repo
stringclasses
900 values
file
stringclasses
754 values
content
stringlengths
4
215k
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit_optimization.algorithms import MinimumEigenOptimizer from qiskit import Aer from qiskit.utils import algorithm_globals, QuantumInstance from qiskit.algorithms import QAOA, NumPyMinimumEigensolver import numpy as np val = [5,6,7,8,9] wt = [4,5,6,7,8] W = 18 def dp(W, wt, val, n): k = [[0 for x in range(W + 1)] for x in range(n + 1)] for i in range(n + 1): for w in range(W + 1): if i == 0 or w == 0: k[i][w] = 0 elif wt[i-1] <= w: k[i][w] = max(val[i-1] + k[i-1][w-wt[i-1]], k[i-1][w]) else: k[i][w] = k[i-1][w] picks=[0 for x in range(n)] volume=W for i in range(n,-1,-1): if (k[i][volume]>k[i-1][volume]): picks[i-1]=1 volume -= wt[i-1] return k[n][W],picks n = len(val) print("optimal value:", dp(W, wt, val, n)[0]) print('\n index of the chosen items:') for i in range(n): if dp(W, wt, val, n)[1][i]: print(i,end=' ') # import packages necessary for application classes. from qiskit_optimization.applications import Knapsack def knapsack_quadratic_program(): # Put values, weights and max_weight parameter for the Knapsack() ############################## # Provide your code here prob = Knapsack(val, wt, W) # ############################## # to_quadratic_program generates a corresponding QuadraticProgram of the instance of the knapsack problem. kqp = prob.to_quadratic_program() return prob, kqp prob,quadratic_program=knapsack_quadratic_program() quadratic_program # Numpy Eigensolver meo = MinimumEigenOptimizer(min_eigen_solver=NumPyMinimumEigensolver()) result = meo.solve(quadratic_program) print('result:\n', result) print('\n index of the chosen items:', prob.interpret(result)) # QAOA seed = 123 algorithm_globals.random_seed = seed qins = QuantumInstance(backend=Aer.get_backend('qasm_simulator'), shots=1000, seed_simulator=seed, seed_transpiler=seed) meo = MinimumEigenOptimizer(min_eigen_solver=QAOA(reps=1, quantum_instance=qins)) result = meo.solve(quadratic_program) print('result:\n', result) print('\n index of the chosen items:', prob.interpret(result)) # Check your answer and submit using the following code from qc_grader import grade_ex4a grade_ex4a(quadratic_program) L1 = [5,3,3,6,9,7,1] L2 = [8,4,5,12,10,11,2] C1 = [1,1,2,1,1,1,2] C2 = [3,2,3,2,4,3,3] C_max = 16 def knapsack_argument(L1, L2, C1, C2, C_max): ############################## # Provide your code here values = [j-i for i,j in zip(L1,L2)] weights = [j-i for i,j in zip(C1,C2)] max_weight = max([i+j for i,j in zip(L1, L2)]) # ############################## return values, weights, max_weight values, weights, max_weight = knapsack_argument(L1, L2, C1, C2, C_max) print(values, weights, max_weight) prob = Knapsack(values = values, weights = weights, max_weight = max_weight) qp = prob.to_quadratic_program() qp # Check your answer and submit using the following code from qc_grader import grade_ex4b grade_ex4b(knapsack_argument) # QAOA seed = 123 algorithm_globals.random_seed = seed qins = QuantumInstance(backend=Aer.get_backend('qasm_simulator'), shots=1000, seed_simulator=seed, seed_transpiler=seed) meo = MinimumEigenOptimizer(min_eigen_solver=QAOA(reps=1, quantum_instance=qins)) result = meo.solve(qp) print('result:', result.x) item = np.array(result.x) revenue=0 for i in range(len(item)): if item[i]==0: revenue+=L1[i] else: revenue+=L2[i] print('total revenue:', revenue) instance_examples = [ { 'L1': [3, 7, 3, 4, 2, 6, 2, 2, 4, 6, 6], 'L2': [7, 8, 7, 6, 6, 9, 6, 7, 6, 7, 7], 'C1': [2, 2, 2, 3, 2, 4, 2, 2, 2, 2, 2], 'C2': [4, 3, 3, 4, 4, 5, 3, 4, 4, 3, 4], 'C_max': 33 }, { 'L1': [4, 2, 2, 3, 5, 3, 6, 3, 8, 3, 2], 'L2': [6, 5, 8, 5, 6, 6, 9, 7, 9, 5, 8], 'C1': [3, 3, 2, 3, 4, 2, 2, 3, 4, 2, 2], 'C2': [4, 4, 3, 5, 5, 3, 4, 5, 5, 3, 5], 'C_max': 38 }, { 'L1': [5, 4, 3, 3, 3, 7, 6, 4, 3, 5, 3], 'L2': [9, 7, 5, 5, 7, 8, 8, 7, 5, 7, 9], 'C1': [2, 2, 4, 2, 3, 4, 2, 2, 2, 2, 2], 'C2': [3, 4, 5, 4, 4, 5, 3, 3, 5, 3, 5], 'C_max': 35 } ] from typing import List, Union import math from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister, assemble from qiskit.compiler import transpile from qiskit.circuit import Gate from qiskit.circuit.library.standard_gates import * from qiskit.circuit.library import QFT def phase_return(index_qubits: int, gamma: float, L1: list, L2: list, to_gate=True) -> Union[Gate, QuantumCircuit]: qr_index = QuantumRegister(index_qubits, "index") qc = QuantumCircuit(qr_index) ############################## ### U_1(gamma * (lambda2 - lambda1)) for each qubit ### # Provide your code here ############################## return qc.to_gate(label=" phase return ") if to_gate else qc def subroutine_add_const(data_qubits: int, const: int, to_gate=True) -> Union[Gate, QuantumCircuit]: qc = QuantumCircuit(data_qubits) ############################## ### Phase Rotation ### # Provide your code here ############################## return qc.to_gate(label=" [+"+str(const)+"] ") if to_gate else qc def const_adder(data_qubits: int, const: int, to_gate=True) -> Union[Gate, QuantumCircuit]: qr_data = QuantumRegister(data_qubits, "data") qc = QuantumCircuit(qr_data) ############################## ### QFT ### # Provide your code here ############################## ############################## ### Phase Rotation ### # Use `subroutine_add_const` ############################## ############################## ### IQFT ### # Provide your code here ############################## return qc.to_gate(label=" [ +" + str(const) + "] ") if to_gate else qc def cost_calculation(index_qubits: int, data_qubits: int, list1: list, list2: list, to_gate = True) -> Union[Gate, QuantumCircuit]: qr_index = QuantumRegister(index_qubits, "index") qr_data = QuantumRegister(data_qubits, "data") qc = QuantumCircuit(qr_index, qr_data) for i, (val1, val2) in enumerate(zip(list1, list2)): ############################## ### Add val2 using const_adder controlled by i-th index register (set to 1) ### # Provide your code here ############################## qc.x(qr_index[i]) ############################## ### Add val1 using const_adder controlled by i-th index register (set to 0) ### # Provide your code here ############################## qc.x(qr_index[i]) return qc.to_gate(label=" Cost Calculation ") if to_gate else qc def constraint_testing(data_qubits: int, C_max: int, to_gate = True) -> Union[Gate, QuantumCircuit]: qr_data = QuantumRegister(data_qubits, "data") qr_f = QuantumRegister(1, "flag") qc = QuantumCircuit(qr_data, qr_f) ############################## ### Set the flag register for indices with costs larger than C_max ### # Provide your code here ############################## return qc.to_gate(label=" Constraint Testing ") if to_gate else qc def penalty_dephasing(data_qubits: int, alpha: float, gamma: float, to_gate = True) -> Union[Gate, QuantumCircuit]: qr_data = QuantumRegister(data_qubits, "data") qr_f = QuantumRegister(1, "flag") qc = QuantumCircuit(qr_data, qr_f) ############################## ### Phase Rotation ### # Provide your code here ############################## return qc.to_gate(label=" Penalty Dephasing ") if to_gate else qc def reinitialization(index_qubits: int, data_qubits: int, C1: list, C2: list, C_max: int, to_gate = True) -> Union[Gate, QuantumCircuit]: qr_index = QuantumRegister(index_qubits, "index") qr_data = QuantumRegister(data_qubits, "data") qr_f = QuantumRegister(1, "flag") qc = QuantumCircuit(qr_index, qr_data, qr_f) ############################## ### Reinitialization Circuit ### # Provide your code here ############################## return qc.to_gate(label=" Reinitialization ") if to_gate else qc def mixing_operator(index_qubits: int, beta: float, to_gate = True) -> Union[Gate, QuantumCircuit]: qr_index = QuantumRegister(index_qubits, "index") qc = QuantumCircuit(qr_index) ############################## ### Mixing Operator ### # Provide your code here ############################## return qc.to_gate(label=" Mixing Operator ") if to_gate else qc def solver_function(L1: list, L2: list, C1: list, C2: list, C_max: int) -> QuantumCircuit: # the number of qubits representing answers index_qubits = len(L1) # the maximum possible total cost max_c = sum([max(l0, l1) for l0, l1 in zip(C1, C2)]) # the number of qubits representing data values can be defined using the maximum possible total cost as follows: data_qubits = math.ceil(math.log(max_c, 2)) + 1 if not max_c & (max_c - 1) == 0 else math.ceil(math.log(max_c, 2)) + 2 ### Phase Operator ### # return part def phase_return(): ############################## ### TODO ### ### Paste your code from above cells here ### ############################## # penalty part def subroutine_add_const(): ############################## ### TODO ### ### Paste your code from above cells here ### ############################## # penalty part def const_adder(): ############################## ### TODO ### ### Paste your code from above cells here ### ############################## # penalty part def cost_calculation(): ############################## ### TODO ### ### Paste your code from above cells here ### ############################## # penalty part def constraint_testing(): ############################## ### TODO ### ### Paste your code from above cells here ### ############################## # penalty part def penalty_dephasing(): ############################## ### TODO ### ### Paste your code from above cells here ### ############################## # penalty part def reinitialization(): ############################## ### TODO ### ### Paste your code from above cells here ### ############################## ### Mixing Operator ### def mixing_operator(): ############################## ### TODO ### ### Paste your code from above cells here ### ############################## qr_index = QuantumRegister(index_qubits, "index") # index register qr_data = QuantumRegister(data_qubits, "data") # data register qr_f = QuantumRegister(1, "flag") # flag register cr_index = ClassicalRegister(index_qubits, "c_index") # classical register storing the measurement result of index register qc = QuantumCircuit(qr_index, qr_data, qr_f, cr_index) ### initialize the index register with uniform superposition state ### qc.h(qr_index) ### DO NOT CHANGE THE CODE BELOW p = 5 alpha = 1 for i in range(p): ### set fixed parameters for each round ### beta = 1 - (i + 1) / p gamma = (i + 1) / p ### return part ### qc.append(phase_return(index_qubits, gamma, L1, L2), qr_index) ### step 1: cost calculation ### qc.append(cost_calculation(index_qubits, data_qubits, C1, C2), qr_index[:] + qr_data[:]) ### step 2: Constraint testing ### qc.append(constraint_testing(data_qubits, C_max), qr_data[:] + qr_f[:]) ### step 3: penalty dephasing ### qc.append(penalty_dephasing(data_qubits, alpha, gamma), qr_data[:] + qr_f[:]) ### step 4: reinitialization ### qc.append(reinitialization(index_qubits, data_qubits, C1, C2, C_max), qr_index[:] + qr_data[:] + qr_f[:]) ### mixing operator ### qc.append(mixing_operator(index_qubits, beta), qr_index) ### measure the index ### ### since the default measurement outcome is shown in big endian, it is necessary to reverse the classical bits in order to unify the endian ### qc.measure(qr_index, cr_index[::-1]) return qc # Execute your circuit with following prepare_ex4c() function. # The prepare_ex4c() function works like the execute() function with only QuantumCircuit as an argument. from qc_grader import prepare_ex4c job = prepare_ex4c(solver_function) result = job.result() # Check your answer and submit using the following code from qc_grader import grade_ex4c grade_ex4c(job)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit import * from qiskit.visualization import plot_histogram import numpy as np def NOT(inp): """An NOT gate. Parameters: inp (str): Input, encoded in qubit 0. Returns: QuantumCircuit: Output NOT circuit. str: Output value measured from qubit 0. """ qc = QuantumCircuit(1, 1) # A quantum circuit with a single qubit and a single classical bit qc.reset(0) # We encode '0' as the qubit state |0⟩, and '1' as |1⟩ # Since the qubit is initially |0⟩, we don't need to do anything for an input of '0' # For an input of '1', we do an x to rotate the |0⟩ to |1⟩ if inp=='1': qc.x(0) # barrier between input state and gate operation qc.barrier() # Now we've encoded the input, we can do a NOT on it using x qc.x(0) #barrier between gate operation and measurement qc.barrier() # Finally, we extract the |0⟩/|1⟩ output of the qubit and encode it in the bit c[0] qc.measure(0,0) qc.draw() # We'll run the program on a simulator backend = Aer.get_backend('qasm_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = backend.run(qc, shots=1, memory=True) output = job.result().get_memory()[0] return qc, output ## Test the function for inp in ['0', '1']: qc, out = NOT(inp) print('NOT with input',inp,'gives output',out) display(qc.draw()) print('\n') def XOR(inp1,inp2): """An XOR gate. Parameters: inpt1 (str): Input 1, encoded in qubit 0. inpt2 (str): Input 2, encoded in qubit 1. Returns: QuantumCircuit: Output XOR circuit. str: Output value measured from qubit 1. """ qc = QuantumCircuit(2, 1) qc.reset(range(2)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) # barrier between input state and gate operation qc.barrier() # this is where your program for quantum XOR gate goes qc.cx(0, 1) # barrier between input state and gate operation qc.barrier() qc.measure(1,0) # output from qubit 1 is measured #We'll run the program on a simulator backend = Aer.get_backend('qasm_simulator') #Since the output will be deterministic, we can use just a single shot to get it job = backend.run(qc, shots=1, memory=True) output = job.result().get_memory()[0] return qc, output ## Test the function for inp1 in ['0', '1']: for inp2 in ['0', '1']: qc, output = XOR(inp1, inp2) print('XOR with inputs',inp1,inp2,'gives output',output) display(qc.draw()) print('\n') def AND(inp1,inp2): """An AND gate. Parameters: inpt1 (str): Input 1, encoded in qubit 0. inpt2 (str): Input 2, encoded in qubit 1. Returns: QuantumCircuit: Output XOR circuit. str: Output value measured from qubit 2. """ qc = QuantumCircuit(3, 1) qc.reset(range(2)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) qc.barrier() # this is where your program for quantum AND gate goes qc.ccx(0,1,2) qc.barrier() qc.measure(2, 0) # output from qubit 2 is measured # We'll run the program on a simulator backend = Aer.get_backend('qasm_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = backend.run(qc, shots=1, memory=True) output = job.result().get_memory()[0] return qc, output ## Test the function for inp1 in ['0', '1']: for inp2 in ['0', '1']: qc, output = AND(inp1, inp2) print('AND with inputs',inp1,inp2,'gives output',output) display(qc.draw()) print('\n') def NAND(inp1,inp2): """An NAND gate. Parameters: inpt1 (str): Input 1, encoded in qubit 0. inpt2 (str): Input 2, encoded in qubit 1. Returns: QuantumCircuit: Output NAND circuit. str: Output value measured from qubit 2. """ qc = QuantumCircuit(3, 1) qc.reset(range(3)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) qc.barrier() # this is where your program for quantum NAND gate goes qc.ccx(0,1,2) if inp=='1': qc.x(2) qc.barrier() qc.measure(2, 0) # output from qubit 2 is measured # We'll run the program on a simulator backend = Aer.get_backend('aer_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = backend.run(qc,shots=1,memory=True) output = job.result().get_memory()[0] return qc, output ## Test the function for inp1 in ['0', '1']: for inp2 in ['0', '1']: qc, output = NAND(inp1, inp2) print('NAND with inputs',inp1,inp2,'gives output',output) display(qc.draw()) print('\n') def OR(inp1,inp2): """An OR gate. Parameters: inpt1 (str): Input 1, encoded in qubit 0. inpt2 (str): Input 2, encoded in qubit 1. Returns: QuantumCircuit: Output XOR circuit. str: Output value measured from qubit 2. """ qc = QuantumCircuit(3, 1) qc.reset(range(3)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) qc.barrier() # this is where your program for quantum OR gate goes qc.cx(0, 2) qc.cx(1, 2) qc.barrier() qc.measure(2, 0) # output from qubit 2 is measured # We'll run the program on a simulator backend = Aer.get_backend('aer_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = backend.run(qc,shots=1,memory=True) output = job.result().get_memory()[0] return qc, output ## Test the function for inp1 in ['0', '1']: for inp2 in ['0', '1']: qc, output = OR(inp1, inp2) print('OR with inputs',inp1,inp2,'gives output',output) display(qc.draw()) print('\n') from qiskit import IBMQ #IBMQ.save_account("a68a35747d4eccd1d58f275e637909987c789ce5c0edd8a4f43014672bf0301b54b28b1b5f44ba8ff87500777429e1e4ceb79621a6ba248d6cca6bca0e233d23", overwrite=True) IBMQ.load_account() IBMQ.providers() provider = IBMQ.get_provider('ibm-q') provider.backends() import qiskit.tools.jupyter # run this cell backend = provider.get_backend('ibmq_quito') qc_and = QuantumCircuit(3) qc_and.ccx(0,1,2) print('AND gate') display(qc_and.draw()) print('\n\nTranspiled AND gate with all the required connectivity') qc_and.decompose().draw() from qiskit.tools.monitor import job_monitor # run the cell to define AND gate for real quantum system def AND(inp1, inp2, backend, layout): qc = QuantumCircuit(3, 1) qc.reset(range(3)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) qc.barrier() qc.ccx(0, 1, 2) qc.barrier() qc.measure(2, 0) qc_trans = transpile(qc, backend, initial_layout=layout, optimization_level=3) job = backend.run(qc_trans, shots=8192) print(job.job_id()) job_monitor(job) output = job.result().get_counts() return qc_trans, output backend layout = [0, 1, 2] output_all = [] qc_trans_all = [] prob_all = [] worst = 1 best = 0 for input1 in ['0','1']: for input2 in ['0','1']: qc_trans, output = AND(input1, input2, backend, layout) output_all.append(output) qc_trans_all.append(qc_trans) prob = output[str(int( input1=='1' and input2=='1' ))]/8192 prob_all.append(prob) print('\nProbability of correct answer for inputs',input1,input2) print('{:.2f}'.format(prob) ) print('---------------------------------') worst = min(worst,prob) best = max(best, prob) print('') print('\nThe highest of these probabilities was {:.2f}'.format(best)) print('The lowest of these probabilities was {:.2f}'.format(worst)) print('Transpiled AND gate circuit for ibmq_vigo with input 0 0') print('\nThe circuit depth : {}'.format (qc_trans_all[0].depth())) print('# of nonlocal gates : {}'.format (qc_trans_all[0].num_nonlocal_gates())) print('Probability of correct answer : {:.2f}'.format(prob_all[0]) ) qc_trans_all[0].draw() print('Transpiled AND gate circuit for ibmq_vigo with input 0 1') print('\nThe circuit depth : {}'.format (qc_trans_all[1].depth())) print('# of nonlocal gates : {}'.format (qc_trans_all[1].num_nonlocal_gates())) print('Probability of correct answer : {:.2f}'.format(prob_all[1]) ) qc_trans_all[1].draw() print('Transpiled AND gate circuit for ibmq_vigo with input 1 0') print('\nThe circuit depth : {}'.format (qc_trans_all[2].depth())) print('# of nonlocal gates : {}'.format (qc_trans_all[2].num_nonlocal_gates())) print('Probability of correct answer : {:.2f}'.format(prob_all[2]) ) qc_trans_all[2].draw() print('Transpiled AND gate circuit for ibmq_vigo with input 1 1') print('\nThe circuit depth : {}'.format (qc_trans_all[3].depth())) print('# of nonlocal gates : {}'.format (qc_trans_all[3].num_nonlocal_gates())) print('Probability of correct answer : {:.2f}'.format(prob_all[3]) ) qc_trans_all[3].draw()
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import numpy as np # Importing standard Qiskit libraries from qiskit import QuantumCircuit, transpile, Aer, execute from qiskit.tools.jupyter import * from qiskit.visualization import * from qiskit.providers.aer import QasmSimulator backend = Aer.get_backend('statevector_simulator') qc1 = QuantumCircuit(4) # perform gate operations on individual qubits qc1.x(0) qc1.y(1) qc1.z(2) qc1.s(3) # Draw circuit qc1.draw() # Plot blochshere out1 = execute(qc1,backend).result().get_statevector() plot_bloch_multivector(out1) qc2 = QuantumCircuit(4) # initialize qubits qc2.x(range(4)) # perform gate operations on individual qubits qc2.x(0) qc2.y(1) qc2.z(2) qc2.s(3) # Draw circuit qc2.draw() # Plot blochshere out2 = execute(qc2,backend).result().get_statevector() plot_bloch_multivector(out2) qc3 = QuantumCircuit(4) # initialize qubits qc3.h(range(4)) # perform gate operations on individual qubits qc3.x(0) qc3.y(1) qc3.z(2) qc3.s(3) # Draw circuit qc3.draw() # Plot blochshere out3 = execute(qc3,backend).result().get_statevector() plot_bloch_multivector(out3) qc4 = QuantumCircuit(4) # initialize qubits qc4.x(range(4)) qc4.h(range(4)) # perform gate operations on individual qubits qc4.x(0) qc4.y(1) qc4.z(2) qc4.s(3) # Draw circuit qc4.draw() # Plot blochshere out4 = execute(qc4,backend).result().get_statevector() plot_bloch_multivector(out4) qc5 = QuantumCircuit(4) # initialize qubits qc5.h(range(4)) qc5.s(range(4)) # perform gate operations on individual qubits qc5.x(0) qc5.y(1) qc5.z(2) qc5.s(3) # Draw circuit qc5.draw() # Plot blochshere out5 = execute(qc5,backend).result().get_statevector() plot_bloch_multivector(out5) qc6 = QuantumCircuit(4) # initialize qubits qc6.x(range(4)) qc6.h(range(4)) qc6.s(range(4)) # perform gate operations on individual qubits qc6.x(0) qc6.y(1) qc6.z(2) qc6.s(3) # Draw circuit qc6.draw() # Plot blochshere out6 = execute(qc6,backend).result().get_statevector() plot_bloch_multivector(out6) import qiskit qiskit.__qiskit_version__
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit import * import numpy as np from numpy import linalg as la from qiskit.tools.monitor import job_monitor import qiskit.tools.jupyter qc = QuantumCircuit(1) #### your code goes here # z measurement of qubit 0 measure_z = QuantumCircuit(1,1) measure_z.measure(0,0) # x measurement of qubit 0 measure_x = QuantumCircuit(1,1) # your code goes here # y measurement of qubit 0 measure_y = QuantumCircuit(1,1) # your code goes here shots = 2**14 # number of samples used for statistics sim = Aer.get_backend('qasm_simulator') bloch_vector_measure = [] for measure_circuit in [measure_x, measure_y, measure_z]: # run the circuit with a the selected measurement and get the number of samples that output each bit value counts = execute(qc+measure_circuit, sim, shots=shots).result().get_counts() # calculate the probabilities for each bit value probs = {} for output in ['0','1']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 bloch_vector_measure.append( probs['0'] - probs['1'] ) # normalizing the bloch sphere vector bloch_vector = bloch_vector_measure/la.norm(bloch_vector_measure) print('The bloch sphere coordinates are [{0:4.3f}, {1:4.3f}, {2:4.3f}]' .format(*bloch_vector)) from kaleidoscope.interactive import bloch_sphere bloch_sphere(bloch_vector, vectors_annotation=True) from qiskit.visualization import plot_bloch_vector plot_bloch_vector( bloch_vector ) # circuit for the state Tri1 Tri1 = QuantumCircuit(2) # your code goes here # circuit for the state Tri2 Tri2 = QuantumCircuit(2) # your code goes here # circuit for the state Tri3 Tri3 = QuantumCircuit(2) # your code goes here # circuit for the state Sing Sing = QuantumCircuit(2) # your code goes here # <ZZ> measure_ZZ = QuantumCircuit(2) measure_ZZ.measure_all() # <XX> measure_XX = QuantumCircuit(2) # your code goes here # <YY> measure_YY = QuantumCircuit(2) # your code goes here shots = 2**14 # number of samples used for statistics A = 1.47e-6 #unit of A is eV E_sim = [] for state_init in [Tri1,Tri2,Tri3,Sing]: Energy_meas = [] for measure_circuit in [measure_XX, measure_YY, measure_ZZ]: # run the circuit with a the selected measurement and get the number of samples that output each bit value qc = state_init+measure_circuit counts = execute(qc, sim, shots=shots).result().get_counts() # calculate the probabilities for each computational basis probs = {} for output in ['00','01', '10', '11']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 Energy_meas.append( probs['00'] - probs['01'] - probs['10'] + probs['11'] ) E_sim.append(A * np.sum(np.array(Energy_meas))) # Run this cell to print out your results print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E_sim[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E_sim[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E_sim[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E_sim[3])) # reduced plank constant in (eV) and the speed of light(cgs units) hbar, c = 4.1357e-15, 3e10 # energy difference between the triplets and singlet E_del = abs(E_sim[0] - E_sim[3]) # frequency associated with the energy difference f = E_del/hbar # convert frequency to wavelength in (cm) wavelength = c/f print('The wavelength of the radiation from the transition\ in the hyperfine structure is : {:.1f} cm'.format(wavelength)) provider = IBMQ.load_account() backend = provider.get_backend('ibmq_athens') # run this cell to get the backend information through the widget backend # assign your choice for the initial layout to the list variable `initial_layout`. initial_layout = qc_all = [state_init+measure_circuit for state_init in [Tri1,Tri2,Tri3,Sing] for measure_circuit in [measure_XX, measure_YY, measure_ZZ] ] shots = 8192 job = execute(qc_all, backend, initial_layout=initial_layout, optimization_level=3, shots=shots) print(job.job_id()) job_monitor(job) # getting the results of your job results = job.result() ## To access the results of the completed job #results = backend.retrieve_job('job_id').result() def Energy(results, shots): """Compute the energy levels of the hydrogen ground state. Parameters: results (obj): results, results from executing the circuits for measuring a hamiltonian. shots (int): shots, number of shots used for the circuit execution. Returns: Energy (list): energy values of the four different hydrogen ground states """ E = [] A = 1.47e-6 for ind_state in range(4): Energy_meas = [] for ind_comp in range(3): counts = results.get_counts(ind_state*3+ind_comp) # calculate the probabilities for each computational basis probs = {} for output in ['00','01', '10', '11']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 Energy_meas.append( probs['00'] - probs['01'] - probs['10'] + probs['11'] ) E.append(A * np.sum(np.array(Energy_meas))) return E E = Energy(results, shots) print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E[3])) from qiskit.ignis.mitigation.measurement import * # your code to create the circuits, meas_calibs, goes here meas_calibs, state_labels = # execute meas_calibs on your choice of the backend job = execute(meas_calibs, backend, shots = shots) print(job.job_id()) job_monitor(job) cal_results = job.result() ## To access the results of the completed job #cal_results = backend.retrieve_job('job_id').result() # your code to obtain the measurement filter object, 'meas_filter', goes here results_new = meas_filter.apply(results) E_new = Energy(results_new, shots) print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E_new[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E_new[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E_new[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E_new[3])) # results for the energy estimation from the simulation, # execution on a quantum system without error mitigation and # with error mitigation in numpy array format Energy_exact, Energy_exp_orig, Energy_exp_new = np.array(E_sim), np.array(E), np.array(E_new) # Calculate the relative errors of the energy values without error mitigation # and assign to the numpy array variable `Err_rel_orig` of size 4 Err_rel_orig = # Calculate the relative errors of the energy values with error mitigation # and assign to the numpy array variable `Err_rel_new` of size 4 Err_rel_new = np.set_printoptions(precision=3) print('The relative errors of the energy values for four bell basis\ without measurement error mitigation : {}'.format(Err_rel_orig)) np.set_printoptions(precision=3) print('The relative errors of the energy values for four bell basis\ with measurement error mitigation : {}'.format(Err_rel_new))
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
# Importing standard Qiskit libraries from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit import Aer, assemble from qiskit.visualization import plot_histogram, plot_bloch_multivector, plot_state_qsphere, plot_state_city, plot_state_paulivec, plot_state_hinton # Ignore warnings import warnings warnings.filterwarnings('ignore') # Define backend sim = Aer.get_backend('aer_simulator') def createBellStates(inp1, inp2): qc = QuantumCircuit(2) qc.reset(range(2)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) qc.barrier() qc.h(0) qc.cx(0,1) qc.save_statevector() qobj = assemble(qc) result = sim.run(qobj).result() state = result.get_statevector() return qc, state, result print('Note: Since these qubits are in entangled state, their state cannot be written as two separate qubit states. This also means that we lose information when we try to plot our state on separate Bloch spheres as seen below.\n') inp1 = 0 inp2 = 1 qc, state, result = createBellStates(inp1, inp2) display(plot_bloch_multivector(state)) # Uncomment below code in order to explore other states #for inp2 in ['0', '1']: #for inp1 in ['0', '1']: #qc, state, result = createBellStates(inp1, inp2) #print('For inputs',inp2,inp1,'Representation of Entangled States are:') # Uncomment any of the below functions to visualize the resulting quantum states # Draw the quantum circuit #display(qc.draw()) # Plot states on QSphere #display(plot_state_qsphere(state)) # Plot states on Bloch Multivector #display(plot_bloch_multivector(state)) # Plot histogram #display(plot_histogram(result.get_counts())) # Plot state matrix like a city #display(plot_state_city(state)) # Represent state matix using Pauli operators as the basis #display(plot_state_paulivec(state)) # Plot state matrix as Hinton representation #display(plot_state_hinton(state)) #print('\n')''' from qiskit import IBMQ, execute from qiskit.providers.ibmq import least_busy from qiskit.tools import job_monitor # Loading your IBM Quantum account(s) provider = IBMQ.load_account() backend = least_busy(provider.backends(filters=lambda x: x.configuration().n_qubits >= 2 and not x.configuration().simulator and x.status().operational==True)) def createBSRealDevice(inp1, inp2): qr = QuantumRegister(2) cr = ClassicalRegister(2) qc = QuantumCircuit(qr, cr) qc.reset(range(2)) if inp1 == 1: qc.x(0) if inp2 == 1: qc.x(1) qc.barrier() qc.h(0) qc.cx(0,1) qc.measure(qr, cr) job = execute(qc, backend=backend, shots=100) job_monitor(job) result = job.result() return qc, result inp1 = 0 inp2 = 0 print('For inputs',inp2,inp1,'Representation of Entangled States are,') #first results qc, first_result = createBSRealDevice(inp1, inp2) first_counts = first_result.get_counts() # Draw the quantum circuit display(qc.draw()) #second results qc, second_result = createBSRealDevice(inp1, inp2) second_counts = second_result.get_counts() # Plot results on histogram with legend legend = ['First execution', 'Second execution'] plot_histogram([first_counts, second_counts], legend=legend) def ghzCircuit(inp1, inp2, inp3): qc = QuantumCircuit(3) qc.reset(range(3)) if inp1 == 1: qc.x(0) if inp2 == 1: qc.x(1) if inp3 == 1: qc.x(2) qc.barrier() qc.h(0) qc.cx(0,1) qc.cx(0,2) qc.save_statevector() qobj = assemble(qc) result = sim.run(qobj).result() state = result.get_statevector() return qc, state, result print('Note: Since these qubits are in entangled state, their state cannot be written as two separate qubit states. This also means that we lose information when we try to plot our state on separate Bloch spheres as seen below.\n') inp1 = 0 inp2 = 1 inp3 = 1 qc, state, result = ghzCircuit(inp1, inp2, inp3) display(plot_bloch_multivector(state)) # Uncomment below code in order to explore other states #for inp3 in ['0','1']: #for inp2 in ['0','1']: #for inp1 in ['0','1']: #qc, state, result = ghzCircuit(inp1, inp2, inp3) #print('For inputs',inp3,inp2,inp1,'Representation of GHZ States are:') # Uncomment any of the below functions to visualize the resulting quantum states # Draw the quantum circuit #display(qc.draw()) # Plot states on QSphere #display(plot_state_qsphere(state)) # Plot states on Bloch Multivector #display(plot_bloch_multivector(state)) # Plot histogram #display(plot_histogram(result.get_counts())) # Plot state matrix like a city #display(plot_state_city(state)) # Represent state matix using Pauli operators as the basis #display(plot_state_paulivec(state)) # Plot state matrix as Hinton representation #display(plot_state_hinton(state)) #print('\n') def ghz5QCircuit(inp1, inp2, inp3, inp4, inp5): qc = QuantumCircuit(5) #qc.reset(range(5)) if inp1 == 1: qc.x(0) if inp2 == 1: qc.x(1) if inp3 == 1: qc.x(2) if inp4 == 1: qc.x(3) if inp5 == 1: qc.x(4) qc.barrier() qc.h(0) qc.cx(0,1) qc.cx(0,2) qc.cx(0,3) qc.cx(0,4) qc.save_statevector() qobj = assemble(qc) result = sim.run(qobj).result() state = result.get_statevector() return qc, state, result # Explore GHZ States for input 00010. Note: the input has been stated in little-endian format. inp1 = 0 inp2 = 1 inp3 = 0 inp4 = 0 inp5 = 0 qc, state, result = ghz5QCircuit(inp1, inp2, inp3, inp4, inp5) print('For inputs',inp5,inp4,inp3,inp2,inp1,'Representation of GHZ States are:') display(plot_state_qsphere(state)) print('\n') # Explore GHZ States for input 11001. Note: the input has been stated in little-endian format. inp1 = 1 inp2 = 0 inp3 = 0 inp4 = 1 inp5 = 1 qc, state, result = ghz5QCircuit(inp1, inp2, inp3, inp4, inp5) print('For inputs',inp5,inp4,inp3,inp2,inp1,'Representation of GHZ States are:') display(plot_state_qsphere(state)) print('\n') # Explore GHZ States for input 01010. Note: the input has been stated in little-endian format. inp1 = 0 inp2 = 1 inp3 = 0 inp4 = 1 inp5 = 0 qc, state, result = ghz5QCircuit(inp1, inp2, inp3, inp4, inp5) print('For inputs',inp5,inp4,inp3,inp2,inp1,'Representation of GHZ States are:') display(plot_state_qsphere(state)) print('\n') # Uncomment below code in order to explore other states #for inp5 in ['0','1']: #for inp4 in ['0','1']: #for inp3 in ['0','1']: #for inp2 in ['0','1']: #for inp1 in ['0','1']: #qc, state, result = ghz5QCircuit(inp1, inp2, inp3, inp4, inp5) #print('For inputs',inp5,inp4,inp3,inp2,inp1,'Representation of GHZ States are:') # Uncomment any of the below functions to visualize the resulting quantum states # Draw the quantum circuit #display(qc.draw()) # Plot states on QSphere #display(plot_state_qsphere(state)) # Plot states on Bloch Multivector #display(plot_bloch_multivector(state)) # Plot histogram #display(plot_histogram(result.get_counts())) # Plot state matrix like a city #display(plot_state_city(state)) # Represent state matix using Pauli operators as the basis #display(plot_state_paulivec(state)) # Plot state matrix as Hinton representation #display(plot_state_hinton(state)) #print('\n') backend = least_busy(provider.backends(filters=lambda x: x.configuration().n_qubits >= 5 and not x.configuration().simulator and x.status().operational==True)) def create5QGHZRealDevice(inp1, inp2, inp3, inp4, inp5): qr = QuantumRegister(5) cr = ClassicalRegister(5) qc = QuantumCircuit(qr, cr) qc.reset(range(5)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) if inp3=='1': qc.x(1) if inp4=='1': qc.x(1) if inp5=='1': qc.x(1) qc.barrier() qc.h(0) qc.cx(0,1) qc.cx(0,2) qc.cx(0,3) qc.cx(0,4) qc.measure(qr, cr) job = execute(qc, backend=backend, shots=1000) job_monitor(job) result = job.result() return qc, result inp1 = 0 inp2 = 0 inp3 = 0 inp4 = 0 inp5 = 0 #first results qc, first_result = create5QGHZRealDevice(inp1, inp2, inp3, inp4, inp5) first_counts = first_result.get_counts() # Draw the quantum circuit display(qc.draw()) #second results qc, second_result = create5QGHZRealDevice(inp1, inp2, inp3, inp4, inp5) second_counts = second_result.get_counts() print('For inputs',inp5,inp4,inp3,inp2,inp1,'Representation of GHZ circuit states are,') # Plot results on histogram with legend legend = ['First execution', 'Second execution'] plot_histogram([first_counts, second_counts], legend=legend) import qiskit qiskit.__qiskit_version__
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
# Importing standard Qiskit libraries from qiskit import QuantumCircuit, execute, Aer, IBMQ from qiskit.compiler import transpile, assemble from qiskit.tools.jupyter import * from qiskit.visualization import * from ibm_quantum_widgets import * # useful to have pi import math pi=math.pi # Loading your IBM Q account(s) provider = IBMQ.load_account() device = provider.get_backend('ibmq_5_yorktown') qc=QuantumCircuit(3) qc.ccx(0,1,2) new_circuit = transpile(qc,backend=device) new_circuit.draw(output='mpl') qc = QuantumCircuit(3) theta = pi # Theta can be anything (pi chosen arbitrarily) # qc.h(2) gets replaced with qc.rz(pi/2, 2) qc.sx(2) qc.rz(pi/2, 2) #already basic gate qc.cx(1,2) # qc.tdg(2) gets replaced with qc.rz(7*pi/4, 2) #already basic gate qc.cx(0,2) # qc.t(2) gets replaced with qc.rz(pi/4, 2) #Already a basic gate qc.cx(1,2) # qc.tdg(2) gets replaced with qc.rz(7*pi/4, 2) #already a basic gate qc.cx(0,2) # qc.t(1) gets replaced with qc.rz(pi/4, 1) # qc.t(2) gets replaced with qc.rz(pi/4, 2) # qc.h(2) gets replaced with qc.rz(pi/2, 2) qc.sx(2) qc.rz(pi/2, 2) #Already a basic gate qc.cx(0,1) # qc.t(0) gets replaced with qc.rz(pi/4, 0) # qc.tdg(1) gets replaced with qc.rz(pi/4, 1) #already a basic gate qc.cx(0,1) qc.draw()
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit import QuantumCircuit from qiskit import QuantumRegister, QuantumCircuit c = QuantumRegister(1, 'control') t = QuantumRegister(2, 'target') cu = QuantumCircuit(c, t, name="Controlled 13^x mod 35") # Your code goes here # easy (non-optimal) solution: cu.ccx(c, t[0], t[1]) cu.cx(c, t[0]) # end solution cu.draw() c = QuantumRegister(1, 'control') t = QuantumRegister(2, 'target') cu2 = QuantumCircuit(c, t) # Your code here # Non-optimal solution: cu2 = cu.compose(cu) # end solution cu2.draw() c = QuantumRegister(1, 'control') t = QuantumRegister(2, 'target') cu4 = QuantumCircuit(c, t) # Your code here # VERY bad solution (to be removed): cu4 = cu2.compose(cu2) # end solution cu4.draw() cqr = QuantumRegister(3, 'control') tqr = QuantumRegister(2, 'target') cux = QuantumCircuit(cqr, tqr) solutions = [cu, cu2, cu4] for i in range(3): cux = cux.compose(solutions[i], [cqr[i], tqr[0], tqr[1]]) cux.draw() # To be removed before the challenge from qiskit.circuit.library import QFT from qiskit import transpile import numpy as np cqr = QuantumRegister(3, 'control') tqr = QuantumRegister(2, 'target') cux2 = QuantumCircuit(cqr, tqr) cux2.append(QFT(2, do_swaps=False), [3, 4]) cux2.cz(0, 3) cux2.cp(np.pi/2, 0, 4) cux2.cz(1, 4) cux2.append(QFT(2, inverse=True, do_swaps=False), [3, 4]) display(cux2.draw()) t_cux2 = transpile(cux2, basis_gates=['u','cx'], optimization_level=3) display(t_cux2.draw()) t_cux2.count_ops()['cx'] from qiskit.circuit.library import QFT from qiskit import ClassicalRegister cr = ClassicalRegister(3) shor_circuit = QuantumCircuit(cqr, tqr, cr) shor_circuit.h(cqr) shor_circuit.compose(cux2, inplace=True) shor_circuit.append(QFT(3, inverse=True, do_swaps=True), cqr) shor_circuit.measure(cqr, cr) shor_circuit.draw() from qiskit.test.mock import FakeAthens from qiskit import assemble from qiskit.visualization import plot_histogram # we can do some more transpiling to squeeze out extra performance, but this isn't necessary from qiskit.transpiler import PassManager from qiskit.transpiler.passes import HoareOptimizer athens = FakeAthens() tqc = transpile(shor_circuit, athens, optimization_level=3) pm = PassManager(HoareOptimizer()) tqc = pm.run(tqc) counts = athens.run(assemble(tqc)).result().get_counts() plot_histogram(counts)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister, Aer, assemble, transpile import qiskit.tools.jupyter from qiskit.test.mock import FakeTokyo code = QuantumRegister(5,'code') syn = QuantumRegister(4,'syn') out = ClassicalRegister(4,'output') backend = FakeTokyo() error_qubits = [0,4] # qc_syn qc_syn = QuantumCircuit(code,syn,out) # left ZZZ qc_syn.cx(code[0],syn[1]) qc_syn.cx(code[2],syn[1]) qc_syn.cx(code[3],syn[1]) qc_syn.barrier() # right ZZZ qc_syn.cx(code[2],syn[2]) qc_syn.cx(code[4],syn[2]) qc_syn.cx(code[1],syn[0]) # qc_syn.cx(syn[0],syn[2]) # qc_syn.cx(code[1],syn[0]) # qc_syn.barrier() # top XXX qc_syn.h(syn[0]) qc_syn.cx(syn[0],code[0]) qc_syn.cx(syn[0],code[1]) qc_syn.cx(syn[0],code[2]) qc_syn.h(syn[0]) qc_syn.barrier() # bottom XXX qc_syn.h(syn[3]) qc_syn.cx(syn[3],code[2]) qc_syn.cx(syn[3],code[3]) qc_syn.cx(syn[3],code[4]) qc_syn.h(syn[3]) qc_syn.barrier() # measure the auxilliary qubits qc_syn.measure(syn,out) # qc_init qc_init = QuantumCircuit(code,syn,out) qc_init.h(syn[0]) qc_init.cx(syn[0],code[0]) qc_init.cx(syn[0],code[1]) qc_init.cx(syn[0],code[2]) qc_init.cx(code[2],syn[0]) qc_init.h(syn[3]) qc_init.cx(syn[3],code[2]) qc_init.cx(syn[3],code[3]) qc_init.cx(syn[3],code[4]) qc_init.cx(code[4],syn[3]) qc_init.barrier() # initial layout initial_layout = [0,2,6,10,12,1,5,7,11] # qc_syn qc_syn = QuantumCircuit(code,syn,out) # left ZZZ qc_syn.cx(code[0],syn[1]) qc_syn.cx(code[2],syn[1]) qc_syn.cx(code[3],syn[1]) qc_syn.barrier() # right ZZZ qc_syn.cx(code[2],syn[2]) qc_syn.cx(code[4],syn[2]) qc_syn.cx(code[1],syn[0]) qc_syn.cx(syn[0],syn[2]) qc_syn.cx(code[1],syn[0]) qc_syn.barrier() # top XXX qc_syn.h(syn[0]) qc_syn.cx(syn[0],code[0]) qc_syn.cx(syn[0],code[1]) qc_syn.cx(syn[0],code[2]) qc_syn.h(syn[0]) qc_syn.barrier() # bottom XXX qc_syn.h(syn[3]) qc_syn.cx(syn[3],code[2]) qc_syn.cx(syn[3],code[3]) qc_syn.cx(syn[3],code[4]) qc_syn.h(syn[3]) qc_syn.barrier() # measure the auxilliary qubits qc_syn.measure(syn,out) # qc_init qc_init = QuantumCircuit(code,syn,out) # initial layout initial_layout = [0,2,6,10,12,1,5,7,11] # qc_syn qc_syn = QuantumCircuit(code,syn,out) qc_syn.measure(syn,out) # qc_init qc_init = QuantumCircuit(code,syn,out) qc_init.h(syn[0]) qc_init.cx(syn[0],code[0]) qc_init.cx(syn[0],code[1]) qc_init.cx(syn[0],code[2]) qc_init.cx(code[2],syn[0]) qc_init.h(syn[3]) qc_init.cx(syn[3],code[2]) qc_init.cx(syn[3],code[3]) qc_init.cx(syn[3],code[4]) qc_init.cx(code[4],syn[3]) qc_init.barrier() # initial layout initial_layout = [0,2,6,10,12,1,5,7,11] # qc_syn qc_syn = QuantumCircuit(code,syn,out) # left ZZZ qc_syn.cx(code[0],syn[1]) qc_syn.cx(code[2],syn[1]) qc_syn.cx(code[3],syn[1]) qc_syn.barrier() # right ZZZ qc_syn.cx(code[2],syn[2]) qc_syn.cx(code[4],syn[2]) qc_syn.cx(code[1],syn[2]) qc_syn.barrier() # top XXX qc_syn.h(syn[0]) qc_syn.cx(syn[0],code[0]) qc_syn.cx(syn[0],code[1]) qc_syn.cx(syn[0],code[2]) qc_syn.h(syn[0]) qc_syn.barrier() # bottom XXX qc_syn.h(syn[3]) qc_syn.cx(syn[3],code[2]) qc_syn.cx(syn[3],code[3]) qc_syn.cx(syn[3],code[4]) qc_syn.h(syn[3]) qc_syn.barrier() # measure the auxilliary qubits qc_syn.measure(syn,out) # qc_init qc_init = QuantumCircuit(code,syn,out) qc_init.h(code[0]) qc_init.cx(code[0],code[1]) qc_init.cx(code[0],code[2]) qc_init.h(code[3]) qc_init.cx(code[3],code[2]) qc_init.cx(code[3],code[4]) qc_init.barrier() # initial layout initial_layout = list(range(9))
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
# Import helper module from local folder import sys import os sys.path.append(os.getcwd()) from resources import helper # Numerical and plotting tools import numpy as np import matplotlib.pyplot as plt # Import SI unit conversion factors from resources.helper import GHz, MHz, kHz, us, ns # Importing standard Qiskit libraries from qiskit import IBMQ from qiskit.tools.jupyter import * # Loading your IBM Quantum account IBMQ.load_account() # IBMQ.providers() # see a list of providers you have access to # Get the special provider assigned to you using information from the output above hub_name = 'iqc2021-1' # e.g. 'iqc2021-1' group_name = 'challenge-159' # e.g. 'challenge-1' project_name = 'ex4' # Your project name should be 'ex4' provider = IBMQ.get_provider(hub=hub_name, group=group_name, project=project_name) # Get `ibmq_jakarta` backend from the provider backend_name = 'ibmq_jakarta' backend = provider.get_backend(backend_name) backend # See details of the `ibmq_jakarta` quantum system from qiskit import pulse from qiskit.pulse import Play, Schedule, DriveChannel # Please use qubit 0 throughout the notebook qubit = 0 backend_config = backend.configuration() exc_chans = helper.get_exc_chans(globals()) dt = backend_config.dt print(f"Sampling time: {dt*1e9} ns") backend_defaults = backend.defaults() center_frequency = backend_defaults.qubit_freq_est inst_sched_map = backend_defaults.instruction_schedule_map inst_sched_map.instructions # Retrieve calibrated measurement pulse from backend meas = inst_sched_map.get('measure', qubits=[qubit]) meas.exclude(channels=exc_chans).draw(time_range=[0,1000]) from qiskit.pulse import DriveChannel, Gaussian # The same spec pulse for both 01 and 12 spec drive_amp = 0.25 drive_duration = inst_sched_map.get('x', qubits=[qubit]).duration # Calibrated backend pulse use advanced DRAG pulse to reduce leakage to the |2> state. # Here we will use simple Gaussian pulse drive_sigma = drive_duration // 4 # DRAG pulses typically 4*sigma long. spec_pulse = Gaussian(duration=drive_duration, amp=drive_amp, sigma=drive_sigma, name=f"Spec drive amplitude = {drive_amp}") # Construct an np array of the frequencies for our experiment spec_freqs_GHz = helper.get_spec01_freqs(center_frequency, qubit) # Create the base schedule # Start with drive pulse acting on the drive channel spec01_scheds = [] for freq in spec_freqs_GHz: with pulse.build(name="Spec Pulse at %.3f GHz" % freq) as spec01_sched: with pulse.align_sequential(): # Pay close attention to this part to solve the problem at the end pulse.set_frequency(freq*GHz, DriveChannel(qubit)) pulse.play(spec_pulse, DriveChannel(qubit)) pulse.call(meas) spec01_scheds.append(spec01_sched) # Draw spec01 schedule spec01_scheds[-1].exclude(channels=exc_chans).draw(time_range=[0,1000]) from qiskit.tools.monitor import job_monitor # Run the job on a real backend spec01_job = backend.run(spec01_scheds, job_name="Spec 01", **helper.job_params) print(spec01_job.job_id()) job_monitor(spec01_job) # If the queuing time is too long, you can save the job id # And retrieve the job after it's done # Replace 'JOB_ID' with the the your job id and uncomment to line below #spec01_job = backend.retrieve_job('JOB_ID') from resources.helper import SpecFitter amp_guess = 5e6 f01_guess = 5 B = 1 C = 0 fit_guess = [amp_guess, f01_guess, B, C] fit = SpecFitter(spec01_job.result(), spec_freqs_GHz, qubits=[qubit], fit_p0=fit_guess) fit.plot(0, series='z') f01 = fit.spec_freq(0, series='z') print("Spec01 frequency is %.6f GHz" % f01) # Retrieve qubit frequency from backend properties f01_calibrated = backend.properties().frequency(qubit) / GHz f01_error = abs(f01-f01_calibrated) * 1000 # error in MHz print("Qubit frequency error is %.6f MHz" % f01_error) max_rabi_amp = 0.75 rabi_amps = helper.get_rabi_amps(max_rabi_amp) rabi_scheds = [] for ridx, amp in enumerate(rabi_amps): with pulse.build(name="rabisched_%d_0" % ridx) as sched: # '0' corresponds to Rabi with pulse.align_sequential(): pulse.set_frequency(f01*GHz, DriveChannel(qubit)) rabi_pulse = Gaussian(duration=drive_duration, amp=amp, \ sigma=drive_sigma, name=f"Rabi drive amplitude = {amp}") pulse.play(rabi_pulse, DriveChannel(qubit)) pulse.call(meas) rabi_scheds.append(sched) # Draw rabi schedule rabi_scheds[-1].exclude(channels=exc_chans).draw(time_range=[0,1000]) # Run the job on a real device rabi_job = backend.run(rabi_scheds, job_name="Rabi", **helper.job_params) print(rabi_job.job_id()) job_monitor(rabi_job) # If the queuing time is too long, you can save the job id # And retrieve the job after it's done # Replace 'JOB_ID' with the the your job id and uncomment to line below #rabi_job = backend.retrieve_job('JOB_ID') from qiskit.ignis.characterization.calibrations.fitters import RabiFitter amp_guess = 5e7 fRabi_guess = 2 phi_guess = 0.5 c_guess = 0 fit_guess = [amp_guess, fRabi_guess, phi_guess, c_guess] fit = RabiFitter(rabi_job.result(), rabi_amps, qubits=[qubit], fit_p0=fit_guess) fit.plot(qind=0, series='0') x180_amp = fit.pi_amplitude() print("Pi amplitude is %.3f" % x180_amp) # Define pi pulse x_pulse = Gaussian(duration=drive_duration, amp=x180_amp, sigma=drive_sigma, name='x_pulse') def build_spec12_pulse_schedule(freq, anharm_guess_GHz): with pulse.build(name="Spec Pulse at %.3f GHz" % (freq+anharm_guess_GHz)) as spec12_schedule: with pulse.align_sequential(): # WRITE YOUR CODE BETWEEN THESE LINES - START # X Pulse pulse.set_frequency(f01*GHz, DriveChannel(qubit)) pulse.play(x_pulse, DriveChannel(qubit)) # 0-2 Spec Pulse pulse.set_frequency((freq+anharm_guess_GHz)*GHz, DriveChannel(qubit)) pulse.play(spec_pulse, DriveChannel(qubit)) pulse.call(meas) # WRITE YOUR CODE BETWEEN THESE LINES - END return spec12_schedule anharmonicity_guess_GHz = -0.3 # your anharmonicity guess freqs_GHz = helper.get_spec12_freqs(f01, qubit) # Now vary the sideband frequency for each spec pulse spec12_scheds = [] for freq in freqs_GHz: spec12_scheds.append(build_spec12_pulse_schedule(freq, anharmonicity_guess_GHz)) # Draw spec12 schedule spec12_scheds[-1].exclude(channels=exc_chans).draw(time_range=[0,1000]) spec12_scheds[1].exclude(channels=exc_chans).draw(time_range=[0,1000]) # Run the job on a real device spec12_job = backend.run(spec12_scheds, job_name="Spec 12", **helper.job_params) print(spec12_job.job_id()) job_monitor(spec12_job) # If the queuing time is too long, you can save the job id # And retrieve the job after it's done # Replace 'JOB_ID' with the the your job id and uncomment to line below #spec12_job = backend.retrieve_job('JOB_ID') amp_guess = 2e7 f12_guess = f01 - 0.3 B = .1 C = 0 fit_guess = [amp_guess, f12_guess, B, C] fit = SpecFitter(spec12_job.result(), freqs_GHz+anharmonicity_guess_GHz, qubits=[qubit], fit_p0=fit_guess) fit.plot(0, series='z') f12 = fit.spec_freq(0, series='z') print("Spec12 frequency is %.6f GHz" % f12) # Check your answer using following code from qc_grader import grade_ex4 grade_ex4(f12,qubit,backend_name) # Submit your answer. You can re-submit at any time. from qc_grader import submit_ex4 submit_ex4(f12,qubit,backend_name) Ec = f01 - f12 Ej = (2*f01-f12)**2/(8*(f01-f12)) print(f"Ej/Ec: {Ej/Ec:.2f}") # This value is typically ~ 30
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
# Classical HF computation from qiskit_nature.drivers import PySCFDriver molecule = "H .0 .0 .0; H .0 .0 0.739" driver = PySCFDriver(atom=molecule) qmolecule = driver.run() n_el = qmolecule.num_alpha + qmolecule.num_beta n_mo = qmolecule.num_molecular_orbitals n_so = 2 * qmolecule.num_molecular_orbitals n_q = n_so e_nn = qmolecule.nuclear_repulsion_energy print("1. Number of electrons: {}".format(n_el)) print("2. Number of molecular orbitals: {}".format(n_mo)) print("3. Number of spin-orbitals: {}".format(n_so)) print("4. Number of qubits: {}".format(n_q)) print("5. Nuclear repulsion energy: {}".format(e_nn)) # Generate the second-quantized operators from qiskit_nature.problems.second_quantization.electronic import ElectronicStructureProblem problem = ElectronicStructureProblem(driver) second_q_ops = problem.second_q_ops() main_op = second_q_ops[0] from qiskit_nature.mappers.second_quantization import ParityMapper, BravyiKitaevMapper, JordanWignerMapper from qiskit_nature.converters.second_quantization.qubit_converter import QubitConverter # Setup the qubit converter mapper_type = 'JordanWignerMapper' if mapper_type == 'ParityMapper': mapper = ParityMapper() elif mapper_type == 'JordanWignerMapper': mapper = JordanWignerMapper() elif mapper_type == 'BravyiKitaevMapper': mapper = BravyiKitaevMapper() converter = QubitConverter(mapper=mapper, two_qubit_reduction=False) # Exact solution from qiskit_nature.algorithms.ground_state_solvers.minimum_eigensolver_factories import NumPyMinimumEigensolverFactory from qiskit_nature.algorithms.ground_state_solvers import GroundStateEigensolver import numpy as np def exact_diagonalizer(problem, converter): solver = NumPyMinimumEigensolverFactory() calc = GroundStateEigensolver(converter, solver) result = calc.solve(problem) return result result_exact = exact_diagonalizer(problem, converter) exact_energy = np.real(result_exact.eigenenergies[0]) print("Exact electronic energy", exact_energy) print(result_exact) # The fermionic operators are mapped to qubit operators num_particles = (problem.molecule_data_transformed.num_alpha, problem.molecule_data_transformed.num_beta) qubit_op = converter.convert(main_op, num_particles=num_particles) from qiskit_nature.circuit.library import HartreeFock num_particles = (problem.molecule_data_transformed.num_alpha, problem.molecule_data_transformed.num_beta) num_spin_orbitals = 2 * problem.molecule_data_transformed.num_molecular_orbitals init_state = HartreeFock(num_spin_orbitals, num_particles, converter) print(init_state) from qiskit.circuit.library import TwoLocal from qiskit_nature.circuit.library import UCCSD, PUCCD, SUCCD from qiskit.circuit import Parameter, QuantumCircuit # Choose the ansatz ansatz_type = "TwoLocal" # Parameters for q-UCC antatze num_particles = (problem.molecule_data_transformed.num_alpha, problem.molecule_data_transformed.num_beta) num_spin_orbitals = 2 * problem.molecule_data_transformed.num_molecular_orbitals # Put arguments for twolocal if ansatz_type == "TwoLocal": # Single qubit rotations that are placed on all qubits with independent parameters rotation_blocks = ['ry'] # Entangling gates entanglement_blocks = 'cx' # How the qubits are entangled entanglement = 'linear' # Repetitions of rotation_blocks + entanglement_blocks with independent parameters repetitions = 1 # Skip the final rotation_blocks layer skip_final_rotation_layer = False ansatz = TwoLocal(qubit_op.num_qubits, rotation_blocks, entanglement_blocks, reps=repetitions, entanglement=entanglement, skip_final_rotation_layer=skip_final_rotation_layer) # Add the initial state ansatz.compose(init_state, front=True, inplace=True) elif ansatz_type == "UCCSD": ansatz = UCCSD(converter,num_particles,num_spin_orbitals,initial_state = init_state) elif ansatz_type == "PUCCD": ansatz = PUCCD(converter,num_particles,num_spin_orbitals,initial_state = init_state) elif ansatz_type == "SUCCD": ansatz = SUCCD(converter,num_particles,num_spin_orbitals,initial_state = init_state) elif ansatz_type == "Custom": num_qubits = qubit_op.num_qubits qc = QuantumCircuit(num_qubits) param_count = 1 for i in range(num_qubits): theta = Parameter(f"ry_angle{param_count}" ) qc.ry(theta, i) param_count += 1 qc.cx(0,1) qc.cx(1,2) qc.cx(2,3) for i in range(num_qubits): theta = Parameter(f"ry_angle{param_count}") qc.ry(theta, i) param_count += 1 ansatz = qc ansatz.compose(init_state, front=True, inplace=True) print(ansatz) # Backend from qiskit import Aer backend = Aer.get_backend('statevector_simulator') # Classical optimizer from qiskit.algorithms.optimizers import COBYLA, L_BFGS_B, SPSA, SLSQP optimizer_type = 'COBYLA' # You may want to tune the parameters # of each optimizer, here the defaults are used if optimizer_type == 'COBYLA': optimizer = COBYLA(maxiter=500) elif optimizer_type == 'L_BFGS_B': optimizer = L_BFGS_B(maxfun=500) elif optimizer_type == 'SPSA': optimizer = SPSA(maxiter=500) elif optimizer_type == 'SLSQP': optimizer = SLSQP(maxiter=500) # Run VQE from qiskit.algorithms import VQE from IPython.display import display, clear_output # Print and save the data in lists def callback(eval_count, parameters, mean, std): # Overwrites the same line when printing display("Evaluation: {}, Energy: {}, Std: {}".format(eval_count, mean, std)) clear_output(wait=True) counts.append(eval_count) values.append(mean) params.append(parameters) deviation.append(std) counts = [] values = [] params = [] deviation = [] # Set initial parameters of the ansatz # We choose a fixed small displacement # So all participants start from similar starting point try: initial_point = [0.01] * len(ansatz.ordered_parameters) except: initial_point = [0.01] * ansatz.num_parameters algorithm = VQE(ansatz, optimizer=optimizer, quantum_instance=backend, callback=callback, initial_point=initial_point) result = algorithm.compute_minimum_eigenvalue(qubit_op) print(result) # Store results in a dictionary from qiskit.transpiler import PassManager from qiskit.transpiler.passes import Unroller # Unroller transpile your circuit into CNOTs and U gates pass_ = Unroller(['u', 'cx']) pm = PassManager(pass_) ansatz_tp = pm.run(ansatz) cnots = ansatz_tp.count_ops()['cx'] score = cnots accuracy_threshold = 4.0 # in mHa energy = result.optimal_value if ansatz_type == "TwoLocal": result_dict = { 'optimizer': optimizer.__class__.__name__, 'mapping': converter.mapper.__class__.__name__, 'ansatz': ansatz.__class__.__name__, 'rotation blocks': rotation_blocks, 'entanglement_blocks': entanglement_blocks, 'entanglement': entanglement, 'repetitions': repetitions, 'skip_final_rotation_layer': skip_final_rotation_layer, 'energy (Ha)': energy, 'error (mHa)': (energy-exact_energy)*1000, 'pass': (energy-exact_energy)*1000 <= accuracy_threshold, '# of parameters': len(result.optimal_point), 'final parameters': result.optimal_point, '# of evaluations': result.optimizer_evals, 'optimizer time': result.optimizer_time, '# of qubits': int(qubit_op.num_qubits), '# of CNOTs': cnots, 'score': score} else: result_dict = { 'optimizer': optimizer.__class__.__name__, 'mapping': converter.mapper.__class__.__name__, 'ansatz': ansatz.__class__.__name__, 'rotation blocks': None, 'entanglement_blocks': None, 'entanglement': None, 'repetitions': None, 'skip_final_rotation_layer': None, 'energy (Ha)': energy, 'error (mHa)': (energy-exact_energy)*1000, 'pass': (energy-exact_energy)*1000 <= accuracy_threshold, '# of parameters': len(result.optimal_point), 'final parameters': result.optimal_point, '# of evaluations': result.optimizer_evals, 'optimizer time': result.optimizer_time, '# of qubits': int(qubit_op.num_qubits), '# of CNOTs': cnots, 'score': score} # Plot the results import matplotlib.pyplot as plt fig, ax = plt.subplots(1, 1) ax.set_xlabel('Iterations') ax.set_ylabel('Energy') ax.grid() fig.text(0.7, 0.75, f'Energy: {result.optimal_value:.3f}\nScore: {score:.0f}') plt.title(f"{result_dict['optimizer']}-{result_dict['mapping']}\n{result_dict['ansatz']}") ax.plot(counts, values) ax.axhline(exact_energy, linestyle='--') fig_title = f"\ {result_dict['optimizer']}-\ {result_dict['mapping']}-\ {result_dict['ansatz']}-\ Energy({result_dict['energy (Ha)']:.3f})-\ Score({result_dict['score']:.0f})\ .png" fig.savefig(fig_title, dpi=300) # Display and save the data import pandas as pd import os.path filename = 'results_h2.csv' if os.path.isfile(filename): result_df = pd.read_csv(filename) result_df = result_df.append([result_dict]) else: result_df = pd.DataFrame.from_dict([result_dict]) result_df.to_csv(filename) result_df[['optimizer','ansatz', '# of qubits', '# of parameters','rotation blocks', 'entanglement_blocks', 'entanglement', 'repetitions', 'error (mHa)', 'pass', 'score']] from qiskit_nature.drivers import PySCFDriver molecule = 'Li 0.0 0.0 0.0; H 0.0 0.0 1.5474' driver = PySCFDriver(atom=molecule) qmolecule = driver.run() n_el = qmolecule.num_alpha + qmolecule.num_beta n_mo = qmolecule.num_molecular_orbitals n_so = 2 * qmolecule.num_molecular_orbitals n_q = n_so e_nn = qmolecule.nuclear_repulsion_energy print("Number of electrons: {}".format(n_el)) print("Number of molecular orbitals: {}".format(n_mo)) print("Number of spin-orbitals: {}".format(n_so)) print("Number of qubits: {}".format(n_q)) print("Nuclear repulsion energy: {}".format(e_nn)) # Generate the second-quantized operators from qiskit_nature.problems.second_quantization.electronic import ElectronicStructureProblem problem = ElectronicStructureProblem(driver) second_q_ops = problem.second_q_ops() main_op = second_q_ops[0] from qiskit_nature.mappers.second_quantization import ParityMapper, BravyiKitaevMapper, JordanWignerMapper from qiskit_nature.converters.second_quantization.qubit_converter import QubitConverter # Setup the qubit converter mapper_type = 'JordanWignerMapper' if mapper_type == 'ParityMapper': mapper = ParityMapper() elif mapper_type == 'JordanWignerMapper': mapper = JordanWignerMapper() elif mapper_type == 'BravyiKitaevMapper': mapper = BravyiKitaevMapper() converter = QubitConverter(mapper=mapper, two_qubit_reduction=False) # Exact solution from qiskit_nature.algorithms.ground_state_solvers.minimum_eigensolver_factories import NumPyMinimumEigensolverFactory from qiskit_nature.algorithms.ground_state_solvers import GroundStateEigensolver import numpy as np def exact_diagonalizer(problem, converter): solver = NumPyMinimumEigensolverFactory() calc = GroundStateEigensolver(converter, solver) result = calc.solve(problem) return result result_exact = exact_diagonalizer(problem, converter) exact_energy = np.real(result_exact.eigenenergies[0]) print("Exact electronic energy", exact_energy) print(result_exact) from qiskit_nature.problems.second_quantization.electronic import ElectronicStructureProblem from qiskit_nature.transformers import FreezeCoreTransformer freezeCoreTransformer = FreezeCoreTransformer(True) problem = ElectronicStructureProblem(driver, q_molecule_transformers=[freezeCoreTransformer]) # Generate the second-quantized operators second_q_ops = problem.second_q_ops() # Hamiltonian main_op = second_q_ops[0] from qiskit_nature.mappers.second_quantization import ParityMapper from qiskit_nature.converters.second_quantization.qubit_converter import QubitConverter # Setup the mapper and qubit converter mapper_type = 'ParityMapper' mapper = ParityMapper() converter = QubitConverter(mapper=mapper, two_qubit_reduction=True) # The fermionic operators are mapped to qubit operators num_particles = (problem.molecule_data_transformed.num_alpha, problem.molecule_data_transformed.num_beta) symmetries = True if symmetries: num_particles = (problem.molecule_data_transformed.num_alpha, problem.molecule_data_transformed.num_beta) converter = QubitConverter(mapper, two_qubit_reduction=True, z2symmetry_reduction="auto") qubit_op = converter.convert( main_op, num_particles, sector_locator=problem.symmetry_sector_locator, ) else: converter = QubitConverter(mapper=mapper, two_qubit_reduction=True) qubit_op = converter.convert(main_op, num_particles=num_particles) print("Number of qubits: ", qubit_op.num_qubits) result_exact = exact_diagonalizer(problem, converter) exact_energy = np.real(result_exact.eigenenergies[0]) print("Exact electronic energy", exact_energy) print(result_exact) from qiskit_nature.problems.second_quantization.electronic import ElectronicStructureProblem from qiskit_nature.transformers import FreezeCoreTransformer # Eliminate the MOs 3 and 4 that correspond to 2px and 2py in addition to freezen the core electrons freezeCoreTransformer = FreezeCoreTransformer(True,[3,4]) problem = ElectronicStructureProblem(driver, q_molecule_transformers=[freezeCoreTransformer]) # Generate the second-quantized operators second_q_ops = problem.second_q_ops() # Hamiltonian main_op = second_q_ops[0] from qiskit_nature.mappers.second_quantization import ParityMapper from qiskit_nature.converters.second_quantization.qubit_converter import QubitConverter # Setup the mapper and qubit converter mapper_type = 'ParityMapper' mapper = ParityMapper() converter = QubitConverter(mapper=mapper, two_qubit_reduction=True) # The fermionic operators are mapped to qubit operators num_particles = (problem.molecule_data_transformed.num_alpha, problem.molecule_data_transformed.num_beta) symmetries = False if symmetries: num_particles = (problem.molecule_data_transformed.num_alpha, problem.molecule_data_transformed.num_beta) converter = QubitConverter(mapper, two_qubit_reduction=True, z2symmetry_reduction="auto") qubit_op = converter.convert( main_op, num_particles, sector_locator=problem.symmetry_sector_locator, ) else: converter = QubitConverter(mapper=mapper, two_qubit_reduction=True) qubit_op = converter.convert(main_op, num_particles=num_particles) print("Number of qubits: ", qubit_op.num_qubits) result_exact = exact_diagonalizer(problem, converter) exact_energy = np.real(result_exact.eigenenergies[0]) print("Exact electronic energy", exact_energy) from qiskit_nature.circuit.library import HartreeFock num_particles = (problem.molecule_data_transformed.num_alpha, problem.molecule_data_transformed.num_beta) num_spin_orbitals = 2 * problem.molecule_data_transformed.num_molecular_orbitals init_state = HartreeFock(num_spin_orbitals, num_particles, converter) init_state.draw() # ansatz 1 num_qubits = qubit_op.num_qubits qc = QuantumCircuit(num_qubits) param_count = 1 for i in range(num_qubits): theta = Parameter(f"ry_angle{param_count}" ) qc.ry(theta, i) param_count += 1 qc.cx(0,1) qc.cx(1,2) qc.cx(2,3) for i in range(num_qubits): theta = Parameter(f"ry_angle{param_count}") qc.ry(theta, i) param_count += 1 ansatz = qc ansatz.compose(init_state, front=True, inplace=True) ansatz.draw() # ansatz 2 # num_qubits = qubit_op.num_qubits # qc = QuantumCircuit(num_qubits) # param_count = 1 # for i in range(num_qubits): # theta = Parameter(f"ry_angle{param_count}" ) # theta2 = Parameter(f"rz_angle{param_count}" ) # qc.ry(theta, i) # qc.rz(theta2, i) # param_count += 1 # qc.cx(2,3) # qc.cx(0,2) # qc.cx(1,3) # for i in range(num_qubits): # theta = Parameter(f"ry_angle{param_count}") # theta2 = Parameter(f"rz_angle{param_count}" ) # qc.ry(theta, i) # qc.rz(theta2, i) # param_count += 1 # ansatz = qc # ansatz.compose(init_state, front=True, inplace=True) # ansatz.draw() from qiskit import Aer backend = Aer.get_backend('statevector_simulator') from qiskit.algorithms.optimizers import SLSQP optimizer_type = 'SLSQP' optimizer = SLSQP(maxiter=1000) from qiskit.algorithms import VQE from IPython.display import display, clear_output # Print and save the data in lists def callback(eval_count, parameters, mean, std): # Overwrites the same line when printing display("Evaluation: {}, Energy: {}, Std: {}".format(eval_count, mean, std)) clear_output(wait=True) counts.append(eval_count) values.append(mean) params.append(parameters) deviation.append(std) counts = [] values = [] params = [] deviation = [] # Set initial parameters of the ansatz # We choose a fixed small displacement # So all participants start from similar starting point try: initial_point = [0.01] * len(ansatz.ordered_parameters) except: initial_point = [0.01] * ansatz.num_parameters algorithm = VQE(ansatz, optimizer=optimizer, quantum_instance=backend, callback=callback, initial_point=initial_point) result = algorithm.compute_minimum_eigenvalue(qubit_op) print(result) # Store results in a dictionary from qiskit.transpiler import PassManager from qiskit.transpiler.passes import Unroller # Unroller transpile your circuit into CNOTs and U gates pass_ = Unroller(['u', 'cx']) pm = PassManager(pass_) ansatz_tp = pm.run(ansatz) cnots = ansatz_tp.count_ops()['cx'] score = cnots accuracy_threshold = 4.0 # in mHa energy = result.optimal_value if ansatz_type == "TwoLocal": result_dict = { 'optimizer': optimizer.__class__.__name__, 'mapping': converter.mapper.__class__.__name__, 'ansatz': ansatz.__class__.__name__, 'rotation blocks': rotation_blocks, 'entanglement_blocks': entanglement_blocks, 'entanglement': entanglement, 'repetitions': repetitions, 'skip_final_rotation_layer': skip_final_rotation_layer, 'energy (Ha)': energy, 'error (mHa)': (energy-exact_energy)*1000, 'pass': (energy-exact_energy)*1000 <= accuracy_threshold, '# of parameters': len(result.optimal_point), 'final parameters': result.optimal_point, '# of evaluations': result.optimizer_evals, 'optimizer time': result.optimizer_time, '# of qubits': int(qubit_op.num_qubits), '# of CNOTs': cnots, 'score': score} else: result_dict = { 'optimizer': optimizer.__class__.__name__, 'mapping': converter.mapper.__class__.__name__, 'ansatz': ansatz.__class__.__name__, 'rotation blocks': None, 'entanglement_blocks': None, 'entanglement': None, 'repetitions': None, 'skip_final_rotation_layer': None, 'energy (Ha)': energy, 'error (mHa)': (energy-exact_energy)*1000, 'pass': (energy-exact_energy)*1000 <= accuracy_threshold, '# of parameters': len(result.optimal_point), 'final parameters': result.optimal_point, '# of evaluations': result.optimizer_evals, 'optimizer time': result.optimizer_time, '# of qubits': int(qubit_op.num_qubits), '# of CNOTs': cnots, 'score': score} # Plot the results import matplotlib.pyplot as plt fig, ax = plt.subplots(1, 1) ax.set_xlabel('Iterations') ax.set_ylabel('Energy') ax.grid() fig.text(0.7, 0.75, f'Energy: {result.optimal_value:.3f}\nScore: {score:.0f}') plt.title(f"{result_dict['optimizer']}-{result_dict['mapping']}\n{result_dict['ansatz']}") ax.plot(counts, values) ax.axhline(exact_energy, linestyle='--') fig_title = f"\ {result_dict['optimizer']}-\ {result_dict['mapping']}-\ {result_dict['ansatz']}-\ Energy({result_dict['energy (Ha)']:.3f})-\ Score({result_dict['score']:.0f})\ .png" fig.savefig(fig_title, dpi=300) # Display and save the data import pandas as pd import os.path filename = 'results_lih.csv' if os.path.isfile(filename): result_df = pd.read_csv(filename) result_df = result_df.append([result_dict]) else: result_df = pd.DataFrame.from_dict([result_dict]) result_df.to_csv(filename) result_df[['optimizer','ansatz', '# of qubits', 'error (mHa)', 'pass', 'score']]
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import numpy as np import pandas as pd import itertools import cma import os import sys import argparse import pickle import random import re from pprint import pprint import qiskit from qiskit import * from qiskit import Aer from qiskit import IBMQ from qiskit.providers.aer.noise.noise_model import NoiseModel from qiskit.test.mock import * from qiskit.providers.aer import AerSimulator, QasmSimulator from qiskit.ignis.mitigation.measurement import complete_meas_cal, CompleteMeasFitter import mitiq IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q-utokyo', group='internal', project='hirashi-jst') provider = IBMQ.get_provider(hub='', group='internal', project='hirashi-jst') print("provider:", provider) L = 3 p = 2 dt = 1.0 tf = 20 shots = 8192 def TwirlCircuit(circ: str) -> QuantumCircuit: """ そのまま使う: 修正は後回し """ #! qasm ベタ書き def apply_pauli(num: int, qb: int) -> str: if (num == 0): return f'id q[{qb}];\n' elif (num == 1): return f'x q[{qb}];\n' elif (num == 2): return f'y q[{qb}];\n' else: return f'z q[{qb}];\n' paulis = [(i,j) for i in range(0,4) for j in range(0,4)] paulis.remove((0,0)) paulis_map = [(0, 1), (3, 2), (3, 3), (1, 1), (1, 0), (2, 3), (2, 2), (2, 1), (2, 0), (1, 3), (1, 2), (3, 0), (3, 1), (0, 2), (0, 3)] new_circ = '' ops = circ.qasm().splitlines(True) #! 生のqasmコードを持ってきてる: オペレータに分解 for op in ops: if (op[:2] == 'cx'): # can add for cz, etc. num = random.randrange(len(paulis)) #! permute paulis qbs = re.findall('q\[(.)\]', op) new_circ += apply_pauli(paulis[num][0], qbs[0]) new_circ += apply_pauli(paulis[num][1], qbs[1]) new_circ += op new_circ += apply_pauli(paulis_map[num][0], qbs[0]) new_circ += apply_pauli(paulis_map[num][1], qbs[1]) else: new_circ += op return qiskit.circuit.QuantumCircuit.from_qasm_str(new_circ) # とりあえずOK def evolve(alpha: float, q0: Union[int, QuantumRegister], q1: Union[int, QuantumRegister]) -> QuantumCircuit: """ The implementation of Fig. 4 in https://arxiv.org/abs/2112.12654 """ qc = QuantumCircuit(2) qc.rz(-np.pi / 2, q1) qc.cnot(q1, q0) qc.rz(alpha - np.pi / 2, q0) qc.ry(np.pi / 2 - alpha, q1) qc.cnot(q0, q1) qc.ry(alpha - np.pi / 2, q1) qc.cnot(q1, q0) qc.rz(np.pi / 2, q0) return qc # とりあえずOK def make_ansatz_circuit(num_qubits: int, ansatz_depth: int, parameters: np.array) -> QuantumCircuit: """ Prepare ansatz circuit code reference: https://gitlab.com/QANED/heis_dynamics method reference: https://arxiv.org/abs/1906.06343 == AnsatzCircuit(param, p) -> QuantumCircuit Args: parameters: 1d array (for 2d parameters on circuit) """ qc = QuantumCircuit(num_qubits) for l in range(ansatz_depth): if num_qubits & 1: for i in range(0, num_qubits, 2): # linear condition qc.compose(evolve(parameters[l * ansatz_depth + i] / 4), [i, i + 1], inplace = True) #! we do not have to divide the angle by 4 for i in range(1, num_qubits - 1, 2): # linear condition # ! we do not have to divide the angle by 4 qc.compose(evolve(parameters[l * ansatz_depth + i] / 4), [i, i + 1], inplace=True) else: for i in range(0, num_qubits - 1, 2): # linear condition # ! we do not have to divide the angle by 4 qc.compose(evolve(parameters[l * ansatz_depth + i]), [i, i + 1], inplace=True) for i in range(1, num_qubits - 1, 2): # linear condition # ! we do not have to divide the angle by 4 qc.compose(evolve(parameters[l * ansatz_depth + i]), [i, i + 1], inplace=True) return qc # とりあえずOK def make_trotter_circuit(num_qubits: int, time_interval: float) -> QuantumCircuit: """ Prepare Trotter circuit code reference: https://gitlab.com/QANED/heis_dynamics method reference: https://arxiv.org/abs/1906.06343 == TrotterEvolveCircuit(dt, nt, init) -> QuantumCircuit """ qc = QuantumCircuit(num_qubits) for n in range(trotter_steps): #! time_interval の符号に注意 if num_qubits & 1: for i in range(0, num_qubits, 2): # linear condition qc.compose(evolve(time_interval / 4), [i, i + 1], inplace = True) #! we do not have to divide the angle by 4 for i in range(1, num_qubits - 1, 2): # linear condition qc.compose(evolve(time_interval / 4), [i, i + 1], inplace = True) # ! we do not have to divide the angle by 4 else: for i in range(0, num_qubits - 1, 2): # linear condition qc.compose(evolve(time_interval / 4), [i, i + 1], inplace = True) #! we do not have to divide the angle by 4 for i in range(1, num_qubits - 1, 2): # linear condition qc.compose(evolve(time_interval / 4), [i, i + 1], inplace = True) # ! we do not have to divide the angle by 4 return qc #TODO VTCとは別実装?→ no, 同じ実装に。 def SimulateAndReorder(circ): """ #! execution wrapper Executes a circuit using the statevector simulator and reorders basis to match with standard """ backend = Aer.get_backend('statevector_simulator') return execute(circ.reverse_bits(), backend).result().get_statevector() def Simulate(circ): """ #! execution wrapper Executes a circuit using the statevector simulator. Doesn't reorder -- which is needed for intermediate steps in the VTC """ backend = Aer.get_backend('statevector_simulator') return execute(circ, backend).result().get_statevector() #TODO def LoschmidtEchoExecutor(circuits, backend, shots, filter): """ #! 回路を実行 Returns the expectation value to be mitigated. :param circuit: Circuit to run. #! ここでのcircuitsは :param backend: backend to run the circuit on :param shots: Number of times to execute the circuit to compute the expectation value. :param fitter: measurement error mitigator """ # circuits = [TwirlCircuit(circ) for circ in circuits] scale_factors = [1.0, 2.0, 3.0] #! ZNEのノイズスケーリングパラメタ folded_circuits = [] #! ZNE用の回路 for circuit in circuits: folded_circuits.append([mitiq.zne.scaling.fold_gates_at_random(circuit, scale) for scale in scale_factors]) #! ここでmitiqを使用 folded_circuits = list(itertools.chain(*folded_circuits)) #! folded_circuitsを平坦化 folded_circuits = [TwirlCircuit(circ) for circ in folded_circuits] #! 後からPauli Twirlingを施す! print("length of circuit in job", len(folded_circuits)) #! jobを投げる job = qiskit.execute( experiments=folded_circuits, backend=backend, optimization_level=0, shots=shots ) print("casted job") #! fidelity測定用(VTCをしないなら、ここはtomographyで良い) c = ['1','1','0'] #! これをpermutationする # c = [str((1 + (-1)**(i+1)) // 2) for i in range(L)] c = ''.join(c)[::-1] #! endianを反転 (big endianへ) res = job.result() if (filter is not None): #! QREM res = filter.apply(res) print("retrieved job") all_counts = [job.result().get_counts(i) for i in range(len(folded_circuits))] expectation_values = [] for counts in all_counts: total_allowed_shots = [counts.get(''.join(p)) for p in set(itertools.permutations(c))] #! ここでcをpermutationしている total_allowed_shots = sum([0 if x is None else x for x in total_allowed_shots]) if counts.get(c) is None: expectation_values.append(0) else: expectation_values.append(counts.get(c)/total_allowed_shots) # expectation_values = [counts.get(c) / shots for counts in all_counts] zero_noise_values = [] if isinstance(backend, qiskit.providers.aer.backends.qasm_simulator.QasmSimulator): # exact_sim for i in range(len(circuits)): zero_noise_values.append(np.mean(expectation_values[i*len(scale_factors):(i+1)*len(scale_factors)])) else: #device_sim, real_device fac = mitiq.zne.inference.LinearFactory(scale_factors) for i in range(len(circuits)): zero_noise_values.append(fac.extrapolate(scale_factors, expectation_values[i*len(scale_factors):(i+1)*len(scale_factors)])) print("zero_noise_values") pprint(zero_noise_values) print() return zero_noise_values #TODO def LoschmidtEchoCircuit(params, U_v, U_trot, init, p): """ #! 回路を作成 Cost function using the Loschmidt Echo. Just using statevectors currently -- can rewrite using shots :param params: parameters new variational circuit that represents U_trot U_v | init >. Need dagger for cost function :param U_v: variational circuit that stores the state before the trotter step :param U_trot: trotter step :param init: initial state :param p: number of ansatz steps """ U_v_prime = AnsatzCircuit(params, p) circ = init + U_v + U_trot + U_v_prime.inverse() circ.measure_all() return circ def LoschmidtEcho(params, U_v, U_trot, init, p, backend, shots, filter): """ #! 実行パート """ circs = [] for param in params: circs.append(LoschmidtEchoCircuit(param, U_v, U_trot, init, p)) #! 回路を作成 print("length of circuits without zne:", len(circs)) res = LoschmidtEchoExecutor(circs, backend, shots, filter) #! 回路を実行 return abs(1 - np.array(res)) def LoschmidtEchoExact(params, U_v, U_trot, init, p): """ #! unused function """ U_v_prime = AnsatzCircuit(params, p) circ = init + U_v + U_trot + U_v_prime.inverse() circ_vec = Simulate(circ) init_vec = Simulate(init) return 1 - abs(np.conj(circ_vec) @ init_vec)**2 def CMAES(U_v, U_trot, init, p, backend, shots, filter): """ #! 実行 + 最適化パート """ init_params = np.random.uniform(0, 2*np.pi, (L-1)*p) es = cma.CMAEvolutionStrategy(init_params, np.pi/2) es.opts.set({'ftarget':5e-3, 'maxiter':1000}) # es = pickle.load(open(f'./results_{L}/optimizer_dump', 'rb')) while not es.stop(): #! 最適化パート # solutions = es.ask(25) # ! 25 = number of returned solutions solutions = es.ask(10) print("solutions") pprint(solutions) es.tell(solutions, LoschmidtEcho(solutions, U_v, U_trot, init, p, backend, shots, filter)) #! 実行パート # es.tell(solutions, LoschmidtEchoExact(solutions, U_v, U_trot, init, p)) #! 実行パート es.disp() open(f'./results_{L}/optimizer_dump', 'wb').write(es.pickle_dumps()) return es.result_pretty() def VTC(tf, dt, p, init, backend, shots, filter): """ #! tf: 総経過時間 #! dt: trotter step size: 時間間隔 #! p: ansatzのステップ数 """ VTCParamList = [np.zeros((L-1)*p)] #! デフォルトのパラメタ(初期値) VTCStepList = [SimulateAndReorder(init.copy())] #! type: List[Statevector] # TrotterFixStepList = [init] TimeStep = [0] if (os.path.exists(f'./results_{L}/VTD_params_{tf}_{L}_{p}_{dt}_{shots}.csv')): #! 2巡目からこっち VTCParamList = pd.read_csv(f'./results_{L}/VTD_params_{tf}_{L}_{p}_{dt}_{shots}.csv', index_col=0) VTCStepList = pd.read_csv(f'./results_{L}/VTD_results_{tf}_{L}_{p}_{dt}_{shots}.csv', index_col=0) temp = VTCParamList.iloc[-1] print(temp, "th time interval") U_v = AnsatzCircuit(temp, p) else: #! 最初はこっちに入る VTCParamList = pd.DataFrame(np.array(VTCParamList), index=np.array(TimeStep)) VTCStepList = pd.DataFrame(np.array(VTCStepList), index=np.array(TimeStep)) print("0 th time interval") print() U_v = QuantumCircuit(L) ts = VTCParamList.index #! 時間間隔 U_trot = TrotterEvolveCircuit(dt, p, QuantumCircuit(L)) #! Trotter分解のunitaryを作る print() print("start CMAES") print() res = CMAES(U_v, U_trot, init, p, backend, shots, filter) #! ここでプロセスを実行!!!! print() print("res") pprint(res) #! 新しいループ結果を追加し、tsを更新 res = res.xbest # ! best solution evaluated print("res.xbest") pprint(res) VTCParamList.loc[ts[-1]+(dt*p)] = np.array(res) VTCStepList.loc[ts[-1]+(dt*p)] = np.array(SimulateAndReorder(init + AnsatzCircuit(res, p))) ts = VTCParamList.index # VTCParamList = pd.DataFrame(np.array(VTCParamList), index=np.array(TimeStep)) # VTCStepList = pd.DataFrame(np.array(VTCStepList), index=np.array(TimeStep)) #! csvファイルを更新 VTCParamList.to_csv(f'./results_{L}/VTD_params_{tf}_{L}_{p}_{dt}_{shots}.csv') VTCStepList.to_csv(f'./results_{L}/VTD_results_{tf}_{L}_{p}_{dt}_{shots}.csv') if (ts[-1] >= tf): return else: print("next step") VTC(tf, dt, p, init, backend, shots, filter) #! ここからQREM回路 qr = QuantumRegister(L) meas_calibs, state_labels = complete_meas_cal(qr=qr, circlabel='mcal') # device_backend = FakeJakarta() # device_sim = AerSimulator.from_backend(device_backend) real_device = provider.get_backend('ibmq_jakarta') noise_model = NoiseModel.from_backend(real_device) device_sim = QasmSimulator(method='statevector', noise_model=noise_model) exact_sim = Aer.get_backend('qasm_simulator') # QasmSimulator(method='statevector') t_qc = transpile(meas_calibs) qobj = assemble(t_qc, shots=8192) # cal_results = real_device.run(qobj, shots=8192).result() cal_results = device_sim.run(qobj, shots=8192).result() meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') print("qrem done") # np.around(meas_fitter.cal_matrix, decimals=2) init = QuantumCircuit(L) # c = [str((1 + (-1)**(i+1)) // 2) for i in range(L)] c = ['1','1','0'] #! なぜinitial stateが110なの??????? もしかしてopen science prizeを意識??? #! けどループでこのプログラムが実行されるたびにここが|110>だとおかしくないか? for q in range(len(c)): if (c[q] == '1'): init.x(q) #! ここまでQREM回路 nt = int(np.ceil(tf / (dt * p))) # f = open(f'./results_{L}/logging.txt', 'a') # sys.stdout = f #! tf: シミュレーションの(経過)時間 #! dt: trotter分解のステップ数 #! p: ansatzのステップ数 (論文中のL) # VTC(tf, dt, p, init, real_device, shots, meas_fitter.filter) #! mainの処理 print("vtc start!!!! \n\n\n") VTC(tf, dt, p, init, device_sim, shots, meas_fitter.filter) #! mainの処理 # f.close()
