repo
stringclasses
900 values
file
stringclasses
754 values
content
stringlengths
4
215k
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qsvm_datasets import * from qiskit_aqua.utils import split_dataset_to_data_and_labels, map_label_to_class_name from qiskit_aqua.input import get_input_instance from qiskit_aqua import run_algorithm # setup aqua logging import logging from qiskit_aqua._logging import set_logging_config, build_logging_config # set_logging_config(build_logging_config(logging.DEBUG)) # choose INFO, DEBUG to see the log from qiskit import IBMQ IBMQ.load_accounts() feature_dim=2 # we support feature_dim 2 or 3 sample_Total, training_input, test_input, class_labels = ad_hoc_data(training_size=20, test_size=10, n=feature_dim, gap=0.3, PLOT_DATA=True) datapoints, class_to_label = split_dataset_to_data_and_labels(test_input) print(class_to_label) params = { 'problem': {'name': 'svm_classification', 'random_seed': 10598}, 'algorithm': { 'name': 'QSVM.Kernel' }, 'backend': {'name': 'qasm_simulator', 'shots': 1024}, 'feature_map': {'name': 'SecondOrderExpansion', 'depth': 2, 'entanglement': 'linear'} } algo_input = get_input_instance('SVMInput') algo_input.training_dataset = training_input algo_input.test_dataset = test_input algo_input.datapoints = datapoints[0] # 0 is data, 1 is labels result = run_algorithm(params, algo_input) print("testing success ratio: ", result['testing_accuracy']) print("predicted classes:", result['predicted_classes']) print("kernel matrix during the training:") kernel_matrix = result['kernel_matrix_training'] img = plt.imshow(np.asmatrix(kernel_matrix),interpolation='nearest',origin='upper',cmap='bone_r') plt.show() sample_Total, training_input, test_input, class_labels = Breast_cancer(training_size=20, test_size=10, n=2, PLOT_DATA=True) # n =2 is the dimension of each data point datapoints, class_to_label = split_dataset_to_data_and_labels(test_input) label_to_class = {label:class_name for class_name, label in class_to_label.items()} print(class_to_label, label_to_class) algo_input = get_input_instance('SVMInput') algo_input.training_dataset = training_input algo_input.test_dataset = test_input algo_input.datapoints = datapoints[0] result = run_algorithm(params, algo_input) print("testing success ratio: ", result['testing_accuracy']) print("ground truth: {}".format(map_label_to_class_name(datapoints[1], label_to_class))) print("predicted: {}".format(result['predicted_classes'])) print("kernel matrix during the training:") kernel_matrix = result['kernel_matrix_training'] img = plt.imshow(np.asmatrix(kernel_matrix),interpolation='nearest',origin='upper',cmap='bone_r') plt.show()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import matplotlib.pyplot as plt import matplotlib.axes as axes %matplotlib inline import numpy as np import networkx as nx from qiskit.tools.visualization import plot_histogram from qiskit_aqua import Operator, run_algorithm, get_algorithm_instance from qiskit_aqua.input import get_input_instance from qiskit_aqua.translators.ising import maxcut, tsp # setup aqua logging import logging from qiskit_aqua._logging import set_logging_config, build_logging_config # set_logging_config(build_logging_config(logging.DEBUG)) # choose INFO, DEBUG to see the log # ignoring deprecation errors on matplotlib import warnings import matplotlib.cbook warnings.filterwarnings("ignore",category=matplotlib.cbook.mplDeprecation) from qiskit import IBMQ IBMQ.load_accounts() # Generating a graph of 4 nodes n=4 # Number of nodes in graph G=nx.Graph() G.add_nodes_from(np.arange(0,n,1)) elist=[(0,1,1.0),(0,2,1.0),(0,3,1.0),(1,2,1.0),(2,3,1.0)] # tuple is (i,j,weight) where (i,j) is the edge G.add_weighted_edges_from(elist) colors = ['r' for node in G.nodes()] pos = nx.spring_layout(G) default_axes = plt.axes(frameon=True) nx.draw_networkx(G, node_color=colors, node_size=600, alpha=.8, ax=default_axes, pos=pos) # Computing the weight matrix from the random graph w = np.zeros([n,n]) for i in range(n): for j in range(n): temp = G.get_edge_data(i,j,default=0) if temp != 0: w[i,j] = temp['weight'] print(w) best_cost_brute = 0 for b in range(2**n): x = [int(t) for t in reversed(list(bin(b)[2:].zfill(n)))] cost = 0 for i in range(n): for j in range(n): cost = cost + w[i,j]*x[i]*(1-x[j]) if best_cost_brute < cost: best_cost_brute = cost xbest_brute = x print('case = ' + str(x)+ ' cost = ' + str(cost)) colors = ['r' if xbest_brute[i] == 0 else 'b' for i in range(n)] nx.draw_networkx(G, node_color=colors, node_size=600, alpha=.8, pos=pos) print('\nBest solution = ' + str(xbest_brute) + ' cost = ' + str(best_cost_brute)) qubitOp, offset = maxcut.get_maxcut_qubitops(w) algo_input = get_input_instance('EnergyInput') algo_input.qubit_op = qubitOp #Making the Hamiltonian in its full form and getting the lowest eigenvalue and eigenvector algorithm_cfg = { 'name': 'ExactEigensolver', } params = { 'problem': {'name': 'ising'}, 'algorithm': algorithm_cfg } result = run_algorithm(params,algo_input) x = maxcut.sample_most_likely(result['eigvecs'][0]) print('energy:', result['energy']) print('maxcut objective:', result['energy'] + offset) print('solution:', maxcut.get_graph_solution(x)) print('solution objective:', maxcut.maxcut_value(x, w)) colors = ['r' if maxcut.get_graph_solution(x)[i] == 0 else 'b' for i in range(n)] nx.draw_networkx(G, node_color=colors, node_size=600, alpha = .8, pos=pos) algorithm_cfg = { 'name': 'VQE', 'operator_mode': 'matrix' } optimizer_cfg = { 'name': 'SPSA', 'max_trials': 300 } var_form_cfg = { 'name': 'RY', 'depth': 5, 'entanglement': 'linear' } params = { 'problem': {'name': 'ising', 'random_seed': 10598}, 'algorithm': algorithm_cfg, 'optimizer': optimizer_cfg, 'variational_form': var_form_cfg, 'backend': {'name': 'statevector_simulator'} } result = run_algorithm(params, algo_input) x = maxcut.sample_most_likely(result['eigvecs'][0]) print('energy:', result['energy']) print('time:', result['eval_time']) print('maxcut objective:', result['energy'] + offset) print('solution:', maxcut.get_graph_solution(x)) print('solution objective:', maxcut.maxcut_value(x, w)) colors = ['r' if maxcut.get_graph_solution(x)[i] == 0 else 'b' for i in range(n)] nx.draw_networkx(G, node_color=colors, node_size=600, alpha = .8, pos=pos) # run quantum algorithm with shots params['algorithm']['operator_mode'] = 'grouped_paulis' params['backend']['name'] = 'qasm_simulator' params['backend']['shots'] = 1024 result = run_algorithm(params, algo_input) x = maxcut.sample_most_likely(result['eigvecs'][0]) print('energy:', result['energy']) print('time:', result['eval_time']) print('maxcut objective:', result['energy'] + offset) print('solution:', maxcut.get_graph_solution(x)) print('solution objective:', maxcut.maxcut_value(x, w)) plot_histogram(result['eigvecs'][0]) colors = ['r' if maxcut.get_graph_solution(x)[i] == 0 else 'b' for i in range(n)] nx.draw_networkx(G, node_color=colors, node_size=600, alpha = .8, pos=pos)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import matplotlib.pyplot as plt import matplotlib.axes as axes %matplotlib inline import numpy as np import networkx as nx from qiskit.tools.visualization import plot_histogram from qiskit_aqua import Operator, run_algorithm, get_algorithm_instance from qiskit_aqua.input import get_input_instance from qiskit_aqua.translators.ising import maxcut, tsp # setup aqua logging import logging from qiskit_aqua._logging import set_logging_config, build_logging_config # set_logging_config(build_logging_config(logging.DEBUG)) # choose INFO, DEBUG to see the log # ignoring deprecation errors on matplotlib import warnings import matplotlib.cbook warnings.filterwarnings("ignore",category=matplotlib.cbook.mplDeprecation) from qiskit import IBMQ IBMQ.load_accounts() # Generating a graph of 3 nodes n = 3 num_qubits = n ** 2 ins = tsp.random_tsp(n) G = nx.Graph() G.add_nodes_from(np.arange(0, n, 1)) colors = ['r' for node in G.nodes()] pos = {k: v for k, v in enumerate(ins.coord)} default_axes = plt.axes(frameon=True) nx.draw_networkx(G, node_color=colors, node_size=600, alpha=.8, ax=default_axes, pos=pos) print('distance\n', ins.w) from itertools import permutations def brute_force_tsp(w, N): a=list(permutations(range(1,N))) last_best_distance = 1e10 for i in a: distance = 0 pre_j = 0 for j in i: distance = distance + w[j,pre_j] pre_j = j distance = distance + w[pre_j,0] order = (0,) + i if distance < last_best_distance: best_order = order last_best_distance = distance print('order = ' + str(order) + ' Distance = ' + str(distance)) return last_best_distance, best_order best_distance, best_order = brute_force_tsp(ins.w, ins.dim) print('Best order from brute force = ' + str(best_order) + ' with total distance = ' + str(best_distance)) def draw_tsp_solution(G, order, colors, pos): G2 = G.copy() n = len(order) for i in range(n): j = (i + 1) % n G2.add_edge(order[i], order[j]) default_axes = plt.axes(frameon=True) nx.draw_networkx(G2, node_color=colors, node_size=600, alpha=.8, ax=default_axes, pos=pos) draw_tsp_solution(G, best_order, colors, pos) qubitOp, offset = tsp.get_tsp_qubitops(ins) algo_input = get_input_instance('EnergyInput') algo_input.qubit_op = qubitOp #Making the Hamiltonian in its full form and getting the lowest eigenvalue and eigenvector algorithm_cfg = { 'name': 'ExactEigensolver', } params = { 'problem': {'name': 'ising'}, 'algorithm': algorithm_cfg } result = run_algorithm(params,algo_input) print('energy:', result['energy']) #print('tsp objective:', result['energy'] + offset) x = tsp.sample_most_likely(result['eigvecs'][0]) print('feasible:', tsp.tsp_feasible(x)) z = tsp.get_tsp_solution(x) print('solution:', z) print('solution objective:', tsp.tsp_value(z, ins.w)) draw_tsp_solution(G, z, colors, pos) algorithm_cfg = { 'name': 'VQE', 'operator_mode': 'matrix' } optimizer_cfg = { 'name': 'SPSA', 'max_trials': 300 } var_form_cfg = { 'name': 'RY', 'depth': 5, 'entanglement': 'linear' } params = { 'problem': {'name': 'ising', 'random_seed': 10598}, 'algorithm': algorithm_cfg, 'optimizer': optimizer_cfg, 'variational_form': var_form_cfg, 'backend': {'name': 'statevector_simulator'} } result = run_algorithm(params,algo_input) print('energy:', result['energy']) print('time:', result['eval_time']) #print('tsp objective:', result['energy'] + offset) x = tsp.sample_most_likely(result['eigvecs'][0]) print('feasible:', tsp.tsp_feasible(x)) z = tsp.get_tsp_solution(x) print('solution:', z) print('solution objective:', tsp.tsp_value(z, ins.w)) draw_tsp_solution(G, z, colors, pos) # run quantum algorithm with shots params['algorithm']['operator_mode'] = 'grouped_paulis' params['backend']['name'] = 'qasm_simulator' params['backend']['shots'] = 1024 result = run_algorithm(params,algo_input) print('energy:', result['energy']) print('time:', result['eval_time']) #print('tsp objective:', result['energy'] + offset) x = tsp.sample_most_likely(result['eigvecs'][0]) print('feasible:', tsp.tsp_feasible(x)) z = tsp.get_tsp_solution(x) print('solution:', z) print('solution objective:', tsp.tsp_value(z, ins.w)) plot_histogram(result['eigvecs'][0]) draw_tsp_solution(G, z, colors, pos)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit_aqua_chemistry import AquaChemistry from qiskit import IBMQ IBMQ.load_accounts() # Input dictionary to configure Qiskit AQUA Chemistry for the chemistry problem. aqua_chemistry_dict = { 'driver': {'name': 'HDF5'}, 'HDF5': {'hdf5_input': '0.7_sto-3g.hdf5'}, 'operator': {'name': 'hamiltonian'}, 'algorithm': {'name': 'VQE'}, 'optimizer': {'name': 'COBYLA'}, 'variational_form': {'name': 'UCCSD'}, 'initial_state': {'name': 'HartreeFock'}, 'backend': {'name': 'statevector_simulator'} } solver = AquaChemistry() result = solver.run(aqua_chemistry_dict) print('Ground state energy: {}'.format(result['energy'])) for line in result['printable']: print(line)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
#importing array and useful math functions import numpy as np #importing circuits and registers from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister #importing backends and running environment from qiskit import BasicAer, execute
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import ClassicalRegister, QuantumRegister from qiskit import QuantumCircuit, execute from qiskit import register #import Qconfig and set APIToken and API url import sys, getpass try: sys.path.append("../../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} print('Qconfig loaded from %s.' % Qconfig.__file__) except: APItoken = getpass.getpass('Please input your token and hit enter: ') qx_config = { "APItoken": APItoken, "url":"https://quantumexperience.ng.bluemix.net/api"} print('Qconfig.py not found in qiskit-tutorial directory; Qconfig loaded using user input.') register(qx_config['APItoken'], qx_config['url']) from battleships_engine import * title_screen() device = ask_for_device() from qiskit import get_backend backend = get_backend(device) shipPos = ask_for_ships() # the game variable will be set to False once the game is over game = True # the variable bombs[X][Y] will hold the number of times position Y has been bombed by player X+1 bomb = [ [0]*5 for _ in range(2)] # all values are initialized to zero # set the number of samples used for statistics shots = 1024 # the variable grid[player] will hold the results for the grid of each player grid = [{},{}] while (game): # ask both players where they want to bomb, and update the list of bombings so far bomb = ask_for_bombs( bomb ) # now we create and run the quantum programs that implement this on the grid for each player qc = [] for player in range(2): # now to set up the quantum program to simulate the grid for this player # set up registers and program q = QuantumRegister(5) c = ClassicalRegister(5) qc.append( QuantumCircuit(q, c) ) # add the bombs (of the opposing player) for position in range(5): # add as many bombs as have been placed at this position for n in range( bomb[(player+1)%2][position] ): # the effectiveness of the bomb # (which means the quantum operation we apply) # depends on which ship it is for ship in [0,1,2]: if ( position == shipPos[player][ship] ): frac = 1/(ship+1) # add this fraction of a NOT to the QASM qc[player].u3(frac * math.pi, 0.0, 0.0, q[position]) # Finally, measure them for position in range(5): qc[player].measure(q[position], c[position]) # compile and run the quantum program job = execute(qc, backend, shots=shots) if device=='ibmqx4': print("\nWe've now get submitted the job to the quantum computer to see what happens to the ships of each player\n(it might take a while).\n") else: print("\nWe've now get submitted the job to the simulator to see what happens to the ships of each player.\n") # and extract data for player in range(2): grid[player] = job.result().get_counts(qc[player]) game = display_grid ( grid, shipPos, shots )
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
print("Hello! I'm a code cell") print('Set up started...') %matplotlib notebook import sys sys.path.append('game_engines') import hello_quantum print('Set up complete!') initialize = [] success_condition = {} allowed_gates = {'0': {'NOT': 3}, '1': {}, 'both': {}} vi = [[1], False, False] qubit_names = {'0':'the only bit', '1':None} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [] success_condition = {} allowed_gates = {'0': {}, '1': {'NOT': 0}, 'both': {}} vi = [[], False, False] qubit_names = {'0':'the bit on the left', '1':'the bit on the right'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['x', '0']] success_condition = {'IZ': -1.0} allowed_gates = {'0': {'CNOT': 0}, '1': {'CNOT': 0}, 'both': {}} vi = [[], False, False] qubit_names = {'0':'the bit on the left', '1':'the bit on the right'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['x', '0']] success_condition = {'ZI': 1.0, 'IZ': -1.0} allowed_gates = {'0': {'CNOT': 0}, '1': {'CNOT': 0}, 'both': {}} vi = [[], False, False] qubit_names = {'0':'the bit on the left', '1':'the bit on the right'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['h', '0']] success_condition = {'IZ': 0.0} allowed_gates = {'0': {'CNOT': 0}, '1': {'CNOT': 0}, 'both': {}} vi = [[], False, False] qubit_names = {'0':'the bit on the left', '1':'the bit on the right'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['h', '0']] success_condition = {'ZZ': -1.0} allowed_gates = {'0': {'NOT': 0, 'CNOT': 0}, '1': {'NOT': 0, 'CNOT': 0}, 'both': {}} vi = [[], False, True] qubit_names = {'0':'the bit on the left', '1':'the bit on the right'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['h', '1']] success_condition = {'IZ': -1.0} allowed_gates = {'0': {'NOT': 0, 'CNOT': 0}, '1': {'NOT': 0, 'CNOT': 0}, 'both': {}} vi = [[], False, True] qubit_names = {'0':'the bit on the left', '1':'the bit on the right'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [ ["x","0"] ] success_condition = {"ZI":1.0} allowed_gates = { "0":{"x":3}, "1":{}, "both":{} } vi = [[1],True,True] qubit_names = {'0':'the only qubit', '1':None} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['x', '0']] success_condition = {'ZI': 1.0} allowed_gates = {'0': {'x': 0}, '1': {}, 'both': {}} vi = [[1], True, True] qubit_names = {'0':'the only qubit', '1':None} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['x', '1']] success_condition = {'IZ': 1.0} allowed_gates = {'0': {}, '1': {'x': 0}, 'both': {}} vi = [[0], True, True] qubit_names = {'0':None, '1':'the other qubit'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [] success_condition = {'ZI': 0.0} allowed_gates = {'0': {'h': 3}, '1': {}, 'both': {}} vi = [[1], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['h', '1']] success_condition = {'IZ': 1.0} allowed_gates = {'0': {}, '1': {'x': 3, 'h': 0}, 'both': {}} vi = [[0], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['h', '0'], ['z', '0']] success_condition = {'XI': 1.0} allowed_gates = {'0': {'z': 0, 'h': 0}, '1': {}, 'both': {}} vi = [[1], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [] success_condition = {'ZI': -1.0} allowed_gates = {'0': {'z': 0, 'h': 0}, '1': {}, 'both': {}} vi = [[1], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['h', '0']] success_condition = {'IX': 1.0} allowed_gates = {'0': {}, '1': {'z': 0, 'h': 0}, 'both': {}} vi = [[0], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['ry(pi/4)', '1']] success_condition = {'IZ': -0.7071, 'IX': -0.7071} allowed_gates = {'0': {}, '1': {'z': 0, 'h': 0}, 'both': {}} vi = [[0], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['x', '1']] success_condition = {'ZI': 0.0, 'IZ': 0.0} allowed_gates = {'0': {'x': 0, 'z': 0, 'h': 0}, '1': {'x': 0, 'z': 0, 'h': 0}, 'both': {}} vi = [[], True, False] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['h','0'],['h','1']] success_condition = {'ZZ': -1.0} allowed_gates = {'0': {'x': 0, 'z': 0, 'h': 0}, '1': {'x': 0, 'z': 0, 'h': 0}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['x','0']] success_condition = {'XX': 1.0} allowed_gates = {'0': {'x': 0, 'z': 0, 'h': 0}, '1': {'x': 0, 'z': 0, 'h': 0}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [] success_condition = {'XZ': -1.0} allowed_gates = {'0': {'x': 0, 'z': 0, 'h': 0}, '1': {'x': 0, 'z': 0, 'h': 0}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['ry(-pi/4)', '1'], ['ry(-pi/4)','0']] success_condition = {'ZI': -0.7071, 'IZ': -0.7071} allowed_gates = {'0': {'x': 0}, '1': {'x': 0}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['x', '1'], ['x','0']] success_condition = {'XI':1, 'IX':1} allowed_gates = {'0': {'z': 0, 'h': 0}, '1': {'z': 0, 'h': 0}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['x', '0']] success_condition = {'ZI': 1.0, 'IZ': -1.0} allowed_gates = {'0': {'cx': 0}, '1': {'cx': 0}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['h', '0'],['x', '1']] success_condition = {'XI': -1.0, 'IZ': 1.0} allowed_gates = {'0': {'h': 0, 'cz': 0}, '1': {'cx': 0}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['h', '0'],['x', '1'],['h', '1']] success_condition = { } allowed_gates = {'0':{'cz': 2}, '1':{'cz': 2}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['x', '0']] success_condition = {'IZ': -1.0} allowed_gates = {'0': {'h':0}, '1': {'h':0}, 'both': {'cz': 0}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['h', '0'],['h', '1']] success_condition = {'XI': -1.0, 'IX': -1.0} allowed_gates = {'0': {}, '1': {'z':0,'cx': 0}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [] success_condition = {'IZ': -1.0} allowed_gates = {'0': {'x':0,'h':0,'cx':0}, '1': {'h':0}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['ry(-pi/4)','0'],['ry(-pi/4)','0'],['ry(-pi/4)','0'],['x','0'],['x','1']] success_condition = {'ZI': -1.0,'XI':0,'IZ':0.7071,'IX':-0.7071} allowed_gates = {'0': {'h':0}, '1': {'h':0}, 'both': {'cz': 0}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['x','0'],['h','1']] success_condition = {'IX':1,'ZI':-1} allowed_gates = {'0': {'h':0}, '1': {'h':0}, 'both': {'cz':3}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names,shots=2000) initialize = [['x','1']] success_condition = {'IZ':1.0,'ZI':-1.0} allowed_gates = {'0': {'h':0}, '1': {'h':0}, 'both': {'cz':0}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names,shots=2000) initialize = [] success_condition = {} allowed_gates = {'0': {'ry(pi/4)': 4}, '1': {}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names) initialize = [['x','0']] success_condition = {'XX': 1.0} allowed_gates = {'0': {'x': 0, 'z': 0, 'h': 0}, '1': {'x': 0, 'z': 0, 'h': 0}, 'both': {}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names, mode='line') initialize = [] success_condition = {'ZI': -1.0} allowed_gates = {'0': {'bloch':1, 'ry(pi/4)': 0}, '1':{}, 'both': {'unbloch':0}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names, mode='line') initialize = [['h','0'],['h','1']] success_condition = {'ZI': -1.0,'IZ': -1.0} allowed_gates = {'0': {'bloch':0, 'ry(pi/4)': 0, 'ry(-pi/4)': 0}, '1': {'bloch':0, 'ry(pi/4)': 0, 'ry(-pi/4)': 0}, 'both': {'unbloch':0}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names, mode='line') initialize = [['h','0']] success_condition = {'ZZ': 1.0} allowed_gates = {'0': {}, '1': {'bloch':0, 'ry(pi/4)': 0, 'ry(-pi/4)': 0}, 'both': {'unbloch':0,'cz':0}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names, mode='line') initialize = [['ry(pi/4)','0'],['ry(pi/4)','1']] success_condition = {'ZI': 1.0,'IZ': 1.0} allowed_gates = {'0': {'bloch':0, 'z':0, 'ry(pi/4)': 1}, '1': {'bloch':0, 'x':0, 'ry(pi/4)': 1}, 'both': {'unbloch':0}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names, mode='line') initialize = [['x','0'],['h','1']] success_condition = {'IZ': 1.0} allowed_gates = {'0': {}, '1': {'bloch':0, 'cx':0, 'ry(pi/4)': 1, 'ry(-pi/4)': 1}, 'both': {'unbloch':0}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names, mode='line') initialize = [] success_condition = {'IZ': 1.0,'IX': 1.0} allowed_gates = {'0': {'bloch':0, 'x':0, 'z':0, 'h':0, 'cx':0, 'ry(pi/4)': 0, 'ry(-pi/4)': 0}, '1': {'bloch':0, 'x':0, 'z':0, 'h':0, 'cx':0, 'ry(pi/4)': 0, 'ry(-pi/4)': 0}, 'both': {'cz':0, 'unbloch':0}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names, mode='line') import random def setup_variables (): ### Replace this section with anything you want ### r = random.random() A = r*(2/3) B = r*(1/3) ### End of section ### return A, B def hash2bit ( variable, hash ): ### Replace this section with anything you want ### if hash=='V': bit = (variable<0.5) elif hash=='H': bit = (variable<0.25) bit = str(int(bit)) ### End of section ### return bit shots = 8192 def calculate_P ( ): P = {} for hashes in ['VV','VH','HV','HH']: # calculate each P[hashes] by sampling over `shots` samples P[hashes] = 0 for shot in range(shots): A, B = setup_variables() a = hash2bit ( A, hashes[0] ) # hash type for variable `A` is the first character of `hashes` b = hash2bit ( B, hashes[1] ) # hash type for variable `B` is the second character of `hashes` P[hashes] += (a!=b) / shots return P P = calculate_P() print(P) def bell_test (P): sum_P = sum(P.values()) for hashes in P: bound = sum_P - P[hashes] print("The upper bound for P['"+hashes+"'] is "+str(bound)) print("The value of P['"+hashes+"'] is "+str(P[hashes])) if P[hashes]<=bound: print("The upper bound is obeyed :)\n") else: if P[hashes]-bound < 0.1: print("This seems to have gone over the upper bound, but only by a little bit :S\nProbably just rounding errors or statistical noise.\n") else: print("!!!!! This has gone well over the upper bound :O !!!!!\n") bell_test(P) from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit def initialize_program (): qubit = QuantumRegister(2) A = qubit[0] B = qubit[1] bit = ClassicalRegister(2) a = bit[0] b = bit[1] qc = QuantumCircuit(qubit, bit) return A, B, a, b, qc def hash2bit ( variable, hash, bit, qc ): if hash=='H': qc.h( variable ) qc.measure( variable, bit ) initialize = [] success_condition = {'ZZ':-0.7071,'ZX':-0.7071,'XZ':-0.7071,'XX':-0.7071} allowed_gates = {'0': {'bloch':0, 'x':0, 'z':0, 'h':0, 'cx':0, 'ry(pi/4)': 0, 'ry(-pi/4)': 0}, '1': {'bloch':0, 'x':0, 'z':0, 'h':0, 'cx':0, 'ry(pi/4)': 0, 'ry(-pi/4)': 0}, 'both': {'cz':0, 'unbloch':0}} vi = [[], True, True] qubit_names = {'0':'A', '1':'B'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names, mode='line') import numpy as np def setup_variables ( A, B, qc ): for line in puzzle.program: eval(line) shots = 8192 from qiskit import execute def calculate_P ( backend ): P = {} program = {} for hashes in ['VV','VH','HV','HH']: A, B, a, b, program[hashes] = initialize_program () setup_variables( A, B, program[hashes] ) hash2bit ( A, hashes[0], a, program[hashes]) hash2bit ( B, hashes[1], b, program[hashes]) # submit jobs job = execute( list(program.values()), backend, shots=shots ) # get the results for hashes in ['VV','VH','HV','HH']: stats = job.result().get_counts(program[hashes]) P[hashes] = 0 for string in stats.keys(): a = string[-1] b = string[-2] if a!=b: P[hashes] += stats[string] / shots return P device = 'qasm_simulator' from qiskit import Aer, IBMQ try: IBMQ.load_accounts() except: pass try: backend = Aer.get_backend(device) except: backend = IBMQ.get_backend(device) print(backend.status()) P = calculate_P( backend ) print(P) bell_test( P )
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
device = 'ibmq_16_melbourne' from qiskit import IBMQ IBMQ.load_accounts() backend = IBMQ.get_backend(device) num = backend.configuration()['n_qubits'] coupling_map = backend.configuration()['coupling_map'] print('number of qubits\n',num,'\n') print('list of pairs of qubits that are directly connected\n',coupling_map) if device in ['ibmqx2','ibmqx4']: pos = { 0: (1,1), 1: (1,0), 2: (0.5,0.5), 3: (0,0), 4: (0,1) } elif device in ['ibmqx5']: pos = { 0: (0,0), 1: (0,1), 2: (1,1), 3: (2,1), 4: (3,1), 5: (4,1), 6: (5,1), 7: (6,1), 8: (7,1), 9: (7,0), 10: (6,0), 11: (5,0), 12: (4,0), 13: (3,0), 14: (2,0), 15: (1,0) } elif device in ['ibmq_16_melbourne']: pos = { 0: (0,1), 1: (1,1), 2: (2,1), 3: (3,1), 4: (4,1), 5: (5,1), 6: (6,1), 7: (7,0), 8: (6,0), 9: (5,0), 10: (4,0), 11: (3,0), 12: (2,0), 13: (1,0) } import sys sys.path.append('game_engines') from universal import layout grid = layout(num,coupling_map,pos) grid.plot() from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit.tools.visualization import circuit_drawer import numpy as np qr = QuantumRegister(2) cr = ClassicalRegister(2) qp = QuantumCircuit(qr,cr) qp.rx( np.pi/2,qr[0]) qp.cx(qr[0],qr[1]) qp.measure(qr,cr) circuit_drawer(qp) from qiskit import execute from qiskit import Aer job = execute(qp,backend=Aer.get_backend('qasm_simulator')) results = job.result().get_counts() print(results) pairs = grid.matching() print(pairs) import random qr = QuantumRegister(num) cr = ClassicalRegister(num) qp = QuantumCircuit(qr,cr) for pair in pairs: qp.ry( (1+2*random.random())*np.pi/4,qr[pair[0]]) # angle generated randonly between pi/4 and 3pi/4 qp.cx(qr[pair[0]],qr[pair[1]]) qp.measure(qr,cr) from qiskit import execute job = execute(qp,backend=IBMQ.get_backend('ibmq_qasm_simulator')) results = job.result().get_counts() probs = grid.calculate_probs(results) grid.plot(probs=probs) job = execute(qp,backend=backend) results = job.result().get_counts() probs = grid.calculate_probs(results) grid.plot(probs=probs) def mitigate(probs): av_prob = {} for j in range(num): # for each qubit, work out which neighbour it agrees with most neighbours = [] for pair in grid.links: if j in grid.links[pair]: neighbours.append(pair) (guessed_pair,val) = (None,1) for pair in neighbours: if probs[pair]<val: guessed_pair = pair val = probs[pair] # then find the average probability of a 1 for the two av_prob[j] = (probs[grid.links[guessed_pair][0]]+probs[grid.links[guessed_pair][1]])/2 # replace the probabilities for all qubits with these averages for j in range(num): probs[j] = av_prob[j] return probs probs = mitigate(probs) grid.plot(probs=probs) pair_labels = {} colors = {} for node in grid.pos: if type(node)==str: pair_labels[node] = node colors[node] = (0.5,0.5,0.5) chosen_pairs = [] m = 0 while len(chosen_pairs)<len(pairs): m += 1 print('\nMOVE',m) grid.plot(probs=probs,labels=pair_labels,colors=colors) pair = str.upper(input(" > Type the name of a pair of qubits whose numbers are the same (or very similar)...\n")) chosen_pairs.append( pair ) colors[pair] = (0.5,0.5,0.5) for j in range(2): colors[grid.links[pair][j]] = (0.5,0.5,0.5) grid.plot(probs=probs,labels=pair_labels,colors=colors) success = True for pair in chosen_pairs: success = success and ( (grid.links[pair] in pairs) or (grid.links[pair][::-1] in pairs) ) if success: input("\n ** You got all the correct pairs! :) **\n\n Press any key to continue\n") else: input("\n ** You didn't get all the correct pairs! :( **\n\n Press any key to continue\n")
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import matplotlib.pyplot as plt %matplotlib inline import numpy as np # useful math functions from math import pi, cos, acos, sqrt # importing the QISKit from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import available_backends, execute, register, get_backend import sys, getpass try: sys.path.append("../../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} print('Qconfig loaded from %s.' % Qconfig.__file__) except: APItoken = getpass.getpass('Please input your token and hit enter: ') qx_config = { "APItoken": APItoken, "url":"https://quantumexperience.ng.bluemix.net/api"} print('Qconfig.py not found in qiskit-tutorial directory; Qconfig loaded using user input.') # import basic plot tools from qiskit.tools.visualization import plot_histogram M = 16 # Maximum number of physical qubits available numberOfCoins = 8 # This number should be up to M-1, where M is the number of qubits available indexOfFalseCoin = 6 # This should be 0, 1, ..., numberOfCoins - 1, where we use Python indexing if numberOfCoins < 4 or numberOfCoins >= M: raise Exception("Please use numberOfCoins between 4 and ", M-1) if indexOfFalseCoin < 0 or indexOfFalseCoin >= numberOfCoins: raise Exception("indexOfFalseCoin must be between 0 and ", numberOfCoins-1) # Creating registers # numberOfCoins qubits for the binary query string and 1 qubit for working and recording the result of quantum balance qr = QuantumRegister(numberOfCoins+1) # for recording the measurement on qr cr = ClassicalRegister(numberOfCoins+1) circuitName = "QueryStateCircuit" queryStateCircuit = QuantumCircuit(qr, cr) N = numberOfCoins # Create uniform superposition of all strings of length N for i in range(N): queryStateCircuit.h(qr[i]) # Perform XOR(x) by applying CNOT gates sequentially from qr[0] to qr[N-1] and storing the result to qr[N] for i in range(N): queryStateCircuit.cx(qr[i], qr[N]) # Measure qr[N] and store the result to cr[N]. We continue if cr[N] is zero, or repeat otherwise queryStateCircuit.measure(qr[N], cr[N]) # we proceed to query the quantum beam balance if the value of cr[0]...cr[N] is all zero # by preparing the Hadamard state of |1>, i.e., |0> - |1> at qr[N] queryStateCircuit.x(qr[N]).c_if(cr, 0) queryStateCircuit.h(qr[N]).c_if(cr, 0) # we rewind the computation when cr[N] is not zero for i in range(N): queryStateCircuit.h(qr[i]).c_if(cr, 2**N) k = indexOfFalseCoin # Apply the quantum beam balance on the desired superposition state (marked by cr equal to zero) queryStateCircuit.cx(qr[k], qr[N]).c_if(cr, 0) # Apply Hadamard transform on qr[0] ... qr[N-1] for i in range(N): queryStateCircuit.h(qr[i]).c_if(cr, 0) # Measure qr[0] ... qr[N-1] for i in range(N): queryStateCircuit.measure(qr[i], cr[i]) backend = "local_qasm_simulator" shots = 1 # We perform a one-shot experiment results = execute(queryStateCircuit, backend=backend, shots=shots).result() answer = results.get_counts() for key in answer.keys(): if key[0:1] == "1": raise Exception("Fail to create desired superposition of balanced query string. Please try again") plot_histogram(answer) from collections import Counter for key in answer.keys(): normalFlag, _ = Counter(key[1:]).most_common(1)[0] #get most common label for i in range(2,len(key)): if key[i] != normalFlag: print("False coin index is: ", len(key) - i - 1)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from game_engines.quantum_slot import quantum_slot_machine quantum_slot_machine()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from IPython.display import YouTubeVideo YouTubeVideo('U6_wSh_-EQc', width=960, height=490) !pip install qiskit --quiet !pip install qiskit-aer --quiet !pip install pylatexenc --quiet # @markdown ### **1. Import `Qiskit` and essential packages for UI demonstration** { display-mode: "form" } from abc import abstractmethod, ABCMeta # For define pure virtual functions from IPython.display import clear_output from ipywidgets import Output, Button, HBox, VBox, HTML, Dropdown from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister, transpile from qiskit.visualization import plot_bloch_multivector, plot_histogram from qiskit_aer import AerSimulator # @markdown ### **2. `Board` class for essential quantum operations** { display-mode: "form" } class Board: def __init__(self, size=3, simulator=None): # Initialize the quantum circuit with one qubit and classical bit for each cell self.size = size self.simulator = simulator self.superposition_count = 0 self.cells = [[' ' for _ in range(size)] for _ in range(size)] # Initialize the board representation self.qubits = QuantumRegister(size**2, 'q') self.bits = ClassicalRegister(size**2, 'c') self.circuit = QuantumCircuit(self.qubits, self.bits) ''' For a 3x3 board, the winning lines are: - Horizontal lines: (0, 1, 2), (3, 4, 5), (6, 7, 8) - Vertical lines: (0, 3, 6), (1, 4, 7), (2, 5, 8) - Diagonal lines: (0, 4, 8), (2, 4, 6) ''' self.winning_lines = [tuple(range(i, size**2, size)) for i in range(size)] + \ [tuple(range(i * size, (i + 1) * size)) for i in range(size)] + \ [tuple(range(0, size**2, size + 1)), tuple(range(size - 1, size**2 - 1, size - 1))] def make_classical_move(self, row, col, player_mark, is_collapsed=False): if self.cells[row][col] == ' ' or is_collapsed: # Check if the cell is occupied self.cells[row][col] = player_mark index = row * self.size + col if player_mark == 'X': self.circuit.x(self.qubits[index]) else: self.circuit.id(self.qubits[index]) return True return False def make_swap_move(self, row1, col1, row2, col2, **kwargs): if self.cells[row1][col1] != ' ' and self.cells[row2][col2] != ' ': indices = [row1 * self.size + col1, row2 * self.size + col2] self.circuit.swap(self.qubits[indices[0]], self.qubits[indices[1]]) self.cells[row1][col1], self.cells[row2][col2] = self.cells[row2][col2], self.cells[row1][col1] return True return False def make_superposition_move(self, row, col, player_mark, **kwargs): if self.cells[row][col] == ' ': index = row * self.size + col self.circuit.h(self.qubits[index]) self.cells[row][col] = player_mark + '?' self.superposition_count += 1 return True return False def make_entangled_move(self, *positions, risk_level, player_mark, **kwargs): # Entangle the quantum states of 2 or 3 cells based on the risk level pos_count = len(positions) if pos_count not in [2, 3] or risk_level not in [1, 2, 3, 4] or len(set(positions)) != pos_count or \ (pos_count == 2 and risk_level not in [1, 3]) or (pos_count == 3 and risk_level not in [2, 4]) or \ any(self.cells[row][col] != ' ' for row, col in positions): return False indices = [row * self.size + col for row, col in positions] self.circuit.h(self.qubits[indices[0]]) if pos_count == 2: # Pairwise Entanglement with Bell state for 2 qubits: # Lv1. |Ψ+⟩ = (∣01⟩ + ∣10⟩)/√2 | Lv3. |Φ+⟩ = (∣00⟩ + ∣11⟩)/√2 if risk_level == 1: self.circuit.x(self.qubits[indices[1]]) self.circuit.cx(self.qubits[indices[0]], self.qubits[indices[1]]) else: # Triple Entanglement with GHZ state for 3 qubits: # Lv2. (∣010⟩ + ∣101⟩)/√2 | Lv4. (∣000⟩ + ∣111⟩)/√2 if risk_level == 2: self.circuit.x(self.qubits[indices[1]]) self.circuit.x(self.qubits[indices[2]]) # Apply CNOT chain to entangle all 3 qubits self.circuit.cx(self.qubits[indices[0]], self.qubits[indices[1]]) self.circuit.cx(self.qubits[indices[1]], self.qubits[indices[2]]) for row, col in positions: self.cells[row][col] = player_mark + '?' self.superposition_count += pos_count return True def can_be_collapsed(self): # If superpositions/entanglement cells form a potential winning line => collapse for line in self.winning_lines: if all(self.cells[i // self.size][i % self.size].endswith('?') for i in line): return True return False def collapse_board(self): # Update the board based on the measurement results and apply the corresponding classical moves self.circuit.barrier() self.circuit.measure(self.qubits, self.bits) # Measure all qubits to collapse them to classical states transpiled_circuit = transpile(self.circuit, self.simulator) job = self.simulator.run(transpiled_circuit, memory=True) counts = job.result().get_counts() max_state = max(counts, key=counts.get)[::-1] # Get the state with the highest probability for i in range(self.size ** 2): row, col = divmod(i, self.size) if self.cells[row][col].endswith('?'): self.circuit.reset(self.qubits[i]) self.make_classical_move(row, col, 'X' if max_state[i] == '1' else 'O', is_collapsed=True) self.superposition_count = 0 return counts def check_win(self): # Dynamic implementation for above logic with dynamic winning lines for line in self.winning_lines: # Check if all cells in the line are the same and not empty first_cell = self.cells[line[0] // self.size][line[0] % self.size] if first_cell not in [' ', 'X?', 'O?']: is_same = all(self.cells[i // self.size][i % self.size] == first_cell for i in line) if is_same: return line # If no spaces and no superpositions left => 'Draw' # If all cells are filled but some are still in superpositions => collapse_board if all(self.cells[i // self.size][i % self.size] not in [' '] for i in range(self.size**2)): if self.superposition_count <= 0: return 'Draw' return self.superposition_count return None # @markdown ### **3. `QuantumT3Widgets` class for game interface** class QuantumT3Widgets(metaclass=ABCMeta): def __init__(self, board, current_player, quantum_move_mode): self.board = board self.current_player = current_player self.quantum_move_mode = quantum_move_mode self.log = Output(layout={'margin': '10px 0 0 0'}) self.histogram_output = Output(layout={'margin': '0 0 10px 10px'}) self.circuit_output = Output() self.create_widgets() def create_widgets(self): # Create widgets for each cell and controls for game actions self.buttons = [] for row in range(self.board.size): self.buttons.append([]) for col in range(self.board.size): button = Button( description = ' ', layout = {'width': '100px', 'height': '100px', 'border': '1px solid black'}, style = {'button_color': 'lightgray', 'font_weight': 'bold', 'text_color': 'white'} ) button.on_click(self.create_on_cell_clicked(row, col)) self.buttons[row].append(button) self.create_action_buttons() self.game_info = HTML(f'<b>Current Player: {self.current_player} / Quantum Mode: {self.quantum_move_mode}</b>') self.board_histogram_widget = HBox( [VBox([VBox([HBox(row) for row in self.buttons]), self.game_info]), self.histogram_output], layout = {'display': 'flex', 'justify_content': 'center', 'align_items': 'flex-end'} ) display(VBox([self.board_histogram_widget, self.action_buttons, self.log, self.circuit_output])) def create_action_buttons(self): self.reset_btn = Button(description='Reset', button_style='danger') self.collapse_btn = Button(description='Collapse', button_style='warning') self.classical_btn = Button(description='Classical Move', button_style='primary') self.swap_btn = Button(description='SWAP Move', button_style='info') self.superposition_btn = Button(description='Superposition', button_style='success') self.entangled_btn = Button(description='Entanglement', button_style='success') self.entangled_options = Dropdown(options=[ ('', 0), # Qubits collapse to opposite states (not consecutive) ('Lv1. PAIRWAISE: ∣Ψ+⟩ = (∣01⟩ + ∣10⟩) / √2', 1), # Qubits collapse to opposite states (not consecutive) ('Lv2. TRIPLE: GHZ_Xs = (∣010⟩ + ∣101⟩) / √2', 2), ('Lv3. PAIRWAISE: ∣Φ+⟩ = (∣00⟩ + ∣11⟩) / √2', 3), # Can form consecutive winning cells or accidentally help the opponent ('Lv4. TRIPLE: GHZ = (∣000⟩ + ∣111⟩) / √2', 4), ], value=0, disabled=True) self.entangled_options.observe(self.update_entangled_options, names='value') self.reset_btn.on_click(self.on_reset_btn_clicked) self.collapse_btn.on_click(self.on_collapse_btn_clicked) self.classical_btn.on_click(self.create_on_move_clicked('CLASSICAL')) self.swap_btn.on_click(self.create_on_move_clicked('SWAP', 'Select 2 cells to swap their states.')) self.superposition_btn.on_click(self.create_on_move_clicked('SUPERPOSITION', 'Select a cell to put in superposition.')) self.entangled_btn.on_click(self.create_on_move_clicked('ENTANGLED', 'Select 2/3 cells based on risk level to entangle.')) self.action_buttons = HBox([ self.reset_btn, self.collapse_btn, self.classical_btn, self.swap_btn, self.superposition_btn, self.entangled_btn, self.entangled_options ]) @abstractmethod # Pure virtual functions => Must be overridden in the derived classes def on_reset_btn_clicked(self, btn=None): raise NotImplementedError('on_reset_btn_clicked method is not implemented.') @abstractmethod # Pure virtual functions => Must be overridden in the derived classes def on_collapse_btn_clicked(self, btn=None): raise NotImplementedError('on_collapse_btn_clicked method is not implemented.') @abstractmethod # Pure virtual functions => Must be overridden in the derived classes def on_move_clicked(self, mode, message=''): raise NotImplementedError('on_move_clicked method is not implemented.') @abstractmethod # Pure virtual functions => Must be overridden in the derived classes def on_cell_clicked(self, btn, row, col): raise NotImplementedError('on_cell_clicked method is not implemented.') def update_entangled_options(self, change): with self.log: self.entangled_options.disabled = change.new != 0 for row in self.buttons: for button in row: button.disabled = change.new == 0 # Check if there are enough empty cells for the selected operation empty_count = sum(cell == ' ' for row in self.board.cells for cell in row) total_empty_required = {1: 2, 2: 3, 3: 2, 4: 3} # Total empty cells required for each risk level if change.new == 0: return elif empty_count < total_empty_required[change.new]: print(f'Not enough empty cells to perform entanglement with risk level {change.new}. Please select another.') self.entangled_options.value = 0 else: print(f'Risk Level {change.new} ACTIVATED =>', end=' ') if change.new in [1, 3]: print(f'Select 2 cells (qubits) for this PAIRWAISE entanglement.') else: print(f'Select 3 cells (qubits) for this TRIPLE entanglement.') def create_on_move_clicked(self, mode, message=''): def on_move_clicked(btn): with self.log: try: self.on_move_clicked(mode, message) except Exception as e: print(f'ERROR: {e}') return on_move_clicked def create_on_cell_clicked(self, row, col): def on_cell_clicked(btn): with self.log: try: self.on_cell_clicked(btn, row, col) except Exception as e: print(f'ERROR: {e}') return on_cell_clicked def display_circuit(self): with self.circuit_output: clear_output(wait=True) display(self.board.circuit.draw('mpl', fold=-1, initial_state=True)) def display_histogram(self, counts): with self.histogram_output: clear_output(wait=True) display(plot_histogram(counts, figsize=(9, 4))) # @markdown ### **4. `QuantumT3GUI` class for game flow and interaction between players and `Board`** class QuantumT3GUI(QuantumT3Widgets): def __init__(self, size=3, simulator=None): super().__init__(Board(size, simulator), 'X', 'CLASSICAL') self.quantum_moves_selected = [] # Selected cells for operation on multi-qubit gates self.game_over = False def buttons_disabled(self, is_disabled=True): for btn in self.action_buttons.children[1:]: btn.disabled = is_disabled for row in self.buttons: for btn in row: btn.disabled = is_disabled def update_entire_board(self): for row in range(self.board.size): for col in range(self.board.size): cell = self.board.cells[row][col] color_map = {'X': 'dodgerblue', 'O': 'purple', '?': 'green', ' ': 'lightgray'} self.buttons[row][col].description = cell if cell != ' ' else ' ' self.buttons[row][col].style.button_color = color_map[cell[-1]] def clean_incompleted_quantum_moves(self): for row, col in self.quantum_moves_selected: if self.board.cells[row][col] == ' ': self.buttons[row][col].description = ' ' self.buttons[row][col].style.button_color = 'lightgray' self.quantum_moves_selected = [] def on_reset_btn_clicked(self, btn=None): with self.log: clear_output(wait=True) self.board = Board(self.board.size, self.board.simulator) self.current_player = 'X' self.quantum_move_mode = 'CLASSICAL' self.quantum_moves_selected = [] self.game_info.value = f'<b>Current Player: {self.current_player} / Quantum Mode: {self.quantum_move_mode}</b>' self.game_over = False self.update_entire_board() self.buttons_disabled(False) self.entangled_options.disabled = True with self.histogram_output: clear_output() with self.circuit_output: clear_output() print('Game reset. New game started.') def on_collapse_btn_clicked(self, btn=None): with self.log: if self.quantum_moves_selected: print('Please complete the current quantum operation before measuring the board.') return clear_output(wait=True) counts = self.board.collapse_board() self.display_histogram(counts) self.update_entire_board() # Update the board cells with the collapsed states self.check_win() print('Board measured and quantum states collapsed.') def on_move_clicked(self, mode, message=''): clear_output(wait=True) self.quantum_move_mode = mode self.game_info.value = f'<b>Current Player: {self.current_player} / Quantum Mode: {self.quantum_move_mode}</b>' self.clean_incompleted_quantum_moves() for row in self.buttons: for button in row: button.disabled = mode == 'ENTANGLED' if mode == 'ENTANGLED': self.entangled_options.value = 0 self.entangled_options.disabled = mode != 'ENTANGLED' print(f'{mode} mode ACTIVATED' + (f': {message}' if message else '')) def on_cell_clicked(self, btn, row, col): if self.quantum_move_mode == 'CLASSICAL': if self.board.make_classical_move(row, col, self.current_player): btn.description = self.board.cells[row][col] btn.style.button_color = 'dodgerblue' if self.current_player == 'X' else 'purple' self.check_win() else: print('That position is already occupied. Please choose another.') elif self.quantum_move_mode == 'SUPERPOSITION': if self.board.cells[row][col] == ' ': btn.description = self.current_player + '?' btn.style.button_color = 'green' self.make_quantum_move_wrapper( pos=(row, col), board_func=self.board.make_superposition_move, success_msg='Cell is now in superposition state.') else: print('Invalid SUPERPOSITION move. Cell must be empty.') elif len(self.quantum_moves_selected) < 3: # Multi-qubit gates operation self.quantum_moves_selected.append((row, col)) # Store the selected cell of operation print(f'Cell ({row + 1}, {col + 1}) selected for {self.quantum_move_mode} move.') if self.quantum_move_mode == 'SWAP' and len(self.quantum_moves_selected) == 2: flat_pos = sum(self.quantum_moves_selected, ()) # Flatten the tuple to match 4 arguments in Board.make_swap_move pos1, pos2 = self.quantum_moves_selected self.make_quantum_move_wrapper( pos=flat_pos, board_func=self.board.make_swap_move, success_msg=f'SWAPPED Cell {pos1} to {pos2}', success_func=self.swap_on_board, failure_msg='Invalid SWAP move. Both cells must be non-empty.') elif self.quantum_move_mode == 'ENTANGLED': if self.board.cells[row][col] == ' ': btn.description = self.current_player + '?' btn.style.button_color = 'green' total_empty_required = {1: 2, 2: 3, 3: 2, 4: 3} # Total empty cells required for each risk level if len(self.quantum_moves_selected) == total_empty_required[self.entangled_options.value]: self.make_quantum_move_wrapper( pos=self.quantum_moves_selected, board_func=self.board.make_entangled_move, success_msg='These positions are now entangled and in a superposition state.', failure_msg='Invalid ENTANGLEMENT move. Duplicated cell selection.') else: clear_output(wait=True) print('Invalid ENTANGLEMENT move. A position is already occupied.') self.quantum_moves_selected.pop() # Remove the invalid cell from the selected list def swap_on_board(self): row1, col1 = self.quantum_moves_selected[0][0], self.quantum_moves_selected[0][1] row2, col2 = self.quantum_moves_selected[1][0], self.quantum_moves_selected[1][1] # Swap the description and color of the selected cells self.buttons[row1][col1].description, self.buttons[row2][col2].description = \ self.buttons[row2][col2].description, self.buttons[row1][col1].description self.buttons[row1][col1].style.button_color, self.buttons[row2][col2].style.button_color = \ self.buttons[row2][col2].style.button_color, self.buttons[row1][col1].style.button_color def make_quantum_move_wrapper(self, pos, board_func, success_msg='', success_func=None, failure_msg=''): if board_func(*pos, risk_level=self.entangled_options.value, player_mark=self.current_player): if success_msg: print(success_msg) if success_func: success_func() if self.board.can_be_collapsed(): print('Perform automatic board measurement and collapse the states.') self.quantum_moves_selected = [] self.on_collapse_btn_clicked() else: self.check_win() else: clear_output(wait=True) if failure_msg: print(failure_msg) self.clean_incompleted_quantum_moves() def check_win(self): self.quantum_moves_selected = [] while not self.game_over: # Check if the game is over after each move self.display_circuit() result = self.board.check_win() if result == 'Draw': # All cells are filled but no winner yet self.game_over = True print("Game Over. It's a draw!") elif type(result) == tuple: # A player wins self.game_over = True for cell_index in result: row, col = divmod(cell_index, self.board.size) self.buttons[row][col].style.button_color = 'orangered' print(f'Game Over. {self.board.cells[row][col]} wins!') elif type(result) == int: # All cells are filled but some are still in superpositions print(f'All cells are filled but {result} of them still in superpositions => Keep Collapsing...') self.quantum_moves_selected = [] self.on_collapse_btn_clicked() # Automatically collapse the board break else: # Switch players if no winner yet then continue the game self.current_player = 'O' if self.current_player == 'X' else 'X' # Switch players self.game_info.value = f'<b>Current Player: {self.current_player} / Quantum Mode: {self.quantum_move_mode}</b>' break if self.game_over: self.buttons_disabled(True) game = QuantumT3GUI(size=3, simulator=AerSimulator())
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import Aer, IBMQ import getpass, random, numpy, math def title_screen (): print("\n\n\n\n\n\n\n\n") print(" ██████╗ ██╗ ██╗ █████╗ ███╗ ██╗████████╗██╗ ██╗███╗ ███╗ ") print(" ██╔═══██╗██║ ██║██╔══██╗████╗ ██║╚══██╔══╝██║ ██║████╗ ████║ ") print(" ██║ ██║██║ ██║███████║██╔██╗ ██║ ██║ ██║ ██║██╔████╔██║ ") print(" ██║▄▄ ██║██║ ██║██╔══██║██║╚██╗██║ ██║ ██║ ██║██║╚██╔╝██║ ") print(" ╚██████╔╝╚██████╔╝██║ ██║██║ ╚████║ ██║ ╚██████╔╝██║ ╚═╝ ██║ ") print(" ╚══▀▀═╝ ╚═════╝ ╚═╝ ╚═╝╚═╝ ╚═══╝ ╚═╝ ╚═════╝ ╚═╝ ╚═╝ ") print("") print(" ██████╗ █████╗ ████████╗████████╗██╗ ███████╗███████╗██╗ ██╗██╗██████╗ ███████╗") print(" ██╔══██╗██╔══██╗╚══██╔══╝╚══██╔══╝██║ ██╔════╝██╔════╝██║ ██║██║██╔══██╗██╔════╝") print(" ██████╔╝███████║ ██║ ██║ ██║ █████╗ ███████╗███████║██║██████╔╝███████╗") print(" ██╔══██╗██╔══██║ ██║ ██║ ██║ ██╔══╝ ╚════██║██╔══██║██║██╔═══╝ ╚════██║") print(" ██████╔╝██║ ██║ ██║ ██║ ███████╗███████╗███████║██║ ██║██║██║ ███████║") print(" ╚═════╝ ╚═╝ ╚═╝ ╚═╝ ╚═╝ ╚══════╝╚══════╝╚══════╝╚═╝ ╚═╝╚═╝╚═╝ ╚══════╝") print("") print(" ___ ___ _ _ ") print(" | _ ) _ _ | \ ___ __ ___ __| | ___ | |__ _ _ ") print(" | _ \| || | | |) |/ -_)/ _|/ _ \/ _` |/ _ \| / /| || |") print(" |___/ \_, | |___/ \___|\__|\___/\__,_|\___/|_\_\ \_,_|") print(" |__/ ") print("") print(" A game played on a real quantum computer!") print("") print("") randPlace = input("> Press Enter to play...\n").upper() def ask_for_device (): d = input("Do you want to play on the real device? (y/n)\n").upper() if (d=="Y"): device = IBMQ.get_backend('ibmq_5_tenerife') # if real, we use ibmqx4 else: device = Aer.get_backend('qasm_simulator') # otherwise, we use a simulator return device def ask_for_ships (): # we'll start with a 'press enter to continue' type command. But it hides a secret! If you input 'R', the positions will be chosen randomly randPlace = input("> Press Enter to start placing ships...\n").upper() # The variable ship[X][Y] will hold the position of the Yth ship of player X+1 shipPos = [ [-1]*3 for _ in range(2)] # all values are initialized to the impossible position -1| # loop over both players and all three ships for each for player in [0,1]: # if we chose to bypass player choice and do random, we do that if randPlace=="R": randPos = random.sample(range(5), 3) for ship in [0,1,2]: shipPos[player][ship] = randPos[ship] #print(randPos) #uncomment if you want a sneaky peek at where the ships are else: for ship in [0,1,2]: # ask for a position for each ship, and keep asking until a valid answer is given choosing = True while (choosing): # get player input position = getpass.getpass("Player " + str(player+1) + ", choose a position for ship " + str(ship+1) + " (0, 1, 2, 3 or 4)\n" ) # see if the input is valid and ask for another if not if position.isdigit(): # valid answers have to be integers position = int(position) if (position in [0,1,2,3,4]) and (not position in shipPos[player]): # they need to be between 0 and 5, and not used for another ship of the same player shipPos[player][ship] = position choosing = False print ("\n") elif position in shipPos[player]: print("\nYou already have a ship there. Try again.\n") else: print("\nThat's not a valid position. Try again.\n") else: print("\nThat's not a valid position. Try again.\n") return shipPos def ask_for_bombs ( bomb ): input("> Press Enter to place some bombs...\n") # ask both players where they want to bomb for player in range(2): print("\n\nIt's now Player " + str(player+1) + "'s turn.\n") # keep asking until a valid answer is given choosing = True while (choosing): # get player input position = input("Choose a position to bomb (0, 1, 2, 3 or 4)\n") # see if this is a valid input. ask for another if not if position.isdigit(): # valid answers have to be integers position = int(position) if position in range(5): # they need to be between 0 and 5, and not used for another ship of the same player bomb[player][position] = bomb[player][position] + 1 choosing = False print ("\n") else: print("\nThat's not a valid position. Try again.\n") else: print("\nThat's not a valid position. Try again.\n") return bomb def display_grid ( grid, shipPos, shots ): # since this function has been called, the game must still be on game = True # look at the damage on all qubits (we'll even do ones with no ships) damage = [ [0]*5 for _ in range(2)] # this will hold the prob of a 1 for each qubit for each player # for this we loop over all strings of 5 bits for each player for player in range(2): for bitString in grid[player].keys(): # and then over all positions for position in range(5): # if the string has a 1 at that position, we add a contribution to the damage # remember that the bit for position 0 is the rightmost one, and so at bitString[4] if (bitString[4-position]=="1"): damage[player][position] += grid[player][bitString]/shots # give results to players for player in [0,1]: input("\nPress Enter to see the results for Player " + str(player+1) + "'s ships...\n") # report damage for qubits that are ships, and which have significant damage # ideally this would be non-zero damage, but noise means it can happen for ships that haven't been hit # so we choose 5% as the threshold display = [" ? "]*5 # loop over all qubits that are ships for position in shipPos[player]: # if the damage is high enough, display the damage if ( damage[player][position] > 0.1 ): if (damage[player][position]>0.9): display[position] = "100%" else: display[position] = str(int( 100*damage[player][position] )) + "% " #print(position,damage[player][position]) print("Here is the percentage damage for ships that have been bombed.\n") print(display[ 4 ] + " " + display[ 0 ]) print(" |\ /|") print(" | \ / |") print(" | \ / |") print(" | " + display[ 2 ] + " |") print(" | / \ |") print(" | / \ |") print(" |/ \|") print(display[ 3 ] + " " + display[ 1 ]) print("\n") print("Ships with 95% damage or more have been destroyed\n") print("\n") # if a player has all their ships destroyed, the game is over # ideally this would mean 100% damage, but we go for 95% because of noise again if (damage[player][ shipPos[player][0] ]>.9) and (damage[player][ shipPos[player][1] ]>.9) and (damage[player][ shipPos[player][2] ]>.9): print ("***All Player " + str(player+1) + "'s ships have been destroyed!***\n\n") game = False if (game is False): print("") print("=====================================GAME OVER=====================================") print("") return game
