Unnamed: 0
int64
0
15.9k
cleaned_code
stringlengths
67
124k
cleaned_prompt
stringlengths
168
30.3k
5,200
<ASSISTANT_TASK:> Python Code: # define the font styles title_font = fm.FontProperties(family='serif', style='normal', size=19, weight='normal', stretch='normal') label_font = fm.FontProperties(family='serif', style='normal', size=16, weight='normal', stretch='normal') ticks_font = fm.FontProperties(family='serif', style='normal', size=10, weight='normal', stretch='normal') annotation_font = fm.FontProperties(family='serif', style='normal', size=10, weight='normal', stretch='normal') axis_bgcolor = 'white' # make a re-usable function to draw nice bar charts def plot_hist(data, title='', xlabel='Test Statistic Values', ylabel='Frequency', color='red'): if type(data) == list: data = pd.Series(data) ax = data.hist(figsize=[9, 6], width=0.35, alpha=0.5, color=color, edgecolor='k', grid=False, rwidth=.9) ax.set_xticklabels(data.index, rotation=45, rotation_mode='anchor', ha='right') ax.yaxis.grid(True) #for label in ax.get_yticklabels(): # label.set_fontproperties(ticks_font) ax.spines['top'].set_visible(False) ax.spines['right'].set_visible(False) ax.grid(False) ax.set_facecolor(axis_bgcolor) ax.set_title(title, fontproperties=title_font) ax.set_xlabel(xlabel, fontproperties=label_font) ax.set_ylabel(ylabel, fontproperties=label_font) plt.show() ax2 = fig.add_subplot(2,1,2) ax2.hist(dem_electoral, 22, alpha=0.7, label='Democrat',rwidth=.9, color='#0099ff') ax2.axvline(x=269, c='k', linewidth=7) ax2.set_title("Histogram of Electoral Votes: Democrats", fontsize=20, **hfont) ax2.grid(False) ax2.set_xlabel('Number of Electoral Votes', fontsize=15) ax2.set_ylabel('Frequency', fontsize=14) ax2.spines['top'].set_visible(False) ax2.spines['right'].set_visible(False) ax2.set_xlim(200,335) def diff_means3(data, response, treatment): trt1 = data[treatment].cat.categories[0] trt2 = data[treatment].cat.categories[1] mean_diff = data[response][data[treatment]==trt1].mean() - data[response][data[treatment]==trt2].mean() return mean_diff class PermTest(object): def __init__(self, data): self.data = data self.formatted_data = None def format_data(self, response1=None, response2=None): Converts data from a 2-column format (where each column refers to a treatment type) to a 2-column format where response is one column, treatment is the other. This is done for both efficiency of storage and test runtime. :param data: pandas DataFrame. each column must be of same length :return: pandas DataFrame in response, treatment format # create new treatment Series if (response1==None) and (response2==None): # No columns specified, so default to first 2 nrow, ncol = self.data.iloc[:,[0,1]].shape treatment_column = pd.Series([self.data.iloc[:,[0,1]].columns.values[i] for i in range(ncol) for j in range(nrow)], dtype='category') response_column = pd.concat([self.data.iloc[:,0], self.data.iloc[:,1]]).tolist() else: nrow, ncol = self.data.loc[:,[response1,response2]].shape treatment_column = pd.Series([self.data.loc[:,[response1,response2]].columns.values[i] for i in range(ncol) for j in range(nrow)], dtype='category') response_column = pd.concat([self.data.loc[:,response1], self.data.loc[:,response2]]).tolist() self.formatted_data = pd.DataFrame({"response": response_column, "treatment": treatment_column}) def diff_means(self, response="response", treatment="treatment", data=None): if data is None: trt1 = self.formatted_data[treatment].cat.categories[0] trt2 = self.formatted_data[treatment].cat.categories[1] mean_diff = self.formatted_data[response][self.formatted_data[treatment]==trt1].mean() \ - self.formatted_data[response][self.formatted_data[treatment]==trt2].mean() return mean_diff else: trt1 = data[treatment].cat.categories[0] trt2 = data[treatment].cat.categories[1] mean_diff = data[response][data[treatment]==trt1].mean() \ - data[response][data[treatment]==trt2].mean() return mean_diff def simPermDsn(self, response="response", treatment="treatment", test="mean", k=100): Creates permutation dsn for our data :param data: :param hasTrt: :param testStat: :param k: :return: df = self.formatted_data[:] testStatistics = [] if test == "mean": for simulation in range(k): df[treatment] = pd.Series(np.random.permutation(self.formatted_data[treatment]), dtype='category') testStatistics.append(self.diff_means(response=response, treatment=treatment, data=df)) return testStatistics def pvalue(self, response="response", treatment="treatment", test="mean", k=100): Returns p-value for test if test == "mean": current_stat = self.diff_means(response=response, treatment=treatment) simulated_stats = self.simPermDsn(response=response, treatment=treatment, test=test, k=k) simulated_stats = np.array(simulated_stats) p_value = 1.0 * sum(abs(simulated_stats) >= abs(current_stat))/k return p_value def plot_dsn(self, response="response", treatment="treatment", test="mean", k=100): Plots distribution of test statistics simulated_stats = self.simPermDsn(response=response, treatment=treatment, test=test, k=k) tit = "Permutated Test Statistic Distribution for k={} Simulations".format(k) plot_hist(simulated_stats, title=tit, xlabel="Test Statistic Value", ylabel="Frequency") data = pd.DataFrame({"treatment1":[1.5, 2, 5, 0.5, 4, 6.6, 4.5, 3, 4, 2.5], "treatment2":[1, 5, 4, 3, 5, 6, 4, 3, 4.5, 3.2]}) data pt = PermTest(data) pt.format_data() pt.formatted_data print(pt.diff_means('response', 'treatment', data=None)) testsimdata = pt.simPermDsn(k=1000) pt.plot_dsn(k=1000) pt.test() chi_squared_values = [] for i in range(100): nums = np.random.random((32561,)) ex = 32561/2 nums[nums < 0.5] = 0 nums[nums >= 0.5] = 1 male = sum(nums==0) female = 32561-male male_diff = (male - ex)**2 / ex female_diff = (female - ex)**2 / ex chi_squared_values.append(male_diff + female_diff) plt.hist(chi_squared_values) plt.show() # return error if unequal lengths def chi_squared_statistic(o,e): o = np.array(o) e = np.array(e) return np.sum(1.0*(o - e)**2 / e) class ChiSquaredTest(): def __init__(self, observed=None, expected=None): self.observed = observed self.expected = expected def plot_dsn(self, k=100): simulated_stats = self.simPermDsn(k=k) tit = "Chi-Squared Test Statistic Distribution for k={} Simulations".format(k) plot_hist(simulated_stats, title=tit, xlabel="Test Statistic Value", ylabel="Frequency") def testStat(self, input_observed=None, input_expected=None): if input_observed or input_expected: chisq_teststat = chi_squared_statistic(input_observed, input_expected) else: chisq_teststat = chi_squared_statistic(self.observed, self.expected) return chisq_teststat def simPermDsn(self, input_observed=None, input_expected=None, k=100): if input_observed or input_expected: test_stat = self.testStat(input_observed, input_expected) n = len(input_observed) else: test_stat = self.testStat() n = len(self.observed) # create sampling distribution chisqrd_vals = [] for i in range(k): values = np.random.random((n,)) ex = 1.0*n/2 values[values<.5]=0 values[values>=.5]=1 diff1 = chi_squared_statistic(sum(values==0),ex) diff2 = chi_squared_statistic(sum(values==1),ex) chisqrd_vals.append(diff1+diff2) return chisqrd_vals def pvalue(self, input_observed=None, input_expected=None): current_stat = self.testStat(input_observed, input_expected) simulated_stats = self.simPermDsn(input_observed, input_expected) # p-value = proportion of test stats greater than ours p_value = 1.0*sum(simulated_stats >= current_stat) / len(simulated_stats) return p_value obs = [26816, 3624, 1039, 311, 771] ex = [26146.5, 3939.9, 1044.3, 310.5, 1119.8] print(sum(obs)) print(sum(ex)) obs1 = [1,2,3,4,5] ex1 = [1,2,2,4,5] chisq = ChiSquaredTest(obs, ex) chisq.pvalue(obs1,ex1) chisq.plot_dsn(k=250) z=None # To Implement # Levene's Test for Unequal Variances # Mann-Whitney Test http://www.stat.wisc.edu/~st571-1/Fall2005/lec18-21.1.pdf # t-test # ANOVA http://www.marsja.se/four-ways-to-conduct-one-way-anovas-using-python/ z==None <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Now our data is formatted in the format we want. Step8: Permutation Test Step9: Create data Step10: Create PermTest instance and formate data Step11: Calculate difference of means Step12: Create simulated distribution of test statistics (differences of means) Step13: Visualize simulated distribution Step14: Obtain p-value for test Step16: Chi Squared Test Step17: Create data Step18: Create instance of ChiSquaredTest Step19: Get pvalue Step20: View bootstrapped distribution
5,201
<ASSISTANT_TASK:> Python Code: # Authors: Christopher Holdgraf <choldgraf@berkeley.edu> # # License: BSD (3-clause) from scipy.io import loadmat import numpy as np from mayavi import mlab from matplotlib import pyplot as plt from os import path as op import mne from mne.viz import ClickableImage # noqa from mne.viz import plot_alignment, snapshot_brain_montage print(__doc__) subjects_dir = mne.datasets.sample.data_path() + '/subjects' path_data = mne.datasets.misc.data_path() + '/ecog/sample_ecog.mat' # We've already clicked and exported layout_path = op.join(op.dirname(mne.__file__), 'data', 'image') layout_name = 'custom_layout.lout' mat = loadmat(path_data) ch_names = mat['ch_names'].tolist() elec = mat['elec'] dig_ch_pos = dict(zip(ch_names, elec)) mon = mne.channels.DigMontage(dig_ch_pos=dig_ch_pos) info = mne.create_info(ch_names, 1000., 'ecog', montage=mon) print('Created %s channel positions' % len(ch_names)) fig = plot_alignment(info, subject='sample', subjects_dir=subjects_dir, surfaces=['pial'], meg=False) mlab.view(200, 70) xy, im = snapshot_brain_montage(fig, mon) # Convert from a dictionary to array to plot xy_pts = np.vstack(xy[ch] for ch in info['ch_names']) # Define an arbitrary "activity" pattern for viz activity = np.linspace(100, 200, xy_pts.shape[0]) # This allows us to use matplotlib to create arbitrary 2d scatterplots fig2, ax = plt.subplots(figsize=(10, 10)) ax.imshow(im) ax.scatter(*xy_pts.T, c=activity, s=200, cmap='coolwarm') ax.set_axis_off() # fig2.savefig('./brain.png', bbox_inches='tight') # For ClickableImage # This code opens the image so you can click on it. Commented out # because we've stored the clicks as a layout file already. # # The click coordinates are stored as a list of tuples # im = plt.imread('./brain.png') # click = ClickableImage(im) # click.plot_clicks() # # Generate a layout from our clicks and normalize by the image # print('Generating and saving layout...') # lt = click.to_layout() # lt.save(op.join(layout_path, layout_name)) # To save if we want # # We've already got the layout, load it lt = mne.channels.read_layout(layout_name, path=layout_path, scale=False) x = lt.pos[:, 0] * float(im.shape[1]) y = (1 - lt.pos[:, 1]) * float(im.shape[0]) # Flip the y-position fig, ax = plt.subplots() ax.imshow(im) ax.scatter(x, y, s=120, color='r') plt.autoscale(tight=True) ax.set_axis_off() plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load data Step2: Project 3D electrodes to a 2D snapshot Step3: Manually creating 2D electrode positions
5,202
<ASSISTANT_TASK:> Python Code: labVersion = 'cs190_week1_v_1_2' # TODO: Replace <FILL IN> with appropriate code # Manually calculate your answer and represent the vector as a list of integers values. # For example, [2, 4, 8]. x = [3, -6, 0] y = [4, 8, 16] # TEST Scalar multiplication: vectors (1a) # Import test library from test_helper import Test Test.assertEqualsHashed(x, 'e460f5b87531a2b60e0f55c31b2e49914f779981', 'incorrect value for vector x') Test.assertEqualsHashed(y, 'e2d37ff11427dbac7f833a5a7039c0de5a740b1e', 'incorrect value for vector y') # TODO: Replace <FILL IN> with appropriate code # Manually calculate your answer and represent the vector as a list of integers values. z = [4, 10, 18] # TEST Element-wise multiplication: vectors (1b) Test.assertEqualsHashed(z, '4b5fe28ee2d274d7e0378bf993e28400f66205c2', 'incorrect value for vector z') # TODO: Replace <FILL IN> with appropriate code # Manually calculate your answer and set the variables to their appropriate integer values. c1 = -11 c2 = 26 # TEST Dot product (1c) Test.assertEqualsHashed(c1, '8d7a9046b6a6e21d66409ad0849d6ab8aa51007c', 'incorrect value for c1') Test.assertEqualsHashed(c2, '887309d048beef83ad3eabf2a79a64a389ab1c9f', 'incorrect value for c2') # TODO: Replace <FILL IN> with appropriate code # Represent matrices as lists within lists. For example, [[1,2,3], [4,5,6]] represents a matrix with # two rows and three columns. Use integer values. X = [[22, 28], [49, 64]] Y = [[1, 2, 3], [2, 4, 6], [3, 6, 9]] # TEST Matrix multiplication (1d) Test.assertEqualsHashed(X, 'c2ada2598d8a499e5dfb66f27a24f444483cba13', 'incorrect value for matrix X') Test.assertEqualsHashed(Y, 'f985daf651531b7d776523836f3068d4c12e4519', 'incorrect value for matrix Y') # It is convention to import NumPy with the alias np import numpy as np # TODO: Replace <FILL IN> with appropriate code # Create a numpy array with the values 1, 2, 3 simpleArray = np.array([1, 2, 3]) # Perform the scalar product of 5 and the numpy array timesFive = 5*simpleArray print simpleArray print timesFive # TEST Scalar multiplication (2a) Test.assertTrue(np.all(timesFive == [5, 10, 15]), 'incorrect value for timesFive') # TODO: Replace <FILL IN> with appropriate code # Create a ndarray based on a range and step size. u = np.arange(0, 5, .5) v = np.arange(5, 10, .5) elementWise = u*v dotProduct = np.dot(u, v) print 'u: {0}'.format(u) print 'v: {0}'.format(v) print '\nelementWise\n{0}'.format(elementWise) print '\ndotProduct\n{0}'.format(dotProduct) # TEST Element-wise multiplication and dot product (2b) Test.assertTrue(np.all(elementWise == [ 0., 2.75, 6., 9.75, 14., 18.75, 24., 29.75, 36., 42.75]), 'incorrect value for elementWise') Test.assertEquals(dotProduct, 183.75, 'incorrect value for dotProduct') # TODO: Replace <FILL IN> with appropriate code from numpy.linalg import inv A = np.matrix([[1,2,3,4],[5,6,7,8]]) print 'A:\n{0}'.format(A) # Print A transpose print '\nA transpose:\n{0}'.format(A.T) # Multiply A by A transpose AAt = np.array([[ 30, 70], [ 70, 174]]) print '\nAAt:\n{0}'.format(AAt) # Invert AAt with np.linalg.inv() AAtInv = np.array([[ 0.54375, -0.21875], [-0.21875, 0.09375]]) print '\nAAtInv:\n{0}'.format(AAtInv) # Show inverse times matrix equals identity # We round due to numerical precision print '\nAAtInv * AAt:\n{0}'.format((AAtInv * AAt).round(4)) # TEST Matrix math (2c) Test.assertTrue(np.all(AAt == np.matrix([[30, 70], [70, 174]])), 'incorrect value for AAt') Test.assertTrue(np.allclose(AAtInv, np.matrix([[0.54375, -0.21875], [-0.21875, 0.09375]])), 'incorrect value for AAtInv') # TODO: Replace <FILL IN> with appropriate code features = np.array([1, 2, 3, 4]) print 'features:\n{0}'.format(features) # The last three elements of features lastThree = features[1:len(features)] print '\nlastThree:\n{0}'.format(lastThree) # TEST Slices (3a) Test.assertTrue(np.all(lastThree == [2, 3, 4]), 'incorrect value for lastThree') # TODO: Replace <FILL IN> with appropriate code zeros = np.zeros(8) ones = np.ones(8) print 'zeros:\n{0}'.format(zeros) print '\nones:\n{0}'.format(ones) zerosThenOnes = np.hstack((zeros, ones)) # A 1 by 16 array zerosAboveOnes = np.vstack((zeros, ones)) # A 2 by 8 array print '\nzerosThenOnes:\n{0}'.format(zerosThenOnes) print '\nzerosAboveOnes:\n{0}'.format(zerosAboveOnes) # TEST Combining ndarray objects (3b) Test.assertTrue(np.all(zerosThenOnes == [0,0,0,0,0,0,0,0,1,1,1,1,1,1,1,1]), 'incorrect value for zerosThenOnes') Test.assertTrue(np.all(zerosAboveOnes == [[0,0,0,0,0,0,0,0],[1,1,1,1,1,1,1,1]]), 'incorrect value for zerosAboveOnes') from pyspark.mllib.linalg import DenseVector # TODO: Replace <FILL IN> with appropriate code numpyVector = np.array([-3, -4, 5]) print '\nnumpyVector:\n{0}'.format(numpyVector) # Create a DenseVector consisting of the values [3.0, 4.0, 5.0] myDenseVector = DenseVector([3.0, 4.0, 5.0]) # Calculate the dot product between the two vectors. denseDotProduct = myDenseVector.dot(numpyVector) print 'myDenseVector:\n{0}'.format(myDenseVector) print '\ndenseDotProduct:\n{0}'.format(denseDotProduct) # TEST PySpark's DenseVector (3c) Test.assertTrue(isinstance(myDenseVector, DenseVector), 'myDenseVector is not a DenseVector') Test.assertTrue(np.allclose(myDenseVector, np.array([3., 4., 5.])), 'incorrect value for myDenseVector') Test.assertTrue(np.allclose(denseDotProduct, 0.0), 'incorrect value for denseDotProduct') # Example function def addS(x): return x + 's' print type(addS) print addS print addS('cat') # As a lambda addSLambda = lambda x: x + 's' print type(addSLambda) print addSLambda print addSLambda('cat') # TODO: Replace <FILL IN> with appropriate code # Recall that: "lambda x, y: x + y" creates a function that adds together two numbers multiplyByTen = lambda x: x * 10 print multiplyByTen(5) # Note that the function still shows its name as <lambda> print '\n', multiplyByTen # TEST Python lambda expressions (4a) Test.assertEquals(multiplyByTen(10), 100, 'incorrect definition for multiplyByTen') # Code using def that we will recreate with lambdas def plus(x, y): return x + y def minus(x, y): return x - y functions = [plus, minus] print functions[0](4, 5) print functions[1](4, 5) # TODO: Replace <FILL IN> with appropriate code # The first function should add two values, while the second function should subtract the second # value from the first value. lambdaFunctions = [lambda x, y: x + y , lambda x, y: x - y] print lambdaFunctions[0](4, 5) print lambdaFunctions[1](4, 5) # TEST lambda fewer steps than def (4b) Test.assertEquals(lambdaFunctions[0](10, 10), 20, 'incorrect first lambdaFunction') Test.assertEquals(lambdaFunctions[1](10, 10), 0, 'incorrect second lambdaFunction') # Examples. Note that the spacing has been modified to distinguish parameters from tuples. # One-parameter function a1 = lambda x: x[0] + x[1] a2 = lambda (x0, x1): x0 + x1 print 'a1( (3,4) ) = {0}'.format( a1( (3,4) ) ) print 'a2( (3,4) ) = {0}'.format( a2( (3,4) ) ) # Two-parameter function b1 = lambda x, y: (x[0] + y[0], x[1] + y[1]) b2 = lambda (x0, x1), (y0, y1): (x0 + y0, x1 + y1) print '\nb1( (1,2), (3,4) ) = {0}'.format( b1( (1,2), (3,4) ) ) print 'b2( (1,2), (3,4) ) = {0}'.format( b2( (1,2), (3,4) ) ) # TODO: Replace <FILL IN> with appropriate code # Use both syntaxes to create a function that takes in a tuple of two values and swaps their order # E.g. (1, 2) => (2, 1) swap1 = lambda x: (x[1], x[0]) swap2 = lambda (x0, x1): (x1, x0) print 'swap1((1, 2)) = {0}'.format(swap1((1, 2))) print 'swap2((1, 2)) = {0}'.format(swap2((1, 2))) # Using either syntax, create a function that takes in a tuple with three values and returns a tuple # of (2nd value, 3rd value, 1st value). E.g. (1, 2, 3) => (2, 3, 1) swapOrder = lambda (x0, x1, x2) : (x1, x2, x0) print 'swapOrder((1, 2, 3)) = {0}'.format(swapOrder((1, 2, 3))) # Using either syntax, create a function that takes in three tuples each with two values. The # function should return a tuple with the values in the first position summed and the values in the # second position summed. E.g. (1, 2), (3, 4), (5, 6) => (1 + 3 + 5, 2 + 4 + 6) => (9, 12) sumThree = lambda x0, x1, x2: (x0[0] + x1[0] + x2[0], x0[1] + x1[1] + x2[1]) print 'sumThree((1, 2), (3, 4), (5, 6)) = {0}'.format(sumThree((1, 2), (3, 4), (5, 6))) # TEST Lambda expression arguments (4c) Test.assertEquals(swap1((1, 2)), (2, 1), 'incorrect definition for swap1') Test.assertEquals(swap2((1, 2)), (2, 1), 'incorrect definition for swap2') Test.assertEquals(swapOrder((1, 2, 3)), (2, 3, 1), 'incorrect definition fo swapOrder') Test.assertEquals(sumThree((1, 2), (3, 4), (5, 6)), (9, 12), 'incorrect definition for sumThree') # Just run this code # This code will fail with a syntax error, as we can't use print in a lambda expression import traceback try: exec "lambda x: print x" except: traceback.print_exc() # Create a class to give our examples the same syntax as PySpark class FunctionalWrapper(object): def __init__(self, data): self.data = data def map(self, function): Call `map` on the items in `data` using the provided `function` return FunctionalWrapper(map(function, self.data)) def reduce(self, function): Call `reduce` on the items in `data` using the provided `function` return reduce(function, self.data) def filter(self, function): Call `filter` on the items in `data` using the provided `function` return FunctionalWrapper(filter(function, self.data)) def __eq__(self, other): return (isinstance(other, self.__class__) and self.__dict__ == other.__dict__) def __getattr__(self, name): return getattr(self.data, name) def __getitem__(self, k): return self.data.__getitem__(k) def __repr__(self): return 'FunctionalWrapper({0})'.format(repr(self.data)) def __str__(self): return 'FunctionalWrapper({0})'.format(str(self.data)) # Map example # Create some data mapData = FunctionalWrapper(range(5)) # Define a function to be applied to each element f = lambda x: x + 3 # Imperative programming: loop through and create a new object by applying f mapResult = FunctionalWrapper([]) # Initialize the result for element in mapData: mapResult.append(f(element)) # Apply f and save the new value print 'Result from for loop: {0}'.format(mapResult) # Functional programming: use map rather than a for loop print 'Result from map call: {0}'.format(mapData.map(f)) # Note that the results are the same but that the map function abstracts away the implementation # and requires less code # TODO: Replace <FILL IN> with appropriate code dataset = FunctionalWrapper(range(10)) # Multiply each element by 5 mapResult = dataset.map(lambda x : x * 5) # Keep the even elements # Note that "x % 2" evaluates to the remainder of x divided by 2 filterResult = dataset.filter(lambda x : not(x % 2)) # Sum the elements reduceResult = dataset.reduce(lambda x, y : x + y) print 'mapResult: {0}'.format(mapResult) print '\nfilterResult: {0}'.format(filterResult) print '\nreduceResult: {0}'.format(reduceResult) # TEST Functional programming (4e) Test.assertEquals(mapResult, FunctionalWrapper([0, 5, 10, 15, 20, 25, 30, 35, 40, 45]), 'incorrect value for mapResult') Test.assertEquals(filterResult, FunctionalWrapper([0, 2, 4, 6, 8]), 'incorrect value for filterResult') Test.assertEquals(reduceResult, 45, 'incorrect value for reduceResult') # Example of a mult-line expression statement # Note that placing parentheses around the expression allow it to exist on multiple lines without # causing a syntax error. (dataset .map(lambda x: x + 2) .reduce(lambda x, y: x * y)) # TODO: Replace <FILL IN> with appropriate code # Multiply the elements in dataset by five, keep just the even values, and sum those values finalSum = dataset.map(lambda x : x * 5).filter(lambda x : not(x%2)).reduce(lambda x, y : x + y) print finalSum # TEST Composability (4f) Test.assertEquals(finalSum, 100, 'incorrect value for finalSum') # Run this code to view Criteo's agreement # Note that some ad blocker software will prevent this IFrame from loading. # If this happens, open the webpage in a separate tab and follow the instructions from above. from IPython.lib.display import IFrame IFrame("http://labs.criteo.com/downloads/2014-kaggle-display-advertising-challenge-dataset/", 600, 350) # TODO: Replace <FILL IN> with appropriate code # Just replace <FILL IN> with the url for dac_sample.tar.gz import glob import os.path import tarfile import urllib import urlparse # Paste url, url should end with: dac_sample.tar.gz url = 'http://labs.criteo.com/wp-content/uploads/2015/04/dac_sample.tar.gz' url = url.strip() baseDir = os.path.join('data') inputPath = os.path.join('cs190', 'dac_sample.txt') fileName = os.path.join(baseDir, inputPath) inputDir = os.path.split(fileName)[0] def extractTar(check = False): # Find the zipped archive and extract the dataset tars = glob.glob('dac_sample*.tar.gz*') if check and len(tars) == 0: return False if len(tars) > 0: try: tarFile = tarfile.open(tars[0]) except tarfile.ReadError: if not check: print 'Unable to open tar.gz file. Check your URL.' return False tarFile.extract('dac_sample.txt', path=inputDir) print 'Successfully extracted: dac_sample.txt' return True else: print 'You need to retry the download with the correct url.' print ('Alternatively, you can upload the dac_sample.tar.gz file to your Jupyter root ' + 'directory') return False if os.path.isfile(fileName): print 'File is already available. Nothing to do.' elif extractTar(check = True): print 'tar.gz file was already available.' elif not url.endswith('dac_sample.tar.gz'): print 'Check your download url. Are you downloading the Sample dataset?' else: # Download the file and store it in the same directory as this notebook try: urllib.urlretrieve(url, os.path.basename(urlparse.urlsplit(url).path)) except IOError: print 'Unable to download and store: {0}'.format(url) extractTar() import os.path baseDir = os.path.join('data') inputPath = os.path.join('cs190', 'dac_sample.txt') fileName = os.path.join(baseDir, inputPath) if os.path.isfile(fileName): rawData = (sc .textFile(fileName, 2) .map(lambda x: x.replace('\t', ','))) # work with either ',' or '\t' separated data print rawData.take(1) rawDataCount = rawData.count() print rawDataCount # This line tests that the correct number of observations have been loaded assert rawDataCount == 100000, 'incorrect count for rawData' if rawDataCount == 100000: print 'Criteo data loaded successfully!' <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Part 1 Step2: (1b) Element-wise multiplication Step3: (1c) Dot product Step4: (1d) Matrix multiplication Step5: Part 2 Step6: (2b) Element-wise multiplication and dot product Step7: (2c) Matrix math Step8: Part 3 Step9: (3b) Combining ndarray objects Step10: (3c) PySpark's DenseVector Step11: Part 4 Step12: (4b) lambda fewer steps than def Step13: (4c) Lambda expression arguments Step14: (4d) Restrictions on lambda expressions Step18: (4e) Functional programming Step19: (4f) Composability Step20: Part 5
5,203
<ASSISTANT_TASK:> Python Code: # Init matplotlib %matplotlib inline import matplotlib matplotlib.rcParams['figure.figsize'] = (8, 8) # Setup PyAI import sys sys.path.insert(0, '/Users/jdecock/git/pub/jdhp/pyai') # Set the objective function #from pyai.optimize.functions import sphere as func from pyai.optimize.functions import sphere2d as func #from pyai.optimize.functions import additive_gaussian_noise as noise from pyai.optimize.functions import multiplicative_gaussian_noise as noise #from pyai.optimize.functions import additive_poisson_noise as noise #func.noise = noise # Comment this line to use a deterministic objective function xmin = func.bounds[0] # TODO xmax = func.bounds[1] # TODO import numpy as np import math This is a simple Python implementation of the (mu/1, lambda)-sigmaSA-ES as discussed in http://www.scholarpedia.org/article/Evolution_Strategies mu = 3 # mu: the number of parents lmb = 12 # lambda: the number of children rho = 1 # rho: number of parents per child selection_operator = '+' d = 2 # number of dimension of the solution space num_gen = 10 tau = 1./math.sqrt(2.*d) # self-adaptation learning rate # Init the population ########################## # "pop" array layout: # - the first mu lines contain parents # - the next lambda lines contain children # - the first column contains the individual's strategy (sigma) # - the last column contains the individual's assess (f(x)) # - the other columns contain the individual value (x) pop = np.full([mu+lmb, d+2], np.nan) pop[:mu, 0] = 1. # init the parents strategy to 1.0 pop[:mu, 1:-1] = np.random.normal(0., 1., size=[mu,d]) # init the parents value pop[:mu, -1] = func(pop[:mu, 1:-1].T) # evaluate parents print("Initial population:\n", pop) ## Sort parents #pop = pop[pop[:,-1].argsort()] #print(pop) for gen in range(num_gen): # Make children ################################ if rho == 1: # Each child is made from one randomly selected parent pop[mu:,:] = pop[np.random.randint(mu, size=lmb)] elif rho == mu: # Recombine all parents for each child raise NotImplemented() # TODO elif 1 < rho < mu: # Recombine rho randomly selected parents for each child raise NotImplemented() # TODO else: raise ValueError() pop[mu:,-1] = np.nan #print("Children:\n", pop) # Mutate children's sigma ###################### pop[mu:,0] = pop[mu:,0] * np.exp(tau * np.random.normal(size=lmb)) #print("Mutated children (sigma):\n", pop) # Mutate children's value ###################### pop[mu:,1:-1] = pop[mu:,1:-1] + pop[mu:,1:-1] * np.random.normal(size=[lmb,d]) #print("Mutated children (value):\n", pop) # Evaluate children ############################ pop[mu:, -1] = func(pop[mu:, 1:-1].T) #print("Evaluated children:\n", pop) # Select the best individuals ################## if selection_operator == '+': # *plus-selection* operator pop = pop[pop[:,-1].argsort()] elif selection_operator == ',': # *comma-selection* operator pop[:lmb,:] = pop[pop[mu:,-1].argsort()] # TODO: check this... else: raise ValueError() pop[mu:, :] = np.nan #print("Selected individuals for the next generation:\n", pop) print("Result:\n", pop[:mu, :]) tau import random sigma_list = [1.] for i in range(1000): sigma_list.append(sigma_list[-1] * math.exp(tau * random.normalvariate(0., 1.))) # mutate sigma #sigma = sigma * exp(tau*randn) # mutate sigma plt.loglog(sigma_list); x = np.linspace(-4, 4, 100) y1 = np.exp(1./math.sqrt(1.*d) * x) y2 = np.exp(1./math.sqrt(2.*d) * x) y3 = np.exp(1./math.sqrt(3.*d) * x) y4 = np.exp(1./(2.*d) * x) plt.plot(x, y1, label="tau1") plt.plot(x, y2, label="tau2") plt.plot(x, y3, label="tau3") plt.plot(x, y4, label="tau4") plt.legend(); tau1 = 1./math.sqrt(1.*d) tau2 = 1./math.sqrt(2.*d) tau3 = 1./math.sqrt(3.*d) tau4 = 1./(2.*d) x1 = np.exp(tau1 * np.random.normal(size=[100000])) x2 = np.exp(tau2 * np.random.normal(size=[100000])) x3 = np.exp(tau3 * np.random.normal(size=[100000])) x4 = np.exp(tau4 * np.random.normal(size=[100000])) bins = np.linspace(0, 10, 100) plt.hist(x1, bins=bins, alpha=0.5, label=r"$\exp\left(\frac{1}{\sqrt{d}} \mathcal{N}(0,1)\right)$", lw=2, histtype='step') plt.hist(x2, bins=bins, alpha=0.5, label=r"$\exp\left(\frac{1}{\sqrt{2d}} \mathcal{N}(0,1)\right)$", lw=2, histtype='step') plt.hist(x3, bins=bins, alpha=0.5, label=r"$\exp\left(\frac{1}{\sqrt{3d}} \mathcal{N}(0,1)\right)$", lw=2, histtype='step') plt.hist(x4, bins=bins, alpha=0.5, label=r"$\exp\left(\frac{1}{2d} \mathcal{N}(0,1)\right)$", lw=2, histtype='step') plt.xlim(-0.25, 7) plt.axvline(1, color='k', linestyle='dotted') plt.legend(fontsize='x-large'); # Init matplotlib %matplotlib inline import matplotlib matplotlib.rcParams['figure.figsize'] = (8, 8) # Setup PyAI import sys sys.path.insert(0, '/Users/jdecock/git/pub/jdhp/pyai') import numpy as np import time from pyai.optimize import SAES # Plot functions from pyai.optimize.utils import plot_contour_2d_solution_space from pyai.optimize.utils import plot_2d_solution_space from pyai.optimize.utils import array_list_to_array from pyai.optimize.utils import plot_fx_wt_iteration_number from pyai.optimize.utils import plot_err_wt_iteration_number from pyai.optimize.utils import plot_err_wt_execution_time from pyai.optimize.utils import plot_err_wt_num_feval ## Objective function: Rosenbrock function (Scipy's implementation) #func = scipy.optimize.rosen # Set the objective function #from pyai.optimize.functions import sphere as func from pyai.optimize.functions import sphere2d as func #from pyai.optimize.functions import additive_gaussian_noise as noise from pyai.optimize.functions import multiplicative_gaussian_noise as noise #from pyai.optimize.functions import additive_poisson_noise as noise func.noise = noise # Comment this line to use a deterministic objective function xmin = func.bounds[0] # TODO xmax = func.bounds[1] # TODO %%time saes = SAES() func.do_eval_logs = True func.reset_eval_counters() func.reset_eval_logs() res = saes.minimize(func, init_pop_mu=0., init_pop_sigma=1.) func.do_eval_logs = False eval_x_array = np.array(func.eval_logs_dict['x']).T eval_error_array = np.array(func.eval_logs_dict['fx']) - func(func.arg_min) res plot_contour_2d_solution_space(func, xmin=xmin, xmax=xmax, xstar=res, xvisited=eval_x_array, title="SAES"); plot_err_wt_num_feval(eval_error_array, x_log=True, y_log=True) %%time eval_error_array_list = [] NUM_RUNS = 100 for run_index in range(NUM_RUNS): saes = SAES() func.do_eval_logs = True func.reset_eval_counters() func.reset_eval_logs() res = saes.minimize(func, init_pop_mu=0., init_pop_sigma=1., lmb=6) func.do_eval_logs = False eval_error_array = np.array(func.eval_logs_dict['fx']) - func(func.arg_min) print("x* =", res) eval_error_array_list.append(eval_error_array); plot_err_wt_num_feval(array_list_to_array(eval_error_array_list), x_log=True, y_log=True, plot_option="mean") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: (1+1)-$\sigma$-Self-Adaptation-ES Step3: Some explanations about $\sigma$ and $\tau$ Step4: Other inplementations Step5: Define the objective function
5,204
<ASSISTANT_TASK:> Python Code: import NotebookImport from DX_screen import * gs2 = gene_sets.ix[dx_rna.index].fillna(0) rr = screen_feature(dx_rna.frac, rev_kruskal, gs2.T, align=False) fp = (1.*gene_sets.T * dx_rna.frac).T.dropna().replace(0, np.nan).mean().order() fp.name = 'mean frac' ff_u = filter_pathway_hits(rr.ix[ti(fp>.5)].p.order(), gs2) ff_p = filter_pathway_hits(rr.ix[ti(fp<.5)].p.order(), gs2) ff = ff_u.append(ff_p) selected = rr.ix[ff[ff < .00001].index].join(fp) selected.sort('p') d = pd.DataFrame({g: gs2['REACTOME_CELL_CYCLE'] for g in gs2.columns}) a,b = odds_ratio_df(d.T>0, gs2.T>0) dd = rr.ix[ti((a > 100) & (rr.q < 10e-15))].join(fp).sort(fp.name, ascending=False) filter_pathway_hits(dd, gs2) m_g1 = 'REACTOME_M_G1_TRANSITION' cepna = 'REACTOME_DEPOSITION_OF_NEW_CENPA_CONTAINING_NUCLEOSOMES_AT_THE_CENTROMERE' combine(gs2[m_g1]>0, gs2[cepna]>0).value_counts() fig, ax = subplots() v = pd.concat([dx_rna.frac, dx_rna.frac.ix[ti(gs2['REACTOME_CELL_CYCLE']>0)], dx_rna.frac.ix[ti(gs2[m_g1]>0)], dx_rna.frac.ix[ti(gs2[cepna]>0)] ]).dropna() v1 = pd.concat([pd.Series('All Genes', dx_rna.frac.index), pd.Series('Cell Cycle', ti(gs2['REACTOME_CELL_CYCLE']>0)), pd.Series('M/G1\nTransition', ti(gs2[m_g1]>0)), pd.Series('CEPNA\nDeposition', ti(gs2[cepna]>0)) ]) v1.name = '' v.name = 'Fraction Overexpressed' o = ['All Genes','Cell Cycle','CEPNA\nDeposition', 'M/G1\nTransition'] violin_plot_pandas(v1, v, order=o, ann=None, ax=ax) prettify_ax(ax) ax.spines['bottom'].set_visible(False) ax.axhline(.5, color='grey', lw=2, ls='--'); f2 = fp.ix[ti(rr.q < .00001)] ff_u = filter_pathway_hits(fp.ix[ti(f2>.5)].order()[::-1], gs2) ff_p = filter_pathway_hits(fp.ix[ti(f2<.5)].order(), gs2) ff = ff_u.append(ff_p) selected = rr.ix[ff.index].join(f2) selected.ix[(f2 - .5).abs().order().index[::-1]].dropna() unwind = 'REACTOME_UNWINDING_OF_DNA' telo = 'REACTOME_EXTENSION_OF_TELOMERES' fig, ax = subplots() v = pd.concat([dx_rna.frac, dx_rna.frac.ix[ti(gs2[cepna]>0)], dx_rna.frac.ix[ti(gs2[unwind]>0)], dx_rna.frac.ix[ti(gs2[telo]>0)] ]).dropna() v1 = pd.concat([pd.Series('All Genes', dx_rna.frac.index), pd.Series('CEPNA\nDeposition', ti(gs2[cepna]>0)), pd.Series('Unwinding\nof DNA', ti(gs2[unwind]>0)), pd.Series('Extension\nof Telomeres', ti(gs2[telo]>0)) ]) v1.name = '' v.name = 'Fraction Overexpressed' o = ['All Genes', 'CEPNA\nDeposition', 'Extension\nof Telomeres', 'Unwinding\nof DNA', ] violin_plot_pandas(v1, v, order=o, ann=None, ax=ax) prettify_ax(ax) ax.spines['bottom'].set_visible(False) ax.axhline(.5, color='grey', lw=2, ls='--'); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Here I'm running GSEA on the fraction upregulated signal across genes. Step2: First I do a greedy filter based on p-values to find non-overlapping gene sets that are significantly associated with the tumor signal. For details see the filter_pathway_hits funciton. Step3: The cell-cycle is a large pathway with lots of subsets in the mSigDB database. Here I'm looking for significant subsets within this pathway. Step4: These two gene sets are completely non-overlapping subsets of the cell-cycle. Step5: I can also change the greedy filter to look for gene-sets with large effect sizes as opposed to p-values. This is going to give us smaller, but more specific gene-sets. Step6: Interestingly unwinding of DNA has a very large effect size but is a relatviely small gene set at only 11 genes.
5,205
<ASSISTANT_TASK:> Python Code: # Authors: Alexandre Gramfort <alexandre.gramfort@telecom-paristech.fr> # # License: BSD (3-clause) import matplotlib.pyplot as plt import mne from mne import io from mne.datasets import sample from mne.minimum_norm import read_inverse_operator, source_band_induced_power print(__doc__) data_path = sample.data_path() raw_fname = data_path + '/MEG/sample/sample_audvis_raw.fif' fname_inv = data_path + '/MEG/sample/sample_audvis-meg-oct-6-meg-inv.fif' tmin, tmax, event_id = -0.2, 0.5, 1 # Setup for reading the raw data raw = io.read_raw_fif(raw_fname) events = mne.find_events(raw, stim_channel='STI 014') inverse_operator = read_inverse_operator(fname_inv) include = [] raw.info['bads'] += ['MEG 2443', 'EEG 053'] # bads + 2 more # picks MEG gradiometers picks = mne.pick_types(raw.info, meg=True, eeg=False, eog=True, stim=False, include=include, exclude='bads') # Load condition 1 event_id = 1 events = events[:10] # take 10 events to keep the computation time low # Use linear detrend to reduce any edge artifacts epochs = mne.Epochs(raw, events, event_id, tmin, tmax, picks=picks, baseline=(None, 0), reject=dict(grad=4000e-13, eog=150e-6), preload=True, detrend=1) # Compute a source estimate per frequency band bands = dict(alpha=[9, 11], beta=[18, 22]) stcs = source_band_induced_power(epochs, inverse_operator, bands, n_cycles=2, use_fft=False, n_jobs=1) for b, stc in stcs.iteritems(): stc.save('induced_power_%s' % b) plt.plot(stcs['alpha'].times, stcs['alpha'].data.mean(axis=0), label='Alpha') plt.plot(stcs['beta'].times, stcs['beta'].data.mean(axis=0), label='Beta') plt.xlabel('Time (ms)') plt.ylabel('Power') plt.legend() plt.title('Mean source induced power') plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Set parameters Step2: plot mean power
5,206
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'mpi-m', 'mpi-esm-1-2-hr', 'atmos') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.overview.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.overview.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.overview.model_family') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "AGCM" # "ARCM" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.overview.basic_approximations') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "primitive equations" # "non-hydrostatic" # "anelastic" # "Boussinesq" # "hydrostatic" # "quasi-hydrostatic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.resolution.horizontal_resolution_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.resolution.canonical_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.resolution.range_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.resolution.number_of_vertical_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.resolution.high_top') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.timestepping.timestep_dynamics') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.timestepping.timestep_shortwave_radiative_transfer') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.timestepping.timestep_longwave_radiative_transfer') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.orography.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "present day" # "modified" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.key_properties.orography.changes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "related to ice sheets" # "related to tectonics" # "modified mean" # "modified variance if taken into account in model (cf gravity waves)" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.horizontal.scheme_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "spectral" # "fixed grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.horizontal.scheme_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "finite elements" # "finite volumes" # "finite difference" # "centered finite difference" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.horizontal.scheme_order') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "second" # "third" # "fourth" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.horizontal.horizontal_pole') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "filter" # "pole rotation" # "artificial island" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.horizontal.grid_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Gaussian" # "Latitude-Longitude" # "Cubed-Sphere" # "Icosahedral" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.grid.discretisation.vertical.coordinate_type') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "isobaric" # "sigma" # "hybrid sigma-pressure" # "hybrid pressure" # "vertically lagrangian" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.timestepping_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Adams-Bashforth" # "explicit" # "implicit" # "semi-implicit" # "leap frog" # "multi-step" # "Runge Kutta fifth order" # "Runge Kutta second order" # "Runge Kutta third order" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.prognostic_variables') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "surface pressure" # "wind components" # "divergence/curl" # "temperature" # "potential temperature" # "total water" # "water vapour" # "water liquid" # "water ice" # "total water moments" # "clouds" # "radiation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.top_boundary.top_boundary_condition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "sponge layer" # "radiation boundary condition" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.top_boundary.top_heat') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.top_boundary.top_wind') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.lateral_boundary.condition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "sponge layer" # "radiation boundary condition" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.diffusion_horizontal.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.diffusion_horizontal.scheme_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "iterated Laplacian" # "bi-harmonic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_tracers.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Heun" # "Roe and VanLeer" # "Roe and Superbee" # "Prather" # "UTOPIA" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_tracers.scheme_characteristics') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Eulerian" # "modified Euler" # "Lagrangian" # "semi-Lagrangian" # "cubic semi-Lagrangian" # "quintic semi-Lagrangian" # "mass-conserving" # "finite volume" # "flux-corrected" # "linear" # "quadratic" # "quartic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_tracers.conserved_quantities') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "dry mass" # "tracer mass" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_tracers.conservation_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "conservation fixer" # "Priestley algorithm" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_momentum.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "VanLeer" # "Janjic" # "SUPG (Streamline Upwind Petrov-Galerkin)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_momentum.scheme_characteristics') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "2nd order" # "4th order" # "cell-centred" # "staggered grid" # "semi-staggered grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_momentum.scheme_staggering_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Arakawa B-grid" # "Arakawa C-grid" # "Arakawa D-grid" # "Arakawa E-grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_momentum.conserved_quantities') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Angular momentum" # "Horizontal momentum" # "Enstrophy" # "Mass" # "Total energy" # "Vorticity" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.dynamical_core.advection_momentum.conservation_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "conservation fixer" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.aerosols') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "sulphate" # "nitrate" # "sea salt" # "dust" # "ice" # "organic" # "BC (black carbon / soot)" # "SOA (secondary organic aerosols)" # "POM (particulate organic matter)" # "polar stratospheric ice" # "NAT (nitric acid trihydrate)" # "NAD (nitric acid dihydrate)" # "STS (supercooled ternary solution aerosol particle)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_radiation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_radiation.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_radiation.spectral_integration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "wide-band model" # "correlated-k" # "exponential sum fitting" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_radiation.transport_calculation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "two-stream" # "layer interaction" # "bulk" # "adaptive" # "multi-stream" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_radiation.spectral_intervals') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_GHG.greenhouse_gas_complexity') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "CO2" # "CH4" # "N2O" # "CFC-11 eq" # "CFC-12 eq" # "HFC-134a eq" # "Explicit ODSs" # "Explicit other fluorinated gases" # "O3" # "H2O" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_GHG.ODS') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "CFC-12" # "CFC-11" # "CFC-113" # "CFC-114" # "CFC-115" # "HCFC-22" # "HCFC-141b" # "HCFC-142b" # "Halon-1211" # "Halon-1301" # "Halon-2402" # "methyl chloroform" # "carbon tetrachloride" # "methyl chloride" # "methylene chloride" # "chloroform" # "methyl bromide" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_GHG.other_flourinated_gases') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "HFC-134a" # "HFC-23" # "HFC-32" # "HFC-125" # "HFC-143a" # "HFC-152a" # "HFC-227ea" # "HFC-236fa" # "HFC-245fa" # "HFC-365mfc" # "HFC-43-10mee" # "CF4" # "C2F6" # "C3F8" # "C4F10" # "C5F12" # "C6F14" # "C7F16" # "C8F18" # "c-C4F8" # "NF3" # "SF6" # "SO2F2" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_ice.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_ice.physical_representation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "bi-modal size distribution" # "ensemble of ice crystals" # "mean projected area" # "ice water path" # "crystal asymmetry" # "crystal aspect ratio" # "effective crystal radius" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_ice.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "T-matrix" # "geometric optics" # "finite difference time domain (FDTD)" # "Mie theory" # "anomalous diffraction approximation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_liquid.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_liquid.physical_representation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "cloud droplet number concentration" # "effective cloud droplet radii" # "droplet size distribution" # "liquid water path" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_liquid.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "geometric optics" # "Mie theory" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_cloud_inhomogeneity.cloud_inhomogeneity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Monte Carlo Independent Column Approximation" # "Triplecloud" # "analytic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_aerosols.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_aerosols.physical_representation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "number concentration" # "effective radii" # "size distribution" # "asymmetry" # "aspect ratio" # "mixing state" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_aerosols.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "T-matrix" # "geometric optics" # "finite difference time domain (FDTD)" # "Mie theory" # "anomalous diffraction approximation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.shortwave_gases.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_radiation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_radiation.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_radiation.spectral_integration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "wide-band model" # "correlated-k" # "exponential sum fitting" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_radiation.transport_calculation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "two-stream" # "layer interaction" # "bulk" # "adaptive" # "multi-stream" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_radiation.spectral_intervals') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_GHG.greenhouse_gas_complexity') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "CO2" # "CH4" # "N2O" # "CFC-11 eq" # "CFC-12 eq" # "HFC-134a eq" # "Explicit ODSs" # "Explicit other fluorinated gases" # "O3" # "H2O" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_GHG.ODS') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "CFC-12" # "CFC-11" # "CFC-113" # "CFC-114" # "CFC-115" # "HCFC-22" # "HCFC-141b" # "HCFC-142b" # "Halon-1211" # "Halon-1301" # "Halon-2402" # "methyl chloroform" # "carbon tetrachloride" # "methyl chloride" # "methylene chloride" # "chloroform" # "methyl bromide" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_GHG.other_flourinated_gases') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "HFC-134a" # "HFC-23" # "HFC-32" # "HFC-125" # "HFC-143a" # "HFC-152a" # "HFC-227ea" # "HFC-236fa" # "HFC-245fa" # "HFC-365mfc" # "HFC-43-10mee" # "CF4" # "C2F6" # "C3F8" # "C4F10" # "C5F12" # "C6F14" # "C7F16" # "C8F18" # "c-C4F8" # "NF3" # "SF6" # "SO2F2" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_ice.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_ice.physical_reprenstation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "bi-modal size distribution" # "ensemble of ice crystals" # "mean projected area" # "ice water path" # "crystal asymmetry" # "crystal aspect ratio" # "effective crystal radius" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_ice.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "T-matrix" # "geometric optics" # "finite difference time domain (FDTD)" # "Mie theory" # "anomalous diffraction approximation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_liquid.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_liquid.physical_representation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "cloud droplet number concentration" # "effective cloud droplet radii" # "droplet size distribution" # "liquid water path" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_liquid.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "geometric optics" # "Mie theory" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_cloud_inhomogeneity.cloud_inhomogeneity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Monte Carlo Independent Column Approximation" # "Triplecloud" # "analytic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_aerosols.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_aerosols.physical_representation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "number concentration" # "effective radii" # "size distribution" # "asymmetry" # "aspect ratio" # "mixing state" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_aerosols.optical_methods') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "T-matrix" # "geometric optics" # "finite difference time domain (FDTD)" # "Mie theory" # "anomalous diffraction approximation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.radiation.longwave_gases.general_interactions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "scattering" # "emission/absorption" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.boundary_layer_turbulence.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Mellor-Yamada" # "Holtslag-Boville" # "EDMF" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.boundary_layer_turbulence.scheme_type') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "TKE prognostic" # "TKE diagnostic" # "TKE coupled with water" # "vertical profile of Kz" # "non-local diffusion" # "Monin-Obukhov similarity" # "Coastal Buddy Scheme" # "Coupled with convection" # "Coupled with gravity waves" # "Depth capped at cloud base" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.boundary_layer_turbulence.closure_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.boundary_layer_turbulence.counter_gradient') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.deep_convection.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.deep_convection.scheme_type') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "mass-flux" # "adjustment" # "plume ensemble" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.deep_convection.scheme_method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "CAPE" # "bulk" # "ensemble" # "CAPE/WFN based" # "TKE/CIN based" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.deep_convection.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "vertical momentum transport" # "convective momentum transport" # "entrainment" # "detrainment" # "penetrative convection" # "updrafts" # "downdrafts" # "radiative effect of anvils" # "re-evaporation of convective precipitation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.deep_convection.microphysics') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "tuning parameter based" # "single moment" # "two moment" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.shallow_convection.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.shallow_convection.scheme_type') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "mass-flux" # "cumulus-capped boundary layer" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.shallow_convection.scheme_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "same as deep (unified)" # "included in boundary layer turbulence" # "separate diagnosis" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.shallow_convection.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "convective momentum transport" # "entrainment" # "detrainment" # "penetrative convection" # "re-evaporation of convective precipitation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.turbulence_convection.shallow_convection.microphysics') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "tuning parameter based" # "single moment" # "two moment" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.microphysics_precipitation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.microphysics_precipitation.large_scale_precipitation.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.microphysics_precipitation.large_scale_precipitation.hydrometeors') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "liquid rain" # "snow" # "hail" # "graupel" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.microphysics_precipitation.large_scale_cloud_microphysics.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.microphysics_precipitation.large_scale_cloud_microphysics.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "mixed phase" # "cloud droplets" # "cloud ice" # "ice nucleation" # "water vapour deposition" # "effect of raindrops" # "effect of snow" # "effect of graupel" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.atmos_coupling') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "atmosphere_radiation" # "atmosphere_microphysics_precipitation" # "atmosphere_turbulence_convection" # "atmosphere_gravity_waves" # "atmosphere_solar" # "atmosphere_volcano" # "atmosphere_cloud_simulator" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.uses_separate_treatment') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "entrainment" # "detrainment" # "bulk cloud" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.prognostic_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.diagnostic_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.prognostic_variables') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "cloud amount" # "liquid" # "ice" # "rain" # "snow" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.optical_cloud_properties.cloud_overlap_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "random" # "maximum" # "maximum-random" # "exponential" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.optical_cloud_properties.cloud_inhomogeneity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_water_distribution.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_water_distribution.function_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_water_distribution.function_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_water_distribution.convection_coupling') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "coupled with deep" # "coupled with shallow" # "not coupled with convection" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_ice_distribution.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_ice_distribution.function_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_ice_distribution.function_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.cloud_scheme.sub_grid_scale_ice_distribution.convection_coupling') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "coupled with deep" # "coupled with shallow" # "not coupled with convection" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.isscp_attributes.top_height_estimation_method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "no adjustment" # "IR brightness" # "visible optical depth" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.isscp_attributes.top_height_direction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "lowest altitude level" # "highest altitude level" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.cosp_attributes.run_configuration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Inline" # "Offline" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.cosp_attributes.number_of_grid_points') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.cosp_attributes.number_of_sub_columns') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.cosp_attributes.number_of_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.radar_inputs.frequency') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.radar_inputs.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "surface" # "space borne" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.radar_inputs.gas_absorption') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.radar_inputs.effective_radius') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.lidar_inputs.ice_types') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "ice spheres" # "ice non-spherical" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.observation_simulation.lidar_inputs.overlap') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "max" # "random" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.sponge_layer') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Rayleigh friction" # "Diffusive sponge layer" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "continuous spectrum" # "discrete spectrum" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.subgrid_scale_orography') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "effect on drag" # "effect on lifting" # "enhanced topography" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.orographic_gravity_waves.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.orographic_gravity_waves.source_mechanisms') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "linear mountain waves" # "hydraulic jump" # "envelope orography" # "low level flow blocking" # "statistical sub-grid scale variance" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.orographic_gravity_waves.calculation_method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "non-linear calculation" # "more than two cardinal directions" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.orographic_gravity_waves.propagation_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "linear theory" # "non-linear theory" # "includes boundary layer ducting" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.orographic_gravity_waves.dissipation_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "total wave" # "single wave" # "spectral" # "linear" # "wave saturation vs Richardson number" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.non_orographic_gravity_waves.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.non_orographic_gravity_waves.source_mechanisms') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "convection" # "precipitation" # "background spectrum" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.non_orographic_gravity_waves.calculation_method') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "spatially dependent" # "temporally dependent" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.non_orographic_gravity_waves.propagation_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "linear theory" # "non-linear theory" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.gravity_waves.non_orographic_gravity_waves.dissipation_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "total wave" # "single wave" # "spectral" # "linear" # "wave saturation vs Richardson number" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.solar_pathways.pathways') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "SW radiation" # "precipitating energetic particles" # "cosmic rays" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.solar_constant.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "fixed" # "transient" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.solar_constant.fixed_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.solar_constant.transient_characteristics') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.orbital_parameters.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "fixed" # "transient" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.orbital_parameters.fixed_reference_date') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.orbital_parameters.transient_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.orbital_parameters.computation_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Berger 1978" # "Laskar 2004" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.solar.insolation_ozone.solar_ozone_impact') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.volcanos.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.atmos.volcanos.volcanoes_treatment.volcanoes_implementation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "high frequency solar constant anomaly" # "stratospheric aerosols optical thickness" # "Other: [Please specify]" # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Model Family Step7: 1.4. Basic Approximations Step8: 2. Key Properties --&gt; Resolution Step9: 2.2. Canonical Horizontal Resolution Step10: 2.3. Range Horizontal Resolution Step11: 2.4. Number Of Vertical Levels Step12: 2.5. High Top Step13: 3. Key Properties --&gt; Timestepping Step14: 3.2. Timestep Shortwave Radiative Transfer Step15: 3.3. Timestep Longwave Radiative Transfer Step16: 4. Key Properties --&gt; Orography Step17: 4.2. Changes Step18: 5. Grid --&gt; Discretisation Step19: 6. Grid --&gt; Discretisation --&gt; Horizontal Step20: 6.2. Scheme Method Step21: 6.3. Scheme Order Step22: 6.4. Horizontal Pole Step23: 6.5. Grid Type Step24: 7. Grid --&gt; Discretisation --&gt; Vertical Step25: 8. Dynamical Core Step26: 8.2. Name Step27: 8.3. Timestepping Type Step28: 8.4. Prognostic Variables Step29: 9. Dynamical Core --&gt; Top Boundary Step30: 9.2. Top Heat Step31: 9.3. Top Wind Step32: 10. Dynamical Core --&gt; Lateral Boundary Step33: 11. Dynamical Core --&gt; Diffusion Horizontal Step34: 11.2. Scheme Method Step35: 12. Dynamical Core --&gt; Advection Tracers Step36: 12.2. Scheme Characteristics Step37: 12.3. Conserved Quantities Step38: 12.4. Conservation Method Step39: 13. Dynamical Core --&gt; Advection Momentum Step40: 13.2. Scheme Characteristics Step41: 13.3. Scheme Staggering Type Step42: 13.4. Conserved Quantities Step43: 13.5. Conservation Method Step44: 14. Radiation Step45: 15. Radiation --&gt; Shortwave Radiation Step46: 15.2. Name Step47: 15.3. Spectral Integration Step48: 15.4. Transport Calculation Step49: 15.5. Spectral Intervals Step50: 16. Radiation --&gt; Shortwave GHG Step51: 16.2. ODS Step52: 16.3. Other Flourinated Gases Step53: 17. Radiation --&gt; Shortwave Cloud Ice Step54: 17.2. Physical Representation Step55: 17.3. Optical Methods Step56: 18. Radiation --&gt; Shortwave Cloud Liquid Step57: 18.2. Physical Representation Step58: 18.3. Optical Methods Step59: 19. Radiation --&gt; Shortwave Cloud Inhomogeneity Step60: 20. Radiation --&gt; Shortwave Aerosols Step61: 20.2. Physical Representation Step62: 20.3. Optical Methods Step63: 21. Radiation --&gt; Shortwave Gases Step64: 22. Radiation --&gt; Longwave Radiation Step65: 22.2. Name Step66: 22.3. Spectral Integration Step67: 22.4. Transport Calculation Step68: 22.5. Spectral Intervals Step69: 23. Radiation --&gt; Longwave GHG Step70: 23.2. ODS Step71: 23.3. Other Flourinated Gases Step72: 24. Radiation --&gt; Longwave Cloud Ice Step73: 24.2. Physical Reprenstation Step74: 24.3. Optical Methods Step75: 25. Radiation --&gt; Longwave Cloud Liquid Step76: 25.2. Physical Representation Step77: 25.3. Optical Methods Step78: 26. Radiation --&gt; Longwave Cloud Inhomogeneity Step79: 27. Radiation --&gt; Longwave Aerosols Step80: 27.2. Physical Representation Step81: 27.3. Optical Methods Step82: 28. Radiation --&gt; Longwave Gases Step83: 29. Turbulence Convection Step84: 30. Turbulence Convection --&gt; Boundary Layer Turbulence Step85: 30.2. Scheme Type Step86: 30.3. Closure Order Step87: 30.4. Counter Gradient Step88: 31. Turbulence Convection --&gt; Deep Convection Step89: 31.2. Scheme Type Step90: 31.3. Scheme Method Step91: 31.4. Processes Step92: 31.5. Microphysics Step93: 32. Turbulence Convection --&gt; Shallow Convection Step94: 32.2. Scheme Type Step95: 32.3. Scheme Method Step96: 32.4. Processes Step97: 32.5. Microphysics Step98: 33. Microphysics Precipitation Step99: 34. Microphysics Precipitation --&gt; Large Scale Precipitation Step100: 34.2. Hydrometeors Step101: 35. Microphysics Precipitation --&gt; Large Scale Cloud Microphysics Step102: 35.2. Processes Step103: 36. Cloud Scheme Step104: 36.2. Name Step105: 36.3. Atmos Coupling Step106: 36.4. Uses Separate Treatment Step107: 36.5. Processes Step108: 36.6. Prognostic Scheme Step109: 36.7. Diagnostic Scheme Step110: 36.8. Prognostic Variables Step111: 37. Cloud Scheme --&gt; Optical Cloud Properties Step112: 37.2. Cloud Inhomogeneity Step113: 38. Cloud Scheme --&gt; Sub Grid Scale Water Distribution Step114: 38.2. Function Name Step115: 38.3. Function Order Step116: 38.4. Convection Coupling Step117: 39. Cloud Scheme --&gt; Sub Grid Scale Ice Distribution Step118: 39.2. Function Name Step119: 39.3. Function Order Step120: 39.4. Convection Coupling Step121: 40. Observation Simulation Step122: 41. Observation Simulation --&gt; Isscp Attributes Step123: 41.2. Top Height Direction Step124: 42. Observation Simulation --&gt; Cosp Attributes Step125: 42.2. Number Of Grid Points Step126: 42.3. Number Of Sub Columns Step127: 42.4. Number Of Levels Step128: 43. Observation Simulation --&gt; Radar Inputs Step129: 43.2. Type Step130: 43.3. Gas Absorption Step131: 43.4. Effective Radius Step132: 44. Observation Simulation --&gt; Lidar Inputs Step133: 44.2. Overlap Step134: 45. Gravity Waves Step135: 45.2. Sponge Layer Step136: 45.3. Background Step137: 45.4. Subgrid Scale Orography Step138: 46. Gravity Waves --&gt; Orographic Gravity Waves Step139: 46.2. Source Mechanisms Step140: 46.3. Calculation Method Step141: 46.4. Propagation Scheme Step142: 46.5. Dissipation Scheme Step143: 47. Gravity Waves --&gt; Non Orographic Gravity Waves Step144: 47.2. Source Mechanisms Step145: 47.3. Calculation Method Step146: 47.4. Propagation Scheme Step147: 47.5. Dissipation Scheme Step148: 48. Solar Step149: 49. Solar --&gt; Solar Pathways Step150: 50. Solar --&gt; Solar Constant Step151: 50.2. Fixed Value Step152: 50.3. Transient Characteristics Step153: 51. Solar --&gt; Orbital Parameters Step154: 51.2. Fixed Reference Date Step155: 51.3. Transient Method Step156: 51.4. Computation Method Step157: 52. Solar --&gt; Insolation Ozone Step158: 53. Volcanos Step159: 54. Volcanos --&gt; Volcanoes Treatment
5,207
<ASSISTANT_TASK:> Python Code: import matplotlib.pyplot as plt %matplotlib inline plt.gray() from keras.datasets import mnist (X_train, y_train), (X_test, y_test) = mnist.load_data() fig, axes = plt.subplots(3,5, figsize=(12,8)) for i, ax in enumerate(axes.flatten()): ax.imshow(X_train[i], interpolation='nearest') plt.show() from keras.models import Sequential from keras.layers.core import Dense, Dropout, Activation, Flatten from keras.layers.convolutional import Convolution2D, MaxPooling2D from keras.utils import np_utils batch_size = 512 nb_classes = 10 nb_epoch = 3 X_train = X_train.reshape(X_train.shape[0], 1, 28, 28) X_test = X_test.reshape(X_test.shape[0], 1, 28, 28) X_train = X_train.astype("float32") X_test = X_test.astype("float32") X_train /= 255 X_test /= 255 # convert class vectors to binary class matrices Y_train = np_utils.to_categorical(y_train, nb_classes) Y_test = np_utils.to_categorical(y_test, nb_classes) # CAUTION: Without utilizing a GPU even this very short example is incredibly slow to run. model = Sequential() #model.add(Convolution2D(8, 1, 3, 3, input_shape=(1,28,28), activation='relu')) model.add(Convolution2D(4, 3, 3, input_shape=(1,28,28), activation='relu')) #model.add(Convolution2D(4, 3, 3, activation='relu')) model.add(MaxPooling2D(pool_size=(2, 2))) model.add(Dropout(0.25)) model.add(Flatten()) model.add(Dense(4, input_dim=4*28*28*0.25, activation='relu')) model.add(Dropout(0.5)) model.add(Dense(nb_classes, input_dim=4, activation='softmax')) model.compile(loss='categorical_crossentropy', optimizer='adadelta', metrics=['accuracy']) model.fit(X_train[:1024], Y_train[:1024], batch_size=batch_size, nb_epoch=nb_epoch, verbose=1, validation_data=(X_test, Y_test)) score = model.evaluate(X_test, Y_test, verbose=0) print('Test score:', score) predictions = model.predict_classes(X_test) fig, axes = plt.subplots(3,5, figsize=(12,8)) for i, ax in enumerate(axes.flatten()): ax.imshow(X_test[predictions == 7][i].reshape((28,28)), interpolation='nearest') plt.show() from sklearn.metrics import confusion_matrix cm = confusion_matrix(y_test, predictions) np.fill_diagonal(cm, 0) plt.bone() plt.matshow(cm) plt.colorbar() plt.ylabel('True label') plt.xlabel('Predicted label') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: The performance here is very poor. We really need to train with more samples and for more epochs.
5,208
<ASSISTANT_TASK:> Python Code: # Author: Annalisa Pascarella <a.pascarella@iac.cnr.it> # # License: BSD (3-clause) import os.path as op import matplotlib.pyplot as plt import mne from mne.datasets import sample from mne import setup_volume_source_space from mne import make_forward_solution from mne.minimum_norm import make_inverse_operator, apply_inverse from nilearn import plotting # Set dir data_path = sample.data_path() subject = 'sample' data_dir = op.join(data_path, 'MEG', subject) subjects_dir = op.join(data_path, 'subjects') bem_dir = op.join(subjects_dir, subject, 'bem') # Set file names fname_mixed_src = op.join(bem_dir, '%s-oct-6-mixed-src.fif' % subject) fname_aseg = op.join(subjects_dir, subject, 'mri', 'aseg.mgz') fname_model = op.join(bem_dir, '%s-5120-bem.fif' % subject) fname_bem = op.join(bem_dir, '%s-5120-bem-sol.fif' % subject) fname_evoked = data_dir + '/sample_audvis-ave.fif' fname_trans = data_dir + '/sample_audvis_raw-trans.fif' fname_fwd = data_dir + '/sample_audvis-meg-oct-6-mixed-fwd.fif' fname_cov = data_dir + '/sample_audvis-shrunk-cov.fif' # List substructures we are interested in. We select only the # sub structures we want to include in the source space labels_vol = ['Left-Amygdala', 'Left-Thalamus-Proper', 'Left-Cerebellum-Cortex', 'Brain-Stem', 'Right-Amygdala', 'Right-Thalamus-Proper', 'Right-Cerebellum-Cortex'] # Get a surface-based source space. We could set one up like this:: # # >>> src = setup_source_space(subject, fname=None, spacing='oct6', # add_dist=False, subjects_dir=subjects_dir) # # But we already have one saved: src = mne.read_source_spaces(op.join(bem_dir, 'sample-oct-6-src.fif')) # Now we create a mixed src space by adding the volume regions specified in the # list labels_vol. First, read the aseg file and the source space bounds # using the inner skull surface (here using 10mm spacing to save time): vol_src = setup_volume_source_space( subject, mri=fname_aseg, pos=7.0, bem=fname_model, volume_label=labels_vol, subjects_dir=subjects_dir, verbose=True) # Generate the mixed source space src += vol_src # Visualize the source space. src.plot(subjects_dir=subjects_dir) n = sum(src[i]['nuse'] for i in range(len(src))) print('the src space contains %d spaces and %d points' % (len(src), n)) # We could write the mixed source space with:: # # >>> write_source_spaces(fname_mixed_src, src, overwrite=True) # nii_fname = op.join(bem_dir, '%s-mixed-src.nii' % subject) src.export_volume(nii_fname, mri_resolution=True) plotting.plot_img(nii_fname, cmap=plt.cm.spectral) plt.show() # Compute the fwd matrix fwd = make_forward_solution(fname_evoked, fname_trans, src, fname_bem, mindist=5.0, # ignore sources<=5mm from innerskull meg=True, eeg=False, n_jobs=1) leadfield = fwd['sol']['data'] print("Leadfield size : %d sensors x %d dipoles" % leadfield.shape) src_fwd = fwd['src'] n = sum(src_fwd[i]['nuse'] for i in range(len(src_fwd))) print('the fwd src space contains %d spaces and %d points' % (len(src_fwd), n)) # Load data condition = 'Left Auditory' evoked = mne.read_evokeds(fname_evoked, condition=condition, baseline=(None, 0)) noise_cov = mne.read_cov(fname_cov) # Compute inverse solution and for each epoch snr = 3.0 # use smaller SNR for raw data inv_method = 'MNE' # sLORETA, MNE, dSPM parc = 'aparc' # the parcellation to use, e.g., 'aparc' 'aparc.a2009s' lambda2 = 1.0 / snr ** 2 # Compute inverse operator inverse_operator = make_inverse_operator(evoked.info, fwd, noise_cov, depth=None, fixed=False) stcs = apply_inverse(evoked, inverse_operator, lambda2, inv_method, pick_ori=None) # Get labels for FreeSurfer 'aparc' cortical parcellation with 34 labels/hemi labels_parc = mne.read_labels_from_annot(subject, parc=parc, subjects_dir=subjects_dir) # Average the source estimates within each label of the cortical parcellation # and each sub structure contained in the src space # If mode = 'mean_flip' this option is used only for the surface cortical label src = inverse_operator['src'] label_ts = mne.extract_label_time_course([stcs], labels_parc, src, mode='mean', allow_empty=True, return_generator=False) # plot the times series of 2 labels fig, axes = plt.subplots(1) axes.plot(1e3 * stcs.times, label_ts[0][0, :], 'k', label='bankssts-lh') axes.plot(1e3 * stcs.times, label_ts[0][71, :].T, 'r', label='Brain-stem') axes.set(xlabel='Time (ms)', ylabel='MNE current (nAm)') axes.legend() mne.viz.tight_layout() plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Set up our source space. Step2: Export source positions to nift file
5,209
<ASSISTANT_TASK:> Python Code: import pandas as pd import oandapyV20 import oandapyV20.endpoints.orders as orders import configparser config = configparser.ConfigParser() config.read('../config/config_v20.ini') accountID = config['oanda']['account_id'] access_token = config['oanda']['api_key'] client = oandapyV20.API(access_token=access_token) data = { "order": { "price": "1.2", "stopLossOnFill": { "timeInForce": "GTC", "price": "1.22" }, "timeInForce": "GTC", "instrument": "EUR_USD", "units": "-100", "type": "LIMIT", "positionFill": "DEFAULT" } } r = orders.OrderCreate(accountID, data=data) client.request(r) print(r.response) pd.Series(r.response['orderCreateTransaction']) r = orders.OrderList(accountID) client.request(r) print(r.response) pd.Series(r.response['orders'][0]) r = orders.OrdersPending(accountID) client.request(r) print(r.response) res = r.response['orders'] print(res) last_order_id = res[0]['id'] pd.Series(r.response['orders'][0]) r = orders.OrderDetails(accountID=accountID, orderID=last_order_id) client.request(r) data = { "order": { "units": "-500000", "instrument": "EUR_USD", "price": "1.25000", "type": "LIMIT" } } r = orders.OrderReplace(accountID=accountID, orderID=last_order_id, data=data) client.request(r) print(r.response) req_id = r.response['lastTransactionID'] r = orders.OrderCancel(accountID=accountID, orderID=req_id) client.request(r) print(r.response) last_order_id data = {"order": {"units": "100", "instrument": "GBP_USD", "timeInForce": "FOK", "type": "MARKET", "positionFill": "DEFAULT" }, } r = orders.OrderCreate(accountID, data=data) client.request(r) print(r.response) pd.Series(r.response['orderCreateTransaction']) pd.Series(r.response['orderFillTransaction']) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Get a List of Orders for an Account Step2: List all Pending Orders in an Account Step3: Get Details for a Single Order in an Account Step4: Replace an Order in an Account by simultaneously cancelling it and createing a replacement Order. Step5: Cancel a pending Order in an Account. Step6: MKT Order
5,210
<ASSISTANT_TASK:> Python Code: import time import numpy as np import tensorflow as tf import utils from urllib.request import urlretrieve from os.path import isfile, isdir from tqdm import tqdm import zipfile dataset_folder_path = 'data' dataset_filename = 'text8.zip' dataset_name = 'Text8 Dataset' class DLProgress(tqdm): last_block = 0 def hook(self, block_num=1, block_size=1, total_size=None): self.total = total_size self.update((block_num - self.last_block) * block_size) self.last_block = block_num if not isfile(dataset_filename): with DLProgress(unit='B', unit_scale=True, miniters=1, desc=dataset_name) as pbar: urlretrieve( 'http://mattmahoney.net/dc/text8.zip', dataset_filename, pbar.hook) if not isdir(dataset_folder_path): with zipfile.ZipFile(dataset_filename) as zip_ref: zip_ref.extractall(dataset_folder_path) with open('data/text8') as f: text = f.read() words = utils.preprocess(text) print(words[:30]) print("Total words: {}".format(len(words))) print("Unique words: {}".format(len(set(words)))) vocab_to_int, int_to_vocab = utils.create_lookup_tables(words) int_words = [vocab_to_int[word] for word in words] ## Your code here import random threshold = 1e-5 wordsInt = sorted(int_words) print(wordsInt[:30]) pass bins = np.bincount(wordsInt) print(bins[:30]) frequencies = np.zeros(len(words), dtype=float) for index, singlebin in enumerate(bins): frequencies[index] = singlebin / len(int_words) print(frequencies[:30]) probs = np.zeros(len(words), dtype=float) for index, singlefrequency in enumerate(frequencies): probs[index] = 1 - np.sqrt(threshold/singlefrequency) print(probs[:30]) # Discard some word considering single word discarding probability train_words = [] for int_word in int_words: discardRandom = random.random() if probs[int_word] > discardRandom: print("Skip one occurence of " + int_to_vocab[int_word]) else: train_words.append(int_word) print(train_words[:30]) print(len(train_words)) #Solution (faster and cleaner) from collections import Counter import random threshold_2 = 1e-5 word_counts = Counter(int_words) total_count = len(int_words) freqs = {word: count/total_count for word, count in word_counts.items()} p_drop = {word: 1 - np.sqrt(threshold_2/freqs[word]) for word in word_counts} train_words_2 = [word for word in int_words if p_drop[word] < random.random()] def get_target(words, idx, window_size=5): ''' Get a list of words in a window around an index. ''' # My wrong implementation #C = random.uniform(1,window_size,1) #return words[idx-C:idx-1] + words[idx+1:idx+C] #Solution R = np.random.randint(1, window_size+1) start = idx - R if (idx - R) > 0 else 0 stop = idx + R target_words = set(words[start:idx] + words[idx+1:stop+1]) return list(target_words) def get_batches(words, batch_size, window_size=5): ''' Create a generator of word batches as a tuple (inputs, targets) ''' n_batches = len(words)//batch_size # only full batches words = words[:n_batches*batch_size] for idx in range(0, len(words), batch_size): x, y = [], [] batch = words[idx:idx+batch_size] for ii in range(len(batch)): batch_x = batch[ii] batch_y = get_target(batch, ii, window_size) y.extend(batch_y) x.extend([batch_x]*len(batch_y)) yield x, y train_graph = tf.Graph() with train_graph.as_default(): inputs = tf.placeholder(tf.int32, shape=(None), name="inputs") labels = tf.placeholder(tf.int32, shape=(None, None), name="labels") n_vocab = len(int_to_vocab) n_embedding = 200 with train_graph.as_default(): embedding = tf.Variable(tf.random_uniform(shape=(n_vocab, n_embedding), minval=-1.0, maxval=1.0)) embed = tf.nn.embedding_lookup(embedding, inputs) # Number of negative labels to sample n_sampled = 100 with train_graph.as_default(): softmax_w = tf.Variable(tf.truncated_normal(shape=(n_embedding, n_vocab), mean=0.0, stddev=0.01)) softmax_b = tf.Variable(tf.zeros(n_vocab)) # Calculate the loss using negative sampling loss = tf.nn.sampled_softmax_loss(weights=tf.transpose(softmax_w), biases=softmax_b, labels=labels, inputs=embed, num_sampled=100, num_classes=n_vocab) cost = tf.reduce_mean(loss) optimizer = tf.train.AdamOptimizer().minimize(cost) with train_graph.as_default(): ## From Thushan Ganegedara's implementation valid_size = 16 # Random set of words to evaluate similarity on. valid_window = 100 # pick 8 samples from (0,100) and (1000,1100) each ranges. lower id implies more frequent valid_examples = np.array(random.sample(range(valid_window), valid_size//2)) valid_examples = np.append(valid_examples, random.sample(range(1000,1000+valid_window), valid_size//2)) valid_dataset = tf.constant(valid_examples, dtype=tf.int32) # We use the cosine distance: norm = tf.sqrt(tf.reduce_sum(tf.square(embedding), 1, keep_dims=True)) normalized_embedding = embedding / norm valid_embedding = tf.nn.embedding_lookup(normalized_embedding, valid_dataset) similarity = tf.matmul(valid_embedding, tf.transpose(normalized_embedding)) # If the checkpoints directory doesn't exist: !mkdir checkpoints epochs = 10 batch_size = 1000 window_size = 10 with train_graph.as_default(): saver = tf.train.Saver() with tf.Session(graph=train_graph) as sess: iteration = 1 loss = 0 sess.run(tf.global_variables_initializer()) for e in range(1, epochs+1): batches = get_batches(train_words, batch_size, window_size) start = time.time() for x, y in batches: feed = {inputs: x, labels: np.array(y)[:, None]} train_loss, _ = sess.run([cost, optimizer], feed_dict=feed) loss += train_loss if iteration % 100 == 0: end = time.time() print("Epoch {}/{}".format(e, epochs), "Iteration: {}".format(iteration), "Avg. Training loss: {:.4f}".format(loss/100), "{:.4f} sec/batch".format((end-start)/100)) loss = 0 start = time.time() if iteration % 1000 == 0: ## From Thushan Ganegedara's implementation # note that this is expensive (~20% slowdown if computed every 500 steps) sim = similarity.eval() for i in range(valid_size): valid_word = int_to_vocab[valid_examples[i]] top_k = 8 # number of nearest neighbors nearest = (-sim[i, :]).argsort()[1:top_k+1] log = 'Nearest to %s:' % valid_word for k in range(top_k): close_word = int_to_vocab[nearest[k]] log = '%s %s,' % (log, close_word) print(log) iteration += 1 save_path = saver.save(sess, "checkpoints/text8.ckpt") embed_mat = sess.run(normalized_embedding) with train_graph.as_default(): saver = tf.train.Saver() with tf.Session(graph=train_graph) as sess: saver.restore(sess, tf.train.latest_checkpoint('checkpoints')) embed_mat = sess.run(embedding) %matplotlib inline %config InlineBackend.figure_format = 'retina' import matplotlib.pyplot as plt from sklearn.manifold import TSNE viz_words = 500 tsne = TSNE() embed_tsne = tsne.fit_transform(embed_mat[:viz_words, :]) fig, ax = plt.subplots(figsize=(14, 14)) for idx in range(viz_words): plt.scatter(*embed_tsne[idx, :], color='steelblue') plt.annotate(int_to_vocab[idx], (embed_tsne[idx, 0], embed_tsne[idx, 1]), alpha=0.7) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load the text8 dataset, a file of cleaned up Wikipedia articles from Matt Mahoney. The next cell will download the data set to the data folder. Then you can extract it and delete the archive file to save storage space. Step2: Preprocessing Step3: And here I'm creating dictionaries to covert words to integers and backwards, integers to words. The integers are assigned in descending frequency order, so the most frequent word ("the") is given the integer 0 and the next most frequent is 1 and so on. The words are converted to integers and stored in the list int_words. Step4: Subsampling Step5: Making batches Step6: Here's a function that returns batches for our network. The idea is that it grabs batch_size words from a words list. Then for each of those words, it gets the target words in the window. I haven't found a way to pass in a random number of target words and get it to work with the architecture, so I make one row per input-target pair. This is a generator function by the way, helps save memory. Step7: Building the graph Step8: Embedding Step9: Negative sampling Step10: Validation Step11: Training Step12: Restore the trained network if you need to Step13: Visualizing the word vectors
5,211
<ASSISTANT_TASK:> Python Code: import pandas as pd %pylab inline df = pd.read_csv("weather.csv", header=0, index_col=0) df mean_temp = df["temperature"].mean() mean_temp mean_humidity = df["humidity"].mean() mean_humidity temp_selector = df['temperature'] > mean_temp df[temp_selector][["outlook", "play"]] humidity_selector = df['humidity'] > mean_humidity df[humidity_selector][["outlook", "play"]] df["temp_C"] = ( df["temperature"] - 32 ) * (5/9.0) df play_selector = df["play"]=="yes" play_days = df[play_selector] len(play_days) sunny_selector = df["outlook"]=="sunny" sunny_play_days = df[sunny_selector & play_selector] len(sunny_play_days) print play_days["temperature"].mean() print play_days["temperature"].min() print play_days["temperature"].max() print play_days["humidity"].mean() print play_days["humidity"].min() print play_days["humidity"].max() pyplot.ylabel('Temperature') pyplot.xlabel("Humidity") pyplot.scatter(x=play_days["humidity"], y=play_days["temperature"], c='green') no_play_days = df[df["play"]=="no"] pyplot.scatter(x=no_play_days["humidity"], y=no_play_days["temperature"], c='red', marker="x") pyplot.legend(['Play', "No Play"]) #these are in units of thousands, need to scale df1 = pd.read_fwf("processed/st0009ts.txt", header=0, index_col=0, thousands=",").transpose() df2 = pd.read_fwf("processed/st1019ts.txt", header=0, index_col=0, thousands=",").transpose() df3 = pd.read_fwf("processed/st2029ts.txt", header=0, index_col=0, thousands=",").transpose() df4 = pd.read_fwf("processed/st3039ts.txt", header=0, index_col=0, thousands=",").transpose() df5 = pd.read_fwf("processed/st4049ts.txt", header=0, index_col=0, thousands=",").transpose() df6 = pd.read_fwf("processed/st5060ts.txt", header=0, index_col=0, thousands=",").transpose() df7 = pd.read_fwf("processed/st6070ts.txt", header=0, index_col=0, thousands=",").transpose() df = pd.concat([df1, df2, df3, df4, df5, df6, df7]) #scale up to unit of 1 df = df.apply(lambda x: x*1000) #for some reason, this dataset format uses '.'s in U.S. but doesn't for anything else. We'll normalize it here df[["U.S."]] df.rename(columns={'U.S.': 'US'}, inplace=True) #the file format changes here transform = lambda x: "19"+x[2:4] df_9 = pd.read_fwf("processed/st7080ts.txt", header=0, index_col=0, thousands=",").transpose() df_9.index = df_9.index.map(transform) df_10 = pd.read_fwf("processed/st8090ts.txt", header=0, index_col=0, thousands=",").transpose() df_10.index = df_10.index.map(transform) df_10 df_2 = pd.concat([df_9, df_10]) # now merge the two together to get the compleete mergered df df = pd.concat([df, df_2]) df=df.sort_index() #sort df[["CA", "AK"]].plot() df["New England"] = df[["CT", "ME", "MA", "NH", "RI", "VT"]].sum(axis=1) df["Southwest"] = df[["AZ", "CA", "CO", "NV", "NM", "TX", "UT"]].sum(axis=1) df[["New England", "Southwest"]].plot() #remove a few composite columns: df.drop('US', axis=1, inplace=True) df.drop('Southwest', axis=1, inplace=True) df.drop('New England', axis=1, inplace=True) delta = {} rel_delta={} for state in df.columns: delta[state]=df[state].iloc[-1] - df[state].iloc[50] rel_delta[state] = (df[state].iloc[-1] - df[state].iloc[50]) / df[state].iloc[50]*1. * 100 ddf=pd.DataFrame(delta, index=["delta"]).transpose() ddf = ddf.sort(["delta"], ascending=False) ddf.head() ddp=pd.DataFrame(rel_delta, index=["% change"]).transpose() ddp = ddp.sort(["% change"], ascending=False) ddp.head() ddp.tail(n=10) from sklearn import tree import numpy as np wine = np.loadtxt("wine.data", delimiter=',') #Get the targets (first column of file) Y = wine[:, 0] #Remove targets from input data X = wine[:, 1:] #lets split into a test and training set from sklearn.cross_validation import train_test_split X_train, X_test, Y_train, Y_test = train_test_split(X, Y, test_size=0.25, random_state=9) clf = tree.DecisionTreeClassifier() clf = clf.fit(X_train, Y_train) clf.score(X_test, Y_test) import matplotlib.pyplot as plt %matplotlib inline def plot_confusion_matrix(cm, title='Confusion matrix', cmap=plt.cm.Blues): plt.imshow(cm, interpolation='nearest', cmap=cmap) plt.title(title) plt.colorbar() tick_marks = np.arange(3) plt.xticks(tick_marks, ["1", "2", "3"], rotation=45) plt.yticks(tick_marks, ["1", "2", "3"]) plt.tight_layout() plt.ylabel('True label') plt.xlabel('Predicted label') # Compute confusion matrix from sklearn.metrics import confusion_matrix y_true = Y_test y_pred = clf.predict(X_test) cm = confusion_matrix(y_true, y_pred) np.set_printoptions(precision=2) print('Confusion matrix, without normalization') print(cm) plt.figure() plot_confusion_matrix(cm) plt.show() odf = pd.read_csv("hmwk_1_data/AHW_1.csv") odf.head() odf["Age"].plot(kind="hist") odf["Age"].describe() odf["Weight"].plot(kind="hist") odf["Weight"].describe() odf["Height"].plot(kind="hist") odf["Height"].describe() odf.isnull().sum() male = odf["Sex"]=="M" female = odf["Sex"]=="F" odf[male]["Age"].plot(kind="hist") odf[female]["Age"].plot(kind="hist") odf[male]["Weight"].plot(kind="hist") odf[female]["Weight"].plot(kind="hist") odf[male]["Height"].plot(kind="hist") odf[female]["Height"].plot(kind="hist") odf.describe() from pandas.tools.plotting import scatter_matrix pd.scatter_matrix(odf, alpha=0.2, figsize=(10, 10), diagonal='kde') odf["lbs"] = odf["Weight"] * 2.20462 odf.head() pd.scatter_matrix(odf, alpha=0.2, figsize=(10, 10), diagonal='kde') odf["w+h"] = odf["Weight"] + odf["Height"] odf.drop('lbs', axis=1, inplace=True) odf.head() pd.scatter_matrix(odf, alpha=0.2, figsize=(10, 10), diagonal='kde') odf["BMI"] = odf["Weight"] / ((odf["Height"]*0.01)**2) odf.head() odf[male]["BMI"].plot(kind="hist") odf[female]["BMI"].plot(kind="hist") print odf[male]["BMI"].describe() print print odf[female]["BMI"].describe() sports = list(set(odf["Sport"])) sports # choose 3 random sports sports import random random_sports = random.sample(sports, 3) for sport in random_sports: sport_selector = odf["Sport"] == sport odf[sport_selector].plot(kind="scatter", x="Height", y="Weight", marker='x') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Represent the following table using a data structure of your choice Step2: Calculate the mean temperature and mean humidity Step3: Print outlook and play for those days where the temperature is greater than the average temperature Step4: Print outlook and play for those days where the humidity is greater than the average humidity Step5: Convert the temperature to Celsius and add a new column therefore in the table. Step6: #1 Step7: #2 Step8: #3 Step9: #4 Step10: #5 Step11: The only inferences I can make from the scatter plot above, is that you always play when the humidity is between 70 and 85. Temperature seems to play no part of the decision process when you go out to play as from teh scatter plot the plays and no play poionts are evenly distributed across the y axis (Temperature). Step12: Merging Step13: Plot CA vs AK Step14: New England vs Southwest Step15: Greatest Change in Population Step16: As you can see from teh table above, CA had the largest growth in terms of raw numbers for the time period. However, we can gain additional insites by looking at percentatge growth. Step17: Some states had no net growth and some had negative growth Step18: 3 Step19: Test/Train Split Step20: Train Model Step21: Evaluation Step22: As you can see from the confusion matrix, inputs of Class 1 & 2 were perfectly classified. There were only 2 mistakes on Class 3. Step23: What are the statistical distributions of variables using no class? Step24: How much missing data is there? Step25: How do distributions differ by each gender? Step26: Describe summary statistics for each attribute. Step27: Visualize potential difference via the scatter plots. Step28: Create a new variable for the weight in lbs Step29: Add new variable w​eight + height. Step30: BMI Step31: Split Data By Sport
5,212
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt import numpy as np import itertools as itt import time import shutil import os import contextlib import pandas as pd import blaze as blz import bquery import cytoolz from cytoolz.curried import pluck as cytoolz_pluck from collections import OrderedDict import copy from prettyprint import pp elapsed_times = OrderedDict() @contextlib.contextmanager def ctime(message=None): "Counts the time spent in some context" assert message is not None global elapsed_times t_elapsed = 0.0 print('\n') t = time.time() yield if message: print message + ": ", t_elapsed = time.time() - t print round(t_elapsed, 4), "sec" elapsed_times[message] = t_elapsed ga = itt.cycle(['ES', 'NL']) gb = itt.cycle(['b1', 'b2', 'b3', 'b4', 'b5']) gx = itt.cycle([1, 2]) gy = itt.cycle([-1, -2]) rootdir = 'bench-data.bcolz' if os.path.exists(rootdir): shutil.rmtree(rootdir) n_rows = 1000000 # -- data z = np.fromiter(((a, b, x, y) for a, b, x, y in itt.izip(ga, gb, gx, gy)), dtype='S2,S2,i8,i8', count=n_rows) ct = bquery.ctable(z, rootdir=rootdir) ct.flush() print('Simple Test Case') df = pd.DataFrame(z) with ctime(message='pandas'): result = df.groupby(['f0'], sort=False, as_index=False)['f2'].sum() # print(result) print('Simple Test Case') blaze_data = blz.Data(ct.rootdir) expr = blz.by(blaze_data.f0, sum_f2=blaze_data.f2.sum()) with ctime(message='blaze (pandas + bcolz)'): result = blz.compute(expr) # print result print('Simple Test Case') with ctime(message='bquery + bcolz'): result = ct.groupby(['f0'], ['f2']) # print(result) print('Simple Test Case') with ctime(message='bquery, create factorization cache'): ct.cache_factor(['f0'], refresh=True) with ctime(message='bquery + bcolz (fact. cached)'): result = ct.groupby(['f0'], ['f2']) # print(result) print('Simple Test Case Running Time') elapsed_times_bak = OrderedDict({ k: v for (k,v) in sorted(elapsed_times.iteritems())}) pp(elapsed_times_bak) print('Simple Test Case Running Time relative to Pandas') elapsed_times_bak = OrderedDict({ k: v for (k,v) in sorted(elapsed_times.iteritems())}) pp(elapsed_times_bak) elapsed_times = elapsed_times_bak elapsed_times_norm = OrderedDict({ k: v/elapsed_times['pandas'] for (k,v) in sorted(elapsed_times.iteritems())}) print '\nNormalized running time' pp(elapsed_times_norm) if 'bquery, create factorization cache' in elapsed_times_norm: base_bquery = elapsed_times_norm.pop('bquery, create factorization cache') labels = [] val = [] for k,v in sorted(elapsed_times_norm.iteritems(), reverse=True): labels.append(k) val.append(v) pos = np.arange(len(elapsed_times_norm))+.5 # the bar centers on the y axis print elapsed_times_norm.keys() plt.figure(1, figsize=[15,5]) plt.grid(True) plt.barh(pos,val, align='center') plt.barh(pos,[0, base_bquery, 0,0], left=[0, elapsed_times_norm['bquery + bcolz (fact. cached)'], 0, 0], align='center', color = '#FFFFCC') plt.yticks(pos, labels, fontsize=15) plt.xlabel('X times slower', fontsize=15) plt.title('Performance compared to pandas', fontsize=25) elapsed_times = OrderedDict() ga = itt.cycle(['ES', 'NL']) gb = itt.cycle(['b1', 'b2', 'b3', 'b4']) gc = itt.cycle([1, 2]) gd = itt.cycle([3, 4, 4, 3]) ge = itt.cycle(['c','d','e']) gx = itt.cycle([1, 2]) gy = itt.cycle([-1, -2]) gz = itt.cycle([1.11, 2.22, 3.33, 4.44, 5.55]) rootdir = 'bench-data.bcolz' if os.path.exists(rootdir): shutil.rmtree(rootdir) n_rows = 1000000 print('Rows: ', n_rows) z = np.fromiter(((a, b, c, d, e, x, y, z) for a, b, c, d, e, x, y, z in itt.izip(ga, gb, gc, gd, ge, gx, gy, gz)), dtype='S2,S2,i4,i8,S1,i4,i8,f8', count=n_rows) ct = bquery.ctable(z, rootdir=rootdir, ) # -- pandas -- df = pd.DataFrame(z) with ctime(message='pandas'): result = df.groupby(['f0','f1','f2','f3','f4'], sort=False, as_index=False)['f5','f6','f7'].sum() # print(result) # -- bquery -- with ctime(message='bquery + bcolz'): result = ct.groupby(['f0','f1','f2','f3','f4'], ['f5','f6','f7']) # print(result) with ctime(message='bquery, create factorization cache'): ct.cache_factor(['f0','f1','f2','f3','f4'], refresh=True) with ctime(message='bquery over bcolz (factorization cached)'): result = ct.groupby(['f0','f1','f2','f3','f4'], ['f5','f6','f7']) # print(result) print('Complex Test Case Running Time relative to Pandas') elapsed_times_bak = OrderedDict({ k: v for (k,v) in sorted(elapsed_times.iteritems())}) pp(elapsed_times_bak) elapsed_times = elapsed_times_bak elapsed_times_norm = OrderedDict({ k: v/elapsed_times['pandas'] for (k,v) in sorted(elapsed_times.iteritems())}) print '\nNormalized running time' pp(elapsed_times_norm) if 'bquery, create factorization cache' in elapsed_times_norm: base_bquery = elapsed_times_norm.pop('bquery, create factorization cache') labels = [] val = [] for k,v in sorted(elapsed_times_norm.iteritems(), reverse=True): labels.append(k) val.append(v) pos = np.arange(len(elapsed_times_norm))+.5 # the bar centers on the y axis print elapsed_times_norm.keys() plt.figure(1, figsize=[15,5]) plt.grid(True) plt.barh(pos,val, align='center') plt.barh(pos,[0, base_bquery, 0], left=[0, elapsed_times_norm['bquery over bcolz (factorization cached)'], 0], align='center', color = '#FFFFCC') plt.yticks(pos, labels, fontsize=15) plt.xlabel('X times slower', fontsize=15) plt.title('Performance compared to pandas', fontsize=25) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: pandas Step2: blaze Step3: bquery without caching Step4: bquery with caching Step5: Running Times Summary Step6: Graphic Summary Step7: The Light yellow shows the one-time factorization caching (which after the first run can be left out of future queries).
