sentence1 string | sentence2 string | labels int64 |
|---|---|---|
L-gulono-1,4-lactone is the furanose form of gulonolactone having L-configuration. It has a role as a human metabolite and a mouse metabolite. It is functionally related to a L-gulonic acid. | CC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC2=CC=CC=C2)CO | 0 |
N,N-Dimethyldecanamide | CC1(CC(=O)C2=C(O1)C=CC(=C2N)C(=O)CC(CO)N)C | 0 |
2-Bromodecanoic acid | CC(CO)OCC(C)OCC(C)OCC(C)O | 0 |
Harmalol | CN1CCCC1C2=CC=CC=N2 | 0 |
Taurodehydrocholic acid | C[C@@]12[C@H](CC[C@@]3([C@@H]1[C@@H]([C@]45[C@H]3CC[C@H](C4)C(=C)C5)C(=O)O)OC2=O)O | 0 |
1-Hexadecanoyl-2-octadecanoyl-sn-glycero-3-phospho-(1'-sn-glycerol) | CCCCCCCCCCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C | 0 |
Butyrylthiocholine | CCCCCCCC(CCCC)C1=CC=CC=C1 | 0 |
Garbanzol is a member of the class of dihydroflavonols that is (2S)-flavanone substituted by hydroxy groups at positions 3, 7 and 4'. It has a role as an antimutagen and a metabolite. It is a trihydroxyflavanone, a member of dihydroflavonols, a secondary alpha-hydroxy ketone and a member of 4'-hydroxyflavanones. | CCCCCCCCCCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](CO)O)OC(=O)CCCCCCCCCCCCCCC | 0 |
Picropodophyllin | CC(C)[C@@H](C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCN=C(N)N)N | 0 |
Petrosterol | CCOC(=O)O[C@@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)C=C[C@]34C)O)C)C(=O)OCCl | 0 |
Histidylphenylalanine | CC(=O)NC1=C(C(=C(C(=C1I)C(=O)N[C@@H]2[C@H]([C@@H]([C@H](OC2O)CO)O)O)I)N(C)C(=O)C)I | 0 |
(2r)-3-(Hexadecyloxy)-2-methoxypropyl 2-(trimethylammonio)ethyl phosphate | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=CC(=O)CC[C@]34O | 0 |
Lovastatin | C[C@]12CCCC[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4[N+](=O)[O-])C | 0 |
6beta,17-Dimethyl-5alpha-androstane-3beta,17beta-diol is a 3-hydroxy steroid. It has a role as an androgen. | CC(=O)[C@H]1CC[C@@H]2[C@@]1(C[C@@H]3[C@]4([C@H]2CCC5=CC(=O)CC[C@@]54C)O3)C | 0 |
2-[2-methoxy-4-(methylthio)phenyl]-3H-imidazo[4,5-c]pyridine is a member of imidazoles. | COC1=C(C(=C2COC3=CC(=CC4=C3C2=C1CC4)O)O)OC | 0 |
(6R,7R)-3-[(4-carbamoyl-1-pyridin-1-iumyl)methyl]-8-oxo-7-[(1-oxo-2-thiophen-2-ylethyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | C[C@@H]1C[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CCC2=CC1=O)CC[C@@H]4C(=O)C)C)C | 0 |
N-Acetyl-L-leucyl-L-isoleucylglycyl-L-valyl-N-methyl-L-prolinamide is an oligopeptide. | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C | 0 |
Megestrol | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1NC(=O)C[C@@H](C(=O)O)N)CO)O)O | 0 |
4-Nitrophenyl-3-ketovalidamine | C1=CC(=C(C=C1[C@H]2[C@H](C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O | 0 |
Pentamethylbenzene | CC1=CC(=C(C(=C1C(=O)OC)O)C)O | 0 |
Tetrahydrodeoxycortisol | C[C@]12CC[C@H](C[C@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O | 1 |
Chlorpyrifos is an organic thiophosphate that is O,O-diethyl hydrogen phosphorothioate in which the hydrogen of the hydroxy group has been replaced by a 3,5,6-trichloropyridin-2-yl group. It has a role as an EC 3.1.1.7 (acetylcholinesterase) inhibitor, an agrochemical, an EC 3.1.1.8 (cholinesterase) inhibitor, an environmental contaminant, a xenobiotic, an acaricide and an insecticide. It is an organic thiophosphate and a chloropyridine. | C(N[N+](=O)[O-])N[N+](=O)[O-] | 0 |
