found.append(i) # if it's dinky just tack it on to class 0 # code below will just combine it in if np.sum(self.condo[:, i]) < 0.00000001: self.emclasses[i] = 0 else: # it's a new one self.emclasses[i] = onclass for j in range(self.condo.shape[1], i + 1): if j not in found: # check if rows ("distributions") are "close" # i.e. p value in chi squred test < self.clusp tester = \ ss.chisquare(self.totcount * self.condo[:, i], self.totcount * self.condo[:, j])[1] if tester < self.clusp: # they're different found.append(j) onclass += 1 self.emclasses[j] = onclass else: # they're not found.append(j) self.emclasses[j] = onclass self.emclus = onclass + 1 for i in range(self.emclus): colinds = tuple(np.where(self.emclasses == i)[1]) if i == 0: a = np.add.reduce(self.comat[:, colinds], axis=1) else: a = np.vstack((a, np.add.reduce(self.comat[:, colinds], axis=1))) self.emmat = np.transpose(a) # and finally turned into a Markov matrix... self.emmat = np.transpose(np.transpose(self.emmat) / np.sum(self.emmat, axis=1)) self.emest = True
29,968
8,946
#!/usr/bin/env python # encoding: utf-8 """ @author: zk @contact: kun.zhang@nuance.com @file: dataio.py @time: 8/27/2019 4:31 PM @desc: """ import os def load_txt_data(path, mode='utf-8-sig', origin=False): """ This func is used to reading txt file :param origin: :param path: path where file stored :param mode: :type path: str :return: string lines in file in a list :rtype: list """ if type(path) != str: raise TypeError res = [] file = open(path, 'rb') lines = file.read().decode(mode, 'ignore') for line in lines.split('\n'): line = line.strip() if origin: res.append(line) else: if line: res.append(line) file.close() return res def load_excel_data(path): """ This func is used to reading excel file :param path: path where file stored :type path: str :return: data saved in a pandas DataFrame :rtype: pandas.DataFrame """ if type(path) != str: raise TypeError import pandas as pd return pd.read_excel(path).loc[:] def load_variable(path): """ :param path: :return: """ import pickle return pickle.load(open(path, 'rb')) def save_txt_file(data, path, end='\n'): """ This func is used to saving data to txt file support data type: list: Fully support dict: Only save dict key str: will save single char to each line tuple: Fully support set: Fully support :param data: data :param path: path to save :type path: str :param end: :type end: str :return: None """ if type(data) not in [list, dict, str, tuple, set] or type(path) != str: raise TypeError remove_old_file(path) with open(path, 'a', encoding='utf-8') as f: for item in data: f.write(str(item) + end) def save_variable(variable, path): """ :param variable: :param path: :return: """ import pickle return pickle.dump(variable, open(path, 'wb')) def load_file_name(path): """ This func can get root, subdir, file_names :param path: :type path:str :return: """ for root, dirs, files in os.walk(path): return root, dirs, files def load_all_file_name(path, list_name, suffix='', not_include='.py'): """ Load all file name including sub folder :param path: :param list_name: :param suffix: :param not_include: :return: """ for file in os.listdir(path): file_path = os.path.join(path, file) if os.path.isdir(file_path) and not_include not in file_path: load_all_file_name(file_path, list_name, suffix, not_include) elif os.path.splitext(file_path)[1] == suffix: list_name.append(file_path) def check_dir(path): """ check dir exists :param path: :type path:str :return: :rtype: bool """ return os.path.exists(path) def mkdir(path): """ :param path: :type path: str :return: None """ path = path.strip() if not check_dir(path): os.makedirs(path) def remove_old_file(path): """ :param path: :type path: str :return: """ if check_dir(path): os.remove(path) def delete_file(path): os.remove(path) if __name__ == '__main__': pass
3,373
1,147
from constants import * import pygame as pg from time import sleep from metronome import * import math import numpy as np from copy import deepcopy from audio import * from instructions_panel import * from loop import * class MusicMaker: def __init__(self, screen): self.pitch = 0 self.screen = screen self.pitch_range = PITCH_RANGE self.b_left = 0 self.b_middle = 0 self.b_right = 0 self.saved = None self.events = set() self.metronome = Metronome(BUFFERS_PER_MEASURE) self.is_measure = False self.using_scales = list(range(1,6)) self.scale = self.using_scales[3] self.scale_height = SCREEN_DIM[1] / len(self.using_scales) self.background = None self.background_needs_update = True self.instructions = InstructionsPanel() self.audio_player = None self.audio_player = AudioPlayer(self) self.audio_player.run() def do_step(self): ## Avoid the race condition while self.audio_player == None: sleep(.1) ## Gather information from metronome, mouse, and keyboard is_beat = self.metronome.is_beat(self.audio_player.loop_buffer_index) self.is_measure = self.metronome.is_measure(self.audio_player.loop_buffer_index) (m_x, m_y) = pygame.mouse.get_pos() (last_b_left, last_b_middle, last_b_right) = (self.b_left, self.b_middle, self.b_right) (self.b_left, self.b_middle, self.b_right) = pygame.mouse.get_pressed() last_keys = keys[:] keys.clear() keys.extend(pygame.key.get_pressed()) ## Center scales around mouse if self.b_middle and not last_b_middle: self.background_needs_update = True m_x, m_y = self.center_scales_around(m_x, m_y) ## Run events scheduled for the beginning of the step for e in sorted(list(self.events), key=lambda e: e[0]): if e[2] == BEGIN_STEP: if e[1] == NEXT_BUFFER or ( is_beat and e[1] == NEXT_BEAT ) or ( self.is_measure and e[1] == NEXT_MEASURE ): self.audio_player.do_action(e[0]) self.events.remove(e) ########################### ## Keyboard and mouse input for event in pygame.event.get(): if event.type == pygame.QUIT: pygame.quit() ## These events aren't caught by the pygame.mouse methods elif event.type == pygame.MOUSEBUTTONDOWN: ## Scroll down if event.button == 5: self.audio_player.decrease_volume() ## Scroll up if event.button == 4: self.audio_player.increase_volume() ## Window resize elif event.type == pygame.VIDEORESIZE: w,h = event.size min_w, min_h = MIN_DIM w = max(min_w, w) h = max(min_h, h) update_screen_size((w,h)) self.background_needs_update = True self.scale_height = SCREEN_DIM[1] / len(self.using_scales) self.screen = pygame.display.set_mode(SCREEN_DIM, pygame.RESIZABLE) ## Get the exact pitch from the mouse x