content
stringlengths
35
762k
sha1
stringlengths
40
40
id
int64
0
3.66M
def pass_through_formatter(value): """No op update function.""" return value
202ea761db9e1fa858718c61df3a7fd18f02826c
3,639,031
from re import U def instantiate(decoder, model=None, dataset=None): """ Instantiate a full decoder config, e.g. handle list of configs Note that arguments are added in reverse order compared to encoder (model first, then dataset) """ decoder = utils.to_list(decoder) return U.TupleSequential(*[_instantiate(d, model=model, dataset=dataset) for d in decoder])
238b97eab9a653200d0f82b92342a64bbbbc6336
3,639,032
def un_normalize(stdevs, arrList): """ Return an arrayList with ith column multiplied by scalar stdevs[i] if stdevs[i] is not zero, and unmodified if it is zero. Args: stdevs: A list of numbers (should be the list output by normalize). arrList: A list of list of numbers that is the (normalized) data. Returns: list: A list of list of numbers of the same dimensions as arrlist. >>> un_normalize([0.5, 2],[[1, 2], [3,4]]) [[0.5, 4], [1.5, 8]] >>> un_normalize([0.0, 2],[[1, 2], [3,4]]) [[1, 4], [3, 8]] """ stdevs = list(map(lambda x: x if x != 0.0 else 1, stdevs)) return scalarMultCols(stdevs, arrList)
a87aa89b2f591d46b077ea26d877f1d3459df2b3
3,639,033
import json def convert_graph(input_path): """ Converts a CRED-like graph into a graph format supported by the igraph library. The input graph must have been generated by cli2 CRED command (look for credResult.json) :param input_path: The path to the CRED graph to convert (credResult.json) """ with open(input_path, encoding="utf8") as f: cred_file = json.load(f) # Locating important elements in the graph cred_data = cred_file[1]['credData'] graph = cred_file[1]['weightedGraph'][1]['graphJSON'][1] cred_node_addresses = graph['sortedNodeAddresses'] # Summary of edges/nodes and also a reminder about dangling edges print(f'Found cred summary data for {len(cred_data["nodeSummaries"])} nodes and {len(cred_data["edgeSummaries"])} edges') print(f'The graph has {len(graph["nodes"])} nodes, {len(graph["edges"])} edges and {len(graph["sortedNodeAddresses"])} node addresses') print(f'Dangling edges expected: {len(graph["edges"]) - len(cred_data["edgeSummaries"])}') g = Graph(directed=True) # Collecting nodes for i, cred_node in enumerate(graph['nodes']): cred_node_address = cred_node_addresses[cred_node['index']] igraph_node_atts = {'label': cred_node_address[2]+'-'+cred_node_address[-1][:7], 'type': cred_node_address[2], 'timestamp': cred_node['timestampMs'] if cred_node['timestampMs'] is not None else 0, 'totalCred': cred_data['nodeSummaries'][i]['cred'], 'index': cred_node['index'], } g.add_vertex(name=str(cred_node['index']), **igraph_node_atts) # Collecting edges dangling_edges = [] idx = 0 for cred_edge in graph['edges']: # Checking if the edges is a dangling one. If so, we skip. if len(g.vs.select(name_eq=str(cred_edge['srcIndex']))) + len(g.vs.select(name_eq=str(cred_edge['dstIndex']))) < 2: dangling_edges.append({"srcIndex": cred_edge['srcIndex'], "dstIndex": cred_edge['dstIndex']}) continue igraph_edge_atts = {'address': '-'.join(cred_edge['address']), 'timestamp': cred_edge['timestampMs'], 'backwardFlow': cred_data['edgeSummaries'][idx]['backwardFlow'], 'forwardFlow': cred_data['edgeSummaries'][idx]['forwardFlow'], } g.add_edge(str(cred_edge['srcIndex']), str(cred_edge['dstIndex']), **igraph_edge_atts) idx += 1 # Reporting the number of dangling edges found print(f"Dangling edges found: {len(dangling_edges)}") return g
57037a662d033a422965f3efe13f321a5bf7f128
3,639,034
from typing import List def get_valid_classes_from_class_input( class_graph: class_dependency.JavaClassDependencyGraph, class_names_input: str) -> List[str]: """Parses classes given as input into fully qualified, valid classes. Input is a comma-separated list of classes.""" class_names = class_names_input.split(',') return get_valid_classes_from_class_list(class_graph, class_names)
e93edea9692ab9c461ed744a8727effbf705fdea
3,639,035
def us_ppop(ppop): """ Determines if the ppop is in a valid format to be in the US """ # return false if it's null or not 7 digits long if not ppop or len(ppop) != 7: return False ppop = ppop.upper() if ppop[:2] in g_state_by_code or ppop[:2] in g_state_code_by_fips: return True return False
afef4e7634034709f870379cd684a37a793c7ec5
3,639,036
def get_robotstxt_parser(url, session=None): """Get a RobotFileParser for the given robots.txt URL.""" rp = RobotFileParser() try: req = urlopen(url, session, max_content_bytes=MaxContentBytes, allow_errors=range(600)) except Exception: # connect or timeout errors are treated as an absent robots.txt rp.allow_all = True else: if req.status_code >= 400: rp.allow_all = True elif req.status_code == 200: rp.parse(req.text.splitlines()) return rp
f838f8284b250133a1c5f0ca5d514756ff4f1eb0
3,639,038
def init_model(config, checkpoint=None, device='cuda:0'): """Initialize a model from config file. Args: config (str or :obj:`mmcv.Config`): Config file path or the config object. checkpoint (str, optional): Checkpoint path. If left as None, the model will not load any weights. Returns: nn.Module: The constructed model. (nn.Module, None): The constructed extractor model """ if isinstance(config, str): config = mmcv.Config.fromfile(config) elif not isinstance(config, mmcv.Config): raise TypeError('config must be a filename or Config object, ' f'but got {type(config)}') config.data.test.test_mode = True model = build_architecture(config.model) if checkpoint is not None: # load model checkpoint load_checkpoint(model, checkpoint, map_location=device) # save the config in the model for convenience model.cfg = config model.to(device) model.eval() extractor = None if config.model.type == 'VideoBodyModelEstimator': extractor = build_backbone(config.extractor.backbone) if config.extractor.checkpoint is not None: # load model checkpoint load_checkpoint(extractor, config.extractor.checkpoint) extractor.cfg = config extractor.to(device) extractor.eval() return model, extractor
494cbcb012978d49905318d92c136bc7c6241a79
3,639,039
def estimate_period(time, y, y_err, clip=True, plot=True, **kwargs): """ Run a Lomb-Scargle Periodogram to find periodic signals. It's recommended to use the allesfitter.time_series functions sigma_clip and slide_clip beforehand. Parameters ---------- time : array of float e.g. time array (usually in days) y : array of float e.g. flux or RV array (usually as normalized flux or RV in km/s) yerr : array of float e.g. flux or RV error array (usually as normalized flux or RV in km/s) clip : bool, optional Automatically clip the input data with sigma_clip(low=4, high=4) and slide_clip(window_length=1, low=4, high=4). The default is True. plot : bool, optional To plot or not, that is the question. The default is False. **kwargs : collection of keyword arguments Any keyword arguments will be passed onto the astropy periodogram class. Returns ------- best_period : float The best period found. FAP : float The false alarm probability for the best period. fig : matplotlib.figure object, optional The summary figure. Only returned if plot is True. """ #========================================================================== #::: clean the inputs #========================================================================== time, y, y_err = clean(time, y, y_err) plot_bool = plot if clip: y = sigma_clip(time, y, low=4, high=4) y = slide_clip(time, y, window_length=1, low=4, high=4) time, y, y_err = clean(time, y, y_err) #========================================================================== #::: handle inputs #========================================================================== cadence = np.nanmedian(np.diff(time)) if kwargs is None: kwargs = {} if 'minperiod' not in kwargs: kwargs['minperiod'] = 10. * cadence if 'maxperiod' not in kwargs: kwargs['maxperiod'] = time[-1]-time[0] minfreq = 1./kwargs['maxperiod'] maxfreq = 1./kwargs['minperiod'] #========================================================================== #::: now do the periodogram #========================================================================== ls = LombScargle(time, y) #Analyze our dates and s-index data using the AstroPy Lomb Scargle module frequency, power = ls.autopower(minimum_frequency=minfreq, maximum_frequency=maxfreq) #Determine the LS periodogram best_power = np.nanmax(power) best_frequency = frequency[np.argmax(power)] best_period = 1./best_frequency FAP=ls.false_alarm_probability(best_power) #Calculate the FAP for the highest peak in the power array #========================================================================== #::: plot #========================================================================== def plot(): peak_loc=round(float(1./best_frequency),2) FAP_probabilities = [0.5, 0.1, 0.01] #Enter FAP values you want to determine FAP_levels=ls.false_alarm_level(FAP_probabilities) #Get corresponding LS Power values fig, axes = plt.subplots(4, 1, figsize=[10,15], tight_layout=True) #::: plot the periodogram ax = axes[0] ax.semilogx(1./frequency,power,color='b') ax.plot(peak_loc, best_power, marker='d', markersize=12, color='r') ax.text(peak_loc*1.2,best_power*0.95,'Peak Period: '+str(peak_loc)+' days') ax.text(peak_loc*1.2,best_power*0.85,'FAP: '+str(FAP)) ax.hlines(FAP_levels, kwargs['minperiod'], kwargs['maxperiod'], color='grey', lw=1) ax.text(kwargs['maxperiod'], FAP_levels[0],'0.5% FAP ', ha='right') ax.text(kwargs['maxperiod'], FAP_levels[1],'0.1% FAP ', ha='right') ax.text(kwargs['maxperiod'], FAP_levels[2],'0.01% FAP ', ha='right') ax.set(xlabel='Period (days)', ylabel='L-S power') ax.tick_params(axis='both',which='major') #::: plot the phase-folded data ax = axes[1] plot_phase_folded_lightcurve(time, y, period=1./best_frequency, epoch=0, ax=ax) ax.set(ylim=[np.nanmin(y), np.nanmax(y)], ylabel='Data (clipped; phased)') #::: plot the phase-folded data, zoomed ax = axes[2] plot_phase_folded_lightcurve(time, y, period=1./best_frequency, epoch=0, ax=ax) ax.set(ylabel='Data (clipped; phased; y-zoom)') #::: plot the autocorrelation of the data ax = axes[3] plot_acf(pd.Series(y, index=time), ax=ax, lags=np.linspace(start=1,stop=2*best_period/cadence,num=100,dtype=int)) ax.set(xlabel='Lag', ylabel='Autocorrelation', title='') return fig #========================================================================== #::: return #========================================================================== if plot_bool: fig = plot() return best_period, FAP, fig else: return best_period, FAP