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import numpy as np import matplotlib.pyplot as plt from copy import deepcopy # Importing standard Qiskit libraries from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister, transpile, Aer, IBMQ, execute from qiskit.tools.jupyter import * from qiskit.visualization import * from qiskit.providers.aer import QasmSimulator from tqdm.notebook import tqdm from qiskit.providers.aer import QasmSimulator from qiskit.tools.monitor import job_monitor from qiskit.circuit import Parameter import qiskit.quantum_info as qi from qc_grader.challenges.spring_2022.helpers import generate_XX, generate_YY, generate_disordered_tb_instruction # Suppress warnings import warnings warnings.filterwarnings('ignore') import pylatexenc import IPython t = Parameter('t') XX = generate_XX(t) YY = generate_YY(t) from scipy.special import jv t_test = 20 r = np.linspace(-50,50,101) gaussian = np.exp(-r**2/t_test) / np.sum(np.exp(-r**2/t_test)) bessel = np.abs(jv(r,2*t_test))**2 / np.sum(np.abs(jv(r,2*t_test))**2) plt.figure(facecolor='white') plt.plot(r, gaussian, label=r'Gaussian function') plt.plot(r, bessel, label=r'Bessel function') plt.xlabel('Position') plt.ylabel('Probability density') plt.legend() plt.show() num_qubits = 5 ## DO NOT EDIT Trot_tb_qr = QuantumRegister(num_qubits) Trot_tb_qc = QuantumCircuit(Trot_tb_qr, name='Trot') ###EDIT CODE BELOW for j in [0,2]: Trot_tb_qc.append(YY, [Trot_tb_qr[j], Trot_tb_qr[j+1]]) Trot_tb_qc.append(XX, [Trot_tb_qr[j], Trot_tb_qr[j+1]]) for i in [1,3]: Trot_tb_qc.append(YY, [Trot_tb_qr[i], Trot_tb_qr[i+1]]) Trot_tb_qc.append(XX, [Trot_tb_qr[i], Trot_tb_qr[i+1]]) ###DO NOT EDIT BELOW Trot_tb_gate = Trot_tb_qc.to_instruction() Trot_tb_qc.draw(output='mpl') ## Grade and submit your solution from qc_grader.challenges.spring_2022 import grade_ex2a grade_ex2a(Trot_tb_qc) delta_t=0.15 # DO NOT EDIT time_steps=np.arange(1,20,1) # DO NOT EDIT circuits=[] for n_steps in time_steps: qr = QuantumRegister(num_qubits) cr = ClassicalRegister(num_qubits) qc = QuantumCircuit(qr,cr) ###EDIT CODE BELOW qc.x([0]) ###DO NOT EDIT BELOW for _ in range(n_steps): qc.append(Trot_tb_gate, [i for i in range(num_qubits)]) qc = qc.bind_parameters({t: delta_t}) circuits.append(qc) from qiskit import transpile # Use Aer's statevector simulator from qiskit import Aer # Run the quantum circuit on a statevector simulator backend backend_sim = Aer.get_backend('statevector_simulator') probability_density=[] for circ in tqdm(circuits): transpiled_circ=transpile(circ, backend_sim, optimization_level=3) job_sim = backend_sim.run(transpiled_circ) # Grab the results from the job. result_sim = job_sim.result() outputstate = result_sim.get_statevector(transpiled_circ, decimals=5) ps=[] ###EDIT CODE BELOW (Extract the probability of finding the excitation on each qubit) probs=[] for i in range(num_qubits): prob=outputstate.probabilities([i]) # type(..) >> list probs.append(prob) for elem in probs: excited=elem[1] ps.append(excited) ###DO NOT EDIT BELOW probability_density.append(ps) probability_density=np.array(probability_density) plt.figure(figsize=(3,5), facecolor='white') plt.pcolormesh(np.arange(0,num_qubits,1), time_steps*delta_t, probability_density) plt.xlabel('Qubit index') plt.ylabel('Time (1/J)') ## Grade and submit your solution from qc_grader.challenges.spring_2022 import grade_ex2b grade_ex2b(probability_density) from qiskit.tools.monitor import job_monitor from qiskit import IBMQ # Loading your IBM Quantum account IBMQ.load_account() IBMQ.providers() # see a list of providers you have access to # Get the special provider assigned to you using information from the output above hub_name = 'qc-spring-22-4' # e.g. 'qc-spring-22-1' group_name = 'group-2' # e.g. 'group-2' project_name = 'recrrGhzxg3VULGQS' # e.g. 'recPdHH04wfWiNHjG' provider = IBMQ.get_provider(hub=hub_name, group=group_name, project=project_name) # Get `ibm_nairobi` backend from the provider backend_name = 'ibm_nairobi' backend = provider.get_backend(backend_name) backend # See details of the `ibm_nairobi` quantum system initial_layout=[0 , 1 , 3 , 5 , 4] hardware_transpiled_circuits=[] for circ in circuits: hardware_circ=deepcopy(circ) hardware_circ.barrier() hardware_circ.measure(range(num_qubits), range(num_qubits)) hardware_transpiled_circuits.append(transpile(hardware_circ, backend, initial_layout=initial_layout, optimization_level=3)) shots=1024 job = execute(hardware_transpiled_circuits, backend=backend, shots=shots) job_monitor(job) print('Job ID', job.job_id()) qc = QuantumCircuit(5,1) qc.x([0]) qc.measure(0,0) # Measuring only qubit 0 (q_0) and storing the measurement result in classical bit (a.k.a register) 0. jobs = execute(qc,backend,shots=1024) # Sending job to ibm_nairobi. counts = jobs.result().get_counts(qc) probs = {key:value/shots for key, value in counts.items()} print(qc) print(counts) print(probs) experiment_results=backend.retrieve_job('629c26b701885c41f6f358c2').result() i=0 for output in experiment_results.get_counts(): # Doing a for through each measurement (each new experiment). print(f'output: {type(output)}\n') print(output, '\n') #print(output.keys()) # Type >> <class 'dict_keys'> print(f"Number of Basis states/prob. amp.: {len(output)}.\n") i+=1 if i == 2: break type(experiment_results.get_counts()), len(experiment_results.get_counts()) # There are 19 dictionaries. Each dict. corresponds to an average measurement trial. for output in experiment_results.get_counts(): for key, value in output.items(): print(key, value) print('') print(output.keys()) break Z = np.random.rand(2, 2) Z Z.shape, len(Z) plt.pcolormesh(Z) Z.tolist() plt.pcolormesh(Z.tolist()) experiment_results=job.result() #experiment_results=backend.retrieve_job('629c26b701885c41f6f358c2').result() probability_density_exp=[] for output in experiment_results.get_counts(): ps=[] ###EDIT CODE BELOW (Extract the probability of finding the excitation on each qubit) for key in ['00001', '00010', '00100', '01000', '10000']: try: count=float(output.get(key)) prob=(count/shots) except: prob=0 ps.append(prob) ###DO NOT EDIT BELOW probability_density_exp.append(ps) plt.figure(figsize=(3,5), facecolor='white') plt.pcolormesh(np.arange(0,num_qubits,1), time_steps*delta_t, probability_density_exp) plt.xlabel('Qubit index') plt.ylabel('Time (1/J)') beta=(np.sqrt(5)-1)/2 # DO NOT EDIT AA_patern=np.cos(2*np.pi*beta*np.arange(num_qubits)) # DO NOT EDIT plt.plot(np.linspace(-0.5,4.5,101), np.cos(2*np.pi*beta*np.linspace(-0.5,4.5,101)), '--') plt.plot(np.arange(num_qubits), AA_patern, 'o', label=r'$\epsilon_i$') plt.xlabel('Position') plt.ylabel('Energy') plt.legend() plt.title('Aubry-Andre potential') plt.show() Trot_qr_disorder = QuantumRegister(num_qubits) Trot_qc_disorder = QuantumCircuit(Trot_qr_disorder, name='Trot disorder') Trot_qc_disorder.append(Trot_tb_gate,[0,1,2,3,4]) deltas=[Parameter('delta_{:d}'.format(idx)) for idx in range(num_qubits)] ###EDIT CODE BELOW (add a parametric disorder to each qubit) for i in range(0, num_qubits): Trot_qc_disorder.rz(2*deltas[i]*t,i) # (angles, qubits). ###DO NOT EDIT BELOW # Convert custom quantum circuit into a gate Trot_disorder_gate = Trot_qc_disorder.to_instruction() Trot_qc_disorder.draw(output='mpl') delta_t=0.15 time_steps=np.arange(1,20,1) W=2 # DO NOT EDIT disorders=W*AA_patern # DO NOT EDIT disorder_circuits=[] for n_steps in time_steps: qr = QuantumRegister(num_qubits) cr = ClassicalRegister(num_qubits) qc = QuantumCircuit(qr, cr) qc.x(0) for _ in range(n_steps): qc.append(Trot_disorder_gate, [i for i in range(num_qubits)]) qc = qc.bind_parameters({t: delta_t}) qc = qc.bind_parameters({deltas[idx]: disorders[idx] for idx in range(num_qubits)}) disorder_circuits.append(qc) from qiskit import transpile # Use Aer's statevector simulator from qiskit import Aer # Run the quantum circuit on a statevector simulator backend backend_sim = Aer.get_backend('statevector_simulator') probability_density_localization=[] for circ in tqdm(disorder_circuits): transpiled_circ=transpile(circ, backend_sim, optimization_level=3) job_sim = backend_sim.run(transpiled_circ) # Grab the results from the job. result_sim = job_sim.result() outputstate = result_sim.get_statevector(transpiled_circ, decimals=5) ps=[] ###EDIT CODE BELOW (Extract the probability of finding the excitation on each qubit) probs=[] for i in range(num_qubits): prob=outputstate.probabilities([i]) # type(..) >> list probs.append(prob) for elem in probs: excited=elem[1] ps.append(excited) ###DO NOT EDIT BELOW probability_density_localization.append(ps) probability_density_localization=np.array(probability_density_localization) plt.figure(figsize=(3,5), facecolor='white') plt.pcolormesh(np.arange(0,num_qubits,1), time_steps*delta_t ,probability_density_localization) plt.xlabel('Qubit index') plt.ylabel('Time (1/J)') ## Grade and submit your solution from qc_grader.challenges.spring_2022 import grade_ex2c grade_ex2c(probability_density_localization) from qiskit.tools.monitor import job_monitor provider = IBMQ.load_account() provider = IBMQ.get_provider(hub='qc-spring-22-4', group='group-2', project='recrrGhzxg3VULGQS') backend = provider.get_backend('ibm_nairobi') initial_layout=[0 , 1 , 3 , 5 , 4] hardware_transpiled_circuits_disordered=[] for circ in disorder_circuits: hardware_circ=deepcopy(circ) hardware_circ.barrier() hardware_circ.measure(range(num_qubits), range(num_qubits)) hardware_transpiled_circuits_disordered.append(transpile(hardware_circ, backend, initial_layout=initial_layout, optimization_level=3)) shots=1024 job_disorder = execute(hardware_transpiled_circuits_disordered, backend=backend, shots=shots) job_monitor(job_disorder) print('Job ID', job_disorder.job_id()) disorder_experiment_results=job_disorder.result() #disorder_experiment_results=backend.retrieve_job('6290b7ce4bb9753402efaa20').result() disorder_probability_density_exp=[] for output in disorder_experiment_results.get_counts(): ps=[] ###EDIT CODE BELOW (Extract the probability of finding the excitation on each qubit) for key in ['00001', '00010', '00100', '01000', '10000']: try: count=float(output.get(key)) prob=(count/shots) except: prob=0 ps.append(prob) ###DO NOT EDIT BELOW disorder_probability_density_exp.append(ps) plt.figure(figsize=(3,5), facecolor='white') plt.pcolormesh(np.arange(0,num_qubits,1), time_steps*delta_t, disorder_probability_density_exp) plt.xlabel('Qubit index') plt.ylabel('Time (1/J)')
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import numpy as np import matplotlib.pyplot as plt # Importing standard Qiskit libraries from qiskit import QuantumCircuit, QuantumRegister, transpile, Aer, IBMQ, execute from qiskit.tools.jupyter import * from qiskit.visualization import * from qiskit.providers.aer import QasmSimulator from tqdm.notebook import tqdm from qiskit.providers.aer import QasmSimulator from qiskit.tools.monitor import job_monitor from qiskit.circuit import Parameter import qiskit.quantum_info as qi from qc_grader.challenges.spring_2022.helpers import generate_disordered_tb_instruction # Suppress warnings import warnings warnings.filterwarnings('ignore') import pylatexenc import IPython pop = [1,0] Ne=0 # Sum of even populations. No=0 # Sum of odd populations. for j in range(0, len(pop), 2): Ne += pop[j] for j in range(1, len(pop), 2): No += pop[j] I = (Ne-No)/(Ne+No) print(f"Ne={Ne}, No={No}, I={I}") def get_imbalance(state): ###EDIT CODE BELOW ### HINT: MAKE SURE TO SKIP CALCULATING IMBALANCE OF THE |00...0> STATE imbalance_val=0 def get_basis(i): num_qubits = int(np.log2(len(state.probabilities()))) basis = [] for i in list(f'{i:0{num_qubits}b}'): basis.append(int(i)) return basis # A list such as [1,0,0,0] def imbalance(basis): Ne=0 # Sum of even populations. No=0 # Sum of odd populations. for j in range(0, len(basis), 2): Ne += basis[j] for j in range(1, len(basis), 2): No += basis[j] return (Ne-No)/(Ne+No) pop = state.probabilities() # List of probabilities of the state |\psi> for measuring all qubits. for i in range(1, len(pop)): # Skipping i=0 corresponding to the |00...0> basis. basis = get_basis(i) prob_amp = pop[i] # float imbalance_val += imbalance(basis)*prob_amp ###DO NOT EDIT BELOW return imbalance_val st1 = qi.Statevector.from_label('0111') # -1/3 st2 = np.sqrt(2/3)*qi.Statevector.from_label('0111') + np.sqrt(1/3)*qi.Statevector.from_label('1011') # -1/9 st3 = (qi.Statevector.from_label('1000')+qi.Statevector.from_label('1001'))*(1/np.sqrt(2)) # 0.5 for i in [st1, st2, st3]: print(get_imbalance(i)) ## Grade and submit your solution from qc_grader.challenges.spring_2022 import grade_ex3a grade_ex3a(get_imbalance) bell_state = qi.Statevector(np.array([0,1,1,0])/np.sqrt(2)) rho_0 = qi.partial_trace(bell_state,[1]) # We trace out qubit 1 rho_1 = qi.partial_trace(bell_state,[0]) # We trace out qubit 0 print('QB0 vn entropy: ', qi.entropy(rho_0, base=np.exp(1))) print('QB1 vn entropy: ', qi.entropy(rho_1, base=np.exp(1))) t = Parameter('t') num_qubits=12 deltas=[Parameter('delta_{:d}'.format(idx)) for idx in range(num_qubits)] disorder_trot_step=generate_disordered_tb_instruction(t, deltas, num_qubits) # Here we define the disorder pattern beta=(np.sqrt(5)-1)/2 # DO NOT EDIT AA_pattern=np.cos(2*np.pi*beta*np.arange(num_qubits)) # DO NOT EDIT delta_t=0.1 time_steps=np.arange(0,21,2) circuits={} Ws=[1,4,10] for W in Ws: disorders=W*AA_pattern circuits[W]=[] for n_steps in time_steps: qr = QuantumRegister(num_qubits) qc = QuantumCircuit(qr) ###EDIT CODE BELOW qc.x([0,4,8]) ###DO NOT EDIT BELOW for _ in range(n_steps): qc.append(disorder_trot_step, [i for i in range(num_qubits)]) if n_steps!=0: qc = qc.bind_parameters({t: delta_t}) qc = qc.bind_parameters({deltas[idx]: disorders[idx] for idx in range(num_qubits)}) circuits[W].append(qc) from qiskit import transpile # Use Aer's statevector simulator from qiskit import Aer # Run the quantum circuit on a statevector simulator backend backend_sim = Aer.get_backend('statevector_simulator') probability_densities={} state_vector_imbalances={} vn_entropies={} for W in tqdm(Ws): probability_densities[W]=[] state_vector_imbalances[W]=[] vn_entropies[W]=[] for circ in circuits[W]: transpiled_circ=transpile(circ, backend_sim, optimization_level=3) job_sim = backend_sim.run(transpiled_circ) # Grab the results from the job. result_sim = job_sim.result() outputstate = result_sim.get_statevector(transpiled_circ, decimals=6) ps=[] for idx in range(num_qubits): ps.append(np.abs(qi.partial_trace(outputstate,[i for i in range(num_qubits) if i!=idx]))[1,1]**2) entropy=0 ### EDIT CODE BELOW (extract the density matrix of qubit 0 by tracing out all other qubits) rho0=qi.partial_trace(outputstate, [i for i in range(num_qubits) if i!=0]) # trace out qubit 0. entropy=qi.entropy(rho0, base=np.exp(1)) ###DO NOT EDIT BELOW imbalance=get_imbalance(outputstate) ### EDIT CODE BELOW ###DO NOT EDIT BELOW vn_entropies[W].append(entropy) probability_densities[W].append(ps) state_vector_imbalances[W].append(imbalance) fig, axs = plt.subplots(1,3,figsize=(15,5), facecolor='white', sharey=True) for i,W in enumerate(Ws): ax=axs[i] ax.pcolormesh(np.arange(0,num_qubits,1), time_steps*delta_t ,probability_densities[W]) ax.set_xlabel('Qubit index') ax.set_xticks(np.arange(1,num_qubits+1,1)) axs[0].set_ylabel('Time (1/J)') plt.show() for W in Ws: plt.plot(time_steps*delta_t,vn_entropies[W], '--o', label='W={:d}'.format(W)) plt.xlabel(r'Time (1/J)') plt.ylabel(r'$\mathcal{S}_{\rm vn}(\rho_0)$') plt.legend() plt.show() ## Grade and submit your solution from qc_grader.challenges.spring_2022 import grade_ex3b grade_ex3b(vn_entropies) for W in Ws: plt.plot(time_steps*delta_t,state_vector_imbalances[W], '--o', label='W={:d}'.format(W)) plt.xlabel(r'Time (1/J)') plt.ylabel(r'$\mathcal{I}$') plt.legend() plt.show() ## Grade and submit your solution from qc_grader.challenges.spring_2022 import grade_ex3c grade_ex3c(state_vector_imbalances)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit_nature.drivers import Molecule from qiskit_nature.drivers.second_quantization import ElectronicStructureMoleculeDriver, ElectronicStructureDriverType molecule = Molecule( # coordinates are given in Angstrom geometry=[ ["O", [0.0, 0.0, 0.0]], ["H", [0.758602, 0.0, 0.504284]], ["H", [0.758602, 0.0, -0.504284]] ], multiplicity=1, # = 2*spin + 1 charge=0, ) driver = ElectronicStructureMoleculeDriver( molecule=molecule, basis="sto3g", driver_type=ElectronicStructureDriverType.PYSCF, ) properties = driver.run() print(properties) print(properties.get_property("ParticleNumber")) #print(properties.get_property("ElectronicEnergy")) properties.get_property("ElectronicEnergy").nuclear_repulsion_energy # WRITE YOUR CODE BETWEEN THESE LINES - START num_alpha_electrons = 5 num_beta_electrons = 5 num_spin_orbitals = 14 nuclear_rep_energy = properties.get_property("ElectronicEnergy").nuclear_repulsion_energy # WRITE YOUR CODE BETWEEN THESE LINES - END from qc_grader.challenges.spring_2022 import grade_ex4a grade_ex4a( num_alpha_electrons=num_alpha_electrons, num_beta_electrons=num_beta_electrons, num_spin_orbitals=num_spin_orbitals, nuclear_rep_energy=nuclear_rep_energy ) from qiskit_nature.transformers.second_quantization.electronic import ActiveSpaceTransformer # Check the occupation of the spin orbitals PN_property = properties.get_property("ParticleNumber") print(PN_property) # Define the active space around the Fermi level # (selected automatically around the HOMO and LUMO, ordered by energy) transformer = ActiveSpaceTransformer( num_electrons=2, #how many electrons we have in our active space num_molecular_orbitals=2, #how many orbitals we have in our active space ) # We can hand-pick the MOs to be included in the AS # (in case they are not exactly around the Fermi level) # transformer = ActiveSpaceTransformer( # num_electrons=2, #how many electrons we have in our active space # num_molecular_orbitals=2, #how many orbitals we have in our active space # active_orbitals=[4,7], #We are specifically choosing MO number 4 (occupied with two electrons) and 7 (empty) # ) from qiskit_nature.problems.second_quantization.electronic import ElectronicStructureProblem problem = ElectronicStructureProblem(driver, [transformer]) second_q_ops = problem.second_q_ops() # this calls driver.run() internally hamiltonian = second_q_ops[0] print(hamiltonian) from qiskit_nature.operators.second_quantization import FermionicOp # WRITE YOUR CODE BETWEEN THESE LINES - START op = (0.5j* FermionicOp('-_0 +_1')) + (2.0* FermionicOp('-_0 +_2')) # list of valid tuples to initialize the FermionicOp list_operator = op.to_list('sparse') # positive integer that represents the length of registers num_register_length = 3 list_operator # WRITE YOUR CODE BETWEEN THESE LINES - END (FermionicOp('+_1 -_0')).to_list() == (FermionicOp('+_1')@FermionicOp('-_0')).to_list() (0.5j* FermionicOp("+_1 -_0", 4, "dense")).to_list() == (0.5j* FermionicOp("+_1", 4, "dense")@FermionicOp("-_0", 4, "dense")).to_list() from qc_grader.challenges.spring_2022 import grade_ex4b grade_ex4b(list_operator, num_register_length) from qiskit_nature.mappers.second_quantization import ParityMapper, BravyiKitaevMapper, JordanWignerMapper from qiskit_nature.converters.second_quantization import QubitConverter # Setup the mapper and qubit converter mapper_type = 'JordanWignerMapper' if mapper_type == 'ParityMapper': mapper = ParityMapper() elif mapper_type == 'JordanWignerMapper': mapper = JordanWignerMapper() elif mapper_type == 'BravyiKitaevMapper': mapper = BravyiKitaevMapper() converter = QubitConverter(mapper) qubit_op = converter.convert(hamiltonian) print(qubit_op) from qiskit_nature.circuit.library import HartreeFock particle_number = problem.grouped_property_transformed.get_property("ParticleNumber") num_spin_orbitals = particle_number.num_spin_orbitals num_particles = particle_number.num_particles init_state = HartreeFock(num_spin_orbitals, num_particles, converter) print(init_state) from qiskit.circuit.library import TwoLocal from qiskit_nature.circuit.library import UCCSD, PUCCD, SUCCD # Choose the ansatz ansatz_type = "UCCSD" # Put arguments for twolocal if ansatz_type == "TwoLocal": # Single qubit rotations that are placed on all qubits with independent parameters rotation_blocks = ['ry', 'rz'] # Entangling gates entanglement_blocks = 'cz' # How the qubits are entangled entanglement = 'full' # Repetitions of rotation_blocks + entanglement_blocks with independent parameters repetitions = 1 # Skip the final rotation_blocks layer skip_final_rotation_layer = True ansatz = TwoLocal(qubit_op.num_qubits, rotation_blocks, entanglement_blocks, reps=repetitions, entanglement=entanglement, skip_final_rotation_layer=skip_final_rotation_layer) # Add the initial state ansatz.compose(init_state, front=True, inplace=True) elif ansatz_type == "UCCSD": ansatz = UCCSD(converter,num_particles,num_spin_orbitals,initial_state = init_state) elif ansatz_type == "PUCCD": ansatz = PUCCD(converter,num_particles,num_spin_orbitals,initial_state = init_state) elif ansatz_type == "SUCCD": ansatz = SUCCD(converter,num_particles,num_spin_orbitals,initial_state = init_state) elif ansatz_type == "Custom": # Example of how to write your own circuit from qiskit.circuit import Parameter, QuantumCircuit, QuantumRegister # Define the variational parameter theta = Parameter('a') n = qubit_op.num_qubits # Make an empty quantum circuit qc = QuantumCircuit(qubit_op.num_qubits) qubit_label = 0 # Place a Hadamard gate qc.h(qubit_label) # Place a CNOT ladder for i in range(n-1): qc.cx(i, i+1) # Visual separator qc.barrier() # rz rotations on all qubits qc.rz(theta, range(n)) ansatz = qc ansatz.compose(init_state, front=True, inplace=True) print(ansatz.decompose()) from qiskit import Aer backend = Aer.get_backend('statevector_simulator') from qiskit.algorithms.optimizers import COBYLA, L_BFGS_B, SPSA, SLSQP optimizer_type = 'L_BFGS_B' # You may want to tune the parameters # of each optimizer, here the defaults are used if optimizer_type == 'COBYLA': optimizer = COBYLA(maxiter=500) elif optimizer_type == 'L_BFGS_B': optimizer = L_BFGS_B(maxfun=500) elif optimizer_type == 'SPSA': optimizer = SPSA(maxiter=500) elif optimizer_type == 'SLSQP': optimizer = SLSQP(maxiter=500) from qiskit_nature.algorithms.ground_state_solvers.minimum_eigensolver_factories import NumPyMinimumEigensolverFactory from qiskit_nature.algorithms.ground_state_solvers import GroundStateEigensolver import numpy as np def exact_diagonalizer(problem, converter): solver = NumPyMinimumEigensolverFactory() calc = GroundStateEigensolver(converter, solver) result = calc.solve(problem) return result result_exact = exact_diagonalizer(problem, converter) exact_energy = np.real(result_exact.eigenenergies[0]) print("Exact electronic energy", exact_energy) print(result_exact) # The targeted electronic energy for H2 is -1.85336 Ha # Check with your VQE result. from qiskit.algorithms import VQE from IPython.display import display, clear_output # Print and save the data in lists def callback(eval_count, parameters, mean, std): # Overwrites the same line when printing display("Evaluation: {}, Energy: {}, Std: {}".format(eval_count, mean, std)) clear_output(wait=True) counts.append(eval_count) values.append(mean) params.append(parameters) deviation.append(std) counts = [] values = [] params = [] deviation = [] # Set initial parameters of the ansatz # We choose a fixed small displacement # So all participants start from similar starting point try: initial_point = [0.01] * len(ansatz.ordered_parameters) except: initial_point = [0.01] * ansatz.num_parameters algorithm = VQE(ansatz, optimizer=optimizer, quantum_instance=backend, callback=callback, initial_point=initial_point) result = algorithm.compute_minimum_eigenvalue(qubit_op) print(result) # Store results in a dictionary from qiskit.transpiler import PassManager from qiskit.transpiler.passes import Unroller # Unroller transpile your circuit into CNOTs and U gates pass_ = Unroller(['u', 'cx']) pm = PassManager(pass_) ansatz_tp = pm.run(ansatz) cnots = ansatz_tp.count_ops()['cx'] energy = result.optimal_value if ansatz_type == "TwoLocal": result_dict = { 'optimizer': optimizer.__class__.__name__, 'mapping': converter.mapper.__class__.__name__, 'ansatz': ansatz.__class__.__name__, 'rotation blocks': rotation_blocks, 'entanglement_blocks': entanglement_blocks, 'entanglement': entanglement, 'repetitions': repetitions, 'skip_final_rotation_layer': skip_final_rotation_layer, 'energy (Ha)': energy, 'error (mHa)': (energy-exact_energy)*1000, '# of parameters': len(result.optimal_point), 'final parameters': result.optimal_point, '# of evaluations': result.cost_function_evals, '# of qubits': int(qubit_op.num_qubits), '# of CNOTs': cnots} else: result_dict = { 'optimizer': optimizer.__class__.__name__, 'mapping': converter.mapper.__class__.__name__, 'ansatz': ansatz.__class__.__name__, 'rotation blocks': None, 'entanglement_blocks': None, 'entanglement': None, 'repetitions': None, 'skip_final_rotation_layer': None, 'energy (Ha)': energy, 'error (mHa)': (energy-exact_energy)*1000, '# of parameters': len(result.optimal_point), 'final parameters': result.optimal_point, '# of evaluations': result.cost_function_evals, '# of qubits': int(qubit_op.num_qubits), '# of CNOTs': cnots} # Plot the results import matplotlib.pyplot as plt fig, ax = plt.subplots(1, 1) ax.set_xlabel('Iterations') ax.set_ylabel('Energy') ax.grid() fig.text(0.7, 0.75, f'Energy: {result.optimal_value:.3f}') plt.title(f"{result_dict['optimizer']}-{result_dict['mapping']}\n{result_dict['ansatz']}") ax.plot(counts, values) ax.axhline(exact_energy, linestyle='--') fig_title = f"\ {result_dict['optimizer']}-\ {result_dict['mapping']}-\ {result_dict['ansatz']}-\ Energy({result_dict['energy (Ha)']:.3f}).png" fig.savefig(fig_title, dpi=300) # Display and save the data import pandas as pd import os.path filename = 'results_h2o.csv' if os.path.isfile(filename): result_df = pd.read_csv(filename) result_df = result_df.append([result_dict]) else: result_df = pd.DataFrame.from_dict([result_dict]) result_df.to_csv(filename) result_df[['optimizer','ansatz', 'rotation blocks', 'entanglement_blocks', 'entanglement', 'repetitions', '# of qubits', '# of parameters', '# of CNOTs', '# of evaluations', 'error (mHa)']] from qiskit import Aer from qiskit.utils import QuantumInstance from qiskit_nature.algorithms import GroundStateEigensolver, QEOM, VQEUCCFactory # This first part sets the ground state solver # see more about this part in the ground state calculation tutorial quantum_instance = QuantumInstance(Aer.get_backend("aer_simulator_statevector")) solver = VQEUCCFactory(quantum_instance) gsc = GroundStateEigensolver(converter, solver) # The qEOM algorithm is simply instantiated with the chosen ground state solver qeom_excited_states_calculation = QEOM(gsc, "sd") qeom_results = qeom_excited_states_calculation.solve(problem) print(qeom_results) # WRITE YOUR CODE BETWEEN THESE LINES - START # WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import numpy as np import sympy as sym from sympy import exp # Symbolic exponentiation. from scipy.linalg import expm # Numerical exponentiation. from sympy.physics.quantum import TensorProduct, OuterProduct from qiskit import Aer, QuantumRegister, QuantumCircuit, assemble, execute from qiskit.quantum_info import Statevector from qiskit.circuit import Parameter from qiskit.opflow import I, X, Y, Z import pylatexenc # Required to use 'MatplotlibDrawer'. '''1-qubit gates SU(2):''' sigma0 = np.identity(2) # Matrix of the identity gate. sigma1 = np.array([[0,1],[1,0]], dtype=(np.float32)) # Matrix of the Pauli-X gate that performs a Pi radian rotation around the x-axis. sigma2 = np.array([[0,-1j],[1j,0]], dtype=(np.complex64)) # Matrix of the Pauli-Y gate = iXZ. sigma3 = np.array([[1,0],[0,-1]], dtype=(np.float32)) # Matrix of the Pauli-Z gate = P(pi). had = (1/np.sqrt(2))*np.array([[1,1],[1,-1]]) # Matrix of the Hadamard gate that performs a Pi radian rotation around an axis between the x and z axes. phase = np.array([[1,0],[0,1j]]) # Matrix of the Phase gate S = P(pi/2) = square-root of Pauli-Z. '''2-qubit gates SU(4):''' XX = np.kron(sigma1,sigma1) # Matrix of the XX gate. YY = np.kron(sigma2,sigma2) # Matrix of the YY gate. '''Array dimensions:''' sigma0.shape, sigma1.shape, sigma2.shape, sigma3.shape, had.shape, phase.shape, XX.shape, YY.shape # Circuit for the ZZ(t) gate: ''' from qiskit import QuantumCircuit from qiskit.circuit import Parameter ''' t = Parameter('t') qc = QuantumCircuit(2, name='ZZ') qc.cnot(0,1) # CX^{01}. qc.rz(2 * t, 1) # R_z(2t). qc.cnot(0,1) # CX^{01}. qc.draw(output='mpl') # '!pip install pylatexenc' library is required to use 'MatplotlibDrawer'. # Circuit for the XX(t) gate: ''' from qiskit import QuantumCircuit from qiskit.circuit import Parameter ''' t = Parameter('t') qc = QuantumCircuit(2, name='XX') qc.h([0,1]) qc.cx(0, 1) qc.rz(2 * t, 1) qc.cx(0, 1) qc.h([0,1]) qc.draw(output='mpl') # Equivalent circuit for the XX(t) gate: qc = QuantumCircuit(2, name='XX') qc.ry(np.pi/2,[0,1]) qc.cnot(0,1) qc.rz(2 * t, 1) qc.cnot(0,1) qc.ry(-np.pi/2,[0,1]) qc.draw(output='mpl') # Circuit for the YY(t) gate: ''' from qiskit import QuantumCircuit from qiskit.circuit import Parameter ''' t = Parameter('t') qr = QuantumRegister(2) qc = QuantumCircuit(qr, name='YY') qc.sdg([0,1]) qc.h([0,1]) qc.cx(0, 1) qc.rz(2 * t, 1) qc.cx(0, 1) qc.h([0,1]) qc.s([0,1]) qc.draw(output='mpl') # Equivalent circuit for the YY(t) gate: qr = QuantumRegister(2) qc = QuantumCircuit(qr, name='YY') qc.rx(np.pi/2,[0,1]) qc.cnot(0,1) qc.rz(2 * t, 1) qc.cnot(0,1) qc.rx(-np.pi/2,[0,1]) qc.draw(output='mpl') t = Parameter('t') qr = QuantumRegister(2) ZZ_qc = QuantumCircuit(qr, name='ZZ') ZZ_qc.cnot(0,1) ZZ_qc.rz(2 * t, 1) ZZ_qc.cnot(0,1) ZZg = ZZ_qc.to_instruction() XX_qc = QuantumCircuit(qr, name='XX') XX_qc.h([0,1]) XX_qc.append(ZZg, [0,1]) XX_qc.h([0,1]) XXg = XX_qc.to_instruction() YY_qc = QuantumCircuit(qr, name='YY') YY_qc.sdg([0,1]) YY_qc.h([0,1]) YY_qc.append(ZZg, [0,1]) YY_qc.h([0,1]) YY_qc.s([0,1]) YYg = YY_qc.to_instruction() num_qubits = 3 Trot_qr = QuantumRegister(num_qubits) Trot_qc = QuantumCircuit(Trot_qr, name='Trot') for i in range(0, num_qubits - 1): Trot_qc.append(YYg, [Trot_qr[i], Trot_qr[i+1]]) Trot_qc.append(XXg, [Trot_qr[i], Trot_qr[i+1]]) Trot_gate = Trot_qc.to_instruction() Trot_qc.draw(output='mpl') XXI = np.kron(XX, sigma0) YYI = np.kron(YY, sigma0) (expm(-1j*(XXI+YYI)).round(6) == (expm(-1j*XXI)@expm(-1j*YYI)).round(6)).all() ((expm(-1j*XXI)@expm(-1j*YYI)).round(6) == (expm(-1j*YYI)@expm(-1j*XXI)).round(6)).all() '''Return should be >>> False.''' YYI = np.kron(YY, sigma0) IXX = np.kron(sigma0, XX) (expm(-1j*(YYI+IXX)).round(6) == (expm(-1j*YYI)@expm(-1j*IXX)).round(6)).all() from qiskit.opflow import I, X, Y, Z H1 = (X^X^I)+(Y^Y^I) (H1.exp_i().to_matrix().round(7) == ((X^X^I).exp_i()@(Y^Y^I).exp_i()).to_matrix().round(7)).all() '''Return should be >>> False.''' H2 = (Y^Y^I)+(I^X^X) (H2.exp_i().to_matrix().round(3) == ((Y^Y^I).exp_i()@(I^X^X).exp_i()).to_matrix().round(3)).all()
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit import * from qiskit.visualization import plot_histogram import numpy as np def NOT(inp): """An NOT gate. Parameters: inp (str): Input, encoded in qubit 0. Returns: QuantumCircuit: Output NOT circuit. str: Output value measured from qubit 0. """ qc = QuantumCircuit(1, 1) # A quantum circuit with a single qubit and a single classical bit qc.reset(0) # We encode '0' as the qubit state |0⟩, and '1' as |1⟩ # Since the qubit is initially |0⟩, we don't need to do anything for an input of '0' # For an input of '1', we do an x to rotate the |0⟩ to |1⟩ if inp=='1': qc.x(0) # barrier between input state and gate operation qc.barrier() # Now we've encoded the input, we can do a NOT on it using x qc.x(0) #barrier between gate operation and measurement qc.barrier() # Finally, we extract the |0⟩/|1⟩ output of the qubit and encode it in the bit c[0] qc.measure(0,0) qc.draw() # We'll run the program on a simulator backend = Aer.get_backend('qasm_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = backend.run(qc, shots=1, memory=True) output = job.result().get_memory()[0] return qc, output ## Test the function for inp in ['0', '1']: qc, out = NOT(inp) print('NOT with input',inp,'gives output',out) display(qc.draw()) print('\n') def XOR(inp1,inp2): """An XOR gate. Parameters: inpt1 (str): Input 1, encoded in qubit 0. inpt2 (str): Input 2, encoded in qubit 1. Returns: QuantumCircuit: Output XOR circuit. str: Output value measured from qubit 1. """ qc = QuantumCircuit(2, 1) qc.reset(range(2)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) # barrier between input state and gate operation qc.barrier() # this is where your program for quantum XOR gate goes qc.cx(0, 1) # barrier between input state and gate operation qc.barrier() qc.measure(1,0) # output from qubit 1 is measured #We'll run the program on a simulator backend = Aer.get_backend('qasm_simulator') #Since the output will be deterministic, we can use just a single shot to get it job = backend.run(qc, shots=1, memory=True) output = job.result().get_memory()[0] return qc, output ## Test the function for inp1 in ['0', '1']: for inp2 in ['0', '1']: qc, output = XOR(inp1, inp2) print('XOR with inputs',inp1,inp2,'gives output',output) display(qc.draw()) print('\n') def AND(inp1,inp2): """An AND gate. Parameters: inpt1 (str): Input 1, encoded in qubit 0. inpt2 (str): Input 2, encoded in qubit 1. Returns: QuantumCircuit: Output XOR circuit. str: Output value measured from qubit 2. """ qc = QuantumCircuit(3, 1) qc.reset(range(2)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) qc.barrier() # this is where your program for quantum AND gate goes qc.ccx(0,1,2) qc.barrier() qc.measure(2, 0) # output from qubit 2 is measured # We'll run the program on a simulator backend = Aer.get_backend('qasm_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = backend.run(qc, shots=1, memory=True) output = job.result().get_memory()[0] return qc, output ## Test the function for inp1 in ['0', '1']: for inp2 in ['0', '1']: qc, output = AND(inp1, inp2) print('AND with inputs',inp1,inp2,'gives output',output) display(qc.draw()) print('\n') def NAND(inp1,inp2): """An NAND gate. Parameters: inpt1 (str): Input 1, encoded in qubit 0. inpt2 (str): Input 2, encoded in qubit 1. Returns: QuantumCircuit: Output NAND circuit. str: Output value measured from qubit 2. """ qc = QuantumCircuit(3, 1) qc.reset(range(3)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) qc.barrier() # this is where your program for quantum NAND gate goes qc.ccx(0,1,2) if inp=='1': qc.x(2) qc.barrier() qc.measure(2, 0) # output from qubit 2 is measured # We'll run the program on a simulator backend = Aer.get_backend('aer_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = backend.run(qc,shots=1,memory=True) output = job.result().get_memory()[0] return qc, output ## Test the function for inp1 in ['0', '1']: for inp2 in ['0', '1']: qc, output = NAND(inp1, inp2) print('NAND with inputs',inp1,inp2,'gives output',output) display(qc.draw()) print('\n') def OR(inp1,inp2): """An OR gate. Parameters: inpt1 (str): Input 1, encoded in qubit 0. inpt2 (str): Input 2, encoded in qubit 1. Returns: QuantumCircuit: Output XOR circuit. str: Output value measured from qubit 2. """ qc = QuantumCircuit(3, 1) qc.reset(range(3)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) qc.barrier() # this is where your program for quantum OR gate goes qc.cx(0, 2) qc.cx(1, 2) qc.barrier() qc.measure(2, 0) # output from qubit 2 is measured # We'll run the program on a simulator backend = Aer.get_backend('aer_simulator') # Since the output will be deterministic, we can use just a single shot to get it job = backend.run(qc,shots=1,memory=True) output = job.result().get_memory()[0] return qc, output ## Test the function for inp1 in ['0', '1']: for inp2 in ['0', '1']: qc, output = OR(inp1, inp2) print('OR with inputs',inp1,inp2,'gives output',output) display(qc.draw()) print('\n') from qiskit import IBMQ #IBMQ.save_account("a68a35747d4eccd1d58f275e637909987c789ce5c0edd8a4f43014672bf0301b54b28b1b5f44ba8ff87500777429e1e4ceb79621a6ba248d6cca6bca0e233d23", overwrite=True) IBMQ.load_account() IBMQ.providers() provider = IBMQ.get_provider('ibm-q') provider.backends() import qiskit.tools.jupyter # run this cell backend = provider.get_backend('ibmq_quito') qc_and = QuantumCircuit(3) qc_and.ccx(0,1,2) print('AND gate') display(qc_and.draw()) print('\n\nTranspiled AND gate with all the required connectivity') qc_and.decompose().draw() from qiskit.tools.monitor import job_monitor # run the cell to define AND gate for real quantum system def AND(inp1, inp2, backend, layout): qc = QuantumCircuit(3, 1) qc.reset(range(3)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) qc.barrier() qc.ccx(0, 1, 2) qc.barrier() qc.measure(2, 0) qc_trans = transpile(qc, backend, initial_layout=layout, optimization_level=3) job = backend.run(qc_trans, shots=8192) print(job.job_id()) job_monitor(job) output = job.result().get_counts() return qc_trans, output backend layout = [0, 1, 2] output_all = [] qc_trans_all = [] prob_all = [] worst = 1 best = 0 for input1 in ['0','1']: for input2 in ['0','1']: qc_trans, output = AND(input1, input2, backend, layout) output_all.append(output) qc_trans_all.append(qc_trans) prob = output[str(int( input1=='1' and input2=='1' ))]/8192 prob_all.append(prob) print('\nProbability of correct answer for inputs',input1,input2) print('{:.2f}'.format(prob) ) print('---------------------------------') worst = min(worst,prob) best = max(best, prob) print('') print('\nThe highest of these probabilities was {:.2f}'.format(best)) print('The lowest of these probabilities was {:.2f}'.format(worst)) print('Transpiled AND gate circuit for ibmq_vigo with input 0 0') print('\nThe circuit depth : {}'.format (qc_trans_all[0].depth())) print('# of nonlocal gates : {}'.format (qc_trans_all[0].num_nonlocal_gates())) print('Probability of correct answer : {:.2f}'.format(prob_all[0]) ) qc_trans_all[0].draw() print('Transpiled AND gate circuit for ibmq_vigo with input 0 1') print('\nThe circuit depth : {}'.format (qc_trans_all[1].depth())) print('# of nonlocal gates : {}'.format (qc_trans_all[1].num_nonlocal_gates())) print('Probability of correct answer : {:.2f}'.format(prob_all[1]) ) qc_trans_all[1].draw() print('Transpiled AND gate circuit for ibmq_vigo with input 1 0') print('\nThe circuit depth : {}'.format (qc_trans_all[2].depth())) print('# of nonlocal gates : {}'.format (qc_trans_all[2].num_nonlocal_gates())) print('Probability of correct answer : {:.2f}'.format(prob_all[2]) ) qc_trans_all[2].draw() print('Transpiled AND gate circuit for ibmq_vigo with input 1 1') print('\nThe circuit depth : {}'.format (qc_trans_all[3].depth())) print('# of nonlocal gates : {}'.format (qc_trans_all[3].num_nonlocal_gates())) print('Probability of correct answer : {:.2f}'.format(prob_all[3]) ) qc_trans_all[3].draw()
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import numpy as np # Importing standard Qiskit libraries from qiskit import QuantumCircuit, transpile, Aer, execute from qiskit.tools.jupyter import * from qiskit.visualization import * from qiskit.providers.aer import QasmSimulator backend = Aer.get_backend('statevector_simulator') qc1 = QuantumCircuit(4) # perform gate operations on individual qubits qc1.x(0) qc1.y(1) qc1.z(2) qc1.s(3) # Draw circuit qc1.draw() # Plot blochshere out1 = execute(qc1,backend).result().get_statevector() plot_bloch_multivector(out1) qc2 = QuantumCircuit(4) # initialize qubits qc2.x(range(4)) # perform gate operations on individual qubits qc2.x(0) qc2.y(1) qc2.z(2) qc2.s(3) # Draw circuit qc2.draw() # Plot blochshere out2 = execute(qc2,backend).result().get_statevector() plot_bloch_multivector(out2) qc3 = QuantumCircuit(4) # initialize qubits qc3.h(range(4)) # perform gate operations on individual qubits qc3.x(0) qc3.y(1) qc3.z(2) qc3.s(3) # Draw circuit qc3.draw() # Plot blochshere out3 = execute(qc3,backend).result().get_statevector() plot_bloch_multivector(out3) qc4 = QuantumCircuit(4) # initialize qubits qc4.x(range(4)) qc4.h(range(4)) # perform gate operations on individual qubits qc4.x(0) qc4.y(1) qc4.z(2) qc4.s(3) # Draw circuit qc4.draw() # Plot blochshere out4 = execute(qc4,backend).result().get_statevector() plot_bloch_multivector(out4) qc5 = QuantumCircuit(4) # initialize qubits qc5.h(range(4)) qc5.s(range(4)) # perform gate operations on individual qubits qc5.x(0) qc5.y(1) qc5.z(2) qc5.s(3) # Draw circuit qc5.draw() # Plot blochshere out5 = execute(qc5,backend).result().get_statevector() plot_bloch_multivector(out5) qc6 = QuantumCircuit(4) # initialize qubits qc6.x(range(4)) qc6.h(range(4)) qc6.s(range(4)) # perform gate operations on individual qubits qc6.x(0) qc6.y(1) qc6.z(2) qc6.s(3) # Draw circuit qc6.draw() # Plot blochshere out6 = execute(qc6,backend).result().get_statevector() plot_bloch_multivector(out6) import qiskit qiskit.__qiskit_version__
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit import * import numpy as np from numpy import linalg as la from qiskit.tools.monitor import job_monitor import qiskit.tools.jupyter qc = QuantumCircuit(1) #### your code goes here # z measurement of qubit 0 measure_z = QuantumCircuit(1,1) measure_z.measure(0,0) # x measurement of qubit 0 measure_x = QuantumCircuit(1,1) # your code goes here # y measurement of qubit 0 measure_y = QuantumCircuit(1,1) # your code goes here shots = 2**14 # number of samples used for statistics sim = Aer.get_backend('qasm_simulator') bloch_vector_measure = [] for measure_circuit in [measure_x, measure_y, measure_z]: # run the circuit with a the selected measurement and get the number of samples that output each bit value counts = execute(qc+measure_circuit, sim, shots=shots).result().get_counts() # calculate the probabilities for each bit value probs = {} for output in ['0','1']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 bloch_vector_measure.append( probs['0'] - probs['1'] ) # normalizing the bloch sphere vector bloch_vector = bloch_vector_measure/la.norm(bloch_vector_measure) print('The bloch sphere coordinates are [{0:4.3f}, {1:4.3f}, {2:4.3f}]' .format(*bloch_vector)) from kaleidoscope.interactive import bloch_sphere bloch_sphere(bloch_vector, vectors_annotation=True) from qiskit.visualization import plot_bloch_vector plot_bloch_vector( bloch_vector ) # circuit for the state Tri1 Tri1 = QuantumCircuit(2) # your code goes here # circuit for the state Tri2 Tri2 = QuantumCircuit(2) # your code goes here # circuit for the state Tri3 Tri3 = QuantumCircuit(2) # your code goes here # circuit for the state Sing Sing = QuantumCircuit(2) # your code goes here # <ZZ> measure_ZZ = QuantumCircuit(2) measure_ZZ.measure_all() # <XX> measure_XX = QuantumCircuit(2) # your code goes here # <YY> measure_YY = QuantumCircuit(2) # your code goes here shots = 2**14 # number of samples used for statistics A = 1.47e-6 #unit of A is eV E_sim = [] for state_init in [Tri1,Tri2,Tri3,Sing]: Energy_meas = [] for measure_circuit in [measure_XX, measure_YY, measure_ZZ]: # run the circuit with a the selected measurement and get the number of samples that output each bit value qc = state_init+measure_circuit counts = execute(qc, sim, shots=shots).result().get_counts() # calculate the probabilities for each computational basis probs = {} for output in ['00','01', '10', '11']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 Energy_meas.append( probs['00'] - probs['01'] - probs['10'] + probs['11'] ) E_sim.append(A * np.sum(np.array(Energy_meas))) # Run this cell to print out your results print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E_sim[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E_sim[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E_sim[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E_sim[3])) # reduced plank constant in (eV) and the speed of light(cgs units) hbar, c = 4.1357e-15, 3e10 # energy difference between the triplets and singlet E_del = abs(E_sim[0] - E_sim[3]) # frequency associated with the energy difference f = E_del/hbar # convert frequency to wavelength in (cm) wavelength = c/f print('The wavelength of the radiation from the transition\ in the hyperfine structure is : {:.1f} cm'.format(wavelength)) provider = IBMQ.load_account() backend = provider.get_backend('ibmq_athens') # run this cell to get the backend information through the widget backend # assign your choice for the initial layout to the list variable `initial_layout`. initial_layout = qc_all = [state_init+measure_circuit for state_init in [Tri1,Tri2,Tri3,Sing] for measure_circuit in [measure_XX, measure_YY, measure_ZZ] ] shots = 8192 job = execute(qc_all, backend, initial_layout=initial_layout, optimization_level=3, shots=shots) print(job.job_id()) job_monitor(job) # getting the results of your job results = job.result() ## To access the results of the completed job #results = backend.retrieve_job('job_id').result() def Energy(results, shots): """Compute the energy levels of the hydrogen ground state. Parameters: results (obj): results, results from executing the circuits for measuring a hamiltonian. shots (int): shots, number of shots used for the circuit execution. Returns: Energy (list): energy values of the four different hydrogen ground states """ E = [] A = 1.47e-6 for ind_state in range(4): Energy_meas = [] for ind_comp in range(3): counts = results.get_counts(ind_state*3+ind_comp) # calculate the probabilities for each computational basis probs = {} for output in ['00','01', '10', '11']: if output in counts: probs[output] = counts[output]/shots else: probs[output] = 0 Energy_meas.append( probs['00'] - probs['01'] - probs['10'] + probs['11'] ) E.append(A * np.sum(np.array(Energy_meas))) return E E = Energy(results, shots) print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E[3])) from qiskit.ignis.mitigation.measurement import * # your code to create the circuits, meas_calibs, goes here meas_calibs, state_labels = # execute meas_calibs on your choice of the backend job = execute(meas_calibs, backend, shots = shots) print(job.job_id()) job_monitor(job) cal_results = job.result() ## To access the results of the completed job #cal_results = backend.retrieve_job('job_id').result() # your code to obtain the measurement filter object, 'meas_filter', goes here results_new = meas_filter.apply(results) E_new = Energy(results_new, shots) print('Energy expection value of the state Tri1 : {:.3e} eV'.format(E_new[0])) print('Energy expection value of the state Tri2 : {:.3e} eV'.format(E_new[1])) print('Energy expection value of the state Tri3 : {:.3e} eV'.format(E_new[2])) print('Energy expection value of the state Sing : {:.3e} eV'.format(E_new[3])) # results for the energy estimation from the simulation, # execution on a quantum system without error mitigation and # with error mitigation in numpy array format Energy_exact, Energy_exp_orig, Energy_exp_new = np.array(E_sim), np.array(E), np.array(E_new) # Calculate the relative errors of the energy values without error mitigation # and assign to the numpy array variable `Err_rel_orig` of size 4 Err_rel_orig = # Calculate the relative errors of the energy values with error mitigation # and assign to the numpy array variable `Err_rel_new` of size 4 Err_rel_new = np.set_printoptions(precision=3) print('The relative errors of the energy values for four bell basis\ without measurement error mitigation : {}'.format(Err_rel_orig)) np.set_printoptions(precision=3) print('The relative errors of the energy values for four bell basis\ with measurement error mitigation : {}'.format(Err_rel_new))
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
# Importing standard Qiskit libraries from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit import Aer, assemble from qiskit.visualization import plot_histogram, plot_bloch_multivector, plot_state_qsphere, plot_state_city, plot_state_paulivec, plot_state_hinton # Ignore warnings import warnings warnings.filterwarnings('ignore') # Define backend sim = Aer.get_backend('aer_simulator') def createBellStates(inp1, inp2): qc = QuantumCircuit(2) qc.reset(range(2)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) qc.barrier() qc.h(0) qc.cx(0,1) qc.save_statevector() qobj = assemble(qc) result = sim.run(qobj).result() state = result.get_statevector() return qc, state, result print('Note: Since these qubits are in entangled state, their state cannot be written as two separate qubit states. This also means that we lose information when we try to plot our state on separate Bloch spheres as seen below.\n') inp1 = 0 inp2 = 1 qc, state, result = createBellStates(inp1, inp2) display(plot_bloch_multivector(state)) # Uncomment below code in order to explore other states #for inp2 in ['0', '1']: #for inp1 in ['0', '1']: #qc, state, result = createBellStates(inp1, inp2) #print('For inputs',inp2,inp1,'Representation of Entangled States are:') # Uncomment any of the below functions to visualize the resulting quantum states # Draw the quantum circuit #display(qc.draw()) # Plot states on QSphere #display(plot_state_qsphere(state)) # Plot states on Bloch Multivector #display(plot_bloch_multivector(state)) # Plot histogram #display(plot_histogram(result.get_counts())) # Plot state matrix like a city #display(plot_state_city(state)) # Represent state matix using Pauli operators as the basis #display(plot_state_paulivec(state)) # Plot state matrix as Hinton representation #display(plot_state_hinton(state)) #print('\n')''' from qiskit import IBMQ, execute from qiskit.providers.ibmq import least_busy from qiskit.tools import job_monitor # Loading your IBM Quantum account(s) provider = IBMQ.load_account() backend = least_busy(provider.backends(filters=lambda x: x.configuration().n_qubits >= 2 and not x.configuration().simulator and x.status().operational==True)) def createBSRealDevice(inp1, inp2): qr = QuantumRegister(2) cr = ClassicalRegister(2) qc = QuantumCircuit(qr, cr) qc.reset(range(2)) if inp1 == 1: qc.x(0) if inp2 == 1: qc.x(1) qc.barrier() qc.h(0) qc.cx(0,1) qc.measure(qr, cr) job = execute(qc, backend=backend, shots=100) job_monitor(job) result = job.result() return qc, result inp1 = 0 inp2 = 0 print('For inputs',inp2,inp1,'Representation of Entangled States are,') #first results qc, first_result = createBSRealDevice(inp1, inp2) first_counts = first_result.get_counts() # Draw the quantum circuit display(qc.draw()) #second results qc, second_result = createBSRealDevice(inp1, inp2) second_counts = second_result.get_counts() # Plot results on histogram with legend legend = ['First execution', 'Second execution'] plot_histogram([first_counts, second_counts], legend=legend) def ghzCircuit(inp1, inp2, inp3): qc = QuantumCircuit(3) qc.reset(range(3)) if inp1 == 1: qc.x(0) if inp2 == 1: qc.x(1) if inp3 == 1: qc.x(2) qc.barrier() qc.h(0) qc.cx(0,1) qc.cx(0,2) qc.save_statevector() qobj = assemble(qc) result = sim.run(qobj).result() state = result.get_statevector() return qc, state, result print('Note: Since these qubits are in entangled state, their state cannot be written as two separate qubit states. This also means that we lose information when we try to plot our state on separate Bloch spheres as seen below.\n') inp1 = 0 inp2 = 1 inp3 = 1 qc, state, result = ghzCircuit(inp1, inp2, inp3) display(plot_bloch_multivector(state)) # Uncomment below code in order to explore other states #for inp3 in ['0','1']: #for inp2 in ['0','1']: #for inp1 in ['0','1']: #qc, state, result = ghzCircuit(inp1, inp2, inp3) #print('For inputs',inp3,inp2,inp1,'Representation of GHZ States are:') # Uncomment any of the below functions to visualize the resulting quantum states # Draw the quantum circuit #display(qc.draw()) # Plot states on QSphere #display(plot_state_qsphere(state)) # Plot states on Bloch Multivector #display(plot_bloch_multivector(state)) # Plot histogram #display(plot_histogram(result.get_counts())) # Plot state matrix like a city #display(plot_state_city(state)) # Represent state matix using Pauli operators as the basis #display(plot_state_paulivec(state)) # Plot state matrix as Hinton representation #display(plot_state_hinton(state)) #print('\n') def ghz5QCircuit(inp1, inp2, inp3, inp4, inp5): qc = QuantumCircuit(5) #qc.reset(range(5)) if inp1 == 1: qc.x(0) if inp2 == 1: qc.x(1) if inp3 == 1: qc.x(2) if inp4 == 1: qc.x(3) if inp5 == 1: qc.x(4) qc.barrier() qc.h(0) qc.cx(0,1) qc.cx(0,2) qc.cx(0,3) qc.cx(0,4) qc.save_statevector() qobj = assemble(qc) result = sim.run(qobj).result() state = result.get_statevector() return qc, state, result # Explore GHZ States for input 00010. Note: the input has been stated in little-endian format. inp1 = 0 inp2 = 1 inp3 = 0 inp4 = 0 inp5 = 0 qc, state, result = ghz5QCircuit(inp1, inp2, inp3, inp4, inp5) print('For inputs',inp5,inp4,inp3,inp2,inp1,'Representation of GHZ States are:') display(plot_state_qsphere(state)) print('\n') # Explore GHZ States for input 11001. Note: the input has been stated in little-endian format. inp1 = 1 inp2 = 0 inp3 = 0 inp4 = 1 inp5 = 1 qc, state, result = ghz5QCircuit(inp1, inp2, inp3, inp4, inp5) print('For inputs',inp5,inp4,inp3,inp2,inp1,'Representation of GHZ States are:') display(plot_state_qsphere(state)) print('\n') # Explore GHZ States for input 01010. Note: the input has been stated in little-endian format. inp1 = 0 inp2 = 1 inp3 = 0 inp4 = 1 inp5 = 0 qc, state, result = ghz5QCircuit(inp1, inp2, inp3, inp4, inp5) print('For inputs',inp5,inp4,inp3,inp2,inp1,'Representation of GHZ States are:') display(plot_state_qsphere(state)) print('\n') # Uncomment below code in order to explore other states #for inp5 in ['0','1']: #for inp4 in ['0','1']: #for inp3 in ['0','1']: #for inp2 in ['0','1']: #for inp1 in ['0','1']: #qc, state, result = ghz5QCircuit(inp1, inp2, inp3, inp4, inp5) #print('For inputs',inp5,inp4,inp3,inp2,inp1,'Representation of GHZ States are:') # Uncomment any of the below functions to visualize the resulting quantum states # Draw the quantum circuit #display(qc.draw()) # Plot states on QSphere #display(plot_state_qsphere(state)) # Plot states on Bloch Multivector #display(plot_bloch_multivector(state)) # Plot histogram #display(plot_histogram(result.get_counts())) # Plot state matrix like a city #display(plot_state_city(state)) # Represent state matix using Pauli operators as the basis #display(plot_state_paulivec(state)) # Plot state matrix as Hinton representation #display(plot_state_hinton(state)) #print('\n') backend = least_busy(provider.backends(filters=lambda x: x.configuration().n_qubits >= 5 and not x.configuration().simulator and x.status().operational==True)) def create5QGHZRealDevice(inp1, inp2, inp3, inp4, inp5): qr = QuantumRegister(5) cr = ClassicalRegister(5) qc = QuantumCircuit(qr, cr) qc.reset(range(5)) if inp1=='1': qc.x(0) if inp2=='1': qc.x(1) if inp3=='1': qc.x(1) if inp4=='1': qc.x(1) if inp5=='1': qc.x(1) qc.barrier() qc.h(0) qc.cx(0,1) qc.cx(0,2) qc.cx(0,3) qc.cx(0,4) qc.measure(qr, cr) job = execute(qc, backend=backend, shots=1000) job_monitor(job) result = job.result() return qc, result inp1 = 0 inp2 = 0 inp3 = 0 inp4 = 0 inp5 = 0 #first results qc, first_result = create5QGHZRealDevice(inp1, inp2, inp3, inp4, inp5) first_counts = first_result.get_counts() # Draw the quantum circuit display(qc.draw()) #second results qc, second_result = create5QGHZRealDevice(inp1, inp2, inp3, inp4, inp5) second_counts = second_result.get_counts() print('For inputs',inp5,inp4,inp3,inp2,inp1,'Representation of GHZ circuit states are,') # Plot results on histogram with legend legend = ['First execution', 'Second execution'] plot_histogram([first_counts, second_counts], legend=legend) import qiskit qiskit.__qiskit_version__
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit import QuantumCircuit, QuantumRegister from qiskit.quantum_info import SparsePauliOp def heisenberg_hamiltonian( length: int, jx: float = 1.0, jy: float = 0.0, jz: float = 0.0 ) -> SparsePauliOp: terms = [] for i in range(length - 1): if jx: terms.append(("XX", [i, i + 1], jx)) if jy: terms.append(("YY", [i, i + 1], jy)) if jz: terms.append(("ZZ", [i, i + 1], jz)) return SparsePauliOp.from_sparse_list(terms, num_qubits=length) def state_prep_circuit(num_qubits: int, layers: int = 1) -> QuantumCircuit: qubits = QuantumRegister(num_qubits, name="q") circuit = QuantumCircuit(qubits) circuit.h(qubits) for _ in range(layers): for i in range(0, num_qubits - 1, 2): circuit.cx(qubits[i], qubits[i + 1]) circuit.ry(0.1, qubits) for i in range(1, num_qubits - 1, 2): circuit.cx(qubits[i], qubits[i + 1]) circuit.ry(0.1, qubits) return circuit length = 5 hamiltonian = heisenberg_hamiltonian(length, 1.0, 1.0) circuit = state_prep_circuit(length, layers=2) print(hamiltonian) circuit.draw("mpl") from qiskit_aer.primitives import Estimator estimator = Estimator(approximation=True) job = estimator.run(circuit, hamiltonian, shots=None) result = job.result() exact_value = result.values[0] print(f"Exact energy: {exact_value}") from qiskit_ibm_runtime import QiskitRuntimeService hub = "ibm-q-internal" group = "deployed" project = "default" service = QiskitRuntimeService(instance=f"{hub}/{group}/{project}") from qiskit_ibm_runtime import Estimator, Options, Session from qiskit.transpiler import CouplingMap backend = service.get_backend("simulator_statevector") # set simulation options simulator = { "basis_gates": ["id", "rz", "sx", "cx", "reset"], "coupling_map": list(CouplingMap.from_line(length + 1)), } shots = 10000 import math options = Options( simulator=simulator, resilience_level=0, ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variance = result.metadata[0]["variance"] std = math.sqrt(variance / shots) print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") from qiskit_aer.noise import NoiseModel, ReadoutError noise_model = NoiseModel() ##### your code here ##### # P(A|B) = [P(A|0), P(A|1)] = [ 1 - q0_01, q0_01 ] = [ 0.8, 0.2 ] q0_10 = 0.5 q0_01 = 0.2 qn_10 = 0.05 qn_01 = 0.02 re_l = [ReadoutError( [ [1 - q0_01, q0_01], [q0_10, 1 - q0_10], ] )] n_qubits = 6 for _ in range(n_qubits - 1): re_l.append(ReadoutError( [ [1 - qn_01, qn_01], [qn_10, 1 - qn_10], ] )) for q in range(n_qubits): noise_model.add_readout_error(re_l[q], (q, )) print(noise_model.to_dict()) # Submit your answer from qc_grader.challenges.qgss_2023 import grade_lab5_ex1 grade_lab5_ex1(noise_model) options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=0, transpilation=dict(initial_layout=list(range(length))), ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variance = result.metadata[0]["variance"] std = math.sqrt(variance / shots) print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=0, transpilation=dict(initial_layout=list(range(1, length + 1))), ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variance = result.metadata[0]["variance"] std = math.sqrt(variance / shots) print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=1, transpilation=dict(initial_layout=list(range(1, length + 1))), ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variance = result.metadata[0]["variance"] std = math.sqrt(variance / shots) print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") new_shots: int ##### your code here ##### new_shots = 20000 # Submit your answer from qc_grader.challenges.qgss_2023 import grade_lab5_ex2 grade_lab5_ex2(new_shots) from qiskit_aer.noise import depolarizing_error noise_model = NoiseModel() ##### your code here ##### error = depolarizing_error(0.01, 2) noise_model.add_all_qubit_quantum_error(error, ['cx']) print(noise_model) # Submit your answer from qc_grader.challenges.qgss_2023 import grade_lab5_ex3 grade_lab5_ex3(noise_model) options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=1, ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variance = result.metadata[0]["variance"] std = math.sqrt(variance / shots) print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=2, ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variances = result.metadata[0]["zne"]["noise_amplification"]["variance"] print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variances: {variances}")