Jietacin B is an azoxy compound. | C1=CC(=CC=C1C(=O)NP(=O)(N)N)F | 0 |
19-Chloro-3beta-hydroxyandrost-5-en-17-one acetate | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(C(=O)C=C3[C@H]2CC[C@H]4[C@@]3(CC[C@@H](C4)O)C)C | 0 |
17beta-Hydroxyestr-5(10)-en-3-one acetate is a steroid ester. | CC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C3CCC(=O)C4)C | 1 |
Adenosine 5'-[alpha,beta-methylene]triphosphate is a nucleoside triphosphate analogue. | CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC([C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)O)C)O | 0 |
3-Methylbutyl heptanoate | CN1C2CCC1CC(C2)OC(C3=CC=CC=C3)C4=CC=CC=C4 | 0 |
Solanidine | C1[C@H](OC2=C(C1=O)C=CC(=C2)O)C3=CC=C(C=C3)O | 0 |
1-Naphthaleneacetamide | CSC1=C(C(=O)C(=C(C1=O)SC)SC)SC | 0 |
2,6-di-O-phosphono-beta-D-fructofuranose | C[C@H]1C[C@@H]2[C@@H]([C@@H](C(=O)O2)C)[C@@H](C3=C(C(=O)C[C@H]13)C)O | 0 |
Epimelibiose is a alpha-D-Manp-(1->6)-D-Galp in which the carbon bearing the anomeric hydroxy group has alpha configuration. It has a role as a plant metabolite and a mouse metabolite. | C[C@]12CC[C@H]3[C@H]([C@@H]1CC=C2)CCC4=C3C=CC(=C4)O | 0 |
8-Propanoylneosolaniol is a trichothecene. | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)F)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)O | 0 |
(25R)-cholest-5-ene-3beta,26-diol is a 26-hydroxycholesterol in which the 25-position has R-configuration. It has a role as an apoptosis inducer, a neuroprotective agent, a human metabolite and a mouse metabolite. It is functionally related to a cholesterol. | CC(=O)[C@H]1CC[C@@H]2[C@@]1([C@H]([C@@H]([C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)O)Br)C | 0 |
Bucumolol | CC(=CCC1=C(C=C2C(=C1)C=CC(=O)O2)OC)C | 0 |
Linifolin A is a sesquiterpene lactone. | C[C@@H]1C[C@H]2[C@H]([C@H]([C@]3([C@H]1C=CC3=O)C)OC(=O)C)C(=C)C(=O)O2 | 1 |
Gallium Citrate Ga-67 | CC(C)[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)[C@H](CCCCN)N | 0 |
Loribid | C1C(=C(N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)C(=O)O)Cl | 0 |
Acesulfame is a sulfamate ester that is 1,2,3-oxathiazin-4(3H)-one 2,2-dioxide substituted by a methyl group at position 6. It has a role as a xenobiotic, an environmental contaminant and a sweetening agent. It is a sulfamate ester, an organonitrogen heterocyclic compound, an oxacycle and an organic heteromonocyclic compound. | CC1(C(CCC(O1)(C)C=C)O)C | 0 |
Phomalone is an aromatic ketone. | COC1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3O2 | 0 |
Quinolin-8-ol is a monohydroxyquinoline that is quinoline substituted by a hydroxy group at position 8. Its fungicidal properties are used for the control of grey mould on vines and tomatoes. It has a role as an antibacterial agent, an iron chelator, an antiseptic drug and an antifungal agrochemical. It derives from a hydride of a quinoline. | CC1=CCOC(C1)C=C(C)C | 0 |
2alpha,3alpha-(Difluoromethylene)-5alpha-androstan-17beta-ol acetate is a steroid ester. | C[C@H]1CCC(=O)[C@](C[C@@H]([C@@H]2[C@@H]([C@H]1O)OC(=O)C2=C)OC(=O)C(=C)C)(C)OC(=O)C | 0 |