23cc58d910ff5541847fa4d5892979aa312d1609
3,639,040
def get_test_packages(): """Get a list of packages which need tests run. Filters the package list in the following order: * Check command line for packages passed in as positional arguments * Check if the the local remote and local branch environment variables have been set to specify a remote branch to diff against. * Check if in Travis, then limit the subset based on changes in a Pull Request ("push" builds to branches may not have any filtering) * Just use all packages An additional check is done for the cases when a diff is computed (i.e. using local remote and local branch environment variables, and on Travis). Once the filtered list of **changed** packages is found, the package dependency graph is used to add any additional packages which depend on the changed packages. :rtype: list :returns: A list of all package directories where tests need be run. """ all_packages = get_package_directories() local_diff = local_diff_branch() parser = get_parser() args = parser.parse_args() if args.packages is not UNSET_SENTINEL: verify_packages(args.packages, all_packages) return sorted(args.packages) elif local_diff is not None: changed_packages = get_changed_packages( 'HEAD', local_diff, all_packages) return follow_dependencies(changed_packages, all_packages) elif in_travis(): changed_packages = get_travis_directories(all_packages) return follow_dependencies(changed_packages, all_packages) else: return all_packages
302a3136ec84e81a68348e5ff1bffa9c916f36a1
3,639,041
def decoding_character(morse_character): """ Input: - morse_character : ๋ฌธ์ž์—ด๊ฐ’์œผ๋กœ get_morse_code_dict ํ•จ์ˆ˜๋กœ ์•ŒํŒŒ๋ฒณ์œผ๋กœ ์น˜ํ™˜์ด ๊ฐ€๋Šฅํ•œ ๊ฐ’์˜ ์ž…๋ ฅ์ด ๋ณด์žฅ๋จ Output: - Morse Code๋ฅผ ์•ŒํŒŒ๋ฒณ์œผ๋กœ ์น˜ํ™˜ํ•จ ๊ฐ’ Examples: >>> import morsecode as mc >>> mc.decoding_character("-") 'T' >>> mc.decoding_character(".") 'E' >>> mc.decoding_character(".-") 'A' >>> mc.decoding_character("...") 'S' >>> mc.decoding_character("....") 'H' >>> mc.decoding_character("-.-") 'K' """ # ===Modify codes below============= # ์กฐ๊ฑด์— ๋”ฐ๋ผ ๋ณ€ํ™˜๋˜์–ด์•ผ ํ•  ๊ฒฐ๊ณผ๋ฅผ result ๋ณ€์ˆ˜์— ํ• ๋‹น ๋˜๋Š” ํ•„์š”์— ๋”ฐ๋ผ ์ž์œ ๋กœ์šด ์ˆ˜์ • #morse_code_dict = get_morse_code_dict() char_dict = get_char_code_dict() result = char_dict.get(morse_character) return result
29c3f99da372a713d349a0c7640403ae32c08aba
3,639,042
def SparsityParametersAddDimMetadata(builder, dimMetadata): """This method is deprecated. Please switch to AddDimMetadata.""" return AddDimMetadata(builder, dimMetadata)
5a7604ca44fbf3f2a1d520018269c472340511e5
3,639,043
def check_branch(payload, branch): """ Check if a push was on configured branch. :param payload: Payload from web hook. :param branch: Name of branch to trigger action on. :return: True if push was on configured branch, False otherwise. """ if "ref" in payload: if payload["ref"] == branch: return True return False
88bd0ebae330ee169e97a40aee208b2f92ee4a32
3,639,044
from typing import Union def convert(q: Quantity, new_unit: Union[str, Unit], equivalencies=None) -> Quantity: """Convert quantity to a new unit. :raises InvalidUnit: When target unit does not exist. :raises InvalidUnitConversion: If the conversion is invalid. Customized to be a bit more universal than the original quantities. """ try: return q.to(new_unit, equivalencies or []) except u.UnitConversionError: if q.unit.physical_type == "temperature": return q.to(new_unit, u.temperature()) else: raise InvalidUnitConversion( f"Cannot convert unit '{q.unit}' to '{new_unit}'." ) from None except ValueError as err: raise InvalidUnit(f"Unit '{new_unit}' does not exist.") from None
7d28a40d3da4a6189aeb9efb252f50088838a1f3
3,639,045
def randomized_pairwise_t_test(arr1, arr2, output=True): """ Perform a randomized pairwise t-test on two arrays of values of equal size. see Cohen, P.R., Empirical Methods for Artificial Intelligence, p. 168 """ # Make sure both arrays are the same length assert len(arr1) == len(arr2) # Cast them to floats arr1 = map(float, arr1) arr2 = map(float, arr2) # Calculate the absolute diffs diffs = [(arr1[i] - arr2[i]) for i in range(len(arr1))] # Calculate the original mean originalMean = sum(diffs) / float(len(diffs)) numLess = 0 # Do 10000 trials to test for i in range(10000): running_sum = 0. for j in range(len(diffs)): if choice([True,False]): running_sum += diffs[j] else: running_sum -= diffs[j] mean = running_sum / float(len(diffs)) if mean <= originalMean: numLess += 1 # Finally output / return the stats ratio = float(numLess + 1) / float(10001) ratio = min(ratio, 1-ratio) if output: print ("mean difference: %f\nsignificant at p <= %f" % (originalMean, ratio)) return originalMean, ratio
92ceb071fcc03dd952a15ffe08f2bd305c603a39
3,639,046
from typing import Dict from datetime import datetime import uuid def update_metadata(radar, longitude: np.ndarray, latitude: np.ndarray) -> Dict: """ Update metadata of the gridded products. Parameter: ========== radar: pyart.core.Grid Radar data. Returns: ======== metadata: dict Output metadata dictionnary. """ today = datetime.datetime.utcnow() dtime = cftime.num2pydate(radar.time["data"], radar.time["units"]) maxlon = longitude.max() minlon = longitude.min() maxlat = latitude.max() minlat = latitude.min() metadata = { "comment": "Gridded radar volume using Barnes et al. ROI", "field_names": ", ".join([k for k in radar.fields.keys()]), "geospatial_bounds": f"POLYGON(({minlon:0.6} {minlat:0.6},{minlon:0.6} {maxlat:0.6},{maxlon:0.6} {maxlat:0.6},{maxlon:0.6} {minlat:0.6},{minlon:0.6} {minlat:0.6}))", "geospatial_lat_max": f"{maxlat:0.6}", "geospatial_lat_min": f"{minlat:0.6}", "geospatial_lat_units": "degrees_north", "geospatial_lon_max": f"{maxlon:0.6}", "geospatial_lon_min": f"{minlon:0.6}", "geospatial_lon_units": "degrees_east", "geospatial_vertical_min": np.int32(radar.origin_altitude["data"][0]), "geospatial_vertical_max": np.int32(20000), "geospatial_vertical_positive": "up", "history": f"created by Valentin Louf on gadi.nci.org.au at {today.isoformat()} using Py-ART", "processing_level": "b2", "time_coverage_start": dtime[0].isoformat(), "time_coverage_end": dtime[-1].isoformat(), "uuid": str(uuid.uuid4()), } return metadata
ae4b26372221262426803f40394caa06245d5afb
3,639,047
import copy def idxsel2xsel(file, isel, dimensions, order): """ convert a index space selection object to an xSelect object """ if not isinstance(isel, idxSelect): raise TypeError('wrong argument type') xsel = {} xsel_size = {} xsel_dims = {} isarray = False interp = False masked = False multidim = False i = 0 for axis in dimensions: inc_i = True try: idx = isel[axis] if idx.interp: interp = True if idx.isarray: isarray = True if idx.dims is not None: multidim = True if isinstance(idx.v, N.ma.MaskedArray): masked = True xsel_dims[axis] = idx.dims idx = idx.v if isinstance(idx, slice): dimsize = file.cf_dimensions[axis] res = [idx.start, idx.stop, idx.step] if (idx.step is not None and idx.step < 0): if idx.start is None: res[0] = dimsize - 1 if idx.stop is None: res[1] = None else: if idx.start is None: res[0] = 0 if idx.stop is None: res[1] = dimsize if idx.step is None: res[2] = 1 xsel[axis] = slice(res[0], res[1], res[2]) elif N.isscalar(idx): xsel[axis] = idx if len(order) > 0: order.remove(i) for val in order: if val > i: order[order.index(val)] = val - 1 inc_i = False else: #xsel[axis] = idx.copy() xsel[axis] = copy.copy(idx) if len(idx.shape) == 0 or idx.shape == 1: if len(order) > 0: order.remove(i) for val in order: if val > i: order[order.index(val)] = val - 1 inc_i = False except KeyError: dimsize = file.cf_dimensions[axis] xsel[axis] = (slice(0, dimsize, 1)) xsel_dims[axis] = None if inc_i: i += 1 if isarray: # convert slices to 1d-arrays and determine result size for axis in dimensions: idx = xsel[axis] if isinstance(idx, slice): xsel[axis] = N.arange(idx.start, idx.stop, idx.step) if xsel_dims[axis] is None: if is_scalar(xsel[axis]): xsel_size[axis] = 0 else: xsel_size[axis] = len(xsel[axis]) else: xsel_size[axis] = isel[axis].axlen # determine shape of xsel dim_ret = [] for axis in dimensions: if xsel_size[axis] != 0: dim_ret.append(xsel_size[axis]) ndim_ret = len(dim_ret) # all 1d arrays if not multidim: i = 0 for axis in dimensions: if xsel_size[axis] != 0: idx_shape = N.ones(ndim_ret,dtype="int32") idx_shape[i] = dim_ret[i] xsel[axis].shape = idx_shape i += 1 # at least one multidimensional coordinate else: i = 0 for axis in dimensions: if xsel_dims[axis] is None: if xsel_size[axis] != 0: idx_shape = N.ones(ndim_ret,dtype="int32") idx_shape[i] = dim_ret[i] xsel[axis].shape = idx_shape i += 1 else: idx_shape2 = {} for axis2 in dimensions: if xsel_size[axis2] != 0: if axis2 in xsel_dims[axis]: idx_shape2[axis2] = isel[axis].dimsize(axis2) else: idx_shape2[axis2] = 1 idx_shape = [] for axis2 in dimensions: if axis2 in idx_shape2: idx_shape.append(idx_shape2[axis2]) if isel[axis].type != 'scalar': i += 1 # check if we only need basic slicing if not isarray and not interp: isbasic = True else: isbasic = False ret = [] for axis in dimensions: ret.append(xsel[axis]) ret = xSelect(ret) ret.isbasic = isbasic ret.interp = interp ret.masked = masked ret.order = order return ret