coordinate self.mouse_pitch = self.coord_to_pitch(m_x, coord=0, reverse=False) ## Close the application if is_key_mod(ESCAPE, None): self.audio_player.stop_stream() print("Ending stream...") ## Start and stop recording if not keys[SPACE] and self.audio_player.loop_recording: self.events.add(EVENT_STOP_LOOP_REC) if keys[SPACE] and not self.audio_player.loop_recording: self.events.add(EVENT_START_LOOP_REC) ## Start and stop playing of all loops if is_key_mod(K_P, None) and not last_keys[K_P]: if self.audio_player.loop_playing: self.events.add(EVENT_STOP_LOOP_PLAY) else: self.events.add(EVENT_START_LOOP_PLAY) ## If a loop is selected: if self.audio_player.active_loops[0] >= 0 and not self.audio_player.loop_recording: ## Move the active loops left/right by one beat (with wrapping) if is_key_mod(LEFT, None) and not last_keys[LEFT]: for i in self.audio_player.active_loops: self.audio_player.loops[i].horizontal_shift(-1*self.metronome.beat_len) if is_key_mod(RIGHT, None) and not last_keys[RIGHT]: for i in self.audio_player.active_loops: self.audio_player.loops[i].horizontal_shift(self.metronome.beat_len) ## Move the active loops left/right by one buffer (with wrapping) if is_key_mod(LEFT, SHIFT) and not last_keys[LEFT]: for i in self.audio_player.active_loops: self.audio_player.loops[i].horizontal_shift(-1) if is_key_mod(RIGHT, SHIFT) and not last_keys[RIGHT]: for i in self.audio_player.active_loops: self.audio_player.loops[i].horizontal_shift(1) ## Toggle mute on the active loops if is_key_mod(K_M, None) and not last_keys[K_M]: for i in self.audio_player.active_loops: self.audio_player.loops[i].toggle_mute() ## Increase and decrease volume of the active loops if keys[EQUALS] or keys[PLUS] or keys[KP_PLUS]: for i in self.audio_player.active_loops: self.audio_player.loops[i].adjust_volume(.02) if keys[MINUS] or keys[KP_MINUS]: for i in self.audio_player.active_loops: self.audio_player.loops[i].adjust_volume(-.02) ## Copy the active loops below them as a group, and mute the copies if is_key_mod(K_C, CTRL) and not last_keys[K_C]: loop_copies = [self.audio_player.loops[i].get_copy() for i in self.audio_player.active_loops] for i,loop in enumerate(loop_copies): loop.set_mute(True) self.audio_player.loops.insert(self.audio_player.active_loops[-1]+1+i, loop) self.audio_player.active_loops = [x+len(loop_copies) for x in self.audio_player.active_loops] ## Move the active loops up and down in the lineup other_index = -1 loops = self.audio_player.loops if is_key_mod(UP, ALT) and not last_keys[UP] and self.audio_player.active_loops[0] > 0: for index in self.audio_player.active_loops: other_index = (index-1)%len(self.audio_player.loops) loops[index], loops[other_index] = loops[other_index], loops[index] self.audio_player.active_loops = [x-1 for x in self.audio_player.active_loops] elif is_key_mod(DOWN, ALT) and not last_keys[DOWN] and self.audio_player.active_loops[-1] < len(loops)-1: for index in self.audio_player.active_loops[::-1]: other_index = (index+1)%len(self.audio_player.loops) loops[index], loops[other_index] = loops[other_index], loops[index] self.audio_player.active_loops = [x+1 for x in self.audio_player.active_loops] ## Add the selected loops if is_key_mod(K_A, None) and not last_keys[K_A]: while len(self.audio_player.active_loops) > 1: i = self.audio_player.active_loops[0] other = self.audio_player.active_loops.pop() self.audio_player.loops[i].combine(self.audio_player.loops[other]) del self.audio_player.loops[other] ## Pitch shift the selected loops UP/DOWN if is_key_mod(UP, CTRL) and is_key_mod(UP, SHIFT) and not last_keys[UP]: for index in self.audio_player.active_loops: #Shift up one eighth of a tone self.audio_player.loops[index].pitch_shift(.25) elif is_key_mod(UP, CTRL) and not last_keys[UP]: for index in self.audio_player.active_loops: #Shift up one semitone self.audio_player.loops[index].pitch_shift(1) elif is_key_mod(DOWN, CTRL) and is_key_mod(DOWN, SHIFT) and not last_keys[DOWN]: for index in self.audio_player.active_loops: #Shift up one eighth of a tone self.audio_player.loops[index].pitch_shift(-.25) elif is_key_mod(DOWN, CTRL) and not last_keys[DOWN]: for index in self.audio_player.active_loops: #Shift up one semitone self.audio_player.loops[index].pitch_shift(-1) ## Delete the current loop with backspace or delete if (is_key_mod(BACKSPACE, None) and not last_keys[BACKSPACE]) or (is_key_mod(DELETE, None) and not last_keys[DELETE]): for i in self.audio_player.active_loops[::-1]: del self.audio_player.loops[i] self.audio_player.active_loops = [self.audio_player.active_loops[0]] if self.audio_player.active_loops[0] >= len(self.audio_player.loops): self.audio_player.active_loops[0] -= 1 else: ## Metronome selected (index -1) ##Only allow changes to the metronome when there are no loops: if len(self.audio_player.loops) == 0: ## Add or subtract from the metronome length if is_key_mod(LEFT, None) and not last_keys[LEFT]: self.metronome.change_measure_length(-self.metronome.beats) if is_key_mod(RIGHT, None) and not last_keys[RIGHT]: self.metronome.change_measure_length(self.metronome.beats) ## Add or subtract from the metronome beat count if is_key_mod(LEFT, SHIFT) and not last_keys[LEFT]: self.metronome.change_beat_count(-1) if is_key_mod(RIGHT, SHIFT) and not last_keys[RIGHT]: self.metronome.change_beat_count(1) ## Toggle justify pitch if is_key_mod(K_J, None) and not last_keys[K_J]: self.audio_player.justify_pitch = not self.audio_player.justify_pitch self.background_needs_update = True for loop in self.audio_player.loops: loop.recalculate_buffers() if not self.audio_player.loop_recording: ## Move the active loop indicator up and down if is_key_mod(UP, None) and not last_keys[UP]: self.audio_player.active_loops = [ self.audio_player.active_loops[0] % (len(self.audio_player.loops)+1) - 1 ] if is_key_mod(DOWN, None) and not last_keys[DOWN]: self.audio_player.active_loops = [ (self.audio_player.active_loops[-1]+2) % (len(self.audio_player.loops)+1) - 1 ] ## Select a range of loops if is_key_mod(UP, SHIFT) and not is_key_mod(UP, CTRL) and not last_keys[UP] and self.audio_player.active_loops[0] > 0: self.audio_player.active_loops.insert(0, self.audio_player.active_loops[0]-1) if is_key_mod(DOWN, SHIFT) and not is_key_mod(DOWN, CTRL) and not last_keys[DOWN] and self.audio_player.active_loops[0] >= 0 and self.audio_player.active_loops[-1] < len(self.audio_player.loops) - 1: self.audio_player.active_loops.append(self.audio_player.active_loops[-1]+1) ## Multiply metronome and loops a given number of times for num in range(0,10): if is_key_mod(NUMS[num], None) and not last_keys[NUMS[num]]: self.audio_player.multiply_tracks(num) ## Articulating and continuing a note playing if self.b_left: if not self.audio_player.playing: self.audio_player.articulate() else: self.audio_player.settle_to_volume() ## Allowing a note to fade away when not left clicking if not self.b_left: self.audio_player.volume_decay() ## Identify the current scale by mouse position self.scale_index = (self.using_scales[0] + int(m_y / SCREEN_DIM[1] * len(self.using_scales))) %12 self.scale = SCALES[self.scale_index] ## Temporarily align to the chromatic scale on the current scale if (self.b_right): self.scale = CHROMATIC_SCALE ## Show and hide the instructions (really for QUESTION_MARK, but SLASH is more accepting) if (keys[SLASH] and not last_keys[SLASH]): self.instructions.minimized = not self.instructions.minimized ####################### ## Pitch decisionmaking ## Get scale degree of closest pitch self.closest_pitch = sorted(self.scale, key=lambda x: min(abs((self.mouse_pitch%12)-x), 12 - abs((self.mouse_pitch%12)-x))) [0] ## Put closest pitch in correct octave self.closest_pitch += math.floor(self.mouse_pitch / 12) * 12 ## Correct an error by rounding up if self.mouse_pitch > 11.5 if abs(self.mouse_pitch - self.closest_pitch) > 10: self.closest_pitch += 12 ## In case we switched scales for the chromatic scale, switch back now that we decided on a closest pitch self.scale = SCALES[self.scale_index] ## Decide whether to align to the closest pitch, or use the mouse pitch #if not last_b_middle: if self.b_left or self.audio_player.volume == 0: if is_key_mod(K_S, None): self.pitch = self.mouse_pitch else: self.pitch = self.closest_pitch ## Run events scheduled for the end of the step for e in sorted(list(self.events), key=lambda e: e[0]): if e[2] == END_STEP: if e[1] == NEXT_BUFFER or ( is_beat and e[1] == NEXT_BEAT ) or ( self.is_measure and e[1] == NEXT_MEASURE ): self.audio_player.do_action(e[0]) self.events.remove(e) self.paint_screen() def center_scales_around(self, m_x, m_y): range_width = self.pitch_range[1] - self.pitch_range[0] range_middle = self.pitch_range[1] - range_width // 2 diff = self.closest_pitch - range_middle self.pitch_range = (self.pitch_range[0]+diff, self.pitch_range[1]+diff) y_diff = self.scale_index - self.using_scales[len(self.using_scales)//2] self.using_scales = [(i+y_diff)%12 for i in self.using_scales] new_m_x = self.pitch_to_coord(self.mouse_pitch) new_m_y = m_y-y_diff*self.scale_height pygame.mouse.set_pos(new_m_x, new_m_y) return new_m_x, new_m_y def paint_screen(self): ## Draw the mostly unchanging buffered background if self.background == None or self.background_needs_update: self.background = self.redraw_background() self.screen.blit(self.background, (0,0)) ## Draw the active notes y=0 notes = [l.recorded_notes[self.audio_player.loop_buffer_index] for l in self.audio_player.loops if not l.muted] self.recorded_notes_to_draw = [rn for sublist in notes for rn in sublist] for i in self.using_scales: s = SCALES[i] self.draw_scale_activity(s, y, self.scale is s) y += self.scale_height ## Draw metronome self.metronome.paint_self(self.screen, self.audio_player.loop_buffer_index, -1 in self.audio_player.active_loops) ## Draw the loops y = 60 x = 10 w = self.metronome.measure_len * self.metronome.visual_buffer_width h = 30 v_margin = 10 for i in range(len(self.audio_player.loops)): loop = self.audio_player.loops[i] loop.paint_self(self.screen, (x,y,w,h), i in self.audio_player.active_loops, self.audio_player.loop_recording) y += h + v_margin ## Draw the instruction panel self.instructions.paint_self(self.screen) pygame.display.flip() ''' Draws the active elements of a scale (row of notes) on the screen. ''' def draw_scale_activity(self, scale, y, is_active): notes_to_draw = [rn for rn in self.recorded_notes_to_draw if rn.scale==scale] if self.scale == scale: notes_to_draw.append(RecordedNote(-1, self.pitch, self.audio_player.volume, None, self.scale, None, None)) for p in range(self.pitch_range[0], self.pitch_range[1]+1): p_i = p % 12 if p_i in scale: x = self.pitch_to_coord(p, coord=0, reverse=False, scale=scale[0]) color = ACTIVE_COLORS[p_i] if is_active and self.closest_pitch == p else INACTIVE_COLORS[p_i] ##Determine line width based on notes_to_draw: on_this_pitch = [rn for rn in notes_to_draw if rn.pitch == p] notes_to_draw = [rn for rn in notes_to_draw if not rn in on_this_pitch] if len(on_this_pitch) > 0: sum_volume = sum(map(lambda rn: rn.get_loudness(), on_this_pitch)) line_width = max(INACTIVE_NOTE_WIDTH, int(sum_volume*ACTIVE_NOTE_STRETCH)) pygame.draw.line(self.screen, color, (x,y), (x,y+self.scale_height), line_width) if get_font() and p_i == scale[0]: l1 = get_font().render(NOTE_NAMES[p_i], 1, color) self.screen.blit(l1, (x+10, y+self.scale_height-30)) if is_active: color = INACTIVE_COLORS[scale[0]] pygame.draw.line(self.screen, color, (0,y), (SCREEN_DIM[0],y), 4) pygame.draw.line(self.screen, color, (0,y+self.scale_height), (SCREEN_DIM[0],y+self.scale_height), 4) ## The remaining pitches in notes_to_draw are not on a bar for rn in notes_to_draw: line_width = max(INACTIVE_NOTE_WIDTH, int(rn.get_loudness() * ACTIVE_NOTE_STRETCH)) x = self.pitch_to_coord(rn.pitch) pygame.draw.line(self.screen, FREE_NOTE_COLOR, (x, y), (x,y+self.scale_height), line_width) ''' Draws the inactive scale elements into a buffer image ''' def redraw_background(self): self.background_needs_update = False screen = pygame.Surface(SCREEN_DIM) screen.fill(BACK_COLOR) y=0 for i in self.using_scales: self.draw_scale_background(screen, SCALES[i], y) y += self.scale_height return screen ''' Draws the inactive elements of one scale onto an image ''' def draw_scale_background(self, screen, scale, y): pygame.draw.rect(screen, DARK_COLORS[scale[0]], (0,y,SCREEN_DIM[0],self.scale_height)) pygame.draw.line(screen, SCALE_INACTIVE_SEPARATOR_COLOR, (0,y), (SCREEN_DIM[0],y), 1) pygame.draw.line(screen, SCALE_INACTIVE_SEPARATOR_COLOR, (0,y+self.scale_height), (SCREEN_DIM[0],y+self.scale_height), 1) for p in range(self.pitch_range[0], self.pitch_range[1]+1): p_i = p % 12 if p_i in scale: x = self.pitch_to_coord(p, coord=0, reverse=False, scale=scale[0]) pygame.draw.line(screen, INACTIVE_COLORS[p_i], (x,y), (x,y+self.scale_height), INACTIVE_NOTE_WIDTH) if get_font() and p_i == scale[0]: l1 = get_font().render(NOTE_NAMES[p_i], 1, INACTIVE_COLORS[p_i]) screen.blit(l1, (x+10, y+self.scale_height-30)) def coord_to_pitch(self, y, coord=0, reverse=False): if reverse: return (self.pitch_range[1] - self.pitch_range[0]) / SCREEN_DIM[coord] * (SCREEN_DIM[coord] - y) + self.pitch_range[0] else: return (self.pitch_range[1] - self.pitch_range[0]) / SCREEN_DIM[coord] * y + self.pitch_range[0] def pitch_to_coord(self, p, coord=0, reverse=False, scale=None): if scale != None and self.audio_player.justify_pitch: p = pitch_to_just_pitch(p, scale) if reverse: return SCREEN_DIM[coord] - (p - self.pitch_range[0]) / (self.pitch_range[1] - self.pitch_range[0]) * SCREEN_DIM[coord] else: return (p - self.pitch_range[0]) / (self.pitch_range[1] - self.pitch_range[0]) * SCREEN_DIM[coord]