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# -*- coding: utf-8 -*- """Additional composite gates used in quantum tic tac toe""" import numpy as np def x_bus(qc,*bus): """Negates a whole bus""" for q in bus: qc.x(q) def bus_or(qc,target,*busses): """Negates target if any of input busses is totally true, can add overall phase. Page 16 of reference""" if len(busses)==1: qc.cnx(qc,*busses[0],target) elif len(busses) == 2: #negate everything qc.x_bus(qc,*busses[0],*busses[1],target) qc.ry(np.pi/4,target) qc.any_x(qc,*busses[1],target) qc.ry(np.pi/4,target) qc.any_x(qc,*busses[0],target) qc.ry(-np.pi/4,target) qc.any_x(qc,*busses[1],target) qc.ry(-np.pi/4,target) qc.x_bus(qc,*busses[0],*busses[1]) elif len(busses) >= 3: #Need to negate all qubits, do so for each bus for bus in busses: qc.x_bus(qc,*bus) #Then negate the target also qc.x(target) qc.ry(np.pi/4,target) qc.any_x(qc,*busses[1],target) qc.ry(np.pi/4,target) #Recursiveness here: qc.bus_or(qc,target,*busses[:-1]) qc.ry(-np.pi/4,target) qc.any_x(qc,*busses[1],target) qc.ry(-np.pi/4,target) for bus in busses: qc.x_bus(qc,*bus) #No need to negate target again def any_x(qc,*qubits): """Negate last qubit if any of initial qubits are 1.""" qc.x_bus(qc,*qubits) qc.cnx(qc,*qubits) qc.x_bus(qc,*qubits[:-1]) def cry(qc,theta,q1,q2): """Controlled ry""" qc.ry(theta/2,q2) qc.cx(q1,q2) qc.ry(-theta/2,q2) qc.cx(q1,q2) def cnx(qc,*qubits): """Control n-1 qubits, apply 'not' to last one Follows: @article{PhysRevA.52.3457, title = {Elementary gates for quantum computation}, author = {Barenco, Adriano and Bennett, Charles H. and Cleve, Richard and DiVincenzo, David P. and Margolus, Norman and Shor, Peter and Sleator, Tycho and Smolin, John A. and Weinfurter, Harald}, doi = {10.1103/PhysRevA.52.3457}, url = {https://link.aps.org/doi/10.1103/PhysRevA.52.3457} } Follwing Lemma 7.9, which uses Lemma 5.1 and 4.3 """ if len(qubits) >= 3: last = qubits[-1] #A matrix: (made up of a and Y rotation, lemma4.3) qc.crz(np.pi/2,qubits[-2],qubits[-1]) #cry qc.cry(qc,np.pi/2,qubits[-2],qubits[-1]) #Control not gate qc.cnx(qc,*qubits[:-2],qubits[-1]) #B matrix (cry again, but opposite angle) qc.cry(qc,-np.pi/2,qubits[-2],qubits[-1]) #Control qc.cnx(qc,*qubits[:-2],qubits[-1]) #C matrix (final rotation) qc.crz(-np.pi/2,qubits[-2],qubits[-1]) elif len(qubits)==3: qc.ccx(*qubits) elif len(qubits)==2: qc.cx(*qubits) if __name__ == "__main__": from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit import CompositeGate, available_backends, execute q = QuantumRegister(5, "qr") q2 = QuantumRegister(1, "qr") print(len(q2)) c = ClassicalRegister(5, "cr") qc = QuantumCircuit(q, c) qc.cry = cry qc.cnx = cnx qc.any_x = any_x qc.x_bus = x_bus qc.bus_or = bus_or #qc.h(q[0]) qc.h(q[1]) qc.h(q[2]) qc.h(q[3]) qc.h(q[-1]) qc.bus_or(qc,q[0],[q[1],q[2],q[3]],[q[4]]) qc.measure(q,c) job_sim = execute(qc, "local_qasm_simulator",shots=100) sim_result = job_sim.result() # Show the results print("simulation: ", sim_result) print(sim_result.get_counts(qc)) print(qc.qasm())
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import IBMQ from qiskit import BasicAer as Aer from qiskit import ClassicalRegister, QuantumRegister, QuantumCircuit from qiskit import execute import numpy as np import matplotlib.pyplot as plt from matplotlib.patches import Circle, Rectangle import copy from ipywidgets import widgets from IPython.display import display, clear_output try: IBMQ.load_accounts() except: pass class run_game(): # Implements a puzzle, which is defined by the given inputs. def __init__(self,initialize, success_condition, allowed_gates, vi, qubit_names, eps=0.1, backend=Aer.get_backend('qasm_simulator'), shots=1024,mode='circle',verbose=False): """ initialize List of gates applied to the initial 00 state to get the starting state of the puzzle. Supported single qubit gates (applied to qubit '0' or '1') are 'x', 'y', 'z', 'h', 'ry(pi/4)'. Supported two qubit gates are 'cz' and 'cx'. Specify only the target qubit. success_condition Values for pauli observables that must be obtained for the puzzle to declare success. allowed_gates For each qubit, specify which operations are allowed in this puzzle. 'both' should be used only for operations that don't need a qubit to be specified ('cz' and 'unbloch'). Gates are expressed as a dict with an int as value. If this is non-zero, it specifies the number of times the gate is must be used (no more or less) for the puzzle to be successfully solved. If the value is zero, the player can use the gate any number of times. vi Some visualization information as a three element list. These specify: * which qubits are hidden (empty list if both shown). * whether both circles shown for each qubit (use True for qubit puzzles and False for bit puzzles). * whether the correlation circles (the four in the middle) are shown. qubit_names The two qubits are always called '0' and '1' from the programming side. But for the player, we can display different names. eps=0.1 How close the expectation values need to be to the targets for success to be declared. backend=Aer.get_backend('qasm_simulator') Backend to be used by Qiskit to calculate expectation values (defaults to local simulator). shots=1024 Number of shots used to to calculate expectation values. mode='circle' Either the standard 'Hello Quantum' visualization can be used (with mode='circle') or the alternative line based one (mode='line'). verbose=False """ def get_total_gate_list(): # Get a text block describing allowed gates. total_gate_list = "" for qubit in allowed_gates: gate_list = "" for gate in allowed_gates[qubit]: if required_gates[qubit][gate] > 0 : gate_list += ' ' + gate+" (use "+str(required_gates[qubit][gate])+" time"+"s"*(required_gates[qubit][gate]>1)+")" elif allowed_gates[qubit][gate]==0: gate_list += ' '+gate + ' ' if gate_list!="": if qubit=="both" : gate_list = "\nAllowed symmetric operations:" + gate_list else : gate_list = "\nAllowed operations for " + qubit_names[qubit] + ":\n" + " "*10 + gate_list total_gate_list += gate_list +"\n" return total_gate_list def get_success(required_gates): # Determine whether the success conditions are satisfied, both for expectation values, and the number of gates to be used. success = True grid.get_rho() if verbose: print(grid.rho) for pauli in success_condition: success = success and (abs(success_condition[pauli] - grid.rho[pauli])<eps) for qubit in required_gates: for gate in required_gates[qubit]: success = success and (required_gates[qubit][gate]==0) return success def get_command(gate,qubit): # For a given gate and qubit, return the string describing the corresoinding Qiskit string. if qubit=='both': qubit = '1' qubit_name = qubit_names[qubit] for name in qubit_names.values(): if name!=qubit_name: other_name = name # then make the command (both for the grid, and for printing to screen) if gate in ['x','y','z','h']: real_command = 'grid.qc.'+gate+'(grid.qr['+qubit+'])' clean_command = 'qc.'+gate+'('+qubit_name+')' elif gate in ['ry(pi/4)','ry(-pi/4)']: real_command = 'grid.qc.ry('+'-'*(gate=='ry(-pi/4)')+'np.pi/4,grid.qr['+qubit+'])' clean_command = 'qc.ry('+'-'*(gate=='ry(-pi/4)')+'np.pi/4,'+qubit_name+')' elif gate in ['cz','cx','swap']: real_command = 'grid.qc.'+gate+'(grid.qr['+'0'*(qubit=='1')+'1'*(qubit=='0')+'],grid.qr['+qubit+'])' clean_command = 'qc.'+gate+'('+other_name+','+qubit_name+')' return [real_command,clean_command] clear_output() bloch = [None] # set up initial state and figure grid = pauli_grid(backend=backend,shots=shots,mode=mode) for gate in initialize: eval( get_command(gate[0],gate[1])[0] ) required_gates = copy.deepcopy(allowed_gates) # determine which qubits to show in figure if allowed_gates['0']=={} : # if no gates are allowed for qubit 0, we know to only show qubit 1 shown_qubit = 1 elif allowed_gates['1']=={} : # and vice versa shown_qubit = 0 else : shown_qubit = 2 # show figure grid.update_grid(bloch=bloch[0],hidden=vi[0],qubit=vi[1],corr=vi[2],message=get_total_gate_list()) description = {'gate':['Choose gate'],'qubit':['Choose '+'qu'*vi[1]+'bit'],'action':['Make it happen!']} all_allowed_gates_raw = [] for q in ['0','1','both']: all_allowed_gates_raw += list(allowed_gates[q]) all_allowed_gates_raw = list(set(all_allowed_gates_raw)) all_allowed_gates = [] for g in ['bloch','unbloch']: if g in all_allowed_gates_raw: all_allowed_gates.append( g ) for g in ['x','y','z','h','cz','cx']: if g in all_allowed_gates_raw: all_allowed_gates.append( g ) for g in all_allowed_gates_raw: if g not in all_allowed_gates: all_allowed_gates.append( g ) gate = widgets.ToggleButtons(options=description['gate']+all_allowed_gates) qubit = widgets.ToggleButtons(options=['']) action = widgets.ToggleButtons(options=['']) boxes = widgets.VBox([gate,qubit,action]) display(boxes) if vi[1]: print('\nYour quantum program so far\n') self.program = [] def given_gate(a): # Action to be taken when gate is chosen. This sets up the system to choose a qubit. if gate.value: if gate.value in allowed_gates['both']: qubit.options = description['qubit'] + ["not required"] qubit.value = "not required" else: allowed_qubits = [] for q in ['0','1']: if (gate.value in allowed_gates[q]) or (gate.value in allowed_gates['both']): allowed_qubits.append(q) allowed_qubit_names = [] for q in allowed_qubits: allowed_qubit_names += [qubit_names[q]] qubit.options = description['qubit'] + allowed_qubit_names def given_qubit(b): # Action to be taken when qubit is chosen. This sets up the system to choose an action. if qubit.value not in ['',description['qubit'][0],'Success!']: action.options = description['action']+['Apply operation'] def given_action(c): # Action to be taken when user confirms their choice of gate and qubit. # This applied the command, updates the visualization and checks whether the puzzle is solved. if action.value not in ['',description['action'][0]]: # apply operation if action.value=='Apply operation': if qubit.value not in ['',description['qubit'][0],'Success!']: # translate bit gates to qubit gates if gate.value=='NOT': q_gate = 'x' elif gate.value=='CNOT': q_gate = 'cx' else: q_gate = gate.value if qubit.value=="not required": q = qubit_names['1'] else: q = qubit.value q01 = '0'*(qubit.value==qubit_names['0']) + '1'*(qubit.value==qubit_names['1']) + 'both'*(qubit.value=="not required") if q_gate in ['bloch','unbloch']: if q_gate=='bloch': bloch[0] = q01 else: bloch[0] = None else: command = get_command(q_gate,q01) eval(command[0]) if vi[1]: print(command[1]) self.program.append( command[1] ) if required_gates[q01][gate.value]>0: required_gates[q01][gate.value] -= 1 grid.update_grid(bloch=bloch[0],hidden=vi[0],qubit=vi[1],corr=vi[2],message=get_total_gate_list()) success = get_success(required_gates) if success: gate.options = ['Success!'] qubit.options = ['Success!'] action.options = ['Success!'] plt.close(grid.fig) else: gate.value = description['gate'][0] qubit.options = [''] action.options = [''] gate.observe(given_gate) qubit.observe(given_qubit) action.observe(given_action) class pauli_grid(): # Allows a quantum circuit to be created, modified and implemented, and visualizes the output in the style of 'Hello Quantum'. def __init__(self,backend=Aer.get_backend('qasm_simulator'),shots=1024,mode='circle'): """ backend=Aer.get_backend('qasm_simulator') Backend to be used by Qiskit to calculate expectation values (defaults to local simulator). shots=1024 Number of shots used to to calculate expectation values. mode='circle' Either the standard 'Hello Quantum' visualization can be used (with mode='circle') or the alternative line based one (mode='line'). """ self.backend = backend self.shots = shots self.box = {'ZI':(-1, 2),'XI':(-2, 3),'IZ':( 1, 2),'IX':( 2, 3),'ZZ':( 0, 3),'ZX':( 1, 4),'XZ':(-1, 4),'XX':( 0, 5)} self.rho = {} for pauli in self.box: self.rho[pauli] = 0.0 for pauli in ['ZI','IZ','ZZ']: self.rho[pauli] = 1.0 self.qr = QuantumRegister(2) self.cr = ClassicalRegister(2) self.qc = QuantumCircuit(self.qr, self.cr) self.mode = mode # colors are background, qubit circles and correlation circles, respectively if self.mode=='line': self.colors = [(1.6/255,72/255,138/255),(132/255,177/255,236/255),(33/255,114/255,216/255)] else: self.colors = [(1.6/255,72/255,138/255),(132/255,177/255,236/255),(33/255,114/255,216/255)] self.fig = plt.figure(figsize=(5,5),facecolor=self.colors[0]) self.ax = self.fig.add_subplot(111) plt.axis('off') self.bottom = self.ax.text(-3,1,"",size=9,va='top',color='w') self.lines = {} for pauli in self.box: w = plt.plot( [self.box[pauli][0],self.box[pauli][0]], [self.box[pauli][1],self.box[pauli][1]], color=(1.0,1.0,1.0), lw=0 ) b = plt.plot( [self.box[pauli][0],self.box[pauli][0]], [self.box[pauli][1],self.box[pauli][1]], color=(0.0,0.0,0.0), lw=0 ) c = {} c['w'] = self.ax.add_patch( Circle(self.box[pauli], 0.0, color=(0,0,0), zorder=10) ) c['b'] = self.ax.add_patch( Circle(self.box[pauli], 0.0, color=(1,1,1), zorder=10) ) self.lines[pauli] = {'w':w,'b':b,'c':c} def get_rho(self): # Runs the circuit specified by self.qc and determines the expectation values for 'ZI', 'IZ', 'ZZ', 'XI', 'IX', 'XX', 'ZX' and 'XZ'. bases = ['ZZ','ZX','XZ','XX'] results = {} for basis in bases: temp_qc = copy.deepcopy(self.qc) for j in range(2): if basis[j]=='X': temp_qc.h(self.qr[j]) temp_qc.barrier(self.qr) temp_qc.measure(self.qr,self.cr) job = execute(temp_qc, backend=self.backend, shots=self.shots) results[basis] = job.result().get_counts() for string in results[basis]: results[basis][string] = results[basis][string]/self.shots prob = {} # prob of expectation value -1 for single qubit observables for j in range(2): for p in ['X','Z']: pauli = {} for pp in 'IXZ': pauli[pp] = (j==1)*pp + p + (j==0)*pp prob[pauli['I']] = 0 for basis in [pauli['X'],pauli['Z']]: for string in results[basis]: if string[(j+1)%2]=='1': prob[pauli['I']] += results[basis][string]/2 # prob of expectation value -1 for two qubit observables for basis in ['ZZ','ZX','XZ','XX']: prob[basis] = 0 for string in results[basis]: if string[0]!=string[1]: prob[basis] += results[basis][string] for pauli in prob: self.rho[pauli] = 1-2*prob[pauli] def update_grid(self,rho=None,labels=False,bloch=None,hidden=[],qubit=True,corr=True,message=""): """ rho = None Dictionary of expectation values for 'ZI', 'IZ', 'ZZ', 'XI', 'IX', 'XX', 'ZX' and 'XZ'. If supplied, this will be visualized instead of the results of running self.qc. labels = None Dictionary of strings for 'ZI', 'IZ', 'ZZ', 'XI', 'IX', 'XX', 'ZX' and 'XZ' that are printed in the corresponding boxes. bloch = None If a qubit name is supplied, and if mode='line', Bloch circles are displayed for this qubit hidden = [] Which qubits have their circles hidden (empty list if both shown). qubit = True Whether both circles shown for each qubit (use True for qubit puzzles and False for bit puzzles). corr = True Whether the correlation circles (the four in the middle) are shown. message A string of text that is displayed below the grid. """ def see_if_unhidden(pauli): # For a given Pauli, see whether its circle should be shown. unhidden = True # first: does it act non-trivially on a qubit in `hidden` for j in hidden: unhidden = unhidden and (pauli[j]=='I') # second: does it contain something other than 'I' or 'Z' when only bits are shown if qubit==False: for j in range(2): unhidden = unhidden and (pauli[j] in ['I','Z']) # third: is it a correlation pauli when these are not allowed if corr==False: unhidden = unhidden and ((pauli[0]=='I') or (pauli[1]=='I')) return unhidden def add_line(line,pauli_pos,pauli): """ For mode='line', add in the line. line = the type of line to be drawn (X, Z or the other one) pauli = the box where the line is to be drawn expect = the expectation value that determines its length """ unhidden = see_if_unhidden(pauli) coord = None p = (1-self.rho[pauli])/2 # prob of 1 output # in the following, white lines goes from a to b, and black from b to c if unhidden: if line=='Z': a = ( self.box[pauli_pos][0], self.box[pauli_pos][1]+l/2 ) c = ( self.box[pauli_pos][0], self.box[pauli_pos][1]-l/2 ) b = ( (1-p)*a[0] + p*c[0] , (1-p)*a[1] + p*c[1] ) lw = 8 coord = (b[1] - (a[1]+c[1])/2)*1.2 + (a[1]+c[1])/2 elif line=='X': a = ( self.box[pauli_pos][0]+l/2, self.box[pauli_pos][1] ) c = ( self.box[pauli_pos][0]-l/2, self.box[pauli_pos][1] ) b = ( (1-p)*a[0] + p*c[0] , (1-p)*a[1] + p*c[1] ) lw = 9 coord = (b[0] - (a[0]+c[0])/2)*1.1 + (a[0]+c[0])/2 else: a = ( self.box[pauli_pos][0]+l/(2*np.sqrt(2)), self.box[pauli_pos][1]+l/(2*np.sqrt(2)) ) c = ( self.box[pauli_pos][0]-l/(2*np.sqrt(2)), self.box[pauli_pos][1]-l/(2*np.sqrt(2)) ) b = ( (1-p)*a[0] + p*c[0] , (1-p)*a[1] + p*c[1] ) lw = 9 self.lines[pauli]['w'].pop(0).remove() self.lines[pauli]['b'].pop(0).remove() self.lines[pauli]['w'] = plt.plot( [a[0],b[0]], [a[1],b[1]], color=(1.0,1.0,1.0), lw=lw ) self.lines[pauli]['b'] = plt.plot( [b[0],c[0]], [b[1],c[1]], color=(0.0,0.0,0.0), lw=lw ) return coord l = 0.9 # line length r = 0.6 # circle radius L = 0.98*np.sqrt(2) # box height and width if rho==None: self.get_rho() # draw boxes for pauli in self.box: if 'I' in pauli: color = self.colors[1] else: color = self.colors[2] self.ax.add_patch( Rectangle( (self.box[pauli][0],self.box[pauli][1]-1), L, L, angle=45, color=color) ) # draw circles for pauli in self.box: unhidden = see_if_unhidden(pauli) if unhidden: if self.mode=='line': self.ax.add_patch( Circle(self.box[pauli], r, color=(0.5,0.5,0.5)) ) else: prob = (1-self.rho[pauli])/2 self.ax.add_patch( Circle(self.box[pauli], r, color=(prob,prob,prob)) ) # update bars if required if self.mode=='line': if bloch in ['0','1']: for other in 'IXZ': px = other*(bloch=='1') + 'X' + other*(bloch=='0') pz = other*(bloch=='1') + 'Z' + other*(bloch=='0') z_coord = add_line('Z',pz,pz) x_coord = add_line('X',pz,px) for j in self.lines[pz]['c']: self.lines[pz]['c'][j].center = (x_coord,z_coord) self.lines[pz]['c'][j].radius = (j=='w')*0.05 + (j=='b')*0.04 px = 'I'*(bloch=='0') + 'X' + 'I'*(bloch=='1') pz = 'I'*(bloch=='0') + 'Z' + 'I'*(bloch=='1') add_line('Z',pz,pz) add_line('X',px,px) else: for pauli in self.box: for j in self.lines[pauli]['c']: self.lines[pauli]['c'][j].radius = 0.0 if pauli in ['ZI','IZ','ZZ']: add_line('Z',pauli,pauli) if pauli in ['XI','IX','XX']: add_line('X',pauli,pauli) if pauli in ['XZ','ZX']: add_line('ZX',pauli,pauli) self.bottom.set_text(message) if labels: for pauli in box: plt.text(self.box[pauli][0]-0.05,self.box[pauli][1]-0.85, pauli) self.ax.set_xlim([-3,3]) self.ax.set_ylim([0,6]) self.fig.canvas.draw()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
%matplotlib notebook import hello_quantum grid = hello_quantum.pauli_grid() grid.update_grid() for gate in [['x','1'],['h','0'],['z','0'],['h','1'],['z','1']]: command = 'grid.qc.'+gate[0]+'(grid.qr['+gate[1]+'])' eval(command) grid.update_grid() grid = hello_quantum.pauli_grid(mode='line') grid.update_grid() initialize = [['x', '0'],['cx', '1']] success_condition = {'IZ': 1.0} allowed_gates = {'0': {'h':0}, '1': {'h':0}, 'both': {'cz': 1}} vi = [[], True, True] qubit_names = {'0':'qubit 0', '1':'qubit 1'} puzzle = hello_quantum.run_game(initialize, success_condition, allowed_gates, vi, qubit_names)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
"""A quantum tic tac toe running in command line""" from qiskit import Aer from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import CompositeGate from qiskit import execute import numpy as np from composite_gates import cry,cnx,any_x,bus_or,x_bus class Move(): def __init__(self,indices,player,q1=None,q2=None): """A data structure for game moves""" self.indices = indices self.player=player self.q1=q1 self.q2=q2 def __str__(self): return str([self.indices,self.player,self.q1,self.q2]) class Board(): def __init__(self,x,y,print_info=False): #quantum register, classical register, quantum circuit. self.print_info=print_info self.q = QuantumRegister(1) self.c = ClassicalRegister(1) self.qc = QuantumCircuit(self.q, self.c) self.qc.cry = cry self.qc.x_bus = x_bus self.qc.cnx = cnx self.qc.any_x = any_x self.qc.bus_or = bus_or #the dimensions of the bord self.x=x self.y=y #To keep track of what is in each cell, no entanglement etc. #Provides a graphic of the game state. self.cells = np.empty((x,y),dtype=object) self.cells[:]='' #Initially game is empty. self.game_full = False self.moves = [] def __str__(self): return str(self.cells) def add_move(self,indices,player): """Adds a move if it is non-clashing, otherwise passes it on""" for index in indices: if index[0] >= self.x: return 'Index out of range' if index[1] >= self.y: return 'Index out of range' status = self._add_move(indices,player) if status=='ok': if player==0: char = 'X' elif player==1: char = 'O' char+=str(len(self.moves)) for index in indices: s = self.cells[index[0],index[1]] if s: #If the cell has some text #Add char with a comma self.cells[index[0],index[1]]+=' '+char else: #cell is empty so just add char self.cells[index[0],index[1]]+=char print(self.cells) return status def _add_move(self,indices,player): """Actually adds the move if not clashing, otherwise passes it to _add_clashing_move""" if len(indices)==2: if indices[0]==indices[1]: indices = [indices[0]] num=len(indices) caught_clashes = False #turns true if all moves are safe clashes for existing_move in self.moves: for index in indices: if index in existing_move.indices: if len(existing_move.indices)==1: return 'overfull' #This move will ALWAYS be there, if it can. #hence, overfull. else: #captures any clash caught_clashes = True if caught_clashes: return self._add_clashing_move(indices,player) else: #Reach this section if there are no clashes at all if num==1: self.moves.append(Move(indices,player)) #No control needed return 'ok' else: self.q.size+=2 #indicator qubit, and move qubit q1 = self.q[self.q.size-2] #To make this readable... q2 = self.q[self.q.size-1] self.qc.h(q1) #the last qubit in register. self.qc.x(q2) self.qc.cx(q1,q2) self.moves.append(Move(indices,player,q1,q2)) return 'ok' def _add_clashing_move(self,indices,player): """Adds a clashing move""" if len(indices)==1: #100% of qubit is on one clashing spot. #This spot COULD be occupied. self.q.size+=1 #Only one bit needed, move happens or not. index = indices[0] bus = [] for existing_move in self.moves: if index in existing_move.indices: if index==existing_move.indices[0]: bus.append(existing_move.q1) elif index==existing_move.indices[1]: bus.append(existing_move.q2) #Now if any entry on the bus is true, our qubit is false. self.qc.x(self.q[self.q.size-1]) # make it 1 self.qc.any_x(self.qc,*bus,self.q[self.q.size-1]) #negate is any dependents are true. #So the new move can happen if none of the others happen. self.moves.append(Move(indices,player,self.q[self.q.size-1])) return 'ok' elif len(indices)==2: #Check first spot is not occupied, then second spot if first #is not occupied. self.q.size+=2 #Two bits needed (maybe) for each index. #This can be optimized, in effect only one qubit is needed, #and its result indicates the selected qubit. #However, then some control qubit is needed too. #Since there are moves that could possibly be erased completely! bus0 = [] bus1 = [] for existing_move in self.moves: if indices[0] in existing_move.indices: if indices[0]==existing_move.indices[0]: bus0.append(existing_move.q1) elif indices[0]==existing_move.indices[1]: bus0.append(existing_move.q2) if indices[1] in existing_move.indices: if indices[1]==existing_move.indices[0]: bus1.append(existing_move.q1) elif indices[1]==existing_move.indices[1]: bus1.append(existing_move.q2) #Now if any entry on the bus is true, our first qubit is false. q1 = self.q[self.q.size-2] #a bit easier to look at (: q2 = self.q[self.q.size-1] if bus0: self.qc.x(q1) self.qc.cnx(self.qc,*bus0,q1) else: self.qc.h(q1) #And now the second qubit is 1 only if none of its competitors #are 1, and likewise if the previous qubit is zero. self.qc.x(q2) self.qc.bus_or(self.qc,q2,bus1,[q1]) self.moves.append(Move(indices,player,q1,q2)) return 'ok' def run(self): """Game loop""" self.running=True if self.print_info: print("Welcome to Quantum tic tac toe!") print("At each turn choose if to make one or two moves.") print("Playing one move at a time is a classic tic tac toe game.") print("At each turn the game state is printed.") print("This constitutes a 3x3 grid (standard game!).") print("You will see empty cells if no move was made on that part of the board.") print("Moves made by X are marked with Xi, 'i' some number.") print("e.g. X3 is the third move, played by X. When a move is made in a super position,") print("You will see its label, say X3, appear in several places.") print("This means your move is in a superposition of two classical moves!") print("A superposition of classical moves does not guarantee that a spot is occupied,") print("so other players can attempt to occupy it too.") print("Then the new move will be anti-correlated with the move already in that spot.") print("And so the game branches out into many simultaneous states.") print("The outcome is then computed by simulation...") print("so don't make too many quantum moves or it will take long to compute!") print("Enter 'q' at any time to quit") print("Enter 'end' to end the game, and compute the winner(s).") print("Good luck!") while self.running: self.ask_player(0) self.ask_player(1) if self.game_full: self.compute_winner() def ask_player(self,player): """Ask a player for move details""" asking=False if self.running: asking = True while asking: if player==0: player_name = 'X' elif player==1: player_name = 'O' print("PLAYER "+player_name+" :") cells = self.question('Play in 1 or 2 cells?') if cells=='1': x = int(self.question('x index:')) y = int(self.question('y index:')) status = self.add_move([[y,x]],player) if status == 'ok': asking = False else: print(status) elif cells=='2': x1 = int(self.question('x1 index:')) y1 = int(self.question('y1 index:')) x2 = int(self.question('x2 index:')) y2 = int(self.question('y2 index:')) status = self.add_move([[y1,x1],[y2,x2]],player) if status == 'ok': asking = False else: print(status) if not self.running: asking=False def question(self,text): """ask user a question""" if self.running: answer = input(text) if answer=='q': self.running=False return None elif answer=='end': self.game_full = True self.running = False else: return answer else: return None def compute_winner(self): """Find overall game winner, by finding winners of each outcome""" self.c.size = self.q.size #Make them the same self.qc.measure(self.q, self.c) #Measure backend = Aer.get_backend('qasm_simulator') job_sim = execute(self.qc, backend=backend, shots=100) sim_result = job_sim.result() print("simulation: ", sim_result) print(sim_result.get_counts(self.qc)) self.counts = sim_result.get_counts(self.qc) for count in self.counts: #Takes key names c = list(count)[:-1] #splits key '1011' => ['1','0','1','1'] c = c[::-1] #invert it so it goes 0 up... #Ignore the last bit since I dont know how to get rid of it #It is zero always. #The reason it is included is that I create a quantum register and #then start adding operations, quantum registers need at least one bit. counter = 0 weight = self.counts[count] empty = np.zeros((self.x,self.y),dtype=str) for m in self.moves: if m.player == 0: char = 'x' elif m.player==1: char = 'o' result = [] if m.q1: result.append(c[counter]) counter+=1 if m.q2: result.append(c[counter]) counter+=1 #print(result) if len(result) == len(m.indices): #print(m) if result[0]=='1': empty[m.indices[0][0],m.indices[0][1]] = char if len(result)>1: if result[1]=='1': if result[0]=='1': print('problem! a move appeard in two places.') print(m) empty[m.indices[1][0],m.indices[1][1]] = char elif not result: #Then it was a classcal move empty[m.indices[0][0],m.indices[0][1]] = char xscore,oscore=self.winners(empty) print('X wins: '+str(xscore)) print('O wins: '+str(oscore)) print('Shots: '+str(weight)) print(empty) def winners(self,empty): """Compute winners of a board""" oscore = 0 xscore = 0 for x in range(self.x): if empty[x,1]==empty[x,0] and empty[x,2]==empty[x,1]: if empty[x,0]=='o': oscore+=1 elif empty[x,0]=='x': xscore +=1 for y in range(self.y): if empty[1,y]==empty[0,y] and empty[2,y]==empty[0,y]: if empty[0,y]=='o': oscore+=1 elif empty[0,y]=='x': xscore +=1 if empty[0,0]==empty[1,1] and empty[1,1]==empty[2,2]: if empty[0,0]=='o': oscore+=1 elif empty[0,0]=='x': xscore += 1 if empty[2,0]==empty[1,1] and empty[1,1]==empty[0,2]: if empty[2,0]=='o': oscore+=1 elif empty[2,0]=='x': xscore += 1 return [xscore,oscore] def _populate_board(self): """Automatically populate as below, for testing purposes""" self.add_move([[2,2],[0,0]],1) self.add_move([[1,1],[1,2]],0) self.add_move([[1,2],[2,1]],1) self.add_move([[2,1]],0) self.add_move([[0,1]],1) self.add_move([[1,0]],0) self.add_move([[2,0]],1) self.add_move([[2,2]],0) self.add_move([[0,0]],1) self.add_move([[0,2]],0) self.add_move([[1,1]],1) self.add_move([[1,2]],0) if __name__=="__main__": B= Board(3,3) B.run() #B._populate_board() #a = B.compute_winner()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import json from urllib.parse import urlencode from urllib.request import urlopen from qiskit import * from qiskit.tools.monitor import job_monitor import ipywidgets as widgets from IPython.display import display import threading import os script_dir = os.path.dirname(__file__) IBMQ.load_accounts(hub=None) __all__ = ['quantum_slot_machine'] def quantum_slot_machine(): """A slot machine that uses random numbers generated by quantum mechanical processses. """ qslot = widgets.VBox(children=[slot, opts]) qslot.children[0].children[1].children[7].children[1]._qslot = qslot qslot.children[0].children[1].children[7].children[1].on_click(pull_slot) ibmq_thread = threading.Thread(target=get_ibmq_ints, args=(qslot,)) ibmq_thread.start() display(qslot) def get_slot_values(backend, qslot): if backend == 'qasm_simulator': back = BasicAer.get_backend('qasm_simulator') q = QuantumRegister(9, name='q') c = ClassicalRegister(9, name='c') qc = QuantumCircuit(q, c) for kk in range(9): qc.h(q[kk]) qc.measure(q, c) job = execute(qc, backend=back, shots=1) result = job.result() counts = list(result.get_counts().keys())[0] return int(counts[0:3], 2), int(counts[3:6], 2), int(counts[6:9], 2) elif backend == 'ibmq_5_tenerife': int1 = qslot.children[0]._stored_ints.pop(0) int2 = qslot.children[0]._stored_ints.pop(0) int3 = qslot.children[0]._stored_ints.pop(0) if len(qslot.children[0]._stored_ints) == 0: ibmq_thread = threading.Thread(target=get_ibmq_ints, args=(qslot,)) ibmq_thread.start() return int1, int2, int3 elif backend == 'ANU QRNG': URL = 'https://qrng.anu.edu.au/API/jsonI.php' url = URL + '?' + urlencode({'type': 'hex16', 'length': 3, 'size': 1}) data = json.loads(urlopen(url).read().decode('ascii')) rngs = [int(bin(int(kk, 16))[2:].zfill(8)[:3], 2) for kk in data['data']] return rngs[0], rngs[1], rngs[2] else: raise Exception('Invalid backend choice.') def set_images(a, b, c, qslot): slot0 = qslot.children[0].children[1].children[1] slot1 = qslot.children[0].children[1].children[3] slot2 = qslot.children[0].children[1].children[5] slot0.value = qslot.children[0]._images[a] slot1.value = qslot.children[0]._images[b] slot2.value = qslot.children[0]._images[c] def update_credits(change, qslot): qslot.children[0]._credits += change qslot.children[1].children[1].value = front_str + \ str(qslot.children[0]._credits)+back_str def compute_payout(ints, qslot): out = 1 #Paytable # all sevens if all([x == 7 for x in ints]): value = 700 # all watermelons elif all([x == 6 for x in ints]): value = 200 # all strawberry elif all([x == 5 for x in ints]): value = 10 # all orange elif all([x == 4 for x in ints]): value = 20 # all lemon elif all([x == 3 for x in ints]): value = 60 # all grape elif all([x == 2 for x in ints]): value = 15 # all cherry elif all([x == 1 for x in ints]): value = 40 # all bell elif all([x == 0 for x in ints]): value = 80 # two bells elif sum([x == 0 for x in ints])== 2: value = 5 # two bells elif sum([x == 0 for x in ints]) == 1: value = 1 else: value = 0 if value: update_credits(value, qslot) # if no credits left if qslot.children[0]._credits <= 0: qslot.children[1].children[1].value = front_str + \ "LOSE"+back_str out = 0 return out def pull_slot(b): qslot = b._qslot update_credits(-1, qslot) b.disabled = True set_images(-1, -1, -1, qslot) backend = qslot.children[1].children[0].value ints = get_slot_values(backend, qslot) set_images(ints[0], ints[1], ints[2], qslot) alive = compute_payout(ints, qslot) if alive: b.disabled = False # generate new ibm q values def get_ibmq_ints(qslot): qslot.children[1].children[0].options = ['qasm_simulator', 'ANU QRNG'] qslot.children[1].children[0].value = 'qasm_simulator' back = IBMQ.get_backend('ibmq_5_tenerife') q = QuantumRegister(3, name='q') c = ClassicalRegister(3, name='c') qc = QuantumCircuit(q, c) for kk in range(3): qc.h(q[kk]) qc.measure(q, c) job = execute(qc, backend=back, shots=300, memory=True) qslot.children[1].children[2].clear_output() with qslot.children[1].children[2]: job_monitor(job) qslot.children[0]._stored_ints = [ int(kk, 16) for kk in job.result().results[0].data.memory] qslot.children[1].children[0].options = ['qasm_simulator', 'ibmq_5_tenerife', 'ANU QRNG'] #top top_file = open(script_dir+"/machine/slot_top.png", "rb") top_image = top_file.read() slot_top = widgets.Image( value=top_image, format='png', width='100%', height='auto', layout=widgets.Layout(margin='0px 0px 0px 0px') ) #bottom bottom_file = open(script_dir+"/machine/slot_bottom.png", "rb") bottom_image = bottom_file.read() slot_bottom = widgets.Image( value=bottom_image, format='png', width='100%', height='auto', layout=widgets.Layout(margin='0px 0px 0px 0px') ) #left left_file = open(script_dir+"/machine/slot_left.png", "rb") left_image = left_file.read() left = widgets.Image( value=left_image, format='png', width='auto', height='auto', margin='0px 0px 0px 0px' ) #left right_file = open(script_dir+"/machine/slot_right.png", "rb") right_image = right_file.read() right = widgets.Image( value=right_image, format='png', width='auto', height='auto', margin='0px 0px 0px 0px' ) #mid mid_file = open(script_dir+"/machine/slot_middle.png", "rb") mid_image = mid_file.read() mid = widgets.Image( value=mid_image, format='png', width='auto', height='auto', margin='0px 0px 0px 0px' ) #symbols blank_sym = open(script_dir+"/symbols/blank.png", "rb") blank_img = blank_sym.read() slot0 = widgets.Image( value=blank_img, format='png', width='auto', height='auto', max_width='175px', max_height='175px' ) slot1 = widgets.Image( value=blank_img, format='png', width='auto', height='auto', max_width='175px', max_height='175px' ) slot2 = widgets.Image( value=blank_img, format='png', width='auto', height='auto', max_width='175px', max_height='175px' ) #arm arm_upper_file = open(script_dir+"/machine/slot_handle_upper.png", "rb") arm__upper_image = arm_upper_file.read() arm_upper = widgets.Image( value=arm__upper_image, format='png', width='auto') arm_lower_file = open(script_dir+"/machine/slot_handle_lower.png", "rb") arm__lower_image = arm_lower_file.read() arm_lower = widgets.Image( value=arm__lower_image, format='png', width='auto') arm_button = widgets.Button(description='PUSH', button_style='danger', layout=widgets.Layout(width='120px', height='auto', margin='0px 35px')) arm_button.style.font_weight = 'bold' arm = widgets.VBox(children=[arm_upper, arm_button, arm_lower], layout=widgets.Layout(width='auto', margin='0px 0px 0px 0px')) items = [left, slot0, mid, slot1, mid, slot2, right, arm] box_layout = widgets.Layout(display='flex', flex_flow='row', align_items='center', width='auto', margin='0px 0px 0px 0px') slot_middle = widgets.Box(children=items, layout=box_layout) slot = widgets.VBox(children=[slot_top, slot_middle, slot_bottom], layout=widgets.Layout(display='flex', flex_flow='column', align_items='center', width='auto', margin='0px 0px 0px 0px')) slot._stored_ints = [] imgs = ['waiting.png', 'bell.png', 'cherry.png', 'grape.png', 'lemon.png', 'orange.png', 'strawberry.png', 'watermelon.png', 'seven.png'] slot._images = {} for kk, img in enumerate(imgs): slot._images[kk-1] = open(script_dir+"/symbols/%s" % img, "rb").read() slot._credits = 20 solver = widgets.Dropdown( options=['qasm_simulator', 'ibmq_5_tenerife', 'ANU QRNG'], value='qasm_simulator', description='', disabled=False, layout=widgets.Layout(width='25%', padding='10px') ) front_str = "<div style = 'background-color:#000000; height:70px; text-align:right;padding:10px' > <p style='color:#FFFFFF; font-size: 60px;margin: 10px'>" back_str = "</p></div>" payout = widgets.HTML( value=front_str+str(20)+back_str, placeholder='', description='', layout=widgets.Layout(width='33%', height='70px') ) out = widgets.Output(layout=widgets.Layout(width='33%', padding='10px')) opts = widgets.HBox(children=[solver, payout, out], layout=widgets.Layout(width='100%', justify_content='center', border='2px solid black'))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import qiskit qr = qiskit.QuantumRegister(1) cr = qiskit.ClassicalRegister(1) program = qiskit.QuantumCircuit(qr, cr) program.measure(qr,cr) job = qiskit.execute( program, qiskit.BasicAer.get_backend('qasm_simulator') ) print( job.result().get_counts() ) qiskit.IBMQ.load_accounts() backend = qiskit.providers.ibmq.least_busy(qiskit.IBMQ.backends(simulator=False)) print("We'll use the least busy device:",backend.name()) job = qiskit.execute( program, backend ) print( job.result().get_counts() )
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import ClassicalRegister, QuantumRegister from qiskit import QuantumCircuit, execute from qiskit.tools.visualization import plot_histogram #Set up the quantum and classical registers, and combine them into a circuit qr = QuantumRegister(1) cr = ClassicalRegister(1) qc = QuantumCircuit(qr, cr) qc.h(qr[0]) #Create a superposition on the single quantum bit qc.measure(qr[0], cr[0]) #Measure the single bit, and store its value in the clasical bit from qiskit import register, available_backends, get_backend #Import the config file (Qconfig.py) to retrieve the API token and API url try: import sys sys.path.append('../') #Parent directory import Qconfig qx_config = { 'APItoken': Qconfig.APItoken, 'url': Qconfig.config['url']} except Exception as e: print(e) qx_config = { 'APItoken':'YOUR_TOKEN_HERE', 'url':'https://quantumexperience.ng.bluemix.net/api'} #Setup API register(qx_config['APItoken'], qx_config['url']) backend = 'ibmq_qasm_simulator' #Replace 'ibmq_qasm_simulator' with 'ibmqx5' to run on the quantum computer shots_sim = 100 #Adjust this number as desired, with effects as described above job_sim = execute(qc, backend, shots=shots_sim) #Run job on chosen backend for chosen number of shots stats_sim = job_sim.result().get_counts() #Retrieve results #Select '0' to represent 'laurel' if '0' not in stats_sim.keys(): stats_sim['laurel'] = 0 else: stats_sim['laurel'] = stats_sim.pop('0') #Which leaves '1' to represent 'yanny' if '1' not in stats_sim.keys(): stats_sim['yanny'] = 0 else: stats_sim['yanny'] = stats_sim.pop('1') plot_histogram(stats_sim) from pydub import AudioSegment from pydub.playback import play #Import two tracks laurel = AudioSegment.from_wav('laurel_or_yanny_audio_files/laurel.wav') yanny = AudioSegment.from_wav('laurel_or_yanny_audio_files/yanny.wav') play(laurel) #Listen to the laurel-specific track play(yanny) #Listen to the yanny-specific track #Modify the volumes based on the results of the experiment laurel = laurel + ((100*stats_sim['laurel']/shots_sim)-50) #Laurel yanny = yanny + ((100*stats_sim['yanny']/shots_sim)-50) #Yanny #Mix the two together and play the result mixed = laurel.overlay(yanny) play(mixed) mixed.export('laurel_or_yanny_audio_files/quantumLaurelYanny.wav', format='wav') print("Installed packages are as the following") !python --version print() !conda list 'qiskit|IBMQuantumExperience|numpy|scipy'
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# begin with importing essential libraries for IBM Q from qiskit import IBMQ, BasicAer from qiskit import ClassicalRegister, QuantumRegister, QuantumCircuit # set up Quantum Register and Classical Register for 3 qubits q = QuantumRegister(3) c = ClassicalRegister(3) # Create a Quantum Circuit qc = QuantumCircuit(q, c) qc.h(q) qc.measure(q, c) qc.draw() def answer(result): for key in result.keys(): state = key print('The Quantum 8-ball says:') if state == '000': print('It is certain.') elif state == '001': print('Without a doubt.') elif state == '010': print('Yes - definitely.') elif state == '011': print('Most likely.') elif state == '100': print("Don't count on it.") elif state == '101': print('My reply is no.') elif state == '110': print('Very doubtful.') else: print('Concentrate and ask again.') from qiskit import execute job = execute(qc, backend=BasicAer.get_backend('qasm_simulator'), shots=1) result = job.result().get_counts(qc) answer(result) # load IBM Q account IBMQ.load_accounts() # define the least busy device from qiskit.providers.ibmq import least_busy backend = least_busy(IBMQ.backends(simulator=False)) print("The least busy device:",backend.name()) job = execute(qc, backend=backend, shots=1) result = job.result().get_counts(qc) answer(result)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import ClassicalRegister, QuantumRegister from qiskit import QuantumCircuit, execute from qiskit.tools.visualization import plot_histogram # set up registers and program qr = QuantumRegister(16) cr = ClassicalRegister(16) qc = QuantumCircuit(qr, cr) # rightmost eight (qu)bits have ')' = 00101001 qc.x(qr[0]) qc.x(qr[3]) qc.x(qr[5]) # second eight (qu)bits have superposition of # '8' = 00111000 # ';' = 00111011 # these differ only on the rightmost two bits qc.h(qr[9]) # create superposition on 9 qc.cx(qr[9],qr[8]) # spread it to 8 with a CNOT qc.x(qr[11]) qc.x(qr[12]) qc.x(qr[13]) # measure for j in range(16): qc.measure(qr[j], cr[j]) from qiskit import register, available_backends, get_backend #import Qconfig and set APIToken and API url try: import sys sys.path.append("../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} except Exception as e: print(e) qx_config = { "APItoken":"YOUR_TOKEN_HERE", "url":"https://quantumexperience.ng.bluemix.net/api"} #set api register(qx_config['APItoken'], qx_config['url']) backend = "ibmq_qasm_simulator" shots_sim = 128 job_sim = execute(qc, backend, shots=shots_sim) stats_sim = job_sim.result().get_counts() plot_histogram(stats_sim) import matplotlib.pyplot as plt %matplotlib inline plt.rc('font', family='monospace') def plot_smiley (stats, shots): for bitString in stats: char = chr(int( bitString[0:8] ,2)) # get string of the leftmost 8 bits and convert to an ASCII character char += chr(int( bitString[8:16] ,2)) # do the same for string of rightmost 8 bits, and add it to the previous character prob = stats[bitString] / shots # fraction of shots for which this result occurred # create plot with all characters on top of each other with alpha given by how often it turned up in the output plt.annotate( char, (0.5,0.5), va="center", ha="center", color = (0,0,0, prob ), size = 300) if (prob>0.05): # list prob and char for the dominant results (occurred for more than 5% of shots) print(str(prob)+"\t"+char) plt.axis('off') plt.show() plot_smiley(stats_sim, shots_sim) backends = available_backends() backend = get_backend('ibmqx5') print('Status of ibmqx5:',backend.status) if backend.status["operational"] is True: print("\nThe device is operational, so we'll submit the job.") shots_device = 1000 job_device = execute(qc, backend, shots=shots_device) stats_device = job_device.result().get_counts() else: print("\nThe device is not operational. Try again later.") plot_smiley(stats_device, shots_device)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import getpass, time from qiskit import ClassicalRegister, QuantumRegister, QuantumCircuit from qiskit import available_backends, execute, register, least_busy # import basic plot tools from qiskit.tools.visualization import plot_histogram, circuit_drawer APItoken = getpass.getpass('Please input your token and hit enter: ') qx_config = { "APItoken": APItoken, "url":"https://quantumexperience.ng.bluemix.net/api"} try: register(qx_config['APItoken'], qx_config['url']) print('\nYou have access to great power!') print(available_backends({'local': False, 'simulator': False})) except: print('Something went wrong.\nDid you enter a correct token?') backend = least_busy(available_backends({'simulator': False, 'local': False})) print("The least busy backend is " + backend) q = QuantumRegister(2) c = ClassicalRegister(2) qc = QuantumCircuit(q, c) qc.h(q[0]) qc.cx(q[0], q[1]) qc.measure(q, c) job_exp = execute(qc, backend=backend, shots=1024, max_credits=3) lapse = 0 interval = 30 while not job_exp.done: print('Status @ {} seconds'.format(interval * lapse)) print(job_exp.status) time.sleep(interval) lapse += 1 print(job_exp.status) plot_histogram(job_exp.result().get_counts(qc)) print('You have made entanglement!') circuit_drawer(qc)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
YEAST = "----------------------------------MM----------------------------" PROTOZOAN = "--MM---------------M------------MMMM---------------M------------" BACTERIAL = "---M---------------M------------MMMM---------------M------------" import sys import numpy as np import math from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit import execute def encode_bitstring(bitstring, qr, cr, inverse=False): """ create a circuit for constructing the quantum superposition of the bitstring """ n = math.ceil(math.log2(len(bitstring))) + 1 #number of qubits assert n > 2, "the length of bitstring must be at least 2" qc = QuantumCircuit(qr, cr) #the probability amplitude of the desired state desired_vector = np.array([ 0.0 for i in range(2**n) ]) #initialize to zero amplitude = np.sqrt(1.0/2**(n-1)) for i, b in enumerate(bitstring): pos = i * 2 if b == "1" or b == "M": pos += 1 desired_vector[pos] = amplitude if not inverse: qc.initialize(desired_vector, [ qr[i] for i in range(n) ] ) qc.barrier(qr) else: qc.initialize(desired_vector, [ qr[i] for i in range(n) ] ).inverse() #invert the circuit for i in range(n): qc.measure(qr[i], cr[i]) print() return qc n = math.ceil(math.log2(len(YEAST))) + 1 #number of qubits qr = QuantumRegister(n) cr = ClassicalRegister(n) qc_yeast = encode_bitstring(YEAST, qr, cr) qc_protozoan = encode_bitstring(PROTOZOAN, qr, cr) qc_bacterial = encode_bitstring(BACTERIAL, qr, cr) circs = {"YEAST": qc_yeast, "PROTOZOAN": qc_protozoan, "BACTERIAL": qc_bacterial} inverse_qc_yeast = encode_bitstring(YEAST, qr, cr, inverse=True) inverse_qc_protozoan = encode_bitstring(PROTOZOAN, qr, cr, inverse=True) inverse_qc_bacterial = encode_bitstring(BACTERIAL, qr, cr, inverse=True) inverse_circs = {"YEAST": inverse_qc_yeast, "PROTOZOAN": inverse_qc_protozoan, "BACTERIAL": inverse_qc_bacterial} from qiskit import IBMQ, BasicAer key = "PROTOZOAN" #the name of the code used as key to find similar ones # use local simulator backend = BasicAer.get_backend("qasm_simulator") shots = 1000 combined_circs = {} count = {} most_similar, most_similar_score = "", -1.0 for other_key in inverse_circs: if other_key == key: continue combined_circs[other_key] = circs[key] + inverse_circs[other_key] #combined circuits to look for similar codes job = execute(combined_circs[other_key], backend=backend,shots=shots) st = job.result().get_counts(combined_circs[other_key]) if "0"*n in st: sim_score = st["0"*n]/shots else: sim_score = 0.0 print("Similarity score of",key,"and",other_key,"is",sim_score) if most_similar_score < sim_score: most_similar, most_similar_score = other_key, sim_score print("[ANSWER]", key,"is most similar to", most_similar)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import numpy as np import matplotlib.pyplot as plt import qiskit from qiskit.providers.aer.noise.errors.standard_errors import amplitude_damping_error from qiskit.providers.aer.noise.errors.standard_errors import phase_damping_error from qiskit.providers.aer.noise import NoiseModel from qiskit.ignis.characterization.coherence import T1Fitter, T2StarFitter, T2Fitter from qiskit.ignis.characterization.coherence import t1_circuits, t2_circuits, t2star_circuits # 12 numbers ranging from 10 to 1000, logarithmically spaced # extra point at 1500 num_of_gates = np.append((np.logspace(1, 3, 12)).astype(int), np.array([1500])) gate_time = 0.1 # Select the qubits whose T1 are to be measured qubits = [0] # Generate experiments circs, xdata = t1_circuits(num_of_gates, gate_time, qubits) # Set the simulator with amplitude damping noise t1 = 25.0 gamma = 1 - np.exp(-gate_time/t1) error = amplitude_damping_error(gamma) noise_model = NoiseModel() noise_model.add_quantum_error(error, 'id', [0]) # Run the simulator backend = qiskit.Aer.get_backend('qasm_simulator') shots = 200 backend_result = qiskit.execute(circs, backend, shots=shots, noise_model=noise_model).result() %matplotlib inline # Fit the data to an exponential # The correct answers are a=1, and c=0, and t1=25/15 for qubit 0/2 # The user does not know the correct answer exactly, # so starts the fit from a different but close location initial_t1 = t1*1.2 initial_a = 1.0 initial_c = 0.0 fit = T1Fitter(backend_result, xdata, qubits, fit_p0=[initial_a, initial_t1, initial_c], fit_bounds=([0, 0, -1], [2, initial_t1*2, 1])) fit.plot(0) # 50 points linearly spaced in two regions (fine and coarse) # 30 from 10->150, 20 from 160->450 num_of_gates = np.append((np.linspace(10, 150, 30)).astype(int), (np.linspace(160,450,20)).astype(int)) gate_time = 0.1 # Select the qubits whose T2* are to be measured qubits = [0] # Generate experiments circs, xdata, osc_freq = t2star_circuits(num_of_gates, gate_time, qubits, nosc=5) backend = qiskit.Aer.get_backend('qasm_simulator') # Set the simulator with phase damping noise t2 = 10 p = 1 - np.exp(-2*gate_time/t2) error = phase_damping_error(p) noise_model = NoiseModel() noise_model.add_quantum_error(error, 'id', [0]) # Run the simulator shots = 300 backend_result = qiskit.execute(circs, backend, shots=shots, noise_model=noise_model).result() %matplotlib inline # Fit the data to an oscillator # The correct answers are a=0.5, f=osc_freq, phi=0, c=0.5, and t2=10/5 for qubit 0/2 # The user does not know the correct answer exactly, # so starts the fit from a different but close location initial_t2 = t2*1.1 initial_a = 0.5 initial_c = 0.5 initial_f = osc_freq initial_phi = -np.pi/20 fit = T2StarFitter(backend_result, xdata, qubits, fit_p0=[initial_a, initial_t2, initial_f, initial_phi, initial_c], fit_bounds=([-0.5, 0, 0, -np.pi, -0.5], [1.5, 2*t2, 2*osc_freq, np.pi, 1.5])) fit.plot(0) # 50 points linearly spaced to 300 num_of_gates = (np.linspace(10, 300, 50)).astype(int) gate_time = 0.1 # Select the qubits whose T2 are to be measured qubits = [0] # Generate experiments circs, xdata = t2_circuits(num_of_gates, gate_time, qubits) backend = qiskit.Aer.get_backend('qasm_simulator') # Set the simulator with phase damping noise t2 = 10 p = 1 - np.exp(-2*gate_time/t2) error = phase_damping_error(p) noise_model = NoiseModel() noise_model.add_quantum_error(error, 'id', [0]) # Run the simulator shots = 300 backend_result = qiskit.execute(circs, backend, shots=shots, noise_model=noise_model).result() %matplotlib inline # Fit the data to an exponent # The correct answers are a=1, c=0, and t2=10/5 for qubit 0/2 # The user does not know the correct answer exactly, # so starts the fit from a different but close location initial_t2 = t2*1.1 initial_a = 0.5 initial_c = 0.5 fit = T2Fitter(backend_result, xdata, qubits, fit_p0=[initial_a, initial_t2, initial_c], fit_bounds=([-0.5, 0, -0.5], [1.5, 2*t2, 1.5])) fit.plot(0) num_of_gates = (np.linspace(1, 30, 30)).astype(int) gate_time = 0.1 # Select the qubits whose T2 are to be measured qubits = [0] # Echo parameters n_echos = 5 alt_phase_echo = True # Generate experiments circs, xdata = t2_circuits(num_of_gates, gate_time, qubits, n_echos, alt_phase_echo) backend = qiskit.Aer.get_backend('qasm_simulator') # Set the simulator with phase damping noise t2 = 10 p = 1 - np.exp(-2*gate_time/t2) error = phase_damping_error(p) noise_model = NoiseModel() noise_model.add_quantum_error(error, 'id', [0]) # Run the simulator shots = 300 backend_result = qiskit.execute(circs, backend, shots=shots, noise_model=noise_model).result() %matplotlib inline # Fit the data to an exponent # The correct answers are a=1, c=0, and t2=10/5 for qubit 0/2 # The user does not know the correct answer exactly, # so starts the fit from a different but close location initial_t2 = t2*1.1 initial_a = 0.5 initial_c = 0.5 fit = T2Fitter(backend_result, xdata, qubits, fit_p0=[initial_a, initial_t2, initial_c], fit_bounds=([-0.5, 0, -0.5], [1.5, 2*t2, 1.5])) fit.plot(0)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# Import general libraries (needed for functions) import numpy as np import time # Import Qiskit classes import qiskit from qiskit import QuantumRegister, QuantumCircuit, ClassicalRegister, Aer from qiskit.providers.aer import noise from qiskit.tools.visualization import plot_histogram # Import measurement calibration functions from qiskit.ignis.mitigation.measurement import (complete_meas_cal, CompleteMeasFitter, MeasurementFilter)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