5,213
<ASSISTANT_TASK:> Python Code: import dowhy from dowhy import CausalModel import pandas as pd import numpy as np # Config dict to set the logging level import logging.config DEFAULT_LOGGING = { 'version': 1, 'disable_existing_loggers': False, 'loggers': { '': { 'level': 'WARN', }, } } logging.config.dictConfig(DEFAULT_LOGGING) # Disabling warnings output import warnings from sklearn.exceptions import DataConversionWarning warnings.filterwarnings(action='ignore', category=DataConversionWarning) data = pd.read_csv("https://raw.githubusercontent.com/AMLab-Amsterdam/CEVAE/master/datasets/IHDP/csv/ihdp_npci_1.csv", header = None) col = ["treatment", "y_factual", "y_cfactual", "mu0", "mu1" ,] for i in range(1,26): col.append("x"+str(i)) data.columns = col data = data.astype({"treatment":'bool'}, copy=False) data.head() from rpy2.robjects import r as R from os.path import expanduser home = expanduser("~") %reload_ext rpy2.ipython # %R install.packages("Matching") %R library(Matching) %R data(lalonde) %R -o lalonde lalonde = lalonde.astype({'treat':'bool'}, copy=False) lalonde.head() # Create a causal model from the data and given common causes common_causes = [] for i in range(1, 26): common_causes += ["x"+str(i)] ihdp_model = CausalModel( data=data, treatment='treatment', outcome='y_factual', common_causes=common_causes ) ihdp_model.view_model(layout="dot") from IPython.display import Image, display display(Image(filename="causal_model.png")) lalonde_model = CausalModel( data=lalonde, treatment='treat', outcome='re78', common_causes='nodegr+black+hisp+age+educ+married'.split('+') ) lalonde_model.view_model(layout="dot") from IPython.display import Image, display display(Image(filename="causal_model.png")) #Identify the causal effect for the ihdp dataset ihdp_identified_estimand = ihdp_model.identify_effect(proceed_when_unidentifiable=True) print(ihdp_identified_estimand) #Identify the causal effect for the lalonde dataset lalonde_identified_estimand = lalonde_model.identify_effect(proceed_when_unidentifiable=True) print(lalonde_identified_estimand) ihdp_estimate = ihdp_model.estimate_effect( ihdp_identified_estimand, method_name="backdoor.propensity_score_weighting" ) print("The Causal Estimate is " + str(ihdp_estimate.value)) lalonde_estimate = lalonde_model.estimate_effect( lalonde_identified_estimand, method_name="backdoor.propensity_score_weighting" ) print("The Causal Estimate is " + str(lalonde_estimate.value)) ihdp_refute_random_common_cause = ihdp_model.refute_estimate( ihdp_identified_estimand, ihdp_estimate, method_name="random_common_cause" ) print(ihdp_refute_random_common_cause) ihdp_refute_placebo_treatment = ihdp_model.refute_estimate( ihdp_identified_estimand, ihdp_estimate, method_name="placebo_treatment_refuter", placebo_type="permute" ) print(ihdp_refute_placebo_treatment) ihdp_refute_random_subset = ihdp_model.refute_estimate( ihdp_identified_estimand, ihdp_estimate, method_name="data_subset_refuter", subset_fraction=0.8 ) print(ihdp_refute_random_subset) lalonde_refute_random_common_cause = lalonde_model.refute_estimate( lalonde_identified_estimand, lalonde_estimate, method_name="random_common_cause" ) print(lalonde_refute_random_common_cause) lalonde_refute_placebo_treatment = lalonde_model.refute_estimate( lalonde_identified_estimand, lalonde_estimate, method_name="placebo_treatment_refuter", placebo_type="permute" ) print(lalonde_refute_placebo_treatment) lalonde_refute_random_subset = lalonde_model.refute_estimate( lalonde_identified_estimand, lalonde_estimate, method_name="data_subset_refuter", subset_fraction=0.9 ) print(lalonde_refute_random_subset) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Loading the Dataset Step2: Lalonde Dataset Step3: Step 1 Step4: Lalonde Step5: Step 2 Step6: Lalonde Step7: Step 3 Step8: Lalonde Step9: Step 4 Step10: Replace Treatment with Placebo Step11: Remove Random Subset of Data Step12: Lalonde Step13: Replace Treatment with Placebo Step14: Remove Random Subset of Data
5,214
<ASSISTANT_TASK:> Python Code: import numpy as np import matplotlib.pyplot as plt from sklearn.datasets import load_iris iris = load_iris() data, labels = iris.data[:,0:2], iris.data[:,2] num_samples = len(labels) # size of our dataset # shuffle the dataset shuffle_order = np.random.permutation(num_samples) data = data[shuffle_order, :] labels = labels[shuffle_order] def weighted_sum(x, w, b): return b + np.dot(w, x) # set our paramters w = [0.2, 0.6] b = -0.3 # for example, let's use the first data point X, y = data, labels pred_y = [weighted_sum(x, w, b) for x in X] # let's print out the first prediction print("for x=[%0.2f, %0.2f], predicted = %0.2f, actual = %0.2f" % (X[0][0], X[0][1], pred_y[0], y[0])) # sum squared error def cost(y_pred, y_actual): return 0.5 * np.sum((y_actual-y_pred)**2) error = cost(pred_y, y) print(error) import random # grab our data X, y = data, labels # always a good idea to normalize X = X / np.amax(X, axis=0) y = y / np.amax(y, axis=0) # choose a random initial m, b w, b = [random.random(), random.random()], random.random() # our function w1 * x1 + w2 * x2 + b def F(X, w, b): return np.sum(w*X, axis=1) + b # what is our error? y_pred = F(X, w, b) init_cost = cost(y_pred, y) print("initial parameters: w1=%0.3f, w2=%0.3f, b=%0.3f"%(w[0], w[1], b)) print("initial cost = %0.3f" % init_cost) # implement partial derivatives of our parameters def dJdw1(X, y, w, b): return -np.dot(X[:,0], y - F(X, w, b)) def dJdw2(X, y, w, b): return -np.dot(X[:,1], y - F(X, w, b)) def dJdb(X, y, w, b): return -np.sum(y - F(X, w, b)) # choose the alpha parameter and number of iterations alpha = 0.001 n_iters = 2000 # run through gradient descent errors = [] for i in range(n_iters): w[0] = w[0] - alpha * dJdw1(X, y, w, b) w[1] = w[1] - alpha * dJdw2(X, y, w, b) b = b - alpha * dJdb(X, y, w, b) y_pred = F(X, w, b) j = cost(y_pred, y) errors.append(j) # plot the error plt.figure(figsize=(16, 3)) plt.plot(range(n_iters), errors, linewidth=2) plt.title("Cost by iteration") plt.ylabel("Cost") plt.xlabel("iterations") # what is our final error rate y_pred = F(X, w, b) final_cost = cost(y_pred, y) print("final parameters: w1=%0.3f, w2=%0.3f, b=%0.3f"%(w[0], w[1], b)) print("final cost = %0.3f" % final_cost) from mpl_toolkits.mplot3d import Axes3D fig = plt.figure() ax = fig.gca(projection='3d') x1, x2 = np.meshgrid(np.arange(-10, 10, 1), np.arange(-10, 10, 1)) y = b + w[0]*x1 + w[1]*x2 ax.plot_surface(x1, x2, y, rstride=1, cstride=1, cmap=plt.cm.coolwarm, linewidth=0, antialiased=False) def sigmoid(z): return 1.0 / (1.0 + np.exp(-z)) x = np.arange(-10.0, 10.0, 0.2) sig = sigmoid(x) plt.plot(x, sig) plt.title('Sigmoid function') def weighted_sum(x, w, b): return b + np.dot(w, x) def sigmoid(z): return 1 / (1 + np.exp(-z)) # reset our parameters w = [0.2, 0.6] b = -0.3 X, y = data, labels # get weighted sum like before Z = [weighted_sum(x, w, b) for x in X] # now transform the weighted sums with a sigmoid y_pred = [sigmoid(z) for z in Z] # evaluate error error = cost(y_pred, y) print(error) fig = plt.figure() ax = fig.gca(projection='3d') x1, x2 = np.meshgrid(np.arange(-10, 10, 1), np.arange(-10, 10, 1)) y = sigmoid(b + w[0]*x1 + w[1]*x2) ax.plot_surface(x1, x2, y, rstride=1, cstride=1, cmap=plt.cm.coolwarm, linewidth=0, antialiased=False) W1 = np.random.randn(2, 3) W2 = np.random.randn(3, 1) print("W1=", W1) print("W2=", W2) X, y = data, labels # first layer weighted sum z z = np.dot(X, W1) # project z through non-linear sigmoid z = sigmoid(z) # do another dot product at end (sigmoid is omitted) y_pred = np.dot(z, W2) # what is our cost error = cost(y_pred, y) print('predicted %0.2f for example 0, actual %0.2f, total cost %0.2f'%(pred_y[0], y[0], error)) class Neural_Network(object): def __init__(self, n0, n1, n2): self.n0 = n0 self.n1 = n1 self.n2 = n2 # initialize weights self.W1 = np.random.randn(self.n0, self.n1) self.W2 = np.random.randn(self.n1 ,self.n2) def predict(self, x): z = np.dot(x, self.W1) z = sigmoid(z) y = np.dot(z, self.W2) return y net = Neural_Network(2, 3, 1) X, y = data, labels y_pred = net.predict(X) error = cost(y_pred, y) print('predicted %0.2f for example 0, actual %0.2f, total cost %0.2f'%(pred_y[0], y[0], error)) import itertools def get_gradient(net, X, y): w_delta = 1e-8 # get the current value of the loss, wherever the parameters are y_pred_current = net.predict(X) error_current = cost(y_pred_current, y) # grab the current weights and copy them (so we can restore them after modification) dw1, dw2 = np.zeros((net.n0, net.n1)), np.zeros((net.n1, net.n2)) W1, W2 = np.copy(net.W1), np.copy(net.W2) # for the first layer, iterate through each weight, # perturb it slightly, and calculate the numerical # slope between that loss and the original loss for i, j in itertools.product(range(net.n0), range(net.n1)): net.W1 = np.copy(W1) net.W1[i][j] += w_delta y_pred = net.predict(X) error = cost(y_pred, y) dw1[i][j] = (error - error_current) / w_delta # do the same thing for the second layer for i, j in itertools.product(range(net.n1), range(net.n2)): net.W2 = np.copy(W2) net.W2[i][j] += w_delta y_pred = net.predict(X) error = cost(y_pred, y) dw2[i][j] = (error - error_current) / w_delta # restore the original weights net.W1, net.W2 = np.copy(W1), np.copy(W2) return dw1, dw2 # load the data and labels X, y = data, labels.reshape((len(labels),1)) # it's always a good idea to normalize the data between 0 and 1 X = X/np.amax(X, axis=0) y = y/np.amax(y, axis=0) # create a 2x3x1 neural net net = Neural_Network(2, 3, 1) # what is the current cost? y_orig = net.predict(X) init_cost = cost(y_orig, y) print("initial cost = %0.3f" % init_cost) # Set the learning rate, and how many epochs (updates) to try n_epochs = 2000 learning_rate = 0.01 # for each epoch, calculate the gradient, then subtract it from the parameters, and save the cost errors = [] for i in range(n_epochs): dw1, dw2 = get_gradient(net, X, y) net.W1 = net.W1 - learning_rate * dw1 net.W2 = net.W2 - learning_rate * dw2 y_pred = net.predict(X) error = cost(y_pred, y) errors.append(error) # plot it plt.plot(range(0, len(errors)), errors, linewidth=2) # what is the final cost? y_pred = net.predict(X) final_cost = cost(y_pred, y) print("final cost = %0.3f" % final_cost) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Like the 1-dimensional problem previously, we can still do linear regression, except now we have two variables and therefore two weights as well. Let's denote the input variables as $x_1$ and $x_2$ and instead of using $m$ as the coefficient variable, let's use $w_1$ and $w_2$. So for linear regression, we would have the following function Step2: Recall that we can evaluate the quality of our predictions using the sum-squared error function. Step3: Given a dataset, we can use this setup to do linear regression, just as we did in the case of the one-dimensional dataset in th previous section. In this case, we are no longer able to visualize the loss surface, because our function has 3 parameters ($w_1$, $w_2$, and $b$) and therefore requires four dimensions to plot the loss surface with repsect to the parameters). But the regression would work just the same way; we can optimize our three parameters using calculus and finding the partial derivative of the cost function with respect to all the parameters. Step4: A nice thing to do is to visualize our function. We can plot the prediction surface, $f(X)$ as a function of $X=\left[x_1,x_2\right]$ within some range. We do that in the next cell Step5: We found a respectable cost applying linear regression to our dataset. But we can still do better. The problem with linear regression is the linearity. Sometimes, data is not so nicely shaped that a plane can fit it well. Real-world datasets are much more often irregularly shaped, with data being distributed along apparently curved surfaces. Step6: Basically, a sigmoid just squashes any input it gets to between 0 and 1. Step7: That migh look much worse, but we haven't optimized yet! Step8: The function we posed above can already be considered a neural network. But let's complicate things a bit further, by adding a hidden layer. Neurons can be arranged in layers. So instead of having just two input neurons and an output neuron, let's place a layer of three neurons in the middle. Step9: For simplicity, let's just keep all the biases, $b$ fixed to 0 for now. We'll bring them back layer. Step10: Let's turn this basic operation into We can turn this into a class. Step11: Instantiate a neural network with 2 input neurons, 3 hidden neurons, and 1 output neuron. Step12: Now to do a forward pass, we can simply run the networks predict function Step13: Gradient descent Step14: The above function get_gradient calculates the gradient of a 2-layer network net, given a dataset X, y. In the next cell, we now go through the learning procedure. We load our dataset, instantiate a neural network, and train it on the data using the gradient method made above.
5,215
<ASSISTANT_TASK:> Python Code: from ipywidgets import widgets, interact from IPython.display import display import seaborn as sbn import matplotlib.pyplot as plt %matplotlib inline import numpy as np from IPython.core.pylabtools import figsize sbn.set_context("talk", font_scale=.8) figsize(10, 8) # The model used for this seminar is contained in the file model.py from model import (cost_of_vehicle_to_grid, compute_profit, annualized_capital_cost, battery_lifetime, max_vehicle_power) # Uncomment the next line and run this cell to view the model code in this notebook # %load model.py @interact(connector=widgets.FloatSlider(value=2.3, min=2.3, max=22, step=0.5), battery_size=widgets.FloatSlider(value=24, min=10, max=100, step=5), distance_driven=widgets.FloatSlider(value=0, min=0, max=100, step=5), range_buffer=widgets.FloatSlider(value=0, min=0, max=100, step=10), dispatch_time=widgets.FloatSlider(value=1.4, min=0.5, max=24, step=0.5)) def plot_power(connector: float, battery_size: float, distance_driven: float, range_buffer: float, dispatch_time: float) -> float : power = max_vehicle_power(connector, battery_size, distance_driven, range_buffer, dispatch_time ) return print("The maximum power is {} kW".format(round(power, 2))) def monte_carlo_large(data): dispatch_time = 4 y = max_vehicle_power(data[0], data[1], data[2], data[3], data[6], data[4], data[5]) return y number_sims = 1000 # Make some random data in the correct ranges mc_connector = np.random.uniform(2.3, 22, number_sims) mc_battery_size = np.random.uniform(50, 100, number_sims) mc_distance_driven = np.random.uniform(0, 80, number_sims) mc_range_buffer = np.random.uniform(0, 80, number_sims) mc_driving_eff = np.random.uniform(2, 6, number_sims) mc_inv_eff = np.random.uniform(0.87, 0.97, number_sims) mc_dispatch_time = np.random.uniform(0.5, 24, number_sims) data = np.array((mc_connector, mc_battery_size, mc_distance_driven, mc_range_buffer, mc_driving_eff, mc_inv_eff, mc_dispatch_time)) # Run the code y = monte_carlo_large(data) # Make some scatter plots to compare the results plt.subplot(241) plt.scatter(mc_connector, y) plt.title("Connector size (kW)") plt.ylabel("Max Power (kW)") plt.subplot(242) plt.scatter(mc_battery_size, y) plt.title("Battery Size (kWh)") # plt.ylabel("Max Power (kW)") plt.subplot(243) plt.scatter(mc_distance_driven, y) plt.title("Distance Driven (km)") # plt.ylabel("Max Power (kW)") plt.subplot(244) plt.scatter(mc_range_buffer, y) plt.title("Range Buffer (km)") # plt.ylabel("Max Power (kW)") plt.subplot(245) plt.scatter(mc_driving_eff, y) plt.title("Driving Eff (kWh/km)") plt.ylabel("Max Power (kW)") plt.subplot(246) plt.scatter(mc_inv_eff, y) plt.title("Inverter Eff (%)") # plt.ylabel("Max Power (kW)") plt.subplot(247) plt.scatter(mc_dispatch_time, y) plt.title("Dispatch Time (hours)") # plt.ylabel("Max Power (kW)") plt.tight_layout() # plt.savefig('scatter.png') plt.hist(y) plt.xlabel("Power (kW)") plt.ylabel("Frequency") from SALib.sample import morris as ms from SALib.analyze import morris as ma from SALib.plotting import morris as mp morris_problem = { # There are n variables 'num_vars': 7, # These are their names 'names': ['conn', 'batt', 'dist', 'range', 'dri_eff', 'inv_eff', 'dispatch_time'], # Plausible ranges over which we'll move the variables 'bounds': [[2.3, 22], # connection_power (kW) [50, 100], # battery size (kWh) [0, 80], # distance driven (km) [0, 80], # range buffer (km) [4,5.5], # driving efficiency (kWh/km) [0.87,0.97], # inverter efficienct (%) [0.5, 24] # dispatch time - hours of the day in which # the energy is dispatched ], # I don't want to group any of these variables together 'groups': None } number_of_trajectories = 1000 sample = ms.sample(morris_problem, number_of_trajectories, num_levels=4) # Run the sample through the monte carlo procedure of the power model output = monte_carlo_large(sample.T) # Store the results for plotting of the analysis Si = ma.analyze(morris_problem, sample, output, print_to_console=False) print("{:20s} {:>7s} {:>7s} {:>7s}".format("Name", "mu", "mu_star", "sigma")) for name, s1, st, mean in zip(morris_problem['names'], Si['mu'], Si['mu_star'], Si['sigma']): print("{:20s} {:=7.2f} {:=7.2f} {:=7.2f}".format(name, s1, st, mean)) fig, (ax1, ax2) = plt.subplots(1,2) mp.horizontal_bar_plot(ax1, Si, {}) mp.covariance_plot(ax2, Si, {}) @interact(battery_size=widgets.FloatSlider(value=24, min=10, max=100, step=5), battery_unit_cost=widgets.FloatSlider(value=350, min=100, max=400, step=50), connector_power=widgets.FloatSlider(value=2.3, min=2.3, max=22, step=0.5), lifetime_cycles=widgets.FloatSlider(value=2000, min=1000, max=10000, step=1000), depth_of_discharge=widgets.FloatSlider(value=0.8, min=0.5, max=1.0, step=0.1), electricity_price=widgets.FloatSlider(value=0.1, min=0.01, max=0.5, step=0.01), purchased_energy_cost=widgets.FloatSlider(value=0.1, min=0.01, max=0.5, step=0.01), capacity_price=widgets.FloatSlider(value=0.007, min=0.001, max=0.01, step=0.001), round_trip_efficiency=widgets.FloatSlider(value=0.73, min=0.50, max=1.0, step=0.01), cost_of_v2g_equip=widgets.FloatSlider(value=2000, min=100, max=5000, step=100), discount_rate=widgets.FloatSlider(value=0.10, min=0.0, max=0.2, step=0.01), economic_lifetime=widgets.FloatSlider(value=10, min=3, max=25, step=1), ratio_dispatch_to_contract=widgets.FloatSlider(value=0.10, min=0.01, max=0.50, step=0.01), distance_driven=widgets.FloatSlider(value=0, min=0, max=100, step=5), range_buffer=widgets.FloatSlider(value=0, min=0, max=100, step=10), hours_connected_per_day=widgets.FloatSlider(value=18, min=0.5, max=24, step=0.5)) def plot_profit(battery_size, battery_unit_cost, connector_power, lifetime_cycles, depth_of_discharge, electricity_price, purchased_energy_cost, capacity_price, round_trip_efficiency, cost_of_v2g_equip, discount_rate, economic_lifetime, distance_driven, range_buffer, ratio_dispatch_to_contract, hours_connected_per_day): profit, revenue, cost = compute_profit(battery_size, battery_unit_cost, connector_power, lifetime_cycles, depth_of_discharge, electricity_price, purchased_energy_cost, capacity_price, round_trip_efficiency, cost_of_v2g_equip, discount_rate, economic_lifetime, distance_driven, range_buffer, ratio_dispatch_to_contract, hours_connected_per_day ) return print("Profit £{} = £{} - £{}".format(np.round(profit,2), np.round(revenue, 2), np.round(cost,2) )) from SALib.sample.saltelli import sample as ss from SALib.analyze.sobol import analyze as sa problem = { # There are sixteen variables 'num_vars': 16, # These are their names 'names': ['battery_size', 'battery_unit_cost', 'connector_power', 'lifetime_cycles', 'depth_of_discharge', 'electricity_price', 'purchased_energy_cost', 'capacity_price', 'round_trip_efficiency', 'cost_of_v2g_equip', 'discount_rate', 'economic_lifetime', 'distance_driven', 'range_buffer', 'ratio_dispatch_to_contract', 'hours_connected_per_day'], # These are their plausible ranges over which we'll move the variables 'bounds': [ [10, 100], [100, 400], [2.3, 22], [1000, 10000], [0.5, 1.0], [0.01, 0.2], [0.01, 0.2], [0.001, 0.01], [0.65, 1.0], [100, 5000], [0.0, 0.2], [3, 25], [0, 100], [0, 100], [0.01, 0.50], [0.5, 24], ], # I don't want to group any of these variables together 'groups': None } sample = ss(problem, 1000, calc_second_order=False) profit, revenue, cost = compute_profit(sample[:, 0], sample[:, 1], sample[:, 2], sample[:, 3], sample[:, 4], sample[:, 5], sample[:, 6], sample[:, 7], sample[:, 8], sample[:, 9], sample[:, 10], sample[:, 11], sample[:, 12], sample[:, 13], sample[:, 14], sample[:, 15]) SI = sa(problem, profit, parallel=True, n_processors=4, calc_second_order=False, print_to_console=False) print("{:28s} {:>5s} {:>5s} {:>12s}".format("Name", "1st", "Total", "Mean of Input")) for name, s1, st, mean in zip(problem['names'], SI['S1'], SI['ST'], sample.mean(axis=0)): print("{:28s} {:=5.2f} {:=5.2f} ({:=12.2f})".format(name, s1, st, mean)) print("\nST sums to {:.2f}".format(SI['ST'].sum())) @interact(battery_size=widgets.FloatSlider(value=70, min=10, max=100, step=5), purchased_energy_cost=widgets.FloatSlider(value=0.1, min=0.01, max=0.5, step=0.01), cost_of_v2g_equip=widgets.FloatSlider(value=2000, min=100, max=5000, step=100), economic_lifetime=widgets.FloatSlider(value=10, min=3, max=25, step=1), ratio_dispatch_to_contract=widgets.FloatSlider(value=0.10, min=0.01, max=0.50, step=0.01), lifetime_cycles=widgets.FloatSlider(value=2000, min=1000, max=10000, step=500)) def plot_profit(battery_size, purchased_energy_cost, cost_of_v2g_equip, economic_lifetime, ratio_dispatch_to_contract, lifetime_cycles): profit, revenue, cost = compute_profit(lifetime_cycles=lifetime_cycles, battery_size=battery_size, purchased_energy_cost=purchased_energy_cost, cost_of_v2g_equip=cost_of_v2g_equip, economic_lifetime=economic_lifetime, ratio_dispatch_to_contract=ratio_dispatch_to_contract ) return print("Profit £{} = £{} - £{}".format(np.round(profit,2), np.round(revenue, 2), np.round(cost,2) )) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Uncertainty and Modelling Step2: Scatter plots Step3: You might be tempted to plot a histogram of the model outputs. This shows how often a particular value occurs in the results, but given that we are only exploring the model variable ranges, don't read too much into this distribution. Step4: Using SALib to run a Global Sensitivity Analysis Step5: Define a problem file Step6: Generate a Sample Step7: Ranking Step8: We can plot the results Step9: A More Complicated Example Step10: Screening Step11: The results should look something like this
5,216
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'test-institute-2', 'sandbox-2', 'land') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.land_atmosphere_flux_exchanges') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "water" # "energy" # "carbon" # "nitrogen" # "phospherous" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.atmospheric_coupling_treatment') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.land_cover') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "bare soil" # "urban" # "lake" # "land ice" # "lake ice" # "vegetated" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.land_cover_change') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.conservation_properties.energy') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.conservation_properties.water') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.conservation_properties.carbon') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.timestepping_framework.timestep_dependent_on_atmosphere') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.timestepping_framework.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.timestepping_framework.timestepping_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.software_properties.repository') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.software_properties.code_version') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.key_properties.software_properties.code_languages') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.horizontal.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.horizontal.matches_atmosphere_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.vertical.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.grid.vertical.total_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_water_coupling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.number_of_soil layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.structure') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.texture') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.organic_matter') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.albedo') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.water_table') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.continuously_varying_soil_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.soil_map.soil_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.prognostic') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.functions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "vegetation type" # "soil humidity" # "vegetation state" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.direct_diffuse') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "distinction between direct and diffuse albedo" # "no distinction between direct and diffuse albedo" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.snow_free_albedo.number_of_wavelength_bands') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.vertical_discretisation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.number_of_ground_water_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.lateral_connectivity') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "perfect connectivity" # "Darcian flow" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Bucket" # "Force-restore" # "Choisnel" # "Explicit diffusion" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.freezing.number_of_ground_ice_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.freezing.ice_storage_method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.freezing.permafrost') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.drainage.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.hydrology.drainage.types') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Gravity drainage" # "Horton mechanism" # "topmodel-based" # "Dunne mechanism" # "Lateral subsurface flow" # "Baseflow from groundwater" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.vertical_discretisation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.heat_storage') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Force-restore" # "Explicit diffusion" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.soil.heat_treatment.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "soil moisture freeze-thaw" # "coupling with snow temperature" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.number_of_snow_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.density') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "constant" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.water_equivalent') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.heat_content') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.temperature') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.liquid_water_content') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.snow_cover_fractions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "ground snow fraction" # "vegetation snow fraction" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "snow interception" # "snow melting" # "snow freezing" # "blowing snow" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.snow_albedo.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "prescribed" # "constant" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.snow.snow_albedo.functions') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "vegetation type" # "snow age" # "snow density" # "snow grain type" # "aerosol deposition" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.dynamic_vegetation') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_representation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "vegetation types" # "biome types" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_types') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "broadleaf tree" # "needleleaf tree" # "C3 grass" # "C4 grass" # "vegetated" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biome_types') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "evergreen needleleaf forest" # "evergreen broadleaf forest" # "deciduous needleleaf forest" # "deciduous broadleaf forest" # "mixed forest" # "woodland" # "wooded grassland" # "closed shrubland" # "opne shrubland" # "grassland" # "cropland" # "wetlands" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_time_variation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "fixed (not varying)" # "prescribed (varying from files)" # "dynamical (varying from simulation)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.vegetation_map') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.interception') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.phenology') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic (vegetation map)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.phenology_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.leaf_area_index') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prescribed" # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.leaf_area_index_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biomass') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biomass_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biogeography') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.biogeography_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.stomatal_resistance') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "light" # "temperature" # "water availability" # "CO2" # "O3" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.stomatal_resistance_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.vegetation.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.number_of_surface_temperatures') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.evaporation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "alpha" # "beta" # "combined" # "Monteith potential evaporation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.energy_balance.processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "transpiration" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.anthropogenic_carbon') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "grand slam protocol" # "residence time" # "decay time" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.number_of_carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.forest_stand_dynamics') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.photosynthesis.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.autotrophic_respiration.maintainance_respiration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.autotrophic_respiration.growth_respiration') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.allocation.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.allocation.allocation_bins') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "leaves + stems + roots" # "leaves + stems + roots (leafy + woody)" # "leaves + fine roots + coarse roots + stems" # "whole plant (no distinction)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.allocation.allocation_fractions') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "fixed" # "function of vegetation type" # "function of plant allometry" # "explicitly calculated" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.phenology.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.vegetation.mortality.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.number_of_carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.decomposition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.litter.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.number_of_carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.carbon_pools') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.decomposition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.soil.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.is_permafrost_included') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.emitted_greenhouse_gases') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.decomposition') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.carbon_cycle.permafrost_carbon.impact_on_soil_properties') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.nitrogen_cycle.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.tiling') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.grid_inherited_from_land_surface') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.grid_description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.number_of_reservoirs') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.water_re_evaporation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "flood plains" # "irrigation" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.coupled_to_atmosphere') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.coupled_to_land') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.quantities_exchanged_with_atmosphere') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "heat" # "water" # "tracers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.basin_flow_direction_map') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "present day" # "adapted for other periods" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.flooding') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.oceanic_discharge.discharge_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "direct (large rivers)" # "diffuse" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.river_routing.oceanic_discharge.quantities_transported') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "heat" # "water" # "tracers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.coupling_with_rivers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.quantities_exchanged_with_rivers') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "heat" # "water" # "tracers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.vertical_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.ice_treatment') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.albedo') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "prognostic" # "diagnostic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.dynamics') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "No lake dynamics" # "vertical" # "horizontal" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.dynamic_lake_extent') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.method.endorheic_basins') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.land.lakes.wetlands.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Description Step7: 1.4. Land Atmosphere Flux Exchanges Step8: 1.5. Atmospheric Coupling Treatment Step9: 1.6. Land Cover Step10: 1.7. Land Cover Change Step11: 1.8. Tiling Step12: 2. Key Properties --&gt; Conservation Properties Step13: 2.2. Water Step14: 2.3. Carbon Step15: 3. Key Properties --&gt; Timestepping Framework Step16: 3.2. Time Step Step17: 3.3. Timestepping Method Step18: 4. Key Properties --&gt; Software Properties Step19: 4.2. Code Version Step20: 4.3. Code Languages Step21: 5. Grid Step22: 6. Grid --&gt; Horizontal Step23: 6.2. Matches Atmosphere Grid Step24: 7. Grid --&gt; Vertical Step25: 7.2. Total Depth Step26: 8. Soil Step27: 8.2. Heat Water Coupling Step28: 8.3. Number Of Soil layers Step29: 8.4. Prognostic Variables Step30: 9. Soil --&gt; Soil Map Step31: 9.2. Structure Step32: 9.3. Texture Step33: 9.4. Organic Matter Step34: 9.5. Albedo Step35: 9.6. Water Table Step36: 9.7. Continuously Varying Soil Depth Step37: 9.8. Soil Depth Step38: 10. Soil --&gt; Snow Free Albedo Step39: 10.2. Functions Step40: 10.3. Direct Diffuse Step41: 10.4. Number Of Wavelength Bands Step42: 11. Soil --&gt; Hydrology Step43: 11.2. Time Step Step44: 11.3. Tiling Step45: 11.4. Vertical Discretisation Step46: 11.5. Number Of Ground Water Layers Step47: 11.6. Lateral Connectivity Step48: 11.7. Method Step49: 12. Soil --&gt; Hydrology --&gt; Freezing Step50: 12.2. Ice Storage Method Step51: 12.3. Permafrost Step52: 13. Soil --&gt; Hydrology --&gt; Drainage Step53: 13.2. Types Step54: 14. Soil --&gt; Heat Treatment Step55: 14.2. Time Step Step56: 14.3. Tiling Step57: 14.4. Vertical Discretisation Step58: 14.5. Heat Storage Step59: 14.6. Processes Step60: 15. Snow Step61: 15.2. Tiling Step62: 15.3. Number Of Snow Layers Step63: 15.4. Density Step64: 15.5. Water Equivalent Step65: 15.6. Heat Content Step66: 15.7. Temperature Step67: 15.8. Liquid Water Content Step68: 15.9. Snow Cover Fractions Step69: 15.10. Processes Step70: 15.11. Prognostic Variables Step71: 16. Snow --&gt; Snow Albedo Step72: 16.2. Functions Step73: 17. Vegetation Step74: 17.2. Time Step Step75: 17.3. Dynamic Vegetation Step76: 17.4. Tiling Step77: 17.5. Vegetation Representation Step78: 17.6. Vegetation Types Step79: 17.7. Biome Types Step80: 17.8. Vegetation Time Variation Step81: 17.9. Vegetation Map Step82: 17.10. Interception Step83: 17.11. Phenology Step84: 17.12. Phenology Description Step85: 17.13. Leaf Area Index Step86: 17.14. Leaf Area Index Description Step87: 17.15. Biomass Step88: 17.16. Biomass Description Step89: 17.17. Biogeography Step90: 17.18. Biogeography Description Step91: 17.19. Stomatal Resistance Step92: 17.20. Stomatal Resistance Description Step93: 17.21. Prognostic Variables Step94: 18. Energy Balance Step95: 18.2. Tiling Step96: 18.3. Number Of Surface Temperatures Step97: 18.4. Evaporation Step98: 18.5. Processes Step99: 19. Carbon Cycle Step100: 19.2. Tiling Step101: 19.3. Time Step Step102: 19.4. Anthropogenic Carbon Step103: 19.5. Prognostic Variables Step104: 20. Carbon Cycle --&gt; Vegetation Step105: 20.2. Carbon Pools Step106: 20.3. Forest Stand Dynamics Step107: 21. Carbon Cycle --&gt; Vegetation --&gt; Photosynthesis Step108: 22. Carbon Cycle --&gt; Vegetation --&gt; Autotrophic Respiration Step109: 22.2. Growth Respiration Step110: 23. Carbon Cycle --&gt; Vegetation --&gt; Allocation Step111: 23.2. Allocation Bins Step112: 23.3. Allocation Fractions Step113: 24. Carbon Cycle --&gt; Vegetation --&gt; Phenology Step114: 25. Carbon Cycle --&gt; Vegetation --&gt; Mortality Step115: 26. Carbon Cycle --&gt; Litter Step116: 26.2. Carbon Pools Step117: 26.3. Decomposition Step118: 26.4. Method Step119: 27. Carbon Cycle --&gt; Soil Step120: 27.2. Carbon Pools Step121: 27.3. Decomposition Step122: 27.4. Method Step123: 28. Carbon Cycle --&gt; Permafrost Carbon Step124: 28.2. Emitted Greenhouse Gases Step125: 28.3. Decomposition Step126: 28.4. Impact On Soil Properties Step127: 29. Nitrogen Cycle Step128: 29.2. Tiling Step129: 29.3. Time Step Step130: 29.4. Prognostic Variables Step131: 30. River Routing Step132: 30.2. Tiling Step133: 30.3. Time Step Step134: 30.4. Grid Inherited From Land Surface Step135: 30.5. Grid Description Step136: 30.6. Number Of Reservoirs Step137: 30.7. Water Re Evaporation Step138: 30.8. Coupled To Atmosphere Step139: 30.9. Coupled To Land Step140: 30.10. Quantities Exchanged With Atmosphere Step141: 30.11. Basin Flow Direction Map Step142: 30.12. Flooding Step143: 30.13. Prognostic Variables Step144: 31. River Routing --&gt; Oceanic Discharge Step145: 31.2. Quantities Transported Step146: 32. Lakes Step147: 32.2. Coupling With Rivers Step148: 32.3. Time Step Step149: 32.4. Quantities Exchanged With Rivers Step150: 32.5. Vertical Grid Step151: 32.6. Prognostic Variables Step152: 33. Lakes --&gt; Method Step153: 33.2. Albedo Step154: 33.3. Dynamics Step155: 33.4. Dynamic Lake Extent Step156: 33.5. Endorheic Basins Step157: 34. Lakes --&gt; Wetlands
5,217
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'mpi-m', 'mpi-esm-1-2-hr', 'seaice') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.model.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.model.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.variables.prognostic') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Sea ice temperature" # "Sea ice concentration" # "Sea ice thickness" # "Sea ice volume per grid cell area" # "Sea ice u-velocity" # "Sea ice v-velocity" # "Sea ice enthalpy" # "Internal ice stress" # "Salinity" # "Snow temperature" # "Snow depth" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.seawater_properties.ocean_freezing_point') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "TEOS-10" # "Constant" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.seawater_properties.ocean_freezing_point_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.resolution.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.resolution.canonical_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.resolution.number_of_horizontal_gridpoints') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.target') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.simulations') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.metrics_used') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.tuning_applied.variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.key_parameter_values.typical_parameters') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Ice strength (P*) in units of N m{-2}" # "Snow conductivity (ks) in units of W m{-1} K{-1} " # "Minimum thickness of ice created in leads (h0) in units of m" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.key_parameter_values.additional_parameters') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.assumptions.description') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.assumptions.on_diagnostic_variables') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.assumptions.missing_processes') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.properties') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Energy" # "Mass" # "Salt" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.budget') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.was_flux_correction_used') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.key_properties.conservation.corrected_conserved_prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.grid') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Ocean grid" # "Atmosphere Grid" # "Own Grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.grid_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Structured grid" # "Unstructured grid" # "Adaptive grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Finite differences" # "Finite elements" # "Finite volumes" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.thermodynamics_time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.dynamics_time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.horizontal.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.vertical.layering') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Zero-layer" # "Two-layers" # "Multi-layers" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.vertical.number_of_layers') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.discretisation.vertical.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.has_mulitple_categories') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.number_of_categories') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.category_limits') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.ice_thickness_distribution_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.seaice_categories.other') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.has_snow_on_ice') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.number_of_snow_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.snow_fraction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.grid.snow_on_seaice.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.horizontal_transport') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Incremental Re-mapping" # "Prather" # "Eulerian" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.transport_in_thickness_space') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Incremental Re-mapping" # "Prather" # "Eulerian" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.ice_strength_formulation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Hibler 1979" # "Rothrock 1975" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.redistribution') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Rafting" # "Ridging" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.dynamics.rheology') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Free-drift" # "Mohr-Coloumb" # "Visco-plastic" # "Elastic-visco-plastic" # "Elastic-anisotropic-plastic" # "Granular" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.enthalpy_formulation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Pure ice latent heat (Semtner 0-layer)" # "Pure ice latent and sensible heat" # "Pure ice latent and sensible heat + brine heat reservoir (Semtner 3-layer)" # "Pure ice latent and sensible heat + explicit brine inclusions (Bitz and Lipscomb)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.thermal_conductivity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Pure ice" # "Saline ice" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.heat_diffusion') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Conduction fluxes" # "Conduction and radiation heat fluxes" # "Conduction, radiation and latent heat transport" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.basal_heat_flux') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Heat Reservoir" # "Thermal Fixed Salinity" # "Thermal Varying Salinity" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.fixed_salinity_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.heat_content_of_precipitation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.energy.precipitation_effects_on_salinity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.new_ice_formation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.ice_vertical_growth_and_melt') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.ice_lateral_melting') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Floe-size dependent (Bitz et al 2001)" # "Virtual thin ice melting (for single-category)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.ice_surface_sublimation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.mass.frazil_ice') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.has_multiple_sea_ice_salinities') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.sea_ice_salinity_thermal_impacts') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.mass_transport.salinity_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Prescribed salinity profile" # "Prognostic salinity profile" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.mass_transport.constant_salinity_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.mass_transport.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.thermodynamics.salinity_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Prescribed salinity profile" # "Prognostic salinity profile" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.thermodynamics.constant_salinity_value') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.salt.thermodynamics.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.ice_thickness_distribution.representation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Explicit" # "Virtual (enhancement of thermal conductivity, thin ice melting)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.ice_floe_size_distribution.representation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Explicit" # "Parameterised" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.ice_floe_size_distribution.additional_details') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.melt_ponds.are_included') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.melt_ponds.formulation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Flocco and Feltham (2010)" # "Level-ice melt ponds" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.melt_ponds.impacts') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Albedo" # "Freshwater" # "Heat" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.has_snow_aging') # PROPERTY VALUE(S): # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.snow_aging_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.has_snow_ice_formation') # PROPERTY VALUE(S): # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.snow_ice_formation_scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.redistribution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.thermodynamics.snow_processes.heat_diffusion') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Single-layered heat diffusion" # "Multi-layered heat diffusion" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.radiative_processes.surface_albedo') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Delta-Eddington" # "Parameterized" # "Multi-band albedo" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.seaice.radiative_processes.ice_radiation_transmission') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Delta-Eddington" # "Exponential attenuation" # "Ice radiation transmission per category" # "Other: [Please specify]" # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 2. Key Properties --&gt; Variables Step7: 3. Key Properties --&gt; Seawater Properties Step8: 3.2. Ocean Freezing Point Value Step9: 4. Key Properties --&gt; Resolution Step10: 4.2. Canonical Horizontal Resolution Step11: 4.3. Number Of Horizontal Gridpoints Step12: 5. Key Properties --&gt; Tuning Applied Step13: 5.2. Target Step14: 5.3. Simulations Step15: 5.4. Metrics Used Step16: 5.5. Variables Step17: 6. Key Properties --&gt; Key Parameter Values Step18: 6.2. Additional Parameters Step19: 7. Key Properties --&gt; Assumptions Step20: 7.2. On Diagnostic Variables Step21: 7.3. Missing Processes Step22: 8. Key Properties --&gt; Conservation Step23: 8.2. Properties Step24: 8.3. Budget Step25: 8.4. Was Flux Correction Used Step26: 8.5. Corrected Conserved Prognostic Variables Step27: 9. Grid --&gt; Discretisation --&gt; Horizontal Step28: 9.2. Grid Type Step29: 9.3. Scheme Step30: 9.4. Thermodynamics Time Step Step31: 9.5. Dynamics Time Step Step32: 9.6. Additional Details Step33: 10. Grid --&gt; Discretisation --&gt; Vertical Step34: 10.2. Number Of Layers Step35: 10.3. Additional Details Step36: 11. Grid --&gt; Seaice Categories Step37: 11.2. Number Of Categories Step38: 11.3. Category Limits Step39: 11.4. Ice Thickness Distribution Scheme Step40: 11.5. Other Step41: 12. Grid --&gt; Snow On Seaice Step42: 12.2. Number Of Snow Levels Step43: 12.3. Snow Fraction Step44: 12.4. Additional Details Step45: 13. Dynamics Step46: 13.2. Transport In Thickness Space Step47: 13.3. Ice Strength Formulation Step48: 13.4. Redistribution Step49: 13.5. Rheology Step50: 14. Thermodynamics --&gt; Energy Step51: 14.2. Thermal Conductivity Step52: 14.3. Heat Diffusion Step53: 14.4. Basal Heat Flux Step54: 14.5. Fixed Salinity Value Step55: 14.6. Heat Content Of Precipitation Step56: 14.7. Precipitation Effects On Salinity Step57: 15. Thermodynamics --&gt; Mass Step58: 15.2. Ice Vertical Growth And Melt Step59: 15.3. Ice Lateral Melting Step60: 15.4. Ice Surface Sublimation Step61: 15.5. Frazil Ice Step62: 16. Thermodynamics --&gt; Salt Step63: 16.2. Sea Ice Salinity Thermal Impacts Step64: 17. Thermodynamics --&gt; Salt --&gt; Mass Transport Step65: 17.2. Constant Salinity Value Step66: 17.3. Additional Details Step67: 18. Thermodynamics --&gt; Salt --&gt; Thermodynamics Step68: 18.2. Constant Salinity Value Step69: 18.3. Additional Details Step70: 19. Thermodynamics --&gt; Ice Thickness Distribution Step71: 20. Thermodynamics --&gt; Ice Floe Size Distribution Step72: 20.2. Additional Details Step73: 21. Thermodynamics --&gt; Melt Ponds Step74: 21.2. Formulation Step75: 21.3. Impacts Step76: 22. Thermodynamics --&gt; Snow Processes Step77: 22.2. Snow Aging Scheme Step78: 22.3. Has Snow Ice Formation Step79: 22.4. Snow Ice Formation Scheme Step80: 22.5. Redistribution Step81: 22.6. Heat Diffusion Step82: 23. Radiative Processes Step83: 23.2. Ice Radiation Transmission
5,218
<ASSISTANT_TASK:> Python Code: %matplotlib inline %config InlineBackend.figure_format = 'retina' import numpy as np import pandas as pd import matplotlib.pyplot as plt data_path = 'Bike-Sharing-Dataset/hour.csv' rides = pd.read_csv(data_path) rides.head() rides[:24*10].plot(x='dteday', y='cnt') dummy_fields = ['season', 'weathersit', 'mnth', 'hr', 'weekday'] for each in dummy_fields: dummies = pd.get_dummies(rides[each], prefix=each, drop_first=False) rides = pd.concat([rides, dummies], axis=1) fields_to_drop = ['instant', 'dteday', 'season', 'weathersit', 'weekday', 'atemp', 'mnth', 'workingday', 'hr'] data = rides.drop(fields_to_drop, axis=1) data.head() quant_features = ['casual', 'registered', 'cnt', 'temp', 'hum', 'windspeed'] # Store scalings in a dictionary so we can convert back later scaled_features = {} for each in quant_features: mean, std = data[each].mean(), data[each].std() scaled_features[each] = [mean, std] data.loc[:, each] = (data[each] - mean)/std # Save data for approximately the last 21 days test_data = data[-21*24:] # Now remove the test data from the data set data = data[:-21*24] # Separate the data into features and targets target_fields = ['cnt', 'casual', 'registered'] features, targets = data.drop(target_fields, axis=1), data[target_fields] test_features, test_targets = test_data.drop(target_fields, axis=1), test_data[target_fields] # Hold out the last 60 days or so of the remaining data as a validation set train_features, train_targets = features[:-60*24], targets[:-60*24] val_features, val_targets = features[-60*24:], targets[-60*24:] class NeuralNetwork(object): def __init__(self, input_nodes, hidden_nodes, output_nodes, learning_rate): # Set number of nodes in input, hidden and output layers. self.input_nodes = input_nodes self.hidden_nodes = hidden_nodes self.output_nodes = output_nodes # Initialize weights self.weights_input_to_hidden = np.random.normal(0.0, self.input_nodes**-0.5, (self.input_nodes, self.hidden_nodes)) self.weights_hidden_to_output = np.random.normal(0.0, self.hidden_nodes**-0.5, (self.hidden_nodes, self.output_nodes)) self.lr = learning_rate #### TODO: Set self.activation_function to your implemented sigmoid function #### # # Note: in Python, you can define a function with a lambda expression, # as shown below. self.activation_function = lambda x : (1/(1+np.exp(-x))) # Replace 0 with your sigmoid calculation. ### If the lambda code above is not something you're familiar with, # You can uncomment out the following three lines and put your # implementation there instead. # #def sigmoid(x): # return 0 # Replace 0 with your sigmoid calculation here #self.activation_function = sigmoid def train(self, features, targets): ''' Train the network on batch of features and targets. Arguments --------- features: 2D array, each row is one data record, each column is a feature targets: 1D array of target values ''' n_records = features.shape[0] delta_weights_i_h = np.zeros(self.weights_input_to_hidden.shape) delta_weights_h_o = np.zeros(self.weights_hidden_to_output.shape) for X, y in zip(features, targets): #### Implement the forward pass here #### ### Forward pass ### # TODO: Hidden layer - Replace these values with your calculations. hidden_inputs = np.dot(X, self.weights_input_to_hidden) # signals into hidden layer hidden_outputs = self.activation_function(hidden_inputs) # signals from hidden layer # TODO: Output layer - Replace these values with your calculations. final_inputs = np.dot(hidden_outputs, self.weights_hidden_to_output) # signals into final output layer final_outputs = final_inputs # signals from final output layer #### Implement the backward pass here #### ### Backward pass ### # TODO: Output error - Replace this value with your calculations. error = y - final_outputs # Output layer error is the difference between desired target and actual output. # TODO: Calculate the hidden layer's contribution to the error hidden_error = np.dot(error, self.weights_hidden_to_output.T) # TODO: Backpropagated error terms - Replace these values with your calculations. output_error_term = error #* final_outputs * (1-final_outputs) hidden_error_term = hidden_error * hidden_outputs * (1 - hidden_outputs) # Weight step (input to hidden) delta_weights_i_h += hidden_error_term * X[:, None] # Weight step (hidden to output) #delta_weights_h_o += np.dot(hidden_outputs[:, None], output_error_term[None, :]) delta_weights_h_o += output_error_term * hidden_outputs[:, None] #output_error_term * hidden_outputs # TODO: Update the weights - Replace these values with your calculations. self.weights_hidden_to_output += self.lr * delta_weights_h_o / n_records # update hidden-to-output weights with gradient descent step self.weights_input_to_hidden += self.lr * delta_weights_i_h / n_records # update input-to-hidden weights with gradient descent step def run(self, features): ''' Run a forward pass through the network with input features Arguments --------- features: 1D array of feature values ''' #### Implement the forward pass here #### # TODO: Hidden layer - replace these values with the appropriate calculations. hidden_inputs = np.dot(features, self.weights_input_to_hidden) # signals into hidden layer hidden_outputs = self.activation_function(hidden_inputs) # signals from hidden layer # TODO: Output layer - Replace these values with the appropriate calculations. final_inputs = np.dot(hidden_outputs, self.weights_hidden_to_output) # signals into final output layer final_outputs = final_inputs # signals from final output layer return final_outputs def MSE(y, Y): return np.mean((y-Y)**2) import unittest inputs = np.array([[0.5, -0.2, 0.1]]) targets = np.array([[0.4]]) test_w_i_h = np.array([[0.1, -0.2], [0.4, 0.5], [-0.3, 0.2]]) test_w_h_o = np.array([[0.3], [-0.1]]) class TestMethods(unittest.TestCase): ########## # Unit tests for data loading ########## def test_data_path(self): # Test that file path to dataset has been unaltered self.assertTrue(data_path.lower() == 'bike-sharing-dataset/hour.csv') def test_data_loaded(self): # Test that data frame loaded self.assertTrue(isinstance(rides, pd.DataFrame)) ########## # Unit tests for network functionality ########## def test_activation(self): network = NeuralNetwork(3, 2, 1, 0.5) # Test that the activation function is a sigmoid self.assertTrue(np.all(network.activation_function(0.5) == 1/(1+np.exp(-0.5)))) def test_train(self): # Test that weights are updated correctly on training network = NeuralNetwork(3, 2, 1, 0.5) network.weights_input_to_hidden = test_w_i_h.copy() network.weights_hidden_to_output = test_w_h_o.copy() network.train(inputs, targets) self.assertTrue(np.allclose(network.weights_hidden_to_output, np.array([[ 0.37275328],[-0.03172939]]))) self.assertTrue(np.allclose(network.weights_input_to_hidden, np.array([[ 0.10562014, -0.20185996], [0.39775194, 0.50074398], [-0.29887597, 0.19962801]]))) def test_run(self): # Test correctness of run method network = NeuralNetwork(3, 2, 1, 0.5) network.weights_input_to_hidden = test_w_i_h.copy() network.weights_hidden_to_output = test_w_h_o.copy() out = network.run(inputs) self.assertTrue(np.allclose(out, 0.09998924)) suite = unittest.TestLoader().loadTestsFromModule(TestMethods()) unittest.TextTestRunner().run(suite) import sys ### Set the hyperparameters here ### # epoc - 100-3000, hidden_nodes: 10-56*2, learning rate: 0.01 -0.1 iterations = 4000 learning_rate = 0.8 hidden_nodes = 16 output_nodes = 1 N_i = train_features.shape[1] network = NeuralNetwork(N_i, hidden_nodes, output_nodes, learning_rate) losses = {'train':[], 'validation':[]} for ii in range(iterations): # Go through a random batch of 128 records from the training data set batch = np.random.choice(train_features.index, size=128) X, y = train_features.ix[batch].values, train_targets.ix[batch]['cnt'] network.train(X, y) # Printing out the training progress train_loss = MSE(network.run(train_features).T, train_targets['cnt'].values) val_loss = MSE(network.run(val_features).T, val_targets['cnt'].values) sys.stdout.write("\rProgress: {:2.1f}".format(100 * ii/float(iterations)) \ + "% ... Training loss: " + str(train_loss)[:5] \ + " ... Validation loss: " + str(val_loss)[:5]) sys.stdout.flush() losses['train'].append(train_loss) losses['validation'].append(val_loss) ##plot them plt.plot(losses['train'], label='Training loss') plt.plot(losses['validation'], label='Validation loss') plt.legend() _ = plt.ylim(0,2) ##predict fig, ax = plt.subplots(figsize=(8,4)) mean, std = scaled_features['cnt'] predictions = network.run(test_features).T*std + mean ax.plot(predictions[0], label='Prediction') ax.plot((test_targets['cnt']*std + mean).values, label='Data') ax.set_xlim(right=len(predictions)) ax.legend() dates = pd.to_datetime(rides.ix[test_data.index]['dteday']) dates = dates.apply(lambda d: d.strftime('%b %d')) ax.set_xticks(np.arange(len(dates))[12::24]) _ = ax.set_xticklabels(dates[12::24], rotation=45) plt.plot(losses['train'], label='Training loss') plt.plot(losses['validation'], label='Validation loss') plt.legend() _ = plt.ylim() fig, ax = plt.subplots(figsize=(8,4)) mean, std = scaled_features['cnt'] predictions = network.run(test_features).T*std + mean ax.plot(predictions[0], label='Prediction') ax.plot((test_targets['cnt']*std + mean).values, label='Data') ax.set_xlim(right=len(predictions)) ax.legend() dates = pd.to_datetime(rides.ix[test_data.index]['dteday']) dates = dates.apply(lambda d: d.strftime('%b %d')) ax.set_xticks(np.arange(len(dates))[12::24]) _ = ax.set_xticklabels(dates[12::24], rotation=45) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load and prepare the data Step2: Checking out the data Step3: Dummy variables Step4: Scaling target variables Step5: Splitting the data into training, testing, and validation sets Step6: We'll split the data into two sets, one for training and one for validating as the network is being trained. Since this is time series data, we'll train on historical data, then try to predict on future data (the validation set). Step7: Time to build the network Step8: Unit tests Step9: Training the network Step10: Check out your predictions
5,219
<ASSISTANT_TASK:> Python Code: import numpy as np import matplotlib.pyplot as plt import sunpy.instr.aia %matplotlib inline data = np.loadtxt('../aia_sample_data/aia_wresponse_raw.dat') channels = [94,131,171,193,211,304,335] ssw_results = {} for i in range(len(channels)): ssw_results[channels[i]] = {'wavelength':data[:,0], 'response':data[:,i+1]} response = sunpy.instr.aia.Response(path_to_genx_dir='../ssw_aia_response_data/') response.calculate_wavelength_response() fig,axes = plt.subplots(3,3,figsize=(12,12)) for c,ax in zip(channels,axes.flatten()): #ssw ax.plot(ssw_results[c]['wavelength'],ssw_results[c]['response'], color=response.channel_colors[c],label='ssw') #sunpy ax.plot(response.wavelength_response[c]['wavelength'],response.wavelength_response[c]['response'], color=response.channel_colors[c],marker='.',ms=12,label='SunPy') if c!=335 and c!=304: ax.set_xlim([c-20,c+20]) ax.set_title('{} $\mathrm{{\mathring{{A}}}}$'.format(c),fontsize=20) ax.set_xlabel(r'$\lambda$ ({0:latex})'.format(response.wavelength_response[c]['wavelength'].unit),fontsize=20) ax.set_ylabel(r'$R_i(\lambda)$ ({0:latex})'.format(response.wavelength_response[c]['response'].unit),fontsize=20) axes[0,0].legend(loc='best') plt.tight_layout() fig,axes = plt.subplots(3,3,figsize=(12,12),sharey=True,sharex=True) for c,ax in zip(channels,axes.flatten()): #ssw ax2 = ax.twinx() ssw_interp = ssw_results[c]['response']*response.wavelength_response[c]['response'].unit delta_response = np.fabs(response.wavelength_response[c]['response'] - ssw_interp)/(ssw_interp) ax.plot(response.wavelength_response[c]['wavelength'],delta_response,color=response.channel_colors[c]) ax2.plot(response.wavelength_response[c]['wavelength'],response.wavelength_response[c]['response'], color='k',linestyle='--') ax.set_title('{} $\mathrm{{\mathring{{A}}}}$'.format(c),fontsize=20) ax.set_xlabel(r'$\lambda$ ({0:latex})'.format(response.wavelength_response[c]['wavelength'].unit),fontsize=20) ax.set_ylabel(r'$\frac{|\mathrm{SSW}-\mathrm{SunPy}|}{\mathrm{SSW}}$',fontsize=20) ax2.set_ylabel(r'$R_i(\lambda)$ ({0:latex})'.format(response.wavelength_response[c]['response'].unit)) ax.set_ylim([-1.1,1.1]) plt.tight_layout() fig,axes = plt.subplots(1,2,figsize=(10,5)) for c,ax in zip([304,335],axes.flatten()): #ssw ax.plot(ssw_results[c]['wavelength'],ssw_results[c]['response'], color=response.channel_colors[c],label='ssw') #sunpy ax.plot(response.wavelength_response[c]['wavelength'],response.wavelength_response[c]['response'], color=response.channel_colors[c],marker='.',ms=12,label='SunPy') if c==304: ax.set_xlim([80,100]) if c==335: ax.set_xlim([120,140]) ax.set_title('{} $\mathrm{{\mathring{{A}}}}$'.format(c),fontsize=20) ax.set_xlabel(r'$\lambda$ ({0:latex})'.format(response.wavelength_response[c]['wavelength'].unit),fontsize=20) ax.set_ylabel(r'$R_i(\lambda)$ ({0:latex})'.format(response.wavelength_response[c]['response'].unit),fontsize=20) axes[0].legend(loc='best') plt.tight_layout() fig,axes = plt.subplots(1,2,figsize=(10,5)) for ax,c in zip(axes.flatten(),[304,335]): wvl_response = response._channel_info[c]['effective_area']*response._calculate_system_gain(c) ax.plot(response.wavelength_response[c]['wavelength'], wvl_response,'--',color=response.channel_colors[c],label=r'EA from SSW') ax.plot(response.wavelength_response[c]['wavelength'], response.wavelength_response[c]['response'],'.',ms=12,color=response.channel_colors[c], label=r'SunPy') if c==304: ax.set_xlim([80,100]) if c==335: ax.set_xlim([120,140]) ax.set_title('{} $\mathrm{{\mathring{{A}}}}$'.format(c),fontsize=20) ax.set_xlabel(r'$\lambda$ ({0:latex})'.format(response.wavelength_response[c]['wavelength'].unit),fontsize=20) ax.set_ylabel(r'$R_i(\lambda)$ ({0:latex})'.format(response.wavelength_response[c]['response'].unit),fontsize=20) axes[0].legend(loc='best') plt.tight_layout() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Wavelength Response Step2: Run the SunPy calculation. Step3: Plot the results against each other. Step4: Now, do a "residual plot" of the differences between the two results. Step5: Now, zooming in on the two spikes in the 335 and 304 $\mathrm{\mathring{A}}$ channels... Step6: It looks like there is contamination from the 94 $\mathrm{\mathring{A}}$ channel in the 304 $\mathrm{\mathring{A}}$ channel and contamination from 131 $\mathrm{\mathring{A}}$ in the 335 $\mathrm{\mathring{A}}$ channel. Why? Is this a mistake or just something we haven't accounted for in the SunPy calculation?