ff00a7705a9ae1f633e7ec19682367ccfea2b7bf
3,639,048
def _retrieve_max_kb_s_sent_state(status: FritzStatus, last_value: str) -> float: """Return upload max transmission rate.""" return round(status.max_bit_rate[0] / 1000, 1)
e1c0a710131289e457f3c15da411a7f8d17fdfc7
3,639,049
def user_detail(request, id, format=None): """ Retrieve, update or delete a server assets instance. """ try: snippet = User.objects.get(id=id) except User.DoesNotExist: return Response(status=status.HTTP_404_NOT_FOUND) if request.method == 'GET': serializer = UserSerializer(snippet) return Response(serializer.data) elif request.method == 'PUT': serializer = UserSerializer(snippet, data=request.data) if serializer.is_valid(): serializer.save() return Response(serializer.data) return Response(serializer.errors, status=status.HTTP_400_BAD_REQUEST) elif request.method == 'DELETE': if not request.user.has_perm('ops.delete_user'): return Response(status=status.HTTP_403_FORBIDDEN) snippet.delete() return Response(status=status.HTTP_204_NO_CONTENT)
9339c85cec0b271d5eeb8a1caec976992869174a
3,639,050
def _gsmooth_img(args): """ HELPER FUNCTION: private! Smooth an image with a gaussian in 2d """ img,kernel,use_fft,kwargs = args if use_fft: return convolve_fft(img, kernel, normalize_kernel=True, **kwargs) else: return convolve(img, kernel, normalize_kernel=True, **kwargs)
313a0c4475935665cb0e4c55bea343adf3a9fab4
3,639,051
def __logs_by_scan_id(scan_id, language): """ select all events by scan id hash Args: scan_id: scan id hash language: language Returns: an array with JSON events or an empty array """ try: logs = [] for log in send_read_query( "select host,username,password,port,type,date,description from hosts_log where scan_id=\"{0}\"".format( scan_id), language): data = { "SCAN_ID": scan_id, "HOST": log[0], "USERNAME": log[1], "PASSWORD": log[2], "PORT": log[3], "TYPE": log[4], "TIME": log[5], "DESCRIPTION": log[6] } logs.append(data) return logs except: return []
26ef72dd2e0ed974a84f2ddc67e61fd90f769f17
3,639,053
def docs(): """Redirect to documentation on Github Route: /docs Methods: GET Return: redirect to webpage """ return redirect("https://kinsaurralde.github.io/ws_281x-lights/#/")
18fbbf2e4d53c66545bdf1129de5d1d4ac5944fd
3,639,054
def std(a, weights=None, axis=None, dtype=None, ddof=0, keepdims=False): """ Compute the weighted standard deviation along the specified axis. :param a: Array containing numbers whose standard deviation is desired. If `a` is not an array, a conversion is attempted. :param weights: Array containing weights for the elements of `a`. If `weights` is not an array, a conversion is attempted. :param axis: Axis or axes along which the means are computed. The default is to compute the mean of the flattened array. Type is None or int or tuple of ints, optional. :param dtype: data type to use in computing the mean. :param int ddof: Delta Degrees of Freedom. The divisor used in calculations is ``W - ddof``, where ``W`` is the sum of weights (or number of elements if `weights` is None). By default `ddof` is zero :param bool keepdims: If this is set to True, the axes which are reduced are left in the result as dimensions with size one. :return: np.ndarray """ if weights is None: return np.std(a, axis=axis, dtype=dtype, ddof=ddof, keepdims=keepdims) else: w = np.array(weights) m = mean(a, weights=w, axis=axis, keepdims=True) return np.sqrt( np.sum( w * (np.array(a) - m) ** 2, axis=axis, dtype=dtype, keepdims=keepdims ) / ( # noqa: W504 np.sum(w, axis=axis, dtype=dtype, keepdims=keepdims) - ddof ) )
758421b85657197413ab4fe2713bf18da2ac184a
3,639,055
import logging def createOneHourCandles(markets, database): """ Function that creates tables for one minute candles. :param database: :param markets: :return: """ conn = pymysql.connect(host='localhost', user='jan', password='17051982', database=database) func_logging = logging.getLogger("bittrex_database." + str(__name__) + ".createOneHourCandles()") for ix in markets: with conn.cursor() as cur: comm = f'CREATE OR REPLACE TABLE `{ix}` (' \ f'symbol CHAR(20) NOT NULL, ' \ f'ttime FLOAT NOT NULL, ' \ f'oopen DOUBLE NOT NULL, ' \ f'hhigh DOUBLE NOT NULL, ' \ f'llow DOUBLE NOT NULL, ' \ f'cclose DOUBLE NOT NULL, ' \ f'base_vol DOUBLE NOT NULL, ' \ f'quote_vol DOUBLE NOT NULL, ' \ f'usd_vol DOUBLE NOT NULL, ' \ f'PRIMARY KEY (symbol, ttime)' \ f') ENGINE=Maria' cur.execute(comm) conn.commit() func_logging.info("One hour candles database have been initiated with empty columns.") return True
c800570a4dd17acb0b588064938ccf098e6c53bb
3,639,056
def coaddspectra(splist,plotsp=True,outf=None,sn_smooth_npix=10): """ Coadd spectra Parameters ---------- splist : list of XSpectrum1D objects List of spectra to coadd plotsp : bool If True, plot the coadded spectrum outf : str Output file sn_smooth_npix : float Parameter in coadd1d.combspec function that defines number of pixels to median filter by when computing S/N used to decide how to scale and weight spectra Returns ------- sp : XSpectrum1D A spectrum that represents coadded spectra from the splist list """ waves = [] fluxes = [] ivars = [] masks = [] for isp in splist: waves.append(isp.wavelength) fluxes.append(isp.flux) ivars.append(1. / (isp.sig) ** 2.) imask = np.repeat(True, len(isp.flux)) j = np.where((isp.flux == 0) & (isp.sig == 0))[0] imask[j] = False masks.append(imask) waves = np.ndarray.transpose(np.asarray(waves)) fluxes = np.ndarray.transpose(np.asarray(fluxes)) ivars = np.ndarray.transpose(np.asarray(ivars)) masks = np.ndarray.transpose(np.asarray(masks)) wave_stack, flux_stack, ivar_stack, mask_stack = coadd1d.combspec( waves, fluxes, ivars, masks, sn_smooth_npix, show=plotsp) ii = np.where(wave_stack > 0)[0] coadded_waves = wave_stack[ii] coadded_fluxes = flux_stack[ii] coadded_sigs = 1 / (np.sqrt(ivar_stack[ii])) # write and return the spectrum sp = xspec.XSpectrum1D(coadded_waves, coadded_fluxes, coadded_sigs) if outf is not None: sp.write_to_fits(outf) return sp
1e0c312389f566a34cca878251b7d808968e175c
3,639,057
def get_rel_sim(relation, question, dataset): """ Get max cosine distance for relations :param relation: :param question: :return: """ query_ngrams = generate_ngrams(question) query_ngrams_vec = [get_avg_word2vec(phr, dataset) for phr in query_ngrams] relation_ngram = get_avg_word2vec(relation, dataset) similarities = [cosine_similarity(relation_ngram, q)[0][0] for q in query_ngrams_vec] if similarities and np.max(similarities) > 0.5: return np.max(similarities) else: return 0.0
63c313fac32ec2483979585c60cea916979aaf5d
3,639,058
def mk_request(bits, cn): """ Create a X509 request with the given number of bits in they key. Args: bits -- number of RSA key bits cn -- common name in the request Returns a X509 request and the private key (EVP) """ pk = EVP.PKey() x = X509.Request() rsa = RSA.gen_key(bits, 65537, lambda: None) pk.assign_rsa(rsa) x.set_pubkey(pk) name = x.get_subject() name.C = config.get('ca', 'cert_country') name.CN = cn name.ST = config.get('ca', 'cert_state') name.L = config.get('ca', 'cert_locality') name.O = config.get('ca', 'cert_organization') name.OU = config.get('ca', 'cert_org_unit') x.sign(pk, 'sha256') return x, pk
f6ac4fe385caba149b85599fa6f48fc3d0dc7ccf
3,639,059
import re def nice(name): """Generate a nice name based on the given string. Examples: >>> names = [ ... "simple_command", ... "simpleCommand", ... "SimpleCommand", ... "Simple command", ... ] >>> for name in names: ... nice(name) 'Simple Command' 'Simple Command' 'Simple Command' 'Simple Command' Arguments: name (str): The string from which generate the nice name. Returns: str: The generated nice name. """ # The regular expression will match all upper case characters except the # one that starts the string and insert a space before it. return re.sub(r"(?<!^)([A-Z])", r" \1", name).replace("_", " ").title()
ab96675423812a85744bb76e7f62d08bbbac2eea
3,639,060
def get_outputs(): """Get the available outputs, excluding outputs in the EXCLUDED_OUTPUTS variable.""" outputs = [] tree = connection.get_tree() for node in filter( lambda node: node.type == "output" and node.name not in EXCLUDED_OUTPUTS, tree ): workspaces = node.nodes[1].nodes if workspaces: outputs.append((node, workspaces)) return outputs
6db1ea83252a7a6f4fd7f731c206c5d4a738a282
3,639,061
def get_user_owner_mailboxes_tuples(user): """ Return owned mailboxes of a user as tuple """ return ((owned_mailbox.id, owned_mailbox.email_address) for owned_mailbox in get_user_owner_mailboxes_query(user))
e7db6658497678387f4a93237b686d29bc27d91f
3,639,062
def modinv(a, m): """Modular Multiplicative Inverse""" a = a % m g, x, y = egcd(a, m) if g != 1: raise Exception('modular inverse does not exist') else: return x % m
9ddea93398f8c96f828a8efaea36f21f6b8dd13e
3,639,063
import socket def get_ip(): """Get the ip of the host computer""" s = socket.socket(socket.AF_INET, socket.SOCK_DGRAM) try: s.connect(('1.1.1.1', 1)) IP = s.getsockname()[0] except Exception: IP = '127.0.0.1' finally: s.close() return IP
fb4f79eaa25573d7078f69c5d5ad71c51c9d1c44
3,639,064
def available_structure_info(): """ Lists available attributes for :func:`abagen.mouse.get_structure_info` """ return _STRUCTURE_ATTRIBUTES.copy()