20,511
6,771
import aiohttp import struct import json import re class eGame: heartbeat = b'\x00\x00\x00\x12\x00\x12\x00\x01\x00\x07\x00\x00\x00\x01\x00\x00\x00\x00' heartbeatInterval = 60 @staticmethod async def get_ws_info(url): rid = url.split('/')[-1] page_id = aid = rid headers = { 'User-Agent': 'Mozilla/5.0 (iPhone; CPU iPhone OS 11_0 like Mac OS X) AppleWebKit/604.1.38 (KHTML, like Gecko) Version/11.0 Mobile/15A372 Safari/604.1' } async with aiohttp.ClientSession() as session: async with session.get('https://m.egame.qq.com/live?anchorid' + rid, headers=headers) as resp: res = await resp.text() res_ = re.findall(r'"videoInfo":(.*),"h5Url"', res)[0] str_id = json.loads(res_)['pid'] params = { 'param': json.dumps({"0":{"module":"pgg.ws_token_go_svr.DefObj","method":"get_token","param":{"scene_flag":16,"subinfo":{"page":{"scene":1,"page_id":int(page_id),"str_id":str(str_id),"msg_type_list":[1,2]}},"version":1,"message_seq":-1,"dc_param":{"params":{"info":{"aid":aid}},"position":{"page_id":"QG_HEARTBEAT_PAGE_LIVE_ROOM"},"refer":{}},"other_uid":0}}}) } async with session.post('https://share.egame.qq.com/cgi-bin/pgg_async_fcgi', data=params, headers=headers) as resp: res = json.loads(await resp.text()) token = res['data']['0']['retBody']['data']['token'] # 开始拼接reg_datas reg_datas = [] tokenbuf = token.encode('ascii') bodybuf = struct.pack('!Bi', 7, len(tokenbuf)) + tokenbuf headerbuf = struct.pack('!ihhhihh', 18 + len(bodybuf), 18, 1, 1, 0, 0, 0) data = headerbuf + bodybuf reg_datas.append(data) reg_datas.append(eGame.heartbeat) return 'wss://barragepush.egame.qq.com/sub', reg_datas @staticmethod def decode_msg(data): """ type: 0、3、9用户发言;7、33礼物信息;29、35欢迎信息;24、31系统提醒;23关注信息 """ msgs = [] msg = {} s = MessageDecode(data) body = s.v()['body'] if body: bin_datas = body['bin_data'] for bin_data in bin_datas: # if bin_data['type'] in (0, 3, 9): if bin_data.get('type', '') in (0, 3, 9): msg['name'] = bin_data['nick'] msg['content'] = bin_data['content'] msg['msg_type'] = 'danmaku' else: msg = {'name': '', 'content': '', 'msg_type': 'other'} msgs.append(msg.copy()) return msgs else: msg = {'name': '', 'content': '', 'msg_type': 'None'} msgs.append(msg.copy()) return msgs class MessageDecode: """ 数据解包,还原JS中的操作步骤 """ def __init__(self, data): self.data = data self.ie = { 'event_id': 0, 'msg_type': 1, 'bin_data': 2, 'params': 3, 'start_tm': 4, 'data_list': 6, 'end_tm': 5, 'message_seq': 7, } self.ne = { 'uid': 0, 'msgid': 1, 'nick': 2, 'content': 3, 'tm': 4, 'type': 5, 'scenes_flag': 6, 'ext': 7, 'send_scenes': 8 } self.oe = { 'event_id': 0, 'event_name': 1, 'info': 2, 'params': 3, 'bin_data': 4 } def v(self): data = self.data startPosition = 18 endPosition, = struct.unpack_from('!i', data, 0) seq, = struct.unpack_from('!i', data, 10) operation, = struct.unpack_from('!h', data, 8) if endPosition != len(data): raise Exception('The received packet length is abnormal') return { 'seq': seq, 'operation': operation, 'body': self.w(operation, startPosition, endPosition, data) } def w(self, operation, startPosition, endPosition, data): if operation == 3: return self.x(startPosition, endPosition, data) else: return None def x(self, startPosition, endPosition, data): i, = struct.unpack_from('!i', data, startPosition) n = data[startPosition: endPosition] if len(n) >= (4 + i): o = n[4:(4 + i)] a = self.S(o) y = self.ye(a) return y else: return None def ye(self, e): return self.T({ 'resultObj': e, 'template': self.ie, 'afterChange': 1, }) def afterChange(self, e, t, i, n, o): if t == 'bin_data': v = [] ve = {} for m in n: a = self.S(e, m['ext']) b = o['msg_type'] if b == 1: ve = self.T({ 'resultObj': a, 'template': self.ne }) elif b == 2: ve = self.T({ 'resultObj': a, 'template': self.oe }) v.append(ve.copy()) return v else: return n def T(self, e): i = e['resultObj'] n = e['template'] o = e.get('beforeChange', '') r = e.get('afterChange', '') a = {} for s in n.keys(): for t in i[0]: if t['tag'] == n[s]: q = t p = q['value'] c = q['ext'] if r: a[s] = self.afterChange(i[1], s, c, p, a) else: a[s] = p break return a def S(self, e, t=0): if t == '': t = 0 i = [] n = len(e) while t < n: o = self.m(e, t) dict_ = { 'value': o['value'], 'lastPosition': o['position'], 'ext': o['ext'], 'tag': o['tag'] } i.append(dict_.copy()) t = o['position'] return i, e def m(self, e, t): value = position = ext = '' i = e a, = struct.unpack_from('!B', i, t) tag = (240 & a) >> 4 type = 15 & a s_position = t + 1 if type == 0: value, position = self.f0(i, s_position) elif type == 1: value, position = self.f1(i, s_position) elif type == 2: value, position = self.f2(i, s_position) elif type == 3: value, position = self.f3(i, s_position) elif type == 6: value, position, ext = self.f6(i, s_position) elif type == 7: value, position, ext = self.f7(i, s_position) elif type == 8: value, position = self.f8(i, s_position) elif type == 9: value, position = self.f9(i, s_position) elif type == 12: value, position = self.f12(i, s_position) elif type == 13: value, position = self.f13(i, s_position) i = '' return { 'i': i, 'tag': tag, 'type': type, 'value': value, 'position': position, 'ext': ext } def f0(self, e, t): o = 1 try: n, = struct.unpack_from('!B', e, t) except: n = '' return n, t + o def f1(self, e, t): o = 2 try: n, = struct.unpack_from('!H', e, t) except: n = '' return n, t + o def f2(self, e, t): o = 4 try: n, = struct.unpack_from('!I', e, t) except: n = '' return n, t + o def f3(self, e, t): e = struct.unpack('!8B', e[t:t + 8]) i = (e[0] << 24) + (e[1] << 16) + (e[2] << 8) + e[3] o = (e[4] << 