Medetomidine hydrochloride is a hydrochloride. | CN1C(=O)C=CC=C1C2CCC3=C(C2)C=CC(=C3)OC | 0 |
26-hydroxycholesterol is an oxysterol that is cholesterol substituted at position 26 by a hydroxy group. It has a role as a human metabolite and an EC 3.1.1.1 (carboxylesterase) inhibitor. It is a 26-hydroxy steroid, an oxysterol and a 3beta-hydroxy-Delta(5)-steroid. It is functionally related to a cholesterol. | C1=C(C2=C(N=CN=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N)C#N | 0 |
5-hydroxy-3,4-dihydroquinolin-2(1H)-one | CC1=NC=C(C(=N1)N)CO | 0 |
Santonin | C[C@H]1[C@@H]2CC[C@]3(C=CC(=O)C(=C3[C@H]2OC1=O)C)C | 1 |
6alpha-fluoro-17-hydroxycorticosterone 21-acetate is a steroid ester that is pregn-4-en-21-yl acetate substituted by oxo groups at positions 3 and 20, hydroxy groups at positions 11 and 17 and a fluoro group at position 6. It is a fluorinated steroid, a steroid ester, an acetate ester, an 11beta-hydroxy steroid, a 17alpha-hydroxy steroid, a 3-oxo-Delta(4) steroid, a 20-oxo steroid and a tertiary alpha-hydroxy ketone. It derives from a hydride of a pregnane. | CC[C@H]1CCC[C@H](C(=O)NCCC[C@H]([C@@H](CC1)O[C@H]2[C@@H]([C@@H]([C@@H]([C@@H](O2)C)O)N)O)CC)CC | 0 |
4-(Dimethylamino)benzaldehyde | CN(C)C1=CC=C(C=C1)C=O | 1 |
4-Phenyl-2-butyl acetate is a member of benzenes. | CCCCOC(=O)CC(C1=CC=CC=C1)N2CCCCC2 | 0 |
Bitertanol, (R,R)-(+/-)- | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC3=C(C=C2)C(=O)C(=CO3)C4=CC=C(C=C4)O)O)O)O | 0 |
Darunavir is an N,N-disubstituted benzenesulfonamide bearing an unsubstituted amino group at the 4-position, used for the treatment of HIV infection. A second-generation HIV protease inhibitor, darunavir was designed to form robust interactions with the protease enzyme from many strains of HIV, including those from treatment-experienced patients with multiple resistance mutations to other protease inhibitors. It has a role as a HIV protease inhibitor and an antiviral drug. It is a furofuran, a carbamate ester and a sulfonamide. | C1[C@H](C2=C3C=CC4=C(C3=CN=C2C5=CC6=C(C=C51)OCO6)OCO4)O | 0 |
(S)-atropine is an atropine with a 2S-configuration. It is functionally related to a (S)-tropic acid. It is a conjugate base of a (S)-atropinium. | CC1=CC2=C(C3=C([C@@H]([C@H]2O)O)C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC(=C5)O)O)OC)C(=C1C(=O)O)O | 0 |
Mitotane is a diarylmethane. | C=CC1=CN=CC2=C1C(COC2=O)CO | 0 |
2,4,4,6-Tetramethyl-1,4-dihydropyridine-3,5-dicarbonitrile | CCN(CC)C(=S)SSC(=S)N(CC)CC | 0 |
(R,R)-5,11-diethyl-5,6,11,12-tetrahydro-2,8-chrysenediol is a carbotetracyclic compound that is 5,6,11,12-tetrahydrochrysene substituted by hydroxy groups at positions 2 and 8 and by ethyl groups at positions 5 and 11 (the 5R,11R-stereoisomer). It is an agonist of ER-alpha and antagonist of ER-beta receptors. It has a role as an estrogen receptor antagonist, an estrogen receptor agonist, a geroprotector and a neuroprotective agent. It is a carbotetracyclic compound and a polyphenol. | CC[C@@H]1CC2=C(C=CC(=C2)O)C3=C1C4=C(C[C@H]3CC)C=C(C=C4)O | 1 |