14591c89c9f7212440da282f50408459692d1fc4
3,639,065
def centos(function): """Decorator to set the Linux distribution to CentOS 7""" def wrapper(*args, **kwargs): hpccm.config.g_linux_distro = linux_distro.CENTOS hpccm.config.g_linux_version = StrictVersion('7.0') return function(*args, **kwargs) return wrapper
9c54a7aac46bd30d490c625afa4392d5127a2be7
3,639,066
def Normalized2(p): """Return vector p normlized by dividing by its squared length. Return (0.0, 1.0) if the result is undefined.""" (x, y) = p sqrlen = x * x + y * y if sqrlen < 1e-100: return (0.0, 1.0) else: try: d = sqrt(sqrlen) return (x / d, y / d) except: return (0.0, 1.0)
42cc78350f264226c624a81ca5b0bd6457d353b0
3,639,067
def findwskeyword(keyword, sol): """Find and return a value for a keyword in the list of the wavelength solution""" i = sol.index(keyword) j = sol[i:].index('\n') return sol[i:i + j].split('=')[1].strip()
b3cc028415d74ecfd7ec3868ae591d7b4d3b8860
3,639,068
import numpy from typing import Tuple from typing import Callable from typing import Union from typing import List def algorithm(array: numpy.array, start: Tuple[int, int], end: Tuple[int, int], heuristic: Callable = manhattan) -> Union[List, None]: """ Returns a list of all points, for the path between `start` and `end` :param array: a numpy array of Node instances :param start: a tuple (or list) of points corresponding to where to start on array :param end: like start, but for the end :param heuristic: a function that represents the heuristic (default: manhattan heuristic) Example: >>> test = numpy.array( [[0, 0, 0, 0, 0, 1], [0, 1, 1, 1, 0, 1], [0, 1, 0, 0, 0, 1], [0, 1, 0, 1, 1, 1], [0, 0, 0, 0, 1, 0], [1, 1, 1, 0, 0, 0]] ) >>> print(algorithm(test, (0, 0), (5, 5))) """ array = array_to_class(array) actual_start = array[start[0], start[1]] actual_end = array[end[0], end[1]] count = 0 open_set = PriorityQueue() open_set.put((0, count, actual_start)) came_from = {} g_score = {node: inf for row in array for node in row} f_score = {node: inf for row in array for node in row} g_score[actual_start] = 0 f_score[actual_start] = heuristic(start, end) open_set_hash = {actual_start} while not open_set.empty(): current = open_set.get()[2] current_pos = current.pos open_set_hash.remove(current) if current == actual_end: return reconstruct_path(came_from, start, end) for neighbor in get_neighbors(array, current_pos): neighbor_instance = array[neighbor[0], neighbor[1]] temp_g_score = g_score[current] + 1 if temp_g_score < g_score[neighbor_instance]: came_from[neighbor_instance] = current g_score[neighbor_instance] = temp_g_score f_score[neighbor_instance] = temp_g_score + heuristic(neighbor, end) if neighbor_instance not in open_set_hash: count += 1 open_set.put((f_score[neighbor_instance], count, neighbor_instance)) open_set_hash.add(neighbor_instance) return None
9a91e27bc0dbe78f7b2801dbdfbef6747a845aa7
3,639,069
from . import logger def MFString(string_list): """ input a list of unicode strings output: a unicode string formed by encoding, enclosing each item in double quotes, and concatenating 27 Nov 2016: The complete case is as yet unimplemented, to avoid sending bad X3D into the world will instead fail with a Exception if any of the elements of list contain a XML special case in '"&<> """ special_characters = u"\'\"&<>" assert( len(special_characters) == 5) # check unicode_type = type(u"") for item in string_list: if not type(item) is unicode_type: logger.warn("Non unicode entry for MFString: %s" % (repr(item),)) for c in special_characters: if c in item: raise ValueError("Unimplemented case: special character in MFString item: %s" % (repr(item),)) return " ".join([u'"%s"' % item for item in string_list])
a068c25ab157b5537ea47e625ca8ed9aecd0f4e5
3,639,070
def re_allocate_memory(ptr: VoidPtr, size: int)-> VoidPtr: """ Internal memory free ptr: The pointer which is pointing the previously allocated memory block by allocate_memory. size: The new size of memory block. """ return _rl.MemRealloc( ptr, _to_int(size) )
806c17a6863db3af8c5b42474fe05c624685757c
3,639,071
import json def get_task_manager(setup_file, **kwargs): """ Create a task manager of a correct type. Parameters ---------- setup_file : string File name of the setup file. kwargs : dict Additional kwargs. Returns ------- manager : TaskManager Created task manager. """ setup = json.load(open(setup_file)) manager = setup['manager'].lower() if manager == 'slurm': return SlurmTaskManager(setup_file, **kwargs) elif manager == 'sge': return SgeTaskManager(setup_file, **kwargs) elif manager == 'local': return LocalTaskManager(setup_file, **kwargs) else: raise ValueError('Unknown task manager: %s', manager)
a297937fd4520549df034a22739250461cbf2c0e
3,639,072
def format_time(time): """ Converts datetimes to the format expected in SAML2 XMLs. """ return time.strftime("%Y-%m-%dT%H:%M:%SZ")
03651b72aa0b177ac1ac3f1ccafdba6fe967a11a
3,639,073
def get_delivery_voucher_discount(voucher, total_price, delivery_price): """Calculate discount value for a voucher of delivery type.""" voucher.validate_min_amount_spent(total_price) return voucher.get_discount_amount_for(delivery_price)
8ede095730c1d29d01949dff47b4a2893d29720c
3,639,074
def has_admin_access(request): # type: (Request) -> bool """ Verifies if the authenticated user doing the request has administrative access. .. note:: Any request view that does not explicitly override ``permission`` by another value than the default :envvar:`MAGPIE_ADMIN_PERMISSION` will already automatically guarantee that the request user is an administrator since HTTP [403] Forbidden would have been otherwise replied. This method is indented for operations that are more permissive and require conditional validation of administrator access. .. seealso:: Definitions in :class:`magpie.models.RootFactory` and :class:`magpie.models.UserFactory` define conditional principals and :term:`ACL` based on the request. """ admin_perm = get_constant("MAGPIE_ADMIN_PERMISSION", request) authz_policy = request.registry.queryUtility(IAuthorizationPolicy) # noqa principals = get_principals(request) result = authz_policy.permits(models.RootFactory(request), principals, admin_perm) return isinstance(result, ACLAllowed)
54a109375c60354759d98177a2db275f627034b2
3,639,075
def model_selection(modelname, num_out_classes=2, pretrain_path=None): """ :param modelname, num_out_classes, pretrained, dropout: :return: model, image size """ return TransferModel(modelchoice=modelname, num_out_classes=num_out_classes, pretrain_path=pretrain_path)
ef80dd1c5c52bc0d090801ebb1d5e17f303e48ad
3,639,077
def stack1(x, filters, blocks, stride1=2, dilation=1, name=None): """A set of stacked residual blocks. # Arguments x: input tensor. filters: integer, filters of the bottleneck layer in a block. blocks: integer, blocks in the stacked blocks. stride1: default 2, stride of the first layer in the first block. name: string, stack label. # Returns Output tensor for the stacked blocks. """ x = block1(x, filters, stride=stride1, name=name + '_block1') for i in range(2, blocks + 1): x = block1(x, filters, conv_shortcut=False, dilation=dilation, name=name + '_block' + str(i)) return x
43103a2bcad203b1b32f33e352960bdea8d526c9
3,639,078
def _CreateDynamicDisplayAdSettings(media_service, opener): """Creates settings for dynamic display ad. Args: media_service: a SudsServiceProxy instance for AdWords's MediaService. opener: an OpenerDirector instance. Returns: The dynamic display ad settings. """ image = _CreateImage(media_service, opener, 'https://goo.gl/dEvQeF') logo = { 'type': 'IMAGE', 'mediaId': image['mediaId'], 'xsi_type': 'Image' } dynamic_settings = { 'landscapeLogoImage': logo, 'pricePrefix': 'as low as', 'promoText': 'Free shipping!', 'xsi_type': 'DynamicSettings', } return dynamic_settings
c79145ec39a7aed97eea7efe9145eab5c706b146
3,639,079
def contacts_per_person_normal_00x30(): """ Real Name: b'contacts per person normal 00x30' Original Eqn: b'10' Units: b'contact/Day' Limits: (None, None) Type: constant b'' """ return 10
1d0f7caaa4cceafbc34045b2983e388cd1169f8b
3,639,080
def _get_scripts_shell(script_file): # type: (pathlib.Path) -> str """ Returns the shell used in the passed script file. If no shell is recognized exception is raised. Depended on presence of shebang. Supported shells: Bash, Fish, Zsh :param script_file: :return: :raises exceptions.UnknownShell: If no shell is recognized """ with script_file.open('r') as f: shebang = f.readline().lower() for shell in SUPPORTED_SHELLS: if shell in shebang: return shell raise exceptions.UnknownShell('It seems that the currently used post-commit ' 'hook uses shebang that is not known to Gitrack: ' + shebang)
74332334d9b3caf1be720d656ca6e64f4971e35e
3,639,081
from shutil import which def is_cmd_tool(name): """ Check whether `name` is on PATH and marked as executable. From: https://stackoverflow.com/a/34177358 """ return which(name) is not None
a35f84f1bf46aedac488a31402996f075fbe80e2
3,639,082
import pickle def load_model(model: Model, language=()): """Load geo model and return as dict.""" log.info("Reading geomodel: %s", model) with open(model.path, "rb") as infile: m = pickle.load(infile) result = defaultdict(set) for _geonameid, l in list(m.items()): result[l["name"].lower()].add((l["name"], l["latitude"], l["longitude"], l["country"], l["population"])) for lang in l["alternative_names"]: if lang in language or not language: for altname in l["alternative_names"][lang]: result[altname.lower()].add( (l["name"], l["latitude"], l["longitude"], l["country"], l["population"])) log.info("Read %d geographical names", len(result)) return result