5,220
<ASSISTANT_TASK:> Python Code: from polyglot.detect import Detector arabic_text = u أفاد مصدر امني في قيادة عمليات صلاح الدين في العراق بأن " القوات الامنية تتوقف لليوم الثالث على التوالي عن التقدم الى داخل مدينة تكريت بسبب انتشار قناصي التنظيم الذي يطلق على نفسه اسم "الدولة الاسلامية" والعبوات الناسفة والمنازل المفخخة والانتحاريين، فضلا عن ان القوات الامنية تنتظر وصول تعزيزات اضافية ". detector = Detector(arabic_text) print(detector.language) mixed_text = u China (simplified Chinese: 中国; traditional Chinese: 中國), officially the People's Republic of China (PRC), is a sovereign state located in East Asia. for language in Detector(mixed_text).languages: print(language) for line in mixed_text.strip().splitlines(): print(line + u"\n") for language in Detector(line).languages: print(language) print("\n") detector = Detector("pizza") print(detector) print(Detector("4")) print(Detector("4", quiet=True)) !polyglot detect --help !polyglot detect --input testdata/cricket.txt from polyglot.utils import pretty_list print(pretty_list(Detector.supported_languages())) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Example Step4: Mixed Text Step5: If the text contains snippets from different languages, the detector is able to find the most probable langauges used in the text. Step6: To take a closer look, we can inspect the text line by line, notice that the confidence in the detection went down for the first line Step7: Best Effort Strategy Step8: In case, that the detection is not reliable even when we are using the best effort strategy, an exception UnknownLanguage will be thrown. Step9: Such an exception may not be desirable especially for trivial cases like characters that could belong to so many languages. Step10: Command Line Step11: The subcommand detect tries to identify the language code for each line in a text file. Step12: Supported Languages
5,221
<ASSISTANT_TASK:> Python Code: import numpy as np from qutip import * H = Qobj([[1],[0]]) V = Qobj([[0],[1]]) P45 = Qobj([[1/np.sqrt(2)],[1/np.sqrt(2)]]) M45 = Qobj([[1/np.sqrt(2)],[-1/np.sqrt(2)]]) R = Qobj([[1/np.sqrt(2)],[-1j/np.sqrt(2)]]) L = Qobj([[1/np.sqrt(2)],[1j/np.sqrt(2)]]) V def HWP(theta): return Qobj([[np.cos(2*theta),np.sin(2*theta)],[np.sin(2*theta),-np.cos(2*theta)]]).tidyup() def LP(theta): return Qobj([[np.cos(theta)**2,np.cos(theta)*np.sin(theta)],[np.sin(theta)*np.cos(theta),np.sin(theta)**2]]).tidyup() def QWP(theta): return Qobj([[np.cos(theta)**2 + 1j*np.sin(theta)**2, (1-1j)*np.sin(theta)*np.cos(theta)], [(1-1j)*np.sin(theta)*np.cos(theta), np.sin(theta)**2 + 1j*np.cos(theta)**2]]).tidyup() QWP(np.pi/4) H.dag()*H np.sin? psi = Qobj([[1+1j],[2-1j]]) psi psi.dag() psi.dag().dag() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: These are the polarization states Step2: Devices Step3: Example 1) Check that the $|H\rangle$ state is normalized Step4: To show more information on an object, use the question mark after the function or object Step5: Example 2) Converting from ket to bra
5,222
<ASSISTANT_TASK:> Python Code: print("He said, 'what ?'") s = "This is a string." print(s) print(type(s)) print(len(s)) s = 42 print(s) print(type(s)) print(s * 2) print(s + 7) # Neither statement modifies the variable. s += 2**3 # s is being incremented by 2^3 print("Same as s = s + 2**3") print(s) print(s == 42) print(s == 50) print(s > 10) x = "Blah" print(x + x) print(len(x)) mylist = [1, 2.41341] mylist.append("We can mix types !") print(mylist) print(type(mylist)) print(mylist, "\n") print(mylist[0]) print(mylist[1]) print(mylist[2]) print("Length is {} long.\n".format(len(mylist))) print("There are {} ones in this list.\n".format(mylist.count(1))) mylist.reverse() print("Reversed ! {}".format(mylist)) for i in mylist : print(i) print("Hello\n") print("Finished") from __future__ import braces print(1 in mylist) print(2 in mylist) for i in range(len(mylist)) : print(i, mylist[i]) for index, value in enumerate(mylist) : print("Element number {} in the list has the value {}".format(index, value)) x = 5 if x > 3 : print("x is greater than 3.") elif x == 5 : print("We aren't going to see this. Why ?") else : print("x is not greater than 3.") print("We can see this, it's not in the if statement.") for outer in range(1, 3) : print("BIG CLICK, outer loop change to {}".format(outer)) for inner in range(4) : print("*little click*, outer is still {}, and inner is {}.".format(outer, inner)) print("I'm done here.") myint = 2 myfloat = 3.14 print(type(myint), type(myfloat)) # Multiplying an int with a float gives a float : the int was promoted. print(myint * myfloat) print(type(myint * myfloat)) # A minor difference between Python 2 and Python 3 : print(7 / 3) # Py2 : 2 # Py3 : 2.3333 # In Python 2, operations between same type gives the same type : print(type(7 / 3)) # Py2 : <type 'int'> # Py3 : <class 'float'> # Quick hack with ints to floats - there's no need to typecast, just give it a float print(float(7) / 3) print(7 / 3.0) # In Python 3, this is handled "correctly"; you can use // as integer division print(7 // 3) # Quick note for Py2 users - see https://www.python.org/dev/peps/pep-0238/ from __future__ import division print(7 / 3) # Create a list of integers 0, 1, 2, 3, 4 A = list(range(5)) print(A) # Py2 vs Py3 : # In Py2, range() returns a list already # Let's replace the middle element A[2] = "Naaaaah" print(A) print(A[1:4]) print(A[:2]) print(A[2:]) print(A[len(A)-2:]) print(A[-2:]) print(list(range(0, 5, 2))) print(A[0:5:2]) # Here, it will give us elements 0, 2, 4. # This will simply go from start to finish with a stride of 2 print(A[::2]) # And this one, from the second element to finish, with a stride of 2 print(A[1::2]) # So, uh... Reverse ? print(A[::-1]) print(A + A) print(A * 3) pythonPoints = { "Quentin" : 1./3, "Paul" : 42, "Matthew" : 1e3 } print(pythonPoints) # Dictionaries associate keys with values print(pythonPoints.keys()) print(pythonPoints.values()) # You can access them through their keys print(pythonPoints["Paul"] * 2) if "Ruthie" in pythonPoints : # for dicts, "in" checks the keys print("Ruthie's here too !") else : pythonPoints["Ruthie"] = 0 print("Ruthie has {} mad skillz.".format(pythonPoints["Ruthie"])) # Let's build a list of elements 1^2, 2^2, ..., 5^2 y = [i**2 for i in range(6)] print(y) # Want to keep your index ? Use a dictionary. squares = { x : x**2 for x in range(6) } for key, val in squares.items() : print("{} squared is {}".format(key, val)) # Also useful : zip() # for key, val in zip(squares.keys(), squares.values()) : # print("{} : {}".format(key, val)) # We can inline if statements too print(42 if type(42) is int else 32) # Note this is interpreted as # print (something if a, else print something_else) # and not # (print something) if a, else (do something_else) # Fibonacci numbers # OH NO RECURSION def fib(n) : if n < 2 : return n else : return fib(n-1) + fib(n-2) print("Done defining.") # Testing : for i in range(10) : print(fib(i)) def printFib(i) : print("The {}th number of the Fibonnaci sequence is {}.".format(i, fib(i))) printFib(20) # I modified this one from Learn Python The Hard Way ( highly recommended ) : formatstring = "Start {} {}" print(formatstring.format(formatstring, formatstring)) # Written on-the-fly, because I got mad skills print("This is a haiku\n\tI'm awful at poetry\nWait, this really worked") myfile = open("example.txt", "r") for line in myfile : print(line.strip("\n")) # There are other options instead of looping over each line. # You can instead use myfile.read(). # Writing : you can dump a variable using myfile.write() # after having opened it in "w" mode. # There are many other ways to read and write files, # including ways to read and write CSV directly. A = list(range(4, 29, 3)) print(A) B = [a**2 for a in A] print(B) B += B[::-1] print(B) def addflip(mylist) : squared = [element**2 for element in mylist] return squared + squared[::-1] print(addflip(range(5))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Strings are delimited by ", but can also use '. This is useful because you can now use one set of quotes inside another, and it'll still be one big string. Step2: Variables don't need to be given a type, as Python is dynamically-typed. That means if I wanted to reuse s as an integer, Python would have no issue with that. Step3: Single-line comments use #. Step4: This statement is equivalent to saying s = s + 2**3, it's just shorthand. Also works with Step5: The == operator is the comparison operator. Here, we also see Python's syntax for logical statements Step6: Strings can be concatenated using the + operator. The len() function returns the length of a string. Step7: Python accesses elements in lists from 0, not from 1 as in Matlab or R. This will be familiar to C and Java users. Step8: Lists have several methods ( count, sort, reverse, pop, insert, remove, ... ). Here are a few. Step9: Any thoughts on why len() is a global function in Python, and not a method of the list object ? Step10: Note the indentation. Loops in Python don't get delimited by brackets like in C or R. Each block gets its own indentation. Step11: The keyword in can also be used to check whether something is in a container Step12: If you wanted to loop by indexing the list, we can use range(), which, in its simplest ( single-argument ) form, returns a list from 0 to that element minus 1. Step13: Another way to do this is the enumerate function Step14: What about if statements ? Step15: Notice how the contents of the while loop are indented, and then code that is outside the loop continues unindented below. Step16: Here, we used range() with two arguments. In Python 2, it generates a list from the first argument to the second argument minus 1. In Python 3, it returns an immutable iterable, but you can cast it to a list by calling something like list(range(5)). Also, note that we can feed the print function several things to print, separated by a comma. Step17: More Lists Step18: What are the middle three elements ? Let's use the Step19: We don't need to give a start or an end Step20: Can we access the last element ? What about the last two ? Step21: Earlier, we saw that range() can take two arguments Step22: The Step23: What if I don't want to explicitly remember the size of the list ? Step24: List arithmetic ? Step25: Dictionaries Step26: There are a couple of other built-in containers, like tuples and sets. I won't go into them here, plainly because I have to use them so rarely that it's not worth the time during the session. If you want to read up Step27: Functions Step28: Looks good. We've just defined a function that takes one argument, n, and returns something based on what n is. The Fibonacci function is quite particular because it calls itself ( recursion ), but it's a small, fun example, so why not. Step29: Here, %d is a format code for integer. %f is for floating point numbers ( floats ), and %s is for strings. Step30: Also worth knowing are \n and \t Step31: File IO Step32: Syntax Exercises
5,223
<ASSISTANT_TASK:> Python Code: #instantiate our environment import os import sys %matplotlib inline import pandas as pd import statsmodels.api as sm # read the data into a pandas dataframe df = pd.read_csv("read_depth.strains.tsv", header=0, delimiter="\t") print("Shape: {}".format(df.shape)) df.head() dfa = df[(df["A_read_depth"] > 0) & (df["A_strains"] > 0)] dfb = df[(df["B_read_depth"] > 0) & (df["B_strains"] > 0)] dfc = df[(df["C_read_depth"] > 0) & (df["C_strains"] > 0)] print("Shape: {}".format(dfa.shape)) dfa.head() ax = dfa.plot('A_read_depth', 'A_strains', kind='scatter') ax.set(ylabel="# strains", xlabel="read depth") dfas = dfa[dfa['A_read_depth'] < 1000] print("Shape: {}".format(dfas.shape)) ax = dfas.plot('A_read_depth', 'A_strains', kind='scatter') ax.set(ylabel="# strains", xlabel="read depth") model = sm.OLS(dfa['A_strains'], dfa['A_read_depth']).fit() predictions = model.predict(dfa['A_read_depth']) model.summary() model = sm.OLS(dfas['A_strains'], dfas['A_read_depth']).fit() predictions = model.predict(dfas['A_read_depth']) model.summary() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Filter the data Step2: Note that we have reduced our matrix from having 11,054 entries with all the zeros to only having 1,397 entries now! Step3: Note that this plot is skewed by a few outliers. Lets limit it to anything where read_depth < 1000 and redraw the plot Step4: When we zoom in, this doesn't look like a strong correlation. Note that there are a lot of data points here compared to the whole data set. In the data set excluding (0,0) we had 1,397 entries, and now we have 1,386 entries, so we only removed 9 values! Step5: Removing the outliers
5,224
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np import csv from altair import Chart, X, Y, Axis, SortField import matplotlib.pyplot as plt pd.__version__ %matplotlib inline total = pd.read_csv("../data/database2017.csv") total.shape total.tail() totallast30 = total.sort_values(by='created_at',ascending=False)[:30] totallast30.plot(kind="bar", x=totallast30["entry_id"], title="Consumo de energia dispositivo", legend=True) Chart(totallast30).mark_bar().encode(x="created_at", y="field1") Chart(totallast30).mark_bar().encode(y='created_at', x='field1') Chart(totallast30).mark_bar().encode( x=X('field1'), y=Y('created_at'), color='entry_id') Chart(totallast30).mark_bar().encode( x=X('created_at:O', axis=Axis(title='Project')), y=Y('field1:Q', axis=Axis(title='2014 Budget')), color='entry_id') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Leitura dos últimos 30 registros Step2: Faço a leitura dos últimos 30 registros no arquivo para mostrar em gráfico a evolução do consumo da bateria. Pode ser notado que fiquei alguns meses sem coletar informações da campainha por problema técnico com o gateway. Mesmo retornando o equipamento verifiquei que está bem baixo o consumo do dispositivo. Step3: entry_id
5,225
<ASSISTANT_TASK:> Python Code: import hail as hl hl.utils.get_movie_lens('data/') users = hl.read_table('data/users.ht') users.filter(users.occupation == 'programmer').count() users.aggregate(hl.agg.filter(users.occupation == 'programmer', hl.agg.count())) users.aggregate(hl.agg.counter(users.occupation == 'programmer'))[True] missing_occupations = hl.set(['other', 'none']) t = users.annotate( cleaned_occupation = hl.cond(missing_occupations.contains(users.occupation), hl.null('str'), users.occupation)) t.show() users.show() users.describe() users.select(users.sex, users.occupation).show() mean_age = round(users.aggregate(hl.agg.stats(users.age)).mean) users.select(users.sex, users.occupation, mean_shifted_age = users.age - mean_age).show() missing_occupations = hl.set(['other', 'none']) t = users.select( cleaned_occupation = hl.cond(missing_occupations.contains(users.occupation), hl.null('str'), users.occupation)) t.show() missing_occupations = hl.set(['other', 'none']) t = users.transmute( cleaned_occupation = hl.cond(missing_occupations.contains(users.occupation), hl.null('str'), users.occupation)) t.show() t = users.annotate_globals(cohort = 5, cloudable = hl.set(['sample1', 'sample10', 'sample15'])) t.describe() t.cloudable hl.eval(t.cloudable) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We can also express this query in multiple ways using aggregations Step2: Annotate Step3: Compare this to what we had before Step4: Note Step5: Select and Transmute Step6: We can also create a new field that stores the age relative to the average. Note that new fields must be assigned a name (in this case mean_shifted_age) Step7: transmute replaces any fields mentioned on the right-hand side with the new fields, but leaves unmentioned fields unchanged. transmute is useful for transforming data into a new form. Compare the following two snippts of code. The second is identical to the first with transmute replacing select. Step8: Global Fields
5,226
<ASSISTANT_TASK:> Python Code: # These are all the modules we'll be using later. Make sure you can import them # before proceeding further. from __future__ import print_function import numpy as np import tensorflow as tf from six.moves import cPickle as pickle from six.moves import range pickle_file = 'notMNIST.pickle' with open(pickle_file, 'rb') as f: save = pickle.load(f) train_dataset = save['train_dataset'] train_labels = save['train_labels'] valid_dataset = save['valid_dataset'] valid_labels = save['valid_labels'] test_dataset = save['test_dataset'] test_labels = save['test_labels'] del save # hint to help gc free up memory print('Training set', train_dataset.shape, train_labels.shape) print('Validation set', valid_dataset.shape, valid_labels.shape) print('Test set', test_dataset.shape, test_labels.shape) image_size = 28 num_labels = 10 def reformat(dataset, labels): dataset = dataset.reshape((-1, image_size * image_size)).astype(np.float32) # Map 0 to [1.0, 0.0, 0.0 ...], 1 to [0.0, 1.0, 0.0 ...] labels = (np.arange(num_labels) == labels[:,None]).astype(np.float32) return dataset, labels train_dataset, train_labels = reformat(train_dataset, train_labels) valid_dataset, valid_labels = reformat(valid_dataset, valid_labels) test_dataset, test_labels = reformat(test_dataset, test_labels) print('Training set', train_dataset.shape, train_labels.shape) print('Validation set', valid_dataset.shape, valid_labels.shape) print('Test set', test_dataset.shape, test_labels.shape) # With gradient descent training, even this much data is prohibitive. # Subset the training data for faster turnaround. train_subset = 10000 graph = tf.Graph() with graph.as_default(): # Input data. # Load the training, validation and test data into constants that are # attached to the graph. tf_train_dataset = tf.constant(train_dataset[:train_subset, :]) tf_train_labels = tf.constant(train_labels[:train_subset]) tf_valid_dataset = tf.constant(valid_dataset) tf_test_dataset = tf.constant(test_dataset) # Variables. # These are the parameters that we are going to be training. The weight # matrix will be initialized using random valued following a (truncated) # normal distribution. The biases get initialized to zero. weights = tf.Variable( tf.truncated_normal([image_size * image_size, num_labels])) biases = tf.Variable(tf.zeros([num_labels])) # Training computation. # We multiply the inputs with the weight matrix, and add biases. We compute # the softmax and cross-entropy (it's one operation in TensorFlow, because # it's very common, and it can be optimized). We take the average of this # cross-entropy across all training examples: that's our loss. logits = tf.matmul(tf_train_dataset, weights) + biases loss = tf.reduce_mean( tf.nn.softmax_cross_entropy_with_logits(logits, tf_train_labels)) # Optimizer. # We are going to find the minimum of this loss using gradient descent. optimizer = tf.train.GradientDescentOptimizer(0.5).minimize(loss) # Predictions for the training, validation, and test data. # These are not part of training, but merely here so that we can report # accuracy figures as we train. train_prediction = tf.nn.softmax(logits) valid_prediction = tf.nn.softmax( tf.matmul(tf_valid_dataset, weights) + biases) test_prediction = tf.nn.softmax(tf.matmul(tf_test_dataset, weights) + biases) num_steps = 801 def accuracy(predictions, labels): return (100.0 * np.sum(np.argmax(predictions, 1) == np.argmax(labels, 1)) / predictions.shape[0]) with tf.Session(graph=graph) as session: # This is a one-time operation which ensures the parameters get initialized as # we described in the graph: random weights for the matrix, zeros for the # biases. tf.initialize_all_variables().run() print('Initialized') for step in range(num_steps): # Run the computations. We tell .run() that we want to run the optimizer, # and get the loss value and the training predictions returned as numpy # arrays. _, l, predictions = session.run([optimizer, loss, train_prediction]) if (step % 100 == 0): print('Loss at step %d: %f' % (step, l)) print('Training accuracy: %.1f%%' % accuracy( predictions, train_labels[:train_subset, :])) # Calling .eval() on valid_prediction is basically like calling run(), but # just to get that one numpy array. Note that it recomputes all its graph # dependencies. print('Validation accuracy: %.1f%%' % accuracy( valid_prediction.eval(), valid_labels)) print('Test accuracy: %.1f%%' % accuracy(test_prediction.eval(), test_labels)) batch_size = 128 graph = tf.Graph() with graph.as_default(): # Input data. For the training data, we use a placeholder that will be fed # at run time with a training minibatch. tf_train_dataset = tf.placeholder(tf.float32, shape=(batch_size, image_size * image_size)) tf_train_labels = tf.placeholder(tf.float32, shape=(batch_size, num_labels)) tf_valid_dataset = tf.constant(valid_dataset) tf_test_dataset = tf.constant(test_dataset) # Variables. weights = tf.Variable( tf.truncated_normal([image_size * image_size, num_labels])) biases = tf.Variable(tf.zeros([num_labels])) # Training computation. logits = tf.matmul(tf_train_dataset, weights) + biases loss = tf.reduce_mean( tf.nn.softmax_cross_entropy_with_logits(logits, tf_train_labels)) # Optimizer. optimizer = tf.train.GradientDescentOptimizer(0.5).minimize(loss) # Predictions for the training, validation, and test data. train_prediction = tf.nn.softmax(logits) valid_prediction = tf.nn.softmax( tf.matmul(tf_valid_dataset, weights) + biases) test_prediction = tf.nn.softmax(tf.matmul(tf_test_dataset, weights) + biases) num_steps = 3001 with tf.Session(graph=graph) as session: tf.initialize_all_variables().run() print("Initialized") for step in range(num_steps): # Pick an offset within the training data, which has been randomized. # Note: we could use better randomization across epochs. offset = (step * batch_size) % (train_labels.shape[0] - batch_size) # Generate a minibatch. batch_data = train_dataset[offset:(offset + batch_size), :] batch_labels = train_labels[offset:(offset + batch_size), :] # Prepare a dictionary telling the session where to feed the minibatch. # The key of the dictionary is the placeholder node of the graph to be fed, # and the value is the numpy array to feed to it. feed_dict = {tf_train_dataset : batch_data, tf_train_labels : batch_labels} _, l, predictions = session.run( [optimizer, loss, train_prediction], feed_dict=feed_dict) if (step % 500 == 0): print("Minibatch loss at step %d: %f" % (step, l)) print("Minibatch accuracy: %.1f%%" % accuracy(predictions, batch_labels)) print("Validation accuracy: %.1f%%" % accuracy( valid_prediction.eval(), valid_labels)) print("Test accuracy: %.1f%%" % accuracy(test_prediction.eval(), test_labels)) ########################################################################## ## Turning logistic regression to 1-hidden layer neural net with nn.relu batch_size = 128 hidden_nodes = 1024 graph = tf.Graph() with graph.as_default(): # Input data. For the training data, we use a placeholder that will be fed # at run time with a training minibatch. tf_train_dataset = tf.placeholder(tf.float32, shape=(batch_size, image_size * image_size)) tf_train_labels = tf.placeholder(tf.float32, shape=(batch_size, num_labels)) tf_valid_dataset = tf.constant(valid_dataset) tf_test_dataset = tf.constant(test_dataset) # Layer 1 l1_weights = tf.Variable(tf.truncated_normal([image_size * image_size, hidden_nodes])) l1_biases = tf.Variable(tf.zeros([hidden_nodes])) l1_logits = tf.matmul(tf_train_dataset, l1_weights) + l1_biases l1_output = tf.nn.relu(l1_logits) # Layer 2 l2_weights = tf.Variable(tf.truncated_normal([hidden_nodes, num_labels])) l2_biases = tf.Variable(tf.truncated_normal([num_labels])) l2_logits = tf.matmul(l1_output, l2_weights) + l2_biases # Loss loss = tf.reduce_mean(tf.nn.softmax_cross_entropy_with_logits(l2_logits, tf_train_labels)) # Optimizer. optimizer = tf.train.GradientDescentOptimizer(0.5).minimize(loss) # Predictions for the training, validation, and test data. train_prediction = tf.nn.softmax(l2_logits) l1_logits = tf.matmul(tf_valid_dataset, l1_weights) + l1_biases l1_output = tf.nn.relu(l1_logits) l2_logits = tf.matmul(l1_output, l2_weights) + l2_biases valid_prediction = tf.nn.softmax(l2_logits) l1_logits = tf.matmul(tf_test_dataset, l1_weights) + l1_biases l1_output = tf.nn.relu(l1_logits) l2_logits = tf.matmul(l1_output, l2_weights) + l2_biases test_prediction = tf.nn.softmax(l2_logits) num_steps = 3001 with tf.Session(graph=graph) as session: tf.initialize_all_variables().run() print("Initialized") for step in range(num_steps): # Pick an offset within the training data, which has been randomized. # Note: we could use better randomization across epochs. offset = (step * batch_size) % (train_labels.shape[0] - batch_size) # Generate a minibatch. batch_data = train_dataset[offset:(offset + batch_size), :] batch_labels = train_labels[offset:(offset + batch_size), :] # Prepare a dictionary telling the session where to feed the minibatch. # The key of the dictionary is the placeholder node of the graph to be fed, # and the value is the numpy array to feed to it. feed_dict = {tf_train_dataset : batch_data, tf_train_labels : batch_labels} _, l, predictions = session.run( [optimizer, loss, train_prediction], feed_dict=feed_dict) if (step % 500 == 0): print("Minibatch loss at step %d: %f" % (step, l)) print("Minibatch accuracy: %.1f%%" % accuracy(predictions, batch_labels)) print("Validation accuracy: %.1f%%" % accuracy( valid_prediction.eval(), valid_labels)) print("Test accuracy: %.1f%%" % accuracy(test_prediction.eval(), test_labels)) print(train_labels.shape[0]) print(batch_data.shape) print(batch_labels.shape) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: First reload the data we generated in 1_notmnist.ipynb. Step2: Reformat into a shape that's more adapted to the models we're going to train Step3: We're first going to train a multinomial logistic regression using simple gradient descent. Step4: Let's run this computation and iterate Step5: Let's now switch to stochastic gradient descent training instead, which is much faster. Step6: Let's run it Step7: Problem
5,227
<ASSISTANT_TASK:> Python Code: import numpy as np import matplotlib import matplotlib.pyplot as plt from mpl_toolkits.mplot3d import Axes3D %matplotlib inline EI = 5000. #kN m^2 H = 3600. #kN m/m F1 = -2600. #kN F2 = -3600. #kN F3 = -4600. #kN phi = np.linspace(np.pi, -np.pi, 501) theta0 = np.arccos(H/F3) phi3 = np.linspace(theta0, - theta0, 501) N1 = F1*np.cos(phi) Q1 = -F1*np.sin(phi) M1 = -np.sqrt(2*EI*(H - N1)) # sign is consistent with the choice of sense for theta N2 = F2*np.cos(phi) Q2 = -F2*np.sin(phi) M2 = -np.sqrt(2*EI*(H - N2)) N3 = F3*np.cos(phi3) Q3 = -F3*np.sin(phi3) M3 = -np.sqrt(2*EI*(H - N3)) fig = plt.figure(figsize=(9., 9.)) ax = fig.gca(projection='3d') ax.plot(N1, Q1, M1, color='r') ax.plot(N1, Q1, -M1, color='r') ax.plot(N2, Q2, M2, color='g') ax.plot(N2, Q2, -M2, color='g') ax.plot(N3, Q3, M3, color='b') ax.plot(N3, Q3, -M3, color='b') ax.set_xlabel('$N$') ax.set_ylabel('$V$') ax.set_zlabel('$M$') print('F= {0:.0f} kN, H = {1:.0f} kN m/m, theta_0 = {2:.5f} rad'.format(F3, H, theta0)) sectionForces = [] N0 = F3*np.cos(theta0) Q0 = -F3*np.sin(theta0) M0 = 0. sectionForces.append([N0, Q0, M0]) nEdges = 50 h = 0.1 Nn = N0 Qn = Q0 Mn = M0 for n1 in range(1, nEdges+1): Nn1 = Nn*np.cos(h*(Mn - h*Qn/4)/EI) + Qn*np.sin(h*(Mn - h*Qn/4)/EI) Qn1 = Qn*np.cos(h*(Mn - h*Qn/4)/EI) - Nn*np.sin(h*(Mn - h*Qn/4)/EI) Mn1 = Mn - 0.5*h*(Qn + Qn1) sectionForces.append([Nn1, Qn1, Mn1]) Nn = Nn1 Qn = Qn1 Mn = Mn1 axialForce = np.array([force[0] for force in sectionForces]) shearForce = np.array([force[1] for force in sectionForces]) bendingMoment = np.array([force[2] for force in sectionForces]) H = bendingMoment**2/2/EI + axialForce fig = plt.figure(figsize=(9., 9.)) ax = fig.gca(projection='3d') ax.plot(N3, Q3, M3, color='b') ax.plot(N3, Q3, -M3, color='b') ax.scatter(axialForce, shearForce, bendingMoment, color='r') ax.set_xlabel('$N$') ax.set_ylabel('$Q$') ax.set_zlabel('$M$') fig = plt.figure(figsize=(7., 7.)) ax = fig.gca() ax.plot(np.linspace(0, h*nEdges, nEdges+1), H) ax.set_xlabel('$s$') ax.set_ylabel('$\mathcal{H}$') import scipy.optimize def implicitMidpoint(Xn1, Xn, h, EI): f = np.empty(3) f[0] = Xn1[0] - Xn[0] - h*(Xn[1] + Xn1[1])*(Xn[2] + Xn1[2])/4./EI f[1] = Xn1[1] - Xn[1] + h*(Xn[0] + Xn1[0])*(Xn[2] + Xn1[2])/4./EI f[2] = Xn1[2] - Xn[2] + h*(Xn[1] + Xn1[1])/2. return f sectionForces = [] N0 = F3*np.cos(theta0) Q0 = -F3*np.sin(theta0) M0 = 0. sectionForces.append([N0, Q0, M0]) nEdges = 50 h = 0.1 Xn = np.array([N0, Q0, M0]) for n1 in range(1, nEdges+1): eqSystem = lambda Xn1: implicitMidpoint(Xn1, Xn, h, EI) solution = scipy.optimize.root(eqSystem, Xn) Xn1 = solution.x sectionForces.append(Xn1) Xn = Xn1 axialForce = np.array([force[0] for force in sectionForces]) shearForce = np.array([force[1] for force in sectionForces]) bendingMoment = np.array([force[2] for force in sectionForces]) H = bendingMoment**2/2/EI + axialForce fig = plt.figure(figsize=(9., 9.)) ax = fig.gca(projection='3d') ax.plot(N3, Q3, M3, color='b') ax.plot(N3, Q3, -M3, color='b') ax.scatter(axialForce, shearForce, bendingMoment, color='r') ax.set_xlabel('$N$') ax.set_ylabel('$Q$') ax.set_zlabel('$M$') fig = plt.figure(figsize=(7., 7.)) ax = fig.gca() ax.plot(np.linspace(0, h*nEdges, nEdges+1), H) ax.set_xlabel('$s$') ax.set_ylabel('$\mathcal{H}$') EI = 5000. #kN m^2 H = 3600. #kN m/m F = -4600. #kN theta0 = np.arccos(H/F) theta = np.linspace(theta0, -theta0, nEdges+1) N = F*np.cos(theta) Q = -F*np.sin(theta) M = -np.sqrt(2*EI*(H - N)) h = [] for n in range(nEdges): hNn = 4*EI*(N[n+1] - N[n])/(Q[n] + Q[n+1])/(M[n] + M[n+1]) hQn = -4*EI*(Q[n+1] - Q[n])/(N[n] + N[n+1])/(M[n] + M[n+1]) hMn = -2*(M[n+1] - M[n])/(Q[n] + Q[n+1]) h.append([hNn, hQn, hMn]) # h h = [] for n in range(nEdges): hn = -2*(M[n+1] - M[n])/(Q[n] + Q[n+1]) h.append(hn) print('The length of the rod is {:.3f} m'.format(np.sum(h))) kappa = M / EI phi = np.zeros(nEdges) rotor = np.zeros(nEdges) + 1j*np.zeros(nEdges) for n in range(1, nEdges): phi[n] = 2.*np.arctan(kappa[n]*(h[n-1] + h[n])/4.) rotor[n] = (4./(h[n-1] + h[n]) + 1j * kappa[n])/(4./(h[n-1] + h[n]) - 1j * kappa[n]) np.sum(phi)/2 phi[0] = theta0 rotor[0] = np.exp(1j*phi[0]) gamma = np.zeros(len(kappa)) + 1j*np.zeros(len(kappa)) gamma[0] = 0.+0j gamma[1] = gamma[0] + h[0]*rotor[0] for n in range(1, len(kappa)-1): gamma[n+1] = gamma[n] + h[n]/h[n-1] * (gamma[n] - gamma[n-1]) * rotor[n] fig = plt.figure(figsize=(9,9)) ax = fig.gca(aspect='equal') ax.plot(gamma.real, gamma.imag, color='b') ax.set_xlabel('$x$') ax.set_ylabel('$y$') print('Total rotation at the orbit: {:.5f}*pi rad'.format((theta[-1] - theta[0])/np.pi)) print('Total rotation computed with DDG: {:.5f}*pi rad'.format((np.sum(phi) - phi[0])/np.pi)) EI = 5000. #kN m^2 H = 3600. #kN m/m F = -4600. #kN nEdges = 200 nVertex = nEdges + 1 theta0 = np.arccos(H/F) theta = np.linspace(theta0, -theta0, nVertex) N = F*np.cos(theta) Q = -F*np.sin(theta) M = -np.sqrt(2*EI*(H - N)) h = np.zeros(nEdges) h[:] = -2*(M[1:] - M[0:-1])/(Q[0:-1] + Q[1:]) # pythonic looping print('The length of the rod is {:.3f} m'.format(np.sum(h))) kappa = M / EI phi = np.zeros(nVertex-1) rotor = np.zeros(nVertex-1) + 1j*np.zeros(nVertex-1) phi[0] = theta0 phi[1:] = 2.*np.arctan(kappa[1:-1]*(h[0:-1] + h[1:])/4.) rotor[0] = np.exp(1j*phi[0]) rotor[1:] = (4./(h[0:-1] + h[1:]) + 1j * kappa[1:-1])/(4./(h[0:-1] + h[1:]) - 1j * kappa[1:-1]) gamma = np.zeros(nVertex) + 1j*np.zeros(nVertex) gamma[0] = 0.+0j gamma[1] = gamma[0] + h[0]*rotor[0] for n in range(1, nVertex-1): gamma[n+1] = gamma[n] + h[n]/h[n-1] * (gamma[n] - gamma[n-1]) * rotor[n] fig = plt.figure(figsize=(9,9)) ax = fig.gca(aspect='equal') ax.plot(gamma.real, gamma.imag, color='b') ax.set_xlabel('$x$') ax.set_ylabel('$y$') print('Total rotation at the orbit: {:.5f}*pi rad'.format((theta[-1] - theta[0])/np.pi)) print('Total rotation computed with DDG: {:.5f}*pi rad'.format((np.sum(phi) - phi[0])/np.pi)) EI = 5000. #kN m^2 H = 3600. #kN m/m F = -3500. #kN nEdges = 50 nVertex = nEdges + 1 if F > H: theta0 = np.arccos(H/F) else: theta0 = np.pi theta = np.linspace(theta0, -theta0, nVertex) N = F*np.cos(theta) Q = -F*np.sin(theta) M = -np.sqrt(2*EI*(H - N)) h = np.zeros(nEdges) h[:] = -2*(M[1:] - M[0:-1])/(Q[0:-1] + Q[1:]) kappa = M / EI phi = np.zeros(nVertex-1) rotor = np.zeros(nVertex-1) + 1j*np.zeros(nVertex-1) phi[0] = theta0 phi[1:] = 2.*np.arctan(kappa[1:-1]*(h[0:-1] + h[1:])/4.) rotor[0] = np.exp(1j*phi[0]) rotor[1:] = (4./(h[0:-1] + h[1:]) + 1j * kappa[1:-1])/(4./(h[0:-1] + h[1:]) - 1j * kappa[1:-1]) gamma = np.zeros(nVertex) + 1j*np.zeros(nVertex) gamma[0] = 0.+0j gamma[1] = gamma[0] + h[0]*rotor[0] for n in range(1, nVertex-1): gamma[n+1] = gamma[n] + h[n]/h[n-1] * (gamma[n] - gamma[n-1]) * rotor[n] fig = plt.figure(figsize=(9,9)) ax = fig.gca(aspect='equal') ax.plot(gamma.real, gamma.imag, color='b') ax.set_xlabel('$x$') ax.set_ylabel('$y$') print('Total rotation at the orbit: {:.5f}*pi rad'.format((theta[-1] - theta[0])/np.pi)) print('Total rotation computed with DDG: {:.5f}*pi rad'.format((np.sum(phi) - phi[0])/np.pi)) EI = 5000. #kN m^2 H = 3600. #kN m/m F = -3500. #kN nEdges = 50 nVertex = nEdges + 1 if F > H: theta0 = np.arccos(H/F) else: theta0 = np.pi theta = np.linspace(theta0, -theta0, nVertex) N = F*np.cos(theta) Q = -F*np.sin(theta) M = -np.sqrt(2*EI*(H - N)) h = np.zeros(nEdges) h[:] = -2*(M[1:] - M[0:-1])/(Q[0:-1] + Q[1:]) kappa = M / EI phi = np.zeros(nVertex-1) rotor = np.zeros(nVertex-1) + 1j*np.zeros(nVertex-1) phi[0] = theta0 + np.arctan(h[0]*kappa[0]/2) # modified code line phi[1:] = 2.*np.arctan(kappa[1:-1]*(h[0:-1] + h[1:])/4.) rotor[0] = np.exp(1j*phi[0]) rotor[1:] = (4./(h[0:-1] + h[1:]) + 1j * kappa[1:-1])/(4./(h[0:-1] + h[1:]) - 1j * kappa[1:-1]) gamma = np.zeros(nVertex) + 1j*np.zeros(nVertex) gamma[0] = 0.+0j gamma[1] = gamma[0] + h[0]*rotor[0] for n in range(1, nVertex-1): gamma[n+1] = gamma[n] + h[n]/h[n-1] * (gamma[n] - gamma[n-1]) * rotor[n] fig = plt.figure(figsize=(9,9)) ax = fig.gca(aspect='equal') ax.plot(gamma.real, gamma.imag, color='b') ax.set_xlabel('$x$') ax.set_ylabel('$y$') print('The y coordinate at the end section is now y = {:.7f} m'.format(gamma[-1].imag)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 4.1.1 Visualizing the section force orbits Step2: 4.1.2 Numerical solution of the equilibrium equations Step3: The result shows that this numerical method does not preserve the Hamiltonian. Therefore, we try now with the implicit midpoint rule, which according to Hairer et al. (2006), p. 247 preserves quadratic invariants Step4: This method yields an excellent result. However, if we are thinking in a formfinding problem of a pinned rod, we can't control that the endpoint of our solution falls on the endpoint of the rod. Therefore we will try another experiment using the recurrent step of the implicit midpoint rule. Step5: We are testing if the interval values computed from each formula are consistent Step6: The experiment succeeds; if we examin the result for $h$, we see that every formula produces exactly the same results in each step. We have a straightforward and simple method to compute section forces and rod length for a prescribed traction and Hamiltonian. Step7: 4.2 Spatial case Step8: Let's pack the code into a single tool and do a new experiment Step9: We make a new experiment, this time with $F<\mathcal{H}$ which means that there are moments at the end sections Step10: It is easy to observe that the solution is "rotated" compared to the expected one. The reason of this behavior is that no rotation has been considered at the start node, but there is rotation caused by the non-zero curvature at the start section. Let's modify the code to fix this issue. For this purpose we will add to the initial (reference) angle, half of the angle corresponding to the curvature at the start section, and we will take $h_0$ as averaging length for the curvature
5,228
<ASSISTANT_TASK:> Python Code: client = pymongo.MongoClient("46.101.236.181") db = client.allfake # get collection names collections = sorted([collection for collection in db.collection_names()]) day = {} # number of tweets per day per collection diff = {} # cumullative diffusion on day per colletion for collection in collections: # timeframe relevant_from = db[collection].find().sort("timestamp", pymongo.ASCENDING).limit(1)[0]['timestamp'] relevant_till = db[collection].find().sort("timestamp", pymongo.DESCENDING).limit(1)[0]['timestamp'] i = 0 day[collection] = [] # number of tweets for every collection for every day diff[collection] = [] # cummulative diffusion for every collection for every day averagediff = [] # average diffusion speed for every day for all news d = relevant_from delta = datetime.timedelta(days=1) while d <= relevant_till: # tweets per day per collection day[collection].append(db[collection].find({"timestamp":{"$gte": d, "$lt": d + delta}}).count()) # cummulative diffusion per day per collection if i == 0: diff[collection].append( day[collection][i] ) else: diff[collection].append( diff[collection][i-1] + day[collection][i] ) d += delta i += 1 # the longest duration of diffusion among all news headlines max_days = max([len(day[coll]) for coll in \ [days_col for days_col in day] ]) summ_of_diffusions = [0] * max_days # summary diffusion for every day # calculate summary diffusion for every day for d in range(max_days): for c in collections: # if there is an entry for this day for this collection, add its number of tweets to the number of this day if d < len(day[c]): summ_of_diffusions[d] += day[c][d] plt.step(range(len(summ_of_diffusions)),summ_of_diffusions, 'g') plt.xlabel('Day') plt.ylabel('Number of tweets') plt.title('Diffusion of all fake news together') plt.show() summ_of_diffusions_cumulative = [0] * max_days summ_of_diffusions_cumulative[0] = summ_of_diffusions[0] for d in range(1, max_days): summ_of_diffusions_cumulative[d] += summ_of_diffusions_cumulative[d-1] + summ_of_diffusions[d] plt.step(range(len(summ_of_diffusions_cumulative)),summ_of_diffusions_cumulative, 'g') plt.xlabel('Day') plt.ylabel('Cummulative number of tweets') plt.title('Cummulative diffusion of all fake news together') plt.show() for collection in collections: plt.step([d+1 for d in range(len(diff[collection]))], diff[collection]) plt.xlabel('Day') plt.ylabel('Cumulative tweets number') plt.title('Cumulative diffusion for fake news headlines') plt.show() averagediff = [0 for _ in range(max_days)] # average diffusion per day for collection in collections: for i,d in enumerate(day[collection]): averagediff[i] += d / len(collections) plt.xlabel('Day') plt.ylabel('Average number of tweets') plt.step(range(1,len(averagediff)+1),averagediff, 'r') plt.title('Average diffusion of fake news') plt.show() plt.yscale('log') plt.xlabel('Day') plt.ylabel('Average number of tweets') plt.step(range(1,len(averagediff)+1),averagediff, 'r') plt.show() # export some data to another notebook averagediff_fake = averagediff %store averagediff_fake avgdiff_std = [0 for _ in range(max_days)] # standard deviation for every day for all collections number_tweets = [[] for _ in range(max_days)] # number of tweets for every day for every collection for d in range(max_days): for c in collections: # if there is an entry for this day for this collection if d < len(day[c]): # add number of tweets for this day for this colletion to the number_tweets for this day number_tweets[d].append(day[c][d]) # calculate standard deviation for this day avgdiff_std[d] = np.std(number_tweets[d]) plt.ylabel('Standart deviation for average number of tweets per day') plt.xlabel('Day') plt.step(range(1,len(avgdiff_std)+1),avgdiff_std, 'r') plt.title('Standard deviation for fake news average') plt.show() inside_std = [0 for _ in range(max_days)] # number of values inside one standard deviation for every day inside_std_share = [0 for _ in range(max_days)] # share of values inside one standard deviation for every day for d in range(max_days): for c in collections: # set borders of mean plusminus one std lowest = averagediff[d] - avgdiff_std[d] highest = averagediff[d] + avgdiff_std[d] # if there is entray for this day for this collection and its value is inside the borderes if d < len(day[c]) and (day[c][d] >= lowest and day[c][d] <= highest): # increment number of values inside one std for this day inside_std[d] += 1 # calculate the share of values inside one std for this day inside_std_share[d] = inside_std[d] / float(len(number_tweets[d])) plt.ylabel('Percent of values in 1 std from average') plt.xlabel('Day') plt.scatter(range(1,len(inside_std_share)+1),inside_std_share, c='r') plt.title('Percentage of values inside the range\n of one standard deviation from mean for fake news') plt.show() averagediff_fake = averagediff %store averagediff_fake %store -r averagediff_real plt.xlabel('Day') plt.ylabel('Average number of tweets') plt.step(range(1,len(averagediff)+1),averagediff, 'r', label="fake news") plt.step(range(1,len(averagediff_real)+1),averagediff_real, 'g', label="real news") plt.legend() plt.title('Average diffusion for both types of news') plt.show() plt.ylabel('Average number of tweets') plt.xlabel('Day') plt.yscale('log') plt.step(range(1,len(averagediff)+1),averagediff, 'r', label="fake news") plt.step(range(1,len(averagediff_real)+1),averagediff_real, 'g', label="real news") plt.legend() plt.title('Average diffusion for both types of news in logarithmic scale') plt.show() diffDurationAvg = 0; # average duration of diffusion durations = [len(day[col]) for col in collections] # all durations diffDurationAvg = np.mean(durations) # mean duration diffDurationAvg_std = np.std(durations) # standard deviation for the mean print "Average diffusion duration: %.2f days" % diffDurationAvg print "Standard deviation: %.2f days" % diffDurationAvg_std <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Count number of tweets per day for every news, calculate cummulative diffusion Step2: Plot diffusion for every day for all news together Step3: Plot cummulative diffusion of all news together Step4: Plot cummulative diffusion for every news headline Step5: Average diffusion per day for all news Step6: The same graph but in logrithmic scale Step7: Calculate and plot standart deviation Step8: Calculate and share of values inside one standard deviation for every day Step9: Store average diffusion data on hard drive to use by another jupyter notebook Step10: Plot average diffusion for both real and fake news on one graph Step11: In logarithmic scale Step12: Calculate average diffusion duration (number of days until difussion is dead)
5,229
<ASSISTANT_TASK:> Python Code: from euler import Seq, timer def p001(): return ( range(1000) >> Seq.filter(lambda n: (n%3==0) | (n%5==0)) >> Seq.sum) timer(p001) from euler import Seq, timer def p002(): return ( Seq.unfold(lambda (a,b): (b, (b, b+a)), (0,1)) >> Seq.filter(lambda n: n%2==0) >> Seq.takeWhile(lambda n: n<4000000) >> Seq.sum) timer(p002) from euler import Seq, FactorInteger, fst, timer def p003(): return FactorInteger(600851475143) >> Seq.map(fst) >> Seq.max timer(p003) from euler import Seq, timer def p004(): return ( range(100, 1000) >> Seq.collect(lambda a: range(a, 1000) >> Seq.filter(lambda b: str(a*b)[::-1] == str(a*b)) >> Seq.map(lambda b: a*b)) >> Seq.max) timer(p004) from euler import Seq, timer def p004(): return ( [a*b for a in range(100, 1000) for b in range(a, 1000) if str(a*b)[::-1] == str(a*b)] >> Seq.max) timer(p004) from euler import Seq, LCM, timer def p005(): return (range(1,21) >> Seq.reduce(LCM)) timer(p005) from euler import timer, Seq def p006(): return (range(101) >> Seq.sum) ** 2 - (range(101) >> Seq.sumBy(lambda i: i**2)) timer(p006) from euler import timer def p006(): return sum(range(101)) ** 2 - sum(i ** 2 for i in range(101)) timer(p006) from euler import prime, timer def p007(): return prime(10000) timer(p007) from euler import Seq, timer def p007(): return ( "".join(open('data/p008.txt').read().splitlines()) >> Seq.window(5) >> Seq.map(lambda s: s >> Seq.map(int) >> Seq.product) >> Seq.max) timer(p007) from euler import timer, Seq def p009(): return( range(1,999) >> Seq.collect(lambda a: range(a, 1000-a) >> Seq.filter(lambda b: (a**2 + b**2 == (1000-a-b)**2)) >> Seq.map(lambda b: a*b*(1000-a-b))) >> Seq.head) timer(p009) def p009(): return ( [a*b*(1000-a-b) for a in range(1,999) for b in range(a, 1000-a) if (a ** 2 + b ** 2 == (1000-a-b) ** 2)][0]) timer(p009) from euler import Seq, primes, timer def p010(): return ( primes() >> Seq.takeWhile(lambda n: n<2000000) >> Seq.sum) timer(p010) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Even Fibonacci numbers Step2: Largest prime factor Step3: Largest palindrome product Step4: Smallest multiple Step5: Sum square difference Step6: 10001st prime Step7: Largest product in a series Step8: Special Pythagorean triplet Step9: Summation of primes
5,230
<ASSISTANT_TASK:> Python Code: from jyquickhelper import add_notebook_menu add_notebook_menu() %matplotlib inline from numpy import random n = 1000 X = random.rand(n, 2) X[:5] y = X[:, 0] * 3 - 2 * X[:, 1] ** 2 + random.rand(n) y[:5] from sklearn.model_selection import train_test_split X_train, X_test, y_train, y_test = train_test_split(X, y) from sklearn.linear_model import LinearRegression reg = LinearRegression() reg.fit(X_train, y_train) from sklearn.metrics import r2_score score = r2_score(y_test, reg.predict(X_test)) score from sklearn.preprocessing import PolynomialFeatures poly = PolynomialFeatures() poly.fit(X_train) X_train2 = poly.transform(X_train) reg2 = LinearRegression() reg2.fit(X_train2, y_train) score2 = r2_score(y_test, reg2.predict(poly.transform(X_test))) score2 from sklearn.ensemble import RandomForestRegressor rf = RandomForestRegressor() rf.fit(X_train, y_train) r2_score(y_test, rf.predict(X_test)) rf2 = RandomForestRegressor() rf2.fit(X_train2, y_train) r2_score(y_test, rf2.predict(poly.transform(X_test))) X_test2 = random.rand(n, 2) + 0.5 y_test2 = X_test2[:, 0] * 3 - 2 * X_test2[:, 1] ** 2 + random.rand(n) res = [] for model in [reg, reg2, rf, rf2]: name = model.__class__.__name__ try: pred = model.predict(X_test) pred2 = model.predict(X_test2) except Exception: pred = model.predict(poly.transform(X_test)) pred2 = model.predict(poly.transform(X_test2)) name += " + X^2" res.append(dict(name=name, r2=r2_score(y_test, pred), r2_jeu2=r2_score(y_test2, pred2))) import pandas df = pandas.DataFrame(res) df reg2.coef_, reg2.intercept_ import matplotlib.pyplot as plt fig, ax = plt.subplots(1, 2, figsize=(14, 4)) a, b = 0.9, 1.1 index1 = (X_test2[:, 0] >= a) & (X_test2[:, 0] <= b) index2 = (X_test2[:, 1] >= a) & (X_test2[:, 1] <= b) yth = X_test2[:, 0] * 3 - 2 * X_test2[:, 1] ax[0].set_xlabel("X1") ax[0].set_ylabel("Y") ax[0].plot(X_test2[index2, 0], yth[index2], '.', label='Y théorique') ax[1].set_xlabel("X2") ax[1].set_ylabel("Y") ax[1].plot(X_test2[index1, 1], yth[index1], '.', label='Y théorique') for model in [reg, reg2, rf, rf2]: name = model.__class__.__name__ try: pred2 = model.predict(X_test2) except Exception: pred2 = model.predict(poly.transform(X_test2)) name += " + X^2" ax[0].plot(X_test2[index2, 0], pred2[index2], '.', label=name) ax[1].plot(X_test2[index1, 1], pred2[index1], '.', label=name) ax[0].legend() ax[1].legend(); from sklearn.tree import DecisionTreeRegressor res = [] for md in range(1, 20): tree = DecisionTreeRegressor(max_depth=md) tree.fit(X_train, y_train) r2_train = r2_score(y_train, tree.predict(X_train)) r2_test = r2_score(y_test, tree.predict(X_test)) res.append(dict(profondeur=md, r2_train=r2_train, r2_test=r2_test)) df = pandas.DataFrame(res) df.head() ax = df.plot(x='profondeur', y=['r2_train', 'r2_test']) ax.set_title("Evolution du R2 selon la profondeur"); from sklearn.linear_model import Ridge, Lasso import numpy.linalg as nplin import numpy def coef_non_nuls(coef): return sum(numpy.abs(coef) > 0.001) res = [] for d in range(1, 21): poly = PolynomialFeatures(degree=d) poly.fit(X_train) X_test2 = poly.transform(X_test) reg = LinearRegression() reg.fit(poly.transform(X_train), y_train) r2_reg = r2_score(y_test, reg.predict(X_test2)) rid = Ridge(alpha=10) rid.fit(poly.transform(X_train), y_train) r2_rid = r2_score(y_test, rid.predict(X_test2)) las = Lasso(alpha=0.01) las.fit(poly.transform(X_train), y_train) r2_las = r2_score(y_test, las.predict(X_test2)) res.append(dict(degre=d, nb_features=X_test2.shape[1], r2_reg=r2_reg, r2_las=r2_las, r2_rid=r2_rid, norm_reg=nplin.norm(reg.coef_), norm_rid=nplin.norm(rid.coef_), norm_las=nplin.norm(las.coef_), nnul_reg=coef_non_nuls(reg.coef_), nnul_rid=coef_non_nuls(rid.coef_), nnul_las=coef_non_nuls(las.coef_), )) df = pandas.DataFrame(res) df fig, ax = plt.subplots(1, 2, figsize=(12, 4)) df.plot(x="nb_features", y=["r2_reg", "r2_las", "r2_rid"], ax=ax[0]) ax[0].set_xlabel("Nombre de features") ax[0].set_ylim([0, 1]) ax[0].set_title("r2") df.plot(x="nb_features", y=["nnul_reg", "nnul_las", "nnul_rid"], ax=ax[1]) ax[1].set_xlabel("Nombre de features") ax[1].set_title("Nombre de coefficients non nuls"); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Des données synthétiques Step2: Exercice 1 Step3: Exercice 2 Step4: Exercice 3 Step5: Le coefficient $R^2$ est plus élevé car on utilise les mêmes variables que le modèle. Il n'est théoriquement pas possible d'aller au delà. Step6: Le modèle linéaire est le meilleur modèle dans notre cas puisque les données ont été construites de la sorte. Il est attendu que le $R^2$ ne soit pas plus élevé tout du moins pas significativement plus élevé. On regarde avec les features polynômiales... Step7: Avant de tirer des conclusions hâtives, il faudrait recommencer plusieurs fois l'expérience avant de dire que la performance est plus ou moins élevée avec ces features ce que ce notebook ne fera pas puisque la réponse théorique est connue dans ce cas. Step8: Le seul modèle qui s'en tire vraiment est la régression linéaire avec les features polynômiales. Comme il équivaut au modèle théorique, il est normal qu'il ne se plante pas trop même si ses coefficients ne sont pas identique au modèle théorique (il faudrait plus de données pour que cela converge). Step9: Pour les autes modèles, voyons déjà visuellement ce qu'il se passe. Step10: Le graphe étudie les variables des modèles selon une coordonnées tout en restreignant l'autre dans un intervalle donné. On voit tout de suite que la forêt aléatoire devient constante au delà d'un certain seuil. C'est encore une fois tout à fait normal puisque la base d'apprentissage ne contient des $X_1, X_2$ que dans l'intervalle $[0, 1]$. En dehors, chaque arbre de décision produit une valeur constante tout simplement parce que ce sont des fonctions en escalier Step11: Exercice 8
5,231
<ASSISTANT_TASK:> Python Code: # First check the Python version import sys if sys.version_info < (3,4): print('You are running an older version of Python!\n\n', 'You should consider updating to Python 3.4.0 or', 'higher as the libraries built for this course', 'have only been tested in Python 3.4 and higher.\n') print('Try installing the Python 3.5 version of anaconda' 'and then restart `jupyter notebook`:\n', 'https://www.continuum.io/downloads\n\n') # Now get necessary libraries try: import os import numpy as np import matplotlib.pyplot as plt from skimage.transform import resize from skimage import data from scipy.misc import imresize from scipy.ndimage.filters import gaussian_filter import IPython.display as ipyd import tensorflow as tf from libs import utils, gif, datasets, dataset_utils, nb_utils except ImportError as e: print("Make sure you have started notebook in the same directory", "as the provided zip file which includes the 'libs' folder", "and the file 'utils.py' inside of it. You will NOT be able", "to complete this assignment unless you restart jupyter", "notebook inside the directory created by extracting", "the zip file or cloning the github repo.") print(e) # We'll tell matplotlib to inline any drawn figures like so: %matplotlib inline plt.style.use('ggplot') # Bit of formatting because I don't like the default inline code style: from IPython.core.display import HTML HTML(<style> .rendered_html code { padding: 2px 4px; color: #c7254e; background-color: #f9f2f4; border-radius: 4px; } </style>) import tensorflow as tf from six.moves import urllib script = 'http://www.awesomefilm.com/script/biglebowski.txt' txts = [] f, _ = urllib.request.urlretrieve(script, script.split('/')[-1]) with open(f, 'r') as fp: txt = fp.read() txt[:100] txt = "\n".join([txt_i.strip() for txt_i in txt.replace('\t', '').split('\n') if len(txt_i)]) len(txt) vocab = list(set(txt)) vocab.sort() print(len(vocab)) print(vocab) from collections import OrderedDict encoder = OrderedDict(zip(vocab, range(len(vocab)))) decoder = OrderedDict(zip(range(len(vocab)), vocab)) encoder # Number of sequences in a mini batch batch_size = 100 # Number of characters in a sequence sequence_length = 50 # Number of cells in our LSTM layer n_cells = 128 # Number of LSTM layers n_layers = 3 # Total number of characters in the one-hot encoding n_chars = len(vocab) X = tf.placeholder(tf.int32, shape=..., name='X') # We'll have a placeholder for our true outputs Y = tf.placeholder(tf.int32, shape=..., name='Y') # we first create a variable to take us from our one-hot representation to our LSTM cells embedding = tf.get_variable("embedding", [n_chars, n_cells]) # And then use tensorflow's embedding lookup to look up the ids in X Xs = tf.nn.embedding_lookup(embedding, X) # The resulting lookups are concatenated into a dense tensor print(Xs.get_shape().as_list()) with tf.name_scope('reslice'): Xs = [tf.squeeze(seq, [1]) for seq in tf.split(Xs, sequence_length, 1)] cells = tf.contrib.rnn.BasicLSTMCell(num_units=n_cells, state_is_tuple=True, forget_bias=1.0) cells.state_size initial_state = cells.zero_state(tf.shape(X)[0], tf.float32) initial_state cells = tf.contrib.rnn.MultiRNNCell( [cells] * n_layers, state_is_tuple=True) initial_state = cells.zero_state(tf.shape(X)[0], tf.float32) initial_state outputs, state = tf.contrib.rnn.static_rnn(cell=..., inputs=..., initial_state=...) state outputs outputs_flat = tf.reshape(tf.concat(values=outputs, axis=1), [-1, n_cells]) outputs_flat with tf.variable_scope('prediction'): W = tf.get_variable( "W", shape=[n_cells, n_chars], initializer=tf.random_normal_initializer(stddev=0.1)) b = tf.get_variable( "b", shape=[n_chars], initializer=tf.random_normal_initializer(stddev=0.1)) # Find the output prediction of every single character in our minibatch # we denote the pre-activation prediction, logits. logits = tf.matmul(outputs_flat, W) + b # We get the probabilistic version by calculating the softmax of this probs = tf.nn.softmax(logits) # And then we can find the index of maximum probability Y_pred = tf.argmax(probs, 1) with tf.variable_scope('loss'): # Compute mean cross entropy loss for each output. Y_true_flat = tf.reshape(tf.concat(values=Y, axis=1), [-1]) # logits are [batch_size x timesteps, n_chars] and # Y_true_flat are [batch_size x timesteps] loss = tf.nn.sparse_softmax_cross_entropy_with_logits(labels=Y_true_flat, logits=logits) # Compute the mean over our `batch_size` x `timesteps` number of observations mean_loss = tf.reduce_mean(loss) with tf.name_scope('optimizer'): optimizer = tf.train.AdamOptimizer(learning_rate=0.001) gradients = [] clip = tf.constant(5.0, name="clip") for grad, var in optimizer.compute_gradients(mean_loss): gradients.append((tf.clip_by_value(grad, -clip, clip), var)) updates = optimizer.apply_gradients(gradients) nb_utils.show_graph(tf.get_default_graph().as_graph_def()) with tf.Session() as sess: init = tf.global_variables_initializer() sess.run(init) cursor = 0 it_i = 0 while it_i < 500: Xs, Ys = [], [] for batch_i in range(batch_size): if (cursor + sequence_length) >= len(txt) - sequence_length - 1: cursor = 0 Xs.append([encoder[ch] for ch in txt[cursor:cursor + sequence_length]]) Ys.append([encoder[ch] for ch in txt[cursor + 1: cursor + sequence_length + 1]]) cursor = (cursor + sequence_length) Xs = np.array(Xs).astype(np.int32) Ys = np.array(Ys).astype(np.int32) loss_val, _ = sess.run([mean_loss, updates], feed_dict={X: Xs, Y: Ys}) if it_i % 100 == 0: print(it_i, loss_val) if it_i % 500 == 0: p = sess.run(probs, feed_dict={X: np.array(Xs[-1])[np.newaxis]}) ps = [np.random.choice(range(n_chars), p=p_i.ravel()) for p_i in p] p = [np.argmax(p_i) for p_i in p] if isinstance(txt[0], str): print('original:', "".join( [decoder[ch] for ch in Xs[-1]])) print('synth(samp):', "".join( [decoder[ch] for ch in ps])) print('synth(amax):', "".join( [decoder[ch] for ch in p])) else: print([decoder[ch] for ch in ps]) it_i += 1 tf.reset_default_graph() with open('trump.txt', 'r') as fp: txt = fp.read() txt[:100] words = set(txt.split(' ')) words counts = {word_i: 0 for word_i in words} for word_i in txt.split(' '): counts[word_i] += 1 counts [(word_i, counts[word_i]) for word_i in sorted(counts, key=counts.get, reverse=True)] from libs import charrnn ckpt_name = './trump.ckpt' g = tf.Graph() n_layers = 3 n_cells = 512 with tf.Session(graph=g) as sess: model = charrnn.build_model(txt=txt, batch_size=1, sequence_length=1, n_layers=n_layers, n_cells=n_cells, gradient_clip=10.0) sess.run(tf.global_variables_initializer()) saver = tf.train.Saver() if os.path.exists(ckpt_name): saver.restore(sess, ckpt_name) print("Model restored.") nb_utils.show_graph(g.as_graph_def()) n_iterations = 100 curr_states = None g = tf.Graph() with tf.Session(graph=g) as sess: model = charrnn.build_model(txt=txt, batch_size=1, sequence_length=1, n_layers=n_layers, n_cells=n_cells, gradient_clip=10.0) sess.run(tf.global_variables_initializer()) saver = tf.train.Saver() if os.path.exists(ckpt_name): saver.restore(sess, ckpt_name) print("Model restored.") # Get every tf.Tensor for the initial state init_states = [] for s_i in model['initial_state']: init_states.append(s_i.c) init_states.append(s_i.h) # Similarly, for every state after inference final_states = [] for s_i in model['final_state']: final_states.append(s_i.c) final_states.append(s_i.h) # Let's start with the letter 't' and see what comes out: synth = [[encoder[' ']]] for i in range(n_iterations): # We'll create a feed_dict parameter which includes what to # input to the network, model['X'], as well as setting # dropout to 1.0, meaning no dropout. feed_dict = {model['X']: [synth[-1]], model['keep_prob']: 1.0} # Now we'll check if we currently have a state as a result # of a previous inference, and if so, add to our feed_dict # parameter the mapping of the init_state to the previous # output state stored in "curr_states". if curr_states: feed_dict.update( {init_state_i: curr_state_i for (init_state_i, curr_state_i) in zip(init_states, curr_states)}) # Now we can infer and see what letter we get p = sess.run(model['probs'], feed_dict=feed_dict)[0] # And make sure we also keep track of the new state curr_states = sess.run(final_states, feed_dict=feed_dict) # Find the most likely character p = np.argmax(p) # Append to string synth.append([p]) # Print out the decoded letter print(model['decoder'][p], end='') sys.stdout.flush() curr_states = None g = tf.Graph() with tf.Session(graph=g) as sess: model = charrnn.build_model(txt=txt, batch_size=1, sequence_length=1, n_layers=n_layers, n_cells=n_cells, gradient_clip=10.0) sess.run(tf.global_variables_initializer()) saver = tf.train.Saver() if os.path.exists(ckpt_name): saver.restore(sess, ckpt_name) print("Model restored.") # Get every tf.Tensor for the initial state init_states = [] for s_i in model['initial_state']: init_states.append(s_i.c) init_states.append(s_i.h) # Similarly, for every state after inference final_states = [] for s_i in model['final_state']: final_states.append(s_i.c) final_states.append(s_i.h) # Let's start with the letter 't' and see what comes out: synth = [[encoder[' ']]] for i in range(n_iterations): # We'll create a feed_dict parameter which includes what to # input to the network, model['X'], as well as setting # dropout to 1.0, meaning no dropout. feed_dict = {model['X']: [synth[-1]], model['keep_prob']: 1.0} # Now we'll check if we currently have a state as a result # of a previous inference, and if so, add to our feed_dict # parameter the mapping of the init_state to the previous # output state stored in "curr_states". if curr_states: feed_dict.update( {init_state_i: curr_state_i for (init_state_i, curr_state_i) in zip(init_states, curr_states)}) # Now we can infer and see what letter we get p = sess.run(model['probs'], feed_dict=feed_dict)[0] # And make sure we also keep track of the new state curr_states = sess.run(final_states, feed_dict=feed_dict) # Now instead of finding the most likely character, # we'll sample with the probabilities of each letter p = p.astype(np.float64) p = np.random.multinomial(1, p.ravel() / p.sum()) p = np.argmax(p) # Append to string synth.append([p]) # Print out the decoded letter print(model['decoder'][p], end='') sys.stdout.flush() temperature = 0.5 curr_states = None g = tf.Graph() with tf.Session(graph=g) as sess: model = charrnn.build_model(txt=txt, batch_size=1, sequence_length=1, n_layers=n_layers, n_cells=n_cells, gradient_clip=10.0) sess.run(tf.global_variables_initializer()) saver = tf.train.Saver() if os.path.exists(ckpt_name): saver.restore(sess, ckpt_name) print("Model restored.") # Get every tf.Tensor for the initial state init_states = [] for s_i in model['initial_state']: init_states.append(s_i.c) init_states.append(s_i.h) # Similarly, for every state after inference final_states = [] for s_i in model['final_state']: final_states.append(s_i.c) final_states.append(s_i.h) # Let's start with the letter 't' and see what comes out: synth = [[encoder[' ']]] for i in range(n_iterations): # We'll create a feed_dict parameter which includes what to # input to the network, model['X'], as well as setting # dropout to 1.0, meaning no dropout. feed_dict = {model['X']: [synth[-1]], model['keep_prob']: 1.0} # Now we'll check if we currently have a state as a result # of a previous inference, and if so, add to our feed_dict # parameter the mapping of the init_state to the previous # output state stored in "curr_states". if curr_states: feed_dict.update( {init_state_i: curr_state_i for (init_state_i, curr_state_i) in zip(init_states, curr_states)}) # Now we can infer and see what letter we get p = sess.run(model['probs'], feed_dict=feed_dict)[0] # And make sure we also keep track of the new state curr_states = sess.run(final_states, feed_dict=feed_dict) # Now instead of finding the most likely character, # we'll sample with the probabilities of each letter p = p.astype(np.float64) p = np.log(p) / temperature p = np.exp(p) / np.sum(np.exp(p)) p = np.random.multinomial(1, p.ravel() / p.sum()) p = np.argmax(p) # Append to string synth.append([p]) # Print out the decoded letter print(model['decoder'][p], end='') sys.stdout.flush() prime = "obama" temperature = 1.0 curr_states = None n_iterations = 500 g = tf.Graph() with tf.Session(graph=g) as sess: model = charrnn.build_model(txt=txt, batch_size=1, sequence_length=1, n_layers=n_layers, n_cells=n_cells, gradient_clip=10.0) sess.run(tf.global_variables_initializer()) saver = tf.train.Saver() if os.path.exists(ckpt_name): saver.restore(sess, ckpt_name) print("Model restored.") # Get every tf.Tensor for the initial state init_states = [] for s_i in model['initial_state']: init_states.append(s_i.c) init_states.append(s_i.h) # Similarly, for every state after inference final_states = [] for s_i in model['final_state']: final_states.append(s_i.c) final_states.append(s_i.h) # Now we'll keep track of the state as we feed it one # letter at a time. curr_states = None for ch in prime: feed_dict = {model['X']: [[model['encoder'][ch]]], model['keep_prob']: 1.0} if curr_states: feed_dict.update( {init_state_i: curr_state_i for (init_state_i, curr_state_i) in zip(init_states, curr_states)}) # Now we can infer and see what letter we get p = sess.run(model['probs'], feed_dict=feed_dict)[0] p = p.astype(np.float64) p = np.log(p) / temperature p = np.exp(p) / np.sum(np.exp(p)) p = np.random.multinomial(1, p.ravel() / p.sum()) p = np.argmax(p) # And make sure we also keep track of the new state curr_states = sess.run(final_states, feed_dict=feed_dict) # Now we're ready to do what we were doing before but with the # last predicted output stored in `p`, and the current state of # the model. synth = [[p]] print(prime + model['decoder'][p], end='') for i in range(n_iterations): # Input to the network feed_dict = {model['X']: [synth[-1]], model['keep_prob']: 1.0} # Also feed our current state feed_dict.update( {init_state_i: curr_state_i for (init_state_i, curr_state_i) in zip(init_states, curr_states)}) # Inference p = sess.run(model['probs'], feed_dict=feed_dict)[0] # Keep track of the new state curr_states = sess.run(final_states, feed_dict=feed_dict) # Sample p = p.astype(np.float64) p = np.log(p) / temperature p = np.exp(p) / np.sum(np.exp(p)) p = np.random.multinomial(1, p.ravel() / p.sum()) p = np.argmax(p) # Append to string synth.append([p]) # Print out the decoded letter print(model['decoder'][p], end='') sys.stdout.flush() utils.build_submission('session-5.zip', ('vaegan.gif', 'session-5-part-1.ipynb', 'session-5-part-2.ipynb')) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Session 5 Step2: <style> .rendered_html code { Step3: Let's take a look at the first part of this Step4: We'll just clean up the text a little. This isn't necessary, but can help the training along a little. In the example text I provided, there is a lot of white space (those \t's are tabs). I'll remove them. There are also repetitions of \n, new lines, which are not necessary. The code below will remove the tabs, ending whitespace, and any repeating newlines. Replace this with any preprocessing that makes sense for your dataset. Try to boil it down to just the possible letters for what you want to learn/synthesize while retaining any meaningful patterns Step5: Now we can see how much text we have Step6: In general, we'll want as much text as possible. But I'm including this just as a minimal example so you can explore your own. Try making a text file and seeing the size of it. You'll want about 1 MB at least. Step7: And then create a mapping which can take us from the letter to an integer look up table of that letter (and vice-versa). To do this, we'll use an OrderedDict from the collections library. In Python 3.6, this is the default behavior of dict, but in earlier versions of Python, we'll need to be explicit by using OrderedDict. Step8: We'll store a few variables that will determine the size of our network. First, batch_size determines how many sequences at a time we'll train on. The seqence_length parameter defines the maximum length to unroll our recurrent network for. This is effectively the depth of our network during training to help guide gradients along. Within each layer, we'll have n_cell LSTM units, and n_layers layers worth of LSTM units. Finally, we'll store the total number of possible characters in our data, which will determine the size of our one hot encoding (like we had for MNIST in Session 3). Step9: Let's now create the input and output to our network. We'll use placeholders and feed these in later. The size of these need to be [batch_size, sequence_length]. We'll then see how to build the network in between. Step10: The first thing we need to do is convert each of our sequence_length vectors in our batch to n_cells LSTM cells. We use a lookup table to find the value in X and use this as the input to n_cells LSTM cells. Our lookup table has n_chars possible elements and connects each character to n_cells cells. We create our lookup table using tf.get_variable and then the function tf.nn.embedding_lookup to connect our X placeholder to n_cells number of neurons. Step11: Now recall from the lecture that recurrent neural networks share their weights across timesteps. So we don't want to have one large matrix with every timestep, but instead separate them. We'll use tf.split to split our [batch_size, sequence_length, n_cells] array in Xs into a list of sequence_length elements each composed of [batch_size, n_cells] arrays. This gives us sequence_length number of arrays of [batch_size, 1, n_cells]. We then use tf.squeeze to remove the 1st index corresponding to the singleton sequence_length index, resulting in simply [batch_size, n_cells]. Step12: With each of our timesteps split up, we can now connect them to a set of LSTM recurrent cells. We tell the tf.contrib.rnn.BasicLSTMCell method how many cells we want, i.e. how many neurons there are, and we also specify that our state will be stored as a tuple. This state defines the internal state of the cells as well as the connection from the previous timestep. We can also pass a value for the forget_bias. Be sure to experiment with this parameter as it can significantly effect performance (e.g. Gers, Felix A, Schmidhuber, Jurgen, and Cummins, Fred. Learning to forget Step13: Let's take a look at the cell's state size Step14: c defines the internal memory and h the output. We'll have as part of our cells, both an initial_state and a final_state. These will become important during inference and we'll see how these work more then. For now, we'll set the initial_state to all zeros using the convenience function provided inside our cells object, zero_state Step15: Looking at what this does, we can see that it creates a tf.Tensor of zeros for our c and h states for each of our n_cells and stores this as a tuple inside the LSTMStateTuple object Step16: So far, we have created a single layer of LSTM cells composed of n_cells number of cells. If we want another layer, we can use the tf.contrib.rnn.MultiRNNCell method, giving it our current cells, and a bit of pythonery to multiply our cells by the number of layers we want. We'll then update our initial_state variable to include the additional cells Step17: Now if we take a look at our initial_state, we should see one LSTMStateTuple for each of our layers Step18: So far, we haven't connected our recurrent cells to anything. Let's do this now using the tf.contrib.rnn.static_rnn method. We also pass it our initial_state variables. It gives us the outputs of the rnn, as well as their states after having been computed. Contrast that with the initial_state, which set the LSTM cells to zeros. After having computed something, the cells will all have a different value somehow reflecting the temporal dynamics and expectations of the next input. These will be stored in the state tensors for each of our LSTM layers inside a LSTMStateTuple just like the initial_state variable. Step19: Let's take a look at the state now Step20: Our outputs are returned as a list for each of our timesteps Step21: We'll now stack all our outputs for every timestep. We can treat every observation at each timestep and for each batch using the same weight matrices going forward, since these should all have shared weights. Each timstep for each batch is its own observation. So we'll stack these in a 2d matrix so that we can create our softmax layer Step22: Our outputs are now concatenated so that we have [batch_size * timesteps, n_cells] Step23: We now create a softmax layer just like we did in Session 3 and in Session 3's homework. We multiply our final LSTM layer's n_cells outputs by a weight matrix to give us n_chars outputs. We then scale this output using a tf.nn.softmax layer so that they become a probability by exponentially scaling its value and dividing by its sum. We store the softmax probabilities in probs as well as keep track of the maximum index in Y_pred Step24: To train the network, we'll measure the loss between our predicted outputs and true outputs. We could use the probs variable, but we can also make use of tf.nn.softmax_cross_entropy_with_logits which will compute the softmax for us. We therefore need to pass in the variable just before the softmax layer, denoted as logits (unscaled values). This takes our variable logits, the unscaled predicted outputs, as well as our true outputs, Y. Before we give it Y, we'll need to reshape our true outputs in the same way, [batch_size x timesteps, n_chars]. Luckily, tensorflow provides a convenience for doing this, the tf.nn.sparse_softmax_cross_entropy_with_logits function Step25: Finally, we can create an optimizer in much the same way as we've done with every other network. Except, we will also "clip" the gradients of every trainable parameter. This is a hacky way to ensure that the gradients do not grow too large (the literature calls this the "exploding gradient problem"). However, note that the LSTM is built to help ensure this does not happen by allowing the gradient to be "gated". To learn more about this, please consider reading the following material Step26: Let's take a look at the graph Step27: Below is the rest of code we'll need to train the network. I do not recommend running this inside Jupyter Notebook for the entire length of the training because the network can take 1-2 days at least to train, and your browser may very likely complain. Instead, you should write a python script containing the necessary bits of code and run it using the Terminal. We didn't go over how to do this, so I'll leave it for you as an exercise. The next part of this notebook will have you load a pre-trained network. Step28: <a name="part-5---pretrained-char-rnn-of-donald-trump"></a> Step29: <a name="getting-the-trump-data"></a> Step30: Let's take a look at what's going on in here Step31: <a name="basic-text-analysis"></a> Step32: Now let's count their occurrences Step33: We can sort this like so Step34: As we should expect, "the" is the most common word, as it is in the English language Step35: Let's get the checkpoint and build the model then restore the variables from the checkpoint. The only parameters of consequence are n_layers and n_cells which define the total size and layout of the model. The rest are flexible. We'll set the batch_size and sequence_length to 1, meaning we can feed in a single character at a time only, and get back 1 character denoting the very next character's prediction. Step36: Let's now take a look at the model Step37: <a name="inference-keeping-track-of-the-state"></a> Step38: <a name="probabilistic-sampling"></a> Step39: <a name="inference-temperature"></a> Step40: <a name="inference-priming"></a> Step41: <a name="assignment-submission"></a>
5,232
<ASSISTANT_TASK:> Python Code: import swat import time import numpy as np import pandas as pd import matplotlib.pyplot as plt import matplotlib.colors as colors import matplotlib.cm as cmx # Also import networkx used for rendering a network import networkx as nx %matplotlib inline s = swat.CAS('http://cas.mycompany.com:8888') # REST API s.loadactionset('hypergroup') df = pd.DataFrame.from_records([[2,1],[3,1],[3,2],[4,1],[4,2],[4,3],[5,1],[6,1],[7,1],[7,5],[7,6],[8,1],[8,2],[8,3],[8,4],[9,1],[9,3],[10,3],[11,1],[11,5],[11,6],[12,1],[13,1],[13,4],[14,1],[14,2],[14,3],[14,4],[17,6],[17,7],[18,1],[18,2],[20,1],[20,2],[22,1],[22,2],[26,24],[26,25],[28,3],[28,24],[28,25],[29,3],[30,24],[30,27],[31,2],[31,9],[32,1],[32,25],[32,26],[32,29],[33,3],[33,9],[33,15],[33,16],[33,19],[33,21],[33,23],[33,24],[33,30],[33,31],[33,32],[34,9],[34,10],[34,14],[34,15],[34,16],[34,19],[34,20],[34,21],[34,23],[34,24],[34,27],[34,28],[34,29],[34,30],[34,31],[34,32],[34,33]], columns=['FROM','TO']) df['SOURCE'] = df['FROM'].astype(str) df['TARGET'] = df['TO'].astype(str) df.head() if s.tableexists('karate').exists: s.CASTable('KARATE').droptable() dataset = s.upload(df, importoptions=dict(filetype='csv', vars=[dict(type='double'), dict(type='double'), dict(type='varchar'), dict(type='varchar')]), casout=dict(name='KARATE', promote=True)).casTable dataset.head(5) dataset.summary() def renderNetworkGraph(filterCommunity=-1, size=18, sizeVar='_HypGrp_', colorVar='', sizeMultipler=500, nodes_table='nodes', edges_table='edges'): ''' Build an array of node positions and related colors based on community ''' nodes = s.CASTable(nodes_table) if filterCommunity >= 0: nodes = nodes.query('_Community_ EQ %F' % filterCommunity) nodes = nodes.to_frame() nodePos = {} nodeColor = {} nodeSize = {} communities = [] i = 0 for nodeId in nodes._Value_: nodePos[nodeId] = (nodes._AllXCoord_[i], nodes._AllYCoord_[i]) if colorVar: nodeColor[nodeId] = nodes[colorVar][i] if nodes[colorVar][i] not in communities: communities.append(nodes[colorVar][i]) nodeSize[nodeId] = max(nodes[sizeVar][i],0.1)*sizeMultipler i += 1 communities.sort() # Build a list of source-target tuples edges = s.CASTable(edges_table) if filterCommunity >= 0: edges = edges.query('_SCommunity_ EQ %F AND _TCommunity_ EQ %F' % (filterCommunity, filterCommunity)) edges = edges.to_frame() edgeTuples = [] for i, p in enumerate(edges._Source_): edgeTuples.append( (edges._Source_[i], edges._Target_[i]) ) # Add nodes and edges to the graph plt.figure(figsize=(size,size)) graph = nx.DiGraph() graph.add_edges_from(edgeTuples) # Size mapping getNodeSize=[nodeSize[v] for v in graph] # Color mapping jet = cm = plt.get_cmap('jet') getNodeColor=None if colorVar: getNodeColor=[nodeColor[v] for v in graph] cNorm = colors.Normalize(vmin=min(communities), vmax=max(communities)) scalarMap = cmx.ScalarMappable(norm=cNorm, cmap=jet) # Using a figure here to work-around the fact that networkx doesn't # produce a labelled legend f = plt.figure(1) ax = f.add_subplot(1,1,1) for community in communities: ax.plot([0],[0], color=scalarMap.to_rgba(community), label='Community %s' % '{:2.0f}'.format(community), linewidth=10) # Render the graph nx.draw_networkx_nodes(graph, nodePos, node_size=getNodeSize, node_color=getNodeColor, cmap=jet) nx.draw_networkx_edges(graph, nodePos, width=1, alpha=0.5) nx.draw_networkx_labels(graph, nodePos, font_size=11, font_family='sans-serif') if len(communities) > 0: plt.legend(loc='upper left', prop={'size':11}) plt.title('Zachary Karate Club social network', fontsize=30) plt.axis('off') plt.show() # Create output table objects edges = s.CASTable('edges', replace=True) nodes = s.CASTable('nodes', replace=True) dataset[['SOURCE', 'TARGET']].hyperGroup( createOut = 'never', allGraphs = True, edges = edges, vertices = nodes ) renderNetworkGraph(size=10, sizeMultipler=2000) dataset[['SOURCE', 'TARGET']].hyperGroup( createOut = 'never', allGraphs = True, community = True, edges = edges, vertices = nodes ) nodes.distinct() nodes.summary() topKOut = s.CASTable('topKOut', replace=True) nodes[['_Community_']].topk( aggregator = 'N', topK = 4, casOut = topKOut ) topKOut = topKOut.sort_values('_Rank_').head(10) topKOut.columns nCommunities = len(topKOut) ind = np.arange(nCommunities) # the x locations for the groups plt.figure(figsize=(8,4)) p1 = plt.bar(ind + 0.2, topKOut._Score_, 0.5, color='orange', alpha=0.75) plt.ylabel('Vertices', fontsize=12) plt.xlabel('Community', fontsize=12) plt.title('Number of nodes for the top %s communities' % '{:2.0f}'.format(nCommunities)) plt.xticks(ind + 0.2, topKOut._Fmtvar_) plt.show() nodes.query('_Community_ EQ 1').head(5) edges.head(5) renderNetworkGraph(size=10, colorVar='_Community_', sizeMultipler=2000) dataset[['SOURCE', 'TARGET']].hyperGroup( createOut = 'never', community = True, centrality = True, mergeCommSmallest = True, allGraphs = True, graphPartition = True, scaleCentralities = 'central1', # Returns centrality values closer to 1 in the center edges = edges, vertices = nodes ) nodes.head() renderNetworkGraph(size=10, colorVar='_Community_', sizeVar='_Betweenness_') renderNetworkGraph(1, size=10, sizeVar='_CentroidAngle_', sizeMultipler=5) s.close() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Connect to Cloud Analytic Services in SAS Viya Step2: Load the action set for hypergroup Step3: Load data into CAS Step4: Hypergroup doesn't support numeric source and target columns - so make sure to cast them as varchars. Step5: Data Exploration Step6: Graph rendering utility Step7: Execute community and hypergroup detection Step8: Note Step9: How many hypergroups and communities do we have? Step10: Basic community analysis Step11: Note Step12: What edges do we have? Step13: Render the network graph Step14: Analyze node centrality Step15: Between-ness centrality quantifies the number of times a node acts as a bridge along the shortest path(s) between two other nodes. As such it describes the importance of a node in a network. Step16: Filter communities
5,233
<ASSISTANT_TASK:> Python Code: # Criando um dicionario vazio d = {} # Adicionando elementos para chave-valor d['a'] = 'alpha' d['o'] = 'omega' d['g'] = 'gamma' # algumas propriedades uteis d #Exibindo as chaves d.keys() # Iterando sobre as chaves for k in d.keys(): print 'Key:',k,'->',d[k] #Exibindo os valores d.values() #Exibindo os itens d.items() # Iterando sobre as Tulas que representam o par chave-valor for tup in d.items(): print(tup) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Observe que os itens sao apresentados na forma de Tuplas representando o par chave-valor**
5,234
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt import matplotlib import ndreg from ndreg import preprocessor, util, plotter import SimpleITK as sitk matplotlib.rcParams['figure.figsize'] = (10.0, 8.0) def myshow(img, cmap='gray', colorbar=False): plt.imshow(sitk.GetArrayViewFromImage(img), cmap=cmap) if colorbar: plt.colorbar() plt.axis('off') plt.show() params = { # input image path 'image_path': './Thy1eYFP_Control_9.tiff', # voxel spacing is in mm and corresponds to (x, y, z) spacing 'image_spacing': (0.04128, 0.04128, 0.04128), 'image_orientation': 'rpi', # the modality can be 'lavision' or 'colm' 'image_modality': 'lavision', 'atlas_spacing': (0.05, 0.05, 0.05), 'atlas_path': './ARA_50um.tiff', } img = util.imgRead(params['image_path']) img.SetSpacing(params['image_spacing']) atlas = util.imgRead(params['atlas_path']) atlas.SetSpacing(params['atlas_spacing']) plotter.imgShow(img, vmax=2000) plotter.imgShow(atlas, vmax=400) img_p = preprocessor.preprocess_brain(img, params['atlas_spacing'], params['image_modality'], params['image_orientation']) atlas_registered = ndreg.register_brain(atlas, img_p) plotter.imgShow(atlas_registered) plotter.imgShow(plotter.imgChecker(atlas_registered, img_p), vmax=2) ndreg.imgMSE(sitk.Normalize(atlas), sitk.Normalize(img)) ndreg.imgMSE(sitk.Normalize(atlas), sitk.Normalize(img_p)) ndreg.imgMSE(sitk.Normalize(atlas_registered), sitk.Normalize(img_p)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Some metadata is required before registration Step2: Load the sample data Step3: Preprocessing Step4: Registration Step5: Visualize registered image Step6: Quantitative evaluation
5,235