Glaucolide A is a carboxylic ester and a ketone. | CC(=O)[C@H]1CC[C@@H]2[C@@]1([C@](C[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)(CCl)O)C | 0 |
Syringaldehyde is a hydroxybenzaldehyde that is 4-hydroxybenzaldehyde substituted by methoxy groups at positions 3 and 5. Isolated from Pisonia aculeata and Panax japonicus var. major, it exhibits hypoglycemic activity. It has a role as a hypoglycemic agent and a plant metabolite. It is a hydroxybenzaldehyde and a dimethoxybenzene. | CCCOP(=O)(OCCC)OC1=CC=C(C=C1)SC | 0 |
Benzonitrile oxide is a nitrile oxide. It is functionally related to a benzonitrile. | C1CN2C(=N1)C3=CC=CC=C3C2(C4=CC=C(C=C4)Cl)O | 0 |
1-[2-(3-Methoxyphenyl)ethyl]-6-oxo-1,6-dihydropyridine-3-carboxylic acid | C1=CC=C2C(=C1)C=NC=N2 | 0 |
6-(alpha-D-glucosaminyl)-1D-myo-inositol | C[C@@]1(CC[C@]2(C(=C[C@@H]3[C@@H]4[C@@]2(CCC[C@@]4(C(=O)O3)C)C)C1)O)CCOS(=O)(=O)[O-] | 0 |
Flurandrenolide | C[C@]12CCC(=O)C=C1[C@H](C[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3C[C@@H]5[C@]4(OC(O5)(C)C)C(=O)CO)C)O)F | 1 |
3-Hydroxybenzoic acid | CC(C)CCOC1=CC=C(C=C1)N | 0 |
3beta-Hydroxy-5alpha-cholest-7-ene-4alpha-carboxylate is a cholestanoid. | C[C@@]12CCC[C@@]([C@H]1CC[C@]34[C@H]2CC[C@@H](C3)C(=C4)CO)(C)C(=O)O | 0 |
2-(2-aminoethyl)phenol is a primary amine. | CC1CCC(=C(C1=O)O)C(C)C | 0 |
3-Fluoro-1-(4-hydroxyphenyl)-1-propanone is a member of acetophenones. | CCOC(=O)CCCCC(=O)OCC | 0 |
(2S)-2-[[(2S,3S)-2-[[(2S)-2-aminopropanoyl]amino]-3-methylpentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(N)O)O)O)N | 0 |
2,4-Dichloroaniline | CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC | 0 |
Mometasone | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H]([C@@H]([C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C | 0 |
9-Fluoro-16alpha-hydroxyandrost-4-ene-3,11,17-trione is a 3-hydroxy steroid. It has a role as an androgen. | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O | 0 |
Dracorubin is a proanthocyanidin isolated from Dracaena draco. It has a role as a plant metabolite. It is a proanthocyanidin and an aromatic ether. | CC1=C2C3=C(C=C(OC3=CC1=O)C4=CC=CC=C4)C5=C6C(=C(C=C5O2)OC)CC[C@H](O6)C7=CC=CC=C7 | 1 |
2,3-DI-Phytanyl-glycerol | CC1=C2[C@@H]([C@@H]3[C@@H](CC1)C(=C)C(=O)O3)C(=CC2=O)CO | 0 |
Teleocidin B-3 is an amino acid amide. | C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4C(=O)CO)C)O | 0 |
AMP-PNP is an adenosine 5'-phosphate. | C1C[C@H]2C=C3[C@@H]4[C@@H]([C@H]2NC1)C5=CC6=C(C=C5CN4CC3O)OCO6 | 0 |
9-Fluoro-17-methyl-5beta-androstane-3alpha,11beta,17beta-triol | CC[C@H](C)[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H]([C@@H](C)CC)C(=O)O)N | 0 |
beta-COLUBRINE | CC(CC1=CC(=C(C=C1)O)O)(C(=O)O)NN.C1=CC(=C(C=C1C[C@@H](C(=O)O)N)O)O | 0 |
3-Hydroxylidocaine is an amino acid amide. | CC1=C(C=CC=C1NC2=C(C=CC=N2)C(=O)O)C(F)(F)F | 0 |
Juliflorine | CC(=C)[C@H]1CC2=C(O1)C=C(C3=C2O[C@@H]4COC5=CC(=C(C=C5[C@@H]4C3=O)OC)OC)O | 0 |
BENZO(a)PYRENE-11,12-DIOL, 11,12-DIHYDRO-, cis- | C1C[C@@H]2[C@H]3C[C@H](CN2C1)C4=CC=CC(=O)N4C3 | 0 |