af77d0e0835b8be6b7b87b142141f4c50082a0ae
3,639,083
def saml_metadata_generator(sp, validated=True, privacypolicy=False, tree=None, disable_entity_extensions=False): """ Generates metadata for single SP. sp: ServiceProvider object validated: if false, using unvalidated metadata privacypolicy: fill empty privacypolicy URLs with default value tree: use as root if given, generate new root if not return tree """ entity, history, validation_date = get_entity(sp, validated) if not entity: return tree if tree is not None: entity_descriptor = etree.SubElement(tree, "EntityDescriptor", entityID=entity.entity_id) else: entity_descriptor = etree.Element("EntityDescriptor", entityID=entity.entity_id, nsmap={"ds": 'http://www.w3.org/2000/09/xmldsig#', "mdattr": 'urn:oasis:names:tc:SAML:metadata:attribute', "mdui": 'urn:oasis:names:tc:SAML:metadata:ui', "saml": 'urn:oasis:names:tc:SAML:2.0:assertion', "xmlns": 'urn:oasis:names:tc:SAML:2.0:metadata', "xsd": 'http://www.w3.org/2001/XMLSchema', "xsi": 'http://www.w3.org/2001/XMLSchema-instance', }) if not disable_entity_extensions: if history: metadata_entity_extensions(entity_descriptor, history) else: metadata_entity_extensions(entity_descriptor, sp) metadata_spssodescriptor(entity_descriptor, sp, history, validation_date, privacypolicy) metadata_contact(entity_descriptor, sp, validation_date) if history: metadata_organization(entity_descriptor, history) else: metadata_organization(entity_descriptor, sp) if tree is not None: return tree else: return entity_descriptor
78f065fe7962e7221626c41b81b550ceaa9e7370
3,639,084
def normalize_not_found(wrapped): """View decorator to make 404 error messages more readable""" def wrapper(context, request): # Replace incoming 404 with one that has a sensible message response = wrapped(_standard_not_found(), request) return response return wrapper
2a9a696c98b777e4f7295015840fbff6235092e7
3,639,087
def process_results(unprocessed, P, R, G): """Process the results returned by the worker pool, sorting them by policy and run e.g. results[i][j][k] are the results from policy i on run j on graph k. Parameters: - unprocessed: Unprocessed results (as returned by the worker pool) - P: number of policies - R: number of runs - G: number of graphs/SCMs/test cases """ results = [] for i in range(P): policy_results = [] for r in range(R): run_results = unprocessed[(i*G*R + G*r):(i*G*R + G*(r+1))] policy_results.append(run_results) results.append(policy_results) return results
24c2854723b3fc33c3fee58595f84d789e861fbc
3,639,089
def make_inline_table(data): """Create an inline table from the given data.""" table = tomlkit.inline_table() table.update(data) return table
c70352de9a716ad5d3f1f33b33ea65c10ebc8f98
3,639,090
def _mi_dc(x, y, k): """ Calculates the mututal information between a continuous vector x and a disrete class vector y. This implementation can calculate the MI between the joint distribution of one or more continuous variables (X[:, 1:3]) with a discrete variable (y). Thanks to Adam Pocock, the author of the FEAST package for the idea. Brian C. Ross, 2014, PLOS ONE Mutual Information between Discrete and Continuous Data Sets """ y = y.flatten() n = x.shape[0] classes = np.unique(y) knn = NearestNeighbors(n_neighbors=k) # distance to kth in-class neighbour d2k = np.empty(n) # number of points within each point's class Nx = [] for yi in y: Nx.append(np.sum(y == yi)) # find the distance of the kth in-class point for c in classes: mask = np.where(y == c)[0] knn.fit(x[mask, :]) d2k[mask] = knn.kneighbors()[0][:, -1] # find the number of points within the distance of the kth in-class point knn.fit(x) m = knn.radius_neighbors(radius=d2k, return_distance=False) m = [i.shape[0] for i in m] # calculate MI based on Equation 2 in Ross 2014 MI = psi(n) - np.mean(psi(Nx)) + psi(k) - np.mean(psi(m)) return MI
35b1295739d9df390980db11b7f03976c5ada3de
3,639,091
def get_new_deals_intent_handler(handler_input): """ Purpose: Handler for getting new deals Args: handler_input (Dict): Input data from the Alexa Skill Return: alexa_reponse (Dict): Reponse for Alexa Skill to handle """ feed = get_slickdeals_feed(SLICKDEALS_URL) deals = get_top_slickdeals(feed) speech_text = "There are {0} deals. The first deal is {1}".format( len(deals), deals[0] ) return ( handler_input.response_builder.speak(speech_text) .set_card(SimpleCard("Slick Deals", speech_text)) .set_should_end_session(True) .response )
7c30af6414a99193d5a7f97f58285b06571c85fa
3,639,092
def analyse_dataset(imgs, lbls, name=None): """Analyse labelled dataset # Arguments: imgs: ndarray, a set of images lbls: ndarray, labels for a set of images """ if name is not None: print('Dataset: {}'.format(name)) unique_lbl, counts = np.unique(lbls, return_counts=True) min_samples = min(counts) max_samples = max(counts) avr_samples = np.mean(counts) std_dev = np.std(counts) imgs_dict = dict() imgs_dict['name'] = name imgs_dict['n_samples'] = imgs.shape[0] imgs_dict['samples_shape'] = imgs.shape[1:] imgs_dict['n_unique_labels'] = len(counts) imgs_dict['unique_labels'] = unique_lbl imgs_dict['min_samples'] = min_samples imgs_dict['max_samples'] = max_samples imgs_dict['average_samples'] = round(avr_samples, 0) imgs_dict['std_dev'] = round(std_dev, 2) for k, v in imgs_dict.items(): print('{}: {}'.format(k, v)) return imgs_dict
a6eabfab49b4bdc8590b64275ee2d0bcd19b9a0b
3,639,094
def transform(doc, *, sort_keys=False): """reorder""" heavy_defs = ["definitions", "schemas", "responses", "parameters", "paths"] r = make_dict() for k, v in doc.items(): if k in heavy_defs: continue r[k] = v for k in heavy_defs: if k in doc: r[k] = doc[k] if sort_keys: r = str_dict(r) # side effect return r
3b939ac3185cdae147709bab1709dd1a39d426c9
3,639,095
from typing import Optional from typing import List def plot_card( box: str, title: str, data: PackedRecord, plot: Plot, events: Optional[List[str]] = None, commands: Optional[List[Command]] = None, ) -> PlotCard: """Create a card displaying a plot. Args: box: A string indicating how to place this component on the page. title: The title for this card. data: Data for this card. plot: The plot to be displayed in this card. events: The events to capture on this card. commands: Contextual menu commands for this component. Returns: A `h2o_wave.types.PlotCard` instance. """ return PlotCard( box, title, data, plot, events, commands, )
fe1816d045bcf59cb28e29c90e517c79df82c621
3,639,096
def get_cluster_id(url): """ Google assign a cluster identifier to a group of web documents that appear to be the same publication in different places on the web. How they do this is a bit of a mystery, but this identifier is important since it uniquely identifies the publication. """ vals = parse_qs(urlparse(url).query).get("cluster", []) if len(vals) == 1: return vals[0] else: vals = parse_qs(urlparse(url).query).get("cites", []) print(vals) if len(vals) == 1: return vals[0] return None
95a5f554560fd219cd07cbd8c8e251e9c8bd4d5e
3,639,097
from typing import List def vol_allocation_factory(covs:List, pres:List=None)->[float]: """ Allocate capital between portfolios using either cov or pre matrices :param covs: List of covariance matrices :param pres: List of precision matrices :return: Capital allocation vector """ if pres is None: pres = [] try: return normalize([ 1/vol_portfolio_variance(cov=cov, pre=pre) for cov, pre in zip_longest(covs, pres, fillvalue=None) ]) except Exception as e: print('vol allocation failed') return diagonal_allocation_factory(covs=covs, pres=pres)
82e707f6d79e0c2b02c5c6f5acb4c6cce130bd4c
3,639,098
import requests def get_inspection_page(**kwargs): """Fetch inspection data.""" url = KING_COUNTY_DOMAIN + DATA_PATH params = INSPECTION_PARAMS.copy() for key, val in kwargs.items(): print(key) if key in INSPECTION_PARAMS: params[key] = val resp = requests.get(url, params=params) resp.raise_for_status() return resp.content, resp.encoding
70c2b95ea6e829f4231c887a59f717a68ede9327
3,639,099
import requests import json def get_table_count(url, table_id): """ Count the number of rowns in a ActivityTable :param url: :param table_id: The ActivityTable ID to update count from and return :return: count : count of rows from ActivityTable """ token = ActivitySites.objects.get(site_id=1) if token.activity_tables_token: headers = {'content-type': 'application/json', 'Authorization': 'Token ' + token.activity_tables_token} else: headers = {'content-type': 'application/json'} print("Token Not Found") response = requests.get(url, headers=headers, verify=True) data = json.loads(response.content) count = None try: count = data['data_count'] ActivityTable.objects.filter(table_id=table_id)\ .update(unique_count=count) except KeyError: pass return count
d7243c202317f0302fb2515f09aa096f0c275619
3,639,100
def get_audio_mfcc_features(txt_files, wav_files, n_input, n_context, word_num_map, txt_labels=None): """ ๆๅ–้Ÿณ้ข‘ๆ•ฐๆฎ็š„MFCC็‰นๅพ :param txt_files: :param wav_files: :param n_input: :param n_context: :param word_num_map: :param txt_labels: :return: """ audio_features = [] audio_features_len = [] text_vector = [] text_vector_len = [] if txt_files != None: txt_labels = txt_files for txt_obj, wav_file in zip(txt_labels, wav_files): # ่ฝฝๅ…ฅ้Ÿณ้ข‘ๆ•ฐๆฎๅนถ่ฝฌๅŒ–ไธบ็‰นๅพๅ€ผ audio_data = audiofile_to_input_vector(wav_file, n_input, n_context) audio_data = audio_data.astype('float32') audio_features.append(audio_data) audio_features_len.append(np.int32(len(audio_data))) # ่ฝฝๅ…ฅ้Ÿณ้ข‘ๅฏนๅบ”็š„ๆ–‡ๆœฌ target = [] if txt_files != None: # txt_objๆ˜ฏๆ–‡ไปถ target = trans_text_ch_to_vector(txt_obj, word_num_map) else: target = trans_text_ch_to_vector(None, word_num_map, txt_obj) # txt_objๆ˜ฏlabels # target = text_to_char_array(target) text_vector.append(target) text_vector_len.append(len(target)) audio_features = np.asarray(audio_features) audio_features_len = np.asarray(audio_features_len) text_vector = np.asarray(text_vector) text_vector_len = np.asarray(text_vector_len) return audio_features, audio_features_len, text_vector, text_vector_len