<ASSISTANT_TASK:> Python Code: from sympy import * from geom_util import * from sympy.vector import CoordSys3D N = CoordSys3D('N') alpha1, alpha2, alpha3 = symbols("alpha_1 alpha_2 alpha_3", real = True, positive=True) init_printing() %matplotlib inline %reload_ext autoreload %autoreload 2 %aimport geom_util H1=symbols('H1') H2=S(1) H3=S(1) H=[H1, H2, H3] DIM=3 dH = zeros(DIM,DIM) for i in range(DIM): for j in range(DIM): if (i == 0 and j != 1): dH[i,j]=Symbol('H_{{{},{}}}'.format(i+1,j+1)) dH G_up = getMetricTensorUpLame(H1, H2, H3) G_down = getMetricTensorDownLame(H1, H2, H3) DIM=3 G_down_diff = MutableDenseNDimArray.zeros(DIM, DIM, DIM) for i in range(DIM): for j in range(DIM): for k in range(DIM): G_down_diff[i,i,k]=2*H[i]*dH[i,k] GK = getChristoffelSymbols2(G_up, G_down_diff, (alpha1, alpha2, alpha3)) GK def row_index_to_i_j_grad(i_row): return i_row // 3, i_row % 3 B = zeros(9, 12) B[0,1] = S(1) B[1,2] = S(1) B[2,3] = S(1) B[3,5] = S(1) B[4,6] = S(1) B[5,7] = S(1) B[6,9] = S(1) B[7,10] = S(1) B[8,11] = S(1) for row_index in range(9): i,j=row_index_to_i_j_grad(row_index) B[row_index, 0] = -GK[i,j,0] B[row_index, 4] = -GK[i,j,1] B[row_index, 8] = -GK[i,j,2] B P=zeros(12,12) P[0,0]=H[0] P[1,0]=dH[0,0] P[1,1]=H[0] P[2,0]=dH[0,1] P[2,2]=H[0] P[3,0]=dH[0,2] P[3,3]=H[0] P[4,4]=H[1] P[5,4]=dH[1,0] P[5,5]=H[1] P[6,4]=dH[1,1] P[6,6]=H[1] P[7,4]=dH[1,2] P[7,7]=H[1] P[8,8]=H[2] P[9,8]=dH[2,0] P[9,9]=H[2] P[10,8]=dH[2,1] P[10,10]=H[2] P[11,8]=dH[2,2] P[11,11]=H[2] P=simplify(P) P B_P = zeros(9,9) for i in range(3): for j in range(3): row_index = i*3+j B_P[row_index, row_index] = 1/(H[i]*H[j]) Grad_U_P = simplify(B_P*B*P) Grad_U_P E=zeros(6,9) E[0,0]=1 E[1,4]=1 E[2,8]=1 E[3,1]=1 E[3,3]=1 E[4,2]=1 E[4,6]=1 E[5,5]=1 E[5,7]=1 E StrainL=simplify(E*Grad_U_P) StrainL def E_NonLinear(grad_u): N = 3 du = zeros(N, N) # print("===Deformations===") for i in range(N): for j in range(N): index = i*N+j du[j,i] = grad_u[index] # print("========") I = eye(3) a_values = S(1)/S(2) * du * G_up E_NL = zeros(6,9) E_NL[0,0] = a_values[0,0] E_NL[0,3] = a_values[0,1] E_NL[0,6] = a_values[0,2] E_NL[1,1] = a_values[1,0] E_NL[1,4] = a_values[1,1] E_NL[1,7] = a_values[1,2] E_NL[2,2] = a_values[2,0] E_NL[2,5] = a_values[2,1] E_NL[2,8] = a_values[2,2] E_NL[3,1] = 2*a_values[0,0] E_NL[3,4] = 2*a_values[0,1] E_NL[3,7] = 2*a_values[0,2] E_NL[4,0] = 2*a_values[2,0] E_NL[4,3] = 2*a_values[2,1] E_NL[4,6] = 2*a_values[2,2] E_NL[5,2] = 2*a_values[1,0] E_NL[5,5] = 2*a_values[1,1] E_NL[5,8] = 2*a_values[1,2] return E_NL %aimport geom_util u=getUHat3DPlane(alpha1, alpha2, alpha3) # u=getUHatU3Main(alpha1, alpha2, alpha3) gradu=B*u E_NL = E_NonLinear(gradu)*B E_NL %aimport geom_util u=getUHatU3MainPlane(alpha1, alpha2, alpha3) gradup=Grad_U_P*u # e=E*gradup # e E_NLp = E_NonLinear(gradup)*gradup simplify(E_NLp) w %aimport geom_util C_tensor = getIsotropicStiffnessTensor() C = convertStiffnessTensorToMatrix(C_tensor) C StrainL.T*C*StrainL*H1 T=zeros(12,6) T[0,0]=1 T[0,2]=alpha3 T[1,1]=1 T[1,3]=alpha3 T[3,2]=1 T[8,4]=1 T[9,5]=1 T D_p_T = StrainL*T simplify(D_p_T) u = Function("u") t = Function("theta") w = Function("w") u1=u(alpha1)+alpha3*t(alpha1) u3=w(alpha1) gu = zeros(12,1) gu[0] = u1 gu[1] = u1.diff(alpha1) gu[3] = u1.diff(alpha3) gu[8] = u3 gu[9] = u3.diff(alpha1) gradup=Grad_U_P*gu # E_NLp = E_NonLinear(gradup)*gradup # simplify(E_NLp) # gradup=Grad_U_P*gu # o20=(K*u(alpha1)-w(alpha1).diff(alpha1)+t(alpha1))/2 # o21=K*t(alpha1) # O=1/2*o20*o20+alpha3*o20*o21-alpha3*K/2*o20*o20 # O=expand(O) # O=collect(O,alpha3) # simplify(O) StrainNL = E_NonLinear(gradup)*gradup StrainL*gu+simplify(StrainNL) L=zeros(12,12) h=Symbol('h') p0=1/2-alpha3/h p1=1/2+alpha3/h p2=1-(2*alpha3/h)**2 L[0,0]=p0 L[0,2]=p1 L[0,4]=p2 L[1,1]=p0 L[1,3]=p1 L[1,5]=p2 L[3,0]=p0.diff(alpha3) L[3,2]=p1.diff(alpha3) L[3,4]=p2.diff(alpha3) L[8,6]=p0 L[8,8]=p1 L[8,10]=p2 L[9,7]=p0 L[9,9]=p1 L[9,11]=p2 L[11,6]=p0.diff(alpha3) L[11,8]=p1.diff(alpha3) L[11,10]=p2.diff(alpha3) L D_p_L = StrainL*L simplify(D_p_L) h = 0.5 exp=(0.5-alpha3/h)*(1-(2*alpha3/h)**2)#/(1+alpha3*0.8) p02=integrate(exp, (alpha3, -h/2, h/2)) integral = expand(simplify(p02)) integral rho=Symbol('rho') B_h=zeros(3,12) B_h[0,0]=1 B_h[1,4]=1 B_h[2,8]=1 M=simplify(rho*P.T*B_h.T*G_up*B_h*P) M M_p = L.T*M*L integrate(M_p, (alpha3, -h/2, h/2)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Lame params Step2: Metric tensor Step3: ${\displaystyle \hat{G}=\sum_{i,j} g_{ij}\vec{R}^i\vec{R}^j}$ Step4: Christoffel symbols Step5: Gradient of vector Step6: Physical coordinates Step7: Strain tensor Step8: Virtual work Step9: Tymoshenko theory Step10: Square theory Step11: Mass matrix
5,236
<ASSISTANT_TASK:> Python Code: import numpy as np import pandas as pd import itertools from scipy import stats from statsmodels.stats.descriptivestats import sign_test from statsmodels.stats.weightstats import zconfint from statsmodels.stats.weightstats import * %pylab inline seattle_data = pd.read_csv('seattle.txt', sep = '\t', header = 0) seattle_data.shape seattle_data.head() price2001 = seattle_data[seattle_data['Year'] == 2001].Price price2002 = seattle_data[seattle_data['Year'] == 2002].Price pylab.figure(figsize=(12,4)) pylab.subplot(1,2,1) pylab.grid() pylab.hist(price2001, color = 'r') pylab.xlabel('2001') pylab.subplot(1,2,2) pylab.grid() pylab.hist(price2002, color = 'b') pylab.xlabel('2002') pylab.show() print '95%% confidence interval for the mean: [%f, %f]' % zconfint(price2001) print '95%% confidence interval for the mean: [%f, %f]' % zconfint(price2002) stats.mannwhitneyu(price2001, price2002) def permutation_t_stat_ind(sample1, sample2): return np.mean(sample1) - np.mean(sample2) def get_random_combinations(n1, n2, max_combinations): index = range(n1 + n2) indices = set([tuple(index)]) for i in range(max_combinations - 1): np.random.shuffle(index) indices.add(tuple(index)) return [(index[:n1], index[n1:]) for index in indices] def permutation_zero_dist_ind(sample1, sample2, max_combinations = None): joined_sample = np.hstack((sample1, sample2)) n1 = len(sample1) n = len(joined_sample) if max_combinations: indices = get_random_combinations(n1, len(sample2), max_combinations) else: indices = [(list(index), filter(lambda i: i not in index, range(n))) \ for index in itertools.combinations(range(n), n1)] distr = [joined_sample[list(i[0])].mean() - joined_sample[list(i[1])].mean() \ for i in indices] return distr pylab.hist(permutation_zero_dist_ind(price2001, price2002, max_combinations = 1000)) pylab.show() def permutation_test(sample, mean, max_permutations = None, alternative = 'two-sided'): if alternative not in ('two-sided', 'less', 'greater'): raise ValueError("alternative not recognized\n" "should be 'two-sided', 'less' or 'greater'") t_stat = permutation_t_stat_ind(sample, mean) zero_distr = permutation_zero_dist_ind(sample, mean, max_permutations) if alternative == 'two-sided': return sum([1. if abs(x) >= abs(t_stat) else 0. for x in zero_distr]) / len(zero_distr) if alternative == 'less': return sum([1. if x <= t_stat else 0. for x in zero_distr]) / len(zero_distr) if alternative == 'greater': return sum([1. if x >= t_stat else 0. for x in zero_distr]) / len(zero_distr) print "p-value: %f" % permutation_test(price2001, price2002, max_permutations = 10000) print "p-value: %f" % permutation_test(price2001, price2002, max_permutations = 50000) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Загрузка данных Step2: Двухвыборочные критерии для независимых выборок Step3: Ранговый критерий Манна-Уитни Step4: Перестановочный критерий
5,237
<ASSISTANT_TASK:> Python Code: # Load library import pandas as pd # Create data frame df = pd.DataFrame() # Create data df['dates'] = pd.date_range('1/1/2001', periods=5, freq='D') df['stock_price'] = [1.1,2.2,3.3,4.4,5.5] # Lagged values by one row df['previous_days_stock_price'] = df['stock_price'].shift(1) # Show data frame df <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Create Date Data Step2: Lag Time Data By One Row
5,238
<ASSISTANT_TASK:> Python Code: from sys import version print(version) from typing import TypeVar, List _a = TypeVar('alpha') def taille(liste : List[_a]) -> int: longueur = 0 for _ in liste: longueur += 1 return longueur taille([]) taille([1, 2, 3]) len([]) len([1, 2, 3]) from typing import TypeVar, List _a = TypeVar('alpha') def concatene(liste1 : List[_a], liste2 : List[_a]) -> List[_a]: # return liste1 + liste2 # easy solution liste = [] for i in liste1: liste.append(i) for i in liste2: liste.append(i) return liste concatene([1, 2], [3, 4]) [1, 2] + [3, 4] concatene([1, 2], ["pas", "entier", "?"]) from typing import TypeVar, List _a = TypeVar('alpha') def appartient(x : _a, liste : List[_a]) -> bool: for y in liste: if x == y: return True # on stoppe avant la fin return False appartient(1, []) appartient(1, [1]) appartient(1, [1, 2, 3]) appartient(4, [1, 2, 3]) 1 in [] 1 in [1] 1 in [1, 2, 3] 4 in [1, 2, 3] %timeit appartient(1000, list(range(10000))) %timeit 1000 in list(range(10000)) from typing import TypeVar, List _a = TypeVar('alpha') def miroir(liste : List[_a]) -> List[_a]: # return liste[::-1] # version facile liste2 = [] for x in liste: liste2.insert(0, x) return liste2 miroir([2, 3, 5, 7, 11]) [2, 3, 5, 7, 11][::-1] %timeit miroir([2, 3, 5, 7, 11]) %timeit [2, 3, 5, 7, 11][::-1] from typing import TypeVar, List _a = TypeVar('alpha') def alterne(liste1 : List[_a], liste2 : List[_a]) -> List[_a]: liste3 = [] i, j = 0, 0 n, m = len(liste1), len(liste2) while i < n and j < m: # encore deux liste3.append(liste1[i]) i += 1 liste3.append(liste2[j]) j += 1 while i < n: # si n > m liste3.append(liste1[i]) i += 1 while j < m: # ou si n < m liste3.append(liste2[j]) j += 1 return liste3 alterne([3, 5], [2, 4, 6]) alterne([1, 3, 5], [2, 4, 6]) alterne([1, 3, 5], [4, 6]) from typing import TypeVar, List _a = TypeVar('alpha') def nb_occurrences(x : _a, liste : List[_a]) -> int: nb = 0 for y in liste: if x == y: nb += 1 return nb nb_occurrences(0, [1, 2, 3, 4]) nb_occurrences(2, [1, 2, 3, 4]) nb_occurrences(2, [1, 2, 2, 3, 2, 4]) nb_occurrences(5, [1, 2, 3, 4]) filter? from typing import List def pairs(liste : List[int]) -> List[int]: # return list(filter(lambda x : x % 2 == 0, liste)) return [x for x in liste if x % 2 == 0] pairs([1, 2, 3, 4, 5, 6]) pairs([1, 2, 3, 4, 5, 6, 7, 100000]) pairs([1, 2, 3, 4, 5, 6, 7, 100000000000]) pairs([1, 2, 3, 4, 5, 6, 7, 1000000000000000000]) from typing import List def myrange(n : int) -> List[int]: liste = [] i = 1 while i <= n: liste.append(i) i += 1 return liste myrange(4) from typing import List def intervale(a : int, b : int=None) -> List[int]: if b == None: a, b = 1, a liste = [] i = a while i <= b: liste.append(i) i += 1 return liste intervale(10) intervale(1, 4) def racine(n : int) -> int: i = 1 for i in range(n + 1): if i*i > n: return i - 1 return i racine(1) racine(5) racine(102) racine(120031) from typing import List def intervale2(a : int, b : int, pas : int=1) -> List[int]: assert pas > 0 liste = [] i = a while i <= b: liste.append(i) i += pas return liste intervale2(2, 12, 1) intervale2(2, 12, 3) def estDivisible(n : int, k : int) -> bool: return (n % k) == 0 estDivisible(10, 2) estDivisible(10, 3) estDivisible(10, 4) estDivisible(10, 5) def estPremier(n : int) -> bool: return (n == 2) or (n == 3) or not any(map(lambda k: estDivisible(n, k), intervale2(2, racine(n), 1))) for n in range(2, 20): print(n, list(map(lambda k: estDivisible(n, k), intervale2(2, racine(n), 1)))) from typing import List def premiers(n : int) -> List[int]: return [p for p in intervale2(2, n, 1) if estPremier(p)] premiers(10) premiers(100) class ListeChainee(): def __init__(self, hd=None, tl=None): self.hd = hd self.tl = tl def __repr__(self) -> str: if self.tl is None: if self.hd is None: return "[]" else: return f"{self.hd} :: []" else: return f"{self.hd} :: {self.tl}" def jolie(self) -> str: if self.tl is None: if self.hd is None: return "[]" else: return f"[{self.hd}]" else: j = self.tl.jolie() j = j.replace("[", "").replace("]", "") if j == "": return f"[{self.hd}]" else: return f"[{self.hd}, {j}]" # équivalent à :: en OCaml def insert(hd, tl: ListeChainee) -> ListeChainee: Insère hd en début de la liste chainée tl. return ListeChainee(hd=hd, tl=tl) # liste vide, puis des listes plus grandes vide = ListeChainee() # [] l_1 = insert(1, vide) # 1 :: [] ~= [1] l_12 = insert(2, l_1) # 2 :: 1 :: [] ~= [2, 1] l_123 = insert(3, l_12) # 3 :: 2 :: 1 :: [] print(vide) # [] print(l_1) # 1 :: [] print(l_12) # 2 :: 1 :: [] print(l_123) # 3 :: 2 :: 1 :: [] print(vide.jolie()) # [] print(l_1.jolie()) # [1] print(l_12.jolie()) # [2, 1] print(l_123.jolie()) # [3, 2, 1] from typing import Optional def taille(liste: Optional[ListeChainee]) -> int: if liste is None: return 0 elif liste.tl is None: return 0 if liste.hd is None else 1 return 1 + taille(liste.tl) print(taille(vide)) # 0 print(taille(l_1)) # 1 print(taille(l_12)) # 2 print(taille(l_123)) # 3 def copy(liste: ListeChainee) -> ListeChainee: if liste.tl is None: return ListeChainee(hd=liste.hd, tl=None) else: return ListeChainee(hd=liste.hd, tl=copy(liste.tl)) print(id(vide)) print(id(copy(vide))) def concat(liste1: ListeChainee, liste2: ListeChainee) -> ListeChainee: if taille(liste1) == 0: return liste2 elif taille(liste2) == 0: return liste1 # nouvelle liste : comme ça changer queue.tl ne modifie PAS liste1 resultat = copy(liste1) queue = resultat while taille(queue.tl) > 0: queue = queue.tl assert taille(queue.tl) == 0 queue.tl = ListeChainee(hd=liste2.hd, tl=liste2.tl) return resultat print(concat(vide, l_1)) print(vide) # pas modifiée : [] print(l_1) # pas modifiée : 1 :: [] concat(l_1, l_12) # 1 :: 2 :: 1 :: [] concat(l_1, l_123) # 1 :: 3 :: 2 :: 1 :: [] concat(l_1, vide) # 1 :: [] concat(l_12, vide) # 2 :: 1 :: [] concat(l_12, l_1) # 2 :: 1 :: 1 :: [] concat(l_123, l_123) # 3 :: 2 :: 1 :: 3 :: 2 :: 1 :: [] def appartient(x, liste: ListeChainee) -> bool: if liste.hd is None: return False else: if liste.hd == x: return True else: return appartient(x, liste.tl) assert appartient(0, vide) == False assert appartient(0, l_1) == False assert appartient(0, l_12) == False assert appartient(0, l_123) == False assert appartient(1, l_1) == True assert appartient(1, l_12) == True assert appartient(1, l_123) == True assert appartient(2, l_1) == False assert appartient(2, l_12) == True assert appartient(2, l_123) == True assert appartient(3, l_1) == False assert appartient(3, l_12) == False assert appartient(3, l_123) == True def miroir(liste: ListeChainee) -> ListeChainee: if taille(liste) <= 1: return copy(liste) else: hd, tl = liste.hd, copy(liste.tl) # O(n) juste_hd = ListeChainee(hd=hd, tl=None) # O(1) return concat(miroir(tl), juste_hd) # O(n^2) + O(n) à cause de concat print(miroir(vide)) # [] => [] print(miroir(l_1)) # [1] => [1] print(miroir(l_12)) # [2, 1] => [1, 2] print(miroir(l_123)) # [3, 2, 1] => [1, 2, 3] def alterne(liste1: ListeChainee, liste2: ListeChainee) -> ListeChainee: if taille(liste1) == 0: return copy(liste2) # on recopie pour ne rien modifier if taille(liste2) == 0: return copy(liste1) # on recopie pour ne rien modifier h1, t1 = liste1.hd, liste1.tl h2, t2 = liste2.hd, liste2.tl return insert(h1, insert(h2, alterne(t1, t2))) print(alterne(l_1, l_12)) # [1, 2, 1] print(alterne(l_12, l_1)) # [2, 1, 1] print(alterne(l_123, l_1)) # [3, 1, 2, 1] print(alterne(l_123, l_12)) # [3, 2, 2, 1, 1] print(alterne(l_123, l_123)) # [3, 3, 2, 2, 1, 1] print(alterne(l_12, l_123)) # [2, 3, 1, 2, 1] print(alterne(l_1, l_123)) # [1, 3, 2, 1] def nb_occurrences(x, liste: ListeChainee) -> int: if liste is None or liste.hd is None: return 0 else: count = 1 if x == liste.hd else 0 if liste.tl is None: return count else: return count + nb_occurrences(x, liste.tl) assert nb_occurrences(1, vide) == 0 assert nb_occurrences(1, l_1) == 1 assert nb_occurrences(1, l_12) == 1 assert nb_occurrences(2, l_12) == 1 assert nb_occurrences(1, l_123) == 1 assert nb_occurrences(2, l_123) == 1 assert nb_occurrences(3, l_123) == 1 assert nb_occurrences(1, concat(l_1, l_1)) == 2 assert nb_occurrences(2, concat(l_1, l_12)) == 1 assert nb_occurrences(3, concat(l_12, l_1)) == 0 assert nb_occurrences(1, concat(l_12, l_12)) == 2 assert nb_occurrences(2, concat(l_12, l_12)) == 2 assert nb_occurrences(1, concat(l_123, concat(l_1, l_1))) == 3 assert nb_occurrences(2, concat(l_123, concat(l_1, l_12))) == 2 assert nb_occurrences(3, concat(l_123, concat(l_12, l_1))) == 1 assert nb_occurrences(3, concat(l_123, concat(l_12, l_12))) == 1 def nb_occurrences(x, liste: ListeChainee, count=0) -> int: if liste is None or liste.hd is None: return count else: count += 1 if x == liste.hd else 0 if liste.tl is None: return count else: return nb_occurrences(x, liste.tl, count=count) def filtrer(liste: ListeChainee, predicate) -> ListeChainee: if liste is None or liste.hd is None: # liste de taille 0 return ListeChainee(hd=None, tl=None) elif liste.tl is None: # liste de taille 1 if predicate(liste.hd): # on renvoie [hd] return ListeChainee(hd=liste.hd, tl=None) else: # on renvoie [] return ListeChainee(hd=None, tl=None) else: # liste de taille >= 2 if predicate(liste.hd): return insert(liste.hd, filtrer(liste.tl, predicate)) else: return filtrer(liste.tl, predicate) def pairs(liste: ListeChainee) -> ListeChainee: def predicate(x): return (x % 2) == 0 # aussi : predicate = lambda x: (x % 2) == 0 return filtrer(liste, predicate) def impairs(liste: ListeChainee) -> ListeChainee: def predicate(x): return (x % 2) == 1 return filtrer(liste, predicate) print(pairs(vide)) # [] print(pairs(l_1)) # [] print(pairs(l_12)) # [2] print(pairs(l_123)) # [2] print(pairs(insert(4, insert(6, insert(8, l_123))))) # [4, 6, 8, 2] print(pairs(insert(5, insert(6, insert(8, l_123))))) # [6, 8, 2] print(impairs(vide)) # [] print(impairs(l_1)) # [1] print(impairs(l_12)) # [1] print(impairs(l_123)) # [3, 1] print(impairs(insert(4, insert(6, insert(8, l_123))))) # [3, 1] print(impairs(insert(5, insert(6, insert(8, l_123))))) # [5, 3, 1] def myrange(n: int) -> ListeChainee: if n <= 0: return ListeChainee(hd=None, tl=None) elif n == 1: return ListeChainee(hd=1, tl=None) # return insert(1, vide) else: return ListeChainee(hd=n, tl=myrange(n-1)) print(myrange(1)) # [1] print(myrange(2)) # [1, 2] print(myrange(3)) # [1, 2, 3] print(myrange(4)) # [1, 2, 3, 4] def intervale(a: int, b: Optional[int]=None) -> ListeChainee: if b is None: a, b = 1, a n = b - a if n < 0: # [a..b] = [] return ListeChainee(hd=None, tl=None) elif n == 0: # [a..b] = [a] return ListeChainee(hd=a, tl=None) else: # [a..b] = a :: [a+1..b] return ListeChainee(hd=a, tl=intervale(a+1, b)) print(intervale(10)) # [1, 2, 3, 4, 5, 6, 7, 8, 9, 10] print(intervale(1, 4)) # [1, 2, 3, 4] print(intervale(13, 13)) # [13] print(intervale(13, 10)) # [] from typing import Callable def mymap(fonction: Callable, liste: ListeChainee) -> ListeChainee: if liste is None or liste.hd is None: # liste de taille 0 return ListeChainee(hd=None, tl=None) elif liste.tl is None: # liste de taille 1 return ListeChainee(hd=fonction(liste.hd), tl=None) else: # liste de taille >= 2 return ListeChainee(hd=fonction(liste.hd), tl=mymap(fonction, liste.tl)) print(myrange(10)) print(mymap(lambda x: x, myrange(10))) def intervale_bis(a: int, b: int) -> ListeChainee: return miroir(mymap(lambda x: x + (a - 1), myrange(b - a + 1))) print(intervale_bis(1, 10)) # [1, 2, 3, 4, 5, 6, 7, 8, 9, 10] print(intervale_bis(1, 4)) # [1, 2, 3, 4] print(intervale_bis(13, 13)) # [13] print(intervale_bis(13, 10)) # [] def racine(n: int) -> int: i = 1 for i in range(n + 1): if i*i > n: return i - 1 return i print(racine(1)) # 1 print(racine(5)) # 2 print(racine(102)) # 10 print(racine(120031)) # 346 def intervale2(a: int, b: Optional[int]=None, pas: int=1) -> ListeChainee: if b is None: a, b = 1, a n = b - a if n < 0: # [a..b::p] = [] return ListeChainee(hd=None, tl=None) elif n == 0: # [a..b::p] = [a] return ListeChainee(hd=a, tl=None) else: # [a..b::p] = a :: [a+p..b::p] return ListeChainee(hd=a, tl=intervale2(a + pas, b=b, pas=pas)) print(intervale2(1, 10, 2)) # [1, 3, 5, 7, 9] print(intervale2(1, 4, 2)) # [1, 3] print(intervale2(13, 13, 2)) # [13] print(intervale2(13, 10, 2)) # [] def estDivisible(n: int, k: int) -> bool: return (n % k) == 0 estDivisible(10, 2) estDivisible(10, 3) estDivisible(10, 4) estDivisible(10, 5) def estPremier(n : int) -> bool: return taille(filtrer(intervale2(2, racine(n), 1), lambda k: estDivisible(n, k))) == 0 for n in range(2, 20): print("Petits diviseurs de", n, " -> ", filtrer(intervale2(2, racine(n), 1), lambda k: estDivisible(n, k))) def premiers(n : int) -> ListeChainee: return filtrer(intervale2(2, n, 1), estPremier) premiers(10) # [2, 3, 5, 7] premiers(100) # [2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37, 41, 43, 47, 53, 59, 61, 67, 71, 73, 79, 83, 89, 97] test = [3, 1, 8, 4, 5, 6, 1, 2] from typing import TypeVar, List _a = TypeVar('alpha') def insere(x : _a, liste : List[_a]) -> List[_a]: if len(liste) == 0: return [x] else: t, q = liste[0], liste[1:] if x <= t: return [x] + liste else: return [t] + insere(x, q) def tri_insertion(liste : List[_a]) -> List[_a]: if len(liste) == 0: return [] else: t, q = liste[0], liste[1:] return insere(t, tri_insertion(q)) tri_insertion(test) from typing import TypeVar, List, Callable _a = TypeVar('alpha') def insere2(ordre : Callable[[_a, _a], bool], x : _a, liste : List[_a]) -> List[_a]: if len(liste) == 0: return [x] else: t, q = liste[0], liste[1:] if ordre(x, t): return [x] + liste else: return [t] + insere2(ordre, x, q) def tri_insertion2(ordre : Callable[[_a, _a], bool], liste : List[_a]) -> List[_a]: if len(liste) == 0: return [] else: t, q = liste[0], liste[1:] return insere2(ordre, t, tri_insertion2(ordre, q)) ordre_croissant = lambda x, y: x <= y tri_insertion2(ordre_croissant, test) ordre_decroissant = lambda x, y: x >= y tri_insertion2(ordre_decroissant, test) from typing import TypeVar, List, Tuple _a = TypeVar('alpha') def selectionne_min(liste : List[_a]) -> Tuple[_a, List[_a]]: if len(liste) == 0: raise ValueError("Selectionne_min sur liste vide") else: def cherche_min(mini : _a, autres : List[_a], reste : List[_a]) -> Tuple[_a, List[_a]]: if len(reste) == 0: return (mini, autres) else: t, q = reste[0], reste[1:] if t < mini: return cherche_min(t, [mini] + autres, q) else: return cherche_min(mini, [t] + autres, q) t, q = liste[0], liste[1:] return cherche_min(t, [], q) test selectionne_min(test) def tri_selection(liste : List[_a]) -> List[_a]: if len(liste) == 0: return [] else: mini, autres = selectionne_min(liste) return [mini] + tri_selection(autres) tri_selection(test) from typing import TypeVar, List, Tuple _a = TypeVar('alpha') def separe(liste : List[_a]) -> Tuple[List[_a], List[_a]]: if len(liste) == 0: return ([], []) elif len(liste) == 1: return ([liste[0]], []) else: x, y, q = liste[0], liste[1], liste[2:] a, b = separe(q) return ([x] + a, [y] + b) test separe(test) def fusion(liste1 : List[_a], liste2 : List[_a]) -> List[_a]: if (len(liste1), len(liste2)) == (0, 0): return [] elif len(liste1) == 0: return liste2 elif len(liste2) == 0: return liste1 else: # les deux sont non vides x, a = liste1[0], liste1[1:] y, b = liste2[0], liste2[1:] if x <= y: return [x] + fusion(a, [y] + b) else: return [y] + fusion([x] + a, b) fusion([1, 3, 7], [2, 3, 8]) def tri_fusion(liste : List[_a]) -> List[_a]: if len(liste) <= 1: return liste else: a, b = separe(liste) return fusion(tri_fusion(a), tri_fusion(b)) tri_fusion(test) %timeit tri_insertion(test) %timeit tri_selection(test) %timeit tri_fusion(test) from sys import setrecursionlimit setrecursionlimit(100000) # nécessaire pour tester les différentes fonctions récursives sur de grosses listes import random def test_random(n : int) -> List[int]: return [random.randint(-1000, 1000) for _ in range(n)] for n in [10, 100, 1000]: print("\nFor n =", n) for tri in [tri_insertion, tri_selection, tri_fusion]: print(" and tri = {}".format(tri.__name__)) %timeit tri(test_random(n)) from typing import TypeVar, List, Callable _a, _b = TypeVar('_a'), TypeVar('_b') def applique(f : Callable[[_a], _b], liste : List[_a]) -> List[_b]: # Triche : return list(map(f, liste)) # 1ère approche : return [f(x) for x in liste] # 2ème approche : fliste = [] for x in liste: fliste.append(f(x)) return fliste # 3ème approche n = len(liste) if n == 0: return [] fliste = [liste[0] for _ in range(n)] for i in range(n): fliste[i] = f(liste[i]) return fliste def premiers_carres_parfaits(n : int) -> List[int]: return applique(lambda x : x * x, list(range(1, n + 1))) premiers_carres_parfaits(12) from typing import TypeVar, List, Callable _a = TypeVar('_a') def itere(f : Callable[[_a], None], liste : List[_a]) -> None: for x in liste: f(x) print_int = lambda i: print("{}".format(i)) def affiche_liste_entiers(liste : List[int]) -> None: print("Debut") itere(print_int, liste) print("Fin") affiche_liste_entiers([1, 2, 4, 5, 12011993]) from typing import TypeVar, List, Callable _a = TypeVar('_a') # Comme all(map(f, liste)) def qqsoit(f : Callable[[_a], bool], liste : List[_a]) -> bool: for x in liste: if not f(x): return False # arret preliminaire return True # Comme any(map(f, liste)) def ilexiste(f : Callable[[_a], bool], liste : List[_a]) -> bool: for x in liste: if f(x): return True # arret preliminaire return False qqsoit(lambda x: (x % 2) == 0, [1, 2, 3, 4, 5]) ilexiste(lambda x: (x % 2) == 0, [1, 2, 3, 4, 5]) %timeit qqsoit(lambda x: (x % 2) == 0, [1, 2, 3, 4, 5]) %timeit all(map(lambda x: (x % 2) == 0, [1, 2, 3, 4, 5])) %timeit ilexiste(lambda x: (x % 2) == 0, [1, 2, 3, 4, 5]) %timeit any(map(lambda x: (x % 2) == 0, [1, 2, 3, 4, 5])) def appartient_curry(x : _a) -> Callable[[List[_a]], bool]: return lambda liste: ilexiste(lambda y: x == y, liste) def appartient(x : _a, liste : List[_a]) -> bool: return ilexiste(lambda y: x == y, liste) def toutes_egales(x : _a, liste : List[_a]) -> bool: return qqsoit(lambda y: x == y, liste) appartient_curry(1)([1, 2, 3]) appartient(1, [1, 2, 3]) appartient(5, [1, 2, 3]) toutes_egales(1, [1, 2, 3]) toutes_egales(5, [1, 2, 3]) %timeit appartient(random.randint(-10, 10), [random.randint(-1000, 1000) for _ in range(1000)]) %timeit random.randint(-10, 10) in [random.randint(-1000, 1000) for _ in range(1000)] from typing import TypeVar, List, Callable _a = TypeVar('_a') # Comme list(filter(f, liste)) def filtre(f : Callable[[_a], bool], liste : List[_a]) -> List[_a]: # return [x for x in liste if f(x)] liste2 = [] for x in liste: if f(x): liste2.append(x) return liste2 filtre(lambda x: (x % 2) == 0, [1, 2, 3, 4, 5]) filtre(lambda x: (x % 2) != 0, [1, 2, 3, 4, 5]) pairs = lambda liste: filtre(lambda x: (x % 2) == 0, liste) impairs = lambda liste: filtre(lambda x: (x % 2) != 0, liste) pairs(list(range(10))) impairs(list(range(10))) from typing import TypeVar, List, Callable _a = TypeVar('_a') # Comme list(filter(f, liste)) def reduit_rec(f : Callable[[_a, _b], _a], acc : _a, liste : List[_b]) -> _a: if len(liste) == 0: return acc else: h, q = liste[0], liste[1:] return reduit(f, f(acc, h), q) # Version non récursive, bien plus efficace def reduit(f : Callable[[_a, _b], _a], acc : _a, liste : List[_b]) -> _a: acc_value = acc for x in liste: acc_value = f(acc_value, x) return acc_value from operator import add somme_rec = lambda liste: reduit_rec(add, 0, liste) somme = lambda liste: reduit(add, 0, liste) somme_rec(list(range(10))) somme(list(range(10))) sum(list(range(10))) %timeit somme_rec(list(range(10))) %timeit somme(list(range(10))) %timeit sum(list(range(10))) %timeit somme_rec(list(range(1000))) %timeit somme(list(range(1000))) %timeit sum(list(range(1000))) from operator import mul produit = lambda liste: reduit(mul, 1, liste) produit(list(range(1, 6))) # 5! = 120 def factorielle(n : int) -> int: return produit(range(1, n + 1)) for n in range(1, 15): print("{:>7}! = {:>13}".format(n, factorielle(n))) miroir = lambda liste: reduit(lambda l, x : [x] + l, [], liste) miroir([2, 3, 5, 7, 11]) from typing import Dict, Optional, Tuple # Impossible de définir un type récursivement, pas comme en Caml arbre_bin = Dict[str, Optional[Tuple[Dict, Dict]]] from pprint import pprint arbre_test = {'Noeud': ( {'Noeud': ( {'Noeud': ( {'Feuille': None}, {'Feuille': None} )}, {'Feuille': None} )}, {'Feuille': None} )} pprint(arbre_test) Feuille = {'Feuille': None} Noeud = lambda x, y : {'Noeud': (x, y)} arbre_test = Noeud(Noeud(Noeud(Feuille, Feuille), Feuille), Feuille) pprint(arbre_test) def taille(a : arbre_bin) -> int: # Pattern matching ~= if, elif,.. sur les clés de la profondeur 1 # du dictionnaire (une seule clé) if 'Feuille' in a: return 1 elif 'Noeud' in a: x, y = a['Noeud'] return 1 + taille(x) + taille(y) taille(arbre_test) # 7 def hauteur(a : arbre_bin) -> int: if 'Feuille' in a: return 0 elif 'Noeud' in a: x, y = a['Noeud'] return 1 + max(hauteur(x), hauteur(y)) hauteur(arbre_test) # 3 from typing import TypeVar, Union, List F = TypeVar('F') N = TypeVar('N') element_parcours = Union[F, N] parcours = List[element_parcours] def parcours_prefixe(a : arbre_bin) -> parcours: if 'Feuille' in a: return [F] elif 'Noeud' in a: g, d = a['Noeud'] return [N] + parcours_prefixe(g) + parcours_prefixe(d) parcours_prefixe(arbre_test) def parcours_postfixe(a : arbre_bin) -> parcours: if 'Feuille' in a: return [F] elif 'Noeud' in a: g, d = a['Noeud'] return parcours_postfixe(g) + parcours_postfixe(d) + [N] parcours_postfixe(arbre_test) def parcours_infixe(a : arbre_bin) -> parcours: if 'Feuille' in a: return [F] elif 'Noeud' in a: g, d = a['Noeud'] return parcours_infixe(g) + [N] + parcours_infixe(d) parcours_infixe(arbre_test) def parcours_prefixe2(a : arbre_bin) -> parcours: def parcours(vus, b): if 'Feuille' in b: vus.insert(0, F) return vus elif 'Noeud' in b: vus.insert(0, N) g, d = b['Noeud'] return parcours(parcours(vus, g), d) p = parcours([], a) return p[::-1] parcours_prefixe2(arbre_test) def parcours_postfixe2(a : arbre_bin) -> parcours: def parcours(vus, b): if 'Feuille' in b: vus.insert(0, F) return vus elif 'Noeud' in b: g, d = b['Noeud'] p = parcours(parcours(vus, g), d) p.insert(0, N) return p p = parcours([], a) return p[::-1] parcours_postfixe2(arbre_test) def parcours_infixe2(a : arbre_bin) -> parcours: def parcours(vus, b): if 'Feuille' in b: vus.insert(0, F) return vus elif 'Noeud' in b: g, d = b['Noeud'] p = parcours(vus, g) p.insert(0, N) return parcours(p, d) p = parcours([], a) return p[::-1] parcours_infixe2(arbre_test) from collections import deque def parcours_largeur(a : arbre_bin) -> parcours: file = deque() # fonction avec effet de bord sur la file def vasy() -> parcours: if len(file) == 0: return [] else: b = file.pop() if 'Feuille' in b: # return [F] + vasy() v = vasy() v.insert(0, F) return v elif 'Noeud' in b: g, d = b['Noeud'] file.insert(0, g) file.insert(0, d) # return [N] + vasy() v = vasy() v.insert(0, N) return v file.insert(0, a) return vasy() parcours_largeur(arbre_test) def parcours_profondeur(a : arbre_bin) -> parcours: pile = [] # fonction avec effet de bord sur la file def vasy() -> parcours: if len(pile) == 0: return [] else: b = pile.pop() if 'Feuille' in b: # return [F] + vasy() v = vasy() v.append(F) return v elif 'Noeud' in b: g, d = b['Noeud'] pile.append(g) pile.append(d) # return [N] + vasy() v = vasy() v.insert(0, N) return v pile.append(a) return vasy() parcours_profondeur(arbre_test) test_prefixe = parcours_prefixe2(arbre_test) test_prefixe from typing import Tuple def reconstruit_prefixe(par : parcours) -> arbre_bin: def reconstruit(p : parcours) -> Tuple[arbre_bin, parcours]: if len(p) == 0: raise ValueError("parcours invalide pour reconstruit_prefixe") elif p[0] == F: return (Feuille, p[1:]) elif p[0] == N: g, q = reconstruit(p[1:]) d, r = reconstruit(q) return (Noeud(g, d), r) # call it a, p = reconstruit(par) if len(p) == 0: return a else: raise ValueError("parcours invalide pour reconstruit_prefixe") reconstruit_prefixe([F]) reconstruit_prefixe(test_prefixe) reconstruit_prefixe([N, F, F] + test_prefixe) # échoue largeur_test = parcours_largeur(arbre_test) largeur_test from collections import deque def reconstruit_largeur(par : parcours) -> arbre_bin: file = deque() # Fonction avec effets de bord def lire_element(e : element_parcours) -> None: if e == F: file.append(Feuille) elif e == N: d = file.popleft() g = file.popleft() # attention à l'ordre ! file.append(Noeud(g, d)) # Applique cette fonction à chaque élement du parcours for e in reversed(par): lire_element(e) if len(file) == 1: return file.popleft() else: raise ValueError("parcours invalide pour reconstruit_largeur") largeur_test reconstruit_largeur(largeur_test) arbre_test from collections import deque def reconstruit_prefixe2(par : parcours) -> arbre_bin: pile = deque() # Fonction avec effets de bord def lire_element(e : element_parcours) -> None: if e == F: pile.append(Feuille) elif e == N: g = pile.pop() d = pile.pop() # attention à l'ordre ! pile.append(Noeud(g, d)) # Applique cette fonction à chaque élement du parcours for e in reversed(par): lire_element(e) if len(pile) == 1: return pile.pop() else: raise ValueError("parcours invalide pour reconstruit_prefixe2") prefixe_test = parcours_prefixe2(arbre_test) prefixe_test reconstruit_prefixe2(prefixe_test) arbre_test <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Listes Step2: Exercice 2 Step3: Mais attention le typage est toujours optionnel en Python Step4: Exercice 3 Step5: Notre implémentation est évidemment plus lente que le test x in liste de la librarie standard... Step6: Exercice 4 Step7: Exercice 5 Step8: La complexité est linéaire en $\mathcal{O}(\max(|\text{liste 1}|, |\text{liste 2}|)$. Step9: Exercice 7 Step10: Exercice 8 Step11: Exercice 9 Step12: Une version purement fonctionnelle est moins facile qu'une version impérative avec une référence booléenne. Step14: Listes simplement chaînée (manuellement définies) Step15: Exercice 1 Step16: Exercice 2 Step17: On peut vérifier que cela marche en regardant, par exemple, l'id de deux objets si le deuxième est une copie du premier Step18: Et donc pour concaténer deux chaînes, c'est facile Step19: Exercice 3 Step20: Exercice 4 Step21: Exercice 5 Step22: La complexité est quadratique en $\mathcal{O}((\max(|\text{liste 1}|, |\text{liste 2}|)^2)$ à cause des recopies. Step23: On peut facilement écrire une variante qui sera récursive terminale ("tail recursive") Step24: Exercice 7 Step25: Et donc c'est rapide Step26: Exercice 8 Step27: Si on veut les avoir dans l'ordre croissant, il faudrait utiliser miroir qui est quadratique. Step28: Une autre approche est d'écrire la fonction mymap et de dire que Step29: Exercice 9 Step30: Une version purement fonctionnelle est moins facile qu'une version impérative avec une référence booléenne. Step31: On est prêt à écrire estPremier Step32: En effet il suffit de construire d'abord la liste des entiers impairs de 2 à $\lfloor \sqrt{n} \rfloor$, de les filtrer par ceux qui divisent $n$, et de vérifier si on a aucun diviseur (taille(..) == 0) auquel cas $n$ est premier, ou si $n$ a au moins un diviseur auquel cas $n$ n'est pas premier. Step33: On voit dans l'exemple ci dessus les nombres premiers comme ceux n'ayant aucun diviseurs, et les nombres non premiers comme ceux ayant au moins un diviseur. Step34: Quelques tris par comparaison Step35: Exercice 10 Step36: Complexité en temps $\mathcal{O}(n^2)$. Step37: Exercice 12 Step38: (On voit que la liste autre a été inversée) Step39: Complexité en temps Step40: Complexité en temps $\mathcal{O}(n \log n)$. Step41: C'est assez pour vérifier que le tri fusion est bien plus efficace que les autres. Step42: Exercice 17 Step43: Exercice 18 Step44: Exercice 19 Step45: Exercice 20 Step46: Exercice 21 Step47: Est-ce que notre implémentation peut être plus rapide que le test x in liste ? Step48: Exercice 22 Step49: Exercice 23 Step50: Exercice 24 Step51: Très pratique pour calculer des sommes, notamment. Step52: Pour de petites listes, la version récursive est aussi efficace que la version impérative. Chouette ! Step53: Bonus Step54: Exercice 26 Step55: Attention en Python, les listes ne sont PAS simplement chainées, donc lambda l, x Step56: Avec une syntaxe améliorée, on se rapproche de très près de la syntaxe de Caml/OCaml Step57: Exercice 28 Step58: Exercice 29 Step59: Exercice 30 Step60: Exercice 32 Step61: Pourquoi ont-ils une complexité quadratique ? La concaténation (@ en OCaml, + en Python) ne se fait pas en temps constant mais linéaire dans la taille de la plus longue liste. Step62: Exercice 34 Step63: En remplaçant la file par une pile (une simple list), on obtient le parcours en profondeur, avec la même complexité. Step64: Exercice 35 et fin Step65: L'idée de cette solution est la suivante Step66: Et cet exemple va échouer Step67: Reconstruction depuis le parcours en largeur Step68: Le même algorithme (enfin presque, modulo interversion de g et d)
5,239
<ASSISTANT_TASK:> Python Code: import os, sys import inspect import numpy as np import datetime as dt import time import pytz import pandas as pd import pdb script_dir = os.path.dirname(os.path.abspath(inspect.getfile(inspect.currentframe()))) # add the path to opengrid to sys.path sys.path.append(os.path.join(script_dir, os.pardir, os.pardir)) from opengrid.library import config c=config.Config() DEV = c.get('env', 'type') == 'dev' # DEV is True if we are in development environment, False if on the droplet if not DEV: # production environment: don't try to display plots import matplotlib matplotlib.use('Agg') import matplotlib.pyplot as plt from matplotlib.dates import HourLocator, DateFormatter, AutoDateLocator # find tmpo sys.path.append(c.get('tmpo', 'folder')) from opengrid.library.houseprint import houseprint if DEV: if c.get('env', 'plots') == 'inline': %matplotlib inline else: %matplotlib qt else: pass # don't try to render plots plt.rcParams['figure.figsize'] = 12,8 BXL = pytz.timezone('Europe/Brussels') number_of_days = 7 hp = houseprint.load_houseprint_from_file('new_houseprint.pkl') hp.init_tmpo() start = pd.Timestamp(time.time() - number_of_days*86400, unit='s') df = hp.get_data(sensortype='electricity', head=start, resample='s') df = df.resample(rule='60s', how='max') df = df.diff()*3600/60 df.index = df.index.tz_convert(BXL) # plot a few dataframes to inspect them if DEV: for sensor in df.columns: plt.figure() df[sensor].plot() def testvalid(row): return row['maxima'] > 0 and row['maxima'] <> row['minima'] def get_minima(sensor): Return the standby consumption for the covered days for a given sensor as an array. Take care of days where this sensor has NO VALID standby consumption global minima res = np.ndarray(len(minima)) for i,df in enumerate(minima): try: res[i] = df[sensor] except: res[i] = np.nan return res index_slices = [] # will contain the correct index slices for each of the analysed nights minima = [] # each element in minima is a dataframe with standby consumption per valid sensor valid_sensors = set() # we keep track of all sensors that yield a valid standby consumption for at least one day. # find the date for which we still have the full night (between 01:00 and 05:00). We will store it as datetime at 00:00 (local time) hour = df.index[-1].hour # the hour of the last index. if hour >= 5: last_day = df.index[-1].date() else: last_day = (df.index[-1] - dt.timedelta(days=1)).date() for day in range(number_of_days)[::-1]: #pdb.set_trace() dt_start = dt.datetime.combine(last_day - dt.timedelta(days=day), dt.time(0,0)) # start slicing at 01:00 local time dt_stop = dt.datetime.combine(last_day - dt.timedelta(days=day), dt.time(5,0)) # stop slicing at 05:00 local time df_night = df.ix[dt_start:dt_stop] # contains only data for a single night index_slices.append(df_night.index.copy()) df_results = pd.DataFrame(index=df.columns) #df_results contains the results of the analysis for a single night. Index = sensorid df_results['minima'] = df_night.min(axis=0) df_results['maxima'] = df_night.max(axis=0) df_results['valid'] = df_results.apply(testvalid, axis=1) minima.append(df_results['minima'].ix[df_results.valid]) valid_sensors.update(set(minima[-1].index.tolist())) index_slices_days = [x[0] for x in index_slices[1:]] index = pd.DatetimeIndex(freq='D', start=index_slices_days[0], periods=number_of_days) df_=pd.concat(minima, axis=1) df_.columns = index df_statistics = df_.describe().T df_statistics for sensor in list(valid_sensors)[:]: plt.figure(figsize=(10,8)) ax1=plt.subplot(211) ax1.plot_date(df_statistics.index, df_statistics[u'25%'], '-', lw=2, color='g', label=u'25%') ax1.plot_date(df_statistics.index, df_statistics[u'50%'], '-', lw=2, color='orange', label=u'50%') ax1.plot_date(df_statistics.index, df_statistics[u'75%'], '-', lw=2, color='r', label=u'75%') ax1.plot_date(df_.T.index, df_.T[sensor], 'rD', ms=7) xticks = [x.strftime(format='%d/%m') for x in df_statistics.index] locs, lables=plt.xticks() plt.xticks(locs, xticks, rotation='vertical') plt.title(hp.find_sensor(sensor).device.key + ' - ' + sensor) ax1.grid() ax1.set_ylabel('Watt') ax2=plt.subplot(212) try: ax2.plot(index_slices[-1], df.ix[index_slices[-1]][sensor], 'b-', label='Afgelopen nacht') ax2.xaxis_date(BXL) #Put timeseries plot in local time # rotate the labels plt.xticks(rotation='vertical') plt.legend() ax2.set_ylabel('Watt') except: print "Could not create graph for {}".format(hp.find_sensor(sensor).device.key) else: plt.savefig(os.path.join(c.get('data', 'folder'), 'figures', 'standby_vertical_'+sensor+'.png'), dpi=100) if not DEV: plt.close() try: valid_sensors.remove('565de0a7dc64d8370aa321491217b85f') # the FLM of 3E does not fit in household standby benchmark except: pass for sensor in valid_sensors: plt.figure(figsize=(10,5)) ax1=plt.subplot(121) box = [x.values for x in minima] ax1.boxplot(box, positions=range(len(df_statistics)), notch=False) ax1.plot(range(len(df_statistics)), get_minima(sensor), 'rD', ms=10, label='Sluipverbruik') xticks = [x[0].strftime(format='%d/%m') for x in index_slices] plt.xticks(range(len(df_statistics)), xticks, rotation='vertical') #plt.title(hp.get_flukso_from_sensor(sensor) + ' - ' + sensor) ax1.grid() ax1.set_ylabel('Watt') plt.legend(numpoints=1, frameon=False) #ax1.set_xticklabels([t.strftime(format='%d/%m') for t in df_all_perday.index.tolist()]) ax2=plt.subplot(122) try: ax2.plot(index_slices[-1], df.ix[index_slices[-1]][sensor], 'b-', label='Afgelopen nacht') ax2.xaxis_date(BXL) #Put timeseries plot in local time # rotate the labels plt.xticks(rotation='vertical') ax2.set_ylabel('Watt') ax2.grid() plt.legend(loc='upper right', frameon=False) plt.tight_layout() except Exception as e: print(e) else: plt.savefig(os.path.join(c.get('data', 'folder'), 'figures', 'standby_horizontal_'+sensor+'.png'), dpi=100) if not DEV: plt.close() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Script settings Step2: We create one big dataframe, the columns are the sensors of type electricity Step3: Convert Datetimeindex to local time Step5: We define two low-level functions Step6: Data handling Step7: Plots
5,240
<ASSISTANT_TASK:> Python Code: import matplotlib import matplotlib.pyplot as plt import numpy as np import pymc as pm from numpy.random import choice %matplotlib inline matplotlib.style.use('ggplot') matplotlib.rc_params_from_file("../styles/matplotlibrc" ).update() def switch_envelope(chosen_envelope): if chosen_envelope == 'a': return 'b' else: return 'a' '''Find out if the final envelope _actually_ contains the highest value''' def isLargerAmount(chosen_envelope, envelope_contents): inverted_contents = create_inverted_envelope(envelope_contents) if chosen_envelope == inverted_contents.get(np.max(inverted_contents.keys())): return 1 # success else: return 0 # failure '''We need an inverse lookup table to associate the highest value with an envelope''' def create_inverted_envelope(envelope_contents): dct = {} for key in envelope_contents.keys(): dct[envelope_contents.get(key)] = key return dct def singleExperiment(money_distribution, threshold_distribution): # create two identical envelopes with a random amount of money envelope_contents = {'a': money_distribution.random().item(), 'b': money_distribution.random().item()} #choose an envelope chosen_envelope = choice(['a','b']) #check for the amount and switch if necessary if (threshold_distribution.random().item() >= envelope_contents[chosen_envelope]): chosen_envelope = switch_envelope(chosen_envelope) #evaluate whether strategy was a success return isLargerAmount(chosen_envelope, envelope_contents) money = pm.DiscreteUniform('money', 100, 100000) threshold = pm.Exponential("threshold", 0.00005) def run_n_experiments(n_trials, money, threshold): lst = [] for idx in range(n_trials): lst.append(singleExperiment(money, threshold)) return np.mean(lst) print 'The success probability is approximately p = %0.3f' % run_n_experiments(100, money, threshold) money = pm.DiscreteUniform('money', 100, 100000) def createSuccessValuesFrom(rates): success_values = [] for rate in rates: threshold = pm.Exponential("threshold", rate) success_values.append(run_n_experiments(1000, money, threshold)) return success_values array_of_rates = np.logspace(-8, 0, num=100) plt.semilogx(array_of_rates, createSuccessValuesFrom(array_of_rates)) def averageSuccessRate(threshold, number_of_repetitions): trial = 0 lst = [] while trial < number_of_repetitions: lst.append(run_n_experiments(100, money, threshold)) trial += 1 return np.mean(lst), np.std(lst) def createSmoothSuccessValuesFrom(rates, number_of_repetitions): success_values = [] stddev = [] for rate in rates: threshold = pm.Exponential("threshold", rate) success_values.append(averageSuccessRate(threshold, number_of_repetitions)[0]) stddev.append(averageSuccessRate(threshold, number_of_repetitions)[1]) return success_values, stddev array_of_rates = np.logspace(-8, 0, num=50) smoothened_rates = createSmoothSuccessValuesFrom(array_of_rates, 25) plt.semilogx(array_of_rates, smoothened_rates[0]) threshold = pm.Exponential('threshold', 0.00002) print 'The success probability is approximately p = %0.3f +/- %0.3f ' % averageSuccessRate(threshold, 100) def createSuccessValuesWithMoneyRangeFrom(rates, money): success_values = [] for rate in rates: threshold = pm.Exponential("threshold", rate) success_values.append(run_n_experiments(1000, money, threshold)) return success_values money_1 = pm.DiscreteUniform('money', 100, np.power(10, 3)) money_2 = pm.DiscreteUniform('money', 100, np.power(10, 6)) money_3 = pm.DiscreteUniform('money', 100000, np.power(10, 9)) array_of_rates = np.logspace(-10, 0, num=100) plt.semilogx(array_of_rates, createSuccessValuesWithMoneyRangeFrom(array_of_rates, money_1), array_of_rates, createSuccessValuesWithMoneyRangeFrom(array_of_rates, money_2), array_of_rates, createSuccessValuesWithMoneyRangeFrom(array_of_rates, money_3)) money_1 = pm.Normal('money', np.power(10,5), 100) money_2 = pm.Normal('money', np.power(10,5), 500) money_3 = pm.Normal('money', np.power(10,5), 10000) array_of_rates = np.logspace(-8, 0, num=100) plt.semilogx(array_of_rates, createSuccessValuesWithMoneyRangeFrom(array_of_rates, money_1), array_of_rates, createSuccessValuesWithMoneyRangeFrom(array_of_rates, money_2), array_of_rates, createSuccessValuesWithMoneyRangeFrom(array_of_rates, money_3)) from IPython.core.display import HTML def css_styling(): styles = open("../styles/custom.css", "r").read() return HTML(styles) css_styling() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Helper methods Step2: We also need some helper methods to evaluate the success of our strategy Step3: Implementing the actual strategy Step4: Performing the experiment Step5: Let us run the experiment $n_{trials}$ times. Since we return values $1$ and $0$ for success and failure, respectively, we can find a good approximation of the success probability by computing the mean. Step6: It seems strategy 2 from above is correct! The probability is significantly higher than $0.5$ and switching seems like a good choice. How is that possible? Step7: Dependence on the rate parameter Step8: Now let's create a couple of rates and plot the final result Step9: We see that this curve is pretty noisy. To smoothen the noise, we can create a bunch of curves and average them. Alternatively we can create a bunch of success rates for every threshold rate and average them. Step10: Let's plot the results! Step11: We see that after the noise reduction we still have a pronounced feature. To fully appreciate that let's see what the deviation from the mean is for an eyeballed optimal rate of $\lambda = 2\, 10^{-5}$ Step12: We win! Even within a standard deviation the success rate is significant. Step13: We can clearly see that with increasing the spread of the distribution the maximum is moving towars smaller rates. In fact you can roughly say that the maximum occurs at at a rate close to the inverse of the upper boundary. This makes sense since the expectation value $E(T) = 1/\lambda$ and thus an optimal threshold choice is given by the inverse of the upper limit of the money distribution. Step14: Our advantage is gone! The fact that we do know something about the money distribution mysteriously decorrelates the envelopes and renders our strategy obsolete. We might as well stick with any envelope independent of the amount of money we find in it. However, this might not be a bad trade, since we now have a rough idea of what is in either envelope before we even open it.
5,241
<ASSISTANT_TASK:> Python Code: x = [7, 3, 5] x.pop? # anything after the hashtag is a comment # load packages import datetime as dt import pandas.io.data as web # data import tools import matplotlib.pyplot as plt # plotting tools # The next one is an IPython command: it says to put plots here in the notebook, rather than open a separate window. %matplotlib inline # get data from FRED fred_series = ["GDPC1"] start_date = dt.datetime(1960, 1, 1) data = web.DataReader(fred_series, "fred", start_date) # print last 3 data points to see what we've got print(data.tail(3)) # compute annual growth rates g = 4*data.pct_change() # change label g.columns = ['US GDP Growth'] # enter your commands here # more examples: some statistics on GDP growth print(['Mean GDP growth ', g.mean()]) print(['Std deviation ', g.std()]) # do this for subperiods... # quick and dirty plot # note the financial crisis: GDP fell 8% one quarter (at an annual rate, so really 2%) g.plot() plt.show() # more complex plot, bar chart for last 6 quarters # also: add moving average? # load packages (if it's redundant it'll be ignored) import pandas.io.data as web # read data from Ken French's website ff = web.DataReader('F-F_Research_Data_Factors', 'famafrench')[0] # NB: ff.xs is a conflict, rename to xsm ff.columns = ['xsm', 'smb', 'hml', 'rf'] # see what we've got print(ff.head(3)) print(ff.describe()) # compute and print summary stats moments = [ff.mean(), ff.std(), ff.skew(), ff.kurtosis() - 3] # \n here is a line break print('Summary stats for Fama-French factors (mean, std, skew, ex kurt)') #, end='\n\n') print(moments) #[print(moment, end='\n\n') for moment in moments] # try some things yourself # like what? type ff.[tab] import pandas as pd pd.__version__ # some plots ff.plot() plt.show() ff.hist(bins=50, sharex=True) plt.show() ff.boxplot(whis=0, return_type='axes') plt.show() # load package under name wb from pandas.io import wb # find the codes for the variables of interest wb.search wb.search(string='gdp.*capita').iloc[:2] # specify dates, variables, and countries start = 2011 # GDP per capita, population, life expectancy variable_list = ['NY.GDP.PCAP.KD', 'SP.POP.TOTL', 'SP.DYN.LE00.IN'] country_list = ['US', 'FR', 'JP', 'CN', 'IN', 'BR', 'MX'] # Python understands we need to go to the second line because ( hasn't been closed by ) data = wb.download(indicator=variable_list, country=country_list, start=start, end=start).dropna() # see what we've got print(data) # check the column labels, change to something simpler print(data.columns) data.columns = ['gdppc', 'pop', 'le'] print(data) # scatterplot # life expectancy v GDP per capita # size of circles controlled by population # load packages (ignored if redundant) import numpy as np import matplotlib.pyplot as plt plt.scatter(data['gdppc'], data['le'], s=0.000001*data['pop'], alpha=0.5) plt.ylabel('Life Expectancy') plt.xlabel('GDP Per Capita') plt.show() # Note: size of circles based on population # load packages import pandas as pd import pandas.io.data as web from pandas.io.data import Options import datetime as dt import matplotlib.pylab as plt # ticker ticker = 'spy' # load stock price first (the underlying) # pick a recent date and subtract seven days to be sure we get a quote # http://pymotw.com/2/datetime/#date-arithmetic today = dt.date.today() one_week = dt.timedelta(days=7) start = today - one_week stock = web.DataReader(ticker, 'yahoo', start) print(stock) # just to see what we have # take the last close (-1 is the last, 'Close' is the close) # this shows up in our figure atm = stock.ix[-1,'Close'] # the -1 takes the last observation # get option prices for same ticker option = Options(ticker, 'yahoo') expiry = dt.date(2014, 11, 20) data_calls = option.get_call_data(expiry=expiry).dropna() data_puts = option.get_put_data(expiry=expiry).dropna() # check what we have print(data_calls.index) print(data_calls.tail()) # compute mid of bid and ask and arrange series for plotting calls_bid = data_calls['Bid'] calls_ask = data_calls['Ask'] calls_strikes = data_calls['Strike'] calls_mid = (data_calls['Bid'] + data_calls['Ask'])/2 puts_strikes = data_puts['Strike'] puts_mid = (data_puts['Bid'] + data_puts['Ask'])/2 # plot call and put prices v strike plt.plot(calls_strikes, calls_mid, 'r', lw=2, label='calls') plt.plot(puts_strikes, puts_mid, 'b', lw=2, label='puts') # prettify it #plt.axis([120, 250, 0, 50]) plt.axvline(x=atm, color='k', linestyle='--', label='ATM') plt.legend(loc='best') plt.show() # rerun the figure above with different color lines. Or dashed lines for call and put prices. # or change the form of the vertical ATM line: solid? another color? <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Example 1 Step2: The variable g (quarterly GDP growth expressed as an annual rate) is now what Python calls a DataFrame, which is a collection of data organized by variable and observation. You can get some of its properties by typing some or all of the following in the box below Step3: Example 2 Step4: Answer(s)? Aren't the boxplots in the last figure cool? The histograms above them? What do you see in them? How do the various returns compare? Step5: Example 4 Step6: Note to self.
5,242
<ASSISTANT_TASK:> Python Code: # These are all the modules we'll be using later. Make sure you can import them # before proceeding further. import matplotlib.pyplot as plt import numpy as np import os import tarfile import urllib from urllib.request import urlretrieve from IPython.display import display, Image from scipy import ndimage from sklearn.linear_model import LogisticRegression import pickle url = 'http://yaroslavvb.com/upload/notMNIST/' def maybe_download(filename, expected_bytes): Download a file if not present, and make sure it's the right size. if not os.path.exists(filename): filename, _ = urllib.urlretrieve(url + filename, filename) statinfo = os.stat(filename) if statinfo.st_size == expected_bytes: print ('Found and verified', filename) else: raise Exception('Failed to verify' + filename + '. Can you get to it with a browser?') return filename train_filename = maybe_download('notMNIST_large.tar.gz', 247336696) test_filename = maybe_download('notMNIST_small.tar.gz', 8458043) num_classes = 10 def extract(filename): tar = tarfile.open(filename) tar.extractall() tar.close() root = os.path.splitext(os.path.splitext(filename)[0])[0] # remove .tar.gz data_folders = [os.path.join(root, d) for d in sorted(os.listdir(root))] if len(data_folders) != num_classes: raise Exception( 'Expected %d folders, one per class. Found %d instead.' % ( num_folders, len(data_folders))) print (data_folders) return data_folders train_folders = extract(train_filename) test_folders = extract(test_filename) image_size = 28 # Pixel width and height. pixel_depth = 255.0 # Number of levels per pixel. def load(data_folders, min_num_images, max_num_images): dataset = np.ndarray( shape=(max_num_images, image_size, image_size), dtype=np.float32) labels = np.ndarray(shape=(max_num_images), dtype=np.int32) label_index = 0 image_index = 0 for folder in data_folders: print folder for image in os.listdir(folder): if image_index >= max_num_images: raise Exception('More images than expected: %d >= %d' % ( num_images, max_num_images)) image_file = os.path.join(folder, image) try: image_data = (ndimage.imread(image_file).astype(float) - pixel_depth / 2) / pixel_depth if image_data.shape != (image_size, image_size): raise Exception('Unexpected image shape: %s' % str(image_data.shape)) dataset[image_index, :, :] = image_data labels[image_index] = label_index image_index += 1 except IOError as e: print 'Could not read:', image_file, ':', e, '- it\'s ok, skipping.' label_index += 1 num_images = image_index dataset = dataset[0:num_images, :, :] labels = labels[0:num_images] if num_images < min_num_images: raise Exception('Many fewer images than expected: %d < %d' % ( num_images, min_num_images)) print 'Full dataset tensor:', dataset.shape print 'Mean:', np.mean(dataset) print 'Standard deviation:', np.std(dataset) print 'Labels:', labels.shape return dataset, labels train_dataset, train_labels = load(train_folders, 450000, 550000) test_dataset, test_labels = load(test_folders, 18000, 20000) np.random.seed(133) def randomize(dataset, labels): permutation = np.random.permutation(labels.shape[0]) shuffled_dataset = dataset[permutation,:,:] shuffled_labels = labels[permutation] return shuffled_dataset, shuffled_labels train_dataset, train_labels = randomize(train_dataset, train_labels) test_dataset, test_labels = randomize(test_dataset, test_labels) train_size = 200000 valid_size = 10000 valid_dataset = train_dataset[:valid_size,:,:] valid_labels = train_labels[:valid_size] train_dataset = train_dataset[valid_size:valid_size+train_size,:,:] train_labels = train_labels[valid_size:valid_size+train_size] print 'Training', train_dataset.shape, train_labels.shape print 'Validation', valid_dataset.shape, valid_labels.shape pickle_file = 'notMNIST.pickle' try: f = open(pickle_file, 'wb') save = { 'train_dataset': train_dataset, 'train_labels': train_labels, 'valid_dataset': valid_dataset, 'valid_labels': valid_labels, 'test_dataset': test_dataset, 'test_labels': test_labels, } pickle.dump(save, f, pickle.HIGHEST_PROTOCOL) f.close() except Exception as e: print 'Unable to save data to', pickle_file, ':', e raise statinfo = os.stat(pickle_file) print 'Compressed pickle size:', statinfo.st_size <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: First, we'll download the dataset to our local machine. The data consists of characters rendered in a variety of fonts on a 28x28 image. The labels are limited to 'A' through 'J' (10 classes). The training set has about 500k and the testset 19000 labelled examples. Given these sizes, it should be possible to train models quickly on any machine. Step3: Extract the dataset from the compressed .tar.gz file. Step4: Problem 1 Step5: Problem 2 Step6: Problem 3 Step7: Finally, let's save the data for later reuse
5,243
<ASSISTANT_TASK:> Python Code: import toytree import toyplot # generate a random tree tre = toytree.rtree.unittree(ntips=10, treeheight=100, seed=123) # draw tree on canvas canvas, axes, mark = tre.draw(ts='c', layout='r', tip_labels=True); # get annotator tool anno = toytree.utils.Annotator(tre, axes, mark) # annotate clade by selecting names anno.draw_clade_box( names=['r0', 'r5'], style={ "fill": 'red', "fill-opacity": 0.15, "stroke-width": 2, "stroke": 'red', "stroke-opacity": 0.3, }, ); # draw tree on canvas canvas, axes, mark = tre.draw(ts='o', layout='r', tip_labels=False); # draw rectangles next to two clades axes.rectangle(20, 40, -0.45, 3.45, color=toytree.colors[1], opacity=0.5) axes.rectangle(20, 40, 3.55, 5.45, color=toytree.colors[2], opacity=0.5) axes.rectangle(20, 40, 5.55, 9.45, color=toytree.colors[3], opacity=0.5) axes.text(50, 1.5, "clade A", style={"text-anchor": "start", "fill": toytree.colors[1]}) axes.text(50, 4.5, "clade B", style={"text-anchor": "start", "fill": toytree.colors[2]}) axes.text(50, 7.5, "clade C", style={"text-anchor": "start", "fill": toytree.colors[3]}); import numpy as np import string tre = toytree.rtree.unittree(ntips=10, treeheight=100, seed=123) tre = tre.set_node_values( "name", {i: str(i) + string.ascii_letters[:np.random.randint(5, 15)] for i in range(10)} ) color = toytree.colors[1] # draw tree on canvas canvas, axes, mark = tre.draw(ts='c', layout='r', tip_labels=True); # get annotator tool anno = toytree.utils.Annotator(tre, axes, mark) # annotate clade anno.draw_clade_box( tre.get_tip_labels()[:3], yspace=tre.treenode.height / 15, style={ "fill": color, "fill-opacity": 0.25, "stroke-width": 2, "stroke": color, "stroke-opacity": 0.5, }, ); <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Builtin method to highlight clades Step2: Or, use toyplot directly Step3: More examples
5,244
<ASSISTANT_TASK:> Python Code: import os # The Vertex AI Workbench Notebook product has specific requirements IS_WORKBENCH_NOTEBOOK = os.getenv("DL_ANACONDA_HOME") IS_USER_MANAGED_WORKBENCH_NOTEBOOK = os.path.exists( "/opt/deeplearning/metadata/env_version" ) # Vertex AI Notebook requires dependencies to be installed with '--user' USER_FLAG = "" if IS_WORKBENCH_NOTEBOOK: USER_FLAG = "--user" ! pip3 install tensorflow-io==0.18 $USER_FLAG -q ! pip3 install --upgrade google-cloud-aiplatform \ google-cloud-pipeline-components \ google-cloud-logging \ pyarrow \ kfp $USER_FLAG -q import os if not os.getenv("IS_TESTING"): # Automatically restart kernel after installs import IPython app = IPython.Application.instance() app.kernel.do_shutdown(True) PROJECT_ID = "[your-project-id]" # @param {type:"string"} if PROJECT_ID == "" or PROJECT_ID is None or PROJECT_ID == "[your-project-id]": # Get your GCP project id from gcloud shell_output = ! gcloud config list --format 'value(core.project)' 2>/dev/null PROJECT_ID = shell_output[0] print("Project ID:", PROJECT_ID) ! gcloud config set project $PROJECT_ID REGION = "[your-region]" # @param {type: "string"} if REGION == "[your-region]": REGION = "us-central1" from datetime import datetime TIMESTAMP = datetime.now().strftime("%Y%m%d%H%M%S") # If you are running this notebook in Colab, run this cell and follow the # instructions to authenticate your GCP account. This provides access to your # Cloud Storage bucket and lets you submit training jobs and prediction # requests. import os import sys # If on Vertex AI Workbench, then don't execute this code IS_COLAB = False if not os.path.exists("/opt/deeplearning/metadata/env_version") and not os.getenv( "DL_ANACONDA_HOME" ): if "google.colab" in sys.modules: IS_COLAB = True from google.colab import auth as google_auth google_auth.authenticate_user() # If you are running this notebook locally, replace the string below with the # path to your service account key and run this cell to authenticate your GCP # account. elif not os.getenv("IS_TESTING"): %env GOOGLE_APPLICATION_CREDENTIALS '' BUCKET_NAME = "[your-bucket-name]" # @param {type:"string"} BUCKET_URI = f"gs://{BUCKET_NAME}" if BUCKET_URI == "" or BUCKET_URI is None or BUCKET_URI == "gs://[your-bucket-name]": BUCKET_URI = "gs://" + PROJECT_ID + "aip-" + TIMESTAMP ! gsutil mb -l $REGION $BUCKET_URI ! gsutil ls -al $BUCKET_URI SERVICE_ACCOUNT = "[your-service-account]" # @param {type:"string"} if ( SERVICE_ACCOUNT == "" or SERVICE_ACCOUNT is None or SERVICE_ACCOUNT == "[your-service-account]" ): # Get your service account from gcloud if not IS_COLAB: shell_output = !gcloud auth list 2>/dev/null SERVICE_ACCOUNT = shell_output[2].replace("*", "").strip() if IS_COLAB: shell_output = ! gcloud projects describe $PROJECT_ID project_number = shell_output[-1].split(":")[1].strip().replace("'", "") SERVICE_ACCOUNT = f"{project_number}-compute@developer.gserviceaccount.com" print("Service Account:", SERVICE_ACCOUNT) ! gsutil iam ch serviceAccount:{SERVICE_ACCOUNT}:roles/storage.objectCreator $BUCKET_URI ! gsutil iam ch serviceAccount:{SERVICE_ACCOUNT}:roles/storage.objectViewer $BUCKET_URI import base64 import json import google.cloud.aiplatform as aiplatform import tensorflow as tf from kfp import dsl from kfp.v2 import compiler from kfp.v2.dsl import Artifact, Input, Output, component aiplatform.init(project=PROJECT_ID, location=REGION, staging_bucket=BUCKET_URI) IMPORT_FILE = ( "gs://cloud-samples-data/vision/automl_classification/flowers/all_data_v2.csv" ) @component(packages_to_install=["google-cloud-aiplatform"]) def evaluateAutoMLModelOp( model: Input[Artifact], region: str, model_evaluation: Output[Artifact] ): import logging import google.cloud.aiplatform.gapic as gapic # Get a reference to the Model Service client client_options = {"api_endpoint": f"{region}-aiplatform.googleapis.com"} model_service_client = gapic.ModelServiceClient(client_options=client_options) model_id = model.metadata["resourceName"] model_evaluations = model_service_client.list_model_evaluations(parent=model_id) model_evaluation = list(model_evaluations)[0] logging.info(model_evaluation) PIPELINE_ROOT = "{}/pipeline_root/automl_icn_training".format(BUCKET_URI) DEPLOY_COMPUTE = "n1-standard-4" @dsl.pipeline( name="automl-icn-training", description="AutoML image classification training" ) def pipeline( import_file: str, batch_files: list, display_name: str, bucket: str = PIPELINE_ROOT, project: str = PROJECT_ID, region: str = REGION, ): from google_cloud_pipeline_components import aiplatform as gcc_aip dataset_op = gcc_aip.ImageDatasetCreateOp( project=project, display_name=display_name, gcs_source=import_file, import_schema_uri=aiplatform.schema.dataset.ioformat.image.single_label_classification, ) training_op = gcc_aip.AutoMLImageTrainingJobRunOp( project=project, display_name=display_name, prediction_type="classification", model_type="CLOUD", dataset=dataset_op.outputs["dataset"], model_display_name=display_name, training_fraction_split=0.6, validation_fraction_split=0.2, test_fraction_split=0.2, budget_milli_node_hours=8000, ) eval_op = evaluateAutoMLModelOp(model=training_op.outputs["model"], region=region) batch_op = gcc_aip.ModelBatchPredictOp( project=project, job_display_name="batch_predict_job", model=training_op.outputs["model"], gcs_source_uris=batch_files, gcs_destination_output_uri_prefix=bucket, instances_format="jsonl", predictions_format="jsonl", model_parameters={}, machine_type=DEPLOY_COMPUTE, starting_replica_count=1, max_replica_count=1, ).after(eval_op) endpoint_op = gcc_aip.EndpointCreateOp( project=project, location=region, display_name=display_name, ).after(batch_op) _ = gcc_aip.ModelDeployOp( model=training_op.outputs["model"], endpoint=endpoint_op.outputs["endpoint"], automatic_resources_min_replica_count=1, automatic_resources_max_replica_count=1, traffic_split={"0": 100}, ) test_items = !gsutil cat $IMPORT_FILE | head -n2 if len(str(test_items[0]).split(",")) == 3: _, test_item_1, test_label_1 = str(test_items[0]).split(",") _, test_item_2, test_label_2 = str(test_items[1]).split(",") else: test_item_1, test_label_1 = str(test_items[0]).split(",") test_item_2, test_label_2 = str(test_items[1]).split(",") print(test_item_1, test_label_1) print(test_item_2, test_label_2) file_1 = test_item_1.split("/")[-1] file_2 = test_item_2.split("/")[-1] ! gsutil cp $test_item_1 $BUCKET_URI/$file_1 ! gsutil cp $test_item_2 $BUCKET_URI/$file_2 test_item_1 = BUCKET_URI + "/" + file_1 test_item_2 = BUCKET_URI + "/" + file_2 gcs_input_uri = BUCKET_URI + "/test.jsonl" with tf.io.gfile.GFile(gcs_input_uri, "w") as f: data = {"content": test_item_1, "mime_type": "image/jpeg"} f.write(json.dumps(data) + "\n") data = {"content": test_item_2, "mime_type": "image/jpeg"} f.write(json.dumps(data) + "\n") print(gcs_input_uri) ! gsutil cat $gcs_input_uri compiler.Compiler().compile( pipeline_func=pipeline, package_path="automl_icn_training.json" ) pipeline = aiplatform.PipelineJob( display_name="automl_icn_training", template_path="automl_icn_training.json", pipeline_root=PIPELINE_ROOT, parameter_values={ "import_file": IMPORT_FILE, "batch_files": [gcs_input_uri], "display_name": "flowers" + TIMESTAMP, "project": PROJECT_ID, "region": REGION, }, ) pipeline.run() ! rm -f automl_icn_training.json PROJECT_NUMBER = pipeline.gca_resource.name.split("/")[1] print(PROJECT_NUMBER) def print_pipeline_output(job, output_task_name): JOB_ID = job.name print(JOB_ID) for _ in range(len(job.gca_resource.job_detail.task_details)): TASK_ID = job.gca_resource.job_detail.task_details[_].task_id EXECUTE_OUTPUT = ( PIPELINE_ROOT + "/" + PROJECT_NUMBER + "/" + JOB_ID + "/" + output_task_name + "_" + str(TASK_ID) + "/executor_output.json" ) GCP_RESOURCES = ( PIPELINE_ROOT + "/" + PROJECT_NUMBER + "/" + JOB_ID + "/" + output_task_name + "_" + str(TASK_ID) + "/gcp_resources" ) EVAL_METRICS = ( PIPELINE_ROOT + "/" + PROJECT_NUMBER + "/" + JOB_ID + "/" + output_task_name + "_" + str(TASK_ID) + "/evaluation_metrics" ) if tf.io.gfile.exists(EXECUTE_OUTPUT): ! gsutil cat $EXECUTE_OUTPUT return EXECUTE_OUTPUT elif tf.io.gfile.exists(GCP_RESOURCES): ! gsutil cat $GCP_RESOURCES return GCP_RESOURCES elif tf.io.gfile.exists(EVAL_METRICS): ! gsutil cat $EVAL_METRICS return EVAL_METRICS return None print("image-dataset-create") artifacts = print_pipeline_output(pipeline, "image-dataset-create") print("\n\n") print("automl-image-training-job") artifacts = print_pipeline_output(pipeline, "automl-image-training-job") print("\n\n") output = !gsutil cat $artifacts output = json.loads(output[0]) model_id = output["artifacts"]["model"]["artifacts"][0]["metadata"]["resourceName"] print("\n") print(model_id) print("endpoint-create") artifacts = print_pipeline_output(pipeline, "endpoint-create") print("\n\n") output = !gsutil cat $artifacts output = json.loads(output[0]) endpoint_id = output["artifacts"]["endpoint"]["artifacts"][0]["metadata"][ "resourceName" ] print("\n") print(endpoint_id) print("model-deploy") artifacts = print_pipeline_output(pipeline, "model-deploy") print("\n\n") print("evaluateautomlmodelop") artifacts = print_pipeline_output(pipeline, "evaluateautomlmodelop") print("\n\n") print("model-batch-predict") artifacts = print_pipeline_output(pipeline, "model-batch-predict") output = !gsutil cat $artifacts output = json.loads(output[0]) print("\n\n") print( output["artifacts"]["batchpredictionjob"]["artifacts"][0]["metadata"][ "gcsOutputDirectory" ] ) output = !gsutil cat $artifacts output = json.loads(output[0]) batch_job_id = output["artifacts"]["batchpredictionjob"]["artifacts"][0]["metadata"][ "resourceName" ] pipeline.delete() endpoint = aiplatform.Endpoint(endpoint_id) test_item = !gsutil cat $IMPORT_FILE | head -n1 if len(str(test_item[0]).split(",")) == 3: _, test_item, test_label = str(test_item[0]).split(",") else: test_item, test_label = str(test_item[0]).split(",") print(test_item, test_label) with tf.io.gfile.GFile(test_item, "rb") as f: content = f.read() # The format of each instance should conform to the deployed model's prediction input schema. instances = [{"content": base64.b64encode(content).decode("utf-8")}] prediction = endpoint.predict(instances=instances) print(prediction) endpoint.undeploy_all() endpoint.delete() model = aiplatform.Model(model_id) model.delete() batch_job = aiplatform.BatchPredictionJob(batch_job_id) batch_job.delete() delete_bucket = False if delete_bucket or os.getenv("IS_TESTING"): ! gsutil rm -r $BUCKET_URI <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Restart the kernel Step2: Set up your Google Cloud project Step3: Region Step4: Timestamp Step5: Authenticate your Google Cloud account Step6: Create a Cloud Storage bucket Step7: Only if your bucket doesn't already exist Step8: Finally, validate access to your Cloud Storage bucket by examining its contents Step9: Service Account Step10: Set service account access for Vertex AI Pipelines Step11: Import libraries Step12: Initialize Vertex AI SDK for Python Step13: Location of Cloud Storage training data. Step14: Create AutoML model evaluation component Step15: Construct AutoML training pipeline Step16: Get test item(s) Step17: Copy test item(s) Step18: Make the batch input file Step19: Compile and execute the pipeline Step20: View AutoML training pipeline results Step21: Delete a pipeline job Step22: Load an endpoint Step23: Send a online prediction request Step24: Make the prediction Step25: Cleaning up Step26: Delete the Cloud Storage bucket
5,245
<ASSISTANT_TASK:> Python Code: from projectq import MainEngine from projectq.backends import AWSBraketBackend from projectq.ops import Measure, H, C, X, All creds = { 'AWS_ACCESS_KEY_ID': 'aws_access_key_id', 'AWS_SECRET_KEY': 'aws_secret_key', } # replace with your Access key and Secret key s3_folder = ['S3Bucket', 'S3Directory'] # replace with your S3 bucket and directory device = 'SV1' # replace by the device you want to use eng = MainEngine(AWSBraketBackend(use_hardware=False, credentials=creds, s3_folder=s3_folder, num_runs=10, interval=10)) # Allocate the required qubits qureg = eng.allocate_qureg(3) # Create the circuit. In this example a quantum teleportation algorithms that teleports the first qubit to the third one. H | qureg[0] H | qureg[1] C(X) | (qureg[1], qureg[2]) C(X) | (qureg[0], qureg[1]) H | qureg[0] C(X) | (qureg[1], qureg[2]) # At the end we measure the qubits to get the results; should be all-0 or all-1 All(Measure) | qureg # And run the circuit eng.flush() # Obtain and print the probabilies of the states prob_dict = eng.backend.get_probabilities(qureg) print("Probabilites for each of the results: ", prob_dict) # Set the Task Arn of the job to be retrieved and instantiate the engine with the AWSBraketBackend task_arn = 'your_task_arn' # replace with the actual TaskArn you want to use eng1 = MainEngine(AWSBraketBackend(retrieve_execution=task_arn, credentials=creds, num_retries=2, verbose=True)) # Configure the qubits to get the states probabilies qureg1 = eng1.allocate_qureg(3) # Ask the backend to retrieve the results eng1.flush() # Obtain and print the probabilities of the states prob_dict1 = eng1.backend.get_probabilities(qureg1) print("Probabilities ", prob_dict1) import matplotlib.pyplot as plt %matplotlib inline from projectq.libs.hist import histogram histogram(eng1.backend, qureg1) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Prior to the instantiation of the backend we need to configure the credentials, the S3 storage folder and the device to be used (in the example the State Vector Simulator SV1) Step2: Next we instantiate the engine with the AWSBraketBackend including the credentials and S3 configuration. By setting the 'use_hardware' parameter to False we indicate the use of the Simulator. In addition we set the number of times we want to run the circuit and the interval in secons to ask for the results. For a complete list of parameters and descriptions, please check the documentation. Step3: We can now allocate the required qubits and create the circuit to be run. With the last instruction we ask the backend to run the circuit. Step4: The backend will automatically create the task and generate a unique identifier (the task Arn) that can be used to recover the status of the task and results later on. Step5: Retrieve results form a previous execution Step6: We can plot an histogram with the probabilities as well.
5,246
<ASSISTANT_TASK:> Python Code: PROJECT_ID = "YOUR PROJECT ID" BUCKET_NAME = "gs://YOUR BUCKET NAME" REGION = "YOUR REGION" SERVICE_ACCOUNT = "YOUR SERVICE ACCOUNT" ! gsutil ls -al $BUCKET_NAME content_name = "pt-img-cls-multi-node-ddp-cust-cont" ! ls trainer ! cat trainer/requirements.txt ! pip install -r trainer/requirements.txt ! cat trainer/task.py %run trainer/task.py --epochs 5 --no-cuda --local-mode ! ls ./tmp ! rm -rf ./tmp hostname = "gcr.io" image_name = content_name tag = "latest" custom_container_image_uri = f"{hostname}/{PROJECT_ID}/{image_name}:{tag}" ! cd trainer && docker build -t $custom_container_image_uri -f Dockerfile . ! docker run --rm $custom_container_image_uri --epochs 5 --no-cuda --local-mode ! docker push $custom_container_image_uri ! gcloud container images list --repository $hostname/$PROJECT_ID ! pip install -r requirements.txt from google.cloud import aiplatform aiplatform.init( project=PROJECT_ID, staging_bucket=BUCKET_NAME, location=REGION, ) content_name = content_name + "-cpu" tensorboard = aiplatform.Tensorboard.create( display_name=content_name, ) display_name = content_name gcs_output_uri_prefix = f"{BUCKET_NAME}/{display_name}" replica_count = 4 machine_type = "n1-standard-4" args = [ "--backend", "gloo", "--no-cuda", "--batch-size", "128", "--epochs", "25", ] custom_container_training_job = aiplatform.CustomContainerTrainingJob( display_name=display_name, container_uri=custom_container_image_uri, ) custom_container_training_job.run( args=args, base_output_dir=gcs_output_uri_prefix, replica_count=replica_count, machine_type=machine_type, tensorboard=tensorboard.resource_name, service_account=SERVICE_ACCOUNT, ) print(f"Custom Training Job Name: {custom_container_training_job.resource_name}") print(f"GCS Output URI Prefix: {gcs_output_uri_prefix}") ! gsutil ls $gcs_output_uri_prefix ! gsutil rm -rf $gcs_output_uri_prefix <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Local Training Step2: Vertex Training using Vertex SDK and Custom Container Step3: Initialize Vertex SDK Step4: Create a Vertex Tensorboard Instance Step5: Option Step6: Training Output Artifact Step7: Clean Up Artifact
5,247
<ASSISTANT_TASK:> Python Code: import numpy as np import scipy.io as sio import matplotlib.pyplot as plt import control !wget https://alfkjartan.github.io/files/sysid_hw_data.mat data = sio.loadmat("sysid_hw_data.mat") N = len(data["u1"]) plt.figure(figsize=(14,1.7)) plt.step(range(N),data["u1"]) plt.ylabel("u_1") plt.figure(figsize=(14,1.7)) plt.step(range(N),data["y1"]) plt.ylabel("y_1") data["u1"].size y = np.ravel(data["y1"]) u = np.ravel(data["u1"]) Phi = np.array([-y[1:N-1], u[1:N-1], u[:N-2]]).T yy = y[2:] theta_ls = np.linalg.lstsq(Phi, yy) theta_ls print("Estimated: a = %f" % theta_ls[0][0]) print("Estimated: b_0 = %f" % theta_ls[0][1]) print("Estimated: b_1 = %f" % theta_ls[0][2]) # Import the predict_lti function which will calculate the k-step ahead prediction. from lti_fcns import predict_lti yv = np.ravel(data["y1_val"]) uv = np.ravel(data["u1_val"]) k = 8 # The prediction horizon d = 1 # The input delay of the system a = np.array([1, theta_ls[0][0]]) b = np.ravel(theta_ls[0][1:]) (ypred, tpred) = predict_lti(b,a,yv, uv, k, d) N = len(uv) plt.figure(figsize=(14,3)) plt.step(range(N), yv) plt.plot(tpred, ypred, 'ro') # Calculate the Root Mean Square Error (RMSE) and fit (in %) err = yv[tpred[0]:] - ypred RMSE = np.sqrt(1.0/N * np.sum( np.square(yv[tpred[0]:] - ypred))) fit = 100 * (1 - np.linalg.norm(err)/np.linalg.norm(yv - np.mean(yv))) plt.title("RMSE = %f, fit = %f %%" % (RMSE, fit)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load the data Step2: Plot the data Step3: Identify first order model Step4: Validation
5,248
<ASSISTANT_TASK:> Python Code: def find_max(words): return sorted(words, key = lambda x: (-len(set(x)), x))[0] <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description:
5,249
<ASSISTANT_TASK:> Python Code: cd ~/Desktop/SSUsearch/ mkdir -p ./workdir #check seqfile files to process in data directory (make sure you still remember the data directory) !ls ./data/test/data Seqfile='./data/test/data/1c.fa' Cpu='1' # number of maxixum threads for search and alignment Hmm='./data/SSUsearch_db/Hmm.ssu.hmm' # hmm model for ssu Gene='ssu' Script_dir='./scripts' Gene_model_org='./data/SSUsearch_db/Gene_model_org.16s_ecoli_J01695.fasta' Ali_template='./data/SSUsearch_db/Ali_template.silva_ssu.fasta' Start='577' #pick regions for de novo clustering End='727' Len_cutoff='100' # min length for reads picked for the region Gene_tax='./data/SSUsearch_db/Gene_tax.silva_taxa_family.tax' # silva 108 ref Gene_db='./data/SSUsearch_db/Gene_db.silva_108_rep_set.fasta' Gene_tax_cc='./data/SSUsearch_db/Gene_tax_cc.greengene_97_otus.tax' # greengene 2012.10 ref for copy correction Gene_db_cc='./data/SSUsearch_db/Gene_db_cc.greengene_97_otus.fasta' # first part of file basename will the label of this sample import os Filename=os.path.basename(Seqfile) Tag=Filename.split('.')[0] import os New_path = '{}:{}'.format('~/Desktop/SSUsearch/external_tools/bin/', os.environ['PATH']) Hmm=os.path.abspath(Hmm) Seqfile=os.path.abspath(Seqfile) Script_dir=os.path.abspath(Script_dir) Gene_model_org=os.path.abspath(Gene_model_org) Ali_template=os.path.abspath(Ali_template) Gene_tax=os.path.abspath(Gene_tax) Gene_db=os.path.abspath(Gene_db) Gene_tax_cc=os.path.abspath(Gene_tax_cc) Gene_db_cc=os.path.abspath(Gene_db_cc) os.environ.update( {'PATH':New_path, 'Cpu':Cpu, 'Hmm':os.path.abspath(Hmm), 'Gene':Gene, 'Seqfile':os.path.abspath(Seqfile), 'Filename':Filename, 'Tag':Tag, 'Script_dir':os.path.abspath(Script_dir), 'Gene_model_org':os.path.abspath(Gene_model_org), 'Ali_template':os.path.abspath(Ali_template), 'Start':Start, 'End':End, 'Len_cutoff':Len_cutoff, 'Gene_tax':os.path.abspath(Gene_tax), 'Gene_db':os.path.abspath(Gene_db), 'Gene_tax_cc':os.path.abspath(Gene_tax_cc), 'Gene_db_cc':os.path.abspath(Gene_db_cc)}) !echo "*** make sure: parameters are right" !echo "Seqfile: $Seqfile\nCpu: $Cpu\nFilename: $Filename\nTag: $Tag" cd workdir mkdir -p $Tag.ssu.out ### start hmmsearch %%bash echo "*** hmmsearch starting" time hmmsearch --incE 10 --incdomE 10 --cpu $Cpu \ --domtblout $Tag.ssu.out/$Tag.qc.$Gene.hmmdomtblout \ -o /dev/null -A $Tag.ssu.out/$Tag.qc.$Gene.sto \ $Hmm $Seqfile echo "*** hmmsearch finished" !python $Script_dir/get-seq-from-hmmout.py \ $Tag.ssu.out/$Tag.qc.$Gene.hmmdomtblout \ $Tag.ssu.out/$Tag.qc.$Gene.sto \ $Tag.ssu.out/$Tag.qc.$Gene %%bash echo "*** Starting mothur align" cat $Gene_model_org $Tag.ssu.out/$Tag.qc.$Gene > $Tag.ssu.out/$Tag.qc.$Gene.RFadded # mothur does not allow tab between its flags, thus no indents here time mothur "#align.seqs(candidate=$Tag.ssu.out/$Tag.qc.$Gene.RFadded, template=$Ali_template, threshold=0.5, flip=t, processors=$Cpu)" rm -f mothur.*.logfile !python $Script_dir/mothur-align-report-parser-cutoff.py \ $Tag.ssu.out/$Tag.qc.$Gene.align.report \ $Tag.ssu.out/$Tag.qc.$Gene.align \ $Tag.ssu.out/$Tag.qc.$Gene.align.filter \ 0.5 !python $Script_dir/remove-gap.py $Tag.ssu.out/$Tag.qc.$Gene.align.filter $Tag.ssu.out/$Tag.qc.$Gene.align.filter.fa !python $Script_dir/region-cut.py $Tag.ssu.out/$Tag.qc.$Gene.align.filter $Start $End $Len_cutoff !mv $Tag.ssu.out/$Tag.qc.$Gene.align.filter."$Start"to"$End".cut.lenscreen $Tag.ssu.out/$Tag.forclust %%bash rm -f $Tag.ssu.out/$Tag.qc.$Gene.align.filter.silva_taxa_family*.taxonomy mothur "#classify.seqs(fasta=$Tag.ssu.out/$Tag.qc.$Gene.align.filter.fa, template=$Gene_db, taxonomy=$Gene_tax, cutoff=50, processors=$Cpu)" mv $Tag.ssu.out/$Tag.qc.$Gene.align.filter.silva_taxa_family*.taxonomy \ $Tag.ssu.out/$Tag.qc.$Gene.align.filter.wang.silva.taxonomy !python $Script_dir/count-taxon.py \ $Tag.ssu.out/$Tag.qc.$Gene.align.filter.wang.silva.taxonomy \ $Tag.ssu.out/$Tag.qc.$Gene.align.filter.wang.silva.taxonomy.count !rm -f mothur.*.logfile %%bash rm -f $Tag.ssu.out/$Tag.qc.$Gene.align.filter.greengene_97_otus*.taxonomy mothur "#classify.seqs(fasta=$Tag.ssu.out/$Tag.qc.$Gene.align.filter.fa, template=$Gene_db_cc, taxonomy=$Gene_tax_cc, cutoff=50, processors=$Cpu)" mv $Tag.ssu.out/$Tag.qc.$Gene.align.filter.greengene_97_otus*.taxonomy \ $Tag.ssu.out/$Tag.qc.$Gene.align.filter.wang.gg.taxonomy !python $Script_dir/count-taxon.py \ $Tag.ssu.out/$Tag.qc.$Gene.align.filter.wang.gg.taxonomy \ $Tag.ssu.out/$Tag.qc.$Gene.align.filter.wang.gg.taxonomy.count !rm -f mothur.*.logfile # check the output directory !ls $Tag.ssu.out !echo "*** pipeline runs successsfully :)" <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: README Step2: Other parameters to set Step3: Pass hits to mothur aligner Step4: Get aligned seqs that have > 50% matched to references Step5: Search is done here (the computational intensive part). Hooray! Step6: Classify SSU rRNA gene seqs using SILVA Step7: Classify SSU rRNA gene seqs with Greengene for copy correction later Step8: This part of pipeline (working with one sequence file) finishes here. Next we will combine samples for community analysis (see unsupervised analysis).