Pyrimethamine is an aminopyrimidine that is pyrimidine-2,4-diamine which is substituted at position 5 by a p-chlorophenyl group and at position 6 by an ethyl group. It is a folic acid antagonist used as an antimalarial or with a sulfonamide to treat toxoplasmosis. It has a role as an antimalarial, an EC 1.5.1.3 (dihydrofolate reductase) inhibitor and an antiprotozoal drug. It is an aminopyrimidine and a member of monochlorobenzenes. | C1=CC(=CN=C1)CC2=CC3=C(C=C2)OC(=C3)C(=O)O | 0 |
Tetrathiafulvalene is a member of the class of fulvalenes that is ethene substituted by 1,3-dithiol-2-ylidene groups at positions 1 and 2. It is an organosulfur heterocyclic compound and a member of fulvalenes. | CC(CC1=CNC2=C1C=C(C=C2)OC)N | 0 |
S-Decyl GSH is a peptide. | C[C@H]1CCC[C@]2([C@@]13C[C@@]3(CC2)C(C)(C)O)C | 0 |
Diethyl malate | CC1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O | 0 |
Splitomicin | C=CCS(=O)CC(C(=O)O)N | 0 |
Fibrostatin B | C1=C(C2=C(N=CN=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N)C(=O)N | 0 |
Cystathionine | C(NC(=O)N)NC(=O)NCNC(=O)N | 0 |
Annotine is an azaspiro compound. | CC(=O)OCC(=O)[C@H]1CC[C@@H]2[C@@]1(CC=C3C2=CC=C4[C@@]3(CC[C@@H](C4)OC(=O)C)C)C | 0 |
Asn-Gln is a dipeptide composed of L-asparagine and L-glutamine joined by a peptide linkage. It has a role as a metabolite. It is functionally related to a L-asparagine and a L-glutamine. | CN1CCC2=CC3=C(C=C2[C@@H]1[C@H]4C5=C(C(=C(C=C5)OC)OC)C(=O)O4)OCO3 | 0 |
3-Aminobenzamide | CCCOC(=O)C1=C(C(=C(S1)C(=O)OCCC)O)O | 0 |
(S)-versiconol is an optically active form of versiconol having S-configuration. It is a conjugate acid of a (S)-versiconol(1-). | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O | 0 |
Pimprinethine is a member of indoles. | CCOC(=O)CCCCCCCCC(=O)OCC | 0 |
1-Methylnicotinamide | CC(C)(CO)C(C(=O)O)O | 0 |
3,4,5-trimethylphenyl methylcarbamate is a carbamate ester that consists of 3,4,5-trimethylphenol carrying an O-(N-methylcarbamoyl) group. One of two constituents of trimethacarb. It has a role as an agrochemical and an insecticide. It is functionally related to a 3,4,5-trimethylphenol. | COC1=C(C(=CC=C1)OC)OCCNCC2COC3=CC=CC=C3O2 | 0 |
1-Docosene | [O-]S(=O)(=O)SSS(=O)(=O)[O-].[K+].[K+] | 0 |
Naphthalene-1,2-diol is a naphthalenediol. It has a role as a mouse metabolite. | C1=CC=C2C(=C1)C=CC(=C2O)O | 1 |
[4-(1,2-Dihydroxyethyl)-2-methoxyphenyl]oxidanesulfonic acid | C1=CC=C(C=C1)S(=O)(=O)OC2=CC=C(C=C2)Cl | 0 |
5-Bromo-4-chloro-3-indolyl beta-galactoside | C[C@@H]1[C@@H]2[C@H](C(=O)N2C(=C1S[C@H]3C[C@H](NC3)C(=O)NC4=CC=CC(=C4)C(=O)O)C(=O)O)[C@@H](C)O | 0 |
Bis(2-ethylhexyl) amine is a secondary amino compound. | C[CH2-].[Mg+2].[Cl-] | 0 |
4-Hydroxymethyl-3-methoxyphenoxyacetic acid is a monocarboxylic acid. | CC(C)(C)CC(C)(C)C1=CC=C(C=C1)O | 0 |
(S)-verapamil is a 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile that has S configuration. It is a conjugate base of a (S)-verapamil(1+). It is an enantiomer of a dexverapamil. | C[C@@H](C(=O)N[C@@H](CO)C(=O)O)NC(=O)[C@H](CCSC)N | 0 |
(2R,3R)-nemonapride is an optically active form of nemonapride having (2R,3R)-configuration. It is a conjugate base of a (2R,3R)-nemonapride(1+). It is an enantiomer of a (2S,3S)-nemonapride. | COC1=CC(=CC(=C1OC)OC)[C@H]2[C@@H]3[C@@H](CC4=CC5=C(C=C24)OCO5)COC3=O | 0 |
Razoxane | COP(=S)(OC)OC1=NC(=C(C=C1Cl)Cl)Cl | 0 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.