#Assign these values as per your requirements. global min_qubits,max_qubits,skip_qubits,max_circuits,num_shots,Noise_Inclusion min_qubits=1 max_qubits=3 skip_qubits=1 max_circuits=3 num_shots=1000 use_XX_YY_ZZ_gates = True Noise_Inclusion = False saveplots = False Memory_utilization_plot = True Type_of_Simulator = "built_in" #Inputs are "built_in" or "FAKE" or "FAKEV2" backend_name = "FakeGuadalupeV2" #Can refer to the README files for the available backends gate_counts_plots = True #Change your Specification of Simulator in Declaring Backend Section #By Default : built_in -> qasm_simulator and FAKE -> FakeSantiago() and FAKEV2 -> FakeSantiagoV2() import numpy as np import os,json from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister, Aer, transpile, execute import time import matplotlib.pyplot as plt # Import from Qiskit Aer noise module from qiskit_aer.noise import (NoiseModel, QuantumError, ReadoutError,pauli_error, depolarizing_error, thermal_relaxation_error,reset_error) # Benchmark Name benchmark_name = "Hamiltonian Simulation" # Selection of basis gate set for transpilation # Note: selector 1 is a hardware agnostic gate set basis_selector = 1 basis_gates_array = [ [], ['rx', 'ry', 'rz', 'cx'], # a common basis set, default ['cx', 'rz', 'sx', 'x'], # IBM default basis set ['rx', 'ry', 'rxx'], # IonQ default basis set ['h', 'p', 'cx'], # another common basis set ['u', 'cx'] # general unitaries basis gates ] np.random.seed(0) num_gates = 0 depth = 0 def get_QV(backend): import json # Assuming backend.conf_filename is the filename and backend.dirname is the directory path conf_filename = backend.dirname + "/" + backend.conf_filename # Open the JSON file with open(conf_filename, 'r') as file: # Load the JSON data data = json.load(file) # Extract the quantum_volume parameter QV = data.get('quantum_volume', None) return QV def checkbackend(backend_name,Type_of_Simulator): if Type_of_Simulator == "built_in": available_backends = [] for i in Aer.backends(): available_backends.append(i.name) if backend_name in available_backends: platform = backend_name return platform else: print(f"incorrect backend name or backend not available. Using qasm_simulator by default !!!!") print(f"available backends are : {available_backends}") platform = "qasm_simulator" return platform elif Type_of_Simulator == "FAKE" or Type_of_Simulator == "FAKEV2": import qiskit.providers.fake_provider as fake_backends if hasattr(fake_backends,backend_name) is True: print(f"Backend {backend_name} is available for type {Type_of_Simulator}.") backend_class = getattr(fake_backends,backend_name) backend_instance = backend_class() return backend_instance else: print(f"Backend {backend_name} is not available or incorrect for type {Type_of_Simulator}. Executing with FakeSantiago!!!") if Type_of_Simulator == "FAKEV2": backend_class = getattr(fake_backends,"FakeSantiagoV2") else: backend_class = getattr(fake_backends,"FakeSantiago") backend_instance = backend_class() return backend_instance if Type_of_Simulator == "built_in": platform = checkbackend(backend_name,Type_of_Simulator) #By default using "Qasm Simulator" backend = Aer.get_backend(platform) QV_=None print(f"{platform} device is capable of running {backend.num_qubits}") print(f"backend version is {backend.backend_version}") elif Type_of_Simulator == "FAKE": basis_selector = 0 backend = checkbackend(backend_name,Type_of_Simulator) QV_ = get_QV(backend) platform = backend.properties().backend_name +"-"+ backend.properties().backend_version #Replace this string with the backend Provider's name as this is used for Plotting. max_qubits=backend.configuration().n_qubits print(f"{platform} device is capable of running {backend.configuration().n_qubits}") print(f"{platform} has QV={QV_}") if max_qubits > 30: print(f"Device is capable with max_qubits = {max_qubits}") max_qubit = 30 print(f"Using fake backend {platform} with max_qubits {max_qubits}") elif Type_of_Simulator == "FAKEV2": basis_selector = 0 if "V2" not in backend_name: backend_name = backend_name+"V2" backend = checkbackend(backend_name,Type_of_Simulator) QV_ = get_QV(backend) platform = backend.name +"-" +backend.backend_version max_qubits=backend.num_qubits print(f"{platform} device is capable of running {backend.num_qubits}") print(f"{platform} has QV={QV_}") if max_qubits > 30: print(f"Device is capable with max_qubits = {max_qubits}") max_qubit = 30 print(f"Using fake backend {platform} with max_qubits {max_qubits}") else: print("Enter valid Simulator.....") # saved circuits and subcircuits for display QC_ = None XX_ = None YY_ = None ZZ_ = None XXYYZZ_ = None # import precalculated data to compare against filename = os.path.join("precalculated_data.json") with open(filename, 'r') as file: data = file.read() precalculated_data = json.loads(data) ############### Circuit Definition def HamiltonianSimulation(n_spins, K, t, w, h_x, h_z): ''' Construct a Qiskit circuit for Hamiltonian Simulation :param n_spins:The number of spins to simulate :param K: The Trotterization order :param t: duration of simulation :return: return a Qiskit circuit for this Hamiltonian ''' num_qubits = n_spins secret_int = f"{K}-{t}" # allocate qubits qr = QuantumRegister(n_spins); cr = ClassicalRegister(n_spins); qc = QuantumCircuit(qr, cr, name=f"hamsim-{num_qubits}-{secret_int}") tau = t / K # start with initial state of 1010101... for k in range(0, n_spins, 2): qc.x(qr[k]) qc.barrier() # loop over each trotter step, adding gates to the circuit defining the hamiltonian for k in range(K): # the Pauli spin vector product [qc.rx(2 * tau * w * h_x[i], qr[i]) for i in range(n_spins)] [qc.rz(2 * tau * w * h_z[i], qr[i]) for i in range(n_spins)] qc.barrier() # Basic implementation of exp(i * t * (XX + YY + ZZ)) if _use_XX_YY_ZZ_gates: # XX operator on each pair of qubits in linear chain for j in range(2): for i in range(j%2, n_spins - 1, 2): qc.append(xx_gate(tau).to_instruction(), [qr[i], qr[(i + 1) % n_spins]]) # YY operator on each pair of qubits in linear chain for j in range(2): for i in range(j%2, n_spins - 1, 2): qc.append(yy_gate(tau).to_instruction(), [qr[i], qr[(i + 1) % n_spins]]) # ZZ operation on each pair of qubits in linear chain for j in range(2): for i in range(j%2, n_spins - 1, 2): qc.append(zz_gate(tau).to_instruction(), [qr[i], qr[(i + 1) % n_spins]]) # Use an optimal XXYYZZ combined operator # See equation 1 and Figure 6 in https://arxiv.org/pdf/quant-ph/0308006.pdf else: # optimized XX + YY + ZZ operator on each pair of qubits in linear chain for j in range(2): for i in range(j % 2, n_spins - 1, 2): qc.append(xxyyzz_opt_gate(tau).to_instruction(), [qr[i], qr[(i + 1) % n_spins]]) qc.barrier() # measure all the qubits used in the circuit for i_qubit in range(n_spins): qc.measure(qr[i_qubit], cr[i_qubit]) # save smaller circuit example for display global QC_ if QC_ == None or n_spins <= 6: if n_spins < 9: QC_ = qc return qc ############### XX, YY, ZZ Gate Implementations # Simple XX gate on q0 and q1 with angle 'tau' def xx_gate(tau): qr = QuantumRegister(2); qc = QuantumCircuit(qr, name="xx_gate") qc.h(qr[0]) qc.h(qr[1]) qc.cx(qr[0], qr[1]) qc.rz(3.1416*tau, qr[1]) qc.cx(qr[0], qr[1]) qc.h(qr[0]) qc.h(qr[1]) # save circuit example for display global XX_ XX_ = qc return qc # Simple YY gate on q0 and q1 with angle 'tau' def yy_gate(tau): qr = QuantumRegister(2); qc = QuantumCircuit(qr, name="yy_gate") qc.s(qr[0]) qc.s(qr[1]) qc.h(qr[0]) qc.h(qr[1]) qc.cx(qr[0], qr[1]) qc.rz(3.1416*tau, qr[1]) qc.cx(qr[0], qr[1]) qc.h(qr[0]) qc.h(qr[1]) qc.sdg(qr[0]) qc.sdg(qr[1]) # save circuit example for display global YY_ YY_ = qc return qc # Simple ZZ gate on q0 and q1 with angle 'tau' def zz_gate(tau): qr = QuantumRegister(2); qc = QuantumCircuit(qr, name="zz_gate") qc.cx(qr[0], qr[1]) qc.rz(3.1416*tau, qr[1]) qc.cx(qr[0], qr[1]) # save circuit example for display global ZZ_ ZZ_ = qc return qc # Optimal combined XXYYZZ gate (with double coupling) on q0 and q1 with angle 'tau' def xxyyzz_opt_gate(tau): alpha = tau; beta = tau; gamma = tau qr = QuantumRegister(2); qc = QuantumCircuit(qr, name="xxyyzz_opt") qc.rz(3.1416/2, qr[1]) qc.cx(qr[1], qr[0]) qc.rz(3.1416*gamma - 3.1416/2, qr[0]) qc.ry(3.1416/2 - 3.1416*alpha, qr[1]) qc.cx(qr[0], qr[1]) qc.ry(3.1416*beta - 3.1416/2, qr[1]) qc.cx(qr[1], qr[0]) qc.rz(-3.1416/2, qr[0]) # save circuit example for display global XXYYZZ_ XXYYZZ_ = qc return qc # Create an empty noise model noise_parameters = NoiseModel() if Type_of_Simulator == "built_in": # Add depolarizing error to all single qubit gates with error rate 0.05% and to all two qubit gates with error rate 0.5% depol_one_qb_error = 0.05 depol_two_qb_error = 0.005 noise_parameters.add_all_qubit_quantum_error(depolarizing_error(depol_one_qb_error, 1), ['rx', 'ry', 'rz']) noise_parameters.add_all_qubit_quantum_error(depolarizing_error(depol_two_qb_error, 2), ['cx']) # Add amplitude damping error to all single qubit gates with error rate 0.0% and to all two qubit gates with error rate 0.0% amp_damp_one_qb_error = 0.0 amp_damp_two_qb_error = 0.0 noise_parameters.add_all_qubit_quantum_error(depolarizing_error(amp_damp_one_qb_error, 1), ['rx', 'ry', 'rz']) noise_parameters.add_all_qubit_quantum_error(depolarizing_error(amp_damp_two_qb_error, 2), ['cx']) # Add reset noise to all single qubit resets reset_to_zero_error = 0.005 reset_to_one_error = 0.005 noise_parameters.add_all_qubit_quantum_error(reset_error(reset_to_zero_error, reset_to_one_error),["reset"]) # Add readout error p0given1_error = 0.000 p1given0_error = 0.000 error_meas = ReadoutError([[1 - p1given0_error, p1given0_error], [p0given1_error, 1 - p0given1_error]]) noise_parameters.add_all_qubit_readout_error(error_meas) #print(noise_parameters) elif Type_of_Simulator == "FAKE"or"FAKEV2": noise_parameters = NoiseModel.from_backend(backend) #print(noise_parameters) ### Analysis methods to be expanded and eventually compiled into a separate analysis.py file import math, functools def hellinger_fidelity_with_expected(p, q): """ p: result distribution, may be passed as a counts distribution q: the expected distribution to be compared against References: `Hellinger Distance @ wikipedia <https://en.wikipedia.org/wiki/Hellinger_distance>`_ Qiskit Hellinger Fidelity Function """ p_sum = sum(p.values()) q_sum = sum(q.values()) if q_sum == 0: print("ERROR: polarization_fidelity(), expected distribution is invalid, all counts equal to 0") return 0 p_normed = {} for key, val in p.items(): p_normed[key] = val/p_sum # if p_sum != 0: # p_normed[key] = val/p_sum # else: # p_normed[key] = 0 q_normed = {} for key, val in q.items(): q_normed[key] = val/q_sum total = 0 for key, val in p_normed.items(): if key in q_normed.keys(): total += (np.sqrt(val) - np.sqrt(q_normed[key]))**2 del q_normed[key] else: total += val total += sum(q_normed.values()) # in some situations (error mitigation) this can go negative, use abs value if total < 0: print(f"WARNING: using absolute value in fidelity calculation") total = abs(total) dist = np.sqrt(total)/np.sqrt(2) fidelity = (1-dist**2)**2 return fidelity def polarization_fidelity(counts, correct_dist, thermal_dist=None): """ Combines Hellinger fidelity and polarization rescaling into fidelity calculation used in every benchmark counts: the measurement outcomes after `num_shots` algorithm runs correct_dist: the distribution we expect to get for the algorithm running perfectly thermal_dist: optional distribution to pass in distribution from a uniform superposition over all states. If `None`: generated as `uniform_dist` with the same qubits as in `counts` returns both polarization fidelity and the hellinger fidelity Polarization from: `https://arxiv.org/abs/2008.11294v1` """ num_measured_qubits = len(list(correct_dist.keys())[0]) #print(num_measured_qubits) counts = {k.zfill(num_measured_qubits): v for k, v in counts.items()} # calculate hellinger fidelity between measured expectation values and correct distribution hf_fidelity = hellinger_fidelity_with_expected(counts,correct_dist) # to limit cpu and memory utilization, skip noise correction if more than 16 measured qubits if num_measured_qubits > 16: return { 'fidelity':hf_fidelity, 'hf_fidelity':hf_fidelity } # if not provided, generate thermal dist based on number of qubits if thermal_dist == None: thermal_dist = uniform_dist(num_measured_qubits) # set our fidelity rescaling value as the hellinger fidelity for a depolarized state floor_fidelity = hellinger_fidelity_with_expected(thermal_dist, correct_dist) # rescale fidelity result so uniform superposition (random guessing) returns fidelity # rescaled to 0 to provide a better measure of success of the algorithm (polarization) new_floor_fidelity = 0 fidelity = rescale_fidelity(hf_fidelity, floor_fidelity, new_floor_fidelity) return { 'fidelity':fidelity, 'hf_fidelity':hf_fidelity } ## Uniform distribution function commonly used def rescale_fidelity(fidelity, floor_fidelity, new_floor_fidelity): """ Linearly rescales our fidelities to allow comparisons of fidelities across benchmarks fidelity: raw fidelity to rescale floor_fidelity: threshold fidelity which is equivalent to random guessing new_floor_fidelity: what we rescale the floor_fidelity to Ex, with floor_fidelity = 0.25, new_floor_fidelity = 0.0: 1 -> 1; 0.25 -> 0; 0.5 -> 0.3333; """ rescaled_fidelity = (1-new_floor_fidelity)/(1-floor_fidelity) * (fidelity - 1) + 1 # ensure fidelity is within bounds (0, 1) if rescaled_fidelity < 0: rescaled_fidelity = 0.0 if rescaled_fidelity > 1: rescaled_fidelity = 1.0 return rescaled_fidelity def uniform_dist(num_state_qubits): dist = {} for i in range(2**num_state_qubits): key = bin(i)[2:].zfill(num_state_qubits) dist[key] = 1/(2**num_state_qubits) return dist from matplotlib.patches import Rectangle import matplotlib.cm as cm from matplotlib.colors import ListedColormap, LinearSegmentedColormap, Normalize from matplotlib.patches import Circle ############### Color Map functions # Create a selection of colormaps from which to choose; default to custom_spectral cmap_spectral = plt.get_cmap('Spectral') cmap_greys = plt.get_cmap('Greys') cmap_blues = plt.get_cmap('Blues') cmap_custom_spectral = None # the default colormap is the spectral map cmap = cmap_spectral cmap_orig = cmap_spectral # current cmap normalization function (default None) cmap_norm = None default_fade_low_fidelity_level = 0.16 default_fade_rate = 0.7 # Specify a normalization function here (default None) def set_custom_cmap_norm(vmin, vmax): global cmap_norm if vmin == vmax or (vmin == 0.0 and vmax == 1.0): print("... setting cmap norm to None") cmap_norm = None else: print(f"... setting cmap norm to [{vmin}, {vmax}]") cmap_norm = Normalize(vmin=vmin, vmax=vmax) # Remake the custom spectral colormap with user settings def set_custom_cmap_style( fade_low_fidelity_level=default_fade_low_fidelity_level, fade_rate=default_fade_rate): #print("... set custom map style") global cmap, cmap_custom_spectral, cmap_orig cmap_custom_spectral = create_custom_spectral_cmap( fade_low_fidelity_level=fade_low_fidelity_level, fade_rate=fade_rate) cmap = cmap_custom_spectral cmap_orig = cmap_custom_spectral # Create the custom spectral colormap from the base spectral def create_custom_spectral_cmap( fade_low_fidelity_level=default_fade_low_fidelity_level, fade_rate=default_fade_rate): # determine the breakpoint from the fade level num_colors = 100 breakpoint = round(fade_low_fidelity_level * num_colors) # get color list for spectral map spectral_colors = [cmap_spectral(v/num_colors) for v in range(num_colors)] #print(fade_rate) # create a list of colors to replace those below the breakpoint # and fill with "faded" color entries (in reverse) low_colors = [0] * breakpoint #for i in reversed(range(breakpoint)): for i in range(breakpoint): # x is index of low colors, normalized 0 -> 1 x = i / breakpoint # get color at this index bc = spectral_colors[i] r0 = bc[0] g0 = bc[1] b0 = bc[2] z0 = bc[3] r_delta = 0.92 - r0 #print(f"{x} {bc} {r_delta}") # compute saturation and greyness ratio sat_ratio = 1 - x #grey_ratio = 1 - x ''' attempt at a reflective gradient if i >= breakpoint/2: xf = 2*(x - 0.5) yf = pow(xf, 1/fade_rate)/2 grey_ratio = 1 - (yf + 0.5) else: xf = 2*(0.5 - x) yf = pow(xf, 1/fade_rate)/2 grey_ratio = 1 - (0.5 - yf) ''' grey_ratio = 1 - math.pow(x, 1/fade_rate) #print(f" {xf} {yf} ") #print(f" {sat_ratio} {grey_ratio}") r = r0 + r_delta * sat_ratio g_delta = r - g0 b_delta = r - b0 g = g0 + g_delta * grey_ratio b = b0 + b_delta * grey_ratio #print(f"{r} {g} {b}\n") low_colors[i] = (r,g,b,z0) #print(low_colors) # combine the faded low colors with the regular spectral cmap to make a custom version cmap_custom_spectral = ListedColormap(low_colors + spectral_colors[breakpoint:]) #spectral_colors = [cmap_custom_spectral(v/10) for v in range(10)] #for i in range(10): print(spectral_colors[i]) #print("") return cmap_custom_spectral # Make the custom spectral color map the default on module init set_custom_cmap_style() # Arrange the stored annotations optimally and add to plot def anno_volumetric_data(ax, depth_base=2, label='Depth', labelpos=(0.2, 0.7), labelrot=0, type=1, fill=True): # sort all arrays by the x point of the text (anno_offs) global x_anno_offs, y_anno_offs, anno_labels, x_annos, y_annos all_annos = sorted(zip(x_anno_offs, y_anno_offs, anno_labels, x_annos, y_annos)) x_anno_offs = [a for a,b,c,d,e in all_annos] y_anno_offs = [b for a,b,c,d,e in all_annos] anno_labels = [c for a,b,c,d,e in all_annos] x_annos = [d for a,b,c,d,e in all_annos] y_annos = [e for a,b,c,d,e in all_annos] #print(f"{x_anno_offs}") #print(f"{y_anno_offs}") #print(f"{anno_labels}") for i in range(len(anno_labels)): x_anno = x_annos[i] y_anno = y_annos[i] x_anno_off = x_anno_offs[i] y_anno_off = y_anno_offs[i] label = anno_labels[i] if i > 0: x_delta = abs(x_anno_off - x_anno_offs[i - 1]) y_delta = abs(y_anno_off - y_anno_offs[i - 1]) if y_delta < 0.7 and x_delta < 2: y_anno_off = y_anno_offs[i] = y_anno_offs[i - 1] - 0.6 #x_anno_off = x_anno_offs[i] = x_anno_offs[i - 1] + 0.1 ax.annotate(label, xy=(x_anno+0.0, y_anno+0.1), arrowprops=dict(facecolor='black', shrink=0.0, width=0.5, headwidth=4, headlength=5, edgecolor=(0.8,0.8,0.8)), xytext=(x_anno_off + labelpos[0], y_anno_off + labelpos[1]), rotation=labelrot, horizontalalignment='left', verticalalignment='baseline', color=(0.2,0.2,0.2), clip_on=True) if saveplots == True: plt.savefig("VolumetricPlotSample.jpg") # Plot one group of data for volumetric presentation def plot_volumetric_data(ax, w_data, d_data, f_data, depth_base=2, label='Depth', labelpos=(0.2, 0.7), labelrot=0, type=1, fill=True, w_max=18, do_label=False, do_border=True, x_size=1.0, y_size=1.0, zorder=1, offset_flag=False, max_depth=0, suppress_low_fidelity=False): # since data may come back out of order, save point at max y for annotation i_anno = 0 x_anno = 0 y_anno = 0 # plot data rectangles low_fidelity_count = True last_y = -1 k = 0 # determine y-axis dimension for one pixel to use for offset of bars that start at 0 (_, dy) = get_pixel_dims(ax) # do this loop in reverse to handle the case where earlier cells are overlapped by later cells for i in reversed(range(len(d_data))): x = depth_index(d_data[i], depth_base) y = float(w_data[i]) f = f_data[i] # each time we star a new row, reset the offset counter # DEVNOTE: this is highly specialized for the QA area plots, where there are 8 bars # that represent time starting from 0 secs. We offset by one pixel each and center the group if y != last_y: last_y = y; k = 3 # hardcoded for 8 cells, offset by 3 #print(f"{i = } {x = } {y = }") if max_depth > 0 and d_data[i] > max_depth: #print(f"... excessive depth (2), skipped; w={y} d={d_data[i]}") break; # reject cells with low fidelity if suppress_low_fidelity and f < suppress_low_fidelity_level: if low_fidelity_count: break else: low_fidelity_count = True # the only time this is False is when doing merged gradation plots if do_border == True: # this case is for an array of x_sizes, i.e. each box has different width if isinstance(x_size, list): # draw each of the cells, with no offset if not offset_flag: ax.add_patch(box_at(x, y, f, type=type, fill=fill, x_size=x_size[i], y_size=y_size, zorder=zorder)) # use an offset for y value, AND account for x and width to draw starting at 0 else: ax.add_patch(box_at((x/2 + x_size[i]/4), y + k*dy, f, type=type, fill=fill, x_size=x+ x_size[i]/2, y_size=y_size, zorder=zorder)) # this case is for only a single cell else: ax.add_patch(box_at(x, y, f, type=type, fill=fill, x_size=x_size, y_size=y_size)) # save the annotation point with the largest y value if y >= y_anno: x_anno = x y_anno = y i_anno = i # move the next bar down (if using offset) k -= 1 # if no data rectangles plotted, no need for a label if x_anno == 0 or y_anno == 0: return x_annos.append(x_anno) y_annos.append(y_anno) anno_dist = math.sqrt( (y_anno - 1)**2 + (x_anno - 1)**2 ) # adjust radius of annotation circle based on maximum width of apps anno_max = 10 if w_max > 10: anno_max = 14 if w_max > 14: anno_max = 18 scale = anno_max / anno_dist # offset of text from end of arrow if scale > 1: x_anno_off = scale * x_anno - x_anno - 0.5 y_anno_off = scale * y_anno - y_anno else: x_anno_off = 0.7 y_anno_off = 0.5 x_anno_off += x_anno y_anno_off += y_anno # print(f"... {xx} {yy} {anno_dist}") x_anno_offs.append(x_anno_off) y_anno_offs.append(y_anno_off) anno_labels.append(label) if do_label: ax.annotate(label, xy=(x_anno+labelpos[0], y_anno+labelpos[1]), rotation=labelrot, horizontalalignment='left', verticalalignment='bottom', color=(0.2,0.2,0.2)) x_annos = [] y_annos = [] x_anno_offs = [] y_anno_offs = [] anno_labels = [] # init arrays to hold annotation points for label spreading def vplot_anno_init (): global x_annos, y_annos, x_anno_offs, y_anno_offs, anno_labels x_annos = [] y_annos = [] x_anno_offs = [] y_anno_offs = [] anno_labels = [] # Number of ticks on volumetric depth axis max_depth_log = 22 # average transpile factor between base QV depth and our depth based on results from QV notebook QV_transpile_factor = 12.7 # format a number using K,M,B,T for large numbers, optionally rounding to 'digits' decimal places if num > 1 # (sign handling may be incorrect) def format_number(num, digits=0): if isinstance(num, str): num = float(num) num = float('{:.3g}'.format(abs(num))) sign = '' metric = {'T': 1000000000000, 'B': 1000000000, 'M': 1000000, 'K': 1000, '': 1} for index in metric: num_check = num / metric[index] if num_check >= 1: num = round(num_check, digits) sign = index break numstr = f"{str(num)}" if '.' in numstr: numstr = numstr.rstrip('0').rstrip('.') return f"{numstr}{sign}" # Return the color associated with the spcific value, using color map norm def get_color(value): # if there is a normalize function installed, scale the data if cmap_norm: value = float(cmap_norm(value)) if cmap == cmap_spectral: value = 0.05 + value*0.9 elif cmap == cmap_blues: value = 0.00 + value*1.0 else: value = 0.0 + value*0.95 return cmap(value) # Return the x and y equivalent to a single pixel for the given plot axis def get_pixel_dims(ax): # transform 0 -> 1 to pixel dimensions pixdims = ax.transData.transform([(0,1),(1,0)])-ax.transData.transform((0,0)) xpix = pixdims[1][0] ypix = pixdims[0][1] #determine x- and y-axis dimension for one pixel dx = (1 / xpix) dy = (1 / ypix) return (dx, dy) ############### Helper functions # return the base index for a circuit depth value # take the log in the depth base, and add 1 def depth_index(d, depth_base): if depth_base <= 1: return d if d == 0: return 0 return math.log(d, depth_base) + 1 # draw a box at x,y with various attributes def box_at(x, y, value, type=1, fill=True, x_size=1.0, y_size=1.0, alpha=1.0, zorder=1): value = min(value, 1.0) value = max(value, 0.0) fc = get_color(value) ec = (0.5,0.5,0.5) return Rectangle((x - (x_size/2), y - (y_size/2)), x_size, y_size, alpha=alpha, edgecolor = ec, facecolor = fc, fill=fill, lw=0.5*y_size, zorder=zorder) # draw a circle at x,y with various attributes def circle_at(x, y, value, type=1, fill=True): size = 1.0 value = min(value, 1.0) value = max(value, 0.0) fc = get_color(value) ec = (0.5,0.5,0.5) return Circle((x, y), size/2, alpha = 0.7, # DEVNOTE: changed to 0.7 from 0.5, to handle only one cell edgecolor = ec, facecolor = fc, fill=fill, lw=0.5) def box4_at(x, y, value, type=1, fill=True, alpha=1.0): size = 1.0 value = min(value, 1.0) value = max(value, 0.0) fc = get_color(value) ec = (0.3,0.3,0.3) ec = fc return Rectangle((x - size/8, y - size/2), size/4, size, alpha=alpha, edgecolor = ec, facecolor = fc, fill=fill, lw=0.1) # Draw a Quantum Volume rectangle with specified width and depth, and grey-scale value def qv_box_at(x, y, qv_width, qv_depth, value, depth_base): #print(f"{qv_width} {qv_depth} {depth_index(qv_depth, depth_base)}") return Rectangle((x - 0.5, y - 0.5), depth_index(qv_depth, depth_base), qv_width, edgecolor = (value,value,value), facecolor = (value,value,value), fill=True, lw=1) def bkg_box_at(x, y, value=0.9): size = 0.6 return Rectangle((x - size/2, y - size/2), size, size, edgecolor = (.75,.75,.75), facecolor = (value,value,value), fill=True, lw=0.5) def bkg_empty_box_at(x, y): size = 0.6 return Rectangle((x - size/2, y - size/2), size, size, edgecolor = (.75,.75,.75), facecolor = (1.0,1.0,1.0), fill=True, lw=0.5) # Plot the background for the volumetric analysis def plot_volumetric_background(max_qubits=11, QV=32, depth_base=2, suptitle=None, avail_qubits=0, colorbar_label="Avg Result Fidelity"): if suptitle == None: suptitle = f"Volumetric Positioning\nCircuit Dimensions and Fidelity Overlaid on Quantum Volume = {QV}" QV0 = QV qv_estimate = False est_str = "" if QV == 0: # QV = 0 indicates "do not draw QV background or label" QV = 2048 elif QV < 0: # QV < 0 indicates "add est. to label" QV = -QV qv_estimate = True est_str = " (est.)" if avail_qubits > 0 and max_qubits > avail_qubits: max_qubits = avail_qubits max_width = 13 if max_qubits > 11: max_width = 18 if max_qubits > 14: max_width = 20 if max_qubits > 16: max_width = 24 if max_qubits > 24: max_width = 33 #print(f"... {avail_qubits} {max_qubits} {max_width}") plot_width = 6.8 plot_height = 0.5 + plot_width * (max_width / max_depth_log) #print(f"... {plot_width} {plot_height}") # define matplotlib figure and axis; use constrained layout to fit colorbar to right fig, ax = plt.subplots(figsize=(plot_width, plot_height), constrained_layout=True) plt.suptitle(suptitle) plt.xlim(0, max_depth_log) plt.ylim(0, max_width) # circuit depth axis (x axis) xbasis = [x for x in range(1,max_depth_log)] xround = [depth_base**(x-1) for x in xbasis] xlabels = [format_number(x) for x in xround] ax.set_xlabel('Circuit Depth') ax.set_xticks(xbasis) plt.xticks(xbasis, xlabels, color='black', rotation=45, ha='right', va='top', rotation_mode="anchor") # other label options #plt.xticks(xbasis, xlabels, color='black', rotation=-60, ha='left') #plt.xticks(xbasis, xlabels, color='black', rotation=-45, ha='left', va='center', rotation_mode="anchor") # circuit width axis (y axis) ybasis = [y for y in range(1,max_width)] yround = [1,2,3,4,5,6,7,8,10,12,15] # not used now ylabels = [str(y) for y in yround] # not used now #ax.set_ylabel('Circuit Width (Number of Qubits)') ax.set_ylabel('Circuit Width') ax.set_yticks(ybasis) #create simple line plot (not used right now) #ax.plot([0, 10],[0, 10]) log2QV = math.log2(QV) QV_width = log2QV QV_depth = log2QV * QV_transpile_factor # show a quantum volume rectangle of QV = 64 e.g. (6 x 6) if QV0 != 0: ax.add_patch(qv_box_at(1, 1, QV_width, QV_depth, 0.87, depth_base)) else: ax.add_patch(qv_box_at(1, 1, QV_width, QV_depth, 0.91, depth_base)) # the untranspiled version is commented out - we do not show this by default # also show a quantum volume rectangle un-transpiled # ax.add_patch(qv_box_at(1, 1, QV_width, QV_width, 0.80, depth_base)) # show 2D array of volumetric cells based on this QV_transpiled # DEVNOTE: we use +1 only to make the visuals work; s/b without # Also, the second arg of the min( below seems incorrect, needs correction maxprod = (QV_width + 1) * (QV_depth + 1) for w in range(1, min(max_width, round(QV) + 1)): # don't show VB squares if width greater than known available qubits if avail_qubits != 0 and w > avail_qubits: continue i_success = 0 for d in xround: # polarization factor for low circuit widths maxtest = maxprod / ( 1 - 1 / (2**w) ) # if circuit would fail here, don't draw box if d > maxtest: continue if w * d > maxtest: continue # guess for how to capture how hardware decays with width, not entirely correct # # reduce maxtext by a factor of number of qubits > QV_width # # just an approximation to account for qubit distances # if w > QV_width: # over = w - QV_width # maxtest = maxtest / (1 + (over/QV_width)) # draw a box at this width and depth id = depth_index(d, depth_base) # show vb rectangles; if not showing QV, make all hollow (or less dark) if QV0 == 0: #ax.add_patch(bkg_empty_box_at(id, w)) ax.add_patch(bkg_box_at(id, w, 0.95)) else: ax.add_patch(bkg_box_at(id, w, 0.9)) # save index of last successful depth i_success += 1 # plot empty rectangle after others d = xround[i_success] id = depth_index(d, depth_base) ax.add_patch(bkg_empty_box_at(id, w)) # Add annotation showing quantum volume if QV0 != 0: t = ax.text(max_depth_log - 2.0, 1.5, f"QV{est_str}={QV}", size=12, horizontalalignment='right', verticalalignment='center', color=(0.2,0.2,0.2), bbox=dict(boxstyle="square,pad=0.3", fc=(.9,.9,.9), ec="grey", lw=1)) # add colorbar to right of plot plt.colorbar(cm.ScalarMappable(cmap=cmap), cax=None, ax=ax, shrink=0.6, label=colorbar_label, panchor=(0.0, 0.7)) return ax # Function to calculate circuit depth def calculate_circuit_depth(qc): # Calculate the depth of the circuit depth = qc.depth() return depth def calculate_transpiled_depth(qc,basis_selector): # use either the backend or one of the basis gate sets if basis_selector == 0: qc = transpile(qc, backend) else: basis_gates = basis_gates_array[basis_selector] qc = transpile(qc, basis_gates=basis_gates, seed_transpiler=0) transpiled_depth = qc.depth() return transpiled_depth,qc def plot_fidelity_data(fidelity_data, Hf_fidelity_data, title): avg_fidelity_means = [] avg_Hf_fidelity_means = [] avg_num_qubits_values = list(fidelity_data.keys()) # Calculate the average fidelity and Hamming fidelity for each unique number of qubits for num_qubits in avg_num_qubits_values: avg_fidelity = np.average(fidelity_data[num_qubits]) avg_fidelity_means.append(avg_fidelity) avg_Hf_fidelity = np.mean(Hf_fidelity_data[num_qubits]) avg_Hf_fidelity_means.append(avg_Hf_fidelity) return avg_fidelity_means,avg_Hf_fidelity_means list_of_gates = [] def list_of_standardgates(): import qiskit.circuit.library as lib from qiskit.circuit import Gate import inspect # List all the attributes of the library module gate_list = dir(lib) # Filter out non-gate classes (like functions, variables, etc.) gates = [gate for gate in gate_list if isinstance(getattr(lib, gate), type) and issubclass(getattr(lib, gate), Gate)] # Get method names from QuantumCircuit circuit_methods = inspect.getmembers(QuantumCircuit, inspect.isfunction) method_names = [name for name, _ in circuit_methods] # Map gate class names to method names gate_to_method = {} for gate in gates: gate_class = getattr(lib, gate) class_name = gate_class.__name__.replace('Gate', '').lower() # Normalize class name for method in method_names: if method == class_name or method == class_name.replace('cr', 'c-r'): gate_to_method[gate] = method break # Add common operations that are not strictly gates additional_operations = { 'Measure': 'measure', 'Barrier': 'barrier', } gate_to_method.update(additional_operations) for k,v in gate_to_method.items(): list_of_gates.append(v) def update_counts(gates,custom_gates): operations = {} for key, value in gates.items(): operations[key] = value for key, value in custom_gates.items(): if key in operations: operations[key] += value else: operations[key] = value return operations def get_gate_counts(gates,custom_gate_defs): result = gates.copy() # Iterate over the gate counts in the quantum circuit for gate, count in gates.items(): if gate in custom_gate_defs: custom_gate_ops = custom_gate_defs[gate] # Multiply custom gate operations by the count of the custom gate in the circuit for _ in range(count): result = update_counts(result, custom_gate_ops) # Remove the custom gate entry as we have expanded it del result[gate] return result dict_of_qc = dict() custom_gates_defs = dict() # Function to count operations recursively def count_operations(qc): dict_of_qc.clear() circuit_traverser(qc) operations = dict() operations = dict_of_qc[qc.name] del dict_of_qc[qc.name] # print("operations :",operations) # print("dict_of_qc :",dict_of_qc) for keys in operations.keys(): if keys not in list_of_gates: for k,v in dict_of_qc.items(): if k in operations.keys(): custom_gates_defs[k] = v operations=get_gate_counts(operations,custom_gates_defs) custom_gates_defs.clear() return operations def circuit_traverser(qc): dict_of_qc[qc.name]=dict(qc.count_ops()) for i in qc.data: if str(i.operation.name) not in list_of_gates: qc_1 = i.operation.definition circuit_traverser(qc_1) def get_memory(): import resource usage = resource.getrusage(resource.RUSAGE_SELF) max_mem = usage.ru_maxrss/1024 #in MB return max_mem def analyzer(num_qubits): # we have precalculated the correct distribution that a perfect quantum computer will return # it is stored in the json file we import at the top of the code correct_dist = precalculated_data[f"Qubits - {num_qubits}"] return correct_dist num_state_qubits=1 #(default) not exposed to users def run (min_qubits=min_qubits, max_qubits=max_qubits, skip_qubits=skip_qubits, max_circuits=max_circuits, num_shots=num_shots, use_XX_YY_ZZ_gates = use_XX_YY_ZZ_gates): creation_times = [] elapsed_times = [] quantum_times = [] circuit_depths = [] transpiled_depths = [] fidelity_data = {} Hf_fidelity_data = {} numckts = [] mem_usage = [] algorithmic_1Q_gate_counts = [] algorithmic_2Q_gate_counts = [] transpiled_1Q_gate_counts = [] transpiled_2Q_gate_counts = [] print(f"{benchmark_name} Benchmark Program - {platform}") #defining all the standard gates supported by qiskit in a list if gate_counts_plots == True: list_of_standardgates() # validate parameters (smallest circuit is 2 qubits) max_qubits = max(2, max_qubits) min_qubits = min(max(2, min_qubits), max_qubits) if min_qubits % 2 == 1: min_qubits += 1 # min_qubits must be even skip_qubits = max(1, skip_qubits) #print(f"min, max qubits = {min_qubits} {max_qubits}") global _use_XX_YY_ZZ_gates _use_XX_YY_ZZ_gates = use_XX_YY_ZZ_gates if _use_XX_YY_ZZ_gates: print("... using unoptimized XX YY ZZ gates") global max_ckts max_ckts = max_circuits global min_qbits,max_qbits,skp_qubits min_qbits = min_qubits max_qbits = max_qubits skp_qubits = skip_qubits print(f"min, max qubits = {min_qubits} {max_qubits}") # Execute Benchmark Program N times for multiple circuit sizes for num_qubits in range(min_qubits, max_qubits + 1, skip_qubits): fidelity_data[num_qubits] = [] Hf_fidelity_data[num_qubits] = [] # reset random seed np.random.seed(0) # determine number of circuits to execute for this group num_circuits = max(1, max_circuits) print(f"Executing [{num_circuits}] circuits with num_qubits = {num_qubits}") numckts.append(num_circuits) # parameters of simulation #### CANNOT BE MODIFIED W/O ALSO MODIFYING PRECALCULATED DATA ######### w = precalculated_data['w'] # strength of disorder k = precalculated_data['k'] # Trotter error. # A large Trotter order approximates the Hamiltonian evolution better. # But a large Trotter order also means the circuit is deeper. # For ideal or noise-less quantum circuits, k >> 1 gives perfect hamiltonian simulation. t = precalculated_data['t'] # time of simulation ####################################################################### for circuit_id in range(num_circuits): print("*********************************************") print(f"qc of {num_qubits} qubits for circuit_id: {circuit_id}") #creation of Quantum Circuit. ts = time.time() h_x = precalculated_data['h_x'][:num_qubits] # precalculated random numbers between [-1, 1] h_z = precalculated_data['h_z'][:num_qubits] qc = HamiltonianSimulation(num_qubits, K=k, t=t, w=w, h_x= h_x, h_z=h_z) #creation time creation_time = time.time() - ts creation_times.append(creation_time) print(f"creation time = {creation_time*1000} ms") # Calculate gate count for the algorithmic circuit (excluding barriers and measurements) if gate_counts_plots == True: operations = count_operations(qc) n1q = 0; n2q = 0 if operations != None: for key, value in operations.items(): if key == "measure": continue if key == "barrier": continue if key.startswith("c") or key.startswith("mc"): n2q += value else: n1q += value algorithmic_1Q_gate_counts.append(n1q) algorithmic_2Q_gate_counts.append(n2q) # collapse the sub-circuit levels used in this benchmark (for qiskit) qc=qc.decompose() #print(qc) # Calculate circuit depth depth = calculate_circuit_depth(qc) circuit_depths.append(depth) # Calculate transpiled circuit depth transpiled_depth,qc = calculate_transpiled_depth(qc,basis_selector) transpiled_depths.append(transpiled_depth) #print(qc) print(f"Algorithmic Depth = {depth} and Normalized Depth = {transpiled_depth}") if gate_counts_plots == True: # Calculate gate count for the transpiled circuit (excluding barriers and measurements) tr_ops = qc.count_ops() #print("tr_ops = ",tr_ops) tr_n1q = 0; tr_n2q = 0 if tr_ops != None: for key, value in tr_ops.items(): if key == "measure": continue if key == "barrier": continue if key.startswith("c"): tr_n2q += value else: tr_n1q += value transpiled_1Q_gate_counts.append(tr_n1q) transpiled_2Q_gate_counts.append(tr_n2q) print(f"Algorithmic 1Q gates = {n1q} ,Algorithmic 2Q gates = {n2q}") print(f"Normalized 1Q gates = {tr_n1q} ,Normalized 2Q gates = {tr_n2q}") #execution if Type_of_Simulator == "built_in": #To check if Noise is required if Noise_Inclusion == True: noise_model = noise_parameters else: noise_model = None ts = time.time() job = execute(qc, backend, shots=num_shots, noise_model=noise_model) elif Type_of_Simulator == "FAKE" or Type_of_Simulator == "FAKEV2" : ts = time.time() job = backend.run(qc,shots=num_shots, noise_model=noise_parameters) #retrieving the result result = job.result() #print(result) #calculating elapsed time elapsed_time = time.time() - ts elapsed_times.append(elapsed_time) # Calculate quantum processing time quantum_time = result.time_taken quantum_times.append(quantum_time) print(f"Elapsed time = {elapsed_time*1000} ms and Quantum Time = {quantum_time*1000} ms") #counts in result object counts = result.get_counts() #Correct distribution to compare with counts correct_dist = analyzer(num_qubits) #fidelity calculation comparision of counts and correct_dist fidelity_dict = polarization_fidelity(counts, correct_dist) fidelity_data[num_qubits].append(fidelity_dict['fidelity']) Hf_fidelity_data[num_qubits].append(fidelity_dict['hf_fidelity']) #maximum memory utilization (if required) if Memory_utilization_plot == True: max_mem = get_memory() print(f"Maximum Memory Utilized: {max_mem} MB") mem_usage.append(max_mem) print("*********************************************") ########## # print a sample circuit print("Sample Circuit:"); print(QC_ if QC_ != None else " ... too large!") if _use_XX_YY_ZZ_gates: print("\nXX, YY, ZZ =") print(XX_); print(YY_); print(ZZ_) else: print("\nXXYYZZ_opt =") print(XXYYZZ_) return (creation_times, elapsed_times, quantum_times, circuit_depths, transpiled_depths, fidelity_data, Hf_fidelity_data, numckts , algorithmic_1Q_gate_counts, algorithmic_2Q_gate_counts, transpiled_1Q_gate_counts, transpiled_2Q_gate_counts,mem_usage) # Execute the benchmark program, accumulate metrics, and calculate circuit depths (creation_times, elapsed_times, quantum_times, circuit_depths,transpiled_depths, fidelity_data, Hf_fidelity_data, numckts, algorithmic_1Q_gate_counts, algorithmic_2Q_gate_counts, transpiled_1Q_gate_counts, transpiled_2Q_gate_counts,mem_usage) = run() # Define the range of qubits for the x-axis num_qubits_range = range(min_qbits, max_qbits+1,skp_qubits) print("num_qubits_range =",num_qubits_range) # Calculate average creation time, elapsed time, quantum processing time, and circuit depth for each number of qubits avg_creation_times = [] avg_elapsed_times = [] avg_quantum_times = [] avg_circuit_depths = [] avg_transpiled_depths = [] avg_1Q_algorithmic_gate_counts = [] avg_2Q_algorithmic_gate_counts = [] avg_1Q_Transpiled_gate_counts = [] avg_2Q_Transpiled_gate_counts = [] max_memory = [] start = 0 for num in numckts: avg_creation_times.append(np.mean(creation_times[start:start+num])) avg_elapsed_times.append(np.mean(elapsed_times[start:start+num])) avg_quantum_times.append(np.mean(quantum_times[start:start+num])) avg_circuit_depths.append(np.mean(circuit_depths[start:start+num])) avg_transpiled_depths.append(np.mean(transpiled_depths[start:start+num])) if gate_counts_plots == True: avg_1Q_algorithmic_gate_counts.append(int(np.mean(algorithmic_1Q_gate_counts[start:start+num]))) avg_2Q_algorithmic_gate_counts.append(int(np.mean(algorithmic_2Q_gate_counts[start:start+num]))) avg_1Q_Transpiled_gate_counts.append(int(np.mean(transpiled_1Q_gate_counts[start:start+num]))) avg_2Q_Transpiled_gate_counts.append(int(np.mean(transpiled_2Q_gate_counts[start:start+num]))) if Memory_utilization_plot == True:max_memory.append(np.max(mem_usage[start:start+num])) start += num # Calculate the fidelity data avg_f, avg_Hf = plot_fidelity_data(fidelity_data, Hf_fidelity_data, "Fidelity Comparison") # Plot histograms for average creation time, average elapsed time, average quantum processing time, and average circuit depth versus the number of qubits # Add labels to the bars def autolabel(rects,ax,str='{:.3f}',va='top',text_color="black"): for rect in rects: height = rect.get_height() ax.annotate(str.format(height), # Formatting to two decimal places xy=(rect.get_x() + rect.get_width() / 2, height / 2), xytext=(0, 0), textcoords="offset points", ha='center', va=va,color=text_color,rotation=90) bar_width = 0.3 # Determine the number of subplots and their arrangement if Memory_utilization_plot and gate_counts_plots: fig, (ax1, ax2, ax3, ax4, ax5, ax6, ax7) = plt.subplots(7, 1, figsize=(18, 30)) # Plotting for both memory utilization and gate counts # ax1, ax2, ax3, ax4, ax5, ax6, ax7 are available elif Memory_utilization_plot: fig, (ax1, ax2, ax3, ax6, ax7) = plt.subplots(5, 1, figsize=(18, 30)) # Plotting for memory utilization only # ax1, ax2, ax3, ax6, ax7 are available elif gate_counts_plots: fig, (ax1, ax2, ax3, ax4, ax5, ax6) = plt.subplots(6, 1, figsize=(18, 30)) # Plotting for gate counts only # ax1, ax2, ax3, ax4, ax5, ax6 are available else: fig, (ax1, ax2, ax3, ax6) = plt.subplots(4, 1, figsize=(18, 30)) # Default plotting # ax1, ax2, ax3, ax6 are available fig.suptitle(f"General Benchmarks : {platform} - {benchmark_name}", fontsize=16) for i in range(len(avg_creation_times)): #converting seconds to milli seconds by multiplying 1000 avg_creation_times[i] *= 1000 ax1.set_xticks(range(min(num_qubits_range), max(num_qubits_range)+1, skp_qubits)) x = ax1.bar(num_qubits_range, avg_creation_times, color='deepskyblue') autolabel(ax1.patches, ax1) ax1.set_xlabel('Number of Qubits') ax1.set_ylabel('Average Creation Time (ms)') ax1.set_title('Average Creation Time vs Number of Qubits',fontsize=14) ax2.set_xticks(range(min(num_qubits_range), max(num_qubits_range)+1, skp_qubits)) for i in range(len(avg_elapsed_times)): #converting seconds to milli seconds by multiplying 1000 avg_elapsed_times[i] *= 1000 for i in range(len(avg_quantum_times)): #converting seconds to milli seconds by multiplying 1000 avg_quantum_times[i] *= 1000 Elapsed= ax2.bar(np.array(num_qubits_range) - bar_width / 2, avg_elapsed_times, width=bar_width, color='cyan', label='Elapsed Time') Quantum= ax2.bar(np.array(num_qubits_range) + bar_width / 2, avg_quantum_times,width=bar_width, color='deepskyblue',label ='Quantum Time') autolabel(Elapsed,ax2,str='{:.1f}') autolabel(Quantum,ax2,str='{:.1f}') ax2.set_xlabel('Number of Qubits') ax2.set_ylabel('Average Time (ms)') ax2.set_title('Average Time vs Number of Qubits') ax2.legend() ax3.set_xticks(range(min(num_qubits_range), max(num_qubits_range)+1, skp_qubits)) Normalized = ax3.bar(np.array(num_qubits_range) - bar_width / 2, avg_transpiled_depths, color='cyan', label='Normalized Depth', width=bar_width) # Adjust width here Algorithmic = ax3.bar(np.array(num_qubits_range) + bar_width / 2,avg_circuit_depths, color='deepskyblue', label='Algorithmic Depth', width=bar_width) # Adjust width here autolabel(Normalized,ax3,str='{:.2f}') autolabel(Algorithmic,ax3,str='{:.2f}') ax3.set_xlabel('Number of Qubits') ax3.set_ylabel('Average Circuit Depth') ax3.set_title('Average Circuit Depth vs Number of Qubits') ax3.legend() if gate_counts_plots == True: ax4.set_xticks(range(min(num_qubits_range), max(num_qubits_range)+1, skp_qubits)) Normalized_1Q_counts = ax4.bar(np.array(num_qubits_range) - bar_width / 2, avg_1Q_Transpiled_gate_counts, color='cyan', label='Normalized Gate Counts', width=bar_width) # Adjust width here Algorithmic_1Q_counts = ax4.bar(np.array(num_qubits_range) + bar_width / 2, avg_1Q_algorithmic_gate_counts, color='deepskyblue', label='Algorithmic Gate Counts', width=bar_width) # Adjust width here autolabel(Normalized_1Q_counts,ax4,str='{}') autolabel(Algorithmic_1Q_counts,ax4,str='{}') ax4.set_xlabel('Number of Qubits') ax4.set_ylabel('Average 1-Qubit Gate Counts') ax4.set_title('Average 1-Qubit Gate Counts vs Number of Qubits') ax4.legend() ax5.set_xticks(range(min(num_qubits_range), max(num_qubits_range)+1, skp_qubits)) Normalized_2Q_counts = ax5.bar(np.array(num_qubits_range) - bar_width / 2, avg_2Q_Transpiled_gate_counts, color='cyan', label='Normalized Gate Counts', width=bar_width) # Adjust width here Algorithmic_2Q_counts = ax5.bar(np.array(num_qubits_range) + bar_width / 2, avg_2Q_algorithmic_gate_counts, color='deepskyblue', label='Algorithmic Gate Counts', width=bar_width) # Adjust width here autolabel(Normalized_2Q_counts,ax5,str='{}') autolabel(Algorithmic_2Q_counts,ax5,str='{}') ax5.set_xlabel('Number of Qubits') ax5.set_ylabel('Average 2-Qubit Gate Counts') ax5.set_title('Average 2-Qubit Gate Counts vs Number of Qubits') ax5.legend() ax6.set_xticks(range(min(num_qubits_range), max(num_qubits_range)+1, skp_qubits)) Hellinger = ax6.bar(np.array(num_qubits_range) - bar_width / 2, avg_Hf, width=bar_width, label='Hellinger Fidelity',color='cyan') # Adjust width here Normalized = ax6.bar(np.array(num_qubits_range) + bar_width / 2, avg_f, width=bar_width, label='Normalized Fidelity', color='deepskyblue') # Adjust width here autolabel(Hellinger,ax6,str='{:.2f}') autolabel(Normalized,ax6,str='{:.2f}') ax6.set_xlabel('Number of Qubits') ax6.set_ylabel('Average Value') ax6.set_title("Fidelity Comparison") ax6.legend() if Memory_utilization_plot == True: ax7.set_xticks(range(min(num_qubits_range), max(num_qubits_range)+1, skp_qubits)) x = ax7.bar(num_qubits_range, max_memory, color='turquoise', width=bar_width, label="Memory Utilizations") autolabel(ax7.patches, ax7) ax7.set_xlabel('Number of Qubits') ax7.set_ylabel('Maximum Memory Utilized (MB)') ax7.set_title('Memory Utilized vs Number of Qubits',fontsize=14) plt.tight_layout(rect=[0, 0, 1, 0.96]) if saveplots == True: plt.savefig("ParameterPlotsSample.jpg") plt.show() # Quantum Volume Plot Suptitle = f"Volumetric Positioning - {platform}" appname=benchmark_name if QV_ == None: QV=2048 else: QV=QV_ depth_base =2 ax = plot_volumetric_background(max_qubits=max_qbits, QV=QV,depth_base=depth_base, suptitle=Suptitle, colorbar_label="Avg Result Fidelity") w_data = num_qubits_range # determine width for circuit w_max = 0 for i in range(len(w_data)): y = float(w_data[i]) w_max = max(w_max, y) d_tr_data = avg_transpiled_depths f_data = avg_f plot_volumetric_data(ax, w_data, d_tr_data, f_data, depth_base, fill=True,label=appname, labelpos=(0.4, 0.6), labelrot=15, type=1, w_max=w_max) anno_volumetric_data(ax, depth_base,label=appname, labelpos=(0.4, 0.6), labelrot=15, type=1, fill=False)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# Import general libraries (needed for functions) import numpy as np import time # Import Qiskit classes import qiskit from qiskit import QuantumRegister, QuantumCircuit, ClassicalRegister, Aer from qiskit.providers.aer import noise from qiskit.tools.visualization import plot_histogram # Import measurement calibration functions from qiskit.ignis.mitigation.measurement import (complete_meas_cal, CompleteMeasFitter, MeasurementFilter) # Generate the calibration circuits qr = qiskit.QuantumRegister(5) meas_calibs, state_labels = complete_meas_cal(qubit_list=[2,3,4], qr=qr, circlabel='mcal') state_labels # Execute the calibration circuits without noise backend = qiskit.Aer.get_backend('qasm_simulator') job = qiskit.execute(meas_calibs, backend=backend, shots=1000) cal_results = job.result() # The calibration matrix without noise is the identity matrix meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') print(meas_fitter.cal_matrix) # Generate a noise model for the 5 qubits noise_model = noise.NoiseModel() for qi in range(5): read_err = noise.errors.readout_error.ReadoutError([[0.9, 0.1],[0.25,0.75]]) noise_model.add_readout_error(read_err, [qi]) # Execute the calibration circuits backend = qiskit.Aer.get_backend('qasm_simulator') job = qiskit.execute(meas_calibs, backend=backend, shots=1000, noise_model=noise_model) cal_results = job.result() # Calculate the calibration matrix with the noise model meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') print(meas_fitter.cal_matrix) # Plot the calibration matrix meas_fitter.plot_calibration() # What is the measurement fidelity? print("Average Measurement Fidelity: %f" % meas_fitter.readout_fidelity()) # What is the measurement fidelity of Q0? print("Average Measurement Fidelity of Q0: %f" % meas_fitter.readout_fidelity( label_list = [['000','001','010','011'],['100','101','110','111']])) # Make a 3Q GHZ state cr = ClassicalRegister(3) ghz = QuantumCircuit(qr, cr) ghz.h(qr[2]) ghz.cx(qr[2], qr[3]) ghz.cx(qr[3], qr[4]) ghz.measure(qr[2],cr[0]) ghz.measure(qr[3],cr[1]) ghz.measure(qr[4],cr[2]) job = qiskit.execute([ghz], backend=backend, shots=5000, noise_model=noise_model) results = job.result() # Results without mitigation raw_counts = results.get_counts() # Get the filter object meas_filter = meas_fitter.filter # Results with mitigation mitigated_results = meas_filter.apply(results) mitigated_counts = mitigated_results.get_counts(0) from qiskit.tools.visualization import * plot_histogram([raw_counts, mitigated_counts], legend=['raw', 'mitigated'])
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
#Import general libraries (needed for functions) import numpy as np import matplotlib.pyplot as plt from IPython import display #Import Qiskit classes classes import qiskit from qiskit.providers.aer.noise import NoiseModel from qiskit.providers.aer.noise.errors.standard_errors import depolarizing_error, thermal_relaxation_error #Import the RB Functions import qiskit.ignis.verification.randomized_benchmarking as rb #Generate RB circuits (2Q RB) #number of qubits nQ=2 rb_opts = {} #Number of Cliffords in the sequence rb_opts['length_vector'] = [1, 10, 20, 50, 75, 100, 125, 150, 175] #Number of seeds (random sequences) rb_opts['nseeds'] = 5 #Default pattern rb_opts['rb_pattern'] = [[0,1]] rb_circs, xdata = rb.randomized_benchmarking_seq(**rb_opts) print(rb_circs[0][0]) # Create a new circuit without the measurement qc = qiskit.QuantumCircuit(*rb_circs[0][-1].qregs,*rb_circs[0][-1].cregs) for i in rb_circs[0][-1][0:-nQ]: qc._attach(i) # The Unitary is an identity (with a global phase) backend = qiskit.Aer.get_backend('unitary_simulator') basis_gates = ['u1','u2','u3','cx'] # use U,CX for now basis_gates_str = ','.join(basis_gates) job = qiskit.execute(qc, backend=backend, basis_gates=basis_gates_str) print(np.around(job.result().get_unitary(),3)) # Run on a noisy simulator noise_model = NoiseModel() # Depolarizing_error dp = 0.002 noise_model.add_all_qubit_quantum_error(depolarizing_error(dp, 1), ['u1', 'u2', 'u3']) noise_model.add_all_qubit_quantum_error(depolarizing_error(dp, 2), 'cx') backend = qiskit.Aer.get_backend('qasm_simulator') qobj_list = [] # Create the RB fitter rb_fit = rb.RBFitter(None, xdata, rb_opts['rb_pattern']) for rb_seed,rb_circ_seed in enumerate(rb_circs): qobj = qiskit.compile(rb_circ_seed, backend=backend, basis_gates=basis_gates_str) job = backend.run(qobj, noise_model=noise_model) qobj_list.append(qobj) # Add data to the fitter rb_fit.add_data(job.result()) print('After seed %d, alpha: %f, EPC: %f'%(rb_seed,rb_fit.fit[0]['params'][1], rb_fit.fit[0]['epc'])) plt.figure(figsize=(8, 6)) ax = plt.subplot(1, 1, 1) # Plot the essence by calling plot_rb_data rb_fit.plot_rb_data(0, ax=ax, add_label=True, show_plt=False) # Add title and label ax.set_title('%d Qubit RB'%(nQ), fontsize=18) plt.show() #Count the number of single and 2Q gates in the 2Q Cliffords gates_per_cliff = rb.rb_utils.gates_per_clifford(qobj_list,xdata[0],basis_gates,rb_opts['rb_pattern'][0]) for i in range(len(basis_gates)): print("Number of %s gates per Clifford: %f"%(basis_gates[i], np.mean([gates_per_cliff[0][i],gates_per_cliff[0][i]]))) # Prepare lists of the number of qubits and the errors ngates = np.zeros(7) ngates[0:3] = gates_per_cliff[0][0:3] ngates[3:6] = gates_per_cliff[1][0:3] ngates[6] = gates_per_cliff[0][3] gate_qubits = np.array([0,0,0,1,1,1,-1], dtype=int) gate_errs = np.zeros(len(gate_qubits)) gate_errs[[1,4]] = dp/2 #convert from depolarizing error to epg (1Q) gate_errs[[2,5]] = 2*dp/2 #convert from depolarizing error to epg (1Q) gate_errs[6] = dp*3/4 #convert from depolarizing error to epg (2Q) #Calculate the predicted epc pred_epc = rb.rb_utils.twoQ_clifford_error(ngates,gate_qubits,gate_errs) print("Predicted 2Q Error per Clifford: %e"%pred_epc)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import numpy as np import itertools import qiskit from qiskit import QuantumRegister, QuantumCircuit from qiskit import Aer import qiskit.ignis.verification.tomography as tomo from qiskit.quantum_info import state_fidelity I = np.array([[1,0],[0,1]]) X = np.array([[0,1],[1,0]]) Y = np.array([[0,-1j],[1j,0]]) Z = np.array([[1,0],[0,-1]]) def HS_product(A,B): return 0.5*np.trace(np.conj(B).T @ A) PX0 = 0.5*np.array([[1, 1], [1, 1]]) PX1 = 0.5*np.array([[1, -1], [-1, 1]]) PY0 = 0.5*np.array([[1, -1j], [1j, 1]]) PY1 = 0.5*np.array([[1, 1j], [-1j, 1]]) PZ0 = np.array([[1, 0], [0, 0]]) PZ1 = np.array([[0, 0], [0, 1]]) projectors = [PX0, PX1, PY0, PY1, PZ0, PZ1] M = np.array([p.flatten() for p in projectors]) M M_dg = np.conj(M).T linear_inversion_matrix = np.linalg.inv(M_dg @ M) @ M_dg projectors_2 = [np.kron(p1, p2) for (p1, p2) in itertools.product(projectors, repeat = 2)] M_2 = np.array([p.flatten() for p in projectors_2]) M_dg_2 = np.conj(M_2).T linear_inversion_matrix_2 = np.linalg.inv(M_dg_2 @ M_2) @ M_dg_2 q2 = QuantumRegister(2) bell = QuantumCircuit(q2) bell.h(q2[0]) bell.cx(q2[0], q2[1]) bell.qasm() qst_bell = tomo.state_tomography_circuits(bell, q2) job = qiskit.execute(qst_bell, Aer.get_backend('qasm_simulator'), shots=5000) statefit = tomo.StateTomographyFitter(job.result(), qst_bell) statefit.data p, M, weights = statefit._fitter_data(True, 0.5) M_dg = np.conj(M).T linear_inversion_matrix = np.linalg.inv(M_dg @ M) @ M_dg rho_bell = linear_inversion_matrix @ p rho_bell = np.reshape(rho_bell, (4, 4)) print(rho_bell) job = qiskit.execute(bell, Aer.get_backend('statevector_simulator')) psi_bell = job.result().get_statevector(bell) F_bell = state_fidelity(psi_bell, rho_bell) print('Fit Fidelity linear inversion =', F_bell) rho_cvx_bell = statefit.fit(method='cvx') F_bell = state_fidelity(psi_bell, rho_cvx_bell) print('Fit Fidelity CVX fit =', F_bell) rho_mle_bell = statefit.fit(method='lstsq') F_bell = state_fidelity(psi_bell, rho_mle_bell) print('Fit Fidelity MLE fit =', F_bell)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import ClassicalRegister, QuantumRegister from qiskit import QuantumCircuit, execute from qiskit import register, available_backends, get_backend #import Qconfig and set APIToken and API url import sys sys.path.append("../../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} #set api register(qx_config['APItoken'], qx_config['url']) import math, scipy, copy, time import numpy as np def AddDelay (script,q,num,delay): for _ in range(delay): for address in range(num): script.iden(q[address]) def AddCnot(script,q,control,target,device): # set the coupling map # b in coupling_map[a] means a CNOT with control qubit a and target qubit b can be implemented # this is essentially just copy and pasted from # https://github.com/IBM/qiskit-qx-info/tree/master/backends/ibmqx3 # https://github.com/IBM/qiskit-qx-info/tree/master/backends/ibmqx5 # but with a few stylistic changes coupling_map = {} coupling_map['ibmqx3'] = {0: [1], 1: [2], 2: [3], 3: [14], 4: [3, 5], 5: [], 6: [7, 11], 7: [10], 8: [7], 9: [10, 8], 10:[], 11: [10], 12: [5, 11, 13], 13: [4, 14], 14:[], 15: [0, 14]} coupling_map['ibmqx5'] = {0:[],1:[0,2], 2:[3], 3:[4, 14], 4:[], 5:[4], 6:[5,7,11], 7:[10], 8:[7], 9:[8, 10], 10:[], 11:[10], 12:[5, 11, 13], 13:[4, 14], 14:[], 15:[0, 2, 14]} simulator = (device not in ['ibmqx3','ibmqx5']) # if simulator, just do the CNOT if simulator: script.cx(q[control], q[target]) # same if the coupling map allows it elif target in coupling_map[device][control]: script.cx(q[control], q[target]) # if it can be done the other way round we conjugate with Hadamards elif ( control in coupling_map[device][target] ): script.h(q[control]) script.h(q[target]) script.cx(q[target], q[control]) script.h(q[control]) script.h(q[target]) else: print('Qubits ' + str(control) + ' and ' + str(target) + ' cannot be entangled.') def GetAddress (codeQubit,offset,simulator): if (simulator): address = 2*codeQubit + offset else: address = (5-2*codeQubit-offset)%16 #address = (6+2*codeQubit+offset)%16 # this can be used to go clockwise instead return address def RunRepetition(bit,d,device,delay,totalRuns): # set the number of shots to use on the backend shots = 8192 # determine whether a simulator is used simulator = (device not in ['ibmqx3','ibmqx5']) # if the simulator is used, we declare the minimum number of qubits required if (simulator): num = 2*d # for the real device there are always 16 else: num = 16 repetitionScript = [] # we create a batch job of totalRuns identical runs for run in range(totalRuns): # set up registers and program q = QuantumRegister(num) c = ClassicalRegister(num) repetitionScript.append( QuantumCircuit(q, c) ) # now we insert all the quantum gates to be applied # a barrier is inserted between each section of the code to prevent the complilation doing things we don't want it to # the stored bit is initialized by repeating it across all code qubits same state # since qubits are automatically initialized as 0, we just need to do Xs if b=1 if (bit==1): for codeQubit in range(d): repetitionScript[run].x( q[GetAddress(codeQubit,0,simulator)] ) # also do it for the single qubit on the end for comparision repetitionScript[run].x( q[GetAddress(d-1,1,simulator)] ) repetitionScript[run].barrier() # if the code is simulated add rotations for error like effects (and a barrier) AddDelay(repetitionScript[run],q,num,delay) # we then start the syndrome measurements by doing CNOTs between each code qubit and the next ancilla along the line for codeQubit in range(d-1): AddCnot(repetitionScript[run],q,GetAddress(codeQubit,0,simulator),GetAddress(codeQubit,1,simulator),device) repetitionScript[run].barrier() # if the code is simulated add rotations for error like effects (and a barrier) AddDelay(repetitionScript[run],q,num,delay) # next we perform CNOTs between each code qubit and the previous ancilla along the line for codeQubit in range(1,d): AddCnot(repetitionScript[run],q,GetAddress(codeQubit,0,simulator),GetAddress(codeQubit,-1,simulator),device) repetitionScript[run].barrier() # if the code is simulated add rotations for error like effects (and a barrier) AddDelay(repetitionScript[run],q,num,delay) # all qubits are then measured for address in range(num): repetitionScript[run].measure(q[address], c[address]) # noise is turned on if simulator is used #repetitionScript[run].noise(int(simulator)) # run the job (if the device is available) backends = available_backends() backend = get_backend(device) print('Status of '+device+':',backend.status) dataNeeded = True while dataNeeded==True: if backend.status["available"] is True: print("\nThe device is available, so the following job is being submitted.\n") print(repetitionScript[1].qasm()) shots_device = 1000 job = execute(repetitionScript, backend, shots=shots, skip_translation=True) results = [] for run in range(totalRuns): results.append( job.result().get_counts(repetitionScript[run]) ) dataNeeded = False else: print("\nThe device is not available, so we will wait for a while.") time.sleep(600) # the raw data states the number of runs for which each outcome occurred # we convert this to fractions before output. for run in range(totalRuns): for key in results[run].keys(): results[run][key] = results[run][key]/shots # return the results return results def AddProbToResults(prob,string,results): if string not in results.keys(): results[string] = 0 results[string] += prob def CalculateError(encodedBit,results,table): # total prob of error will be caculated by looping over all strings # some will end up being ignored, so we'll also need to renormalize error = 0 renorm = 1 # all strings from our sample are looped over for string in results.keys(): # we find the probability P(string|encodedBit) from the lookup table right = 0 if string in table[encodedBit].keys(): right = table[encodedBit][string] # as is the probability P(string|!encodedBit) wrong = 0 if string in table[(encodedBit+1)%2].keys(): wrong = table[(encodedBit+1)%2][string] # if this is a string for which P(string|!encodedBit)>P(string|encodedBit), the decoding fails # the probabilty for this sample is then added to the error if (wrong>right): error += results[string] # if P(string|!encodedBit)=P(string|encodedBit)=0 we have no data to decode, so we should ignore this sample # otherwise if P(string|!encodedBit)=P(string|encodedBit), the decoder randomly chooses between them # P(failure|string) is therefore 0.5 in this case elif (wrong==right): if wrong==0: renorm -= results[string] else: error += 0.5*results[string] # otherwise the decoding succeeds, and we don't care about that if renorm==0: error = 1 else: error = error/renorm return error def GetData(device,minSize,maxSize,totalRuns,delay): # loop over code sizes that will fit on the chip (d=3 to d=8) for d in range(minSize,maxSize+1): print("\n\n**d = " + str(d) + "**") # get data for each encoded bit value for bit in range(2): # run the job and put results in resultsRaw results = RunRepetition(bit,d,device,delay,totalRuns) delayString = "" if delay>0: delayString = '_delay='+str(delay) for run in range(totalRuns): f = open('Repetition_Code_Results/'+device+'/results_d=' + str(d) + delayString + '_run=' + str(run) + '_bit=' + str(bit) + '.txt', 'w') f.write( str(results[run]) ) f.close() def ProcessData(device,encodedBit,minSize,maxSize,totalRuns,delay): # determine whether a simulator is used simulator = (device not in ['ibmqx3','ibmqx5']) # initialize list used to store the calculated means and variances for results from the codes codeResults = [[[0]*4 for _ in range(j)] for j in range(minSize,maxSize+1)] singleResults = [[[0]*2 for _ in range(16)] for _ in range(minSize,maxSize+1)] # singleResults[d-minSize][j][0] is the probability of state 1 for qubit j when used in a code of distance d # singleResults[d-minSize][j][1] is the variance for the above # the results will show that the case of partial decoding requires more analysis # for this reason we will also output combinedCodeResults, which is all runs of codeResults combined # here we initialize list of combined results from the code only case combinedResultsCode = [[{} for _ in range(minSize,maxSize+1) ] for _ in range(2)] for d in range(minSize,maxSize+1): # we loop over code sizes and runs to create the required dictionaries of data: # resultsFull, resultsCode and resultsSingle (and well as the things used to make them) # the results that come fresh from the backend resultsVeryRaw = [[{} for _ in range(2)] for run in range(0,totalRuns)] resultsRaw = [[{} for _ in range(2)] for run in range(0,totalRuns)] # the results from the full code (including ancillas) # resultsFull[k] gives results for the effective distance d-k code obtained by ignoring the last k code qubits and ancillas resultsFull = [[[{} for _ in range(d)] for _ in range(2)] for run in range(0,totalRuns)] # the same but with ancilla results excluded resultsCode = [[[{} for _ in range(d)] for _ in range(2)] for run in range(0,totalRuns)] # results each single bit resultsSingle = [[[{} for _ in range(16)] for _ in range(2)] for run in range(0,totalRuns)] for run in range(0,totalRuns): # we get results for both possible encoded bits for bit in range(2): delayString = "" if delay>0: delayString = '_delay='+str(delay) # get results for this run from file f = open('Repetition_Code_Results/'+device+'/results_d=' + str(d) + delayString + '_run=' + str(run) + '_bit=' + str(bit) + '.txt') resultsVeryRaw[run][bit] = eval(f.read()) f.close() # loop over all keys in the raw results and look at the ones without strings as values # since all such entries should have a bit string as a key, we call it stringVeryRaw for stringVeryRaw in resultsVeryRaw[run][bit].keys(): if resultsVeryRaw[run][bit][stringVeryRaw] is not str: # create a new dictionary in which each key is padded to a bit string of length 16 stringRaw = stringVeryRaw.rjust(16,'0') resultsRaw[run][bit][stringRaw] = resultsVeryRaw[run][bit][stringVeryRaw] # now stringRaw only has data in the correct format # let's loop over its entries and process stuff for stringRaw in resultsRaw[run][bit].keys(): # get the prob corresponding to this string probToAdd = resultsRaw[run][bit][stringRaw] # first we deal with resultsFull and resultsCode # loop over all truncated codes relevant for this d for k in range(d): # distance of this truncated code dd = d-k # extract the bit string relevant for resultsFull # from left to right this will alternate between code and ancilla qubits in increasing order stringFull = '' for codeQubit in range(dd): # add bit value for a code qubit... stringFull += stringRaw[15-GetAddress(codeQubit,0,simulator)] if (codeQubit!