5,250
<ASSISTANT_TASK:> Python Code: # 定义一个tuple tuple1 = ('bosco','ricky','pinky') tuple1 # 一个项目的 tuple tuple2 = (5,) tuple2 # 一次赋多值 x,y,z = tuple1 print(x,y,z) # 用in判断 'bosco' in tuple1 # 索引 tuple1[0] # string tuple("money") list1 = [16,2,53,24,5,36,67,80] list1 # 索引 indexing list1[5] # 分片 slicing list1[:5] list1[3:] list1[-3:] list1[1:6] list1[-4:-1] list1[0:6:2] list1[6:0:-2] list1[::-3] # more functions len(list1) max(list1) min(list1) # 改变元素 list1[1]=30 list1 # 增加元素 list1.append(4) list1 list1.sort() list1 # 算数 list2 = ['alpha','beta','gamma','gamma','alpha','alpha'] list2.count('alpha') list2 = [2,56,8,2,9,9,47,2,2] list2.count(2) # 联合list list3 = [56,8,7,91] list3_add = [15,32,5] list3.extend(list3_add) list3 list4 = ['apple','banana','orange','peach'] list4.index('orange') # 找出该元素位置 list4.insert(2,'cherry') # 在2号位插入新元素 list4 list4.pop(1) # 删除1号位元素(并显示被删除的元素) list4 list4.remove('orange') # 删除该元素(不显示被删除元素) list4 list('hey') sorted('hey') sentence = "Take it away" sentence.find('it') # i:5 sen1 = ['hello','world','welcome','so','good'] sen2 = 'miao' sen2.join(sen1) # join函数(str):在sen1的每个元素之间插入sen2 sentence = "I toOK a Photo" sentence.lower() # 大写字母转小写 sentence.upper() # 小写转大写 sentence = "it was my bro" sentence.replace('bro','sis') # 替换字符string import numpy as np a = np.array([[18., 17., 16.], [14., 19., 18.]]) a a.ndim # rank of an array a.shape # dimension or shape of an array (result is a tuple) a.size # total number of items a.dtype # type of item (rq. array里面所有item都是同样的类型) np.arange(15) np.arange(3,9) np.arange(3,9,2) np.linspace(3,9,5) np.zeros(3) np.zeros((3,2)) np.ones(3) np.ones((3,2)) np.eye(3) np.diag([5,3,6]) family = {'Dad':'Dickson','Mom':'Sara','Bro':'Bosco'} family family['Dad'] dict1 = {'a':5,666:'yoooo',(12,'b'):('c','d')} dict1 home = family.copy() home 'Mom' in home 'Sis' in home 'Bosco' in home.values() family.clear() family user = {'name':'Bosco','age':40,'sex':'male'} user user['age'] = 32 # 修改一个value user user['city'] = 'New York' # 添加一个项目 user del user['sex'] # 删除一个项目 user list1 = [5,9,88,26,19] type(list1) tuple1 = [75,31,4,60] type(tuple1) array1 = np.array([62,8,99,6]) type(array1) dict1 = {'a':5,666:'yoooo',(12,'b'):('c','d')} type(dict1) l_to_t = tuple(list1) type(l_to_t) a_to_t = tuple(array1) type(a_to_t) # key to tuple d_to_t = tuple(dict1) d_to_t # value to tuple dv_to_t = tuple(dict1.values()) dv_to_t t_to_l = list(tuple1) type(t_to_l) a_to_l = list(array1) type(a_to_l) # key to list d_to_l = list(dict1) d_to_l # value to list dv_to_l = list(dict1.values()) dv_to_l l_to_a = np.array(list1) type(l_to_a) t_to_a = np.array(tuple1) type(t_to_a) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 2. list<a name="2list"></a> Step2: list2 Step3: list3 Step4: list4 Step5: string Step6: 3. array<a name="3array"></a> Step7: some functions about array Step8: some functions to creat special array with <font color='seagreen'>NumPy</font> Step9: <font color='seagreen'>np.linspace (</font> <font color='DarkSlateGray'>a,b,num=50</font> <font color='seagreen'>)</font><a name="linspace"></a> Step10: <font color='seagreen'>np.zeros(</font> <font color='DarkSlateGray'>shape</font> <font color='seagreen'>)</font><a name="zeros"></a> Step11: <font color='seagreen'>np.ones(</font> <font color='DarkSlateGray'>shape</font> <font color='seagreen'>)</font><a name="ones"></a> Step12: <font color='seagreen'>np.eye(</font> <font color='DarkSlateGray'>N</font> <font color='seagreen'>)</font><a name="eye"></a> Step13: <font color='seagreen'>np.diag(</font> <font color='DarkSlateGray'>v</font> <font color='seagreen'>)</font><a name="diag"></a> Step14: 4. dictionary<a name="4dictionary"></a> Step15: 键不可变,可以是数字、字符串、元组。 Step16: copy a dictionary Step17: check key in dictionary Step18: check values in dictionary Step19: clear a dictionary Step20: modify a dictionary Step21: 5. transform<a name="5transform"></a> Step22: list / array / dictionary 转 tuple Step23: tuple / array / dictionary 转 list Step24: list / tuple 转 array
5,251
<ASSISTANT_TASK:> Python Code: import copy import cPickle import os import subprocess import cdpybio as cpb import matplotlib.pyplot as plt import numpy as np import pandas as pd from scipy.linalg import svd import scipy.stats as stats import seaborn as sns import statsmodels.formula.api as smf import cardipspy as cpy import ciepy %matplotlib inline %load_ext rpy2.ipython outdir = os.path.join(ciepy.root, 'output', 'rna_seq_analysis') cpy.makedir(outdir) private_outdir = os.path.join(ciepy.root, 'private_output', 'rna_seq_analysis') cpy.makedir(private_outdir) sns.set_context('notebook') sns.set_style('whitegrid') fn = os.path.join(ciepy.root, 'output', 'input_data', 'wgs_metadata.tsv') wgs_meta = pd.read_table(fn, index_col=0, squeeze=True) fn = os.path.join(ciepy.root, 'output', 'input_data', 'rnaseq_metadata.tsv') rna_meta = pd.read_table(fn, index_col=0) fn = os.path.join(ciepy.root, 'output', 'input_data', 'subject_metadata.tsv') subject_meta = pd.read_table(fn, index_col=0) ext_meta = pd.read_table(os.path.join(ciepy.root, 'output', 'input_data', 'GSE73211.tsv'), index_col=0, low_memory=False) tpm = pd.read_table(os.path.join(ciepy.root, 'output', 'input_data', 'rsem_tpm.tsv'), index_col=0, low_memory=False) ext_tpm = pd.read_table(os.path.join(ciepy.root, 'output', 'input_data', 'GSE73211_tpm.tsv'), index_col=0, low_memory=False) gene_info = pd.read_table(cpy.gencode_gene_info, index_col=0) fn = os.path.join(ciepy.root, 'output', 'input_data', 'star_logs.tsv') star_logs = pd.read_table(fn, index_col=0) fn = os.path.join(ciepy.root, 'output', 'input_data', 'picard_metrics.tsv') picard = pd.read_table(fn, index_col=0) meta = rna_meta.merge(subject_meta, left_on='subject_id', right_index=True, how='inner') fig, axs = plt.subplots(2, 2) axs = axs.flatten() ax = axs[0] k = 'Number of input reads' star_logs[k].hist(ax=ax) ax.set_ylabel('Number of samples') ax.set_xlabel(k) ax = axs[1] k = 'Uniquely mapped reads number' star_logs[k].hist(ax=ax) ax.set_ylabel('Number of samples') ax.set_xlabel(k) ax = axs[2] k = 'Uniquely mapped reads %' star_logs[k].hist(ax=ax) ax.set_ylabel('Number of samples') ax.set_xlabel(k) ax = axs[3] k = 'Average mapped length' star_logs[k].hist(ax=ax) ax.set_ylabel('Number of samples') ax.set_xlabel(k) plt.tight_layout() n = star_logs['Number of input reads'].mean() print('Average of {:.2f} million read pairs per sample'.format(n / 10**6)) star_logs['Uniquely mapped reads %'].min() star_logs['Uniquely mapped reads %'].median() wgs_meta.cell.value_counts() picard[['MEDIAN_INSERT_SIZE', 'PERCENT_DUPLICATION', u'MEDIAN_5PRIME_TO_3PRIME_BIAS']].hist(); picard.PERCENT_DUPLICATION.median() picard[['MEDIAN_INSERT_SIZE', 'PERCENT_DUPLICATION', u'MEDIAN_5PRIME_TO_3PRIME_BIAS']].describe() s = (tpm == 0).sum(axis=1) print(s.value_counts().head(2)) s.hist(bins=100) plt.title('Number of samples with zero TPM for each gene') plt.ylabel('Number of genes') plt.xlabel('Number of samples'); s = (tpm[gene_info.ix[tpm.index, 'gene_type'] == 'protein_coding'] == 0).sum(axis=1) print(s.value_counts().head(2)) s.hist(bins=100) plt.title('Number of samples with zero TPM for each protein coding gene') plt.ylabel('Number of genes') plt.xlabel('Number of samples'); plur_markers = ['POU5F1', 'SOX2', 'NANOG', 'ZFP42', 'LIN28A'] diff_markers = ['T', 'EOMES', 'SOX17', 'FOXA2', 'GATA4', 'HAND1', 'CDX2', 'PAX6', 'SOX1', 'EN1'] def get_gene_id(x): return gene_info[gene_info.gene_name == x].index[0] plur_markers = pd.Series(plur_markers, index=[get_gene_id(x) for x in plur_markers]) diff_markers = pd.Series(diff_markers, index=[get_gene_id(x) for x in diff_markers]) url = 'http://www.nature.com/nbt/journal/v33/n11/extref/nbt.3387-S5.xlsx' scorecard = pd.read_excel(url) scorecard = scorecard.drop(scorecard.columns[2:], axis=1) scorecard = scorecard[scorecard.gene.apply(lambda x: x in gene_info.gene_name.values)] scorecard.index = [get_gene_id(x) for x in scorecard.gene] scorecard = scorecard[scorecard['class'].apply(lambda x: x in ['Mesoderm', 'Pluri'])] tpm_all = pd.concat([tpm, ext_tpm], axis=1) tdf = np.log10(tpm_all.ix[scorecard.index].T + 1) tdf = tdf - tdf.mean() tdf = tdf / tdf.std() cs = pd.Series(dict(zip(list(set(ext_meta.cell_type)), sns.color_palette('colorblind')[3:6]))) rc = ([sns.color_palette('colorblind')[2]] * tpm.shape[1]) + list(cs[ext_meta.cell_type]) cs = pd.Series(dict(zip(list(set(scorecard['class'])), sns.color_palette("Set2", 7)))) cc = cs[scorecard['class']] sns.clustermap(tdf, xticklabels=[], yticklabels=[], col_colors=cc, row_colors=rc);#, col_cluster=False); # Filter for robustly expressed genes and take log. tpm_f = tpm[(tpm == 0).sum(axis=1) == 0] log_tpm = np.log10(tpm_f + 1) # Mean center. log_tpm_c = (log_tpm.T - log_tpm.mean(axis=1)).T # Variance normalize. log_tpm_n = (log_tpm_c.T / log_tpm_c.std(axis=1)).T cov = log_tpm.std(axis=1) / log_tpm.mean(axis=1) cov.sort_values(ascending=False, inplace=True) cov.hist() plt.title('Coefficient of variation histogram') plt.xlabel('Coefficient of variation') plt.ylabel('Number of genes'); res = cpb.analysis.SVD(log_tpm, scale_variance=True) res.plot_variance_explained(xtick_start=10, xtick_spacing=20, cumulative=False) res.plot_variance_explained(num_pc=30) pc_anova = res.pc_anova(meta[['sex', 'ethnicity_group', 'sequence_id']]) pc_anova.pvalue fig, ax = res.plot_pc_scatter( 'PC1', 'PC2', color=meta.ix[res.v.index, 'sequence_id'], color_name='Flowcell') fig, ax = res.plot_pc_scatter( 'PC2', 'PC3', color=meta.ix[res.v.index, 'sequence_id'], color_name='Flowcell') fig, ax = res.plot_pc_scatter( 'PC3', 'PC4', color=meta.ix[res.v.index, 'sequence_id'], color_name='Flowcell') a = meta.dropna(subset=['family_id']).drop_duplicates(subset=['family_id']) b = meta[meta.family_id.isnull()] euro_no_fam = pd.concat([a, b]) # Filter for robustly expressed genes and take log. subset_tpm_f = tpm.ix[(tpm == 0).sum(axis=1) == 0, euro_no_fam.index] subset_log_tpm = np.log10(subset_tpm_f + 1) # Mean center. subset_log_tpm_c = (subset_log_tpm.T - subset_log_tpm.mean(axis=1)).T # Variance normalize. subset_log_tpm_n = (subset_log_tpm_c.T / subset_log_tpm_c.std(axis=1)).T subset_cov = subset_log_tpm.std(axis=1) / subset_log_tpm.mean(axis=1) subset_cov.sort_values(ascending=False, inplace=True) subset_cov.hist() plt.title('Coefficient of variation histogram') plt.xlabel('Coefficient of variation') plt.ylabel('Number of genes'); subset_svd = cpb.analysis.SVD(subset_log_tpm, scale_variance=True) subset_svd.plot_variance_explained(xtick_start=10, xtick_spacing=10, cumulative=False) subset_svd.plot_variance_explained(num_pc=30) fig, ax = subset_svd.plot_pc_scatter( 'PC1', 'PC2', color=meta.ix[subset_svd.v.index, 'sequence_id'], marker=meta.ix[subset_svd.v.index, 'sex'], color_name='Flowcell', marker_name='Sex') subset_svd_500 = cpb.analysis.SVD(subset_log_tpm_n.ix[subset_cov.head(500).index]) fig, ax = subset_svd_500.plot_pc_scatter( 'PC1', 'PC2', color=meta.ix[subset_svd.v.index, 'sequence_id'], marker=meta.ix[subset_svd.v.index, 'sex'], color_name='Flowcell', marker_name='Sex') t = subset_log_tpm_n.ix[subset_cov.head(500).index] ct = t.corr(method='spearman') cg = sns.clustermap( ct, xticklabels=False, yticklabels=False, row_colors=color_meta.ix[ct.index, ['sex']].T.values, col_colors=color_meta.ix[ct.index, ['sequence_id']].T.values) tdf = subset_log_tpm_n.ix[subset_cov.head(500).index] fn = os.path.join(outdir, 'subset_sparse_pca.tsv') p = os.path.join(outdir, 'subset_sparse_pca.pickle') if not os.path.exists(fn): from sklearn import decomposition sparse_pca = decomposition.SparsePCA(n_components=5, n_jobs=30) sparse_pca.fit(tdf.T) ind = ['PC{}'.format(x) for x in range(1, sparse_pca.components_.shape[0] + 1)] sparse_components = pd.DataFrame(sparse_pca.components_, columns=tdf.index, index=ind).T sparse_components.to_csv(fn, sep='\t') cPickle.dump(sparse_pca, open(p, 'wb')) else: sparse_componenets = pd.read_table(fn, index_col=0, header=0) sparse_pca = cPickle.load(open(p, 'rb')) #plt.scatter(subset_svd_500.u['PC1'], sparse_pca.components_[0], lw=0, alpha=0.8) ax = sns.jointplot(subset_svd_500.u['PC1'], sparse_pca.components_[0], stat_func=None, alpha=0.25) plt.xlabel('PCA loading') plt.ylabel('Sparse PCA loading') ax.set_axis_labels(xlabel='Distance in kb', ylabel='$-\log_{10}$ $p$-value') plt.tight_layout() #plt.title('PCA vs. sparse PCA first eigenvector'); sparse_pca.components_[0].max() ax = sns.jointplot(x=subset_svd_500.u['PC1'].values, y=sparse_pca.components_[0], stat_func=None, alpha=0.5) ax.set_axis_labels(xlabel='PCA eigenvector', ylabel='Sparse PCA eigenvector') plt.tight_layout() genes = [x.split('.')[0] for x in subset_cov.index] sig = np.array([False] * len(genes)) sig[0:500] = True subset_var_go_results = cpb.analysis.goseq_gene_enrichment(genes, sig) genes = [x.split('.')[0] for x in subset_cov.index] sig = pd.Series(np.array([False] * len(genes)), index=subset_cov.index) se = pd.Series(sparse_pca.components_[0], index=tdf.index) sig[se[se != 0].index] = True spc1_var_go_results = cpb.analysis.goseq_gene_enrichment(genes, sig.values) spc1_var_go_results.head() se = pd.Series(sparse_pca.components_[0], index=tdf.index) t = subset_log_tpm_n.ix[se[se != 0].index] cg = sns.clustermap( t, xticklabels=False, yticklabels=False, col_colors=color_meta.ix[ct.index, ['sex', 'sequence_id']].T.values) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: STAR Logs Step2: Picard Metrics Step3: Expression Distribution Step4: We can see overal that there are a fair number of genes that are not expressed Step5: Protein coding genes are highly enriched for being expressed in all samples. Step6: All samples Step7: Clustering Step8: The ANOVA and PC plots show that the different batches on the flowcells Step9: TODO
5,252
<ASSISTANT_TASK:> Python Code: import veneer v = veneer.Veneer(port=9876) input_sets = v.input_sets() input_sets input_sets.as_dataframe() things_to_record=[ {'NetworkElement':'Lower Gauge','RecordingVariable':'Downstream Flow Volume'}, {'NetworkElement':'Crop Fields'}, {'NetworkElement':'Recreational Lake','RecordingElement':'StorageVolume'} ] v.configure_recording(enable=things_to_record) all_results = {} for i in [0,1,2,3,4]: print(i) for i in range(10): print(i) import pandas as pd for input_set in input_sets: set_name = input_set['Name'] # Log what's happening veneer.log('Running ' + set_name) # Run the model with the current input set v.run_model(SelectedInputSet=set_name) # Retrieve the run index so we can pass it to v.retrieve_multiple_time_series run_index = v.retrieve_run() # Now, retrieve the results we want end_of_system_flow = v.retrieve_multiple_time_series(run_data=run_index,criteria={ 'NetworkElement':'Lower Gauge','RecordingVariable':'Downstream Flow Volume' }) crop_time_series = v.retrieve_multiple_time_series(run_data=run_index,criteria={ 'NetworkElement':'Crop Fields','RecordingVariable':'.*@Demand Model@.*' }) all_results[set_name] = pd.merge(end_of_system_flow,crop_time_series,left_index=True,right_index=True) all_results all_results['Default Input Set'][0:10] %pylab inline import matplotlib.pyplot as plt for input_set in all_results: all_results[input_set]['Lower Gauge:Downstream Flow Volume'].plot(label=input_set) plt.legend() delta = all_results['Default Input Set']-all_results['Unrestricted Take'] delta delta['Lower Gauge:Downstream Flow Volume'].plot() functions = v.functions() f_df = functions.as_dataframe() f_df print(f_df) v.update_function('$InflowScaling',0.5) print(v.functions().as_dataframe()) v.update_function('$InflowScaling',1.0) for fn in functions: v.update_function(fn['Name'],fn['Expression']) import numpy as np NUMBER_OF_SIMULATIONS=50 sampled_scaling_factors = np.random.exponential(size=NUMBER_OF_SIMULATIONS) sampled_scaling_factors plt.hist(sampled_scaling_factors) spill_results=[] # Store our time series criteria in a variable to use it in configuring recording and retrieving results ts_match_criteria = {'NetworkElement':'Recreational Lake','RecordingVariable':'Spill Volume'} v.configure_recording(enable=[ts_match_criteria]) for scaling_factor in sampled_scaling_factors: veneer.log('Running for $InflowScaling=%f'%scaling_factor) # We are running the multiple many times in this case - so lets drop any results we already have... v.drop_all_runs() # Set $InflowScaling to current scaling factor v.update_function('$InflowScaling',scaling_factor) v.run_model() # Retrieve the spill time series, as an annual sum, with the column named for the variable ('Spill Volume') run_results = v.retrieve_multiple_time_series(criteria=ts_match_criteria,timestep='annual',name_fn=veneer.name_for_variable) # Store the mean spill volume and the scaling factor we used spill_results.append({'ScalingFactor':scaling_factor,'SpillVolume':run_results['Spill Volume'].mean()}) # Convert the results to a Data Frame spill_results_df = pd.DataFrame(spill_results) spill_results_df spill_results_df['SpillVolumeGL'] = spill_results_df['SpillVolume'] * 1e-6 # Convert to GL spill_results_df['SpillVolumeGL'].hist() variables = v.variables() variables_df = variables.as_dataframe() variables_df variables_df[variables_df.VeneerSupported] v.variable_piecewise('$PatternPW') v.variable_time_series('$CrabTS')[::500] pattern = v.variable_piecewise('$PatternPW') pattern pattern['Result'] *= 2.0 # Multiply each value of Result column by 2 pattern v.update_variable_piecewise('$PatternPW',pattern) v.variable_piecewise('$PatternPW') crab_ts = v.variable_time_series('$CrabTS') crab_ts.plot() monthly_scaling=[0.6,0.75,1.0,1.0,1.1,1.20,1.20,1.1,1.0,0.8,0.6,0.5] len(monthly_scaling) scaling_df = pd.DataFrame(data={'Month':range(1,13),'Scale':monthly_scaling}).set_index('Month') scaling_df plt.plot(crab_ts.index.month) scaling_df.Scale[12] scaling_df.Scale[[2,5,7,12,12,1]] scaling_for_timesteps = scaling_df.Scale[crab_ts.index.month].values plot(scaling_for_timesteps) crab_ts['ValueScaled'] = crab_ts.Value * scaling_for_timesteps # Lets plot the first year to see the effect crab_ts[0:365].plot() # That's hard to see, so lets look at the difference: delta = crab_ts.Value-crab_ts.ValueScaled delta[0:365].plot() crab_ts.columns new_ts = crab_ts[['ValueScaled']] new_ts[0::500] v.update_variable_time_series('$CrabTS',new_ts) template='Nodes.Lake Release.Monthly Pattern=[%s]{ML/d}' monthly_values=[5,3,4,6,6,7,7,6,5,4,4,5] list_as_string= ' '.join([str(v) for v in monthly_values]) list_as_string command = template%(list_as_string) command input_sets = v.input_sets() input_sets.as_dataframe() the_input_set = input_sets[0] the_input_set['Configuration'] the_input_set['Configuration'].append(command) the_input_set['Configuration'] v.update_input_set(the_input_set['Name'],the_input_set) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Finding the input sets in the model Step2: Note Step3: We now want to iterate over the input sets, running the model each time, and retrieving some results for each run. Step4: A python for loop takes the form Step5: There are lots of ways to support loop writing, such as the range(n) function, which returns an iterable object that goes from 0 to n-1 Step6: We will loop over the input_sets list, where each item in the list is a Python dictionary. Those dictionaries contain the 'Name' key, which we need to pass to Source Step7: Now that that's run, lets look at the results Step8: but we can pick the results for a given input set. Step9: Note how the results from two calls to v.retrieve_multiple_time_series have been combined into the one DataFrame Step10: There's obviously no visible difference there... Step11: So there is a difference, albeit small c.f. the overall system flow. Step12: Note Step13: We can see that $InflowScaling is used by three functions - $CrabSaled, $FishScaled and $ShellScaled. These functions are used to scale the respective inflow timeseries by a single scaling factor. Step14: Before proceeding, lets reset $InflowScaling to its original value Step15: Alternatively, we could reset all the functions to the values we retrieved earlier. Step16: Batch run using functions Step17: Now we can construct our loop and gather the results. Step18: Notes Step19: Modifying time series and piecewise linear functions Step20: This summary doesn't tell you anything about the details of the values in the variable - although in some cases there is a URL pointing to the details (in the PiecewiseFunction column or the TimeSeries column). Step21: We can query for either the piecewise function or the time series Step22: We can update a piecewise linear variable by passing an appropriate dataframe (one with two columns, each with numbers) to v.update_variable_piecewise Step23: You can check that the change has taken effect by looking in the Functions Manager in Source, or retrieving the piecewise function again Step24: Updating time series variables works in much the same way - you need to pass a DataFrame with an appropriate structure. In this case, you need a date time index and a single column of values. Step25: Lets generate a synthetic time series based on the existing sequence. Step26: So, now we need to apply these monthly factors to every day in the time series. Step27: So, now we need to take that sequence of values and find the corresponding scaling factors. Step28: Now, see what happens when we provide a series of months (including duplicates) Step29: Extending this, and using the list of months for each timestep, we can find the scaling factor for each timestep Step30: Now, we can multiple the values in the time series by the scaling factors Step31: We now have an extra column in our DataFrame. Source is expecting one column for our time series Step32: Modifying input sets Step33: As you can see, the 0s (separated by spaces) have been replaced with a single %s. When used with the string substitution functionality, this tells Python to expect another string that should be inserted at this point. Step34: Now, we want to convert our list of numbers (monthly_values) to a string, separated by space. We can use the join method, available on all strings, to do what we want. Step35: We can now combine this list into the template to create an input set command Step36: We can now update an input set of choice by adding this command. Step37: We'll modify the first one in the list Step38: We can use .append to add a command to the 'Configuration' Step39: Now, we can update the input set within Source
5,253
<ASSISTANT_TASK:> Python Code: # Authors: Alexandre Gramfort <alexandre.gramfort@telecom-paristech.fr> # Denis Engemann <denis.engemann@gmail.com> # # License: BSD (3-clause) import matplotlib.pyplot as plt import mne from mne import io from mne.datasets import sample print(__doc__) data_path = sample.data_path() raw_fname = data_path + '/MEG/sample/sample_audvis_filt-0-40_raw.fif' event_fname = data_path + '/MEG/sample/sample_audvis_filt-0-40_raw-eve.fif' event_id, tmin, tmax = 1, -0.2, 0.5 # Setup for reading the raw data raw = io.Raw(raw_fname) events = mne.read_events(event_fname) # Set up pick list: EEG + MEG - bad channels (modify to your needs) raw.info['bads'] = ['MEG 2443', 'EEG 053'] picks = mne.pick_types(raw.info, meg='grad', eeg=False, stim=True, eog=True, exclude='bads') # Read epochs epochs = mne.Epochs(raw, events, event_id, tmin, tmax, proj=True, picks=picks, baseline=(None, 0), preload=True, reject=dict(grad=4000e-13, eog=150e-6)) layout = mne.find_layout(epochs.info, 'meg') # use full layout title = 'ERF images - MNE sample data' mne.viz.plot_topo_image_epochs(epochs, layout, sigma=0.5, vmin=-200, vmax=200, colorbar=True, title=title) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Set parameters Step2: Show event related fields images
5,254
<ASSISTANT_TASK:> Python Code: As I will attempt to describe in the next slides, Python is an amazing way to lead to a more fun learning and teaching experience. It can be a basic calculator, a fancy calculator and Math, Science, Geography.. Tools that will help us in that quest are: When you bring in SymPy to the picture, things really get awesome. You are suddenly writing computer programs which are capable of speaking algebra. You are no more limited to numbers. # Create graphs from algebraic expressions from sympy import Symbol, plot x = Symbol('x') p = plot(2*x**2 + 2*x + 2) # Solve equations from sympy import solve, Symbol x = Symbol('x') solve(2*x + 1) # Limits from sympy import Symbol, Limit, sin x = Symbol('x') Limit(sin(x)/x, x, 0).doit() # Derivative from sympy import Symbol, Derivative, sin, init_printing x = Symbol('x') init_printing() Derivative(sin(x)**(2*x+1), x).doit() # Indefinite integral from sympy import Symbol, Integral, sqrt, sin, init_printing x = Symbol('x') init_printing() Integral(sqrt(x)).doit() # Definite integral from sympy import Symbol, Integral, sqrt x = Symbol('x') Integral(sqrt(x), (x, 0, 2)).doit() ### TODO: digit recognition using Neural networks ### Scikitlearn, pandas, scipy, statsmodel <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: (Main) Tools Step2: Python - Making other subjects more lively
5,255
<ASSISTANT_TASK:> Python Code: import numpy as np import pandas as pd import pandas_datareader as pdr import matplotlib.pyplot as plt import seaborn as sns plt.rc("figure",figsize=(16,8)) plt.rc("font",size=15) plt.rc("lines",linewidth=3) sns.set_style("darkgrid") reader = pdr.fred.FredReader(["HOUST"], start="1980-01-01", end="2020-04-01") data = reader.read() housing = data.HOUST housing.index.freq = housing.index.inferred_freq ax = housing.plot() from statsmodels.tsa.forecasting.theta import ThetaModel tm = ThetaModel(housing) res = tm.fit() print(res.summary()) forecasts = {"housing": housing} for year in range(1995, 2020, 2): sub = housing[:str(year)] res = ThetaModel(sub).fit() fcast = res.forecast(24) forecasts[str(year)] = fcast forecasts = pd.DataFrame(forecasts) ax = forecasts["1995":].plot(legend=False) children = ax.get_children() children[0].set_linewidth(4) children[0].set_alpha(0.3) children[0].set_color("#000000") ax.set_title("Housing Starts") plt.tight_layout(pad=1.0) tm = ThetaModel(np.log(housing), method="additive") res = tm.fit(use_mle=True) print(res.summary()) res.forecast_components(12) reader = pdr.fred.FredReader(["NA000349Q"], start="1980-01-01", end="2020-04-01") pce = reader.read() pce.columns = ["PCE"] _ = pce.plot() mod = ThetaModel(np.log(pce)) res = mod.fit() print(res.summary()) forecasts = pd.DataFrame({"ln PCE":np.log(pce.PCE), "theta=1.2": res.forecast(12, theta=1.2), "theta=2": res.forecast(12), "theta=3": res.forecast(12, theta=3), "No damping": res.forecast(12, theta=np.inf) }) _ = forecasts.tail(36).plot() plt.title("Forecasts of ln PCE") plt.tight_layout(pad=1.0) ax = res.plot_predict(24, theta=2) ln_pce = np.log(pce.PCE) forecasts = {"ln PCE": ln_pce} for year in range(1995,2020,3): sub = ln_pce[:str(year)] res = ThetaModel(sub).fit() fcast = res.forecast(12) forecasts[str(year)] = fcast forecasts = pd.DataFrame(forecasts) ax = forecasts["1995":].plot(legend=False) children = ax.get_children() children[0].set_linewidth(4) children[0].set_alpha(0.3) children[0].set_color("#000000") ax.set_title("ln PCE") plt.tight_layout(pad=1.0) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Load some Data Step2: We fit specify the model without any options and fit it. The summary shows that the data was deseasonalized using the multiplicative method. The drift is modest and negative, and the smoothing parameter is fairly low. Step3: The model is first and foremost a forecasting method. Forecasts are produced using the forecast method from fitted model. Below we produce a hedgehog plot by forecasting 2-years ahead every 2 years. Step4: We could alternatively fir the log of the data. Here it makes more sense to force the deseasonalizing to use the additive method, if needed. We also fit the model parameters using MLE. This method fits the IMA Step5: The forecast only depends on the forecast trend component, Step6: Personal Consumption Expenditure Step7: Since this series is always positive, we model the $\ln$. Step8: Next we explore differenced in the forecast as $\theta$ changes. When $\theta$ is close to 1, the drift is nearly absent. As $\theta$ increases, the drift becomes more obvious. Step9: Finally, plot_predict can be used to visualize the predictions and prediction intervals which are constructed assuming the IMA is true. Step10: We conclude be producing a hedgehog plot using 2-year non-overlapping samples.
5,256
<ASSISTANT_TASK:> Python Code: restaurants = pd.read_csv("NYC_Restaurants.csv", dtype=unicode) for index, item in enumerate(restaurants.columns.values): print index, item #use .apply() method to combine the 4 columns to get the unique restaurant name restaurants["RESTAURANT"] = restaurants[["DBA", "BUILDING", "STREET", "ZIPCODE"]].\ apply(lambda x: "{} {} {} {}".format(x[0], x[1], x[2], x[3]), axis=1) #incase that the RESTAURANT names contain spaces or symbols, strip off them restaurants["RESTAURANT"] = restaurants["RESTAURANT"].map(lambda y: y.strip()) print restaurants["RESTAURANT"][:10] print "There are", len(restaurants.drop_duplicates(subset="RESTAURANT")["RESTAURANT"].value_counts()), "restaurants in the data." num_chain = sum(restaurants.drop_duplicates(subset="RESTAURANT")["DBA"].value_counts()>=2) print "There are", num_chain, "chain restaurants." chains = restaurants.drop_duplicates(subset="RESTAURANT")["DBA"].value_counts()[: num_chain].index.values def chain(restaurant): return (restaurant in chains) mask = restaurants["DBA"].map(chain) restaurants[mask].drop_duplicates(subset="RESTAURANT")["DBA"].value_counts()[:20].plot(kind="bar") print "The percentage of chain restaurants is", print "{:.2%}".format(sum(restaurants.drop_duplicates(subset="RESTAURANT")["DBA"].value_counts()>=2)/float(len(restaurants["RESTAURANT"].value_counts()))) def lower_case(X): return X.lower() mask_1 = restaurants["DBA"].map(chain) mask_2 = restaurants["BORO"].map(lower_case) != "missing" restaurants[-mask_1].drop_duplicates(subset="RESTAURANT")[mask_2]["BORO"].value_counts().sort_values(ascending=False).plot(kind="bar") series_tmp_1 = restaurants[mask_2].drop_duplicates(subset="RESTAURANT")["BORO"].value_counts() series_tmp_2 = restaurants[-mask_1][mask_2].drop_duplicates(subset="RESTAURANT")["BORO"].value_counts() series_tmp_ratio = series_tmp_2/series_tmp_1 series_tmp_ratio.sort_values(ascending=False).plot(kind="bar") print "The highest non-chain/total ratio is:", "{:0.2%} ({})".format(series_tmp_ratio.sort_values(ascending=False)[0],\ series_tmp_ratio.sort_values(ascending=False).index.values[0]) if series_tmp_ratio.sort_values(ascending=False).index.values[0] !=\ restaurants[-mask_1].drop_duplicates(subset="RESTAURANT")[mask_2]["BORO"].value_counts().sort_values(ascending=False).index.values[0]: print "It is not the same borough." else: print "It is the same borough." restaurants.drop_duplicates(subset="RESTAURANT")["CUISINE DESCRIPTION"].value_counts()\ .sort_values(ascending=False)[:20].plot(kind="bar") non_clean_restaurants = restaurants[-restaurants["VIOLATION CODE"].isnull()]["RESTAURANT"].value_counts().index.values def is_clean(restaurant, blacklist=non_clean_restaurants): return restaurant not in blacklist mask_clean = restaurants["RESTAURANT"].map(is_clean) restaurants[mask_clean]["CUISINE DESCRIPTION"].value_counts().sort_values(ascending=False)[:20].plot(kind="bar") top_cuisine_series = restaurants.drop_duplicates(subset=["RESTAURANT","CUISINE DESCRIPTION"])["CUISINE DESCRIPTION"].value_counts() def is_top_cuisine(cuisine): return top_cuisine_series[cuisine]>=20 mask_3 = restaurants["VIOLATION CODE"].isnull() mask_4 = restaurants["CUISINE DESCRIPTION"].map(is_top_cuisine) series_tmp_3 = restaurants[mask_4][mask_3]["CUISINE DESCRIPTION"].value_counts() series_tmp_4 = restaurants[mask_4]["CUISINE DESCRIPTION"].value_counts() (series_tmp_3/series_tmp_4).sort_values(ascending=False)[:10].plot(kind="bar") violation_boro_tab = pd.crosstab( index=restaurants["VIOLATION DESCRIPTION"], columns=restaurants[restaurants["BORO"]!="Missing"]["BORO"], dropna=True ) print "The most common violation in each borough is summarised below:" violation_boro_tab.idxmax() violation_frequency_series = restaurants["VIOLATION DESCRIPTION"].value_counts() violation_boro_norm_tab = violation_boro_tab.apply(lambda x: x.map(float)/violation_frequency_series, axis=0) print "After normalization, the most common violation in each borough is summarised below:" violation_boro_norm_tab.idxmax() restaurants["AREA"] = restaurants["PHONE"].map(lambda x: x[:3]) print "There are", print sum(restaurants.drop_duplicates(subset=["AREA", "ZIPCODE"])["AREA"].value_counts() == 1), print "area codes corresponding to only 1 zipcode" restaurants["STREET TYPE"] = restaurants["STREET"].map(lambda s: s.split()[-1]) restaurants["STREET BASE"] = restaurants["STREET"].map(lambda s: " ".join(s.split()[:-1])) restaurants["STREET BASE & ZIP"] = restaurants["STREET BASE"].map(lambda s: s+" ") + restaurants["ZIPCODE"] new_dataframe = pd.concat( [restaurants["STREET BASE"], restaurants["STREET TYPE"], restaurants["STREET BASE & ZIP"]], axis=1 ) new_dataframe = new_dataframe[new_dataframe["STREET BASE"].map(lambda s: len(s)>0)].drop_duplicates() merged_new_dataframe = pd.merge( new_dataframe, new_dataframe, left_on="STREET BASE & ZIP", right_on="STREET BASE & ZIP", suffixes=[" 1", " 2"] ) merged_new_dataframe = merged_new_dataframe[merged_new_dataframe["STREET TYPE 1"] != merged_new_dataframe["STREET TYPE 2"]] street_name = pd.crosstab( index=merged_new_dataframe["STREET TYPE 1"], columns=merged_new_dataframe["STREET TYPE 2"], dropna=True ) print "The most common alias for each of the following street type is listed" street_name.idxmax()[ ["AVE", "ST", "RD", "PL", "BOULEARD", "BOULEVARD"] ] <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Question 1 Step2: Question 2 Step3: Question 3 Step4: Question 4 Step5: Question 5 Step6: Question 6 Step7: Question 7 Step8: Question 8 Step9: Question 9 Step10: Question 10 Step11: Question 11 Step12: Question 12 Step13: Question 13 Step14: Question 14
5,257
<ASSISTANT_TASK:> Python Code: total = 0 # initialise total for yeargroup in range(6): prompt = "How many pupils are in year S"+str(yeargroup+1)+": " pupils = int(input(prompt)) total = total + pupils # add to total print("Total = ", total) vauxhall = 0 ford = 0 mazda = 0 for car in range(10): car_make = input("Enter make of car f, v or m: ") if car_make == "f": ford = ford + 1 # it's a ford! if car_make == "v": vauxhall = vauxhall + 1 # another vauxhall if car_make == "m": mazda += 1 # += 1 is a nice shorthand for adding 1 print("\nYou saw:") # \n forces a new line. print(str(ford)+" Fords,") print(str(vauxhall)+" Vauxhalls,") print(str(mazda)+" Mazdas.") input("Press Enter to Finish") # Edit this copy of the program to handle another make of car. vauxhall = 0 ford = 0 mazda = 0 for car in range(10): car_make = input("Enter make of car f, v or m: ") if car_make == "f": ford = ford + 1 # it's a ford! if car_make == "v": vauxhall = vauxhall + 1 # anothber vauxhall if car_make == "m": mazda += 1 # += 1 is a nice shorthand for adding 1 print("\nYou saw:") # \n forces a new line. print(str(ford)+" Fords,") print(str(vauxhall)+" Vauxhalls,") print(str(mazda)+" Mazdas.") input("Press Enter to Finish") <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: If you have done it right, you should see Step2: Run the program above, if you haven't already! It just runs for 10 cars.
5,258
<ASSISTANT_TASK:> Python Code: import sys sys.path.append(r"..") import daymetpy ornl_lat, ornl_long = 35.9313167, -84.3104124 df = daymetpy.daymet_timeseries(lon=ornl_long, lat=ornl_lat, start_year=2012, end_year=2013) df.head() import pandas as pd import seaborn as sns import matplotlib.pyplot as plt %matplotlib inline fig, (ax1, ax2) = plt.subplots(2, figsize=(18, 10), sharex=True) rolling3day = pd.rolling_mean(df, 15) ax1.fill_between(rolling3day.index, rolling3day.tmin, rolling3day.tmax, alpha=0.5, lw=0) ax1.plot(df.index, df[['tmax', 'tmin']].mean(axis=1), lw=2, alpha=0.5) ax1.set_title('Daymet temp at ORNL', fontsize=20) ax1.set_ylabel(u'Temp. (°C)', fontsize=20) monthlysum = df.resample("M", how='sum') ax2.bar(monthlysum.index, monthlysum.prcp, width=20,) ax2.set_title('Daymet precip at ORNL', fontsize=20) ax2.set_ylabel(u'Precip. (mm)', fontsize=20) fig.tight_layout() denver_loc = (-104.9903, 39.7392) miami_loc = (-80.2089, 25.7753) denver = daymetpy.daymet_timeseries(lon=denver_loc[0], lat=denver_loc[1], start_year=2012, end_year=2014) miami = daymetpy.daymet_timeseries(lon=miami_loc[0], lat=miami_loc[1], start_year=2012, end_year=2014) fig, ax1 = plt.subplots(1, figsize=(18, 10)) rolling3day = pd.rolling_mean(denver, 15) ax1.fill_between(rolling3day.index, rolling3day.tmin, rolling3day.tmax, alpha=0.4, lw=0, label='Denver', color=sns.xkcd_palette(['faded green'])[0]) ax1.set_title('Denver vs Miami temps (15 day mean)', fontsize=20) rolling3day = pd.rolling_mean(miami, 15) ax1.fill_between(rolling3day.index, rolling3day.tmin, rolling3day.tmax, alpha=0.4, lw=0, label='Miami', color=sns.xkcd_palette(['dusty purple'])[0]) ax1.set_ylabel(u'Temp. (°C)', fontsize=20) fig.tight_layout() plt.legend(fontsize=20) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Which gives us a nice data frame with weather data for the Oak Ridge National Lab Step2: Which we can visualize using matplotlib and seaborn Step3: And ask questions such as
5,259
<ASSISTANT_TASK:> Python Code: from datetime import datetime, timedelta from IPython.display import display from math import factorial from matplotlib import pyplot as plt import io import numpy as np import pandas as pd Σ = sum %matplotlib inline def timetable(a, b): return b + timedelta(minutes=int(a)) v_timetable = np.vectorize(timetable) def sampling_generator( size: int=20, initial_datetime: datetime=None ) -> np.array: if initial_datetime is None: initial_datetime = datetime.now() return v_timetable( np.random.randint(0, 60, size=size), datetime.now() ) def mean_diff_time(se_time: pd.Series) -> float: n = se_time.shape[0] l_diff = [0] * (n-1) for i in range(1, n): j = i-1 l_diff[j] = (se_time[i] - se_time[j]).seconds/60 return np.mean(l_diff) initial_datetime = datetime.now() df_chegada = pd.DataFrame({ 'entrada': sampling_generator( initial_datetime=initial_datetime ) }).sort_values(by='entrada').reset_index(drop=True) df_saida = pd.DataFrame({ 'saída': sampling_generator( initial_datetime=initial_datetime ) }).sort_values(by='saída').reset_index(drop=True) fig, ax = plt.subplots(1, 2) df_chegada.hist(ax=ax[0]) df_saida.hist(ax=ax[1]) plt.show() print('tables head') display(df_chegada.head()) display(df_saida.head()) initial_datetime.strftime('%d de %b de %Y - %l:%M%p') S = 3 print('S:', S) μ_chegada = mean_diff_time(df_chegada['entrada']) # fixando los valores para teste μ_chegada = 3.05263157895 print('μ_chegada:', μ_chegada, 'mins') λ = 60/μ_chegada print('λ:', λ) μ_atendimento = mean_diff_time(df_saida['saída']) # fixando valores para teste μ_atendimento = 2.84210526316 print('μ_atendimento:', μ_atendimento, 'mins') μ = 60/(μ_atendimento*S) print('μ:', μ, 'clientes/hora') ρ = (λ/(S*μ))*100 print('ρ:', ρ, '%') P_0 = ( Σ([(((λ/μ)**n)/(factorial(n))) for n in range(S)]) + (((λ/μ)**S)/(factorial(S) * (1-(λ/(S*μ))))) )**(-1) print('P_0:', P_0) P_ocupados = (((λ/μ)**S)/(factorial(S)*(1-(λ/(S*μ))))) * P_0 print('P_ocupados:', P_ocupados) L_q = ((((λ/μ)**S)*λ*μ*S)/(factorial(S)*((μ*S-λ)**2)))*P_0 print('L_q:', L_q, 'usuários na fila') L = L_q + (λ/μ) print('L:', L, 'usuários no sistema') W_q = L_q/λ print('W_q:', W_q, 'horas') W = L/λ print('W:', W, 'horas') p_dobro = ((λ*2)/(S*μ)) print('p_dobro:', p_dobro*100, '%') if p_dobro < 1: print('Ok: o sistema atinge a estabilidade') else: print('O sistema não atinge a estabilidade') # dados de teste providos pelo professor t_S = 3 t_λ = 19.655 # Clientes/hora t_μ = 7.037 # Clientes/hora t_ρ = 0.93 # % t_P_0 = 0.016570 # 1,657 % - Probabilidade 0 clientes # Prob S clientes no sistema 0.060176 -> 6,018 % t_P_ocupados = 0.87251 # 87,251 % t_L_q = 11.78 # clientes t_L = 14.57 # clientes - Número médio clientes no sistema t_W_q = 0.599 # horas - Tempo médio de espera na fila t_W = 0.741 # horas - Tempo médio de espera sistema np.testing.assert_approx_equal(S, t_S) np.testing.assert_approx_equal(λ, t_λ, 3) np.testing.assert_approx_equal(μ, t_μ, 3) np.testing.assert_approx_equal(ρ, t_ρ*100, 1) np.testing.assert_approx_equal(P_0, t_P_0, 3) np.testing.assert_approx_equal(P_ocupados, t_P_ocupados, 3) np.testing.assert_approx_equal(L_q, t_L_q, 3) np.testing.assert_approx_equal(L, t_L, 3) np.testing.assert_approx_equal(W_q, W_q, 3) np.testing.assert_approx_equal(W, t_W, 3) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step4: Dados Step5: a) Descrição do sistema de filas, local, data e horários da coleta de dados Step6: b) Número de servidores atendendo = S Step7: c) O tempo médio entre as chegadas à fila ( um cliente a cada 5 min, por ex.) Step8: d) A taxa de chegada de usuários no sistema de filas – λ ( clientes por unidade de tempo) Step9: e) O tempo médio de atendimento de cada cliente ( 20 min, por ex.) Step10: f) A taxa de atendimento dos usuários – μ ( clientes por unidade de tempo, por servidor Step11: g) A ocupação do sistema(em porcentagem); Step12: h) A probabilidade de o sistema estar vazio Step13: i) A probabilidade de todos os servidores estarem ocupados Step14: k) O número esperado de usuários na fila Step15: j) O número esperado de usuários no sistema Step16: l) O tempo médio dos usuários na fila Step17: m) O tempo provável dos usuários no sistema Step18: n) Se a taxa de chamadas duplicasse, o que aconteceria com o sistema? E quais as providências que deveriam ser tomadas. Step19: Antes de pensar em aumentar a quantidade de servidores, deve ser feito um estudo para identificar se é possível otimizar o tempo de atendimento que pode estar sendo prejudicado por algum procedimento ineficiente ou por lentidão dos rescursos computacionais ou de falta de habilidade do servidor. Depois de haver otimização dos recursos, caso não for suficiente, deverá ser avaliada a opção de aumentar o número de servidores nos horários críticos ou apresentar uma proposta para facilitar o atendimento, como pré-atendimento online ou alguma facilidade extra em horários de pouco fluxo de entrada de clientes
5,260
<ASSISTANT_TASK:> Python Code: import random from pomegranate import * random.seed(0) state1 = State( UniformDistribution(0.0, 1.0), name="uniform" ) state2 = State( NormalDistribution(0, 2), name="normal" ) model = HiddenMarkovModel( name="ExampleModel" ) model.add_state( state1 ) model.add_state( state2 ) model.add_transition( model.start, state1, 0.5 ) model.add_transition( model.start, state2, 0.5 ) model.add_transition( state1, state1, 0.4 ) model.add_transition( state1, state2, 0.4 ) model.add_transition( state2, state2, 0.4 ) model.add_transition( state2, state1, 0.4 ) model.add_transition( state1, model.end, 0.2 ) model.add_transition( state2, model.end, 0.2 ) model.bake() sequence = model.sample() print(sequence) print(model.forward( sequence )[ len(sequence), model.end_index ]) print(model.backward( sequence )[0,model.start_index]) trans, ems = model.forward_backward( sequence ) print(trans) print(ems) model.fit( [ sequence ] ) print("Forward") print(model.forward( sequence )[ len(sequence), model.end_index ]) print() print("Backward") print(model.backward( sequence )[ 0,model.start_index ]) print() trans, ems = model.forward_backward( sequence ) print(trans) print(ems) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: First we will create the states of the model, one uniform and one normal. Step2: We will then create the model by creating a HiddenMarkovModel instance. Then we will add the states. Step3: Now we'll add the start states to the model. Step4: And the transition matrix. Step5: Finally the ending states to the model. Step6: To finalize the model, we "bake" it. Step7: New we'll create a sample sequence using our model. Step8: Now we'll feed the sequence through a forward algorithm with our model. Step9: Next we'll do the same, except with a backwards algorithm. Step10: Then we'll feed the sequence again, through a forward-backward algorithm. Step11: Finally we'll train our model with our example sequence. Step12: Then repeat the algorithms we fed the sequence through before on our improved model.
5,261
<ASSISTANT_TASK:> Python Code: !cd data/ && pdftohtml -c -hidden -xml ALA1934_RR-excerpt.pdf ALA1934_RR-excerpt.pdf.xml !ls -1 data/ !head -n 30 data/ALA1934_RR-excerpt.pdf.xml !python3 -m http.server 8080 --bind 127.0.0.1 DATAPATH = 'data/' OUTPUTPATH = 'generated_output/' INPUT_XML = 'ALA1934_RR-excerpt.pdf.xml' import os from pdftabextract.common import read_xml, parse_pages # Load the XML that was generated with pdftohtml xmltree, xmlroot = read_xml(os.path.join(DATAPATH, INPUT_XML)) # parse it and generate a dict of pages pages = parse_pages(xmlroot) pages[3].keys() from pprint import pprint p_num = 3 p = pages[p_num] print('number', p['number']) print('width', p['width']) print('height', p['height']) print('image', p['image']) print('the first three text boxes:') pprint(p['texts'][:3]) import numpy as np from pdftabextract import imgproc # get the image file of the scanned page imgfilebasename = p['image'][:p['image'].rindex('.')] imgfile = os.path.join(DATAPATH, p['image']) print("page %d: detecting lines in image file '%s'..." % (p_num, imgfile)) # create an image processing object with the scanned page iproc_obj = imgproc.ImageProc(imgfile) # calculate the scaling of the image file in relation to the text boxes coordinate system dimensions page_scaling_x = iproc_obj.img_w / p['width'] # scaling in X-direction page_scaling_y = iproc_obj.img_h / p['height'] # scaling in Y-direction # detect the lines lines_hough = iproc_obj.detect_lines(canny_kernel_size=3, canny_low_thresh=50, canny_high_thresh=150, hough_rho_res=1, hough_theta_res=np.pi/500, hough_votes_thresh=round(0.2 * iproc_obj.img_w)) print("> found %d lines" % len(lines_hough)) import cv2 # helper function to save an image def save_image_w_lines(iproc_obj, imgfilebasename): img_lines = iproc_obj.draw_lines(orig_img_as_background=True) img_lines_file = os.path.join(OUTPUTPATH, '%s-lines-orig.png' % imgfilebasename) print("> saving image with detected lines to '%s'" % img_lines_file) cv2.imwrite(img_lines_file, img_lines) save_image_w_lines(iproc_obj, imgfilebasename) from math import radians, degrees from pdftabextract.common import ROTATION, SKEW_X, SKEW_Y from pdftabextract.geom import pt from pdftabextract.textboxes import rotate_textboxes, deskew_textboxes # find rotation or skew # the parameters are: # 1. the minimum threshold in radians for a rotation to be counted as such # 2. the maximum threshold for the difference between horizontal and vertical line rotation (to detect skew) # 3. an optional threshold to filter out "stray" lines whose angle is too far apart from the median angle of # all other lines that go in the same direction (no effect here) rot_or_skew_type, rot_or_skew_radians = iproc_obj.find_rotation_or_skew(radians(0.5), # uses "lines_hough" radians(1), omit_on_rot_thresh=radians(0.5)) # rotate back or deskew text boxes needs_fix = True if rot_or_skew_type == ROTATION: print("> rotating back by %f°" % -degrees(rot_or_skew_radians)) rotate_textboxes(p, -rot_or_skew_radians, pt(0, 0)) elif rot_or_skew_type in (SKEW_X, SKEW_Y): print("> deskewing in direction '%s' by %f°" % (rot_or_skew_type, -degrees(rot_or_skew_radians))) deskew_textboxes(p, -rot_or_skew_radians, rot_or_skew_type, pt(0, 0)) else: needs_fix = False print("> no page rotation / skew found") if needs_fix: # rotate back or deskew detected lines lines_hough = iproc_obj.apply_found_rotation_or_skew(rot_or_skew_type, -rot_or_skew_radians) save_image_w_lines(iproc_obj, imgfilebasename + '-repaired') # save repaired XML (i.e. XML with deskewed textbox positions) output_files_basename = INPUT_XML[:INPUT_XML.rindex('.')] repaired_xmlfile = os.path.join(OUTPUTPATH, output_files_basename + '.repaired.xml') print("saving repaired XML file to '%s'..." % repaired_xmlfile) xmltree.write(repaired_xmlfile) from pdftabextract.clustering import find_clusters_1d_break_dist MIN_COL_WIDTH = 60 # minimum width of a column in pixels, measured in the scanned pages # cluster the detected *vertical* lines using find_clusters_1d_break_dist as simple clustering function # (break on distance MIN_COL_WIDTH/2) # additionally, remove all cluster sections that are considered empty # a cluster is considered empty when the number of text boxes in it is below 10% of the median number of text boxes # per cluster section vertical_clusters = iproc_obj.find_clusters(imgproc.DIRECTION_VERTICAL, find_clusters_1d_break_dist, remove_empty_cluster_sections_use_texts=p['texts'], # use this page's textboxes remove_empty_cluster_sections_n_texts_ratio=0.1, # 10% rule remove_empty_cluster_sections_scaling=page_scaling_x, # the positions are in "scanned image space" -> we scale them to "text box space" dist_thresh=MIN_COL_WIDTH/2) print("> found %d clusters" % len(vertical_clusters)) # draw the clusters img_w_clusters = iproc_obj.draw_line_clusters(imgproc.DIRECTION_VERTICAL, vertical_clusters) save_img_file = os.path.join(OUTPUTPATH, '%s-vertical-clusters.png' % imgfilebasename) print("> saving image with detected vertical clusters to '%s'" % save_img_file) cv2.imwrite(save_img_file, img_w_clusters) from pdftabextract.clustering import calc_cluster_centers_1d page_colpos = np.array(calc_cluster_centers_1d(vertical_clusters)) / page_scaling_x print('found %d column borders:' % len(page_colpos)) print(page_colpos) # right border of the second column col2_rightborder = page_colpos[2] # calculate median text box height median_text_height = np.median([t['height'] for t in p['texts']]) # get all texts in the first two columns with a "usual" textbox height # we will only use these text boxes in order to determine the line positions because they are more "stable" # otherwise, especially the right side of the column header can lead to problems detecting the first table row text_height_deviation_thresh = median_text_height / 2 texts_cols_1_2 = [t for t in p['texts'] if t['right'] <= col2_rightborder and abs(t['height'] - median_text_height) <= text_height_deviation_thresh] from pdftabextract.clustering import zip_clusters_and_values from pdftabextract.textboxes import border_positions_from_texts, split_texts_by_positions, join_texts from pdftabextract.common import all_a_in_b, DIRECTION_VERTICAL # get all textboxes' top and bottom border positions borders_y = border_positions_from_texts(texts_cols_1_2, DIRECTION_VERTICAL) # break into clusters using half of the median text height as break distance clusters_y = find_clusters_1d_break_dist(borders_y, dist_thresh=median_text_height/2) clusters_w_vals = zip_clusters_and_values(clusters_y, borders_y) # for each cluster, calculate the median as center pos_y = calc_cluster_centers_1d(clusters_w_vals) pos_y.append(p['height']) print('number of line positions:', len(pos_y)) import re # a (possibly malformed) population number + space + start of city name pttrn_table_row_beginning = re.compile(r'^[\d Oo][\d Oo]{2,} +[A-ZÄÖÜ]') # 1. try to find the top row of the table texts_cols_1_2_per_line = split_texts_by_positions(texts_cols_1_2, pos_y, DIRECTION_VERTICAL, alignment='middle', enrich_with_positions=True) # go through the texts line per line for line_texts, (line_top, line_bottom) in texts_cols_1_2_per_line: line_str = join_texts(line_texts) if pttrn_table_row_beginning.match(line_str): # check if the line content matches the given pattern top_y = line_top break else: top_y = 0 top_y # hints for a footer text box words_in_footer = ('anzeige', 'annahme', 'ala') # 2. try to find the bottom row of the table min_footer_text_height = median_text_height * 1.5 min_footer_y_pos = p['height'] * 0.7 # get all texts in the lower 30% of the page that have are at least 50% bigger than the median textbox height bottom_texts = [t for t in p['texts'] if t['top'] >= min_footer_y_pos and t['height'] >= min_footer_text_height] bottom_texts_per_line = split_texts_by_positions(bottom_texts, pos_y + [p['height']], # always down to the end of the page DIRECTION_VERTICAL, alignment='middle', enrich_with_positions=True) # go through the texts at the bottom line per line page_span = page_colpos[-1] - page_colpos[0] min_footer_text_width = page_span * 0.8 for line_texts, (line_top, line_bottom) in bottom_texts_per_line: line_str = join_texts(line_texts) has_wide_footer_text = any(t['width'] >= min_footer_text_width for t in line_texts) # check if there's at least one wide text or if all of the required words for a footer match if has_wide_footer_text or all_a_in_b(words_in_footer, line_str): bottom_y = line_top break else: bottom_y = p['height'] bottom_y # finally filter the line positions so that only the lines between the table top and bottom are left page_rowpos = [y for y in pos_y if top_y <= y <= bottom_y] print("> page %d: %d lines between [%f, %f]" % (p_num, len(page_rowpos), top_y, bottom_y)) from pdftabextract.extract import make_grid_from_positions grid = make_grid_from_positions(page_colpos, page_rowpos) n_rows = len(grid) n_cols = len(grid[0]) print("> page %d: grid with %d rows, %d columns" % (p_num, n_rows, n_cols)) # the page grid is a 2D matrix that contains the rectangular table cells # this is the top left table cell: grid[0][0] from pdftabextract.common import save_page_grids page_grids_file = os.path.join(OUTPUTPATH, output_files_basename + '.pagegrids_p3_only.json') print("saving page grids JSON file to '%s'" % page_grids_file) save_page_grids({p_num: grid}, page_grids_file) from pdftabextract.extract import fit_texts_into_grid, datatable_to_dataframe datatable = fit_texts_into_grid(p['texts'], grid) df = datatable_to_dataframe(datatable) df.head(n=10) csv_output_file = os.path.join(OUTPUTPATH, output_files_basename + '-p3_only.csv') print("saving extracted data to '%s'" % csv_output_file) df.to_csv(csv_output_file, index=False) excel_output_file = os.path.join(OUTPUTPATH, output_files_basename + '-p3_only.xlsx') print("saving extracted data to '%s'" % excel_output_file) df.to_excel(excel_output_file, index=False) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We generated an XML which consists of several &lt;page&gt; elements, containing an &lt;image&gt; (the "background" image, i.e. the scanned page) and several text boxes (&lt;text&gt;) with coordinates and the respective text box value. The images themselves have also been extracted from the PDF. Step2: When you execute the above line you can start up pdf2xml-viewer by visiting http Step3: Now we can load the the XML, parse it and have a look at the third page (the page from which we later want to extract the data). Step4: Each page consists of an xmlnode which points to the original XML page element, a page number, the page dimensions, an image (the scanned page) and the text boxes Step5: The text boxes in p['texts'] contain the coordinates and dimensions of each text box as well as the content (value) and a reference to the original XML node. Step6: The important thing is that we created an ImageProc instance using the scanned page image file that is referred to in the image key of the page p. ImageProc will identify the dimensions of the image file which allows us to calculate the scaling between the image dimensions and the text boxes' coordinate system. It is important to understand that the coordinate system in image space has a different scaling than the coordinate system used to position the text boxes. For example, the image could be scanned with a size of 1000x3000 pixels (iproc_obj.img_w by iproc_obj.img_h) while the text boxes of a page are positioned on a canvas of size 500x1500 units (p['width'] by p['height']). Step7: This is our image with the detected lines Step8: We can see that a skew in direction sy (meaning vertical direction) is detected. To fix this, deskew_textboxes is called with our page p as first parameter, then the negated skew (negated in order to "skew back"), the skew type (direction) and the origin point about which the deskewing is done (top left corner). Step9: As we can see, only the horizontal lines are straightened. Please note that the deskewing is not applied to the original image because this is not necessary for our further processing and hence the repaired lines are now a bit off from the table borders in the original image. Step10: 5. Detect clusters of vertical lines for identifying the columns of a table Step11: Here we see the detected clusters marked with different colors Step12: 6. Find out the row positions of the table by analyzing the y-coordinates' distribution of text boxes Step13: Next we get the text boxes' top and bottom border positions, cluster them, and calculate the cluster centers. Step14: Now try to find the first table row by checking when we find the first text box that contains a string which matches a typical row pattern. Step15: We find the last table row by checking if we find a "big" text box in the lower page area that matches certain words. Step16: 7. Create a grid of columns and lines Step17: We should now evaluate our page grid using pdf2xml-viewer. At first, we will need to load the XML of the repaired (deskewed) pages and then the JSON file containing the page grid information for page 3. When we select page 3 we should see an output like this Step18: Of course you would now usually do a lot of parsing, data clean up and validation because with this kind of messy data it will never be 100% perfect. Still this is a good basis to work on. We can export the data now as CSV and Excel
5,262
<ASSISTANT_TASK:> Python Code: #Final iteration tried across different cuts. Accuracy >55% keywords = [ 'nice', 'pleased', 'better', 'like', 'easy', 'excellent', 'love','impressed', 'satisfied','pretty', 'best','works great'] for key in keywords: # Note that we add spaces around the key so that we're getting the word, # not just pattern matching. amazon[str(key)] = amazon.Sentence.str.contains( ' '+str(key)+' ', case=False ) #Use the whole dataset amazon['allcaps'] = amazon.Sentence.str.isupper() amazon['Sentiment'] = (amazon['Sentiment'] == 1) plt.figure(figsize=(20, 7)) sns.heatmap(amazon.corr()) # Define data & target for the model data = amazon[keywords + ['allcaps']] target = amazon['Sentiment'] # Initantiate our model and store it in a new variable. bnb = BernoulliNB() # Fit our model to the data. bnb.fit(data, target) # Classify, storing the result in a new variable. y_pred = bnb.predict(data) # Display our results. print("Number of mislabeled points (w/o training) out of a total {} points : {}".format( data.shape[0], (target != y_pred).sum() )) #Calculate Confusion Martrix print(confusion_matrix(target, y_pred)) # from confusion matrix calculate accuracy cm = confusion_matrix(target, y_pred) #Accuracy total=sum(sum(cm)) accuracy=(cm[0,0]+cm[1,1])/total print ('Accuracy : ', accuracy) #Specifity Specifity = cm[0,0]/(cm[0,0]+cm[0,1]) print('Specifity : ', Specifity ) #Sensitivity Sensitivity = cm[1,1]/(cm[1,0]+cm[1,1]) print('Sensitivity : ', Sensitivity) #Prepare data for PCA X_std = StandardScaler().fit_transform(data) mean_vec = np.mean(X_std, axis=0) cov_mat = (X_std - mean_vec).T.dot((X_std - mean_vec)) / (X_std.shape[0]-1) #Eigenvectores & Eigenvalues cov_mat = np.cov(X_std.T) eig_vals, eig_vecs = np.linalg.eig(cov_mat) # Inspecting the eigenvalues and eigenvectors. for i in range(len(eig_vals)): eigvecs = eig_vecs[:, i].reshape(1, len(keywords)+1).T print('Eigenvector {}: \n{}'.format(i + 1, eigvecs)) print('Eigenvalue {}: {}'.format(i + 1, eig_vals[i])) print(40 * '-') sklearn_pca = PCA(n_components=len(keywords)) Y_sklearn = sklearn_pca.fit_transform(X_std) print( 'The percentage of total variance in the dataset explained by each', 'component from Sklearn PCA.\n', sklearn_pca.explained_variance_ratio_ ) # create the RFE model and select attributes rfe = RFE(bnb, len(keywords)) fit = rfe.fit(data,target) # summarize the selection of the attributes result_RFE = pd.DataFrame(list(zip(data.head(0), rfe.ranking_, rfe.support_)),columns=['Features','Ranking','Support'] ) result_RFE.sort_values('Ranking') #Result as a list for "keywords" result= result_RFE[result_RFE.Support] my_list = result["Features"].tolist() my_list for key in keywords: # Note that we add spaces around the key so that we're getting the word, # not just pattern matching. train[str(key)] = train.Sentence.str.contains( ' '+str(key)+' ', case=False ) #Using the train subset train['allcaps'] = train.Sentence.str.isupper() train['Sentiment'] = (train['Sentiment'] == 1) #Plot correlation matrix plt.figure(figsize=(20, 7)) sns.heatmap(train.corr()) # Define training data & target for the model data1 = train[keywords + ['allcaps']] target1 = train['Sentiment'] # Initantiate our model and store it in a new variable. bnb2 = BernoulliNB() # Fit our model to the data. bnb2.fit(data1, target1) # Classify, storing the result in a new variable. y_pred1 = bnb2.predict(data1) # Display our results. print("Number of mislabeled points in TRAIN out of a total {} points : {}".format( data1.shape[0], (target1 != y_pred1).sum() )) confusion_matrix(target1, y_pred1) # Display our results. print("Number of mislabeled points in TRAIN out of a total {} points : {}".format( data1.shape[0], (target1 != y_pred1).sum() )) confusion_matrix(target1, y_pred1) # from confusion matrix calculate accuracy cm1 = confusion_matrix(target1, y_pred1) total1=sum(sum(cm1)) accuracy1=(cm1[0,0]+cm1[1,1])/total1 print ('Accuracy : ', accuracy1) Specifity1 = cm1[0,0]/(cm1[0,0]+cm1[0,1]) print('Specifity : ', Specifity1 ) Sensitivity1 = cm1[1,1]/(cm1[1,0]+cm1[1,1]) print('Sensitivity : ', Sensitivity1) for key in keywords: # Note that we add spaces around the key so that we're getting the word, # not just pattern matching. test[str(key)] = test.Sentence.str.contains( ' '+str(key)+' ', case=False ) test['allcaps'] = test.Sentence.str.isupper() test['Sentiment'] = (test['Sentiment'] == 1) #Define the data & target with test subset data2 = test[keywords +['allcaps']] target2 = test['Sentiment'] # Initantiate our model and store it in a new variable. bnb2 = BernoulliNB() # Fit our model to the data. bnb2.fit(data2, target2) # Classify, storing the result in a new variable. y_pred2 = bnb2.predict(data2) # Display our results. print("Number of mislabeled points in TEST out of a total {} points : {}".format( data2.shape[0], (target2 != y_pred2).sum() )) confusion_matrix(target2, y_pred2) # from confusion matrix calculate accuracy cm2 = confusion_matrix(target2, y_pred2) total2=sum(sum(cm2)) accuracy2=(cm2[0,0]+cm2[1,1])/total2 print ('Accuracy : ', accuracy2) Specifity2 = cm2[0,0]/(cm2[0,0]+cm2[0,1]) print('Specifity : ', Specifity2 ) Sensitivity2 = cm2[1,1]/(cm2[1,0]+cm2[1,1]) print('Sensitivity : ', Sensitivity2) #Test through cross validation the result of the best model using the the hould out subsets keywords2 = keywords for key in keywords2: # Note that we add spaces around the key so that we're getting the word, # not just pattern matching. train[str(key)] = train.Sentence.str.contains( ' '+str(key)+' ', case=False ) #Define data andtarget for cross validation amazon['allcaps'] = amazon.Sentence.str.isupper() amazon['Sentiment'] = (amazon['Sentiment'] == 1) datacv = amazon[keywords2] targetcv = amazon['Sentiment'] # Initantiate our model and store it in a new variable. bnbcv = BernoulliNB() # Fit our model to the data. bnbcv.fit(datacv, targetcv) # Classify, storing the result in a new variable. y_predcv = bnbcv.predict(datacv) # Display our results. print("Number of mislabeled points out of a total {} points : {}".format( datacv.shape[0], (targetcv != y_predcv).sum() )) #Show Confusion Matrix confusion_matrix(targetcv, y_predcv) #Cross validation, scores skf = StratifiedKFold(n_splits=10, random_state=0) scores = cross_val_score(bnb, datacv, targetcv, cv=skf) #Test the prediction capacity of the model predicted = cross_val_predict(bnb, datacv, y_predcv, cv=skf) prediction = metrics.accuracy_score(targetcv, predicted) #Print scores, accuracy of the model and prediction print(scores) print("Accuracy: %0.2f (+/- %0.2f)" % (scores.mean(), scores.std() * 2)) print("Prediction: %0.2f " % (prediction)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Principal Components Analysis Step2: Recursive Feature Elimination Step3: Splitting the data in a train and a test subset Step4: Test the result of training the model Step5: Cross validation & feature selection
5,263
<ASSISTANT_TASK:> Python Code: # To support both python 2 and python 3 from __future__ import division, print_function, unicode_literals # Common imports import numpy as np import os import sys # to make this notebook's output stable across runs def reset_graph(seed=42): tf.reset_default_graph() tf.set_random_seed(seed) np.random.seed(seed) # To plot pretty figures %matplotlib inline import matplotlib import matplotlib.pyplot as plt plt.rcParams['axes.labelsize'] = 14 plt.rcParams['xtick.labelsize'] = 12 plt.rcParams['ytick.labelsize'] = 12 # Where to save the figures PROJECT_ROOT_DIR = "." CHAPTER_ID = "autoencoders" def save_fig(fig_id, tight_layout=True): path = os.path.join(PROJECT_ROOT_DIR, "images", CHAPTER_ID, fig_id + ".png") print("Saving figure", fig_id) if tight_layout: plt.tight_layout() plt.savefig(path, format='png', dpi=300) def plot_image(image, shape=[28, 28]): plt.imshow(image.reshape(shape), cmap="Greys", interpolation="nearest") plt.axis("off") def plot_multiple_images(images, n_rows, n_cols, pad=2): images = images - images.min() # make the minimum == 0, so the padding looks white w,h = images.shape[1:] image = np.zeros(((w+pad)*n_rows+pad, (h+pad)*n_cols+pad)) for y in range(n_rows): for x in range(n_cols): image[(y*(h+pad)+pad):(y*(h+pad)+pad+h),(x*(w+pad)+pad):(x*(w+pad)+pad+w)] = images[y*n_cols+x] plt.imshow(image, cmap="Greys", interpolation="nearest") plt.axis("off") rnd.seed(4) m = 200 w1, w2 = 0.1, 0.3 noise = 0.1 angles = rnd.rand(m) * 3 * np.pi / 2 - 0.5 data = np.empty((m, 3)) data[:, 0] = np.cos(angles) + np.sin(angles)/2 + noise * rnd.randn(m) / 2 data[:, 1] = np.sin(angles) * 0.7 + noise * rnd.randn(m) / 2 data[:, 2] = data[:, 0] * w1 + data[:, 1] * w2 + noise * rnd.randn(m) from sklearn.preprocessing import StandardScaler scaler = StandardScaler() X_train = scaler.fit_transform(data[:100]) X_test = scaler.transform(data[100:]) import tensorflow as tf reset_graph() n_inputs = 3 n_hidden = 2 # codings n_outputs = n_inputs learning_rate = 0.01 X = tf.placeholder(tf.float32, shape=[None, n_inputs]) hidden = tf.layers.dense(X, n_hidden) outputs = tf.layers.dense(hidden, n_outputs) reconstruction_loss = tf.reduce_mean(tf.square(outputs - X)) optimizer = tf.train.AdamOptimizer(learning_rate) training_op = optimizer.minimize(reconstruction_loss) init = tf.global_variables_initializer() n_iterations = 1000 codings = hidden with tf.Session() as sess: init.run() for iteration in range(n_iterations): training_op.run(feed_dict={X: X_train}) codings_val = codings.eval(feed_dict={X: X_test}) fig = plt.figure(figsize=(4,3)) plt.plot(codings_val[:,0], codings_val[:, 1], "b.") plt.xlabel("$z_1$", fontsize=18) plt.ylabel("$z_2$", fontsize=18, rotation=0) save_fig("linear_autoencoder_pca_plot") plt.show() from tensorflow.examples.tutorials.mnist import input_data mnist = input_data.read_data_sets("/tmp/data/") reset_graph() from functools import partial n_inputs = 28 * 28 n_hidden1 = 300 n_hidden2 = 150 # codings n_hidden3 = n_hidden1 n_outputs = n_inputs learning_rate = 0.01 l2_reg = 0.0001 X = tf.placeholder(tf.float32, shape=[None, n_inputs]) he_init = tf.contrib.layers.variance_scaling_initializer() # He initialization #Equivalent to: #he_init = lambda shape, dtype=tf.float32: tf.truncated_normal(shape, 0., stddev=np.sqrt(2/shape[0])) l2_regularizer = tf.contrib.layers.l2_regularizer(l2_reg) my_dense_layer = partial(tf.layers.dense, activation=tf.nn.elu, kernel_initializer=he_init, kernel_regularizer=l2_regularizer) hidden1 = my_dense_layer(X, n_hidden1) hidden2 = my_dense_layer(hidden1, n_hidden2) hidden3 = my_dense_layer(hidden2, n_hidden3) outputs = my_dense_layer(hidden3, n_outputs, activation=None) reconstruction_loss = tf.reduce_mean(tf.square(outputs - X)) reg_losses = tf.get_collection(tf.GraphKeys.REGULARIZATION_LOSSES) loss = tf.add_n([reconstruction_loss] + reg_losses) optimizer = tf.train.AdamOptimizer(learning_rate) training_op = optimizer.minimize(loss) init = tf.global_variables_initializer() saver = tf.train.Saver() # not shown in the book n_epochs = 5 batch_size = 150 with tf.Session() as sess: init.run() for epoch in range(n_epochs): n_batches = mnist.train.num_examples // batch_size for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") # not shown in the book sys.stdout.flush() # not shown X_batch, y_batch = mnist.train.next_batch(batch_size) sess.run(training_op, feed_dict={X: X_batch}) loss_train = reconstruction_loss.eval(feed_dict={X: X_batch}) # not shown print("\r{}".format(epoch), "Train MSE:", loss_train) # not shown saver.save(sess, "./my_model_all_layers.ckpt") # not shown def show_reconstructed_digits(X, outputs, model_path = None, n_test_digits = 2): with tf.Session() as sess: if model_path: saver.restore(sess, model_path) X_test = mnist.test.images[:n_test_digits] outputs_val = outputs.eval(feed_dict={X: X_test}) fig = plt.figure(figsize=(8, 3 * n_test_digits)) for digit_index in range(n_test_digits): plt.subplot(n_test_digits, 2, digit_index * 2 + 1) plot_image(X_test[digit_index]) plt.subplot(n_test_digits, 2, digit_index * 2 + 2) plot_image(outputs_val[digit_index]) show_reconstructed_digits(X, outputs, "./my_model_all_layers.ckpt") save_fig("reconstruction_plot") reset_graph() n_inputs = 28 * 28 n_hidden1 = 300 n_hidden2 = 150 # codings n_hidden3 = n_hidden1 n_outputs = n_inputs learning_rate = 0.01 l2_reg = 0.0005 activation = tf.nn.elu regularizer = tf.contrib.layers.l2_regularizer(l2_reg) initializer = tf.contrib.layers.variance_scaling_initializer() X = tf.placeholder(tf.float32, shape=[None, n_inputs]) weights1_init = initializer([n_inputs, n_hidden1]) weights2_init = initializer([n_hidden1, n_hidden2]) weights1 = tf.Variable(weights1_init, dtype=tf.float32, name="weights1") weights2 = tf.Variable(weights2_init, dtype=tf.float32, name="weights2") weights3 = tf.transpose(weights2, name="weights3") # tied weights weights4 = tf.transpose(weights1, name="weights4") # tied weights biases1 = tf.Variable(tf.zeros(n_hidden1), name="biases1") biases2 = tf.Variable(tf.zeros(n_hidden2), name="biases2") biases3 = tf.Variable(tf.zeros(n_hidden3), name="biases3") biases4 = tf.Variable(tf.zeros(n_outputs), name="biases4") hidden1 = activation(tf.matmul(X, weights1) + biases1) hidden2 = activation(tf.matmul(hidden1, weights2) + biases2) hidden3 = activation(tf.matmul(hidden2, weights3) + biases3) outputs = tf.matmul(hidden3, weights4) + biases4 reconstruction_loss = tf.reduce_mean(tf.square(outputs - X)) reg_loss = regularizer(weights1) + regularizer(weights2) loss = reconstruction_loss + reg_loss optimizer = tf.train.AdamOptimizer(learning_rate) training_op = optimizer.minimize(loss) init = tf.global_variables_initializer() saver = tf.train.Saver() n_epochs = 5 batch_size = 150 with tf.Session() as sess: init.run() for epoch in range(n_epochs): n_batches = mnist.train.num_examples // batch_size for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") sys.stdout.flush() X_batch, y_batch = mnist.train.next_batch(batch_size) sess.run(training_op, feed_dict={X: X_batch}) loss_train = reconstruction_loss.eval(feed_dict={X: X_batch}) print("\r{}".format(epoch), "Train MSE:", loss_train) saver.save(sess, "./my_model_tying_weights.ckpt") show_reconstructed_digits(X, outputs, "./my_model_tying_weights.ckpt") reset_graph() from functools import partial def train_autoencoder(X_train, n_neurons, n_epochs, batch_size, learning_rate = 0.01, l2_reg = 0.0005, activation=tf.nn.elu, seed=42): graph = tf.Graph() with graph.as_default(): tf.set_random_seed(seed) n_inputs = X_train.shape[1] X = tf.placeholder(tf.float32, shape=[None, n_inputs]) my_dense_layer = partial( tf.layers.dense, activation=activation, kernel_initializer=tf.contrib.layers.variance_scaling_initializer(), kernel_regularizer=tf.contrib.layers.l2_regularizer(l2_reg)) hidden = my_dense_layer(X, n_neurons, name="hidden") outputs = my_dense_layer(hidden, n_inputs, activation=None, name="outputs") reconstruction_loss = tf.reduce_mean(tf.square(outputs - X)) reg_losses = tf.get_collection(tf.GraphKeys.REGULARIZATION_LOSSES) loss = tf.add_n([reconstruction_loss] + reg_losses) optimizer = tf.train.AdamOptimizer(learning_rate) training_op = optimizer.minimize(loss) init = tf.global_variables_initializer() with tf.Session(graph=graph) as sess: init.run() for epoch in range(n_epochs): n_batches = len(X_train) // batch_size for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") sys.stdout.flush() indices = rnd.permutation(len(X_train))[:batch_size] X_batch = X_train[indices] sess.run(training_op, feed_dict={X: X_batch}) loss_train = reconstruction_loss.eval(feed_dict={X: X_batch}) print("\r{}".format(epoch), "Train MSE:", loss_train) params = dict([(var.name, var.eval()) for var in tf.get_collection(tf.GraphKeys.TRAINABLE_VARIABLES)]) hidden_val = hidden.eval(feed_dict={X: X_train}) return hidden_val, params["hidden/kernel:0"], params["hidden/bias:0"], params["outputs/kernel:0"], params["outputs/bias:0"] hidden_output, W1, b1, W4, b4 = train_autoencoder(mnist.train.images, n_neurons=300, n_epochs=4, batch_size=150) _, W2, b2, W3, b3 = train_autoencoder(hidden_output, n_neurons=150, n_epochs=4, batch_size=150) reset_graph() n_inputs = 28*28 X = tf.placeholder(tf.float32, shape=[None, n_inputs]) hidden1 = tf.nn.elu(tf.matmul(X, W1) + b1) hidden2 = tf.nn.elu(tf.matmul(hidden1, W2) + b2) hidden3 = tf.nn.elu(tf.matmul(hidden2, W3) + b3) outputs = tf.matmul(hidden3, W4) + b4 show_reconstructed_digits(X, outputs) reset_graph() n_inputs = 28 * 28 n_hidden1 = 300 n_hidden2 = 150 # codings n_hidden3 = n_hidden1 n_outputs = n_inputs learning_rate = 0.01 l2_reg = 0.0001 activation = tf.nn.elu regularizer = tf.contrib.layers.l2_regularizer(l2_reg) initializer = tf.contrib.layers.variance_scaling_initializer() X = tf.placeholder(tf.float32, shape=[None, n_inputs]) weights1_init = initializer([n_inputs, n_hidden1]) weights2_init = initializer([n_hidden1, n_hidden2]) weights3_init = initializer([n_hidden2, n_hidden3]) weights4_init = initializer([n_hidden3, n_outputs]) weights1 = tf.Variable(weights1_init, dtype=tf.float32, name="weights1") weights2 = tf.Variable(weights2_init, dtype=tf.float32, name="weights2") weights3 = tf.Variable(weights3_init, dtype=tf.float32, name="weights3") weights4 = tf.Variable(weights4_init, dtype=tf.float32, name="weights4") biases1 = tf.Variable(tf.zeros(n_hidden1), name="biases1") biases2 = tf.Variable(tf.zeros(n_hidden2), name="biases2") biases3 = tf.Variable(tf.zeros(n_hidden3), name="biases3") biases4 = tf.Variable(tf.zeros(n_outputs), name="biases4") hidden1 = activation(tf.matmul(X, weights1) + biases1) hidden2 = activation(tf.matmul(hidden1, weights2) + biases2) hidden3 = activation(tf.matmul(hidden2, weights3) + biases3) outputs = tf.matmul(hidden3, weights4) + biases4 reconstruction_loss = tf.reduce_mean(tf.square(outputs - X)) optimizer = tf.train.AdamOptimizer(learning_rate) with tf.name_scope("phase1"): phase1_outputs = tf.matmul(hidden1, weights4) + biases4 # bypass hidden2 and hidden3 phase1_reconstruction_loss = tf.reduce_mean(tf.square(phase1_outputs - X)) phase1_reg_loss = regularizer(weights1) + regularizer(weights4) phase1_loss = phase1_reconstruction_loss + phase1_reg_loss phase1_training_op = optimizer.minimize(phase1_loss) with tf.name_scope("phase2"): phase2_reconstruction_loss = tf.reduce_mean(tf.square(hidden3 - hidden1)) phase2_reg_loss = regularizer(weights2) + regularizer(weights3) phase2_loss = phase2_reconstruction_loss + phase2_reg_loss train_vars = [weights2, biases2, weights3, biases3] phase2_training_op = optimizer.minimize(phase2_loss, var_list=train_vars) # freeze hidden1 init = tf.global_variables_initializer() saver = tf.train.Saver() training_ops = [phase1_training_op, phase2_training_op] reconstruction_losses = [phase1_reconstruction_loss, phase2_reconstruction_loss] n_epochs = [4, 4] batch_sizes = [150, 150] with tf.Session() as sess: init.run() for phase in range(2): print("Training phase #{}".format(phase + 1)) for epoch in range(n_epochs[phase]): n_batches = mnist.train.num_examples // batch_sizes[phase] for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") sys.stdout.flush() X_batch, y_batch = mnist.train.next_batch(batch_sizes[phase]) sess.run(training_ops[phase], feed_dict={X: X_batch}) loss_train = reconstruction_losses[phase].eval(feed_dict={X: X_batch}) print("\r{}".format(epoch), "Train MSE:", loss_train) saver.save(sess, "./my_model_one_at_a_time.ckpt") loss_test = reconstruction_loss.eval(feed_dict={X: mnist.test.images}) print("Test MSE:", loss_test) training_ops = [phase1_training_op, phase2_training_op] reconstruction_losses = [phase1_reconstruction_loss, phase2_reconstruction_loss] n_epochs = [4, 4] batch_sizes = [150, 150] with tf.Session() as sess: init.run() for phase in range(2): print("Training phase #{}".format(phase + 1)) if phase == 1: hidden1_cache = hidden1.eval(feed_dict={X: mnist.train.images}) for epoch in range(n_epochs[phase]): n_batches = mnist.train.num_examples // batch_sizes[phase] for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") sys.stdout.flush() if phase == 1: indices = rnd.permutation(mnist.train.num_examples) hidden1_batch = hidden1_cache[indices[:batch_sizes[phase]]] feed_dict = {hidden1: hidden1_batch} sess.run(training_ops[phase], feed_dict=feed_dict) else: X_batch, y_batch = mnist.train.next_batch(batch_sizes[phase]) feed_dict = {X: X_batch} sess.run(training_ops[phase], feed_dict=feed_dict) loss_train = reconstruction_losses[phase].eval(feed_dict=feed_dict) print("\r{}".format(epoch), "Train MSE:", loss_train) saver.save(sess, "./my_model_cache_frozen.ckpt") loss_test = reconstruction_loss.eval(feed_dict={X: mnist.test.images}) print("Test MSE:", loss_test) n_test_digits = 2 X_test = mnist.test.images[:n_test_digits] with tf.Session() as sess: saver.restore(sess, "./my_model_one_at_a_time.ckpt") # not shown in the book outputs_val = outputs.eval(feed_dict={X: X_test}) def plot_image(image, shape=[28, 28]): plt.imshow(image.reshape(shape), cmap="Greys", interpolation="nearest") plt.axis("off") for digit_index in range(n_test_digits): plt.subplot(n_test_digits, 2, digit_index * 2 + 1) plot_image(X_test[digit_index]) plt.subplot(n_test_digits, 2, digit_index * 2 + 2) plot_image(outputs_val[digit_index]) with tf.Session() as sess: saver.restore(sess, "./my_model_one_at_a_time.ckpt") # not shown in the book weights1_val = weights1.eval() for i in range(5): plt.subplot(1, 5, i + 1) plot_image(weights1_val.T[i]) save_fig("extracted_features_plot") # not shown plt.show() # not shown reset_graph() n_inputs = 28 * 28 n_hidden1 = 300 n_hidden2 = 150 n_outputs = 10 learning_rate = 0.01 l2_reg = 0.0005 activation = tf.nn.elu regularizer = tf.contrib.layers.l2_regularizer(l2_reg) initializer = tf.contrib.layers.variance_scaling_initializer() X = tf.placeholder(tf.float32, shape=[None, n_inputs]) y = tf.placeholder(tf.int32, shape=[None]) weights1_init = initializer([n_inputs, n_hidden1]) weights2_init = initializer([n_hidden1, n_hidden2]) weights3_init = initializer([n_hidden2, n_hidden3]) weights1 = tf.Variable(weights1_init, dtype=tf.float32, name="weights1") weights2 = tf.Variable(weights2_init, dtype=tf.float32, name="weights2") weights3 = tf.Variable(weights3_init, dtype=tf.float32, name="weights3") biases1 = tf.Variable(tf.zeros(n_hidden1), name="biases1") biases2 = tf.Variable(tf.zeros(n_hidden2), name="biases2") biases3 = tf.Variable(tf.zeros(n_hidden3), name="biases3") hidden1 = activation(tf.matmul(X, weights1) + biases1) hidden2 = activation(tf.matmul(hidden1, weights2) + biases2) logits = tf.matmul(hidden2, weights3) + biases3 cross_entropy = tf.nn.sparse_softmax_cross_entropy_with_logits(labels=y, logits=logits) reg_loss = regularizer(weights1) + regularizer(weights2) + regularizer(weights3) loss = cross_entropy + reg_loss optimizer = tf.train.AdamOptimizer(learning_rate) training_op = optimizer.minimize(loss) correct = tf.nn.in_top_k(logits, y, 1) accuracy = tf.reduce_mean(tf.cast(correct, tf.float32)) init = tf.global_variables_initializer() pretrain_saver = tf.train.Saver([weights1, weights2, biases1, biases2]) saver = tf.train.Saver() n_epochs = 4 batch_size = 150 n_labeled_instances = 20000 with tf.Session() as sess: init.run() for epoch in range(n_epochs): n_batches = n_labeled_instances // batch_size for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") sys.stdout.flush() indices = rnd.permutation(n_labeled_instances)[:batch_size] X_batch, y_batch = mnist.train.images[indices], mnist.train.labels[indices] sess.run(training_op, feed_dict={X: X_batch, y: y_batch}) accuracy_val = accuracy.eval(feed_dict={X: X_batch, y: y_batch}) print("\r{}".format(epoch), "Train accuracy:", accuracy_val, end=" ") saver.save(sess, "./my_model_supervised.ckpt") accuracy_val = accuracy.eval(feed_dict={X: mnist.test.images, y: mnist.test.labels}) print("Test accuracy:", accuracy_val) n_epochs = 4 batch_size = 150 n_labeled_instances = 20000 #training_op = optimizer.minimize(loss, var_list=[weights3, biases3]) # Freeze layers 1 and 2 (optional) with tf.Session() as sess: init.run() pretrain_saver.restore(sess, "./my_model_cache_frozen.ckpt") for epoch in range(n_epochs): n_batches = n_labeled_instances // batch_size for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") sys.stdout.flush() indices = rnd.permutation(n_labeled_instances)[:batch_size] X_batch, y_batch = mnist.train.images[indices], mnist.train.labels[indices] sess.run(training_op, feed_dict={X: X_batch, y: y_batch}) accuracy_val = accuracy.eval(feed_dict={X: X_batch, y: y_batch}) print("\r{}".format(epoch), "Train accuracy:", accuracy_val, end="\t") saver.save(sess, "./my_model_supervised_pretrained.ckpt") accuracy_val = accuracy.eval(feed_dict={X: mnist.test.images, y: mnist.test.labels}) print("Test accuracy:", accuracy_val) reset_graph() n_inputs = 28 * 28 n_hidden1 = 300 n_hidden2 = 150 # codings n_hidden3 = n_hidden1 n_outputs = n_inputs learning_rate = 0.01 noise_level = 1.0 X = tf.placeholder(tf.float32, shape=[None, n_inputs]) X_noisy = X + noise_level * tf.random_normal(tf.shape(X)) hidden1 = tf.layers.dense(X_noisy, n_hidden1, activation=tf.nn.relu, name="hidden1") hidden2 = tf.layers.dense(hidden1, n_hidden2, activation=tf.nn.relu, # not shown in the book name="hidden2") # not shown hidden3 = tf.layers.dense(hidden2, n_hidden3, activation=tf.nn.relu, # not shown name="hidden3") # not shown outputs = tf.layers.dense(hidden3, n_outputs, name="outputs") # not shown reconstruction_loss = tf.reduce_mean(tf.square(outputs - X)) # MSE optimizer = tf.train.AdamOptimizer(learning_rate) training_op = optimizer.minimize(reconstruction_loss) init = tf.global_variables_initializer() saver = tf.train.Saver() n_epochs = 10 batch_size = 150 with tf.Session() as sess: init.run() for epoch in range(n_epochs): n_batches = mnist.train.num_examples // batch_size for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") sys.stdout.flush() X_batch, y_batch = mnist.train.next_batch(batch_size) sess.run(training_op, feed_dict={X: X_batch}) loss_train = reconstruction_loss.eval(feed_dict={X: X_batch}) print("\r{}".format(epoch), "Train MSE:", loss_train) saver.save(sess, "./my_model_stacked_denoising_gaussian.ckpt") reset_graph() n_inputs = 28 * 28 n_hidden1 = 300 n_hidden2 = 150 # codings n_hidden3 = n_hidden1 n_outputs = n_inputs learning_rate = 0.01 dropout_rate = 0.3 training = tf.placeholder_with_default(False, shape=(), name='training') X = tf.placeholder(tf.float32, shape=[None, n_inputs]) X_drop = tf.layers.dropout(X, dropout_rate, training=training) hidden1 = tf.layers.dense(X_drop, n_hidden1, activation=tf.nn.relu, name="hidden1") hidden2 = tf.layers.dense(hidden1, n_hidden2, activation=tf.nn.relu, # not shown in the book name="hidden2") # not shown hidden3 = tf.layers.dense(hidden2, n_hidden3, activation=tf.nn.relu, # not shown name="hidden3") # not shown outputs = tf.layers.dense(hidden3, n_outputs, name="outputs") # not shown reconstruction_loss = tf.reduce_mean(tf.square(outputs - X)) # MSE optimizer = tf.train.AdamOptimizer(learning_rate) training_op = optimizer.minimize(reconstruction_loss) init = tf.global_variables_initializer() saver = tf.train.Saver() n_epochs = 10 batch_size = 150 with tf.Session() as sess: init.run() for epoch in range(n_epochs): n_batches = mnist.train.num_examples // batch_size for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") sys.stdout.flush() X_batch, y_batch = mnist.train.next_batch(batch_size) sess.run(training_op, feed_dict={X: X_batch, training: True}) loss_train = reconstruction_loss.eval(feed_dict={X: X_batch}) print("\r{}".format(epoch), "Train MSE:", loss_train) saver.save(sess, "./my_model_stacked_denoising_dropout.ckpt") show_reconstructed_digits(X, outputs, "./my_model_stacked_denoising_dropout.ckpt") p = 0.1 q = np.linspace(0.001, 0.999, 500) kl_div = p * np.log(p / q) + (1 - p) * np.log((1 - p) / (1 - q)) mse = (p - q)**2 plt.plot([p, p], [0, 0.3], "k:") plt.text(0.05, 0.32, "Target\nsparsity", fontsize=14) plt.plot(q, kl_div, "b-", label="KL divergence") plt.plot(q, mse, "r--", label="MSE") plt.legend(loc="upper left") plt.xlabel("Actual sparsity") plt.ylabel("Cost", rotation=0) plt.axis([0, 1, 0, 0.95]) save_fig("sparsity_loss_plot") reset_graph() n_inputs = 28 * 28 n_hidden1 = 1000 # sparse codings n_outputs = n_inputs def kl_divergence(p, q): # Kullback Leibler divergence return p * tf.log(p / q) + (1 - p) * tf.log((1 - p) / (1 - q)) learning_rate = 0.01 sparsity_target = 0.1 sparsity_weight = 0.2 X = tf.placeholder(tf.float32, shape=[None, n_inputs]) # not shown in the book hidden1 = tf.layers.dense(X, n_hidden1, activation=tf.nn.sigmoid) # not shown outputs = tf.layers.dense(hidden1, n_outputs) # not shown hidden1_mean = tf.reduce_mean(hidden1, axis=0) # batch mean sparsity_loss = tf.reduce_sum(kl_divergence(sparsity_target, hidden1_mean)) reconstruction_loss = tf.reduce_mean(tf.square(outputs - X)) # MSE loss = reconstruction_loss + sparsity_weight * sparsity_loss optimizer = tf.train.AdamOptimizer(learning_rate) training_op = optimizer.minimize(loss) init = tf.global_variables_initializer() saver = tf.train.Saver() n_epochs = 100 batch_size = 1000 with tf.Session() as sess: init.run() for epoch in range(n_epochs): n_batches = mnist.train.num_examples // batch_size for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") sys.stdout.flush() X_batch, y_batch = mnist.train.next_batch(batch_size) sess.run(training_op, feed_dict={X: X_batch}) reconstruction_loss_val, sparsity_loss_val, loss_val = sess.run([reconstruction_loss, sparsity_loss, loss], feed_dict={X: X_batch}) print("\r{}".format(epoch), "Train MSE:", reconstruction_loss_val, "\tSparsity loss:", sparsity_loss_val, "\tTotal loss:", loss_val) saver.save(sess, "./my_model_sparse.ckpt") show_reconstructed_digits(X, outputs, "./my_model_sparse.ckpt") hidden1 = tf.layers.dense(X, n_hidden1, activation=tf.nn.sigmoid) logits = tf.layers.dense(hidden1, n_outputs) outputs = tf.nn.sigmoid(logits) xentropy = tf.nn.sigmoid_cross_entropy_with_logits(labels=X, logits=logits) reconstruction_loss = tf.reduce_mean(xentropy) reset_graph() from functools import partial n_inputs = 28 * 28 n_hidden1 = 500 n_hidden2 = 500 n_hidden3 = 20 # codings n_hidden4 = n_hidden2 n_hidden5 = n_hidden1 n_outputs = n_inputs learning_rate = 0.001 initializer = tf.contrib.layers.variance_scaling_initializer() my_dense_layer = partial( tf.layers.dense, activation=tf.nn.elu, kernel_initializer=initializer) X = tf.placeholder(tf.float32, [None, n_inputs]) hidden1 = my_dense_layer(X, n_hidden1) hidden2 = my_dense_layer(hidden1, n_hidden2) hidden3_mean = my_dense_layer(hidden2, n_hidden3, activation=None) hidden3_sigma = my_dense_layer(hidden2, n_hidden3, activation=None) noise = tf.random_normal(tf.shape(hidden3_sigma), dtype=tf.float32) hidden3 = hidden3_mean + hidden3_sigma * noise hidden4 = my_dense_layer(hidden3, n_hidden4) hidden5 = my_dense_layer(hidden4, n_hidden5) logits = my_dense_layer(hidden5, n_outputs, activation=None) outputs = tf.sigmoid(logits) xentropy = tf.nn.sigmoid_cross_entropy_with_logits(labels=X, logits=logits) reconstruction_loss = tf.reduce_sum(xentropy) eps = 1e-10 # smoothing term to avoid computing log(0) which is NaN latent_loss = 0.5 * tf.reduce_sum( tf.square(hidden3_sigma) + tf.square(hidden3_mean) - 1 - tf.log(eps + tf.square(hidden3_sigma))) loss = reconstruction_loss + latent_loss optimizer = tf.train.AdamOptimizer(learning_rate=learning_rate) training_op = optimizer.minimize(loss) init = tf.global_variables_initializer() saver = tf.train.Saver() n_epochs = 50 batch_size = 150 with tf.Session() as sess: init.run() for epoch in range(n_epochs): n_batches = mnist.train.num_examples // batch_size for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") sys.stdout.flush() X_batch, y_batch = mnist.train.next_batch(batch_size) sess.run(training_op, feed_dict={X: X_batch}) loss_val, reconstruction_loss_val, latent_loss_val = sess.run([loss, reconstruction_loss, latent_loss], feed_dict={X: X_batch}) print("\r{}".format(epoch), "Train total loss:", loss_val, "\tReconstruction loss:", reconstruction_loss_val, "\tLatent loss:", latent_loss_val) saver.save(sess, "./my_model_variational.ckpt") reset_graph() from functools import partial n_inputs = 28 * 28 n_hidden1 = 500 n_hidden2 = 500 n_hidden3 = 20 # codings n_hidden4 = n_hidden2 n_hidden5 = n_hidden1 n_outputs = n_inputs learning_rate = 0.001 initializer = tf.contrib.layers.variance_scaling_initializer() my_dense_layer = partial( tf.layers.dense, activation=tf.nn.elu, kernel_initializer=initializer) X = tf.placeholder(tf.float32, [None, n_inputs]) hidden1 = my_dense_layer(X, n_hidden1) hidden2 = my_dense_layer(hidden1, n_hidden2) hidden3_mean = my_dense_layer(hidden2, n_hidden3, activation=None) hidden3_gamma = my_dense_layer(hidden2, n_hidden3, activation=None) noise = tf.random_normal(tf.shape(hidden3_gamma), dtype=tf.float32) hidden3 = hidden3_mean + tf.exp(0.5 * hidden3_gamma) * noise hidden4 = my_dense_layer(hidden3, n_hidden4) hidden5 = my_dense_layer(hidden4, n_hidden5) logits = my_dense_layer(hidden5, n_outputs, activation=None) outputs = tf.sigmoid(logits) xentropy = tf.nn.sigmoid_cross_entropy_with_logits(labels=X, logits=logits) reconstruction_loss = tf.reduce_sum(xentropy) latent_loss = 0.5 * tf.reduce_sum( tf.exp(hidden3_gamma) + tf.square(hidden3_mean) - 1 - hidden3_gamma) loss = reconstruction_loss + latent_loss optimizer = tf.train.AdamOptimizer(learning_rate=learning_rate) training_op = optimizer.minimize(loss) init = tf.global_variables_initializer() saver = tf.train.Saver() import numpy as np n_digits = 60 n_epochs = 50 batch_size = 150 with tf.Session() as sess: init.run() for epoch in range(n_epochs): n_batches = mnist.train.num_examples // batch_size for iteration in range(n_batches): print("\r{}%".format(100 * iteration // n_batches), end="") # not shown in the book sys.stdout.flush() # not shown X_batch, y_batch = mnist.train.next_batch(batch_size) sess.run(training_op, feed_dict={X: X_batch}) loss_val, reconstruction_loss_val, latent_loss_val = sess.run([loss, reconstruction_loss, latent_loss], feed_dict={X: X_batch}) # not shown print("\r{}".format(epoch), "Train total loss:", loss_val, "\tReconstruction loss:", reconstruction_loss_val, "\tLatent loss:", latent_loss_val) # not shown saver.save(sess, "./my_model_variational.ckpt") # not shown codings_rnd = np.random.normal(size=[n_digits, n_hidden3]) outputs_val = outputs.eval(feed_dict={hidden3: codings_rnd}) plt.figure(figsize=(8,50)) # not shown in the book for iteration in range(n_digits): plt.subplot(n_digits, 10, iteration + 1) plot_image(outputs_val[iteration]) n_rows = 6 n_cols = 10 plot_multiple_images(outputs_val.reshape(-1, 28, 28), n_rows, n_cols) save_fig("generated_digits_plot") plt.show() latent_loss = 0.5 * tf.reduce_sum( tf.exp(hidden3_gamma) + tf.square(hidden3_mean) - 1 - hidden3_gamma) n_digits = 3 X_test, y_test = mnist.test.next_batch(batch_size) codings = hidden3 with tf.Session() as sess: saver.restore(sess, "./my_model_variational.ckpt") codings_val = codings.eval(feed_dict={X: X_test}) with tf.Session() as sess: saver.restore(sess, "./my_model_variational.ckpt") outputs_val = outputs.eval(feed_dict={codings: codings_val}) fig = plt.figure(figsize=(8, 2.5 * n_digits)) for iteration in range(n_digits): plt.subplot(n_digits, 2, 1 + 2 * iteration) plot_image(X_test[iteration]) plt.subplot(n_digits, 2, 2 + 2 * iteration) plot_image(outputs_val[iteration]) n_iterations = 3 n_digits = 6 codings_rnd = np.random.normal(size=[n_digits, n_hidden3]) with tf.Session() as sess: saver.restore(sess, "./my_model_variational.ckpt") target_codings = np.roll(codings_rnd, -1, axis=0) for iteration in range(n_iterations + 1): codings_interpolate = codings_rnd + (target_codings - codings_rnd) * iteration / n_iterations outputs_val = outputs.eval(feed_dict={codings: codings_interpolate}) plt.figure(figsize=(11, 1.5*n_iterations)) for digit_index in range(n_digits): plt.subplot(1, n_digits, digit_index + 1) plot_image(outputs_val[digit_index]) plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: A couple utility functions to plot grayscale 28x28 image Step2: PCA with a linear Autoencoder Step3: Normalize the data Step4: Now let's build the Autoencoder... Step5: Stacked Autoencoders Step6: Train all layers at once Step7: Now let's train it! Note that we don't feed target values (y_batch is not used). This is unsupervised training. Step8: This function loads the model, evaluates it on the test set (it measures the reconstruction error), then it displays the original image and its reconstruction Step9: Tying weights Step10: Training one Autoencoder at a time in multiple graphs Step11: Now let's train two Autoencoders. The first one is trained on the training data, and the second is trained on the previous Autoencoder's hidden layer output Step12: Finally, we can create a Stacked Autoencoder by simply reusing the weights and biases from the Autoencoders we just trained Step13: Training one Autoencoder at a time in a single graph Step14: Cache the frozen layer outputs Step15: Visualizing the Reconstructions Step16: Visualizing the extracted features Step17: Unsupervised pretraining Step18: Regular training (without pretraining) Step19: Now reusing the first two layers of the autoencoder we pretrained Step20: Stacked denoising Autoencoder Step21: Using dropout Step22: Sparse Autoencoder Step23: Note that the coding layer must output values from 0 to 1, which is why we use the sigmoid activation function Step24: To speed up training, you can normalize the inputs between 0 and 1, and use the cross entropy instead of the MSE for the cost function Step25: Variational Autoencoder Step26: Generate digits Step27: Note that the latent loss is computed differently in this second variant Step28: Encode & Decode Step29: Decode Step30: Let's plot the reconstructions Step31: Interpolate digits
5,264
<ASSISTANT_TASK:> Python Code: from __future__ import division, print_function %matplotlib inline #format the book import book_format book_format.set_style() import matplotlib.pyplot as plt data = [10.1, 10.2, 9.8, 10.1, 10.2, 10.3, 10.1, 9.9, 10.2, 10.0, 9.9, 11.4] plt.plot(data) plt.xlabel('time') plt.ylabel('position'); data2 = [11.3, 12.1, 13.3, 13.9, 14.5, 15.2] plt.plot(data + data2); data3 = [9.8, 10.2, 9.9, 10.1, 10.0, 10.3, 9.9, 10.1] plt.plot(data + data3); import numpy as np from numpy import random from numpy.random import randn import matplotlib.pyplot as plt from filterpy.kalman import KalmanFilter import kf_book.book_plots as bp def plot_rts(noise, Q=0.001, show_velocity=False): random.seed(123) fk = KalmanFilter(dim_x=2, dim_z=1) fk.x = np.array([0., 1.]) # state (x and dx) fk.F = np.array([[1., 1.], [0., 1.]]) # state transition matrix fk.H = np.array([[1., 0.]]) # Measurement function fk.P = 10. # covariance matrix fk.R = noise # state uncertainty fk.Q = Q # process uncertainty # create noisy data zs = np.asarray([t + randn()*noise for t in range (40)]) # filter data with Kalman filter, than run smoother on it mu, cov, _, _ = fk.batch_filter(zs) M, P, C, _ = fk.rts_smoother(mu, cov) # plot data if show_velocity: index = 1 print('gu') else: index = 0 if not show_velocity: bp.plot_measurements(zs, lw=1) plt.plot(M[:, index], c='b', label='RTS') plt.plot(mu[:, index], c='g', ls='--', label='KF output') if not show_velocity: N = len(zs) plt.plot([0, N], [0, N], 'k', lw=2, label='track') plt.legend(loc=4) plt.show() plot_rts(7.) plot_rts(noise=1.) plot_rts(noise=7., Q=.1) plot_rts(7.,show_velocity=True) from kf_book.book_plots import figsize from kf_book.smoothing_internal import * with figsize(y=2): show_fixed_lag_numberline() from filterpy.kalman import FixedLagSmoother, KalmanFilter import numpy.random as random fls = FixedLagSmoother(dim_x=2, dim_z=1, N=8) fls.x = np.array([0., .5]) fls.F = np.array([[1.,1.], [0.,1.]]) fls.H = np.array([[1.,0.]]) fls.P *= 200 fls.R *= 5. fls.Q *= 0.001 kf = KalmanFilter(dim_x=2, dim_z=1) kf.x = np.array([0., .5]) kf.F = np.array([[1.,1.], [0.,1.]]) kf.H = np.array([[1.,0.]]) kf.P *= 200 kf.R *= 5. kf.Q *= 0.001 N = 4 # size of lag nom = np.array([t/2. for t in range (0, 40)]) zs = np.array([t + random.randn()*5.1 for t in nom]) for z in zs: fls.smooth(z) kf_x, _, _, _ = kf.batch_filter(zs) x_smooth = np.array(fls.xSmooth)[:, 0] fls_res = abs(x_smooth - nom) kf_res = abs(kf_x[:, 0] - nom) plt.plot(zs,'o', alpha=0.5, marker='o', label='zs') plt.plot(x_smooth, label='FLS') plt.plot(kf_x[:, 0], label='KF', ls='--') plt.legend(loc=4) print('standard deviation fixed-lag: {:.3f}'.format(np.mean(fls_res))) print('standard deviation kalman: {:.3f}'.format(np.mean(kf_res))) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Introduction Step2: After a period of near steady state, we have a very large change. Assume the change is past the limit of the aircraft's flight envelope. Nonetheless the Kalman filter incorporates that new measurement into the filter based on the current Kalman gain. It cannot reject the noise because the measurement could reflect the initiation of a turn. Granted it is unlikely that we are turning so abruptly, but it is impossible to say whether Step3: Given these future measurements we can infer that yes, the aircraft initiated a turn. Step4: In this case we are led to conclude that the aircraft did not turn and that the outlying measurement was merely very noisy. Step5: I've injected a lot of noise into the signal to allow you to visually distinguish the RTS output from the ideal output. In the graph above we can see that the Kalman filter, drawn as the green dotted line, is reasonably smooth compared to the input, but it still wanders from from the ideal line when several measurements in a row are biased towards one side of the line. In contrast, the RTS output is both extremely smooth and very close to the ideal output. Step6: However, we must understand that this smoothing is predicated on the system model. We have told the filter that what we are tracking follows a constant velocity model with very low process error. When the filter looks ahead it sees that the future behavior closely matches a constant velocity so it is able to reject most of the noise in the signal. Suppose instead our system has a lot of process noise. For example, if we are tracking a light aircraft in gusty winds its velocity will change often, and the filter will be less able to distinguish between noise and erratic movement due to the wind. We can see this in the next graph. Step7: This underscores the fact that these filters are not smoothing the data in colloquial sense of the term. The filter is making an optimal estimate based on previous measurements, future measurements, and what you tell it about the behavior of the system and the noise in the system and measurements. Step8: The improvement in the velocity, which is an hidden variable, is even more dramatic. Step9: At step $k$ we can estimate $x_k$ using the normal Kalman filter equations. However, we can make a better estimate for $x_{k-1}$ by using the measurement received for $x_k$. Likewise, we can make a better estimate for $x_{k-2}$ by using the measurements recevied for $x_{k-1}$ and $x_{k}$. We can extend this computation back for an arbitrary $N$ steps.