24) + (e[5] << 16) + (e[6] << 8) + e[7] value = (i << 32) + o position = t + 8 return value, position def f4(self, e, t): o = 4 try: n, = struct.unpack_from('!f', e, t) except: n = '' return n, t + o def f5(self, e, t): o = 8 try: n, = struct.unpack_from('!d', e, t) except: n = '' return n, t + o def f6(self, e, t): n, = struct.unpack_from('!B', e, t) r = t + 1 s = r + n value = (e[r:s]).decode('utf8', errors='ignore') return value, s, r def f7(self, e, t): n, = struct.unpack_from('!I', e, t) r = t + 4 s = r + n value = (e[r:s]).decode('utf8', errors='ignore') return value, s, r def f8(self, e, t): i = {} b = self.m(e, t) o = b['value'] r = b['position'] while o > 0: a = self.m(e, r) s = self.m(e, a['position']) if a['tag'] == 0 and s['tag'] == 1: i[a['value']] = s['value'] r = s['position'] o -= 1 return i, r def f9(self, e, t): i = self.m(e, t) n = i['value'] o = i['position'] r = [] while n > 0: a = self.m(e, o) r.append(a.copy()) o = a['position'] n -= 1 return r, o def f10(self, e, t): i = [] while True: n = self.m(e, t) t = n['position'] if n['type'] == 11: return i, t i.append(n['value'].copy()) def f11(self, e, t): return '', t def f12(self, e, t): return 0, t def f13(self, e, t): i = self.m(e, t) return e[(t + i['position']):i['value']], t + i['position'] + i['value']
10,084
3,503
from django.views.generic import DetailView, TemplateView from star_ratings.models import Rating from .models import Beer, Snack class BeerRateView(TemplateView): model = Beer template_name = 'minimal_rating_system/article_ratings.html' def get_context_data(self, **kwargs): kwargs['article_class'] = "Beer" kwargs['articles'] = self.model.objects.all().order_by('date_created') return super(BeerRateView, self).get_context_data(**kwargs) class SnackRateView(TemplateView): model = Snack template_name = 'minimal_rating_system/article_ratings.html' def get_context_data(self, **kwargs): kwargs['article_class'] = "Snack" kwargs['articles'] = self.model.objects.all().order_by('date_created') return super(SnackRateView, self).get_context_data(**kwargs)
832
265
# Generated by Django 3.2.5 on 2021-07-20 15:33 from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('AwardsApp', '0004_alter_userprofile_bio'), ] operations = [ migrations.RemoveField( model_name='userprofile', name='bio', ), ]
335
117
# Imports from flask import Flask, render_template, session, redirect, request, flash, url_for, abort from flask_session import Session from werkzeug.exceptions import default_exceptions, HTTPException, InternalServerError from werkzeug.security import check_password_hash, generate_password_hash from cs50 import SQL import os import markdown from time import sleep from new import login_required # App Config app = Flask(__name__) db = SQL("sqlite:///school.db") app.debug = True app.secret_key = b'\xb3\xaaS\xdf\xc0\x1fBc\x9b\x84\x9a\xfaCd\xc3\xd9' app.static_folder = 'static' app.config["TEMPLATES_AUTO_RELOAD"] = True @app.after_request def after_request(response): response.headers["Cache-Control"] = "no-cache, no-store, must-revalidate" response.headers["Expires"] = 0 response.headers["Pragma"] = "no-cache" return response # Session Config app.config['SESSION_TYPE'] = 'filesystem' Session(app) app.config.from_object(__name__) # Routes @app.route('/') def index(): if session.get("id"): return redirect(url_for('home')) return render_template("index.html") @app.route('/account') @login_required def account(): user = db.execute("SELECT * FROM users WHERE id = :id", id=session['id'])[0] return render_template('account.html', user=user) @app.route('/changemail', methods=['GET', 'POST']) @login_required def mailc(): if request.method == 'POST': if not request.form.get('mail'): flash(u'Please fill every credentials.', 'sorry') return redirect(request.url) rows2 = db.execute("SELECT * FROM users WHERE mail = :schoolname", schoolname=request.form.get('mail').lower()) if len(rows2) != 0: flash(u'This mail is already registered.', 'sorry') return redirect(request.url) db.execute('UPDATE users SET mail = :mail WHERE id = :id', mail=request.form.get('mail'), id=session['id']) return redirect(url_for('home')) else: return render_template('mail.html') @app.route('/changepass', methods=['GET', 'POST']) @login_required def passc(): if request.method == 'POST': if not request.form.get('password'): flash(u'Please fill every credentials.', 'sorry') return redirect(request.url) if request.form.get("password") != request.form.get("confirmation"): flash(u'Passwords do not match.', 'sorry') return redirect(request.url) db.execute('UPDATE users SET hash = :passw WHERE id = :id', passw=generate_password_hash(request.form.get('password')), id=session['id']) return redirect(url_for('home')) else: return render_template('pass.html') @app.route('/changename', methods=['GET', 'POST']) @login_required def namec(): if request.method == 'POST': if not request.form.get('username'): flash(u'Please fill every credentials.', 'sorry') return redirect(request.url) rows = db.execute("SELECT * FROM users WHERE schoolname = :schoolname", schoolname=request.form.get('username').lower()) if len(rows) != 0: flash(u'This school name is already registered.', 'sorry') return redirect(request.url) db.execute('UPDATE users SET schoolname = :name WHERE id = :id', name=request.form.get('username'), id=session['id']) return redirect(url_for('home')) else: return render_template('name.html') @app.route('/home') @login_required def home(): sites = db.execute("SELECT * FROM sites WHERE user_id = :id", id=session['id']) user = db.execute("SELECT * FROM users WHERE id = :id", id=session['id'])[0] return render_template('home.html', sites=sites, user=user) @app.route('/page/<urlheader>') def pages(urlheader): if len(db.execute("SELECT * FROM sites WHERE header = :header", header=urlheader)) == 0: abort(404) else: sites = db.execute("SELECT * FROM sites WHERE header = :header", header=urlheader) file = open('templates/temp.html', 'w') file.write(sites[0]['content']) sleep(0.1) file.close() return render_template('pages.html') @app.route('/pages', methods=['GET', 'POST']) @login_required def page(): sites = db.execute("SELECT * FROM sites WHERE user_id = :id", id=session['id']) return render_template('page.html', sites=sites) @app.route('/login', methods=['GET', 'POST']) def login(): if session.get("id"): return redirect(url_for('home')) if request.method == 'POST': if not