=(d-1)): #...and then the ancilla next to it (if we haven't reached the end of the code) stringFull += stringRaw[15-GetAddress(codeQubit,1,simulator)] # remove ancilla bits from this to get the string for resultsCode stringCode = "" for n in range(dd): stringCode += stringFull[2*n] AddProbToResults(probToAdd,stringFull,resultsFull[run][bit][k]) AddProbToResults(probToAdd,stringCode,resultsCode[run][bit][k]) # now we'll do results single # the qubits are listed in the order they are in the code # so for each code qubit for jj in range(8): # loop over it and its neighbour for offset in range(2): stringSingle = stringRaw[15-GetAddress(jj,offset,simulator)] AddProbToResults(probToAdd,stringSingle,resultsSingle[run][bit][2*jj+offset]) # combined this run's resultsCode with the total, using the k=0 values for stringCode in resultsCode[run][bit][0].keys(): probToAdd = resultsCode[run][bit][0][stringCode]/10 AddProbToResults(probToAdd,stringCode,combinedResultsCode[bit][d-minSize]) for run in range(0,totalRuns): # initialize list used to store the calculated means and variances for results from the codes codeSample = [[0]*2 for _ in range(d)] # here # codeSample gives the results # codeSample[0] gives results for the whole code # codeSample[k][0] is the error prob when decoding uses both code and ancilla qubits # codeSample[k][1] is the error prob when decoding uses only code qubits singleSample = [0]*16 # singleSample[j] is the probability of state 1 for qubit j when the required bit value is encoded # write results in for k in range(d): # calculate look up tables by averaging over all other runs fullTable = [{} for _ in range(2)] codeTable = [{} for _ in range(2)] for b in range(2): for r in [rr for rr in range(totalRuns) if rr!=run]: for string in resultsFull[r][b][k]: AddProbToResults(resultsFull[r][b][k][string]/(totalRuns-1),string,fullTable[b]) for string in resultsCode[r][b][k]: AddProbToResults(resultsCode[r][b][k][string]/(totalRuns-1),string,codeTable[b]) # then calculate corresponding errors codeSample[k][0] = CalculateError(encodedBit,resultsFull[run][encodedBit][k],fullTable) codeSample[k][1] = CalculateError(encodedBit,resultsCode[run][encodedBit][k],codeTable) for j in range(16): if '1' in resultsSingle[run][encodedBit][j].keys(): singleSample[j] = resultsSingle[run][encodedBit][j]['1'] # add results from this run to the overall means and variances for k in range(d): for l in range(2): codeResults[d-minSize][k][2*l] += codeSample[k][l] / totalRuns # means codeResults[d-minSize][k][2*l+1] += codeSample[k][l]**2 / totalRuns # variances for j in range(16): singleResults[d-minSize][j][0] += singleSample[j] / totalRuns singleResults[d-minSize][j][1] += singleSample[j]**2 / totalRuns # finish the variances by subtracting the square of the mean for k in range(d): for l in range(1,2,4): codeResults[d-minSize][k][l] -= codeResults[d-minSize][k][l-1]**2 for j in range(16): singleResults[d-minSize][j][1] -= singleResults[d-minSize][j][0]**2 # return processed results return codeResults, singleResults, combinedResultsCode def MakeGraph(X,Y,y,axisLabel,labels=[],legendPos='upper right',verbose=False,log=False,tall=False): from matplotlib import pyplot as plt plt.rcParams.update({'font.size': 30}) markers = ["o","^","h","D","*"] # if verbose, print the numbers to screen if verbose==True: print("\nX values") print(X) for j in range(len(Y)): print("\nY values for "+labels[j]) print(Y[j]) print("\nError bars") print(y[j]) print("") # convert the variances of varY into widths of error bars for j in range(len(y)): for k in range(len(y[j])): y[j][k] = math.sqrt(y[j][k]/2) if tall: plt.figure(figsize=(20,20)) else: plt.figure(figsize=(20,10)) # add in the series for j in range(len(Y)): marker = markers[j%len(markers)] if labels==[]: plt.errorbar(X, Y[j], marker = marker, markersize=20, yerr = y[j], linewidth=5) else: plt.errorbar(X, Y[j], label=labels[j], marker = marker, markersize=20, yerr = y[j], linewidth=5) plt.legend(loc=legendPos) # label the axes plt.xlabel(axisLabel[0]) plt.ylabel(axisLabel[1]) # make sure X axis is fully labelled plt.xticks(X) # logarithms if required if log==True: plt.yscale('log') # make the graph plt.show() plt.rcParams.update(plt.rcParamsDefault) # set device to use # this also sets the maximum d. We only go up to 6 on the simulator userInput = input("Do you want results for a real device? (input Y or N) If not, results will be from a simulator. \n").upper() if (userInput=="Y"): device = 'ibmqx3' else: device = 'ibmq_qasm_simulator' # determine the delay userInput = input("What value of the delay do you want results for? \n").upper() delay = 0 try: delay = int(userInput) except: pass # determine the code sizes to be considered userInput = input("What is the minimum size code you wish to consider? (input 3, 4, 5, 6, 7 or 8) \n").upper() if userInput in ['3','4','5','6','7','8']: minSize = int(userInput) else: minSize = 3 userInput = input("What is the maximum size code you wish to consider? (input a number no less than the minimum, but no larger than 8) \n").upper() if userInput in ['3','4','5','6','7','8']: maxSize = int(userInput) else: maxSize = 8 # determine whether data needs to be taken if device=='ibmqx5': dataAlready = True else: userInput = input("Do you want to process saved data? (Y/N) If not, new data will be obtained. \n").upper() if (userInput=="Y"): dataAlready = True else: dataAlready = False # set number of runs used for stats # totalRuns is for a repetition code of length d totalRuns = 10 # if we need data, we get it if (dataAlready==False): # get the required data for the desired number of runs GetData(device,minSize,maxSize,totalRuns,delay) codeResults = [[],[]] singleResults = [[],[]] for encodedBit in range(2): try: codeResults[encodedBit], singleResults[encodedBit], combinedResultsCode = ProcessData(device,encodedBit,minSize,maxSize,totalRuns,delay) except Exception as e: print(e) # plot for single qubit data for each code distance for d in range(minSize,maxSize+1): X = range(16) Y = [] y = [] # a series for each encoded bit for encodedBit in range(2): Y.append([singleResults[encodedBit][d-minSize][j][0] for j in range(16)]) y.append([singleResults[encodedBit][d-minSize][j][1] for j in range(16)]) # make graph print("\n\n***Final state of each qubit for code of distance d = " + str(d) + "***") MakeGraph(X,Y,y,['Qubit position in code','Probability of 1']) for encodedBit in range(2): # separate plots for each encoded bit X = range(minSize,maxSize+1) Y = [] y = [] for dec in range(2): # dec=0 corresponds to full decoding, and 1 to partial Y.append([codeResults[encodedBit][d-minSize][0][2*dec+0] for d in range(minSize,maxSize+1)]) y.append([codeResults[encodedBit][d-minSize][0][2*dec+1] for d in range(minSize,maxSize+1)]) # minimum error value for the single qubit memory is found and plotted as a comparsion (with max error bars) simulator = (device not in ['ibmqx3','ibmqx5']) minSingle = min([singleResults[encodedBit][d-minSize][GetAddress(d-1,1,simulator)][0] for d in range(minSize,maxSize+1)]) maxSingle = max([singleResults[encodedBit][d-minSize][GetAddress(d-1,1,simulator)][1] for d in range(minSize,maxSize+1)]) Y.append([minSingle]*(maxSize-minSize+1)) y.append([maxSingle]*(maxSize-minSize+1)) print("\n\n***Encoded " + str(encodedBit) + "***") MakeGraph(X,Y,y,['Code distance, d','Error probability, P'], labels=['Full decoding','Partial decoding','Single qubit memory'],legendPos='lower left',log=True,verbose=True) for encodedBit in range(2): # separate plots for each encoded bit for decoding in ['full','partial']: dec = (decoding=='partial') # this is treated as 0 if full and 1 if partial X = range(1,maxSize+1) Y = [] y = [] labels = [] for d in range(minSize,maxSize+1):# series for each code size seriesY = [math.nan]*(maxSize) seriesy = [math.nan]*(maxSize) for k in range(d): seriesY[d-k-1] = codeResults[encodedBit][d-minSize][k][2*dec+0] seriesy[d-k-1] = codeResults[encodedBit][d-minSize][k][2*dec+1] Y.append(seriesY) y.append(seriesy) labels.append('d='+str(d)) print("\n\n***Encoded " + str(encodedBit) + " with " + dec*"partial" + (1-dec)*"full" + " decoding***") MakeGraph(X,Y,y,['Effective code distance','Logical error probability'], labels=labels,legendPos = 'upper right') def MakeModelTables (q,d): # outputs an array of two dictionaries for the lookup table for a simple model of a distance d code # q[0] is prob of 0->1 noise, and q[1] is prob of 1->0 # no disinction is made between strings with the same number of errors # the prob for all are assigned to a single string, all with 0s on the left and 1s on the right modelResults = [{},{}] bit = ["0","1"] for encodedBit in range(2): for errors in range(d+1): if encodedBit==0: string = "0"*(d-errors)+"1"*errors else: string = "0"*errors+"1"*(d-errors) modelResults[encodedBit][string] = scipy.special.binom(d,errors) * q[encodedBit]**errors * (1-q[encodedBit])**(d-errors) return modelResults def TotalLogical (p0,d,p1=0): # outputs total logical error prob for a single or two round code P0 = CalculateError( encodedBit, MakeModelTables([p0,p0],d)[0], MakeModelTables([p0,p0],d) ) P1 = CalculateError( encodedBit, MakeModelTables([p0,p0],d)[1], MakeModelTables([p1,p1],d) ) return P0*(1-P1) + P1*(1-P0) for encodedBit in range(2): # separate plots for each encoded bit p = [0]*2 # here is where we'll put p_0 and p_1 bar = [0]*2 for dec in [1,0]: # dec=0 corresponds to full decoding, and 1 to partial # get the results we want to fit to realResults = [codeResults[encodedBit][d-minSize][0][2*dec] for d in range(minSize,maxSize+1)] # search possible values intul we find a minimum (assumed to be global) # first we do the partial decoding to get p (which is stored in p[0]) # then the full decoding to get p[1]=p_1 minimizing = True delta = 0.001 q = delta diff =[math.inf,math.inf] while minimizing: q += delta # set new q diff[0] = diff[1] # copy diff value for last p # calculate diff for new q diff[1] = 0 for d in range(minSize,maxSize+1): if dec==1: Q = TotalLogical(q,d) else: Q = TotalLogical(p[0]-q,d,p1=q) diff[1] += ( math.log( realResults[d-minSize] ) - math.log( Q ) )**2 # see if a minimum has been found minimizing = ( diff[0]>diff[1] ) # go back a step on p to get pSum p[1-dec] = q - delta # get diff per qubit bar[1-dec] = math.exp(math.sqrt( diff[0]/(maxSize-minSize+1) )) p[0] = p[0] - p[1] # put p_0 in p[0] (instead of p) print("\n\n***Encoded " + str(encodedBit) + "***\n" ) for j in [0,1]: print(" p_"+str(j)+" = " + str(p[j]) + " with fit values typically differing by a factor of " + str(bar[j]) + "\n") plottedMinSize = max(4,minSize) # we won't print results for d=3 for clarity X = range(plottedMinSize,maxSize+1) Y = [] y = [] # original plots for dec in range(2): # dec=0 corresponds to full decoding, and 1 to partial # results from the device Y.append([codeResults[encodedBit][d-minSize][0][2*dec+0] for d in range(plottedMinSize,maxSize+1)]) y.append([codeResults[encodedBit][d-minSize][0][2*dec+1] for d in range(plottedMinSize,maxSize+1)]) # fit lines for dec in range(2): if dec==1: Y.append([TotalLogical(p[0]+p[1],d) for d in range(plottedMinSize,maxSize+1)]) else: Y.append([TotalLogical(p[0],d,p1=p[1]) for d in range(plottedMinSize,maxSize+1)]) y.append([0]*(maxSize-plottedMinSize+1)) MakeGraph(X,Y,y,['Code distance, d','Error probability, P'], labels=['Full decoding','Partial decoding','Full decoding (model)','Partial decoding (model)'],legendPos='lower left',log=True) # for each code distance and each encoded bit value, we'll create a list of the probabilities for each possible number of errors # list is initialized with zeros errorNum = [[[0]*(d+1) for d in range(minSize,maxSize+1)] for _ in range(2)] for d in range(minSize,maxSize+1): for bit in range(2): # for each code distance and each encoded bit value we look at all possible result strings for string in combinedResultsCode[bit][d-minSize]: # count the number of errors in each string num = 0 for j in range(d): num += ( int( string[j] , 2 ) + bit )%2 # add prob to corresponding number of errors errorNum[bit][d-minSize][num] += combinedResultsCode[bit][d-minSize][string] # the we make a graph for each, and print a title Y0 = [y if y>0 else math.nan for y in errorNum[0][d-minSize]] Y1 = [y if y>0 else math.nan for y in errorNum[1][d-minSize]] print("\n\n***Probability of errors on code qubits for d = " + str(d) + "***") MakeGraph(range(d+1),[Y0,Y1],[[0]*(d+1)]*2,['Number of code qubit errors','Probability (log base 10)'], labels=['Encoded 0','Encoded 1'],legendPos='upper right',log=True) # actually, we make two graphs. This one plots the number of 1s rather than errors, and so the plot for encoded 1 is inverted # Y0 in this graph is as before Y1 = Y1[::-1] # but Y1 has its order inverted print("\n\n***Probability for number of 1s in code qubit result for d = " + str(d) + "***") MakeGraph(range(d+1),[Y0,Y1],[[0]*(d+1)]*2,['Number of 1s in code qubit result','Probability (log base 10)'], labels=['Encoded 0','Encoded 1'],legendPos='center right',log=True)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
%matplotlib inline import matplotlib import numpy as np import matplotlib.pyplot as plt import sympy from sympy import * import itertools from IPython.display import display init_printing() #allows nice math displays class QuantumMatrix(): def __init__(self, m, coeff = 1): self.matrix = sympy.Matrix(m) self.coefficient = coeff self.canonize() def canonize(self): a = next((x for x in self.matrix if x != 0), None) if a is not None: #zero vector for i,j in itertools.product([0,1], [0,1]): self.matrix[i,j] = sympy.simplify(self.matrix[i,j] / a) self.coefficient = sympy.simplify(self.coefficient * a) def __str__(self): coeff_string = "" if self.coefficient != 1: coeff_string = "{} * ".format(self.coefficient) return "{}[[{}, {}], [{}, {}]]".format(coeff_string,self.matrix[0], self.matrix[1], self.matrix[2], self.matrix[3]) def __mul__(self, rhs): return QuantumMatrix(self.matrix * rhs.matrix, self.coefficient * rhs.coefficient) def __add__(self, rhs): temp_rhs_matrix = sympy.Matrix([[1,0],[0,1]]) for i,j in itertools.product([0,1], [0,1]): temp_rhs_matrix[i,j] = sympy.simplify((rhs.matrix[i,j] * self.coefficient) / rhs.coefficient) return QuantumMatrix(self.matrix + temp_rhs_matrix, self.coefficient * 1/sympy.sqrt(2)) def __sub__(self, rhs): return self + QuantumMatrix(rhs.matrix, rhs.coefficient * -1) def __eq__(self, rhs): return (self.matrix == rhs.matrix and self.coefficient == rhs.coefficient) def equiv(self, rhs): return (self.matrix == rhs.matrix) def __iter__(self): for x in self.matrix: yield x X = QuantumMatrix( [[0,1], [1,0]]) Y = QuantumMatrix( [[0,-sympy.I], [sympy.I,0]]) Z = QuantumMatrix( [[1,0], [0,-1]]) I = QuantumMatrix( [[1,0], [0,1]]) print ("The Pauli matrices (when neglecting the global phase):") print ("Identity: I=") display(sympy.Matrix(I.matrix)) print ("X=") display(sympy.Matrix(X.matrix)) print ("Y=") display(sympy.Matrix(Y.matrix)) print ("Z=") display(sympy.Matrix(Z.matrix)) print ("The Pauli gates X,Y,Z are of order 2:") A=X*X print ("X*X=") display(sympy.Matrix(A.matrix)) A=Y*Y print ("Y*Y=") display(sympy.Matrix(A.matrix)) A=Z*Z print ("Z*Z=") display(sympy.Matrix(A.matrix)) print ("For example, one can verify that X*Y=Y*X=Z:") A=X*Y B=Y*X print ("X*Y = Z =") display(sympy.Matrix(A.matrix)) print ("Y*X = Z =") display(sympy.Matrix(B.matrix)) print ("Similarly, X*Z=Z*X=Y, Y*Z=Z*Y=X") H = QuantumMatrix( [[1,1], [1,-1]], 1/sympy.sqrt(2)) print ("Hadamard gate: H=") display(sympy.Matrix(H.matrix)) print ("H is of order 2:") A=H*H print ("H*H =") display(sympy.Matrix(A.matrix)) print ("H operates on the Pauli gates by conjugation as a reflection: X<-->Z:") A=H*X*H print("H*X*H = Z =") display(sympy.Matrix(A.matrix)) A=H*Z*H print("H*Z*H = X =") display(sympy.Matrix(A.matrix)) A=H*Y*H print("H*Y*H = Y =") display(sympy.Matrix(A.matrix)) S = QuantumMatrix( [[1,0], [0,sympy.I]]) print ("Phase gate: S=") display(sympy.Matrix(S.matrix)) print ("Z=S*S, thus S has order 4, and the inverse of S is S*Z:") A=S*S print ("S*S = Z =") display(sympy.Matrix(A.matrix)) print ("The inverse of S: Sdg = S*Z =") Sdg = S*Z display(sympy.Matrix(Sdg.matrix)) print ("Indeed, S*Sdg =") A = S*Sdg display(sympy.Matrix(A.matrix)) print ("S operates on the Pauli gates by conjugation as a reflection: Y<-->Z:") A = S*X*Sdg # =Y print ("S*X*Sdg = Y =") display(sympy.Matrix(A.matrix)) print ("S*Y*Sdg = X =") A = S*Y*Sdg # =X display(sympy.Matrix(A.matrix)) print ("S*Z*Sdg = Z =") A = S*Z*Sdg # =Z display(sympy.Matrix(A.matrix)) print ("We therefore get the commutator relations:") print ("S*X = Y*S and Sdg*Y = X*Sdg") print ("S*Y = X*S and Sdg*X = Y*Sdg") print ("S*Z = Z*S = Sdg and Sdg*Z = Z*Sdg = S") V = H*S*H*S print ("Let: V = H*S*H*S =") display(sympy.Matrix(V.matrix)) print ("V is of order 3:") A=V*V*V print ("V*V*V =") display(sympy.Matrix(A.matrix)) print ("Hence, V = Sdg*H =") A=Sdg*H display(sympy.Matrix(A.matrix)) print ("The inverse of V is: W = S*Z*H*S*Z*H = H*S = ") W=H*S display(sympy.Matrix(W.matrix)) print ("Indeed, W = V*V =") A=V*V display(sympy.Matrix(A.matrix)) print ("V operates on the Pauli gates by conjugation as a rotation: Z-->X-->Y-->Z:") A=W*X*V print("W*X*V = Y =") display(sympy.Matrix(A.matrix)) A=W*Y*V print("W*Y*V = Z =") display(sympy.Matrix(A.matrix)) A=W*Z*V print("W*Z*V = X = ") display(sympy.Matrix(A.matrix)) print ("I=") display(sympy.Matrix(I.matrix)) print ("X=") display(sympy.Matrix(X.matrix)) print ("Y=") display(sympy.Matrix(Y.matrix)) print ("Z=") display(sympy.Matrix(Z.matrix)) print ("V=") display(sympy.Matrix(V.matrix)) A=V*X print ("V*X=") display(sympy.Matrix(A.matrix)) A=V*Y print ("V*Y=") display(sympy.Matrix(A.matrix)) A=V*Z print ("V*Z=") display(sympy.Matrix(A.matrix)) print ("W=") display(sympy.Matrix(W.matrix)) A=W*X print ("W*X=") display(sympy.Matrix(A.matrix)) A=W*Y print ("W*Y=") display(sympy.Matrix(A.matrix)) A=W*Z print ("W*Z=") display(sympy.Matrix(A.matrix)) print ("H=") display(sympy.Matrix(H.matrix)) A=H*X print ("H*X=") display(sympy.Matrix(A.matrix)) A=H*Y print ("H*Y=") display(sympy.Matrix(A.matrix)) A=H*Z print ("H*Z=") display(sympy.Matrix(A.matrix)) print ("H*V=") A=H*V display(sympy.Matrix(A.matrix)) A=H*V*X print ("H*V*X=") display(sympy.Matrix(A.matrix)) A=H*V*Y print ("H*V*Y=") display(sympy.Matrix(A.matrix)) A=H*V*Z print ("H*V*Z=") display(sympy.Matrix(A.matrix)) print ("H*W=") A=H*W display(sympy.Matrix(A.matrix)) A=H*W*X print ("H*W*X=") display(sympy.Matrix(A.matrix)) A=H*W*Y print ("H*W*Y=") display(sympy.Matrix(A.matrix)) A=H*W*Z print ("H*W*Z=") display(sympy.Matrix(A.matrix)) print ("H*V = H*H*S*H*S = S*H*S =") A=S*H*S #H*V display(sympy.Matrix(A.matrix)) A=Sdg*H*S #H*V*Y print ("H*V*Y = H*H*S*H*S*Y = S*H*S*Y = S*H*X*S = S*Z*H*S = Sdg*H*S =") display(sympy.Matrix(A.matrix)) A=S*H*Sdg #H*V*Z print ("H*V*Z = H*H*S*H*S*Z = S*H*Sdg =") display(sympy.Matrix(A.matrix)) print ("H*W = H*H*S = S =") A=S #H*W display(sympy.Matrix(A.matrix)) A= S*X #H*W*X print ("H*W*X = S*X = ") display(sympy.Matrix(A.matrix)) A=S*Y #H*W*Y print ("H*W*Y = S*Y =") display(sympy.Matrix(A.matrix)) A=Sdg #H*W*Z print ("H*W*Z = Sdg =") display(sympy.Matrix(A.matrix)) Class1Size = 2*2*3*3*4*4 print ("The size of Class 1 is: ", Class1Size) Class2Size = 2*2*3*3*3*3*4*4 print ("The size of Class 2 is: ", Class2Size) Class3Size = 2*2*3*3*3*3*4*4 print ("The size of Class 3 is: ", Class3Size) Class4Size = 2*2*3*3*4*4 print ("The size of Class 4 is: ", Class4Size) TotalSize = Class1Size + Class2Size + Class3Size + Class4Size print ("The size of the 2-qubit Clifford group is: ", TotalSize)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import random import math from sympy.ntheory import isprime # importing QISKit from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import Aer, IBMQ, execute from qiskit.tools.monitor import job_monitor from qiskit.providers.ibmq import least_busy from qiskit.tools.visualization import plot_histogram IBMQ.load_accounts() sim_backend = Aer.get_backend('qasm_simulator') device_backend = least_busy(IBMQ.backends(operational=True, simulator=False)) #Function that takes in a prime number and a string of letters and returns a quantum circuit def qfa_algorithm(string, prime): if isprime(prime) == False: raise ValueError("This number is not a prime") #Raises a ValueError if the input prime number is not prime else: n = math.ceil((math.log(prime))) #Rounds up to the next integer of the log(prime) qr = QuantumRegister(n) #Creates a quantum register of length log(prime) for log(prime) qubits cr = ClassicalRegister(n) #Creates a classical register for measurement qfaCircuit = QuantumCircuit(qr, cr) #Defining the circuit to take in the values of qr and cr for x in range(n): #For each qubit, we want to apply a series of unitary operations with a random int random_value = random.randint(1,prime - 1) #Generates the random int for each qubit from {1, prime -1} for letter in string: #For each letter in the string, we want to apply the same unitary operation to each qubit qfaCircuit.ry((2*math.pi*random_value) / prime, qr[x]) #Applies the Y-Rotation to each qubit qfaCircuit.measure(qr[x], cr[x]) #Measures each qubit return qfaCircuit #Returns the created quantum circuit #A function that returns a string saying if the string is accepted into the language or rejected def accept(parameter): states = list(result.get_counts(parameter)) for s in states: for integer in s: if integer == "1": return "Reject: the string is not accepted into the language" return "Accept: the string is accepted into the language" range_lower = 0 range_higher = 36 prime_number = 11 for length in range(range_lower,range_higher): params = qfa_algorithm("a"* length, prime_number) job = execute(params, sim_backend, shots=1000) result = job.result() print(accept(params), "\n", "Length:",length," " ,result.get_counts(params)) qfa_algorithm("a"* 3, prime_number).draw(output='mpl') #Function that takes in a prime number and a string of letters and returns a quantum circuit def qfa_controlled_algorithm(string, prime): if isprime(prime) == False: raise ValueError("This number is not a prime") #Raises a ValueError if the input prime number is not prime else: n = math.ceil((math.log(math.log(prime,2),2))) #Represents log(log(p)) control qubits states = 2 ** (n) #Number of states that the qubits can represent/Number of QFA's to be performed qr = QuantumRegister(n+1) #Creates a quantum register of log(log(prime)) control qubits + 1 target qubit cr = ClassicalRegister(1) #Creates a classical register of log(log(prime)) control qubits + 1 target qubit control_qfaCircuit = QuantumCircuit(qr, cr) #Defining the circuit to take in the values of qr and cr for q in range(n): #We want to take each control qubit and put them in a superposition by applying a Hadamard Gate control_qfaCircuit.h(qr[q]) for letter in string: #For each letter in the string, we want to apply a series of Controlled Y-rotations for q in range(n): control_qfaCircuit.cu3(2*math.pi*(2**q)/prime, 0, 0, qr[q], qr[n]) #Controlled Y on Target qubit control_qfaCircuit.measure(qr[n], cr[0]) #Measure the target qubit return control_qfaCircuit #Returns the created quantum circuit for length in range(range_lower,range_higher): params = qfa_controlled_algorithm("a"* length, prime_number) job = execute(params, sim_backend, shots=1000) result = job.result() print(accept(params), "\n", "Length:",length," " ,result.get_counts(params)) qfa_controlled_algorithm("a"* 3, prime_number).draw(output='mpl') prime_number = 3 length = 2 # set the length so that it is not divisible by the prime_number print("The length of a is", length, " while the prime number is", prime_number) qfa1 = qfa_controlled_algorithm("a"* length, prime_number) job = execute(qfa1, backend=device_backend, shots=100) job_monitor(job) result = job.result() plot_histogram(result.get_counts()) qfa1.draw(output='mpl') print_number = length = 3 # set the length so that it is divisible by the prime_number print("The length of a is", length, " while the prime number is", prime_number) qfa2 = qfa_controlled_algorithm("a"* length, prime_number) job = execute(qfa2, backend=device_backend, shots=100) job_monitor(job) result = job.result() plot_histogram(result.get_counts()) qfa2.draw(output='mpl')
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
#Imports from itertools import product import matplotlib.pyplot as plt %matplotlib inline from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister, Result from qiskit import available_backends, get_backend, execute, register, least_busy from qiskit.tools.visualization import matplotlib_circuit_drawer, qx_color_scheme #require qiskit>0.5.5 %config InlineBackend.figure_format = 'svg' style = qx_color_scheme() style['compress'] = True style['cregbundle'] = True style['plotbarrier'] = True circuit_drawer = lambda circuit: matplotlib_circuit_drawer(circuit, style=style) # Creating registers qa = QuantumRegister(1, 'alice') qb = QuantumRegister(1, 'bob') c = ClassicalRegister(2, 'c') # Bell Measurement bell_measurement = QuantumCircuit(qa, qb, c) bell_measurement.cx(qa, qb) bell_measurement.h(qa) bell_measurement.measure(qa[0], c[0]) bell_measurement.measure(qb[0], c[1]) circuit_drawer(bell_measurement) alice = {} bob = {} # eigenvalue alice['+'] = QuantumCircuit(qa, qb, c) # do nothing alice['-'] = QuantumCircuit(qa, qb, c) alice['-'] .x(qa) bob['+'] = QuantumCircuit(qa, qb, c) # do nothing bob['-'] = QuantumCircuit(qa, qb, c) bob['-'].x(qb) # matrix alice['Z'] = QuantumCircuit(qa, qb, c) # do nothing alice['X'] = QuantumCircuit(qa, qb, c) alice['X'].h(qa) bob['W'] = QuantumCircuit(qa, qb, c) bob['W'].h(qb) bob['W'].t(qb) bob['W'].h(qb) bob['W'].s(qb) bob['V'] = QuantumCircuit(qa, qb, c) bob['V'].h(qb) bob['V'].tdg(qb) bob['V'].h(qb) bob['V'].s(qb) qc = alice['+'] + alice['Z'] + bob['+'] + bob['V'] circuit_drawer(qc) qc = alice['-'] + alice['X'] + bob['+'] + bob['W'] circuit_drawer(qc) backend = 'local_qasm_simulator' shots = 1024 circuits = {} for a_sign, a_basis, b_sign, b_basis in product(['+', '-'], ['Z', 'X'], ['+', '-'], ['V', 'W']): name = a_sign + a_basis + b_sign + b_basis circuits[name] = QuantumCircuit(qa, qb, c) circuits[name] += alice[a_sign] circuits[name] += alice[a_basis] circuits[name] += bob[b_sign] circuits[name] += bob[b_basis] circuits[name].barrier(qa) circuits[name].barrier(qb) circuits[name] += bell_measurement # Example print('A quantum circuit of -X+V.') circuit_drawer(circuits['-X+V']) job = execute(circuits.values(), backend=backend, shots=shots) result = job.result() completely_mixed = {'00': 0, '01': 0, '10': 0, '11': 0} for a_sign, a_basis, b_sign, b_basis in product(['+', '-'], ['Z', 'X'], ['+', '-'], ['V', 'W']): name = a_sign + a_basis + b_sign + b_basis completely_mixed['00'] += result.average_data(circuits[name], {'00': 1})/16 completely_mixed['01'] += result.average_data(circuits[name], {'01': 1})/16 completely_mixed['10'] += result.average_data(circuits[name], {'10': 1})/16 completely_mixed['11'] += result.average_data(circuits[name], {'11': 1})/16 plt.bar(completely_mixed.keys(), completely_mixed.values(), width=0.5) plt.xlabel('Outcome', fontsize=15) plt.ylabel('Probability for the completely mixed state', fontsize=10) plt.axhline(y=0.25, color='red', linewidth=1) def E(result: Result, observable: dict, a_basis: str, b_basis: str) -> float: val = 0 str2int = lambda x: 1 if x == '+' else -1 for a_sign, b_sign in product(['+', '-'], ['+', '-']): name = a_sign + a_basis + b_sign + b_basis sign = str2int(a_sign) * str2int(b_sign) val += sign * result.average_data(circuits[name], observable) return val def D(result: Result, outcome: str) -> float: val = 0 for a_basis, b_basis in product(['Z', 'X'], ['V', 'W']): if outcome[0] == outcome[1] and a_basis == 'X' and b_basis == 'V': sign = -1 elif outcome[0] != outcome[1] and a_basis == 'X' and b_basis == 'W': sign = -1 else: sign = 1 val += sign * E(result, {outcome: 1}, a_basis=a_basis, b_basis=b_basis) return val for outcome in ['00', '01', '10', '11']: if completely_mixed[outcome] <= 1/4: # check the condition print('D is equal to {} for the outcome {}.'.format(D(result, outcome), outcome)) # Connecting to the IBM Quantum Experience import sys, getpass try: sys.path.append("../../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} print('Qconfig loaded from %s.' % Qconfig.__file__) except: APItoken = getpass.getpass('Please input your token and hit enter: ') qx_config = { "APItoken": APItoken, "url":"https://quantumexperience.ng.bluemix.net/api"} print('Qconfig.py not found in qiskit-tutorial directory; Qconfig loaded using user input.') register(qx_config['APItoken'], qx_config['url']) device_shots = 1024 device_name = least_busy(available_backends({'simulator': False, 'local': False})) device = get_backend(device_name) device_coupling = device.configuration['coupling_map'] print("the best backend is " + device_name + " with coupling " + str(device_coupling)) job = execute(circuits.values(), backend=device_name, shots=device_shots) result = job.result() completely_mixed = {'00': 0, '01': 0, '10': 0, '11': 0} for a_sign, a_basis, b_sign, b_basis in product(['+', '-'], ['Z', 'X'], ['+', '-'], ['V', 'W']): name = a_sign + a_basis + b_sign + b_basis completely_mixed['00'] += result.average_data(circuits[name], {'00': 1})/16 completely_mixed['01'] += result.average_data(circuits[name], {'01': 1})/16 completely_mixed['10'] += result.average_data(circuits[name], {'10': 1})/16 completely_mixed['11'] += result.average_data(circuits[name], {'11': 1})/16 plt.bar(completely_mixed.keys(), completely_mixed.values(), width=0.5) plt.xlabel('Outcome', fontsize=15) plt.ylabel('Probability for the completely mixed state', fontsize=10) plt.axhline(y=0.25, color='red', linewidth=1) for outcome in ['00', '01', '10', '11']: if completely_mixed[outcome] <= 1/4: # check the condition print('D is equal to {} for the outcome {}.'.format(D(result, outcome), outcome))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# Importing QISKit import math, sys from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister # Import basic plotting tools from qiskit.tools.visualization import plot_histogram # Import methods to connect with remote backends from qiskit import available_backends, execute, register, get_backend # Import token to use remote backends try: sys.path.append("../../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} except: qx_config = { "APItoken":"YOUR_TOKEN_HERE", "url":"https://quantumexperience.ng.bluemix.net/api"} #to enable sleep import time #connect to remote API to be able to use remote simulators and real devices register(qx_config['APItoken'], qx_config['url']) print("Available backends:", available_backends()) def input_state(circ, q, n): """n-qubit input state for QFT that produces output 1.""" for j in range(n): circ.h(q[j]) circ.u1(math.pi/float(2**(j)), q[j]).inverse() def qft(circ, q, n): """n-qubit QFT on q in circ.""" for j in range(n): for k in range(j): circ.cu1(math.pi/float(2**(j-k)), q[j], q[k]) circ.h(q[j]) q = QuantumRegister(3) c = ClassicalRegister(3) qft3 = QuantumCircuit(q, c) input_state(qft3, q, 3) qft(qft3, q, 3) for i in range(3): qft3.measure(q[i], c[i]) print(qft3.qasm()) simulate = execute(qft3, backend="local_qasm_simulator", shots=1024).result() simulate.get_counts() backend = "ibmqx4" shots = 1024 if get_backend(backend).status["available"] is True: job_exp = execute(qft3, backend=backend, shots=shots) lapse = 0 interval = 10 while not job_exp.done: print('Status @ {} seconds'.format(interval * lapse)) print(job_exp.status) time.sleep(interval) lapse += 1 print(job_exp.status) results = job_exp.result() plot_histogram(results.get_counts())
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
#Import packages import numpy as np import matplotlib.pyplot as plt %matplotlib inline import time # import from qiskit from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister, execute, compile from qiskit.converters import qobj_to_circuits from qiskit import Aer, IBMQ from qiskit.providers.aer import noise # import tomography library import qiskit.tools.qcvv.tomography as tomo # useful additional packages from qiskit.tools.visualization import plot_state, plot_histogram from qiskit.tools.qi.qi import state_fidelity, outer from qiskit.tools.qi.qi import outer from qiskit.quantum_info import state_fidelity from qiskit.tools.monitor import job_monitor, backend_overview from qiskit.providers.ibmq import least_busy Aer.backends() # No need for credentials for running the next cells # Determine the job n = int(input("type number of qubits + enter: ")) # create a n-qubit quantum register qr = QuantumRegister(n) cr = ClassicalRegister(n) my_state = QuantumCircuit(qr, cr, name='my_state') # desired vector for a n-qubit W state desired_vector = [] qr_vector = [] n_vector = 2**n for i in range(n_vector): desired_vector.append(0) for j in range(n) : desired_vector[2**j] = 1/np.sqrt(n) # choice of the circuit building method (arbitrary or specific) print("Do you want to use the specific method?") W_state_circuit = input(" Answer by (y/n) + enter\n").upper() if (W_state_circuit == "N") : method = "arbitrary" # Initialize a n-qubit W quantum state using the arbitrary method for j in range(n) : qr_vector.append(qr[j]) my_state.initialize(desired_vector, qr_vector) else: # Quantum circuit to make a n-qubit W state using the specific method method = "specific" my_state.x(qr[n-1]) #start is |10...0> for i in range(1,n) : theta = np.arccos(np.sqrt(1/(n-i+1))) my_state.ry(-theta,qr[n-i-1]) my_state.cz(qr[n-i],qr[n-i-1]) my_state.ry(theta,qr[n-i-1]) for i in range(1,n) : my_state.cx(qr[n-i-1],qr[n-i]) # Measurement circuit measuring = QuantumCircuit(qr, cr, name='measuring') for i in range(n) : measuring.measure(qr[i] , cr[i]) test = my_state+measuring # Test circuit "my_state" : Noise free model on simulator backend_sim = Aer.get_backend('qasm_simulator') shots = 1024 job_noisefree = execute(test, backend_sim, shots=shots, max_credits=5) job_monitor(job_noisefree) noisefree_count = job_noisefree.result().get_counts(test) time_exp = time.strftime('%d/%m/%Y %H:%M:%S') print("Date (DMY):", time_exp) print(noisefree_count) plot_histogram(noisefree_count, color=['purple'], title=str(n) + '- qubit W state, noise free simulation, ' + method + " method") # QASM from test QASM_source = test.qasm() print(QASM_source) # Draw the circuit test.draw(output='mpl') # Execute state tomography using noise free quantum device simulation # obtain the final state vector backend_stvct = Aer.get_backend('statevector_simulator') job = execute(my_state, backend_stvct) my_state_psi = job.result().get_statevector(my_state) # construct state tomography set for measurement of qubits [0, ..., n-1] in the Pauli basis qubit_set = [] for i in range(0,n) : qubit_set.append(i) my_state_tomo_set = tomo.state_tomography_set(qubit_set) # default value for meas_basis ='Pauli'. # add the state tomography measurement circuits to the Quantum Program my_state_tomo_circuits = tomo.create_tomography_circuits(my_state, qr, cr, my_state_tomo_set) backend_tomo = Aer.get_backend('qasm_simulator') # for simulation # take 1024 shots for each measurement basis # note: reduce this number for larger number of qubits shots = 1024 mode = "noise free simulation" my_state_job = execute(my_state_tomo_circuits, backend_tomo, shots=shots) job_monitor(my_state_job) my_state_tomo_result = my_state_job.result() # extract tomography data from results my_state_tomo_data = tomo.tomography_data(my_state_tomo_result, my_state.name, my_state_tomo_set) # Quantum fidelity # reconstruct experimentally measured density matrix rho_fit = tomo.fit_tomography_data(my_state_tomo_data) # calculate fidelity of fitted state: time_exp = time.strftime('%d/%m/%Y %H:%M:%S') print("Date (DMY):", time_exp) print('Tomography',str(n)+'-qubit W state on', backend_tomo, ", shots:", shots, ", method:", method, ", mode:", mode) F_fit = state_fidelity(rho_fit, my_state_psi) print('Fidelity with theoretical ideal state') print('F =', F_fit) IBMQ.load_accounts() backend_overview() # you may skip running this cell if you want backend_real = least_busy(IBMQ.backends(operational=True, simulator=False)) print(backend_real) # Prepare device noise simulation (DNS) device = backend_real print("device: ", device) properties = device.properties() coupling_map = device.configuration().coupling_map prepared = False if device.name() == 'ibmq_16_melbourne' : gate_times = [ ('u1', None, 0), ('u2', None, 100), ('u3', None, 200), ('cx', [1, 0], 678), ('cx', [1, 2], 547), ('cx', [2, 3], 721), ('cx', [4, 3], 733), ('cx', [4, 10], 721), ('cx', [5, 4], 800), ('cx', [5, 6], 800), ('cx', [5, 9], 895), ('cx', [6, 8], 895), ('cx', [7, 8], 640), ('cx', [9, 8], 895), ('cx', [9, 10], 800), ('cx', [11, 10], 721), ('cx', [11, 3], 634), ('cx', [12, 2], 773), ('cx', [13, 1], 2286), ('cx', [13, 12], 1504), ('cx', [], 800) ] prepared = True elif device.name() == 'ibmqx4' : gate_times = [ ('u1', None, 0), ('u2', None, 60), ('u3', None, 120), ('cx', [1, 0], 340), ('cx', [2, 0], 424), ('cx', [2, 1], 520), ('cx', [3, 2], 620), ('cx', [3, 4], 420), ('cx', [4, 2], 920) ] prepared = True else : print("No gate times yet defined in this notebook for: ", device) if prepared : # Construct the noise model from backend properties and custom gate times noise_model = noise.device.basic_device_noise_model(properties, gate_times=gate_times) # Get the basis gates for the noise model basis_gates = noise_model.basis_gates print("noise model prepared for", device) # Execute test using device noise simulation (DNS) backend_noise = Aer.get_backend('qasm_simulator') # for simulation (DNS) shots = 1024 mode = "DNS" job_noise = execute(test, backend_noise, noise_model=noise_model, coupling_map=coupling_map, basis_gates=basis_gates) job_monitor(job_noise) print(job_noise.status) time_exp = time.strftime('%d/%m/%Y %H:%M:%S') print("Date (DMY):", time_exp) noisy_count = job_noise.result().get_counts(test) print(noisy_count) plot_histogram(noisy_count, color=['cyan'], title= str(n) + '- qubit W state, ' + mode + ': {}, '.format(device.name()) + method + " method") # Execute state tomography using device noise simulation (DNS) # obtain the final state vector backend_stvct = Aer.get_backend('statevector_simulator') job = execute(my_state, backend_stvct) my_state_psi = job.result().get_statevector(my_state) # construct state tomography set for measurement of qubits [0, ..., n-1] in the Pauli basis qubit_set = [] for i in range(0,n) : qubit_set.append(i) my_state_tomo_set = tomo.state_tomography_set(qubit_set) # default value for meas_basis ='Pauli'. # add the state tomography measurement circuits to the Quantum Program my_state_tomo_circuits = tomo.create_tomography_circuits(my_state, qr, cr, my_state_tomo_set) backend_tomo = Aer.get_backend('qasm_simulator') # for simulation # take 1024 shots for each measurement basis # note: reduce this number for larger number of qubits shots = 1024 mode = "DNS" my_state_job = execute(my_state_tomo_circuits, backend_tomo, noise_model=noise_model, coupling_map=coupling_map, basis_gates=basis_gates) job_monitor(my_state_job) my_state_tomo_result = my_state_job.result() # extract tomography data from results my_state_tomo_data = tomo.tomography_data(my_state_tomo_result, my_state.name, my_state_tomo_set) # Quantum fidelity # reconstruct experimentally measured density matrix rho_fit = tomo.fit_tomography_data(my_state_tomo_data) # calculate fidelity of fitted state: time_exp = time.strftime('%d/%m/%Y %H:%M:%S') print("Date (DMY):", time_exp) print('Tomography',str(n)+'-qubit W state on', backend_tomo, ", shots:", shots, ", method:", method, ", mode:", mode, "of", device) F_fit = state_fidelity(rho_fit, my_state_psi) print('Fidelity with theoretical ideal state') print('F =', F_fit) plt.xlabel('Number of Entangled Qubits') plt.ylabel('Quantum Fidelity') plt.axis([1.4, 6, 0, 1]) plt.grid() plt.plot([2,3,4,5], [0.788,0.734,0.628,0.542], 'mo-', label="Specific Algorithm - DNS") plt.plot([2,3,4,5], [0.773,0.682,0.386,0.148], 'cs-', label="Arbitrary Initialization - DNS") plt.legend() plt.show() # Execute test using superconducting quantum computing device (SQC) #Choose the backend #backend_noise = Aer.get_backend('qasm_simulator') # for optional test before final experiment backend_noise = device # for least busy SQC device # Execute on SQC and get counts shots = 1024 if backend_noise.name() == "qasm_simulator" : # optional test before final experiment mode = "DNS" job_noise = execute(test, backend_noise, noise_model=noise_model, coupling_map=coupling_map, basis_gates=basis_gates) else: # final experiment on real device mode = "SQC" job_noise = execute(test, backend_noise) job_monitor(job_noise) print(job_noise.status) time_exp = time.strftime('%d/%m/%Y %H:%M:%S') noisy_count = job_noise.result().get_counts(test) print(noisy_count) plot_histogram(noisy_count, color=['orange'], title= str(n) + '- qubit W state, ' + mode + ': {}, '.format(device.name()) + method + " method") # Execute state tomography on superconducting quantum computing device (SQC) # obtain the final state vector backend_stvct = Aer.get_backend('statevector_simulator') job = execute(my_state, backend_stvct) my_state_psi = job.result().get_statevector(my_state) # construct state tomography set for measurement of qubits [0, ..., n-1] in the Pauli basis qubit_set = [] for i in range(0,n) : qubit_set.append(i) my_state_tomo_set = tomo.state_tomography_set(qubit_set) # default value for meas_basis ='Pauli'. # add the state tomography measurement circuits to the Quantum Program my_state_tomo_circuits = tomo.create_tomography_circuits(my_state, qr, cr, my_state_tomo_set) #Choose the backend #backend_tomo = Aer.get_backend('qasm_simulator') # optional test before final experiment backend_tomo = device # for least busy SQC device # take 1024 shots for each measurement basis # note: reduce this number for larger number of qubits shots = 1024 # loop: 27 circuits maximum per job to avoid exceeding the allowed limit for the real device. n_circ = 3**n i_max = min(27,n_circ) my_jobs = [] index_job = -1 for i in range(0,n_circ,i_max) : circs =[] for j in range(i, i+i_max): circs.append(my_state_tomo_circuits[j]) if backend_tomo.name() == "qasm_simulator" : # optional test before final experiment mode = "DNS" my_state_job = execute(circs, backend_tomo, noise_model=noise_model, coupling_map=coupling_map, basis_gates=basis_gates) else: # final experiment on real device mode = "SQC" my_state_job = execute(circs, backend_tomo, shots=shots) my_jobs.append(my_state_job) index_job = index_job + 1 job_monitor(my_jobs[index_job], monitor_async = True) my_state_new_result = my_state_job.result() if i == 0: my_state_tomo_result = my_state_new_result else: my_state_tomo_result = my_state_tomo_result + my_state_new_result # extract tomography data from results my_state_tomo_data = tomo.tomography_data(my_state_tomo_result, my_state.name, my_state_tomo_set) # Quantum fidelity # reconstruct experimentally measured density matrix rho_fit = tomo.fit_tomography_data(my_state_tomo_data) # calculate fidelity of fitted state: time_exp = time.strftime('%d/%m/%Y %H:%M:%S') print("Date (DMY):", time_exp) print('Tomography',str(n)+'-qubit W state on', backend_tomo, ", shots:", shots, ", method:", method, ", mode:", mode, device) F_fit = state_fidelity(rho_fit, my_state_psi) print('Fidelity with theoretical ideal state') print('F =', F_fit) plt.xlabel('Number of Entangled Qubits') plt.ylabel('Quantum Fidelity') plt.axis([1.4, 6, 0, 1]) plt.grid() plt.plot([2,3,4,5], [0.812,0.735,0.592,0.457], 'ro-', label="Specific Algorithm") plt.plot([2,3,4,5], [0.838,0.539,0.144,0.060], 'bs-', label="Arbitrary Initialization") plt.legend() plt.show() # DSN vs SQC, count histograms # Shots = 1024 count_noisefree = {'010': 344, '001': 335, '100': 345} count_DNS = {'110': 42, '010': 258, '111': 9, '011': 38, '000': 76, '001': 281, '100': 286, '101': 34} count_real = {'001': 274, '000': 129, '010': 224, '011': 20, '100': 282, '111': 14, '101': 46, '110': 35} plot_histogram([count_noisefree, count_DNS, count_real], title= 'Determistic W state generation, specific algorithm, device: ibmqx4', color=['purple','cyan', 'orange'], bar_labels=False, legend = ['Noise free simulation', 'Device noise simulation','Real quantum device']) plt.xlabel('Number of Entangled Qubits') plt.ylabel('Quantum Fidelity') plt.axis([1.4, 6, 0, 1]) plt.grid() plt.plot([2,3,4,5], [0.812,0.735,0.592,0.457], 'ro-', label="Specific Algorithm - SQC") plt.plot([2,3,4,5], [0.838,0.539,0.144,0.060], 'bs-', label="Arbitrary Initialization - SQC") plt.plot([2,3,4,5], [0.788,0.734,0.628,0.542], 'mo-', label="Specific Algorithm - DNS") plt.plot([2,3,4,5], [0.773,0.682,0.386,0.148], 'cs-', label="Arbitrary Initialization - DNS") plt.legend() plt.show()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import matplotlib.pyplot as plt %matplotlib inline import numpy as np # useful math functions from math import pi, cos, acos, sqrt import random # importing the QISKit from qiskit import QuantumProgram import Qconfig # import basic plot tools from qiskit.tools.visualization import plot_histogram Q_program = QuantumProgram() Q_program.set_api(Qconfig.APItoken, Qconfig.config["url"]) # set the APIToken and API url N = 4 # Creating registers qr = Q_program.create_quantum_register("qr", N) # for recording the measurement on qr cr = Q_program.create_classical_register("cr", N) circuitName = "sharedEntangled" sharedEntangled = Q_program.create_circuit(circuitName, [qr], [cr]) #Create uniform superposition of all strings of length 2 for i in range(2): sharedEntangled.h(qr[i]) #The amplitude is minus if there are odd number of 1s for i in range(2): sharedEntangled.z(qr[i]) #Copy the content of the fist two qubits to the last two qubits for i in range(2): sharedEntangled.cx(qr[i], qr[i+2]) #Flip the last two qubits for i in range(2,4): sharedEntangled.x(qr[i]) #we first define controlled-u gates required to assign phases from math import pi def ch(qProg, a, b): """ Controlled-Hadamard gate """ qProg.h(b) qProg.sdg(b) qProg.cx(a, b) qProg.h(b) qProg.t(b) qProg.cx(a, b) qProg.t(b) qProg.h(b) qProg.s(b) qProg.x(b) qProg.s(a) return qProg def cu1pi2(qProg, c, t): """ Controlled-u1(phi/2) gate """ qProg.u1(pi/4.0, c) qProg.cx(c, t) qProg.u1(-pi/4.0, t) qProg.cx(c, t) qProg.u1(pi/4.0, t) return qProg def cu3pi2(qProg, c, t): """ Controlled-u3(pi/2, -pi/2, pi/2) gate """ qProg.u1(pi/2.0, t) qProg.cx(c, t) qProg.u3(-pi/4.0, 0, 0, t) qProg.cx(c, t) qProg.u3(pi/4.0, -pi/2.0, 0, t) return qProg # dictionary for Alice's operations/circuits aliceCircuits = {} # Quantum circuits for Alice when receiving idx in 1, 2, 3 for idx in range(1, 4): circuitName = "Alice"+str(idx) aliceCircuits[circuitName] = Q_program.create_circuit(circuitName, [qr], [cr]) theCircuit = aliceCircuits[circuitName] if idx == 1: #the circuit of A_1 theCircuit.x(qr[1]) theCircuit.cx(qr[1], qr[0]) theCircuit = cu1pi2(theCircuit, qr[1], qr[0]) theCircuit.x(qr[0]) theCircuit.x(qr[1]) theCircuit = cu1pi2(theCircuit, qr[0], qr[1]) theCircuit.x(qr[0]) theCircuit = cu1pi2(theCircuit, qr[0], qr[1]) theCircuit = cu3pi2(theCircuit, qr[0], qr[1]) theCircuit.x(qr[0]) theCircuit = ch(theCircuit, qr[0], qr[1]) theCircuit.x(qr[0]) theCircuit.x(qr[1]) theCircuit.cx(qr[1], qr[0]) theCircuit.x(qr[1]) elif idx == 2: theCircuit.x(qr[0]) theCircuit.x(qr[1]) theCircuit = cu1pi2(theCircuit, qr[0], qr[1]) theCircuit.x(qr[0]) theCircuit.x(qr[1]) theCircuit = cu1pi2(theCircuit, qr[0], qr[1]) theCircuit.x(qr[0]) theCircuit.h(qr[0]) theCircuit.h(qr[1]) elif idx == 3: theCircuit.cz(qr[0], qr[1]) theCircuit.swap(qr[0], qr[1]) theCircuit.h(qr[0]) theCircuit.h(qr[1]) theCircuit.x(qr[0]) theCircuit.x(qr[1]) theCircuit.cz(qr[0], qr[1]) theCircuit.x(qr[0]) theCircuit.x(qr[1]) #measure the first two qubits in the computational basis theCircuit.measure(qr[0], cr[0]) theCircuit.measure(qr[1], cr[1]) # dictionary for Bob's operations/circuits bobCircuits = {} # Quantum circuits for Bob when receiving idx in 1, 2, 3 for idx in range(1,4): circuitName = "Bob"+str(idx) bobCircuits[circuitName] = Q_program.create_circuit(circuitName, [qr], [cr]) theCircuit = bobCircuits[circuitName] if idx == 1: theCircuit.x(qr[2]) theCircuit.x(qr[3]) theCircuit.cz(qr[2], qr[3]) theCircuit.x(qr[3]) theCircuit.u1(pi/2.0, qr[2]) theCircuit.x(qr[2]) theCircuit.z(qr[2]) theCircuit.cx(qr[2], qr[3]) theCircuit.cx(qr[3], qr[2]) theCircuit.h(qr[2]) theCircuit.h(qr[3]) theCircuit.x(qr[3]) theCircuit = cu1pi2(theCircuit, qr[2], qr[3]) theCircuit.x(qr[2]) theCircuit.cz(qr[2], qr[3]) theCircuit.x(qr[2]) theCircuit.x(qr[3]) elif idx == 2: theCircuit.x(qr[2]) theCircuit.x(qr[3]) theCircuit.cz(qr[2], qr[3]) theCircuit.x(qr[3]) theCircuit.u1(pi/2.0, qr[3]) theCircuit.cx(qr[2], qr[3]) theCircuit.h(qr[2]) theCircuit.h(qr[3]) elif idx == 3: theCircuit.cx(qr[3], qr[2]) theCircuit.x(qr[3]) theCircuit.h(qr[3]) #measure the third and fourth qubits in the computational basis theCircuit.measure(qr[2], cr[2]) theCircuit.measure(qr[3], cr[3]) a, b = random.randint(1,3), random.randint(1,3) #generate random integers print("The values of a and b are, resp.,", a,b) aliceCircuit = aliceCircuits["Alice"+str(a)] bobCircuit = bobCircuits["Bob"+str(b)] circuitName = "Alice"+str(a)+"Bob"+str(b) Q_program.add_circuit(circuitName, sharedEntangled+aliceCircuit+bobCircuit) backend = "local_qasm_simulator" ##backend = "ibmqx2" shots = 1 # We perform a one-shot experiment results = Q_program.execute([circuitName], backend=backend, shots=shots) answer = results.get_counts(circuitName) print(answer) for key in answer.keys(): aliceAnswer = [int(key[-1]), int(key[-2])] bobAnswer = [int(key[-3]), int(key[-4])] if sum(aliceAnswer) % 2 == 0:#the sume of Alice answer must be even aliceAnswer.append(0) else: aliceAnswer.append(1) if sum(bobAnswer) % 2 == 1:#the sum of Bob answer must be odd bobAnswer.append(0) else: bobAnswer.append(1) break print("Alice answer for a = ", a, "is", aliceAnswer) print("Bob answer for b = ", b, "is", bobAnswer) if(aliceAnswer[b-1] != bobAnswer[a-1]): #check if the intersection of their answers is the same print("Alice and Bob lost") else: print("Alice and Bob won") backend = "local_qasm_simulator" #backend = "ibmqx2" shots = 10 # We perform 10 shots of experiments for each round nWins = 0 nLost = 0 for a in range(1,4): for b in range(1,4): print("Asking Alice and Bob with a and b are, resp.,", a,b) rWins = 0 rLost = 0 aliceCircuit = aliceCircuits["Alice"+str(a)] bobCircuit = bobCircuits["Bob"+str(b)] circuitName = "Alice"+str(a)+"Bob"+str(b) Q_program.add_circuit(circuitName, sharedEntangled+aliceCircuit+bobCircuit) if backend == "ibmqx2": ibmqx2_backend = Q_program.get_backend_configuration('ibmqx2') ibmqx2_coupling = ibmqx2_backend['coupling_map'] results = Q_program.execute([circuitName], backend=backend, shots=shots, coupling_map=ibmqx2_coupling, max_credits=3, wait=10, timeout=240) else: results = Q_program.execute([circuitName], backend=backend, shots=shots) answer = results.get_counts(circuitName) for key in answer.keys(): kfreq = answer[key] #frequencies of keys obtained from measurements aliceAnswer = [int(key[-1]), int(key[-2])] bobAnswer = [int(key[-3]), int(key[-4])] if sum(aliceAnswer) % 2 == 0: aliceAnswer.append(0) else: aliceAnswer.append(1) if sum(bobAnswer) % 2 == 1: bobAnswer.append(0) else: bobAnswer.append(1) #print("Alice answer for a = ", a, "is", aliceAnswer) #print("Bob answer for b = ", b, "is", bobAnswer) if(aliceAnswer[b-1] != bobAnswer[a-1]): #print(a, b, "Alice and Bob lost") nLost += kfreq rLost += kfreq else: #print(a, b, "Alice and Bob won") nWins += kfreq rWins += kfreq print("\t#wins = ", rWins, "out of ", shots, "shots") print("Number of Games = ", nWins+nLost) print("Number of Wins = ", nWins) print("Winning probabilities = ", (nWins*100.0)/(nWins+nLost))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import random for n in range(5): print('Flip '+str(n+1)) if random.random()<0.5: print('HEADS\n') else: print('TAILS\n') import time for n in range(5): t = str(time.time()) print('Flip '+str(n+1)+' (system time = ' + t + ')') if int(t[-1])%2==0: print('HEADS\n') else: print('TAILS\n') from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit q = QuantumRegister(1) c = ClassicalRegister(1) circ = QuantumCircuit(q, c) circ.h(q) circ.measure(q, c) from qiskit import BasicAer, execute backend = BasicAer.get_backend('qasm_simulator') job = execute(circ, backend, shots=5, memory=True) data = job.result().get_memory() print(data) for output in data: print('Flip with output bit value ' +output) if output=='0': print('HEADS\n') else: print('TAILS\n') from qiskit import IBMQ IBMQ.load_accounts() backend = IBMQ.get_backend('ibmq_5_tenerife') job = execute(circ, backend, shots=5, memory=True) for output in job.result().get_memory(): print('Flip with output bit value ' +output) if output=='0': print('HEADS\n') else: print('TAILS\n') job.result().get_memory() n = 3 q = QuantumRegister(n) c = ClassicalRegister(n) circ = QuantumCircuit(q, c) for j in range(n): circ.h(q[j]) circ.measure(q,c) job = execute(circ, BasicAer.get_backend('qasm_simulator'), shots=8192) # get the histogram of bit string results, convert it to one of integers and plot it bit_counts = job.result().get_counts() int_counts = {} for bitstring in bit_counts: int_counts[ int(bitstring,2) ] = bit_counts[bitstring] from qiskit.tools.visualization import plot_histogram plot_histogram(int_counts) q = QuantumRegister(n) c = ClassicalRegister(n) circ = QuantumCircuit(q, c) for j in range(n): circ.rx(3.14159/(2.5+j),q[j]) circ.measure(q,c) job = execute(circ, BasicAer.get_backend('qasm_simulator'), shots=8192) bit_counts = job.result().get_counts() int_counts = {} for bitstring in bit_counts: int_counts[ int(bitstring,2) ] = bit_counts[bitstring] plot_histogram(int_counts) job = execute(circ, BasicAer.get_backend('qasm_simulator'), shots=10, memory=True) data = job.result().get_memory() print(data) int_data = [] for bitstring in data: int_data.append( int(bitstring,2) ) print(int_data)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import matplotlib.pyplot as plt %matplotlib inline import numpy as np from math import pi import sys # importing the QISKit from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import available_backends, execute, register, get_backend # importing API token to access remote backends try: sys.path.append("../../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} except: qx_config = { "APItoken":"YOUR_TOKEN_HERE", "url":"https://quantumexperience.ng.bluemix.net/api"} # import basic plot tools from qiskit.tools.visualization import plot_histogram backend = 'local_qasm_simulator' # the device to run on shots = 1024 # the number of shots in the experiment #to record the rotation number for encoding 00, 10, 11, 01 rotationNumbers = {"00":1, "10":3, "11":5, "01":7} # Creating registers # qubit for encoding 2 bits of information qr = QuantumRegister(1) # bit for recording the measurement of the qubit cr = ClassicalRegister(1) # dictionary for encoding circuits encodingCircuits = {} # Quantum circuits for encoding 00, 10, 11, 01 for bits in ("00", "01", "10", "11"): circuitName = "Encode"+bits encodingCircuits[circuitName] = QuantumCircuit(qr, cr, name=circuitName) encodingCircuits[circuitName].u3(rotationNumbers[bits]*pi/4.0, 0, 0, qr[0]) encodingCircuits[circuitName].barrier() # dictionary for decoding circuits decodingCircuits = {} # Quantum circuits for decoding the first and second bit for pos in ("First", "Second"): circuitName = "Decode"+pos decodingCircuits[circuitName] = QuantumCircuit(qr, cr, name=circuitName) if pos == "Second": #if pos == "First" we can directly measure decodingCircuits[circuitName].h(qr[0]) decodingCircuits[circuitName].measure(qr[0], cr[0]) #combine encoding and decoding of QRACs to get a list of complete circuits circuitNames = [] circuits = [] for k1 in encodingCircuits.keys(): for k2 in decodingCircuits.keys(): circuitNames.append(k1+k2) circuits.append(encodingCircuits[k1]+decodingCircuits[k2]) print("List of circuit names:", circuitNames) #list of circuit names job = execute(circuits, backend=backend, shots=shots) results = job.result() print("Experimental Result of Encode01DecodeFirst") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode01DecodeFirst")])) #We should measure "0" with probability 0.85 print("Experimental Result of Encode01DecodeSecond") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode01DecodeSecond")])) #We should measure "1" with probability 0.85 print("Experimental Result of Encode11DecodeFirst") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode11DecodeFirst")])) #We should measure "1" with probability 0.85 print("Experimental Result of Encode11DecodeSecond") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode11DecodeSecond")])) #We should measure "1" with probability 0.85 #to enable sleep import time backend = "ibmqx4" #connect to remote API to be able to use remote simulators and real devices register(qx_config['APItoken'], qx_config['url']) print("Available backends:", available_backends()) if get_backend(backend).status["available"] is True: job_exp = execute(circuits, backend=backend, shots=shots) lapse = 0 interval = 50 while not job_exp.done: print('Status @ {} seconds'.format(interval * lapse)) print(job_exp.status) time.sleep(interval) lapse += 1 print(job_exp.status) results = job_exp.result() print("Experimental Result of Encode01DecodeFirst") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode01DecodeFirst")])) #We should measure "0" with probability 0.85 print("Experimental Result of Encode01DecodeSecond") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode01DecodeSecond")])) #We should measure "1" with probability 0.85 backend = 'local_qasm_simulator' # the device to run on shots = 1024 # the number of shots in the experiment from math import sqrt, cos, acos #compute the value of theta theta = acos(sqrt(0.5 + sqrt(3.0)/6.0)) #to record the u3 parameters for encoding 000, 010, 100, 110, 001, 011, 101, 111 rotationParams = {"000":(2*theta, pi/4, -pi/4), "010":(2*theta, 3*pi/4, -3*pi/4), "100":(pi-2*theta, pi/4, -pi/4), "110":(pi-2*theta, 3*pi/4, -3*pi/4), "001":(2*theta, -pi/4, pi/4), "011":(2*theta, -3*pi/4, 3*pi/4), "101":(pi-2*theta, -pi/4, pi/4), "111":(pi-2*theta, -3*pi/4, 3*pi/4)} # Creating registers # qubit for encoding 3 bits of information qr = QuantumRegister(1) # bit for recording the measurement of the qubit cr = ClassicalRegister(1) # dictionary for encoding circuits encodingCircuits = {} # Quantum circuits for encoding 000, ..., 111 for bits in rotationParams.keys(): circuitName = "Encode"+bits encodingCircuits[circuitName] = QuantumCircuit(qr, cr, name=circuitName) encodingCircuits[circuitName].u3(*rotationParams[bits], qr[0]) encodingCircuits[circuitName].barrier() # dictionary for decoding circuits decodingCircuits = {} # Quantum circuits for decoding the first, second and third bit for pos in ("First", "Second", "Third"): circuitName = "Decode"+pos decodingCircuits[circuitName] = QuantumCircuit(qr, cr, name=circuitName) if pos == "Second": #if pos == "First" we can directly measure decodingCircuits[circuitName].h(qr[0]) elif pos == "Third": decodingCircuits[circuitName].u3(pi/2, -pi/2, pi/2, qr[0]) decodingCircuits[circuitName].measure(qr[0], cr[0]) #combine encoding and decoding of QRACs to get a list of complete circuits circuitNames = [] circuits = [] for k1 in encodingCircuits.keys(): for k2 in decodingCircuits.keys(): circuitNames.append(k1+k2) circuits.append(encodingCircuits[k1]+decodingCircuits[k2]) print("List of circuit names:", circuitNames) #list of circuit names job = execute(circuits, backend=backend, shots=shots) results = job.result() print("Experimental Result of Encode010DecodeFirst") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode010DecodeFirst")])) #We should measure "0" with probability 0.78 print("Experimental Result of Encode010DecodeSecond") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode010DecodeSecond")])) #We should measure "1" with probability 0.78 print("Experimental Result of Encode010DecodeThird") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode010DecodeThird")])) #We should measure "0" with probability 0.78 backend = "ibmqx4" #backend = "local_qasm_simulator" print("Available backends:", available_backends()) if get_backend(backend).status["available"] is True: job_exp = execute(circuits, backend=backend, shots=shots) lapse = 0 interval = 50 while not job_exp.done: print('Status @ {} seconds'.format(interval * lapse)) print(job_exp.status) time.sleep(interval) lapse += 1 print(job_exp.status) results = job_exp.result() print("Experimental Result of Encode010DecodeFirst") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode010DecodeFirst")])) #We should measure "0" with probability 0.78 print("Experimental Result of Encode010DecodeSecond") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode010DecodeSecond")])) #We should measure "1" with probability 0.78 print("Experimental Result of Encode010DecodeThird") plot_histogram(results.get_counts(circuits[circuitNames.index("Encode010DecodeThird")])) #We should measure "0" with probability 0.78