bed03fb10944d00e27af400776a8efc894770e46
3,639,101
def getOffsetsFromPixelFractions(col, row): """ Determine just the fractional part (the intra-pixel part) of the col,row position. For example, if (col, row) = (123.4, 987.6), then (colFrac, rowFrac) = (.4, .6). Function then returns the offset necessary for addressing the interleaved PRF array. to ensure you get the location appropriate for your sub-pixel values. Inputs ------ col (float) Column position row (float) Row position. Returns ------ (colFrac, rowFrac) (int, int) offset necessary for addressing the interleaved PRF array. """ gridSize = 9 colFrac = np.remainder(float(col), 1) rowFrac = np.remainder(float(row), 1) colOffset = gridSize - np.round(gridSize * colFrac) - 1 rowOffset = gridSize - np.round(gridSize * rowFrac) - 1 return int(colOffset), int(rowOffset)
4f5945f4e3e6e2dd71056b615dc3571f6ece42c6
3,639,102
def all_index(request): """ Inventory Index View """ # build changelist item_changelist = HTSChangeList(request, Item, list_filter=[], search_fields=[], list_per_page=200, model_admin=ItemAdmin(Item, None) ) context_dict = { 'item_changelist': item_changelist, 'page_name': 'Inventory Index' } context_dict.update(INVENTORY_CONTEXT_DEFAULTS) return render(request, 'inventory/inventory_all_index.html', context_dict)
7fdd0b5f278b55767a7918e2977315312e823e93
3,639,103
def calcSeason(ra, time): """Calculate the 'season' in the survey for a series of ra/dec/time values of an observation. Based only on the RA of the point on the sky, it calculates the 'season' based on when this point would be overhead. To convert to an integer season label, take np.floor of the returned float season values. Note that seasons should be calculated for a fixed point on the sky, not for each pointing that overlaps a point on the sky. For example, bad things might happen if you compute the season for observations that overlap RA=0, but were centered on RA=359. Parameters ---------- ra : float The RA (in degrees) of the point on the sky time : np.ndarray The times of the observations, in MJD Returns ------- np.ndarray The season values """ # A reference RA and equinox to anchor ra/season calculation - RA = 0 is overhead at this (local) time. # This time was chosen as it is close to the expected start of the survey. # Generally speaking, this is the equinox (RA=0 is overhead at midnight) Equinox = 60208.00106863426 # convert ra into 'days' dayRA = ra / 360 * 365.25 firstSeasonBegan = Equinox + dayRA - 0.5 * 365.25 seasons = (time - firstSeasonBegan) / 365.25 # Set first season to 0 seasons = seasons - np.floor(np.min(seasons)) return seasons # The value for the equinox above was calculated as follows: #from astropy.time import Time #from astropy.coordinates import EarthLocation #loc = EarthLocation.of_site('Cerro Pachon') #t = Time('2023-09-21T00:01:32.33', format='isot', scale='utc', location=loc) #print(t.sidereal_time('apparent') - loc.lon, t.utc.mjd)
1309a302fac9d01d7b5567d5722bf8f04dc9b88e
3,639,104
def set_node_event_info(info: NodeEventInfo) -> Item: """Encaches an item. :param info: Node event information. :returns: Item to be cached. """ if info.event_type in ( EventType.MONIT_CONSENSUS_FINALITY_SIGNATURE, EventType.MONIT_BLOCK_FINALIZED, EventType.MONIT_BLOCK_ADDED, ): names = [ info.block_hash, ] elif info.event_type == EventType.MONIT_DEPLOY_PROCESSED: names = [ info.block_hash, info.deploy_hash, ] else: names=[] return Item( item_key=ItemKey( paths=[ info.network, COL_EVENT, info.event_type.name[6:], ], names=names, ), data=info, expiration=EXPIRATION_COL_EVENT )
9ee50e73b1c50172ada1b6040b675cbda5aede44
3,639,105
def check_hashtarget(bible_hash, target): """ tests if the biblepay hash is valid for the hashtarget, means that is it lower. True = is lower and all is fine """ rs = False try: rs = int(bible_hash, 16) < int(target, 16) except: pass return rs
a0041d8834b2a0af0a08c2562ffed599925ed5a8
3,639,106
def assert_and_infer_cfg_fl(cfg_fl, args, make_immutable=True, train_mode=True): """ Calls /semantic-segmentation/config.assert_and_infer_cfg and adds additional assertions """ if args.manual_client_setup: cfg_fl.CLIENT.MANUAL = args.manual_client_setup if cfg_fl.CLIENT.MANUAL: print('-------------------------') print('> Clients manual settings') print('-------------------------') for i in cfg_fl.CLIENT.POPULATION: print(i) if args.replicate: cfg_fl.REPLICATE = args.replicate if args.seed: cfg_fl.SEED = args.seed cfg_fl.TORCH_SEED = args.seed if args.task: cfg_fl.TASK = args.task if args.dataset: cfg_fl.DATASET.DATASET_NAME = args.dataset if args.clients_per_dist: cfg_fl.FEDERATION.CLIENTS_PER_DIST = args.clients_per_dist if cfg_fl.FEDERATION.CLIENTS_PER_DIST is not None and cfg_fl.FEDERATION.NUM_CLIENTS is None: cfg_fl.FEDERATION.NUM_CLIENTS = cfg_fl.FEDERATION.CLIENTS_PER_DIST * cfg_fl.FEDERATION.NUM_DISTRIBUTIONS if args.num_clients: cfg_fl.FEDERATION.NUM_CLIENTS = args.num_clients if args.print_logx: cfg_fl.LOGX_STDOUT = True if args.num_distributions: cfg_fl.FEDERATION.NUM_DISTRIBUTIONS = args.num_distributions assertion_num_clients = "Either 'clients_per_dist' or 'num_clients' needs to be specified" assert cfg_fl.FEDERATION.CLIENTS_PER_DIST or cfg_fl.FEDERATION.NUM_CLIENTS, assertion_num_clients # if args.dist_type: # cfg.FEDERATION.DIST_TYPE = args.dist_type if args.clustering_method: cfg.FEDERATION.CLUSTERING_METHOD = args.clustering_method if args.federation_method: assert args.federation_method in ['fomo', 'embeddings', 'local', 'fedavg'] cfg_fl.FEDERATION.METHOD = args.federation_method if args.federation_method == 'fedavg': cfg_fl.FEDERATION.FED_AVERAGING = True if args.random_distributions: cfg_fl.FEDERATION.RANDOM_DISTS = args.random_distributions # True if args.federated_averaging: cfg_fl.FEDERATION.FED_AVERAGING = True cfg_fl.FEDERATION.METHOD = 'fedavg' if args.local_train_val_size: cfg_fl.FEDERATION.LOCAL_TRAIN_VAL_SIZE = args.local_train_val_size if args.federation_epoch: cfg_fl.FEDERATION.EPOCH = args.federation_epoch if args.num_update_clients: cfg_fl.CLIENT_WEIGHT.NUM_UPDATE_CLIENTS = args.num_update_clients if args.model_weight_delta: cfg_fl.CLIENT_WEIGHT.WEIGHT_DELTA = args.model_weight_delta if args.explicit_weight_delta: cfg_fl.CLIENT_WEIGHT.WEIGHT_DELTA = args.explicit_weight_delta cfg_fl.CLIENT_WEIGHT.LEAVE_ONE_OUT = False if args.client_weight_epsilon: cfg_fl.CLIENT_WEIGHT.EPSILON = args.client_weight_epsilon if args.client_weight_epsilon_decay: cfg_fl.CLIENT_WEIGHT.EPSILON_DECAY = args.client_weight_epsilon_decay if args.client_weight_method: cfg_fl.CLIENT_WEIGHT.METHOD = args.client_weight_method if args.update_positive_delta_only: cfg_fl.MODEL_WEIGHT.UPDATE_POSITIVE_ONLY = args.update_positive_delta_only if args.leave_one_out: cfg_fl.CLIENT_WEIGHT.LEAVE_ONE_OUT = args.leave_one_out if args.baseline_model: cfg_fl.CLIENT_WEIGHT.BASELINE = args.baseline_model if args.train_split: cfg_fl.CLIENT.TRAIN_SPLIT = args.train_split cfg_fl.CLIENT.VAL_SPLIT = 1 - args.train_split if args.dataset == 'cifar100': args.num_classes = 100 elif args.dataset == 'cifar10': args.num_classes = 10 elif args.dataset == 'mnist': args.num_classes = 10 return cfg_fl
b779e0a5f06d06b9ebc542f3cd7c190efb70bca5
3,639,107
def replace_service(name, metadata, spec, source, template, old_service, saltenv, namespace="default", **kwargs): """ Replaces an existing service with a new one defined by name and namespace, having the specificed metadata and spec. """ body = __create_object_body( kind="Service", obj_class=kubernetes.client.V1Service, spec_creator=__dict_to_service_spec, name=name, namespace=namespace, metadata=metadata, spec=spec, source=source, template=template, saltenv=saltenv, ) # Some attributes have to be preserved # otherwise exceptions will be thrown body.spec.cluster_ip = old_service["spec"]["cluster_ip"] body.metadata.resource_version = old_service["metadata"][ "resource_version"] cfg = _setup_conn(**kwargs) try: api_instance = kubernetes.client.CoreV1Api() api_response = api_instance.replace_namespaced_service( name, namespace, body) return api_response.to_dict() except (ApiException, HTTPError) as exc: if isinstance(exc, ApiException) and exc.status == 404: return None else: log.exception("Exception when calling " "CoreV1Api->replace_namespaced_service") raise CommandExecutionError(exc) finally: _cleanup(**cfg)
e363ed9d9233ff6455963edba5bfa8109f6c7260
3,639,108