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import numpy as np import matplotlib.pyplot as plt plt.rcParams.update({'font.size': 16}) # enlarge matplotlib fonts # Import qubit states Zero (|0>) and One (|1>), and Pauli operators (X, Y, Z) from qiskit.opflow import Zero, One, I, X, Y, Z # Suppress warnings import warnings warnings.filterwarnings('ignore') # Returns the matrix representation of the XXX Heisenberg model for 3 spin-1/2 particles in a line def H_heis3(): # Interactions (I is the identity matrix; X, Y, and Z are Pauli matricies; ^ is a tensor product) XXs = (I^X^X) + (X^X^I) YYs = (I^Y^Y) + (Y^Y^I) ZZs = (I^Z^Z) + (Z^Z^I) # Sum interactions H = XXs + YYs + ZZs # Return Hamiltonian return H # Returns the matrix representation of U_heis3(t) for a given time t assuming an XXX Heisenberg Hamiltonian for 3 spins-1/2 particles in a line def U_heis3(t): # Compute XXX Hamiltonian for 3 spins in a line H = H_heis3() # Return the exponential of -i multipled by time t multipled by the 3 spin XXX Heisenberg Hamilonian return (t * H).exp_i() # Define array of time points ts = np.linspace(0, np.pi, 100) # Define initial state |110> initial_state = One^One^Zero # Compute probability of remaining in |110> state over the array of time points # ~initial_state gives the bra of the initial state (<110|) # @ is short hand for matrix multiplication # U_heis3(t) is the unitary time evolution at time t # t needs to be wrapped with float(t) to avoid a bug # (...).eval() returns the inner product <110|U_heis3(t)|110> # np.abs(...)**2 is the modulus squared of the innner product which is the expectation value, or probability, of remaining in |110> probs_110 = [np.abs((~initial_state @ U_heis3(float(t)) @ initial_state).eval())**2 for t in ts] # Plot evolution of |110> plt.plot(ts, probs_110) plt.xlabel('time') plt.ylabel(r'probability of state $|110\rangle$') plt.title(r'Evolution of state $|110\rangle$ under $H_{Heis3}$') plt.grid() plt.show() # Importing standard Qiskit modules from qiskit import QuantumCircuit, QuantumRegister, IBMQ, execute, transpile from qiskit.providers.aer import QasmSimulator from qiskit.tools.monitor import job_monitor from qiskit.circuit import Parameter # Import state tomography modules from qiskit.ignis.verification.tomography import state_tomography_circuits, StateTomographyFitter from qiskit.quantum_info import state_fidelity # suppress warnings import warnings warnings.filterwarnings('ignore') # load IBMQ Account data # IBMQ.save_account(TOKEN) # replace TOKEN with your API token string (https://quantum-computing.ibm.com/lab/docs/iql/manage/account/ibmq) provider = IBMQ.load_account() # Get backend for experiment provider = IBMQ.get_provider(hub='ibm-q-community', group='ibmquantumawards', project='open-science-22') jakarta = provider.get_backend('ibmq_jakarta') # properties = jakarta.properties() # Simulated backend based on ibmq_jakarta's device noise profile sim_noisy_jakarta = QasmSimulator.from_backend(provider.get_backend('ibmq_jakarta')) # Noiseless simulated backend sim = QasmSimulator() # Parameterize variable t to be evaluated at t=pi later t = Parameter('t') # Build a subcircuit for XX(t) two-qubit gate XX_qr = QuantumRegister(2) XX_qc = QuantumCircuit(XX_qr, name='XX') XX_qc.ry(np.pi/2,[0,1]) XX_qc.cnot(0,1) XX_qc.rz(2 * t, 1) XX_qc.cnot(0,1) XX_qc.ry(-np.pi/2,[0,1]) # Convert custom quantum circuit into a gate XX = XX_qc.to_instruction() # Build a subcircuit for YY(t) two-qubit gate YY_qr = QuantumRegister(2) YY_qc = QuantumCircuit(YY_qr, name='YY') YY_qc.rx(np.pi/2,[0,1]) YY_qc.cnot(0,1) YY_qc.rz(2 * t, 1) YY_qc.cnot(0,1) YY_qc.rx(-np.pi/2,[0,1]) # Convert custom quantum circuit into a gate YY = YY_qc.to_instruction() # Build a subcircuit for ZZ(t) two-qubit gate ZZ_qr = QuantumRegister(2) ZZ_qc = QuantumCircuit(ZZ_qr, name='ZZ') ZZ_qc.cnot(0,1) ZZ_qc.rz(2 * t, 1) ZZ_qc.cnot(0,1) # Convert custom quantum circuit into a gate ZZ = ZZ_qc.to_instruction() # Combine subcircuits into a single multiqubit gate representing a single trotter step num_qubits = 3 Trot_qr = QuantumRegister(num_qubits) Trot_qc = QuantumCircuit(Trot_qr, name='Trot') for i in range(0, num_qubits - 1): Trot_qc.append(ZZ, [Trot_qr[i], Trot_qr[i+1]]) Trot_qc.append(YY, [Trot_qr[i], Trot_qr[i+1]]) Trot_qc.append(XX, [Trot_qr[i], Trot_qr[i+1]]) # Convert custom quantum circuit into a gate Trot_gate = Trot_qc.to_instruction() # The final time of the state evolution target_time = np.pi # Number of trotter steps trotter_steps = 4 ### CAN BE >= 4 # Initialize quantum circuit for 3 qubits qr = QuantumRegister(7) qc = QuantumCircuit(qr) # Prepare initial state (remember we are only evolving 3 of the 7 qubits on jakarta qubits (q_5, q_3, q_1) corresponding to the state |110>) qc.x([3,5]) # DO NOT MODIFY (|q_5,q_3,q_1> = |110>) # Simulate time evolution under H_heis3 Hamiltonian for _ in range(trotter_steps): qc.append(Trot_gate, [qr[1], qr[3], qr[5]]) # Evaluate simulation at target_time (t=pi) meaning each trotter step evolves pi/trotter_steps in time qc = qc.bind_parameters({t: target_time/trotter_steps}) # Generate state tomography circuits to evaluate fidelity of simulation st_qcs = state_tomography_circuits(qc, [qr[1], qr[3], qr[5]]) # Display circuit for confirmation # st_qcs[-1].decompose().draw() # view decomposition of trotter gates st_qcs[-1].draw() # only view trotter gates shots = 8192 reps = 8 backend = sim_noisy_jakarta # reps = 8 # backend = jakarta jobs = [] for _ in range(reps): # execute job = execute(st_qcs, backend, shots=shots) print('Job ID', job.job_id()) jobs.append(job) for job in jobs: job_monitor(job) try: if job.error_message() is not None: print(job.error_message()) except: pass # Compute the state tomography based on the st_qcs quantum circuits and the results from those ciricuits def state_tomo(result, st_qcs): # The expected final state; necessary to determine state tomography fidelity target_state = (One^One^Zero).to_matrix() # DO NOT MODIFY (|q_5,q_3,q_1> = |110>) # Fit state tomography results tomo_fitter = StateTomographyFitter(result, st_qcs) rho_fit = tomo_fitter.fit(method='lstsq') # Compute fidelity fid = state_fidelity(rho_fit, target_state) return fid # Compute tomography fidelities for each repetition fids = [] for job in jobs: fid = state_tomo(job.result(), st_qcs) fids.append(fid) print('state tomography fidelity = {:.4f} \u00B1 {:.4f}'.format(np.mean(fids), np.std(fids))) import qiskit.tools.jupyter %qiskit_version_table
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit_nature.drivers import Molecule from qiskit_nature.drivers.second_quantization import ElectronicStructureMoleculeDriver, ElectronicStructureDriverType molecule = Molecule( # coordinates are given in Angstrom geometry=[ ["O", [0.0, 0.0, 0.0]], ["H", [0.758602, 0.0, 0.504284]], ["H", [0.758602, 0.0, -0.504284]] ], multiplicity=1, # = 2*spin + 1 charge=0, ) driver = ElectronicStructureMoleculeDriver( molecule=molecule, basis="sto3g", driver_type=ElectronicStructureDriverType.PYSCF, ) properties = driver.run() # WRITE YOUR CODE BETWEEN THESE LINES - START num_alpha_electrons = num_beta_electrons = num_spin_orbitals = nuclear_rep_energy = # WRITE YOUR CODE BETWEEN THESE LINES - END from qc_grader.challenges.spring_2022 import grade_ex4a grade_ex4a( num_alpha_electrons=num_alpha_electrons, num_beta_electrons=num_beta_electrons, num_spin_orbitals=num_spin_orbitals, nuclear_rep_energy=nuclear_rep_energy ) from qiskit_nature.transformers.second_quantization.electronic import ActiveSpaceTransformer # Check the occupation of the spin orbitals PN_property = properties.get_property("ParticleNumber") print(PN_property) # Define the active space around the Fermi level # (selected automatically around the HOMO and LUMO, ordered by energy) transformer = ActiveSpaceTransformer( num_electrons=2, #how many electrons we have in our active space num_molecular_orbitals=2, #how many orbitals we have in our active space ) # We can hand-pick the MOs to be included in the AS # (in case they are not exactly around the Fermi level) # transformer = ActiveSpaceTransformer( # num_electrons=2, #how many electrons we have in our active space # num_molecular_orbitals=2, #how many orbitals we have in our active space # active_orbitals=[4,7], #We are specifically choosing MO number 4 (occupied with two electrons) and 7 (empty) # ) from qiskit_nature.problems.second_quantization.electronic import ElectronicStructureProblem problem = ElectronicStructureProblem(driver, [transformer]) second_q_ops = problem.second_q_ops() # this calls driver.run() internally hamiltonian = second_q_ops[0] print(hamiltonian) from qiskit_nature.operators.second_quantization import FermionicOp # WRITE YOUR CODE BETWEEN THESE LINES - START # list of valid tuples to initialize the FermionicOp list_operator = # positive integer that represents the length of registers num_register_length = # WRITE YOUR CODE BETWEEN THESE LINES - END from qc_grader.challenges.spring_2022 import grade_ex4b grade_ex4b(list_operator, num_register_length) from qiskit_nature.mappers.second_quantization import ParityMapper, BravyiKitaevMapper, JordanWignerMapper from qiskit_nature.converters.second_quantization import QubitConverter # Setup the mapper and qubit converter mapper_type = 'JordanWignerMapper' if mapper_type == 'ParityMapper': mapper = ParityMapper() elif mapper_type == 'JordanWignerMapper': mapper = JordanWignerMapper() elif mapper_type == 'BravyiKitaevMapper': mapper = BravyiKitaevMapper() converter = QubitConverter(mapper) qubit_op = converter.convert(hamiltonian) print(qubit_op) from qiskit_nature.circuit.library import HartreeFock particle_number = problem.grouped_property_transformed.get_property("ParticleNumber") num_spin_orbitals = particle_number.num_spin_orbitals num_particles = particle_number.num_particles init_state = HartreeFock(num_spin_orbitals, num_particles, converter) print(init_state) from qiskit.circuit.library import TwoLocal from qiskit_nature.circuit.library import UCCSD, PUCCD, SUCCD # Choose the ansatz ansatz_type = "UCCSD" # Put arguments for twolocal if ansatz_type == "TwoLocal": # Single qubit rotations that are placed on all qubits with independent parameters rotation_blocks = ['ry', 'rz'] # Entangling gates entanglement_blocks = 'cz' # How the qubits are entangled entanglement = 'full' # Repetitions of rotation_blocks + entanglement_blocks with independent parameters repetitions = 1 # Skip the final rotation_blocks layer skip_final_rotation_layer = True ansatz = TwoLocal(qubit_op.num_qubits, rotation_blocks, entanglement_blocks, reps=repetitions, entanglement=entanglement, skip_final_rotation_layer=skip_final_rotation_layer) # Add the initial state ansatz.compose(init_state, front=True, inplace=True) elif ansatz_type == "UCCSD": ansatz = UCCSD(converter,num_particles,num_spin_orbitals,initial_state = init_state) elif ansatz_type == "PUCCD": ansatz = PUCCD(converter,num_particles,num_spin_orbitals,initial_state = init_state) elif ansatz_type == "SUCCD": ansatz = SUCCD(converter,num_particles,num_spin_orbitals,initial_state = init_state) elif ansatz_type == "Custom": # Example of how to write your own circuit from qiskit.circuit import Parameter, QuantumCircuit, QuantumRegister # Define the variational parameter theta = Parameter('a') n = qubit_op.num_qubits # Make an empty quantum circuit qc = QuantumCircuit(qubit_op.num_qubits) qubit_label = 0 # Place a Hadamard gate qc.h(qubit_label) # Place a CNOT ladder for i in range(n-1): qc.cx(i, i+1) # Visual separator qc.barrier() # rz rotations on all qubits qc.rz(theta, range(n)) ansatz = qc ansatz.compose(init_state, front=True, inplace=True) print(ansatz.decompose()) from qiskit import Aer backend = Aer.get_backend('statevector_simulator') from qiskit.algorithms.optimizers import COBYLA, L_BFGS_B, SPSA, SLSQP optimizer_type = 'L_BFGS_B' # You may want to tune the parameters # of each optimizer, here the defaults are used if optimizer_type == 'COBYLA': optimizer = COBYLA(maxiter=500) elif optimizer_type == 'L_BFGS_B': optimizer = L_BFGS_B(maxfun=500) elif optimizer_type == 'SPSA': optimizer = SPSA(maxiter=500) elif optimizer_type == 'SLSQP': optimizer = SLSQP(maxiter=500) from qiskit_nature.algorithms.ground_state_solvers.minimum_eigensolver_factories import NumPyMinimumEigensolverFactory from qiskit_nature.algorithms.ground_state_solvers import GroundStateEigensolver import numpy as np def exact_diagonalizer(problem, converter): solver = NumPyMinimumEigensolverFactory() calc = GroundStateEigensolver(converter, solver) result = calc.solve(problem) return result result_exact = exact_diagonalizer(problem, converter) exact_energy = np.real(result_exact.eigenenergies[0]) print("Exact electronic energy", exact_energy) print(result_exact) # The targeted electronic energy for H2 is -1.85336 Ha # Check with your VQE result. from qiskit.algorithms import VQE from IPython.display import display, clear_output # Print and save the data in lists def callback(eval_count, parameters, mean, std): # Overwrites the same line when printing display("Evaluation: {}, Energy: {}, Std: {}".format(eval_count, mean, std)) clear_output(wait=True) counts.append(eval_count) values.append(mean) params.append(parameters) deviation.append(std) counts = [] values = [] params = [] deviation = [] # Set initial parameters of the ansatz # We choose a fixed small displacement # So all participants start from similar starting point try: initial_point = [0.01] * len(ansatz.ordered_parameters) except: initial_point = [0.01] * ansatz.num_parameters algorithm = VQE(ansatz, optimizer=optimizer, quantum_instance=backend, callback=callback, initial_point=initial_point) result = algorithm.compute_minimum_eigenvalue(qubit_op) print(result) # Store results in a dictionary from qiskit.transpiler import PassManager from qiskit.transpiler.passes import Unroller # Unroller transpile your circuit into CNOTs and U gates pass_ = Unroller(['u', 'cx']) pm = PassManager(pass_) ansatz_tp = pm.run(ansatz) cnots = ansatz_tp.count_ops()['cx'] energy = result.optimal_value if ansatz_type == "TwoLocal": result_dict = { 'optimizer': optimizer.__class__.__name__, 'mapping': converter.mapper.__class__.__name__, 'ansatz': ansatz.__class__.__name__, 'rotation blocks': rotation_blocks, 'entanglement_blocks': entanglement_blocks, 'entanglement': entanglement, 'repetitions': repetitions, 'skip_final_rotation_layer': skip_final_rotation_layer, 'energy (Ha)': energy, 'error (mHa)': (energy-exact_energy)*1000, '# of parameters': len(result.optimal_point), 'final parameters': result.optimal_point, '# of evaluations': result.cost_function_evals, '# of qubits': int(qubit_op.num_qubits), '# of CNOTs': cnots} else: result_dict = { 'optimizer': optimizer.__class__.__name__, 'mapping': converter.mapper.__class__.__name__, 'ansatz': ansatz.__class__.__name__, 'rotation blocks': None, 'entanglement_blocks': None, 'entanglement': None, 'repetitions': None, 'skip_final_rotation_layer': None, 'energy (Ha)': energy, 'error (mHa)': (energy-exact_energy)*1000, '# of parameters': len(result.optimal_point), 'final parameters': result.optimal_point, '# of evaluations': result.cost_function_evals, '# of qubits': int(qubit_op.num_qubits), '# of CNOTs': cnots} # Plot the results import matplotlib.pyplot as plt fig, ax = plt.subplots(1, 1) ax.set_xlabel('Iterations') ax.set_ylabel('Energy') ax.grid() fig.text(0.7, 0.75, f'Energy: {result.optimal_value:.3f}') plt.title(f"{result_dict['optimizer']}-{result_dict['mapping']}\n{result_dict['ansatz']}") ax.plot(counts, values) ax.axhline(exact_energy, linestyle='--') fig_title = f"\ {result_dict['optimizer']}-\ {result_dict['mapping']}-\ {result_dict['ansatz']}-\ Energy({result_dict['energy (Ha)']:.3f}).png" fig.savefig(fig_title, dpi=300) # Display and save the data import pandas as pd import os.path filename = 'results_h2o.csv' if os.path.isfile(filename): result_df = pd.read_csv(filename) result_df = result_df.append([result_dict]) else: result_df = pd.DataFrame.from_dict([result_dict]) result_df.to_csv(filename) result_df[['optimizer','ansatz', 'rotation blocks', 'entanglement_blocks', 'entanglement', 'repetitions', '# of qubits', '# of parameters', '# of CNOTs', '# of evaluations', 'error (mHa)']] from qiskit import Aer from qiskit.utils import QuantumInstance from qiskit_nature.algorithms import GroundStateEigensolver, QEOM, VQEUCCFactory # This first part sets the ground state solver # see more about this part in the ground state calculation tutorial quantum_instance = QuantumInstance(Aer.get_backend("aer_simulator_statevector")) solver = VQEUCCFactory(quantum_instance) gsc = GroundStateEigensolver(converter, solver) # The qEOM algorithm is simply instantiated with the chosen ground state solver qeom_excited_states_calculation = QEOM(gsc, "sd") qeom_results = qeom_excited_states_calculation.solve(problem) print(qeom_results) # WRITE YOUR CODE BETWEEN THESE LINES - START # WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit.quantum_info import Statevector from qiskit.visualization import plot_bloch_multivector excited = Statevector.from_int(1, 2) plot_bloch_multivector(excited.data) from qiskit.tools.jupyter import * from qiskit import IBMQ IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q', group='open', project='main') backend = provider.get_backend('ibmq_armonk') backend_config = backend.configuration() assert backend_config.open_pulse, "Backend doesn't support Pulse" dt = backend_config.dt print(f"Sampling time: {dt*1e9} ns") backend_defaults = backend.defaults() import numpy as np # unit conversion factors -> all backend properties returned in SI (Hz, sec, etc) GHz = 1.0e9 # Gigahertz MHz = 1.0e6 # Megahertz us = 1.0e-6 # Microseconds ns = 1.0e-9 # Nanoseconds # We will find the qubit frequency for the following qubit. qubit = 0 # The Rabi sweep will be at the given qubit frequency. center_frequency_Hz = backend_defaults.qubit_freq_est[qubit] # The default frequency is given in Hz # warning: this will change in a future release print(f"Qubit {qubit} has an estimated frequency of {center_frequency_Hz / GHz} GHz.") from qiskit import pulse, assemble # This is where we access all of our Pulse features! from qiskit.pulse import Play from qiskit.pulse import pulse_lib # This Pulse module helps us build sampled pulses for common pulse shapes ### Collect the necessary channels drive_chan = pulse.DriveChannel(qubit) meas_chan = pulse.MeasureChannel(qubit) acq_chan = pulse.AcquireChannel(qubit) inst_sched_map = backend_defaults.instruction_schedule_map measure = inst_sched_map.get('measure', qubits=[0]) # Rabi experiment parameters # Drive amplitude values to iterate over: 50 amplitudes evenly spaced from 0 to 0.75 num_rabi_points = 50 drive_amp_min = 0 drive_amp_max = 0.75 drive_amps = np.linspace(drive_amp_min, drive_amp_max, num_rabi_points) # drive waveforms mush be in units of 16 drive_sigma = 80 # in dt drive_samples = 8*drive_sigma # in dt # Build the Rabi experiments: # A drive pulse at the qubit frequency, followed by a measurement, # where we vary the drive amplitude each time. rabi_schedules = [] for drive_amp in drive_amps: rabi_pulse = pulse_lib.gaussian(duration=drive_samples, amp=drive_amp, sigma=drive_sigma, name=f"Rabi drive amplitude = {drive_amp}") this_schedule = pulse.Schedule(name=f"Rabi drive amplitude = {drive_amp}") this_schedule += Play(rabi_pulse, drive_chan) # The left shift `<<` is special syntax meaning to shift the start time of the schedule by some duration this_schedule += measure << this_schedule.duration rabi_schedules.append(this_schedule) rabi_schedules[-1].draw(label=True, scaling=1.0) # assemble the schedules into a Qobj num_shots_per_point = 1024 rabi_experiment_program = assemble(rabi_schedules, backend=backend, meas_level=1, meas_return='avg', shots=num_shots_per_point, schedule_los=[{drive_chan: center_frequency_Hz}] * num_rabi_points) # RUN the job on a real device #job = backend.run(rabi_experiment_program) #print(job.job_id()) #from qiskit.tools.monitor import job_monitor #job_monitor(job) # OR retreive result from previous run job = backend.retrieve_job("5ef3bf17dc3044001186c011") rabi_results = job.result() import matplotlib.pyplot as plt plt.style.use('dark_background') scale_factor = 1e-14 # center data around 0 def baseline_remove(values): return np.array(values) - np.mean(values) rabi_values = [] for i in range(num_rabi_points): # Get the results for `qubit` from the ith experiment rabi_values.append(rabi_results.get_memory(i)[qubit]*scale_factor) rabi_values = np.real(baseline_remove(rabi_values)) plt.xlabel("Drive amp [a.u.]") plt.ylabel("Measured signal [a.u.]") plt.scatter(drive_amps, rabi_values, color='white') # plot real part of Rabi values plt.show() from scipy.optimize import curve_fit def fit_function(x_values, y_values, function, init_params): fitparams, conv = curve_fit(function, x_values, y_values, init_params) y_fit = function(x_values, *fitparams) return fitparams, y_fit fit_params, y_fit = fit_function(drive_amps, rabi_values, lambda x, A, B, drive_period, phi: (A*np.cos(2*np.pi*x/drive_period - phi) + B), [10, 0.1, 0.6, 0]) plt.scatter(drive_amps, rabi_values, color='white') plt.plot(drive_amps, y_fit, color='red') drive_period = fit_params[2] # get period of rabi oscillation plt.axvline(drive_period/2, color='red', linestyle='--') plt.axvline(drive_period, color='red', linestyle='--') plt.annotate("", xy=(drive_period, 0), xytext=(drive_period/2,0), arrowprops=dict(arrowstyle="<->", color='red')) plt.xlabel("Drive amp [a.u.]", fontsize=15) plt.ylabel("Measured signal [a.u.]", fontsize=15) plt.show() pi_amp = abs(drive_period / 2) print(f"Pi Amplitude = {pi_amp}") # Drive parameters # The drive amplitude for pi/2 is simply half the amplitude of the pi pulse drive_amp = pi_amp / 2 # x_90 is a concise way to say pi_over_2; i.e., an X rotation of 90 degrees x90_pulse = pulse_lib.gaussian(duration=drive_samples, amp=drive_amp, sigma=drive_sigma, name='x90_pulse') # Ramsey experiment parameters time_max_us = 1.8 time_step_us = 0.025 times_us = np.arange(0.1, time_max_us, time_step_us) # Convert to units of dt delay_times_dt = times_us * us / dt # create schedules for Ramsey experiment ramsey_schedules = [] for delay in delay_times_dt: this_schedule = pulse.Schedule(name=f"Ramsey delay = {delay * dt / us} us") this_schedule += Play(x90_pulse, drive_chan) this_schedule += Play(x90_pulse, drive_chan) << this_schedule.duration + int(delay) this_schedule += measure << this_schedule.duration ramsey_schedules.append(this_schedule) ramsey_schedules[-1].draw(label=True, scaling=1.0) # Execution settings num_shots = 256 detuning_MHz = 2 ramsey_frequency = round(center_frequency_Hz + detuning_MHz * MHz, 6) # need ramsey freq in Hz ramsey_program = assemble(ramsey_schedules, backend=backend, meas_level=1, meas_return='avg', shots=num_shots, schedule_los=[{drive_chan: ramsey_frequency}]*len(ramsey_schedules) ) # RUN the job on a real device #job = backend.run(ramsey_experiment_program) #print(job.job_id()) #from qiskit.tools.monitor import job_monitor #job_monitor(job) # OR retreive job from previous run job = backend.retrieve_job('5ef3ed3a84b1b70012374317') ramsey_results = job.result() ramsey_values = [] for i in range(len(times_us)): ramsey_values.append(ramsey_results.get_memory(i)[qubit]*scale_factor) fit_params, y_fit = fit_function(times_us, np.real(ramsey_values), lambda x, A, del_f_MHz, C, B: ( A * np.cos(2*np.pi*del_f_MHz*x - C) + B ), [5, 1./0.4, 0, 0.25] ) # Off-resonance component _, del_f_MHz, _, _, = fit_params # freq is MHz since times in us plt.scatter(times_us, np.real(ramsey_values), color='white') plt.plot(times_us, y_fit, color='red', label=f"df = {del_f_MHz:.2f} MHz") plt.xlim(0, np.max(times_us)) plt.xlabel('Delay between X90 pulses [$\mu$s]', fontsize=15) plt.ylabel('Measured Signal [a.u.]', fontsize=15) plt.title('Ramsey Experiment', fontsize=15) plt.legend() plt.show()
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() # our backend is the Pulse Simulator from resources import helper from qiskit.providers.aer import PulseSimulator backend_sim = PulseSimulator() # sample duration for pulse instructions dt = 1e-9 # create the model duffing_model = helper.get_transmon(dt) # get qubit frequency from Duffing model qubit_lo_freq = duffing_model.hamiltonian.get_qubit_lo_from_drift() import numpy as np # visualization tools import matplotlib.pyplot as plt plt.style.use('dark_background') # unit conversion factors -> all backend properties returned in SI (Hz, sec, etc) GHz = 1.0e9 # Gigahertz MHz = 1.0e6 # Megahertz kHz = 1.0e3 # kilohertz us = 1.0e-6 # microseconds ns = 1.0e-9 # nanoseconds from qiskit import pulse from qiskit.pulse import Play, Acquire from qiskit.pulse.pulse_lib import GaussianSquare # qubit to be used throughout the notebook qubit = 0 ### Collect the necessary channels drive_chan = pulse.DriveChannel(qubit) meas_chan = pulse.MeasureChannel(qubit) acq_chan = pulse.AcquireChannel(qubit) # Construct a measurement schedule and add it to an InstructionScheduleMap meas_samples = 1200 meas_pulse = GaussianSquare(duration=meas_samples, amp=0.025, sigma=4, width=1150) measure_sched = Play(meas_pulse, meas_chan) | Acquire(meas_samples, acq_chan, pulse.MemorySlot(qubit)) inst_map = pulse.InstructionScheduleMap() inst_map.add('measure', [qubit], measure_sched) # save the measurement/acquire pulse for later measure = inst_map.get('measure', qubits=[qubit]) from qiskit.pulse import pulse_lib # the same spect pulse used in every schedule drive_amp = 0.9 drive_sigma = 16 drive_duration = 128 spec_pulse = pulse_lib.gaussian(duration=drive_duration, amp=drive_amp, sigma=drive_sigma, name=f"Spec drive amplitude = {drive_amp}") # Construct an np array of the frequencies for our experiment spec_freqs_GHz = np.arange(5.0, 5.2, 0.005) # Create the base schedule # Start with drive pulse acting on the drive channel spec_schedules = [] for freq in spec_freqs_GHz: sb_spec_pulse = helper.apply_sideband(spec_pulse, qubit_lo_freq[0]-freq*GHz, dt) spec_schedule = pulse.Schedule(name='SB Frequency = {}'.format(freq)) spec_schedule += Play(sb_spec_pulse, drive_chan) # The left shift `<<` is special syntax meaning to shift the start time of the schedule by some duration spec_schedule += measure << spec_schedule.duration spec_schedules.append(spec_schedule) spec_schedules[0].draw() from qiskit import assemble # assemble the schedules into a Qobj spec01_qobj = assemble(**helper.get_params('spec01', globals())) # run the simulation spec01_result = backend_sim.run(spec01_qobj, duffing_model).result() # retrieve the data from the experiment spec01_values = helper.get_values_from_result(spec01_result, qubit) fit_params, y_fit = helper.fit_lorentzian(spec_freqs_GHz, spec01_values, [5, 5, 1, 0]) f01 = fit_params[1] plt.scatter(spec_freqs_GHz, np.real(spec01_values), color='white') # plot real part of sweep values plt.plot(spec_freqs_GHz, y_fit, color='red') plt.xlim([min(spec_freqs_GHz), max(spec_freqs_GHz)]) plt.xlabel("Frequency [GHz]") plt.ylabel("Measured Signal [a.u.]") plt.show() print("01 Spectroscopy yields %f GHz"%f01) x180_amp = 0.629070 #from lab 6 Rabi experiment x_pulse = pulse_lib.gaussian(duration=drive_duration, amp=x180_amp, sigma=drive_sigma, name='x_pulse') anharmonicity_guess_GHz = -0.3 def build_spec12_pulse_schedule(freq): sb12_spec_pulse = helper.apply_sideband(spec_pulse, (freq + anharmonicity_guess_GHz)*GHz, dt) ### create a 12 spectroscopy pulse schedule spec12_schedule (already done) ### play an x pulse on the drive channel ### play sidebanded spec pulse on the drive channel ### add measurement pulse to schedule spec12_schedule = pulse.Schedule() ### WRITE YOUR CODE BETWEEN THESE LINES - START spec12_schedule += Play(x_pulse, drive_chan) spec12_schedule += Play(sb12_spec_pulse, drive_chan) spec12_schedule += measure << spec12_schedule.duration ### WRITE YOUR CODE BETWEEN THESE LINES - STOP return spec12_schedule sb_freqs_GHz = np.arange(-.1, .1, 0.005) # sweep +/- 100 MHz around guess # now vary the sideband frequency for each spec pulse spec_schedules = [] for freq in sb_freqs_GHz: spec_schedules.append(build_spec12_pulse_schedule(freq)) spec_schedules[0].draw() # assemble the schedules into a Qobj spec12_qobj = assemble(**helper.get_params('spec12', globals())) answer1 = spec12_qobj # run the simulation spec12_result = backend_sim.run(spec12_qobj, duffing_model).result() # retrieve the data from the experiment spec12_values = helper.get_values_from_result(spec12_result, qubit) anharm_offset = qubit_lo_freq[0]/GHz + anharmonicity_guess_GHz fit_params, y_fit = helper.fit_lorentzian(anharm_offset + sb_freqs_GHz, spec12_values, [5, 4.5, .1, 3]) f12 = fit_params[1] plt.scatter(anharm_offset + sb_freqs_GHz, np.real(spec12_values), color='white') # plot real part of sweep values plt.plot(anharm_offset + sb_freqs_GHz, y_fit, color='red') plt.xlim([anharm_offset + min(sb_freqs_GHz), anharm_offset + max(sb_freqs_GHz)]) plt.xlabel("Frequency [GHz]") plt.ylabel("Measured Signal [a.u.]") plt.show() print("12 Spectroscopy yields %f GHz"%f12) print("Measured transmon anharmonicity is %f MHz"%((f12-f01)*GHz/MHz)) from IPython.display import display, Javascript;display(Javascript('IPython.notebook.save_checkpoint();')); from grading_tools import send_code;send_code('ex1.ipynb')
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
# import SymPy and define symbols import sympy as sp sp.init_printing(use_unicode=True) wr = sp.Symbol('\omega_r') # resonator frequency wq = sp.Symbol('\omega_q') # qubit frequency g = sp.Symbol('g', real=True) # vacuum Rabi coupling Delta = sp.Symbol('Delta', real=True) # wr - wq; defined later # import operator relations and define them from sympy.physics.quantum.boson import BosonOp a = BosonOp('a') # resonator photon annihilation operator from sympy.physics.quantum import pauli, Dagger, Commutator from sympy.physics.quantum.operatorordering import normal_ordered_form # Pauli matrices sx = pauli.SigmaX() sy = pauli.SigmaY() sz = pauli.SigmaZ() # qubit raising and lowering operators splus = pauli.SigmaPlus() sminus = pauli.SigmaMinus() # define J-C Hamiltonian in terms of diagonal and non-block diagonal terms H0 = wr*Dagger(a)*a - (1/2)*wq*sz; H1 = 0 H2 = g*(Dagger(a)*sminus + a*splus); HJC = H0 + H1 + H2; HJC # print # using the above method for finding the ansatz eta = Commutator(H0, H2); eta pauli.qsimplify_pauli(normal_ordered_form(eta.doit().expand())) A = sp.Symbol('A') B = sp.Symbol('B') eta = A * Dagger(a) * sminus - B * a * splus; pauli.qsimplify_pauli(normal_ordered_form(Commutator(H0, eta).doit().expand())) H2 S1 = eta.subs(A, g/Delta) S1 = S1.subs(B, g/Delta); S1.factor() Heff = H0 + H1 + 0.5*pauli.qsimplify_pauli(normal_ordered_form(Commutator(H2, S1).doit().expand())).simplify(); Heff from qiskit.tools.jupyter import * from qiskit import IBMQ IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q', group='open', project='main') backend = provider.get_backend('ibmq_armonk') backend_config = backend.configuration() assert backend_config.open_pulse, "Backend doesn't support Pulse" dt = backend_config.dt print(f"Sampling time: {dt*1e9} ns") backend_defaults = backend.defaults() import numpy as np # unit conversion factors -> all backend properties returned in SI (Hz, sec, etc) GHz = 1.0e9 # Gigahertz MHz = 1.0e6 # Megahertz kHz = 1.0e3 us = 1.0e-6 # Microseconds ns = 1.0e-9 # Nanoseconds # We will find the qubit frequency for the following qubit. qubit = 0 # The sweep will be centered around the estimated qubit frequency. center_frequency_Hz = backend_defaults.qubit_freq_est[qubit] # The default frequency is given in Hz # warning: this will change in a future release print(f"Qubit {qubit} has an estimated frequency of {center_frequency_Hz / GHz} GHz.") # scale factor to remove factors of 10 from the data scale_factor = 1e-14 # We will sweep 40 MHz around the estimated frequency frequency_span_Hz = 40 * MHz # in steps of 1 MHz. frequency_step_Hz = 1 * MHz # We will sweep 20 MHz above and 20 MHz below the estimated frequency frequency_min = center_frequency_Hz - frequency_span_Hz / 2 frequency_max = center_frequency_Hz + frequency_span_Hz / 2 # Construct an np array of the frequencies for our experiment frequencies_GHz = np.arange(frequency_min / GHz, frequency_max / GHz, frequency_step_Hz / GHz) print(f"The sweep will go from {frequency_min / GHz} GHz to {frequency_max / GHz} GHz \ in steps of {frequency_step_Hz / MHz} MHz.") from qiskit import pulse # This is where we access all of our Pulse features! inst_sched_map = backend_defaults.instruction_schedule_map measure = inst_sched_map.get('measure', qubits=[qubit]) x_pulse = inst_sched_map.get('x', qubits=[qubit]) ### Collect the necessary channels drive_chan = pulse.DriveChannel(qubit) meas_chan = pulse.MeasureChannel(qubit) acq_chan = pulse.AcquireChannel(qubit) # Create the base schedule # Start with drive pulse acting on the drive channel schedule = pulse.Schedule(name='Frequency sweep') schedule += x_pulse # The left shift `<<` is special syntax meaning to shift the start time of the schedule by some duration schedule += measure << schedule.duration # Create the frequency settings for the sweep (MUST BE IN HZ) frequencies_Hz = frequencies_GHz*GHz schedule_frequencies = [{drive_chan: freq} for freq in frequencies_Hz] schedule.draw(label=True, scaling=0.8) from qiskit import assemble frequency_sweep_program = assemble(schedule, backend=backend, meas_level=1, meas_return='avg', shots=1024, schedule_los=schedule_frequencies) # RUN the job on a real device #job = backend.run(rabi_experiment_program) #print(job.job_id()) #from qiskit.tools.monitor import job_monitor #job_monitor(job) # OR retreive result from previous run job = backend.retrieve_job('5ef3b081fbc24b001275b03b') frequency_sweep_results = job.result() import matplotlib.pyplot as plt plt.style.use('dark_background') sweep_values = [] for i in range(len(frequency_sweep_results.results)): # Get the results from the ith experiment res = frequency_sweep_results.get_memory(i)*scale_factor # Get the results for `qubit` from this experiment sweep_values.append(res[qubit]) plt.scatter(frequencies_GHz, np.real(sweep_values), color='white') # plot real part of sweep values plt.xlim([min(frequencies_GHz), max(frequencies_GHz)]) plt.xlabel("Frequency [GHz]") plt.ylabel("Measured signal [a.u.]") plt.show() from scipy.optimize import curve_fit def fit_function(x_values, y_values, function, init_params): fitparams, conv = curve_fit(function, x_values, y_values, init_params) y_fit = function(x_values, *fitparams) return fitparams, y_fit fit_params, y_fit = fit_function(frequencies_GHz, np.real(sweep_values), lambda x, A, q_freq, B, C: (A / np.pi) * (B / ((x - q_freq)**2 + B**2)) + C, [5, 4.975, 1, 3] # initial parameters for curve_fit ) plt.scatter(frequencies_GHz, np.real(sweep_values), color='white') plt.plot(frequencies_GHz, y_fit, color='red') plt.xlim([min(frequencies_GHz), max(frequencies_GHz)]) plt.xlabel("Frequency [GHz]") plt.ylabel("Measured Signal [a.u.]") plt.show() # Create the schedules for 0 and 1 schedule_0 = pulse.Schedule(name='0') schedule_0 += measure schedule_1 = pulse.Schedule(name='1') schedule_1 += x_pulse schedule_1 += measure << schedule_1.duration schedule_0.draw() schedule_1.draw() frequency_span_Hz = 320 * kHz frequency_step_Hz = 8 * kHz center_frequency_Hz = backend_defaults.meas_freq_est[qubit] print(f"Qubit {qubit} has an estimated readout frequency of {center_frequency_Hz / GHz} GHz.") frequency_min = center_frequency_Hz - frequency_span_Hz / 2 frequency_max = center_frequency_Hz + frequency_span_Hz / 2 frequencies_GHz = np.arange(frequency_min / GHz, frequency_max / GHz, frequency_step_Hz / GHz) print(f"The sweep will go from {frequency_min / GHz} GHz to {frequency_max / GHz} GHz\ in steps of {frequency_step_Hz / MHz} MHz.") num_shots_per_frequency = 2048 frequencies_Hz = frequencies_GHz*GHz schedule_los = [{meas_chan: freq} for freq in frequencies_Hz] cavity_sweep_0 = assemble(schedule_0, backend=backend, meas_level=1, meas_return='avg', shots=num_shots_per_frequency, schedule_los=schedule_los) cavity_sweep_1 = assemble(schedule_1, backend=backend, meas_level=1, meas_return='avg', shots=num_shots_per_frequency, schedule_los=schedule_los) # RUN the job on a real device #job_0 = backend.run(cavity_sweep_0) #job_monitor(job_0) #job_0.error_message() #job_1 = backend.run(cavity_sweep_1) #job_monitor(job_1) #job_1.error_message() # OR retreive result from previous run job_0 = backend.retrieve_job('5efa5b447c0d6800137fff1c') job_1 = backend.retrieve_job('5efa6b2720eee10013be46b4') cavity_sweep_0_results = job_0.result() cavity_sweep_1_results = job_1.result() scale_factor = 1e-14 sweep_values_0 = [] for i in range(len(cavity_sweep_0_results.results)): res_0 = cavity_sweep_0_results.get_memory(i)*scale_factor sweep_values_0.append(res_0[qubit]) sweep_values_1 = [] for i in range(len(cavity_sweep_1_results.results)): res_1 = cavity_sweep_1_results.get_memory(i)*scale_factor sweep_values_1.append(res_1[qubit]) plotx = frequencies_Hz/kHz ploty_0 = np.abs(sweep_values_0) ploty_1 = np.abs(sweep_values_1) plt.plot(plotx, ploty_0, color='blue', marker='.') # plot real part of sweep values plt.plot(plotx, ploty_1, color='red', marker='.') # plot real part of sweep values plt.legend([r'$\vert0\rangle$', r'$\vert1\rangle$']) plt.grid() plt.xlabel("Frequency [kHz]") plt.ylabel("Measured signal [a.u.]") plt.yscale('log') plt.show()
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import numpy as np # Importing standard Qiskit libraries from qiskit import QuantumCircuit, transpile, assemble, Aer, IBMQ, execute from qiskit.quantum_info import Statevector from qiskit.visualization import plot_bloch_multivector, plot_histogram from qiskit_textbook.problems import dj_problem_oracle def lab1_ex1(): qc = QuantumCircuit(1) # # # FILL YOUR CODE IN HERE # # qc.x(0) return qc state = Statevector.from_instruction(lab1_ex1()) plot_bloch_multivector(state) from qc_grader import grade_lab1_ex1 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex1(lab1_ex1()) def lab1_ex2(): qc = QuantumCircuit(1) # # # FILL YOUR CODE IN HERE # # qc.h(0) return qc state = Statevector.from_instruction(lab1_ex2()) plot_bloch_multivector(state) from qc_grader import grade_lab1_ex2 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex2(lab1_ex2()) def lab1_ex3(): qc = QuantumCircuit(1) # # # FILL YOUR CODE IN HERE # # qc.x(0) qc.h(0) return qc state = Statevector.from_instruction(lab1_ex3()) plot_bloch_multivector(state) from qc_grader import grade_lab1_ex3 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex3(lab1_ex3()) def lab1_ex4(): qc = QuantumCircuit(1) # # # FILL YOUR CODE IN HERE # # qc.h(0) qc.sdg(0) return qc state = Statevector.from_instruction(lab1_ex4()) plot_bloch_multivector(state) from qc_grader import grade_lab1_ex4 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex4(lab1_ex4()) def lab1_ex5(): qc = QuantumCircuit(2,2) # this time, we not only want two qubits, but also two classical bits for the measurement # # # FILL YOUR CODE IN HERE # # qc.h(0) qc.cx(0,1) qc.x(0) return qc qc = lab1_ex5() qc.draw() # we draw the circuit from qc_grader import grade_lab1_ex5 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex5(lab1_ex5()) qc.measure(0, 0) # we perform a measurement on qubit q_0 and store the information on the classical bit c_0 qc.measure(1, 1) # we perform a measurement on qubit q_1 and store the information on the classical bit c_1 backend = Aer.get_backend('qasm_simulator') # we choose the simulator as our backend counts = execute(qc, backend, shots = 1000).result().get_counts() # we run the simulation and get the counts plot_histogram(counts) # let us plot a histogram to see the possible outcomes and corresponding probabilities def lab1_ex6(): # # # FILL YOUR CODE IN HERE # # qc = QuantumCircuit(3,3) qc.h(0) qc.cx(0,1) qc.cx(1,2) qc.y(1) return qc qc = lab1_ex6() qc.draw() # we draw the circuit from qc_grader import grade_lab1_ex6 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex6(lab1_ex6()) oraclenr = 4 # determines the oracle (can range from 1 to 5) oracle = dj_problem_oracle(oraclenr) # gives one out of 5 oracles oracle.name = "DJ-Oracle" def dj_classical(n, input_str): # build a quantum circuit with n qubits and 1 classical readout bit dj_circuit = QuantumCircuit(n+1,1) # Prepare the initial state corresponding to your input bit string for i in range(n): if input_str[i] == '1': dj_circuit.x(i) # append oracle dj_circuit.append(oracle, range(n+1)) # measure the fourth qubit dj_circuit.measure(n,0) return dj_circuit n = 4 # number of qubits input_str = '1111' dj_circuit = dj_classical(n, input_str) dj_circuit.draw() # draw the circuit input_str = '1111' dj_circuit = dj_classical(n, input_str) qasm_sim = Aer.get_backend('qasm_simulator') transpiled_dj_circuit = transpile(dj_circuit, qasm_sim) qobj = assemble(transpiled_dj_circuit, qasm_sim) results = qasm_sim.run(qobj).result() answer = results.get_counts() plot_histogram(answer) def lab1_ex7(): min_nr_inputs = 2 max_nr_inputs = 9 return [min_nr_inputs, max_nr_inputs] from qc_grader import grade_lab1_ex7 # Note that the grading function is expecting a list of two integers grade_lab1_ex7(lab1_ex7()) n=4 def psi_0(n): qc = QuantumCircuit(n+1,n) # Build the state (|00000> - |10000>)/sqrt(2) # # # FILL YOUR CODE IN HERE # # qc.x(4) qc.h(4) return qc dj_circuit = psi_0(n) dj_circuit.draw() def psi_1(n): # obtain the |psi_0> = |00001> state qc = psi_0(n) # create the superposition state |psi_1> # # qc.h(0) qc.h(1) qc.h(2) qc.h(3) # # qc.barrier() return qc dj_circuit = psi_1(n) dj_circuit.draw() def psi_2(oracle,n): # circuit to obtain psi_1 qc = psi_1(n) # append the oracle qc.append(oracle, range(n+1)) return qc dj_circuit = psi_2(oracle, n) dj_circuit.draw() def lab1_ex8(oracle, n): # note that this exercise also depends on the code in the functions psi_0 (In [24]) and psi_1 (In [25]) qc = psi_2(oracle, n) # apply n-fold hadamard gate # # # FILL YOUR CODE IN HERE # # qc.h(0) qc.h(1) qc.h(2) qc.h(3) # add the measurement by connecting qubits to classical bits # # qc.measure(0,0) qc.measure(1,1) qc.measure(2,2) qc.measure(3,3) # # return qc dj_circuit = lab1_ex8(oracle, n) dj_circuit.draw() from qc_grader import grade_lab1_ex8 # Note that the grading function is expecting a quantum circuit with measurements grade_lab1_ex8(lab1_ex8(dj_problem_oracle(4),n)) qasm_sim = Aer.get_backend('qasm_simulator') transpiled_dj_circuit = transpile(dj_circuit, qasm_sim) qobj = assemble(transpiled_dj_circuit) results = qasm_sim.run(qobj).result() answer = results.get_counts() plot_histogram(answer)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import networkx as nx import numpy as np import plotly.graph_objects as go import matplotlib as mpl import pandas as pd from IPython.display import clear_output from plotly.subplots import make_subplots from matplotlib import pyplot as plt from qiskit import Aer from qiskit import QuantumCircuit from qiskit.visualization import plot_state_city from qiskit.algorithms.optimizers import COBYLA, SLSQP, ADAM from time import time from copy import copy from typing import List from qc_grader.graph_util import display_maxcut_widget, QAOA_widget, graphs mpl.rcParams['figure.dpi'] = 300 from qiskit.circuit import Parameter, ParameterVector #Parameters are initialized with a simple string identifier parameter_0 = Parameter('θ[0]') parameter_1 = Parameter('θ[1]') circuit = QuantumCircuit(1) #We can then pass the initialized parameters as the rotation angle argument to the Rx and Ry gates circuit.ry(theta = parameter_0, qubit = 0) circuit.rx(theta = parameter_1, qubit = 0) circuit.draw('mpl') parameter = Parameter('θ') circuit = QuantumCircuit(1) circuit.ry(theta = parameter, qubit = 0) circuit.rx(theta = parameter, qubit = 0) circuit.draw('mpl') #Set the number of layers and qubits n=3 num_layers = 2 #ParameterVectors are initialized with a string identifier and an integer specifying the vector length parameters = ParameterVector('θ', n*(num_layers+1)) circuit = QuantumCircuit(n, n) for layer in range(num_layers): #Appending the parameterized Ry gates using parameters from the vector constructed above for i in range(n): circuit.ry(parameters[n*layer+i], i) circuit.barrier() #Appending the entangling CNOT gates for i in range(n): for j in range(i): circuit.cx(j,i) circuit.barrier() #Appending one additional layer of parameterized Ry gates for i in range(n): circuit.ry(parameters[n*num_layers+i], i) circuit.barrier() circuit.draw('mpl') print(circuit.parameters) #Create parameter dictionary with random values to bind param_dict = {parameter: np.random.random() for parameter in parameters} print(param_dict) #Assign parameters using the assign_parameters method bound_circuit = circuit.assign_parameters(parameters = param_dict) bound_circuit.draw('mpl') new_parameters = ParameterVector('Ψ',9) new_circuit = circuit.assign_parameters(parameters = [k*new_parameters[i] for k in range(9)]) new_circuit.draw('mpl') #Run the circuit with assigned parameters on Aer's statevector simulator simulator = Aer.get_backend('statevector_simulator') result = simulator.run(bound_circuit).result() statevector = result.get_statevector(bound_circuit) plot_state_city(statevector) #The following line produces an error when run because 'circuit' still contains non-assigned parameters #result = simulator.run(circuit).result() for key in graphs.keys(): print(key) graph = nx.Graph() #Add nodes and edges graph.add_nodes_from(np.arange(0,6,1)) edges = [(0,1,2.0),(0,2,3.0),(0,3,2.0),(0,4,4.0),(0,5,1.0),(1,2,4.0),(1,3,1.0),(1,4,1.0),(1,5,3.0),(2,4,2.0),(2,5,3.0),(3,4,5.0),(3,5,1.0)] graph.add_weighted_edges_from(edges) graphs['custom'] = graph #Display widget display_maxcut_widget(graphs['custom']) def maxcut_cost_fn(graph: nx.Graph, bitstring: List[int]) -> float: """ Computes the maxcut cost function value for a given graph and cut represented by some bitstring Args: graph: The graph to compute cut values for bitstring: A list of integer values '0' or '1' specifying a cut of the graph Returns: The value of the cut """ #Get the weight matrix of the graph weight_matrix = nx.adjacency_matrix(graph).toarray() size = weight_matrix.shape[0] value = 0. #INSERT YOUR CODE TO COMPUTE THE CUT VALUE HERE for i in range(size): for j in range(size): value+= weight_matrix[i,j]*bitstring[i]*(1-bitstring[j]) return value def plot_maxcut_histogram(graph: nx.Graph) -> None: """ Plots a bar diagram with the values for all possible cuts of a given graph. Args: graph: The graph to compute cut values for """ num_vars = graph.number_of_nodes() #Create list of bitstrings and corresponding cut values bitstrings = ['{:b}'.format(i).rjust(num_vars, '0')[::-1] for i in range(2**num_vars)] values = [maxcut_cost_fn(graph = graph, bitstring = [int(x) for x in bitstring]) for bitstring in bitstrings] #Sort both lists by largest cut value values, bitstrings = zip(*sorted(zip(values, bitstrings))) #Plot bar diagram bar_plot = go.Bar(x = bitstrings, y = values, marker=dict(color=values, colorscale = 'plasma', colorbar=dict(title='Cut Value'))) fig = go.Figure(data=bar_plot, layout = dict(xaxis=dict(type = 'category'), width = 1500, height = 600)) fig.show() plot_maxcut_histogram(graph = graphs['custom']) from qc_grader import grade_lab2_ex1 bitstring = [1, 0, 1, 1, 0, 0] #DEFINE THE CORRECT MAXCUT BITSTRING HERE # Note that the grading function is expecting a list of integers '0' and '1' grade_lab2_ex1(bitstring) from qiskit_optimization import QuadraticProgram quadratic_program = QuadraticProgram('sample_problem') print(quadratic_program.export_as_lp_string()) quadratic_program.binary_var(name = 'x_0') quadratic_program.integer_var(name = 'x_1') quadratic_program.continuous_var(name = 'x_2', lowerbound = -2.5, upperbound = 1.8) quadratic = [[0,1,2],[3,4,5],[0,1,2]] linear = [10,20,30] quadratic_program.minimize(quadratic = quadratic, linear = linear, constant = -5) print(quadratic_program.export_as_lp_string()) def quadratic_program_from_graph(graph: nx.Graph) -> QuadraticProgram: """Constructs a quadratic program from a given graph for a MaxCut problem instance. Args: graph: Underlying graph of the problem. Returns: QuadraticProgram """ #Get weight matrix of graph weight_matrix = nx.adjacency_matrix(graph) shape = weight_matrix.shape size = shape[0] #Build qubo matrix Q from weight matrix W qubo_matrix = np.zeros((size, size)) qubo_vector = np.zeros(size) for i in range(size): for j in range(size): qubo_matrix[i, j] -= weight_matrix[i, j] for i in range(size): for j in range(size): qubo_vector[i] += weight_matrix[i,j] #INSERT YOUR CODE HERE quadratic_program=QuadraticProgram('sample_problem') for i in range(size): quadratic_program.binary_var(name='x_{}'.format(i)) quadratic_program.maximize(quadratic =qubo_matrix, linear = qubo_vector) return quadratic_program quadratic_program = quadratic_program_from_graph(graphs['custom']) print(quadratic_program.export_as_lp_string()) from qc_grader import grade_lab2_ex2 # Note that the grading function is expecting a quadratic program grade_lab2_ex2(quadratic_program) def qaoa_circuit(qubo: QuadraticProgram, p: int = 1): """ Given a QUBO instance and the number of layers p, constructs the corresponding parameterized QAOA circuit with p layers. Args: qubo: The quadratic program instance p: The number of layers in the QAOA circuit Returns: The parameterized QAOA circuit """ size = len(qubo.variables) qubo_matrix = qubo.objective.quadratic.to_array(symmetric=True) qubo_linearity = qubo.objective.linear.to_array() #Prepare the quantum and classical registers qaoa_circuit = QuantumCircuit(size,size) #Apply the initial layer of Hadamard gates to all qubits qaoa_circuit.h(range(size)) #Create the parameters to be used in the circuit gammas = ParameterVector('gamma', p) betas = ParameterVector('beta', p) #Outer loop to create each layer for i in range(p): #Apply R_Z rotational gates from cost layer #INSERT YOUR CODE HERE for j in range(size): qubo_matrix_sum_of_col = 0 for k in range(size): qubo_matrix_sum_of_col+= qubo_matrix[j][k] qaoa_circuit.rz(gammas[i]*(qubo_linearity[j]+qubo_matrix_sum_of_col),j) #Apply R_ZZ rotational gates for entangled qubit rotations from cost layer #INSERT YOUR CODE HERE for j in range(size): for k in range(size): if j!=k: qaoa_circuit.rzz(gammas[i]*qubo_matrix[j][k]*0.5,j,k) # Apply single qubit X - rotations with angle 2*beta_i to all qubits #INSERT YOUR CODE HERE for j in range(size): qaoa_circuit.rx(2*betas[i],j) return qaoa_circuit quadratic_program = quadratic_program_from_graph(graphs['custom']) custom_circuit = qaoa_circuit(qubo = quadratic_program) test = custom_circuit.assign_parameters(parameters=[1.0]*len(custom_circuit.parameters)) from qc_grader import grade_lab2_ex3 # Note that the grading function is expecting a quantum circuit grade_lab2_ex3(test) from qiskit.algorithms import QAOA from qiskit_optimization.algorithms import MinimumEigenOptimizer backend = Aer.get_backend('statevector_simulator') qaoa = QAOA(optimizer = ADAM(), quantum_instance = backend, reps=1, initial_point = [0.1,0.1]) eigen_optimizer = MinimumEigenOptimizer(min_eigen_solver = qaoa) quadratic_program = quadratic_program_from_graph(graphs['custom']) result = eigen_optimizer.solve(quadratic_program) print(result) def plot_samples(samples): """ Plots a bar diagram for the samples of a quantum algorithm Args: samples """ #Sort samples by probability samples = sorted(samples, key = lambda x: x.probability) #Get list of probabilities, function values and bitstrings probabilities = [sample.probability for sample in samples] values = [sample.fval for sample in samples] bitstrings = [''.join([str(int(i)) for i in sample.x]) for sample in samples] #Plot bar diagram sample_plot = go.Bar(x = bitstrings, y = probabilities, marker=dict(color=values, colorscale = 'plasma',colorbar=dict(title='Function Value'))) fig = go.Figure( data=sample_plot, layout = dict( xaxis=dict( type = 'category' ) ) ) fig.show() plot_samples(result.samples) graph_name = 'custom' quadratic_program = quadratic_program_from_graph(graph=graphs[graph_name]) trajectory={'beta_0':[], 'gamma_0':[], 'energy':[]} offset = 1/4*quadratic_program.objective.quadratic.to_array(symmetric = True).sum() + 1/2*quadratic_program.objective.linear.to_array().sum() def callback(eval_count, params, mean, std_dev): trajectory['beta_0'].append(params[1]) trajectory['gamma_0'].append(params[0]) trajectory['energy'].append(-mean + offset) optimizers = { 'cobyla': COBYLA(), 'slsqp': SLSQP(), 'adam': ADAM() } qaoa = QAOA(optimizer = optimizers['cobyla'], quantum_instance = backend, reps=1, initial_point = [6.2,1.8],callback = callback) eigen_optimizer = MinimumEigenOptimizer(min_eigen_solver = qaoa) result = eigen_optimizer.solve(quadratic_program) fig = QAOA_widget(landscape_file=f'./resources/energy_landscapes/{graph_name}.csv', trajectory = trajectory, samples = result.samples) fig.show() graph_name = 'custom' quadratic_program = quadratic_program_from_graph(graphs[graph_name]) #Create callback to record total number of evaluations max_evals = 0 def callback(eval_count, params, mean, std_dev): global max_evals max_evals = eval_count #Create empty lists to track values energies = [] runtimes = [] num_evals=[] #Run QAOA for different values of p for p in range(1,10): print(f'Evaluating for p = {p}...') qaoa = QAOA(optimizer = optimizers['cobyla'], quantum_instance = backend, reps=p, callback=callback) eigen_optimizer = MinimumEigenOptimizer(min_eigen_solver = qaoa) start = time() result = eigen_optimizer.solve(quadratic_program) runtimes.append(time()-start) num_evals.append(max_evals) #Calculate energy of final state from samples avg_value = 0. for sample in result.samples: avg_value += sample.probability*sample.fval energies.append(avg_value) #Create and display plots energy_plot = go.Scatter(x = list(range(1,10)), y =energies, marker=dict(color=energies, colorscale = 'plasma')) runtime_plot = go.Scatter(x = list(range(1,10)), y =runtimes, marker=dict(color=runtimes, colorscale = 'plasma')) num_evals_plot = go.Scatter(x = list(range(1,10)), y =num_evals, marker=dict(color=num_evals, colorscale = 'plasma')) fig = make_subplots(rows = 1, cols = 3, subplot_titles = ['Energy value', 'Runtime', 'Number of evaluations']) fig.update_layout(width=1800,height=600, showlegend=False) fig.add_trace(energy_plot, row=1, col=1) fig.add_trace(runtime_plot, row=1, col=2) fig.add_trace(num_evals_plot, row=1, col=3) clear_output() fig.show() def plot_qaoa_energy_landscape(graph: nx.Graph, cvar: float = None): num_shots = 1000 seed = 42 simulator = Aer.get_backend('qasm_simulator') simulator.set_options(seed_simulator = 42) #Generate circuit circuit = qaoa_circuit(qubo = quadratic_program_from_graph(graph), p=1) circuit.measure(range(graph.number_of_nodes()),range(graph.number_of_nodes())) #Create dictionary with precomputed cut values for all bitstrings cut_values = {} size = graph.number_of_nodes() for i in range(2**size): bitstr = '{:b}'.format(i).rjust(size, '0')[::-1] x = [int(bit) for bit in bitstr] cut_values[bitstr] = maxcut_cost_fn(graph, x) #Perform grid search over all parameters data_points = [] max_energy = None for beta in np.linspace(0,np.pi, 50): for gamma in np.linspace(0, 4*np.pi, 50): bound_circuit = circuit.assign_parameters([beta, gamma]) result = simulator.run(bound_circuit, shots = num_shots).result() statevector = result.get_counts(bound_circuit) energy = 0 measured_cuts = [] for bitstring, count in statevector.items(): measured_cuts = measured_cuts + [cut_values[bitstring]]*count if cvar is None: #Calculate the mean of all cut values energy = sum(measured_cuts)/num_shots else: #raise NotImplementedError() #INSERT YOUR CODE HERE measured_cuts = sorted(measured_cuts, reverse = True) for w in range(int(cvar*num_shots)): energy += measured_cuts[w]/int((cvar*num_shots)) #Update optimal parameters if max_energy is None or energy > max_energy: max_energy = energy optimum = {'beta': beta, 'gamma': gamma, 'energy': energy} #Update data data_points.append({'beta': beta, 'gamma': gamma, 'energy': energy}) #Create and display surface plot from data_points df = pd.DataFrame(data_points) df = df.pivot(index='beta', columns='gamma', values='energy') matrix = df.to_numpy() beta_values = df.index.tolist() gamma_values = df.columns.tolist() surface_plot = go.Surface( x=gamma_values, y=beta_values, z=matrix, coloraxis = 'coloraxis' ) fig = go.Figure(data = surface_plot) fig.show() #Return optimum return optimum graph = graphs['custom'] optimal_parameters = plot_qaoa_energy_landscape(graph = graph) print('Optimal parameters:') print(optimal_parameters) optimal_parameters = plot_qaoa_energy_landscape(graph = graph, cvar = 0.2) print(optimal_parameters) from qc_grader import grade_lab2_ex4 # Note that the grading function is expecting a python dictionary # with the entries 'beta', 'gamma' and 'energy' grade_lab2_ex4(optimal_parameters)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
# General Imports import numpy as np # Visualisation Imports import matplotlib.pyplot as plt # Scikit Imports from sklearn import datasets from sklearn.model_selection import train_test_split from sklearn.svm import SVC from sklearn.decomposition import PCA from sklearn.preprocessing import StandardScaler, MinMaxScaler # Qiskit Imports from qiskit import Aer, execute from qiskit.circuit import QuantumCircuit, Parameter, ParameterVector from qiskit.circuit.library import PauliFeatureMap, ZFeatureMap, ZZFeatureMap from qiskit.circuit.library import TwoLocal, NLocal, RealAmplitudes, EfficientSU2 from qiskit.circuit.library import HGate, RXGate, RYGate, RZGate, CXGate, CRXGate, CRZGate from qiskit_machine_learning.kernels import QuantumKernel # Load digits dataset digits = datasets.load_digits(n_class=2) # Plot example '0' and '1' fig, axs = plt.subplots(1, 2, figsize=(6,3)) axs[0].set_axis_off() axs[0].imshow(digits.images[0], cmap=plt.cm.gray_r, interpolation='nearest') axs[1].set_axis_off() axs[1].imshow(digits.images[1], cmap=plt.cm.gray_r, interpolation='nearest') plt.show() # Split dataset sample_train, sample_test, label_train, label_test = train_test_split( digits.data, digits.target, test_size=0.2, random_state=22) # Reduce dimensions n_dim = 4 pca = PCA(n_components=n_dim).fit(sample_train) sample_train = pca.transform(sample_train) sample_test = pca.transform(sample_test) # Normalise std_scale = StandardScaler().fit(sample_train) sample_train = std_scale.transform(sample_train) sample_test = std_scale.transform(sample_test) # Scale samples = np.append(sample_train, sample_test, axis=0) minmax_scale = MinMaxScaler((-1, 1)).fit(samples) sample_train = minmax_scale.transform(sample_train) sample_test = minmax_scale.transform(sample_test) # Select train_size = 100 sample_train = sample_train[:train_size] label_train = label_train[:train_size] test_size = 20 sample_test = sample_test[:test_size] label_test = label_test[:test_size] print(sample_train[0], label_train[0]) print(sample_test[0], label_test[0]) # 3 features, depth 2 map_z = ZFeatureMap(feature_dimension=3, reps=2) map_z.draw('mpl') # 3 features, depth 1 map_zz = ZZFeatureMap(feature_dimension=3, reps=1) map_zz.draw('mpl') # 3 features, depth 1, linear entanglement map_zz = ZZFeatureMap(feature_dimension=3, reps=1, entanglement='linear') map_zz.draw('mpl') # 3 features, depth 1, circular entanglement map_zz = ZZFeatureMap(feature_dimension=3, reps=1, entanglement='circular') map_zz.draw('mpl') # 3 features, depth 1 map_pauli = PauliFeatureMap(feature_dimension=3, reps=1, paulis = ['X', 'Y', 'ZZ']) map_pauli.draw('mpl') def custom_data_map_func(x): coeff = x[0] if len(x) == 1 else reduce(lambda m, n: m * n, np.sin(np.pi - x)) return coeff map_customdatamap = PauliFeatureMap(feature_dimension=3, reps=1, paulis=['Z','ZZ'], data_map_func=custom_data_map_func) #map_customdatamap.draw() # qiskit isn't able to draw the circuit with np.sin in the custom data map twolocal = TwoLocal(num_qubits=3, reps=2, rotation_blocks=['ry','rz'], entanglement_blocks='cx', entanglement='circular', insert_barriers=True) twolocal.draw('mpl') twolocaln = NLocal(num_qubits=3, reps=2, rotation_blocks=[RYGate(Parameter('a')), RZGate(Parameter('a'))], entanglement_blocks=CXGate(), entanglement='circular', insert_barriers=True) twolocaln.draw('mpl') # rotation block: rot = QuantumCircuit(2) params = ParameterVector('r', 2) rot.ry(params[0], 0) rot.rz(params[1], 1) # entanglement block: ent = QuantumCircuit(4) params = ParameterVector('e', 3) ent.crx(params[0], 0, 1) ent.crx(params[1], 1, 2) ent.crx(params[2], 2, 3) nlocal = NLocal(num_qubits=6, rotation_blocks=rot, entanglement_blocks=ent, entanglement='linear', insert_barriers=True) nlocal.draw('mpl') qubits = 3 repeats = 2 x = ParameterVector('x', length=qubits) var_custom = QuantumCircuit(qubits) for _ in range(repeats): for i in range(qubits): var_custom.rx(x[i], i) for i in range(qubits): for j in range(i + 1, qubits): var_custom.cx(i, j) var_custom.p(x[i] * x[j], j) var_custom.cx(i, j) var_custom.barrier() var_custom.draw('mpl') print(sample_train[0]) encode_map = ZZFeatureMap(feature_dimension=4, reps=2, entanglement='linear', insert_barriers=True) encode_circuit = encode_map.bind_parameters(sample_train[0]) encode_circuit.draw(output='mpl') x = [-0.1,0.2] # YOUR CODE HERE encode_map_x =ZZFeatureMap(feature_dimension=2, reps=4) ex1_circuit =encode_map_x.bind_parameters(x) ex1_circuit.draw(output='mpl') from qc_grader import grade_lab3_ex1 # Note that the grading function is expecting a quantum circuit grade_lab3_ex1(ex1_circuit) zz_map = ZZFeatureMap(feature_dimension=4, reps=2, entanglement='linear', insert_barriers=True) zz_kernel = QuantumKernel(feature_map=zz_map, quantum_instance=Aer.get_backend('statevector_simulator')) print(sample_train[0]) print(sample_train[1]) zz_circuit = zz_kernel.construct_circuit(sample_train[0], sample_train[1]) zz_circuit.decompose().decompose().draw(output='mpl') backend = Aer.get_backend('qasm_simulator') job = execute(zz_circuit, backend, shots=8192, seed_simulator=1024, seed_transpiler=1024) counts = job.result().get_counts(zz_circuit) counts['0000']/sum(counts.values()) matrix_train = zz_kernel.evaluate(x_vec=sample_train) matrix_test = zz_kernel.evaluate(x_vec=sample_test, y_vec=sample_train) fig, axs = plt.subplots(1, 2, figsize=(10, 5)) axs[0].imshow(np.asmatrix(matrix_train), interpolation='nearest', origin='upper', cmap='Blues') axs[0].set_title("training kernel matrix") axs[1].imshow(np.asmatrix(matrix_test), interpolation='nearest', origin='upper', cmap='Reds') axs[1].set_title("testing kernel matrix") plt.show() x = [-0.1,0.2] y = [0.4,-0.6] # YOUR CODE HERE encode_map_x2 = ZZFeatureMap(feature_dimension=2, reps=4) zz_kernel_x2 =QuantumKernel(feature_map=encode_map_x2,quantum_instance=Aer.get_backend('statevector_simulator')) zz_circuit_x2 =zz_kernel_x2.construct_circuit(x,y) backend =Aer.get_backend('qasm_simulator') job = execute(zz_circuit_x2,backend,shots=8192, seed_simulator=1024, seed_transpiler=1024) counts_x2 = job.result().get_counts(zz_circuit_x2) amplitude= counts_x2['00']/sum(counts_x2.values()) from qc_grader import grade_lab3_ex2 # Note that the grading function is expecting a floating point number grade_lab3_ex2(amplitude) zzpc_svc = SVC(kernel='precomputed') zzpc_svc.fit(matrix_train, label_train) zzpc_score = zzpc_svc.score(matrix_test, label_test) print(f'Precomputed kernel classification test score: {zzpc_score}') zzcb_svc = SVC(kernel=zz_kernel.evaluate) zzcb_svc.fit(sample_train, label_train) zzcb_score = zzcb_svc.score(sample_test, label_test) print(f'Callable kernel classification test score: {zzcb_score}') classical_kernels = ['linear', 'poly', 'rbf', 'sigmoid'] for kernel in classical_kernels: classical_svc = SVC(kernel=kernel) classical_svc.fit(sample_train, label_train) classical_score = classical_svc.score(sample_test, label_test) print('%s kernel classification test score: %0.2f' % (kernel, classical_score))
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit.circuit.library import RealAmplitudes ansatz = RealAmplitudes(num_qubits=2, reps=1, entanglement='linear') ansatz.draw('mpl', style='iqx') from qiskit.opflow import Z, I hamiltonian = Z ^ Z from qiskit.opflow import StateFn expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(ansatz) import numpy as np point = np.random.random(ansatz.num_parameters) index = 2 from qiskit import Aer from qiskit.utils import QuantumInstance backend = Aer.get_backend('qasm_simulator') q_instance = QuantumInstance(backend, shots = 8192, seed_simulator = 2718, seed_transpiler = 2718) from qiskit.circuit import QuantumCircuit from qiskit.opflow import Z, X H = X ^ X U = QuantumCircuit(2) U.h(0) U.cx(0, 1) # YOUR CODE HERE expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(U) matmult_result =expectation.eval() from qc_grader import grade_lab4_ex1 # Note that the grading function is expecting a complex number grade_lab4_ex1(matmult_result) from qiskit.opflow import CircuitSampler, PauliExpectation sampler = CircuitSampler(q_instance) # YOUR CODE HERE sampler = CircuitSampler(q_instance) # q_instance is the QuantumInstance from the beginning of the notebook expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(U) in_pauli_basis = PauliExpectation().convert(expectation) shots_result = sampler.convert(in_pauli_basis).eval() from qc_grader import grade_lab4_ex2 # Note that the grading function is expecting a complex number grade_lab4_ex2(shots_result) from qiskit.opflow import PauliExpectation, CircuitSampler expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(ansatz) in_pauli_basis = PauliExpectation().convert(expectation) sampler = CircuitSampler(q_instance) def evaluate_expectation(x): value_dict = dict(zip(ansatz.parameters, x)) result = sampler.convert(in_pauli_basis, params=value_dict).eval() return np.real(result) eps = 0.2 e_i = np.identity(point.size)[:, index] # identity vector with a 1 at index ``index``, otherwise 0 plus = point + eps * e_i minus = point - eps * e_i finite_difference = (evaluate_expectation(plus) - evaluate_expectation(minus)) / (2 * eps) print(finite_difference) from qiskit.opflow import Gradient expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(ansatz) shifter = Gradient('fin_diff', analytic=False, epsilon=eps) grad = shifter.convert(expectation, params=ansatz.parameters[index]) print(grad) value_dict = dict(zip(ansatz.parameters, point)) sampler.convert(grad, value_dict).eval().real eps = np.pi / 2 e_i = np.identity(point.size)[:, index] # identity vector with a 1 at index ``index``, otherwise 0 plus = point + eps * e_i minus = point - eps * e_i finite_difference = (evaluate_expectation(plus) - evaluate_expectation(minus)) / 2 print(finite_difference) expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(ansatz) shifter = Gradient() # parameter-shift rule is the default grad = shifter.convert(expectation, params=ansatz.parameters[index]) sampler.convert(grad, value_dict).eval().real expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(ansatz) shifter = Gradient('lin_comb') # parameter-shift rule is the default grad = shifter.convert(expectation, params=ansatz.parameters[index]) sampler.convert(grad, value_dict).eval().real # initial_point = np.random.random(ansatz.num_parameters) initial_point = np.array([0.43253681, 0.09507794, 0.42805949, 0.34210341]) expectation = StateFn(hamiltonian, is_measurement=True).compose(StateFn(ansatz)) gradient = Gradient().convert(expectation) gradient_in_pauli_basis = PauliExpectation().convert(gradient) sampler = CircuitSampler(q_instance) def evaluate_gradient(x): value_dict = dict(zip(ansatz.parameters, x)) result = sampler.convert(gradient_in_pauli_basis, params=value_dict).eval() # add parameters in here! return np.real(result) # Note: The GradientDescent class will be released with Qiskit 0.28.0 and can then be imported as: # from qiskit.algorithms.optimizers import GradientDescent from qc_grader.gradient_descent import GradientDescent gd_loss = [] def gd_callback(nfevs, x, fx, stepsize): gd_loss.append(fx) gd = GradientDescent(maxiter=300, learning_rate=0.01, callback=gd_callback) x_opt, fx_opt, nfevs = gd.optimize(initial_point.size, # number of parameters evaluate_expectation, # function to minimize gradient_function=evaluate_gradient, # function to evaluate the gradient initial_point=initial_point) # initial point import matplotlib import matplotlib.pyplot as plt matplotlib.rcParams['font.size'] = 14 plt.figure(figsize=(12, 6)) plt.plot(gd_loss, label='vanilla gradient descent') plt.axhline(-1, ls='--', c='tab:red', label='target') plt.ylabel('loss') plt.xlabel('iterations') plt.legend(); from qiskit.opflow import NaturalGradient expectation = StateFn(hamiltonian, is_measurement=True).compose(StateFn(ansatz)) natural_gradient = NaturalGradient(regularization='ridge').convert(expectation) natural_gradient_in_pauli_basis = PauliExpectation().convert(natural_gradient) sampler = CircuitSampler(q_instance, caching="all") def evaluate_natural_gradient(x): value_dict = dict(zip(ansatz.parameters, x)) result = sampler.convert(natural_gradient, params=value_dict).eval() return np.real(result) print('Vanilla gradient:', evaluate_gradient(initial_point)) print('Natural gradient:', evaluate_natural_gradient(initial_point)) qng_loss = [] def qng_callback(nfevs, x, fx, stepsize): qng_loss.append(fx) qng = GradientDescent(maxiter=300, learning_rate=0.01, callback=qng_callback) x_opt, fx_opt, nfevs = qng.optimize(initial_point.size, evaluate_expectation, gradient_function=evaluate_natural_gradient, initial_point=initial_point) def plot_loss(): plt.figure(figsize=(12, 6)) plt.plot(gd_loss, 'tab:blue', label='vanilla gradient descent') plt.plot(qng_loss, 'tab:green', label='quantum natural gradient') plt.axhline(-1, c='tab:red', ls='--', label='target') plt.ylabel('loss') plt.xlabel('iterations') plt.legend() plot_loss() from qc_grader.spsa import SPSA spsa_loss = [] def spsa_callback(nfev, x, fx, stepsize, accepted): spsa_loss.append(fx) spsa = SPSA(maxiter=300, learning_rate=0.01, perturbation=0.01, callback=spsa_callback) x_opt, fx_opt, nfevs = spsa.optimize(initial_point.size, evaluate_expectation, initial_point=initial_point) def plot_loss(): plt.figure(figsize=(12, 6)) plt.plot(gd_loss, 'tab:blue', label='vanilla gradient descent') plt.plot(qng_loss, 'tab:green', label='quantum natural gradient') plt.plot(spsa_loss, 'tab:blue', ls='--', label='SPSA') plt.axhline(-1, c='tab:red', ls='--', label='target') plt.ylabel('loss') plt.xlabel('iterations') plt.legend() plot_loss() # Note: The QNSPSA class will be released with Qiskit 0.28.0 and can then be imported as: # from qiskit.algorithms.optimizers import QNSPSA from qc_grader.qnspsa import QNSPSA qnspsa_loss = [] def qnspsa_callback(nfev, x, fx, stepsize, accepted): qnspsa_loss.append(fx) fidelity = QNSPSA.get_fidelity(ansatz, q_instance, expectation=PauliExpectation()) qnspsa = QNSPSA(fidelity, maxiter=300, learning_rate=0.01, perturbation=0.01, callback=qnspsa_callback) x_opt, fx_opt, nfevs = qnspsa.optimize(initial_point.size, evaluate_expectation, initial_point=initial_point) def plot_loss(): plt.figure(figsize=(12, 6)) plt.plot(gd_loss, 'tab:blue', label='vanilla gradient descent') plt.plot(qng_loss, 'tab:green', label='quantum natural gradient') plt.plot(spsa_loss, 'tab:blue', ls='--', label='SPSA') plt.plot(qnspsa_loss, 'tab:green', ls='--', label='QN-SPSA') plt.axhline(-1, c='tab:red', ls='--', label='target') plt.ylabel('loss') plt.xlabel('iterations') plt.legend() plot_loss() autospsa_loss = [] def autospsa_callback(nfev, x, fx, stepsize, accepted): autospsa_loss.append(fx) autospsa = SPSA(maxiter=300, learning_rate=None, perturbation=None, callback=autospsa_callback) x_opt, fx_opt, nfevs = autospsa.optimize(initial_point.size, evaluate_expectation, initial_point=initial_point) def plot_loss(): plt.figure(figsize=(12, 6)) plt.plot(gd_loss, 'tab:blue', label='vanilla gradient descent') plt.plot(qng_loss, 'tab:green', label='quantum natural gradient') plt.plot(spsa_loss, 'tab:blue', ls='--', label='SPSA') plt.plot(qnspsa_loss, 'tab:green', ls='--', label='QN-SPSA') plt.plot(autospsa_loss, 'tab:red', label='Powerlaw SPSA') plt.axhline(-1, c='tab:red', ls='--', label='target') plt.ylabel('loss') plt.xlabel('iterations') plt.legend() plot_loss() H_tfi = -(Z^Z^I)-(I^Z^Z)-(X^I^I)-(I^X^I)-(I^I^X) from qc_grader import grade_lab4_ex3 # Note that the grading function is expecting a Hamiltonian grade_lab4_ex3(H_tfi) from qiskit.circuit.library import EfficientSU2 efficient_su2 = EfficientSU2(3, entanglement="linear", reps=2) tfi_sampler = CircuitSampler(q_instance) def evaluate_tfi(parameters): exp = StateFn(H_tfi, is_measurement=True).compose(StateFn(efficient_su2)) value_dict = dict(zip(efficient_su2.parameters, parameters)) result = tfi_sampler.convert(PauliExpectation().convert(exp), params=value_dict).eval() return np.real(result) # target energy tfi_target = -3.4939592074349326 # initial point for reproducibility tfi_init = np.array([0.95667807, 0.06192812, 0.47615196, 0.83809827, 0.89022282, 0.27140831, 0.9540853 , 0.41374024, 0.92595507, 0.76150126, 0.8701938 , 0.05096063, 0.25476016, 0.71807858, 0.85661325, 0.48311132, 0.43623886, 0.6371297 ]) tfi_result = SPSA(maxiter=300, learning_rate=None, perturbation=None) tfi_result = tfi_result.optimize(tfi_init.size, evaluate_tfi, initial_point=tfi_init) tfi_minimum = tfi_result[1] print("Error:", np.abs(tfi_result[1] - tfi_target)) from qc_grader import grade_lab4_ex4 # Note that the grading function is expecting a floating point number grade_lab4_ex4(tfi_minimum) from qiskit_machine_learning.datasets import ad_hoc_data training_features, training_labels, test_features, test_labels = ad_hoc_data( training_size=20, test_size=10, n=2, one_hot=False, gap=0.5 ) # the training labels are in {0, 1} but we'll use {-1, 1} as class labels! training_labels = 2 * training_labels - 1 test_labels = 2 * test_labels - 1 def plot_sampled_data(): from matplotlib.patches import Patch from matplotlib.lines import Line2D import matplotlib.pyplot as plt plt.figure(figsize=(12,6)) for feature, label in zip(training_features, training_labels): marker = 'o' color = 'tab:green' if label == -1 else 'tab:blue' plt.scatter(feature[0], feature[1], marker=marker, s=100, color=color) for feature, label in zip(test_features, test_labels): marker = 's' plt.scatter(feature[0], feature[1], marker=marker, s=100, facecolor='none', edgecolor='k') legend_elements = [ Line2D([0], [0], marker='o', c='w', mfc='tab:green', label='A', ms=15), Line2D([0], [0], marker='o', c='w', mfc='tab:blue', label='B', ms=15), Line2D([0], [0], marker='s', c='w', mfc='none', mec='k', label='test features', ms=10) ] plt.legend(handles=legend_elements, bbox_to_anchor=(1, 0.6)) plt.title('Training & test data') plt.xlabel('$x$') plt.ylabel('$y$') plot_sampled_data() from qiskit.circuit.library import ZZFeatureMap dim = 2 feature_map = ZZFeatureMap(dim, reps=1) # let's keep it simple! feature_map.draw('mpl', style='iqx') ansatz = RealAmplitudes(num_qubits=dim, entanglement='linear', reps=1) # also simple here! ansatz.draw('mpl', style='iqx') circuit = feature_map.compose(ansatz) circuit.draw('mpl', style='iqx') hamiltonian = Z ^ Z # global Z operators gd_qnn_loss = [] def gd_qnn_callback(*args): gd_qnn_loss.append(args[2]) gd = GradientDescent(maxiter=100, learning_rate=0.01, callback=gd_qnn_callback) from qiskit_machine_learning.neural_networks import OpflowQNN qnn_expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(circuit) qnn = OpflowQNN(qnn_expectation, input_params=list(feature_map.parameters), weight_params=list(ansatz.parameters), exp_val=PauliExpectation(), gradient=Gradient(), # <-- Parameter-Shift gradients quantum_instance=q_instance) from qiskit_machine_learning.algorithms import NeuralNetworkClassifier #initial_point = np.array([0.2, 0.1, 0.3, 0.4]) classifier = NeuralNetworkClassifier(qnn, optimizer=gd) classifier.fit(training_features, training_labels); predicted = classifier.predict(test_features) def plot_predicted(): from matplotlib.lines import Line2D plt.figure(figsize=(12, 6)) for feature, label in zip(training_features, training_labels): marker = 'o' color = 'tab:green' if label == -1 else 'tab:blue' plt.scatter(feature[0], feature[1], marker=marker, s=100, color=color) for feature, label, pred in zip(test_features, test_labels, predicted): marker = 's' color = 'tab:green' if pred == -1 else 'tab:blue' if label != pred: # mark wrongly classified plt.scatter(feature[0], feature[1], marker='o', s=500, linewidths=2.5, facecolor='none', edgecolor='tab:red') plt.scatter(feature[0], feature[1], marker=marker, s=100, color=color) legend_elements = [ Line2D([0], [0], marker='o', c='w', mfc='tab:green', label='A', ms=15), Line2D([0], [0], marker='o', c='w', mfc='tab:blue', label='B', ms=15), Line2D([0], [0], marker='s', c='w', mfc='tab:green', label='predict A', ms=10), Line2D([0], [0], marker='s', c='w', mfc='tab:blue', label='predict B', ms=10), Line2D([0], [0], marker='o', c='w', mfc='none', mec='tab:red', label='wrongly classified', mew=2, ms=15) ] plt.legend(handles=legend_elements, bbox_to_anchor=(1, 0.7)) plt.title('Training & test data') plt.xlabel('$x$') plt.ylabel('$y$') plot_predicted() qng_qnn_loss = [] def qng_qnn_callback(*args): qng_qnn_loss.append(args[2]) gd = GradientDescent(maxiter=100, learning_rate=0.01, callback=qng_qnn_callback) qnn = OpflowQNN(qnn_expectation, input_params=list(feature_map.parameters), weight_params=list(ansatz.parameters), gradient=NaturalGradient(regularization='ridge'), # <-- using Natural Gradients! quantum_instance=q_instance) classifier = NeuralNetworkClassifier(qnn, optimizer=gd)#, initial_point=initial_point) classifier.fit(training_features, training_labels); def plot_losses(): plt.figure(figsize=(12, 6)) plt.plot(gd_qnn_loss, 'tab:blue', marker='o', label='vanilla gradients') plt.plot(qng_qnn_loss, 'tab:green', marker='o', label='natural gradients') plt.xlabel('iterations') plt.ylabel('loss') plt.legend(loc='best') plot_losses() from qiskit.opflow import I def sample_gradients(num_qubits, reps, local=False): """Sample the gradient of our model for ``num_qubits`` qubits and ``reps`` repetitions. We sample 100 times for random parameters and compute the gradient of the first RY rotation gate. """ index = num_qubits - 1 # you can also exchange this for a local operator and observe the same! if local: operator = Z ^ Z ^ (I ^ (num_qubits - 2)) else: operator = Z ^ num_qubits # real amplitudes ansatz ansatz = RealAmplitudes(num_qubits, entanglement='linear', reps=reps) # construct Gradient we want to evaluate for different values expectation = StateFn(operator, is_measurement=True).compose(StateFn(ansatz)) grad = Gradient().convert(expectation, params=ansatz.parameters[index]) # evaluate for 100 different, random parameter values num_points = 100 grads = [] for _ in range(num_points): # points are uniformly chosen from [0, pi] point = np.random.uniform(0, np.pi, ansatz.num_parameters) value_dict = dict(zip(ansatz.parameters, point)) grads.append(sampler.convert(grad, value_dict).eval()) return grads num_qubits = list(range(2, 13)) reps = num_qubits # number of layers = numbers of qubits gradients = [sample_gradients(n, r) for n, r in zip(num_qubits, reps)] fit = np.polyfit(num_qubits, np.log(np.var(gradients, axis=1)), deg=1) x = np.linspace(num_qubits[0], num_qubits[-1], 200) plt.figure(figsize=(12, 6)) plt.semilogy(num_qubits, np.var(gradients, axis=1), 'o-', label='measured variance') plt.semilogy(x, np.exp(fit[0] * x + fit[1]), 'r--', label=f'exponential fit w/ {fit[0]:.2f}') plt.xlabel('number of qubits') plt.ylabel(r'$\mathrm{Var}[\partial_{\theta 1} \langle E(\theta) \rangle]$') plt.legend(loc='best'); from qiskit.opflow import NaturalGradient def sample_natural_gradients(num_qubits, reps): index = num_qubits - 1 operator = Z ^ num_qubits ansatz = RealAmplitudes(num_qubits, entanglement='linear', reps=reps) expectation = StateFn(operator, is_measurement=True).compose(StateFn(ansatz)) grad = # TODO: ``grad`` should be the natural gradient for the parameter at index ``index``. # Hint: Check the ``sample_gradients`` function, this one is almost the same. grad = NaturalGradient().convert(expectation, params=ansatz.parameters[index]) num_points = 100 grads = [] for _ in range(num_points): point = np.random.uniform(0, np.pi, ansatz.num_parameters) value_dict = dict(zip(ansatz.parameters, point)) grads.append(sampler.convert(grad, value_dict).eval()) return grads num_qubits = list(range(2, 13)) reps = num_qubits # number of layers = numbers of qubits natural_gradients = [sample_natural_gradients(n, r) for n, r in zip(num_qubits, reps)] fit = np.polyfit(num_qubits, np.log(np.var(natural_gradients, axis=1)), deg=1) x = np.linspace(num_qubits[0], num_qubits[-1], 200) plt.figure(figsize=(12, 6)) plt.semilogy(num_qubits, np.var(gradients, axis=1), 'o-', label='vanilla gradients') plt.semilogy(num_qubits, np.var(natural_gradients, axis=1), 's-', label='natural gradients') plt.semilogy(x, np.exp(fit[0] * x + fit[1]), 'r--', label=f'exponential fit w/ {float(fit[0]):.2f}') plt.xlabel('number of qubits') plt.ylabel(r'$\mathrm{Var}[\partial_{\theta 1} \langle E(\theta) \rangle]$') plt.legend(loc='best'); num_qubits = list(range(2, 13)) fixed_depth_global_gradients = [sample_gradients(n, 1) for n in num_qubits] fit = np.polyfit(num_qubits, np.log(np.var(fixed_depth_global_gradients, axis=1)), deg=1) x = np.linspace(num_qubits[0], num_qubits[-1], 200) plt.figure(figsize=(12, 6)) plt.semilogy(num_qubits, np.var(gradients, axis=1), 'o-', label='global cost, linear depth') plt.semilogy(num_qubits, np.var(fixed_depth_global_gradients, axis=1), 'o-', label='global cost, constant depth') plt.semilogy(x, np.exp(fit[0] * x + fit[1]), 'r--', label=f'exponential fit w/ {fit[0]:.2f}') plt.xlabel('number of qubits') plt.ylabel(r'$\mathrm{Var}[\partial_{\theta 1} \langle E(\theta) \rangle]$') plt.legend(loc='best'); num_qubits = list(range(2, 13)) linear_depth_local_gradients = [sample_gradients(n, n, local=True) for n in num_qubits] fit = np.polyfit(num_qubits, np.log(np.var(linear_depth_local_gradients, axis=1)), deg=1) x = np.linspace(num_qubits[0], num_qubits[-1], 200) plt.figure(figsize=(12, 6)) plt.semilogy(num_qubits, np.var(gradients, axis=1), 'o-', label='global cost, linear depth') plt.semilogy(num_qubits, np.var(fixed_depth_global_gradients, axis=1), 'o-', label='global cost, constant depth') plt.semilogy(num_qubits, np.var(linear_depth_local_gradients, axis=1), 'o-', label='local cost, linear depth') plt.semilogy(x, np.exp(fit[0] * x + fit[1]), 'r--', label=f'exponential fit w/ {fit[0]:.2f}') plt.xlabel('number of qubits') plt.ylabel(r'$\mathrm{Var}[\partial_{\theta 1} \langle E(\theta) \rangle]$') plt.legend(loc='best'); num_qubits = list(range(2, 13)) fixed_depth_local_gradients = [sample_gradients(n, 1, local=True) for n in num_qubits] fit = np.polyfit(num_qubits, np.log(np.var(fixed_depth_local_gradients, axis=1)), deg=1) x = np.linspace(num_qubits[0], num_qubits[-1], 200) plt.figure(figsize=(12, 6)) plt.semilogy(num_qubits, np.var(gradients, axis=1), 'o-', label='global cost, linear depth') plt.semilogy(num_qubits, np.var(fixed_depth_global_gradients, axis=1), 'o-', label='global cost, constant depth') plt.semilogy(num_qubits, np.var(linear_depth_local_gradients, axis=1), 'o-', label='local cost, linear depth') plt.semilogy(num_qubits, np.var(fixed_depth_local_gradients, axis=1), 'o-', label='local cost, constant depth') plt.semilogy(x, np.exp(fit[0] * x + fit[1]), 'r--', label=f'exponential fit w/ {fit[0]:.2f}') plt.xlabel('number of qubits') plt.ylabel(r'$\mathrm{Var}[\partial_{\theta 1} \langle E(\theta) \rangle]$') plt.legend(loc='best'); num_qubits = 6 operator = Z ^ Z ^ (I ^ (num_qubits - 4)) def minimize(circuit, optimizer): initial_point = np.random.random(circuit.num_parameters) exp = StateFn(operator, is_measurement=True) @ StateFn(circuit) grad = Gradient().convert(exp) # pauli basis exp = PauliExpectation().convert(exp) grad = PauliExpectation().convert(grad) sampler = CircuitSampler(q_instance, caching="all") def loss(x): values_dict = dict(zip(circuit.parameters, x)) return np.real(sampler.convert(exp, values_dict).eval()) def gradient(x): values_dict = dict(zip(circuit.parameters, x)) return np.real(sampler.convert(grad, values_dict).eval()) return optimizer.optimize(circuit.num_parameters, loss, gradient, initial_point=initial_point) circuit = RealAmplitudes(4, reps=1, entanglement='linear') circuit.draw('mpl', style='iqx') circuit.reps = 5 circuit.draw('mpl', style='iqx') def layerwise_training(ansatz, max_num_layers, optimizer): optimal_parameters = [] fopt = None for reps in range(1, max_num_layers): ansatz.reps = reps # bind already optimized parameters values_dict = dict(zip(ansatz.parameters, optimal_parameters)) partially_bound = ansatz.bind_parameters(values_dict) xopt, fopt, _ = minimize(partially_bound, optimizer) print('Circuit depth:', ansatz.depth(), 'best value:', fopt) optimal_parameters += list(xopt) return fopt, optimal_parameters ansatz = RealAmplitudes(4, entanglement='linear') optimizer = GradientDescent(maxiter=50) np.random.seed(12) fopt, optimal_parameters = layerwise_training(ansatz, 4, optimizer)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
# General tools import numpy as np import matplotlib.pyplot as plt # Qiskit Circuit Functions from qiskit import execute,QuantumCircuit, QuantumRegister, ClassicalRegister, Aer, transpile import qiskit.quantum_info as qi # Tomography functions from qiskit.ignis.verification.tomography import process_tomography_circuits, ProcessTomographyFitter from qiskit.ignis.mitigation.measurement import complete_meas_cal, CompleteMeasFitter import warnings warnings.filterwarnings('ignore') target = QuantumCircuit(2) #target = # YOUR CODE HERE target.h(0) target.h(1) target.rx(np.pi/2,0) target.rx(np.pi/2,1) target.cx(0,1) target.p(np.pi,1) target.cx(0,1) target_unitary = qi.Operator(target) target.draw('mpl') from qc_grader import grade_lab5_ex1 # Note that the grading function is expecting a quantum circuit with no measurements grade_lab5_ex1(target) simulator = Aer.get_backend('qasm_simulator') qpt_circs = process_tomography_circuits(target,measured_qubits=[0,1])# YOUR CODE HERE qpt_job = execute(qpt_circs,simulator,seed_simulator=3145,seed_transpiler=3145,shots=8192) qpt_result = qpt_job.result() # YOUR CODE HERE qpt_tomo= ProcessTomographyFitter(qpt_result,qpt_circs) Choi_qpt= qpt_tomo.fit(method='lstsq') fidelity = qi.average_gate_fidelity(Choi_qpt,target_unitary) from qc_grader import grade_lab5_ex2 # Note that the grading function is expecting a floating point number grade_lab5_ex2(fidelity) # T1 and T2 values for qubits 0-3 T1s = [15000, 19000, 22000, 14000] T2s = [30000, 25000, 18000, 28000] # Instruction times (in nanoseconds) time_u1 = 0 # virtual gate time_u2 = 50 # (single X90 pulse) time_u3 = 100 # (two X90 pulses) time_cx = 300 time_reset = 1000 # 1 microsecond time_measure = 1000 # 1 microsecond from qiskit.providers.aer.noise import thermal_relaxation_error from qiskit.providers.aer.noise import NoiseModel # QuantumError objects errors_reset = [thermal_relaxation_error(t1, t2, time_reset) for t1, t2 in zip(T1s, T2s)] errors_measure = [thermal_relaxation_error(t1, t2, time_measure) for t1, t2 in zip(T1s, T2s)] errors_u1 = [thermal_relaxation_error(t1, t2, time_u1) for t1, t2 in zip(T1s, T2s)] errors_u2 = [thermal_relaxation_error(t1, t2, time_u2) for t1, t2 in zip(T1s, T2s)] errors_u3 = [thermal_relaxation_error(t1, t2, time_u3) for t1, t2 in zip(T1s, T2s)] errors_cx = [[thermal_relaxation_error(t1a, t2a, time_cx).expand( thermal_relaxation_error(t1b, t2b, time_cx)) for t1a, t2a in zip(T1s, T2s)] for t1b, t2b in zip(T1s, T2s)] # Add errors to noise model noise_thermal = NoiseModel() for j in range(4): noise_thermal.add_quantum_error(errors_measure[j],'measure',[j]) noise_thermal.add_quantum_error(errors_reset[j],'reset',[j]) noise_thermal.add_quantum_error(errors_u3[j],'u3',[j]) noise_thermal.add_quantum_error(errors_u2[j],'u2',[j]) noise_thermal.add_quantum_error(errors_u1[j],'u1',[j]) for k in range(4): noise_thermal.add_quantum_error(errors_cx[j][k],'cx',[j,k]) # YOUR CODE HERE from qc_grader import grade_lab5_ex3 # Note that the grading function is expecting a NoiseModel grade_lab5_ex3(noise_thermal) np.random.seed(0) noise_qpt_circs = process_tomography_circuits(target,measured_qubits=[0,1])# YOUR CODE HERE noise_qpt_job = execute(noise_qpt_circs,simulator,seed_simulator=3145,seed_transpiler=3145,shots=8192,noise_model=noise_thermal) noise_qpt_result = noise_qpt_job.result() # YOUR CODE HERE noise_qpt_tomo= ProcessTomographyFitter(noise_qpt_result,noise_qpt_circs) noise_Choi_qpt= noise_qpt_tomo.fit(method='lstsq') fidelity = qi.average_gate_fidelity(noise_Choi_qpt,target_unitary) from qc_grader import grade_lab5_ex4 # Note that the grading function is expecting a floating point number grade_lab5_ex4(fidelity) np.random.seed(0) # YOUR CODE HERE #qr = QuantumRegister(2) qubit_list = [0,1] meas_calibs, state_labels = complete_meas_cal(qubit_list=qubit_list) meas_calibs_job = execute(meas_calibs,simulator,seed_simulator=3145,seed_transpiler=3145,shots=8192,noise_model=noise_thermal) cal_results = meas_calibs_job.result() meas_fitter = CompleteMeasFitter(cal_results, state_labels, qubit_list=qubit_list) Cal_result = meas_fitter.filter.apply(noise_qpt_result) # YOUR CODE HERE Cal_qpt_tomo= ProcessTomographyFitter(Cal_result,noise_qpt_circs) Cal_Choi_qpt= Cal_qpt_tomo.fit(method='lstsq') fidelity = qi.average_gate_fidelity(Cal_Choi_qpt,target_unitary) from qc_grader import grade_lab5_ex5 # Note that the grading function is expecting a floating point number grade_lab5_ex5(fidelity)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import numpy as np # Importing standard Qiskit libraries from qiskit import QuantumCircuit, transpile, Aer, IBMQ from qiskit.tools.jupyter import * from qiskit.visualization import * from ibm_quantum_widgets import * from qiskit.providers.aer import QasmSimulator # Loading your IBM Quantum account(s) provider = IBMQ.load_account() # Qiskit module from qiskit import QuantumCircuit import qiskit.circuit.library as circuit_library import qiskit.quantum_info as qi import qiskit.ignis.mitigation as mit # Qiskit tools for noisy simulation from qiskit.providers.aer import QasmSimulator from qiskit.providers.aer.noise import NoiseModel from qiskit.providers.aer.utils import insert_noise # Qiskit tools for running and monitoring jobs from qiskit import execute from qiskit.tools.monitor import job_monitor # Other imports import numpy as np # Suppress warnings import warnings warnings.filterwarnings('ignore') num_qubits = 7 # adjacency matrix for `ibmq_casablanca` adjmat = [ [0, 1, 0, 0, 0, 0, 0], [1, 0, 1, 1, 0, 0, 0], [0, 1, 0, 0, 0, 0, 0], [0, 1, 0, 0, 0, 1, 0], [0, 0, 0, 0, 0, 1, 0], [0, 0, 0, 1, 1, 0, 1], [0, 0, 0, 0, 0, 1, 0]] def create_graph_state(): graph_state_circuit = circuit_library.GraphState(adjmat) return graph_state_circuit # the graph state can be created using Qiskit's circuit library state_circuit = create_graph_state() state_circuit.draw() def compute_stabilizer_group(circuit): """Compute the stabilizer group for stabilizer circuit.""" state = qi.Statevector.from_instruction(circuit) labels = [] for i in qi.pauli_basis(state.num_qubits): val = round(qi.state_fidelity(i.to_matrix()[0], state, validate=False)) if val != 0: label = i.to_labels()[0] if val == 1: label = '+' + label else: label = '-' + label labels.append(label) return labels def stabilizer_coeff_pauli(stabilizer): """Return the 1 or -1 coeff and Pauli label.""" coeff = 1 pauli = coeff if stabilizer[0] == '-': coeff = -1 if stabilizer[0] in ['+', '-']: pauli = stabilizer[1:] else: pauli = stabilizer return coeff, pauli def stabilizer_measure_circuit(stabilizer, initial_circuit=None): """Return a stabilizer measurement circuits. Args: stabilizer (str): a stabilizer string initial_circuit (QuantumCircuit): Optional, the initial circuit. Returns: QuantumCircuit: the circuit with stabilizer measurements. """ _, pauli = stabilizer_coeff_pauli(stabilizer) if initial_circuit is None: circ = QuantumCircuit(len(pauli)) else: circ = initial_circuit.copy() for i, s in enumerate(reversed(pauli)): if s == 'X': circ.h(i) if s == 'Y': circ.sdg(i) circ.h(i) circ.measure_all() return circ ## Compute the stabilizers for this graph state generators = qi.Clifford(state_circuit).stabilizer.pauli.to_labels() stabilizers = compute_stabilizer_group(state_circuit) print('Stabilizers:', stabilizers) print('Generators:', generators) ## Append the stabilizer measurements to the graph state circuit stabilizer_circuits = [stabilizer_measure_circuit(stab, state_circuit) for stab in stabilizers] stabilizer_circuits[0].draw() labels = ['0000000', '0000011', '0000101', '0001001', '0001010', '0001100', '0010001', '0010010', '0010100', '0011000', '0100001', '0100010', '0100100', '0101000', '0110000', '1000001', '1000010', '1000100', '1001000', '1010000', '1100000', '1111111'] meas_cal_circuits, metadata = mit.expval_meas_mitigator_circuits(num_qubits, labels=labels) [meas_cal_circuits_full, state_labels] = mit.complete_meas_cal(range(num_qubits)) #backend = QasmSimulator.from_backend(provider.get_backend('ibmq_casablanca')) IBMQ.load_account() # Load account from disk IBMQ.providers() from qiskit import IBMQ, assemble, transpile from qiskit.circuit.random import random_circuit backend = provider.backend.ibmq_qasm_simulator reps = 10 all_jobs = [] all_jobs_mit = [] for ii in range(reps): # Run QPT on backend shots = 8192 il = [0,1,2,3,4,5,6] job_backend = execute(stabilizer_circuits, backend, shots=shots, initial_layout=il) job_mit_backend = execute(meas_cal_circuits, backend, shots=shots, initial_layout=il) print('Job IDs ({}/{}): \n measurement calibration: {}\n stabilizer measurements: {}'.format( ii+1, reps, job_mit_backend.job_id(), job_backend.job_id())) all_jobs.append(job_backend) all_jobs_mit.append(job_mit_backend) for job in all_jobs: job_monitor(job) try: if job.error_message() is not None: print(job.error_message()) except: pass result_backend = [] result_mit_backend = [] for job in all_jobs: # Retrieve results (this may take a while depending on the queue) result_backend.append(job.result()) for job in all_jobs_mit: result_mit_backend.append(job.result()) def stabilizer_measure_diagonal(stabilizer): """Return the diagonal vector for a stabilizer measurement. Args: stabilizer (str): a stabilizer string Returns: np.ndarray: the diagonal for measurement in the stabilizer basis. """ coeff, pauli = stabilizer_coeff_pauli(stabilizer) diag = np.array([1]) for s in reversed(pauli): if s == 'I': tmp = np.array([1, 1]) else: tmp = np.array([1, -1]) diag = np.kron(tmp, diag) return coeff * diag def stabilizer_fidelity(expvals, stddevs=None): """Compute stabilizer state fidelity from stabilizer expvals.""" mean = np.mean(expvals) if stddevs is None: return mean stddev = np.sqrt(np.sum(stddevs ** 2)) return mean, stddev def stabilizer_expvals(result, stabilizers, meas_mitigator=None): """Compute expectation values from stabilizer measurement results.""" ### YOUR CODE GOES HERE -- START expvals = [] stddevs = [] for i, stab in enumerate(stabilizers): expval, stddev = mit.expectation_value( result.get_counts(i), diagonal=stabilizer_measure_diagonal(stab), meas_mitigator=meas_mitigator) expvals.append(expval) stddevs.append(stddev) return np.array(expvals), np.array(stddevs) ## Mitigate the stabilizer expectation values F_nomit_backend = [] F_mit_backend = [] for ii in range(reps): # Unmitigated Expectation Values expvals_nomit_b, stddevs_nomit_b = stabilizer_expvals( result_backend[ii], stabilizers) # Fit measurement error mitigators mitigator_backend = mit.ExpvalMeasMitigatorFitter(result_mit_backend[ii], metadata).fit() # Measurement error mitigated expectation values expvals_mit_b, stddevs_mit_b = stabilizer_expvals( result_backend[ii], stabilizers, meas_mitigator=mitigator_backend) # save the fidelities for this iteration F_nomit_backend.append(stabilizer_fidelity(expvals_nomit_b, stddevs_nomit_b)[0]) F_mit_backend.append(stabilizer_fidelity(expvals_mit_b, stddevs_mit_b)[0]) ## The final results print('Graph-state fidelity estimates') print('\nNo mitigation') print('F({}) = {:.3f} \u00B1 {:.3f}'.format(properties.backend_name, np.mean(F_nomit_backend), np.std(F_nomit_backend))) print('\nCTMP error mitigation') print('F({}) = {:.3f} \u00B1 {:.3f}'.format(properties.backend_name, np.mean(F_mit_backend), np.std(F_mit_backend)))
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import numpy as np # Importing standard Qiskit libraries from qiskit import QuantumCircuit, transpile, assemble, Aer, IBMQ, execute from qiskit.quantum_info import Statevector from qiskit.visualization import plot_bloch_multivector, plot_histogram from qiskit_textbook.problems import dj_problem_oracle def lab1_ex1(): qc = QuantumCircuit(1) # # # FILL YOUR CODE IN HERE # # qc.x(0) return qc state = Statevector.from_instruction(lab1_ex1()) plot_bloch_multivector(state) from qc_grader import grade_lab1_ex1 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex1(lab1_ex1()) def lab1_ex2(): qc = QuantumCircuit(1) # # # FILL YOUR CODE IN HERE # # qc.h(0) return qc state = Statevector.from_instruction(lab1_ex2()) plot_bloch_multivector(state) from qc_grader import grade_lab1_ex2 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex2(lab1_ex2()) def lab1_ex3(): qc = QuantumCircuit(1) # # # FILL YOUR CODE IN HERE # # qc.x(0) qc.h(0) return qc state = Statevector.from_instruction(lab1_ex3()) plot_bloch_multivector(state) from qc_grader import grade_lab1_ex3 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex3(lab1_ex3()) def lab1_ex4(): qc = QuantumCircuit(1) # # # FILL YOUR CODE IN HERE # # qc.h(0) qc.sdg(0) return qc state = Statevector.from_instruction(lab1_ex4()) plot_bloch_multivector(state) from qc_grader import grade_lab1_ex4 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex4(lab1_ex4()) def lab1_ex5(): qc = QuantumCircuit(2,2) # this time, we not only want two qubits, but also two classical bits for the measurement # # # FILL YOUR CODE IN HERE # # qc.h(0) qc.cx(0,1) qc.x(0) return qc qc = lab1_ex5() qc.draw() # we draw the circuit from qc_grader import grade_lab1_ex5 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex5(lab1_ex5()) qc.measure(0, 0) # we perform a measurement on qubit q_0 and store the information on the classical bit c_0 qc.measure(1, 1) # we perform a measurement on qubit q_1 and store the information on the classical bit c_1 backend = Aer.get_backend('qasm_simulator') # we choose the simulator as our backend counts = execute(qc, backend, shots = 1000).result().get_counts() # we run the simulation and get the counts plot_histogram(counts) # let us plot a histogram to see the possible outcomes and corresponding probabilities def lab1_ex6(): # # # FILL YOUR CODE IN HERE # # qc = QuantumCircuit(3,3) qc.h(0) qc.cx(0,1) qc.cx(1,2) qc.y(1) return qc qc = lab1_ex6() qc.draw() # we draw the circuit from qc_grader import grade_lab1_ex6 # Note that the grading function is expecting a quantum circuit without measurements grade_lab1_ex6(lab1_ex6()) oraclenr = 4 # determines the oracle (can range from 1 to 5) oracle = dj_problem_oracle(oraclenr) # gives one out of 5 oracles oracle.name = "DJ-Oracle" def dj_classical(n, input_str): # build a quantum circuit with n qubits and 1 classical readout bit dj_circuit = QuantumCircuit(n+1,1) # Prepare the initial state corresponding to your input bit string for i in range(n): if input_str[i] == '1': dj_circuit.x(i) # append oracle dj_circuit.append(oracle, range(n+1)) # measure the fourth qubit dj_circuit.measure(n,0) return dj_circuit n = 4 # number of qubits input_str = '1111' dj_circuit = dj_classical(n, input_str) dj_circuit.draw() # draw the circuit input_str = '1111' dj_circuit = dj_classical(n, input_str) qasm_sim = Aer.get_backend('qasm_simulator') transpiled_dj_circuit = transpile(dj_circuit, qasm_sim) qobj = assemble(transpiled_dj_circuit, qasm_sim) results = qasm_sim.run(qobj).result() answer = results.get_counts() plot_histogram(answer) def lab1_ex7(): min_nr_inputs = 2 max_nr_inputs = 9 return [min_nr_inputs, max_nr_inputs] from qc_grader import grade_lab1_ex7 # Note that the grading function is expecting a list of two integers grade_lab1_ex7(lab1_ex7()) n=4 def psi_0(n): qc = QuantumCircuit(n+1,n) # Build the state (|00000> - |10000>)/sqrt(2) # # # FILL YOUR CODE IN HERE # # qc.x(4) qc.h(4) return qc dj_circuit = psi_0(n) dj_circuit.draw() def psi_1(n): # obtain the |psi_0> = |00001> state qc = psi_0(n) # create the superposition state |psi_1> # # qc.h(0) qc.h(1) qc.h(2) qc.h(3) # # qc.barrier() return qc dj_circuit = psi_1(n) dj_circuit.draw() def psi_2(oracle,n): # circuit to obtain psi_1 qc = psi_1(n) # append the oracle qc.append(oracle, range(n+1)) return qc dj_circuit = psi_2(oracle, n) dj_circuit.draw() def lab1_ex8(oracle, n): # note that this exercise also depends on the code in the functions psi_0 (In [24]) and psi_1 (In [25]) qc = psi_2(oracle, n) # apply n-fold hadamard gate # # # FILL YOUR CODE IN HERE # # qc.h(0) qc.h(1) qc.h(2) qc.h(3) # add the measurement by connecting qubits to classical bits # # qc.measure(0,0) qc.measure(1,1) qc.measure(2,2) qc.measure(3,3) # # return qc dj_circuit = lab1_ex8(oracle, n) dj_circuit.draw() from qc_grader import grade_lab1_ex8 # Note that the grading function is expecting a quantum circuit with measurements grade_lab1_ex8(lab1_ex8(dj_problem_oracle(4),n)) qasm_sim = Aer.get_backend('qasm_simulator') transpiled_dj_circuit = transpile(dj_circuit, qasm_sim) qobj = assemble(transpiled_dj_circuit) results = qasm_sim.run(qobj).result() answer = results.get_counts() plot_histogram(answer)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
import networkx as nx import numpy as np import plotly.graph_objects as go import matplotlib as mpl import pandas as pd from IPython.display import clear_output from plotly.subplots import make_subplots from matplotlib import pyplot as plt from qiskit import Aer from qiskit import QuantumCircuit from qiskit.visualization import plot_state_city from qiskit.algorithms.optimizers import COBYLA, SLSQP, ADAM from time import time from copy import copy from typing import List from qc_grader.graph_util import display_maxcut_widget, QAOA_widget, graphs mpl.rcParams['figure.dpi'] = 300 from qiskit.circuit import Parameter, ParameterVector #Parameters are initialized with a simple string identifier parameter_0 = Parameter('θ[0]') parameter_1 = Parameter('θ[1]') circuit = QuantumCircuit(1) #We can then pass the initialized parameters as the rotation angle argument to the Rx and Ry gates circuit.ry(theta = parameter_0, qubit = 0) circuit.rx(theta = parameter_1, qubit = 0) circuit.draw('mpl') parameter = Parameter('θ') circuit = QuantumCircuit(1) circuit.ry(theta = parameter, qubit = 0) circuit.rx(theta = parameter, qubit = 0) circuit.draw('mpl') #Set the number of layers and qubits n=3 num_layers = 2 #ParameterVectors are initialized with a string identifier and an integer specifying the vector length parameters = ParameterVector('θ', n*(num_layers+1)) circuit = QuantumCircuit(n, n) for layer in range(num_layers): #Appending the parameterized Ry gates using parameters from the vector constructed above for i in range(n): circuit.ry(parameters[n*layer+i], i) circuit.barrier() #Appending the entangling CNOT gates for i in range(n): for j in range(i): circuit.cx(j,i) circuit.barrier() #Appending one additional layer of parameterized Ry gates for i in range(n): circuit.ry(parameters[n*num_layers+i], i) circuit.barrier() circuit.draw('mpl') print(circuit.parameters) #Create parameter dictionary with random values to bind param_dict = {parameter: np.random.random() for parameter in parameters} print(param_dict) #Assign parameters using the assign_parameters method bound_circuit = circuit.assign_parameters(parameters = param_dict) bound_circuit.draw('mpl') new_parameters = ParameterVector('Ψ',9) new_circuit = circuit.assign_parameters(parameters = [k*new_parameters[i] for k in range(9)]) new_circuit.draw('mpl') #Run the circuit with assigned parameters on Aer's statevector simulator simulator = Aer.get_backend('statevector_simulator') result = simulator.run(bound_circuit).result() statevector = result.get_statevector(bound_circuit) plot_state_city(statevector) #The following line produces an error when run because 'circuit' still contains non-assigned parameters #result = simulator.run(circuit).result() for key in graphs.keys(): print(key) graph = nx.Graph() #Add nodes and edges graph.add_nodes_from(np.arange(0,6,1)) edges = [(0,1,2.0),(0,2,3.0),(0,3,2.0),(0,4,4.0),(0,5,1.0),(1,2,4.0),(1,3,1.0),(1,4,1.0),(1,5,3.0),(2,4,2.0),(2,5,3.0),(3,4,5.0),(3,5,1.0)] graph.add_weighted_edges_from(edges) graphs['custom'] = graph #Display widget display_maxcut_widget(graphs['custom']) def maxcut_cost_fn(graph: nx.Graph, bitstring: List[int]) -> float: """ Computes the maxcut cost function value for a given graph and cut represented by some bitstring Args: graph: The graph to compute cut values for bitstring: A list of integer values '0' or '1' specifying a cut of the graph Returns: The value of the cut """ #Get the weight matrix of the graph weight_matrix = nx.adjacency_matrix(graph).toarray() size = weight_matrix.shape[0] value = 0. #INSERT YOUR CODE TO COMPUTE THE CUT VALUE HERE for i in range(size): for j in range(size): value+= weight_matrix[i,j]*bitstring[i]*(1-bitstring[j]) return value def plot_maxcut_histogram(graph: nx.Graph) -> None: """ Plots a bar diagram with the values for all possible cuts of a given graph. Args: graph: The graph to compute cut values for """ num_vars = graph.number_of_nodes() #Create list of bitstrings and corresponding cut values bitstrings = ['{:b}'.format(i).rjust(num_vars, '0')[::-1] for i in range(2**num_vars)] values = [maxcut_cost_fn(graph = graph, bitstring = [int(x) for x in bitstring]) for bitstring in bitstrings] #Sort both lists by largest cut value values, bitstrings = zip(*sorted(zip(values, bitstrings))) #Plot bar diagram bar_plot = go.Bar(x = bitstrings, y = values, marker=dict(color=values, colorscale = 'plasma', colorbar=dict(title='Cut Value'))) fig = go.Figure(data=bar_plot, layout = dict(xaxis=dict(type = 'category'), width = 1500, height = 600)) fig.show() plot_maxcut_histogram(graph = graphs['custom']) from qc_grader import grade_lab2_ex1 bitstring = [1, 0, 1, 1, 0, 0] #DEFINE THE CORRECT MAXCUT BITSTRING HERE # Note that the grading function is expecting a list of integers '0' and '1' grade_lab2_ex1(bitstring) from qiskit_optimization import QuadraticProgram quadratic_program = QuadraticProgram('sample_problem') print(quadratic_program.export_as_lp_string()) quadratic_program.binary_var(name = 'x_0') quadratic_program.integer_var(name = 'x_1') quadratic_program.continuous_var(name = 'x_2', lowerbound = -2.5, upperbound = 1.8) quadratic = [[0,1,2],[3,4,5],[0,1,2]] linear = [10,20,30] quadratic_program.minimize(quadratic = quadratic, linear = linear, constant = -5) print(quadratic_program.export_as_lp_string()) def quadratic_program_from_graph(graph: nx.Graph) -> QuadraticProgram: """Constructs a quadratic program from a given graph for a MaxCut problem instance. Args: graph: Underlying graph of the problem. Returns: QuadraticProgram """ #Get weight matrix of graph weight_matrix = nx.adjacency_matrix(graph) shape = weight_matrix.shape size = shape[0] #Build qubo matrix Q from weight matrix W qubo_matrix = np.zeros((size, size)) qubo_vector = np.zeros(size) for i in range(size): for j in range(size): qubo_matrix[i, j] -= weight_matrix[i, j] for i in range(size): for j in range(size): qubo_vector[i] += weight_matrix[i,j] #INSERT YOUR CODE HERE quadratic_program=QuadraticProgram('sample_problem') for i in range(size): quadratic_program.binary_var(name='x_{}'.format(i)) quadratic_program.maximize(quadratic =qubo_matrix, linear = qubo_vector) return quadratic_program quadratic_program = quadratic_program_from_graph(graphs['custom']) print(quadratic_program.export_as_lp_string()) from qc_grader import grade_lab2_ex2 # Note that the grading function is expecting a quadratic program grade_lab2_ex2(quadratic_program) def qaoa_circuit(qubo: QuadraticProgram, p: int = 1): """ Given a QUBO instance and the number of layers p, constructs the corresponding parameterized QAOA circuit with p layers. Args: qubo: The quadratic program instance p: The number of layers in the QAOA circuit Returns: The parameterized QAOA circuit """ size = len(qubo.variables) qubo_matrix = qubo.objective.quadratic.to_array(symmetric=True) qubo_linearity = qubo.objective.linear.to_array() #Prepare the quantum and classical registers qaoa_circuit = QuantumCircuit(size,size) #Apply the initial layer of Hadamard gates to all qubits qaoa_circuit.h(range(size)) #Create the parameters to be used in the circuit gammas = ParameterVector('gamma', p) betas = ParameterVector('beta', p) #Outer loop to create each layer for i in range(p): #Apply R_Z rotational gates from cost layer #INSERT YOUR CODE HERE for j in range(size): qubo_matrix_sum_of_col = 0 for k in range(size): qubo_matrix_sum_of_col+= qubo_matrix[j][k] qaoa_circuit.rz(gammas[i]*(qubo_linearity[j]+qubo_matrix_sum_of_col),j) #Apply R_ZZ rotational gates for entangled qubit rotations from cost layer #INSERT YOUR CODE HERE for j in range(size): for k in range(size): if j!=k: qaoa_circuit.rzz(gammas[i]*qubo_matrix[j][k]*0.5,j,k) # Apply single qubit X - rotations with angle 2*beta_i to all qubits #INSERT YOUR CODE HERE for j in range(size): qaoa_circuit.rx(2*betas[i],j) return qaoa_circuit quadratic_program = quadratic_program_from_graph(graphs['custom']) custom_circuit = qaoa_circuit(qubo = quadratic_program) test = custom_circuit.assign_parameters(parameters=[1.0]*len(custom_circuit.parameters)) from qc_grader import grade_lab2_ex3 # Note that the grading function is expecting a quantum circuit grade_lab2_ex3(test) from qiskit.algorithms import QAOA from qiskit_optimization.algorithms import MinimumEigenOptimizer backend = Aer.get_backend('statevector_simulator') qaoa = QAOA(optimizer = ADAM(), quantum_instance = backend, reps=1, initial_point = [0.1,0.1]) eigen_optimizer = MinimumEigenOptimizer(min_eigen_solver = qaoa) quadratic_program = quadratic_program_from_graph(graphs['custom']) result = eigen_optimizer.solve(quadratic_program) print(result) def plot_samples(samples): """ Plots a bar diagram for the samples of a quantum algorithm Args: samples """ #Sort samples by probability samples = sorted(samples, key = lambda x: x.probability) #Get list of probabilities, function values and bitstrings probabilities = [sample.probability for sample in samples] values = [sample.fval for sample in samples] bitstrings = [''.join([str(int(i)) for i in sample.x]) for sample in samples] #Plot bar diagram sample_plot = go.Bar(x = bitstrings, y = probabilities, marker=dict(color=values, colorscale = 'plasma',colorbar=dict(title='Function Value'))) fig = go.Figure( data=sample_plot, layout = dict( xaxis=dict( type = 'category' ) ) ) fig.show() plot_samples(result.samples) graph_name = 'custom' quadratic_program = quadratic_program_from_graph(graph=graphs[graph_name]) trajectory={'beta_0':[], 'gamma_0':[], 'energy':[]} offset = 1/4*quadratic_program.objective.quadratic.to_array(symmetric = True).sum() + 1/2*quadratic_program.objective.linear.to_array().sum() def callback(eval_count, params, mean, std_dev): trajectory['beta_0'].append(params[1]) trajectory['gamma_0'].append(params[0]) trajectory['energy'].append(-mean + offset) optimizers = { 'cobyla': COBYLA(), 'slsqp': SLSQP(), 'adam': ADAM() } qaoa = QAOA(optimizer = optimizers['cobyla'], quantum_instance = backend, reps=1, initial_point = [6.2,1.8],callback = callback) eigen_optimizer = MinimumEigenOptimizer(min_eigen_solver = qaoa) result = eigen_optimizer.solve(quadratic_program) fig = QAOA_widget(landscape_file=f'./resources/energy_landscapes/{graph_name}.csv', trajectory = trajectory, samples = result.samples) fig.show() graph_name = 'custom' quadratic_program = quadratic_program_from_graph(graphs[graph_name]) #Create callback to record total number of evaluations max_evals = 0 def callback(eval_count, params, mean, std_dev): global max_evals max_evals = eval_count #Create empty lists to track values energies = [] runtimes = [] num_evals=[] #Run QAOA for different values of p for p in range(1,10): print(f'Evaluating for p = {p}...') qaoa = QAOA(optimizer = optimizers['cobyla'], quantum_instance = backend, reps=p, callback=callback) eigen_optimizer = MinimumEigenOptimizer(min_eigen_solver = qaoa) start = time() result = eigen_optimizer.solve(quadratic_program) runtimes.append(time()-start) num_evals.append(max_evals) #Calculate energy of final state from samples avg_value = 0. for sample in result.samples: avg_value += sample.probability*sample.fval energies.append(avg_value) #Create and display plots energy_plot = go.Scatter(x = list(range(1,10)), y =energies, marker=dict(color=energies, colorscale = 'plasma')) runtime_plot = go.Scatter(x = list(range(1,10)), y =runtimes, marker=dict(color=runtimes, colorscale = 'plasma')) num_evals_plot = go.Scatter(x = list(range(1,10)), y =num_evals, marker=dict(color=num_evals, colorscale = 'plasma')) fig = make_subplots(rows = 1, cols = 3, subplot_titles = ['Energy value', 'Runtime', 'Number of evaluations']) fig.update_layout(width=1800,height=600, showlegend=False) fig.add_trace(energy_plot, row=1, col=1) fig.add_trace(runtime_plot, row=1, col=2) fig.add_trace(num_evals_plot, row=1, col=3) clear_output() fig.show() def plot_qaoa_energy_landscape(graph: nx.Graph, cvar: float = None): num_shots = 1000 seed = 42 simulator = Aer.get_backend('qasm_simulator') simulator.set_options(seed_simulator = 42) #Generate circuit circuit = qaoa_circuit(qubo = quadratic_program_from_graph(graph), p=1) circuit.measure(range(graph.number_of_nodes()),range(graph.number_of_nodes())) #Create dictionary with precomputed cut values for all bitstrings cut_values = {} size = graph.number_of_nodes() for i in range(2**size): bitstr = '{:b}'.format(i).rjust(size, '0')[::-1] x = [int(bit) for bit in bitstr] cut_values[bitstr] = maxcut_cost_fn(graph, x) #Perform grid search over all parameters data_points = [] max_energy = None for beta in np.linspace(0,np.pi, 50): for gamma in np.linspace(0, 4*np.pi, 50): bound_circuit = circuit.assign_parameters([beta, gamma]) result = simulator.run(bound_circuit, shots = num_shots).result() statevector = result.get_counts(bound_circuit) energy = 0 measured_cuts = [] for bitstring, count in statevector.items(): measured_cuts = measured_cuts + [cut_values[bitstring]]*count if cvar is None: #Calculate the mean of all cut values energy = sum(measured_cuts)/num_shots else: #raise NotImplementedError() #INSERT YOUR CODE HERE measured_cuts = sorted(measured_cuts, reverse = True) for w in range(int(cvar*num_shots)): energy += measured_cuts[w]/int((cvar*num_shots)) #Update optimal parameters if max_energy is None or energy > max_energy: max_energy = energy optimum = {'beta': beta, 'gamma': gamma, 'energy': energy} #Update data data_points.append({'beta': beta, 'gamma': gamma, 'energy': energy}) #Create and display surface plot from data_points df = pd.DataFrame(data_points) df = df.pivot(index='beta', columns='gamma', values='energy') matrix = df.to_numpy() beta_values = df.index.tolist() gamma_values = df.columns.tolist() surface_plot = go.Surface( x=gamma_values, y=beta_values, z=matrix, coloraxis = 'coloraxis' ) fig = go.Figure(data = surface_plot) fig.show() #Return optimum return optimum graph = graphs['custom'] optimal_parameters = plot_qaoa_energy_landscape(graph = graph) print('Optimal parameters:') print(optimal_parameters) optimal_parameters = plot_qaoa_energy_landscape(graph = graph, cvar = 0.2) print(optimal_parameters) from qc_grader import grade_lab2_ex4 # Note that the grading function is expecting a python dictionary # with the entries 'beta', 'gamma' and 'energy' grade_lab2_ex4(optimal_parameters)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
# General Imports import numpy as np # Visualisation Imports import matplotlib.pyplot as plt # Scikit Imports from sklearn import datasets from sklearn.model_selection import train_test_split from sklearn.svm import SVC from sklearn.decomposition import PCA from sklearn.preprocessing import StandardScaler, MinMaxScaler # Qiskit Imports from qiskit import Aer, execute from qiskit.circuit import QuantumCircuit, Parameter, ParameterVector from qiskit.circuit.library import PauliFeatureMap, ZFeatureMap, ZZFeatureMap from qiskit.circuit.library import TwoLocal, NLocal, RealAmplitudes, EfficientSU2 from qiskit.circuit.library import HGate, RXGate, RYGate, RZGate, CXGate, CRXGate, CRZGate from qiskit_machine_learning.kernels import QuantumKernel # Load digits dataset digits = datasets.load_digits(n_class=2) # Plot example '0' and '1' fig, axs = plt.subplots(1, 2, figsize=(6,3)) axs[0].set_axis_off() axs[0].imshow(digits.images[0], cmap=plt.cm.gray_r, interpolation='nearest') axs[1].set_axis_off() axs[1].imshow(digits.images[1], cmap=plt.cm.gray_r, interpolation='nearest') plt.show() # Split dataset sample_train, sample_test, label_train, label_test = train_test_split( digits.data, digits.target, test_size=0.2, random_state=22) # Reduce dimensions n_dim = 4 pca = PCA(n_components=n_dim).fit(sample_train) sample_train = pca.transform(sample_train) sample_test = pca.transform(sample_test) # Normalise std_scale = StandardScaler().fit(sample_train) sample_train = std_scale.transform(sample_train) sample_test = std_scale.transform(sample_test) # Scale samples = np.append(sample_train, sample_test, axis=0) minmax_scale = MinMaxScaler((-1, 1)).fit(samples) sample_train = minmax_scale.transform(sample_train) sample_test = minmax_scale.transform(sample_test) # Select train_size = 100 sample_train = sample_train[:train_size] label_train = label_train[:train_size] test_size = 20 sample_test = sample_test[:test_size] label_test = label_test[:test_size] print(sample_train[0], label_train[0]) print(sample_test[0], label_test[0]) # 3 features, depth 2 map_z = ZFeatureMap(feature_dimension=3, reps=2) map_z.draw('mpl') # 3 features, depth 1 map_zz = ZZFeatureMap(feature_dimension=3, reps=1) map_zz.draw('mpl') # 3 features, depth 1, linear entanglement map_zz = ZZFeatureMap(feature_dimension=3, reps=1, entanglement='linear') map_zz.draw('mpl') # 3 features, depth 1, circular entanglement map_zz = ZZFeatureMap(feature_dimension=3, reps=1, entanglement='circular') map_zz.draw('mpl') # 3 features, depth 1 map_pauli = PauliFeatureMap(feature_dimension=3, reps=1, paulis = ['X', 'Y', 'ZZ']) map_pauli.draw('mpl') def custom_data_map_func(x): coeff = x[0] if len(x) == 1 else reduce(lambda m, n: m * n, np.sin(np.pi - x)) return coeff map_customdatamap = PauliFeatureMap(feature_dimension=3, reps=1, paulis=['Z','ZZ'], data_map_func=custom_data_map_func) #map_customdatamap.draw() # qiskit isn't able to draw the circuit with np.sin in the custom data map twolocal = TwoLocal(num_qubits=3, reps=2, rotation_blocks=['ry','rz'], entanglement_blocks='cx', entanglement='circular', insert_barriers=True) twolocal.draw('mpl') twolocaln = NLocal(num_qubits=3, reps=2, rotation_blocks=[RYGate(Parameter('a')), RZGate(Parameter('a'))], entanglement_blocks=CXGate(), entanglement='circular', insert_barriers=True) twolocaln.draw('mpl') # rotation block: rot = QuantumCircuit(2) params = ParameterVector('r', 2) rot.ry(params[0], 0) rot.rz(params[1], 1) # entanglement block: ent = QuantumCircuit(4) params = ParameterVector('e', 3) ent.crx(params[0], 0, 1) ent.crx(params[1], 1, 2) ent.crx(params[2], 2, 3) nlocal = NLocal(num_qubits=6, rotation_blocks=rot, entanglement_blocks=ent, entanglement='linear', insert_barriers=True) nlocal.draw('mpl') qubits = 3 repeats = 2 x = ParameterVector('x', length=qubits) var_custom = QuantumCircuit(qubits) for _ in range(repeats): for i in range(qubits): var_custom.rx(x[i], i) for i in range(qubits): for j in range(i + 1, qubits): var_custom.cx(i, j) var_custom.p(x[i] * x[j], j) var_custom.cx(i, j) var_custom.barrier() var_custom.draw('mpl') print(sample_train[0]) encode_map = ZZFeatureMap(feature_dimension=4, reps=2, entanglement='linear', insert_barriers=True) encode_circuit = encode_map.bind_parameters(sample_train[0]) encode_circuit.draw(output='mpl') x = [-0.1,0.2] # YOUR CODE HERE encode_map_x =ZZFeatureMap(feature_dimension=2, reps=4) ex1_circuit =encode_map_x.bind_parameters(x) ex1_circuit.draw(output='mpl') from qc_grader import grade_lab3_ex1 # Note that the grading function is expecting a quantum circuit grade_lab3_ex1(ex1_circuit) zz_map = ZZFeatureMap(feature_dimension=4, reps=2, entanglement='linear', insert_barriers=True) zz_kernel = QuantumKernel(feature_map=zz_map, quantum_instance=Aer.get_backend('statevector_simulator')) print(sample_train[0]) print(sample_train[1]) zz_circuit = zz_kernel.construct_circuit(sample_train[0], sample_train[1]) zz_circuit.decompose().decompose().draw(output='mpl') backend = Aer.get_backend('qasm_simulator') job = execute(zz_circuit, backend, shots=8192, seed_simulator=1024, seed_transpiler=1024) counts = job.result().get_counts(zz_circuit) counts['0000']/sum(counts.values()) matrix_train = zz_kernel.evaluate(x_vec=sample_train) matrix_test = zz_kernel.evaluate(x_vec=sample_test, y_vec=sample_train) fig, axs = plt.subplots(1, 2, figsize=(10, 5)) axs[0].imshow(np.asmatrix(matrix_train), interpolation='nearest', origin='upper', cmap='Blues') axs[0].set_title("training kernel matrix") axs[1].imshow(np.asmatrix(matrix_test), interpolation='nearest', origin='upper', cmap='Reds') axs[1].set_title("testing kernel matrix") plt.show() x = [-0.1,0.2] y = [0.4,-0.6] # YOUR CODE HERE encode_map_x2 = ZZFeatureMap(feature_dimension=2, reps=4) zz_kernel_x2 =QuantumKernel(feature_map=encode_map_x2,quantum_instance=Aer.get_backend('statevector_simulator')) zz_circuit_x2 =zz_kernel_x2.construct_circuit(x,y) backend =Aer.get_backend('qasm_simulator') job = execute(zz_circuit_x2,backend,shots=8192, seed_simulator=1024, seed_transpiler=1024) counts_x2 = job.result().get_counts(zz_circuit_x2) amplitude= counts_x2['00']/sum(counts_x2.values()) from qc_grader import grade_lab3_ex2 # Note that the grading function is expecting a floating point number grade_lab3_ex2(amplitude) zzpc_svc = SVC(kernel='precomputed') zzpc_svc.fit(matrix_train, label_train) zzpc_score = zzpc_svc.score(matrix_test, label_test) print(f'Precomputed kernel classification test score: {zzpc_score}') zzcb_svc = SVC(kernel=zz_kernel.evaluate) zzcb_svc.fit(sample_train, label_train) zzcb_score = zzcb_svc.score(sample_test, label_test) print(f'Callable kernel classification test score: {zzcb_score}') classical_kernels = ['linear', 'poly', 'rbf', 'sigmoid'] for kernel in classical_kernels: classical_svc = SVC(kernel=kernel) classical_svc.fit(sample_train, label_train) classical_score = classical_svc.score(sample_test, label_test) print('%s kernel classification test score: %0.2f' % (kernel, classical_score))
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit.circuit.library import RealAmplitudes ansatz = RealAmplitudes(num_qubits=2, reps=1, entanglement='linear') ansatz.draw('mpl', style='iqx') from qiskit.opflow import Z, I hamiltonian = Z ^ Z from qiskit.opflow import StateFn expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(ansatz) import numpy as np point = np.random.random(ansatz.num_parameters) index = 2 from qiskit import Aer from qiskit.utils import QuantumInstance backend = Aer.get_backend('qasm_simulator') q_instance = QuantumInstance(backend, shots = 8192, seed_simulator = 2718, seed_transpiler = 2718) from qiskit.circuit import QuantumCircuit from qiskit.opflow import Z, X H = X ^ X U = QuantumCircuit(2) U.h(0) U.cx(0, 1) # YOUR CODE HERE expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(U) matmult_result =expectation.eval() from qc_grader import grade_lab4_ex1 # Note that the grading function is expecting a complex number grade_lab4_ex1(matmult_result) from qiskit.opflow import CircuitSampler, PauliExpectation sampler = CircuitSampler(q_instance) # YOUR CODE HERE sampler = CircuitSampler(q_instance) # q_instance is the QuantumInstance from the beginning of the notebook expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(U) in_pauli_basis = PauliExpectation().convert(expectation) shots_result = sampler.convert(in_pauli_basis).eval() from qc_grader import grade_lab4_ex2 # Note that the grading function is expecting a complex number grade_lab4_ex2(shots_result) from qiskit.opflow import PauliExpectation, CircuitSampler expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(ansatz) in_pauli_basis = PauliExpectation().convert(expectation) sampler = CircuitSampler(q_instance) def evaluate_expectation(x): value_dict = dict(zip(ansatz.parameters, x)) result = sampler.convert(in_pauli_basis, params=value_dict).eval() return np.real(result) eps = 0.2 e_i = np.identity(point.size)[:, index] # identity vector with a 1 at index ``index``, otherwise 0 plus = point + eps * e_i minus = point - eps * e_i finite_difference = (evaluate_expectation(plus) - evaluate_expectation(minus)) / (2 * eps) print(finite_difference) from qiskit.opflow import Gradient expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(ansatz) shifter = Gradient('fin_diff', analytic=False, epsilon=eps) grad = shifter.convert(expectation, params=ansatz.parameters[index]) print(grad) value_dict = dict(zip(ansatz.parameters, point)) sampler.convert(grad, value_dict).eval().real eps = np.pi / 2 e_i = np.identity(point.size)[:, index] # identity vector with a 1 at index ``index``, otherwise 0 plus = point + eps * e_i minus = point - eps * e_i finite_difference = (evaluate_expectation(plus) - evaluate_expectation(minus)) / 2 print(finite_difference) expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(ansatz) shifter = Gradient() # parameter-shift rule is the default grad = shifter.convert(expectation, params=ansatz.parameters[index]) sampler.convert(grad, value_dict).eval().real expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(ansatz) shifter = Gradient('lin_comb') # parameter-shift rule is the default grad = shifter.convert(expectation, params=ansatz.parameters[index]) sampler.convert(grad, value_dict).eval().real # initial_point = np.random.random(ansatz.num_parameters) initial_point = np.array([0.43253681, 0.09507794, 0.42805949, 0.34210341]) expectation = StateFn(hamiltonian, is_measurement=True).compose(StateFn(ansatz)) gradient = Gradient().convert(expectation) gradient_in_pauli_basis = PauliExpectation().convert(gradient) sampler = CircuitSampler(q_instance) def evaluate_gradient(x): value_dict = dict(zip(ansatz.parameters, x)) result = sampler.convert(gradient_in_pauli_basis, params=value_dict).eval() # add parameters in here! return np.real(result) # Note: The GradientDescent class will be released with Qiskit 0.28.0 and can then be imported as: # from qiskit.algorithms.optimizers import GradientDescent from qc_grader.gradient_descent import GradientDescent gd_loss = [] def gd_callback(nfevs, x, fx, stepsize): gd_loss.append(fx) gd = GradientDescent(maxiter=300, learning_rate=0.01, callback=gd_callback) x_opt, fx_opt, nfevs = gd.optimize(initial_point.size, # number of parameters evaluate_expectation, # function to minimize gradient_function=evaluate_gradient, # function to evaluate the gradient initial_point=initial_point) # initial point import matplotlib import matplotlib.pyplot as plt matplotlib.rcParams['font.size'] = 14 plt.figure(figsize=(12, 6)) plt.plot(gd_loss, label='vanilla gradient descent') plt.axhline(-1, ls='--', c='tab:red', label='target') plt.ylabel('loss') plt.xlabel('iterations') plt.legend(); from qiskit.opflow import NaturalGradient expectation = StateFn(hamiltonian, is_measurement=True).compose(StateFn(ansatz)) natural_gradient = NaturalGradient(regularization='ridge').convert(expectation) natural_gradient_in_pauli_basis = PauliExpectation().convert(natural_gradient) sampler = CircuitSampler(q_instance, caching="all") def evaluate_natural_gradient(x): value_dict = dict(zip(ansatz.parameters, x)) result = sampler.convert(natural_gradient, params=value_dict).eval() return np.real(result) print('Vanilla gradient:', evaluate_gradient(initial_point)) print('Natural gradient:', evaluate_natural_gradient(initial_point)) qng_loss = [] def qng_callback(nfevs, x, fx, stepsize): qng_loss.append(fx) qng = GradientDescent(maxiter=300, learning_rate=0.01, callback=qng_callback) x_opt, fx_opt, nfevs = qng.optimize(initial_point.size, evaluate_expectation, gradient_function=evaluate_natural_gradient, initial_point=initial_point) def plot_loss(): plt.figure(figsize=(12, 6)) plt.plot(gd_loss, 'tab:blue', label='vanilla gradient descent') plt.plot(qng_loss, 'tab:green', label='quantum natural gradient') plt.axhline(-1, c='tab:red', ls='--', label='target') plt.ylabel('loss') plt.xlabel('iterations') plt.legend() plot_loss() from qc_grader.spsa import SPSA spsa_loss = [] def spsa_callback(nfev, x, fx, stepsize, accepted): spsa_loss.append(fx) spsa = SPSA(maxiter=300, learning_rate=0.01, perturbation=0.01, callback=spsa_callback) x_opt, fx_opt, nfevs = spsa.optimize(initial_point.size, evaluate_expectation, initial_point=initial_point) def plot_loss(): plt.figure(figsize=(12, 6)) plt.plot(gd_loss, 'tab:blue', label='vanilla gradient descent') plt.plot(qng_loss, 'tab:green', label='quantum natural gradient') plt.plot(spsa_loss, 'tab:blue', ls='--', label='SPSA') plt.axhline(-1, c='tab:red', ls='--', label='target') plt.ylabel('loss') plt.xlabel('iterations') plt.legend() plot_loss() # Note: The QNSPSA class will be released with Qiskit 0.28.0 and can then be imported as: # from qiskit.algorithms.optimizers import QNSPSA from qc_grader.qnspsa import QNSPSA qnspsa_loss = [] def qnspsa_callback(nfev, x, fx, stepsize, accepted): qnspsa_loss.append(fx) fidelity = QNSPSA.get_fidelity(ansatz, q_instance, expectation=PauliExpectation()) qnspsa = QNSPSA(fidelity, maxiter=300, learning_rate=0.01, perturbation=0.01, callback=qnspsa_callback) x_opt, fx_opt, nfevs = qnspsa.optimize(initial_point.size, evaluate_expectation, initial_point=initial_point) def plot_loss(): plt.figure(figsize=(12, 6)) plt.plot(gd_loss, 'tab:blue', label='vanilla gradient descent') plt.plot(qng_loss, 'tab:green', label='quantum natural gradient') plt.plot(spsa_loss, 'tab:blue', ls='--', label='SPSA') plt.plot(qnspsa_loss, 'tab:green', ls='--', label='QN-SPSA') plt.axhline(-1, c='tab:red', ls='--', label='target') plt.ylabel('loss') plt.xlabel('iterations') plt.legend() plot_loss() autospsa_loss = [] def autospsa_callback(nfev, x, fx, stepsize, accepted): autospsa_loss.append(fx) autospsa = SPSA(maxiter=300, learning_rate=None, perturbation=None, callback=autospsa_callback) x_opt, fx_opt, nfevs = autospsa.optimize(initial_point.size, evaluate_expectation, initial_point=initial_point) def plot_loss(): plt.figure(figsize=(12, 6)) plt.plot(gd_loss, 'tab:blue', label='vanilla gradient descent') plt.plot(qng_loss, 'tab:green', label='quantum natural gradient') plt.plot(spsa_loss, 'tab:blue', ls='--', label='SPSA') plt.plot(qnspsa_loss, 'tab:green', ls='--', label='QN-SPSA') plt.plot(autospsa_loss, 'tab:red', label='Powerlaw SPSA') plt.axhline(-1, c='tab:red', ls='--', label='target') plt.ylabel('loss') plt.xlabel('iterations') plt.legend() plot_loss() H_tfi = -(Z^Z^I)-(I^Z^Z)-(X^I^I)-(I^X^I)-(I^I^X) from qc_grader import grade_lab4_ex3 # Note that the grading function is expecting a Hamiltonian grade_lab4_ex3(H_tfi) from qiskit.circuit.library import EfficientSU2 efficient_su2 = EfficientSU2(3, entanglement="linear", reps=2) tfi_sampler = CircuitSampler(q_instance) def evaluate_tfi(parameters): exp = StateFn(H_tfi, is_measurement=True).compose(StateFn(efficient_su2)) value_dict = dict(zip(efficient_su2.parameters, parameters)) result = tfi_sampler.convert(PauliExpectation().convert(exp), params=value_dict).eval() return np.real(result) # target energy tfi_target = -3.4939592074349326 # initial point for reproducibility tfi_init = np.array([0.95667807, 0.06192812, 0.47615196, 0.83809827, 0.89022282, 0.27140831, 0.9540853 , 0.41374024, 0.92595507, 0.76150126, 0.8701938 , 0.05096063, 0.25476016, 0.71807858, 0.85661325, 0.48311132, 0.43623886, 0.6371297 ]) tfi_result = SPSA(maxiter=300, learning_rate=None, perturbation=None) tfi_result = tfi_result.optimize(tfi_init.size, evaluate_tfi, initial_point=tfi_init) tfi_minimum = tfi_result[1] print("Error:", np.abs(tfi_result[1] - tfi_target)) from qc_grader import grade_lab4_ex4 # Note that the grading function is expecting a floating point number grade_lab4_ex4(tfi_minimum) from qiskit_machine_learning.datasets import ad_hoc_data training_features, training_labels, test_features, test_labels = ad_hoc_data( training_size=20, test_size=10, n=2, one_hot=False, gap=0.5 ) # the training labels are in {0, 1} but we'll use {-1, 1} as class labels! training_labels = 2 * training_labels - 1 test_labels = 2 * test_labels - 1 def plot_sampled_data(): from matplotlib.patches import Patch from matplotlib.lines import Line2D import matplotlib.pyplot as plt plt.figure(figsize=(12,6)) for feature, label in zip(training_features, training_labels): marker = 'o' color = 'tab:green' if label == -1 else 'tab:blue' plt.scatter(feature[0], feature[1], marker=marker, s=100, color=color) for feature, label in zip(test_features, test_labels): marker = 's' plt.scatter(feature[0], feature[1], marker=marker, s=100, facecolor='none', edgecolor='k') legend_elements = [ Line2D([0], [0], marker='o', c='w', mfc='tab:green', label='A', ms=15), Line2D([0], [0], marker='o', c='w', mfc='tab:blue', label='B', ms=15), Line2D([0], [0], marker='s', c='w', mfc='none', mec='k', label='test features', ms=10) ] plt.legend(handles=legend_elements, bbox_to_anchor=(1, 0.6)) plt.title('Training & test data') plt.xlabel('$x$') plt.ylabel('$y$') plot_sampled_data() from qiskit.circuit.library import ZZFeatureMap dim = 2 feature_map = ZZFeatureMap(dim, reps=1) # let's keep it simple! feature_map.draw('mpl', style='iqx') ansatz = RealAmplitudes(num_qubits=dim, entanglement='linear', reps=1) # also simple here! ansatz.draw('mpl', style='iqx') circuit = feature_map.compose(ansatz) circuit.draw('mpl', style='iqx') hamiltonian = Z ^ Z # global Z operators gd_qnn_loss = [] def gd_qnn_callback(*args): gd_qnn_loss.append(args[2]) gd = GradientDescent(maxiter=100, learning_rate=0.01, callback=gd_qnn_callback) from qiskit_machine_learning.neural_networks import OpflowQNN qnn_expectation = StateFn(hamiltonian, is_measurement=True) @ StateFn(circuit) qnn = OpflowQNN(qnn_expectation, input_params=list(feature_map.parameters), weight_params=list(ansatz.parameters), exp_val=PauliExpectation(), gradient=Gradient(), # <-- Parameter-Shift gradients quantum_instance=q_instance) from qiskit_machine_learning.algorithms import NeuralNetworkClassifier #initial_point = np.array([0.2, 0.1, 0.3, 0.4]) classifier = NeuralNetworkClassifier(qnn, optimizer=gd) classifier.fit(training_features, training_labels); predicted = classifier.predict(test_features) def plot_predicted(): from matplotlib.lines import Line2D plt.figure(figsize=(12, 6)) for feature, label in zip(training_features, training_labels): marker = 'o' color = 'tab:green' if label == -1 else 'tab:blue' plt.scatter(feature[0], feature[1], marker=marker, s=100, color=color) for feature, label, pred in zip(test_features, test_labels, predicted): marker = 's' color = 'tab:green' if pred == -1 else 'tab:blue' if label != pred: # mark wrongly classified plt.scatter(feature[0], feature[1], marker='o', s=500, linewidths=2.5, facecolor='none', edgecolor='tab:red') plt.scatter(feature[0], feature[1], marker=marker, s=100, color=color) legend_elements = [ Line2D([0], [0], marker='o', c='w', mfc='tab:green', label='A', ms=15), Line2D([0], [0], marker='o', c='w', mfc='tab:blue', label='B', ms=15), Line2D([0], [0], marker='s', c='w', mfc='tab:green', label='predict A', ms=10), Line2D([0], [0], marker='s', c='w', mfc='tab:blue', label='predict B', ms=10), Line2D([0], [0], marker='o', c='w', mfc='none', mec='tab:red', label='wrongly classified', mew=2, ms=15) ] plt.legend(handles=legend_elements, bbox_to_anchor=(1, 0.7)) plt.title('Training & test data') plt.xlabel('$x$') plt.ylabel('$y$') plot_predicted() qng_qnn_loss = [] def qng_qnn_callback(*args): qng_qnn_loss.append(args[2]) gd = GradientDescent(maxiter=100, learning_rate=0.01, callback=qng_qnn_callback) qnn = OpflowQNN(qnn_expectation, input_params=list(feature_map.parameters), weight_params=list(ansatz.parameters), gradient=NaturalGradient(regularization='ridge'), # <-- using Natural Gradients! quantum_instance=q_instance) classifier = NeuralNetworkClassifier(qnn, optimizer=gd)#, initial_point=initial_point) classifier.fit(training_features, training_labels); def plot_losses(): plt.figure(figsize=(12, 6)) plt.plot(gd_qnn_loss, 'tab:blue', marker='o', label='vanilla gradients') plt.plot(qng_qnn_loss, 'tab:green', marker='o', label='natural gradients') plt.xlabel('iterations') plt.ylabel('loss') plt.legend(loc='best') plot_losses() from qiskit.opflow import I def sample_gradients(num_qubits, reps, local=False): """Sample the gradient of our model for ``num_qubits`` qubits and ``reps`` repetitions. We sample 100 times for random parameters and compute the gradient of the first RY rotation gate. """ index = num_qubits - 1 # you can also exchange this for a local operator and observe the same! if local: operator = Z ^ Z ^ (I ^ (num_qubits - 2)) else: operator = Z ^ num_qubits # real amplitudes ansatz ansatz = RealAmplitudes(num_qubits, entanglement='linear', reps=reps) # construct Gradient we want to evaluate for different values expectation = StateFn(operator, is_measurement=True).compose(StateFn(ansatz)) grad = Gradient().convert(expectation, params=ansatz.parameters[index]) # evaluate for 100 different, random parameter values num_points = 100 grads = [] for _ in range(num_points): # points are uniformly chosen from [0, pi] point = np.random.uniform(0, np.pi, ansatz.num_parameters) value_dict = dict(zip(ansatz.parameters, point)) grads.append(sampler.convert(grad, value_dict).eval()) return grads num_qubits = list(range(2, 13)) reps = num_qubits # number of layers = numbers of qubits gradients = [sample_gradients(n, r) for n, r in zip(num_qubits, reps)] fit = np.polyfit(num_qubits, np.log(np.var(gradients, axis=1)), deg=1) x = np.linspace(num_qubits[0], num_qubits[-1], 200) plt.figure(figsize=(12, 6)) plt.semilogy(num_qubits, np.var(gradients, axis=1), 'o-', label='measured variance') plt.semilogy(x, np.exp(fit[0] * x + fit[1]), 'r--', label=f'exponential fit w/ {fit[0]:.2f}') plt.xlabel('number of qubits') plt.ylabel(r'$\mathrm{Var}[\partial_{\theta 1} \langle E(\theta) \rangle]$') plt.legend(loc='best'); from qiskit.opflow import NaturalGradient def sample_natural_gradients(num_qubits, reps): index = num_qubits - 1 operator = Z ^ num_qubits ansatz = RealAmplitudes(num_qubits, entanglement='linear', reps=reps) expectation = StateFn(operator, is_measurement=True).compose(StateFn(ansatz)) grad = # TODO: ``grad`` should be the natural gradient for the parameter at index ``index``. # Hint: Check the ``sample_gradients`` function, this one is almost the same. grad = NaturalGradient().convert(expectation, params=ansatz.parameters[index]) num_points = 100 grads = [] for _ in range(num_points): point = np.random.uniform(0, np.pi, ansatz.num_parameters) value_dict = dict(zip(ansatz.parameters, point)) grads.append(sampler.convert(grad, value_dict).eval()) return grads num_qubits = list(range(2, 13)) reps = num_qubits # number of layers = numbers of qubits natural_gradients = [sample_natural_gradients(n, r) for n, r in zip(num_qubits, reps)] fit = np.polyfit(num_qubits, np.log(np.var(natural_gradients, axis=1)), deg=1) x = np.linspace(num_qubits[0], num_qubits[-1], 200) plt.figure(figsize=(12, 6)) plt.semilogy(num_qubits, np.var(gradients, axis=1), 'o-', label='vanilla gradients') plt.semilogy(num_qubits, np.var(natural_gradients, axis=1), 's-', label='natural gradients') plt.semilogy(x, np.exp(fit[0] * x + fit[1]), 'r--', label=f'exponential fit w/ {float(fit[0]):.2f}') plt.xlabel('number of qubits') plt.ylabel(r'$\mathrm{Var}[\partial_{\theta 1} \langle E(\theta) \rangle]$') plt.legend(loc='best'); num_qubits = list(range(2, 13)) fixed_depth_global_gradients = [sample_gradients(n, 1) for n in num_qubits] fit = np.polyfit(num_qubits, np.log(np.var(fixed_depth_global_gradients, axis=1)), deg=1) x = np.linspace(num_qubits[0], num_qubits[-1], 200) plt.figure(figsize=(12, 6)) plt.semilogy(num_qubits, np.var(gradients, axis=1), 'o-', label='global cost, linear depth') plt.semilogy(num_qubits, np.var(fixed_depth_global_gradients, axis=1), 'o-', label='global cost, constant depth') plt.semilogy(x, np.exp(fit[0] * x + fit[1]), 'r--', label=f'exponential fit w/ {fit[0]:.2f}') plt.xlabel('number of qubits') plt.ylabel(r'$\mathrm{Var}[\partial_{\theta 1} \langle E(\theta) \rangle]$') plt.legend(loc='best'); num_qubits = list(range(2, 13)) linear_depth_local_gradients = [sample_gradients(n, n, local=True) for n in num_qubits] fit = np.polyfit(num_qubits, np.log(np.var(linear_depth_local_gradients, axis=1)), deg=1) x = np.linspace(num_qubits[0], num_qubits[-1], 200) plt.figure(figsize=(12, 6)) plt.semilogy(num_qubits, np.var(gradients, axis=1), 'o-', label='global cost, linear depth') plt.semilogy(num_qubits, np.var(fixed_depth_global_gradients, axis=1), 'o-', label='global cost, constant depth') plt.semilogy(num_qubits, np.var(linear_depth_local_gradients, axis=1), 'o-', label='local cost, linear depth') plt.semilogy(x, np.exp(fit[0] * x + fit[1]), 'r--', label=f'exponential fit w/ {fit[0]:.2f}') plt.xlabel('number of qubits') plt.ylabel(r'$\mathrm{Var}[\partial_{\theta 1} \langle E(\theta) \rangle]$') plt.legend(loc='best'); num_qubits = list(range(2, 13)) fixed_depth_local_gradients = [sample_gradients(n, 1, local=True) for n in num_qubits] fit = np.polyfit(num_qubits, np.log(np.var(fixed_depth_local_gradients, axis=1)), deg=1) x = np.linspace(num_qubits[0], num_qubits[-1], 200) plt.figure(figsize=(12, 6)) plt.semilogy(num_qubits, np.var(gradients, axis=1), 'o-', label='global cost, linear depth') plt.semilogy(num_qubits, np.var(fixed_depth_global_gradients, axis=1), 'o-', label='global cost, constant depth') plt.semilogy(num_qubits, np.var(linear_depth_local_gradients, axis=1), 'o-', label='local cost, linear depth') plt.semilogy(num_qubits, np.var(fixed_depth_local_gradients, axis=1), 'o-', label='local cost, constant depth') plt.semilogy(x, np.exp(fit[0] * x + fit[1]), 'r--', label=f'exponential fit w/ {fit[0]:.2f}') plt.xlabel('number of qubits') plt.ylabel(r'$\mathrm{Var}[\partial_{\theta 1} \langle E(\theta) \rangle]$') plt.legend(loc='best'); num_qubits = 6 operator = Z ^ Z ^ (I ^ (num_qubits - 4)) def minimize(circuit, optimizer): initial_point = np.random.random(circuit.num_parameters) exp = StateFn(operator, is_measurement=True) @ StateFn(circuit) grad = Gradient().convert(exp) # pauli basis exp = PauliExpectation().convert(exp) grad = PauliExpectation().convert(grad) sampler = CircuitSampler(q_instance, caching="all") def loss(x): values_dict = dict(zip(circuit.parameters, x)) return np.real(sampler.convert(exp, values_dict).eval()) def gradient(x): values_dict = dict(zip(circuit.parameters, x)) return np.real(sampler.convert(grad, values_dict).eval()) return optimizer.optimize(circuit.num_parameters, loss, gradient, initial_point=initial_point) circuit = RealAmplitudes(4, reps=1, entanglement='linear') circuit.draw('mpl', style='iqx') circuit.reps = 5 circuit.draw('mpl', style='iqx') def layerwise_training(ansatz, max_num_layers, optimizer): optimal_parameters = [] fopt = None for reps in range(1, max_num_layers): ansatz.reps = reps # bind already optimized parameters values_dict = dict(zip(ansatz.parameters, optimal_parameters)) partially_bound = ansatz.bind_parameters(values_dict) xopt, fopt, _ = minimize(partially_bound, optimizer) print('Circuit depth:', ansatz.depth(), 'best value:', fopt) optimal_parameters += list(xopt) return fopt, optimal_parameters ansatz = RealAmplitudes(4, entanglement='linear') optimizer = GradientDescent(maxiter=50) np.random.seed(12) fopt, optimal_parameters = layerwise_training(ansatz, 4, optimizer)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