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
#initialization import sys import matplotlib.pyplot as plt %matplotlib inline import numpy as np # importing the QISKit from qiskit import QuantumProgram try: sys.path.append("../../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} except: qx_config = { "APItoken":"YOUR_TOKEN_HERE", "url":"https://quantumexperience.ng.bluemix.net/api"} # import basic plot tools from qiskit.tools.visualization import plot_histogram #set api from IBMQuantumExperience import IBMQuantumExperience api = IBMQuantumExperience(token=qx_config['APItoken'], config={'url': qx_config['url']}) #prepare backends from qiskit.backends import discover_local_backends, discover_remote_backends, get_backend_instance remote_backends = discover_remote_backends(api) #we have to call this to connect to remote backends local_backends = discover_local_backends() # Quantum program setup Q_program = QuantumProgram() #for plot with 16qubit import numpy as np from functools import reduce from scipy import linalg as la from collections import Counter import matplotlib.pyplot as plt def plot_histogram5(data, number_to_keep=False): """Plot a histogram of data. data is a dictionary of {'000': 5, '010': 113, ...} number_to_keep is the number of terms to plot and rest is made into a single bar called other values """ if number_to_keep is not False: data_temp = dict(Counter(data).most_common(number_to_keep)) data_temp["rest"] = sum(data.values()) - sum(data_temp.values()) data = data_temp labels = sorted(data) values = np.array([data[key] for key in labels], dtype=float) pvalues = values / sum(values) numelem = len(values) ind = np.arange(numelem) # the x locations for the groups width = 0.35 # the width of the bars fig, ax = plt.subplots() rects = ax.bar(ind, pvalues, width, color='seagreen') # add some text for labels, title, and axes ticks ax.set_ylabel('Probabilities', fontsize=12) ax.set_xticks(ind) ax.set_xticklabels(labels, fontsize=12, rotation=70) ax.set_ylim([0., min([1.2, max([1.2 * val for val in pvalues])])]) # attach some text labels for rect in rects: height = rect.get_height() ax.text(rect.get_x() + rect.get_width() / 2., 1.05 * height, '%f' % float(height), ha='center', va='bottom', fontsize=8) plt.show() q1_2 = Q_program.create_quantum_register("q1_2", 3) c1_2 = Q_program.create_classical_register("c1_2", 3) qw1_2 = Q_program.create_circuit("qw1_2", [q1_2], [c1_2]) t=8 #time qw1_2.x(q1_2[2]) qw1_2.u3(t, 0, 0, q1_2[1]) qw1_2.cx(q1_2[2], q1_2[1]) qw1_2.u3(t, 0, 0, q1_2[1]) qw1_2.cx(q1_2[2], q1_2[1]) qw1_2.measure(q1_2[0], c1_2[0]) qw1_2.measure(q1_2[1], c1_2[2]) qw1_2.measure(q1_2[2], c1_2[1]) print(qw1_2.qasm()) result = Q_program.execute(["qw1_2"], backend='local_qiskit_simulator', shots=1000) plot_histogram5(result.get_counts("qw1_2")) result = Q_program.execute(["qw1_2"], backend='ibmqx4', shots=1000, max_credits=3, wait=10, timeout=1024) plot_histogram5(result.get_counts("qw1_2")) q1 = Q_program.create_quantum_register("q1", 3) c1 = Q_program.create_classical_register("c1", 3) qw1 = Q_program.create_circuit("qw1", [q1], [c1]) t=8 #time qw1.x(q1[1]) qw1.cx(q1[2], q1[1]) qw1.u3(t, 0, 0, q1[2]) qw1.cx(q1[2], q1[0]) qw1.u3(t, 0, 0, q1[2]) qw1.cx(q1[2], q1[0]) qw1.cx(q1[2], q1[1]) qw1.u3(2*t, 0, 0, q1[2]) qw1.measure(q1[0], c1[0]) qw1.measure(q1[1], c1[1]) qw1.measure(q1[2], c1[2]) print(qw1.qasm()) result = Q_program.execute(["qw1"], backend='local_qiskit_simulator') plot_histogram5(result.get_counts("qw1")) result = Q_program.execute(["qw1"], backend='ibmqx4', shots=1000, max_credits=3, wait=10, timeout=600) plot_histogram5(result.get_counts("qw1"))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import matplotlib.pyplot as plt %matplotlib inline import numpy as np # useful math functions from math import pi, cos, acos, sqrt import sys # importing the QISKit from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import available_backends, execute, register, get_backend # importing API token to access remote backends try: sys.path.append("../../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} except: qx_config = { "APItoken":"YOUR_TOKEN_HERE", "url":"https://quantumexperience.ng.bluemix.net/api"} # import basic plot tools from qiskit.tools.visualization import plot_histogram def ch(qProg, a, b): """ Controlled-Hadamard gate """ qProg.h(b) qProg.sdg(b) qProg.cx(a, b) qProg.h(b) qProg.t(b) qProg.cx(a, b) qProg.t(b) qProg.h(b) qProg.s(b) qProg.x(b) qProg.s(a) return qProg def cu3(qProg, theta, phi, lambd, c, t): """ Controlled-u3 gate """ qProg.u1((lambd-phi)/2, t) qProg.cx(c, t) qProg.u3(-theta/2, 0, -(phi+lambd)/2, t) qProg.cx(c, t) qProg.u3(theta/2, phi, 0, t) return qProg #CHANGE THIS 7BIT 0-1 STRING TO PERFORM EXPERIMENT ON ENCODING 0000000, ..., 1111111 x1234567 = "0101010" if len(x1234567) != 7 or not("1" in x1234567 or "0" in x1234567): raise Exception("x1234567 is a 7-bit 0-1 pattern. Please set it to the correct pattern") #compute the value of rotation angle theta of (3,1)-QRAC theta = acos(sqrt(0.5 + sqrt(3.0)/6.0)) #to record the u3 parameters for encoding 000, 010, 100, 110, 001, 011, 101, 111 rotationParams = {"000":(2*theta, pi/4, -pi/4), "010":(2*theta, 3*pi/4, -3*pi/4), "100":(pi-2*theta, pi/4, -pi/4), "110":(pi-2*theta, 3*pi/4, -3*pi/4), "001":(2*theta, -pi/4, pi/4), "011":(2*theta, -3*pi/4, 3*pi/4), "101":(pi-2*theta, -pi/4, pi/4), "111":(pi-2*theta, -3*pi/4, 3*pi/4)} # Creating registers # qubits for encoding 7 bits of information with qr[0] kept by the sender qr = QuantumRegister(3) # bits for recording the measurement of the qubits qr[1] and qr[2] cr = ClassicalRegister(2) encodingName = "Encode"+x1234567 encodingCircuit = QuantumCircuit(qr, cr, name=encodingName) #Prepare superposition of mixing QRACs of x1...x6 and x7 encodingCircuit.u3(1.187, 0, 0, qr[0]) #Encoding the seventh bit seventhBit = x1234567[6] if seventhBit == "1": #copy qr[0] into qr[1] and qr[2] encodingCircuit.cx(qr[0], qr[1]) encodingCircuit.cx(qr[0], qr[2]) #perform controlled-Hadamard qr[0], qr[1], and toffoli qr[0], qr[1] , qr[2] encodingCircuit = ch(encodingCircuit, qr[0], qr[1]) encodingCircuit.ccx(qr[0], qr[1], qr[2]) #End of encoding the seventh bit #encode x1...x6 with two (3,1)-QRACS. To do that, we must flip q[0] so that the controlled encoding is executed encodingCircuit.x(qr[0]) #Encoding the first 3 bits 000, ..., 111 into the second qubit, i.e., (3,1)-QRAC on the second qubit firstThreeBits = x1234567[0:3] #encodingCircuit.cu3(*rotationParams[firstThreeBits], qr[0], qr[1]) encodingCircuit = cu3(encodingCircuit, *rotationParams[firstThreeBits], qr[0], qr[1]) #Encoding the second 3 bits 000, ..., 111 into the third qubit, i.e., (3,1)-QRAC on the third qubit secondThreeBits = x1234567[3:6] #encodingCircuit.cu3(*rotationParams[secondTreeBits], qr[0], qr[2]) encodingCircuit = cu3(encodingCircuit, *rotationParams[secondThreeBits], qr[0], qr[2]) #end of encoding encodingCircuit.barrier() # dictionary for decoding circuits decodingCircuits = {} # Quantum circuits for decoding the 1st to 6th bits for i, pos in enumerate(["First", "Second", "Third", "Fourth", "Fifth", "Sixth"]): circuitName = "Decode"+pos decodingCircuits[circuitName] = QuantumCircuit(qr, cr, name=circuitName) if i < 3: #measure 1st, 2nd, 3rd bit if pos == "Second": #if pos == "First" we can directly measure decodingCircuits[circuitName].h(qr[1]) elif pos == "Third": decodingCircuits[circuitName].u3(pi/2, -pi/2, pi/2, qr[1]) decodingCircuits[circuitName].measure(qr[1], cr[1]) else: #measure 4th, 5th, 6th bit if pos == "Fifth": #if pos == "Fourth" we can directly measure decodingCircuits[circuitName].h(qr[2]) elif pos == "Sixth": decodingCircuits[circuitName].u3(pi/2, -pi/2, pi/2, qr[2]) decodingCircuits[circuitName].measure(qr[2], cr[1]) #Quantum circuits for decoding the 7th bit decodingCircuits["DecodeSeventh"] = QuantumCircuit(qr, cr, name="DecodeSeventh") decodingCircuits["DecodeSeventh"].measure(qr[1], cr[0]) decodingCircuits["DecodeSeventh"].measure(qr[2], cr[1]) #combine encoding and decoding of (7,2)-QRACs to get a list of complete circuits circuitNames = [] circuits = [] k1 = encodingName for k2 in decodingCircuits.keys(): circuitNames.append(k1+k2) circuits.append(encodingCircuit+decodingCircuits[k2]) print("List of circuit names:", circuitNames) #list of circuit names #Q_program.get_qasms(circuitNames) #list qasms codes backend = "local_qasm_simulator" #backend = "ibmqx2" shots = 1000 job = execute(circuits, backend=backend, shots=shots) results = job.result() for k in ["DecodeFirst", "DecodeSecond", "DecodeThird", "DecodeFourth", "DecodeFifth", "DecodeSixth"]: print("Experimental Result of ", encodingName+k) plot_histogram(results.get_counts(circuits[circuitNames.index(encodingName+k)])) print("Experimental result of ", encodingName+"DecodeSeventh") plot_histogram(results.get_counts(circuits[circuitNames.index(encodingName+"DecodeSeventh")]))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import matplotlib.pyplot as plt %matplotlib inline import numpy as np from collections import Counter #Use this to convert results from list to dict for histogram # importing the QISKit from qiskit import QuantumCircuit, QuantumProgram import Qconfig # import basic plot tools from qiskit.tools.visualization import plot_histogram device = 'ibmqx2' # the device to run on #device = 'local_qasm_simulator' # uncomment to run on the simulator N = 50 # Number of bombs steps = 20 # Number of steps for the algorithm, limited by maximum circuit depth eps = np.pi / steps # Algorithm parameter, small QPS_SPECS = { "name": "IFM", "circuits": [{ "name": "IFM_gen", # Prototype circuit for bomb generation "quantum_registers": [{ "name":"q_gen", "size":1 }], "classical_registers": [{ "name":"c_gen", "size":1 }]}, {"name": "IFM_meas", # Prototype circuit for bomb measurement "quantum_registers": [{ "name":"q", "size":2 }], "classical_registers": [{ "name":"c", "size":steps+1 }]}] } Q_program = QuantumProgram(specs=QPS_SPECS) Q_program.set_api(Qconfig.APItoken, Qconfig.config["url"]) # Quantum circuits to generate bombs circuits = ["IFM_gen"+str(i) for i in range(N)] # NB: Can't have more than one measurement per circuit for circuit in circuits: q_gen = Q_program.get_quantum_register("q_gen") c_gen = Q_program.get_classical_register('c_gen') IFM = Q_program.create_circuit(circuit, [q_gen], [c_gen]) IFM.h(q_gen[0]) #Turn the qubit into |0> + |1> IFM.measure(q_gen[0], c_gen[0]) _ = Q_program.get_qasms(circuits) # Suppress the output result = Q_program.execute(circuits, device, shots=1, max_credits=5, wait=10, timeout=240) # Note that we only want one shot bombs = [] for circuit in circuits: for key in result.get_counts(circuit): # Hack, there should only be one key, since there was only one shot bombs.append(int(key)) #print(', '.join(('Live' if bomb else 'Dud' for bomb in bombs))) # Uncomment to print out "truth" of bombs plot_histogram(Counter(('Live' if bomb else 'Dud' for bomb in bombs))) #Plotting bomb generation results device = 'local_qasm_simulator' #Running on the simulator circuits = ["IFM_meas"+str(i) for i in range(N)] #Creating one measurement circuit for each bomb for i in range(N): bomb = bombs[i] q = Q_program.get_quantum_register("q") c = Q_program.get_classical_register('c') IFM = Q_program.create_circuit(circuits[i], [q], [c]) for step in range(steps): IFM.ry(eps, q[0]) #First we rotate the control qubit by epsilon if bomb: #If the bomb is live, the gate is a controlled X gate IFM.cx(q[0],q[1]) #If the bomb is a dud, the gate is a controlled identity gate, which does nothing IFM.measure(q[1], c[step]) #Now we measure to collapse the combined state IFM.measure(q[0], c[steps]) Q_program.get_qasms(circuits) result = Q_program.execute(circuits, device, shots=1, max_credits=5, wait=10, timeout=240) def get_status(counts): # Return whether a bomb was a dud, was live but detonated, or was live and undetonated # Note that registers are returned in reversed order for key in counts: if '1' in key[1:]: #If we ever measure a '1' from the measurement qubit (q1), the bomb was measured and will detonate return '!!BOOM!!' elif key[0] == '1': #If the control qubit (q0) was rotated to '1', the state never entangled because the bomb was a dud return 'Dud' else: #If we only measured '0' for both the control and measurement qubit, the bomb was live but never set off return 'Live' results = {'Live': 0, 'Dud': 0, "!!BOOM!!": 0} for circuit in circuits: status = get_status(result.get_counts(circuit)) results[status] += 1 plot_histogram(results)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# importing the QISKit from qiskit import QuantumCircuit, QuantumProgram import Qconfig # import tomography library import qiskit.tools.qcvv.tomography as tomo #visualization packages from qiskit.tools.visualization import plot_wigner_function, plot_wigner_data density_matrix = np.matrix([[0.5, 0, 0, 0.5],[0, 0, 0, 0],[0, 0, 0, 0],[0.5, 0, 0, 0.5]]) print(density_matrix) plot_wigner_function(density_matrix, res=200) import sympy as sym from sympy.physics.quantum import TensorProduct num = int(np.log2(len(density_matrix))) harr = sym.sqrt(3) Delta_su2 = sym.zeros(2) Delta = sym.ones(1) for qubit in range(num): phi = sym.Indexed('phi', qubit) theta = sym.Indexed('theta', qubit) costheta = harr*sym.cos(2*theta) sintheta = harr*sym.sin(2*theta) Delta_su2[0,0] = (1+costheta)/2 Delta_su2[0,1] = -(sym.exp(2j*phi)*sintheta)/2 Delta_su2[1,0] = -(sym.exp(-2j*phi)*sintheta)/2 Delta_su2[1,1] = (1-costheta)/2 Delta = TensorProduct(Delta,Delta_su2) W = sym.trace(density_matrix*Delta) print(sym.latex(W)) Q_program = QuantumProgram() number_of_qubits = 2 backend = 'local_qasm_simulator' shots = 1024 bell_qubits = [0, 1] qr = Q_program.create_quantum_register('qr',2) cr = Q_program.create_classical_register('cr',2) bell = Q_program.create_circuit('bell', [qr], [cr]) bell.h(qr[0]) bell.cx(qr[0],qr[1]) bell_tomo_set = tomo.state_tomography_set([0, 1]) bell_tomo_circuits = tomo.create_tomography_circuits(Q_program, 'bell', qr, cr, bell_tomo_set) bell_tomo_result = Q_program.execute(bell_tomo_circuits, backend=backend, shots=shots) bell_tomo_data = tomo.tomography_data(bell_tomo_result, 'bell', bell_tomo_set) rho_fit_sim = tomo.fit_tomography_data(bell_tomo_data) plot_wigner_function(np.matrix(rho_fit_sim),res=200) Delta_su2 = sym.zeros(2) Delta = sym.ones(1) for qubit in range(num): phi = sym.Indexed('phi', qubit) theta = sym.Indexed('theta', qubit) costheta = harr*sym.cos(2*theta) sintheta = harr*sym.sin(2*theta) Delta_su2[0,0] = (1+costheta)/2 Delta_su2[0,1] = -(sym.exp(2j*phi)*sintheta)/2 Delta_su2[1,0] = -(sym.exp(-2j*phi)*sintheta)/2 Delta_su2[1,1] = (1-costheta)/2 Delta = TensorProduct(Delta,Delta_su2) W = sym.trace(np.matrix(rho_fit_sim)*Delta) print(sym.latex(W)) Q_program.set_api(Qconfig.APItoken, Qconfig.config['url']) backend = 'ibmqx2' max_credits = 8 shots = 1024 bell_qubits = [0, 1] bell_tomo_set = tomo.state_tomography_set(bell_qubits) bell_tomo_circuits = tomo.create_tomography_circuits(Q_program, 'bell', qr, cr, bell_tomo_set) bell_tomo_result = Q_program.execute(bell_tomo_circuits, backend=backend, shots=shots, max_credits=max_credits, timeout=300) bell_tomo_data = tomo.tomography_data(bell_tomo_result, 'bell', bell_tomo_set) rho_fit_ibmqx = tomo.fit_tomography_data(bell_tomo_data) plot_wigner_function(np.matrix(rho_fit_ibmqx), res=100) print(rho_fit_ibmqx) Delta_su2 = sym.zeros(2) Delta = sym.ones(1) for qubit in range(num): phi = sym.Indexed('phi', qubit) theta = sym.Indexed('theta', qubit) costheta = harr*sym.cos(2*theta) sintheta = harr*sym.sin(2*theta) Delta_su2[0,0] = (1+costheta)/2 Delta_su2[0,1] = -(sym.exp(2j*phi)*sintheta)/2 Delta_su2[1,0] = -(sym.exp(-2j*phi)*sintheta)/2 Delta_su2[1,1] = (1-costheta)/2 Delta = TensorProduct(Delta,Delta_su2) W = sym.trace(np.matrix(rho_fit_ibmqx)*Delta) print(sym.latex(W)) theta1_points = 8 theta2_points = 8 number_of_points = theta1_points*theta2_points the1 = [0]*number_of_points the2 = [0]*number_of_points #initialize theta values phis = [[0]*number_of_points]*number_of_qubits #set phi values to 0 point = 0 for i in range(theta1_points): for k in range(theta2_points): the1[point] = 2*i*np.pi/theta1_points the2[point] = 2*k*np.pi/theta2_points #create the values of theta for all points on plot point += 1 thetas = np.vstack((the1,the2)) bell_circuits = tomo.build_wigner_circuits(Q_program, 'bell', phis, thetas, bell_qubits, qr, cr) backend = 'local_qasm_simulator' shots = 1024 bell_result = Q_program.execute(bell_circuits, backend=backend, shots=shots) print(bell_result) wdata = tomo.wigner_data(bell_result, bell_qubits, bell_circuits, shots=shots) wdata = np.matrix(wdata) wdata = wdata.reshape(theta1_points,theta2_points) plot_wigner_data(wdata, method='plaquette') equator_points = 64 theta = [np.pi/2]*equator_points phi = [0]*equator_points point = 0 for i in range(equator_points): phi[i] = 2*i*np.pi/equator_points thetas = np.vstack((theta,theta)) phis = np.vstack((phi,phi)) bell_eq_circuits = tomo.build_wigner_circuits(Q_program, 'bell', phis, thetas, bell_qubits, qr, cr) bell_eq_result = Q_program.execute(bell_eq_circuits, backend=backend, shots=shots) wdata_eq = tomo.wigner_data(bell_eq_result, bell_qubits, bell_eq_circuits, shots=shots) plot_wigner_data(wdata_eq, method='curve') Q_program = QuantumProgram() number_of_qubits = 5 backend = 'local_qasm_simulator' shots = 1024 ghz_qubits = [0, 1, 2, 3, 4] qr = Q_program.create_quantum_register('qr',5) cr = Q_program.create_classical_register('cr',5) ghz = Q_program.create_circuit('ghz', [qr], [cr]) ghz.h(qr[0]) ghz.h(qr[1]) ghz.x(qr[2]) ghz.h(qr[3]) ghz.h(qr[4]) ghz.cx(qr[0],qr[2]) ghz.cx(qr[1],qr[2]) ghz.cx(qr[3],qr[2]) ghz.cx(qr[4],qr[2]) ghz.h(qr[0]) ghz.h(qr[1]) ghz.h(qr[2]) ghz.h(qr[3]) ghz.h(qr[4]) equator_points = 64 thetas = [[np.pi/2]*equator_points]*number_of_qubits phi = [0]*equator_points point = 0 for i in range(equator_points): phi[i] = 2*i*np.pi/equator_points phis = np.vstack((phi,phi,phi,phi,phi)) ghz_eq_circuits = tomo.build_wigner_circuits(Q_program, 'ghz', phis, thetas, ghz_qubits, qr, cr) ghz_eq_result = Q_program.execute(ghz_eq_circuits, backend=backend, shots=shots, timeout = 300) wghzdata_eq = tomo.wigner_data(ghz_eq_result, ghz_qubits, ghz_eq_circuits, shots=shots) plot_wigner_data(wghzdata_eq, method='curve') import matplotlib.pyplot as plt plt.plot(phi, wghzdata_eq, 'o') plt.axis([0, 2*np.pi, -0.6, 0.6]) plt.show() density_matrix = np.zeros((32,32)) density_matrix[0][0] = 0.5 density_matrix[0][31] = -0.5 density_matrix[31][0] = -0.5 density_matrix[31][31] = 0.5 plot_wigner_function(density_matrix, res=200)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import matplotlib.pyplot as plt %matplotlib inline import numpy as np # importing Qiskit from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit, execute, BasicAer, IBMQ # Creating registers qr = QuantumRegister(1) cr = ClassicalRegister(1) circuits = [] # Creating the circuits phase_vector = range(0,100) for phase_index in phase_vector: phase_shift = phase_index-50 phase = 2*np.pi*phase_shift/50 circuit_name = "phase_gate_%d"%phase_index qc_phase_gate = QuantumCircuit(qr, cr, name=circuit_name) qc_phase_gate.h(qr) qc_phase_gate.u1(phase, qr) qc_phase_gate.h(qr) qc_phase_gate.measure(qr[0], cr[0]) circuits.append(qc_phase_gate) # Visualising one of the circuits as an example circuits[25].draw(output='mpl') # To run using qasm simulator backend = BasicAer.get_backend('qasm_simulator') # the number of shots in the experiment shots = 1024 result = execute(circuits, backend=backend, shots=shots).result() probz = [] phase_value = [] for phase_index in phase_vector: phase_shift = phase_index - 50 phase_value.append(2*phase_shift/50) if '0' in result.get_counts(circuits[phase_index]): probz.append(2*result.get_counts(circuits[phase_index]).get('0')/shots-1) else: probz.append(-1) plt.plot(phase_value, probz, 'b',0.25,1/np.sqrt(2),'ro',0.5,0,'ko',1,-1,'go',-0.25,1/np.sqrt(2),'rx',-0.5,0,'kx',-1,-1,'gx') plt.xlabel('Phase value (Pi)') plt.ylabel('Eigenvalue of X') plt.show() # Creating registers qr = QuantumRegister(1) cr = ClassicalRegister(1) circuits = [] # Creating the circuits phase_vector = range(0,100) for phase_index in phase_vector: phase_shift = phase_index-50 phase = 2*np.pi*phase_shift/50 circuit_name = "phase_gate_%d"%phase_index qc_phase_gate = QuantumCircuit(qr, cr, name=circuit_name) qc_phase_gate.u3(phase,0,np.pi, qr) qc_phase_gate.measure(qr[0], cr[0]) circuits.append(qc_phase_gate) # Visualising one of the circuits as an example circuits[75].draw(output='mpl') # To run of qasm simulator backend = BasicAer.get_backend('qasm_simulator') # the number of shots in the experiment shots = 1024 result = execute(circuits, backend=backend, shots=shots).result() probz = [] phase_value = [] for phase_index in phase_vector: phase_shift = phase_index - 50 phase_value.append(2*phase_shift/50) if '0' in result.get_counts(circuits[phase_index]): probz.append(2*result.get_counts(circuits[phase_index]).get('0')/shots-1) else: probz.append(-1) plt.plot(phase_value, probz, 'b',0.5,0,'ko',1,-1,'go',-0.5,0,'kx',-1,-1,'gx') plt.xlabel('Phase value (Pi)') plt.ylabel('Eigenvalue of Z') plt.show()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import matplotlib.pyplot as plt %matplotlib inline # importing Qiskit from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit import BasicAer, IBMQ, execute # import basic plot tools from qiskit.tools.visualization import plot_histogram backend = BasicAer.get_backend('qasm_simulator') # run on local simulator by default # Uncomment the following lines to run on a real device # IBMQ.load_accounts() # from qiskit.backends.ibmq import least_busy # backend = least_busy(IBMQ.backends(operational=True, simulator=False)) # print("the best backend is " + backend.name()) # Creating registers q2 = QuantumRegister(2) c1 = ClassicalRegister(1) c2 = ClassicalRegister(2) # quantum circuit to make an entangled bell state bell = QuantumCircuit(q2) bell.h(q2[0]) bell.cx(q2[0], q2[1]) # quantum circuit to measure q0 in the standard basis measureIZ = QuantumCircuit(q2, c1) measureIZ.measure(q2[0], c1[0]) bellIZ = bell+measureIZ # quantum circuit to measure q0 in the superposition basis measureIX = QuantumCircuit(q2, c1) measureIX.h(q2[0]) measureIX.measure(q2[0], c1[0]) bellIX = bell+measureIX # quantum circuit to measure q1 in the standard basis measureZI = QuantumCircuit(q2, c1) measureZI.measure(q2[1], c1[0]) bellZI = bell+measureZI # quantum circuit to measure q1 in the superposition basis measureXI = QuantumCircuit(q2, c1) measureXI.h(q2[1]) measureXI.measure(q2[1], c1[0]) bellXI = bell+measureXI # quantum circuit to measure q in the standard basis measureZZ = QuantumCircuit(q2, c2) measureZZ.measure(q2[0], c2[0]) measureZZ.measure(q2[1], c2[1]) bellZZ = bell+measureZZ # quantum circuit to measure q in the superposition basis measureXX = QuantumCircuit(q2, c2) measureXX.h(q2[0]) measureXX.h(q2[1]) measureXX.measure(q2[0], c2[0]) measureXX.measure(q2[1], c2[1]) bellXX = bell+measureXX bellIZ.draw(output='mpl') bellIX.draw(output='mpl') bellZI.draw(output='mpl') bellXI.draw(output='mpl') bellZZ.draw(output='mpl') bellXX.draw(output='mpl') circuits = [bellIZ,bellIX,bellZI,bellXI,bellZZ,bellXX] job = execute(circuits, backend) result = job.result() plot_histogram(result.get_counts(bellIZ)) result.get_counts(bellIZ) plot_histogram(result.get_counts(bellIX)) plot_histogram(result.get_counts(bellZI)) plot_histogram(result.get_counts(bellXI)) plot_histogram(result.get_counts(bellZZ)) plot_histogram(result.get_counts(bellXX)) # quantum circuit to make a mixed state mixed1 = QuantumCircuit(q2, c2) mixed2 = QuantumCircuit(q2, c2) mixed2.x(q2) mixed1.measure(q2[0], c2[0]) mixed1.measure(q2[1], c2[1]) mixed2.measure(q2[0], c2[0]) mixed2.measure(q2[1], c2[1]) mixed1.draw(output='mpl') mixed2.draw(output='mpl') mixed_state = [mixed1,mixed2] job = execute(mixed_state, backend) result = job.result() counts1 = result.get_counts(mixed_state[0]) counts2 = result.get_counts(mixed_state[1]) from collections import Counter ground = Counter(counts1) excited = Counter(counts2) plot_histogram(ground+excited)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# Imports import matplotlib.pyplot as plt %matplotlib inline import numpy as np from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister, execute from qiskit.tools.visualization import plot_histogram from qiskit.tools.monitor import job_monitor from qiskit.quantum_info.analyzation.average import average_data from qiskit import IBMQ, BasicAer from qiskit.providers.ibmq import least_busy IBMQ.load_accounts() # use simulator to learn more about entangled quantum states where possible sim_backend = BasicAer.get_backend('qasm_simulator') sim_shots = 8192 # use device to test entanglement device_shots = 1024 device_backend = least_busy(IBMQ.backends(operational=True, simulator=False)) print("the best backend is " + device_backend.name()) # Creating registers q = QuantumRegister(2) c = ClassicalRegister(2) # quantum circuit to make an entangled bell state bell = QuantumCircuit(q, c) bell.h(q[0]) bell.cx(q[0], q[1]) # quantum circuit to measure q in the standard basis measureZZ = QuantumCircuit(q, c) measureZZ.measure(q[0], c[0]) measureZZ.measure(q[1], c[1]) bellZZ = bell+measureZZ # quantum circuit to measure q in the superposition basis measureXX = QuantumCircuit(q, c) measureXX.h(q[0]) measureXX.h(q[1]) measureXX.measure(q[0], c[0]) measureXX.measure(q[1], c[1]) bellXX = bell+measureXX # quantum circuit to measure ZX measureZX = QuantumCircuit(q, c) measureZX.h(q[0]) measureZX.measure(q[0], c[0]) measureZX.measure(q[1], c[1]) bellZX = bell+measureZX # quantum circuit to measure XZ measureXZ = QuantumCircuit(q, c) measureXZ.h(q[1]) measureXZ.measure(q[0], c[0]) measureXZ.measure(q[1], c[1]) bellXZ = bell+measureXZ circuits = [bellZZ,bellXX,bellZX,bellXZ] bellZZ.draw(output='mpl') bellXX.draw(output='mpl') bellZX.draw(output='mpl') bellXZ.draw(output='mpl') job = execute(circuits, backend=device_backend, shots=device_shots) job_monitor(job) result = job.result() observable_first ={'00': 1, '01': -1, '10': 1, '11': -1} observable_second ={'00': 1, '01': 1, '10': -1, '11': -1} observable_correlated ={'00': 1, '01': -1, '10': -1, '11': 1} print('IZ = ' + str(average_data(result.get_counts(bellZZ),observable_first))) print('ZI = ' + str(average_data(result.get_counts(bellZZ),observable_second))) print('ZZ = ' + str(average_data(result.get_counts(bellZZ),observable_correlated))) print('IX = ' + str(average_data(result.get_counts(bellXX),observable_first))) print('XI = ' + str(average_data(result.get_counts(bellXX),observable_second))) print('XX = ' + str(average_data(result.get_counts(bellXX),observable_correlated))) print('ZX = ' + str(average_data(result.get_counts(bellZX),observable_correlated))) print('XZ = ' + str(average_data(result.get_counts(bellXZ),observable_correlated))) CHSH = lambda x : x[0]+x[1]+x[2]-x[3] measure = [measureZZ, measureZX, measureXX, measureXZ] # Theory sim_chsh_circuits = [] sim_x = [] sim_steps = 30 for step in range(sim_steps): theta = 2.0*np.pi*step/30 bell_middle = QuantumCircuit(q,c) bell_middle.ry(theta,q[0]) for m in measure: sim_chsh_circuits.append(bell+bell_middle+m) sim_x.append(theta) job = execute(sim_chsh_circuits, backend=sim_backend, shots=sim_shots) result = job.result() sim_chsh = [] circ = 0 for x in range(len(sim_x)): temp_chsh = [] for m in range(len(measure)): temp_chsh.append(average_data(result.get_counts(sim_chsh_circuits[circ].name),observable_correlated)) circ += 1 sim_chsh.append(CHSH(temp_chsh)) # Experiment real_chsh_circuits = [] real_x = [] real_steps = 10 for step in range(real_steps): theta = 2.0*np.pi*step/10 bell_middle = QuantumCircuit(q,c) bell_middle.ry(theta,q[0]) for m in measure: real_chsh_circuits.append(bell+bell_middle+m) real_x.append(theta) job = execute(real_chsh_circuits, backend=device_backend, shots=device_shots) job_monitor(job) result = job.result() real_chsh = [] circ = 0 for x in range(len(real_x)): temp_chsh = [] for m in range(len(measure)): temp_chsh.append(average_data(result.get_counts(real_chsh_circuits[circ].name),observable_correlated)) circ += 1 real_chsh.append(CHSH(temp_chsh)) plt.plot(sim_x, sim_chsh, 'r-', real_x, real_chsh, 'bo') plt.plot([0, 2*np.pi], [2, 2], 'b-') plt.plot([0, 2*np.pi], [-2, -2], 'b-') plt.grid() plt.ylabel('CHSH', fontsize=20) plt.xlabel(r'$Y(\theta)$', fontsize=20) plt.show() print(real_chsh) # 2 - qubits # quantum circuit to make GHZ state q2 = QuantumRegister(2) c2 = ClassicalRegister(2) ghz = QuantumCircuit(q2, c2) ghz.h(q2[0]) ghz.cx(q2[0],q2[1]) # quantum circuit to measure q in standard basis measureZZ = QuantumCircuit(q2, c2) measureZZ.measure(q2[0], c2[0]) measureZZ.measure(q2[1], c2[1]) ghzZZ = ghz+measureZZ measureXX = QuantumCircuit(q2, c2) measureXX.h(q2[0]) measureXX.h(q2[1]) measureXX.measure(q2[0], c2[0]) measureXX.measure(q2[1], c2[1]) ghzXX = ghz+measureXX circuits2 = [ghzZZ, ghzXX] ghzZZ.draw(output='mpl') ghzXX.draw(output='mpl') job2 = execute(circuits2, backend=sim_backend, shots=sim_shots) result2 = job2.result() plot_histogram(result2.get_counts(ghzZZ)) plot_histogram(result2.get_counts(ghzXX)) # 3 - qubits # quantum circuit to make GHZ state q3 = QuantumRegister(3) c3 = ClassicalRegister(3) ghz3 = QuantumCircuit(q3, c3) ghz3.h(q3[0]) ghz3.cx(q3[0],q3[1]) ghz3.cx(q3[1],q3[2]) # quantum circuit to measure q in standard basis measureZZZ = QuantumCircuit(q3, c3) measureZZZ.measure(q3[0], c3[0]) measureZZZ.measure(q3[1], c3[1]) measureZZZ.measure(q3[2], c3[2]) ghzZZZ = ghz3+measureZZZ measureXXX = QuantumCircuit(q3, c3) measureXXX.h(q3[0]) measureXXX.h(q3[1]) measureXXX.h(q3[2]) measureXXX.measure(q3[0], c3[0]) measureXXX.measure(q3[1], c3[1]) measureXXX.measure(q3[2], c3[2]) ghzXXX = ghz3+measureXXX circuits3 = [ghzZZZ, ghzXXX] ghzZZZ.draw(output='mpl') ghzXXX.draw(output='mpl') job3 = execute(circuits3, backend=sim_backend, shots=sim_shots) result3 = job3.result() plot_histogram(result3.get_counts(ghzZZZ)) plot_histogram(result3.get_counts(ghzXXX)) # 4 - qubits # quantum circuit to make GHZ state q4 = QuantumRegister(4) c4 = ClassicalRegister(4) ghz4 = QuantumCircuit(q4, c4) ghz4.h(q4[0]) ghz4.cx(q4[0],q4[1]) ghz4.cx(q4[1],q4[2]) ghz4.h(q4[3]) ghz4.h(q4[2]) ghz4.cx(q4[3],q4[2]) ghz4.h(q4[3]) ghz4.h(q4[2]) # quantum circuit to measure q in standard basis measureZZZZ = QuantumCircuit(q4, c4) measureZZZZ.measure(q4[0], c4[0]) measureZZZZ.measure(q4[1], c4[1]) measureZZZZ.measure(q4[2], c4[2]) measureZZZZ.measure(q4[3], c4[3]) ghzZZZZ = ghz4+measureZZZZ measureXXXX = QuantumCircuit(q4, c4) measureXXXX.h(q4[0]) measureXXXX.h(q4[1]) measureXXXX.h(q4[2]) measureXXXX.h(q4[3]) measureXXXX.measure(q4[0], c4[0]) measureXXXX.measure(q4[1], c4[1]) measureXXXX.measure(q4[2], c4[2]) measureXXXX.measure(q4[3], c4[3]) ghzXXXX = ghz4+measureXXXX circuits4 = [ghzZZZZ, ghzXXXX] ghzZZZZ.draw(output='mpl') ghzXXXX.draw(output='mpl') job4 = execute(circuits4, backend=sim_backend, shots=sim_shots) result4 = job4.result() plot_histogram(result4.get_counts(ghzZZZZ)) plot_histogram(result4.get_counts(ghzXXXX)) # quantum circuit to make GHZ state q3 = QuantumRegister(3) c3 = ClassicalRegister(3) ghz3 = QuantumCircuit(q3, c3) ghz3.h(q3[0]) ghz3.cx(q3[0],q3[1]) ghz3.cx(q3[0],q3[2]) # quantum circuit to measure q in standard basis measureZZZ = QuantumCircuit(q3, c3) measureZZZ.measure(q3[0], c3[0]) measureZZZ.measure(q3[1], c3[1]) measureZZZ.measure(q3[2], c3[2]) ghzZZZ = ghz3+measureZZZ circuits5 = [ghzZZZ] ghzZZZ.draw(output='mpl') job5 = execute(circuits5, backend=sim_backend, shots=sim_shots) result5 = job5.result() plot_histogram(result5.get_counts(ghzZZZ)) MerminM = lambda x : x[0]*x[1]*x[2]*x[3] observable ={'000': 1, '001': -1, '010': -1, '011': 1, '100': -1, '101': 1, '110': 1, '111': -1} # quantum circuit to measure q XXX measureXXX = QuantumCircuit(q3, c3) measureXXX.h(q3[0]) measureXXX.h(q3[1]) measureXXX.h(q3[2]) measureXXX.measure(q3[0], c3[0]) measureXXX.measure(q3[1], c3[1]) measureXXX.measure(q3[2], c3[2]) ghzXXX = ghz3+measureXXX # quantum circuit to measure q XYY measureXYY = QuantumCircuit(q3, c3) measureXYY.s(q3[1]).inverse() measureXYY.s(q3[2]).inverse() measureXYY.h(q3[0]) measureXYY.h(q3[1]) measureXYY.h(q3[2]) measureXYY.measure(q3[0], c3[0]) measureXYY.measure(q3[1], c3[1]) measureXYY.measure(q3[2], c3[2]) ghzXYY = ghz3+measureXYY # quantum circuit to measure q YXY measureYXY = QuantumCircuit(q3, c3) measureYXY.s(q3[0]).inverse() measureYXY.s(q3[2]).inverse() measureYXY.h(q3[0]) measureYXY.h(q3[1]) measureYXY.h(q3[2]) measureYXY.measure(q3[0], c3[0]) measureYXY.measure(q3[1], c3[1]) measureYXY.measure(q3[2], c3[2]) ghzYXY = ghz3+measureYXY # quantum circuit to measure q YYX measureYYX = QuantumCircuit(q3, c3) measureYYX.s(q3[0]).inverse() measureYYX.s(q3[1]).inverse() measureYYX.h(q3[0]) measureYYX.h(q3[1]) measureYYX.h(q3[2]) measureYYX.measure(q3[0], c3[0]) measureYYX.measure(q3[1], c3[1]) measureYYX.measure(q3[2], c3[2]) ghzYYX = ghz3+measureYYX circuits6 = [ghzXXX, ghzYYX, ghzYXY, ghzXYY] ghzXXX.draw(output='mpl') ghzYYX.draw(output='mpl') ghzYXY.draw(output='mpl') ghzXYY.draw(output='mpl') job6 = execute(circuits6, backend=device_backend, shots=device_shots) job_monitor(job6) result6 = job6.result() temp=[] temp.append(average_data(result6.get_counts(ghzXXX),observable)) temp.append(average_data(result6.get_counts(ghzYYX),observable)) temp.append(average_data(result6.get_counts(ghzYXY),observable)) temp.append(average_data(result6.get_counts(ghzXYY),observable)) print(MerminM(temp))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import sys, getpass try: sys.path.append("../../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} print('Qconfig loaded from %s.' % Qconfig.__file__) except: APItoken = getpass.getpass('Please input your token and hit enter: ') qx_config = { "APItoken": APItoken, "url":"https://quantumexperience.ng.bluemix.net/api"} print('Qconfig.py not found in qiskit-tutorial directory; Qconfig loaded using user input.') # useful additional packages import matplotlib.pyplot as plt %matplotlib inline import numpy as np from pprint import pprint # importing QISKit from qiskit import QuantumProgram, QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit import available_backends, execute, register, least_busy # import basic plot tools from qiskit.tools.visualization import plot_histogram, circuit_drawer backend = 'local_qasm_simulator' # run on local simulator by default # Uncomment the following lines to run on a real device # register(qx_config['APItoken'], qx_config['url']) # backend = least_busy(available_backends({'simulator': False, 'local': False})) # print("the best backend is " + backend) # Creating registers tq = QuantumRegister(3) tc0 = ClassicalRegister(1) tc1 = ClassicalRegister(1) tc2 = ClassicalRegister(1) # Quantum circuit to make the shared entangled state teleport = QuantumCircuit(tq, tc0,tc1,tc2) teleport.h(tq[1]) teleport.cx(tq[1], tq[2]) teleport.ry(np.pi/4,tq[0]) teleport.cx(tq[0], tq[1]) teleport.h(tq[0]) teleport.barrier() teleport.measure(tq[0], tc0[0]) teleport.measure(tq[1], tc1[0]) teleport.z(tq[2]).c_if(tc0, 1) teleport.x(tq[2]).c_if(tc1, 1) teleport.measure(tq[2], tc2[0]) circuit_drawer(teleport) teleport_job = execute(teleport, 'local_qasm_simulator') # note that this circuit doesn't run on a real device teleport_result = teleport_job.result() data = teleport_result.get_counts(teleport) alice = {} alice['00'] = data['0 0 0'] + data['1 0 0'] alice['10'] = data['0 1 0'] + data['1 1 0'] alice['01'] = data['0 0 1'] + data['1 0 1'] alice['11'] = data['0 1 1'] + data['1 1 1'] plot_histogram(alice) bob = {} bob['0'] = data['0 0 0'] + data['0 1 0'] + data['0 0 1'] + data['0 1 1'] bob['1'] = data['1 0 0'] + data['1 1 0'] + data['1 0 1'] + data['1 1 1'] plot_histogram(bob) # Creating registers sdq = QuantumRegister(2) sdc = ClassicalRegister(2) # Quantum circuit to make the shared entangled state superdense = QuantumCircuit(sdq, sdc) superdense.h(sdq[0]) superdense.cx(sdq[0], sdq[1]) # For 00, do nothing # For 01, apply $X$ #shared.x(q[0]) # For 01, apply $Z$ #shared.z(q[0]) # For 11, apply $XZ$ superdense.z(sdq[0]) superdense.x(sdq[0]) superdense.barrier() superdense.cx(sdq[0], sdq[1]) superdense.h(sdq[0]) superdense.measure(sdq[0], sdc[0]) superdense.measure(sdq[1], sdc[1]) circuit_drawer(superdense) superdense_job = execute(superdense, backend) superdense_result = superdense_job.result() plot_histogram(superdense_result.get_counts(superdense))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import numpy as np import qiskit from qiskit import QuantumCircuit import matplotlib.pyplot as plt from qiskit.circuit import QuantumCircuit, Parameter import warnings warnings.filterwarnings('ignore') theta = Parameter("θ") phi = Parameter("φ") lamb = Parameter("λ") def sampleCircuitA(layer=1, qubits=4): circuit = QuantumCircuit(qubits) for i in range(layer): for i in range(qubits - 1): circuit.cx(i, i + 1) circuit.cx(qubits - 1, 0) for i in range(qubits - 1): circuit.cx(i, i + 1) circuit.cx(qubits - 1, 0) circuit.barrier() for i in range(qubits): circuit.u3(theta, phi, lamb, i) return circuit circuitA = sampleCircuitA(qubits=4) circuitA.draw(output='mpl') def sampleCircuitB1(layer=1, qubits=4): circuit = QuantumCircuit(qubits) for i in range(qubits): circuit.u1(theta, i) for i in range(layer): for j in range(qubits - 1): circuit.cz(j, j + 1) circuit.cz(qubits - 1, 0) circuit.barrier() for j in range(qubits): circuit.u1(theta, j) return circuit def sampleCircuitB2(layer=1, qubits=4): circuit = QuantumCircuit(qubits) for i in range(qubits): circuit.u2(phi, lamb, i) for i in range(layer): for j in range(qubits - 1): circuit.cz(j, j + 1) circuit.cz(qubits - 1, 0) circuit.barrier() for j in range(qubits): circuit.u2(phi, lamb, j) return circuit def sampleCircuitB3(layer=1, qubits=4): circuit = QuantumCircuit(qubits) for i in range(qubits): circuit.u3(theta, phi, lamb, i) for i in range(layer): for j in range(qubits - 1): circuit.cz(j, j + 1) circuit.cz(qubits - 1, 0) circuit.barrier() for j in range(qubits): circuit.u3(theta, phi, lamb, j) return circuit circuitB1 = sampleCircuitB1(qubits=4) circuitB1.draw(output='mpl') circuitB2 = sampleCircuitB2(qubits=4) circuitB2.draw(output='mpl') circuitB3 = sampleCircuitB3(qubits=4) circuitB3.draw(output='mpl') def sampleCircuitC(layer=1, qubits=4): circuit = QuantumCircuit(qubits) for i in range(layer): for j in range(qubits): circuit.ry(theta, j) circuit.crx(theta, qubits - 1, 0) for j in range(qubits - 1, 0, -1): circuit.crx(theta, j - 1, j) circuit.barrier() for j in range(qubits): circuit.ry(theta, j) circuit.crx(theta, 3, 2) circuit.crx(theta, 0, 3) circuit.crx(theta, 1, 0) circuit.crx(theta, 2, 1) return circuit circuitC = sampleCircuitC(qubits=4) circuitC.draw(output='mpl') def sampleCircuitD(layer=1, qubits=4): circuit = QuantumCircuit(qubits) for i in range(layer): for j in range(qubits): circuit.rx(theta, j) circuit.rz(theta, j) for j in range(qubits - 1, -1, -1): for k in range(qubits - 1, -1, -1): if j != k: circuit.crx(theta, j, k) circuit.barrier() for j in range(qubits): circuit.rx(theta, j) circuit.rz(theta, j) return circuit circuitD = sampleCircuitD(qubits=4) circuitD.draw(output='mpl') def sampleCircuitE(layer=1, qubits=4): circuit = QuantumCircuit(qubits) for i in range(layer): for j in range(qubits): circuit.rx(theta, j) circuit.rz(theta, j) for j in range(1, qubits, 2): circuit.crx(theta, j, j - 1) for j in range(qubits): circuit.rx(theta, j) circuit.rz(theta, j) for j in range(2, qubits, 2): circuit.crx(theta, j, j - 1) return circuit circuitE = sampleCircuitE(qubits=4) circuitE.draw(output='mpl') def sampleCircuitF(layer=1, qubits=4): circuit = QuantumCircuit(qubits) for i in range(layer): for j in range(qubits): circuit.rx(theta, j) circuit.rz(theta, j) circuit.crx(theta, qubits - 1, 0) for j in range(qubits - 1, 0, -1): circuit.crx(theta, j - 1, j) return circuit circuitF = sampleCircuitF(qubits=4) circuitF.draw(output='mpl') def sampleEncoding(qubits): circuit = QuantumCircuit(qubits) for i in range(qubits): circuit.h(i) circuit.ry(theta, i) return circuit circuit = sampleEncoding(4) circuit.draw(output='mpl') # demo: circuit = sampleEncoding(5).compose(sampleCircuitB3(layer=2, qubits=5)) circuit.draw(output='mpl')
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import numpy as np from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import execute from qiskit import BasicAer from qiskit.tools.visualization import plot_histogram from qiskit import IBMQ from qiskit.providers.ibmq import least_busy from qiskit.tools.monitor import job_monitor IBMQ.load_accounts() backend = IBMQ.get_backend('ibmq_qasm_simulator', hub=None) shots = 1024 # Number of shots to run the program (experiment); maximum is 8192 shots. max_credits = 3 # Maximum number of credits to spend on executions. def DJ_N3(qc): qc.h(q[0]) qc.h(q[1]) qc.h(q[2]) qc.h(q[2]) qc.z(q[0]) qc.cx(q[1], q[2]) qc.h(q[2]) qc.h(q[0]) qc.h(q[1]) qc.h(q[2]) qc.measure(q,c) # Create a Quantum Register with 3 qubits. q = QuantumRegister(3, 'q') c = ClassicalRegister(3,'c') # Create a Quantum Circuit acting on the q register qc = QuantumCircuit(q,c) DJ_N3(qc) qc.draw() job_hpc = execute(qc, backend=backend, shots=shots, max_credits=max_credits) result_hpc = job_hpc.result() counts_hpc = result_hpc.get_counts(qc) plot_histogram(counts_hpc)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import qiskit qiskit.__qiskit_version__ import numpy as np import matplotlib.pyplot as plt %matplotlib inline # importing Qiskit from qiskit import BasicAer, IBMQ from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister, execute from qiskit.compiler import transpile from qiskit.tools.visualization import plot_histogram q = QuantumRegister(6) qc = QuantumCircuit(q) qc.x(q[2]) qc.cx(q[1], q[5]) qc.cx(q[2], q[5]) qc.cx(q[3], q[5]) qc.ccx(q[1], q[2], q[4]) qc.ccx(q[3], q[4], q[5]) qc.ccx(q[1], q[2], q[4]) qc.x(q[2]) qc.draw(output='mpl') def black_box_u_f(circuit, f_in, f_out, aux, n, exactly_1_3_sat_formula): """Circuit that computes the black-box function from f_in to f_out. Create a circuit that verifies whether a given exactly-1 3-SAT formula is satisfied by the input. The exactly-1 version requires exactly one literal out of every clause to be satisfied. """ num_clauses = len(exactly_1_3_sat_formula) for (k, clause) in enumerate(exactly_1_3_sat_formula): # This loop ensures aux[k] is 1 if an odd number of literals # are true for literal in clause: if literal > 0: circuit.cx(f_in[literal-1], aux[k]) else: circuit.x(f_in[-literal-1]) circuit.cx(f_in[-literal-1], aux[k]) # Flip aux[k] if all literals are true, using auxiliary qubit # (ancilla) aux[num_clauses] circuit.ccx(f_in[0], f_in[1], aux[num_clauses]) circuit.ccx(f_in[2], aux[num_clauses], aux[k]) # Flip back to reverse state of negative literals and ancilla circuit.ccx(f_in[0], f_in[1], aux[num_clauses]) for literal in clause: if literal < 0: circuit.x(f_in[-literal-1]) # The formula is satisfied if and only if all auxiliary qubits # except aux[num_clauses] are 1 if (num_clauses == 1): circuit.cx(aux[0], f_out[0]) elif (num_clauses == 2): circuit.ccx(aux[0], aux[1], f_out[0]) elif (num_clauses == 3): circuit.ccx(aux[0], aux[1], aux[num_clauses]) circuit.ccx(aux[2], aux[num_clauses], f_out[0]) circuit.ccx(aux[0], aux[1], aux[num_clauses]) else: raise ValueError('We only allow at most 3 clauses') # Flip back any auxiliary qubits to make sure state is consistent # for future executions of this routine; same loop as above. for (k, clause) in enumerate(exactly_1_3_sat_formula): for literal in clause: if literal > 0: circuit.cx(f_in[literal-1], aux[k]) else: circuit.x(f_in[-literal-1]) circuit.cx(f_in[-literal-1], aux[k]) circuit.ccx(f_in[0], f_in[1], aux[num_clauses]) circuit.ccx(f_in[2], aux[num_clauses], aux[k]) circuit.ccx(f_in[0], f_in[1], aux[num_clauses]) for literal in clause: if literal < 0: circuit.x(f_in[-literal-1]) # -- end function def n_controlled_Z(circuit, controls, target): """Implement a Z gate with multiple controls""" if (len(controls) > 2): raise ValueError('The controlled Z with more than 2 ' + 'controls is not implemented') elif (len(controls) == 1): circuit.h(target) circuit.cx(controls[0], target) circuit.h(target) elif (len(controls) == 2): circuit.h(target) circuit.ccx(controls[0], controls[1], target) circuit.h(target) # -- end function def inversion_about_average(circuit, f_in, n): """Apply inversion about the average step of Grover's algorithm.""" # Hadamards everywhere for j in range(n): circuit.h(f_in[j]) # D matrix: flips the sign of the state |000> only for j in range(n): circuit.x(f_in[j]) n_controlled_Z(circuit, [f_in[j] for j in range(n-1)], f_in[n-1]) for j in range(n): circuit.x(f_in[j]) # Hadamards everywhere again for j in range(n): circuit.h(f_in[j]) # -- end function qr = QuantumRegister(3) qInvAvg = QuantumCircuit(qr) inversion_about_average(qInvAvg, qr, 3) qInvAvg.draw(output='mpl') """ Grover search implemented in Qiskit. This module contains the code necessary to run Grover search on 3 qubits, both with a simulator and with a real quantum computing device. This code is the companion for the paper "An introduction to quantum computing, without the physics", Giacomo Nannicini, https://arxiv.org/abs/1708.03684. """ def input_state(circuit, f_in, f_out, n): """(n+1)-qubit input state for Grover search.""" for j in range(n): circuit.h(f_in[j]) circuit.x(f_out) circuit.h(f_out) # -- end function # Make a quantum program for the n-bit Grover search. n = 3 # Exactly-1 3-SAT formula to be satisfied, in conjunctive # normal form. We represent literals with integers, positive or # negative, to indicate a Boolean variable or its negation. exactly_1_3_sat_formula = [[1, 2, -3], [-1, -2, -3], [-1, 2, 3]] # Define three quantum registers: 'f_in' is the search space (input # to the function f), 'f_out' is bit used for the output of function # f, aux are the auxiliary bits used by f to perform its # computation. f_in = QuantumRegister(n) f_out = QuantumRegister(1) aux = QuantumRegister(len(exactly_1_3_sat_formula) + 1) # Define classical register for algorithm result ans = ClassicalRegister(n) # Define quantum circuit with above registers grover = QuantumCircuit() grover.add_register(f_in) grover.add_register(f_out) grover.add_register(aux) grover.add_register(ans) input_state(grover, f_in, f_out, n) T = 2 for t in range(T): # Apply T full iterations black_box_u_f(grover, f_in, f_out, aux, n, exactly_1_3_sat_formula) inversion_about_average(grover, f_in, n) # Measure the output register in the computational basis for j in range(n): grover.measure(f_in[j], ans[j]) # Execute circuit backend = BasicAer.get_backend('qasm_simulator') job = execute([grover], backend=backend, shots=1000) result = job.result() # Get counts and plot histogram counts = result.get_counts(grover) plot_histogram(counts) IBMQ.load_account() # get ibmq_16_melbourne configuration and coupling map backend = IBMQ.get_backend('ibmq_16_melbourne') # compile the circuit for ibmq_16_rueschlikon grover_compiled = transpile(grover, backend=backend, seed_transpiler=1, optimization_level=3) print('gates = ', grover_compiled.count_ops()) print('depth = ', grover_compiled.depth()) grover.draw(output='mpl', scale=0.5)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import numpy as np # Import Qiskit from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit import Aer, execute from qiskit.tools.visualization import plot_histogram, plot_state_city # List Aer backends Aer.backends() from qiskit.providers.aer import QasmSimulator, StatevectorSimulator, UnitarySimulator # Construct quantum circuit qr = QuantumRegister(2, 'qr') cr = ClassicalRegister(2, 'cr') circ = QuantumCircuit(qr, cr) circ.h(qr[0]) circ.cx(qr[0], qr[1]) circ.measure(qr, cr) # Select the QasmSimulator from the Aer provider simulator = Aer.get_backend('qasm_simulator') # Execute and get counts result = execute(circ, simulator).result() counts = result.get_counts(circ) plot_histogram(counts, title='Bell-State counts') # Construct quantum circuit qr = QuantumRegister(2, 'qr') cr = ClassicalRegister(2, 'cr') circ = QuantumCircuit(qr, cr) circ.h(qr[0]) circ.cx(qr[0], qr[1]) circ.measure(qr, cr) # Select the QasmSimulator from the Aer provider simulator = Aer.get_backend('qasm_simulator') # Execute and get memory result = execute(circ, simulator, shots=10, memory=True).result() memory = result.get_memory(circ) print(memory) # Construct an empty quantum circuit qr = QuantumRegister(2) cr = ClassicalRegister(2) circ = QuantumCircuit(qr, cr) circ.measure(qr, cr) # Set the initial state opts = {"initial_statevector": np.array([1, 0, 0, 1] / np.sqrt(2))} # Select the QasmSimulator from the Aer provider simulator = Aer.get_backend('qasm_simulator') # Execute and get counts result = execute(circ, simulator, backend_options=opts).result() counts = result.get_counts(circ) plot_histogram(counts, title="Bell initial statevector") # Construct quantum circuit without measure qr = QuantumRegister(2, 'qr') circ = QuantumCircuit(qr) circ.h(qr[0]) circ.cx(qr[0], qr[1]) # Select the StatevectorSimulator from the Aer provider simulator = Aer.get_backend('statevector_simulator') # Execute and get counts result = execute(circ, simulator).result() statevector = result.get_statevector(circ) plot_state_city(statevector, title='Bell state') # Construct quantum circuit with measure qr = QuantumRegister(2, 'qr') cr = ClassicalRegister(2, 'cr') circ = QuantumCircuit(qr, cr) circ.h(qr[0]) circ.cx(qr[0], qr[1]) circ.measure(qr, cr) # Select the StatevectorSimulator from the Aer provider simulator = Aer.get_backend('statevector_simulator') # Execute and get counts result = execute(circ, simulator).result() statevector = result.get_statevector(circ) plot_state_city(statevector, title='Bell state post-measurement') # Construct an empty quantum circuit qr = QuantumRegister(2) circ = QuantumCircuit(qr) circ.iden(qr) # Set the initial state opts = {"initial_statevector": np.array([1, 0, 0, 1] / np.sqrt(2))} # Select the StatevectorSimulator from the Aer provider simulator = Aer.get_backend('statevector_simulator') # Execute and get counts result = execute(circ, simulator, backend_options=opts).result() statevector = result.get_statevector(circ) plot_state_city(statevector, title="Bell initial statevector") # Construct an empty quantum circuit qr = QuantumRegister(2) circ = QuantumCircuit(qr) circ.h(qr[0]) circ.cx(qr[0], qr[1]) # Select the UnitarySimulator from the Aer provider simulator = Aer.get_backend('unitary_simulator') # Execute and get counts result = execute(circ, simulator).result() unitary = result.get_unitary(circ) print("Circuit unitary:\n", unitary) # Construct an empty quantum circuit qr = QuantumRegister(2) circ = QuantumCircuit(qr) circ.iden(qr) # Set the initial unitary opts = {"initial_unitary": np.array([[ 1, 1, 0, 0], [ 0, 0, 1, -1], [ 0, 0, 1, 1], [ 1, -1, 0, 0]] / np.sqrt(2))} # Select the UnitarySimulator from the Aer provider simulator = Aer.get_backend('unitary_simulator') # Execute and get counts result = execute(circ, simulator, backend_options=opts).result() unitary = result.get_unitary(circ) unitary = result.get_unitary(circ) print("Initial Unitary:\n", unitary)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
#量子エラー研究.平均誤差率 from qiskit import IBMQ, transpile from qiskit import QuantumCircuit from qiskit_aer import AerSimulator from qiskit.tools.visualization import plot_histogram from qiskit.providers.fake_provider import FakeVigo device_backend =FakeVigo() circ = QuantumCircuit(3, 3) circ.h(0) circ.cx(0, 1) circ.cx(1, 2) circ.measure([0,1,2],[0,1,2]) sim_ideal = AerSimulator() result = sim_ideal.run(transpile(circ, sim_ideal)).result() counts =result.get_counts(0) plot_histogram(counts, title='Ideal counts for 3-qubit GHZ state') #ibmq-vigo のsimulator sim_vigo = AerSimulator.from_backend(device_backend) tcirc = transpile(circ,sim_vigo) result_noise =sim_vigo.run(tcirc).result() counts_noise = result_noise.get_counts(0) plot_histogram(counts_noise, title="Counts for 3-qubit GHZ device noise model") import qiskit.tools.jupyter %qiskit_version_table %qiskit_copyright