from typing import Optional from typing import Dict from typing import Any from typing import List from datetime import datetime import logging def timesketch_add_manual_event( data: Text, timestamp: Optional[int] = 0, date_string: Optional[Text] = '', timestamp_desc: Optional[Text] = '', attributes: Optional[Dict[str, Any]] = None, tags: Optional[List[str]] = None) -> Dict[str, str]: """Add a manually generated event to the sketch. Args: data (str): The message string for for the event to be generated. timestamp (int): Optional timestamp in either seconds since Epoch or microseconds since Epoch. date_string (str): An optional date time as a human readable string. If neither date_string nor timestamp is provided then the current timestamp will be used as the time of the event. timestamp_desc (str): Optional timestamp description field. attributes (dict): Optional dict which contains extra attributes to add to the manual event. tags (list): Optional list of tags to add to the manual event. Returns: Dictionary with query results. """ connect() state_obj = state.state() sketch = state_obj.get_from_cache('timesketch_sketch') if not sketch: print('Not able to connect to a sketch.') return {} # Default timestamp. date_obj = datetime.datetime.now(datetime.timezone.utc) date = date_obj.isoformat() if timestamp: try: date_obj = datetime.datetime.fromtimestamp( timestamp, datetime.timezone.utc) except ValueError: date_obj = datetime.datetime.fromtimestamp( timestamp / 1e6, datetime.timezone.utc) date = date_obj.isoformat() elif date_string: elements = time_elements.TimeElements() if 'T' in date_string: try: elements.CopyFromStringISO8601(date_string) except ValueError: logging.error( 'Unable to convert date string, is it really in ISO 8601 format?') return {} try: elements.CopyFromString(date_string) except ValueError: try: elements.CopyFromStringRFC1123(date_string) except ValueError: logging.error( 'Unable to convert date string, needs to be in ISO 8601, 1123 or ' 'in the format YYYY-MM-DD hh:mm:ss.######[+-]##:##') return {} date = elements.CopyToDateTimeStringISO8601() if not timestamp_desc: timestamp_desc = 'Event Logged' if not isinstance(tags, (tuple, list)): tags = [] if not isinstance(attributes, dict): attributes = {} if not date: logging.error('Unable to convert date string, please check it.') return {} return sketch.add_event( data, date, timestamp_desc, attributes=attributes, tags=tags)
c84f04bbd3a9344c5797e6d79be141b05f6edae0
3,639,109
def filter_vcf_by_sex(vcf_file, data): """Post-filter a single sample VCF, handling sex chromosomes. Handles sex chromosomes and mitochondrial. Does not try to resolve called hets into potential homozygotes when converting diploid to haploid. Skips filtering on pooled samples, we still need to implement. """ if len(vcfutils.get_samples(vcf_file)) > 1: return vcf_file _, sexes = _configured_ploidy_sex([data]) sex = sexes.pop() out_file = "%s-ploidyfix%s" % utils.splitext_plus(vcf_file) if not utils.file_exists(out_file): orig_out_file = out_file out_file = orig_out_file.replace(".vcf.gz", ".vcf") with file_transaction(out_file) as tx_out_file: with open(tx_out_file, "w") as out_handle: with utils.open_gzipsafe(vcf_file) as in_handle: for line in in_handle: if line.startswith("#"): out_handle.write(line) else: line = _fix_line_ploidy(line, sex) if line: out_handle.write(line) if orig_out_file.endswith(".gz"): out_file = vcfutils.bgzip_and_index(out_file, data["config"]) return out_file
6eb6528ce4deb86b8c8ecd8746143cb0f6c82fde
3,639,110
def gen_spacer(spacer_char="-", nl=2): """ Returns a spacer string with 60 of designated character, "-" is default It will generate two lines of 60 characters """ spacer = "" for i in range(nl): spacer += spacer_char * 60 spacer += "\n" return spacer
7434f191dafdf500c2fc3e67373afc664e543ce0
3,639,111
def repo_config_factory(repo_type, repo_id, repo_label, **kwargs): """ Constructs a repository configuration in form of a TTL structure utilizing the TTL templates from ./repo_types_template. """ # Check if the repo_type is a known template if repo_type not in REPO_TYPES: raise RepositoryTypeUnknown # Get the path to the template template_path = TEMPLATE_FOLDER / '{}{}'.format(repo_type, '.ttl') # Open the template file and read it with open(template_path) as template_file: template = template_file.read() # get the default values for the template params = DEFAULTS # Overwrite them with the given kwargs params.update(kwargs) # Fill the params in the template ttl = template.format(repo_id=repo_id.replace('-', '_'), repo_label=repo_label, **params) # return the final TTL return ttl
3840d698691f226d56d25233c3fc00db23abd5d9
3,639,112
def oil_isothermal_density(rho: NDArrayOrFloat, p: NDArrayOrFloat) -> NDArrayOrFloat: """Calculates the oil density for a given pressure at 15.6 degC B&W 1992 Equation 18 Args: rho: The oil reference density (g/cc) at 15.6 degC can be compensated for disovled gases by running `oil_rho_sat` first. p: Pressure (MPa) Returns: The oil density (g/cc) at pressure p """ return ( rho + (0.00277 * p - 1.71e-7 * np.power(p, 3)) * np.power(rho - 1.15, 2) + 3.49e-4 * p )
f8184f4820b5a19525b47f357b92ea7059e2bd74
3,639,113
def get_waveform_dataset(path): """Loads the waveform dataset from a given path. Args: path: The path to the .npz file containing the waveform data set. Returns: An array of waveform chunks loaded from the given path. """ dataset = np.load(path)['arr_0'] return dataset
3d8e13cddd7abdb3bc459b68761e4a6385208c77
3,639,114
def untranslate_module_name(module): """Rename module names mention in JSON to names that we can import This reverses the translation applied by translate_module_name() to a module name available to the current version of Python. """ if PY3: # remap `__builtin__` and `exceptions` to the `builtins` module if module == '__builtin__': module = 'builtins' elif module == 'exceptions': module = 'builtins' return module
fae87c9fb852ff1b6b82e4ebccf9c058fb4a313f
3,639,117
def RGBRamp(size=256, upperValue=.6666666666666667): """Generate an RGB color ramp, values range from 0.0 to 1.0""" assert size > 0 hsv = HSVRamp(size, upperValue) rgb = Numeric.zeros( (hsv.shape[0], 3), viewerConst.FPRECISION ) for i in xrange(hsv.shape[0]): rgb[i] = ToRGB(hsv[i]) return rgb
10be72b654ac9e36610bc4c08fd05edbba45de8a
3,639,118
def find_poly_ras_intersect(shape, raster_dir, extension='.tif'): """ Finds all the tiles falling within raster object the get shape geometry should be seperated from the intesect check, currently causes a exit code 139 on unix box :param polygon: :param extension: :param raster_dir: """ print 'starting shape: {}'.format(shape) # get vector geometry if not os.path.isfile(shape): raise NotImplementedError('Shapefile not found') polygon = ogr.Open(shape) layer = polygon.GetLayer() feature = layer.GetFeature(0) vector_geo = feature.GetGeometryRef() # print 'vector geometry: {}'.format(vector_geo) tiles = [os.path.join(raster_dir, x) for x in os.listdir(os.path.join(raster_dir)) if x.endswith(extension)] raster_list = [] for tile in tiles: print tile, srt.tif_proj4_spatial_reference(tile) if srt.check_same_reference_system(shape, tile): raster_geo = get_polygon_from_raster(tile) if raster_geo.Intersect(vector_geo): print 'tile: {} intersects {}'.format(os.path.basename(tile), os.path.basename(shape)) raster_list.append(tile) return raster_list
8f7ae23a2c442ff5b61bde46d8b42ac4c2c8eade
3,639,119
from typing import Iterable import requests def Session( retries: int = 10, backoff_factor: float = 0.3, allowed_methods: Iterable[str] = ('HEAD', 'TRACE', 'GET', 'POST', 'PUT', 'OPTIONS', 'DELETE'), status_forcelist: Iterable[int] = (408, 429, 500, 502, 503, 504), ) -> requests.Session: """Return a Session object with full retry capabilities. Args: retries (int): number of retries backoff_factor (float): speed factor for retries (in seconds) allowed_methods (iterable): http methods to retry on status_forcelist (iterable): http status codes to retry on Returns: :py:class:`requests.Session`: session object """ session = requests.Session() retry = Retry( total=retries, connect=retries, read=retries, redirect=retries, # status=retries, allowed_methods=allowed_methods, status_forcelist=status_forcelist, backoff_factor=backoff_factor, ) adapter = HTTPAdapter(max_retries=retry) session.mount('http://', adapter) session.mount('https://', adapter) return session
ca7d5f4d3f34e24c67eae47c01a6bd63796b03be
3,639,120
def tp53(): """Create a TP53 gene fixture.""" params = { 'label': 'tumor protein p53', 'concept_id': 'hgnc:11998', 'symbol': 'TP53', 'location_annotations': [], 'strand': None, 'locations': [ { '_id': 'ga4gh:VCL._Cl_XG2bfBUVG6uwi-jHtCHavOAyfPXN', 'chr': '17', 'interval': { 'end': 'p13.1', 'start': 'p13.1', 'type': 'CytobandInterval' }, 'species_id': 'taxonomy:9606', 'type': 'ChromosomeLocation' } ], 'previous_symbols': [], 'aliases': [ 'p53', 'LFS1' ], 'symbol_status': 'approved', 'associated_with': [ 'vega:OTTHUMG00000162125', 'refseq:NM_000546', 'cosmic:TP53', 'omim:191170', 'ucsc:uc060aur.1', 'uniprot:P04637', 'orphanet:120204', 'ccds:CCDS73968', 'ccds:CCDS73971', 'ccds:CCDS73970', 'ccds:CCDS73969', 'ccds:CCDS73967', 'ccds:CCDS73966', 'ccds:CCDS73965', 'ccds:CCDS73964', 'ccds:CCDS73963', 'ccds:CCDS11118', 'ccds:CCDS45605', 'ccds:CCDS45606', 'ena.embl:AF307851', 'pubmed:6396087', 'pubmed:3456488', 'pubmed:2047879' ], 'xrefs': [ 'ensembl:ENSG00000141510', 'ncbigene:7157' ] } return Gene(**params)
d1c41af9dce6b5eee3aa475c207a669529001b7d
3,639,121
def factorOrder(factors, varOrder): """Return an order of factors for sampling given a variable order for sampling""" pri = [0 for x in varOrder] for i,x in enumerate(varOrder): # first, find position of each var in sampling order pri[x]=i factorOrder = [ Factor() for x in varOrder ] # fill order with blanks initially for f in factors: f_pri = max([pri[x] for x in f.vars]) # get last-sampled variable for this factor if factorOrder[f_pri].nvar == 0: factorOrder[f_pri] = f # if first factor for this variable, save it else: # o.w. take one with the lowest conditional entropy: if ent[f_pri] < 0: # (compute previous' if necessary) ent[f_pri] = factorOrder[f_pri].entropy() - factorOrder[f_pri].sum([f_pri]).entropy() ent_new = f.entropy() - f.sum([f_pri]).entropy() # (and this factor's) if ent_new < ent[f_pri]: # (keep whichever is lower) factorOrder[f_pri] = f ent[f_pri] = ent_new return factorOrder
98ec337ab126d77b854be28f937eef392b9c8144
3,639,122