# required imports: from qiskit.visualization import array_to_latex from qiskit.quantum_info import Statevector, random_statevector from qiskit.quantum_info.operators import Operator, Pauli from qiskit import QuantumCircuit from qiskit.circuit.library import HGate, CXGate import numpy as np ket0 = [[1],[0]] array_to_latex(ket0) bra0 = [1,0] array_to_latex(bra0) ket1 = [[0], [1]] bra1 = [0, 1] from qc_grader.challenges.qgss_2023 import grade_lab1_ex1 grade_lab1_ex1([ket1, bra1]) sv_bra0 = Statevector(bra0) sv_bra0 sv_bra0.draw('latex') sv_eq = Statevector([1/2, 3/4, 4/5, 6/8]) sv_eq.draw('latex') sv_eq.is_valid() sv_valid = Statevector([1/2, 1/2, 1/2, 1/2]) from qc_grader.challenges.qgss_2023 import grade_lab1_ex2 grade_lab1_ex2(sv_valid) op_bra0 = Operator(bra0) op_bra0 op_ket0 = Operator(ket0) op_bra0.tensor(op_ket0) braket = np.dot(op_bra0,op_ket0) array_to_latex(braket) ketbra = np.outer(ket0,bra0) array_to_latex(ketbra) braket = np.dot(op_bra0,op_ket0) array_to_latex(braket) bra1ket0 = [0] bra0ket1 = [0] bra1ket1 = [1] ket1bra0 = [[0, 0], [1, 0]] ket0bra1 = [[0, 1], [0, 0]] ket1bra1 = [[0, 0], [0, 1]] from qc_grader.challenges.qgss_2023 import grade_lab1_ex3 grade_lab1_ex3([bra1ket0, bra0ket1, bra1ket1, ket1bra0, ket0bra1, ket1bra1]) answer = ['a'] from qc_grader.challenges.qgss_2023 import grade_lab1_ex4 grade_lab1_ex4(answer) m1 = Operator([[1,1],[0,0]]) array_to_latex(m1) m3 = Operator([[0,1],[1,0]]) array_to_latex(m3) array_to_latex(m1@ket0) m2 = Operator([[1, 0], [0, 1]]) m4 = Operator([[0, 0], [1, 1]]) from qc_grader.challenges.qgss_2023 import grade_lab1_ex5 grade_lab1_ex5([m2, m4]) cnot = CXGate() array_to_latex(cnot) m3.is_unitary() random = Operator(np.array([[ 0.50778085-0.44607116j, -0.1523741 +0.14128434j, 0.44607116+0.50778085j, -0.14128434-0.1523741j ], [ 0.16855994+0.12151822j, 0.55868196+0.38038841j, -0.12151822+0.16855994j, -0.38038841+0.55868196j], [ 0.50778085-0.44607116j, -0.1523741 +0.14128434j, -0.44607116-0.50778085j, 0.14128434+0.1523741j ], [ 0.16855994+0.12151822j, 0.55868196+0.38038841j, 0.12151822-0.16855994j, 0.38038841-0.55868196j]])) random.is_unitary() non_unitary_op = Operator(np.array([0,1,2,3])) from qc_grader.challenges.qgss_2023 import grade_lab1_ex6 grade_lab1_ex6(non_unitary_op) pauli_x = Pauli('X') array_to_latex(pauli_x) pauli_y = Pauli('Y') array_to_latex(pauli_y) pauli_z = Pauli('Z') array_to_latex(pauli_z) op_x = Operator(pauli_x) op_x op_new = np.dot(op_x,ket0) array_to_latex(op_new) result = [[0.+0.j], [-1.+0.j]] from qc_grader.challenges.qgss_2023 import grade_lab1_ex7 grade_lab1_ex7(result) hadamard = HGate() array_to_latex(hadamard) hop = Operator(hadamard) hop.is_unitary() bell = QuantumCircuit(2) bell.h(0) # apply an H gate to the circuit bell.cx(0,1) # apply a CNOT gate to the circuit bell.draw(output="mpl") bell_op = Operator(bell) array_to_latex(bell_op) ghz = QuantumCircuit(3) ############################## # add gates to your circuit here ghz.h(0) ghz.cx(0, 1) ghz.cx(1, 2) ############################## ghz.draw(output='mpl') from qc_grader.challenges.qgss_2023 import grade_lab1_ex8 grade_lab1_ex8(ghz) plus_state = Statevector.from_label("+") plus_state.draw('latex') plus_state plus_state.probabilities_dict() # run this cell multiple times to show collapsing into one state or the other res = plus_state.measure() res qc = QuantumCircuit(1,1) qc.h(0) qc.measure(0, 0) qc.draw(output="mpl") sv_bell = Statevector([np.sqrt(1/2), 0, 0, np.sqrt(1/2)]) sv_bell.draw('latex') sv_bell.probabilities_dict() sv_psi_plus = Statevector([0, np.sqrt(1/2), np.sqrt(1/2), 0]) prob_psi_plus = {'01': 0.5000000000000001, '10': 0.5000000000000001} sv_psi_minus = Statevector([0, np.sqrt(1/2), -np.sqrt(1/2), 0]) prob_psi_minus = {'01': 0.5000000000000001, '10': 0.5000000000000001} sv_phi_minus = Statevector([np.sqrt(1/2), 0, 0, -np.sqrt(1/2)]) prob_phi_minus = {'00': 0.5000000000000001, '11': 0.5000000000000001} from qc_grader.challenges.qgss_2023 import grade_lab1_ex9 grade_lab1_ex9([prob_psi_plus, prob_psi_minus, prob_phi_minus]) qft = QuantumCircuit(2) ############################## # add gates to your circuit here qft.h(1) qft.cp(np.pi/2, 0, 1) qft.h(0) qft.swap(0, 1) ############################## qft.draw(output='mpl') from qc_grader.challenges.qgss_2023 import grade_lab1_ex10 grade_lab1_ex10(qft) U = Operator(qft) array_to_latex(U)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
%set_env QC_GRADE_ONLY=true from qiskit.circuit import QuantumCircuit from qiskit.primitives import Estimator, Sampler from qiskit.quantum_info import SparsePauliOp from qiskit.visualization import plot_histogram import numpy as np import matplotlib.pyplot as plt plt.style.use('dark_background') # optional # create excited |1> state qc_1 = QuantumCircuit(1) qc_1.x(0) qc_1.draw('mpl') # create superposition |+> state qc_plus = QuantumCircuit(1) qc_plus.h(0) qc_plus.draw('mpl') qc_1.measure_all() qc_plus.measure_all() sampler = Sampler() job_1 = sampler.run(qc_1) job_plus = sampler.run(qc_plus) job_1.result().quasi_dists job_plus.result().quasi_dists legend = ["Excited State", "Plus State"] # TODO: Excited State does not appear plot_histogram([job_1.result().quasi_dists[0], job_plus.result().quasi_dists[0]], legend=legend) qc_1.remove_final_measurements() qc_plus.remove_final_measurements() # rotate into the X-basis qc_1.h(0) qc_plus.h(0) qc_1.measure_all() qc_plus.measure_all() sampler = Sampler() job_1 = sampler.run(qc_1) job_plus = sampler.run(qc_plus) plot_histogram([job_1.result().quasi_dists[0], job_plus.result().quasi_dists[0]], legend=legend) qc2_1 = QuantumCircuit(1) qc2_1.x(0) qc2_plus = QuantumCircuit(1) qc2_plus.h(0) obsvs = list(SparsePauliOp(['Z', 'X'])) estimator = Estimator() job2_1 = estimator.run([qc2_1]*len(obsvs), observables=obsvs) job2_plus = estimator.run([qc2_plus]*len(obsvs), observables=obsvs) job2_1.result() # TODO: make this into module that outputs a nice table print(f' | <Z> | <X> ') print(f'----|------------------') print(f'|1> | {job2_1.result().values[0]} | {job2_1.result().values[1]}') print(f'|+> | {job2_plus.result().values[0]} | {job2_plus.result().values[1]}') # this is a correct answer: obsv = SparsePauliOp('X').tensor(SparsePauliOp(['X', 'Z'], coeffs=[1, -1])) + SparsePauliOp('Z').tensor(SparsePauliOp(['X', 'Z'], coeffs=[1, 1])) from qc_grader.challenges.qgss_2023 import grade_lab2_ex1 grade_lab2_ex1(obsv) from qiskit.circuit import Parameter theta = Parameter('θ') qc = QuantumCircuit(2) qc.h(0) qc.cx(0, 1) qc.ry(theta, 0) qc.draw('mpl') # this is a correct answer num_params = 21 angles=[[angle] for angle in np.linspace(-np.pi, np.pi, num_params)] estimator = Estimator() job = estimator.run([qc]*len(angles), observables=[obsv]*len(angles), parameter_values=angles) exps = job.result().values plt.plot(angles, exps, marker='x', ls='-', color='green') plt.plot(angles, [2]*len(angles), ls='--', color='red', label='Classical Bound') plt.plot(angles, [-2]*len(angles), ls='--', color='red') plt.xlabel('angle (rad)') plt.ylabel('CHSH Witness') plt.legend(loc=4) from qc_grader.challenges.qgss_2023 import grade_lab2_ex2 grade_lab2_ex2(obsv, angles) from qiskit.circuit import ClassicalRegister, QuantumRegister theta = Parameter('θ') qr = QuantumRegister(1, 'q') qc = QuantumCircuit(qr) qc.ry(theta, 0) qc.draw('mpl') tele_qc = qc.copy() bell = QuantumRegister(2, 'Bell') alice = ClassicalRegister(2, 'Alice') bob = ClassicalRegister(1, 'Bob') tele_qc.add_register(bell, alice, bob) tele_qc.draw('mpl') # create Bell state with other two qubits tele_qc.barrier() tele_qc.h(1) tele_qc.cx(1, 2) tele_qc.barrier() tele_qc.draw('mpl') # alice operates on her qubits tele_qc.cx(0, 1) tele_qc.h(0) tele_qc.barrier() tele_qc.draw('mpl') tele_qc.measure([qr[0], bell[0]], alice) tele_qc.draw('mpl') # either pairs are correct # tele_qc.x(2).c_if(alice[1], 1) # tele_qc.z(2).c_if(alice[0], 1) with tele_qc.if_test((alice[1], 1)): tele_qc.x(2) with tele_qc.if_test((alice[0], 1)): tele_qc.z(2) tele_qc.draw('mpl') tele_qc.barrier() tele_qc.measure(bell[1], bob) tele_qc.draw('mpl') from qc_grader.challenges.qgss_2023 import grade_lab2_ex3 grade_lab2_ex3(tele_qc, theta, 5*np.pi/7) from qiskit_aer.primitives import Sampler angle = 5*np.pi/7 sampler = Sampler() qc.measure_all() job_static = sampler.run(qc.bind_parameters({theta: angle})) job_dynamic = sampler.run(tele_qc.bind_parameters({theta: angle})) print(f"Original Dists: {job_static.result().quasi_dists[0].binary_probabilities()}") print(f"Teleported Dists: {job_dynamic.result().quasi_dists[0].binary_probabilities()}") from qiskit.result import marginal_counts # this is correct tele_counts = marginal_counts(job_dynamic.result().quasi_dists[0].binary_probabilities(), indices=[2]) legend = ['Original State', 'Teleported State'] plot_histogram([job_static.result().quasi_dists[0].binary_probabilities(), tele_counts], legend=legend) from qc_grader.challenges.qgss_2023 import grade_lab2_ex4 grade_lab2_ex4(tele_counts, job_dynamic.result().quasi_dists[0]) import qiskit.tools.jupyter %qiskit_version_table
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
# upgrade/update pip library !pip install --upgrade pip # install the last official version of the grader from IBM's Qiskit Community !pip install git+https://github.com/qiskit-community/Quantum-Challenge-Grader.git@main # import the quantum circuit, Aer, # and execute instruction # from the IBM' Qiskit library from qiskit import QuantumCircuit, Aer, execute # import the numpy library import numpy as np # import the plot histogram function # from the IBM's Qiskit Visualization module from qiskit.visualization import plot_histogram # import the plotting from # the Matplotlib's Pyplot module import matplotlib.pyplot as plt # import the GCD (Greatest Common Divisor) # from the built-in mathematics module from math import gcd # define the function to genera the quantum circuit # for the Quantum Fourier Transform (QFT) on n qubits def qft(n): # creates a quantum circuit with n qubits, # implementing the Quantum Fourier Transform (QFT) circuit = QuantumCircuit(n) # define the function to perform the Swap gates # on the quantum registers of the quantum circuit # for the Quantum Fourier Transform (QFT) on n qubits def swap_registers( circuit, n ): # for a number of iterations equal to half of # the number of qubits used on the quantum circuit # for the Quantum Fourier Transform (QFT) for qubit in range( n // 2 ): # apply the Swap gate between the kth qubit and # the (n - k)th qubit on the quantum register defined before circuit.swap( qubit, ( n - qubit - 1 ) ) # return the quantum circuit with the Swap gates # applied on the n qubits of the quantum register, # to implement the Quantum Fourier Transform (QFT) return circuit # define the function to perform the Controlled-Phase gates # on the quantum registers of the quantum circuit # for the Quantum Fourier Transform (QFT) on n qubits # (it is applied to the first n qubits, # and without the Swap gates performed) def qft_rotations( circuit, n ): # if it is the last opposite iteration if n == 0: # return with the Controlled-Phase gates # on the quantum registers of the quantum circuit # for the Quantum Fourier Transform (QFT) on n qubits # (it is applied to the first n qubits, # and without the Swap gates performed) return circuit # iterates on the opposite direction, # setting a new nth iteration n -= 1 # apply the Hadamard gate to the kth qubit, # on the quantum register defined before, # and iterating on the opposite direction circuit.h(n) # for the remaining qubits to consider # i the kth opposite iteration for qubit in range(n): # apply the Controlled-Phase gate for # the theta angle equal to (pi / 2)^(n - k), # with control on the nth qubit and target on the kth qubit circuit.cp( ( np.pi / 2 )**( n - qubit ), qubit, n ) # call this fuction recursively for # the next opposite iteration qft_rotations( circuit, n ) # perform the Controlled-Phase gates # on the quantum registers of the quantum circuit # for the Quantum Fourier Transform (QFT) on n qubits # (it is applied to the first n qubits, # and without the Swap gates performed) qft_rotations( circuit, n ) # perform the Swap gates on the quantum registers of # the quantum circuit for the Quantum Fourier Transform (QFT) on n qubits swap_registers( circuit, n ) # return the quantum circuit with n qubits, # implementing the Quantum Fourier Transform (QFT) return circuit # define the function to genera the quantum circuit # for the Inverse Quantum Fourier Transform (IQFT) on n qubits def qft_dagger( circuit, n ): # note: do not forget to apply again the Swap gates # to peform its inverse operation # for a number of iterations equal to half of # the number of qubits used on the quantum circuit # for the Inverse Quantum Fourier Transform (IQFT) for qubit in range( n // 2 ): # apply the Swap gate between the kth qubit and # the (n - k)th qubit on the quantum register defined before circuit.swap( qubit, ( n - qubit - 1 ) ) # for each number of qubits of the quantum register defined before, # to consider in the current jth iteration for j in range(n): # for each mth qubit of the quantum register defined before, # to consider in the current iteration for m in range(j): # apply the Controlled-Phase gate for # the theta angle equal to -pi / ( 2^( j - m ) ), # with control on the mth qubit and target on the jth qubit qc.cp( -np.pi / float( 2**( j - m ) ), m, j ) # apply the Hadamard gate to the jth qubit # on the quantum register defined before qc.h(j) # define the size n of the quantum register to # store the phase information phase_register_size = 4 # create a quantum circuit with a quantum register # with n qubits and a classical register with n bits, # to implement the Quantum Phase Estimation (QPE) for n = 4 qubits qpe4 = QuantumCircuit( ( phase_register_size + 1 ), phase_register_size ) #################################################### #### insert your code here #### # define the function to perform the Quantum Hadamard Transform on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE) def apply_quantum_hadamard_transform( circuit, n ): # for each qubit of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE) for n qubits for qubit_idx in range(n): # apply the Hadamard gate to the current ith qubit circuit.h(qubit_idx) # define the function to perform the Controlled-Phase gates on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE), # as part of the Quantum Fourier Transform (QFT) def apply_controlled_phases( theta, circuit, n ): # for each ith step according to # the number of n qubits used for step in range(n): # compute the iteration parameter t # as a power of 2, according to the current step t = 2**step # for each iteration according to # the iteration parameter t for _ in range(t): # apply the Controlled-Phase gate for the theta angle, # with control on the ith qubit and target on the last qubit circuit.cp( theta, step, n ) # define the function to perform the Swap gates on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE), # as part of the Quantum Fourier Transform (QFT) def apply_swaps( circuit, n ): # for a number of iterations equal to half of # the number of phase counting qubits used # on the resepective quantum circuit # for the Quantum Fourier Transform (QFT) for qubit_idx in range( phase_register_size // 2 ): # apply the Swap gate between the kth qubit and # the (n - k)th qubit on the quantum register defined before circuit.swap( qubit_idx, ( n - qubit_idx - 1 ) ) # define the function to perform # the Inverse Quantum Fourier Transform (IQFT) on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE) def apply_quantum_fourier_transform_inverse( circuit, n ): # for each qubit on the quantum register for j in range(n): # for each additional mth qubit ranging to # the current jth qubit being iterated before for m in range(j): # apply the Controlled-Phase gate for # the theta angle equal to -pi / ( 2^( j - m ) ), # with control on the mth qubit and target on the jth qubit circuit.cp( -np.pi / float( 2**( j - m ) ), m, j ) # apply the Hadamard gate to the jth qubit (system's qubit) circuit.h(j) # define the function to perform a measurement of # all the n qubits on the quantum register of a quantum circuit, # and storing the classical outcomes on the n bits of # the classical register of that same quantum circuit def measure_all_qubits(circuit, n): # for each pair of qubits and bits for j in range(n): # measure the current qubit on the quantum register, # and stores the classical outcome obtained # in the current bit on the classical register circuit.measure(j, j) # define the function to perform the Quantum Phase Estimation (QPE) # according to a theta angle given, on a quantum circuit of n qubits def quantum_phase_estimation( theta, circuit, n ): # perform the Quantum Hadamard Transform on # the n qubits of the quantum register of # the quantum circuit implementing # the Quantum Phase Estimation (QPE) apply_quantum_hadamard_transform( circuit, n ) # apply the Pauli-X gate to the last qubit on # the quantum register of the quantum circuit of # the Quantum Phase Estimation (QPE) circuit.x(n) # apply a barrier to the quantum circuit of # the Quantum Phase Estimation (QPE) circuit.barrier() # perform the Controlled-Phase gates on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE), # as part of the Quantum Fourier Transform (QFT) apply_controlled_phases( theta, circuit, n ) # apply a barrier to the quantum circuit of # the Quantum Phase Estimation (QPE) circuit.barrier() # perform the Swap gates on the n qubits of # the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE), # as part of the Quantum Fourier Transform (QFT) apply_swaps( circuit, n ) # apply a barrier to the quantum circuit of # the Quantum Phase Estimation (QPE) circuit.barrier() # perform the Inverse Quantum Fourier Transform (IQFT) on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE) apply_quantum_fourier_transform_inverse( circuit, n ) # apply a barrier to the quantum circuit of # the Quantum Phase Estimation (QPE) circuit.barrier() # perform a measurement of all the n qubits on # the quantum register of the quantum circuit of # the Quantum Phase Estimation (QPE) and storing # the classical outcomes on the n bits of # the classical register of that same quantum circuit measure_all_qubits( circuit, n ) #################################################### # define the theta angle to be equal to (2 * pi) / 3 theta = ( 2 * np.pi ) / 3 # perform the Quantum Phase Estimation (QPE) # according to the theta angle defined, # on the quantum circuit of n qubits defined before quantum_phase_estimation( theta, qpe4, phase_register_size ) # draw the quantum circuit implementing # the Quantum Phase Estimation (QPE) defined before qpe4.draw("mpl") # run this cell to simulate 'qpe4' and # to plot the histogram of the result # create the Aer Simulator object sim = Aer.get_backend("aer_simulator") # define the number of shots shots = 20000 # execute the simulation for the Quantum Phase Estimation (QPE), # with n = 4 counting qubits, and retrieve # the result counts of this quantum simulation count_qpe4 = execute( qpe4, sim, shots=shots ).result().get_counts() # plot the histogram of the result counts of the quantum simulation # for the Quantum Phase Estimation (QPE), with n = 4 counting qubits plot_histogram( count_qpe4, figsize=(9,5) ) # submit your answer # import the grader for the exercise 1 of the lab 3 from qc_grader.challenges.qgss_2023 import grade_lab3_ex1 # grade the exercise 1 of the lab 3 grade_lab3_ex1( count_qpe4 ) # process the result count data to determine accuracy of # the estimated phase and grab the highest probability measurement # define the maximum number of counts which will be obtained max_binary_counts = 0 # define the maximum binary value which will be obtained max_binary_val = "" # for each count obtained from the quantum simulation of # the Quantum Phase Estimation (QPE) for key, item in count_qpe4.items(): # if the current number of counts is greater than # the current maximum number of counts obtained if item > max_binary_counts: # update the maximum number of counts obtained max_binary_counts = item # update the maximum binary value obtained max_binary_val = key ######################################### #### your function to convert a binary #### #### string to a decimal number goes here #### # define the function to convert # a binary string to a decimal number def bin_to_decimal( binary_string ): # return a binary string # converted to a decimal number return int( binary_string, 2 ) # calculate the estimated phase obtained # from the quantum simulation of # the Quantum Phase Estimation (QPE) estimated_phase = ( bin_to_decimal(max_binary_val) / 2**phase_register_size ) # calculate the phase accuracy # which can be obtained from # the quantum simulation of # the Quantum Phase Estimation (QPE) # with the quantum circuit defined before, # inverse of the highest power of 2 # (i.e. smallest decimal) this quantum circuit can estimate phase_accuracy_window = 2**( -phase_register_size ) # submit your answer # import the grader for the exercise 2 of the lab 3 from qc_grader.challenges.qgss_2023 import grade_lab3_ex2 # grade the exercise 2 of the lab 3 grade_lab3_ex2( [ estimated_phase, phase_accuracy_window ] ) # import the IBM's Provider from # the Qiskit's IBM Provider module from qiskit_ibm_provider import IBMProvider # import the transpile function from # the IBM's Qikist Compiler module from qiskit.compiler import transpile # create an IBM's Provider object provider = IBMProvider() # define the hub for the IBM's Provider hub = "summer-school-6" # define the group for the IBM's Provider group = "group-3" # define the project for the IBM's Provider project = "7048813929" # define the backend's name for the IBM's Provider backend_name = "ibmq_manila" # retrieve the backend from the IBM's Provider backend = provider.get_backend( backend_name, instance=f"{hub}/{group}/{project}" ) ########################################## #### your code goes here #### # define the initial maximum quantum circuit depth obtained max_depth = 1e-20 # define the initial minimum quantum circuit depth obtained min_depth = 1e20 # define the number of trials to transpile/optimize # the quantum circuit for the Quantum Phase Estimation (QPE) num_trials = 10 # for each trial to transpile/optimize the quantum circuit # for the Quantum Phase Estimation (QPE) for _ in range(num_trials): # transpile/optimize the quantum circuit # for the Quantum Phase Estimation (QPE), # for the current considering trial transpiled_qpe4 = transpile( qpe4, backend, optimization_level=3 ) # retrieve the quantum circuit depth of # the transpiled/optimized quantum circuit # for the Quantum Phase Estimation (QPE) transpiled_qpe4_depth = transpiled_qpe4.depth() # if the quantum circuit depth of # the transpiled/optimized quantum circuit # for the Quantum Phase Estimation (QPE) # is greater than the current maximum # quantum circuit depth obtained if transpiled_qpe4_depth > max_depth: # update the maximum quantum circuit depth # obtained with the current quantum circuit depth max_depth = transpiled_qpe4_depth # update the quantum circuit with the maximum depth # with the current quantum circuit transpiled/optimized max_depth_qpe = transpiled_qpe4 # if the quantum circuit depth of # the transpiled/optimized quantum circuit # for the Quantum Phase Estimation (QPE) # is lower than the current minimum # quantum circuit depth obtained if transpiled_qpe4_depth < min_depth: # update the minimum quantum circuit depth # obtained with the current quantum circuit depth min_depth = transpiled_qpe4_depth # update the quantum circuit with the minimum depth # with the current quantum circuit transpiled/optimized min_depth_qpe = transpiled_qpe4 ########################################## # submit your answer # import the grader for the exercise 3 of the lab 3 from qc_grader.challenges.qgss_2023 import grade_lab3_ex3 # grade the exercise 3 of the lab 3 grade_lab3_ex3( [ max_depth_qpe, min_depth_qpe ] ) # define the number of shots #shots = 2000 # OPTIONAL: run the minimum depth quantum circuit for # the Quantum Phase Estimation (QPE) # execute and retrieve the job for the simulation # for the Quantum Phase Estimation (QPE), # with n = 4 counting qubits, and retrieve # the result counts of this quantum simulation, # using the minimum quantum circuit depth #job_min_qpe4 = backend.run( min_depth_qpe, sim, shots=shots ) # print the id of the job of the simulation # for the Quantum Phase Estimation (QPE), # with n = 4 counting qubits, and retrieve # the result counts of this quantum simulation, # using the minimum quantum circuit depth #print( job_min_qpe4.job_id() ) # gather the result counts data # execute the simulation for the Quantum Phase Estimation (QPE), # with n = 4 counting qubits, and retrieve # the result counts of this quantum simulation, # using the minimum quantum circuit depth #count_min_qpe4 = job_min_qpe4.result().get_counts() # plot the histogram of the result counts of the quantum simulation # for the Quantum Phase Estimation (QPE), with n = 4 counting qubits, # and using the minimum quantum circuit depth #plot_histogram( count_min_qpe4, figsize=(9,5) ) # OPTIONAL: run the maximum depth quantum circuit for # the Quantum Phase Estimation (QPE) # execute and retrieve the job for the simulation # for the Quantum Phase Estimation (QPE), # with n = 4 counting qubits, and retrieve # the result counts of this quantum simulation, # using the maximum quantum circuit depth #job_max_qpe4 = backend.run( max_depth_qpe, sim, shots=shots ) # print the id of the job of the simulation # for the Quantum Phase Estimation (QPE), # with n = 4 counting qubits, and retrieve # the result counts of this quantum simulation, # using the maximum quantum circuit depth #print( job_max_qpe4.job_id() ) # gather the result counts data # execute the simulation for the Quantum Phase Estimation (QPE), # with n = 4 counting qubits, and retrieve # the result counts of this quantum simulation, # using the maximum quantum circuit depth #count_max_qpe4 = job_max_qpe4.result().get_counts() # plot the histogram of the result counts of the quantum simulation # for the Quantum Phase Estimation (QPE), with n = 4 counting qubits, # and using the maximum quantum circuit depth #plot_histogram( count_max_qpe4, figsize=(9,5) ) # define the function to perform the Quantum Hadamard Transform on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE) def apply_quantum_hadamard_transform( circuit, n ): # for each qubit of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE) for n qubits for qubit_idx in range(n): # apply the Hadamard gate to the current ith qubit circuit.h(qubit_idx) # define the function to perform the Controlled-Phase gates on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE), # as part of the Quantum Fourier Transform (QFT) def apply_controlled_phases( theta, circuit, n ): # for each ith step according to # the number of n qubits used for step in range(n): # compute the iteration parameter t # as a power of 2, according to the current step t = 2**step # for each iteration according to # the iteration parameter t for _ in range(t): # apply the Controlled-Phase gate for the theta angle, # with control on the ith qubit and target on the last qubit circuit.cp( theta, step, n ) # define the function to perform the Swap gates on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE), # as part of the Quantum Fourier Transform (QFT) def apply_swaps( circuit, n ): # for a number of iterations equal to half of # the number of phase counting qubits used # on the resepective quantum circuit # for the Quantum Fourier Transform (QFT) for qubit_idx in range( phase_register_size // 2 ): # apply the Swap gate between the kth qubit and # the (n - k)th qubit on the quantum register defined before circuit.swap( qubit_idx, ( n - qubit_idx - 1 ) ) # define the function to perform # the Inverse Quantum Fourier Transform (IQFT) on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE) def apply_quantum_fourier_transform_inverse( circuit, n ): # for each jth qubit on the quantum register for j in range(n): # for each additional mth qubit ranging to # the current jth qubit being iterated before for m in range(j): # apply the Controlled-Phase gate for # the theta angle equal to -pi / ( 2^( j - m ) ), # with control on the mth qubit and target on the jth qubit circuit.cp( -np.pi / float( 2**( j - m ) ), m, j ) # apply the Hadamard gate to the jth qubit circuit.h(j) # define the function to perform a measurement of # all the n qubits on the quantum register of a quantum circuit, # and storing the classical outcomes on the n bits of # the classical register of that same quantum circuit def measure_all_qubits( circuit, n ): # for each pair of qubits and bits for j in range(n): # measure the current qubit on the quantum register, # and stores the classical outcome obtained # in the current bit on the classical register circuit.measure(j, j) # define the function to create a quantum circuit, # implementing the Quantum Phase Estimation (QPE) on (n + 1) qubits def qpe_circuit(register_size): ######################################### #### your code goes here #### # define the theta phase angle to estimate theta = 1/7 # create the quantum circuit with a quantum register with (n + 1) qubits # and a classical register with n bits, intended to implement # the Quantum Phase Estimation (QPE) on n qubits qpe = QuantumCircuit( ( register_size + 1 ), register_size ) # perform the Quantum Hadamard Transform on # the n qubits of the quantum register of # the quantum circuit implementing # the Quantum Phase Estimation (QPE) apply_quantum_hadamard_transform( qpe, register_size ) # apply the Pauli-X gate to the last qubit on # the quantum register of the quantum circuit of # the Quantum Phase Estimation (QPE) qpe.x(register_size) # apply a barrier to the quantum circuit of # the Quantum Phase Estimation (QPE) qpe.barrier() # perform the Controlled-Phase gates on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE), # as part of the Quantum Fourier Transform (QFT) apply_controlled_phases( theta, qpe, register_size ) # apply a barrier to the quantum circuit of # the Quantum Phase Estimation (QPE) qpe.barrier() # perform the Swap gates on the n qubits of # the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE), # as part of the Quantum Fourier Transform (QFT) apply_swaps( qpe, register_size ) # apply a barrier to the quantum circuit of # the Quantum Phase Estimation (QPE) qpe.barrier() # perform the Inverse Quantum Fourier Transform (IQFT) on # the n qubits of the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE) apply_quantum_fourier_transform_inverse( qpe, register_size ) # apply a barrier to the quantum circuit of # the Quantum Phase Estimation (QPE) qpe.barrier() # perform a measurement of all the n qubits on # the quantum register of the quantum circuit of # the Quantum Phase Estimation (QPE) and storing # the classical outcomes on the n bits of # the classical register of that same quantum circuit measure_all_qubits( qpe, register_size ) # return the quantum circuit, implementing # the Quantum Phase Estimation (QPE) on n qubits return qpe ######################################### # run this cell to simulate 'qpe' and # to plot the histogram of the result # define several quantum register sizes # equal to n, allowing to vary them #reg_size = 4 reg_size = 5 #reg_size = 6 #reg_size = 7 #reg_size = 8 # create a quantum circuit for # the Quantum Phase Estimation (QPE), # given the quantum register defined before, # with n counting qubits qpe_check = qpe_circuit( reg_size ) # create the Aer Simulator object sim = Aer.get_backend("aer_simulator") # define the number of shots shots = 10000 # execute the simulation for the Quantum Phase Estimation (QPE), # with n counting qubits, and retrieve its result counts count_qpe = execute( qpe_check, sim, shots=shots ).result().get_counts() # plot the histogram of the result counts of the quantum simulation # for the Quantum Phase Estimation (QPE), with n counting qubits plot_histogram( count_qpe, figsize=(9,5) ) # process the result count data to determine accuracy of # the estimated phase and grab the highest probability measurement # define the maximum number of counts which will be obtained max_binary_counts = 0 # define the maximum binary value which will be obtained max_binary_val = "" # for each count obtained from the quantum simulation of # the Quantum Phase Estimation (QPE) for key, item in count_qpe.items(): # if the current number of counts is greater than # the current maximum number of counts obtained if item > max_binary_counts: # update the maximum number of counts obtained max_binary_counts = item # update the maximum binary value obtained max_binary_val = key ######################################### #### your function to convert a binary #### #### string to a decimal number goes here #### # define the function to convert # a binary string to a decimal number def bin_to_decimal( binary_string ): # return a binary string # converted to a decimal number return int( binary_string, 2 ) # calculate the estimated phase obtained # from the quantum simulation of # the Quantum Phase Estimation (QPE) estimated_phase = ( bin_to_decimal(max_binary_val) / 2**reg_size ) # print the estimated phase obtained # from the quantum simulation of # the Quantum Phase Estimation (QPE) print("Estimated Phase:", estimated_phase) # calculate the phase accuracy # which can be obtained from # the quantum simulation of # the Quantum Phase Estimation (QPE) # with the quantum circuit defined before, # inverse of the highest power of 2 # (i.e. smallest decimal) this quantum circuit can estimate phase_accuracy_window = 2**( -reg_size ) # print the phase accuracy # which can be obtained from # the quantum simulation of # the Quantum Phase Estimation (QPE) # with the quantum circuit defined before, # inverse of the highest power of 2 # (i.e. smallest decimal) this quantum circuit can estimate print("Phase Accuracy Window:", phase_accuracy_window) # define the theta phase angle, # which was pretended to be estimated theta = 1 / 7 # compute the accuracy of the estimated phase, # as the distance between the estimated phase # and the theta phase angle, which was pretended to be estimated accuracy_estimated_phase = abs( theta - estimated_phase ) # print the accuracy of the estimated phase, # as the distance between the estimated phase # and the theta phase angle, which was pretended to be estimated print("Accuracy of the Estimated Phase:", accuracy_estimated_phase) ### put your answer here ### # to estimate accurately the phase information to be within 2^(-6) # we need n + 1 = 6 (=) n = 5 qubits to store the phase information required_register_size = 5 ### submit your answer ### # import the grader for the exercise 4 of the lab 3 from qc_grader.challenges.qgss_2023 import grade_lab3_ex4 # grade the exercise 4 of the lab 3 grade_lab3_ex4( required_register_size ) # create 7 mod 15 unitary operator # for a quantum circuit N = 15 # define the number of m qubits required # for the 7 mod 15 operator to be executed m = int( np.ceil( np.log2( N ) ) ) # create the quantum circuit with # a quantum register of m qubits # to implement the 7 mod 15 unitary operator U_qc = QuantumCircuit( m ) # apply the Pauli-X gate to all the m qubits of # the quantum register of the quantum circuit # implementing the 7 mod 15 unitary operator U_qc.x( range(m) ) # apply the Swap gate between the 2nd qubit and # the 3rd qubit on the quantum register of # the quantum circuit implementing # the 7 mod 15 unitary operator U_qc.swap(1, 2) # apply the Swap gate between the 3rd qubit and # the 4th qubit on the quantum register of # the quantum circuit implementing # the 7 mod 15 unitary operator U_qc.swap(2, 3) # apply the Swap gate between the 1st qubit and # the 4th qubit on the quantum register of # the quantum circuit implementing # the 7 mod 15 unitary operator U_qc.swap(0, 3) # convert the quantum circuit implementing # the 7 mod 15 unitary operator to # a quantum unitary gate U = U_qc.to_gate() # define the name of the 7 mod 15 # unitary operator created before U.name ="{}Mod{}".format(7, N) # your code goes here # print the number of qubits print("Num. qubits: m =", m); # define the quantum circuits for the inputs # |1> = |0001>, |2> = |0010>, and |5> = |0101> ######################################### # create the a quantum circuit with m qubits, # for the input state |1> = |0001> qcirc_input_1 = QuantumCircuit(m) # apply the Pauli-X gate to # the 1st qubit of the quantum register of # the quantum circuit defined before qcirc_input_1.x(0) # apply the U gate to all # the m qubits of the quantum register of # the quantum circuit defined before qcirc_input_1.append( U, range(m) ) # measure all the m qubits of # the quantum register of # the quantum circuit defined before qcirc_input_1.measure_all() ######################################### # create the a quantum circuit with m qubits, # for input state |2> = |0010> qcirc_input_2 = QuantumCircuit(m) # apply the Pauli-X gate to # the 2nd qubit of the quantum register of # the quantum circuit defined before qcirc_input_2.x(1) # apply the U gate to all # the m qubits of the quantum register of # the quantum circuit defined before qcirc_input_2.append( U, range(m) ) # measure all the m qubits of # the quantum register of # the quantum circuit defined before qcirc_input_2.measure_all() ######################################### # create the a quantum circuit with m qubits, # for input state |5> = |0101> qcirc_input_5 = QuantumCircuit(m) # apply the Pauli-X gate to # the 1st qubit of the quantum register of # the quantum circuit defined before qcirc_input_5.x(0) # apply the Pauli-X gate to # the 3rd qubit of the quantum register of # the quantum circuit defined before qcirc_input_5.x(2) # apply the U gate to all # the m qubits of the quantum register of # the quantum circuit defined before qcirc_input_5.append( U, range(m) ) # measure all the m qubits of # the quantum register of # the quantum circuit defined before qcirc_input_5.measure_all() ######################################### # run this cell to simulate 'qcirc' and to plot the histogram of the result # create the Aer Simulator object sim = Aer.get_backend("aer_simulator") # define the number of shots shots = 20000 # save the count data for the input state |1> = |0001> input_1 = execute(qcirc_input_1, sim, shots=shots).result().get_counts() # save the count data for the input state |2> = |0010> input_2 = execute(qcirc_input_2, sim, shots=shots).result().get_counts() # save the count data for the input state |5> = |0101> input_5 = execute(qcirc_input_5, sim, shots=shots).result().get_counts() # submit your answer # import the grader for the exercise 5 of the lab 3 from qc_grader.challenges.qgss_2023 import grade_lab3_ex5 # grade the exercise 5 of the lab 3 grade_lab3_ex5( [ input_1, input_2, input_5 ] ) # create an unitary quantum circuit # with a quantum register of m qubits unitary_circ = QuantumCircuit(m) #### your code goes here #### # for each iteration in a range of 2^2 = 4 for _ in range( 2**2 ): # apply the U gate on all # the m qubits on the quantum register unitary_circ.append( U, range(m) ) # create a Unitary Simulator object sim = Aer.get_backend("unitary_simulator") # execute the quantum simulation of # an unitary quantum circuit with # a quantum register of m qubits, # defined before, retrieving its unitary operator unitary = execute( unitary_circ, sim ).result().get_unitary() # submit your answer # import the grader for the exercise 6 of the lab 3 from qc_grader.challenges.qgss_2023 import grade_lab3_ex6 # grade the exercise 6 of the lab 3 grade_lab3_ex6( unitary, unitary_circ ) # define the function to built a 2^k-Controlled-U gate object, # which repeats the action of the operator U, 2^k times def cU_multi(k): # define the size n of the system's quantum register sys_register_size = 4 # create the quantum circuit with n qubits on # the system's quantum register, to build # a 2^k-Controlled-U gate object circ = QuantumCircuit( sys_register_size ) # for each iteration ranging until 2^k for _ in range(2**k): # apply the U gate to all the n qubits on # the system's quantum register of # the quantum circuit to represent # the 2^k-Controlled-U gate circ.append(U, range(sys_register_size)) # convert the operator resulting from the construction of # the quantum circuit defined before, to a quantum gate U_multi = circ.to_gate() # define the name of the 2^k-Controlled-U gate, # as being a "7 Mod 15 gate" U_multi.name = "7Mod15_[2^{}]".format(k) # set this 2^k-Controlled-U gate as multi-qubit gate, # depending on a given control qubit cU_multi = U_multi.control() # return the 2^k-Controlled-U gate object, # which repeats the action of the operator U, 2^k times return cU_multi # define the size m of the quantum register # for the phase counting of the qubits phase_register_size = 8 # define the size n of the quantum register # for the successive applications of # the 2^k-Controlled-U gate defined before cu_register_size = 4 # create the Quantum Circuit needed to run # with m = 8 qubits for the phase counting # and with n = 4 qubits for the successive # applications of the 2^k-Controlled-U gate # defined before, to implement the Shor's Algorithm # for Factoring, based on Quantum Phase Estimation (QPE) shor_qpe = QuantumCircuit( ( phase_register_size + cu_register_size ), phase_register_size ) # perform the Quantum Hadamard Transform on # the m qubits for the phase counting of # the quantum register of the quantum circuit # implementing the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) apply_quantum_hadamard_transform( shor_qpe, phase_register_size ) # apply the Pauli-X gate to the last qubit on # the quantum register of the quantum circuit to # implement the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) shor_qpe.x( phase_register_size ) # apply a barrier to the quantum circuit to # implement the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) shor_qpe.barrier() # for each kth qubit on the quantum register # for the phase counting of the qubits for k in range( phase_register_size ): # retrieve the 2^k-Controlled-U gate object, # which repeats the action of the operator U, # 2^k times, defined before cU = cU_multi(k) # apply the 2^k-Controlled-U gate object, # which repeats the action of the operator U, # 2^k times, defined before, for the kth iteration, # to the quantum circuit to implement # the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) shor_qpe.append( cU, [k] + list( range( phase_register_size, ( phase_register_size + cu_register_size ) ) ) ) # apply a barrier to the quantum circuit to # implement the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) shor_qpe.barrier() # perform the Swap gates on the n qubits of # the quantum register of the quantum circuit # implementing the Quantum Phase Estimation (QPE), # as part of the Quantum Fourier Transform (QFT), # required to build the quantum circuit to implement # the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) apply_swaps(shor_qpe, phase_register_size) # apply a barrier to the quantum circuit to # implement the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) shor_qpe.barrier() # perform the Inverse Quantum Fourier Transform (IQFT) on # the m qubits for the phase counting of # the quantum register of the quantum circuit # implementing the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) apply_quantum_fourier_transform_inverse( shor_qpe, phase_register_size ) # apply a barrier to the quantum circuit to # implement the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) shor_qpe.barrier() # perform a measurement of all # the m qubits for the phase counting of # the quantum register of the quantum circuit # implementing the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) shor_qpe.measure( range( phase_register_size ), range( phase_register_size ) ) # draw the quantum circuit implementing # the quantum circuit to # implement the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) shor_qpe.draw("mpl") # run this cell to simulate 'shor_qpe' and # to plot the histogram of the results # create an Aer Simulator object sim = Aer.get_backend("aer_simulator") # define the number of shots shots = 20000 # execute the quantum simulation for # the quantum circuit for the Shor's Algorithm, # based on Quantum Phase Estimation (QPE), # with n phase counting qubits, and retrieve # the result counts of this quantum simulation shor_qpe_counts = execute(shor_qpe, sim, shots=shots).result().get_counts() # plot the histogram of the result counts of the quantum simulation # for the quantum circuit for the Shor's Algorithm, based on # Quantum Phase Estimation (QPE), with n phase counting qubits plot_histogram( shor_qpe_counts, figsize=(9,5) ) # submit your answer # import the grader for the exercise 7 of the lab 3 from qc_grader.challenges.qgss_2023 import grade_lab3_ex7 # grade the exercise 7 of the lab 3 grade_lab3_ex7( shor_qpe_counts ) # import the Fraction object # from the built-in fractions module from fractions import Fraction # print the number '0.666', # as an unlimited Fraction object print( "Unlimited Fraction(0.666):", Fraction(0.666), '\n') # print the number '0.666', # as a limited Fraction object # with the denominator of 15 print( "Limited Fraction(0.666), with a max. denominator of 15:", Fraction(0.666).limit_denominator(15) ) # create a list with the estimated phases of the result counts # obtained from the execution of the quantum simulation # for the Quantum Phase Estimation (QPE), with n counting qubits estimated_phases = [ bin_to_decimal(binary_val) / 2**phase_register_size for binary_val in shor_qpe_counts ] # print the list with the estimated phases of the result counts # obtained from the execution of the quantum simulation # for the Quantum Phase Estimation (QPE), with n counting qubits print( "Estimated Phases:", estimated_phases ) # create a list of with the estimated phases of the result counts # obtained from the execution of the quantum simulation # for the Quantum Phase Estimation (QPE), with n counting qubits, # represented as Fraction objects with the format s/r shor_qpe_fractions = [ Fraction(estimated_phase).limit_denominator(15) for estimated_phase in estimated_phases ] # print the list of with the estimated phases of the result counts # obtained from the execution of the quantum simulation # for the Quantum Phase Estimation (QPE), with n counting qubits, # represented as Fraction objects with the format s/r print( "Estimated Fractions:", shor_qpe_fractions ) # submit your answer # import the grader for the exercise 8 of the lab 3 from qc_grader.challenges.qgss_2023 import grade_lab3_ex8 # grade the exercise 8 of the lab 3 grade_lab3_ex8( shor_qpe_fractions ) # define the function to create and execute # the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE), # with k phase counting qubits def shor_qpe(k): # define the co-prime a a = 7 # define the number N to factor N = 15 # compute the number m of # additional qubits required m = int( np.ceil( np.log2(N) ) ) ################################################# # step 1. Begin a while loop until a nontrivial guess is found #### your code goes here #### # define the boolean flag to determine # if a non trivial guess was found, initially as False non_trivial_guess_found = False # while no trivial factor guess was found, # execute the while loop while( not non_trivial_guess_found ): ################################################# # step 2a. construct a QPE quantum circuit # with m phase counting qubits to guess # the phase phi = s/r, using the function # cU_multi() defined before #### your code goes here #### # create a quantum circuit for # the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE), # with k phase counting qubits, # and additional m qubits for # the successive applications of # the 2^k-Controlled-U gate defined before qc = QuantumCircuit( ( k + m ), k) # perform the Quantum Hadamard Transform on # the k phase counting qubits of the respective # quantum register of the quantum circuit # for the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) apply_quantum_hadamard_transform( qc, k ) # apply a Pauli-X gate to the last # phase counting qubit of the respective # quantum register of the quantum circuit # for the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) qc.x(k) # apply a barrier to the quantum circuit for # the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE), # with k phase counting qubits, # and additional m qubits for # the successive applications of # the 2^k-Controlled-U gate defined before qc.barrier() # for each kth qubit on the quantum register # for the phase counting of the qubits for k_i in range(k): # retrieve the 2^k-Controlled-U gate object, # which repeats the action of the operator U, # 2^k times, defined before cU = cU_multi(k_i) # apply the 2^k-Controlled-U gate object, # which repeats the action of the operator U, # 2^k times, defined before, for the kth iteration, # to the quantum circuit for the Shor's Algorithm # for Factoring, based on Quantum Phase Estimation (QPE), # with k phase counting qubits, and additional m qubits # for the successive applications of # the 2^k-Controlled-U gate defined before qc.append( cU, [k_i] + list( range( k, ( k + m ) ) ) ) # apply a barrier to the quantum circuit for # the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE), # with k phase counting qubits, # and additional m qubits for # the successive applications of # the 2^k-Controlled-U gate defined before qc.barrier() # perform the Swap gates on the k # phase counting qubits of the respective # quantum register of the quantum circuit # for the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE), # as part of the Quantum Fourier Transform (QFT) apply_swaps( qc, k ) # apply a barrier to the quantum circuit for # the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE), # with k phase counting qubits, # and additional m qubits for # the successive applications of # the 2^k-Controlled-U gate defined before qc.barrier() # perform the Inverse Quantum Fourier Transform (IQFT) on # the k phase counting qubits of the respective # quantum register of the quantum circuit # for the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) apply_quantum_fourier_transform_inverse( qc, k ) # apply a barrier to the quantum circuit for # the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE), # with k phase counting qubits, # and additional m qubits for # the successive applications of # the 2^k-Controlled-U gate defined before qc.barrier() # perform a measurement of all # the k phase counting qubits of the respective # quantum register of the quantum circuit # for the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) qc.measure( range(k), range(k) ) ################################################# # step 2b. run the QPE quantum circuit with a single shot, # record the results and convert the estimated phase # bitstring to a decimal format #### your code goes here #### # create an Aer Simulator object sim = Aer.get_backend("aer_simulator") # define the number of shots shots = 1 # execute the simulation for the Quantum Phase Estimation (QPE), # with n counting qubits, and retrieve the result counts # obtained from this quantum simulation shor_qpe_counts = execute( qc, sim, shots=shots ).result().get_counts() # plot the histogram of the result counts of the quantum simulation # for the Quantum Phase Estimation (QPE), with n counting qubits plot_histogram( shor_qpe_counts, figsize=(9,5) ) # compute the estimated phases from the result counts # obtained from the quantum simulation of the quantum circuit # implementing the Shor's Algorithm for Factoring, # based on Quantum Phase Estimation (QPE) estimated_phases = [ bin_to_decimal( binary_val ) / 2**k for binary_val in shor_qpe_counts ] ################################################# # step 3. use the Fraction object to find the guess for r #### your code goes here #### # convert the estimated phase to a fraction s/r format fraction_s_r = [ Fraction(estimated_phase).limit_denominator(N) for estimated_phase in estimated_phases ][0] # retrieve the numerator s and the denominator r # from the estimated phase represented as a fraction s, r = fraction_s_r.numerator, fraction_s_r.denominator ################################################# # step 4. now that r has been found, use the built-in # greatest common divisor function to determine # the guesses for a factor of N # build the list of guesses for possible non-trivial factors of N guesses = [ gcd( a**( r // 2 ) - 1, N ), gcd( a**( r // 2 ) + 1, N ) ] ################################################# # step 5. for each guess in guesses, check if # at least one is a non-trivial factor, # i.e., ( ( guess != 1 ) or ( guess != N ) ) # and ( N % guess == 0 ) #### your code goes here #### # for each of the guesses computed before for guess in guesses: # if the current guess is not a trivial factor if ( ( ( guess != 1 ) or ( guess != N ) ) and ( N % guess == 0 ) ): # update the boolean flag to determine # if a non trivial guess was found, as True non_trivial_guess_found = True # break the current for loop break ################################################# # step 6. if a non-trivial factor is found return # the list 'guesses', otherwise # continue the while loop # return the list of the guesses, # containing a non-trivial factor of N return guesses ################################################# # submit your circuit # import the grader for the exercise 9 of the lab 3 from qc_grader.challenges.qgss_2023 import grade_lab3_ex9 # grade the exercise 9 of the lab 3 grade_lab3_ex9( shor_qpe ) # import the IBM's Qiskit Jupyter Tools import qiskit.tools.jupyter # show the table of the IBM's Qiskit version %qiskit_version_table
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit import ClassicalRegister, QuantumCircuit, QuantumRegister import numpy as np def step_1_circuit(qr: QuantumRegister, cr: ClassicalRegister) -> QuantumCircuit: # qr is a quantum register with 2 qubits # cr is a classical register with 2 bits qc = QuantumCircuit(qr, cr) ####### your code goes here ####### ##1 Initialization q0, q1 = qr # apply Hadamard on the auxiliary qubit qc.h(q0) # put the system qubit into the |1> state qc.x(q1) ##2 Apply control-U operator as many times as needed to get the least significant phase bit # controlled-S is equivalent to CPhase with angle pi / 2 s_angle = np.pi / 2 # we want to apply controlled-S 2^k times k = 1 # calculate the angle of CPhase corresponding to 2^k applications of controlled-S cphase_angle = s_angle * 2**k # apply the controlled phase gate qc.cp(cphase_angle, q0, q1) ##3 Measure the auxiliary qubit in x-basis into the first classical bit # apply Hadamard to change to the X basis qc.h(q0) # measure the auxiliary qubit into the first classical bit c0, _ = cr qc.measure(q0, c0) return qc qr = QuantumRegister(2, "q") cr = ClassicalRegister(2, "c") qc = QuantumCircuit(qr, cr) qc = step_1_circuit(qr, cr) qc.draw("mpl") # Submit your circuit from qc_grader.challenges.qgss_2023 import grade_lab4_ex1 grade_lab4_ex1(qc) def step_2_circuit(qr: QuantumRegister, cr: ClassicalRegister) -> QuantumCircuit: # qr is a quantum register with 2 qubits # cr is a classical register with 2 bits # begin with the circuit from Step 1 qc = step_1_circuit(qr, cr) ####### your code goes here ####### ##1 Reset and re-initialize the auxiliary qubit q0, q1 = qr # reset the auxiliary qubit qc.reset(q0) # apply Hadamard on the auxiiliary qubit qc.h(q0) ##2 Apply phase correction conditioned on the first classical bit c0, c1 = cr with qc.if_test((c0, 1)): qc.p(-np.pi / 2, q0) ##3 Apply control-U operator as many times as needed to get the next phase bit # controlled-S is equivalent to CPhase with angle pi / 2 s_angle = np.pi / 2 # we want to apply controlled-S 2^k times k = 0 # calculate the angle of CPhase corresponding to 2^k applications of controlled-S cphase_angle = s_angle * 2**k # apply the controlled phase gate qc.cp(cphase_angle, q0, q1) ##4 Measure the auxiliary qubit in x-basis into the second classical bit # apply Hadamard to change to the X basis qc.h(q0) # measure the auxiliary qubit into the first classical bit qc.measure(q0, c1) return qc qr = QuantumRegister(2, "q") cr = ClassicalRegister(2, "c") qc = QuantumCircuit(qr, cr) qc = step_2_circuit(qr, cr) qc.draw("mpl") # Submit your circuit from qc_grader.challenges.qgss_2023 import grade_lab4_ex2 grade_lab4_ex2(qc) from qiskit_aer import AerSimulator sim = AerSimulator() job = sim.run(qc, shots=1000) result = job.result() counts = result.get_counts() counts from qiskit import ClassicalRegister, QuantumCircuit, QuantumRegister import numpy as np def t_gate_ipe_circuit(qr: QuantumRegister, cr: ClassicalRegister) -> QuantumCircuit: # qr is a quantum register with 2 qubits # cr is a classical register with 3 bits qc = QuantumCircuit(qr, cr) ####### your code goes here ####### # Initialization q0, q1 = qr qc.h(q0) qc.x(q1) # Apply control-U operator as many times as needed to get the least significant phase bit t_angle = np.pi / 4 k = 2 cphase_angle = t_angle * 2**k qc.cp(cphase_angle, q0, q1) # Measure the auxiliary qubit in x-basis into the first classical bit qc.h(q0) c0, c1, c2 = cr qc.measure(q0, c0) # Reset and re-initialize the auxiliary qubit qc.reset(q0) qc.h(q0) # Apply phase correction conditioned on the first classical bit with qc.if_test((c0, 1)): qc.p(-np.pi / 2, q0) # Apply control-U operator as many times as needed to get the next phase bit k = 1 cphase_angle = t_angle * 2**k qc.cp(cphase_angle, q0, q1) # Measure the auxiliary qubit in x-basis into the second classical bit qc.h(q0) qc.measure(q0, c1) # Reset and re-initialize the auxiliary qubit qc.reset(q0) qc.h(q0) # Apply phase correction conditioned on the first and second classical bits with qc.if_test((c0, 1)): qc.p(-np.pi / 4, q0) with qc.if_test((c1, 1)): qc.p(-np.pi / 2, q0) # Apply control-U operator as many times as needed to get the next phase bit k = 0 cphase_angle = t_angle * 2**k qc.cp(cphase_angle, q0, q1) # Measure the auxiliary qubit in x-basis into the third classical bit qc.h(q0) qc.measure(q0, c2) return qc qr = QuantumRegister(2, "q") cr = ClassicalRegister(3, "c") qc = QuantumCircuit(qr, cr) qc = t_gate_ipe_circuit(qr, cr) qc.draw("mpl") from qiskit_aer import AerSimulator sim = AerSimulator() job = sim.run(qc, shots=1000) result = job.result() counts = result.get_counts() counts # Submit your circuit from qc_grader.challenges.qgss_2023 import grade_lab4_ex3 grade_lab4_ex3(qc) from qiskit import ClassicalRegister, QuantumCircuit, QuantumRegister import numpy as np def u_circuit(qr: QuantumRegister, cr: ClassicalRegister) -> QuantumCircuit: # qr is a quantum register with 2 qubits # cr is a classical register with 2 bits qc = QuantumCircuit(qr, cr) # Initialization q0, q1 = qr qc.h(q0) qc.x(q1) # Apply control-U operator as many times as needed to get the least significant phase bit u_angle = 2 * np.pi / 3 k = 1 cphase_angle = u_angle * 2**k qc.cp(cphase_angle, q0, q1) # Measure the auxiliary qubit in x-basis into the first classical bit qc.h(q0) c0, c1 = cr qc.measure(q0, c0) # Reset and re-initialize the auxiliary qubit qc.reset(q0) qc.h(q0) # Apply phase correction conditioned on the first classical bit with qc.if_test((c0, 1)): qc.p(-np.pi / 2, q0) # Apply control-U operator as many times as needed to get the next phase bit k = 0 cphase_angle = u_angle * 2**k qc.cp(cphase_angle, q0, q1) # Measure the auxiliary qubit in x-basis into the second classical bit qc.h(q0) qc.measure(q0, c1) return qc qr = QuantumRegister(2, "q") cr = ClassicalRegister(2, "c") qc = QuantumCircuit(qr, cr) qc = u_circuit(qr, cr) qc.draw("mpl") from qiskit_aer import AerSimulator sim = AerSimulator() job = sim.run(qc, shots=1000) result = job.result() counts = result.get_counts() print(counts) success_probability = counts["01"] / counts.shots() print(f"Success probability: {success_probability}") from qiskit import ClassicalRegister, QuantumCircuit, QuantumRegister import numpy as np def u_circuit(qr: QuantumRegister, cr: ClassicalRegister) -> QuantumCircuit: # qr is a quantum register with 2 qubits # cr is a classical register with 1 bits qc = QuantumCircuit(qr, cr) # Initialization q0, q1 = qr qc.h(q0) qc.x(q1) # Apply control-U operator as many times as needed to get the least significant phase bit u_angle = 2 * np.pi / 3 k = 1 cphase_angle = u_angle * 2**k qc.cp(cphase_angle, q0, q1) # Measure the auxiliary qubit in x-basis qc.h(q0) (c0,) = cr qc.measure(q0, c0) return qc qr = QuantumRegister(2, "q") cr = ClassicalRegister(1, "c") qc = QuantumCircuit(qr, cr) qc = u_circuit(qr, cr) qc.draw("mpl") job = sim.run(qc, shots=15) result = job.result() counts = result.get_counts() print(counts) step1_bit: int ####### your code goes here ####### step1_bit = 1 if counts["1"] > counts["0"] else 0 print(step1_bit) # Submit your result from qc_grader.challenges.qgss_2023 import grade_lab4_ex4 grade_lab4_ex4(step1_bit) from qiskit import ClassicalRegister, QuantumCircuit, QuantumRegister import numpy as np def u_circuit(qr: QuantumRegister, cr: ClassicalRegister) -> QuantumCircuit: # qr is a quantum register with 2 qubits # cr is a classical register with 2 bits qc = QuantumCircuit(qr, cr) ####### your code goes here ####### # Initialization q0, q1 = qr if step1_bit: qc.x(q0) qc.x(q1) # Measure the auxiliary qubit c0, c1 = cr qc.measure(q0, c0) # Reset and re-initialize the auxiliary qubit qc.reset(q0) qc.h(q0) # Apply phase correction conditioned on the first classical bit with qc.if_test((c0, 1)): qc.p(-np.pi / 2, q0) # Apply control-U operator as many times as needed to get the next phase bit u_angle = 2 * np.pi / 3 k = 0 cphase_angle = u_angle * 2**k qc.cp(cphase_angle, q0, q1) # Measure the auxiliary qubit in x-basis into the second classical bit qc.h(q0) qc.measure(q0, c1) return qc qr = QuantumRegister(2, "q") cr = ClassicalRegister(2, "c") qc = QuantumCircuit(qr, cr) qc = u_circuit(qr, cr) qc.draw("mpl") # Submit your result from qc_grader.challenges.qgss_2023 import grade_lab4_ex5 grade_lab4_ex5(qc) from qiskit_aer import AerSimulator sim = AerSimulator() job = sim.run(qc, shots=1000) result = job.result() counts = result.get_counts() print(counts) success_probability = counts["01"] / counts.shots() print(f"Success probability: {success_probability}") from qiskit.circuit import Gate def iterative_phase_estimation( qr: QuantumRegister, cr: ClassicalRegister, controlled_unitaries: list[Gate], state_prep: Gate, ) -> QuantumCircuit: qc = QuantumCircuit(qr, cr) ####### your code goes here ####### auxiliary_qubit = qr[0] system_qubits = qr[1:] qc.append(state_prep, system_qubits) for i in range(len(cr)): k = len(cr) - 1 - i qc.reset(auxiliary_qubit) qc.h(auxiliary_qubit) for j in range(i): with qc.if_test((cr[j], 1)): qc.p(-np.pi / 2 ** (i - j), auxiliary_qubit) qc.append(controlled_unitaries[k], qr) qc.h(auxiliary_qubit) qc.measure(auxiliary_qubit, cr[i]) return qc from qiskit.circuit.library import CPhaseGate, XGate qr = QuantumRegister(2, "q") cr = ClassicalRegister(2, "c") s_angle = np.pi / 2 controlled_unitaries = [CPhaseGate(s_angle * 2**k) for k in range(2)] qc = iterative_phase_estimation(qr, cr, controlled_unitaries, XGate()) sim = AerSimulator() job = sim.run(qc, shots=1000) result = job.result() counts = result.get_counts() counts from qiskit_ibm_provider import IBMProvider provider = IBMProvider() hub = "YOUR_HUB" group = "YOUR_GROUP" project = "YOUR_PROJECT" backend_name = "ibmq_manila" backend = provider.get_backend(backend_name, instance=f"{hub}/{group}/{project}") from qiskit import transpile qr = QuantumRegister(2, "q") cr = ClassicalRegister(2, "c") qc = QuantumCircuit(qr, cr) qc = step_2_circuit(qr, cr) qc_transpiled = transpile(qc, backend) job = backend.run(qc_transpiled, shots=1000, dynamic=True) job_id = job.job_id() print(job_id) retrieve_job = provider.retrieve_job(job_id) retrieve_job.status() from qiskit.tools.visualization import plot_histogram counts = retrieve_job.result().get_counts() plot_histogram(counts)
https://github.com/MonitSharma/Qiskit-Summer-School-and-Quantum-Challenges
MonitSharma
from qiskit import QuantumCircuit, QuantumRegister from qiskit.quantum_info import SparsePauliOp def heisenberg_hamiltonian( length: int, jx: float = 1.0, jy: float = 0.0, jz: float = 0.0 ) -> SparsePauliOp: terms = [] for i in range(length - 1): if jx: terms.append(("XX", [i, i + 1], jx)) if jy: terms.append(("YY", [i, i + 1], jy)) if jz: terms.append(("ZZ", [i, i + 1], jz)) return SparsePauliOp.from_sparse_list(terms, num_qubits=length) def state_prep_circuit(num_qubits: int, layers: int = 1) -> QuantumCircuit: qubits = QuantumRegister(num_qubits, name="q") circuit = QuantumCircuit(qubits) circuit.h(qubits) for _ in range(layers): for i in range(0, num_qubits - 1, 2): circuit.cx(qubits[i], qubits[i + 1]) circuit.ry(0.1, qubits) for i in range(1, num_qubits - 1, 2): circuit.cx(qubits[i], qubits[i + 1]) circuit.ry(0.1, qubits) return circuit length = 5 hamiltonian = heisenberg_hamiltonian(length, 1.0, 1.0) circuit = state_prep_circuit(length, layers=2) print(hamiltonian) circuit.draw("mpl") from qiskit_aer.primitives import Estimator estimator = Estimator(approximation=True) job = estimator.run(circuit, hamiltonian, shots=None) result = job.result() exact_value = result.values[0] print(f"Exact energy: {exact_value}") from qiskit_ibm_runtime import QiskitRuntimeService hub = "ibm-q-internal" group = "deployed" project = "default" service = QiskitRuntimeService(instance=f"{hub}/{group}/{project}") from qiskit_ibm_runtime import Estimator, Options, Session from qiskit.transpiler import CouplingMap backend = service.get_backend("simulator_statevector") # set simulation options simulator = { "basis_gates": ["id", "rz", "sx", "cx", "reset"], "coupling_map": list(CouplingMap.from_line(length + 1)), } shots = 10000 import math options = Options( simulator=simulator, resilience_level=0, ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variance = result.metadata[0]["variance"] std = math.sqrt(variance / shots) print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") from qiskit_aer.noise import NoiseModel, ReadoutError noise_model = NoiseModel() ##### your code here ##### # add modest readout error on all qubits p0given1 = 0.05 p1given0 = 0.02 readout_error = ReadoutError( [ [1 - p1given0, p1given0], [p0given1, 1 - p0given1], ] ) noise_model.add_all_qubit_readout_error(readout_error) # add really bad readout error on qubit 0 p0given1 = 0.5 p1given0 = 0.2 readout_error = ReadoutError( [ [1 - p1given0, p1given0], [p0given1, 1 - p0given1], ] ) noise_model.add_readout_error(readout_error, [0]) print(noise_model) # Submit your answer from qc_grader.challenges.qgss_2023 import grade_lab5_ex1 grade_lab5_ex1(noise_model) options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=0, transpilation=dict(initial_layout=list(range(length))), ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variance = result.metadata[0]["variance"] std = math.sqrt(variance / shots) print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=0, transpilation=dict(initial_layout=list(range(1, length + 1))), ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variance = result.metadata[0]["variance"] std = math.sqrt(variance / shots) print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=1, transpilation=dict(initial_layout=list(range(1, length + 1))), ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variance = result.metadata[0]["variance"] std = math.sqrt(variance / shots) print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") new_shots: int ##### your code here ##### new_shots = 20000 # Submit your answer from qc_grader.challenges.qgss_2023 import grade_lab5_ex2 grade_lab5_ex2(new_shots) from qiskit_aer.noise import depolarizing_error noise_model = NoiseModel() ##### your code here ##### noise_model.add_all_qubit_quantum_error(depolarizing_error(0.01, 2), ["cx"]) print(noise_model) # Submit your answer from qc_grader.challenges.qgss_2023 import grade_lab5_ex3 grade_lab5_ex3(noise_model) options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=1, ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variance = result.metadata[0]["variance"] std = math.sqrt(variance / shots) print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=2, ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variances = result.metadata[0]["zne"]["noise_amplification"]["variance"] print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variances: {variances}") from qiskit_aer.noise import depolarizing_error, amplitude_damping_error noise_model = NoiseModel() ##### your code here ##### noise_model.add_all_qubit_quantum_error(amplitude_damping_error(0.01).tensor(amplitude_damping_error(0.05)), ["cx"]) print(noise_model) options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=1, ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variance = result.metadata[0]["variance"] std = math.sqrt(variance / shots) print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variance: {variance}") print(f"Standard error: {std}") options = Options( simulator=dict(noise_model=noise_model, **simulator), resilience_level=2, ) with Session(service=service, backend=backend): estimator = Estimator(options=options) job = estimator.run(circuit, hamiltonian, shots=shots) result = job.result() experiment_value = result.values[0] error = abs(experiment_value - exact_value) variances = result.metadata[0]["zne"]["noise_amplification"]["variance"] print(f"Estimated energy: {experiment_value}") print(f"Energy error: {error}") print(f"Variances: {variances}")
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import pennylane as qml import jax from jax import numpy as np jax.config.update("jax_platform_name", "cpu") dev = qml.device('default.qubit', wires=2) x = np.array([0.1, 0.2, 0.3]) @qml.qnode(dev, diff_method="adjoint") def circuit(a): qml.RX(a[0], wires=0) qml.CNOT(wires=(0,1)) qml.RY(a[1], wires=1) qml.RZ(a[2], wires=1) return qml.expval(qml.PauliX(wires=1)) n_gates = 4 n_params = 3 ops = [ qml.RX(x[0], wires=0), qml.CNOT(wires=(0,1)), qml.RY(x[1], wires=1), qml.RZ(x[2], wires=1) ] M = qml.PauliX(wires=1) from pennylane.devices.qubit import create_initial_state, apply_operation state = create_initial_state((0, 1)) for op in ops: state = apply_operation(op, state) print(state) bra = apply_operation(M, state) ket = state M_expval = np.vdot(bra, ket) print("vdot : ", M_expval) print("QNode : ", circuit(x)) bra_n = create_initial_state((0, 1)) for op in ops: bra_n = apply_operation(op, bra_n) bra_n = apply_operation(M, bra_n) bra_n = apply_operation(qml.adjoint(ops[-1]), bra_n) ket_n = create_initial_state((0, 1)) for op in ops[:-1]: # don't apply last operation ket_n = apply_operation(op, ket_n) M_expval_n = np.vdot(bra_n, ket_n) print(M_expval_n) bra_n_v2 = apply_operation(M, state) ket_n_v2 = state adj_op = qml.adjoint(ops[-1]) bra_n_v2 = apply_operation(adj_op, bra_n_v2) ket_n_v2 = apply_operation(adj_op, ket_n_v2) M_expval_n_v2 = np.vdot(bra_n_v2, ket_n_v2) print(M_expval_n_v2) bra_loop = apply_operation(M, state) ket_loop = state for op in reversed(ops): adj_op = qml.adjoint(op) bra_loop = apply_operation(adj_op, bra_loop) ket_loop = apply_operation(adj_op, ket_loop) print(np.vdot(bra_loop, ket_loop)) grad_op0 = qml.operation.operation_derivative(ops[0]) print(grad_op0) bra = apply_operation(M, state) ket = state grads = [] for op in reversed(ops): adj_op = qml.adjoint(op) ket = apply_operation(adj_op, ket) # Calculating the derivative if op.num_params != 0: dU = qml.operation.operation_derivative(op) ket_temp = apply_operation(qml.QubitUnitary(dU, op.wires), ket) dM = 2 * np.real(np.vdot(bra, ket_temp)) grads.append(dM) bra = apply_operation(adj_op, bra) # Finally reverse the order of the gradients # since we calculated them in reverse grads = grads[::-1] print("our calculation: ", [float(grad) for grad in grads]) grad_compare = jax.grad(circuit)(x) print("comparison: ", grad_compare) dev_lightning = qml.device('lightning.qubit', wires=2) @qml.qnode(dev_lightning, diff_method="adjoint") def circuit_adjoint(a): qml.RX(a[0], wires=0) qml.CNOT(wires=(0,1)) qml.RY(a[1], wires=1) qml.RZ(a[2], wires=1) return qml.expval(M) print(jax.grad(circuit_adjoint)(x))