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qsvm_datasets import * from qiskit import Aer from qiskit_aqua.utils import split_dataset_to_data_and_labels, map_label_to_class_name from qiskit_aqua.input import SVMInput from qiskit_aqua import run_algorithm, QuantumInstance from qiskit_aqua.algorithms import QSVMKernel from qiskit_aqua.components.feature_maps import SecondOrderExpansion # setup aqua logging import logging from qiskit_aqua import set_aqua_logging # set_aqua_logging(logging.DEBUG) # choose INFO, DEBUG to see the log from qiskit import IBMQ IBMQ.load_accounts() feature_dim=2 # we support feature_dim 2 or 3 sample_Total, training_input, test_input, class_labels = ad_hoc_data(training_size=20, test_size=10, n=feature_dim, gap=0.3, PLOT_DATA=True) extra_test_data = sample_ad_hoc_data(sample_Total, 10, n=feature_dim) datapoints, class_to_label = split_dataset_to_data_and_labels(extra_test_data) print(class_to_label) seed = 10598 feature_map = SecondOrderExpansion(num_qubits=feature_dim, depth=2, entanglement='linear') qsvm = QSVMKernel(feature_map, training_input, test_input, datapoints[0]) backend = Aer.get_backend('qasm_simulator') quantum_instance = QuantumInstance(backend, shots=1024, seed=seed, seed_mapper=seed) result = qsvm.run(quantum_instance) """declarative approach params = { 'problem': {'name': 'svm_classification', 'random_seed': 10598}, 'algorithm': { 'name': 'QSVM.Kernel' }, 'backend': {'name': 'qasm_simulator', 'shots': 1024}, 'feature_map': {'name': 'SecondOrderExpansion', 'depth': 2, 'entanglement': 'linear'} } algo_input = SVMInput(training_input, test_input, datapoints[0]) result = run_algorithm(params, algo_input) """ print("testing success ratio: {}".format(result['testing_accuracy'])) print("preduction of datapoints:") print("ground truth: {}".format(map_label_to_class_name(datapoints[1], qsvm.label_to_class))) print("prediction: {}".format(result['predicted_classes'])) print("kernel matrix during the training:") kernel_matrix = result['kernel_matrix_training'] img = plt.imshow(np.asmatrix(kernel_matrix),interpolation='nearest',origin='upper',cmap='bone_r') plt.show() sample_Total, training_input, test_input, class_labels = Breast_cancer(training_size=20, test_size=10, n=2, PLOT_DATA=True) seed = 10598 feature_map = SecondOrderExpansion(num_qubits=feature_dim, depth=2, entanglement='linear') qsvm = QSVMKernel(feature_map, training_input, test_input) backend = Aer.get_backend('qasm_simulator') quantum_instance = QuantumInstance(backend, shots=1024, seed=seed, seed_mapper=seed) result = qsvm.run(quantum_instance) """declarative approach, re-use the params above algo_input = SVMInput(training_input, test_input) result = run_algorithm(params, algo_input) """ print("testing success ratio: ", result['testing_accuracy']) print("kernel matrix during the training:") kernel_matrix = result['kernel_matrix_training'] img = plt.imshow(np.asmatrix(kernel_matrix),interpolation='nearest',origin='upper',cmap='bone_r') plt.show()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit_chemistry import QiskitChemistry from qiskit import Aer # from qiskit import IBMQ # IBMQ.load_accounts() # backend = IBMQ.get_backend('ibmq_16_melbourne') from qiskit import Aer backend = Aer.get_backend('statevector_simulator') # Input dictionary to configure Qiskit AQUA Chemistry for the chemistry problem. qiskit_chemistry_dict = { 'driver': {'name': 'HDF5'}, 'HDF5': {'hdf5_input': 'H2/0.7_sto-3g.hdf5'}, 'operator': {'name': 'hamiltonian'}, 'algorithm': {'name': 'VQE'}, 'optimizer': {'name': 'COBYLA'}, 'variational_form': {'name': 'UCCSD'}, 'initial_state': {'name': 'HartreeFock'} } solver = QiskitChemistry() result = solver.run(qiskit_chemistry_dict, backend=backend) print('Ground state energy: {}'.format(result['energy'])) for line in result['printable']: print(line)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import matplotlib.pyplot as plt %matplotlib inline import numpy as np from qiskit import Aer from qiskit_chemistry import QiskitChemistry import warnings warnings.filterwarnings('ignore') # setup qiskit_chemistry logging import logging from qiskit_chemistry import set_qiskit_chemistry_logging set_qiskit_chemistry_logging(logging.ERROR) # choose among DEBUG, INFO, WARNING, ERROR, CRITICAL and NOTSET # from qiskit import IBMQ # IBMQ.load_accounts() # First, we use classical eigendecomposition to get ground state energy (including nuclear repulsion energy) as reference. qiskit_chemistry_dict = { 'driver': {'name': 'HDF5'}, 'HDF5': {'hdf5_input': 'H2/H2_equilibrium_0.735_sto-3g.hdf5'}, 'operator': {'name':'hamiltonian', 'qubit_mapping': 'parity', 'two_qubit_reduction': True}, 'algorithm': {'name': 'ExactEigensolver'} } solver = QiskitChemistry() result = solver.run(qiskit_chemistry_dict) print('Ground state energy (classical): {:.12f}'.format(result['energy'])) # Second, we use variational quantum eigensolver (VQE) qiskit_chemistry_dict['algorithm']['name'] = 'VQE' qiskit_chemistry_dict['optimizer'] = {'name': 'SPSA', 'max_trials': 350} qiskit_chemistry_dict['variational_form'] = {'name': 'RYRZ', 'depth': 3, 'entanglement':'full'} backend = Aer.get_backend('statevector_simulator') solver = QiskitChemistry() result = solver.run(qiskit_chemistry_dict, backend=backend) print('Ground state energy (quantum) : {:.12f}'.format(result['energy'])) print("====================================================") # You can also print out other info in the field 'printable' for line in result['printable']: print(line) # select H2 or LiH to experiment with molecule='H2' qiskit_chemistry_dict = { 'driver': {'name': 'HDF5'}, 'HDF5': {'hdf5_input': ''}, 'operator': {'name':'hamiltonian', 'qubit_mapping': 'parity', 'two_qubit_reduction': True}, 'algorithm': {'name': ''}, 'optimizer': {'name': 'SPSA', 'max_trials': 350}, 'variational_form': {'name': 'RYRZ', 'depth': 3, 'entanglement':'full'} } # choose which backend want to use # backend = Aer.get_backend('statevector_simulator') backend = Aer.get_backend('qasm_simulator') backend_cfg = {'shots': 1024} algos = ['ExactEigensolver', 'VQE'] if molecule == 'LiH': mol_distances = np.arange(0.6, 5.1, 0.1) qiskit_chemistry_dict['operator']['freeze_core'] = True qiskit_chemistry_dict['operator']['orbital_reduction'] = [-3, -2] qiskit_chemistry_dict['optimizer']['max_trials'] = 2500 qiskit_chemistry_dict['variational_form']['depth'] = 5 else: mol_distances = np.arange(0.2, 4.1, 0.1) energy = np.zeros((len(algos), len(mol_distances))) for j, algo in enumerate(algos): qiskit_chemistry_dict['algorithm']['name'] = algo if algo == 'ExactEigensolver': qiskit_chemistry_dict.pop('backend', None) elif algo == 'VQE': qiskit_chemistry_dict['backend'] = backend_cfg print("Using {}".format(algo)) for i, dis in enumerate(mol_distances): print("Processing atomic distance: {:1.1f} Angstrom".format(dis), end='\r') qiskit_chemistry_dict['HDF5']['hdf5_input'] = "{}/{:1.1f}_sto-3g.hdf5".format(molecule, dis) result = solver.run(qiskit_chemistry_dict, backend=backend if algo == 'VQE' else None) energy[j][i] = result['energy'] print("\n") for i, algo in enumerate(algos): plt.plot(mol_distances, energy[i], label=algo) plt.xlabel('Atomic distance (Angstrom)') plt.ylabel('Energy') plt.legend() plt.show()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# import common packages import numpy as np from qiskit import Aer # lib from Qiskit Aqua from qiskit_aqua import Operator, QuantumInstance from qiskit_aqua.algorithms import VQE, ExactEigensolver from qiskit_aqua.components.optimizers import COBYLA # lib from Qiskit Aqua Chemistry from qiskit_chemistry import FermionicOperator from qiskit_chemistry.drivers import PySCFDriver, UnitsType from qiskit_chemistry.aqua_extensions.components.variational_forms import UCCSD from qiskit_chemistry.aqua_extensions.components.initial_states import HartreeFock # using driver to get fermionic Hamiltonian # PySCF example driver = PySCFDriver(atom='Li .0 .0 .0; H .0 .0 1.6', unit=UnitsType.ANGSTROM, charge=0, spin=0, basis='sto3g') molecule = driver.run() # please be aware that the idx here with respective to original idx freeze_list = [0] remove_list = [-3, -2] # negative number denotes the reverse order map_type = 'parity' h1 = molecule.one_body_integrals h2 = molecule.two_body_integrals nuclear_repulsion_energy = molecule.nuclear_repulsion_energy num_particles = molecule.num_alpha + molecule.num_beta num_spin_orbitals = molecule.num_orbitals * 2 print("HF energy: {}".format(molecule.hf_energy - molecule.nuclear_repulsion_energy)) print("# of electrons: {}".format(num_particles)) print("# of spin orbitals: {}".format(num_spin_orbitals)) # prepare full idx of freeze_list and remove_list # convert all negative idx to positive remove_list = [x % molecule.num_orbitals for x in remove_list] freeze_list = [x % molecule.num_orbitals for x in freeze_list] # update the idx in remove_list of the idx after frozen, since the idx of orbitals are changed after freezing remove_list = [x - len(freeze_list) for x in remove_list] remove_list += [x + molecule.num_orbitals - len(freeze_list) for x in remove_list] freeze_list += [x + molecule.num_orbitals for x in freeze_list] # prepare fermionic hamiltonian with orbital freezing and eliminating, and then map to qubit hamiltonian # and if PARITY mapping is selected, reduction qubits energy_shift = 0.0 qubit_reduction = True if map_type == 'parity' else False ferOp = FermionicOperator(h1=h1, h2=h2) if len(freeze_list) > 0: ferOp, energy_shift = ferOp.fermion_mode_freezing(freeze_list) num_spin_orbitals -= len(freeze_list) num_particles -= len(freeze_list) if len(remove_list) > 0: ferOp = ferOp.fermion_mode_elimination(remove_list) num_spin_orbitals -= len(remove_list) qubitOp = ferOp.mapping(map_type=map_type, threshold=0.00000001) qubitOp = qubitOp.two_qubit_reduced_operator(num_particles) if qubit_reduction else qubitOp qubitOp.chop(10**-10) print(qubitOp.print_operators()) print(qubitOp) # Using exact eigensolver to get the smallest eigenvalue exact_eigensolver = ExactEigensolver(qubitOp, k=1) ret = exact_eigensolver.run() print('The computed energy is: {:.12f}'.format(ret['eigvals'][0].real)) print('The total ground state energy is: {:.12f}'.format(ret['eigvals'][0].real + energy_shift + nuclear_repulsion_energy)) # from qiskit import IBMQ # IBMQ.load_accounts() backend = Aer.get_backend('statevector_simulator') # setup COBYLA optimizer max_eval = 200 cobyla = COBYLA(maxiter=max_eval) # setup HartreeFock state HF_state = HartreeFock(qubitOp.num_qubits, num_spin_orbitals, num_particles, map_type, qubit_reduction) # setup UCCSD variational form var_form = UCCSD(qubitOp.num_qubits, depth=1, num_orbitals=num_spin_orbitals, num_particles=num_particles, active_occupied=[0], active_unoccupied=[0, 1], initial_state=HF_state, qubit_mapping=map_type, two_qubit_reduction=qubit_reduction, num_time_slices=1) # setup VQE vqe = VQE(qubitOp, var_form, cobyla, 'matrix') quantum_instance = QuantumInstance(backend=backend) results = vqe.run(quantum_instance) print('The computed ground state energy is: {:.12f}'.format(results['eigvals'][0])) print('The total ground state energy is: {:.12f}'.format(results['eigvals'][0] + energy_shift + nuclear_repulsion_energy)) print("Parameters: {}".format(results['opt_params']))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import matplotlib.pyplot as plt %matplotlib inline import numpy as np from qiskit import BasicAer from qiskit_aqua.algorithms import AmplitudeEstimation from qiskit_aqua.components.uncertainty_problems import EuropeanCallExpectedValue, EuropeanCallDelta from qiskit_aqua.components.random_distributions import LogNormalDistribution # number of qubits to represent the uncertainty num_uncertainty_qubits = 3 # parameters for considered random distribution S = 2.0 # initial spot price vol = 0.4 # volatility of 40% r = 0.05 # annual interest rate of 4% T = 40 / 365 # 40 days to maturity # resulting parameters for log-normal distribution mu = ((r - 0.5 * vol**2) * T + np.log(S)) sigma = vol * np.sqrt(T) mean = np.exp(mu + sigma**2/2) variance = (np.exp(sigma**2) - 1) * np.exp(2*mu + sigma**2) stddev = np.sqrt(variance) # lowest and highest value considered for the spot price; in between, an equidistant discretization is considered. low = np.maximum(0, mean - 3*stddev) high = mean + 3*stddev # construct circuit factory for uncertainty model uncertainty_model = LogNormalDistribution(num_uncertainty_qubits, mu=mu, sigma=sigma, low=low, high=high) # plot probability distribution x = uncertainty_model.values y = uncertainty_model.probabilities plt.bar(x, y, width=0.2) plt.xticks(x, size=15, rotation=90) plt.yticks(size=15) plt.grid() plt.xlabel('Spot Price at Maturity $S_T$ (\$)', size=15) plt.ylabel('Probability ($\%$)', size=15) plt.show() # set the strike price (should be within the low and the high value of the uncertainty) strike_price = 2 # set the approximation scaling for the payoff function c_approx = 0.25 # construct circuit factory for payoff function european_call = EuropeanCallExpectedValue( uncertainty_model, strike_price=strike_price, c_approx=c_approx ) # plot exact payoff function (evaluated on the grid of the uncertainty model) x = uncertainty_model.values y = np.maximum(0, x - strike_price) plt.plot(x, y, 'ro-') plt.grid() plt.title('Payoff Function', size=15) plt.xlabel('Spot Price', size=15) plt.ylabel('Payoff', size=15) plt.xticks(x, size=15, rotation=90) plt.yticks(size=15) plt.show() # evaluate exact expected value (normalized to the [0, 1] interval) exact_value = np.dot(uncertainty_model.probabilities, y) exact_delta = sum(uncertainty_model.probabilities[x >= strike_price]) print('exact (normalized) expected value:\t%.4f' % exact_value) print('exact (normalized) delta value: \t%.4f' % exact_delta) # set number of evaluation qubits (samples) m = 5 # construct amplitude estimation ae = AmplitudeEstimation(m, european_call) # result = ae.run(quantum_instance=BasicAer.get_backend('qasm_simulator'), shots=100) result = ae.run(quantum_instance=BasicAer.get_backend('statevector_simulator')) print('Exact value: \t%.4f' % exact_value) print('Estimated value:\t%.4f' % result['estimation']) print('Probability: \t%.4f' % result['max_probability']) # plot estimated values for "a" plt.bar(result['values'], result['probabilities'], width=0.5/len(result['probabilities'])) plt.xticks([0, 0.25, 0.5, 0.75, 1], size=15) plt.yticks([0, 0.25, 0.5, 0.75, 1], size=15) plt.title('"a" Value', size=15) plt.ylabel('Probability', size=15) plt.ylim((0,1)) plt.grid() plt.show() # plot estimated values for option price (after re-scaling and reversing the c_approx-transformation) plt.bar(result['mapped_values'], result['probabilities'], width=1/len(result['probabilities'])) plt.plot([exact_value, exact_value], [0,1], 'r--', linewidth=2) plt.xticks(size=15) plt.yticks([0, 0.25, 0.5, 0.75, 1], size=15) plt.title('Estimated Option Price', size=15) plt.ylabel('Probability', size=15) plt.ylim((0,1)) plt.grid() plt.show() european_call_delta = EuropeanCallDelta( uncertainty_model, strike_price ) # set number of evaluation qubits (=log(samples) m = 5 # construct amplitude estimation ae_delta = AmplitudeEstimation(m, european_call_delta) # result_delta = ae_delta.run(quantum_instance=BasicAer.get_backend('qasm_simulator'), shots=100) result_delta = ae_delta.run(quantum_instance=BasicAer.get_backend('statevector_simulator')) print('Exact delta: \t%.4f' % exact_delta) print('Esimated value:\t%.4f' % result_delta['estimation']) print('Probability: \t%.4f' % result_delta['max_probability']) # plot estimated values for delta plt.bar(result_delta['values'], result_delta['probabilities'], width=0.5/len(result_delta['probabilities'])) plt.plot([exact_delta, exact_delta], [0,1], 'r--', linewidth=2) plt.xticks(size=15) plt.yticks([0, 0.25, 0.5, 0.75, 1], size=15) plt.title('Estimated Option Delta', size=15) plt.ylabel('Probability', size=15) plt.ylim((0,1)) plt.grid() plt.show()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import matplotlib.pyplot as plt %matplotlib inline import numpy as np from qiskit import BasicAer from qiskit_aqua.algorithms import AmplitudeEstimation from qiskit_aqua.components.random_distributions import MultivariateNormalDistribution from qiskit_aqua.components.uncertainty_problems import FixedIncomeExpectedValue # can be used in case a principal component analysis has been done to derive the uncertainty model, ignored in this example. A = np.eye(2) b = np.zeros(2) # specify the number of qubits that are used to represent the different dimenions of the uncertainty model num_qubits = [2, 2] # specify the lower and upper bounds for the different dimension low = [0, 0] high = [0.12, 0.24] mu = [0.12, 0.24] sigma = 0.01*np.eye(2) # construct corresponding distribution u = MultivariateNormalDistribution(num_qubits, low, high, mu, sigma) # plot contour of probability density function x = np.linspace(low[0], high[0], 2**num_qubits[0]) y = np.linspace(low[1], high[1], 2**num_qubits[1]) z = u.probabilities.reshape(2**num_qubits[0], 2**num_qubits[1]) plt.contourf(x, y, z) plt.xticks(x, size=15) plt.yticks(y, size=15) plt.grid() plt.xlabel('$r_1$ (%)', size=15) plt.ylabel('$r_2$ (%)', size=15) plt.colorbar() plt.show() # specify cash flow cf = [1.0, 2.0] periods = range(1, len(cf)+1) # plot cash flow plt.bar(periods, cf) plt.xticks(periods, size=15) plt.yticks(size=15) plt.grid() plt.xlabel('periods', size=15) plt.ylabel('cashflow ($)', size=15) plt.show() # estimate real value cnt = 0 exact_value = 0.0 for x1 in np.linspace(low[0], high[0], pow(2, num_qubits[0])): for x2 in np.linspace(low[1], high[1], pow(2, num_qubits[1])): prob = u.probabilities[cnt] for t in range(len(cf)): # evaluate linear approximation of real value w.r.t. interest rates exact_value += prob * (cf[t]/pow(1 + b[t], t+1) - (t+1)*cf[t]*np.dot(A[:, t], np.asarray([x1, x2]))/pow(1 + b[t], t+2)) cnt += 1 print('Exact value: \t%.4f' % exact_value) # specify approximation factor c_approx = 0.125 # get fixed income circuit appfactory fixed_income = FixedIncomeExpectedValue(u, A, b, cf, c_approx) # set number of evaluation qubits (samples) m = 5 # construct amplitude estimation ae = AmplitudeEstimation(m, fixed_income) # result = ae.run(quantum_instance=BasicAer.get_backend('qasm_simulator'), shots=100) result = ae.run(quantum_instance=BasicAer.get_backend('statevector_simulator')) print('Exact value: \t%.4f' % exact_value) print('Estimated value:\t%.4f' % result['estimation']) print('Probability: \t%.4f' % result['max_probability']) # plot estimated values for "a" (direct result of amplitude estimation, not rescaled yet) plt.bar(result['values'], result['probabilities'], width=0.5/len(result['probabilities'])) plt.xticks([0, 0.25, 0.5, 0.75, 1], size=15) plt.yticks([0, 0.25, 0.5, 0.75, 1], size=15) plt.title('"a" Value', size=15) plt.ylabel('Probability', size=15) plt.xlim((0,1)) plt.ylim((0,1)) plt.grid() plt.show() # plot estimated values for fixed-income asset (after re-scaling and reversing the c_approx-transformation) plt.bar(result['mapped_values'], result['probabilities'], width=3/len(result['probabilities'])) plt.plot([exact_value, exact_value], [0,1], 'r--', linewidth=2) plt.xticks(size=15) plt.yticks([0, 0.25, 0.5, 0.75, 1], size=15) plt.title('Estimated Option Price', size=15) plt.ylabel('Probability', size=15) plt.ylim((0,1)) plt.grid() plt.show()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import BasicAer from qiskit_aqua import QuantumInstance from qiskit_aqua import Operator, run_algorithm from qiskit_aqua.input import EnergyInput from qiskit_aqua.translators.ising import portfolio from qiskit_aqua.algorithms import VQE, QAOA, ExactEigensolver from qiskit_aqua.components.optimizers import COBYLA from qiskit_aqua.components.variational_forms import RY import numpy as np from qiskit import IBMQ IBMQ.load_accounts() # set number of assets (= number of qubits) num_assets = 4 # get random expected return vector (mu) and covariance matrix (sigma) mu, sigma = portfolio.random_model(num_assets, seed=42) q = 0.5 # set risk factor budget = int(num_assets / 2) # set budget penalty = num_assets # set parameter to scale the budget penalty term qubitOp, offset = portfolio.get_portfolio_qubitops(mu, sigma, q, budget, penalty) algo_input = EnergyInput(qubitOp) def index_to_selection(i, num_assets): s = "{0:b}".format(i).rjust(num_assets) x = np.array([1 if s[i]=='1' else 0 for i in reversed(range(num_assets))]) return x def print_result(result): selection = portfolio.sample_most_likely(result['eigvecs'][0]) value = portfolio.portfolio_value(selection, mu, sigma, q, budget, penalty) print('Optimal: selection {}, value {:.4f}'.format(selection, value)) probabilities = np.abs(result['eigvecs'][0])**2 i_sorted = reversed(np.argsort(probabilities)) print('\n----------------- Full result ---------------------') print('selection\tvalue\t\tprobability') print('---------------------------------------------------') for i in i_sorted: x = index_to_selection(i, num_assets) value = portfolio.portfolio_value(x, mu, sigma, q, budget, penalty) probability = probabilities[i] print('%10s\t%.4f\t\t%.4f' %(x, value, probability)) exact_eigensolver = ExactEigensolver(qubitOp, k=1) result = exact_eigensolver.run() """ the equivalent if using declarative approach algorithm_cfg = { 'name': 'ExactEigensolver' } params = { 'problem': {'name': 'ising'}, 'algorithm': algorithm_cfg } result = run_algorithm(params, algo_input) """ print_result(result) backend = BasicAer.get_backend('statevector_simulator') seed = 50 cobyla = COBYLA() cobyla.set_options(maxiter=250) ry = RY(qubitOp.num_qubits, depth=3, entanglement='full') vqe = VQE(qubitOp, ry, cobyla, 'matrix') vqe.random_seed = seed quantum_instance = QuantumInstance(backend=backend, seed=seed, seed_mapper=seed) result = vqe.run(quantum_instance) """declarative approach algorithm_cfg = { 'name': 'VQE', 'operator_mode': 'matrix' } optimizer_cfg = { 'name': 'COBYLA', 'maxiter': 250 } var_form_cfg = { 'name': 'RY', 'depth': 3, 'entanglement': 'full' } params = { 'problem': {'name': 'ising', 'random_seed': seed}, 'algorithm': algorithm_cfg, 'optimizer': optimizer_cfg, 'variational_form': var_form_cfg } result = run_algorithm(params, algo_input, backend=backend) """ print_result(result) backend = BasicAer.get_backend('statevector_simulator') seed = 50 cobyla = COBYLA() cobyla.set_options(maxiter=250) qaoa = QAOA(qubitOp, cobyla, 3, 'matrix') qaoa.random_seed = seed quantum_instance = QuantumInstance(backend=backend, seed=seed, seed_mapper=seed) result = qaoa.run(quantum_instance) """declarative approach algorithm_cfg = { 'name': 'QAOA.Variational', 'p': 3, 'operator_mode': 'matrix' } optimizer_cfg = { 'name': 'COBYLA', 'maxiter': 250 } params = { 'problem': {'name': 'ising', 'random_seed': seed}, 'algorithm': algorithm_cfg, 'optimizer': optimizer_cfg } result = run_algorithm(params, algo_input, backend=backend) """ print_result(result)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit_aqua import register_pluggable from evolutionfidelity.evolutionfidelity import EvolutionFidelity try: register_pluggable(EvolutionFidelity) except Exception as e: print(e) from qiskit import Aer import numpy as np from qiskit_aqua.operator import Operator from evolutionfidelity.evolutionfidelity import EvolutionFidelity from qiskit_aqua.components.initial_states import Zero from qiskit_aqua import QuantumInstance num_qubits = 2 temp = np.random.random((2 ** num_qubits, 2 ** num_qubits)) qubit_op = Operator(matrix=temp + temp.T) initial_state = Zero(qubit_op.num_qubits) algo = EvolutionFidelity(qubit_op, initial_state, expansion_order=1) backend = Aer.get_backend('statevector_simulator') quantum_instance = QuantumInstance(backend=backend) result = algo.run(quantum_instance) print(result['score']) from qiskit_aqua.input import EnergyInput from qiskit_aqua import run_algorithm params = { 'problem': { 'name': 'eoh' }, 'algorithm': { 'name': 'EvolutionFidelity', 'expansion_order': 1 }, 'initial_state': { 'name': 'ZERO' } } algo_input = EnergyInput(qubit_op) result = run_algorithm(params, algo_input, backend=backend) print(result['score'])
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# -*- coding: utf-8 -*- # Copyright 2018 IBM. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================= """ The Fidelity of Quantum Evolution. This is a simple tutorial example to show how to build an algorithm to extend Qiskit Aqua library. Algorithms are designed to be dynamically discovered within Qiskit Aqua. For this the entire parent directory 'evolutionfidelity' should be moved under the 'qiskit_aqua' directory. The current demonstration notebook shows how to explicitly register the algorithm and works without re-locating this code. The former automatic discovery does however allow the algorithm to be found and seen in the UI browser, and selected from the GUI when choosing an algorithm. """ import logging import numpy as np from qiskit import QuantumRegister from qiskit.quantum_info import state_fidelity from qiskit_aqua.algorithms import QuantumAlgorithm from qiskit_aqua import AquaError, PluggableType, get_pluggable_class logger = logging.getLogger(__name__) class EvolutionFidelity(QuantumAlgorithm): """The Tutorial Sample EvolutionFidelity algorithm.""" PROP_EXPANSION_ORDER = 'expansion_order' """ A configuration dictionary defines the algorithm to QISKIt Aqua. It can contain the following though this sample does not have them all. name: Is the registered name and will be used as the case-sensitive key to load an instance description: As it implies a brief description of algorithm classical: True if purely a classical algorithm that does not need a quantum backend input_schema: A json schema detailing the configuration variables of this entity. Each variable as a type, and can be given default, minimum etc. This conforms to JSON Schema which can be consulted for for detail. The existing algorithms and other pluggable entities may also be helpful to refer to. problems: A list of problems the algorithm can solve depends: A list of dependent object types defaults: A list of configurations for the dependent objects. May just list names if the dependent's defaults are acceptable """ CONFIGURATION = { 'name': 'EvolutionFidelity', 'description': 'Sample Demo EvolutionFidelity Algorithm for Quantum Systems', 'input_schema': { '$schema': 'http://json-schema.org/schema#', 'id': 'evolution_fidelity_schema', 'type': 'object', 'properties': { PROP_EXPANSION_ORDER: { 'type': 'integer', 'default': 1, 'minimum': 1 }, }, 'additionalProperties': False }, 'problems': ['eoh'], 'depends': ['initial_state'], 'defaults': { 'initial_state': { 'name': 'ZERO' } } } """ If directly use these objects programmatically then the constructor is more convenient to call than init_params. init_params itself uses this to do the actual object initialization. """ def __init__(self, operator, initial_state, expansion_order=1): self.validate(locals()) super().__init__() self._operator = operator self._initial_state = initial_state self._expansion_order = expansion_order self._ret = {} """ init_params is called via run_algorithm. The params contain all the configuration settings of the objects. algo_input contains data computed from above for the algorithm. A simple algorithm may have all its data in configuration params such that algo_input is None """ @classmethod def init_params(cls, params, algo_input): """ Initialize via parameters dictionary and algorithm input instance. Args: params: parameters dictionary algo_input: EnergyInput instance """ if algo_input is None: raise AquaError("EnergyInput instance is required.") operator = algo_input.qubit_op evolution_fidelity_params = params.get(QuantumAlgorithm.SECTION_KEY_ALGORITHM) expansion_order = evolution_fidelity_params.get(EvolutionFidelity.PROP_EXPANSION_ORDER) # Set up initial state, we need to add computed num qubits to params initial_state_params = params.get(QuantumAlgorithm.SECTION_KEY_INITIAL_STATE) initial_state_params['num_qubits'] = operator.num_qubits initial_state = get_pluggable_class(PluggableType.INITIAL_STATE, initial_state_params['name']).init_params(initial_state_params) return cls(operator, initial_state, expansion_order) """ Once the algorithm has been initialized then run is called to carry out the computation and the result is returned as a dictionary. E.g., the `_run` method is required to be implemented for an algorithm. """ def _run(self): evo_time = 1 # get the groundtruth via simple matrix * vector state_out_exact = self._operator.evolve(self._initial_state.construct_circuit('vector'), evo_time, 'matrix', 0) qr = QuantumRegister(self._operator.num_qubits, name='q') circuit = self._initial_state.construct_circuit('circuit', qr) circuit += self._operator.evolve( None, evo_time, 'circuit', 1, quantum_registers=qr, expansion_mode='suzuki', expansion_order=self._expansion_order ) result = self._quantum_instance.execute(circuit) state_out_dynamics = np.asarray(result.get_statevector(circuit)) self._ret['score'] = state_fidelity(state_out_exact, state_out_dynamics) return self._ret
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# useful additional packages import matplotlib.pyplot as plt import matplotlib.axes as axes %matplotlib inline import numpy as np import networkx as nx from qiskit import Aer from qiskit.tools.visualization import plot_histogram from qiskit_aqua import Operator, run_algorithm from qiskit_aqua.input import EnergyInput from qiskit_aqua.translators.ising import maxcut, tsp from qiskit_aqua.algorithms import VQE, ExactEigensolver from qiskit_aqua.components.optimizers import SPSA from qiskit_aqua.components.variational_forms import RY from qiskit_aqua import QuantumInstance # setup aqua logging import logging from qiskit_aqua import set_aqua_logging # set_aqua_logging(logging.DEBUG) # choose INFO, DEBUG to see the log from qiskit import IBMQ IBMQ.load_accounts() # Generating a graph of 4 nodes n=4 # Number of nodes in graph G=nx.Graph() G.add_nodes_from(np.arange(0,n,1)) elist=[(0,1,1.0),(0,2,1.0),(0,3,1.0),(1,2,1.0),(2,3,1.0)] # tuple is (i,j,weight) where (i,j) is the edge G.add_weighted_edges_from(elist) colors = ['r' for node in G.nodes()] pos = nx.spring_layout(G) default_axes = plt.axes(frameon=True) nx.draw_networkx(G, node_color=colors, node_size=600, alpha=.8, ax=default_axes, pos=pos) # Computing the weight matrix from the random graph w = np.zeros([n,n]) for i in range(n): for j in range(n): temp = G.get_edge_data(i,j,default=0) if temp != 0: w[i,j] = temp['weight'] print(w) best_cost_brute = 0 for b in range(2**n): x = [int(t) for t in reversed(list(bin(b)[2:].zfill(n)))] cost = 0 for i in range(n): for j in range(n): cost = cost + w[i,j]*x[i]*(1-x[j]) if best_cost_brute < cost: best_cost_brute = cost xbest_brute = x print('case = ' + str(x)+ ' cost = ' + str(cost)) colors = ['r' if xbest_brute[i] == 0 else 'b' for i in range(n)] nx.draw_networkx(G, node_color=colors, node_size=600, alpha=.8, pos=pos) print('\nBest solution = ' + str(xbest_brute) + ' cost = ' + str(best_cost_brute)) qubitOp, offset = maxcut.get_maxcut_qubitops(w) algo_input = EnergyInput(qubitOp) #Making the Hamiltonian in its full form and getting the lowest eigenvalue and eigenvector ee = ExactEigensolver(qubitOp, k=1) result = ee.run() """ algorithm_cfg = { 'name': 'ExactEigensolver', } params = { 'problem': {'name': 'ising'}, 'algorithm': algorithm_cfg } result = run_algorithm(params,algo_input) """ x = maxcut.sample_most_likely(result['eigvecs'][0]) print('energy:', result['energy']) print('maxcut objective:', result['energy'] + offset) print('solution:', maxcut.get_graph_solution(x)) print('solution objective:', maxcut.maxcut_value(x, w)) colors = ['r' if maxcut.get_graph_solution(x)[i] == 0 else 'b' for i in range(n)] nx.draw_networkx(G, node_color=colors, node_size=600, alpha = .8, pos=pos) seed = 10598 spsa = SPSA(max_trials=300) ry = RY(qubitOp.num_qubits, depth=5, entanglement='linear') vqe = VQE(qubitOp, ry, spsa, 'matrix') backend = Aer.get_backend('statevector_simulator') quantum_instance = QuantumInstance(backend=backend, seed=seed, seed_mapper=seed) result = vqe.run(quantum_instance) """declarative apporach algorithm_cfg = { 'name': 'VQE', 'operator_mode': 'matrix' } optimizer_cfg = { 'name': 'SPSA', 'max_trials': 300 } var_form_cfg = { 'name': 'RY', 'depth': 5, 'entanglement': 'linear' } params = { 'problem': {'name': 'ising', 'random_seed': seed}, 'algorithm': algorithm_cfg, 'optimizer': optimizer_cfg, 'variational_form': var_form_cfg, 'backend': {'name': 'statevector_simulator'} } result = run_algorithm(params, algo_input) """ x = maxcut.sample_most_likely(result['eigvecs'][0]) print('energy:', result['energy']) print('time:', result['eval_time']) print('maxcut objective:', result['energy'] + offset) print('solution:', maxcut.get_graph_solution(x)) print('solution objective:', maxcut.maxcut_value(x, w)) colors = ['r' if maxcut.get_graph_solution(x)[i] == 0 else 'b' for i in range(n)] nx.draw_networkx(G, node_color=colors, node_size=600, alpha = .8, pos=pos) # run quantum algorithm with shots seed = 10598 spsa = SPSA(max_trials=300) ry = RY(qubitOp.num_qubits, depth=5, entanglement='linear') vqe = VQE(qubitOp, ry, spsa, 'grouped_paulis') backend = Aer.get_backend('qasm_simulator') quantum_instance = QuantumInstance(backend=backend, shots=1024, seed=seed, seed_mapper=seed) result = vqe.run(quantum_instance) """declarative approach, update the param from the previous cell. params['algorithm']['operator_mode'] = 'grouped_paulis' params['backend']['name'] = 'qasm_simulator' params['backend']['shots'] = 1024 result = run_algorithm(params, algo_input) """ x = maxcut.sample_most_likely(result['eigvecs'][0]) print('energy:', result['energy']) print('time:', result['eval_time']) print('maxcut objective:', result['energy'] + offset) print('solution:', maxcut.get_graph_solution(x)) print('solution objective:', maxcut.maxcut_value(x, w)) plot_histogram(result['eigvecs'][0]) colors = ['r' if maxcut.get_graph_solution(x)[i] == 0 else 'b' for i in range(n)] nx.draw_networkx(G, node_color=colors, node_size=600, alpha = .8, pos=pos) # Generating a graph of 3 nodes n = 3 num_qubits = n ** 2 ins = tsp.random_tsp(n) G = nx.Graph() G.add_nodes_from(np.arange(0, n, 1)) colors = ['r' for node in G.nodes()] pos = {k: v for k, v in enumerate(ins.coord)} default_axes = plt.axes(frameon=True) nx.draw_networkx(G, node_color=colors, node_size=600, alpha=.8, ax=default_axes, pos=pos) print('distance\n', ins.w) from itertools import permutations def brute_force_tsp(w, N): a=list(permutations(range(1,N))) last_best_distance = 1e10 for i in a: distance = 0 pre_j = 0 for j in i: distance = distance + w[j,pre_j] pre_j = j distance = distance + w[pre_j,0] order = (0,) + i if distance < last_best_distance: best_order = order last_best_distance = distance print('order = ' + str(order) + ' Distance = ' + str(distance)) return last_best_distance, best_order best_distance, best_order = brute_force_tsp(ins.w, ins.dim) print('Best order from brute force = ' + str(best_order) + ' with total distance = ' + str(best_distance)) def draw_tsp_solution(G, order, colors, pos): G2 = G.copy() n = len(order) for i in range(n): j = (i + 1) % n G2.add_edge(order[i], order[j]) default_axes = plt.axes(frameon=True) nx.draw_networkx(G2, node_color=colors, node_size=600, alpha=.8, ax=default_axes, pos=pos) draw_tsp_solution(G, best_order, colors, pos) qubitOp, offset = tsp.get_tsp_qubitops(ins) algo_input = EnergyInput(qubitOp) #Making the Hamiltonian in its full form and getting the lowest eigenvalue and eigenvector ee = ExactEigensolver(qubitOp, k=1) result = ee.run() """ algorithm_cfg = { 'name': 'ExactEigensolver', } params = { 'problem': {'name': 'ising'}, 'algorithm': algorithm_cfg } result = run_algorithm(params,algo_input) """ print('energy:', result['energy']) #print('tsp objective:', result['energy'] + offset) x = tsp.sample_most_likely(result['eigvecs'][0]) print('feasible:', tsp.tsp_feasible(x)) z = tsp.get_tsp_solution(x) print('solution:', z) print('solution objective:', tsp.tsp_value(z, ins.w)) draw_tsp_solution(G, z, colors, pos) seed = 10598 spsa = SPSA(max_trials=300) ry = RY(qubitOp.num_qubits, depth=5, entanglement='linear') vqe = VQE(qubitOp, ry, spsa, 'matrix') backend = Aer.get_backend('statevector_simulator') quantum_instance = QuantumInstance(backend=backend, seed=seed, seed_mapper=seed) result = vqe.run(quantum_instance) """ algorithm_cfg = { 'name': 'VQE', 'operator_mode': 'matrix' } optimizer_cfg = { 'name': 'SPSA', 'max_trials': 300 } var_form_cfg = { 'name': 'RY', 'depth': 5, 'entanglement': 'linear' } params = { 'problem': {'name': 'ising', 'random_seed': seed}, 'algorithm': algorithm_cfg, 'optimizer': optimizer_cfg, 'variational_form': var_form_cfg, 'backend': {'name': 'statevector_simulator'} } result = run_algorithm(parahms,algo_input) """ print('energy:', result['energy']) print('time:', result['eval_time']) #print('tsp objective:', result['energy'] + offset) x = tsp.sample_most_likely(result['eigvecs'][0]) print('feasible:', tsp.tsp_feasible(x)) z = tsp.get_tsp_solution(x) print('solution:', z) print('solution objective:', tsp.tsp_value(z, ins.w)) draw_tsp_solution(G, z, colors, pos) # run quantum algorithm with shots seed = 10598 spsa = SPSA(max_trials=300) ry = RY(qubitOp.num_qubits, depth=5, entanglement='linear') vqe = VQE(qubitOp, ry, spsa, 'grouped_paulis', batch_mode=True) backend = Aer.get_backend('qasm_simulator') quantum_instance = QuantumInstance(backend=backend, shots=1024, seed=seed, seed_mapper=seed) result = vqe.run(quantum_instance) """update params in the previous cell params['algorithm']['operator_mode'] = 'grouped_paulis' params['backend']['name'] = 'qasm_simulator' params['backend']['shots'] = 1024 result = run_algorithm(params,algo_input) """ print('energy:', result['energy']) print('time:', result['eval_time']) #print('tsp objective:', result['energy'] + offset) x = tsp.sample_most_likely(result['eigvecs'][0]) print('feasible:', tsp.tsp_feasible(x)) z = tsp.get_tsp_solution(x) print('solution:', z) print('solution objective:', tsp.tsp_value(z, ins.w)) plot_histogram(result['eigvecs'][0]) draw_tsp_solution(G, z, colors, pos)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import numpy as np from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import execute # Create a Quantum Register with 3 qubits. q = QuantumRegister(3, 'q') # Create a Quantum Circuit acting on the q register circ = QuantumCircuit(q) # Add a H gate on qubit 0, putting this qubit in superposition. circ.h(q[0]) # Add a CX (CNOT) gate on control qubit 0 and target qubit 1, putting # the qubits in a Bell state. circ.cx(q[0], q[1]) # Add a CX (CNOT) gate on control qubit 0 and target qubit 2, putting # the qubits in a GHZ state. circ.cx(q[0], q[2]) circ.draw() # Import Aer from qiskit import BasicAer # Run the quantum circuit on a statevector simulator backend backend = BasicAer.get_backend('statevector_simulator') # Create a Quantum Program for execution job = execute(circ, backend) result = job.result() outputstate = result.get_statevector(circ, decimals=3) print(outputstate) from qiskit.tools.visualization import plot_state_city plot_state_city(outputstate) # Run the quantum circuit on a unitary simulator backend backend = BasicAer.get_backend('unitary_simulator') job = execute(circ, backend) result = job.result() # Show the results print(result.get_unitary(circ, decimals=3)) # Create a Classical Register with 3 bits. c = ClassicalRegister(3, 'c') # Create a Quantum Circuit meas = QuantumCircuit(q, c) meas.barrier(q) # map the quantum measurement to the classical bits meas.measure(q,c) # The Qiskit circuit object supports composition using # the addition operator. qc = circ+meas #drawing the circuit qc.draw() # Use Aer's qasm_simulator backend_sim = BasicAer.get_backend('qasm_simulator') # Execute the circuit on the qasm simulator. # We've set the number of repeats of the circuit # to be 1024, which is the default. job_sim = execute(qc, backend_sim, shots=1024) # Grab the results from the job. result_sim = job_sim.result() counts = result_sim.get_counts(qc) print(counts) from qiskit.tools.visualization import plot_histogram plot_histogram(counts) from qiskit import IBMQ IBMQ.load_accounts() print("Available backends:") IBMQ.backends() from qiskit.providers.ibmq import least_busy large_enough_devices = IBMQ.backends(filters=lambda x: x.configuration().n_qubits > 4 and not x.configuration().simulator) backend = least_busy(large_enough_devices) print("The best backend is " + backend.name()) from qiskit.tools.monitor import job_monitor shots = 1024 # Number of shots to run the program (experiment); maximum is 8192 shots. max_credits = 3 # Maximum number of credits to spend on executions. job_exp = execute(qc, backend=backend, shots=shots, max_credits=max_credits) job_monitor(job_exp) result_exp = job_exp.result() counts_exp = result_exp.get_counts(qc) plot_histogram([counts_exp,counts]) backend = IBMQ.get_backend('ibmq_qasm_simulator', hub=None) shots = 1024 # Number of shots to run the program (experiment); maximum is 8192 shots. max_credits = 3 # Maximum number of credits to spend on executions. job_hpc = execute(qc, backend=backend, shots=shots, max_credits=max_credits) result_hpc = job_hpc.result() counts_hpc = result_hpc.get_counts(qc) plot_histogram(counts_hpc) jobID = job_exp.job_id() print('JOB ID: {}'.format(jobID)) job_get=backend.retrieve_job(jobID) job_get.result().get_counts(qc)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit.tools.visualization import plot_histogram from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import execute, BasicAer q = QuantumRegister(2) c = ClassicalRegister(2) # quantum circuit to make a Bell state bell = QuantumCircuit(q,c) bell.h(q[0]) bell.cx(q[0],q[1]) meas = QuantumCircuit(q,c) meas.measure(q, c) # execute the quantum circuit backend = BasicAer.get_backend('qasm_simulator') # the device to run on circ = bell+meas result = execute(circ, backend, shots=1000).result() counts = result.get_counts(circ) print(counts) plot_histogram(counts) # Execute 2 qubit Bell state again second_result = execute(circ, backend, shots=1000).result() second_counts = second_result.get_counts(circ) # Plot results with legend legend = ['First execution', 'Second execution'] plot_histogram([counts, second_counts], legend=legend) plot_histogram([counts, second_counts], legend=legend, sort='desc', figsize=(15,12), color=['orange', 'black'], bar_labels=False) from qiskit.tools.visualization import iplot_histogram # Run in interactive mode iplot_histogram(counts) from qiskit.tools.visualization import plot_state_city, plot_bloch_multivector, plot_state_paulivec, plot_state_hinton, plot_state_qsphere # execute the quantum circuit backend = BasicAer.get_backend('statevector_simulator') # the device to run on result = execute(bell, backend).result() psi = result.get_statevector(bell) plot_state_city(psi) plot_state_hinton(psi) plot_state_qsphere(psi) plot_state_paulivec(psi) plot_bloch_multivector(psi) plot_state_city(psi, title="My City", color=['black', 'orange']) plot_state_hinton(psi, title="My Hinton") plot_state_paulivec(psi, title="My Paulivec", color=['purple', 'orange', 'green']) plot_bloch_multivector(psi, title="My Bloch Spheres") from qiskit.tools.visualization import iplot_state_paulivec # Generate an interactive pauli vector plot iplot_state_paulivec(psi) from qiskit.tools.visualization import plot_bloch_vector plot_bloch_vector([0,1,0]) plot_bloch_vector([0,1,0], title='My Bloch Sphere')
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import IBMQ IBMQ.backends() IBMQ.delete_accounts() IBMQ.stored_accounts() import Qconfig_IBMQ_experience import Qconfig_IBMQ_network IBMQ.enable_account(Qconfig_IBMQ_experience.APItoken) # uncomment to print to screen (it will show your token and url) # IBMQ.active_accounts() IBMQ.backends() IBMQ.disable_accounts(token=Qconfig_IBMQ_experience.APItoken) IBMQ.backends() IBMQ.save_account(Qconfig_IBMQ_experience.APItoken, overwrite=True) IBMQ.save_account(Qconfig_IBMQ_network.APItoken, Qconfig_IBMQ_network.url, overwrite=True) # uncomment to print to screen (it will show your token and url) # IBMQ.stored_accounts() IBMQ.active_accounts() IBMQ.backends() IBMQ.load_accounts() IBMQ.backends() IBMQ.backends(hub='ibm-q-internal') IBMQ.disable_accounts(hub='ibm-q-internal') # uncomment to print to screen (it will show your token and url) # IBMQ.active_accounts() IBMQ.backends() IBMQ.disable_accounts() IBMQ.load_accounts(hub=None) IBMQ.backends() IBMQ.backends(operational=True, simulator=False) IBMQ.backends(filters=lambda x: x.configuration().n_qubits <= 5 and not x.configuration().simulator and x.status().operational==True) from qiskit.providers.ibmq import least_busy small_devices = IBMQ.backends(filters=lambda x: x.configuration().n_qubits == 5 and not x.configuration().simulator) least_busy(small_devices) IBMQ.get_backend('ibmq_16_melbourne') backend = least_busy(small_devices) backend.provider backend.name() backend.status() backend.configuration() backend.properties() backend.hub backend.group backend.project for ran_job in backend.jobs(limit=5): print(str(ran_job.job_id()) + " " + str(ran_job.status())) job = backend.retrieve_job(ran_job.job_id()) job.status() backend_temp = job.backend() backend_temp job.job_id() result = job.result() counts = result.get_counts() print(counts) job.creation_date() from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister from qiskit import compile qr = QuantumRegister(3) cr = ClassicalRegister(3) circuit = QuantumCircuit(qr, cr) circuit.x(qr[0]) circuit.x(qr[1]) circuit.ccx(qr[0], qr[1], qr[2]) circuit.cx(qr[0], qr[1]) circuit.measure(qr, cr) qobj = compile(circuit, backend=backend, shots=1024) job = backend.run(qobj) job.status() import time #time.sleep(10) job.cancel() job.status() job = backend.run(qobj) from qiskit.tools.monitor import job_monitor job_monitor(job) result = job.result() counts = result.get_counts() print(counts)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import numpy as np import matplotlib.pyplot as plt import qiskit from qiskit.providers.aer.noise.errors.standard_errors import coherent_unitary_error from qiskit.providers.aer.noise import NoiseModel from qiskit.ignis.characterization.hamiltonian import ZZFitter, zz_circuits from qiskit.ignis.characterization.gates import (AmpCalFitter, ampcal_1Q_circuits, AngleCalFitter, anglecal_1Q_circuits, AmpCalCXFitter, ampcal_cx_circuits, AngleCalCXFitter, anglecal_cx_circuits) # ZZ rates are typically ~ 100kHz so we want Ramsey oscillations around 1MHz # 12 numbers ranging from 10 to 1000, logarithmically spaced # extra point at 1500 num_of_gates = np.arange(0,150,5) gate_time = 0.1 # Select the qubits whose ZZ will be measured qubits = [0] spectators = [1] # Generate experiments circs, xdata, osc_freq = zz_circuits(num_of_gates, gate_time, qubits, spectators, nosc=2) # Set the simulator with ZZ zz_unitary = np.eye(4,dtype=complex) zz_unitary[3,3] = np.exp(1j*2*np.pi*0.02*gate_time) error = coherent_unitary_error(zz_unitary) noise_model = NoiseModel() noise_model.add_nonlocal_quantum_error(error, 'id', [0], [0,1]) # Run the simulator backend = qiskit.Aer.get_backend('qasm_simulator') shots = 500 # For demonstration purposes split the execution into two jobs print("Running the first 20 circuits") backend_result1 = qiskit.execute(circs[0:20], backend, shots=shots, noise_model=noise_model).result() print("Running the rest of the circuits") backend_result2 = qiskit.execute(circs[20:], backend, shots=shots, noise_model=noise_model).result() %matplotlib inline # Fit the data to an oscillation plt.figure(figsize=(10, 6)) initial_a = 1 initial_c = 0 initial_f = osc_freq initial_phi = -np.pi/20 # Instantiate the fitter # pass the 2 results in as a list of results fit = ZZFitter([backend_result1, backend_result2], xdata, qubits, spectators, fit_p0=[initial_a, initial_f, initial_phi, initial_c], fit_bounds=([-0.5, 0, -np.pi, -0.5], [1.5, 2*osc_freq, np.pi, 1.5])) fit.plot_ZZ(0, ax=plt.gca()) print("ZZ Rate: %f kHz"%(fit.ZZ_rate()[0]*1e3)) plt.show() qubits = [4,2] circs, xdata = ampcal_1Q_circuits(10, qubits) print(circs[2]) # Set the simulator # Add a rotation error err_unitary = np.zeros([2,2],dtype=complex) angle_err = 0.1 for i in range(2): err_unitary[i,i] = np.cos(angle_err) err_unitary[i,(i+1) % 2] = np.sin(angle_err) err_unitary[0,1] *= -1.0 error = coherent_unitary_error(err_unitary) noise_model = NoiseModel() noise_model.add_all_qubit_quantum_error(error, 'u2') # Run the simulator backend = qiskit.Aer.get_backend('qasm_simulator') shots = 500 backend_result1 = qiskit.execute(circs, backend, shots=shots, noise_model=noise_model).result() %matplotlib inline # Fit the data to an oscillation plt.figure(figsize=(10, 6)) initial_theta = 0.02 initial_c = 0.5 initial_phi = 0.1 fit = AmpCalFitter(backend_result1, xdata, qubits, fit_p0=[initial_theta, initial_c], fit_bounds=([-np.pi, -1], [np.pi, 1])) # plot the result for the number 1 indexed qubit. # In this case that refers to Q2 since we passed in as [4, 2]) fit.plot(1, ax=plt.gca()) print("Rotation Error on U2: %f rads"%(fit.angle_err()[0])) plt.show() qubits = [0,1] circs, xdata = anglecal_1Q_circuits(10, qubits, angleerr=0.1) #The U1 gates are added errors to test the procedure print(circs[2]) # Set the simulator # Run the simulator backend = qiskit.Aer.get_backend('qasm_simulator') shots = 1000 backend_result1 = qiskit.execute(circs, backend, shots=shots).result() %matplotlib inline # Fit the data to an oscillation plt.figure(figsize=(10, 6)) initial_theta = 0.02 initial_c = 0.5 initial_phi = 0.01 fit = AngleCalFitter(backend_result1, xdata, qubits, fit_p0=[initial_theta, initial_c], fit_bounds=([-np.pi, -1], [np.pi, 1])) fit.plot(0, ax=plt.gca()) print("Angle error between X and Y: %f rads"%(fit.angle_err()[0])) plt.show() # We can specify more than one CX gate to calibrate in parallel # but these lists must be the same length and not contain # any duplicate elements qubits = [0,2] controls = [1,3] circs, xdata = ampcal_cx_circuits(15, qubits, controls) print(circs[2]) # Set the simulator # Add a rotation error on CX # only if the control is in the excited state err_unitary = np.eye(4,dtype=complex) angle_err = 0.15 for i in range(2): err_unitary[2+i,2+i] = np.cos(angle_err) err_unitary[2+i,2+(i+1) % 2] = -1j*np.sin(angle_err) error = coherent_unitary_error(err_unitary) noise_model = NoiseModel() noise_model.add_nonlocal_quantum_error(error, 'cx', [1,0], [0,1]) # Run the simulator backend = qiskit.Aer.get_backend('qasm_simulator') shots = 1500 backend_result1 = qiskit.execute(circs, backend, shots=shots, noise_model=noise_model).result() %matplotlib inline # Fit the data to an oscillation plt.figure(figsize=(10, 6)) initial_theta = 0.02 initial_c = 0.5 initial_phi = 0.01 fit = AmpCalCXFitter(backend_result1, xdata, qubits, fit_p0=[initial_theta, initial_c], fit_bounds=([-np.pi, -1], [np.pi, 1])) fit.plot(0, ax=plt.gca()) print("Rotation Error on CX: %f rads"%(fit.angle_err()[0])) plt.show() qubits = [0,2] controls = [1,3] circs, xdata = anglecal_cx_circuits(15, qubits, controls, angleerr=0.1) print(circs[2]) # Set the simulator # Run the simulator backend = qiskit.Aer.get_backend('qasm_simulator') shots = 1000 backend_result1 = qiskit.execute(circs, backend, shots=shots).result() %matplotlib inline # Fit the data to an oscillation plt.figure(figsize=(10, 6)) initial_theta = 0.02 initial_c = 0.5 initial_phi = 0.01 fit = AngleCalCXFitter(backend_result1, xdata, qubits, fit_p0=[initial_theta, initial_c], fit_bounds=([-np.pi, -1], [np.pi, 1])) fit.plot(0, ax=plt.gca()) print("Rotation Error on CX: %f rads"%(fit.angle_err()[0])) plt.show()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# Import general libraries (needed for functions) import numpy as np import time # Import Qiskit classes import qiskit from qiskit import QuantumRegister, QuantumCircuit, ClassicalRegister, Aer from qiskit.providers.aer import noise from qiskit.tools.visualization import plot_histogram # Import measurement calibration functions from qiskit.ignis.mitigation.measurement import (complete_meas_cal, CompleteMeasFitter, MeasurementFilter) # Generate the calibration circuits qr = qiskit.QuantumRegister(5) meas_calibs, state_labels = complete_meas_cal(qubit_list=[2,3,4], qr=qr, circlabel='mcal') state_labels # Execute the calibration circuits without noise backend = qiskit.Aer.get_backend('qasm_simulator') job = qiskit.execute(meas_calibs, backend=backend, shots=1000) cal_results = job.result() # The calibration matrix without noise is the identity matrix meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') print(meas_fitter.cal_matrix) # Generate a noise model for the 5 qubits noise_model = noise.NoiseModel() for qi in range(5): read_err = noise.errors.readout_error.ReadoutError([[0.9, 0.1],[0.25,0.75]]) noise_model.add_readout_error(read_err, [qi]) # Execute the calibration circuits backend = qiskit.Aer.get_backend('qasm_simulator') job = qiskit.execute(meas_calibs, backend=backend, shots=1000, noise_model=noise_model) cal_results = job.result() # Calculate the calibration matrix with the noise model meas_fitter = CompleteMeasFitter(cal_results, state_labels, circlabel='mcal') print(meas_fitter.cal_matrix) # Plot the calibration matrix meas_fitter.plot_calibration() # What is the measurement fidelity? print("Average Measurement Fidelity: %f" % meas_fitter.readout_fidelity()) # What is the measurement fidelity of Q0? print("Average Measurement Fidelity of Q0: %f" % meas_fitter.readout_fidelity( label_list = [['000','001','010','011'],['100','101','110','111']])) # Make a 3Q GHZ state cr = ClassicalRegister(3) ghz = QuantumCircuit(qr, cr) ghz.h(qr[2]) ghz.cx(qr[2], qr[3]) ghz.cx(qr[3], qr[4]) ghz.measure(qr[2],cr[0]) ghz.measure(qr[3],cr[1]) ghz.measure(qr[4],cr[2]) job = qiskit.execute([ghz], backend=backend, shots=5000, noise_model=noise_model) results = job.result() # Results without mitigation raw_counts = results.get_counts() # Get the filter object meas_filter = meas_fitter.filter # Results with mitigation mitigated_results = meas_filter.apply(results) mitigated_counts = mitigated_results.get_counts(0) from qiskit.tools.visualization import * plot_histogram([raw_counts, mitigated_counts], legend=['raw', 'mitigated'])
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# Needed for functions import numpy as np import time # Import QISKit classes import qiskit from qiskit import QuantumRegister, QuantumCircuit, Aer from qiskit.quantum_info import state_fidelity from qiskit.tools.qi.qi import outer # Tomography functions from qiskit.ignis.verification.tomography import process_tomography_circuits, ProcessTomographyFitter # Process tomography of a Hadamard gate q = QuantumRegister(1) circ = QuantumCircuit(q) circ.h(q[0]) # Run circuit on unitary simulator to find ideal unitary job = qiskit.execute(circ, Aer.get_backend('unitary_simulator')) ideal_unitary = job.result().get_unitary(circ) # convert to Choi-matrix in column-major convention choi_ideal = outer(ideal_unitary.ravel(order='F')) # Generate process tomography circuits and run on qasm simulator qpt_circs = process_tomography_circuits(circ, q) job = qiskit.execute(qpt_circs, Aer.get_backend('qasm_simulator'), shots=4000) # Extract tomography data so that counts are indexed by measurement configuration qpt_tomo = ProcessTomographyFitter(job.result(), qpt_circs) qpt_tomo.data # MLE Least-Squares tomographic reconstruction t = time.time() choi_lstsq = qpt_tomo.fit(method='lstsq') print('Least-Sq Fitter') print('fit time:', time.time() - t) print('fit fidelity:', state_fidelity(choi_ideal / 2, choi_lstsq / 2)) # CVXOPT Semidefinite-Program tomographic reconstruction t = time.time() choi_cvx = qpt_tomo.fit(method='cvx') print('\nCVXOPT Fitter') print('fit time:', time.time() - t) print('fit fidelity:', state_fidelity(choi_ideal / 2, choi_cvx / 2)) # Process tomography of a Hadamard gate q = QuantumRegister(2) circ = QuantumCircuit(q) circ.swap(q[0], q[1]) # Ideal channel is a unitary ideal_unitary = np.eye(2) choi_ideal = outer(ideal_unitary.ravel(order='F')) # Generate process tomography circuits and run on qasm simulator # We use the optional prepared_qubits kwarg to specify that the prepared qubit was different to measured qubit qpt_circs = process_tomography_circuits(circ, q[1], prepared_qubits=q[0]) job = qiskit.execute(qpt_circs, Aer.get_backend('qasm_simulator'), shots=2000) # Extract tomography data so that counts are indexed by measurement configuration qpt_tomo = ProcessTomographyFitter(job.result(), qpt_circs) qpt_tomo.data # Least-Squares tomographic reconstruction t = time.time() choi_lstsq = qpt_tomo.fit(method='lstsq') print('Least-Sq Fitter') print('fit time:', time.time() - t) print('fit fidelity:', state_fidelity(choi_ideal / 2, choi_lstsq / 2)) # CVXOPT Semidefinite-Program tomographic reconstruction t = time.time() choi_cvx = qpt_tomo.fit(method='cvx') print('\nCVXOPT Fitter') print('fit time:', time.time() - t) print('fit fidelity:', state_fidelity(choi_ideal / 2, choi_cvx / 2)) # Bell-state entangling circuit q = QuantumRegister(2) circ = QuantumCircuit(q) circ.h(q[0]) circ.cx(q[0], q[1]) # Run circuit on unitary simulator to find ideal unitary job = qiskit.execute(circ, Aer.get_backend('unitary_simulator')) ideal_unitary = job.result().get_unitary(circ) # convert to Choi-matrix in column-major convention choi_ideal = outer(ideal_unitary.ravel(order='F')) # Generate process tomography circuits and run on qasm simulator qpt_circs = process_tomography_circuits(circ, q) job = qiskit.execute(qpt_circs, Aer.get_backend('qasm_simulator'), shots=2000) # Extract tomography data so that counts are indexed by measurement configuration qpt_tomo = ProcessTomographyFitter(job.result(), qpt_circs) t = time.time() choi_lstsq = qpt_tomo.fit(method='lstsq') print('Least-Sq Fitter') print('fit time:', time.time() - t) print('fit fidelity:', state_fidelity(choi_ideal / 4, choi_lstsq / 4)) t = time.time() choi_cvx = qpt_tomo.fit(method='cvx') print('\nCVXOPT Fitter') print('fit time:', time.time() - t) print('fit fidelity:', state_fidelity(choi_ideal / 4, choi_cvx / 4)) # Process tomography of a Hadamard gate q = QuantumRegister(1) circ = QuantumCircuit(q) circ.h(q[0]) # Run circuit on unitary simulator to find ideal unitary job = qiskit.execute(circ, Aer.get_backend('unitary_simulator')) ideal_unitary = job.result().get_unitary(circ) # convert to Choi-matrix in column-major convention choi_ideal = outer(ideal_unitary.ravel(order='F')) # Generate process tomography circuits and run on qasm simulator qpt_circs = process_tomography_circuits(circ, q, prep_labels='SIC', prep_basis='SIC') job = qiskit.execute(qpt_circs, Aer.get_backend('qasm_simulator'), shots=2000) # Extract tomography data so that counts are indexed by measurement configuration qpt_tomo = ProcessTomographyFitter(job.result(), qpt_circs, prep_basis='SIC') qpt_tomo.data # MLE Least-Squares tomographic reconstruction t = time.time() choi_lstsq = qpt_tomo.fit(method='lstsq') print('Least-Sq Fitter') print('fit time:', time.time() - t) print('fit fidelity:', state_fidelity(choi_ideal / 2, choi_lstsq / 2)) # CVXOPT Semidefinite-Program tomographic reconstruction t = time.time() choi_cvx = qpt_tomo.fit(method='cvx') print('\nCVXOPT Fitter') print('fit time:', time.time() - t) print('fit fidelity:', state_fidelity(choi_ideal / 2, choi_cvx / 2))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