5,265
<ASSISTANT_TASK:> Python Code: import pandas as pd import numpy as np from pandas.tools.plotting import scatter_matrix from matplotlib import pyplot as plt from sklearn.model_selection import train_test_split from sklearn.model_selection import KFold from sklearn.model_selection import cross_val_score from sklearn.metrics import classification_report from sklearn.metrics import confusion_matrix from sklearn.metrics import accuracy_score from sklearn.linear_model import LogisticRegression from sklearn.tree import DecisionTreeClassifier from sklearn.neighbors import KNeighborsClassifier from sklearn.discriminant_analysis import LinearDiscriminantAnalysis from sklearn.naive_bayes import GaussianNB from sklearn.svm import SVC from sklearn import metrics # find path to your RetailMart.xlsx dataset = pd.read_excel(open('C:/Users/craigrshenton/Desktop/Dropbox/excel_data_sci/ch06/RetailMart.xlsx','rb'), sheetname=0) dataset = dataset.drop('Unnamed: 17', 1) # drop empty col dataset.rename(columns={'PREGNANT':'Pregnant'}, inplace=True) dataset.rename(columns={'Home/Apt/ PO Box':'Residency'}, inplace=True) # add simpler col name dataset.columns = [x.strip().replace(' ', '_') for x in dataset.columns] # python does not like spaces in var names # shape print(dataset.shape) # types print(dataset.dtypes) # head dataset.head() # feature distribution print(dataset.groupby('Implied_Gender').size()) # target distribution print(dataset.groupby('Pregnant').size()) # correlation r = dataset.corr(method='pearson') id_matrix = np.identity(r.shape[0]) # create identity matrix r = r-id_matrix # remove same-feature correlations np.where( r > 0.7 ) # dummify gender variable dummy_gender = pd.get_dummies(dataset['Implied_Gender'], prefix='Gender') print(dummy_gender.head()) # dummify residency variable dummy_resident = pd.get_dummies(dataset['Residency'], prefix='Resident') print(dummy_resident.head()) # Drop catagorical variables dataset = dataset.drop('Implied_Gender', 1) dataset = dataset.drop('Residency', 1) # Add dummy variables dataset = pd.concat([dummy_gender.ix[:, 'Gender_M':],dummy_resident.ix[:, 'Resident_H':],dataset], axis=1) dataset.head() # Make clean dataframe for regression model array = dataset.values n_features = len(array[0]) X = array[:,0:n_features-1] # features y = array[:,n_features-1] # target # Split-out validation dataset validation_size = 0.20 seed = 7 X_train, X_validation, Y_train, Y_validation = train_test_split(X, y, test_size=validation_size, random_state=seed) # Spot-Check Algorithms models = [] models.append(('LR', LogisticRegression())) models.append(('LDA', LinearDiscriminantAnalysis())) models.append(('KNN', KNeighborsClassifier())) models.append(('CART', DecisionTreeClassifier())) models.append(('NB', GaussianNB())) models.append(('SVM', SVC())) # evaluate each model in turn results = [] names = [] for name, model in models: kfold = KFold(n_splits=10, random_state=seed) cv_results = cross_val_score(model, X_train, Y_train, cv=kfold, scoring='accuracy') results.append(cv_results) names.append(name) msg = "%s: %f (%f)" % (name, cv_results.mean(), cv_results.std()) print(msg) # Compare Algorithms fig = plt.figure() fig.suptitle('Algorithm Comparison') ax = fig.add_subplot(111) plt.boxplot(results) ax.set_xticklabels(names) plt.show() lda = LinearDiscriminantAnalysis() lda.fit(X_train, Y_train) predictions = lda.predict(X_validation) print(accuracy_score(Y_validation, predictions)) print(confusion_matrix(Y_validation, predictions)) print(classification_report(Y_validation, predictions)) # predict probability of survival y_pred_prob = lda.predict_proba(X_validation)[:, 1] # plot ROC curve fpr, tpr, thresholds = metrics.roc_curve(Y_validation, y_pred_prob) plt.plot(fpr, tpr) plt.plot([0, 1], [0, 1], color='navy', linestyle='--') plt.xlim([-0.05, 1.0]) plt.ylim([0.0, 1.05]) plt.gca().set_aspect('equal', adjustable='box') plt.xlabel('False Positive Rate (1 - Specificity)') plt.ylabel('True Positive Rate (Sensitivity)') plt.show() # calculate AUC print(metrics.roc_auc_score(Y_validation, y_pred_prob)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: b) Load dataset Step2: The 'Pregnant' column can only take on one of two (in this case) possabilities. Here 1 = pregnant, and 0 = not pregnant Step3: We can see no features with significant correlation coefficents (i.e., $r$ values > 0.7) Step4: 4. Evaluate Algorithms Step5: b) Spot Check Algorithms Step6: c) Select The Best Model Step7: 5. Make predictions on validation dataset
5,266
<ASSISTANT_TASK:> Python Code: # Import the library we need, which is Pandas and Matplotlib import pandas as pd import numpy as np import matplotlib.pyplot as plt %matplotlib inline # Set some parameters to get good visuals - style to ggplot and size to 15,10 plt.style.use('ggplot') plt.rcParams['figure.figsize'] = (15, 10) # Read the csv file of Monthwise Quantity and Price csv file we have. df = pd.read_csv('MonthWiseMarketArrivals_clean.csv') # Changing the date column to a Time Interval columnn df.date = pd.DatetimeIndex(df.date) # Change the index to the date column df.index = pd.PeriodIndex(df.date, freq='M') # Sort the data frame by date df = df.sort_values(by = "date") df.head() dfBang = df[df.city == 'BANGALORE'] dfBang.head() dfBang.plot(kind = "scatter", x = "quantity", y = "priceMod", s = 100) dfBang.plot(kind = "scatter", x = "quantity", y = "priceMod", s = 100, alpha = 0.7, xlim = [0,2000000]) dfBang.corr() pd.set_option('precision', 2) dfBang.corr() from pandas.tools.plotting import scatter_matrix scatter_matrix(dfBang, figsize=(15, 15), diagonal='kde', s = 50) import statsmodels.api as sm x = dfBang.quantity y = dfBang.priceMod lm = sm.OLS(y, x).fit() lm.summary() # Import seaborn library for more funcitionality import seaborn as sns # We can try and fit a linear line to the data to see if there is a relaltionship sns.regplot(x="quantity", y="priceMod", data=dfBang); sns.jointplot(x="quantity", y="priceMod", data=dfBang, kind="reg"); # Set some parameters to get good visuals - style to ggplot and size to 15,10 plt.style.use('ggplot') plt.rcParams['figure.figsize'] = (15, 10) dfBang.index = pd.DatetimeIndex(dfBang.date) dfBang.head() # Let us create a time series variable for priceMin ts = dfBang.priceMin ts.plot() # We take the log transform to reduce the impact of high values ts_log = np.log(ts) ts_log.plot() # One approach to remove the trend and seasonality impact is to take the difference between each observation ts_log_diff = ts_log - ts_log.shift() ts_log_diff.plot() ts_log.plot() # For smoothing the values we can use # 12 month Moving Averages ts_log_diff_ma = pd.rolling_mean(ts_log_diff, window = 12) # Simple Exponential Smoothing ts_log_diff_exp = pd.ewma(ts_log_diff, halflife=24) ts_log_diff_ma.plot() ts_log_diff_exp.plot() ts_log_diff.plot() from statsmodels.tsa.arima_model import ARIMA model = ARIMA(ts_log, order=(0, 1, 2)) results_MA = model.fit(disp=-1) plt.plot(ts_log_diff) plt.plot(results_MA.fittedvalues, color='blue') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Question 3 Step2: PRINCIPLE Step3: PRINCIPLE Step4: PRINCIPLE Step5: Question 4 Step6: Now we can fit an ARIMA model on this (Explaining ARIMA is out of scope of this workshop)
5,267
<ASSISTANT_TASK:> Python Code: lista_de_numeros = [1, 6, 3, 9, 5, 2] lista_ordenada = sorted(lista_de_numeros) print lista_ordenada print lista_de_numeros lista_de_numeros = [1, 6, 3, 9, 5, 2] print sorted(lista_de_numeros, reverse=True) def crear_curso(): curso = [ {'nombre': 'Rodriguez, Carlos', 'nota': 6, 'padron': 98128}, {'nombre': 'Perez, Lucas', 'nota': 6, 'padron': 93453}, {'nombre': 'Gonzalez, Ramiro', 'nota': 8, 'padron': 93716}, {'nombre': 'Gonzalez, Carlos', 'nota': 6, 'padron': 90464}, {'nombre': 'Lopez, Carlos', 'nota': 7, 'padron': 98569} ] return curso def imprimir_curso(lista): for idx, x in enumerate(lista): msg = ' {pos:2}. {padron} - {nombre}: {nota}' print msg.format(pos=idx, **x) def obtener_padron(alumno): return alumno['padron'] curso = crear_curso() print 'La lista tiene los alumnos:' imprimir_curso(curso) lista_ordenada = sorted(curso, key=obtener_padron) print 'Y la lista ordenada por padrón:' imprimir_curso(lista_ordenada) lista = [11, 4, 6, 1, 3, 5, 7] if 3 in lista: print '3 esta en la lista' else: print '3 no esta en la lista' if 15 in lista: print '15 esta en la lista' else: print '15 no esta en la lista' lista = [11, 4, 6, 1, 3, 5, 7] if 3 not in lista: print '3 NO esta en la lista' else: print '3 SI esta en la lista' lista = [11, 4, 6, 1, 3, 5, 7] pos = lista.index(3) print 'El 3 se encuentra en la posición', pos pos = lista.index(15) print 'El 15 se encuentra en la posición', pos curso = crear_curso() print 'La lista tiene los alumnos:' imprimir_curso(curso) alumno_93716 = (alumno for alumno in curso if alumno['padron'] == 93716).next() print 'El alumno de padron 93716 se llama {nombre}'.format(**alumno_93716) help("lambda") mi_funcion = lambda x, y: x+y resultado = mi_funcion(1, 2) print resultado print type(mi_funcion) def mi_funcion2(x, y): return x + y resultado = mi_funcion2(1, 2) print resultado print type(mi_funcion2) curso = crear_curso() print 'Curso original' imprimir_curso(curso) lista_ordenada = sorted(curso, key=lambda alumno: (-alumno['nota'], alumno['padron'])) print 'Curso ordenado' imprimir_curso(lista_ordenada) print 1/0 dividendo = 10 divisor = '0' print 'Intentare hacer la división de {}/{}'.format(dividendo, divisor) try: resultado = dividendo / divisor print resultado except ZeroDivisionError: print 'No se puede hacer la división ya que el divisor es 0.' except TypeError: print 'Alguno de los parametros no es un número' print 'Algo' def dividir(x, y): return x/y def regla_de_tres(x, y, z): return dividir(z*y, x) # Si de 28 alumnos, aprobaron 15, el porcentaje de aprobados es de... porcentaje_de_aprobados = regla_de_tres(28, 15, 100) print 'Porcentaje de aprobados: {0:.2f}%'.format(porcentaje_de_aprobados) resultado = regla_de_tres(0, 13, 100) print 'Porcentaje de aprobados: {0:.2f}%'.format(resultado) def dividir(x, y): return x/y def regla_de_tres(x, y, z): resultado = 0 try: resultado = dividir(z*y, x) except ZeroDivisionError: print 'No se puede calcular la regla de tres ' \ 'porque el divisor es 0' return resultado print regla_de_tres(0, 1, 2) def dividir(x, y): return x/y def regla_de_tres(x, y, z): return dividir(z*y, x) try: print regla_de_tres(0, 1, 2) except ZeroDivisionError: print 'No se puede calcular la regla de tres ' \ 'porque el divisor es 0' def dividir_numeros(x, y): try: resultado = x/y print 'El resultado es: %s' % resultado except ZeroDivisionError: print 'ERROR: Ha ocurrido un error por dividir por 0' dividir_numeros(1, 0) dividir_numeros(10, 2) dividir_numeros("10", 2) def dividir_numeros(x, y): try: resultado = x/y print 'El resultado es: %s' % resultado except TypeError: print 'ERROR: Ha ocurrido un error por mezclar tipos de datos' except ZeroDivisionError: print 'ERROR: Ha ocurrido un error de división por cero' except Exception: print 'ERROR: Ha ocurrido un error inesperado' dividir_numeros(1, 0) dividir_numeros(10, 2) dividir_numeros("10", 2) def dividir_numeros(x, y): try: resultado = x/y print 'El resultado es: %s' % resultado except (ZeroDivisionError, TypeError): print 'ERROR: No se puede calcular la división' dividir_numeros(1, 0) dividir_numeros(10, 2) dividir_numeros("10", 2) try: print 1/0 except ZeroDivisionError: print 'Ha ocurrido un error de división por cero' try: print 1/0 except Exception: print 'Ha ocurrido un error inesperado' def dividir_numeros(x, y): try: resultado = x/y print 'El resultado es {}'.format(resultado) except ZeroDivisionError: print 'Error: División por cero' else: print 'Este mensaje se mostrará sólo si no ocurre ningún error' finally: print 'Este bloque de código se muestra siempre' dividir_numeros(1, 0) print '-------------' dividir_numeros(10, 2) def dividir_numeros(x, y): try: resultado = x/y print 'El resultado es {}'.format(resultado) except ZeroDivisionError: print 'Error: División por cero' else: print 'Ahora hago que ocurra una excepción' print 1/0 finally: print 'Este bloque de código se muestra siempre' dividir_numeros(1, 0) print '-------------' dividir_numeros(10, 2) def dividir_numeros(x, y): if y == 0: raise Exception('Error de división por cero') resultado = x/y print 'El resultado es {0}'.format(resultado) try: dividir_numeros(1, 0) except ZeroDivisionError as e: print 'ERROR: División por cero' except Exception as e: print 'ERROR: ha ocurrido un error del tipo Exception' print '----------' dividir_numeros(1, 0) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Pero, ¿y cómo hacemos para ordenarla de mayor a menor?. <br> Step2: ¿Y si lo que quiero ordenar es una lista de registros?. <br> Step3: Búsquedas en listas Step4: También es muy fácil saber si un elemento no esta en la lista Step5: En cambio, si lo que queremos es saber es dónde se encuentra el número 3 en la lista es Step6: Ahora, para todos estos casos lo que hice fue buscar un elemento completo, es decir, que tenía que conocer todo lo que buscaba y no sólamente una parte, como podría ser el padrón de un alumno. Step7: Funciones anónimas Step8: Si bien no son funciones que se usen todos los días, se suelen usar cuando una función recibe otra función como parámetro (las funciones son un tipo de dato, por lo que se las pueden asignar a variables, y por lo tanto, también pueden ser parámetros). Step9: Excepciones Step10: Pero no hay que tenerle miedo a las excepciones, sólo hay que tenerlas en cuenta y controlarlas en el caso de que ocurran Step11: Pero supongamos que implementamos la regla de tres de la siguiente forma Step12: En cambio, si le pasamos 0 en el lugar de x Step13: Acá podemos ver todo el traceback o stacktrace, que son el cómo se fueron llamando las distintas funciones entre sí hasta que llegamos al error. <br> Step14: Pero en este caso igual muestra 0, por lo que si queremos, podemos poner los try/except incluso más arriba en el stacktrace Step15: Todos los casos son distintos y no hay UN lugar ideal dónde capturar la excepción; es cuestión del desarrollador decidir dónde conviene ponerlo para cada problema. Step16: En esos casos podemos capturar más de una excepción de la siguiente forma Step17: Incluso, si queremos que los dos errores muestren el mismo mensaje podemos capturar ambas excepciones juntas Step18: Jerarquía de excepciones Step19: Y también como Step20: Si bien siempre se puede poner Exception en lugar del tipo de excepción que se espera, no es una buena práctica de programación ya que se pueden esconder errores indeseados. Por ejemplo, un error de sintaxis. Step21: Pero entonces, ¿por qué no poner ese código dentro del try-except?. Porque tal vez no queremos capturar con las cláusulas except lo que se ejecute en ese bloque de código Step22: Lanzar excepciones
5,268
<ASSISTANT_TASK:> Python Code: import os import numpy as np import pandas as pd import tensorflow as tf # read data from file data = pd.read_csv('data/train.csv') print(data.info()) # fill nan values with 0 data = data.fillna(0) # convert ['male', 'female'] values of Sex to [1, 0] data['Sex'] = data['Sex'].apply(lambda s: 1 if s == 'male' else 0) # 'Survived' is the label of one class, # add 'Deceased' as the other class data['Deceased'] = data['Survived'].apply(lambda s: 1 - s) # select features and labels for training dataset_X = data[['Sex', 'Age', 'Pclass', 'SibSp', 'Parch', 'Fare']] dataset_Y = data[['Deceased', 'Survived']] print(dataset_X) print(dataset_Y) from sklearn.model_selection import train_test_split # split training data and validation set data X_train, X_val, y_train, y_val = train_test_split(dataset_X.as_matrix(), dataset_Y.as_matrix(), test_size=0.2, random_state=42) # 声明输入数据占位符 # shape参数的第一个元素为None,表示可以同时放入任意条记录 X = tf.placeholder(tf.float32, shape=[None, 6], name='input') y = tf.placeholder(tf.float32, shape=[None, 2], name='label') # 声明变量 weights = tf.Variable(tf.random_normal([6, 2]), name='weights') bias = tf.Variable(tf.zeros([2]), name='bias') y_pred = tf.nn.softmax(tf.matmul(X, weights) + bias) # 使用交叉熵作为代价函数 cross_entropy = - tf.reduce_sum(y * tf.log(y_pred + 1e-10), reduction_indices=1) # 批量样本的代价值为所有样本交叉熵的平均值 cost = tf.reduce_mean(cross_entropy) # 使用随机梯度下降算法优化器来最小化代价,系统自动构建反向传播部分的计算图 train_op = tf.train.GradientDescentOptimizer(0.001).minimize(cost) # 计算准确率 correct_pred = tf.equal(tf.argmax(y, 1), tf.argmax(y_pred, 1)) acc_op = tf.reduce_mean(tf.cast(correct_pred, tf.float32)) with tf.Session() as sess: # variables have to be initialized at the first place tf.global_variables_initializer().run() # training loop for epoch in range(10): total_loss = 0. for i in range(len(X_train)): # prepare feed data and run feed_dict = {X: [X_train[i]], y: [y_train[i]]} _, loss = sess.run([train_op, cost], feed_dict=feed_dict) total_loss += loss # display loss per epoch print('Epoch: %04d, total loss=%.9f' % (epoch + 1, total_loss)) print 'Training complete!' # Accuracy calculated by TensorFlow accuracy = sess.run(acc_op, feed_dict={X: X_val, y: y_val}) print("Accuracy on validation set: %.9f" % accuracy) # Accuracy calculated by NumPy pred = sess.run(y_pred, feed_dict={X: X_val}) correct = np.equal(np.argmax(pred, 1), np.argmax(y_val, 1)) numpy_accuracy = np.mean(correct.astype(np.float32)) print("Accuracy on validation set (numpy): %.9f" % numpy_accuracy) # 训练步数记录 global_step = tf.Variable(0, name='global_step', trainable=False) # 存档入口 saver = tf.train.Saver() # 在Saver声明之后定义的变量将不会被存储 # non_storable_variable = tf.Variable(777) ckpt_dir = './ckpt_dir' if not os.path.exists(ckpt_dir): os.makedirs(ckpt_dir) with tf.Session() as sess: tf.global_variables_initializer().run() # 加载模型存档 ckpt = tf.train.get_checkpoint_state(ckpt_dir) if ckpt and ckpt.model_checkpoint_path: print('Restoring from checkpoint: %s' % ckpt.model_checkpoint_path) saver.restore(sess, ckpt.model_checkpoint_path) start = global_step.eval() for epoch in range(start, start + 10): total_loss = 0. for i in range(0, len(X_train)): feed_dict = { X: [X_train[i]], y: [y_train[i]] } _, loss = sess.run([train_op, cost], feed_dict=feed_dict) total_loss += loss print('Epoch: %04d, loss=%.9f' % (epoch + 1, total_loss)) # 模型存档 global_step.assign(epoch).eval() saver.save(sess, ckpt_dir + '/logistic.ckpt', global_step=global_step) print('Training complete!') ################################ # Constructing Dataflow Graph ################################ # arguments that can be set in command line tf.app.flags.DEFINE_integer('epochs', 10, 'Training epochs') tf.app.flags.DEFINE_integer('batch_size', 10, 'size of mini-batch') FLAGS = tf.app.flags.FLAGS with tf.name_scope('input'): # create symbolic variables X = tf.placeholder(tf.float32, shape=[None, 6]) y_true = tf.placeholder(tf.float32, shape=[None, 2]) with tf.name_scope('classifier'): # weights and bias are the variables to be trained weights = tf.Variable(tf.random_normal([6, 2])) bias = tf.Variable(tf.zeros([2])) y_pred = tf.nn.softmax(tf.matmul(X, weights) + bias) # add histogram summaries for weights, view on tensorboard tf.summary.histogram('weights', weights) tf.summary.histogram('bias', bias) # Minimise cost using cross entropy # NOTE: add a epsilon(1e-10) when calculate log(y_pred), # otherwise the result will be -inf with tf.name_scope('cost'): cross_entropy = - tf.reduce_sum(y_true * tf.log(y_pred + 1e-10), reduction_indices=1) cost = tf.reduce_mean(cross_entropy) tf.summary.scalar('loss', cost) # use gradient descent optimizer to minimize cost train_op = tf.train.GradientDescentOptimizer(0.001).minimize(cost) with tf.name_scope('accuracy'): correct_pred = tf.equal(tf.argmax(y_true, 1), tf.argmax(y_pred, 1)) acc_op = tf.reduce_mean(tf.cast(correct_pred, tf.float32)) # Add scalar summary for accuracy tf.summary.scalar('accuracy', acc_op) global_step = tf.Variable(0, name='global_step', trainable=False) # use saver to save and restore model saver = tf.train.Saver() # this variable won't be stored, since it is declared after tf.train.Saver() non_storable_variable = tf.Variable(777) ckpt_dir = './ckpt_dir' if not os.path.exists(ckpt_dir): os.makedirs(ckpt_dir) ################################ # Training the model ################################ # use session to run the calculation with tf.Session() as sess: # create a log writer. run 'tensorboard --logdir=./logs' writer = tf.summary.FileWriter('./logs', sess.graph) merged = tf.summary.merge_all() # variables have to be initialized at the first place tf.global_variables_initializer().run() # restore variables from checkpoint if exists ckpt = tf.train.get_checkpoint_state(ckpt_dir) if ckpt and ckpt.model_checkpoint_path: print('Restoring from checkpoint: %s' % ckpt.model_checkpoint_path) saver.restore(sess, ckpt.model_checkpoint_path) start = global_step.eval() # training loop for epoch in range(start, start + FLAGS.epochs): total_loss = 0. for i in range(0, len(X_train), FLAGS.batch_size): # train with mini-batch feed_dict = { X: X_train[i: i + FLAGS.batch_size], y_true: y_train[i: i + FLAGS.batch_size] } _, loss = sess.run([train_op, cost], feed_dict=feed_dict) total_loss += loss # display loss per epoch print('Epoch: %04d, loss=%.9f' % (epoch + 1, total_loss)) summary, accuracy = sess.run([merged, acc_op], feed_dict={X: X_val, y_true: y_val}) writer.add_summary(summary, epoch) # Write summary print('Accuracy on validation set: %.9f' % accuracy) # set and update(eval) global_step with epoch global_step.assign(epoch).eval() saver.save(sess, ckpt_dir + '/logistic.ckpt', global_step=global_step) print('Training complete!') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 2. 预处理 Step2: 3. 将训练数据切分为训练集(training set)和验证集(validation set) Step3: 二、构建计算图 Step4: 2. 声明参数变量 Step5: 3. 构造前向传播计算图 Step6: 4. 声明代价函数 Step7: NOTE Step8: 6. (optional) 计算准确率 Step9: 三、构建训练迭代 & 执行训练 Step10: 四、存储和加载模型参数 Step11: TensorBoard
5,269
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt import networkx as nx G=nx.DiGraph() G.add_edge('sex','height',weight=0.6) nx.draw_networkx(G, node_color='y',node_size=2000, width=3) plt.axis('off') plt.show() import numpy as np import pandas as pd import csv import json from libpgm.graphskeleton import GraphSkeleton from libpgm.nodedata import NodeData from libpgm.discretebayesiannetwork import DiscreteBayesianNetwork from libpgm.tablecpdfactorization import TableCPDFactorization from libpgm.pgmlearner import PGMLearner titanic = pd.DataFrame.from_csv("./data/titanic3.csv", index_col = None) titanic.head() titanic.describe() ptable = pd.pivot_table(titanic, values=["name"], columns=["survived", "pclass","sex"], aggfunc=lambda x: len(x.unique()), margins=True) print ptable # housekeeping # libpgm needs data as node:value list for each row with open("./data/titanic3.csv") as f: rdr = csv.reader(f, ) headers = next(rdr, None) data = [{k:float(v) for k,v in zip(headers, row) if k !="name"} for row in rdr] headers.remove("name") # not going to model survival based on name #print data pgn = { "V": headers, "E": [["age", "pclass"], ["sex", "survived"], ["pclass", "survived"]], "Vdata": None } # print pgn G=nx.DiGraph() for f,t in pgn["E"]: G.add_edge(f,t) nx.draw_networkx(G, node_color='y',node_size=2000, width=3) plt.axis('off') plt.show() skel = GraphSkeleton() skel.V = pgn["V"] skel.E = pgn["E"] skel.toporder() learner = PGMLearner() result = learner.discrete_mle_estimateparams(skel, data) pd.DataFrame(result.Vdata["sex"]["cprob"]).transpose() pd.DataFrame(result.Vdata["age"]["cprob"]).transpose() pd.DataFrame(result.Vdata["pclass"]["cprob"]).transpose() # use our solutions from above nd = NodeData() nd.Vdata = result.Vdata nd.alldata = None bn = DiscreteBayesianNetwork(skel, nd) # query alters tables tcpd = TableCPDFactorization(bn) print "What is p(male=0)? {:.3%}".format( tcpd.specificquery(dict(sex=[1]), dict()) ) tcpd = TableCPDFactorization(bn) print "What is p(female=1)? {:.3%}".format( tcpd.specificquery(dict(sex=[0]), dict()) ) # query alters tables tcpd = TableCPDFactorization(bn) print "What is p(female=1,survived=1)? {:.3%}".format( tcpd.specificquery(dict(sex=[1]), dict(survived=1)) ) # query alters tables tcpd = TableCPDFactorization(bn) print "What is p(male=0,survived=0)? {:.3%}".format( tcpd.specificquery(dict(sex=[0]), dict(survived=0)) ) # query alters tables tcpd = TableCPDFactorization(bn) print "What is p(male=0,class=3,survived=0)? {:.3%}".format( tcpd.specificquery(dict(sex=[0],pclass=[3.0]), dict(survived=0)) ) # maybe useful for comparison pd.pivot_table(titanic, values=["name"], columns=["sex", "pclass","survived"], aggfunc=lambda x: len(x.unique())) # instantiate my learner learner = PGMLearner() # estimate structure result = learner.lg_constraint_estimatestruct(data, indegree=1) # output print json.dumps(result.E, indent=2) print json.dumps(result.V, indent=2) G=nx.DiGraph() for f,t in result.E: G.add_edge(f,t,weight=0.6) nx.draw_networkx(G, node_color='y',node_size=2000, width=3) plt.axis('off') plt.show() skel = GraphSkeleton() skel.V = result.V skel.E = result.E skel.toporder() learner = PGMLearner() result = learner.discrete_mle_estimateparams(skel, data) nd = NodeData() nd.Vdata = result.Vdata nd.alldata = None bn = DiscreteBayesianNetwork(skel, nd) # query alters tables tcpd = TableCPDFactorization(bn) print "What is p(male=0)? {:.3%}".format( tcpd.specificquery(dict(sex=[1]), dict()) ) tcpd = TableCPDFactorization(bn) print "What is p(female=1)? {:.3%}".format( tcpd.specificquery(dict(sex=[0]), dict()) ) # query alters tables tcpd = TableCPDFactorization(bn) print "What is p(female=1,survived=1)? {:.3%}".format( tcpd.specificquery(dict(sex=[1]), dict(survived=1)) ) # query alters tables tcpd = TableCPDFactorization(bn) print "What is p(male=0,survived=0)? {:.3%}".format( tcpd.specificquery(dict(sex=[0]), dict(survived=0)) ) # query alters tables tcpd = TableCPDFactorization(bn) print "What is p(male=0,class=3,survived=0)? {:.3%}".format( tcpd.specificquery(dict(sex=[0],pclass=[3.0]), dict(survived=0)) ) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Why is this formalism a useful probabalistic problem solving tool? Step2: And now, for some data Step3: A pivot table might give another useful summary Step4: Learn Parameters of Graph Model give Data Step5: Some choices Step6: Now the nodes have conditional probability information stored in them. For example, Step7: Now let's look at a downstream node. Step8: Causal Reasoning Step9: Learn Graph Structure Step10: different model, so learn new parameters Step11: Queries with New Model
5,270
<ASSISTANT_TASK:> Python Code: editdist_sp = [ (sp1,sp2,editdistance.eval(sp1,sp2)) for sp1,sp2 in itertools.combinations(read_annot["species_fillna"].unique(),2) ] editdist_df = pd.DataFrame.from_records(editdist_sp,columns=["sp1","sp2","edit_distance"]) editdist_df["similarity"] = editdist_df.apply(lambda r: (max(len(r["sp1"]),len(r["sp2"]))-r["edit_distance"])/ max(len(r["sp1"]),len(r["sp2"])),axis=1) editdist_df.head() cluster_membership = {} clusters = [] #Single linkage clustering for _,row in editdist_df[editdist_df.similarity > 0.65 ].sort_values("similarity",ascending=False).iterrows(): if row["sp1"] not in cluster_membership and row["sp2"] not in cluster_membership: #Create new cluster and add them both clusters.append([row["sp1"],row["sp2"]]) cluster_membership[row["sp1"]] = len(clusters)-1 cluster_membership[row["sp2"]] = len(clusters)-1 elif row["sp1"] in cluster_membership: if row["sp2"] not in cluster_membership: #Add sp2 to sp1 cluster clusters[cluster_membership[row["sp1"]]].append(row["sp2"]) cluster_membership[row["sp2"]] = cluster_membership[row["sp1"]] else: if cluster_membership[row["sp1"]] != cluster_membership[row["sp2"]]: #Combine clusters! c1_pos = cluster_membership[row["sp1"]] c2_pos = cluster_membership[row["sp2"]] clusters[c1_pos] += clusters[c2_pos] for c in clusters[c2_pos]: cluster_membership[c] = c1_pos clusters[c2_pos] = None else: #Row 2 is in cluster and row1 is not clusters[cluster_membership[row["sp2"]]].append(row["sp1"]) cluster_membership[row["sp1"]] = cluster_membership[row["sp2"]] cluster_names = [";".join(c) if c else None for c in clusters] read_annot["sp_group"] = read_annot["species_fillna"].apply(lambda x: cluster_names[cluster_membership[x]] if x in cluster_membership and "unclassified" not in x else x) df_counts = read_annot.groupby("sp_group").size().reset_index() df_counts.columns = ["species","read_count"] print(df_counts[df_counts.read_count >= 2].shape) df_counts[df_counts.read_count >= 2].sort_values("read_count",ascending=False) virus_count_histogram = df_counts[df_counts.read_count >= 3].groupby("read_count").size().reset_index() sns.barplot(x=virus_count_histogram["read_count"],y=virus_count_histogram[0]) df_counts[df_counts.read_count >= 2].sort_values("read_count",ascending=False).to_csv("454_seqs_kaiju_greedy.filt_species.tsv",sep="\t",index=False) !ls <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Use new clade groups
5,271
<ASSISTANT_TASK:> Python Code: regimen = clinical['Regimen Type'].ix[pts].dropna() print regimen.value_counts() regimen = regimen[regimen.map(regimen.value_counts()) > 10] regimen = regimen.ix[pts].fillna('Other') regimen = regimen.str.replace(' Based','') regimen = regimen.ix[ti(duration != 'Control')] regimen.value_counts() adherence = clinical['adherence %'].ix[pts].dropna() paofi = clinical['paofi total'].ix[pts].dropna() beck = clinical['beck total'].ix[pts].dropna() iadl = clinical.IADL.ix[pts].dropna() age.name = 'Age (years)' bmi.name = 'BMI' control_color = (0.2980392156862745, 0.4470588235294118, 0.6901960784313725) hiv_color = (0.3333333333333333, 0.6588235294117647, 0.40784313725490196) sns.set_style(rc={'font.family': 'sans-serif', 'font.sans-serif': ['Arial'], 'font.size': 14}) fig, axs = subplots(4,2, figsize=(8, 10)) sns.violinplot(age, hiv, inner='None', ax=axs[0][0], order=['HIV-','HIV+']) axs[0][0].set_yticks([0,20,40,60,80]) sns.violinplot(bmi, hiv, inner='None', ax=axs[0][1], order=['HIV-','HIV+']) duration_m.hist(ax=axs[1][0], color=hiv_color) axs[1][0].set_xlabel('Estimated HIV duration (months)') sns.barplot(stage.dropna(), ax=axs[1][1], color=hiv_color) o = [u'PI/NRTI', u'NNRTI/NRTI', u'3-class','Other'] sns.barplot(regimen, ax=axs[2][0], x_order=o, color=hiv_color) adherence.dropna().hist(ax=axs[2][1], color=hiv_color, bins=15) axs[2][1].set_xlabel('Drug adherence (%)') beck.dropna().hist(ax=axs[3][0], color=hiv_color) axs[3][0].set_xlabel('Beck depression inventory') paofi.dropna().hist(ax=axs[3][1], color=hiv_color) axs[3][1].set_xlabel('PAOFI') letters = list(map(chr, range(97, 123)))[:8] for i,ax in enumerate(axs.flatten()): ax.text(-0.15, 1.15, letters[i].upper(), transform=ax.transAxes, fontsize=20, fontweight='bold', va='top', ha='right') if i > 1: ax.set_ylabel('No. of patients') prettify_ax(ax) fig.tight_layout() fig.savefig(FIGDIR + 'sup_clinical_params.pdf') pd.crosstab(labs['LLQ PLASMA'], duration) fisher_exact_test(duration=='HIV Long', labs['LLQ PLASMA']=='>LLQ') c = ['LLQ PLASMA', 'PT', 'INR'] c = ['WBC','RBC','HGB','HCT','MCV','MCH','MCHC','Platelets'] fig, axs = subplots(4,2, figsize=(8,10)) axs = axs.flatten() for i,b in enumerate(c): labs[b].hist(ax=axs[i], color=hiv_color) axs[i].set_xlabel(b) axs[i].set_ylabel('No. of patients') prettify_ax(axs[i]) letters = list(map(chr, range(97, 123)))[8:] for i,ax in enumerate(axs.flatten()): ax.text(-0.15, 1.15, letters[i].upper(), transform=ax.transAxes, fontsize=20, fontweight='bold', va='top', ha='right') prettify_ax(ax) fig.tight_layout() fig.savefig(FIGDIR + 'sup_clinical_blood.pdf') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: LLQ
5,272
<ASSISTANT_TASK:> Python Code: import numpy as np import pandas as pd from IPython.display import Image def mean_squared_error(y_true, y_pred): calculate the mean_squared_error given a vector of true ys and a vector of predicted ys diff = y_true - y_pred return np.dot(diff, diff) / len(diff) def predict_test_values(model, X_train, y_train, X_test): model.fit(X_train, y_train) return model.predict(X_test) def calc_train_and_test_error(model, X_train, y_train, X_test, y_test): model.fit(X_train, y_train) y_pred_train = model.predict(X_train) y_pred_test = model.predict(X_test) return mean_squared_error(y_train, y_pred_train), mean_squared_error(y_test, y_pred_test) Image(url='http://radimrehurek.com/data_science_python/plot_bias_variance_examples_2.png') # Ridge Regression in scikit-learn from sklearn import linear_model model_ridge = linear_model.Ridge(alpha = .5) # once it's been fit, you can look at the learned beta values of the model with: model_ridge.coef_ # load overfitting data with np.load('data/overfitting_data.npz') as data: x_train = data['x_train'] y_train = data['y_train'] x_test = data['x_test'] y_test = data['y_test'] model_lr = linear_model.LinearRegression() model_ridge = linear_model.Ridge(alpha=1) print "Linear Regression Training and Test Errors:" print calc_train_and_test_error(model_lr, x_train, y_train, x_test, y_test) print print "Ridge Regression Training and Test Errors:" print calc_train_and_test_error(model_ridge, x_train, y_train, x_test, y_test) print print "Sum of Linear Regression Coefficients:" print np.sum(np.abs(model_lr.coef_)) print print "Sum of Ridge Regression Coefficients:" print np.sum(np.abs(model_ridge.coef_)) print ?linear_model.Ridge # LASSO in scikit-learn from sklearn import linear_model model_lasso = linear_model.Lasso(alpha = 0.5) # Write your code here model_lasso = linear_model.Lasso(alpha=1) print "Ridge Regression Training and Test Errors:" print calc_train_and_test_error(model_lasso, x_train, y_train, x_test, y_test) print print "Sum of Ridge Regression Coefficients:" print np.sum(np.abs(model_lasso.coef_)) print n_disp_coefs = 10 print 'Linear Regression Coefficients:' print model_lr.coef_[:n_disp_coefs] print print 'Ridge Regression Coefficients:' print model_ridge.coef_[:n_disp_coefs] print print 'LASSO Coefficients:' print model_lasso.coef_[:n_disp_coefs] print from sklearn import linear_model model_en = linear_model.ElasticNet(alpha=0.5, l1_ratio=0.1) # note: scikit learn's current implementation of ElasticNet isn't stable with l1_ratio <= 0.01 # Write your code here model_en = linear_model.ElasticNet(alpha=1, l1_ratio=0.5) print 'ElasticNet Errors:' print calc_train_and_test_error(model_en, x_train, y_train, x_test, y_test) print print 'Sum of ElasticNet Coefficients' print np.sum(np.abs(model_en.coef_)) print n_disp_coefs = 10 print 'ElasticNet Coefficients:' print model_en.coef_[:n_disp_coefs] print # a helper function for performing validation set cross validation from sklearn.cross_validation import train_test_split validation_portion = 0.1 seed = 1234 x_train_small, x_valid, y_train_small, y_valid = \ train_test_split(x_train, y_train, test_size=validation_portion, random_state=seed) print 'Original Training Set Size:' print x_train.shape, y_train.shape print print 'Reducted Training Set Size:' print x_train_small.shape, y_train_small.shape print print 'Validation Set Size:' print x_valid.shape, y_valid.shape print def validation_set_error(model, x_train, y_train, validation_portion=0.1, seed=1234): # FILL IN YOUR CODE HERE x_train_small, x_valid, y_train_small, y_valid = \ train_test_split(x_train, y_train, test_size=validation_portion, random_state=seed) model.fit(x_train_small, y_train_small) y_pred_valid = model.predict(x_valid) return mean_squared_error(y_valid, y_pred_valid) # set up models model_lr_valid = linear_model.LinearRegression() model_ridge_valid = linear_model.Ridge(alpha=10) # calculate errors valid_portion = .1 n_seeds = 5 print "Linear Regression Training and Test Errors:" # FILL IN YOUR CODE HERE print calc_train_and_test_error(model_lr_valid, x_train_small, y_train_small, x_test, y_test) print print "Linear Regression Validation Errors:" # FILL IN YOUR CODE HERE print validation_set_error(model_lr_valid, x_train, y_train, validation_portion=0.1, seed=1234) print for seed in range(n_seeds): print validation_set_error(model_lr_valid, x_train, y_train, validation_portion=valid_portion, seed=seed) print print "Ridge Regression Training and Test Errors:" # FILL IN YOUR CODE HERE print calc_train_and_test_error(model_ridge_valid, x_train_small, y_train_small, x_test, y_test) print print "Ridge Regression Validation Errors:" # FILL IN YOUR CODE HERE print validation_set_error(model_ridge_valid, x_train, y_train, validation_portion=0.1, seed=1234) print for seed in range(n_seeds): print validation_set_error(model_ridge_valid, x_train, y_train, validation_portion=valid_portion, seed=seed) print Image(url='https://chrisjmccormick.files.wordpress.com/2013/07/10_fold_cv.png') # scikit learn provides a useful object to help you perform kfold cross validation from sklearn.cross_validation import KFold n_data = len(y_train) fold_count = 0 for train_reduced_row_ids, valid_row_ids in KFold(n_data, n_folds=4): print print print "FOLD %d:" % fold_count print "-------" print("train_ids:\n%s\n\nvalid_ids\n%s" % (train_reduced_row_ids, valid_row_ids)) x_train_reduced = x_train[train_reduced_row_ids] y_train_reduced = y_train[train_reduced_row_ids] x_valid = x_train[valid_row_ids] y_valid = y_train[valid_row_ids] fold_count += 1 # NOTE: KFolds isn't random at all. It's important to shuffle your data first before using it. from sklearn.utils import shuffle x_train_shuffled, y_train_shuffled = shuffle(x_train, y_train) def kfold_error(model, x_train, y_train, k=4, seed=1234): # FILL IN YOUR CODE HERE # shuffle training data x_train_shuffled, y_train_shuffled = shuffle(x_train, y_train, random_state=seed) n_data = len(y_train) error_sum = 0 for train_reduced_row_ids, valid_row_ids in KFold(n_data, n_folds=k): x_train_reduced = x_train_shuffled[train_reduced_row_ids] y_train_reduced = y_train_shuffled[train_reduced_row_ids] x_valid = x_train_shuffled[valid_row_ids] y_valid = y_train_shuffled[valid_row_ids] model.fit(x_train_reduced, y_train_reduced) y_valid_pred = model.predict(x_valid) error_sum += mean_squared_error(y_valid, y_valid_pred) return error_sum*1.0 / k # set up models model_lr_valid = linear_model.LinearRegression() model_ridge_valid = linear_model.Ridge(alpha=10) # calculate errors n_seeds = 3 k = 5 print "Linear Regression Training and Test Errors:" # FILL IN YOUR CODE HERE print calc_train_and_test_error(model_lr_valid, x_train, y_train, x_test, y_test) print print "Linear Regression K-Fold Errors:" # FILL IN YOUR CODE HERE print for seed in range(n_seeds): print kfold_error(model_lr_valid, x_train, y_train, k=k, seed=seed) print print print "Ridge Regression Training and Test Errors:" # FILL IN YOUR CODE HERE print calc_train_and_test_error(model_ridge_valid, x_train, y_train, x_test, y_test) print print "Ridge Regression K-Fold Errors:" # FILL IN YOUR CODE HERE print for seed in range(n_seeds): print kfold_error(model_ridge_valid, x_train, y_train, k=k, seed=seed) print [np.nan] + [1,2] def model_name(model): s = model.__str__().lower() if "linearregression" in s: return 'LinearRegression' elif "lasso" in s: return 'Lasso(a=%g)' % model.alpha elif "ridge" in s: return 'Ridge(a=%g)' % model.alpha elif "elastic" in s: return 'ElasticNet(a=%g, r=%g)' % (model.alpha, model.l1_ratio) else: raise ValueError("Unknown Model Type") def create_models(alphas=(.01, .03, .1, .3, 1, 3), l1_ratios=(.7, .5, .3)): models = [linear_model.LinearRegression()] models.extend([linear_model.Ridge(a) for a in alphas]) models.extend([linear_model.Lasso(a) for a in alphas]) models.extend([linear_model.ElasticNet(a, l1_ratio=l) for a in alphas for l in l1_ratios]) return models def results_df(models, betas_true, x_train, y_train, x_test, y_test, k=4): n_data, n_dim = x_train.shape n_zeros = n_dim - len(betas_true) betas_true = np.concatenate([betas_true, np.zeros(n_zeros)]) # fit models to training data [m.fit(x_train, y_train) for m in models] betas = np.vstack([betas_true] + [m.coef_ for m in models]) beta_names = ['Beta ' + str(i) for i in range(n_dim)] # set up model names model_names = ["True Coefs"] + [model_name(m) for m in models] df = pd.DataFrame(data=betas, columns=beta_names, index=model_names) # calculate training errors y_preds = [m.predict(x_train) for m in models] errors = [np.nan] + [mean_squared_error(y_train, y_pred) for y_pred in y_preds] df['Train Error'] = errors # calculate validation errors errors = [np.nan] + [kfold_error(m, x_train, y_train, k=k) for m in models] df['Cross Validation Error'] = errors # calculate test errors y_preds = [m.predict(x_test) for m in models] errors = [np.nan] + [mean_squared_error(y_test, y_pred) for y_pred in y_preds] df['Test Error'] = errors return df # these are some of the magic parameters that I used to actually # generate the overfitting dataset n_dim = 598 n_dim_meaningful = 3 n_dim_disp_extra = 2 # the actual betas used to generate the y values. the rest were 0. betas_true = np.arange(n_dim_meaningful) + 1 # create a whole bunch of untrained models models = create_models(alphas=(.01, .03, .1, .3, 1), l1_ratios=(.9, .7, .5)) # all_results = results_df(models, betas_true, x_train, y_train, x_test, y_test, k=4) # decide which columns we want to display disp_cols = ["Beta " + str(i) for i in range(n_dim_meaningful + n_dim_disp_extra)] disp_cols += ['Train Error', 'Cross Validation Error', 'Test Error'] # display the results all_results[disp_cols] %matplotlib inline import matplotlib.pyplot as plt f = plt.figure() plt.scatter(all_results['Cross Validation Error'], all_results['Test Error']) plt.xlabel('Cross Validation Error') plt.ylabel('Test Error') f.set_size_inches(8, 8) plt.show() # scikit learn includes some functions for making cross validation easier # and computationally faster for a some models from sklearn import linear_model model_ridge_cv = linear_model.RidgeCV(alphas=[0.1, 1.0, 10.0]) model_lasso_cv = linear_model.LassoCV(alphas=[0.1, 1.0, 10.0]) model_en_cv = linear_model.ElasticNetCV(l1_ratio=[.9], n_alphas=100) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: Predictive Modeling Step3: The Central Theses of Machine Learning Step4: How to Fight Overfitting? Step5: <span style="color Step6: L1 Regularized Linear Regression Loss Function -- "LASSO" Step7: <span style="color Step8: L1 + L2 Regularized Linear Regression Loss Function -- "ElasticNet" Step9: <span style="color Step10: Cross Validation Step11: <span style="color Step12: K-Fold Cross Validation Step13: Good Step14: <span style="color Step15: Putting It All Together
5,273
<ASSISTANT_TASK:> Python Code: # Versão da Linguagem Python from platform import python_version print('Versão da Linguagem Python Usada Neste Jupyter Notebook:', python_version()) # Imprimindo números pares entre 50 e 101 for i in range(50, 101, 2): print(i) for i in range(3, 6): print (i) for i in range(0, -20, -2): print(i) lista = ['Morango', 'Banana', 'Abacaxi', 'Uva'] lista_tamanho = len(lista) for i in range(0, lista_tamanho): print(lista[i]) # Tudo em Python é um objeto type(range(0,3)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Range
5,274
<ASSISTANT_TASK:> Python Code: import essentia.standard as es from tempfile import TemporaryDirectory # Loading an audio file. audio = es.MonoLoader(filename='../../../test/audio/recorded/dubstep.flac')() # Compute beat positions and BPM. rhythm_extractor = es.RhythmExtractor2013(method="multifeature") bpm, beats, beats_confidence, _, beats_intervals = rhythm_extractor(audio) print("BPM:", bpm) print("Beat positions (sec.):", beats) print("Beat estimation confidence:", beats_confidence) # Mark beat positions in the audio and write it to a file. # Use beeps instead of white noise to mark them, as it is more distinctive. marker = es.AudioOnsetsMarker(onsets=beats, type='beep') marked_audio = marker(audio) # Write to an audio file in a temporary directory. temp_dir = TemporaryDirectory() es.MonoWriter(filename=temp_dir.name + '/dubstep_beats.flac')(marked_audio) import IPython IPython.display.Audio(temp_dir.name + '/dubstep_beats.flac') from pylab import plot, show, figure, imshow %matplotlib inline import matplotlib.pyplot as plt plt.rcParams['figure.figsize'] = (15, 6) plot(audio) for beat in beats: plt.axvline(x=beat*44100, color='red') plt.xlabel('Time (samples)') plt.title("Audio waveform and the estimated beat positions") show() peak1_bpm, peak1_weight, peak1_spread, peak2_bpm, peak2_weight, peak2_spread, histogram = \ es.BpmHistogramDescriptors()(beats_intervals) print("Overall BPM (estimated before): %0.1f" % bpm) print("First histogram peak: %0.1f bpm" % peak1_bpm) print("Second histogram peak: %0.1f bpm" % peak2_bpm) fig, ax = plt.subplots() ax.bar(range(len(histogram)), histogram, width=1) ax.set_xlabel('BPM') ax.set_ylabel('Frequency of occurrence') plt.title("BPM histogram") ax.set_xticks([20 * x + 0.5 for x in range(int(len(histogram) / 20))]) ax.set_xticklabels([str(20 * x) for x in range(int(len(histogram) / 20))]) plt.show() # Loading an audio file. audio = es.MonoLoader(filename='../../../test/audio/recorded/dubstep.flac')() # Compute BPM. bpm = es.PercivalBpmEstimator()(audio) print("BPM:", bpm) # Our input audio is indeed a well-cut loop. Let's compute the BPM. bpm = es.LoopBpmEstimator()(audio) print("Loop BPM:", bpm) !curl -SLO https://essentia.upf.edu/models/tempo/tempocnn/deeptemp-k16-3.pb import essentia.standard as es sr = 11025 audio_11khz = es.MonoLoader(filename='../../../test/audio/recorded/techno_loop.wav', sampleRate=sr)() global_bpm, local_bpm, local_probs = es.TempoCNN(graphFilename='deeptemp-k16-3.pb')(audio_11khz) print('song BPM: {}'.format(global_bpm)) import numpy as np duration = 5 # seconds audio_slice = audio_11khz[:sr * duration] plt.plot(audio_slice) markers = np.arange(0, len(audio_slice), sr / (global_bpm / 60)) for marker in markers: plt.axvline(x=marker, color='red') plt.title("Audio waveform on top of a tempo grid") show() print('local BPM: {}'.format(local_bpm)) print('local probabilities: {}'.format(local_probs)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: We can now listen to the resulting audio with the beats marked by beeps. We can also visualize beat estimations. Step2: BPM histogram Step3: BPM estimation with PercivalBpmEstimator Step4: BPM estimation for audio loops Step5: BPM estimation with TempoCNN Step6: We can plot a slice of the waveform on top of a grid with the estimated tempo to get visual verification Step7: TempoCNN operates on audio slices of 12 seconds with an overlap of 6 seconds by default. Additionally, the algorithm outputs the local estimations along with their probabilities. The global value is computed by majority voting by default. However, this method is only recommended when a constant tempo can be assumed.
5,275
<ASSISTANT_TASK:> Python Code: import pandas as pd qs = [(2, 0), (1, 1), (0, 2), (3, 0), (2, 1), (1, 2), (0, 3), (4, 0), (3, 1), (2, 2), (1, 3), (0, 4), ] index = pd.MultiIndex.from_tuples(qs, names=['Boys', 'Girls']) from scipy.stats import binom boys = index.to_frame()['Boys'] girls = index.to_frame()['Girls'] ps = binom.pmf(girls, boys+girls, 0.5) prior1 = pd.Series(ps, index, name='Prior') pd.DataFrame(prior1) ps = [30, 30, 30, 40, 40, 40, 40, 10, 10, 10, 10, 10] prior1 *= ps pd.DataFrame(prior1) import pandas as pd def make_table(prior, likelihood): Make a DataFrame representing a Bayesian update. table = pd.DataFrame(prior) table.columns = ['Prior'] table['Likelihood'] = likelihood table['Product'] = (table['Prior'] * table['Likelihood']) total = table['Product'].sum() table['Posterior'] = table['Product'] / total return table likelihood1 = prior1.index.to_frame()['Boys'] table1 = make_table(prior1, likelihood1) table1 from scipy.stats import binom ns = prior1.index.to_frame()['Girls'] p = 1 / 100 k = 1 likelihood2 = binom.pmf(k, ns, p) likelihood2 prior2 = table1['Posterior'] table2 = make_table(prior2, likelihood2) table2 ns = prior1.index.to_frame()['Girls'] - 1 ns.name = 'Additional sisters' neg = (ns < 0) ns[neg] = 0 pd.DataFrame(ns) p = 1 / 10 k = 1 likelihood3 = binom.sf(k-1, ns, p) likelihood3 prior3 = table2['Posterior'] table3 = make_table(prior3, likelihood3) table3 p = table3['Product'].sum() p 1/p <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: To compute the proportion of each type of family, I'll use Scipy to compute the binomial distribution. Step2: And put the results into a Pandas Series. Step3: But we also have the information frequencies of these families are proportional to 30%, 40%, and 10%, so we can multiply through. Step5: So that's the (unnormalized) prior. Step6: This function takes a prior and a likelihood and returns a DataFrame Step7: So that's what we should believe about the family after the first update. Step8: Here's the second update. Step9: Based on the sister named Mary, we can rule out families with no girls, and families with more than one girls are more likely. Step10: A convenient way to compute the total probability of an outcome is to do an update as if it happened, ignore the posterior probabilities, and compute the sum of the products. Step11: At this point, there are only three family types left standing, (1,2), (2,2), and (1,3). Step12: The Bayes factor
5,276
<ASSISTANT_TASK:> Python Code: import tensorflow as tf from tensorflow.python.client import timeline import pylab import numpy as np %matplotlib inline %config InlineBackend.figure_format = 'retina' tf.logging.set_verbosity(tf.logging.INFO) tf.reset_default_graph() num_samples = 100000 from datetime import datetime version = int(datetime.now().strftime("%s")) print(version) x_train = np.random.rand(num_samples).astype(np.float32) print(x_train) noise = np.random.normal(scale=0.01, size=len(x_train)) y_train = x_train * 0.1 + 0.3 + noise print(y_train) pylab.plot(x_train, y_train, '.') x_test = np.random.rand(len(x_train)).astype(np.float32) print(x_test) noise = np.random.normal(scale=0.01, size=len(x_train)) y_test = x_test * 0.1 + 0.3 + noise print(y_test) pylab.plot(x_train, y_train, '.') with tf.device("/cpu:0"): W = tf.get_variable(shape=[], name='weights') print(W) b = tf.get_variable(shape=[], name='bias') print(b) x_observed = tf.placeholder(shape=[None], dtype=tf.float32, name='x_observed') print(x_observed) with tf.device("/cpu:0"): y_pred = W * x_observed + b print(y_pred) with tf.device("/cpu:0"): y_observed = tf.placeholder(shape=[None], dtype=tf.float32, name='y_observed') print(y_observed) loss_op = tf.reduce_mean(tf.square(y_pred - y_observed)) optimizer_op = tf.train.GradientDescentOptimizer(0.025) train_op = optimizer_op.minimize(loss_op) print("loss:", loss_op) print("optimizer:", optimizer_op) print("train:", train_op) with tf.device("/cpu:0"): init_op = tf.global_variables_initializer() print(init_op) train_summary_writer = tf.summary.FileWriter('/root/tensorboard/linear/cpu/%s/train' % version, graph=tf.get_default_graph()) test_summary_writer = tf.summary.FileWriter('/root/tensorboard/linear/cpu/%s/test' % version, graph=tf.get_default_graph()) config = tf.ConfigProto( log_device_placement=True, ) print(config) sess = tf.Session(config=config) sess.run(init_op) print(sess.run(W)) print(sess.run(b)) def test(x, y): return sess.run(loss_op, feed_dict={x_observed: x, y_observed: y}) test(x=x_test, y=y_test) loss_summary_scalar_op = tf.summary.scalar('loss', loss_op) loss_summary_merge_all_op = tf.summary.merge_all() %%time max_steps = 400 run_metadata = tf.RunMetadata() for step in range(max_steps): if (step < max_steps): test_summary_log, _ = sess.run([loss_summary_merge_all_op, loss_op], feed_dict={x_observed: x_test, y_observed: y_test}) train_summary_log, _ = sess.run([loss_summary_merge_all_op, train_op], feed_dict={x_observed: x_train, y_observed: y_train}) else: test_summary_log, _ = sess.run([loss_summary_merge_all_op, loss_op], feed_dict={x_observed: x_test, y_observed: y_test}) train_summary_log, _ = sess.run([loss_summary_merge_all_op, train_op], feed_dict={x_observed: x_train, y_observed: y_train}, options=tf.RunOptions(trace_level=tf.RunOptions.FULL_TRACE), run_metadata=run_metadata) trace = timeline.Timeline(step_stats=run_metadata.step_stats) with open('cpu-timeline.json', 'w') as trace_file: trace_file.write(trace.generate_chrome_trace_format(show_memory=True)) if step % 1 == 0: print(step, sess.run([W, b])) train_summary_writer.add_summary(train_summary_log, step) train_summary_writer.flush() test_summary_writer.add_summary(test_summary_log, step) test_summary_writer.flush() pylab.plot(x_train, y_train, '.', label="target") pylab.plot(x_train, sess.run(y_pred, feed_dict={x_observed: x_train, y_observed: y_train}), ".", label="predicted") pylab.legend() pylab.ylim(0, 1.0) test(x=x_test, y=y_test) from tensorflow.python.saved_model import utils tensor_info_x_observed = utils.build_tensor_info(x_observed) print(tensor_info_x_observed) tensor_info_y_pred = utils.build_tensor_info(y_pred) print(tensor_info_y_pred) export_path = "/root/models/linear/cpu/%s" % version print(export_path) from tensorflow.python.saved_model import builder as saved_model_builder from tensorflow.python.saved_model import signature_constants from tensorflow.python.saved_model import signature_def_utils from tensorflow.python.saved_model import tag_constants with tf.device("/cpu:0"): builder = saved_model_builder.SavedModelBuilder(export_path) prediction_signature = signature_def_utils.build_signature_def( inputs = {'x_observed': tensor_info_x_observed}, outputs = {'y_pred': tensor_info_y_pred}, method_name = signature_constants.PREDICT_METHOD_NAME) legacy_init_op = tf.group(tf.initialize_all_tables(), name='legacy_init_op') builder.add_meta_graph_and_variables(sess, [tag_constants.SERVING], signature_def_map={'predict':prediction_signature, signature_constants.DEFAULT_SERVING_SIGNATURE_DEF_KEY:prediction_signature}, legacy_init_op=legacy_init_op) builder.save() %%bash ls -l /root/models/linear/cpu/[version] from tensorflow.python.framework import graph_io graph_io.write_graph(sess.graph, "/root/models/optimize_me/", "unoptimized_cpu.pb") sess.close() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Create Model Test/Validation Data Step2: Look at the Model Graph In Tensorboard Step3: Train Model Step4: Look at the Train and Test Loss Summary In Tensorboard Step5: Look at the Model On Disk Step6: HACK
5,277
<ASSISTANT_TASK:> Python Code: import warnings warnings.filterwarnings('ignore') %matplotlib inline %pylab inline import matplotlib.pylab as plt import numpy as np from distutils.version import StrictVersion import sklearn print(sklearn.__version__) assert StrictVersion(sklearn.__version__ ) >= StrictVersion('0.18.1') import tensorflow as tf tf.logging.set_verbosity(tf.logging.ERROR) print(tf.__version__) assert StrictVersion(tf.__version__) >= StrictVersion('1.1.0') import keras print(keras.__version__) assert StrictVersion(keras.__version__) >= StrictVersion('2.0.6') !ls -l speed-limit-signs !cat speed-limit-signs/README.md import os import skimage.data import skimage.transform from keras.utils.np_utils import to_categorical import numpy as np def load_data(data_dir, type=".ppm"): num_categories = 6 # Get all subdirectories of data_dir. Each represents a label. directories = [d for d in os.listdir(data_dir) if os.path.isdir(os.path.join(data_dir, d))] # Loop through the label directories and collect the data in # two lists, labels and images. labels = [] images = [] for d in directories: label_dir = os.path.join(data_dir, d) file_names = [os.path.join(label_dir, f) for f in os.listdir(label_dir) if f.endswith(type)] # For each label, load it's images and add them to the images list. # And add the label number (i.e. directory name) to the labels list. for f in file_names: images.append(skimage.data.imread(f)) labels.append(int(d)) images64 = [skimage.transform.resize(image, (64, 64)) for image in images] return images64, labels # Load datasets. ROOT_PATH = "./" original_dir = os.path.join(ROOT_PATH, "speed-limit-signs") images, labels = load_data(original_dir, type=".ppm") import matplotlib import matplotlib.pyplot as plt def display_images_and_labels(images, labels): Display the first image of each label. unique_labels = set(labels) plt.figure(figsize=(15, 15)) i = 1 for label in unique_labels: # Pick the first image for each label. image = images[labels.index(label)] plt.subplot(8, 8, i) # A grid of 8 rows x 8 columns plt.axis('off') plt.title("Label {0} ({1})".format(label, labels.count(label))) i += 1 _ = plt.imshow(image) display_images_and_labels(images, labels) # again a little bit of feature engeneering y = np.array(labels) X = np.array(images) from keras.utils.np_utils import to_categorical num_categories = 6 y = to_categorical(y, num_categories) from sklearn.model_selection import train_test_split X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.9, random_state=42, stratify=y) X_train.shape, y_train.shape # full architecture # %load https://djcordhose.github.io/ai/fragments/vgg_style_no_dropout.py # my sample minimized architecture # %load https://djcordhose.github.io/ai/fragments/vgg_style_no_dropout_overfitting.py model = Model(input=inputs, output=predictions) model.summary() model.compile(optimizer='adam', loss='categorical_crossentropy', metrics=['accuracy']) # Determines how many samples are using for training in one batch # Depends on harware GPU architecture, set as high as possible (this works well on K80) BATCH_SIZE = 500 %time model.fit(X_train, y_train, epochs=100, validation_split=0.2, batch_size=BATCH_SIZE) X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.2, random_state=42, stratify=y) # https://keras.io/callbacks/#tensorboard tb_callback = keras.callbacks.TensorBoard(log_dir='./tf_log') # To start tensorboard # tensorboard --logdir=/mnt/c/Users/olive/Development/ml/tf_log # open http://localhost:6006 early_stopping_callback = keras.callbacks.EarlyStopping(monitor='val_loss', patience=50, verbose=1) checkpoint_callback = keras.callbacks.ModelCheckpoint('./model-checkpoints/weights.epoch-{epoch:02d}-val_loss-{val_loss:.2f}.hdf5'); keras.layers.Dropout? # full architecture with dropout # %load https://djcordhose.github.io/ai/fragments/vgg_style_dropout.py # my sample minimized architecture # %load https://djcordhose.github.io/ai/fragments/vgg_style_dropout_minmal.py model = Model(input=inputs, output=predictions) model.summary() model.compile(optimizer='adam', loss='categorical_crossentropy', metrics=['accuracy']) !rm -r tf_log %time model.fit(X_train, y_train, epochs=500, batch_size=BATCH_SIZE, validation_split=0.2, callbacks=[tb_callback, early_stopping_callback]) # %time model.fit(X_train, y_train, epochs=500, batch_size=BATCH_SIZE, validation_split=0.2, callbacks=[tb_callback]) # %time model.fit(X_train, y_train, epochs=500, batch_size=BATCH_SIZE, validation_split=0.2) train_loss, train_accuracy = model.evaluate(X_train, y_train, batch_size=BATCH_SIZE) train_loss, train_accuracy test_loss, test_accuracy = model.evaluate(X_test, y_test, batch_size=BATCH_SIZE) test_loss, test_accuracy # model.save('conv-vgg.hdf5') model.save('conv-simple.hdf5') !ls -lh # https://transfer.sh/ # Saved for 14 days # !curl --upload-file conv-vgg.hdf5 https://transfer.sh !curl --upload-file conv-simple.hdf5 https://transfer.sh # pre-trained model # acc: 0.98- val_acc: 0.89 # https://transfer.sh/DuZA7/conv-simple.hdf5 import random # Pick 10 random images for test data set random.seed(42) # to make this deterministic sample_indexes = random.sample(range(len(X_test)), 10) sample_images = [X_test[i] for i in sample_indexes] sample_labels = [y_test[i] for i in sample_indexes] ground_truth = np.argmax(sample_labels, axis=1) ground_truth X_sample = np.array(sample_images) prediction = model.predict(X_sample) predicted_categories = np.argmax(prediction, axis=1) predicted_categories # Display the predictions and the ground truth visually. def display_prediction (images, true_labels, predicted_labels): fig = plt.figure(figsize=(10, 10)) for i in range(len(true_labels)): truth = true_labels[i] prediction = predicted_labels[i] plt.subplot(5, 2,1+i) plt.axis('off') color='green' if truth == prediction else 'red' plt.text(80, 10, "Truth: {0}\nPrediction: {1}".format(truth, prediction), fontsize=12, color=color) plt.imshow(images[i]) display_prediction(sample_images, ground_truth, predicted_categories) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Loading and Preparing Data Step3: Big Kudos to Waleed Abdulla for providing the initial idea and many of the functions used to prepare and display the images Step4: Let's start with creating a minimal model that overfits on a very small training set Step5: This is how overfitting looks like in the Metrics Step6: Hands-On Step7: How Metrics might look like when training 500 epochs with given full model Step8: What images does it work well on?
5,278
<ASSISTANT_TASK:> Python Code: # Import libraries necessary for this project import numpy as np import pandas as pd from IPython.display import display # Allows the use of display() for DataFrames # Import supplementary visualizations code visuals.py import visuals as vs # Pretty display for notebooks %matplotlib inline # Load the dataset in_file = 'titanic_data.csv' full_data = pd.read_csv(in_file) # Print the first few entries of the RMS Titanic data display(full_data.head()) # Store the 'Survived' feature in a new variable and remove it from the dataset outcomes = full_data['Survived'] data = full_data.drop('Survived', axis = 1) # Show the new dataset with 'Survived' removed display(data.head()) def accuracy_score(truth, pred): Returns accuracy score for input truth and predictions. # Ensure that the number of predictions matches number of outcomes if len(truth) == len(pred): # Calculate and return the accuracy as a percent return "Predictions have an accuracy of {:.2f}%.".format((truth == pred).mean()*100) else: return "Number of predictions does not match number of outcomes!" # Test the 'accuracy_score' function predictions = pd.Series(np.ones(5, dtype = int)) print accuracy_score(outcomes[:5], predictions) def predictions_0(data): Model with no features. Always predicts a passenger did not survive. predictions = [] for _, passenger in data.iterrows(): # Predict the survival of 'passenger' predictions.append(0) # Return our predictions return pd.Series(predictions) # Make the predictions predictions = predictions_0(data) print accuracy_score(outcomes, predictions) vs.survival_stats(data, outcomes, 'Sex') def predictions_1(data): Model with one feature: - Predict a passenger survived if they are female. predictions = [] for _, passenger in data.iterrows(): # Remove the 'pass' statement below # and write your prediction conditions here if passenger['Sex'] == 'female': predictions.append(1) else: predictions.append(0) # Return our predictions return pd.Series(predictions) # Make the predictions predictions = predictions_1(data) print accuracy_score(outcomes, predictions) vs.survival_stats(data, outcomes, 'Age', ["Sex == 'male'"]) def predictions_2(data): Model with two features: - Predict a passenger survived if they are female. - Predict a passenger survived if they are male and younger than 10. predictions = [] for _, passenger in data.iterrows(): # Remove the 'pass' statement below # and write your prediction conditions here if passenger['Sex'] == 'female': predictions.append(1) elif passenger['Age'] < 10: predictions.append(1) else: predictions.append(0) # Return our predictions return pd.Series(predictions) # Make the predictions predictions = predictions_2(data) print accuracy_score(outcomes, predictions) vs.survival_stats(data, outcomes, 'Pclass', ["Age > 10", "Sex == 'female'"]) def predictions_3(data): Model with multiple features. Makes a prediction with an accuracy of at least 80%. predictions = [] for _, passenger in data.iterrows(): # Remove the 'pass' statement below # and write your prediction conditions here if passenger['Sex'] == 'female' and passenger['Pclass'] < 3: predictions.append(1) elif passenger['Age'] < 6: predictions.append(1) else: predictions.append(0) # Return our predictions return pd.Series(predictions) # Make the predictions predictions = predictions_3(data) print accuracy_score(outcomes, predictions) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: From a sample of the RMS Titanic data, we can see the various features present for each passenger on the ship Step3: The very same sample of the RMS Titanic data now shows the Survived feature removed from the DataFrame. Note that data (the passenger data) and outcomes (the outcomes of survival) are now paired. That means for any passenger data.loc[i], they have the survival outcome outcomes[i]. Step5: Tip Step6: Question 1 Step7: Answer Step9: Examining the survival statistics, a large majority of males did not survive the ship sinking. However, a majority of females did survive the ship sinking. Let's build on our previous prediction Step10: Question 2 Step11: Answer Step13: Examining the survival statistics, the majority of males younger than 10 survived the ship sinking, whereas most males age 10 or older did not survive the ship sinking. Let's continue to build on our previous prediction Step14: Question 3 Step15: Answer Step17: After exploring the survival statistics visualization, fill in the missing code below so that the function will make your prediction. Step18: Question 4
5,279
<ASSISTANT_TASK:> Python Code: import logging from conf import LisaLogging LisaLogging.setup() # Execute this cell to enabled executor debugging statements logging.getLogger('Executor').setLevel(logging.DEBUG) from env import TestEnv # Setup a test environment with target configuration env = TestEnv({ # Target platform and board "platform" : 'linux', "board" : 'juno', # Target board IP/MAC address "host" : '192.168.0.1', # Login credentials "username" : 'root', "password" : 'test0000', # Folder where all the results will be collected "results_dir" : "ExecutorExample", # FTrace events to collect for all the tests configuration which have # the "ftrace" flag enabled "ftrace" : { "events" : [ "sched_switch", "sched_wakeup", "sched_wakeup_new", "cpu_frequency", ], "buffsize" : 80 * 1024, }, # Tools required by the experiments "tools" : [ 'trace-cmd', 'perf' ], # Modules required by these experiments "modules" : [ 'bl', 'cpufreq' ], }) my_tests_conf = { # Platform configurations to test "confs" : [ { "tag" : "base", "flags" : "ftrace", # Enable FTrace events "sched_features" : "NO_ENERGY_AWARE", # Disable EAS "cpufreq" : { # Use PERFORMANCE CpuFreq "governor" : "performance", }, }, { "tag" : "eas", "flags" : "ftrace", # Enable FTrace events "sched_features" : "ENERGY_AWARE", # Enable EAS "cpufreq" : { # Use PERFORMANCE CpuFreq "governor" : "performance", }, }, ], # Workloads to run (on each platform configuration) "wloads" : { # Run hackbench with 1 group using pipes "perf" : { "type" : "perf_bench", "conf" : { "class" : "messaging", "params" : { "group" : 1, "loop" : 10, "pipe" : True, "thread": True, } } }, # Run a 20% duty-cycle periodic task "rta" : { "type" : "rt-app", "loadref" : "big", "conf" : { "class" : "profile", "params" : { "p20" : { "kind" : "Periodic", "params" : { "duty_cycle_pct" : 20, }, }, }, }, }, }, # Number of iterations for each workload "iterations" : 1, } from executor import Executor executor = Executor(env, my_tests_conf) executor.run() !tree {executor.te.res_dir} <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Target Configuration Step2: Tests Configuration Step3: Tests execution
5,280
<ASSISTANT_TASK:> Python Code: # Import libraries import numpy as np import pandas as pd from time import time from sklearn.metrics import f1_score # Read student data student_data = pd.read_csv("student-data.csv") print "Student data read successfully!" # TODO: Calculate number of students n_students = None # TODO: Calculate number of features n_features = None # TODO: Calculate passing students n_passed = None # TODO: Calculate failing students n_failed = None # TODO: Calculate graduation rate grad_rate = None # Print the results print "Total number of students: {}".format(n_students) print "Number of features: {}".format(n_features) print "Number of students who passed: {}".format(n_passed) print "Number of students who failed: {}".format(n_failed) print "Graduation rate of the class: {:.2f}%".format(grad_rate) # Extract feature columns feature_cols = list(student_data.columns[:-1]) # Extract target column 'passed' target_col = student_data.columns[-1] # Show the list of columns print "Feature columns:\n{}".format(feature_cols) print "\nTarget column: {}".format(target_col) # Separate the data into feature data and target data (X_all and y_all, respectively) X_all = student_data[feature_cols] y_all = student_data[target_col] # Show the feature information by printing the first five rows print "\nFeature values:" print X_all.head() def preprocess_features(X): ''' Preprocesses the student data and converts non-numeric binary variables into binary (0/1) variables. Converts categorical variables into dummy variables. ''' # Initialize new output DataFrame output = pd.DataFrame(index = X.index) # Investigate each feature column for the data for col, col_data in X.iteritems(): # If data type is non-numeric, replace all yes/no values with 1/0 if col_data.dtype == object: col_data = col_data.replace(['yes', 'no'], [1, 0]) # If data type is categorical, convert to dummy variables if col_data.dtype == object: # Example: 'school' => 'school_GP' and 'school_MS' col_data = pd.get_dummies(col_data, prefix = col) # Collect the revised columns output = output.join(col_data) return output X_all = preprocess_features(X_all) print "Processed feature columns ({} total features):\n{}".format(len(X_all.columns), list(X_all.columns)) # TODO: Import any additional functionality you may need here # TODO: Set the number of training points num_train = None # Set the number of testing points num_test = X_all.shape[0] - num_train # TODO: Shuffle and split the dataset into the number of training and testing points above X_train = None X_test = None y_train = None y_test = None # Show the results of the split print "Training set has {} samples.".format(X_train.shape[0]) print "Testing set has {} samples.".format(X_test.shape[0]) def train_classifier(clf, X_train, y_train): ''' Fits a classifier to the training data. ''' # Start the clock, train the classifier, then stop the clock start = time() clf.fit(X_train, y_train) end = time() # Print the results print "Trained model in {:.4f} seconds".format(end - start) def predict_labels(clf, features, target): ''' Makes predictions using a fit classifier based on F1 score. ''' # Start the clock, make predictions, then stop the clock start = time() y_pred = clf.predict(features) end = time() # Print and return results print "Made predictions in {:.4f} seconds.".format(end - start) return f1_score(target.values, y_pred, pos_label='yes') def train_predict(clf, X_train, y_train, X_test, y_test): ''' Train and predict using a classifer based on F1 score. ''' # Indicate the classifier and the training set size print "Training a {} using a training set size of {}. . .".format(clf.__class__.__name__, len(X_train)) # Train the classifier train_classifier(clf, X_train, y_train) # Print the results of prediction for both training and testing print "F1 score for training set: {:.4f}.".format(predict_labels(clf, X_train, y_train)) print "F1 score for test set: {:.4f}.".format(predict_labels(clf, X_test, y_test)) # TODO: Import the three supervised learning models from sklearn # from sklearn import model_A # from sklearn import model_B # from skearln import model_C # TODO: Initialize the three models clf_A = None clf_B = None clf_C = None # TODO: Set up the training set sizes X_train_100 = None y_train_100 = None X_train_200 = None y_train_200 = None X_train_300 = None y_train_300 = None # TODO: Execute the 'train_predict' function for each classifier and each training set size # train_predict(clf, X_train, y_train, X_test, y_test) # TODO: Import 'GridSearchCV' and 'make_scorer' # TODO: Create the parameters list you wish to tune parameters = None # TODO: Initialize the classifier clf = None # TODO: Make an f1 scoring function using 'make_scorer' f1_scorer = None # TODO: Perform grid search on the classifier using the f1_scorer as the scoring method grid_obj = None # TODO: Fit the grid search object to the training data and find the optimal parameters grid_obj = None # Get the estimator clf = grid_obj.best_estimator_ # Report the final F1 score for training and testing after parameter tuning print "Tuned model has a training F1 score of {:.4f}.".format(predict_labels(clf, X_train, y_train)) print "Tuned model has a testing F1 score of {:.4f}.".format(predict_labels(clf, X_test, y_test)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Implementation Step2: Preparing the Data Step3: Preprocess Feature Columns Step4: Implementation Step5: Training and Evaluating Models Step6: Implementation Step7: Tabular Results
5,281
<ASSISTANT_TASK:> Python Code: %pylab inline from colormap import Colormap c = Colormap() cmap = c.cmap('cool') # let us see what it looks like c.test_colormap(cmap) #Would be nice to plot a bunch of colormap to pick up one interesting c.plot_colormap('diverging') c.plot_colormap(c.misc) c.plot_colormap(c.qualitative) c.plot_colormap(c.sequentials) c.plot_colormap(c.sequentials2) # This list is implemented in colormap package itself c.plot_colormap(c.diverging_black) mycmap = c.cmap_linear('red', 'white', 'green(w3c)') c.test_colormap(mycmap) mycmap = c.cmap_bicolor('red', 'green(w3c)') c.test_colormap(mycmap) # there is also 2 extra maps from R mycmap = c.get_cmap_heat() c.test_colormap(mycmap) # color can be given a a name available in import colormap.xfree86 as colors list(colors.XFree86_colors.keys())[0:5] #or list(colors.XFree86_colors.values())[0:5] # or as RGB, HLS, HSV, YUX, Hexa format from colormap import Color co = Color('white') co.hex mycmap = c.cmap_linear('red', '#FFFFFF', 'green(w3c)') c.test_colormap(mycmap) # Conversion between colors c = Color('red') c.rgb c.hls c.hex print(c) from colormap import cmap_builder, test_cmap mycm = cmap_builder('red', 'white', 'green') test_cmap(mycm) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Well, I have not found the one I wanted...I wanted from red to white to green Step2: Using cma_builder and test_cmap
5,282
<ASSISTANT_TASK:> Python Code: # First load RESSPyLab and necessary packages import numpy as np import RESSPyLab as rpl # Identify the material material_def = {'material_id': ['Example 1'], 'load_protocols': ['1,5']} # Set the path to the x log file x_log_file_1 = './output/x_log.txt' x_logs_all = [x_log_file_1] # Load the data data_files_1 = ['example_1.csv'] data_1 = rpl.load_data_set(data_files_1) data_all = [data_1] # Make the tables param_table, metric_table = rpl.summary_tables_maker_vc(material_def, x_logs_all, data_all) # Load the base parameters, we want the last entry in the file x_base = np.loadtxt(x_log_file_1, delimiter=' ') x_base = x_base[-1] # Load (or set) the sample parameters x_sample = np.array([179750., 318.47, 100.72, 8.00, 11608.17, 145.22, 1026.33, 4.68]) # Calculate the metric consistency_metric = rpl.vc_consistency_metric(x_base, x_sample, data_1) print consistency_metric # Identify the material material_def = {'material_id': ['Example 1'], 'load_protocols': ['1']} # Set the path to the x log file x_log_file_2 = './output/x_log_upd.txt' x_logs_all = [x_log_file_2] # Load the data data_files_2 = ['example_1.csv'] data_2 = rpl.load_data_set(data_files_2) data_all = [data_2] # Make the tables param_table, metric_table = rpl.summary_tables_maker_uvc(material_def, x_logs_all, data_all) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Original Voce-Chaboche model Step2: Tables can be easily generated following a standard format for several data sets by appending additional entries to the lists of values in material_def and to x_logs_all and data_all. Step3: The value of $\xi_2 = 65$ %, indicating that the two sets of parameters are inconsistent for this data set.