def home(request): """ rendering ui by template for homepage this view never cache for delivering correct translation inside template """ template = loader.get_template('weather/home.html') return HttpResponse(template.render({}, request))
b2fdf6facd633441da9d11a53a781e9e418b42de
3,639,124
def plot_histogram(df, path, col_x, ax=None, size=None, save=True, suffix=None, show=False, **kwargs): """Geneate a histogram plot. Args: df (:class:`pandas.DataFrame`): Data frame to plot. path (str): Path to data frame to use if ``df`` is None, also used as the basis for output path. col_x (str): Name of column with values to plot. ax (:class:`matplotlib.axes.Axes`): Matplotlib axes; defaults to None to generate a new figure with axes. size (Sequence[float]): Sequence of ``width, height`` to size the figure; defaults to None. save (bool): True to save the plot; defaults to True. suffix: String to append to output path before extension; defaults to None to ignore. show: True to display the image; otherwise, the figure will only be saved to file, if :attr:``config.savefig`` is set. Defaults to True. kwargs (Any): Extra arguments to :meth:`decorate_plot`. Returns: :class:`matplotlib.axes.Axes`: Matplotlib axes. """ # load data frame from CSV unless already given and set up figure if df is None: df = pd.read_csv(path) if ax is None: fig, gs = plot_support.setup_fig(1, 1, size) ax = plt.subplot(gs[0, 0]) # generate histogram n, bins, patches = ax.hist(df[col_x]) decorate_plot(ax, **kwargs) # save and display plot if indicated if save: out_path = libmag.make_out_path(path, suffix=suffix) plot_support.save_fig(out_path, config.savefig) if show: plt.show() return ax
ec97358a9b7f8c3d20dd7a15d77b588fc2bffbe0
3,639,125
def __check_interface_state(duthost, interface, state='up'): """ Check interface status Args: duthost: DUT host object interface: Interface of DUT state: state of DUT's interface Returns: Bool value which confirm port state """ ports_down = duthost.interface_facts(up_ports=[interface])['ansible_facts']['ansible_interface_link_down_ports'] if 'down' in state: return interface in ports_down return interface not in ports_down
bc17d489064e9a81ec77dad5ab3682c9a96fa88d
3,639,126
def find_dateTime_in_html(text): """ find dateTime in html """ r = findall('<time dateTime="(.*?)">', text) if r: return r return []
0ba36b69a52f421e303da4c10b70362d6d724c96
3,639,127
import torch def get_number_of_voxels_per_class(labels: torch.Tensor) -> torch.Tensor: """ Computes the number of voxels for each class in a one-hot label map. :param labels: one-hot label map in shape Batches x Classes x Z x Y x X or Classes x Z x Y x X :return: A tensor of shape [Batches x Classes] containing the number of non-zero voxels along Z, Y, X """ if not len(labels.shape) in [5, 4]: raise Exception("labels must have either 4 (Classes x Z x Y x X) " "or 5 dimensions (Batches x Classes x Z x Y x X), found:{}" .format(len(labels.shape))) if len(labels.shape) == 4: labels = labels[None, ...] return torch.count_nonzero(labels, dim=(2, 3, 4))
568a91639a42cf3cd3debe365c5a963512d95dfc
3,639,128
def get_columns_width(user_width): """define width of the report columns""" default_width = [30, 7, 60] if not user_width: return default_width try: return [7 if user_width[i] < 7 else user_width[i] for i in range(3)] except (TypeError, IndexError): _LOGGER.error( "Invalid configuration for table column widths, default values" " used %s", default_width, ) return default_width
96901c79ac7ba2cf6d5dc56fe26d63e81a2437d4
3,639,129
def tx_failure(): """ Failed ```tx```. """ message = request.args.get('m') protocol = request.args.get('p') address = request.args.get('a') command = request.args.get('c') repeats = request.args.get('r') bits = request.args.get('b') response = make_response( render_template( "tx.html", success=False, message=message, protocol=protocol, address=address, command=command, repeats=repeats, bits=bits ) ) response.headers.set('Irbox-Success', 'false') return response
f5938cf59207125030502113ce3b541301279b98
3,639,130
import pydoc def read_docstring(object_): """ Returns object docstring without the FILE information. """ fmt = "```\n{}\n```\n" docs = pydoc.plain(pydoc.render_doc(object_)).split("FILE")[0].rstrip() return fmt.format(docs)
5c21f6eadf400ac9316e3f44d98464536b9b7536
3,639,131
def _bernoulli_spiral(theta, theta_offset=0., *args, **kwargs): """Return Equiangular (Bernoulli's) spiral Args: theta: array-like, angles from polar coordinates to be converted theta_offset: float, angle offset in radians (2*pi = 0) Kwargs: exp_scale: growth rate of the exponential """ exp_scale = kwargs.pop('exp_scale', 0.1) x, y = np.exp(exp_scale * theta) * np.cos(theta + theta_offset), np.exp( exp_scale * theta) * np.sin(theta + theta_offset) x_norm = np.max(np.abs(x)) y_norm = np.max(np.abs(y)) x, y = x / x_norm, y / y_norm return x, y
3e889bc61ab8e93daefc2feeaad40ae86c167627
3,639,132
import httpx import copy def _redacted_to_curl(request: httpx.Request) -> str: """Pass through to curlify2.to_curl that redacts the authorization in the headers """ if (auth_header := request.headers.get('authorization')) is None: return curlify2.to_curl(request) req_copy = copy.copy(request) req_copy.headers = copy.deepcopy(request.headers) if "Bearer" in auth_header: req_copy.headers['authorization'] = "Bearer [REDACTED]" else: req_copy.headers['authorization'] = "[REDACTED]" return curlify2.to_curl(req_copy)
e3a713c3fcf6c875af4cae6ab4c5e696eb0bd432
3,639,133
def parse_scales_line(line): """ Args: - line: Returns: - scales_dict """ def advance_past_token(str, token): return str[str.find(token) + len(token):] scales_dict = {} line = advance_past_token(line, 'Scales:') pair_str = line.split(',') for pair_str in pair_str: dname, scale = pair_str.split(':') scales_dict[dname.strip()] = float(scale) return scales_dict
b16e1f431b878aa6418beaed3f141fe928a229e1
3,639,135
import collections def parse_remove_configuration(configuration): """ Turns the configuration line of splitting into a name and a set of params. """ if configuration is None: return "None", None print('conf', configuration) conf_dict = collections.OrderedDict(configuration) name = 'remove' for key in conf_dict.keys(): if key != 'weights' and key != 'boost': name += '_' name += key return name, conf_dict
40bf749c2e142cef534f945179b987fd3c7ba6d8
3,639,136
def _calc_cost_grad_first(data_input, w, label, features): """Calculate the partial cost and gradient.""" train_data = read_stage_file(data_input, features + [label]) size_train = train_data.shape[0] labels = train_data[label].values train_data = train_data[features].values if size_train > 0: dim = train_data.shape[1] if dim != len(w): w = np.zeros(dim, dtype=float) # initial prediction = (labels * np.dot(train_data, w)) # hinge loss (select negative values) idx = np.nonzero((prediction - 1) < 0) loss = np.sum(1 - prediction[idx]) # -y * x for all values lesser than 1 grad = - np.dot(labels[idx], train_data[idx]) return [loss, grad, size_train], [labels, train_data] else: return [0, 0, size_train], [labels, train_data]
d7b62ac39f824f7598cc83a078bc0f5e4e49c4ea
3,639,137
def subtract_dbm(dbm1: float, dbm2: float): """Adds two decibel values""" watt1 = dbm_to_watt(dbm1) watt2 = dbm_to_watt(dbm2) return watt_to_dbm(watt1 - watt2)
ea7c6f9372182a6a39d72265428e86b26b4da765
3,639,138
def focused_evaluate(board): """ Given a board, return a numeric rating of how good that board is for the current player. A return value >= 1000 means that the current player has won; a return value <= -1000 means that the current player has lost """ score = board.longest_chain(board.get_current_player_id()) * 10 # Prefer having your pieces in the center of the board. for row in range(6): for col in range(7): if board.get_cell(row, col) == board.get_current_player_id(): score -= abs(3-col) elif board.get_cell(row, col) == board.get_other_player_id(): score += abs(3-col) if board.is_game_over(): if int(board.is_win()) == int(board.get_current_player_id()): score = +1000; score -= board.num_tokens_on_board() elif int(board.is_win()) == int(board.get_other_player_id()): score = -1000 return score
b2cbb91cdb048ef41a13532e400173daa05af4b8
3,639,140
def tanh(x, name=None): """ sparse tanh activation, requiring x to be a sparse coo or sparse csr tensor. .. math:: out = tanh(x) Parameters: x (Tensor): The input Sparse Tensor with data type float32, float64. name (str, optional): Name for the operation (optional, default is None). For more information, please refer to :ref:`api_guide_Name`. Returns: A Sparse Tensor with the same data type and shape as ``x`` . Examples: .. code-block:: python import paddle from paddle.fluid.framework import _test_eager_guard with _test_eager_guard(): dense_x = paddle.to_tensor([-2, 0, 1], dtype='float32') sparse_x = dense_x.to_sparse_coo(1) out = paddle.sparse.tanh(sparse_x) """ assert in_dynamic_mode(), "Currently, Sparse API only support dynamic mode" if x.is_sparse_coo(): return _C_ops.final_state_sparse_coo_tanh(x) elif x.is_sparse_csr(): return _C_ops.final_state_sparse_csr_tanh(x) else: raise ValueError( "Currently, sparse.tanh only support the input of SparseCooTensor or SparseCsrTensor" )
24bf0889c2e1ba642442e0d8f6b11eeeaf94bf6c
3,639,141
def collector(monkeypatch): """ Unit test: base case """ col = SunPowerPVSupervisorCollector(use_device_data_timestamp=False) attrs = [ 'connect', 'disconnect', 'info_metrics', ] mocked = MagicMock() mocked.connect.return_value = [] mocked.disconnect.return_value = [] mocked.info_metrics.return_value = [] for attr in attrs: monkeypatch.setattr(col, attr, getattr(mocked, attr)) return col
f9e99071b2dde231b4a3fc7c89e00846d26efb12
3,639,143