#Import general libraries (needed for functions) import numpy as np import matplotlib.pyplot as plt from IPython import display #Import Qiskit classes classes import qiskit from qiskit.providers.aer.noise import NoiseModel from qiskit.providers.aer.noise.errors.standard_errors import depolarizing_error, thermal_relaxation_error #Import the RB Functions import qiskit.ignis.verification.randomized_benchmarking as rb #Number of qubits nQ = 3 #There are 3 qubits: Q0,Q1,Q2. #Number of seeds (random sequences) nseeds = 5 #Number of Cliffords in the sequence (start, stop, steps) nCliffs = np.arange(1,200,20) #2Q RB on Q0,Q2 and 1Q RB on Q1 rb_pattern = [[0,2],[1]] #Do three times as many 1Q Cliffords length_multiplier = [1,3] rb_opts = {} rb_opts['length_vector'] = nCliffs rb_opts['nseeds'] = nseeds rb_opts['rb_pattern'] = rb_pattern rb_opts['length_multiplier'] = length_multiplier rb_circs, xdata = rb.randomized_benchmarking_seq(**rb_opts) print(rb_circs[0][0]) #Create a new circuit without the measurement qc = qiskit.QuantumCircuit(*rb_circs[0][-1].qregs,*rb_circs[0][-1].cregs) for i in rb_circs[0][-1][0:-nQ]: qc._attach(i) #The Unitary is an identity (with a global phase) backend = qiskit.Aer.get_backend('unitary_simulator') basis_gates = ['u1','u2','u3','cx'] # use U,CX for now basis_gates_str = ','.join(basis_gates) job = qiskit.execute(qc, backend=backend, basis_gates=basis_gates_str) print(np.around(job.result().get_unitary(),3)) noise_model = NoiseModel() p1Q = 0.002 p2Q = 0.01 noise_model.add_all_qubit_quantum_error(depolarizing_error(p1Q, 1), 'u2') noise_model.add_all_qubit_quantum_error(depolarizing_error(2*p1Q, 1), 'u3') noise_model.add_all_qubit_quantum_error(depolarizing_error(p2Q, 2), 'cx') #noise_model = None backend = qiskit.Aer.get_backend('qasm_simulator') basis_gates = ['u1','u2','u3','cx'] # use U,CX for now basis_gates_str = ','.join(basis_gates) shots = 200 result_list = [] qobj_list = [] import time for rb_seed,rb_circ_seed in enumerate(rb_circs): print('Compiling seed %d'%rb_seed) qobj = qiskit.compile(rb_circ_seed, backend=backend, basis_gates=basis_gates_str, shots=shots) print('Simulating seed %d'%rb_seed) job = backend.run(qobj, noise_model=noise_model, backend_options={'max_parallel_experiments': 0}) result_list.append(job.result()) qobj_list.append(qobj) print("Finished Simulating") #Create an RBFitter object with 1 seed of data rbfit = rb.fitters.RBFitter(result_list[0], xdata, rb_opts['rb_pattern']) plt.figure(figsize=(15, 6)) for i in range(2): ax = plt.subplot(1, 2, i+1) pattern_ind = i # Plot the essence by calling plot_rb_data rbfit.plot_rb_data(pattern_ind, ax=ax, add_label=True, show_plt=False) # Add title and label ax.set_title('%d Qubit RB'%(len(rb_opts['rb_pattern'][i])), fontsize=18) plt.show() rbfit = rb.fitters.RBFitter(result_list[0], xdata, rb_opts['rb_pattern']) for seed_num, data in enumerate(result_list):#range(1,len(result_list)): plt.figure(figsize=(15, 6)) axis = [plt.subplot(1, 2, 1), plt.subplot(1, 2, 2)] # Add another seed to the data rbfit.add_data([data]) for i in range(2): pattern_ind = i # Plot the essence by calling plot_rb_data rbfit.plot_rb_data(pattern_ind, ax=axis[i], add_label=True, show_plt=False) # Add title and label axis[i].set_title('%d Qubit RB - after seed %d'%(len(rb_opts['rb_pattern'][i]), seed_num), fontsize=18) # Display display.display(plt.gcf()) # Clear display after each seed and close display.clear_output(wait=True) time.sleep(1.0) plt.close() shots = 200 result_list = [] qobj_list = [] for rb_seed,rb_circ_seed in enumerate(rb_circs): print('Compiling seed %d'%rb_seed) qobj = qiskit.compile(rb_circ_seed, backend=backend, basis_gates=basis_gates_str, shots=shots) print('Simulating seed %d'%rb_seed) job = backend.run(qobj, noise_model=noise_model, backend_options={'max_parallel_experiments': 0}) result_list.append(job.result()) qobj_list.append(qobj) print("Finished Simulating") #Add this data to the previous fit rbfit.add_data(result_list) #Replot plt.figure(figsize=(15, 6)) for i in range(2): ax = plt.subplot(1, 2, i+1) pattern_ind = i # Plot the essence by calling plot_rb_data rbfit.plot_rb_data(pattern_ind, ax=ax, add_label=True, show_plt=False) # Add title and label ax.set_title('%d Qubit RB'%(len(rb_opts['rb_pattern'][i])), fontsize=18) plt.show() #Count the number of single and 2Q gates in the 2Q Cliffords gates_per_cliff = rb.rb_utils.gates_per_clifford(qobj_list,xdata[0],basis_gates,rb_opts['rb_pattern'][0]) for i in range(len(basis_gates)): print("Number of %s gates per Clifford: %f"%(basis_gates[i], np.mean([gates_per_cliff[0][i],gates_per_cliff[0][i]]))) #Prepare lists of the number of qubits and the errors ngates = np.zeros(7) ngates[0:3] = gates_per_cliff[0][0:3] ngates[3:6] = gates_per_cliff[1][0:3] ngates[6] = gates_per_cliff[0][3] gate_qubits = np.array([0,0,0,1,1,1,-1], dtype=int) gate_errs = np.zeros(len(gate_qubits)) gate_errs[[1,4]] = p1Q/2 #convert from depolarizing error to epg (1Q) gate_errs[[2,5]] = 2*p1Q/2 #convert from depolarizing error to epg (1Q) gate_errs[6] = p2Q*3/4 #convert from depolarizing error to epg (2Q) #Calculate the predicted epc pred_epc = rb.rb_utils.twoQ_clifford_error(ngates,gate_qubits,gate_errs) print("Predicted 2Q Error per Clifford: %e"%pred_epc) rb_opts2 = rb_opts.copy() rb_opts2['rb_pattern'] = [[0,1]] rb_opts2['length_multiplier'] = 1 rb_circs2, xdata2 = rb.randomized_benchmarking_seq(**rb_opts2) noise_model2 = NoiseModel() #Add T1/T2 noise to the simulation t1 = 100. t2 = 80. gate1Q = 0.1 gate2Q = 0.5 noise_model2.add_all_qubit_quantum_error(thermal_relaxation_error(t1,t2,gate1Q), 'u2') noise_model2.add_all_qubit_quantum_error(thermal_relaxation_error(t1,t2,2*gate1Q), 'u3') noise_model2.add_all_qubit_quantum_error( thermal_relaxation_error(t1,t2,gate2Q).kron(thermal_relaxation_error(t1,t2,gate2Q)), 'cx') backend = qiskit.Aer.get_backend('qasm_simulator') basis_gates = ['u1','u2','u3','cx'] # use U,CX for now basis_gates_str = ','.join(basis_gates) shots = 500 result_list2 = [] qobj_list2 = [] for rb_seed,rb_circ_seed in enumerate(rb_circs2): print('Compiling seed %d'%rb_seed) qobj = qiskit.compile(rb_circ_seed, backend=backend, basis_gates=basis_gates_str, shots=shots) print('Simulating seed %d'%rb_seed) job = backend.run(qobj, noise_model=noise_model2, backend_options={'max_parallel_experiments': 0}) result_list2.append(job.result()) qobj_list2.append(qobj) print("Finished Simulating") #Create an RBFitter object rbfit = rb.RBFitter(result_list2, xdata2, rb_opts2['rb_pattern']) plt.figure(figsize=(10, 6)) ax = plt.gca() # Plot the essence by calling plot_rb_data rbfit.plot_rb_data(0, ax=ax, add_label=True, show_plt=False) # Add title and label ax.set_title('2 Qubit RB with T1/T2 noise', fontsize=18) plt.show() #Count the number of single and 2Q gates in the 2Q Cliffords gates_per_cliff = rb.rb_utils.gates_per_clifford(qobj_list2,xdata2[0],basis_gates,rb_opts2['rb_pattern'][0]) for i in range(len(basis_gates)): print("Number of %s gates per Clifford: %f"%(basis_gates[i], np.mean([gates_per_cliff[0][i],gates_per_cliff[0][i]]))) #Prepare lists of the number of qubits and the errors ngates = np.zeros(7) ngates[0:3] = gates_per_cliff[0][0:3] ngates[3:6] = gates_per_cliff[1][0:3] ngates[6] = gates_per_cliff[0][3] gate_qubits = np.array([0,0,0,1,1,1,-1], dtype=int) gate_errs = np.zeros(len(gate_qubits)) #Here are the predicted primitive gate errors from the coherence limit gate_errs[[1,4]] = rb.rb_utils.coherence_limit(1,[t1],[t2],gate1Q) gate_errs[[2,5]] = rb.rb_utils.coherence_limit(1,[t1],[t2],2*gate1Q) gate_errs[6] = rb.rb_utils.coherence_limit(2,[t1,t1],[t2,t2],gate2Q) #Calculate the predicted epc pred_epc = rb.rb_utils.twoQ_clifford_error(ngates,gate_qubits,gate_errs) print("Predicted 2Q Error per Clifford: %e"%pred_epc)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
import sys, getpass try: sys.path.append("../../") # go to parent dir import Qconfig qx_config = { "APItoken": Qconfig.APItoken, "url": Qconfig.config['url']} print('Qconfig loaded from %s.' % Qconfig.__file__) except: APItoken = getpass.getpass('Please input your token and hit enter: ') qx_config = { "APItoken": APItoken, "url":"https://quantumexperience.ng.bluemix.net/api"} print('Qconfig.py not found in qiskit-tutorial directory; Qconfig loaded using user input.') import qiskit as qk import numpy as np from scipy.optimize import curve_fit from qiskit.tools.qcvv.fitters import exp_fit_fun, osc_fit_fun, plot_coherence # function for padding with QId gates def pad_QId(circuit,N,qr): # circuit to add to, N = number of QId gates to add, qr = qubit reg for ii in range(N): circuit.barrier(qr) circuit.iden(qr) return circuit qk.register(qx_config['APItoken'], qx_config['url']) # backend and token settings backend = qk.get_backend('ibmqx4') # the device to run on shots = 1024 # the number of shots in the experiment # Select qubit whose T1 is to be measured qubit=1 # Creating registers qr = qk.QuantumRegister(5) cr = qk.ClassicalRegister(5) # the delay times are all set in terms of single-qubit gates # so we need to calculate the time from these parameters params = backend.parameters['qubits'][qubit] pulse_length=params['gateTime']['value'] # single-qubit gate time buffer_length=params['buffer']['value'] # spacing between pulses unit = params['gateTime']['unit'] steps=10 gates_per_step=120 max_gates=(steps-1)*gates_per_step+1 tot_length=buffer_length+pulse_length time_per_step=gates_per_step*tot_length qc_dict={} for ii in range(steps): step_num='step_%s'%(str(ii)) qc_dict.update({step_num:qk.QuantumCircuit(qr, cr)}) qc_dict[step_num].x(qr[qubit]) qc_dict[step_num]=pad_QId(qc_dict[step_num],gates_per_step*ii,qr[qubit]) qc_dict[step_num].barrier(qr[qubit]) qc_dict[step_num].measure(qr[qubit], cr[qubit]) circuits=list(qc_dict.values()) # run the program status = backend.status if status['operational'] == False or status['pending_jobs'] > 10: print('Warning: the selected backend appears to be busy or unavailable at present; consider choosing a different one if possible') t1_job=qk.execute(circuits, backend, shots=shots) # arrange the data from the run result_t1 = t1_job.result() keys_0_1=list(result_t1.get_counts(qc_dict['step_0']).keys())# get the key of the excited state '00001' data=np.zeros(len(qc_dict.keys())) # numpy array for data sigma_data = np.zeros(len(qc_dict.keys())) # change unit from ns to microseconds plot_factor=1 if unit.find('ns')>-1: plot_factor=1000 punit='$\mu$s' xvals=time_per_step*np.linspace(0,len(qc_dict.keys()),len(qc_dict.keys()))/plot_factor # calculate the time steps in microseconds for ii,key in enumerate(qc_dict.keys()): # get the data in terms of counts for the excited state normalized to the total number of counts data[ii]=float(result_t1.get_counts(qc_dict[key])[keys_0_1[1]])/shots sigma_data[ii] = np.sqrt(data[ii]*(1-data[ii]))/np.sqrt(shots) # fit the data to an exponential fitT1, fcov = curve_fit(exp_fit_fun, xvals, data, bounds=([-1,2,0], [1., 500, 1])) ferr = np.sqrt(np.diag(fcov)) plot_coherence(xvals, data, sigma_data, fitT1, exp_fit_fun, punit, 'T$_1$ ', qubit) print("a: " + str(round(fitT1[0],2)) + u" \u00B1 " + str(round(ferr[0],2))) print("T1: " + str(round(fitT1[1],2))+ " µs" + u" \u00B1 " + str(round(ferr[1],2)) + ' µs') print("c: " + str(round(fitT1[2],2)) + u" \u00B1 " + str(round(ferr[2],2))) str(params['T1']['value']) +' ' + params['T1']['unit'] # Select qubit on which to measure T2* qubit=1 # Creating registers qr = qk.QuantumRegister(5) cr = qk.ClassicalRegister(5) params = backend.parameters['qubits'][qubit] pulse_length=params['gateTime']['value'] # single-qubit gate time buffer_length=params['buffer']['value'] # spacing between pulses unit = params['gateTime']['unit'] steps=35 gates_per_step=20 max_gates=(steps-1)*gates_per_step+2 num_osc=5 tot_length=buffer_length+pulse_length time_per_step=gates_per_step*tot_length qc_dict={} for ii in range(steps): step_num='step_%s'%(str(ii)) qc_dict.update({step_num:qk.QuantumCircuit(qr, cr)}) qc_dict[step_num].h(qr[qubit]) qc_dict[step_num]=pad_QId(qc_dict[step_num],gates_per_step*ii,qr[qubit]) qc_dict[step_num].u1(2*np.pi*num_osc*ii/(steps-1),qr[qubit]) qc_dict[step_num].h(qr[qubit]) qc_dict[step_num].barrier(qr[qubit]) qc_dict[step_num].measure(qr[qubit], cr[qubit]) circuits=list(qc_dict.values()) # run the program status = backend.status if status['operational'] == False or status['pending_jobs'] > 10: print('Warning: the selected backend appears to be busy or unavailable at present; consider choosing a different one if possible') t2star_job=qk.execute(circuits, backend, shots=shots) # arrange the data from the run result_t2star = t2star_job.result() keys_0_1=list(result_t2star.get_counts(qc_dict['step_0']).keys())# get the key of the excited state '00001' # change unit from ns to microseconds plot_factor=1 if unit.find('ns')>-1: plot_factor=1000 punit='$\mu$s' xvals=time_per_step*np.linspace(0,len(qc_dict.keys()),len(qc_dict.keys()))/plot_factor # calculate the time steps data=np.zeros(len(qc_dict.keys())) # numpy array for data sigma_data = np.zeros(len(qc_dict.keys())) for ii,key in enumerate(qc_dict.keys()): # get the data in terms of counts for the excited state normalized to the total number of counts data[ii]=float(result_t2star.get_counts(qc_dict[key])[keys_0_1[1]])/shots sigma_data[ii] = np.sqrt(data[ii]*(1-data[ii]))/np.sqrt(shots) fitT2s, fcov = curve_fit(osc_fit_fun, xvals, data, p0=[0.5, 100, 1/10, np.pi, 0], bounds=([0.3,0,0,0,0], [0.5, 200, 1/2,2*np.pi,1])) ferr = np.sqrt(np.diag(fcov)) plot_coherence(xvals, data, sigma_data, fitT2s, osc_fit_fun, punit, '$T_2^*$ ', qubit) print("a: " + str(round(fitT2s[0],2)) + u" \u00B1 " + str(round(ferr[0],2))) print("T2*: " + str(round(fitT2s[1],2))+ " µs"+ u" \u00B1 " + str(round(ferr[1],2)) + ' µs') print("f: " + str(round(10**3*fitT2s[2],3)) + 'kHz' + u" \u00B1 " + str(round(10**6*ferr[2],3)) + 'kHz') print("phi: " + str(round(fitT2s[3],2)) + u" \u00B1 " + str(round(ferr[3],2))) print("c: " + str(round(fitT2s[4],2)) + u" \u00B1 " + str(round(ferr[4],2))) # Select qubit to measure T2 echo on qubit=1 # Creating registers qr = qk.QuantumRegister(5) cr = qk.ClassicalRegister(5) params = backend.parameters['qubits'][qubit] pulse_length=params['gateTime']['value'] # single-qubit gate time buffer_length=params['buffer']['value'] # spacing between pulses unit = params['gateTime']['unit'] steps=18 gates_per_step=28 tot_length=buffer_length+pulse_length max_gates=(steps-1)*2*gates_per_step+3 time_per_step=(2*gates_per_step)*tot_length qc_dict={} for ii in range(steps): step_num='step_%s'%(str(ii)) qc_dict.update({step_num:qk.QuantumCircuit(qr, cr)}) qc_dict[step_num].h(qr[qubit]) qc_dict[step_num]=pad_QId(qc_dict[step_num],gates_per_step*ii,qr[qubit]) qc_dict[step_num].x(qr[qubit]) qc_dict[step_num]=pad_QId(qc_dict[step_num],gates_per_step*ii,qr[qubit]) qc_dict[step_num].h(qr[qubit]) qc_dict[step_num].barrier(qr[qubit]) qc_dict[step_num].measure(qr[qubit], cr[qubit]) circuits=list(qc_dict.values()) # run the program status = backend.status if status['operational'] == False or status['pending_jobs'] > 10: print('Warning: the selected backend appears to be busy or unavailable at present; consider choosing a different one if possible') t2echo_job=qk.execute(circuits, backend, shots=shots) # arrange the data from the run result_t2echo = t2echo_job.result() keys_0_1=list(result_t2echo.get_counts(qc_dict['step_0']).keys())# get the key of the excited state '00001' # change unit from ns to microseconds plot_factor=1 if unit.find('ns')>-1: plot_factor=1000 punit='$\mu$s' xvals=time_per_step*np.linspace(0,len(qc_dict.keys()),len(qc_dict.keys()))/plot_factor # calculate the time steps data=np.zeros(len(qc_dict.keys())) # numpy array for data sigma_data = np.zeros(len(qc_dict.keys())) for ii,key in enumerate(qc_dict.keys()): # get the data in terms of counts for the excited state normalized to the total number of counts data[ii]=float(result_t2echo.get_counts(qc_dict[key])[keys_0_1[1]])/shots sigma_data[ii] = np.sqrt(data[ii]*(1-data[ii]))/np.sqrt(shots) fitT2e, fcov = curve_fit(exp_fit_fun, xvals, data, bounds=([-1,10,0], [1, 150, 1])) ferr = np.sqrt(np.diag(fcov)) plot_coherence(xvals, data, sigma_data, fitT2e, exp_fit_fun, punit, '$T_{2echo}$ ', qubit) print("a: " + str(round(fitT2e[0],2)) + u" \u00B1 " + str(round(ferr[0],2))) print("T2: " + str(round(fitT2e[1],2))+ ' µs' + u" \u00B1 " + str(round(ferr[1],2)) + ' µs') print("c: " + str(round(fitT2e[2],2)) + u" \u00B1 " + str(round(ferr[2],2))) str(params['T2']['value']) +' ' + params['T2']['unit'] # Select qubit for CPMG measurement of T2 qubit=1 # Creating registers qr = qk.QuantumRegister(5) cr = qk.ClassicalRegister(5) params = backend.parameters['qubits'][qubit] pulse_length=params['gateTime']['value'] # single-qubit gate time buffer_length=params['buffer']['value'] # spacing between pulses unit = params['gateTime']['unit'] steps=10 gates_per_step=18 num_echo=5 # has to be odd number to end up in excited state at the end tot_length=buffer_length+pulse_length time_per_step=((num_echo+1)*gates_per_step+num_echo)*tot_length max_gates=num_echo*(steps-1)*gates_per_step+num_echo+2 qc_dict={} for ii in range(steps): step_num='step_%s'%(str(ii)) qc_dict.update({step_num:qk.QuantumCircuit(qr, cr)}) qc_dict[step_num].h(qr[qubit]) for iii in range(num_echo): qc_dict[step_num]=pad_QId(qc_dict[step_num], gates_per_step*ii, qr[qubit]) qc_dict[step_num].x(qr[qubit]) qc_dict[step_num]=pad_QId(qc_dict[step_num], gates_per_step*ii, qr[qubit]) qc_dict[step_num].h(qr[qubit]) qc_dict[step_num].barrier(qr[qubit]) qc_dict[step_num].measure(qr[qubit], cr[qubit]) circuits=list(qc_dict.values()) # run the program status = backend.status if status['operational'] == False or status['pending_jobs'] > 10: print('Warning: the selected backend appears to be busy or unavailable at present; consider choosing a different one if possible') t2cpmg_job=qk.execute(circuits, backend, shots=shots) # arrange the data from the run result_t2cpmg = t2cpmg_job.result() keys_0_1=list(result_t2cpmg.get_counts(qc_dict['step_0']).keys())# get the key of the excited state '00001' # change unit from ns to microseconds plot_factor=1 if unit.find('ns')>-1: plot_factor=1000 punit='$\mu$s' xvals=time_per_step*np.linspace(0,len(qc_dict.keys()),len(qc_dict.keys()))/plot_factor # calculate the time steps data=np.zeros(len(qc_dict.keys())) # numpy array for data sigma_data = np.zeros(len(qc_dict.keys())) for ii,key in enumerate(qc_dict.keys()): # get the data in terms of counts for the excited state normalized to the total number of counts data[ii]=float(result_t2cpmg.get_counts(qc_dict[key])[keys_0_1[1]])/shots sigma_data[ii] = np.sqrt(data[ii]*(1-data[ii]))/np.sqrt(shots) fitT2cpmg, fcov = curve_fit(exp_fit_fun, xvals, data, bounds=([-1,10,0], [1, 150, 1])) ferr = np.sqrt(np.diag(fcov)) plot_coherence(xvals, data, sigma_data, fitT2cpmg, exp_fit_fun, punit, '$T_{2cpmg}$ ', qubit) print("a: " + str(round(fitT2cpmg[0],2)) + u" \u00B1 " + str(round(ferr[0],2))) print("T2: " + str(round(fitT2cpmg[1],2))+ ' µs' + u" \u00B1 " + str(round(ferr[1],2)) + ' µs') print("c: " + str(round(fitT2cpmg[2],2)) + u" \u00B1 " + str(round(ferr[2],2)))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# Needed for functions import numpy as np import time # Import Qiskit classes import qiskit from qiskit import QuantumRegister, QuantumCircuit, ClassicalRegister, Aer from qiskit.quantum_info import state_fidelity from qiskit.providers.aer import noise # Tomography functions from qiskit.ignis.verification.tomography import state_tomography_circuits, StateTomographyFitter import qiskit.ignis.mitigation.measurement as mc # Create the expected density matrix q2 = QuantumRegister(2) bell = QuantumCircuit(q2) bell.h(q2[0]) bell.cx(q2[0], q2[1]) print(bell) job = qiskit.execute(bell, Aer.get_backend('statevector_simulator')) psi_bell = job.result().get_statevector(bell) print(psi_bell) # Create the actual circuit q2 = QuantumRegister(6) bell = QuantumCircuit(q2) bell.h(q2[3]) bell.cx(q2[3], q2[5]) print(bell) # Generate circuits and run on simulator t = time.time() # Generate the state tomography circuits. Only pass in the # registers we want to measure (in this case 3 and 5) qst_bell = state_tomography_circuits(bell, [q2[3],q2[5]]) job = qiskit.execute(qst_bell, Aer.get_backend('qasm_simulator'), shots=5000) print('Time taken:', time.time() - t) # Generate the state tomography circuits using the default settings for # basis tomo_bell = StateTomographyFitter(job.result(), qst_bell) # Perform the tomography fit # which outputs a density matrix rho_bell = tomo_bell.fit() F_bell = state_fidelity(psi_bell, rho_bell) print('Fit Fidelity =', F_bell) #Add measurement noise noise_model = noise.NoiseModel() for qi in range(6): read_err = noise.errors.readout_error.ReadoutError([[0.75, 0.25],[0.1,0.9]]) noise_model.add_readout_error(read_err,[qi]) #generate the calibration circuits meas_calibs, state_labels = mc.complete_meas_cal(qubit_list=[3,5]) backend = Aer.get_backend('qasm_simulator') qobj_cal = qiskit.compile(meas_calibs, backend=backend, shots=15000) qobj_tomo = qiskit.compile(qst_bell, backend=backend, shots=15000) job_cal = backend.run(qobj_cal, noise_model=noise_model) job_tomo = backend.run(qobj_tomo, noise_model=noise_model) meas_fitter = mc.CompleteMeasFitter(job_cal.result(),state_labels) tomo_bell = StateTomographyFitter(job_tomo.result(), qst_bell) #no correction rho_bell = tomo_bell.fit() F_bell = state_fidelity(psi_bell, rho_bell) print('Fit Fidelity (no correction) =', F_bell) #correct data correct_tomo_results = meas_fitter.filter.apply(job_tomo.result(), method='least_squares') tomo_bell = StateTomographyFitter(correct_tomo_results, qst_bell) rho_bell = tomo_bell.fit() F_bell = state_fidelity(psi_bell, rho_bell) print('Fit Fidelity (w/ correction) =', F_bell) def random_u3_tomo(nq, shots): def rand_angles(): return tuple(2 * np.pi * np.random.random(3) - np.pi) q = QuantumRegister(nq) circ = QuantumCircuit(q) for j in range(nq): circ.u3(*rand_angles(), q[j]) job = qiskit.execute(circ, Aer.get_backend('statevector_simulator')) psi_rand = job.result().get_statevector(circ) qst_circs = state_tomography_circuits(circ, q) job = qiskit.execute(qst_circs, Aer.get_backend('qasm_simulator'), shots=shots) tomo_data = StateTomographyFitter(job.result(), qst_circs) rho_cvx = tomo_data.fit(method='cvx') rho_lstsq = tomo_data.fit(method='lstsq') print('F fit (CVX) =', state_fidelity(psi_rand, rho_cvx)) print('F fit (LSTSQ) =', state_fidelity(psi_rand, rho_lstsq)) for j in range(5): print('Random single-qubit unitaries: set {}'.format(j)) random_u3_tomo(3, 5000) # Create a state preparation circuit q5 = QuantumRegister(5) bell5 = QuantumCircuit(q5) bell5.h(q5[0]) for j in range(4): bell5.cx(q5[j], q5[j + 1]) # Get ideal output state job = qiskit.execute(bell5, Aer.get_backend('statevector_simulator')) psi_bell5 = job.result().get_statevector(bell5) # Generate circuits and run on simulator t = time.time() qst_bell5 = state_tomography_circuits(bell5, q5) job = qiskit.execute(qst_bell5, Aer.get_backend('qasm_simulator'), shots=5000) # Extract tomography data so that counts are indexed by measurement configuration tomo_bell5 = StateTomographyFitter(job.result(), qst_bell5) print('Time taken:', time.time() - t) t = time.time() rho_lstsq_bell5 = tomo_bell5.fit(method='lstsq') print('Least-Sq Reconstruction') print('Time taken:', time.time() - t) print('Fit Fidelity:', state_fidelity(psi_bell5, rho_lstsq_bell5)) t = time.time() rho_cvx_bell5 = tomo_bell5.fit(method='cvx') print('CVX Reconstruction') print('Time taken:', time.time() - t) print('Fidelity:', state_fidelity(psi_bell5, rho_cvx_bell5))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import * IBMQ.load_accounts(hub=None) from qiskit.tools.jupyter import * from qiskit.tools.monitor import job_monitor q = QuantumRegister(2) c = ClassicalRegister(2) qc = QuantumCircuit(q, c) qc.h(q[0]) qc.cx(q[0], q[1]) qc.measure(q, c); from qiskit.providers.ibmq import least_busy backend = least_busy(IBMQ.backends(simulator=False)) backend.name() job = execute(qc, backend) job_monitor(job, monitor_async=True) %%qiskit_job_status job2 = execute(qc, backend) num_jobs = 5 my_jobs = [] for j in range(num_jobs): my_jobs.append(execute(qc, backend)) job_monitor(my_jobs[j], monitor_async=True) %%qiskit_job_status my_jobs2 = [] for j in range(num_jobs): my_jobs2.append(execute(qc, backend)) %%qiskit_job_status import numpy as np my_jobs3 = np.empty(num_jobs, dtype=object) for j in range(num_jobs): my_jobs3[j] = execute(qc, backend) %%qiskit_job_status -i 5 job4 = execute(qc, backend) %%qiskit_job_status --interval 5 job5 = execute(qc, backend) %qiskit_backend_monitor backend %qiskit_backend_overview
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import * IBMQ.load_accounts(hub=None) from qiskit.tools.monitor import job_monitor, backend_monitor, backend_overview q = QuantumRegister(2) c = ClassicalRegister(2) qc = QuantumCircuit(q, c) qc.h(q[0]) qc.cx(q[0], q[1]) qc.measure(q, c); from qiskit.providers.ibmq import least_busy backend = least_busy(IBMQ.backends(filters=lambda x: not x.configuration().simulator)) backend.name() job1 = execute(qc, backend) job_monitor(job1) job2 = execute(qc, backend) job_monitor(job2, interval=5) backend_monitor(backend) backend_overview()
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
def run_hadamard_simulator(number_of_qubits, list_of_qubits, shots): ''' Run our amazing Hadamard simulator! Note: this function is not designed to be efficient Args: number_of_qubits (integer): number of qubits in the qunatum circuit list_of_qubits (list of integers): a list of qubits on whom Hadamard gates are applied shots (integer): number of shots Returns: list of integers: each entry in the list contains the number of shots where the measurement result is the correspnding basis state; basis states are ordered lexicographically ''' # For each qubit, store whether it is manipulated by an odd number of Hadamard gates # Example: for run_hadamard_simulator(5, [3, 1, 3, 4], 100) # we obtain hadamard_list: # [0, 1, 0, 0, 1] # because qubits 1 and 4 have an odd number of Hadamard gates. hadamard_list = [0]*number_of_qubits for qubit in list_of_qubits: hadamard_list[qubit] = (1 + hadamard_list[qubit])%2 # Calculate the result for each basis state result = [0]*(2**number_of_qubits) for i in range(2**number_of_qubits): # Example: when i is 2, # the basis_state is 01000 basis_state = '{0:b}'.format(i).zfill(number_of_qubits)[::-1] for qubit in range(number_of_qubits): if hadamard_list[qubit] == 0 and basis_state[qubit] == '1': result[i] = 0 break if hadamard_list[qubit] == 1: result[i] += int(shots/(2**(1 + hadamard_list.count(1)))) return result run_hadamard_simulator(4, [3, 1, 3, 2], 1024) from qiskit.providers import BaseJob class HadamardJob(BaseJob): def __init__(self, backend): super().__init__(backend, 1) def result(self): return self._result def cancel(self): pass def status(self): pass def submit(self): pass from qiskit.providers import BaseBackend from qiskit.providers.models import BackendConfiguration from qiskit import qobj as qiskit_qobj from qiskit.result import Result class HadamardSimulator(BaseBackend): ''' A wrapper backend for the Hadamard simulator ''' def __init__(self, provider=None): configuration = { 'backend_name': 'hadamard_simulator', 'backend_version': '0.1.0', 'url': 'http://www.i_love_hadamard.com', 'simulator': True, 'local': True, 'description': 'Simulates only Hadamard gates', 'basis_gates': ['h', 'x'], # basis_gates must contain at least two gates 'memory': True, 'n_qubits': 30, 'conditional': False, 'max_shots': 100000, 'open_pulse': False, 'gates': [ { 'name': 'TODO', 'parameters': [], 'qasm_def': 'TODO' } ] } # We will explain about the provider in the next section super().__init__(configuration=BackendConfiguration.from_dict(configuration), provider=provider) def run(self, qobj): """Run qobj Args: qobj (QObj): circuit description Returns: HadamardJob: derived from BaseJob """ hadamard_job = HadamardJob(None) experiment_results = [] for circuit_index, circuit in enumerate(qobj.experiments): number_of_qubits = circuit.config.n_qubits shots = qobj.config.shots list_of_qubits = [] for operation in circuit.instructions: if getattr(operation, 'conditional', None): raise QiskitError('conditional operations are not supported ' 'by the Hadamard simulator') if operation.name != 'h': if operation.name == 'measure': continue else: raise QiskitError('The Hadamrd simulator allows only Hadamard gates') list_of_qubits.append(operation.qubits[0]) # Need to verify that # all the qubits are measured, and to different classical registers. # Raise an error otherwise. # We skip this part here. counts = run_hadamard_simulator(number_of_qubits, list_of_qubits, shots) formatted_counts = {} for i in range(2**number_of_qubits): if counts[i] != 0: formatted_counts[hex(i)] = counts[i] experiment_results.append({ 'name': circuit.header.name, 'success': True, 'shots': shots, 'data': {'counts': formatted_counts}, 'header': circuit.header.as_dict() }) hadamard_job._result = Result.from_dict({ 'results': experiment_results, 'backend_name': 'hadamard_simulator', 'backend_version': '0.1.0', 'qobj_id': '0', 'job_id': '0', 'success': True }) return hadamard_job from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister, execute from qiskit.transpiler import PassManager qreg = QuantumRegister(4) creg = ClassicalRegister(4) qc = QuantumCircuit(qreg, creg) qc.h(qreg[3]) qc.h(qreg[1]) qc.h(qreg[3]) qc.h(qreg[2]) qc.measure(qreg, creg) hadamard_job = execute(qc, backend=HadamardSimulator(), pass_manager=PassManager(), shots=1024) result = hadamard_job.result() print(result.get_counts(qc)) from qiskit.providers import BaseProvider from qiskit.providers.providerutils import filter_backends class HadamardProvider(BaseProvider): """Provider for the Hadamard backend""" def __init__(self, *args, **kwargs): super().__init__(args, kwargs) # Populate the list of Hadamard backends self._backends = [HadamardSimulator(provider=self)] def backends(self, name=None, filters=None, **kwargs): # pylint: disable=arguments-differ backends = self._backends if name: backends = [backend for backend in backends if backend.name() == name] return filter_backends(backends, filters=filters, **kwargs) from qiskit import execute, Aer from qiskit.transpiler import PassManager hadamard_provider = HadamardProvider() new_hadamard_job = execute(qc, hadamard_provider.get_backend('hadamard_simulator'), pass_manager=PassManager(), shots=1024) new_hadamard_result = new_hadamard_job.result() aer_job = execute(qc, Aer.get_backend('qasm_simulator'), pass_manager=PassManager(), shots=1024) aer_result = aer_job.result() print('Hadamard simulator:') print(new_hadamard_result.get_counts(qc)) print('Aer simulator:') print(aer_result.get_counts(qc))
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
%matplotlib inline import numpy as np import matplotlib.pyplot as plt # Importing standard Qiskit libraries and configuring account from qiskit import QuantumCircuit, execute, IBMQ from qiskit.compiler import transpile from qiskit.providers.aer import QasmSimulator, StatevectorSimulator from qiskit.visualization import * from qiskit.quantum_info import * qc1 = QuantumCircuit(1) qc1.x(0) qc1.measure_all() qc1.draw(output='mpl') job1 = execute(qc1, backend=QasmSimulator(), shots=1024) plot_histogram(job1.result().get_counts()) qc2 = QuantumCircuit(2) # State Preparation qc2.x(0) qc2.barrier() # Perform q_0 XOR 0 qc2.cx(0,1) qc2.measure_all() qc2.draw(output='mpl') job2 = execute(qc2.reverse_bits(), backend=QasmSimulator(), shots=1024) plot_histogram(job2.result().get_counts()) qc3 = QuantumCircuit(3) # State Preparation qc3.x(0) qc3.x(1) qc3.barrier() # Perform q_0 XOR 0 qc3.ccx(0,1,2) qc3.measure_all() qc3.draw(output='mpl') job3 = execute(qc3.reverse_bits(), backend=QasmSimulator(), shots=1024) plot_histogram(job3.result().get_counts()) qc4 = QuantumCircuit(3) # State Preparation qc4.h(range(3)) qc4.measure_all() qc4.draw(output='mpl') job4 = execute(qc4.reverse_bits(), backend=QasmSimulator(), shots=8192) plot_histogram(job4.result().get_counts()) from qiskit.providers.aer.noise import NoiseModel from qiskit.test.mock import FakeMelbourne device_backend = FakeMelbourne() coupling_map = device_backend.configuration().coupling_map noise_model = NoiseModel.from_backend(device_backend) basis_gates = noise_model.basis_gates result_noise = execute(qc4, QasmSimulator(), shots=8192, noise_model=noise_model, coupling_map=coupling_map, basis_gates=basis_gates).result() plot_histogram(result_noise.get_counts()) qc3_t = transpile(qc3, basis_gates=basis_gates) qc3_t.draw(output='mpl') # Loading your IBM Q account(s) provider = IBMQ.load_account() provider.backends() ibmq_backend = provider.get_backend('ibmq_16_melbourne') result_device = execute(qc4, backend=ibmq_backend, shots=8192).result() plot_histogram(result_device.get_counts())
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# Useful additional packages import matplotlib.pyplot as plt %matplotlib inline import numpy as np from math import pi from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister, execute from qiskit.tools.visualization import circuit_drawer from qiskit.quantum_info import state_fidelity from qiskit import BasicAer backend = BasicAer.get_backend('unitary_simulator') q = QuantumRegister(1) qc = QuantumCircuit(q) qc.u3(pi/2,pi/2,pi/2,q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.u2(pi/2,pi/2,q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.u1(pi/2,q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.u0(pi/2,q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.iden(q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.x(q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.y(q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.z(q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.h(q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.s(q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.sdg(q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.t(q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.tdg(q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.rx(pi/2,q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.ry(pi/2,q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.rz(pi/2,q) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) q = QuantumRegister(2) qc = QuantumCircuit(q) qc.cx(q[0],q[1]) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.cy(q[0],q[1]) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.cz(q[0],q[1]) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.ch(q[0],q[1]) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.crz(pi/2,q[0],q[1]) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.cu1(pi/2,q[0], q[1]) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.cu3(pi/2, pi/2, pi/2, q[0], q[1]) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.swap(q[0], q[1]) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) q = QuantumRegister(3) qc = QuantumCircuit(q) qc.ccx(q[0], q[1], q[2]) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) qc = QuantumCircuit(q) qc.cswap(q[0], q[1], q[2]) qc.draw() job = execute(qc, backend) job.result().get_unitary(qc, decimals=3) q = QuantumRegister(1) c = ClassicalRegister(1) qc = QuantumCircuit(q, c) qc.measure(q, c) qc.draw() backend = BasicAer.get_backend('qasm_simulator') job = execute(qc, backend, shots=1024) job.result().get_counts(qc) qc = QuantumCircuit(q, c) qc.h(q) qc.measure(q, c) qc.draw() job = execute(qc, backend, shots=1024) job.result().get_counts(qc) qc = QuantumCircuit(q, c) qc.reset(q[0]) qc.measure(q, c) qc.draw() job = execute(qc, backend, shots=1024) job.result().get_counts(qc) qc = QuantumCircuit(q, c) qc.h(q) qc.reset(q[0]) qc.measure(q, c) qc.draw() job = execute(qc, backend, shots=1024) job.result().get_counts(qc) qc = QuantumCircuit(q, c) qc.x(q[0]).c_if(c, 0) qc.measure(q,c) qc.draw() job = execute(qc, backend, shots=1024) job.result().get_counts(qc) qc = QuantumCircuit(q, c) qc.h(q) qc.measure(q,c) qc.x(q[0]).c_if(c, 0) qc.measure(q,c) qc.draw() job = execute(qc, backend, shots=1024) job.result().get_counts(qc) # Initializing a three-qubit quantum state import math desired_vector = [ 1 / math.sqrt(16) * complex(0, 1), 1 / math.sqrt(8) * complex(1, 0), 1 / math.sqrt(16) * complex(1, 1), 0, 0, 1 / math.sqrt(8) * complex(1, 2), 1 / math.sqrt(16) * complex(1, 0), 0] q = QuantumRegister(3) qc = QuantumCircuit(q) qc.initialize(desired_vector, [q[0],q[1],q[2]]) qc.draw(output='latex') backend = BasicAer.get_backend('statevector_simulator') job = execute(qc, backend) qc_state = job.result().get_statevector(qc) qc_state state_fidelity(desired_vector,qc_state)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import * from qiskit.tools.parallel import parallel_map from qiskit.tools.events import TextProgressBar from qiskit.tools.jupyter import * # Needed to load the Jupyter HTMLProgressBar num_circuits = 1000 width = 4 depth = 4 import copy import math import numpy as np from qiskit.tools.qi.qi import random_unitary_matrix from qiskit.mapper import two_qubit_kak def build_qv_circuit(idx, seeds, width, depth): """Builds a single Quantum Volume circuit. Two circuits, one with measurements, and one widthout, are returned. The model circuits consist of layers of Haar random elements of SU(4) applied between corresponding pairs of qubits in a random bipartition. See: https://arxiv.org/abs/1811.12926 """ np.random.seed(seeds[idx]) q = QuantumRegister(width, "q") c = ClassicalRegister(width, "c") # Create measurement subcircuit qc = QuantumCircuit(q,c) # For each layer for j in range(depth): # Generate uniformly random permutation Pj of [0...n-1] perm = np.random.permutation(width) # For each pair p in Pj, generate Haar random SU(4) # Decompose each SU(4) into CNOT + SU(2) and add to Ci for k in range(math.floor(width/2)): qubits = [int(perm[2*k]), int(perm[2*k+1])] U = random_unitary_matrix(4) for gate in two_qubit_kak(U): i0 = qubits[gate["args"][0]] if gate["name"] == "cx": i1 = qubits[gate["args"][1]] qc.cx(q[i0], q[i1]) elif gate["name"] == "u1": qc.u1(gate["params"][2], q[i0]) elif gate["name"] == "u2": qc.u2(gate["params"][1], gate["params"][2], q[i0]) elif gate["name"] == "u3": qc.u3(gate["params"][0], gate["params"][1], gate["params"][2], q[i0]) elif gate["name"] == "id": pass # do nothing qc_no_meas = copy.deepcopy(qc) # Create circuit with final measurement qc.measure(q,c) return qc, qc_no_meas num_circuits = 1000 seeds = np.random.randint(np.iinfo(np.int32).max, size=num_circuits) TextProgressBar() parallel_map(build_qv_circuit, np.arange(num_circuits), task_args=(seeds, width, depth)); seeds = np.random.randint(np.iinfo(np.int32).max, size=num_circuits) HTMLProgressBar() parallel_map(build_qv_circuit, np.arange(num_circuits), task_args=(seeds, width, depth));
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import QuantumCircuit, ClassicalRegister, QuantumRegister # Build a quantum circuit n = 3 # number of qubits q = QuantumRegister(n) c = ClassicalRegister(n) circuit = QuantumCircuit(q, c) circuit.x(q[1]) circuit.h(q) circuit.cx(q[0], q[1]) circuit.measure(q, c); print(circuit) circuit.draw() # Matplotlib Drawing circuit.draw(output='mpl') # Latex Drawing circuit.draw(output='latex') # Draw a new circuit with barriers and more registers q_a = QuantumRegister(3, name='qa') q_b = QuantumRegister(5, name='qb') c_a = ClassicalRegister(3) c_b = ClassicalRegister(5) circuit = QuantumCircuit(q_a, q_b, c_a, c_b) circuit.x(q_a[1]) circuit.x(q_b[1]) circuit.x(q_b[2]) circuit.x(q_b[4]) circuit.barrier() circuit.h(q_a) circuit.barrier(q_a) circuit.h(q_b) circuit.cswap(q_b[0], q_b[1], q_b[2]) circuit.cswap(q_b[2], q_b[3], q_b[4]) circuit.cswap(q_b[3], q_b[4], q_b[0]) circuit.barrier(q_b) circuit.measure(q_a, c_a) circuit.measure(q_b, c_b); # Draw the circuit circuit.draw(output='latex') # Draw the circuit with reversed bit order circuit.draw(output='latex', reverse_bits=True) # Draw the circuit without barriers circuit.draw(output='latex', plot_barriers=False) # Draw the circuit without barriers and reverse bit order circuit.draw(output='latex', plot_barriers=False, reverse_bits=True) # Set line length to 80 for above circuit circuit.draw(output='text', line_length=80) # Change the background color in mpl style = {'backgroundcolor': 'lightgreen'} circuit.draw(output='mpl', style=style) # Scale the mpl output to 1/2 the normal size circuit.draw(output='mpl', scale=0.5) # Scale the latex output to 1/2 the normal size circuit.draw(output='latex', scale=0.5) # Print the latex source for the visualization print(circuit.draw(output='latex_source')) # Save the latex source to a file circuit.draw(output='latex_source', filename='/tmp/circuit.tex'); from qiskit.tools.visualization import circuit_drawer circuit_drawer(circuit, output='mpl', plot_barriers=False)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import * Aer.backends() IBMQ.load_accounts() IBMQ.backends() from pprint import pprint backend_name = 'ibmqx4' backend = IBMQ.get_backend(backend_name) backend.status() backend.configuration() backend.properties() from qiskit.backends.ibmq import least_busy devices = IBMQ.backends(simulator=False) least_busy_device = least_busy(devices) least_busy_device.status() last_10_jobs = least_busy_device.jobs(limit=10) for j in last_10_jobs: print(j.job_id()) from qiskit.tools.visualization import circuit_drawer qr = QuantumRegister(4) cr = ClassicalRegister(4) circ = QuantumCircuit(qr, cr) circ.h(qr[0]) circ.cx(qr[0], qr[1]) circ.tdg(qr[2]) circ.cx(qr[2], qr[1]) circ.x(qr[2]) circ.cx(qr[0], qr[2]) circ.cx(qr[1], qr[3]) circ.measure(qr, cr) circuit_drawer(circ, scale=0.5) %matplotlib inline qiskit.tools.visualization.matplotlib_circuit_drawer(circ) simulator_backend = IBMQ.get_backend(simulator=True, hub=None) job = execute(circ, simulator_backend) import time from qiskit.backends import JobStatus print(job.status()) while job.status() != JobStatus.DONE: time.sleep(1) print(job.status()) qobj = compile(circ, simulator_backend) compiled_circ = qobj_to_circuits(qobj)[0] circuit_drawer(compiled_circ, scale=0.5) qobj.as_dict() job = simulator_backend.run(qobj) result = job.result() import qiskit.wrapper.jupyter %%qiskit_job_status job = execute(circ, backend) %%qiskit_progress_bar qobj = compile(circ, backend) from qiskit import * from qiskit.tools.visualization.interactive import * q = QuantumRegister(5) circ1 = QuantumCircuit(q) circ1.h(q) circ1.ry(1.3, q[0]) circ1.cx(q[0], q[1]) statevector_simulator = Aer.get_backend('statevector_simulator') result = execute(circ1, statevector_simulator).result() psi = result.get_statevector() iplot_state(psi, method='qsphere') # method could be city, paulivec, qsphere, bloch, wigner # Not displayable in github c = ClassicalRegister(5) circ2 = QuantumCircuit(q, c) circ2.h(q) circ2.measure(q, c) circ3 = QuantumCircuit(q, c) circ3.h(q[0]) circ3.y(q[1]) circ3.cx(q[1], q[0]) circ3.measure(q, c) qasm_simulator = Aer.get_backend('qasm_simulator') result = execute([circ2, circ3], qasm_simulator).result() counts_list = [result.get_counts(circ) for circ in [circ2, circ3]] # Needs to be run in Jupyter, will not render on github iplot_histogram(counts_list, legend=['first circuit', 'second circuit']) # Not displayable in github
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from qiskit import QuantumRegister, ClassicalRegister, QuantumCircuit from qiskit.tools.qi.qi import qft import numpy as np import copy # Setting up a Hadamard QPE circuit for demonstrations below. def h_qpe(circ, q, n): for i in range(n-1): circ.h(q[i]) for j in range(0, n-1, 2): # Only place a CH^n on every other qubit, because CX^n = I for n even circ.ch(q[j], q[n-1]) circ.barrier() qft(circ, q, n-1) n = 5 qr = QuantumRegister(n) cr = ClassicalRegister(n) circuit = QuantumCircuit(qr, cr) circuit.rx(np.pi/4, qr[n-1]) circuit.barrier() h_qpe(circuit, qr, n) unt_circ = copy.deepcopy(circuit) circuit.barrier() circuit.measure(qr, cr) %%capture --no-display from qiskit import BasicAer, LegacySimulators, Aer qasm_backend = BasicAer.get_backend('qasm_simulator') sv_backend = BasicAer.get_backend('statevector_simulator') unt_backend = BasicAer.get_backend('unitary_simulator') # Setup from qiskit import execute qasm_job = execute(circuit, qasm_backend) sv_job = execute(unt_circ, sv_backend) unt_job = execute(unt_circ, unt_backend) qasm_result = qasm_job.result() sv_result = sv_job.result() unt_result = unt_job.result() qasm_result.data() sv_result.data() unt_result.data() # Not displayed because results are too large for github. qasm_result.get_counts() sv_result.get_statevector() unt_result.get_unitary() len(sv_result.get_statevector()) from qiskit import LegacySimulators from qiskit.extensions.simulator.snapshot import snapshot snap_backend = LegacySimulators.get_backend('statevector_simulator') snap_unt_circ = copy.deepcopy(unt_circ) snap_unt_circ.snapshot(10) sv_job = execute(snap_unt_circ, snap_backend) sv_result = sv_job.result() sv_result.data()['snapshots'] from qiskit.quantum_info.analyzation.average import average_data counts = qasm_result.get_counts() iden = np.eye(len(counts)) oper = {} for i, key in enumerate(counts.keys()): oper[key] = iden[i] average_data(counts, oper) #!pip install qiskit-terra[visualization] from qiskit.tools.visualization import circuit_drawer from qiskit.tools.visualization.dag_visualization import dag_drawer lin_len = 98 # Change to wider in Jupyter, this is only to render nicely in github circuit.draw(line_length=lin_len) style = {'cregbundle': True, 'usepiformat': True, 'subfontsize': 12, 'fold': 100, 'showindex': True, 'backgroundcolor': '#fffaff', "displaycolor": { # Taken from qx_color_scheme() in _circuit_visualization.py "id": "#ffca64", "u0": "#f69458", "u1": "#f69458", "u2": "#f69458", "u3": "#f69458", "x": "#a6ce38", "y": "#a6ce38", "z": "#a6ce38", "h": "#00bff2", "s": "#00bff2", "sdg": "#00bff2", "t": "#ff6666", "tdg": "#ff6666", "rx": "#ffca64", "ry": "#ffca64", "rz": "#ffca64", "reset": "#d7ddda", "target": "#00bff2", "meas": "#f070aa"}} circuit.draw(output='mpl', style=style) circuit.draw(output='latex_source', plot_barriers=False) circuit.draw(output='latex', plot_barriers=False) from qiskit import transpiler draw_circ = transpiler.transpile(circuit, qasm_backend, basis_gates='U,CX') draw_circ.draw(line_length=2000) # Not shown in github for rendering reasons, load in Jupyter from qiskit.tools.qi.qi import outer from qiskit.tools.visualization import plot_histogram, plot_state_city, plot_bloch_multivector, plot_state_paulivec, plot_state_hinton, plot_state_qsphere from qiskit.tools.visualization import iplot_histogram, iplot_state_city, iplot_bloch_multivector, iplot_state_paulivec, iplot_state_hinton, iplot_state_qsphere counts = qasm_result.get_counts() phi = sv_result.get_statevector() rho = outer(phi) plot_histogram(counts) plot_state_city(rho) plot_state_hinton(rho) hist_fig = plot_histogram(counts) state_fig = plot_state_city(rho) hist_fig.savefig('histogram.png') state_fig.savefig('state_plot.png') iplot_bloch_multivector(rho) # Not displayed in github, download and run loacally. from qiskit.converters.circuit_to_dag import circuit_to_dag my_dag = circuit_to_dag(circuit) dag_drawer(my_dag) job = execute(circuit, qasm_backend, shots=50, memory=True) result = job.result() result.get_memory(circuit) from qiskit.transpiler import PassManager from qiskit.transpiler.passes import BasicSwap, CXCancellation, LookaheadSwap, StochasticSwap from qiskit.transpiler import transpile from qiskit.mapper import CouplingMap qr = QuantumRegister(7, 'q') qr = QuantumRegister(7, 'q') tpl_circuit = QuantumCircuit(qr) tpl_circuit.h(qr[3]) tpl_circuit.cx(qr[0], qr[6]) tpl_circuit.cx(qr[6], qr[0]) tpl_circuit.cx(qr[0], qr[1]) tpl_circuit.cx(qr[3], qr[1]) tpl_circuit.cx(qr[3], qr[0]) tpl_circuit.draw() coupling = [[0, 1], [1, 2], [2, 3], [3, 4], [4, 5], [5, 6]] simulator = BasicAer.get_backend('qasm_simulator') coupling_map = CouplingMap(couplinglist=coupling) pass_manager = PassManager() pass_manager.append([BasicSwap(coupling_map=coupling_map)]) basic_circ = transpile(tpl_circuit, simulator, pass_manager=pass_manager) basic_circ.draw() pass_manager = PassManager() pass_manager.append([LookaheadSwap(coupling_map=coupling_map)]) lookahead_circ = transpile(tpl_circuit, simulator, pass_manager=pass_manager) lookahead_circ.draw() pass_manager = PassManager() pass_manager.append([StochasticSwap(coupling_map=coupling_map)]) stoch_circ = transpile(tpl_circuit, simulator, pass_manager=pass_manager) stoch_circ.draw() qasm_job = execute(circuit, qasm_backend, pass_manager=PassManager()) from qiskit.converters.dag_to_circuit import dag_to_circuit new_circ_from_dag = dag_to_circuit(my_dag) new_circ_from_dag.draw(line_length = lin_len) from qiskit import QuantumCircuit qasm_str = circuit.qasm() new_circ = QuantumCircuit.from_qasm_str(qasm_str) new_circ.draw(line_length = lin_len) filepath = 'my_qasm_file.txt' qasm_file = open(filepath, "w") qasm_file.write(unt_circ.qasm()) qasm_file.close() new_unt_circ = QuantumCircuit.from_qasm_file(filepath) new_unt_circ.draw(line_length = lin_len)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
from math import pi from qiskit import QuantumCircuit, QuantumRegister, ClassicalRegister from qiskit.tools.visualization import matplotlib_circuit_drawer as drawer, qx_color_scheme # We recommend the following options for Jupter notebook %matplotlib inline # Create a Quantum Register called "q" with 3 qubits qr = QuantumRegister(3, 'q') # Create a Classical Register called "c" with 3 bits cr = ClassicalRegister(3, 'c') # Create a Quantum Circuit called involving "qr" and "cr" circuit = QuantumCircuit(qr, cr) circuit.x(qr[0]).c_if(cr, 3) circuit.z(qr[0]) circuit.u2(pi/2, 2*pi/3, qr[1]) circuit.cu1(pi, qr[0], qr[1]) # Barrier to seperator the input from the circuit circuit.barrier(qr[0]) circuit.barrier(qr[1]) circuit.barrier(qr[2]) # Toffoli gate from qubit 0,1 to qubit 2 circuit.ccx(qr[0], qr[1], qr[2]) # CNOT (Controlled-NOT) gate from qubit 0 to qubit 1 circuit.cx(qr[0], qr[1]) circuit.swap(qr[0], qr[2]) # measure gate from qr to cr circuit.measure(qr, cr) QASM_source = circuit.qasm() print(QASM_source) drawer(circuit) drawer(circuit, basis='u1,u2,u3,id,cx', scale=1.0) my_style = {'plotbarrier': True} drawer(circuit, style=my_style) my_style = {'cregbundle': True} drawer(circuit, style=my_style) my_style = {'showindex': True} drawer(circuit, style=my_style) my_style = {'compress': True} drawer(circuit, style=my_style) my_style = {'fold': 6} drawer(circuit, style=my_style) my_style = {'usepiformat': True} drawer(circuit, style=my_style) qr = QuantumRegister(1, 'q') circuit_xyz = QuantumCircuit(qr) circuit_xyz.x(qr[0]) circuit_xyz.y(qr[0]) circuit_xyz.z(qr[0]) drawer(circuit_xyz) my_style = {'displaytext': {'x': '😺', 'y': '\Sigma', 'z': '✈'}} drawer(circuit_xyz, style=my_style) qr = QuantumRegister(2, 'q') circuit_cucz = QuantumCircuit(qr) circuit_cucz.cz(qr[0], qr[1]) circuit_cucz.cu1(pi, qr[0], qr[1]) drawer(circuit_cucz) my_style = {'latexdrawerstyle': False} drawer(circuit_cucz, style=my_style) qr = QuantumRegister(3, 'q') cr = ClassicalRegister(3, 'c') circuit_all = QuantumCircuit(qr, cr) circuit_all.x(qr[0]) circuit_all.y(qr[0]) circuit_all.z(qr[0]) circuit_all.barrier(qr[0]) circuit_all.barrier(qr[1]) circuit_all.barrier(qr[2]) circuit_all.h(qr[0]) circuit_all.s(qr[0]) circuit_all.sdg(qr[0]) circuit_all.t(qr[0]) circuit_all.tdg(qr[0]) circuit_all.iden(qr[0]) circuit_all.reset(qr[0]) circuit_all.rx(pi, qr[0]) circuit_all.ry(pi, qr[0]) circuit_all.rz(pi, qr[0]) circuit_all.u0(pi, qr[0]) circuit_all.u1(pi, qr[0]) circuit_all.u2(pi, pi, qr[0]) circuit_all.u3(pi, pi, pi, qr[0]) circuit_all.swap(qr[0], qr[1]) circuit_all.cx(qr[0], qr[1]) circuit_all.cy(qr[0], qr[1]) circuit_all.cz(qr[0], qr[1]) circuit_all.ch(qr[0], qr[1]) circuit_all.cu1(pi, qr[0], qr[1]) circuit_all.cu3(pi, pi, pi, qr[0], qr[1]) circuit_all.crz(pi, qr[0], qr[1]) circuit_all.ccx(qr[0], qr[1], qr[2]) circuit_all.cswap(qr[0], qr[1], qr[2]) circuit_all.measure(qr, cr) drawer(circuit_all) cmp_style = qx_color_scheme() cmp_style drawer(circuit_all, style=cmp_style) cmp_style.update({ 'usepiformat': True, 'showindex': True, 'cregbundle': True, 'compress': True, 'fold': 17 }) drawer(circuit_all, filename='circuit.pdf', style=cmp_style)
https://github.com/shesha-raghunathan/DATE2019-qiskit-tutorial
shesha-raghunathan
# Import the QuantumProgram and our configuration import math from pprint import pprint from qiskit import QuantumProgram import Qconfig qp = QuantumProgram() # quantum register for the first circuit q1 = qp.create_quantum_register('q1', 4) c1 = qp.create_classical_register('c1', 4) # quantum register for the second circuit q2 = qp.create_quantum_register('q2', 2) c2 = qp.create_classical_register('c2', 2) # making the first circuits qc1 = qp.create_circuit('GHZ', [q1], [c1]) qc2 = qp.create_circuit('superposition', [q2], [c2]) qc1.h(q1[0]) qc1.cx(q1[0], q1[1]) qc1.cx(q1[1], q1[2]) qc1.cx(q1[2], q1[3]) for i in range(4): qc1.measure(q1[i], c1[i]) # making the second circuits qc2.h(q2) for i in range(2): qc2.measure(q2[i], c2[i]) # printing the circuits print(qp.get_qasm('GHZ')) print(qp.get_qasm('superposition')) qobj = qp.compile(['GHZ','superposition'], backend='local_qasm_simulator') qp.get_execution_list(qobj) qp.get_execution_list(qobj, verbose=True) qp.get_compiled_configuration(qobj, 'GHZ', ) print(qp.get_compiled_qasm(qobj, 'GHZ')) # Coupling map coupling_map = {0: [1, 2, 3]} # Place the qubits on a triangle in the bow-tie initial_layout={("q1", 0): ("q", 0), ("q1", 1): ("q", 1), ("q1", 2): ("q", 2), ("q1", 3): ("q", 3)} qobj = qp.compile(['GHZ'], backend='local_qasm_simulator', coupling_map=coupling_map, initial_layout=initial_layout) print(qp.get_compiled_qasm(qobj,'GHZ')) # Define methods for making QFT circuits def input_state(circ, q, n): """n-qubit input state for QFT that produces output 1.""" for j in range(n): circ.h(q[j]) circ.u1(math.pi/float(2**(j)), q[j]).inverse() def qft(circ, q, n): """n-qubit QFT on q in circ.""" for j in range(n): for k in range(j): circ.cu1(math.pi/float(2**(j-k)), q[j], q[k]) circ.h(q[j]) qp = QuantumProgram() q = qp.create_quantum_register("q", 3) c = qp.create_classical_register("c", 3) qft3 = qp.create_circuit("qft3", [q], [c]) input_state(qft3, q, 3) qft(qft3, q, 3) for i in range(3): qft3.measure(q[i], c[i]) print(qft3.qasm()) result = qp.execute(["qft3"], backend="local_qasm_simulator", shots=1024) result.get_counts("qft3") print(result.get_ran_qasm("qft3")) # Coupling map for ibmqx2 "bowtie" coupling_map = {0: [1, 2], 1: [2], 2: [], 3: [2, 4], 4: [2]} # Place the qubits on a triangle in the bow-tie initial_layout={("q", 0): ("q", 2), ("q", 1): ("q", 3), ("q", 2): ("q", 4)} result2 = qp.execute(["qft3"], backend="local_qasm_simulator", coupling_map=coupling_map, initial_layout=initial_layout) result2.get_counts("qft3") print(result2.get_ran_qasm("qft3")) # Place the qubits on a linear segment of the ibmqx3 coupling_map = {0: [1], 1: [2], 2: [3], 3: [14], 4: [3, 5], 6: [7, 11], 7: [10], 8: [7], 9: [8, 10], 11: [10], 12: [5, 11, 13], 13: [4, 14], 15: [0, 14]} initial_layout={("q", 0): ("q", 0), ("q", 1): ("q", 1), ("q", 2): ("q", 2)} result3 = qp.execute(["qft3"], backend="local_qasm_simulator", coupling_map=coupling_map, initial_layout=initial_layout) result3.get_counts("qft3") print(result3.get_ran_qasm("qft3"))
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# Install the plugin # !pip install -e . import numpy as np from qiskit import QuantumCircuit from qiskit.quantum_info import random_clifford from qiskit.transpiler import PassManager from qiskit_transpiler_service.ai.synthesis import AICliffordSynthesis from qiskit_transpiler_service.ai.collection import CollectCliffords from qiskit.transpiler.preset_passmanagers import generate_preset_pass_manager from qiskit_ibm_runtime import QiskitRuntimeService coupling_map = QiskitRuntimeService().backend("ibm_cairo").coupling_map circuit = QuantumCircuit(27) for c in range(3): nq = 8 qs = np.random.choice(range(circuit.num_qubits), size=nq, replace=False) circuit.compose(random_clifford(nq).to_circuit(), qubits=qs.tolist(), inplace=True) for q in qs: circuit.t(q) print( f"Original circuit -> Depth: {circuit.decompose(reps=3).depth()}, Gates(2q): {circuit.decompose(reps=3).num_nonlocal_gates()}" ) circuit.draw(output="mpl", fold=-1, scale=0.3, style="iqp") qiskit_lvl3_transpiler = generate_preset_pass_manager( optimization_level=3, coupling_map=coupling_map ) lvl3_transpiled_circuit = qiskit_lvl3_transpiler.run(circuit) print( f"Qiskit lvl3 Transpiler -> Depth: {lvl3_transpiled_circuit.decompose(reps=3).depth()}, Gates(2q): {lvl3_transpiled_circuit.decompose(reps=3).num_nonlocal_gates()}" ) lvl3_transpiled_circuit.draw(output="mpl", fold=-1, scale=0.2, style="iqp") ai_optimize_cliffords = PassManager( [ CollectCliffords(), AICliffordSynthesis(backend_name="ibm_canberra"), ] ) # AI Synthesis passes respect the coupling map and should run after transpiling ai_optimized_circuit = ai_optimize_cliffords.run(lvl3_transpiled_circuit) print( f"AI-Optimized circuit -> Depth: {ai_optimized_circuit.decompose(reps=3).depth()}, Gates(2q): {ai_optimized_circuit.decompose(reps=3).num_nonlocal_gates()}" ) ai_optimized_circuit.draw(output="mpl", fold=-1, scale=0.25, style="iqp")