5,283
<ASSISTANT_TASK:> Python Code: import numpy as np from sklearn.preprocessing import scale Dtrans = np.loadtxt("transfusion.data",dtype=np.str_,delimiter=",") X = np.array(Dtrans[1:,0:4],dtype=float) y = np.array(Dtrans[1:,4],dtype=float) X = scale(X) from sklearn import svm import sklearn.linear_model as skl_lm from sklearn.model_selection import KFold, cross_val_score from sklearn.model_selection import LeaveOneOut import time import matplotlib.pyplot as plt from sklearn.model_selection import train_test_split from sklearn.metrics import precision_recall_curve, roc_curve,confusion_matrix, classification_report %matplotlib inline C = [0.1 ,0.5 , 1.0, 3.0, 10, 20 , 50 ,100 ] methods = ['5-fold cross validation', 'leave-one-out CV', '50% holdout' ] timelist = [] loo = LeaveOneOut() kfold = KFold(n_splits=5) idx = np.random.choice(np.arange(len(X)),374, replace=False) test = list(set(idx).intersection(set(range(748)))) for method in methods: print 'tune method is ',method for i in C: A = time.clock() svc = svm.SVC(C=i) if method == '5-fold cross validation': print 'C =',i,' score =',cross_val_score(svc, X, y, cv=kfold).mean() elif method == 'leave-one-out CV': print 'C =',i,' score =',cross_val_score(svc, X, y, cv=loo).mean() else: print 'C =',i,' score =',svc.fit(X[idx], y[idx]).score(X[test], y[test]) B = time.clock() timelist.append(B-A) for i in range(3): print 'avg running time of ',methods[i],' is ',np.mean(timelist[i*8:(i+1)*8]),' seconds' xx = np.linspace(0,5,100)[1:] five_fold = [] leaveone = [] holdout = [] for method in methods: for i in xx: svc = svm.SVC(gamma=i) if method == '5-fold cross validation': five_fold.append(cross_val_score(svc, X, y, cv=kfold).mean()) elif method == 'leave-one-out CV': leaveone.append(cross_val_score(svc, X, y, cv=loo).mean()) else: holdout.append(svc.fit(X[idx], y[idx]).score(X[test], y[test])) plt.figure() plt.plot(xx,five_fold,label=methods[0]) plt.plot(xx,leaveone,label=methods[1]) plt.plot(xx,holdout,label=methods[2]) plt.legend(loc='right' ) plt.xlabel('ridge penalty parameter') plt.ylabel('accuracy') plt.title('relation between ridge penalty parameter and accuraacy') plt.show() print methods[0],'best accuracy:',max(five_fold),'best ridge penalty:',xx[np.argmax(five_fold)] print methods[1],'best accuracy:',max(leaveone),'best ridge penalty:',xx[np.argmax(leaveone)] print methods[2],'best accuracy:',max(holdout),'best ridge penalty:',xx[np.argmax(holdout)] def best_band_5fold(X,y,model,linear=False): ''' find best bandwidth input X, y , MODEL being used to fit, whether use linear svc output best bandwidth ''' C = np.linspace(0.000001,31,100) five_fold = [] kfold = KFold(n_splits=5) for i in C: svc = model(C=i) if linear: svc = model(C=i,kernel='linear') five_fold.append(cross_val_score(svc, X, y, cv=kfold).mean()) return C[np.argmax(five_fold)] print 'best bandwith for RBF SVM',best_band_5fold(X,y,svm.SVC) print 'best bandwith for linearSVM',best_band_5fold(X,y,svm.SVC,linear=True) print 'best bandwith for logistic',best_band_5fold(X,y,skl_lm.LogisticRegression) X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=.3, random_state=0) logit = skl_lm.LogisticRegression(solver='newton-cg', C=0.155779889447) logit.fit(X_train,y_train) prob = logit.predict_proba(X_test) logfpr, logtpr, logthr = roc_curve(y_test, prob[:,1]) logpre, logrec, logthresh = precision_recall_curve(y_test, prob[:,1]) svc = svm.SVC(probability=True, C=29.1306533266) svc.fit(X_train,y_train) pred = svc.predict_proba(X_test) svcfpr, svctpr, svcthr = roc_curve(y_test, pred[:,1]) svcpre, svcrec, svcthresh = precision_recall_curve(y_test, pred[:,1]) lsvm = svm.SVC(C=1e-06,kernel='linear',probability=True) lsvm.fit(X_train,y_train) pred = lsvm.predict_proba(X_test) lsvmfpr, lsvmtpr, lsvmthr = roc_curve(y_test, pred[:,1]) lsvmpre, lsvmrec, lsvmthresh = precision_recall_curve(y_test, pred[:,1]) plt.figure() lw = 2 plt.plot(logfpr,logtpr,lw=lw, label='logistic regression') plt.plot(lsvmfpr,lsvmtpr,lw=lw, label='linear SVM') plt.plot(svcfpr,svctpr,lw=lw, label='RBF SVM') plt.plot([0, 1], [0, 1], color='navy', lw=lw, linestyle='--') plt.xlim([0.0, 1.0]) plt.ylim([0.0, 1.05]) plt.xlabel('False Positive Rate') plt.ylabel('True Positive Rate') plt.title('Receiver operating characteristic for three methods') plt.legend(loc="lower right") plt.show() plt.figure() lw = 2 plt.plot(logrec,logpre,lw=lw, label='logistic regression') plt.plot(lsvmrec,lsvmpre,lw=lw, label='linear SVM') plt.plot(svcrec,svcpre,lw=lw, label='RBF SVM') plt.xlim([0.0, 1.0]) plt.ylim([0.0, 1.05]) plt.xlabel('Recall') plt.ylabel('Precision') plt.title('Precision Recall curve for three methods') plt.legend(loc=1) plt.show() from collections import Counter import scipy.sparse as sp def read_corpus(filename): Read a R8 corpus Input: filename Output: the corpus which is a list of documents with topic labels and stemmed terms corpus = [] DF = Counter() with open(filename,"r") as f: for line in f: label, terms = line.split('\t') terms = terms.strip().split() label = label.strip() corpus.append([label,Counter(terms)]) DF += Counter(set(terms)) return(corpus, DF) train_corpus, train_DF = read_corpus('r8-train-stemmed.txt') test_corpus, test_DF = read_corpus('r8-test-stemmed.txt') # You should use the document frequency for the whole corpus full_DF = train_DF + test_DF ## dict_list is the list of dictionary terms, ## while dict_index can take you from the term back to its index dict_list = full_DF.keys() dict_index = {t:i for i,t in enumerate(dict_list)} n, p = len(train_corpus), len(full_DF) logN = np.log(len(train_corpus) + len(test_corpus)) X_tr = sp.lil_matrix((n,p)) ## This creates the sparse training matrix, you will need to modify this to create the test matrix. ## I am using a normalized TFIDF transform below, figure out what it is doing. for i in xrange(n): tpc, doc = train_corpus[i] vec = np.array([(logN - np.log(train_DF[term]))*doc[term] for term in doc.keys()]) vec = vec / np.linalg.norm(vec) X_tr[i,[dict_index[term] for term in doc.keys()]] = vec from sklearn.cluster import KMeans cluster_center = KMeans().fit(X_tr).cluster_centers_ for cluster in cluster_center: print [name for name, age in dict_index.items() if age in np.argsort(cluster)[-10:]] print 'sizes of the clusters is ',cluster.size y_label = {} y = [i[0] for i in train_corpus] for i,j in zip(set(y),range(8)): y_label[i] = j print(y_label) y = [y_label[i] for i in y if i in y_label] pred = KMeans().fit_predict(X_tr,y) confusion_matrix(y, pred) from sklearn.cluster import AgglomerativeClustering from scipy.cluster.hierarchy import dendrogram, linkage X_transp = X_tr.T def draw_dendrograme(X_transp ,num, method): ''' draw dendrograme for different linkage type num is cluster number(int), method is linkage type(str) ''' clusterer = AgglomerativeClustering(n_clusters=num, linkage=method) MODEL1 = clusterer.fit(X_transp.toarray()) model1_list = MODEL1.labels_ cluster_dict = {} for i in range(len(model1_list)): if model1_list[i] not in cluster_dict: cluster_dict[model1_list[i]] = [i] else: cluster_dict[model1_list[i]].append(i) center=[] for i in range(40): center.append(np.mean(X_transp[cluster_dict[i],:],axis=0)) ceterarray = np.array(center).reshape(40,5485) Z = linkage(ceterarray, method=method ) plt.figure() plt.title('dendrograms for '+ method+' linkage type') dn = dendrogram(Z) plt.show() draw_dendrograme(X_transp, 40, 'ward') draw_dendrograme(X_transp, 40, 'complete') draw_dendrograme(X_transp, 40, 'average') #1000 most common words in the training set instead top_1000 = sorted(train_DF.items(), key=lambda x: x[1],reverse=True)[:1000] top_1000_index = [dict_index[i[0]] for i in top_1000] X_1000 = X_transp[top_1000_index] Z = linkage(X_1000.toarray(), method='ward' ) plt.figure() plt.title('1000 most common words dendrograms for ward linkage type') dn = dendrogram(Z,p=40,truncate_mode='lastp') Z = linkage(X_1000.toarray(), method='complete' ) plt.figure() plt.title('1000 most common words dendrograms for complete linkage type') dn = dendrogram(Z,p=40,truncate_mode='lastp') Z = linkage(X_1000.toarray(), method='average' ) plt.figure() plt.title('1000 most common words dendrograms for average linkage type') dn = dendrogram(Z,p=40,truncate_mode='lastp') from sklearn.preprocessing import label_binarize from sklearn.multiclass import OneVsRestClassifier from scipy import interp from sklearn.metrics import roc_curve, auc from itertools import cycle print 'best bandwidth',best_band_5fold(X_tr,y,svm.SVC) xx = np.linspace(0,5,10)[1:] kfold = KFold(n_splits=5) five_fold2 = [] for i in xx: svc = svm.SVC(gamma=i) five_fold2.append(cross_val_score(svc, X_tr, y_train, cv=kfold).mean()) print 'best ridge penalty:',xx[np.argmax(five_fold2)] #generate train matrix m, p = len(test_corpus), len(full_DF) logN = np.log(len(train_corpus) + len(test_corpus)) X_testtr = sp.lil_matrix((m,p)) for i in xrange(m): tpc, doc = test_corpus[i] vec = np.array([(logN - np.log(test_DF[term]))*doc[term] for term in doc.keys()]) vec = vec / np.linalg.norm(vec) X_testtr[i,[dict_index[term] for term in doc.keys()]] = vec y_label = {} y_train = [i[0] for i in train_corpus] y_test = [i[0] for i in test_corpus] for i,j in zip(set(y_train),range(8)): y_label[i] = j y_train = [y_label[i] for i in y_train if i in y_label] y_test = [y_label[i] for i in y_test if i in y_label] y_train = label_binarize(y_train, classes=[0,1,2,3,4,5,6,7]) y_test = label_binarize(y_test, classes=[0,1,2,3,4,5,6,7]) n_classes = y_train.shape[1] random_state = np.random.RandomState(0) classifier = OneVsRestClassifier(svm.SVC(gamma=0.555555555556,C=1, probability=True,random_state=random_state)) y_score = classifier.fit(X_tr, y_train).decision_function(X_testtr) # Compute ROC curve and ROC area for each class fpr = dict() tpr = dict() roc_auc = dict() for i in range(n_classes): fpr[i], tpr[i], _ = roc_curve(y_test[:, i], y_score[:, i]) roc_auc[i] = auc(fpr[i], tpr[i]) # Compute micro-average ROC curve and ROC area fpr["micro"], tpr["micro"], _ = roc_curve(y_test.ravel(), y_score.ravel()) roc_auc["micro"] = auc(fpr["micro"], tpr["micro"]) all_fpr = np.unique(np.concatenate([fpr[i] for i in range(n_classes)])) lw = 3 # Then interpolate all ROC curves at this points mean_tpr = np.zeros_like(all_fpr) for i in range(n_classes): mean_tpr += interp(all_fpr, fpr[i], tpr[i]) # Finally average it and compute AUC mean_tpr /= n_classes fpr["macro"] = all_fpr tpr["macro"] = mean_tpr roc_auc["macro"] = auc(fpr["macro"], tpr["macro"]) # Plot all ROC curves plt.figure(figsize=(15,10)) plt.plot(fpr["micro"], tpr["micro"], label='micro-average ROC curve (area = {0:0.2f})' ''.format(roc_auc["micro"]), color='deeppink', linestyle=':', linewidth=6) plt.plot(fpr["macro"], tpr["macro"], label='macro-average ROC curve (area = {0:0.2f})' ''.format(roc_auc["macro"]), color='navy', linestyle=':', linewidth=6) colors = cycle(['black','silver','red','gold','blue','moccasin','darkorange','cornflowerblue']) for i, color in zip(range(n_classes), colors): plt.plot(fpr[i], tpr[i], color=color, lw=lw, label='ROC curve of class {0} (area = {1:0.2f})' ''.format(i, roc_auc[i])) plt.plot([0, 1], [0, 1], 'k--', lw=lw) plt.xlim([0.0, 1.0]) plt.ylim([0.0, 1.05]) plt.xlabel('False Positive Rate',fontsize=20) plt.ylabel('True Positive Rate',fontsize=20) plt.title('Receiver operating characteristic to multi-class',fontsize=20) plt.legend(loc=4) plt.show() from sklearn.metrics import average_precision_score y_train = label_binarize(y_train, classes=[0,1,2,3,4,5,6,7]) y_test = label_binarize(y_test, classes=[0,1,2,3,4,5,6,7]) n_classes = y_train.shape[1] # Run classifier classifier = OneVsRestClassifier(svm.SVC(gamma=0.555555555556,C=1e-06, probability=True,random_state=random_state)) y_score = classifier.fit(X_tr, y_train).decision_function(X_testtr) # Compute Precision-Recall and plot curve precision = dict() recall = dict() average_precision = dict() for i in range(n_classes): precision[i], recall[i], _ = precision_recall_curve(y_test[:, i], y_score[:, i]) average_precision[i] = average_precision_score(y_test[:, i], y_score[:, i]) # Compute micro-average ROC curve and ROC area precision["micro"], recall["micro"], _ = precision_recall_curve(y_test.ravel(), y_score.ravel()) average_precision["micro"] = average_precision_score(y_test, y_score, average="micro") # Plot Precision-Recall curve for each class plt.figure(figsize=(15,10)) plt.plot(recall["micro"], precision["micro"], color='gold', lw=lw, label='micro-average Precision-recall curve (area = {0:0.2f})' ''.format(average_precision["micro"])) for i, color in zip(range(n_classes), colors): plt.plot(recall[i], precision[i], color=color, lw=lw, label='Precision-recall curve of class {0} (area = {1:0.2f})' ''.format(i, average_precision[i])) plt.xlim([0.0, 1.0]) plt.ylim([0.0, 1.05]) plt.xlabel('Recall',fontsize=20) plt.ylabel('Precision',fontsize=20) plt.title('Extension of Precision-Recall curve to multi-class',fontsize=20) plt.legend(loc="lower left") plt.show() y_test = [i[0] for i in test_corpus] y_test = [y_label[i] for i in y_test if i in y_label] svc = svm.SVC(C=1.0, gamma=0.555555555556) svc.fit(X_tr,y) predy = svc.predict(X_testtr) print 'RBF Kernel' confusion_matrix(y_test, predy) svc = svm.SVC(C=1.0, gamma=0.555555555556,kernel='linear') svc.fit(X_tr,y) predy = svc.predict(X_testtr) print 'Linear Kernel' confusion_matrix(y_test, predy) y_label = {} y_train = [i[0] for i in train_corpus] y_test = [i[0] for i in test_corpus] for i,j in zip(set(y_train),range(8)): y_label[i] = j y_train = [y_label[i] for i in y_train if i in y_label] y_test = [y_label[i] for i in y_test if i in y_label] y_train = [1 if i==0 else 0 for i in y_train] y_test = [1 if i==0 else 0 for i in y_test] svc = svm.SVC( C=1.0,gamma=0.555555555556,probability=True) lsvc = svm.SVC(C=1.0, probability=True,kernel='linear') svc.fit(X_tr,y_train) lsvc.fit(X_tr,y_train) pred = svc.predict_proba(X_testtr) lpred = lsvc.predict_proba(X_testtr) svcfpr, svctpr, svcthr = roc_curve(y_test, pred[:,1]) svcpre, svcrec, svcthresh = precision_recall_curve(y_test, pred[:,1]) lsvcfpr, lsvctpr, lsvcthr = roc_curve(y_test, lpred[:,1]) lsvcpre, lsvcrec, lsvcthresh = precision_recall_curve(y_test, lpred[:,1]) plt.figure() lw = 2 plt.plot(svcfpr,svctpr,lw=lw, label='RBF SVM') plt.plot(lsvcfpr,lsvctpr,lw=lw, label='Linear SVM') plt.plot([0, 1], [0, 1], color='navy', lw=lw, linestyle='--') plt.xlim([0.0, 1.0]) plt.ylim([0.0, 1.05]) plt.xlabel('False Positive Rate') plt.ylabel('True Positive Rate') plt.title('Receiver operating characteristic for earn class') plt.legend(loc="lower right") plt.show() plt.figure() lw = 2 plt.plot(svcrec,svcpre,lw=lw, label='RBF SVM') plt.plot(lsvcrec,lsvcpre,lw=lw, label='Linear SVM') plt.xlim([0.0, 1.0]) plt.ylim([0.0, 1.05]) plt.xlabel('Recall') plt.ylabel('Precision') plt.title('Precision Recall curve for earn class') plt.legend(loc=4) plt.show() svc = svm.SVC( gamma=0.555555555556,probability=True) svc.fit(X_tr,y_train) predyy = svc.predict(X_testtr) print('rbf svc') confusion_matrix(y_test, predyy) lsvc = svm.SVC(kernel='linear') lsvc.fit(X_tr,y_train) predyy = lsvc.predict(X_testtr) print('linear svc') confusion_matrix(y_test, predyy) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Exercise 1.1 (10 pts) Use 5-fold cross validation, leave-one-out CV, and a 50% holdout to tune the bandwidth and ridge penalty parameter for the RBF kernel for SVMs. Qualitatively compare the results. Step2: Exercise 1.2 (10 pts) Select one of these methods for tuning the bandwidth parameters and make this a function that takes in a dataset, performs cross-validation, and outputs the tuning parameters. Make a training and test set split and tune parameters for linear SVMs, RBF kernel SVMs, and logistic regression on the training set, then compare their performances on the test set using ROC and PR curves. Step4: Reuters dataset Step5: Exercise 2.1 (10 pts) Compute Kmeans with 8 clusters on the training set. For each cluster, what are the 10 terms that have the highest components in the cluster center vectors? What are the sizes of the clusters? Compute a 'confusion matrix' to compare these 8 clusters to the labelled topics (I want an 8 x 8 matrix of counts of documents in each topic and cluster - there are 8 topics). Step6: 10 highest components terms in each the cluster center vectors Step7: confusion matrix to for these 8 clusters Step8: Exercise 2.2 (10 pts) Reverse the roles of words and documents and perform hierarchical agglomerative clustering (you can just transpose X) up to 40 clusters. Compare the dendrograms for three different linkage types, and try to make sense of the resulting clusters. Step9: 1000 most common words in the training set Step10: Exercise 2.3 (10 pts) Use SVMs trained on the training set to predict the test set. Evaluate the performance with the ROC, PR, and confusion matrix. Don't forget to appropriately cross-validate to tune parameters. Step11: classify earn
5,284
<ASSISTANT_TASK:> Python Code: 7**4 s = "Hi there Sam!" s.split() planet = "Earth" diameter = 12742 print("The diameter of {} is {} kilometers.".format(planet,diameter)) lst = [1,2,[3,4],[5,[100,200,['hello']],23,11],1,7] lst[3][1][2] d = {'k1':[1,2,3,{'tricky':['oh','man','inception',{'target':[1,2,3,'hello']}]}]} # Tuple is immutable na = "user@domain.com" na.split("@")[1] def domainGet(name): return name.split("@")[1] domainGet('user@domain.com') def findDog(sentence): x = sentence.split() for item in x: if item == "dog": return True findDog('Is there a dog here?') countDog('This dog runs faster than the other dog dude!') seq = ['soup','dog','salad','cat','great'] def caught_speeding(speed, is_birthday): if s_birthday == False: if speed <= 60: return "No ticket" elif speed >= 61 and speed <=80: return "small ticket" elif speed >81: return "Big ticket" else: return "pass" caught_speeding(81,False) caught_speeding(81,False) lst = ["7:00","7:30"] lst type(lst) type(lst[1]) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Split this string Step2: Given the variables Step3: Given this nested list, use indexing to grab the word "hello" Step4: Given this nested dictionary grab the word "hello". Be prepared, this will be annoying/tricky Step5: What is the main difference between a tuple and a list? Step6: Create a function that grabs the email website domain from a string in the form Step7: Create a basic function that returns True if the word 'dog' is contained in the input string. Don't worry about edge cases like a punctuation being attached to the word dog, but do account for capitalization. Step8: Create a function that counts the number of times the word "dog" occurs in a string. Again ignore edge cases. Step9: Use lambda expressions and the filter() function to filter out words from a list that don't start with the letter 's'. For example Step10: Final Problem Step11: Great job!
5,285
<ASSISTANT_TASK:> Python Code: %matplotlib inline import matplotlib.pyplot as plt import seaborn as sns import numpy as np from scipy.interpolate import interp1d, interp2d f = np.load('trajectory.npz') x = f['x'] y = f['y'] t = f['t'] assert isinstance(x, np.ndarray) and len(x)==40 assert isinstance(y, np.ndarray) and len(y)==40 assert isinstance(t, np.ndarray) and len(t)==40 x_approx = interp1d(t, x, kind='cubic') y_approx = interp1d(t, y, kind='cubic') traj_approx = interp2d(x, y, t, kind='cubic') newt = np.linspace(t.min(),max(t),200) newx = x_approx(newt) newy = y_approx(newt) assert newt[0]==t.min() assert newt[-1]==t.max() assert len(newt)==200 assert len(newx)==200 assert len(newy)==200 fig = plt.figure(figsize=(7,7)) plt.plot(newx, newy, marker='.') plt.plot(x, y, 'ro') plt.xticks([-1.0,-0.5,0.0,0.5,1.0]) plt.yticks([-1.0,-0.5,0.0,0.5,1.0]) plt.xlabel('x(t)') plt.ylabel('y(t)') assert True # leave this to grade the trajectory plot <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 2D trajectory interpolation Step2: Use these arrays to create interpolated functions $x(t)$ and $y(t)$. Then use those functions to create the following arrays Step3: Make a parametric plot of ${x(t),y(t)}$ that shows the interpolated values and the original points
5,286
<ASSISTANT_TASK:> Python Code: %matplotlib notebook import numpy as np import pandas as pd import statsmodels.api as sm import matplotlib.pyplot as plt # First we'll simulate the synthetic data def simulate_seasonal_term(periodicity, total_cycles, noise_std=1., harmonics=None): duration = periodicity * total_cycles assert duration == int(duration) duration = int(duration) harmonics = harmonics if harmonics else int(np.floor(periodicity / 2)) lambda_p = 2 * np.pi / float(periodicity) gamma_jt = noise_std * np.random.randn((harmonics)) gamma_star_jt = noise_std * np.random.randn((harmonics)) total_timesteps = 100 * duration # Pad for burn in series = np.zeros(total_timesteps) for t in range(total_timesteps): gamma_jtp1 = np.zeros_like(gamma_jt) gamma_star_jtp1 = np.zeros_like(gamma_star_jt) for j in range(1, harmonics + 1): cos_j = np.cos(lambda_p * j) sin_j = np.sin(lambda_p * j) gamma_jtp1[j - 1] = (gamma_jt[j - 1] * cos_j + gamma_star_jt[j - 1] * sin_j + noise_std * np.random.randn()) gamma_star_jtp1[j - 1] = (- gamma_jt[j - 1] * sin_j + gamma_star_jt[j - 1] * cos_j + noise_std * np.random.randn()) series[t] = np.sum(gamma_jtp1) gamma_jt = gamma_jtp1 gamma_star_jt = gamma_star_jtp1 wanted_series = series[-duration:] # Discard burn in return wanted_series duration = 100 * 3 periodicities = [10, 100] num_harmonics = [3, 2] std = np.array([2, 3]) np.random.seed(8678309) terms = [] for ix, _ in enumerate(periodicities): s = simulate_seasonal_term( periodicities[ix], duration / periodicities[ix], harmonics=num_harmonics[ix], noise_std=std[ix]) terms.append(s) terms.append(np.ones_like(terms[0]) * 10.) series = pd.Series(np.sum(terms, axis=0)) df = pd.DataFrame(data={'total': series, '10(3)': terms[0], '100(2)': terms[1], 'level':terms[2]}) h1, = plt.plot(df['total']) h2, = plt.plot(df['10(3)']) h3, = plt.plot(df['100(2)']) h4, = plt.plot(df['level']) plt.legend(['total','10(3)','100(2)', 'level']) plt.show() model = sm.tsa.UnobservedComponents(series.values, level='fixed intercept', freq_seasonal=[{'period': 10, 'harmonics': 3}, {'period': 100, 'harmonics': 2}]) res_f = model.fit(disp=False) print(res_f.summary()) # The first state variable holds our estimate of the intercept print("fixed intercept estimated as {0:.3f}".format(res_f.smoother_results.smoothed_state[0,-1:][0])) res_f.plot_components() plt.show() model.ssm.transition[:, :, 0] model = sm.tsa.UnobservedComponents(series, level='fixed intercept', seasonal=10, freq_seasonal=[{'period': 100, 'harmonics': 2}]) res_tf = model.fit() print(res_tf.summary()) # The first state variable holds our estimate of the intercept print("fixed intercept estimated as {0:.3f}".format(res_tf.smoother_results.smoothed_state[0,-1:][0])) res_tf.plot_components() plt.show() model = sm.tsa.UnobservedComponents(series, level='fixed intercept', freq_seasonal=[{'period': 100}]) res_lf = model.fit() print(res_lf.summary()) # The first state variable holds our estimate of the intercept print("fixed intercept estimated as {0:.3f}".format(res_lf.smoother_results.smoothed_state[0,-1:][0])) res_lf.plot_components() plt.show() model = sm.tsa.UnobservedComponents(series, level='fixed intercept', seasonal=100) res_lt = model.fit(disp=False) print(res_lt.summary()) # The first state variable holds our estimate of the intercept print("fixed intercept estimated as {0:.3f}".format(res_lt.smoother_results.smoothed_state[0,-1:][0])) res_lt.plot_components() plt.show() # Assign better names for our seasonal terms true_seasonal_10_3 = terms[0] true_seasonal_100_2 = terms[1] true_sum = true_seasonal_10_3 + true_seasonal_100_2 time_s = np.s_[:50] # After this they basically agree fig1 = plt.figure() ax1 = fig1.add_subplot(111) h1, = ax1.plot(series.index[time_s], res_f.freq_seasonal[0].filtered[time_s], label='Double Freq. Seas') h2, = ax1.plot(series.index[time_s], res_tf.seasonal.filtered[time_s], label='Mixed Domain Seas') h3, = ax1.plot(series.index[time_s], true_seasonal_10_3[time_s], label='True Seasonal 10(3)') plt.legend([h1, h2, h3], ['Double Freq. Seasonal','Mixed Domain Seasonal','Truth'], loc=2) plt.title('Seasonal 10(3) component') plt.show() time_s = np.s_[:50] # After this they basically agree fig2 = plt.figure() ax2 = fig2.add_subplot(111) h21, = ax2.plot(series.index[time_s], res_f.freq_seasonal[1].filtered[time_s], label='Double Freq. Seas') h22, = ax2.plot(series.index[time_s], res_tf.freq_seasonal[0].filtered[time_s], label='Mixed Domain Seas') h23, = ax2.plot(series.index[time_s], true_seasonal_100_2[time_s], label='True Seasonal 100(2)') plt.legend([h21, h22, h23], ['Double Freq. Seasonal','Mixed Domain Seasonal','Truth'], loc=2) plt.title('Seasonal 100(2) component') plt.show() time_s = np.s_[:100] fig3 = plt.figure() ax3 = fig3.add_subplot(111) h31, = ax3.plot(series.index[time_s], res_f.freq_seasonal[1].filtered[time_s] + res_f.freq_seasonal[0].filtered[time_s], label='Double Freq. Seas') h32, = ax3.plot(series.index[time_s], res_tf.freq_seasonal[0].filtered[time_s] + res_tf.seasonal.filtered[time_s], label='Mixed Domain Seas') h33, = ax3.plot(series.index[time_s], true_sum[time_s], label='True Seasonal 100(2)') h34, = ax3.plot(series.index[time_s], res_lf.freq_seasonal[0].filtered[time_s], label='Lazy Freq. Seas') h35, = ax3.plot(series.index[time_s], res_lt.seasonal.filtered[time_s], label='Lazy Time Seas') plt.legend([h31, h32, h33, h34, h35], ['Double Freq. Seasonal','Mixed Domain Seasonal','Truth', 'Lazy Freq. Seas', 'Lazy Time Seas'], loc=1) plt.title('Seasonal components combined') plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Synthetic data creation Step2: Unobserved components (frequency domain modeling) Step3: Observe that the fitted variances are pretty close to the true variances of 4 and 9. Further, the individual seasonal components look pretty close to the true seasonal components. The smoothed level term is kind of close to the true level of 10. Finally, our diagnostics look solid; the test statistics are small enough to fail to reject our three tests. Step4: The plotted components look good. However, the estimated variance of the second seasonal term is inflated from reality. Additionally, we reject the Ljung-Box statistic, indicating we may have remaining autocorrelation after accounting for our components. Step5: Note that one of our diagnostic tests would be rejected at the .05 level. Step6: The seasonal component itself looks good--it is the primary singal. The estimated variance of the seasonal term is very high ($>10^5$), leading to a lot of uncertainty in our one-step-ahead predictions and slow responsiveness to new data, as evidenced by large errors in one-step ahead predictions and observations. Finally, all three of our diagnostic tests were rejected.
5,287
<ASSISTANT_TASK:> Python Code: import numpy as np import matplotlib.pyplot as plt %matplotlib inline from IPython.display import HTML HTML('../style/course.css') #apply general CSS from scipy.optimize import leastsq plt.rcParams['figure.figsize'] = (18, 6) from IPython.display import HTML HTML('../style/code_toggle.html') def sinusoid(x, t): Returns a vector containing the values of a sinusoid with parameters x evaluated at points t. INPUTS: t Value of independent variable at the sampled points. x Vector of parameters. x1 = x[0] #Amplitude x2 = x[1] #Frequency x3 = x[2] #Phase-shift return x1*np.sin(2*np.pi*x2*t + x3) def sinusoid_jacobian(x, t): Returns the Jacobian corresponding to the function defined in sinusoid. INPUTS: t Value of independent variable at the sampled points. x Vector of parameters. x1 = x[0] #Amplitude x2 = x[1] #Frequency x3 = x[2] #Phase-shift jacobian = np.empty([t.shape[0], x.shape[0]]) jacobian[:,0] = np.sin(2*np.pi*x2*t + x3) jacobian[:,1] = 2*np.pi*t*x1*np.cos(2*np.pi*x2*t + x3) jacobian[:,2] = x1*np.cos(2*np.pi*x2*t + x3) return jacobian def sinusoid_residual(x, t, d): Returns a vector containing the residual values. INPUTS: d Vector of measured values. t Value of independent variable at the sampled points. x Vector of parameters. return d - sinusoid(x, t) t = np.arange(-0.06, 0.06, 0.06/300) #The points at which we will be taking our "measurements" noise = 2*np.random.normal(size=(t.shape[0])) #A noise vector which we will use to manufacture "real" measurements. true_x = np.array([10., 33.3, 0.52]) #The true values of our parameter vector. x = np.array([8., 43.5, 1.05]) #Initial guess of parameter vector for our solver. d = sinusoid(true_x, t) + noise #Our "observed" data, contructed from our true parameter values and the noise vector. m = sinusoid(x, t) #Our fitted function using the initial guess parameters. plt.plot(t, d) plt.plot(t, m) plt.show() def levenberg_marquardt(d, t, x, r_func, j_func, maxit=100, lamda=1, K=10, eps1=1e-6, eps2=1e-6): Returns a vector containing the optimal parameter values found by the algorithm. INPUTS: d Vector of measured values. t Value of independent variable at the sampled points. x Vector of parameters. r_func Function which generates the residual vector. j_func Function which generates the Jacobian. maxiter Maximum number of iterations. lamda Initial value of tuning parameter. K Initial value of retuning factor. eps1 First tolerance parameter - triggers when residual is below this number. eps2 Second tolerance parameter - triggers when relative changes to the parameter vector are below this number. #Initialises some important values and stores the original lamda value. r = r_func(x, t, d) old_chi = np.linalg.norm(r) olamda = lamda it = 0 while True: #Heavy lifting portion of the algorithm. Computes the parameter update. #This is just the implementation of the mathmatical update rule. J = j_func(x, t) JT = J.T JTJ = JT.dot(J) JTJdiag = np.eye(JTJ.shape[0])*JTJ JTJinv = np.linalg.pinv(JTJ + lamda*JTJdiag) JTr = JT.dot(r) delta_x = JTJinv.dot(JTr) x += delta_x #Convergence tests. If a solution has been found, returns the result. #The chi value is the norm of the residual and is used to determine #whether the solution is improving. If the chi value is sufficiently #small, the function terminates. The second test checks to see whether #or not the solution is improving, and terminates if it isn't. r = r_func(x, t, d) new_chi = np.linalg.norm(r) if new_chi < eps1: return x elif np.linalg.norm(delta_x) < eps2*(np.linalg.norm(x) + eps2): return x #Tuning stage. If the parameter update was good, continue and restore lamda. #If the update was bad, scale lamda by K and revert last update. if new_chi > old_chi: x -= delta_x lamda = lamda*K else: old_chi = new_chi lamda = olamda #If the number of iterations grows too large, return the last value of x. it += 1 if it >= maxit: return x solved_x = levenberg_marquardt(d, t, x, sinusoid_residual, sinusoid_jacobian) print(solved_x) plt.plot(t, d, label="Data") plt.plot(t, sinusoid(solved_x, t), label="LM") plt.plot(t, sinusoid(true_x, t), label="Truth") plt.xlabel("t") plt.legend(loc='upper right') plt.show() plt.plot(t, d, label="Data") plt.plot(t, sinusoid(solved_x, t), label="LM") plt.xlabel("t") plt.legend(loc='upper right') plt.show() x = np.array([8., 43.5, 1.05]) leastsq_x = leastsq(sinusoid_residual, x, args=(t, d)) print("scipy.optimize.leastsq: ", leastsq_x[0]) print("Our LM: ", solved_x) plt.plot(t, d, label="Data") plt.plot(t, sinusoid(leastsq_x[0], t), label="optimize.leastsq") plt.xlabel("t") plt.legend(loc='upper right') plt.show() x = np.array([8., 35., 1.05]) leastsq_x = leastsq(sinusoid_residual, x, args=(t, d)) print("scipy.optimize.leastsq: ", leastsq_x[0]) print("Our LM: ", solved_x) plt.plot(t, d, label="Data") plt.plot(t, sinusoid(leastsq_x[0], t), label="optimize.leastsq") plt.xlabel("t") plt.legend(loc='upper right') plt.show() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Import section specific modules Step5: 2.11 Least-squares Minimization<a id='groundwork Step6: The three functions defined above will be used frequently during the Levenberg-Marquardt solution procedure. The following few lines of code just set up the values we need to call the Levenberg-Marquardt solver. Step8: The following plots show the observed data and the curve corresponding to our initial guess for the parameters. Step9: The above is the main function of the Levenberg-Marquardt algorithm. The code may appear daunting at first, but all it does is implement the Levenberg-Marquardt update rule and some checks of convergence. We can now apply it to the problem with relative ease to obtain a numerical solution for our parameter vector. Step10: We can now compare our numerical result with both the truth and the data. The following plot shows the various quantities of interest. Step11: The fitted values are so close to the true values that it is almost impossible to differentiate between the red and green lines in the above plot. The true values have been omitted from the following plot to make it clearer that the numerical solution does an excellent job of arriving at the correct parameter values. Step12: A final, important thing to note is that the Levenberg-Marquardt algorithm is already implemented in Python. It is used in scipy.optimise.leastsq. This is often useful for doing rapid numerical solution without the need for an analytic Jacobian. As a simple proof, we can call the built-in method to verify our results. Step13: In this case, the built-in method clearly fails. I have done this deliberately to illustrate a point - a given implementation of an algorithm might not be the best one for your application. In this case, the manner in which the tuning parameters are handled prevents the solution from converging correctly. This can be avoided by choosing a starting guess closer to the truth and once again highlights the importance of initial values in problems of this type.
5,288
<ASSISTANT_TASK:> Python Code: import matplotlib.pyplot as plt import numpy as np import h5py, os, osr, copy %matplotlib inline import warnings warnings.filterwarnings('ignore') def aop_h5refl2array(refl_filename): aop_h5refl2array reads in a NEON AOP reflectance hdf5 file and returns 1. reflectance array (with the no data value and reflectance scale factor applied) 2. dictionary of metadata including spatial information, and wavelengths of the bands -------- Parameters refl_filename -- full or relative path and name of reflectance hdf5 file -------- Returns -------- reflArray: array of reflectance values metadata: dictionary containing the following metadata: bad_band_window1 (tuple) bad_band_window2 (tuple) bands: # of bands (float) data ignore value: value corresponding to no data (float) epsg: coordinate system code (float) map info: coordinate system, datum & ellipsoid, pixel dimensions, and origin coordinates (string) reflectance scale factor: factor by which reflectance is scaled (float) wavelength: wavelength values (float) wavelength unit: 'm' (string) -------- NOTE: This function applies to the NEON hdf5 format implemented in 2016, and should be used for data acquired 2016 and after. Data in earlier NEON hdf5 format (collected prior to 2016) is expected to be re-processed after the 2018 flight season. -------- Example Execution: -------- sercRefl, sercRefl_metadata = h5refl2array('NEON_D02_SERC_DP3_368000_4306000_reflectance.h5') import h5py #Read in reflectance hdf5 file hdf5_file = h5py.File(refl_filename,'r') #Get the site name file_attrs_string = str(list(hdf5_file.items())) file_attrs_string_split = file_attrs_string.split("'") sitename = file_attrs_string_split[1] #Extract the reflectance & wavelength datasets refl = hdf5_file[sitename]['Reflectance'] reflData = refl['Reflectance_Data'] reflRaw = refl['Reflectance_Data'].value #Create dictionary containing relevant metadata information metadata = {} metadata['map info'] = refl['Metadata']['Coordinate_System']['Map_Info'].value metadata['wavelength'] = refl['Metadata']['Spectral_Data']['Wavelength'].value #Extract no data value & scale factor metadata['data ignore value'] = float(reflData.attrs['Data_Ignore_Value']) metadata['reflectance scale factor'] = float(reflData.attrs['Scale_Factor']) #metadata['interleave'] = reflData.attrs['Interleave'] #Apply no data value reflClean = reflRaw.astype(float) arr_size = reflClean.shape if metadata['data ignore value'] in reflRaw: print('% No Data: ',np.round(np.count_nonzero(reflClean==metadata['data ignore value'])*100/(arr_size[0]*arr_size[1]*arr_size[2]),1)) nodata_ind = np.where(reflClean==metadata['data ignore value']) reflClean[nodata_ind]=np.nan #Apply scale factor reflArray = reflClean/metadata['reflectance scale factor'] #Extract spatial extent from attributes metadata['spatial extent'] = reflData.attrs['Spatial_Extent_meters'] #Extract bad band windows metadata['bad band window1'] = (refl.attrs['Band_Window_1_Nanometers']) metadata['bad band window2'] = (refl.attrs['Band_Window_2_Nanometers']) #Extract projection information #metadata['projection'] = refl['Metadata']['Coordinate_System']['Proj4'].value metadata['epsg'] = int(refl['Metadata']['Coordinate_System']['EPSG Code'].value) #Extract map information: spatial extent & resolution (pixel size) mapInfo = refl['Metadata']['Coordinate_System']['Map_Info'].value hdf5_file.close return reflArray, metadata help(aop_h5refl2array) aop_h5refl2array? serc_h5_tile = ('../data/NEON_D02_SERC_DP3_368000_4306000_reflectance.h5') sercRefl,sercMetadata = aop_h5refl2array(serc_h5_tile) sercRefl.shape def plot_aop_refl(band_array,refl_extent,colorlimit=(0,1),ax=plt.gca(),title='',cbar ='on',cmap_title='',colormap='Greys'): '''plot_refl_data reads in and plots a single band or 3 stacked bands of a reflectance array -------- Parameters -------- band_array: array of reflectance values, created from aop_h5refl2array refl_extent: extent of reflectance data to be plotted (xMin, xMax, yMin, yMax) use metadata['spatial extent'] from aop_h5refl2array function colorlimit: optional, range of values to plot (min,max). - helpful to look at the histogram of reflectance values before plotting to determine colorlimit. ax: optional, default = current axis title: optional; plot title (string) cmap_title: optional; colorbar title colormap: optional (string, see https://matplotlib.org/examples/color/colormaps_reference.html) for list of colormaps -------- Returns -------- plots flightline array of single band of reflectance data -------- Examples: -------- plot_aop_refl(sercb56, sercMetadata['spatial extent'], colorlimit=(0,0.3), title='SERC Band 56 Reflectance', cmap_title='Reflectance', colormap='Greys_r') ''' import matplotlib.pyplot as plt plot = plt.imshow(band_array,extent=refl_extent,clim=colorlimit); if cbar == 'on': cbar = plt.colorbar(plot,aspect=40); plt.set_cmap(colormap); cbar.set_label(cmap_title,rotation=90,labelpad=20) plt.title(title); ax = plt.gca(); ax.ticklabel_format(useOffset=False, style='plain'); #do not use scientific notation for ticklabels rotatexlabels = plt.setp(ax.get_xticklabels(),rotation=90); #rotate x tick labels 90 degrees sercb56 = sercRefl[:,:,55] plot_aop_refl(sercb56, sercMetadata['spatial extent'], colorlimit=(0,0.3), title='SERC Band 56 Reflectance', cmap_title='Reflectance', colormap='Greys_r') def stack_rgb(reflArray,bands): import numpy as np red = reflArray[:,:,bands[0]-1] green = reflArray[:,:,bands[1]-1] blue = reflArray[:,:,bands[2]-1] stackedRGB = np.stack((red,green,blue),axis=2) return stackedRGB rgb_bands = (58,34,19) print('Band 58 Center Wavelength = %.2f' %(sercMetadata['wavelength'][57]),'nm') print('Band 33 Center Wavelength = %.2f' %(sercMetadata['wavelength'][33]),'nm') print('Band 19 Center Wavelength = %.2f' %(sercMetadata['wavelength'][18]),'nm') SERCrgb = stack_rgb(sercRefl,rgb_bands) SERCrgb.shape plot_aop_refl(SERCrgb, sercMetadata['spatial extent'], title='SERC RGB Image', cbar='off') from skimage import exposure def plot_aop_rgb(rgbArray,ext,ls_pct=5,plot_title=''): from skimage import exposure pLow, pHigh = np.percentile(rgbArray[~np.isnan(rgbArray)], (ls_pct,100-ls_pct)) img_rescale = exposure.rescale_intensity(rgbArray, in_range=(pLow,pHigh)) plt.imshow(img_rescale,extent=ext) plt.title(plot_title + '\n Linear ' + str(ls_pct) + '% Contrast Stretch'); ax = plt.gca(); ax.ticklabel_format(useOffset=False, style='plain') #do not use scientific notation # rotatexlabels = plt.setp(ax.get_xticklabels(),rotation=90) #rotate x tick labels 90 degree plot_aop_rgb(SERCrgb, sercMetadata['spatial extent'], plot_title = 'SERC RGB') CIRbands = (90,34,19) print('Band 90 Center Wavelength = %.2f' %(sercMetadata['wavelength'][89]),'nm') print('Band 34 Center Wavelength = %.2f' %(sercMetadata['wavelength'][33]),'nm') print('Band 19 Center Wavelength = %.2f' %(sercMetadata['wavelength'][18]),'nm') SERCcir = stack_rgb(sercRefl,CIRbands) plot_aop_rgb(SERCcir, sercMetadata['spatial extent'], ls_pct=2, plot_title='SERC CIR') from IPython.html.widgets import * array = copy.copy(sercRefl) metadata = copy.copy(sercMetadata) def RGBplot_widget(R,G,B): #Pre-allocate array size rgbArray = np.zeros((array.shape[0],array.shape[1],3), 'uint8') Rband = array[:,:,R-1].astype(np.float) #Rband_clean = clean_band(Rband,Refl_md) Gband = array[:,:,G-1].astype(np.float) #Gband_clean = clean_band(Gband,Refl_md) Bband = array[:,:,B-1].astype(np.float) #Bband_clean = clean_band(Bband,Refl_md) rgbArray[..., 0] = Rband*256 rgbArray[..., 1] = Gband*256 rgbArray[..., 2] = Bband*256 # Apply Adaptive Histogram Equalization to Improve Contrast: img_nonan = np.ma.masked_invalid(rgbArray) #first mask the image img_adapteq = exposure.equalize_adapthist(img_nonan, clip_limit=0.10) plot = plt.imshow(img_adapteq,extent=metadata['spatial extent']); plt.title('Bands: \nR:' + str(R) + ' (' + str(round(metadata['wavelength'][R-1])) +'nm)' + '\n G:' + str(G) + ' (' + str(round(metadata['wavelength'][G-1])) + 'nm)' + '\n B:' + str(B) + ' (' + str(round(metadata['wavelength'][B-1])) + 'nm)'); ax = plt.gca(); ax.ticklabel_format(useOffset=False, style='plain') rotatexlabels = plt.setp(ax.get_xticklabels(),rotation=90) interact(RGBplot_widget, R=(1,426,1), G=(1,426,1), B=(1,426,1)) rgbArray = copy.copy(SERCrgb) def linearStretch(percent): pLow, pHigh = np.percentile(rgbArray[~np.isnan(rgbArray)], (percent,100-percent)) img_rescale = exposure.rescale_intensity(rgbArray, in_range=(pLow,pHigh)) plt.imshow(img_rescale,extent=sercMetadata['spatial extent']) plt.title('SERC RGB \n Linear ' + str(percent) + '% Contrast Stretch'); ax = plt.gca() ax.ticklabel_format(useOffset=False, style='plain') rotatexlabels = plt.setp(ax.get_xticklabels(),rotation=90) interact(linearStretch,percent=(0,20,1)) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step2: The first function we will use is aop_h5refl2array. This function is loaded into the cell below, we encourage you to look through the code to understand what it is doing -- most of these steps should look familiar to you from the first lesson. This function can be thought of as a wrapper to automate the steps required to read AOP hdf5 reflectance tiles into a Python format. This function also cleans the data Step3: If you forget what this function does, or don't want to scroll up to read the docstrings, remember you can use help or ? to display the associated docstrings. Step4: Now that we have an idea of how this function works, let's try it out. First, define the path where th e reflectance data is stored and use os.path.join to create the full path to the data file. Note that if you want to run this notebook later on a different reflectance tile, you just have to change this variable. Step5: Now that we've specified our reflectance tile, we can call aop_h5refl2array to read in the reflectance tile as a python array called sercRefl , and the associated metadata into a dictionary sercMetadata Step6: We can use the shape method to see the dimensions of the array we read in. NEON tiles are (1000 x 1000 x # of bands), the number of bands may vary depending on the hyperspectral sensor used, but should be in the vicinity of 426. Step7: plot_aop_refl Step8: Now that we have loaded this function, let's extract a single band from the SERC reflectance array and plot it Step9: RGB Plots - Band Stacking Step10: First, we will look at red, green, and blue bands, whos indices are defined below. To confirm that these band indices correspond to wavelengths in the expected portion of the spectrum, we can print out the wavelength values stored in metadata['wavelength'] Step11: Below we use stack_rgb to create an RGB array. Check that the dimensions of this array are as expected. Step12: plot_aop_refl Step13: You'll notice that this image is very dark; it is possible to make out some of the features (roads, buildings), but it is not ideal. Since colorlimits don't apply to 3-band images, we have to use some other image processing tools to enhance the visibility of this image. Step14: False Color Image - Color Infrared (CIR) Step15: Demo Step16: Demo
5,289
<ASSISTANT_TASK:> Python Code: #@title Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # https://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import tensorflow as tf import numpy as np tf.constant(u"Thanks 😊") tf.constant([u"You're", u"welcome!"]).shape # Unicode string, represented as a UTF-8 encoded string scalar. text_utf8 = tf.constant(u"语言处理") text_utf8 # Unicode string, represented as a UTF-16-BE encoded string scalar. text_utf16be = tf.constant(u"语言处理".encode("UTF-16-BE")) text_utf16be # Unicode string, represented as a vector of Unicode code points. text_chars = tf.constant([ord(char) for char in u"语言处理"]) text_chars tf.strings.unicode_decode(text_utf8, input_encoding='UTF-8') tf.strings.unicode_encode(text_chars, output_encoding='UTF-8') tf.strings.unicode_transcode(text_utf8, input_encoding='UTF8', output_encoding='UTF-16-BE') # A batch of Unicode strings, each represented as a UTF8-encoded string. batch_utf8 = [s.encode('UTF-8') for s in [u'hÃllo', u'What is the weather tomorrow', u'Göödnight', u'😊']] batch_chars_ragged = tf.strings.unicode_decode(batch_utf8, input_encoding='UTF-8') for sentence_chars in batch_chars_ragged.to_list(): print(sentence_chars) batch_chars_padded = batch_chars_ragged.to_tensor(default_value=-1) print(batch_chars_padded.numpy()) batch_chars_sparse = batch_chars_ragged.to_sparse() nrows, ncols = batch_chars_sparse.dense_shape.numpy() elements = [['_' for i in range(ncols)] for j in range(nrows)] for (row, col), value in zip(batch_chars_sparse.indices.numpy(), batch_chars_sparse.values.numpy()): elements[row][col] = str(value) # max_width = max(len(value) for row in elements for value in row) value_lengths = [] for row in elements: for value in row: value_lengths.append(len(value)) max_width = max(value_lengths) print('[%s]' % '\n '.join( '[%s]' % ', '.join(value.rjust(max_width) for value in row) for row in elements)) tf.strings.unicode_encode([[99, 97, 116], [100, 111, 103], [99, 111, 119]], output_encoding='UTF-8') tf.strings.unicode_encode(batch_chars_ragged, output_encoding='UTF-8') tf.strings.unicode_encode( tf.RaggedTensor.from_sparse(batch_chars_sparse), output_encoding='UTF-8') tf.strings.unicode_encode( tf.RaggedTensor.from_tensor(batch_chars_padded, padding=-1), output_encoding='UTF-8') # Note that the final character takes up 4 bytes in UTF8. thanks = u'Thanks 😊'.encode('UTF-8') num_bytes = tf.strings.length(thanks).numpy() num_chars = tf.strings.length(thanks, unit='UTF8_CHAR').numpy() print('{} bytes; {} UTF-8 characters'.format(num_bytes, num_chars)) # Here, unit='BYTE' (default). Returns a single byte with len=1 tf.strings.substr(thanks, pos=7, len=1).numpy() # Specifying unit='UTF8_CHAR', returns a single 4 byte character in this case print(tf.strings.substr(thanks, pos=7, len=1, unit='UTF8_CHAR').numpy()) tf.strings.unicode_split(thanks, 'UTF-8').numpy() codepoints, offsets = tf.strings.unicode_decode_with_offsets(u'🎈🎉🎊', 'UTF-8') for (codepoint, offset) in zip(codepoints.numpy(), offsets.numpy()): print('At byte offset {}: codepoint {}'.format(offset, codepoint)) uscript = tf.strings.unicode_script([33464, 1041]) # ['芸', 'Б'] print(uscript.numpy()) # [17, 8] == [USCRIPT_HAN, USCRIPT_CYRILLIC] print(tf.strings.unicode_script(batch_chars_ragged)) # dtype: string; shape: [num_sentences] # # The sentences to process. Edit this line to try out different inputs! sentence_texts = [u'Hello, world.', u'世界こんにちは'] # dtype: int32; shape: [num_sentences, (num_chars_per_sentence)] # # sentence_char_codepoint[i, j] is the codepoint for the j'th character in # the i'th sentence. sentence_char_codepoint = tf.strings.unicode_decode(sentence_texts, 'UTF-8') print(sentence_char_codepoint) # dtype: int32; shape: [num_sentences, (num_chars_per_sentence)] # # sentence_char_scripts[i, j] is the Unicode script of the j'th character in # the i'th sentence. sentence_char_script = tf.strings.unicode_script(sentence_char_codepoint) print(sentence_char_script) # dtype: bool; shape: [num_sentences, (num_chars_per_sentence)] # # sentence_char_starts_word[i, j] is True if the j'th character in the i'th # sentence is the start of a word. sentence_char_starts_word = tf.concat( [tf.fill([sentence_char_script.nrows(), 1], True), tf.not_equal(sentence_char_script[:, 1:], sentence_char_script[:, :-1])], axis=1) # dtype: int64; shape: [num_words] # # word_starts[i] is the index of the character that starts the i'th word (in # the flattened list of characters from all sentences). word_starts = tf.squeeze(tf.where(sentence_char_starts_word.values), axis=1) print(word_starts) # dtype: int32; shape: [num_words, (num_chars_per_word)] # # word_char_codepoint[i, j] is the codepoint for the j'th character in the # i'th word. word_char_codepoint = tf.RaggedTensor.from_row_starts( values=sentence_char_codepoint.values, row_starts=word_starts) print(word_char_codepoint) # dtype: int64; shape: [num_sentences] # # sentence_num_words[i] is the number of words in the i'th sentence. sentence_num_words = tf.reduce_sum( tf.cast(sentence_char_starts_word, tf.int64), axis=1) # dtype: int32; shape: [num_sentences, (num_words_per_sentence), (num_chars_per_word)] # # sentence_word_char_codepoint[i, j, k] is the codepoint for the k'th character # in the j'th word in the i'th sentence. sentence_word_char_codepoint = tf.RaggedTensor.from_row_lengths( values=word_char_codepoint, row_lengths=sentence_num_words) print(sentence_word_char_codepoint) tf.strings.unicode_encode(sentence_word_char_codepoint, 'UTF-8').to_list() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Unicode strings Step2: The tf.string data type Step3: A tf.string tensor treats byte strings as atomic units. This enables it to store byte strings of varying lengths. The string length is not included in the tensor dimensions. Step4: If you use Python to construct strings, note that string literals are Unicode-encoded by default. Step5: Converting between representations Step6: Batch dimensions Step7: You can use this tf.RaggedTensor directly, or convert it to a dense tf.Tensor with padding or a tf.SparseTensor using the methods tf.RaggedTensor.to_tensor and tf.RaggedTensor.to_sparse. Step8: When encoding multiple strings with the same lengths, use a tf.Tensor as the input. Step9: When encoding multiple strings with varying length, use a tf.RaggedTensor as the input. Step10: If you have a tensor with multiple strings in padded or sparse format, convert it first into a tf.RaggedTensor before calling tf.strings.unicode_encode. Step11: Unicode operations Step12: Character substrings Step13: Split Unicode strings Step14: Byte offsets for characters Step15: Unicode scripts Step16: The tf.strings.unicode_script operation can also be applied to multidimensional tf.Tensors or tf.RaggedTensors of codepoints Step17: Example Step18: First, decode the sentences into character codepoints, and find the script identifeir for each character. Step19: Use the script identifiers to determine where word boundaries should be added. Add a word boundary at the beginning of each sentence, and for each character whose script differs from the previous character. Step20: You can then use those start offsets to build a RaggedTensor containing the list of words from all batches. Step21: To finish, segment the word codepoints RaggedTensor back into sentences and encode into UTF-8 strings for readability.
5,290
<ASSISTANT_TASK:> Python Code: import inspect import types import sys # I sometimes need to choose PyTorch... #sys.path.insert(0, '/home/tv/pytorch/pytorch/build/lib.linux-x86_64-3.8//') import torch import torch.utils.dlpack # import TVM import sys import os tvm_root = '/home/tv/rocm/tvm/tvm/' tvm_paths = [os.path.join(tvm_root, p) for p in ['python', 'topi/python', 'nnvm/python']] os.environ['PYTHONPATH'] = ':'.join([os.environ.get('PYTHONPATH', '')] + tvm_paths) for p in tvm_paths: sys.path.insert(0, p) import tvm import tvm.relay torch.cuda.get_device_name() import transformers from transformers import BertModel, BertTokenizer, BertConfig import numpy import torch enc = BertTokenizer.from_pretrained("bert-base-uncased") # Tokenizing input text text = "[CLS] Who was Jim Henson ? [SEP] Jim Henson was a puppeteer [SEP]" tokenized_text = enc.tokenize(text) # Masking one of the input tokens masked_index = 8 tokenized_text[masked_index] = '[MASK]' indexed_tokens = enc.convert_tokens_to_ids(tokenized_text) segments_ids = [0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1] # Creating a dummy input tokens_tensor = torch.tensor([indexed_tokens]) segments_tensors = torch.tensor([segments_ids]) dummy_input = [tokens_tensor, segments_tensors] # If you are instantiating the model with `from_pretrained` you can also easily set the TorchScript flag model = BertModel.from_pretrained("bert-base-uncased", torchscript=True) model.eval() for p in model.parameters(): p.requires_grad_(False) transformers.__version__ dtype = torch.float32 dtype_str = str(dtype).split('.')[-1] # Creating the trace model.to(dtype) traced_model = torch.jit.trace(model, [tokens_tensor, segments_tensors]) traced_model.eval() for p in traced_model.parameters(): p.requires_grad_(False) class DebugWrap(torch.nn.Module): def __init__(self, root, target_qn): super().__init__() self.root = (root,) # Hide from PyTorch parent, = self.root target_qn = target_qn.split('.') self.target_basename = target_qn[-1] for nc in target_qn[:-1]: parent = getattr(parent, nc) self.parent = (parent,) target = getattr(parent, self.target_basename) self.wrapped = target setattr(parent, self.target_basename, self) def remove(self): parent, = self.parent setattr(parent, self.target_basename, self.wrapped) self.root = None def forward(self, *inp, **kwinp): assert self.root is not None self.DEBUG_INP = inp self.DEBUG_KWINP = kwinp out = self.wrapped(*inp, **kwinp) self.DEBUG_OUT = out return out import graphviz def visualize(expr, collapse_small=True, node_attr_dict = {}): def collect_ops(node): ops = set() def visitor(e): if isinstance(e, tvm.ir.Op): ops.add(e.name) tvm.relay.analysis.post_order_visit(node, visitor) return ops # node_dict maps a Relay node to an index (node ID) def _traverse_expr(node, node_dict): if node in node_dict: return node_dict[node] = len(node_dict) node_dict = {} tvm.relay.analysis.post_order_visit(expr, lambda x: _traverse_expr(x, node_dict)) relayviz_nodes = [] dot = graphviz.Digraph(format='svg') dot.attr('node', shape = 'box') def to_str(node): if isinstance(node, tvm.relay.Constant): return repr(node).lstrip('Constant(')[:-1] else: raise NotImplementedError("to_str:" + repr(node)) def is_small_const(c): if not (collapse_small and isinstance(c, tvm.relay.Constant)): return False if isinstance(c.data, tvm.runtime.ndarray.NDArray): return numpy.prod(c.data.shape) < 10 return True # Sort by node ID for node, node_id in sorted(node_dict.items(), key=lambda x: x[1]): if isinstance(node, tvm.relay.Function): dot.node(str(node_id), 'Function', **node_attr_dict.get(node, {})) dot.edge(str(node_dict[node.body]), str(node_id)) elif isinstance(node, tvm.relay.Var): if node.type_annotation is not None: if hasattr(node.type_annotation, 'shape'): shape = tuple([int(x) for x in node.type_annotation.shape]) dtype = node.type_annotation.dtype typstr = 'Tensor[{}, {}]'.format(shape, dtype) else: typstr = str(node.type_annotation) else: typstr = '?' d = dict(shape = 'ellipse') d.update(node_attr_dict.get(node, {})) dot.node(str(node_id), '{}: {}'.format( node.name_hint, typstr ), **d) elif isinstance(node, tvm.relay.Tuple): dot.node(str(node_id), 'Tuple[...])', **node_attr_dict.get(node, {})) for field in node.fields: dot.edge(str(node_dict[field]), str(node_id)) elif isinstance(node, tvm.relay.Constant): if not is_small_const(node): # small consts are shown in ops dot.node(str(node_id), 'Constant({}, {})'.format(node.data.shape, node.data.dtype), **node_attr_dict.get(node, {})) elif isinstance(node, tvm.relay.Call): args_with_edge = [] arg_str_list = [] for arg in node.args: if is_small_const(arg): arg_str_list.append(to_str(arg)) else: arg_str_list.append('·') args_with_edge.append(arg) arg_str = ', '.join(arg_str_list) if isinstance(node.op, tvm.ir.Op): name = node.op.name attrs = {k:getattr(node.attrs, k) for k in node.attrs.keys()} if hasattr(node.attrs, 'keys') else {} #attrs = inspect.getmembers(node.attrs) attr_str_list = [k+'='+(str(v) if len(str(v))<15 else "...") for k, v in attrs.items()] if attr_str_list: attr_str = '| '+ ', '.join(attr_str_list) else: attr_str = '' else: ops = collect_ops(node) if ops: name = '_'.join(ops) else: name = '...' attr_str = '' s = f'{name}({arg_str}{attr_str})' dot.node(str(node_id), s, **node_attr_dict.get(node, {})) for arg in args_with_edge: dot.edge(str(node_dict[arg]), str(node_id)) elif isinstance(node, tvm.ir.Op): # dot.node(str(node_id), 'Op {}'.format(node.name)) pass # covered in call elif isinstance(node, tvm.relay.TupleGetItem): dot.node(str(node_id), 'TupleGetItem(idx={})'.format(node.index), **node_attr_dict.get(node, {})) dot.edge(str(node_dict[node.tuple_value]), str(node_id)) elif isinstance(node, tvm.relay.Let): dot.node(str(node_id), 'Let(XX)', **node_attr_dict.get(node, {})) dot.edge(str(node_dict[node.value]), str(node_id)) dot.edge(str(node_id), str(node_dict[node.var])) else: raise RuntimeError( 'Unknown node type. node_id: {}, node: {}'.format(node_id, type(node))) return dot try: debug_wrap = DebugWrap(model, "encoder.layer.0") # encoder.layer.0.attention.self tt = tokens_tensor.cpu() st = segments_tensors.cpu() model(tt, st) finally: debug_wrap.remove() model.train() traced_module = torch.jit.trace(debug_wrap.wrapped, [i.to(dtype) for i in debug_wrap.DEBUG_INP[:2]]) shape_list = [(i.debugName().split('.')[0], i.type().sizes()) for i in list(traced_module.graph.inputs())[1:]] mod, mod_params = tvm.relay.frontend.from_pytorch(traced_module, shape_list, default_dtype=dtype_str) # the converter will output arguments in an arbitrary order (well, by position of use), we want that of the input fn = mod['main'] # Careful traced module's vs. non-traced module's parameter ordering. # Anecdotally, I have not seen orderings differ between the two, though. arg_order = ([n for n, _ in shape_list] +[n for n, _ in traced_module.named_parameters()]) tmp_arg_idx = {p.name_hint: i for i, p in enumerate(fn.params)} fn = tvm.relay.Function([fn.params[tmp_arg_idx[n]] for n in arg_order], fn.body) visualize(fn) import numpy def work_on_fn(pass_cls): def apply_pass(fn_or_mod): if isinstance(fn_or_mod, tvm.IRModule): return pass_cls()(fn_or_mod) if isinstance(fn_or_mod, tvm.relay.Function): return pass_cls()( tvm.IRModule({'main': fn_or_mod}))['main'] raise NotImplemented("unsupporded type {}".format(type(fn_or_mod))) return apply_pass infer_type = work_on_fn(tvm.relay.transform.InferType) to_graph_normal_form = work_on_fn(tvm.relay.transform.ToGraphNormalForm) dead_code_elimination = work_on_fn(tvm.relay.transform.DeadCodeElimination) eliminate_common_subexpr = work_on_fn(tvm.relay.transform.EliminateCommonSubexpr) class ShapeConstDedupMutator(tvm.relay.ExprMutator): def __init__(self): super().__init__() self.shape_consts = {} def visit_call(self, call): if (isinstance(call.op, tvm.ir.Op) and call.op.name in {"reshape", "broadcast_to", "collapse_sum_to"} and isinstance(call.args[1], tvm.relay.Constant)): # assert list(call.attrs.newshape) == list(call.args[1].data.asnumpy()) new_fn = self.visit(call.op) new_args = [self.visit(arg) for arg in call.args] const = new_args[1] assert const.data.dtype.startswith('int') and len(const.data.shape)==1 key = tuple(const.data.asnumpy()) if key in self.shape_consts: new_args[1] = self.shape_consts[key] else: self.shape_consts[key] = new_args[1] return tvm.relay.Call(new_fn, new_args, call.attrs) return super().visit_call(call) class TransposeDedupMutator(tvm.relay.ExprMutator): def visit_call(self, call): if (isinstance(call.op, tvm.ir.Op) and call.op.name == "transpose" and isinstance(call.args[0], tvm.relay.Call) and isinstance(call.args[0].op, tvm.ir.Op) and call.args[0].op.name == "transpose"): axes = [call.args[0].attrs.axes[int(i)] for i in call.attrs.axes] new_inp = self.visit(call.args[0].args[0]) if axes == list(range(len(axes))): # neutral permutation, should really do this separately... return new_inp return tvm.relay.transpose(new_inp, axes) return super().visit_call(call) #@tvm.relay.transform.function_pass(opt_level=1) #def TransposeDedup(fn, mod, ctx): # return TransposeDedupMutator().visit(fn) class ZeroZapp(tvm.relay.dataflow_pattern.DFPatternCallback): def __init__(self): self.zeros = tvm.relay.dataflow_pattern.is_op("zeros")(tvm.relay.dataflow_pattern.wildcard()) self.other_tensor = tvm.relay.dataflow_pattern.wildcard() self.pattern = (self.zeros + self.other_tensor) | (self.other_tensor + self.zeros) def callback(self, pre, post, node_map): rt = node_map[self.pattern][0] ot = node_map[self.other_tensor][0] if (ot._checked_type_ == rt._checked_type_): return ot else: return tvm.relay.broadcast_to(ot, list(rt._checked_type_.shape)) class ZeroZapp(tvm.relay.dataflow_pattern.DFPatternCallback): def __init__(self): self.ones = tvm.relay.dataflow_pattern.is_op("zeros")(tvm.relay.dataflow_pattern.wildcard()) | tvm.relay.dataflow_pattern.is_constant() self.other_tensor = tvm.relay.dataflow_pattern.wildcard() self.pattern = (self.ones + self.other_tensor) | (self.other_tensor + self.ones) def callback(self, pre, post, node_map): rt = node_map[self.pattern][0] ones = node_map[self.ones][0] ot = node_map[self.other_tensor][0] if isinstance(ones, tvm.relay.Constant): val = ones.data.asnumpy() if not ((val == 0) if numpy.isscalar(val) else (val == 0).all()): return rt # I don't know why I don't reliably get checked types here... if (((rt._checked_type_ is not None) and (ot._checked_type_ == rt._checked_type_)) or (rt.type_args[0] == rt.type_args[1])): return ot elif (rt._checked_type_ is not None): return tvm.relay.broadcast_to(ot, list(rt._checked_type_.shape)) return rt class OneZapp(tvm.relay.dataflow_pattern.DFPatternCallback): def __init__(self): self.ones = tvm.relay.dataflow_pattern.is_op("ones")(tvm.relay.dataflow_pattern.wildcard()) | tvm.relay.dataflow_pattern.is_constant() self.other_tensor = tvm.relay.dataflow_pattern.wildcard() self.pattern = (self.ones * self.other_tensor) | (self.other_tensor * self.ones) def callback(self, pre, post, node_map): global val rt = node_map[self.pattern][0] ones = node_map[self.ones][0] ot = node_map[self.other_tensor][0] if isinstance(ones, tvm.relay.Constant): val = ones.data.asnumpy() if not ((val == 1) if numpy.isscalar(val) else (val == 1).all()): return rt if (((rt._checked_type_ is not None) and (ot._checked_type_ == rt._checked_type_)) or (rt.type_args[0] == rt.type_args[1])): return ot if (rt._checked_type_ is not None): return tvm.relay.broadcast_to(ot, list(rt._checked_type_.shape)) return rt class LikeZapp(tvm.relay.dataflow_pattern.DFPatternCallback): def __init__(self): self.translations_with_dt = {'zeros_like': tvm.relay.zeros, 'ones_like': tvm.relay.ones} self.data_tensor = tvm.relay.dataflow_pattern.wildcard() self.pattern_tensor = tvm.relay.dataflow_pattern.wildcard() self.pattern = ((tvm.relay.dataflow_pattern.is_op("zeros_like") | tvm.relay.dataflow_pattern.is_op("ones_like") )(self.data_tensor) ) | (( tvm.relay.dataflow_pattern.is_op("collapse_sum_like") | tvm.relay.dataflow_pattern.is_op("reshape_like") | tvm.relay.dataflow_pattern.is_op("broadcast_to_like") )(self.data_tensor, self.pattern_tensor)) def callback(self, pre, post, node_map): data = node_map[self.data_tensor][0] res = node_map[self.pattern][0] if res.op.name in self.translations_with_dt: ret = self.translations_with_dt[res.op.name](list(res.type_args[0].shape), res.type_args[0].dtype) # which dtype? return ret if (res.type_args[0] is not None and res.type_args[0] == res.type_args[1]): return data if res.op.name == 'broadcast_to_like': return tvm.relay.broadcast_to(data, list(res.type_args[1].shape)) if res.op.name == 'reshape_like': return tvm.relay.reshape(data, list(res.type_args[1].shape)) if res.op.name == 'collapse_sum_like': return tvm.relay.collapse_sum_to(data, list(res.type_args[1].shape)) return res class DecomposeLayerNorm(tvm.relay.dataflow_pattern.DFPatternCallback): # TVM doesn't have a LayerNorm backward def __init__(self): self.pattern = tvm.relay.dataflow_pattern.is_op("nn.layer_norm")( tvm.relay.dataflow_pattern.wildcard(), tvm.relay.dataflow_pattern.wildcard(), tvm.relay.dataflow_pattern.wildcard()) def callback(self, pre, post, node_map): # probably only 1d... res = node_map[self.pattern][0] inp, weight, bias = res.args mean = tvm.relay.mean(inp, axis=res.attrs.axis, keepdims=True) std = tvm.relay.std(inp, axis=res.attrs.axis, keepdims=True) res_new = ((inp - mean) / (std + tvm.relay.const(res.attrs.epsilon, dtype=res.type_args[0].dtype))) * weight + bias return res_new class ExternalizeDropout(tvm.relay.dataflow_pattern.DFPatternCallback): # TVM doesn't have a Dropout defined (for inference it can be deleted) # but it also does not appear to have random, so we make the random draw # an input def __init__(self): self.dropout_info = {} self.counter = 0 self.inp = tvm.relay.dataflow_pattern.wildcard() self.dropout = tvm.relay.dataflow_pattern.is_op("nn.dropout")(self.inp) self.pattern = tvm.relay.dataflow_pattern.is_tuple_get_item(self.dropout, 0) def callback(self, pre, post, node_map): res = node_map[self.pattern][0] dropout = node_map[self.dropout][0] inp = node_map[self.inp][0] typ = dropout.type_args[0] rate = dropout.attrs.rate name = f"dropout:{self.counter}" self.counter += 1 do_var = tvm.relay.var(name, type_annotation=typ) self.dropout_info[name] = (rate, typ) return inp * (do_var * tvm.relay.const(1 / (1 - rate), dtype=typ.dtype)) def externalize_dropout(fn): edo = ExternalizeDropout() fn = tvm.relay.dataflow_pattern.rewrite(edo, fn) return fn, edo.dropout_info fn = TransposeDedupMutator().visit(fn) fn = infer_type(fn) output_type = fn.body.checked_type if isinstance(output_type, tvm.relay.TensorType): gr_out = tvm.relay.var("gr:out", output_type) fn_for_gr = tvm.relay.Function(list(fn.params) + [gr_out], tvm.relay.sum(fn.body * gr_out)) else: # we can try to handle tuples of tensors, but our nesting patience ends there assert (isinstance(output_type, tvm.relay.TupleType) and all([isinstance(f, tvm.relay.TensorType) for f in output_type.fields])) gr_outs = [tvm.relay.var(f"gr:out:{i}", t) for i, t in enumerate(output_type.fields)] prods_with_gr_out = [tvm.relay.sum(tvm.relay.TupleGetItem(fn.body, i) * go_i) for i, go_i in enumerate(gr_outs)] s = prods_with_gr_out[0] for p in prods_with_gr_out[1:]: s = s + p fn_for_gr = tvm.relay.Function(list(fn.params) + gr_outs, s) fn_for_gr = infer_type(fn_for_gr) fn_for_gr = tvm.relay.dataflow_pattern.rewrite(DecomposeLayerNorm(), fn_for_gr) fn_for_gr = infer_type(fn_for_gr) fn_for_gr, dropout_info = externalize_dropout(fn_for_gr) fn_for_gr = infer_type(fn_for_gr) visualize(fn_for_gr) grfn = tvm.relay.transform.gradient(fn_for_gr, mode='first_order') grfn = to_graph_normal_form(grfn) # Now we have (sum(orig_out * grad_out), (grad_inp_1, ..., grad_inp_n, grad_grad_out, gr_dropout ...)) # but we only want orig_out and grad_inp_1, ..., grad_inp_n def is_aux_input(p): return p.name_hint.startswith('dropout:') or p.name_hint.startswith('gr:out:') # the gr_out and dropout parameters will have gradients computed, but we do not want that grads_to_keep = tvm.relay.Tuple([g for p, g in zip(grfn.params, grfn.body.fields[1].fields) if not is_aux_input(p)]) assert grfn.body.fields[0].op.name == 'sum' assert grfn.body.fields[0].args[0].op.name == 'multiply' if isinstance(output_type, tvm.relay.TensorType): orig_out = grfn.body.fields[0].args[0].args[0] else: assert isinstance(output_type, tvm.relay.TupleType) orig_out = grfn.body.fields[0].args[0].args[0].tuple_value out_and_grad = tvm.relay.Tuple([orig_out, grads_to_keep]) out_and_grad_fn = tvm.relay.Function(grfn.params, out_and_grad) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = dead_code_elimination(out_and_grad_fn) out_and_grad_fn = eliminate_common_subexpr(out_and_grad_fn) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = tvm.relay.dataflow_pattern.rewrite(LikeZapp(), out_and_grad_fn) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = tvm.relay.dataflow_pattern.rewrite(ZeroZapp(), out_and_grad_fn) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = tvm.relay.dataflow_pattern.rewrite(OneZapp(), out_and_grad_fn) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = tvm.relay.dataflow_pattern.rewrite(OneZapp(), out_and_grad_fn) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = dead_code_elimination(out_and_grad_fn) out_and_grad_fn = eliminate_common_subexpr(out_and_grad_fn) visualize(out_and_grad_fn) orig_out = out_and_grad_fn.body.fields[0] grad_ins = out_and_grad_fn.body.fields[1] color_dict = {} def color(n, c): if n in color_dict: return color_dict[n] = c for a in getattr(n, 'args', []): color(a, c) for a in getattr(n, 'fields', []): color(a, c) for nam in ('body', 'tuple_value'): b = getattr(n, nam, None) if b is not None: color(b, c) color(orig_out, {'color': 'red'}) seen = set() def color_crossings(n, c): if n in seen: return seen.add(n) if n in color_dict: color_dict[n] = c return for a in getattr(n, 'args', []): color_crossings(a, c) for a in getattr(n, 'fields', []): color_crossings(a, c) for nam in ('body', 'tuple_value'): b = getattr(n, nam, None) if b is not None: color_crossings(b, c) color_crossings(grad_ins, {'color': 'blue'}) visualize(out_and_grad_fn, node_attr_dict=color_dict) nodes_to_capture = [n for n, v in color_dict.items() if v['color'] == 'blue' and not isinstance(n, (tvm.relay.Constant, tvm.relay.Var))] capture_tup = tvm.relay.Tuple(nodes_to_capture) nodes_to_capture_idx = {n:i for i, n in enumerate(nodes_to_capture)} capture_vars = [tvm.relay.var(f"input:captures:{i}", type_annotation=nodes_to_capture[i].checked_type) for i, n in enumerate(nodes_to_capture)] grads_in = out_and_grad_fn.body.fields[1] needed_vars = set() class GradientOnlyMutator(tvm.relay.ExprMutator): def __init__(self): super().__init__() def visit_var(self, var): needed_vars.add(var) return var def visit(self, expr): if expr in nodes_to_capture_idx: return capture_vars[nodes_to_capture_idx[expr]] return super().visit(expr) grads_in_only = GradientOnlyMutator().visit(grads_in) gr_only_fn = tvm.relay.Function(sorted(needed_vars) + capture_vars, grads_in_only) # TODO: check against output of original fn_for_gr_input_names = {p.name_hint for p in fn_for_gr.params} needed_var_names = {v.name_hint for v in needed_vars} assert needed_var_names <= fn_for_gr_input_names inputs_to_keep = [n for n in needed_vars if not is_aux_input(n)] capture_tup = tvm.relay.Tuple([n for n in nodes_to_capture]) fw_and_cap_params = [p for p in out_and_grad_fn.params if not p.name_hint.startswith('gr:out:')] fw_and_cap_fn = tvm.relay.Function(fw_and_cap_params, tvm.relay.Tuple((out_and_grad_fn.body.fields[0],) + (capture_tup,))) visualize(fw_and_cap_fn) if isinstance(fn.body, tvm.relay.Tuple): # tuple of tensors output fw_and_cap_fn_flattened = tvm.relay.Function(fw_and_cap_fn.params, tvm.relay.Tuple(list(fw_and_cap_fn.body.fields[0].fields) # or single tensor + list(fw_and_cap_fn.body.fields[1].fields))) else: # single tensor output fw_and_cap_fn_flattened = tvm.relay.Function(fw_and_cap_fn.params, tvm.relay.Tuple([fw_and_cap_fn.body.fields[0]] + list(fw_and_cap_fn.body.fields[1].fields))) target = 'rocm -model=gfx906' target_host = 'llvm' ctx = tvm.context(target) fw_and_cap_mod = tvm.IRModule({"main": fw_and_cap_fn_flattened}) with tvm.transform.PassContext(opt_level=3): graph, lib, params = tvm.relay.build(fw_and_cap_mod, target=target, target_host=target_host, params={}) fw_and_cap_compiled_module = tvm.contrib.graph_runtime.create(graph, lib, ctx) fw_and_cap_compiled_module.set_input(**params) gr_only_mod = tvm.IRModule({"main": gr_only_fn}) with tvm.transform.PassContext(opt_level=3): graph, lib, params = tvm.relay.build(gr_only_mod, target=target, target_host=target_host, params={}) gr_only_compiled_module = tvm.contrib.graph_runtime.create(graph, lib, ctx) gr_only_compiled_module.set_input(**params) # we do have funny const tensors from TVM :/ def tensor_to_tvm(t): return tvm.nd.from_dlpack(torch.utils.dlpack.to_dlpack(t)) def tensor_from_tvm(a): return(torch.utils.dlpack.from_dlpack(a.to_dlpack())) debug_wrap.wrapped.cuda() traced_module.cuda() model_params_tvm = {k: tensor_to_tvm(v) for k, v in debug_wrap.wrapped.state_dict().items()} inp_c = [i.cuda() for i in debug_wrap.DEBUG_INP[:2]] inp_tvm = [tensor_to_tvm(i) for i in inp_c] dropout_info torch.manual_seed(12345) drop_c = {} for k in dropout_info.keys(): # we don't know the order p, typ = dropout_info[k] drop_c[k] = torch.nn.functional.dropout(torch.ones([int(i) for i in typ.shape], dtype=getattr(torch, typ.dtype), device="cuda"), p=p)*(1-p) drop_tvm = {n: tensor_to_tvm(t) for n, t in drop_c.items()} fw_and_cap_compiled_module.set_input('input', inp_tvm[0]) fw_and_cap_compiled_module.set_input('attention_mask', inp_tvm[1]) fw_and_cap_compiled_module.set_input(**model_params_tvm) fw_and_cap_compiled_module.set_input(**drop_tvm) fw_and_cap_compiled_module.run() torch.manual_seed(12345) debug_wrap.wrapped.train() numpy.abs(fw_and_cap_compiled_module.get_output(0).asnumpy()-debug_wrap.wrapped(*inp_c)[0].detach().cpu().numpy()).max() gr_out_c = torch.randn(debug_wrap.DEBUG_OUT[0].shape, device="cuda", dtype=debug_wrap.DEBUG_OUT[0].dtype) num_captures = len(capture_vars) num_regular_outputs = len(fw_and_cap_fn_flattened.body.fields) - num_captures captured_values = {v.name_hint: fw_and_cap_compiled_module.get_output(num_regular_outputs + i) for i, v in enumerate(capture_vars)} #gr_only_compiled_module.set_input('input', inp_tvm[0]) #gr_only_compiled_module.set_input('attention_mask', inp_tvm[1]) gr_only_compiled_module.set_input(**drop_tvm) gr_only_compiled_module.set_input(**model_params_tvm) gr_only_compiled_module.set_input(**captured_values) gr_only_compiled_module.set_input('gr:out:0', tensor_to_tvm(gr_out_c)) gr_only_compiled_module.run() torch.manual_seed(12345) debug_wrap.wrapped.train() inp_c_rq = [i.requires_grad_() for i in inp_c] for p in debug_wrap.wrapped.parameters(): p.requires_grad_() res = debug_wrap.wrapped(*inp_c_rq)[0] grads_pt = torch.autograd.grad(res, inp_c_rq + list(debug_wrap.wrapped.parameters()), gr_out_c, allow_unused=True) for i, g_pt in enumerate(grads_pt): print(numpy.abs(gr_only_compiled_module.get_output(i).asnumpy() - g_pt.cpu().numpy()).max()) fw_input_names = [p.name_hint for p in fw_and_cap_fn_flattened.params if not is_aux_input(p)] input_to_idx = {n:i for i, n in enumerate(fw_input_names)} inputs_to_keep_idx = [input_to_idx[i.name_hint] for i in inputs_to_keep] class TVMFunction(torch.autograd.Function): # nb. using the modules is not thread safe... @staticmethod def forward(ctx, *inputs): assert len(inputs) == len(fw_input_names) assert all([i.is_cuda for i in inputs]) drop_c = {} for k in dropout_info.keys(): # we don't know the order p, typ = dropout_info[k] drop_c[k] = torch.nn.functional.dropout(torch.ones([int(i) for i in typ.shape], dtype=getattr(torch, typ.dtype), device="cuda"), p=p)*(1-p) # we don't need to worry about PyTorch changing these because they're not visible. # so we don't need save_for_backward here drop_tvm = {n: tensor_to_tvm(t) for n, t in drop_c.items()} ctx.drop_tvm = drop_tvm fw_and_cap_compiled_module.set_input(**drop_tvm) inputs_tvm = [tensor_to_tvm(t) for t in inputs] for n, i in zip(fw_input_names, inputs_tvm): fw_and_cap_compiled_module.set_input(n, i) fw_and_cap_compiled_module.run() if isinstance(output_type, tvm.relay.TensorType): res = tensor_from_tvm(fw_and_cap_compiled_module.get_output(0)) num_outputs = 1 else: res = tuple(tensor_from_tvm(fw_and_cap_compiled_module.get_output(i)) for i in range(len(output_type.fields))) num_outputs = len(res) ctx.save_for_backward(*([inputs[i] for i in inputs_to_keep_idx] +[tensor_from_tvm(fw_and_cap_compiled_module.get_output(i)) for i in range(num_outputs, fw_and_cap_compiled_module.get_num_outputs())])) return res @staticmethod def backward(ctx, *grad_outs): saved = ctx.saved_tensors kept_inputs = {fw_input_names[i]: tensor_to_tvm(t) for i, t in zip(inputs_to_keep_idx, saved[:len(inputs_to_keep_idx)])} gr_only_compiled_module.set_input(**kept_inputs) captures = {f'input:captures:{i}': tensor_to_tvm(t) for i, t in enumerate(saved[len(kept_inputs):])} gr_only_compiled_module.set_input(**captures) grad_outs_tvm = {f"gr:out:{i}": tensor_to_tvm(go) for i, go in enumerate(grad_outs)} gr_only_compiled_module.set_input(**grad_outs_tvm) gr_only_compiled_module.set_input(**ctx.drop_tvm) gr_only_compiled_module.run() grad_in = [tensor_from_tvm(gr_only_compiled_module.get_output(i)) for i in range(gr_only_compiled_module.get_num_outputs())] return tuple(grad_in) def tvm_fn(*inputs): return TVMFunction.apply(*inputs) tvm_fn.__signature__ = inspect.signature(tvm_fn).replace( parameters=[inspect.Parameter(n.replace('.', '__'), inspect.Parameter.POSITIONAL_ONLY) for n in fw_input_names]) inp_all = (inp_c_rq + list(traced_module.parameters())) torch.manual_seed(12345) res_tvm = tvm_fn(*inp_all) grad_outs = tuple(torch.randn_like(r) for r in res_tvm) grads_tvm = torch.autograd.grad(res_tvm, inp_all, grad_outs) assert len(grads_tvm) == len(grads_pt) list((g1-g2).abs().max().item() for g1, g2 in zip(grads_tvm, grads_pt)) def create_tvm_function_from_traced_module(traced_module): assert traced_model.training, "We only do training right now" dt = next(traced_module.parameters()).dtype.__str__().split('.')[-1] shape_list = [(i.debugName().split('.')[0], i.type().sizes()) for i in list(traced_module.graph.inputs())[1:]] mod, mod_params = tvm.relay.frontend.pytorch.from_pytorch(traced_module, shape_list, default_dtype=dt) # the converter will output arguments in an arbitrary order (well, by position of use), we want that of the input fn = mod['main'] # Careful traced module's vs. non-traced module's parameter ordering. # Anecdotally, I have not seen orderings differ between the two, though. arg_order = ([n for n, _ in shape_list] +[n for n, _ in traced_module.named_parameters()]) tmp_arg_idx = {p.name_hint: i for i, p in enumerate(fn.params)} fn = tvm.relay.Function([fn.params[tmp_arg_idx[n]] for n in arg_order], fn.body) fn = TransposeDedupMutator().visit(fn) # prepare function to also use grad_out fn = infer_type(fn) output_type = fn.body.checked_type # fn.ret_type :) if isinstance(output_type, tvm.relay.TensorType): gr_out = tvm.relay.var("gr:out", output_type) fn_for_gr = tvm.relay.Function(list(fn.params) + [gr_out], tvm.relay.sum(fn.body * gr_out)) else: # we can try to handle tuples of tensors, but our nesting patience ends there assert (isinstance(output_type, tvm.relay.TupleType) and all([isinstance(f, tvm.relay.TensorType) for f in output_type.fields])) gr_outs = [tvm.relay.var(f"gr:out:{i}", t) for i, t in enumerate(output_type.fields)] prods_with_gr_out = [tvm.relay.sum(tvm.relay.TupleGetItem(fn.body, i) * go_i) for i, go_i in enumerate(gr_outs)] s = prods_with_gr_out[0] for p in prods_with_gr_out[1:]: s = s + p fn_for_gr = tvm.relay.Function(list(fn.params) + gr_outs, s) fn_for_gr = infer_type(fn_for_gr) fn_for_gr = tvm.relay.dataflow_pattern.rewrite(DecomposeLayerNorm(), fn_for_gr) fn_for_gr = infer_type(fn_for_gr) fn_for_gr, dropout_info = externalize_dropout(fn_for_gr) fn_for_gr = infer_type(fn_for_gr) # take the gradient grfn = tvm.relay.transform.gradient(fn_for_gr, mode='first_order') grfn = to_graph_normal_form(grfn) # removing of unneeded outputs and simplifications of the gradient # Now we have (sum(orig_out * grad_out), (grad_inp_1, ..., grad_inp_n, grad_grad_out, gr_dropout ...)) # but we only want orig_out and grad_inp_1, ..., grad_inp_n def is_aux_input(p): return p.name_hint.startswith('dropout:') or p.name_hint.startswith('gr:out:') # the gr_out and dropout parameters will have gradients computed, but we do not want that grads_to_keep = tvm.relay.Tuple([g for p, g in zip(grfn.params, grfn.body.fields[1].fields) if not is_aux_input(p)]) assert grfn.body.fields[0].op.name == 'sum' assert grfn.body.fields[0].args[0].op.name == 'multiply' if isinstance(output_type, tvm.relay.TensorType): orig_out = grfn.body.fields[0].args[0].args[0] else: assert isinstance(output_type, tvm.relay.TupleType) orig_out = grfn.body.fields[0].args[0].args[0].tuple_value out_and_grad = tvm.relay.Tuple([orig_out, grads_to_keep]) out_and_grad_fn = tvm.relay.Function(grfn.params, out_and_grad) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = dead_code_elimination(out_and_grad_fn) out_and_grad_fn = eliminate_common_subexpr(out_and_grad_fn) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = tvm.relay.dataflow_pattern.rewrite(LikeZapp(), out_and_grad_fn) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = tvm.relay.dataflow_pattern.rewrite(ZeroZapp(), out_and_grad_fn) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = tvm.relay.dataflow_pattern.rewrite(OneZapp(), out_and_grad_fn) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = tvm.relay.dataflow_pattern.rewrite(OneZapp(), out_and_grad_fn) out_and_grad_fn = infer_type(out_and_grad_fn) out_and_grad_fn = dead_code_elimination(out_and_grad_fn) out_and_grad_fn = eliminate_common_subexpr(out_and_grad_fn) # split the graph into forward and backward orig_out = out_and_grad_fn.body.fields[0] grad_ins = out_and_grad_fn.body.fields[1] color_dict = {} def color(n, c): if n in color_dict: return color_dict[n] = c for a in getattr(n, 'args', []): color(a, c) for a in getattr(n, 'fields', []): color(a, c) for nam in ('body', 'tuple_value'): b = getattr(n, nam, None) if b is not None: color(b, c) color(orig_out, {'color': 'red'}) seen = set() def color_crossings(n, c): if n in seen: return seen.add(n) if n in color_dict: color_dict[n] = c return for a in getattr(n, 'args', []): color_crossings(a, c) for a in getattr(n, 'fields', []): color_crossings(a, c) for nam in ('body', 'tuple_value'): b = getattr(n, nam, None) if b is not None: color_crossings(b, c) color_crossings(grad_ins, {'color': 'blue'}) nodes_to_capture = [n for n, v in color_dict.items() if v['color'] == 'blue' and not isinstance(n, (tvm.relay.Constant, tvm.relay.Var))] capture_tup = tvm.relay.Tuple(nodes_to_capture) nodes_to_capture_idx = {n:i for i, n in enumerate(nodes_to_capture)} capture_vars = [tvm.relay.var(f"input:captures:{i}", type_annotation=nodes_to_capture[i].checked_type) for i, n in enumerate(nodes_to_capture)] grads_in = out_and_grad_fn.body.fields[1] needed_vars = set() class GradientOnlyMutator(tvm.relay.ExprMutator): def __init__(self): super().__init__() def visit_var(self, var): needed_vars.add(var) return var def visit(self, expr): if expr in nodes_to_capture_idx: return capture_vars[nodes_to_capture_idx[expr]] return super().visit(expr) grads_in_only = GradientOnlyMutator().visit(grads_in) # TODO: check against output of original fn_for_gr_input_names = {p.name_hint for p in fn_for_gr.params} needed_var_names = {v.name_hint for v in needed_vars} gr_only_fn = tvm.relay.Function(sorted(needed_vars) + capture_vars, grads_in_only) assert needed_var_names <= fn_for_gr_input_names inputs_to_keep = [n for n in needed_vars if not is_aux_input(n)] # build the forward function that also returns the data for the backward capture_tup = tvm.relay.Tuple([n for n in nodes_to_capture]) fw_and_cap_params = [p for p in out_and_grad_fn.params if not p.name_hint.startswith('gr:out:')] fw_and_cap_fn = tvm.relay.Function(fw_and_cap_params, tvm.relay.Tuple((out_and_grad_fn.body.fields[0],) + (capture_tup,))) if isinstance(fn.body, tvm.relay.Tuple): # tuple of tensors output fw_and_cap_fn_flattened = tvm.relay.Function(fw_and_cap_fn.params, tvm.relay.Tuple(list(fw_and_cap_fn.body.fields[0].fields) # or single tensor + list(fw_and_cap_fn.body.fields[1].fields))) else: # single tensor output fw_and_cap_fn_flattened = tvm.relay.Function(fw_and_cap_fn.params, tvm.relay.Tuple([fw_and_cap_fn.body.fields[0]] + list(fw_and_cap_fn.body.fields[1].fields))) target = 'rocm -model=gfx906' target_host = 'llvm' ctx = tvm.context(target) fw_and_cap_mod = tvm.IRModule({"main": fw_and_cap_fn_flattened}) with tvm.transform.PassContext(opt_level=3): graph, lib, params = tvm.relay.build(fw_and_cap_mod, target=target, target_host=target_host, params={}) fw_and_cap_compiled_module = tvm.contrib.graph_runtime.create(graph, lib, ctx) fw_and_cap_compiled_module.set_input(**params) gr_only_mod = tvm.IRModule({"main": gr_only_fn}) with tvm.transform.PassContext(opt_level=3): graph, lib, params = tvm.relay.build(gr_only_mod, target=target, target_host=target_host, params={}) gr_only_compiled_module = tvm.contrib.graph_runtime.create(graph, lib, ctx) gr_only_compiled_module.set_input(**params) # we may have funny const tensors from TVM fw_input_names = [p.name_hint for p in fw_and_cap_fn_flattened.params if not is_aux_input(p)] input_to_idx = {n:i for i, n in enumerate(fw_input_names)} inputs_to_keep_idx = [input_to_idx[i.name_hint] for i in inputs_to_keep] class TVMFunction(torch.autograd.Function): # nb. using the compiled_modules is not thread safe... @staticmethod def forward(ctx, *inputs): assert len(inputs) == len(fw_input_names) assert all([i.is_cuda for i in inputs]) drop_c = {} for k in dropout_info.keys(): # we don't know the order p, typ = dropout_info[k] drop_c[k] = torch.nn.functional.dropout(torch.ones([int(i) for i in typ.shape], dtype=getattr(torch, typ.dtype), device="cuda"), p=p)*(1-p) # we don't need to worry about PyTorch changing these because they're not visible. # so we don't need save_for_backward here drop_tvm = {n: tensor_to_tvm(t) for n, t in drop_c.items()} ctx.drop_tvm = drop_tvm fw_and_cap_compiled_module.set_input(**drop_tvm) inputs_tvm = [tensor_to_tvm(t) for t in inputs] for n, i in zip(fw_input_names, inputs_tvm): fw_and_cap_compiled_module.set_input(n, i) fw_and_cap_compiled_module.run() if isinstance(output_type, tvm.relay.TensorType): res = tensor_from_tvm(fw_and_cap_compiled_module.get_output(0)) num_outputs = 1 else: res = tuple(tensor_from_tvm(fw_and_cap_compiled_module.get_output(i)) for i in range(len(output_type.fields))) num_outputs = len(res) ctx.save_for_backward(*([inputs[i] for i in inputs_to_keep_idx] +[tensor_from_tvm(fw_and_cap_compiled_module.get_output(i)) for i in range(num_outputs, fw_and_cap_compiled_module.get_num_outputs())])) return res @staticmethod def backward(ctx, *grad_outs): saved = ctx.saved_tensors kept_inputs = {fw_input_names[i]: tensor_to_tvm(t) for i, t in zip(inputs_to_keep_idx, saved[:len(inputs_to_keep_idx)])} gr_only_compiled_module.set_input(**kept_inputs) captures = {f'input:captures:{i}': tensor_to_tvm(t) for i, t in enumerate(saved[len(kept_inputs):])} gr_only_compiled_module.set_input(**captures) grad_outs_tvm = {f"gr:out:{i}": tensor_to_tvm(go) for i, go in enumerate(grad_outs)} gr_only_compiled_module.set_input(**grad_outs_tvm) gr_only_compiled_module.set_input(**ctx.drop_tvm) gr_only_compiled_module.run() grad_in = [tensor_from_tvm(gr_only_compiled_module.get_output(i)) for i in range(gr_only_compiled_module.get_num_outputs())] return tuple(grad_in) def tvm_fn(*inputs): return TVMFunction.apply(*inputs) tvm_fn.__signature__ = inspect.signature(tvm_fn).replace( parameters=[inspect.Parameter(n.replace('.', '__'), inspect.Parameter.POSITIONAL_ONLY) for n in fw_input_names]) return tvm_fn tvm_fn = create_tvm_function_from_traced_module(traced_module) inp_all = (inp_c_rq + list(traced_module.parameters())) torch.manual_seed(12345) res_tvm = tvm_fn(*inp_all) grad_outs = tuple(torch.randn_like(r) for r in res_tvm) grads_tvm = torch.autograd.grad(res_tvm, inp_all, grad_outs) torch.manual_seed(12345) res_pt = traced_module(*inp_c_rq) grads_pt = torch.autograd.grad(res_pt, inp_all, grad_outs) assert len(res_tvm) == len(res_pt) and len(grads_tvm) == len(grads_pt) (list((r1-r2).abs().max().item() for r1, r2 in zip(res_tvm, res_pt)), list((g1-g2).abs().max().item() for g1, g2 in zip(grads_tvm, grads_pt))) def add_tvm_dispatch(module, sample_inputs): traced_module = torch.jit.trace(module, sample_inputs, ) tvm_fn = create_tvm_function_from_traced_module(traced_module) tvm_input_shapes = [(i.shape, i.dtype, i.device) for i in sample_inputs] old_forward = module.forward old_remove_tvm_dispatch = getattr(module, 'remove_tvm_dispatch', None) def forward(self, *inputs): input_shapes = [(i.shape, i.dtype, i.device) for i in inputs] if tvm_input_shapes != input_shapes: res = old_forward(*inputs) else: inp_all = inputs + tuple(self.parameters()) res = tvm_fn(*inp_all) return res def remove_tvm_dispatch(self): self.forward = old_forward if old_remove_tvm_dispatch is not None: self.remove_tvm_dispatch = old_remove_tvm_dispatch module.remove_tvm_dispatch = types.MethodType(remove_tvm_dispatch, module) module.forward = types.MethodType(forward, module) module = debug_wrap.wrapped inp_c2 = [torch.cat([i, i], dim=0) for i in inp_c] # batch size 2 will be new type(module) add_tvm_dispatch(module, inp_c) module.forward(*inp_c) module(*inp_c2) # different shape module.remove_tvm_dispatch() # cleaning up tasks1 = tvm.autotvm.task.extract_from_program(fw_and_cap_fn_flattened, target=target, params=params) tasks2 = tvm.autotvm.task.extract_from_program(gr_only_mod["main"], target=target, params=params) log_filename = 'bert-train-0.log' n_trial = 20 # for real tuning, make this 2000! def do_tune(tasks, log_filename): tmp_log_file = log_filename + ".tmp" for i, tsk in enumerate(reversed(tasks)): prefix = "[Task %2d/%2d] " %(i+1, len(tasks)) # we use threading and tornado here to work around TVM and Jupyter colliding over IOLoops # In a regular python command line, you should be able to just call the tuner... import threading import tornado # create tuner tuner = tvm.autotvm.tuner.XGBTuner(tsk, loss_type='rank') if os.path.isfile(tmp_log_file): tuner.load_history(tvm.autotvm.record.load_from_file(tmp_log_file)) # do tuning tsk_trial = min(n_trial, len(tsk.config_space)) def tune_task_fn(): iol = tornado.ioloop.IOLoop() # we need an event loop tuner.tune( n_trial=n_trial, early_stopping=600, measure_option=tvm.autotvm.measure_option( builder=tvm.autotvm.LocalBuilder(timeout=10), runner=tvm.autotvm.LocalRunner(number=20, repeat=3, timeout=4, min_repeat_ms=150)), callbacks=[ tvm.autotvm.callback.progress_bar(tsk_trial, prefix=prefix), tvm.autotvm.callback.log_to_file(tmp_log_file) ]) tuning_thread = threading.Thread(target=tune_task_fn) # create a thread start it and wait on it tuning_thread.start() tuning_thread.join() # done tuning, on to the next task # pick best records to a cache file tvm.autotvm.record.pick_best(tmp_log_file, log_filename) #do_tune(tasks1+tasks2, log_filename) with tvm.autotvm.apply_history_best(log_filename): tvm_fn = create_tvm_function_from_traced_module(traced_module) def x(): for i in range(100): res_tvm = tvm_fn(*inp_all) grads_tvm = torch.autograd.grad(res_tvm, inp_all, grad_outs) ctx.sync() x() %timeit x() def x(): for i in range(100): res_pt = traced_module(*inp_c_rq) grads_pt = torch.autograd.grad(res_pt, inp_all, grad_outs) torch.cuda.synchronize() x() %timeit x() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Helpfully, transformers supports tracing their model with the PyTorch JIT. We use their tutorial on it, the following is copied straight from the tutorial Step2: Now we can trace our model. As we want to do inference, we impose evaluation mode and not requiring gradients for the parameters. Step3: Readers of the PyTorch Bert & TVM tutorial will recall the wrapper we had for getting inputs and outputs of a submodule of the model. Step4: We also had a fancy visualization. We now have a small addition, the dictionary to specify attributes for nodes. This will come in handy later. Step5: Let's wrap the first BertLayer in our model. You could also take smaller bits if you run my tutorials on your phone and want smaller graphs. Step6: We trace the module. Step7: Let's convert the traced model to TVM. This works just as before. Step8: One thing we'll do in between is to move from a module interface - with named parameters - to a functional Step9: Let's look at our function. Step10: As in the BERT inference, we want to run some optimization passes. Step11: As hinted at above, TVM's gradient taking assumes that it is the last element in the computation (the ones-Tensors discussed above). This isn't a good fit with PyTorch's modular view which expects a grad_out for each output to be given. Happily, this is computationally equivalent to multiplying by grad out and summation, so we amend our function with that. We wish to be flexible, so we allow both functions returning a single tensor and those returning a tuple of tensors. Step12: Finally we can take the grad. As we get a lot of let nodes, we bring it to normal form. Step13: TVM's gradient-taking returns a function that has the same parameters as the original function (in our case amended with the grad_out and dropout) and then returns a tuple of the original return and a tuple containing gradients for all inputs. Step14: Now is a good time to take a look at our graph Step15: But in PyTorch, we first compute the forward and then the backwards, so we have to take out the saw and Step16: Now we can split the function as described above. We collect the blue nodes as to capture - but constants will Step17: Now we can split out the backward, replacing all the blue nodes with variables. Step18: Next we take the forward and amend it to also return the required intermediates. Step19: TVM cannot return nested tuples, so we flatten the output in the function. Again we differentiate between tensor-valued functions and tuple valued ones (i.e. those returning potentially multiple tensors). Step20: And at last, we can let TVM do its magic and compile our functions. Step21: Time to give it a spin. We define convenience functions to move tensors between PyTorch and TVM and get the model parameters as a TVM dictionary. Step22: Similarly, we get the inputs on the GPU in PyTorch and TVM. Step23: We need to deal with the dropout. It will turn out that our record of the dropout random draws happens in the same order as the dropout in the model. We did a depth-first search on the computational graph to find them and if the values of the the dropout are connected in the graph rather than being on independent branches, this will be the order in which PyTorch draws the matrices, too. If not, good luck fiddeling with the order. Step24: Now we can run the forward. Step25: And we can compare the output to PyTorch's Step26: Supergood. Let's also try the backward. We generate a grad_out, set all the variables and run the backward model and run the backward model Step27: On the PyTorch side, it is easiest to re-run the forward (remembering to reset the random seed) and get the grads. Step28: Did it work? It seems so Step29: But we wanted to get something running in PyTorch, right? Step30: Because calling TVMFunction.apply does not please the eye, we define a convenience function and because we always love to have proper signatures, we also give it the names of our inputs. Step31: Let's check everything still works. Step32: Yay! Step33: Let's give it a spin and see that it hasn't stopped working. Step34: Even better Step35: All done! Step36: Performance Step37: We build with our log.