request.form.get("username") or not request.form.get("password"): flash(u'Please fill every credentials.', 'sorry') return redirect(request.url) rows = db.execute("SELECT * FROM users WHERE schoolname = :schoolname", schoolname=request.form.get('username').lower()) if len(rows) != 1 or not check_password_hash(rows[0]["hash"], request.form.get('password')): flash(u'Invalid username and/or password.', 'sorry') return redirect(request.url) session['id'] = rows[0]['id'] flash(u'Logged In!', 'okay') return redirect(url_for('home')) else: return render_template('login.html') @app.route('/register', methods=['GET', 'POST']) def register(): if session.get("id"): return redirect(url_for('home')) if request.method == 'POST': # Ensure username was submitted if not request.form.get("username") or not request.form.get("password") or not request.form.get("mail"): flash(u'Please fill every credentials.', 'sorry') return redirect(request.url) if request.form.get("password") != request.form.get("confirmation"): flash(u'Passwords do not match.', 'sorry') return redirect(request.url) rows = db.execute("SELECT * FROM users WHERE schoolname = :schoolname", schoolname=request.form.get('username').lower()) rows2 = db.execute("SELECT * FROM users WHERE mail = :schoolname", schoolname=request.form.get('mail').lower()) if len(rows) != 0: flash(u'This school name is already taken.', 'sorry') return redirect(request.url) if len(rows2) != 0: flash(u'This mail is already registered.', 'sorry') return redirect(request.url) # Ensure password was submitted db.execute("INSERT INTO users (schoolname, mail, hash) VALUES (:name, :mail, :hash)", name=request.form.get("username").lower(), mail=request.form.get("mail").lower() , hash=generate_password_hash(request.form.get("password"))) rows = db.execute("SELECT * FROM users WHERE schoolname = :schoolname", schoolname=request.form.get('username').lower()) session["user_id"] = rows[0]["id"] # Redirect user to home page os.mkdir('dirs\\' + str(session["user_id"])) flash(u"Registered!", 'okay') return redirect(url_for('login')) else: return render_template("register.html") @app.route('/logout') @login_required def logout(): session.clear() return redirect(url_for('login')) @app.route('/learnmore') def learnmore(): return render_template('learn.html') @app.route('/new', methods=['GET', 'POST']) @login_required def new(): if request.method == 'POST': if not request.form.get('header') or not request.form.get('desc') or not request.form.get('content'): flash('Please fill everything.', 'sorry') return redirect(url_for('new')) if len(db.execute("SELECT * FROM sites WHERE header = :header", header=request.form.get('header').lower())) != 0: flash('Header already exists.', 'sorry') return redirect(url_for('new')) db.execute("INSERT INTO sites (header, desc, content, user_id) VALUES (:header, :desc, :content, :id)", header=request.form.get('header'), desc=request.form.get('desc'), content=markdown.markdown(request.form.get('content')), id=session['id']) flash(u'Created!', 'okay') return redirect(url_for('home')) else: return render_template('new.html') @app.errorhandler(404) def page_not_found(e): # note that we set the 404 status explicitly return render_template('404.html') if __name__ == "__main__": app.run(debug=True)
8,530
2,677
from pycipher import Rot13 import unittest class TestRot13(unittest.TestCase): def test_decipher(self): text = 'abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ' declist = ['nopqrstuvwxyzabcdefghijklmnopqrstuvwxyzabcdefghijklm'] dec = Rot13().decipher(text) self.assertEqual(dec.upper(), declist[0].upper()) def test_encipher(self): text = 'abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ' enclist = ['nopqrstuvwxyzabcdefghijklmnopqrstuvwxyzabcdefghijklm'] enc = Rot13().encipher(text) self.assertEqual(enc.upper(), enclist[0].upper())
621
257
from typing import Any from hypothesis import given from lz.functional import identity from tests import strategies @given(strategies.scalars) def test_basic(object_: Any) -> None: result = identity(object_) assert result is object_
246
72
from datetime import datetime, timedelta from discord import Embed from discord.ext.commands import Cog from discord.ext.commands import command import logging class Reactionpolls(Cog): NUMBERS = [ "1️⃣", "2️⃣", "3️⃣", "4️⃣", "5️⃣", "6️⃣", "7️⃣", "8️⃣", "9️⃣", "🔟" ] def __init__(self, bot): self.bot = bot self.log = logging.getLogger("gerfroniabot.reactionpolls") self.polls = [] @Cog.listener() async def on_ready(self): if not self.bot.ready: self.bot.cogs_ready.ready_up("reactionpolls") self.log.info("Reactionpolls cog ready") @command(name="umfrage", aliases=["umf"], brief="Erstelle eine offene Umfrage") async def make_poll(self, ctx, minutes: int, question: str, *options): """ Erstelle eine offene Umfrage, auf die alle anderen Mitglieder mit Emojis reagieren können, um abzustimmen. Der erste Parameter ist die Dauer in Minuten, nach der der Bot das Ergebnis bekanntgeben wird. Der zweite Parameter, der gegebenenfalls in "Anführungszeichen" gesetzt werden muss, wenn er Leerzeichen enthält, ist die Frage, die du den Mitgliedern stellen möchtest. Alle weiteren Parameter (durch Leerzeichen getrennt) werden als Antwortmöglichkeiten hinzugefügt. Du kannst höchstens zehn Optionen angeben. """ if minutes < 1 or minutes > 120: await ctx.send(":ballot_box_with_check: Die Umfragedauer muss zwischen 1 und 120 Minuten liegen.") return if len(options) > 10: await ctx.send(":ballot_box_with_check: Du kannst nicht mehr als 10 Antwortmöglichkeiten festlegen.") return embed = Embed( title=f":ballot_box_with_check: {question}", description=f"Umfrage von {ctx.author.display_name}", timestamp=datetime.utcnow(), colour=ctx.author.colour ) run_until = datetime.now() + timedelta(minutes=minutes) fields= [("Antwortmöglichkeiten", "\n".join([f"{self.NUMBERS[idx]} {option}" for idx, option in enumerate(options)]), False), ("Hilfe", f"Reagiere mit der entsprechenden Zahl auf diese Nachricht, um abzustimmen. " f"Die Umfrage läuft bis {run_until.strftime('%H:%M')} Uhr.", False)] for name, value, inline in fields: embed.add_field(name=name, value=value, inline=inline) message = await ctx.send(embed=embed) for emoji in self.NUMBERS[:len(options)]: await message.add_reaction(emoji) self.polls.append(message.id) self.bot.scheduler.add_job(self.complete_poll, "date", run_date=run_until, args=[message.channel.id, message.id]) async def complete_poll(self, channel_id, message_id): message = await self.bot.get_channel(channel_id).fetch_message(message_id) most_voted = max(message.reactions, key=lambda r: r.count) await message.channel.send(f":ballot_box_with_check: Die Abstimmung ist beendet. Option {most_voted.emoji} hat mit {most_voted.count-1} Stimmen gewonnen.") @Cog.listener() async def on_raw_reaction_add(self, payload): if payload.message_id in self.polls: message = await self.bot.get_channel(payload.channel_id).fetch_message(payload.message_id) for reaction in message.reactions: if (not payload.member.bot and payload.member in await reaction.users().flatten() and reaction.emoji != payload.emoji.name): await message.remove_reaction(reaction.emoji, payload.member) def setup(bot): bot.add_cog(Reactionpolls(bot))