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import numpy as np n_samples = 100 p_1 = 0.2 x_data = np.random.binomial(1, p_1, (n_samples,)) print(x_data) frequency_of_zeros, frequency_of_ones = 0, 0 for x in x_data: if x: frequency_of_ones += 1/n_samples else: frequency_of_zeros += 1/n_samples print(frequency_of_ones+frequency_of_zeros) import matplotlib.pyplot as plt %matplotlib inline p_0 = np.linspace(0, 1, 100) p_1 = 1-p_0 fig, ax = plt.subplots() ax.set_xlim(-1.2, 1.2) ax.set_ylim(-1.2, 1.2) ax.spines['left'].set_position('center') ax.spines['bottom'].set_position('center') ax.spines['right'].set_color('none') ax.spines['top'].set_color('none') ax.set_xlabel("$p_0$") ax.xaxis.set_label_coords(1.0, 0.5) ax.set_ylabel("$p_1$") ax.yaxis.set_label_coords(0.5, 1.0) plt.plot(p_0, p_1) p = np.array([[0.8], [0.2]]) np.linalg.norm(p, ord=1) Π_0 = np.array([[1, 0], [0, 0]]) np.linalg.norm(Π_0 @ p, ord=1) Π_1 = np.array([[0, 0], [0, 1]]) np.linalg.norm(Π_1 @ p, ord=1) p = np.array([[.5], [.5]]) M = np.array([[0.7, 0.6], [0.3, 0.4]]) np.linalg.norm(M @ p, ord=1) ϵ = 10e-10 p_0 = np.linspace(ϵ, 1-ϵ, 100) p_1 = 1-p_0 H = -(p_0*np.log2(p_0) + p_1*np.log2(p_1)) fig, ax = plt.subplots() ax.set_xlim(0, 1) ax.set_ylim(0, -np.log2(0.5)) ax.set_xlabel("$p_0$") ax.set_ylabel("$H$") plt.plot(p_0, H) plt.axvline(x=0.5, color='k', linestyle='--') # %pip install qiskit from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit_aer import AerSimulator from qiskit.visualization import plot_histogram, plot_bloch_multivector from qiskit.primitives import BackendEstimator, BackendSampler import numpy as np π = np.pi backend = AerSimulator(method='statevector') q = QuantumRegister(1) c = ClassicalRegister(1) circuit = QuantumCircuit(q, c) circuit.measure(q, c) circuit.draw(output='mpl') sampler = BackendSampler(backend=backend) result = sampler.run(circuit).result() print(result.quasi_dists[0]) # get the statevcector from qiskit.quantum_info import Statevector q = QuantumRegister(1) c = ClassicalRegister(1) circuit = QuantumCircuit(q, c) state = Statevector.from_instruction(circuit) print(state) plot_bloch_multivector(state) circuit = QuantumCircuit(q, c) circuit.ry(π/2, q[0]) circuit.measure(q, c) circuit.draw(output='mpl') job = sampler.run(circuit) result = job.result() print(result.quasi_dists[0]) plot_histogram(result.quasi_dists[0]) circuit = QuantumCircuit(q, c) circuit.ry(π/2, q[0]) # get statevector state = Statevector.from_instruction(circuit) print(state) plot_bloch_multivector(state) circuit = QuantumCircuit(q, c) circuit.x(q[0]) circuit.ry(π/2, q[0]) # get statevector state = Statevector.from_instruction(circuit) print(state) plot_bloch_multivector(state) circuit.measure(q, c) job = sampler.run(circuit) result = job.result() print(result.quasi_dists[0]) plot_histogram(result.quasi_dists[0]) circuit = QuantumCircuit(q, c) circuit.ry(π/2, q[0]) circuit.ry(π/2, q[0]) circuit.measure(q, c) job = sampler.run(circuit) result = job.result() print(result.quasi_dists[0]) plot_histogram(result.quasi_dists[0]) q0 = np.array([[1], [0]]) q1 = np.array([[1], [0]]) np.kron(q0, q1) q = QuantumRegister(2) c = ClassicalRegister(2) circuit = QuantumCircuit(q, c) circuit.h(q[0]) circuit.cx(q[0], q[1]) circuit.measure(q, c) job = sampler.run(circuit) result = job.result() print(result.quasi_dists[0]) plot_histogram(result.quasi_dists[0])
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import pennylane as qml from pennylane import numpy as np from pennylane.optimize import AdamOptimizer, GradientDescentOptimizer import matplotlib.pyplot as plt # Set a random seed np.random.seed(42) # Make a dataset of points inside and outside of a circle def circle(samples, center=[0.0, 0.0], radius=np.sqrt(2 / np.pi)): """ Generates a dataset of points with 1/0 labels inside a given radius. Args: samples (int): number of samples to generate center (tuple): center of the circle radius (float: radius of the circle Returns: Xvals (array[tuple]): coordinates of points yvals (array[int]): classification labels """ Xvals, yvals = [], [] for i in range(samples): x = 2 * (np.random.rand(2)) - 1 y = 0 if np.linalg.norm(x - center) < radius: y = 1 Xvals.append(x) yvals.append(y) return np.array(Xvals, requires_grad=False), np.array(yvals, requires_grad=False) def plot_data(x, y, fig=None, ax=None): """ Plot data with red/blue values for a binary classification. Args: x (array[tuple]): array of data points as tuples y (array[int]): array of data points as tuples """ if fig == None: fig, ax = plt.subplots(1, 1, figsize=(5, 5)) reds = y == 0 blues = y == 1 ax.scatter(x[reds, 0], x[reds, 1], c="red", s=20, edgecolor="k") ax.scatter(x[blues, 0], x[blues, 1], c="blue", s=20, edgecolor="k") ax.set_xlabel("$x_1$") ax.set_ylabel("$x_2$") Xdata, ydata = circle(500) fig, ax = plt.subplots(1, 1, figsize=(4, 4)) plot_data(Xdata, ydata, fig=fig, ax=ax) plt.show() # Define output labels as quantum state vectors def density_matrix(state): """Calculates the density matrix representation of a state. Args: state (array[complex]): array representing a quantum state vector Returns: dm: (array[complex]): array representing the density matrix """ return state * np.conj(state).T label_0 = [[1], [0]] label_1 = [[0], [1]] state_labels = np.array([label_0, label_1], requires_grad=False) dev = qml.device("default.qubit", wires=1) # Install any pennylane-plugin to run on some particular backend @qml.qnode(dev) def qcircuit(params, x, y): """A variational quantum circuit representing the Universal classifier. Args: params (array[float]): array of parameters x (array[float]): single input vector y (array[float]): single output state density matrix Returns: float: fidelity between output state and input """ for p in params: qml.Rot(*x, wires=0) qml.Rot(*p, wires=0) return qml.expval(qml.Hermitian(y, wires=[0])) def cost(params, x, y, state_labels=None): """Cost function to be minimized. Args: params (array[float]): array of parameters x (array[float]): 2-d array of input vectors y (array[float]): 1-d array of targets state_labels (array[float]): array of state representations for labels Returns: float: loss value to be minimized """ # Compute prediction for each input in data batch loss = 0.0 dm_labels = [density_matrix(s) for s in state_labels] for i in range(len(x)): f = qcircuit(params, x[i], dm_labels[y[i]]) loss = loss + (1 - f) ** 2 return loss / len(x) def test(params, x, y, state_labels=None): """ Tests on a given set of data. Args: params (array[float]): array of parameters x (array[float]): 2-d array of input vectors y (array[float]): 1-d array of targets state_labels (array[float]): 1-d array of state representations for labels Returns: predicted (array([int]): predicted labels for test data output_states (array[float]): output quantum states from the circuit """ fidelity_values = [] dm_labels = [density_matrix(s) for s in state_labels] predicted = [] for i in range(len(x)): fidel_function = lambda y: qcircuit(params, x[i], y) fidelities = [fidel_function(dm) for dm in dm_labels] best_fidel = np.argmax(fidelities) predicted.append(best_fidel) fidelity_values.append(fidelities) return np.array(predicted), np.array(fidelity_values) def accuracy_score(y_true, y_pred): """Accuracy score. Args: y_true (array[float]): 1-d array of targets y_predicted (array[float]): 1-d array of predictions state_labels (array[float]): 1-d array of state representations for labels Returns: score (float): the fraction of correctly classified samples """ score = y_true == y_pred return score.sum() / len(y_true) def iterate_minibatches(inputs, targets, batch_size): """ A generator for batches of the input data Args: inputs (array[float]): input data targets (array[float]): targets Returns: inputs (array[float]): one batch of input data of length `batch_size` targets (array[float]): one batch of targets of length `batch_size` """ for start_idx in range(0, inputs.shape[0] - batch_size + 1, batch_size): idxs = slice(start_idx, start_idx + batch_size) yield inputs[idxs], targets[idxs] # Generate training and test data num_training = 200 num_test = 2000 Xdata, y_train = circle(num_training) X_train = np.hstack((Xdata, np.zeros((Xdata.shape[0], 1), requires_grad=False))) Xtest, y_test = circle(num_test) X_test = np.hstack((Xtest, np.zeros((Xtest.shape[0], 1), requires_grad=False))) # Train using Adam optimizer and evaluate the classifier num_layers = 3 learning_rate = 0.6 epochs = 10 batch_size = 32 opt = AdamOptimizer(learning_rate, beta1=0.9, beta2=0.999) # initialize random weights params = np.random.uniform(size=(num_layers, 3), requires_grad=True) predicted_train, fidel_train = test(params, X_train, y_train, state_labels) accuracy_train = accuracy_score(y_train, predicted_train) predicted_test, fidel_test = test(params, X_test, y_test, state_labels) accuracy_test = accuracy_score(y_test, predicted_test) # save predictions with random weights for comparison initial_predictions = predicted_test loss = cost(params, X_test, y_test, state_labels) print( "Epoch: {:2d} | Cost: {:3f} | Train accuracy: {:3f} | Test Accuracy: {:3f}".format( 0, loss, accuracy_train, accuracy_test ) ) for it in range(epochs): for Xbatch, ybatch in iterate_minibatches(X_train, y_train, batch_size=batch_size): params, _, _, _ = opt.step(cost, params, Xbatch, ybatch, state_labels) predicted_train, fidel_train = test(params, X_train, y_train, state_labels) accuracy_train = accuracy_score(y_train, predicted_train) loss = cost(params, X_train, y_train, state_labels) predicted_test, fidel_test = test(params, X_test, y_test, state_labels) accuracy_test = accuracy_score(y_test, predicted_test) res = [it + 1, loss, accuracy_train, accuracy_test] print( "Epoch: {:2d} | Loss: {:3f} | Train accuracy: {:3f} | Test accuracy: {:3f}".format( *res ) ) print( "Cost: {:3f} | Train accuracy {:3f} | Test Accuracy : {:3f}".format( loss, accuracy_train, accuracy_test ) ) print("Learned weights") for i in range(num_layers): print("Layer {}: {}".format(i, params[i])) fig, axes = plt.subplots(1, 3, figsize=(10, 3)) plot_data(X_test, initial_predictions, fig, axes[0]) plot_data(X_test, predicted_test, fig, axes[1]) plot_data(X_test, y_test, fig, axes[2]) axes[0].set_title("Predictions with random weights") axes[1].set_title("Predictions after training") axes[2].set_title("True test data") plt.tight_layout() plt.show()
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import numpy as np X = np.array([[0, 1], [1, 0]]) print("XX^dagger") print(X @ X.T.conj()) print("X^daggerX") print(X.T.conj() @ X) print("The norm of the state |0> before applying X") zero_ket = np.array([[1], [0]]) print(np.linalg.norm(zero_ket)) print("The norm of the state after applying X") print(np.linalg.norm(X @ zero_ket)) import numpy as np from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit_aer import AerSimulator from qiskit.quantum_info import Statevector np.set_printoptions(precision=3, suppress=True) backend_statevector = AerSimulator(method='statevector') q = QuantumRegister(1) c = ClassicalRegister(1) circuit = QuantumCircuit(q, c) circuit.x(q[0]) circuit.x(q[0]) # get the statevector state = Statevector.from_instruction(circuit) print(state.data) def mixed_state(pure_state, visibility): density_matrix = pure_state @ pure_state.T.conj() maximally_mixed_state = np.eye(4)/2**2 return visibility*density_matrix + (1-visibility)*maximally_mixed_state ϕ = np.array([[1],[0],[0],[1]])/np.sqrt(2) print("Maximum visibility is a pure state:") print(mixed_state(ϕ, 1.0)) print("The state is still entangled with visibility 0.8:") print(mixed_state(ϕ, 0.8)) print("Entanglement is lost by 0.6:") print(mixed_state(ϕ, 0.6)) print("Barely any coherence remains by 0.2:") print(mixed_state(ϕ, 0.2)) import matplotlib.pyplot as plt temperatures = [.5, 5, 2000] energies = np.linspace(0, 20, 100) fig, ax = plt.subplots() for i, T in enumerate(temperatures): probabilities = np.exp(-energies/T) Z = probabilities.sum() probabilities /= Z ax.plot(energies, probabilities, linewidth=3, label = "$T_" + str(i+1)+"$") ax.set_xlim(0, 20) ax.set_ylim(0, 1.2*probabilities.max()) ax.set_xticks([]) ax.set_yticks([]) ax.set_xlabel('Energy') ax.set_ylabel('Probability') ax.legend()
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
from PIL import Image import numpy as np import matplotlib.pyplot as plt cut=128 img = Image.open('nasa_image.jpg').convert('L') plt.imshow(img) img = np.asarray(img.getdata()).reshape((2463,2895)) for i in range(2463//cut): for j in range(2895//cut): cutimg = img[i*cut:(i+1)*cut] cutimg = cutimg[:,list(range(j*cut,(j+1)*cut))] plt.imsave('result/{} {}.jpg'.format(i,j), cutimg ,cmap='gray') for i in range(2463//cut): for j in range(2895//cut): img16 = Image.open('result/{} {}.jpg'.format(i,j)).resize((16,16)).convert('L') img16 = np.asarray(img16.getdata()).reshape((16,16)) img16 = Image.open('result/{} {}.jpg'.format(5,1)).resize((16,16)).convert('L') plt.imshow(img16, cmap='gray') img16 = np.asarray(img16.getdata(), dtype=np.float64).reshape((16,16)) import random import numpy as np import matplotlib.pyplot as plt import sys sys.path.append('../PyFiles') # where the Helper files are saved # Pull in the helper files. from ImageRead import * # the helper files we created to read Images from QNN import * # the helper file that creates the QNN target_o = [1 for i in range(25)]+[0 for i in range(25)] pathY=r'../dataset/Original/galaxy/' pathN=r'../dataset/Original/No-galaxy/' nameN='' nameY='' inputY=[imageResize(callImage(i+1,pathY,nameY),16) for i in range(25)] inputN=[imageResize(callImage(i+1,pathN,nameN),16) for i in range(25)] input_combine = inputY+inputN np.random.seed(0) idx=np.array([int(i) for i in range(50)]).flatten() np.random.shuffle(idx) dataInput = list(input_combine[i] for i in idx ) dataTarget = list( imageBinarize(input_combine[i]) for i in idx ) data_target_o=list( target_o[i] for i in idx ) n_samples_show = 10 fig, axes = plt.subplots(nrows=2, ncols=n_samples_show, figsize=(20, 6)) for i in range(n_samples_show): axes[0,i].imshow(dataInput[i], cmap='gray') axes[0,i].set_xticks([]) axes[0,i].set_yticks([]) axes[1,i].imshow(dataInput[i+5], cmap='gray') axes[1,i].set_xticks([]) axes[1,i].set_yticks([]) from qiskit.circuit.parameter import Parameter from qiskit_machine_learning.neural_networks import CircuitQNN from qiskit_machine_learning.connectors import TorchConnector from qiskit.utils import QuantumInstance from torch.nn import Linear, CrossEntropyLoss, MSELoss from torch.optim import LBFGS, SGD,Adam qi = QuantumInstance(Aer.get_backend('statevector_simulator')) from qiskit.circuit.library import RealAmplitudes, ZZFeatureMap from qiskit_machine_learning.algorithms.classifiers import NeuralNetworkClassifier, VQC from qiskit.algorithms.optimizers import COBYLA, L_BFGS_B # Model for LBFGS # Combining the circuit together with CircuitQNN np.random.seed(3) nqubits=6 num_inputs=256 qc = QuantumCircuit(nqubits) # Encoding param_x=[]; for i in range(num_inputs): param_x.append(Parameter('x'+str(i))) for i in range(8): param_x.append(np.pi/2) feature_map = encoding(qc,param_x,22) # Optimzing circuit PQC param_y=[]; for i in range(nqubits*2): param_y.append(Parameter('θ'+str(i))) ansatz=circuit15(qc,param_y) qc.append(feature_map, range(nqubits)) qc.append(ansatz, range(nqubits)) qnn2 = CircuitQNN(qc, input_params=feature_map.parameters, weight_params=ansatz.parameters, interpret=parity, output_shape=2, quantum_instance=qi) initial_weights = 0.1*(2*np.random.rand(qnn2.num_weights) - 1) # define optimizer and loss function model2 = TorchConnector(qnn2, initial_weights) optimizer = LBFGS(model2.parameters(),lr=0.05) f_loss = CrossEntropyLoss() X= [normlaizeData(dataInput[i].flatten()) for i in range(50)] y01= [data_target_o[i] for i in range(50)] from torch import Tensor # traning model accuracy y_predict = [] for x in X: output = model2(Tensor(x)) y_predict += [np.argmax(output.detach().numpy())] print('Accuracy:', sum(y_predict == np.array(y01))/len(np.array(y01))) # define optimizer and loss function model2 = TorchConnector(qnn2, initial_weights) optimizer = LBFGS(model2.parameters(),lr=0.05) f_loss = CrossEntropyLoss() X= [normlaizeData(dataInput[i].flatten()) for i in range(50)] y01= [data_target_o[i] for i in range(50)] from torch import Tensor # start training model2.train() # set model to training mode # define objective function def closure(): optimizer.zero_grad() # initialize gradient loss = 0.0 # initialize loss for x, y_target in zip(X, y01): # evaluate batch loss output = model2(Tensor(x)).reshape(1, 2) # forward pass loss += f_loss(output, Tensor([y_target]).long()) loss.backward() # backward pass print(loss.item()) # print loss return loss # run optimizer optimizer.step(closure) optimizer.step(closure) # traning model accuracy y_predict = [] for x in X: output = model2(Tensor(x)) y_predict += [np.argmax(output.detach().numpy())] print('Accuracy:', sum(y_predict == np.array(y01))/len(np.array(y01))) # define optimizer and loss function from torch import Tensor model2 = TorchConnector(qnn2, initial_weights) optimizer = LBFGS(model2.parameters(),lr=0.06) f_loss = CrossEntropyLoss() X= [normlaizeData(dataInput[i].flatten()) for i in range(50)] y01= [data_target_o[i] for i in range(50)] y_predict = [] for x in X: output = model2(Tensor(x)) y_predict += [np.argmax(output.detach().numpy())] print('Accuracy:', sum(y_predict == np.array(y01))/len(np.array(y01))) from torch import Tensor # start training model2.train() # set model to training mode # define objective function def closure(): optimizer.zero_grad() # initialize gradient loss = 0.0 # initialize loss for x, y_target in zip(X, y01): # evaluate batch loss output = model2(Tensor(x)).reshape(1, 2) # forward pass loss += f_loss(output, Tensor([y_target]).long()) loss.backward() # backward pass print(loss.item()) # print loss return loss # run optimizer optimizer.step(closure) optimizer.step(closure) # traning model accuracy y_predict = [] for x in X: output = model2(Tensor(x)) y_predict += [np.argmax(output.detach().numpy())] print('Accuracy:', sum(y_predict == np.array(y01))/len(np.array(y01))) # define optimizer and loss function from torch import Tensor model2 = TorchConnector(qnn2, initial_weights) optimizer = LBFGS(model2.parameters(),lr=0.07) f_loss = CrossEntropyLoss() X= [normlaizeData(dataInput[i].flatten()) for i in range(50)] y01= [data_target_o[i] for i in range(50)] y_predict = [] for x in X: output = model2(Tensor(x)) y_predict += [np.argmax(output.detach().numpy())] print('Accuracy:', sum(y_predict == np.array(y01))/len(np.array(y01))) from torch import Tensor # start training model2.train() # set model to training mode # define objective function def closure(): optimizer.zero_grad() # initialize gradient loss = 0.0 # initialize loss for x, y_target in zip(X, y01): # evaluate batch loss output = model2(Tensor(x)).reshape(1, 2) # forward pass loss += f_loss(output, Tensor([y_target]).long()) loss.backward() # backward pass print(loss.item()) # print loss return loss # run optimizer optimizer.step(closure) optimizer.step(closure) # traning model accuracy y_predict = [] for x in X: output = model2(Tensor(x)) y_predict += [np.argmax(output.detach().numpy())] print('Accuracy:', sum(y_predict == np.array(y01))/len(np.array(y01))) target_o = [1 for i in range(25)]+[0 for i in range(25)] pathY=r'../dataset/Original/galaxy1/' pathN=r'../dataset/Original/no-galaxy1/' nameN='' nameY='' inputY=[imageResize(callImage(i+1,pathY,nameY),16) for i in range(25)] inputN=[imageResize(callImage(i+1,pathN,nameN),16) for i in range(25)] input_combine = inputY+inputN np.random.seed(0) idx=np.array([int(i) for i in range(50)]).flatten() np.random.shuffle(idx) dataInput = list(input_combine[i] for i in idx ) dataTarget = list( imageBinarize(input_combine[i]) for i in idx ) data_target_o=list( target_o[i] for i in idx ) Xtest= [normlaizeData(dataInput[i].flatten()) for i in range(25)] y01test= [data_target_o[i] for i in range(25)] Xtest1= [normlaizeData(dataInput[i].flatten()) for i in range(50)] y01test1= [data_target_o[i] for i in range(50)] y_predict = [] for x in Xtest: output = model2(Tensor(x)) y_predict += [np.argmax(output.detach().numpy())] print('Accuracy25data:', sum(y_predict == np.array(y01test))/len(np.array(y01test))) y_predict1 = [] for x in Xtest1: output = model2(Tensor(x)) y_predict1 += [np.argmax(output.detach().numpy())] print('Accuracy50data:', sum(y_predict1 == np.array(y01test1))/len(np.array(y01test1)))
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import pennylane as qml from pennylane import numpy as np dev_gaussian = qml.device("default.gaussian", wires=1) @qml.qnode(dev_gaussian) def mean_photon_gaussian(mag_alpha, phase_alpha, phi): qml.Displacement(mag_alpha, phase_alpha, wires=0) qml.Rotation(phi, wires=0) return qml.expval(qml.NumberOperator(0)) def cost(params): return (mean_photon_gaussian(params[0], params[1], params[2]) - 1.0) ** 2 init_params = np.array([0.015, 0.02, 0.005], requires_grad=True) print(cost(init_params)) # initialise the optimizer opt = qml.GradientDescentOptimizer(stepsize=0.1) # set the number of steps steps = 20 # set the initial parameter values params = init_params for i in range(steps): # update the circuit parameters params = opt.step(cost, params) print("Cost after step {:5d}: {:8f}".format(i + 1, cost(params))) print("Optimized mag_alpha:{:8f}".format(params[0])) print("Optimized phase_alpha:{:8f}".format(params[1])) print("Optimized phi:{:8f}".format(params[2]))
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import pennylane as qml from pennylane import numpy as np dev_fock = qml.device("strawberryfields.fock", wires=2, cutoff_dim=2) @qml.qnode(dev_fock, diff_method="parameter-shift") def photon_redirection(params): qml.FockState(1, wires=0) qml.Beamsplitter(params[0], params[1], wires=[0, 1]) return qml.expval(qml.NumberOperator(1)) def cost(params): return -photon_redirection(params) init_params = np.array([0.01, 0.01], requires_grad=True) print(cost(init_params)) dphoton_redirection = qml.grad(photon_redirection, argnum=0) print(dphoton_redirection([0.0, 0.0])) # initialise the optimizer opt = qml.GradientDescentOptimizer(stepsize=0.4) # set the number of steps steps = 100 # set the initial parameter values params = init_params for i in range(steps): # update the circuit parameters params = opt.step(cost, params) if (i + 1) % 5 == 0: print("Cost after step {:5d}: {: .7f}".format(i + 1, cost(params))) print("Optimized rotation angles: {}".format(params)) # create the devices dev_qubit = qml.device("default.qubit", wires=1) dev_fock = qml.device("strawberryfields.fock", wires=2, cutoff_dim=10) @qml.qnode(dev_qubit) def qubit_rotation(phi1, phi2): """Qubit rotation QNode""" qml.RX(phi1, wires=0) qml.RY(phi2, wires=0) return qml.expval(qml.PauliZ(0)) @qml.qnode(dev_fock, diff_method="parameter-shift") def photon_redirection(params): """The photon redirection QNode""" qml.FockState(1, wires=0) qml.Beamsplitter(params[0], params[1], wires=[0, 1]) return qml.expval(qml.NumberOperator(1)) def squared_difference(x, y): """Classical node to compute the squared difference between two inputs""" return np.abs(x - y) ** 2 def cost(params, phi1=0.5, phi2=0.1): """Returns the squared difference between the photon-redirection and qubit-rotation QNodes, for fixed values of the qubit rotation angles phi1 and phi2""" qubit_result = qubit_rotation(phi1, phi2) photon_result = photon_redirection(params) return squared_difference(qubit_result, photon_result) # initialise the optimizer opt = qml.GradientDescentOptimizer(stepsize=0.4) # set the number of steps steps = 100 # set the initial parameter values params = np.array([0.01, 0.01], requires_grad=True) for i in range(steps): # update the circuit parameters params = opt.step(cost, params) if (i + 1) % 5 == 0: print("Cost after step {:5d}: {: .7f}".format(i + 1, cost(params))) print("Optimized rotation angles: {}".format(params)) result = [1.20671364, 0.01] print(photon_redirection(result)) print(qubit_rotation(0.5, 0.1))
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
%pip install qiskit from qiskit import ClassicalRegister, QuantumRegister, QuantumCircuit from qiskit_aer import AerSimulator from qiskit.primitives import BackendEstimator, BackendSampler import numpy as np np.set_printoptions(precision=3, suppress=True) backend = AerSimulator(method='automatic') q = QuantumRegister(1) c = ClassicalRegister(1) circuit = QuantumCircuit(q, c) circuit.measure(q[0], c[0]) circuit.draw(output='mpl') sampler = BackendSampler(backend) job = sampler.run(circuit, options={'shots': 1}) result = job.result() print("Counts",result.quasi_dists[0]) backend = AerSimulator(method='statevector') from qiskit.quantum_info import Statevector circuit = QuantumCircuit(q, c) circuit.id(q[0]) # get the statevcector state = Statevector.from_instruction(circuit) print(state) circuit.draw(output='mpl') from qiskit.visualization import plot_bloch_multivector print("Initial state") plot_bloch_multivector(state) circuit.h(q[0]) circuit.draw(output='mpl') state = Statevector.from_instruction(circuit) print("After a Hadamard gate") plot_bloch_multivector(state) from qiskit.visualization import plot_histogram circuit.measure(q[0], c[0]) job = sampler.run(circuit, options={'shots': 1024}) result = job.result() print("Initial state statistics") plot_histogram(result.quasi_dists[0])
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import pennylane as qml H = qml.Hamiltonian( [1, 1, 0.5], [qml.PauliX(0), qml.PauliZ(1), qml.PauliX(0) @ qml.PauliX(1)] ) print(H) dev = qml.device('default.qubit', wires=2) t = 1 n = 2 @qml.qnode(dev) def circuit(): qml.ApproxTimeEvolution(H, t, n) return [qml.expval(qml.PauliZ(i)) for i in range(2)] print(qml.draw(circuit, expansion_strategy='device')()) def circ(theta): qml.RX(theta, wires=0) qml.Hadamard(wires=1) qml.CNOT(wires=[0, 1]) @qml.qnode(dev) def circuit(param): circ(param) return [qml.expval(qml.PauliZ(i)) for i in range(2)] print(qml.draw(circuit)(0.5)) @qml.qnode(dev) def circuit(params, **kwargs): qml.layer(circ, 3, params) return [qml.expval(qml.PauliZ(i)) for i in range(2)] print(qml.draw(circuit)([0.3, 0.4, 0.5])) from pennylane import qaoa from pennylane import numpy as np from matplotlib import pyplot as plt import networkx as nx edges = [(0, 1), (1, 2), (2, 0), (2, 3)] graph = nx.Graph(edges) nx.draw(graph, with_labels=True) plt.show() cost_h, mixer_h = qaoa.min_vertex_cover(graph, constrained=False) print("Cost Hamiltonian", cost_h) print("Mixer Hamiltonian", mixer_h) def qaoa_layer(gamma, alpha): qaoa.cost_layer(gamma, cost_h) qaoa.mixer_layer(alpha, mixer_h) wires = range(4) depth = 2 def circuit(params, **kwargs): for w in wires: qml.Hadamard(wires=w) qml.layer(qaoa_layer, depth, params[0], params[1]) !pip install pennylane-qulacs["cpu"] dev = qml.device("qulacs.simulator", wires=wires) @qml.qnode(dev) def cost_function(params): circuit(params) return qml.expval(cost_h) optimizer = qml.GradientDescentOptimizer() steps = 70 params = np.array([[0.5, 0.5], [0.5, 0.5]], requires_grad=True) for i in range(steps): params = optimizer.step(cost_function, params) print("Optimal Parameters") print(params) @qml.qnode(dev) def probability_circuit(gamma, alpha): circuit([gamma, alpha]) return qml.probs(wires=wires) probs = probability_circuit(params[0], params[1]) plt.style.use("seaborn") plt.bar(range(2 ** len(wires)), probs) plt.show() reward_h = qaoa.edge_driver(nx.Graph([(0, 2)]), ['11']) new_cost_h = cost_h + 2 * reward_h def qaoa_layer(gamma, alpha): qaoa.cost_layer(gamma, new_cost_h) qaoa.mixer_layer(alpha, mixer_h) def circuit(params, **kwargs): for w in wires: qml.Hadamard(wires=w) qml.layer(qaoa_layer, depth, params[0], params[1]) @qml.qnode(dev) def cost_function(params): circuit(params) return qml.expval(new_cost_h) params = np.array([[0.5, 0.5], [0.5, 0.5]], requires_grad=True) for i in range(steps): params = optimizer.step(cost_function, params) print("Optimal Parameters") print(params) @qml.qnode(dev) def probability_circuit(gamma, alpha): circuit([gamma, alpha]) return qml.probs(wires=wires) probs = probability_circuit(params[0], params[1]) plt.style.use("seaborn") plt.bar(range(2 ** len(wires)), probs) plt.show()
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import matplotlib.pyplot as plt import numpy as np %matplotlib inline np.set_printoptions(precision=3, suppress=True) if(1j**2==-1): print("Complex Number") else: print("Not a Complex Number") x = 3.5 + 2.1j print("Type of x:" , type(x)) print("Real part of x:", x.real) print("Imaginary part of x:", x.imag) def plot_complex(a): for x in range(len(a)): plt.plot([0,a[x].real], [0,a[x].imag], 'r-o') plt.axhline(y=0, color='k') plt.axvline(x=0, color='k') plt.ylabel('Imaginary') plt.xlabel('Real') limit = np.max(np.ceil(np.absolute(a))) plt.xlim((-limit,limit)) plt.ylim((-limit,limit)) plt.show() plot_complex([x]) abs(x) r = abs(x) φ = np.arctan2(x.imag, x.real) z = r*np.exp(1j*φ) z == x print(x.conjugate()) plot_complex([x.conjugate()]) a = np.array([[1+2j], [2+2j]]) a a.T.conj() b = np.array([[0.1], [2j]]) b.T.conj() @ a c = np.array([[1], [0]]) d = np.array([[0], [1]]) c.T.conj() @ d print("The square of the l2 norm of a:", np.linalg.norm(a)**2) print("The same thing calculated as an inner product:", a.T.conj() @ a) sum(a != 0), sum(c != 0) np.linalg.norm(a, ord=1) np.kron(c, d) A = np.array([[1+2j, 2], [1j, 3+4j]]) A A.T.conj() A @ a a @ a.T.conj() λs, eigenvectors = np.linalg.eig(A) np.all(A == A.T.conj()) B = a @ a.T.conj() np.all(B == B.T.conj())
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import numpy as np zero_ket = np.array([[1], [0]]) print("|0> ket:\n", zero_ket) print("<0| bra:\n", zero_ket.T.conj()) zero_ket.T.conj() @ zero_ket one_ket = np.array([[0], [1]]) zero_ket.T.conj() @ one_ket zero_ket @ zero_ket.T.conj() ψ = np.array([[1], [0]])/np.sqrt(2) Π_0 = zero_ket @ zero_ket.T.conj() ψ.T.conj() @ Π_0 @ ψ from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit_aer import AerSimulator from qiskit.visualization import plot_histogram from qiskit.primitives import BackendEstimator, BackendSampler backend = AerSimulator() sampler = BackendSampler(backend) q = QuantumRegister(1) c = ClassicalRegister(1) circuit = QuantumCircuit(q, c) circuit.h(q[0]) circuit.measure(q, c) job = sampler.run(circuit, shots=100) result = job.result() counts = result.quasi_dists[0] plot_histogram(counts) ψ = np.array([[np.sqrt(2)/2], [np.sqrt(2)/2]]) Π_0 = zero_ket @ zero_ket.T.conj() probability_0 = ψ.T.conj() @ Π_0 @ ψ Π_0 @ ψ/np.sqrt(probability_0) c = ClassicalRegister(2) circuit = QuantumCircuit(q, c) circuit.h(q[0]) circuit.measure(q[0], c[0]) circuit.measure(q[0], c[1]) job = sampler.run(circuit, shots=100) result = job.result() counts = result.quasi_dists[0] plot_histogram(counts) q = QuantumRegister(2) c = ClassicalRegister(2) circuit = QuantumCircuit(q, c) circuit.h(q[0]) circuit.measure(q, c) job = sampler.run(circuit, shots=100) result = job.result() counts = result.quasi_dists[0] plot_histogram(counts) q = QuantumRegister(2) c = ClassicalRegister(2) circuit = QuantumCircuit(q, c) circuit.h(q[0]) circuit.cx(q[0], q[1]) circuit.measure(q, c) job = sampler.run(circuit, shots=100) result = job.result() counts = result.quasi_dists[0] plot_histogram(counts) ψ = np.array([[1], [1]])/np.sqrt(2) ρ = ψ @ ψ.T.conj() Π_0 = zero_ket @ zero_ket.T.conj() np.trace(Π_0 @ ρ) probability_0 = np.trace(Π_0 @ ρ) Π_0 @ ρ @ Π_0/probability_0 zero_ket = np.array([[1], [0]]) one_ket = np.array([[0], [1]]) ψ = (zero_ket + one_ket)/np.sqrt(2) print("Density matrix of the equal superposition") print(ψ @ ψ.T.conj()) print("Density matrix of the equally mixed state of |0><0| and |1><1|") print((zero_ket @ zero_ket.T.conj()+one_ket @ one_ket.T.conj())/2)
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import pennylane as qml from pennylane import numpy as np dev = qml.device('default.mixed', wires = 2) @qml.qnode(dev) def circuit(): qml.Hadamard(wires = 0) qml.CNOT(wires = [0,1]) return qml.expval(qml.PauliZ(0) @ qml.PauliZ(1)) print(f"QNode output = {circuit() :.4f}") print(f"Output state is = \n{np.real(dev.state)}") @qml.qnode(dev) def bitflip_circuit(p): qml.Hadamard(wires=0) qml.CNOT(wires=[0, 1]) qml.BitFlip(p, wires=0) qml.BitFlip(p, wires=1) return qml.expval(qml.PauliZ(0) @ qml.PauliZ(1)) ps = [0.001, 0.01, 0.1, 0.2] for p in ps: print(f"QNode output for bit flip probability {p} is {bitflip_circuit(p):.4f}") print(f"Output state for bit flip probability {p} is \n{np.real(dev.state)}") @qml.qnode(dev) def depolarizing_circuit(p): qml.Hadamard(wires=0) qml.CNOT(wires=[0, 1]) qml.DepolarizingChannel(p, wires=0) qml.DepolarizingChannel(p, wires=1) return qml.expval(qml.PauliZ(0) @ qml.PauliZ(1)) ps = [0.001, 0.01, 0.1, 0.2] for p in ps: print(f"QNode output for depolarizing probability {p} is {depolarizing_circuit(p):.4f}") ev = np.tensor(0.7781, requires_grad=False) # observed expectation value def sigmoid(x): return 1/(1+np.exp(-x)) @qml.qnode(dev) def damping_circuit(x): qml.Hadamard(wires=0) qml.CNOT(wires=[0, 1]) qml.AmplitudeDamping(sigmoid(x), wires=0) # p = sigmoid(x) qml.AmplitudeDamping(sigmoid(x), wires=1) return qml.expval(qml.PauliZ(0) @ qml.PauliZ(1)) def cost(x, target): return (damping_circuit(x) - target)**2 opt = qml.GradientDescentOptimizer(stepsize=10) steps = 35 x = np.tensor(0.0, requires_grad=True) for i in range(steps): (x, ev), cost_val = opt.step_and_cost(cost, x, ev) if i % 5 == 0 or i == steps - 1: print(f"Step: {i} Cost: {cost_val}") print(f"QNode output after optimization = {damping_circuit(x):.4f}") print(f"Experimental expectation value = {ev}") print(f"Optimized noise parameter p = {sigmoid(x.take(0)):.4f}")
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import pennylane as qml from pennylane import numpy as np from matplotlib import pyplot as plt # set the random seed np.random.seed(42) # create a device to execute the circuit on dev = qml.device("default.qubit", wires=3) @qml.qnode(dev, diff_method="parameter-shift") def circuit(params): qml.RX(params[0], wires=0) qml.RY(params[1], wires=1) qml.RZ(params[2], wires=2) qml.broadcast(qml.CNOT, wires=[0, 1, 2], pattern="ring") qml.RX(params[3], wires=0) qml.RY(params[4], wires=1) qml.RZ(params[5], wires=2) qml.broadcast(qml.CNOT, wires=[0, 1, 2], pattern="ring") return qml.expval(qml.PauliY(0) @ qml.PauliZ(2)) # initial parameters params = np.random.random([6], requires_grad=True) print("Parameters:", params) print("Expectation value:", circuit(params)) fig, ax = qml.draw_mpl(circuit, decimals=2)(params) plt.show() def parameter_shift_term(qnode, params, i): shifted = params.copy() shifted[i] += np.pi/2 forward = qnode(shifted) # forward evaluation shifted[i] -= np.pi backward = qnode(shifted) # backward evaluation return 0.5 * (forward - backward) # gradient with respect to the first parameter print(parameter_shift_term(circuit, params, 0)) def parameter_shift(qnode, params): gradients = np.zeros([len(params)]) for i in range(len(params)): gradients[i] = parameter_shift_term(qnode, params, i) return gradients print(parameter_shift(circuit, params)) grad_function = qml.grad(circuit) print(grad_function(params)[0]) print(qml.gradients.param_shift(circuit)(params)) dev = qml.device("default.qubit", wires=4) @qml.qnode(dev, diff_method="parameter-shift") def circuit(params): qml.StronglyEntanglingLayers(params, wires=[0, 1, 2, 3]) return qml.expval(qml.PauliZ(0) @ qml.PauliZ(1) @ qml.PauliZ(2) @ qml.PauliZ(3)) # initialize circuit parameters param_shape = qml.StronglyEntanglingLayers.shape(n_wires=4, n_layers=15) params = np.random.normal(scale=0.1, size=param_shape, requires_grad=True) print(params.size) print(circuit(params)) import timeit reps = 3 num = 10 times = timeit.repeat("circuit(params)", globals=globals(), number=num, repeat=reps) forward_time = min(times) / num print(f"Forward pass (best of {reps}): {forward_time} sec per loop") # create the gradient function grad_fn = qml.grad(circuit) times = timeit.repeat("grad_fn(params)", globals=globals(), number=num, repeat=reps) backward_time = min(times) / num print(f"Gradient computation (best of {reps}): {backward_time} sec per loop") print(2 * forward_time * params.size) dev = qml.device("default.qubit", wires=4) @qml.qnode(dev, diff_method="backprop") def circuit(params): qml.StronglyEntanglingLayers(params, wires=[0, 1, 2, 3]) return qml.expval(qml.PauliZ(0) @ qml.PauliZ(1) @ qml.PauliZ(2) @ qml.PauliZ(3)) # initialize circuit parameters param_shape = qml.StronglyEntanglingLayers.shape(n_wires=4, n_layers=15) params = np.random.normal(scale=0.1, size=param_shape, requires_grad=True) print(circuit(params)) import timeit reps = 3 num = 10 times = timeit.repeat("circuit(params)", globals=globals(), number=num, repeat=reps) forward_time = min(times) / num print(f"Forward pass (best of {reps}): {forward_time} sec per loop") times = timeit.repeat("qml.grad(circuit)(params)", globals=globals(), number=num, repeat=reps) backward_time = min(times) / num print(f"Backward pass (best of {reps}): {backward_time} sec per loop") dev = qml.device("default.qubit", wires=4) def circuit(params): qml.StronglyEntanglingLayers(params, wires=[0, 1, 2, 3]) return qml.expval(qml.PauliZ(0) @ qml.PauliZ(1) @ qml.PauliZ(2) @ qml.PauliZ(3)) reps = 2 num = 3 forward_shift = [] gradient_shift = [] forward_backprop = [] gradient_backprop = [] for depth in range(0, 21): param_shape = qml.StronglyEntanglingLayers.shape(n_wires=4, n_layers=depth) params = np.random.normal(scale=0.1, size=param_shape, requires_grad=True) num_params = params.size # forward pass timing # =================== qnode_shift = qml.QNode(circuit, dev, diff_method="parameter-shift") qnode_backprop = qml.QNode(circuit, dev, diff_method="backprop") # parameter-shift t = timeit.repeat("qnode_shift(params)", globals=globals(), number=num, repeat=reps) forward_shift.append([num_params, min(t) / num]) # backprop t = timeit.repeat("qnode_backprop(params)", globals=globals(), number=num, repeat=reps) forward_backprop.append([num_params, min(t) / num]) if num_params == 0: continue # Gradient timing # =============== qnode_shift = qml.QNode(circuit, dev, diff_method="parameter-shift") qnode_backprop = qml.QNode(circuit, dev, diff_method="backprop") # parameter-shift t = timeit.repeat("qml.grad(qnode_shift)(params)", globals=globals(), number=num, repeat=reps) gradient_shift.append([num_params, min(t) / num]) # backprop t = timeit.repeat("qml.grad(qnode_backprop)(params)", globals=globals(), number=num, repeat=reps) gradient_backprop.append([num_params, min(t) / num]) gradient_shift = np.array(gradient_shift).T gradient_backprop = np.array(gradient_backprop).T forward_shift = np.array(forward_shift).T forward_backprop = np.array(forward_backprop).T plt.style.use("bmh") fig, ax = plt.subplots(1, 1, figsize=(6, 4)) ax.plot(*gradient_shift, '.-', label="Parameter-shift") ax.plot(*gradient_backprop, '.-', label="Backprop") ax.set_ylabel("Time (s)") ax.set_xlabel("Number of parameters") ax.legend() plt.show() gradient_shift[1] /= forward_shift[1, 1:] gradient_backprop[1] /= forward_backprop[1, 1:] fig, ax = plt.subplots(1, 1, figsize=(6, 4)) ax.plot(*gradient_shift, '.-', label="Parameter-shift") ax.plot(*gradient_backprop, '.-', label="Backprop") # perform a least squares regression to determine the linear best fit/gradient # for the normalized time vs. number of parameters x = gradient_shift[0] m_shift, c_shift = np.polyfit(*gradient_shift, deg=1) m_back, c_back = np.polyfit(*gradient_backprop, deg=1) ax.plot(x, m_shift * x + c_shift, '--', label=f"{m_shift:.2f}p{c_shift:+.2f}") ax.plot(x, m_back * x + c_back, '--', label=f"{m_back:.2f}p{c_back:+.2f}") ax.set_ylabel("Normalized time") ax.set_xlabel("Number of parameters") ax.set_xscale("log") ax.set_yscale("log") ax.legend() plt.show()
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import matplotlib.pyplot as plt import pennylane as qml from pennylane import numpy as np np.random.seed(135) def square_loss(targets, predictions): loss = 0 for t, p in zip(targets, predictions): loss += (t - p) ** 2 loss = loss / len(targets) return 0.5*loss degree = 1 # since we are using a single qubit model it would be better to keep it to 1 scaling = 1 # scaling factor for the data coeffs = [0.15 + 0.15j]*degree # coefficient of the non-zero frequencies coeff0 = 0.1 # coefficient of zero frequency def target_function(x): """ Generate a truncated Fourier series, where the data gets re-scaled """ res = coeff0 for idx, coeff in enumerate(coeffs): exponent = np.complex128(scaling * (idx + 1) * x * 1j) conj_coeff = np.conjugate(coeff) res += coeff * np.exp(exponent) + conj_coeff * np.exp(-exponent) return np.real(res) x = np.linspace(-6, 6, 70, requires_grad=False) target_y = np.array([target_function(x_) for x_ in x], requires_grad=False) plt.plot(x, target_y, c='black') plt.scatter(x, target_y, facecolor='white', edgecolor='black') plt.ylim(-1, 1) plt.show(); scaling = 1 dev = qml.device('default.qubit', wires =1) def S(x): """Data encodng circuit block""" qml.RX(scaling * x, wires = 0) def W(theta): """Trainable circuit block""" qml.Rot(theta[0], theta[1], theta[2], wires=0) @qml.qnode(dev) def serial_quantum_model(weights,x): for theta in weights[:-1]: W(theta) S(x) # (L+1)'th unitary W(weights[-1]) return qml.expval(qml.PauliZ(wires=0)) r = 1 # number of times the encoding gets repeated (here equal to the number of layers) weights = 2 * np.pi * np.random.random(size=(r+1, 3), requires_grad=True) # some random initial weights x = np.linspace(-6, 6, 70, requires_grad=False) random_quantum_model_y = [serial_quantum_model(weights, x_) for x_ in x] plt.plot(x, random_quantum_model_y, c='blue') plt.ylim(-1,1) plt.show() print(qml.draw(serial_quantum_model)(weights, x[-1])) def cost(weights, x, y): predictions = [serial_quantum_model(weights, x_) for x_ in x] return square_loss(y, predictions) max_steps = 50 opt = qml.AdamOptimizer(0.3) batch_size = 25 cst = [cost(weights, x, target_y)] # initial cost for step in range(max_steps): # Select batch of data batch_index = np.random.randint(0, len(x), (batch_size,)) x_batch = x[batch_index] y_batch = target_y[batch_index] # Update the weights by one optimizer step weights, _, _ = opt.step(cost, weights, x_batch, y_batch) # Save, and possibly print, the current cost c = cost(weights, x, target_y) cst.append(c) if (step + 1) % 10 == 0: print("Cost at step {0:3}: {1}".format(step + 1, c)) predictions = [serial_quantum_model(weights, x_) for x_ in x] plt.plot(x, target_y, c='black') plt.scatter(x, target_y, facecolor='white', edgecolor='black') plt.plot(x, predictions, c='blue') plt.ylim(-1,1) plt.show(); plt.plot(range(len(cst)), cst) plt.ylabel("Cost") plt.xlabel("Step") plt.ylim(0, 0.23) plt.show(); from pennylane.templates import StronglyEntanglingLayers n_ansatz_layers = 2 n_qubits = 3 dev = qml.device('default.qubit', wires=4) @qml.qnode(dev) def ansatz(weights): StronglyEntanglingLayers(weights, wires=range(n_qubits)) return qml.expval(qml.Identity(wires=0)) weights_ansatz = 2 * np.pi * np.random.random(size=(n_ansatz_layers, n_qubits, 3)) print(qml.draw(ansatz, expansion_strategy="device")(weights_ansatz)) scaling = 1 r = 3 dev = qml.device('default.qubit', wires=r) def S(x): """Data-encoding circuit block.""" for w in range(r): qml.RX(scaling * x, wires=w) def W(theta): """Trainable circuit block.""" StronglyEntanglingLayers(theta, wires=range(r)) @qml.qnode(dev) def parallel_quantum_model(weights, x): W(weights[0]) S(x) W(weights[1]) return qml.expval(qml.PauliZ(wires=0)) trainable_block_layers = 3 weights = 2 * np.pi * np.random.random(size=(2, trainable_block_layers, r, 3), requires_grad=True) x = np.linspace(-6, 6, 70, requires_grad=False) random_quantum_model_y = [parallel_quantum_model(weights, x_) for x_ in x] plt.plot(x, random_quantum_model_y, c='blue') plt.ylim(-1,1) plt.show(); def cost(weights, x, y): predictions = [parallel_quantum_model(weights, x_) for x_ in x] return square_loss(y, predictions) max_steps = 50 opt = qml.AdamOptimizer(0.3) batch_size = 25 cst = [cost(weights, x, target_y)] # initial cost for step in range(max_steps): # select batch of data batch_index = np.random.randint(0, len(x), (batch_size,)) x_batch = x[batch_index] y_batch = target_y[batch_index] # update the weights by one optimizer step weights, _, _ = opt.step(cost, weights, x_batch, y_batch) # save, and possibly print, the current cost c = cost(weights, x, target_y) cst.append(c) if (step + 1) % 10 == 0: print("Cost at step {0:3}: {1}".format(step + 1, c)) predictions = [parallel_quantum_model(weights, x_) for x_ in x] plt.plot(x, target_y, c='black') plt.scatter(x, target_y, facecolor='white', edgecolor='black') plt.plot(x, predictions, c='blue') plt.ylim(-1,1) plt.show(); plt.plot(range(len(cst)), cst) plt.ylabel("Cost") plt.xlabel("Step") plt.show(); def fourier_coefficients(f, K): """ Computes the first 2*K+1 Fourier coefficients of a 2*pi periodic function. """ n_coeffs = 2 * K + 1 t = np.linspace(0, 2 * np.pi, n_coeffs, endpoint=False) y = np.fft.rfft(f(t)) / t.size return y from pennylane.templates import BasicEntanglerLayers scaling = 1 n_qubits = 4 dev = qml.device('default.qubit', wires=n_qubits) def S(x): """Data encoding circuit block.""" for w in range(n_qubits): qml.RX(scaling * x, wires=w) def W(theta): """Trainable circuit block.""" BasicEntanglerLayers(theta, wires=range(n_qubits)) @qml.qnode(dev) def quantum_model(weights, x): W(weights[0]) S(x) W(weights[1]) return qml.expval(qml.PauliZ(wires=0)) n_ansatz_layers = 1 def random_weights(): return 2 * np.pi * np.random.random(size=(2, n_ansatz_layers, n_qubits)) n_coeffs = 5 n_samples = 100 coeffs = [] for i in range(n_samples): weights = random_weights() def f(x): return np.array([quantum_model(weights, x_) for x_ in x]) coeffs_sample = fourier_coefficients(f, n_coeffs) coeffs.append(coeffs_sample) coeffs = np.array(coeffs) coeffs_real = np.real(coeffs) coeffs_imag = np.imag(coeffs) n_coeffs = len(coeffs_real[0]) fig, ax = plt.subplots(1, n_coeffs, figsize=(15, 4)) for idx, ax_ in enumerate(ax): ax_.set_title(r"$c_{}$".format(idx)) ax_.scatter(coeffs_real[:, idx], coeffs_imag[:, idx], s=20, facecolor='white', edgecolor='red') ax_.set_aspect("equal") ax_.set_ylim(-1, 1) ax_.set_xlim(-1, 1) plt.tight_layout(pad=0.5) plt.show(); var = 2 n_ansatz_layers = 1 dev_cv = qml.device('default.gaussian', wires=1) def S(x): qml.Rotation(x, wires=0) def W(theta): """Trainable circuit block.""" for r_ in range(n_ansatz_layers): qml.Displacement(theta[0], theta[1], wires=0) qml.Squeezing(theta[2], theta[3], wires=0) @qml.qnode(dev_cv) def quantum_model(weights, x): W(weights[0]) S(x) W(weights[1]) return qml.expval(qml.X(wires=0)) def random_weights(): return np.random.normal(size=(2, 5 * n_ansatz_layers), loc=0, scale=var) n_coeffs = 5 n_samples = 100 coeffs = [] for i in range(n_samples): weights = random_weights() def f(x): return np.array([quantum_model(weights, x_) for x_ in x]) coeffs_sample = fourier_coefficients(f, n_coeffs) coeffs.append(coeffs_sample) coeffs = np.array(coeffs) coeffs_real = np.real(coeffs) coeffs_imag = np.imag(coeffs) n_coeffs = len(coeffs_real[0]) fig, ax = plt.subplots(1, n_coeffs, figsize=(15, 4)) for idx, ax_ in enumerate(ax): ax_.set_title(r"$c_{}$".format(idx)) ax_.scatter(coeffs_real[:, idx], coeffs_imag[:, idx], s=20, facecolor='white', edgecolor='red') ax_.set_aspect("equal") ax_.set_ylim(-1, 1) ax_.set_xlim(-1, 1) plt.tight_layout(pad=0.5) plt.show();
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import pennylane as qml from pennylane import numpy as np dev1 = qml.device("default.qubit", wires=1) @qml.qnode(dev1) def circuit(params): qml.RX(params[0], wires=0) qml.RY(params[1], wires=0) return qml.expval(qml.PauliZ(0)) print(circuit([0.54,0.12])) dcircuit = qml.grad(circuit, argnum = 0) print(dcircuit([0.54,0.12])) @qml.qnode(dev1) def circuit2(phi1, phi2): qml.RX(phi1, wires=0) qml.RY(phi2, wires=0) return qml.expval(qml.PauliZ(0)) dcircuit = qml.grad(circuit2, argnum=[0, 1]) print(dcircuit(0.54, 0.12)) def cost(x): return circuit(x) init_params = np.array([0.011, 0.012], requires_grad=True) print(cost(init_params)) # initialise the optimizer opt = qml.GradientDescentOptimizer(stepsize=0.4) # set the number of steps steps = 100 # set the initial parameter values params = init_params for i in range(steps): # update the circuit parameters params = opt.step(cost, params) if (i + 1) % 5 == 0: print("Cost after step {:5d}: {: .7f}".format(i + 1, cost(params))) print("Optimized rotation angles: {}".format(params))
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
!pip install amazon-braket-pennylane-plugin my_bucket = "amazon-braket-Your-Bucket-Name" # the name of the bucket, keep the 'amazon-braket-' prefix and then include the bucket name my_prefix = "Your-Folder-Name" # the name of the folder in the bucket s3_folder = (my_bucket, my_prefix) device_arn = "arn:aws:braket:::device/quantum-simulator/amazon/sv1" import pennylane as qml from pennylane import numpy as np n_wires = 25 dev_remote = qml.device( "braket.aws.qubit", device_arn=device_arn, wires=n_wires, s3_destination_folder=s3_folder, parallel=True, ) dev_local = qml.device("default.qubit", wires=n_wires) def circuit(params): for i in range(n_wires): qml.RX(params[i], wires=i) for i in range(n_wires): qml.CNOT(wires=[i, (i + 1) % n_wires]) # Measure all qubits to make sure all's good with Braket observables = [qml.PauliZ(n_wires - 1)] + [qml.Identity(i) for i in range(n_wires - 1)] return qml.expval(qml.operation.Tensor(*observables)) qnode_remote = qml.QNode(circuit, dev_remote) qnode_local = qml.QNode(circuit, dev_local) import time params = np.random.random(n_wires) t_0_remote = time.time() qnode_remote(params) t_1_remote = time.time() t_0_local = time.time() qnode_local(params) t_1_local = time.time() print("Execution time on remote device (seconds):", t_1_remote - t_0_remote) print("Execution time on local device (seconds):", t_1_local - t_0_local) d_qnode_remote = qml.grad(qnode_remote) t_0_remote_grad = time.time() d_qnode_remote(params) t_1_remote_grad = time.time() print("Gradient calculation time on remote device (seconds):", t_1_remote_grad - t_0_remote_grad) d_qnode_local = qml.grad(qnode_local) t_0_local_grad = time.time() d_qnode_local(params) t_1_local_grad = time.time() print("Gradient calculation time on local device (seconds):", t_1_local_grad - t_0_local_grad) import networkx as nx nodes = n_wires = 20 edges = 60 seed = 1967 g = nx.gnm_random_graph(nodes, edges, seed=seed) positions = nx.spring_layout(g, seed=seed) nx.draw(g, with_labels=True, pos=positions) dev = qml.device( "braket.aws.qubit", device_arn=device_arn, wires=n_wires, s3_destination_folder=s3_folder, parallel=True, max_parallel=20, poll_timeout_seconds=30, ) cost_h, mixer_h = qml.qaoa.maxcut(g) n_layers = 2 def qaoa_layer(gamma, alpha): qml.qaoa.cost_layer(gamma, cost_h) qml.qaoa.mixer_layer(alpha, mixer_h) def circuit(params, **kwargs): for i in range(n_wires): # Prepare an equal superposition over all qubits qml.Hadamard(wires=i) qml.layer(qaoa_layer, n_layers, params[0], params[1]) return qml.expval(cost_h) cost_function = qml.QNode(circuit, dev) optimizer = qml.AdagradOptimizer(stepsize=0.1) import time np.random.seed(1967) params = 0.01 * np.random.uniform(size=[2, n_layers], requires_grad=True) iterations = 10 for i in range(iterations): t0 = time.time() params, cost_before = optimizer.step_and_cost(cost_function, params) t1 = time.time() if i == 0: print("Initial cost:", cost_before) else: print(f"Cost at step {i}:", cost_before) print(f"Completed iteration {i + 1}") print(f"Time to complete iteration: {t1 - t0} seconds") print(f"Cost at step {iterations}:", cost_function(params)) np.save("params.npy", params) print("Parameters saved to params.npy")
https://github.com/MonitSharma/Learn-Quantum-Machine-Learning
MonitSharma
import pennylane as qml from pennylane import numpy as np from pennylane.optimize import NesterovMomentumOptimizer dev = qml.device("default.qubit", wires=4) def layer(W): qml.Rot(W[0, 0], W[0, 1], W[0, 2], wires=0) qml.Rot(W[1, 0], W[1, 1], W[1, 2], wires=1) qml.Rot(W[2, 0], W[2, 1], W[2, 2], wires=2) qml.Rot(W[3, 0], W[3, 1], W[3, 2], wires=3) qml.CNOT(wires=[0, 1]) qml.CNOT(wires=[1, 2]) qml.CNOT(wires=[2, 3]) qml.CNOT(wires=[3, 0]) def statepreparation(x): qml.BasisState(x, wires=[0, 1, 2, 3]) @qml.qnode(dev) def circuit(weights, x): statepreparation(x) for W in weights: layer(W) return qml.expval(qml.PauliZ(0)) def variational_classifier(weights, bias, x): return circuit(weights, x) + bias def square_loss(labels, predictions): loss = 0 for l, p in zip(labels, predictions): loss = loss + (l - p) ** 2 loss = loss / len(labels) return loss def accuracy(labels, predictions): loss = 0 for l, p in zip(labels, predictions): if abs(l - p) < 1e-5: loss = loss + 1 loss = loss / len(labels) return loss def cost(weights, bias, X, Y): predictions = [variational_classifier(weights, bias, x) for x in X] return square_loss(Y, predictions) data = np.loadtxt("variational/data/parity.txt") X = np.array(data[:, :-1], requires_grad=False) Y = np.array(data[:, -1], requires_grad=False) Y = Y * 2 - np.ones(len(Y)) # shift label from {0, 1} to {-1, 1} for i in range(5): print("X = {}, Y = {: d}".format(X[i], int(Y[i]))) print("...") np.random.seed(0) num_qubits = 4 num_layers = 2 weights_init = 0.01 * np.random.randn(num_layers, num_qubits, 3, requires_grad=True) bias_init = np.array(0.0, requires_grad=True) print(weights_init, bias_init) opt = NesterovMomentumOptimizer(0.5) batch_size = 5 weights = weights_init bias = bias_init for it in range(25): # Update the weights by one optimizer step batch_index = np.random.randint(0, len(X), (batch_size,)) X_batch = X[batch_index] Y_batch = Y[batch_index] weights, bias, _, _ = opt.step(cost, weights, bias, X_batch, Y_batch) # Compute accuracy predictions = [np.sign(variational_classifier(weights, bias, x)) for x in X] acc = accuracy(Y, predictions) print( "Iter: {:5d} | Cost: {:0.7f} | Accuracy: {:0.7f} ".format( it + 1, cost(weights, bias, X, Y), acc ) ) dev = qml.device("default.qubit", wires=2) def get_angles(x): beta0 = 2 * np.arcsin(np.sqrt(x[1] ** 2) / np.sqrt(x[0] ** 2 + x[1] ** 2 + 1e-12)) beta1 = 2 * np.arcsin(np.sqrt(x[3] ** 2) / np.sqrt(x[2] ** 2 + x[3] ** 2 + 1e-12)) beta2 = 2 * np.arcsin( np.sqrt(x[2] ** 2 + x[3] ** 2) / np.sqrt(x[0] ** 2 + x[1] ** 2 + x[2] ** 2 + x[3] ** 2) ) return np.array([beta2, -beta1 / 2, beta1 / 2, -beta0 / 2, beta0 / 2]) def statepreparation(a): qml.RY(a[0], wires=0) qml.CNOT(wires=[0, 1]) qml.RY(a[1], wires=1) qml.CNOT(wires=[0, 1]) qml.RY(a[2], wires=1) qml.PauliX(wires=0) qml.CNOT(wires=[0, 1]) qml.RY(a[3], wires=1) qml.CNOT(wires=[0, 1]) qml.RY(a[4], wires=1) qml.PauliX(wires=0) x = np.array([0.53896774, 0.79503606, 0.27826503, 0.0], requires_grad=False) ang = get_angles(x) @qml.qnode(dev) def test(angles): statepreparation(angles) return qml.expval(qml.PauliZ(0)) test(ang) print("x : ", x) print("angles : ", ang) print("amplitude vector: ", np.real(dev.state)) def layer(W): qml.Rot(W[0, 0], W[0, 1], W[0, 2], wires=0) qml.Rot(W[1, 0], W[1, 1], W[1, 2], wires=1) qml.CNOT(wires=[0, 1]) @qml.qnode(dev) def circuit(weights, angles): statepreparation(angles) for W in weights: layer(W) return qml.expval(qml.PauliZ(0)) def variational_classifier(weights, bias, angles): return circuit(weights, angles) + bias def cost(weights, bias, features, labels): predictions = [variational_classifier(weights, bias, f) for f in features] return square_loss(labels, predictions) data = np.loadtxt("variational/data/iris.txt") X = data[:, 0:2] print("First X sample (original) :", X[0]) # pad the vectors to size 2^2 with constant values padding = 0.3 * np.ones((len(X), 1)) X_pad = np.c_[np.c_[X, padding], np.zeros((len(X), 1))] print("First X sample (padded) :", X_pad[0]) # normalize each input normalization = np.sqrt(np.sum(X_pad ** 2, -1)) X_norm = (X_pad.T / normalization).T print("First X sample (normalized):", X_norm[0]) # angles for state preparation are new features features = np.array([get_angles(x) for x in X_norm], requires_grad=False) print("First features sample :", features[0]) Y = data[:, -1] import matplotlib.pyplot as plt plt.figure() plt.scatter(X[:, 0][Y == 1], X[:, 1][Y == 1], c="b", marker="o", edgecolors="k") plt.scatter(X[:, 0][Y == -1], X[:, 1][Y == -1], c="r", marker="o", edgecolors="k") plt.title("Original data") plt.show() plt.figure() dim1 = 0 dim2 = 1 plt.scatter( X_norm[:, dim1][Y == 1], X_norm[:, dim2][Y == 1], c="b", marker="o", edgecolors="k" ) plt.scatter( X_norm[:, dim1][Y == -1], X_norm[:, dim2][Y == -1], c="r", marker="o", edgecolors="k" ) plt.title("Padded and normalised data (dims {} and {})".format(dim1, dim2)) plt.show() plt.figure() dim1 = 0 dim2 = 3 plt.scatter( features[:, dim1][Y == 1], features[:, dim2][Y == 1], c="b", marker="o", edgecolors="k" ) plt.scatter( features[:, dim1][Y == -1], features[:, dim2][Y == -1], c="r", marker="o", edgecolors="k" ) plt.title("Feature vectors (dims {} and {})".format(dim1, dim2)) plt.show() np.random.seed(0) num_data = len(Y) num_train = int(0.75 * num_data) index = np.random.permutation(range(num_data)) feats_train = features[index[:num_train]] Y_train = Y[index[:num_train]] feats_val = features[index[num_train:]] Y_val = Y[index[num_train:]] # We need these later for plotting X_train = X[index[:num_train]] X_val = X[index[num_train:]] num_qubits = 2 num_layers = 6 weights_init = 0.01 * np.random.randn(num_layers, num_qubits, 3, requires_grad=True) bias_init = np.array(0.0, requires_grad=True) opt = NesterovMomentumOptimizer(0.01) batch_size = 5 # train the variational classifier weights = weights_init bias = bias_init for it in range(60): # Update the weights by one optimizer step batch_index = np.random.randint(0, num_train, (batch_size,)) feats_train_batch = feats_train[batch_index] Y_train_batch = Y_train[batch_index] weights, bias, _, _ = opt.step(cost, weights, bias, feats_train_batch, Y_train_batch) # Compute predictions on train and validation set predictions_train = [np.sign(variational_classifier(weights, bias, f)) for f in feats_train] predictions_val = [np.sign(variational_classifier(weights, bias, f)) for f in feats_val] # Compute accuracy on train and validation set acc_train = accuracy(Y_train, predictions_train) acc_val = accuracy(Y_val, predictions_val) print( "Iter: {:5d} | Cost: {:0.7f} | Acc train: {:0.7f} | Acc validation: {:0.7f} " "".format(it + 1, cost(weights, bias, features, Y), acc_train, acc_val) ) plt.figure() cm = plt.cm.RdBu # make data for decision regions xx, yy = np.meshgrid(np.linspace(0.0, 1.5, 20), np.linspace(0.0, 1.5, 20)) X_grid = [np.array([x, y]) for x, y in zip(xx.flatten(), yy.flatten())] # preprocess grid points like data inputs above padding = 0.3 * np.ones((len(X_grid), 1)) X_grid = np.c_[np.c_[X_grid, padding], np.zeros((len(X_grid), 1))] # pad each input normalization = np.sqrt(np.sum(X_grid ** 2, -1)) X_grid = (X_grid.T / normalization).T # normalize each input features_grid = np.array( [get_angles(x) for x in X_grid] ) # angles for state preparation are new features predictions_grid = [variational_classifier(weights, bias, f) for f in features_grid] Z = np.reshape(predictions_grid, xx.shape) # plot decision regions cnt = plt.contourf( xx, yy, Z, levels=np.arange(-1, 1.1, 0.1), cmap=cm, alpha=0.8, extend="both" ) plt.contour( xx, yy, Z, levels=[0.0], colors=("black",), linestyles=("--",), linewidths=(0.8,) ) plt.colorbar(cnt, ticks=[-1, 0, 1]) # plot data plt.scatter( X_train[:, 0][Y_train == 1], X_train[:, 1][Y_train == 1], c="b", marker="o", edgecolors="k", label="class 1 train", ) plt.scatter( X_val[:, 0][Y_val == 1], X_val[:, 1][Y_val == 1], c="b", marker="^", edgecolors="k", label="class 1 validation", ) plt.scatter( X_train[:, 0][Y_train == -1], X_train[:, 1][Y_train == -1], c="r", marker="o", edgecolors="k", label="class -1 train", ) plt.scatter( X_val[:, 0][Y_val == -1], X_val[:, 1][Y_val == -1], c="r", marker="^", edgecolors="k", label="class -1 validation", ) plt.legend() plt.show()
https://github.com/fiasqo-io/quantumcircuit_gym
fiasqo-io
import gym import gym_quantcircuit import numpy as np env = gym.make('quantcircuit-v0') num_qubits = 3 test_goal_state = [0j] * (2**num_qubits - 1) + [1+0j] env.var_init(num_qubits, unitary=False, gate_group='pauli', connectivity='fully_connected', goal_state=test_goal_state) env.render() env.plot_connectivity_graph() action = env.sample() env.gate_list[action] env.step(action) env.render() for _ in range(5): env.step(env.sample()) env.render() env.reset() env.render() # Environment must be created before this step custom_gate_group = [ env.qcircuit.x, env.qcircuit.h, env.qcircuit.t ] env.set_gate_group('custom',custom_gate_group) env.gate_list = env._create_gates() env.gate_list # Nearest neighbour nnenv = gym.make('quantcircuit-v0') nnenv.var_init(5,connectivity='nearest_neighbour') nnenv.plot_connectivity_graph() # Fully Connected fc_env = gym.make('quantcircuit-v0') fc_env.var_init(5,connectivity='fully_connected') fc_env.plot_connectivity_graph() # IBM - limited to 5, 14 or 20 qubits (these are the only current physical architectures) ibm_env = gym.make('quantcircuit-v0') ibm_env.var_init(5,connectivity='ibm') ibm_env.plot_connectivity_graph() # Custom custom_conn = np.array([[1,1,1,0],[1,1,1,0],[1,1,1,1],[0,0,1,1]]) custom_env = gym.make('quantcircuit-v0') custom_env.var_init(4,connectivity='custom',custom_connectivity=custom_conn) custom_env.plot_connectivity_graph() num_gates = 2 curriculum, tracker = env.make_curriculum(num_gates) curriculum tracker
https://github.com/fiasqo-io/quantumcircuit_gym
fiasqo-io
import itertools as it import gym from gym import error, spaces, utils from gym.utils import seeding import qiskit from qiskit import QuantumRegister, QuantumCircuit, execute, Aer from qutip import qeye, basis, Qobj, fidelity, hadamard_transform, qubit_states, tracedist import numpy as np import matplotlib.pyplot as plt import networkx as nx class QuantCircuitEnv(gym.Env): """ A quantum circuit implementation using the Qiskit library, containing methods to construct and simulate quantum circuits designed to perform specific operations. Mainly for use in Reinforcement Learning with an agent choosing and learning actions for a specific goal. """ def __init__(self): pass def var_init(self, num_qubits, unitary=False, gate_group='pauli', connectivity='nearest_neighbour', goal_state=None, goal_unitary=None, custom_gates=None, custom_connectivity=None): """ Initialises the Quantum Circuit Environment object with arguments since gym.make can't do so. Args: num_qubits (int): number of qubits in the desired circuit unitary (bool): if True sets environment to use unitary matrices, otherwise uses statevectors gate_group (str): string to define the gate group used, options include 'pauli','clifford' and 'IQP' goal_state (list): list of complex values defining goal statevector, must have 2**num_qubits values goal_unitary (np.array): goal unitary matrix, must have shape (2**num_qubits, 2**num_qubits) custom_gates (list): list of gate functions to use in the circuit custom_connectivity (np.array): a NxN binary matrix where N is the number of qubits, with entry [i,j] = 1 when qubit i is physically connected to qubit j. Return: None """ # Define whether using unitaries or statevectors try: self.is_unitary = bool(unitary) except ValueError: print('Please use a boolean value for "unitary".') # Set number of qubits in circuit, and dimensionality try: self.num_qubits = int(num_qubits) except ValueError: print('Please use an integer value for number of qubits.') self.dimension = 2**self.num_qubits # Initialise qiskit circuit object self.q_reg = QuantumRegister(self.num_qubits) self.qcircuit = QuantumCircuit(self.q_reg) # Initialise current/goal statevectors self.current_state = [1+0j] + [0+0j]*(self.dimension - 1) # concatenate real and imaginary parts of statevector into one array self.comp_state = np.append(np.real(self.current_state), np.imag(self.current_state)) if goal_state is None: self.goal_state = [1+0j]+[0+0j]*(self.dimension-1) else: assert len(goal_state) == self.dimension, 'Goal state is not correct length.' self.goal_state = goal_state self.comp_goal = np.append(np.real(self.goal_state), np.imag(self.goal_state)) # Initialise unitaries if self.is_unitary: self.current_unitary = qeye(self.dimension).full() if goal_unitary is None: self.goal_unitary = qeye(self.dimension).full() else: assert np.asarray(goal_unitary).shape == (self.dimension, self.dimension), ('Goal ' 'unitary is not correct shape.') self.goal_unitary = goal_unitary # Define gate group used self.gate_group = gate_group self.set_gate_group(gate_group, custom_gates) # Initialise qubit connectivity self.define_connectivity(connectivity, custom_connectivity) # Initialise gate list self.gate_list = self._create_gates() # Initialise other various values self.basis_state = basis(self.dimension) self.gate_count = 1 self.action_space_n = len(self.gate_list) self.num_actions = self.num_qubits*6 self.EPS = 1e-10 self.has_run = False def step(self, action): """ Takes a single step (action) inside the environment Args: action (int): index of the action in self.gate_list generated by self._create_gates - containing all combinations of legal qubit/gate combinations Return: diff (np.array): difference between current and goal state reward (float): reward gained from taking the specified action done (bool): True if agent has reached the goal, False otherwise measures (dict): dictionary containing the measure used to determine reward """ if not self.has_run: self.set_gate_group(self.gate_group) self.gate_list = self._create_gates() self.has_run = True assert action in range(self.action_space_n), 'Not a valid action.' # Initialize done variable done = False # Extra reward for using identities instead of other gates - may not be needed? extra = 0 # Keep track of number of gates used self.gate_count += 1 # Check if multi-qubit gate - self.gate_list[action][0] is a tuple of the qubits if len(self.gate_list[action][0]) > 1: # Apply gate to circuit - the second arg of the tuple is the gate function self.gate_list[action][1](self.q_reg[self.gate_list[action][0][0]], self.q_reg[self.gate_list[action][0][1]]) else: # Do the same but for single qubit gates self.gate_list[action][1](self.q_reg[self.gate_list[action][0][0]]) # Unitary case if self.is_unitary: self.job = execute(self.qcircuit, backend=qiskit.BasicAer.get_backend('unitary_simulator')) self.current_unitary = self.job.result().get_unitary(self.qcircuit) diff = np.asarray(self.goal_unitary-self.current_unitary).flatten() diff = np.append(np.real(diff), np.imag(diff)) # Statevector case else: self.job = execute(self.qcircuit, backend=qiskit.BasicAer.get_backend('statevector_simulator')) self.current_state = self.job.result().get_statevector(self.qcircuit) self.comp_state = np.append(np.real(self.current_state), np.imag(self.current_state)) diff = self.comp_goal - self.comp_state reward = 0 # Reward inversely proportional to number of gates used if fidelity is hit if round(self.fidelity(), 3) == 1: reward = 50*(1/(self.gate_count+1)) done = True return diff, reward, done, {'fidelity': round(self.fidelity(), 3)} def reset(self): """ Resets the circuit to empty and any relevant variables to their initial state Return: diff (list): real and imaginary parts of the current reset quantum state/unitary """ self.qcircuit = QuantumCircuit(self.q_reg) self.current_state = [1+0j]+[0+0j]*(2**self.num_qubits-1) self.current_unitary = qeye(2**self.num_qubits).full() self.comp_state = np.append(np.real(self.current_state), np.imag(self.current_state)) self.gate_count = 0 self.has_run = False if self.is_unitary: diff = np.asarray(self.goal_unitary-self.current_unitary).flatten() diff = np.append(np.real(diff), np.imag(diff)) else: diff = self.comp_goal - self.comp_state return diff def render(self): """ Return: text drawing of the current circuit represented by the QuantumCircuit object """ return self.qcircuit.draw() def define_goal(self, goal_state): """ Defines goal statevector or unitary matrix for the circuit. Args: goal_state (list): flattened statevector or unitary matrix Return: None """ if self.is_unitary: self.goal_unitary = goal_state elif not self.is_unitary: assert len(goal_state) == len(self.current_state) self.goal_state = goal_state self.comp_goal = np.append(np.real(goal_state), np.imag(goal_state)) def sample(self): """ Return: action (int): a specific action in the circuit environment action space """ action = np.random.randint(0, self.action_space_n) return action def fidelity(self): """ Calculates fidelity of current and goal state/unitary. Return: fid (float): fidelity measure """ if self.is_unitary: assert self.current_unitary.shape == self.goal_unitary.shape fid = fidelity(Qobj(self.current_unitary)*self.basis_state, Qobj(self.goal_unitary)*self.basis_state) else: assert len(self.current_state) == len(self.goal_state) fid = fidelity(Qobj([self.current_state]), Qobj([self.goal_state])) return fid def set_gate_group(self, gate_group, custom_gates=None): """ Defines the gate group to be used within the enviroment Args: gate_group (str): name of the gate group used custom_gates (dict): A set of custom gates may be defined using a dictionary, the form looks like{"gate_name":gate_function} Returns: None """ gate_group = gate_group.lower() if gate_group == 'clifford': # Clifford group uses cnot, phase gate and hadamard self.gate_group_list = [ self.qcircuit.iden, self.qcircuit.cx, self.qcircuit.h, self.qcircuit.s, self.qcircuit.t ] elif gate_group == 'pauli': self.gate_group_list = [ self.qcircuit.iden, self.qcircuit.h, self.qcircuit.x, self.qcircuit.z, self.qcircuit.cx ] elif gate_group == 'IQP': self.gate_group_list = [ self.qcircuit.iden, self.qcircuit.t, (2, self.c_s_gate) ] # Sets up the circuit with initial hadamard gates, # as is necessary for circuits with the IQP format temp_state = (hadamard_transform(self.num_qubits)* qubit_states(self.num_qubits)).full() self.qcircuit.initialize(temp_state.flatten(), [self.q_reg[i] for i in range(self.num_qubits)]) elif gate_group == 'custom': assert custom_gates is not None, 'custom_gates is not defined.' self.gate_group_list = custom_gates else: raise "%s gate_group not defined!"%gate_group def _create_gates(self): """ Create a list of gate/qubit tuples that contains all possible combinations given a defined qubit connectivity. Return: gate_list (list): list of tuples of all qubit/gate combinations """ gate_list = [] for gates in self.gate_group_list: if isinstance(gates, tuple): gate_qubits = gates[0] gates = gates[1] else: # Qiskit defines the gate function as 'iden', # but in the descriptions of a circuit object calls the identity 'id' # changed to make valid key for the dictionary if gates.__name__ == 'iden': name = 'id' else: name = gates.__name__ gate_qubits = self.qcircuit.definitions[str(name)]['n_bits'] # Check if multi-qubit gate (currently max is 2 qubits) if gate_qubits > 1: for qubits_t in range(self.num_qubits): for qubits_c in range(self.num_qubits): # Check for connectivity, and don't allow connection with self if self.connectivity[qubits_t, qubits_c] == 1 and qubits_t != qubits_c: gate_list.append(((qubits_t, qubits_c), gates)) else: # Assumption made that these are single-qubit gates for i in range(self.num_qubits): gate_list.append(((i, ), gates)) return gate_list def define_connectivity(self, connectivity, custom_matrix=None): """ Creates a binary matrix that describes the connections between qubits Args: connectivity (str): string representation of connectivity format custom_matrix (np.array): binary array with index pairs denoting a connection between those two qubits i.e. (i,j) = 1 if qubit i is connected to qubit j. This is a one way mapping, if two way connectivity is desired the array must be symmetric about the diagonal. Return: None """ connectivity_matrix = np.identity(self.num_qubits) connectivity = connectivity.lower() assert connectivity in ['nearest_neighbour', 'fully_connected', 'custom', 'ibm'] if connectivity == 'nearest_neighbour': for i in range(self.num_qubits-1): connectivity_matrix[i, i+1] = 1 connectivity_matrix[i+1, i] = 1 # Connects extremities connectivity_matrix[0, self.num_qubits-1] == 1 connectivity_matrix[self.num_qubits-1, 0] == 1 elif connectivity == 'fully_connected': #fully conencted mean every conenction is allowable connectivity_matrix = np.ones((self.num_qubits, self.num_qubits)) elif connectivity == "custom": assert np.asarray(custom_matrix).shape == ((self.num_qubits, self.num_qubits), "Dimension mismatch!") connectivity_matrix = custom_matrix elif connectivity == "ibm": assert self.num_qubits in [5, 14, 20] # Based on IBMQ 5 Tenerife and IBMQ 5 Yorktown if self.num_qubits == 5: connectivity_matrix = np.array([[0, 1, 1, 0, 0], [1, 0, 1, 0, 0], [1, 1, 0, 1, 1], [0, 0, 1, 0, 1], [0, 0, 1, 1, 0]]) # Based on IBMQ 14 Melbourne elif self.num_qubits == 14: connectivity_matrix = np.zeros((14, 14)) for i in range(14): for j in range(14): if i + j == 14: connectivity_matrix[(i, j)] = 1 for i in range(13): if i != 6: connectivity_matrix[(i, i+1)] = 1 # Based on IBMQ 20 Tokyo elif self.num_qubits == 20: connectivity_matrix = np.zeros((20, 20)) for k in [0, 5, 10, 15]: for j in range(k, k+4): connectivity_matrix[(j, j+1)] = 1 for k in range(5): connectivity_matrix[(k, k+5)] = 1 connectivity_matrix[(k+5, k+10)] = 1 connectivity_matrix[(k+10, k+15)] = 1 for k in [1, 3, 5, 7, 11, 13]: connectivity_matrix[(k, k+6)] = 1 for k in [2, 4, 6, 8, 12, 14]: connectivity_matrix[(k, k+4)] = 1 self.connectivity = connectivity_matrix def plot_connectivity_graph(self): """ Draws a graph of nodes and edges that represents the physical connectivity of the qubits. Graph will not be completely symmetric and will not be an exact replica of the framework, but will provide an accurate visual representation of the connections between qubits. Returns: None """ graph = nx.Graph() graph.add_nodes_from([i for i in range(self.num_qubits)]) for i in range(self.num_qubits): for j in range(self.num_qubits): if self.connectivity[(i, j)] == 1: graph.add_edge(i, j) nx.draw(graph, with_labels=True, font_weight='bold') plt.show() def trace_norm(self): """ Calculates trace norms of density state of matrix - to use this as a metric, take the difference (p_0 - p_1) and return the value of the trace distance Return: dist (float): trace distance of difference between density matrices """ current = Qobj(self.current_state) goal = Qobj(self.goal_state) density_1 = current*current.dag() density_2 = goal*goal.dag() dist = tracedist(density_1, density_2) return dist def c_s_gate(self, target, control): """ Creates custom composite gate from defined qiskit gates that is contained in the IQP group Args: target (int): index of the target qubit control (int): index of the control qubit Return: None """ # We need to create a controlled-S gate using simple gates from qiskit, # this can be done using cnots and T gates + T_dag self.qcircuit.cx(control, target) self.qcircuit.tdg(target) self.qcircuit.cx(control, target) self.qcircuit.t(target) self.qcircuit.t(control) def make_curriculum(self, num_gates, loop_list=None): """ Designs curriculum for agent which gradually increases goal difficulty. Args: num_gates (int): max number of gates for a circuit in the curriculum loop_list (list): A list of times you want to loop each curriculum stage Return: curriculum (list): list of goal unitaries/statevectors for the agent to target tracker (array): array of how many goals found in each section """ if not loop_list is None: assert len(loop_list) == num_gates, ('List of number of loops for each gate' 'must have length num_gates') loop_num = 0 gate_group_n = len(self.gate_group_list) curriculum, state_check, tracker = ([], [], []) self.gate_list = self._create_gates() num_moves = len(self.gate_list) moves = np.linspace(0, num_moves-1, num_moves) for j in range(0, num_gates): max_gates = j+1 curriculum_sect = [] if max_gates < 4: all_moves = [p for p in it.product(moves, repeat=max_gates)] else: all_moves = np.zeros(5000) for k in range(0, len(all_moves)): self.reset() self.set_gate_group(self.gate_group) l = 0 move_set = all_moves[k] while l != max_gates: if max_gates >= 4: #randomly search combinations i = np.random.randint(0, num_moves) else: #move through every combination i = move_set[l] self.gate_list = self._create_gates() tple = self.gate_list[int(i)] if len(tple[0]) > 1: tple[1](self.q_reg[tple[0][0]], self.q_reg[tple[0][1]]) else: tple[1](self.q_reg[tple[0][0]]) l += 1 else: job2 = execute(self.qcircuit, backend=qiskit.BasicAer.get_backend('statevector_simulator')) state_to_check = job2.result().get_statevector(self.qcircuit) for i in range(len(state_to_check.real)): state_to_check.real[i] = np.round(state_to_check.real[i], 4) state_to_check.imag[i] = np.round(state_to_check.imag[i], 4) if self.is_unitary: job = execute(self.qcircuit, backend=qiskit.BasicAer.get_backend('unitary_simulator')) current_state = job.result().get_unitary(self.qcircuit) for i in range(len(current_state.real)): for j in range(len(current_state[0].real)): current_state.real[i][j] = np.round(current_state.real[i][j], 4) current_state.imag[i][j] = np.round(current_state.imag[i][j], 4) else: current_state = state_to_check if len(state_check) >= 1: if (any(np.equal(state_check, state_to_check).all(1)) or any(np.equal(state_check, -state_to_check).all(1))): pass else: curriculum_sect.append(current_state) state_check.append(state_to_check) else: curriculum_sect.append(current_state) state_check.append(state_to_check) tracker.append(len(curriculum_sect)) if loop_list is None: loop = 1 else: loop = loop_list[loop_num] curriculum += curriculum_sect*loop loop_num += 1 for i in range(len(curriculum)): curriculum[i] = np.ndarray.tolist(curriculum[i]) return curriculum, tracker