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# Install the plugin # !pip install -e . import numpy as np from qiskit import QuantumCircuit from qiskit.quantum_info import random_clifford from qiskit.transpiler import PassManager from qiskit_transpiler_service.ai.synthesis import AILinearFunctionSynthesis from qiskit_transpiler_service.ai.collection import CollectLinearFunctions from qiskit.transpiler.preset_passmanagers import generate_preset_pass_manager from qiskit_ibm_runtime import QiskitRuntimeService coupling_map = QiskitRuntimeService().backend("ibm_cairo").coupling_map circuit = QuantumCircuit(27) for c in range(3): nq = 8 qs = np.random.choice(range(circuit.num_qubits), size=nq, replace=False) circuit.compose(random_clifford(nq).to_circuit(), qubits=qs.tolist(), inplace=True) for q in qs: circuit.t(q) print( f"Original circuit -> Depth: {circuit.decompose(reps=3).depth()}, Gates(2q): {circuit.decompose(reps=3).num_nonlocal_gates()}" ) circuit.draw(output="mpl", fold=-1, scale=0.3, style="iqp") qiskit_lvl3_transpiler = generate_preset_pass_manager( optimization_level=3, coupling_map=coupling_map ) lvl3_transpiled_circuit = qiskit_lvl3_transpiler.run(circuit) print( f"Qiskit lvl3 Transpiler -> Depth: {lvl3_transpiled_circuit.decompose(reps=3).depth()}, Gates(2q): {lvl3_transpiled_circuit.decompose(reps=3).num_nonlocal_gates()}" ) lvl3_transpiled_circuit.draw(output="mpl", fold=-1, scale=0.2, style="iqp") ai_optimize_cliffords = PassManager( [ CollectLinearFunctions(), AILinearFunctionSynthesis(backend_name="ibm_cairo"), ] ) # AI Synthesis passes respect the coupling map and should run after transpiling ai_optimized_circuit = ai_optimize_cliffords.run(lvl3_transpiled_circuit) print( f"AI-Optimized circuit -> Depth: {ai_optimized_circuit.decompose(reps=3).depth()}, Gates(2q): {ai_optimized_circuit.decompose(reps=3).num_nonlocal_gates()}" ) ai_optimized_circuit.draw(output="mpl", fold=-1, scale=0.25, style="iqp")
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# Install the plugin # !pip install -e . from qiskit import QuantumCircuit from qiskit.transpiler import PassManager from qiskit_transpiler_service.ai.collection import CollectPermutations from qiskit_transpiler_service.ai.synthesis import AIPermutationSynthesis from qiskit.circuit.library import Permutation num_qubits = 27 circuit = QuantumCircuit(num_qubits) circuit.append( Permutation( num_qubits=num_qubits, pattern=[(i + 1) % num_qubits for i in range(num_qubits)] ), qargs=range(num_qubits), ) circuit = circuit.decompose(reps=2) print( f"Original circuit -> Depth: {circuit.decompose(reps=3).depth()}, Gates(2q): {circuit.decompose(reps=3).num_nonlocal_gates()}" ) circuit.draw(output="mpl", fold=-1, scale=0.3, style="iqp") ai_optimize_perms = PassManager( [ CollectPermutations(do_commutative_analysis=True), AIPermutationSynthesis(backend_name="ibm_cairo"), ] ) # AI Synthesis passes respect the coupling map and should run after transpiling ai_optimized_circuit = ai_optimize_perms.run(circuit) print( f"AI-Optimized circuit -> Depth: {ai_optimized_circuit.decompose(reps=3).depth()}, Gates(2q): {ai_optimized_circuit.decompose(reps=3).num_nonlocal_gates()}" ) ai_optimized_circuit.draw(output="mpl", fold=-1, scale=0.25, style="iqp")
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# Install the plugin # !pip install -e . from qiskit.transpiler import PassManager from qiskit_transpiler_service.ai.routing import AIRouting from qiskit.circuit.library import EfficientSU2 circuit = EfficientSU2(100, entanglement="circular", reps=1).decompose() print( f"Original circuit -> Depth: {circuit.depth()}, Gates(2q): {circuit.num_nonlocal_gates()}" ) circuit.draw(output="mpl", fold=-1, scale=0.2, style="iqp") qiskit_ai_transpiler = PassManager( [AIRouting(backend_name="ibm_torino", optimization_level=1, layout_mode="optimize")] ) ai_transpiled_circuit = qiskit_ai_transpiler.run(circuit) print( f"Qiskit AI Transpiler -> Depth: {ai_transpiled_circuit.depth()}, Gates(2q): {ai_transpiled_circuit.num_nonlocal_gates()}" ) ai_transpiled_circuit.draw(output="mpl", fold=-1, scale=0.2, style="iqp") from qiskit.transpiler.preset_passmanagers import generate_preset_pass_manager from qiskit_ibm_runtime import QiskitRuntimeService coupling_map = QiskitRuntimeService().backend("ibm_torino").coupling_map qiskit_lvl3_transpiler = generate_preset_pass_manager( optimization_level=3, coupling_map=coupling_map ) lvl3_transpiled_circuit = qiskit_lvl3_transpiler.run(circuit) print( f"Qiskit lvl3 Transpiler -> Depth: {lvl3_transpiled_circuit.depth()}, Gates(2q): {lvl3_transpiled_circuit.num_nonlocal_gates()}" ) lvl3_transpiled_circuit.draw(output="mpl", fold=-1, scale=0.2, style="iqp") from qiskit_transpiler_service.transpiler_service import TranspilerService qiskit_lvl3_transpiler_service = TranspilerService( backend_name="ibm_torino", ai="false", optimization_level=3, ) lvl3_transpiled_circuit_v2 = qiskit_lvl3_transpiler_service.run(circuit) print( f"Qiskit lvl3 Transpiler -> Depth: {lvl3_transpiled_circuit_v2.depth()}, Gates(2q): {lvl3_transpiled_circuit_v2.num_nonlocal_gates()}" ) lvl3_transpiled_circuit_v2.draw(output="mpl", fold=-1, scale=0.2, style="iqp") qiskit_lvl3_ai_transpiler_service = TranspilerService( backend_name="ibm_torino", ai="true", optimization_level=3, ) lvl3_transpiled_ai_circuit_v2 = qiskit_lvl3_ai_transpiler_service.run(circuit) print( f"Qiskit lvl3 AI Transpiler -> Depth: {lvl3_transpiled_ai_circuit_v2.depth()}, Gates(2q): {lvl3_transpiled_ai_circuit_v2.num_nonlocal_gates()}" ) lvl3_transpiled_ai_circuit_v2.draw(output="mpl", fold=-1, scale=0.2, style="iqp")
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
from qiskit.circuit.library import EfficientSU2 from qiskit_transpiler_service.transpiler_service import TranspilerService circuit = EfficientSU2(101, entanglement="circular", reps=1).decompose() cloud_transpiler_service = TranspilerService( backend_name="ibm_sherbrooke", ai="false", optimization_level=3, ) transpiled_circuit_no_ai = cloud_transpiler_service.run(circuit) from qiskit.circuit.library import EfficientSU2 from qiskit_transpiler_service.transpiler_service import TranspilerService circuit = EfficientSU2(101, entanglement="circular", reps=1).decompose() cloud_transpiler_service = TranspilerService( backend_name="ibm_sherbrooke", ai="true", optimization_level=1, ) transpiled_circuit_ai = cloud_transpiler_service.run(circuit) from qiskit.circuit.library import EfficientSU2 from qiskit_transpiler_service.transpiler_service import TranspilerService circuit = EfficientSU2(101, entanglement="circular", reps=1).decompose() cloud_transpiler_service = TranspilerService( backend_name="ibm_sherbrooke", ai="auto", optimization_level=1, ) transpiled_circuit_ai_auto = cloud_transpiler_service.run(circuit) from qiskit.circuit.library import EfficientSU2 from qiskit_transpiler_service.transpiler_service import TranspilerService circuit = EfficientSU2(101, entanglement="circular", reps=1).decompose() cloud_transpiler_service = TranspilerService( backend_name="ibm_sherbrooke", ai="auto", optimization_level=1, ) transpiled_circuit = cloud_transpiler_service.run(circuit) from qiskit.transpiler import PassManager from qiskit_transpiler_service.ai.routing import AIRouting from qiskit.circuit.library import EfficientSU2 ai_passmanager = PassManager( [ AIRouting( backend_name="ibm_sherbrooke", optimization_level=2, layout_mode="optimize" ) ] ) circuit = EfficientSU2(101, entanglement="circular", reps=1).decompose() transpiled_circuit_ai_lvl2 = ai_passmanager.run(circuit) from qiskit.transpiler import PassManager from qiskit_transpiler_service.ai.routing import AIRouting from qiskit_transpiler_service.ai.synthesis import AILinearFunctionSynthesis from qiskit_transpiler_service.ai.collection import CollectLinearFunctions from qiskit.circuit.library import EfficientSU2 ai_passmanager = PassManager( [ AIRouting( backend_name="ibm_torino", optimization_level=3, layout_mode="optimize" ), # Route circuit CollectLinearFunctions(), # Collect Linear Function blocks AILinearFunctionSynthesis( backend_name="ibm_torino" ), # Re-synthesize Linear Function blocks ] ) circuit = EfficientSU2(10, entanglement="full", reps=1).decompose() transpiled_circuit_synthesis = ai_passmanager.run(circuit) print( f"Depth: {transpiled_circuit_no_ai.decompose(reps=3).depth()}, Gates(2q): {transpiled_circuit_no_ai.decompose(reps=3).num_nonlocal_gates()}" ) print( f"Depth: {transpiled_circuit_ai.decompose(reps=3).depth()}, Gates(2q): {transpiled_circuit_ai.decompose(reps=3).num_nonlocal_gates()}" ) print( f"Depth: {transpiled_circuit_ai_auto.decompose(reps=3).depth()}, Gates(2q): {transpiled_circuit_ai_auto.decompose(reps=3).num_nonlocal_gates()}" ) print( f"Depth: {transpiled_circuit_ai_lvl2.decompose(reps=3).depth()}, Gates(2q): {transpiled_circuit_ai_lvl2.decompose(reps=3).num_nonlocal_gates()}" ) print( f"Depth: {transpiled_circuit_synthesis.decompose(reps=3).depth()}, Gates(2q): {transpiled_circuit_synthesis.decompose(reps=3).num_nonlocal_gates()}" )
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """ =============================================================================== Qiskit Transpiler Service (:mod:`qiskit_transpiler_service.transpiler_service`) =============================================================================== .. currentmodule:: qiskit_transpiler_service.transpiler_service Classes ======= .. autosummary:: :toctree: ../stubs/ TranspilerService """ import logging from typing import Dict, List, Union, Literal from qiskit import QuantumCircuit from .wrappers.transpile import TranspileAPI logger = logging.getLogger(__name__) class TranspilerService: """Class for using the transpiler service. :param optimization_level: The optimization level to use during the transpilation. There are 4 optimization levels ranging from 0 to 3, where 0 is intended for not performing any optimizations and 3 spends the most effort to optimize the circuit. :type optimization_level: int :param ai: Specifies if the transpilation should use AI or not, defaults to True. :type ai: str, optional :param coupling_map: A list of pairs that represents physical links between qubits. :type coupling_map: list[list[int]], optional :param backend_name: Name of the backend used for doing the transpilation. :type backend_name: str, optional :param qiskit_transpile_options: Other options to transpile with qiskit. :type qiskit_transpile_options: dict, optional :param ai_layout_mode: Specifies how to handle the layout selection. There are 3 layout modes: keep (respects the layout set by the previous transpiler passes), improve (uses the layout set by the previous transpiler passes as a starting point) and optimize (ignores previous layout selections). :type ai_layout_mode: str, optional """ def __init__( self, optimization_level: int, ai: Literal["true", "false", "auto"] = "true", coupling_map: Union[List[List[int]], None] = None, backend_name: Union[str, None] = None, qiskit_transpile_options: Dict = None, ai_layout_mode: str = None, ) -> None: """Initializes the instance.""" self.transpiler_service = TranspileAPI() self.backend_name = backend_name self.coupling_map = coupling_map self.optimization_level = optimization_level self.ai = ai self.qiskit_transpile_options = qiskit_transpile_options if ai_layout_mode is not None: if ai_layout_mode.upper() not in ["KEEP", "OPTIMIZE", "IMPROVE"]: raise ( f"ERROR. Unknown ai_layout_mode: {ai_layout_mode.upper()}. Valid modes: 'KEEP', 'OPTIMIZE', 'IMPROVE'" ) self.ai_layout_mode = ai_layout_mode.upper() else: self.ai_layout_mode = ai_layout_mode super().__init__() def run( self, circuits: Union[List[Union[str, QuantumCircuit]], Union[str, QuantumCircuit]], ): """Transpile the circuit(s) by calling the service /transpile endpoint. Args: circuits: circuit(s) to transpile. Returns: The transpiled circuit(s) """ logger.info(f"Requesting transpile to the service") transpile_result = self.transpiler_service.transpile( circuits=circuits, backend=self.backend_name, coupling_map=self.coupling_map, optimization_level=self.optimization_level, ai=self.ai, qiskit_transpile_options=self.qiskit_transpile_options, ) if transpile_result is None: logger.warning( "Qiskit transpiler service couldn't transpile the circuit(s)" ) return None logger.info("Qiskit transpiler service returned a result") return transpile_result
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
import pydoc import re import pytket.passes as tkps def get_arguments_from_doc(tket_pass): arguments = [] _doc = pydoc.getdoc(tket_pass) if 'Overloaded function.' in _doc: #Return the first signature #TODO: We should return all possible signatures. This would requires changes in ToQiskitPass also. matches = re.findall("[1-9]\. (" + tket_pass.__name__ + '[^\n]+)', _doc) synopsis_line = matches[0] else: synopsis_line = pydoc.splitdoc(_doc)[0] # To avoid issue caused by callable parentheses: synopsis_line = re.sub('Callable\[\[[^\[]+\][^\[]+\]', 'Callable', synopsis_line) match = re.search("\(([^(]+)\)", synopsis_line) if match is not None: splitted_args = match.group(1).split(', ') for arg_str in splitted_args: if arg_str == '**kwargs': continue else: argument = arg_str.split(': ') eq_index = argument[1].find('=') if eq_index > 0: (_type, _default) = argument[1].split(' = ') arguments.append((argument[0], _type, _default)) else: arguments.append(tuple(argument)) return arguments # This is **temp**. Conversion should be done in a better way # https://github.com/CQCL/pytket-qiskit/blob/develop/pytket/extensions/qiskit/qiskit_convert.py from pytket.extensions.qiskit import qiskit_to_tk, tk_to_qiskit from qiskit.converters import dag_to_circuit, circuit_to_dag from pytket.circuit import Circuit from qiskit.dagcircuit import DAGCircuit def qiskit_dag_to_tk(dag: DAGCircuit): # Replace any gate that is not known to pyket by its definition from pytket.extensions.qiskit.qiskit_convert import _known_qiskit_gate for node in dag.op_nodes(): if not type(node.op) in _known_qiskit_gate: dag.substitute_node_with_dag(node, circuit_to_dag(node.op.definition)) return qiskit_to_tk(dag_to_circuit(dag)) def tk_to_qiskit_dag(tkcirc: Circuit): return circuit_to_dag(tk_to_qiskit(tkcirc))
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Replace each sequence of Clifford, Linear Function or Permutation gates by a single block of these types of gate.""" from functools import partial from qiskit import QuantumCircuit from qiskit.circuit import Instruction from qiskit.circuit.barrier import Barrier from qiskit.circuit.library import LinearFunction, PermutationGate from qiskit.converters import circuit_to_dag, dag_to_dagdependency, dagdependency_to_dag from qiskit.dagcircuit.dagcircuit import DAGCircuit from qiskit.quantum_info.operators import Clifford from qiskit.transpiler.basepasses import TransformationPass from qiskit.transpiler.passes.optimization.collect_and_collapse import ( CollectAndCollapse, collapse_to_operation, ) from qiskit.transpiler.passes.utils import control_flow CLIFFORD_MAX_BLOCK_SIZE = 9 LINEAR_MAX_BLOCK_SIZE = 9 PERMUTATION_MAX_BLOCK_SIZE = 12 clifford_gate_names = [ "x", "y", "z", "h", "s", "sdg", "cx", "cy", "cz", "swap", "clifford", "linear_function", "pauli", ] linear_gate_names = ["cx", "swap", "linear_function"] permutation_gate_names = ["swap"] class Flatten(TransformationPass): """Replaces all instructions that contain a circuit with their circuit""" def __init__(self, node_names): super().__init__() self.node_names = node_names def run(self, dag: DAGCircuit): for node in dag.named_nodes(*self.node_names): if ( hasattr(node.op, "params") and len(node.op.params) > 1 and isinstance(node.op.params[1], QuantumCircuit) ): dag.substitute_node_with_dag(node, circuit_to_dag(node.op.params[1])) return dag _flatten_cliffords = Flatten(("clifford", "Clifford")) _flatten_linearfunctions = Flatten(("linear_function", "Linear_function")) _flatten_permutations = Flatten(("permutation", "Permutation")) from qiskit.dagcircuit.collect_blocks import BlockCollector class GreedyBlockCollector(BlockCollector): def __init__(self, dag, max_block_size): super().__init__(dag) self.max_block_size = max_block_size def collect_matching_block(self, filter_fn): """Iteratively collects the largest block of input nodes (that is, nodes with ``_in_degree`` equal to 0) that match a given filtering function, limiting the maximum size of the block. """ current_block = [] unprocessed_pending_nodes = self._pending_nodes self._pending_nodes = [] block_qargs = set() # Iteratively process unprocessed_pending_nodes: # - any node that does not match filter_fn is added to pending_nodes # - any node that match filter_fn is added to the current_block, # and some of its successors may be moved to unprocessed_pending_nodes. while unprocessed_pending_nodes: node = unprocessed_pending_nodes.pop() if isinstance(node.op, Barrier): continue new_qargs = block_qargs.copy() for q in node.qargs: new_qargs.add(q) if filter_fn(node) and len(new_qargs) <= self.max_block_size: current_block.append(node) block_qargs = new_qargs # update the _in_degree of node's successors for suc in self._direct_succs(node): self._in_degree[suc] -= 1 if self._in_degree[suc] == 0: unprocessed_pending_nodes.append(suc) else: self._pending_nodes.append(node) return current_block class BlockChecker: def __init__(self, gates, block_class): self.gates = gates self.block_class = block_class self.current_set = set() def select(self, node): """Decides if the node should be added to the block.""" return ( node.op.name in self.gates and getattr(node.op, "condition", None) is None ) def collapse(self, circuit): """Construcs an Gate object for the block.""" self.current_set = set() return self.block_class(circuit) class CliffordInstruction(Instruction): def __init__(self, circuit): circuit = _flatten_cliffords(circuit) super().__init__( name="Clifford", num_qubits=circuit.num_qubits, num_clbits=0, params=[Clifford(circuit), circuit], ) def construct_permutation_gate(circuit): circuit = _flatten_permutations(circuit) return PermutationGate(LinearFunction(circuit).permutation_pattern()) def construct_linearfunction_gate(circuit): circuit = _flatten_linearfunctions(circuit) return LinearFunction(circuit) class RepeatedCollectAndCollapse(CollectAndCollapse): def __init__( self, block_checker: BlockChecker, do_commutative_analysis=True, split_blocks=True, min_block_size=2, max_block_size=1000, split_layers=False, collect_from_back=False, num_reps=10, ): collect_function = lambda dag: GreedyBlockCollector( dag, max_block_size ).collect_all_matching_blocks( filter_fn=block_checker.select, split_blocks=split_blocks, min_block_size=min_block_size, split_layers=split_layers, collect_from_back=collect_from_back, ) collapse_function = partial( collapse_to_operation, collapse_function=block_checker.collapse ) super().__init__( collect_function=collect_function, collapse_function=collapse_function, do_commutative_analysis=do_commutative_analysis, ) self.num_reps = num_reps @control_flow.trivial_recurse def run(self, dag): """Run the CollectLinearFunctions pass on `dag`. Args: dag (DAGCircuit): the DAG to be optimized. Returns: DAGCircuit: the optimized DAG. """ # If the option commutative_analysis is set, construct DAGDependency from the given DAGCircuit. if self.do_commutative_analysis: dag = dag_to_dagdependency(dag) for _ in range(self.num_reps): # call collect_function to collect blocks from DAG blocks = self.collect_function(dag) # call collapse_function to collapse each block in the DAG self.collapse_function(dag, blocks) # If the option commutative_analysis is set, construct back DAGCircuit from DAGDependency. if self.do_commutative_analysis: dag = dagdependency_to_dag(dag) return dag class CollectCliffords(RepeatedCollectAndCollapse): """CollectCliffords(do_commutative_analysis: bool = True, min_block_size: int = 2, max_block_size: int = CLIFFORD_MAX_BLOCK_SIZE, collect_from_back: bool = False, num_reps: int = 10) Collects Clifford blocks as `Instruction` objects and stores the original sub-circuit to compare against it after synthesis. :param do_commutative_analysis: Enable or disable commutative analysis, defaults to True :type do_commutative_analysis: bool, optional :param min_block_size: Set the minimum size for blocks generated during the collect Cliffords pass, defaults to 2. :type min_block_size: int, optional :param max_block_size: Set the maximum size for blocks generated during the collect Cliffords pass, defaults to 9. :type max_block_size: int, optional :param collect_from_back: Specify if collect blocks in reverse order or not, defaults to False. :type collect_from_back: bool, optional :param num_reps: Specify how many times to repeat the optimization process, defaults to 10. :type num_reps: int, optional """ def __init__( self, do_commutative_analysis=True, min_block_size=2, max_block_size=CLIFFORD_MAX_BLOCK_SIZE, collect_from_back=False, num_reps=10, ): super().__init__( BlockChecker( gates=clifford_gate_names, block_class=CliffordInstruction, ), do_commutative_analysis=do_commutative_analysis, split_blocks=True, min_block_size=min_block_size, max_block_size=max_block_size, split_layers=False, collect_from_back=collect_from_back, num_reps=num_reps, ) class CollectLinearFunctions(RepeatedCollectAndCollapse): """CollectLinearFunctions(do_commutative_analysis: bool = True, min_block_size: int = 4, max_block_size: int = LINEAR_MAX_BLOCK_SIZE, collect_from_back: bool = False, num_reps: int = 10) Collects blocks of `SWAP` and `CX` as `LinearFunction` objects and stores the original sub-circuit to compare against it after synthesis. :param do_commutative_analysis: Enable or disable commutative analysis, defaults to True :type do_commutative_analysis: bool, optional :param min_block_size: Set the minimum size for blocks generated during the collect linear functions pass, defaults to 4. :type min_block_size: int, optional :param max_block_size: Set the maximum size for blocks generated during the collect linear functions pass, defaults to 9. :type max_block_size: int, optional :param collect_from_back: Specify if collect blocks in reverse order or not, defaults to False. :type collect_from_back: bool, optional :param num_reps: Specify how many times to repeat the optimization process, defaults to 10. :type num_reps: int, optional """ def __init__( self, do_commutative_analysis=True, min_block_size=4, max_block_size=LINEAR_MAX_BLOCK_SIZE, collect_from_back=False, num_reps=10, ): super().__init__( BlockChecker( gates=linear_gate_names, block_class=construct_linearfunction_gate, ), do_commutative_analysis=do_commutative_analysis, split_blocks=True, min_block_size=min_block_size, max_block_size=max_block_size, split_layers=False, collect_from_back=collect_from_back, num_reps=num_reps, ) class CollectPermutations(RepeatedCollectAndCollapse): """CollectPermutations(do_commutative_analysis: bool = True, min_block_size: int = 4, max_block_size: int = PERMUTATION_MAX_BLOCK_SIZE, collect_from_back: bool = False, num_reps: int = 10) Collects blocks of `SWAP` circuits as `Permutations`. :param do_commutative_analysis: Enable or disable commutative analysis, defaults to True :type do_commutative_analysis: bool, optional :param min_block_size: Set the minimum size for blocks generated during the collect permutations pass, defaults to 4. :type min_block_size: int, optional :param max_block_size: Set the maximum size for blocks generated during the collect permutations pass, defaults to 12. :type max_block_size: int, optional :param collect_from_back: Specify if collect blocks in reverse order or not, defaults to False. :type collect_from_back: bool, optional :param num_reps: Specify how many times to repeat the optimization process, defaults to 10. :type num_reps: int, optional """ def __init__( self, do_commutative_analysis=True, min_block_size=4, max_block_size=PERMUTATION_MAX_BLOCK_SIZE, collect_from_back=False, num_reps=10, ): super().__init__( BlockChecker( gates=permutation_gate_names, block_class=construct_permutation_gate, ), do_commutative_analysis=do_commutative_analysis, split_blocks=True, min_block_size=min_block_size, max_block_size=max_block_size, split_layers=False, collect_from_back=collect_from_back, num_reps=num_reps, )
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Routing and Layout selection with AI""" # import torch # torch.set_num_threads(1) import numpy as np from qiskit import ClassicalRegister, QuantumCircuit from qiskit.converters import circuit_to_dag, dag_to_circuit from qiskit.transpiler import CouplingMap, TranspilerError from qiskit.transpiler.basepasses import TransformationPass from qiskit.transpiler.layout import Layout from qiskit_transpiler_service.wrappers import AIRoutingAPI class AIRouting(TransformationPass): """AIRouting(backend_name: str | None = None, coupling_map: list[list[int]] | None = None, optimization_level: int = 2, layout_mode: str = "OPTIMIZE") The `AIRouting` pass acts both as a layout stage and a routing stage. :param backend_name: Name of the backend used for doing the transpilation. :type backend_name: str, optional :param coupling_map: A list of pairs that represents physical links between qubits. :type coupling_map: list[list[int]], optional :param optimization_level: With a range from 1 to 3, determines the computational effort to spend in the process (higher usually gives better results but takes longer), defaults to 2. :type optimization_level: int :param layout_mode: Specifies how to handle the layout selection. There are 3 layout modes: keep (respects the layout set by the previous transpiler passes), improve (uses the layout set by the previous transpiler passes as a starting point) and optimize (ignores previous layout selections), defaults to `OPTIMIZE`. :type layout_mode: str """ def __init__( self, backend_name=None, coupling_map=None, optimization_level: int = 2, layout_mode: str = "OPTIMIZE", ): super().__init__() if backend_name is not None and coupling_map is not None: raise ValueError( f"ERROR. Both backend_name and coupling_map were specified as options. Please just use one of them." ) if backend_name is not None: self.backend = backend_name elif coupling_map is not None: if isinstance(coupling_map, CouplingMap): self.backend = list(coupling_map.get_edges()) elif isinstance(coupling_map, list): self.backend = coupling_map else: raise ValueError( f"ERROR. coupling_map should either be a list of int tuples or a Qiskit CouplingMap object." ) else: raise ValueError(f"ERROR. Either backend_name OR coupling_map must be set.") self.optimization_level = optimization_level if layout_mode is not None and layout_mode.upper() not in [ "KEEP", "OPTIMIZE", "IMPROVE", ]: raise ValueError( f"ERROR. Unknown ai_layout_mode: {layout_mode}. Valid modes: 'KEEP', 'OPTIMIZE', 'IMPROVE'" ) self.layout_mode = layout_mode.upper() self.service = AIRoutingAPI() def run(self, dag): """Run the AIRouting pass on `dag`. Args: dag (DAGCircuit): the directed acyclic graph to be mapped. Returns: DAGCircuit: A dag mapped to be compatible with the coupling_map. Raises: TranspilerError: if the coupling map or the layout are not compatible with the DAG, or if the coupling_map=None """ if len(dag.qregs) != 1 or dag.qregs.get("q", None) is None: raise TranspilerError("AIRouting runs on physical circuits only") # Pass dag to circuit for sending to AIRouting qc = dag_to_circuit(dag) # Remove measurements before sending to AIRouting # TODO: Fix this for mid-circuit measurements cregs = [] measurements = [] if len(qc.cregs) > 0: cregs = qc.cregs.copy() measurements = [g for g in qc if g.operation.name == "measure"] qc.remove_final_measurements(inplace=True) routed_qc, init_layout, final_layout = self.service.routing( qc, self.backend, self.optimization_level, False, self.layout_mode, ) # TODO: Improve this nq = max(init_layout) + 1 routed_qc = QuantumCircuit(nq).compose( routed_qc, qubits=range(routed_qc.num_qubits) ) # Restore final measurements if they were removed if len(measurements) > 0: meas_qubits = [final_layout[g.qubits[0]._index] for g in measurements] routed_qc.barrier(meas_qubits) for creg in cregs: routed_qc.add_register(creg) for g, q in zip(measurements, meas_qubits): routed_qc.append(g.operation, qargs=(q,), cargs=g.clbits) # Pass routed circuit to dag # TODO: Improve this routed_dag = circuit_to_dag(routed_qc) if routed_qc.num_qubits > dag.num_qubits(): new_dag = copy_dag_metadata(dag, routed_dag) else: new_dag = dag.copy_empty_like() new_dag.compose(routed_dag) qubits = new_dag.qubits input_qubit_mapping = {q: i for i, q in enumerate(qubits)} full_initial_layout = init_layout + sorted( set(range(len(qubits))) - set(init_layout) ) full_final_layout = final_layout + list(range(len(final_layout), len(qubits))) full_final_layout_p = [ full_final_layout[i] for i in np.argsort(full_initial_layout) ] initial_layout_qiskit = Layout(dict(zip(full_initial_layout, qubits))) final_layout_qiskit = Layout(dict(zip(full_final_layout_p, qubits))) self.property_set["layout"] = initial_layout_qiskit self.property_set["original_qubit_indices"] = input_qubit_mapping self.property_set["final_layout"] = final_layout_qiskit return new_dag def add_measurements(circ, qubits): circ.add_register(ClassicalRegister(len(qubits))) circ.barrier() for i, q in enumerate(qubits): circ.measure(q, i) return circ def copy_dag_metadata(dag, target_dag): """Return a copy of self with the same structure but empty. That structure includes: * name and other metadata * global phase * duration * all the qubits and clbits, including the registers. Returns: DAGCircuit: An empty copy of self. """ target_dag.name = dag.name target_dag._global_phase = dag._global_phase target_dag.duration = dag.duration target_dag.unit = dag.unit target_dag.metadata = dag.metadata target_dag._key_cache = dag._key_cache return target_dag
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. import os from urllib.parse import urljoin from qiskit import QuantumCircuit, qasm2, qasm3 from qiskit.qasm2 import QASM2ExportError from .base import QiskitTranspilerService class AIRoutingAPI(QiskitTranspilerService): """A helper class that covers some basic funcionality from the AIRouting API""" def __init__(self): super().__init__("routing") def routing( self, circuit: QuantumCircuit, coupling_map, optimization_level: int = 1, check_result: bool = False, layout_mode: str = "OPTIMIZE", ): is_qasm3 = False try: qasm = qasm2.dumps(circuit) except QASM2ExportError: qasm = qasm3.dumps(circuit) is_qasm3 = True json_args = {"qasm": qasm.replace("\n", " "), "coupling_map": coupling_map} params = { "check_result": check_result, "layout_mode": layout_mode, "optimization_level": optimization_level, } routing_resp = self.request_and_wait( endpoint="routing", body=json_args, params=params ) if routing_resp.get("success"): routed_circuit = ( qasm3.loads(routing_resp["qasm"]) if is_qasm3 else QuantumCircuit.from_qasm_str(routing_resp["qasm"]) ) return ( routed_circuit, routing_resp["layout"]["initial"], routing_resp["layout"]["final"], )
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2023 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. import logging from typing import Union, List from qiskit import QuantumCircuit from qiskit.circuit.library import LinearFunction from qiskit.quantum_info import Clifford from .base import QiskitTranspilerService logging.basicConfig() logging.getLogger(__name__).setLevel(logging.INFO) class AICliffordAPI(QiskitTranspilerService): """A helper class that covers some basic funcionality from the Clifford AI Synthesis API""" def __init__(self): super().__init__("clifford") def transpile( self, circuits: List[Union[QuantumCircuit, Clifford]], backend: str, qargs: List[List[int]], ): transpile_resps = self.request_and_wait( endpoint="transpile", body={ "clifford_dict": [Clifford(circuit).to_dict() for circuit in circuits], "qargs": qargs, }, params={"backend": backend}, ) results = [] for transpile_resp in transpile_resps: if transpile_resp.get("success") and transpile_resp.get("qasm") is not None: results.append(QuantumCircuit.from_qasm_str(transpile_resp.get("qasm"))) else: results.append(None) return results class AILinearFunctionAPI(QiskitTranspilerService): """A helper class that covers some basic funcionality from the Linear Function AI Synthesis API""" def __init__(self): super().__init__("linear_functions") def transpile( self, circuits: List[Union[QuantumCircuit, LinearFunction]], backend: str, qargs: List[List[int]], ): transpile_resps = self.request_and_wait( endpoint="transpile", body={ "clifford_dict": [Clifford(circuit).to_dict() for circuit in circuits], "qargs": qargs, }, params={"backend": backend}, ) results = [] for transpile_resp in transpile_resps: if transpile_resp.get("success") and transpile_resp.get("qasm") is not None: results.append(QuantumCircuit.from_qasm_str(transpile_resp.get("qasm"))) else: results.append(None) return results class AIPermutationAPI(QiskitTranspilerService): """A helper class that covers some basic funcionality from the Permutation AI Synthesis API""" def __init__(self): super().__init__("permutations") def transpile( self, patterns: List[List[int]], backend: str, qargs: List[List[int]], ): transpile_resps = self.request_and_wait( endpoint="transpile", body={"permutation": patterns, "qargs": qargs}, params={"backend": backend}, ) results = [] for transpile_resp in transpile_resps: if transpile_resp.get("success") and transpile_resp.get("qasm") is not None: results.append(QuantumCircuit.from_qasm_str(transpile_resp.get("qasm"))) else: results.append(None) return results
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. import logging from typing import Dict, List, Union, Literal import numpy as np from qiskit import QuantumCircuit, QuantumRegister, qasm2, qasm3 from qiskit.circuit import QuantumCircuit, QuantumRegister, Qubit from qiskit.qasm2 import QASM2ExportError, QASM2ParseError from qiskit.transpiler import TranspileLayout from qiskit.transpiler.layout import Layout from qiskit_transpiler_service.wrappers import QiskitTranspilerService # setting backoff logger to error level to avoid too much logging logging.getLogger("backoff").setLevel(logging.ERROR) logger = logging.getLogger(__name__) class TranspileAPI(QiskitTranspilerService): """A helper class that covers some basic funcionality from the Qiskit Transpiler API""" def __init__(self): super().__init__() def transpile( self, circuits: Union[ Union[List[str], str], Union[List[QuantumCircuit], QuantumCircuit] ], optimization_level: int = 1, backend: Union[str, None] = None, coupling_map: Union[List[List[int]], None] = None, ai: Literal["true", "false", "auto"] = "true", qiskit_transpile_options: Dict = None, ai_layout_mode: str = None, ): circuits = circuits if isinstance(circuits, list) else [circuits] qasm_circuits = [_input_to_qasm(circ) for circ in circuits] json_args = { "qasm_circuits": qasm_circuits, } if qiskit_transpile_options is not None: json_args["qiskit_transpile_options"] = qiskit_transpile_options if coupling_map is not None: json_args["backend_coupling_map"] = coupling_map params = { "backend": backend, "optimization_level": optimization_level, "ai": ai, } if ai_layout_mode is not None: params["ai_layout_mode"] = ai_layout_mode transpile_resp = self.request_and_wait( endpoint="transpile", body=json_args, params=params ) logger.debug(f"transpile_resp={transpile_resp}") transpiled_circuits = [] for res, orig_circ in zip(transpile_resp, circuits): try: transpiled_circuits.append(_get_circuit_from_result(res, orig_circ)) except Exception as ex: logger.error("Error transforming the result to a QuantumCircuit object") raise return ( transpiled_circuits if len(transpiled_circuits) > 1 else transpiled_circuits[0] ) def benchmark( self, circuits: Union[ Union[List[str], str], Union[List[QuantumCircuit], QuantumCircuit] ], backend: str, optimization_level: int = 1, qiskit_transpile_options: Dict = None, ): raise Exception("Not implemented") def _input_to_qasm(input_circ: Union[QuantumCircuit, str]): if isinstance(input_circ, QuantumCircuit): try: qasm = qasm2.dumps(input_circ).replace("\n", " ") except QASM2ExportError: qasm = qasm3.dumps(input_circ).replace("\n", " ") elif isinstance(input_circ, str): qasm = input_circ.replace("\n", " ") else: raise TypeError("Input circuits must be QuantumCircuit or qasm string.") return qasm def _get_circuit_from_result(transpile_resp, orig_circuit): transpiled_circuit = _get_circuit_from_qasm(transpile_resp["qasm"]) init_layout = transpile_resp["layout"]["initial"] final_layout = transpile_resp["layout"]["final"] orig_circuit = ( _get_circuit_from_qasm(orig_circuit) if isinstance(orig_circuit, str) else orig_circuit ) transpiled_circuit = QuantumCircuit(len(init_layout)).compose(transpiled_circuit) transpiled_circuit._layout = _create_transpile_layout( init_layout, final_layout, transpiled_circuit, orig_circuit ) return transpiled_circuit def _create_initial_layout(initial, n_used_qubits): """Create initial layout using the initial index layout and the number of active qubits.""" total_qubits = len(initial) q_total = n_used_qubits a_total = total_qubits - q_total initial_layout = Layout() for q in range(q_total): initial_layout.add(initial[q], Qubit(QuantumRegister(q_total, "q"), q)) for a in range(q_total, total_qubits): initial_layout.add( initial[a], Qubit(QuantumRegister(a_total, "ancilla"), a - q_total) ) return initial_layout def _create_input_qubit_mapping(qubits_used, total_qubits): """Create input qubit mapping with the number of active qubits and the total number of qubits.""" input_qubit_mapping = { Qubit(QuantumRegister(qubits_used, "q"), q): q for q in range(qubits_used) } input_ancilla_mapping = { Qubit( QuantumRegister(total_qubits - qubits_used, "ancilla"), q - qubits_used ): q for q in range(qubits_used, total_qubits) } input_qubit_mapping.update(input_ancilla_mapping) return input_qubit_mapping def _create_final_layout(initial, final, circuit): """Create final layout with the initial and final index layout and the circuit.""" final_layout = Layout() q_total = len(initial) q_reg = QuantumRegister(q_total, "q") for i, j in zip(final, initial): q_index = circuit.find_bit(Qubit(q_reg, j)).index qubit = circuit.qubits[q_index] final_layout.add(i, qubit) return final_layout def _create_transpile_layout(initial, final, circuit, orig_circuit): """Build the full transpile layout.""" n_used_qubits = orig_circuit.num_qubits return TranspileLayout( initial_layout=_create_initial_layout( initial=initial, n_used_qubits=n_used_qubits ), # final=final), input_qubit_mapping=_create_input_qubit_mapping( qubits_used=n_used_qubits, total_qubits=len(initial) ), final_layout=_create_final_layout( initial=initial, final=final, circuit=circuit ), _input_qubit_count=n_used_qubits, _output_qubit_list=circuit.qubits, ) def _get_circuit_from_qasm(qasm_string): try: return qasm2.loads( qasm_string, custom_instructions=qasm2.LEGACY_CUSTOM_INSTRUCTIONS, ) except QASM2ParseError: return qasm3.loads(qasm_string)
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Unit-testing Transpiler Service""" import numpy as np import pytest from qiskit import QuantumCircuit, qasm2, qasm3 from qiskit.circuit.library import IQP, EfficientSU2, QuantumVolume from qiskit.circuit.random import random_circuit from qiskit.compiler import transpile from qiskit.quantum_info import SparsePauliOp, random_hermitian from qiskit_transpiler_service.transpiler_service import TranspilerService from qiskit_transpiler_service.wrappers import _get_circuit_from_result @pytest.mark.parametrize( "optimization_level", [1, 2, 3], ids=["opt_level_1", "opt_level_2", "opt_level_3"] ) @pytest.mark.parametrize("ai", ["false", "true"], ids=["no_ai", "ai"]) @pytest.mark.parametrize( "qiskit_transpile_options", [None, {"seed_transpiler": 0}], ids=["no opt", "one option"], ) def test_rand_circ_backend_routing(optimization_level, ai, qiskit_transpile_options): backend_name = "ibm_brisbane" random_circ = random_circuit(5, depth=3, seed=42) cloud_transpiler_service = TranspilerService( backend_name=backend_name, ai=ai, optimization_level=optimization_level, qiskit_transpile_options=qiskit_transpile_options, ) transpiled_circuit = cloud_transpiler_service.run(random_circ) assert isinstance(transpiled_circuit, QuantumCircuit) @pytest.mark.parametrize( "optimization_level", [1, 2, 3], ids=["opt_level_1", "opt_level_2", "opt_level_3"] ) @pytest.mark.parametrize("ai", ["false", "true"], ids=["no_ai", "ai"]) @pytest.mark.parametrize( "qiskit_transpile_options", [None, {"seed_transpiler": 0}], ids=["no opt", "one option"], ) def test_qv_backend_routing(optimization_level, ai, qiskit_transpile_options): backend_name = "ibm_brisbane" qv_circ = QuantumVolume(27, depth=3, seed=42).decompose(reps=3) cloud_transpiler_service = TranspilerService( backend_name=backend_name, ai=ai, optimization_level=optimization_level, qiskit_transpile_options=qiskit_transpile_options, ) transpiled_circuit = cloud_transpiler_service.run(qv_circ) assert isinstance(transpiled_circuit, QuantumCircuit) @pytest.mark.parametrize( "coupling_map", [ [[0, 1], [1, 2], [2, 3], [3, 4], [4, 5]], [[0, 1], [1, 2], [2, 3], [3, 4], [4, 5], [5, 6], [6, 7]], ], ) @pytest.mark.parametrize("optimization_level", [1, 2, 3]) @pytest.mark.parametrize("ai", ["false", "true"], ids=["no_ai", "ai"]) @pytest.mark.parametrize("qiskit_transpile_options", [None, {"seed_transpiler": 0}]) def test_rand_circ_cmap_routing( coupling_map, optimization_level, ai, qiskit_transpile_options ): random_circ = random_circuit(5, depth=3, seed=42).decompose(reps=3) cloud_transpiler_service = TranspilerService( coupling_map=coupling_map, ai=ai, optimization_level=optimization_level, qiskit_transpile_options=qiskit_transpile_options, ) transpiled_circuit = cloud_transpiler_service.run(random_circ) assert isinstance(transpiled_circuit, QuantumCircuit) def test_qv_circ_several_circuits_routing(): qv_circ = QuantumVolume(5, depth=3, seed=42).decompose(reps=3) cloud_transpiler_service = TranspilerService( backend_name="ibm_brisbane", ai="true", optimization_level=1, ) transpiled_circuit = cloud_transpiler_service.run([qv_circ] * 2) for circ in transpiled_circuit: assert isinstance(circ, QuantumCircuit) transpiled_circuit = cloud_transpiler_service.run([qasm2.dumps(qv_circ)] * 2) for circ in transpiled_circuit: assert isinstance(circ, QuantumCircuit) transpiled_circuit = cloud_transpiler_service.run([qasm2.dumps(qv_circ), qv_circ]) for circ in transpiled_circuit: assert isinstance(circ, QuantumCircuit) def test_qv_circ_wrong_input_routing(): qv_circ = QuantumVolume(5, depth=3, seed=42).decompose(reps=3) cloud_transpiler_service = TranspilerService( backend_name="ibm_brisbane", ai="true", optimization_level=1, ) circ_dict = {"a": qv_circ} with pytest.raises(TypeError): cloud_transpiler_service.run(circ_dict) @pytest.mark.parametrize("ai", ["false", "true"], ids=["no_ai", "ai"]) def test_transpile_layout_reconstruction(ai): n_qubits = 27 mat = np.real(random_hermitian(n_qubits, seed=1234)) circuit = IQP(mat) observable = SparsePauliOp("Z" * n_qubits) cloud_transpiler_service = TranspilerService( backend_name="ibm_brisbane", ai=ai, optimization_level=1, ) transpiled_circuit = cloud_transpiler_service.run(circuit) # This fails if initial layout is not correct try: observable.apply_layout(transpiled_circuit.layout) except Exception: pytest.fail( "This should not fail. Probably something wrong with the reconstructed layout." ) def test_transpile_non_valid_backend(): circuit = EfficientSU2(100, entanglement="circular", reps=1).decompose() non_valid_backend_name = "ibm_torin" transpiler_service = TranspilerService( backend_name=non_valid_backend_name, ai="false", optimization_level=3, ) try: transpiler_service.run(circuit) pytest.fail("Error expected") except Exception as e: assert ( str(e) == f'"User doesn\'t have access to the specified backend: {non_valid_backend_name}"' ) def test_transpile_exceed_circuit_size(): circuit = EfficientSU2(100, entanglement="circular", reps=50).decompose() transpiler_service = TranspilerService( backend_name="ibm_kyoto", ai="false", optimization_level=3, ) try: transpiler_service.run(circuit) pytest.fail("Error expected") except Exception as e: assert str(e) == "'Circuit has more gates than the allowed maximum of 5000.'" def test_transpile_malformed_body(): circuit = EfficientSU2(100, entanglement="circular", reps=1).decompose() transpiler_service = TranspilerService( backend_name="ibm_kyoto", ai="false", optimization_level=3, qiskit_transpile_options={"failing_option": 0}, ) try: transpiler_service.run(circuit) pytest.fail("Error expected") except Exception as e: assert ( str(e) == "\"transpile() got an unexpected keyword argument 'failing_option'\"" ) def test_transpile_failing_task(): open_qasm_circuit = 'OPENQASM 2.0;\ninclude "qelib1.inc";\ngate dcx q0,q1 { cx q0,q1; cx q1,q0; }\nqreg q[3];\ncz q[0],q[2];\nsdg q[1];\ndcx q[2],q[1];\nu3(3.890139082217223,3.447697582994976,1.1583481971959322) q[0];\ncrx(2.3585459177723522) q[1],q[0];\ny q[2];' circuit = QuantumCircuit.from_qasm_str(open_qasm_circuit) transpiler_service = TranspilerService( backend_name="ibm_kyoto", ai="false", optimization_level=3, coupling_map=[[1, 2], [2, 1]], qiskit_transpile_options={ "basis_gates": ["u1", "u2", "u3", "cx"], "seed_transpiler": 0, }, ) try: transpiler_service.run(circuit) pytest.fail("Error expected") except Exception as e: assert "The background task" in str(e) assert "FAILED" in str(e) def compare_layouts(plugin_circ, non_ai_circ): assert ( plugin_circ.layout.initial_layout == non_ai_circ.layout.initial_layout ), "initial_layouts differs" assert ( plugin_circ.layout.initial_index_layout() == non_ai_circ.layout.initial_index_layout() ), "initial_index_layout differs" assert ( plugin_circ.layout.input_qubit_mapping == non_ai_circ.layout.input_qubit_mapping ), "input_qubit_mapping differs" assert ( plugin_circ.layout._input_qubit_count == non_ai_circ.layout._input_qubit_count ), "_input_qubit_count differs" assert ( plugin_circ.layout._output_qubit_list == non_ai_circ.layout._output_qubit_list ), "_output_qubit_list differs" # Sometimes qiskit transpilation does not add final_layout if non_ai_circ.layout.final_layout: assert ( plugin_circ.layout.final_layout == non_ai_circ.layout.final_layout ), "final_layout differs" assert ( plugin_circ.layout.final_index_layout() == non_ai_circ.layout.final_index_layout() ), "final_index_layout differs" def get_circuit_as_in_service(circuit): return { "qasm": qasm3.dumps(circuit), "layout": { "initial": circuit.layout.initial_index_layout(), "final": circuit.layout.final_index_layout(False), }, } def transpile_and_check_layout(cmap, circuit): non_ai_circ = transpile( circuits=circuit, coupling_map=cmap, optimization_level=1, ) service_resp = get_circuit_as_in_service(non_ai_circ) plugin_circ = _get_circuit_from_result(service_resp, circuit) compare_layouts(plugin_circ, non_ai_circ) def test_layout_construction_no_service(backend, cmap_backend): for n_qubits in [5, 10, 15, 20, 27]: circuit = random_circuit(n_qubits, 4, measure=True) transpile_and_check_layout(cmap_backend[backend], circuit) for n_qubits in [5, 10, 15, 20, 27]: circuit = EfficientSU2(n_qubits, entanglement="circular", reps=1).decompose() transpile_and_check_layout(cmap_backend[backend], circuit) for n_qubits in [5, 10, 15, 20, 27]: circuit = QuantumCircuit(n_qubits) circuit.cx(0, 1) circuit.cx(1, 2) circuit.h(4) transpile_and_check_layout(cmap_backend[backend], circuit)
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. import numpy as np import pytest from qiskit import QuantumCircuit from qiskit.circuit.library import QuantumVolume from qiskit.quantum_info import random_clifford from qiskit.transpiler.preset_passmanagers import generate_preset_pass_manager def create_random_circuit(total_n_ubits, cliffords_n_qubits, clifford_num): circuit = QuantumCircuit(total_n_ubits) nq = cliffords_n_qubits for c in range(clifford_num): qs = np.random.choice(range(circuit.num_qubits), size=nq, replace=False) circuit.compose( random_clifford(nq, seed=42).to_circuit(), qubits=qs.tolist(), inplace=True ) for q in qs: circuit.t(q) return circuit def create_linear_circuit(n_qubits, gates): circuit = QuantumCircuit(n_qubits) for q in range(n_qubits - 1): if gates == "cx": circuit.cx(q, q + 1) elif gates == "swap": circuit.swap(q, q + 1) elif gates == "cz": circuit.cz(q, q + 1) elif gates == "rzz": circuit.rzz(1.23, q, q + 1) return circuit @pytest.fixture(scope="module") def random_circuit_transpiled(backend, cmap_backend): circuit = create_random_circuit(27, 4, 2) qiskit_lvl3_transpiler = generate_preset_pass_manager( optimization_level=3, coupling_map=cmap_backend[backend] ) return qiskit_lvl3_transpiler.run(circuit) @pytest.fixture(scope="module") def qv_circ(): return QuantumVolume(10, depth=3, seed=42).decompose(reps=1) @pytest.fixture(scope="module", params=[3, 10, 30]) def cnot_circ(request): return create_linear_circuit(request.param, "cx") @pytest.fixture(scope="module", params=[3, 10, 30]) def swap_circ(request): return create_linear_circuit(request.param, "swap") @pytest.fixture(scope="module", params=[3, 10, 30]) def cz_circ(request): return create_linear_circuit(request.param, "cz") @pytest.fixture(scope="module", params=[3, 10, 30]) def rzz_circ(request): return create_linear_circuit(request.param, "rzz")
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Unit-testing clifford_ai""" from qiskit import QuantumCircuit from qiskit.transpiler import PassManager from qiskit_transpiler_service.ai.collection import CollectCliffords from qiskit_transpiler_service.ai.synthesis import AICliffordSynthesis def test_clifford_function(random_circuit_transpiled, backend): ai_optimize_lf = PassManager( [ CollectCliffords(), AICliffordSynthesis(backend_name=backend), ] ) ai_optimized_circuit = ai_optimize_lf.run(random_circuit_transpiled) assert isinstance(ai_optimized_circuit, QuantumCircuit) def test_clifford_wrong_backend(random_circuit_transpiled, caplog): ai_optimize_lf = PassManager( [ CollectCliffords(), AICliffordSynthesis(backend_name="wrong_backend"), ] ) ai_optimized_circuit = ai_optimize_lf.run(random_circuit_transpiled) assert "couldn't synthesize the circuit" in caplog.text assert "Keeping the original circuit" in caplog.text assert isinstance(ai_optimized_circuit, QuantumCircuit)
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Unit-testing linear_function_collection""" from qiskit import QuantumCircuit from qiskit.transpiler import PassManager from qiskit_transpiler_service.ai.collection import CollectCliffords def test_clifford_collection_pass(random_circuit_transpiled): collect = PassManager( [ CollectCliffords(), ] ) collected_circuit = collect.run(random_circuit_transpiled) assert isinstance(collected_circuit, QuantumCircuit) def test_clifford_collection_pass_collect(cz_circ): collect = PassManager( [ CollectCliffords(min_block_size=1, max_block_size=5), ] ) collected_circuit = collect.run(cz_circ) assert isinstance(collected_circuit, QuantumCircuit) assert any(g.operation.name.lower() == "clifford" for g in collected_circuit) def test_clifford_collection_pass_no_collect(rzz_circ): collect = PassManager( [ CollectCliffords(min_block_size=7, max_block_size=12), ] ) collected_circuit = collect.run(rzz_circ) assert all(g.operation.name.lower() != "clifford" for g in collected_circuit) def test_clifford_collection_max_block_size(cz_circ): collect = PassManager( [ CollectCliffords(max_block_size=7), ] ) collected_circuit = collect.run(cz_circ) assert all(len(g.qubits) <= 7 for g in collected_circuit) def test_clifford_collection_min_block_size(cz_circ): collect = PassManager( [ CollectCliffords(min_block_size=7, max_block_size=12), ] ) collected_circuit = collect.run(cz_circ) assert all( len(g.qubits) >= 7 or g.operation.name.lower() != "clifford" for g in collected_circuit )
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Unit-testing linear_function_ai""" import pytest from qiskit import QuantumCircuit from qiskit.transpiler import PassManager from qiskit_transpiler_service.ai.collection import CollectLinearFunctions from qiskit_transpiler_service.ai.synthesis import AILinearFunctionSynthesis def test_linear_function_pass(random_circuit_transpiled, backend, caplog): ai_optimize_lf = PassManager( [ CollectLinearFunctions(), AILinearFunctionSynthesis(backend_name=backend), ] ) ai_optimized_circuit = ai_optimize_lf.run(random_circuit_transpiled) assert isinstance(ai_optimized_circuit, QuantumCircuit) def test_linear_function_wrong_backend(caplog): circuit = QuantumCircuit(10) for i in range(8): circuit.cx(i, i + 1) for i in range(8): circuit.h(i) for i in range(8): circuit.cx(i, i + 1) ai_optimize_lf = PassManager( [ CollectLinearFunctions(), AILinearFunctionSynthesis(backend_name="a_wrong_backend"), ] ) ai_optimized_circuit = ai_optimize_lf.run(circuit) assert "couldn't synthesize the circuit" in caplog.text assert "Keeping the original circuit" in caplog.text assert isinstance(ai_optimized_circuit, QuantumCircuit) def test_linear_always_replace(backend, caplog): orig_qc = QuantumCircuit(3) orig_qc.cx(0, 1) orig_qc.cx(1, 2) ai_optimize_lf = PassManager( [ CollectLinearFunctions(), AILinearFunctionSynthesis( backend_name=backend, replace_only_if_better=False ), ] ) ai_optimized_circuit = ai_optimize_lf.run(orig_qc) assert "Keeping the original circuit" not in caplog.text assert isinstance(ai_optimized_circuit, QuantumCircuit) def test_linear_function_only_replace_if_better(backend, caplog): orig_qc = QuantumCircuit(3) orig_qc.cx(0, 1) orig_qc.cx(1, 2) ai_optimize_lf = PassManager( [ CollectLinearFunctions(min_block_size=2), AILinearFunctionSynthesis(backend_name=backend), ] ) ai_optimized_circuit = ai_optimize_lf.run(orig_qc) assert ai_optimized_circuit == orig_qc assert "Keeping the original circuit" in caplog.text assert isinstance(ai_optimized_circuit, QuantumCircuit)
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Unit-testing linear_function_collection""" import pytest from qiskit import QuantumCircuit from qiskit.transpiler import PassManager from qiskit_transpiler_service.ai.collection import CollectLinearFunctions def test_lf_collection_pass(random_circuit_transpiled): collect = PassManager( [ CollectLinearFunctions(), ] ) collected_circuit = collect.run(random_circuit_transpiled) assert isinstance(collected_circuit, QuantumCircuit) def test_lf_collection_pass_collect(cnot_circ): collect = PassManager( [ CollectLinearFunctions(min_block_size=1, max_block_size=5), ] ) collected_circuit = collect.run(cnot_circ) assert isinstance(collected_circuit, QuantumCircuit) assert any(g.operation.name.lower() == "linear_function" for g in collected_circuit) def test_lf_collection_pass_no_collect(rzz_circ): collect = PassManager( [ CollectLinearFunctions(min_block_size=7, max_block_size=12), ] ) collected_circuit = collect.run(rzz_circ) assert all(g.operation.name.lower() != "linear_function" for g in collected_circuit) def test_lf_collection_max_block_size(cnot_circ): collect = PassManager( [ CollectLinearFunctions(max_block_size=7), ] ) collected_circuit = collect.run(cnot_circ) assert all(len(g.qubits) <= 7 for g in collected_circuit) def test_lf_collection_min_block_size(cnot_circ): collect = PassManager( [ CollectLinearFunctions(min_block_size=7, max_block_size=12), ] ) collected_circuit = collect.run(cnot_circ) assert all( len(g.qubits) >= 7 or g.operation.name.lower() != "linear_function" for g in collected_circuit ) @pytest.mark.timeout(10) def test_collection_with_barrier(cnot_circ): cnot_circ.measure_all() collect = PassManager( [ CollectLinearFunctions(min_block_size=7, max_block_size=12), ] ) # Without proper handling this test timeouts (actually the collect runs forever) collect.run(cnot_circ)
https://github.com/Qiskit/qiskit-transpiler-service
Qiskit
# -*- coding: utf-8 -*- # (C) Copyright 2024 IBM. All Rights Reserved. # # This code is licensed under the Apache License, Version 2.0. You may # obtain a copy of this license in the LICENSE.txt file in the root directory # of this source tree or at http://www.apache.org/licenses/LICENSE-2.0. # # Any modifications or derivative works of this code must retain this # copyright notice, and modified files need to carry a notice indicating # that they have been altered from the originals. """Unit-testing permutation_ai""" import pytest from qiskit import QuantumCircuit from qiskit.transpiler import PassManager from qiskit.transpiler.preset_passmanagers import generate_preset_pass_manager from qiskit_transpiler_service.ai.collection import CollectPermutations from qiskit_transpiler_service.ai.synthesis import AIPermutationSynthesis @pytest.fixture def permutations_circuit(backend, cmap_backend): coupling_map = cmap_backend[backend] cmap = list(coupling_map.get_edges()) orig_qc = QuantumCircuit(27) for i, j in cmap: orig_qc.h(i) orig_qc.cx(i, j) for i, j in cmap: orig_qc.swap(i, j) for i, j in cmap: orig_qc.h(i) orig_qc.cx(i, j) for i, j in cmap[:4]: orig_qc.swap(i, j) for i, j in cmap: orig_qc.cx(i, j) return orig_qc def test_permutation_collector(permutations_circuit, backend, cmap_backend): qiskit_lvl3_transpiler = generate_preset_pass_manager( optimization_level=1, coupling_map=cmap_backend[backend] ) permutations_circuit = qiskit_lvl3_transpiler.run(permutations_circuit) pm = PassManager( [ CollectPermutations(max_block_size=27), ] ) perm_only_circ = pm.run(permutations_circuit) from qiskit.converters import circuit_to_dag dag = circuit_to_dag(perm_only_circ) perm_nodes = dag.named_nodes("permutation", "Permutation") assert len(perm_nodes) == 2 assert perm_nodes[0].op.num_qubits == 27 assert perm_nodes[1].op.num_qubits == 4 assert not dag.named_nodes("linear_function", "Linear_function") assert not dag.named_nodes("clifford", "Clifford") def test_permutation_pass(permutations_circuit, backend, cmap_backend, caplog): qiskit_lvl3_transpiler = generate_preset_pass_manager( optimization_level=1, coupling_map=cmap_backend[backend] ) permutations_circuit = qiskit_lvl3_transpiler.run(permutations_circuit) ai_optimize_lf = PassManager( [ CollectPermutations(max_block_size=27), AIPermutationSynthesis(backend_name=backend), ] ) ai_optimized_circuit = ai_optimize_lf.run(permutations_circuit) assert "Using the synthesized circuit" in caplog.text assert isinstance(ai_optimized_circuit, QuantumCircuit) def test_permutation_wrong_backend(caplog): orig_qc = QuantumCircuit(3) orig_qc.swap(0, 1) orig_qc.swap(1, 2) ai_optimize_lf = PassManager( [ CollectPermutations(min_block_size=2, max_block_size=27), AIPermutationSynthesis(backend_name="a_wrong_backend"), ] ) ai_optimized_circuit = ai_optimize_lf.run(orig_qc) assert "couldn't synthesize the circuit" in caplog.text assert "Keeping the original circuit" in caplog.text assert isinstance(ai_optimized_circuit, QuantumCircuit)