3,703
1,193
""" Copyright (C) 2020 ETH Zurich. All rights reserved. Author: Sergei Vostrikov, ETH Zurich Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ # Basic libraries import argparse import numpy as np import sys from os.path import dirname, abspath from pybf.pybf.io_interfaces import ImageLoader from pybf.pybf.visualization import plot_image def visualize_image_dataset(path_to_img_dataset, save_path=None, save_visualized_images=False, show_images=True, frames_to_plot=None, low_res_img_to_plot=None, db_range=None): # Load beamformed images imgLoader = ImageLoader(path_to_img_dataset) # Check path to save images if save_path is None: # Construct save path (save to dataset folder) len_to_cut = len(path_to_img_dataset.split('/')[-1]) save_path = path_to_img_dataset[:-1 - len_to_cut] # Check simulation flag if imgLoader._simulation_flag: scs_coords_xz = imgLoader.get_scatters_coords()[[0,1],:] else: scs_coords_xz = None # Get the coordinates of transducer elements elements_coord = imgLoader.get_elements_coords() # Calculate image sizes pixels_coords = imgLoader.get_pixels_coords() image_size_x_0 = pixels_coords[0, :].min() image_size_x_1 = pixels_coords[0, :].max() image_size_z_0 = pixels_coords[1, :].min() image_size_z_1 = pixels_coords[1, :].max() # Check the frames_to_plot list if frames_to_plot is not None: if len(frames_to_plot)is 0: frames_to_plot = imgLoader.frame_indices else: frames_to_plot = [] # Check the low_res_img_to_plot list if low_res_img_to_plot is not None: if len(low_res_img_to_plot) is 0: low_res_img_to_plot = imgLoader.lri_indices else: low_res_img_to_plot = [] # Iterate over frames amd low resolution images for n_frame in frames_to_plot: # Plot Low Resolution Images for n_lri in low_res_img_to_plot: # Get data img_data = imgLoader.get_low_res_image(n_frame, n_lri) # Extract envelope img_data = np.abs(img_data) plot_image(img_data, elements_coords_xz=elements_coord, title='Frame ' + str(n_frame) +' LRI ' + str(n_lri), image_x_range=[image_size_x_0, image_size_x_1], image_z_range=[image_size_z_0, image_size_z_1], db_range=db_range, scatters_coords_xz=scs_coords_xz, framework='plotly', save_fig=save_visualized_images, show=show_images, path_to_save=save_path) # Plot High Resolution Image # Get data img_data = imgLoader.get_high_res_image(n_frame) # Extract envelope img_data = np.abs(img_data) plot_image(img_data, elements_coords_xz=elements_coord, title='Frame ' + str(n_frame) +' HRI', image_x_range=[image_size_x_0, image_size_x_1], image_z_range=[image_size_z_0, image_size_z_1], db_range=db_range, scatters_coords_xz=scs_coords_xz, framework='plotly', save_fig=save_visualized_images, show=show_images, path_to_save=save_path) # Close the file with beamformed images imgLoader.close_file() return if __name__ == '__main__': parser = argparse.ArgumentParser() parser.add_argument( '--path_to_img_dataset', type=str, default='', help='Path to the image dataset file.') def str2bool(v): if isinstance(v, bool): return v if v.lower() in ('yes', 'true', 'True', 't', 'y', '1'): return True elif v.lower() in ('no', 'false', 'False', 'f', 'n', '0'): return False else: raise argparse.ArgumentTypeError('Boolean value expected.') # Parameters for visualization parser.add_argument( '--save_visualized_images', type=str2bool, nargs='?', const=True, default=False, help='Flag to save visualized images.') parser.add_argument( '--frames_to_plot', type=int, nargs="+", default=None, help='Space separated list of frames to plot.\ "[]" - plot all frames. "None" - plot none.') parser.add_argument( '--low_res_img_to_plot', type=int, nargs="+", default=None, help='Space separated list of low resolution images to plot.\ "[]" - plot all frames. "None" - plot none.') parser.add_argument( '--db_range', type=float, default=None, help='Decibels range for log compression of images ') FLAGS, unparsed = parser.parse_known_args() # Run main function visualize_image_dataset(FLAGS.path_to_img_dataset, FLAGS.save_visualized_images, FLAGS.frames_to_plot, FLAGS.low_res_img_to_plot, FLAGS.db_range)
5,975
1,867
# Copyright 2019 Huawei Technologies Co., Ltd # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== import mindspore.dataset as ds IMAGENET_RAWDATA_DIR = "../data/dataset/testImageNetData2/train" IMAGENET_TFFILE_DIR = ["../data/dataset/test_tf_file_3_images2/train-0000-of-0001.data", "../data/dataset/test_tf_file_3_images2/train-0000-of-0002.data", "../data/dataset/test_tf_file_3_images2/train-0000-of-0003.data", "../data/dataset/test_tf_file_3_images2/train-0000-of-0004.data"] MNIST_DATA_DIR = "../data/dataset/testMnistData" MANIFEST_DATA_FILE = "../data/dataset/testManifestData/test.manifest" CIFAR10_DATA_DIR = "../data/dataset/testCifar10Data" CIFAR100_DATA_DIR = "../data/dataset/testCifar100Data" def test_imagenet_rawdata_dataset_size(): ds_total = ds.ImageFolderDatasetV2(IMAGENET_RAWDATA_DIR) assert ds_total.get_dataset_size() == 6 ds_shard_1_0 = ds.ImageFolderDatasetV2(IMAGENET_RAWDATA_DIR, num_shards=1, shard_id=0) assert ds_shard_1_0.get_dataset_size() == 6 ds_shard_2_0 = ds.ImageFolderDatasetV2(IMAGENET_RAWDATA_DIR, num_shards=2, shard_id=0) assert ds_shard_2_0.get_dataset_size() == 3 ds_shard_3_0 = ds.ImageFolderDatasetV2(IMAGENET_RAWDATA_DIR, num_shards=3, shard_id=0) assert ds_shard_3_0.get_dataset_size() == 2 def test_imagenet_tf_file_dataset_size(): ds_total = ds.TFRecordDataset(IMAGENET_TFFILE_DIR) assert ds_total.get_dataset_size() == 12 ds_shard_1_0 = ds.TFRecordDataset(IMAGENET_TFFILE_DIR, num_shards=1, shard_id=0) assert ds_shard_1_0.get_dataset_size() == 12 ds_shard_2_0 = ds.TFRecordDataset(IMAGENET_TFFILE_DIR, num_shards=2, shard_id=0) assert ds_shard_2_0.get_dataset_size() == 6 ds_shard_3_0 = ds.TFRecordDataset(IMAGENET_TFFILE_DIR, num_shards=3, shard_id=0) assert ds_shard_3_0.get_dataset_size() == 4 def test_mnist_dataset_size(): ds_total = ds.MnistDataset(MNIST_DATA_DIR) assert ds_total.get_dataset_size() == 10000 ds_shard_1_0 = ds.MnistDataset(MNIST_DATA_DIR, num_shards=1, shard_id=0) assert ds_shard_1_0.get_dataset_size() == 10000 ds_shard_2_0 = ds.MnistDataset(MNIST_DATA_DIR, num_shards=2, shard_id=0) assert ds_shard_2_0.get_dataset_size() == 5000 ds_shard_3_0 = ds.MnistDataset(MNIST_DATA_DIR, num_shards=3, shard_id=0) assert ds_shard_3_0.get_dataset_size() == 3334 def test_manifest_dataset_size(): ds_total = ds.ManifestDataset(MANIFEST_DATA_FILE) assert ds_total.get_dataset_size() == 4 ds_shard_1_0 = ds.ManifestDataset(MANIFEST_DATA_FILE, num_shards=1, shard_id=0) assert ds_shard_1_0.get_dataset_size() == 4 ds_shard_2_0 = ds.ManifestDataset(MANIFEST_DATA_FILE, num_shards=2, shard_id=0) assert ds_shard_2_0.get_dataset_size() == 2 ds_shard_3_0 = ds.ManifestDataset(MANIFEST_DATA_FILE, num_shards=3, shard_id=0) assert ds_shard_3_0.get_dataset_size() == 2 def test_cifar10_dataset_size(): ds_total = ds.Cifar10Dataset(CIFAR10_DATA_DIR) assert ds_total.get_dataset_size() == 10000 ds_shard_1_0 = ds.Cifar10Dataset(CIFAR10_DATA_DIR, num_shards=1, shard_id=0) assert ds_shard_1_0.get_dataset_size() == 10000 ds_shard_2_0 = ds.Cifar10Dataset(CIFAR10_DATA_DIR, num_shards=2, shard_id=0) assert ds_shard_2_0.get_dataset_size() == 5000 ds_shard_3_0 = ds.Cifar10Dataset(CIFAR10_DATA_DIR, num_shards=3, shard_id=0) assert ds_shard_3_0.get_dataset_size() == 3334 ds_shard_7_0 = ds.Cifar10Dataset(CIFAR10_DATA_DIR, num_shards=7, shard_id=0) assert ds_shard_7_0.get_dataset_size() == 1429 def test_cifar100_dataset_size(): ds_total = ds.Cifar100Dataset(CIFAR100_DATA_DIR) assert ds_total.get_dataset_size() == 10000 ds_shard_1_0 = ds.Cifar100Dataset(CIFAR100_DATA_DIR, num_shards=1, shard_id=0) assert ds_shard_1_0.get_dataset_size() == 10000 ds_shard_2_0 = ds.Cifar100Dataset(CIFAR100_DATA_DIR, num_shards=2, shard_id=0) assert ds_shard_2_0.get_dataset_size() == 5000 ds_shard_3_0 = ds.Cifar100Dataset(CIFAR100_DATA_DIR, num_shards=3, shard_id=0) assert ds_shard_3_0.get_dataset_size() == 3334
4,725
2,087
# Copyright (c) 2021 Red Hat, Inc. # # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from __future__ import absolute_import from oslo_log import log import tobiko from tobiko.shell import sh LOG = log.getLogger(__name__) def get_iperf_command(parameters, ssh_client): interface = get_iperf_interface(ssh_client=ssh_client) return interface.get_iperf_command(parameters) def get_iperf_interface(ssh_client): manager = tobiko.setup_fixture(IperfInterfaceManager) interface = manager.get_iperf_interface(ssh_client=ssh_client) tobiko.check_valid_type(interface, IperfInterface) return interface class IperfInterfaceManager(tobiko.SharedFixture): def __init__(self): super(IperfInterfaceManager, self).__init__() self.client_interfaces = {} self.interfaces = [] self.default_interface = IperfInterface() def add_iperf_interface(self, interface): LOG.debug('Register iperf interface %r', interface) self.interfaces.append(interface) def get_iperf_interface(self, ssh_client): try: return self.client_interfaces[ssh_client] except KeyError: pass LOG.debug('Assign default iperf interface to SSH client %r', ssh_client) self.client_interfaces[ssh_client] = self.default_interface return self.default_interface class IperfInterface(object): def get_iperf_command(self, parameters): command = sh.shell_command(['iperf3'] + self.get_iperf_options(parameters)) LOG.debug(f'Got iperf command: {command}') return command def get_iperf_options(self, parameters): options = [] port = parameters.port if port: options += self.get_port_option(port) timeout = parameters.timeout if timeout and parameters.mode == 'client': options += self.get_timeout_option(timeout) output_format = parameters.output_format if output_format: options += self.get_output_format_option(output_format) bitrate = parameters.bitrate if bitrate and parameters.mode == 'client': options += self.get_bitrate_option(bitrate) download = parameters.download if download and parameters.mode == 'client': options += self.get_download_option(download) protocol = parameters.protocol if protocol and parameters.mode == 'client': options += self.get_protocol_option(protocol) options += self.get_mode_option(parameters) return options @staticmethod def get_mode_option(parameters): mode = parameters.mode if not mode or mode not in ('client', 'server'): raise ValueError('iperf mode values allowed: [client|server]') elif mode == 'client' and not parameters.ip: raise ValueError('iperf client mode requires a destination ' 'IP address') elif mode == 'client': return ['-c', parameters.ip] else: # mode == 'server' return ['-s', '-D'] # server mode is executed with daemon mode @staticmethod def get_download_option(download): if download: return ['-R'] else: return [] @staticmethod def get_protocol_option(protocol): if protocol == 'tcp': return [] elif protocol == 'udp': return ['-u'] else: raise ValueError('iperf protocol values allowed: [tcp|udp]') @staticmethod def get_timeout_option(timeout): return ['-t', timeout] @staticmethod def get_output_format_option(output_format): if output_format == 'json': return ['-J'] else: raise ValueError('iperf output format values allowed: ' '[json]') @staticmethod def get_port_option(port): return ['-p', port] @staticmethod def get_bitrate_option(bitrate): return ['-b', bitrate]
4,651
1,308
import tensorflow as tf import pathlib import matplotlib.pyplot as plt import pandas as pd import numpy as np #print(np.version.version) #np.set_printoptions(precision=4) dataset=tf.data.Dataset.from_tensor_slices([8,3,0,8,2,1]) num=np.arange(5) numT=tf.convert_to_tensor(num) numF=tf.cast(numT,dtype=tf.float32) print(numT) print(numF) print(dataset) mat=tf.convert_to_tensor(np.zeros([3,3])) print(mat) small_list=tf.convert_to_tensor([1,2,3],dtype=tf.float64) print(small_list) print(np.random.randint(0,5))
512
218
#LeetCode problem 378: Kth Smallest Element in a Sorted Matrix class Solution: def kthSmallest(self, matrix: List[List[int]], k: int) -> int: res=[] for i in range(len(matrix)): for j in range(len(matrix[0])): res.append(matrix[i][j]) return(sorted(res)[k-1])
315
105