https://github.com/UST-QuAntiL/qiskit-service
UST-QuAntiL
# ****************************************************************************** # Copyright (c) 2020-2021 University of Stuttgart # # See the NOTICE file(s) distributed with this work for additional # information regarding copyright ownership. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ****************************************************************************** from qiskit_braket_provider import AWSBraketProvider from braket.aws.aws_session import AwsSession import boto3 from qiskit.providers.jobstatus import JOB_FINAL_STATES from qiskit import QiskitError def get_qpu(access_key, secret_access_key, qpu_name, region='eu-west-2'): boto_session = boto3.Session( aws_access_key_id=access_key, aws_secret_access_key=secret_access_key, region_name=region, ) session = AwsSession(boto_session) provider = AWSBraketProvider() backend = provider.get_backend(qpu_name, aws_session=session) return backend def execute_job(transpiled_circuit, shots, backend): """Generate qObject from transpiled circuit and execute it. Return result.""" try: job = backend.run(transpiled_circuit, shots=shots) job_status = job.status() while job_status not in JOB_FINAL_STATES: print("The job is still running") job_status = job.status() job_result = job.result() print("\nJob result:") print(job_result) job_result_dict = job_result.to_dict() print(job_result_dict) try: statevector = job_result.get_statevector() print("\nState vector:") print(statevector) except QiskitError: statevector = None print("No statevector available!") try: counts = job_result.get_counts() print("\nCounts:") print(counts) except QiskitError: counts = None print("No counts available!") try: unitary = job_result.get_unitary() print("\nUnitary:") print(unitary) except QiskitError: unitary = None print("No unitary available!") return {'job_result_raw': job_result_dict, 'statevector': statevector, 'counts': counts, 'unitary': unitary} except Exception: return None
https://github.com/UST-QuAntiL/qiskit-service
UST-QuAntiL
#!/usr/bin/env python # coding: utf-8 from qiskit import QuantumCircuit from qiskit.aqua.components.optimizers import COBYLA, ADAM, SPSA from qiskit.circuit.library import ZZFeatureMap, RealAmplitudes, ZFeatureMap, PauliFeatureMap from qiskit.quantum_info import Statevector import numpy as np import pandas as pd from sklearn.preprocessing import MinMaxScaler from sklearn.model_selection import train_test_split from sklearn.utils import shuffle import csv import warnings warnings.filterwarnings("ignore") class Benchmark: """ Benchmarking different optimizers, featuremaps and depth of variational circuits """ def __init__(self, optimizer, variational_depth, feature_map, X_train, X_test, Y_train, Y_test): """ Initial function :param optimizer: The optimizer to benchmark :param variational_depth: The depth of the variational circuit :param feature_map: The featuremap that encodes data :param X_train: The x data for training :param X_test: The x data for testing :param Y_train: The y data for training :param Y_test: The y data for testing """ self.optimizer = optimizer self.variational_depth = variational_depth self.feature_map = feature_map self.no_qubit = 4 self.random_state = 42 self.class_labels = ['yes', 'no'] self.circuit = None self.var_form = RealAmplitudes(self.no_qubit, reps=self.variational_depth) self.sv = Statevector.from_label('0' * self.no_qubit) self.X_train, self.X_test, self.Y_train, self.Y_test = X_train, X_test, Y_train, Y_test self.cost_list = [] def prepare_circuit(self): """ Prepares the circuit. Combines an encoding circuit, feature map, to a variational circuit, RealAmplitudes :return: """ self.circuit = self.feature_map.combine(self.var_form) # circuit.draw(output='mpl') def get_data_dict(self, params, x): """ Assign the params to the variational circuit and the data to the featuremap :param params: Parameter for training the variational circuit :param x: The data :return parameters: """ parameters = {} for i, p in enumerate(self.feature_map.ordered_parameters): parameters[p] = x[i] for i, p in enumerate(self.var_form.ordered_parameters): parameters[p] = params[i] return parameters def assign_label(self, bit_string): """ Based on the output from measurements assign no if it odd parity and yes if it is even parity :param bit_string: The bit string eg 00100 :return class_label: Yes or No """ hamming_weight = sum([int(k) for k in list(bit_string)]) is_odd_parity = hamming_weight & 1 if is_odd_parity: return self.class_labels[1] else: return self.class_labels[0] def return_probabilities(self, counts): """ Calculates the probabilities of the class label after assigning the label from the bit string measured as output :type counts: dict :param counts: The counts from the measurement of the quantum circuit :return result: The probability of each class """ shots = sum(counts.values()) result = {self.class_labels[0]: 0, self.class_labels[1]: 0} for key, item in counts.items(): label = self.assign_label(key) result[label] += counts[key] / shots return result def classify(self, x_list, params): """ Assigns the x and params to the quantum circuit the runs a measurement to return the probabilities of each class :type params: List :type x_list: List :param x_list: The x data :param params: Parameters for optimizing the variational circuit :return probs: The probabilities """ qc_list = [] for x in x_list: circ_ = self.circuit.assign_parameters(self.get_data_dict(params, x)) qc = self.sv.evolve(circ_) qc_list += [qc] probs = [] for qc in qc_list: counts = qc.to_counts() prob = self.return_probabilities(counts) probs += [prob] return probs @staticmethod def mse_cost(probs, expected_label): """ Calculates the mean squared error from the expected values and calculated values :type expected_label: List :type probs: List :param probs: The expected values :param expected_label: The real values :return mse: The mean squared error """ p = probs.get(expected_label) actual, pred = np.array(1), np.array(p) mse = np.square(np.subtract(actual, pred)).mean() return mse def cost_function(self, X, Y, params, print_value=False): """ This is the cost function and returns cost for optimization :type print_value: Boolean :type params: List :type Y: List :type X: List :param X: The x data :param Y: The label :param params: The parameters :param print_value: If you want values to be printed :return cost: """ # map training input to list of labels and list of samples cost = 0 training_labels = [] training_samples = [] for sample in X: training_samples += [sample] for label in Y: if label == 0: training_labels += [self.class_labels[0]] elif label == 1: training_labels += [self.class_labels[1]] probs = self.classify(training_samples, params) # evaluate costs for all classified samples for i, prob in enumerate(probs): cost += self.mse_cost(prob, training_labels[i]) cost /= len(training_samples) # print resulting objective function if print_value: print('%.4f' % cost) # return objective value self.cost_list.append(cost) return cost def test_model(self, X, Y, params): """ Test the model based on x test and y test :type params: List :type Y: List :type X: List :param X: The x test set :param Y: The y test set :param params: The parameters :return: """ accuracy = 0 training_samples = [] for sample in X: training_samples += [sample] probs = self.classify(training_samples, params) for i, prob in enumerate(probs): if (prob.get('yes') >= prob.get('no')) and (Y[i] == 0): accuracy += 1 elif (prob.get('no') >= prob.get('yes')) and (Y[i] == 1): accuracy += 1 accuracy /= len(Y) print("Test accuracy: {}".format(accuracy)) def run(self): """ Runs the whole code 1. Prepares the circuit 2. define the objective function 3. Initialize the paramters 4. Optimize the paramters by training the classifier :return: """ self.prepare_circuit() # define objective function for training objective_function = lambda params: self.cost_function(self.X_train, self.Y_train, params, print_value=False) # randomly initialize the parameters np.random.seed(self.random_state) init_params = 2 * np.pi * np.random.rand(self.no_qubit * self.variational_depth * 2) # train classifier opt_params, value, _ = self.optimizer.optimize(len(init_params), objective_function, initial_point=init_params) # print results # print() # print('opt_params:', opt_params) # print('opt_value: ', value) self.test_model(self.X_test, self.Y_test, opt_params) def get_cost_list(self): """ Return the cost list :return cost list: """ return self.cost_list def normalize_data(dataPath="../../Data/Processed/heartdata.csv"): """ Normalizes the data :return X_train, X_test, Y_train, Y_test: """ # Reads the data data = pd.read_csv(dataPath) data = shuffle(data, random_state=42) X, Y = data[['sex', 'cp', 'exang', 'oldpeak']].values, data['num'].values # normalize the data scaler = MinMaxScaler(feature_range=(-2 * np.pi, 2 * np.pi)) X = scaler.fit_transform(X) X_train, X_test, Y_train, Y_test = train_test_split(X, Y, test_size=0.3, random_state=42) return X_train, X_test, Y_train, Y_test def main(): data = {} feature_maps = ['ZZFeatureMap(4, reps=1)', 'ZZFeatureMap(4, reps=2)', 'ZZFeatureMap(4, reps=4)', 'ZFeatureMap(4, reps=1)', 'ZFeatureMap(4, reps=2)', 'ZFeatureMap(4, reps=4)', 'PauliFeatureMap(4, reps=1)', 'PauliFeatureMap(4, reps=2)', 'PauliFeatureMap(4, reps=4)'] optimizers = ["COBYLA(maxiter=50)", "SPSA(max_trials=50)", "ADAM(maxiter=50)"] x_train, x_test, y_train, y_test = normalize_data() for fe in feature_maps: for i in [1, 3, 5]: for opt in optimizers: print("FE: {}\tDepth: {}\tOpt: {}".format(fe, i, opt)) test_benchmark = Benchmark(optimizer=eval(opt), variational_depth=i, feature_map=eval(fe), X_train=x_train, X_test=x_test, Y_train=y_train, Y_test=y_test) test_benchmark.run() data_list = "{} {} vdepth {}".format(fe, opt, i) data[data_list] = test_benchmark.get_cost_list() w = csv.writer(open("../../Data/Processed/heartcosts.csv", "w")) for key, val in data.items(): w.writerow([key, val]) if __name__ == "__main__": main()
https://github.com/UST-QuAntiL/qiskit-service
UST-QuAntiL
# ****************************************************************************** # Copyright (c) 2020-2024 University of Stuttgart # # See the NOTICE file(s) distributed with this work for additional # information regarding copyright ownership. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ****************************************************************************** from time import sleep from qiskit import QiskitError, QuantumRegister, execute, Aer from qiskit.compiler import assemble from qiskit.providers.exceptions import JobError, JobTimeoutError from qiskit.providers.ibmq import IBMQ from qiskit.providers.jobstatus import JOB_FINAL_STATES from qiskit.utils.mitigation import CompleteMeasFitter, complete_meas_cal def get_qpu(token, qpu_name, url='https://auth.quantum-computing.ibm.com/api', hub='ibm-q', group='open', project='main'): """Load account from token. Get backend.""" try: IBMQ.disable_account() except: pass provider = IBMQ.enable_account(token=token, url=url, hub=hub, group=group, project=project) if 'simulator' in qpu_name: backend = Aer.get_backend('aer_simulator') else: backend = provider.get_backend(qpu_name) return backend def delete_token(): """Delete account.""" IBMQ.delete_account() def execute_job(transpiled_circuits, shots, backend, noise_model): """Generate qObject from transpiled circuit and execute it. Return result.""" try: job = backend.run(assemble(transpiled_circuits, shots=shots), noise_model=noise_model) job_status = job.status() while job_status not in JOB_FINAL_STATES: print("The job is still running") job_status = job.status() job_result = job.result() print("\nJob result:") print(job_result) job_result_dict = job_result.to_dict() print(job_result_dict) try: statevector = job_result.get_statevector() print("\nState vector:") print(statevector) except QiskitError: statevector = None print("No statevector available!") try: counts = job_result.get_counts() print("\nCounts:") print(counts) except QiskitError: counts = None print("No counts available!") try: unitary = job_result.get_unitary() print("\nUnitary:") print(unitary) except QiskitError: unitary = None print("No unitary available!") return {'job_result_raw': job_result_dict, 'statevector': statevector, 'counts': counts, 'unitary': unitary} except (JobError, JobTimeoutError): return None def get_meas_fitter(token, qpu_name, shots): """Execute the calibration circuits on the given backend and calculate resulting matrix.""" print("Starting calculation of calibration matrix for QPU: ", qpu_name) backend = get_qpu(token, qpu_name) # Generate a calibration circuit for each state qr = QuantumRegister(len(backend.properties().qubits)) meas_calibs, state_labels = complete_meas_cal(qr=qr, circlabel='mcal') # Execute each calibration circuit and store results print('Executing ' + str(len(meas_calibs)) + ' circuits to create calibration matrix...') cal_results = [] for circuit in meas_calibs: print('Executing circuit ' + circuit.name) cal_results.append(execute_calibration_circuit(circuit, shots, backend)) # Generate calibration matrix out of measurement results meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') return meas_fitter.filter def execute_calibration_circuit(circuit, shots, backend): """Execute a calibration circuit on the specified backend""" job = execute(circuit, backend=backend, shots=shots) job_status = job.status() while job_status not in JOB_FINAL_STATES: print('The execution is still running') sleep(20) job_status = job.status() return job.result()
https://github.com/UST-QuAntiL/qiskit-service
UST-QuAntiL
# ****************************************************************************** # Copyright (c) 2020-2021 University of Stuttgart # # See the NOTICE file(s) distributed with this work for additional # information regarding copyright ownership. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ****************************************************************************** import os import shutil import sys import tempfile import urllib.parse from http.client import HTTPResponse from importlib import reload from urllib import request, error import qiskit from flask import abort from app import app def prepare_code_from_data(data, input_params): """Get implementation code from data. Set input parameters into implementation. Return circuit.""" temp_dir = tempfile.mkdtemp() with open(os.path.join(temp_dir, "__init__.py"), "w") as f: f.write("") with open(os.path.join(temp_dir, "downloaded_code.py"), "w") as f: f.write(data) sys.path.append(temp_dir) try: import downloaded_code # deletes every attribute from downloaded_code, except __name__, because importlib.reload # doesn't reset the module's global variables for attr in dir(downloaded_code): if attr != "__name__": delattr(downloaded_code, attr) reload(downloaded_code) if 'get_circuit' in dir(downloaded_code): circuit = downloaded_code.get_circuit(**input_params) elif 'qc' in dir(downloaded_code): circuit = downloaded_code.qc finally: sys.path.remove(temp_dir) shutil.rmtree(temp_dir, ignore_errors=True) if not circuit: raise ValueError return circuit def prepare_code_from_url(url, input_params, bearer_token: str = "", post_processing=False): """Get implementation code from URL. Set input parameters into implementation. Return circuit.""" try: impl = _download_code(url, bearer_token) except (error.HTTPError, error.URLError): return None if not post_processing: circuit = prepare_code_from_data(impl, input_params) return circuit else: result = prepare_post_processing_code_from_data(impl, input_params) return result def prepare_code_from_qasm(qasm): return qiskit.QuantumCircuit.from_qasm_str(qasm) def prepare_code_from_qasm_url(url, bearer_token: str = ""): """Get implementation code from URL. Set input parameters into implementation. Return circuit.""" try: impl = _download_code(url, bearer_token) except (error.HTTPError, error.URLError): return None return prepare_code_from_qasm(impl) def prepare_post_processing_code_from_data(data, input_params): """Get implementation code from data. Set input parameters into implementation. Return circuit.""" temp_dir = tempfile.mkdtemp() with open(os.path.join(temp_dir, "__init__.py"), "w") as f: f.write("") with open(os.path.join(temp_dir, "downloaded_code.py"), "w") as f: f.write(data) sys.path.append(temp_dir) try: import downloaded_code # deletes every attribute from downloaded_code, except __name__, because importlib.reload # doesn't reset the module's global variables for attr in dir(downloaded_code): if attr != "__name__": delattr(downloaded_code, attr) reload(downloaded_code) if 'post_processing' in dir(downloaded_code): result = downloaded_code.post_processing(**input_params) finally: sys.path.remove(temp_dir) shutil.rmtree(temp_dir, ignore_errors=True) if not result: raise ValueError return result def _download_code(url: str, bearer_token: str = "") -> str: req = request.Request(url) if urllib.parse.urlparse(url).netloc == "platform.planqk.de": if bearer_token == "": app.logger.error("No bearer token specified, download from the PlanQK platform will fail.") abort(401) elif bearer_token.startswith("Bearer"): app.logger.error("The bearer token MUST NOT start with \"Bearer\".") abort(401) req.add_header("Authorization", "Bearer " + bearer_token) try: res: HTTPResponse = request.urlopen(req) except Exception as e: app.logger.error("Could not open url: " + str(e)) if str(e).find("401") != -1: abort(401) if res.getcode() == 200 and urllib.parse.urlparse(url).netloc == "platform.planqk.de": app.logger.info("Request to platform.planqk.de was executed successfully.") if res.getcode() == 401: abort(401) return res.read().decode("utf-8")
https://github.com/UST-QuAntiL/qiskit-service
UST-QuAntiL
# ****************************************************************************** # Copyright (c) 2023 University of Stuttgart # # See the NOTICE file(s) distributed with this work for additional # information regarding copyright ownership. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ****************************************************************************** from qiskit import QiskitError from qiskit.providers.jobstatus import JOB_FINAL_STATES from qiskit_ionq import IonQProvider def get_qpu(token, qpu_name): provider = IonQProvider(token) if "simulator" not in qpu_name: qpu_name = qpu_name.replace(" ", "-").lower() ionq_signature = "ionq_qpu." qpu_name = ionq_signature + qpu_name return provider.get_backend(qpu_name) def execute_job(transpiled_circuit, shots, backend): """Generate qObject from transpiled circuit and execute it. Return result.""" try: job = backend.run(transpiled_circuit, shots=shots) job_status = job.status() while job_status not in JOB_FINAL_STATES: print("The job is still running") job_status = job.status() job_result = job.result() print("\nJob result:") print(job_result) job_result_dict = job_result.to_dict() print(job_result_dict) try: statevector = job_result.get_statevector() print("\nState vector:") print(statevector) except QiskitError: statevector = None print("No statevector available!") try: counts = job_result.get_counts() print("\nCounts:") print(counts) except QiskitError: counts = None print("No counts available!") try: unitary = job_result.get_unitary() print("\nUnitary:") print(unitary) except QiskitError: unitary = None print("No unitary available!") return {'job_result_raw': job_result_dict, 'statevector': statevector, 'counts': counts, 'unitary': unitary} except Exception: return None
https://github.com/UST-QuAntiL/qiskit-service
UST-QuAntiL
# ****************************************************************************** # Copyright (c) 2024 University of Stuttgart # # See the NOTICE file(s) distributed with this work for additional # information regarding copyright ownership. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ****************************************************************************** import base64 import json from flask import jsonify, abort, request from qiskit import transpile from qiskit.providers.ibmq import IBMQAccountError from qiskit.transpiler.exceptions import TranspilerError from app import app, benchmarking, aws_handler, ibmq_handler, implementation_handler, db, parameters, circuit_analysis, \ analysis, ionq_handler from app.benchmark_model import Benchmark from app.generated_circuit_model import Generated_Circuit from app.qpu_metrics import generate_deterministic_uuid, get_all_qpus_and_metrics_as_json_str from app.result_model import Result @app.route('/qiskit-service/api/v1.0/generate-circuit', methods=['POST']) def generate_circuit(): if not request.json: abort(400) impl_language = request.json.get('impl-language', '') impl_url = request.json.get('impl-url', "") input_params = request.json.get('input-params', "") bearer_token = request.json.get("bearer-token", "") impl_data = '' if input_params: input_params = parameters.ParameterDictionary(input_params) if impl_url is not None and impl_url != "": impl_url = request.json['impl-url'] elif 'impl-data' in request.json: impl_data = base64.b64decode(request.json.get('impl-data').encode()).decode() else: abort(400) job = app.implementation_queue.enqueue('app.tasks.generate', impl_url=impl_url, impl_data=impl_data, impl_language=impl_language, input_params=input_params, bearer_token=bearer_token) result = Generated_Circuit(id=job.get_id()) db.session.add(result) db.session.commit() app.logger.info('Returning HTTP response to client...') content_location = '/qiskit-service/api/v1.0/generated-circuits/' + result.id response = jsonify({'Location': content_location}) response.status_code = 202 response.headers['Location'] = content_location response.autocorrect_location_header = True return response @app.route('/qiskit-service/api/v1.0/generated-circuits/<generated_circuit_id>', methods=['GET']) def get_generated_circuit(generated_circuit_id): """Return result when it is available.""" generated_circuit = Generated_Circuit.query.get(generated_circuit_id) if generated_circuit.complete: input_params_dict = json.loads(generated_circuit.input_params) return jsonify( {'id': generated_circuit.id, 'complete': generated_circuit.complete, 'input_params': input_params_dict, 'generated-circuit': generated_circuit.generated_circuit, 'original-depth': generated_circuit.original_depth, 'original-width': generated_circuit.original_width, 'original-total-number-of-operations': generated_circuit.original_total_number_of_operations, 'original-number-of-multi-qubit-gates': generated_circuit.original_number_of_multi_qubit_gates, 'original-number-of-measurement-operations': generated_circuit.original_number_of_measurement_operations, 'original-number-of-single-qubit-gates': generated_circuit.original_number_of_single_qubit_gates, 'original-multi-qubit-gate-depth': generated_circuit.original_multi_qubit_gate_depth}), 200 else: return jsonify({'id': generated_circuit.id, 'complete': generated_circuit.complete}), 200 @app.route('/qiskit-service/api/v1.0/transpile', methods=['POST']) def transpile_circuit(): """Get implementation from URL. Pass input into implementation. Generate and transpile circuit and return depth and width.""" if not request.json or not 'qpu-name' in request.json: abort(400) # Default value is ibmq for services that do not support multiple providers and expect the IBMQ provider provider = request.json.get('provider', 'ibmq') qpu_name = request.json['qpu-name'] impl_language = request.json.get('impl-language', '') input_params = request.json.get('input-params', "") impl_url = request.json.get('impl-url', "") bearer_token = request.json.get("bearer-token", "") if input_params: input_params = parameters.ParameterDictionary(input_params) if provider == 'ibmq' or provider == 'ionq': if 'token' in input_params: token = input_params['token'] elif 'token' in request.json: token = request.json.get('token') else: abort(400) elif provider == 'aws': if 'aws-access-key-id' in input_params and 'aws-secret-access-key' in input_params: aws_access_key_id = input_params['aws-access-key-id'] aws_secret_access_key = input_params['aws-secret-access-key'] elif 'aws-access-key-id' in request.json and 'aws-secret-access-key' in request.json: aws_access_key_id = request.json.get('aws-access-key-id') aws_secret_access_key = request.json.get('aws-secret-access-key') else: abort(400) if impl_url is not None and impl_url != "": impl_url = request.json['impl-url'] if impl_language.lower() == 'openqasm': short_impl_name = 'no name' circuit = implementation_handler.prepare_code_from_qasm_url(impl_url, bearer_token) else: short_impl_name = "untitled" try: circuit = implementation_handler.prepare_code_from_url(impl_url, input_params, bearer_token) except ValueError: abort(400) elif 'impl-data' in request.json: impl_data = base64.b64decode(request.json.get('impl-data').encode()).decode() short_impl_name = 'no short name' if impl_language.lower() == 'openqasm': circuit = implementation_handler.prepare_code_from_qasm(impl_data) else: try: circuit = implementation_handler.prepare_code_from_data(impl_data, input_params) except ValueError: abort(400) elif 'qasm-string' in request.json: short_impl_name = 'no short name' app.logger.info(request.json.get('qasm-string')) circuit = implementation_handler.prepare_code_from_qasm(request.json.get('qasm-string')) else: abort(400) try: non_transpiled_depth_old = 0 non_transpiled_depth = circuit.depth() while non_transpiled_depth_old < non_transpiled_depth: non_transpiled_depth_old = non_transpiled_depth circuit = circuit.decompose() non_transpiled_depth = circuit.depth() non_transpiled_width = circuit_analysis.get_width_of_circuit(circuit) non_transpiled_total_number_of_operations = circuit.size() non_transpiled_number_of_multi_qubit_gates = circuit.num_nonlocal_gates() non_transpiled_number_of_measurement_operations = circuit_analysis.get_number_of_measurement_operations(circuit) non_transpiled_number_of_single_qubit_gates = non_transpiled_total_number_of_operations - non_transpiled_number_of_multi_qubit_gates - non_transpiled_number_of_measurement_operations non_transpiled_multi_qubit_gate_depth, non_transpiled_circuit = circuit_analysis.get_multi_qubit_gate_depth( circuit.copy()) print(f"Non transpiled width {non_transpiled_width} & non transpiled depth {non_transpiled_depth}") if not circuit: app.logger.warn(f"{short_impl_name} not found.") abort(404) except Exception as e: app.logger.info(f"Transpile {short_impl_name} for {qpu_name}: {str(e)}") return jsonify({'error': str(e)}), 200 backend = None credentials = {} if provider == 'ibmq': if 'url' in input_params: credentials['url'] = input_params['url'] if 'hub' in input_params: credentials['hub'] = input_params['hub'] if 'group' in input_params: credentials['group'] = input_params['group'] if 'project' in input_params: credentials['project'] = input_params['project'] backend = ibmq_handler.get_qpu(token, qpu_name, **credentials) elif provider == 'ionq': backend = ionq_handler.get_qpu(token, qpu_name) elif provider == 'aws': if 'region' in input_params: credentials['region'] = input_params['region'] backend = aws_handler.get_qpu(access_key=aws_access_key_id, secret_access_key=aws_secret_access_key, qpu_name=qpu_name, **credentials) if not backend: app.logger.warn(f"{qpu_name} not found.") abort(404) try: if provider == 'aws': transpiled_circuit = transpile(circuit, backend=backend) else: transpiled_circuit = transpile(circuit, backend=backend, optimization_level=3) width = circuit_analysis.get_width_of_circuit(transpiled_circuit) depth = transpiled_circuit.depth() total_number_of_operations = transpiled_circuit.size() number_of_multi_qubit_gates = transpiled_circuit.num_nonlocal_gates() number_of_measurement_operations = circuit_analysis.get_number_of_measurement_operations(transpiled_circuit) number_of_single_qubit_gates = total_number_of_operations - number_of_multi_qubit_gates - number_of_measurement_operations multi_qubit_gate_depth, transpiled_circuit = circuit_analysis.get_multi_qubit_gate_depth(transpiled_circuit) except TranspilerError: app.logger.info(f"Transpile {short_impl_name} for {qpu_name}: too many qubits required") return jsonify({'error': 'too many qubits required'}), 200 app.logger.info(f"Transpile {short_impl_name} for {qpu_name}: w={width}, " f"d={depth}, " f"multi qubit gate depth={multi_qubit_gate_depth}, " f"total number of operations={total_number_of_operations}, " f"number of single qubit gates={number_of_single_qubit_gates}, " f"number of multi qubit gates={number_of_multi_qubit_gates}, " f"number of measurement operations={number_of_measurement_operations}") return jsonify({'original-depth': non_transpiled_depth, 'original-width': non_transpiled_width, 'original-total-number-of-operations': non_transpiled_total_number_of_operations, 'original-number-of-multi-qubit-gates': non_transpiled_number_of_multi_qubit_gates, 'original-number-of-measurement-operations': non_transpiled_number_of_measurement_operations, 'original-number-of-single-qubit-gates': non_transpiled_number_of_single_qubit_gates, 'original-multi-qubit-gate-depth': non_transpiled_multi_qubit_gate_depth, 'depth': depth, 'multi-qubit-gate-depth': multi_qubit_gate_depth, 'width': width, 'total-number-of-operations': total_number_of_operations, 'number-of-single-qubit-gates': number_of_single_qubit_gates, 'number-of-multi-qubit-gates': number_of_multi_qubit_gates, 'number-of-measurement-operations': number_of_measurement_operations, 'transpiled-qasm': transpiled_circuit.qasm()}), 200 @app.route('/qiskit-service/api/v1.0/analyze-original-circuit', methods=['POST']) def analyze_original_circuit(): if not request.json: abort(400) impl_language = request.json.get('impl-language', '') impl_url = request.json.get('impl-url', "") input_params = request.json.get('input-params', "") bearer_token = request.json.get("bearer-token", "") if input_params: input_params = parameters.ParameterDictionary(input_params) if impl_url is not None and impl_url != "": impl_url = request.json['impl-url'] if impl_language.lower() == 'openqasm': short_impl_name = 'no name' circuit = implementation_handler.prepare_code_from_qasm_url(impl_url, bearer_token) else: short_impl_name = "untitled" try: circuit = implementation_handler.prepare_code_from_url(impl_url, input_params, bearer_token) except ValueError: abort(400) elif 'impl-data' in request.json: impl_data = base64.b64decode(request.json.get('impl-data').encode()).decode() short_impl_name = 'no short name' if impl_language.lower() == 'openqasm': circuit = implementation_handler.prepare_code_from_qasm(impl_data) else: try: circuit = implementation_handler.prepare_code_from_data(impl_data, input_params) except ValueError: abort(400) elif 'qasm-string' in request.json: short_impl_name = 'no short name' app.logger.info(request.json.get('qasm-string')) circuit = implementation_handler.prepare_code_from_qasm(request.json.get('qasm-string')) else: abort(400) try: non_transpiled_depth_old = 0 non_transpiled_depth = circuit.depth() while non_transpiled_depth_old < non_transpiled_depth: non_transpiled_depth_old = non_transpiled_depth circuit = circuit.decompose() non_transpiled_depth = circuit.depth() non_transpiled_width = circuit_analysis.get_width_of_circuit(circuit) non_transpiled_total_number_of_operations = circuit.size() non_transpiled_number_of_multi_qubit_gates = circuit.num_nonlocal_gates() non_transpiled_number_of_measurement_operations = circuit_analysis.get_number_of_measurement_operations(circuit) non_transpiled_number_of_single_qubit_gates = non_transpiled_total_number_of_operations - non_transpiled_number_of_multi_qubit_gates - non_transpiled_number_of_measurement_operations non_transpiled_multi_qubit_gate_depth, non_transpiled_circuit = circuit_analysis.get_multi_qubit_gate_depth( circuit) print(f"Non transpiled width {non_transpiled_width} & non transpiled depth {non_transpiled_depth}") if not circuit: app.logger.warn(f"{short_impl_name} not found.") abort(404) except Exception as e: return jsonify({'error': str(e)}), 200 return jsonify({'original-depth': non_transpiled_depth, 'original-width': non_transpiled_width, 'original-total-number-of-operations': non_transpiled_total_number_of_operations, 'original-number-of-multi-qubit-gates': non_transpiled_number_of_multi_qubit_gates, 'original-number-of-measurement-operations': non_transpiled_number_of_measurement_operations, 'original-number-of-single-qubit-gates': non_transpiled_number_of_single_qubit_gates, 'original-multi-qubit-gate-depth': non_transpiled_multi_qubit_gate_depth}), 200 @app.route('/qiskit-service/api/v1.0/execute', methods=['POST']) def execute_circuit(): """Put execution jobs in queue. Return location of the later results.""" if not request.json or not 'qpu-name' in request.json: abort(400) # Default value is ibmq for services that do not support multiple providers and expect the IBMQ provider provider = request.json.get('provider', 'ibmq') correlation_id = request.json.get('correlation-id', None) qpu_name = request.json['qpu-name'] impl_language = request.json.get('impl-language', '') impl_url = request.json.get('impl-url') if type(impl_url) is str: impl_url = [impl_url] impl_data = request.json.get('impl-data') if type(impl_data) is str: impl_data = [impl_data] qasm_string = request.json.get('qasm-string') if type(qasm_string) is str: qasm_string = [qasm_string] transpiled_qasm = request.json.get('transpiled-qasm') if type(transpiled_qasm) is str: transpiled_qasm = [transpiled_qasm] bearer_token = request.json.get("bearer-token", "") input_params = request.json.get('input-params', "") noise_model = request.json.get("noise-model") only_measurement_errors = request.json.get("only-measurement-errors") optimization_level = request.json.get('transpilation-optimization-level', 3) if input_params: input_params = parameters.ParameterDictionary(input_params) token = '' aws_access_key_id = '' aws_secret_access_key = '' if provider == 'ibmq' or provider == 'ionq': if 'token' in input_params: token = input_params['token'] elif 'token' in request.json: token = request.json.get('token') else: abort(400) elif provider == 'aws': if 'aws-access-key-id' in input_params and 'aws-secret-access-key' in input_params: aws_access_key_id = input_params['aws-access-key-id'] aws_secret_access_key = input_params['aws-secret-access-key'] elif 'aws-access-key-id' in request.json and 'aws-secret-access-key' in request.json: aws_access_key_id = request.json.get('aws-access-key-id') aws_secret_access_key = request.json.get('aws-secret-access-key') else: abort(400) # Check parameters required for using premium accounts, de.imbq and reservations credentials = {} if provider == 'ibmq': if 'url' in input_params: credentials['url'] = input_params['url'] if 'hub' in input_params: credentials['hub'] = input_params['hub'] if 'group' in input_params: credentials['group'] = input_params['group'] if 'project' in input_params: credentials['project'] = input_params['project'] elif provider == 'aws': if 'region' in input_params: credentials['region'] = input_params['region'] shots = request.json.get('shots', 1024) job = app.execute_queue.enqueue('app.tasks.execute', correlation_id=correlation_id, provider=provider, impl_url=impl_url, impl_data=impl_data, impl_language=impl_language, transpiled_qasm=transpiled_qasm, qpu_name=qpu_name, token=token, access_key_aws=aws_access_key_id, secret_access_key_aws=aws_secret_access_key, input_params=input_params, noise_model=noise_model, only_measurement_errors=only_measurement_errors, optimization_level=optimization_level, shots=shots, bearer_token=bearer_token, qasm_string=qasm_string, **credentials) result = Result(id=job.get_id(), backend=qpu_name, shots=shots) db.session.add(result) db.session.commit() app.logger.info('Returning HTTP response to client...') content_location = '/qiskit-service/api/v1.0/results/' + result.id response = jsonify({'Location': content_location}) response.status_code = 202 response.headers['Location'] = content_location response.autocorrect_location_header = True return response @app.route('/qiskit-service/api/v1.0/calculate-calibration-matrix', methods=['POST']) def calculate_calibration_matrix(): """Put calibration matrix calculation job in queue. Return location of the later result.""" if not request.json or not 'qpu-name' in request.json or not 'token' in request.json: abort(400) qpu_name = request.json['qpu-name'] token = request.json['token'] shots = request.json.get('shots', 8192) job = app.execute_queue.enqueue('app.tasks.calculate_calibration_matrix', qpu_name=qpu_name, token=token, shots=shots) result = Result(id=job.get_id()) db.session.add(result) db.session.commit() app.logger.info('Returning HTTP response to client...') content_location = '/qiskit-service/api/v1.0/results/' + result.id response = jsonify({'Location': content_location}) response.status_code = 202 response.headers['Location'] = content_location response.autocorrect_location_header = True return response @app.route('/qiskit-service/api/v1.0/calc-wd/<qpu_name>', methods=['GET']) def calc_wd(qpu_name): """calculates wd-value of a given Quantum Computer based on the clifford data in your database and returns it""" wd = benchmarking.calc_wd(qpu_name) return jsonify(wd) # TODO: after Qiskit ignis is deprecated, the generation of Clifford gate circuits has to be adapted @app.route('/qiskit-service/api/v1.0/randomize', methods=['POST']) def randomize(): # """Create randomized circuits of given properties to run benchmarks and return locations to their results""" # if not request.json: # abort(400) # # qpu_name = request.json['qpu-name'] # num_of_qubits = request.json['number-of-qubits'] # min_depth_of_circuit = request.json['min-depth-of-circuit'] # max_depth_of_circuit = request.json['max-depth-of-circuit'] # num_of_circuits = request.json['number-of-circuits'] # clifford = request.json.get('clifford', False) # shots = request.json.get('shots', 1024) # token = request.json['token'] # # locations = benchmarking.randomize(qpu_name=qpu_name, num_of_qubits=num_of_qubits, shots=shots, # min_depth_of_circuit=min_depth_of_circuit, # max_depth_of_circuit=max_depth_of_circuit, num_of_circuits=num_of_circuits, # clifford=clifford, token=token) # # return jsonify(locations) return jsonify(0) @app.route('/qiskit-service/api/v1.0/results/<result_id>', methods=['GET']) def get_result(result_id): """Return result when it is available.""" result = Result.query.get(result_id) if result.complete: result_dict = json.loads(result.result) if result.post_processing_result: post_processing_result_dict = json.loads(result.post_processing_result) return jsonify( {'id': result.id, 'complete': result.complete, 'result': result_dict, 'backend': result.backend, 'shots': result.shots, 'generated-circuit-id': result.generated_circuit_id, 'post-processing-result': post_processing_result_dict}), 200 else: return jsonify( {'id': result.id, 'complete': result.complete, 'result': result_dict, 'backend': result.backend, 'shots': result.shots}), 200 else: return jsonify({'id': result.id, 'complete': result.complete}), 200 @app.route('/qiskit-service/api/v1.0/benchmarks/<benchmark_id>', methods=['GET']) def get_benchmark(benchmark_id): """Return summary of benchmark when it is available. Includes result of both simulator and quantum computer if available """ benchmark_sim = None benchmark_real = None # get the simulator's and quantum computer's result from the db i = 1 # for testing simulator can be benchmarked for benchmark in Benchmark.query.filter(Benchmark.benchmark_id == benchmark_id): if benchmark.backend == 'ibmq_qasm_simulator' and i > 0: benchmark_sim = benchmark i = i - 1 else: benchmark_real = benchmark # check which backend has finished execution and adapt response to that if (benchmark_sim is not None) and (benchmark_real is not None): if benchmark_sim.complete and benchmark_real.complete: if benchmark_sim.result == "" or benchmark_real.result == "": # one backend failed during the execution return json.dumps({'error': 'execution failed'}) # both backends finished execution return jsonify({'id': int(benchmark_id), 'benchmarking-complete': True, 'histogram-intersection': analysis.calc_intersection( json.loads(benchmark_sim.counts).copy(), json.loads(benchmark_real.counts).copy(), benchmark_real.shots), 'perc-error': analysis.calc_percentage_error(json.loads(benchmark_sim.counts), json.loads(benchmark_real.counts)), 'correlation': analysis.calc_correlation(json.loads(benchmark_sim.counts).copy(), json.loads(benchmark_real.counts).copy(), benchmark_real.shots), 'chi-square': analysis.calc_chi_square_distance(json.loads(benchmark_sim.counts).copy(), json.loads(benchmark_real.counts).copy()), 'benchmarking-results': [get_benchmark_body(benchmark_backend=benchmark_sim), get_benchmark_body(benchmark_backend=benchmark_real)]}), 200 elif benchmark_sim.complete and not benchmark_real.complete: if benchmark_sim.result == "": # execution on simulator failed return json.dumps({'error': 'execution failed'}) # simulator finished execution, quantum computer not yet return jsonify({'id': int(benchmark_id), 'benchmarking-complete': False, 'benchmarking-results': [get_benchmark_body(benchmark_backend=benchmark_sim), {'result-id': benchmark_real.id, 'complete': benchmark_real.complete}]}), 200 elif not benchmark_sim.complete and benchmark_real.complete: if benchmark_real.result == "": # execution on quantum computer failed return json.dumps({'error': 'execution failed'}) # quantum computer finished execution, simulator not yet return jsonify({'id': int(benchmark_id), 'benchmarking-complete': False, 'benchmarking-results': [ {'result-id': benchmark_sim.id, 'complete': benchmark_sim.complete}, get_benchmark_body(benchmark_backend=benchmark_real)]}), 200 else: # both backends did not finish execution yet return jsonify({'id': int(benchmark_id), 'benchmarking-complete': False, 'benchmarking-results': [ {'result-id': benchmark_sim.id, 'complete': benchmark_sim.complete}, {'result-id': benchmark_real.id, 'complete': benchmark_real.complete}]}), 200 else: abort(404) @app.route('/qiskit-service/api/v1.0/providers', methods=['GET']) def get_providers(): """Return available providers.""" return jsonify({"_embedded": {"providerDtoes": [ {"id": str(generate_deterministic_uuid("ibmq", "provider")), "name": "ibmq", "offeringURL": "https://quantum-computing.ibm.com/", }, {"id": str(generate_deterministic_uuid("aws", "provider")), "name": "aws", "offeringURL": "https://aws.amazon.com/braket/", }]}}), 200 @app.route('/qiskit-service/api/v1.0/providers/<provider_id>/qpus', methods=['GET']) def get_qpus_and_metrics_of_provider(provider_id: str): """Return qpus and metrics of the specified provider.""" if 'token' not in request.headers: return jsonify({"message": "Error: token missing in request"}), 401 token = request.headers.get('token') if provider_id == str(generate_deterministic_uuid("ibmq", "provider")): try: return get_all_qpus_and_metrics_as_json_str(token), 200 except IBMQAccountError: return jsonify({"message": "the provided token is wrong"}), 401 else: return jsonify({"message": "Error: unknown provider ID."}), 400 @app.route('/qiskit-service/api/v1.0/analysis', methods=['GET']) def get_analysis(): """Return analysis of all benchmarks saved in the database""" return jsonify(benchmarking.analyse()) @app.route('/qiskit-service/api/v1.0/analysis/<qpu_name>', methods=['GET']) def get_analysis_qpu(qpu_name): """Return analysis of all benchmarks from a specific quantum computer saved in the database""" benchmarks = Benchmark.query.all() list = [] for i in range(0, len(benchmarks), 2): if (benchmarks[i].complete and benchmarks[i + 1].complete) and ( benchmarks[i].benchmark_id == benchmarks[i + 1].benchmark_id) and ( benchmarks[i].result != "" and benchmarks[i + 1].result != "") and ( benchmarks[i + 1].backend == qpu_name): counts_sim = json.loads(benchmarks[i].counts) counts_real = json.loads(benchmarks[i + 1].counts) shots = benchmarks[i + 1].shots perc_error = analysis.calc_percentage_error(counts_sim, counts_real) correlation = analysis.calc_correlation(counts_sim.copy(), counts_real.copy(), shots) chi_square = analysis.calc_chi_square_distance(counts_sim.copy(), counts_real.copy()) intersection = analysis.calc_intersection(counts_sim.copy(), counts_real.copy(), shots) list.append({'benchmark-' + str(benchmarks[i].benchmark_id): { 'benchmark-location': '/qiskit-service/api/v1.0/benchmarks/' + str(benchmarks[i].benchmark_id), 'counts-sim': counts_sim, 'counts-real': counts_real, 'percentage-error': perc_error, 'chi-square': chi_square, 'correlation': correlation, 'histogram-intersection': intersection}}) return jsonify(list) @app.route('/qiskit-service/api/v1.0/version', methods=['GET']) def version(): return jsonify({'version': '1.0'}) def get_benchmark_body(benchmark_backend): return {'result-id': benchmark_backend.id, 'result-location': '/qiskit-service/api/v1.0/results/' + benchmark_backend.id, 'backend': benchmark_backend.backend, 'counts': json.loads(benchmark_backend.counts), 'original-depth': benchmark_backend.original_depth, 'original-width': benchmark_backend.original_width, 'original-number-of-multi-qubit-gates': benchmark_backend.original_number_of_multi_qubit_gates, 'transpiled-depth': benchmark_backend.transpiled_depth, 'transpiled-width': benchmark_backend.transpiled_width, 'transpiled-number-of-multi-qubit-gates': benchmark_backend.transpiled_number_of_multi_qubit_gates, 'clifford': benchmark_backend.clifford, 'benchmark-id': benchmark_backend.benchmark_id, 'complete': benchmark_backend.complete, 'shots': benchmark_backend.shots}
https://github.com/UST-QuAntiL/qiskit-service
UST-QuAntiL
# ****************************************************************************** # Copyright (c) 2020-2021 University of Stuttgart # # See the NOTICE file(s) distributed with this work for additional # information regarding copyright ownership. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ****************************************************************************** import base64 import datetime import json from qiskit import transpile, QuantumCircuit, Aer from qiskit.transpiler.exceptions import TranspilerError from qiskit.utils.measurement_error_mitigation import get_measured_qubits from qiskit_aer.noise import NoiseModel from rq import get_current_job from app import implementation_handler, aws_handler, ibmq_handler, db, app, ionq_handler, circuit_analysis from app.NumpyEncoder import NumpyEncoder from app.benchmark_model import Benchmark from app.generated_circuit_model import Generated_Circuit from app.result_model import Result def generate(impl_url, impl_data, impl_language, input_params, bearer_token): app.logger.info("Starting generate task...") job = get_current_job() generated_circuit_code = None if impl_url: generated_circuit_code = implementation_handler.prepare_code_from_url(impl_url, input_params, bearer_token) elif impl_data: generated_circuit_code = implementation_handler.prepare_code_from_data(impl_data, input_params) else: generated_circuit_object = Generated_Circuit.query.get(job.get_id()) generated_circuit_object.generated_circuit = json.dumps({'error': 'generating circuit failed'}) generated_circuit_object.complete = True db.session.commit() if generated_circuit_code: non_transpiled_depth_old = 0 generated_circuit_object = Generated_Circuit.query.get(job.get_id()) generated_circuit_object.generated_circuit = generated_circuit_code.qasm() non_transpiled_depth = generated_circuit_code.depth() while non_transpiled_depth_old < non_transpiled_depth: non_transpiled_depth_old = non_transpiled_depth generated_circuit_code = generated_circuit_code.decompose() non_transpiled_depth = generated_circuit_code.depth() generated_circuit_object.original_depth = non_transpiled_depth generated_circuit_object.original_width = circuit_analysis.get_width_of_circuit(generated_circuit_code) generated_circuit_object.original_total_number_of_operations = generated_circuit_code.size() generated_circuit_object.original_number_of_multi_qubit_gates = generated_circuit_code.num_nonlocal_gates() generated_circuit_object.original_number_of_measurement_operations = circuit_analysis.get_number_of_measurement_operations( generated_circuit_code) generated_circuit_object.original_number_of_single_qubit_gates = generated_circuit_object.original_total_number_of_operations - generated_circuit_object.original_number_of_multi_qubit_gates - generated_circuit_object.original_number_of_measurement_operations generated_circuit_object.original_multi_qubit_gate_depth, non_transpiled_circuit = circuit_analysis.get_multi_qubit_gate_depth( generated_circuit_code) generated_circuit_object.input_params = json.dumps(input_params) app.logger.info(f"Received input params for circuit generation: {generated_circuit_object.input_params}") generated_circuit_object.complete = True db.session.commit() def execute(correlation_id, provider, impl_url, impl_data, impl_language, transpiled_qasm, input_params, token, access_key_aws, secret_access_key_aws, qpu_name, optimization_level, noise_model, only_measurement_errors, shots, bearer_token, qasm_string, **kwargs): """Create database entry for result. Get implementation code, prepare it, and execute it. Save result in db""" app.logger.info("Starting execute task...") job = get_current_job() if provider == 'ibmq': backend = ibmq_handler.get_qpu(token, qpu_name, **kwargs) elif provider == 'ionq': backend = ionq_handler.get_qpu(token, qpu_name) elif provider == 'aws': backend = aws_handler.get_qpu(access_key=access_key_aws, secret_access_key=secret_access_key_aws, qpu_name=qpu_name, **kwargs) if not backend: result = Result.query.get(job.get_id()) result.result = json.dumps({'error': 'qpu-name or token wrong'}) result.complete = True db.session.commit() app.logger.info('Preparing implementation...') if transpiled_qasm: transpiled_circuits = [QuantumCircuit.from_qasm_str(qasm) for qasm in transpiled_qasm] else: if qasm_string: circuits = [implementation_handler.prepare_code_from_qasm(qasm) for qasm in qasm_string] elif impl_url and not correlation_id: if impl_language.lower() == 'openqasm': # list of circuits circuits = [implementation_handler.prepare_code_from_qasm_url(url, bearer_token) for url in impl_url] else: circuits = [implementation_handler.prepare_code_from_url(url, input_params, bearer_token) for url in impl_url] elif impl_data: impl_data = [base64.b64decode(data.encode()).decode() for data in impl_data] if impl_language.lower() == 'openqasm': circuits = [implementation_handler.prepare_code_from_qasm(data) for data in impl_data] else: circuits = [implementation_handler.prepare_code_from_data(data, input_params) for data in impl_data] if not circuits: result = Result.query.get(job.get_id()) result.result = json.dumps({'error': 'URL not found'}) result.complete = True db.session.commit() app.logger.info('Start transpiling...') if noise_model and provider == 'ibmq': noisy_qpu = ibmq_handler.get_qpu(token, noise_model, **kwargs) noise_model = NoiseModel.from_backend(noisy_qpu) properties = noisy_qpu.properties() configuration = noisy_qpu.configuration() coupling_map = configuration.coupling_map basis_gates = noise_model.basis_gates try: transpiled_circuits = transpile(circuits, noisy_qpu) except TranspilerError: result = Result.query.get(job.get_id()) result.result = json.dumps({'error': 'too many qubits required'}) result.complete = True db.session.commit() measurement_qubits = get_measurement_qubits_from_transpiled_circuit(transpiled_circuits) if only_measurement_errors: ro_noise_model = NoiseModel() for k, v in noise_model._local_readout_errors.items(): ro_noise_model.add_readout_error(v, k) noise_model = ro_noise_model backend = Aer.get_backend('aer_simulator') else: try: transpiled_circuits = transpile(circuits, backend=backend, optimization_level=optimization_level) except TranspilerError: result = Result.query.get(job.get_id()) result.result = json.dumps({'error': 'too many qubits required'}) result.complete = True db.session.commit() app.logger.info('Start executing...') if provider == 'aws' and not noise_model: # Note: AWS cannot handle such a noise model job_result = aws_handler.execute_job(transpiled_circuits, shots, backend) elif provider == 'ionq' and not noise_model: job_result = ionq_handler.execute_job(transpiled_circuits, shots, backend) else: # If we need a noise model, we have to use IBM Q job_result = ibmq_handler.execute_job(transpiled_circuits, shots, backend, noise_model) if job_result: result = Result.query.get(job.get_id()) result.result = json.dumps(job_result['counts']) # check if implementation contains post processing of execution results that has to be executed if correlation_id and (impl_url or impl_data): result.generated_circuit_id = correlation_id # prepare input data containing execution results and initial input params for generating the circuit generated_circuit = Generated_Circuit.query.get(correlation_id) input_params_for_post_processing = json.loads(generated_circuit.input_params) input_params_for_post_processing['counts'] = job_result['counts'] if impl_url: post_p_result = implementation_handler.prepare_code_from_url(url=impl_url[0], input_params=input_params_for_post_processing, bearer_token=bearer_token, post_processing=True) elif impl_data: post_p_result = implementation_handler.prepare_post_processing_code_from_data(data=impl_data[0], input_params=input_params_for_post_processing) result.post_processing_result = json.loads(post_p_result) result.complete = True db.session.commit() else: result = Result.query.get(job.get_id()) result.result = json.dumps({'error': 'execution failed'}) result.complete = True db.session.commit() def get_measurement_qubits_from_transpiled_circuit(transpiled_circuit): qubit_index, qubit_mappings = get_measured_qubits([transpiled_circuit]) measurement_qubits = [int(i) for i in list(qubit_mappings.keys())[0].split("_")] return measurement_qubits def convert_into_suitable_format(object): """Enables the serialization of the unserializable datetime.datetime format""" if isinstance(object, datetime.datetime): return object.__str__() def execute_benchmark(transpiled_qasm, token, qpu_name, shots): """Create database entry for result and benchmark. Get implementation code, prepare it, and execute it. Save result in db """ job = get_current_job() backend = ibmq_handler.get_qpu(token, qpu_name) if not backend: result = Result.query.get(job.get_id()) result.result = json.dumps({'error': 'qpu-name or token wrong'}) result.complete = True db.session.commit() app.logger.info('Preparing implementation...') transpiled_circuit = QuantumCircuit.from_qasm_str(transpiled_qasm) app.logger.info('Start executing...') job_result = ibmq_handler.execute_job(transpiled_circuit, shots, backend, None) if job_result: # once the job is finished save results in db result = Result.query.get(job.get_id()) result.result = json.dumps(job_result, default=convert_into_suitable_format) result.complete = True benchmark = Benchmark.query.get(job.get_id()) benchmark.result = json.dumps(job_result, default=convert_into_suitable_format) benchmark.counts = json.dumps(job_result['counts']) benchmark.complete = True db.session.commit() else: result = Result.query.get(job.get_id()) result.result = json.dumps({'error': 'execution failed'}) result.complete = True benchmark = Benchmark.query.get(job.get_id()) benchmark.complete = True db.session.commit() def calculate_calibration_matrix(token, qpu_name, shots): """Calculate the current calibration matrix for the given QPU and save the result in db""" job = get_current_job() backend = ibmq_handler.get_qpu(token, qpu_name) if backend: job_result = ibmq_handler.get_meas_fitter(token, qpu_name, shots) if job_result: result = Result.query.get(job.get_id()) result.result = json.dumps({'matrix': job_result.cal_matrix}, cls=NumpyEncoder) result.complete = True db.session.commit() else: result = Result.query.get(job.get_id()) result.result = json.dumps({'error': 'matrix calculation failed'}) result.complete = True db.session.commit() else: result = Result.query.get(job.get_id()) result.result = json.dumps({'error': 'qpu-name or token wrong'}) result.complete = True db.session.commit()
https://github.com/UST-QuAntiL/qiskit-service
UST-QuAntiL
# ****************************************************************************** # Copyright (c) 2021 University of Stuttgart # # See the NOTICE file(s) distributed with this work for additional # information regarding copyright ownership. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ****************************************************************************** import unittest import os from app.config import basedir from app import app, db import qiskit class TranspileTestCase(unittest.TestCase): def setUp(self): # setup environment variables for testing app.config['TESTING'] = True app.config['WTF_CSRF_ENABLED'] = False app.config['SQLALCHEMY_DATABASE_URI'] = "sqlite:///" + os.path.join(basedir, 'test.db') self.client = app.test_client() db.create_all() def tearDown(self): db.session.remove() db.drop_all() def test_version(self): response = self.client.get('/qiskit-service/api/v1.0/version') self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertTrue("version" in json_data) self.assertEqual(json_data['version'], "1.0") @unittest.skip("Has to be adapted as the benchmarking via Qiskit ignis is deprecated") def test_randomize_full_request(self): # prepare the request request = { 'qpu-name': 'ibmq_qasm_simulator', 'number-of-qubits': 1, 'min-depth-of-circuit': 1, 'max-depth-of-circuit': 1, 'number-of-circuits': 1, 'clifford': False, 'shots': 1024, 'token': os.environ["QISKIT_TOKEN"] } # send the request response = self.client.post('/qiskit-service/api/v1.0/randomize', json=request) self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertEqual(1, len(json_data)) self.assertEqual(3, len(json_data[0])) print(json_data[0]) self.assertIn("result-benchmark", json_data[0]) self.assertIn("result-simulator", json_data[0]) self.assertIn("result-real-backend", json_data[0]) @unittest.skip("Has to be adapted as the benchmarking via Qiskit ignis is deprecated") def test_randomize_no_shots_request(self): # prepare the request request = { 'qpu-name': 'ibmq_qasm_simulator', 'number-of-qubits': 1, 'min-depth-of-circuit': 1, 'max-depth-of-circuit': 1, 'number-of-circuits': 1, 'clifford': False, 'token': os.environ["QISKIT_TOKEN"] } # send the request response = self.client.post('/qiskit-service/api/v1.0/randomize', json=request) self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertEqual(1, len(json_data)) self.assertEqual(3, len(json_data[0])) self.assertIn("result-benchmark", json_data[0]) self.assertIn("result-simulator", json_data[0]) self.assertIn("result-real-backend", json_data[0]) @unittest.skip("Has to be adapted as the benchmarking via Qiskit ignis is deprecated") def test_randomize_no_clifford_request(self): # prepare the request request = { 'qpu-name': 'ibmq_qasm_simulator', 'number-of-qubits': 1, 'min-depth-of-circuit': 1, 'max-depth-of-circuit': 1, 'number-of-circuits': 1, 'token': os.environ["QISKIT_TOKEN"] } # send the request response = self.client.post('/qiskit-service/api/v1.0/randomize', json=request) self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertEqual(1, len(json_data)) self.assertEqual(3, len(json_data[0])) self.assertIn("result-benchmark", json_data[0]) self.assertIn("result-simulator", json_data[0]) self.assertIn("result-real-backend", json_data[0]) @unittest.skip("Has to be adapted as the benchmarking via Qiskit ignis is deprecated") def test_randomize_clifford_full_request(self): # prepare the request request = { 'qpu-name': 'ibmq_qasm_simulator', 'number-of-qubits': 1, 'min-depth-of-circuit': 1, 'max-depth-of-circuit': 1, 'number-of-circuits': 1, 'clifford': True, 'token': os.environ["QISKIT_TOKEN"] } # send the request response = self.client.post('/qiskit-service/api/v1.0/randomize', json=request) self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertEqual(1, len(json_data)) self.assertEqual(3, len(json_data[0])) self.assertIn("result-benchmark", json_data[0]) self.assertIn("result-simulator", json_data[0]) self.assertIn("result-real-backend", json_data[0]) if __name__ == "__main__": unittest.main()
https://github.com/UST-QuAntiL/qiskit-service
UST-QuAntiL