5,291
<ASSISTANT_TASK:> Python Code: # Load data X = np.concatenate((np.ones((pima.shape[0],1)),pima[:,0:8]), axis=1) Y = pima[:,8] Xs = (X - np.mean(X, axis=0))/np.concatenate((np.ones(1),np.std(X[:,1:], axis=0))) n, p = X.shape nsample = 1 nbatch = 768 M = np.identity(p) C = 0 * np.identity(p) eps = 0.1 m = 10 V = 0 * np.identity(p) theta = np.zeros(p) ### HMC version def logistic(x): return 1/(1+np.exp(-x)) def U(theta, Y, X): return - (Y.T @ X @ theta - np.sum(np.log(1+np.exp(X @ theta))) - 0.5 * phi * np.sum(theta**2)) def gradU(theta, Y, X, nbatch): '''A function that returns the stochastic gradient. Adapted from Eq. 5. Inputs are: theta, the parameters Y, the response X, the covariates nbatch, the number of samples to take from the full data ''' n = X.shape[0] Y_pred = logistic(X @ theta) epsilon = (Y[:,np.newaxis] - Y_pred[:,np.newaxis]) grad = X.T @ epsilon - phi * theta[:, np.newaxis] return -grad/n #temp = -grad/n #return temp / np.linalg.norm(temp) def hmc(Y, X, gradU, M, eps, m, theta, C, V): theta0 = theta.copy() # This is just HMC for testing n = X.shape[0] p = X.shape[1] # Precompute Minv = np.linalg.inv(M) # Randomly sample momentum r = np.random.multivariate_normal(np.zeros(p),M)[:,np.newaxis] # Intial energy H0 = U(theta, Y, X) + 0.5 * np.asscalar(r.T @ Minv @ r) # Hamiltonian dynamics r = r - (eps/2)*gradU(theta, Y, X, nbatch) for i in range(m): theta = theta + (eps*Minv@r).ravel() r = r - eps*gradU(theta, Y, X, nbatch) theta = theta + (eps*Minv@r).ravel() r = r - (eps/2)*gradU(theta, Y, X, nbatch) # Final energy H1 = U(theta, Y, X) + np.asscalar(0.5 * r.T @ Minv @ r) # MH step u = np.random.uniform() #rho = np.exp(H1 - H0) rho = np.exp(H0 - H1) #print('(H0, H1, rho): %s,%s,%s' % (H0, H1, rho)) if u < np.min((1, rho)): return theta.copy() else: return theta0.copy() # reject return theta def my_gd(Y, X, gradU, M, eps, m, theta, C, V): # gradient descent n = X.shape[0] p = X.shape[1] for i in range(m): theta = theta - eps*gradU(theta, Y, X, nbatch).ravel() return theta from sklearn.linear_model import LogisticRegression # Unscaled mod_logis = LogisticRegression(fit_intercept=False, C=1e50) mod_logis.fit(X,Y) beta_true_unscale = mod_logis.coef_.ravel() beta_true_unscale # Scaled mod_logis = LogisticRegression(fit_intercept=False, C=1e50) mod_logis.fit(Xs,Y) beta_true_scale = mod_logis.coef_.ravel() beta_true_scale U(np.ones(p)*.1,Y,X) phi = 1 gradU(np.ones(p)*.1, Y, X, 1)*n # HMC - Unscaled nsample = 10000 m = 20 eps = .0001 #theta = np.zeros(p) theta = beta_true_unscale.copy() phi = 0.01 np.random.seed(2) samples = np.zeros((nsample, p)) u = np.zeros(nsample) for i in range(nsample): theta = hmc(Y, X, gradU, M, eps, m, theta, C, V) samples[i] = theta u[i] = U(theta, Y, X) np.mean(samples, axis=0) - beta_true_unscale plt.plot((samples - beta_true_unscale)[:,4]) plt.show() plt.plot(u) plt.show() beta_true_unscale # HMC - Scaled nsample = 10000 m = 20 eps = .001 theta = np.zeros(p) #theta = beta_true_scale.copy() phi = 0.1 np.random.seed(2) samples = np.zeros((nsample, p)) u = np.zeros(nsample) for i in range(nsample): theta = hmc(Y, Xs, gradU, M, eps, m, theta, C, V) samples[i] = theta u[i] = U(theta, Y, Xs) np.mean(samples, axis=0) - beta_true_scale plt.plot((samples - beta_true_scale)[:,1]) plt.show() plt.plot(u) plt.show() # HMC - Scaled (no intercept) nsample = 10000 m = 20 eps = .001 theta = np.zeros(p-1) #theta = beta_true_scale.copy()[1:] phi = 1 np.random.seed(2) samples = np.zeros((nsample, p-1)) u = np.zeros(nsample) for i in range(nsample): theta = hmc(Y, Xs[:,1:], gradU, np.identity(p-1), eps, m, theta, C, V) samples[i] = theta u[i] = U(theta, Y, Xs[:,1:]) np.mean(samples, axis=0) - beta_true_scale[1:] plt.plot((samples - beta_true_scale[1:])[:,5]) plt.show() plt.plot(u) plt.show() # Gradient descent - Unscaled np.random.seed(2) #res = my_gd(Y, X, gradU, M, .0001, 10000, np.zeros(p), C, V) # Starting at zero #res = my_gd(Y, X, gradU, M, .0001, 10000, beta_true_unscale.copy(), C, V) # Starting at true values res = my_gd(Y, X, gradU, M, .0001, 10000, beta_true_unscale.copy(), C, V) # Starting at true values res - beta_true_unscale # Gradient descent - Scaled np.random.seed(2) res = my_gd(Y, Xs, gradU, M, .1, 20000, np.zeros(p), C, V) res - beta_true_scale # Cliburn's gradient descent code def gd(X, y, beta, alpha, niter): Gradient descent algorihtm. n, p = X.shape Xt = X.T for i in range(niter): y_pred = logistic(X @ beta) epsilon = y - y_pred grad = Xt @ epsilon / n beta += alpha * grad return beta # Unscaled #res = gd(X, Y.ravel(), np.zeros(p), alpha=.1, niter=2) # Starting at zero res = gd(X, Y.ravel(), beta_true_unscale.copy(), alpha=.0001, niter=10000) # Starting at true coefficients res - beta_true_unscale # Scaled res = gd(Xs, Y.ravel(), np.zeros(p), alpha=.1, niter=20000) res - beta_true_scale <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Correct coefficients Step2: Our code - HMC Step3: Our code - Gradient descent Step5: Cliburn's code
5,292
<ASSISTANT_TASK:> Python Code: trace0 = go.Scatter( x=[1, 2, 3, 4], y=[10, 15, 13, 17] ) trace1 = go.Scatter( x=[1, 2, 3, 4], y=[16, 5, 11, 9] ) data = go.Data([trace0, trace1]) py.iplot(data, filename = 'basic-line') alpha = np.array([5, 5, 5]) rv = st.dirichlet(alpha) coord_step = 0.01 coord_range = np.arange(coord_step, 1, coord_step) xv, yv = np.meshgrid(coord_range, coord_range) figure(figsize=(12, 10)) sns.heatmap(xv) figure(figsize=(12, 10)) sns.heatmap(yv) zv = 1.0 - xv - yv zv = np.where(zv > 0.0, zv, np.nan) figure(figsize=(12, 10)) sns.heatmap(zv) dv = rv.pdf(np.array((xv, yv, zv))) figure(figsize=(12, 10)) sns.heatmap(dv, vmin=0, vmax=10) pd.Series(dv.flatten()).describe() text = [["pdf: %.2f" % d for d in dv[i]] for i in range(dv.shape[0])] len(text), len(text[0]) data = [ go.Surface( x=xv, y=yv, z=zv, surfacecolor=dv, hoverinfo="x+y+z+text", text=text, name="Dirichlet(%.2f, %.2f, %.2f)" % tuple(alpha) ) ] layout = go.Layout( title='Dirichlet Demo', autosize=False, width=800, height=600, margin=dict( l=65, r=50, b=65, t=90 ) ) fig = go.Figure(data=data, layout=layout) py.iplot(fig, filename='dirichlet_demo') def generate_dirichlet_surface(alpha, coord_step=0.01, visible=False, max_pdf=20): Generate a plotly 3D surface for standard simplex at granularity coord_step, with colors mapped to Dirichlet(alpha) pdf values. Filter out pts with pdf values exceeding max_pdf. rv = st.dirichlet(alpha) coord_range = np.arange(coord_step, 1, coord_step) xv, yv = np.meshgrid(coord_range, coord_range) zv = 1.0 - xv - yv zv = np.where(zv > 0.0, zv, np.nan) dv = rv.pdf(np.array((xv, yv, zv))) zv = np.where(dv > max_pdf, np.nan, zv) dv = np.where(dv > max_pdf, np.nan, dv) text = [["pdf: %.4f" % d for d in dv[i]] for i in range(dv.shape[0])] name = "%.1f %.1f %.1f" % tuple(alpha) res = go.Surface( x=xv, y=yv, z=zv, surfacecolor=dv, cmin=0.0, #cmax=25.0, #cauto=False, colorscale='Viridis', hoverinfo="name+x+y+z+text", text=text, name=name, visible=visible ) return res def generate_dirichlet_interactive_figure(alpha_range=None): Generate a plotly 3D figure with Dirichlet distributions corresponding to a range of alpha parameters, selectable from drop-down menus. if alpha_range is None: alpha_log_beg=-1 alpha_log_end=1 alpha_log_step=5 alpha_log_base=2 alpha_range = np.logspace(alpha_log_beg, alpha_log_end, alpha_log_step, base=alpha_log_base) n_range = len(alpha_range) n = n_range ** 3 alphas = [] sfcs = [] visible=True visibility = np.eye(n).astype(bool) group_indices = [[], []] for group_1 in [True, False]: for alpha_x in alpha_range: for alpha_y in alpha_range: for alpha_z in alpha_range: all_over_1 = alpha_x >= 1 and alpha_y >= 1 and alpha_z >= 1 non_decreasing = alpha_x <= alpha_y <= alpha_z if (all_over_1 and group_1) or ((not all_over_1) and non_decreasing and (not group_1)): group_indices[int(all_over_1)].append(len(alphas)) alpha = np.array([alpha_x, alpha_y, alpha_z]) alphas.append(alpha) print("Generating surface for alpha: %s (group %d)" % (alpha, group_1)) sfc = generate_dirichlet_surface(alpha, coord_step=0.01, visible=visible) sfcs.append(sfc) visible=False data = go.Data(sfcs) print("Generating layout & figure") layout = go.Layout( title='Dirichlet Distribution Interactive Plot', legend={'xanchor': 'right'}, autosize=True, width=800, height=800, #scene={'bgcolor': 'rgb(217, 217, 217)'}, updatemenus=[ dict( x=0, y=1.0 + k_group * 0.1, yanchor='top', font={'size': 10, 'family': 'courier'}, buttons=[ dict( args=['visible', list(visibility[i])], label='alpha=(%.1f %.1f %.1f)' % tuple(alphas[i]), method='restyle' ) for i in group_indices[k_group]] ) for k_group in [0, 1] ], ) fig = go.Figure(data=data, layout=layout) return fig fig = generate_dirichlet_interactive_figure(alpha_range=np.array([2, 1, 0.9])) py.iplot(fig, filename='dirichlet_interactive') <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Try Plotting a Dirichlet Distribution Step4: Make an Interactive 3D Plot with Parameter Selection
5,293
<ASSISTANT_TASK:> Python Code: import array a = array.array('i', range(10)) # 数据类型必须统一 a[1] = 's' a import numpy as np a_list = list(range(10)) b = np.array(a_list) type(b) a = np.zeros(10, dtype=int) print(type(a)) # 查看数组类型 a.dtype a = np.zeros((4,4), dtype=int) print(type(a)) # 查看数组类型 print(a.dtype) a np.ones((4,4), dtype=float) np.full((3,3), 3.14) a np.zeros_like(a) np.ones_like(a) np.full_like(a, 4.12, dtype=float) print(random.randint(5,10)) print(random.random()) np.random.random((3,3)) # 经常会用到 np.random.randint(0,10, (5,5)) list(range(0,10,2)) np.arange(0,3,2) # 经常用到 np.linspace(0, 3, 10) # n维的单位矩阵 np.eye(5) # 嵌套列表的元素访问 var = [[1,2,3], [3,4,5], [5,6,7]] var[0][0] # 数组中元素的访问 a = np.array(var) a[-1][0] a # 这两种访问方式是等价的 a[2, 0], a[2][0] # 数组切片 a[:2, :2] # 同上边的方式是不等价的 a[:2][:2] a # 维度 print(a.ndim) # shape print(a.shape) # size print(a.size) # dtype print(a.dtype) # a.itemsize print(a.itemsize) # nbytes print(a.nbytes) a = np.array(list(range(10))) a print(a + 10) print(a - 10) print(a * 100) a = np.full((3,3), 1.0, dtype=float) a + 10 # 等价于 np.add(a, 10) a = np.linspace(0, np.pi, 5) b = np.sin(a) print(a) print(b) # 求和 print(sum([1,2,3,4,5,6])) # 数组一维求和 a = np.full(10, 2.3) print(sum(a)) # 数组多维求和 a = np.array([[1,2],[3,4]]) print(sum(a)) # np.sum 求和 np.sum(a) np.sum(a, axis=1) np.max(a, axis=1) n = np.random.rand(10000) %timeit sum(n) %timeit np.sum(n) a = np.array(range(10)) a a > 3 a != 3 a == a np.all(a>-1) np.any(a>-1) a = np.full((2,10), 1, dtype=float) a a.reshape(4, 5) l = [ [1,2,3], [34,12,4], [32,2,33] ] a = np.array(l) a np.sort(a) a.sort(axis=0) a a = np.array([1, 2, 3]) b = np.array([[0, 2, 4], [1, 3, 5]]) # 按行去连接 np.concatenate([b,b,b], axis=0) # 按列去连接 np.concatenate([b,b,b], axis=1) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: 从原有列表转换为数组 Step2: 生成数组 Step3: random Step4: 范围取值 Step5: | Data type | Description | Step6: 数组属性 Step7: 运算 Step8: | Operator | Equivalent ufunc | Description | Step9: 统计类型 Step10: notebook使用小技巧 Step11: 由上代码可已看出np.sum的执行效率高,推荐使用 Step12: | Operator | Equivalent ufunc || Operator | Equivalent ufunc | Step13: 变形 Step14: 排序 Step15: 拼接
5,294
<ASSISTANT_TASK:> Python Code: tweets = [] RUTA = '' for line in open(RUTA).readlines(): tweets.append(line.split('\t')) ultimo_tweet = tweets[-1] print('id =>', ultimo_tweet[0]) print('fecha =>', ultimo_tweet[1]) print('autor =>', ultimo_tweet[2]) print('texto =>', ultimo_tweet[3]) # escribe tu código a continuación <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Fíjate en la estructura de la lista Step2: Al lío
5,295
<ASSISTANT_TASK:> Python Code: # Execute this cell to load the notebook's style sheet, then ignore it from IPython.core.display import HTML css_file = '../../style/custom.css' HTML(open(css_file, "r").read()) # Import Libraries (PLEASE RUN THIS CODE FIRST!) # ---------------------------------------------- import numpy as np import matplotlib # Show Plot in The Notebook matplotlib.use("nbagg") import matplotlib.pyplot as plt # Sub-plot Configuration # ---------------------- from matplotlib import gridspec # Ignore Warning Messages # ----------------------- import warnings warnings.filterwarnings("ignore") # Definition of modelling parameters # ---------------------------------- # number of grid points in x-direction # grid point distance in x-direction # wave speed in medium (m/s) # source location in grid in x-direction # receiver location in grid in x-direction # maximum number of time steps # time step # Plot Source Time Function # ------------------------- # dominant frequency of the source (Hz) # source time shift print('Source frequency =', f0, 'Hz') # Source time function (Gaussian) # ------------------------------- # 1st derivative of a Gaussian src = -2. * (time - t0) * (f0 ** 2) * (np.exp(- (f0 ** 2) * (time - t0) ** 2)) # Plot position configuration # --------------------------- plt.ion() fig1 = plt.figure(figsize=(6, 5)) gs1 = gridspec.GridSpec(1, 2, width_ratios=[1, 1], hspace=0.3, wspace=0.3) # Plot source time function # ------------------------- ax1 = plt.subplot(gs1[0]) ax1.plot(time, src) # plot source time function ax1.set_title('Source Time Function') ax1.set_xlim(time[0], time[-1]) ax1.set_xlabel('Time (s)') ax1.set_ylabel('Amplitude') # Plot source spectrum # -------------------- ax2 = plt.subplot(gs1[1]) # source time function in frequency domain # time domain to frequency domain # plot frequency and amplitude # only display frequency from 0 to 250 Hz ax2.set_title('Source Spectrum') ax2.set_xlabel('Frequency (Hz)') ax2.set_ylabel('Amplitude') ax2.yaxis.tick_right() ax2.yaxis.set_label_position("right") plt.show() # Analytical solution # ------------------- G = time * 0. # Initialize coordinates # ---------------------- x = np.arange(nx) x = x * dx # coordinate in x-direction for it in range(nt): # Calculate Green's function (Heaviside function) if (time[it] - np.abs(x[ir] - x[isrc]) / vp0) >= 0: G[it] = 1. / (2 * vp0) # get limit value from the maximum amplitude # Plotting convolution of Green's function with source wavelet plt.plot(time, Gc) plt.title("Analytical solution" ) plt.xlabel("Time, s") plt.ylabel("Amplitude") plt.grid() plt.show() # Plot Snapshot & Seismogram (PLEASE RERUN THIS CODE AGAIN AFTER SIMULATION!) # --------------------------------------------------------------------------- # Initialize empty pressure arrays # -------------------------------- # p at time n (now) # p at time n-1 (past) # p at time n+1 (present) # 2nd spatial derivative of p # Initialize model (assume homogeneous model) # ------------------------------------------- # initialize wave velocity in model # Initialize empty seismogram # --------------------------- # Plot position configuration # --------------------------- plt.ion() fig2 = plt.figure(figsize=(6, 4)) gs2 = gridspec.GridSpec(1, 2, width_ratios=[1, 1], hspace=0.3, wspace=0.3) # Plot 1D wave propagation # ------------------------ # Note: comma is needed to update the variable ax3 = plt.subplot(gs2[0]) leg1,= ax3.plot(isrc, 0, 'r*', markersize=11) # plot position of the source in snapshot leg2,= ax3.plot(ir, 0, 'k^', markersize=8) # plot position of the receiver in snapshot up31,= ax3.plot(p) # plot pressure update each time step ax3.set_xlim(0, nx) ax3.set_ylim(-lim, lim) ax3.set_title('Time Step (nt) = 0') ax3.set_xlabel('nx') ax3.set_ylabel('Amplitude') ax3.legend((leg1, leg2), ('Source', 'Receiver'), loc='upper right', fontsize=10, numpoints=1) # Plot seismogram # --------------- # Note: comma is needed to update the variable ax4 = plt.subplot(gs2[1]) leg3,= ax4.plot(0,0,'r--',markersize=1) # plot analytical solution marker leg4,= ax4.plot(0,0,'b-',markersize=1) # plot numerical solution marker up41,= ax4.plot(time, seis) # update recorded seismogram each time step up42,= ax4.plot([0], [0], 'r|', markersize=15) # update time step position ax4.yaxis.tick_right() ax4.yaxis.set_label_position("right") ax4.set_xlim(time[0], time[-1]) ax4.set_title('Seismogram') ax4.set_xlabel('Time (s)') ax4.set_ylabel('Amplitude') ax4.legend((leg3, leg4), ('Analytical', 'FD'), loc='upper right', fontsize=10, numpoints=1) plt.plot(time,Gc,'r--') # plot analytical solution plt.show() # 1D Wave Propagation (Finite Difference Solution) # ------------------------------------------------ # Calculate Partial Derivatives # ----------------------------- for it in range(nt): # FD approximation of spatial derivative by 3 point operator # ---------------------------------------------------------- # Explicit Time Extrapolation by 3 point operator # ----------------------------------------------- # Add Source Term at isrc # ----------------------- # Absolute pressure w.r.t analytical solution # Remap Time Levels # ----------------- # Output Seismogram # ----------------- # Update Data for Wave Propagation Plot # ------------------------------------- idisp = 2 # display frequency if (it % idisp) == 0: ax3.set_title('Time Step (nt) = %d' % it) up31.set_ydata(p) up41.set_ydata(seis) up42.set_data(time[it], seis[it]) plt.gcf().canvas.draw() <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Solving the 1D acoustic wave equation by finite-differences Step2: Source time function Step3: Analytical Solution Step4: Comparison of numerical with analytical solution
5,296
<ASSISTANT_TASK:> Python Code: import os import sys # Google Cloud Notebook if os.path.exists("/opt/deeplearning/metadata/env_version"): USER_FLAG = "--user" else: USER_FLAG = "" ! pip3 install -U google-cloud-aiplatform $USER_FLAG ! pip3 install -U google-cloud-storage $USER_FLAG if not os.getenv("IS_TESTING"): # Automatically restart kernel after installs import IPython app = IPython.Application.instance() app.kernel.do_shutdown(True) PROJECT_ID = "[your-project-id]" # @param {type:"string"} if PROJECT_ID == "" or PROJECT_ID is None or PROJECT_ID == "[your-project-id]": # Get your GCP project id from gcloud shell_output = !gcloud config list --format 'value(core.project)' 2>/dev/null PROJECT_ID = shell_output[0] print("Project ID:", PROJECT_ID) ! gcloud config set project $PROJECT_ID REGION = "us-central1" # @param {type: "string"} from datetime import datetime TIMESTAMP = datetime.now().strftime("%Y%m%d%H%M%S") # If you are running this notebook in Colab, run this cell and follow the # instructions to authenticate your GCP account. This provides access to your # Cloud Storage bucket and lets you submit training jobs and prediction # requests. # If on Google Cloud Notebook, then don't execute this code if not os.path.exists("/opt/deeplearning/metadata/env_version"): if "google.colab" in sys.modules: from google.colab import auth as google_auth google_auth.authenticate_user() # If you are running this notebook locally, replace the string below with the # path to your service account key and run this cell to authenticate your GCP # account. elif not os.getenv("IS_TESTING"): %env GOOGLE_APPLICATION_CREDENTIALS '' BUCKET_NAME = "gs://[your-bucket-name]" # @param {type:"string"} if BUCKET_NAME == "" or BUCKET_NAME is None or BUCKET_NAME == "gs://[your-bucket-name]": BUCKET_NAME = "gs://" + PROJECT_ID + "aip-" + TIMESTAMP ! gsutil mb -l $REGION $BUCKET_NAME ! gsutil ls -al $BUCKET_NAME import time import google.cloud.aiplatform_v1beta1 as aip from google.protobuf import json_format from google.protobuf.json_format import MessageToJson, ParseDict from google.protobuf.struct_pb2 import Struct, Value # API service endpoint API_ENDPOINT = "{}-aiplatform.googleapis.com".format(REGION) # Vertex location root path for your dataset, model and endpoint resources PARENT = "projects/" + PROJECT_ID + "/locations/" + REGION # Tabular Dataset type DATA_SCHEMA = "gs://google-cloud-aiplatform/schema/dataset/metadata/tables_1.0.0.yaml" # Tabular Labeling type LABEL_SCHEMA = ( "gs://google-cloud-aiplatform/schema/dataset/ioformat/table_io_format_1.0.0.yaml" ) # Tabular Training task TRAINING_SCHEMA = "gs://google-cloud-aiplatform/schema/trainingjob/definition/automl_tables_1.0.0.yaml" if os.getenv("IS_TESTING_DEPOLY_GPU"): DEPLOY_GPU, DEPLOY_NGPU = ( aip.AcceleratorType.NVIDIA_TESLA_K80, int(os.getenv("IS_TESTING_DEPOLY_GPU")), ) else: DEPLOY_GPU, DEPLOY_NGPU = (aip.AcceleratorType.NVIDIA_TESLA_K80, 1) if os.getenv("IS_TESTING_DEPLOY_MACHINE"): MACHINE_TYPE = os.getenv("IS_TESTING_DEPLOY_MACHINE") else: MACHINE_TYPE = "n1-standard" VCPU = "4" DEPLOY_COMPUTE = MACHINE_TYPE + "-" + VCPU print("Deploy machine type", DEPLOY_COMPUTE) # client options same for all services client_options = {"api_endpoint": API_ENDPOINT} def create_dataset_client(): client = aip.DatasetServiceClient(client_options=client_options) return client def create_model_client(): client = aip.ModelServiceClient(client_options=client_options) return client def create_pipeline_client(): client = aip.PipelineServiceClient(client_options=client_options) return client def create_job_client(): client = aip.JobServiceClient(client_options=client_options) return client clients = {} clients["dataset"] = create_dataset_client() clients["model"] = create_model_client() clients["pipeline"] = create_pipeline_client() clients["job"] = create_job_client() for client in clients.items(): print(client) IMPORT_FILE = "gs://cloud-samples-data/tables/iris_1000.csv" count = ! gsutil cat $IMPORT_FILE | wc -l print("Number of Examples", int(count[0])) print("First 10 rows") ! gsutil cat $IMPORT_FILE | head heading = ! gsutil cat $IMPORT_FILE | head -n1 label_column = str(heading).split(",")[-1].split("'")[0] print("Label Column Name", label_column) if label_column is None: raise Exception("label column missing") TIMEOUT = 90 def create_dataset(name, schema, src_uri=None, labels=None, timeout=TIMEOUT): start_time = time.time() try: if src_uri.startswith("gs://"): metadata = {"input_config": {"gcs_source": {"uri": [src_uri]}}} elif src_uri.startswith("bq://"): metadata = {"input_config": {"bigquery_source": {"uri": [src_uri]}}} dataset = aip.Dataset( display_name=name, metadata_schema_uri=schema, labels=labels, metadata=json_format.ParseDict(metadata, Value()), ) operation = clients["dataset"].create_dataset(parent=PARENT, dataset=dataset) print("Long running operation:", operation.operation.name) result = operation.result(timeout=TIMEOUT) print("time:", time.time() - start_time) print("response") print(" name:", result.name) print(" display_name:", result.display_name) print(" metadata_schema_uri:", result.metadata_schema_uri) print(" metadata:", dict(result.metadata)) print(" create_time:", result.create_time) print(" update_time:", result.update_time) print(" etag:", result.etag) print(" labels:", dict(result.labels)) return result except Exception as e: print("exception:", e) return None result = create_dataset("iris-" + TIMESTAMP, DATA_SCHEMA, src_uri=IMPORT_FILE) # The full unique ID for the dataset dataset_id = result.name # The short numeric ID for the dataset dataset_short_id = dataset_id.split("/")[-1] print(dataset_id) def create_pipeline(pipeline_name, model_name, dataset, schema, task): dataset_id = dataset.split("/")[-1] input_config = { "dataset_id": dataset_id, "fraction_split": { "training_fraction": 0.8, "validation_fraction": 0.1, "test_fraction": 0.1, }, } training_pipeline = { "display_name": pipeline_name, "training_task_definition": schema, "training_task_inputs": task, "input_data_config": input_config, "model_to_upload": {"display_name": model_name}, } try: pipeline = clients["pipeline"].create_training_pipeline( parent=PARENT, training_pipeline=training_pipeline ) print(pipeline) except Exception as e: print("exception:", e) return None return pipeline TRANSFORMATIONS = [ {"auto": {"column_name": "sepal_width"}}, {"auto": {"column_name": "sepal_length"}}, {"auto": {"column_name": "petal_length"}}, {"auto": {"column_name": "petal_width"}}, ] PIPE_NAME = "iris_pipe-" + TIMESTAMP MODEL_NAME = "iris_model-" + TIMESTAMP task = Value( struct_value=Struct( fields={ "target_column": Value(string_value=label_column), "prediction_type": Value(string_value="classification"), "train_budget_milli_node_hours": Value(number_value=1000), "disable_early_stopping": Value(bool_value=False), "transformations": json_format.ParseDict(TRANSFORMATIONS, Value()), } ) ) response = create_pipeline(PIPE_NAME, MODEL_NAME, dataset_id, TRAINING_SCHEMA, task) # The full unique ID for the pipeline pipeline_id = response.name # The short numeric ID for the pipeline pipeline_short_id = pipeline_id.split("/")[-1] print(pipeline_id) def get_training_pipeline(name, silent=False): response = clients["pipeline"].get_training_pipeline(name=name) if silent: return response print("pipeline") print(" name:", response.name) print(" display_name:", response.display_name) print(" state:", response.state) print(" training_task_definition:", response.training_task_definition) print(" training_task_inputs:", dict(response.training_task_inputs)) print(" create_time:", response.create_time) print(" start_time:", response.start_time) print(" end_time:", response.end_time) print(" update_time:", response.update_time) print(" labels:", dict(response.labels)) return response response = get_training_pipeline(pipeline_id) while True: response = get_training_pipeline(pipeline_id, True) if response.state != aip.PipelineState.PIPELINE_STATE_SUCCEEDED: print("Training job has not completed:", response.state) model_to_deploy_id = None if response.state == aip.PipelineState.PIPELINE_STATE_FAILED: raise Exception("Training Job Failed") else: model_to_deploy = response.model_to_upload model_to_deploy_id = model_to_deploy.name print("Training Time:", response.end_time - response.start_time) break time.sleep(60) print("model to deploy:", model_to_deploy_id) def list_model_evaluations(name): response = clients["model"].list_model_evaluations(parent=name) for evaluation in response: print("model_evaluation") print(" name:", evaluation.name) print(" metrics_schema_uri:", evaluation.metrics_schema_uri) metrics = json_format.MessageToDict(evaluation._pb.metrics) for metric in metrics.keys(): print(metric) print("logloss", metrics["logLoss"]) print("auPrc", metrics["auPrc"]) return evaluation.name last_evaluation = list_model_evaluations(model_to_deploy_id) HEADING = "petal_length,petal_width,sepal_length,sepal_width" INSTANCE_1 = "1.4,1.3,5.1,2.8" INSTANCE_2 = "1.5,1.2,4.7,2.4" import tensorflow as tf gcs_input_uri = BUCKET_NAME + "/test.csv" with tf.io.gfile.GFile(gcs_input_uri, "w") as f: f.write(HEADING + "\n") f.write(str(INSTANCE_1) + "\n") f.write(str(INSTANCE_2) + "\n") print(gcs_input_uri) ! gsutil cat $gcs_input_uri MIN_NODES = 1 MAX_NODES = 1 BATCH_MODEL = "iris_batch-" + TIMESTAMP def create_batch_prediction_job( display_name, model_name, gcs_source_uri, gcs_destination_output_uri_prefix, parameters=None, ): if DEPLOY_GPU: machine_spec = { "machine_type": DEPLOY_COMPUTE, "accelerator_type": DEPLOY_GPU, "accelerator_count": DEPLOY_NGPU, } else: machine_spec = { "machine_type": DEPLOY_COMPUTE, "accelerator_count": 0, } batch_prediction_job = { "display_name": display_name, # Format: 'projects/{project}/locations/{location}/models/{model_id}' "model": model_name, "model_parameters": json_format.ParseDict(parameters, Value()), "input_config": { "instances_format": IN_FORMAT, "gcs_source": {"uris": [gcs_source_uri]}, }, "output_config": { "predictions_format": OUT_FORMAT, "gcs_destination": {"output_uri_prefix": gcs_destination_output_uri_prefix}, }, "dedicated_resources": { "machine_spec": machine_spec, "starting_replica_count": MIN_NODES, "max_replica_count": MAX_NODES, }, "generate_explanation": True, } response = clients["job"].create_batch_prediction_job( parent=PARENT, batch_prediction_job=batch_prediction_job ) print("response") print(" name:", response.name) print(" display_name:", response.display_name) print(" model:", response.model) try: print(" generate_explanation:", response.generate_explanation) except: pass print(" state:", response.state) print(" create_time:", response.create_time) print(" start_time:", response.start_time) print(" end_time:", response.end_time) print(" update_time:", response.update_time) print(" labels:", response.labels) return response IN_FORMAT = "csv" OUT_FORMAT = "csv" # [csv] response = create_batch_prediction_job( BATCH_MODEL, model_to_deploy_id, gcs_input_uri, BUCKET_NAME, None ) # The full unique ID for the batch job batch_job_id = response.name # The short numeric ID for the batch job batch_job_short_id = batch_job_id.split("/")[-1] print(batch_job_id) def get_batch_prediction_job(job_name, silent=False): response = clients["job"].get_batch_prediction_job(name=job_name) if silent: return response.output_config.gcs_destination.output_uri_prefix, response.state print("response") print(" name:", response.name) print(" display_name:", response.display_name) print(" model:", response.model) try: # not all data types support explanations print(" generate_explanation:", response.generate_explanation) except: pass print(" state:", response.state) print(" error:", response.error) gcs_destination = response.output_config.gcs_destination print(" gcs_destination") print(" output_uri_prefix:", gcs_destination.output_uri_prefix) return gcs_destination.output_uri_prefix, response.state predictions, state = get_batch_prediction_job(batch_job_id) def get_latest_predictions(gcs_out_dir): Get the latest prediction subfolder using the timestamp in the subfolder name folders = !gsutil ls $gcs_out_dir latest = "" for folder in folders: subfolder = folder.split("/")[-2] if subfolder.startswith("prediction-"): if subfolder > latest: latest = folder[:-1] return latest while True: predictions, state = get_batch_prediction_job(batch_job_id, True) if state != aip.JobState.JOB_STATE_SUCCEEDED: print("The job has not completed:", state) if state == aip.JobState.JOB_STATE_FAILED: raise Exception("Batch Job Failed") else: folder = get_latest_predictions(predictions) ! gsutil ls $folder/explanation*.csv ! gsutil cat $folder/explanation*.csv break time.sleep(60) delete_dataset = True delete_pipeline = True delete_model = True delete_endpoint = True delete_batchjob = True delete_customjob = True delete_hptjob = True delete_bucket = True # Delete the dataset using the Vertex fully qualified identifier for the dataset try: if delete_dataset and "dataset_id" in globals(): clients["dataset"].delete_dataset(name=dataset_id) except Exception as e: print(e) # Delete the training pipeline using the Vertex fully qualified identifier for the pipeline try: if delete_pipeline and "pipeline_id" in globals(): clients["pipeline"].delete_training_pipeline(name=pipeline_id) except Exception as e: print(e) # Delete the model using the Vertex fully qualified identifier for the model try: if delete_model and "model_to_deploy_id" in globals(): clients["model"].delete_model(name=model_to_deploy_id) except Exception as e: print(e) # Delete the endpoint using the Vertex fully qualified identifier for the endpoint try: if delete_endpoint and "endpoint_id" in globals(): clients["endpoint"].delete_endpoint(name=endpoint_id) except Exception as e: print(e) # Delete the batch job using the Vertex fully qualified identifier for the batch job try: if delete_batchjob and "batch_job_id" in globals(): clients["job"].delete_batch_prediction_job(name=batch_job_id) except Exception as e: print(e) # Delete the custom job using the Vertex fully qualified identifier for the custom job try: if delete_customjob and "job_id" in globals(): clients["job"].delete_custom_job(name=job_id) except Exception as e: print(e) # Delete the hyperparameter tuning job using the Vertex fully qualified identifier for the hyperparameter tuning job try: if delete_hptjob and "hpt_job_id" in globals(): clients["job"].delete_hyperparameter_tuning_job(name=hpt_job_id) except Exception as e: print(e) if delete_bucket and "BUCKET_NAME" in globals(): ! gsutil rm -r $BUCKET_NAME <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Install the latest GA version of google-cloud-storage library as well. Step2: Restart the kernel Step3: Before you begin Step4: Region Step5: Timestamp Step6: Authenticate your Google Cloud account Step7: Create a Cloud Storage bucket Step8: Only if your bucket doesn't already exist Step9: Finally, validate access to your Cloud Storage bucket by examining its contents Step10: Set up variables Step11: Vertex constants Step12: AutoML constants Step13: Hardware Accelerators Step14: Container (Docker) image Step15: Tutorial Step16: Dataset Step17: Quick peek at your data Step18: Dataset Step19: Now save the unique dataset identifier for the Dataset resource instance you created. Step20: Train the model Step21: Construct the task requirements Step22: Now save the unique identifier of the training pipeline you created. Step23: Get information on a training pipeline Step24: Deployment Step25: Model information Step26: Model deployment for batch prediction Step27: Make the batch input file Step28: Compute instance scaling Step29: Make batch prediction request Step30: Now get the unique identifier for the batch prediction job you created. Step31: Get information on a batch prediction job Step33: Get the predictions with explanations Step34: Cleaning up
5,297
<ASSISTANT_TASK:> Python Code: # DO NOT EDIT ! from pyesdoc.ipython.model_topic import NotebookOutput # DO NOT EDIT ! DOC = NotebookOutput('cmip6', 'test-institute-1', 'sandbox-1', 'ocean') # Set as follows: DOC.set_author("name", "email") # TODO - please enter value(s) # Set as follows: DOC.set_contributor("name", "email") # TODO - please enter value(s) # Set publication status: # 0=do not publish, 1=publish. DOC.set_publication_status(0) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.model_overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.model_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.model_family') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "OGCM" # "slab ocean" # "mixed layer ocean" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.basic_approximations') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Primitive equations" # "Non-hydrostatic" # "Boussinesq" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.prognostic_variables') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Potential temperature" # "Conservative temperature" # "Salinity" # "U-velocity" # "V-velocity" # "W-velocity" # "SSH" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.eos_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Linear" # "Wright, 1997" # "Mc Dougall et al." # "Jackett et al. 2006" # "TEOS 2010" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.eos_functional_temp') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Potential temperature" # "Conservative temperature" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.eos_functional_salt') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Practical salinity Sp" # "Absolute salinity Sa" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.eos_functional_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Pressure (dbars)" # "Depth (meters)" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.ocean_freezing_point') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "TEOS 2010" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.ocean_specific_heat') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.seawater_properties.ocean_reference_density') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.bathymetry.reference_dates') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Present day" # "21000 years BP" # "6000 years BP" # "LGM" # "Pliocene" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.bathymetry.type') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.bathymetry.ocean_smoothing') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.bathymetry.source') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.nonoceanic_waters.isolated_seas') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.nonoceanic_waters.river_mouth') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.software_properties.repository') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.software_properties.code_version') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.software_properties.code_languages') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.canonical_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.range_horizontal_resolution') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.number_of_horizontal_gridpoints') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.number_of_vertical_levels') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.is_adaptive_grid') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.resolution.thickness_level_1') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.tuning_applied.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.tuning_applied.global_mean_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.tuning_applied.regional_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.tuning_applied.trend_metrics_used') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.conservation.description') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.conservation.scheme') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Energy" # "Enstrophy" # "Salt" # "Volume of ocean" # "Momentum" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.conservation.consistency_properties') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.conservation.corrected_conserved_prognostic_variables') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.key_properties.conservation.was_flux_correction_used') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.discretisation.vertical.coordinates') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Z-coordinate" # "Z*-coordinate" # "S-coordinate" # "Isopycnic - sigma 0" # "Isopycnic - sigma 2" # "Isopycnic - sigma 4" # "Isopycnic - other" # "Hybrid / Z+S" # "Hybrid / Z+isopycnic" # "Hybrid / other" # "Pressure referenced (P)" # "P*" # "Z**" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.discretisation.vertical.partial_steps') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.discretisation.horizontal.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Lat-lon" # "Rotated north pole" # "Two north poles (ORCA-style)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.discretisation.horizontal.staggering') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Arakawa B-grid" # "Arakawa C-grid" # "Arakawa E-grid" # "N/a" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.grid.discretisation.horizontal.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Finite difference" # "Finite volumes" # "Finite elements" # "Unstructured grid" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.diurnal_cycle') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "None" # "Via coupling" # "Specific treatment" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.tracers.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Leap-frog + Asselin filter" # "Leap-frog + Periodic Euler" # "Predictor-corrector" # "Runge-Kutta 2" # "AM3-LF" # "Forward-backward" # "Forward operator" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.tracers.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.baroclinic_dynamics.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Preconditioned conjugate gradient" # "Sub cyling" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.baroclinic_dynamics.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Leap-frog + Asselin filter" # "Leap-frog + Periodic Euler" # "Predictor-corrector" # "Runge-Kutta 2" # "AM3-LF" # "Forward-backward" # "Forward operator" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.baroclinic_dynamics.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.barotropic.splitting') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "None" # "split explicit" # "implicit" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.barotropic.time_step') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.timestepping_framework.vertical_physics.method') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.momentum.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Flux form" # "Vector form" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.momentum.scheme_name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.momentum.ALE') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.flux_limiter') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.effective_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.passive_tracers') # PROPERTY VALUE(S): # Set as follows: DOC.set_value("value") # Valid Choices: # "Ideal age" # "CFC 11" # "CFC 12" # "SF6" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.lateral_tracers.passive_tracers_advection') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.vertical_tracers.name') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.advection.vertical_tracers.flux_limiter') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "None" # "Eddy active" # "Eddy admitting" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.operator.direction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Horizontal" # "Isopycnal" # "Isoneutral" # "Geopotential" # "Iso-level" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.operator.order') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Harmonic" # "Bi-harmonic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.operator.discretisation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Second order" # "Higher order" # "Flux limiter" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.eddy_viscosity_coeff.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Space varying" # "Time + space varying (Smagorinsky)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.eddy_viscosity_coeff.constant_coefficient') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.eddy_viscosity_coeff.variable_coefficient') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.eddy_viscosity_coeff.coeff_background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.momentum.eddy_viscosity_coeff.coeff_backscatter') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.mesoscale_closure') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.submesoscale_mixing') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.operator.direction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Horizontal" # "Isopycnal" # "Isoneutral" # "Geopotential" # "Iso-level" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.operator.order') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Harmonic" # "Bi-harmonic" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.operator.discretisation') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Second order" # "Higher order" # "Flux limiter" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_diffusity_coeff.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant" # "Space varying" # "Time + space varying (Smagorinsky)" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_diffusity_coeff.constant_coefficient') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_diffusity_coeff.variable_coefficient') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_diffusity_coeff.coeff_background') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_diffusity_coeff.coeff_backscatter') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_induced_velocity.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "GM" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_induced_velocity.constant_val') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_induced_velocity.flux_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.lateral_physics.tracers.eddy_induced_velocity.added_diffusivity') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.details.langmuir_cells_mixing') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.tracers.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant value" # "Turbulent closure - TKE" # "Turbulent closure - KPP" # "Turbulent closure - Mellor-Yamada" # "Turbulent closure - Bulk Mixed Layer" # "Richardson number dependent - PP" # "Richardson number dependent - KT" # "Imbeded as isopycnic vertical coordinate" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.tracers.closure_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.tracers.constant') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.tracers.background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.momentum.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant value" # "Turbulent closure - TKE" # "Turbulent closure - KPP" # "Turbulent closure - Mellor-Yamada" # "Turbulent closure - Bulk Mixed Layer" # "Richardson number dependent - PP" # "Richardson number dependent - KT" # "Imbeded as isopycnic vertical coordinate" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.momentum.closure_order') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.momentum.constant') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.boundary_layer_mixing.momentum.background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.details.convection_type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Non-penetrative convective adjustment" # "Enhanced vertical diffusion" # "Included in turbulence closure" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.details.tide_induced_mixing') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.details.double_diffusion') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.details.shear_mixing') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.tracers.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant value" # "Turbulent closure / TKE" # "Turbulent closure - Mellor-Yamada" # "Richardson number dependent - PP" # "Richardson number dependent - KT" # "Imbeded as isopycnic vertical coordinate" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.tracers.constant') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.tracers.profile') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.tracers.background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.momentum.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Constant value" # "Turbulent closure / TKE" # "Turbulent closure - Mellor-Yamada" # "Richardson number dependent - PP" # "Richardson number dependent - KT" # "Imbeded as isopycnic vertical coordinate" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.momentum.constant') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.momentum.profile') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.vertical_physics.interior_mixing.momentum.background') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.free_surface.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.free_surface.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Linear implicit" # "Linear filtered" # "Linear semi-explicit" # "Non-linear implicit" # "Non-linear filtered" # "Non-linear semi-explicit" # "Fully explicit" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.free_surface.embeded_seaice') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.bottom_boundary_layer.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.bottom_boundary_layer.type_of_bbl') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Diffusive" # "Acvective" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.bottom_boundary_layer.lateral_mixing_coef') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.uplow_boundaries.bottom_boundary_layer.sill_overflow') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.overview') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.surface_pressure') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.momentum_flux_correction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers_flux_correction') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.wave_effects') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.river_runoff_budget') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.geothermal_heating') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.momentum.bottom_friction.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Linear" # "Non-linear" # "Non-linear (drag function of speed of tides)" # "Constant drag coefficient" # "None" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.momentum.lateral_friction.type') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "None" # "Free-slip" # "No-slip" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.sunlight_penetration.scheme') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "1 extinction depth" # "2 extinction depth" # "3 extinction depth" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.sunlight_penetration.ocean_colour') # PROPERTY VALUE: # Set as follows: DOC.set_value(value) # Valid Choices: # True # False # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.sunlight_penetration.extinction_depth') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.fresh_water_forcing.from_atmopshere') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Freshwater flux" # "Virtual salt flux" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.fresh_water_forcing.from_sea_ice') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # Valid Choices: # "Freshwater flux" # "Virtual salt flux" # "Real salt flux" # "Other: [Please specify]" # TODO - please enter value(s) # PROPERTY ID - DO NOT EDIT ! DOC.set_id('cmip6.ocean.boundary_forcing.tracers.fresh_water_forcing.forced_mode_restoring') # PROPERTY VALUE: # Set as follows: DOC.set_value("value") # TODO - please enter value(s) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Document Authors Step2: Document Contributors Step3: Document Publication Step4: Document Table of Contents Step5: 1.2. Model Name Step6: 1.3. Model Family Step7: 1.4. Basic Approximations Step8: 1.5. Prognostic Variables Step9: 2. Key Properties --&gt; Seawater Properties Step10: 2.2. Eos Functional Temp Step11: 2.3. Eos Functional Salt Step12: 2.4. Eos Functional Depth Step13: 2.5. Ocean Freezing Point Step14: 2.6. Ocean Specific Heat Step15: 2.7. Ocean Reference Density Step16: 3. Key Properties --&gt; Bathymetry Step17: 3.2. Type Step18: 3.3. Ocean Smoothing Step19: 3.4. Source Step20: 4. Key Properties --&gt; Nonoceanic Waters Step21: 4.2. River Mouth Step22: 5. Key Properties --&gt; Software Properties Step23: 5.2. Code Version Step24: 5.3. Code Languages Step25: 6. Key Properties --&gt; Resolution Step26: 6.2. Canonical Horizontal Resolution Step27: 6.3. Range Horizontal Resolution Step28: 6.4. Number Of Horizontal Gridpoints Step29: 6.5. Number Of Vertical Levels Step30: 6.6. Is Adaptive Grid Step31: 6.7. Thickness Level 1 Step32: 7. Key Properties --&gt; Tuning Applied Step33: 7.2. Global Mean Metrics Used Step34: 7.3. Regional Metrics Used Step35: 7.4. Trend Metrics Used Step36: 8. Key Properties --&gt; Conservation Step37: 8.2. Scheme Step38: 8.3. Consistency Properties Step39: 8.4. Corrected Conserved Prognostic Variables Step40: 8.5. Was Flux Correction Used Step41: 9. Grid Step42: 10. Grid --&gt; Discretisation --&gt; Vertical Step43: 10.2. Partial Steps Step44: 11. Grid --&gt; Discretisation --&gt; Horizontal Step45: 11.2. Staggering Step46: 11.3. Scheme Step47: 12. Timestepping Framework Step48: 12.2. Diurnal Cycle Step49: 13. Timestepping Framework --&gt; Tracers Step50: 13.2. Time Step Step51: 14. Timestepping Framework --&gt; Baroclinic Dynamics Step52: 14.2. Scheme Step53: 14.3. Time Step Step54: 15. Timestepping Framework --&gt; Barotropic Step55: 15.2. Time Step Step56: 16. Timestepping Framework --&gt; Vertical Physics Step57: 17. Advection Step58: 18. Advection --&gt; Momentum Step59: 18.2. Scheme Name Step60: 18.3. ALE Step61: 19. Advection --&gt; Lateral Tracers Step62: 19.2. Flux Limiter Step63: 19.3. Effective Order Step64: 19.4. Name Step65: 19.5. Passive Tracers Step66: 19.6. Passive Tracers Advection Step67: 20. Advection --&gt; Vertical Tracers Step68: 20.2. Flux Limiter Step69: 21. Lateral Physics Step70: 21.2. Scheme Step71: 22. Lateral Physics --&gt; Momentum --&gt; Operator Step72: 22.2. Order Step73: 22.3. Discretisation Step74: 23. Lateral Physics --&gt; Momentum --&gt; Eddy Viscosity Coeff Step75: 23.2. Constant Coefficient Step76: 23.3. Variable Coefficient Step77: 23.4. Coeff Background Step78: 23.5. Coeff Backscatter Step79: 24. Lateral Physics --&gt; Tracers Step80: 24.2. Submesoscale Mixing Step81: 25. Lateral Physics --&gt; Tracers --&gt; Operator Step82: 25.2. Order Step83: 25.3. Discretisation Step84: 26. Lateral Physics --&gt; Tracers --&gt; Eddy Diffusity Coeff Step85: 26.2. Constant Coefficient Step86: 26.3. Variable Coefficient Step87: 26.4. Coeff Background Step88: 26.5. Coeff Backscatter Step89: 27. Lateral Physics --&gt; Tracers --&gt; Eddy Induced Velocity Step90: 27.2. Constant Val Step91: 27.3. Flux Type Step92: 27.4. Added Diffusivity Step93: 28. Vertical Physics Step94: 29. Vertical Physics --&gt; Boundary Layer Mixing --&gt; Details Step95: 30. Vertical Physics --&gt; Boundary Layer Mixing --&gt; Tracers Step96: 30.2. Closure Order Step97: 30.3. Constant Step98: 30.4. Background Step99: 31. Vertical Physics --&gt; Boundary Layer Mixing --&gt; Momentum Step100: 31.2. Closure Order Step101: 31.3. Constant Step102: 31.4. Background Step103: 32. Vertical Physics --&gt; Interior Mixing --&gt; Details Step104: 32.2. Tide Induced Mixing Step105: 32.3. Double Diffusion Step106: 32.4. Shear Mixing Step107: 33. Vertical Physics --&gt; Interior Mixing --&gt; Tracers Step108: 33.2. Constant Step109: 33.3. Profile Step110: 33.4. Background Step111: 34. Vertical Physics --&gt; Interior Mixing --&gt; Momentum Step112: 34.2. Constant Step113: 34.3. Profile Step114: 34.4. Background Step115: 35. Uplow Boundaries --&gt; Free Surface Step116: 35.2. Scheme Step117: 35.3. Embeded Seaice Step118: 36. Uplow Boundaries --&gt; Bottom Boundary Layer Step119: 36.2. Type Of Bbl Step120: 36.3. Lateral Mixing Coef Step121: 36.4. Sill Overflow Step122: 37. Boundary Forcing Step123: 37.2. Surface Pressure Step124: 37.3. Momentum Flux Correction Step125: 37.4. Tracers Flux Correction Step126: 37.5. Wave Effects Step127: 37.6. River Runoff Budget Step128: 37.7. Geothermal Heating Step129: 38. Boundary Forcing --&gt; Momentum --&gt; Bottom Friction Step130: 39. Boundary Forcing --&gt; Momentum --&gt; Lateral Friction Step131: 40. Boundary Forcing --&gt; Tracers --&gt; Sunlight Penetration Step132: 40.2. Ocean Colour Step133: 40.3. Extinction Depth Step134: 41. Boundary Forcing --&gt; Tracers --&gt; Fresh Water Forcing Step135: 41.2. From Sea Ice Step136: 41.3. Forced Mode Restoring
5,298
<ASSISTANT_TASK:> Python Code: titles.shape[0] titles.sort(columns='year')[0:2] titles[titles['title']=='Hamlet'].shape[0] titles[titles['title']=='North by Northwest'].shape[0] titles[titles['title']=='Hamlet'].sort(columns='year')['year'].values[0] titles[titles['title']=='Treasure Island'].sort(columns='year') titles[titles['year']==1950].shape[0] titles[titles['year']==1960].shape[0] titles[(titles['year']>1950)&(titles['year']<1960)].shape[0] print(titles[titles['title']=="Batman"]['year'].values) cast[(cast['title']=="Inception")&(cast['year']==2010)].shape[0] sum(cast[(cast['title']=="Inception")&(cast['year']==2010)]['n'].isnull()) sum(cast[(cast['title']=="Inception")&(cast['year']==2010)]['n'].notnull()) cast[cast['title']=='North by Northwest'].dropna().sort(columns='n') cast[(cast['title']=='Sleuth')&(cast['year']==1972)].sort(columns='n') cast[(cast['title']=='Sleuth')&(cast['year']==2007)].sort(columns='n') cast[(cast['title']=='Hamlet')&(cast['year']==1921)].shape[0] cast[(cast['title']=='Hamlet')&(cast['year']==1996)].shape[0] cast[(cast['character']=='Hamlet')].shape[0] cast[(cast['character']=='Ophelia')]['name'].unique().shape[0] cast[(cast['character']=='The Dude')]['name'].unique().shape[0] cast[(cast['character']=='The Stranger')]['name'].unique().shape[0] cast[(cast['name']=='Sidney Poitier')]['character'].unique().shape[0] cast[(cast['name']=='Judi Dench')]['character'].unique().shape[0] cast[(cast['name']=='Cary Grant')&(cast['n']==2)&(cast['year']>=1940)&(cast['year']<1950)].sort(columns='year') cast[(cast['name']=='Cary Grant')&(cast['n']==1)&(cast['year']>=1940)&(cast['year']<1950)].sort(columns='year') cast[(cast['type']=='actor')&(cast['year']>=1940)&(cast['year']<1950)].shape[0] cast[(cast['type']=='actress')&(cast['year']>=1940)&(cast['year']<1950)].shape[0] cast[(cast['n']==1)&(cast['year']<=1980)].shape[0] cast[(cast['n']!=1)&(cast['year']<=1980)].shape[0] sum(cast[(cast['year']<=1980)]['n'].isnull()) <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: What are the earliest two films listed in the titles dataframe? Step2: How many movies have the title "Hamlet"? Step3: How many movies are titled "North by Northwest"? Step4: When was the first movie titled "Hamlet" made? Step5: List all of the "Treasure Island" movies from earliest to most recent. Step6: How many movies were made in the year 1950? Step7: How many movies were made in the year 1960? Step8: How many movies were made from 1950 through 1959? Step9: In what years has a movie titled "Batman" been released? Step10: How many roles were there in the movie "Inception"? Step11: How many roles in the movie "Inception" are NOT ranked by an "n" value? Step12: But how many roles in the movie "Inception" did receive an "n" value? Step13: Display the cast of "North by Northwest" in their correct "n"-value order, ignoring roles that did not earn a numeric "n" value. Step14: Display the entire cast, in "n"-order, of the 1972 film "Sleuth". Step15: Now display the entire cast, in "n"-order, of the 2007 version of "Sleuth". Step16: How many roles were credited in the silent 1921 version of Hamlet? Step17: How many roles were credited in Branagh’s 1996 Hamlet? Step18: How many "Hamlet" roles have been listed in all film credits through history? Step19: How many people have played an "Ophelia"? Step20: How many people have played a role called "The Dude"? Step21: How many people have played a role called "The Stranger"? Step22: How many roles has Sidney Poitier played throughout his career? Step23: How many roles has Judi Dench played? Step24: List the supporting roles (having n=2) played by Cary Grant in the 1940s, in order by year. Step25: List the leading roles that Cary Grant played in the 1940s in order by year. Step26: How many roles were available for actors in the 1950s? Step27: How many roles were avilable for actresses in the 1950s? Step28: How many leading roles (n=1) were available from the beginning of film history through 1980? Step29: How many non-leading roles were available through from the beginning of film history through 1980? Step30: How many roles through 1980 were minor enough that they did not warrant a numeric "n" rank?
5,299
<ASSISTANT_TASK:> Python Code: %pylab inline %matplotlib inline import os SHOGUN_DATA_DIR=os.getenv('SHOGUN_DATA_DIR', '../../../data') from scipy.io import loadmat from shogun import RealFeatures, MulticlassLabels, Math # load the dataset dataset = loadmat(os.path.join(SHOGUN_DATA_DIR, 'multiclass/usps.mat')) Xall = dataset['data'] # the usps dataset has the digits labeled from 1 to 10 # we'll subtract 1 to make them in the 0-9 range instead Yall = np.array(dataset['label'].squeeze(), dtype=np.double)-1 # 4000 examples for training Xtrain = RealFeatures(Xall[:,0:4000]) Ytrain = MulticlassLabels(Yall[0:4000]) # the rest for testing Xtest = RealFeatures(Xall[:,4000:-1]) Ytest = MulticlassLabels(Yall[4000:-1]) # initialize the random number generator with a fixed seed, for repeatability Math.init_random(10) from shogun import NeuralLayers, DeepAutoencoder layers = NeuralLayers() layers = layers.input(256).rectified_linear(512).rectified_linear(128).rectified_linear(512).linear(256).done() ae = DeepAutoencoder(layers) from shogun import AENT_DROPOUT, NNOM_GRADIENT_DESCENT ae.pt_noise_type.set_const(AENT_DROPOUT) # use dropout noise ae.pt_noise_parameter.set_const(0.5) # each input has a 50% chance of being set to zero ae.pt_optimization_method.set_const(NNOM_GRADIENT_DESCENT) # train using gradient descent ae.pt_gd_learning_rate.set_const(0.01) ae.pt_gd_mini_batch_size.set_const(128) ae.pt_max_num_epochs.set_const(50) ae.pt_epsilon.set_const(0.0) # disable automatic convergence testing # uncomment this line to allow the training progress to be printed on the console #from shogun import MSG_INFO; ae.io.set_loglevel(MSG_INFO) # start pre-training. this might take some time ae.pre_train(Xtrain) ae.set_noise_type(AENT_DROPOUT) # same noise type we used for pre-training ae.set_noise_parameter(0.5) ae.set_max_num_epochs(50) ae.set_optimization_method(NNOM_GRADIENT_DESCENT) ae.set_gd_mini_batch_size(128) ae.set_gd_learning_rate(0.0001) ae.set_epsilon(0.0) # start fine-tuning. this might take some time _ = ae.train(Xtrain) # get a 50-example subset of the test set subset = Xtest[:,0:50].copy() # corrupt the first 25 examples with multiplicative noise subset[:,0:25] *= (random.random((256,25))>0.5) # corrupt the other 25 examples with additive noise subset[:,25:50] += random.random((256,25)) # obtain the reconstructions reconstructed_subset = ae.reconstruct(RealFeatures(subset)) # plot the corrupted data and the reconstructions figure(figsize=(10,10)) for i in range(50): ax1=subplot(10,10,i*2+1) ax1.imshow(subset[:,i].reshape((16,16)), interpolation='nearest', cmap = cm.Greys_r) ax1.set_xticks([]) ax1.set_yticks([]) ax2=subplot(10,10,i*2+2) ax2.imshow(reconstructed_subset[:,i].reshape((16,16)), interpolation='nearest', cmap = cm.Greys_r) ax2.set_xticks([]) ax2.set_yticks([]) # obtain the weights matrix of the first hidden layer # the 512 is the number of biases in the layer (512 neurons) # the transpose is because numpy stores matrices in row-major format, and Shogun stores # them in column major format w1 = ae.get_layer_parameters(1)[512:].reshape(256,512).T # visualize the weights between the first 100 neurons in the hidden layer # and the neurons in the input layer figure(figsize=(10,10)) for i in range(100): ax1=subplot(10,10,i+1) ax1.imshow(w1[i,:].reshape((16,16)), interpolation='nearest', cmap = cm.Greys_r) ax1.set_xticks([]) ax1.set_yticks([]) from shogun import NeuralSoftmaxLayer nn = ae.convert_to_neural_network(NeuralSoftmaxLayer(10)) nn.set_max_num_epochs(50) nn.set_labels(Ytrain) _ = nn.train(Xtrain) from shogun import MulticlassAccuracy predictions = nn.apply_multiclass(Xtest) accuracy = MulticlassAccuracy().evaluate(predictions, Ytest) * 100 print "Classification accuracy on the test set =", accuracy, "%" from shogun import DynamicObjectArray, NeuralInputLayer, NeuralConvolutionalLayer, CMAF_RECTIFIED_LINEAR conv_layers = DynamicObjectArray() # 16x16 single channel images conv_layers.append_element(NeuralInputLayer(16,16,1)) # the first encoding layer: 5 feature maps, filters with radius 2 (5x5 filters) # and max-pooling in a 2x2 region: its output will be 10 8x8 feature maps conv_layers.append_element(NeuralConvolutionalLayer(CMAF_RECTIFIED_LINEAR, 5, 2, 2, 2, 2)) # the second encoding layer: 15 feature maps, filters with radius 2 (5x5 filters) # and max-pooling in a 2x2 region: its output will be 20 4x4 feature maps conv_layers.append_element(NeuralConvolutionalLayer(CMAF_RECTIFIED_LINEAR, 15, 2, 2, 2, 2)) # the first decoding layer: same structure as the first encoding layer conv_layers.append_element(NeuralConvolutionalLayer(CMAF_RECTIFIED_LINEAR, 5, 2, 2)) # the second decoding layer: same structure as the input layer conv_layers.append_element(NeuralConvolutionalLayer(CMAF_RECTIFIED_LINEAR, 1, 2, 2)) conv_ae = DeepAutoencoder(conv_layers) conv_ae.pt_noise_type.set_const(AENT_DROPOUT) # use dropout noise conv_ae.pt_noise_parameter.set_const(0.3) # each input has a 30% chance of being set to zero conv_ae.pt_optimization_method.set_const(NNOM_GRADIENT_DESCENT) # train using gradient descent conv_ae.pt_gd_learning_rate.set_const(0.002) conv_ae.pt_gd_mini_batch_size.set_const(100) conv_ae.pt_max_num_epochs[0] = 30 # max number of epochs for pre-training the first encoding layer conv_ae.pt_max_num_epochs[1] = 10 # max number of epochs for pre-training the second encoding layer conv_ae.pt_epsilon.set_const(0.0) # disable automatic convergence testing # start pre-training. this might take some time conv_ae.pre_train(Xtrain) conv_nn = ae.convert_to_neural_network(NeuralSoftmaxLayer(10)) # train the network conv_nn.set_epsilon(0.0) conv_nn.set_max_num_epochs(50) conv_nn.set_labels(Ytrain) # start training. this might take some time _ = conv_nn.train(Xtrain) predictions = conv_nn.apply_multiclass(Xtest) accuracy = MulticlassAccuracy().evaluate(predictions, Ytest) * 100 print "Classification accuracy on the test set =", accuracy, "%" <END_TASK>
<SYSTEM_TASK:> Given the following text description, write Python code to implement the functionality described below step by step <END_TASK> <USER_TASK:> Description: Step1: Creating the autoencoder Step2: Pre-training Step3: Fine-tuning Step4: Evaluation Step5: The figure shows the corrupted examples and their reconstructions. The top half of the figure shows the ones corrupted with multiplicative noise, the bottom half shows the ones corrupted with additive noise. We can see that the autoencoders can provide decent reconstructions despite the heavy noise. Step6: Now, we can use the autoencoder to initialize a supervised neural network. The network will have all the layer of the autoencoder up to (and including) the middle layer. We'll also add a softmax output layer. So, the network will look like Step7: Next, we'll evaluate the accuracy on the test set Step8: Convolutional Autoencoders Step9: Now we'll pre-train the autoencoder Step10: And then convert the autoencoder to a regular neural network for classification Step11: And evaluate it on the test set