# ****************************************************************************** # Copyright (c) 2020-2021 University of Stuttgart # # See the NOTICE file(s) distributed with this work for additional # information regarding copyright ownership. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ****************************************************************************** import unittest import os from app.config import basedir from app import app, db import qiskit import base64 from qiskit.circuit.random import random_circuit class TranspileTestCase(unittest.TestCase): def setUp(self): # setup environment variables for testing app.config['TESTING'] = True app.config['WTF_CSRF_ENABLED'] = False app.config['SQLALCHEMY_DATABASE_URI'] = "sqlite:///" + os.path.join(basedir, 'test.db') self.client = app.test_client() db.create_all() def tearDown(self): db.session.remove() db.drop_all() def test_version(self): response = self.client.get('/qiskit-service/api/v1.0/version') self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertTrue("version" in json_data) self.assertEqual(json_data['version'], "1.0") def test_transpile_hadamard_simulator_url(self): # prepare the request request = { 'impl-url': "https://raw.githubusercontent.com/PlanQK/qiskit-service/master/test/data/hadamard.py", 'impl-language': 'Qiskit', 'qpu-name': "ibmq_qasm_simulator", 'input-params': {}, 'token': os.environ["QISKIT_TOKEN"] } # send the request response = self.client.post('/qiskit-service/api/v1.0/transpile', json=request) self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertIn("width", json_data) self.assertIn("depth", json_data) self.assertIsNotNone(json_data['depth']) self.assertIsNotNone(json_data['width']) self.assertIn('transpiled-qasm', json_data) self.assertIn("total-number-of-operations", json_data) self.assertIn("number-of-multi-qubit-gates", json_data) self.assertIn("multi-qubit-gate-depth", json_data) self.assertIsNotNone(json_data["total-number-of-operations"]) self.assertEqual(json_data["number-of-multi-qubit-gates"], 0) self.assertEqual(json_data["multi-qubit-gate-depth"], 0) self.assertIsNotNone(json_data.get('transpiled-qasm')) r = self.client.post('/qiskit-service/api/v1.0/execute', json=request) self.assertEqual(r.status_code, 202) print(r.headers.get("Location")) def test_transpile_hadamard_simulator_file(self): # prepare the request file_path = (os.path.dirname(__file__)) + '/data/hadamard.py' with open(file_path, 'rb') as f: impl_data = base64.b64encode(f.read()).decode() request = { 'impl-data': impl_data, 'impl-language': 'Qiskit', 'qpu-name': "ibmq_qasm_simulator", 'input-params': {}, 'token': os.environ["QISKIT_TOKEN"] } # send the request response = self.client.post('/qiskit-service/api/v1.0/transpile', json=request) self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertIn("width", json_data) self.assertIn("depth", json_data) self.assertIsNotNone(json_data['depth']) self.assertIsNotNone(json_data['width']) self.assertIn('transpiled-qasm', json_data) self.assertIn("total-number-of-operations", json_data) self.assertIn("number-of-multi-qubit-gates", json_data) self.assertIn("multi-qubit-gate-depth", json_data) self.assertIsNotNone(json_data["total-number-of-operations"]) self.assertIsNotNone(json_data["number-of-multi-qubit-gates"]) self.assertIsNotNone(json_data["multi-qubit-gate-depth"]) self.assertIsNotNone(json_data.get('transpiled-qasm')) r = self.client.post('/qiskit-service/api/v1.0/execute', json=request) self.assertEqual(r.status_code, 202) print(r.headers.get("Location")) def test_transpile_circuit_sim_file(self): # prepare the request file_path = (os.path.dirname(__file__))+'/data/pattern0-3_1_2nCliffs10seed2.qasm' with open(file_path, 'rb') as f: impl_data = base64.b64encode(f.read()).decode() request = { 'impl-data': impl_data, 'impl-language': 'openqasm', 'qpu-name': "ibmq_qasm_simulator", 'input-params': {}, 'token': os.environ.get("QISKIT_TOKEN", "") } # send the request response = self.client.post('/qiskit-service/api/v1.0/transpile', json=request) self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertIn("width", json_data) self.assertIn("depth", json_data) self.assertIsNotNone(json_data['depth']) self.assertIsNotNone(json_data['width']) self.assertIn('transpiled-qasm', json_data) self.assertIn("total-number-of-operations", json_data) self.assertIn("number-of-multi-qubit-gates", json_data) self.assertIn("multi-qubit-gate-depth", json_data) self.assertIsNotNone(json_data["total-number-of-operations"]) self.assertIsNotNone(json_data["number-of-multi-qubit-gates"]) self.assertIsNotNone(json_data["multi-qubit-gate-depth"]) self.assertIsNotNone(json_data.get('transpiled-qasm')) r = self.client.post('/qiskit-service/api/v1.0/execute', json=request) self.assertEqual(r.status_code, 202) print(r.headers.get("Location")) def test_transpile_shor_sim_url_qasm(self): # prepare the request request = { 'impl-url': 'https://quantum-circuit.com/api/get/circuit/KzG7MxH6hpBpM9pCt?format=qasm', 'impl-language': 'OpenQASM', 'qpu-name': "ibmq_qasm_simulator", 'input-params': {}, 'token': os.environ["QISKIT_TOKEN"] } # send the request response = self.client.post('/qiskit-service/api/v1.0/transpile', json=request) self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertIn("width", json_data) self.assertIn("depth", json_data) self.assertIsNotNone(json_data['depth']) self.assertIsNotNone(json_data['width']) self.assertIn('transpiled-qasm', json_data) self.assertIn("total-number-of-operations", json_data) self.assertIn("number-of-multi-qubit-gates", json_data) self.assertIn("multi-qubit-gate-depth", json_data) self.assertIsNotNone(json_data["total-number-of-operations"]) self.assertIsNotNone(json_data["number-of-multi-qubit-gates"]) self.assertIsNotNone(json_data["multi-qubit-gate-depth"]) self.assertIsNotNone(json_data.get('transpiled-qasm')) r = self.client.post('/qiskit-service/api/v1.0/execute', json=request) self.assertEqual(r.status_code, 202) print(r.headers.get("Location")) """ def test_transpile_file_qasm_aws(self): circuit = random_circuit(5, 3, seed=42) circuit = circuit.qasm() impl_data = base64.b64encode(circuit.encode()).decode() # prepare the request request = { 'impl-data': impl_data, 'impl-language': 'OpenQASM', 'provider': 'aws', 'qpu-name': "Aria 2", 'input-params': {}, 'aws_access_key_id': os.environ.get("QISKIT_AWS_TOKEN", ""), 'aws_secret_access_key': os.environ.get("QISKIT_AWS_SECRET", "") } # send the request response = self.client.post('/qiskit-service/api/v1.0/transpile', json=request) self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertIn("width", json_data) self.assertIn("depth", json_data) self.assertIsNotNone(json_data['depth']) self.assertIsNotNone(json_data['width']) self.assertIn('transpiled-qasm', json_data) self.assertIn("total-number-of-operations", json_data) self.assertIn("number-of-multi-qubit-gates", json_data) self.assertIn("multi-qubit-gate-depth", json_data) self.assertIsNotNone(json_data["total-number-of-operations"]) self.assertIsNotNone(json_data["number-of-multi-qubit-gates"]) self.assertIsNotNone(json_data["multi-qubit-gate-depth"]) self.assertIsNotNone(json_data.get('transpiled-qasm')) """ def test_transpile_circuit_sim_file_qasm(self): # prepare the request file_path = (os.path.dirname(__file__))+'/data/pattern0-3_1_2nCliffs10seed2.qasm' with open(file_path, 'rb') as f: impl_data = base64.b64encode(f.read()).decode() request = { 'impl-data': impl_data, 'impl-language': 'OpenQASM', 'qpu-name': "ibmq_qasm_simulator", 'input-params': {}, 'token': os.environ["QISKIT_TOKEN"] } # send the request response = self.client.post('/qiskit-service/api/v1.0/transpile', json=request) self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertIn("width", json_data) self.assertIn("depth", json_data) self.assertIsNotNone(json_data['depth']) self.assertIsNotNone(json_data['width']) self.assertIn('transpiled-qasm', json_data) self.assertIn("total-number-of-operations", json_data) self.assertIn("number-of-multi-qubit-gates", json_data) self.assertIn("multi-qubit-gate-depth", json_data) self.assertIsNotNone(json_data["total-number-of-operations"]) self.assertIsNotNone(json_data["number-of-multi-qubit-gates"]) self.assertIsNotNone(json_data["multi-qubit-gate-depth"]) self.assertIsNotNone(json_data.get('transpiled-qasm')) r = self.client.post('/qiskit-service/api/v1.0/execute', json=request) self.assertEqual(r.status_code, 202) print(r.headers.get("Location")) # def test_transpile_shor_simulator(self): # # this test is deprecated, as Shor is no longer natively supported by newer versions of Qiskit # # prepare the request # request = { # 'impl-url': "https://raw.githubusercontent.com/PlanQK/qiskit-service/master/test/data/shor_general_qiskit.py", # 'qpu-name': "ibmq_qasm_simulator", # 'input-params': { # 'N': { # 'rawValue': "9", # 'type': 'Integer' # } # }, # 'token': os.environ["QISKIT_TOKEN"] # } # # # send the request # response = self.client.post('/qiskit-service/api/v1.0/transpile', # json=request) # # self.assertEqual(response.status_code, 200) # json_data = response.get_json() # self.assertIn("width", json_data) # self.assertIn("depth", json_data) # self.assertIsNotNone(json_data['depth']) # self.assertIsNotNone(json_data['width']) # self.assertIn('transpiled-qasm', json_data) # self.assertIn("total-number-of-operations", json_data) # self.assertIn("number-of-multi-qubit-gates", json_data) # self.assertIn("multi-qubit-gate-depth", json_data) # self.assertIsNotNone(json_data["total-number-of-operations"]) # self.assertIsNotNone(json_data["number-of-multi-qubit-gates"]) # self.assertIsNotNone(json_data["multi-qubit-gate-depth"]) # self.assertIsNotNone(json_data.get('transpiled-qasm')) # # r = self.client.post('/qiskit-service/api/v1.0/execute', json=request) # self.assertEqual(r.status_code, 202) # print(r.headers.get("Location")) # def test_transpile_shor_nairobi(self): # # this test is deprecated, as Shor is no longer natively supported by newer versions of Qiskit # # prepare the request # request = { # 'impl-url': "https://raw.githubusercontent.com/PlanQK/qiskit-service/master/test/data/shor_general_qiskit.py", # 'qpu-name': "ibm_nairobi", # 'input-params': { # 'N': { # 'rawValue': "9", # 'type': 'Integer' # } # }, # 'token': os.environ["QISKIT_TOKEN"] # } # # # send the request # response = self.client.post('/qiskit-service/api/v1.0/transpile', # json=request) # # self.assertEqual(response.status_code, 200) # json_data = response.get_json() # self.assertIn("error", json_data) # self.assertIn("too many qubits", json_data['error']) @unittest.skip("PlanQK access token required") def test_transpile_shor_simulator_planqk_url(self): # prepare the request request = { 'impl-url': "https://platform.planqk.de/qc-catalog/algorithms/e7413acf-c25e-4de8-ab78-75bfc836a839/implementations/1207510f-9007-48b3-93b8-ea51359c0ced/files/1d827208-1976-487e-819b-64df6e990bf3/content", 'impl-language': 'Qiskit', 'qpu-name': "ibmq_qasm_simulator", 'input-params': {}, 'token': os.environ["QISKIT_TOKEN"], "bearer-token": os.environ["BEARER_TOKEN"] } # send the request response = self.client.post('/qiskit-service/api/v1.0/transpile', json=request) self.assertEqual(response.status_code, 200) json_data = response.get_json() self.assertIn("width", json_data) self.assertIn("depth", json_data) self.assertIsNotNone(json_data['depth']) self.assertIsNotNone(json_data['width']) self.assertIn('transpiled-qasm', json_data) self.assertIn("total-number-of-operations", json_data) self.assertIn("number-of-multi-qubit-gates", json_data) self.assertIn("multi-qubit-gate-depth", json_data) self.assertIsNotNone(json_data["total-number-of-operations"]) self.assertIsNotNone(json_data["number-of-multi-qubit-gates"]) self.assertIsNotNone(json_data["multi-qubit-gate-depth"]) self.assertIsNotNone(json_data.get('transpiled-qasm')) r = self.client.post('/qiskit-service/api/v1.0/execute', json=request) self.assertEqual(r.status_code, 202) print(r.headers.get("Location")) def test_batch_execution(self): # Build a thousand circuits. circs = [] for _ in range(1000): circs.append(random_circuit(num_qubits=5, depth=4, measure=True).qasm()) request = { 'impl-qasm': circs, 'impl-language': 'Qiskit', 'qpu-name': "ibmq_qasm_simulator", 'input-params': {}, 'token': os.environ["QISKIT_TOKEN"] } # send the request r = self.client.post('/qiskit-service/api/v1.0/execute', json=request) self.assertEqual(r.status_code, 202) json_data = r.get_json() self.assertIsNotNone("result", json_data) print(r.headers.get("Location")) @unittest.skip("Perth QPU currently not available") def test_noisy_simulator(self): token = os.environ["QISKIT_TOKEN"] request = { 'impl-qasm': "OPENQASM 2.0; include \"qelib1.inc\";qreg q[4];creg c[4];x q[0]; x q[2];barrier q;h q[0];cu1(pi/2) q[1],q[0];h q[1];cu1(pi/4) q[2],q[0];cu1(pi/2) q[2],q[1];h q[2];cu1(pi/8) q[3],q[0];cu1(pi/4) q[3],q[1];cu1(pi/2) q[3],q[2];h q[3];measure q -> c;", 'impl-language': 'Qiskit', 'qpu-name': "aer_qasm_simulator", 'input-params': {}, "noise_model": "ibm_perth", 'token': token } response = self.client.post('/qiskit-service/api/v1.0/execute', json=request) self.assertEqual(response.status_code, 202) print(response.get_json()) @unittest.skip("Perth QPU currently not available") def test_noisy_de_simulator(self): token = os.environ["QISKIT_TOKEN"] request = { 'impl-qasm': "OPENQASM 2.0; include \"qelib1.inc\";qreg q[4];creg c[4];x q[0]; x q[2];barrier q;h q[0];cu1(pi/2) q[1],q[0];h q[1];cu1(pi/4) q[2],q[0];cu1(pi/2) q[2],q[1];h q[2];cu1(pi/8) q[3],q[0];cu1(pi/4) q[3],q[1];cu1(pi/2) q[3],q[2];h q[3];measure q -> c;", 'impl-language': 'Qiskit', 'qpu-name': "aer_qasm_simulator", 'input-params': {}, "noise_model": "ibm_perth", "only-measurement-errors": "True", 'token': token } response = self.client.post('/qiskit-service/api/v1.0/execute', json=request) self.assertEqual(response.status_code, 202) print(response.get_json()) if __name__ == "__main__": unittest.main()
https://github.com/UST-QuAntiL/qiskit-service
UST-QuAntiL
import qiskit def get_circuit(**kwargs): reg = qiskit.QuantumRegister(1, "q") circuit = qiskit.QuantumCircuit(reg) circuit.h(reg) circuit.measure_all() return circuit if __name__ == "__main__": c = get_circuit() print(c)
https://github.com/UST-QuAntiL/qiskit-service
UST-QuAntiL
from qiskit import QuantumRegister, ClassicalRegister from qiskit import QuantumCircuit qc = QuantumCircuit() q = QuantumRegister(5, 'q') c = ClassicalRegister(3, 'c') qc.add_register(q) qc.add_register(c) qc.h(q[0]) qc.h(q[1]) qc.h(q[2]) qc.h(q[1]) qc.cx(q[2], q[3]) qc.cu1(0, q[1], q[0]) qc.cx(q[2], q[4]) qc.h(q[0]) qc.cu1(0, q[1], q[2]) qc.cu1(0, q[0], q[2]) qc.h(q[2]) qc.measure(q[0], c[0]) qc.measure(q[1], c[1]) qc.measure(q[2], c[2])
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
# initialization import matplotlib.pyplot as plt %matplotlib inline import numpy as np # importing Qiskit from qiskit import IBMQ, BasicAer from qiskit.providers.ibmq import least_busy from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister, execute # import basic plot tools from qiskit.tools.visualization import plot_histogram nQubits = 2 # number of physical qubits used to represent s s = 3 # the hidden integer # make sure that a can be represented with nqubits s = s % 2**(nQubits) # Creating registers # qubits for querying the oracle and finding the hidden integer qr = QuantumRegister(nQubits) # bits for recording the measurement on qr cr = ClassicalRegister(nQubits) bvCircuit = QuantumCircuit(qr, cr) barriers = True # Apply Hadamard gates before querying the oracle for i in range(nQubits): bvCircuit.h(qr[i]) # Apply barrier if barriers: bvCircuit.barrier() # Apply the inner-product oracle for i in range(nQubits): if (s & (1 << i)): bvCircuit.z(qr[i]) else: bvCircuit.iden(qr[i]) # Apply barrier if barriers: bvCircuit.barrier() #Apply Hadamard gates after querying the oracle for i in range(nQubits): bvCircuit.h(qr[i]) # Apply barrier if barriers: bvCircuit.barrier() # Measurement bvCircuit.measure(qr, cr) bvCircuit.draw(output='mpl') # use local simulator backend = BasicAer.get_backend('qasm_simulator') shots = 1024 results = execute(bvCircuit, backend=backend, shots=shots).result() answer = results.get_counts() plot_histogram(answer) # Load our saved IBMQ accounts and get the least busy backend device with less than or equal to 5 qubits IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q') provider.backends() backend = least_busy(provider.backends(filters=lambda x: x.configuration().n_qubits <= 5 and not x.configuration().simulator and x.status().operational==True)) print("least busy backend: ", backend) # Run our circuit on the least busy backend. Monitor the execution of the job in the queue from qiskit.tools.monitor import job_monitor shots = 1024 job = execute(bvCircuit, backend=backend, shots=shots) job_monitor(job, interval = 2) # Get the results from the computation results = job.result() answer = results.get_counts() plot_histogram(answer) import qiskit qiskit.__qiskit_version__
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
# initialization import numpy as np # importing Qiskit from qiskit import IBMQ, Aer from qiskit.providers.ibmq import least_busy from qiskit import QuantumCircuit, transpile # import basic plot tools from qiskit.visualization import plot_histogram # set the length of the n-bit input string. n = 3 # set the length of the n-bit input string. n = 3 const_oracle = QuantumCircuit(n+1) output = np.random.randint(2) if output == 1: const_oracle.x(n) const_oracle.draw() balanced_oracle = QuantumCircuit(n+1) b_str = "101" balanced_oracle = QuantumCircuit(n+1) b_str = "101" # Place X-gates for qubit in range(len(b_str)): if b_str[qubit] == '1': balanced_oracle.x(qubit) balanced_oracle.draw() balanced_oracle = QuantumCircuit(n+1) b_str = "101" # Place X-gates for qubit in range(len(b_str)): if b_str[qubit] == '1': balanced_oracle.x(qubit) # Use barrier as divider balanced_oracle.barrier() # Controlled-NOT gates for qubit in range(n): balanced_oracle.cx(qubit, n) balanced_oracle.barrier() balanced_oracle.draw() balanced_oracle = QuantumCircuit(n+1) b_str = "101" # Place X-gates for qubit in range(len(b_str)): if b_str[qubit] == '1': balanced_oracle.x(qubit) # Use barrier as divider balanced_oracle.barrier() # Controlled-NOT gates for qubit in range(n): balanced_oracle.cx(qubit, n) balanced_oracle.barrier() # Place X-gates for qubit in range(len(b_str)): if b_str[qubit] == '1': balanced_oracle.x(qubit) # Show oracle balanced_oracle.draw() dj_circuit = QuantumCircuit(n+1, n) # Apply H-gates for qubit in range(n): dj_circuit.h(qubit) # Put qubit in state |-> dj_circuit.x(n) dj_circuit.h(n) dj_circuit.draw() dj_circuit = QuantumCircuit(n+1, n) # Apply H-gates for qubit in range(n): dj_circuit.h(qubit) # Put qubit in state |-> dj_circuit.x(n) dj_circuit.h(n) # Add oracle dj_circuit = dj_circuit.compose(balanced_oracle) dj_circuit.draw() dj_circuit = QuantumCircuit(n+1, n) # Apply H-gates for qubit in range(n): dj_circuit.h(qubit) # Put qubit in state |-> dj_circuit.x(n) dj_circuit.h(n) # Add oracle dj_circuit = dj_circuit.compose(balanced_oracle) # Repeat H-gates for qubit in range(n): dj_circuit.h(qubit) dj_circuit.barrier() # Measure for i in range(n): dj_circuit.measure(i, i) # Display circuit dj_circuit.draw() # use local simulator aer_sim = Aer.get_backend('aer_simulator') results = aer_sim.run(dj_circuit).result() answer = results.get_counts() plot_histogram(answer) # ...we have a 0% chance of measuring 000. assert answer.get('000', 0) == 0 def dj_oracle(case, n): # We need to make a QuantumCircuit object to return # This circuit has n+1 qubits: the size of the input, # plus one output qubit oracle_qc = QuantumCircuit(n+1) # First, let's deal with the case in which oracle is balanced if case == "balanced": # First generate a random number that tells us which CNOTs to # wrap in X-gates: b = np.random.randint(1,2**n) # Next, format 'b' as a binary string of length 'n', padded with zeros: b_str = format(b, '0'+str(n)+'b') # Next, we place the first X-gates. Each digit in our binary string # corresponds to a qubit, if the digit is 0, we do nothing, if it's 1 # we apply an X-gate to that qubit: for qubit in range(len(b_str)): if b_str[qubit] == '1': oracle_qc.x(qubit) # Do the controlled-NOT gates for each qubit, using the output qubit # as the target: for qubit in range(n): oracle_qc.cx(qubit, n) # Next, place the final X-gates for qubit in range(len(b_str)): if b_str[qubit] == '1': oracle_qc.x(qubit) # Case in which oracle is constant if case == "constant": # First decide what the fixed output of the oracle will be # (either always 0 or always 1) output = np.random.randint(2) if output == 1: oracle_qc.x(n) oracle_gate = oracle_qc.to_gate() oracle_gate.name = "Oracle" # To show when we display the circuit return oracle_gate def dj_algorithm(oracle, n): dj_circuit = QuantumCircuit(n+1, n) # Set up the output qubit: dj_circuit.x(n) dj_circuit.h(n) # And set up the input register: for qubit in range(n): dj_circuit.h(qubit) # Let's append the oracle gate to our circuit: dj_circuit.append(oracle, range(n+1)) # Finally, perform the H-gates again and measure: for qubit in range(n): dj_circuit.h(qubit) for i in range(n): dj_circuit.measure(i, i) return dj_circuit n = 4 oracle_gate = dj_oracle('balanced', n) dj_circuit = dj_algorithm(oracle_gate, n) dj_circuit.draw() transpiled_dj_circuit = transpile(dj_circuit, aer_sim) results = aer_sim.run(transpiled_dj_circuit).result() answer = results.get_counts() plot_histogram(answer) # Load our saved IBMQ accounts and get the least busy backend device with greater than or equal to (n+1) qubits IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q') backend = least_busy(provider.backends(filters=lambda x: x.configuration().n_qubits >= (n+1) and not x.configuration().simulator and x.status().operational==True)) print("least busy backend: ", backend) # Run our circuit on the least busy backend. Monitor the execution of the job in the queue from qiskit.tools.monitor import job_monitor transpiled_dj_circuit = transpile(dj_circuit, backend, optimization_level=3) job = backend.run(transpiled_dj_circuit) job_monitor(job, interval=2) # Get the results of the computation results = job.result() answer = results.get_counts() plot_histogram(answer) # ...the most likely result is 1111. assert max(answer, key=answer.get) == '1111' from qiskit_textbook.problems import dj_problem_oracle oracle = dj_problem_oracle(1) import qiskit.tools.jupyter %qiskit_version_table
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
# initialization import numpy as np # importing Qiskit from qiskit import IBMQ, Aer from qiskit import QuantumCircuit, transpile # import basic plot tools from qiskit.visualization import plot_histogram # set the length of the n-bit input string. n = 3 # Constant Oracle const_oracle = QuantumCircuit(n+1) # Random output output = np.random.randint(2) if output == 1: const_oracle.x(n) const_oracle.draw() # Balanced Oracle balanced_oracle = QuantumCircuit(n+1) # Binary string length b_str = "101" # For each qubit in our circuit # we place an X-gate if the corresponding digit in b_str is 1 # or do nothing if the digit is 0 balanced_oracle = QuantumCircuit(n+1) b_str = "101" # Place X-gates for qubit in range(len(b_str)): if b_str[qubit] == '1': balanced_oracle.x(qubit) balanced_oracle.draw() # Creating the controlled-NOT gates # using each input qubit as a control # and the output as a target balanced_oracle = QuantumCircuit(n+1) b_str = "101" # Place X-gates for qubit in range(len(b_str)): if b_str[qubit] == '1': balanced_oracle.x(qubit) # Use barrier as divider balanced_oracle.barrier() # Controlled-NOT gates for qubit in range(n): balanced_oracle.cx(qubit, n) balanced_oracle.barrier() # Wrapping the controls in X-gates # Place X-gates for qubit in range(len(b_str)): if b_str[qubit] == '1': balanced_oracle.x(qubit) # Show oracle balanced_oracle.draw() dj_circuit = QuantumCircuit(n+1, n) # Apply H-gates for qubit in range(n): dj_circuit.h(qubit) # Put qubit in state |-> dj_circuit.x(n) dj_circuit.h(n) # Add oracle dj_circuit = dj_circuit.compose(balanced_oracle) # Repeat H-gates for qubit in range(n): dj_circuit.h(qubit) dj_circuit.barrier() # Measure for i in range(n): dj_circuit.measure(i, i) # Display circuit dj_circuit.draw() # Viewing the output # use local simulator aer_sim = Aer.get_backend('aer_simulator') results = aer_sim.run(dj_circuit).result() answer = results.get_counts() plot_histogram(answer)
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
import numpy as np # Importing standard Qiskit libraries from qiskit import QuantumCircuit, transpile, Aer, IBMQ from qiskit.tools.jupyter import * from qiskit.visualization import * from ibm_quantum_widgets import * from qiskit.providers.aer import QasmSimulator # Loading your IBM Quantum account(s) provider = IBMQ.load_account() from qiskit.circuit.library.standard_gates import XGate, HGate from operator import * n = 3 N = 8 #2**n index_colour_table = {} colour_hash_map = {} index_colour_table = {'000':"yellow", '001':"red", '010':"blue", '011':"red", '100':"green", '101':"blue", '110':"orange", '111':"red"} colour_hash_map = {"yellow":'100', "red":'011', "blue":'000', "green":'001', "orange":'010'} def database_oracle(index_colour_table, colour_hash_map): circ_database = QuantumCircuit(n + n) for i in range(N): circ_data = QuantumCircuit(n) idx = bin(i)[2:].zfill(n) # removing the "0b" prefix appended by the bin() funtion colour = index_colour_table[idx] colour_hash = colour_hash_map[colour][::-1] for j in range(n): if colour_hash[j] == '1': circ_data.x(j) # qiskit maps the rightmost bit as the 0th qubit -> qn, ..., q0 # we therefore reverse the index string -> q0, ..., qn data_gate = circ_data.to_gate(label=colour).control(num_ctrl_qubits=n, ctrl_state=idx, label="index-"+colour) circ_database.append(data_gate, list(range(n+n))) return circ_database # drawing the database oracle circuit print("Database Encoding") database_oracle(index_colour_table, colour_hash_map).draw() circ_data = QuantumCircuit(n) m = 4 idx = bin(m)[2:].zfill(n) # removing the "0b" prefix appended by the bin() funtion colour = index_colour_table[idx] colour_hash = colour_hash_map[colour][::-1] for j in range(n): if colour_hash[j] == '1': circ_data.x(j) print("Internal colour encoding for the colour green (as an example)"); circ_data.draw() def oracle_grover(database, data_entry): circ_grover = QuantumCircuit(n + n + 1) circ_grover.append(database, list(range(n+n))) target_reflection_gate = XGate().control(num_ctrl_qubits=n, ctrl_state=colour_hash_map[data_entry], label="Reflection of " + "\"" + data_entry + "\" Target") # control() missing 1 required positional argument: 'self' .... if only 'XGate' used instead of 'XGate()' # The “missing 1 required positional argument: 'self'” error is raised when you do not instantiate an object of a class before calling a class method. This error is also raised when you incorrectly instantiate a class. circ_grover.append(target_reflection_gate, list(range(n, n+n+1))) circ_grover.append(database, list(range(n+n))) return circ_grover print("Grover Oracle (target example: orange)") oracle_grover(database_oracle(index_colour_table, colour_hash_map).to_gate(label="Database Encoding"), "orange").decompose().draw() def mcz_gate(num_qubits): num_controls = num_qubits - 1 mcz_gate = QuantumCircuit(num_qubits) target_mcz = QuantumCircuit(1) target_mcz.z(0) target_mcz = target_mcz.to_gate(label="Z_Gate").control(num_ctrl_qubits=num_controls, ctrl_state=None, label="MCZ") mcz_gate.append(target_mcz, list(range(num_qubits))) return mcz_gate.reverse_bits() print("Multi-controlled Z (MCZ) Gate") mcz_gate(n).decompose().draw() def diffusion_operator(num_qubits): circ_diffusion = QuantumCircuit(num_qubits) qubits_list = list(range(num_qubits)) # Layer of H^n gates circ_diffusion.h(qubits_list) # Layer of X^n gates circ_diffusion.x(qubits_list) # Layer of Multi-controlled Z (MCZ) Gate circ_diffusion = circ_diffusion.compose(mcz_gate(num_qubits), qubits_list) # Layer of X^n gates circ_diffusion.x(qubits_list) # Layer of H^n gates circ_diffusion.h(qubits_list) return circ_diffusion print("Diffusion Circuit") diffusion_operator(n).draw() # Putting it all together ... !!! item = "green" print("Searching for the index of the colour", item) circuit = QuantumCircuit(n + n + 1, n) circuit.x(n + n) circuit.barrier() circuit.h(list(range(n))) circuit.h(n+n) circuit.barrier() unitary_oracle = oracle_grover(database_oracle(index_colour_table, colour_hash_map).to_gate(label="Database Encoding"), item).to_gate(label="Oracle Operator") unitary_diffuser = diffusion_operator(n).to_gate(label="Diffusion Operator") M = countOf(index_colour_table.values(), item) Q = int(np.pi * np.sqrt(N/M) / 4) for i in range(Q): circuit.append(unitary_oracle, list(range(n + n + 1))) circuit.append(unitary_diffuser, list(range(n))) circuit.barrier() circuit.measure(list(range(n)), list(range(n))) circuit.draw() backend_sim = Aer.get_backend('qasm_simulator') job_sim = backend_sim.run(transpile(circuit, backend_sim), shots=1024) result_sim = job_sim.result() counts = result_sim.get_counts(circuit) if M==1: print("Index of the colour", item, "is the index with most probable outcome") else: print("Indices of the colour", item, "are the indices the most probable outcomes") from qiskit.visualization import plot_histogram plot_histogram(counts)
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
from math import gcd, log from random import randint def is_prime(N): """Returns if N is prime or not. Notice that this is not optimal, there is faster primality testing algorithms e.g. Miller-Rabin """ if N == 2: return True # only even prime if N % 2 == 0 or N <= 1: return False # even numbers and 1 are not prime for i in range(3, N, 2): # only try odd candidates if i*i > N: break # we only need to check up to sqrt(N) if N % i == 0: return False # found a factor return True def find_power_k(N): """Returns the smallest k > 1 such that N**(1/k) is an integer, or 1 if there is no such k. """ upper_bound = int(log(N)/log(3)) for k in range(2, upper_bound + 1): p = int(N**(1/k)) if p**k == N: return k return 1 def order_finding(a, N): """Returns the smallest r such that a^r = 1 mod N Notice that this is a naive classic implementation and is exponentially slower than the quantum version invented by Peter Shor. """ i = 1 a_i = a % N while a_i != 1: i += 1 a_i = (a_i * a) % N return i order_finding(2, 15) def shor_algorithm(N): """Returns a pair of integers (P, Q) such that PQ = N for integer N""" if N % 2 == 0: # even case return (N//2, 2) if is_prime(N): # prime case return (N, 1) # N is primes, factors cannot be found if find_power_k(N) > 1: # prime power case P = int(N**(1/find_power_k(N))) # we find a k such that N**(1/k) is an integer Q = N//P return (P, Q) # Now we can assume that the criteria for Shor's algorithm is met while True: # Non-deterministic, we will try multiple values for a a = randint(2, N-1) # pick random a if gcd(a, N) != 1: # Lucky case: a and N are not coprime! P = gcd(a, N) # gcd yields a non-trivial factor Q = N//P return (P, Q) r = order_finding(a, N) # quantum subroutine of the code if r % 2 == 0: continue P = gcd(a**(r//2) - 1, N) if P != 1: Q = N//P # gcd yielded non trivial factor return (P, Q) N = 10013 P, Q = shor_algorithm(N) print( "Shor's algorithm found {} = {} x {} which is {}!".format(N, P, Q, ["incorrect", "correct"][P*Q==N]) ) S, T = shor_algorithm(Q) print( "Shor's algorithm found {} = {} x {} which is {} again!".format(Q, S, T, ["incorrect", "correct"][S*T==Q]) )
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
from qiskit import * from qiskit.visualization import plot_histogram simulator = Aer.get_backend("qasm_simulator") circuit = QuantumCircuit(1, 1) circuit.measure(0, 0) circuit.draw(output="mpl") job = execute(circuit, backend=simulator, shots=2**15) result = job.result() counts = result.get_counts() print(counts) plot_histogram(counts) circuit = QuantumCircuit(1, 1) circuit.x(0) circuit.measure(0, 0) circuit.draw(output="mpl") counts = execute(circuit, backend=simulator, shots=2**15).result().get_counts() plot_histogram(counts) circuit = QuantumCircuit(1, 1) circuit.h(0) circuit.measure(0, 0) circuit.draw(output="mpl") counts = execute(circuit, backend=simulator, shots=2**15).result().get_counts() plot_histogram(counts) # Circuit to generate -|0> circuit = QuantumCircuit(1, 1) circuit.x(0) circuit.z(0) circuit.x(0) circuit.measure(0, 0) circuit.draw(output="mpl") counts = execute(circuit, backend=simulator, shots=2**15).result().get_counts() plot_histogram(counts) # Circuit to generate i|0> circuit = QuantumCircuit(1, 1) circuit.x(0) circuit.y(0) circuit.measure(0, 0) circuit.draw(output="mpl") counts = execute(circuit, backend=simulator, shots=2**15).result().get_counts() plot_histogram(counts)
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
%matplotlib inline from qiskit import * from qiskit.visualization import plot_histogram circuit = QuantumCircuit(2) circuit.x(0) circuit.z(1) circuit.draw(output="mpl") unitary_simulator = Aer.get_backend("unitary_simulator") unitary = execute(circuit, backend=unitary_simulator).result().get_unitary() print(unitary) circuit = QuantumCircuit(2) circuit.h(0) circuit.x(1) circuit.cx(0, 1) circuit.draw(output="mpl") state_simulator = Aer.get_backend("statevector_simulator") state_vector = execute(circuit, backend=state_simulator).result().get_statevector() print(state_vector) circuit = QuantumCircuit(2) circuit.h(0) circuit.h(1) circuit.cz(0, 1) circuit.draw(output="mpl") state_vector = execute(circuit, backend=state_simulator).result().get_statevector() print(state_vector) circuit = QuantumCircuit(3, 3) circuit.h([0, 1]) circuit.ccx(0, 1, 2) circuit.measure([0, 1, 2], [0, 1, 2]) circuit.draw(output="mpl") simulator = Aer.get_backend("qasm_simulator") counts = execute(circuit, backend=simulator, shots=2**16).result().get_counts() plot_histogram(counts) circuit = QuantumCircuit(3, 3) circuit.x(0) circuit.cx(0, 1) circuit.ccx(0, 1, 2) circuit.ccx(0, 1, 2) circuit.cx(0, 1) circuit.x(0) circuit.measure([0, 1, 2], [0, 1, 2]) circuit.draw(output="mpl") counts = execute(circuit, backend=simulator, shots=2**16).result().get_counts() plot_histogram(counts)
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
%matplotlib inline from qiskit import * # The following code is for nicer display of the matrices from IPython.display import display, Markdown def format_float(x): if x % 1 == 0: return int(x) else: return x def format_imaginary(z): if abs(z.imag) < 1e-15: return "{}".format(format_float(z.real)) elif abs(z.real) < 1e-15: if z.imag == 1: return "i" elif z.imag == -1: return "-i" return "{}i".format(format_float(z.imag)) if z.imag > 0: return "{} + {}i".format(z.real, abs(z.imag)) else: return "{} - {}i".format(z.real, abs(z.imag)) def display_matrix(gate, gate_name="U"): a00 = format_imaginary(gate[0][0]) a01 = format_imaginary(gate[0][1]) a10 = format_imaginary(gate[1][0]) a11 = format_imaginary(gate[1][1]) ans = r"${} = \begin{{bmatrix}} {} & {} \\ {} & {}\end{{bmatrix}}$".format(gate_name,a00, a01, a10, a11) return Markdown(ans) simulator = Aer.get_backend("unitary_simulator") circuit = QuantumCircuit(1) circuit.draw(output="mpl") job = execute(circuit, backend=simulator) result = job.result() unitary = result.get_unitary() print(unitary) circuit = QuantumCircuit(1) circuit.x(0) circuit.draw(output="mpl") unitary = execute(circuit, backend=simulator).result().get_unitary() display( display_matrix(unitary, "X") ) circuit = QuantumCircuit(1) circuit.x(0) circuit.h(0) circuit.draw(output="mpl") unitary = execute(circuit, backend=simulator).result().get_unitary() display( display_matrix(unitary) ) circuit = QuantumCircuit(1) circuit.h(0) circuit.z(0) circuit.draw(output="mpl") unitary = execute(circuit, backend=simulator).result().get_unitary() display( display_matrix(unitary) ) circuit = QuantumCircuit(1) circuit.z(0) circuit.h(0) circuit.draw(output="mpl") unitary = execute(circuit, backend=simulator).result().get_unitary() display( display_matrix(unitary) ) circuit = QuantumCircuit(1) circuit.y(0) circuit.draw(output="mpl") unitary = execute(circuit, backend=simulator).result().get_unitary() display( display_matrix(unitary, "Y") ) circuit = QuantumCircuit(1) circuit.y(0) circuit.y(0) circuit.draw(output="mpl") unitary = execute(circuit, backend=simulator).result().get_unitary() display( display_matrix(unitary, "U") ) circuit = QuantumCircuit(1) circuit.s(0) circuit.s(0) circuit.draw(output="mpl") unitary = execute(circuit, backend=simulator).result().get_unitary() display( display_matrix(unitary, "U") ) circuit = QuantumCircuit(1) circuit.s(0) circuit.sdg(0) # sdg = s dagger circuit.draw(output="mpl") unitary = execute(circuit, backend=simulator).result().get_unitary() display( display_matrix(unitary, "U") ) circuit = QuantumCircuit(1) circuit.s(0) #circuit.sdg(0) circuit.s(0) circuit.s(0) circuit.s(0) circuit.draw(output="mpl") unitary = execute(circuit, backend=simulator).result().get_unitary() display( display_matrix(unitary, "U") )
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
from qiskit import QuantumCircuit from qiskit.quantum_info import Statevector # Create a Quantum Circuit acting on the q register circuit = QuantumCircuit(1) # print the statevector print(f"Initial Statevector: {Statevector.from_instruction(circuit).data}\n\n") # Add an X gate followed by a H gate to put the qubit in |-> state circuit.x(0) circuit.h(0) print("After putting the qubit in |-> state\n\n") # print the statevector print("Final Statevector: ", Statevector.from_instruction(circuit).data) import numpy as np from qiskit import QuantumCircuit, QuantumRegister from qiskit.quantum_info import Statevector # Create a Quantum Register with 3 qubits q = QuantumRegister(3) # Create a Quantum Circuit acting on the q register to demonstrate the GHZ state circuit = QuantumCircuit(q) # Add a H gate on qubit 0, putting this qubit in superposition. circuit.h(q[0]) # Add a CX (CNOT) gate on control qubit 0 and target qubit 1 circuit.cx(q[0], q[1]) # Add a CX (CNOT) gate on control qubit 0 and target qubit 2 circuit.cx(q[0], q[2]) from qiskit.quantum_info import Statevector # Set the intial state of the simulator to the ground state using from_int state = Statevector.from_int(0, 2**3) # Evolve the state by the quantum circuit state = state.evolve(circuit) #draw using latex state.draw('latex') from qiskit.visualization import array_to_latex #Alternative way of representing in latex array_to_latex(state) state.draw('qsphere')
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
%matplotlib inline from qiskit import * circuit = QuantumCircuit(5, 2) # Steps to change qubits to 1 for test purposes _ = circuit.x(0) _ = circuit.x(1) _ = circuit.x(2) _ = circuit.barrier() _ = circuit.ccx(0, 1, 3) circuit.draw(output="mpl") _ = circuit.ccx(2, 3, 4) circuit.draw(output="mpl") _ = circuit.ccx(0, 1, 3) circuit.draw(output="mpl") # Measure (x^y^z) and working qubuit in classical bit _ = circuit.barrier() _ = circuit.measure(4, 0) _ = circuit.measure(3, 1) circuit.draw(output="mpl") # Simulate simulator = Aer.get_backend("qasm_simulator") job = execute(circuit, backend=simulator, shots=1024) result = job.result() counts = result.get_counts() # Plot results visualization.plot_histogram(counts)
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
# Superdense Coding %matplotlib inline from qiskit import * # Step 0: Prepare the Bell State bell_circuit = QuantumCircuit(2, 2) bell_circuit.h(0) bell_circuit.cx(0, 1) bell_circuit.barrier() bell_circuit.draw(output="mpl") # Step 1: Prepare Alice circuits depending on b0b1 # Case 00: the circuit has no gates alice_00 = QuantumCircuit(2, 2) alice_00.barrier() alice_00.draw(output="mpl") # Case 01: the circuit has the X gate alice_01 = QuantumCircuit(2, 2) alice_01.x(0) alice_01.barrier() alice_01.draw(output="mpl") # Case 10: the circuit has the Z gate alice_10 = QuantumCircuit(2, 2) alice_10.z(0) alice_10.barrier() alice_10.draw(output="mpl") # Case 11: the circuit has the X gate and then Z gate alice_11 = QuantumCircuit(2, 2) alice_11.x(0) alice_11.z(0) alice_11.barrier() alice_11.draw(output="mpl") # Step 2: Apply the inverted entanglement circuit, and then measure invert_circuit = QuantumCircuit(2, 2) invert_circuit.cx(0, 1) invert_circuit.h(0) invert_circuit.barrier() invert_circuit.measure([0, 1], [1, 0]) # Qiskit measures are always reversed, b1b0 not b0b1 invert_circuit.draw(output="mpl") # When merged, the whole circuit looks like (bell_circuit + alice_11 + invert_circuit).draw(output="mpl") # Now we simulate each outcome, to do so we create an auxiliary function that runs it def simulate_circuit(prep, encoding, decoding): """Returns the counts of the circuit that is combination of the three circuits""" circuit = prep + encoding + decoding simulator = Aer.get_backend("qasm_simulator") job = execute(circuit, simulator, shots = 2**16) result = job.result() count = result.get_counts() return count # For 00 count_00 = simulate_circuit(bell_circuit, alice_00, invert_circuit) visualization.plot_histogram(count_00) # For 01 count_01 = simulate_circuit(bell_circuit, alice_01, invert_circuit) visualization.plot_histogram(count_01) # For 10 count_10 = simulate_circuit(bell_circuit, alice_10, invert_circuit) visualization.plot_histogram(count_10) # For 11 count_11 = simulate_circuit(bell_circuit, alice_11, invert_circuit) visualization.plot_histogram(count_11) # The results match our predictions! # For purposes of reproducibility, the Qiskit version is qiskit.__qiskit_version__
https://github.com/IvanIsCoding/Quantum
IvanIsCoding
# Do the necessary imports import numpy as np from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit import IBMQ, Aer, transpile, assemble from qiskit.visualization import plot_histogram, plot_bloch_multivector, array_to_latex from qiskit.extensions import Initialize from qiskit.ignis.verification import marginal_counts from qiskit.quantum_info import random_statevector # Loading your IBM Quantum account(s) provider = IBMQ.load_account() ## SETUP # Protocol uses 3 qubits and 2 classical bits in 2 different registers qr = QuantumRegister(3, name="q") # Protocol uses 3 qubits crz = ClassicalRegister(1, name="crz") # and 2 classical bits crx = ClassicalRegister(1, name="crx") # in 2 different registers teleportation_circuit = QuantumCircuit(qr, crz, crx) def create_bell_pair(qc, a, b): qc.h(a) qc.cx(a,b) qr = QuantumRegister(3, name="q") crz, crx = ClassicalRegister(1, name="crz"), ClassicalRegister(1, name="crx") teleportation_circuit = QuantumCircuit(qr, crz, crx) create_bell_pair(teleportation_circuit, 1, 2) teleportation_circuit.draw() def alice_gates(qc, psi, a): qc.cx(psi, a) qc.h(psi) qr = QuantumRegister(3, name="q") crz, crx = ClassicalRegister(1, name="crz"), ClassicalRegister(1, name="crx") teleportation_circuit = QuantumCircuit(qr, crz, crx) ## STEP 1 create_bell_pair(teleportation_circuit, 1, 2) ## STEP 2 teleportation_circuit.barrier() # Use barrier to separate steps alice_gates(teleportation_circuit, 0, 1) teleportation_circuit.draw() def measure_and_send(qc, a, b): """Measures qubits a & b and 'sends' the results to Bob""" qc.barrier() qc.measure(a,0) qc.measure(b,1) qr = QuantumRegister(3, name="q") crz, crx = ClassicalRegister(1, name="crz"), ClassicalRegister(1, name="crx") teleportation_circuit = QuantumCircuit(qr, crz, crx) create_bell_pair(teleportation_circuit, 1, 2) teleportation_circuit.barrier() # Use barrier to separate steps alice_gates(teleportation_circuit, 0, 1) measure_and_send(teleportation_circuit, 0 ,1) teleportation_circuit.draw() def bob_gates(qc, qubit, crz, crx): qc.x(qubit).c_if(crx, 1) # Apply gates if the registers qc.z(qubit).c_if(crz, 1) # are in the state '1' qr = QuantumRegister(3, name="q") crz, crx = ClassicalRegister(1, name="crz"), ClassicalRegister(1, name="crx") teleportation_circuit = QuantumCircuit(qr, crz, crx) ## STEP 1 create_bell_pair(teleportation_circuit, 1, 2) ## STEP 2 teleportation_circuit.barrier() # Use barrier to separate steps alice_gates(teleportation_circuit, 0, 1) ## STEP 3 measure_and_send(teleportation_circuit, 0, 1) ## STEP 4 teleportation_circuit.barrier() # Use barrier to separate steps bob_gates(teleportation_circuit, 2, crz, crx) teleportation_circuit.draw() # Create random 1-qubit state psi = random_statevector(2) # Display it nicely display(array_to_latex(psi, prefix="|\\psi\\rangle =")) # Show it on a Bloch sphere plot_bloch_multivector(psi) init_gate = Initialize(psi) init_gate.label = "init" ## SETUP qr = QuantumRegister(3, name="q") # Protocol uses 3 qubits crz = ClassicalRegister(1, name="crz") # and 2 classical registers crx = ClassicalRegister(1, name="crx") qc = QuantumCircuit(qr, crz, crx) ## STEP 0 # First, let's initialize Alice's q0 qc.append(init_gate, [0]) qc.barrier() ## STEP 1 # Now begins the teleportation protocol create_bell_pair(qc, 1, 2) qc.barrier() ## STEP 2 # Send q1 to Alice and q2 to Bob alice_gates(qc, 0, 1) ## STEP 3 # Alice then sends her classical bits to Bob measure_and_send(qc, 0, 1) ## STEP 4 # Bob decodes qubits bob_gates(qc, 2, crz, crx) # Display the circuit qc.draw() sim = Aer.get_backend('aer_simulator') qc.save_statevector() out_vector = sim.run(qc).result().get_statevector() plot_bloch_multivector(out_vector)
https://github.com/rohitgit1/Quantum-Computing-Summer-School
rohitgit1
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/rohitgit1/Quantum-Computing-Summer-School
rohitgit1
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/rohitgit1/Quantum-Computing-Summer-School
rohitgit1
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/rohitgit1/Quantum-Computing-Summer-School
rohitgit1
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/rohitgit1/Quantum-Computing-Summer-School
rohitgit1
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/rohitgit1/Quantum-Computing-Summer-School
rohitgit1
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/rohitgit1/Quantum-Computing-Summer-School
rohitgit1
from qiskit.quantum_info import Statevector from qiskit.visualization import plot_bloch_multivector excited = Statevector.from_int(1, 2) plot_bloch_multivector(excited.data) from qiskit.tools.jupyter import * from qiskit import IBMQ IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q', group='open', project='main') backend = provider.get_backend('ibmq_armonk') backend_config = backend.configuration() assert backend_config.open_pulse, "Backend doesn't support Pulse" dt = backend_config.dt print(f"Sampling time: {dt*1e9} ns") backend_defaults = backend.defaults() import numpy as np # unit conversion factors -> all backend properties returned in SI (Hz, sec, etc) GHz = 1.0e9 # Gigahertz MHz = 1.0e6 # Megahertz us = 1.0e-6 # Microseconds ns = 1.0e-9 # Nanoseconds # We will find the qubit frequency for the following qubit. qubit = 0 # The Rabi sweep will be at the given qubit frequency. center_frequency_Hz = backend_defaults.qubit_freq_est[qubit] # The default frequency is given in Hz # warning: this will change in a future release print(f"Qubit {qubit} has an estimated frequency of {center_frequency_Hz / GHz} GHz.") from qiskit import pulse, assemble # This is where we access all of our Pulse features! from qiskit.pulse import Play from qiskit.pulse import pulse_lib # This Pulse module helps us build sampled pulses for common pulse shapes ### Collect the necessary channels drive_chan = pulse.DriveChannel(qubit) meas_chan = pulse.MeasureChannel(qubit) acq_chan = pulse.AcquireChannel(qubit) inst_sched_map = backend_defaults.instruction_schedule_map measure = inst_sched_map.get('measure', qubits=[0]) # Rabi experiment parameters # Drive amplitude values to iterate over: 50 amplitudes evenly spaced from 0 to 0.75 num_rabi_points = 50 drive_amp_min = 0 drive_amp_max = 0.75 drive_amps = np.linspace(drive_amp_min, drive_amp_max, num_rabi_points) # drive waveforms mush be in units of 16 drive_sigma = 80 # in dt drive_samples = 8*drive_sigma # in dt # Build the Rabi experiments: # A drive pulse at the qubit frequency, followed by a measurement, # where we vary the drive amplitude each time. rabi_schedules = [] for drive_amp in drive_amps: rabi_pulse = pulse_lib.gaussian(duration=drive_samples, amp=drive_amp, sigma=drive_sigma, name=f"Rabi drive amplitude = {drive_amp}") this_schedule = pulse.Schedule(name=f"Rabi drive amplitude = {drive_amp}") this_schedule += Play(rabi_pulse, drive_chan) # The left shift `<<` is special syntax meaning to shift the start time of the schedule by some duration this_schedule += measure << this_schedule.duration rabi_schedules.append(this_schedule) rabi_schedules[-1].draw(label=True, scaling=1.0) # assemble the schedules into a Qobj num_shots_per_point = 1024 rabi_experiment_program = assemble(rabi_schedules, backend=backend, meas_level=1, meas_return='avg', shots=num_shots_per_point, schedule_los=[{drive_chan: center_frequency_Hz}] * num_rabi_points) # RUN the job on a real device #job = backend.run(rabi_experiment_program) #print(job.job_id()) #from qiskit.tools.monitor import job_monitor #job_monitor(job) # OR retreive result from previous run job = backend.retrieve_job("5ef3bf17dc3044001186c011") rabi_results = job.result() import matplotlib.pyplot as plt plt.style.use('dark_background') scale_factor = 1e-14 # center data around 0 def baseline_remove(values): return np.array(values) - np.mean(values) rabi_values = [] for i in range(num_rabi_points): # Get the results for `qubit` from the ith experiment rabi_values.append(rabi_results.get_memory(i)[qubit]*scale_factor) rabi_values = np.real(baseline_remove(rabi_values)) plt.xlabel("Drive amp [a.u.]") plt.ylabel("Measured signal [a.u.]") plt.scatter(drive_amps, rabi_values, color='white') # plot real part of Rabi values plt.show() from scipy.optimize import curve_fit def fit_function(x_values, y_values, function, init_params): fitparams, conv = curve_fit(function, x_values, y_values, init_params) y_fit = function(x_values, *fitparams) return fitparams, y_fit fit_params, y_fit = fit_function(drive_amps, rabi_values, lambda x, A, B, drive_period, phi: (A*np.cos(2*np.pi*x/drive_period - phi) + B), [10, 0.1, 0.6, 0]) plt.scatter(drive_amps, rabi_values, color='white') plt.plot(drive_amps, y_fit, color='red') drive_period = fit_params[2] # get period of rabi oscillation plt.axvline(drive_period/2, color='red', linestyle='--') plt.axvline(drive_period, color='red', linestyle='--') plt.annotate("", xy=(drive_period, 0), xytext=(drive_period/2,0), arrowprops=dict(arrowstyle="<->", color='red')) plt.xlabel("Drive amp [a.u.]", fontsize=15) plt.ylabel("Measured signal [a.u.]", fontsize=15) plt.show() pi_amp = abs(drive_period / 2) print(f"Pi Amplitude = {pi_amp}") # Drive parameters # The drive amplitude for pi/2 is simply half the amplitude of the pi pulse drive_amp = pi_amp / 2 # x_90 is a concise way to say pi_over_2; i.e., an X rotation of 90 degrees x90_pulse = pulse_lib.gaussian(duration=drive_samples, amp=drive_amp, sigma=drive_sigma, name='x90_pulse') # Ramsey experiment parameters time_max_us = 1.8 time_step_us = 0.025 times_us = np.arange(0.1, time_max_us, time_step_us) # Convert to units of dt delay_times_dt = times_us * us / dt # create schedules for Ramsey experiment ramsey_schedules = [] for delay in delay_times_dt: this_schedule = pulse.Schedule(name=f"Ramsey delay = {delay * dt / us} us") this_schedule += Play(x90_pulse, drive_chan) this_schedule += Play(x90_pulse, drive_chan) << this_schedule.duration + int(delay) this_schedule += measure << this_schedule.duration ramsey_schedules.append(this_schedule) ramsey_schedules[-1].draw(label=True, scaling=1.0) # Execution settings num_shots = 256 detuning_MHz = 2 ramsey_frequency = round(center_frequency_Hz + detuning_MHz * MHz, 6) # need ramsey freq in Hz ramsey_program = assemble(ramsey_schedules, backend=backend, meas_level=1, meas_return='avg', shots=num_shots, schedule_los=[{drive_chan: ramsey_frequency}]*len(ramsey_schedules) ) # RUN the job on a real device #job = backend.run(ramsey_experiment_program) #print(job.job_id()) #from qiskit.tools.monitor import job_monitor #job_monitor(job) # OR retreive job from previous run job = backend.retrieve_job('5ef3ed3a84b1b70012374317') ramsey_results = job.result() ramsey_values = [] for i in range(len(times_us)): ramsey_values.append(ramsey_results.get_memory(i)[qubit]*scale_factor) fit_params, y_fit = fit_function(times_us, np.real(ramsey_values), lambda x, A, del_f_MHz, C, B: ( A * np.cos(2*np.pi*del_f_MHz*x - C) + B ), [5, 1./0.4, 0, 0.25] ) # Off-resonance component _, del_f_MHz, _, _, = fit_params # freq is MHz since times in us plt.scatter(times_us, np.real(ramsey_values), color='white') plt.plot(times_us, y_fit, color='red', label=f"df = {del_f_MHz:.2f} MHz") plt.xlim(0, np.max(times_us)) plt.xlabel('Delay between X90 pulses [$\mu$s]', fontsize=15) plt.ylabel('Measured Signal [a.u.]', fontsize=15) plt.title('Ramsey Experiment', fontsize=15) plt.legend() plt.show()
https://github.com/rohitgit1/Quantum-Computing-Summer-School
rohitgit1
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() # our backend is the Pulse Simulator from resources import helper from qiskit.providers.aer import PulseSimulator backend_sim = PulseSimulator() # sample duration for pulse instructions dt = 1e-9 # create the model duffing_model = helper.get_transmon(dt) # get qubit frequency from Duffing model qubit_lo_freq = duffing_model.hamiltonian.get_qubit_lo_from_drift() import numpy as np # visualization tools import matplotlib.pyplot as plt plt.style.use('dark_background') # unit conversion factors -> all backend properties returned in SI (Hz, sec, etc) GHz = 1.0e9 # Gigahertz MHz = 1.0e6 # Megahertz kHz = 1.0e3 # kilohertz us = 1.0e-6 # microseconds ns = 1.0e-9 # nanoseconds from qiskit import pulse from qiskit.pulse import Play, Acquire from qiskit.pulse.pulse_lib import GaussianSquare # qubit to be used throughout the notebook qubit = 0 ### Collect the necessary channels drive_chan = pulse.DriveChannel(qubit) meas_chan = pulse.MeasureChannel(qubit) acq_chan = pulse.AcquireChannel(qubit) # Construct a measurement schedule and add it to an InstructionScheduleMap meas_samples = 1200 meas_pulse = GaussianSquare(duration=meas_samples, amp=0.025, sigma=4, width=1150) measure_sched = Play(meas_pulse, meas_chan) | Acquire(meas_samples, acq_chan, pulse.MemorySlot(qubit)) inst_map = pulse.InstructionScheduleMap() inst_map.add('measure', [qubit], measure_sched) # save the measurement/acquire pulse for later measure = inst_map.get('measure', qubits=[qubit]) from qiskit.pulse import pulse_lib # the same spect pulse used in every schedule drive_amp = 0.9 drive_sigma = 16 drive_duration = 128 spec_pulse = pulse_lib.gaussian(duration=drive_duration, amp=drive_amp, sigma=drive_sigma, name=f"Spec drive amplitude = {drive_amp}") # Construct an np array of the frequencies for our experiment spec_freqs_GHz = np.arange(5.0, 5.2, 0.005) # Create the base schedule # Start with drive pulse acting on the drive channel spec_schedules = [] for freq in spec_freqs_GHz: sb_spec_pulse = helper.apply_sideband(spec_pulse, qubit_lo_freq[0]-freq*GHz, dt) spec_schedule = pulse.Schedule(name='SB Frequency = {}'.format(freq)) spec_schedule += Play(sb_spec_pulse, drive_chan) # The left shift `<<` is special syntax meaning to shift the start time of the schedule by some duration spec_schedule += measure << spec_schedule.duration spec_schedules.append(spec_schedule) spec_schedules[0].draw() from qiskit import assemble # assemble the schedules into a Qobj spec01_qobj = assemble(**helper.get_params('spec01', globals())) # run the simulation spec01_result = backend_sim.run(spec01_qobj, duffing_model).result() # retrieve the data from the experiment spec01_values = helper.get_values_from_result(spec01_result, qubit) fit_params, y_fit = helper.fit_lorentzian(spec_freqs_GHz, spec01_values, [5, 5, 1, 0]) f01 = fit_params[1] plt.scatter(spec_freqs_GHz, np.real(spec01_values), color='white') # plot real part of sweep values plt.plot(spec_freqs_GHz, y_fit, color='red') plt.xlim([min(spec_freqs_GHz), max(spec_freqs_GHz)]) plt.xlabel("Frequency [GHz]") plt.ylabel("Measured Signal [a.u.]") plt.show() print("01 Spectroscopy yields %f GHz"%f01) x180_amp = 0.629070 #from lab 6 Rabi experiment x_pulse = pulse_lib.gaussian(duration=drive_duration, amp=x180_amp, sigma=drive_sigma, name='x_pulse') anharmonicity_guess_GHz = -0.3 def build_spec12_pulse_schedule(freq): sb12_spec_pulse = helper.apply_sideband(spec_pulse, (freq + anharmonicity_guess_GHz)*GHz, dt) ### create a 12 spectroscopy pulse schedule spec12_schedule (already done) ### play an x pulse on the drive channel ### play sidebanded spec pulse on the drive channel ### add measurement pulse to schedule spec12_schedule = pulse.Schedule() ### WRITE YOUR CODE BETWEEN THESE LINES - START spec12_schedule += Play(x_pulse, drive_chan) spec12_schedule += Play(sb12_spec_pulse, drive_chan) spec12_schedule += measure << spec12_schedule.duration ### WRITE YOUR CODE BETWEEN THESE LINES - STOP return spec12_schedule sb_freqs_GHz = np.arange(-.1, .1, 0.005) # sweep +/- 100 MHz around guess # now vary the sideband frequency for each spec pulse spec_schedules = [] for freq in sb_freqs_GHz: spec_schedules.append(build_spec12_pulse_schedule(freq)) spec_schedules[0].draw() # assemble the schedules into a Qobj spec12_qobj = assemble(**helper.get_params('spec12', globals())) answer1 = spec12_qobj # run the simulation spec12_result = backend_sim.run(spec12_qobj, duffing_model).result() # retrieve the data from the experiment spec12_values = helper.get_values_from_result(spec12_result, qubit) anharm_offset = qubit_lo_freq[0]/GHz + anharmonicity_guess_GHz fit_params, y_fit = helper.fit_lorentzian(anharm_offset + sb_freqs_GHz, spec12_values, [5, 4.5, .1, 3]) f12 = fit_params[1] plt.scatter(anharm_offset + sb_freqs_GHz, np.real(spec12_values), color='white') # plot real part of sweep values plt.plot(anharm_offset + sb_freqs_GHz, y_fit, color='red') plt.xlim([anharm_offset + min(sb_freqs_GHz), anharm_offset + max(sb_freqs_GHz)]) plt.xlabel("Frequency [GHz]") plt.ylabel("Measured Signal [a.u.]") plt.show() print("12 Spectroscopy yields %f GHz"%f12) print("Measured transmon anharmonicity is %f MHz"%((f12-f01)*GHz/MHz)) from IPython.display import display, Javascript;display(Javascript('IPython.notebook.save_checkpoint();')); from grading_tools import send_code;send_code('ex1.ipynb')
https://github.com/rohitgit1/Quantum-Computing-Summer-School
rohitgit1
# import SymPy and define symbols import sympy as sp sp.init_printing(use_unicode=True) wr = sp.Symbol('\omega_r') # resonator frequency wq = sp.Symbol('\omega_q') # qubit frequency g = sp.Symbol('g', real=True) # vacuum Rabi coupling Delta = sp.Symbol('Delta', real=True) # wr - wq; defined later # import operator relations and define them from sympy.physics.quantum.boson import BosonOp a = BosonOp('a') # resonator photon annihilation operator from sympy.physics.quantum import pauli, Dagger, Commutator from sympy.physics.quantum.operatorordering import normal_ordered_form # Pauli matrices sx = pauli.SigmaX() sy = pauli.SigmaY() sz = pauli.SigmaZ() # qubit raising and lowering operators splus = pauli.SigmaPlus() sminus = pauli.SigmaMinus() # define J-C Hamiltonian in terms of diagonal and non-block diagonal terms H0 = wr*Dagger(a)*a - (1/2)*wq*sz; H1 = 0 H2 = g*(Dagger(a)*sminus + a*splus); HJC = H0 + H1 + H2; HJC # print # using the above method for finding the ansatz eta = Commutator(H0, H2); eta pauli.qsimplify_pauli(normal_ordered_form(eta.doit().expand())) A = sp.Symbol('A') B = sp.Symbol('B') eta = A * Dagger(a) * sminus - B * a * splus; pauli.qsimplify_pauli(normal_ordered_form(Commutator(H0, eta).doit().expand())) H2 S1 = eta.subs(A, g/Delta) S1 = S1.subs(B, g/Delta); S1.factor() Heff = H0 + H1 + 0.5*pauli.qsimplify_pauli(normal_ordered_form(Commutator(H2, S1).doit().expand())).simplify(); Heff from qiskit.tools.jupyter import * from qiskit import IBMQ IBMQ.load_account() provider = IBMQ.get_provider(hub='ibm-q', group='open', project='main') backend = provider.get_backend('ibmq_armonk') backend_config = backend.configuration() assert backend_config.open_pulse, "Backend doesn't support Pulse" dt = backend_config.dt print(f"Sampling time: {dt*1e9} ns") backend_defaults = backend.defaults() import numpy as np # unit conversion factors -> all backend properties returned in SI (Hz, sec, etc) GHz = 1.0e9 # Gigahertz MHz = 1.0e6 # Megahertz kHz = 1.0e3 us = 1.0e-6 # Microseconds ns = 1.0e-9 # Nanoseconds # We will find the qubit frequency for the following qubit. qubit = 0 # The sweep will be centered around the estimated qubit frequency. center_frequency_Hz = backend_defaults.qubit_freq_est[qubit] # The default frequency is given in Hz # warning: this will change in a future release print(f"Qubit {qubit} has an estimated frequency of {center_frequency_Hz / GHz} GHz.") # scale factor to remove factors of 10 from the data scale_factor = 1e-14 # We will sweep 40 MHz around the estimated frequency frequency_span_Hz = 40 * MHz # in steps of 1 MHz. frequency_step_Hz = 1 * MHz # We will sweep 20 MHz above and 20 MHz below the estimated frequency frequency_min = center_frequency_Hz - frequency_span_Hz / 2 frequency_max = center_frequency_Hz + frequency_span_Hz / 2 # Construct an np array of the frequencies for our experiment frequencies_GHz = np.arange(frequency_min / GHz, frequency_max / GHz, frequency_step_Hz / GHz) print(f"The sweep will go from {frequency_min / GHz} GHz to {frequency_max / GHz} GHz \ in steps of {frequency_step_Hz / MHz} MHz.") from qiskit import pulse # This is where we access all of our Pulse features! inst_sched_map = backend_defaults.instruction_schedule_map measure = inst_sched_map.get('measure', qubits=[qubit]) x_pulse = inst_sched_map.get('x', qubits=[qubit]) ### Collect the necessary channels drive_chan = pulse.DriveChannel(qubit) meas_chan = pulse.MeasureChannel(qubit) acq_chan = pulse.AcquireChannel(qubit) # Create the base schedule # Start with drive pulse acting on the drive channel schedule = pulse.Schedule(name='Frequency sweep') schedule += x_pulse # The left shift `<<` is special syntax meaning to shift the start time of the schedule by some duration schedule += measure << schedule.duration # Create the frequency settings for the sweep (MUST BE IN HZ) frequencies_Hz = frequencies_GHz*GHz schedule_frequencies = [{drive_chan: freq} for freq in frequencies_Hz] schedule.draw(label=True, scaling=0.8) from qiskit import assemble frequency_sweep_program = assemble(schedule, backend=backend, meas_level=1, meas_return='avg', shots=1024, schedule_los=schedule_frequencies) # RUN the job on a real device #job = backend.run(rabi_experiment_program) #print(job.job_id()) #from qiskit.tools.monitor import job_monitor #job_monitor(job) # OR retreive result from previous run job = backend.retrieve_job('5ef3b081fbc24b001275b03b') frequency_sweep_results = job.result() import matplotlib.pyplot as plt plt.style.use('dark_background') sweep_values = [] for i in range(len(frequency_sweep_results.results)): # Get the results from the ith experiment res = frequency_sweep_results.get_memory(i)*scale_factor # Get the results for `qubit` from this experiment sweep_values.append(res[qubit]) plt.scatter(frequencies_GHz, np.real(sweep_values), color='white') # plot real part of sweep values plt.xlim([min(frequencies_GHz), max(frequencies_GHz)]) plt.xlabel("Frequency [GHz]") plt.ylabel("Measured signal [a.u.]") plt.show() from scipy.optimize import curve_fit def fit_function(x_values, y_values, function, init_params): fitparams, conv = curve_fit(function, x_values, y_values, init_params) y_fit = function(x_values, *fitparams) return fitparams, y_fit fit_params, y_fit = fit_function(frequencies_GHz, np.real(sweep_values), lambda x, A, q_freq, B, C: (A / np.pi) * (B / ((x - q_freq)**2 + B**2)) + C, [5, 4.975, 1, 3] # initial parameters for curve_fit ) plt.scatter(frequencies_GHz, np.real(sweep_values), color='white') plt.plot(frequencies_GHz, y_fit, color='red') plt.xlim([min(frequencies_GHz), max(frequencies_GHz)]) plt.xlabel("Frequency [GHz]") plt.ylabel("Measured Signal [a.u.]") plt.show() # Create the schedules for 0 and 1 schedule_0 = pulse.Schedule(name='0') schedule_0 += measure schedule_1 = pulse.Schedule(name='1') schedule_1 += x_pulse schedule_1 += measure << schedule_1.duration schedule_0.draw() schedule_1.draw() frequency_span_Hz = 320 * kHz frequency_step_Hz = 8 * kHz center_frequency_Hz = backend_defaults.meas_freq_est[qubit] print(f"Qubit {qubit} has an estimated readout frequency of {center_frequency_Hz / GHz} GHz.") frequency_min = center_frequency_Hz - frequency_span_Hz / 2 frequency_max = center_frequency_Hz + frequency_span_Hz / 2 frequencies_GHz = np.arange(frequency_min / GHz, frequency_max / GHz, frequency_step_Hz / GHz) print(f"The sweep will go from {frequency_min / GHz} GHz to {frequency_max / GHz} GHz\ in steps of {frequency_step_Hz / MHz} MHz.") num_shots_per_frequency = 2048 frequencies_Hz = frequencies_GHz*GHz schedule_los = [{meas_chan: freq} for freq in frequencies_Hz] cavity_sweep_0 = assemble(schedule_0, backend=backend, meas_level=1, meas_return='avg', shots=num_shots_per_frequency, schedule_los=schedule_los) cavity_sweep_1 = assemble(schedule_1, backend=backend, meas_level=1, meas_return='avg', shots=num_shots_per_frequency, schedule_los=schedule_los) # RUN the job on a real device #job_0 = backend.run(cavity_sweep_0) #job_monitor(job_0) #job_0.error_message() #job_1 = backend.run(cavity_sweep_1) #job_monitor(job_1) #job_1.error_message() # OR retreive result from previous run job_0 = backend.retrieve_job('5efa5b447c0d6800137fff1c') job_1 = backend.retrieve_job('5efa6b2720eee10013be46b4') cavity_sweep_0_results = job_0.result() cavity_sweep_1_results = job_1.result() scale_factor = 1e-14 sweep_values_0 = [] for i in range(len(cavity_sweep_0_results.results)): res_0 = cavity_sweep_0_results.get_memory(i)*scale_factor sweep_values_0.append(res_0[qubit]) sweep_values_1 = [] for i in range(len(cavity_sweep_1_results.results)): res_1 = cavity_sweep_1_results.get_memory(i)*scale_factor sweep_values_1.append(res_1[qubit]) plotx = frequencies_Hz/kHz ploty_0 = np.abs(sweep_values_0) ploty_1 = np.abs(sweep_values_1) plt.plot(plotx, ploty_0, color='blue', marker='.') # plot real part of sweep values plt.plot(plotx, ploty_1, color='red', marker='.') # plot real part of sweep values plt.legend([r'$\vert0\rangle$', r'$\vert1\rangle$']) plt.grid() plt.xlabel("Frequency [kHz]") plt.ylabel("Measured signal [a.u.]") plt.yscale('log') plt.show()
https://github.com/rohitgit1/Quantum-Computing-Summer-School
rohitgit1
!pip install -U -r grading_tools/requirements.txt from IPython.display import clear_output clear_output() import numpy as np; pi = np.pi from qiskit import QuantumCircuit, Aer, execute from qiskit.visualization import plot_histogram from copy import deepcopy as make_copy def prepare_hets_circuit(depth, angle1, angle2): hets_circ = QuantumCircuit(depth) hets_circ.ry(angle1, 0) hets_circ.rz(angle1, 0) hets_circ.ry(angle1, 1) hets_circ.rz(angle1, 1) for ii in range(depth): hets_circ.cx(0,1) hets_circ.ry(angle2,0) hets_circ.rz(angle2,0) hets_circ.ry(angle2,1) hets_circ.rz(angle2,1) return hets_circ hets_circuit = prepare_hets_circuit(2, pi/2, pi/2) hets_circuit.draw() def measure_zz_circuit(given_circuit): zz_meas = make_copy(given_circuit) zz_meas.measure_all() return zz_meas zz_meas = measure_zz_circuit(hets_circuit) zz_meas.draw() simulator = Aer.get_backend('qasm_simulator') result = execute(zz_meas, backend = simulator, shots=10000).result() counts = result.get_counts(zz_meas) plot_histogram(counts) def measure_zz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zz = counts['00'] + counts['11'] - counts['01'] - counts['10'] zz = zz / total_counts return zz zz = measure_zz(hets_circuit) print("<ZZ> =", str(zz)) def measure_zi(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] zi = counts['00'] - counts['11'] + counts['01'] - counts['10'] zi = zi / total_counts return zi def measure_iz(given_circuit, num_shots = 10000): zz_meas = measure_zz_circuit(given_circuit) result = execute(zz_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(zz_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] iz = counts['00'] - counts['11'] - counts['01'] + counts['10'] iz = iz / total_counts return iz zi = measure_zi(hets_circuit) print("<ZI> =", str(zi)) iz = measure_iz(hets_circuit) print("<IZ> =", str(iz)) def measure_xx_circuit(given_circuit): xx_meas = make_copy(given_circuit) ### WRITE YOUR CODE BETWEEN THESE LINES - START xx_meas.h(0) xx_meas.h(1) xx_meas.measure_all() ### WRITE YOUR CODE BETWEEN THESE LINES - END return xx_meas xx_meas = measure_xx_circuit(hets_circuit) xx_meas.draw() def measure_xx(given_circuit, num_shots = 10000): xx_meas = measure_xx_circuit(given_circuit) result = execute(xx_meas, backend = simulator, shots = num_shots).result() counts = result.get_counts(xx_meas) if '00' not in counts: counts['00'] = 0 if '01' not in counts: counts['01'] = 0 if '10' not in counts: counts['10'] = 0 if '11' not in counts: counts['11'] = 0 total_counts = counts['00'] + counts['11'] + counts['01'] + counts['10'] xx = counts['00'] + counts['11'] - counts['01'] - counts['10'] xx = xx / total_counts return xx xx = measure_xx(hets_circuit) print("<XX> =", str(xx)) def get_energy(given_circuit, num_shots = 10000): zz = measure_zz(given_circuit, num_shots = num_shots) iz = measure_iz(given_circuit, num_shots = num_shots) zi = measure_zi(given_circuit, num_shots = num_shots) xx = measure_xx(given_circuit, num_shots = num_shots) energy = (-1.0523732)*1 + (0.39793742)*iz + (-0.3979374)*zi + (-0.0112801)*zz + (0.18093119)*xx return energy energy = get_energy(hets_circuit) print("The energy of the trial state is", str(energy)) hets_circuit_plus = None hets_circuit_minus = None ### WRITE YOUR CODE BETWEEN THESE LINES - START hets_circuit_plus = prepare_hets_circuit(2, pi/2 + 0.1*pi/2, pi/2) hets_circuit_minus = prepare_hets_circuit(2, pi/2 - 0.1*pi/2, pi/2) ### WRITE YOUR CODE BETWEEN THESE LINES - END energy_plus = get_energy(hets_circuit_plus, num_shots=100000) energy_minus = get_energy(hets_circuit_minus, num_shots=100000) print(energy_plus, energy_minus) name = 'Pon Rahul M' email = 'ponrahul.21it@licet.ac.in' ### Do not change the lines below from grading_tools import grade grade(answer=measure_xx_circuit(hets_circuit), name=name, email=email, labid='lab9', exerciseid='ex1') grade(answer=hets_circuit_plus, name=name, email=email, labid='lab9', exerciseid='ex2') grade(answer=hets_circuit_minus, name=name, email=email, labid='lab9', exerciseid='ex3') energy_plus_100, energy_plus_1000, energy_plus_10000 = 0, 0, 0 energy_minus_100, energy_minus_1000, energy_minus_10000 = 0, 0, 0 ### WRITE YOUR CODE BETWEEN THESE LINES - START energy_plus_100 = get_energy(hets_circuit_plus, num_shots = 100) energy_minus_100 = get_energy(hets_circuit_minus, num_shots = 100) energy_plus_1000 = get_energy(hets_circuit_plus, num_shots = 1000) energy_minus_1000 = get_energy(hets_circuit_minus, num_shots = 1000) energy_plus_10000 = get_energy(hets_circuit_plus, num_shots = 10000) energy_minus_10000 = get_energy(hets_circuit_minus, num_shots = 10000) ### WRITE YOUR CODE BETWEEN THESE LINES - END print(energy_plus_100, energy_minus_100, "difference = ", energy_minus_100 - energy_plus_100) print(energy_plus_1000, energy_minus_1000, "difference = ", energy_minus_1000 - energy_plus_1000) print(energy_plus_10000, energy_minus_10000, "difference = ", energy_minus_10000 - energy_plus_10000) ### WRITE YOUR CODE BETWEEN THESE LINES - START I = np.array([ [1, 0], [0, 1] ]) X = np.array([ [0, 1], [1, 0] ]) Z = np.array([ [1, 0], [0, -1] ]) h2_hamiltonian = (-1.0523732) * np.kron(I, I) + \ (0.39793742) * np.kron(I, Z) + \ (-0.3979374) * np.kron(Z, I) + \ (-0.0112801) * np.kron(Z, Z) + \ (0.18093119) * np.kron(X, X) from numpy import linalg as LA eigenvalues, eigenvectors = LA.eig(h2_hamiltonian) for ii, eigenvalue in enumerate(eigenvalues): print(f"Eigenvector {eigenvectors[:,ii]} has energy {eigenvalue}") exact_eigenvector = eigenvectors[:,np.argmin(eigenvalues)] exact_eigenvalue = np.min(eigenvalues) print() print("Minimum energy is", exact_eigenvalue) ### WRITE YOUR CODE BETWEEN THESE LINES - END
https://github.com/rodneyosodo/variational-quantum-classifier-on-heartattack
rodneyosodo
import pandas as pd import numpy as np import matplotlib.pyplot as plt import seaborn as sns import pandas_profiling as pp %matplotlib inline # Constants DATA_PATH = "../../Data/Raw/data.csv" PP_PATH = "../../Output/Figures/pandasProfile.html" CLEAN_DATA_PATH = "../../Data/Processed/data.csv" data = pd.read_csv(DATA_PATH) data.shape data.columns data.head(7) data.info() data.describe() def check_unique(df): """" Checks the unique value in each column :param df: The dataframe """ for col in df.columns: unique = df[col].unique() print("Column: {} has {} unique values\n".format(col, unique)) check_unique(data) data['num '].value_counts() fig = plt.figure() sns.countplot(x="num ", data=data, palette="gist_rainbow_r") plt.xlabel("Heart disease (0 = have, 1 = don't)") plt.title("Target distribution") plt.show() fig.savefig("../../Output/Figures/targetdist.png", ) sns.countplot(x='sex', data=data, palette="mako_r") plt.xlabel("Sex (0 = female, 1= male)") plt.title("Age distribution") plt.savefig("../../Output/Figures/agedist.png", format="png") pd.crosstab(data['age'], data['num ']).plot(kind="bar",figsize=(20,6)) plt.title('Heart Disease Frequency for Ages') plt.xlabel('Age') plt.ylabel('Frequency') plt.savefig('../../Output/Figures/heartDiseaseAndAges.png') plt.figure(figsize=(15,8)) ax = sns.boxplot(data=data, orient="v", palette="Set2") plt.title("Box plots") plt.savefig("../../Output/Figures/boxplot.png") sns.pairplot(data, diag_kind="kde") plt.title("Pair plots") plt.savefig("../../Output/Figures/pairplot.png") data = data.rename(columns={'num ':'num'}) def fix_missing_values(df): """" Changes ? in the data to be np.Nan :param df: The dataframe :return df: Fixed dataframe """ cols = df.columns for col in cols: for i in range(len(df[col])): if df[col][i] == '?': df[col][i] = np.NaN return df data = fix_missing_values(data) data.info() def change_dtype(df): """" Changes the data type from object to float64 :param df: The dataframe :return df: Fixed dataframe """ cols = df.columns for col in cols: if df[col].dtype == 'O': df[col] = df[col].astype("float64") return df data = change_dtype(data) def fix_missing_values(df): def delete_missing_values(df): """ Deletes the column with Null values which are less than half of its values """ df = df[['age', 'sex', 'cp', 'trestbps', 'chol', 'fbs', 'restecg', 'thalach','exang', 'oldpeak', 'num']] return df def fill_with_mean(df): """ Fills the NaN values with the mean value of the column """ cols = ['trestbps', 'chol', 'thalach'] for col in cols: df[col].fillna(value=df[col].mean(), inplace=True) return df def fill_with_mode(df): """ Fills the NaN values with the mode value of the column """ cols =['fbs', 'restecg', 'exang'] for col in cols: df[col].fillna(value=df[col].mode()[0], inplace=True) return df df = delete_missing_values(df) df = fill_with_mean(df) df = fill_with_mode(df) return df data = fix_missing_values(data) data.duplicated().sum() data.drop_duplicates(inplace=True) data.drop('num', axis=1).corrwith(data['num']).plot(kind='bar', grid=True, figsize=(12, 8), title="Correlation with target") plt.savefig("../../Output/Figures/correlation.png") pp.ProfileReport(df=data, dark_mode=True, explorative=True) pp.ProfileReport(df=data, dark_mode=True, explorative=True).to_file(PP_PATH) data.to_csv(CLEAN_DATA_PATH, index=False)